diff options
Diffstat (limited to 'macros/latex/contrib/aiaa')
32 files changed, 30322 insertions, 0 deletions
diff --git a/macros/latex/contrib/aiaa/README b/macros/latex/contrib/aiaa/README new file mode 100644 index 0000000000..3d1f4b1649 --- /dev/null +++ b/macros/latex/contrib/aiaa/README @@ -0,0 +1,15 @@ +This is the file `README' for version 3.6 of the `aiaa' LaTeX package. + +Run aiaa.ins through LaTeX to produce the files aiaa-tc.cls and aiaa.bst. + +This distribution provides a LaTeX class (aiaa-tc.cls) and +bibliography style file (aiaa.bst) that are used to create AIAA +technical conference papers. The distribution also contains a +Users Manual (aiaa.pdf), AIAA paper submission instructions +(author_guide.pdf) and two templates, a bare-bones template and +an advanced template. + +For further details and support, read the Users Manual, aiaa.pdf. + +This software is released under the terms of the LaTeX Project Public +License. Copyright (C) 2004 by Bil Kleb, Bill Wood, and Erich Knausenberger. diff --git a/macros/latex/contrib/aiaa/aiaa.dtx b/macros/latex/contrib/aiaa/aiaa.dtx new file mode 100644 index 0000000000..ab606fb7b2 --- /dev/null +++ b/macros/latex/contrib/aiaa/aiaa.dtx @@ -0,0 +1,2189 @@ +% +% \iffalse +%% Description: LaTeX package for AIAA technical conference papers. +%% Keywords: LaTeX, class, AIAA, BibTeX, bibliographic-style +%% Author: Bil Kleb, Bill Wood, Erich Knausenberger +%% Maintainer: same +%% Version: 3.6 <23 May 2004> +%% +%% Run (PDF)LaTeX on `aiaa.dtx' to obtain a Users Manual and code +%% documentation. Note: to get detailed code documentation you need to +%% comment out the \OnlyDescription line in `aiaa.dtx'. +%% +%% See `aiaa.ins' and the Users Manual for installation instructions. +%% +% \fi +% +% \def\filename{aiaa.dtx} +% \def\fileversion{3.6} +% \def\filedate{2004/05/23} +% \def\docdate{\filedate} +% \date{\docdate} +% +% \newcommand*{\cls}[1]{\textsf{#1}} +% \newcommand*{\pkg}[1]{\textsf{#1}} +% \newcommand*{\file}[1]{\texttt{#1}} +% \newcommand*{\kbd}[1]{\texttt{#1}} +% +% \MakeShortVerb{\|} +% +% \CheckSum{524} +% +%% \CharacterTable +%% {Upper-case \A\B\C\D\E\F\G\H\I\J\K\L\M\N\O\P\Q\R\S\T\U\V\W\X\Y\Z +%% Lower-case \a\b\c\d\e\f\g\h\i\j\k\l\m\n\o\p\q\r\s\t\u\v\w\x\y\z +%% Digits \0\1\2\3\4\5\6\7\8\9 +%% Exclamation \! Double quote \" Hash (number) \# +%% Dollar \$ Percent \% Ampersand \& +%% Acute accent \' Left paren \( Right paren \) +%% Asterisk \* Plus \+ Comma \, +%% Minus \- Point \. Solidus \/ +%% Colon \: Semicolon \; Less than \< +%% Equals \= Greater than \> Question mark \? +%% Commercial at \@ Left bracket \[ Backslash \\ +%% Right bracket \] Circumflex \^ Underscore \_ +%% Grave accent \` Left brace \{ Vertical bar \| +%% Right brace \} Tilde \~} +% +% \title{% +% AIAA\thanks{American Institute of Aeronautics and Astronautics.}\ \ +% \LaTeX{} Package Users Manual\thanks{This document describes +% \textsf{aiaa} version \fileversion\ that came of age on \docdate.} +% } +% +% \author{% +% Bil Kleb\thanks{Research Scientist} +% \ and Bill Wood\textsuperscript{\ensuremath{\ddagger}}\\ +% {\normalsize\itshape NASA, Hampton, Viriginia}\\ +% \and +% Erich Knausenberger\thanks{Business Developer}\\ +% {\normalsize\itshape AIAA, Reston, Virginia} +% } +% +% \date{\vspace{-5ex}} +% +% \maketitle +% +% \begin{abstract} +% This document describes the \textsf{aiaa} \LaTeX\ package that +% provides a \LaTeX\ class (\file{aiaa-tc.cls}) and \BibTeX\ +% bibliography style file (\file{aiaa.bst}). +% The files in this package are used to create AIAA technical conference +% papers. +% The package also contains a users manual (you are looking at it) and +% two templates, a bare-bones sample and an advanced sample. +% \end{abstract} +% +% \tableofcontents +% +% \section{Introduction} +% +% The AIAA class works by loading the standard \LaTeX\ article class and +% several LaTeX packages, and then making modifications and extensions +% to suit the AIAA layout requirements.\footnote{% +% The older, unofficial AIAA distribution that yields two-column layout +% is available in the distribution's `pre2004' subdirectory.} +% The AIAA \BibTeX\ style file was created with Daly's makebst program +% and then tweaked according to AIAA conventions. +% In addition, abbreviations for the AIAA journals and more common +% aerospace journals were added. +% +% \subsection{Requirements} +% +% To make use of the AIAA technical conferenece paper class and process +% the AIAA bare-bones template, you will need the following files:\\[3pt] +% \begin{tabular}{llll} +% \cls{article.cls} &\pkg{graphicx.sty}&\pkg{array.sty} &\pkg{setspace.sty}\\ +% \pkg{overcite.sty}&\pkg{lastpage.sty}&\pkg{fancyhdr.sty} +% \end{tabular}\\[3pt] +% These should be included as part of your \TeX\ distribution. +% Note: \pkg{setspace} is only necessary if using the |submit| class +% option described below. +% +% To explore some of \LaTeX's more advanced features such as imbedded +% figures, tables with footnotes, hyperlinks, subfigures, dropped +% capitals at the beginning of paragraphs, automatic nomenclature +% collection and sorting, and bibliography generation that are +% demonstrated in the advanced template, you will need the following +% \LaTeX\ packages,\\[3pt] +% \begin{tabular}{rl} +% \pkg{ifthen} & plain text conditionals \\ +% \pkg{dcolumn} & decimal-aligned tabular math columns \\ +% \pkg{fancyvrb} & extended verbatim environments \\ +% \pkg{subfigure} & subcaptions for subfigures \\ +% \pkg{nomencl} & nomenclature generation via Makeindex \\ +% \pkg{hyperref} & hyperlinks such as email or URLs \\ +% \pkg{threeparttable} & tables with footnotes \\ +% \pkg{wrapfig} & integrate figures and tables in text +% (i.e., DiVinci style) \\ +% +% \pkg{lettrine} & dropped capital letter at beginning of paragraph \\ +% \pkg{subfigmat} & matrices of similar subfigures, aka small multiples \\ +% \pkg{dropping} & an alternative dropped capital letter package +% \end{tabular}\\[3pt] +% \noindent The above packages are ordered according to the likelihood +% that they are included with any given \TeX\ distribution. +% The last three you will most likely have to download from CTAN +% (\href{http://www.ctan.org}{www.ctan.org}) and add to your \TeX\ +% distribution according to its instructions for adding new packages, or +% just place them in your local working directory. +% Please see the Known Problems section before exploring the advanced example. +% +% \subsection{User's Manual} +% +% A PDF version of this Users Manual is provided as part of the distribution. +% It was created by processing \file{aiaa.dtx} with \kbd{pdflatex}. +% Of course a PostScript version can be made by using \kbd{latex}. +% +% If you are new to LaTeX, you should first read {\it A (not so) Short +% Introduction to \LaTeX, or \LaTeX\ in 131 minutes}, which is +% available in a variety of languages from the Comprehensive \TeX\ +% Archive Network (CTAN) website, +% \href{http://www.ctan.org/tex-archive/info/lshort/}% +% {www.ctan.org/tex-archive/info/lshort/}. +% +% \subsection{Installation and Setup} +% +% If you have not already run \file{aiaa.ins} through \LaTeX{}, do so. +% The \pkg{docscript} utility (part of \LaTeX{}) will rip the code +% segments out of \file{aiaa.dtx} and save them in several files. +% If you encounter an error on installation like:\\[5pt] +% | ! Undefined control sequence|\\ +% | \batchLine -> generate|\\ +% | {\file {aiaa-tc.cls}{\from{aiaa.dtx}{class}}}|\\ +% | 1.728 \processbatchFile|\\[5pt] +% it means that your \pkg{docstrip} is very old and that you will need +% to update your \TeX\ distribution to take advantage of the AIAA package. +% +% Move \file{aiaa-tc.cls} to a directory searched by \TeX\footnote{% +% For a Unix te\TeX{} installation, a privileged user could +% put these files in a directory named something like +% \kbd{/usr/local/share/texmf/tex/latex/aiaa}\ for the entire site to +% use, remembering to run \kbd{texhash} to reconfigure te\TeX{} to +% search the new directory; or, a lowly user could make their own +% directory, e.g., \kbd{$\sim$/tex/inputs}, put the files in +% there, and set the environment variable \kbd{TEXINPUTS} via +% `\kbd{setenv TEXINPUTS $\sim$/tex/inputs:}'. +% The colon represents the system search path so, in this case, the user +% files take precedence. +% On a Mac or PC installation put these files in a folder named +% something like \file{TeX-inputs}.} +% and the file \file{aiaa.bst} to a directory searched by +% \BibTeX.\footnote{% +% Similar to preceding footnote, only on Unix, use the +% environment variable \kbd{BSTINPUTS} for the bibliographic style file +% and \kbd{BIBINPUTS} for the bibliographic database; for Mac's, use the +% \file{BibTeX-inputs} folder, failing that try using the +% \file{TeX-inputs} folder.} +% Once things are installed, try to \LaTeX\ the bare-bones template. +% It should produce something similar to the existing PDF copy. +% +% \section{Usage} +% +% The AIAA class is envoked by including\\[5pt] +% | \documentclass[|{\itshape options}|]{aiaa-tc}|\\[5pt] +% at the beginning of your document. +% The AIAA class recognizes a |handcarry| option that places paper +% number, conference information, and copyright information in the paper +% when hand carrying papers to a ``loose papers'' conference, and a +% `submit' option that increases font size and line spacing. +% Other cptions are passed on to \LaTeX's \cls{article} class that is +% subsequently loaded by the AIAA class.\footnote{% +% For example, the \kbd{draft} option replaces figures with a +% labeled box of the appropriate size and graphically depicts lines that +% overrun the right margin (overfull boxes).} +% The document is written just like one were using the standard \LaTeX{} +% \cls{article} document class; and thus, usage is well documented by +% others in various \LaTeX{} books~\cite{companion,guide,latex}. +% However, some of the stock commands have slightly different behaviors +% and there are a few new commands designed to make life a little brighter; +% these are discussed in the following sections. +% +% \subsection{General Commands} +% +% Several standard \LaTeX{} commands have been modified to behave +% slightly differently in the \cls{aiaa-tc} class. +% In addition, several new commands have been introduced to ease +% document preparation. +% Both types are discussed in the following subsections. +% +% \subsubsection{New Behavior from Standard Commands} +% +% \DescribeMacro{\date} +% \DescribeMacro{\maketitle} +% The \cls{aiaa-tc} class does not typeset the |\date| command as part of +% |\maketitle|. +% Standard \LaTeX{} behavior of |\maketitle| is to typeset the current +% date as part of the title section. +% one would have to issue a command like, |\date{\vspace{-5ex}}|, +% to eliminate the date and removed the space created for it. +% +% \DescribeEnv{abstract} +% The |abstract| environment has been redefined within the \cls{aiaa-tc} +% class to produce slightly different typesetting. +% It now produces an indented block of text set in a smaller, bold font. +% This environment should be placed after your |\maketitle|. +% +% \DescribeMacro{\section} +% \DescribeMacro{\subsection} +% \DescribeMacro{\subsubsection} +% \DescribeMacro{\paragraph} +% \DescribeMacro{\subparagraph} +% The counters, fonts, sizes, and positions normally produced by +% these commands have been modified to produce AIAA layout guidelines. +% +% \subsubsection{New Command} +% +% \DescribeMacro{\thanksibid} +% The command |\thanksibid| is very similar to the standard +% |\thanks| command which is used when footnoting +% the author affliations within the |\author| field. +% The distinction is that the |\thanksibid| command allows one +% to repeat a given footnote symbol without repeating the associated +% footnote text. For example,\\[3pt] +% | \author{%|\\ +% | Peter Gnoffo,%|\\ +% | \thanks{Title, department, address, and member grade.}|\\ +% | Bil Kleb,%|\\ +% | \thanks{Title, department B, address, and member grade.}|\\ +% | Bill Wood,%|\\ +% | \thanksibid{2}%| \textit{use the same footnote as the second author.}\\ +% | \ and|\\ +% | Marge Myth%|\\ +% | \thanks{Title, department C, address, and member grade.}|\\ +% | }|\\[3pt] +% Thus, |\thanksibid{2}| would only produce a footnote symbol +% at the end of Bill Wood's name and it would not generate +% any footnote text. +% Note that using the |\thanksibid| command does not increment the +% footnote counter, so for the case given above, an argument of |4| +% would not be a valid choice. +% +% \subsection{Hand Carry Information} +% +% \DescribeMacro{handcarry} +% The following commands are used to load information that is +% used by the |handcarry| class option. +% For example,\\[3pt] +% | \documentclass[handcarry]{aiaa-tc}|\\[3pt] +% The following commands are used produce appropriate headers and footers +% All of these commands are normally set in the preamble +% of your document (similar to |\author| and |\title|).\footnote{% +% The preamble is defined as anywhere between the +% \cs{documentclass}\texttt{\string{\string}} and +% \cs{begin}\texttt{\string{document\string}} commands.} +% +% \DescribeMacro{\AIAApapernumber} +% \DescribeMacro{\AIAAconference} +% \DescribeMacro{\AIAAcopyright} +% The commands |\AIAApapernumber|, |\AIAAconference|, and |\AIAAcopyright| +% are used to put appropriate items in the header and footer of each page. +% The contents of |\AIAApapernumber| is placed in the footer while the +% contents of |\AIAAconference| is placed in the header. +% For example,\\[3pt] +% | \AIAAapernumber{2004-3932}|\\ +% | \AIAAConference{16th AIAA Fluid Dynamics Conference,|\\ +% | June 6--8, Portland, Oregon}|\\[3pt] +% A footnote describing the copyright conditions +% and other information about the document are incorporated via the +% |\AIAAcopyright|. +% This command should be loaded with one of the the copyright series +% of commands: |\CopyrightA|, |\CopyrightB|, |\CopyrightC|, or +% |\CopyrightD|, described below. +% To use, simply include something like the following in +% the your document's preamble:\\[3pt] +% | \AIAAcopyright{\CopyrightA{2004}}|\\[3pt] +% \DescribeMacro{\CopyrightA} +% \DescribeMacro{\CopyrightB} +% \DescribeMacro{\CopyrightC} +% \DescribeMacro{\CopyrightD} +% \DescribeMacro{\CopyrightDAPL} +% where the specific copyright commands will expand to one of the standard AIAA +% forms: A, B, C, D, or D-APL. +% Note: they each have different arguments, or no arguments, depending +% on their requirements,\\[3pt] +% | \CopyrightA{|\textit{year}|}|\\ +% | \CopyrightB{|\textit{year}|}{|\textit{full name or company}|}|\\ +% | \CopyrightC|\\ +% | \CopyrightD{|\textit{year}|}|\\ +% | \CopyrightDAPL{|\textit{year}|}|\\[3pt] +% See AIAA copyright instructions for which form to use. +% +% \subsection{Journal Submission} +% +% \DescribeMacro{submit} +% The |submit| option class option that is invoked as follows,\\[3pt] +% | \documentclass[submit]{aiaa-tc}|\\[3pt] +% \DescribeMacro{\AIAAsubmitinfo} +% will increase the font size and line spacing as well as place a +% running footer according to the contents of |\AIAAsubmitinfo|. +% For example,\\[3pt] +% | \AIAAsubmitinfo{Abbreviated Title, AuthorsLastName et al}|\\[3pt] +% will place an abbreviated title and the authors last name at the +% bottom of each page. +% +% \subsection{Making Modifications} +% +% If you feel the need to modify the behavior of items in +% \cls{aiaa-tc.cls}, simply cut the section you want to change and save +% it to a file named \file{myaiaamods.sty}. +% Then modify the code in \file{myaiaamods.sty} to suit your needs and +% include it in your document via |\usepackage{myaiaamods}| in the +% preamble. +% +% \subsection{Getting Help} +% +% For general questions related to AIAA papers, procedures, and guidelines, +% send email to +% \href{mailto:Paper_Tech_Support@AIAA.Org}{Paper\_Tech\_Support@AIAA.Org}. +% For help /specific/ to this AIAA \LaTeX\ distribution, send email to +% \href{mailto:LaTeX_Support@AIAA.Org}{LaTeX\_Support@AIAA.Org}. +% +% For general \LaTeX\ help, see the {\it The (not so) Short Introduction +% to \LaTeX} mentioned above, {\it \LaTeX: A Document Preparation +% System} (2nd ed.) by Lamport, and {\it The LaTeX Companion} (2nd ed.) +% by Mittelbach et al.~\cite{companion} +% For more specific \LaTeX\ help, do a Google `groups' search on the +% comp.text.tex USENET newsgroup and explore the \TeX\ User Group's frequently +% asked questions site last seen at +% \href{http://www.tex.ac.uk/cgi-bin/texfaq2html}% +% {www.tex.ac.uk/cgi-bin/texfaq2html}. +% If these avenues fail to answer your question, read +% \href{http://www.tex.ac.uk/cgi-bin/texfaq2html?label=askquestion}% +% {www.tex.ac.uk/cgi-bin/texfaq2html?label=askquestion} +% and post a question to the \href{news:comp.text.tex}{comp.text.tex} +% USENET newsgroup. +% (Posting is available through \href{http://www.google.com/}{Google}.) +% +% For an extensive guide to using Encapsulated PostScript in \LaTeX, see +% Keith Reckdahl's \file{epslatex} document available from CTAN's \file{info} +% directory, +% \href{http://www.ctan.org/tex-archive/info/}{www.ctan.org/tex-archive/info/} +% or various \LaTeX{} reference books. +% +% Especially helpful in locating various \LaTeX{} packages is +% the \kbd{Catalogue.html} web page found in the \file{help/Catalogue} +% directory of CTAN. +% +% \subsection{Known Problems} +% +% The bibliographic style sheet |aiaa.bst| isn't fully tested; and thus, +% you may need to fiddle with your |.bbl| file for your final copy, +% i.e., edit |file.bbl| after running a \LaTeX{}, \BibTeX, \LaTeX\ +% sequence, but before running \LaTeX{} the final time. +% Note: If you run \BibTeX\ after modifying |file.bbl|, you will lose +% your modifications when \LaTeX\ is run again. +% +% To typeset the advanced example, you will need a fairly complete \LaTeX{} +% distribution, and even then you will probably need to download packages +% like \pkg{dropping} or \pkg{lettine} as described in the Requirements +% section. +% Also, some packages will need to be newer than 2002 or so. +% For example, older versions of the \pkg{nomenclature} package will +% given an error like\\[3pt] +% | ! Undefined control sequence.| +% | <argument> \nomitemsep | +% while older versions of the \pkg{geometry} package will give\\[3pt] +% | ERROR: Package keyval Error: No value specified for paper.| +% +% \subsection{Sending a Bug Report} +% +% Reports of bugs in the AIAA package are most welcome. +% Before filing a bug report, please take the following actions: +% \begin{enumerate} +% \item Verify your problem is not due to your own input file(s) +% styles sheet(s), or package(s); +% \item Check to see if your problem is documented in the preceeding +% section; +% \item Try to isolate the problem by writing a {\it minimal} \LaTeX\ +% input file which reproduces the unexpected behavior and then: +% \begin{enumerate} +% \item Include the command\\ +% | \setcounter{errorcontextlines}{50}|\\ +% in the preamble of your document to provide extra context when +% things go awry; +% \item Run your file through \LaTeX{}; +% \item Send a description of your problem, the input file and the +% log file via e-mail to: +% \href{mailto:LaTeX_Support@AIAA.Org?subject=bug}% +% {LaTeX\_Support@AIAA.Org}. +% \end{enumerate} +% \end{enumerate} +% +% \section{Acknowledgments} +% +% Foremost, the authors would like to thank all of those that took the +% time to ask questions, give comments, or provide suggestions: +% Karen Bibb, Steve Alter, Meelan Choudhari, Donald Arseneau, Ed Kerschen, +% Paolo Lisandrin, Mark Woodmansee, Dominique Pelletier, Manual Cruz, +% Martin Sanchez, Chris Rumsey, Ray Chase, +% and Tadashi Minowa. +% Without their feedback, this package would wither.\footnote{% +% Hint: If you want to be listed in future versions of this document, +% send kudos, comments, and so on to +% \href{mailto:LaTeX_Support@AIAA.Org}{LaTeX\_Support@AIAA.Org}.} +% +% Bundling and documenting this \pkg{aiaa} package in docstrip +% format was done by using other packages as a model, +% particularly, Mats Dahlgren's \pkg{dropping}~\cite{dropping} +% and Jeff Goldberg et al.'s \pkg{endfloat}~\cite{endfloat}. +% +% Finally, the first author would like to thank the people of the +% |comp.text.tex| newsgroup, the \TeX\ Users Group Frequently Asked +% Questions maintainers, and various package authors for patiently +% answering my inane questions, in particular, but in no particular order: +% Donald Arsenau, Robin Fairbairns, Piet van Oostrum, Jeroen Nijhof, +% Steven Douglas Cochran, Herbert Voss, Jeffrey Goldberg, Mark Wooding, +% Paul Foley, David Kastrup, Jerry Leichter, Patrick Daly, David +% Carlisle, Edward Sznyter, and Jim Hefferon. +% +% \begin{thebibliography}{1} +% +% \bibitem{companion} +% Frank Mittelbach, Michel Goossens, Johannes Bramms, David Carlisle, +% and Chris Rowley. +% \newblock{\em The {\LaTeX} Companion}. +% \newblock 2nd ed. +% \newblock Addison-Wesley, Reading, Massachusetts, 2004. +% +% \bibitem{guide} +% Helmut Kopka and Patrick W. Daly. +% \newblock{\em A Guide to {\LaTeXe}: Tools and Techniques for Computer +% Typesetting}. +% \newblock 4th ed. +% \newblock Addison-Wesley, Reading, Massachusetts, 2003. +% +% \bibitem{latex} +% Leslie Lamport. +% \newblock{\em {\LaTeX}: A Document Preparation System}. +% \newblock 2nd ed. +% \newblock Addison-Wesley, Reading, Massachusetts, 1994. +% +% \bibitem{dropping} +% Mats Dahlgren. +% \newblock \pkg{dropping}---A \LaTeX{} Macro for Dropping +% the First Character(s) of a Paragraph. +% \newblock June 1996. (version~0.1) +% \newblock Electronic Documentation. +% +% \bibitem{graphicx} +% David Carlisle. +% \newblock Packages in the `graphics' bundle. +% \newblock December 1995. +% \newblock Electronic Documentation. +% +% \bibitem{endfloat} +% James Darrell McCauley and Jeff Goldberg. +% \newblock The \texttt{endfloat} Package. +% \newblock October 1995. (version~2.4i) +% \newblock Electronic Documentation. +% +% \end{thebibliography} +% +% \section{Code Documentation} +% +% For the interested reader, the following sections can be made to +% contain a documented verion of the class code and bibliographic style file. +% These detailed coding bits are not included in the Users Manual by +% default. +% If you want to see these in typeset form, you need to comment +% out the |\OnlyDescription| line in the |<driver>| section of +% \file{aiaa.dtx} and process \file{aiaa.dtx} with (PDF)\LaTeX. +% +% \begin{macrocode} +%<*driver> +\documentclass{ltxdoc} + \usepackage[colorlinks]{hyperref} + \OnlyDescription % comment out to typeset class and bibstyle code +\begin{document} + \DocInput{aiaa.dtx} +\end{document} +%</driver> +% \end{macrocode} +% +% \StopEventually{\PrintChanges} +% +% \subsection{The Class} +% +% First, the opening header: +% \begin{macrocode} +%<*class> +%% +%% `aiaa-tc.cls' - A LaTeX class to create AIAA technical conference papers. +%% +%% The basic approach is to load the LaTeX article class and various +%% standard LaTeX packages, and then make modifications and extensions to +%% conform to AIAA's guidelines. +%% +%% To use, simply select this class file in your LaTeX document. For example, +%% +%% \documentclass{aiaa-tc} +%% +%% Class options: +%% +%% handcarry - used for hand carrying a paper to a 'loose papers' +%% conference. It adds the conference name to the +%% top of the first page, paper number to the bottom +%% of each page, and a copyright notice on the bottom +%% of the first +%% +%% submit - produces output typically required for journal submission, +%% i.e., 12pt font and 'double spacing'. +%% +%% plus those accepted by the standard article class such as 'draft'. +%% +%% Class-specific commands: +%% +%% \thanksibid{} - Reuses \thanks footnote symbol from previous +%% author specified by position in \author command. +%% For example, `someone\thanksibid{2}' will reuse the +%% footnote symbol from the second author for 'someone' +%% without producing a repeated footnote at the bottom. +%% +%% \AIAApapernumber{} - For use with 'handcarry' option. +%% \AIAAconference{} - Ditto. +%% \AIAAcopyright{} - Ditto. Must be filled with one of the +%% various copyright types: \AIAAcopyrightA{year}, +%% \AIAAcopyrightB{year}{holder}, \AIAAcopyrightC, +%% \AIAAcopyrightD{year}, or \AIAAcopyrightDAPL{year}. +%% +%% \AIAAsubmitinfo{} - Footer information used by 'submit' option. +%% +%% For support, further details, and a documented version of this class, +%% please read the Users Manual, aiaa.pdf, and the templates that come +%% with the AIAA LaTeX distribution. +%% +%% Wish list: +%% +%% o fine tune hyperref behavior, especially footnote behavior +%% +%% o an \appendix command to switch section styles, counters, etc. +%% +%% o leave space for copyright notice so that handcarry option does +%% not alter pagination. +%% +% \end{macrocode} +% The class identifies itself: +% \begin{macrocode} +\NeedsTeXFormat{LaTeX2e} +\ProvidesClass{aiaa-tc}[2004/04/03 v3.5 AIAA technical conference paper] +% \end{macrocode} +% \begin{macro}{handcarry} +% \begin{macro}{submit} +% Option and associated flag. +% Note that the flag is set when an option is processes, so that it is +% overrides the default. +% \begin{macrocode} +\newif\if@aiaa@handcarry +\newif\if@aiaa@submit +\@aiaa@handcarryfalse +\@aiaa@submitfalse +\DeclareOption{handcarry}{\@aiaa@handcarrytrue\@aiaa@submitfalse} +\DeclareOption{submit}{\@aiaa@submittrue\@aiaa@handcarryfalse} +% \end{macrocode} +% \end{macro} +% \end{macro} +% Pass all unknown options on to the \LaTeX\ article class +% and process them. +% Note: Options are processed in order of the |\DeclareOption| +% commands in this file, so if you want one to take precedence +% over all the other options, process it last. +% \begin{macrocode} +\DeclareOption*{\PassOptionsToClass{\CurrentOption}{article}% + \typeout{Unknown option: passing ``\CurrentOption" + option on to the standard LaTeX article class.}} +\ProcessOptions +% \end{macrocode} +% Unless this is a journal submisssion, load the \LaTeX{} standard +% article class with |letterpaper| and |10pt| options. +% \begin{macrocode} +\if@aiaa@submit + \LoadClass[letterpaper,12pt]{article} +\else + \LoadClass[letterpaper,10pt]{article} +\fi +% \end{macrocode} +% Load packages used by this class. +% \begin{macrocode} +\RequirePackage[margin=1in,top=0.75in,headheight=\baselineskip]% + {geometry}% page layout +\RequirePackage{graphicx}% images +\RequirePackage{array}% extra row height +\RequirePackage{overcite}% superscript, sorted, compressed citation commands +\RequirePackage{lastpage}% to get reference for last page number +\RequirePackage{fancyhdr}% simple control of headers and footers +\if@aiaa@submit + \RequirePackage{setspace}% control line spacing +\fi +% \end{macrocode} +% \begin{macro}{\AIAApapernumber} +% \begin{macro}{\AIAAconference} +% \begin{macro}{\AIAAcopyright} +% \begin{macro}{\AIAAsubmitinfo} +% Define AIAA specific fields: +% \begin{macrocode} +\newcommand*{\AIAApapernumber}[1]{\def\aiaa@papernumber{#1}}\AIAApapernumber{} +\newcommand*{\AIAAconference}[1]{\def\aiaa@conference{#1}}\AIAAconference{} +\newcommand*{\AIAAcopyright}[1]{\def\aiaa@copyright{#1}}\AIAAcopyright{} +\newcommand*{\AIAAsubmitinfo}[1]{\def\aiaa@submitinfo{#1}}\AIAAsubmitinfo{} +% \end{macrocode} +% \end{macro} +% \end{macro} +% \end{macro} +% \end{macro} +% Tie |\intextsep| to |\baselineskip| to more tightly integrate layout +% \begin{macrocode} +\setlength{\intextsep}{0.7\baselineskip \@plus 2\p@ \@minus 1\p@} +% \end{macrocode} +% Change floating defaults to include `here' to promote text/float integration +% \begin{macrocode} +\def\fps@figure{htbp} +\def\fps@table{htbp} +% \end{macrocode} +% \begin{macro}{\AIAAcopyrightA} +% \begin{macro}{\AIAAcopyrightB} +% \begin{macro}{\AIAAcopyrightC} +% \begin{macro}{\AIAAcopyrightD} +% \begin{macro}{\AIAAcopyrightDAPL} +% Define AIAA copyright clauses for use when hand carrying +% \begin{macrocode} +\newcommand{\AIAAcopyrightA}[1]{Copyright \copyright\ #1 by the + American Institute of Aeronautics and Astronautics, Inc. All + rights reserved.}% rev 01/01/2002 +\newcommand{\AIAAcopyrightB}[2]{Copyright \copyright\ #1 by + #2. Published by the American Institute of Aeronautics + and Astronautics, Inc.\ with permission.}% rev 01/01/2002 +\newcommand{\AIAAcopyrightC}{This material is declared a work of the U.S. + Government and is not subject to copyright protection in the + United States.}% rev 01/01/2002 +\newcommand{\AIAAcopyrightD}[1]{Copyright \copyright\ #1 by the American + Institute of Aeronautics and Astronautics, Inc. The U.S. Government + has a royalty-free license to exercise all rights under the copyright + claimed herein for Governmental purposes. All other rights are + reserved by the copyright owner.}% rev 01/01/2002 +\newcommand{\AIAAcopyrightDAPL}[1]{Copyright \copyright\ #1 by the American + Institute of Aeronautics and Astronautics, Inc. Under the copyright + claimed herein, the U.S. Government has a royalty-free license to + exercise all rights for Governmental purposes. All other rights are + reserved by the copyright owner.}% rev 01/01/2002 +% \end{macrocode} +% \end{macro} +% \end{macro} +% \end{macro} +% \end{macro} +% \end{macro} +% \begin{macro}{\aiaa@makecopyright} +% Typeset copyright notice as a footnote of the first page +% \begin{macrocode} +\newcommand\aiaa@makecopyright{% + \begingroup + \renewcommand\thefootnote{} + \if@aiaa@handcarry\footnotetext{\aiaa@copyright}\fi + \endgroup +} +% \end{macrocode} +% \end{macro} +% \begin{macro}{\thanksibid} +% Define |\thanksibid| command to reuse \thanks footnote symbol of a +% previous author +% \begin{macrocode} +\newcounter{aiaa@cthanks} +\newcounter{aiaa@cfootnote} +\newcommand{\thanksibid}[1]{% + \begingroup + \setcounter{aiaa@cfootnote}{\value{footnote}}% store original + \setcounter{aiaa@cthanks}{#1}% + \renewcommand\thefootnote{\fnsymbol{aiaa@cthanks}}% + \footnotemark% + \setcounter{footnote}{\value{aiaa@cfootnote}}% reset to original + \endgroup +} +% \end{macrocode} +% \end{macro} +% \begin{macro}{\maketitle} +% Rework |\maketitle| a bit and remove its |\pagestyle{plain}| [article.cls] +% \begin{macrocode} +\renewcommand\maketitle{\par + \begingroup + \renewcommand\thefootnote{\@fnsymbol\c@footnote}% + \def\@makefnmark{\rlap{\@textsuperscript{\normalfont\@thefnmark}}}% + \long\def\@makefntext##1{\parindent 1em\noindent + \hb@xt@1.8em{% + \hss\@textsuperscript{\normalfont\@thefnmark}}##1}% + \newpage + \global\@topnum\z@ % Prevents figures from going at top of page. + \@maketitle + \@thanks + \endgroup + \setcounter{footnote}{0}% + \renewcommand\thefootnote{\@alph\c@footnote}% change to alpha style footnote + \aiaa@makecopyright + \global\let\thanks\relax + \global\let\thanksibid\relax + \global\let\maketitle\relax + \global\let\@maketitle\relax + \global\let\@thanks\@empty + \global\let\@author\@empty + \global\let\@date\@empty + \global\let\@title\@empty + \global\let\title\relax + \global\let\author\relax + \global\let\date\relax + \global\let\and\relax +} +% \end{macrocode} +% \end{macro} +% \begin{macro}{\@maketitle} +% Add conference name at top and remove date [article.cls] +% \begin{macrocode} +\def\@maketitle{% + \newpage + \null + \begin{center}% + \if@aiaa@handcarry + {\sffamily\scriptsize\aiaa@conference} + \vskip1em + \else + \vskip\baselineskip + \vskip1em + \fi + \let \footnote \thanks + {\LARGE\bfseries \@title \par}% + \vskip 1.5em% + {\large + \lineskip .5em% + \begin{tabular}[t]{c}% + \@author + \end{tabular}\par}% + \end{center}% + \par + \vskip 1.5ex} +% \end{macrocode} +% \end{macro} +% Reduce the quantity of overfull warnings +% \begin{macrocode} +\setlength\hfuzz{2pt} +% \end{macrocode} +% Setup page headers and footers [fancyhdr.sty] +% \begin{macrocode} +\fancyhf{}% clear defaults +\renewcommand{\headrulewidth}{0pt}% turn off default headrule +\cfoot{\footnotesize\normalfont + \thepage\ of \pageref{LastPage}\\ + \rule[.2\baselineskip]{0.5in}{0.2pt}\\ + \if@aiaa@submit + \aiaa@submitinfo + \else + American Institute of Aeronautics and Astronautics + \ifx\aiaa@papernumber\@empty + \relax + \else + \if@aiaa@handcarry Paper \aiaa@papernumber\fi + \fi + \fi} +\pagestyle{fancy} +% \end{macrocode} +% Set graphic defaults [graphicx.sty] +% \begin{macrocode} +\setkeys{Gin}{width=\linewidth,totalheight=\textheight,keepaspectratio} +% \end{macrocode} +% Add some extra space between tabular rows [array.sty] +% \begin{macrocode} +\setlength{\extrarowheight}{2pt} +% \end{macrocode} +% \begin{environment}{\abstract} +% Remove abstract name and add bold font [article.cls] +% \begin{macrocode} +\renewenvironment{abstract}% + {\small\quotation\bfseries}% + {\normalfont\endquotation\normalsize} +% \end{macrocode} +% \end{environment} +% \begin{macro}{\@makecaption} +% Change font and delimeter for captions [article.cls] +% \begin{macrocode} +\long\def\@makecaption#1#2{% + \vskip\abovecaptionskip + \sbox\@tempboxa{\footnotesize\bfseries #1.~~#2}% + \ifdim \wd\@tempboxa >\hsize + \footnotesize\bfseries #1.~~#2\par + \else + \global \@minipagefalse + \hb@xt@\hsize{\hfil\box\@tempboxa\hfil}% + \fi + \vskip\belowcaptionskip} +% \end{macrocode} +% \end{macro} +% Add some belowcaptionskip to make table captions look better [article.cls] +% \begin{macrocode} +\setlength\belowcaptionskip{5pt plus 1pt minus 1pt} +% \end{macrocode} +% Change style of section numbering [article.cls] +% \begin{macrocode} +\renewcommand\thesection {\@Roman\c@section} +\renewcommand\thesubsection {\@Alph\c@subsection} +\renewcommand\thesubsubsection{\@arabic\c@subsubsection} +\renewcommand\theparagraph {\@alph\c@paragraph} +\renewcommand\thesubparagraph {\@roman\c@subparagraph} +\setcounter{secnumdepth}{3}% no counters \paragraph and below +% \end{macrocode} +% \begin{macro}{\@seccntformat} +% Add period after the section counter [latex.ltx] +% \begin{macrocode} +\def\@seccntformat#1{\csname the#1\endcsname.\quad} +% \end{macrocode} +% \end{macro} +% \begin{macro}{\section} +% \begin{macro}{\subsection} +% \begin{macro}{\subsubsection} +% \begin{macro}{\paragraph} +% \begin{macro}{\subparagraph} +% Change style of sections [article.cls] +% \begin{macrocode} +\renewcommand\section{\@startsection {section}{1}{\z@}% + {3.5ex \@plus -1ex \@minus -.2ex}% + {2.3ex \@plus.2ex}% + {\center\normalfont\large\bfseries}} +\renewcommand\subsection{\@startsection{subsection}{2}{\z@}% + {-3.25ex\@plus -1ex \@minus -.2ex}% + {1.5ex \@plus .2ex}% + {\normalfont\normalsize\bfseries}} +\renewcommand\subsubsection{\@startsection{subsubsection}{3}{\z@}% + {-3.25ex\@plus -1ex \@minus -.2ex}% + {1.5ex \@plus .2ex}% + {\normalfont\normalsize\itshape}} +\renewcommand\paragraph{\@startsection{paragraph}{4}{\z@}% + {2.25ex \@plus1ex \@minus.2ex}% + {-1em}% + {\normalfont\normalsize\scshape}} +\renewcommand\subparagraph{\@startsection{subparagraph}{5}{\parindent}% + {2.25ex \@plus1ex \@minus .2ex}% + {-1em}% + {\normalfont\normalfont}} +% \end{macrocode} +% \end{macro} +% \end{macro} +% \end{macro} +% \end{macro} +% \end{macro} +% \begin{macro}{\@biblabel} +% \begin{environment}{thebibliography} +% Redefine bibliography behavior for superscripts and smaller font [article.cls] +% \begin{macrocode} +\renewcommand{\@biblabel}[1]{$^{#1}$} +\renewenvironment{thebibliography}[1]% + {\section*{\refname\@mkboth{\MakeUppercase\refname}% + {\MakeUppercase\refname}}% + \list{\@biblabel{\@arabic\c@enumiv}}% + {\setlength{\leftmargin}{0pt}% + \settowidth{\labelwidth}{\@biblabel{#1}}% + \setlength{\itemindent}{\parindent}% + \advance\itemindent by \labelwidth% + \setlength{\labelsep}{0.0em}% + \setlength{\itemsep}{-\smallskipamount}% + \@openbib@code% + \usecounter{enumiv}% + \let\p@enumiv\@empty% + \renewcommand\theenumiv{\@arabic\c@enumiv}% + \footnotesize% + } + \sloppy\clubpenalty4000\widowpenalty4000% + \sfcode`\.