summaryrefslogtreecommitdiff
path: root/macros/latex/contrib/hc
diff options
context:
space:
mode:
authorNorbert Preining <norbert@preining.info>2019-09-02 13:46:59 +0900
committerNorbert Preining <norbert@preining.info>2019-09-02 13:46:59 +0900
commite0c6872cf40896c7be36b11dcc744620f10adf1d (patch)
tree60335e10d2f4354b0674ec22d7b53f0f8abee672 /macros/latex/contrib/hc
Initial commit
Diffstat (limited to 'macros/latex/contrib/hc')
-rw-r--r--macros/latex/contrib/hc/COPYING339
-rw-r--r--macros/latex/contrib/hc/FILES21
-rw-r--r--macros/latex/contrib/hc/README99
-rw-r--r--macros/latex/contrib/hc/hc-de.bst1507
-rw-r--r--macros/latex/contrib/hc/hc-en.bst1539
-rw-r--r--macros/latex/contrib/hc/hc.dtx1624
-rw-r--r--macros/latex/contrib/hc/hc.ins61
-rw-r--r--macros/latex/contrib/hc/hc.ps2135
8 files changed, 7325 insertions, 0 deletions
diff --git a/macros/latex/contrib/hc/COPYING b/macros/latex/contrib/hc/COPYING
new file mode 100644
index 0000000000..e77696ae8d
--- /dev/null
+++ b/macros/latex/contrib/hc/COPYING
@@ -0,0 +1,339 @@
+ GNU GENERAL PUBLIC LICENSE
+ Version 2, June 1991
+
+ Copyright (C) 1989, 1991 Free Software Foundation, Inc.
+ 675 Mass Ave, Cambridge, MA 02139, USA
+ Everyone is permitted to copy and distribute verbatim copies
+ of this license document, but changing it is not allowed.
+
+ Preamble
+
+ The licenses for most software are designed to take away your
+freedom to share and change it. By contrast, the GNU General Public
+License is intended to guarantee your freedom to share and change free
+software--to make sure the software is free for all its users. This
+General Public License applies to most of the Free Software
+Foundation's software and to any other program whose authors commit to
+using it. (Some other Free Software Foundation software is covered by
+the GNU Library General Public License instead.) You can apply it to
+your programs, too.
+
+ When we speak of free software, we are referring to freedom, not
+price. Our General Public Licenses are designed to make sure that you
+have the freedom to distribute copies of free software (and charge for
+this service if you wish), that you receive source code or can get it
+if you want it, that you can change the software or use pieces of it
+in new free programs; and that you know you can do these things.
+
+ To protect your rights, we need to make restrictions that forbid
+anyone to deny you these rights or to ask you to surrender the rights.
+These restrictions translate to certain responsibilities for you if you
+distribute copies of the software, or if you modify it.
+
+ For example, if you distribute copies of such a program, whether
+gratis or for a fee, you must give the recipients all the rights that
+you have. You must make sure that they, too, receive or can get the
+source code. And you must show them these terms so they know their
+rights.
+
+ We protect your rights with two steps: (1) copyright the software, and
+(2) offer you this license which gives you legal permission to copy,
+distribute and/or modify the software.
+
+ Also, for each author's protection and ours, we want to make certain
+that everyone understands that there is no warranty for this free
+software. If the software is modified by someone else and passed on, we
+want its recipients to know that what they have is not the original, so
+that any problems introduced by others will not reflect on the original
+authors' reputations.
+
+ Finally, any free program is threatened constantly by software
+patents. We wish to avoid the danger that redistributors of a free
+program will individually obtain patent licenses, in effect making the
+program proprietary. To prevent this, we have made it clear that any
+patent must be licensed for everyone's free use or not licensed at all.
+
+ The precise terms and conditions for copying, distribution and
+modification follow.
+
+ GNU GENERAL PUBLIC LICENSE
+ TERMS AND CONDITIONS FOR COPYING, DISTRIBUTION AND MODIFICATION
+
+ 0. This License applies to any program or other work which contains
+a notice placed by the copyright holder saying it may be distributed
+under the terms of this General Public License. The "Program", below,
+refers to any such program or work, and a "work based on the Program"
+means either the Program or any derivative work under copyright law:
+that is to say, a work containing the Program or a portion of it,
+either verbatim or with modifications and/or translated into another
+language. (Hereinafter, translation is included without limitation in
+the term "modification".) Each licensee is addressed as "you".
+
+Activities other than copying, distribution and modification are not
+covered by this License; they are outside its scope. The act of
+running the Program is not restricted, and the output from the Program
+is covered only if its contents constitute a work based on the
+Program (independent of having been made by running the Program).
+Whether that is true depends on what the Program does.
+
+ 1. You may copy and distribute verbatim copies of the Program's
+source code as you receive it, in any medium, provided that you
+conspicuously and appropriately publish on each copy an appropriate
+copyright notice and disclaimer of warranty; keep intact all the
+notices that refer to this License and to the absence of any warranty;
+and give any other recipients of the Program a copy of this License
+along with the Program.
+
+You may charge a fee for the physical act of transferring a copy, and
+you may at your option offer warranty protection in exchange for a fee.
+
+ 2. You may modify your copy or copies of the Program or any portion
+of it, thus forming a work based on the Program, and copy and
+distribute such modifications or work under the terms of Section 1
+above, provided that you also meet all of these conditions:
+
+ a) You must cause the modified files to carry prominent notices
+ stating that you changed the files and the date of any change.
+
+ b) You must cause any work that you distribute or publish, that in
+ whole or in part contains or is derived from the Program or any
+ part thereof, to be licensed as a whole at no charge to all third
+ parties under the terms of this License.
+
+ c) If the modified program normally reads commands interactively
+ when run, you must cause it, when started running for such
+ interactive use in the most ordinary way, to print or display an
+ announcement including an appropriate copyright notice and a
+ notice that there is no warranty (or else, saying that you provide
+ a warranty) and that users may redistribute the program under
+ these conditions, and telling the user how to view a copy of this
+ License. (Exception: if the Program itself is interactive but
+ does not normally print such an announcement, your work based on
+ the Program is not required to print an announcement.)
+
+These requirements apply to the modified work as a whole. If
+identifiable sections of that work are not derived from the Program,
+and can be reasonably considered independent and separate works in
+themselves, then this License, and its terms, do not apply to those
+sections when you distribute them as separate works. But when you
+distribute the same sections as part of a whole which is a work based
+on the Program, the distribution of the whole must be on the terms of
+this License, whose permissions for other licensees extend to the
+entire whole, and thus to each and every part regardless of who wrote it.
+
+Thus, it is not the intent of this section to claim rights or contest
+your rights to work written entirely by you; rather, the intent is to
+exercise the right to control the distribution of derivative or
+collective works based on the Program.
+
+In addition, mere aggregation of another work not based on the Program
+with the Program (or with a work based on the Program) on a volume of
+a storage or distribution medium does not bring the other work under
+the scope of this License.
+
+ 3. You may copy and distribute the Program (or a work based on it,
+under Section 2) in object code or executable form under the terms of
+Sections 1 and 2 above provided that you also do one of the following:
+
+ a) Accompany it with the complete corresponding machine-readable
+ source code, which must be distributed under the terms of Sections
+ 1 and 2 above on a medium customarily used for software interchange; or,
+
+ b) Accompany it with a written offer, valid for at least three
+ years, to give any third party, for a charge no more than your
+ cost of physically performing source distribution, a complete
+ machine-readable copy of the corresponding source code, to be
+ distributed under the terms of Sections 1 and 2 above on a medium
+ customarily used for software interchange; or,
+
+ c) Accompany it with the information you received as to the offer
+ to distribute corresponding source code. (This alternative is
+ allowed only for noncommercial distribution and only if you
+ received the program in object code or executable form with such
+ an offer, in accord with Subsection b above.)
+
+The source code for a work means the preferred form of the work for
+making modifications to it. For an executable work, complete source
+code means all the source code for all modules it contains, plus any
+associated interface definition files, plus the scripts used to
+control compilation and installation of the executable. However, as a
+special exception, the source code distributed need not include
+anything that is normally distributed (in either source or binary
+form) with the major components (compiler, kernel, and so on) of the
+operating system on which the executable runs, unless that component
+itself accompanies the executable.
+
+If distribution of executable or object code is made by offering
+access to copy from a designated place, then offering equivalent
+access to copy the source code from the same place counts as
+distribution of the source code, even though third parties are not
+compelled to copy the source along with the object code.
+
+ 4. You may not copy, modify, sublicense, or distribute the Program
+except as expressly provided under this License. Any attempt
+otherwise to copy, modify, sublicense or distribute the Program is
+void, and will automatically terminate your rights under this License.
+However, parties who have received copies, or rights, from you under
+this License will not have their licenses terminated so long as such
+parties remain in full compliance.
+
+ 5. You are not required to accept this License, since you have not
+signed it. However, nothing else grants you permission to modify or
+distribute the Program or its derivative works. These actions are
+prohibited by law if you do not accept this License. Therefore, by
+modifying or distributing the Program (or any work based on the
+Program), you indicate your acceptance of this License to do so, and
+all its terms and conditions for copying, distributing or modifying
+the Program or works based on it.
+
+ 6. Each time you redistribute the Program (or any work based on the
+Program), the recipient automatically receives a license from the
+original licensor to copy, distribute or modify the Program subject to
+these terms and conditions. You may not impose any further
+restrictions on the recipients' exercise of the rights granted herein.
+You are not responsible for enforcing compliance by third parties to
+this License.
+
+ 7. If, as a consequence of a court judgment or allegation of patent
+infringement or for any other reason (not limited to patent issues),
+conditions are imposed on you (whether by court order, agreement or
+otherwise) that contradict the conditions of this License, they do not
+excuse you from the conditions of this License. If you cannot
+distribute so as to satisfy simultaneously your obligations under this
+License and any other pertinent obligations, then as a consequence you
+may not distribute the Program at all. For example, if a patent
+license would not permit royalty-free redistribution of the Program by
+all those who receive copies directly or indirectly through you, then
+the only way you could satisfy both it and this License would be to
+refrain entirely from distribution of the Program.
+
+If any portion of this section is held invalid or unenforceable under
+any particular circumstance, the balance of the section is intended to
+apply and the section as a whole is intended to apply in other
+circumstances.
+
+It is not the purpose of this section to induce you to infringe any
+patents or other property right claims or to contest validity of any
+such claims; this section has the sole purpose of protecting the
+integrity of the free software distribution system, which is
+implemented by public license practices. Many people have made
+generous contributions to the wide range of software distributed
+through that system in reliance on consistent application of that
+system; it is up to the author/donor to decide if he or she is willing
+to distribute software through any other system and a licensee cannot
+impose that choice.
+
+This section is intended to make thoroughly clear what is believed to
+be a consequence of the rest of this License.
+
+ 8. If the distribution and/or use of the Program is restricted in
+certain countries either by patents or by copyrighted interfaces, the
+original copyright holder who places the Program under this License
+may add an explicit geographical distribution limitation excluding
+those countries, so that distribution is permitted only in or among
+countries not thus excluded. In such case, this License incorporates
+the limitation as if written in the body of this License.
+
+ 9. The Free Software Foundation may publish revised and/or new versions
+of the General Public License from time to time. Such new versions will
+be similar in spirit to the present version, but may differ in detail to
+address new problems or concerns.
+
+Each version is given a distinguishing version number. If the Program
+specifies a version number of this License which applies to it and "any
+later version", you have the option of following the terms and conditions
+either of that version or of any later version published by the Free
+Software Foundation. If the Program does not specify a version number of
+this License, you may choose any version ever published by the Free Software
+Foundation.
+
+ 10. If you wish to incorporate parts of the Program into other free
+programs whose distribution conditions are different, write to the author
+to ask for permission. For software which is copyrighted by the Free
+Software Foundation, write to the Free Software Foundation; we sometimes
+make exceptions for this. Our decision will be guided by the two goals
+of preserving the free status of all derivatives of our free software and
+of promoting the sharing and reuse of software generally.
+
+ NO WARRANTY
+
+ 11. BECAUSE THE PROGRAM IS LICENSED FREE OF CHARGE, THERE IS NO WARRANTY
+FOR THE PROGRAM, TO THE EXTENT PERMITTED BY APPLICABLE LAW. EXCEPT WHEN
+OTHERWISE STATED IN WRITING THE COPYRIGHT HOLDERS AND/OR OTHER PARTIES
+PROVIDE THE PROGRAM "AS IS" WITHOUT WARRANTY OF ANY KIND, EITHER EXPRESSED
+OR IMPLIED, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF
+MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE. THE ENTIRE RISK AS
+TO THE QUALITY AND PERFORMANCE OF THE PROGRAM IS WITH YOU. SHOULD THE
+PROGRAM PROVE DEFECTIVE, YOU ASSUME THE COST OF ALL NECESSARY SERVICING,
+REPAIR OR CORRECTION.
+
+ 12. IN NO EVENT UNLESS REQUIRED BY APPLICABLE LAW OR AGREED TO IN WRITING
+WILL ANY COPYRIGHT HOLDER, OR ANY OTHER PARTY WHO MAY MODIFY AND/OR
+REDISTRIBUTE THE PROGRAM AS PERMITTED ABOVE, BE LIABLE TO YOU FOR DAMAGES,
+INCLUDING ANY GENERAL, SPECIAL, INCIDENTAL OR CONSEQUENTIAL DAMAGES ARISING
+OUT OF THE USE OR INABILITY TO USE THE PROGRAM (INCLUDING BUT NOT LIMITED
+TO LOSS OF DATA OR DATA BEING RENDERED INACCURATE OR LOSSES SUSTAINED BY
+YOU OR THIRD PARTIES OR A FAILURE OF THE PROGRAM TO OPERATE WITH ANY OTHER
+PROGRAMS), EVEN IF SUCH HOLDER OR OTHER PARTY HAS BEEN ADVISED OF THE
+POSSIBILITY OF SUCH DAMAGES.
+
+ END OF TERMS AND CONDITIONS
+
+ How to Apply These Terms to Your New Programs
+
+ If you develop a new program, and you want it to be of the greatest
+possible use to the public, the best way to achieve this is to make it
+free software which everyone can redistribute and change under these terms.
+
+ To do so, attach the following notices to the program. It is safest
+to attach them to the start of each source file to most effectively
+convey the exclusion of warranty; and each file should have at least
+the "copyright" line and a pointer to where the full notice is found.
+
+ <one line to give the program's name and a brief idea of what it does.>
+ Copyright (C) 19yy <name of author>
+
+ This program is free software; you can redistribute it and/or modify
+ it under the terms of the GNU General Public License as published by
+ the Free Software Foundation; either version 2 of the License, or
+ (at your option) any later version.
+
+ This program is distributed in the hope that it will be useful,
+ but WITHOUT ANY WARRANTY; without even the implied warranty of
+ MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
+ GNU General Public License for more details.
+
+ You should have received a copy of the GNU General Public License
+ along with this program; if not, write to the Free Software
+ Foundation, Inc., 675 Mass Ave, Cambridge, MA 02139, USA.
+
+Also add information on how to contact you by electronic and paper mail.
+
+If the program is interactive, make it output a short notice like this
+when it starts in an interactive mode:
+
+ Gnomovision version 69, Copyright (C) 19yy name of author
+ Gnomovision comes with ABSOLUTELY NO WARRANTY; for details type `show w'.
+ This is free software, and you are welcome to redistribute it
+ under certain conditions; type `show c' for details.
+
+The hypothetical commands `show w' and `show c' should show the appropriate
+parts of the General Public License. Of course, the commands you use may
+be called something other than `show w' and `show c'; they could even be
+mouse-clicks or menu items--whatever suits your program.
+
+You should also get your employer (if you work as a programmer) or your
+school, if any, to sign a "copyright disclaimer" for the program, if
+necessary. Here is a sample; alter the names:
+
+ Yoyodyne, Inc., hereby disclaims all copyright interest in the program
+ `Gnomovision' (which makes passes at compilers) written by James Hacker.
+
+ <signature of Ty Coon>, 1 April 1989
+ Ty Coon, President of Vice
+
+This General Public License does not permit incorporating your program into
+proprietary programs. If your program is a subroutine library, you may
+consider it more useful to permit linking proprietary applications with the
+library. If this is what you want to do, use the GNU Library General
+Public License instead of this License.
diff --git a/macros/latex/contrib/hc/FILES b/macros/latex/contrib/hc/FILES
new file mode 100644
index 0000000000..c4dfc0f3d1
--- /dev/null
+++ b/macros/latex/contrib/hc/FILES
@@ -0,0 +1,21 @@
+ HC Bundle for LaTeX2e: The Files
+ ================================
+
+COPYING - The GNU General Public License
+FILES - This file
+README - Readme file
+
+hc-de.bst - German language bibliography style
+hc-en.bst - English language bibliography style
+ created by the LaTeX custom-bib package -
+ custom-bib source code can be found at
+ http://tal.cs.tu-berlin.de/error/TeX/bibtex/src/
+
+hc.ins - Installation driver for scrtime.dtx.
+hc.dtx - Contains:
+ hcart.cls - Substitute for article.cls
+ hcreport.cls - Substitute for report.cls
+ hcletter.cls - Substitute for letter.cls
+ hcslides.cls - Substitute for slides.cls
+ german.hld - additional definitions for the German language
+hc.ps - the documentation
diff --git a/macros/latex/contrib/hc/README b/macros/latex/contrib/hc/README
new file mode 100644
index 0000000000..72ea5638fd
--- /dev/null
+++ b/macros/latex/contrib/hc/README
@@ -0,0 +1,99 @@
+ Readme file for the HC Bundle for LaTeX2e
+ =========================================
+
+Name of the contribution: HC Bundle for LaTeX2e
+
+Author's name: Christian Siefkes
+
+Author's email: error@cs.tu-berlin.de
+
+Suggested CTAN directory: macros/latex/contrib/supported/hc
+
+Summary description:
+Replacement for the LaTeX default classes,
+based upon the KoMa­Script bundle and the Seminar class.
+
+Short text for announcement:
+The HC Bundle for LaTeX2e provides the following four
+classes as replacement for the LaTeX default classes:
+- hcart.cls: substitute for the article class,
+ based upon the KoMa­Script scrartcl class;
+- hcreport.cls: substitute for the report class,
+ based upon the KoMa­Script scrreprt class;
+- hcletter.cls: substitute for the letter class,
+ based upon the KoMa­Script scrlettr class;
+- hcslides.cls: substitute for the slides class,
+ based upon the seminar class.
+
+Type of license: Free / GNU GPL
+
+
+See FILES for a list of files.
+Contact me, if files are missing (and tell me the way you got it):
+e-mail: error@cs.tu-berlin.de
+
+
+Installation:
+-------------
+
+* ATTENTION: You need a complete LaTeX2e and some extra packages
+ (see below)!
+
+ Copy all files to a directory, where TeX/LaTeX can find them.
+ Run hc.ins through LaTeX or TeX, e.g. at UNIX type:
+ latex hc.ins
+ or
+ tex hc.ins
+ You'll get a couple of new cls-files and the file german.hld.
+ Copy them to the coresponding LaTeX-directory.
+
+ To get documentation (hc.dvi|ps) run hc.dtx through LaTeX, e.g. at UNIX
+ type:
+ latex hc.dtx
+ or:
+ tex "&latex" hc.dtx
+ or:
+ latexps hc.dtx
+ You need three runs, to get table of contents and references right
+ (latexps does this automatically).
+
+
+Used LaTeX Packages:
+--------------------
+
+The following LaTeX classes and packages are used by the HC Bundle.
+Those marked with * are required to get the documuntation (hc.dvi|ps).
+
+babel*
+eurofont*
+fancybox
+fancyref*
+fontenc* from the latex base
+html* from the latex2html program
+hyperref
+ifthen* from the latex base
+inputenc* from the latex base
+mathpple*
+multicol* from the tools bundle
+natbib*
+palatino* from the psnfss bundle
+pifont from the psnfss bundle
+scrartcl class* from the koma-script bundle
+scrlettr class from the koma-script bundle
+scrreprt class from the koma-script bundle
+seminar class
+truncate*
+typearea* from the koma-script bundle
+varioref* from the tools bundle
+xspace* from the tools bundle
+
+
+Bug-reports:
+------------
+ You may use latexbugs.tex, but don't send the report to the
+ LaTeX-team, send it to the adress in this file above.
+
+
+Changes since first version:
+----------------------------
+ You'll find all changes at the dtx-file.
diff --git a/macros/latex/contrib/hc/hc-de.bst b/macros/latex/contrib/hc/hc-de.bst
new file mode 100644
index 0000000000..53d826e93d
--- /dev/null
+++ b/macros/latex/contrib/hc/hc-de.bst
@@ -0,0 +1,1507 @@
+%%
+%% This is file `hc-de.bst',
+%% generated with the docstrip utility.
+%%
+%% The original source files were:
+%%
+%% merlin.mbs (with options: `head,exlang,ay,nat,vonx,nm-revv1,aunm-semi,dt-beg,yr-par,aymth,yrp-col,note-yr,atit-u,trtit-b,pre-pub,edby,edbyx,in-col,german,pp,ed,abr,ord,and-xcom,nfss,{}')
+%% german.mbs (with options: `exlang,ay,nat,vonx,nm-revv1,aunm-semi,dt-beg,yr-par,aymth,yrp-col,note-yr,atit-u,trtit-b,pre-pub,edby,edbyx,in-col,german,pp,ed,abr,ord,and-xcom,nfss,{}')
+%% merlin.mbs (with options: `tail,exlang,ay,nat,vonx,nm-revv1,aunm-semi,dt-beg,yr-par,aymth,yrp-col,note-yr,atit-u,trtit-b,pre-pub,edby,edbyx,in-col,german,pp,ed,abr,ord,and-xcom,nfss,{}')
+%% ----------------------------------------
+%% *** Bibliographie-Standard von Christian Siefkes ***
+%%
+ %-------------------------------------------------------------------
+ % The original source file contains the following version information:
+ % \ProvidesFile{merlin.mbs}[1998/02/25 3.85a (PWD)]
+ %
+ % NOTICE:
+ % This file may be used for non-profit purposes.
+ % It may not be distributed in exchange for money,
+ % other than distribution costs.
+ %
+ % The author provides it `as is' and does not guarantee it in any way.
+ %
+ % Copyright (C) 1994-98 Patrick W. Daly
+ %-------------------------------------------------------------------
+ % For use with BibTeX version 0.99a or later
+ %-------------------------------------------------------------------
+ % This bibliography style file is intended for texts in
+ % GERMAN
+ % This is an author-year citation style bibliography. As such, it is
+ % non-standard LaTeX, and requires a special package file to function properly.
+ % Such a package is natbib.sty by Patrick W. Daly
+ % The form of the \bibitem entries is
+ % \bibitem[Jones et al.(1990)]{key}...
+ % \bibitem[Jones et al.(1990)Jones, Baker, and Smith]{key}...
+ % The essential feature is that the label (the part in brackets) consists
+ % of the author names, as they should appear in the citation, with the year
+ % in parentheses following. There must be no space before the opening
+ % parenthesis!
+ % With natbib v5.3, a full list of authors may also follow the year.
+ % In natbib.sty, it is possible to define the type of enclosures that is
+ % really wanted (brackets or parentheses), but in either case, there must
+ % be parentheses in the label.
+ % The \cite command functions as follows:
+ % \citet{key} ==>> Jones et al. (1990)
+ % \citet*{key} ==>> Jones, Baker, and Smith (1990)
+ % \citep{key} ==>> (Jones et al., 1990)
+ % \citep*{key} ==>> (Jones, Baker, and Smith, 1990)
+ % \citep[chap. 2]{key} ==>> (Jones et al., 1990, chap. 2)
+ % \citep[e.g.][]{key} ==>> (e.g. Jones et al., 1990)
+ % \citep[e.g.][p. 32]{key} ==>> (e.g. Jones et al., p. 32)
+ % \citeauthor{key} ==>> Jones et al.
+ % \citeauthor*{key} ==>> Jones, Baker, and Smith
+ % \citeyear{key} ==>> 1990
+ %---------------------------------------------------------------------
+
+ENTRY
+ { address
+ author
+ booktitle
+ chapter
+ edition
+ editor
+ howpublished
+ institution
+ journal
+ key
+ month
+ note
+ number
+ organization
+ pages
+ publisher
+ school
+ series
+ title
+ type
+ volume
+ year
+ }
+ {}
+ { label extra.label sort.label short.list }
+
+INTEGERS { output.state before.all mid.sentence after.sentence after.block }
+
+FUNCTION {init.state.consts}
+{ #0 'before.all :=
+ #1 'mid.sentence :=
+ #2 'after.sentence :=
+ #3 'after.block :=
+}
+
+STRINGS { s t }
+
+FUNCTION {output.nonnull}
+{ 's :=
+ output.state mid.sentence =
+ { ", " * write$ }
+ { output.state after.block =
+ { add.period$ write$
+ newline$
+ "\newblock " write$
+ }
+ { output.state before.all =
+ 'write$
+ { add.period$ " " * write$ }
+ if$
+ }
+ if$
+ mid.sentence 'output.state :=
+ }
+ if$
+ s
+}
+
+FUNCTION {output}
+{ duplicate$ empty$
+ 'pop$
+ 'output.nonnull
+ if$
+}
+
+FUNCTION {output.check}
+{ 't :=
+ duplicate$ empty$
+ { pop$ "empty " t * " in " * cite$ * warning$ }
+ 'output.nonnull
+ if$
+}
+
+FUNCTION {fin.entry}
+{ add.period$
+ write$
+ newline$
+}
+
+FUNCTION {new.block}
+{ output.state before.all =
+ 'skip$
+ { after.block 'output.state := }
+ if$
+}
+
+FUNCTION {new.sentence}
+{ output.state after.block =
+ 'skip$
+ { output.state before.all =
+ 'skip$
+ { after.sentence 'output.state := }
+ if$
+ }
+ if$
+}
+
+FUNCTION {add.blank}
+{ " " * before.all 'output.state :=
+}
+
+FUNCTION {date.block}
+{
+ ":" *
+ add.blank
+}
+
+FUNCTION {not}
+{ { #0 }
+ { #1 }
+ if$
+}
+
+FUNCTION {and}
+{ 'skip$
+ { pop$ #0 }
+ if$
+}
+
+FUNCTION {or}
+{ { pop$ #1 }
+ 'skip$
+ if$
+}
+
+FUNCTION {new.block.checkb}
+{ empty$
+ swap$ empty$
+ and
+ 'skip$
+ 'new.block
+ if$
+}
+
+FUNCTION {field.or.null}
+{ duplicate$ empty$
+ { pop$ "" }
+ 'skip$
+ if$
+}
+
+FUNCTION {emphasize}
+{ duplicate$ empty$
+ { pop$ "" }
+ { "\emph{" swap$ * "}" * }
+ if$
+}
+
+FUNCTION {capitalize}
+{ "u" change.case$ "t" change.case$ }
+
+FUNCTION {space.word}
+{ " " swap$ * " " * }
+
+ % Here are the language-specific definitions for explicit words.
+ % Each function has a name bbl.xxx where xxx is the English word.
+ %-------------------------------------------------------------------
+ % The original source file contains the following version information:
+ % \ProvidesFile{german.mbs}[1995/11/02 1.5 (PWD)]
+ % Copyright (C) 1994, 1995 Patrick W. Daly
+ %-------------------------------------------------------------------
+
+ % The language selected here is GERMAN
+FUNCTION {bbl.and}
+{ "und"}
+
+FUNCTION {bbl.editors}
+{ "Hg." }
+
+FUNCTION {bbl.editor}
+{ "Hg." }
+
+FUNCTION {bbl.edby}
+{ "herausgegeben von" }
+
+FUNCTION {bbl.edition}
+{ "Aufl." }
+
+FUNCTION {bbl.volume}
+{ "Bd." }
+
+FUNCTION {bbl.of}
+{ "von" }
+
+FUNCTION {bbl.number}
+{ "Nr." }
+
+FUNCTION {bbl.nr}
+{ "Nr." }
+
+FUNCTION {bbl.in}
+{ "in" }
+
+FUNCTION {bbl.pages}
+{ "S." }
+
+FUNCTION {bbl.page}
+{ "S." }
+
+FUNCTION {bbl.chapter}
+{ "Kap." }
+
+FUNCTION {bbl.techrep}
+{ "{Techn.\ Ber.}" }
+
+FUNCTION {bbl.mthesis}
+{ "Diplomarbeit" }
+
+FUNCTION {bbl.phdthesis}
+{ "Dissertation" }
+
+FUNCTION {bbl.first}
+{ "1." }
+
+FUNCTION {bbl.second}
+{ "2." }
+
+FUNCTION {bbl.third}
+{ "3." }
+
+FUNCTION {bbl.fourth}
+{ "4." }
+
+FUNCTION {bbl.fifth}
+{ "5." }
+
+FUNCTION {bbl.th}
+{ "." }
+
+MACRO {jan} {"Jan."}
+
+MACRO {feb} {"Febr."}
+
+MACRO {mar} {"M\^^b{a}rz"}
+
+MACRO {apr} {"Apr."}
+
+MACRO {may} {"Mai"}
+
+MACRO {jun} {"Juni"}
+
+MACRO {jul} {"Juli"}
+
+MACRO {aug} {"Aug."}
+
+MACRO {sep} {"Sept."}
+
+MACRO {oct} {"Okt."}
+
+MACRO {nov} {"Nov."}
+
+MACRO {dec} {"Dez."}
+
+ % End of language definition file
+
+MACRO {acmcs} {"ACM Computing Surveys"}
+
+MACRO {acta} {"Acta Informatica"}
+
+MACRO {cacm} {"Communications of the ACM"}
+
+MACRO {ibmjrd} {"IBM Journal of Research and Development"}
+
+MACRO {ibmsj} {"IBM Systems Journal"}
+
+MACRO {ieeese} {"IEEE Transactions on Software Engineering"}
+
+MACRO {ieeetc} {"IEEE Transactions on Computers"}
+
+MACRO {ieeetcad}
+ {"IEEE Transactions on Computer-Aided Design of Integrated Circuits"}
+
+MACRO {ipl} {"Information Processing Letters"}
+
+MACRO {jacm} {"Journal of the ACM"}
+
+MACRO {jcss} {"Journal of Computer and System Sciences"}
+
+MACRO {scp} {"Science of Computer Programming"}
+
+MACRO {sicomp} {"SIAM Journal on Computing"}
+
+MACRO {tocs} {"ACM Transactions on Computer Systems"}
+
+MACRO {tods} {"ACM Transactions on Database Systems"}
+
+MACRO {tog} {"ACM Transactions on Graphics"}
+
+MACRO {toms} {"ACM Transactions on Mathematical Software"}
+
+MACRO {toois} {"ACM Transactions on Office Information Systems"}
+
+MACRO {toplas} {"ACM Transactions on Programming Languages and Systems"}
+
+MACRO {tcs} {"Theoretical Computer Science"}
+
+INTEGERS { nameptr namesleft numnames }
+
+FUNCTION {format.names}
+{ 's :=
+ #1 'nameptr :=
+ s num.names$ 'numnames :=
+ numnames 'namesleft :=
+ { namesleft #0 > }
+ { nameptr #1 >
+ { s nameptr "{ff~}{vv~}{ll}{, jj}" format.name$ }
+ { s nameptr "{vv~}{ll}{, ff}{, jj}" format.name$ }
+ if$
+ 't :=
+ nameptr #1 >
+ {
+ namesleft #1 >
+ { "; " * t * }
+ {
+ s nameptr "{ll}" format.name$ duplicate$ "others" =
+ { 't := }
+ { pop$ }
+ if$
+ t "others" =
+ {
+ " et~al." *
+ }
+ { bbl.and space.word * t * }
+ if$
+ }
+ if$
+ }
+ 't
+ if$
+ nameptr #1 + 'nameptr :=
+ namesleft #1 - 'namesleft :=
+ }
+ while$
+}
+FUNCTION {format.names.ed}
+{ 's :=
+ #1 'nameptr :=
+ s num.names$ 'numnames :=
+ numnames 'namesleft :=
+ { namesleft #0 > }
+ { s nameptr
+ "{ff~}{vv~}{ll}{, jj}"
+ format.name$
+ 't :=
+ nameptr #1 >
+ {
+ namesleft #1 >
+ { "; " * t * }
+ {
+ s nameptr "{ll}" format.name$ duplicate$ "others" =
+ { 't := }
+ { pop$ }
+ if$
+ t "others" =
+ {
+ " et~al." *
+ }
+ { bbl.and space.word * t * }
+ if$
+ }
+ if$
+ }
+ 't
+ if$
+ nameptr #1 + 'nameptr :=
+ namesleft #1 - 'namesleft :=
+ }
+ while$
+}
+
+FUNCTION {format.key}
+{ empty$
+ { key field.or.null }
+ { "" }
+ if$
+}
+
+FUNCTION {format.authors}
+{ author empty$
+ { "" }
+ { author format.names }
+ if$
+}
+
+FUNCTION {format.editors}
+{ editor empty$
+ { "" }
+ { editor format.names
+ editor num.names$ #1 >
+ { ", " * bbl.editors * }
+ { ", " * bbl.editor * }
+ if$
+ }
+ if$
+}
+
+FUNCTION {format.in.editors}
+{ editor empty$
+ { "" }
+ { editor format.names.ed
+ }
+ if$
+}
+
+FUNCTION {format.note}
+{ note empty$
+ { "" }
+ { note #1 #1 substring$
+ duplicate$ "{" =
+ 'skip$
+ { output.state mid.sentence =
+ { "l" }
+ { "u" }
+ if$
+ change.case$
+ }
+ if$
+ note #2 global.max$ substring$ *
+ }
+ if$
+}
+
+FUNCTION {format.title}
+{ title empty$
+ { "" }
+ { title
+ }
+ if$
+}
+
+FUNCTION {format.full.names}
+{'s :=
+ #1 'nameptr :=
+ s num.names$ 'numnames :=
+ numnames 'namesleft :=
+ { namesleft #0 > }
+ { s nameptr
+ "{vv~}{ll}" format.name$
+ 't :=
+ nameptr #1 >
+ {
+ namesleft #1 >
+ { ", " * t * }
+ {
+ s nameptr "{ll}" format.name$ duplicate$ "others" =
+ { 't := }
+ { pop$ }
+ if$
+ t "others" =
+ {
+ " et~al." *
+ }
+ { bbl.and space.word * t * }
+ if$
+ }
+ if$
+ }
+ 't
+ if$
+ nameptr #1 + 'nameptr :=
+ namesleft #1 - 'namesleft :=
+ }
+ while$
+}
+
+FUNCTION {author.editor.key.full}
+{ author empty$
+ { editor empty$
+ { key empty$
+ { cite$ #1 #3 substring$ }
+ 'key
+ if$
+ }
+ { editor format.full.names }
+ if$
+ }
+ { author format.full.names }
+ if$
+}
+
+FUNCTION {author.key.full}
+{ author empty$
+ { key empty$
+ { cite$ #1 #3 substring$ }
+ 'key
+ if$
+ }
+ { author format.full.names }
+ if$
+}
+
+FUNCTION {editor.key.full}
+{ editor empty$
+ { key empty$
+ { cite$ #1 #3 substring$ }
+ 'key
+ if$
+ }
+ { editor format.full.names }
+ if$
+}
+
+FUNCTION {make.full.names}
+{ type$ "book" =
+ type$ "inbook" =
+ or
+ 'author.editor.key.full
+ { type$ "proceedings" =
+ 'editor.key.full
+ 'author.key.full
+ if$
+ }
+ if$
+}
+
+FUNCTION {output.bibitem}
+{ newline$
+ "\bibitem[{" write$
+ label write$
+ ")" make.full.names duplicate$ short.list =
+ { pop$ }
+ { * }
+ if$
+ "}]{" * write$
+ cite$ write$
+ "}" write$
+ newline$
+ ""
+ before.all 'output.state :=
+}
+
+FUNCTION {n.dashify}
+{
+ 't :=
+ ""
+ { t empty$ not }
+ { t #1 #1 substring$ "-" =
+ { t #1 #2 substring$ "--" = not
+ { "--" *
+ t #2 global.max$ substring$ 't :=
+ }
+ { { t #1 #1 substring$ "-" = }
+ { "-" *
+ t #2 global.max$ substring$ 't :=
+ }
+ while$
+ }
+ if$
+ }
+ { t #1 #1 substring$ *
+ t #2 global.max$ substring$ 't :=
+ }
+ if$
+ }
+ while$
+}
+
+FUNCTION {word.in}
+{ bbl.in capitalize
+ ":" *
+ " " * }
+
+FUNCTION {format.date}
+{ year duplicate$ empty$
+ { "empty year in " cite$ * "; set to ????" * warning$
+ pop$ "????" }
+ 'skip$
+ if$
+ month empty$
+ 'skip$
+ { month
+ " " * swap$ *
+ }
+ if$
+ extra.label *
+ before.all 'output.state :=
+ " (" swap$ * ")" *
+}
+
+FUNCTION {format.btitle}
+{ title emphasize
+}
+
+FUNCTION {tie.or.space.connect}
+{ duplicate$ text.length$ #3 <
+ { "~" }
+ { " " }
+ if$
+ swap$ * *
+}
+
+FUNCTION {either.or.check}
+{ empty$
+ 'pop$
+ { "can't use both " swap$ * " fields in " * cite$ * warning$ }
+ if$
+}
+
+FUNCTION {format.bvolume}
+{ volume empty$
+ { "" }
+ { bbl.volume volume tie.or.space.connect
+ series empty$
+ 'skip$
+ { bbl.of space.word * series emphasize * }
+ if$
+ "volume and number" number either.or.check
+ }
+ if$
+}
+
+FUNCTION {format.number.series}
+{ volume empty$
+ { number empty$
+ { series field.or.null }
+ { output.state mid.sentence =
+ { bbl.number }
+ { bbl.number capitalize }
+ if$
+ number tie.or.space.connect
+ series empty$
+ { "there's a number but no series in " cite$ * warning$ }
+ { bbl.in space.word * series * }
+ if$
+ }
+ if$
+ }
+ { "" }
+ if$
+}
+
+FUNCTION {is.num}
+{ chr.to.int$
+ duplicate$ "0" chr.to.int$ < not
+ swap$ "9" chr.to.int$ > not and
+}
+
+FUNCTION {extract.num}
+{ duplicate$ 't :=
+ "" 's :=
+ { t empty$ not }
+ { t #1 #1 substring$
+ t #2 global.max$ substring$ 't :=
+ duplicate$ is.num
+ { s swap$ * 's := }
+ { pop$ "" 't := }
+ if$
+ }
+ while$
+ s empty$
+ 'skip$
+ { pop$ s }
+ if$
+}
+
+FUNCTION {convert.edition}
+{ edition extract.num "l" change.case$ 's :=
+ s "first" = s "1" = or
+ { bbl.first 't := }
+ { s "second" = s "2" = or
+ { bbl.second 't := }
+ { s "third" = s "3" = or
+ { bbl.third 't := }
+ { s "fourth" = s "4" = or
+ { bbl.fourth 't := }
+ { s "fifth" = s "5" = or
+ { bbl.fifth 't := }
+ { s #1 #1 substring$ is.num
+ { s bbl.th * 't := }
+ { edition 't := }
+ if$
+ }
+ if$
+ }
+ if$
+ }
+ if$
+ }
+ if$
+ }
+ if$
+ t
+}
+
+FUNCTION {format.edition}
+{ edition empty$
+ { "" }
+ { output.state mid.sentence =
+ { convert.edition "l" change.case$ " " * bbl.edition * }
+ { convert.edition "t" change.case$ " " * bbl.edition * }
+ if$
+ }
+ if$
+}
+
+INTEGERS { multiresult }
+
+FUNCTION {multi.page.check}
+{ 't :=
+ #0 'multiresult :=
+ { multiresult not
+ t empty$ not
+ and
+ }
+ { t #1 #1 substring$
+ duplicate$ "-" =
+ swap$ duplicate$ "," =
+ swap$ "+" =
+ or or
+ { #1 'multiresult := }
+ { t #2 global.max$ substring$ 't := }
+ if$
+ }
+ while$
+ multiresult
+}
+
+FUNCTION {format.pages}
+{ pages empty$
+ { "" }
+ { pages multi.page.check
+ { bbl.pages pages n.dashify tie.or.space.connect }
+ { bbl.page pages tie.or.space.connect }
+ if$
+ }
+ if$
+}
+
+FUNCTION {format.journal.pages}
+{ pages empty$
+ 'skip$
+ { duplicate$ empty$
+ { pop$ format.pages }
+ {
+ ":" *
+ pages n.dashify *
+ }
+ if$
+ }
+ if$
+}
+
+FUNCTION {format.vol.num.pages}
+{ volume field.or.null
+ number empty$
+ 'skip$
+ {
+ "(" number * ")" * *
+ volume empty$
+ { "there's a number but no volume in " cite$ * warning$ }
+ 'skip$
+ if$
+ }
+ if$
+ format.journal.pages
+}
+
+FUNCTION {format.chapter.pages}
+{ chapter empty$
+ 'format.pages
+ { type empty$
+ { bbl.chapter }
+ { type "l" change.case$ }
+ if$
+ chapter tie.or.space.connect
+ pages empty$
+ 'skip$
+ { ", " * format.pages * }
+ if$
+ }
+ if$
+}
+
+FUNCTION {format.in.ed.booktitle}
+{ booktitle empty$
+ { "" }
+ { editor empty$
+ { word.in booktitle emphasize * }
+ { word.in booktitle emphasize *
+ ", " *
+ editor num.names$ #1 >
+ { bbl.editors }
+ { bbl.editor }
+ if$
+ * " " *
+ format.in.editors *
+ }
+ if$
+ }
+ if$
+}
+
+FUNCTION {format.thesis.type}
+{ type empty$
+ 'skip$
+ { pop$
+ type "t" change.case$
+ }
+ if$
+}
+
+FUNCTION {format.tr.number}
+{ type empty$
+ { bbl.techrep }
+ 'type
+ if$
+ number empty$
+ { "t" change.case$ }
+ { number tie.or.space.connect }
+ if$
+}
+
+FUNCTION {format.article.crossref}
+{
+ word.in
+ " \cite{" * crossref * "}" *
+}
+
+FUNCTION {format.book.crossref}
+{ volume empty$
+ { "empty volume in " cite$ * "'s crossref of " * crossref * warning$
+ word.in
+ }
+ { bbl.volume capitalize
+ volume tie.or.space.connect
+ bbl.of space.word *
+ }
+ if$
+ " \cite{" * crossref * "}" *
+}
+
+FUNCTION {format.incoll.inproc.crossref}
+{
+ word.in
+ " \cite{" * crossref * "}" *
+}
+
+FUNCTION {format.publisher}
+{ publisher empty$
+ { "empty publisher in " cite$ * warning$ }
+ 'skip$
+ if$
+ ""
+ address empty$ publisher empty$ and
+ 'skip$
+ {
+ publisher empty$
+ { address empty$
+ 'skip$
+ { address * }
+ if$
+ }
+ { publisher *
+ address empty$
+ 'skip$
+ { ", " * address * }
+ if$
+ }
+ if$
+ }
+ if$
+ output
+}
+
+FUNCTION {article}
+{ output.bibitem
+ format.authors "author" output.check
+ author format.key output
+ format.date "year" output.check
+ date.block
+ format.title "title" output.check
+ new.block
+ crossref missing$
+ { journal
+ emphasize
+ "journal" output.check
+ format.vol.num.pages output
+ }
+ { format.article.crossref output.nonnull
+ format.pages output
+ }
+ if$
+ new.block
+ format.note output
+ fin.entry
+}
+
+FUNCTION {book}
+{ output.bibitem
+ author empty$
+ { format.editors "author and editor" output.check
+ editor format.key output
+ }
+ { format.authors output.nonnull
+ crossref missing$
+ { "author and editor" editor either.or.check }
+ 'skip$
+ if$
+ }
+ if$
+ format.date "year" output.check
+ date.block
+ format.btitle "title" output.check
+ crossref missing$
+ { format.bvolume output
+ new.block
+ format.number.series output
+ new.sentence
+ format.publisher
+ }
+ {
+ new.block
+ format.book.crossref output.nonnull
+ }
+ if$
+ format.edition output
+ new.block
+ format.note output
+ fin.entry
+}
+
+FUNCTION {booklet}
+{ output.bibitem
+ format.authors output
+ author format.key output
+ format.date "year" output.check
+ date.block
+ format.title "title" output.check
+ new.block
+ howpublished output
+ address output
+ new.block
+ format.note output
+ fin.entry
+}
+
+FUNCTION {inbook}
+{ output.bibitem
+ author empty$
+ { format.editors "author and editor" output.check
+ editor format.key output
+ }
+ { format.authors output.nonnull
+ crossref missing$
+ { "author and editor" editor either.or.check }
+ 'skip$
+ if$
+ }
+ if$
+ format.date "year" output.check
+ date.block
+ format.btitle "title" output.check
+ crossref missing$
+ {
+ format.publisher
+ format.bvolume output
+ format.chapter.pages "chapter and pages" output.check
+ new.block
+ format.number.series output
+ new.sentence
+ }
+ {
+ format.chapter.pages "chapter and pages" output.check
+ new.block
+ format.book.crossref output.nonnull
+ }
+ if$
+ format.edition output
+ new.block
+ format.note output
+ fin.entry
+}
+
+FUNCTION {incollection}
+{ output.bibitem
+ format.authors "author" output.check
+ author format.key output
+ format.date "year" output.check
+ date.block
+ format.title "title" output.check
+ new.block
+ crossref missing$
+ { format.in.ed.booktitle "booktitle" output.check
+ format.publisher
+ format.bvolume output
+ format.number.series output
+ format.chapter.pages output
+ new.sentence
+ format.edition output
+ }
+ { format.incoll.inproc.crossref output.nonnull
+ format.chapter.pages output
+ }
+ if$
+ new.block
+ format.note output
+ fin.entry
+}
+
+FUNCTION {inproceedings}
+{ output.bibitem
+ format.authors "author" output.check
+ author format.key output
+ format.date "year" output.check
+ date.block
+ format.title "title" output.check
+ new.block
+ crossref missing$
+ { format.in.ed.booktitle "booktitle" output.check
+ new.sentence
+ publisher empty$
+ { organization output
+ address output
+ }
+ { organization output
+ format.publisher
+ }
+ if$
+ format.bvolume output
+ format.number.series output
+ format.pages output
+ }
+ { format.incoll.inproc.crossref output.nonnull
+ format.pages output
+ }
+ if$
+ new.block
+ format.note output
+ fin.entry
+}
+
+FUNCTION {conference} { inproceedings }
+
+FUNCTION {manual}
+{ output.bibitem
+ format.authors output
+ author format.key output
+ format.date "year" output.check
+ date.block
+ format.btitle "title" output.check
+ organization address new.block.checkb
+ organization output
+ address output
+ format.edition output
+ new.block
+ format.note output
+ fin.entry
+}
+
+FUNCTION {mastersthesis}
+{ output.bibitem
+ format.authors "author" output.check
+ author format.key output
+ format.date "year" output.check
+ date.block
+ format.btitle "title" output.check
+ new.block
+ bbl.mthesis format.thesis.type output.nonnull
+ school "school" output.check
+ address output
+ new.block
+ format.note output
+ fin.entry
+}
+
+FUNCTION {misc}
+{ output.bibitem
+ format.authors output
+ author format.key output
+ format.date "year" output.check
+ date.block
+ format.title output
+ new.block
+ howpublished output
+ new.block
+ format.note output
+ fin.entry
+}
+
+FUNCTION {phdthesis}
+{ output.bibitem
+ format.authors "author" output.check
+ author format.key output
+ format.date "year" output.check
+ date.block
+ format.btitle "title" output.check
+ new.block
+ bbl.phdthesis format.thesis.type output.nonnull
+ school "school" output.check
+ address output
+ new.block
+ format.note output
+ fin.entry
+}
+
+FUNCTION {proceedings}
+{ output.bibitem
+ format.editors output
+ editor format.key output
+ format.date "year" output.check
+ date.block
+ format.btitle "title" output.check
+ format.bvolume output
+ format.number.series output
+ address output
+ new.sentence
+ organization output
+ publisher output
+ new.block
+ format.note output
+ fin.entry
+}
+
+FUNCTION {techreport}
+{ output.bibitem
+ format.authors "author" output.check
+ author format.key output
+ format.date "year" output.check
+ date.block
+ format.btitle "title" output.check
+ new.block
+ format.tr.number output.nonnull
+ institution "institution" output.check
+ address output
+ new.block
+ format.note output
+ fin.entry
+}
+
+FUNCTION {unpublished}
+{ output.bibitem
+ format.authors "author" output.check
+ author format.key output
+ format.date "year" output.check
+ date.block
+ format.title "title" output.check
+ new.block
+ format.note "note" output.check
+ fin.entry
+}
+
+FUNCTION {default.type} { misc }
+
+READ
+
+FUNCTION {sortify}
+{ purify$
+ "l" change.case$
+}
+
+INTEGERS { len }
+
+FUNCTION {chop.word}
+{ 's :=
+ 'len :=
+ s #1 len substring$ =
+ { s len #1 + global.max$ substring$ }
+ 's
+ if$
+}
+
+FUNCTION {format.lab.names}
+{ 's :=
+ s #1 "{vv~}{ll}" format.name$
+ s num.names$ duplicate$
+ #2 >
+ { pop$
+ " et~al." *
+ }
+ { #2 <
+ 'skip$
+ { s #2 "{ff }{vv }{ll}{ jj}" format.name$ "others" =
+ {
+ " et~al." *
+ }
+ { bbl.and space.word * s #2 "{vv~}{ll}" format.name$
+ * }
+ if$
+ }
+ if$
+ }
+ if$
+}
+
+FUNCTION {author.key.label}
+{ author empty$
+ { key empty$
+ { cite$ #1 #3 substring$ }
+ 'key
+ if$
+ }
+ { author format.lab.names }
+ if$
+}
+
+FUNCTION {author.editor.key.label}
+{ author empty$
+ { editor empty$
+ { key empty$
+ { cite$ #1 #3 substring$ }
+ 'key
+ if$
+ }
+ { editor format.lab.names }
+ if$
+ }
+ { author format.lab.names }
+ if$
+}
+
+FUNCTION {editor.key.label}
+{ editor empty$
+ { key empty$
+ { cite$ #1 #3 substring$ }
+ 'key
+ if$
+ }
+ { editor format.lab.names }
+ if$
+}
+
+FUNCTION {calc.short.authors}
+{ type$ "book" =
+ type$ "inbook" =
+ or
+ 'author.editor.key.label
+ { type$ "proceedings" =
+ 'editor.key.label
+ 'author.key.label
+ if$
+ }
+ if$
+ 'short.list :=
+}
+
+FUNCTION {calc.label}
+{ calc.short.authors
+ short.list
+ "("
+ *
+ year duplicate$ empty$
+ { pop$ "????" }
+ 'skip$
+ if$
+ *
+ 'label :=
+}
+
+FUNCTION {sort.format.names}
+{ 's :=
+ #1 'nameptr :=
+ ""
+ s num.names$ 'numnames :=
+ numnames 'namesleft :=
+ { namesleft #0 > }
+ { s nameptr
+ "{ll{ }}{ ff{ }}{ jj{ }}"
+ format.name$ 't :=
+ nameptr #1 >
+ {
+ " " *
+ namesleft #1 = t "others" = and
+ { "zzzzz" * }
+ { t sortify * }
+ if$
+ }
+ { t sortify * }
+ if$
+ nameptr #1 + 'nameptr :=
+ namesleft #1 - 'namesleft :=
+ }
+ while$
+}
+
+FUNCTION {sort.format.title}
+{ 't :=
+ "A " #2
+ "An " #3
+ "The " #4 t chop.word
+ chop.word
+ chop.word
+ sortify
+ #1 global.max$ substring$
+}
+
+FUNCTION {author.sort}
+{ author empty$
+ { key empty$
+ { "to sort, need author or key in " cite$ * warning$
+ ""
+ }
+ { key sortify }
+ if$
+ }
+ { author sort.format.names }
+ if$
+}
+
+FUNCTION {author.editor.sort}
+{ author empty$
+ { editor empty$
+ { key empty$
+ { "to sort, need author, editor, or key in " cite$ * warning$
+ ""
+ }
+ { key sortify }
+ if$
+ }
+ { editor sort.format.names }
+ if$
+ }
+ { author sort.format.names }
+ if$
+}
+
+FUNCTION {editor.sort}
+{ editor empty$
+ { key empty$
+ { "to sort, need editor or key in " cite$ * warning$
+ ""
+ }
+ { key sortify }
+ if$
+ }
+ { editor sort.format.names }
+ if$
+}
+
+FUNCTION {presort}
+{ calc.label
+ label sortify
+ " "
+ *
+ type$ "book" =
+ type$ "inbook" =
+ or
+ 'author.editor.sort
+ { type$ "proceedings" =
+ 'editor.sort
+ 'author.sort
+ if$
+ }
+ if$
+ #1 entry.max$ substring$
+ 'sort.label :=
+ sort.label
+ *
+ " "
+ *
+ title field.or.null
+ sort.format.title
+ *
+ #1 entry.max$ substring$
+ 'sort.key$ :=
+}
+
+ITERATE {presort}
+
+SORT
+
+STRINGS { last.label next.extra }
+
+INTEGERS { last.extra.num number.label }
+
+FUNCTION {initialize.extra.label.stuff}
+{ #0 int.to.chr$ 'last.label :=
+ "" 'next.extra :=
+ #0 'last.extra.num :=
+ #0 'number.label :=
+}
+
+FUNCTION {forward.pass}
+{ last.label label =
+ { last.extra.num #1 + 'last.extra.num :=
+ last.extra.num int.to.chr$ 'extra.label :=
+ }
+ { "a" chr.to.int$ 'last.extra.num :=
+ "" 'extra.label :=
+ label 'last.label :=
+ }
+ if$
+ number.label #1 + 'number.label :=
+}
+
+FUNCTION {reverse.pass}
+{ next.extra "b" =
+ { "a" 'extra.label := }
+ 'skip$
+ if$
+ extra.label 'next.extra :=
+ extra.label
+ duplicate$ empty$
+ 'skip$
+ { "{\natexlab{" swap$ * "}}" * }
+ if$
+ 'extra.label :=
+ label extra.label * 'label :=
+}
+
+EXECUTE {initialize.extra.label.stuff}
+
+ITERATE {forward.pass}
+
+REVERSE {reverse.pass}
+
+FUNCTION {bib.sort.order}
+{ sort.label
+ " "
+ *
+ year field.or.null sortify
+ *
+ " "
+ *
+ title field.or.null
+ sort.format.title
+ *
+ #1 entry.max$ substring$
+ 'sort.key$ :=
+}
+
+ITERATE {bib.sort.order}
+
+SORT
+
+FUNCTION {begin.bib}
+{ preamble$ empty$
+ 'skip$
+ { preamble$ write$ newline$ }
+ if$
+ "\begin{thebibliography}{" number.label int.to.str$ * "}" *
+ write$ newline$
+ "\expandafter\ifx\csname natexlab\endcsname\relax\def\natexlab#1{#1}\fi"
+ write$ newline$
+}
+
+EXECUTE {begin.bib}
+
+EXECUTE {init.state.consts}
+
+ITERATE {call.type$}
+
+FUNCTION {end.bib}
+{ newline$
+ "\end{thebibliography}" write$ newline$
+}
+
+EXECUTE {end.bib}
+%% End of customized bst file
+%%
+%% End of file `hc-de.bst'.
diff --git a/macros/latex/contrib/hc/hc-en.bst b/macros/latex/contrib/hc/hc-en.bst
new file mode 100644
index 0000000000..434b69a019
--- /dev/null
+++ b/macros/latex/contrib/hc/hc-en.bst
@@ -0,0 +1,1539 @@
+%%
+%% This is file `hc-en.bst',
+%% generated with the docstrip utility.
