diff options
Diffstat (limited to 'macros/latex/contrib/hc')
-rw-r--r-- | macros/latex/contrib/hc/COPYING | 339 | ||||
-rw-r--r-- | macros/latex/contrib/hc/FILES | 21 | ||||
-rw-r--r-- | macros/latex/contrib/hc/README | 99 | ||||
-rw-r--r-- | macros/latex/contrib/hc/hc-de.bst | 1507 | ||||
-rw-r--r-- | macros/latex/contrib/hc/hc-en.bst | 1539 | ||||
-rw-r--r-- | macros/latex/contrib/hc/hc.dtx | 1624 | ||||
-rw-r--r-- | macros/latex/contrib/hc/hc.ins | 61 | ||||
-rw-r--r-- | macros/latex/contrib/hc/hc.ps | 2135 |
8 files changed, 7325 insertions, 0 deletions
diff --git a/macros/latex/contrib/hc/COPYING b/macros/latex/contrib/hc/COPYING new file mode 100644 index 0000000000..e77696ae8d --- /dev/null +++ b/macros/latex/contrib/hc/COPYING @@ -0,0 +1,339 @@ + GNU GENERAL PUBLIC LICENSE + Version 2, June 1991 + + Copyright (C) 1989, 1991 Free Software Foundation, Inc. + 675 Mass Ave, Cambridge, MA 02139, USA + Everyone is permitted to copy and distribute verbatim copies + of this license document, but changing it is not allowed. + + Preamble + + The licenses for most software are designed to take away your +freedom to share and change it. By contrast, the GNU General Public +License is intended to guarantee your freedom to share and change free +software--to make sure the software is free for all its users. This +General Public License applies to most of the Free Software +Foundation's software and to any other program whose authors commit to +using it. (Some other Free Software Foundation software is covered by +the GNU Library General Public License instead.) You can apply it to +your programs, too. + + When we speak of free software, we are referring to freedom, not +price. Our General Public Licenses are designed to make sure that you +have the freedom to distribute copies of free software (and charge for +this service if you wish), that you receive source code or can get it +if you want it, that you can change the software or use pieces of it +in new free programs; and that you know you can do these things. + + To protect your rights, we need to make restrictions that forbid +anyone to deny you these rights or to ask you to surrender the rights. +These restrictions translate to certain responsibilities for you if you +distribute copies of the software, or if you modify it. + + For example, if you distribute copies of such a program, whether +gratis or for a fee, you must give the recipients all the rights that +you have. You must make sure that they, too, receive or can get the +source code. And you must show them these terms so they know their +rights. + + We protect your rights with two steps: (1) copyright the software, and +(2) offer you this license which gives you legal permission to copy, +distribute and/or modify the software. + + Also, for each author's protection and ours, we want to make certain +that everyone understands that there is no warranty for this free +software. If the software is modified by someone else and passed on, we +want its recipients to know that what they have is not the original, so +that any problems introduced by others will not reflect on the original +authors' reputations. + + Finally, any free program is threatened constantly by software +patents. We wish to avoid the danger that redistributors of a free +program will individually obtain patent licenses, in effect making the +program proprietary. To prevent this, we have made it clear that any +patent must be licensed for everyone's free use or not licensed at all. + + The precise terms and conditions for copying, distribution and +modification follow. + + GNU GENERAL PUBLIC LICENSE + TERMS AND CONDITIONS FOR COPYING, DISTRIBUTION AND MODIFICATION + + 0. This License applies to any program or other work which contains +a notice placed by the copyright holder saying it may be distributed +under the terms of this General Public License. The "Program", below, +refers to any such program or work, and a "work based on the Program" +means either the Program or any derivative work under copyright law: +that is to say, a work containing the Program or a portion of it, +either verbatim or with modifications and/or translated into another +language. (Hereinafter, translation is included without limitation in +the term "modification".) Each licensee is addressed as "you". + +Activities other than copying, distribution and modification are not +covered by this License; they are outside its scope. The act of +running the Program is not restricted, and the output from the Program +is covered only if its contents constitute a work based on the +Program (independent of having been made by running the Program). +Whether that is true depends on what the Program does. + + 1. You may copy and distribute verbatim copies of the Program's +source code as you receive it, in any medium, provided that you +conspicuously and appropriately publish on each copy an appropriate +copyright notice and disclaimer of warranty; keep intact all the +notices that refer to this License and to the absence of any warranty; +and give any other recipients of the Program a copy of this License +along with the Program. + +You may charge a fee for the physical act of transferring a copy, and +you may at your option offer warranty protection in exchange for a fee. + + 2. You may modify your copy or copies of the Program or any portion +of it, thus forming a work based on the Program, and copy and +distribute such modifications or work under the terms of Section 1 +above, provided that you also meet all of these conditions: + + a) You must cause the modified files to carry prominent notices + stating that you changed the files and the date of any change. + + b) You must cause any work that you distribute or publish, that in + whole or in part contains or is derived from the Program or any + part thereof, to be licensed as a whole at no charge to all third + parties under the terms of this License. + + c) If the modified program normally reads commands interactively + when run, you must cause it, when started running for such + interactive use in the most ordinary way, to print or display an + announcement including an appropriate copyright notice and a + notice that there is no warranty (or else, saying that you provide + a warranty) and that users may redistribute the program under + these conditions, and telling the user how to view a copy of this + License. (Exception: if the Program itself is interactive but + does not normally print such an announcement, your work based on + the Program is not required to print an announcement.) + +These requirements apply to the modified work as a whole. If +identifiable sections of that work are not derived from the Program, +and can be reasonably considered independent and separate works in +themselves, then this License, and its terms, do not apply to those +sections when you distribute them as separate works. But when you +distribute the same sections as part of a whole which is a work based +on the Program, the distribution of the whole must be on the terms of +this License, whose permissions for other licensees extend to the +entire whole, and thus to each and every part regardless of who wrote it. + +Thus, it is not the intent of this section to claim rights or contest +your rights to work written entirely by you; rather, the intent is to +exercise the right to control the distribution of derivative or +collective works based on the Program. + +In addition, mere aggregation of another work not based on the Program +with the Program (or with a work based on the Program) on a volume of +a storage or distribution medium does not bring the other work under +the scope of this License. + + 3. You may copy and distribute the Program (or a work based on it, +under Section 2) in object code or executable form under the terms of +Sections 1 and 2 above provided that you also do one of the following: + + a) Accompany it with the complete corresponding machine-readable + source code, which must be distributed under the terms of Sections + 1 and 2 above on a medium customarily used for software interchange; or, + + b) Accompany it with a written offer, valid for at least three + years, to give any third party, for a charge no more than your + cost of physically performing source distribution, a complete + machine-readable copy of the corresponding source code, to be + distributed under the terms of Sections 1 and 2 above on a medium + customarily used for software interchange; or, + + c) Accompany it with the information you received as to the offer + to distribute corresponding source code. (This alternative is + allowed only for noncommercial distribution and only if you + received the program in object code or executable form with such + an offer, in accord with Subsection b above.) + +The source code for a work means the preferred form of the work for +making modifications to it. For an executable work, complete source +code means all the source code for all modules it contains, plus any +associated interface definition files, plus the scripts used to +control compilation and installation of the executable. However, as a +special exception, the source code distributed need not include +anything that is normally distributed (in either source or binary +form) with the major components (compiler, kernel, and so on) of the +operating system on which the executable runs, unless that component +itself accompanies the executable. + +If distribution of executable or object code is made by offering +access to copy from a designated place, then offering equivalent +access to copy the source code from the same place counts as +distribution of the source code, even though third parties are not +compelled to copy the source along with the object code. + + 4. You may not copy, modify, sublicense, or distribute the Program +except as expressly provided under this License. Any attempt +otherwise to copy, modify, sublicense or distribute the Program is +void, and will automatically terminate your rights under this License. +However, parties who have received copies, or rights, from you under +this License will not have their licenses terminated so long as such +parties remain in full compliance. + + 5. You are not required to accept this License, since you have not +signed it. However, nothing else grants you permission to modify or +distribute the Program or its derivative works. These actions are +prohibited by law if you do not accept this License. Therefore, by +modifying or distributing the Program (or any work based on the +Program), you indicate your acceptance of this License to do so, and +all its terms and conditions for copying, distributing or modifying +the Program or works based on it. + + 6. Each time you redistribute the Program (or any work based on the +Program), the recipient automatically receives a license from the +original licensor to copy, distribute or modify the Program subject to +these terms and conditions. You may not impose any further +restrictions on the recipients' exercise of the rights granted herein. +You are not responsible for enforcing compliance by third parties to +this License. + + 7. If, as a consequence of a court judgment or allegation of patent +infringement or for any other reason (not limited to patent issues), +conditions are imposed on you (whether by court order, agreement or +otherwise) that contradict the conditions of this License, they do not +excuse you from the conditions of this License. If you cannot +distribute so as to satisfy simultaneously your obligations under this +License and any other pertinent obligations, then as a consequence you +may not distribute the Program at all. For example, if a patent +license would not permit royalty-free redistribution of the Program by +all those who receive copies directly or indirectly through you, then +the only way you could satisfy both it and this License would be to +refrain entirely from distribution of the Program. + +If any portion of this section is held invalid or unenforceable under +any particular circumstance, the balance of the section is intended to +apply and the section as a whole is intended to apply in other +circumstances. + +It is not the purpose of this section to induce you to infringe any +patents or other property right claims or to contest validity of any +such claims; this section has the sole purpose of protecting the +integrity of the free software distribution system, which is +implemented by public license practices. Many people have made +generous contributions to the wide range of software distributed +through that system in reliance on consistent application of that +system; it is up to the author/donor to decide if he or she is willing +to distribute software through any other system and a licensee cannot +impose that choice. + +This section is intended to make thoroughly clear what is believed to +be a consequence of the rest of this License. + + 8. If the distribution and/or use of the Program is restricted in +certain countries either by patents or by copyrighted interfaces, the +original copyright holder who places the Program under this License +may add an explicit geographical distribution limitation excluding +those countries, so that distribution is permitted only in or among +countries not thus excluded. In such case, this License incorporates +the limitation as if written in the body of this License. + + 9. The Free Software Foundation may publish revised and/or new versions +of the General Public License from time to time. Such new versions will +be similar in spirit to the present version, but may differ in detail to +address new problems or concerns. + +Each version is given a distinguishing version number. If the Program +specifies a version number of this License which applies to it and "any +later version", you have the option of following the terms and conditions +either of that version or of any later version published by the Free +Software Foundation. If the Program does not specify a version number of +this License, you may choose any version ever published by the Free Software +Foundation. + + 10. If you wish to incorporate parts of the Program into other free +programs whose distribution conditions are different, write to the author +to ask for permission. For software which is copyrighted by the Free +Software Foundation, write to the Free Software Foundation; we sometimes +make exceptions for this. Our decision will be guided by the two goals +of preserving the free status of all derivatives of our free software and +of promoting the sharing and reuse of software generally. + + NO WARRANTY + + 11. BECAUSE THE PROGRAM IS LICENSED FREE OF CHARGE, THERE IS NO WARRANTY +FOR THE PROGRAM, TO THE EXTENT PERMITTED BY APPLICABLE LAW. EXCEPT WHEN +OTHERWISE STATED IN WRITING THE COPYRIGHT HOLDERS AND/OR OTHER PARTIES +PROVIDE THE PROGRAM "AS IS" WITHOUT WARRANTY OF ANY KIND, EITHER EXPRESSED +OR IMPLIED, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF +MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE. THE ENTIRE RISK AS +TO THE QUALITY AND PERFORMANCE OF THE PROGRAM IS WITH YOU. SHOULD THE +PROGRAM PROVE DEFECTIVE, YOU ASSUME THE COST OF ALL NECESSARY SERVICING, +REPAIR OR CORRECTION. + + 12. IN NO EVENT UNLESS REQUIRED BY APPLICABLE LAW OR AGREED TO IN WRITING +WILL ANY COPYRIGHT HOLDER, OR ANY OTHER PARTY WHO MAY MODIFY AND/OR +REDISTRIBUTE THE PROGRAM AS PERMITTED ABOVE, BE LIABLE TO YOU FOR DAMAGES, +INCLUDING ANY GENERAL, SPECIAL, INCIDENTAL OR CONSEQUENTIAL DAMAGES ARISING +OUT OF THE USE OR INABILITY TO USE THE PROGRAM (INCLUDING BUT NOT LIMITED +TO LOSS OF DATA OR DATA BEING RENDERED INACCURATE OR LOSSES SUSTAINED BY +YOU OR THIRD PARTIES OR A FAILURE OF THE PROGRAM TO OPERATE WITH ANY OTHER +PROGRAMS), EVEN IF SUCH HOLDER OR OTHER PARTY HAS BEEN ADVISED OF THE +POSSIBILITY OF SUCH DAMAGES. + + END OF TERMS AND CONDITIONS + + How to Apply These Terms to Your New Programs + + If you develop a new program, and you want it to be of the greatest +possible use to the public, the best way to achieve this is to make it +free software which everyone can redistribute and change under these terms. + + To do so, attach the following notices to the program. It is safest +to attach them to the start of each source file to most effectively +convey the exclusion of warranty; and each file should have at least +the "copyright" line and a pointer to where the full notice is found. + + <one line to give the program's name and a brief idea of what it does.> + Copyright (C) 19yy <name of author> + + This program is free software; you can redistribute it and/or modify + it under the terms of the GNU General Public License as published by + the Free Software Foundation; either version 2 of the License, or + (at your option) any later version. + + This program is distributed in the hope that it will be useful, + but WITHOUT ANY WARRANTY; without even the implied warranty of + MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + GNU General Public License for more details. + + You should have received a copy of the GNU General Public License + along with this program; if not, write to the Free Software + Foundation, Inc., 675 Mass Ave, Cambridge, MA 02139, USA. + +Also add information on how to contact you by electronic and paper mail. + +If the program is interactive, make it output a short notice like this +when it starts in an interactive mode: + + Gnomovision version 69, Copyright (C) 19yy name of author + Gnomovision comes with ABSOLUTELY NO WARRANTY; for details type `show w'. + This is free software, and you are welcome to redistribute it + under certain conditions; type `show c' for details. + +The hypothetical commands `show w' and `show c' should show the appropriate +parts of the General Public License. Of course, the commands you use may +be called something other than `show w' and `show c'; they could even be +mouse-clicks or menu items--whatever suits your program. + +You should also get your employer (if you work as a programmer) or your +school, if any, to sign a "copyright disclaimer" for the program, if +necessary. Here is a sample; alter the names: + + Yoyodyne, Inc., hereby disclaims all copyright interest in the program + `Gnomovision' (which makes passes at compilers) written by James Hacker. + + <signature of Ty Coon>, 1 April 1989 + Ty Coon, President of Vice + +This General Public License does not permit incorporating your program into +proprietary programs. If your program is a subroutine library, you may +consider it more useful to permit linking proprietary applications with the +library. If this is what you want to do, use the GNU Library General +Public License instead of this License. diff --git a/macros/latex/contrib/hc/FILES b/macros/latex/contrib/hc/FILES new file mode 100644 index 0000000000..c4dfc0f3d1 --- /dev/null +++ b/macros/latex/contrib/hc/FILES @@ -0,0 +1,21 @@ + HC Bundle for LaTeX2e: The Files + ================================ + +COPYING - The GNU General Public License +FILES - This file +README - Readme file + +hc-de.bst - German language bibliography style +hc-en.bst - English language bibliography style + created by the LaTeX custom-bib package - + custom-bib source code can be found at + http://tal.cs.tu-berlin.de/error/TeX/bibtex/src/ + +hc.ins - Installation driver for scrtime.dtx. +hc.dtx - Contains: + hcart.cls - Substitute for article.cls + hcreport.cls - Substitute for report.cls + hcletter.cls - Substitute for letter.cls + hcslides.cls - Substitute for slides.cls + german.hld - additional definitions for the German language +hc.ps - the documentation diff --git a/macros/latex/contrib/hc/README b/macros/latex/contrib/hc/README new file mode 100644 index 0000000000..72ea5638fd --- /dev/null +++ b/macros/latex/contrib/hc/README @@ -0,0 +1,99 @@ + Readme file for the HC Bundle for LaTeX2e + ========================================= + +Name of the contribution: HC Bundle for LaTeX2e + +Author's name: Christian Siefkes + +Author's email: error@cs.tu-berlin.de + +Suggested CTAN directory: macros/latex/contrib/supported/hc + +Summary description: +Replacement for the LaTeX default classes, +based upon the KoMaScript bundle and the Seminar class. + +Short text for announcement: +The HC Bundle for LaTeX2e provides the following four +classes as replacement for the LaTeX default classes: +- hcart.cls: substitute for the article class, + based upon the KoMaScript scrartcl class; +- hcreport.cls: substitute for the report class, + based upon the KoMaScript scrreprt class; +- hcletter.cls: substitute for the letter class, + based upon the KoMaScript scrlettr class; +- hcslides.cls: substitute for the slides class, + based upon the seminar class. + +Type of license: Free / GNU GPL + + +See FILES for a list of files. +Contact me, if files are missing (and tell me the way you got it): +e-mail: error@cs.tu-berlin.de + + +Installation: +------------- + +* ATTENTION: You need a complete LaTeX2e and some extra packages + (see below)! + + Copy all files to a directory, where TeX/LaTeX can find them. + Run hc.ins through LaTeX or TeX, e.g. at UNIX type: + latex hc.ins + or + tex hc.ins + You'll get a couple of new cls-files and the file german.hld. + Copy them to the coresponding LaTeX-directory. + + To get documentation (hc.dvi|ps) run hc.dtx through LaTeX, e.g. at UNIX + type: + latex hc.dtx + or: + tex "&latex" hc.dtx + or: + latexps hc.dtx + You need three runs, to get table of contents and references right + (latexps does this automatically). + + +Used LaTeX Packages: +-------------------- + +The following LaTeX classes and packages are used by the HC Bundle. +Those marked with * are required to get the documuntation (hc.dvi|ps). + +babel* +eurofont* +fancybox +fancyref* +fontenc* from the latex base +html* from the latex2html program +hyperref +ifthen* from the latex base +inputenc* from the latex base +mathpple* +multicol* from the tools bundle +natbib* +palatino* from the psnfss bundle +pifont from the psnfss bundle +scrartcl class* from the koma-script bundle +scrlettr class from the koma-script bundle +scrreprt class from the koma-script bundle +seminar class +truncate* +typearea* from the koma-script bundle +varioref* from the tools bundle +xspace* from the tools bundle + + +Bug-reports: +------------ + You may use latexbugs.tex, but don't send the report to the + LaTeX-team, send it to the adress in this file above. + + +Changes since first version: +---------------------------- + You'll find all changes at the dtx-file. diff --git a/macros/latex/contrib/hc/hc-de.bst b/macros/latex/contrib/hc/hc-de.bst new file mode 100644 index 0000000000..53d826e93d --- /dev/null +++ b/macros/latex/contrib/hc/hc-de.bst @@ -0,0 +1,1507 @@ +%% +%% This is file `hc-de.bst', +%% generated with the docstrip utility. +%% +%% The original source files were: +%% +%% merlin.mbs (with options: `head,exlang,ay,nat,vonx,nm-revv1,aunm-semi,dt-beg,yr-par,aymth,yrp-col,note-yr,atit-u,trtit-b,pre-pub,edby,edbyx,in-col,german,pp,ed,abr,ord,and-xcom,nfss,{}') +%% german.mbs (with options: `exlang,ay,nat,vonx,nm-revv1,aunm-semi,dt-beg,yr-par,aymth,yrp-col,note-yr,atit-u,trtit-b,pre-pub,edby,edbyx,in-col,german,pp,ed,abr,ord,and-xcom,nfss,{}') +%% merlin.mbs (with options: `tail,exlang,ay,nat,vonx,nm-revv1,aunm-semi,dt-beg,yr-par,aymth,yrp-col,note-yr,atit-u,trtit-b,pre-pub,edby,edbyx,in-col,german,pp,ed,abr,ord,and-xcom,nfss,{}') +%% ---------------------------------------- +%% *** Bibliographie-Standard von Christian Siefkes *** +%% + %------------------------------------------------------------------- + % The original source file contains the following version information: + % \ProvidesFile{merlin.mbs}[1998/02/25 3.85a (PWD)] + % + % NOTICE: + % This file may be used for non-profit purposes. + % It may not be distributed in exchange for money, + % other than distribution costs. + % + % The author provides it `as is' and does not guarantee it in any way. + % + % Copyright (C) 1994-98 Patrick W. Daly + %------------------------------------------------------------------- + % For use with BibTeX version 0.99a or later + %------------------------------------------------------------------- + % This bibliography style file is intended for texts in + % GERMAN + % This is an author-year citation style bibliography. As such, it is + % non-standard LaTeX, and requires a special package file to function properly. + % Such a package is natbib.sty by Patrick W. Daly + % The form of the \bibitem entries is + % \bibitem[Jones et al.(1990)]{key}... + % \bibitem[Jones et al.(1990)Jones, Baker, and Smith]{key}... + % The essential feature is that the label (the part in brackets) consists + % of the author names, as they should appear in the citation, with the year + % in parentheses following. There must be no space before the opening + % parenthesis! + % With natbib v5.3, a full list of authors may also follow the year. + % In natbib.sty, it is possible to define the type of enclosures that is + % really wanted (brackets or parentheses), but in either case, there must + % be parentheses in the label. + % The \cite command functions as follows: + % \citet{key} ==>> Jones et al. (1990) + % \citet*{key} ==>> Jones, Baker, and Smith (1990) + % \citep{key} ==>> (Jones et al., 1990) + % \citep*{key} ==>> (Jones, Baker, and Smith, 1990) + % \citep[chap. 2]{key} ==>> (Jones et al., 1990, chap. 2) + % \citep[e.g.][]{key} ==>> (e.g. Jones et al., 1990) + % \citep[e.g.][p. 32]{key} ==>> (e.g. Jones et al., p. 32) + % \citeauthor{key} ==>> Jones et al. + % \citeauthor*{key} ==>> Jones, Baker, and Smith + % \citeyear{key} ==>> 1990 + %--------------------------------------------------------------------- + +ENTRY + { address + author + booktitle + chapter + edition + editor + howpublished + institution + journal + key + month + note + number + organization + pages + publisher + school + series + title + type + volume + year + } + {} + { label extra.label sort.label short.list } + +INTEGERS { output.state before.all mid.sentence after.sentence after.block } + +FUNCTION {init.state.consts} +{ #0 'before.all := + #1 'mid.sentence := + #2 'after.sentence := + #3 'after.block := +} + +STRINGS { s t } + +FUNCTION {output.nonnull} +{ 's := + output.state mid.sentence = + { ", " * write$ } + { output.state after.block = + { add.period$ write$ + newline$ + "\newblock " write$ + } + { output.state before.all = + 'write$ + { add.period$ " " * write$ } + if$ + } + if$ + mid.sentence 'output.state := + } + if$ + s +} + +FUNCTION {output} +{ duplicate$ empty$ + 'pop$ + 'output.nonnull + if$ +} + +FUNCTION {output.check} +{ 't := + duplicate$ empty$ + { pop$ "empty " t * " in " * cite$ * warning$ } + 'output.nonnull + if$ +} + +FUNCTION {fin.entry} +{ add.period$ + write$ + newline$ +} + +FUNCTION {new.block} +{ output.state before.all = + 'skip$ + { after.block 'output.state := } + if$ +} + +FUNCTION {new.sentence} +{ output.state after.block = + 'skip$ + { output.state before.all = + 'skip$ + { after.sentence 'output.state := } + if$ + } + if$ +} + +FUNCTION {add.blank} +{ " " * before.all 'output.state := +} + +FUNCTION {date.block} +{ + ":" * + add.blank +} + +FUNCTION {not} +{ { #0 } + { #1 } + if$ +} + +FUNCTION {and} +{ 'skip$ + { pop$ #0 } + if$ +} + +FUNCTION {or} +{ { pop$ #1 } + 'skip$ + if$ +} + +FUNCTION {new.block.checkb} +{ empty$ + swap$ empty$ + and + 'skip$ + 'new.block + if$ +} + +FUNCTION {field.or.null} +{ duplicate$ empty$ + { pop$ "" } + 'skip$ + if$ +} + +FUNCTION {emphasize} +{ duplicate$ empty$ + { pop$ "" } + { "\emph{" swap$ * "}" * } + if$ +} + +FUNCTION {capitalize} +{ "u" change.case$ "t" change.case$ } + +FUNCTION {space.word} +{ " " swap$ * " " * } + + % Here are the language-specific definitions for explicit words. + % Each function has a name bbl.xxx where xxx is the English word. + %------------------------------------------------------------------- + % The original source file contains the following version information: + % \ProvidesFile{german.mbs}[1995/11/02 1.5 (PWD)] + % Copyright (C) 1994, 1995 Patrick W. Daly + %------------------------------------------------------------------- + + % The language selected here is GERMAN +FUNCTION {bbl.and} +{ "und"} + +FUNCTION {bbl.editors} +{ "Hg." } + +FUNCTION {bbl.editor} +{ "Hg." } + +FUNCTION {bbl.edby} +{ "herausgegeben von" } + +FUNCTION {bbl.edition} +{ "Aufl." } + +FUNCTION {bbl.volume} +{ "Bd." } + +FUNCTION {bbl.of} +{ "von" } + +FUNCTION {bbl.number} +{ "Nr." } + +FUNCTION {bbl.nr} +{ "Nr." } + +FUNCTION {bbl.in} +{ "in" } + +FUNCTION {bbl.pages} +{ "S." } + +FUNCTION {bbl.page} +{ "S." } + +FUNCTION {bbl.chapter} +{ "Kap." } + +FUNCTION {bbl.techrep} +{ "{Techn.\ Ber.}" } + +FUNCTION {bbl.mthesis} +{ "Diplomarbeit" } + +FUNCTION {bbl.phdthesis} +{ "Dissertation" } + +FUNCTION {bbl.first} +{ "1." } + +FUNCTION {bbl.second} +{ "2." } + +FUNCTION {bbl.third} +{ "3." } + +FUNCTION {bbl.fourth} +{ "4." } + +FUNCTION {bbl.fifth} +{ "5." } + +FUNCTION {bbl.th} +{ "." } + +MACRO {jan} {"Jan."} + +MACRO {feb} {"Febr."} + +MACRO {mar} {"M\^^b{a}rz"} + +MACRO {apr} {"Apr."} + +MACRO {may} {"Mai"} + +MACRO {jun} {"Juni"} + +MACRO {jul} {"Juli"} + +MACRO {aug} {"Aug."} + +MACRO {sep} {"Sept."} + +MACRO {oct} {"Okt."} + +MACRO {nov} {"Nov."} + +MACRO {dec} {"Dez."