\@m} + {\def\@noitemerr + {\@latex@warning{Empty `thebibliography' environment}}% + \endlist} +% \end{macrocode} +% \end{environment} +% \end{macro} +% Change line spacing if using |submit| option and modify package +% behaviors slightly if they are loaded. +% \begin{macrocode} +\AtBeginDocument{% + \if@aiaa@submit\onehalfspacing\fi +% \end{macrocode} +% \begin{macro}{\tablenotes} +% |threeparttable.sty|---|\footnotesize| notes, reduce the space between +% the superscript and the note, and increase some spacing (|\itemsep| and +% |\topsep|) in the tablenotes environment +% \begin{macrocode} + \@ifundefined{TPT@hsize}{}{% + \def\tablenotes{% + \TPT@hsize + \list{}% + {\footnotesize\topsep4pt \partopsep\z@skip + \itemsep2pt \parsep\z@ \itemindent\z@ \leftmargin1.5em + \def\makelabel##1{\tnote{##1}\hfil}\labelwidth0.5em\labelsep1pt% + \relax}} + }% +% \end{macrocode} +% \end{macro} +% |nomencl.sty| +% \begin{macrocode} + \@ifundefined{nomgroup}{}{% + \RequirePackage{ifthen}% for typesetting groups within nomenclature +% \end{macrocode} +% Single-space nomenclature +% \begin{macrocode} + \setlength{\nomitemsep}{-\parsep} +% \end{macrocode} +% \begin{macro}{\nomgroup} +% Sort nomenclature according to types +% \begin{macrocode} + \renewcommand{\nomgroup}[1]{% + \medskip% + \ifthenelse{\equal{#1}{A}}% + {\relax}% + {\ifthenelse{\equal{#1}{G}}% + {\item []\hspace*{-\leftmargin}% + \emph{Symbols}\hfill\smallskip}% + {\ifthenelse{\equal{#1}{B}}% + {\item []\hspace*{-\leftmargin}% + \emph{Subscripts}\hfill\smallskip}% + {\ifthenelse{\equal{#1}{C}}% + {\item []\hspace*{-\leftmargin}% + \emph{Conventions}\hfill\smallskip}% + {\ifthenelse{\equal{#1}{T}}% + {\item []\hspace*{-\leftmargin}% + \emph{Superscripts}\hfill\smallskip}{}% + }% + }% + }% + }% + }% \nomgroup + }% @ifundefined +}% \AtBeginDocument +% \end{macrocode} +% \end{macro} +% +% \begin{macrocode} +%</class> +% \end{macrocode} +% +% This concludes \cls{aiaa-tc.cls}. +% +% +% \subsection{The Bibliography Style} +% +% \begin{macrocode} +%<*bibstyle> +% +% Note: this file originally created with Daly's custom-bib software +% +ENTRY + { address + author + booktitle + chapter + edition + editor + howpublished + institution + journal + key + month + note + number + organization + pages + publisher + school + series + title + type + volume + year + } + {} + { label } + +INTEGERS { output.state before.all mid.sentence after.sentence after.block } + +FUNCTION {init.state.consts} +{ #0 'before.all := + #1 'mid.sentence := + #2 'after.sentence := + #3 'after.block := +} + +STRINGS { s t } + +FUNCTION {output.nonnull} +{ 's := + output.state mid.sentence = + { ", " * write$ } + { output.state after.block = + { add.period$ write$ + newline$ + "\newblock " write$ + } + { output.state before.all = + 'write$ + { add.period$ " " * write$ } + if$ + } + if$ + mid.sentence 'output.state := + } + if$ + s +} + +FUNCTION {output} +{ duplicate$ empty$ + 'pop$ + 'output.nonnull + if$ +} + +FUNCTION {output.check} +{ 't := + duplicate$ empty$ + { pop$ "empty " t * " in " * cite$ * warning$ } + 'output.nonnull + if$ +} + +FUNCTION {fin.entry} +{ add.period$ + write$ + newline$ +} + +FUNCTION {new.block} +{ output.state before.all = + 'skip$ + { after.block 'output.state := } + if$ +} + +FUNCTION {new.sentence} +{ output.state after.block = + 'skip$ + { output.state before.all = + 'skip$ + { after.sentence 'output.state := } + if$ + } + if$ +} + +FUNCTION {add.blank} +{ " " * before.all 'output.state := +} + +FUNCTION {date.block} +{ + skip$ +} + +FUNCTION {not} +{ { #0 } + { #1 } + if$ +} + +FUNCTION {and} +{ 'skip$ + { pop$ #0 } + if$ +} + +FUNCTION {or} +{ { pop$ #1 } + 'skip$ + if$ +} + +FUNCTION {non.stop} +{ duplicate$ + "}" * add.period$ + #-1 #1 substring$ "." = +} + +FUNCTION {new.block.checka} +{ empty$ + 'skip$ + 'new.block + if$ +} + +FUNCTION {new.block.checkb} +{ empty$ + swap$ empty$ + and + 'skip$ + 'new.block + if$ +} + +FUNCTION {new.sentence.checka} +{ empty$ + 'skip$ + 'new.sentence + if$ +} + +FUNCTION {new.sentence.checkb} +{ empty$ + swap$ empty$ + and + 'skip$ + 'new.sentence + if$ +} + +FUNCTION {field.or.null} +{ duplicate$ empty$ + { pop$ "" } + 'skip$ + if$ +} + +FUNCTION {emphasize} +{ duplicate$ empty$ + { pop$ "" } + { "{\em " swap$ * "\/}" * } + if$ +} + +FUNCTION {capitalize} +{ "u" change.case$ "t" change.case$ } + +FUNCTION {space.word} +{ " " swap$ * " " * } + +FUNCTION {bbl.and} +{ "and"} + +FUNCTION {bbl.editors} +{ "editors" } + +FUNCTION {bbl.editor} +{ "editor" } + +FUNCTION {bbl.edby} +{ "edited by" } + +FUNCTION {bbl.edition} +{ "ed." } + +FUNCTION {bbl.volume} +{ "Vol." } + +FUNCTION {bbl.of} +{ "of" } + +FUNCTION {bbl.number} +{ "No." } + +FUNCTION {bbl.nr} +{ "No." } + +FUNCTION {bbl.in} +{ "in" } + +FUNCTION {bbl.pages} +{ "pp." } + +FUNCTION {bbl.page} +{ "p." } + +FUNCTION {bbl.chapter} +{ "chap." } + +FUNCTION {bbl.techrep} +{ "Tech. Rep." } + +FUNCTION {bbl.mthesis} +{ "Master's thesis" } + +FUNCTION {bbl.phdthesis} +{ "Ph.D. thesis" } + +FUNCTION {bbl.first} +{ "1st" } + +FUNCTION {bbl.second} +{ "2nd" } + +FUNCTION {bbl.third} +{ "3rd" } + +FUNCTION {bbl.fourth} +{ "4th" } + +FUNCTION {bbl.fifth} +{ "5th" } + +FUNCTION {bbl.st} +{ "st" } + +FUNCTION {bbl.nd} +{ "nd" } + +FUNCTION {bbl.rd} +{ "rd" } + +FUNCTION {bbl.th} +{ "th" } + +MACRO {jan} {"Jan."} + +MACRO {feb} {"Feb."} + +MACRO {mar} {"March"} + +MACRO {apr} {"April"} + +MACRO {may} {"May"} + +MACRO {jun} {"June"} + +MACRO {jul} {"July"} + +MACRO {aug} {"Aug."} + +MACRO {sep} {"Sept."} + +MACRO {oct} {"Oct."} + +MACRO {nov} {"Nov."} + +MACRO {dec} {"Dec."} + +MACRO {jan-feb} {"Jan.-Feb."} + +MACRO {mar-apr} {"Mar.-Apr."} + +MACRO {may-jun} {"May-Jun."} + +MACRO {jul-aug} {"Jul.-Aug."} + +MACRO {sep-oct} {"Sep.-Oct."} + +MACRO {nov-dec} {"Nov.-Dec."} + +FUNCTION {eng.ord} +{ duplicate$ "1" swap$ * + #-2 #1 substring$ "1" = + { bbl.th * } + { duplicate$ #-1 #1 substring$ + duplicate$ "1" = + { pop$ bbl.st * } + { duplicate$ "2" = + { pop$ bbl.nd * } + { "3" = + { bbl.rd * } + { bbl.th * } + if$ + } + if$ + } + if$ + } + if$ +} + +MACRO {jsr} {"Journal of Spacecraft and Rockets"} + +MACRO {aa} {"Aerospace America"} + +MACRO {Sb} {"Space News"} + +MACRO {awst} {"Aviation Week \& Space Technology"} + +MACRO {jcp} {"Journal of Computational Physics"} + +MACRO {ijcfd} {"International Journal of Computational Fluid Dynamics"} + +MACRO {ijnme} {"International Journal for Numerical Methods in Engineering"} + +MACRO {acmcs} {"ACM Computing Surveys"} + +MACRO {acta} {"Acta Informatica"} + +MACRO {cacm} {"Communications of the ACM"} + +MACRO {ibmjrd} {"IBM Journal of Research and Development"} + +MACRO {ibmsj} {"IBM Systems Journal"} + +MACRO {ieeese} {"IEEE Transactions on Software Engineering"} + +MACRO {ieeetc} {"IEEE Transactions on Computers"} + +MACRO {ieeetcad} + {"IEEE Transactions on Computer-Aided Design of Integrated Circuits"} + +MACRO {ipl} {"Information Processing Letters"} + +MACRO {jacm} {"Journal of the ACM"} + +MACRO {jcss} {"Journal of Computer and System Sciences"} + +MACRO {scp} {"Science of Computer Programming"} + +MACRO {sicomp} {"SIAM Journal on Computing"} + +MACRO {tocs} {"ACM Transactions on Computer Systems"} + +MACRO {tods} {"ACM Transactions on Database Systems"} + +MACRO {tog} {"ACM Transactions on Graphics"} + +MACRO {toms} {"ACM Transactions on Mathematical Software"} + +MACRO {toois} {"ACM Transactions on Office Information Systems"} + +MACRO {toplas} {"ACM Transactions on Programming Languages and Systems"} + +MACRO {tcs} {"Theoretical Computer Science"} + +INTEGERS { nameptr namesleft numnames } + +FUNCTION {format.names} +{ 's := + #1 'nameptr := + s num.names$ 'numnames := + numnames 'namesleft := + { namesleft #0 > } + { s nameptr + "{vv~}{ll}{, jj}{, f.}" format.name$ 't := + nameptr #1 > + { + namesleft #1 > + { ", " * t * } + { + numnames #2 > + { "," * } + 'skip$ + if$ + t "others" = + { " et~al." * } + { bbl.and space.word * t * } + if$ + } + if$ + } + 't + if$ + nameptr #1 + 'nameptr := + namesleft #1 - 'namesleft := + } + while$ +} + +FUNCTION {format.names.ed} +{ 's := + #1 'nameptr := + s num.names$ 'numnames := + numnames 'namesleft := + { namesleft #0 > } + { s nameptr + "{f.~}{vv~}{ll}{, jj}" + format.name$ 't := + nameptr #1 > + { + namesleft #1 > + { ", " * t * } + { + numnames #2 > + { "," * } + 'skip$ + if$ + t "others" = + { " et~al." * } + { bbl.and space.word * t * } + if$ + } + if$ + } + 't + if$ + nameptr #1 + 'nameptr := + namesleft #1 - 'namesleft := + } + while$ +} + +FUNCTION {format.authors} +{ author empty$ + { "" } + { + author format.names + } + if$ +} + +FUNCTION {format.editors} +{ editor empty$ + { "" } + { + editor format.names + editor num.names$ #1 > + { ", " * bbl.editors * } + { ", " * bbl.editor * } + if$ + } + if$ +} + +FUNCTION {format.in.editors} +{ editor empty$ + { "" } + { editor format.names.ed + } + if$ +} + +FUNCTION {format.title} +{ title empty$ + { "" } + { title + "\enquote{" swap$ * + non.stop + { ",} " * } + { "} " * } + if$ + } + if$ +} + +FUNCTION {end.quote.title} +{ title empty$ + 'skip$ + { before.all 'output.state := } + if$ +} + +FUNCTION {output.bibitem} +{ newline$ + "\bibitem{" write$ + cite$ write$ + "}" write$ + newline$ + "" + before.all 'output.state := +} + +FUNCTION {n.dashify} +{ 't := + "" + { t empty$ not } + { t #1 #1 substring$ "-" = + { t #1 #2 substring$ "--" = not + { "--" * + t #2 global.max$ substring$ 't := + } + { { t #1 #1 substring$ "-" = } + { "-" * + t #2 global.max$ substring$ 't := + } + while$ + } + if$ + } + { t #1 #1 substring$ * + t #2 global.max$ substring$ 't := + } + if$ + } + while$ +} + +FUNCTION {word.in} +{ "" } + +FUNCTION {format.date} +{ year empty$ + { month empty$ + { "" } + { "there's a month but no year in " cite$ * warning$ + month + } + if$ + } + { month empty$ + 'year + { month " " * year * } + if$ + } + if$ +} + +FUNCTION {format.btitle} +{ title emphasize +} + +FUNCTION {tie.or.space.connect} +{ duplicate$ text.length$ #3 < + { "~" } + { " " } + if$ + swap$ * * +} + +FUNCTION {either.or.check} +{ empty$ + 'pop$ + { "can't use both " swap$ * " fields in " * cite$ * warning$ } + if$ +} + +FUNCTION {format.bvolume} +{ volume empty$ + { "" } + { bbl.volume volume tie.or.space.connect + series empty$ + 'skip$ + { bbl.of space.word * series emphasize * } + if$ + "volume and number" number either.or.check + } + if$ +} + +FUNCTION {format.number.series} +{ volume empty$ + { number empty$ + { series field.or.null } + { output.state mid.sentence = + { bbl.number } + { bbl.number capitalize } + if$ + number tie.or.space.connect + series empty$ + { "there's a number but no series in " cite$ * warning$ } + { bbl.in space.word * series * } + if$ + } + if$ + } + { "" } + if$ +} + +FUNCTION {is.num} +{ chr.to.int$ + duplicate$ "0" chr.to.int$ < not + swap$ "9" chr.to.int$ > not and +} + +FUNCTION {extract.num} +{ duplicate$ 't := + "" 's := + { t empty$ not } + { t #1 #1 substring$ + t #2 global.max$ substring$ 't := + duplicate$ is.num + { s swap$ * 's := } + { pop$ "" 't := } + if$ + } + while$ + s empty$ + 'skip$ + { pop$ s } + if$ +} + +FUNCTION {convert.edition} +{ edition extract.num "l" change.case$ 's := + s "first" = s "1" = or + { bbl.first 't := } + { s "second" = s "2" = or + { bbl.second 't := } + { s "third" = s "3" = or + { bbl.third 't := } + { s "fourth" = s "4" = or + { bbl.fourth 't := } + { s "fifth" = s "5" = or + { bbl.fifth 't := } + { s #1 #1 substring$ is.num + { s eng.ord 't := } + { edition 't := } + if$ + } + if$ + } + if$ + } + if$ + } + if$ + } + if$ + t +} + +FUNCTION {format.edition} +{ edition empty$ + { "" } + { output.state mid.sentence = + { convert.edition "l" change.case$ " " * bbl.edition * } + { convert.edition "t" change.case$ " " * bbl.edition * } + if$ + } + if$ +} + +INTEGERS { multiresult } + +FUNCTION {multi.page.check} +{ 't := + #0 'multiresult := + { multiresult not + t empty$ not + and + } + { t #1 #1 substring$ + duplicate$ "-" = + swap$ duplicate$ "," = + swap$ "+" = + or or + { #1 'multiresult := } + { t #2 global.max$ substring$ 't := } + if$ + } + while$ + multiresult +} + +FUNCTION {format.pages} +{ pages empty$ + { "" } + { pages multi.page.check + { bbl.pages pages n.dashify tie.or.space.connect } + { bbl.page pages tie.or.space.connect } + if$ + } + if$ +} + +FUNCTION {format.journal.pages} +{ + pages empty$ + 'skip$ + { duplicate$ empty$ + { pop$ format.pages } + { ", " * bbl.pages "~" * * pages n.dashify * } + if$ + } + if$ +} + +FUNCTION {format.vol.num.pages} +{ volume field.or.null + volume empty$ + 'skip$ + { bbl.volume "~" * swap$ * } + if$ + number empty$ + 'skip$ + { + ", " bbl.nr * number tie.or.space.connect * + volume empty$ + { "there's a number but no volume in " cite$ * warning$ } + 'skip$ + if$ + } + if$ +} + +FUNCTION {format.chapter.pages} +{ chapter empty$ + { "" } + { type empty$ + { bbl.chapter } + { type "l" change.case$ } + if$ + chapter tie.or.space.connect + } + if$ +} + +FUNCTION {format.in.ed.booktitle} +{ booktitle empty$ + { "" } + { editor empty$ + { word.in booktitle emphasize * } + { word.in booktitle emphasize * + ", " * + bbl.edby + * + " " * + format.in.editors * + } + if$ + } + if$ +} + +FUNCTION {empty.misc.check} +{ author empty$ title empty$ howpublished empty$ + month empty$ year empty$ note empty$ + and and and and and + { "all relevant fields are empty in " cite$ * warning$ } + 'skip$ + if$ +} + +FUNCTION {format.thesis.type} +{ type empty$ + 'skip$ + { pop$ + type "t" change.case$ + } + if$ +} + +FUNCTION {format.tr.number} +{ type empty$ + { bbl.techrep } + 'type + if$ + number empty$ + { "t" change.case$ } + { number tie.or.space.connect } + if$ +} + +FUNCTION {format.article.crossref} +{ + key empty$ + { journal empty$ + { "need key or journal for " cite$ * " to crossref " * crossref * + warning$ + "" + } + { word.in journal emphasize * } + if$ + } + { word.in key * " " *} + if$ + " \cite{" * crossref * "}" * +} + +FUNCTION {format.crossref.editor} +{ editor #1 "{vv~}{ll}" format.name$ + editor num.names$ duplicate$ + #2 > + { pop$ " et~al." * } + { #2 < + 'skip$ + { editor #2 "{ff }{vv }{ll}{ jj}" format.name$ "others" = + { " et~al." * } + { bbl.and space.word * editor #2 "{vv~}{ll}" format.name$ * } + if$ + } + if$ + } + if$ +} + +FUNCTION {format.book.crossref} +{ volume empty$ + { "empty volume in " cite$ * "'s crossref of " * crossref * warning$ + word.in + } + { bbl.volume volume tie.or.space.connect + bbl.of space.word * + } + if$ + editor empty$ + editor field.or.null author field.or.null = + or + { key empty$ + { series empty$ + { "need editor, key, or series for " cite$ * " to crossref " * + crossref * warning$ + "" * + } + { series emphasize * } + if$ + } + { key * } + if$ + } + { format.crossref.editor * } + if$ + " \cite{" * crossref * "}" * +} + +FUNCTION {format.incoll.inproc.crossref} +{ + editor empty$ + editor field.or.null author field.or.null = + or + { key empty$ + { booktitle empty$ + { "need editor, key, or booktitle for " cite$ * " to crossref " * + crossref * warning$ + "" + } + { word.in booktitle emphasize * } + if$ + } + { word.in key * " " *} + if$ + } + { word.in format.crossref.editor * " " *} + if$ + " \cite{" * crossref * "}" * +} + +FUNCTION {format.publisher} +{ publisher empty$ + { "empty publisher in " cite$ * warning$ } + 'skip$ + if$ + "" + address empty$ publisher empty$ and + 'skip$ + { + publisher empty$ + { address empty$ + 'skip$ + { address * } + if$ + } + { publisher * + address empty$ + 'skip$ + { ", " * address * } + if$ + } + if$ + } + if$ + output +} + +FUNCTION {article} +{ output.bibitem + format.authors "author" output.check + format.title "title" output.check + end.quote.title + crossref missing$ + { journal + emphasize + "journal" output.check + format.vol.num.pages output + format.date "year" output.check + } + { format.article.crossref output.nonnull + format.pages output + } + if$ + format.journal.pages + note output + fin.entry +} + +FUNCTION {book} +{ output.bibitem + author empty$ + { format.editors "author and editor" output.check + } + { format.authors output.nonnull + crossref missing$ + { "author and editor" editor either.or.check } + 'skip$ + if$ + } + if$ + format.btitle "title" output.check + crossref missing$ + { format.bvolume output + format.number.series output + format.publisher + } + { + format.book.crossref output.nonnull + } + if$ + format.edition output + format.date "year" output.check + note output + fin.entry +} + +FUNCTION {booklet} +{ output.bibitem + format.authors output + format.title "title" output.check + end.quote.title + howpublished output + address output + format.date output + note output + fin.entry +} + +FUNCTION {inbook} +{ output.bibitem + author empty$ + { format.editors "author and editor" output.check + } + { format.authors output.nonnull + crossref missing$ + { "author and editor" editor either.or.check } + 'skip$ + if$ + } + if$ + format.btitle "title" output.check + crossref missing$ + { + format.bvolume output + format.chapter.pages "chapter and pages" output.check + format.number.series output + format.publisher + } + { + format.chapter.pages "chapter and pages" output.check + format.book.crossref output.nonnull + } + if$ + format.edition output + format.date "year" output.check + format.pages "pages" output.check + note output + fin.entry +} + +FUNCTION {incollection} +{ output.bibitem + format.authors "author" output.check + format.title "title" output.check + end.quote.title + crossref missing$ + { format.in.ed.booktitle "booktitle" output.check + format.bvolume output + format.number.series output + format.chapter.pages output + format.publisher + format.edition output + format.date "year" output.check + } + { format.incoll.inproc.crossref output.nonnull + format.chapter.pages output + } + if$ + format.pages "pages" output.check + note output + fin.entry +} + +FUNCTION {inproceedings} +{ output.bibitem + format.authors "author" output.check + format.title "title" output.check + end.quote.title + crossref missing$ + { format.in.ed.booktitle "booktitle" output.check + format.bvolume output + format.number.series output + publisher empty$ + { organization output + address output + } + { organization output + format.publisher + } + if$ + format.date "year" output.check + } + { format.incoll.inproc.crossref output.nonnull + format.pages output + } + if$ + format.pages "pages" output.check + note output + fin.entry +} + +FUNCTION {conference} { inproceedings } + +FUNCTION {manual} +{ output.bibitem + author empty$ + { organization empty$ + 'skip$ + { organization output.nonnull + address output + } + if$ + } + { format.authors output.nonnull } + if$ + format.btitle "title" output.check + author empty$ + { organization empty$ + { + address output + } + 'skip$ + if$ + } + { + organization output + address output + } + if$ + format.edition output + format.date output + note output + fin.entry +} + +FUNCTION {mastersthesis} +{ output.bibitem + format.authors "author" output.check + format.btitle "title" output.check + bbl.mthesis format.thesis.type output.nonnull + school "school" output.check + address output + format.date "year" output.check + note output + fin.entry +} + +FUNCTION {misc} +{ output.bibitem + format.authors output + format.title output + end.quote.title + howpublished output + format.date output + note output + fin.entry + empty.misc.check +} + +FUNCTION {phdthesis} +{ output.bibitem + format.authors "author" output.check + format.btitle "title" output.check + bbl.phdthesis format.thesis.type output.nonnull + school "school" output.check + address output + format.date "year" output.check + note output + fin.entry +} + +FUNCTION {proceedings} +{ output.bibitem + editor empty$ + { organization output } + { format.editors output.nonnull } + if$ + format.btitle "title" output.check + format.bvolume output + format.number.series output + address empty$ + { editor empty$ + { publisher new.sentence.checka } + { organization publisher new.sentence.checkb + organization output + } + if$ + publisher output + format.date "year" output.check + } + { address output.nonnull + format.date "year" output.check + editor empty$ + 'skip$ + { organization output } + if$ + publisher output + } + if$ + note output + fin.entry +} + +FUNCTION {techreport} +{ output.bibitem + format.authors "author" output.check + format.title "title" output.check + end.quote.title + format.tr.number output.nonnull + institution "institution" output.check + address output + format.date "year" output.check + note output + fin.entry +} + +FUNCTION {unpublished} +{ output.bibitem + format.authors "author" output.check + format.title "title" output.check + end.quote.title + note "note" output.check + fin.entry +} + +FUNCTION {default.type} { misc } + +READ + +STRINGS { longest.label } + +INTEGERS { number.label longest.label.width } + +FUNCTION {initialize.longest.label} +{ "" 'longest.label := + #1 'number.label := + #0 'longest.label.width := +} + +FUNCTION {longest.label.pass} +{ number.label int.to.str$ 'label := + number.label #1 + 'number.label := + label width$ longest.label.width > + { label 'longest.label := + label width$ 'longest.label.width := + } + 'skip$ + if$ +} + +EXECUTE {initialize.longest.label} + +ITERATE {longest.label.pass} + +FUNCTION {begin.bib} +{ preamble$ empty$ + 'skip$ + { preamble$ write$ newline$ } + if$ + "\begin{thebibliography}{" longest.label * "}" * + write$ newline$ + "\newcommand{\enquote}[1]{``#1''}" + write$ newline$ +} + +EXECUTE {begin.bib} + +EXECUTE {init.state.consts} + +ITERATE {call.type$} + +FUNCTION {end.bib} +{ newline$ + "\end{thebibliography}" write$ newline$ +} + +EXECUTE {end.bib} +% +%</bibstyle> +% \end{macrocode} +% This concludes \file{aiaa.bst}. +% +% \Finale +% +% $Id: aiaa.dtx,v 1.11 2004/05/23 12:49:43 kleb Exp $ diff --git a/macros/latex/contrib/aiaa/aiaa.ins b/macros/latex/contrib/aiaa/aiaa.ins new file mode 100644 index 0000000000..c0396e1613 --- /dev/null +++ b/macros/latex/contrib/aiaa/aiaa.ins @@ -0,0 +1,65 @@ +% +% `aiaa.ins' - The installation file for the `aiaa' distribution +% +% To obtain the individual components of the AIAA bundle necessary +% to produce a document, process this file with LaTeX, viz, +% +% latex aiaa.ins +% +% The class and bibliography style files will be extracted from the file +% `aiaa.dtx' via the docstrip utility, which is part of LaTeX. +% +% The Users Manual, 'aiaa.pdf', was produced by running 'aiaa.dtx' +% through LaTeX, viz, +% +% latex aiaa.dtx +% +% `aiaa' is based on the standard LaTeX article class and various +% standard packages. Patrick Daly's custom-bib package was used +% to generate the foundations of the AIAA bibliographic style file. + +\def\batchfile{aiaa.ins} +\input docstrip.tex + +\keepsilent +\preamble + +Welcome to the AIAA LaTeX package. + +For further details and support, read the Users Manual, aiaa.pdf. + +This software is released under the terms of the LaTeX Project Public +License. Copyright (C) 2004 by Bil Kleb, Bill Wood, and Erich Knausenberger. + +\endpreamble + +\declarepostamble\bstpostamble +\endpostamble + +\generate{\file{aiaa-tc.cls} {\from{aiaa.dtx}{class}}} +\generate{\usepostamble\bstpostamble% + \file{aiaa.bst} {\from{aiaa.dtx}{bibstyle}}} + +\Msg{::::::::::::::::::::::::::::::::::::::::::::::::::::::::::::::::::::::::} +\Msg{ } +\Msg{ The AIAA class file,} +\Msg{ } +\Msg{ aiaa-tc.cls} +\Msg{ } +\Msg{ needs to be moved into a directory searched by LaTeX.} +\Msg{ } +\Msg{ The bibliography style file,} +\Msg{ } +\Msg{ aiaa.bst} +\Msg{ } +\Msg{ needs to be moved into a directory searched by BibTeX.} +\Msg{ } +\Msg{ The users manual, `aiaa.pdf', contains more detailed installation} +\Msg{ instructions. If you do not have this file, it can be created} +\Msg{ by running the file `aiaa.dtx' through (PDF)LaTeX.} +\Msg{ } +\Msg{::::::::::::::::::::::::::::::::::::::::::::::::::::::::::::::::::::::::} + +\endinput + +% $Id: aiaa.ins,v 1.5 2004/05/23 12:49:43 kleb Exp $ diff --git a/macros/latex/contrib/aiaa/aiaa.pdf b/macros/latex/contrib/aiaa/aiaa.pdf Binary files differnew file mode 100644 index 0000000000..952efac134 --- /dev/null +++ b/macros/latex/contrib/aiaa/aiaa.pdf diff --git a/macros/latex/contrib/aiaa/author_guide.pdf b/macros/latex/contrib/aiaa/author_guide.pdf Binary files differnew file mode 100644 index 0000000000..633b652334 --- /dev/null +++ b/macros/latex/contrib/aiaa/author_guide.pdf diff --git a/macros/latex/contrib/aiaa/author_guide.tex b/macros/latex/contrib/aiaa/author_guide.tex new file mode 100644 index 0000000000..59814add8e --- /dev/null +++ b/macros/latex/contrib/aiaa/author_guide.tex @@ -0,0 +1,752 @@ +% +% `author_guide.tex' - AIAA author instructions that use the AIAA class. +% +% Typical processing for PostScript (PS) output: +% +% latex author_guide +% bibtex author_guide (bibliography) +% makeindex -s nomencl.ist -o author_guide.gls author_guide.glo (nomenclature) +% latex author_guide (repeat as needed to resolve references) +% +% xdvi author_guide (onscreen draft display) +% dvips author_guide (postscript) +% gv author_guide.ps (onscreen display) +% lpr author_guide.ps (hardcopy) +% +% With the above, only Encapsulated PostScript (EPS) images can be used. +% +% Typical processing for Portable Document Format (PDF) output: +% +% pdflatex author_guide +% bibtex author_guide (bibliography) +% makeindex -s nomencl.ist -o author_guide.gls author_guide.glo (nomenclature) +% pdflatex author_guide (repeat as needed to resolve references) +% +% acroread author_guide.pdf (onscreen display) +% +% If you have EPS figures, you will need to use the epstopdf script +% to convert them to PDF because PDF is a limmited subset of EPS. +% pdflatex accepts a variety of other image formats such as JPG, TIF, +% PNG, and so forth -- check the documentation for your version. +% +% If you do *not* specify suffixes when using the graphicx package's +% \includegraphics command, latex and pdflatex will automatically select +% the appropriate figure format from those available. This allows you +% to produce PS and PDF output from the same LaTeX source file. +% +% To generate a large format (e.g., 11"x17") PostScript copy for editing +% purposes, use +% +% dvips -x 1467 -O -0.65in,0.85in -t tabloid author_guide +% +% For further details and support, read the Users Manual, aiaa.pdf. +% +% This software is released under the terms of the LaTeX Project Public +% License. Copyright (C) 2004 by Bil Kleb, Bill Wood, and Erich Knausenberger. + +\documentclass{aiaa-tc}% insert '[draft]' option to show overfull boxes + + \usepackage{wrapfig}% embedding figures/tables in text (i.e., Galileo style) + \usepackage{threeparttable}% tables with footnotes + \usepackage{dcolumn}% decimal-aligned tabular math columns + \newcolumntype{d}{D{.}{.}{-1}} + \usepackage{nomencl}% automatic nomenclature generation via makeindex + \makeglossary + \usepackage{subfigure}% subcaptions for subfigures + \usepackage{subfigmat}% matrices of similar subfigures, aka small mulitples + \usepackage{fancyvrb}% extended verbatim environments + \fvset{fontsize=\footnotesize,xleftmargin=2em} + \usepackage{lettrine}% dropped capital at beginning of paragraph + \usepackage[dvips]{dropping}% alternative dropped capital package + \usepackage{hyperref}% embedding hyperlinks [must be loaded after dropping] + + \title{Preparation of Papers for\\ + AIAA Technical Conferences} + + \author{% + First A. Author\thanks{Job Title, Department, Address, and AIAA + Member Grade.} + \ and + Second B. Author\thanksibid{1}\\% same footnote as 1st author\\ + {\normalsize\itshape + Business or Academic Affiliation, City, Province, Zipcode, Country}\\ + \and + Third C. Author\thanks{Job Title, Department, Address, and AIAA + Member Grade.}\\ + {\normalsize\itshape + Another Business or Academic Affiliation, City, Province, Zipcode, Country} + } + + \AIAApapernumber{200?-????} + \AIAAconference{Conference Name, Date, and Location} + \AIAAcopyright{\AIAAcopyrightD{200?}} + + % define some commands to maintain consistency + \newcommand{\pkg}[1]{\texttt{#1}} + \newcommand{\cls}[1]{\textsf{#1}} + \newcommand{\file}[1]{\texttt{#1}} + +\begin{document} + +\maketitle + +\begin{abstract} +These instructions give you guidelines for preparing papers for AIAA +Technical Conferences. +Use this document as a guide if you are using \LaTeXe. +Otherwise, use this document as an instruction set. +Should this submission be for a non-electronic meeting, the electronic +file of your paper will be formatted further at AIAA. +Define all symbols used in the abstract. +Do not cite references in the abstract. +The footnote on the first page should list the Job Title and AIAA Member +Grade for each author. +\end{abstract} + +\printglossary% creates nomenclature section produced by MakeIndex + +\section{Introduction} + +\lettrine[nindent=0pt]{T}{his} document is a \LaTeX\ template. +If you are reading a hardcopy or PDF version of this document, please +download the \LaTeX\ macros and sample files from +\href{http://www.ctan.org/}{www.ctan.org} +so you can use it to prepare your manuscript. +The \cls{aiaa-tc} class uses Computer Modern (CM) fonts, which +are part of any standard \TeX installation. +Use the \LaTeX\ files for formatting purposes, +but please see \file{author\_guide.pdf} for specific layout instructions. +Authors will first need to save the \cls{AIAA} files to their +working directory or install them into their \TeX\ distribution. + +\section{Procedure for Paper Submission} + +All manuscripts are to be submitted electronically via the AIAA +submission tool at \href{http://www.aiaa.org/author}{www.aiaa.org/author}. +Select the ``Submit a Paper to an AIAA Conference'' link, then click the +``Edit Old'' button. +When you submitted your abstract for review, you should have received a +tracking number for your paper. +Use this tracking number, along with the last name of the corresponding +author, to gain access to the AIAA Author Status Page. +This site will allow you to track your paper's status, update submission +data, select a copyright statement, and upload your manuscript. + +Before you can upload your manuscript, you will need to select a +copyright statement to appear on your paper. +This can be achieved by clicking the ``Copyright Information'' link on +the Author Status Page. +Be sure to read the instructions and specific statements carefully +before selecting a statement for your manuscript. + +Once you have selected a copyright statement, you can use the ``Upload +Manuscript'' feature of the Author Status Page to upload your paper. +All accepted authors will be notified by AIAA of the relevant +submission deadlines. +In addition, the deadlines for every conference can be found under the +conference title on the Author Status Page. + +As with the submission of your abstract, be sure the name of the file +you upload for processing is short and simple (i.e., ``msc12345.tex'') +with no spaces, tildes, symbols, or other unusual characters. +If the file being uploaded is in \LaTeX, the document must be based +on \cls{article.cls} (this AIAA class is based on this class). +Failure to meet these requirements could result in a processing error +that would require you to re-upload your manuscript.% +\footnote{If you are uploading a PDF or postscript file, please do not + include foreign (i.e., non-Roman alphabet) fonts.} +If you encounter difficulties with the upload and/or conversion of your +manuscript, please contact AIAA Papers Tech Support for assistance at +\href{mailto:paper_tech_support@aiaa.org?subject=upload}% + {paper\_tech\_support@aiaa.org}. + +\section{General Guidelines} + +The following section outlines general (non-formatting) guidelines to +follow, drawn from the original AIAA Manuscript Preparation Kit. +These guidelines are applicable to all authors (except as noted), and +include information on the policies and practices relevant to the +publication of your manuscript. + +\subsection{Publication by AIAA} + +Your manuscript cannot be published by AIAA if: +\begin{enumerate} + \item It has been published previously or + \item An appropriate copyright statement has not yet been selected. +\end{enumerate} + +\subsection{Paper Review and Visa Considerations} + +It is the responsibility of the author to obtain any required government or +company reviews for their papers in advance of publication. +Start early to determine if the reviews are required; this process can +take several weeks. + +If you plan to attend an AIAA technical conference or professional +development course held in the United States and you require a visa for +travel, it is incumbent upon you to apply for a visa with the +U.S. embassy (consular division) or consulate with ample time for +processing. +To avoid bureaucratic problems, AIAA strongly suggests that you submit +your formal application to U.S. authorities a minimum of 120 days in +advance of the date of anticipated travel. + +Prospective conference and course attendees requiring a visa to travel +to the United States should first contact AIAA to request an official +letter of invitation. +This letter and a copy of the conference call for papers should be presented +along with the required documentation to the U.S. consular officials as part of +the formal application process. +AIAA cannot directly intervene with the U.S. Department of State, +consular offices, or embassies on behalf of individuals applying for visas. +A letter of invitation can be requested at +\href{http://www.aiaa.org/visa-info/}{www.aiaa.org/visa-info/} or you +may contact AIAA Customer Service at +\href{mailto:custserv@aiaa.org?subject=visa}{custserv@aiaa.org} for more +information. + +\subsection{Tracking Number vs Paper Number} + +Your paper was assigned a tracking number at the time you submitted +your abstract. +That number plus the corresponding author's last name is used to access +the AIAA Author Status Page. +This number is also useful when contacting AIAA technical support +regarding submission difficulties. +The tracking number is not the final AIAA paper number. +Once the abstract is accepted and assigned to the program, an AIAA +paper number is created. +The paper number, which appears in the format +{\footnotesize\textsf{AIAA-YEAR-NNNN}}, will be used to refer to your +paper in the program and in any publication format. +Do not include a paper number anywhere on your paper, as this number +will be stamped automatically in the top right corner of your paper at +the time of processing. + +\subsection{Copyright} + +Before AIAA can print or publish any paper, the copyright information +must be completed on the AIAA Web site. +Failure to complete the form correctly could result in your paper not +being published. +The following fields must be completed: +\begin{enumerate} + \item Clearance Statement + \item Non-Infringement Statement + \item Publication Status Statement + \item Copyright Assignment Statement +\end{enumerate} +For the Copyright Assignment Statement, select either A, B, C, or~D. +Be sure to read the copyright statements carefully. +If you are not sure which copyright statement to use, contact your legal +department; AIAA cannot help you determine which statement to use. +A hardcopy of the form is found in the Author Kit for your reference. +As you will be completing this form online, you do not need to fill out +the hard-copy form. Please do not upload the copyright form with your +paper, and do not include a copyright statement anywhere on your +paper. The correct statement will be stamped automatically at the time +of processing. + +\subsection{Submission Deadlines} + +\subsubsection{Meetings with Electronic Proceedings} + +Manuscripts will be accepted for upload to the system from the receipt +of the acceptance letter to the beginning of the conference. You will be +notified of the specific manuscript submission deadline in your +acceptance letter, and the deadline will also be listed on the Author +Status Page for your paper. We ask that authors not upload a draft version +of their manuscript with the intent to upload a final version later. +\emph{PLEASE upload only the final version of your manuscript.