+%%
+%% The original source files were:
+%%
+%% merlin.mbs (with options: `,ay,nat,nm-revv1,aunm-semi,dt-beg,yr-par,aymth,yrp-col,note-yr,atit-u,trtit-b,pre-pub,edby,edbyx,in-col,pp,ed,abr,mth-bare,ord,nfss')
+%% ----------------------------------------
+%% *** Christian Siefkes standard bibliography ***
+%%
+ %-------------------------------------------------------------------
+ % The original source file contains the following version information:
+ % \ProvidesFile{merlin.mbs}[1998/02/25 3.85a (PWD)]
+ %
+ % NOTICE:
+ % This file may be used for non-profit purposes.
+ % It may not be distributed in exchange for money,
+ % other than distribution costs.
+ %
+ % The author provides it `as is' and does not guarantee it in any way.
+ %
+ % Copyright (C) 1994-98 Patrick W. Daly
+ %-------------------------------------------------------------------
+ % For use with BibTeX version 0.99a or later
+ %-------------------------------------------------------------------
+ % This bibliography style file is intended for texts in ENGLISH
+ % This is an author-year citation style bibliography. As such, it is
+ % non-standard LaTeX, and requires a special package file to function properly.
+ % Such a package is natbib.sty by Patrick W. Daly
+ % The form of the \bibitem entries is
+ % \bibitem[Jones et al.(1990)]{key}...
+ % \bibitem[Jones et al.(1990)Jones, Baker, and Smith]{key}...
+ % The essential feature is that the label (the part in brackets) consists
+ % of the author names, as they should appear in the citation, with the year
+ % in parentheses following. There must be no space before the opening
+ % parenthesis!
+ % With natbib v5.3, a full list of authors may also follow the year.
+ % In natbib.sty, it is possible to define the type of enclosures that is
+ % really wanted (brackets or parentheses), but in either case, there must
+ % be parentheses in the label.
+ % The \cite command functions as follows:
+ % \citet{key} ==>> Jones et al. (1990)
+ % \citet*{key} ==>> Jones, Baker, and Smith (1990)
+ % \citep{key} ==>> (Jones et al., 1990)
+ % \citep*{key} ==>> (Jones, Baker, and Smith, 1990)
+ % \citep[chap. 2]{key} ==>> (Jones et al., 1990, chap. 2)
+ % \citep[e.g.][]{key} ==>> (e.g. Jones et al., 1990)
+ % \citep[e.g.][p. 32]{key} ==>> (e.g. Jones et al., p. 32)
+ % \citeauthor{key} ==>> Jones et al.
+ % \citeauthor*{key} ==>> Jones, Baker, and Smith
+ % \citeyear{key} ==>> 1990
+ %---------------------------------------------------------------------
+
+ENTRY
+ { address
+ author
+ booktitle
+ chapter
+ edition
+ editor
+ howpublished
+ institution
+ journal
+ key
+ month
+ note
+ number
+ organization
+ pages
+ publisher
+ school
+ series
+ title
+ type
+ volume
+ year
+ }
+ {}
+ { label extra.label sort.label short.list }
+
+INTEGERS { output.state before.all mid.sentence after.sentence after.block }
+
+FUNCTION {init.state.consts}
+{ #0 'before.all :=
+ #1 'mid.sentence :=
+ #2 'after.sentence :=
+ #3 'after.block :=
+}
+
+STRINGS { s t }
+
+FUNCTION {output.nonnull}
+{ 's :=
+ output.state mid.sentence =
+ { ", " * write$ }
+ { output.state after.block =
+ { add.period$ write$
+ newline$
+ "\newblock " write$
+ }
+ { output.state before.all =
+ 'write$
+ { add.period$ " " * write$ }
+ if$
+ }
+ if$
+ mid.sentence 'output.state :=
+ }
+ if$
+ s
+}
+
+FUNCTION {output}
+{ duplicate$ empty$
+ 'pop$
+ 'output.nonnull
+ if$
+}
+
+FUNCTION {output.check}
+{ 't :=
+ duplicate$ empty$
+ { pop$ "empty " t * " in " * cite$ * warning$ }
+ 'output.nonnull
+ if$
+}
+
+FUNCTION {fin.entry}
+{ add.period$
+ write$
+ newline$
+}
+
+FUNCTION {new.block}
+{ output.state before.all =
+ 'skip$
+ { after.block 'output.state := }
+ if$
+}
+
+FUNCTION {new.sentence}
+{ output.state after.block =
+ 'skip$
+ { output.state before.all =
+ 'skip$
+ { after.sentence 'output.state := }
+ if$
+ }
+ if$
+}
+
+FUNCTION {add.blank}
+{ " " * before.all 'output.state :=
+}
+
+FUNCTION {date.block}
+{
+ ":" *
+ add.blank
+}
+
+FUNCTION {not}
+{ { #0 }
+ { #1 }
+ if$
+}
+
+FUNCTION {and}
+{ 'skip$
+ { pop$ #0 }
+ if$
+}
+
+FUNCTION {or}
+{ { pop$ #1 }
+ 'skip$
+ if$
+}
+
+FUNCTION {new.block.checkb}
+{ empty$
+ swap$ empty$
+ and
+ 'skip$
+ 'new.block
+ if$
+}
+
+FUNCTION {field.or.null}
+{ duplicate$ empty$
+ { pop$ "" }
+ 'skip$
+ if$
+}
+
+FUNCTION {emphasize}
+{ duplicate$ empty$
+ { pop$ "" }
+ { "\emph{" swap$ * "}" * }
+ if$
+}
+
+FUNCTION {capitalize}
+{ "u" change.case$ "t" change.case$ }
+
+FUNCTION {space.word}
+{ " " swap$ * " " * }
+
+ % Here are the language-specific definitions for explicit words.
+ % Each function has a name bbl.xxx where xxx is the English word.
+ % The language selected here is ENGLISH
+FUNCTION {bbl.and}
+{ "and"}
+
+FUNCTION {bbl.editors}
+{ "eds." }
+
+FUNCTION {bbl.editor}
+{ "ed." }
+
+FUNCTION {bbl.edby}
+{ "edited by" }
+
+FUNCTION {bbl.edition}
+{ "edn." }
+
+FUNCTION {bbl.volume}
+{ "vol." }
+
+FUNCTION {bbl.of}
+{ "of" }
+
+FUNCTION {bbl.number}
+{ "no." }
+
+FUNCTION {bbl.nr}
+{ "no." }
+
+FUNCTION {bbl.in}
+{ "in" }
+
+FUNCTION {bbl.pages}
+{ "pp." }
+
+FUNCTION {bbl.page}
+{ "p." }
+
+FUNCTION {bbl.chapter}
+{ "chap." }
+
+FUNCTION {bbl.techrep}
+{ "Tech. Rep." }
+
+FUNCTION {bbl.mthesis}
+{ "Master's thesis" }
+
+FUNCTION {bbl.phdthesis}
+{ "Ph.D. thesis" }
+
+FUNCTION {bbl.first}
+{ "1st" }
+
+FUNCTION {bbl.second}
+{ "2nd" }
+
+FUNCTION {bbl.third}
+{ "3rd" }
+
+FUNCTION {bbl.fourth}
+{ "4th" }
+
+FUNCTION {bbl.fifth}
+{ "5th" }
+
+FUNCTION {bbl.st}
+{ "st" }
+
+FUNCTION {bbl.nd}
+{ "nd" }
+
+FUNCTION {bbl.rd}
+{ "rd" }
+
+FUNCTION {bbl.th}
+{ "th" }
+
+MACRO {jan} {"Jan."}
+
+MACRO {feb} {"Feb."}
+
+MACRO {mar} {"Mar."}
+
+MACRO {apr} {"Apr."}
+
+MACRO {may} {"May"}
+
+MACRO {jun} {"Jun."}
+
+MACRO {jul} {"Jul."}
+
+MACRO {aug} {"Aug."}
+
+MACRO {sep} {"Sep."}
+
+MACRO {oct} {"Oct."}
+
+MACRO {nov} {"Nov."}
+
+MACRO {dec} {"Dec."}
+
+FUNCTION {eng.ord}
+{ duplicate$ "1" swap$ *
+ #-2 #1 substring$ "1" =
+ { bbl.th * }
+ { duplicate$ #-1 #1 substring$
+ duplicate$ "1" =
+ { pop$ bbl.st * }
+ { duplicate$ "2" =
+ { pop$ bbl.nd * }
+ { "3" =
+ { bbl.rd * }
+ { bbl.th * }
+ if$
+ }
+ if$
+ }
+ if$
+ }
+ if$
+}
+
+MACRO {acmcs} {"ACM Computing Surveys"}
+
+MACRO {acta} {"Acta Informatica"}
+
+MACRO {cacm} {"Communications of the ACM"}
+
+MACRO {ibmjrd} {"IBM Journal of Research and Development"}
+
+MACRO {ibmsj} {"IBM Systems Journal"}
+
+MACRO {ieeese} {"IEEE Transactions on Software Engineering"}
+
+MACRO {ieeetc} {"IEEE Transactions on Computers"}
+
+MACRO {ieeetcad}
+ {"IEEE Transactions on Computer-Aided Design of Integrated Circuits"}
+
+MACRO {ipl} {"Information Processing Letters"}
+
+MACRO {jacm} {"Journal of the ACM"}
+
+MACRO {jcss} {"Journal of Computer and System Sciences"}
+
+MACRO {scp} {"Science of Computer Programming"}
+
+MACRO {sicomp} {"SIAM Journal on Computing"}
+
+MACRO {tocs} {"ACM Transactions on Computer Systems"}
+
+MACRO {tods} {"ACM Transactions on Database Systems"}
+
+MACRO {tog} {"ACM Transactions on Graphics"}
+
+MACRO {toms} {"ACM Transactions on Mathematical Software"}
+
+MACRO {toois} {"ACM Transactions on Office Information Systems"}
+
+MACRO {toplas} {"ACM Transactions on Programming Languages and Systems"}
+
+MACRO {tcs} {"Theoretical Computer Science"}
+
+INTEGERS { nameptr namesleft numnames }
+
+FUNCTION {format.names}
+{ 's :=
+ #1 'nameptr :=
+ s num.names$ 'numnames :=
+ numnames 'namesleft :=
+ { namesleft #0 > }
+ { nameptr #1 >
+ { s nameptr "{ff~}{vv~}{ll}{, jj}" format.name$ }
+ { s nameptr "{vv~}{ll}{, ff}{, jj}" format.name$ }
+ if$
+ 't :=
+ nameptr #1 >
+ {
+ namesleft #1 >
+ { "; " * t * }
+ {
+ numnames #2 >
+ { ";" * }
+ 'skip$
+ if$
+ s nameptr "{ll}" format.name$ duplicate$ "others" =
+ { 't := }
+ { pop$ }
+ if$
+ t "others" =
+ {
+ " et~al." *
+ }
+ { bbl.and space.word * t * }
+ if$
+ }
+ if$
+ }
+ 't
+ if$
+ nameptr #1 + 'nameptr :=
+ namesleft #1 - 'namesleft :=
+ }
+ while$
+}
+FUNCTION {format.names.ed}
+{ 's :=
+ #1 'nameptr :=
+ s num.names$ 'numnames :=
+ numnames 'namesleft :=
+ { namesleft #0 > }
+ { s nameptr
+ "{ff~}{vv~}{ll}{, jj}"
+ format.name$
+ 't :=
+ nameptr #1 >
+ {
+ namesleft #1 >
+ { "; " * t * }
+ {
+ numnames #2 >
+ { ";" * }
+ 'skip$
+ if$
+ s nameptr "{ll}" format.name$ duplicate$ "others" =
+ { 't := }
+ { pop$ }
+ if$
+ t "others" =
+ {
+ " et~al." *
+ }
+ { bbl.and space.word * t * }
+ if$
+ }
+ if$
+ }
+ 't
+ if$
+ nameptr #1 + 'nameptr :=
+ namesleft #1 - 'namesleft :=
+ }
+ while$
+}
+
+FUNCTION {format.key}
+{ empty$
+ { key field.or.null }
+ { "" }
+ if$
+}
+
+FUNCTION {format.authors}
+{ author empty$
+ { "" }
+ { author format.names }
+ if$
+}
+
+FUNCTION {format.editors}
+{ editor empty$
+ { "" }
+ { editor format.names
+ editor num.names$ #1 >
+ { ", " * bbl.editors * }
+ { ", " * bbl.editor * }
+ if$
+ }
+ if$
+}
+
+FUNCTION {format.in.editors}
+{ editor empty$
+ { "" }
+ { editor format.names.ed
+ }
+ if$
+}
+
+FUNCTION {format.note}
+{ note empty$
+ { "" }
+ { note #1 #1 substring$
+ duplicate$ "{" =
+ 'skip$
+ { output.state mid.sentence =
+ { "l" }
+ { "u" }
+ if$
+ change.case$
+ }
+ if$
+ note #2 global.max$ substring$ *
+ }
+ if$
+}
+
+FUNCTION {format.title}
+{ title empty$
+ { "" }
+ { title
+ }
+ if$
+}
+
+FUNCTION {format.full.names}
+{'s :=
+ #1 'nameptr :=
+ s num.names$ 'numnames :=
+ numnames 'namesleft :=
+ { namesleft #0 > }
+ { s nameptr
+ "{vv~}{ll}" format.name$
+ 't :=
+ nameptr #1 >
+ {
+ namesleft #1 >
+ { ", " * t * }
+ {
+ numnames #2 >
+ { "," * }
+ 'skip$
+ if$
+ s nameptr "{ll}" format.name$ duplicate$ "others" =
+ { 't := }
+ { pop$ }
+ if$
+ t "others" =
+ {
+ " et~al." *
+ }
+ { bbl.and space.word * t * }
+ if$
+ }
+ if$
+ }
+ 't
+ if$
+ nameptr #1 + 'nameptr :=
+ namesleft #1 - 'namesleft :=
+ }
+ while$
+}
+
+FUNCTION {author.editor.key.full}
+{ author empty$
+ { editor empty$
+ { key empty$
+ { cite$ #1 #3 substring$ }
+ 'key
+ if$
+ }
+ { editor format.full.names }
+ if$
+ }
+ { author format.full.names }
+ if$
+}
+
+FUNCTION {author.key.full}
+{ author empty$
+ { key empty$
+ { cite$ #1 #3 substring$ }
+ 'key
+ if$
+ }
+ { author format.full.names }
+ if$
+}
+
+FUNCTION {editor.key.full}
+{ editor empty$
+ { key empty$
+ { cite$ #1 #3 substring$ }
+ 'key
+ if$
+ }
+ { editor format.full.names }
+ if$
+}
+
+FUNCTION {make.full.names}
+{ type$ "book" =
+ type$ "inbook" =
+ or
+ 'author.editor.key.full
+ { type$ "proceedings" =
+ 'editor.key.full
+ 'author.key.full
+ if$
+ }
+ if$
+}
+
+FUNCTION {output.bibitem}
+{ newline$
+ "\bibitem[{" write$
+ label write$
+ ")" make.full.names duplicate$ short.list =
+ { pop$ }
+ { * }
+ if$
+ "}]{" * write$
+ cite$ write$
+ "}" write$
+ newline$
+ ""
+ before.all 'output.state :=
+}
+
+FUNCTION {n.dashify}
+{
+ 't :=
+ ""
+ { t empty$ not }
+ { t #1 #1 substring$ "-" =
+ { t #1 #2 substring$ "--" = not
+ { "--" *
+ t #2 global.max$ substring$ 't :=
+ }
+ { { t #1 #1 substring$ "-" = }
+ { "-" *
+ t #2 global.max$ substring$ 't :=
+ }
+ while$
+ }
+ if$
+ }
+ { t #1 #1 substring$ *
+ t #2 global.max$ substring$ 't :=
+ }
+ if$
+ }
+ while$
+}
+
+FUNCTION {word.in}
+{ bbl.in capitalize
+ ":" *
+ " " * }
+
+FUNCTION {format.date}
+{ year duplicate$ empty$
+ { "empty year in " cite$ * "; set to ????" * warning$
+ pop$ "????" }
+ 'skip$
+ if$
+ month empty$
+ 'skip$
+ { month
+ " " * swap$ *
+ }
+ if$
+ purify$
+ extra.label *
+ before.all 'output.state :=
+ " (" swap$ * ")" *
+}
+
+FUNCTION {format.btitle}
+{ title emphasize
+}
+
+FUNCTION {tie.or.space.connect}
+{ duplicate$ text.length$ #3 <
+ { "~" }
+ { " " }
+ if$
+ swap$ * *
+}
+
+FUNCTION {either.or.check}
+{ empty$
+ 'pop$
+ { "can't use both " swap$ * " fields in " * cite$ * warning$ }
+ if$
+}
+
+FUNCTION {format.bvolume}
+{ volume empty$
+ { "" }
+ { bbl.volume volume tie.or.space.connect
+ series empty$
+ 'skip$
+ { bbl.of space.word * series emphasize * }
+ if$
+ "volume and number" number either.or.check
+ }
+ if$
+}
+
+FUNCTION {format.number.series}
+{ volume empty$
+ { number empty$
+ { series field.or.null }
+ { output.state mid.sentence =
+ { bbl.number }
+ { bbl.number capitalize }
+ if$
+ number tie.or.space.connect
+ series empty$
+ { "there's a number but no series in " cite$ * warning$ }
+ { bbl.in space.word * series * }
+ if$
+ }
+ if$
+ }
+ { "" }
+ if$
+}
+
+FUNCTION {is.num}
+{ chr.to.int$
+ duplicate$ "0" chr.to.int$ < not
+ swap$ "9" chr.to.int$ > not and
+}
+
+FUNCTION {extract.num}
+{ duplicate$ 't :=
+ "" 's :=
+ { t empty$ not }
+ { t #1 #1 substring$
+ t #2 global.max$ substring$ 't :=
+ duplicate$ is.num
+ { s swap$ * 's := }
+ { pop$ "" 't := }
+ if$
+ }
+ while$
+ s empty$
+ 'skip$
+ { pop$ s }
+ if$
+}
+
+FUNCTION {convert.edition}
+{ edition extract.num "l" change.case$ 's :=
+ s "first" = s "1" = or
+ { bbl.first 't := }
+ { s "second" = s "2" = or
+ { bbl.second 't := }
+ { s "third" = s "3" = or
+ { bbl.third 't := }
+ { s "fourth" = s "4" = or
+ { bbl.fourth 't := }
+ { s "fifth" = s "5" = or
+ { bbl.fifth 't := }
+ { s #1 #1 substring$ is.num
+ { s eng.ord 't := }
+ { edition 't := }
+ if$
+ }
+ if$
+ }
+ if$
+ }
+ if$
+ }
+ if$
+ }
+ if$
+ t
+}
+
+FUNCTION {format.edition}
+{ edition empty$
+ { "" }
+ { output.state mid.sentence =
+ { convert.edition "l" change.case$ " " * bbl.edition * }
+ { convert.edition "t" change.case$ " " * bbl.edition * }
+ if$
+ }
+ if$
+}
+
+INTEGERS { multiresult }
+
+FUNCTION {multi.page.check}
+{ 't :=
+ #0 'multiresult :=
+ { multiresult not
+ t empty$ not
+ and
+ }
+ { t #1 #1 substring$
+ duplicate$ "-" =
+ swap$ duplicate$ "," =
+ swap$ "+" =
+ or or
+ { #1 'multiresult := }
+ { t #2 global.max$ substring$ 't := }
+ if$
+ }
+ while$
+ multiresult
+}
+
+FUNCTION {format.pages}
+{ pages empty$
+ { "" }
+ { pages multi.page.check
+ { bbl.pages pages n.dashify tie.or.space.connect }
+ { bbl.page pages tie.or.space.connect }
+ if$
+ }
+ if$
+}
+
+FUNCTION {format.journal.pages}
+{ pages empty$
+ 'skip$
+ { duplicate$ empty$
+ { pop$ format.pages }
+ {
+ ":" *
+ pages n.dashify *
+ }
+ if$
+ }
+ if$
+}
+
+FUNCTION {format.vol.num.pages}
+{ volume field.or.null
+ number empty$
+ 'skip$
+ {
+ "(" number * ")" * *
+ volume empty$
+ { "there's a number but no volume in " cite$ * warning$ }
+ 'skip$
+ if$
+ }
+ if$
+ format.journal.pages
+}
+
+FUNCTION {format.chapter.pages}
+{ chapter empty$
+ 'format.pages
+ { type empty$
+ { bbl.chapter }
+ { type "l" change.case$ }
+ if$
+ chapter tie.or.space.connect
+ pages empty$
+ 'skip$
+ { ", " * format.pages * }
+ if$
+ }
+ if$
+}
+
+FUNCTION {format.in.ed.booktitle}
+{ booktitle empty$
+ { "" }
+ { editor empty$
+ { word.in booktitle emphasize * }
+ { word.in booktitle emphasize *
+ ", " *
+ editor num.names$ #1 >
+ { bbl.editors }
+ { bbl.editor }
+ if$
+ * " " *
+ format.in.editors *
+ }
+ if$
+ }
+ if$
+}
+
+FUNCTION {format.thesis.type}
+{ type empty$
+ 'skip$
+ { pop$
+ type "t" change.case$
+ }
+ if$
+}
+
+FUNCTION {format.tr.number}
+{ type empty$
+ { bbl.techrep }
+ 'type
+ if$
+ number empty$
+ { "t" change.case$ }
+ { number tie.or.space.connect }
+ if$
+}
+
+FUNCTION {format.article.crossref}
+{
+ word.in
+ " \cite{" * crossref * "}" *
+}
+
+FUNCTION {format.book.crossref}
+{ volume empty$
+ { "empty volume in " cite$ * "'s crossref of " * crossref * warning$
+ word.in
+ }
+ { bbl.volume capitalize
+ volume tie.or.space.connect
+ bbl.of space.word *
+ }
+ if$
+ " \cite{" * crossref * "}" *
+}
+
+FUNCTION {format.incoll.inproc.crossref}
+{
+ word.in
+ " \cite{" * crossref * "}" *
+}
+
+FUNCTION {format.publisher}
+{ publisher empty$
+ { "empty publisher in " cite$ * warning$ }
+ 'skip$
+ if$
+ ""
+ address empty$ publisher empty$ and
+ 'skip$
+ {
+ publisher empty$
+ { address empty$
+ 'skip$
+ { address * }
+ if$
+ }
+ { publisher *
+ address empty$
+ 'skip$
+ { ", " * address * }
+ if$
+ }
+ if$
+ }
+ if$
+ output
+}
+
+FUNCTION {article}
+{ output.bibitem
+ format.authors "author" output.check
+ author format.key output
+ format.date "year" output.check
+ date.block
+ format.title "title" output.check
+ new.block
+ crossref missing$
+ { journal
+ emphasize
+ "journal" output.check
+ format.vol.num.pages output
+ }
+ { format.article.crossref output.nonnull
+ format.pages output
+ }
+ if$
+ new.block
+ format.note output
+ fin.entry
+}
+
+FUNCTION {book}
+{ output.bibitem
+ author empty$
+ { format.editors "author and editor" output.check
+ editor format.key output
+ }
+ { format.authors output.nonnull
+ crossref missing$
+ { "author and editor" editor either.or.check }
+ 'skip$
+ if$
+ }
+ if$
+ format.date "year" output.check
+ date.block
+ format.btitle "title" output.check
+ crossref missing$
+ { format.bvolume output
+ new.block
+ format.number.series output
+ new.sentence
+ format.publisher
+ }
+ {
+ new.block
+ format.book.crossref output.nonnull
+ }
+ if$
+ format.edition output
+ new.block
+ format.note output
+ fin.entry
+}
+
+FUNCTION {booklet}
+{ output.bibitem
+ format.authors output
+ author format.key output
+ format.date "year" output.check
+ date.block
+ format.title "title" output.check
+ new.block
+ howpublished output
+ address output
+ new.block
+ format.note output
+ fin.entry
+}
+
+FUNCTION {inbook}
+{ output.bibitem
+ author empty$
+ { format.editors "author and editor" output.check
+ editor format.key output
+ }
+ { format.authors output.nonnull
+ crossref missing$
+ { "author and editor" editor either.or.check }
+ 'skip$
+ if$
+ }
+ if$
+ format.date "year" output.check
+ date.block
+ format.btitle "title" output.check
+ crossref missing$
+ {
+ format.publisher
+ format.bvolume output
+ format.chapter.pages "chapter and pages" output.check
+ new.block
+ format.number.series output
+ new.sentence
+ }
+ {
+ format.chapter.pages "chapter and pages" output.check
+ new.block
+ format.book.crossref output.nonnull
+ }
+ if$
+ format.edition output
+ new.block
+ format.note output
+ fin.entry
+}
+
+FUNCTION {incollection}
+{ output.bibitem
+ format.authors "author" output.check
+ author format.key output
+ format.date "year" output.check
+ date.block
+ format.title "title" output.check
+ new.block
+ crossref missing$
+ { format.in.ed.booktitle "booktitle" output.check
+ format.publisher
+ format.bvolume output
+ format.number.series output
+ format.chapter.pages output
+ new.sentence
+ format.edition output
+ }
+ { format.incoll.inproc.crossref output.nonnull
+ format.chapter.pages output
+ }
+ if$
+ new.block
+ format.note output
+ fin.entry
+}
+
+FUNCTION {inproceedings}
+{ output.bibitem
+ format.authors "author" output.check
+ author format.key output
+ format.date "year" output.check
+ date.block
+ format.title "title" output.check
+ new.block
+ crossref missing$
+ { format.in.ed.booktitle "booktitle" output.check
+ new.sentence
+ publisher empty$
+ { organization output
+ address output
+ }
+ { organization output
+ format.publisher
+ }
+ if$
+ format.bvolume output
+ format.number.series output
+ format.pages output
+ }
+ { format.incoll.inproc.crossref output.nonnull
+ format.pages output
+ }
+ if$
+ new.block
+ format.note output
+ fin.entry
+}
+
+FUNCTION {conference} { inproceedings }
+
+FUNCTION {manual}
+{ output.bibitem
+ format.authors output
+ author format.key output
+ format.date "year" output.check
+ date.block
+ format.btitle "title" output.check
+ organization address new.block.checkb
+ organization output
+ address output
+ format.edition output
+ new.block
+ format.note output
+ fin.entry
+}
+
+FUNCTION {mastersthesis}
+{ output.bibitem
+ format.authors "author" output.check
+ author format.key output
+ format.date "year" output.check
+ date.block
+ format.btitle "title" output.check
+ new.block
+ bbl.mthesis format.thesis.type output.nonnull
+ school "school" output.check
+ address output
+ new.block
+ format.note output
+ fin.entry
+}
+
+FUNCTION {misc}
+{ output.bibitem
+ format.authors output
+ author format.key output
+ format.date "year" output.check
+ date.block
+ format.title output
+ new.block
+ howpublished output
+ new.block
+ format.note output
+ fin.entry
+}
+
+FUNCTION {phdthesis}
+{ output.bibitem
+ format.authors "author" output.check
+ author format.key output
+ format.date "year" output.check
+ date.block
+ format.btitle "title" output.check
+ new.block
+ bbl.phdthesis format.thesis.type output.nonnull
+ school "school" output.check
+ address output
+ new.block
+ format.note output
+ fin.entry
+}
+
+FUNCTION {proceedings}
+{ output.bibitem
+ format.editors output
+ editor format.key output
+ format.date "year" output.check
+ date.block
+ format.btitle "title" output.check
+ format.bvolume output
+ format.number.series output
+ address output
+ new.sentence
+ organization output
+ publisher output
+ new.block
+ format.note output
+ fin.entry
+}
+
+FUNCTION {techreport}
+{ output.bibitem
+ format.authors "author" output.check
+ author format.key output
+ format.date "year" output.check
+ date.block
+ format.btitle "title" output.check
+ new.block
+ format.tr.number output.nonnull
+ institution "institution" output.check
+ address output
+ new.block
+ format.note output
+ fin.entry
+}
+
+FUNCTION {unpublished}
+{ output.bibitem
+ format.authors "author" output.check
+ author format.key output
+ format.date "year" output.check
+ date.block
+ format.title "title" output.check
+ new.block
+ format.note "note" output.check
+ fin.entry
+}
+
+FUNCTION {default.type} { misc }
+
+READ
+
+FUNCTION {sortify}
+{ purify$
+ "l" change.case$
+}
+
+INTEGERS { len }
+
+FUNCTION {chop.word}
+{ 's :=
+ 'len :=
+ s #1 len substring$ =
+ { s len #1 + global.max$ substring$ }
+ 's
+ if$
+}
+
+FUNCTION {format.lab.names}
+{ 's :=
+ s #1 "{vv~}{ll}" format.name$
+ s num.names$ duplicate$
+ #2 >
+ { pop$
+ " et~al." *
+ }
+ { #2 <
+ 'skip$
+ { s #2 "{ff }{vv }{ll}{ jj}" format.name$ "others" =
+ {
+ " et~al." *
+ }
+ { bbl.and space.word * s #2 "{vv~}{ll}" format.name$
+ * }
+ if$
+ }
+ if$
+ }
+ if$
+}
+
+FUNCTION {author.key.label}
+{ author empty$
+ { key empty$
+ { cite$ #1 #3 substring$ }
+ 'key
+ if$
+ }
+ { author format.lab.names }
+ if$
+}
+
+FUNCTION {author.editor.key.label}
+{ author empty$
+ { editor empty$
+ { key empty$
+ { cite$ #1 #3 substring$ }
+ 'key
+ if$
+ }
+ { editor format.lab.names }
+ if$
+ }
+ { author format.lab.names }
+ if$
+}
+
+FUNCTION {editor.key.label}
+{ editor empty$
+ { key empty$
+ { cite$ #1 #3 substring$ }
+ 'key
+ if$
+ }
+ { editor format.lab.names }
+ if$
+}
+
+FUNCTION {calc.short.authors}
+{ type$ "book" =
+ type$ "inbook" =
+ or
+ 'author.editor.key.label
+ { type$ "proceedings" =
+ 'editor.key.label
+ 'author.key.label
+ if$
+ }
+ if$
+ 'short.list :=
+}
+
+FUNCTION {calc.label}
+{ calc.short.authors
+ short.list
+ "("
+ *
+ year duplicate$ empty$
+ { pop$ "????" }
+ 'skip$
+ if$
+ *
+ 'label :=
+}
+
+FUNCTION {sort.format.names}
+{ 's :=
+ #1 'nameptr :=
+ ""
+ s num.names$ 'numnames :=
+ numnames 'namesleft :=
+ { namesleft #0 > }
+ { s nameptr
+ "{vv{ } }{ll{ }}{ ff{ }}{ jj{ }}"
+ format.name$ 't :=
+ nameptr #1 >
+ {
+ " " *
+ namesleft #1 = t "others" = and
+ { "zzzzz" * }
+ { t sortify * }
+ if$
+ }
+ { t sortify * }
+ if$
+ nameptr #1 + 'nameptr :=
+ namesleft #1 - 'namesleft :=
+ }
+ while$
+}
+
+FUNCTION {sort.format.title}
+{ 't :=
+ "A " #2
+ "An " #3
+ "The " #4 t chop.word
+ chop.word
+ chop.word
+ sortify
+ #1 global.max$ substring$
+}
+
+FUNCTION {author.sort}
+{ author empty$
+ { key empty$
+ { "to sort, need author or key in " cite$ * warning$
+ ""
+ }
+ { key sortify }
+ if$
+ }
+ { author sort.format.names }
+ if$
+}
+
+FUNCTION {author.editor.sort}
+{ author empty$
+ { editor empty$
+ { key empty$
+ { "to sort, need author, editor, or key in " cite$ * warning$
+ ""
+ }
+ { key sortify }
+ if$
+ }
+ { editor sort.format.names }
+ if$
+ }
+ { author sort.format.names }
+ if$
+}
+
+FUNCTION {editor.sort}
+{ editor empty$
+ { key empty$
+ { "to sort, need editor or key in " cite$ * warning$
+ ""
+ }
+ { key sortify }
+ if$
+ }
+ { editor sort.format.names }
+ if$
+}
+
+FUNCTION {presort}
+{ calc.label
+ label sortify
+ " "
+ *
+ type$ "book" =
+ type$ "inbook" =
+ or
+ 'author.editor.sort
+ { type$ "proceedings" =
+ 'editor.sort
+ 'author.sort
+ if$
+ }
+ if$
+ #1 entry.max$ substring$
+ 'sort.label :=
+ sort.label
+ *
+ " "
+ *
+ title field.or.null
+ sort.format.title
+ *
+ #1 entry.max$ substring$
+ 'sort.key$ :=
+}
+
+ITERATE {presort}
+
+SORT
+
+STRINGS { last.label next.extra }
+
+INTEGERS { last.extra.num number.label }
+
+FUNCTION {initialize.extra.label.stuff}
+{ #0 int.to.chr$ 'last.label :=
+ "" 'next.extra :=
+ #0 'last.extra.num :=
+ #0 'number.label :=
+}
+
+FUNCTION {forward.pass}
+{ last.label label =
+ { last.extra.num #1 + 'last.extra.num :=
+ last.extra.num int.to.chr$ 'extra.label :=
+ }
+ { "a" chr.to.int$ 'last.extra.num :=
+ "" 'extra.label :=
+ label 'last.label :=
+ }
+ if$
+ number.label #1 + 'number.label :=
+}
+
+FUNCTION {reverse.pass}
+{ next.extra "b" =
+ { "a" 'extra.label := }
+ 'skip$
+ if$
+ extra.label 'next.extra :=
+ extra.label
+ duplicate$ empty$
+ 'skip$
+ { "{\natexlab{" swap$ * "}}" * }
+ if$
+ 'extra.label :=
+ label extra.label * 'label :=
+}
+
+EXECUTE {initialize.extra.label.stuff}
+
+ITERATE {forward.pass}
+
+REVERSE {reverse.pass}
+
+FUNCTION {bib.sort.order}
+{ sort.label
+ " "
+ *
+ year field.or.null sortify
+ *
+ " "
+ *
+ title field.or.null
+ sort.format.title
+ *
+ #1 entry.max$ substring$
+ 'sort.key$ :=
+}
+
+ITERATE {bib.sort.order}
+
+SORT
+
+FUNCTION {begin.bib}
+{ preamble$ empty$
+ 'skip$
+ { preamble$ write$ newline$ }
+ if$
+ "\begin{thebibliography}{" number.label int.to.str$ * "}" *
+ write$ newline$
+ "\expandafter\ifx\csname natexlab\endcsname\relax\def\natexlab#1{#1}\fi"
+ write$ newline$
+}
+
+EXECUTE {begin.bib}
+
+EXECUTE {init.state.consts}
+
+ITERATE {call.type$}
+
+FUNCTION {end.bib}
+{ newline$
+ "\end{thebibliography}" write$ newline$
+}
+
+EXECUTE {end.bib}
+%% End of customized bst file
+%%
+%% End of file `hc-en.bst'.
diff --git a/macros/latex/contrib/hc/hc.dtx b/macros/latex/contrib/hc/hc.dtx
new file mode 100644
index 0000000000..e76abdd853
--- /dev/null
+++ b/macros/latex/contrib/hc/hc.dtx
@@ -0,0 +1,1624 @@
+% \iffalse
+%
+% This is file `hc.dtx'.
+%
+%% Copyright (C) 1998--2000 Christian Siefkes <error@cs.tu-berlin.de>
+%%
+%% Updates are available via http://tal.cs.tu-berlin.de/error/TeX/
+%%
+%% This file is part of the HC Bundle for LaTeX2e.
+%% -----------------------------------------------
+%%
+%% This file is free software; you can redistribute it and/or modify
+%% it under the terms of the GNU Library General Public License as
+%% published by the Free Software Foundation; either version 2 of the
+%% License, or (at your option) any later version.
+%%
+%% This document is distributed in the hope that it will be useful, but
+%% WITHOUT ANY WARRANTY; without even the implied warranty of
+%% MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU
+%% General Public License for more details.
+%%
+%% You should have received a copy of the GNU General Public License
+%% along with this program; see the file COPYING. If not, write to
+%% the Free Software Foundation, Inc., 59 Temple Place - Suite 330,
+%% Boston, MA 02111-1307, USA.
+%%
+% \CharacterTable
+% {Upper-case \A\B\C\D\E\F\G\H\I\J\K\L\M\N\O\P\Q\R\S\T\U\V\W\X\Y\Z
+% Lower-case \a\b\c\d\e\f\g\h\i\j\k\l\m\n\o\p\q\r\s\t\u\v\w\x\y\z
+% Digits \0\1\2\3\4\5\6\7\8\9
+% Exclamation \! Double quote \" Hash (number) \#
+% Dollar \$ Percent \% Ampersand \&
+% Acute accent \' Left paren \( Right paren \)
+% Asterisk \* Plus \+ Comma \,
+% Minus \- Point \. Solidus \/
+% Colon \: Semicolon \; Less than \<
+% Equals \= Greater than \> Question mark \?
+% Commercial at \@ Left bracket \[ Backslash \\
+% Right bracket \] Circumflex \^ Underscore \_
+% Grave accent \` Left brace \{ Vertical bar \|
+% Right brace \} Tilde \~}
+%
+%<class>\NeedsTeXFormat{LaTeX2e}[1995/12/01]
+%<*dtx>
+ \ProvidesFile{hc.dtx}%
+%</dtx>
+%<german>\ProvidesFile{german.hld}%
+%<hcart>\ProvidesClass{hcart}%
+%<hcletter>\ProvidesClass{hcletter}%
+%<hcreport>\ProvidesClass{hcreport}%
+%<hcslides>\ProvidesClass{hcslides}%
+% \fi
+% \ProvidesFile{hc.dtx}%
+ [2000/03/23 v1.07 LaTeX2e HC Bundle]
+% \iffalse
+%
+%<*driver>
+\documentclass[paper]{hcart}
+\usepackage{doc}
+\begin{document}
+\DocInput{hc.dtx}
+\end{document}
+%</driver>
+% \fi
+%
+% \newcommand{\cs}[1]{\texttt{\backslash #1}}
+% \changes{v0.9}{1999/09/09}{First public prerelease}
+% \changes{v1.0}{1999/11/01}{First official public version}
+% \changes{v1.01}{1999/11/05}{better PDF support,
+% \cs{keywords} and \cs{hyperinfo} commands added}
+% \changes{v1.02}{1999/11/28}{author's email \& homepage made
+% hyperlinks, \cs{phyp} and \cs{arrow} commands added}
+% \changes{v1.02a}{1999/12/23}{bugs fixed (load \texttt{babel} after
+% \texttt{natbib} package; correct formatting of \cs{tit(sub)info)}}
+% \changes{v1.02b}{1999/12/26}{\cs{bibfirst} command removed}
+% \changes{v1.02c}{2000/01/02}{\cs{addrdiv} command added}
+% \changes{v1.02d}{2000/01/04}{\cs{enge} command added,
+% \cs{bibmov} command modified}
+% \changes{v1.02e}{2000/01/05}{\cs{etal} command modified}
+% \changes{v1.02f}{2000/01/30}{bug fixed (\texttt{german} option)}
+% \changes{v1.03}{2000/01/31}{\cs{cfcite} command added}
+% \changes{v1.04}{2000/02/23}{\texttt{xspace} package support added}
+% \changes{v1.04a}{2000/02/24}{\texttt{mathpple} package support added}
+% \changes{v1.04b}{2000/02/29}{output of \cs{noyear} and \cs{noplace}
+% commands changed}
+% \changes{v1.05}{2000/03/04}{\texttt{dialog} environment and \cs{newspeaker}
+% command added}
+% \changes{v1.06}{2000/03/10}{\texttt{fnbib} option and \cs{f} command added}
+% \changes{v1.06a}{2000/03/11}{bug fixed (\texttt{fnbib} option)}
+% \changes{v1.06b}{2000/03/13}{implementation of (\texttt{bib} option changed)}
+% \changes{v1.06c}{2000/03/14}{\cs{ps@headings} macro changed)}
+% \changes{v1.07}{2000/03/23}{\cs{see} macro added)}
+% \GetFileInfo{hc.dtx}
+%
+% \tit[\filedate]{The HC Bundle for \LaTeXe\\\fileversion}
+%
+% \MakeShortVerb{\|}
+% \newcommand{\descOpt}[1]{\marginbox{#1}}
+% \newcommand{\descCom}[1]{\marginbox{\tt\textbackslash #1}}
+% \newcommand{\descEnv}[2][]
+% {\marginbox{\texttt{\textbackslash begin{\tt\string{}#2{\tt\string}}}#1}}
+% \newcommand{\comdiv}{\\ \tt\textbackslash}
+% \newcommand{\m}[1]{\mbox{\it #1\/}}
+% \renewcommand{\arg}[1]{{\tt\string{}\m{#1}{\tt\string}}}
+% \newcommand{\oarg}[1]{{\tt[}\m{#1}{\tt]}}
+% \newcommand{\rarg}[1]{<\m{#1}>}
+%
+% \section{Introduction}
+% The HC Bundle for \LaTeXe\ provides the following four classes as
+% replacement for the \LaTeX\ default classes:
+% \begin{flexlist}{hcreport.cls}
+% \item[hcart.cls] substitute for the |article| class,\\
+% based upon the |scrartcl| class from the KoMa-Script bundle;
+% \item[hcreport.cls] substitute for the |report| class,\\
+% based upon the |scrreprt| class from the KoMa-Script bundle;
+% \item[hcletter.cls] substitute for the |letter| class,\\
+% based upon the |scrlettr| class from the KoMa-Script bundle;
+% \item[hcslides.cls] substitute for the |slides| class,\\
+% based upon the |seminar| class.