} + + % End of language definition file + +MACRO {acmcs} {"ACM Computing Surveys"} + +MACRO {acta} {"Acta Informatica"} + +MACRO {cacm} {"Communications of the ACM"} + +MACRO {ibmjrd} {"IBM Journal of Research and Development"} + +MACRO {ibmsj} {"IBM Systems Journal"} + +MACRO {ieeese} {"IEEE Transactions on Software Engineering"} + +MACRO {ieeetc} {"IEEE Transactions on Computers"} + +MACRO {ieeetcad} + {"IEEE Transactions on Computer-Aided Design of Integrated Circuits"} + +MACRO {ipl} {"Information Processing Letters"} + +MACRO {jacm} {"Journal of the ACM"} + +MACRO {jcss} {"Journal of Computer and System Sciences"} + +MACRO {scp} {"Science of Computer Programming"} + +MACRO {sicomp} {"SIAM Journal on Computing"} + +MACRO {tocs} {"ACM Transactions on Computer Systems"} + +MACRO {tods} {"ACM Transactions on Database Systems"} + +MACRO {tog} {"ACM Transactions on Graphics"} + +MACRO {toms} {"ACM Transactions on Mathematical Software"} + +MACRO {toois} {"ACM Transactions on Office Information Systems"} + +MACRO {toplas} {"ACM Transactions on Programming Languages and Systems"} + +MACRO {tcs} {"Theoretical Computer Science"} + +INTEGERS { nameptr namesleft numnames } + +FUNCTION {format.names} +{ 's := + #1 'nameptr := + s num.names$ 'numnames := + numnames 'namesleft := + { namesleft #0 > } + { nameptr #1 > + { s nameptr "{ff~}{vv~}{ll}{, jj}" format.name$ } + { s nameptr "{vv~}{ll}{, ff}{, jj}" format.name$ } + if$ + 't := + nameptr #1 > + { + namesleft #1 > + { "; " * t * } + { + s nameptr "{ll}" format.name$ duplicate$ "others" = + { 't := } + { pop$ } + if$ + t "others" = + { + " et~al." * + } + { bbl.and space.word * t * } + if$ + } + if$ + } + 't + if$ + nameptr #1 + 'nameptr := + namesleft #1 - 'namesleft := + } + while$ +} +FUNCTION {format.names.ed} +{ 's := + #1 'nameptr := + s num.names$ 'numnames := + numnames 'namesleft := + { namesleft #0 > } + { s nameptr + "{ff~}{vv~}{ll}{, jj}" + format.name$ + 't := + nameptr #1 > + { + namesleft #1 > + { "; " * t * } + { + s nameptr "{ll}" format.name$ duplicate$ "others" = + { 't := } + { pop$ } + if$ + t "others" = + { + " et~al." * + } + { bbl.and space.word * t * } + if$ + } + if$ + } + 't + if$ + nameptr #1 + 'nameptr := + namesleft #1 - 'namesleft := + } + while$ +} + +FUNCTION {format.key} +{ empty$ + { key field.or.null } + { "" } + if$ +} + +FUNCTION {format.authors} +{ author empty$ + { "" } + { author format.names } + if$ +} + +FUNCTION {format.editors} +{ editor empty$ + { "" } + { editor format.names + editor num.names$ #1 > + { ", " * bbl.editors * } + { ", " * bbl.editor * } + if$ + } + if$ +} + +FUNCTION {format.in.editors} +{ editor empty$ + { "" } + { editor format.names.ed + } + if$ +} + +FUNCTION {format.note} +{ note empty$ + { "" } + { note #1 #1 substring$ + duplicate$ "{" = + 'skip$ + { output.state mid.sentence = + { "l" } + { "u" } + if$ + change.case$ + } + if$ + note #2 global.max$ substring$ * + } + if$ +} + +FUNCTION {format.title} +{ title empty$ + { "" } + { title + } + if$ +} + +FUNCTION {format.full.names} +{'s := + #1 'nameptr := + s num.names$ 'numnames := + numnames 'namesleft := + { namesleft #0 > } + { s nameptr + "{vv~}{ll}" format.name$ + 't := + nameptr #1 > + { + namesleft #1 > + { ", " * t * } + { + s nameptr "{ll}" format.name$ duplicate$ "others" = + { 't := } + { pop$ } + if$ + t "others" = + { + " et~al." * + } + { bbl.and space.word * t * } + if$ + } + if$ + } + 't + if$ + nameptr #1 + 'nameptr := + namesleft #1 - 'namesleft := + } + while$ +} + +FUNCTION {author.editor.key.full} +{ author empty$ + { editor empty$ + { key empty$ + { cite$ #1 #3 substring$ } + 'key + if$ + } + { editor format.full.names } + if$ + } + { author format.full.names } + if$ +} + +FUNCTION {author.key.full} +{ author empty$ + { key empty$ + { cite$ #1 #3 substring$ } + 'key + if$ + } + { author format.full.names } + if$ +} + +FUNCTION {editor.key.full} +{ editor empty$ + { key empty$ + { cite$ #1 #3 substring$ } + 'key + if$ + } + { editor format.full.names } + if$ +} + +FUNCTION {make.full.names} +{ type$ "book" = + type$ "inbook" = + or + 'author.editor.key.full + { type$ "proceedings" = + 'editor.key.full + 'author.key.full + if$ + } + if$ +} + +FUNCTION {output.bibitem} +{ newline$ + "\bibitem[{" write$ + label write$ + ")" make.full.names duplicate$ short.list = + { pop$ } + { * } + if$ + "}]{" * write$ + cite$ write$ + "}" write$ + newline$ + "" + before.all 'output.state := +} + +FUNCTION {n.dashify} +{ + 't := + "" + { t empty$ not } + { t #1 #1 substring$ "-" = + { t #1 #2 substring$ "--" = not + { "--" * + t #2 global.max$ substring$ 't := + } + { { t #1 #1 substring$ "-" = } + { "-" * + t #2 global.max$ substring$ 't := + } + while$ + } + if$ + } + { t #1 #1 substring$ * + t #2 global.max$ substring$ 't := + } + if$ + } + while$ +} + +FUNCTION {word.in} +{ bbl.in capitalize + ":" * + " " * } + +FUNCTION {format.date} +{ year duplicate$ empty$ + { "empty year in " cite$ * "; set to ????" * warning$ + pop$ "????" } + 'skip$ + if$ + month empty$ + 'skip$ + { month + " " * swap$ * + } + if$ + extra.label * + before.all 'output.state := + " (" swap$ * ")" * +} + +FUNCTION {format.btitle} +{ title emphasize +} + +FUNCTION {tie.or.space.connect} +{ duplicate$ text.length$ #3 < + { "~" } + { " " } + if$ + swap$ * * +} + +FUNCTION {either.or.check} +{ empty$ + 'pop$ + { "can't use both " swap$ * " fields in " * cite$ * warning$ } + if$ +} + +FUNCTION {format.bvolume} +{ volume empty$ + { "" } + { bbl.volume volume tie.or.space.connect + series empty$ + 'skip$ + { bbl.of space.word * series emphasize * } + if$ + "volume and number" number either.or.check + } + if$ +} + +FUNCTION {format.number.series} +{ volume empty$ + { number empty$ + { series field.or.null } + { output.state mid.sentence = + { bbl.number } + { bbl.number capitalize } + if$ + number tie.or.space.connect + series empty$ + { "there's a number but no series in " cite$ * warning$ } + { bbl.in space.word * series * } + if$ + } + if$ + } + { "" } + if$ +} + +FUNCTION {is.num} +{ chr.to.int$ + duplicate$ "0" chr.to.int$ < not + swap$ "9" chr.to.int$ > not and +} + +FUNCTION {extract.num} +{ duplicate$ 't := + "" 's := + { t empty$ not } + { t #1 #1 substring$ + t #2 global.max$ substring$ 't := + duplicate$ is.num + { s swap$ * 's := } + { pop$ "" 't := } + if$ + } + while$ + s empty$ + 'skip$ + { pop$ s } + if$ +} + +FUNCTION {convert.edition} +{ edition extract.num "l" change.case$ 's := + s "first" = s "1" = or + { bbl.first 't := } + { s "second" = s "2" = or + { bbl.second 't := } + { s "third" = s "3" = or + { bbl.third 't := } + { s "fourth" = s "4" = or + { bbl.fourth 't := } + { s "fifth" = s "5" = or + { bbl.fifth 't := } + { s #1 #1 substring$ is.num + { s bbl.th * 't := } + { edition 't := } + if$ + } + if$ + } + if$ + } + if$ + } + if$ + } + if$ + t +} + +FUNCTION {format.edition} +{ edition empty$ + { "" } + { output.state mid.sentence = + { convert.edition "l" change.case$ " " * bbl.edition * } + { convert.edition "t" change.case$ " " * bbl.edition * } + if$ + } + if$ +} + +INTEGERS { multiresult } + +FUNCTION {multi.page.check} +{ 't := + #0 'multiresult := + { multiresult not + t empty$ not + and + } + { t #1 #1 substring$ + duplicate$ "-" = + swap$ duplicate$ "," = + swap$ "+" = + or or + { #1 'multiresult := } + { t #2 global.max$ substring$ 't := } + if$ + } + while$ + multiresult +} + +FUNCTION {format.pages} +{ pages empty$ + { "" } + { pages multi.page.check + { bbl.pages pages n.dashify tie.or.space.connect } + { bbl.page pages tie.or.space.connect } + if$ + } + if$ +} + +FUNCTION {format.journal.pages} +{ pages empty$ + 'skip$ + { duplicate$ empty$ + { pop$ format.pages } + { + ":" * + pages n.dashify * + } + if$ + } + if$ +} + +FUNCTION {format.vol.num.pages} +{ volume field.or.null + number empty$ + 'skip$ + { + "(" number * ")" * * + volume empty$ + { "there's a number but no volume in " cite$ * warning$ } + 'skip$ + if$ + } + if$ + format.journal.pages +} + +FUNCTION {format.chapter.pages} +{ chapter empty$ + 'format.pages + { type empty$ + { bbl.chapter } + { type "l" change.case$ } + if$ + chapter tie.or.space.connect + pages empty$ + 'skip$ + { ", " * format.pages * } + if$ + } + if$ +} + +FUNCTION {format.in.ed.booktitle} +{ booktitle empty$ + { "" } + { editor empty$ + { word.in booktitle emphasize * } + { word.in booktitle emphasize * + ", " * + editor num.names$ #1 > + { bbl.editors } + { bbl.editor } + if$ + * " " * + format.in.editors * + } + if$ + } + if$ +} + +FUNCTION {format.thesis.type} +{ type empty$ + 'skip$ + { pop$ + type "t" change.case$ + } + if$ +} + +FUNCTION {format.tr.number} +{ type empty$ + { bbl.techrep } + 'type + if$ + number empty$ + { "t" change.case$ } + { number tie.or.space.connect } + if$ +} + +FUNCTION {format.article.crossref} +{ + word.in + " \cite{" * crossref * "}" * +} + +FUNCTION {format.book.crossref} +{ volume empty$ + { "empty volume in " cite$ * "'s crossref of " * crossref * warning$ + word.in + } + { bbl.volume capitalize + volume tie.or.space.connect + bbl.of space.word * + } + if$ + " \cite{" * crossref * "}" * +} + +FUNCTION {format.incoll.inproc.crossref} +{ + word.in + " \cite{" * crossref * "}" * +} + +FUNCTION {format.publisher} +{ publisher empty$ + { "empty publisher in " cite$ * warning$ } + 'skip$ + if$ + "" + address empty$ publisher empty$ and + 'skip$ + { + publisher empty$ + { address empty$ + 'skip$ + { address * } + if$ + } + { publisher * + address empty$ + 'skip$ + { ", " * address * } + if$ + } + if$ + } + if$ + output +} + +FUNCTION {article} +{ output.bibitem + format.authors "author" output.check + author format.key output + format.date "year" output.check + date.block + format.title "title" output.check + new.block + crossref missing$ + { journal + emphasize + "journal" output.check + format.vol.num.pages output + } + { format.article.crossref output.nonnull + format.pages output + } + if$ + new.block + format.note output + fin.entry +} + +FUNCTION {book} +{ output.bibitem + author empty$ + { format.editors "author and editor" output.check + editor format.key output + } + { format.authors output.nonnull + crossref missing$ + { "author and editor" editor either.or.check } + 'skip$ + if$ + } + if$ + format.date "year" output.check + date.block + format.btitle "title" output.check + crossref missing$ + { format.bvolume output + new.block + format.number.series output + new.sentence + format.publisher + } + { + new.block + format.book.crossref output.nonnull + } + if$ + format.edition output + new.block + format.note output + fin.entry +} + +FUNCTION {booklet} +{ output.bibitem + format.authors output + author format.key output + format.date "year" output.check + date.block + format.title "title" output.check + new.block + howpublished output + address output + new.block + format.note output + fin.entry +} + +FUNCTION {inbook} +{ output.bibitem + author empty$ + { format.editors "author and editor" output.check + editor format.key output + } + { format.authors output.nonnull + crossref missing$ + { "author and editor" editor either.or.check } + 'skip$ + if$ + } + if$ + format.date "year" output.check + date.block + format.btitle "title" output.check + crossref missing$ + { + format.publisher + format.bvolume output + format.chapter.pages "chapter and pages" output.check + new.block + format.number.series output + new.sentence + } + { + format.chapter.pages "chapter and pages" output.check + new.block + format.book.crossref output.nonnull + } + if$ + format.edition output + new.block + format.note output + fin.entry +} + +FUNCTION {incollection} +{ output.bibitem + format.authors "author" output.check + author format.key output + format.date "year" output.check + date.block + format.title "title" output.check + new.block + crossref missing$ + { format.in.ed.booktitle "booktitle" output.check + format.publisher + format.bvolume output + format.number.series output + format.chapter.pages output + new.sentence + format.edition output + } + { format.incoll.inproc.crossref output.nonnull + format.chapter.pages output + } + if$ + new.block + format.note output + fin.entry +} + +FUNCTION {inproceedings} +{ output.bibitem + format.authors "author" output.check + author format.key output + format.date "year" output.check + date.block + format.title "title" output.check + new.block + crossref missing$ + { format.in.ed.booktitle "booktitle" output.check + new.sentence + publisher empty$ + { organization output + address output + } + { organization output + format.publisher + } + if$ + format.bvolume output + format.number.series output + format.pages output + } + { format.incoll.inproc.crossref output.nonnull + format.pages output + } + if$ + new.block + format.note output + fin.entry +} + +FUNCTION {conference} { inproceedings } + +FUNCTION {manual} +{ output.bibitem + format.authors output + author format.key output + format.date "year" output.check + date.block + format.btitle "title" output.check + organization address new.block.checkb + organization output + address output + format.edition output + new.block + format.note output + fin.entry +} + +FUNCTION {mastersthesis} +{ output.bibitem + format.authors "author" output.check + author format.key output + format.date "year" output.check + date.block + format.btitle "title" output.check + new.block + bbl.mthesis format.thesis.type output.nonnull + school "school" output.check + address output + new.block + format.note output + fin.entry +} + +FUNCTION {misc} +{ output.bibitem + format.authors output + author format.key output + format.date "year" output.check + date.block + format.title output + new.block + howpublished output + new.block + format.note output + fin.entry +} + +FUNCTION {phdthesis} +{ output.bibitem + format.authors "author" output.check + author format.key output + format.date "year" output.check + date.block + format.btitle "title" output.check + new.block + bbl.phdthesis format.thesis.type output.nonnull + school "school" output.check + address output + new.block + format.note output + fin.entry +} + +FUNCTION {proceedings} +{ output.bibitem + format.editors output + editor format.key output + format.date "year" output.check + date.block + format.btitle "title" output.check + format.bvolume output + format.number.series output + address output + new.sentence + organization output + publisher output + new.block + format.note output + fin.entry +} + +FUNCTION {techreport} +{ output.bibitem + format.authors "author" output.check + author format.key output + format.date "year" output.check + date.block + format.btitle "title" output.check + new.block + format.tr.number output.nonnull + institution "institution" output.check + address output + new.block + format.note output + fin.entry +} + +FUNCTION {unpublished} +{ output.bibitem + format.authors "author" output.check + author format.key output + format.date "year" output.check + date.block + format.title "title" output.check + new.block + format.note "note" output.check + fin.entry +} + +FUNCTION {default.type} { misc } + +READ + +FUNCTION {sortify} +{ purify$ + "l" change.case$ +} + +INTEGERS { len } + +FUNCTION {chop.word} +{ 's := + 'len := + s #1 len substring$ = + { s len #1 + global.max$ substring$ } + 's + if$ +} + +FUNCTION {format.lab.names} +{ 's := + s #1 "{vv~}{ll}" format.name$ + s num.names$ duplicate$ + #2 > + { pop$ + " et~al." * + } + { #2 < + 'skip$ + { s #2 "{ff }{vv }{ll}{ jj}" format.name$ "others" = + { + " et~al." * + } + { bbl.and space.word * s #2 "{vv~}{ll}" format.name$ + * } + if$ + } + if$ + } + if$ +} + +FUNCTION {author.key.label} +{ author empty$ + { key empty$ + { cite$ #1 #3 substring$ } + 'key + if$ + } + { author format.lab.names } + if$ +} + +FUNCTION {author.editor.key.label} +{ author empty$ + { editor empty$ + { key empty$ + { cite$ #1 #3 substring$ } + 'key + if$ + } + { editor format.lab.names } + if$ + } + { author format.lab.names } + if$ +} + +FUNCTION {editor.key.label} +{ editor empty$ + { key empty$ + { cite$ #1 #3 substring$ } + 'key + if$ + } + { editor format.lab.names } + if$ +} + +FUNCTION {calc.short.authors} +{ type$ "book" = + type$ "inbook" = + or + 'author.editor.key.label + { type$ "proceedings" = + 'editor.key.label + 'author.key.label + if$ + } + if$ + 'short.list := +} + +FUNCTION {calc.label} +{ calc.short.authors + short.list + "(" + * + year duplicate$ empty$ + { pop$ "????" } + 'skip$ + if$ + * + 'label := +} + +FUNCTION {sort.format.names} +{ 's := + #1 'nameptr := + "" + s num.names$ 'numnames := + numnames 'namesleft := + { namesleft #0 > } + { s nameptr + "{ll{ }}{ ff{ }}{ jj{ }}" + format.name$ 't := + nameptr #1 > + { + " " * + namesleft #1 = t "others" = and + { "zzzzz" * } + { t sortify * } + if$ + } + { t sortify * } + if$ + nameptr #1 + 'nameptr := + namesleft #1 - 'namesleft := + } + while$ +} + +FUNCTION {sort.format.title} +{ 't := + "A " #2 + "An " #3 + "The " #4 t chop.word + chop.word + chop.word + sortify + #1 global.max$ substring$ +} + +FUNCTION {author.sort} +{ author empty$ + { key empty$ + { "to sort, need author or key in " cite$ * warning$ + "" + } + { key sortify } + if$ + } + { author sort.format.names } + if$ +} + +FUNCTION {author.editor.sort} +{ author empty$ + { editor empty$ + { key empty$ + { "to sort, need author, editor, or key in " cite$ * warning$ + "" + } + { key sortify } + if$ + } + { editor sort.format.names } + if$ + } + { author sort.format.names } + if$ +} + +FUNCTION {editor.sort} +{ editor empty$ + { key empty$ + { "to sort, need editor or key in " cite$ * warning$ + "" + } + { key sortify } + if$ + } + { editor sort.format.names } + if$ +} + +FUNCTION {presort} +{ calc.label + label sortify + " " + * + type$ "book" = + type$ "inbook" = + or + 'author.editor.sort + { type$ "proceedings" = + 'editor.sort + 'author.sort + if$ + } + if$ + #1 entry.max$ substring$ + 'sort.label := + sort.label + * + " " + * + title field.or.null + sort.format.title + * + #1 entry.max$ substring$ + 'sort.key$ := +} + +ITERATE {presort} + +SORT + +STRINGS { last.label next.extra } + +INTEGERS { last.extra.num number.label } + +FUNCTION {initialize.extra.label.stuff} +{ #0 int.to.chr$ 'last.label := + "" 'next.extra := + #0 'last.extra.num := + #0 'number.label := +} + +FUNCTION {forward.pass} +{ last.label label = + { last.extra.num #1 + 'last.extra.num := + last.extra.num int.to.chr$ 'extra.label := + } + { "a" chr.to.int$ 'last.extra.num := + "" 'extra.label := + label 'last.label := + } + if$ + number.label #1 + 'number.label := +} + +FUNCTION {reverse.pass} +{ next.extra "b" = + { "a" 'extra.label := } + 'skip$ + if$ + extra.label 'next.extra := + extra.label + duplicate$ empty$ + 'skip$ + { "{\natexlab{" swap$ * "}}" * } + if$ + 'extra.label := + label extra.label * 'label := +} + +EXECUTE {initialize.extra.label.stuff} + +ITERATE {forward.pass} + +REVERSE {reverse.pass} + +FUNCTION {bib.sort.order} +{ sort.label + " " + * + year field.or.null sortify + * + " " + * + title field.or.null + sort.format.title + * + #1 entry.max$ substring$ + 'sort.key$ := +} + +ITERATE {bib.sort.order} + +SORT + +FUNCTION {begin.bib} +{ preamble$ empty$ + 'skip$ + { preamble$ write$ newline$ } + if$ + "\begin{thebibliography}{" number.label int.to.str$ * "}" * + write$ newline$ + "\expandafter\ifx\csname natexlab\endcsname\relax\def\natexlab#1{#1}\fi" + write$ newline$ +} + +EXECUTE {begin.bib} + +EXECUTE {init.state.consts} + +ITERATE {call.type$} + +FUNCTION {end.bib} +{ newline$ + "\end{thebibliography}" write$ newline$ +} + +EXECUTE {end.bib} +%% End of customized bst file +%% +%% End of file `hc-de.bst'. diff --git a/macros/latex/contrib/hc/hc-en.bst b/macros/latex/contrib/hc/hc-en.bst new file mode 100644 index 0000000000..434b69a019 --- /dev/null +++ b/macros/latex/contrib/hc/hc-en.bst @@ -0,0 +1,1539 @@ +%% +%% This is file `hc-en.bst', +%% generated with the docstrip utility. +%% +%% The original source files were: +%% +%% merlin.mbs (with options: `,ay,nat,nm-revv1,aunm-semi,dt-beg,yr-par,aymth,yrp-col,note-yr,atit-u,trtit-b,pre-pub,edby,edbyx,in-col,pp,ed,abr,mth-bare,ord,nfss') +%% ---------------------------------------- +%% *** Christian Siefkes standard bibliography *** +%% + %------------------------------------------------------------------- + % The original source file contains the following version information: + % \ProvidesFile{merlin.mbs}[1998/02/25 3.85a (PWD)] + % + % NOTICE: + % This file may be used for non-profit purposes. + % It may not be distributed in exchange for money, + % other than distribution costs. + % + % The author provides it `as is' and does not guarantee it in any way. + % + % Copyright (C) 1994-98 Patrick W. Daly + %------------------------------------------------------------------- + % For use with BibTeX version 0.99a or later + %------------------------------------------------------------------- + % This bibliography style file is intended for texts in ENGLISH + % This is an author-year citation style bibliography. As such, it is + % non-standard LaTeX, and requires a special package file to function properly. + % Such a package is natbib.sty by Patrick W. Daly + % The form of the \bibitem entries is + % \bibitem[Jones et al.(1990)]{key}... + % \bibitem[Jones et al.(1990)Jones, Baker, and Smith]{key}... + % The essential feature is that the label (the part in brackets) consists + % of the author names, as they should appear in the citation, with the year + % in parentheses following. There must be no space before the opening + % parenthesis! + % With natbib v5.3, a full list of authors may also follow the year. + % In natbib.sty, it is possible to define the type of enclosures that is + % really wanted (brackets or parentheses), but in either case, there must + % be parentheses in the label. + % The \cite command functions as follows: + % \citet{key} ==>> Jones et al. (1990) + % \citet*{key} ==>> Jones, Baker, and Smith (1990) + % \citep{key} ==>> (Jones et al., 1990) + % \citep*{key} ==>> (Jones, Baker, and Smith, 1990) + % \citep[chap. 2]{key} ==>> (Jones et al., 1990, chap. 2) + % \citep[e.g.][]{key} ==>> (e.g. Jones et al., 1990) + % \citep[e.g.][p. 32]{key} ==>> (e.g. Jones et al., p. 32) + % \citeauthor{key} ==>> Jones et al. + % \citeauthor*{key} ==>> Jones, Baker, and Smith + % \citeyear{key} ==>> 1990 + %--------------------------------------------------------------------- + +ENTRY + { address + author + booktitle + chapter + edition + editor + howpublished + institution + journal + key + month + note + number + organization + pages + publisher + school + series + title + type + volume + year + } + {} + { label extra.label sort.label short.list } + +INTEGERS { output.state before.all mid.sentence after.sentence after.block } + +FUNCTION {init.state.consts} +{ #0 'before.all := + #1 'mid.sentence := + #2 'after.sentence := + #3 'after.block := +} + +STRINGS { s t } + +FUNCTION {output.nonnull} +{ 's := + output.state mid.sentence = + { ", " * write$ } + { output.state after.block = + { add.period$ write$ + newline$ + "\newblock " write$ + } + { output.state before.all = + 'write$ + { add.period$ " " * write$ } + if$ + } + if$ + mid.sentence 'output.state := + } + if$ + s +} + +FUNCTION {output} +{ duplicate$ empty$ + 'pop$ + 'output.nonnull + if$ +} + +FUNCTION {output.check} +{ 't := + duplicate$ empty$ + { pop$ "empty " t * " in " * cite$ * warning$ } + 'output.nonnull + if$ +} + +FUNCTION {fin.entry} +{ add.period$ + write$ + newline$ +} + +FUNCTION {new.block} +{ output.state before.all = + 'skip$ + { after.block 'output.state := } + if$ +} + +FUNCTION {new.sentence} +{ output.state after.block = + 'skip$ + { output.state before.all = + 'skip$ + { after.sentence 'output.state := } + if$ + } + if$ +} + +FUNCTION {add.blank} +{ " " * before.all 'output.state := +} + +FUNCTION {date.block} +{ + ":" * + add.blank +} + +FUNCTION {not} +{ { #0 } + { #1 } + if$ +} + +FUNCTION {and} +{ 'skip$ + { pop$ #0 } + if$ +} + +FUNCTION {or} +{ { pop$ #1 } + 'skip$ + if$ +} + +FUNCTION {new.block.checkb} +{ empty$ + swap$ empty$ + and + 'skip$ + 'new.block + if$ +} + +FUNCTION {field.or.null} +{ duplicate$ empty$ + { pop$ "" } + 'skip$ + if$ +} + +FUNCTION {emphasize} +{ duplicate$ empty$ + { pop$ "" } + { "\emph{" swap$ * "}" * } + if$ +} + +FUNCTION {capitalize} +{ "u" change.case$ "t" change.case$ } + +FUNCTION {space.word} +{ " " swap$ * " " * } + + % Here are the language-specific definitions for explicit words. + % Each function has a name bbl.xxx where xxx is the English word. + % The language selected here is ENGLISH +FUNCTION {bbl.and} +{ "and"} + +FUNCTION {bbl.editors} +{ "eds." } + +FUNCTION {bbl.editor} +{ "ed." } + +FUNCTION {bbl.edby} +{ "edited by" } + +FUNCTION {bbl.edition} +{ "edn." } + +FUNCTION {bbl.volume} +{ "vol." } + +FUNCTION {bbl.of} +{ "of" } + +FUNCTION {bbl.number} +{ "no." } + +FUNCTION {bbl.nr} +{ "no." } + +FUNCTION {bbl.in} +{ "in" } + +FUNCTION {bbl.pages} +{ "pp." } + +FUNCTION {bbl.page} +{ "p." } + +FUNCTION {bbl.chapter} +{ "chap." } + +FUNCTION {bbl.techrep} +{ "Tech. Rep." } + +FUNCTION {bbl.mthesis} +{ "Master's thesis" } + +FUNCTION {bbl.phdthesis} +{ "Ph.D. thesis" } + +FUNCTION {bbl.first} +{ "1st" } + +FUNCTION {bbl.second} +{ "2nd" } + +FUNCTION {bbl.third} +{ "3rd" } + +FUNCTION {bbl.fourth} +{ "4th" } + +FUNCTION {bbl.fifth} +{ "5th" } + +FUNCTION {bbl.st} +{ "st" } + +FUNCTION {bbl.nd} +{ "nd" } + +FUNCTION {bbl.rd} +{ "rd" } + +FUNCTION {bbl.th} +{ "th" } + +MACRO {jan} {"Jan."} + +MACRO {feb} {"Feb."} + +MACRO {mar} {"Mar."} + +MACRO {apr} {"Apr."} + +MACRO {may} {"May"} + +MACRO {jun} {"Jun."} + +MACRO {jul} {"Jul."} + +MACRO {aug} {"Aug."} + +MACRO {sep} {"Sep."} + +MACRO {oct} {"Oct."} + +MACRO {nov} {"Nov."} + +MACRO {dec} {"Dec."} + +FUNCTION {eng.ord} +{ duplicate$ "1" swap$ * + #-2 #1 substring$ "1" = + { bbl.th * } + { duplicate$ #-1 #1 substring$ + duplicate$ "1" = + { pop$ bbl.st * } + { duplicate$ "2" = + { pop$ bbl.nd * } + { "3" = + { bbl.rd * } + { bbl.th * } + if$ + } + if$ + } + if$ + } + if$ +} + +MACRO {acmcs} {"ACM Computing Surveys"} + +MACRO {acta} {"Acta Informatica"} + +MACRO {cacm} {"Communications of the ACM"} + +MACRO {ibmjrd} {"IBM Journal of Research and Development"} + +MACRO {ibmsj} {"IBM Systems Journal"} + +MACRO {ieeese} {"IEEE Transactions on Software Engineering"} + +MACRO {ieeetc} {"IEEE Transactions on Computers"} + +MACRO {ieeetcad} + {"IEEE Transactions on Computer-Aided Design of Integrated Circuits"} + +MACRO {ipl} {"Information Processing Letters"} + +MACRO {jacm} {"Journal of the ACM"} + +MACRO {jcss} {"Journal of Computer and System Sciences"} + +MACRO {scp} {"Science of Computer Programming"} + +MACRO {sicomp} {"SIAM Journal on Computing"} + +MACRO {tocs} {"ACM Transactions on Computer Systems"} + +MACRO {tods} {"ACM Transactions on Database Systems"} + +MACRO {tog} {"ACM Transactions on Graphics"} + +MACRO {toms} {"ACM Transactions on Mathematical Software"} + +MACRO {toois} {"ACM Transactions on Office Information Systems"} + +MACRO {toplas} {"ACM Transactions on Programming Languages and Systems"} + +MACRO {tcs} {"Theoretical Computer Science"} + +INTEGERS { nameptr namesleft numnames } + +FUNCTION {format.names} +{ 's := + #1 'nameptr := + s num.names$ 'numnames := + numnames 'namesleft := + { namesleft #0 > } + { nameptr #1 > + { s nameptr "{ff~}{vv~}{ll}{, jj}" format.name$ } + { s nameptr "{vv~}{ll}{, ff}{, jj}" format.name$ } + if$ + 't := + nameptr #1 > + { + namesleft #1 > + { "; " * t * } + { + numnames #2 > + { ";" * } + 'skip$ + if$ + s nameptr "{ll}" format.name$ duplicate$ "others" = + { 't := } + { pop$ } + if$ + t "others" = + { + " et~al." * + } + { bbl.and space.word * t * } + if$ + } + if$ + } + 't + if$ + nameptr #1 + 'nameptr := + namesleft #1 - 'namesleft := + } + while$ +} +FUNCTION {format.names.ed} +{ 's := + #1 'nameptr := + s num.names$ 'numnames := + numnames 'namesleft := + { namesleft #0 > } + { s nameptr + "{ff~}{vv~}{ll}{, jj}" + format.name$ + 't := + nameptr #1 > + { + namesleft #1 > + { "; " * t * } + { + numnames #2 > + { ";" * } + 'skip$ + if$ + s nameptr "{ll}" format.name$ duplicate$ "others" = + { 't := } + { pop$ } + if$ + t "others" = + { + " et~al." * + } + { bbl.and space.word * t * } + if$ + } + if$ + } + 't + if$ + nameptr #1 + 'nameptr := + namesleft #1 - 'namesleft := + } + while$ +} + +FUNCTION {format.key} +{ empty$ + { key field.or.null } + { "" } + if$ +} + +FUNCTION {format.authors} +{ author empty$ + { "" } + { author format.names } + if$ +} + +FUNCTION {format.editors} +{ editor empty$ + { "" } + { editor format.names + editor num.names$ #1 > + { ", " * bbl.editors * } + { ", " * bbl.editor * } + if$ + } + if$ +} + +FUNCTION {format.in.editors} +{ editor empty$ + { "" } + { editor format.names.ed + } + if$ +} + +FUNCTION {format.note} +{ note empty$ + { "" } + { note #1 #1 substring$ + duplicate$ "{" = + 'skip$ + { output.state mid.sentence = + { "l" } + { "u" } + if$ + change.case$ + } + if$ + note #2 global.max$ substring$ * + } + if$ +} + +FUNCTION {format.title} +{ title empty$ + { "" } + { title + } + if$ +} + +FUNCTION {format.full.names} +{'s := + #1 'nameptr := + s num.names$ 'numnames := + numnames 'namesleft := + { namesleft #0 > } + { s nameptr + "{vv~}{ll}" format.name$ + 't := + nameptr #1 > + { + namesleft #1 > + { ", " * t * } + { + numnames #2 > + { "," * } + 'skip$ + if$ + s nameptr "{ll}" format.name$ duplicate$ "others" = + { 't := } + { pop$ } + if$ + t "others" = + { + " et~al." * + } + { bbl.and space.word * t * } + if$ + } + if$ + } + 't + if$ + nameptr #1 + 'nameptr := + namesleft #1 - 'namesleft := + } + while$ +} + +FUNCTION {author.editor.key.full} +{ author empty$ + { editor empty$ + { key empty$ + { cite$ #1 #3 substring$ } + 'key + if$ + } + { editor format.full.names } + if$ + } + { author format.full.names } + if$ +} + +FUNCTION {author.key.full} +{ author empty$ + { key empty$ + { cite$ #1 #3 substring$ } + 'key + if$ + } + { author format.full.names } + if$ +} + +FUNCTION {editor.key.full} +{ editor empty$ + { key empty$ + { cite$ #1 #3 substring$ } + 'key + if$ + } + { editor format.full.names } + if$ +} + +FUNCTION {make.full.names} +{ type$ "book" = + type$ "inbook" = + or + 'author.editor.key.full + { type$ "proceedings" = + 'editor.key.full + 'author.key.full + if$ + } + if$ +} + +FUNCTION {output.bibitem} +{ newline$ + "\bibitem[{" write$ + label write$ + ")" make.full.names duplicate$ short.list = + { pop$ } + { * } + if$ + "}]{" * write$ + cite$ write$ + "}" write$ + newline$ + "" + before.all 'output.state := +} + +FUNCTION {n.dashify} +{ + 't := + "" + { t empty$ not } + { t #1 #1 substring$ "-" = + { t #1 #2 substring$ "--" = not + { "--" * + t #2 global.max$ substring$ 't := + } + { { t #1 #1 substring$ "-" = } + { "-" * + t #2 global.max$ substring$ 't := + } + while$ + } + if$ + } + { t #1 #1 substring$ * + t #2 global.max$ substring$ 't := + } + if$ + } + while$ +} + +FUNCTION {word.in} +{ bbl.in capitalize + ":" * + " " * } + +FUNCTION {format.date} +{ year duplicate$ empty$ + { "empty year in " cite$ * "; set to ????" * warning$ + pop$ "????" } + 'skip$ + if$ + month empty$ + 'skip$ + { month + " " * swap$ * + } + if$ + purify$ + extra.label * + before.all 'output.state := + " (" swap$ * ")" * +} + +FUNCTION {format.btitle} +{ title emphasize +} + +FUNCTION {tie.or.space.connect} +{ duplicate$ text.length$ #3 < + { "~" } + { " " } + if$ + swap$ * * +} + +FUNCTION {either.or.check} +{ empty$ + 'pop$ + { "can't use both " swap$ * " fields in " * cite$ * warning$ } + if$ +} + +FUNCTION {format.bvolume} +{ volume empty$ + { "" } + { bbl.volume volume tie.or.space.connect + series empty$ + 'skip$ + { bbl.of space.word * series emphasize * } + if$ + "volume and number" number either.or.check + } + if$ +} + +FUNCTION {format.number.series} +{ volume empty$ + { number empty$ + { series field.or.null } + { output.state mid.sentence = + { bbl.number } + { bbl.number capitalize } + if$ + number tie.or.space.connect + series empty$ + { "there's a number but no series in " cite$ * warning$ } + { bbl.in space.word * series * } + if$ + } + if$ + } + { "" } + if$ +} + +FUNCTION {is.num} +{ chr.to.int$ + duplicate$ "0" chr.to.int$ < not + swap$ "9" chr.to.int$ > not and +} + +FUNCTION {extract.num} +{ duplicate$ 't := + "" 's := + { t empty$ not } + { t #1 #1 substring$ + t #2 global.max$ substring$ 't := + duplicate$ is.num + { s swap$ * 's := } + { pop$ "" 't := } + if$ + } + while$ + s empty$ + 'skip$ + { pop$ s } + if$ +} + +FUNCTION {convert.edition} +{ edition extract.num "l" change.case$ 's := + s "first" = s "1" = or + { bbl.first 't := } + { s "second" = s "2" = or + { bbl.second 't := } + { s "third" = s "3" = or + { bbl.third 't := } + { s "fourth" = s "4" = or + { bbl.fourth 't := } + { s "fifth" = s "5" = or + { bbl.fifth 't := } + { s #1 #1 substring$ is.num + { s eng.ord 't := } + { edition 't := } + if$ + } + if$ + } + if$ + } + if$ + } + if$ + } + if$ + t +} + +FUNCTION {format.edition} +{ edition empty$ + { "" } + { output.state mid.sentence = + { convert.edition "l" change.case$ " " * bbl.edition * } + { convert.edition "t" change.case$ " " * bbl.edition * } + if$ + } + if$ +} + +INTEGERS { multiresult } + +FUNCTION {multi.page.check} +{ 't := + #0 'multiresult := + { multiresult not + t empty$ not + and + } + { t #1 #1 substring$ + duplicate$ "-" = + swap$ duplicate$ "," = + swap$ "+" = + or or + { #1 'multiresult := } + { t #2 global.max$ substring$ 't := } + if$ + } + while$ + multiresult +} + +FUNCTION {format.pages} +{ pages empty$ + { "" } + { pages multi.page.check + { bbl.pages pages n.dashify tie.or.space.connect } + { bbl.page pages tie.or.space.connect } + if$ + } + if$ +} + +FUNCTION {format.journal.pages} +{ pages empty$ + 'skip$ + { duplicate$ empty$ + { pop$ format.pages } + { + ":" * + pages n.dashify * + } + if$ + } + if$ +} + +FUNCTION {format.vol.num.pages} +{ volume field.or.null + number empty$ + 'skip$ + { + "(" number * ")" * * + volume empty$ + { "there's a number but no volume in " cite$ * warning$ } + 'skip$ + if$ + } + if$ + format.journal.pages +} + +FUNCTION {format.chapter.pages} +{ chapter empty$ + 'format.pages + { type empty$ + { bbl.chapter } + { type "l" change.case$ } + if$ + chapter tie.or.space.connect + pages empty$ + 'skip$ + { ", " * format.pages * } + if$ + } + if$ +} + +FUNCTION {format.in.ed.booktitle} +{ booktitle empty$ + { "" } + { editor empty$ + { word.in booktitle emphasize * } + { word.in booktitle emphasize * + ", " * + editor num.names$ #1 > + { bbl.editors } + { bbl.editor } + if$ + * " " * + format.in.editors * + } + if$ + } + if$ +} + +FUNCTION {format.thesis.type} +{ type empty$ + 'skip$ + { pop$ + type "t" change.case$ + } + if$ +} + +FUNCTION {format.tr.number} +{ type empty$ + { bbl.techrep } + 'type + if$ + number empty$ + { "t" change.case$ } + { number tie.or.space.connect } + if$ +} + +FUNCTION {format.article.crossref} +{ + word.in + " \cite{" * crossref * "}" * +} + +FUNCTION {format.book.crossref} +{ volume empty$ + { "empty volume in " cite$ * "'s crossref of " * crossref * warning$ + word.in + } + { bbl.volume capitalize + volume tie.or.space.connect + bbl.of space.word * + } + if$ + " \cite{" * crossref * "}" * +} + +FUNCTION {format.incoll.inproc.crossref} +{ + word.in + " \cite{" * crossref * "}" * +} + +FUNCTION {format.publisher} +{ publisher empty$ + { "empty publisher in " cite$ * warning$ } + 'skip$ + if$ + "" + address empty$ publisher empty$ and + 'skip$ + { + publisher empty$ + { address empty$ + 'skip$ + { address * } + if$ + } + { publisher * + address empty$ + 'skip$ + { ", " * address * } + if$ + } + if$ + } + if$ + output +} + +FUNCTION {article} +{ output.bibitem + format.authors "author" output.check + author format.key output + format.date "year" output.check + date.block + format.title "title" output.check + new.block + crossref missing$ + { journal + emphasize + "journal" output.check + format.vol.num.pages output + } + { format.article.crossref output.nonnull + format.pages output + } + if$ + new.block + format.note output + fin.entry +} + +FUNCTION {book} +{ output.bibitem + author empty$ + { format.editors "author and editor" output.check + editor format.key output + } + { format.authors output.nonnull + crossref missing$ + { "author and editor" editor either.or.check } + 'skip$ + if$ + } + if$ + format.date "year" output.check + date.block + format.btitle "title" output.check + crossref missing$ + { format.bvolume output + new.block + format.number.series output + new.sentence + format.publisher + } + { + new.block + format.book.crossref output.nonnull + } + if$ + format.edition output + new.block + format.note output + fin.entry +} + +FUNCTION {booklet} +{ output.bibitem + format.authors output + author format.key output + format.date "year" output.check + date.block + format.title "title" output.check + new.block + howpublished output + address output + new.block + format.note output + fin.entry +} + +FUNCTION {inbook} +{ output.bibitem + author empty$ + { format.editors "author and editor" output.check + editor format.key output + } + { format.authors output.nonnull + crossref missing$ + { "author and editor" editor either.or.check } + 'skip$ + if$ + } + if$ + format.date "year" output.check + date.block + format.btitle "title" output.check + crossref missing$ + { + format.publisher + format.bvolume output + format.chapter.pages "chapter and pages" output.check + new.block + format.number.series output + new.sentence + } + { + format.chapter.pages "chapter and pages" output.check + new.block + format.book.crossref output.nonnull + } + if$ + format.edition output + new.block + format.note output + fin.entry +} + +FUNCTION {incollection} +{ output.bibitem + format.authors "author" output.check + author format.key output + format.date "year" output.check + date.block + format.title "title" output.check + new.block + crossref missing$ + { format.in.ed.booktitle "booktitle" output.check + format.publisher + format.bvolume output + format.number.series output + format.chapter.pages output + new.sentence + format.edition output + } + { format.incoll.inproc.crossref output.nonnull + format.chapter.pages output + } + if$ + new.block + format.note output + fin.entry +} + +FUNCTION {inproceedings} +{ output.bibitem + format.authors "author" output.check + author format.key output + format.date "year" output.check + date.block + format.title "title" output.check + new.block + crossref missing$ + { format.in.ed.booktitle "booktitle" output.check + new.sentence + publisher empty$ + { organization output + address output + } + { organization output + format.publisher + } + if$ + format.bvolume output + format.number.series output + format.pages output + } + { format.incoll.inproc.crossref output.nonnull + format.pages output + } + if$ + new.block + format.note output + fin.entry +} + +FUNCTION {conference} { inproceedings } + +FUNCTION {manual} +{ output.bibitem + format.authors output + author format.key output + format.date "year" output.check + date.block + format.btitle "title" output.check + organization address new.block.checkb + organization output + address output + format.edition output + new.block + format.note output + fin.entry +} + +FUNCTION {mastersthesis} +{ output.bibitem + format.authors "author" output.check + author format.key output + format.date "year" output.check + date.block + format.btitle "title" output.check + new.block + bbl.mthesis format.thesis.type output.nonnull + school "school" output.check + address output + new.block + format.note output + fin.entry +} + +FUNCTION {misc} +{ output.bibitem + format.authors output + author format.key output + format.date "year" output.check + date.block + format.title output + new.block + howpublished output + new.block + format.note output + fin.entry +} + +FUNCTION {phdthesis} +{ output.bibitem + format.authors "author" output.check + author format.key output + format.date "year" output.check + date.block + format.btitle "title" output.check + new.block + bbl.phdthesis format.thesis.type output.nonnull + school "school" output.check + address output + new.block + format.note output + fin.entry +} + +FUNCTION {proceedings} +{ output.bibitem + format.editors output + editor format.key output + format.date "year" output.check + date.block + format.btitle "title" output.check + format.bvolume output + format.number.series output + address output + new.sentence + organization output + publisher output + new.block + format.note output + fin.entry +} + +FUNCTION {techreport} +{ output.bibitem + format.authors "author" output.check + author format.key output + format.date "year" output.check + date.block + format.btitle "title" output.check + new.block + format.tr.number output.nonnull + institution "institution" output.check + address output + new.block + format.note output + fin.entry +} + +FUNCTION {unpublished} +{ output.bibitem + format.authors "author" output.check + author format.key output + format.date "year" output.check + date.block + format.title "title" output.check + new.block + format.note "note" output.check + fin.entry +} + +FUNCTION {default.type} { misc } + +READ + +FUNCTION {sortify} +{ purify$ + "l" change.case$ +} + +INTEGERS { len } + +FUNCTION {chop.word} +{ 's := + 'len := + s #1 len substring$ = + { s len #1 + global.max$ substring$ } + 's + if$ +} + +FUNCTION {format.lab.names} +{ 's := + s #1 "{vv~}{ll}" format.name$ + s num.names$ duplicate$ + #2 > + { pop$ + " et~al." * + } + { #2 < + 'skip$ + { s #2 "{ff }{vv }{ll}{ jj}" format.name$ "others" = + { + " et~al." * + } + { bbl.and space.word * s #2 "{vv~}{ll}" format.name$ + * } + if$ + } + if$ + } + if$ +} + +FUNCTION {author.key.label} +{ author empty$ + { key empty$ + { cite$ #1 #3 substring$ } + 'key + if$ + } + { author format.lab.names } + if$ +} + +FUNCTION {author.editor.key.label} +{ author empty$ + { editor empty$ + { key empty$ + { cite$ #1 #3 substring$ } + 'key + if$ + } + { editor format.lab.names } + if$ + } + { author format.lab.names } + if$ +} + +FUNCTION {editor.key.label} +{ editor empty$ + { key empty$ + { cite$ #1 #3 substring$ } + 'key + if$ + } + { editor format.lab.names } + if$ +} + +FUNCTION {calc.short.authors} +{ type$ "book" = + type$ "inbook" = + or + 'author.editor.key.label + { type$ "proceedings" = + 'editor.key.label + 'author.key.label + if$ + } + if$ + 'short.list := +} + +FUNCTION {calc.label} +{ calc.short.authors + short.list + "(" + * + year duplicate$ empty$ + { pop$ "????" } + 'skip$ + if$ + * + 'label := +} + +FUNCTION {sort.format.names} +{ 's := + #1 'nameptr := + "" + s num.names$ 'numnames := + numnames 'namesleft := + { namesleft #0 > } + { s nameptr + "{vv{ } }{ll{ }}{ ff{ }}{ jj{ }}" + format.name$ 't := + nameptr #1 > + { + " " * + namesleft #1 = t "others" = and + { "zzzzz" * } + { t sortify * } + if$ + } + { t sortify * } + if$ + nameptr #1 + 'nameptr := + namesleft #1 - 'namesleft := + } + while$ +} + +FUNCTION {sort.format.title} +{ 't := + "A " #2 + "An " #3 + "The " #4 t chop.word + chop.word + chop.word + sortify + #1 global.max$ substring$ +} + +FUNCTION {author.sort} +{ author empty$ + { key empty$ + { "to sort, need author or key in " cite$ * warning$ + "" + } + { key sortify } + if$ + } + { author sort.format.names } + if$ +} + +FUNCTION {author.editor.sort} +{ author empty$ + { editor empty$ + { key empty$ + { "to sort, need author, editor, or key in " cite$ * warning$ + "" + } + { key sortify } + if$ + } + { editor sort.format.names } + if$ + } + { author sort.format.names } + if$ +} + +FUNCTION {editor.sort} +{ editor empty$ + { key empty$ + { "to sort, need editor or key in " cite$ * warning$ + "" + } + { key sortify } + if$ + } + { editor sort.format.names } + if$ +} + +FUNCTION {presort} +{ calc.label + label sortify + " " + * + type$ "book" = + type$ "inbook" = + or + 'author.editor.sort + { type$ "proceedings" = + 'editor.sort + 'author.sort + if$ + } + if$ + #1 entry.max$ substring$ + 'sort.label := + sort.label + * + " " + * + title field.or.null + sort.format.title + * + #1 entry.max$ substring$ + 'sort.key$ := +} + +ITERATE {presort} + +SORT + +STRINGS { last.label next.extra } + +INTEGERS { last.extra.num number.label } + +FUNCTION {initialize.extra.label.stuff} +{ #0 int.to.chr$ 'last.label := + "" 'next.extra := + #0 'last.extra.num := + #0 'number.label := +} + +FUNCTION {forward.pass} +{ last.label label = + { last.extra.num #1 + 'last.extra.num := + last.extra.num int.to.chr$ 'extra.label := + } + { "a" chr.to.int$ 'last.extra.num := + "" 'extra.label := + label 'last.label := + } + if$ + number.label #1 + 'number.label := +} + +FUNCTION {reverse.pass} +{ next.extra "b" = + { "a" 'extra.label := } + 'skip$ + if$ + extra.label 'next.extra := + extra.label + duplicate$ empty$ + 'skip$ + { "{\natexlab{" swap$ * "}}" * } + if$ + 'extra.label := + label extra.label * 'label := +} + +EXECUTE {initialize.extra.label.stuff} + +ITERATE {forward.pass} + +REVERSE {reverse.pass} + +FUNCTION {bib.sort.order} +{ sort.label + " " + * + year field.or.null sortify + * + " " + * + title field.or.null + sort.format.title + * + #1 entry.max$ substring$ + 'sort.key$ := +} + +ITERATE {bib.sort.order} + +SORT + +FUNCTION {begin.bib} +{ preamble$ empty$ + 'skip$ + { preamble$ write$ newline$ } + if$ + "\begin{thebibliography}{" number.label int.to.str$ * "}" * + write$ newline$ + "\expandafter\ifx\csname natexlab\endcsname\relax\def\natexlab#1{#1}\fi" + write$ newline$ +} + +EXECUTE {begin.bib} + +EXECUTE {init.state.consts} + +ITERATE {call.type$} + +FUNCTION {end.bib} +{ newline$ + "\end{thebibliography}" write$ newline$ +} + +EXECUTE {end.bib} +%% End of customized bst file +%% +%% End of file `hc-en.bst'. diff --git a/macros/latex/contrib/hc/hc.dtx b/macros/latex/contrib/hc/hc.dtx new file mode 100644 index 0000000000..e76abdd853 --- /dev/null +++ b/macros/latex/contrib/hc/hc.dtx @@ -0,0 +1,1624 @@ +% \iffalse +% +% This is file `hc.dtx'. +% +%% Copyright (C) 1998--2000 Christian Siefkes <error@cs.tu-berlin.de> +%% +%% Updates are available via http://tal.cs.tu-berlin.de/error/TeX/ +%% +%% This file is part of the HC Bundle for LaTeX2e. +%% ----------------------------------------------- +%% +%% This file is free software; you can redistribute it and/or modify +%% it under the terms of the GNU Library General Public License as +%% published by the Free Software Foundation; either version 2 of the +%% License, or (at your option) any later version. +%% +%% This document is distributed in the hope that it will be useful, but +%% WITHOUT ANY WARRANTY; without even the implied warranty of +%% MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU +%% General Public License for more details. +%% +%% You should have received a copy of the GNU General Public License +%% along with this program; see the file COPYING. If not, write to +%% the Free Software Foundation, Inc., 59 Temple Place - Suite 330, +%% Boston, MA 02111-1307, USA. +%% +% \CharacterTable +% {Upper-case \A\B\C\D\E\F\G\H\I\J\K\L\M\N\O\P\Q\R\S\T\U\V\W\X\Y\Z +% Lower-case \a\b\c\d\e\f\g\h\i\j\k\l\m\n\o\p\q\r\s\t\u\v\w\x\y\z +% Digits \0\1\2\3\4\5\6\7\8\9 +% Exclamation \! Double quote \" Hash (number) \# +% Dollar \$ Percent \% Ampersand \& +% Acute accent \' Left paren \( Right paren \) +% Asterisk \* Plus \+ Comma \, +% Minus \- Point \. Solidus \/ +% Colon \: Semicolon \; Less than \< +% Equals \= Greater than \> Question mark \? +% Commercial at \@ Left bracket \[ Backslash \\ +% Right bracket \] Circumflex \^ Underscore \_ +% Grave accent \` Left brace \{ Vertical bar \| +% Right brace \} Tilde \~} +% +%<class>\NeedsTeXFormat{LaTeX2e}[1995/12/01] +%<*dtx> + \ProvidesFile{hc.dtx}% +%</dtx> +%<german>\ProvidesFile{german.hld}% +%<hcart>\ProvidesClass{hcart}% +%<hcletter>\ProvidesClass{hcletter}% +%<hcreport>\ProvidesClass{hcreport}% +%<hcslides>\ProvidesClass{hcslides}% +% \fi +% \ProvidesFile{hc.dtx}% + [2000/03/23 v1.07 LaTeX2e HC Bundle] +% \iffalse +% +%<*driver> +\documentclass[paper]{hcart} +\usepackage{doc} +\begin{document} +\DocInput{hc.dtx} +\end{document} +%</driver> +% \fi +% +% \newcommand{\cs}[1]{\texttt{\backslash #1}} +% \changes{v0.9}{1999/09/09}{First public prerelease} +% \changes{v1.0}{1999/11/01}{First official public version} +% \changes{v1.01}{1999/11/05}{better PDF support, +% \cs{keywords} and \cs{hyperinfo} commands added} +% \changes{v1.02}{1999/11/28}{author's email \& homepage made +% hyperlinks, \cs{phyp} and \cs{arrow} commands added} +% \changes{v1.02a}{1999/12/23}{bugs fixed (load \texttt{babel} after +% \texttt{natbib} package; correct formatting of \cs{tit(sub)info)}} +% \changes{v1.02b}{1999/12/26}{\cs{bibfirst} command removed} +% \changes{v1.02c}{2000/01/02}{\cs{addrdiv} command added} +% \changes{v1.02d}{2000/01/04}{\cs{enge} command added, +% \cs{bibmov} command modified} +% \changes{v1.02e}{2000/01/05}{\cs{etal} command modified} +% \changes{v1.02f}{2000/01/30}{bug fixed (\texttt{german} option)} +% \changes{v1.03}{2000/01/31}{\cs{cfcite} command added} +% \changes{v1.04}{2000/02/23}{\texttt{xspace} package support added} +% \changes{v1.04a}{2000/02/24}{\texttt{mathpple} package support added} +% \changes{v1.04b}{2000/02/29}{output of \cs{noyear} and \cs{noplace} +% commands changed} +% \changes{v1.05}{2000/03/04}{\texttt{dialog} environment and \cs{newspeaker} +% command added} +% \changes{v1.06}{2000/03/10}{\texttt{fnbib} option and \cs{f} command added} +% \changes{v1.06a}{2000/03/11}{bug fixed (\texttt{fnbib} option)} +% \changes{v1.06b}{2000/03/13}{implementation of (\texttt{bib} option changed)} +% \changes{v1.06c}{2000/03/14}{\cs{ps@headings} macro changed)} +% \changes{v1.07}{2000/03/23}{\cs{see} macro added)} +% \GetFileInfo{hc.dtx} +% +% \tit[\filedate]{The HC Bundle for \LaTeXe\\\fileversion} +% +% \MakeShortVerb{\|} +% \newcommand{\descOpt}[1]{\marginbox{#1}} +% \newcommand{\descCom}[1]{\marginbox{\tt\textbackslash #1}} +% \newcommand{\descEnv}[2][] +% {\marginbox{\texttt{\textbackslash begin{\tt\string{}#2{\tt\string}}}#1}} +% \newcommand{\comdiv}{\\ \tt\textbackslash} +% \newcommand{\m}[1]{\mbox{\it #1\/}} +% \renewcommand{\arg}[1]{{\tt\string{}\m{#1}{\tt\string}}} +% \newcommand{\oarg}[1]{{\tt[}\m{#1}{\tt]}} +% \newcommand{\rarg}[1]{<\m{#1}>} +% +% \section{Introduction} +% The HC Bundle for \LaTeXe\ provides the following four classes as +% replacement for the \LaTeX\ default classes: +% \begin{flexlist}{hcreport.cls} +% \item[hcart.cls] substitute for the |article| class,\\ +% based upon the |scrartcl| class from the KoMa-Script bundle; +% \item[hcreport.cls] substitute for the |report| class,\\ +% based upon the |scrreprt| class from the KoMa-Script bundle; +% \item[hcletter.cls] substitute for the |letter| class,\\ +% based upon the |scrlettr| class from the KoMa-Script bundle; +% \item[hcslides.cls] substitute for the |slides| class,\\ +% based upon the |seminar| class. +% \end{flexlist} +% \begin{macrocode} +%<*hcart> +\newcommand{\thisclass}{hcart} +\newcommand{\superclass}{scrartcl} +%</hcart> +%<*hcletter> +\newcommand{\thisclass}{hcletter} +\newcommand{\superclass}{scrlettr} +%</hcletter> +%<*hcreport> +\newcommand{\thisclass}{hcreport} +\newcommand{\superclass}{scrreprt} +%</hcreport> +%<*hcslides> +\newcommand{\thisclass}{hcslides} +\newcommand{\superclass}{seminar} +%</hcslides> +% \end{macrocode} +% \section{Options} +% \subsection{General Options} +% \descOpt{german\\english} +% Loads a language. Default is English. At the moment no other languages are +% supported. Requires the |babel| package. +% \begin{macrocode} +%<*class> +\newif\if@german +\@germanfalse +\newif\if@deflang +\@deflangtrue +\DeclareOption{german}{\@deflangfalse\@germantrue + \PassOptionsToPackage{ngerman}{babel} + \PassOptionsToPackage{german}{fancyref} + \AtEndOfClass{\input{german.hld}}} +\DeclareOption{english}{\@deflangfalse + \PassOptionsToPackage{\CurrentOption}{babel}} +% \end{macrocode} +% \descOpt{a4paper\\letterpaper} +% Use the DIN~A4 (default) or the letter paper format? At the moment no other +% paper formats are supported. +% \begin{macrocode} +\newif\if@defpaper +\@defpapertrue +\DeclareOption{a4paper}{ +%<hcart|hcletter|hcreport>\PassOptionsToClass{\CurrentOption}{\superclass} +%<hcslides>\PassOptionsToClass{a4}{\superclass} +\PassOptionsToPackage{\CurrentOption}{hyperref} +\@defpaperfalse} +\DeclareOption{letterpaper}{ +%<hcart|hcletter|hcreport>\PassOptionsToClass{\CurrentOption}{\superclass} +\PassOptionsToPackage{\CurrentOption}{hyperref} +\@defpaperfalse} +% \end{macrocode} +% \descOpt{palatino\\nopalatino} +% Use the Palatino or the Standard \TeX\ font? Palatino is default (requires +% the |palatino| and the |mathpple| packages). +% \begin{macrocode} +\newif\if@palatino +\@palatinotrue +\DeclareOption{palatino}{\@palatinotrue} +\DeclareOption{nopalatino}{\@palatinofalse} +% \end{macrocode} +% \descOpt{ding} +% Provide some fancy lists and symbols using the Dingbat symbols (requires +% the |pifont| style of the |psnfss| package)? +% \begin{macrocode} +\newif\if@ding +\@dingfalse +\DeclareOption{ding}{\@dingtrue} +% \end{macrocode} +% \descOpt{euro\\noeuro} +% Provide the Euro symbol \E\ (default, requires the |eurofont| package)? +% \begin{macrocode} +\newif\if@euro +\@eurotrue +\DeclareOption{euro}{\@eurotrue} +\DeclareOption{noeuro}{\@eurofalse} +% \end{macrocode} +% \descOpt{fancyref\\nofancyref} +% Provide fancy reference commands (default, requires the |fancyref| and the +% |varioref| packages)? +% \begin{macrocode} +\newif\if@fancyref +\@fancyreftrue +\DeclareOption{fancyref}{\@fancyreftrue} +\DeclareOption{nofancyref}{\@fancyreffalse} +% \end{macrocode} +% \descOpt{html\\nohtml} +% Provide HTML commands (default, requires the |html| package bundled with +% \LaTeX2HTML)? +% \begin{macrocode} +\newif\if@html +\@htmltrue +\DeclareOption{html}{\@htmltrue} +\DeclareOption{nohtml}{\@htmlfalse} +%</class> +% \end{macrocode} +% \subsection{Options for the hcart and hcreport classes} +% \descOpt{headsepline\\headnosepline} +% Draw a horizontal line below the header line (default)? +% \begin{macrocode} +%<*hcart|hcreport> +\newif\if@defhsl +\@defhsltrue +\DeclareOption{headsepline}{\PassOptionsToClass +{\CurrentOption}{\superclass}\@defhslfalse} +\DeclareOption{headnosepline}{\PassOptionsToClass +{\CurrentOption}{\superclass}\@defhslfalse} +% \end{macrocode} +% \descOpt{onecolumn\\twocolumn} +% Set the text in one or two columns (default is one)? +% \begin{macrocode} +\DeclareOption{onecolumn}{\PassOptionsToClass +{\CurrentOption}{\superclass}} +\DeclareOption{twocolumn}{\PassOptionsToClass +{\CurrentOption}{\superclass}} +% \end{macrocode} +% \descOpt{hcarea\\hcnoarea} +% Set the default area to 240mm $\times$ 150mm (default)? Otherwise, +% the default value from the |scrartcl| resp. |scrreprt| classes is used +% if you do not set the area manually (e.g. with the |\areaset| command). +% \begin{macrocode} +\newif\if@hcarea +\@hcareatrue +\DeclareOption{hcarea}{\@hcareatrue} +\DeclareOption{hcnoarea}{\@hcareafalse} +% \end{macrocode} +% \descOpt{hcfootnotes\\hcnofootnotes} +% Nicer formatting of footnotes (default)? +% \begin{macrocode} +\newif\if@hcfootnotes +\@hcfootnotestrue +\DeclareOption{hcfootnotes}{\@hcfootnotestrue} +\DeclareOption{hcnofootnotes}{\@hcfootnotesfalse} +% \end{macrocode} +% \descOpt{magazine} +% Provide commands for magazine or newspaper articles? This sets the +% |html| option too. +% \begin{macrocode} +\newif\if@magazine +\@magazinefalse +\DeclareOption{magazine}{\@magazinetrue\@htmltrue} +% \end{macrocode} +% \descOpt{parskip} +% Skip paragraphs instead of indenting them? +% \begin{macrocode} +\newif\if@parskip +\@parskipfalse +\DeclareOption{parskip}{\@parskiptrue} +% \end{macrocode} +% \descOpt{wide} +% Use a wide line distance (ca. 1.5)? +% \begin{macrocode} +\newif\if@wide +\@widefalse +\DeclareOption{wide}{\@widetrue} +%</hcart|hcreport> +% \end{macrocode} +% \subsection{Options for the hcart, hcreport and hcletter classes} +% \descOpt{10pt\\11pt\\12pt} +% Use a font size of 10, 11, or 12 (default) points? +% \begin{macrocode} +%<*hcart|hcreport|hcletter> +\newif\if@defsize +\@defsizetrue +\DeclareOption{10pt}{\PassOptionsToClass{\CurrentOption}{\superclass} +\@defsizefalse} +\DeclareOption{11pt}{\PassOptionsToClass{\CurrentOption}{\superclass} +\@defsizefalse} +\DeclareOption{12pt}{\PassOptionsToClass{\CurrentOption}{\superclass} +\@defsizefalse} +%</hcart|hcreport|hcletter> +% \end{macrocode} +% \subsection{Options for the hcart, hcreport and hcslides classes} +% \descOpt{bib\\nobib} +% Use \BibTeX? +% \begin{macrocode} +%<*hcart|hcreport|hcslides> +\newif\if@bib +\@bibfalse +\DeclareOption{bib}{\@bibtrue} +\DeclareOption{nobib}{\@bibfalse} +% \end{macrocode} +% \descOpt{fnbib\\autbib\\numbib} +% \BibTeX\ references are written in footnotes (default) or in +% author-year or in numerical style. +% These options set the |bib| option too. +% \begin{macrocode} +\newif\if@fnbib +\@fnbibtrue +\newif\if@autbib +\@autbibfalse +\newif\if@numbib +\@numbibfalse +\DeclareOption{fnbib}{\@fnbibtrue\@autbibfalse\@numbibfalse\@bibtrue} +\DeclareOption{autbib}{\@fnbibfalse\@autbibtrue\@numbibfalse\@bibtrue} +\DeclareOption{numbib}{\@fnbibfalse\@autbibfalse\@numbibtrue\@bibtrue} +% \end{macrocode} +% \descOpt{htmlbib\\nohtmlbib} +% Use the |html| package for online references with \BibTeX\ (default)? +% This loads the |html| option too. +% \begin{macrocode} +\newif\if@htmlbib +\@htmlbibtrue +\DeclareOption{htmlbib}{\@htmlbibtrue\@htmltrue} +\DeclareOption{nohtmlbib}{\@htmlbibfalse} +% \end{macrocode} +% \descOpt{paper} +% Provide formatting and commands for a scientific paper? This sets the +% |bib| and |html| options too. +% \begin{macrocode} +\newif\if@paper +\@paperfalse +\DeclareOption{paper}{\@papertrue\@bibtrue\@htmltrue} +% \end{macrocode} +% \descOpt{pdf\\nopdf} +% Prepare file for the PDF format? This loads the |hyperref| package. +% This option is set automagically by running |pdflatex|. +% \begin{macrocode} +\newif\if@pdf +\ifx\pdfoutput\undefined + \@pdffalse +\else + \@pdftrue +\fi +\DeclareOption{pdf}{\@pdftrue} +\DeclareOption{nopdf}{\@pdffalse} +%</hcart|hcreport|hcslides> +% \end{macrocode} +% \subsection{Options for the hcreport class} +% \descOpt{openany\\openright} +% Start new chapters always on a right page (not by default)? +% \begin{macrocode} +%<*hcreport> +\DeclareOption{openany} + {\PassOptionsToClass{\CurrentOption}{\superclass}} +\DeclareOption{openright} + {\PassOptionsToClass{\CurrentOption}{\superclass}} +%</hcreport> +% \end{macrocode} +% \subsection{Options for the hcslides class} +% \descOpt{twotoc\\onetoc} +% Print table of contents in two columns (requires the |multicol| package)? +% \begin{macrocode} +%<*hcslides> +\newif\if@twotoc +\@twotocfalse +\DeclareOption{twotoc}{\@twotoctrue} +\DeclareOption{onetoc}{\@twotocfalse} +%</hcslides> +% \end{macrocode} +% \subsection{Other Options} +% Other options are ignored. +% \begin{macrocode} +%<*class> +\DeclareOption*{\ClassWarning{\thisclass}% + {Unknown Option: `\CurrentOption '}% +} +% \end{macrocode} +% Options not implemented: +% \begin{widedesc} +% \item[scrartcl, scrlettr, scrreprt] +% paper sizes except a4 and letter (a5paper, b5paper, legalpaper, +% executivepaper ...); oneside, twoside; +% \item[scrartcl, scrreprt] +% DIV\dots, DIVcalc, DIVclassic, BCOR; headinclude, headexclude, footinclude, +% footexclude; footsepline, footnosepline; +% bigheadings, normalheadings, smallheadings; +% pointednumbers, pointlessnumbers; abstracton, abstractoff; +% titlepage, notitlepage; leqno, fleqn; openbib; portrait, landscape; +% draft, final; bibtotocnumbered; +% \item[scrlettr] +% orgdate; wlocfield, slocfield; +% \item[seminar] +% portrait, landscape; article, slidesonly, notes, +% notesonly; semlayer, semcolor. +% \end{widedesc} +% \section{Commands and Environments} +% \subsection{Configuration} +% \descCom{defaulttitle\arg{title}\comdiv +% defaultauthor\arg{author}\comdiv +% defaultaddress\arg{address}\comdiv +% defaultemail\arg{mail-address}\comdiv +% defaulthomepage\arg{website}} +% Used if no author information is specified. +% They are all empty by default. Renew them in one of the config files +% (see below). +% \descCom{autdiv} +% Use instead of |\\| in |\defaultauthor|. +% \descCom{autinfodiv} +% Use instead of |\\| in |\defaultaddress| etc. +% \begin{macrocode} +\newcommand{\defaulttitle}{} +\newcommand{\defaultauthor}{} +\newcommand{\defaultaddress}{} +\newcommand{\defaultemail}{} +\newcommand{\defaulthomepage}{} +\newcommand{\currenttitle}{\defaulttitle} +\newcommand{\currentauthor}{\defaultauthor} +\newcommand{\autdiv}{\\[-0.4ex]\normalfont\Large} +\newcommand{\autinfodiv}{\\[-1ex]\normalfont\normalsize} +\ProcessOptions\relax +%</class> +%<*hcart|hcreport> +\if@defhsl + \PassOptionsToClass{headsepline}{\superclass} +\fi +% \end{macrocode} +% The |twoside|, |pointlessnumbers|, +% |liststotoc|, |bibtotoc| and |idxtotoc| +% options are always used with the |hcart| and |hcreport| classes. +% The |hcletter| class always uses the |wlocfield| option. +% \begin{macrocode} +\PassOptionsToClass{twoside,pointlessnumbers,liststotoc, + bibtotoc,idxtotoc}{\superclass} +%</hcart|hcreport> +%<hcletter>\PassOptionsToClass{wlocfield}{\superclass} +%<*hcart|hcreport|hcletter> +\if@defsize + \PassOptionsToClass{12pt}{\superclass} +\fi +%</hcart|hcreport|hcletter> +%<*class> +\if@deflang + \PassOptionsToPackage{english}{babel} +\fi +\if@defpaper +%<hcart|hcreport> \PassOptionsToClass{a4paper}{\superclass} +%<hcslides> \PassOptionsToClass{a4}{\superclass} + \PassOptionsToPackage{a4paper}{hyperref} +\fi +\LoadClass{\superclass} +% \end{macrocode} +% The normal spacing is used after the end of a sentence. +% \begin{macrocode} +\sloppy +\clubpenalty9999 +\@clubpenalty\clubpenalty +\widowpenalty9999 +\displaywidowpenalty1000 +\brokenpenalty1000 +\frenchspacing +% \end{macrocode} +% The modern font encoding (T1) and the latin1 input encoding are used +% (this requires the |T1| and |latin1| packages). The |ifthen|, +% the |babel| and the |xspace| packages are always used. +% The |bib| option loads the |natbib| package. +% \begin{macrocode} +%<hcart|hcreport|hcslides>\RequirePackage{natbib} +\RequirePackage[T1]{fontenc} +\RequirePackage[latin1]{inputenc} +\RequirePackage{ifthen} +\RequirePackage{babel} +\RequirePackage{xspace} +% \end{macrocode} +% The config file |hc.cfg| is used by all classes. Every class also +% uses a config file with its own name, e.g. the hcart class uses +% |hcart.cfg|. The settings in |hc.cfg| may be overwritten by the +% class specific config files. +% \begin{macrocode} +\InputIfFileExists{hc.cfg}{% + \ClassInfo{\thisclass} + {Loading configuration file hc.cfg}}{% + \ClassInfo{\thisclass} + {Configuration file hc.cfg not found}} +\InputIfFileExists{\thisclass.cfg}{% + \ClassInfo{\thisclass} + {Loading configuration file \thisclass.cfg}}{% + \ClassInfo{\thisclass} + {Configuration file \thisclass.cfg not found}} +% \end{macrocode} +% \subsection{General Commands and Environments} +% \descCom{q\arg{quote}} +% \rarg{quote} is put into quotation marks. May be nested: A quote inside +% another quote uses inner quotation marks. +% \begin{macrocode} +\newcommand{\nextstartq}{`} +\newcommand{\nextendq}{'} +\newcommand{\otherstartq}{``} +\newcommand{\otherendq}{''} +\newcommand{\tmpq}{} +\newcommand{\q}[1]{\nextstartq{}% + \let\tmpq\nextstartq% + \let\nextstartq\otherstartq% + \let\otherstartq\tmpq% + \let\tmpq\nextendq% + \let\nextendq\otherendq% + \let\otherendq\tmpq% + #1% + \let\tmpq\nextstartq% + \let\nextstartq\otherstartq% + \let\otherstartq\tmpq% + \let\tmpq\nextendq% + \let\nextendq\otherendq% + \let\otherendq\tmpq% + \nextendq{}% +} +% \end{macrocode} +% \descCom{hq\arg{quote}} +% \rarg{quote} is always put into inner (\hq{half}) quotation marks. +% \begin{macrocode} +\newcommand{\hq}[1]{``#1''} +% \end{macrocode} +% \descCom{fq\arg{quote}} +% \rarg{quote} is always put into outer (\fq{full}) quotation marks. +% \begin{macrocode} +\newcommand{\fq}[1]{`#1'} +% \end{macrocode} +% \descCom{dash\arg{text}} +% \rarg{text} is put between dashes. +% \begin{macrocode} +\newcommand{\dash}[1]{---#1---} +% \end{macrocode} +% \descEnv[\oarg{separator}\arg{longest-title}]{flexlist} +% A list environment similar to the |description| environment. +% All items are indented by the width of \rarg{longest-title}. +% The default \rarg{separator} is \q{:}. +% \begin{macrocode} +\newenvironment{flexlist}[2][:] + {\begin{list}{} + {\settowidth{\labelwidth}{\sffamily\bfseries #2#1 } + \setlength{\leftmargin}{\labelwidth} + \addtolength{\leftmargin}{\labelsep} + \renewcommand{\makelabel}[1] + {\sffamily\bfseries ##1#1 \hfill}}} + {\end{list}} +% \end{macrocode} +% \descEnv[\oarg{separator}]{widedesc} +% A variation of the |flexlist| environment. +% All items are indented by the width of a date (\q{00.00.0000}). +% The default \rarg{separator} is \q{:}. +% \begin{macrocode} +\newenvironment{widedesc}[1][:] + {\begin{flexlist}[#1]{00.00.0000}} + {\end{flexlist}} +% \end{macrocode} +% \descCom{pcent\arg{value}} +% Prints \rarg{value} followed by the percent symbol \%. +% \begin{macrocode} +\newcommand{\pcent}[1]{#1\,\%} +% \end{macrocode} +% \descCom{qdots} +% Prints the scientific omission symbol \qdots. +% \begin{macrocode} +\newcommand{\qdots}{\mbox{[\dots]}\xspace} +% \end{macrocode} +% \descCom{phyp} +% Prints a (part of a) word in parenthesis, ended by a hypen, like +% \phyp{love}letter. +% \begin{macrocode} +\newcommand{\phyp}[1] + {(#1\textormath{\leavevmode\hbox{-}}{-})\hskip\z@skip} +% \end{macrocode} +% \descCom{arrow} +% Prints an arrow: \arrow. +% \begin{macrocode} +\newcommand{\arrow}{\ensuremath{\rightarrow}\xspace} +% \end{macrocode} +% \descCom{f\comdiv ff} +% Print the abbreviations for \q{the following page(s)} +% (\q{f} resp. \q{ff} after a small space). +% \begin{macrocode} +\newcommand{\f}{\,f} +\newcommand{\ff}{\,ff} +% \end{macrocode} +% \descCom{distance} +% Starts a new un-indented paragraph following an empty line. +% \begin{macrocode} +\newcommand{\distance}{\par\bigskip\noindent} +% \end{macrocode} +% \descCom{stardistance} +% Starts a new un-indented paragraph following three centered stars. +% \begin{macrocode} +\newcommand{\stardistance} + {\par\bigskip{\centering *~~~*~~~*\par}\bigskip\noindent} +% \end{macrocode} +% \descCom{linedistance} +% Starts a new un-indented paragraph following an horizontal rule. +% \begin{macrocode} +\newcommand{\linedistance}{% + \begin{center} + \begin{tabular}{p{0.33\textwidth}} + \hrule + \end{tabular} + \end{center} + \medskip\noindent% +} +% \end{macrocode} +% \descCom{sig\arg{name}} +% Prints \rarg{name} as signature (flushright in italics). +% \begin{macrocode} +\newcommand{\sig}[1]{\par{\raggedleft\emph{#1}\par}} +% \end{macrocode} +% \descCom{intro\arg{text}} +% \rarg{text} is centered in an extra paragraph, using a bold font. +% Followed by some space. +% \begin{macrocode} +\newcommand{\intro}[1]{{\par\centering\textbf{#1}\par} + \medskip\noindent\ignorespaces} +% \end{macrocode} +% \descCom{hint\arg{text}} +% \rarg{text} is centered in an extra paragraph, using a large font. +% \begin{macrocode} +\newcommand{\hint}[1]{{\par\centering\LARGE #1\par} + \noindent\ignorespaces} +% \end{macrocode} +% \descCom{cen\arg{text}} +% An alternative to the |center| environment using less space before and after. +% \begin{macrocode} +\newcommand{\cen}[1] + {{\par\centering #1\par}\noindent\ignorespaces} +% \end{macrocode} +% \descCom{marginbox\arg{text}} +% A text in a box, set out into the margin. Lines are divided by |\\|. +% \begin{macrocode} +\newcommand{\marginbox}[1]% + {\par\small\addvspace{4.5ex plus 1ex}% + \vskip -\parskip +%<hcart|hcletter|hcreport> \noindent\hspace{-.75\leftmargini}% +%<hcslides> \noindent + \begin{tabular}{|l|}\hline\ignorespaces + #1 + \\\hline\end{tabular}\nobreak\par\nobreak + \vspace{2.3ex}\vskip -\parskip\noindent\ignorespaces} +% \end{macrocode} +% \descCom{rightaddress} +% Like the |\verse| environment, but moved to the right as far as possible. +% Lines are divided by |\\|. +% \begin{macrocode} +\newcommand{\rightaddress}[1]{% + \par\medskip + {\raggedleft \begin{tabular}{l}\ignorespaces + #1 + \end{tabular} + \medskip\par}\noindent\ignorespaces% +} +% \end{macrocode} +% \descCom{shorttoday} +% Prints the short form (YY/MM/DD) of the current date (|\today|). +% \begin{macrocode} +\newcounter{shortyear} +\setcounter{shortyear}{\the\year} +\addtocounter{shortyear}{-1900} +\whiledo{\theshortyear>99}{\addtocounter{shortyear}{-100}} +\newcommand{\shorttoday} + {\two@digits{\theshortyear}/\the\month/\the\day\xspace} +% \end{macrocode} +% \descEnv{dialog} +% An environment for dialogues and screenplay-like scenes. +% Use the |\newspeaker| command to make the persons you want to +% use in the dialogues. +% \begin{macrocode} +\newenvironment{dialog} + {\begin{flexlist}[\normalfont\emph{:}]{i} + \setlength{\itemsep}{0ex}} + {\end{flexlist}} +\makeatletter +% \end{macrocode} +% \descCom{newspeaker\arg{command-name}\arg{speaker's-name}} +% Produces the command \rarg{command-name} to mark the speeches of +% \rarg{speaker's-name} in a dialogue. \rarg{command-name} must begin +% with a backslash, like all commands.