} + +On-line conference proceedings will be made accessible to attendees +who have registered for the "full conference" option two weeks prior to +the conference. Please keep that date in mind when preparing and +uploading the final manuscript. + +To ensure conference quality, session chairs will enforce a "no paper, +no podium" rule. This policy states that if your manuscript is not +uploaded to the Web site prior to your presentation, you will not be +allowed to present the paper at the conference. There are times when the +organizers at the conference request an earlier deadline than the beginning +of the conference. If such a situation arises, you will be notified in your +Author Acceptance Letter. + +\subsubsection{Loose Papers Meetings} + +The manuscript submission deadline for loose papers meetings is generally +six to eight weeks in advance of the event; you will be notified of the specific +deadline in your acceptance letter, and the date will also appear on the +Author Status Page for your paper. Papers uploaded before the deadline +will be reproduced and shipped to the conference by AIAA at no charge. + +Authors who miss the electronic submission deadline will be expected to +hand-carry 100 copies of their paper to the meeting, and must still upload +their final manuscript to the AIAA Web site before the start of the conference +for their paper to be published. A general No paper, no podium rule is in +effect for all AIAA conferences. If your paper is not submitted to AIAA prior to +your presentation, you will not be allowed to present. If you miss the initial +deadline, contact your session chair or the conference Technical Chair for +further instructions. + +\subsection{Color Illustrations} + +Papers published electronically (online or on CD-ROMs) will be +reproduced in color automatically. If your paper is submitted to a loose +papers meeting (as specified in the author acceptance letter), color +printing can be arranged for an additional charge. Please contact the +technical papers specialist for details at +\href{mailto:bettyg@aiaa.org?subject=illustrations}% + {bettyg@aiaa.org}. + +\section{Detailed Formatting Instructions} + +\subsection{Document Text} + +The default font for AIAA papers written in \LaTeX\ is 10-point Computer +Modern (CM). + +\subsection{Title, Authors' Names, and Affiliations} + +The title of your paper should be coded as \verb|\title{Paper Title}|, +with capital and lower-case letters, and centered at the top of the +page. +The names of the authors, business or academic affiliation, city, and +state/province should follow on separate lines below the title. +The names of authors with the same affiliation can be listed on the same +line above their collective affiliation information. +The authors' names, contact information, and affiliation is coded within +\LaTeX's standard \verb|\author| using \verb|tabular| environment +conventions and the \verb|\thanks| and \verb|\and| commands. +The affiliation line for each author includes the author's city, state, +and zip/postal code (or city, province, zip/postal code and country, as +appropriate). +The contact information for each author is given by the \verb|\thanks| +command and should include job title, department name, street +address/mail stop, and the AIAA member grade. +If this information is the same for two or more authors, the subsequent +authors should use the \verb|\thanksibid{}| command which requires the +number of the duplicate author contact information. +Author names are centered, and affiliations are centered and in italic type. +The title is created by the \verb|\maketitle| command. +For example, +\begin{Verbatim} + \documentclass{aiaa-tc} + \title{Paper Title} + \author{% + Bil Kleb\thanks{Aerospace Engineer, Aerothermodynamics Branch, + Mail Stop 408a, Lifetime AIAA member.} + and Bill Wood\thanksibid{1}\\ + {\itseries NASA Langley Research Center, Hampton, Virginia, 23681} + \and% issues a \end{tabular} followed by a \begin{tabular}{c} + Someone Else\thanks{Job title, department name, street + address/mailstop, AIAA member grade.}\\ + {\itseries Business or Academic Affiliation, City, State, Zipcode} + } + \begin{document} + \maketitle +\end{Verbatim} + +\subsection{Headings} + +AIAA Technical Conferences style defines 3 levels of section +headings: +\begin{description} + \item Level 1 heading (\verb"\section"): bold, larger font, centered, + and numbered with Roman numerals. + \item Level 2 heading (\verb"\subsection"): bold, flush left, and + numbered with capital letters. No opening paragraph indentation. + \item Level 3 heading (\verb"\subsubsection"): italic, flush left, and + numbered with Arabic numbers (e.g., 1, 2, 3). No opening + paragraph indentation. +\end{description} + +\subsection{Abstract} + +The abstract should appear at the beginning of your paper. +It should be one paragraph long (not an introduction) and complete in +itself (no reference numbers). +It should indicate subjects dealt with in the paper and state the +objectives of the investigation. +Newly observed facts and conclusions of the experiment or argument +discussed in the paper must be stated in summary form; readers should +not have to read the paper to understand the abstract. + +\subsection{Footnotes and References} + +Footnotes, where they appear, should be placed above the 1-inch margin at +the bottom of the page. +To insert footnotes, use \verb|\footnote{}| as normal. +Footnotes are formatted automatically in \verb|aiaa.cls|, but if +another medium is used, they should appear in as superscript lower case +letters. +When adding notes to tables, e.g., as accommodated by the +\pkg{threeparttable} package, the symbols are down by hand and should be +in the sequence, *, $\dagger$, $\ddagger$, $\mathsection$, +$\mathparagraph$, $\|$, **, $\dagger\dagger$, and so forth. +This sequence should beginning anew with each table. + +List and number all bibliographical references at the end of the paper. +Corresponding superscript numbers are used to cite references in the +text using the \verb|\cite{}| command,\cite{sutton:85ar} unless the +citation is an integral part of the sentence (e.g., ``It is shown in +Ref.~\citen{miner:75ncr} that\ldots[.]'') +or follows a mathematical expression: ``$A2 + B = C$ +(Ref.~\citen{wirin:90cp}).'' +For this case, the command, \verb|\citen{}| is used. +\cite{*}% to load all refences for demonstration purposes which follow +Multiple citations are sorted and punctuated automatically through the +\cls{aiaa-tc}'s use of the \pkg{overcite}. +Separate reference numbers are shown with +commas\cite{sutton:85ar,miner:75ncr,turner:64a} and ranges are +separated by an en-dash.\cite{sutton:85ar,miner:75ncr,wirin:90cp} +Reference citations in the text should be in numerical order, which is +assured by using \textsc{Bib}\TeX. + +In the reference list, give all authors' names; do not use ``et al.'' +unless there are six authors or more. +Papers that have not been published should be cited as ``unpublished''; +papers that have been submitted or accepted for publication should be +cited as ``submitted for publication.'' +Private communications and personal Web sites should appear as footnotes +rather than in the reference list. + +References should be cited according to the standard publication +reference style. +(For examples, see the ``References'' section of this template.) +This is facilitated by the Bib\TeX\ database and a style file, \file{aiaa.bst}. +As a rule, all words are capitalized except for articles, conjunctions, +and prepositions of four letters or fewer. +Names and locations of publishers should be listed; month and year +should be included for reports and papers. +For papers published in translation journals, please give the English +citation first, followed by the original foreign language citation. + +\subsection{Images, Figures, and Tables} + +All artwork, captions, figures, graphs, and tables will be reproduced +exactly as submitted. +Be sure to position any figures, tables, graphs, or pictures as you want +them printed. +AIAA is not responsible for incorporating your figures, tables, +etc.% +\footnote{Company logos and identification numbers are not permitted on + your illustrations.} + +% an experiment with wrapfig -- read caveats documented in wrapfig.sty +\begin{wrapfigure}{R}{0.5\linewidth} + \includegraphics{figure_magnet} + \caption{Magnetization as a function of applied field, which has + borders so thick that they overwhelm the data and for some reason the + ordinate label is rotated 90 degrees to make it difficult to + read. This figure also demonstrates the dangers of using a bitmap + as opposed to a vector image.} + \label{f:magnetic_field} +\end{wrapfigure} + +Place figure captions below all figures; place table titles above the +tables.% +\footnote{Please do not include captions as part of the figure image +itself.} +If your figure has multiple parts, include the labels ``a),'' ``b),'' +and so on, below each subfigure and above the figure caption. +This can be accomplished with the \pkg{subfigure} package. +Please verify that the figures and tables you mention in the text +actually exist by using \LaTeX's \verb|\label| and \verb|\ref| mechanisms +and verifying that there are no undefined references during typesetting. + +When citing a figure in the text, use ``figure'' as ``Fig., often used +to refer to graphics, is an ugly abbreviation and is not worth the two +spaces saved.''\cite{tufte:83bk} +Do not abbreviate ``table'' either. +Each different type of illustration (i.e., figures, tables, or +images) should be numbered sequentially with relation to other +illustrations of the same type. + +Figure axis labels are often a source of confusion. +Use words rather than symbols. +As in the example to the right, write the quantity ``Magnetization'' +rather than just ``M.'' +Do not enclose units in parenthesis, but rather separate them from the +preceding text by commas. +Do not label axes only with units. +As in figure~\ref{f:magnetic_field}, for example, write ``Magnetization, +A/m'' or ``Magnetization, A m-1,'' not just ``A/m.'' +Do not label axes with a ratio of quantities and units. +For example, write ``Temperature, K,'' not ``Temperature/K.'' + +Multipliers can be especially confusing. +Write ``Magnetization, kA/m'' or ``Magnetization, 103 A/m.'' +Do not write ``Magnetization (A/m) $\times$ 1000'' because the reader +would not then know whether the top axis label in +figure~\ref{f:magnetic_field} meant 16000~A/m or 0.016~A/m. +Figure labels must be legible, approximately 8--12 point type. +Use of the \pkg{psfrag} package can facilitate this, but it makes +generating a PDF version of your paper difficult. + +Figures and tables are referred to as `Floats' in \LaTeX, reflecting +their floating nature. +They are typically numbered whether or not they have a caption and they +are floated to the first available position near the first reference to +that figure/table within the text. +This is accomplished by placing the figure/table environment after +their first reference. +The environment can even be placed mid-sentence as long as \LaTeX's +comment character, \%, is used properly to prevent a paragraph break or +extra spaces. +By default, floats are placed at the top of the first available page, +the bottom of the page, or one a page consisting entirely of floats. + +An example of coding a standard \verb|{figure}| is given below: +\begin{Verbatim} + \begin{figure} + \includegraphics{magetic_field} + \caption{Magnetization as a function of applied field, which has + borders so thick that they overwhelm from the data.} + \label{f:magnetic_field} + \end{figure} +\end{Verbatim} + +\begin{table} + \begin{center} + \begin{threeparttable} + \caption{This is an example of a \pkg{threeparttable} which uses the + \pkg{dcolumn} package to allow for columns to be aligned on decimal + points.} + \label{t:threepart} + \begin{tabular}{lcdd} + First head\tnote{*} & + Second head & + \multicolumn{1}{c}{Third head} & + \multicolumn{1}{c}{$V_M(r)$} \\\hline + center & doctor & 0.2 & 10.55 \\ + tab & dentist & 0.15 & 33.12 \\ + worse & man\tnote{\ensuremath{\dagger}} & 10.58 & 45.10 \\ + better & home & 43.9 & 12.34 \\ + \end{tabular} + \begin{tablenotes} + \item[*] This is a table footnote, which to span multiple lines, has + been greatly extended in length contrary to reason. + \item[\ensuremath{\dagger}] A much shorter table footnote. + \end{tablenotes} + \end{threeparttable} + \end{center} +\end{table} +Tables with footnotes, such as table~\ref{t:threepart}, +can be coded using the \pkg{threeparttable} package as follows: +\begin{Verbatim} + \begin{table} + \begin{center} + \begin{threeparttable} + \caption{This is an example of table caption.} + \label{t:wordtable} + \begin{tabular}{ccdd} + First head\tnote{a} & + Second head\tnote{b} & + \multicolumn{1}{c}{Third head} & + \multicolumn{1}{c}{$V_M(r)$} \\\hline + Left & Word entries & 0.2 & 10.55 \\ + Left & Word entries & 0.15 & 33.12 \\ + Left & Word entries & 10.58 & 45.10 \\ + Left & Word entries & 43.9 & 12.34 \\ + \end{tabular} + \begin{tablenotes} + \item[a] This is a table footnote, which to span multiple lines, has + been greatly extended in length contrary to reason. + \item[b] A much shorter table footnote. + \end{tablenotes} + \end{threeparttable} + \end{center} + \end{table} +\end{Verbatim} + +\subsection{Equations, Numbers, Symbols, and Abbreviations} + +Equations are centered and numbered consecutively, with equation +numbers in parentheses flush right, as in Eq.~\ref{e:function}. +\begin{equation} + \label{e:function} + \int_{0}^{r_{2}} F(r,\varphi)\,dr\,d\varphi = + \left[ \sigma r_{2}/(2\mu_{0}) \right] \cdot + \int_{0}^{\infty} \exp(-\rho|z_{j}-z_{i}|) \lambda^{-1} +\end{equation} +Equation~\ref{e:function} is coded as below: +\begin{Verbatim} + \begin{equation} + \label{e:function} + \int_{0}^{r_{2}} F(r,\varphi)\,dr\,d\varphi = + \left[ \sigma r_{2}/(2\mu_{0}) \right] \cdot + \int_{0}^{\infty} \exp(-\rho|z_{j}-z_{i}|) \lambda^{-1} + \end{equation} +\end{Verbatim} +A sample equation is included below, formatted using the preceding +instructions. +To make your equation more compact, you can use the solidus ($/$), the +exp function, or appropriate exponents. +Use parentheses to avoid ambiguities in denominators. +\begin{equation} + \label{e:displace} + \mathbf{J}_i\cdot\Delta\underline{x}_{i+1}=-\underline{f}_i +\end{equation} +\nomenclature{$J$}{Jacobian Matrix} +\nomenclature[b$i$]{$i$}{Variable number} +\nomenclature[g$\Delta$]{$\Delta x$}{Variable displacement vector} +\nomenclature{$f$}{Residual value vector} +\nomenclature{$x$}{Variable value vector} +\begin{equation} + \label{e:newton} + F=m\alpha +\end{equation} +\nomenclature{$F$}{Force, N} +\nomenclature{$m$}{Mass, kg} +\nomenclature[g$\alpha$]{$\alpha$}{Acceleration, m/s\textsuperscript{2}} + +The \verb|fleqnarray| environment is used to display a sequence of +equations or inequalities. It is very much like a three-column +\verb|array| environment, with consecutive rows separated by +\verb|\\| and consecutive items within a row separated by an \&. +\begin{eqnarray} +&&\sum_{i\in H} p^0\cdot w^{0i}=\sum_i M^i (p^0) = + \sum_i\left[p^0\cdot r^i + \sum_j \alpha^{ij} (p^0\cdot + y^{0j})\right]\nonumber\\ +&&{\qquad}= p^0 \cdot \sum_i r^i + p^0 \cdot \sum_i +\sum_i \alpha^{ij} +\end{eqnarray} +An equation number is placed on every line unless that line has a +\verb|\nonumber| command. + +Be sure that the symbols in your equation are defined before the +equation appears, or immediately following. +In this case the \pkg{nomencl} package is used to automatically generate +the nomenclature section. + +Italicize symbols ($T$ might refer to temperature, but T is the unit +Tesla). +Refer to ``Eq. (1),'' not ``(1)'' or ``equation (1)'' except at the +beginning of a sentence: ``Equation (1) is phat.'' +Equations can be labeled other than ``Eq.'' should they represent +inequalities, matrices, or boundary conditions. +If what is represented is really more than one equation, the +abbreviation ``Eqs.'' can be used. + +Define abbreviations and acronyms the first time they are used in the +text, even after they have already been defined in the abstract. +Very common abbreviations such as AIAA, SI, ac, and dc do not have to be +defined. +Abbreviations that incorporate periods should not have spaces: write +``P.R.,'' not ``P. R.'' +Delete periods between initials if the abbreviation has three or more +initials; e.g., U.N. but ESA.\@ +Do not use abbreviations in the title unless they are unavoidable (for +instance, ``AIAA'' in the title of this article). + +\subsection{General Grammar and Preferred Usage} + +Use only one space after periods or colons. Hyphenate complex +modifiers: ``zero-field-cooled magnetization.'' +Avoid dangling participles, such as, ``Using Eq. (1), the potential was +calculated.'' +[It is not clear who or what used Eq. (1).] +Write instead ``The potential was calculated using Eq. (1),'' or ``Using +Eq. (1), we calculated the potential.'' + +Use a zero before decimal points: ``0.25,'' not ``.25.'' +Use ``cm$^3$,'' not ``cc.'' +Indicate sample dimensions as ``0.1 cm $\times$ 0.2 cm,'' not ``0.1 +$\times$ 0.2~cm$^2$.'' +The preferred abbreviation for ``seconds'' is ``s,'' not ``sec.'' +Do not mix complete spellings and abbreviations of units: use +``Wb/m$^2$'' or ``webers per square meter,'' not ``webers/m$^2$.'' +When expressing a range of values, write ``7 to 9'' or ``7--9,'' not +``7~9.'' + +A parenthetical statement at the end of a sentence is punctuated +outside of the closing parenthesis (like this). +(A parenthetical sentence is punctuated within parenthesis.) +In American English, periods and commas are placed within quotation +marks, like ``this period.'' +Other punctuation is ``outside''! Avoid contractions; for example, write +``do not'' instead of ``don't.'' +The serial comma is preferred: ``A, B, and C'' instead of ``A, B and C.'' + +If you wish, you may write in the first person singular or plural and +use the active voice (``I observed that\ldots'' or ``We observed that\ldots'' +instead of ``It was observed that…''). +Remember to check spelling. +If your native language is not English, please ask a native +English-speaking colleague to proofread your paper. + +The word ``data'' is plural, not singular (i.e., ``data are,'' not ``data +is''). +The subscript for the permeability of vacuum $\mu_0$ is zero, not a +lowercase letter ``oo.'' +The term for residual magnetization is ``remanence''; the adjective is +``remanent''; do not write ``remnance'' or ``remnant.'' +The word ``micrometer'' is preferred over ``micron'' when spelling out +this unit of measure. +A graph within a graph is an ``inset,'' not an ``insert.'' +The word ``alternatively'' is preferred to the word ``alternately'' +(unless you really mean something that alternates). +Use the word ``whereas'' instead of ``while'' (unless you are referring +to simultaneous events). +Do not use the word ``essentially'' to mean ``approximately'' or +``effectively.'' +Do not use the word ``issue'' as a euphemism for ``problem.'' +When compositions are not specified, separate chemical symbols by +en-dashes; for example, ``NiMn'' indicates the intermetallic compound +Ni$_{0.5}$Mn$_{0.5}$ whereas ``Ni--Mn'' indicates an alloy of some +composition Ni$_{x}$Mn$_{1-x}$. + +Be aware of the different meanings of the homophones ``affect'' (usually +a verb) and ``effect'' (usually a noun), ``complement'' and +``compliment,'' ``discreet'' and ``discrete,'' ``principal'' (e.g., +``principal investigator'') and ``principle'' (e.g., ``principle of +measurement''). Do not confuse ``imply'' and ``infer.'' + +Prefixes such as ``non,'' ``sub,'' ``micro,'' ``multi,'' and ``ultra'' +are not independent words; they should be joined to the words they +modify, usually without a hyphen. +There is no period after the ``et'' in the abbreviation ``et al.'' +The abbreviation ``i.e.,'' means ``that is,'' and the abbreviation +``e.g.,'' means ``for example'' (these abbreviations are not +italicized). +An excellent source of more detailed style and formatting instructions +can be found in the AIAA style guide, {\it AIAA Style} (available from AIAA +upon request). + +\section{Conclusion} + +A conclusion section is not required, though it is preferred. +Although a conclusion may review the main points of the paper, do not +replicate the abstract as the conclusion. +A conclusion might elaborate on the importance of the work or suggest +applications and extensions.% +\footnote{The conclusion section is the last section of + the paper that should be numbered. + The appendix (if present), acknowledgment, and references should be + listed without numbers.} + +\section*{Appendix} + +An appendix, if needed, should appear before the acknowledgments. +Use the 'starred' version of the \verb|\section| commands to avoid +section numbering. + +\section*{Acknowledgments} + +The preferred spelling of the word ``acknowledgment'' in American +English is without the ``e'' after the ``g.'' +Avoid expressions such as ``One of us (S.B.A.) would like to thank\ldots[.]'' +Instead, write ``F. A. Author thanks\ldots[.]'' +Sponsor and financial support acknowledgments are also to be listed in +the acknowledgments section. + +% produces the bibliography section when processed by BibTeX +\bibliography{bibtex_database} +\bibliographystyle{aiaa} + +\end{document} + +% $Id: author_guide.tex,v 1.4 2004/05/23 12:49:44 kleb Exp $ + diff --git a/macros/latex/contrib/aiaa/bibtex_database.bib b/macros/latex/contrib/aiaa/bibtex_database.bib new file mode 100644 index 0000000000..6fe1f92491 --- /dev/null +++ b/macros/latex/contrib/aiaa/bibtex_database.bib @@ -0,0 +1,124 @@ +@InCollection{turner:64a, + author = {M. J. Turner and H. C. Martin and R. C. Leible}, + title = {Further Development and Applications of Stiffness Methods}, + booktitle = {Matrix Methods of Structural Analysis}, + year = 1964, + edition = {1st}, + publisher = {Macmillian}, + address = {New York}, + volume = 1, + pages = {203-266} + } + +@Article{bhutta:90jsr, + author = {B. A. Bhutta and C. H. Lewis}, + title = {Large-Angle-of-Attack Vicous Hypersonic Flows over + Complex Lifting Configurations}, + journal = {Journal of Spacecraft and Rockets}, + year = 1990, + volume = 27, + number = 2, + pages = {194-204}, + note = {also AIAA Paper 89--0269, Jan. 1989} +} + +@InCollection{blottner:70cp, + author = {F. G. Blottner}, + title = {Prediction of Electron Density in the Boundary Layer + of Entry Vehicles with Ablation}, + booktitle = {The Entry Plasma Sheath and Its Effects}, + type = {NASA SP--252}, + volume = 1, + year = 1970, + month = oct, + pages = {219--240} +} + +@InProceedings{wirin:90cp, + author = {W. B. Wirin}, + title = {Space Debris 1989}, + booktitle = {Proceedings of the Thrity-Second Colloquium + on the Law of Outer Space}, + year = 1990, + publisher = {AIAA}, + address = {Wahington, DC}, + pages = {184--196} +} + +@TechReport{bhutta:90vra, + author = {B. A. Bhutta and C. H. Lewis}, + title = {PNS Predictions of External/Internal Hypersonic Flows + for NASP Propulsion Applications}, + institution = {VRA, Inc.}, + type = {VRA--TR--90--01}, + year = 1990, + address = {Blacksburg, VA}, + month = jun +} + +@TechReport{miner:75ncr, + author = {E. W. Miner and C. H. Lewis}, + title = {Hypersonic Ionizing Air Viscous Shock-Layer Flows + over Nonanlytic Blunt Bodies}, + year = 1975, + type = {NASA CR--2250}, + month = may +} + +@TechReport{bhutta:90cp, + author = {B. A. Bhutta and C. H. Lewis}, + title = {Aerothermodynamic Performance of 3-D and Bent-Nose RVs + Hypersonic Conditions}, + year = 1990, + type = {AIAA Paper 90--3068}, + month = aug +} + +@InCollection{sutton:85ar, + author = {K. Sutton}, + title = {Air Radiation Revisted}, + booktitle = {Thermal Design of Aeroassisted Orbital Transfer Vehicles}, + publisher = {AIAA}, + year = 1985, + editor = {H. F. Nelson}, + volume = 96, + type = {Progress in Astronautics and Aeronautics}, + address = {New York}, + pages = {419--441} +} + +@TechReport{anon:53, + author = {Anon.}, + title = {Equations, Tables, and Charts for Compressible Flow}, + year = 1953, + type = {NACA Rept.~1135} +} + +@Misc{moss:90pc, + author = {J. N. Moss}, + howpublished = {private communication, + NASA Langley Research Center, + Hampton, VA}, + year = 1990, + month = jun +} + +@Book{tufte:83bk, + author = {Edward R. Tufte}, + title = {The Visual Display of Quantitative Information}, + publisher = {Graphics Press}, + year = 1983 +} + +@PhdThesis{thoman:66phd, + author = {David Charles Thoman}, + title = {Numerical Solutions of Time Dependent Two Dimensional + Flow of a Viscous, Incompressible Fluid Over + Stationary and Rotating Cylinders}, + school = {University of Notre Dame}, + year = 1966, + address = {Indiana}, + month = aug, + annote = { example of viscous timestep restriction, cell Re } +} + diff --git a/macros/latex/contrib/aiaa/figure_magnet.eps b/macros/latex/contrib/aiaa/figure_magnet.eps new file mode 100644 index 0000000000..668ffdc404 --- /dev/null +++ b/macros/latex/contrib/aiaa/figure_magnet.eps @@ -0,0 +1,707 @@ +%!PS-Adobe-3.0 EPSF-3.0
+%%Creator: Adobe Photoshop Version 5.5
+%%Title: fig1.eps
+%%CreationDate: Thu Nov 13 2003 16:14:42
+%%BoundingBox: 0 0 415 314
+%%HiResBoundingBox: 0 0 415 314
+%%SuppressDotGainCompensation
+%%DocumentProcessColors: Black
+%%EndComments
+%%BeginProlog
+%%EndProlog
+%%BeginSetup
+%%EndSetup
+%ImageData: 415 314 1 1 0 52 2 "beginimage"
+%BeginPhotoshop: 4198
+% 3842494D03ED000000000010004800000001000100480000000100013842494D
+% 040D000000000004000000783842494D03F30000000000080000000000000000
+% 3842494D040A00000000000100003842494D271000000000000A000100000000
+% 000000023842494D040800000000001000000001000002400000024000000000
+% 3842494D0414000000000004000000023842494D040C000000000FB700000001
+% 00000070000000550000015000006F9000000F9B00180001FFD8FFE000104A46
+% 494600010201004800480000FFEE000E41646F626500648000000001FFDB0084
+% 000C08080809080C09090C110B0A0B11150F0C0C0F1518131315131318110C0C
+% 0C0C0C0C110C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C
+% 0C010D0B0B0D0E0D100E0E10140E0E0E14140E0E0E0E14110C0C0C0C0C11110C
+% 0C0C0C0C0C110C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C
+% 0C0CFFC00011080055007003012200021101031101FFDD00040007FFC4013F00
+% 00010501010101010100000000000000030001020405060708090A0B01000105
+% 01010101010100000000000000010002030405060708090A0B10000104010302
+% 04020507060805030C33010002110304211231054151611322718132061491A1
+% B14223241552C16233347282D14307259253F0E1F163733516A2B28326449354
+% 6445C2A3743617D255E265F2B384C3D375E3F3462794A485B495C4D4E4F4A5B5
+% C5D5E5F55666768696A6B6C6D6E6F637475767778797A7B7C7D7E7F711000202
+% 0102040403040506070706053501000211032131120441516171221305328191
+% 14A1B14223C152D1F0332462E1728292435315637334F1250616A2B283072635
+% C2D2449354A317644555367465E2F2B384C3D375E3F34694A485B495C4D4E4F4
+% A5B5C5D5E5F55666768696A6B6C6D6E6F62737475767778797A7B7C7FFDA000C
+% 03010002110311003F00F55599F583273703A665754C4B1A0E0E3645CEC7B19B
+% 9961654EB6ADCE6BABBAB7D7756CFA366CF45F915FA5EAFA17E369ACCFAC16E4
+% 63F4CCACB6DCDAB171F1B22CC968ADEEB5C1B539D5BB1ADA72F05D4BEB73777D
+% 3DF6FF0082C8C4FE7D252279FAC9918F6DFD3B2FA739AF73ECC173A9B6C65B43
+% D95BF13D5B6ACB67A6FF0057D66D9914FDA6BBA9F46FAA8ABF99563D3EBE72BF
+% A4620C4166EFE62C363AB27FA3FF004A6D755B556DFE99FA665EFBBFA0637D9B
+% F5A2F4975EFE9586FC9BEBCAC8763D46EC9A4835DAF2C6FA97D2E6358C7556BF
+% F495ED67D056D2538F755F5BC54F14E574E75AD69756F7E35CD6BDC47B297D6D
+% CD7BB198C737FA4FAB95EAFADFD129FB2FEB65CAABEB27A59070F2B08DA5C5D8
+% 8CB71AD0D0D02C8A722CAF37739EE77A1FACD557E8FF004BFAA59EA7E8B4D249
+% 4E65B57D641901F565613F1BD669343B1AD6BFD02F1EAB7ED4DCDB19F68663EF
+% F4DFF63F4ECBBFC1D4C42733EB7FA2E0DBBA71BC536869355C186F6DBFA9B9CD
+% FB439CDC7BF07D992CFE73172BF49559994FE896C24929C9CAAFEB531EEB30F2
+% 302E60B016635B45D5135EE1BAB767579593B2DF47FC37ECF7B3D5FF0000A6EA
+% BEB207501B9584F6ED7B7249C6B5A7716DDE85D437EDB67B196FD9196E359FCE
+% 33ED167DAEAFD154B4D2494E48AFEB56FADE7230360B182DA7D0BA5D58735B91
+% 65793F6AFD15B6D3EA5F4D2EC4B5945BFAA7AF91B3ED964DD57D640EA0372B09
+% EDDAF6E4938D6B4EE2DBBD0BA86FDB6CF632DFB232DC6B3F9C67DA2CFB5D5FA2
+% A969A0E5E47D9716EC9F4ECBFD0ADD67A34B77D8FD80BFD3A6BD37DAF8DB5B3F
+% 7D2539F5D7F5A880DB32301A7D3B03AC6D17380B05C3ECD60A4E5337556E06EF
+% 5E9F5F7E3E67F377E4D2961E4758AFA8E3E1F52BF11E6EC7C8B0B28AED63DC69
+% BAAAEABEB75965F536AFB2E553F68C7B3F4B5E57F31764D3FCCDE17E45AEC6B3
+% 1EA69C5B9A5D73ED2FAAD602D0EA76623E8DCE7B9DFCF577D98AFA3FE13F9B54
+% 45393575FC7DF7FDA2AB31F31FFA5140B2B9B3A7FA54637A55D393F64ADBEAEF
+% FE77DFE8FDB2E7D9F64494FF00FFD0EDED711F5CEA6E2D94FAAEC2073E97FA82
+% CFB3B5F7FD9ACABF596E35AFFB6D9B7FE4EB7ECF4FDABD6CDA3ED3894645BEBC
+% 33474FCBB31FD67B5B8595FA2C67ECBDD696B0E3FD9A28BED6E47B6EF46E659F
+% A2B3FED2E5FF00DA785D97D2BFE7251856DDFAFF00D9CDD563BDCCD9CD95D575
+% 155C7D5FB5FA5FB419EA607FDA5F5BF68FFDE7A5F58E9BEEE959EC6D765F8EFC
+% 0CB6598D4B80B2C7B98DF46BA5BF67C87FAAE67AF5D6FDFF00A37D9FD132FF00
+% ED3A537BA73DD674FC6B1F6B6F73E9ADCEB98F6D8D792D6936B2EAABC7AAD659
+% F4FD4AF1E8659FE86AFA0AC2AFD3AE17F4FC6B83DD68B69ADE2C79ADCE76E6B5
+% DBDEFC3FD51CF77FDD5FD5FF00D07E8958494A4924925292553AA752A3A5E19C
+% CC86D8FA8595545B530D8F9BACAF16BDB533F4967E92E6FB2BDF6FFA2AECB3D8
+% A768EA0F70153A9A5ADB9A49735D69B28DA3D56ED6BF17ECB90EB77B2B7FEB75
+% EC67A9E9FE97D2A529B0B3F1BAA3FA8F4C39DD2E9DEF36595574E5976349A6E7
+% E2DDEAFE8B26EA3F99B1EC63F1BD5FCCBABA7FC1DD14D42D75C18D16BDAD63EC
+% 006E2D617BAB639FF49CCADD6DBB3FE32C5349485D8FBB2ABC9F52C1E9D7657E
+% 887456EF50D4FF0052CAFF003ADABD0DB4BFF31975FF00E912C7C4C5C5F53ECD
+% 4D747AF63AEBBD36866FB1FF00CE5D66C037DAF8F7D8EF7A3249294B3EF73C75
+% FC260BF6B0E26597634BBDE459D3F6DFB437D1FD5F73EBFD23FD5FD67F43FE1F
+% 6682CFBDCF1D7F0982FDAC389965D8D2EF791674FDB7ED0DF47F57DCFAFF0048
+% FF0057F59FD0FF0087D894FF00FFD1EFEEB7347D60AAB7BEBFB03ABAFD26BACB
+% 2978BF6E77A9E8B1B47D9FA97AB8ED67A98B6667EA9F66FB67D9FF0099B147EB
+% 4BAE6F49C97B5EEA71A9C6CABB29E29AB21AE6368B6B18EEC7C9B2BDEF75B733
+% 298DDBE8DDF63B31B22CA997AA9996BAAFAE98155ECA48C9A6D762D9E8B43E29
+% 61F56BFB4BFA8B1D66452EC873A9D9D22D7D58B9B95553FA2B7A8DCAEFD61FB4
+% 8C2C8757AE3B71328E456FF4052F1E9FE8EBB2ECCDCCC7B77FD0BAEA327A77D9
+% FED7F6EA3FA36C4A6F74E65ACE9F8CCB8385ADA6B1607925C1C1ADDFBDCEBB31
+% DBF77FDDCCAFFC337FF3AAC2A9D259E9F4AC366DD9B71EA6ECDBB36C31A36FA7
+% E8617A7B7F73EC589FF8571FF9A561F6B58EADAE0E26D76D6ED6B9C010D759FA
+% 473039B5336D7FCE5BECDFFA2FE76CAD252AEB5B4D4FB5E1C5B5B4B9C18D73DD
+% 0D1B8ECAAA0FB6C7FF00C1D6CDEF5956E46575968C6C41763F49CFC26DF575AC
+% 7B58CB43AC70DB8F4E35F53EEA5F662BBD5FB56CFD17FC1647BD5AC1C2B45583
+% 91D44B6EEAB8D8DE85D90C90D2EB050FCC2C60153365D7E2D6FF00E67FEDB579
+% 2535F17071F19CFB5AC6BB2AE6B1B939658C6DB71ADBE9D7664BE9654DB1ED6F
+% F23657FE0BD356124925292492494A49249252967DEE78EBF84C17ED61C4CB2E
+% C6977BC8B3A7EDBF686FA3FABEE7D7FA47FABFACFE87FC3ECD059F7BBFCBF84D
+% DF589C4CB3E9964D862CE9FEFAEEF4CECA993FA6AFD7AFD57D947E8AEF47F409
+% 4FFFD2EDF3B27A833EB6F4EA039C7A7D94BF7D65CEADA2FDB73EBB9AEFB3B29C
+% B7B69AADA9F81FB46EB3F4B5F50FD9F57ECFFB5AB1F595D1D1F35B915EEE98EC
+% 4C9FDA165766DBD958A9FF00D0E97556537DAFF7FF003F7E3B2AFF0085467747
+% 63FAB37AA59939163EB8F4719CE69A2B0196D2FF00468F4FDB6DBEBB9F6656EF
+% B67FDA7AF21984FBF16DAFF5ADF90CE85D41EDAE9B31598596FC965BBE5E052F
+% F4F1D829752E632D71FD35FEBEF632BF4AAAFF0058FB462A525ABA937031FA5E
+% 37547DCECECD6B290EF41C4BEF0C0FBBD6FB08C9C4C57E965CFF00D3FD9F6577
+% FA76FA1459622F47E98EE9784311D9B93D4035C5CDBB35EDB2D01DAFA66E6575
+% 3AC635DF47D5DEFF00FAD7A6C557EADE4E2F53C53D668736F192D18F566073CB
+% AFA319F7329B7229B31F0198D91EBDD97EAD54E3FA7FF0D655E9ECD8494A4924
+% 925292492494A4924925292492494A59F7BBFCBF84DDF589C4CB3E9964D862CE
+% 9FEFAEEF4CECA993FA6AFD7AFD57D947E8AEF47F41A0B3EFB183AFE1564FBDD8
+% 996E6B7D36990DB3A7871FB493EB55B77B3F415B7D2C8FE72EFE8D424A7FFFD3
+% F55599F580750774CCAAF09CE63ADC6C8ADB656D717D769A9CEC6C96BE97FDA3
+% 656F67A7E9626265E5D975D8FE8FF3562D350BAA6DD53EA79706D8D2D71639CC
+% 74386D3B2DA8B2DADFFF00095BF7B12535FA6BB762D1E9578F5E27D9EA347D9A
+% CDF5EA0CD746DAA9AFEC95D7E8FD9AE67F3CCFF0146CFD24DAFEA1B5A5D4D21C
+% 5B517016B880E73BF5C6B5DF676EE65157BF19FF00F6A9FF00A3B6BC3FE75169
+% A9B4D4CA985C5B5B435A5EE73DD0D1B46FB6D2FB6C7FFC258FDEF53494D4AF27
+% 2AC7DCC6B31DC69B1B5B836F2E2D976F7FACDF43F456B701F8D975D5FE12DBFD
+% 0FD1D3E9E6DD30FEA12E9A690039A1916B8CB4D8F6D8E77EAFED7B713D2BD8CF
+% F0991EA62FA95D55FDB2D2DD755454FBAE7B6AAAA697D963C86B5AD68DCF7BDE
+% EF6B58D6A56DD552D0FB5EDADA5CD60738868DCF70AAA64BBF3ECB5ECAEBFDF7
+% A4A6B9C8CD67A4DB28AF7DBE93618FB1ED0F3BDF981D6371BD95514D7FAADF77
+% A5F6BBFF0056B3EC7BEAF513ECEAA376CC7C7746ED9BAF7898F5FD3DD18AFD9B
+% F6616FFA7E9FDA32BF9DFB255F6D8750BBA4635B565F51BE9A1D8CD7BE975F60