+% \end{flexlist}
+% \begin{macrocode}
+%<*hcart>
+\newcommand{\thisclass}{hcart}
+\newcommand{\superclass}{scrartcl}
+%</hcart>
+%<*hcletter>
+\newcommand{\thisclass}{hcletter}
+\newcommand{\superclass}{scrlettr}
+%</hcletter>
+%<*hcreport>
+\newcommand{\thisclass}{hcreport}
+\newcommand{\superclass}{scrreprt}
+%</hcreport>
+%<*hcslides>
+\newcommand{\thisclass}{hcslides}
+\newcommand{\superclass}{seminar}
+%</hcslides>
+% \end{macrocode}
+% \section{Options}
+% \subsection{General Options}
+% \descOpt{german\\english}
+% Loads a language. Default is English. At the moment no other languages are
+% supported. Requires the |babel| package.
+% \begin{macrocode}
+%<*class>
+\newif\if@german
+\@germanfalse
+\newif\if@deflang
+\@deflangtrue
+\DeclareOption{german}{\@deflangfalse\@germantrue
+ \PassOptionsToPackage{ngerman}{babel}
+ \PassOptionsToPackage{german}{fancyref}
+ \AtEndOfClass{\input{german.hld}}}
+\DeclareOption{english}{\@deflangfalse
+ \PassOptionsToPackage{\CurrentOption}{babel}}
+% \end{macrocode}
+% \descOpt{a4paper\\letterpaper}
+% Use the DIN~A4 (default) or the letter paper format? At the moment no other
+% paper formats are supported.
+% \begin{macrocode}
+\newif\if@defpaper
+\@defpapertrue
+\DeclareOption{a4paper}{
+%<hcart|hcletter|hcreport>\PassOptionsToClass{\CurrentOption}{\superclass}
+%<hcslides>\PassOptionsToClass{a4}{\superclass}
+\PassOptionsToPackage{\CurrentOption}{hyperref}
+\@defpaperfalse}
+\DeclareOption{letterpaper}{
+%<hcart|hcletter|hcreport>\PassOptionsToClass{\CurrentOption}{\superclass}
+\PassOptionsToPackage{\CurrentOption}{hyperref}
+\@defpaperfalse}
+% \end{macrocode}
+% \descOpt{palatino\\nopalatino}
+% Use the Palatino or the Standard \TeX\ font? Palatino is default (requires
+% the |palatino| and the |mathpple| packages).
+% \begin{macrocode}
+\newif\if@palatino
+\@palatinotrue
+\DeclareOption{palatino}{\@palatinotrue}
+\DeclareOption{nopalatino}{\@palatinofalse}
+% \end{macrocode}
+% \descOpt{ding}
+% Provide some fancy lists and symbols using the Dingbat symbols (requires
+% the |pifont| style of the |psnfss| package)?
+% \begin{macrocode}
+\newif\if@ding
+\@dingfalse
+\DeclareOption{ding}{\@dingtrue}
+% \end{macrocode}
+% \descOpt{euro\\noeuro}
+% Provide the Euro symbol \E\ (default, requires the |eurofont| package)?
+% \begin{macrocode}
+\newif\if@euro
+\@eurotrue
+\DeclareOption{euro}{\@eurotrue}
+\DeclareOption{noeuro}{\@eurofalse}
+% \end{macrocode}
+% \descOpt{fancyref\\nofancyref}
+% Provide fancy reference commands (default, requires the |fancyref| and the
+% |varioref| packages)?
+% \begin{macrocode}
+\newif\if@fancyref
+\@fancyreftrue
+\DeclareOption{fancyref}{\@fancyreftrue}
+\DeclareOption{nofancyref}{\@fancyreffalse}
+% \end{macrocode}
+% \descOpt{html\\nohtml}
+% Provide HTML commands (default, requires the |html| package bundled with
+% \LaTeX2HTML)?
+% \begin{macrocode}
+\newif\if@html
+\@htmltrue
+\DeclareOption{html}{\@htmltrue}
+\DeclareOption{nohtml}{\@htmlfalse}
+%</class>
+% \end{macrocode}
+% \subsection{Options for the hcart and hcreport classes}
+% \descOpt{headsepline\\headnosepline}
+% Draw a horizontal line below the header line (default)?
+% \begin{macrocode}
+%<*hcart|hcreport>
+\newif\if@defhsl
+\@defhsltrue
+\DeclareOption{headsepline}{\PassOptionsToClass
+{\CurrentOption}{\superclass}\@defhslfalse}
+\DeclareOption{headnosepline}{\PassOptionsToClass
+{\CurrentOption}{\superclass}\@defhslfalse}
+% \end{macrocode}
+% \descOpt{onecolumn\\twocolumn}
+% Set the text in one or two columns (default is one)?
+% \begin{macrocode}
+\DeclareOption{onecolumn}{\PassOptionsToClass
+{\CurrentOption}{\superclass}}
+\DeclareOption{twocolumn}{\PassOptionsToClass
+{\CurrentOption}{\superclass}}
+% \end{macrocode}
+% \descOpt{hcarea\\hcnoarea}
+% Set the default area to 240mm $\times$ 150mm (default)? Otherwise,
+% the default value from the |scrartcl| resp. |scrreprt| classes is used
+% if you do not set the area manually (e.g. with the |\areaset| command).
+% \begin{macrocode}
+\newif\if@hcarea
+\@hcareatrue
+\DeclareOption{hcarea}{\@hcareatrue}
+\DeclareOption{hcnoarea}{\@hcareafalse}
+% \end{macrocode}
+% \descOpt{hcfootnotes\\hcnofootnotes}
+% Nicer formatting of footnotes (default)?
+% \begin{macrocode}
+\newif\if@hcfootnotes
+\@hcfootnotestrue
+\DeclareOption{hcfootnotes}{\@hcfootnotestrue}
+\DeclareOption{hcnofootnotes}{\@hcfootnotesfalse}
+% \end{macrocode}
+% \descOpt{magazine}
+% Provide commands for magazine or newspaper articles? This sets the
+% |html| option too.
+% \begin{macrocode}
+\newif\if@magazine
+\@magazinefalse
+\DeclareOption{magazine}{\@magazinetrue\@htmltrue}
+% \end{macrocode}
+% \descOpt{parskip}
+% Skip paragraphs instead of indenting them?
+% \begin{macrocode}
+\newif\if@parskip
+\@parskipfalse
+\DeclareOption{parskip}{\@parskiptrue}
+% \end{macrocode}
+% \descOpt{wide}
+% Use a wide line distance (ca. 1.5)?
+% \begin{macrocode}
+\newif\if@wide
+\@widefalse
+\DeclareOption{wide}{\@widetrue}
+%</hcart|hcreport>
+% \end{macrocode}
+% \subsection{Options for the hcart, hcreport and hcletter classes}
+% \descOpt{10pt\\11pt\\12pt}
+% Use a font size of 10, 11, or 12 (default) points?
+% \begin{macrocode}
+%<*hcart|hcreport|hcletter>
+\newif\if@defsize
+\@defsizetrue
+\DeclareOption{10pt}{\PassOptionsToClass{\CurrentOption}{\superclass}
+\@defsizefalse}
+\DeclareOption{11pt}{\PassOptionsToClass{\CurrentOption}{\superclass}
+\@defsizefalse}
+\DeclareOption{12pt}{\PassOptionsToClass{\CurrentOption}{\superclass}
+\@defsizefalse}
+%</hcart|hcreport|hcletter>
+% \end{macrocode}
+% \subsection{Options for the hcart, hcreport and hcslides classes}
+% \descOpt{bib\\nobib}
+% Use \BibTeX?
+% \begin{macrocode}
+%<*hcart|hcreport|hcslides>
+\newif\if@bib
+\@bibfalse
+\DeclareOption{bib}{\@bibtrue}
+\DeclareOption{nobib}{\@bibfalse}
+% \end{macrocode}
+% \descOpt{fnbib\\autbib\\numbib}
+% \BibTeX\ references are written in footnotes (default) or in
+% author-year or in numerical style.
+% These options set the |bib| option too.
+% \begin{macrocode}
+\newif\if@fnbib
+\@fnbibtrue
+\newif\if@autbib
+\@autbibfalse
+\newif\if@numbib
+\@numbibfalse
+\DeclareOption{fnbib}{\@fnbibtrue\@autbibfalse\@numbibfalse\@bibtrue}
+\DeclareOption{autbib}{\@fnbibfalse\@autbibtrue\@numbibfalse\@bibtrue}
+\DeclareOption{numbib}{\@fnbibfalse\@autbibfalse\@numbibtrue\@bibtrue}
+% \end{macrocode}
+% \descOpt{htmlbib\\nohtmlbib}
+% Use the |html| package for online references with \BibTeX\ (default)?
+% This loads the |html| option too.
+% \begin{macrocode}
+\newif\if@htmlbib
+\@htmlbibtrue
+\DeclareOption{htmlbib}{\@htmlbibtrue\@htmltrue}
+\DeclareOption{nohtmlbib}{\@htmlbibfalse}
+% \end{macrocode}
+% \descOpt{paper}
+% Provide formatting and commands for a scientific paper? This sets the
+% |bib| and |html| options too.
+% \begin{macrocode}
+\newif\if@paper
+\@paperfalse
+\DeclareOption{paper}{\@papertrue\@bibtrue\@htmltrue}
+% \end{macrocode}
+% \descOpt{pdf\\nopdf}
+% Prepare file for the PDF format? This loads the |hyperref| package.
+% This option is set automagically by running |pdflatex|.
+% \begin{macrocode}
+\newif\if@pdf
+\ifx\pdfoutput\undefined
+ \@pdffalse
+\else
+ \@pdftrue
+\fi
+\DeclareOption{pdf}{\@pdftrue}
+\DeclareOption{nopdf}{\@pdffalse}
+%</hcart|hcreport|hcslides>
+% \end{macrocode}
+% \subsection{Options for the hcreport class}
+% \descOpt{openany\\openright}
+% Start new chapters always on a right page (not by default)?
+% \begin{macrocode}
+%<*hcreport>
+\DeclareOption{openany}
+ {\PassOptionsToClass{\CurrentOption}{\superclass}}
+\DeclareOption{openright}
+ {\PassOptionsToClass{\CurrentOption}{\superclass}}
+%</hcreport>
+% \end{macrocode}
+% \subsection{Options for the hcslides class}
+% \descOpt{twotoc\\onetoc}
+% Print table of contents in two columns (requires the |multicol| package)?
+% \begin{macrocode}
+%<*hcslides>
+\newif\if@twotoc
+\@twotocfalse
+\DeclareOption{twotoc}{\@twotoctrue}
+\DeclareOption{onetoc}{\@twotocfalse}
+%</hcslides>
+% \end{macrocode}
+% \subsection{Other Options}
+% Other options are ignored.
+% \begin{macrocode}
+%<*class>
+\DeclareOption*{\ClassWarning{\thisclass}%
+ {Unknown Option: `\CurrentOption '}%
+}
+% \end{macrocode}
+% Options not implemented:
+% \begin{widedesc}
+% \item[scrartcl, scrlettr, scrreprt]
+% paper sizes except a4 and letter (a5paper, b5paper, legalpaper,
+% executivepaper ...); oneside, twoside;
+% \item[scrartcl, scrreprt]
+% DIV\dots, DIVcalc, DIVclassic, BCOR; headinclude, headexclude, footinclude,
+% footexclude; footsepline, footnosepline;
+% bigheadings, normalheadings, smallheadings;
+% pointednumbers, pointlessnumbers; abstracton, abstractoff;
+% titlepage, notitlepage; leqno, fleqn; openbib; portrait, landscape;
+% draft, final; bibtotocnumbered;
+% \item[scrlettr]
+% orgdate; wlocfield, slocfield;
+% \item[seminar]
+% portrait, landscape; article, slidesonly, notes,
+% notesonly; semlayer, semcolor.
+% \end{widedesc}
+% \section{Commands and Environments}
+% \subsection{Configuration}
+% \descCom{defaulttitle\arg{title}\comdiv
+% defaultauthor\arg{author}\comdiv
+% defaultaddress\arg{address}\comdiv
+% defaultemail\arg{mail-address}\comdiv
+% defaulthomepage\arg{website}}
+% Used if no author information is specified.
+% They are all empty by default. Renew them in one of the config files
+% (see below).
+% \descCom{autdiv}
+% Use instead of |\\| in |\defaultauthor|.
+% \descCom{autinfodiv}
+% Use instead of |\\| in |\defaultaddress| etc.
+% \begin{macrocode}
+\newcommand{\defaulttitle}{}
+\newcommand{\defaultauthor}{}
+\newcommand{\defaultaddress}{}
+\newcommand{\defaultemail}{}
+\newcommand{\defaulthomepage}{}
+\newcommand{\currenttitle}{\defaulttitle}
+\newcommand{\currentauthor}{\defaultauthor}
+\newcommand{\autdiv}{\\[-0.4ex]\normalfont\Large}
+\newcommand{\autinfodiv}{\\[-1ex]\normalfont\normalsize}
+\ProcessOptions\relax
+%</class>
+%<*hcart|hcreport>
+\if@defhsl
+ \PassOptionsToClass{headsepline}{\superclass}
+\fi
+% \end{macrocode}
+% The |twoside|, |pointlessnumbers|,
+% |liststotoc|, |bibtotoc| and |idxtotoc|
+% options are always used with the |hcart| and |hcreport| classes.
+% The |hcletter| class always uses the |wlocfield| option.
+% \begin{macrocode}
+\PassOptionsToClass{twoside,pointlessnumbers,liststotoc,
+ bibtotoc,idxtotoc}{\superclass}
+%</hcart|hcreport>
+%<hcletter>\PassOptionsToClass{wlocfield}{\superclass}
+%<*hcart|hcreport|hcletter>
+\if@defsize
+ \PassOptionsToClass{12pt}{\superclass}
+\fi
+%</hcart|hcreport|hcletter>
+%<*class>
+\if@deflang
+ \PassOptionsToPackage{english}{babel}
+\fi
+\if@defpaper
+%<hcart|hcreport> \PassOptionsToClass{a4paper}{\superclass}
+%<hcslides> \PassOptionsToClass{a4}{\superclass}
+ \PassOptionsToPackage{a4paper}{hyperref}
+\fi
+\LoadClass{\superclass}
+% \end{macrocode}
+% The normal spacing is used after the end of a sentence.
+% \begin{macrocode}
+\sloppy
+\clubpenalty9999
+\@clubpenalty\clubpenalty
+\widowpenalty9999
+\displaywidowpenalty1000
+\brokenpenalty1000
+\frenchspacing
+% \end{macrocode}
+% The modern font encoding (T1) and the latin1 input encoding are used
+% (this requires the |T1| and |latin1| packages). The |ifthen|,
+% the |babel| and the |xspace| packages are always used.
+% The |bib| option loads the |natbib| package.
+% \begin{macrocode}
+%<hcart|hcreport|hcslides>\RequirePackage{natbib}
+\RequirePackage[T1]{fontenc}
+\RequirePackage[latin1]{inputenc}
+\RequirePackage{ifthen}
+\RequirePackage{babel}
+\RequirePackage{xspace}
+% \end{macrocode}
+% The config file |hc.cfg| is used by all classes. Every class also
+% uses a config file with its own name, e.g. the hcart class uses
+% |hcart.cfg|. The settings in |hc.cfg| may be overwritten by the
+% class specific config files.
+% \begin{macrocode}
+\InputIfFileExists{hc.cfg}{%
+ \ClassInfo{\thisclass}
+ {Loading configuration file hc.cfg}}{%
+ \ClassInfo{\thisclass}
+ {Configuration file hc.cfg not found}}
+\InputIfFileExists{\thisclass.cfg}{%
+ \ClassInfo{\thisclass}
+ {Loading configuration file \thisclass.cfg}}{%
+ \ClassInfo{\thisclass}
+ {Configuration file \thisclass.cfg not found}}
+% \end{macrocode}
+% \subsection{General Commands and Environments}
+% \descCom{q\arg{quote}}
+% \rarg{quote} is put into quotation marks. May be nested: A quote inside
+% another quote uses inner quotation marks.
+% \begin{macrocode}
+\newcommand{\nextstartq}{`}
+\newcommand{\nextendq}{'}
+\newcommand{\otherstartq}{``}
+\newcommand{\otherendq}{''}
+\newcommand{\tmpq}{}
+\newcommand{\q}[1]{\nextstartq{}%
+ \let\tmpq\nextstartq%
+ \let\nextstartq\otherstartq%
+ \let\otherstartq\tmpq%
+ \let\tmpq\nextendq%
+ \let\nextendq\otherendq%
+ \let\otherendq\tmpq%
+ #1%
+ \let\tmpq\nextstartq%
+ \let\nextstartq\otherstartq%
+ \let\otherstartq\tmpq%
+ \let\tmpq\nextendq%
+ \let\nextendq\otherendq%
+ \let\otherendq\tmpq%
+ \nextendq{}%
+}
+% \end{macrocode}
+% \descCom{hq\arg{quote}}
+% \rarg{quote} is always put into inner (\hq{half}) quotation marks.
+% \begin{macrocode}
+\newcommand{\hq}[1]{``#1''}
+% \end{macrocode}
+% \descCom{fq\arg{quote}}
+% \rarg{quote} is always put into outer (\fq{full}) quotation marks.
+% \begin{macrocode}
+\newcommand{\fq}[1]{`#1'}
+% \end{macrocode}
+% \descCom{dash\arg{text}}
+% \rarg{text} is put between dashes.
+% \begin{macrocode}
+\newcommand{\dash}[1]{---#1---}
+% \end{macrocode}
+% \descEnv[\oarg{separator}\arg{longest-title}]{flexlist}
+% A list environment similar to the |description| environment.
+% All items are indented by the width of \rarg{longest-title}.
+% The default \rarg{separator} is \q{:}.
+% \begin{macrocode}
+\newenvironment{flexlist}[2][:]
+ {\begin{list}{}
+ {\settowidth{\labelwidth}{\sffamily\bfseries #2#1 }
+ \setlength{\leftmargin}{\labelwidth}
+ \addtolength{\leftmargin}{\labelsep}
+ \renewcommand{\makelabel}[1]
+ {\sffamily\bfseries ##1#1 \hfill}}}
+ {\end{list}}
+% \end{macrocode}
+% \descEnv[\oarg{separator}]{widedesc}
+% A variation of the |flexlist| environment.
+% All items are indented by the width of a date (\q{00.00.0000}).
+% The default \rarg{separator} is \q{:}.
+% \begin{macrocode}
+\newenvironment{widedesc}[1][:]
+ {\begin{flexlist}[#1]{00.00.0000}}
+ {\end{flexlist}}
+% \end{macrocode}
+% \descCom{pcent\arg{value}}
+% Prints \rarg{value} followed by the percent symbol \%.
+% \begin{macrocode}
+\newcommand{\pcent}[1]{#1\,\%}
+% \end{macrocode}
+% \descCom{qdots}
+% Prints the scientific omission symbol \qdots.
+% \begin{macrocode}
+\newcommand{\qdots}{\mbox{[\dots]}\xspace}
+% \end{macrocode}
+% \descCom{phyp}
+% Prints a (part of a) word in parenthesis, ended by a hypen, like
+% \phyp{love}letter.
+% \begin{macrocode}
+\newcommand{\phyp}[1]
+ {(#1\textormath{\leavevmode\hbox{-}}{-})\hskip\z@skip}
+% \end{macrocode}
+% \descCom{arrow}
+% Prints an arrow: \arrow.
+% \begin{macrocode}
+\newcommand{\arrow}{\ensuremath{\rightarrow}\xspace}
+% \end{macrocode}
+% \descCom{f\comdiv ff}
+% Print the abbreviations for \q{the following page(s)}
+% (\q{f} resp. \q{ff} after a small space).
+% \begin{macrocode}
+\newcommand{\f}{\,f}
+\newcommand{\ff}{\,ff}
+% \end{macrocode}
+% \descCom{distance}
+% Starts a new un-indented paragraph following an empty line.
+% \begin{macrocode}
+\newcommand{\distance}{\par\bigskip\noindent}
+% \end{macrocode}
+% \descCom{stardistance}
+% Starts a new un-indented paragraph following three centered stars.
+% \begin{macrocode}
+\newcommand{\stardistance}
+ {\par\bigskip{\centering *~~~*~~~*\par}\bigskip\noindent}
+% \end{macrocode}
+% \descCom{linedistance}
+% Starts a new un-indented paragraph following an horizontal rule.
+% \begin{macrocode}
+\newcommand{\linedistance}{%
+ \begin{center}
+ \begin{tabular}{p{0.33\textwidth}}
+ \hrule
+ \end{tabular}
+ \end{center}
+ \medskip\noindent%
+}
+% \end{macrocode}
+% \descCom{sig\arg{name}}
+% Prints \rarg{name} as signature (flushright in italics).
+% \begin{macrocode}
+\newcommand{\sig}[1]{\par{\raggedleft\emph{#1}\par}}
+% \end{macrocode}
+% \descCom{intro\arg{text}}
+% \rarg{text} is centered in an extra paragraph, using a bold font.
+% Followed by some space.
+% \begin{macrocode}
+\newcommand{\intro}[1]{{\par\centering\textbf{#1}\par}
+ \medskip\noindent\ignorespaces}
+% \end{macrocode}
+% \descCom{hint\arg{text}}
+% \rarg{text} is centered in an extra paragraph, using a large font.
+% \begin{macrocode}
+\newcommand{\hint}[1]{{\par\centering\LARGE #1\par}
+ \noindent\ignorespaces}
+% \end{macrocode}
+% \descCom{cen\arg{text}}
+% An alternative to the |center| environment using less space before and after.
+% \begin{macrocode}
+\newcommand{\cen}[1]
+ {{\par\centering #1\par}\noindent\ignorespaces}
+% \end{macrocode}
+% \descCom{marginbox\arg{text}}
+% A text in a box, set out into the margin. Lines are divided by |\\|.
+% \begin{macrocode}
+\newcommand{\marginbox}[1]%
+ {\par\small\addvspace{4.5ex plus 1ex}%
+ \vskip -\parskip
+%<hcart|hcletter|hcreport> \noindent\hspace{-.75\leftmargini}%
+%<hcslides> \noindent
+ \begin{tabular}{|l|}\hline\ignorespaces
+ #1
+ \\\hline\end{tabular}\nobreak\par\nobreak
+ \vspace{2.3ex}\vskip -\parskip\noindent\ignorespaces}
+% \end{macrocode}
+% \descCom{rightaddress}
+% Like the |\verse| environment, but moved to the right as far as possible.
+% Lines are divided by |\\|.
+% \begin{macrocode}
+\newcommand{\rightaddress}[1]{%
+ \par\medskip
+ {\raggedleft \begin{tabular}{l}\ignorespaces
+ #1
+ \end{tabular}
+ \medskip\par}\noindent\ignorespaces%
+}
+% \end{macrocode}
+% \descCom{shorttoday}
+% Prints the short form (YY/MM/DD) of the current date (|\today|).
+% \begin{macrocode}
+\newcounter{shortyear}
+\setcounter{shortyear}{\the\year}
+\addtocounter{shortyear}{-1900}
+\whiledo{\theshortyear>99}{\addtocounter{shortyear}{-100}}
+\newcommand{\shorttoday}
+ {\two@digits{\theshortyear}/\the\month/\the\day\xspace}
+% \end{macrocode}
+% \descEnv{dialog}
+% An environment for dialogues and screenplay-like scenes.
+% Use the |\newspeaker| command to make the persons you want to
+% use in the dialogues.
+% \begin{macrocode}
+\newenvironment{dialog}
+ {\begin{flexlist}[\normalfont\emph{:}]{i}
+ \setlength{\itemsep}{0ex}}
+ {\end{flexlist}}
+\makeatletter
+% \end{macrocode}
+% \descCom{newspeaker\arg{command-name}\arg{speaker's-name}}
+% Produces the command \rarg{command-name} to mark the speeches of
+% \rarg{speaker's-name} in a dialogue. \rarg{command-name} must begin
+% with a backslash, like all commands.\\
+% Then the command \rarg{command-name} may be called in a |dialog|
+% environment as follows:\\
+% |command-name\oarg{optional-explanation}\arg{speech-contribution}|
+% \begin{macrocode}
+\newcommand{\newspeaker}[2]{\newcommand{#1}[2][]
+ {\item[\normalfont\emph{#2\ifthenelse{\equal{##1}{}}
+ {}{ (##1)}}] ##2}}
+% \end{macrocode}
+% \descCom{enge\arg{English text}\arg{German text}}
+% Prints \arg{English text}. With the |german| option, \rarg{German text}
+% is printed instead.
+% \begin{macrocode}
+\newcommand{\enge}[2]{#1}
+% \end{macrocode}
+% Some language specific texts.
+% \begin{macrocode}
+\newcommand{\versiontext}{Version date:}
+\newcommand{\onlinetext}{Online:}
+\newcommand{\accesstext}{Access date:}
+\newcommand{\cftext}{cf.}
+\newcommand{\bibvoltext}{of}
+\newcommand{\bvtext}{vol.}
+\newcommand{\bibdir}{Director }
+\newcommand{\bibmovtext}{Movie}
+\newcommand{\bibactorsbefore}{With}
+\newcommand{\bibactorsafter}{et~al}
+\newcommand{\noyear}{n.d.}
+\newcommand{\noaddress}{n.p.}
+\newcommand{\otherabstractname}{Zusammenfassung}
+\newcommand{\keywordsname}{Keywords}
+% \end{macrocode}
+% \subsubsection{The palatino option}
+% \begin{macrocode}
+\if@palatino
+ \RequirePackage{palatino}
+ \RequirePackage{mathpple}
+\fi
+% \end{macrocode}
+% \subsubsection{The ding option}
+% \begin{macrocode}
+\if@ding
+ \RequirePackage{pifont}
+% \end{macrocode}
+% \descCom{tick}
+% Prints a tick.
+% \begin{macrocode}
+ \newcommand{\tick}{\ding{52}}
+% \end{macrocode}
+% \descCom{cross}
+% Prints a cross.
+% \begin{macrocode}
+ \newcommand{\cross}{\ding{56}}
+% \end{macrocode}
+% \descCom{checkbox}
+% Prints a checkbox.
+% \begin{macrocode}
+ \newcommand{\checkbox}{\ding{114}}
+% \end{macrocode}
+% \descEnv{ticklist}
+% A item environment which uses a tick as label
+% (e.g. for lists of do's).
+% \begin{macrocode}
+ \newenvironment{ticklist}
+ {\begin{dinglist}{52}}{\end{dinglist}}
+% \end{macrocode}
+% \descEnv{crosslist}
+% A item environment which uses a cross as label
+% (e.g. for lists of don't).
+% \begin{macrocode}
+ \newenvironment{crosslist}
+ {\begin{dinglist}{56}}{\end{dinglist}}
+% \end{macrocode}
+% \descEnv{checklist}
+% A item environment which uses a checkbox as label
+% (e.g. for check lists).
+% \begin{macrocode}
+ \newenvironment{checklist}
+ {\begin{dinglist}{114}}{\end{dinglist}}
+\fi
+% \end{macrocode}
+% \subsubsection{The euro option}
+% \descCom{E}
+% Prints the Euro symbol \E.
+% \descCom{Es\arg{value}}
+% Prints the Euro symbol followed by \rarg{value}.
+% \begin{macrocode}
+\if@euro
+ \RequirePackage[right,notextcomp]{eurofont}
+ \newcommand{\E}{\textsf{\makefakelighteuro}\xspace}
+ \newcommand{\Es}[1]{\E\nobreak\,#1}
+\fi
+% \end{macrocode}
+% \subsubsection{The fancyref option}
+% Loads the |fancyref| package which provides the command
+% |\fref|\arg{prefix:labelname}. This prints not only the number, but also
+% the type of a reference. The following prefixes (types) are recognized:
+% |chap| (Chapter),
+% |sec| (Section),
+% |eq| (Equation),
+% |fig| (Figure),
+% |tab| (Table),
+% |enum| (Enumeration),
+% |fn| (Footnote).
+% At the beginning of a sentence use |\Fref| instead, which gives upper-case
+% output (in German documents there is no difference).
+% \begin{macrocode}
+\if@fancyref
+ \RequirePackage{fancyref}
+\fi
+% \end{macrocode}
+% \descCom{see\arg{reference}}
+% Prints \q{see \rarg{reference}} in a footnote, using the |\fref| command
+% to print \rarg{reference}.
+% \begin{macrocode}
+\newcommand{\seetext}{see}
+\newcommand{\see}[1]{\footnote{\seetext\ \fref{#1}}}
+% \end{macrocode}
+% \subsubsection{The html option}
+% \descCom{htlink\arg{linked text}\arg{url}}
+% Prints \rarg{linked text} followed by the \rarg{url}. With the |paper|
+% option, a footnote is used. In the HTML version
+% \rarg{linked text} becomes an active link to \rarg{url}.
+% \descCom{hturl\arg{url}}
+% Prints \rarg{url} nice and makes it an active link in the
+% HTML version.
+% \descCom{htmail\arg{mail-adress}}
+% Prints \rarg{mail-adress} nice and makes it an active email link in the
+% HTML version.
+% \begin{macrocode}
+\if@html
+%</class>
+%<*hcletter>
+ \newcounter{part}
+ \newcounter{section}
+ \newcounter{subsection}
+ \newcounter{subsubsection}
+ \newcounter{paragraph}
+ \newcommand{\part}{}
+ \newcommand{\section}{}
+ \newcommand{\subsection}{}
+ \newcommand{\subsubsection}{}
+ \newcommand{\paragraph}{}
+ \newcommand{\subparagraph}{}
+ \RequirePackage{html}
+ \newcommand{\htlink}[2]
+ {{\htmladdnormallink{#1 \texttt{<#2>}}{#2}}}
+%</hcletter>
+%<*hcart|hcreport|hcslides>
+ \RequirePackage{html}
+ \if@paper
+ \newcommand{\htlink}[2]
+ {\htmladdnormallink{#1}{#2}%
+ \footnote{\htmladdnormallink{\texttt{#2}}{#2}}}
+ \else
+ \newcommand{\htlink}[2]
+ {{\htmladdnormallink{#1 \texttt{<#2>}}{#2}}}
+ \fi
+%</hcart|hcreport|hcslides>
+%<*class>
+ \newcommand{\hturl}[1]
+ {{\htmladdnormallink{\texttt{#1}}{#1}}}
+ \newcommand{\htmail}[1]
+ {{\htmladdnormallink{\texttt{#1}}{mailto:#1}}}
+\fi
+%</class>
+% \end{macrocode}
+% \subsection{Commands and Environments for the hcart and hcreport classes}
+% The default depth of section numbering and table of contents is three.
+% |headings| is the default page style. The page number is printed in the
+% header line, the footer line is empty.
+% \begin{macrocode}
+%<*hcart|hcreport>
+\setcounter{secnumdepth}{3}
+\setcounter{tocdepth}{3}
+\RequirePackage[breakwords]{truncate}
+\newlength{\rightmarklength}
+\def\ps@headings{\let\@mkboth\markboth
+ \def\@evenhead{\vbox{\hsize=\textwidth
+ \hb@xt@ \textwidth{%
+ {\pnumfont\thepage\hfil\headfont\truncate{0.92\textwidth}%
+ {\raggedleft\strut\leftmark}}}%
+ \if@hsl \vskip 1.5\p@ \hrule \fi}}
+ \def\@oddhead{\settowidth{\rightmarklength}{\rightmark}%
+ \vbox{\hsize=\textwidth
+ \hb@xt@ \textwidth{{\headfont\truncate{0.92\textwidth}%
+ {\strut\ifthenelse{\lengthtest{\rightmarklength=0em}}%
+ {\leftmark{}}{\rightmark{}}%
+ \hfil}\hfil\pnumfont\thepage}}%
+ \if@hsl \vskip 1.5\p@ \hrule \fi}}
+ \def\@evenfoot{\vbox{\hsize=\textwidth
+ \if@fsl \hrule \vskip 3\p@ \fi
+ \hb@xt@ \textwidth{{\pnumfont\hfil}}}}%
+ \def\@oddfoot{\vbox{\hsize=\textwidth
+ \if@fsl \hrule \vskip 3\p@ \fi
+ \hb@xt@ \textwidth{{\pnumfont\hfil}}}}%
+%<hcreport> \def\chaptermark##1{%
+%<hcreport> \markboth {\ifnum \c@secnumdepth >\m@ne
+%<hcreport> \chaptermarkformat\fi
+%<hcreport> ##1}{}}%
+%<hcreport> \def\sectionmark##1{%
+%<hcreport> \markright {\ifnum \c@secnumdepth >\z@
+%<hcreport> \sectionmarkformat\fi
+%<hcreport> ##1}}}
+%<hcart> \def\sectionmark##1{%
+%<hcart> \markboth {\ifnum \c@secnumdepth >\z@%
+%<hcart> \sectionmarkformat\fi ##1}{}}
+%<hcart> \def\subsectionmark##1{%
+%<hcart> \markright {\ifnum \c@secnumdepth >\@ne%
+%<hcart> \subsectionmarkformat\fi ##1}}}
+\pagestyle{headings}
+% \end{macrocode}
+% \subsubsection{The hcarea option}
+% \begin{macrocode}
+\if@hcarea
+ \RequirePackage{typearea}
+ \areaset[15mm]{150mm}{240mm}
+\fi
+% \end{macrocode}
+% \subsubsection{The hcfootnotes option}
+% \begin{macrocode}
+\if@hcfootnotes
+ \deffootnote{1em}{0.5em}
+ {\textsuperscript{\normalfont\thefootnotemark}\,}
+\fi
+% \end{macrocode}
+% \subsubsection{The magazine option}
+% \descCom{articletitle\arg{title}}
+% Prints the article \rarg{title}.
+% \descCom{subjecttitle\arg{subject}\arg{title}}
+% Prints before the article \rarg{title} the \rarg{subject} in a smaller font.
+% \descCom{titlesubject\arg{title}\arg{subject}}
+% Prints after the article \rarg{title} the \rarg{subject} in a smaller font.
+% \descCom{articlesection\arg{heading}}
+% Prints a heading within an article (actually, a |\subsection*|).
+% \descEnv[\oarg{signature}\arg{title}]{art}
+% A magazine article set in two columns with a \rarg{title} (using
+% |\articletitle|) and an optional \rarg{signature} (using |\sig|).
+% Requires the |multicol| package.
+% \descEnv[\oarg{signature}\arg{subject}\arg{title}]{artsubtit}
+% Like the |art| environment, but uses |\subjecttitle| instead of
+% |\articletitle|.
+% \descEnv[\oarg{signature}\arg{title}\arg{subject}]{arttitsub}
+% Like the |art| environment, but uses |\titlesubject| instead of
+% |\articletitle|.
+% \begin{macrocode}
+\if@magazine
+ \RequirePackage{multicol}
+ \newcommand{\articletitle}[1]
+ {\addsec[#1]{\LARGE #1}}
+ \newcommand{\subjecttitle}[2]
+ {\addsec[#2]{{\large #1}\\{\LARGE #2}}}
+ \newcommand{\titlesubject}[2]
+ {\addsec[#1]{{\LARGE #1}\\{\large #2}}}
+ \newcommand{\articlesection}[1]{\subsection*{#1}}
+ \newcommand{\currentsig}{}
+ \newenvironment{@art}[2][]{%
+ \begin{multicols}{2}[#2]
+ \renewcommand{\currentsig}{#1}%
+ }{%
+ \ifthenelse{\equal{\currentsig}{}}
+ {}
+ {\sig{\currentsig}}
+ \end{multicols}%
+ }
+ \newenvironment{art}[2][]
+ {\begin{@art}[#1]{\articletitle{#2}}}{\end{@art}}
+ \newenvironment{artsubtit}[3][]
+ {\begin{@art}[#1]{\subjecttitle{#2}{#3}}}{\end{@art}}
+ \newenvironment{arttitsub}[3][]
+ {\begin{@art}[#1]{\titlesubject{#2}{#3}}}{\end{@art}}
+\fi
+% \end{macrocode}
+% \subsubsection{The parskip option}
+% \begin{macrocode}
+\if@parskip
+ \setlength\parskip{\medskipamount}
+ \setlength\parindent{0pt}
+\fi
+% \end{macrocode}
+% \subsubsection{The wide option}
+% \begin{macrocode}
+\if@wide
+ \linespread{1.3}
+\fi
+%</hcart|hcreport>
+% \end{macrocode}
+% \subsection{Commands and Environments for the hcart, hcreport and
+% hcslides classes}
+% \subsubsection{The bib option}
+% With the |fnbib| option (default), the |\cite| and |\citet| and |\cite|
+% commands all work the same.
+%
+% With the |autbib| option, |\cite| always works like |\citep|,
+% i.\,e. puts the citation in brackets.
+% Use |\citet| if you do not want this.
+%
+% Commands like |\cite| should always be used \emph{without} a space between
+% them and the preceeding text.
+% \begin{macrocode}
+%<class>\newcommand{\bibliostyle}{hc-en}
+%<*hcart|hcreport|hcslides>
+\if@bib
+\if@fnbib
+ \bibpunct[, ]{}{}{;}{a}{}{,}
+ \renewcommand\NAT@cite%
+ [3]{\footnote{\ifNAT@swa\NAT@@open\if*#2*\else#2\ \fi
+ #1\if*#3*\else\NAT@cmt#3\fi\NAT@@close\else#1\fi}\endgroup}
+ \let\@cite\NAT@cite
+\fi
+\if@autbib
+ \bibpunct[, ]{ [}{]}{;}{a}{}{,}
+ \let\cite\citep
+\fi
+\if@numbib
+ \bibpunct[, ]{ [}{]}{;}{n}{}{,}
+\fi
+% \end{macrocode}
+% \descCom{cfcite\oarg{pages}\arg{source}}
+% Shortcut for |\cite|\oarg{\cftext}\oarg{pages}\arg{source}.
+% \begin{macrocode}
+\newcommand{\cfcite}[2][]{\cite[\cftext][#1]{#2}}
+% \end{macrocode}
+% \descCom{biblio\oarg{style}\arg{bib files}}
+% Writes the bibliography. \rarg{bib files} is a comma-separated list
+% of bib files, \rarg{style} the \BibTeX\ style file (by default
+% |hc-en| for English documents).
+% \begin{macrocode}
+%<hcart|hcslides>\if@paper
+%<hcart|hcslides> \newcommand{\beforebiblio}{\newpage}
+%<hcart|hcslides>\else
+%<hcart|hcslides> \newcommand{\beforebiblio}{\vfill}
+%<hcart|hcslides>\fi
+\newcommand{\biblio}[2][\bibliostyle]{%
+%<hcart|hcslides> \beforebiblio
+ \bibliographystyle{#1}
+ \bibliography{#2}%
+}
+% \end{macrocode}
+% \descCom{qu\oarg{pages}\arg{source}\arg{quotation}}
+% A \rarg{quotation} in quotes followed by the reference {[}\rarg{source},
+% \rarg{pages}{]}.
+% \begin{macrocode}
+\newcommand{\qu}[3][]{\q{#3}\cite[#1]{#2}}
+% \end{macrocode}
+% \descCom{qul\oarg{pages}\arg{source}\arg{quotation}}
+% Like |\qu| but inside a |quote| environment (for longer quotions).
+% \begin{macrocode}
+\newcommand{\qul}[3][]{\begin{quote}
+ \qu[#1]{#2}{#3}
+ \end{quote}}
+% \end{macrocode}
+% \descCom{biburl\arg{url}\arg{access date}}
+% \rarg{url} and \rarg{access date} of online documents.
+% For online-only documents use a \textsc{manual} entry with |\biburl|
+% in the \textsc{organization} field.
+% For other documents put it in the \textsc{note} field.
+% \begin{macrocode}
+ \if@htmlbib
+ \newcommand{\biburl}[2]{\onlinetext\\
+ {\small\hturl{#1}}\\\accesstext\ #2}
+ \else
+ \newcommand{\biburl}[2]{\onlinetext\\
+ {\small\texttt{#1}}\\\accesstext\ #2}
+ \fi
+% \end{macrocode}
+% \descCom{bibdiv}
+% Separator between the title and subtitle of a document.
+% \begin{macrocode}
+ \newcommand{\bibdiv}{. }
+% \end{macrocode}
+% \descCom{bibvol\oarg{separating word}\arg{volume number}\arg{serial title}}
+% Use at the end of the \textsc{title} field (without space before)
+% if the output of the \textsc{volume} and \textsc{series} fields
+% is not convincing. Interesting
+% especially for German documents where \q{der} instead of \q{von}
+% is used as \rarg{separating word} (English: \q{of}).
+% \begin{macrocode}
+ \newcommand{\bibvol}[3][\bibvoltext]
+ {\emph{, \bvtext~#2 #1} #3}
+% \end{macrocode}
+% \descCom{addrdiv}
+% Separator between different places in a \BibTeX\ entry's
+% \textsc{address} field.
+% \begin{macrocode}
+ \newcommand{\addrdiv}{ -- }
+% \end{macrocode}
+% \descCom{etal\oarg{year}}
+% Ends a list (e.\,g. of places in a \BibTeX\ entry's \textsc{address} field)
+% which is not complete \mbox{(\q{\etal})}. A \rarg{year} can be given which
+% is printed afterwards.
+% \begin{macrocode}
+\newcommand{\etal}[1][]{ et~al%
+ \ifthenelse{\equal{#1}{}}{}{. #1}%
+}
+% \end{macrocode}
+% \descCom{noyear\comdiv noaddress}
+% Use in the \textsc{year} resp. \textsc{address} field of a \BibTeX\ entry
+% when no year resp. address is known.
+% \minisec{The following commands are for movie databases
+% (use \textsc{manual} entry):}
+% \descCom{bibdir}
+% Give the director in the \textsc{author} field in the following way:\\
+% |Surname, \bibdir, Christian Name|
+% \descCom{bibmov\arg{country}\arg{studio}\arg{main actors}}
+% Put in the \textsc{organization} field.
+% \begin{macrocode}
+ \newcommand{\bibmov}[3]{\bibmovtext\bibdiv\ #2, #1\bibdiv\
+ \bibactorsbefore\ #3 \bibactorsafter}
+\fi
+% \end{macrocode}
+% \subsubsection{The pdf option}
+% \begin{macrocode}
+\newcommand{\hypertitle}{}
+\newcommand{\hyperauthor}{}
+\newcommand{\hyperabstract}{}
+\newcommand{\hyperkeywords}{}
+\if@pdf
+ \AtEndOfClass{\RequirePackage[hyperindex,colorlinks=true,
+ pdftex,latex2html,extension=pdf]{hyperref}}
+ \AtBeginDocument{%
+ \let\oldautdiv\autdiv
+ \renewcommand{\autdiv}{, }
+ \ifthenelse{\equal{\hypertitle}{}}
+ {\renewcommand{\hypertitle}{\currenttitle}}{}
+ \ifthenelse{\equal{\hyperauthor}{}}
+ {\renewcommand{\hyperauthor}{\currentauthor}}{}
+ \ifthenelse{\equal{\hyperabstract}{}}
+ {\renewcommand{\hyperabstract}{\abstext}}{}
+ \ifthenelse{\equal{\hyperkeywords}{}}
+ {\renewcommand{\hyperkeywords}{\keywordstext}}{}
+ \pdfinfo{
+ /Title (\hypertitle)
+ /Author (\hyperauthor)
+ /Subject (\hyperabstract)
+ /Keywords (\hyperkeywords)
+ }
+ \let\autdiv\oldautdiv
+ }
+\fi
+%</hcart|hcreport|hcslides>
+% \end{macrocode}
+% \subsubsection{Title commands}
+% \descCom{toc}
+% Puts the table of contents at the end of the current page (i.e. after
+% a vertical fill and before a pagebreak).
+% With the |paper| option the table of contents is generated automatically,
+% so |\toc| does nothing at all.
+% \begin{macrocode}
+%<*hcart|hcslides>
+\if@paper
+ \newcommand{\@toc}{%
+ \newpage
+%<hcart> \thispagestyle{empty}
+%<hcslides> \slidepagestyle{HC}
+%<hcart> \if@wide \linespread{1} \fi
+ \tableofcontents
+%<hcart> \if@wide \linespread{1.3} \fi
+ \newpage%
+ }
+ \newcommand{\toc}{}
+\else
+ \newcommand{\@toc}{%
+ \vfill
+%<hcart> \thispagestyle{empty}
+%<hcslides> \slidepagestyle{HC}
+%<hcart> \if@wide \linespread{1} \fi
+ \tableofcontents
+%<hcart> \if@wide \linespread{1.3} \fi
+ \newpage%
+ }
+ \newcommand{\toc}{\@toc}
+\fi
+%</hcart|hcslides>
+%<*hcreport>
+\newcommand{\@toc}{
+ \if@wide \linespread{1} \fi
+ \tableofcontents
+ \if@wide \linespread{1.3} \fi
+ \thispagestyle{empty}
+}
+\if@paper
+ \newcommand{\toc}{}
+\else
+ \newcommand{\toc}{\@toc}
+\fi
+%</hcreport>
+% \end{macrocode}
+% \descCom{titsubinfo\arg{main title}\arg{sub title}\arg{more info}\comdiv
+% titsub\arg{main title}\arg{sub title}\comdiv
+% titinfo\arg{main title}\arg{more info}
+% }
+% They should be used in the premable --
+% call |\tit[ver]| or |\titaut[ver]| in the document body.
+% Use if your document has a main title and a sub title and/or you want to
+% give additional information. Leave
+% the \rarg{title} parameter of |\tit|\texttt{\qdots} empty.
+% \rarg{more info} is printed below the \rarg{(sub) title}
+% in a small font.
+% \begin{macrocode}
+%<*hcart|hcreport|hcslides>
+\if@paper
+ \newcommand{\titsubinfo}[3]{
+ \renewcommand{\defaulttitle}{%
+ #1\vfill
+ {\Large #2\vfill}
+ \vfill {\normalsize #3\vfill}%
+ }
+ \renewcommand{\currenttitle}{#1}%
+ }
+ \newcommand{\titsub}[2]{
+ \renewcommand{\defaulttitle}{%
+ #1\vfill
+ {\Large #2\vfill\vfill}%
+ }
+ \renewcommand{\currenttitle}{#1}%
+ }
+ \newcommand{\titinfo}[2]{
+ \renewcommand{\defaulttitle}{%
+ #1\vfill
+ \vfill {\normalsize #2\vfill}%
+ }
+ \renewcommand{\currenttitle}{#1}%
+ }
+\else
+ \newcommand{\titsubinfo}[3]{
+ \renewcommand{\defaulttitle}{#1\\[0.8ex]
+ {\Large #2\\[0.8ex]}
+ {\normalsize #3\\}%
+ }
+ \renewcommand{\currenttitle}{#1}%
+ }
+ \newcommand{\titsub}[2]{
+ \renewcommand{\defaulttitle}{#1\\[0.8ex]
+ {\Large #2\\[0.8ex]}%
+ }
+ \renewcommand{\currenttitle}{#1}%
+ }
+ \newcommand{\titinfo}[2]{
+ \renewcommand{\defaulttitle}{#1\\[0.8ex]
+ {\normalsize #2\\}%
+ }
+ \renewcommand{\currenttitle}{#1}%
+ }
+\fi
+% \end{macrocode}
+% \descCom{autinfo\arg{author}\arg{address}\arg{email}\arg{homepage}}
+% Should be used in the premable --
+% call |\tit|, |\titaut| or |\titautver| in the document body.
+% Specifies information about the author (name, address, mail-address and
+% homepage). Use |\autdiv| resp. |\autinfodiv| instead of |\\|.
+% \begin{macrocode}
+\newcommand{\autinfo}[4]{%
+ \renewcommand{\defaultauthor}{#1}
+ \renewcommand{\defaultaddress}{#2}
+ \renewcommand{\defaultemail}{#3}
+ \renewcommand{\defaulthomepage}{#4}
+ \renewcommand{\currentauthor}{#1}
+}
+% \end{macrocode}
+% \descCom{abs\oarg{other-language abstract}\arg{abstract}}
+% Should be used in the premable --
+% call |\tit|, |\titaut| or |\titautver| in the document body.
+% Prints an abstract text. Optionally an additional abstract in another
+% language is printed below. The title of the other-language abstract
+% may be changed by redefining |\otherabstractname|. By default
+% \q{\otherabstractname} is used (German).