\\ +% Then the command \rarg{command-name} may be called in a |dialog| +% environment as follows:\\ +% |command-name\oarg{optional-explanation}\arg{speech-contribution}| +% \begin{macrocode} +\newcommand{\newspeaker}[2]{\newcommand{#1}[2][] + {\item[\normalfont\emph{#2\ifthenelse{\equal{##1}{}} + {}{ (##1)}}] ##2}} +% \end{macrocode} +% \descCom{enge\arg{English text}\arg{German text}} +% Prints \arg{English text}. With the |german| option, \rarg{German text} +% is printed instead. +% \begin{macrocode} +\newcommand{\enge}[2]{#1} +% \end{macrocode} +% Some language specific texts. +% \begin{macrocode} +\newcommand{\versiontext}{Version date:} +\newcommand{\onlinetext}{Online:} +\newcommand{\accesstext}{Access date:} +\newcommand{\cftext}{cf.} +\newcommand{\bibvoltext}{of} +\newcommand{\bvtext}{vol.} +\newcommand{\bibdir}{Director } +\newcommand{\bibmovtext}{Movie} +\newcommand{\bibactorsbefore}{With} +\newcommand{\bibactorsafter}{et~al} +\newcommand{\noyear}{n.d.} +\newcommand{\noaddress}{n.p.} +\newcommand{\otherabstractname}{Zusammenfassung} +\newcommand{\keywordsname}{Keywords} +% \end{macrocode} +% \subsubsection{The palatino option} +% \begin{macrocode} +\if@palatino + \RequirePackage{palatino} + \RequirePackage{mathpple} +\fi +% \end{macrocode} +% \subsubsection{The ding option} +% \begin{macrocode} +\if@ding + \RequirePackage{pifont} +% \end{macrocode} +% \descCom{tick} +% Prints a tick. +% \begin{macrocode} + \newcommand{\tick}{\ding{52}} +% \end{macrocode} +% \descCom{cross} +% Prints a cross. +% \begin{macrocode} + \newcommand{\cross}{\ding{56}} +% \end{macrocode} +% \descCom{checkbox} +% Prints a checkbox. +% \begin{macrocode} + \newcommand{\checkbox}{\ding{114}} +% \end{macrocode} +% \descEnv{ticklist} +% A item environment which uses a tick as label +% (e.g. for lists of do's). +% \begin{macrocode} + \newenvironment{ticklist} + {\begin{dinglist}{52}}{\end{dinglist}} +% \end{macrocode} +% \descEnv{crosslist} +% A item environment which uses a cross as label +% (e.g. for lists of don't). +% \begin{macrocode} + \newenvironment{crosslist} + {\begin{dinglist}{56}}{\end{dinglist}} +% \end{macrocode} +% \descEnv{checklist} +% A item environment which uses a checkbox as label +% (e.g. for check lists). +% \begin{macrocode} + \newenvironment{checklist} + {\begin{dinglist}{114}}{\end{dinglist}} +\fi +% \end{macrocode} +% \subsubsection{The euro option} +% \descCom{E} +% Prints the Euro symbol \E. +% \descCom{Es\arg{value}} +% Prints the Euro symbol followed by \rarg{value}. +% \begin{macrocode} +\if@euro + \RequirePackage[right,notextcomp]{eurofont} + \newcommand{\E}{\textsf{\makefakelighteuro}\xspace} + \newcommand{\Es}[1]{\E\nobreak\,#1} +\fi +% \end{macrocode} +% \subsubsection{The fancyref option} +% Loads the |fancyref| package which provides the command +% |\fref|\arg{prefix:labelname}. This prints not only the number, but also +% the type of a reference. The following prefixes (types) are recognized: +% |chap| (Chapter), +% |sec| (Section), +% |eq| (Equation), +% |fig| (Figure), +% |tab| (Table), +% |enum| (Enumeration), +% |fn| (Footnote). +% At the beginning of a sentence use |\Fref| instead, which gives upper-case +% output (in German documents there is no difference). +% \begin{macrocode} +\if@fancyref + \RequirePackage{fancyref} +\fi +% \end{macrocode} +% \descCom{see\arg{reference}} +% Prints \q{see \rarg{reference}} in a footnote, using the |\fref| command +% to print \rarg{reference}. +% \begin{macrocode} +\newcommand{\seetext}{see} +\newcommand{\see}[1]{\footnote{\seetext\ \fref{#1}}} +% \end{macrocode} +% \subsubsection{The html option} +% \descCom{htlink\arg{linked text}\arg{url}} +% Prints \rarg{linked text} followed by the \rarg{url}. With the |paper| +% option, a footnote is used. In the HTML version +% \rarg{linked text} becomes an active link to \rarg{url}. +% \descCom{hturl\arg{url}} +% Prints \rarg{url} nice and makes it an active link in the +% HTML version. +% \descCom{htmail\arg{mail-adress}} +% Prints \rarg{mail-adress} nice and makes it an active email link in the +% HTML version. +% \begin{macrocode} +\if@html +%</class> +%<*hcletter> + \newcounter{part} + \newcounter{section} + \newcounter{subsection} + \newcounter{subsubsection} + \newcounter{paragraph} + \newcommand{\part}{} + \newcommand{\section}{} + \newcommand{\subsection}{} + \newcommand{\subsubsection}{} + \newcommand{\paragraph}{} + \newcommand{\subparagraph}{} + \RequirePackage{html} + \newcommand{\htlink}[2] + {{\htmladdnormallink{#1 \texttt{<#2>}}{#2}}} +%</hcletter> +%<*hcart|hcreport|hcslides> + \RequirePackage{html} + \if@paper + \newcommand{\htlink}[2] + {\htmladdnormallink{#1}{#2}% + \footnote{\htmladdnormallink{\texttt{#2}}{#2}}} + \else + \newcommand{\htlink}[2] + {{\htmladdnormallink{#1 \texttt{<#2>}}{#2}}} + \fi +%</hcart|hcreport|hcslides> +%<*class> + \newcommand{\hturl}[1] + {{\htmladdnormallink{\texttt{#1}}{#1}}} + \newcommand{\htmail}[1] + {{\htmladdnormallink{\texttt{#1}}{mailto:#1}}} +\fi +%</class> +% \end{macrocode} +% \subsection{Commands and Environments for the hcart and hcreport classes} +% The default depth of section numbering and table of contents is three. +% |headings| is the default page style. The page number is printed in the +% header line, the footer line is empty. +% \begin{macrocode} +%<*hcart|hcreport> +\setcounter{secnumdepth}{3} +\setcounter{tocdepth}{3} +\RequirePackage[breakwords]{truncate} +\newlength{\rightmarklength} +\def\ps@headings{\let\@mkboth\markboth + \def\@evenhead{\vbox{\hsize=\textwidth + \hb@xt@ \textwidth{% + {\pnumfont\thepage\hfil\headfont\truncate{0.92\textwidth}% + {\raggedleft\strut\leftmark}}}% + \if@hsl \vskip 1.5\p@ \hrule \fi}} + \def\@oddhead{\settowidth{\rightmarklength}{\rightmark}% + \vbox{\hsize=\textwidth + \hb@xt@ \textwidth{{\headfont\truncate{0.92\textwidth}% + {\strut\ifthenelse{\lengthtest{\rightmarklength=0em}}% + {\leftmark{}}{\rightmark{}}% + \hfil}\hfil\pnumfont\thepage}}% + \if@hsl \vskip 1.5\p@ \hrule \fi}} + \def\@evenfoot{\vbox{\hsize=\textwidth + \if@fsl \hrule \vskip 3\p@ \fi + \hb@xt@ \textwidth{{\pnumfont\hfil}}}}% + \def\@oddfoot{\vbox{\hsize=\textwidth + \if@fsl \hrule \vskip 3\p@ \fi + \hb@xt@ \textwidth{{\pnumfont\hfil}}}}% +%<hcreport> \def\chaptermark##1{% +%<hcreport> \markboth {\ifnum \c@secnumdepth >\m@ne +%<hcreport> \chaptermarkformat\fi +%<hcreport> ##1}{}}% +%<hcreport> \def\sectionmark##1{% +%<hcreport> \markright {\ifnum \c@secnumdepth >\z@ +%<hcreport> \sectionmarkformat\fi +%<hcreport> ##1}}} +%<hcart> \def\sectionmark##1{% +%<hcart> \markboth {\ifnum \c@secnumdepth >\z@% +%<hcart> \sectionmarkformat\fi ##1}{}} +%<hcart> \def\subsectionmark##1{% +%<hcart> \markright {\ifnum \c@secnumdepth >\@ne% +%<hcart> \subsectionmarkformat\fi ##1}}} +\pagestyle{headings} +% \end{macrocode} +% \subsubsection{The hcarea option} +% \begin{macrocode} +\if@hcarea + \RequirePackage{typearea} + \areaset[15mm]{150mm}{240mm} +\fi +% \end{macrocode} +% \subsubsection{The hcfootnotes option} +% \begin{macrocode} +\if@hcfootnotes + \deffootnote{1em}{0.5em} + {\textsuperscript{\normalfont\thefootnotemark}\,} +\fi +% \end{macrocode} +% \subsubsection{The magazine option} +% \descCom{articletitle\arg{title}} +% Prints the article \rarg{title}. +% \descCom{subjecttitle\arg{subject}\arg{title}} +% Prints before the article \rarg{title} the \rarg{subject} in a smaller font. +% \descCom{titlesubject\arg{title}\arg{subject}} +% Prints after the article \rarg{title} the \rarg{subject} in a smaller font. +% \descCom{articlesection\arg{heading}} +% Prints a heading within an article (actually, a |\subsection*|). +% \descEnv[\oarg{signature}\arg{title}]{art} +% A magazine article set in two columns with a \rarg{title} (using +% |\articletitle|) and an optional \rarg{signature} (using |\sig|). +% Requires the |multicol| package. +% \descEnv[\oarg{signature}\arg{subject}\arg{title}]{artsubtit} +% Like the |art| environment, but uses |\subjecttitle| instead of +% |\articletitle|. +% \descEnv[\oarg{signature}\arg{title}\arg{subject}]{arttitsub} +% Like the |art| environment, but uses |\titlesubject| instead of +% |\articletitle|. +% \begin{macrocode} +\if@magazine + \RequirePackage{multicol} + \newcommand{\articletitle}[1] + {\addsec[#1]{\LARGE #1}} + \newcommand{\subjecttitle}[2] + {\addsec[#2]{{\large #1}\\{\LARGE #2}}} + \newcommand{\titlesubject}[2] + {\addsec[#1]{{\LARGE #1}\\{\large #2}}} + \newcommand{\articlesection}[1]{\subsection*{#1}} + \newcommand{\currentsig}{} + \newenvironment{@art}[2][]{% + \begin{multicols}{2}[#2] + \renewcommand{\currentsig}{#1}% + }{% + \ifthenelse{\equal{\currentsig}{}} + {} + {\sig{\currentsig}} + \end{multicols}% + } + \newenvironment{art}[2][] + {\begin{@art}[#1]{\articletitle{#2}}}{\end{@art}} + \newenvironment{artsubtit}[3][] + {\begin{@art}[#1]{\subjecttitle{#2}{#3}}}{\end{@art}} + \newenvironment{arttitsub}[3][] + {\begin{@art}[#1]{\titlesubject{#2}{#3}}}{\end{@art}} +\fi +% \end{macrocode} +% \subsubsection{The parskip option} +% \begin{macrocode} +\if@parskip + \setlength\parskip{\medskipamount} + \setlength\parindent{0pt} +\fi +% \end{macrocode} +% \subsubsection{The wide option} +% \begin{macrocode} +\if@wide + \linespread{1.3} +\fi +%</hcart|hcreport> +% \end{macrocode} +% \subsection{Commands and Environments for the hcart, hcreport and +% hcslides classes} +% \subsubsection{The bib option} +% With the |fnbib| option (default), the |\cite| and |\citet| and |\cite| +% commands all work the same. +% +% With the |autbib| option, |\cite| always works like |\citep|, +% i.\,e. puts the citation in brackets. +% Use |\citet| if you do not want this. +% +% Commands like |\cite| should always be used \emph{without} a space between +% them and the preceeding text. +% \begin{macrocode} +%<class>\newcommand{\bibliostyle}{hc-en} +%<*hcart|hcreport|hcslides> +\if@bib +\if@fnbib + \bibpunct[, ]{}{}{;}{a}{}{,} + \renewcommand\NAT@cite% + [3]{\footnote{\ifNAT@swa\NAT@@open\if*#2*\else#2\ \fi + #1\if*#3*\else\NAT@cmt#3\fi\NAT@@close\else#1\fi}\endgroup} + \let\@cite\NAT@cite +\fi +\if@autbib + \bibpunct[, ]{ [}{]}{;}{a}{}{,} + \let\cite\citep +\fi +\if@numbib + \bibpunct[, ]{ [}{]}{;}{n}{}{,} +\fi +% \end{macrocode} +% \descCom{cfcite\oarg{pages}\arg{source}} +% Shortcut for |\cite|\oarg{\cftext}\oarg{pages}\arg{source}. +% \begin{macrocode} +\newcommand{\cfcite}[2][]{\cite[\cftext][#1]{#2}} +% \end{macrocode} +% \descCom{biblio\oarg{style}\arg{bib files}} +% Writes the bibliography. \rarg{bib files} is a comma-separated list +% of bib files, \rarg{style} the \BibTeX\ style file (by default +% |hc-en| for English documents). +% \begin{macrocode} +%<hcart|hcslides>\if@paper +%<hcart|hcslides> \newcommand{\beforebiblio}{\newpage} +%<hcart|hcslides>\else +%<hcart|hcslides> \newcommand{\beforebiblio}{\vfill} +%<hcart|hcslides>\fi +\newcommand{\biblio}[2][\bibliostyle]{% +%<hcart|hcslides> \beforebiblio + \bibliographystyle{#1} + \bibliography{#2}% +} +% \end{macrocode} +% \descCom{qu\oarg{pages}\arg{source}\arg{quotation}} +% A \rarg{quotation} in quotes followed by the reference {[}\rarg{source}, +% \rarg{pages}{]}. +% \begin{macrocode} +\newcommand{\qu}[3][]{\q{#3}\cite[#1]{#2}} +% \end{macrocode} +% \descCom{qul\oarg{pages}\arg{source}\arg{quotation}} +% Like |\qu| but inside a |quote| environment (for longer quotions). +% \begin{macrocode} +\newcommand{\qul}[3][]{\begin{quote} + \qu[#1]{#2}{#3} + \end{quote}} +% \end{macrocode} +% \descCom{biburl\arg{url}\arg{access date}} +% \rarg{url} and \rarg{access date} of online documents. +% For online-only documents use a \textsc{manual} entry with |\biburl| +% in the \textsc{organization} field. +% For other documents put it in the \textsc{note} field. +% \begin{macrocode} + \if@htmlbib + \newcommand{\biburl}[2]{\onlinetext\\ + {\small\hturl{#1}}\\\accesstext\ #2} + \else + \newcommand{\biburl}[2]{\onlinetext\\ + {\small\texttt{#1}}\\\accesstext\ #2} + \fi +% \end{macrocode} +% \descCom{bibdiv} +% Separator between the title and subtitle of a document. +% \begin{macrocode} + \newcommand{\bibdiv}{. } +% \end{macrocode} +% \descCom{bibvol\oarg{separating word}\arg{volume number}\arg{serial title}} +% Use at the end of the \textsc{title} field (without space before) +% if the output of the \textsc{volume} and \textsc{series} fields +% is not convincing. Interesting +% especially for German documents where \q{der} instead of \q{von} +% is used as \rarg{separating word} (English: \q{of}). +% \begin{macrocode} + \newcommand{\bibvol}[3][\bibvoltext] + {\emph{, \bvtext~#2 #1} #3} +% \end{macrocode} +% \descCom{addrdiv} +% Separator between different places in a \BibTeX\ entry's +% \textsc{address} field. +% \begin{macrocode} + \newcommand{\addrdiv}{ -- } +% \end{macrocode} +% \descCom{etal\oarg{year}} +% Ends a list (e.\,g. of places in a \BibTeX\ entry's \textsc{address} field) +% which is not complete \mbox{(\q{\etal})}. A \rarg{year} can be given which +% is printed afterwards. +% \begin{macrocode} +\newcommand{\etal}[1][]{ et~al% + \ifthenelse{\equal{#1}{}}{}{. #1}% +} +% \end{macrocode} +% \descCom{noyear\comdiv noaddress} +% Use in the \textsc{year} resp. \textsc{address} field of a \BibTeX\ entry +% when no year resp. address is known. +% \minisec{The following commands are for movie databases +% (use \textsc{manual} entry):} +% \descCom{bibdir} +% Give the director in the \textsc{author} field in the following way:\\ +% |Surname, \bibdir, Christian Name| +% \descCom{bibmov\arg{country}\arg{studio}\arg{main actors}} +% Put in the \textsc{organization} field. +% \begin{macrocode} + \newcommand{\bibmov}[3]{\bibmovtext\bibdiv\ #2, #1\bibdiv\ + \bibactorsbefore\ #3 \bibactorsafter} +\fi +% \end{macrocode} +% \subsubsection{The pdf option} +% \begin{macrocode} +\newcommand{\hypertitle}{} +\newcommand{\hyperauthor}{} +\newcommand{\hyperabstract}{} +\newcommand{\hyperkeywords}{} +\if@pdf + \AtEndOfClass{\RequirePackage[hyperindex,colorlinks=true, + pdftex,latex2html,extension=pdf]{hyperref}} + \AtBeginDocument{% + \let\oldautdiv\autdiv + \renewcommand{\autdiv}{, } + \ifthenelse{\equal{\hypertitle}{}} + {\renewcommand{\hypertitle}{\currenttitle}}{} + \ifthenelse{\equal{\hyperauthor}{}} + {\renewcommand{\hyperauthor}{\currentauthor}}{} + \ifthenelse{\equal{\hyperabstract}{}} + {\renewcommand{\hyperabstract}{\abstext}}{} + \ifthenelse{\equal{\hyperkeywords}{}} + {\renewcommand{\hyperkeywords}{\keywordstext}}{} + \pdfinfo{ + /Title (\hypertitle) + /Author (\hyperauthor) + /Subject (\hyperabstract) + /Keywords (\hyperkeywords) + } + \let\autdiv\oldautdiv + } +\fi +%</hcart|hcreport|hcslides> +% \end{macrocode} +% \subsubsection{Title commands} +% \descCom{toc} +% Puts the table of contents at the end of the current page (i.e. after +% a vertical fill and before a pagebreak). +% With the |paper| option the table of contents is generated automatically, +% so |\toc| does nothing at all. +% \begin{macrocode} +%<*hcart|hcslides> +\if@paper + \newcommand{\@toc}{% + \newpage +%<hcart> \thispagestyle{empty} +%<hcslides> \slidepagestyle{HC} +%<hcart> \if@wide \linespread{1} \fi + \tableofcontents +%<hcart> \if@wide \linespread{1.3} \fi + \newpage% + } + \newcommand{\toc}{} +\else + \newcommand{\@toc}{% + \vfill +%<hcart> \thispagestyle{empty} +%<hcslides> \slidepagestyle{HC} +%<hcart> \if@wide \linespread{1} \fi + \tableofcontents +%<hcart> \if@wide \linespread{1.3} \fi + \newpage% + } + \newcommand{\toc}{\@toc} +\fi +%</hcart|hcslides> +%<*hcreport> +\newcommand{\@toc}{ + \if@wide \linespread{1} \fi + \tableofcontents + \if@wide \linespread{1.3} \fi + \thispagestyle{empty} +} +\if@paper + \newcommand{\toc}{} +\else + \newcommand{\toc}{\@toc} +\fi +%</hcreport> +% \end{macrocode} +% \descCom{titsubinfo\arg{main title}\arg{sub title}\arg{more info}\comdiv +% titsub\arg{main title}\arg{sub title}\comdiv +% titinfo\arg{main title}\arg{more info} +% } +% They should be used in the premable -- +% call |\tit[ver]| or |\titaut[ver]| in the document body. +% Use if your document has a main title and a sub title and/or you want to +% give additional information. Leave +% the \rarg{title} parameter of |\tit|\texttt{\qdots} empty. +% \rarg{more info} is printed below the \rarg{(sub) title} +% in a small font. +% \begin{macrocode} +%<*hcart|hcreport|hcslides> +\if@paper + \newcommand{\titsubinfo}[3]{ + \renewcommand{\defaulttitle}{% + #1\vfill + {\Large #2\vfill} + \vfill {\normalsize #3\vfill}% + } + \renewcommand{\currenttitle}{#1}% + } + \newcommand{\titsub}[2]{ + \renewcommand{\defaulttitle}{% + #1\vfill + {\Large #2\vfill\vfill}% + } + \renewcommand{\currenttitle}{#1}% + } + \newcommand{\titinfo}[2]{ + \renewcommand{\defaulttitle}{% + #1\vfill + \vfill {\normalsize #2\vfill}% + } + \renewcommand{\currenttitle}{#1}% + } +\else + \newcommand{\titsubinfo}[3]{ + \renewcommand{\defaulttitle}{#1\\[0.8ex] + {\Large #2\\[0.8ex]} + {\normalsize #3\\}% + } + \renewcommand{\currenttitle}{#1}% + } + \newcommand{\titsub}[2]{ + \renewcommand{\defaulttitle}{#1\\[0.8ex] + {\Large #2\\[0.8ex]}% + } + \renewcommand{\currenttitle}{#1}% + } + \newcommand{\titinfo}[2]{ + \renewcommand{\defaulttitle}{#1\\[0.8ex] + {\normalsize #2\\}% + } + \renewcommand{\currenttitle}{#1}% + } +\fi +% \end{macrocode} +% \descCom{autinfo\arg{author}\arg{address}\arg{email}\arg{homepage}} +% Should be used in the premable -- +% call |\tit|, |\titaut| or |\titautver| in the document body. +% Specifies information about the author (name, address, mail-address and +% homepage). Use |\autdiv| resp. |\autinfodiv| instead of |\\|. +% \begin{macrocode} +\newcommand{\autinfo}[4]{% + \renewcommand{\defaultauthor}{#1} + \renewcommand{\defaultaddress}{#2} + \renewcommand{\defaultemail}{#3} + \renewcommand{\defaulthomepage}{#4} + \renewcommand{\currentauthor}{#1} +} +% \end{macrocode} +% \descCom{abs\oarg{other-language abstract}\arg{abstract}} +% Should be used in the premable -- +% call |\tit|, |\titaut| or |\titautver| in the document body. +% Prints an abstract text. Optionally an additional abstract in another +% language is printed below. The title of the other-language abstract +% may be changed by redefining |\otherabstractname|. By default +% \q{\otherabstractname} is used (German). +% \begin{macrocode} +\newcommand{\abstext}{} +\newcommand{\otherabstext}{} +\newcommand{\abs}[2][]{% + \renewcommand{\otherabstext}{#1} + \renewcommand{\abstext}{#2} +} +% \end{macrocode} +% \descCom{keywords\arg{keywords}} +% Should be used in the premable -- +% call |\tit|, |\titaut| or |\titautver| in the document body. +% Prints a list of keywords. +% \begin{macrocode} +\newcommand{\keywordstext}{} +\newcommand{\keywords}[1]{% + \renewcommand{\keywordstext}{#1} +} +% \end{macrocode} +% \descCom{hyperinfo\arg{title}\arg{author}\arg{abstract}\arg{keywords}} +% An alternative way to specify document information for the PDF version. +% Use when the default document information extracted from +% |\tit[sub][info]|, |\autinfo|, +% |\abs| and |\keywords| does not work as it should. +% If one of the parameters is left empty the default information +% is used instead. +% Do not use any formatting or special commands. +% Must be used in the premable. Without the |pdf| option this command +% is ignored. +% \begin{macrocode} +\if@pdf + \newcommand{\hyperinfo}[4]{ + \renewcommand{\hypertitle}{#1} + \renewcommand{\hyperauthor}{#2} + \renewcommand{\hyperabstract}{#3} + \renewcommand{\hyperkeywords}{#4} + } +\else + \newcommand{\hyperinfo}[4]{} +\fi +% \end{macrocode} +% \descCom{titaut\oarg{date}\arg{title}\arg{author}} +% Replacement for: +% |\title|\arg{title} +% |\author|\arg{author} +% |\date|\arg{date} +% |\maketitle|\\ +% Default date is |\today|. With the |paper| option, a titlepage and +% a table of contents are generated. +% \begin{macrocode} +\if@paper + \newcommand{\titaut}[3][\today]{% +%<hcart|hcreport> \if@wide \linespread{1} \fi +%<hcslides> \slidepagestyle{empty}\setcounter{slide}{0} + \ifthenelse{\equal{#2}{}} + {} + {\renewcommand{\defaulttitle}{#2} + \renewcommand{\currenttitle}{#2}} + \title{\normalfont\huge \defaulttitle \vfill} + \ifthenelse{\equal{#3}{}} + {} + {\renewcommand{\defaultauthor}{#3} + \renewcommand{\currentauthor}{#3}} + \author{\normalfont\Large \defaultauthor\\[0.8ex] + \normalfont\normalsize \defaultaddress\\[0.4ex] + \normalfont\normalsize + \htmladdnormallink{\defaultemail}{mailto:\defaultemail}\\[-1ex] + \normalfont\normalsize + \htmladdnormallink{\defaulthomepage}{\defaulthomepage} +} + \date{\vfill\vfill \normalfont\normalsize #1} +%<hcreport> \lowertitleback{% +%<hcreport> \ifthenelse{\equal{\otherabstext}{}}{}% +%<hcreport> {\minisec{\centering\abstractname} +%<hcreport> \abstext}% +%<hcreport> \ifthenelse{\equal{\otherabstext}{}}{}% +%<hcreport> {\minisec{\centering\otherabstractname} +%<hcreport> \otherabstext}% +%<hcreport> \ifthenelse{\equal{\keywordstext}{}}{}% +%<hcreport> {\minisec{\centering\keywordsname} +%<hcreport> \cen{\keywordstext}}% +%<hcreport> } + \maketitle + \ifthenelse{\isundefined{\currentdate}} + {\newcommand{\currentdate}{#1}}{} +%<hcart|hcslides> \setcounter{page}{0} +%<hcart|hcslides> \thispagestyle{empty} +%<hcart|hcslides> \ifthenelse{\equal{\abstext}{}}{% +%<hcart|hcslides> \ifthenelse{\equal{\keywordstext}{}}{}{ +%<hcart|hcslides> \vfill\vfill +%<hcart|hcslides> \minisec{\centering\keywordsname} +%<hcart|hcslides> \cen{\keywordstext}} +%<hcart|hcslides> }{% +%<hcart|hcslides> \vfill\vfill +%<hcart|hcslides> \minisec{\centering\abstractname} +%<hcart|hcslides> \abstext +%<hcart|hcslides> \ifthenelse{\equal{\otherabstext}{}}{} +%<hcart|hcslides> {\minisec{\centering\otherabstractname} +%<hcart|hcslides> \otherabstext} +%<hcart|hcslides> \ifthenelse{\equal{\keywordstext}{}}{} +%<hcart|hcslides> {\minisec{\centering\keywordsname} +%<hcart|hcslides> \cen{\keywordstext}} +%<hcart|hcslides> } + \setcounter{page}{0} + \thispagestyle{empty} + \@toc% +%<hcart|hcreport> \if@wide \linespread{1.3} \fi +%<hcslides> \slidepagestyle{HC}% + } +\else + \newcommand{\titaut}[3][\today]{% +%<hcart|hcreport> \if@wide \linespread{1} \fi +%<hcslides> \slidepagestyle{empty}\setcounter{slide}{0} + \ifthenelse{\equal{#2}{}} + {} + {\renewcommand{\defaulttitle}{#2} + \renewcommand{\currenttitle}{#2}} + \title{\normalfont\huge \defaulttitle} + \ifthenelse{\equal{#3}{}} + {} + {\renewcommand{\defaultauthor}{#3} + \renewcommand{\currentauthor}{#3}} + \author{\normalfont\Large \defaultauthor} + \date{\normalfont\normalsize #1} +%<hcreport> \lowertitleback{% +%<hcreport> \ifthenelse{\equal{\otherabstext}{}}{}% +%<hcreport> {\minisec{\centering\abstractname} +%<hcreport> \abstext}% +%<hcreport> \ifthenelse{\equal{\otherabstext}{}}{}% +%<hcreport> {\minisec{\centering\otherabstractname} +%<hcreport> \otherabstext}% +%<hcreport> \ifthenelse{\equal{\keywordstext}{}}{}% +%<hcreport> {\minisec{\centering\keywordsname} +%<hcreport> \cen{\keywordstext}}% +%<hcreport> } + \maketitle + \ifthenelse{\isundefined{\currentdate}} + {\newcommand{\currentdate}{#1}}{} +%<hcart|hcslides> \setcounter{page}{0} +%<hcart|hcslides> \thispagestyle{empty} +%<hcart|hcslides> \ifthenelse{\equal{\abstext}{}}{}{ +%<hcart|hcslides> \minisec{\centering\abstractname} +%<hcart|hcslides> \abstext +%<hcart|hcslides> \ifthenelse{\equal{\otherabstext}{}}{} +%<hcart|hcslides> {\minisec{\centering\otherabstractname} +%<hcart|hcslides> \otherabstext} +%<hcart|hcslides> } +%<hcart|hcslides> \ifthenelse{\equal{\keywordstext}{}}{} +%<hcart|hcslides> {\minisec{\centering\keywordsname} +%<hcart|hcslides> \cen{\keywordstext}} + \setcounter{page}{0} + \thispagestyle{empty}% +%<hcart|hcreport> \if@wide \linespread{1.3} \fi +%<hcslides> \newpage\slidepagestyle{HC}% + } +\fi +% \end{macrocode} +% \descCom{tit\oarg{date}\arg{title}} +% Calls |\titaut| with the default author information. +% \begin{macrocode} +\newcommand{\tit}[2][\today]{\titaut[#1]{#2}{}} +% \end{macrocode} +% \descCom{titautver\oarg{version +% date}\arg{title}\arg{author}\arg{general date}} +% Prints a general date (e.g. of first release) and a version date +% (default: |\today|). +% \begin{macrocode} +\newcommand{\titautver}[4][\today]{ + \newcommand{\currentdate}{#1}% + \titaut[#4\\\versiontext\ #1]{#2}{#3} +} +% \end{macrocode} +% \descCom{titver\oarg{version date}\arg{title}\arg{general date}} +% Calls |\titautver| with the default author information. +% \begin{macrocode} +\newcommand{\titver}[3][\today]{\titautver[#1]{#2}{}{#3}} +% \end{macrocode} +% \subsubsection{Sectioning Commands} +% \descCom{fictionsec} +% A sectioning command producing just a number, no text -- useful e.g. +% for fiction without section headings. +% When a new |\section| starts the counter is reset. +% \begin{macrocode} +\newcounter{fictionsec}[section] +\newcommand{\fictionsec}{\addtocounter{fictionsec}{1}% + \subsection*{\centering\thefictionsec}} +%</hcart|hcreport|hcslides> +% \end{macrocode} +% \subsection{Commands and Environments for the hcart class} +% A |\part| command starts a new page. +% \begin{macrocode} +%<*hcart> +\renewcommand\part{\clearpage + \@afterindentfalse + \secdef\@part\@spart} +%</hcart> +% \end{macrocode} +% \subsection{Settings for the hcletter class} +% No fold marks are printed. +% \begin{macrocode} +%<*hcletter> +\foldmarksoff +%</hcletter> +% \end{macrocode} +% \subsection{Commands and Environments for the hcreport class} +% The first page of a chapter and the title page of a part do not +% have a page number. +% \begin{macrocode} +%<*hcreport> +\renewcommand\chapter + {\if@openright\cleardoublepage\else\clearpage\fi + \thispagestyle{empty}% + \global\@topnum\z@ + \@afterindentfalse + \secdef\@chapter\@schapter} +\renewcommand\addchap + {\if@openright\cleardoublepage\else\clearpage\fi + \thispagestyle{empty}% + \global\@topnum\z@ + \@afterindentfalse + \secdef\@addchap\@saddchap} +\renewcommand\part + {\if@openright\cleardoublepage\else\clearpage\fi + \thispagestyle{empty}% + \if@twocolumn + \onecolumn + \@tempswatrue + \else + \@tempswafalse + \fi + \null\vfil + \secdef\@part\@spart} +%</hcreport> +% \end{macrocode} +% \subsection{Commands and Environments for the hcslides class} +% A new page is started by a section or manually with the |\newslide| +% command. +% +% Everything is printed sans serif. +% The |HC| pagestyle is always used. +% The |fancybox| package is required for drawing an shadowed box around +% sections. +% \descCom{addsec\oarg{toc-entry}\arg{heading}} +% For compatibily with the |hcart| and |hcreport| classes. +% Should always be used instead of the |\section*| command. +% \descCom{minisec\arg{heading}} +% For compatibily with the |hcart| and |hcreport| classes. +% Sectioning level between |\subsubsection| and |\paragraph|. +% \begin{macrocode} +%<*hcslides> +\AtBeginDocument{\begin{slide}} +\AtEndDocument{\end{slide}} +\renewcommand{\rmdefault}{\sfdefault} +\raggedslides[5em] +\newcommand{\addsec}[2][]{% + \section*{#2} + \ifthenelse{\equal{#1}{}} + {\addcontentsline{toc}{section}{#2}} + {\addcontentsline{toc}{section}{#1}}% +} +\newcommand\minisec[1]{\@afterindentfalse \vskip 1.5ex + {\parindent \z@ \raggedright\sffamily\bfseries #1\par\nobreak}% + \@afterheading} +\setlength{\slideheight}{0.74\paperwidth} +\setlength{\slidewidth}{0.84\paperheight} +\renewcommand{\slidetopmargin}{0.12\paperwidth} +\renewcommand{\slidebottommargin}{0.12\paperwidth} +\renewcommand{\slideleftmargin}{0.08\paperheight} +\renewcommand{\sliderightmargin}{0.08\paperheight} +\slideframe{none} +\AtBeginDocument{ + \ifthenelse{\equal{\defaultemail}{}} + {\newcommand{\@email}{}} + {\newcommand{\@email} + { \texttt{<}\htmail{\defaultemail}\texttt{>}}} + \newpagestyle{HC}% + {\parbox[b]{\textwidth}% + {\currenttitle\hfill\currentdate\\[-.6ex]% + \rule{\textwidth}{0.6pt}}} + {\parbox[t]{\textwidth}{\rule{\textwidth}{0.6pt}\\[.6ex]% + \renewcommand{\autdiv}{, }% + \currentauthor\@email\hfill\thepage}} + \pagestyle{HC} +} +\RequirePackage{fancybox} +\setcounter{tocdepth}{3} +\renewcommand\section{\@startsection {section}{1}{\z@}% + {-3.5ex \@plus -1ex \@minus -.2ex}% + {2.3ex \@plus.2ex}% + {\newslide\normalfont\Large\bfseries\shadowbox}} +\renewcommand\part{\clearpage + \if@twocolumn + \onecolumn + \@tempswatrue + \else + \@tempswafalse + \fi + \secdef\@part\@spart} +% \end{macrocode} +% \subsubsection{The twotoc option} +% \begin{macrocode} +\if@twotoc + \RequirePackage{multicol} + \renewcommand*\tableofcontents{% + \newlength{\old@columnseprule} + \setlength{\old@columnseprule}{\columnseprule} + \setlength{\columnseprule}{0.4pt} + \begin{multicols}{2}[\section*{\contentsname}] + \@starttoc{toc}% + \end{multicols} + \setlength{\columnseprule}{\old@columnseprule} + } +\fi +%</hcslides> +% \end{macrocode} +% \section{German Language Definitions} +% The |babel| package is loaded with the new German orthograpy (option +% |ngerman|: this requires a rather new version of |babel|). The commands +% |\q|, |\hq|, |\dash|, |\Es| and |\shorttoday| +% are adapted to the German typography. The |\enge| command is redefined. +% The German \BibTeX\ style |hc-de| is used by default. +% The language specific texts are redefined. The German redefinitions of the +% |varioref| package do not seem to work, so the are repeated. +% \begin{macrocode} +%<*german> +\addto{\captionsngerman}{% + \renewcommand{\nextstartq}{\guillemotright} + \renewcommand{\nextendq}{\guillemotleft} + \renewcommand{\otherstartq}{\guilsinglright} + \renewcommand{\otherendq}{\guilsinglleft} + \renewcommand{\hq}[1]{\guilsinglright{}#1\guilsinglleft{}} + \renewcommand{\fq}[1]{\guillemotright{}#1\guillemotleft{}} + \renewcommand{\dash}[1]{--~#1~--} + \renewcommand{\shorttoday} + {\the\day.\the\month.\two@digits{\theshortyear}\xspace} + \renewcommand{\enge}[2]{#2} + \renewcommand{\bibliostyle}{hc-de} + \renewcommand{\contentsname}{Inhalt} + \renewcommand{\versiontext}{Version vom} + \renewcommand{\accesstext}{Zugriff am} + \renewcommand{\cftext}{vgl.} + \renewcommand{\bibvoltext}{der} + \renewcommand{\bvtext}{Bd.} + \renewcommand{\bibdir}{Regie } + \renewcommand{\bibmovtext}{Spielfilm} + \renewcommand{\bibactorsbefore}{Mit} + \renewcommand{\bibactorsafter}{u.a} + \renewcommand{\noyear}{o.J.} + \renewcommand{\noaddress}{o.O.} + \renewcommand{\otherabstractname}{Abstract} + \renewcommand{\keywordsname}{Schl\"usselw\"orter} + \renewcommand{\seetext}{siehe} +} +\if@euro + \addto{\captionsngerman}{% + \renewcommand{\Es}[1]{#1\nobreak\,\E} + } +\fi +\if@fancyref + \def\reftextfaceafter {auf der n\"achsten Seite}% + \def\reftextfacebefore{auf der vorherigen Seite}% + \let\reftextafter \reftextfaceafter + \let\reftextbefore \reftextfacebefore + \def\reftextcurrent {auf dieser Seite}% + \def\reftextfaraway#1{auf Seite~\pageref{#1}}% + \def\reftextpagerange#1#2{auf + Seiten~\pageref{#1}--\pageref{#2}}% + \def\reftextlabelrange#1#2{\ref{#1} bis~\ref{#2}}% +\fi +%</german> +% \end{macrocode} +% +% \StopEventually +% \Finale +% +\endinput +% +% End of File `hc.dtx' diff --git a/macros/latex/contrib/hc/hc.ins b/macros/latex/contrib/hc/hc.ins new file mode 100644 index 0000000000..e42973756c --- /dev/null +++ b/macros/latex/contrib/hc/hc.ins @@ -0,0 +1,61 @@ +%% +%% This file will generate fast loadable files from the dtx files in this +%% bundle when run through LaTeX or TeX. +%% +%% Copyright (C) 1998--2000 Christian Siefkes <error@cs.tu-berlin.de> +%% +%% Updates are available via http://tal.cs.tu-berlin.de/error/TeX/ +%% +%% This file is part of the HC Bundle for LaTeX2e. +%% ----------------------------------------------- +%% +%% This file is free software; you can redistribute it and/or modify +%% it under the terms of the GNU Library General Public License as +%% published by the Free Software Foundation; either version 2 of the +%% License, or (at your option) any later version. +%% +%% This document is distributed in the hope that it will be useful, but +%% WITHOUT ANY WARRANTY; without even the implied warranty of +%% MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU +%% General Public License for more details. +%% +%% You should have received a copy of the GNU General Public License +%% along with this program; see the file COPYING. If not, write to +%% the Free Software Foundation, Inc., 59 Temple Place - Suite 330, +%% Boston, MA 02111-1307, USA. +%% +%% --------------- start of docstrip commands ------------------ +%% +\input docstrip +\askforoverwritefalse + +\preamble +\endpreamble + +\generate{\file{hcart.cls}{\from{hc.dtx}{class,hcart}} + \file{hcletter.cls}{\from{hc.dtx}{class,hcletter}} + \file{hcreport.cls}{\from{hc.dtx}{class,hcreport}} + \file{hcslides.cls}{\from{hc.dtx}{class,hcslides}} + \file{german.hld}{\from{hc.dtx}{german}} + } + +\Msg{***********************************************************} +\Msg{*} +\Msg{* To finish the installation you have to move the following} +\Msg{* files into a directory searched by TeX:} +\Msg{*} +\Msg{* \space\space hcart.cls} +\Msg{* \space\space hcletter.cls} +\Msg{* \space\space hcreport.cls} +\Msg{* \space\space hcslides.cls} +\Msg{* \space\space german.hld} +\Msg{*} +\Msg{* To produce the implementation-documentation run the file} +\Msg{* `hc.dtx' through LaTeX after moving the files.