+% 635A1C6BC7B6F0CB1EDAB7B7D7AF1BED1F4EAFB5FA1EA7EB967AB6DF7555BAB6
+% 58F6B1D73B654D7100B9C1AEB76560FD37FA55D967F52B494D4CECAEA18D55F7
+% 32AC6F4A96B9E2CBF21D4B76B454E73EF7FD96F6D0C6B7ED9BFF009DFE628FFB
+% 936FD8ED936FAAD01AD3516B8BDE5C43838167A6D6D7B36B98E6FABBDFEAFE8F
+% F47FA3B3D4FD154CAEA1D21F8ECAF22EA6FAB3A97BA9A045A726A0CF56EFB363
+% 33D47E733D077F3745776F6299EA98028193EACE3BACA6A65C1AE2C7BB20D2CC
+% 53458D6ECBEAB9F95437D7A77D1FF09FA2B76253609B7D5680D69A8B5C5EF2E2
+% 1C1C0B3D36B6BD9B5CC737D5DEFF0057F47FA3FD1D9EA7E8ABD79395632E0D66
+% 3BB229ADA1D5B6F2E0DC92DF55F8D73FD0DF554D63F19F5DFE97AD6557FA9F63
+% AFF47EB171B2F172D86CC5BABBD836CBAA7078F73597D7EE6177D3A6DAAE67FC
+% 15B5D8963E3578FEA7A66C77AD63AD77A963ED873BE90AFD77D9E8D5FB9453B2
+% 8AFF00C1D692932A36B6D3D6B15E321ADA8636487E29790E7B8D985E9E4368FA
+% 363319ADB6B7DBFE07ED55FF00A757941F4D563AB7D8C6BDD4BB7D4E7004B5C5
+% AEAB7D64FD07FA56595FF52C494FFFD4F55497CAA924A7EAA497CAA924A7E9FE
+% A7F60FB333EDFF00CCFDA31F67D2FE7BD7A7EC3FCD7BBFA6FD9FFE0FFD37E897
+% 0B9DFF00337F66667ED2F53D2FD98CFB57A7FB33ED1B3D6A7F677FC8DFACFABB
+% 7F677D8BFEF13EC9F63FB4FE937AF1A49253EFEDFF009B7F6CCB9FB47D83F59F
+% B4FAB1F66F57ED54FED6F4FD7FF2A7D93ED5E8FED3FB3FFD8CFA3EAFDB3FC3A4
+% 7FE6DFDBDBF61FB47F48C3FB37D8A3ECFEB6DC4FE89B7F47FF0022FD8BED9B7F
+% 47FB0BEDBFB3BFEF6D78024929FA519FF2553B3EDFEA7E97EC7BBFA4FD0BFECF
+% EB7ADFABFF0047FE8DFB73FC37D97F69FF009492FF00217D8FF53FE8DDFF0066
+% FA9FF717F47BBF657BFF00E4DF47EC9BBFEE87D97F58FB0AF9AD2494FD2985FB
+% 0BF6AB7D1FF95BEC14C7AFEA7DA7EC7BECF4777DB3F58FE91BFED5BFF58F5BD1
+% FB77FDA75ACBE5549253F5524BE5549253FFD9003842494D03FD000000000006
+% 000000000000
+%EndPhotoshop
+gsave % EPS gsave
+40 dict begin
+/_image systemdict /image get def
+/_setgray systemdict /setgray get def
+/_currentgray systemdict /currentgray get def
+/_settransfer systemdict /settransfer get def
+/_currenttransfer systemdict /currenttransfer get def
+/blank 0 _currenttransfer exec
+1 _currenttransfer exec eq def
+/negative blank
+{0 _currenttransfer exec 0.5 lt}
+{0 _currenttransfer exec 1 _currenttransfer exec gt}
+ifelse def
+/inverted? negative def
+/level2 systemdict /languagelevel known
+{languagelevel 2 ge} {false} ifelse def
+/level3 systemdict /languagelevel known
+{languagelevel 3 ge} {false} ifelse def
+gsave % Image Header gsave
+/rows 314 def
+/cols 415 def
+415 314 scale
+level2 {
+/DeviceGray
+setcolorspace currentdict /PhotoshopDuotoneColorSpace undef currentdict /PhotoshopDuotoneAltColorSpace undef } if
+/picstr1 52 string def
+/readdata {currentfile exch readhexstring pop} def
+/image2 level2 {/image load def} {{begin
+Width Height BitsPerComponent ImageMatrix
+/DataSource load image end} def} ifelse
+/beginimage {
+image2
+} def
+12 dict begin
+/ImageType 1 def
+/Width cols def
+/Height rows def
+/ImageMatrix [cols 0 0 rows neg 0 rows] def
+/BitsPerComponent 1 def
+/Decode [0 1] def
+/DataSource {picstr1 readdata} def
+currentdict end
+%%BeginBinary: 33691
+beginimage
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFEFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFEFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFEFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFEFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFEFFFFFFFFFF7E3FFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFE
+FFFFFFFFFF789FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFC7BDFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFD7BFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFEFFFFFFFF
+FF703FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF719FFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFEFFFFFFFFFF73DFE00000000000000000000000000000000000000000
+000000000000000000000000000000000000000000003FFFFFFFFFFFFF7BDFC0
+0000000000000000000000000000000000000000000000000000000000000000
+000000000000000000003FFFFFFFFFFFFF7BDFC0000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000003FFE
+FFFFFFFFFF799FC7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FF7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFEFFFFFFFFFF7E7FC7FFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF7FFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFF3FFFFFFFFFFFFFFFFFC7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFF7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFFFFFFFF
+FFFFFFC7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF7FFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFEFFFFFFFFFFFFFFC7FFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF7FFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFF3FFFFFFFFFFFFFFFFFC7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFF7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFFFFFFFFFFFFFFC7
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFF3FFFFFFFFFFFFFFFFFC7FFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFE
+FFFFFFFFFFFFFFC7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFEFFFFFFFFFFFFFFC7FFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFF3FFFFFFFFFFFFFFFFFC7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFEFFFFFFFF
+FFFFFFC7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFEFFFFFFFFFFFFFFC7FFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFF3FFEFFFFFFFFFFFFFFC7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFEFFFFFFFFFFFFFFC7
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFF3FFEFFFFFFFFFFFFFFC7FFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFE
+FFFFFFFFFFFFFFC7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFEFFFFFFFFFFFFFFC7FFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFF3FFEFFFFFFFFFFFFFFC7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFEFFFFFFFF
+FFFFFFC7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFFFFFFFFFFFFFFC7FFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FF0F3FFFFFFFFFFFFF7FBFC7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFE073FFFFFFFFFFFFE7F3FC7
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFE073FFEFFFFFFFFFC7E3FC7FFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFE073FFE
+FFFFFFFFFF7EBFC7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFE073FFEFFFFFFFFFF7DBFC7FFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFF0F3FFEFFFFFFFFFF79BFC7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF1FFFFFF3FFFFFFFFFFF
+FF7BBFC7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFE0FFFFFF3FFEFFFFFFFFFF701FC03FFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFC07F
+FFC03FFEFFFFFFFFFF7FBFC7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFC07FFFFF3FFFFFFFFFFFFF7FBFC7
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFE07FFFFF3FFEFFFFFFFFFFFFFFC7FFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFE0FFFFFF3FFF
+FFFFFFFFFFFFFFC7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFBFFFFFF3FFEFFFFFFFFFFFFFFC7FFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+1FFFFFFFFFFF3FFFFFFFFFFFFFFFFFC7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFE0FFFFFFFFFFF3FFEFFFFFFFF
+FFFFFFC7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFC0FFFFFFFFFFF3FFEFFFFFFFFFFFFFFC7FFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFC0FFFFFFF
+FFFF3FFEFFFFFFFFFFFFFFC7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFC0FFFFFFFFFFF3FFEFFFFFFFFFFFFFFC7
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFE0FFFFFFFFFFF3FFEFFFFFFFFFFFFFFC7FFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFE
+FFFFFFFFFFFFFFC7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFE3FFFFFFFFFFFFFFFF3FFEFFFFFFFFFFFFFFC7FFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFC1FFFF
+FFFFFFFFFFFF3FFEFFFFFFFFFFFFFFC7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFC0FFFFFFFFFFFFFFFF3FFFFFF807FF
+FFFFFFC7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFC0FFFFFFFFFFFFFFFF3FFFFFF007FFFFFFFFC7FFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFC0FFFFFFFFFFFF
+FFFF3FFEFFE7FFFFFFFFFFC7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFC1FFFFFFFFFFFFFFFF3FFFFFE7FFFFFFFFFFC7
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFE3FFFFFFFFFFFFFFFF3FFEFFF7FFFFFFFFFFC7FFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFE
+FFFBFFFFFFFFFFC7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFC3FFFFFFFFFFFFFFFFFFFFF3FFEFFF007FFFFFFFFC7FFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF81FFFFFFFFF
+FFFFFFFFFFFF3FFFFFF3FFFFFFFFFFC7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFF81FFFFFFFFFFFFFFFFFFFFF3FFEFFE7FFFF
+FF783FC7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFF81FFFFFFFFFFFFFFFFFFFFF3FFFFFF7FFFFFE7B9FC7FFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF81FFFFFFFFFFFFFFFFF
+FFFF3FFEFFF3FFFFFC7BDFC7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFC3FFFFFFFFFFFFFFFFFFFFF3FFFFFF007FFFF7FDFC7
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFF3FFEFFF007FFFF7F9FC7FFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFE7FFFFFFFFFFFFFFFFFFFFFFFFFF3FFF
+FFFFFFFFFF7F3FC7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFF83FFFFFFFFFFFFFFFFFFFFFFFFFF3FFEFF1FFFFFFF7E7FC7FFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF81FFFFFFFFFFFFFF
+FFFFFFFFFFFF3FFFFFC1FFFFFF7DFFC7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFF01FFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFFF83FFF
+FF79FFC7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+01FFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFFFF87FFFF701FC7FFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF83FFFFFFFFFFFFFFFFFFFFFF
+FFFF3FFFFFFFF7FFFFFFFFC7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFE7FFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFFFFE7FFFFFFFFC7
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFF3FFFFFFF07FFFFFFFFC7FFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFEFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFF
+FFFC3FFFFFFFFFC7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFF83FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFFE17FFFFFFFFFC7FFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF03FFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFF3FFFFF877FFFFFFFFFC7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFF03FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFF3F7FFF
+FFFFFFC7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF03FFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFF877FFFFFFFFFC7FFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF83FFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFF3FFFFFF17FFFFFFFFFC7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFCFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFFFC3FFFFFFFFFC7
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFF3FFFFFFF07FFFFFFFFC7FFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFF
+FFFFE7FFFFFFFFC7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF87
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFFFFFFFFFFFFFFC7FFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF03FFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFF3FFFFFF7E7FFFFFFFFC7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFF03FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFFF38FFF
+FFFFFFC7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF03FFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFFF91FFFFFFFFFC7FFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFF03FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFF3FFFFFF87FFFFFFFFFC7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFF07FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFFFCFFFFFFFFFFC7
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFF3FFFFF0007FFFFFFFFC7FFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFF
+FF0007FFFFFFFFC7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFFFFFFFFFF7C3FC7FFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF0FFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFF3FFFFFFFFFFFFE79DFC7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFE07FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFFFFFFFF
+FD7BDFC7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFE07FFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFFFFFFFFFF7BDFC7FFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFE07FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFF3FFFFFFFFFFFFF7BDFC7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+E07FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFFFFFFFFFF7BDFC7
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF0FFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFF3FFFFFFFFFFFFF7BDFC7FFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFE3FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFF
+FFFFF7FFFF7BDFC7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFC1FFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFFFFC1FFFF799FC7FFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFF80FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFF3FFFFFFFEDFFFF7C3FC7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFF80FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFFFFFFFF
+FFFFFFC7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF80FFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFFFFFFFFFFFFFFC7FFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFC1FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFF3FFFFFFFFFFFFFFFFFC7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFDFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFFF007FFFFFFFFC7
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF87FFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFF3FFFFFF3FFFFFFFFFFC7FFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFF03FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFF
+FFE7FFFFFFFFFFC7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF03FFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFFF7FFFFFFFFFFC7FFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFF03FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFF3FFFFFF7FFFFFFFFFFC7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FF03FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFFF007FF
+FFFFFFC7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF87FFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFFF007FFFFFFFFC7FFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFBFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFF3FFFFFFFFFFFFFFFFFC7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFE0FFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFFFFFFFFFFFFFFC7
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFC0FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFF3FFFFFF81FFFFFFFFFC7FFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFC0FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFF
+FFF18FFFFFFFFFC7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFC0FFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFFF7E7FFFFFFFFC7FFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFE0FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFF3FFFFFE7F7FFFFFFFFC7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF1
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFFE7F7FF
+FFFFFFC7FFFFFFFFFFFFFFFFFFFFFFFFFFFEFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFFF7E7FFFFFFFFC7FFFFFFFFFFFFFFFF
+FFFFFFFFFFF83FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFF3FFFFFF18FFFFFFFFFC7FFFFFFFFFFFFFFFFFFFFFFFFFFF81FFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFFF81FFFFFFE7FC7
+FFFFFFFFFFFFFFFFFFFFFFFFFFF01FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFF3FFFFFFFFFFFFFF99FC7FFFFFFFFFFFFFFFFFFFFFFFF
+FFF01FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFF
+FFFFFFFFFFFBDFC7FFFFFFFFFFFFFFFFFFFFFFFFFFF81FFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFF3007FFFFF9DFC7FFFFFFFF
+FFFFFFFFFFFFFFFFFFFC7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFF3FFFFFFFFFFFFFFC3FC7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFFFFFFFF
+FFFC3FC7FFFFFFFFFFFFFFFFFFFFFFFF9FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFFF7F7FFFFFBDFC7FFFFFFFFFFFFFFFF
+FFFFFFFE0FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFF3FFFFFF7E7FFFFFBDFC7FFFFFFFFFFFFFFFFFFFFFFFE07FFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFF8007FFFFFBDFC7
+FFFFFFFFFFFFFFFFFFFFFFFE07FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFF3FFFFFF7FFFFFFF99FC7FFFFFFFFFFFFFFFFFFFFFFFE
+07FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFF
+FFFFFFFFFFFC3FC7FFFFFFFFFFFFFFFFFFFFFFFE0FFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFFFFF7FFFFFFFFC7FFFFFFFF
+FFFFFFFFFFFFFFFF9FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFF3FFFFFF007FFFFFFFFC7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFFF00FFF
+FFFFFFC7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFFE66FFFFFFFFFC7FFFFFFFFFFFFFFFF
+FFFFC1FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFF3FFFFFE777FFFFFFFFC7FFFFFFFFFFFFFFFFFFFF81FFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFFF777FFFFFFFFC7
+FFFFFFFFFFFFFFFFFFFF81FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFF3FFFFFF367FFFFFFFFC7FFFFFFFFFFFFFFFFFFFF81FF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFF
+FFFB0FFFFFFFFFC7FFFFFFFFFFFFFFFFFFFF81FFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFFFFDFFFFFFFFFC7FFFFFFFF
+FFFFFFFFFFFFC3FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFF3FFFFFFFFFFFFFFFFFC7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFFF3E7FF
+FFFFFFC7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFFF1E7FFFFFFFFC7FFFFFFFFFFFFFFFF
+F8FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFF3FFFFFF4E7FFFFFFFFC7FFFFFFFFFFFFFFFFF07FFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFFF667FFFFFFFFC7
+FFFFFFFFFFFFFFFFF03FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFF3FFFFFF727FFFFFFFFC7FFFFFFFFFFFFFFFFE03FFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFF
+FFF787FFFFFFFFC7FFFFFFFFFFFFFFFFF03FFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFFF7C7FFFFFFFFC7FFFFFFFF
+FFFFFFFFF07FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFF3FFFFFFFFFFFFFFFFFC7FFFFFFFFFFFFFFFFF9FFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFFFFFFFF
+FFFFFFC7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFF3007FFFFFE3FC7FFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFF3FFFFFFFFFFFFFF99FC7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFFFFFFFFFFFBDFC7
+FFFFFFFFFFFFFE1FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFF3FFFFFF7F7FFFFFB7FC7FFFFFFFFFFFFFC0FFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFF
+FF8007FFFFF01FC7FFFFFFFFFFFFFC0FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFF800FFFFFF3DFC7FFFFFFFF
+FFFFFC0FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFF3FFFFFF7FFFFFFF3DFC7FFFFFFFFFFFFFC0FFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFFFFFFFF
+FFFBDFC03FFFFFFFFFFFFE1FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFC03FFFFFFC5FFFFFFBDFC7FFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFF3FFFFFF84FFFFFFC3FC7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFFF267FFFFFFFFC7
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFF3FFFFFF677FFFFFFFFC7FFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFF
+FFF677FFFFFFFFC7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFFF667FFFFFFFFC7FFFFFFFF
+FF83FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFF3FFFFFF24FFFFFFFFFC7FFFFFFFFFF03FFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFFF80FFF
+FFFFFFC7FFFFFFFFFF01FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFFFFFFFFFFFFFFC7FFFFFFFFFF01FFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFF3FFFFFFFFFFFFFFFFFC7FFFFFFFFFF83FFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFFF807FFFFFFFFC7
+FFFFFFFFFF87FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFF3FFFFFF007FFFFFFFFC7FFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFF
+FFF7FFFFFFFFFFC7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFFF7FFFFFFFFFFC7FFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFF3FFFFFF7FFFFFFFFFFC7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFFFBFFFF
+FFFFFFC7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFFF007FFFFFFFFC7FFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFF3FFFFFFFFFFFFFFFFFC7FFFFFFF1FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFFFFFFFFFFFFFFC7
+FFFFFFE0FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFF3FFFFFFFFFFFFFFFFFC7FFFFFFC07FFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFF
+FFF001FFFFFFFFC7FFFFFFC07FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFFF98CFFFFFFFFC7FFFFFFC0
+7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFF3FFFFFF7E6FFFFFFBFC7FFFFFFE0FFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFFF7F67F
+FFFF3FC7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFFF7E67FFFFE3FC7FFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFF3FFFFFF3E6FFFFFEBFC7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFFF80CFFFFFDBFC7
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFF3FFFFFFE7FFFFFFBBFC7FFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFF
+FFFFFFFFFFF01FC7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFFFC07FFFFF01FC7FFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFF3FFFFFF007FFFFFFBFC7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFFF24FFF
+FFFFBFC7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFFF767FFFFFFFFC7FFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFF3FFFFFF777FFFFFFFFC7FFF83FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFFF777FFFFFFFFC7
+FFF81FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFF3FFFFFF127FFFFFFFFC7FFF81FFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFF
+FFFB8FFFFFFFFFC7FFF81FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFFFFFFFFFFFFFFC7FFF81FFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFF3FFFFFFFFFFFFFFFFFC7FFFC3FFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFF8007FF
+FFFFFFC7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFF8007FFFFFFFFC7FFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFF3FFFFF87FFFFFFFFFFC7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFFF0FFFFFFFFFFC7
+FF3FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFF3FFFFFFE1FFFFFFFFFC7FC0FFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFF
+FFFFC7FFFFFFFFC7FC0FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFFFF87FFFFFFFFC7FC0FFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFF3FFFFFFC1FFFFFFFFFC7FC0FFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFFE0FFFF
+FFFFFFC7FC0FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFF8FFFFFFFFFFFC7FF3FFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFF3FFFFF8007FFFFFFFFC7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFF8007FFFFFFFFC7
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFF3FFFFFFFFFFFFFFC7FC7FFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFF
+FFFFFFFFFFF81FC7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFFFFFFFFFFFBDFC7FFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFF3FFFFFFFFFFFFFFFDFC7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFFFFFFFF
+FFFF9FC70FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFFFFFFFFFFFFBFC607FFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFF3FFFFFFFFFFFFFFF7FC607FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFFFFFFFFFFFEFFC6
+07FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFF3FFFFFFFFFFFFFF9FFC607FFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFF
+FFFFFFFFFFFBFFC707FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFFFFFFFFFFF01FC7FFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFF3FFFFFFFFFFFFFFFFFC7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFFFFFFFF
+FFFFFFC7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFFFFFFFFFFFFFFC07FFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFF3FFFFFFFFFFFFFFFFFC03FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFFFFFFFFFFFFFFC0
+3FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFF3FFFFFFFFFFFFFFFFFC03FFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFF
+FFFFFFFFFFFFFFC03FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFFFFFFFFFFFFFFC07FFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFF3FFFFFFFFFFFFFFFFFC7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFFFFFFFF
+FFFFFFC7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFFFFFFFFFFFFFFC7FFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFF3FFFFFFFFFFFFFFFFFC7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFFFFFFFFFFFFFFC7
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFF3FFFFFFFFFFFFFFFFFC7FFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFF
+FFFFFFFFFFFFFFC7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFFFFFFFFFFFFFFC7FFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFF3FFFFFFFFFFFFFFFFFC7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFFFFFFFF
+FFFFFFC7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFFFFFFFFFFFFFFC7FFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFF3FFFFFFFFFFFFFFE7FC7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFFFFFFFFFFFC9FC7
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF7FFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFF3FFFFFFFFFFFFFFBDFC7FFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFF7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFF
+FFFFFFFFFFFBDFC7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FF7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFFFFFFFFFFFBDFC7FFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF7FFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFF3FFFFFFFFFFFFFFBDF83FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFF7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFFFFFFFF
+FFFBDF0000000000000000000000000000000000000000000000000000000000
+00000000000000000000000000003FFFFFFFFFFFFFFBDF000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+00003FFFFFFFFFFFFFFBDF000000000000000000000000000000000000000000
+000000000000000000000000000000000000000000003FFFFFFFFFFFFFF99F83
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFC3F83FFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF83FFFFFFFFFFFFFFFF
+7FFFFFFFFFFFFFFF83FFFFFFFFFFFFFFFC3FFFFFFFFFFFFFFFF9FFFFFFFFFFFF
+FFFE0FFFFFFFFFFFFFFFFFBBFFFFFFFFFFFFFFFE7FFFFFFFFFFFFFFFB9FFFFFF
+FFFFFFFFF99FFFFFFFFFFFFFFFF9FFFFFFFFFFFFFFFEFFFFFFFFFFFFFFFFFF3B
+FFFFFFFFFFFFFFF97FFFFFFFFFFFFFFF3DFFFFFFFFFFFFFFFFDFFFFFFFFFFFFF
+FFF5FFFFFFFFFFFFFFFCFFFFFFFFFFFFFFFFFF7DFFFFFFFFFFFFFFFB7FFFFFFF
+FFFFFFFFFDFFFFFFFFFFFFFFFF9FFFFFFFFFFFFFFFE5FFFFFFFFFFFFFFFD3FFF
+FFFFFFFFFFFFFF7DFFFFFFFFFFFFFFFF7FFFFFFFFFFFFFFFFBFFFFFFFFFFFFFF
+FF3FFFFFFFFFFFFFFFCDFFFFFFFFFFFFFFFCCFFFFFFFFFFFFFFFFF7DFFFFFFFF
+FFFFFFFF7FFFFFFFFFFFFFFFF3FFFFFFFFFFFFFFFFDFFFFFFFFFFFFFFFDDFFFF
+FFFFFFFFFFFFEFFFFFFFFFFFFFFFFF7DFFFFFFFFFFFFFFFF7FFFFFFFFFFFFFFF
+E7FFFFFFFFFFFFFFFFCFFFFFFFFFFFFFFFBDFFFFFFFFFFFFFFFFEFFFFFFFFFFF
+FFFFFF39FFFFFFFFFFFFFFFF7FFFFFFFFFFFFFFFDFFFFFFFFFFFFFFFFBCFFFFF
+FFFFFFFFFF80FFFFFFFFFFFFFFFDEFFFFFFFFFFFFFFFFFBBFFFFFFFFFFFFFFFF
+7FFFFFFFFFFFFFFFBFFFFFFFFFFFFFFFF9DFFFFFFFFFFFFFFFFDFFFFFFFFFFFF
+FFFDCFFFFFFFFFFFFFFFFF83FFFFFFFFFFFFFFFF7FFFFFFFFFFFFFFF01FFFFFF
+FFFFFFFFFC1FFFFFFFFFFFFFFFFDFFFFFFFFFFFFFFFE1FFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFF7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFE7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFC7FFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFFE67FFF
+CFE00DFFE7FBFFFE7E1FD7FF9FEFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFE3FFFFFE7FFFFCFE7FFFFE7FBFFFC7CCFB7FF
+1FEFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFE9FFFFFE7FFFFCFE7FFFFE7FBFFF879EF77FF4FCFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFCDF4380E6707C0FE7FDE0
+E70BFFF679EE03FE6FDD087FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFDCF198C6667398FE7FDCCE663FFFE7BE603FEEFDCC33F
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFDCF3D
+9E666FB3CFE01D9E66F3FFFE7BE7F7FEE7DDE7BFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF9EF7C9E666F93CFE01DBF64F3FFFE
+7BE7F7FCF79DE7BFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFF8077C9F664013CFE7FD8064FBFFFE7BE7FFFC07BDE7BFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFBF77C9F664FF3
+CFE7FDBFE4FBFFFE79EFFFF9F3BDE7BFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFF3F33D9E666F93CFE7FD9E66F3FFFE79EFFFFB
+F93DE7BFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFF7F3198CE667398FE7FDCC66633FFE7CCFFFFBF97DE7BFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFE7FB0380E670780FE7FDC0
+E70B1FFE7C1FFFF3F97DE7BFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFF7F9FFFFFFFFFFFFFFFFFFF9FFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF7F
+9FFFFFFFFFFFFFFFFFFF9FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF7F9FFFFFFFFFFFFFFFFFFF3FFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFF7F9FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFF
+
+%%EndBinary
+grestore end % Image Trailer grestore
+grestore % EPS grestore
diff --git a/macros/latex/contrib/aiaa/figure_magnet.pdf b/macros/latex/contrib/aiaa/figure_magnet.pdf Binary files differnew file mode 100644 index 0000000000..5219f2d39d --- /dev/null +++ b/macros/latex/contrib/aiaa/figure_magnet.pdf diff --git a/macros/latex/contrib/aiaa/pre2004/CHANGES b/macros/latex/contrib/aiaa/pre2004/CHANGES new file mode 100644 index 0000000000..04cd691599 --- /dev/null +++ b/macros/latex/contrib/aiaa/pre2004/CHANGES @@ -0,0 +1,84 @@ +This is the file `CHANGES', which accompanies the `aiaa' distribution, +version 2.4, dated 1999/02/22 by bil kleb <w.l.kleb@larc.nasa.gov> + +v2.4 (1999/02/22) + + fixed \\ errors if some fields were left undefined for article + or note options + + changed reprint copy on cover + + moved manifest to its own file + +v2.3 (1999/02/22) [never released to CTAN] + + web address + + caption label delimeter for submit class + + played with table of content listings for subfigures under + submit class + +v2.2 (1998/09/09) [never released to CTAN] + + title/author set to raggedright in makecover for articles/notes + + the field of journalissue to exclude page range, plus... + + added \JournalPage command to indicate starting page of journal + article/note. now the page range on the cover and page numbers + of the document are accounted for automatically + +v2.1 (1998/08/04) + + added note about web site home + + zip code for aiaa + + belowcaptionskip for tables + +v2.0 (1998/02/28) + + patch level 1: (1998/03/02) + + version numbers + + updated typeouts + + patch level 0: + + font sizes and positions of various elements on the + cover page for conference papers. + + eliminated extraneous \endinput from the end of aiaa.bst + + new zip code for AIAA + + updated AIAA logo + + added a space between copyright symbol and year in copyright + notices a, b, and d + + added more journal abbreviations to bibliographic style + + added \thanksibid command + + units used in creating the cover pages to inches + + +v1.0 (1997/03/03) + + added subfigmatrix environment to make "tables" of figures + + \Figure and \Reference commands eliminated + + \incfig command modified to be simplier, less intrusive. + in fact, now it is really just a shorter version of the + antecedent \includegraphics + + subfigure caption skips + + +v0.9 (1997/02/20) + + initial release diff --git a/macros/latex/contrib/aiaa/pre2004/MANIFEST b/macros/latex/contrib/aiaa/pre2004/MANIFEST new file mode 100644 index 0000000000..081c38ab41 --- /dev/null +++ b/macros/latex/contrib/aiaa/pre2004/MANIFEST @@ -0,0 +1,39 @@ +This is the file `MANIFEST', which accompanies the `aiaa' distribution, +version 2.4, dated 1999/02/22 by bil kleb <w.l.kleb@larc.nasa.gov> + +The `aiaa' distribution consists of several files. the first three +are the core, and the rest are examples and test equipment: + + main directory: + + aiaa.ins - the installation driver for aiaa.dtx + aiaa.dtx - instructions on how to use the new class, + the code itself, the 9pt style, and the + bibliographic style sheet, all in + `docstrip'-able format + aiaalgo.eps - the aiaa logo in encapsulated postscript format + demos - directory of samples and test equipment + + demos/paper subdirectory: + + smpaiaa.tex - a sample document + smpfig.eps - a sample figure + smpbtx.bib - a sample BibTeX database for use with smpaiaa.tex + + demos/subfigs directory: + + smpsubf.tex - a sample document devoted entirely to various + subfigure layouts + smpfig.eps - a sample figure + + demos/talk subdirectory: + + smptalk.tex - a sample presentation using `slides' class + smptalk.sty - a sample package for use with smptalk.tex + smpfig.eps - a sample figure + + demos/refs subdirectory: + + tstref.tex - an additional document made for specifically + testing the aiaa bibliographic style + tstbtx.bib - the BibTeX database that goes with aiaaref.tex diff --git a/macros/latex/contrib/aiaa/pre2004/README b/macros/latex/contrib/aiaa/pre2004/README new file mode 100644 index 0000000000..0cb5a5d501 --- /dev/null +++ b/macros/latex/contrib/aiaa/pre2004/README @@ -0,0 +1,57 @@ +This is the file `README', which accompanies the `aiaa' distribution, +version 2.4, dated 1999/02/22 by bil kleb <w.l.kleb@larc.nasa.gov> + +INTRODUCTION: + +This distribution is centered around a modification to the standard article +document class to produce (nearly) aiaa-conformant conference papers +and journal submittals---it will even simulate the typesetting +of journal articles and notes for length-determination +purposes. The distribution also contains a (mostly) aiaa-compliant +bibliographic style sheet for use with BibTeX, a 9pt style sheet, +a sample document, a sample presentation, and other miscellaneous +examples and test equipment. + +USER'S MANUAL: + +To produce a users' manual, run LaTeX on `aiaa.dtx'. + +INSTALLATION: + +To obtain the individual files which are part of the aiaa package, +run LaTeX on the installation file, `aiaa.ins'. LaTeX's docstrip +utility will extract the files from `aiaa.dtx'. + +DISTRIBUTING: + +You are free to re-distribute these files provided the restrictions +mentioned in 'aiaa.ins' are obeyed. These are mainly that the +three core files always must be distributed as a whole and that +no one is allowed to distribute the files for profit. + +REQUIREMENTS: + +This package relies on the presence of a number of other packages: + + caption2 dropping endfloat fancyhdr + graphicx lastpage setspace subfigure + +Most come bundled with the various (La)TeX distributions, others +are available from any CTAN site or its mirrors---see the users' +manual for more information on CTAN. Typically you'll need +to get `dropping' and `caption2'. + +DISCLAIMER: + +This distribution is not connected with the AIAA in any way, it +simply represents the product of several people's efforts to +create a usable AIAA LaTeX2e template for conference papers +and journal submissions. + +WEBSITE: + +http://abweb.larc.nasa.gov:8080/~kleb/aiaa/ + +INQUIRIES: + +Inquiries can be sent to: <w.l.kleb@larc.nasa.gov> diff --git a/macros/latex/contrib/aiaa/pre2004/aiaa.dtx b/macros/latex/contrib/aiaa/pre2004/aiaa.dtx new file mode 100644 index 0000000000..116a768eed --- /dev/null +++ b/macros/latex/contrib/aiaa/pre2004/aiaa.dtx @@ -0,0 +1,2995 @@ +% +% \iffalse +%% Description: a bundle of LaTeX and BibTeX files to produce +%% AIAA papers and simulated journal articles/notes +%% Keywords: LaTeX, class, AIAA, BibTeX, bibliographic-style, 9pt-option +%% Author: Bil Kleb <w.l.kleb@larc.nasa.gov> +%% Maintainer: same +%% Version: 2.4 <22 feb 1999> +%% +%% Please see the information in file `aiaa.ins' on how you +%% may use and (re-)distribute this file. Run LaTeX on the file +%% `aiaa.ins' to get the main aiaa class and other auxilary packages. +%% Also run LaTeX on `aiaa.dtx' (this file) to obtain a users manual +%% and code documentation. +%% +%% NOTE: This file may NOT be distributed if not accompanied +%% by 'aiaa.ins' and `aiaalgo.eps'. +% \fi +% +% \def\filename{aiaa.dtx} +% \def\fileversion{2.4} +% \def\filedate{1999/02/22} +% \def\docdate{\filedate} +% \date{\docdate} +% +% \newcommand*{\cls}[1]{\textsl{#1}} +% \newcommand*{\pkg}[1]{\textsf{#1}} +% \newcommand*{\file}[1]{\texttt{#1}} +% \newcommand*{\kbd}[1]{\texttt{#1}} +% \setcounter{errorcontextlines}{10} +% +% \MakeShortVerb{\|} +% +% \CheckSum{1685} +%% \CharacterTable +%% {Upper-case \A\B\C\D\E\F\G\H\I\J\K\L\M\N\O\P\Q\R\S\T\U\V\W\X\Y\Z +%% Lower-case \a\b\c\d\e\f\g\h\i\j\k\l\m\n\o\p\q\r\s\t\u\v\w\x\y\z +%% Digits \0\1\2\3\4\5\6\7\8\9 +%% Exclamation \! Double quote \" Hash (number) \# +%% Dollar \$ Percent \% Ampersand \& +%% Acute accent \' Left paren \( Right paren \) +%% Asterisk \* Plus \+ Comma \, +%% Minus \- Point \. Solidus \/ +%% Colon \: Semicolon \; Less than \< +%% Equals \= Greater than \> Question mark \? +%% Commercial at \@ Left bracket \[ Backslash \\ +%% Right bracket \] Circumflex \^ Underscore \_ +%% Grave accent \` Left brace \{ Vertical bar \| +%% Right brace \} Tilde \~} +% +% \title{% +% \textsf{aiaa} -- a \LaTeX{} Class and \BibTeX{} +% Style\\ for AIAA\thanks{The American Institute of Aeronautics +% and Astronautics.