+% \begin{macrocode}
+\newcommand{\abstext}{}
+\newcommand{\otherabstext}{}
+\newcommand{\abs}[2][]{%
+ \renewcommand{\otherabstext}{#1}
+ \renewcommand{\abstext}{#2}
+}
+% \end{macrocode}
+% \descCom{keywords\arg{keywords}}
+% Should be used in the premable --
+% call |\tit|, |\titaut| or |\titautver| in the document body.
+% Prints a list of keywords.
+% \begin{macrocode}
+\newcommand{\keywordstext}{}
+\newcommand{\keywords}[1]{%
+ \renewcommand{\keywordstext}{#1}
+}
+% \end{macrocode}
+% \descCom{hyperinfo\arg{title}\arg{author}\arg{abstract}\arg{keywords}}
+% An alternative way to specify document information for the PDF version.
+% Use when the default document information extracted from
+% |\tit[sub][info]|, |\autinfo|,
+% |\abs| and |\keywords| does not work as it should.
+% If one of the parameters is left empty the default information
+% is used instead.
+% Do not use any formatting or special commands.
+% Must be used in the premable. Without the |pdf| option this command
+% is ignored.
+% \begin{macrocode}
+\if@pdf
+ \newcommand{\hyperinfo}[4]{
+ \renewcommand{\hypertitle}{#1}
+ \renewcommand{\hyperauthor}{#2}
+ \renewcommand{\hyperabstract}{#3}
+ \renewcommand{\hyperkeywords}{#4}
+ }
+\else
+ \newcommand{\hyperinfo}[4]{}
+\fi
+% \end{macrocode}
+% \descCom{titaut\oarg{date}\arg{title}\arg{author}}
+% Replacement for:
+% |\title|\arg{title}
+% |\author|\arg{author}
+% |\date|\arg{date}
+% |\maketitle|\\
+% Default date is |\today|. With the |paper| option, a titlepage and
+% a table of contents are generated.
+% \begin{macrocode}
+\if@paper
+ \newcommand{\titaut}[3][\today]{%
+%<hcart|hcreport> \if@wide \linespread{1} \fi
+%<hcslides> \slidepagestyle{empty}\setcounter{slide}{0}
+ \ifthenelse{\equal{#2}{}}
+ {}
+ {\renewcommand{\defaulttitle}{#2}
+ \renewcommand{\currenttitle}{#2}}
+ \title{\normalfont\huge \defaulttitle \vfill}
+ \ifthenelse{\equal{#3}{}}
+ {}
+ {\renewcommand{\defaultauthor}{#3}
+ \renewcommand{\currentauthor}{#3}}
+ \author{\normalfont\Large \defaultauthor\\[0.8ex]
+ \normalfont\normalsize \defaultaddress\\[0.4ex]
+ \normalfont\normalsize
+ \htmladdnormallink{\defaultemail}{mailto:\defaultemail}\\[-1ex]
+ \normalfont\normalsize
+ \htmladdnormallink{\defaulthomepage}{\defaulthomepage}
+}
+ \date{\vfill\vfill \normalfont\normalsize #1}
+%<hcreport> \lowertitleback{%
+%<hcreport> \ifthenelse{\equal{\otherabstext}{}}{}%
+%<hcreport> {\minisec{\centering\abstractname}
+%<hcreport> \abstext}%
+%<hcreport> \ifthenelse{\equal{\otherabstext}{}}{}%
+%<hcreport> {\minisec{\centering\otherabstractname}
+%<hcreport> \otherabstext}%
+%<hcreport> \ifthenelse{\equal{\keywordstext}{}}{}%
+%<hcreport> {\minisec{\centering\keywordsname}
+%<hcreport> \cen{\keywordstext}}%
+%<hcreport> }
+ \maketitle
+ \ifthenelse{\isundefined{\currentdate}}
+ {\newcommand{\currentdate}{#1}}{}
+%<hcart|hcslides> \setcounter{page}{0}
+%<hcart|hcslides> \thispagestyle{empty}
+%<hcart|hcslides> \ifthenelse{\equal{\abstext}{}}{%
+%<hcart|hcslides> \ifthenelse{\equal{\keywordstext}{}}{}{
+%<hcart|hcslides> \vfill\vfill
+%<hcart|hcslides> \minisec{\centering\keywordsname}
+%<hcart|hcslides> \cen{\keywordstext}}
+%<hcart|hcslides> }{%
+%<hcart|hcslides> \vfill\vfill
+%<hcart|hcslides> \minisec{\centering\abstractname}
+%<hcart|hcslides> \abstext
+%<hcart|hcslides> \ifthenelse{\equal{\otherabstext}{}}{}
+%<hcart|hcslides> {\minisec{\centering\otherabstractname}
+%<hcart|hcslides> \otherabstext}
+%<hcart|hcslides> \ifthenelse{\equal{\keywordstext}{}}{}
+%<hcart|hcslides> {\minisec{\centering\keywordsname}
+%<hcart|hcslides> \cen{\keywordstext}}
+%<hcart|hcslides> }
+ \setcounter{page}{0}
+ \thispagestyle{empty}
+ \@toc%
+%<hcart|hcreport> \if@wide \linespread{1.3} \fi
+%<hcslides> \slidepagestyle{HC}%
+ }
+\else
+ \newcommand{\titaut}[3][\today]{%
+%<hcart|hcreport> \if@wide \linespread{1} \fi
+%<hcslides> \slidepagestyle{empty}\setcounter{slide}{0}
+ \ifthenelse{\equal{#2}{}}
+ {}
+ {\renewcommand{\defaulttitle}{#2}
+ \renewcommand{\currenttitle}{#2}}
+ \title{\normalfont\huge \defaulttitle}
+ \ifthenelse{\equal{#3}{}}
+ {}
+ {\renewcommand{\defaultauthor}{#3}
+ \renewcommand{\currentauthor}{#3}}
+ \author{\normalfont\Large \defaultauthor}
+ \date{\normalfont\normalsize #1}
+%<hcreport> \lowertitleback{%
+%<hcreport> \ifthenelse{\equal{\otherabstext}{}}{}%
+%<hcreport> {\minisec{\centering\abstractname}
+%<hcreport> \abstext}%
+%<hcreport> \ifthenelse{\equal{\otherabstext}{}}{}%
+%<hcreport> {\minisec{\centering\otherabstractname}
+%<hcreport> \otherabstext}%
+%<hcreport> \ifthenelse{\equal{\keywordstext}{}}{}%
+%<hcreport> {\minisec{\centering\keywordsname}
+%<hcreport> \cen{\keywordstext}}%
+%<hcreport> }
+ \maketitle
+ \ifthenelse{\isundefined{\currentdate}}
+ {\newcommand{\currentdate}{#1}}{}
+%<hcart|hcslides> \setcounter{page}{0}
+%<hcart|hcslides> \thispagestyle{empty}
+%<hcart|hcslides> \ifthenelse{\equal{\abstext}{}}{}{
+%<hcart|hcslides> \minisec{\centering\abstractname}
+%<hcart|hcslides> \abstext
+%<hcart|hcslides> \ifthenelse{\equal{\otherabstext}{}}{}
+%<hcart|hcslides> {\minisec{\centering\otherabstractname}
+%<hcart|hcslides> \otherabstext}
+%<hcart|hcslides> }
+%<hcart|hcslides> \ifthenelse{\equal{\keywordstext}{}}{}
+%<hcart|hcslides> {\minisec{\centering\keywordsname}
+%<hcart|hcslides> \cen{\keywordstext}}
+ \setcounter{page}{0}
+ \thispagestyle{empty}%
+%<hcart|hcreport> \if@wide \linespread{1.3} \fi
+%<hcslides> \newpage\slidepagestyle{HC}%
+ }
+\fi
+% \end{macrocode}
+% \descCom{tit\oarg{date}\arg{title}}
+% Calls |\titaut| with the default author information.
+% \begin{macrocode}
+\newcommand{\tit}[2][\today]{\titaut[#1]{#2}{}}
+% \end{macrocode}
+% \descCom{titautver\oarg{version
+% date}\arg{title}\arg{author}\arg{general date}}
+% Prints a general date (e.g. of first release) and a version date
+% (default: |\today|).
+% \begin{macrocode}
+\newcommand{\titautver}[4][\today]{
+ \newcommand{\currentdate}{#1}%
+ \titaut[#4\\\versiontext\ #1]{#2}{#3}
+}
+% \end{macrocode}
+% \descCom{titver\oarg{version date}\arg{title}\arg{general date}}
+% Calls |\titautver| with the default author information.
+% \begin{macrocode}
+\newcommand{\titver}[3][\today]{\titautver[#1]{#2}{}{#3}}
+% \end{macrocode}
+% \subsubsection{Sectioning Commands}
+% \descCom{fictionsec}
+% A sectioning command producing just a number, no text -- useful e.g.
+% for fiction without section headings.
+% When a new |\section| starts the counter is reset.
+% \begin{macrocode}
+\newcounter{fictionsec}[section]
+\newcommand{\fictionsec}{\addtocounter{fictionsec}{1}%
+ \subsection*{\centering\thefictionsec}}
+%</hcart|hcreport|hcslides>
+% \end{macrocode}
+% \subsection{Commands and Environments for the hcart class}
+% A |\part| command starts a new page.
+% \begin{macrocode}
+%<*hcart>
+\renewcommand\part{\clearpage
+ \@afterindentfalse
+ \secdef\@part\@spart}
+%</hcart>
+% \end{macrocode}
+% \subsection{Settings for the hcletter class}
+% No fold marks are printed.
+% \begin{macrocode}
+%<*hcletter>
+\foldmarksoff
+%</hcletter>
+% \end{macrocode}
+% \subsection{Commands and Environments for the hcreport class}
+% The first page of a chapter and the title page of a part do not
+% have a page number.
+% \begin{macrocode}
+%<*hcreport>
+\renewcommand\chapter
+ {\if@openright\cleardoublepage\else\clearpage\fi
+ \thispagestyle{empty}%
+ \global\@topnum\z@
+ \@afterindentfalse
+ \secdef\@chapter\@schapter}
+\renewcommand\addchap
+ {\if@openright\cleardoublepage\else\clearpage\fi
+ \thispagestyle{empty}%
+ \global\@topnum\z@
+ \@afterindentfalse
+ \secdef\@addchap\@saddchap}
+\renewcommand\part
+ {\if@openright\cleardoublepage\else\clearpage\fi
+ \thispagestyle{empty}%
+ \if@twocolumn
+ \onecolumn
+ \@tempswatrue
+ \else
+ \@tempswafalse
+ \fi
+ \null\vfil
+ \secdef\@part\@spart}
+%</hcreport>
+% \end{macrocode}
+% \subsection{Commands and Environments for the hcslides class}
+% A new page is started by a section or manually with the |\newslide|
+% command.
+%
+% Everything is printed sans serif.
+% The |HC| pagestyle is always used.
+% The |fancybox| package is required for drawing an shadowed box around
+% sections.
+% \descCom{addsec\oarg{toc-entry}\arg{heading}}
+% For compatibily with the |hcart| and |hcreport| classes.
+% Should always be used instead of the |\section*| command.
+% \descCom{minisec\arg{heading}}
+% For compatibily with the |hcart| and |hcreport| classes.
+% Sectioning level between |\subsubsection| and |\paragraph|.
+% \begin{macrocode}
+%<*hcslides>
+\AtBeginDocument{\begin{slide}}
+\AtEndDocument{\end{slide}}
+\renewcommand{\rmdefault}{\sfdefault}
+\raggedslides[5em]
+\newcommand{\addsec}[2][]{%
+ \section*{#2}
+ \ifthenelse{\equal{#1}{}}
+ {\addcontentsline{toc}{section}{#2}}
+ {\addcontentsline{toc}{section}{#1}}%
+}
+\newcommand\minisec[1]{\@afterindentfalse \vskip 1.5ex
+ {\parindent \z@ \raggedright\sffamily\bfseries #1\par\nobreak}%
+ \@afterheading}
+\setlength{\slideheight}{0.74\paperwidth}
+\setlength{\slidewidth}{0.84\paperheight}
+\renewcommand{\slidetopmargin}{0.12\paperwidth}
+\renewcommand{\slidebottommargin}{0.12\paperwidth}
+\renewcommand{\slideleftmargin}{0.08\paperheight}
+\renewcommand{\sliderightmargin}{0.08\paperheight}
+\slideframe{none}
+\AtBeginDocument{
+ \ifthenelse{\equal{\defaultemail}{}}
+ {\newcommand{\@email}{}}
+ {\newcommand{\@email}
+ { \texttt{<}\htmail{\defaultemail}\texttt{>}}}
+ \newpagestyle{HC}%
+ {\parbox[b]{\textwidth}%
+ {\currenttitle\hfill\currentdate\\[-.6ex]%
+ \rule{\textwidth}{0.6pt}}}
+ {\parbox[t]{\textwidth}{\rule{\textwidth}{0.6pt}\\[.6ex]%
+ \renewcommand{\autdiv}{, }%
+ \currentauthor\@email\hfill\thepage}}
+ \pagestyle{HC}
+}
+\RequirePackage{fancybox}
+\setcounter{tocdepth}{3}
+\renewcommand\section{\@startsection {section}{1}{\z@}%
+ {-3.5ex \@plus -1ex \@minus -.2ex}%
+ {2.3ex \@plus.2ex}%
+ {\newslide\normalfont\Large\bfseries\shadowbox}}
+\renewcommand\part{\clearpage
+ \if@twocolumn
+ \onecolumn
+ \@tempswatrue
+ \else
+ \@tempswafalse
+ \fi
+ \secdef\@part\@spart}
+% \end{macrocode}
+% \subsubsection{The twotoc option}
+% \begin{macrocode}
+\if@twotoc
+ \RequirePackage{multicol}
+ \renewcommand*\tableofcontents{%
+ \newlength{\old@columnseprule}
+ \setlength{\old@columnseprule}{\columnseprule}
+ \setlength{\columnseprule}{0.4pt}
+ \begin{multicols}{2}[\section*{\contentsname}]
+ \@starttoc{toc}%
+ \end{multicols}
+ \setlength{\columnseprule}{\old@columnseprule}
+ }
+\fi
+%</hcslides>
+% \end{macrocode}
+% \section{German Language Definitions}
+% The |babel| package is loaded with the new German orthograpy (option
+% |ngerman|: this requires a rather new version of |babel|). The commands
+% |\q|, |\hq|, |\dash|, |\Es| and |\shorttoday|
+% are adapted to the German typography. The |\enge| command is redefined.
+% The German \BibTeX\ style |hc-de| is used by default.
+% The language specific texts are redefined. The German redefinitions of the
+% |varioref| package do not seem to work, so the are repeated.
+% \begin{macrocode}
+%<*german>
+\addto{\captionsngerman}{%
+ \renewcommand{\nextstartq}{\guillemotright}
+ \renewcommand{\nextendq}{\guillemotleft}
+ \renewcommand{\otherstartq}{\guilsinglright}
+ \renewcommand{\otherendq}{\guilsinglleft}
+ \renewcommand{\hq}[1]{\guilsinglright{}#1\guilsinglleft{}}
+ \renewcommand{\fq}[1]{\guillemotright{}#1\guillemotleft{}}
+ \renewcommand{\dash}[1]{--~#1~--}
+ \renewcommand{\shorttoday}
+ {\the\day.\the\month.\two@digits{\theshortyear}\xspace}
+ \renewcommand{\enge}[2]{#2}
+ \renewcommand{\bibliostyle}{hc-de}
+ \renewcommand{\contentsname}{Inhalt}
+ \renewcommand{\versiontext}{Version vom}
+ \renewcommand{\accesstext}{Zugriff am}
+ \renewcommand{\cftext}{vgl.}
+ \renewcommand{\bibvoltext}{der}
+ \renewcommand{\bvtext}{Bd.}
+ \renewcommand{\bibdir}{Regie }
+ \renewcommand{\bibmovtext}{Spielfilm}
+ \renewcommand{\bibactorsbefore}{Mit}
+ \renewcommand{\bibactorsafter}{u.a}
+ \renewcommand{\noyear}{o.J.}
+ \renewcommand{\noaddress}{o.O.}
+ \renewcommand{\otherabstractname}{Abstract}
+ \renewcommand{\keywordsname}{Schl\"usselw\"orter}
+ \renewcommand{\seetext}{siehe}
+}
+\if@euro
+ \addto{\captionsngerman}{%
+ \renewcommand{\Es}[1]{#1\nobreak\,\E}
+ }
+\fi
+\if@fancyref
+ \def\reftextfaceafter {auf der n\"achsten Seite}%
+ \def\reftextfacebefore{auf der vorherigen Seite}%
+ \let\reftextafter \reftextfaceafter
+ \let\reftextbefore \reftextfacebefore
+ \def\reftextcurrent {auf dieser Seite}%
+ \def\reftextfaraway#1{auf Seite~\pageref{#1}}%
+ \def\reftextpagerange#1#2{auf
+ Seiten~\pageref{#1}--\pageref{#2}}%
+ \def\reftextlabelrange#1#2{\ref{#1} bis~\ref{#2}}%
+\fi
+%</german>
+% \end{macrocode}
+%
+% \StopEventually
+% \Finale
+%
+\endinput
+%
+% End of File `hc.dtx'
diff --git a/macros/latex/contrib/hc/hc.ins b/macros/latex/contrib/hc/hc.ins
new file mode 100644
index 0000000000..e42973756c
--- /dev/null
+++ b/macros/latex/contrib/hc/hc.ins
@@ -0,0 +1,61 @@
+%%
+%% This file will generate fast loadable files from the dtx files in this
+%% bundle when run through LaTeX or TeX.
+%%
+%% Copyright (C) 1998--2000 Christian Siefkes <error@cs.tu-berlin.de>
+%%
+%% Updates are available via http://tal.cs.tu-berlin.de/error/TeX/
+%%
+%% This file is part of the HC Bundle for LaTeX2e.
+%% -----------------------------------------------
+%%
+%% This file is free software; you can redistribute it and/or modify
+%% it under the terms of the GNU Library General Public License as
+%% published by the Free Software Foundation; either version 2 of the
+%% License, or (at your option) any later version.
+%%
+%% This document is distributed in the hope that it will be useful, but
+%% WITHOUT ANY WARRANTY; without even the implied warranty of
+%% MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU
+%% General Public License for more details.
+%%
+%% You should have received a copy of the GNU General Public License
+%% along with this program; see the file COPYING. If not, write to
+%% the Free Software Foundation, Inc., 59 Temple Place - Suite 330,
+%% Boston, MA 02111-1307, USA.
+%%
+%% --------------- start of docstrip commands ------------------
+%%
+\input docstrip
+\askforoverwritefalse
+
+\preamble
+\endpreamble
+
+\generate{\file{hcart.cls}{\from{hc.dtx}{class,hcart}}
+ \file{hcletter.cls}{\from{hc.dtx}{class,hcletter}}
+ \file{hcreport.cls}{\from{hc.dtx}{class,hcreport}}
+ \file{hcslides.cls}{\from{hc.dtx}{class,hcslides}}
+ \file{german.hld}{\from{hc.dtx}{german}}
+ }
+
+\Msg{***********************************************************}
+\Msg{*}
+\Msg{* To finish the installation you have to move the following}
+\Msg{* files into a directory searched by TeX:}
+\Msg{*}
+\Msg{* \space\space hcart.cls}
+\Msg{* \space\space hcletter.cls}
+\Msg{* \space\space hcreport.cls}
+\Msg{* \space\space hcslides.cls}
+\Msg{* \space\space german.hld}
+\Msg{*}
+\Msg{* To produce the implementation-documentation run the file}
+\Msg{* `hc.dtx' through LaTeX after moving the files.}
+\Msg{*}
+\Msg{* Happy TeXing}
+\Msg{***********************************************************}
+
+
+\ReportTotals
+\endbatchfile
diff --git a/macros/latex/contrib/hc/hc.ps b/macros/latex/contrib/hc/hc.ps
new file mode 100644
index 0000000000..989d0ef53b
--- /dev/null
+++ b/macros/latex/contrib/hc/hc.ps
@@ -0,0 +1,2135 @@
+%!PS-Adobe-2.0
+%%Creator: dvips(k) 5.86 Copyright 1999 Radical Eye Software
+%%Title: hc.dvi
+%%Pages: 36
+%%PageOrder: Ascend
+%%BoundingBox: 0 0 596 842
+%%DocumentFonts: Palatino-Roman EURM10 Helvetica-Bold Courier
+%%+ Courier-Oblique Helvetica Palatino-Italic
+%%EndComments
+%DVIPSWebPage: (www.radicaleye.com)
+%DVIPSCommandLine: dvips hc
+%DVIPSParameters: dpi=600, compressed
+%DVIPSSource: TeX output 2000.03.23:1259
+%%BeginProcSet: texc.pro
+%!
+/TeXDict 300 dict def TeXDict begin/N{def}def/B{bind def}N/S{exch}N/X{S
+N}B/A{dup}B/TR{translate}N/isls false N/vsize 11 72 mul N/hsize 8.5 72
+mul N/landplus90{false}def/@rigin{isls{[0 landplus90{1 -1}{-1 1}ifelse 0
+0 0]concat}if 72 Resolution div 72 VResolution div neg scale isls{
+landplus90{VResolution 72 div vsize mul 0 exch}{Resolution -72 div hsize
+mul 0}ifelse TR}if Resolution VResolution vsize -72 div 1 add mul TR[
+matrix currentmatrix{A A round sub abs 0.00001 lt{round}if}forall round
+exch round exch]setmatrix}N/@landscape{/isls true N}B/@manualfeed{
+statusdict/manualfeed true put}B/@copies{/#copies X}B/FMat[1 0 0 -1 0 0]
+N/FBB[0 0 0 0]N/nn 0 N/IEn 0 N/ctr 0 N/df-tail{/nn 8 dict N nn begin
+/FontType 3 N/FontMatrix fntrx N/FontBBox FBB N string/base X array
+/BitMaps X/BuildChar{CharBuilder}N/Encoding IEn N end A{/foo setfont}2
+array copy cvx N load 0 nn put/ctr 0 N[}B/sf 0 N/df{/sf 1 N/fntrx FMat N
+df-tail}B/dfs{div/sf X/fntrx[sf 0 0 sf neg 0 0]N df-tail}B/E{pop nn A
+definefont setfont}B/Cw{Cd A length 5 sub get}B/Ch{Cd A length 4 sub get
+}B/Cx{128 Cd A length 3 sub get sub}B/Cy{Cd A length 2 sub get 127 sub}
+B/Cdx{Cd A length 1 sub get}B/Ci{Cd A type/stringtype ne{ctr get/ctr ctr
+1 add N}if}B/id 0 N/rw 0 N/rc 0 N/gp 0 N/cp 0 N/G 0 N/CharBuilder{save 3
+1 roll S A/base get 2 index get S/BitMaps get S get/Cd X pop/ctr 0 N Cdx
+0 Cx Cy Ch sub Cx Cw add Cy setcachedevice Cw Ch true[1 0 0 -1 -.1 Cx
+sub Cy .1 sub]/id Ci N/rw Cw 7 add 8 idiv string N/rc 0 N/gp 0 N/cp 0 N{
+rc 0 ne{rc 1 sub/rc X rw}{G}ifelse}imagemask restore}B/G{{id gp get/gp
+gp 1 add N A 18 mod S 18 idiv pl S get exec}loop}B/adv{cp add/cp X}B
+/chg{rw cp id gp 4 index getinterval putinterval A gp add/gp X adv}B/nd{
+/cp 0 N rw exit}B/lsh{rw cp 2 copy get A 0 eq{pop 1}{A 255 eq{pop 254}{
+A A add 255 and S 1 and or}ifelse}ifelse put 1 adv}B/rsh{rw cp 2 copy
+get A 0 eq{pop 128}{A 255 eq{pop 127}{A 2 idiv S 128 and or}ifelse}
+ifelse put 1 adv}B/clr{rw cp 2 index string putinterval adv}B/set{rw cp
+fillstr 0 4 index getinterval putinterval adv}B/fillstr 18 string 0 1 17
+{2 copy 255 put pop}for N/pl[{adv 1 chg}{adv 1 chg nd}{1 add chg}{1 add
+chg nd}{adv lsh}{adv lsh nd}{adv rsh}{adv rsh nd}{1 add adv}{/rc X nd}{
+1 add set}{1 add clr}{adv 2 chg}{adv 2 chg nd}{pop nd}]A{bind pop}
+forall N/D{/cc X A type/stringtype ne{]}if nn/base get cc ctr put nn
+/BitMaps get S ctr S sf 1 ne{A A length 1 sub A 2 index S get sf div put
+}if put/ctr ctr 1 add N}B/I{cc 1 add D}B/bop{userdict/bop-hook known{
+bop-hook}if/SI save N @rigin 0 0 moveto/V matrix currentmatrix A 1 get A
+mul exch 0 get A mul add .99 lt{/QV}{/RV}ifelse load def pop pop}N/eop{
+SI restore userdict/eop-hook known{eop-hook}if showpage}N/@start{
+userdict/start-hook known{start-hook}if pop/VResolution X/Resolution X
+1000 div/DVImag X/IEn 256 array N 2 string 0 1 255{IEn S A 360 add 36 4
+index cvrs cvn put}for pop 65781.76 div/vsize X 65781.76 div/hsize X}N
+/p{show}N/RMat[1 0 0 -1 0 0]N/BDot 260 string N/Rx 0 N/Ry 0 N/V{}B/RV/v{
+/Ry X/Rx X V}B statusdict begin/product where{pop false[(Display)(NeXT)
+(LaserWriter 16/600)]{A length product length le{A length product exch 0
+exch getinterval eq{pop true exit}if}{pop}ifelse}forall}{false}ifelse
+end{{gsave TR -.1 .1 TR 1 1 scale Rx Ry false RMat{BDot}imagemask
+grestore}}{{gsave TR -.1 .1 TR Rx Ry scale 1 1 false RMat{BDot}
+imagemask grestore}}ifelse B/QV{gsave newpath transform round exch round
+exch itransform moveto Rx 0 rlineto 0 Ry neg rlineto Rx neg 0 rlineto
+fill grestore}B/a{moveto}B/delta 0 N/tail{A/delta X 0 rmoveto}B/M{S p
+delta add tail}B/b{S p tail}B/c{-4 M}B/d{-3 M}B/e{-2 M}B/f{-1 M}B/g{0 M}
+B/h{1 M}B/i{2 M}B/j{3 M}B/k{4 M}B/w{0 rmoveto}B/l{p -4 w}B/m{p -3 w}B/n{
+p -2 w}B/o{p -1 w}B/q{p 1 w}B/r{p 2 w}B/s{p 3 w}B/t{p 4 w}B/x{0 S
+rmoveto}B/y{3 2 roll p a}B/bos{/SS save N}B/eos{SS restore}B end
+
+%%EndProcSet
+%%BeginProcSet: 8r.enc
+% @@psencodingfile@{
+% author = "S. Rahtz, P. MacKay, Alan Jeffrey, B. Horn, K. Berry",
+% version = "0.6",
+% date = "1 July 1998",
+% filename = "8r.enc",
+% email = "tex-fonts@@tug.org",
+% docstring = "Encoding for TrueType or Type 1 fonts
+% to be used with TeX."
+% @}
+%
+% Idea is to have all the characters normally included in Type 1 fonts
+% available for typesetting. This is effectively the characters in Adobe
+% Standard Encoding + ISO Latin 1 + extra characters from Lucida.
+%
+% Character code assignments were made as follows:
+%
+% (1) the Windows ANSI characters are almost all in their Windows ANSI
+% positions, because some Windows users cannot easily reencode the
+% fonts, and it makes no difference on other systems. The only Windows
+% ANSI characters not available are those that make no sense for
+% typesetting -- rubout (127 decimal), nobreakspace (160), softhyphen
+% (173). quotesingle and grave are moved just because it's such an
+% irritation not having them in TeX positions.
+%
+% (2) Remaining characters are assigned arbitrarily to the lower part
+% of the range, avoiding 0, 10 and 13 in case we meet dumb software.
+%
+% (3) Y&Y Lucida Bright includes some extra text characters; in the
+% hopes that other PostScript fonts, perhaps created for public
+% consumption, will include them, they are included starting at 0x12.
+%
+% (4) Remaining positions left undefined are for use in (hopefully)
+% upward-compatible revisions, if someday more characters are generally
+% available.
+%
+% (5) hyphen appears twice for compatibility with both
+% ASCII and Windows.
+%
+/TeXBase1Encoding [
+% 0x00 (encoded characters from Adobe Standard not in Windows 3.1)
+ /.notdef /dotaccent /fi /fl
+ /fraction /hungarumlaut /Lslash /lslash
+ /ogonek /ring /.notdef
+ /breve /minus /.notdef
+% These are the only two remaining unencoded characters, so may as
+% well include them.
+ /Zcaron /zcaron
+% 0x10
+ /caron /dotlessi
+% (unusual TeX characters available in, e.g., Lucida Bright)
+ /dotlessj /ff /ffi /ffl
+ /.notdef /.notdef /.notdef /.notdef
+ /.notdef /.notdef /.notdef /.notdef
+ % very contentious; it's so painful not having quoteleft and quoteright
+ % at 96 and 145 that we move the things normally found there to here.
+ /grave /quotesingle
+% 0x20 (ASCII begins)
+ /space /exclam /quotedbl /numbersign
+ /dollar /percent /ampersand /quoteright
+ /parenleft /parenright /asterisk /plus /comma /hyphen /period /slash
+% 0x30
+ /zero /one /two /three /four /five /six /seven
+ /eight /nine /colon /semicolon /less /equal /greater /question
+% 0x40
+ /at /A /B /C /D /E /F /G /H /I /J /K /L /M /N /O
+% 0x50
+ /P /Q /R /S /T /U /V /W
+ /X /Y /Z /bracketleft /backslash /bracketright /asciicircum /underscore
+% 0x60
+ /quoteleft /a /b /c /d /e /f /g /h /i /j /k /l /m /n /o
+% 0x70
+ /p /q /r /s /t /u /v /w
+ /x /y /z /braceleft /bar /braceright /asciitilde
+ /.notdef % rubout; ASCII ends
+% 0x80
+ /.notdef /.notdef /quotesinglbase /florin
+ /quotedblbase /ellipsis /dagger /daggerdbl
+ /circumflex /perthousand /Scaron /guilsinglleft
+ /OE /.notdef /.notdef /.notdef
+% 0x90
+ /.notdef /.notdef /.notdef /quotedblleft
+ /quotedblright /bullet /endash /emdash
+ /tilde /trademark /scaron /guilsinglright
+ /oe /.notdef /.notdef /Ydieresis
+% 0xA0
+ /.notdef % nobreakspace
+ /exclamdown /cent /sterling
+ /currency /yen /brokenbar /section
+ /dieresis /copyright /ordfeminine /guillemotleft
+ /logicalnot
+ /hyphen % Y&Y (also at 45); Windows' softhyphen
+ /registered
+ /macron
+% 0xD0
+ /degree /plusminus /twosuperior /threesuperior
+ /acute /mu /paragraph /periodcentered
+ /cedilla /onesuperior /ordmasculine /guillemotright
+ /onequarter /onehalf /threequarters /questiondown
+% 0xC0
+ /Agrave /Aacute /Acircumflex /Atilde /Adieresis /Aring /AE /Ccedilla
+ /Egrave /Eacute /Ecircumflex /Edieresis
+ /Igrave /Iacute /Icircumflex /Idieresis
+% 0xD0
+ /Eth /Ntilde /Ograve /Oacute
+ /Ocircumflex /Otilde /Odieresis /multiply
+ /Oslash /Ugrave /Uacute /Ucircumflex
+ /Udieresis /Yacute /Thorn /germandbls
+% 0xE0
+ /agrave /aacute /acircumflex /atilde
+ /adieresis /aring /ae /ccedilla
+ /egrave /eacute /ecircumflex /edieresis
+ /igrave /iacute /icircumflex /idieresis
+% 0xF0
+ /eth /ntilde /ograve /oacute
+ /ocircumflex /otilde /odieresis /divide
+ /oslash /ugrave /uacute /ucircumflex
+ /udieresis /yacute /thorn /ydieresis
+] def
+
+%%EndProcSet
+%%BeginProcSet: texps.pro
+%!
+TeXDict begin/rf{findfont dup length 1 add dict begin{1 index/FID ne 2
+index/UniqueID ne and{def}{pop pop}ifelse}forall[1 index 0 6 -1 roll
+exec 0 exch 5 -1 roll VResolution Resolution div mul neg 0 0]/Metrics
+exch def dict begin Encoding{exch dup type/integertype ne{pop pop 1 sub
+dup 0 le{pop}{[}ifelse}{FontMatrix 0 get div Metrics 0 get div def}
+ifelse}forall Metrics/Metrics currentdict end def[2 index currentdict
+end definefont 3 -1 roll makefont/setfont cvx]cvx def}def/ObliqueSlant{
+dup sin S cos div neg}B/SlantFont{4 index mul add}def/ExtendFont{3 -1
+roll mul exch}def/ReEncodeFont{CharStrings rcheck{/Encoding false def
+dup[exch{dup CharStrings exch known not{pop/.notdef/Encoding true def}
+if}forall Encoding{]exch pop}{cleartomark}ifelse}if/Encoding exch def}
+def end
+
+%%EndProcSet
+%%BeginFont: EURM10
+%!PS-AdobeFont-1.1: EURM10 2.1
+%%CreationDate: 1992 Nov 20 17:36:34
+
+% Euler fonts were designed by Hermann Zapf.
+% Copyright (C) 1997 American Mathematical Society. All Rights Reserved.
+
+11 dict begin
+/FontInfo 7 dict dup begin
+/version (2.1) readonly def
+/Notice (Copyright (C) 1997 American Mathematical Society. All Rights Reserved) readonly def
+/FullName (EURM10) readonly def
+/FamilyName (Euler) readonly def
+/Weight (Medium) readonly def
+/ItalicAngle 0 def
+/isFixedPitch false def
+end readonly def
+/FontName /EURM10 def
+/PaintType 0 def
+/FontType 1 def
+/FontMatrix [0.001 0 0 0.001 0 0] readonly def
+/Encoding 256 array
+0 1 255 {1 index exch /.notdef put} for
+dup 34 /epsilon put
+readonly def
+/FontBBox{-32 -206 1060 722}readonly def
+/UniqueXX 5031984 def
+currentdict end
+currentfile eexec
+80347982ab3942d930e069a70d0d48311d7190fa2d133a583138f76695558e7a
+e9348d37cac6651806d08527c1bb4a062a4835ac37784cc39ad8841404e438b4
+d52d3901e47a1de4f7924e0fb3daf442499175bab1226edf692a4956739f8828
+e80592f450c5d5c22ac88bcfbe9748f61d18243a16f4a4467f084e8e2be46ef4
+7fc51c3a8199e3cda62ff9c4fb73956dab8b6683d2156377808cb35026073e80
+523f59a30d195fcf9b9fce4ffafc6f33457e3200f33e9a53d3b289d794ea7c8e
+a770ca5e9f22b46f1b98c218de1bcbbb7c566ea09d85d7856b7378cdacfbcc06
+c5c63aa0627d66bd2c4847c2d9ada8f1ab19d3b7c7f44fe613435eacab83f263
+c50555650f08f2cf4584351eab971f1a387972569a838fb1908025b2285b3ef3
+43b700540d6871ae7d9feb5b7508d8a89fb2628159973e3a4ac98fe412fd2a93
+8d61971f2c443407a5eca894167af5165ef7c77dd5898a0f8fbc9fc39c0faad5
+546cec837fedd342680832c1b548417c22a296a4db0b1b1153227e37a56c08ef
+ca95e32f396983552dc62ad81dc858d6e56c2ff0047d6a8dc024eab31fcf0b8b
+7d36f12ce4d803fe6cf9a85472ec1927214e3648cfee51f00c068d926c3ecbe7
+54c0564da6c761916f6bb57dda086ba03d9b14372407452aa245cbb5b57039e5
+cd94d07fca3ea67b3e0671c24641e2ea7b1c9b7771f7131557e5891ba5969b22
+552ba300929cb58ef762905ea011b68c6436d838686efb675e1b2b836a46156a
+1517ddc57b8a5d74bbfb5aa8426d23825e7f94b7e0e35511aeb1932766eff425
+13423666185e95a8b13ccd4e4866dd93d75c047a984924f5680a20a89c4910b3
+239fd6ea36fc9a8ded8b6c9e5d09284a54c0cee0468bbdec736c6f4e3c518c3f
+83ddac1a3c97ad34537f27bb12bd797e7193fa8c5eb083ad0b2bc382092b54b8
+a5ba12d35295155a723d4dd2005e873b7b46da55924b771a5590a4d6bdb195af
+347801090b2786bcb8ae3f94157080264774763b4c832b87a9c9dee25cbb8860
+2c92402c43a66388c6596e7f628b0f8f4c05d9fa435c65f3fc2f853eec6b45c8
+48166a05287a085a247e4d927532d74a2fbdc4eddafd4c9d32ce6ee266a877a6
+7cbc1407ac3d4d5749d9bafdd0d7b73587695caaa25293b9c93a759a977e1e7f
+1019c4e1721fbf3347034e0c88c4442968cdaea4b05d928a193ae2c882103666
+ed7103d55d77c20b87b821982a80f1f5f707136e3a1715c4803aa6393d154c45
+67660dfd6e6ff62d6685ca4e9f63dd3398f0b6de404baecb45611037642a21e8
+62cfce3fa70ef9068794677aee3318d067e0637784d0c627ce2aabfdb79fae38
+b3b8c855ca931a4e8d650369378323f92db3255d1ae0d8995290d94e17aa1c36
+5a8e45920735e74dd992735d5e23991e05cb2f5389456bb66b04a74740d2ec59
+4de51f0d02c3060231147c0f0ad316b678aa0650d8267c8de11e7ac3a57370a8
+344fdbcabd503e21843838d773dee2e172534616ad5b3bca06478fdae4196c70
+519dab8c929fc45e855f1b53c30793e6038ac09dde4cf804fea44c812c865fb2
+94a6613739b7d66c9f9e024a899c83964624d47b3a54ab4bc156cb4b0da5f5ec
+bf45fdadb41c8c4c808965e2799228c939ec258520007fd5561c970cb68d09ad
+3be8cabd09a514fb31589c1c
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+cleartomark
+
+%%EndFont
+TeXDict begin 39158280 55380996 1000 600 600 (hc.dvi)
+@start /Fa 170[53 6[53 61 44 10[53 65[{TeXBase1Encoding ReEncodeFont}5
+72.7272 /Helvetica-Bold rf /Fb 134[51 1[71 51 56 30 51
+35 1[56 56 56 81 25 2[25 56 56 30 51 56 51 56 51 12[56
+25[30 13[25 2[30 30 40[{TeXBase1Encoding ReEncodeFont}26
+90.9091 /Helvetica-Bold rf /Fc 165[49 49 2[53 57 45 38
+49 2[57 60 69 44 2[25 61 55 1[44 56 1[44 57 65[{
+TeXBase1Encoding ReEncodeFont}18 72.7272 /Palatino-Roman
+rf /Fd 188[66 67[{TeXBase1Encoding ReEncodeFont}1 90.9091
+/Helvetica rf /Fe 130[55 1[55 1[55 55 55 55 55 55 55
+55 55 55 55 55 55 55 55 55 55 55 55 55 55 55 55 55 55
+3[55 55 55 6[55 55 4[55 5[55 1[55 55 1[55 17[55 2[55
+55 55 1[55 42[{TeXBase1Encoding ReEncodeFont}42 90.9091
+/Courier rf /Ff 137[66 73 40 66 47 1[73 73 73 106 33
+2[33 73 73 40 66 73 66 1[66 13[80 3[93 7[93 1[80 1[86
+10[66 66 66 66 66 66 66 66 2[33 1[33 41[73 2[{
+TeXBase1Encoding ReEncodeFont}34 119.552 /Helvetica-Bold
+rf /Fg 134[45 45 66 45 51 30 35 35 42 45 40 51 71 25
+40 25 25 45 45 25 35 45 37 42 40 25[66 1[56 10[23 11[23
+30 3[30 30 25 36[48 2[{TeXBase1Encoding ReEncodeFont}34
+90.9091 /Palatino-Italic rf /Fh 105[45 1[45 45 24[45
+51 47 76 51 55 30 39 36 51 55 50 53 80 26 51 21 26 53
+51 30 44 56 40 50 45 25 2[30 1[30 61 61 61 91 66 71 56
+48 61 1[55 71 76 86 56 2[31 76 69 51 56 70 64 56 71 1[40
+55 1[55 23 23 4[45 45 1[45 45 45 55 23 30 23 2[30 30
+25 1[76 33[55 55 2[{TeXBase1Encoding ReEncodeFont}75
+90.9091 /Palatino-Roman rf
+%DVIPSBitmapFont: Fi cmmi10 11.4098 1
+/Fi 1 62 df<166016F01501A216E01503A216C01507A21680150FA216005DA2151E153E
+A25DA2157815F8A25D1401A25D1403A25D1407A25D140FA292C7FC5CA2143EA2143C147C
+A2147814F8A25C1301A25C1303A25C1307A2495AA291C8FC5BA2131E133EA2133C137CA2
+137813F8A25B1201A25B1203A2485AA25B120FA290C9FC5AA2121E123EA2123C127CA212
+7812F8A25A1260245F7BC62F>61 D E
+%EndDVIPSBitmapFont
+/Fk 129[55 55 55 55 55 55 55 55 55 55 55 55 55 55 55
+55 55 55 55 55 55 55 55 55 55 55 55 55 55 55 55 2[55
+55 55 55 2[55 55 55 55 55 55 1[55 55 55 55 55 55 55 55
+55 55 55 55 55 55 55 55 55 1[55 55 55 55 55 55 55 55
+55 55 55 55 55 55 55 55 55 55 55 1[55 55 55 55 1[55 1[55
+55 34[{TeXBase1Encoding ReEncodeFont}84 90.9091 /Courier-Oblique
+rf
+%DVIPSBitmapFont: Fl cmss10 10.95 15
+/Fl 15 117 df<EB0FF890B5FC00031480000F14E04814F0A29038F00FF890388003FC38
+1E0001001814FE00101300C812FF157FA7EC7FFF010FB5FC137F48B6FC120748EBF07F38
+3FFC0013C048C7FC12FE5AA315FF7E5C387F8007EBE01F6CB6FCA26C147F6C13FC6C13F0
+000190C7FC202B7CA92C>97 D<49B47E010F13F0013F13FC4913FF90B612805A481300D8
+07FCEB1F00D80FF0130748487F4990C7FC123F5B127F90C9FCA312FEAA127FA36C7EA26C
+6C14406DEB01C06C6C13036C6C131F01FF13FF6C90B5FC7E6C6C14806DEBFE00010F13F0
+01011380222B7DA928>99 D<ED07F0B3A4EB07F8EB3FFF4913C748B512F74814FF5A1480
+390FFC003FD81FF0131F49130F48481307A2485A90C7FCA312FEAA127FA37F003F140F7F
+6C6C131F6D133F6C6C137F9038FF01FF6C90B5FC6C14F76C14E76C148790383FFE07D90F
+F0C7FC24407DBE2F>I<EB03F8EB1FFF017F13C090B57E488048803807FE07390FF801FC
+9038E000FE4848137E003F143E49133F90C77E5A127EED0F80B7FCA600FCC9FCA37E127E
+A2127FA26C7EA26C7E6D14806C6C1303D807FC131F01FF13FF6C90B5FC7E6C6C14006D13
+FC010F13E0010190C7FC212B7DA928>I<D903FC133F90390FFF03FF013F13DF4990B512
+8090B7FC5A9026FE07FCC7FC3803F80148486C7E49137EA248487FA86C6C137EA26D13FE
+6C6C485A3901FE07F848B5FC5D485C5D01CF90C8FC380FC3FC0180C9FC7FA212077F90B5
+12F06C14FF16C048814815F85A3A3FE0001FFCD87F80EB03FE90C712016F7E00FE81A56C
+5D6C6C495A6D1303D83FF0EB0FFCD81FFEEB7FF86CB65A6C5D6C5DC692C7FC011F13F801
+0313C0293D7EA82D>103 D<12FEB3A449B4FC010713C0011F13F0017F13F890B512FCB6
+FC9038F80FFEEBE003EBC00190388000FFA290C7127FA35AB3A9203F79BE2F>I<12FFA8
+1200AF127FB3B3A4083F7ABE16>I<12FEB3B3B3A9073F79BE16>108
+D<26FC01FFECFF800107D9C00313E0011FD9F00F13F8017FD9F83F7F90B56C487F00FD92
+B5FC3CFFF80FFFFC07FFD9E003EBF001496C497E496C49EB7F80A290C76C48133FA34892
+C7FCB3A9392979A848>I<38FC01FF010713C0011F13F0017F13F890B512FC12FD39FFF8
+0FFEEBE003EBC00190388000FFA290C7127FA35AB3A9202979A82F>I<EB01FE90380FFF
+C0013F13F0497F90B57E000314FF14033A07F8007F804848EB3FC04848EB1FE049130F48
+48EB07F0A290C712034815F8A2007E140100FE15FCA96C14036C15F8A36C6CEB07F06D13
+0FA26C6CEB1FE06C6CEB3FC001FC13FF2607FF0313806C90B512006C5C6C5C013F13F001
+0F13C0D901FEC7FC262B7DA92D>I<14FFD8FE0713E0011F7F017F7FB67E819038F80FFF
+EBE003D98000138090C7EA7FC0153F5AED1FE0A2150FA216F01507A8150F16E0A2151FA2
+ED3FC06C147F6DEBFF805CD9E00313009038F81FFE90B55A485C6D5B6D5B010F1380D901
+FEC7FC90C9FCB1243B79A82F>I<00FC137CEB03FC130F131F133F137FEBFFC038FDFE00
+EAFFF85B5B5BA25BA290C7FCA25AB3A6162979A81F>114 D<EB1FF890B51280000314E0
+4814F85A5A393FE00FF0EB8000007F143090C8FCA57F6C7E13F06CB4FC14F06C13FE6C7F
+000114C06C14E0011F13F013019038001FF81407EC03FCA21401A3124012700078EB03F8
+007E130738FFE01F90B512F015E06C14C0001F14800003EBFE0038003FF01E2B7EA923>
+I<13FCACB612C0A6D800FCC7FCB3A86D132015E0EB7F03ECFFF0A27F15C06D1300EB07F0
+1C357EB321>I E
+%EndDVIPSBitmapFont
+%DVIPSBitmapFont: Fm cmsy10 11.4098 6
+/Fm 6 107 df<0060163000F016786C16F86C1501007EED03F06CED07E06C6CEC0FC06C
+6CEC1F806C6CEC3F006C6C147E6C6C5C6C6C495A017E495A6D495A6D6C485A6D6C485A6D
+6C48C7FC903803F07E6D6C5A903800FDF8EC7FF06E5A6E5AA24A7E4A7EECFDF8903801F8
+FC903803F07E49487E49486C7E49486C7E49486C7E017E6D7E496D7E48486D7E4848147E
+4848804848EC1F804848EC0FC048C8EA07E0007EED03F048ED01F8481500481678006016
+302D2E72AE4A>2 D<EB01E0A2805CA60070EC038000F8EC07C000FE141F00FF143FD87F
+81EB7F803A1FE1C1FE003907F0C3F83901F8C7E039007EDF80D91FFEC7FCEB07F8EB01E0
+EB07F8EB1FFE90387EDF803901F8C7E03907F0C3F8391FE1C1FE3A7F81E07F80D8FF01EB
+3FC000FE141F00F814070070EC0380000091C7FCA6805CA222297AAB2F>I<190761A286
+1907A286190386A2737EA2737E1A781A7C868687747E747E747EF201FCF2007F007FBC12
+C0BD12F0A26C1BC0CEEA7F00F201FCF203F0505A505A505A98C7FC1A3E621A781AF84F5A
+A24F5AA262190762A2190F97C8FCA28554327BB05F>33 D<1418143C147CA2147814F8A2
+EB01F0A214E01303A2EB07C0A21480130FA2EB1F00A2131E133EA25BA2137813F8A2485A
+A25B1203A2485AA25B120FA248C7FCA2121E123EA25AA2127812F8A41278127CA27EA212
+1E121FA26C7EA212077FA26C7EA212017FA26C7EA21378137CA27FA2131E131FA2EB0F80
+A2130714C0A2EB03E0A2130114F0A2EB00F8A21478147CA2143C1418165E77C625>104
+D<126012F07EA21278127CA27EA2121E121FA26C7EA212077FA26C7EA212017FA26C7EA2
+1378137CA27FA2131E131FA2EB0F80A2130714C0A2EB03E0A2130114F0A2EB00F8A21478
+147CA4147814F8A2EB01F0A214E01303A2EB07C0A21480130FA2EB1F00A2131E133EA25B
+A2137813F8A2485AA25B1203A2485AA25B120FA248C7FCA2121E123EA25AA2127812F8A2
+5A1260165E7BC625>I<126012F0B3B3B3B3B3A31260045F75C61A>I
+E
+%EndDVIPSBitmapFont
+/Fn 139[60 60 60 1[60 60 60 60 60 2[60 3[60 60 60 1[60
+97[{TeXBase1Encoding ReEncodeFont}13 99.6264 /Courier
+rf /Fo 221[48 34[{ .167 SlantFont }1 99.6264 /EURM10
+rf /Fp 190[52 65[{TeXBase1Encoding ReEncodeFont}1 66.4176
+/Palatino-Roman rf /Fq 137[56 60 32 42 39 1[60 54 58
+88 29 2[29 58 55 33 48 61 44 1[50 17[78 2[61 4[76 1[61
+77 71 10[50 2[50 50 50 50 50 2[25 1[25 41[60 2[{
+.167 SlantFont TeXBase1Encoding ReEncodeFont}33 99.6264
+/Palatino-Roman rf /Fr 133[50 55 1[78 55 61 33 55 39
+1[61 61 61 89 28 55 1[28 61 61 33 55 61 55 61 55 12[61
+66 3[78 2[61 2[28 1[78 1[66 72 72 8[33 55 55 2[55 55
+55 55 55 2[28 43[61 2[{TeXBase1Encoding ReEncodeFont}42
+99.6264 /Helvetica-Bold rf /Fs 137[80 88 48 80 56 1[88
+88 88 128 3[40 1[88 1[80 88 80 1[80 17[112 2[88 2[40
+1[112 1[96 104 104 14[80 80 80 80 46[88 2[{
+TeXBase1Encoding ReEncodeFont}27 143.462 /Helvetica-Bold
+rf /Ft 27[50 77[50 27[50 55 1[83 56 60 32 42 39 1[60
+54 58 88 29 55 1[29 58 55 33 48 61 44 55 50 8[66 2[78
+61 52 67 2[78 1[94 61 72 2[83 76 55 61 1[71 61 1[74 4[25
+25 50 50 50 50 50 50 50 50 50 50 60 25 33 25 41[60 2[{
+TeXBase1Encoding ReEncodeFont}58 99.6264 /Palatino-Roman
+rf /Fu 139[47 61 57 3[83 2[80 1[42 83 1[48 69 3[72 13[75
+15[102 67[{TeXBase1Encoding ReEncodeFont}12 143.462 /Palatino-Roman
+rf /Fv 221[100 34[{ .167 SlantFont }1 206.559 /EURM10
+rf /Fw 190[134 65[{TeXBase1Encoding ReEncodeFont}1 172.188
+/Palatino-Roman rf /Fx 137[117 125 2[82 2[113 120 1[60
+3[120 1[69 99 126 11[138 3[127 7[126 3[172 2[126 1[146
+126 10[103 4[103 103 103 1[52 46[{TeXBase1Encoding ReEncodeFont}22
+206.559 /Palatino-Roman rf end
+%%EndProlog
+%%BeginSetup
+%%Feature: *Resolution 600dpi
+TeXDict begin
+%%PaperSize: A4
+
+%%EndSetup
+%%Page: 0 1
+0 0 bop 629 718 a Fx(The)51 b(HC)h(Bundle)g(for)f(L)2471
+695 y Fw(A)2574 718 y Fx(T)2667 767 y(E)2766 718 y(X)31
+b(2)3025 749 y Fv(")1641 968 y Fx(v1.07)1347 2260 y Fu(Christian)k
+(Siefkes)1236 2496 y Ft(T)-9 b(echnische)25 b(Universit\344t)h(Berlin)
+1614 2612 y(Sekr)-7 b(.)25 b(FR)g(6\2262)1191 2727 y(Franklinstr)-7
+b(.)27 b(28/29,)d(10587)g(Berlin)1420 2928 y(err)n(or@cs.tu-berlin.de)
+1164 3044 y(http://tal.cs.tu-berlin.de/err)n(or/)1621
+5199 y(2000/03/23)p eop
+%%Page: 1 2
+1 1 bop 109 275 a Fs(Contents)109 503 y Fr(1)94 b(Intr)n(oduction)2759
+b(2)109 723 y(2)94 b(Options)2962 b(2)258 843 y Ft(2.1)104
+b(General)25 b(Options)41 b(.)50 b(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)g
+(.)f(.)h(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)
+f(.)h(.)156 b(2)258 964 y(2.2)104 b(Options)26 b(for)g(the)f(hcart)h
+(and)f(hcr)n(eport)h(classes)56 b(.)50 b(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)
+g(.)f(.)h(.)g(.)f(.)h(.)156 b(4)258 1084 y(2.3)104 b(Options)26
+b(for)g(the)f(hcart,)h(hcr)n(eport)h(and)d(hcletter)i(classes)49
+b(.)g(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)156 b(6)258 1205
+y(2.4)104 b(Options)26 b(for)g(the)f(hcart,)h(hcr)n(eport)h(and)d
+(hcslides)h(classes)i(.)49 b(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)156
+b(6)258 1325 y(2.5)104 b(Options)26 b(for)g(the)f(hcr)n(eport)i(class)
+65 b(.)50 b(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)g
+(.)f(.)h(.)g(.)f(.)h(.)156 b(8)258 1445 y(2.6)104 b(Options)26
+b(for)g(the)f(hcslides)h(class)85 b(.)50 b(.)g(.)f(.)h(.)g(.)f(.)h(.)g
+(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)156
+b(8)258 1566 y(2.7)104 b(Other)26 b(Options)59 b(.)49
+b(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)g
+(.)f(.)h(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)156
+b(8)109 1786 y Fr(3)94 b(Commands)27 b(and)h(En)l(vir)n(onments)1906
+b(9)258 1906 y Ft(3.1)104 b(Con\002guration)73 b(.)49
+b(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)g
+(.)f(.)h(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)156
+b(9)258 2026 y(3.2)104 b(General)25 b(Commands)g(and)f(Envir)n(onments)
+89 b(.)50 b(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)
+112 b(1)-5 b(1)487 2147 y(3.2.1)119 b(The)25 b(palatino)g(option)31
+b(.)49 b(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)
+g(.)g(.)f(.)h(.)g(.)f(.)h(.)106 b(16)487 2267 y(3.2.2)119
+b(The)25 b(ding)g(option)40 b(.)50 b(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)
+f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)106
+b(16)487 2388 y(3.2.3)119 b(The)25 b(eur)n(o)g(option)44
+b(.)50 b(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)
+f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)106 b(17)487 2508
+y(3.2.4)119 b(The)25 b(fancyr)n(ef)h(option)34 b(.)49
+b(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)g
+(.)f(.)h(.)g(.)f(.)h(.)106 b(17)487 2628 y(3.2.5)119
+b(The)25 b(html)g(option)36 b(.)50 b(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)
+f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)106
+b(17)258 2749 y(3.3)e(Commands)25 b(and)g(Envir)n(onments)h(for)g(the)f
+(hcart)h(and)e(hcr)n(eport)j(classes)h(.)50 b(.)106 b(18)487
+2869 y(3.3.1)119 b(The)25 b(hcar)n(ea)g(option)31 b(.)50
+b(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g
+(.)g(.)f(.)h(.)g(.)f(.)h(.)106 b(19)487 2990 y(3.3.2)119
+b(The)25 b(hcfootnotes)i(option)k(.)50 b(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)
+g(.)f(.)h(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)106
+b(19)487 3110 y(3.3.3)119 b(The)25 b(magazine)f(option)40
+b(.)50 b(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)
+g(.)f(.)h(.)g(.)f(.)h(.)106 b(20)487 3230 y(3.3.4)119
+b(The)25 b(parskip)g(option)58 b(.)49 b(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h
+(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)106
+b(21)487 3351 y(3.3.5)119 b(The)25 b(wide)f(option)98
+b(.)50 b(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)
+h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)106 b(21)258 3471 y(3.4)e(Commands)25
+b(and)f(Envir)n(onments)j(for)e(the)g(hcart,)h(hcr)n(eport)g(and)f
+(hcslides)487 3591 y(classes)97 b(.)49 b(.)h(.)g(.)g(.)f(.)h(.)g(.)g(.)