} +\Msg{*} +\Msg{* Happy TeXing} +\Msg{***********************************************************} + + +\ReportTotals +\endbatchfile diff --git a/macros/latex/contrib/hc/hc.ps b/macros/latex/contrib/hc/hc.ps new file mode 100644 index 0000000000..989d0ef53b --- /dev/null +++ b/macros/latex/contrib/hc/hc.ps @@ -0,0 +1,2135 @@ +%!PS-Adobe-2.0 +%%Creator: dvips(k) 5.86 Copyright 1999 Radical Eye Software +%%Title: hc.dvi +%%Pages: 36 +%%PageOrder: Ascend +%%BoundingBox: 0 0 596 842 +%%DocumentFonts: Palatino-Roman EURM10 Helvetica-Bold Courier +%%+ Courier-Oblique Helvetica Palatino-Italic +%%EndComments +%DVIPSWebPage: (www.radicaleye.com) +%DVIPSCommandLine: dvips hc +%DVIPSParameters: dpi=600, compressed +%DVIPSSource: TeX output 2000.03.23:1259 +%%BeginProcSet: texc.pro +%! +/TeXDict 300 dict def TeXDict begin/N{def}def/B{bind def}N/S{exch}N/X{S +N}B/A{dup}B/TR{translate}N/isls false N/vsize 11 72 mul N/hsize 8.5 72 +mul N/landplus90{false}def/@rigin{isls{[0 landplus90{1 -1}{-1 1}ifelse 0 +0 0]concat}if 72 Resolution div 72 VResolution div neg scale isls{ +landplus90{VResolution 72 div vsize mul 0 exch}{Resolution -72 div hsize +mul 0}ifelse TR}if Resolution VResolution vsize -72 div 1 add mul TR[ +matrix currentmatrix{A A round sub abs 0.00001 lt{round}if}forall round +exch round exch]setmatrix}N/@landscape{/isls true N}B/@manualfeed{ +statusdict/manualfeed true put}B/@copies{/#copies X}B/FMat[1 0 0 -1 0 0] +N/FBB[0 0 0 0]N/nn 0 N/IEn 0 N/ctr 0 N/df-tail{/nn 8 dict N nn begin +/FontType 3 N/FontMatrix fntrx N/FontBBox FBB N string/base X array +/BitMaps X/BuildChar{CharBuilder}N/Encoding IEn N end A{/foo setfont}2 +array copy cvx N load 0 nn put/ctr 0 N[}B/sf 0 N/df{/sf 1 N/fntrx FMat N +df-tail}B/dfs{div/sf X/fntrx[sf 0 0 sf neg 0 0]N df-tail}B/E{pop nn A +definefont setfont}B/Cw{Cd A length 5 sub get}B/Ch{Cd A length 4 sub get +}B/Cx{128 Cd A length 3 sub get sub}B/Cy{Cd A length 2 sub get 127 sub} +B/Cdx{Cd A length 1 sub get}B/Ci{Cd A type/stringtype ne{ctr get/ctr ctr +1 add N}if}B/id 0 N/rw 0 N/rc 0 N/gp 0 N/cp 0 N/G 0 N/CharBuilder{save 3 +1 roll S A/base get 2 index get S/BitMaps get S get/Cd X pop/ctr 0 N Cdx +0 Cx Cy Ch sub Cx Cw add Cy setcachedevice Cw Ch true[1 0 0 -1 -.1 Cx +sub Cy .1 sub]/id Ci N/rw Cw 7 add 8 idiv string N/rc 0 N/gp 0 N/cp 0 N{ +rc 0 ne{rc 1 sub/rc X rw}{G}ifelse}imagemask restore}B/G{{id gp get/gp +gp 1 add N A 18 mod S 18 idiv pl S get exec}loop}B/adv{cp add/cp X}B +/chg{rw cp id gp 4 index getinterval putinterval A gp add/gp X adv}B/nd{ +/cp 0 N rw exit}B/lsh{rw cp 2 copy get A 0 eq{pop 1}{A 255 eq{pop 254}{ +A A add 255 and S 1 and or}ifelse}ifelse put 1 adv}B/rsh{rw cp 2 copy +get A 0 eq{pop 128}{A 255 eq{pop 127}{A 2 idiv S 128 and or}ifelse} +ifelse put 1 adv}B/clr{rw cp 2 index string putinterval adv}B/set{rw cp +fillstr 0 4 index getinterval putinterval adv}B/fillstr 18 string 0 1 17 +{2 copy 255 put pop}for N/pl[{adv 1 chg}{adv 1 chg nd}{1 add chg}{1 add +chg nd}{adv lsh}{adv lsh nd}{adv rsh}{adv rsh nd}{1 add adv}{/rc X nd}{ +1 add set}{1 add clr}{adv 2 chg}{adv 2 chg nd}{pop nd}]A{bind pop} +forall N/D{/cc X A type/stringtype ne{]}if nn/base get cc ctr put nn +/BitMaps get S ctr S sf 1 ne{A A length 1 sub A 2 index S get sf div put +}if put/ctr ctr 1 add N}B/I{cc 1 add D}B/bop{userdict/bop-hook known{ +bop-hook}if/SI save N @rigin 0 0 moveto/V matrix currentmatrix A 1 get A +mul exch 0 get A mul add .99 lt{/QV}{/RV}ifelse load def pop pop}N/eop{ +SI restore userdict/eop-hook known{eop-hook}if showpage}N/@start{ +userdict/start-hook known{start-hook}if pop/VResolution X/Resolution X +1000 div/DVImag X/IEn 256 array N 2 string 0 1 255{IEn S A 360 add 36 4 +index cvrs cvn put}for pop 65781.76 div/vsize X 65781.76 div/hsize X}N +/p{show}N/RMat[1 0 0 -1 0 0]N/BDot 260 string N/Rx 0 N/Ry 0 N/V{}B/RV/v{ +/Ry X/Rx X V}B statusdict begin/product where{pop false[(Display)(NeXT) +(LaserWriter 16/600)]{A length product length le{A length product exch 0 +exch getinterval eq{pop true exit}if}{pop}ifelse}forall}{false}ifelse +end{{gsave TR -.1 .1 TR 1 1 scale Rx Ry false RMat{BDot}imagemask +grestore}}{{gsave TR -.1 .1 TR Rx Ry scale 1 1 false RMat{BDot} +imagemask grestore}}ifelse B/QV{gsave newpath transform round exch round +exch itransform moveto Rx 0 rlineto 0 Ry neg rlineto Rx neg 0 rlineto +fill grestore}B/a{moveto}B/delta 0 N/tail{A/delta X 0 rmoveto}B/M{S p +delta add tail}B/b{S p tail}B/c{-4 M}B/d{-3 M}B/e{-2 M}B/f{-1 M}B/g{0 M} +B/h{1 M}B/i{2 M}B/j{3 M}B/k{4 M}B/w{0 rmoveto}B/l{p -4 w}B/m{p -3 w}B/n{ +p -2 w}B/o{p -1 w}B/q{p 1 w}B/r{p 2 w}B/s{p 3 w}B/t{p 4 w}B/x{0 S +rmoveto}B/y{3 2 roll p a}B/bos{/SS save N}B/eos{SS restore}B end + +%%EndProcSet +%%BeginProcSet: 8r.enc +% @@psencodingfile@{ +% author = "S. Rahtz, P. MacKay, Alan Jeffrey, B. Horn, K. Berry", +% version = "0.6", +% date = "1 July 1998", +% filename = "8r.enc", +% email = "tex-fonts@@tug.org", +% docstring = "Encoding for TrueType or Type 1 fonts +% to be used with TeX." +% @} +% +% Idea is to have all the characters normally included in Type 1 fonts +% available for typesetting. This is effectively the characters in Adobe +% Standard Encoding + ISO Latin 1 + extra characters from Lucida. +% +% Character code assignments were made as follows: +% +% (1) the Windows ANSI characters are almost all in their Windows ANSI +% positions, because some Windows users cannot easily reencode the +% fonts, and it makes no difference on other systems. The only Windows +% ANSI characters not available are those that make no sense for +% typesetting -- rubout (127 decimal), nobreakspace (160), softhyphen +% (173). quotesingle and grave are moved just because it's such an +% irritation not having them in TeX positions. +% +% (2) Remaining characters are assigned arbitrarily to the lower part +% of the range, avoiding 0, 10 and 13 in case we meet dumb software. +% +% (3) Y&Y Lucida Bright includes some extra text characters; in the +% hopes that other PostScript fonts, perhaps created for public +% consumption, will include them, they are included starting at 0x12. +% +% (4) Remaining positions left undefined are for use in (hopefully) +% upward-compatible revisions, if someday more characters are generally +% available. +% +% (5) hyphen appears twice for compatibility with both +% ASCII and Windows. +% +/TeXBase1Encoding [ +% 0x00 (encoded characters from Adobe Standard not in Windows 3.1) + /.notdef /dotaccent /fi /fl + /fraction /hungarumlaut /Lslash /lslash + /ogonek /ring /.notdef + /breve /minus /.notdef +% These are the only two remaining unencoded characters, so may as +% well include them. + /Zcaron /zcaron +% 0x10 + /caron /dotlessi +% (unusual TeX characters available in, e.g., Lucida Bright) + /dotlessj /ff /ffi /ffl + /.notdef /.notdef /.notdef /.notdef + /.notdef /.notdef /.notdef /.notdef + % very contentious; it's so painful not having quoteleft and quoteright + % at 96 and 145 that we move the things normally found there to here. + /grave /quotesingle +% 0x20 (ASCII begins) + /space /exclam /quotedbl /numbersign + /dollar /percent /ampersand /quoteright + /parenleft /parenright /asterisk /plus /comma /hyphen /period /slash +% 0x30 + /zero /one /two /three /four /five /six /seven + /eight /nine /colon /semicolon /less /equal /greater /question +% 0x40 + /at /A /B /C /D /E /F /G /H /I /J /K /L /M /N /O +% 0x50 + /P /Q /R /S /T /U /V /W + /X /Y /Z /bracketleft /backslash /bracketright /asciicircum /underscore +% 0x60 + /quoteleft /a /b /c /d /e /f /g /h /i /j /k /l /m /n /o +% 0x70 + /p /q /r /s /t /u /v /w + /x /y /z /braceleft /bar /braceright /asciitilde + /.notdef % rubout; ASCII ends +% 0x80 + /.notdef /.notdef /quotesinglbase /florin + /quotedblbase /ellipsis /dagger /daggerdbl + /circumflex /perthousand /Scaron /guilsinglleft + /OE /.notdef /.notdef /.notdef +% 0x90 + /.notdef /.notdef /.notdef /quotedblleft + /quotedblright /bullet /endash /emdash + /tilde /trademark /scaron /guilsinglright + /oe /.notdef /.notdef /Ydieresis +% 0xA0 + /.notdef % nobreakspace + /exclamdown /cent /sterling + /currency /yen /brokenbar /section + /dieresis /copyright /ordfeminine /guillemotleft + /logicalnot + /hyphen % Y&Y (also at 45); Windows' softhyphen + /registered + /macron +% 0xD0 + /degree /plusminus /twosuperior /threesuperior + /acute /mu /paragraph /periodcentered + /cedilla /onesuperior /ordmasculine /guillemotright + /onequarter /onehalf /threequarters /questiondown +% 0xC0 + /Agrave /Aacute /Acircumflex /Atilde /Adieresis /Aring /AE /Ccedilla + /Egrave /Eacute /Ecircumflex /Edieresis + /Igrave /Iacute /Icircumflex /Idieresis +% 0xD0 + /Eth /Ntilde /Ograve /Oacute + /Ocircumflex /Otilde /Odieresis /multiply + /Oslash /Ugrave /Uacute /Ucircumflex + /Udieresis /Yacute /Thorn /germandbls +% 0xE0 + /agrave /aacute /acircumflex /atilde + /adieresis /aring /ae /ccedilla + /egrave /eacute /ecircumflex /edieresis + /igrave /iacute /icircumflex /idieresis +% 0xF0 + /eth /ntilde /ograve /oacute + /ocircumflex /otilde /odieresis /divide + /oslash /ugrave /uacute /ucircumflex + /udieresis /yacute /thorn /ydieresis +] def + +%%EndProcSet +%%BeginProcSet: texps.pro +%! +TeXDict begin/rf{findfont dup length 1 add dict begin{1 index/FID ne 2 +index/UniqueID ne and{def}{pop pop}ifelse}forall[1 index 0 6 -1 roll +exec 0 exch 5 -1 roll VResolution Resolution div mul neg 0 0]/Metrics +exch def dict begin Encoding{exch dup type/integertype ne{pop pop 1 sub +dup 0 le{pop}{[}ifelse}{FontMatrix 0 get div Metrics 0 get div def} +ifelse}forall Metrics/Metrics currentdict end def[2 index currentdict +end definefont 3 -1 roll makefont/setfont cvx]cvx def}def/ObliqueSlant{ +dup sin S cos div neg}B/SlantFont{4 index mul add}def/ExtendFont{3 -1 +roll mul exch}def/ReEncodeFont{CharStrings rcheck{/Encoding false def +dup[exch{dup CharStrings exch known not{pop/.notdef/Encoding true def} +if}forall Encoding{]exch pop}{cleartomark}ifelse}if/Encoding exch def} +def end + +%%EndProcSet +%%BeginFont: EURM10 +%!PS-AdobeFont-1.1: EURM10 2.1 +%%CreationDate: 1992 Nov 20 17:36:34 + +% Euler fonts were designed by Hermann Zapf. +% Copyright (C) 1997 American Mathematical Society. All Rights Reserved. + +11 dict begin +/FontInfo 7 dict dup begin +/version (2.1) readonly def +/Notice (Copyright (C) 1997 American Mathematical Society. All Rights Reserved) readonly def +/FullName (EURM10) readonly def +/FamilyName (Euler) readonly def +/Weight (Medium) readonly def +/ItalicAngle 0 def +/isFixedPitch false def +end readonly def +/FontName /EURM10 def +/PaintType 0 def +/FontType 1 def +/FontMatrix [0.001 0 0 0.001 0 0] readonly def +/Encoding 256 array +0 1 255 {1 index exch /.notdef put} for +dup 34 /epsilon put +readonly def +/FontBBox{-32 -206 1060 722}readonly def +/UniqueXX 5031984 def +currentdict end +currentfile eexec +80347982ab3942d930e069a70d0d48311d7190fa2d133a583138f76695558e7a +e9348d37cac6651806d08527c1bb4a062a4835ac37784cc39ad8841404e438b4 +d52d3901e47a1de4f7924e0fb3daf442499175bab1226edf692a4956739f8828 +e80592f450c5d5c22ac88bcfbe9748f61d18243a16f4a4467f084e8e2be46ef4 +7fc51c3a8199e3cda62ff9c4fb73956dab8b6683d2156377808cb35026073e80 +523f59a30d195fcf9b9fce4ffafc6f33457e3200f33e9a53d3b289d794ea7c8e +a770ca5e9f22b46f1b98c218de1bcbbb7c566ea09d85d7856b7378cdacfbcc06 +c5c63aa0627d66bd2c4847c2d9ada8f1ab19d3b7c7f44fe613435eacab83f263 +c50555650f08f2cf4584351eab971f1a387972569a838fb1908025b2285b3ef3 +43b700540d6871ae7d9feb5b7508d8a89fb2628159973e3a4ac98fe412fd2a93 +8d61971f2c443407a5eca894167af5165ef7c77dd5898a0f8fbc9fc39c0faad5 +546cec837fedd342680832c1b548417c22a296a4db0b1b1153227e37a56c08ef +ca95e32f396983552dc62ad81dc858d6e56c2ff0047d6a8dc024eab31fcf0b8b +7d36f12ce4d803fe6cf9a85472ec1927214e3648cfee51f00c068d926c3ecbe7 +54c0564da6c761916f6bb57dda086ba03d9b14372407452aa245cbb5b57039e5 +cd94d07fca3ea67b3e0671c24641e2ea7b1c9b7771f7131557e5891ba5969b22 +552ba300929cb58ef762905ea011b68c6436d838686efb675e1b2b836a46156a +1517ddc57b8a5d74bbfb5aa8426d23825e7f94b7e0e35511aeb1932766eff425 +13423666185e95a8b13ccd4e4866dd93d75c047a984924f5680a20a89c4910b3 +239fd6ea36fc9a8ded8b6c9e5d09284a54c0cee0468bbdec736c6f4e3c518c3f +83ddac1a3c97ad34537f27bb12bd797e7193fa8c5eb083ad0b2bc382092b54b8 +a5ba12d35295155a723d4dd2005e873b7b46da55924b771a5590a4d6bdb195af +347801090b2786bcb8ae3f94157080264774763b4c832b87a9c9dee25cbb8860 +2c92402c43a66388c6596e7f628b0f8f4c05d9fa435c65f3fc2f853eec6b45c8 +48166a05287a085a247e4d927532d74a2fbdc4eddafd4c9d32ce6ee266a877a6 +7cbc1407ac3d4d5749d9bafdd0d7b73587695caaa25293b9c93a759a977e1e7f +1019c4e1721fbf3347034e0c88c4442968cdaea4b05d928a193ae2c882103666 +ed7103d55d77c20b87b821982a80f1f5f707136e3a1715c4803aa6393d154c45 +67660dfd6e6ff62d6685ca4e9f63dd3398f0b6de404baecb45611037642a21e8 +62cfce3fa70ef9068794677aee3318d067e0637784d0c627ce2aabfdb79fae38 +b3b8c855ca931a4e8d650369378323f92db3255d1ae0d8995290d94e17aa1c36 +5a8e45920735e74dd992735d5e23991e05cb2f5389456bb66b04a74740d2ec59 +4de51f0d02c3060231147c0f0ad316b678aa0650d8267c8de11e7ac3a57370a8 +344fdbcabd503e21843838d773dee2e172534616ad5b3bca06478fdae4196c70 +519dab8c929fc45e855f1b53c30793e6038ac09dde4cf804fea44c812c865fb2 +94a6613739b7d66c9f9e024a899c83964624d47b3a54ab4bc156cb4b0da5f5ec +bf45fdadb41c8c4c808965e2799228c939ec258520007fd5561c970cb68d09ad +3be8cabd09a514fb31589c1c +0000000000000000000000000000000000000000000000000000000000000000 +0000000000000000000000000000000000000000000000000000000000000000 +0000000000000000000000000000000000000000000000000000000000000000 +0000000000000000000000000000000000000000000000000000000000000000 +0000000000000000000000000000000000000000000000000000000000000000 +0000000000000000000000000000000000000000000000000000000000000000 +0000000000000000000000000000000000000000000000000000000000000000 +0000000000000000000000000000000000000000000000000000000000000000 +cleartomark + +%%EndFont +TeXDict begin 39158280 55380996 1000 600 600 (hc.dvi) +@start /Fa 170[53 6[53 61 44 10[53 65[{TeXBase1Encoding ReEncodeFont}5 +72.7272 /Helvetica-Bold rf /Fb 134[51 1[71 51 56 30 51 +35 1[56 56 56 81 25 2[25 56 56 30 51 56 51 56 51 12[56 +25[30 13[25 2[30 30 40[{TeXBase1Encoding ReEncodeFont}26 +90.9091 /Helvetica-Bold rf /Fc 165[49 49 2[53 57 45 38 +49 2[57 60 69 44 2[25 61 55 1[44 56 1[44 57 65[{ +TeXBase1Encoding ReEncodeFont}18 72.7272 /Palatino-Roman +rf /Fd 188[66 67[{TeXBase1Encoding ReEncodeFont}1 90.9091 +/Helvetica rf /Fe 130[55 1[55 1[55 55 55 55 55 55 55 +55 55 55 55 55 55 55 55 55 55 55 55 55 55 55 55 55 55 +3[55 55 55 6[55 55 4[55 5[55 1[55 55 1[55 17[55 2[55 +55 55 1[55 42[{TeXBase1Encoding ReEncodeFont}42 90.9091 +/Courier rf /Ff 137[66 73 40 66 47 1[73 73 73 106 33 +2[33 73 73 40 66 73 66 1[66 13[80 3[93 7[93 1[80 1[86 +10[66 66 66 66 66 66 66 66 2[33 1[33 41[73 2[{ +TeXBase1Encoding ReEncodeFont}34 119.552 /Helvetica-Bold +rf /Fg 134[45 45 66 45 51 30 35 35 42 45 40 51 71 25 +40 25 25 45 45 25 35 45 37 42 40 25[66 1[56 10[23 11[23 +30 3[30 30 25 36[48 2[{TeXBase1Encoding ReEncodeFont}34 +90.9091 /Palatino-Italic rf /Fh 105[45 1[45 45 24[45 +51 47 76 51 55 30 39 36 51 55 50 53 80 26 51 21 26 53 +51 30 44 56 40 50 45 25 2[30 1[30 61 61 61 91 66 71 56 +48 61 1[55 71 76 86 56 2[31 76 69 51 56 70 64 56 71 1[40 +55 1[55 23 23 4[45 45 1[45 45 45 55 23 30 23 2[30 30 +25 1[76 33[55 55 2[{TeXBase1Encoding ReEncodeFont}75 +90.9091 /Palatino-Roman rf +%DVIPSBitmapFont: Fi cmmi10 11.4098 1 +/Fi 1 62 df<166016F01501A216E01503A216C01507A21680150FA216005DA2151E153E +A25DA2157815F8A25D1401A25D1403A25D1407A25D140FA292C7FC5CA2143EA2143C147C +A2147814F8A25C1301A25C1303A25C1307A2495AA291C8FC5BA2131E133EA2133C137CA2 +137813F8A25B1201A25B1203A2485AA25B120FA290C9FC5AA2121E123EA2123C127CA212 +7812F8A25A1260245F7BC62F>61 D E +%EndDVIPSBitmapFont +/Fk 129[55 55 55 55 55 55 55 55 55 55 55 55 55 55 55 +55 55 55 55 55 55 55 55 55 55 55 55 55 55 55 55 2[55 +55 55 55 2[55 55 55 55 55 55 1[55 55 55 55 55 55 55 55 +55 55 55 55 55 55 55 55 55 1[55 55 55 55 55 55 55 55 +55 55 55 55 55 55 55 55 55 55 55 1[55 55 55 55 1[55 1[55 +55 34[{TeXBase1Encoding ReEncodeFont}84 90.9091 /Courier-Oblique +rf +%DVIPSBitmapFont: Fl cmss10 10.95 15 +/Fl 15 117 df<EB0FF890B5FC00031480000F14E04814F0A29038F00FF890388003FC38 +1E0001001814FE00101300C812FF157FA7EC7FFF010FB5FC137F48B6FC120748EBF07F38 +3FFC0013C048C7FC12FE5AA315FF7E5C387F8007EBE01F6CB6FCA26C147F6C13FC6C13F0 +000190C7FC202B7CA92C>97 D<49B47E010F13F0013F13FC4913FF90B612805A481300D8 +07FCEB1F00D80FF0130748487F4990C7FC123F5B127F90C9FCA312FEAA127FA36C7EA26C +6C14406DEB01C06C6C13036C6C131F01FF13FF6C90B5FC7E6C6C14806DEBFE00010F13F0 +01011380222B7DA928>99 D<ED07F0B3A4EB07F8EB3FFF4913C748B512F74814FF5A1480 +390FFC003FD81FF0131F49130F48481307A2485A90C7FCA312FEAA127FA37F003F140F7F +6C6C131F6D133F6C6C137F9038FF01FF6C90B5FC6C14F76C14E76C148790383FFE07D90F +F0C7FC24407DBE2F>I<EB03F8EB1FFF017F13C090B57E488048803807FE07390FF801FC +9038E000FE4848137E003F143E49133F90C77E5A127EED0F80B7FCA600FCC9FCA37E127E +A2127FA26C7EA26C7E6D14806C6C1303D807FC131F01FF13FF6C90B5FC7E6C6C14006D13 +FC010F13E0010190C7FC212B7DA928>I<D903FC133F90390FFF03FF013F13DF4990B512 +8090B7FC5A9026FE07FCC7FC3803F80148486C7E49137EA248487FA86C6C137EA26D13FE +6C6C485A3901FE07F848B5FC5D485C5D01CF90C8FC380FC3FC0180C9FC7FA212077F90B5 +12F06C14FF16C048814815F85A3A3FE0001FFCD87F80EB03FE90C712016F7E00FE81A56C +5D6C6C495A6D1303D83FF0EB0FFCD81FFEEB7FF86CB65A6C5D6C5DC692C7FC011F13F801 +0313C0293D7EA82D>103 D<12FEB3A449B4FC010713C0011F13F0017F13F890B512FCB6 +FC9038F80FFEEBE003EBC00190388000FFA290C7127FA35AB3A9203F79BE2F>I<12FFA8 +1200AF127FB3B3A4083F7ABE16>I<12FEB3B3B3A9073F79BE16>108 +D<26FC01FFECFF800107D9C00313E0011FD9F00F13F8017FD9F83F7F90B56C487F00FD92 +B5FC3CFFF80FFFFC07FFD9E003EBF001496C497E496C49EB7F80A290C76C48133FA34892 +C7FCB3A9392979A848>I<38FC01FF010713C0011F13F0017F13F890B512FC12FD39FFF8 +0FFEEBE003EBC00190388000FFA290C7127FA35AB3A9202979A82F>I<EB01FE90380FFF +C0013F13F0497F90B57E000314FF14033A07F8007F804848EB3FC04848EB1FE049130F48 +48EB07F0A290C712034815F8A2007E140100FE15FCA96C14036C15F8A36C6CEB07F06D13 +0FA26C6CEB1FE06C6CEB3FC001FC13FF2607FF0313806C90B512006C5C6C5C013F13F001 +0F13C0D901FEC7FC262B7DA92D>I<14FFD8FE0713E0011F7F017F7FB67E819038F80FFF +EBE003D98000138090C7EA7FC0153F5AED1FE0A2150FA216F01507A8150F16E0A2151FA2 +ED3FC06C147F6DEBFF805CD9E00313009038F81FFE90B55A485C6D5B6D5B010F1380D901 +FEC7FC90C9FCB1243B79A82F>I<00FC137CEB03FC130F131F133F137FEBFFC038FDFE00 +EAFFF85B5B5BA25BA290C7FCA25AB3A6162979A81F>114 D<EB1FF890B51280000314E0 +4814F85A5A393FE00FF0EB8000007F143090C8FCA57F6C7E13F06CB4FC14F06C13FE6C7F +000114C06C14E0011F13F013019038001FF81407EC03FCA21401A3124012700078EB03F8 +007E130738FFE01F90B512F015E06C14C0001F14800003EBFE0038003FF01E2B7EA923> +I<13FCACB612C0A6D800FCC7FCB3A86D132015E0EB7F03ECFFF0A27F15C06D1300EB07F0 +1C357EB321>I E +%EndDVIPSBitmapFont +%DVIPSBitmapFont: Fm cmsy10 11.4098 6 +/Fm 6 107 df<0060163000F016786C16F86C1501007EED03F06CED07E06C6CEC0FC06C +6CEC1F806C6CEC3F006C6C147E6C6C5C6C6C495A017E495A6D495A6D6C485A6D6C485A6D +6C48C7FC903803F07E6D6C5A903800FDF8EC7FF06E5A6E5AA24A7E4A7EECFDF8903801F8 +FC903803F07E49487E49486C7E49486C7E49486C7E017E6D7E496D7E48486D7E4848147E +4848804848EC1F804848EC0FC048C8EA07E0007EED03F048ED01F8481500481678006016 +302D2E72AE4A>2 D<EB01E0A2805CA60070EC038000F8EC07C000FE141F00FF143FD87F +81EB7F803A1FE1C1FE003907F0C3F83901F8C7E039007EDF80D91FFEC7FCEB07F8EB01E0 +EB07F8EB1FFE90387EDF803901F8C7E03907F0C3F8391FE1C1FE3A7F81E07F80D8FF01EB +3FC000FE141F00F814070070EC0380000091C7FCA6805CA222297AAB2F>I<190761A286 +1907A286190386A2737EA2737E1A781A7C868687747E747E747EF201FCF2007F007FBC12 +C0BD12F0A26C1BC0CEEA7F00F201FCF203F0505A505A505A98C7FC1A3E621A781AF84F5A +A24F5AA262190762A2190F97C8FCA28554327BB05F>33 D<1418143C147CA2147814F8A2 +EB01F0A214E01303A2EB07C0A21480130FA2EB1F00A2131E133EA25BA2137813F8A2485A +A25B1203A2485AA25B120FA248C7FCA2121E123EA25AA2127812F8A41278127CA27EA212 +1E121FA26C7EA212077FA26C7EA212017FA26C7EA21378137CA27FA2131E131FA2EB0F80 +A2130714C0A2EB03E0A2130114F0A2EB00F8A21478147CA2143C1418165E77C625>104 +D<126012F07EA21278127CA27EA2121E121FA26C7EA212077FA26C7EA212017FA26C7EA2 +1378137CA27FA2131E131FA2EB0F80A2130714C0A2EB03E0A2130114F0A2EB00F8A21478 +147CA4147814F8A2EB01F0A214E01303A2EB07C0A21480130FA2EB1F00A2131E133EA25B +A2137813F8A2485AA25B1203A2485AA25B120FA248C7FCA2121E123EA25AA2127812F8A2 +5A1260165E7BC625>I<126012F0B3B3B3B3B3A31260045F75C61A>I +E +%EndDVIPSBitmapFont +/Fn 139[60 60 60 1[60 60 60 60 60 2[60 3[60 60 60 1[60 +97[{TeXBase1Encoding ReEncodeFont}13 99.6264 /Courier +rf /Fo 221[48 34[{ .167 SlantFont }1 99.6264 /EURM10 +rf /Fp 190[52 65[{TeXBase1Encoding ReEncodeFont}1 66.4176 +/Palatino-Roman rf /Fq 137[56 60 32 42 39 1[60 54 58 +88 29 2[29 58 55 33 48 61 44 1[50 17[78 2[61 4[76 1[61 +77 71 10[50 2[50 50 50 50 50 2[25 1[25 41[60 2[{ +.167 SlantFont TeXBase1Encoding ReEncodeFont}33 99.6264 +/Palatino-Roman rf /Fr 133[50 55 1[78 55 61 33 55 39 +1[61 61 61 89 28 55 1[28 61 61 33 55 61 55 61 55 12[61 +66 3[78 2[61 2[28 1[78 1[66 72 72 8[33 55 55 2[55 55 +55 55 55 2[28 43[61 2[{TeXBase1Encoding ReEncodeFont}42 +99.6264 /Helvetica-Bold rf /Fs 137[80 88 48 80 56 1[88 +88 88 128 3[40 1[88 1[80 88 80 1[80 17[112 2[88 2[40 +1[112 1[96 104 104 14[80 80 80 80 46[88 2[{ +TeXBase1Encoding ReEncodeFont}27 143.462 /Helvetica-Bold +rf /Ft 27[50 77[50 27[50 55 1[83 56 60 32 42 39 1[60 +54 58 88 29 55 1[29 58 55 33 48 61 44 55 50 8[66 2[78 +61 52 67 2[78 1[94 61 72 2[83 76 55 61 1[71 61 1[74 4[25 +25 50 50 50 50 50 50 50 50 50 50 60 25 33 25 41[60 2[{ +TeXBase1Encoding ReEncodeFont}58 99.6264 /Palatino-Roman +rf /Fu 139[47 61 57 3[83 2[80 1[42 83 1[48 69 3[72 13[75 +15[102 67[{TeXBase1Encoding ReEncodeFont}12 143.462 /Palatino-Roman +rf /Fv 221[100 34[{ .167 SlantFont }1 206.559 /EURM10 +rf /Fw 190[134 65[{TeXBase1Encoding ReEncodeFont}1 172.188 +/Palatino-Roman rf /Fx 137[117 125 2[82 2[113 120 1[60 +3[120 1[69 99 126 11[138 3[127 7[126 3[172 2[126 1[146 +126 10[103 4[103 103 103 1[52 46[{TeXBase1Encoding ReEncodeFont}22 +206.559 /Palatino-Roman rf end +%%EndProlog +%%BeginSetup +%%Feature: *Resolution 600dpi +TeXDict begin +%%PaperSize: A4 + +%%EndSetup +%%Page: 0 1 +0 0 bop 629 718 a Fx(The)51 b(HC)h(Bundle)g(for)f(L)2471 +695 y Fw(A)2574 718 y Fx(T)2667 767 y(E)2766 718 y(X)31 +b(2)3025 749 y Fv(")1641 968 y Fx(v1.07)1347 2260 y Fu(Christian)k +(Siefkes)1236 2496 y Ft(T)-9 b(echnische)25 b(Universit\344t)h(Berlin) +1614 2612 y(Sekr)-7 b(.)25 b(FR)g(6\2262)1191 2727 y(Franklinstr)-7 +b(.)27 b(28/29,)d(10587)g(Berlin)1420 2928 y(err)n(or@cs.tu-berlin.de) +1164 3044 y(http://tal.cs.tu-berlin.de/err)n(or/)1621 +5199 y(2000/03/23)p eop +%%Page: 1 2 +1 1 bop 109 275 a Fs(Contents)109 503 y Fr(1)94 b(Intr)n(oduction)2759 +b(2)109 723 y(2)94 b(Options)2962 b(2)258 843 y Ft(2.1)104 +b(General)25 b(Options)41 b(.)50 b(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)g +(.)f(.)h(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.) +f(.)h(.)156 b(2)258 964 y(2.2)104 b(Options)26 b(for)g(the)f(hcart)h +(and)f(hcr)n(eport)h(classes)56 b(.)50 b(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.) +g(.)f(.)h(.)g(.)f(.)h(.)156 b(4)258 1084 y(2.3)104 b(Options)26 +b(for)g(the)f(hcart,)h(hcr)n(eport)h(and)d(hcletter)i(classes)49 +b(.)g(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)156 b(6)258 1205 +y(2.4)104 b(Options)26 b(for)g(the)f(hcart,)h(hcr)n(eport)h(and)d +(hcslides)h(classes)i(.)49 b(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)156 +b(6)258 1325 y(2.5)104 b(Options)26 b(for)g(the)f(hcr)n(eport)i(class) +65 b(.)50 b(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)g +(.)f(.)h(.)g(.)f(.)h(.)156 b(8)258 1445 y(2.6)104 b(Options)26 +b(for)g(the)f(hcslides)h(class)85 b(.)50 b(.)g(.)f(.)h(.)g(.)f(.)h(.)g +(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)156 +b(8)258 1566 y(2.7)104 b(Other)26 b(Options)59 b(.)49 +b(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)g +(.)f(.)h(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)156 +b(8)109 1786 y Fr(3)94 b(Commands)27 b(and)h(En)l(vir)n(onments)1906 +b(9)258 1906 y Ft(3.1)104 b(Con\002guration)73 b(.)49 +b(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)g +(.)f(.)h(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)156 +b(9)258 2026 y(3.2)104 b(General)25 b(Commands)g(and)f(Envir)n(onments) +89 b(.)50 b(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.) +112 b(1)-5 b(1)487 2147 y(3.2.1)119 b(The)25 b(palatino)g(option)31 +b(.)49 b(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.) +g(.)g(.)f(.)h(.)g(.)f(.)h(.)106 b(16)487 2267 y(3.2.2)119 +b(The)25 b(ding)g(option)40 b(.)50 b(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.) +f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)106 +b(16)487 2388 y(3.2.3)119 b(The)25 b(eur)n(o)g(option)44 +b(.)50 b(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.) +f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)106 b(17)487 2508 +y(3.2.4)119 b(The)25 b(fancyr)n(ef)h(option)34 b(.)49 +b(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)g +(.)f(.)h(.)g(.)f(.)h(.)106 b(17)487 2628 y(3.2.5)119 +b(The)25 b(html)g(option)36 b(.)50 b(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.) +f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)106 +b(17)258 2749 y(3.3)e(Commands)25 b(and)g(Envir)n(onments)h(for)g(the)f +(hcart)h(and)e(hcr)n(eport)j(classes)h(.)50 b(.)106 b(18)487 +2869 y(3.3.1)119 b(The)25 b(hcar)n(ea)g(option)31 b(.)50 +b(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g +(.)g(.)f(.)h(.)g(.)f(.)h(.)106 b(19)487 2990 y(3.3.2)119 +b(The)25 b(hcfootnotes)i(option)k(.)50 b(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.) +g(.)f(.)h(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)106 +b(19)487 3110 y(3.3.3)119 b(The)25 b(magazine)f(option)40 +b(.)50 b(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.) +g(.)f(.)h(.)g(.)f(.)h(.)106 b(20)487 3230 y(3.3.4)119 +b(The)25 b(parskip)g(option)58 b(.)49 b(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h +(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)106 +b(21)487 3351 y(3.3.5)119 b(The)25 b(wide)f(option)98 +b(.)50 b(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.) +h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)106 b(21)258 3471 y(3.4)e(Commands)25 +b(and)f(Envir)n(onments)j(for)e(the)g(hcart,)h(hcr)n(eport)g(and)f +(hcslides)487 3591 y(classes)97 b(.)49 b(.)h(.)g(.)g(.)f(.)h(.)g(.)g(.) +f(.)h(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f +(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)106 b(21)487 3712 +y(3.4.1)119 b(The)25 b(bib)g(option)30 b(.)49 b(.)h(.)g(.)f(.)h(.)g(.)g +(.)f(.)h(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.) +f(.)h(.)106 b(21)487 3832 y(3.4.2)119 b(The)25 b(pdf)g(option)89 +b(.)50 b(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.) +f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)106 b(24)487 3953 +y(3.4.3)119 b(T)-5 b(itle)25 b(commands)43 b(.)50 b(.)g(.)f(.)h(.)g(.)g +(.)f(.)h(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.) +f(.)h(.)106 b(25)487 4073 y(3.4.4)119 b(Sectioning)26 +b(Commands)49 b(.)h(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h +(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)106 b(31)258 4193 y(3.5)e(Commands)25 +b(and)g(Envir)n(onments)h(for)g(the)f(hcart)h(class)38 +b(.)50 b(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)106 b(31)258 +4314 y(3.6)e(Settings)27 b(for)f(the)f(hcletter)h(class)37 +b(.)50 b(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.) +g(.)f(.)h(.)g(.)f(.)h(.)106 b(31)258 4434 y(3.7)e(Commands)25 +b(and)g(Envir)n(onments)h(for)g(the)f(hcr)n(eport)h(class)38 +b(.)50 b(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)106 b(31)258 4555 +y(3.8)e(Commands)25 b(and)g(Envir)n(onments)h(for)g(the)f(hcslides)g +(class)58 b(.)50 b(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)106 +b(32)487 4675 y(3.8.1)119 b(The)25 b(twotoc)i(option)92 +b(.)49 b(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.) +g(.)g(.)f(.)h(.)g(.)f(.)h(.)106 b(33)109 4895 y Fr(4)94 +b(German)27 b(Langua)o(g)q(e)i(De\002nitions)1865 b(34)p +eop +%%Page: 2 3 +2 2 bop 109 -62 a Ft(2)2989 b Fq(2)100 b(Options)p 109 +-10 3544 4 v 109 275 a Fs(1)143 b(Intr)m(oduction)109 +503 y Ft(The)34 b(HC)f(Bundle)h(for)h(L)1034 480 y Fp(A)1071 +503 y Ft(T)1115 526 y(E)1164 503 y(X)15 b(2)1289 518 +y Fo(")1377 503 y Ft(pr)n(ovides)35 b(the)f(following)i(four)f(classes) +g(as)f(r)n(eplacement)109 623 y(for)25 b(the)h(L)449 +600 y Fp(A)486 623 y Ft(T)530 647 y(E)578 623 y(X)g(default)f(classes:) +109 827 y Fr(hcar)r(t.c)n(ls:)238 b Ft(substitute)26 +b(for)g(the)f Fn(article)f Ft(class,)789 947 y(based)g(upon)h(the)h +Fn(scrartcl)d Ft(class)i(fr)n(om)h(the)f(KoMa-Script)i(bundle;)109 +1151 y Fr(hcrepor)r(t.c)n(ls:)77 b Ft(substitute)26 b(for)g(the)f +Fn(report)f Ft(class,)789 1271 y(based)g(upon)h(the)h +Fn(scrreprt)d Ft(class)i(fr)n(om)h(the)f(KoMa-Script)i(bundle;)109 +1475 y Fr(hc)n(letter)-6 b(.c)n(ls:)132 b Ft(substitute)26 +b(for)g(the)f Fn(letter)f Ft(class,)789 1595 y(based)g(upon)h(the)h +Fn(scrlettr)d Ft(class)i(fr)n(om)h(the)f(KoMa-Script)i(bundle;)109 +1799 y Fr(hcslides.c)n(ls:)85 b Ft(substitute)26 b(for)g(the)f +Fn(slides)f Ft(class,)789 1919 y(based)g(upon)h(the)h +Fn(seminar)d Ft(class.)193 2115 y Fm(h)r(\003)q Fl(hca)m(rt)r +Fm(i)192 2228 y Fk(\\newcommand{\\t)o(hi)o(scl)o(as)o(s})o({h)o(ca)o +(rt})192 2341 y(\\newcommand{\\s)o(up)o(erc)o(la)o(ss)o(}{)o(sc)o(rar)o +(tc)o(l})193 2454 y Fm(h)r Fi(=)q Fl(hca)m(rt)r Fm(i)193 +2567 y(h)r(\003)q Fl(hcletter)s Fm(i)192 2680 y Fk(\\newcommand{\\t)o +(hi)o(scl)o(as)o(s})o({h)o(cl)o(ett)o(er)o(})192 2792 +y(\\newcommand{\\s)o(up)o(erc)o(la)o(ss)o(}{)o(sc)o(rle)o(tt)o(r})193 +2905 y Fm(h)r Fi(=)q Fl(hcletter)s Fm(i)193 3018 y(h)r(\003)q +Fl(hcrep)s(o)m(rt)r Fm(i)192 3131 y Fk(\\newcommand{\\t)o(hi)o(scl)o +(as)o(s})o({h)o(cr)o(epo)o(rt)o(})192 3244 y(\\newcommand{\\s)o(up)o +(erc)o(la)o(ss)o(}{)o(sc)o(rre)o(pr)o(t})193 3357 y Fm(h)r +Fi(=)q Fl(hcrep)s(o)m(rt)r Fm(i)193 3470 y(h)r(\003)q +Fl(hcslides)q Fm(i)192 3583 y Fk(\\newcommand{\\t)o(hi)o(scl)o(as)o(s}) +o({h)o(cs)o(lid)o(es)o(})192 3696 y(\\newcommand{\\s)o(up)o(erc)o(la)o +(ss)o(}{)o(se)o(min)o(ar)o(})193 3809 y Fm(h)r Fi(=)q +Fl(hcslides)q Fm(i)109 4155 y Fs(2)143 b(Options)109 +4412 y Ff(2.1)120 b(General)35 b(Options)p -74 4640 409 +4 v -76 4753 4 113 v -24 4719 a Fh(german)p 332 4753 +V -76 4866 V -24 4832 a(english)p 332 4866 V -74 4869 +409 4 v 109 5042 a(Loads)23 b(a)i(language.)f(Default)i(is)e(English.)g +(At)g(the)g(moment)g(no)g(other)f(languages)h(ar)n(e)h(supported.)109 +5154 y(Requir)n(es)c(the)h Fe(babel)e Fh(package.)193 +5292 y Fm(h)r(\003)q Fl(class)q Fm(i)192 5405 y Fk(\\newif\\if@germ)o +(an)192 5518 y(\\@germanfalse)p eop +%%Page: 3 4 +3 3 bop 109 -62 a Fq(2.1)99 b(General)24 b(Options)2544 +b Ft(3)p 109 -10 3544 4 v 192 270 a Fk(\\newif\\if@defl)o(an)o(g)192 +383 y(\\@deflangtrue)192 496 y(\\DeclareOption)o({g)o(erm)o(an)o(}{)o +(\\@)o(de)o(fl)o(ang)o(fa)o(ls)o(e\\)o(@g)o(erm)o(an)o(tr)o(ue)301 +609 y(\\PassOptionsTo)o(Pac)o(ka)o(ge)o({n)o(ge)o(rm)o(an})o({b)o(ab)o +(el)o(})301 722 y(\\PassOptionsTo)o(Pac)o(ka)o(ge)o({g)o(er)o(ma)o(n}{) +o(fa)o(nc)o(yr)o(ef)o(})301 835 y(\\AtEndOfClass{)o(\\in)o(pu)o(t{)o +(ge)o(rm)o(an)o(.hl)o(d})o(}})192 948 y(\\DeclareOption)o({e)o(ngl)o +(is)o(h})o({\\)o(@d)o(ef)o(lan)o(gf)o(al)o(se)301 1061 +y(\\PassOptionsTo)o(Pac)o(ka)o(ge)o({\\)o(Cu)o(rr)o(ent)o(Op)o(ti)o(on) +o(}{)o(bab)o(el)o(}})p -74 1338 543 4 v -76 1451 4 113 +v -24 1418 a Fh(a4paper)p 467 1451 V -76 1564 V -24 1530 +a(letterpaper)p 467 1564 V -74 1568 543 4 v 109 1740 +a(Use)24 b(the)g(DIN)h(A4)g(\(default\))h(or)f(the)f(letter)g(paper)g +(format?)i(At)f(the)f(moment)g(no)h(other)f(paper)h(for)n(-)109 +1853 y(mats)d(ar)n(e)h(supported.)192 2016 y Fk(\\newif\\if@defp)o(ap)o +(er)192 2129 y(\\@defpapertrue)192 2242 y(\\DeclareOption)o({a)o(4pa)o +(pe)o(r})o({)193 2355 y Fm(h)q Fl(hca)m(rt)c Fm(j)g Fl(hcletter)h +Fm(j)f Fl(hcrep)s(o)m(rt)r Fm(i)q Fk(\\PassOptionsToCl)o(as)o(s{)o(\\C) +o(ur)o(ren)o(tO)o(pt)o(io)o(n})o({\\s)o(up)o(er)o(cl)o(as)o(s})193 +2468 y Fm(h)q Fl(hcslides)p Fm(i)q Fk(\\PassOptionsToCl)o(as)o(s{)o(a4) +o(}{)o(\\su)o(pe)o(rc)o(la)o(ss)o(})192 2581 y(\\PassOptionsTo)o(Pa)o +(cka)o(ge)o({\\)o(Cu)o(rr)o(en)o(tOp)o(ti)o(on)o(}{)o(hy)o(per)o(re)o +(f})192 2694 y(\\@defpaperfals)o(e})192 2807 y(\\DeclareOption)o({l)o +(ett)o(er)o(pa)o(pe)o(r})o({)193 2920 y Fm(h)q Fl(hca)m(rt)g +Fm(j)g Fl(hcletter)h Fm(j)f Fl(hcrep)s(o)m(rt)r Fm(i)q +Fk(\\PassOptionsToCl)o(as)o(s{)o(\\C)o(ur)o(ren)o(tO)o(pt)o(io)o(n})o +({\\s)o(up)o(er)o(cl)o(as)o(s})192 3032 y(\\PassOptionsTo)o(Pa)o(cka)o +(ge)o({\\)o(Cu)o(rr)o(en)o(tOp)o(ti)o(on)o(}{)o(hy)o(per)o(re)o(f})192 +3145 y(\\@defpaperfals)o(e})p -74 3423 533 4 v -76 3536 +4 113 v -24 3502 a Fh(palatino)p 457 3536 V -76 3649 +V -24 3615 a(nopalatino)p 457 3649 V -74 3652 533 4 v +109 3825 a(Use)30 b(the)g(Palatino)i(or)f(the)f(Standar)n(d)h(T)1525 +3846 y(E)1569 3825 y(X)g(font?)g(Palatino)h(is)f(default)g(\(r)n(equir) +n(es)g(the)g Fe(palatino)109 3938 y Fh(and)22 b(the)g +Fe(mathpple)d Fh(packages\).)192 4101 y Fk(\\newif\\if@pala)o(ti)o(no) +192 4214 y(\\@palatinotrue)192 4327 y(\\DeclareOption)o({p)o(ala)o(ti)o +(no)o(}{)o(\\@)o(pa)o(lat)o(in)o(ot)o(ru)o(e})192 4440 +y(\\DeclareOption)o({n)o(opa)o(la)o(ti)o(no)o(}{)o(\\@)o(pal)o(at)o(in) +o(of)o(al)o(se})p -74 4726 286 4 v -76 4839 4 113 v -24 +4805 a Fh(ding)p 209 4839 V -74 4842 286 4 v 109 5016 +a(Pr)n(ovide)27 b(some)f(fancy)i(lists)f(and)h(symbols)e(using)h(the)f +(Dingbat)i(symbols)f(\(r)n(equir)n(es)g(the)g Fe(pifont)109 +5129 y Fh(style)21 b(of)i(the)f Fe(psnfss)e Fh(package\)?)192 +5292 y Fk(\\newif\\if@ding)192 5405 y(\\@dingfalse)192 +5518 y(\\DeclareOption)o({d)o(ing)o(}{)o(\\@)o(di)o(ng)o(tr)o(ue})p +eop +%%Page: 4 5 +4 4 bop 109 -62 a Ft(4)2989 b Fq(2)100 b(Options)p 109 +-10 3544 4 v -74 174 385 4 v -76 287 4 113 v -24 253 +a Fh(eur)n(o)p 309 287 V -76 400 V -24 366 a(noeur)n(o)p +309 400 V -74 403 385 4 v 109 576 a(Pr)n(ovide)22 b(the)g(Eur)n(o)g +(symbol)29 b Fd(C)p 1132 538 53 2 v 1132 551 48 2 v 22 +w Fh(\(default,)23 b(r)n(equir)n(es)f(the)g Fe(eurofont)d +Fh(package\)?)192 729 y Fk(\\newif\\if@euro)192 842 y(\\@eurotrue)192 +955 y(\\DeclareOption)o({e)o(uro)o(}{)o(\\@)o(eu)o(ro)o(tru)o(e})192 +1067 y(\\DeclareOption)o({n)o(oeu)o(ro)o(}{)o(\\@)o(eu)o(rof)o(al)o(se) +o(})p -74 1320 530 4 v -76 1432 4 113 v -24 1399 a Fh(fancyr)n(ef)p +454 1432 V -76 1545 V -24 1511 a(nofancyr)n(ef)p 454 +1545 V -74 1549 530 4 v 109 1721 a(Pr)n(ovide)25 b(fancy)h(r)n(efer)n +(ence)f(commands)g(\(default,)g(r)n(equir)n(es)g(the)g +Fe(fancyref)d Fh(and)j(the)g Fe(varioref)109 1834 y Fh(packages\)?)192 +1986 y Fk(\\newif\\if@fanc)o(yr)o(ef)192 2099 y(\\@fancyreftrue)192 +2212 y(\\DeclareOption)o({f)o(anc)o(yr)o(ef)o(}{)o(\\@)o(fan)o(cy)o(re) +o(ft)o(ru)o(e})192 2325 y(\\DeclareOption)o({n)o(ofa)o(nc)o(yr)o(ef)o +(}{)o(\\@f)o(an)o(cy)o(re)o(ff)o(al)o(se})p -74 2577 +392 4 v -76 2690 4 113 v -24 2656 a Fh(html)p 316 2690 +V -76 2803 V -24 2769 a(nohtml)p 316 2803 V -74 2806 +392 4 v 109 2978 a(Pr)n(ovide)71 b(HTML)g(commands)h(\(default,)g(r)n +(equir)n(es)f(the)g Fe(html)g Fh(package)g(bundled)g(with)109 +3091 y(L)132 3074 y Fp(A)170 3091 y Fh(T)211 3113 y(E)254 +3091 y(X2HTML\)?)192 3244 y Fk(\\newif\\if@html)192 3357 +y(\\@htmltrue)192 3470 y(\\DeclareOption)o({h)o(tml)o(}{)o(\\@)o(ht)o +(ml)o(tru)o(e})192 3582 y(\\DeclareOption)o({n)o(oht)o(ml)o(}{)o(\\@)o +(ht)o(mlf)o(al)o(se)o(})193 3695 y Fm(h)r Fi(=)q Fl(class)q +Fm(i)109 4024 y Ff(2.2)120 b(Options)34 b(f)n(or)e(the)i(hcar)r(t)g +(and)g(hcrepor)r(t)f(c)n(lasses)p -74 4287 686 4 v -76 +4400 4 113 v -24 4366 a Fh(headsepline)p 610 4400 V -76 +4513 V -24 4479 a(headnosepline)p 610 4513 V -74 4516 +686 4 v 109 4688 a(Draw)23 b(a)g(horizontal)g(line)g(below)g(the)f +(header)f(line)i(\(default\)?)193 4841 y Fm(h)r(\003)q +Fl(hca)m(rt)c Fm(j)g Fl(hcrep)s(o)m(rt)r Fm(i)192 4954 +y Fk(\\newif\\if@defh)o(sl)192 5066 y(\\@defhsltrue)192 +5179 y(\\DeclareOption)o({h)o(ead)o(se)o(pl)o(in)o(e})o({\\P)o(as)o(sO) +o(pt)o(io)o(ns)o(ToC)o(la)o(ss)192 5292 y({\\CurrentOptio)o(n})o({\\s)o +(up)o(er)o(cl)o(as)o(s}\\)o(@d)o(ef)o(hs)o(lf)o(al)o(se})192 +5405 y(\\DeclareOption)o({h)o(ead)o(no)o(se)o(pl)o(in)o(e}{)o(\\P)o(as) +o(sO)o(pt)o(io)o(nsT)o(oC)o(la)o(ss)192 5518 y({\\CurrentOptio)o(n})o +({\\s)o(up)o(er)o(cl)o(as)o(s}\\)o(@d)o(ef)o(hs)o(lf)o(al)o(se})p +eop +%%Page: 5 6 +5 5 bop 109 -62 a Fq(2.2)99 b(Options)26 b(for)g(the)f(hcart)h(and)e +(hcr)n(eport)j(classes)1437 b Ft(5)p 109 -10 3544 4 v +-74 174 560 4 v -76 287 4 113 v -24 253 a Fh(onecolumn)p +483 287 V -76 400 V -24 366 a(twocolumn)p 483 400 V -74 +403 560 4 v 109 575 a(Set)21 b(the)h(text)g(in)h(one)e(or)i(two)f +(columns)g(\(default)h(is)g(one\)?)192 733 y Fk(\\DeclareOption)o({o)o +(nec)o(ol)o(um)o(n})o({\\)o(Pa)o(ssO)o(pt)o(io)o(ns)o(To)o(Cla)o(ss)192 +846 y({\\CurrentOptio)o(n})o({\\s)o(up)o(er)o(cl)o(as)o(s})o(})192 +959 y(\\DeclareOption)o({t)o(woc)o(ol)o(um)o(n})o({\\)o(Pa)o(ssO)o(pt)o +(io)o(ns)o(To)o(Cla)o(ss)192 1072 y({\\CurrentOptio)o(n})o({\\s)o(up)o +(er)o(cl)o(as)o(s})o(})p -74 1337 465 4 v -76 1450 4 +113 v -24 1416 a Fh(hcar)n(ea)p 388 1450 V -76 1563 V +-24 1529 a(hcnoar)n(ea)p 388 1563 V -74 1566 465 4 v +109 1738 a(Set)e(the)g(default)h(ar)n(ea)h(to)f(240mm)j +Fm(\002)e Fh(150mm)h(\(default\)?)f(Otherwise,)e(the)g(default)h(value) +h(fr)n(om)g(the)109 1851 y Fe(scrartcl)d Fh(r)n(esp.)i +Fe(scrreprt)e Fh(classes)j(is)h(used)e(if)j(you)d(do)h(not)g(set)f(the) +h(ar)n(ea)i(manually)g(\(e.g.)d(with)109 1964 y(the)f +Fe(\\areaset)f Fh(command\).)192 2122 y Fk(\\newif\\if@hcar)o(ea)192 +2235 y(\\@hcareatrue)192 2348 y(\\DeclareOption)o({h)o(car)o(ea)o(}{)o +(\\@)o(hc)o(ar)o(eat)o(ru)o(e})192 2461 y(\\DeclareOption)o({h)o(cno)o +(ar)o(ea)o(}{)o(\\@)o(hc)o(are)o(af)o(al)o(se)o(})p -74 +2726 669 4 v -76 2839 4 113 v -24 2805 a Fh(hcfootnotes)p +593 2839 V -76 2952 V -24 2918 a(hcnofootnotes)p 593 +2952 V -74 2955 669 4 v 109 3127 a(Nicer)i(formatting)h(of)f(footnotes) +e(\(default\)?)192 3285 y Fk(\\newif\\if@hcfo)o(ot)o(not)o(es)192 +3398 y(\\@hcfootnotest)o(ru)o(e)192 3511 y(\\DeclareOption)o({h)o(cfo)o +(ot)o(no)o(te)o(s})o({\\)o(@hc)o(fo)o(ot)o(no)o(te)o(str)o(ue)o(})192 +3624 y(\\DeclareOption)o({h)o(cno)o(fo)o(ot)o(no)o(te)o(s})o({\\@)o(hc) +o(fo)o(ot)o(no)o(tes)o(fa)o(ls)o(e})p -74 3897 490 4 +v -76 4010 4 113 v -24 3976 a Fh(magazine)p 414 4010 +V -74 4013 490 4 v 109 4187 a(Pr)n(ovide)i(commands)h(for)f(magazine)i +(or)e(newspaper)f(articles?)j(This)e(sets)f(the)h Fe(html)f +Fh(option)g(too.)192 4345 y Fk(\\newif\\if@maga)o(zi)o(ne)192 +4458 y(\\@magazinefals)o(e)192 4571 y(\\DeclareOption)o({m)o(aga)o(zi)o +(ne)o(}{)o(\\@)o(ma)o(gaz)o(in)o(et)o(ru)o(e\\)o(@ht)o(ml)o(tr)o(ue)o +(})p -74 4844 406 4 v -76 4957 4 113 v -24 4923 a Fh(parskip)p +330 4957 V -74 4960 406 4 v 109 5134 a(Skip)h(paragraphs)g(instead)g +(of)g(indenting)g(them?)192 5292 y Fk(\\newif\\if@pars)o(ki)o(p)192 +5405 y(\\@parskipfalse)192 5518 y(\\DeclareOption)o({p)o(ars)o(ki)o(p}) +o({\\)o(@p)o(ar)o(ski)o(pt)o(ru)o(e})p eop +%%Page: 6 7 +6 6 bop 109 -62 a Ft(6)2989 b Fq(2)100 b(Options)p 109 +-10 3544 4 v -74 191 301 4 v -76 304 4 113 v -24 270 +a Fh(wide)p 225 304 V -74 307 301 4 v 109 481 a(Use)21 +b(a)i(wide)f(line)i(distance)e(\(ca.)h(1.5\)?)192 615 +y Fk(\\newif\\if@wide)192 728 y(\\@widefalse)192 841 +y(\\DeclareOption)o({w)o(ide)o(}{)o(\\@)o(wi)o(de)o(tru)o(e})193 +954 y Fm(h)r Fi(=)q Fl(hca)m(rt)c Fm(j)g Fl(hcrep)s(o)m(rt)r +Fm(i)109 1238 y Ff(2.3)120 b(Options)34 b(f)n(or)e(the)i(hcar)r(t,)g +(hcrepor)r(t)g(and)g(hc)n(letter)f(c)n(lasses)p -74 1466 +275 4 v -76 1579 4 113 v -24 1545 a Fh(10pt)p 199 1579 +V -76 1692 V -24 1658 a(1)-5 b(1pt)p 199 1692 V -76 1805 +V -24 1771 a(12pt)p 199 1805 V -74 1808 275 4 v 109 1980 +a(Use)21 b(a)i(font)g(size)f(of)h(10,)g(1)-5 b(1,)24 +b(or)e(12)i(\(default\))f(points?)193 2114 y Fm(h)r(\003)q +Fl(hca)m(rt)c Fm(j)g Fl(hcrep)s(o)m(rt)h Fm(j)f Fl(hcletter)s +Fm(i)192 2227 y Fk(\\newif\\if@defs)o(iz)o(e)192 2340 +y(\\@defsizetrue)192 2453 y(\\DeclareOption)o({1)o(0pt)o(}{)o(\\P)o(as) +o(sO)o(pti)o(on)o(sT)o(oC)o(la)o(ss)o({\\C)o(ur)o(re)o(nt)o(Op)o(tio)o +(n})o({\\)o(su)o(pe)o(rcl)o(as)o(s})192 2566 y(\\@defsizefalse)o(})192 +2679 y(\\DeclareOption)o({1)o(1pt)o(}{)o(\\P)o(as)o(sO)o(pti)o(on)o(sT) +o(oC)o(la)o(ss)o({\\C)o(ur)o(re)o(nt)o(Op)o(tio)o(n})o({\\)o(su)o(pe)o +(rcl)o(as)o(s})192 2792 y(\\@defsizefalse)o(})192 2904 +y(\\DeclareOption)o({1)o(2pt)o(}{)o(\\P)o(as)o(sO)o(pti)o(on)o(sT)o(oC) +o(la)o(ss)o({\\C)o(ur)o(re)o(nt)o(Op)o(tio)o(n})o({\\)o(su)o(pe)o(rcl)o +(as)o(s})192 3017 y(\\@defsizefalse)o(})193 3130 y Fm(h)r +Fi(=)q Fl(hca)m(rt)g Fm(j)g Fl(hcrep)s(o)m(rt)h Fm(j)f +Fl(hcletter)s Fm(i)109 3414 y Ff(2.4)120 b(Options)34 +b(f)n(or)e(the)i(hcar)r(t,)g(hcrepor)r(t)g(and)g(hcslides)h(c)n(lasses) +p -74 3643 330 4 v -76 3755 4 113 v -24 3722 a Fh(bib)p +253 3755 V -76 3868 V -24 3834 a(nobib)p 253 3868 V -74 +3872 330 4 v 109 4041 a(Use)21 b(B)m Fc(I)r(B)-5 b Fh(T)444 +4071 y(E)488 4041 y(X?)193 4175 y Fm(h)r(\003)q Fl(hca)m(rt)19 +b Fm(j)g Fl(hcrep)s(o)m(rt)h Fm(j)f Fl(hcslides)q Fm(i)192 +4288 y Fk(\\newif\\if@bib)192 4401 y(\\@bibfalse)192 +4514 y(\\DeclareOption)o({b)o(ib})o({\\)o(@b)o(ib)o(tr)o(ue})192 +4627 y(\\DeclareOption)o({n)o(obi)o(b})o({\\)o(@b)o(ib)o(fal)o(se)o(})p +-74 4844 415 4 v -76 4957 4 113 v -24 4923 a Fh(fnbib)p +339 4957 V -76 5070 V -24 5036 a(autbib)p 339 5070 V +-76 5183 V -24 5149 a(numbib)p 339 5183 V -74 5186 415 +4 v 109 5359 a(B)m Fc(I)r(B)-5 b Fh(T)269 5388 y(E)313 +5359 y(X)18 b(r)n(efer)n(ences)f(ar)n(e)h(written)g(in)g(footnotes)e +(\(default\))i(or)g(in)h(author)n(-year)f(or)f(in)i(numerical)h(style.) +109 5471 y(These)h(options)g(set)g(the)h Fe(bib)f Fh(option)h(too.)p +eop +%%Page: 7 8 +7 7 bop 109 -62 a Fq(2.4)99 b(Options)26 b(for)g(the)f(hcart,)h(hcr)n +(eport)g(and)f(hcslides)g(classes)1034 b Ft(7)p 109 -10 +3544 4 v 192 270 a Fk(\\newif\\if@fnbi)o(b)192 383 y(\\@fnbibtrue)192 +496 y(\\newif\\if@autb)o(ib)192 609 y(\\@autbibfalse)192 +722 y(\\newif\\if@numb)o(ib)192 835 y(\\@numbibfalse)192 +948 y(\\DeclareOption)o({f)o(nbi)o(b})o({\\)o(@f)o(nb)o(ib)o(tru)o(e\\) +o(@a)o(ut)o(bi)o(bfa)o(ls)o(e\\)o(@n)o(um)o(bib)o(fa)o(ls)o(e\\)o(@b)o +(ibt)o(ru)o(e})192 1061 y(\\DeclareOption)o({a)o(utb)o(ib)o(}{)o(\\@)o +(fn)o(bi)o(bfa)o(ls)o(e\\)o(@a)o(ut)o(bib)o(tr)o(ue)o(\\@)o(nu)o(mbi)o +(bf)o(al)o(se)o(\\@)o(bib)o(tr)o(ue)o(})192 1173 y(\\DeclareOption)o +({n)o(umb)o(ib)o(}{)o(\\@)o(fn)o(bi)o(bfa)o(ls)o(e\\)o(@a)o(ut)o(bib)o +(fa)o(ls)o(e\\)o(@n)o(umb)o(ib)o(tr)o(ue)o(\\@)o(bib)o(tr)o(ue)o(})p +-74 1472 519 4 v -76 1585 4 113 v -24 1551 a Fh(htmlbib)p +443 1585 V -76 1698 V -24 1664 a(nohtmlbib)p 443 1698 +V -74 1701 519 4 v 109 1873 a(Use)27 b(the)h Fe(html)f +Fh(package)h(for)h(online)f(r)n(efer)n(ences)g(with)g(B)m +Fc(I)r(B)-5 b Fh(T)2283 1903 y(E)2328 1873 y(X)28 b(\(default\)?)h +(This)g(loads)f(the)g Fe(html)109 1986 y Fh(option)21 +b(too.)192 2159 y Fk(\\newif\\if@html)o(bi)o(b)192 2272 +y(\\@htmlbibtrue)192 2385 y(\\DeclareOption)o({h)o(tml)o(bi)o(b})o({\\) +o(@h)o(tm)o(lbi)o(bt)o(ru)o(e\\)o(@h)o(tml)o(tr)o(ue)o(})192 +2498 y(\\DeclareOption)o({n)o(oht)o(ml)o(bi)o(b})o({\\)o(@h)o(tml)o(bi) +o(bf)o(al)o(se)o(})p -74 2804 334 4 v -76 2917 4 113 +v -24 2883 a Fh(paper)p 258 2917 V -74 2921 334 4 v 109 +3094 a(Pr)n(ovide)32 b(formatting)h(and)f(commands)h(for)f(a)i +(scienti\002c)e(paper?)h(This)f(sets)f(the)h Fe(bib)f +Fh(and)i Fe(html)109 3207 y Fh(options)21 b(too.)192 +3380 y Fk(\\newif\\if@pape)o(r)192 3493 y(\\@paperfalse)192 +3606 y(\\DeclareOption)o({p)o(ape)o(r})o({\\)o(@p)o(ap)o(er)o(tru)o +(e\\)o(@b)o(ib)o(tr)o(ue\\)o(@h)o(tm)o(lt)o(ru)o(e})p +-74 3904 343 4 v -76 4017 4 113 v -24 3984 a Fh(pdf)p +267 4017 V -76 4130 V -24 4096 a(nopdf)p 267 4130 V -74 +4134 343 4 v 109 4306 a(Pr)n(epar)n(e)32 b(\002le)h(for)g(the)f(PDF)g +(format?)i(This)e(loads)h(the)f Fe(hyperref)d Fh(package.)j(This)h +(option)e(is)i(set)109 4419 y(automagically)24 b(by)e(r)o(unning)h +Fe(pdflatex)p Fh(.)192 4591 y Fk(\\newif\\if@pdf)192 +4704 y(\\ifx\\pdfoutput)o(\\u)o(nde)o(fi)o(ne)o(d)301 +4817 y(\\@pdffalse)192 4930 y(\\else)301 5043 y(\\@pdftrue)192 +5156 y(\\fi)192 5269 y(\\DeclareOption)o({p)o(df})o({\\)o(@p)o(df)o(tr) +o(ue)o(})192 5382 y(\\DeclareOption)o({n)o(opd)o(f})o({\\)o(@p)o(df)o +(fa)o(lse)o(})193 5494 y Fm(h)r Fi(=)q Fl(hca)m(rt)c +Fm(j)g Fl(hcrep)s(o)m(rt)h Fm(j)f Fl(hcslides)q Fm(i)p +eop +%%Page: 8 9 +8 8 bop 109 -62 a Ft(8)2989 b Fq(2)100 b(Options)p 109 +-10 3544 4 v 109 270 a Ff(2.5)120 b(Options)34 b(f)n(or)e(the)i +(hcrepor)r(t)g(c)n(lass)p -74 498 496 4 v -76 611 4 113 +v -24 577 a Fh(openany)p 420 611 V -76 724 V -24 690 +a(openright)p 420 724 V -74 728 496 4 v 109 900 a(Start)22 +b(new)g(chapters)f(always)i(on)g(a)g(right)f(page)g(\(not)g(by)h +(default\)?)193 1030 y Fm(h)r(\003)q Fl(hcrep)s(o)m(rt)r +Fm(i)192 1143 y Fk(\\DeclareOption)o({o)o(pen)o(an)o(y})301 +1256 y({\\PassOptionsT)o(oCl)o(as)o(s{)o(\\C)o(ur)o(ren)o(tO)o(pt)o(io) +o(n})o({\\)o(sup)o(er)o(cl)o(as)o(s})o(})192 1369 y(\\DeclareOption)o +({o)o(pen)o(ri)o(gh)o(t})301 1482 y({\\PassOptionsT)o(oCl)o(as)o(s{)o +(\\C)o(ur)o(ren)o(tO)o(pt)o(io)o(n})o({\\)o(sup)o(er)o(cl)o(as)o(s})o +(})193 1595 y Fm(h)r Fi(=)q Fl(hcrep)s(o)m(rt)r Fm(i)109 +1875 y Ff(2.6)120 b(Options)34 b(f)n(or)e(the)i(hcslides)i(c)n(lass)p +-74 2104 375 4 v -76 2216 4 113 v -24 2183 a Fh(twotoc)p +298 2216 V -76 2329 V -24 2296 a(onetoc)p 298 2329 V +-74 2333 375 4 v 109 2505 a(Print)22 b(table)h(of)g(contents)e(in)i +(two)f(columns)g(\(r)n(equir)n(es)h(the)f Fe(multicol)d +Fh(package\)?)193 2635 y Fm(h)r(\003)q Fl(hcslides)q +Fm(i)192 2748 y Fk(\\newif\\if@twot)o(oc)192 2861 y(\\@twotocfalse)192 +2974 y(\\DeclareOption)o({t)o(wot)o(oc)o(}{)o(\\@)o(tw)o(oto)o(ct)o(ru) +o(e})192 3087 y(\\DeclareOption)o({o)o(net)o(oc)o(}{)o(\\@)o(tw)o(oto)o +(cf)o(al)o(se)o(})193 3200 y Fm(h)r Fi(=)q Fl(hcslides)q +Fm(i)109 3481 y Ff(2.7)120 b(Other)33 b(Options)109 3657 +y Fh(Other)22 b(options)f(ar)n(e)i(ignor)n(ed.)193 3788 +y Fm(h)r(\003)q Fl(class)q Fm(i)192 3901 y Fk(\\DeclareOption)o(*{)o +(\\Cl)o(as)o(sW)o(ar)o(ni)o(ng{)o(\\t)o(hi)o(sc)o(la)o(ss)o(}\045)355 +4014 y({Unknown)51 b(Option:)h(`\\CurrentOptio)o(n)c('}\045)192 +4127 y(})109 4257 y Fh(Options)22 b(not)g(implemented:)109 +4409 y Fb(scrar)r(tc)n(l,)j(scrlettr)-5 b(,)25 b(scrrepr)r(t:)74 +b Fh(paper)22 b(sizes)g(except)f(a4)j(and)f(letter)e(\(a5paper)-7 +b(,)23 b(b5paper)-7 b(,)23 b(legalpa-)668 4521 y(per)-7 +b(,)22 b(executivepaper)f(...\);)h(oneside,)e(twoside;)109 +4695 y Fb(scrar)r(tc)n(l,)25 b(scrrepr)r(t:)73 b Fh(DIV.)14 +b(.)g(.)g(,)j(DIVcalc,)i(DIVclassic,)h(BCOR;)e(headinclude,)g +(headexclude,)g(foot-)668 4808 y(include,)h(footexclude;)e +(footsepline,)g(footnosepline;)g(bigheadings,)h(normalhead-)668 +4920 y(ings,)37 b(smallheadings;)h(pointednumbers,)d(pointlessnumbers;) +g(abstracton,)j(ab-)668 5033 y(stractof)n(f;)29 b(titlepage,)g +(notitlepage;)f(leqno,)g(\003eqn;)i(openbib;)f(portrait,)f(landscape;) +668 5146 y(draft,)22 b(\002nal;)h(bibtotocnumber)n(ed;)109 +5319 y Fb(scrlettr:)221 b Fh(or)n(gdate;)21 b(wloc\002eld,)h +(sloc\002eld;)109 5492 y Fb(seminar:)179 b Fh(portrait,)16 +b(landscape;)i(article,)g(slidesonly)-10 b(,)15 b(notes,)h(notesonly;)f +(semlayer)-7 b(,)17 b(semcolor)-7 b(.)p eop +%%Page: 9 10 +9 9 bop 109 -62 a Fq(3)99 b(Commands)25 b(and)f(Envir)n(onments)1993 +b Ft(9)p 109 -10 3544 4 v 109 275 a Fs(3)143 b(Commands)37 +b(and)i(En)-6 b(vir)m(onments)109 531 y Ff(3.1)120 b(Con\002guration)p +-74 781 1381 4 v -76 894 4 113 v -24 861 a Fe(\\defaulttitle{)o +Fg(title)l Fe(})p 1305 894 V -76 1007 V -24 973 a(\\defaultauthor)o({)p +Fg(author)-5 b Fe(})p 1305 1007 V -76 1120 V -24 1086 +a(\\defaultaddres)o(s{)o Fg(addr)n(ess)m Fe(})p 1305 +1120 V -76 1233 V -24 1199 a(\\defaultemail{)o Fg(mail-addr)n(ess)n +Fe(})p 1305 1233 V -76 1346 V -24 1312 a(\\defaulthomepa)o(ge)o({)p +Fg(w)o(ebsite)l Fe(})p 1305 1346 V -74 1349 1381 4 v +109 1521 a Fh(Used)20 b(if)i(no)g(author)f(information)h(is)g +(speci\002ed.)f(They)f(ar)n(e)i(all)i(empty)c(by)i(default.)f(Renew)f +(them)i(in)109 1634 y(one)f(of)i(the)f(con\002g)g(\002les)g(\(see)g +(below\).)p -74 1881 482 4 v -76 1994 4 113 v -24 1960 +a Fe(\\autdiv)p 406 1994 V -74 1997 482 4 v 109 2171 +a Fh(Use)f(instead)h(of)h Fe(\\\\)e Fh(in)j Fe(\\defaultauthor)o +Fh(.)p -74 2417 700 4 v -76 2530 4 113 v -24 2496 a Fe(\\autinfodiv)p +624 2530 V -74 2533 700 4 v 109 2707 a Fh(Use)d(instead)h(of)h +Fe(\\\\)e Fh(in)j Fe(\\defaultaddres)o(s)16 b Fh(etc.)192 +2854 y Fk(\\newcommand{\\d)o(ef)o(aul)o(tt)o(it)o(le)o(}{)o(})192 +2967 y(\\newcommand{\\d)o(ef)o(aul)o(ta)o(ut)o(ho)o(r})o({})192 +3080 y(\\newcommand{\\d)o(ef)o(aul)o(ta)o(dd)o(re)o(ss)o(}{)o(})192 +3192 y(\\newcommand{\\d)o(ef)o(aul)o(te)o(ma)o(il)o(}{)o(})192 +3305 y(\\newcommand{\\d)o(ef)o(aul)o(th)o(om)o(ep)o(ag)o(e})o({})192 +3418 y(\\newcommand{\\c)o(ur)o(ren)o(tt)o(it)o(le)o(}{)o(\\d)o(efa)o +(ul)o(tt)o(it)o(le)o(})192 3531 y(\\newcommand{\\c)o(ur)o(ren)o(ta)o +(ut)o(ho)o(r})o({\\)o(def)o(au)o(lt)o(au)o(th)o(or})192 +3644 y(\\newcommand{\\a)o(ut)o(div)o(}{)o(\\\\)o([-)o(0.)o(4e)o(x]\\)o +(no)o(rm)o(al)o(fo)o(nt\\)o(La)o(rg)o(e})192 3757 y(\\newcommand{\\a)o +(ut)o(inf)o(od)o(iv)o(}{)o(\\\\)o([-)o(1ex)o(]\\)o(no)o(rm)o(al)o(fon)o +(t\\)o(no)o(rm)o(al)o(siz)o(e})192 3870 y(\\ProcessOption)o(s\\)o(rel)o +(ax)193 3983 y Fm(h)r Fi(=)q Fl(class)q Fm(i)193 4096 +y(h)r(\003)q Fl(hca)m(rt)j Fm(j)g Fl(hcrep)s(o)m(rt)r +Fm(i)192 4209 y Fk(\\if@defhsl)301 4322 y(\\PassOptionsTo)o(Cla)o(ss)o +({h)o(ea)o(ds)o(ep)o(lin)o(e})o({\\)o(su)o(pe)o(rcl)o(as)o(s})192 +4434 y(\\fi)109 4581 y Fh(The)27 b Fe(twoside)p Fh(,)d +Fe(pointlessnumber)o(s)p Fh(,)d Fe(liststotoc)p Fh(,)i +Fe(bibtotoc)i Fh(and)i Fe(idxtotoc)e Fh(options)109 4694 +y(ar)n(e)19 b(always)f(used)f(with)i(the)e Fe(hcart)g +Fh(and)h Fe(hcreport)d Fh(classes.)j(The)g Fe(hcletter)d +Fh(class)k(always)g(uses)109 4807 y(the)i Fe(wlocfield)e +Fh(option.)192 4954 y Fk(\\PassOptionsTo)o(Cl)o(ass)o({t)o(wo)o(si)o +(de)o(,p)o(oin)o(tl)o(es)o(sn)o(um)o(ber)o(s,)o(li)o(st)o(st)o(oto)o +(c,)301 5066 y(bibtotoc,idxto)o(toc)o(}{)o(\\s)o(up)o(er)o(cl)o(ass)o +(})193 5179 y Fm(h)r Fi(=)q Fl(hca)m(rt)g Fm(j)g Fl(hcrep)s(o)m(rt)r +Fm(i)193 5292 y(h)q Fl(hcletter)r Fm(i)q Fk(\\PassOptionsToCl)o(as)o +(s{)o(wl)o(oc)o(fie)o(ld)o(}{)o(\\s)o(up)o(erc)o(la)o(ss)o(})193 +5405 y Fm(h)r(\003)q Fl(hca)m(rt)g Fm(j)g Fl(hcrep)s(o)m(rt)h +Fm(j)f Fl(hcletter)s Fm(i)192 5518 y Fk(\\if@defsize)p +eop +%%Page: 10 11 +10 10 bop 109 -62 a Ft(10)1941 b Fq(3)99 b(Commands)25 +b(and)g(Envir)n(onments)p 109 -10 3544 4 v 301 270 a +Fk(\\PassOptionsTo)o(Cla)o(ss)o({1)o(2p)o(t})o({\\s)o(up)o(er)o(cl)o +(as)o(s})192 383 y(\\fi)193 496 y Fm(h)r Fi(=)q Fl(hca)m(rt)19 +b Fm(j)g Fl(hcrep)s(o)m(rt)h Fm(j)f Fl(hcletter)s Fm(i)193 +609 y(h)r(\003)q Fl(class)q Fm(i)192 722 y Fk(\\if@deflang)301 +835 y(\\PassOptionsTo)o(Pac)o(ka)o(ge)o({e)o(ng)o(lis)o(h})o({b)o(ab)o +(el)o(})192 948 y(\\fi)192 1061 y(\\if@defpaper)193 1173 +y Fm(h)q Fl(hca)m(rt)g Fm(j)g Fl(hcrep)s(o)m(rt)r Fm(i)110 +b Fk(\\PassOptionsToC)o(la)o(ss)o({a)o(4p)o(ape)o(r})o({\\)o(su)o(pe)o +(rcl)o(as)o(s})193 1286 y Fm(h)q Fl(hcslides)p Fm(i)g +Fk(\\PassOptionsToCl)o(as)o(s{)o(a4)o(}{\\)o(su)o(pe)o(rc)o(la)o(ss}) +301 1399 y(\\PassOptionsTo)o(Pac)o(ka)o(ge)o({a)o(4p)o(ape)o(r})o({h)o +(yp)o(er)o(re)o(f})192 1512 y(\\fi)192 1625 y(\\LoadClass{\\su)o(pe)o +(rcl)o(as)o(s})109 1820 y Fh(The)22 b(normal)h(spacing)g(is)f(used)f +(after)i(the)f(end)g(of)g(a)h(sentence.)192 2015 y Fk(\\sloppy)192 +2128 y(\\clubpenalty99)o(99)192 2241 y(\\@clubpenalty\\)o(cl)o(ubp)o +(en)o(al)o(ty)192 2353 y(\\widowpenalty9)o(99)o(9)192 +2466 y(\\displaywidowp)o(en)o(alt)o(y1)o(00)o(0)192 2579 +y(\\brokenpenalty)o(10)o(00)192 2692 y(\\frenchspacing)109 +2887 y Fh(The)g(modern)f(font)i(encoding)f(\(T1\))h(and)g(the)f(latin1) +i(input)f(encoding)e(ar)n(e)j(used)d(\(this)i(r)n(equir)n(es)f(the)109 +3000 y Fe(T1)18 b Fh(and)h Fe(latin1)d Fh(packages\).)i(The)h +Fe(ifthen)p Fh(,)d(the)i Fe(babel)f Fh(and)i(the)f Fe(xspace)e +Fh(packages)i(ar)n(e)i(always)109 3113 y(used.)h(The)g +Fe(bib)h Fh(option)f(loads)i(the)f Fe(natbib)e Fh(package.)193 +3308 y Fm(h)q Fl(hca)m(rt)f Fm(j)g Fl(hcrep)s(o)m(rt)h +Fm(j)f Fl(hcslides)p Fm(i)q Fk(\\RequirePackage{)o(na)o(tb)o(ib)o(})192 +3421 y(\\RequirePackag)o(e[)o(T1])o({f)o(on)o(te)o(nc)o(})192 +3533 y(\\RequirePackag)o(e[)o(lat)o(in)o(1])o({i)o(np)o(ute)o(nc)o(}) +192 3646 y(\\RequirePackag)o(e{)o(ift)o(he)o(n})192 3759 +y(\\RequirePackag)o(e{)o(bab)o(el)o(})192 3872 y(\\RequirePackag)o(e{)o +(xsp)o(ac)o(e})109 4067 y Fh(The)27 b(con\002g)h(\002le)g +Fe(hc.cfg)d Fh(is)k(used)d(by)i(all)i(classes.)d(Every)g(class)i(also)f +(uses)f(a)h(con\002g)g(\002le)g(with)g(its)109 4180 y(own)h(name,)h +(e.g.)f(the)h(hcart)g(class)h(uses)e Fe(hcart.cfg)p Fh(.)d(The)j +(settings)f(in)j Fe(hc.cfg)c Fh(may)k(be)f(over)n(-)109 +4293 y(written)21 b(by)i(the)f(class)h(speci\002c)f(con\002g)h +(\002les.)192 4488 y Fk(\\InputIfFileEx)o(is)o(ts{)o(hc)o(.c)o(fg)o(}{) +o(\045)301 4601 y(\\ClassInfo{\\th)o(isc)o(la)o(ss)o(})410 +4713 y({Loading)51 b(configuration)d(file)53 b(hc.cfg}}{\045)301 +4826 y(\\ClassInfo{\\th)o(isc)o(la)o(ss)o(})410 4939 +y({Configuration)48 b(file)53 b(hc.cfg)f(not)h(found}})192 +5052 y(\\InputIfFileEx)o(is)o(ts{)o(\\t)o(hi)o(sc)o(la)o(ss.)o(cf)o(g}) +o({\045)301 5165 y(\\ClassInfo{\\th)o(isc)o(la)o(ss)o(})410 +5278 y({Loading)e(configuration)d(file)53 b(\\thisclass.cfg})o(}{)o +(\045)301 5391 y(\\ClassInfo{\\th)o(isc)o(la)o(ss)o(})410 +5504 y({Configuration)48 b(file)53 b(\\thisclass.cfg)48 +b(not)53 b(found}})p eop +%%Page: 11 12 +11 11 bop 109 -62 a Fq(3.2)99 b(General)24 b(Commands)h(and)g(Envir)n +(onments)1501 b Ft(1)-5 b(1)p 109 -10 3544 4 v 109 270 +a Ff(3.2)120 b(General)35 b(Commands)g(and)f(En)-5 b(vir)n(onments)p +-74 542 517 4 v -76 655 4 113 v -24 621 a Fe(\\q{)p Fg(quote)o +Fe(})p 441 655 V -74 658 517 4 v 109 832 a Fh(<)p Fg(quote)p +Fh(>)28 b(is)g(put)f(into)h(quotation)f(marks.)g(May)h(be)g(nested:)d +(A)i(quote)g(inside)g(another)g(quote)g(uses)109 945 +y(inner)22 b(quotation)g(marks.)192 1102 y Fk(\\newcommand{\\n)o(ex)o +(tst)o(ar)o(tq)o(}{)o(`})192 1215 y(\\newcommand{\\n)o(ex)o(ten)o(dq)o +(}{)o('})192 1328 y(\\newcommand{\\o)o(th)o(ers)o(ta)o(rt)o(q})o({`)o +(`})192 1441 y(\\newcommand{\\o)o(th)o(ere)o(nd)o(q})o({')o('})192 +1554 y(\\newcommand{\\t)o(mp)o(q}{)o(})192 1667 y(\\newcommand{\\q)o +(}[)o(1]{)o(\\n)o(ex)o(ts)o(ta)o(rt)o(q{})o(\045)301 +1780 y(\\let\\tmpq\\next)o(sta)o(rt)o(q\045)301 1893 +y(\\let\\nextstart)o(q\\o)o(th)o(er)o(st)o(ar)o(tq)o(\045)301 +2006 y(\\let\\otherstar)o(tq\\)o(tm)o(pq)o(\045)301 2118 +y(\\let\\tmpq\\next)o(end)o(q\045)301 2231 y(\\let\\nextendq\\)o(oth)o +(er)o(en)o(dq)o(\045)301 2344 y(\\let\\otherendq)o(\\tm)o(pq)o(\045)301 +2457 y(#1\045)301 2570 y(\\let\\tmpq\\next)o(sta)o(rt)o(q\045)301 +2683 y(\\let\\nextstart)o(q\\o)o(th)o(er)o(st)o(ar)o(tq)o(\045)301 +2796 y(\\let\\otherstar)o(tq\\)o(tm)o(pq)o(\045)301 2909 +y(\\let\\tmpq\\next)o(end)o(q\045)301 3022 y(\\let\\nextendq\\)o(oth)o +(er)o(en)o(dq)o(\045)301 3135 y(\\let\\otherendq)o(\\tm)o(pq)o(\045)301 +3248 y(\\nextendq{}\045)192 3360 y(})p -74 3632 571 4 +v -76 3745 4 113 v -24 3711 a Fe(\\hq{)p Fg(quote)n Fe(})p +495 3745 V -74 3748 571 4 v 109 3922 a Fh(<)p Fg(quote)p +Fh(>)h(is)g(always)g(put)f(into)g(inner)h(\(\223half)5 +b(\224\))25 b(quotation)d(marks.)192 4080 y Fk(\\newcommand{\\h)o(q})o +([1])o({`)o(`#)o(1')o('})p -74 4351 V -76 4464 4 113 +v -24 4430 a Fe(\\fq{)p Fg(quote)n Fe(})p 495 4464 V +-74 4467 571 4 v 109 4641 a Fh(<)p Fg(quote)p Fh(>)h(is)g(always)g(put) +f(into)g(outer)f(\(`full'\))k(quotation)d(marks.)192 +4799 y Fk(\\newcommand{\\f)o(q})o([1])o({`)o(#1)o('})p +-74 5070 623 4 v -76 5183 4 113 v -24 5149 a Fe(\\dash{)p +Fg(text)n Fe(})p 547 5183 V -74 5187 623 4 v 109 5361 +a Fh(<)p Fg(text)q Fh(>)h(is)g(put)e(between)g(dashes.)192 +5518 y Fk(\\newcommand{\\d)o(as)o(h}[)o(1])o({-)o(--)o(#1)o(--)o(-})p +eop +%%Page: 12 13 +12 12 bop 109 -62 a Ft(12)1941 b Fq(3)99 b(Commands)25 +b(and)g(Envir)n(onments)p 109 -10 3544 4 v -74 191 1969 +4 v -76 304 4 113 v -24 270 a Fe(\\begin{flexlis)o(t})o([)p +Fg(separator)m Fe(]{)p Fg(longest-title)s Fe(})p 1892 +304 V -74 307 1969 4 v 109 481 a Fh(A)e(list)h(envir)n(onment)f +(similar)i(to)e(the)f Fe(description)d Fh(envir)n(onment.)j(All)j +(items)e(ar)n(e)h(indented)d(by)109 594 y(the)g(width)i(of)f(<)p +Fg(longest-title)t Fh(>.)g(The)g(default)h(<)p Fg(separator)s +Fh(>)g(is)f(`:'.)192 747 y Fk(\\newenvironmen)o(t{)o(fle)o(xl)o(is)o +(t})o([2)o(][:)o(])410 860 y({\\begin{list}{})519 973 +y({\\settowidth{\\l)o(ab)o(el)o(wi)o(dth)o(}{)o(\\s)o(ff)o(am)o(il)o +(y\\b)o(fs)o(er)o(ie)o(s)48 b(#2#1)53 b(})574 1086 y(\\setlength{\\le)o +(ft)o(ma)o(rg)o(in})o({\\)o(la)o(be)o(lw)o(id)o(th})574 +1199 y(\\addtolength{\\)o(le)o(ft)o(ma)o(rgi)o(n})o({\\)o(la)o(be)o(ls) +o(ep})574 1312 y(\\renewcommand{)o(\\m)o(ak)o(el)o(abe)o(l})o([1)o(]) +683 1425 y({\\sffamily\\bfs)o(er)o(ie)o(s)c(##1#1)j(\\hfill}}})410 +1538 y({\\end{list}})p -74 1800 1420 4 v -76 1913 4 113 +v -24 1879 a Fe(\\begin{widedes)o(c})o([)p Fg(separator)m +Fe(])p 1344 1913 V -74 1916 1420 4 v 109 2090 a Fh(A)22 +b(variation)h(of)f(the)g Fe(flexlist)d Fh(envir)n(onment.)i(All)i +(items)f(ar)n(e)g(indented)f(by)h(the)f(width)h(of)g(a)h(date)109 +2203 y(\(`00.00.0000'\).)j(The)c(default)h(<)p Fg(separator)s +Fh(>)g(is)g(`:'.)192 2356 y Fk(\\newenvironmen)o(t{)o(wid)o(ed)o(es)o +(c})o([1)o(][:)o(])301 2469 y({\\begin{flexli)o(st})o([#)o(1])o({0)o +(0.)o(00.)o(00)o(00)o(}})301 2582 y({\\end{flexlist)o(}})p +-74 2844 733 4 v -76 2957 4 113 v -24 2923 a Fe(\\pcent{)p +Fg(value)m Fe(})p 657 2957 V -74 2961 733 4 v 109 3135 +a Fh(Prints)f(<)p Fg(value)q Fh(>)h(followed)f(by)g(the)g(per)n(cent)g +(symbol)g(\045.)192 3288 y Fk(\\newcommand{\\p)o(ce)o(nt})o([1)o(]{)o +(#1)o(\\,)o(\\\045})p -74 3550 427 4 v -76 3663 4 113 +v -24 3629 a Fe(\\qdots)p 351 3663 V -74 3666 427 4 v +109 3840 a Fh(Prints)g(the)g(scienti\002c)h(omission)f(symbol)g([.)14 +b(.)g(.)g(])o(.)192 3994 y Fk(\\newcommand{\\q)o(do)o(ts})o({\\)o(mb)o +(ox)o({[)o(\\do)o(ts)o(]})o(\\x)o(sp)o(ac)o(e})p -74 +4256 373 4 v -76 4369 4 113 v -24 4335 a Fe(\\phyp)p +296 4369 V -74 4372 373 4 v 109 4546 a Fh(Prints)22 b(a)h(\(part)g(of)f +(a\))i(wor)n(d)e(in)h(par)n(enthesis,)e(ended)f(by)j(a)g(hypen,)e(like) +i(\(love-\)letter)-7 b(.)192 4699 y Fk(\\newcommand{\\p)o(hy)o(p}[)o +(1])301 4812 y({\(#1\\textormat)o(h{\\)o(le)o(av)o(ev)o(mo)o(de\\)o(hb) +o(ox)o({-)o(}})o({-)o(}\)\\)o(hs)o(ki)o(p\\)o(z@)o(ski)o(p})p +-74 5074 427 4 v -76 5187 4 113 v -24 5154 a Fe(\\arrow)p +351 5187 V -74 5191 427 4 v 109 5365 a Fh(Prints)22 b(an)h(arr)n(ow:)g +Fm(!)q Fh(.)192 5518 y Fk(\\newcommand{\\a)o(rr)o(ow})o({\\)o(en)o(su)o +(re)o(mat)o(h{)o(\\r)o(ig)o(ht)o(ar)o(row)o(}\\)o(xs)o(pa)o(ce)o(})p +eop +%%Page: 13 14 +13 13 bop 109 -62 a Fq(3.2)99 b(General)24 b(Commands)h(and)g(Envir)n +(onments)1495 b Ft(13)p 109 -10 3544 4 v -74 174 264 +4 v -76 287 4 113 v -24 253 a Fe(\\f)p 187 287 V -76 +400 V -24 366 a(\\ff)p 187 400 V -74 403 264 4 v 109 +575 a Fh(Print)22 b(the)g(abbr)n(eviations)i(for)f(`the)f(following)h +(page\(s\)')f(\(`f')i(r)n(esp.)d(`f)n(f')j(after)f(a)g(small)h +(space\).)192 736 y Fk(\\newcommand{\\f)o(}{)o(\\,f)o(})192 +849 y(\\newcommand{\\f)o(f})o({\\,)o(ff)o(})p -74 1128 +591 4 v -76 1241 4 113 v -24 1208 a Fe(\\distance)p 515 +1241 V -74 1245 591 4 v 109 1419 a Fh(Starts)d(a)i(new)f(un-indented)f +(paragraph)i(following)g(an)g(empty)e(line.)192 1580 +y Fk(\\newcommand{\\d)o(is)o(tan)o(ce)o(}{)o(\\p)o(ar)o(\\b)o(igs)o(ki) +o(p\\)o(no)o(in)o(den)o(t})p -74 1859 809 4 v -76 1972 +4 113 v -24 1938 a Fe(\\stardistance)p 733 1972 V -74 +1975 809 4 v 109 2149 a Fh(Starts)g(a)i(new)f(un-indented)f(paragraph)i +(following)g(thr)n(ee)e(center)n(ed)h(stars.)192 2310 +y Fk(\\newcommand{\\s)o(ta)o(rdi)o(st)o(an)o(ce)o(})301 +2423 y({\\par\\bigskip{)o(\\ce)o(nt)o(er)o(in)o(g)48 +b(*~~~*~~~*\\par}\\b)o(ig)o(sk)o(ip)o(\\n)o(oin)o(de)o(nt)o(})p +-74 2703 V -76 2815 4 113 v -24 2782 a Fe(\\linedistance)p +733 2815 V -74 2819 809 4 v 109 2993 a Fh(Starts)21 b(a)i(new)f +(un-indented)f(paragraph)i(following)g(an)g(horizontal)g(r)o(ule.)192 +3154 y Fk(\\newcommand{\\l)o(in)o(edi)o(st)o(an)o(ce)o(}{)o(\045)301 +3267 y(\\begin{center})301 3379 y(\\begin{tabular)o(}{p)o({0)o(.3)o +(3\\)o(te)o(xt)o(wid)o(th)o(}})301 3492 y(\\hrule)301 +3605 y(\\end{tabular})301 3718 y(\\end{center})301 3831 +y(\\medskip\\noind)o(ent)o(\045)192 3944 y(})p -74 4224 +624 4 v -76 4336 4 113 v -24 4303 a Fe(\\sig{)p Fg(name)m +Fe(})p 548 4336 V -74 4340 624 4 v 109 4514 a Fh(Prints)f(<)p +Fg(name)p Fh(>)h(as)f(signatur)n(e)g(\(\003ushright)g(in)h(italics\).) +192 4675 y Fk(\\newcommand{\\s)o(ig)o(}[1)o(]{)o(\\p)o(ar)o({\\)o(ra)o +(gge)o(dl)o(ef)o(t\\)o(em)o(ph{)o(#1)o(}\\)o(pa)o(r})o(})p +-74 4954 678 4 v -76 5067 4 113 v -24 5033 a Fe(\\intro{)p +Fg(text)n Fe(})p 601 5067 V -74 5070 678 4 v 109 5244 +a Fh(<)p Fg(text)q Fh(>)g(is)g(center)n(ed)e(in)i(an)g(extra)f +(paragraph,)g(using)g(a)i(bold)e(font.)g(Followed)g(by)g(some)g(space.) +192 5405 y Fk(\\newcommand{\\i)o(nt)o(ro})o([1)o(]{)o({\\)o(pa)o(r\\)o +(cen)o(te)o(ri)o(ng)o(\\t)o(ext)o(bf)o({#)o(1})o(\\p)o(ar})301 +5518 y(\\medskip\\noind)o(ent)o(\\i)o(gn)o(or)o(es)o(pa)o(ces)o(})p +eop +%%Page: 14 15 +14 14 bop 109 -62 a Ft(14)1941 b Fq(3)99 b(Commands)25 +b(and)g(Envir)n(onments)p 109 -10 3544 4 v -74 191 623 +4 v -76 304 4 113 v -24 270 a Fe(\\hint{)p Fg(text)n +Fe(})p 547 304 V -74 307 623 4 v 109 481 a Fh(<)p Fg(text)q +Fh(>)e(is)g(center)n(ed)e(in)i(an)g(extra)f(paragraph,)g(using)g(a)i +(lar)n(ge)f(font.)192 621 y Fk(\\newcommand{\\h)o(in)o(t}[)o(1])o({{)o +(\\p)o(ar)o(\\ce)o(nt)o(er)o(in)o(g\\)o(LA)o(RGE)48 b(#1\\par})301 +734 y(\\noindent\\igno)o(res)o(pa)o(ce)o(s})p -74 964 +569 4 v -76 1077 4 113 v -24 1043 a Fe(\\cen{)p Fg(text)o +Fe(})p 492 1077 V -74 1080 569 4 v 109 1254 a Fh(An)22 +b(alternative)h(to)f(the)g Fe(center)e Fh(envir)n(onment)i(using)g +(less)g(space)g(befor)n(e)g(and)h(after)-7 b(.)192 1393 +y Fk(\\newcommand{\\c)o(en)o(}[1)o(])301 1506 y({{\\par\\centeri)o(ng) +48 b(#1\\par}\\noinden)o(t\\)o(ig)o(no)o(res)o(pa)o(ce)o(s})p +-74 1736 896 4 v -76 1849 4 113 v -24 1815 a Fe(\\marginbox{)p +Fg(text)l Fe(})p 820 1849 V -74 1853 896 4 v 109 2026 +a Fh(A)22 b(text)g(in)h(a)g(box,)f(set)g(out)f(into)i(the)f(mar)n(gin.) +h(Lines)f(ar)n(e)h(divided)f(by)g Fe(\\\\)p Fh(.)192 +2166 y Fk(\\newcommand{\\m)o(ar)o(gin)o(bo)o(x})o([1)o(]\045)301 +2279 y({\\par\\small\\ad)o(dvs)o(pa)o(ce)o({4)o(.5)o(ex)48 +b(plus)53 b(1ex}\045)355 2392 y(\\vskip)f(-\\parskip)193 +2505 y Fm(h)q Fl(hca)m(rt)19 b Fm(j)g Fl(hcletter)h Fm(j)f +Fl(hcrep)s(o)m(rt)r Fm(i)165 b Fk(\\noindent\\hspac)o(e{)o(-.)o(75)o +(\\le)o(ft)o(ma)o(rg)o(in)o(i}\045)193 2618 y Fm(h)q +Fl(hcslides)p Fm(i)g Fk(\\noindent)355 2731 y(\\begin{tabular}{)o(|l)o +(|})o(\\h)o(li)o(ne\\)o(ig)o(no)o(re)o(sp)o(ac)o(es)355 +2844 y(#1)355 2957 y(\\\\\\hline\\end{tab)o(ul)o(ar)o(}\\)o(no)o(bre)o +(ak)o(\\p)o(ar)o(\\n)o(ob)o(rea)o(k)355 3069 y(\\vspace{2.3ex}\\v)o(sk) +o(ip)48 b(-\\parskip\\noin)o(de)o(nt\\)o(ig)o(no)o(re)o(sp)o(ace)o(s})p +-74 3299 809 4 v -76 3412 4 113 v -24 3378 a Fe(\\rightaddress)p +733 3412 V -74 3416 809 4 v 109 3590 a Fh(Like)17 b(the)g +Fe(\\verse)f Fh(envir)n(onment,)h(but)h(moved)f(to)h(the)f(right)h(as)g +(far)h(as)f(possible.)f(Lines)g(ar)n(e)i(divided)109 +3702 y(by)j Fe(\\\\)p Fh(.)192 3842 y Fk(\\newcommand{\\r)o(ig)o(hta)o +(dd)o(re)o(ss)o(}[)o(1]{)o(\045)301 3955 y(\\par\\medskip)301 +4068 y({\\raggedleft)49 b(\\begin{tabular})o({l)o(}\\)o(ig)o(no)o(re)o +(spa)o(ce)o(s)301 4181 y(#1)301 4294 y(\\end{tabular})301 +4407 y(\\medskip\\par}\\)o(noi)o(nd)o(en)o(t\\)o(ig)o(nor)o(es)o(pa)o +(ce)o(s\045)192 4520 y(})p -74 4750 700 4 v -76 4862 +4 113 v -24 4829 a Fe(\\shorttoday)p 624 4862 V -74 4866 +700 4 v 109 5040 a Fh(Prints)22 b(the)g(short)f(form)i(\(YY/MM/DD\))g +(of)g(the)f(curr)n(ent)g(date)g(\()p Fe(\\today)p Fh(\).)192 +5179 y Fk(\\newcounter{sh)o(or)o(tye)o(ar)o(})192 5292 +y(\\setcounter{sh)o(or)o(tye)o(ar)o(}{)o(\\t)o(he)o(\\ye)o(ar)o(})192 +5405 y(\\addtocounter{)o(sh)o(ort)o(ye)o(ar)o(}{)o(-1)o(900)o(})192 +5518 y(\\whiledo{\\thes)o(ho)o(rty)o(ea)o(r>)o(99)o(}{)o(\\ad)o(dt)o +(oc)o(ou)o(nt)o(er)o({sh)o(or)o(ty)o(ea)o(r})o({-1)o(00)o(}})p +eop +%%Page: 15 16 +15 15 bop 109 -62 a Fq(3.2)99 b(General)24 b(Commands)h(and)g(Envir)n +(onments)1495 b Ft(15)p 109 -10 3544 4 v 192 270 a Fk(\\newcommand{\\s) +o(ho)o(rtt)o(od)o(ay)o(})301 383 y({\\two@digits{\\)o(the)o(sh)o(or)o +(ty)o(ea)o(r})o(/\\t)o(he)o(\\m)o(on)o(th)o(/\\t)o(he)o(\\d)o(ay)o(\\x) +o(spa)o(ce)o(})p -74 665 864 4 v -76 777 4 113 v -24 +744 a Fe(\\begin{dialog})p 787 777 V -74 781 864 4 v +109 955 a Fh(An)27 b(envir)n(onment)g(for)g(dialogues)f(and)i(scr)n +(eenplay-like)f(scenes.)e(Use)h(the)h Fe(\\newspeaker)22 +b Fh(com-)109 1068 y(mand)h(to)f(make)g(the)g(persons)e(you)i(want)h +(to)f(use)f(in)i(the)f(dialogues.)192 1229 y Fk(\\newenvironmen)o(t{)o +(dia)o(lo)o(g})301 1342 y({\\begin{flexli)o(st})o([\\)o(no)o(rm)o(al)o +(fo)o(nt\\)o(em)o(ph)o({:)o(}])o({i})464 1455 y(\\setlength{\\item)o +(se)o(p})o({0)o(ex)o(}})301 1568 y({\\end{flexlist)o(}})192 +1681 y(\\makeatletter)p -74 1963 2055 4 v -76 2075 4 +113 v -24 2042 a Fe(\\newspeaker{)p Fg(command-name)-5 +b Fe(}{)p Fg(speaker)s(')g(s-name)s Fe(})p 1978 2075 +V -74 2079 2055 4 v 109 2253 a Fh(Pr)n(oduces)26 b(the)h(command)h(<)p +Fg(command-name)q Fh(>)g(to)f(mark)h(the)f(speeches)f(of)h(<)p +Fg(speaker)s(')-5 b(s-name)t Fh(>)28 b(in)h(a)109 2366 +y(dialogue.)22 b(<)p Fg(command-name)p Fh(>)h(must)f(begin)g(with)h(a)g +(backslash,)g(like)g(all)h(commands.)109 2479 y(Then)18 +b(the)h(command)h(<)p Fg(command-name)p Fh(>)g(may)g(be)f(called)h(in)g +(a)g Fe(dialog)d Fh(envir)n(onment)i(as)g(follows:)109 +2591 y Fe(command-name\\o)o(ar)o(g{)o(opt)o(io)o(na)o(l-)o(ex)o(pla)o +(na)o(ti)o(on)o(}\\)o(arg)o({s)o(pe)o(ec)o(h-)o(con)o(tr)o(ib)o(ut)o +(io)o(n})192 2753 y Fk(\\newcommand{\\n)o(ew)o(spe)o(ak)o(er)o(}[)o(2]) +o({\\)o(new)o(co)o(mm)o(an)o(d{)o(#1})o([2)o(][)o(])301 +2866 y({\\item[\\normal)o(fon)o(t\\)o(em)o(ph)o({#)o(2\\)o(ift)o(he)o +(ne)o(ls)o(e{)o(\\eq)o(ua)o(l{)o(##)o(1})o({}})464 2979 +y({}{)54 b(\(##1\)}}])d(##2}})p -74 3261 1500 4 v -76 +3373 4 113 v -24 3340 a Fe(\\enge{)p Fg(English)20 b(text)r +Fe(}{)p Fg(German)i(text)q Fe(})p 1424 3373 V -74 3377 +1500 4 v 109 3551 a Fh(Prints)g Fe({)p Fg(English)h(text)q +Fe(})p Fh(.)f(W)-5 b(ith)23 b(the)f Fe(german)e Fh(option,)h(<)p +Fg(German)i(text)q Fh(>)g(is)g(printed)e(instead.)192 +3712 y Fk(\\newcommand{\\e)o(ng)o(e}[)o(2])o({#)o(1})109 +3874 y Fh(Some)h(language)g(speci\002c)h(texts.)192 4036 +y Fk(\\newcommand{\\v)o(er)o(sio)o(nt)o(ex)o(t})o({V)o(er)o(sio)o(n)48 +b(date:})192 4149 y(\\newcommand{\\o)o(nl)o(ine)o(te)o(xt)o(}{)o(On)o +(li)o(ne:)o(})192 4262 y(\\newcommand{\\a)o(cc)o(ess)o(te)o(xt)o(}{)o +(Ac)o(ce)o(ss)g(date:})192 4375 y(\\newcommand{\\c)o(ft)o(ext)o(}{)o +(cf)o(.