}\ \ Conference Papers\\ and Journal +% Submission/Simulation\thanks{This document describes \textsf{aiaa} version +% \fileversion which was born on \docdate .}} +% +% \author{bil kleb\thanks{Research Scientist, NASA Langley +% Research Center, Hampton, Virginia.}} +% +% \maketitle +% +% \begin{abstract} +% This document describes the \textsf{aiaa} distribution which +% is centered around a modification of the standard \LaTeX{} +% article class, \cls{article.cls}. The new class produces +% AIAA-conformant\footnote{Note this distribution is not a +% product of, nor endorsed by, the AIAA.} +% conference papers and journal submittals---it +% will even simulate the typesetting of journal articles and notes +% for length-determination purposes. This distribution also contains +% a (mostly) AIAA-compliant bibliographic style sheet, +% sample documents, a sample presentation, and other test equipment. +% \end{abstract} +% +% \tableofcontents +% +% \section{Introduction} +% +% The \textsf{aiaa} distribution consists of a \LaTeX{} class +% and various other files which are supposed to simplify +% the task of producing an AIAA conference paper +% and the subsequent journal submission +% For instance, with a simple, +% one-word option in the beginning of the document, a manuscript can +% take the form of a two-column conference paper replete with +% cover-page or a double-spaced journal submission manuscript +% with figures and tables at the end, including the required +% caption lists. +% +% \section{Userguide} +% +% I apologize for the sparseness of this documentation; but, hey, +% this is not in my job description.\ |;)|\ \ Hopefully the sample +% documents \file{smpaiaa.tex}, \file{smpsubf.tex}, and \file{smptalk.tex} +% provide suitable documentation through example. +% +% \subsection{Requirements} +% +% The \kbd{aiaa} distribution was developed using +% \LaTeXe{} of 1995/12/01, patch level 1, +% running \TeX{} 3.14159 and +% \texttt{dvips} 5.58f---the te\TeX{} distribution 0.3.3.\footnote{ +% The \kbd{aiaa} distribution has also been demonstrated on +% a Mac running the {\scshape Oz}\TeX{} \TeX{} distribution and a +% PC running the Mik\TeX{} \TeX{} distribution.} +% So anything more recent should work, but anything older: no guarantees. +% In particular, your \kbd{graphicx} package needs +% to be newer than September 1995 so that the |keepaspectratio| +% command is available. +% +% The \cls{aiaa} class depends +% on having access to a number of packages.\footnote{When you process +% a file with \LaTeX{}, it will let you which packages it is +% missing. The less common ones are \pkg{dropping} and \pkg{caption2} while +% the other required packages: +% \pkg{lastpage}, \pkg{setspace}, \pkg{endfloat}, \pkg{overcite}, +% \pkg{graphicx}, and \pkg{fancyhdr} are usually bundled with +% most \LaTeX{} distributions.} +% If your local site does not have all the packages necessary, they +% can be obtained from your nearest Comprehensive TeX Archive +% Network (CTAN) site. In fact, chances are that this is where you found +% this distribution. Details on how to obtain packages from a +% CTAN site are available at |http://www.tug.org/| +% or various \LaTeX{} reference books~\cite{companion,guide}. +% Especially helpful in locating various \LaTeX{} packages is +% the \kbd{Catalogue.html} web page found in the \kbd{help/Catalogue} +% directory of CTAN. +% +% \subsection{Setup} +% +% If you have not already run \file{aiaa.ins} through \LaTeX{}, +% do so. The \pkg{docscript} utility (part of \LaTeX{}) +% will rip the code segments out of \file{aiaa.dtx} +% and save them in several files. If you encounter an error +% on installation like: +% \begin{verbatim} +% ! Undefined control sequence +% \batchLine -> generate +% {\file {aiaa.cls}{\from{aiaa.dtx}{class}}} +% 1.728 \processbatchFile +% \end{verbatim} +% this means that your \pkg{docstrip} is very old and that you +% will need to update your entire \LaTeX{} distribution to +% take advantage of the \pkg{aiaa} package. +% +% Move the files \file{aiaa.cls}, +% \file{aiaa9pt.sty}, \file{aiaaenf.cfg}, and \file{aiaalgo.eps} +% to a directory searched by \TeX{}\footnote{For a Unix te\TeX{} installation, +% a privileged user could put these files in a directory named +% something like \kbd{/usr/local/teTeX/texmf/tex/latex/aiaa}\ for +% the entire site to use, remembering to run \kbd{texhash} to +% re-configure te\TeX{} to search the new directory; +% or, a lowly user could make their own directory, {\it e.g.}, +% \kbd{$\sim$/tex/inputs}, put the files in there, and set +% the environment variable \kbd{TEXINPUTS} via `\kbd{setenv +% TEXINPUTS $\sim$/tex/inputs:}'. The colon represents the system search +% path so, in this case, the user files take precedence. +% On a Mac or PC installation put these files in +% a folder named something like \file{TeX-inputs}.} +% and the file \file{aiaa.bst} to +% a directory searched by \BibTeX{}.\footnote{% +% Similar to preceding footnote, only on Unix use +% the environment variable \kbd{BSTINPUTS} +% for the bibliographic style file and +% \kbd{BIBINPUTS} for the bibliographic database; for Mac's, +% use the \file{BibTeX-inputs} folder, failing that try +% using the \file{TeX-inputs} folder.} +% Once things are installed, try to \LaTeX{} the sample AIAA +% paper in the \file{demo/paper} directory, |smpaiaa.tex|. It should +% produce something similar to |smpaiaa.ps|. +% +% \subsection{Usage} +% The \cls{aiaa} class is envoked by including\\ +% | \documentclass[|{\itshape options}|]{aiaa}|\\ +% at the beginning of your document. The package +% recognizes the following options: |submit|, |paper|, +% |article|, |note|, and |cover|. +% The |paper| option is the default and the |submit| option +% overrides any other option. The |cover| option produces +% a cover-page for conference papers or simulated journal +% reprints. +% In addition, any options that the standard \LaTeX{} article +% class accepts can be also inserted, {\it e.g.}, +% \kbd{draft}.\footnote{The \kbd{draft} +% option replaces figures with a labeled box of the appropriate size.} +% Note, when using the |note| +% option, your title and author information may need to be +% modified with extra line breaks (|\\|) +% since this information is no longer allowed to span both +% columns and may overfill the short tex twidth available. +% Other than this, the document is written just like one were +% using the standard \LaTeX{} article document class; and thus, I +% don't have to write much more on usage since it has already +% been documented by others in various \LaTeX{} +% books~\cite{companion,guide,latex}. However, +% some of the old commands have slightly different behaviors and there are +% a few new commands designed to make life a little brighter; +% these are discussed in the following sections. +% +% \subsection{General Commands} +% +% Several standard \LaTeX{} commands have been modified +% to behave differently under the new class. In addition, +% several new commands have been introduced to ease +% document preparation. Both types are discussed in the +% following subsections. +% +% \subsubsection{New Behavior from Old Commands} +% +% \DescribeMacro{\abstract} +% The |\abstract| command has been redefined within the \cls{aiaa} +% class to behave as part of the |\maketitle| sequence. Simply +% load |\abstract| as you would |\title| or |\author|, and +% as long as you have not selected the options |submit| or |note| +% (which do not allow for abstracts), the text loaded into +% the |\abstract| command will be typeset, indented and centered, +% underneath the title/author section. Remember |\abstract| must +% be loaded {\bfseries before} |\maketitle| is invoked. This is +% typically done in the preamble\footnote{% +% The preamble is defined as anywhere between the +% \cs{documentclass}\texttt{\string{\string}} +% and \cs{begin}\texttt{\string{document\string}} commands.} +% of your \LaTeX{} document. +% +% \DescribeMacro{\date} +% The \cls{aiaa} class automatically nulls the |\date| command used +% by |\maketitle|. Standard \LaTeX{} behavior of |\maketitle| +% is to typeset the current date as part of the title section +% if one is not given. So, normal one has to issue the command: +% |\date{}| when producing AIAA papers. When using the +% \cls{aiaa} class, this is no longer necessary; this command +% has already been issued. +% +% \DescribeMacro{\and} +% \DescribeMacro{\maketitle} +% Suffice it to say that |\maketitle| and |\and| have also been +% hacked, the ramifications of which I have yet to determine. +% +% \DescribeMacro{\section} +% \DescribeMacro{\subsection} +% \DescribeMacro{\subsubsection} +% \DescribeMacro{\paragraph} +% \DescribeMacro{\subparagraph} +% One no longer has to use the starred versions of these +% commands to defeat the numbering of sections. The counter +% \kbd{secnumdepth} has been set to $-2$ via, +% |\setcounter{secnumdepth}{-2}| +% so that even the unstarred versions of the sectioning commands +% never produce a number.\footnote{The \kbd{secnumdepth} counter +% controls how many +% nesting levels of section numbers should be produced. +% Of course you can defeat this by changing the counter back to its +% \LaTeX{} \cls{article} class default value of $3$ which +% will number sections down to subsections.} +% In addition, the fonts, sizes, and positions normally produced by +% these commands have been modified to make the output similar +% to a typeset journal article. In other words, +% we take advantage of the fact that you are not using a +% typewriter, {\it e.g.}, AIAA-suggested underlining for section +% names, etc.{} is replaced by the typesetting-capable equivalent. +% +% \subsubsection{New Commands} +% +% \DescribeMacro{\thanksibid} +% The command |\thanksibid| is very similar to the standard +% |\thanks| command which is used when footnoting +% the author affliations within the |\author| field. +% The distinction is that the |\thanksibid| command allows one +% to repeat a given footnote symbol without repeating the associated +% footnote text. Example of use: +% \begin{verbatim} +% \author{% +% Peter Gnoffo\thanks{Some thanks for a peter.}, +% Bil Kleb\thanks{Some thanks for a bill.}, +% Bill Wood\thanksibid{2}, and % use same footnote as for second author. +% Marge Mithus\thanks{Some thanks for a marge.} +% } +% \end{verbatim} +% Thus, |\thanksibid{2}| would only produce a footnote symbol +% at the end of Bill Wood's name and it would not generate +% another footnote. Note that using the |\thanksibid| command +% does not increment the footnote counter, so for the case given +% above, an argument of `4' would not be a valid choice. +% This command was developed so that when you have \cls{aiaa} +% make a cover sheet, extraneous footnote symbols will not be +% present. +% +% \DescribeMacro{\dropword} +% The command |\dropword| is used for the first word of the +% introduction, and for any option other than |submit|, will +% produce a `dropped' capital for the beginning of the paragraph. +% Its use is simply:\\ +% | \dropword First words of the introduction, etc.|\\ +% Note: this command also capitalizes the remaining +% portion of the first word. +% This macro relies on the presence of the |dropping| package +% by Mats Dahlgren~\cite{dropping}. +% +% \DescribeMacro{\incfig} +% The |\incfig| command is used for including figures via David Carlisle's +% \pkg{graphicx} package~\cite{graphicx}. The +% command |\incfig| command is merely a shorter version of +% the original |\includegraphics| command along with a centering +% command, {\it i.e.}:\\ +% | \newcommand{\incfig}{\centering\includegraphics}|\\ +% It is typically used for including Encapsulated Postscript files +% (|*.eps|) within a |figure| environment. +% For example, to include +% a figure named |figa.eps| residing in a |figs| subdirectory, one +% would use: +% \begin{verbatim} +% and \Figure{f:figurea} shows that things are purple. +% \begin{figure} +% \incfig{figs/figa} +% \caption{This is the caption for figure a.} +% \label{f:figurea} +% \end{figure} +% \Figure{f:figurea} also shows that people are green. +% \end{verbatim} +% For more information regarding the inclusion of external +% graphic files, see the file \file{epslatex.ps} in the \kbd{info} +% directory of the CTAN. Also, read the Graphics Guide that +% is part of the \pkg{graphicx} package. +% +% \DescribeEnv{subfigmatrix} +% Via the \pkg{subfigure} package and a new environment, |subfigmatrix|, +% one can easily create a ``matrix'' of subfigures. The +% environment takes one argument: the number of columns across +% the matrix will be. +% For instance, to produce a matrix of four subfigures, two by two: +% \begin{verbatim} +% \begin{figure} +% \begin{subfigmatrix}{2} +% \subfigure[Subfigure one. ]{\incfig{one}\label{f:matrix_1}} +% \subfigure[Subfigure two. ]{\incfig{two}} +% \subfigure[Subfigure three.]{\incfig{three}} +% \subfigure[Subfigure four. ]{\incfig{four}\label{f:matrix_4}} +% \end{subfigmatrix} +% \caption{A `matrix' of four subfigures.} +% \label{f:matrix} +% \end{figure} +% and with imbedded \label commands we can refer to +% Figure~\ref{f:matrix} in entirety or specific subfigures like +% subfigure~\ref{f:matrix_1} or subfigure~\ref{f:matrix_4}. +% \end{verbatim} +% See the demonstration file \file{smpsubf.tex} which comes with +% this distribtuion for more extensive examples. +% +% \subsection{Layout-specific Commands} +% +% The following commands are used to load information for other +% commands that produce appropriate headers, footers, cover-page +% items, and document notices---{\it e.g.}, copyright conditions. All +% of these commands are normally set in the preamble +% of your document (similar to |\author| and |\title|). +% For a more modular, and perhaps cleaner approach, you could +% place all of it in a file, \file{preamble.tex}, and use +% |\input{preamble}| to include it in your main document. +% +% \subsubsection{Header and Footer Information} +% +% \DescribeMacro{\SubmitName} +% \DescribeMacro{\PaperNumber} +% \DescribeMacro{\ArticleIssue} +% \DescribeMacro{\ArticleHeader} +% \DescribeMacro{\NoteHeader} +% The commands |\SubmitName|, |\PaperNumber|, +% |\ArticleIssue|, |\ArticleHeader|, and +% |\NoteHeader| are used to put appropriate items in the header +% and footer of each page, {\it e.g.}, +% \begin{verbatim} +% \SubmitName{Kleb} +% \PaperNumber{96--0825} +% \ArticleIssue{Vol.~32, No.~6, November--December 1995}% first page +% \ArticleHeader{Kleb et al: Pitch-Over Maneuver}% subsequent pages +% \NoteHeader{J.Spacecraft, Vol.~32, No.~6: Engineering Notes} +% \end{verbatim} +% The command |\SubmitName| is used to mark the main author's +% name on all pages for the +% journal manuscript submission option: |submit|. The +% |\PaperNumber| is used to include the paper number +% for AIAA conference papers. +% The commands |\ArticleIssue|, +% |\ArticleHeader|, and |\NoteHeader| are used to create +% the appropriate headers when simulating a journal article or +% note. The contents of |\ArticleIssue| appear on the first page +% and the contents of |\ArticleHeader| appear on subsequent pages while for +% journal note simulations the contents of |\NoteHeader| is used for all pages. +% +% \subsubsection{Cover-page Information} +% +% \DescribeMacro{\CoverFigure} +% \DescribeMacro{\Conference} +% \DescribeMacro{\JournalName} +% \DescribeMacro{\JournalIssue} +% \DescribeMacro{\JournalPage} +% The commands |\CoverFigure|, +% |\Conference|, |\JournalIssue|, |\JournalPage|, and |\JournalName| provide +% information for producing cover-pages. +% \begin{verbatim} +% \CoverFigure{tstfig.eps} +% \Conference{31st AIAA Aerospace Sciences \\ +% Meeting and Exhibit \\ +% {\mfseries January 6--9, 1997/Reno, NV}}% note: non-bold date/loc. +% \JournalName{Journal of Spacecraft and Rockets} +% \JournalPage{715} +% \JournalIssue{Volume 32, Number 6} +% \end{verbatim} +% The commands |\CoverFigure| and +% |\Conference| define a representative figure (optional) +% and conference name/date/location to be used on the cover-page +% of a conference paper, while +% the commands |\JournalName| and |\JournalIssue| are for the +% cover-page produced for journal article or note reprint simulations. +% +% \subsubsection{Copyright and Other Document Notices} +% +% \DescribeMacro{\PaperNotice} +% \DescribeMacro{\JournalNotice} +% A footnote describing the copyright conditions +% and other information about the document are incorporated via the +% |\PaperNotice| and |\JournalNotice| commands. These normally include +% one of the the copyright series +% of commands: |\CopyrightA|, |\CopyrightB|, |\CopyrightC|, or +% |\CopyrightD|, described below. +% To use, simply include something like the following in +% the your document's preamble: +% \begin{verbatim} +% \PaperNotice{\CopyrightA{1996}} +% \JournalNotice{Presented as Paper 96--0825 at the AIAA 34th +% Aerospace Sciences Meeting, Reno,~NV, +% Jan.~15--18,~1996; received Feb.~15,~1996; +% revision received Nov.~25,~1996. \CopyrightC} +% \end{verbatim} +% +% \DescribeMacro{\CopyrightA} +% \DescribeMacro{\CopyrightB} +% \DescribeMacro{\CopyrightC} +% \DescribeMacro{\CopyrightD} +% The copyright commands will expand to one of the standard AIAA +% forms: A, B, C, or D. +% Note: they each have different arguments---or no +% arguments---depending on the requirements:\\ +% | \CopyrightA{|\textit{year}|}|\\ +% | \CopyrightB{|\textit{year}|}{|\textit{full name or company}|}|\\ +% | \CopyrightC|\\ +% | \CopyrightD{|\textit{year}|}|\\ +% See your AIAA copyright instructions for which form to use. +% +% \section{Known Problems} +% +% \begin{itemize} +% +% \item The bibliographic style sheet |aiaa.bst| isn't fully +% tested; and thus, you may need to fiddle with your +% |.bbl| file for your final copy, {\it i.e.}, edit |file.bbl| +% after running a \LaTeX{}, \BibTeX{}, \LaTeX{} sequence, +% but before running \LaTeX{} the final time. Note, if +% you run \BibTeX{} after modifying |file.bbl|, you will +% lose your modifications when \LaTeX{} is run +% again. Therefore, it is best to turn off write-permission +% on \file{file.bbl} after you have it correct. +% +% \item When using the |submit| option for a document which +% contains subfigures,\footnote{See +% sample documents \file{smpaiaa.tex} and +% \file{smpsubf.tex} for examples of subfigure use.} +% some of the subfigures my be clipped. +% In fact, the way the |submit| option deals with subfigures +% needs work---to put it mildly. The current work-around +% is to add \kbd{width} or \kbd{height} options to your |\incfig| +% commands until the figures fit properly. These options +% are explained in the documentation which comes with +% the \pkg{graphics} package~\cite{graphicx}. +% +% \item Currently you have to make subfigure captions appear +% in bold font explicitly, {\it e.g.},\\ +% | \subfigure[\bf Subfigure caption.]{\incfig{fig.eps}}|\\ +% The next version of \pkg{subfigure} is supposed to remedy this. +% +% \item The notices come after the author footnotes. To +% produce the correct behavior requires significant +% changes to the |\maketitle| command. +% +% \item The simulated journal article modes use the standard, free, +% Computer Modern Fonts. The AIAA journals most likely +% use licensed (\$) fonts. +% +% \item The simulated journal cover-pages do not have anywhre near +% the correct font for the journal name---does anyone know +% where to get such a {\em free}, tall, bold, squashed +% helvetic-style font? It looks like Bitstream's Aurora +% condensed\ldots +% +% \item (Not actually an \pkg{aiaa} problem.) +% Using the starred versions of |figure| and |table| +% environments (floats which span both columns) +% inter-mixed with the unstarred versions (single-column +% wide floats) often creates a situation where the +% figures or tables appear out of order. For the final +% copy, this can normally be corrected with judicious +% use of float position specifiers.\footnote{Recall, {\bf +% never} use just \kbd{[h]}, always give other options or +% that float might get `stuck' and force it and all the +% following floats to the end of the document.} +% Unfortunately, this is +% stock, documented behavior for \LaTeX{}. +% However, recently a package \pkg{fix2col} has become available +% which appears to rectify this behavior. It can be +% found on CTAN in the +% \kbd{macros/latex/contrib/supported/carlisle} directory. +% +% \end{itemize} +% +% \section{Acknowledgements} +% +% Bundling and documenting this |aiaa| distribution in docstrip +% format was done by using other packages as a model, +% particularly, Mats Dahlgren's \pkg{dropping}~\cite{dropping} +% and Jeff Goldberg {\em et al}'s \pkg{endfloat}~\cite{endfloat}. +% +% I want to thank the people of the |comp.text.tex| newsgroup, +% the \TeX{}/\LaTeX{} Frequently Asked Questions maintainers, +% and various package authors for patiently answering my inane +% questions, in particular, but in no particular order: +% \begin{list} +% {$\triangleright$} +% {\setlength{\itemsep}{0pt}\setlength{\parsep}{0pt}} +% \item Donald Arsenau (|asnd@reg.triumf.ca|) +% \item Robin Fairbairns (|Robin.Fairbairns@cl.cam.ac.uk|) +% \item Piet van Oostrum (|piet@cs.ruu.nl|) +% \item Jeroen Nijhof (|nijhof@th.rug.nl|) +% \item Steven Douglas Cochran (|sdc+@cs.cmu.edu|) +% \item Jeffrey Goldberg (|J.Goldberg@cranfield.ac.uk|) +% \item Mark Wooding (|mdw@excessus.demon.co.uk|) +% \item Paul Foley (|mycroft@actrix.gen.nz|) +% \item David Kastrup (|dak@fsnif.neuroinformatik.ruhr-uni-bochum.de|) +% \item Jerry Leichter (|leichter@smarts.com|) +% \item P.~W.~Daly (|daly@linpwd.mpae.gwdg.de|) +% \item David Carlisle (|carlisle@goofy.zdv.Uni-Mainz.de|) +% \item Edward Sznyter (|sznyter@babel.com|) +% \end{list} +% +% \section{Sending a Bug Report} +% The \textsf{aiaa} distribution is highly likely to contain +% bugs. Reports of bugs in the package are most welcome. +% However, I consider this to be a minimally ``supported'' package. +% I will do what I can, when I can---promising nothing. +% Before filing a bug report, please take the following actions: +% \begin{enumerate} +% \item Ensure your problem is not due to your own input file(s) +% styles sheet(s), or package(s); +% \item Ensure your problem is not covered in the section +% ``Known Problems'' above; +% \item Try to isolate the problem by writing a {\it minimal} +% \LaTeX{} input file which reproduces the unexpected behavior. +% Include the command\\ +% | \setcounter{errorcontextlines}{50}|\\ +% in your input to provide extra context when things go awry; +% \item Run your file through \LaTeX{}; +% \item Send a description of your problem, the input file +% and the log file via e-mail to: \texttt{w.l.kleb@larc.nasa.gov}. +% \end{enumerate} +% I am not in the business of answering generic \TeX{}/\LaTeX{} +% questions; so if your problem appears to be such, I will +% let you know.\bigskip +% +% \noindent{\itshape Enjoy(?) the everpresent deadline and enjoy your +% \LaTeX!\raisebox{-\baselineskip}{---bil}} +% +% \begin{thebibliography}{1} +% +% \bibitem{companion} +% Michel Goossens, Frank Mittelbach, and Alexander Samarin. +% \newblock{\em The {\LaTeX} Companion}. +% \newblock Addison-Wesley, Reading, Massachusetts, 1994. +% +% \bibitem{guide} +% Helmut Kopka and Patrick W. Daly. +% \newblock{\em A Guide to {\LaTeXe}: Document Prepartion for +% Beginners and Advanced Users}. +% \newblock 2nd ed. +% \newblock Addison-Wesley, Reading, Massachusetts, 1994. +% +% \bibitem{latex} +% Leslie Lamport. +% \newblock{\em {\LaTeX}: A Document Preparation System}. +% \newblock 2nd ed. +% \newblock Addison-Wesley, Reading, Massachusetts, 1994. +% +% \bibitem{dropping} +% Mats Dahlgren. +% \newblock \pkg{dropping}---A \LaTeX{} Macro for Dropping +% the First Character(s) of a Paragraph. +% \newblock June 1996. (version~0.1) +% \newblock Electronic Documentation. +% +% \bibitem{graphicx} +% David Carlisle. +% \newblock Packages in the `graphics' bundle. +% \newblock December 1995. +% \newblock Electronic Documentation. +% +% \bibitem{endfloat} +% James Darrell McCauley and Jeff Goldberg. +% \newblock The \texttt{endfloat} Package. +% \newblock October 1995. (version~2.4i) +% \newblock Electronic Documentation. +% +% \end{thebibliography} +% +% \StopEventually{\PrintChanges} +% +% \newpage +% +% \section{The Documentation} +% +% The following contains the documentation driver for this user manual. +% \begin{macrocode} +%<*driver> +\documentclass{ltxdoc} +\setlength\hfuzz{2pt}% reduce overfull warnings +\OnlyDescription % stop at \StopEventually comment to get everything +%\RecordChanges % display change information +\begin{document} + \DocInput{aiaa.dtx} +\end{document} +%</driver> +% \end{macrocode} +% +% \section{The Code} +% +% For the interested reader(s), following is a semi-documented +% of the class code, the 9pt style, bibliographic style file, and +% the endfloat configuration. These detailed coding bits +% are not included in the Users' Manual by default, if you really +% want to see these in typeset form, you need to comment out the +% |\OnlyDescription| line in the |<driver>| section of this file +% \file{aiaa.dtx}. +% If you feel the need to +% modify things, simply cut the section you want to change +% and save it to a file named \file{mymods.sty}. Then modify +% the code in \file{mymods.sty} to suit your needs and include +% it in your document via |\usepackage{mymods}| in the +% preamble. +% +% \subsection{The class code} +% +% The underlying logic is supposed to look like:\footnote{Picture +% environment flowchart generated by flow 0.99b.}\\[1pt] +% +% \setlength\unitlength{1.8em} +% \thicklines +% \begin{picture}(16.000000,20.000000)(-1.000000,-20.000000) +% \put(1.0000,-0.5000){\oval(2.0000,1.0000)} +% \put(0.0000,-1.0000){\makebox(2.0000,1.0000)[c]{\shortstack[c]{ +% begin +% }}} +% \put(1.0000,-1.0000){\vector(0,-1){1.0000}} +% \put(-1.0000,-4.0000){\framebox(4.0000,2.0000)[c]{\shortstack[c]{ +% code common\\ +% to all options +% }}} +% \put(1.0000,-4.0000){\vector(0,-1){1.0000}} +% \put(-0.5000,-6.5000){\line(1,1){1.5000}} +% \put(-0.5000,-6.5000){\line(1,-1){1.5000}} +% \put(2.5000,-6.5000){\line(-1,-1){1.5000}} +% \put(2.5000,-6.5000){\line(-1,1){1.5000}} +% \put(-0.5000,-8.0000){\makebox(3.0000,3.0000)[c]{\shortstack[c]{ +% \texttt{submit}? +% }}} +% \put(2.5000,-6.0500){\makebox(0,0)[lt]{No}} +% \put(1.4500,-8.0000){\makebox(0,0)[lb]{Yes}} +% \put(1.0000,-8.0000){\vector(0,-1){1.0000}} +% \put(0.0000,-11.0000){\framebox(2.0000,2.0000)[c]{\shortstack[c]{ +% \texttt{submit}\\ +% code +% }}} +% \put(1.0000,-11.0000){\vector(0,-1){1.0000}} +% \put(1.0000,-12.5000){\oval(2.0000,1.0000)} +% \put(0.0000,-13.0000){\makebox(2.0000,1.0000)[c]{\shortstack[c]{ +% done +% }}} +% \put(2.5000,-6.5000){\vector(1,0){1.0000}} +% \put(3.5000,-7.5000){\framebox(5.0000,2.0000)[c]{\shortstack[c]{ +% \texttt{paper}/\texttt{article}\\ +% /\texttt{note} code +% }}} +% \put(6.0000,-7.5000){\vector(0,-1){1.0000}} +% \put(4.5000,-10.0000){\line(1,1){1.5000}} +% \put(4.5000,-10.0000){\line(1,-1){1.5000}} +% \put(7.5000,-10.0000){\line(-1,-1){1.5000}} +% \put(7.5000,-10.0000){\line(-1,1){1.5000}} +% \put(4.5000,-11.5000){\makebox(3.0000,3.0000)[c]{\shortstack[c]{ +% \texttt{paper}? +% }}} +% \put(7.5000,-9.5500){\makebox(0,0)[lt]{No}} +% \put(6.4500,-11.5000){\makebox(0,0)[lb]{Yes}} +% \put(7.5000,-10.0000){\vector(1,0){1.0000}} +% \put(8.5000,-11.0000){\framebox(4.0000,2.0000)[c]{\shortstack[c]{ +% \texttt{article} or\\ +% \texttt{note} code +% }}} +% \put(10.5000,-11.0000){\vector(0,-1){1.0000}} +% \put(9.0000,-13.5000){\line(1,1){1.5000}} +% \put(9.0000,-13.5000){\line(1,-1){1.5000}} +% \put(12.0000,-13.5000){\line(-1,-1){1.5000}} +% \put(12.0000,-13.5000){\line(-1,1){1.5000}} +% \put(9.0000,-15.0000){\makebox(3.0000,3.0000)[c]{\shortstack[c]{ +% \texttt{article}? +% }}} +% \put(12.0000,-13.0500){\makebox(0,0)[lt]{No}} +% \put(10.9500,-15.0000){\makebox(0,0)[lb]{Yes}} +% \put(12.0000,-13.5000){\vector(1,0){1.0000}} +% \put(13.0000,-14.5000){\framebox(2.0000,2.0000)[c]{\shortstack[c]{ +% \texttt{note}\\ +% code +% }}} +% \put(14.0000,-14.5000){\vector(0,-1){1.0000}} +% \put(14.0000,-16.0000){\oval(2.0000,1.0000)} +% \put(13.0000,-16.5000){\makebox(2.0000,1.0000)[c]{\shortstack[c]{ +% done +% }}} +% \put(10.5000,-15.0000){\vector(0,-1){1.0000}} +% \put(9.0000,-18.0000){\framebox(3.0000,2.0000)[c]{\shortstack[c]{ +% \texttt{article}\\ +% code +% }}} +% \put(10.5000,-18.0000){\vector(0,-1){1.0000}} +% \put(10.5000,-19.5000){\oval(2.0000,1.0000)} +% \put(9.5000,-20.0000){\makebox(2.0000,1.0000)[c]{\shortstack[c]{ +% done +% }}} +% \put(6.0000,-11.5000){\vector(0,-1){1.0000}} +% \put(5.0000,-14.5000){\framebox(2.0000,2.0000)[c]{\shortstack[c]{ +% \texttt{paper}\\ +% code +% }}} +% \put(6.0000,-14.5000){\vector(0,-1){1.0000}} +% \put(6.0000,-16.0000){\oval(2.0000,1.0000)} +% \put(5.0000,-16.5000){\makebox(2.0000,1.0000)[c]{\shortstack[c]{ +% done +% }}} +% \end{picture}\\ +% This does not mean the code as a whole is organized according +% to this; but, rather this is the case for each +% macro/environment defined. +% +% First, the package is to identify itself: +% \begin{macrocode} +% +%<*class> +% +\NeedsTeXFormat{LaTeX2e}[1994/06/01] +\ProvidesClass{aiaa}[1999/02/22 v2.4 AIAA document class] +% \end{macrocode} +% Flags +% \begin{macrocode} +\newif\if@submit +\newif\if@paper +\newif\if@article +\newif\if@note +\newif\if@cover +% \end{macrocode} +% Default settings +% \begin{macrocode} +\@submitfalse +\@papertrue +\@articlefalse +\@notefalse +\@coverfalse +% \end{macrocode} +% declaration of options +% Note that options will be processed in order of the |\DeclareOption| +% commands in this file, so since we want submit to take precedence +% over all the other options, we process it last. Note also that +% all flags are reset with each option, so that they are +% independent of the defaults. +% \begin{macrocode} +\DeclareOption{note}{\@notetrue\@articlefalse\@submitfalse\@paperfalse} +\DeclareOption{article}{\@articletrue\@notefalse\@paperfalse\@submitfalse} +\DeclareOption{paper}{\@papertrue\@articlefalse\@notefalse\@submitfalse} +\DeclareOption{submit}{\@submittrue\@paperfalse\@articlefalse} +\DeclareOption{cover}{\@covertrue} +\DeclareOption*{\PassOptionsToClass{\CurrentOption}{article}% + \typeout{NOTE: Passing ``\CurrentOption" option on to the + standard LaTeX article class}} +% \end{macrocode} +% actually process the options +% \begin{macrocode} +\ProcessOptions +\typeout{} +\if@submit% + \typeout{NOTE: aiaa journal submission mode + - all other aiaa options ignored} +\else% paper, article, or note + \if@paper% + \typeout{TYPESETTING in AIAA conference PAPER format ...} + \else% article or note + \if@article% + \typeout{TYPESETTING in AIAA journal ARTICLE simulation format ...} + \else% note + \typeout{TYPESETTING in AIAA journal NOTE simulation ...} + \fi + \fi +\fi +\typeout{} +% \end{macrocode} +% load the \LaTeX{} standard article class with |twoside| and +% |twocolumn| for all but the submit option. For a journal article +% or note, also load the aiaa9pt package. +% \begin{macrocode} +\if@submit% + \LoadClass[12pt]{article}% + \RequirePackage[noheads,tablesfirst,nomarkers]{endfloat}% + \RequirePackage{setspace}% + \RequirePackage{lastpage}% +\else% paper, article or note + \LoadClass[twoside,twocolumn]{article}% + \RequirePackage[dvips]{dropping}% dvips set to make compatible with pdflatex + \RequirePackage{lastpage}% + \if@paper% + \relax% + \else% article or note + \RequirePackage{aiaa9pt}% + \fi% +\fi +% \end{macrocode} +% packages used by this class for all options +% \begin{macrocode} +\RequirePackage{graphicx} +\RequirePackage{overcite} +\RequirePackage{caption2} +\RequirePackage{fancyhdr} +\RequirePackage{subfigure}[1995/03/06] +%\RequirePackage[bf]{subfigure}[199!/??