+f(.)h(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f
+(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)106 b(21)487 3712
+y(3.4.1)119 b(The)25 b(bib)g(option)30 b(.)49 b(.)h(.)g(.)f(.)h(.)g(.)g
+(.)f(.)h(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)
+f(.)h(.)106 b(21)487 3832 y(3.4.2)119 b(The)25 b(pdf)g(option)89
+b(.)50 b(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)
+f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)106 b(24)487 3953
+y(3.4.3)119 b(T)-5 b(itle)25 b(commands)43 b(.)50 b(.)g(.)f(.)h(.)g(.)g
+(.)f(.)h(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)
+f(.)h(.)106 b(25)487 4073 y(3.4.4)119 b(Sectioning)26
+b(Commands)49 b(.)h(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h
+(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)106 b(31)258 4193 y(3.5)e(Commands)25
+b(and)g(Envir)n(onments)h(for)g(the)f(hcart)h(class)38
+b(.)50 b(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)106 b(31)258
+4314 y(3.6)e(Settings)27 b(for)f(the)f(hcletter)h(class)37
+b(.)50 b(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)
+g(.)f(.)h(.)g(.)f(.)h(.)106 b(31)258 4434 y(3.7)e(Commands)25
+b(and)g(Envir)n(onments)h(for)g(the)f(hcr)n(eport)h(class)38
+b(.)50 b(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)106 b(31)258 4555
+y(3.8)e(Commands)25 b(and)g(Envir)n(onments)h(for)g(the)f(hcslides)g
+(class)58 b(.)50 b(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)106
+b(32)487 4675 y(3.8.1)119 b(The)25 b(twotoc)i(option)92
+b(.)49 b(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)
+g(.)g(.)f(.)h(.)g(.)f(.)h(.)106 b(33)109 4895 y Fr(4)94
+b(German)27 b(Langua)o(g)q(e)i(De\002nitions)1865 b(34)p
+eop
+%%Page: 2 3
+2 2 bop 109 -62 a Ft(2)2989 b Fq(2)100 b(Options)p 109
+-10 3544 4 v 109 275 a Fs(1)143 b(Intr)m(oduction)109
+503 y Ft(The)34 b(HC)f(Bundle)h(for)h(L)1034 480 y Fp(A)1071
+503 y Ft(T)1115 526 y(E)1164 503 y(X)15 b(2)1289 518
+y Fo(")1377 503 y Ft(pr)n(ovides)35 b(the)f(following)i(four)f(classes)
+g(as)f(r)n(eplacement)109 623 y(for)25 b(the)h(L)449
+600 y Fp(A)486 623 y Ft(T)530 647 y(E)578 623 y(X)g(default)f(classes:)
+109 827 y Fr(hcar)r(t.c)n(ls:)238 b Ft(substitute)26
+b(for)g(the)f Fn(article)f Ft(class,)789 947 y(based)g(upon)h(the)h
+Fn(scrartcl)d Ft(class)i(fr)n(om)h(the)f(KoMa-Script)i(bundle;)109
+1151 y Fr(hcrepor)r(t.c)n(ls:)77 b Ft(substitute)26 b(for)g(the)f
+Fn(report)f Ft(class,)789 1271 y(based)g(upon)h(the)h
+Fn(scrreprt)d Ft(class)i(fr)n(om)h(the)f(KoMa-Script)i(bundle;)109
+1475 y Fr(hc)n(letter)-6 b(.c)n(ls:)132 b Ft(substitute)26
+b(for)g(the)f Fn(letter)f Ft(class,)789 1595 y(based)g(upon)h(the)h
+Fn(scrlettr)d Ft(class)i(fr)n(om)h(the)f(KoMa-Script)i(bundle;)109
+1799 y Fr(hcslides.c)n(ls:)85 b Ft(substitute)26 b(for)g(the)f
+Fn(slides)f Ft(class,)789 1919 y(based)g(upon)h(the)h
+Fn(seminar)d Ft(class.)193 2115 y Fm(h)r(\003)q Fl(hca)m(rt)r
+Fm(i)192 2228 y Fk(\\newcommand{\\t)o(hi)o(scl)o(as)o(s})o({h)o(ca)o
+(rt})192 2341 y(\\newcommand{\\s)o(up)o(erc)o(la)o(ss)o(}{)o(sc)o(rar)o
+(tc)o(l})193 2454 y Fm(h)r Fi(=)q Fl(hca)m(rt)r Fm(i)193
+2567 y(h)r(\003)q Fl(hcletter)s Fm(i)192 2680 y Fk(\\newcommand{\\t)o
+(hi)o(scl)o(as)o(s})o({h)o(cl)o(ett)o(er)o(})192 2792
+y(\\newcommand{\\s)o(up)o(erc)o(la)o(ss)o(}{)o(sc)o(rle)o(tt)o(r})193
+2905 y Fm(h)r Fi(=)q Fl(hcletter)s Fm(i)193 3018 y(h)r(\003)q
+Fl(hcrep)s(o)m(rt)r Fm(i)192 3131 y Fk(\\newcommand{\\t)o(hi)o(scl)o
+(as)o(s})o({h)o(cr)o(epo)o(rt)o(})192 3244 y(\\newcommand{\\s)o(up)o
+(erc)o(la)o(ss)o(}{)o(sc)o(rre)o(pr)o(t})193 3357 y Fm(h)r
+Fi(=)q Fl(hcrep)s(o)m(rt)r Fm(i)193 3470 y(h)r(\003)q
+Fl(hcslides)q Fm(i)192 3583 y Fk(\\newcommand{\\t)o(hi)o(scl)o(as)o(s})
+o({h)o(cs)o(lid)o(es)o(})192 3696 y(\\newcommand{\\s)o(up)o(erc)o(la)o
+(ss)o(}{)o(se)o(min)o(ar)o(})193 3809 y Fm(h)r Fi(=)q
+Fl(hcslides)q Fm(i)109 4155 y Fs(2)143 b(Options)109
+4412 y Ff(2.1)120 b(General)35 b(Options)p -74 4640 409
+4 v -76 4753 4 113 v -24 4719 a Fh(german)p 332 4753
+V -76 4866 V -24 4832 a(english)p 332 4866 V -74 4869
+409 4 v 109 5042 a(Loads)23 b(a)i(language.)f(Default)i(is)e(English.)g
+(At)g(the)g(moment)g(no)g(other)f(languages)h(ar)n(e)h(supported.)109
+5154 y(Requir)n(es)c(the)h Fe(babel)e Fh(package.)193
+5292 y Fm(h)r(\003)q Fl(class)q Fm(i)192 5405 y Fk(\\newif\\if@germ)o
+(an)192 5518 y(\\@germanfalse)p eop
+%%Page: 3 4
+3 3 bop 109 -62 a Fq(2.1)99 b(General)24 b(Options)2544
+b Ft(3)p 109 -10 3544 4 v 192 270 a Fk(\\newif\\if@defl)o(an)o(g)192
+383 y(\\@deflangtrue)192 496 y(\\DeclareOption)o({g)o(erm)o(an)o(}{)o
+(\\@)o(de)o(fl)o(ang)o(fa)o(ls)o(e\\)o(@g)o(erm)o(an)o(tr)o(ue)301
+609 y(\\PassOptionsTo)o(Pac)o(ka)o(ge)o({n)o(ge)o(rm)o(an})o({b)o(ab)o
+(el)o(})301 722 y(\\PassOptionsTo)o(Pac)o(ka)o(ge)o({g)o(er)o(ma)o(n}{)
+o(fa)o(nc)o(yr)o(ef)o(})301 835 y(\\AtEndOfClass{)o(\\in)o(pu)o(t{)o
+(ge)o(rm)o(an)o(.hl)o(d})o(}})192 948 y(\\DeclareOption)o({e)o(ngl)o
+(is)o(h})o({\\)o(@d)o(ef)o(lan)o(gf)o(al)o(se)301 1061
+y(\\PassOptionsTo)o(Pac)o(ka)o(ge)o({\\)o(Cu)o(rr)o(ent)o(Op)o(ti)o(on)
+o(}{)o(bab)o(el)o(}})p -74 1338 543 4 v -76 1451 4 113
+v -24 1418 a Fh(a4paper)p 467 1451 V -76 1564 V -24 1530
+a(letterpaper)p 467 1564 V -74 1568 543 4 v 109 1740
+a(Use)24 b(the)g(DIN)h(A4)g(\(default\))h(or)f(the)f(letter)g(paper)g
+(format?)i(At)f(the)f(moment)g(no)h(other)f(paper)h(for)n(-)109
+1853 y(mats)d(ar)n(e)h(supported.)192 2016 y Fk(\\newif\\if@defp)o(ap)o
+(er)192 2129 y(\\@defpapertrue)192 2242 y(\\DeclareOption)o({a)o(4pa)o
+(pe)o(r})o({)193 2355 y Fm(h)q Fl(hca)m(rt)c Fm(j)g Fl(hcletter)h
+Fm(j)f Fl(hcrep)s(o)m(rt)r Fm(i)q Fk(\\PassOptionsToCl)o(as)o(s{)o(\\C)
+o(ur)o(ren)o(tO)o(pt)o(io)o(n})o({\\s)o(up)o(er)o(cl)o(as)o(s})193
+2468 y Fm(h)q Fl(hcslides)p Fm(i)q Fk(\\PassOptionsToCl)o(as)o(s{)o(a4)
+o(}{)o(\\su)o(pe)o(rc)o(la)o(ss)o(})192 2581 y(\\PassOptionsTo)o(Pa)o
+(cka)o(ge)o({\\)o(Cu)o(rr)o(en)o(tOp)o(ti)o(on)o(}{)o(hy)o(per)o(re)o
+(f})192 2694 y(\\@defpaperfals)o(e})192 2807 y(\\DeclareOption)o({l)o
+(ett)o(er)o(pa)o(pe)o(r})o({)193 2920 y Fm(h)q Fl(hca)m(rt)g
+Fm(j)g Fl(hcletter)h Fm(j)f Fl(hcrep)s(o)m(rt)r Fm(i)q
+Fk(\\PassOptionsToCl)o(as)o(s{)o(\\C)o(ur)o(ren)o(tO)o(pt)o(io)o(n})o
+({\\s)o(up)o(er)o(cl)o(as)o(s})192 3032 y(\\PassOptionsTo)o(Pa)o(cka)o
+(ge)o({\\)o(Cu)o(rr)o(en)o(tOp)o(ti)o(on)o(}{)o(hy)o(per)o(re)o(f})192
+3145 y(\\@defpaperfals)o(e})p -74 3423 533 4 v -76 3536
+4 113 v -24 3502 a Fh(palatino)p 457 3536 V -76 3649
+V -24 3615 a(nopalatino)p 457 3649 V -74 3652 533 4 v
+109 3825 a(Use)30 b(the)g(Palatino)i(or)f(the)f(Standar)n(d)h(T)1525
+3846 y(E)1569 3825 y(X)g(font?)g(Palatino)h(is)f(default)g(\(r)n(equir)
+n(es)g(the)g Fe(palatino)109 3938 y Fh(and)22 b(the)g
+Fe(mathpple)d Fh(packages\).)192 4101 y Fk(\\newif\\if@pala)o(ti)o(no)
+192 4214 y(\\@palatinotrue)192 4327 y(\\DeclareOption)o({p)o(ala)o(ti)o
+(no)o(}{)o(\\@)o(pa)o(lat)o(in)o(ot)o(ru)o(e})192 4440
+y(\\DeclareOption)o({n)o(opa)o(la)o(ti)o(no)o(}{)o(\\@)o(pal)o(at)o(in)
+o(of)o(al)o(se})p -74 4726 286 4 v -76 4839 4 113 v -24
+4805 a Fh(ding)p 209 4839 V -74 4842 286 4 v 109 5016
+a(Pr)n(ovide)27 b(some)f(fancy)i(lists)f(and)h(symbols)e(using)h(the)f
+(Dingbat)i(symbols)f(\(r)n(equir)n(es)g(the)g Fe(pifont)109
+5129 y Fh(style)21 b(of)i(the)f Fe(psnfss)e Fh(package\)?)192
+5292 y Fk(\\newif\\if@ding)192 5405 y(\\@dingfalse)192
+5518 y(\\DeclareOption)o({d)o(ing)o(}{)o(\\@)o(di)o(ng)o(tr)o(ue})p
+eop
+%%Page: 4 5
+4 4 bop 109 -62 a Ft(4)2989 b Fq(2)100 b(Options)p 109
+-10 3544 4 v -74 174 385 4 v -76 287 4 113 v -24 253
+a Fh(eur)n(o)p 309 287 V -76 400 V -24 366 a(noeur)n(o)p
+309 400 V -74 403 385 4 v 109 576 a(Pr)n(ovide)22 b(the)g(Eur)n(o)g
+(symbol)29 b Fd(C)p 1132 538 53 2 v 1132 551 48 2 v 22
+w Fh(\(default,)23 b(r)n(equir)n(es)f(the)g Fe(eurofont)d
+Fh(package\)?)192 729 y Fk(\\newif\\if@euro)192 842 y(\\@eurotrue)192
+955 y(\\DeclareOption)o({e)o(uro)o(}{)o(\\@)o(eu)o(ro)o(tru)o(e})192
+1067 y(\\DeclareOption)o({n)o(oeu)o(ro)o(}{)o(\\@)o(eu)o(rof)o(al)o(se)
+o(})p -74 1320 530 4 v -76 1432 4 113 v -24 1399 a Fh(fancyr)n(ef)p
+454 1432 V -76 1545 V -24 1511 a(nofancyr)n(ef)p 454
+1545 V -74 1549 530 4 v 109 1721 a(Pr)n(ovide)25 b(fancy)h(r)n(efer)n
+(ence)f(commands)g(\(default,)g(r)n(equir)n(es)g(the)g
+Fe(fancyref)d Fh(and)j(the)g Fe(varioref)109 1834 y Fh(packages\)?)192
+1986 y Fk(\\newif\\if@fanc)o(yr)o(ef)192 2099 y(\\@fancyreftrue)192
+2212 y(\\DeclareOption)o({f)o(anc)o(yr)o(ef)o(}{)o(\\@)o(fan)o(cy)o(re)
+o(ft)o(ru)o(e})192 2325 y(\\DeclareOption)o({n)o(ofa)o(nc)o(yr)o(ef)o
+(}{)o(\\@f)o(an)o(cy)o(re)o(ff)o(al)o(se})p -74 2577
+392 4 v -76 2690 4 113 v -24 2656 a Fh(html)p 316 2690
+V -76 2803 V -24 2769 a(nohtml)p 316 2803 V -74 2806
+392 4 v 109 2978 a(Pr)n(ovide)71 b(HTML)g(commands)h(\(default,)g(r)n
+(equir)n(es)f(the)g Fe(html)g Fh(package)g(bundled)g(with)109
+3091 y(L)132 3074 y Fp(A)170 3091 y Fh(T)211 3113 y(E)254
+3091 y(X2HTML\)?)192 3244 y Fk(\\newif\\if@html)192 3357
+y(\\@htmltrue)192 3470 y(\\DeclareOption)o({h)o(tml)o(}{)o(\\@)o(ht)o
+(ml)o(tru)o(e})192 3582 y(\\DeclareOption)o({n)o(oht)o(ml)o(}{)o(\\@)o
+(ht)o(mlf)o(al)o(se)o(})193 3695 y Fm(h)r Fi(=)q Fl(class)q
+Fm(i)109 4024 y Ff(2.2)120 b(Options)34 b(f)n(or)e(the)i(hcar)r(t)g
+(and)g(hcrepor)r(t)f(c)n(lasses)p -74 4287 686 4 v -76
+4400 4 113 v -24 4366 a Fh(headsepline)p 610 4400 V -76
+4513 V -24 4479 a(headnosepline)p 610 4513 V -74 4516
+686 4 v 109 4688 a(Draw)23 b(a)g(horizontal)g(line)g(below)g(the)f
+(header)f(line)i(\(default\)?)193 4841 y Fm(h)r(\003)q
+Fl(hca)m(rt)c Fm(j)g Fl(hcrep)s(o)m(rt)r Fm(i)192 4954
+y Fk(\\newif\\if@defh)o(sl)192 5066 y(\\@defhsltrue)192
+5179 y(\\DeclareOption)o({h)o(ead)o(se)o(pl)o(in)o(e})o({\\P)o(as)o(sO)
+o(pt)o(io)o(ns)o(ToC)o(la)o(ss)192 5292 y({\\CurrentOptio)o(n})o({\\s)o
+(up)o(er)o(cl)o(as)o(s}\\)o(@d)o(ef)o(hs)o(lf)o(al)o(se})192
+5405 y(\\DeclareOption)o({h)o(ead)o(no)o(se)o(pl)o(in)o(e}{)o(\\P)o(as)
+o(sO)o(pt)o(io)o(nsT)o(oC)o(la)o(ss)192 5518 y({\\CurrentOptio)o(n})o
+({\\s)o(up)o(er)o(cl)o(as)o(s}\\)o(@d)o(ef)o(hs)o(lf)o(al)o(se})p
+eop
+%%Page: 5 6
+5 5 bop 109 -62 a Fq(2.2)99 b(Options)26 b(for)g(the)f(hcart)h(and)e
+(hcr)n(eport)j(classes)1437 b Ft(5)p 109 -10 3544 4 v
+-74 174 560 4 v -76 287 4 113 v -24 253 a Fh(onecolumn)p
+483 287 V -76 400 V -24 366 a(twocolumn)p 483 400 V -74
+403 560 4 v 109 575 a(Set)21 b(the)h(text)g(in)h(one)e(or)i(two)f
+(columns)g(\(default)h(is)g(one\)?)192 733 y Fk(\\DeclareOption)o({o)o
+(nec)o(ol)o(um)o(n})o({\\)o(Pa)o(ssO)o(pt)o(io)o(ns)o(To)o(Cla)o(ss)192
+846 y({\\CurrentOptio)o(n})o({\\s)o(up)o(er)o(cl)o(as)o(s})o(})192
+959 y(\\DeclareOption)o({t)o(woc)o(ol)o(um)o(n})o({\\)o(Pa)o(ssO)o(pt)o
+(io)o(ns)o(To)o(Cla)o(ss)192 1072 y({\\CurrentOptio)o(n})o({\\s)o(up)o
+(er)o(cl)o(as)o(s})o(})p -74 1337 465 4 v -76 1450 4
+113 v -24 1416 a Fh(hcar)n(ea)p 388 1450 V -76 1563 V
+-24 1529 a(hcnoar)n(ea)p 388 1563 V -74 1566 465 4 v
+109 1738 a(Set)e(the)g(default)h(ar)n(ea)h(to)f(240mm)j
+Fm(\002)e Fh(150mm)h(\(default\)?)f(Otherwise,)e(the)g(default)h(value)
+h(fr)n(om)g(the)109 1851 y Fe(scrartcl)d Fh(r)n(esp.)i
+Fe(scrreprt)e Fh(classes)j(is)h(used)e(if)j(you)d(do)h(not)g(set)f(the)
+h(ar)n(ea)i(manually)g(\(e.g.)d(with)109 1964 y(the)f
+Fe(\\areaset)f Fh(command\).)192 2122 y Fk(\\newif\\if@hcar)o(ea)192
+2235 y(\\@hcareatrue)192 2348 y(\\DeclareOption)o({h)o(car)o(ea)o(}{)o
+(\\@)o(hc)o(ar)o(eat)o(ru)o(e})192 2461 y(\\DeclareOption)o({h)o(cno)o
+(ar)o(ea)o(}{)o(\\@)o(hc)o(are)o(af)o(al)o(se)o(})p -74
+2726 669 4 v -76 2839 4 113 v -24 2805 a Fh(hcfootnotes)p
+593 2839 V -76 2952 V -24 2918 a(hcnofootnotes)p 593
+2952 V -74 2955 669 4 v 109 3127 a(Nicer)i(formatting)h(of)f(footnotes)
+e(\(default\)?)192 3285 y Fk(\\newif\\if@hcfo)o(ot)o(not)o(es)192
+3398 y(\\@hcfootnotest)o(ru)o(e)192 3511 y(\\DeclareOption)o({h)o(cfo)o
+(ot)o(no)o(te)o(s})o({\\)o(@hc)o(fo)o(ot)o(no)o(te)o(str)o(ue)o(})192
+3624 y(\\DeclareOption)o({h)o(cno)o(fo)o(ot)o(no)o(te)o(s})o({\\@)o(hc)
+o(fo)o(ot)o(no)o(tes)o(fa)o(ls)o(e})p -74 3897 490 4
+v -76 4010 4 113 v -24 3976 a Fh(magazine)p 414 4010
+V -74 4013 490 4 v 109 4187 a(Pr)n(ovide)i(commands)h(for)f(magazine)i
+(or)e(newspaper)f(articles?)j(This)e(sets)f(the)h Fe(html)f
+Fh(option)g(too.)192 4345 y Fk(\\newif\\if@maga)o(zi)o(ne)192
+4458 y(\\@magazinefals)o(e)192 4571 y(\\DeclareOption)o({m)o(aga)o(zi)o
+(ne)o(}{)o(\\@)o(ma)o(gaz)o(in)o(et)o(ru)o(e\\)o(@ht)o(ml)o(tr)o(ue)o
+(})p -74 4844 406 4 v -76 4957 4 113 v -24 4923 a Fh(parskip)p
+330 4957 V -74 4960 406 4 v 109 5134 a(Skip)h(paragraphs)g(instead)g
+(of)g(indenting)g(them?)192 5292 y Fk(\\newif\\if@pars)o(ki)o(p)192
+5405 y(\\@parskipfalse)192 5518 y(\\DeclareOption)o({p)o(ars)o(ki)o(p})
+o({\\)o(@p)o(ar)o(ski)o(pt)o(ru)o(e})p eop
+%%Page: 6 7
+6 6 bop 109 -62 a Ft(6)2989 b Fq(2)100 b(Options)p 109
+-10 3544 4 v -74 191 301 4 v -76 304 4 113 v -24 270
+a Fh(wide)p 225 304 V -74 307 301 4 v 109 481 a(Use)21
+b(a)i(wide)f(line)i(distance)e(\(ca.)h(1.5\)?)192 615
+y Fk(\\newif\\if@wide)192 728 y(\\@widefalse)192 841
+y(\\DeclareOption)o({w)o(ide)o(}{)o(\\@)o(wi)o(de)o(tru)o(e})193
+954 y Fm(h)r Fi(=)q Fl(hca)m(rt)c Fm(j)g Fl(hcrep)s(o)m(rt)r
+Fm(i)109 1238 y Ff(2.3)120 b(Options)34 b(f)n(or)e(the)i(hcar)r(t,)g
+(hcrepor)r(t)g(and)g(hc)n(letter)f(c)n(lasses)p -74 1466
+275 4 v -76 1579 4 113 v -24 1545 a Fh(10pt)p 199 1579
+V -76 1692 V -24 1658 a(1)-5 b(1pt)p 199 1692 V -76 1805
+V -24 1771 a(12pt)p 199 1805 V -74 1808 275 4 v 109 1980
+a(Use)21 b(a)i(font)g(size)f(of)h(10,)g(1)-5 b(1,)24
+b(or)e(12)i(\(default\))f(points?)193 2114 y Fm(h)r(\003)q
+Fl(hca)m(rt)c Fm(j)g Fl(hcrep)s(o)m(rt)h Fm(j)f Fl(hcletter)s
+Fm(i)192 2227 y Fk(\\newif\\if@defs)o(iz)o(e)192 2340
+y(\\@defsizetrue)192 2453 y(\\DeclareOption)o({1)o(0pt)o(}{)o(\\P)o(as)
+o(sO)o(pti)o(on)o(sT)o(oC)o(la)o(ss)o({\\C)o(ur)o(re)o(nt)o(Op)o(tio)o
+(n})o({\\)o(su)o(pe)o(rcl)o(as)o(s})192 2566 y(\\@defsizefalse)o(})192
+2679 y(\\DeclareOption)o({1)o(1pt)o(}{)o(\\P)o(as)o(sO)o(pti)o(on)o(sT)
+o(oC)o(la)o(ss)o({\\C)o(ur)o(re)o(nt)o(Op)o(tio)o(n})o({\\)o(su)o(pe)o
+(rcl)o(as)o(s})192 2792 y(\\@defsizefalse)o(})192 2904
+y(\\DeclareOption)o({1)o(2pt)o(}{)o(\\P)o(as)o(sO)o(pti)o(on)o(sT)o(oC)
+o(la)o(ss)o({\\C)o(ur)o(re)o(nt)o(Op)o(tio)o(n})o({\\)o(su)o(pe)o(rcl)o
+(as)o(s})192 3017 y(\\@defsizefalse)o(})193 3130 y Fm(h)r
+Fi(=)q Fl(hca)m(rt)g Fm(j)g Fl(hcrep)s(o)m(rt)h Fm(j)f
+Fl(hcletter)s Fm(i)109 3414 y Ff(2.4)120 b(Options)34
+b(f)n(or)e(the)i(hcar)r(t,)g(hcrepor)r(t)g(and)g(hcslides)h(c)n(lasses)
+p -74 3643 330 4 v -76 3755 4 113 v -24 3722 a Fh(bib)p
+253 3755 V -76 3868 V -24 3834 a(nobib)p 253 3868 V -74
+3872 330 4 v 109 4041 a(Use)21 b(B)m Fc(I)r(B)-5 b Fh(T)444
+4071 y(E)488 4041 y(X?)193 4175 y Fm(h)r(\003)q Fl(hca)m(rt)19
+b Fm(j)g Fl(hcrep)s(o)m(rt)h Fm(j)f Fl(hcslides)q Fm(i)192
+4288 y Fk(\\newif\\if@bib)192 4401 y(\\@bibfalse)192
+4514 y(\\DeclareOption)o({b)o(ib})o({\\)o(@b)o(ib)o(tr)o(ue})192
+4627 y(\\DeclareOption)o({n)o(obi)o(b})o({\\)o(@b)o(ib)o(fal)o(se)o(})p
+-74 4844 415 4 v -76 4957 4 113 v -24 4923 a Fh(fnbib)p
+339 4957 V -76 5070 V -24 5036 a(autbib)p 339 5070 V
+-76 5183 V -24 5149 a(numbib)p 339 5183 V -74 5186 415
+4 v 109 5359 a(B)m Fc(I)r(B)-5 b Fh(T)269 5388 y(E)313
+5359 y(X)18 b(r)n(efer)n(ences)f(ar)n(e)h(written)g(in)g(footnotes)e
+(\(default\))i(or)g(in)h(author)n(-year)f(or)f(in)i(numerical)h(style.)