})192 4488 y(\\newcommand{\\b)o(ib)o(vol)o(te)o(xt)o(}{)o(of)o +(})192 4601 y(\\newcommand{\\b)o(vt)o(ext)o(}{)o(vo)o(l.)o(})192 +4713 y(\\newcommand{\\b)o(ib)o(dir)o(}{)o(Di)o(re)o(ct)o(or)g(})192 +4826 y(\\newcommand{\\b)o(ib)o(mov)o(te)o(xt)o(}{)o(Mo)o(vi)o(e})192 +4939 y(\\newcommand{\\b)o(ib)o(act)o(or)o(sb)o(ef)o(or)o(e})o({Wi)o(th) +o(})192 5052 y(\\newcommand{\\b)o(ib)o(act)o(or)o(sa)o(ft)o(er)o(}{)o +(et~)o(al)o(})192 5165 y(\\newcommand{\\n)o(oy)o(ear)o(}{)o(n.)o(d.)o +(})192 5278 y(\\newcommand{\\n)o(oa)o(ddr)o(es)o(s})o({n)o(.p)o(.})192 +5391 y(\\newcommand{\\o)o(th)o(era)o(bs)o(tr)o(ac)o(tn)o(am)o(e}{)o(Zu) +o(sa)o(mm)o(en)o(fas)o(su)o(ng)o(})192 5504 y(\\newcommand{\\k)o(ey)o +(wor)o(ds)o(na)o(me)o(}{)o(Ke)o(ywo)o(rd)o(s})p eop +%%Page: 16 17 +16 16 bop 109 -62 a Ft(16)1941 b Fq(3)99 b(Commands)25 +b(and)g(Envir)n(onments)p 109 -10 3544 4 v 109 270 a +Fr(3.2.1)100 b(The)28 b(palatino)f(option)192 448 y Fk(\\if@palatino) +301 561 y(\\RequirePackag)o(e{p)o(al)o(at)o(in)o(o})301 +674 y(\\RequirePackag)o(e{m)o(at)o(hp)o(pl)o(e})192 787 +y(\\fi)109 962 y Fr(3.2.2)100 b(The)28 b(ding)f(option)192 +1140 y Fk(\\if@ding)355 1253 y(\\RequirePackage{)o(pi)o(fo)o(nt)o(})p +-74 1484 373 4 v -76 1597 4 113 v -24 1563 a Fe(\\tick)p +296 1597 V -74 1600 373 4 v 109 1774 a Fh(Prints)22 b(a)h(tick.)355 +1888 y Fk(\\newcommand{\\tic)o(k})o({\\)o(di)o(ng)o({52)o(}})p +-74 2120 427 4 v -76 2233 4 113 v -24 2199 a Fe(\\cross)p +351 2233 V -74 2236 427 4 v 109 2410 a Fh(Prints)f(a)h(cr)n(oss.)355 +2524 y Fk(\\newcommand{\\cro)o(ss)o(}{)o(\\d)o(in)o(g{5)o(6})o(})p +-74 2755 591 4 v -76 2868 4 113 v -24 2834 a Fe(\\checkbox)p +515 2868 V -74 2872 591 4 v 109 3046 a Fh(Prints)f(a)h(checkbox.)355 +3160 y Fk(\\newcommand{\\che)o(ck)o(bo)o(x})o({\\)o(din)o(g{)o(11)o(4}) +o(})p -74 3391 973 4 v -76 3504 4 113 v -24 3470 a Fe(\\begin{ticklis)o +(t})p 896 3504 V -74 3507 973 4 v 109 3681 a Fh(A)f(item)h(envir)n +(onment)f(which)h(uses)e(a)i(tick)g(as)g(label)h(\(e.g.)d(for)i(lists)f +(of)h(do's\).)355 3795 y Fk(\\newenvironment{)o(ti)o(ck)o(li)o(st)o(}) +410 3908 y({\\begin{dinglis)o(t})o({5)o(2})o(}{)o(\\en)o(d{)o(di)o(ng)o +(li)o(st)o(}})p -74 4140 1027 4 v -76 4252 4 113 v -24 +4219 a Fe(\\begin{crossli)o(st)o(})p 951 4252 V -74 4256 +1027 4 v 109 4430 a Fh(A)f(item)h(envir)n(onment)f(which)h(uses)e(a)i +(cr)n(oss)g(as)f(label)i(\(e.g.)e(for)g(lists)h(of)f(don't\).)355 +4544 y Fk(\\newenvironment{)o(cr)o(os)o(sl)o(is)o(t})410 +4657 y({\\begin{dinglis)o(t})o({5)o(6})o(}{)o(\\en)o(d{)o(di)o(ng)o(li) +o(st)o(}})p -74 4888 V -76 5001 4 113 v -24 4967 a Fe(\\begin{checkli)o +(st)o(})p 951 5001 V -74 5004 1027 4 v 109 5178 a Fh(A)g(item)h(envir)n +(onment)f(which)h(uses)e(a)i(checkbox)g(as)f(label)i(\(e.g.)e(for)g +(check)h(lists\).)355 5292 y Fk(\\newenvironment{)o(ch)o(ec)o(kl)o(is)o +(t})410 5405 y({\\begin{dinglis)o(t})o({1)o(14)o(}})o({\\e)o(nd)o({d)o +(in)o(gl)o(is)o(t}})192 5518 y(\\fi)p eop +%%Page: 17 18 +17 17 bop 109 -62 a Fq(3.2)99 b(General)24 b(Commands)h(and)g(Envir)n +(onments)1495 b Ft(17)p 109 -10 3544 4 v 109 270 a Fr(3.2.3)100 +b(The)28 b(eur)n(o)f(option)p -74 518 209 4 v -76 631 +4 113 v -24 598 a Fe(\\E)p 133 631 V -74 635 209 4 v +109 809 a Fh(Prints)22 b(the)g(Eur)n(o)g(symbol)29 b +Fd(C)p 1055 771 53 2 v 1055 784 48 2 v -1 w Fh(.)p -74 +1057 570 4 v -76 1170 4 113 v -24 1136 a Fe(\\Es{)p Fg(value)o +Fe(})p 493 1170 V -74 1173 570 4 v 109 1347 a Fh(Prints)22 +b(the)g(Eur)n(o)g(symbol)g(followed)g(by)h(<)p Fg(value)q +Fh(>.)192 1495 y Fk(\\if@euro)355 1608 y(\\RequirePackage[)o(ri)o(gh)o +(t,)o(no)o(te)o(xtc)o(om)o(p])o({e)o(ur)o(ofo)o(nt)o(})355 +1720 y(\\newcommand{\\E}{)o(\\t)o(ex)o(ts)o(f{)o(\\m)o(ake)o(fa)o(ke)o +(li)o(gh)o(teu)o(ro)o(}\\)o(xs)o(pa)o(ce})355 1833 y +(\\newcommand{\\Es})o([1)o(]{)o(\\E)o(\\n)o(ob)o(rea)o(k\\)o(,#)o(1}) +192 1946 y(\\fi)109 2232 y Fr(3.2.4)100 b(The)28 b(fanc)o(yref)h +(option)109 2418 y Fh(Loads)j(the)h Fe(fancyref)e Fh(package)i(which)i +(pr)n(ovides)e(the)g(command)h Fe(\\fref{)p Fg(pr)n(e\002x:labelname)q +Fe(})p Fh(.)109 2531 y(This)25 b(prints)g(not)g(only)h(the)f(number)-7 +b(,)26 b(but)f(also)i(the)e(type)f(of)i(a)g(r)n(efer)n(ence.)f(The)g +(following)i(pr)n(e\002xes)109 2644 y(\(types\))d(ar)n(e)i(r)n +(ecognized:)f Fe(chap)f Fh(\(Chapter\),)h Fe(sec)g Fh(\(Section\),)g +Fe(eq)g Fh(\(Equation\),)h Fe(fig)e Fh(\(Figur)n(e\),)h +Fe(tab)109 2757 y Fh(\(T)-8 b(able\),)30 b Fe(enum)e +Fh(\(Enumeration\),)h Fe(fn)g Fh(\(Footnote\).)e(At)i(the)g(beginning)h +(of)f(a)i(sentence)d(use)g Fe(\\Fref)109 2870 y Fh(instead,)21 +b(which)i(gives)g(upper)n(-case)e(output)g(\(in)j(German)f(documents)e +(ther)n(e)g(is)i(no)f(dif)n(fer)n(ence\).)192 3017 y +Fk(\\if@fancyref)301 3130 y(\\RequirePackag)o(e{f)o(an)o(cy)o(re)o(f}) +192 3243 y(\\fi)p -74 3492 749 4 v -76 3604 4 113 v -24 +3571 a Fe(\\see{)p Fg(r)n(efer)n(ence)p Fe(})p 673 3604 +V -74 3608 749 4 v 109 3782 a Fh(Prints)g(`see)f(<)p +Fg(r)n(efer)n(ence)s Fh(>')i(in)g(a)h(footnote,)c(using)i(the)g +Fe(\\fref)e Fh(command)j(to)f(print)h(<)p Fg(r)n(efer)n(ence)r +Fh(>.)192 3929 y Fk(\\newcommand{\\s)o(ee)o(tex)o(t})o({s)o(ee)o(})192 +4042 y(\\newcommand{\\s)o(ee)o(}[1)o(]{)o(\\f)o(oo)o(tn)o(ot)o(e{\\)o +(se)o(et)o(ex)o(t\\)48 b(\\fref{#1}}})109 4328 y Fr(3.2.5)100 +b(The)28 b(html)f(option)p -74 4577 1198 4 v -76 4689 +4 113 v -24 4656 a Fe(\\htlink{)p Fg(linked)20 b(text)q +Fe(}{)p Fg(url)p Fe(})p 1121 4689 V -74 4693 1198 4 v +109 4867 a Fh(Prints)k(<)p Fg(linked)h(text)q Fh(>)h(followed)e(by)i +(the)e(<)p Fg(url)p Fh(>.)i(W)-5 b(ith)25 b(the)g Fe(paper)e +Fh(option,)h(a)i(footnote)d(is)j(used.)d(In)109 4980 +y(the)e(HTML)h(version)g(<)p Fg(linked)i(text)r Fh(>)e(becomes)g(an)h +(active)h(link)f(to)f(<)p Fg(url)p Fh(>.)p -74 5228 648 +4 v -76 5341 4 113 v -24 5307 a Fe(\\hturl{)p Fg(url)m +Fe(})p 571 5341 V -74 5344 648 4 v 109 5518 a Fh(Prints)g(<)p +Fg(url)p Fh(>)h(nice)g(and)f(makes)h(it)f(an)h(active)h(link)f(in)g +(the)f(HTML)g(version.)p eop +%%Page: 18 19 +18 18 bop 109 -62 a Ft(18)1941 b Fq(3)99 b(Commands)25 +b(and)g(Envir)n(onments)p 109 -10 3544 4 v -74 191 1009 +4 v -76 304 4 113 v -24 270 a Fe(\\htmail{)p Fg(mail-adr)n(ess)o +Fe(})p 932 304 V -74 307 1009 4 v 109 481 a Fh(Prints)d(<)p +Fg(mail-adr)n(ess)s Fh(>)h(nice)g(and)g(makes)f(it)h(an)g(active)g +(email)h(link)f(in)g(the)f(HTML)g(version.)192 633 y +Fk(\\if@html)193 746 y Fm(h)r Fi(=)q Fl(class)q Fm(i)193 +859 y(h)r(\003)q Fl(hcletter)s Fm(i)301 972 y Fk(\\newcounter{pa)o(rt}) +301 1085 y(\\newcounter{se)o(cti)o(on)o(})301 1198 y(\\newcounter{su)o +(bse)o(ct)o(io)o(n})301 1311 y(\\newcounter{su)o(bsu)o(bs)o(ec)o(ti)o +(on)o(})301 1424 y(\\newcounter{pa)o(rag)o(ra)o(ph)o(})301 +1537 y(\\newcommand{\\p)o(art)o(}{)o(})301 1650 y(\\newcommand{\\s)o +(ect)o(io)o(n})o({})301 1762 y(\\newcommand{\\s)o(ubs)o(ec)o(ti)o(on)o +(}{)o(})301 1875 y(\\newcommand{\\s)o(ubs)o(ub)o(se)o(ct)o(io)o(n}{)o +(})301 1988 y(\\newcommand{\\p)o(ara)o(gr)o(ap)o(h})o({})301 +2101 y(\\newcommand{\\s)o(ubp)o(ar)o(ag)o(ra)o(ph)o(}{})301 +2214 y(\\RequirePackag)o(e{h)o(tm)o(l})301 2327 y(\\newcommand{\\h)o +(tli)o(nk)o(}[)o(2])410 2440 y({{\\htmladdnorma)o(ll)o(in)o(k{)o(#1)48 +b(\\texttt{<#2>}}{)o(#2)o(}})o(})193 2553 y Fm(h)r Fi(=)q +Fl(hcletter)s Fm(i)193 2666 y(h)r(\003)q Fl(hca)m(rt)19 +b Fm(j)g Fl(hcrep)s(o)m(rt)h Fm(j)f Fl(hcslides)q Fm(i)301 +2779 y Fk(\\RequirePackag)o(e{h)o(tm)o(l})301 2892 y(\\if@paper)410 +3004 y(\\newcommand{\\ht)o(li)o(nk)o(}[)o(2])519 3117 +y({\\htmladdnormal)o(li)o(nk)o({#)o(1}{)o(#2)o(}\045)574 +3230 y(\\footnote{\\htm)o(la)o(dd)o(no)o(rma)o(ll)o(in)o(k{)o(\\t)o(ex) +o(ttt)o({#)o(2})o(}{)o(#2)o(}}})301 3343 y(\\else)410 +3456 y(\\newcommand{\\ht)o(li)o(nk)o(}[)o(2])519 3569 +y({{\\htmladdnorma)o(ll)o(in)o(k{)o(#1)48 b(\\texttt{<#2>}}{)o(#2)o(}}) +o(})301 3682 y(\\fi)193 3795 y Fm(h)r Fi(=)q Fl(hca)m(rt)19 +b Fm(j)g Fl(hcrep)s(o)m(rt)h Fm(j)f Fl(hcslides)q Fm(i)193 +3908 y(h)r(\003)q Fl(class)q Fm(i)301 4021 y Fk(\\newcommand{\\h)o(tur) +o(l})o([1)o(])410 4134 y({{\\htmladdnorma)o(ll)o(in)o(k{)o(\\t)o(ext)o +(tt)o({#)o(1})o(}{)o(#1)o(}}})301 4246 y(\\newcommand{\\h)o(tma)o(il)o +(}[)o(1])410 4359 y({{\\htmladdnorma)o(ll)o(in)o(k{)o(\\t)o(ext)o(tt)o +({#)o(1})o(}{)o(ma)o(ilt)o(o:)o(#1)o(}})o(})192 4472 +y(\\fi)193 4585 y Fm(h)r Fi(=)q Fl(class)q Fm(i)109 4913 +y Ff(3.3)120 b(Commands)36 b(and)d(En)-5 b(vir)n(onments)35 +b(f)n(or)d(the)h(hcar)r(t)h(and)g(hcrepor)r(t)394 5063 +y(c)n(lasses)109 5253 y Fh(The)26 b(default)g(depth)f(of)i(section)f +(numbering)g(and)h(table)g(of)g(contents)e(is)i(thr)n(ee.)e +Fe(headings)e Fh(is)k(the)109 5366 y(default)19 b(page)g(style.)g(The)g +(page)g(number)h(is)g(printed)e(in)j(the)e(header)g(line,)h(the)f +(footer)f(line)j(is)f(empty)-10 b(.)193 5518 y Fm(h)r(\003)q +Fl(hca)m(rt)19 b Fm(j)g Fl(hcrep)s(o)m(rt)r Fm(i)p eop +%%Page: 19 20 +19 19 bop 109 -62 a Fq(3.3)99 b(Commands)25 b(and)f(Envir)n(onments)j +(for)e(the)g(hcart)h(and)f(hcr)n(eport)h(classes)389 +b Ft(19)p 109 -10 3544 4 v 192 270 a Fk(\\setcounter{se)o(cn)o(umd)o +(ep)o(th)o(}{)o(3})192 383 y(\\setcounter{to)o(cd)o(ept)o(h})o({3)o(}) +192 496 y(\\RequirePackag)o(e[)o(bre)o(ak)o(wo)o(rd)o(s])o({t)o(run)o +(ca)o(te)o(})192 609 y(\\newlength{\\ri)o(gh)o(tma)o(rk)o(le)o(ng)o(th) +o(})192 722 y(\\def\\ps@headin)o(gs)o({\\l)o(et)o(\\@)o(mk)o(bo)o(th)o +(\\ma)o(rk)o(bo)o(th)301 835 y(\\def\\@evenhead)o({\\v)o(bo)o(x{)o(\\h) +o(si)o(ze)o(=\\t)o(ex)o(tw)o(id)o(th)410 948 y(\\hb@xt@)51 +b(\\textwidth{\045)410 1061 y({\\pnumfont\\thep)o(ag)o(e\\)o(hf)o(il)o +(\\h)o(ead)o(fo)o(nt)o(\\t)o(ru)o(nca)o(te)o({0)o(.9)o(2\\)o(tex)o(tw)o +(id)o(th)o(}\045)519 1173 y({\\raggedleft\\st)o(ru)o(t\\)o(le)o(ft)o +(mar)o(k})o(}})o(\045)410 1286 y(\\if@hsl)g(\\vskip)h(1.5\\p@)g +(\\hrule)g(\\fi}})301 1399 y(\\def\\@oddhead{)o(\\se)o(tt)o(ow)o(id)o +(th)o({\\)o(rig)o(ht)o(ma)o(rk)o(le)o(ngt)o(h})o({\\)o(ri)o(gh)o(tma)o +(rk)o(}\045)355 1512 y(\\vbox{\\hsize=\\te)o(xt)o(wi)o(dt)o(h)410 +1625 y(\\hb@xt@)f(\\textwidth{{\\he)o(ad)o(fon)o(t\\)o(tr)o(un)o(ca)o +(te{)o(0.)o(92)o(\\t)o(ex)o(twi)o(dt)o(h})o(\045)519 +1738 y({\\strut\\ifthene)o(ls)o(e{)o(\\l)o(en)o(gth)o(te)o(st)o({\\)o +(ri)o(ght)o(ma)o(rk)o(le)o(ng)o(th=)o(0e)o(m})o(}\045)574 +1851 y({\\leftmark{}}{)o(\\r)o(ig)o(ht)o(ma)o(rk{)o(}})o(\045)574 +1964 y(\\hfil}\\hfil\\pn)o(um)o(fo)o(nt)o(\\t)o(hep)o(ag)o(e})o(}\045) +410 2077 y(\\if@hsl)g(\\vskip)h(1.5\\p@)g(\\hrule)g(\\fi}})301 +2190 y(\\def\\@evenfoot)o({\\v)o(bo)o(x{)o(\\h)o(si)o(ze)o(=\\t)o(ex)o +(tw)o(id)o(th)410 2303 y(\\if@fsl)f(\\hrule)h(\\vskip)g(3\\p@)h(\\fi) +410 2415 y(\\hb@xt@)e(\\textwidth{{\\pn)o(um)o(fon)o(t\\)o(hf)o(il)o +(}})o(}}\045)301 2528 y(\\def\\@oddfoot{)o(\\vb)o(ox)o({\\)o(hs)o(iz)o +(e=)o(\\te)o(xt)o(wi)o(dt)o(h)410 2641 y(\\if@fsl)g(\\hrule)h(\\vskip)g +(3\\p@)h(\\fi)410 2754 y(\\hb@xt@)e(\\textwidth{{\\pn)o(um)o(fon)o(t\\) +o(hf)o(il)o(}})o(}}\045)193 2867 y Fm(h)q Fl(hcrep)s(o)m(rt)r +Fm(i)110 b Fk(\\def\\chapterma)o(rk)o(##1)o({\045)193 +2980 y Fm(h)q Fl(hcrep)s(o)m(rt)r Fm(i)164 b Fk(\\markboth)51 +b({\\ifnum)g(\\c@secnumdepth)d(>\\m@ne)193 3093 y Fm(h)q +Fl(hcrep)s(o)m(rt)r Fm(i)437 b Fk(\\chaptermarkfor)o(ma)o(t\\)o(fi)193 +3206 y Fm(h)q Fl(hcrep)s(o)m(rt)r Fm(i)g Fk(##1}{}}\045)193 +3319 y Fm(h)q Fl(hcrep)s(o)m(rt)r Fm(i)110 b Fk(\\def\\sectionma)o(rk)o +(##1)o({\045)193 3432 y Fm(h)q Fl(hcrep)s(o)m(rt)r Fm(i)219 +b Fk(\\markright)50 b({\\ifnum)h(\\c@secnumdepth)d(>\\z@)193 +3545 y Fm(h)q Fl(hcrep)s(o)m(rt)r Fm(i)437 b Fk(\\sectionmarkfor)o(ma)o +(t\\)o(fi)193 3657 y Fm(h)q Fl(hcrep)s(o)m(rt)r Fm(i)g +Fk(##1}}})193 3770 y Fm(h)q Fl(hca)m(rt)q Fm(i)110 b +Fk(\\def\\sectionmar)o(k#)o(#1)o({\045)193 3883 y Fm(h)q +Fl(hca)m(rt)q Fm(i)165 b Fk(\\markboth)50 b({\\ifnum)h(\\c@secnumdepth) +e(>\\z@\045)193 3996 y Fm(h)q Fl(hca)m(rt)q Fm(i)219 +b Fk(\\sectionmarkfor)o(ma)o(t\\)o(fi)48 b(##1}{}})193 +4109 y Fm(h)q Fl(hca)m(rt)q Fm(i)110 b Fk(\\def\\subsection)o(ma)o(rk)o +(##)o(1{\045)193 4222 y Fm(h)q Fl(hca)m(rt)q Fm(i)165 +b Fk(\\markright)50 b({\\ifnum)h(\\c@secnumdepth)d(>\\@ne\045)193 +4335 y Fm(h)q Fl(hca)m(rt)q Fm(i)219 b Fk(\\subsectionmark)o(fo)o(rm)o +(at\\)o(fi)48 b(##1}}})192 4448 y(\\pagestyle{hea)o(di)o(ngs)o(})109 +4727 y Fr(3.3.1)100 b(The)28 b(hcarea)h(option)192 4907 +y Fk(\\if@hcarea)301 5020 y(\\RequirePackag)o(e{t)o(yp)o(ea)o(re)o(a}) +301 5133 y(\\areaset[15mm])o({15)o(0m)o(m})o({2)o(40)o(mm)o(})192 +5246 y(\\fi)109 5430 y Fr(3.3.2)100 b(The)28 b(hcf)n(ootnotes)g(option) +p eop +%%Page: 20 21 +20 20 bop 109 -62 a Ft(20)1941 b Fq(3)99 b(Commands)25 +b(and)g(Envir)n(onments)p 109 -10 3544 4 v 192 270 a +Fk(\\if@hcfootnote)o(s)301 383 y(\\deffootnote{1)o(em})o({0)o(.5)o(em)o +(})410 496 y({\\textsuperscri)o(pt)o({\\)o(no)o(rm)o(alf)o(on)o(t\\)o +(th)o(ef)o(oo)o(tno)o(te)o(ma)o(rk)o(}\\)o(,})192 609 +y(\\fi)109 788 y Fr(3.3.3)100 b(The)28 b(ma)o(gazine)f(option)p +-74 1024 1065 4 v -76 1137 4 113 v -24 1103 a Fe(\\articletitle{)o +Fg(title)l Fe(})p 988 1137 V -74 1140 1065 4 v 109 1314 +a Fh(Prints)22 b(the)g(article)h(<)p Fg(title)r Fh(>.)p +-74 1550 1430 4 v -76 1663 4 113 v -24 1629 a Fe(\\subjecttitle{)o +Fg(subject)-5 b Fe(}{)p Fg(title)q Fe(})p 1353 1663 V +-74 1667 1430 4 v 109 1841 a Fh(Prints)22 b(befor)n(e)g(the)g(article)h +(<)p Fg(title)r Fh(>)g(the)f(<)p Fg(subject)q Fh(>)g(in)h(a)h(smaller)f +(font.)p -74 2077 V -76 2190 4 113 v -24 2156 a Fe(\\titlesubject{)o +Fg(title)l Fe(}{)p Fg(subject)p Fe(})p 1353 2190 V -74 +2193 1430 4 v 109 2367 a Fh(Prints)f(after)g(the)g(article)i(<)p +Fg(title)q Fh(>)f(the)f(<)p Fg(subject)q Fh(>)h(in)g(a)g(smaller)g +(font.)p -74 2603 1315 4 v -76 2716 4 113 v -24 2682 +a Fe(\\articlesectio)o(n{)o Fg(heading)l Fe(})p 1239 +2716 V -74 2719 1315 4 v 109 2893 a Fh(Prints)f(a)h(heading)f(within)h +(an)g(article)h(\(actually)-10 b(,)23 b(a)h Fe(\\subsection*)p +Fh(\).)p -74 3130 1412 4 v -76 3242 4 113 v -24 3209 +a Fe(\\begin{art}[)p Fg(signatur)n(e)l Fe(]{)p Fg(title)q +Fe(})p 1335 3242 V -74 3246 1412 4 v 109 3420 a Fh(A)31 +b(magazine)i(article)g(set)d(in)i(two)f(columns)h(with)g(a)g(<)p +Fg(title)q Fh(>)g(\(using)g Fe(\\articletitle)p Fh(\))26 +b(and)32 b(an)109 3533 y(optional)22 b(<)p Fg(signatur)n(e)r +Fh(>)h(\(using)f Fe(\\sig)p Fh(\).)f(Requir)n(es)h(the)g +Fe(multicol)d Fh(package.)p -74 3769 2104 4 v -76 3882 +4 113 v -24 3848 a Fe(\\begin{artsubt)o(it)o(}[)o Fg(signatur)n(e)l +Fe(]{)p Fg(subject)p Fe(}{)p Fg(title)q Fe(})p 2028 3882 +V -74 3885 2104 4 v 109 4059 a Fh(Like)i(the)h Fe(art)g +Fh(envir)n(onment,)g(but)g(uses)f Fe(\\subjecttitle)c +Fh(instead)22 b(of)g Fe(\\articletitle)p Fh(.)p -74 4295 +V -76 4408 4 113 v -24 4374 a Fe(\\begin{arttits)o(ub)o(}[)o +Fg(signatur)n(e)l Fe(]{)p Fg(title)q Fe(}{)p Fg(subject)p +Fe(})p 2028 4408 V -74 4411 2104 4 v 109 4585 a Fh(Like)f(the)h +Fe(art)g Fh(envir)n(onment,)g(but)g(uses)f Fe(\\titlesubject)c +Fh(instead)22 b(of)g Fe(\\articletitle)p Fh(.)192 4728 +y Fk(\\if@magazine)301 4841 y(\\RequirePackag)o(e{m)o(ul)o(ti)o(co)o +(l})301 4954 y(\\newcommand{\\a)o(rti)o(cl)o(et)o(it)o(le)o(}[1)o(])410 +5066 y({\\addsec[#1]{\\L)o(AR)o(GE)48 b(#1}})301 5179 +y(\\newcommand{\\s)o(ubj)o(ec)o(tt)o(it)o(le)o(}[2)o(])410 +5292 y({\\addsec[#2]{{\\)o(la)o(rg)o(e)g(#1}\\\\{\\LARGE)h(#2}}})301 +5405 y(\\newcommand{\\t)o(itl)o(es)o(ub)o(je)o(ct)o(}[2)o(])410 +5518 y({\\addsec[#1]{{\\)o(LA)o(RG)o(E)f(#1}\\\\{\\large)h(#2}}})p +eop +%%Page: 21 22 +21 21 bop 109 -62 a Fq(3.4)99 b(Commands)23 b(and)g(Envir)n(onments)i +(for)f(the)g(hcart,)g(hcr)n(eport)h(and)e(hcslides)17 +b(.)e(.)g(.)198 b Ft(21)p 109 -10 3544 4 v 301 270 a +Fk(\\newcommand{\\a)o(rti)o(cl)o(es)o(ec)o(ti)o(on)o(}[1)o(]{)o(\\s)o +(ub)o(se)o(cti)o(on)o(*{)o(#1)o(}})301 383 y(\\newcommand{\\c)o(urr)o +(en)o(ts)o(ig)o(}{)o(})301 496 y(\\newenvironmen)o(t{@)o(ar)o(t})o([2)o +(][)o(]{)o(\045)410 609 y(\\begin{multicol)o(s})o({2)o(}[)o(#2)o(])410 +722 y(\\renewcommand{\\)o(cu)o(rr)o(en)o(ts)o(ig)o(}{#)o(1})o(\045)301 +835 y(}{\045)410 948 y(\\ifthenelse{\\eq)o(ua)o(l{)o(\\c)o(ur)o(re)o +(nts)o(ig)o(}{)o(}})519 1061 y({})519 1173 y({\\sig{\\currents)o(ig)o +(}})410 1286 y(\\end{multicols})o(\045)301 1399 y(})301 +1512 y(\\newenvironmen)o(t{a)o(rt)o(}[)o(2])o([])410 +1625 y({\\begin{@art}[#)o(1])o({\\)o(ar)o(ti)o(cl)o(eti)o(tl)o(e{)o(#2) +o(}})o(}{\\)o(en)o(d{)o(@a)o(rt)o(}})301 1738 y(\\newenvironmen)o(t{a)o +(rt)o(su)o(bt)o(it)o(}[)o(3][)o(])410 1851 y({\\begin{@art}[#)o(1])o +({\\)o(su)o(bj)o(ec)o(tti)o(tl)o(e{)o(#2)o(}{)o(#3})o(}})o({\\)o(en)o +(d{)o(@ar)o(t})o(})301 1964 y(\\newenvironmen)o(t{a)o(rt)o(ti)o(ts)o +(ub)o(}[)o(3][)o(])410 2077 y({\\begin{@art}[#)o(1])o({\\)o(ti)o(tl)o +(es)o(ubj)o(ec)o(t{)o(#2)o(}{)o(#3})o(}})o({\\)o(en)o(d{)o(@ar)o(t})o +(})192 2190 y(\\fi)109 2450 y Fr(3.3.4)100 b(The)28 b(par)o(skip)f +(option)192 2627 y Fk(\\if@parskip)301 2740 y(\\setlength\\par)o(ski)o +(p{)o(\\m)o(ed)o(sk)o(ip)o(amo)o(un)o(t})301 2852 y(\\setlength\\par)o +(ind)o(en)o(t{)o(0p)o(t})192 2965 y(\\fi)109 3136 y Fr(3.3.5)100 +b(The)28 b(wide)f(option)192 3313 y Fk(\\if@wide)301 +3426 y(\\linespread{1.)o(3})192 3539 y(\\fi)193 3652 +y Fm(h)r Fi(=)q Fl(hca)m(rt)19 b Fm(j)g Fl(hcrep)s(o)m(rt)r +Fm(i)109 3852 y Ff(3.4)120 b(Commands)36 b(and)d(En)-5 +b(vir)n(onments)35 b(f)n(or)d(the)h(hcar)r(t,)i(hcrepor)r(t)e(and)394 +4001 y(hcslides)j(c)n(lasses)109 4186 y Fr(3.4.1)100 +b(The)28 b(bib)f(option)109 4363 y Fh(W)-5 b(ith)19 b(the)g +Fe(fnbib)f Fh(option)h(\(default\),)g(the)g Fe(\\cite)f +Fh(and)i Fe(\\citet)d Fh(and)i Fe(\\cite)f Fh(commands)i(all)h(work)109 +4476 y(the)g(same.)255 4589 y(W)-5 b(ith)27 b(the)e Fe(autbib)f +Fh(option,)h Fe(\\cite)g Fh(always)i(works)e(like)i Fe(\\citep)p +Fh(,)c(i.)15 b(e.)26 b(puts)g(the)f(citation)j(in)109 +4702 y(brackets.)21 b(Use)h Fe(\\citet)e Fh(if)j(you)f(do)g(not)g(want) +g(this.)255 4815 y(Commands)g(like)g Fe(\\cite)d Fh(should)i(always)h +(be)f(used)f Fg(without)j Fh(a)f(space)f(between)f(them)h(and)h(the)109 +4928 y(pr)n(eceeding)f(text.)193 5066 y Fm(h)q Fl(class)p +Fm(i)q Fk(\\newcommand{\\bi)o(bl)o(io)o(st)o(yle)o(}{)o(hc)o(-e)o(n}) +193 5179 y Fm(h)r(\003)q Fl(hca)m(rt)e Fm(j)g Fl(hcrep)s(o)m(rt)h +Fm(j)f Fl(hcslides)q Fm(i)192 5292 y Fk(\\if@bib)192 +5405 y(\\if@fnbib)301 5518 y(\\bibpunct[,)49 b(]{}{}{;}{a}{}{,)o(})p +eop +%%Page: 22 23 +22 22 bop 109 -62 a Ft(22)1941 b Fq(3)99 b(Commands)25 +b(and)g(Envir)n(onments)p 109 -10 3544 4 v 301 270 a +Fk(\\renewcommand\\)o(NAT)o(@c)o(it)o(e\045)410 383 y +([3]{\\footnote{\\)o(if)o(NA)o(T@)o(sw)o(a\\N)o(AT)o(@@)o(op)o(en)o +(\\i)o(f*#)o(2*)o(\\e)o(ls)o(e#)o(2\\)48 b(\\fi)628 496 +y(#1\\if*#3*\\else\\)o(NA)o(T@)o(cmt)o(#3)o(\\f)o(i\\)o(NA)o(T@)o(@cl)o +(os)o(e\\)o(el)o(se)o(#1\\)o(fi)o(}\\)o(en)o(dg)o(rou)o(p})301 +609 y(\\let\\@cite\\NAT)o(@ci)o(te)192 722 y(\\fi)192 +835 y(\\if@autbib)301 948 y(\\bibpunct[,)h(]{)54 b([}{]}{;}{a}{}{,)o(}) +301 1061 y(\\let\\cite\\cite)o(p)192 1173 y(\\fi)192 +1286 y(\\if@numbib)355 1399 y(\\bibpunct[,)c(]{)k([}{]}{;}{n}{}{)o(,}) +192 1512 y(\\fi)p -74 1744 1134 4 v -76 1857 4 113 v +-24 1823 a Fe(\\cfcite[)p Fg(pages)n Fe(]{)p Fg(sour)n(ce)p +Fe(})p 1058 1857 V -74 1860 1134 4 v 109 2034 a Fh(Shortcut)21 +b(for)i Fe(\\cite[)p Fg(cf.)m Fe(][)p Fg(pages)q Fe(]{)p +Fg(sour)n(ce)p Fe(})p Fh(.)192 2175 y Fk(\\newcommand{\\c)o(fc)o(ite)o +(}[)o(2])o([])o({\\)o(cit)o(e[)o(\\c)o(ft)o(ex)o(t])o([#1)o(]{)o(#2)o +(}})p -74 2407 1148 4 v -76 2520 4 113 v -24 2486 a Fe(\\biblio[)p +Fg(style)n Fe(]{)p Fg(bib)f(\002les)q Fe(})p 1072 2520 +V -74 2523 1148 4 v 109 2697 a Fh(W)-7 b(rites)40 b(the)g(bibliography) +-10 b(.)40 b(<)p Fg(bib)24 b(\002les)q Fh(>)41 b(is)f(a)i +(comma-separated)e(list)h(of)f(bib)i(\002les,)e(<)p Fg(style)r +Fh(>)h(the)109 2810 y(B)m Fc(I)r(B)-5 b Fh(T)269 2840 +y(E)313 2810 y(X)22 b(style)g(\002le)g(\(by)h(default)g +Fe(hc-en)d Fh(for)j(English)f(documents\).)193 2951 y +Fm(h)q Fl(hca)m(rt)d Fm(j)g Fl(hcslides)q Fm(i)q Fk(\\if@paper)193 +3063 y Fm(h)q Fl(hca)m(rt)g Fm(j)g Fl(hcslides)q Fm(i)110 +b Fk(\\newcommand{\\b)o(ef)o(or)o(ebi)o(bl)o(io)o(}{)o(\\n)o(ewp)o(ag)o +(e})193 3176 y Fm(h)q Fl(hca)m(rt)19 b Fm(j)g Fl(hcslides)q +Fm(i)q Fk(\\else)193 3289 y Fm(h)q Fl(hca)m(rt)g Fm(j)g +Fl(hcslides)q Fm(i)110 b Fk(\\newcommand{\\b)o(ef)o(or)o(ebi)o(bl)o(io) +o(}{)o(\\v)o(fil)o(l})193 3402 y Fm(h)q Fl(hca)m(rt)19 +b Fm(j)g Fl(hcslides)q Fm(i)q Fk(\\fi)192 3515 y(\\newcommand{\\b)o(ib) +o(lio)o(}[)o(2])o([\\)o(bi)o(bli)o(os)o(ty)o(le)o(]{)o(\045)193 +3628 y Fm(h)q Fl(hca)m(rt)g Fm(j)g Fl(hcslides)q Fm(i)110 +b Fk(\\beforebiblio)301 3741 y(\\bibliographys)o(tyl)o(e{)o(#1)o(})301 +3854 y(\\bibliography{)o(#2})o(\045)192 3967 y(})p -74 +4199 1375 4 v -76 4312 4 113 v -24 4278 a Fe(\\qu[)p +Fg(pages)p Fe(]{)p Fg(sour)n(ce)p Fe(}{)p Fg(quotation)p +Fe(})p 1299 4312 V -74 4315 1375 4 v 109 4489 a Fh(A)22 +b(<)p Fg(quotation)q Fh(>)h(in)g(quotes)e(followed)h(by)h(the)e(r)n +(efer)n(ence)h([<)p Fg(sour)n(ce)r Fh(>,)h(<)p Fg(pages)r +Fh(>].)192 4630 y Fk(\\newcommand{\\q)o(u})o([3])o([])o({\\)o(q{)o(#3)o +(}\\c)o(it)o(e[)o(#1)o(]{)o(#2)o(}})p -74 4862 1430 4 +v -76 4974 4 113 v -24 4941 a Fe(\\qul[)p Fg(pages)o +Fe(]{)p Fg(sour)n(ce)q Fe(}{)p Fg(quotation)p Fe(})p +1354 4974 V -74 4978 1430 4 v 109 5152 a Fh(Like)e Fe(\\qu)h +Fh(but)g(inside)g(a)i Fe(quote)c Fh(envir)n(onment)i(\(for)h(longer)f +(quotions\).)192 5292 y Fk(\\newcommand{\\q)o(ul)o(}[3)o(][)o(]{)o(\\b) +o(eg)o(in{)o(qu)o(ot)o(e})301 5405 y(\\qu[#1]{#2}{#3)o(})301 +5518 y(\\end{quote}})p eop +%%Page: 23 24 +23 23 bop 109 -62 a Fq(3.4)99 b(Commands)23 b(and)g(Envir)n(onments)i +(for)f(the)g(hcart,)g(hcr)n(eport)h(and)e(hcslides)17 +b(.)e(.)g(.)198 b Ft(23)p 109 -10 3544 4 v -74 191 1206 +4 v -76 304 4 113 v -24 270 a Fe(\\biburl{)p Fg(url)l +Fe(}{)p Fg(access)23 b(date)r Fe(})p 1130 304 V -74 307 +1206 4 v 109 481 a Fh(<)p Fg(url)p Fh(>)h(and)h(<)p Fg(access)f(date)q +Fh(>)h(of)f(online)g(documents.)f(For)g(online-only)h(documents)f(use)g +(a)k Fc(M)t(A)t(N)t(U)t(A)t(L)109 594 y Fh(entry)19 b(with)i +Fe(\\biburl)d Fh(in)j(the)h Fc(O)t(R)t(G)t(A)t(N)t(I)t(Z)t(A)o(T)t(I)t +(O)t(N)27 b Fh(\002eld.)21 b(For)f(other)f(documents)h(put)g(it)h(in)g +(the)h Fc(N)t(O)t(T)t(E)109 707 y Fh(\002eld.)301 840 +y Fk(\\if@htmlbib)410 953 y(\\newcommand{\\bi)o(bu)o(rl)o(}[)o(2])o +({\\)o(onl)o(in)o(et)o(ex)o(t\\)o(\\)464 1066 y({\\small\\hturl{#1)o +(}})o(\\\\)o(\\a)o(cc)o(ess)o(te)o(xt)o(\\)48 b(#2})301 +1179 y(\\else)410 1292 y(\\newcommand{\\bi)o(bu)o(rl)o(}[)o(2])o({\\)o +(onl)o(in)o(et)o(ex)o(t\\)o(\\)464 1404 y({\\small\\texttt{#)o(1})o +(}\\)o(\\\\)o(ac)o(ces)o(st)o(ex)o(t\\)g(#2})301 1517 +y(\\fi)p -74 1743 482 4 v -76 1856 4 113 v -24 1822 a +Fe(\\bibdiv)p 406 1856 V -74 1859 482 4 v 109 2033 a +Fh(Separator)21 b(between)g(the)h(title)h(and)f(subtitle)g(of)h(a)g +(document.)355 2166 y Fk(\\newcommand{\\bib)o(di)o(v})o({.)48 +b(})p -74 2392 2344 4 v -76 2505 4 113 v -24 2471 a Fe(\\bibvol[)p +Fg(separating)21 b(word)q Fe(]{)p Fg(volume)i(number)o +Fe(}{)p Fg(serial)h(title)r Fe(})p 2267 2505 V -74 2508 +2344 4 v 109 2682 a Fh(Use)e(at)i(the)f(end)g(of)h(the)h +Fc(T)t(I)t(T)t(L)t(E)j Fh(\002eld)23 b(\(without)g(space)g(befor)n(e\)) +h(if)h(the)e(output)f(of)h(the)i Fc(V)t(O)t(L)t(U)t(M)t(E)k +Fh(and)111 2795 y Fc(S)t(E)t(R)t(I)t(E)t(S)e Fh(\002elds)21 +b(is)h(not)f(convincing.)i(Inter)n(esting)d(especially)i(for)g(German)g +(documents)e(wher)n(e)h(`der')109 2908 y(instead)g(of)i(`von')g(is)g +(used)e(as)i(<)p Fg(separating)j(word)p Fh(>)d(\(English:)f(`of'\).)355 +3041 y Fk(\\newcommand{\\bib)o(vo)o(l})o([3)o(][)o(\\b)o(ibv)o(ol)o(te) +o(xt)o(])464 3154 y({\\emph{,)51 b(\\bvtext~#2)f(#1})j(#3})p +-74 3379 536 4 v -76 3492 4 113 v -24 3458 a Fe(\\addrdiv)p +460 3492 V -74 3495 536 4 v 109 3669 a Fh(Separator)21 +b(between)g(dif)n(fer)n(ent)i(places)g(in)g(a)g(B)m Fc(I)r(B)-5 +b Fh(T)1851 3699 y(E)1895 3669 y(X)22 b(entry's)h Fc(A)t(D)t(D)t(R)t(E) +t(S)t(S)29 b Fh(\002eld.)355 3802 y Fk(\\newcommand{\\add)o(rd)o(iv)o +(}{)48 b(--)53 b(})p -74 4028 638 4 v -76 4141 4 113 +v -24 4107 a Fe(\\etal[)p Fg(year)n Fe(])p 562 4141 V +-74 4144 638 4 v 109 4318 a Fh(Ends)38 b(a)j(list)f(\(e.)14 +b(g.)40 b(of)g(places)g(in)g(a)g(B)m Fc(I)r(B)-5 b Fh(T)1596 +4348 y(E)1640 4318 y(X)40 b(entry's)g Fc(A)t(D)t(D)t(R)t(E)t(S)t(S)47 +b Fh(\002eld\))39 b(which)i(is)f(not)f(complete)109 4431 +y(\(`)23 b(et)f(al'\))q(.)h(A)f(<)p Fg(year)r Fh(>)h(can)g(be)g(given)f +(which)h(is)g(printed)e(afterwar)n(ds.)192 4564 y Fk(\\newcommand{\\e)o +(ta)o(l}[)o(1])o([])o({)48 b(et~al\045)301 4677 y(\\ifthenelse{\\e)o +(qua)o(l{)o(#1)o(}{)o(}})o({})o({.)g(#1}\045)192 4790 +y(})p -74 5004 646 4 v -76 5117 4 113 v -24 5083 a Fe(\\noyear)p +569 5117 V -76 5230 V -24 5196 a(\\noaddress)p 569 5230 +V -74 5233 646 4 v 109 5405 a Fh(Use)33 b(in)h(the)i +Fc(Y)t(E)t(A)t(R)h Fh(r)n(esp.)e Fc(A)t(D)t(D)t(R)t(E)t(S)t(S)41 +b Fh(\002eld)33 b(of)i(a)f(B)m Fc(I)r(B)-5 b Fh(T)2021 +5435 y(E)2065 5405 y(X)34 b(entry)f(when)h(no)f(year)h(r)n(esp.)f(addr) +n(ess)g(is)109 5518 y(known.)p eop +%%Page: 24 25 +24 24 bop 109 -62 a Ft(24)1941 b Fq(3)99 b(Commands)25 +b(and)g(Envir)n(onments)p 109 -10 3544 4 v 109 270 a +Fb(The)f(f)n(ollo)o(wing)g(commands)e(are)j(f)n(or)g(mo)n(vie)f +(databases)e(\(use)k Fa(M)t(A)t(N)t(UA)t(L)j Fb(entr)q(y\):)p +-74 563 482 4 v -76 675 4 113 v -24 642 a Fe(\\bibdir)p +406 675 V -74 679 482 4 v 109 853 a Fh(Give)23 b(the)f(dir)n(ector)g +(in)h(the)h Fc(A)t(U)t(T)t(H)t(O)t(R)i Fh(\002eld)c(in)h(the)f +(following)h(way:)109 966 y Fe(Surname,)51 b(\\bibdir,)f(Christian)h +(Name)p -74 1258 1754 4 v -76 1371 4 113 v -24 1337 a(\\bibmov{)p +Fg(country)l Fe(}{)p Fg(studio)q Fe(}{)p Fg(main)22 b(actors)q +Fe(})p 1678 1371 V -74 1374 1754 4 v 109 1548 a Fh(Put)g(in)h(the)h +Fc(O)t(R)t(G)t(A)t(N)t(I)t(Z)t(A)o(T)t(I)t(O)t(N)k Fh(\002eld.)301 +1715 y Fk(\\newcommand{\\b)o(ibm)o(ov)o(}[)o(3])o({\\)o(bib)o(mo)o(vt)o +(ex)o(t\\)o(bi)o(bdi)o(v\\)48 b(#2,)53 b(#1\\bibdiv\\)410 +1828 y(\\bibactorsbefor)o(e\\)48 b(#3)53 b(\\bibactorsafter)o(})192 +1941 y(\\fi)109 2279 y Fr(3.4.2)100 b(The)28 b(pdf)f(option)192 +2470 y Fk(\\newcommand{\\h)o(yp)o(ert)o(it)o(le)o(}{)o(})192 +2582 y(\\newcommand{\\h)o(yp)o(era)o(ut)o(ho)o(r})o({})192 +2695 y(\\newcommand{\\h)o(yp)o(era)o(bs)o(tr)o(ac)o(t})o({})192 +2808 y(\\newcommand{\\h)o(yp)o(erk)o(ey)o(wo)o(rd)o(s})o({})192 +2921 y(\\if@pdf)301 3034 y(\\AtEndOfClass{)o(\\Re)o(qu)o(ir)o(eP)o(ac)o +(kag)o(e[)o(hy)o(pe)o(ri)o(nd)o(ex,)o(co)o(lo)o(rl)o(in)o(ks=)o(tr)o +(ue)o(,)464 3147 y(pdftex,latex2htm)o(l,)o(ex)o(te)o(nsi)o(on)o(=p)o +(df)o(]{)o(hy)o(per)o(re)o(f})o(})301 3260 y(\\AtBeginDocume)o(nt{)o +(\045)410 3373 y(\\let\\oldautdiv\\)o(au)o(td)o(iv)410 +3486 y(\\renewcommand{\\)o(au)o(td)o(iv)o(}{)o(,)49 b(})410 +3599 y(\\ifthenelse{\\eq)o(ua)o(l{)o(\\h)o(yp)o(ert)o(it)o(le)o(}{)o +(}})574 3712 y({\\renewcommand)o({\\)o(hy)o(pe)o(rti)o(tl)o(e})o({\\)o +(cu)o(rr)o(ent)o(ti)o(tl)o(e})o(}{)o(})410 3824 y(\\ifthenelse{\\eq)o +(ua)o(l{)o(\\h)o(yp)o(era)o(ut)o(ho)o(r})o({})o(})574 +3937 y({\\renewcommand)o({\\)o(hy)o(pe)o(rau)o(th)o(or)o(}{)o(\\c)o(ur) +o(ren)o(ta)o(ut)o(ho)o(r})o(}{})410 4050 y(\\ifthenelse{\\eq)o(ua)o(l{) +o(\\h)o(yp)o(era)o(bs)o(tr)o(ac)o(t})o({})o(})574 4163 +y({\\renewcommand)o({\\)o(hy)o(pe)o(rab)o(st)o(ra)o(ct)o(}{)o(\\a)o +(bst)o(ex)o(t})o(}{)o(})410 4276 y(\\ifthenelse{\\eq)o(ua)o(l{)o(\\h)o +(yp)o(erk)o(ey)o(wo)o(rd)o(s})o({})o(})574 4389 y({\\renewcommand)o +({\\)o(hy)o(pe)o(rke)o(yw)o(or)o(ds)o(}{)o(\\k)o(eyw)o(or)o(ds)o(te)o +(xt)o(}}{)o(})410 4502 y(\\pdfinfo{)574 4615 y(/Title)i +(\(\\hypertitle\))574 4728 y(/Author)g(\(\\hyperauthor\))574 +4841 y(/Subject)f(\(\\hyperabstract\))574 4954 y(/Keywords)g +(\(\\hyperkeywords)o(\))519 5066 y(})519 5179 y(\\let\\autdiv\\old)o +(au)o(td)o(iv)301 5292 y(})192 5405 y(\\fi)193 5518 y +Fm(h)r Fi(=)q Fl(hca)m(rt)19 b Fm(j)g Fl(hcrep)s(o)m(rt)h +Fm(j)f Fl(hcslides)q Fm(i)p eop +%%Page: 25 26 +25 25 bop 109 -62 a Fq(3.4)99 b(Commands)23 b(and)g(Envir)n(onments)i +(for)f(the)g(hcart,)g(hcr)n(eport)h(and)e(hcslides)17 +b(.)e(.)g(.)198 b Ft(25)p 109 -10 3544 4 v 109 270 a +Fr(3.4.3)100 b(Title)27 b(commands)p -74 629 318 4 v +-76 742 4 113 v -24 708 a Fe(\\toc)p 242 742 V -74 746 +318 4 v 109 920 a Fh(Puts)20 b(the)h(table)i(of)e(contents)f(at)i(the)f +(end)g(of)h(the)f(curr)n(ent)g(page)g(\(i.e.)h(after)g(a)g(vertical)h +(\002ll)g(and)e(befor)n(e)109 1032 y(a)j(pagebr)n(eak\).)g(W)-5 +b(ith)24 b(the)f Fe(paper)f Fh(option)h(the)g(table)i(of)f(contents)e +(is)j(generated)c(automatically)-10 b(,)26 b(so)109 1145 +y Fe(\\toc)21 b Fh(does)g(nothing)g(at)i(all.)193 1340 +y Fm(h)r(\003)q Fl(hca)m(rt)c Fm(j)g Fl(hcslides)q Fm(i)192 +1453 y Fk(\\if@paper)301 1566 y(\\newcommand{\\@)o(toc)o(}{)o(\045)410 +1679 y(\\newpage)193 1792 y Fm(h)q Fl(hca)m(rt)q Fm(i)219 +b Fk(\\thispagestyle{)o(em)o(pt)o(y})193 1905 y Fm(h)q +Fl(hcslides)p Fm(i)h Fk(\\slidepagestyl)o(e{)o(HC)o(})193 +2018 y Fm(h)q Fl(hca)m(rt)q Fm(i)f Fk(\\if@wide)51 b(\\linespread{1})d +(\\fi)410 2131 y(\\tableofcontent)o(s)193 2244 y Fm(h)q +Fl(hca)m(rt)q Fm(i)219 b Fk(\\if@wide)51 b(\\linespread{1.3)o(})d(\\fi) +410 2357 y(\\newpage\045)301 2470 y(})301 2582 y(\\newcommand{\\t)o +(oc})o({})192 2695 y(\\else)301 2808 y(\\newcommand{\\@)o(toc)o(}{)o +(\045)410 2921 y(\\vfill)193 3034 y Fm(h)q Fl(hca)m(rt)q +Fm(i)219 b Fk(\\thispagestyle{)o(em)o(pt)o(y})193 3147 +y Fm(h)q Fl(hcslides)p Fm(i)h Fk(\\slidepagestyl)o(e{)o(HC)o(})193 +3260 y Fm(h)q Fl(hca)m(rt)q Fm(i)f Fk(\\if@wide)51 b(\\linespread{1})d +(\\fi)410 3373 y(\\tableofcontent)o(s)193 3486 y Fm(h)q +Fl(hca)m(rt)q Fm(i)219 b Fk(\\if@wide)51 b(\\linespread{1.3)o(})d(\\fi) +410 3599 y(\\newpage\045)301 3712 y(})301 3824 y(\\newcommand{\\t)o +(oc})o({\\)o(@t)o(oc)o(})192 3937 y(\\fi)193 4050 y Fm(h)r +Fi(=)q Fl(hca)m(rt)19 b Fm(j)g Fl(hcslides)q Fm(i)193 +4163 y(h)r(\003)q Fl(hcrep)s(o)m(rt)r Fm(i)192 4276 y +Fk(\\newcommand{\\@)o(to)o(c}{)301 4389 y(\\if@wide)51 +b(\\linespread{1})d(\\fi)301 4502 y(\\tableofconten)o(ts)301 +4615 y(\\if@wide)j(\\linespread{1.)o(3})d(\\fi)301 4728 +y(\\thispagestyle)o({em)o(pt)o(y})192 4841 y(})192 4954 +y(\\if@paper)301 5066 y(\\newcommand{\\t)o(oc})o({})192 +5179 y(\\else)301 5292 y(\\newcommand{\\t)o(oc})o({\\)o(@t)o(oc)o(})192 +5405 y(\\fi)193 5518 y Fm(h)r Fi(=)q Fl(hcrep)s(o)m(rt)r +Fm(i)p eop +%%Page: 26 27 +26 26 bop 109 -62 a Ft(26)1941 b Fq(3)99 b(Commands)25 +b(and)g(Envir)n(onments)p 109 -10 3544 4 v -74 174 2025 +4 v -76 287 4 113 v -24 253 a Fe(\\titsubinfo{)p Fg(main)17 +b(title)q Fe(}{)p Fg(sub)22 b(title)q Fe(}{)p Fg(mor)n(e)h(info)q +Fe(})p 1949 287 V -76 400 V -24 366 a(\\titsub{)p Fg(main)c(title)q +Fe(}{)p Fg(sub)j(title)q Fe(})p 1949 400 V -76 513 V +-24 479 a(\\titinfo{)p Fg(main)c(title)r Fe(}{)p Fg(mor)n(e)23 +b(info)p Fe(})p 1949 513 V -74 516 2025 4 v 109 688 a +Fh(They)g(should)g(be)h(used)f(in)i(the)e(pr)n(emable)i(\226)g(call)h +Fe(\\tit[ver])20 b Fh(or)k Fe(\\titaut[ver])19 b Fh(in)25 +b(the)e(docu-)109 801 y(ment)c(body)-10 b(.)19 b(Use)g(if)i(your)e +(document)g(has)i(a)f(main)i(title)e(and)g(a)h(sub)e(title)h(and/or)g +(you)f(want)i(to)e(give)109 914 y(additional)27 b(information.)g(Leave) +f(the)g(<)p Fg(title)q Fh(>)h(parameter)f(of)g Fe(\\tit[...])78 +b Fh(empty)-10 b(.)24 b(<)p Fg(mor)n(e)g(info)q Fh(>)109 +1027 y(is)e(printed)g(below)g(the)g(<)p Fg(\(sub\))h(title)r +Fh(>)g(in)g(a)g(small)h(font.)193 1228 y Fm(h)r(\003)q +Fl(hca)m(rt)19 b Fm(j)g Fl(hcrep)s(o)m(rt)h Fm(j)f Fl(hcslides)q +Fm(i)192 1340 y Fk(\\if@paper)301 1453 y(\\newcommand{\\t)o(its)o(ub)o +(in)o(fo)o(}[)o(3]{)410 1566 y(\\renewcommand{\\)o(de)o(fa)o(ul)o(tt)o +(itl)o(e})o({\045)519 1679 y(#1\\vfill)519 1792 y({\\Large)51 +b(#2\\vfill})519 1905 y(\\vfill)h({\\normalsize)d(#3\\vfill}\045)410 +2018 y(})410 2131 y(\\renewcommand{\\)o(cu)o(rr)o(en)o(tt)o(itl)o(e})o +({#)o(1})o(\045)301 2244 y(})301 2357 y(\\newcommand{\\t)o(its)o(ub)o +(}[)o(2])o({)410 2470 y(\\renewcommand{\\)o(de)o(fa)o(ul)o(tt)o(itl)o +(e})o({\045)519 2582 y(#1\\vfill)519 2695 y({\\Large)i +(#2\\vfill\\vfill}\045)410 2808 y(})410 2921 y(\\renewcommand{\\)o(cu)o +(rr)o(en)o(tt)o(itl)o(e})o({#)o(1})o(\045)301 3034 y(})301 +3147 y(\\newcommand{\\t)o(iti)o(nf)o(o})o([2)o(]{)410 +3260 y(\\renewcommand{\\)o(de)o(fa)o(ul)o(tt)o(itl)o(e})o({\045)519 +3373 y(#1\\vfill)519 3486 y(\\vfill)h({\\normalsize)d(#2\\vfill}\045) +410 3599 y(})410 3712 y(\\renewcommand{\\)o(cu)o(rr)o(en)o(tt)o(itl)o +(e})o({#)o(1})o(\045)301 3824 y(})192 3937 y(\\else)301 +4050 y(\\newcommand{\\t)o(its)o(ub)o(in)o(fo)o(}[)o(3]{)410 +4163 y(\\renewcommand{\\)o(de)o(fa)o(ul)o(tt)o(itl)o(e})o({#)o(1\\)o +(\\[)o(0.)o(8ex)o(])519 4276 y({\\Large)i(#2\\\\[0.8ex]})519 +4389 y({\\normalsize)e(#3\\\\}\045)410 4502 y(})410 4615 +y(\\renewcommand{\\)o(cu)o(rr)o(en)o(tt)o(itl)o(e})o({#)o(1})o(\045)301 +4728 y(})301 4841 y(\\newcommand{\\t)o(its)o(ub)o(}[)o(2])o({)410 +4954 y(\\renewcommand{\\)o(de)o(fa)o(ul)o(tt)o(itl)o(e})o({#)o(1\\)o +(\\[)o(0.)o(8ex)o(])519 5066 y({\\Large)i(#2\\\\[0.8ex]}\045)410 +5179 y(})410 5292 y(\\renewcommand{\\)o(cu)o(rr)o(en)o(tt)o(itl)o(e})o +({#)o(1})o(\045)301 5405 y(})301 5518 y(\\newcommand{\\t)o(iti)o(nf)o +(o})o([2)o(]{)p eop +%%Page: 27 28 +27 27 bop 109 -62 a Fq(3.4)99 b(Commands)23 b(and)g(Envir)n(onments)i +(for)f(the)g(hcart,)g(hcr)n(eport)h(and)e(hcslides)17 +b(.)e(.)g(.)198 b Ft(27)p 109 -10 3544 4 v 410 270 a +Fk(\\renewcommand{\\)o(de)o(fa)o(ul)o(tt)o(it)o(le})o({#)o(1\\)o(\\[)o +(0.)o(8ex)o(])519 383 y({\\normalsize)49 b(#2\\\\}\045)410 +496 y(})410 609 y(\\renewcommand{\\)o(cu)o(rr)o(en)o(tt)o(it)o(le})o +({#)o(1})o(\045)301 722 y(})192 835 y(\\fi)p -74 1169 +2042 4 v -76 1282 4 113 v -24 1248 a Fe(\\autinfo{)p +Fg(author)m Fe(}{)p Fg(addr)n(ess)r Fe(}{)p Fg(email)p +Fe(}{)p Fg(homepage)r Fe(})p 1965 1282 V -74 1285 2042 +4 v 109 1459 a Fh(Should)23 b(be)h(used)e(in)i(the)f(pr)n(emable)i +(\226)f(call)i Fe(\\tit)p Fh(,)c Fe(\\titaut)f Fh(or)i +Fe(\\titautver)d Fh(in)k(the)f(document)109 1572 y(body)-10 +b(.)31 b(Speci\002es)h(information)i(about)f(the)f(author)g(\(name,)i +(addr)n(ess,)d(mail-addr)n(ess)i(and)g(home-)109 1685 +y(page\).)22 b(Use)f Fe(\\autdiv)f Fh(r)n(esp.)h Fe(\\autinfodiv)d +Fh(instead)k(of)g Fe(\\\\)p Fh(.)192 1869 y Fk(\\newcommand{\\a)o(ut)o +(inf)o(o})o([4)o(]{)o(\045)301 1982 y(\\renewcommand{)o(\\de)o(fa)o(ul) +o(ta)o(ut)o(ho)o(r}{)o(#1)o(})301 2095 y(\\renewcommand{)o(\\de)o(fa)o +(ul)o(ta)o(dd)o(re)o(ss})o({#)o(2})301 2208 y(\\renewcommand{)o(\\de)o +(fa)o(ul)o(te)o(ma)o(il)o(}{#)o(3})301 2321 y(\\renewcommand{)o(\\de)o +(fa)o(ul)o(th)o(om)o(ep)o(age)o(}{)o(#4)o(})301 2433 +y(\\renewcommand{)o(\\cu)o(rr)o(en)o(ta)o(ut)o(ho)o(r}{)o(#1)o(})192 +2546 y(})p -74 2880 1692 4 v -76 2993 4 113 v -24 2959 +a Fe(\\abs[)p Fg(other-language)h(abstract)s Fe(]{)p +Fg(abstract)q Fe(})p 1615 2993 V -74 2997 1692 4 v 109 +3171 a Fh(Should)g(be)h(used)e(in)i(the)f(pr)n(emable)i(\226)f(call)i +Fe(\\tit)p Fh(,)c Fe(\\titaut)f Fh(or)i Fe(\\titautver)d +Fh(in)k(the)f(document)109 3283 y(body)-10 b(.)33 b(Prints)h(an)h +(abstract)g(text.)e(Optionally)i(an)g(additional)g(abstract)g(in)g +(another)f(language)g(is)109 3396 y(printed)f(below)-8 +b(.)34 b(The)g(title)h(of)g(the)f(other)n(-language)f(abstract)j(may)f +(be)f(changed)h(by)f(r)n(ede\002ning)109 3509 y Fe(\\otherabstract)o +(na)o(me)o Fh(.)17 b(By)22 b(default)g(`Zusammenfassung')g(is)h(used)e +(\(German\).)192 3694 y Fk(\\newcommand{\\a)o(bs)o(tex)o(t})o({})192 +3806 y(\\newcommand{\\o)o(th)o(era)o(bs)o(te)o(xt)o(}{)o(})192 +3919 y(\\newcommand{\\a)o(bs)o(}[2)o(][)o(]{)o(\045)301 +4032 y(\\renewcommand{)o(\\ot)o(he)o(ra)o(bs)o(te)o(xt)o(}{#)o(1})301 +4145 y(\\renewcommand{)o(\\ab)o(st)o(ex)o(t})o({#)o(2})192 +4258 y(})p -74 4592 1043 4 v -76 4705 4 113 v -24 4671 +a Fe(\\keywords{)p Fg(keywords)m Fe(})p 967 4705 V -74 +4708 1043 4 v 109 4882 a Fh(Should)i(be)h(used)e(in)i(the)f(pr)n +(emable)i(\226)f(call)i Fe(\\tit)p Fh(,)c Fe(\\titaut)f +Fh(or)i Fe(\\titautver)d Fh(in)k(the)f(document)109 4995 +y(body)-10 b(.)21 b(Prints)h(a)h(list)g(of)g(keywor)n(ds.)192 +5179 y Fk(\\newcommand{\\k)o(ey)o(wor)o(ds)o(te)o(xt)o(}{)o(})192 +5292 y(\\newcommand{\\k)o(ey)o(wor)o(ds)o(}[)o(1])o({\045)301 +5405 y(\\renewcommand{)o(\\ke)o(yw)o(or)o(ds)o(te)o(xt)o(}{#)o(1})192 +5518 y(})p eop +%%Page: 28 29 +28 28 bop 109 -62 a Ft(28)1941 b Fq(3)99 b(Commands)25 +b(and)g(Envir)n(onments)p 109 -10 3544 4 v -74 191 2105 +4 v -76 304 4 113 v -24 270 a Fe(\\hyperinfo{)p Fg(title)l +Fe(}{)p Fg(author)p Fe(}{)p Fg(abstract)r Fe(}{)p Fg(keywords)q +Fe(})p 2029 304 V -74 307 2105 4 v 109 481 a Fh(An)37 +b(alternative)h(way)f(to)g(specify)g(document)f(information)i(for)g +(the)e(PDF)i(version.)e(Use)h(when)109 594 y(the)19 b(default)h +(document)f(information)i(extracted)e(fr)n(om)h Fe(\\tit[sub][info])o +Fh(,)14 b Fe(\\autinfo)p Fh(,)j Fe(\\abs)109 707 y Fh(and)j +Fe(\\keywords)d Fh(does)i(not)h(work)f(as)i(it)g(should.)e(If)i(one)e +(of)i(the)f(parameters)f(is)i(left)g(empty)e(the)h(de-)109 +820 y(fault)j(information)h(is)f(used)f(instead.)g(Do)h(not)f(use)g +(any)h(formatting)g(or)g(special)g(commands.)g(Must)109 +933 y(be)f(used)f(in)i(the)f(pr)n(emable.)h(W)-5 b(ithout)22 +b(the)g Fe(pdf)f Fh(option)h(this)g(command)h(is)g(ignor)n(ed.)192 +1086 y Fk(\\if@pdf)301 1199 y(\\newcommand{\\h)o(ype)o(ri)o(nf)o(o})o +([4)o(]{)410 1312 y(\\renewcommand{\\)o(hy)o(pe)o(rt)o(it)o(le})o({#)o +(1})410 1425 y(\\renewcommand{\\)o(hy)o(pe)o(ra)o(ut)o(hor)o(}{)o(#2)o +(})410 1538 y(\\renewcommand{\\)o(hy)o(pe)o(ra)o(bs)o(tra)o(ct)o(}{)o +(#3)o(})410 1651 y(\\renewcommand{\\)o(hy)o(pe)o(rk)o(ey)o(wor)o(ds)o +(}{)o(#4)o(})301 1764 y(})192 1877 y(\\else)301 1990 +y(\\newcommand{\\h)o(ype)o(ri)o(nf)o(o})o([4)o(]{})192 +2102 y(\\fi)p -74 2365 1349 4 v -76 2478 4 113 v -24 +2444 a Fe(\\titaut[)p Fg(date)m Fe(]{)p Fg(title)q Fe(}{)p +Fg(author)p Fe(})p 1273 2478 V -74 2481 1349 4 v 109 +2655 a Fh(Replacement)e(for:)i Fe(\\title{)p Fg(title)n +Fe(})f(\\author{)p Fg(author)n Fe(})g(\\date{)p Fg(date)o +Fe(})g(\\maketitle)109 2768 y Fh(Default)30 b(date)f(is)g +Fe(\\today)p Fh(.)e(W)-5 b(ith)29 b(the)g Fe(paper)e +Fh(option,)h(a)i(titlepage)f(and)g(a)h(table)g(of)g(contents)e(ar)n(e) +109 2881 y(generated.)192 3034 y Fk(\\if@paper)301 3147 +y(\\newcommand{\\t)o(ita)o(ut)o(}[)o(3])o([\\)o(tod)o(ay)o(]{)o(\045) +193 3260 y Fm(h)q Fl(hca)m(rt)19 b Fm(j)g Fl(hcrep)s(o)m(rt)r +Fm(i)219 b Fk(\\if@wide)51 b(\\linespread{1})d(\\fi)193 +3373 y Fm(h)q Fl(hcslides)p Fm(i)220 b Fk(\\slidepagestyl)o(e{)o(em)o +(pt)o(y}\\)o(se)o(tc)o(ou)o(nt)o(er{)o(sl)o(id)o(e})o({0)o(})410 +3486 y(\\ifthenelse{\\eq)o(ua)o(l{)o(#2)o(}{)o(}})519 +3599 y({})519 3712 y({\\renewcommand{)o(\\d)o(ef)o(au)o(ltt)o(it)o(le)o +(}{)o(#2)o(})628 3824 y(\\renewcommand{\\)o(cu)o(rr)o(ent)o(ti)o(tl)o +(e})o({#)o(2})o(})410 3937 y(\\title{\\normalf)o(on)o(t\\)o(hu)o(ge)48 +b(\\defaulttitle)h(\\vfill})410 4050 y(\\ifthenelse{\\eq)o(ua)o(l{)o +(#3)o(}{)o(}})519 4163 y({})519 4276 y({\\renewcommand{)o(\\d)o(ef)o +(au)o(lta)o(ut)o(ho)o(r})o({#)o(3})628 4389 y(\\renewcommand{\\)o(cu)o +(rr)o(ent)o(au)o(th)o(or)o(}{)o(#3)o(}})410 4502 y(\\author{\\normal)o +(fo)o(nt)o(\\L)o(ar)o(ge)f(\\defaultauthor\\)o(\\[)o(0.)o(8e)o(x])519 +4615 y(\\normalfont\\nor)o(ma)o(ls)o(iz)o(e)h(\\defaultaddres)o(s\\)o +(\\[)o(0.)o(4e)o(x])519 4728 y(\\normalfont\\nor)o(ma)o(ls)o(iz)o(e)519 +4841 y(\\htmladdnormall)o(in)o(k{)o(\\d)o(efa)o(ul)o(te)o(ma)o(il)o(}{) +o(mai)o(lt)o(o:)o(\\d)o(ef)o(aul)o(te)o(ma)o(il)o(}\\)o(\\[-)192 +4954 y(1ex])519 5066 y(\\normalfont\\nor)o(ma)o(ls)o(iz)o(e)519 +5179 y(\\htmladdnormall)o(in)o(k{)o(\\d)o(efa)o(ul)o(th)o(om)o(ep)o(ag) +o(e}{)o(\\d)o(ef)o(au)o(lt)o(hom)o(ep)o(ag)o(e})192 5292 +y(})410 5405 y(\\date{\\vfill\\vf)o(il)o(l)f(\\normalfont\\nor)o(ma)o +(lsi)o(ze)g(#1})193 5518 y Fm(h)q Fl(hcrep)s(o)m(rt)r +Fm(i)219 b Fk(\\lowertitlebac)o(k{\045)p eop +%%Page: 29 30 +29 29 bop 109 -62 a Fq(3.4)99 b(Commands)23 b(and)g(Envir)n(onments)i +(for)f(the)g(hcart,)g(hcr)n(eport)h(and)e(hcslides)17 +b(.)e(.)g(.)198 b Ft(29)p 109 -10 3544 4 v 193 270 a +Fm(h)q Fl(hcrep)s(o)m(rt)r Fm(i)328 b Fk(\\ifthenelse{\\eq)o(ua)o(l{)o +(\\o)o(th)o(era)o(bs)o(te)o(xt)o(}{)o(}}{)o(}\045)193 +383 y Fm(h)q Fl(hcrep)s(o)m(rt)r Fm(i)492 b Fk({\\minisec{\\cen)o(te)o +(ri)o(ng)o(\\ab)o(st)o(ra)o(ct)o(na)o(me})193 496 y Fm(h)q +Fl(hcrep)s(o)m(rt)r Fm(i)601 b Fk(\\abstext}\045)193 +609 y Fm(h)q Fl(hcrep)s(o)m(rt)r Fm(i)328 b Fk(\\ifthenelse{\\eq)o(ua)o +(l{)o(\\o)o(th)o(era)o(bs)o(te)o(xt)o(}{)o(}}{)o(}\045)193 +722 y Fm(h)q Fl(hcrep)s(o)m(rt)r Fm(i)492 b Fk({\\minisec{\\cen)o(te)o +(ri)o(ng)o(\\ot)o(he)o(ra)o(bs)o(tr)o(act)o(na)o(me)o(})193 +835 y Fm(h)q Fl(hcrep)s(o)m(rt)r Fm(i)601 b Fk(\\otherabstext})o(\045) +193 948 y Fm(h)q Fl(hcrep)s(o)m(rt)r Fm(i)328 b Fk(\\ifthenelse{\\eq)o +(ua)o(l{)o(\\k)o(ey)o(wor)o(ds)o(te)o(xt)o(}{)o(}}{)o(}\045)193 +1061 y Fm(h)q Fl(hcrep)s(o)m(rt)r Fm(i)492 b Fk({\\minisec{\\cen)o(te)o +(ri)o(ng)o(\\ke)o(yw)o(or)o(ds)o(na)o(me})193 1173 y +Fm(h)q Fl(hcrep)s(o)m(rt)r Fm(i)601 b Fk(\\cen{\\keywords)o(te)o(xt)o +(}}\045)193 1286 y Fm(h)q Fl(hcrep)s(o)m(rt)r Fm(i)219 +b Fk(})410 1399 y(\\maketitle)410 1512 y(\\ifthenelse{\\is)o(un)o(de)o +(fi)o(ne)o(d{)o(\\cu)o(rr)o(en)o(td)o(at)o(e}})519 1625 +y({\\newcommand{\\c)o(ur)o(re)o(nt)o(da)o(te})o({#)o(1})o(}{)o(})193 +1738 y Fm(h)q Fl(hca)m(rt)19 b Fm(j)g Fl(hcslides)q Fm(i)219 +b Fk(\\setcounter{pa)o(ge)o(}{0)o(})193 1851 y Fm(h)q +Fl(hca)m(rt)19 b Fm(j)g Fl(hcslides)q Fm(i)219 b Fk(\\thispagestyle)o +({e)o(mpt)o(y})193 1964 y Fm(h)q Fl(hca)m(rt)19 b Fm(j)g +Fl(hcslides)q Fm(i)273 b Fk(\\ifthenelse{\\eq)o(ual)o({\\)o(ab)o(st)o +(ex)o(t}{)o(}})o({\045)193 2077 y Fm(h)q Fl(hca)m(rt)19 +b Fm(j)g Fl(hcslides)q Fm(i)437 b Fk(\\ifthenelse{\\eq)o(ua)o(l{)o(\\k) +o(ey)o(wor)o(ds)o(te)o(xt)o(}{)o(}}{)o(}{)193 2190 y +Fm(h)q Fl(hca)m(rt)19 b Fm(j)g Fl(hcslides)q Fm(i)601 +b Fk(\\vfill\\vfill)193 2303 y Fm(h)q Fl(hca)m(rt)19 +b Fm(j)g Fl(hcslides)q Fm(i)601 b Fk(\\minisec{\\cent)o(er)o(in)o(g\\)o +(key)o(wo)o(rd)o(sn)o(am)o(e})193 2415 y Fm(h)q Fl(hca)m(rt)19 +b Fm(j)g Fl(hcslides)q Fm(i)601 b Fk(\\cen{\\keywords)o(te)o(xt)o(}}) +193 2528 y Fm(h)q Fl(hca)m(rt)19 b Fm(j)g Fl(hcslides)q +Fm(i)219 b Fk(}{\045)193 2641 y Fm(h)q Fl(hca)m(rt)19 +b Fm(j)g Fl(hcslides)q Fm(i)382 b Fk(\\vfill\\vfill)193 +2754 y Fm(h)q Fl(hca)m(rt)19 b Fm(j)g Fl(hcslides)q Fm(i)546 +b Fk(\\minisec{\\cente)o(ri)o(ng)o(\\a)o(bst)o(ra)o(ct)o(na)o(me)o(}) +193 2867 y Fm(h)q Fl(hca)m(rt)19 b Fm(j)g Fl(hcslides)q +Fm(i)546 b Fk(\\abstext)193 2980 y Fm(h)q Fl(hca)m(rt)19 +b Fm(j)g Fl(hcslides)q Fm(i)546 b Fk(\\ifthenelse{\\eq)o(ua)o(l{)o(\\o) +o(the)o(ra)o(bs)o(te)o(xt)o(}{})o(}{)o(})193 3093 y Fm(h)q +Fl(hca)m(rt)19 b Fm(j)g Fl(hcslides)q Fm(i)710 b Fk({\\minisec{\\cen)o +(te)o(ri)o(ng\\)o(ot)o(he)o(ra)o(bs)o(tra)o(ct)o(na)o(me)o(})193 +3206 y Fm(h)q Fl(hca)m(rt)19 b Fm(j)g Fl(hcslides)q Fm(i)819 +b Fk(\\otherabstext})193 3319 y Fm(h)q Fl(hca)m(rt)19 +b Fm(j)g Fl(hcslides)q Fm(i)546 b Fk(\\ifthenelse{\\eq)o(ua)o(l{)o(\\k) +o(eyw)o(or)o(ds)o(te)o(xt)o(}{})o(}{)o(})193 3432 y Fm(h)q +Fl(hca)m(rt)19 b Fm(j)g Fl(hcslides)q Fm(i)710 b Fk({\\minisec{\\cen)o +(te)o(ri)o(ng\\)o(ke)o(yw)o(or)o(ds)o(nam)o(e})193 3545 +y Fm(h)q Fl(hca)m(rt)19 b Fm(j)g Fl(hcslides)q Fm(i)819 +b Fk(\\cen{\\keywords)o(te)o(xt})o(})193 3657 y Fm(h)q +Fl(hca)m(rt)19 b Fm(j)g Fl(hcslides)q Fm(i)219 b Fk(})410 +3770 y(\\setcounter{pag)o(e})o({0)o(})410 3883 y(\\thispagestyle{)o(em) +o(pt)o(y})410 3996 y(\\@toc\045)193 4109 y Fm(h)q Fl(hca)m(rt)19 +b Fm(j)g Fl(hcrep)s(o)m(rt)r Fm(i)219 b Fk(\\if@wide)51 +b(\\linespread{1.3)o(})d(\\fi)193 4222 y Fm(h)q Fl(hcslides)p +Fm(i)438 b Fk(\\slidepagestyl)o(e{)o(HC})o(\045)301 4335 +y(})192 4448 y(\\else)301 4561 y(\\newcommand{\\t)o(ita)o(ut)o(}[)o(3]) +o([\\)o(to)o(day)o(]{)o(\045)193 4674 y Fm(h)q Fl(hca)m(rt)19 +b Fm(j)g Fl(hcrep)s(o)m(rt)r Fm(i)219 b Fk(\\if@wide)51 +b(\\linespread{1})d(\\fi)193 4787 y Fm(h)q Fl(hcslides)p +Fm(i)220 b Fk(\\slidepagestyl)o(e{)o(em)o(pt)o(y}\\)o(se)o(tc)o(ou)o +(nt)o(er{)o(sl)o(id)o(e})o({0)o(})410 4899 y(\\ifthenelse{\\eq)o(ua)o +(l{)o(#2)o(}{)o(}})519 5012 y({})519 5125 y({\\renewcommand{)o(\\d)o +(ef)o(au)o(lt)o(tit)o(le)o(}{)o(#2)o(})628 5238 y(\\renewcommand{\\)o +(cu)o(rr)o(en)o(tti)o(tl)o(e})o({#)o(2})o(})410 5351 +y(\\title{\\normalf)o(on)o(t\\)o(hu)o(ge)48 b(\\defaulttitle})410 +5464 y(\\ifthenelse{\\eq)o(ua)o(l{)o(#3)o(}{)o(}})p eop +%%Page: 30 31 +30 30 bop 109 -62 a Ft(30)1941 b Fq(3)99 b(Commands)25 +b(and)g(Envir)n(onments)p 109 -10 3544 4 v 519 270 a +Fk({})519 383 y({\\renewcommand{)o(\\d)o(ef)o(au)o(lta)o(ut)o(ho)o(r})o +({#)o(3})628 496 y(\\renewcommand{\\)o(cu)o(rr)o(ent)o(au)o(th)o(or)o +(}{)o(#3)o(}})410 609 y(\\author{\\normal)o(fo)o(nt)o(\\L)o(ar)o(ge)48 +b(\\defaultauthor})410 722 y(\\date{\\normalfo)o(nt)o(\\n)o(or)o(ma)o +(lsi)o(ze)g(#1})193 835 y Fm(h)q Fl(hcrep)s(o)m(rt)r +Fm(i)219 b Fk(\\lowertitlebac)o(k{\045)193 948 y Fm(h)q +Fl(hcrep)s(o)m(rt)r Fm(i)328 b Fk(\\ifthenelse{\\eq)o(ua)o(l{)o(\\o)o +(th)o(era)o(bs)o(te)o(xt)o(}{)o(}}{)o(}\045)193 1061 +y Fm(h)q Fl(hcrep)s(o)m(rt)r Fm(i)492 b Fk({\\minisec{\\cen)o(te)o(ri)o +(ng)o(\\ab)o(st)o(ra)o(ct)o(na)o(me})193 1173 y Fm(h)q +Fl(hcrep)s(o)m(rt)r Fm(i)601 b Fk(\\abstext}\045)193 +1286 y Fm(h)q Fl(hcrep)s(o)m(rt)r Fm(i)328 b Fk(\\ifthenelse{\\eq)o(ua) +o(l{)o(\\o)o(th)o(era)o(bs)o(te)o(xt)o(}{)o(}}{)o(}\045)193 +1399 y Fm(h)q Fl(hcrep)s(o)m(rt)r Fm(i)492 b Fk({\\minisec{\\cen)o(te)o +(ri)o(ng)o(\\ot)o(he)o(ra)o(bs)o(tr)o(act)o(na)o(me)o(})193 +1512 y Fm(h)q Fl(hcrep)s(o)m(rt)r Fm(i)601 b Fk(\\otherabstext})o(\045) +193 1625 y Fm(h)q Fl(hcrep)s(o)m(rt)r Fm(i)328 b Fk(\\ifthenelse{\\eq)o +(ua)o(l{)o(\\k)o(ey)o(wor)o(ds)o(te)o(xt)o(}{)o(}}{)o(}\045)193 +1738 y Fm(h)q Fl(hcrep)s(o)m(rt)r Fm(i)492 b Fk({\\minisec{\\cen)o(te)o +(ri)o(ng)o(\\ke)o(yw)o(or)o(ds)o(na)o(me})193 1851 y +Fm(h)q Fl(hcrep)s(o)m(rt)r Fm(i)601 b Fk(\\cen{\\keywords)o(te)o(xt)o +(}}\045)193 1964 y Fm(h)q Fl(hcrep)s(o)m(rt)r Fm(i)219 +b Fk(})410 2077 y(\\maketitle)410 2190 y(\\ifthenelse{\\is)o(un)o(de)o +(fi)o(ne)o(d{\\)o(cu)o(rr)o(en)o(td)o(at)o(e}})519 2303 +y({\\newcommand{\\c)o(ur)o(re)o(nt)o(dat)o(e})o({#)o(1})o(}{)o(})193 +2415 y Fm(h)q Fl(hca)m(rt)19 b Fm(j)g Fl(hcslides)q Fm(i)219 +b Fk(\\setcounter{pa)o(ge)o(}{0)o(})193 2528 y Fm(h)q +Fl(hca)m(rt)19 b Fm(j)g Fl(hcslides)q Fm(i)219 b Fk(\\thispagestyle)o +({e)o(mpt)o(y})193 2641 y Fm(h)q Fl(hca)m(rt)19 b Fm(j)g +Fl(hcslides)q Fm(i)273 b Fk(\\ifthenelse{\\eq)o(ual)o({\\)o(ab)o(st)o +(ex)o(t}{)o(}})o({})o({)193 2754 y Fm(h)q Fl(hca)m(rt)19 +b Fm(j)g Fl(hcslides)q Fm(i)546 b Fk(\\minisec{\\cente)o(ri)o(ng)o(\\a) +o(bst)o(ra)o(ct)o(na)o(me)o(})193 2867 y Fm(h)q Fl(hca)m(rt)19 +b Fm(j)g Fl(hcslides)q Fm(i)546 b Fk(\\abstext)193 2980 +y Fm(h)q Fl(hca)m(rt)19 b Fm(j)g Fl(hcslides)q Fm(i)546 +b Fk(\\ifthenelse{\\eq)o(ua)o(l{)o(\\o)o(the)o(ra)o(bs)o(te)o(xt)o(}{}) +o(}{)o(})193 3093 y Fm(h)q Fl(hca)m(rt)19 b Fm(j)g Fl(hcslides)q +Fm(i)710 b Fk({\\minisec{\\cen)o(te)o(ri)o(ng\\)o(ot)o(he)o(ra)o(bs)o +(tra)o(ct)o(na)o(me)o(})193 3206 y Fm(h)q Fl(hca)m(rt)19 +b Fm(j)g Fl(hcslides)q Fm(i)819 b Fk(\\otherabstext})193 +3319 y Fm(h)q Fl(hca)m(rt)19 b Fm(j)g Fl(hcslides)q Fm(i)219 +b Fk(})193 3432 y Fm(h)q Fl(hca)m(rt)19 b Fm(j)g Fl(hcslides)q +Fm(i)273 b Fk(\\ifthenelse{\\eq)o(ual)o({\\)o(ke)o(yw)o(or)o(dst)o(ex)o +(t})o({})o(}{)o(})193 3545 y Fm(h)q Fl(hca)m(rt)19 b +Fm(j)g Fl(hcslides)q Fm(i)437 b Fk({\\minisec{\\cent)o(er)o(in)o(g\\)o +(ke)o(ywo)o(rd)o(sn)o(am)o(e})193 3657 y Fm(h)q Fl(hca)m(rt)19 +b Fm(j)g Fl(hcslides)q Fm(i)546 b Fk(\\cen{\\keywordst)o(ex)o(t})o(}) +410 3770 y(\\setcounter{pag)o(e})o({0)o(})410 3883 y(\\thispagestyle{)o +(em)o(pt)o(y})o(\045)193 3996 y Fm(h)q Fl(hca)m(rt)19 +b Fm(j)g Fl(hcrep)s(o)m(rt)r Fm(i)219 b Fk(\\if@wide)51 +b(\\linespread{1.3)o(})d(\\fi)193 4109 y Fm(h)q Fl(hcslides)p +Fm(i)220 b Fk(\\newpage\\slide)o(pa)o(ge)o(st)o(yle)o({H)o(C})o(\045) +301 4222 y(})192 4335 y(\\fi)p -74 4931 834 4 v -76 5044 +4 113 v -24 5010 a Fe(\\tit[)p Fg(date)o Fe(]{)p Fg(title)p +Fe(})p 758 5044 V -74 5048 834 4 v 109 5221 a Fh(Calls)24 +b Fe(\\titaut)19 b Fh(with)k(the)f(default)g(author)g(information.)192 +5518 y Fk(\\newcommand{\\t)o(it)o(}[2)o(][)o(\\t)o(od)o(ay)o(]{\\)o(ti) +o(ta)o(ut)o([#)o(1])o({#2)o(}{)o(}})p eop +%%Page: 31 32 +31 31 bop 109 -62 a Fq(3.5)99 b(Commands)25 b(and)f(Envir)n(onments)j +(for)e(the)g(hcart)h(class)1071 b Ft(31)p 109 -10 3544 +4 v -74 191 2355 4 v -76 304 4 113 v -24 270 a Fe(\\titautver[)p +Fg(version)19 b(date)q Fe(]{)p Fg(title)q Fe(}{)p Fg(author)p +Fe(}{)p Fg(general)24 b(date)q Fe(})p 2278 304 V -74 +307 2355 4 v 109 481 a Fh(Prints)e(a)h(general)f(date)g(\(e.g.)f(of)i +(\002rst)f(r)n(elease\))g(and)h(a)g(version)f(date)g(\(default:)h +Fe(\\today)p Fh(\).)192 621 y Fk(\\newcommand{\\t)o(it)o(aut)o(ve)o(r}) +o([4)o(][)o(\\t)o(oda)o(y])o({)301 734 y(\\newcommand{\\c)o(urr)o(en)o +(td)o(at)o(e})o({#)o(1}\045)301 847 y(\\titaut[#4\\\\\\v)o(ers)o(io)o +(nt)o(ex)o(t\\)48 b(#1]{#2}{#3})192 960 y(})p -74 1191 +1839 4 v -76 1304 4 113 v -24 1270 a Fe(\\titver[)p Fg(version)20 +b(date)r Fe(]{)p Fg(title)p Fe(}{)p Fg(general)k(date)q +Fe(})p 1763 1304 V -74 1307 1839 4 v 109 1481 a Fh(Calls)g +Fe(\\titautver)18 b Fh(with)k(the)g(default)h(author)f(information.)192 +1621 y Fk(\\newcommand{\\t)o(it)o(ver)o(}[)o(3])o([\\)o(to)o(da)o(y]{)o +(\\t)o(it)o(au)o(tv)o(er[)o(#1)o(]{)o(#2)o(}{)o(}{#)o(3})o(})109 +1887 y Fr(3.4.4)100 b(Sectioning)28 b(Commands)p -74 +2118 700 4 v -76 2231 4 113 v -24 2197 a Fe(\\fictionsec)p +624 2231 V -74 2234 700 4 v 109 2408 a Fh(A)c(sectioning)f(command)i +(pr)n(oducing)e(just)h(a)g(number)-7 b(,)24 b(no)g(text)f(\226)i +(useful)f(e.g.)f(for)h(\002ction)g(without)109 2521 y(section)d +(headings.)h(When)g(a)h(new)f Fe(\\section)d Fh(starts)j(the)f(counter) +h(is)h(r)n(eset.)192 2661 y Fk(\\newcounter{fi)o(ct)o(ion)o(se)o(c})o +([s)o(ec)o(ti)o(on])192 2774 y(\\newcommand{\\f)o(ic)o(tio)o(ns)o(ec)o +(}{)o(\\a)o(dd)o(toc)o(ou)o(nt)o(er)o({f)o(ict)o(io)o(ns)o(ec)o(}{)o +(1}\045)301 2887 y(\\subsection*{\\)o(cen)o(te)o(ri)o(ng)o(\\t)o(he)o +(fic)o(ti)o(on)o(se)o(c})o(})193 3000 y Fm(h)r Fi(=)q +Fl(hca)m(rt)c Fm(j)g Fl(hcrep)s(o)m(rt)h Fm(j)f Fl(hcslides)q +Fm(i)109 3294 y Ff(3.5)120 b(Commands)36 b(and)d(En)-5 +b(vir)n(onments)35 b(f)n(or)d(the)h(hcar)r(t)h(c)n(lass)109 +3473 y Fh(A)22 b Fe(\\part)f Fh(command)i(starts)e(a)i(new)f(page.)193 +3613 y Fm(h)r(\003)q Fl(hca)m(rt)r Fm(i)192 3726 y Fk(\\renewcommand\\) +o(pa)o(rt{)o(\\c)o(le)o(ar)o(pa)o(ge)355 3839 y(\\@afterindentfal)o(se) +355 3952 y(\\secdef\\@part\\@s)o(pa)o(rt)o(})193 4065 +y Fm(h)r Fi(=)q Fl(hca)m(rt)r Fm(i)109 4359 y Ff(3.6)120 +b(Settings)34 b(f)n(or)e(the)i(hc)n(letter)g(c)n(lass)109 +4539 y Fh(No)22 b(fold)g(marks)h(ar)n(e)g(printed.)193 +4679 y Fm(h)r(\003)q Fl(hcletter)s Fm(i)192 4792 y Fk(\\foldmarksoff) +193 4904 y Fm(h)r Fi(=)q Fl(hcletter)s Fm(i)109 5199 +y Ff(3.7)120 b(Commands)36 b(and)d(En)-5 b(vir)n(onments)35 +b(f)n(or)d(the)h(hcrepor)r(t)h(c)n(lass)109 5378 y Fh(The)22 +b(\002rst)f(page)h(of)h(a)g(chapter)f(and)h(the)f(title)g(page)g(of)h +(a)g(part)f(do)g(not)g(have)h(a)g(page)f(number)-7 b(.)193 +5518 y Fm(h)r(\003)q Fl(hcrep)s(o)m(rt)r Fm(i)p eop +%%Page: 32 33 +32 32 bop 109 -62 a Ft(32)1941 b Fq(3)99 b(Commands)25 +b(and)g(Envir)n(onments)p 109 -10 3544 4 v 192 270 a +Fk(\\renewcommand\\)o(ch)o(apt)o(er)410 383 y({\\if@openright\\)o(cl)o +(ea)o(rd)o(ou)o(ble)o(pa)o(ge)o(\\e)o(ls)o(e\\)o(cle)o(ar)o(pa)o(ge)o +(\\f)o(i)1283 496 y(\\thispagestyle)o({e)o(mp)o(ty)o(}\045)1283 +609 y(\\global\\@topnu)o(m\\)o(z@)1283 722 y(\\@afterindentf)o(al)o(se) +1283 835 y(\\secdef\\@chapt)o(er)o(\\@)o(sc)o(hap)o(te)o(r})192 +948 y(\\renewcommand\\)o(ad)o(dch)o(ap)410 1061 y({\\if@openright\\)o +(cl)o(ea)o(rd)o(ou)o(ble)o(pa)o(ge)o(\\e)o(ls)o(e\\)o(cle)o(ar)o(pa)o +(ge)o(\\f)o(i)1283 1173 y(\\thispagestyle)o({e)o(mp)o(ty)o(}\045)1283 +1286 y(\\global\\@topnu)o(m\\)o(z@)1283 1399 y(\\@afterindentf)o(al)o +(se)1283 1512 y(\\secdef\\@addch)o(ap)o(\\@)o(sa)o(ddc)o(ha)o(p})192 +1625 y(\\renewcommand\\)o(pa)o(rt)410 1738 y({\\if@openright\\)o(cl)o +(ea)o(rd)o(ou)o(ble)o(pa)o(ge)o(\\e)o(ls)o(e\\)o(cle)o(ar)o(pa)o(ge)o +(\\f)o(i)1119 1851 y(\\thispagestyle{)o(em)o(pt)o(y})o(\045)1119 +1964 y(\\if@twocolumn)1337 2077 y(\\onecolumn)1337 2190 +y(\\@tempswatrue)1228 2303 y(\\else)1337 2415 y(\\@tempswafalse)1119 +2528 y(\\fi)1119 2641 y(\\null\\vfil)1119 2754 y(\\secdef\\@part\\@)o +(sp)o(ar)o(t})193 2867 y Fm(h)r Fi(=)q Fl(hcrep)s(o)m(rt)r +Fm(i)109 3155 y Ff(3.8)120 b(Commands)36 b(and)d(En)-5 +b(vir)n(onments)35 b(f)n(or)d(the)h(hcslides)j(c)n(lass)109 +3332 y Fh(A)22 b(new)g(page)g(is)h(started)e(by)h(a)h(section)f(or)h +(manually)h(with)e(the)g Fe(\\newslide)d Fh(command.)255 +3445 y(Everything)33 b(is)i(printed)e(sans)h(serif.)g(The)g +Fe(HC)g Fh(pagestyle)e(is)j(always)g(used.)e(The)h Fe(fancybox)109 +3558 y Fh(package)22 b(is)h(r)n(equir)n(ed)f(for)g(drawing)h(an)g +(shadowed)d(box)j(ar)n(ound)f(sections.)p -74 3784 1323 +4 v -76 3897 4 113 v -24 3863 a Fe(\\addsec[)p Fg(toc-entry)n +Fe(]{)p Fg(heading)q Fe(})p 1247 3897 V -74 3900 1323 +4 v 109 4074 a Fh(For)j(compatibily)i(with)f(the)f Fe(hcart)e +Fh(and)j Fe(hcreport)c Fh(classes.)k(Should)f(always)h(be)f(used)g +(instead)109 4187 y(of)d(the)g Fe(\\section*)d Fh(command.)p +-74 4413 933 4 v -76 4526 4 113 v -24 4492 a Fe(\\minisec{)p +Fg(heading)m Fe(})p 857 4526 V -74 4529 933 4 v 109 4703 +a Fh(For)50 b(compatibily)i(with)e(the)g Fe(hcart)f Fh(and)h +Fe(hcreport)e Fh(classes.)i(Sectioning)g(level)h(between)109 +4816 y Fe(\\subsubsection)16 b Fh(and)23 b Fe(\\paragraph)p +Fh(.)193 4954 y Fm(h)r(\003)q Fl(hcslides)q Fm(i)192 +5066 y Fk(\\AtBeginDocume)o(nt)o({\\b)o(eg)o(in)o({s)o(li)o(de})o(})192 +5179 y(\\AtEndDocument)o({\\)o(end)o({s)o(li)o(de)o(}})192 +5292 y(\\renewcommand{)o(\\r)o(mde)o(fa)o(ul)o(t})o({\\)o(sfd)o(ef)o +(au)o(lt)o(})192 5405 y(\\raggedslides[)o(5e)o(m])192 +5518 y(\\newcommand{\\a)o(dd)o(sec)o(}[)o(2])o([])o({\045)p +eop +%%Page: 33 34 +33 33 bop 109 -62 a Fq(3.8)99 b(Commands)25 b(and)f(Envir)n(onments)j +(for)e(the)g(hcslides)h(class)941 b Ft(33)p 109 -10 3544 +4 v 301 270 a Fk(\\section*{#2})301 383 y(\\ifthenelse{\\e)o(qua)o(l{)o +(#1)o(}{)o(}})410 496 y({\\addcontentsli)o(ne)o({t)o(oc)o(}{)o(se)o +(cti)o(on)o(}{)o(#2)o(}})410 609 y({\\addcontentsli)o(ne)o({t)o(oc)o +(}{)o(se)o(cti)o(on)o(}{)o(#1)o(}})o(\045)192 722 y(})192 +835 y(\\newcommand\\mi)o(ni)o(sec)o([1)o(]{)o(\\@)o(af)o(te)o(rin)o(de) +o(nt)o(fa)o(ls)o(e)49 b(\\vskip)i(1.5ex)301 948 y({\\parindent)e(\\z@) +54 b(\\raggedright\\s)o(ff)o(am)o(il)o(y\\)o(bfs)o(er)o(ie)o(s)48 +b(#1\\par\\nobreak}\045)301 1061 y(\\@afterheading)o(})192 +1173 y(\\setlength{\\sl)o(id)o(ehe)o(ig)o(ht)o(}{)o(0.)o(74)o(\\pa)o +(pe)o(rw)o(id)o(th)o(})192 1286 y(\\setlength{\\sl)o(id)o(ewi)o(dt)o +(h})o({0)o(.8)o(4\\)o(pap)o(er)o(he)o(ig)o(ht)o(})192 +1399 y(\\renewcommand{)o(\\s)o(lid)o(et)o(op)o(ma)o(rg)o(in)o(}{0)o(.1) +o(2\\)o(pa)o(pe)o(rwi)o(dt)o(h})192 1512 y(\\renewcommand{)o(\\s)o(lid) +o(eb)o(ot)o(to)o(mm)o(ar)o(gin)o(}{)o(0.)o(12)o(\\p)o(ape)o(rw)o(id)o +(th)o(})192 1625 y(\\renewcommand{)o(\\s)o(lid)o(el)o(ef)o(tm)o(ar)o +(gi)o(n}{)o(0.)o(08)o(\\p)o(ap)o(erh)o(ei)o(gh)o(t})192 +1738 y(\\renewcommand{)o(\\s)o(lid)o(er)o(ig)o(ht)o(ma)o(rg)o(in})o({0) +o(.0)o(8\\)o(pa)o(per)o(he)o(ig)o(ht)o(})192 1851 y(\\slideframe{no)o +(ne)o(})192 1964 y(\\AtBeginDocume)o(nt)o({)301 2077 +y(\\ifthenelse{\\e)o(qua)o(l{)o(\\d)o(ef)o(au)o(lt)o(ema)o(il)o(}{)o +(}})410 2190 y({\\newcommand{\\@)o(em)o(ai)o(l})o({})o(})410 +2303 y({\\newcommand{\\@)o(em)o(ai)o(l})519 2415 y({)54 +b(\\texttt{<}\\htma)o(il)o({\\)o(de)o(fau)o(lt)o(em)o(ai)o(l})o(\\te)o +(xt)o(tt)o({>)o(}})o(})301 2528 y(\\newpagestyle{)o(HC})o(\045)410 +2641 y({\\parbox[b]{\\te)o(xt)o(wi)o(dt)o(h})o(\045)574 +2754 y({\\currenttitle)o(\\h)o(fi)o(ll)o(\\c)o(urr)o(en)o(td)o(at)o +(e\\)o(\\[-)o(.6)o(ex)o(]\045)628 2867 y(\\rule{\\textwidt)o(h})o({0)o +(.6)o(pt})o(}})410 2980 y({\\parbox[t]{\\te)o(xt)o(wi)o(dt)o(h})o({\\)o +(rul)o(e{)o(\\t)o(ex)o(tw)o(idt)o(h})o({0)o(.6)o(pt)o(}\\\\)o([.)o(6e)o +(x])o(\045)574 3093 y(\\renewcommand{)o(\\a)o(ut)o(di)o(v})o({,)48 +b(}\045)574 3206 y(\\currentauthor)o(\\@)o(em)o(ai)o(l\\)o(hfi)o(ll)o +(\\t)o(he)o(pa)o(ge})o(})301 3319 y(\\pagestyle{HC})192 +3432 y(})192 3545 y(\\RequirePackag)o(e{)o(fan)o(cy)o(bo)o(x})192 +3657 y(\\setcounter{to)o(cd)o(ept)o(h})o({3)o(})192 3770 +y(\\renewcommand\\)o(se)o(cti)o(on)o({\\)o(@s)o(ta)o(rt)o(sec)o(ti)o +(on)g({section}{1}{\\)o(z@})o(\045)301 3883 y({-3.5ex)j(\\@plus)h(-1ex) +h(\\@minus)e(-.2ex}\045)301 3996 y({2.3ex)h(\\@plus.2ex}\045)301 +4109 y({\\newslide\\nor)o(mal)o(fo)o(nt)o(\\L)o(ar)o(ge)o(\\bf)o(se)o +(ri)o(es)o(\\s)o(had)o(ow)o(bo)o(x})o(})192 4222 y(\\renewcommand\\)o +(pa)o(rt{)o(\\c)o(le)o(ar)o(pa)o(ge)1119 4335 y(\\if@twocolumn)1337 +4448 y(\\onecolumn)1337 4561 y(\\@tempswatrue)1228 4674 +y(\\else)1337 4787 y(\\@tempswafalse)1119 4899 y(\\fi)1119 +5012 y(\\secdef\\@part\\@)o(sp)o(ar)o(t})109 5331 y Fr(3.8.1)100 +b(The)28 b(tw)n(otoc)f(option)192 5518 y Fk(\\if@twotoc)p +eop +%%Page: 34 35 +34 34 bop 109 -62 a Ft(34)1960 b Fq(4)99 b(German)25 +b(Language)g(De\002nitions)p 109 -10 3544 4 v 301 270 +a Fk(\\RequirePackag)o(e{m)o(ul)o(ti)o(co)o(l})301 383 +y(\\renewcommand*)o(\\ta)o(bl)o(eo)o(fc)o(on)o(ten)o(ts)o({\045)410 +496 y(\\newlength{\\old)o(@c)o(ol)o(um)o(ns)o(epr)o(ul)o(e})410 +609 y(\\setlength{\\old)o(@c)o(ol)o(um)o(ns)o(epr)o(ul)o(e})o({\\)o(co) +o(lu)o(mns)o(ep)o(ru)o(le)o(})410 722 y(\\setlength{\\col)o(um)o(ns)o +(ep)o(ru)o(le})o({0)o(.4)o(pt)o(})410 835 y(\\begin{multicol)o(s})o({2) +o(}[)o(\\s)o(ect)o(io)o(n*)o({\\)o(co)o(nt)o(ent)o(sn)o(am)o(e})o(])410 +948 y(\\@starttoc{toc})o(\045)410 1061 y(\\end{multicols})410 +1173 y(\\setlength{\\col)o(um)o(ns)o(ep)o(ru)o(le})o({\\)o(ol)o(d@)o +(co)o(lu)o(mns)o(ep)o(ru)o(le)o(})410 1286 y(})192 1399 +y(\\fi)193 1512 y Fm(h)r Fi(=)q Fl(hcslides)q Fm(i)109 +1763 y Fs(4)143 b(German)38 b(Langua)o(g)q(e)f(De\002nitions)109 +1983 y Fh(The)27 b Fe(babel)f Fh(package)h(is)h(loaded)f(with)h(the)f +(new)g(German)i(orthograpy)d(\(option)h Fe(ngerman)p +Fh(:)d(this)109 2096 y(r)n(equir)n(es)39 b(a)i(rather)f(new)g(version)g +(of)g Fe(babel)p Fh(\).)e(The)i(commands)g Fe(\\q)p Fh(,)f +Fe(\\hq)p Fh(,)g Fe(\\dash)p Fh(,)f Fe(\\Es)h Fh(and)109 +2209 y Fe(\\shorttoday)28 b Fh(ar)n(e)34 b(adapted)e(to)h(the)g(German) +h(typography)-10 b(.)30 b(The)j Fe(\\enge)e Fh(command)j(is)g(r)n(ede-) +109 2322 y(\002ned.)20 b(The)i(German)g(B)m Fc(I)r(B)-5 +b Fh(T)1044 2352 y(E)1088 2322 y(X)22 b(style)f Fe(hc-de)f +Fh(is)i(used)e(by)i(default.)f(The)h(language)f(speci\002c)h(texts)f +(ar)n(e)109 2435 y(r)n(ede\002ned.)i(The)h(German)i(r)n(ede\002nitions) +e(of)h(the)g Fe(varioref)d Fh(package)j(do)f(not)h(seem)f(to)h(work,)f +(so)109 2548 y(the)d(ar)n(e)i(r)n(epeated.)193 2695 y +Fm(h)r(\003)q Fl(german)r Fm(i)192 2808 y Fk(\\addto{\\captio)o(ns)o +(nge)o(rm)o(an)o(}{)o(\045)301 2921 y(\\renewcommand{)o(\\ne)o(xt)o(st) +o(ar)o(tq)o(}{\\)o(gu)o(il)o(le)o(mo)o(tr)o(igh)o(t})301 +3034 y(\\renewcommand{)o(\\ne)o(xt)o(en)o(dq)o(}{)o(\\gu)o(il)o(le)o +(mo)o(tl)o(ef)o(t})301 3147 y(\\renewcommand{)o(\\ot)o(he)o(rs)o(ta)o +(rt)o(q}{)o(\\g)o(ui)o(ls)o(in)o(gl)o(rig)o(ht)o(})301 +3260 y(\\renewcommand{)o(\\ot)o(he)o(re)o(nd)o(q})o({\\g)o(ui)o(ls)o +(in)o(gl)o(le)o(ft})301 3373 y(\\renewcommand{)o(\\hq)o(}[)o(1])o({\\)o +(gu)o(ils)o(in)o(gl)o(ri)o(gh)o(t{)o(}#1)o(\\g)o(ui)o(ls)o(in)o(gll)o +(ef)o(t{)o(}})301 3486 y(\\renewcommand{)o(\\fq)o(}[)o(1])o({\\)o(gu)o +(ill)o(em)o(ot)o(ri)o(gh)o(t{)o(}#1)o(\\g)o(ui)o(ll)o(em)o(otl)o(ef)o +(t{)o(}})301 3599 y(\\renewcommand{)o(\\da)o(sh)o(}[)o(1])o({-)o(-~#)o +(1~)o(--)o(})301 3712 y(\\renewcommand{)o(\\sh)o(or)o(tt)o(od)o(ay)o(}) +410 3824 y({\\the\\day.\\the\\)o(mo)o(nt)o(h.)o(\\t)o(wo@)o(di)o(gi)o +(ts)o({\\)o(th)o(esh)o(or)o(ty)o(ea)o(r})o(\\xs)o(pa)o(ce)o(})301 +3937 y(\\renewcommand{)o(\\en)o(ge)o(}[)o(2])o({#)o(2})301 +4050 y(\\renewcommand{)o(\\bi)o(bl)o(io)o(st)o(yl)o(e}{)o(hc)o(-d)o(e}) +301 4163 y(\\renewcommand{)o(\\co)o(nt)o(en)o(ts)o(na)o(me})o({I)o(nh)o +(al)o(t})301 4276 y(\\renewcommand{)o(\\ve)o(rs)o(io)o(nt)o(ex)o(t}{)o +(Ve)o(rs)o(io)o(n)48 b(vom})301 4389 y(\\renewcommand{)o(\\ac)o(ce)o +(ss)o(te)o(xt)o(}{Z)o(ug)o(ri)o(ff)g(am})301 4502 y(\\renewcommand{)o +(\\cf)o(te)o(xt)o(}{)o(vg)o(l.})301 4615 y(\\renewcommand{)o(\\bi)o(bv) +o(ol)o(te)o(xt)o(}{d)o(er)o(})301 4728 y(\\renewcommand{)o(\\bv)o(te)o +(xt)o(}{)o(Bd)o(.})301 4841 y(\\renewcommand{)o(\\bi)o(bd)o(ir)o(}{)o +(Re)o(gie)g(})301 4954 y(\\renewcommand{)o(\\bi)o(bm)o(ov)o(te)o(xt)o +(}{S)o(pi)o(el)o(fi)o(lm)o(})301 5066 y(\\renewcommand{)o(\\bi)o(ba)o +(ct)o(or)o(sb)o(efo)o(re)o(}{)o(Mi)o(t})301 5179 y(\\renewcommand{)o +(\\bi)o(ba)o(ct)o(or)o(sa)o(fte)o(r})o({u)o(.a)o(})301 +5292 y(\\renewcommand{)o(\\no)o(ye)o(ar)o(}{)o(o.)o(J.})301 +5405 y(\\renewcommand{)o(\\no)o(ad)o(dr)o(es)o(s})o({o.)o(O.)o(})301 +5518 y(\\renewcommand{)o(\\ot)o(he)o(ra)o(bs)o(tr)o(act)o(na)o(me)o(}{) +o(Ab)o(st)o(rac)o(t})p eop +%%Page: 35 36 +35 35 bop 109 -62 a Fq(4)99 b(German)25 b(Language)g(De\002nitions)1961 +b Ft(35)p 109 -10 3544 4 v 301 270 a Fk(\\renewcommand{)o(\\ke)o(yw)o +(or)o(ds)o(na)o(me)o(}{S)o(ch)o(l\\)o("u)o(ss)o(elw)o(\\")o(or)o(te)o +(r})301 383 y(\\renewcommand{)o(\\se)o(et)o(ex)o(t})o({s)o(ie)o(he})192 +496 y(})192 609 y(\\if@euro)301 722 y(\\addto{\\captio)o(nsn)o(ge)o(rm) +o(an)o(}{)o(\045)410 835 y(\\renewcommand{\\)o(Es)o(}[)o(1])o({#)o(1\\) +o(nob)o(re)o(ak)o(\\,)o(\\E)o(})301 948 y(})192 1061 +y(\\fi)192 1173 y(\\if@fancyref)410 1286 y(\\def\\reftextfac)o(ea)o(ft) +o(er)48 b({auf)53 b(der)g(n\\"achsten)d(Seite}\045)410 +1399 y(\\def\\reftextfac)o(eb)o(ef)o(or)o(e{)o(au)o(f)f(der)k +(vorherigen)d(Seite}\045)410 1512 y(\\let\\reftextaft)o(er)266 +b(\\reftextfaceaf)o(ter)410 1625 y(\\let\\reftextbef)o(or)o(e)212 +b(\\reftextfacebe)o(for)o(e)410 1738 y(\\def\\reftextcur)o(re)o(nt)157 +b({auf)53 b(dieser)e(Seite}\045)410 1851 y(\\def\\reftextfar)o(aw)o(ay) +o(#1)o({a)o(uf)d(Seite~\\pageref{)o(#1)o(}})o(\045)410 +1964 y(\\def\\reftextpag)o(er)o(an)o(ge)o(#1)o(#2)o({au)o(f)574 +2077 y(Seiten~\\pagere)o(f{)o(#1)o(}-)o(-\\)o(pag)o(er)o(ef)o({#)o(2})o +(}\045)410 2190 y(\\def\\reftextlab)o(el)o(ra)o(ng)o(e#)o(1#)o(2{\\)o +(re)o(f{)o(#1)o(})g(bis~\\ref{#2}}\045)192 2303 y(\\fi)193 +2415 y Fm(h)r Fi(=)q Fl(german)r Fm(i)p eop +%%Trailer +end +userdict /end-hook known{end-hook}if +%%EOF |