/??] % when new version comes out +% \end{macrocode} +% +% main code +% +% page sizes: +% \begin{macrocode} +\if@submit + \setlength{\topmargin}{-0.25in} + \setlength{\headsep}{9.5pt} + \setlength{\textheight}{9in} + \setlength{\textwidth}{6.5in} + \setlength{\oddsidemargin}{0.0in} + \AtBeginDocument{\onehalfspacing}% turn on `doublespacing' +\else% paper, article, or note + \setlength{\topmargin}{-0.75in} + \if@paper + \setlength{\headsep}{9.5pt} + \setlength{\textheight}{9.5in} + \setlength{\textwidth}{6.75in} + \setlength{\columnsep}{0.25in} + \setlength{\footskip}{0.25in} + \else% article or note + \setlength{\topmargin}{-0.75in} + \setlength{\headsep}{10pt} + \setlength{\footskip}{16pt} + \setlength{\textheight}{10in} + \setlength{\textwidth}{7in} + \setlength{\columnsep}{0.375in} + \setlength{\oddsidemargin}{-0.25in} + \renewcommand{\baselinestretch}{0.9} + \fi + \setlength{\evensidemargin}{\oddsidemargin} +\fi +% \end{macrocode} +% +% \begin{macro}{\SubmitName} +% \begin{macro}{\PaperNumber} +% \begin{macro}{\ArticleHeader} +% \begin{macro}{\ArticleIssue} +% \begin{macro}{\JournalName} +% \begin{macro}{\JournalIssue} +% \begin{macro}{\JournalPage} +% \begin{macro}{\NoteHeader} +% various macros +% \begin{macrocode} +\newcommand*{\SubmitName}[1]% + {\def\AA@submitname{#1}} +\newcommand*{\PaperNumber}[1]% + {\def\AA@papernumber{#1}} +\newcommand*{\ArticleHeader}[1]% + {\def\AA@articleheader{#1}} +\newcommand*{\ArticleIssue}[1]% + {\def\AA@articleissue{#1}} +\newcommand*{\JournalName}[1]% + {\def\AA@journalname{#1}} +\newcommand*{\JournalIssue}[1]% + {\def\AA@journalissue{#1}} +\newcounter{AA@journalpage} +\newcommand*{\JournalPage}[1]% + {\setcounter{AA@journalpage}{#1}} +\newcommand*{\NoteHeader}[1]% + {\def\AA@noteheader{#1}} +% \end{macrocode} +% \end{macro} +% \end{macro} +% \end{macro} +% \end{macro} +% \end{macro} +% \end{macro} +% \end{macro} +% \end{macro} +% initialize them +% \begin{macrocode} +\SubmitName{} +\PaperNumber{} +\ArticleHeader{} +\ArticleIssue{} +\JournalName{} +\JournalIssue{} +\NoteHeader{} +\setcounter{AA@journalpage}{1} +% \end{macrocode} +% fancy headers/footers: +% \begin{macrocode} +\pagestyle{fancy}% note: must be issued after any \textwidth command +\renewcommand{\headrulewidth}{0pt} +\renewcommand{\footrulewidth}{0pt} +\fancyhf{} % clear all footers and headers +\if@submit + \rfoot{\footnotesize\scshape\thepage\ of \pageref{LastPage}} + \lfoot{\footnotesize\scshape\AA@submitname} +\else% paper, article, or note + \if@paper + \cfoot{\footnotesize\scshape\thepage\ of \pageref{LastPage} + \ifx\AA@papernumber\@empty\relax\else\\ + \rule[.2\baselineskip]{0.5in}{0.2pt}\\ + American Institute of Aeronautics + and Astronautics Paper \AA@papernumber\fi} + \else% article or note + \if@article + \chead{\footnotesize\scshape\MakeUppercase{\AA@articleheader}} + \fancyhead[RO,LE]{\footnotesize\thepage} + \fancypagestyle{plain}{% + \fancyhf{} + \lhead{\ifx\AA@journalname\@empty\relax\else + \footnotesize{\scshape\AA@journalname}\\ + \AA@articleissue\fi} + \cfoot{\footnotesize\thepage}} + \else% note + \chead[\footnotesize\scshape\AA@noteheader]% + {\footnotesize\scshape\AA@noteheader} + \rhead[]{\footnotesize \thepage} + \lhead[\footnotesize \thepage]{} + \fi + \fi +\fi +% \end{macrocode} +% \begin{macro}{\abstract} +% Redefine the |\abstract| command and load the date with nothing +% \begin{macrocode} +\renewcommand{\abstract}[1]% + {\def\@abstract{#1}} +\abstract{} +\let\@date\@empty +% \end{macrocode} +% \end{macro} +% +% \begin{macro}{\dropword} +% macro to drop first letter of word and capitalize the remaining +% portion, thanks to jeroen nijhof |<nijhof@th.rug.nl>| +% +% use:\\ +% | \dropword| word with rest of sentence or newline or whatever... +% \begin{macrocode} +\if@submit% + \def\dropword{} +\else + \def\dropword#1#2 {\dropping{2}{\bfseries{} #1}\MakeUppercase{#2} }% spaces important! +\fi +% \end{macrocode} +% \end{macro} +% +% increase penalty (x10) for consecutive lines ending in hyphens: +% \begin{macrocode} +\doublehyphendemerits=100000 +% \end{macrocode} +% ignore small line overfull errors: +% \begin{macrocode} +\setlength\hfuzz{3pt}% reduce the quantity of overfull warnings +% \end{macrocode} +% +% \begin{macro}{\makecover} +% \begin{macro}{\Conference} +% The command |\makecover| is used to make a cover for a +% AIAA conference paper or a simulated journal reprint. +% It is only active when the |submit| option is not in effect +% The |\makenotice| command is used to create the footnote +% containing copyright and other information about the document. +% The commands |\makecover| and |\makenotice| are internally +% called by the |\maketitle| command and are constructed +% similarly to the |\maketitle| command, in that |\makecover| uses +% information supplied by the commands described in the previous +% section, and |\makenotice| incorporates one of the appropriate +% |\_____Notice| commands. +% \begin{macrocode} +\newcommand{\Conference}[1]{\def\AA@conference{#1}} +\Conference{} +\newcommand{\CoverFigure}[1]{\def\AA@coverfigure{#1}} +\CoverFigure{} +\if@submit% + \newcommand{\makecover}{} +\else% paper, article, or note + \newcommand{\makecover}{% + \begin{titlepage} + \let\AA@sfdefault\sfdefault% save normal fonts + \let\AA@rmdefault\rmdefault + \let\AA@ttdefault\ttdefault + \renewcommand{\sfdefault}{phv}% change to new fonts + \renewcommand{\rmdefault}{ptm} + \renewcommand{\ttdefault}{pcr} + \enlargethispage{1in} + \setcounter{page}{0} + \renewcommand\thanks[1]{}% locally kill the \thanks{} command + \renewcommand\thanksibid[1]{}% kill the ibid version too + \setlength{\unitlength}{1in}% unit of measure for the picture + \begin{picture}(7.5,9)(0.45,0.495)% start a 7-1/2'' x 9'' picture: + \if@paper% + \linethickness{4pt} + \put(0,0){\framebox(7.45,8.95){}}% make a framed box accounting + % for line thickness + \linethickness{0.5pt} + \renewcommand{\and}{\relax} + \put(-0.07,8.7){\incfig[width=3in]{aiaalgo}}% aiaa logo at top left + \put(1.2,8.0)% paper number, title, author/location + {\makebox(0,0)[tl]{\parbox{5in} + {\raggedright\sffamily\bfseries + \Huge AIAA \AA@papernumber% paper number + \\[5pt] + \huge\@title% title + \\[5pt] + \Large\mdseries\@author}}}% author/location + \ifx\AA@coverfigure\@empty% optional figure + \relax + \else + \put(3.725,1.7){\makebox(0,0)[b]{% + \includegraphics[width=5in,height=4in]% + {\AA@coverfigure}}}% + \fi + \put(3.725,0.05){\makebox(0,0)[b]{\parbox{7.45in}% meeting, location, and date + {\centering\Huge\bfseries\sffamily% + \AA@conference}}} + \put(-0.055,-0.36){\parbox[t]{7.5in}% notice + {\normalsize\sffamily\bfseries + For permission to copy or republish, contact the + American Institute of Aeronautics and Astronautics\\ + 1801 Alexander Bell Drive, Suite 500, Reston, VA 20191--4344}} + \else% article, or note + \put(0.7,7.75)% title and authors + {\makebox(0,0)[tl]{\parbox{6.5in} + {\raggedright\sffamily\bfseries + \huge\@title% + \\[5pt] + \Large\mdseries\@author}}} + \ifx\AA@journalname\@empty\relax\else + \put(0.7,1.9){\makebox(0,0)[tl]{\parbox{7.5in}% journal/issue + {\raggedright\bfseries\sffamily + Simulated Reprint for\\ + \Huge% + \AA@journalname\\ + \small\mdseries + \ifx\AA@journalissue\@empty% + \relax + \else% + \AA@journalissue, + \fi + Pages \theAA@journalpage--\pageref{LastPage}}}}\fi + \put(0.5,0.45){\incfig[width=1in]{aiaalgo}}% aiaa logo at bottom left + \put(0.7,0.3)% notice + {\makebox(0,0)[tl]{\parbox{6.5in} + {\sffamily + \slshape A publication of the\\ + \upshape American Institute of Aeronautics and Astronautics, Inc.\\ + 1801 Alexander Bell Drive, Suite 500\\ + Reston, VA 20191--4344}}} + \fi + \end{picture} + \renewcommand\sfdefault{\AA@sfdefault} + \renewcommand\rmdefault{\AA@rmdefault} + \renewcommand\ttdefault{\AA@ttdefault} + \end{titlepage}} +\fi +% \end{macrocode} +% \end{macro} +% \end{macro} +% +% \begin{macro}{\PaperNotice} +% \begin{macro}{\JournalNotice} +% \begin{macro}{\makenotice} +% the footnote notice maker +% \begin{macrocode} +\newcommand{\PaperNotice}[1]{\def\AA@papernotice{\scriptsize #1}} +\PaperNotice{} +\newcommand{\JournalNotice}[1]{\def\AA@journalnotice{\scriptsize #1}} +\JournalNotice{} +\if@submit% + \newcommand\makenotice{}% +\else% paper, article, or note + \newcommand\makenotice{% + \begingroup + \renewcommand\thefootnote{} + \if@paper% + \ifx\AA@papernotice\@empty\else\footnotetext{\AA@papernotice}\fi + \else% article or note + \ifx\AA@journalnotice\@empty\else\footnotetext{\AA@journalnotice}\fi + \fi% + \endgroup +% \renewcommand{\thefootnote}{\arabic{footnote}}% + } +\fi +% \end{macrocode} +% \end{macro} +% \end{macro} +% \end{macro} +% \begin{macro}{\CopyrightA} +% \begin{macro}{\CopyrightB} +% \begin{macro}{\CopyrightC} +% \begin{macro}{\CopyrightD} +% load copyright commands +% \begin{macrocode} +\newcommand{\CopyrightA}[1]{Copyright \copyright\ #1 by the + American Institute of Aeronautics and Astronautics, Inc. All + rights reserved.} +\newcommand{\CopyrightB}[2]{Copyright \copyright\ #1 by + #2. Published by the American Institute of Aeronautics + and Astronautics, Inc.\ with permission.} +\newcommand{\CopyrightC}{This paper is a work of the U.S. + Government and is not subject to copyright protection in the + United States.} +\newcommand{\CopyrightD}[1]{Copyright \copyright\ #1 by the + American Institute of Aeronautics and Astronautics, Inc. No + copyright is asserted in the United States under Title 17, + U.S. Code. The U.S. Government has a royalty-free license to + exercise all rights under the copyright claimed herein for + Governmental Purposes. All other rights are reserved by the + copyright owner.} +% \end{macrocode} +% \end{macro} +% \end{macro} +% \end{macro} +% \end{macro} +% modify float captions +% \begin{macrocode} +\if@submit + \renewcommand\figurename{Figure} + \renewcommand\captionlabeldelim{:\hspace{1em}} +\else% paper, article, or note + \renewcommand\figurename{Fig.}% change to the ugly, silly + % abbreviatation as per aiaa---saves + % all of two characters !? + \renewcommand\captionlabeldelim{~~} +\fi +\renewcommand\captionfont{\small\bfseries} +\renewcommand\p@subfigure{\thefigure(} +\renewcommand\thesubfigure{\alph{subfigure})} +\renewcommand\subcaplabelfont{\captionfont} +\renewcommand{\subfigcapmargin}{2pt} +\if@submit + \relax +\else + \setlength{\abovecaptionskip}{ 6pt plus 2pt minus 2pt} + \setlength{\belowcaptionskip}{ 3pt plus 1pt minus 1pt}% note good for tables! + \renewcommand{\subfigcapskip}{.2\abovecaptionskip}% seem to + \renewcommand{\subfigbottomskip}{.7\belowcaptionskip}% have no effect? +\fi +% \end{macrocode} +% modify float spacing or, if we're submitting something, +% the behavior of the |endfloat| package. +% \begin{macrocode} +\if@submit% modify endfloat behaviour + \InputIfFileExists{aiaaenf.cfg}{\typeout{loading aiaaenf.cfg}}% + {\typeout{WARNING: endfloat behavior will not + be as advertised since aiaaenf.cfg + was not found.}} +\else% modify float spacing + \renewcommand{\topfraction}{0.9} + \renewcommand{\bottomfraction}{0.9} + \renewcommand{\textfraction}{0.1} + \renewcommand{\floatpagefraction}{0.8}% 0.5 is the default + \renewcommand{\dbltopfraction}{\floatpagefraction} + \renewcommand{\dblfloatpagefraction}{\floatpagefraction} + \setcounter{topnumber}{10} + \setcounter{dbltopnumber}{\value{topnumber}} + \setcounter{bottomnumber}{\value{topnumber}} + \setcounter{totalnumber}{\value{topnumber}} + \addtocounter{totalnumber}{\value{bottomnumber}} + \setlength{\floatsep} { 5pt plus 2pt minus 2pt} + \setlength{\textfloatsep} { 5pt plus 2pt minus 3pt} + \setlength{\intextsep} { 5pt plus 2pt minus 2pt} + \setlength{\dblfloatsep} {\floatsep} + \setlength{\dbltextfloatsep} {\textfloatsep} +\fi +% \end{macrocode} +% modifying bibliography output +% \begin{macrocode} +\renewcommand{\@biblabel}[1]{$^{#1}$} +\renewenvironment{thebibliography}[1]% + {\section*{\refname\@mkboth{\MakeUppercase\refname}% + {\MakeUppercase\refname}}% + \list{\@biblabel{\@arabic\c@enumiv}}% + {\setlength{\leftmargin}{0pt}% + \settowidth{\labelwidth}{\@biblabel{#1}}% + \setlength{\itemindent}{\parindent}% + \advance\itemindent by \labelwidth% + \setlength{\labelsep}{0.0em}% + \setlength{\itemsep}{-\smallskipamount}% + \@openbib@code% + \usecounter{enumiv}% + \let\p@enumiv\@empty% + \renewcommand\theenumiv{\@arabic\c@enumiv}% + \if@submit% + \normalsize% + \else% + \footnotesize% + \fi} + \sloppy\clubpenalty4000\widowpenalty4000% + \sfcode`\.\@m} + {\def\@noitemerr + {\@latex@warning{Empty `thebibliography' environment}}% + \endlist} +% \end{macrocode} +% +% \begin{macro}{\thanksibid} +% Define a command that is used in conjunction with the +% |\thanks| command. It is used for the special case +% where the argument of the |\thanks| for one author is +% the same as another.\footnote{Hence, the use of the latin {\it ibid}, +% short for {\it ibidem}, meaning the same as.} +% \begin{macrocode} +\newcounter{ibid} +\newcounter{tempcnt} +\newcommand{\thanksibid}[1]{% + \begingroup + \setcounter{tempcnt}{\value{footnote}}% + \setcounter{ibid}{#1}% + \def\thefootnote{\fnsymbol{ibid}}% + \footnotemark% + \setcounter{footnote}{\value{tempcnt}}% + \endgroup +} +% \end{macrocode} +% \end{macro} +% +% \begin{macro}{\incfig} +% define command that picks-up the current line width +% for automatic figure sizing +% \begin{macrocode} +\newcommand{\incfig}{\centering\includegraphics} +\setkeys{Gin}{width=\linewidth,keepaspectratio} +\if@submit% + \setkeys{Gin}{totalheight=0.35\textheight} +\else% paper, article, or note + \relax +\fi +% \end{macrocode} +% \end{macro} +% +% \begin{environment}{subfigmatrix} +% Define command that makes subfigure `tables'. +% +% \begin{macrocode} +% 27 Feb 1997 Steven Douglas Cochran - Created. +% 28 Feb 1997 Bil Kleb - modified to not use minipages +% Define and initialize the internal variables. +% +\newlength{\sfm@width}% Subfigure width +\newlength{\sfm@colsep}% Subfigure column separation +\setlength{\sfm@colsep}{2\tabcolsep}% Use twice tabular column separation +\newcounter{sfm@count}% Item count +\newenvironment{subfigmatrix}[1]{% + \begingroup% + \centering% + \vspace*{-\subfigtopskip}% remove the vertical spacing inserted + % by the subfigure package + % + % Save the "real" subfigure macro and start the item counter off + % at -1 to detect the first item. + % Set the \sfm@width to the single element size. + % + \let\sfm@subfigure\subfigure% + \setcounter{sfm@count}{-1}% + \setlength{\sfm@width}{\linewidth}% + \addtolength{\sfm@width}{\sfm@colsep}% + \addtolength{\sfm@width}{-#1\sfm@colsep}% + \divide\sfm@width by#1 + \setkeys{Gin}{width=\sfm@width,keepaspectratio}% + % + % Redefine the \subfigure and \subtable macros locally to this + % environment so that we can wrap them with minipages. + % + \def\subfigure{% try the transpose + \ifnum \value{sfm@count} = -1 + % very first item + \setcounter{sfm@count}{1}% + \else% Not very first item + \addtocounter{sfm@count}{1}% + \ifnum \value{sfm@count} = 1 + % Beginning of next column, finish the last column. + \\% + \else% + % middle or last item + \hfill% + \ifnum #1 = \value{sfm@count}% + % Reset the counter of at the end of the row. + \setcounter{sfm@count}{0}% + \fi% + \fi% + \fi% + \sfm@subfigure}% + \let\subtable\subfigure% + }{% + \\% + \endgroup}% +% \end{macrocode} +% \end{environment} +% +% \begin{macro}{\maketitle} +% change maketitle behavior to preserve twocolumn mode for +% journal note, to create a cover page if appropriate, and make +% the copyright-style notices about the document. +% \begin{macrocode} +\if@paper + \renewcommand{\and}{\\[-.9\baselineskip]} +\else + \renewcommand{\and}{\\*[-8pt]} +\fi +\renewcommand{\maketitle}{% + \if@cover + \makecover + \else + \relax + \fi + \par + \begingroup + \renewcommand\thefootnote{\@fnsymbol\c@footnote}% + \def\@makefnmark{\rlap{\@textsuperscript{\normalfont\@thefnmark}}}% + \long\def\@makefntext##1{\parindent 1em\noindent + \hb@xt@1.8em{% + \hss\@textsuperscript{\normalfont\@thefnmark}}##1}% + \global\@topnum\z@ % Prevents figures from going at top of page. + \if@submit% + \@maketitle% + \else% paper, article, or note + \if@note% + \@maketitle% + \else% paper article -- should already be in twocolumn mode + \ifnum \col@number=\@ne% if in column one, good: + \@maketitle + \else% not in column one, so start new page: + \twocolumn[\@maketitle] + \fi + \if@article% + \thispagestyle{plain} + \fi + \fi + \fi + \@thanks + \endgroup + \suppressfloats + \setcounter{footnote}{0}% + \if@submit% submission + \relax + \else% paper, article, or note: + \if@paper + \relax + \else% article or note: + \setcounter{page}{\theAA@journalpage} + \fi + \fi + \makenotice + \global\let\maketitle\relax + \global\let\@maketitle\relax + \global\let\@abstract\@empty + \global\let\@thanks\@empty + \global\let\thanks\relax + \global\let\@author\@empty + \global\let\author\relax + \global\let\@title\@empty + \global\let\title\relax + \global\let\@date\@empty + \global\let\abstract\relax + \global\let\date\relax +} +% \end{macrocode} +% \end{macro} +% \begin{macro}{\@maketitle} +% modify the fonts used for the title, etc +% \begin{macrocode} +\def\@maketitle{% + \newpage + \begin{center}% + \let \footnote \thanks + {\huge\bf \@title \par}% + \vskip 1.5em% + {\lineskip .5em% + \large% + \begin{tabular}[t]{c}% + \@author + \end{tabular}\par}% + \vskip 1em% + \if@submit + \relax + \else% paper, article, or note + \if@note + \relax + \else% paper or article + \newenvironment{AA@abstract} + {\list{}{\listparindent 1.5em% + \itemindent \listparindent + \leftmargin 0.75in% + \rightmargin \leftmargin + \parsep \z@ \@plus \p@}% + \item\relax} + {\endlist} + \ifx\@abstract\@empty + \relax + \else + \begin{AA@abstract} + \footnotesize\textbf\@abstract + \end{AA@abstract} + \fi + \fi + \fi + \end{center}% + \if@submit% + \ifx\@abstract\@empty + \relax + \else% + \section{Abstract} \@abstract% + \fi + \else% paper, article, or note + \par% + \if@note% + \vskip -\medskipamount% + \else% + \vskip 1em% + \fi% + \fi% +} +% \end{macrocode} +% \end{macro} +% modify the section headers +% \begin{macrocode} +\setcounter{secnumdepth}{-2}% instead of having to use the *'d + % section commands +% \end{macrocode} +% \begin{macro}{\section} +% \begin{macrocode} +\renewcommand\section{\@startsection + {section}% % section name + {1}% % level + {\z@}% % indentation of heading + {1.8ex}% % before skip (neg, no parindent) + {0.5ex}% % after skip (neg, run-on heading space) + {\normalfont\center\large\bfseries}} +% \end{macrocode} +% \end{macro} +% \begin{macro}{\subsection} +% \begin{macrocode} +\renewcommand\subsection{\@startsection{subsection}{2}% + {\z@}% + {1.5ex}% + {0.5ex}% + {\normalfont\small\bfseries\raggedright}} +% \end{macrocode} +% \end{macro} +% \begin{macro}{\subsubsection} +% \begin{macrocode} +\renewcommand\subsubsection{\@startsection{subsubsection}{3}% + {\z@}% + {1.5ex}% + {0.5ex}% + {\normalfont\normalsize\itshape\raggedright}} +% \end{macrocode} +% \end{macro} +% \begin{macro}{\paragraph} +% \begin{macrocode} +\renewcommand\paragraph{\@startsection{paragraph}{4}% + {\parindent}% + {0.3ex}% + {-1em}% + {\normalfont\normalsize\sffamily}} +% \end{macrocode} +% \end{macro} +% \begin{macro}{\subparagraph} +% \begin{macrocode} +\renewcommand\subparagraph{\@startsection{subparagraph}{5}% + {\parindent}% + {0.3ex}% + {-1em}% + {\normalfont\normalsize\itshape}} +% \end{macrocode} +% \end{macro} +% list files used during job: +% \begin{macrocode} +\listfiles +% +%</class> +% +% \end{macrocode} +% +% This brings us to the end of \cls{aiaa.cls}. +% +% \subsection{The 9pt style file} +% +% This is the package \pkg{aiaa9pt.sty}, it provides 9pt font settings +% for simulation of journal articles/notes. It is essentially +% a hack of size10.clo (a the standard \LaTeX{} class option). +% +% \begin{macrocode} +% +%<*style> +% +\ProvidesFile{aiaa9pt.sty} + [1999/02/22 v2.4 AIAA style file (9pt option)] +\renewcommand\normalsize{% + \@setfontsize\normalsize\@ixpt\@xipt + \abovedisplayskip 9\p@ \@plus2\p@ \@minus4\p@ + \abovedisplayshortskip \z@ \@plus3\p@ + \belowdisplayshortskip 6\p@ \@plus3\p@ \@minus3\p@ + \belowdisplayskip \abovedisplayskip + \let\@listi\@listI} +\normalsize +\renewcommand\small{% + \@setfontsize\small\@viiipt\@xpt% + \abovedisplayskip 7\p@ \@plus2\p@ \@minus3\p@ + \abovedisplayshortskip \z@ \@plus2\p@ + \belowdisplayshortskip 3\p@ \@plus2\p@ \@minus2\p@ + \def\@listi{\leftmargin\leftmargini + \topsep 3\p@ \@plus2\p@ \@minus2\p@ + \parsep \p@ \@plus\p@ \@minus\p@ + \itemsep \parsep}% + \belowdisplayskip \abovedisplayskip +} +\renewcommand\footnotesize{% + \@setfontsize\footnotesize\@viipt{8.3}% + \abovedisplayskip 4\p@ \@plus2\p@ \@minus3\p@ + \abovedisplayshortskip \z@ \@plus\p@ + \belowdisplayshortskip 2\p@ \@plus\p@ \@minus\p@ + \def\@listi{\leftmargin\leftmargini + \topsep 2\p@ \@plus\p@ \@minus\p@ + \parsep 2\p@ \@plus\p@ \@minus\p@ + \itemsep \parsep}% + \belowdisplayskip \abovedisplayskip +} +\renewcommand\scriptsize{\@setfontsize\scriptsize\@vipt\@viipt} +\renewcommand\tiny{\@setfontsize\tiny\@vpt\@vpt} +\renewcommand\large{\@setfontsize\large\@xipt{13.6}} +\renewcommand\Large{\@setfontsize\Large\@xivpt{18}} +\renewcommand\LARGE{\@setfontsize\LARGE\@xviipt{22}} +\renewcommand\huge{\@setfontsize\huge\@xxpt{25}} +\renewcommand\Huge{\@setfontsize\Huge\@xxvpt{30}} +\if@twocolumn + \setlength\parindent{1em} +\else + \setlength\parindent{13\p@} +\fi +\setlength\smallskipamount{3\p@ \@plus 1\p@ \@minus 1\p@} +\setlength\medskipamount{6\p@ \@plus 2\p@ \@minus 2\p@} +\setlength\bigskipamount{12\p@ \@plus 4\p@ \@minus 4\p@} +\setlength\headheight{12\p@} +\setlength\headsep {25\p@} +\setlength\topskip {9\p@} +\setlength\footskip{30\p@} +\setlength\maxdepth{.5\topskip} + \setlength\@tempdima{\paperwidth} + \addtolength\@tempdima{-2in} + \setlength\@tempdimb{345\p@} + \if@twocolumn + \ifdim\@tempdima>2\@tempdimb\relax + \setlength\textwidth{2\@tempdimb} + \else + \setlength\textwidth{\@tempdima} + \fi + \else + \ifdim\@tempdima>\@tempdimb\relax + \setlength\textwidth{\@tempdimb} + \else + \setlength\textwidth{\@tempdima} + \fi + \fi + \@settopoint\textwidth + \setlength\@tempdima{\paperheight} + \addtolength\@tempdima{-2in} + \addtolength\@tempdima{-1.5in} + \divide\@tempdima\baselineskip + \@tempcnta=\@tempdima + \setlength\textheight{\@tempcnta\baselineskip} +\addtolength\textheight{\topskip} +\if@twocolumn + \setlength\marginparsep {10\p@} +\else + \setlength\marginparsep{11\p@} +\fi +\setlength\marginparpush{5\p@} + \if@twoside + \setlength\@tempdima {\paperwidth} + \addtolength\@tempdima {-\textwidth} + \setlength\oddsidemargin {.4\@tempdima} + \addtolength\oddsidemargin {-1in} + \setlength\marginparwidth {.6\@tempdima} + \addtolength\marginparwidth {-\marginparsep} + \addtolength\marginparwidth {-0.4in} + \else + \setlength\@tempdima {\paperwidth} + \addtolength\@tempdima {-\textwidth} + \setlength\oddsidemargin {.5\@tempdima} + \addtolength\oddsidemargin {-1in} + \setlength\marginparwidth {.5\@tempdima} + \addtolength\marginparwidth {-\marginparsep} + \addtolength\marginparwidth {-0.4in} + \addtolength\marginparwidth {-.4in} + \fi + \ifdim \marginparwidth >2in + \setlength\marginparwidth{2in} + \fi + \@settopoint\oddsidemargin + \@settopoint\marginparwidth + \setlength\evensidemargin {\paperwidth} + \addtolength\evensidemargin{-2in} + \addtolength\evensidemargin{-\textwidth} + \addtolength\evensidemargin{-\oddsidemargin} + \@settopoint\evensidemargin + \setlength\topmargin{\paperheight} + \addtolength\topmargin{-2in} + \addtolength\topmargin{-\headheight} + \addtolength\topmargin{-\headsep} + \addtolength\topmargin{-\textheight} + \addtolength\topmargin{-\footskip} % this might be wrong! + \addtolength\topmargin{-.5\topmargin} + \@settopoint\topmargin +\setlength\footnotesep{5.755\p@} +\setlength{\skip\footins}{9.5\p@ \@plus 4\p@ \@minus 2\p@} +\setlength\floatsep {12\p@ \@plus 2\p@ \@minus 2\p@} +\setlength\textfloatsep{20\p@ \@plus 2\p@ \@minus 4\p@} +\setlength\intextsep {12\p@ \@plus 2\p@ \@minus 2\p@} +\setlength\dblfloatsep {12\p@ \@plus 2\p@ \@minus 2\p@} +\setlength\dbltextfloatsep{20\p@ \@plus 2\p@ \@minus 4\p@} +\setlength\@fptop{0\p@ \@plus 1fil} +\setlength\@fpsep{8\p@ \@plus 2fil} +\setlength\@fpbot{0\p@ \@plus 1fil} +\setlength\@dblfptop{0\p@ \@plus 1fil} +\setlength\@dblfpsep{8\p@ \@plus 2fil} +\setlength\@dblfpbot{0\p@ \@plus 1fil} +\setlength\partopsep{2\p@ \@plus 1\p@ \@minus 1\p@} +\def\@listi{\leftmargin\leftmargini + \parsep 4\p@ \@plus2\p@ \@minus\p@ + \topsep 8\p@ \@plus2\p@ \@minus4\p@ + \itemsep4\p@ \@plus2\p@ \@minus\p@} +\let\@listI\@listi +\@listi +\def\@listii {\leftmargin\leftmarginii + \labelwidth\leftmarginii + \advance\labelwidth-\labelsep + \topsep 4\p@ \@plus2\p@ \@minus\p@ + \parsep 2\p@ \@plus\p@ \@minus\p@ + \itemsep \parsep} +\def\@listiii{\leftmargin\leftmarginiii + \labelwidth\leftmarginiii + \advance\labelwidth-\labelsep + \topsep 2\p@ \@plus\p@\@minus\p@ + \parsep \z@ + \partopsep \p@ \@plus\z@ \@minus\p@ + \itemsep \topsep} +\def\@listiv {\leftmargin\leftmarginiv + \labelwidth\leftmarginiv + \advance\labelwidth-\labelsep} +\def\@listv {\leftmargin\leftmarginv + \labelwidth\leftmarginv + \advance\labelwidth-\labelsep} +\def\@listvi {\leftmargin\leftmarginvi + \labelwidth\leftmarginvi + \advance\labelwidth-\labelsep} +%</style> +% +% \end{macrocode} +% +% This brings us to the end of \pkg{aiaa9pt.sty}. +% +% \subsection{AIAA Bibliographic Style File} +% +% \begin{macrocode} +% +%<*bibstyle> +% +% note: this file generated by p. daly's custom-bib software +% +ENTRY + { address + author + booktitle + chapter + edition + editor + howpublished + institution + journal + key + month + note + number + organization + pages + publisher + school + series + title + type + volume + year + } + {} + { label } + +INTEGERS { output.state before.all mid.sentence after.sentence after.block } + +FUNCTION {init.state.consts} +{ #0 'before.all := + #1 'mid.sentence := + #2 'after.sentence := + #3 'after.block := +} + +STRINGS { s t } + +FUNCTION {output.nonnull} +{ 's := + output.state mid.sentence = + { ", " * write$ } + { output.state after.block = + { add.period$ write$ + newline$ + "\newblock " write$ + } + { output.state before.all = + 'write$ + { add.period$ " " * write$ } + if$ + } + if$ + mid.sentence 'output.state := + } + if$ + s +} + +FUNCTION {output} +{ duplicate$ empty$ + 'pop$ + 'output.nonnull + if$ +} + +FUNCTION {output.check} +{ 't := + duplicate$ empty$ + { pop$ "empty " t * " in " * cite$ * warning$ } + 'output.nonnull + if$ +} + +FUNCTION {fin.entry} +{ add.period$ + write$ + newline$ +} + +FUNCTION {new.block} +{ output.state before.all = + 'skip$ + { after.block 'output.state := } + if$ +} + +FUNCTION {new.sentence} +{ output.state after.block = + 'skip$ + { output.state before.all = + 'skip$ + { after.sentence 'output.state := } + if$ + } + if$ +} + +FUNCTION {add.blank} +{ " " * before.all 'output.state := +} + +FUNCTION {date.block} +{ + skip$ +} + +FUNCTION {not} +{ { #0 } + { #1 } + if$ +} + +FUNCTION {and} +{ 'skip$ + { pop$ #0 } + if$ +} + +FUNCTION {or} +{ { pop$ #1 } + 'skip$ + if$ +} + +FUNCTION {non.stop} +{ duplicate$ + "}" * add.period$ + #-1 #1 substring$ "." = +} + +FUNCTION {new.block.checka} +{ empty$ + 'skip$ + 'new.block + if$ +} + +FUNCTION {new.block.checkb} +{ empty$ + swap$ empty$ + and + 'skip$ + 'new.block + if$ +} + +FUNCTION {new.sentence.checka} +{ empty$ + 'skip$ + 'new.sentence + if$ +} + +FUNCTION {new.sentence.checkb} +{ empty$ + swap$ empty$ + and + 'skip$ + 'new.sentence + if$ +} + +FUNCTION {field.or.null} +{ duplicate$ empty$ + { pop$ "" } + 'skip$ + if$ +} + +FUNCTION {emphasize} +{ duplicate$ empty$ + { pop$ "" } + { "{\em " swap$ * "\/}" * } + if$ +} + +FUNCTION {capitalize} +{ "u" change.case$ "t" change.case$ } + +FUNCTION {space.word} +{ " " swap$ * " " * } + + % Here are the language-specific definitions for explicit words. + % Each function has a name bbl.xxx where xxx is the English word. + % The language selected here is ENGLISH +FUNCTION {bbl.and} +{ "and"} + +FUNCTION {bbl.editors} +{ "editors" } + +FUNCTION {bbl.editor} +{ "editor" } + +FUNCTION {bbl.edby} +{ "edited by" } + +FUNCTION {bbl.edition} +{ "ed." } + +FUNCTION {bbl.volume} +{ "Vol." } + +FUNCTION {bbl.of} +{ "of" } + +FUNCTION {bbl.number} +{ "No." } + +FUNCTION {bbl.nr} +{ "No." } + +FUNCTION {bbl.in} +{ "in" } + +FUNCTION {bbl.pages} +{ "pp." } + +FUNCTION {bbl.page} +{ "p." } + +FUNCTION {bbl.chapter} +{ "chap." } + +FUNCTION {bbl.techrep} +{ "Tech. Rep." } + +FUNCTION {bbl.mthesis} +{ "Master's thesis" } + +FUNCTION {bbl.phdthesis} +{ "Ph.D. thesis" } + +FUNCTION {bbl.first} +{ "1st" } + +FUNCTION {bbl.second} +{ "2nd" } + +FUNCTION {bbl.third} +{ "3rd" } + +FUNCTION {bbl.fourth} +{ "4th" } + +FUNCTION {bbl.fifth} +{ "5th" } + +FUNCTION {bbl.st} +{ "st" } + +FUNCTION {bbl.nd} +{ "nd" } + +FUNCTION {bbl.rd} +{ "rd" } + +FUNCTION {bbl.th} +{ "th" } + +MACRO {jan} {"Jan."} + +MACRO {feb} {"Feb."} + +MACRO {mar} {"March"} + +MACRO {apr} {"April"} + +MACRO {may} {"May"} + +MACRO {jun} {"June"} + +MACRO {jul} {"July"} + +MACRO {aug} {"Aug."} + +MACRO {sep} {"Sept."} + +MACRO {oct} {"Oct."} + +MACRO {nov} {"Nov."} + +MACRO {dec} {"Dec."} + +MACRO {jan-feb} {"Jan.-Feb."} + +MACRO {mar-apr} {"Mar.-Apr."} + +MACRO {may-jun} {"May-Jun."} + +MACRO {jul-aug} {"Jul.-Aug."} + +MACRO {sep-oct} {"Sep.-Oct."} + +MACRO {nov-dec} {"Nov.-Dec."} + +FUNCTION {eng.ord} +{ duplicate$ "1" swap$ * + #-2 #1 substring$ "1" = + { bbl.th * } + { duplicate$ #-1 #1 substring$ + duplicate$ "1" = + { pop$ bbl.st * } + { duplicate$ "2" = + { pop$ bbl.nd * } + { "3" = + { bbl.rd * } + { bbl.th * } + if$ + } + if$ + } + if$ + } + if$ +} + +MACRO {jsr} {"Journal of Spacecraft and Rockets"} + +MACRO {aa} {"Aerospace America"} + +MACRO {sn} {"Space News"} + +MACRO {awst} {"Aviation Week \& Space Technology"} + +MACRO {jcp} {"Journal of Computational Physics"} + +MACRO {ijcfd} {"International Journal of Computational Fluid Dynamics"} + +MACRO {ijnme} {"International Journal for Numerical Methods in Engineering"} + +MACRO {acmcs} {"ACM Computing Surveys"} + +MACRO {acta} {"Acta Informatica"} + +MACRO {cacm} {"Communications of the ACM"} + +MACRO {ibmjrd} {"IBM Journal of Research and Development"} + +MACRO {ibmsj} {"IBM Systems Journal"} + +MACRO {ieeese} {"IEEE Transactions on Software Engineering"} + +MACRO {ieeetc} {"IEEE Transactions on Computers"} + +MACRO {ieeetcad} + {"IEEE Transactions on Computer-Aided Design of Integrated Circuits"} + +MACRO {ipl} {"Information Processing Letters"} + +MACRO {jacm} {"Journal of the ACM"} + +MACRO {jcss} {"Journal of Computer and System Sciences"} + +MACRO {scp} {"Science of Computer Programming"} + +MACRO {sicomp} {"SIAM Journal on Computing"} + +MACRO {tocs} {"ACM Transactions on Computer Systems"} + +MACRO {tods} {"ACM Transactions on Database Systems"} + +MACRO {tog} {"ACM Transactions on Graphics"} + +MACRO {toms} {"ACM Transactions on Mathematical Software"} + +MACRO {toois} {"ACM Transactions on Office Information Systems"} + +MACRO {toplas} {"ACM Transactions on Programming Languages and Systems"} + +MACRO {tcs} {"Theoretical Computer Science"} + +INTEGERS { nameptr namesleft numnames } + +FUNCTION {format.names} +{ 's := + #1 'nameptr := + s num.names$ 'numnames := + numnames 'namesleft := + { namesleft #0 > } + { s nameptr + "{vv~}{ll}{, jj}{, f.}" format.name$ 't := + nameptr #1 > + { + namesleft #1 > + { ", " * t * } + { + numnames #2 > + { "," * } + 'skip$ + if$ + t "others" = + { " et~al." * } + { bbl.and space.word * t * } + if$ + } + if$ + } + 't + if$ + nameptr #1 + 'nameptr := + namesleft #1 - 'namesleft := + } + while$ +} + +FUNCTION {format.names.ed} +{ 's := + #1 'nameptr := + s num.names$ 'numnames := + numnames 'namesleft := + { namesleft #0 > } + { s nameptr + "{f.