+109 5471 y(These)h(options)g(set)g(the)h Fe(bib)f Fh(option)h(too.)p
+eop
+%%Page: 7 8
+7 7 bop 109 -62 a Fq(2.4)99 b(Options)26 b(for)g(the)f(hcart,)h(hcr)n
+(eport)g(and)f(hcslides)g(classes)1034 b Ft(7)p 109 -10
+3544 4 v 192 270 a Fk(\\newif\\if@fnbi)o(b)192 383 y(\\@fnbibtrue)192
+496 y(\\newif\\if@autb)o(ib)192 609 y(\\@autbibfalse)192
+722 y(\\newif\\if@numb)o(ib)192 835 y(\\@numbibfalse)192
+948 y(\\DeclareOption)o({f)o(nbi)o(b})o({\\)o(@f)o(nb)o(ib)o(tru)o(e\\)
+o(@a)o(ut)o(bi)o(bfa)o(ls)o(e\\)o(@n)o(um)o(bib)o(fa)o(ls)o(e\\)o(@b)o
+(ibt)o(ru)o(e})192 1061 y(\\DeclareOption)o({a)o(utb)o(ib)o(}{)o(\\@)o
+(fn)o(bi)o(bfa)o(ls)o(e\\)o(@a)o(ut)o(bib)o(tr)o(ue)o(\\@)o(nu)o(mbi)o
+(bf)o(al)o(se)o(\\@)o(bib)o(tr)o(ue)o(})192 1173 y(\\DeclareOption)o
+({n)o(umb)o(ib)o(}{)o(\\@)o(fn)o(bi)o(bfa)o(ls)o(e\\)o(@a)o(ut)o(bib)o
+(fa)o(ls)o(e\\)o(@n)o(umb)o(ib)o(tr)o(ue)o(\\@)o(bib)o(tr)o(ue)o(})p
+-74 1472 519 4 v -76 1585 4 113 v -24 1551 a Fh(htmlbib)p
+443 1585 V -76 1698 V -24 1664 a(nohtmlbib)p 443 1698
+V -74 1701 519 4 v 109 1873 a(Use)27 b(the)h Fe(html)f
+Fh(package)h(for)h(online)f(r)n(efer)n(ences)g(with)g(B)m
+Fc(I)r(B)-5 b Fh(T)2283 1903 y(E)2328 1873 y(X)28 b(\(default\)?)h
+(This)g(loads)f(the)g Fe(html)109 1986 y Fh(option)21
+b(too.)192 2159 y Fk(\\newif\\if@html)o(bi)o(b)192 2272
+y(\\@htmlbibtrue)192 2385 y(\\DeclareOption)o({h)o(tml)o(bi)o(b})o({\\)
+o(@h)o(tm)o(lbi)o(bt)o(ru)o(e\\)o(@h)o(tml)o(tr)o(ue)o(})192
+2498 y(\\DeclareOption)o({n)o(oht)o(ml)o(bi)o(b})o({\\)o(@h)o(tml)o(bi)
+o(bf)o(al)o(se)o(})p -74 2804 334 4 v -76 2917 4 113
+v -24 2883 a Fh(paper)p 258 2917 V -74 2921 334 4 v 109
+3094 a(Pr)n(ovide)32 b(formatting)h(and)f(commands)h(for)f(a)i
+(scienti\002c)e(paper?)h(This)f(sets)f(the)h Fe(bib)f
+Fh(and)i Fe(html)109 3207 y Fh(options)21 b(too.)192
+3380 y Fk(\\newif\\if@pape)o(r)192 3493 y(\\@paperfalse)192
+3606 y(\\DeclareOption)o({p)o(ape)o(r})o({\\)o(@p)o(ap)o(er)o(tru)o
+(e\\)o(@b)o(ib)o(tr)o(ue\\)o(@h)o(tm)o(lt)o(ru)o(e})p
+-74 3904 343 4 v -76 4017 4 113 v -24 3984 a Fh(pdf)p
+267 4017 V -76 4130 V -24 4096 a(nopdf)p 267 4130 V -74
+4134 343 4 v 109 4306 a(Pr)n(epar)n(e)32 b(\002le)h(for)g(the)f(PDF)g
+(format?)i(This)e(loads)h(the)f Fe(hyperref)d Fh(package.)j(This)h
+(option)e(is)i(set)109 4419 y(automagically)24 b(by)e(r)o(unning)h
+Fe(pdflatex)p Fh(.)192 4591 y Fk(\\newif\\if@pdf)192
+4704 y(\\ifx\\pdfoutput)o(\\u)o(nde)o(fi)o(ne)o(d)301
+4817 y(\\@pdffalse)192 4930 y(\\else)301 5043 y(\\@pdftrue)192
+5156 y(\\fi)192 5269 y(\\DeclareOption)o({p)o(df})o({\\)o(@p)o(df)o(tr)
+o(ue)o(})192 5382 y(\\DeclareOption)o({n)o(opd)o(f})o({\\)o(@p)o(df)o
+(fa)o(lse)o(})193 5494 y Fm(h)r Fi(=)q Fl(hca)m(rt)c
+Fm(j)g Fl(hcrep)s(o)m(rt)h Fm(j)f Fl(hcslides)q Fm(i)p
+eop
+%%Page: 8 9
+8 8 bop 109 -62 a Ft(8)2989 b Fq(2)100 b(Options)p 109
+-10 3544 4 v 109 270 a Ff(2.5)120 b(Options)34 b(f)n(or)e(the)i
+(hcrepor)r(t)g(c)n(lass)p -74 498 496 4 v -76 611 4 113
+v -24 577 a Fh(openany)p 420 611 V -76 724 V -24 690
+a(openright)p 420 724 V -74 728 496 4 v 109 900 a(Start)22
+b(new)g(chapters)f(always)i(on)g(a)g(right)f(page)g(\(not)g(by)h
+(default\)?)193 1030 y Fm(h)r(\003)q Fl(hcrep)s(o)m(rt)r
+Fm(i)192 1143 y Fk(\\DeclareOption)o({o)o(pen)o(an)o(y})301
+1256 y({\\PassOptionsT)o(oCl)o(as)o(s{)o(\\C)o(ur)o(ren)o(tO)o(pt)o(io)
+o(n})o({\\)o(sup)o(er)o(cl)o(as)o(s})o(})192 1369 y(\\DeclareOption)o
+({o)o(pen)o(ri)o(gh)o(t})301 1482 y({\\PassOptionsT)o(oCl)o(as)o(s{)o
+(\\C)o(ur)o(ren)o(tO)o(pt)o(io)o(n})o({\\)o(sup)o(er)o(cl)o(as)o(s})o
+(})193 1595 y Fm(h)r Fi(=)q Fl(hcrep)s(o)m(rt)r Fm(i)109
+1875 y Ff(2.6)120 b(Options)34 b(f)n(or)e(the)i(hcslides)i(c)n(lass)p
+-74 2104 375 4 v -76 2216 4 113 v -24 2183 a Fh(twotoc)p
+298 2216 V -76 2329 V -24 2296 a(onetoc)p 298 2329 V
+-74 2333 375 4 v 109 2505 a(Print)22 b(table)h(of)g(contents)e(in)i
+(two)f(columns)g(\(r)n(equir)n(es)h(the)f Fe(multicol)d
+Fh(package\)?)193 2635 y Fm(h)r(\003)q Fl(hcslides)q
+Fm(i)192 2748 y Fk(\\newif\\if@twot)o(oc)192 2861 y(\\@twotocfalse)192
+2974 y(\\DeclareOption)o({t)o(wot)o(oc)o(}{)o(\\@)o(tw)o(oto)o(ct)o(ru)
+o(e})192 3087 y(\\DeclareOption)o({o)o(net)o(oc)o(}{)o(\\@)o(tw)o(oto)o
+(cf)o(al)o(se)o(})193 3200 y Fm(h)r Fi(=)q Fl(hcslides)q
+Fm(i)109 3481 y Ff(2.7)120 b(Other)33 b(Options)109 3657
+y Fh(Other)22 b(options)f(ar)n(e)i(ignor)n(ed.)193 3788
+y Fm(h)r(\003)q Fl(class)q Fm(i)192 3901 y Fk(\\DeclareOption)o(*{)o
+(\\Cl)o(as)o(sW)o(ar)o(ni)o(ng{)o(\\t)o(hi)o(sc)o(la)o(ss)o(}\045)355
+4014 y({Unknown)51 b(Option:)h(`\\CurrentOptio)o(n)c('}\045)192
+4127 y(})109 4257 y Fh(Options)22 b(not)g(implemented:)109
+4409 y Fb(scrar)r(tc)n(l,)j(scrlettr)-5 b(,)25 b(scrrepr)r(t:)74
+b Fh(paper)22 b(sizes)g(except)f(a4)j(and)f(letter)e(\(a5paper)-7
+b(,)23 b(b5paper)-7 b(,)23 b(legalpa-)668 4521 y(per)-7
+b(,)22 b(executivepaper)f(...\);)h(oneside,)e(twoside;)109
+4695 y Fb(scrar)r(tc)n(l,)25 b(scrrepr)r(t:)73 b Fh(DIV.)14
+b(.)g(.)g(,)j(DIVcalc,)i(DIVclassic,)h(BCOR;)e(headinclude,)g
+(headexclude,)g(foot-)668 4808 y(include,)h(footexclude;)e
+(footsepline,)g(footnosepline;)g(bigheadings,)h(normalhead-)668
+4920 y(ings,)37 b(smallheadings;)h(pointednumbers,)d(pointlessnumbers;)
+g(abstracton,)j(ab-)668 5033 y(stractof)n(f;)29 b(titlepage,)g
+(notitlepage;)f(leqno,)g(\003eqn;)i(openbib;)f(portrait,)f(landscape;)
+668 5146 y(draft,)22 b(\002nal;)h(bibtotocnumber)n(ed;)109
+5319 y Fb(scrlettr:)221 b Fh(or)n(gdate;)21 b(wloc\002eld,)h
+(sloc\002eld;)109 5492 y Fb(seminar:)179 b Fh(portrait,)16
+b(landscape;)i(article,)g(slidesonly)-10 b(,)15 b(notes,)h(notesonly;)f
+(semlayer)-7 b(,)17 b(semcolor)-7 b(.)p eop
+%%Page: 9 10
+9 9 bop 109 -62 a Fq(3)99 b(Commands)25 b(and)f(Envir)n(onments)1993
+b Ft(9)p 109 -10 3544 4 v 109 275 a Fs(3)143 b(Commands)37
+b(and)i(En)-6 b(vir)m(onments)109 531 y Ff(3.1)120 b(Con\002guration)p
+-74 781 1381 4 v -76 894 4 113 v -24 861 a Fe(\\defaulttitle{)o
+Fg(title)l Fe(})p 1305 894 V -76 1007 V -24 973 a(\\defaultauthor)o({)p
+Fg(author)-5 b Fe(})p 1305 1007 V -76 1120 V -24 1086
+a(\\defaultaddres)o(s{)o Fg(addr)n(ess)m Fe(})p 1305
+1120 V -76 1233 V -24 1199 a(\\defaultemail{)o Fg(mail-addr)n(ess)n
+Fe(})p 1305 1233 V -76 1346 V -24 1312 a(\\defaulthomepa)o(ge)o({)p
+Fg(w)o(ebsite)l Fe(})p 1305 1346 V -74 1349 1381 4 v
+109 1521 a Fh(Used)20 b(if)i(no)g(author)f(information)h(is)g
+(speci\002ed.)f(They)f(ar)n(e)i(all)i(empty)c(by)i(default.)f(Renew)f
+(them)i(in)109 1634 y(one)f(of)i(the)f(con\002g)g(\002les)g(\(see)g
+(below\).)p -74 1881 482 4 v -76 1994 4 113 v -24 1960
+a Fe(\\autdiv)p 406 1994 V -74 1997 482 4 v 109 2171
+a Fh(Use)f(instead)h(of)h Fe(\\\\)e Fh(in)j Fe(\\defaultauthor)o
+Fh(.)p -74 2417 700 4 v -76 2530 4 113 v -24 2496 a Fe(\\autinfodiv)p
+624 2530 V -74 2533 700 4 v 109 2707 a Fh(Use)d(instead)h(of)h
+Fe(\\\\)e Fh(in)j Fe(\\defaultaddres)o(s)16 b Fh(etc.)192
+2854 y Fk(\\newcommand{\\d)o(ef)o(aul)o(tt)o(it)o(le)o(}{)o(})192
+2967 y(\\newcommand{\\d)o(ef)o(aul)o(ta)o(ut)o(ho)o(r})o({})192
+3080 y(\\newcommand{\\d)o(ef)o(aul)o(ta)o(dd)o(re)o(ss)o(}{)o(})192
+3192 y(\\newcommand{\\d)o(ef)o(aul)o(te)o(ma)o(il)o(}{)o(})192
+3305 y(\\newcommand{\\d)o(ef)o(aul)o(th)o(om)o(ep)o(ag)o(e})o({})192
+3418 y(\\newcommand{\\c)o(ur)o(ren)o(tt)o(it)o(le)o(}{)o(\\d)o(efa)o
+(ul)o(tt)o(it)o(le)o(})192 3531 y(\\newcommand{\\c)o(ur)o(ren)o(ta)o
+(ut)o(ho)o(r})o({\\)o(def)o(au)o(lt)o(au)o(th)o(or})192
+3644 y(\\newcommand{\\a)o(ut)o(div)o(}{)o(\\\\)o([-)o(0.)o(4e)o(x]\\)o
+(no)o(rm)o(al)o(fo)o(nt\\)o(La)o(rg)o(e})192 3757 y(\\newcommand{\\a)o
+(ut)o(inf)o(od)o(iv)o(}{)o(\\\\)o([-)o(1ex)o(]\\)o(no)o(rm)o(al)o(fon)o
+(t\\)o(no)o(rm)o(al)o(siz)o(e})192 3870 y(\\ProcessOption)o(s\\)o(rel)o
+(ax)193 3983 y Fm(h)r Fi(=)q Fl(class)q Fm(i)193 4096
+y(h)r(\003)q Fl(hca)m(rt)j Fm(j)g Fl(hcrep)s(o)m(rt)r
+Fm(i)192 4209 y Fk(\\if@defhsl)301 4322 y(\\PassOptionsTo)o(Cla)o(ss)o
+({h)o(ea)o(ds)o(ep)o(lin)o(e})o({\\)o(su)o(pe)o(rcl)o(as)o(s})192
+4434 y(\\fi)109 4581 y Fh(The)27 b Fe(twoside)p Fh(,)d
+Fe(pointlessnumber)o(s)p Fh(,)d Fe(liststotoc)p Fh(,)i
+Fe(bibtotoc)i Fh(and)i Fe(idxtotoc)e Fh(options)109 4694
+y(ar)n(e)19 b(always)f(used)f(with)i(the)e Fe(hcart)g
+Fh(and)h Fe(hcreport)d Fh(classes.)j(The)g Fe(hcletter)d
+Fh(class)k(always)g(uses)109 4807 y(the)i Fe(wlocfield)e
+Fh(option.)192 4954 y Fk(\\PassOptionsTo)o(Cl)o(ass)o({t)o(wo)o(si)o
+(de)o(,p)o(oin)o(tl)o(es)o(sn)o(um)o(ber)o(s,)o(li)o(st)o(st)o(oto)o
+(c,)301 5066 y(bibtotoc,idxto)o(toc)o(}{)o(\\s)o(up)o(er)o(cl)o(ass)o
+(})193 5179 y Fm(h)r Fi(=)q Fl(hca)m(rt)g Fm(j)g Fl(hcrep)s(o)m(rt)r
+Fm(i)193 5292 y(h)q Fl(hcletter)r Fm(i)q Fk(\\PassOptionsToCl)o(as)o
+(s{)o(wl)o(oc)o(fie)o(ld)o(}{)o(\\s)o(up)o(erc)o(la)o(ss)o(})193
+5405 y Fm(h)r(\003)q Fl(hca)m(rt)g Fm(j)g Fl(hcrep)s(o)m(rt)h
+Fm(j)f Fl(hcletter)s Fm(i)192 5518 y Fk(\\if@defsize)p
+eop
+%%Page: 10 11
+10 10 bop 109 -62 a Ft(10)1941 b Fq(3)99 b(Commands)25
+b(and)g(Envir)n(onments)p 109 -10 3544 4 v 301 270 a
+Fk(\\PassOptionsTo)o(Cla)o(ss)o({1)o(2p)o(t})o({\\s)o(up)o(er)o(cl)o
+(as)o(s})192 383 y(\\fi)193 496 y Fm(h)r Fi(=)q Fl(hca)m(rt)19
+b Fm(j)g Fl(hcrep)s(o)m(rt)h Fm(j)f Fl(hcletter)s Fm(i)193
+609 y(h)r(\003)q Fl(class)q Fm(i)192 722 y Fk(\\if@deflang)301
+835 y(\\PassOptionsTo)o(Pac)o(ka)o(ge)o({e)o(ng)o(lis)o(h})o({b)o(ab)o
+(el)o(})192 948 y(\\fi)192 1061 y(\\if@defpaper)193 1173
+y Fm(h)q Fl(hca)m(rt)g Fm(j)g Fl(hcrep)s(o)m(rt)r Fm(i)110
+b Fk(\\PassOptionsToC)o(la)o(ss)o({a)o(4p)o(ape)o(r})o({\\)o(su)o(pe)o
+(rcl)o(as)o(s})193 1286 y Fm(h)q Fl(hcslides)p Fm(i)g
+Fk(\\PassOptionsToCl)o(as)o(s{)o(a4)o(}{\\)o(su)o(pe)o(rc)o(la)o(ss})
+301 1399 y(\\PassOptionsTo)o(Pac)o(ka)o(ge)o({a)o(4p)o(ape)o(r})o({h)o
+(yp)o(er)o(re)o(f})192 1512 y(\\fi)192 1625 y(\\LoadClass{\\su)o(pe)o
+(rcl)o(as)o(s})109 1820 y Fh(The)22 b(normal)h(spacing)g(is)f(used)f
+(after)i(the)f(end)g(of)g(a)h(sentence.)192 2015 y Fk(\\sloppy)192
+2128 y(\\clubpenalty99)o(99)192 2241 y(\\@clubpenalty\\)o(cl)o(ubp)o
+(en)o(al)o(ty)192 2353 y(\\widowpenalty9)o(99)o(9)192
+2466 y(\\displaywidowp)o(en)o(alt)o(y1)o(00)o(0)192 2579
+y(\\brokenpenalty)o(10)o(00)192 2692 y(\\frenchspacing)109
+2887 y Fh(The)g(modern)f(font)i(encoding)f(\(T1\))h(and)g(the)f(latin1)
+i(input)f(encoding)e(ar)n(e)j(used)d(\(this)i(r)n(equir)n(es)f(the)109
+3000 y Fe(T1)18 b Fh(and)h Fe(latin1)d Fh(packages\).)i(The)h
+Fe(ifthen)p Fh(,)d(the)i Fe(babel)f Fh(and)i(the)f Fe(xspace)e
+Fh(packages)i(ar)n(e)i(always)109 3113 y(used.)h(The)g
+Fe(bib)h Fh(option)f(loads)i(the)f Fe(natbib)e Fh(package.)193
+3308 y Fm(h)q Fl(hca)m(rt)f Fm(j)g Fl(hcrep)s(o)m(rt)h
+Fm(j)f Fl(hcslides)p Fm(i)q Fk(\\RequirePackage{)o(na)o(tb)o(ib)o(})192
+3421 y(\\RequirePackag)o(e[)o(T1])o({f)o(on)o(te)o(nc)o(})192
+3533 y(\\RequirePackag)o(e[)o(lat)o(in)o(1])o({i)o(np)o(ute)o(nc)o(})
+192 3646 y(\\RequirePackag)o(e{)o(ift)o(he)o(n})192 3759
+y(\\RequirePackag)o(e{)o(bab)o(el)o(})192 3872 y(\\RequirePackag)o(e{)o
+(xsp)o(ac)o(e})109 4067 y Fh(The)27 b(con\002g)h(\002le)g
+Fe(hc.cfg)d Fh(is)k(used)d(by)i(all)i(classes.)d(Every)g(class)i(also)f
+(uses)f(a)h(con\002g)g(\002le)g(with)g(its)109 4180 y(own)h(name,)h
+(e.g.)f(the)h(hcart)g(class)h(uses)e Fe(hcart.cfg)p Fh(.)d(The)j
+(settings)f(in)j Fe(hc.cfg)c Fh(may)k(be)f(over)n(-)109
+4293 y(written)21 b(by)i(the)f(class)h(speci\002c)f(con\002g)h
+(\002les.)192 4488 y Fk(\\InputIfFileEx)o(is)o(ts{)o(hc)o(.c)o(fg)o(}{)
+o(\045)301 4601 y(\\ClassInfo{\\th)o(isc)o(la)o(ss)o(})410
+4713 y({Loading)51 b(configuration)d(file)53 b(hc.cfg}}{\045)301
+4826 y(\\ClassInfo{\\th)o(isc)o(la)o(ss)o(})410 4939
+y({Configuration)48 b(file)53 b(hc.cfg)f(not)h(found}})192
+5052 y(\\InputIfFileEx)o(is)o(ts{)o(\\t)o(hi)o(sc)o(la)o(ss.)o(cf)o(g})
+o({\045)301 5165 y(\\ClassInfo{\\th)o(isc)o(la)o(ss)o(})410
+5278 y({Loading)e(configuration)d(file)53 b(\\thisclass.cfg})o(}{)o
+(\045)301 5391 y(\\ClassInfo{\\th)o(isc)o(la)o(ss)o(})410
+5504 y({Configuration)48 b(file)53 b(\\thisclass.cfg)48
+b(not)53 b(found}})p eop
+%%Page: 11 12
+11 11 bop 109 -62 a Fq(3.2)99 b(General)24 b(Commands)h(and)g(Envir)n
+(onments)1501 b Ft(1)-5 b(1)p 109 -10 3544 4 v 109 270
+a Ff(3.2)120 b(General)35 b(Commands)g(and)f(En)-5 b(vir)n(onments)p
+-74 542 517 4 v -76 655 4 113 v -24 621 a Fe(\\q{)p Fg(quote)o
+Fe(})p 441 655 V -74 658 517 4 v 109 832 a Fh(<)p Fg(quote)p
+Fh(>)28 b(is)g(put)f(into)h(quotation)f(marks.)g(May)h(be)g(nested:)d
+(A)i(quote)g(inside)g(another)g(quote)g(uses)109 945
+y(inner)22 b(quotation)g(marks.)192 1102 y Fk(\\newcommand{\\n)o(ex)o
+(tst)o(ar)o(tq)o(}{)o(`})192 1215 y(\\newcommand{\\n)o(ex)o(ten)o(dq)o
+(}{)o('})192 1328 y(\\newcommand{\\o)o(th)o(ers)o(ta)o(rt)o(q})o({`)o
+(`})192 1441 y(\\newcommand{\\o)o(th)o(ere)o(nd)o(q})o({')o('})192
+1554 y(\\newcommand{\\t)o(mp)o(q}{)o(})192 1667 y(\\newcommand{\\q)o
+(}[)o(1]{)o(\\n)o(ex)o(ts)o(ta)o(rt)o(q{})o(\045)301
+1780 y(\\let\\tmpq\\next)o(sta)o(rt)o(q\045)301 1893
+y(\\let\\nextstart)o(q\\o)o(th)o(er)o(st)o(ar)o(tq)o(\045)301
+2006 y(\\let\\otherstar)o(tq\\)o(tm)o(pq)o(\045)301 2118
+y(\\let\\tmpq\\next)o(end)o(q\045)301 2231 y(\\let\\nextendq\\)o(oth)o
+(er)o(en)o(dq)o(\045)301 2344 y(\\let\\otherendq)o(\\tm)o(pq)o(\045)301
+2457 y(#1\045)301 2570 y(\\let\\tmpq\\next)o(sta)o(rt)o(q\045)301
+2683 y(\\let\\nextstart)o(q\\o)o(th)o(er)o(st)o(ar)o(tq)o(\045)301
+2796 y(\\let\\otherstar)o(tq\\)o(tm)o(pq)o(\045)301 2909
+y(\\let\\tmpq\\next)o(end)o(q\045)301 3022 y(\\let\\nextendq\\)o(oth)o
+(er)o(en)o(dq)o(\045)301 3135 y(\\let\\otherendq)o(\\tm)o(pq)o(\045)301
+3248 y(\\nextendq{}\045)192 3360 y(})p -74 3632 571 4
+v -76 3745 4 113 v -24 3711 a Fe(\\hq{)p Fg(quote)n Fe(})p
+495 3745 V -74 3748 571 4 v 109 3922 a Fh(<)p Fg(quote)p
+Fh(>)h(is)g(always)g(put)f(into)g(inner)h(\(\223half)5
+b(\224\))25 b(quotation)d(marks.)192 4080 y Fk(\\newcommand{\\h)o(q})o
+([1])o({`)o(`#)o(1')o('})p -74 4351 V -76 4464 4 113
+v -24 4430 a Fe(\\fq{)p Fg(quote)n Fe(})p 495 4464 V
+-74 4467 571 4 v 109 4641 a Fh(<)p Fg(quote)p Fh(>)h(is)g(always)g(put)
+f(into)g(outer)f(\(`full'\))k(quotation)d(marks.)192
+4799 y Fk(\\newcommand{\\f)o(q})o([1])o({`)o(#1)o('})p
+-74 5070 623 4 v -76 5183 4 113 v -24 5149 a Fe(\\dash{)p
+Fg(text)n Fe(})p 547 5183 V -74 5187 623 4 v 109 5361
+a Fh(<)p Fg(text)q Fh(>)h(is)g(put)e(between)g(dashes.)192
+5518 y Fk(\\newcommand{\\d)o(as)o(h}[)o(1])o({-)o(--)o(#1)o(--)o(-})p
+eop
+%%Page: 12 13
+12 12 bop 109 -62 a Ft(12)1941 b Fq(3)99 b(Commands)25
+b(and)g(Envir)n(onments)p 109 -10 3544 4 v -74 191 1969
+4 v -76 304 4 113 v -24 270 a Fe(\\begin{flexlis)o(t})o([)p
+Fg(separator)m Fe(]{)p Fg(longest-title)s Fe(})p 1892
+304 V -74 307 1969 4 v 109 481 a Fh(A)e(list)h(envir)n(onment)f
+(similar)i(to)e(the)f Fe(description)d Fh(envir)n(onment.)j(All)j
+(items)e(ar)n(e)h(indented)d(by)109 594 y(the)g(width)i(of)f(<)p
+Fg(longest-title)t Fh(>.)g(The)g(default)h(<)p Fg(separator)s
+Fh(>)g(is)f(`:'.)192 747 y Fk(\\newenvironmen)o(t{)o(fle)o(xl)o(is)o
+(t})o([2)o(][:)o(])410 860 y({\\begin{list}{})519 973
+y({\\settowidth{\\l)o(ab)o(el)o(wi)o(dth)o(}{)o(\\s)o(ff)o(am)o(il)o
+(y\\b)o(fs)o(er)o(ie)o(s)48 b(#2#1)53 b(})574 1086 y(\\setlength{\\le)o
+(ft)o(ma)o(rg)o(in})o({\\)o(la)o(be)o(lw)o(id)o(th})574
+1199 y(\\addtolength{\\)o(le)o(ft)o(ma)o(rgi)o(n})o({\\)o(la)o(be)o(ls)
+o(ep})574 1312 y(\\renewcommand{)o(\\m)o(ak)o(el)o(abe)o(l})o([1)o(])
+683 1425 y({\\sffamily\\bfs)o(er)o(ie)o(s)c(##1#1)j(\\hfill}}})410
+1538 y({\\end{list}})p -74 1800 1420 4 v -76 1913 4 113
+v -24 1879 a Fe(\\begin{widedes)o(c})o([)p Fg(separator)m
+Fe(])p 1344 1913 V -74 1916 1420 4 v 109 2090 a Fh(A)22
+b(variation)h(of)f(the)g Fe(flexlist)d Fh(envir)n(onment.)i(All)i
+(items)f(ar)n(e)g(indented)f(by)h(the)f(width)h(of)g(a)h(date)109
+2203 y(\(`00.00.0000'\).)j(The)c(default)h(<)p Fg(separator)s
+Fh(>)g(is)g(`:'.)192 2356 y Fk(\\newenvironmen)o(t{)o(wid)o(ed)o(es)o
+(c})o([1)o(][:)o(])301 2469 y({\\begin{flexli)o(st})o([#)o(1])o({0)o
+(0.)o(00.)o(00)o(00)o(}})301 2582 y({\\end{flexlist)o(}})p
+-74 2844 733 4 v -76 2957 4 113 v -24 2923 a Fe(\\pcent{)p
+Fg(value)m Fe(})p 657 2957 V -74 2961 733 4 v 109 3135
+a Fh(Prints)f(<)p Fg(value)q Fh(>)h(followed)f(by)g(the)g(per)n(cent)g
+(symbol)g(\045.)192 3288 y Fk(\\newcommand{\\p)o(ce)o(nt})o([1)o(]{)o
+(#1)o(\\,)o(\\\045})p -74 3550 427 4 v -76 3663 4 113
+v -24 3629 a Fe(\\qdots)p 351 3663 V -74 3666 427 4 v
+109 3840 a Fh(Prints)g(the)g(scienti\002c)h(omission)f(symbol)g([.)14
+b(.)g(.)g(])o(.)192 3994 y Fk(\\newcommand{\\q)o(do)o(ts})o({\\)o(mb)o
+(ox)o({[)o(\\do)o(ts)o(]})o(\\x)o(sp)o(ac)o(e})p -74
+4256 373 4 v -76 4369 4 113 v -24 4335 a Fe(\\phyp)p
+296 4369 V -74 4372 373 4 v 109 4546 a Fh(Prints)22 b(a)h(\(part)g(of)f
+(a\))i(wor)n(d)e(in)h(par)n(enthesis,)e(ended)f(by)j(a)g(hypen,)e(like)
+i(\(love-\)letter)-7 b(.)192 4699 y Fk(\\newcommand{\\p)o(hy)o(p}[)o
+(1])301 4812 y({\(#1\\textormat)o(h{\\)o(le)o(av)o(ev)o(mo)o(de\\)o(hb)
+o(ox)o({-)o(}})o({-)o(}\)\\)o(hs)o(ki)o(p\\)o(z@)o(ski)o(p})p
+-74 5074 427 4 v -76 5187 4 113 v -24 5154 a Fe(\\arrow)p
+351 5187 V -74 5191 427 4 v 109 5365 a Fh(Prints)22 b(an)h(arr)n(ow:)g
+Fm(!)q Fh(.)192 5518 y Fk(\\newcommand{\\a)o(rr)o(ow})o({\\)o(en)o(su)o
+(re)o(mat)o(h{)o(\\r)o(ig)o(ht)o(ar)o(row)o(}\\)o(xs)o(pa)o(ce)o(})p
+eop
+%%Page: 13 14
+13 13 bop 109 -62 a Fq(3.2)99 b(General)24 b(Commands)h(and)g(Envir)n
+(onments)1495 b Ft(13)p 109 -10 3544 4 v -74 174 264
+4 v -76 287 4 113 v -24 253 a Fe(\\f)p 187 287 V -76
+400 V -24 366 a(\\ff)p 187 400 V -74 403 264 4 v 109
+575 a Fh(Print)22 b(the)g(abbr)n(eviations)i(for)f(`the)f(following)h
+(page\(s\)')f(\(`f')i(r)n(esp.)d(`f)n(f')j(after)f(a)g(small)h
+(space\).)192 736 y Fk(\\newcommand{\\f)o(}{)o(\\,f)o(})192
+849 y(\\newcommand{\\f)o(f})o({\\,)o(ff)o(})p -74 1128
+591 4 v -76 1241 4 113 v -24 1208 a Fe(\\distance)p 515
+1241 V -74 1245 591 4 v 109 1419 a Fh(Starts)d(a)i(new)f(un-indented)f
+(paragraph)i(following)g(an)g(empty)e(line.)192 1580
+y Fk(\\newcommand{\\d)o(is)o(tan)o(ce)o(}{)o(\\p)o(ar)o(\\b)o(igs)o(ki)
+o(p\\)o(no)o(in)o(den)o(t})p -74 1859 809 4 v -76 1972
+4 113 v -24 1938 a Fe(\\stardistance)p 733 1972 V -74
+1975 809 4 v 109 2149 a Fh(Starts)g(a)i(new)f(un-indented)f(paragraph)i
+(following)g(thr)n(ee)e(center)n(ed)h(stars.)192 2310
+y Fk(\\newcommand{\\s)o(ta)o(rdi)o(st)o(an)o(ce)o(})301
+2423 y({\\par\\bigskip{)o(\\ce)o(nt)o(er)o(in)o(g)48
+b(*~~~*~~~*\\par}\\b)o(ig)o(sk)o(ip)o(\\n)o(oin)o(de)o(nt)o(})p
+-74 2703 V -76 2815 4 113 v -24 2782 a Fe(\\linedistance)p
+733 2815 V -74 2819 809 4 v 109 2993 a Fh(Starts)21 b(a)i(new)f
+(un-indented)f(paragraph)i(following)g(an)g(horizontal)g(r)o(ule.)192
+3154 y Fk(\\newcommand{\\l)o(in)o(edi)o(st)o(an)o(ce)o(}{)o(\045)301
+3267 y(\\begin{center})301 3379 y(\\begin{tabular)o(}{p)o({0)o(.3)o
+(3\\)o(te)o(xt)o(wid)o(th)o(}})301 3492 y(\\hrule)301
+3605 y(\\end{tabular})301 3718 y(\\end{center})301 3831
+y(\\medskip\\noind)o(ent)o(\045)192 3944 y(})p -74 4224
+624 4 v -76 4336 4 113 v -24 4303 a Fe(\\sig{)p Fg(name)m
+Fe(})p 548 4336 V -74 4340 624 4 v 109 4514 a Fh(Prints)f(<)p
+Fg(name)p Fh(>)h(as)f(signatur)n(e)g(\(\003ushright)g(in)h(italics\).)
+192 4675 y Fk(\\newcommand{\\s)o(ig)o(}[1)o(]{)o(\\p)o(ar)o({\\)o(ra)o
+(gge)o(dl)o(ef)o(t\\)o(em)o(ph{)o(#1)o(}\\)o(pa)o(r})o(})p
+-74 4954 678 4 v -76 5067 4 113 v -24 5033 a Fe(\\intro{)p
+Fg(text)n Fe(})p 601 5067 V -74 5070 678 4 v 109 5244
+a Fh(<)p Fg(text)q Fh(>)g(is)g(center)n(ed)e(in)i(an)g(extra)f
+(paragraph,)g(using)g(a)i(bold)e(font.)g(Followed)g(by)g(some)g(space.)
+192 5405 y Fk(\\newcommand{\\i)o(nt)o(ro})o([1)o(]{)o({\\)o(pa)o(r\\)o
+(cen)o(te)o(ri)o(ng)o(\\t)o(ext)o(bf)o({#)o(1})o(\\p)o(ar})301
+5518 y(\\medskip\\noind)o(ent)o(\\i)o(gn)o(or)o(es)o(pa)o(ces)o(})p
+eop
+%%Page: 14 15
+14 14 bop 109 -62 a Ft(14)1941 b Fq(3)99 b(Commands)25
+b(and)g(Envir)n(onments)p 109 -10 3544 4 v -74 191 623
+4 v -76 304 4 113 v -24 270 a Fe(\\hint{)p Fg(text)n
+Fe(})p 547 304 V -74 307 623 4 v 109 481 a Fh(<)p Fg(text)q
+Fh(>)e(is)g(center)n(ed)e(in)i(an)g(extra)f(paragraph,)g(using)g(a)i
+(lar)n(ge)f(font.)192 621 y Fk(\\newcommand{\\h)o(in)o(t}[)o(1])o({{)o
+(\\p)o(ar)o(\\ce)o(nt)o(er)o(in)o(g\\)o(LA)o(RGE)48 b(#1\\par})301
+734 y(\\noindent\\igno)o(res)o(pa)o(ce)o(s})p -74 964
+569 4 v -76 1077 4 113 v -24 1043 a Fe(\\cen{)p Fg(text)o
+Fe(})p 492 1077 V -74 1080 569 4 v 109 1254 a Fh(An)22
+b(alternative)h(to)f(the)g Fe(center)e Fh(envir)n(onment)i(using)g
+(less)g(space)g(befor)n(e)g(and)h(after)-7 b(.)192 1393
+y Fk(\\newcommand{\\c)o(en)o(}[1)o(])301 1506 y({{\\par\\centeri)o(ng)
+48 b(#1\\par}\\noinden)o(t\\)o(ig)o(no)o(res)o(pa)o(ce)o(s})p
+-74 1736 896 4 v -76 1849 4 113 v -24 1815 a Fe(\\marginbox{)p
+Fg(text)l Fe(})p 820 1849 V -74 1853 896 4 v 109 2026
+a Fh(A)22 b(text)g(in)h(a)g(box,)f(set)g(out)f(into)i(the)f(mar)n(gin.)
+h(Lines)f(ar)n(e)h(divided)f(by)g Fe(\\\\)p Fh(.)192
+2166 y Fk(\\newcommand{\\m)o(ar)o(gin)o(bo)o(x})o([1)o(]\045)301
+2279 y({\\par\\small\\ad)o(dvs)o(pa)o(ce)o({4)o(.5)o(ex)48
+b(plus)53 b(1ex}\045)355 2392 y(\\vskip)f(-\\parskip)193
+2505 y Fm(h)q Fl(hca)m(rt)19 b Fm(j)g Fl(hcletter)h Fm(j)f
+Fl(hcrep)s(o)m(rt)r Fm(i)165 b Fk(\\noindent\\hspac)o(e{)o(-.)o(75)o
+(\\le)o(ft)o(ma)o(rg)o(in)o(i}\045)193 2618 y Fm(h)q
+Fl(hcslides)p Fm(i)g Fk(\\noindent)355 2731 y(\\begin{tabular}{)o(|l)o
+(|})o(\\h)o(li)o(ne\\)o(ig)o(no)o(re)o(sp)o(ac)o(es)355
+2844 y(#1)355 2957 y(\\\\\\hline\\end{tab)o(ul)o(ar)o(}\\)o(no)o(bre)o
+(ak)o(\\p)o(ar)o(\\n)o(ob)o(rea)o(k)355 3069 y(\\vspace{2.3ex}\\v)o(sk)
+o(ip)48 b(-\\parskip\\noin)o(de)o(nt\\)o(ig)o(no)o(re)o(sp)o(ace)o(s})p
+-74 3299 809 4 v -76 3412 4 113 v -24 3378 a Fe(\\rightaddress)p
+733 3412 V -74 3416 809 4 v 109 3590 a Fh(Like)17 b(the)g
+Fe(\\verse)f Fh(envir)n(onment,)h(but)h(moved)f(to)h(the)f(right)h(as)g
+(far)h(as)f(possible.)f(Lines)g(ar)n(e)i(divided)109
+3702 y(by)j Fe(\\\\)p Fh(.)192 3842 y Fk(\\newcommand{\\r)o(ig)o(hta)o
+(dd)o(re)o(ss)o(}[)o(1]{)o(\045)301 3955 y(\\par\\medskip)301
+4068 y({\\raggedleft)49 b(\\begin{tabular})o({l)o(}\\)o(ig)o(no)o(re)o
+(spa)o(ce)o(s)301 4181 y(#1)301 4294 y(\\end{tabular})301
+4407 y(\\medskip\\par}\\)o(noi)o(nd)o(en)o(t\\)o(ig)o(nor)o(es)o(pa)o
+(ce)o(s\045)192 4520 y(})p -74 4750 700 4 v -76 4862
+4 113 v -24 4829 a Fe(\\shorttoday)p 624 4862 V -74 4866
+700 4 v 109 5040 a Fh(Prints)22 b(the)g(short)f(form)i(\(YY/MM/DD\))g
+(of)g(the)f(curr)n(ent)g(date)g(\()p Fe(\\today)p Fh(\).)192
+5179 y Fk(\\newcounter{sh)o(or)o(tye)o(ar)o(})192 5292
+y(\\setcounter{sh)o(or)o(tye)o(ar)o(}{)o(\\t)o(he)o(\\ye)o(ar)o(})192
+5405 y(\\addtocounter{)o(sh)o(ort)o(ye)o(ar)o(}{)o(-1)o(900)o(})192
+5518 y(\\whiledo{\\thes)o(ho)o(rty)o(ea)o(r>)o(99)o(}{)o(\\ad)o(dt)o
+(oc)o(ou)o(nt)o(er)o({sh)o(or)o(ty)o(ea)o(r})o({-1)o(00)o(}})p
+eop
+%%Page: 15 16
+15 15 bop 109 -62 a Fq(3.2)99 b(General)24 b(Commands)h(and)g(Envir)n
+(onments)1495 b Ft(15)p 109 -10 3544 4 v 192 270 a Fk(\\newcommand{\\s)
+o(ho)o(rtt)o(od)o(ay)o(})301 383 y({\\two@digits{\\)o(the)o(sh)o(or)o
+(ty)o(ea)o(r})o(/\\t)o(he)o(\\m)o(on)o(th)o(/\\t)o(he)o(\\d)o(ay)o(\\x)
+o(spa)o(ce)o(})p -74 665 864 4 v -76 777 4 113 v -24
+744 a Fe(\\begin{dialog})p 787 777 V -74 781 864 4 v
+109 955 a Fh(An)27 b(envir)n(onment)g(for)g(dialogues)f(and)i(scr)n
+(eenplay-like)f(scenes.)e(Use)h(the)h Fe(\\newspeaker)22
+b Fh(com-)109 1068 y(mand)h(to)f(make)g(the)g(persons)e(you)i(want)h
+(to)f(use)f(in)i(the)f(dialogues.)192 1229 y Fk(\\newenvironmen)o(t{)o
+(dia)o(lo)o(g})301 1342 y({\\begin{flexli)o(st})o([\\)o(no)o(rm)o(al)o
+(fo)o(nt\\)o(em)o(ph)o({:)o(}])o({i})464 1455 y(\\setlength{\\item)o
+(se)o(p})o({0)o(ex)o(}})301 1568 y({\\end{flexlist)o(}})192
+1681 y(\\makeatletter)p -74 1963 2055 4 v -76 2075 4
+113 v -24 2042 a Fe(\\newspeaker{)p Fg(command-name)-5
+b Fe(}{)p Fg(speaker)s(')g(s-name)s Fe(})p 1978 2075
+V -74 2079 2055 4 v 109 2253 a Fh(Pr)n(oduces)26 b(the)h(command)h(<)p
+Fg(command-name)q Fh(>)g(to)f(mark)h(the)f(speeches)f(of)h(<)p
+Fg(speaker)s(')-5 b(s-name)t Fh(>)28 b(in)h(a)109 2366
+y(dialogue.)22 b(<)p Fg(command-name)p Fh(>)h(must)f(begin)g(with)h(a)g
+(backslash,)g(like)g(all)h(commands.)109 2479 y(Then)18
+b(the)h(command)h(<)p Fg(command-name)p Fh(>)g(may)g(be)f(called)h(in)g
+(a)g Fe(dialog)d Fh(envir)n(onment)i(as)g(follows:)109
+2591 y Fe(command-name\\o)o(ar)o(g{)o(opt)o(io)o(na)o(l-)o(ex)o(pla)o
+(na)o(ti)o(on)o(}\\)o(arg)o({s)o(pe)o(ec)o(h-)o(con)o(tr)o(ib)o(ut)o
+(io)o(n})192 2753 y Fk(\\newcommand{\\n)o(ew)o(spe)o(ak)o(er)o(}[)o(2])
+o({\\)o(new)o(co)o(mm)o(an)o(d{)o(#1})o([2)o(][)o(])301
+2866 y({\\item[\\normal)o(fon)o(t\\)o(em)o(ph)o({#)o(2\\)o(ift)o(he)o
+(ne)o(ls)o(e{)o(\\eq)o(ua)o(l{)o(##)o(1})o({}})464 2979
+y({}{)54 b(\(##1\)}}])d(##2}})p -74 3261 1500 4 v -76
+3373 4 113 v -24 3340 a Fe(\\enge{)p Fg(English)20 b(text)r
+Fe(}{)p Fg(German)i(text)q Fe(})p 1424 3373 V -74 3377
+1500 4 v 109 3551 a Fh(Prints)g Fe({)p Fg(English)h(text)q
+Fe(})p Fh(.)f(W)-5 b(ith)23 b(the)f Fe(german)e Fh(option,)h(<)p
+Fg(German)i(text)q Fh(>)g(is)g(printed)e(instead.)192
+3712 y Fk(\\newcommand{\\e)o(ng)o(e}[)o(2])o({#)o(1})109
+3874 y Fh(Some)h(language)g(speci\002c)h(texts.)192 4036
+y Fk(\\newcommand{\\v)o(er)o(sio)o(nt)o(ex)o(t})o({V)o(er)o(sio)o(n)48
+b(date:})192 4149 y(\\newcommand{\\o)o(nl)o(ine)o(te)o(xt)o(}{)o(On)o
+(li)o(ne:)o(})192 4262 y(\\newcommand{\\a)o(cc)o(ess)o(te)o(xt)o(}{)o
+(Ac)o(ce)o(ss)g(date:})192 4375 y(\\newcommand{\\c)o(ft)o(ext)o(}{)o
+(cf)o(.})192 4488 y(\\newcommand{\\b)o(ib)o(vol)o(te)o(xt)o(}{)o(of)o
+(})192 4601 y(\\newcommand{\\b)o(vt)o(ext)o(}{)o(vo)o(l.)o(})192
+4713 y(\\newcommand{\\b)o(ib)o(dir)o(}{)o(Di)o(re)o(ct)o(or)g(})192
+4826 y(\\newcommand{\\b)o(ib)o(mov)o(te)o(xt)o(}{)o(Mo)o(vi)o(e})192
+4939 y(\\newcommand{\\b)o(ib)o(act)o(or)o(sb)o(ef)o(or)o(e})o({Wi)o(th)
+o(})192 5052 y(\\newcommand{\\b)o(ib)o(act)o(or)o(sa)o(ft)o(er)o(}{)o
+(et~)o(al)o(})192 5165 y(\\newcommand{\\n)o(oy)o(ear)o(}{)o(n.)o(d.)o
+(})192 5278 y(\\newcommand{\\n)o(oa)o(ddr)o(es)o(s})o({n)o(.p)o(.})192
+5391 y(\\newcommand{\\o)o(th)o(era)o(bs)o(tr)o(ac)o(tn)o(am)o(e}{)o(Zu)
+o(sa)o(mm)o(en)o(fas)o(su)o(ng)o(})192 5504 y(\\newcommand{\\k)o(ey)o
+(wor)o(ds)o(na)o(me)o(}{)o(Ke)o(ywo)o(rd)o(s})p eop
+%%Page: 16 17
+16 16 bop 109 -62 a Ft(16)1941 b Fq(3)99 b(Commands)25
+b(and)g(Envir)n(onments)p 109 -10 3544 4 v 109 270 a
+Fr(3.2.1)100 b(The)28 b(palatino)f(option)192 448 y Fk(\\if@palatino)
+301 561 y(\\RequirePackag)o(e{p)o(al)o(at)o(in)o(o})301
+674 y(\\RequirePackag)o(e{m)o(at)o(hp)o(pl)o(e})192 787
+y(\\fi)109 962 y Fr(3.2.2)100 b(The)28 b(ding)f(option)192
+1140 y Fk(\\if@ding)355 1253 y(\\RequirePackage{)o(pi)o(fo)o(nt)o(})p
+-74 1484 373 4 v -76 1597 4 113 v -24 1563 a Fe(\\tick)p
+296 1597 V -74 1600 373 4 v 109 1774 a Fh(Prints)22 b(a)h(tick.)355
+1888 y Fk(\\newcommand{\\tic)o(k})o({\\)o(di)o(ng)o({52)o(}})p
+-74 2120 427 4 v -76 2233 4 113 v -24 2199 a Fe(\\cross)p
+351 2233 V -74 2236 427 4 v 109 2410 a Fh(Prints)f(a)h(cr)n(oss.)355
+2524 y Fk(\\newcommand{\\cro)o(ss)o(}{)o(\\d)o(in)o(g{5)o(6})o(})p
+-74 2755 591 4 v -76 2868 4 113 v -24 2834 a Fe(\\checkbox)p
+515 2868 V -74 2872 591 4 v 109 3046 a Fh(Prints)f(a)h(checkbox.)355
+3160 y Fk(\\newcommand{\\che)o(ck)o(bo)o(x})o({\\)o(din)o(g{)o(11)o(4})
+o(})p -74 3391 973 4 v -76 3504 4 113 v -24 3470 a Fe(\\begin{ticklis)o
+(t})p 896 3504 V -74 3507 973 4 v 109 3681 a Fh(A)f(item)h(envir)n
+(onment)f(which)h(uses)e(a)i(tick)g(as)g(label)h(\(e.g.)d(for)i(lists)f
+(of)h(do's\).)355 3795 y Fk(\\newenvironment{)o(ti)o(ck)o(li)o(st)o(})
+410 3908 y({\\begin{dinglis)o(t})o({5)o(2})o(}{)o(\\en)o(d{)o(di)o(ng)o
+(li)o(st)o(}})p -74 4140 1027 4 v -76 4252 4 113 v -24
+4219 a Fe(\\begin{crossli)o(st)o(})p 951 4252 V -74 4256
+1027 4 v 109 4430 a Fh(A)f(item)h(envir)n(onment)f(which)h(uses)e(a)i
+(cr)n(oss)g(as)f(label)i(\(e.g.)e(for)g(lists)h(of)f(don't\).)355
+4544 y Fk(\\newenvironment{)o(cr)o(os)o(sl)o(is)o(t})410
+4657 y({\\begin{dinglis)o(t})o({5)o(6})o(}{)o(\\en)o(d{)o(di)o(ng)o(li)
+o(st)o(}})p -74 4888 V -76 5001 4 113 v -24 4967 a Fe(\\begin{checkli)o
+(st)o(})p 951 5001 V -74 5004 1027 4 v 109 5178 a Fh(A)g(item)h(envir)n
+(onment)f(which)h(uses)e(a)i(checkbox)g(as)f(label)i(\(e.g.)e(for)g
+(check)h(lists\).)355 5292 y Fk(\\newenvironment{)o(ch)o(ec)o(kl)o(is)o
+(t})410 5405 y({\\begin{dinglis)o(t})o({1)o(14)o(}})o({\\e)o(nd)o({d)o
+(in)o(gl)o(is)o(t}})192 5518 y(\\fi)p eop
+%%Page: 17 18
+17 17 bop 109 -62 a Fq(3.2)99 b(General)24 b(Commands)h(and)g(Envir)n
+(onments)1495 b Ft(17)p 109 -10 3544 4 v 109 270 a Fr(3.2.3)100
+b(The)28 b(eur)n(o)f(option)p -74 518 209 4 v -76 631
+4 113 v -24 598 a Fe(\\E)p 133 631 V -74 635 209 4 v
+109 809 a Fh(Prints)22 b(the)g(Eur)n(o)g(symbol)29 b
+Fd(C)p 1055 771 53 2 v 1055 784 48 2 v -1 w Fh(.)p -74
+1057 570 4 v -76 1170 4 113 v -24 1136 a Fe(\\Es{)p Fg(value)o
+Fe(})p 493 1170 V -74 1173 570 4 v 109 1347 a Fh(Prints)22
+b(the)g(Eur)n(o)g(symbol)g(followed)g(by)h(<)p Fg(value)q
+Fh(>.)192 1495 y Fk(\\if@euro)355 1608 y(\\RequirePackage[)o(ri)o(gh)o
+(t,)o(no)o(te)o(xtc)o(om)o(p])o({e)o(ur)o(ofo)o(nt)o(})355
+1720 y(\\newcommand{\\E}{)o(\\t)o(ex)o(ts)o(f{)o(\\m)o(ake)o(fa)o(ke)o
+(li)o(gh)o(teu)o(ro)o(}\\)o(xs)o(pa)o(ce})355 1833 y
+(\\newcommand{\\Es})o([1)o(]{)o(\\E)o(\\n)o(ob)o(rea)o(k\\)o(,#)o(1})
+192 1946 y(\\fi)109 2232 y Fr(3.2.4)100 b(The)28 b(fanc)o(yref)h
+(option)109 2418 y Fh(Loads)j(the)h Fe(fancyref)e Fh(package)i(which)i
+(pr)n(ovides)e(the)g(command)h Fe(\\fref{)p Fg(pr)n(e\002x:labelname)q
+Fe(})p Fh(.)109 2531 y(This)25 b(prints)g(not)g(only)h(the)f(number)-7
+b(,)26 b(but)f(also)i(the)e(type)f(of)i(a)g(r)n(efer)n(ence.)f(The)g
+(following)i(pr)n(e\002xes)109 2644 y(\(types\))d(ar)n(e)i(r)n
+(ecognized:)f Fe(chap)f Fh(\(Chapter\),)h Fe(sec)g Fh(\(Section\),)g
+Fe(eq)g Fh(\(Equation\),)h Fe(fig)e Fh(\(Figur)n(e\),)h
+Fe(tab)109 2757 y Fh(\(T)-8 b(able\),)30 b Fe(enum)e
+Fh(\(Enumeration\),)h Fe(fn)g Fh(\(Footnote\).)e(At)i(the)g(beginning)h
+(of)f(a)i(sentence)d(use)g Fe(\\Fref)109 2870 y Fh(instead,)21
+b(which)i(gives)g(upper)n(-case)e(output)g(\(in)j(German)f(documents)e
+(ther)n(e)g(is)i(no)f(dif)n(fer)n(ence\).)192 3017 y
+Fk(\\if@fancyref)301 3130 y(\\RequirePackag)o(e{f)o(an)o(cy)o(re)o(f})
+192 3243 y(\\fi)p -74 3492 749 4 v -76 3604 4 113 v -24
+3571 a Fe(\\see{)p Fg(r)n(efer)n(ence)p Fe(})p 673 3604
+V -74 3608 749 4 v 109 3782 a Fh(Prints)g(`see)f(<)p
+Fg(r)n(efer)n(ence)s Fh(>')i(in)g(a)h(footnote,)c(using)i(the)g
+Fe(\\fref)e Fh(command)j(to)f(print)h(<)p Fg(r)n(efer)n(ence)r
+Fh(>.)192 3929 y Fk(\\newcommand{\\s)o(ee)o(tex)o(t})o({s)o(ee)o(})192
+4042 y(\\newcommand{\\s)o(ee)o(}[1)o(]{)o(\\f)o(oo)o(tn)o(ot)o(e{\\)o
+(se)o(et)o(ex)o(t\\)48 b(\\fref{#1}}})109 4328 y Fr(3.2.5)100
+b(The)28 b(html)f(option)p -74 4577 1198 4 v -76 4689
+4 113 v -24 4656 a Fe(\\htlink{)p Fg(linked)20 b(text)q
+Fe(}{)p Fg(url)p Fe(})p 1121 4689 V -74 4693 1198 4 v
+109 4867 a Fh(Prints)k(<)p Fg(linked)h(text)q Fh(>)h(followed)e(by)i
+(the)e(<)p Fg(url)p Fh(>.)i(W)-5 b(ith)25 b(the)g Fe(paper)e
+Fh(option,)h(a)i(footnote)d(is)j(used.)d(In)109 4980
+y(the)e(HTML)h(version)g(<)p Fg(linked)i(text)r Fh(>)e(becomes)g(an)h
+(active)h(link)f(to)f(<)p Fg(url)p Fh(>.)p -74 5228 648
+4 v -76 5341 4 113 v -24 5307 a Fe(\\hturl{)p Fg(url)m
+Fe(})p 571 5341 V -74 5344 648 4 v 109 5518 a Fh(Prints)g(<)p
+Fg(url)p Fh(>)h(nice)g(and)f(makes)h(it)f(an)h(active)h(link)f(in)g
+(the)f(HTML)g(version.)p eop
+%%Page: 18 19
+18 18 bop 109 -62 a Ft(18)1941 b Fq(3)99 b(Commands)25
+b(and)g(Envir)n(onments)p 109 -10 3544 4 v -74 191 1009
+4 v -76 304 4 113 v -24 270 a Fe(\\htmail{)p Fg(mail-adr)n(ess)o
+Fe(})p 932 304 V -74 307 1009 4 v 109 481 a Fh(Prints)d(<)p
+Fg(mail-adr)n(ess)s Fh(>)h(nice)g(and)g(makes)f(it)h(an)g(active)g
+(email)h(link)f(in)g(the)f(HTML)g(version.)192 633 y
+Fk(\\if@html)193 746 y Fm(h)r Fi(=)q Fl(class)q Fm(i)193
+859 y(h)r(\003)q Fl(hcletter)s Fm(i)301 972 y Fk(\\newcounter{pa)o(rt})
+301 1085 y(\\newcounter{se)o(cti)o(on)o(})301 1198 y(\\newcounter{su)o
+(bse)o(ct)o(io)o(n})301 1311 y(\\newcounter{su)o(bsu)o(bs)o(ec)o(ti)o
+(on)o(})301 1424 y(\\newcounter{pa)o(rag)o(ra)o(ph)o(})301
+1537 y(\\newcommand{\\p)o(art)o(}{)o(})301 1650 y(\\newcommand{\\s)o
+(ect)o(io)o(n})o({})301 1762 y(\\newcommand{\\s)o(ubs)o(ec)o(ti)o(on)o
+(}{)o(})301 1875 y(\\newcommand{\\s)o(ubs)o(ub)o(se)o(ct)o(io)o(n}{)o
+(})301 1988 y(\\newcommand{\\p)o(ara)o(gr)o(ap)o(h})o({})301
+2101 y(\\newcommand{\\s)o(ubp)o(ar)o(ag)o(ra)o(ph)o(}{})301
+2214 y(\\RequirePackag)o(e{h)o(tm)o(l})301 2327 y(\\newcommand{\\h)o
+(tli)o(nk)o(}[)o(2])410 2440 y({{\\htmladdnorma)o(ll)o(in)o(k{)o(#1)48
+b(\\texttt{<#2>}}{)o(#2)o(}})o(})193 2553 y Fm(h)r Fi(=)q
+Fl(hcletter)s Fm(i)193 2666 y(h)r(\003)q Fl(hca)m(rt)19
+b Fm(j)g Fl(hcrep)s(o)m(rt)h Fm(j)f Fl(hcslides)q Fm(i)301
+2779 y Fk(\\RequirePackag)o(e{h)o(tm)o(l})301 2892 y(\\if@paper)410
+3004 y(\\newcommand{\\ht)o(li)o(nk)o(}[)o(2])519 3117
+y({\\htmladdnormal)o(li)o(nk)o({#)o(1}{)o(#2)o(}\045)574
+3230 y(\\footnote{\\htm)o(la)o(dd)o(no)o(rma)o(ll)o(in)o(k{)o(\\t)o(ex)
+o(ttt)o({#)o(2})o(}{)o(#2)o(}}})301 3343 y(\\else)410
+3456 y(\\newcommand{\\ht)o(li)o(nk)o(}[)o(2])519 3569
+y({{\\htmladdnorma)o(ll)o(in)o(k{)o(#1)48 b(\\texttt{<#2>}}{)o(#2)o(}})
+o(})301 3682 y(\\fi)193 3795 y Fm(h)r Fi(=)q Fl(hca)m(rt)19
+b Fm(j)g Fl(hcrep)s(o)m(rt)h Fm(j)f Fl(hcslides)q Fm(i)193
+3908 y(h)r(\003)q Fl(class)q Fm(i)301 4021 y Fk(\\newcommand{\\h)o(tur)
+o(l})o([1)o(])410 4134 y({{\\htmladdnorma)o(ll)o(in)o(k{)o(\\t)o(ext)o
+(tt)o({#)o(1})o(}{)o(#1)o(}}})301 4246 y(\\newcommand{\\h)o(tma)o(il)o
+(}[)o(1])410 4359 y({{\\htmladdnorma)o(ll)o(in)o(k{)o(\\t)o(ext)o(tt)o
+({#)o(1})o(}{)o(ma)o(ilt)o(o:)o(#1)o(}})o(})192 4472
+y(\\fi)193 4585 y Fm(h)r Fi(=)q Fl(class)q Fm(i)109 4913
+y Ff(3.3)120 b(Commands)36 b(and)d(En)-5 b(vir)n(onments)35
+b(f)n(or)d(the)h(hcar)r(t)h(and)g(hcrepor)r(t)394 5063
+y(c)n(lasses)109 5253 y Fh(The)26 b(default)g(depth)f(of)i(section)f
+(numbering)g(and)h(table)g(of)g(contents)e(is)i(thr)n(ee.)e
+Fe(headings)e Fh(is)k(the)109 5366 y(default)19 b(page)g(style.)g(The)g
+(page)g(number)h(is)g(printed)e(in)j(the)e(header)g(line,)h(the)f
+(footer)f(line)j(is)f(empty)-10 b(.)193 5518 y Fm(h)r(\003)q
+Fl(hca)m(rt)19 b Fm(j)g Fl(hcrep)s(o)m(rt)r Fm(i)p eop
+%%Page: 19 20
+19 19 bop 109 -62 a Fq(3.3)99 b(Commands)25 b(and)f(Envir)n(onments)j
+(for)e(the)g(hcart)h(and)f(hcr)n(eport)h(classes)389
+b Ft(19)p 109 -10 3544 4 v 192 270 a Fk(\\setcounter{se)o(cn)o(umd)o
+(ep)o(th)o(}{)o(3})192 383 y(\\setcounter{to)o(cd)o(ept)o(h})o({3)o(})
+192 496 y(\\RequirePackag)o(e[)o(bre)o(ak)o(wo)o(rd)o(s])o({t)o(run)o
+(ca)o(te)o(})192 609 y(\\newlength{\\ri)o(gh)o(tma)o(rk)o(le)o(ng)o(th)
+o(})192 722 y(\\def\\ps@headin)o(gs)o({\\l)o(et)o(\\@)o(mk)o(bo)o(th)o
+(\\ma)o(rk)o(bo)o(th)301 835 y(\\def\\@evenhead)o({\\v)o(bo)o(x{)o(\\h)
+o(si)o(ze)o(=\\t)o(ex)o(tw)o(id)o(th)410 948 y(\\hb@xt@)51
+b(\\textwidth{\045)410 1061 y({\\pnumfont\\thep)o(ag)o(e\\)o(hf)o(il)o
+(\\h)o(ead)o(fo)o(nt)o(\\t)o(ru)o(nca)o(te)o({0)o(.9)o(2\\)o(tex)o(tw)o
+(id)o(th)o(}\045)519 1173 y({\\raggedleft\\st)o(ru)o(t\\)o(le)o(ft)o
+(mar)o(k})o(}})o(\045)410 1286 y(\\if@hsl)g(\\vskip)h(1.5\\p@)g
+(\\hrule)g(\\fi}})301 1399 y(\\def\\@oddhead{)o(\\se)o(tt)o(ow)o(id)o
+(th)o({\\)o(rig)o(ht)o(ma)o(rk)o(le)o(ngt)o(h})o({\\)o(ri)o(gh)o(tma)o
+(rk)o(}\045)355 1512 y(\\vbox{\\hsize=\\te)o(xt)o(wi)o(dt)o(h)410
+1625 y(\\hb@xt@)f(\\textwidth{{\\he)o(ad)o(fon)o(t\\)o(tr)o(un)o(ca)o
+(te{)o(0.)o(92)o(\\t)o(ex)o(twi)o(dt)o(h})o(\045)519
+1738 y({\\strut\\ifthene)o(ls)o(e{)o(\\l)o(en)o(gth)o(te)o(st)o({\\)o
+(ri)o(ght)o(ma)o(rk)o(le)o(ng)o(th=)o(0e)o(m})o(}\045)574
+1851 y({\\leftmark{}}{)o(\\r)o(ig)o(ht)o(ma)o(rk{)o(}})o(\045)574
+1964 y(\\hfil}\\hfil\\pn)o(um)o(fo)o(nt)o(\\t)o(hep)o(ag)o(e})o(}\045)
+410 2077 y(\\if@hsl)g(\\vskip)h(1.5\\p@)g(\\hrule)g(\\fi}})301
+2190 y(\\def\\@evenfoot)o({\\v)o(bo)o(x{)o(\\h)o(si)o(ze)o(=\\t)o(ex)o
+(tw)o(id)o(th)410 2303 y(\\if@fsl)f(\\hrule)h(\\vskip)g(3\\p@)h(\\fi)
+410 2415 y(\\hb@xt@)e(\\textwidth{{\\pn)o(um)o(fon)o(t\\)o(hf)o(il)o
+(}})o(}}\045)301 2528 y(\\def\\@oddfoot{)o(\\vb)o(ox)o({\\)o(hs)o(iz)o
+(e=)o(\\te)o(xt)o(wi)o(dt)o(h)410 2641 y(\\if@fsl)g(\\hrule)h(\\vskip)g
+(3\\p@)h(\\fi)410 2754 y(\\hb@xt@)e(\\textwidth{{\\pn)o(um)o(fon)o(t\\)
+o(hf)o(il)o(}})o(}}\045)193 2867 y Fm(h)q Fl(hcrep)s(o)m(rt)r
+Fm(i)110 b Fk(\\def\\chapterma)o(rk)o(##1)o({\045)193
+2980 y Fm(h)q Fl(hcrep)s(o)m(rt)r Fm(i)164 b Fk(\\markboth)51
+b({\\ifnum)g(\\c@secnumdepth)d(>\\m@ne)193 3093 y Fm(h)q
+Fl(hcrep)s(o)m(rt)r Fm(i)437 b Fk(\\chaptermarkfor)o(ma)o(t\\)o(fi)193
+3206 y Fm(h)q Fl(hcrep)s(o)m(rt)r Fm(i)g Fk(##1}{}}\045)193
+3319 y Fm(h)q Fl(hcrep)s(o)m(rt)r Fm(i)110 b Fk(\\def\\sectionma)o(rk)o
+(##1)o({\045)193 3432 y Fm(h)q Fl(hcrep)s(o)m(rt)r Fm(i)219
+b Fk(\\markright)50 b({\\ifnum)h(\\c@secnumdepth)d(>\\z@)193
+3545 y Fm(h)q Fl(hcrep)s(o)m(rt)r Fm(i)437 b Fk(\\sectionmarkfor)o(ma)o
+(t\\)o(fi)193 3657 y Fm(h)q Fl(hcrep)s(o)m(rt)r Fm(i)g
+Fk(##1}}})193 3770 y Fm(h)q Fl(hca)m(rt)q Fm(i)110 b
+Fk(\\def\\sectionmar)o(k#)o(#1)o({\045)193 3883 y Fm(h)q
+Fl(hca)m(rt)q Fm(i)165 b Fk(\\markboth)50 b({\\ifnum)h(\\c@secnumdepth)
+e(>\\z@\045)193 3996 y Fm(h)q Fl(hca)m(rt)q Fm(i)219
+b Fk(\\sectionmarkfor)o(ma)o(t\\)o(fi)48 b(##1}{}})193
+4109 y Fm(h)q Fl(hca)m(rt)q Fm(i)110 b Fk(\\def\\subsection)o(ma)o(rk)o
+(##)o(1{\045)193 4222 y Fm(h)q Fl(hca)m(rt)q Fm(i)165
+b Fk(\\markright)50 b({\\ifnum)h(\\c@secnumdepth)d(>\\@ne\045)193
+4335 y Fm(h)q Fl(hca)m(rt)q Fm(i)219 b Fk(\\subsectionmark)o(fo)o(rm)o
+(at\\)o(fi)48 b(##1}}})192 4448 y(\\pagestyle{hea)o(di)o(ngs)o(})109
+4727 y Fr(3.3.1)100 b(The)28 b(hcarea)h(option)192 4907
+y Fk(\\if@hcarea)301 5020 y(\\RequirePackag)o(e{t)o(yp)o(ea)o(re)o(a})
+301 5133 y(\\areaset[15mm])o({15)o(0m)o(m})o({2)o(40)o(mm)o(})192
+5246 y(\\fi)109 5430 y Fr(3.3.2)100 b(The)28 b(hcf)n(ootnotes)g(option)
+p eop
+%%Page: 20 21
+20 20 bop 109 -62 a Ft(20)1941 b Fq(3)99 b(Commands)25
+b(and)g(Envir)n(onments)p 109 -10 3544 4 v 192 270 a
+Fk(\\if@hcfootnote)o(s)301 383 y(\\deffootnote{1)o(em})o({0)o(.5)o(em)o
+(})410 496 y({\\textsuperscri)o(pt)o({\\)o(no)o(rm)o(alf)o(on)o(t\\)o
+(th)o(ef)o(oo)o(tno)o(te)o(ma)o(rk)o(}\\)o(,})192 609
+y(\\fi)109 788 y Fr(3.3.3)100 b(The)28 b(ma)o(gazine)f(option)p
+-74 1024 1065 4 v -76 1137 4 113 v -24 1103 a Fe(\\articletitle{)o
+Fg(title)l Fe(})p 988 1137 V -74 1140 1065 4 v 109 1314
+a Fh(Prints)22 b(the)g(article)h(<)p Fg(title)r Fh(>.)p
+-74 1550 1430 4 v -76 1663 4 113 v -24 1629 a Fe(\\subjecttitle{)o
+Fg(subject)-5 b Fe(}{)p Fg(title)q Fe(})p 1353 1663 V
+-74 1667 1430 4 v 109 1841 a Fh(Prints)22 b(befor)n(e)g(the)g(article)h
+(<)p Fg(title)r Fh(>)g(the)f(<)p Fg(subject)q Fh(>)g(in)h(a)h(smaller)f
+(font.)p -74 2077 V -76 2190 4 113 v -24 2156 a Fe(\\titlesubject{)o
+Fg(title)l Fe(}{)p Fg(subject)p Fe(})p 1353 2190 V -74
+2193 1430 4 v 109 2367 a Fh(Prints)f(after)g(the)g(article)i(<)p
+Fg(title)q Fh(>)f(the)f(<)p Fg(subject)q Fh(>)h(in)g(a)g(smaller)g
+(font.)p -74 2603 1315 4 v -76 2716 4 113 v -24 2682
+a Fe(\\articlesectio)o(n{)o Fg(heading)l Fe(})p 1239
+2716 V -74 2719 1315 4 v 109 2893 a Fh(Prints)f(a)h(heading)f(within)h
+(an)g(article)h(\(actually)-10 b(,)23 b(a)h Fe(\\subsection*)p
+Fh(\).)p -74 3130 1412 4 v -76 3242 4 113 v -24 3209
+a Fe(\\begin{art}[)p Fg(signatur)n(e)l Fe(]{)p Fg(title)q
+Fe(})p 1335 3242 V -74 3246 1412 4 v 109 3420 a Fh(A)31
+b(magazine)i(article)g(set)d(in)i(two)f(columns)h(with)g(a)g(<)p
+Fg(title)q Fh(>)g(\(using)g Fe(\\articletitle)p Fh(\))26
+b(and)32 b(an)109 3533 y(optional)22 b(<)p Fg(signatur)n(e)r
+Fh(>)h(\(using)f Fe(\\sig)p Fh(\).)f(Requir)n(es)h(the)g
+Fe(multicol)d Fh(package.)p -74 3769 2104 4 v -76 3882
+4 113 v -24 3848 a Fe(\\begin{artsubt)o(it)o(}[)o Fg(signatur)n(e)l
+Fe(]{)p Fg(subject)p Fe(}{)p Fg(title)q Fe(})p 2028 3882
+V -74 3885 2104 4 v 109 4059 a Fh(Like)i(the)h Fe(art)g
+Fh(envir)n(onment,)g(but)g(uses)f Fe(\\subjecttitle)c
+Fh(instead)22 b(of)g Fe(\\articletitle)p Fh(.)p -74 4295
+V -76 4408 4 113 v -24 4374 a Fe(\\begin{arttits)o(ub)o(}[)o
+Fg(signatur)n(e)l Fe(]{)p Fg(title)q Fe(}{)p Fg(subject)p
+Fe(})p 2028 4408 V -74 4411 2104 4 v 109 4585 a Fh(Like)f(the)h
+Fe(art)g Fh(envir)n(onment,)g(but)g(uses)f Fe(\\titlesubject)c
+Fh(instead)22 b(of)g Fe(\\articletitle)p Fh(.)192 4728
+y Fk(\\if@magazine)301 4841 y(\\RequirePackag)o(e{m)o(ul)o(ti)o(co)o
+(l})301 4954 y(\\newcommand{\\a)o(rti)o(cl)o(et)o(it)o(le)o(}[1)o(])410
+5066 y({\\addsec[#1]{\\L)o(AR)o(GE)48 b(#1}})301 5179
+y(\\newcommand{\\s)o(ubj)o(ec)o(tt)o(it)o(le)o(}[2)o(])410
+5292 y({\\addsec[#2]{{\\)o(la)o(rg)o(e)g(#1}\\\\{\\LARGE)h(#2}}})301
+5405 y(\\newcommand{\\t)o(itl)o(es)o(ub)o(je)o(ct)o(}[2)o(])410
+5518 y({\\addsec[#1]{{\\)o(LA)o(RG)o(E)f(#1}\\\\{\\large)h(#2}}})p
+eop
+%%Page: 21 22
+21 21 bop 109 -62 a Fq(3.4)99 b(Commands)23 b(and)g(Envir)n(onments)i
+(for)f(the)g(hcart,)g(hcr)n(eport)h(and)e(hcslides)17
+b(.)e(.)g(.)198 b Ft(21)p 109 -10 3544 4 v 301 270 a
+Fk(\\newcommand{\\a)o(rti)o(cl)o(es)o(ec)o(ti)o(on)o(}[1)o(]{)o(\\s)o
+(ub)o(se)o(cti)o(on)o(*{)o(#1)o(}})301 383 y(\\newcommand{\\c)o(urr)o
+(en)o(ts)o(ig)o(}{)o(})301 496 y(\\newenvironmen)o(t{@)o(ar)o(t})o([2)o
+(][)o(]{)o(\045)410 609 y(\\begin{multicol)o(s})o({2)o(}[)o(#2)o(])410
+722 y(\\renewcommand{\\)o(cu)o(rr)o(en)o(ts)o(ig)o(}{#)o(1})o(\045)301
+835 y(}{\045)410 948 y(\\ifthenelse{\\eq)o(ua)o(l{)o(\\c)o(ur)o(re)o
+(nts)o(ig)o(}{)o(}})519 1061 y({})519 1173 y({\\sig{\\currents)o(ig)o
+(}})410 1286 y(\\end{multicols})o(\045)301 1399 y(})301
+1512 y(\\newenvironmen)o(t{a)o(rt)o(}[)o(2])o([])410
+1625 y({\\begin{@art}[#)o(1])o({\\)o(ar)o(ti)o(cl)o(eti)o(tl)o(e{)o(#2)
+o(}})o(}{\\)o(en)o(d{)o(@a)o(rt)o(}})301 1738 y(\\newenvironmen)o(t{a)o
+(rt)o(su)o(bt)o(it)o(}[)o(3][)o(])410 1851 y({\\begin{@art}[#)o(1])o
+({\\)o(su)o(bj)o(ec)o(tti)o(tl)o(e{)o(#2)o(}{)o(#3})o(}})o({\\)o(en)o
+(d{)o(@ar)o(t})o(})301 1964 y(\\newenvironmen)o(t{a)o(rt)o(ti)o(ts)o
+(ub)o(}[)o(3][)o(])410 2077 y({\\begin{@art}[#)o(1])o({\\)o(ti)o(tl)o
+(es)o(ubj)o(ec)o(t{)o(#2)o(}{)o(#3})o(}})o({\\)o(en)o(d{)o(@ar)o(t})o
+(})192 2190 y(\\fi)109 2450 y Fr(3.3.4)100 b(The)28 b(par)o(skip)f
+(option)192 2627 y Fk(\\if@parskip)301 2740 y(\\setlength\\par)o(ski)o
+(p{)o(\\m)o(ed)o(sk)o(ip)o(amo)o(un)o(t})301 2852 y(\\setlength\\par)o
+(ind)o(en)o(t{)o(0p)o(t})192 2965 y(\\fi)109 3136 y Fr(3.3.5)100
+b(The)28 b(wide)f(option)192 3313 y Fk(\\if@wide)301
+3426 y(\\linespread{1.)o(3})192 3539 y(\\fi)193 3652
+y Fm(h)r Fi(=)q Fl(hca)m(rt)19 b Fm(j)g Fl(hcrep)s(o)m(rt)r
+Fm(i)109 3852 y Ff(3.4)120 b(Commands)36 b(and)d(En)-5
+b(vir)n(onments)35 b(f)n(or)d(the)h(hcar)r(t,)i(hcrepor)r(t)e(and)394
+4001 y(hcslides)j(c)n(lasses)109 4186 y Fr(3.4.1)100
+b(The)28 b(bib)f(option)109 4363 y Fh(W)-5 b(ith)19 b(the)g
+Fe(fnbib)f Fh(option)h(\(default\),)g(the)g Fe(\\cite)f
+Fh(and)i Fe(\\citet)d Fh(and)i Fe(\\cite)f Fh(commands)i(all)h(work)109
+4476 y(the)g(same.)255 4589 y(W)-5 b(ith)27 b(the)e Fe(autbib)f
+Fh(option,)h Fe(\\cite)g Fh(always)i(works)e(like)i Fe(\\citep)p
+Fh(,)c(i.)15 b(e.)26 b(puts)g(the)f(citation)j(in)109
+4702 y(brackets.)21 b(Use)h Fe(\\citet)e Fh(if)j(you)f(do)g(not)g(want)
+g(this.)255 4815 y(Commands)g(like)g Fe(\\cite)d Fh(should)i(always)h
+(be)f(used)f Fg(without)j Fh(a)f(space)f(between)f(them)h(and)h(the)109
+4928 y(pr)n(eceeding)f(text.)193 5066 y Fm(h)q Fl(class)p
+Fm(i)q Fk(\\newcommand{\\bi)o(bl)o(io)o(st)o(yle)o(}{)o(hc)o(-e)o(n})
+193 5179 y Fm(h)r(\003)q Fl(hca)m(rt)e Fm(j)g Fl(hcrep)s(o)m(rt)h
+Fm(j)f Fl(hcslides)q Fm(i)192 5292 y Fk(\\if@bib)192
+5405 y(\\if@fnbib)301 5518 y(\\bibpunct[,)49 b(]{}{}{;}{a}{}{,)o(})p
+eop
+%%Page: 22 23
+22 22 bop 109 -62 a Ft(22)1941 b Fq(3)99 b(Commands)25
+b(and)g(Envir)n(onments)p 109 -10 3544 4 v 301 270 a
+Fk(\\renewcommand\\)o(NAT)o(@c)o(it)o(e\045)410 383 y
+([3]{\\footnote{\\)o(if)o(NA)o(T@)o(sw)o(a\\N)o(AT)o(@@)o(op)o(en)o
+(\\i)o(f*#)o(2*)o(\\e)o(ls)o(e#)o(2\\)48 b(\\fi)628 496
+y(#1\\if*#3*\\else\\)o(NA)o(T@)o(cmt)o(#3)o(\\f)o(i\\)o(NA)o(T@)o(@cl)o
+(os)o(e\\)o(el)o(se)o(#1\\)o(fi)o(}\\)o(en)o(dg)o(rou)o(p})301
+609 y(\\let\\@cite\\NAT)o(@ci)o(te)192 722 y(\\fi)192
+835 y(\\if@autbib)301 948 y(\\bibpunct[,)h(]{)54 b([}{]}{;}{a}{}{,)o(})
+301 1061 y(\\let\\cite\\cite)o(p)192 1173 y(\\fi)192
+1286 y(\\if@numbib)355 1399 y(\\bibpunct[,)c(]{)k([}{]}{;}{n}{}{)o(,})
+192 1512 y(\\fi)p -74 1744 1134 4 v -76 1857 4 113 v
+-24 1823 a Fe(\\cfcite[)p Fg(pages)n Fe(]{)p Fg(sour)n(ce)p
+Fe(})p 1058 1857 V -74 1860 1134 4 v 109 2034 a Fh(Shortcut)21
+b(for)i Fe(\\cite[)p Fg(cf.)m Fe(][)p Fg(pages)q Fe(]{)p
+Fg(sour)n(ce)p Fe(})p Fh(.)192 2175 y Fk(\\newcommand{\\c)o(fc)o(ite)o
+(}[)o(2])o([])o({\\)o(cit)o(e[)o(\\c)o(ft)o(ex)o(t])o([#1)o(]{)o(#2)o
+(}})p -74 2407 1148 4 v -76 2520 4 113 v -24 2486 a Fe(\\biblio[)p
+Fg(style)n Fe(]{)p Fg(bib)f(\002les)q Fe(})p 1072 2520
+V -74 2523 1148 4 v 109 2697 a Fh(W)-7 b(rites)40 b(the)g(bibliography)
+-10 b(.)40 b(<)p Fg(bib)24 b(\002les)q Fh(>)41 b(is)f(a)i
+(comma-separated)e(list)h(of)f(bib)i(\002les,)e(<)p Fg(style)r
+Fh(>)h(the)109 2810 y(B)m Fc(I)r(B)-5 b Fh(T)269 2840
+y(E)313 2810 y(X)22 b(style)g(\002le)g(\(by)h(default)g
+Fe(hc-en)d Fh(for)j(English)f(documents\).)193 2951 y
+Fm(h)q Fl(hca)m(rt)d Fm(j)g Fl(hcslides)q Fm(i)q Fk(\\if@paper)193
+3063 y Fm(h)q Fl(hca)m(rt)g Fm(j)g Fl(hcslides)q Fm(i)110
+b Fk(\\newcommand{\\b)o(ef)o(or)o(ebi)o(bl)o(io)o(}{)o(\\n)o(ewp)o(ag)o
+(e})193 3176 y Fm(h)q Fl(hca)m(rt)19 b Fm(j)g Fl(hcslides)q
+Fm(i)q Fk(\\else)193 3289 y Fm(h)q Fl(hca)m(rt)g Fm(j)g
+Fl(hcslides)q Fm(i)110 b Fk(\\newcommand{\\b)o(ef)o(or)o(ebi)o(bl)o(io)
+o(}{)o(\\v)o(fil)o(l})193 3402 y Fm(h)q Fl(hca)m(rt)19
+b Fm(j)g Fl(hcslides)q Fm(i)q Fk(\\fi)192 3515 y(\\newcommand{\\b)o(ib)
+o(lio)o(}[)o(2])o([\\)o(bi)o(bli)o(os)o(ty)o(le)o(]{)o(\045)193
+3628 y Fm(h)q Fl(hca)m(rt)g Fm(j)g Fl(hcslides)q Fm(i)110
+b Fk(\\beforebiblio)301 3741 y(\\bibliographys)o(tyl)o(e{)o(#1)o(})301
+3854 y(\\bibliography{)o(#2})o(\045)192 3967 y(})p -74
+4199 1375 4 v -76 4312 4 113 v -24 4278 a Fe(\\qu[)p
+Fg(pages)p Fe(]{)p Fg(sour)n(ce)p Fe(}{)p Fg(quotation)p
+Fe(})p 1299 4312 V -74 4315 1375 4 v 109 4489 a Fh(A)22
+b(<)p Fg(quotation)q Fh(>)h(in)g(quotes)e(followed)h(by)h(the)e(r)n
+(efer)n(ence)h([<)p Fg(sour)n(ce)r Fh(>,)h(<)p Fg(pages)r
+Fh(>].)192 4630 y Fk(\\newcommand{\\q)o(u})o([3])o([])o({\\)o(q{)o(#3)o
+(}\\c)o(it)o(e[)o(#1)o(]{)o(#2)o(}})p -74 4862 1430 4
+v -76 4974 4 113 v -24 4941 a Fe(\\qul[)p Fg(pages)o
+Fe(]{)p Fg(sour)n(ce)q Fe(}{)p Fg(quotation)p Fe(})p
+1354 4974 V -74 4978 1430 4 v 109 5152 a Fh(Like)e Fe(\\qu)h
+Fh(but)g(inside)g(a)i Fe(quote)c Fh(envir)n(onment)i(\(for)h(longer)f
+(quotions\).)192 5292 y Fk(\\newcommand{\\q)o(ul)o(}[3)o(][)o(]{)o(\\b)
+o(eg)o(in{)o(qu)o(ot)o(e})301 5405 y(\\qu[#1]{#2}{#3)o(})301
+5518 y(\\end{quote}})p eop
+%%Page: 23 24
+23 23 bop 109 -62 a Fq(3.4)99 b(Commands)23 b(and)g(Envir)n(onments)i
+(for)f(the)g(hcart,)g(hcr)n(eport)h(and)e(hcslides)17
+b(.)e(.)g(.)198 b Ft(23)p 109 -10 3544 4 v -74 191 1206
+4 v -76 304 4 113 v -24 270 a Fe(\\biburl{)p Fg(url)l
+Fe(}{)p Fg(access)23 b(date)r Fe(})p 1130 304 V -74 307
+1206 4 v 109 481 a Fh(<)p Fg(url)p Fh(>)h(and)h(<)p Fg(access)f(date)q
+Fh(>)h(of)f(online)g(documents.)f(For)g(online-only)h(documents)f(use)g
+(a)k Fc(M)t(A)t(N)t(U)t(A)t(L)109 594 y Fh(entry)19 b(with)i
+Fe(\\biburl)d Fh(in)j(the)h Fc(O)t(R)t(G)t(A)t(N)t(I)t(Z)t(A)o(T)t(I)t
+(O)t(N)27 b Fh(\002eld.)21 b(For)f(other)f(documents)h(put)g(it)h(in)g
+(the)h Fc(N)t(O)t(T)t(E)109 707 y Fh(\002eld.)301 840
+y Fk(\\if@htmlbib)410 953 y(\\newcommand{\\bi)o(bu)o(rl)o(}[)o(2])o
+({\\)o(onl)o(in)o(et)o(ex)o(t\\)o(\\)464 1066 y({\\small\\hturl{#1)o
+(}})o(\\\\)o(\\a)o(cc)o(ess)o(te)o(xt)o(\\)48 b(#2})301
+1179 y(\\else)410 1292 y(\\newcommand{\\bi)o(bu)o(rl)o(}[)o(2])o({\\)o
+(onl)o(in)o(et)o(ex)o(t\\)o(\\)464 1404 y({\\small\\texttt{#)o(1})o
+(}\\)o(\\\\)o(ac)o(ces)o(st)o(ex)o(t\\)g(#2})301 1517
+y(\\fi)p -74 1743 482 4 v -76 1856 4 113 v -24 1822 a
+Fe(\\bibdiv)p 406 1856 V -74 1859 482 4 v 109 2033 a
+Fh(Separator)21 b(between)g(the)h(title)h(and)f(subtitle)g(of)h(a)g
+(document.)355 2166 y Fk(\\newcommand{\\bib)o(di)o(v})o({.)48
+b(})p -74 2392 2344 4 v -76 2505 4 113 v -24 2471 a Fe(\\bibvol[)p
+Fg(separating)21 b(word)q Fe(]{)p Fg(volume)i(number)o
+Fe(}{)p Fg(serial)h(title)r Fe(})p 2267 2505 V -74 2508
+2344 4 v 109 2682 a Fh(Use)e(at)i(the)f(end)g(of)h(the)h
+Fc(T)t(I)t(T)t(L)t(E)j Fh(\002eld)23 b(\(without)g(space)g(befor)n(e\))
+h(if)h(the)e(output)f(of)h(the)i Fc(V)t(O)t(L)t(U)t(M)t(E)k
+Fh(and)111 2795 y Fc(S)t(E)t(R)t(I)t(E)t(S)e Fh(\002elds)21
+b(is)h(not)f(convincing.)i(Inter)n(esting)d(especially)i(for)g(German)g
+(documents)e(wher)n(e)h(`der')109 2908 y(instead)g(of)i(`von')g(is)g
+(used)e(as)i(<)p Fg(separating)j(word)p Fh(>)d(\(English:)f(`of'\).)355
+3041 y Fk(\\newcommand{\\bib)o(vo)o(l})o([3)o(][)o(\\b)o(ibv)o(ol)o(te)
+o(xt)o(])464 3154 y({\\emph{,)51 b(\\bvtext~#2)f(#1})j(#3})p
+-74 3379 536 4 v -76 3492 4 113 v -24 3458 a Fe(\\addrdiv)p
+460 3492 V -74 3495 536 4 v 109 3669 a Fh(Separator)21
+b(between)g(dif)n(fer)n(ent)i(places)g(in)g(a)g(B)m Fc(I)r(B)-5
+b Fh(T)1851 3699 y(E)1895 3669 y(X)22 b(entry's)h Fc(A)t(D)t(D)t(R)t(E)
+t(S)t(S)29 b Fh(\002eld.)355 3802 y Fk(\\newcommand{\\add)o(rd)o(iv)o
+(}{)48 b(--)53 b(})p -74 4028 638 4 v -76 4141 4 113
+v -24 4107 a Fe(\\etal[)p Fg(year)n Fe(])p 562 4141 V
+-74 4144 638 4 v 109 4318 a Fh(Ends)38 b(a)j(list)f(\(e.)14
+b(g.)40 b(of)g(places)g(in)g(a)g(B)m Fc(I)r(B)-5 b Fh(T)1596
+4348 y(E)1640 4318 y(X)40 b(entry's)g Fc(A)t(D)t(D)t(R)t(E)t(S)t(S)47
+b Fh(\002eld\))39 b(which)i(is)f(not)f(complete)109 4431
+y(\(`)23 b(et)f(al'\))q(.)h(A)f(<)p Fg(year)r Fh(>)h(can)g(be)g(given)f
+(which)h(is)g(printed)e(afterwar)n(ds.)192 4564 y Fk(\\newcommand{\\e)o
+(ta)o(l}[)o(1])o([])o({)48 b(et~al\045)301 4677 y(\\ifthenelse{\\e)o
+(qua)o(l{)o(#1)o(}{)o(}})o({})o({.)g(#1}\045)192 4790
+y(})p -74 5004 646 4 v -76 5117 4 113 v -24 5083 a Fe(\\noyear)p
+569 5117 V -76 5230 V -24 5196 a(\\noaddress)p 569 5230
+V -74 5233 646 4 v 109 5405 a Fh(Use)33 b(in)h(the)i
+Fc(Y)t(E)t(A)t(R)h Fh(r)n(esp.)e Fc(A)t(D)t(D)t(R)t(E)t(S)t(S)41
+b Fh(\002eld)33 b(of)i(a)f(B)m Fc(I)r(B)-5 b Fh(T)2021
+5435 y(E)2065 5405 y(X)34 b(entry)f(when)h(no)f(year)h(r)n(esp.)f(addr)
+n(ess)g(is)109 5518 y(known.)p eop
+%%Page: 24 25
+24 24 bop 109 -62 a Ft(24)1941 b Fq(3)99 b(Commands)25
+b(and)g(Envir)n(onments)p 109 -10 3544 4 v 109 270 a
+Fb(The)f(f)n(ollo)o(wing)g(commands)e(are)j(f)n(or)g(mo)n(vie)f
+(databases)e(\(use)k Fa(M)t(A)t(N)t(UA)t(L)j Fb(entr)q(y\):)p
+-74 563 482 4 v -76 675 4 113 v -24 642 a Fe(\\bibdir)p
+406 675 V -74 679 482 4 v 109 853 a Fh(Give)23 b(the)f(dir)n(ector)g
+(in)h(the)h Fc(A)t(U)t(T)t(H)t(O)t(R)i Fh(\002eld)c(in)h(the)f
+(following)h(way:)109 966 y Fe(Surname,)51 b(\\bibdir,)f(Christian)h
+(Name)p -74 1258 1754 4 v -76 1371 4 113 v -24 1337 a(\\bibmov{)p
+Fg(country)l Fe(}{)p Fg(studio)q Fe(}{)p Fg(main)22 b(actors)q
+Fe(})p 1678 1371 V -74 1374 1754 4 v 109 1548 a Fh(Put)g(in)h(the)h
+Fc(O)t(R)t(G)t(A)t(N)t(I)t(Z)t(A)o(T)t(I)t(O)t(N)k Fh(\002eld.)301
+1715 y Fk(\\newcommand{\\b)o(ibm)o(ov)o(}[)o(3])o({\\)o(bib)o(mo)o(vt)o
+(ex)o(t\\)o(bi)o(bdi)o(v\\)48 b(#2,)53 b(#1\\bibdiv\\)410
+1828 y(\\bibactorsbefor)o(e\\)48 b(#3)53 b(\\bibactorsafter)o(})192
+1941 y(\\fi)109 2279 y Fr(3.4.2)100 b(The)28 b(pdf)f(option)192
+2470 y Fk(\\newcommand{\\h)o(yp)o(ert)o(it)o(le)o(}{)o(})192
+2582 y(\\newcommand{\\h)o(yp)o(era)o(ut)o(ho)o(r})o({})192
+2695 y(\\newcommand{\\h)o(yp)o(era)o(bs)o(tr)o(ac)o(t})o({})192
+2808 y(\\newcommand{\\h)o(yp)o(erk)o(ey)o(wo)o(rd)o(s})o({})192
+2921 y(\\if@pdf)301 3034 y(\\AtEndOfClass{)o(\\Re)o(qu)o(ir)o(eP)o(ac)o
+(kag)o(e[)o(hy)o(pe)o(ri)o(nd)o(ex,)o(co)o(lo)o(rl)o(in)o(ks=)o(tr)o
+(ue)o(,)464 3147 y(pdftex,latex2htm)o(l,)o(ex)o(te)o(nsi)o(on)o(=p)o
+(df)o(]{)o(hy)o(per)o(re)o(f})o(})301 3260 y(\\AtBeginDocume)o(nt{)o
+(\045)410 3373 y(\\let\\oldautdiv\\)o(au)o(td)o(iv)410
+3486 y(\\renewcommand{\\)o(au)o(td)o(iv)o(}{)o(,)49 b(})410
+3599 y(\\ifthenelse{\\eq)o(ua)o(l{)o(\\h)o(yp)o(ert)o(it)o(le)o(}{)o
+(}})574 3712 y({\\renewcommand)o({\\)o(hy)o(pe)o(rti)o(tl)o(e})o({\\)o
+(cu)o(rr)o(ent)o(ti)o(tl)o(e})o(}{)o(})410 3824 y(\\ifthenelse{\\eq)o
+(ua)o(l{)o(\\h)o(yp)o(era)o(ut)o(ho)o(r})o({})o(})574
+3937 y({\\renewcommand)o({\\)o(hy)o(pe)o(rau)o(th)o(or)o(}{)o(\\c)o(ur)
+o(ren)o(ta)o(ut)o(ho)o(r})o(}{})410 4050 y(\\ifthenelse{\\eq)o(ua)o(l{)
+o(\\h)o(yp)o(era)o(bs)o(tr)o(ac)o(t})o({})o(})574 4163
+y({\\renewcommand)o({\\)o(hy)o(pe)o(rab)o(st)o(ra)o(ct)o(}{)o(\\a)o
+(bst)o(ex)o(t})o(}{)o(})410 4276 y(\\ifthenelse{\\eq)o(ua)o(l{)o(\\h)o
+(yp)o(erk)o(ey)o(wo)o(rd)o(s})o({})o(})574 4389 y({\\renewcommand)o
+({\\)o(hy)o(pe)o(rke)o(yw)o(or)o(ds)o(}{)o(\\k)o(eyw)o(or)o(ds)o(te)o
+(xt)o(}}{)o(})410 4502 y(\\pdfinfo{)574 4615 y(/Title)i
+(\(\\hypertitle\))574 4728 y(/Author)g(\(\\hyperauthor\))574
+4841 y(/Subject)f(\(\\hyperabstract\))574 4954 y(/Keywords)g
+(\(\\hyperkeywords)o(\))519 5066 y(})519 5179 y(\\let\\autdiv\\old)o
+(au)o(td)o(iv)301 5292 y(})192 5405 y(\\fi)193 5518 y
+Fm(h)r Fi(=)q Fl(hca)m(rt)19 b Fm(j)g Fl(hcrep)s(o)m(rt)h
+Fm(j)f Fl(hcslides)q Fm(i)p eop
+%%Page: 25 26
+25 25 bop 109 -62 a Fq(3.4)99 b(Commands)23 b(and)g(Envir)n(onments)i
+(for)f(the)g(hcart,)g(hcr)n(eport)h(and)e(hcslides)17
+b(.)e(.)g(.)198 b Ft(25)p 109 -10 3544 4 v 109 270 a
+Fr(3.4.3)100 b(Title)27 b(commands)p -74 629 318 4 v
+-76 742 4 113 v -24 708 a Fe(\\toc)p 242 742 V -74 746
+318 4 v 109 920 a Fh(Puts)20 b(the)h(table)i(of)e(contents)f(at)i(the)f
+(end)g(of)h(the)f(curr)n(ent)g(page)g(\(i.e.)h(after)g(a)g(vertical)h
+(\002ll)g(and)e(befor)n(e)109 1032 y(a)j(pagebr)n(eak\).)g(W)-5
+b(ith)24 b(the)f Fe(paper)f Fh(option)h(the)g(table)i(of)f(contents)e
+(is)j(generated)c(automatically)-10 b(,)26 b(so)109 1145
+y Fe(\\toc)21 b Fh(does)g(nothing)g(at)i(all.)193 1340
+y Fm(h)r(\003)q Fl(hca)m(rt)c Fm(j)g Fl(hcslides)q Fm(i)192
+1453 y Fk(\\if@paper)301 1566 y(\\newcommand{\\@)o(toc)o(}{)o(\045)410
+1679 y(\\newpage)193 1792 y Fm(h)q Fl(hca)m(rt)q Fm(i)219
+b Fk(\\thispagestyle{)o(em)o(pt)o(y})193 1905 y Fm(h)q
+Fl(hcslides)p Fm(i)h Fk(\\slidepagestyl)o(e{)o(HC)o(})193
+2018 y Fm(h)q Fl(hca)m(rt)q Fm(i)f Fk(\\if@wide)51 b(\\linespread{1})d
+(\\fi)410 2131 y(\\tableofcontent)o(s)193 2244 y Fm(h)q
+Fl(hca)m(rt)q Fm(i)219 b Fk(\\if@wide)51 b(\\linespread{1.3)o(})d(\\fi)
+410 2357 y(\\newpage\045)301 2470 y(})301 2582 y(\\newcommand{\\t)o
+(oc})o({})192 2695 y(\\else)301 2808 y(\\newcommand{\\@)o(toc)o(}{)o
+(\045)410 2921 y(\\vfill)193 3034 y Fm(h)q Fl(hca)m(rt)q
+Fm(i)219 b Fk(\\thispagestyle{)o(em)o(pt)o(y})193 3147
+y Fm(h)q Fl(hcslides)p Fm(i)h Fk(\\slidepagestyl)o(e{)o(HC)o(})193
+3260 y Fm(h)q Fl(hca)m(rt)q Fm(i)f Fk(\\if@wide)51 b(\\linespread{1})d
+(\\fi)410 3373 y(\\tableofcontent)o(s)193 3486 y Fm(h)q
+Fl(hca)m(rt)q Fm(i)219 b Fk(\\if@wide)51 b(\\linespread{1.3)o(})d(\\fi)
+410 3599 y(\\newpage\045)301 3712 y(})301 3824 y(\\newcommand{\\t)o
+(oc})o({\\)o(@t)o(oc)o(})192 3937 y(\\fi)193 4050 y Fm(h)r
+Fi(=)q Fl(hca)m(rt)19 b Fm(j)g Fl(hcslides)q Fm(i)193
+4163 y(h)r(\003)q Fl(hcrep)s(o)m(rt)r Fm(i)192 4276 y
+Fk(\\newcommand{\\@)o(to)o(c}{)301 4389 y(\\if@wide)51
+b(\\linespread{1})d(\\fi)301 4502 y(\\tableofconten)o(ts)301
+4615 y(\\if@wide)j(\\linespread{1.)o(3})d(\\fi)301 4728
+y(\\thispagestyle)o({em)o(pt)o(y})192 4841 y(})192 4954
+y(\\if@paper)301 5066 y(\\newcommand{\\t)o(oc})o({})192
+5179 y(\\else)301 5292 y(\\newcommand{\\t)o(oc})o({\\)o(@t)o(oc)o(})192
+5405 y(\\fi)193 5518 y Fm(h)r Fi(=)q Fl(hcrep)s(o)m(rt)r
+Fm(i)p eop
+%%Page: 26 27
+26 26 bop 109 -62 a Ft(26)1941 b Fq(3)99 b(Commands)25
+b(and)g(Envir)n(onments)p 109 -10 3544 4 v -74 174 2025
+4 v -76 287 4 113 v -24 253 a Fe(\\titsubinfo{)p Fg(main)17
+b(title)q Fe(}{)p Fg(sub)22 b(title)q Fe(}{)p Fg(mor)n(e)h(info)q
+Fe(})p 1949 287 V -76 400 V -24 366 a(\\titsub{)p Fg(main)c(title)q
+Fe(}{)p Fg(sub)j(title)q Fe(})p 1949 400 V -76 513 V
+-24 479 a(\\titinfo{)p Fg(main)c(title)r Fe(}{)p Fg(mor)n(e)23
+b(info)p Fe(})p 1949 513 V -74 516 2025 4 v 109 688 a
+Fh(They)g(should)g(be)h(used)f(in)i(the)e(pr)n(emable)i(\226)g(call)h
+Fe(\\tit[ver])20 b Fh(or)k Fe(\\titaut[ver])19 b Fh(in)25
+b(the)e(docu-)109 801 y(ment)c(body)-10 b(.)19 b(Use)g(if)i(your)e
+(document)g(has)i(a)f(main)i(title)e(and)g(a)h(sub)e(title)h(and/or)g
+(you)f(want)i(to)e(give)109 914 y(additional)27 b(information.)g(Leave)
+f(the)g(<)p Fg(title)q Fh(>)h(parameter)f(of)g Fe(\\tit[...])78
+b Fh(empty)-10 b(.)24 b(<)p Fg(mor)n(e)g(info)q Fh(>)109
+1027 y(is)e(printed)g(below)g(the)g(<)p Fg(\(sub\))h(title)r
+Fh(>)g(in)g(a)g(small)h(font.)193 1228 y Fm(h)r(\003)q
+Fl(hca)m(rt)19 b Fm(j)g Fl(hcrep)s(o)m(rt)h Fm(j)f Fl(hcslides)q
+Fm(i)192 1340 y Fk(\\if@paper)301 1453 y(\\newcommand{\\t)o(its)o(ub)o
+(in)o(fo)o(}[)o(3]{)410 1566 y(\\renewcommand{\\)o(de)o(fa)o(ul)o(tt)o
+(itl)o(e})o({\045)519 1679 y(#1\\vfill)519 1792 y({\\Large)51
+b(#2\\vfill})519 1905 y(\\vfill)h({\\normalsize)d(#3\\vfill}\045)410
+2018 y(})410 2131 y(\\renewcommand{\\)o(cu)o(rr)o(en)o(tt)o(itl)o(e})o
+({#)o(1})o(\045)301 2244 y(})301 2357 y(\\newcommand{\\t)o(its)o(ub)o
+(}[)o(2])o({)410 2470 y(\\renewcommand{\\)o(de)o(fa)o(ul)o(tt)o(itl)o
+(e})o({\045)519 2582 y(#1\\vfill)519 2695 y({\\Large)i
+(#2\\vfill\\vfill}\045)410 2808 y(})410 2921 y(\\renewcommand{\\)o(cu)o
+(rr)o(en)o(tt)o(itl)o(e})o({#)o(1})o(\045)301 3034 y(})301
+3147 y(\\newcommand{\\t)o(iti)o(nf)o(o})o([2)o(]{)410
+3260 y(\\renewcommand{\\)o(de)o(fa)o(ul)o(tt)o(itl)o(e})o({\045)519
+3373 y(#1\\vfill)519 3486 y(\\vfill)h({\\normalsize)d(#2\\vfill}\045)
+410 3599 y(})410 3712 y(\\renewcommand{\\)o(cu)o(rr)o(en)o(tt)o(itl)o
+(e})o({#)o(1})o(\045)301 3824 y(})192 3937 y(\\else)301
+4050 y(\\newcommand{\\t)o(its)o(ub)o(in)o(fo)o(}[)o(3]{)410
+4163 y(\\renewcommand{\\)o(de)o(fa)o(ul)o(tt)o(itl)o(e})o({#)o(1\\)o
+(\\[)o(0.)o(8ex)o(])519 4276 y({\\Large)i(#2\\\\[0.8ex]})519
+4389 y({\\normalsize)e(#3\\\\}\045)410 4502 y(})410 4615
+y(\\renewcommand{\\)o(cu)o(rr)o(en)o(tt)o(itl)o(e})o({#)o(1})o(\045)301
+4728 y(})301 4841 y(\\newcommand{\\t)o(its)o(ub)o(}[)o(2])o({)410
+4954 y(\\renewcommand{\\)o(de)o(fa)o(ul)o(tt)o(itl)o(e})o({#)o(1\\)o
+(\\[)o(0.)o(8ex)o(])519 5066 y({\\Large)i(#2\\\\[0.8ex]}\045)410
+5179 y(})410 5292 y(\\renewcommand{\\)o(cu)o(rr)o(en)o(tt)o(itl)o(e})o
+({#)o(1})o(\045)301 5405 y(})301 5518 y(\\newcommand{\\t)o(iti)o(nf)o
+(o})o([2)o(]{)p eop
+%%Page: 27 28
+27 27 bop 109 -62 a Fq(3.4)99 b(Commands)23 b(and)g(Envir)n(onments)i
+(for)f(the)g(hcart,)g(hcr)n(eport)h(and)e(hcslides)17
+b(.)e(.)g(.)198 b Ft(27)p 109 -10 3544 4 v 410 270 a
+Fk(\\renewcommand{\\)o(de)o(fa)o(ul)o(tt)o(it)o(le})o({#)o(1\\)o(\\[)o
+(0.)o(8ex)o(])519 383 y({\\normalsize)49 b(#2\\\\}\045)410
+496 y(})410 609 y(\\renewcommand{\\)o(cu)o(rr)o(en)o(tt)o(it)o(le})o
+({#)o(1})o(\045)301 722 y(})192 835 y(\\fi)p -74 1169
+2042 4 v -76 1282 4 113 v -24 1248 a Fe(\\autinfo{)p
+Fg(author)m Fe(}{)p Fg(addr)n(ess)r Fe(}{)p Fg(email)p
+Fe(}{)p Fg(homepage)r Fe(})p 1965 1282 V -74 1285 2042
+4 v 109 1459 a Fh(Should)23 b(be)h(used)e(in)i(the)f(pr)n(emable)i
+(\226)f(call)i Fe(\\tit)p Fh(,)c Fe(\\titaut)f Fh(or)i
+Fe(\\titautver)d Fh(in)k(the)f(document)109 1572 y(body)-10
+b(.)31 b(Speci\002es)h(information)i(about)f(the)f(author)g(\(name,)i
+(addr)n(ess,)d(mail-addr)n(ess)i(and)g(home-)109 1685
+y(page\).)22 b(Use)f Fe(\\autdiv)f Fh(r)n(esp.)h Fe(\\autinfodiv)d
+Fh(instead)k(of)g Fe(\\\\)p Fh(.)192 1869 y Fk(\\newcommand{\\a)o(ut)o
+(inf)o(o})o([4)o(]{)o(\045)301 1982 y(\\renewcommand{)o(\\de)o(fa)o(ul)
+o(ta)o(ut)o(ho)o(r}{)o(#1)o(})301 2095 y(\\renewcommand{)o(\\de)o(fa)o
+(ul)o(ta)o(dd)o(re)o(ss})o({#)o(2})301 2208 y(\\renewcommand{)o(\\de)o
+(fa)o(ul)o(te)o(ma)o(il)o(}{#)o(3})301 2321 y(\\renewcommand{)o(\\de)o
+(fa)o(ul)o(th)o(om)o(ep)o(age)o(}{)o(#4)o(})301 2433
+y(\\renewcommand{)o(\\cu)o(rr)o(en)o(ta)o(ut)o(ho)o(r}{)o(#1)o(})192
+2546 y(})p -74 2880 1692 4 v -76 2993 4 113 v -24 2959
+a Fe(\\abs[)p Fg(other-language)h(abstract)s Fe(]{)p
+Fg(abstract)q Fe(})p 1615 2993 V -74 2997 1692 4 v 109
+3171 a Fh(Should)g(be)h(used)e(in)i(the)f(pr)n(emable)i(\226)f(call)i
+Fe(\\tit)p Fh(,)c Fe(\\titaut)f Fh(or)i Fe(\\titautver)d
+Fh(in)k(the)f(document)109 3283 y(body)-10 b(.)33 b(Prints)h(an)h
+(abstract)g(text.)e(Optionally)i(an)g(additional)g(abstract)g(in)g
+(another)f(language)g(is)109 3396 y(printed)f(below)-8
+b(.)34 b(The)g(title)h(of)g(the)f(other)n(-language)f(abstract)j(may)f
+(be)f(changed)h(by)f(r)n(ede\002ning)109 3509 y Fe(\\otherabstract)o
+(na)o(me)o Fh(.)17 b(By)22 b(default)g(`Zusammenfassung')g(is)h(used)e
+(\(German\).)192 3694 y Fk(\\newcommand{\\a)o(bs)o(tex)o(t})o({})192
+3806 y(\\newcommand{\\o)o(th)o(era)o(bs)o(te)o(xt)o(}{)o(})192
+3919 y(\\newcommand{\\a)o(bs)o(}[2)o(][)o(]{)o(\045)301
+4032 y(\\renewcommand{)o(\\ot)o(he)o(ra)o(bs)o(te)o(xt)o(}{#)o(1})301
+4145 y(\\renewcommand{)o(\\ab)o(st)o(ex)o(t})o({#)o(2})192
+4258 y(})p -74 4592 1043 4 v -76 4705 4 113 v -24 4671
+a Fe(\\keywords{)p Fg(keywords)m Fe(})p 967 4705 V -74
+4708 1043 4 v 109 4882 a Fh(Should)i(be)h(used)e(in)i(the)f(pr)n
+(emable)i(\226)f(call)i Fe(\\tit)p Fh(,)c Fe(\\titaut)f
+Fh(or)i Fe(\\titautver)d Fh(in)k(the)f(document)109 4995
+y(body)-10 b(.)21 b(Prints)h(a)h(list)g(of)g(keywor)n(ds.)192
+5179 y Fk(\\newcommand{\\k)o(ey)o(wor)o(ds)o(te)o(xt)o(}{)o(})192
+5292 y(\\newcommand{\\k)o(ey)o(wor)o(ds)o(}[)o(1])o({\045)301
+5405 y(\\renewcommand{)o(\\ke)o(yw)o(or)o(ds)o(te)o(xt)o(}{#)o(1})192
+5518 y(})p eop
+%%Page: 28 29
+28 28 bop 109 -62 a Ft(28)1941 b Fq(3)99 b(Commands)25
+b(and)g(Envir)n(onments)p 109 -10 3544 4 v -74 191 2105
+4 v -76 304 4 113 v -24 270 a Fe(\\hyperinfo{)p Fg(title)l
+Fe(}{)p Fg(author)p Fe(}{)p Fg(abstract)r Fe(}{)p Fg(keywords)q
+Fe(})p 2029 304 V -74 307 2105 4 v 109 481 a Fh(An)37
+b(alternative)h(way)f(to)g(specify)g(document)f(information)i(for)g
+(the)e(PDF)i(version.)e(Use)h(when)109 594 y(the)19 b(default)h
+(document)f(information)i(extracted)e(fr)n(om)h Fe(\\tit[sub][info])o
+Fh(,)14 b Fe(\\autinfo)p Fh(,)j Fe(\\abs)109 707 y Fh(and)j
+Fe(\\keywords)d Fh(does)i(not)h(work)f(as)i(it)g(should.)e(If)i(one)e
+(of)i(the)f(parameters)f(is)i(left)g(empty)e(the)h(de-)109
+820 y(fault)j(information)h(is)f(used)f(instead.)g(Do)h(not)f(use)g
+(any)h(formatting)g(or)g(special)g(commands.)g(Must)109
+933 y(be)f(used)f(in)i(the)f(pr)n(emable.)h(W)-5 b(ithout)22
+b(the)g Fe(pdf)f Fh(option)h(this)g(command)h(is)g(ignor)n(ed.)192
+1086 y Fk(\\if@pdf)301 1199 y(\\newcommand{\\h)o(ype)o(ri)o(nf)o(o})o
+([4)o(]{)410 1312 y(\\renewcommand{\\)o(hy)o(pe)o(rt)o(it)o(le})o({#)o
+(1})410 1425 y(\\renewcommand{\\)o(hy)o(pe)o(ra)o(ut)o(hor)o(}{)o(#2)o
+(})410 1538 y(\\renewcommand{\\)o(hy)o(pe)o(ra)o(bs)o(tra)o(ct)o(}{)o
+(#3)o(})410 1651 y(\\renewcommand{\\)o(hy)o(pe)o(rk)o(ey)o(wor)o(ds)o
+(}{)o(#4)o(})301 1764 y(})192 1877 y(\\else)301 1990
+y(\\newcommand{\\h)o(ype)o(ri)o(nf)o(o})o([4)o(]{})192
+2102 y(\\fi)p -74 2365 1349 4 v -76 2478 4 113 v -24
+2444 a Fe(\\titaut[)p Fg(date)m Fe(]{)p Fg(title)q Fe(}{)p
+Fg(author)p Fe(})p 1273 2478 V -74 2481 1349 4 v 109
+2655 a Fh(Replacement)e(for:)i Fe(\\title{)p Fg(title)n
+Fe(})f(\\author{)p Fg(author)n Fe(})g(\\date{)p Fg(date)o
+Fe(})g(\\maketitle)109 2768 y Fh(Default)30 b(date)f(is)g
+Fe(\\today)p Fh(.)e(W)-5 b(ith)29 b(the)g Fe(paper)e
+Fh(option,)h(a)i(titlepage)f(and)g(a)h(table)g(of)g(contents)e(ar)n(e)
+109 2881 y(generated.)192 3034 y Fk(\\if@paper)301 3147
+y(\\newcommand{\\t)o(ita)o(ut)o(}[)o(3])o([\\)o(tod)o(ay)o(]{)o(\045)
+193 3260 y Fm(h)q Fl(hca)m(rt)19 b Fm(j)g Fl(hcrep)s(o)m(rt)r
+Fm(i)219 b Fk(\\if@wide)51 b(\\linespread{1})d(\\fi)193
+3373 y Fm(h)q Fl(hcslides)p Fm(i)220 b Fk(\\slidepagestyl)o(e{)o(em)o
+(pt)o(y}\\)o(se)o(tc)o(ou)o(nt)o(er{)o(sl)o(id)o(e})o({0)o(})410
+3486 y(\\ifthenelse{\\eq)o(ua)o(l{)o(#2)o(}{)o(}})519
+3599 y({})519 3712 y({\\renewcommand{)o(\\d)o(ef)o(au)o(ltt)o(it)o(le)o
+(}{)o(#2)o(})628 3824 y(\\renewcommand{\\)o(cu)o(rr)o(ent)o(ti)o(tl)o
+(e})o({#)o(2})o(})410 3937 y(\\title{\\normalf)o(on)o(t\\)o(hu)o(ge)48
+b(\\defaulttitle)h(\\vfill})410 4050 y(\\ifthenelse{\\eq)o(ua)o(l{)o
+(#3)o(}{)o(}})519 4163 y({})519 4276 y({\\renewcommand{)o(\\d)o(ef)o
+(au)o(lta)o(ut)o(ho)o(r})o({#)o(3})628 4389 y(\\renewcommand{\\)o(cu)o
+(rr)o(ent)o(au)o(th)o(or)o(}{)o(#3)o(}})410 4502 y(\\author{\\normal)o
+(fo)o(nt)o(\\L)o(ar)o(ge)f(\\defaultauthor\\)o(\\[)o(0.)o(8e)o(x])519
+4615 y(\\normalfont\\nor)o(ma)o(ls)o(iz)o(e)h(\\defaultaddres)o(s\\)o
+(\\[)o(0.)o(4e)o(x])519 4728 y(\\normalfont\\nor)o(ma)o(ls)o(iz)o(e)519
+4841 y(\\htmladdnormall)o(in)o(k{)o(\\d)o(efa)o(ul)o(te)o(ma)o(il)o(}{)
+o(mai)o(lt)o(o:)o(\\d)o(ef)o(aul)o(te)o(ma)o(il)o(}\\)o(\\[-)192
+4954 y(1ex])519 5066 y(\\normalfont\\nor)o(ma)o(ls)o(iz)o(e)519
+5179 y(\\htmladdnormall)o(in)o(k{)o(\\d)o(efa)o(ul)o(th)o(om)o(ep)o(ag)
+o(e}{)o(\\d)o(ef)o(au)o(lt)o(hom)o(ep)o(ag)o(e})192 5292
+y(})410 5405 y(\\date{\\vfill\\vf)o(il)o(l)f(\\normalfont\\nor)o(ma)o
+(lsi)o(ze)g(#1})193 5518 y Fm(h)q Fl(hcrep)s(o)m(rt)r
+Fm(i)219 b Fk(\\lowertitlebac)o(k{\045)p eop
+%%Page: 29 30
+29 29 bop 109 -62 a Fq(3.4)99 b(Commands)23 b(and)g(Envir)n(onments)i
+(for)f(the)g(hcart,)g(hcr)n(eport)h(and)e(hcslides)17
+b(.)e(.)g(.)198 b Ft(29)p 109 -10 3544 4 v 193 270 a
+Fm(h)q Fl(hcrep)s(o)m(rt)r Fm(i)328 b Fk(\\ifthenelse{\\eq)o(ua)o(l{)o
+(\\o)o(th)o(era)o(bs)o(te)o(xt)o(}{)o(}}{)o(}\045)193
+383 y Fm(h)q Fl(hcrep)s(o)m(rt)r Fm(i)492 b Fk({\\minisec{\\cen)o(te)o
+(ri)o(ng)o(\\ab)o(st)o(ra)o(ct)o(na)o(me})193 496 y Fm(h)q
+Fl(hcrep)s(o)m(rt)r Fm(i)601 b Fk(\\abstext}\045)193
+609 y Fm(h)q Fl(hcrep)s(o)m(rt)r Fm(i)328 b Fk(\\ifthenelse{\\eq)o(ua)o
+(l{)o(\\o)o(th)o(era)o(bs)o(te)o(xt)o(}{)o(}}{)o(}\045)193
+722 y Fm(h)q Fl(hcrep)s(o)m(rt)r Fm(i)492 b Fk({\\minisec{\\cen)o(te)o
+(ri)o(ng)o(\\ot)o(he)o(ra)o(bs)o(tr)o(act)o(na)o(me)o(})193
+835 y Fm(h)q Fl(hcrep)s(o)m(rt)r Fm(i)601 b Fk(\\otherabstext})o(\045)
+193 948 y Fm(h)q Fl(hcrep)s(o)m(rt)r Fm(i)328 b Fk(\\ifthenelse{\\eq)o
+(ua)o(l{)o(\\k)o(ey)o(wor)o(ds)o(te)o(xt)o(}{)o(}}{)o(}\045)193
+1061 y Fm(h)q Fl(hcrep)s(o)m(rt)r Fm(i)492 b Fk({\\minisec{\\cen)o(te)o
+(ri)o(ng)o(\\ke)o(yw)o(or)o(ds)o(na)o(me})193 1173 y
+Fm(h)q Fl(hcrep)s(o)m(rt)r Fm(i)601 b Fk(\\cen{\\keywords)o(te)o(xt)o
+(}}\045)193 1286 y Fm(h)q Fl(hcrep)s(o)m(rt)r Fm(i)219
+b Fk(})410 1399 y(\\maketitle)410 1512 y(\\ifthenelse{\\is)o(un)o(de)o
+(fi)o(ne)o(d{)o(\\cu)o(rr)o(en)o(td)o(at)o(e}})519 1625
+y({\\newcommand{\\c)o(ur)o(re)o(nt)o(da)o(te})o({#)o(1})o(}{)o(})193
+1738 y Fm(h)q Fl(hca)m(rt)19 b Fm(j)g Fl(hcslides)q Fm(i)219
+b Fk(\\setcounter{pa)o(ge)o(}{0)o(})193 1851 y Fm(h)q
+Fl(hca)m(rt)19 b Fm(j)g Fl(hcslides)q Fm(i)219 b Fk(\\thispagestyle)o
+({e)o(mpt)o(y})193 1964 y Fm(h)q Fl(hca)m(rt)19 b Fm(j)g
+Fl(hcslides)q Fm(i)273 b Fk(\\ifthenelse{\\eq)o(ual)o({\\)o(ab)o(st)o
+(ex)o(t}{)o(}})o({\045)193 2077 y Fm(h)q Fl(hca)m(rt)19
+b Fm(j)g Fl(hcslides)q Fm(i)437 b Fk(\\ifthenelse{\\eq)o(ua)o(l{)o(\\k)
+o(ey)o(wor)o(ds)o(te)o(xt)o(}{)o(}}{)o(}{)193 2190 y
+Fm(h)q Fl(hca)m(rt)19 b Fm(j)g Fl(hcslides)q Fm(i)601
+b Fk(\\vfill\\vfill)193 2303 y Fm(h)q Fl(hca)m(rt)19
+b Fm(j)g Fl(hcslides)q Fm(i)601 b Fk(\\minisec{\\cent)o(er)o(in)o(g\\)o
+(key)o(wo)o(rd)o(sn)o(am)o(e})193 2415 y Fm(h)q Fl(hca)m(rt)19
+b Fm(j)g Fl(hcslides)q Fm(i)601 b Fk(\\cen{\\keywords)o(te)o(xt)o(}})
+193 2528 y Fm(h)q Fl(hca)m(rt)19 b Fm(j)g Fl(hcslides)q
+Fm(i)219 b Fk(}{\045)193 2641 y Fm(h)q Fl(hca)m(rt)19
+b Fm(j)g Fl(hcslides)q Fm(i)382 b Fk(\\vfill\\vfill)193
+2754 y Fm(h)q Fl(hca)m(rt)19 b Fm(j)g Fl(hcslides)q Fm(i)546
+b Fk(\\minisec{\\cente)o(ri)o(ng)o(\\a)o(bst)o(ra)o(ct)o(na)o(me)o(})
+193 2867 y Fm(h)q Fl(hca)m(rt)19 b Fm(j)g Fl(hcslides)q
+Fm(i)546 b Fk(\\abstext)193 2980 y Fm(h)q Fl(hca)m(rt)19
+b Fm(j)g Fl(hcslides)q Fm(i)546 b Fk(\\ifthenelse{\\eq)o(ua)o(l{)o(\\o)
+o(the)o(ra)o(bs)o(te)o(xt)o(}{})o(}{)o(})193 3093 y Fm(h)q
+Fl(hca)m(rt)19 b Fm(j)g Fl(hcslides)q Fm(i)710 b Fk({\\minisec{\\cen)o
+(te)o(ri)o(ng\\)o(ot)o(he)o(ra)o(bs)o(tra)o(ct)o(na)o(me)o(})193
+3206 y Fm(h)q Fl(hca)m(rt)19 b Fm(j)g Fl(hcslides)q Fm(i)819
+b Fk(\\otherabstext})193 3319 y Fm(h)q Fl(hca)m(rt)19
+b Fm(j)g Fl(hcslides)q Fm(i)546 b Fk(\\ifthenelse{\\eq)o(ua)o(l{)o(\\k)
+o(eyw)o(or)o(ds)o(te)o(xt)o(}{})o(}{)o(})193 3432 y Fm(h)q
+Fl(hca)m(rt)19 b Fm(j)g Fl(hcslides)q Fm(i)710 b Fk({\\minisec{\\cen)o
+(te)o(ri)o(ng\\)o(ke)o(yw)o(or)o(ds)o(nam)o(e})193 3545
+y Fm(h)q Fl(hca)m(rt)19 b Fm(j)g Fl(hcslides)q Fm(i)819
+b Fk(\\cen{\\keywords)o(te)o(xt})o(})193 3657 y Fm(h)q
+Fl(hca)m(rt)19 b Fm(j)g Fl(hcslides)q Fm(i)219 b Fk(})410
+3770 y(\\setcounter{pag)o(e})o({0)o(})410 3883 y(\\thispagestyle{)o(em)
+o(pt)o(y})410 3996 y(\\@toc\045)193 4109 y Fm(h)q Fl(hca)m(rt)19
+b Fm(j)g Fl(hcrep)s(o)m(rt)r Fm(i)219 b Fk(\\if@wide)51
+b(\\linespread{1.3)o(})d(\\fi)193 4222 y Fm(h)q Fl(hcslides)p
+Fm(i)438 b Fk(\\slidepagestyl)o(e{)o(HC})o(\045)301 4335
+y(})192 4448 y(\\else)301 4561 y(\\newcommand{\\t)o(ita)o(ut)o(}[)o(3])
+o([\\)o(to)o(day)o(]{)o(\045)193 4674 y Fm(h)q Fl(hca)m(rt)19
+b Fm(j)g Fl(hcrep)s(o)m(rt)r Fm(i)219 b Fk(\\if@wide)51
+b(\\linespread{1})d(\\fi)193 4787 y Fm(h)q Fl(hcslides)p
+Fm(i)220 b Fk(\\slidepagestyl)o(e{)o(em)o(pt)o(y}\\)o(se)o(tc)o(ou)o
+(nt)o(er{)o(sl)o(id)o(e})o({0)o(})410 4899 y(\\ifthenelse{\\eq)o(ua)o
+(l{)o(#2)o(}{)o(}})519 5012 y({})519 5125 y({\\renewcommand{)o(\\d)o
+(ef)o(au)o(lt)o(tit)o(le)o(}{)o(#2)o(})628 5238 y(\\renewcommand{\\)o
+(cu)o(rr)o(en)o(tti)o(tl)o(e})o({#)o(2})o(})410 5351
+y(\\title{\\normalf)o(on)o(t\\)o(hu)o(ge)48 b(\\defaulttitle})410
+5464 y(\\ifthenelse{\\eq)o(ua)o(l{)o(#3)o(}{)o(}})p eop
+%%Page: 30 31
+30 30 bop 109 -62 a Ft(30)1941 b Fq(3)99 b(Commands)25
+b(and)g(Envir)n(onments)p 109 -10 3544 4 v 519 270 a
+Fk({})519 383 y({\\renewcommand{)o(\\d)o(ef)o(au)o(lta)o(ut)o(ho)o(r})o
+({#)o(3})628 496 y(\\renewcommand{\\)o(cu)o(rr)o(ent)o(au)o(th)o(or)o
+(}{)o(#3)o(}})410 609 y(\\author{\\normal)o(fo)o(nt)o(\\L)o(ar)o(ge)48
+b(\\defaultauthor})410 722 y(\\date{\\normalfo)o(nt)o(\\n)o(or)o(ma)o
+(lsi)o(ze)g(#1})193 835 y Fm(h)q Fl(hcrep)s(o)m(rt)r
+Fm(i)219 b Fk(\\lowertitlebac)o(k{\045)193 948 y Fm(h)q
+Fl(hcrep)s(o)m(rt)r Fm(i)328 b Fk(\\ifthenelse{\\eq)o(ua)o(l{)o(\\o)o
+(th)o(era)o(bs)o(te)o(xt)o(}{)o(}}{)o(}\045)193 1061
+y Fm(h)q Fl(hcrep)s(o)m(rt)r Fm(i)492 b Fk({\\minisec{\\cen)o(te)o(ri)o
+(ng)o(\\ab)o(st)o(ra)o(ct)o(na)o(me})193 1173 y Fm(h)q
+Fl(hcrep)s(o)m(rt)r Fm(i)601 b Fk(\\abstext}\045)193
+1286 y Fm(h)q Fl(hcrep)s(o)m(rt)r Fm(i)328 b Fk(\\ifthenelse{\\eq)o(ua)
+o(l{)o(\\o)o(th)o(era)o(bs)o(te)o(xt)o(}{)o(}}{)o(}\045)193
+1399 y Fm(h)q Fl(hcrep)s(o)m(rt)r Fm(i)492 b Fk({\\minisec{\\cen)o(te)o
+(ri)o(ng)o(\\ot)o(he)o(ra)o(bs)o(tr)o(act)o(na)o(me)o(})193
+1512 y Fm(h)q Fl(hcrep)s(o)m(rt)r Fm(i)601 b Fk(\\otherabstext})o(\045)
+193 1625 y Fm(h)q Fl(hcrep)s(o)m(rt)r Fm(i)328 b Fk(\\ifthenelse{\\eq)o
+(ua)o(l{)o(\\k)o(ey)o(wor)o(ds)o(te)o(xt)o(}{)o(}}{)o(}\045)193
+1738 y Fm(h)q Fl(hcrep)s(o)m(rt)r Fm(i)492 b Fk({\\minisec{\\cen)o(te)o
+(ri)o(ng)o(\\ke)o(yw)o(or)o(ds)o(na)o(me})193 1851 y
+Fm(h)q Fl(hcrep)s(o)m(rt)r Fm(i)601 b Fk(\\cen{\\keywords)o(te)o(xt)o
+(}}\045)193 1964 y Fm(h)q Fl(hcrep)s(o)m(rt)r Fm(i)219
+b Fk(})410 2077 y(\\maketitle)410 2190 y(\\ifthenelse{\\is)o(un)o(de)o
+(fi)o(ne)o(d{\\)o(cu)o(rr)o(en)o(td)o(at)o(e}})519 2303
+y({\\newcommand{\\c)o(ur)o(re)o(nt)o(dat)o(e})o({#)o(1})o(}{)o(})193
+2415 y Fm(h)q Fl(hca)m(rt)19 b Fm(j)g Fl(hcslides)q Fm(i)219
+b Fk(\\setcounter{pa)o(ge)o(}{0)o(})193 2528 y Fm(h)q
+Fl(hca)m(rt)19 b Fm(j)g Fl(hcslides)q Fm(i)219 b Fk(\\thispagestyle)o
+({e)o(mpt)o(y})193 2641 y Fm(h)q Fl(hca)m(rt)19 b Fm(j)g
+Fl(hcslides)q Fm(i)273 b Fk(\\ifthenelse{\\eq)o(ual)o({\\)o(ab)o(st)o
+(ex)o(t}{)o(}})o({})o({)193 2754 y Fm(h)q Fl(hca)m(rt)19
+b Fm(j)g Fl(hcslides)q Fm(i)546 b Fk(\\minisec{\\cente)o(ri)o(ng)o(\\a)
+o(bst)o(ra)o(ct)o(na)o(me)o(})193 2867 y Fm(h)q Fl(hca)m(rt)19
+b Fm(j)g Fl(hcslides)q Fm(i)546 b Fk(\\abstext)193 2980
+y Fm(h)q Fl(hca)m(rt)19 b Fm(j)g Fl(hcslides)q Fm(i)546
+b Fk(\\ifthenelse{\\eq)o(ua)o(l{)o(\\o)o(the)o(ra)o(bs)o(te)o(xt)o(}{})
+o(}{)o(})193 3093 y Fm(h)q Fl(hca)m(rt)19 b Fm(j)g Fl(hcslides)q
+Fm(i)710 b Fk({\\minisec{\\cen)o(te)o(ri)o(ng\\)o(ot)o(he)o(ra)o(bs)o
+(tra)o(ct)o(na)o(me)o(})193 3206 y Fm(h)q Fl(hca)m(rt)19
+b Fm(j)g Fl(hcslides)q Fm(i)819 b Fk(\\otherabstext})193
+3319 y Fm(h)q Fl(hca)m(rt)19 b Fm(j)g Fl(hcslides)q Fm(i)219
+b Fk(})193 3432 y Fm(h)q Fl(hca)m(rt)19 b Fm(j)g Fl(hcslides)q
+Fm(i)273 b Fk(\\ifthenelse{\\eq)o(ual)o({\\)o(ke)o(yw)o(or)o(dst)o(ex)o
+(t})o({})o(}{)o(})193 3545 y Fm(h)q Fl(hca)m(rt)19 b
+Fm(j)g Fl(hcslides)q Fm(i)437 b Fk({\\minisec{\\cent)o(er)o(in)o(g\\)o
+(ke)o(ywo)o(rd)o(sn)o(am)o(e})193 3657 y Fm(h)q Fl(hca)m(rt)19
+b Fm(j)g Fl(hcslides)q Fm(i)546 b Fk(\\cen{\\keywordst)o(ex)o(t})o(})
+410 3770 y(\\setcounter{pag)o(e})o({0)o(})410 3883 y(\\thispagestyle{)o
+(em)o(pt)o(y})o(\045)193 3996 y Fm(h)q Fl(hca)m(rt)19
+b Fm(j)g Fl(hcrep)s(o)m(rt)r Fm(i)219 b Fk(\\if@wide)51
+b(\\linespread{1.3)o(})d(\\fi)193 4109 y Fm(h)q Fl(hcslides)p
+Fm(i)220 b Fk(\\newpage\\slide)o(pa)o(ge)o(st)o(yle)o({H)o(C})o(\045)
+301 4222 y(})192 4335 y(\\fi)p -74 4931 834 4 v -76 5044
+4 113 v -24 5010 a Fe(\\tit[)p Fg(date)o Fe(]{)p Fg(title)p
+Fe(})p 758 5044 V -74 5048 834 4 v 109 5221 a Fh(Calls)24
+b Fe(\\titaut)19 b Fh(with)k(the)f(default)g(author)g(information.)192
+5518 y Fk(\\newcommand{\\t)o(it)o(}[2)o(][)o(\\t)o(od)o(ay)o(]{\\)o(ti)
+o(ta)o(ut)o([#)o(1])o({#2)o(}{)o(}})p eop
+%%Page: 31 32
+31 31 bop 109 -62 a Fq(3.5)99 b(Commands)25 b(and)f(Envir)n(onments)j
+(for)e(the)g(hcart)h(class)1071 b Ft(31)p 109 -10 3544
+4 v -74 191 2355 4 v -76 304 4 113 v -24 270 a Fe(\\titautver[)p
+Fg(version)19 b(date)q Fe(]{)p Fg(title)q Fe(}{)p Fg(author)p
+Fe(}{)p Fg(general)24 b(date)q Fe(})p 2278 304 V -74
+307 2355 4 v 109 481 a Fh(Prints)e(a)h(general)f(date)g(\(e.g.)f(of)i
+(\002rst)f(r)n(elease\))g(and)h(a)g(version)f(date)g(\(default:)h
+Fe(\\today)p Fh(\).)192 621 y Fk(\\newcommand{\\t)o(it)o(aut)o(ve)o(r})
+o([4)o(][)o(\\t)o(oda)o(y])o({)301 734 y(\\newcommand{\\c)o(urr)o(en)o
+(td)o(at)o(e})o({#)o(1}\045)301 847 y(\\titaut[#4\\\\\\v)o(ers)o(io)o
+(nt)o(ex)o(t\\)48 b(#1]{#2}{#3})192 960 y(})p -74 1191
+1839 4 v -76 1304 4 113 v -24 1270 a Fe(\\titver[)p Fg(version)20
+b(date)r Fe(]{)p Fg(title)p Fe(}{)p Fg(general)k(date)q
+Fe(})p 1763 1304 V -74 1307 1839 4 v 109 1481 a Fh(Calls)g
+Fe(\\titautver)18 b Fh(with)k(the)g(default)h(author)f(information.)192
+1621 y Fk(\\newcommand{\\t)o(it)o(ver)o(}[)o(3])o([\\)o(to)o(da)o(y]{)o
+(\\t)o(it)o(au)o(tv)o(er[)o(#1)o(]{)o(#2)o(}{)o(}{#)o(3})o(})109
+1887 y Fr(3.4.4)100 b(Sectioning)28 b(Commands)p -74
+2118 700 4 v -76 2231 4 113 v -24 2197 a Fe(\\fictionsec)p
+624 2231 V -74 2234 700 4 v 109 2408 a Fh(A)c(sectioning)f(command)i
+(pr)n(oducing)e(just)h(a)g(number)-7 b(,)24 b(no)g(text)f(\226)i
+(useful)f(e.g.)f(for)h(\002ction)g(without)109 2521 y(section)d
+(headings.)h(When)g(a)h(new)f Fe(\\section)d Fh(starts)j(the)f(counter)
+h(is)h(r)n(eset.)192 2661 y Fk(\\newcounter{fi)o(ct)o(ion)o(se)o(c})o
+([s)o(ec)o(ti)o(on])192 2774 y(\\newcommand{\\f)o(ic)o(tio)o(ns)o(ec)o
+(}{)o(\\a)o(dd)o(toc)o(ou)o(nt)o(er)o({f)o(ict)o(io)o(ns)o(ec)o(}{)o
+(1}\045)301 2887 y(\\subsection*{\\)o(cen)o(te)o(ri)o(ng)o(\\t)o(he)o
+(fic)o(ti)o(on)o(se)o(c})o(})193 3000 y Fm(h)r Fi(=)q
+Fl(hca)m(rt)c Fm(j)g Fl(hcrep)s(o)m(rt)h Fm(j)f Fl(hcslides)q
+Fm(i)109 3294 y Ff(3.5)120 b(Commands)36 b(and)d(En)-5
+b(vir)n(onments)35 b(f)n(or)d(the)h(hcar)r(t)h(c)n(lass)109
+3473 y Fh(A)22 b Fe(\\part)f Fh(command)i(starts)e(a)i(new)f(page.)193
+3613 y Fm(h)r(\003)q Fl(hca)m(rt)r Fm(i)192 3726 y Fk(\\renewcommand\\)
+o(pa)o(rt{)o(\\c)o(le)o(ar)o(pa)o(ge)355 3839 y(\\@afterindentfal)o(se)
+355 3952 y(\\secdef\\@part\\@s)o(pa)o(rt)o(})193 4065
+y Fm(h)r Fi(=)q Fl(hca)m(rt)r Fm(i)109 4359 y Ff(3.6)120
+b(Settings)34 b(f)n(or)e(the)i(hc)n(letter)g(c)n(lass)109
+4539 y Fh(No)22 b(fold)g(marks)h(ar)n(e)g(printed.)193
+4679 y Fm(h)r(\003)q Fl(hcletter)s Fm(i)192 4792 y Fk(\\foldmarksoff)
+193 4904 y Fm(h)r Fi(=)q Fl(hcletter)s Fm(i)109 5199
+y Ff(3.7)120 b(Commands)36 b(and)d(En)-5 b(vir)n(onments)35
+b(f)n(or)d(the)h(hcrepor)r(t)h(c)n(lass)109 5378 y Fh(The)22
+b(\002rst)f(page)h(of)h(a)g(chapter)f(and)h(the)f(title)g(page)g(of)h
+(a)g(part)f(do)g(not)g(have)h(a)g(page)f(number)-7 b(.)193
+5518 y Fm(h)r(\003)q Fl(hcrep)s(o)m(rt)r Fm(i)p eop
+%%Page: 32 33
+32 32 bop 109 -62 a Ft(32)1941 b Fq(3)99 b(Commands)25
+b(and)g(Envir)n(onments)p 109 -10 3544 4 v 192 270 a
+Fk(\\renewcommand\\)o(ch)o(apt)o(er)410 383 y({\\if@openright\\)o(cl)o
+(ea)o(rd)o(ou)o(ble)o(pa)o(ge)o(\\e)o(ls)o(e\\)o(cle)o(ar)o(pa)o(ge)o
+(\\f)o(i)1283 496 y(\\thispagestyle)o({e)o(mp)o(ty)o(}\045)1283
+609 y(\\global\\@topnu)o(m\\)o(z@)1283 722 y(\\@afterindentf)o(al)o(se)
+1283 835 y(\\secdef\\@chapt)o(er)o(\\@)o(sc)o(hap)o(te)o(r})192
+948 y(\\renewcommand\\)o(ad)o(dch)o(ap)410 1061 y({\\if@openright\\)o
+(cl)o(ea)o(rd)o(ou)o(ble)o(pa)o(ge)o(\\e)o(ls)o(e\\)o(cle)o(ar)o(pa)o
+(ge)o(\\f)o(i)1283 1173 y(\\thispagestyle)o({e)o(mp)o(ty)o(}\045)1283
+1286 y(\\global\\@topnu)o(m\\)o(z@)1283 1399 y(\\@afterindentf)o(al)o
+(se)1283 1512 y(\\secdef\\@addch)o(ap)o(\\@)o(sa)o(ddc)o(ha)o(p})192
+1625 y(\\renewcommand\\)o(pa)o(rt)410 1738 y({\\if@openright\\)o(cl)o
+(ea)o(rd)o(ou)o(ble)o(pa)o(ge)o(\\e)o(ls)o(e\\)o(cle)o(ar)o(pa)o(ge)o
+(\\f)o(i)1119 1851 y(\\thispagestyle{)o(em)o(pt)o(y})o(\045)1119
+1964 y(\\if@twocolumn)1337 2077 y(\\onecolumn)1337 2190
+y(\\@tempswatrue)1228 2303 y(\\else)1337 2415 y(\\@tempswafalse)1119
+2528 y(\\fi)1119 2641 y(\\null\\vfil)1119 2754 y(\\secdef\\@part\\@)o
+(sp)o(ar)o(t})193 2867 y Fm(h)r Fi(=)q Fl(hcrep)s(o)m(rt)r
+Fm(i)109 3155 y Ff(3.8)120 b(Commands)36 b(and)d(En)-5
+b(vir)n(onments)35 b(f)n(or)d(the)h(hcslides)j(c)n(lass)109
+3332 y Fh(A)22 b(new)g(page)g(is)h(started)e(by)h(a)h(section)f(or)h
+(manually)h(with)e(the)g Fe(\\newslide)d Fh(command.)255
+3445 y(Everything)33 b(is)i(printed)e(sans)h(serif.)g(The)g
+Fe(HC)g Fh(pagestyle)e(is)j(always)g(used.)e(The)h Fe(fancybox)109
+3558 y Fh(package)22 b(is)h(r)n(equir)n(ed)f(for)g(drawing)h(an)g
+(shadowed)d(box)j(ar)n(ound)f(sections.)p -74 3784 1323
+4 v -76 3897 4 113 v -24 3863 a Fe(\\addsec[)p Fg(toc-entry)n
+Fe(]{)p Fg(heading)q Fe(})p 1247 3897 V -74 3900 1323
+4 v 109 4074 a Fh(For)j(compatibily)i(with)f(the)f Fe(hcart)e
+Fh(and)j Fe(hcreport)c Fh(classes.)k(Should)f(always)h(be)f(used)g
+(instead)109 4187 y(of)d(the)g Fe(\\section*)d Fh(command.)p
+-74 4413 933 4 v -76 4526 4 113 v -24 4492 a Fe(\\minisec{)p
+Fg(heading)m Fe(})p 857 4526 V -74 4529 933 4 v 109 4703
+a Fh(For)50 b(compatibily)i(with)e(the)g Fe(hcart)f Fh(and)h
+Fe(hcreport)e Fh(classes.)i(Sectioning)g(level)h(between)109
+4816 y Fe(\\subsubsection)16 b Fh(and)23 b Fe(\\paragraph)p
+Fh(.)193 4954 y Fm(h)r(\003)q Fl(hcslides)q Fm(i)192
+5066 y Fk(\\AtBeginDocume)o(nt)o({\\b)o(eg)o(in)o({s)o(li)o(de})o(})192
+5179 y(\\AtEndDocument)o({\\)o(end)o({s)o(li)o(de)o(}})192
+5292 y(\\renewcommand{)o(\\r)o(mde)o(fa)o(ul)o(t})o({\\)o(sfd)o(ef)o
+(au)o(lt)o(})192 5405 y(\\raggedslides[)o(5e)o(m])192
+5518 y(\\newcommand{\\a)o(dd)o(sec)o(}[)o(2])o([])o({\045)p
+eop
+%%Page: 33 34
+33 33 bop 109 -62 a Fq(3.8)99 b(Commands)25 b(and)f(Envir)n(onments)j
+(for)e(the)g(hcslides)h(class)941 b Ft(33)p 109 -10 3544
+4 v 301 270 a Fk(\\section*{#2})301 383 y(\\ifthenelse{\\e)o(qua)o(l{)o
+(#1)o(}{)o(}})410 496 y({\\addcontentsli)o(ne)o({t)o(oc)o(}{)o(se)o
+(cti)o(on)o(}{)o(#2)o(}})410 609 y({\\addcontentsli)o(ne)o({t)o(oc)o
+(}{)o(se)o(cti)o(on)o(}{)o(#1)o(}})o(\045)192 722 y(})192
+835 y(\\newcommand\\mi)o(ni)o(sec)o([1)o(]{)o(\\@)o(af)o(te)o(rin)o(de)
+o(nt)o(fa)o(ls)o(e)49 b(\\vskip)i(1.5ex)301 948 y({\\parindent)e(\\z@)
+54 b(\\raggedright\\s)o(ff)o(am)o(il)o(y\\)o(bfs)o(er)o(ie)o(s)48
+b(#1\\par\\nobreak}\045)301 1061 y(\\@afterheading)o(})192
+1173 y(\\setlength{\\sl)o(id)o(ehe)o(ig)o(ht)o(}{)o(0.)o(74)o(\\pa)o
+(pe)o(rw)o(id)o(th)o(})192 1286 y(\\setlength{\\sl)o(id)o(ewi)o(dt)o
+(h})o({0)o(.8)o(4\\)o(pap)o(er)o(he)o(ig)o(ht)o(})192
+1399 y(\\renewcommand{)o(\\s)o(lid)o(et)o(op)o(ma)o(rg)o(in)o(}{0)o(.1)
+o(2\\)o(pa)o(pe)o(rwi)o(dt)o(h})192 1512 y(\\renewcommand{)o(\\s)o(lid)
+o(eb)o(ot)o(to)o(mm)o(ar)o(gin)o(}{)o(0.)o(12)o(\\p)o(ape)o(rw)o(id)o
+(th)o(})192 1625 y(\\renewcommand{)o(\\s)o(lid)o(el)o(ef)o(tm)o(ar)o
+(gi)o(n}{)o(0.)o(08)o(\\p)o(ap)o(erh)o(ei)o(gh)o(t})192
+1738 y(\\renewcommand{)o(\\s)o(lid)o(er)o(ig)o(ht)o(ma)o(rg)o(in})o({0)
+o(.0)o(8\\)o(pa)o(per)o(he)o(ig)o(ht)o(})192 1851 y(\\slideframe{no)o
+(ne)o(})192 1964 y(\\AtBeginDocume)o(nt)o({)301 2077
+y(\\ifthenelse{\\e)o(qua)o(l{)o(\\d)o(ef)o(au)o(lt)o(ema)o(il)o(}{)o
+(}})410 2190 y({\\newcommand{\\@)o(em)o(ai)o(l})o({})o(})410
+2303 y({\\newcommand{\\@)o(em)o(ai)o(l})519 2415 y({)54
+b(\\texttt{<}\\htma)o(il)o({\\)o(de)o(fau)o(lt)o(em)o(ai)o(l})o(\\te)o
+(xt)o(tt)o({>)o(}})o(})301 2528 y(\\newpagestyle{)o(HC})o(\045)410
+2641 y({\\parbox[b]{\\te)o(xt)o(wi)o(dt)o(h})o(\045)574
+2754 y({\\currenttitle)o(\\h)o(fi)o(ll)o(\\c)o(urr)o(en)o(td)o(at)o
+(e\\)o(\\[-)o(.6)o(ex)o(]\045)628 2867 y(\\rule{\\textwidt)o(h})o({0)o
+(.6)o(pt})o(}})410 2980 y({\\parbox[t]{\\te)o(xt)o(wi)o(dt)o(h})o({\\)o
+(rul)o(e{)o(\\t)o(ex)o(tw)o(idt)o(h})o({0)o(.6)o(pt)o(}\\\\)o([.)o(6e)o
+(x])o(\045)574 3093 y(\\renewcommand{)o(\\a)o(ut)o(di)o(v})o({,)48
+b(}\045)574 3206 y(\\currentauthor)o(\\@)o(em)o(ai)o(l\\)o(hfi)o(ll)o
+(\\t)o(he)o(pa)o(ge})o(})301 3319 y(\\pagestyle{HC})192
+3432 y(})192 3545 y(\\RequirePackag)o(e{)o(fan)o(cy)o(bo)o(x})192
+3657 y(\\setcounter{to)o(cd)o(ept)o(h})o({3)o(})192 3770
+y(\\renewcommand\\)o(se)o(cti)o(on)o({\\)o(@s)o(ta)o(rt)o(sec)o(ti)o
+(on)g({section}{1}{\\)o(z@})o(\045)301 3883 y({-3.5ex)j(\\@plus)h(-1ex)
+h(\\@minus)e(-.2ex}\045)301 3996 y({2.3ex)h(\\@plus.2ex}\045)301
+4109 y({\\newslide\\nor)o(mal)o(fo)o(nt)o(\\L)o(ar)o(ge)o(\\bf)o(se)o
+(ri)o(es)o(\\s)o(had)o(ow)o(bo)o(x})o(})192 4222 y(\\renewcommand\\)o
+(pa)o(rt{)o(\\c)o(le)o(ar)o(pa)o(ge)1119 4335 y(\\if@twocolumn)1337
+4448 y(\\onecolumn)1337 4561 y(\\@tempswatrue)1228 4674
+y(\\else)1337 4787 y(\\@tempswafalse)1119 4899 y(\\fi)1119
+5012 y(\\secdef\\@part\\@)o(sp)o(ar)o(t})109 5331 y Fr(3.8.1)100
+b(The)28 b(tw)n(otoc)f(option)192 5518 y Fk(\\if@twotoc)p
+eop
+%%Page: 34 35
+34 34 bop 109 -62 a Ft(34)1960 b Fq(4)99 b(German)25
+b(Language)g(De\002nitions)p 109 -10 3544 4 v 301 270
+a Fk(\\RequirePackag)o(e{m)o(ul)o(ti)o(co)o(l})301 383
+y(\\renewcommand*)o(\\ta)o(bl)o(eo)o(fc)o(on)o(ten)o(ts)o({\045)410
+496 y(\\newlength{\\old)o(@c)o(ol)o(um)o(ns)o(epr)o(ul)o(e})410
+609 y(\\setlength{\\old)o(@c)o(ol)o(um)o(ns)o(epr)o(ul)o(e})o({\\)o(co)
+o(lu)o(mns)o(ep)o(ru)o(le)o(})410 722 y(\\setlength{\\col)o(um)o(ns)o
+(ep)o(ru)o(le})o({0)o(.4)o(pt)o(})410 835 y(\\begin{multicol)o(s})o({2)
+o(}[)o(\\s)o(ect)o(io)o(n*)o({\\)o(co)o(nt)o(ent)o(sn)o(am)o(e})o(])410
+948 y(\\@starttoc{toc})o(\045)410 1061 y(\\end{multicols})410
+1173 y(\\setlength{\\col)o(um)o(ns)o(ep)o(ru)o(le})o({\\)o(ol)o(d@)o
+(co)o(lu)o(mns)o(ep)o(ru)o(le)o(})410 1286 y(})192 1399
+y(\\fi)193 1512 y Fm(h)r Fi(=)q Fl(hcslides)q Fm(i)109
+1763 y Fs(4)143 b(German)38 b(Langua)o(g)q(e)f(De\002nitions)109
+1983 y Fh(The)27 b Fe(babel)f Fh(package)h(is)h(loaded)f(with)h(the)f
+(new)g(German)i(orthograpy)d(\(option)h Fe(ngerman)p
+Fh(:)d(this)109 2096 y(r)n(equir)n(es)39 b(a)i(rather)f(new)g(version)g
+(of)g Fe(babel)p Fh(\).)e(The)i(commands)g Fe(\\q)p Fh(,)f
+Fe(\\hq)p Fh(,)g Fe(\\dash)p Fh(,)f Fe(\\Es)h Fh(and)109
+2209 y Fe(\\shorttoday)28 b Fh(ar)n(e)34 b(adapted)e(to)h(the)g(German)
+h(typography)-10 b(.)30 b(The)j Fe(\\enge)e Fh(command)j(is)g(r)n(ede-)
+109 2322 y(\002ned.)20 b(The)i(German)g(B)m Fc(I)r(B)-5
+b Fh(T)1044 2352 y(E)1088 2322 y(X)22 b(style)f Fe(hc-de)f
+Fh(is)i(used)e(by)i(default.)f(The)h(language)f(speci\002c)h(texts)f
+(ar)n(e)109 2435 y(r)n(ede\002ned.)i(The)h(German)i(r)n(ede\002nitions)
+e(of)h(the)g Fe(varioref)d Fh(package)j(do)f(not)h(seem)f(to)h(work,)f
+(so)109 2548 y(the)d(ar)n(e)i(r)n(epeated.)193 2695 y
+Fm(h)r(\003)q Fl(german)r Fm(i)192 2808 y Fk(\\addto{\\captio)o(ns)o
+(nge)o(rm)o(an)o(}{)o(\045)301 2921 y(\\renewcommand{)o(\\ne)o(xt)o(st)
+o(ar)o(tq)o(}{\\)o(gu)o(il)o(le)o(mo)o(tr)o(igh)o(t})301
+3034 y(\\renewcommand{)o(\\ne)o(xt)o(en)o(dq)o(}{)o(\\gu)o(il)o(le)o
+(mo)o(tl)o(ef)o(t})301 3147 y(\\renewcommand{)o(\\ot)o(he)o(rs)o(ta)o
+(rt)o(q}{)o(\\g)o(ui)o(ls)o(in)o(gl)o(rig)o(ht)o(})301
+3260 y(\\renewcommand{)o(\\ot)o(he)o(re)o(nd)o(q})o({\\g)o(ui)o(ls)o
+(in)o(gl)o(le)o(ft})301 3373 y(\\renewcommand{)o(\\hq)o(}[)o(1])o({\\)o
+(gu)o(ils)o(in)o(gl)o(ri)o(gh)o(t{)o(}#1)o(\\g)o(ui)o(ls)o(in)o(gll)o
+(ef)o(t{)o(}})301 3486 y(\\renewcommand{)o(\\fq)o(}[)o(1])o({\\)o(gu)o
+(ill)o(em)o(ot)o(ri)o(gh)o(t{)o(}#1)o(\\g)o(ui)o(ll)o(em)o(otl)o(ef)o
+(t{)o(}})301 3599 y(\\renewcommand{)o(\\da)o(sh)o(}[)o(1])o({-)o(-~#)o
+(1~)o(--)o(})301 3712 y(\\renewcommand{)o(\\sh)o(or)o(tt)o(od)o(ay)o(})
+410 3824 y({\\the\\day.\\the\\)o(mo)o(nt)o(h.)o(\\t)o(wo@)o(di)o(gi)o
+(ts)o({\\)o(th)o(esh)o(or)o(ty)o(ea)o(r})o(\\xs)o(pa)o(ce)o(})301
+3937 y(\\renewcommand{)o(\\en)o(ge)o(}[)o(2])o({#)o(2})301
+4050 y(\\renewcommand{)o(\\bi)o(bl)o(io)o(st)o(yl)o(e}{)o(hc)o(-d)o(e})
+301 4163 y(\\renewcommand{)o(\\co)o(nt)o(en)o(ts)o(na)o(me})o({I)o(nh)o
+(al)o(t})301 4276 y(\\renewcommand{)o(\\ve)o(rs)o(io)o(nt)o(ex)o(t}{)o
+(Ve)o(rs)o(io)o(n)48 b(vom})301 4389 y(\\renewcommand{)o(\\ac)o(ce)o
+(ss)o(te)o(xt)o(}{Z)o(ug)o(ri)o(ff)g(am})301 4502 y(\\renewcommand{)o
+(\\cf)o(te)o(xt)o(}{)o(vg)o(l.})301 4615 y(\\renewcommand{)o(\\bi)o(bv)
+o(ol)o(te)o(xt)o(}{d)o(er)o(})301 4728 y(\\renewcommand{)o(\\bv)o(te)o
+(xt)o(}{)o(Bd)o(.})301 4841 y(\\renewcommand{)o(\\bi)o(bd)o(ir)o(}{)o
+(Re)o(gie)g(})301 4954 y(\\renewcommand{)o(\\bi)o(bm)o(ov)o(te)o(xt)o
+(}{S)o(pi)o(el)o(fi)o(lm)o(})301 5066 y(\\renewcommand{)o(\\bi)o(ba)o
+(ct)o(or)o(sb)o(efo)o(re)o(}{)o(Mi)o(t})301 5179 y(\\renewcommand{)o
+(\\bi)o(ba)o(ct)o(or)o(sa)o(fte)o(r})o({u)o(.a)o(})301
+5292 y(\\renewcommand{)o(\\no)o(ye)o(ar)o(}{)o(o.)o(J.})301
+5405 y(\\renewcommand{)o(\\no)o(ad)o(dr)o(es)o(s})o({o.)o(O.)o(})301
+5518 y(\\renewcommand{)o(\\ot)o(he)o(ra)o(bs)o(tr)o(act)o(na)o(me)o(}{)
+o(Ab)o(st)o(rac)o(t})p eop
+%%Page: 35 36
+35 35 bop 109 -62 a Fq(4)99 b(German)25 b(Language)g(De\002nitions)1961
+b Ft(35)p 109 -10 3544 4 v 301 270 a Fk(\\renewcommand{)o(\\ke)o(yw)o
+(or)o(ds)o(na)o(me)o(}{S)o(ch)o(l\\)o("u)o(ss)o(elw)o(\\")o(or)o(te)o
+(r})301 383 y(\\renewcommand{)o(\\se)o(et)o(ex)o(t})o({s)o(ie)o(he})192
+496 y(})192 609 y(\\if@euro)301 722 y(\\addto{\\captio)o(nsn)o(ge)o(rm)
+o(an)o(}{)o(\045)410 835 y(\\renewcommand{\\)o(Es)o(}[)o(1])o({#)o(1\\)
+o(nob)o(re)o(ak)o(\\,)o(\\E)o(})301 948 y(})192 1061
+y(\\fi)192 1173 y(\\if@fancyref)410 1286 y(\\def\\reftextfac)o(ea)o(ft)
+o(er)48 b({auf)53 b(der)g(n\\"achsten)d(Seite}\045)410
+1399 y(\\def\\reftextfac)o(eb)o(ef)o(or)o(e{)o(au)o(f)f(der)k
+(vorherigen)d(Seite}\045)410 1512 y(\\let\\reftextaft)o(er)266
+b(\\reftextfaceaf)o(ter)410 1625 y(\\let\\reftextbef)o(or)o(e)212
+b(\\reftextfacebe)o(for)o(e)410 1738 y(\\def\\reftextcur)o(re)o(nt)157
+b({auf)53 b(dieser)e(Seite}\045)410 1851 y(\\def\\reftextfar)o(aw)o(ay)
+o(#1)o({a)o(uf)d(Seite~\\pageref{)o(#1)o(}})o(\045)410
+1964 y(\\def\\reftextpag)o(er)o(an)o(ge)o(#1)o(#2)o({au)o(f)574
+2077 y(Seiten~\\pagere)o(f{)o(#1)o(}-)o(-\\)o(pag)o(er)o(ef)o({#)o(2})o
+(}\045)410 2190 y(\\def\\reftextlab)o(el)o(ra)o(ng)o(e#)o(1#)o(2{\\)o
+(re)o(f{)o(#1)o(})g(bis~\\ref{#2}}\045)192 2303 y(\\fi)193
+2415 y Fm(h)r Fi(=)q Fl(german)r Fm(i)p eop
+%%Trailer
+end
+userdict /end-hook known{end-hook}if
+%%EOF