~}{vv~}{ll}{, jj}" + format.name$ 't := + nameptr #1 > + { + namesleft #1 > + { ", " * t * } + { + numnames #2 > + { "," * } + 'skip$ + if$ + t "others" = + { " et~al." * } + { bbl.and space.word * t * } + if$ + } + if$ + } + 't + if$ + nameptr #1 + 'nameptr := + namesleft #1 - 'namesleft := + } + while$ +} + +FUNCTION {format.authors} +{ author empty$ + { "" } + { + author format.names + } + if$ +} + +FUNCTION {format.editors} +{ editor empty$ + { "" } + { + editor format.names + editor num.names$ #1 > + { ", " * bbl.editors * } + { ", " * bbl.editor * } + if$ + } + if$ +} + +FUNCTION {format.in.editors} +{ editor empty$ + { "" } + { editor format.names.ed + } + if$ +} + +FUNCTION {format.title} +{ title empty$ + { "" } + { title + "\enquote{" swap$ * + non.stop + { ",} " * } + { "} " * } + if$ + } + if$ +} + +FUNCTION {end.quote.title} +{ title empty$ + 'skip$ + { before.all 'output.state := } + if$ +} + +FUNCTION {output.bibitem} +{ newline$ + "\bibitem{" write$ + cite$ write$ + "}" write$ + newline$ + "" + before.all 'output.state := +} + +FUNCTION {n.dashify} +{ 't := + "" + { t empty$ not } + { t #1 #1 substring$ "-" = + { t #1 #2 substring$ "--" = not + { "--" * + t #2 global.max$ substring$ 't := + } + { { t #1 #1 substring$ "-" = } + { "-" * + t #2 global.max$ substring$ 't := + } + while$ + } + if$ + } + { t #1 #1 substring$ * + t #2 global.max$ substring$ 't := + } + if$ + } + while$ +} + +FUNCTION {word.in} +{ "" } + +FUNCTION {format.date} +{ year empty$ + { month empty$ + { "" } + { "there's a month but no year in " cite$ * warning$ + month + } + if$ + } + { month empty$ + 'year + { month " " * year * } + if$ + } + if$ +} + +FUNCTION {format.btitle} +{ title emphasize +} + +FUNCTION {tie.or.space.connect} +{ duplicate$ text.length$ #3 < + { "~" } + { " " } + if$ + swap$ * * +} + +FUNCTION {either.or.check} +{ empty$ + 'pop$ + { "can't use both " swap$ * " fields in " * cite$ * warning$ } + if$ +} + +FUNCTION {format.bvolume} +{ volume empty$ + { "" } + { bbl.volume volume tie.or.space.connect + series empty$ + 'skip$ + { bbl.of space.word * series emphasize * } + if$ + "volume and number" number either.or.check + } + if$ +} + +FUNCTION {format.number.series} +{ volume empty$ + { number empty$ + { series field.or.null } + { output.state mid.sentence = + { bbl.number } + { bbl.number capitalize } + if$ + number tie.or.space.connect + series empty$ + { "there's a number but no series in " cite$ * warning$ } + { bbl.in space.word * series * } + if$ + } + if$ + } + { "" } + if$ +} + +FUNCTION {is.num} +{ chr.to.int$ + duplicate$ "0" chr.to.int$ < not + swap$ "9" chr.to.int$ > not and +} + +FUNCTION {extract.num} +{ duplicate$ 't := + "" 's := + { t empty$ not } + { t #1 #1 substring$ + t #2 global.max$ substring$ 't := + duplicate$ is.num + { s swap$ * 's := } + { pop$ "" 't := } + if$ + } + while$ + s empty$ + 'skip$ + { pop$ s } + if$ +} + +FUNCTION {convert.edition} +{ edition extract.num "l" change.case$ 's := + s "first" = s "1" = or + { bbl.first 't := } + { s "second" = s "2" = or + { bbl.second 't := } + { s "third" = s "3" = or + { bbl.third 't := } + { s "fourth" = s "4" = or + { bbl.fourth 't := } + { s "fifth" = s "5" = or + { bbl.fifth 't := } + { s #1 #1 substring$ is.num + { s eng.ord 't := } + { edition 't := } + if$ + } + if$ + } + if$ + } + if$ + } + if$ + } + if$ + t +} + +FUNCTION {format.edition} +{ edition empty$ + { "" } + { output.state mid.sentence = + { convert.edition "l" change.case$ " " * bbl.edition * } + { convert.edition "t" change.case$ " " * bbl.edition * } + if$ + } + if$ +} + +INTEGERS { multiresult } + +FUNCTION {multi.page.check} +{ 't := + #0 'multiresult := + { multiresult not + t empty$ not + and + } + { t #1 #1 substring$ + duplicate$ "-" = + swap$ duplicate$ "," = + swap$ "+" = + or or + { #1 'multiresult := } + { t #2 global.max$ substring$ 't := } + if$ + } + while$ + multiresult +} + +FUNCTION {format.pages} +{ pages empty$ + { "" } + { pages multi.page.check + { bbl.pages pages n.dashify tie.or.space.connect } + { bbl.page pages tie.or.space.connect } + if$ + } + if$ +} + +FUNCTION {format.journal.pages} +{ + pages empty$ + 'skip$ + { duplicate$ empty$ + { pop$ format.pages } + { ", " * bbl.pages "~" * * pages n.dashify * } + if$ + } + if$ +} + +FUNCTION {format.vol.num.pages} +{ volume field.or.null + volume empty$ + 'skip$ + { bbl.volume "~" * swap$ * } + if$ + number empty$ + 'skip$ + { + ", " bbl.nr * number tie.or.space.connect * + volume empty$ + { "there's a number but no volume in " cite$ * warning$ } + 'skip$ + if$ + } + if$ +} + +FUNCTION {format.chapter.pages} +{ chapter empty$ + { "" } + { type empty$ + { bbl.chapter } + { type "l" change.case$ } + if$ + chapter tie.or.space.connect + } + if$ +} + +FUNCTION {format.in.ed.booktitle} +{ booktitle empty$ + { "" } + { editor empty$ + { word.in booktitle emphasize * } + { word.in booktitle emphasize * + ", " * + bbl.edby + * + " " * + format.in.editors * + } + if$ + } + if$ +} + +FUNCTION {empty.misc.check} +{ author empty$ title empty$ howpublished empty$ + month empty$ year empty$ note empty$ + and and and and and + { "all relevant fields are empty in " cite$ * warning$ } + 'skip$ + if$ +} + +FUNCTION {format.thesis.type} +{ type empty$ + 'skip$ + { pop$ + type "t" change.case$ + } + if$ +} + +FUNCTION {format.tr.number} +{ type empty$ + { bbl.techrep } + 'type + if$ + number empty$ + { "t" change.case$ } + { number tie.or.space.connect } + if$ +} + +FUNCTION {format.article.crossref} +{ + key empty$ + { journal empty$ + { "need key or journal for " cite$ * " to crossref " * crossref * + warning$ + "" + } + { word.in journal emphasize * } + if$ + } + { word.in key * " " *} + if$ + " \cite{" * crossref * "}" * +} + +FUNCTION {format.crossref.editor} +{ editor #1 "{vv~}{ll}" format.name$ + editor num.names$ duplicate$ + #2 > + { pop$ " et~al." * } + { #2 < + 'skip$ + { editor #2 "{ff }{vv }{ll}{ jj}" format.name$ "others" = + { " et~al." * } + { bbl.and space.word * editor #2 "{vv~}{ll}" format.name$ * } + if$ + } + if$ + } + if$ +} + +FUNCTION {format.book.crossref} +{ volume empty$ + { "empty volume in " cite$ * "'s crossref of " * crossref * warning$ + word.in + } + { bbl.volume volume tie.or.space.connect + bbl.of space.word * + } + if$ + editor empty$ + editor field.or.null author field.or.null = + or + { key empty$ + { series empty$ + { "need editor, key, or series for " cite$ * " to crossref " * + crossref * warning$ + "" * + } + { series emphasize * } + if$ + } + { key * } + if$ + } + { format.crossref.editor * } + if$ + " \cite{" * crossref * "}" * +} + +FUNCTION {format.incoll.inproc.crossref} +{ + editor empty$ + editor field.or.null author field.or.null = + or + { key empty$ + { booktitle empty$ + { "need editor, key, or booktitle for " cite$ * " to crossref " * + crossref * warning$ + "" + } + { word.in booktitle emphasize * } + if$ + } + { word.in key * " " *} + if$ + } + { word.in format.crossref.editor * " " *} + if$ + " \cite{" * crossref * "}" * +} + +FUNCTION {format.publisher} +{ publisher empty$ + { "empty publisher in " cite$ * warning$ } + 'skip$ + if$ + "" + address empty$ publisher empty$ and + 'skip$ + { + publisher empty$ + { address empty$ + 'skip$ + { address * } + if$ + } + { publisher * + address empty$ + 'skip$ + { ", " * address * } + if$ + } + if$ + } + if$ + output +} + +FUNCTION {article} +{ output.bibitem + format.authors "author" output.check + format.title "title" output.check + end.quote.title + crossref missing$ + { journal + emphasize + "journal" output.check + format.vol.num.pages output + format.date "year" output.check + } + { format.article.crossref output.nonnull + format.pages output + } + if$ + format.journal.pages + note output + fin.entry +} + +FUNCTION {book} +{ output.bibitem + author empty$ + { format.editors "author and editor" output.check + } + { format.authors output.nonnull + crossref missing$ + { "author and editor" editor either.or.check } + 'skip$ + if$ + } + if$ + format.btitle "title" output.check + crossref missing$ + { format.bvolume output + format.number.series output + format.publisher + } + { + format.book.crossref output.nonnull + } + if$ + format.edition output + format.date "year" output.check + note output + fin.entry +} + +FUNCTION {booklet} +{ output.bibitem + format.authors output + format.title "title" output.check + end.quote.title + howpublished output + address output + format.date output + note output + fin.entry +} + +FUNCTION {inbook} +{ output.bibitem + author empty$ + { format.editors "author and editor" output.check + } + { format.authors output.nonnull + crossref missing$ + { "author and editor" editor either.or.check } + 'skip$ + if$ + } + if$ + format.btitle "title" output.check + crossref missing$ + { + format.bvolume output + format.chapter.pages "chapter and pages" output.check + format.number.series output + format.publisher + } + { + format.chapter.pages "chapter and pages" output.check + format.book.crossref output.nonnull + } + if$ + format.edition output + format.date "year" output.check + format.pages "pages" output.check + note output + fin.entry +} + +FUNCTION {incollection} +{ output.bibitem + format.authors "author" output.check + format.title "title" output.check + end.quote.title + crossref missing$ + { format.in.ed.booktitle "booktitle" output.check + format.bvolume output + format.number.series output + format.chapter.pages output + format.publisher + format.edition output + format.date "year" output.check + } + { format.incoll.inproc.crossref output.nonnull + format.chapter.pages output + } + if$ + format.pages "pages" output.check + note output + fin.entry +} + +FUNCTION {inproceedings} +{ output.bibitem + format.authors "author" output.check + format.title "title" output.check + end.quote.title + crossref missing$ + { format.in.ed.booktitle "booktitle" output.check + format.bvolume output + format.number.series output + publisher empty$ + { organization output + address output + } + { organization output + format.publisher + } + if$ + format.date "year" output.check + } + { format.incoll.inproc.crossref output.nonnull + format.pages output + } + if$ + format.pages "pages" output.check + note output + fin.entry +} + +FUNCTION {conference} { inproceedings } + +FUNCTION {manual} +{ output.bibitem + author empty$ + { organization empty$ + 'skip$ + { organization output.nonnull + address output + } + if$ + } + { format.authors output.nonnull } + if$ + format.btitle "title" output.check + author empty$ + { organization empty$ + { + address output + } + 'skip$ + if$ + } + { + organization output + address output + } + if$ + format.edition output + format.date output + note output + fin.entry +} + +FUNCTION {mastersthesis} +{ output.bibitem + format.authors "author" output.check + format.btitle "title" output.check + bbl.mthesis format.thesis.type output.nonnull + school "school" output.check + address output + format.date "year" output.check + note output + fin.entry +} + +FUNCTION {misc} +{ output.bibitem + format.authors output + format.title output + end.quote.title + howpublished output + format.date output + note output + fin.entry + empty.misc.check +} + +FUNCTION {phdthesis} +{ output.bibitem + format.authors "author" output.check + format.btitle "title" output.check + bbl.phdthesis format.thesis.type output.nonnull + school "school" output.check + address output + format.date "year" output.check + note output + fin.entry +} + +FUNCTION {proceedings} +{ output.bibitem + editor empty$ + { organization output } + { format.editors output.nonnull } + if$ + format.btitle "title" output.check + format.bvolume output + format.number.series output + address empty$ + { editor empty$ + { publisher new.sentence.checka } + { organization publisher new.sentence.checkb + organization output + } + if$ + publisher output + format.date "year" output.check + } + { address output.nonnull + format.date "year" output.check + editor empty$ + 'skip$ + { organization output } + if$ + publisher output + } + if$ + note output + fin.entry +} + +FUNCTION {techreport} +{ output.bibitem + format.authors "author" output.check + format.title "title" output.check + end.quote.title + format.tr.number output.nonnull + institution "institution" output.check + address output + format.date "year" output.check + note output + fin.entry +} + +FUNCTION {unpublished} +{ output.bibitem + format.authors "author" output.check + format.title "title" output.check + end.quote.title + note "note" output.check + fin.entry +} + +FUNCTION {default.type} { misc } + +READ + +STRINGS { longest.label } + +INTEGERS { number.label longest.label.width } + +FUNCTION {initialize.longest.label} +{ "" 'longest.label := + #1 'number.label := + #0 'longest.label.width := +} + +FUNCTION {longest.label.pass} +{ number.label int.to.str$ 'label := + number.label #1 + 'number.label := + label width$ longest.label.width > + { label 'longest.label := + label width$ 'longest.label.width := + } + 'skip$ + if$ +} + +EXECUTE {initialize.longest.label} + +ITERATE {longest.label.pass} + +FUNCTION {begin.bib} +{ preamble$ empty$ + 'skip$ + { preamble$ write$ newline$ } + if$ + "\begin{thebibliography}{" longest.label * "}" * + write$ newline$ + "\newcommand{\enquote}[1]{``#1''}" + write$ newline$ +} + +EXECUTE {begin.bib} + +EXECUTE {init.state.consts} + +ITERATE {call.type$} + +FUNCTION {end.bib} +{ newline$ + "\end{thebibliography}" write$ newline$ +} + +EXECUTE {end.bib} +%</bibstyle> +% \end{macrocode} +% +% This brings us to the end of \file{aiaa.bst}. +% +% \subsection{AIAA Endfloat Configuration File} +% +% \begin{macrocode} +% +%<*enfconfig> + \renewcommand{\listfigurename}{List of Figure Captions} + \renewcommand{\listtablename}{List of Table Captions} + \setcounter{lofdepth}{2}% puts subfigure captions in lof + \def\numberline#1{\setlength{\@tempdima}{0.3in}% + \hb@xt@\@tempdima{#1:}}% make bold numbers + \renewcommand*{\l@figure}[2]{\vskip\abovedisplayskip% + \setlength\@tempdima{1.5em}% + \noindent{\bfseries \figurename\ #1}\par} + \renewcommand*{\l@table}[2]{% + \setlength\@tempdima{1.5em}% + \noindent{\bfseries \tablename}\ + #1\hfil\vskip\belowdisplayskip } +% change lof behavior for subfigures: + \renewcommand{\@dottedxxxline}[6]{% + \ifnum #2>\@nameuse{c@#1depth}\else + \vskip 3pt\hspace{0em}{\bfseries #5}\par\vskip 1pt + \fi} + \newcommand{\lox@subfigure}{\thesubfigure} + \newcommand{\lox@subtable}{\thesubtable} + \renewcommand{\@subcaption}[2]{% + \begingroup + \let\label\@gobble + \let\protect\string + \edef\@currentlabel{\csname lox@#1\endcsname}% + \xdef\@subfigcaptionlist{% + \@subfigcaptionlist,% + {\numberline{\@currentlabel}\noexpand{\ignorespaces #2}}}% + \endgroup + \@nameuse{@make#1caption}{\@nameuse{@the#1}}{#2}} + \renewcommand{\@makecaption}[2]{} + \renewcommand{\@makesubfigurecaption}[2]{} + \renewcommand{\@makesubtablecaption}[2]{} + \let\OrigCaption\caption + \renewcommand{\caption}[2][X]{\OrigCaption[#2]{}} + \newcommand{\processfigures@hooka}{\@empty} + \def\AtEndFigures{\g@addto@macro\processfigures@hooka} + \newcommand{\processtables@hooka}{\@empty} + \def\AtEndTables{\g@addto@macro\processtables@hooka} + \AtBeginTables{\cfoot{\footnotesize\scshape\tablename\ \thetable\captionlabeldelim}} + \AtEndTables{\cfoot{}} + \AtBeginFigures{\cfoot{\footnotesize\scshape\figurename\ \thefigure\captionlabeldelim}} + \AtEndFigures{\cfoot{}} + \def\processfigures{% + \expandafter\ifnum \csname @ef@fffopen\endcsname>0 + \immediate\closeout\efloat@postfff \ef@setct{fff}{0} + \clearpage % bj + \if@figlist % bj + {\normalsize\listoffigures} % bj + \clearpage % bj + \fi + \if@fighead + \section*{\figuresection} % bj + \suppressfloats[t] % jpg + \fi + \markboth{\uppercase{\figuresection}}{\uppercase{\figuresection}}% bj + \processfigures@hook \@input{\jobname.fff} \processfigures@hooka + \fi} + \def\processtables{% + \expandafter\ifnum \csname @ef@tttopen\endcsname>0 + \immediate\closeout\efloat@postttt \ef@setct{ttt}{0} + \clearpage % bj + \if@tablist % bj + {\normalsize\listoftables} % bj + \clearpage % bj + \fi + \if@tabhead + \section*{\tablesection} % bj + \suppressfloats[t] % jpg + \fi + \markboth{\uppercase{\tablesection}}{\uppercase{\tablesection}}% bj + \processtables@hook \@input{\jobname.ttt} \processtables@hooka + \fi} +%</enfconfig> +% \end{macrocode} +% +% This brings us to the end of \file{aiaaenf.cfg}. +% +% \Finale +% diff --git a/macros/latex/contrib/aiaa/pre2004/aiaa.ins b/macros/latex/contrib/aiaa/pre2004/aiaa.ins new file mode 100644 index 0000000000..68d52e2ddf --- /dev/null +++ b/macros/latex/contrib/aiaa/pre2004/aiaa.ins @@ -0,0 +1,76 @@ +% +% This is file `aiaa.ins', the installation file for the `aiaa' +% distribution, version 2.4, dated 1999/02/22 by bil kleb +% <w.l.kleb@larc.nasa.gov> +% +% To obtain the individual components of the aiaa bundle necessary +% to produce a document, RUN THIS FILE THROUGH LATEX. The files +% will be extracted from the file `aiaa.dtx' via the docstrip utility +% that is part of latex. To produce a users' manual, run the +% bundle itself, 'aiaa.dtx', through LaTeX. +% +% You may use the `aiaa' distribution freely, but at your own +% risk. The author can not be held responsible for any consequence +% of your using any of these files, or files created from these, +% including hardware, software, and data damage. You may not make +% any changes to the files aiaa.dtx or aiaa.ins. You may incorporate +% the code from these files in other files under different names, +% provided the original author are given at least some token +% amount of credit for his work and that you yourself take +% the complaints from the user(s) of your file(s). You may freely +% distribute the files aiaa.dtx, aiaa.ins, and aiaalgo.eps provided: +% +% 1) You do not take money for the distribution or use +% of these files except for a nominal charge for data medium +% and postage +% 2) You always distribute `aiaa.dtx', `aiaa.ins', and `aiaalgo.eps' +% at the same time, i.e., as a package. +% +% `aiaa' is based on the standard LaTeX article class and used +% patrick daly's custom-bib package to generate the aiaa +% bibliographic style file. These files were created with +% copious help from those in the comp.text.tex newsgroup, the +% standard LaTeX books, and various package maintainers. +% +\def\batchfile{aiaa.ins} +\input docstrip.tex + +\keepsilent +\preamble + +The "aiaa" distribution by bil kleb <w.l.kleb@larc.nasa.gov>. +Please see the file `aiaa.ins' for information on how you may +(re-)distribute the `aiaa' bundle of files. + +\endpreamble + +\declarepostamble\bstpostamble +\endpostamble + +\generate{\file{aiaa.cls} {\from{aiaa.dtx}{class}}} +\generate{\file{aiaa9pt.sty}{\from{aiaa.dtx}{style}}} +\generate{\usepostamble\bstpostamble% + \file{aiaa.bst} {\from{aiaa.dtx}{bibstyle}}} +\generate{\file{aiaaenf.cfg}{\from{aiaa.dtx}{enfconfig}}} + +\Msg{::::::::::::::::::::::::::::::::::::::::::::::::::::::::::::::::::::::::} +\Msg{ } +\Msg{ Now you should have the following files:} +\Msg{ } +\Msg{ aiaa.cls aiaa9pt.sty aiaaenf.cfg aiaalgo.eps} +\Msg{ } +\Msg{ They need to be moved into a directory searched by (La)TeX.} +\Msg{ Furthermore, the bibliographic style file:} +\Msg{ } +\Msg{ aiaa.bst} +\Msg{ } +\Msg{ needs to be moved into a directory searched by BibTeX.} +\Msg{ } +\Msg{ The aiaa users manual, which is created by running} +\Msg{ the file `aiaa.dtx' through LaTeX, has more detailed} +\Msg{ installation instructions.} +\Msg{ } +\Msg{::::::::::::::::::::::::::::::::::::::::::::::::::::::::::::::::::::::::} +%% +%% end of file aiaa.ins +%% diff --git a/macros/latex/contrib/aiaa/pre2004/aiaa.pdf b/macros/latex/contrib/aiaa/pre2004/aiaa.pdf Binary files differnew file mode 100644 index 0000000000..254012f9be --- /dev/null +++ b/macros/latex/contrib/aiaa/pre2004/aiaa.pdf diff --git a/macros/latex/contrib/aiaa/pre2004/aiaalgo.eps b/macros/latex/contrib/aiaa/pre2004/aiaalgo.eps new file mode 100644 index 0000000000..7b084add44 --- /dev/null +++ b/macros/latex/contrib/aiaa/pre2004/aiaalgo.eps @@ -0,0 +1,6416 @@ +%!PS-Adobe-3.0 EPSF-3.0 +%%Creator: Adobe Illustrator(TM) 7.0 +%%For: (Richard A Wheless) (NASA Langley Research Center) +%%Title: (AIAALOGO) +%%CreationDate: (2/3/98) (3:59 PM) +%%BoundingBox: 247 387 357 420 +%%HiResBoundingBox: 247.1666 387.5 356.6667 419.1667 +%%DocumentProcessColors: Black +%%DocumentSuppliedResources: procset Adobe_level2_AI5 1.2 0 +%%+ procset Adobe_ColorImage_AI6 1.1 0 +%%+ procset Adobe_Illustrator_AI5 1.2 0 +%%+ procset Adobe_cshow 2.0 8 +%AI5_FileFormat 3 +%AI3_ColorUsage: Black&White +%AI3_IncludePlacedImages +%AI7_ImageSettings: 1 +%%CMYKCustomColor: 1 0 0.55 0 (Aqua) +%%+ 1 0.5 0 0 (Blue) +%%+ 0.5 0.4 0.3 0 (Blue Gray) +%%+ 0.8 0.05 0 0 (Blue Sky) +%%+ 0.5 0.85 1 0 (Brown) +%%+ 1 0.9 0.1 0 (Dark Blue) +%%+ 1 0.55 1 0 (Forest Green) +%%+ 0.05 0.2 0.95 0 (Gold) +%%+ 0.75 0.05 1 0 (Grass Green) +%%+ 0 0.45 1 0 (Orange) +%%+ 0.15 1 1 0 (Red) +%%+ 0.45 0.9 0 0 (Violet) +%%AI6_ColorSeparationSet: 1 1 (AI6 Default Color Separation Set) +%%+ Options: 1 16 0 1 0 1 1 1 0 1 1 1 1 18 0 0 0 0 0 0 0 0 -1 -1 +%%+ PPD: 1 21 0 0 60 45 2 2 1 0 0 1 0 0 0 0 0 0 0 0 0 0 () +%AI3_TemplateBox: 306 396 306 396 +%AI3_TileBox: 30 31 582 761 +%AI3_DocumentPreview: Header +%AI5_ArtSize: 612 792 +%AI5_RulerUnits: 0 +%AI5_ArtFlags: 1 0 0 1 0 0 1 1 0 +%AI5_TargetResolution: 800 +%AI5_NumLayers: 1 +%AI5_OpenToView: 218 464 6 1018 725 18 0 1 3 40 0 0 +%AI5_OpenViewLayers: 7 +%%PageOrigin:30 31 +%%AI3_PaperRect:-30 761 582 -31 +%%AI3_Margin:30 -31 -30 31 +%AI7_GridSettings: 72 8 72 8 1 0 0.768627 0.843137 1 0.884314 0.921569 1 +%%EndComments +%%BeginProlog +%%BeginResource: procset Adobe_level2_AI5 1.2 0 +%%Title: (Adobe Illustrator (R) Version 5.0 Level 2 Emulation) +%%Version: 1.2 0 +%%CreationDate: (04/10/93) () +%%Copyright: ((C) 1987-1996 Adobe Systems Incorporated All Rights Reserved) +userdict /Adobe_level2_AI5 25 dict dup begin + put + /packedarray where not + { + userdict begin + /packedarray + { + array astore readonly + } bind def + /setpacking /pop load def + /currentpacking false def + end + 0 + } if + pop + userdict /defaultpacking currentpacking put true setpacking + /initialize + { + Adobe_level2_AI5 begin + } bind def + /terminate + { + currentdict Adobe_level2_AI5 eq + { + end + } if + } bind def + mark + /setcustomcolor where not + { + /findcmykcustomcolor + { + 0 + 6 packedarray + } bind def + /findrgbcustomcolor + { + 1 + 5 packedarray + } bind def + /setcustomcolor + { + exch + aload pop + 0 eq + { + pop + 4 + { + 4 index mul + 4 1 roll + } repeat + 5 -1 roll pop + setcmykcolor + } + { + pop + 3 + { + 1 exch sub + 3 index mul + 1 exch sub + 3 1 roll + } repeat + 4 -1 roll pop + setrgbcolor + } ifelse + } + def + } if + + /gt38? mark {version cvr cvx exec} stopped {cleartomark true} {38 gt exch pop} ifelse def + userdict /deviceDPI 72 0 matrix defaultmatrix dtransform dup mul exch dup mul add sqrt put + userdict /level2? + systemdict /languagelevel known dup + { + pop systemdict /languagelevel get 2 ge + } if + put +/level2ScreenFreq +{ + begin + 60 + HalftoneType 1 eq + { + pop Frequency + } if + HalftoneType 2 eq + { + pop GrayFrequency + } if + HalftoneType 5 eq + { + pop Default level2ScreenFreq + } if + end +} bind def +userdict /currentScreenFreq + level2? {currenthalftone level2ScreenFreq} {currentscreen pop pop} ifelse put +level2? not + { + /setcmykcolor where not + { + /setcmykcolor + { + exch .11 mul add exch .59 mul add exch .3 mul add + 1 exch sub setgray + } def + } if + /currentcmykcolor where not + { + /currentcmykcolor + { + 0 0 0 1 currentgray sub + } def + } if + /setoverprint where not + { + /setoverprint /pop load def + } if + /selectfont where not + { + /selectfont + { + exch findfont exch + dup type /arraytype eq + { + makefont + } + { + scalefont + } ifelse + setfont + } bind def + } if + /cshow where not + { + /cshow + { + [ + 0 0 5 -1 roll aload pop + ] cvx bind forall + } bind def + } if + } if + cleartomark + /anyColor? + { + add add add 0 ne + } bind def + /testColor + { + gsave + setcmykcolor currentcmykcolor + grestore + } bind def + /testCMYKColorThrough + { + testColor anyColor? + } bind def + userdict /composite? + level2? + { + gsave 1 1 1 1 setcmykcolor currentcmykcolor grestore + add add add 4 eq + } + { + 1 0 0 0 testCMYKColorThrough + 0 1 0 0 testCMYKColorThrough + 0 0 1 0 testCMYKColorThrough + 0 0 0 1 testCMYKColorThrough + and and and + } ifelse + put + composite? not + { + userdict begin + gsave + /cyan? 1 0 0 0 testCMYKColorThrough def + /magenta? 0 1 0 0 testCMYKColorThrough def + /yellow? 0 0 1 0 testCMYKColorThrough def + /black? 0 0 0 1 testCMYKColorThrough def + grestore + /isCMYKSep? cyan? magenta? yellow? black? or or or def + /customColor? isCMYKSep? not def + end + } if + end defaultpacking setpacking +%%EndResource +%%BeginProcSet: Adobe_ColorImage_AI6 1.1 0 +userdict /Adobe_ColorImage_AI6 known not +{ + userdict /Adobe_ColorImage_AI6 24 dict put +} if +userdict /Adobe_ColorImage_AI6 get begin +/initialize +{ + Adobe_ColorImage_AI6 begin + Adobe_ColorImage_AI6 + { + dup type /arraytype eq + { + dup xcheck + { + bind + } if + } if + pop pop + } forall +} def +/terminate { end } def +currentdict /Adobe_ColorImage_AI6_Vars known not +{ + /Adobe_ColorImage_AI6_Vars 15 dict def +} if +Adobe_ColorImage_AI6_Vars begin + /channelcount 0 def + /sourcecount 0 def + /sourcearray 4 array def + /plateindex -1 def + /XIMask 0 def + /XIBinary 0 def + /XIChannelCount 0 def + /XIBitsPerPixel 0 def + /XIImageHeight 0 def + /XIImageWidth 0 def + /XIImageMatrix null def + /XIBuffer null def + /XIDataProc null def + /XIVersion 6 def +end +/WalkRGBString null def +/WalkCMYKString null def +/StuffRGBIntoGrayString null def +/RGBToGrayImageProc null def +/StuffCMYKIntoGrayString null def +/CMYKToGrayImageProc null def +/ColorImageCompositeEmulator null def +/SeparateCMYKImageProc null def +/FourEqual null def +/TestPlateIndex null def +currentdict /_colorimage known not +{ + /colorimage where + { + /colorimage get /_colorimage exch def + } + { + /_colorimage null def + } ifelse +} if +/_currenttransfer systemdict /currenttransfer get def +/colorimage null def +/XI null def +/WalkRGBString +{ + 0 3 index + dup length 1 sub 0 3 3 -1 roll + { + 3 getinterval { } forall + 5 index exec + 3 index + } for + + 5 { pop } repeat +} def +/WalkCMYKString +{ + 0 3 index + dup length 1 sub 0 4 3 -1 roll + { + 4 getinterval { } forall + + 6 index exec + + 3 index + + } for + + 5 { pop } repeat + +} def +/StuffRGBIntoGrayString +{ + .11 mul exch + + .59 mul add exch + + .3 mul add + + cvi 3 copy put + + pop 1 add +} def +/RGBToGrayImageProc +{ + Adobe_ColorImage_AI6_Vars begin + sourcearray 0 get exec + dup length 3 idiv string + dup 3 1 roll + + /StuffRGBIntoGrayString load exch + WalkRGBString + end +} def +/StuffCMYKIntoGrayString +{ + exch .11 mul add + + exch .59 mul add + + exch .3 mul add + + dup 255 gt { pop 255 } if + + 255 exch sub cvi 3 copy put + + pop 1 add +} def +/CMYKToGrayImageProc +{ + Adobe_ColorImage_AI6_Vars begin + sourcearray 0 get exec + dup length 4 idiv string + dup 3 1 roll + + /StuffCMYKIntoGrayString load exch + WalkCMYKString + end +} def +/ColorImageCompositeEmulator +{ + pop true eq + { + Adobe_ColorImage_AI6_Vars /sourcecount get 5 add { pop } repeat + } + { + Adobe_ColorImage_AI6_Vars /channelcount get 1 ne + { + Adobe_ColorImage_AI6_Vars begin + sourcearray 0 3 -1 roll put + + channelcount 3 eq + { + /RGBToGrayImageProc + } + { + /CMYKToGrayImageProc + } ifelse + load + end + } if + image + } ifelse +} def +/SeparateCMYKImageProc +{ + Adobe_ColorImage_AI6_Vars begin + sourcecount 0 ne + { + sourcearray plateindex get exec + } + { + sourcearray 0 get exec + + dup length 4 idiv string + + 0 2 index + + plateindex 4 2 index length 1 sub + { + get 255 exch sub + + 3 copy put pop 1 add + + 2 index + } for + pop pop exch pop + } ifelse + end +} def + +/FourEqual +{ + 4 index ne + { + pop pop pop false + } + { + 4 index ne + { + pop pop false + } + { + 4 index ne + { + pop false + } + { + 4 index eq + } ifelse + } ifelse + } ifelse +} def +/TestPlateIndex +{ + Adobe_ColorImage_AI6_Vars begin + /plateindex -1 def + /setcmykcolor where + { + pop + gsave + 1 0 0 0 setcmykcolor systemdict /currentgray get exec 1 exch sub + 0 1 0 0 setcmykcolor systemdict /currentgray get exec 1 exch sub + 0 0 1 0 setcmykcolor systemdict /currentgray get exec 1 exch sub + 0 0 0 1 setcmykcolor systemdict /currentgray get exec 1 exch sub + grestore + 1 0 0 0 FourEqual + { + /plateindex 0 def + } + { + 0 1 0 0 FourEqual + { + /plateindex 1 def + } + { + 0 0 1 0 FourEqual + { + /plateindex 2 def + } + { + 0 0 0 1 FourEqual + { + /plateindex 3 def + } + { + 0 0 0 0 FourEqual + { + /plateindex 5 def + } if + } ifelse + } ifelse + } ifelse + } ifelse + pop pop pop pop + } if + plateindex + end +} def +/colorimage +{ + Adobe_ColorImage_AI6_Vars begin + /channelcount 1 index def + /sourcecount 2 index 1 eq { channelcount 1 sub } { 0 } ifelse def + 4 sourcecount add index dup + 8 eq exch 1 eq or not + end + + { + /_colorimage load null ne + { + _colorimage + } + { + Adobe_ColorImage_AI6_Vars /sourcecount get + 7 add { pop } repeat + } ifelse + } + { + dup 3 eq + TestPlateIndex + dup -1 eq exch 5 eq or or + { + /_colorimage load null eq + { + ColorImageCompositeEmulator + } + { + dup 1 eq + { + pop pop image + } + { + Adobe_ColorImage_AI6_Vars /plateindex get 5 eq + { + gsave + + 0 _currenttransfer exec + 1 _currenttransfer exec + eq + { 0 _currenttransfer exec 0.5 lt } + { 0 _currenttransfer exec 1 _currenttransfer exec gt } ifelse + + { { pop 0 } } { { pop 1 } } ifelse + systemdict /settransfer get exec + } if + + _colorimage + + Adobe_ColorImage_AI6_Vars /plateindex get 5 eq + { + grestore + } if + } ifelse + } ifelse + } + { + dup 1 eq + { + pop pop + image + } + { + pop pop + Adobe_ColorImage_AI6_Vars begin + sourcecount -1 0 + { + exch sourcearray 3 1 roll put + } for + /SeparateCMYKImageProc load + end + systemdict /image get exec + } ifelse + } ifelse + } ifelse +} def +/XG +{ + pop pop +} def +/XF +{ + 13 {pop} repeat +} def +/Xh +{ + Adobe_ColorImage_AI6_Vars begin + gsave + /XIMask exch 0 ne def + /XIImageHeight exch def + /XIImageWidth exch def + /XIImageMatrix exch def + 0 0 moveto + XIImageMatrix concat + XIImageWidth XIImageHeight scale + + XIMask + { + /_lp /null ddef + _fc + /_lp /imagemask ddef + } + if + /XIVersion 7 def + end +} def +/XH +{ + Adobe_ColorImage_AI6_Vars begin + /XIVersion 6 def + grestore + end +} def +/XI +{ + Adobe_ColorImage_AI6_Vars begin + gsave + /XIMask exch 0 ne def + /XIBinary exch 0 ne def + pop + pop + /XIChannelCount exch def + /XIBitsPerPixel exch def + /XIImageHeight exch def + /XIImageWidth exch def + pop pop pop pop + /XIImageMatrix exch def + XIBitsPerPixel 1 eq + { + XIImageWidth 8 div ceiling cvi + } + { + XIImageWidth XIChannelCount mul + } ifelse + /XIBuffer exch string def + XIBinary + { + /XIDataProc { currentfile XIBuffer readstring pop } def + XIVersion 6 le + { + currentfile 128 string readline pop pop + } + if + } + { + /XIDataProc { currentfile XIBuffer readhexstring pop } def + } ifelse + + XIVersion 6 le + { + 0 0 moveto + XIImageMatrix concat + XIImageWidth XIImageHeight scale + XIMask + { + /_lp /null ddef + _fc + /_lp /imagemask ddef + } if + } if + + XIMask + { + XIImageWidth XIImageHeight + false + [ XIImageWidth 0 0 XIImageHeight neg 0 0 ] + /XIDataProc load + imagemask + } + { + XIImageWidth XIImageHeight + XIBitsPerPixel + [ XIImageWidth 0 0 XIImageHeight neg 0 0 ] + /XIDataProc load + + XIChannelCount 1 eq + { + gsave + 0 setgray + image + grestore + } + { + false + XIChannelCount + colorimage + } ifelse + } ifelse + grestore + end +} def +end +%%EndProcSet +%%BeginResource: procset Adobe_Illustrator_AI5 1.2 0 +%%Title: (Adobe Illustrator (R) Version 7.0 Full Prolog) +%%Version: 1.2 0 +%%CreationDate: (3/7/1994) () +%%Copyright: ((C) 1987-1996 Adobe Systems Incorporated All Rights Reserved) +currentpacking true setpacking +userdict /Adobe_Illustrator_AI5_vars 107 dict dup begin +put +/_eo false def +/_lp /none def +/_pf +{ +} def +/_ps +{ +} def +/_psf +{ +} def +/_pss +{ +} def +/_pjsf +{ +} def +/_pjss +{ +} def +/_pola 0 def +/_doClip 0 def +/cf currentflat def +/_lineorientation 0 def +/_charorientation 0 def +/_yokoorientation 0 def +/_tm matrix def +/_renderStart +[ +/e0 /r0 /a0 /o0 /e1 /r1 /a1 /i0 +] def +/_renderEnd +[ +null null null null /i1 /i1 /i1 /i1 +] def +/_render -1 def +/_shift [0 0] def +/_ax 0 def +/_ay 0 def +/_cx 0 def +/_cy 0 def +/_leading +[ +0 0 +] def +/_ctm matrix def +/_mtx matrix def +/_sp 16#020 def +/_hyphen (-) def +/_fontSize 0 def +/_fontAscent 0 def +/_fontDescent 0 def +/_fontHeight 0 def +/_fontRotateAdjust 0 def +/Ss 256 string def +Ss 0 (fonts/) putinterval +/_cnt 0 def +/_scale [1 1] def +/_nativeEncoding 0 def +/_useNativeEncoding 0 def +/_tempEncode 0 def +/_pntr 0 def +/_tDict 2 dict def +/_hfname 100 string def +/_hffound false def +/Tx +{ +} def +/Tj +{ +} def +/CRender +{ +} def +/_AI3_savepage +{ +} def +/_gf null def +/_cf 4 array def +/_rgbf 3 array def +/_if null def +/_of false def +/_fc +{ +} def +/_gs null def +/_cs 4 array def +/_rgbs 3 array def +/_is null def +/_os false def +/_sc +{ +} def +/_pd 1 dict def +/_ed 15 dict def +/_pm matrix def +/_fm null def +/_fd null def +/_fdd null def +/_sm null def +/_sd null def +/_sdd null def +/_i null def +/_lobyte 0 def +/_hibyte 0 def +/_cproc null def +/_cscript 0 def +/_hvax 0 def +/_hvay 0 def +/_hvwb 0 def +/_hvcx 0 def +/_hvcy 0 def +/_bitfont null def +/_bitlobyte 0 def +/_bithibyte 0 def +/_bitkey null def +/_bitdata null def +/_bitindex 0 def +/discardSave null def +/buffer 256 string def +/beginString null def +/endString null def +/endStringLength null def +/layerCnt 1 def +/layerCount 1 def +/perCent (%) 0 get def +/perCentSeen? false def +/newBuff null def +/newBuffButFirst null def +/newBuffLast null def +/clipForward? false def +end +userdict /Adobe_Illustrator_AI5 known not { + userdict /Adobe_Illustrator_AI5 95 dict put +} if +userdict /Adobe_Illustrator_AI5 get begin +/initialize +{ + Adobe_Illustrator_AI5 dup begin + Adobe_Illustrator_AI5_vars begin + discardDict + { + bind pop pop + } forall + dup /nc get begin + { + dup xcheck 1 index type /operatortype ne and + { + bind + } if + pop pop + } forall + end + newpath +} def +/terminate +{ + end + end +} def +/_ +null def +/ddef +{ + Adobe_Illustrator_AI5_vars 3 1 roll put +} def +/xput +{ + dup load dup length exch maxlength eq + { + dup dup load dup + length 2 mul dict copy def + } if + load begin + def + end +} def +/npop +{ + { + pop + } repeat +} def +/hswj +{ + dup stringwidth 3 2 roll + { + _hvwb eq { exch _hvcx add exch _hvcy add } if + exch _hvax add exch _hvay add + } cforall +} def +/vswj +{ + 0 0 3 -1 roll + { + dup 255 le + _charorientation 1 eq + and + { + dup cstring stringwidth 5 2 roll + _hvwb eq { exch _hvcy sub exch _hvcx sub } if + exch _hvay sub exch _hvax sub + 4 -1 roll sub exch + 3 -1 roll sub exch + } + { + _hvwb eq { exch _hvcy sub exch _hvcx sub } if + exch _hvay sub exch _hvax sub + _fontHeight sub + } ifelse + } cforall +} def +/swj +{ + 6 1 roll + /_hvay exch ddef + /_hvax exch ddef + /_hvwb exch ddef + /_hvcy exch ddef + /_hvcx exch ddef + _lineorientation 0 eq { hswj } { vswj } ifelse +} def +/sw +{ + 0 0 0 6 3 roll swj +} def +/vjss +{ + 4 1 roll + { + dup cstring + dup length 1 eq + _charorientation 1 eq + and + { + -90 rotate + currentpoint + _fontRotateAdjust add + moveto + gsave + false charpath currentpoint + 5 index setmatrix stroke + grestore + _fontRotateAdjust sub + moveto + _sp eq + { + 5 index 5 index rmoveto + } if + 2 copy rmoveto + 90 rotate + } + { + currentpoint + _fontHeight sub + 5 index sub + 3 index _sp eq + { + 9 index sub + } if + + currentpoint + exch 4 index stringwidth pop 2 div sub + exch _fontAscent sub + moveto + + gsave + 2 index false charpath + 6 index setmatrix stroke + grestore + + moveto pop pop + } ifelse + } cforall + 6 npop +} def +/hjss +{ + 4 1 roll + { + dup cstring + gsave + false charpath currentpoint + 5 index setmatrix stroke + grestore + moveto + _sp eq + { + 5 index 5 index rmoveto + } if + 2 copy rmoveto + } cforall + 6 npop +} def +/jss +{ + _lineorientation 0 eq { hjss } { vjss } ifelse +} def +/ss +{ + 0 0 0 7 3 roll jss +} def +/vjsp +{ + 4 1 roll + { + dup cstring + dup length 1 eq + _charorientation 1 eq + and + { + -90 rotate + currentpoint + _fontRotateAdjust add + moveto + false charpath + currentpoint + _fontRotateAdjust sub + moveto + _sp eq + { + 5 index 5 index rmoveto + } if + 2 copy rmoveto + 90 rotate + } + { + currentpoint + _fontHeight sub + 5 index sub + 3 index _sp eq + { + 9 index sub + } if + + currentpoint + exch 4 index stringwidth pop 2 div sub + exch _fontAscent sub + moveto + + 2 index false charpath + + moveto pop pop + } ifelse + } cforall + 6 npop +} def +/hjsp +{ + 4 1 roll + { + dup cstring + false charpath + _sp eq + { + 5 index 5 index rmoveto + } if + 2 copy rmoveto + } cforall + 6 npop +} def +/jsp +{ + matrix currentmatrix + _lineorientation 0 eq {hjsp} {vjsp} ifelse +} def +/sp +{ + matrix currentmatrix + 0 0 0 7 3 roll + _lineorientation 0 eq {hjsp} {vjsp} ifelse +} def +/pl +{ + transform + 0.25 sub round 0.25 add exch + 0.25 sub round 0.25 add exch + itransform +} def +/setstrokeadjust where +{ + pop true setstrokeadjust + /c + { + curveto + } def + /C + /c load def + /v + { + currentpoint 6 2 roll curveto + } def + /V + /v load def + /y + { + 2 copy curveto + } def + /Y + /y load def + /l + { + lineto + } def + /L + /l load def + /m + { + moveto + } def +} +{ + /c + { + pl curveto + } def + /C + /c load def + /v + { + currentpoint 6 2 roll pl curveto + } def + /V + /v load def + /y + { + pl 2 copy curveto + } def + /Y + /y load def + /l + { + pl lineto + } def + /L + /l load def + /m + { + pl moveto + } def +} ifelse +/d +{ + setdash +} def +/cf +{ +} def +/i +{ + dup 0 eq + { + pop cf + } if + setflat +} def +/j +{ + setlinejoin +} def +/J +{ + setlinecap +} def +/M +{ + setmiterlimit +} def +/w +{ + setlinewidth +} def +/XR +{ + 0 ne + /_eo exch ddef +} def +/H +{ +} def +/h +{ + closepath +} def +/N +{ + _pola 0 eq + { + _doClip 1 eq + { + _eo {eoclip} {clip} ifelse /_doClip 0 ddef + } if + newpath + } + { + /CRender + { + N + } ddef + } ifelse +} def +/n +{ + N +} def +/F +{ + _pola 0 eq + { + _doClip 1 eq + { + gsave _pf grestore _eo {eoclip} {clip} ifelse newpath /_lp /none ddef _fc + /_doClip 0 ddef + } + { + _pf + } ifelse + } + { + /CRender + { + F + } ddef + } ifelse +} def +/f +{ + closepath + F +} def +/S +{ + _pola 0 eq + { + _doClip 1 eq + { + gsave _ps grestore _eo {eoclip} {clip} ifelse newpath /_lp /none ddef _sc + /_doClip 0 ddef + } + { + _ps + } ifelse + } + { + /CRender + { + S + } ddef + } ifelse +} def +/s +{ + closepath + S +} def +/B +{ + _pola 0 eq + { + _doClip 1 eq + gsave F grestore + { + gsave S grestore _eo {eoclip} {clip} ifelse newpath /_lp /none ddef _sc + /_doClip 0 ddef + } + { + S + } ifelse + } + { + /CRender + { + B + } ddef + } ifelse +} def +/b +{ + closepath + B +} def +/W +{ + /_doClip 1 ddef +} def +/* +{ + count 0 ne + { + dup type /stringtype eq + { + pop + } if + } if + newpath +} def +/u +{ +} def +/U +{ +} def +/q +{ + _pola 0 eq + { + gsave + } if +} def +/Q +{ + _pola 0 eq + { + grestore + } if +} def +/*u +{ + _pola 1 add /_pola exch ddef +} def +/*U +{ + _pola 1 sub /_pola exch ddef + _pola 0 eq + { + CRender + } if +} def +/D +{ + pop +} def +/*w +{ +} def +/*W +{ +} def +/` +{ + /_i save ddef + clipForward? + { + nulldevice + } if + 6 1 roll 4 npop + concat pop + userdict begin + /showpage + { + } def + 0 setgray + 0 setlinecap + 1 setlinewidth + 0 setlinejoin + 10 setmiterlimit + [] 0 setdash + /setstrokeadjust where {pop false setstrokeadjust} if + newpath + 0 setgray + false setoverprint +} def +/~ +{ + end + _i restore +} def +/O +{ + 0 ne + /_of exch ddef + /_lp /none ddef +} def +/R +{ + 0 ne + /_os exch ddef + /_lp /none ddef +} def +/g +{ + /_gf exch ddef + /_fc + { + _lp /fill ne + { + _of setoverprint + _gf setgray + /_lp /fill ddef + } if + } ddef + /_pf + { + _fc + _eo {eofill} {fill} ifelse + } ddef + /_psf + { + _fc + hvashow + } ddef + /_pjsf + { + _fc + hvawidthshow + } ddef + /_lp /none ddef +} def +/G +{ + /_gs exch ddef + /_sc + { + _lp /stroke ne + { + _os setoverprint + _gs setgray + /_lp /stroke ddef + } if + } ddef + /_ps + { + _sc + stroke + } ddef + /_pss + { + _sc + ss + } ddef + /_pjss + { + _sc + jss + } ddef + /_lp /none ddef +} def +/k +{ + _cf astore pop + /_fc + { + _lp /fill ne + { + _of setoverprint + _cf aload pop setcmykcolor + /_lp /fill ddef + } if + } ddef + /_pf + { + _fc + _eo {eofill} {fill} ifelse + } ddef + /_psf + { + _fc + hvashow + } ddef + /_pjsf + { + _fc + hvawidthshow + } ddef + /_lp /none ddef +} def +/K +{ + _cs astore pop + /_sc + { + _lp /stroke ne + { + _os setoverprint + _cs aload pop setcmykcolor + /_lp /stroke ddef + } if + } ddef + /_ps + { + _sc + stroke + } ddef + /_pss + { + _sc + ss + } ddef + /_pjss + { + _sc + jss + } ddef + /_lp /none ddef +} def +/Xa +{ + _rgbf astore pop + /_fc + { + _lp /fill ne + { + _of setoverprint + _rgbf aload pop setrgbcolor + /_lp /fill ddef + } if + } ddef + /_pf + { + _fc + _eo {eofill} {fill} ifelse + } ddef + /_psf + { + _fc + hvashow + } ddef + /_pjsf + { + _fc + hvawidthshow + } ddef + /_lp /none ddef +} def +/XA +{ + _rgbs astore pop + /_sc + { + _lp /stroke ne + { + _os setoverprint + _rgbs aload pop setrgbcolor + /_lp /stroke ddef + } if + } ddef + /_ps + { + _sc + stroke + } ddef + /_pss + { + _sc + ss + } ddef + /_pjss + { + _sc + jss + } ddef + /_lp /none ddef +} def +/_rgbtocmyk +{ +3 + { + 1 exch sub 3 1 roll + } repeat +3 copy 1 4 1 roll +3 + { + 3 index 2 copy gt + { + exch + } if + pop 4 1 roll + } repeat +pop pop pop +4 1 roll +3 + { + 3 index sub + 3 1 roll + } repeat +4 -1 roll +} def +/Xx +{ + exch + /_gf exch ddef + 0 eq + { + findcmykcustomcolor + } + { + /findrgbcustomcolor where not { + 4 1 roll _rgbtocmyk + 5 -1 roll + findcmykcustomcolor + } + { + pop + findrgbcustomcolor + } ifelse + } ifelse + /_if exch ddef + /_fc + { + _lp /fill ne + { + _of setoverprint + _if _gf 1 exch sub setcustomcolor + /_lp /fill ddef + } if + } ddef + /_pf + { + _fc + _eo {eofill} {fill} ifelse + } ddef + /_psf + { + _fc + hvashow + } ddef + /_pjsf + { + _fc + hvawidthshow + } ddef + /_lp /none ddef +} def +/XX +{ + exch + /_gs exch ddef + 0 eq + { + findcmykcustomcolor + } + { + /findrgbcustomcolor where not { + 4 1 roll _rgbtocmyk + 5 -1 roll + findcmykcustomcolor + } + { + pop + findrgbcustomcolor + } ifelse + } ifelse + /_is exch ddef + /_sc + { + _lp /stroke ne + { + _os setoverprint + _is _gs 1 exch sub setcustomcolor + /_lp /stroke ddef + } if + } ddef + /_ps + { + _sc + stroke + } ddef + /_pss + { + _sc + ss + } ddef + /_pjss + { + _sc + jss + } ddef + /_lp /none ddef +} def +/x +{ + /_gf exch ddef + findcmykcustomcolor + /_if exch ddef + /_fc + { + _lp /fill ne + { + _of setoverprint + _if _gf 1 exch sub setcustomcolor + /_lp /fill ddef + } if + } ddef + /_pf + { + _fc + _eo {eofill} {fill} ifelse + } ddef + /_psf + { + _fc + hvashow + } ddef + /_pjsf + { + _fc + hvawidthshow + } ddef + /_lp /none ddef +} def +/X +{ + /_gs exch ddef + findcmykcustomcolor + /_is exch ddef + /_sc + { + _lp /stroke ne + { + _os setoverprint + _is _gs 1 exch sub setcustomcolor + /_lp /stroke ddef + } if + } ddef + /_ps + { + _sc + stroke + } ddef + /_pss + { + _sc + ss + } ddef + /_pjss + { + _sc + jss + } ddef + /_lp /none ddef +} def +/A +{ + pop +} def +/annotatepage +{ +userdict /annotatepage 2 copy known {get exec} {pop pop} ifelse +} def +/XT { + pop pop +} def +/discard +{ + save /discardSave exch store + discardDict begin + /endString exch store + gt38? + { + 2 add + } if + load + stopped + pop + end + discardSave restore +} bind def +userdict /discardDict 7 dict dup begin +put +/pre38Initialize +{ + /endStringLength endString length store + /newBuff buffer 0 endStringLength getinterval store + /newBuffButFirst newBuff 1 endStringLength 1 sub getinterval store + /newBuffLast newBuff endStringLength 1 sub 1 getinterval store +} def +/shiftBuffer +{ + newBuff 0 newBuffButFirst putinterval + newBuffLast 0 + currentfile read not + { + stop + } if + put +} def +0 +{ + pre38Initialize + mark + currentfile newBuff readstring exch pop + { + { + newBuff endString eq + { + cleartomark stop + } if + shiftBuffer + } loop + } + { + stop + } ifelse +} def +1 +{ + pre38Initialize + /beginString exch store + mark + currentfile newBuff readstring exch pop + { + { + newBuff beginString eq + { + /layerCount dup load 1 add store + } + { + newBuff endString eq + { + /layerCount dup load 1 sub store + layerCount 0 eq + { + cleartomark stop + } if + } if + } ifelse + shiftBuffer + } loop + } if +} def +2 +{ + mark + { + currentfile buffer readline not + { + stop + } if + endString eq + { + cleartomark stop + } if + } loop +} def +3 +{ + /beginString exch store + /layerCnt 1 store + mark + { + currentfile buffer readline not + { + stop + } if + dup beginString eq + { + pop /layerCnt dup load 1 add store + } + { + endString eq + { + layerCnt 1 eq + { + cleartomark stop + } + { + /layerCnt dup load 1 sub store + } ifelse + } if + } ifelse + } loop +} def +end +userdict /clipRenderOff 15 dict dup begin +put +{ + /n /N /s /S /f /F /b /B +} +{ + { + _doClip 1 eq + { + /_doClip 0 ddef _eo {eoclip} {clip} ifelse + } if + newpath + } def +} forall +/Tr /pop load def +/Bb {} def +/BB /pop load def +/Bg {12 npop} def +/Bm {6 npop} def +/Bc /Bm load def +/Bh {4 npop} def +end +/Lb +{ + 4 npop + 6 1 roll + pop + 4 1 roll + pop pop pop + 0 eq + { + 0 eq + { + (%AI5_BeginLayer) 1 (%AI5_EndLayer--) discard + } + { + + /clipForward? true def + + /Tx /pop load def + /Tj /pop load def + + currentdict end clipRenderOff begin begin + } ifelse + } + { + 0 eq + { + save /discardSave exch store + } if + } ifelse +} bind def +/LB +{ + discardSave dup null ne + { + restore + } + { + pop + clipForward? + { + currentdict + end + end + begin + + /clipForward? false ddef + } if + } ifelse +} bind def +/Pb +{ + pop pop + 0 (%AI5_EndPalette) discard +} bind def +/Np +{ + 0 (%AI5_End_NonPrinting--) discard +} bind def +/Ln /pop load def +/Ap +/pop load def +/Ar +{ + 72 exch div + 0 dtransform dup mul exch dup mul add sqrt + dup 1 lt + { + pop 1 + } if + setflat +} def +/Mb +{ + q +} def +/Md +{ +} def +/MB +{ + Q +} def +/nc 4 dict def +nc begin +/setgray +{ + pop +} bind def +/setcmykcolor +{ + 4 npop +} bind def +/setrgbcolor +{ + 3 npop +} bind def +/setcustomcolor +{ + 2 npop +} bind def +currentdict readonly pop +end +end +setpacking +%%EndResource +%%BeginResource: procset Adobe_cshow 2.0 8 +%%Title: (Writing System Operators) +%%Version: 2.0 8 +%%CreationDate: (1/23/89) () +%%Copyright: ((C) 1992-1996 Adobe Systems Incorporated All Rights Reserved) +currentpacking true setpacking +userdict /Adobe_cshow 14 dict dup begin put +/initialize +{ + Adobe_cshow begin + Adobe_cshow + { + dup xcheck + { + bind + } if + pop pop + } forall + end + Adobe_cshow begin +} def +/terminate +{ +currentdict Adobe_cshow eq + { + end + } if +} def +/cforall +{ + /_lobyte 0 ddef + /_hibyte 0 ddef + /_cproc exch ddef + /_cscript currentfont /FontScript known { currentfont /FontScript get } { -1 } ifelse ddef + { + /_lobyte exch ddef + _hibyte 0 eq + _cscript 1 eq + _lobyte 129 ge _lobyte 159 le and + _lobyte 224 ge _lobyte 252 le and or and + _cscript 2 eq + _lobyte 161 ge _lobyte 254 le and and + _cscript 3 eq + _lobyte 161 ge _lobyte 254 le and and + _cscript 25 eq + _lobyte 161 ge _lobyte 254 le and and + _cscript -1 eq + or or or or and + { + /_hibyte _lobyte ddef + } + { + _hibyte 256 mul _lobyte add + _cproc + /_hibyte 0 ddef + } ifelse + } forall +} def +/cstring +{ + dup 256 lt + { + (s) dup 0 4 3 roll put + } + { + dup 256 idiv exch 256 mod + (hl) dup dup 0 6 5 roll put 1 4 3 roll put + } ifelse +} def +/clength +{ + 0 exch + { 256 lt { 1 } { 2 } ifelse add } cforall +} def +/hawidthshow +{ + { + dup cstring + show + _hvax _hvay rmoveto + _hvwb eq { _hvcx _hvcy rmoveto } if + } cforall +} def +/vawidthshow +{ + { + dup 255 le + _charorientation 1 eq + and + { + -90 rotate + 0 _fontRotateAdjust rmoveto + cstring + _hvcx _hvcy _hvwb _hvax _hvay 6 -1 roll awidthshow + 0 _fontRotateAdjust neg rmoveto + 90 rotate + } + { + currentpoint + _fontHeight sub + exch _hvay sub exch _hvax sub + 2 index _hvwb eq { exch _hvcy sub exch _hvcx sub } if + 3 2 roll + cstring + dup stringwidth pop 2 div neg _fontAscent neg rmoveto + show + moveto + } ifelse + } cforall +} def +/hvawidthshow +{ + 6 1 roll + /_hvay exch ddef + /_hvax exch ddef + /_hvwb exch ddef + /_hvcy exch ddef + /_hvcx exch ddef + _lineorientation 0 eq { hawidthshow } { vawidthshow } ifelse +} def +/hvwidthshow +{ + 0 0 3 -1 roll hvawidthshow +} def +/hvashow +{ + 0 0 0 6 -3 roll hvawidthshow +} def +/hvshow +{ + 0 0 0 0 0 6 -1 roll hvawidthshow +} def +currentdict readonly pop end +setpacking +%%EndResource +%%EndProlog +%%BeginSetup +Adobe_level2_AI5 /initialize get exec +Adobe_cshow /initialize get exec +Adobe_ColorImage_AI6 /initialize get exec +Adobe_Illustrator_AI5 /initialize get exec +%AI5_Begin_NonPrinting +Np +%AI3_BeginPattern: (Arrow1.2.out/in) +(Arrow1.2.out/in) 1 1 39.4039 39.4039 [ +%AI3_Tile +(0 O 0 R 0.75 0.75 0.375 0 k + 0.75 0.75 0.375 0 K +) @ +( +%AI6_BeginPatternLayer +800 Ar +1 J 0 j 1 w 4 M []0 d +%AI3_Note: +0 D +0 XR +33.9039 15.6187 m +39.4247 20.202 L +39.4247 20.202 L +33.8869 24.6252 L +S +39.2997 20.202 m +24.5706 20.202 l +20.4039 20.4792 20.4039 16.8125 v +20.4039 13.1458 20.4039 12.5625 y +S +%AI6_EndPatternLayer +) & +] E +%AI3_EndPattern +%AI3_BeginPattern: (Arrow1.2.side) +(Arrow1.2.side) 1 1 39.404 39.4039 [ +%AI3_Tile +(0 O 0 R 0.75 0.75 0.375 0 k + 0.75 0.75 0.375 0 K +) @ +( +%AI6_BeginPatternLayer +800 Ar +1 J 0 j 1 w 4 M []0 d +%AI3_Note: +0 D +0 XR +20.202 20.202 m +39.404 20.202 l +S +33.904 15.6187 m +39.4248 20.202 L +39.4248 20.202 L +33.887 24.6252 L +S +%AI6_EndPatternLayer +) & +] E +%AI3_EndPattern +%AI3_BeginPattern: (Bricks) +(Bricks) 1.6 1.6 73.6 73.6 [ +%AI3_Tile +(0 O 0 R 0.3 0.85 0.85 0 k + 0.3 0.85 0.85 0 K +) @ +( +%AI6_BeginPatternLayer +800 Ar +0 J 0 j 1 w 4 M []0 d +%AI3_Note: +0 D +0 XR +1.6 1.6 m +1.6 73.6 L +73.6 73.6 L +73.6 1.6 L +1.6 1.6 L +f +%AI6_EndPatternLayer +) & +(0 O 0 R 1 g + 1 G +) @ +( +%AI6_BeginPatternLayer +800 Ar +0 J 0 j 0.3 w 4 M []0 d +%AI3_Note: +0 D +0 XR +1.6 70.01 m +73.6 70.01 l +S +1.6 62.809 m +73.6 62.809 L +S +1.6 55.609 m +73.6 55.609 L +S +1.6 48.408 m +73.6 48.408 L +S +1.6 41.208 m +73.6 41.208 L +S +1.6 34.007 m +73.6 34.007 L +S +1.6 26.807 m +73.6 26.807 L +S +1.6 19.606 m +73.6 19.606 L +S +1.6 12.406 m +73.6 12.406 L +S +1.6 5.206 m +73.6 5.206 L +S +70.01 70.01 m +70.01 62.822 l +S +55.61 70.01 m +55.61 62.822 L +S +41.21 70.01 m +41.21 62.822 L +S +26.81 70.01 m +26.81 62.822 L +S +12.41 70.01 m +12.41 62.822 L +S +70.01 55.572 m +70.01 48.385 l +S +55.61 55.572 m +55.61 48.385 L +S +41.21 55.572 m +41.21 48.385 L +S +26.81 55.572 m +26.81 48.385 L +S +12.41 55.572 m +12.41 48.385 L +S +70.01 41.197 m +70.01 34.01 l +S +55.61 41.197 m +55.61 34.01 L +S +41.21 41.197 m +41.21 34.01 L +S +26.81 41.197 m +26.81 34.01 L +S +12.41 41.197 m +12.41 34.01 L +S +70.01 26.822 m +70.01 19.635 l +S +55.61 26.822 m +55.61 19.635 L +S +41.21 26.822 m +41.21 19.635 L +S +26.81 26.822 m +26.81 19.635 L +S +12.41 26.822 m +12.41 19.635 L +S +70.01 12.385 m +70.01 5.197 l +S +55.61 12.385 m +55.61 5.197 L +S +41.21 12.385 m +41.21 5.197 L +S +26.81 12.385 m +26.81 5.197 L +S +12.41 12.385 m +12.41 5.197 L +S +62.797 5.197 m +62.797 1.6 L +S +48.397 5.197 m +48.397 1.6 L +S +33.997 5.197 m +33.997 1.6 L +S +19.597 5.197 m +19.597 1.6 L +S +5.197 5.197 m +5.197 1.6 l +S +62.797 19.635 m +62.797 12.447 L +S +48.397 19.635 m +48.397 12.447 L +S +33.997 19.635 m +33.997 12.447 L +S +19.597 19.635 m +19.597 12.447 L +S +5.197 19.635 m +5.197 12.447 l +S +62.797 34.01 m +62.797 26.822 L +S +48.397 34.01 m +48.397 26.822 L +S +19.597 34.01 m +19.597 26.822 L +S +5.197 34.01 m +5.197 26.822 l +S +62.797 48.385 m +62.797 41.197 L +S +48.397 48.385 m +48.397 41.197 L +S +33.997 48.385 m +33.997 41.197 L +S +19.597 48.385 m +19.597 41.197 L +S +5.197 48.385 m +5.197 41.197 l +S +62.797 62.822 m +62.797 55.635 L +S +48.397 62.822 m +48.397 55.635 L +S +33.997 62.822 m +33.997 55.635 L +S +19.597 62.822 m +19.597 55.635 L +S +5.197 62.822 m +5.197 55.635 l +S +62.797 73.5589 m +62.797 70.072 L +S +48.397 73.5589 m +48.397 70.072 L +S +33.997 73.5589 m +33.997 70.072 L +S +19.597 73.5589 m +19.597 70.072 L +S +5.197 73.5589 m +5.197 70.072 l +S +33.997 34.01 m +33.997 26.822 L +S +%AI6_EndPatternLayer +) & +] E +%AI3_EndPattern +%AI3_BeginPattern: (Checks) +(Checks) 1 1 31.3995 31.3995 [ +%AI3_Tile +(0 O 0 R 0 0.9 1 0 k + 0 0.9 1 0 K +) @ +( +%AI6_BeginPatternLayer +800 Ar +0 J 0 j 1 w 4 M []0 d +%AI3_Note: +0 D +1 XR +19.9995 4.8 m +27.5995 4.8 L +27.5995 12.3995 L +19.9995 12.3995 L +19.9995 4.8 L +f +31.3995 27.5995 m +31.3995 31.3995 L +27.5995 31.3995 L +27.5995 27.5995 L +31.3995 27.5995 L +f +19.9995 27.5995 m +19.9995 19.9995 L +27.5995 19.9995 L +27.5995 27.5995 L +19.9995 27.5995 L +f +0 XR +12.3995 12.3995 m +19.9995 12.3995 L +19.9995 19.9995 L +12.3995 19.9995 L +12.3995 12.3995 L +f +1 XR +12.3995 27.5995 m +4.8 27.5995 L +4.8 19.9995 L +12.3995 19.9995 L +12.3995 27.5995 L +f +4.8 12.3995 m +4.8 4.8 L +12.3995 4.8 L +12.3995 12.3995 L +4.8 12.3995 L +f +19.9995 27.5995 m +19.9995 31.3995 L +12.3995 31.3995 L +12.3995 27.5995 L +19.9995 27.5995 L +f +12.3995 4.8 m +12.3995 1 L +19.9995 1 L +19.9995 4.8 L +12.3995 4.8 L +f +4.8 19.9995 m +1 19.9995 L +1 12.3995 L +4.8 12.3995 L +4.8 19.9995 L +f +27.5995 19.9995 m +27.5995 12.3995 L +31.3995 12.3995 L +31.3995 19.9995 L +27.5995 19.9995 L +f +4.8 31.3995 m +1 31.3995 L +1 27.5995 L +4.8 27.5995 L +4.8 31.3995 L +f +27.5995 1 m +31.3995 1 L +31.3995 4.8 L +27.5995 4.8 L +27.5995 1 L +f +1 4.8 m +1 1 L +4.8 1 L +4.8 4.8 L +1 4.8 L +f +%AI6_EndPatternLayer +) & +(0 O 0 R 0 0.05 0.2 0 k + 0 0.05 0.2 0 K +) @ +( +%AI6_BeginPatternLayer +800 Ar +0 J 0 j 1 w 4 M []0 d +%AI3_Note: +0 D +1 XR +4.8 4.8 m +4.8 1 L +12.3995 1 L +12.3995 4.8 L +4.8 4.8 L +f +4.8 12.3995 m +1 12.3995 L +1 4.8 L +4.8 4.8 L +4.8 12.3995 L +f +19.9995 4.8 m +19.9995 1 L +27.5995 1 L +27.5995 4.8 L +19.9995 4.8 L +f +12.3995 12.3995 m +12.3995 4.8 L +19.9995 4.8 L +19.9995 12.3995 L +12.3995 12.3995 L +f +27.5995 4.8 m +31.3995 4.8 L +31.3995 12.3995 L +27.5995 12.3995 L +27.5995 4.8 L +f +12.3995 19.9995 m +4.8 19.9995 L +4.8 12.3995 L +12.3995 12.3995 L +12.3995 19.9995 L +f +4.8 27.5995 m +1 27.5995 L +1 19.9995 L +4.8 19.9995 L +4.8 27.5995 L +f +19.9995 12.3995 m +27.5995 12.3995 L +27.5995 19.9995 L +19.9995 19.9995 L +19.9995 12.3995 L +f +19.9995 19.9995 m +19.9995 27.5995 L +12.3995 27.5995 L +12.3995 19.9995 L +19.9995 19.9995 L +f +27.5995 19.9995 m +31.3995 19.9995 L +31.3995 27.5995 L +27.5995 27.5995 L +27.5995 19.9995 L +f +12.3995 27.5995 m +12.3995 31.3995 L +4.8 31.3995 L +4.8 27.5995 L +12.3995 27.5995 L +f +27.5995 27.5995 m +27.5995 31.3995 L +19.9995 31.3995 L +19.9995 27.5995 L +27.5995 27.5995 L +f +%AI6_EndPatternLayer +) & +] E +%AI3_EndPattern +%AI3_BeginPattern: (Confetti) +(Confetti) 4.85 3.617 76.85 75.617 [ +%AI3_Tile +(0 O 0 R 1 g + 1 G +) @ +( +%AI6_BeginPatternLayer +800 Ar +0 J 0 j 1 w 4 M []0 d +%AI3_Note: +0 D +0 XR +4.85 3.617 m +4.85 75.617 L +76.85 75.617 L +76.85 3.617 L +4.85 3.617 L +f +%AI6_EndPatternLayer +) & +(0 O 0 R 0 g + 0 G +) @ +( +%AI6_BeginPatternLayer +800 Ar +0 J 0 j 0.3 w 4 M []0 d +%AI3_Note: +0 D +0 XR +10.6 64.867 m +7.85 62.867 l +S +9.1 8.617 m +6.85 6.867 l +S +78.1 68.617 m +74.85 67.867 l +S +76.85 56.867 m +74.35 55.117 l +S +79.6 51.617 m +76.6 51.617 l +S +76.35 44.117 m +73.6 45.867 l +S +78.6 35.867 m +76.6 34.367 l +S +76.1 23.867 m +73.35 26.117 l +S +78.1 12.867 m +73.85 13.617 l +S +68.35 14.617 m +66.1 12.867 l +S +76.6 30.617 m +73.6 30.617 l +S +62.85 58.117 m +60.956 60.941 l +S +32.85 59.617 m +31.196 62.181 l +S +47.891 64.061 m +49.744 66.742 l +S +72.814 2.769 m +73.928 5.729 l +S +67.976 2.633 m +67.35 5.909 l +S +61.85 27.617 m +59.956 30.441 l +S +53.504 56.053 m +51.85 58.617 l +S +52.762 1.779 m +52.876 4.776 l +S +45.391 5.311 m +47.244 7.992 l +S +37.062 3.375 m +35.639 5.43 l +S +55.165 34.828 m +57.518 37.491 l +S +20.795 3.242 m +22.12 5.193 l +S +14.097 4.747 m +15.008 8.965 l +S +9.736 1.91 m +8.073 4.225 l +S +31.891 5.573 m +32.005 8.571 l +S +12.1 70.367 m +15.6 68.867 l +S +9.35 54.867 m +9.6 58.117 l +S +12.85 31.867 m +14.35 28.117 l +S +10.1 37.367 m +12.35 41.117 l +S +34.1 71.117 m +31.85 68.617 l +S +38.35 71.117 m +41.6 68.367 l +S +55.1 71.117 m +58.35 69.117 l +S +57.35 65.117 m +55.35 61.867 l +S +64.35 66.367 m +69.35 68.617 l +S +71.85 62.867 m +69.35 61.117 l +S +23.6 70.867 m +23.6 67.867 l +S +20.6 65.867 m +17.35 65.367 l +S +24.85 61.367 m +25.35 58.117 l +S +25.85 65.867 m +29.35 66.617 l +S +14.1 54.117 m +16.85 56.117 l +S +12.35 11.617 m +12.6 15.617 l +S +12.1 19.867 m +14.35 22.367 l +S +26.1 9.867 m +23.6 13.367 l +S +34.6 47.117 m +32.1 45.367 l +S +62.6 41.867 m +59.85 43.367 l +S +31.6 35.617 m +27.85 36.367 l +S +36.35 26.117 m +34.35 24.617 l +S +33.85 14.117 m +31.1 16.367 l +S +37.1 9.867 m +35.1 11.117 l +S +34.35 20.867 m +31.35 20.867 l +S +44.6 56.617 m +42.1 54.867 l +S +47.35 51.367 m +44.35 51.367 l +S +44.1 43.867 m +41.35 45.617 l +S +43.35 33.117 m +42.6 30.617 l +S +43.85 23.617 m +41.1 25.867 l +S +44.35 15.617 m +42.35 16.867 l +S +67.823 31.1 m +64.823 31.1 l +S +27.1 32.617 m +29.6 30.867 l +S +31.85 55.117 m +34.85 55.117 l +S +19.6 40.867 m +22.1 39.117 l +S +16.85 35.617 m +19.85 35.617 l +S +20.1 28.117 m +22.85 29.867 l +S +52.1 42.617 m +54.484 44.178 l +S +52.437 50.146 m +54.821 48.325 l +S +59.572 54.133 m +59.35 51.117 l +S +50.185 10.055 m +53.234 9.928 l +S +51.187 15.896 m +53.571 14.075 l +S +58.322 19.883 m +59.445 16.823 l +S +53.1 32.117 m +50.6 30.367 l +S +52.85 24.617 m +49.6 25.617 l +S +61.85 9.117 m +59.1 10.867 l +S +69.35 34.617 m +66.6 36.367 l +S +67.1 23.617 m +65.1 22.117 l +S +24.435 46.055 m +27.484 45.928 l +S +25.437 51.896 m +27.821 50.075 l +S +62.6 47.117 m +65.321 46.575 l +S +19.85 19.867 m +20.35 16.617 l +S +21.85 21.867 m +25.35 22.617 l +S +37.6 62.867 m +41.6 62.117 l +S +38.323 42.1 m +38.823 38.6 l +S +69.35 52.617 m +66.85 53.867 l +S +14.85 62.117 m +18.1 59.367 l +S +9.6 46.117 m +7.1 44.367 l +S +20.6 51.617 m +18.6 50.117 l +S +46.141 70.811 m +47.994 73.492 l +S +69.391 40.561 m +71.244 43.242 l +S +38.641 49.311 m +39.35 52.117 l +S +25.141 16.811 m +25.85 19.617 l +S +36.6 32.867 m +34.6 31.367 l +S +6.1 68.617 m +2.85 67.867 l +S +4.85 56.867 m +2.35 55.117 l +S +7.6 51.617 m +4.6 51.617 l +S +6.6 35.867 m +4.6 34.367 l +S +6.1 12.867 m +1.85 13.617 l +S +4.6 30.617 m +1.6 30.617 l +S +72.814 74.769 m +73.928 77.729 l +S +67.976 74.633 m +67.35 77.909 l +S +52.762 73.779 m +52.876 76.776 l +S +37.062 75.375 m +35.639 77.43 l +S +20.795 75.242 m +22.12 77.193 l +S +9.736 73.91 m +8.073 76.225 l +S +10.1 23.617 m +6.35 24.367 l +S +73.217 18.276 m +71.323 21.1 l +S +28.823 39.6 m +29.505 42.389 l +S +49.6 38.617 m +47.6 37.117 l +S +60.323 73.6 m +62.323 76.6 l +S +60.323 1.6 m +62.323 4.6 l +S +%AI6_EndPatternLayer +) & +] E +%AI3_EndPattern +%AI3_BeginPattern: (DblLine1.2.inner) +(DblLine1.2.inner) 1 1 39.2705 39.2706 [ +%AI3_Tile +(0 O 0 R 1 0.14 0.09 0 k + 1 0.14 0.09 0 K +) @ +( +%AI6_BeginPatternLayer +800 Ar +0 J 0 j 1 w 4 M []0 d +%AI3_Note: +0 D +0 XR +39.2702 22.175 m +39.2702 13.6108 L +26.66 13.6108 L +26.66 1.0003 L +18.0958 1.0003 L +18.0948 22.175 L +18.0958 22.175 L +18.0958 22.1752 L +39.2702 22.175 L +f +39.2708 24.6929 m +15.5779 24.6929 L +15.5779 1.0003 L +14.9037 1.0003 L +14.9032 25.3675 L +39.2708 25.3675 L +39.2708 24.6929 L +f +%AI6_EndPatternLayer +) & +] E +%AI3_EndPattern +%AI3_BeginPattern: (DblLine1.2.outer) +(DblLine1.2.outer) 1 1.0003 39.2706 39.271 [ +%AI3_Tile +(0 O 0 R 1 0.14 0.09 0 k + 1 0.14 0.09 0 K +) @ +( +%AI6_BeginPatternLayer +800 Ar +0 J 0 j 0.3 w 4 M []0 d +%AI3_Note: +0 D +0 XR +39.2708 26.6602 m +13.6111 26.6602 L +13.6111 1.0005 L +22.1751 1 L +22.1751 18.096 L +39.2708 18.096 L +39.2708 26.6602 L +f +39.2708 15.578 m +24.6928 15.578 L +24.6928 1 L +25.367 1 L +25.367 14.9038 L +39.2708 14.9038 L +39.2708 15.578 L +f +%AI6_EndPatternLayer +) & +] E +%AI3_EndPattern +%AI3_BeginPattern: (DblLine1.2.side) +(DblLine1.2.side) 1 1 39.2706 39.2706 [ +%AI3_Tile +(0 O 0 R 1 0.14 0.09 0 k + 1 0.14 0.09 0 K +) @ +( +%AI6_BeginPatternLayer +800 Ar +0 J 0 j 0.3 w 4 M []0 d +%AI3_Note: +0 D +0 XR +39.2704 18.0958 m +39.2704 26.6598 L +1.0001 26.6598 L +1.0001 18.0958 L +39.2704 18.0958 L +f +39.2704 14.9037 m +39.2704 15.5776 L +1.0001 15.5776 L +1.0001 14.9037 L +39.2704 14.9037 L +f +%AI6_EndPatternLayer +) & +] E +%AI3_EndPattern +%AI3_BeginPattern: (Diamonds) +(Diamonds) 1 1 37.1865 41.9411 [ +%AI3_Tile +(0 O 0 R 0.2 0 1 0 k + 0.2 0 1 0 K +) @ +( +%AI6_BeginPatternLayer +800 Ar +0 J 0 j 0.3 w 4 M []0 d +%AI3_Note: +0 D +0 XR +1.0002 1.0004 m +1.0002 41.9411 L +37.1865 41.9411 L +37.1865 1.0004 L +1.0002 1.0004 L +f +%AI6_EndPatternLayer +) & +(0 O 0 R 0 g + 0 G +) @ +( +%AI6_BeginPatternLayer +800 Ar +0 J 0 j 1 w 4 M []0 d +%AI3_Note: +0 D +1 XR +19.0936 41.9408 m +19.0929 41.9408 L +19.0933 41.9402 L +19.0936 41.9408 L +f +7.0311 41.9408 m +7.0304 41.9408 L +7.0308 41.9402 L +7.0311 41.9408 L +f +31.1556 41.9408 m +31.1548 41.9408 L +31.1552 41.9402 L +31.1556 41.9408 L +f +%AI6_EndPatternLayer +) & +(0 O 0 R 0.75 0.9 0 0 k + 0.75 0.9 0 0 K +) @ +( +%AI6_BeginPatternLayer +800 Ar +0 J 0 j 0.3 w 4 M []0 d +%AI3_Note: +0 D +1 XR +37.1865 1 m +37.1865 11.2349 L +31.1552 1 L +37.1865 1 L +f +19.0933 1 m +31.1552 1 L +25.124 11.2349 L +19.0933 1 L +f +7.0308 1 m +19.0933 1 L +13.062 11.2349 L +7.0308 1 L +f +1 1 m +7.0308 1 L +1 11.2349 L +1 1 L +f +37.1859 11.2349 m +37.1865 11.236 L +37.1865 31.7059 L +31.1552 21.4704 L +37.1859 11.2349 L +f +19.0933 21.4704 m +25.124 11.2349 L +31.1552 21.4704 L +25.124 31.7059 L +19.0933 21.4704 L +f +7.0308 21.4704 m +13.062 11.2349 L +19.0933 21.4704 L +13.062 31.7059 L +7.0308 21.4704 L +f +1 31.7059 m +1 11.2349 L +7.0308 21.4704 L +1 31.7059 L +f +37.1859 31.7059 m +37.1865 31.707 L +37.1865 41.9408 L +31.1556 41.9408 L +31.1552 41.9402 L +37.1859 31.7059 L +f +25.124 31.7059 m +31.1552 41.9402 L +31.1548 41.9408 L +19.0936 41.9408 L +19.0933 41.9402 L +25.124 31.7059 L +f +13.062 31.7059 m +19.0933 41.9402 L +19.0929 41.9408 L +7.0311 41.9408 L +7.0308 41.9402 L +13.062 31.7059 L +f +7.0304 41.9408 m +1 41.9408 L +1 31.7059 L +7.0308 41.9402 L +7.0304 41.9408 L +f +%AI6_EndPatternLayer +) & +] E +%AI3_EndPattern +%AI3_BeginPattern: (Hexagon) +(Hexagon) 4 1.6 70.151 77.983 [ +%AI3_Tile +(0 O 0 R 0 1 0.35 0 k + 0 1 0.35 0 K +) @ +( +%AI6_BeginPatternLayer +800 Ar +0 J 0 j 1 w 4 M []0 d +%AI3_Note: +0 D +0 XR +70.151 77.983 m +70.151 1.6 L +4 1.6 L +4 77.983 L +70.151 77.983 L +f +%AI6_EndPatternLayer +) & +(0 O 0 R 0.9921 1 0 0 k + 0.9921 1 0 0 K +) @ +( +%AI6_BeginPatternLayer +800 Ar +0 J 0 j 0.3 w 4 M []0 d +%AI3_Note: +0 D +0 XR +20.538 30.244 m +S +26.05 20.696 m +15.025 20.696 L +9.513 30.244 L +15.025 39.792 L +26.05 39.792 L +31.564 30.244 L +26.05 20.696 L +s +20.537 11.148 m +S +26.05 1.6 m +15.024 1.6 L +9.512 11.148 L +15.024 20.696 L +26.05 20.696 L +31.563 11.148 L +26.05 1.6 L +s +53.614 30.244 m +S +59.126 20.696 m +48.101 20.696 L +42.589 30.244 L +48.101 39.792 L +59.126 39.792 L +64.639 30.244 L +59.126 20.696 L +s +53.614 11.148 m +S +59.126 1.6 m +48.101 1.6 L +42.588 11.148 L +48.101 20.696 L +59.126 20.696 L +64.638 11.148 L +59.126 1.6 L +s +20.538 68.436 m +S +26.051 58.888 m +15.025 58.888 L +9.513 68.436 L +15.025 77.984 L +26.051 77.984 L +31.564 68.436 L +26.051 58.888 L +s +20.538 49.34 m +S +26.051 39.792 m +15.025 39.792 L +9.513 49.34 L +15.025 58.888 L +26.05 58.888 L +31.564 49.34 L +26.051 39.792 L +s +53.614 68.436 m +S +59.127 58.888 m +48.102 58.888 L +42.589 68.436 L +48.101 77.985 L +59.127 77.985 L +64.639 68.436 L +59.127 58.888 L +s +53.614 49.34 m +S +59.127 39.792 m +48.101 39.792 L +42.589 49.34 L +48.101 58.888 L +59.127 58.888 L +64.639 49.341 L +59.127 39.792 L +s +4 20.696 m +S +3.876 30.244 m +9.512 30.244 L +15.024 20.696 L +9.512 11.147 L +3.876 11.147 L +S +37.075 20.696 m +S +42.588 11.148 m +31.563 11.148 L +26.05 20.696 L +31.563 30.244 L +42.589 30.244 L +48.101 20.696 L +42.588 11.148 L +s +37.076 58.888 m +S +42.589 49.34 m +31.564 49.34 L +26.05 58.888 L +31.564 68.436 L +42.589 68.436 L +48.101 58.888 L +42.589 49.34 L +s +70.151 20.696 m +S +70.2094 11.147 m +64.639 11.147 L +59.127 20.696 L +64.639 30.244 L +70.2094 30.244 L +S +70.152 58.888 m +S +70.0427 49.34 m +64.639 49.34 L +59.127 58.888 L +64.639 68.436 L +70.0427 68.436 L +S +4 58.888 m +S +3.876 68.436 m +9.513 68.436 L +15.025 58.888 L +9.513 49.34 L +3.876 49.34 L +S +%AI6_EndPatternLayer +) & +] E +%AI3_EndPattern +%AI3_BeginPattern: (Laurel.inner) +(Laurel.inner) 1 1 28.5392 28.5392 [ +%AI3_Tile +(0 O 0 R 0 0.55 1 0.12 k + 0 0.55 1 0.12 K +) @ +( +%AI6_BeginPatternLayer +800 Ar +0 J 0 j 0.3 w 4 M []0 d +%AI3_Note: +0 D +0 XR +19.2768 15.3585 m +28.9144 15.3585 L +28.9144 14.2335 L +19.2768 14.2335 L +19.2768 15.3585 L +f +%AI6_EndPatternLayer +) & +(0 O 0 R 0 0.55 1 0.3 k + 0 0.55 1 0.3 K +) @ +( +%AI6_BeginPatternLayer +800 Ar +0 J 0 j 0.3 w 4 M []0 d +%AI3_Note: +0 D +0 XR +14.7461 18.9624 m +13.0264 17.8486 11.3273 14.4193 11.3273 10.0362 c +11.3273 5.6547 12.9768 2.1518 14.744 1.1112 C +14.7443 1.1112 L +16.4707 2.1518 18.1679 5.6547 18.1679 10.0362 c +18.1679 14.4143 16.432 17.8633 14.7461 18.9624 C +f +%AI6_EndPatternLayer +) & +] E +%AI3_EndPattern +%AI3_BeginPattern: (Laurel.outer) +(Laurel.outer) 1 1.3751 28.5393 28.9143 [ +%AI3_Tile +(0 O 0 R 0 0.55 1 0.12 k + 0 0.55 1 0.12 K +) @ +( +%AI6_BeginPatternLayer +800 Ar +0 J 0 j 0.3 w 4 M []0 d +%AI3_Note: +0 D +0 XR +14.2395 10.6375 m +14.2395 1 L +15.3645 1 L +15.3645 10.6375 L +14.2395 10.6375 L +f +%AI6_EndPatternLayer +) & +(0 O 0 R 0 0.55 1 0.3 k + 0 0.55 1 0.3 K +) @ +( +%AI6_BeginPatternLayer +800 Ar +0 J 0 j 0.3 w 4 M []0 d +%AI3_Note: +0 D +0 XR +10.5769 15.124 m +11.6906 16.8438 15.1198 18.5429 19.503 18.5429 c +23.8844 18.5429 27.3874 16.8935 28.428 15.1262 C +28.428 15.1259 L +27.3874 13.3995 23.8844 11.7023 19.503 11.7023 c +15.1249 11.7023 11.676 13.4382 10.5769 15.124 C +f +%AI6_EndPatternLayer +) & +] E +%AI3_EndPattern +%AI3_BeginPattern: (Laurel.side) +(Laurel.side) 1.3972 1 28.9364 28.5392 [ +%AI3_Tile +(0 O 0 R 0 0.55 1 0.12 k + 0 0.55 1 0.12 K +) @ +( +%AI6_BeginPatternLayer +800 Ar +0 J 0 j 0.3 w 4 M []0 d +%AI3_Note: +0 D +0 XR +29.1571 15.2998 m +1 15.2998 L +1 14.1748 L +29.1571 14.1748 L +29.1571 15.2998 L +f +%AI6_EndPatternLayer +) & +(0 O 0 R 0 0.55 1 0.3 k + 0 0.55 1 0.3 K +) @ +( +%AI6_BeginPatternLayer +800 Ar +0 J 0 j 0.3 w 4 M []0 d +%AI3_Note: +0 D +0 XR +2.0183 27.4787 m +1.5899 25.4751 2.8132 21.8488 5.9125 18.7494 c +9.0107 15.6513 12.654 14.3407 14.6395 14.8545 C +14.6398 14.8547 L +15.1246 16.8113 13.8478 20.4883 10.7496 23.5865 c +7.6538 26.6824 3.9876 27.8936 2.0183 27.4787 C +f +%AI6_EndPatternLayer +) & +(0 O 0 R 0 0.39 0.7 0.12 k + 0 0.39 0.7 0.12 K +) @ +( +%AI6_BeginPatternLayer +800 Ar +0 J 0 j 0.3 w 4 M []0 d +%AI3_Note: +0 D +0 XR +2.0183 2.0091 m +1.5899 4.0126 2.8132 7.6389 5.9125 10.7382 c +9.0107 13.8365 12.654 15.147 14.6395 14.6332 C +14.6398 14.633 L +15.1246 12.6765 13.8478 8.9993 10.7496 5.9011 c +7.6538 2.8054 3.9876 1.5941 2.0183 2.0091 C +f +%AI6_EndPatternLayer +) & +(0 O 0 R 0 0.55 1 0.3 k + 0 0.55 1 0.3 K +) @ +( +%AI6_BeginPatternLayer +800 Ar +0 J 0 j 0.3 w 4 M []0 d +%AI3_Note: +0 D +0 XR +15.821 2.0091 m +15.3925 4.0126 16.6159 7.6389 19.7152 10.7382 c +22.8134 13.8365 26.4567 15.147 28.4422 14.6332 C +28.4424 14.633 L +28.9273 12.6765 27.6505 8.9993 24.5523 5.9011 c +21.4565 2.8054 17.7903 1.5941 15.821 2.0091 C +f +%AI6_EndPatternLayer +) & +(0 O 0 R 0 0.39 0.7 0.12 k + 0 0.39 0.7 0.12 K +) @ +( +%AI6_BeginPatternLayer +800 Ar +0 J 0 j 0.3 w 4 M []0 d +%AI3_Note: +0 D +0 XR +15.821 27.4787 m +15.3925 25.4751 16.6159 21.8488 19.7152 18.7494 c +22.8134 15.6513 26.4567 14.3407 28.4422 14.8545 C +28.4424 14.8547 L +28.9273 16.8113 27.6505 20.4883 24.5523 23.5865 c +21.4565 26.6824 17.7903 27.8936 15.821 27.4787 C +f +%AI6_EndPatternLayer +) & +] E +%AI3_EndPattern +%AI3_BeginPattern: (Leaves-fall) +(Leaves-fall) 1 1 52.733 89.816 [ +%AI3_Tile +(0 O 0 R 0.05 0.2 1 0 k + 0.05 0.2 1 0 K +) @ +( +%AI6_BeginPatternLayer +800 Ar +0 J 0 j 1 w 4 M []0 d +%AI3_Note: +0 D +0 XR +52.733 89.816 m +52.733 1 L +1 1 L +1 89.816 L +52.733 89.816 L +f +%AI6_EndPatternLayer +) & +(0 O 0 R 0.83 0 1 0 k + 0.83 0 1 0 K +) @ +( +%AI6_BeginPatternLayer +800 Ar +0 J 0 j 1 w 4 M []0 d +%AI3_Note: +1 D +0 XR +25.317 2.083 m +25.994 2.283 26.284 2.435 V +24.815 5.147 29.266 9.428 30.186 10.168 C +30.787 9.943 30.907 7.41 30.23 6.073 C +31.073 6.196 33.262 4.818 34.02 3.529 C +34.085 4.217 35.655 7.158 36.481 7.535 C +35.561 7.933 34.896 9.406 34.134 10.854 C +35.156 11.021 36.555 10.1 38.026 9.195 C +38.541 9.996 39.915 10.968 41.174 11.484 C +40.086 12.171 39.591 12.912 39.094 14.372 C +38.052 13.806 35.865 13.657 35.336 13.944 C +35.85 15.057 38.096 15.6 38.827 15.547 C +38.573 16.409 38.425 18.562 38.598 21.155 C +36.939 19.839 35.393 18.522 33.734 18.58 C +34.003 17.158 33.367 15.353 32.99 14.86 C +32.417 15.604 32.006 16.431 32.361 18.408 C +30.908 18.893 29.671 19.439 28.297 20.697 C +28.297 18.866 27.725 17.664 26.857 16.388 C +28.117 15.9 29.389 14.697 29.385 13.658 C +28.537 13.81 26.845 14.554 26.352 15.547 C +25.634 14.8 23.95 13.491 22.346 13.487 C +23.534 12.632 24.454 11.598 24.549 9.686 C +25.802 10.657 28.255 11.272 29.635 10.674 C +24.794 6.438 25.262 3.405 25.317 2.083 C +f +12.412 33.743 m +11.887 33.272 11.691 33.01 V +14.182 31.192 11.928 25.366 11.415 24.303 C +10.776 24.247 9.369 26.988 9.405 28.486 C +8.273 27.73 6.608 27.851 5.006 28.137 C +5.578 27.049 5.177 25.104 4.376 24.303 C +5.378 24.339 6.729 23.624 8.038 22.643 C +7.203 21.823 5.376 21.984 3.46 22.643 C +3.46 21.27 2.638 19.533 1.801 18.351 C +3.117 18.408 4.262 17.722 5.12 16.691 C +5.785 18.26 7.819 19.373 8.725 19.324 C +8.742 17.959 7.169 15.869 6.147 15.47 C +6.747 14.801 7.766 13.27 8.725 10.854 C +9.524 12.78 10.694 14.022 11.927 14.955 C +10.785 16.517 10.959 17.388 11.358 18.866 C +12.101 18.325 13.132 17.893 13.303 15.89 C +15.02 16.176 16.156 16.104 17.653 15.203 C +17.198 16.865 17.195 18.466 17.515 20.166 C +15.665 20.026 14.105 20.239 13.075 21.728 C +13.905 21.955 16.165 22.014 17.039 21.082 C +17.366 22.064 18.261 23.47 19.707 24.164 C +18.267 24.424 17.282 25.523 16.373 27.209 C +15.66 25.793 13.433 24.128 11.93 24.073 C +13.933 28.137 13.933 31.055 12.412 33.743 C +f +31.125 30.5 m +31.445 31.128 31.648 31.385 V +34.045 29.444 38.851 32.752 39.746 33.521 C +39.636 34.153 37.511 35.29 35.794 34.26 C +36.234 35.549 35.332 37.51 34.134 38.552 C +35.873 38.451 38.019 39.813 38.541 40.555 C +38.763 39.577 39.946 38.307 41.231 37.293 C +41.582 38.266 40.887 40.384 39.971 41.986 C +41.206 42.487 42.318 43.417 42.776 44.676 C +43.233 43.359 44.236 42.685 45.58 41.929 C +44.421 40.502 43.64 38.328 43.92 37.465 C +45.243 37.8 46.814 40.518 46.937 41.607 C +47.812 40.841 49.366 40.154 51.947 39.848 C +50.246 38.77 49.884 36.778 49.3 35.347 C +48.152 35.794 45.983 35.853 45.008 35.29 C +45.721 34.711 47.061 34.16 49.071 34.146 C +49.071 32.601 49.534 31.469 50.788 30.254 C +49.065 30.267 46.965 29.781 45.469 29.389 C +45.221 30.718 44.378 32.314 43.233 32.715 C +43.227 31.854 43.493 29.605 44.378 28.938 C +43.513 28.37 42.26 26.993 41.803 25.276 C +41.181 26.601 40.32 27.906 38.457 28.35 C +39.642 29.403 40.477 31.42 40.143 32.887 C +35.091 28.905 32.414 30.203 31.125 30.5 C +f +25.317 46.491 m +25.994 46.691 26.284 46.843 V +24.815 49.556 29.266 53.837 30.186 54.576 C +30.787 54.351 30.907 51.818 30.23 50.482 C +31.073 50.605 33.262 49.227 34.02 47.938 C +34.085 48.625 35.655 51.566 36.481 51.944 C +35.561 52.341 34.896 53.814 34.134 55.263 C +35.156 55.43 36.555 54.508 38.026 53.603 C +38.541 54.404 39.915 55.377 41.174 55.892 C +40.086 56.579 39.591 57.321 39.094 58.78 C +38.052 58.215 35.865 58.065 35.336 58.353 C +35.85 59.465 38.096 60.008 38.827 59.955 C +38.573 60.817 38.425 62.97 38.598 65.563 C +36.939 64.247 35.393 62.931 33.734 62.988 C +34.003 61.567 33.367 59.761 32.99 59.268 C +32.417 60.012 32.006 60.839 32.361 62.817 C +30.908 63.302 29.671 63.847 28.297 65.106 C +28.297 63.274 27.725 62.073 26.857 60.796 C +28.117 60.308 29.389 59.106 29.385 58.067 C +28.537 58.219 26.845 58.963 26.352 59.955 C +25.634 59.209 23.95 57.899 22.346 57.895 C +23.534 57.041 24.454 56.006 24.549 54.094 C +25.802 55.065 28.255 55.68 29.635 55.083 C +24.794 50.846 25.262 47.814 25.317 46.491 C +f +12.412 78.151 m +11.887 77.68 11.691 77.418 V +14.182 75.601 11.928 69.774 11.415 68.711 C +10.776 68.655 9.369 71.396 9.405 72.894 C +8.273 72.138 6.608 72.259 5.006 72.545 C +5.578 71.458 5.177 69.512 4.376 68.711 C +5.378 68.747 6.729 68.032 8.038 67.052 C +7.203 66.231 5.376 66.393 3.46 67.052 C +3.46 65.678 2.638 63.941 1.801 62.759 C +3.117 62.817 4.262 62.13 5.12 61.1 C +5.785 62.669 7.819 63.781 8.725 63.732 C +8.742 62.367 7.169 60.277 6.147 59.878 C +6.747 59.209 7.766 57.678 8.725 55.263 C +9.524 57.189 10.694 58.431 11.927 59.364 C +10.785 60.925 10.959 61.796 11.358 63.274 C +12.101 62.734 13.132 62.301 13.303 60.298 C +15.02 60.584 16.156 60.512 17.653 59.612 C +17.198 61.273 17.195 62.874 17.515 64.574 C +15.665 64.434 14.105 64.648 13.075 66.136 C +13.905 66.363 16.165 66.422 17.039 65.49 C +17.366 66.472 18.261 67.878 19.707 68.572 C +18.267 68.832 17.282 69.931 16.373 71.617 C +15.66 70.202 13.433 68.536 11.93 68.482 C +13.933 72.545 13.933 75.464 12.412 78.151 C +f +31.125 74.908 m +31.445 75.537 31.648 75.794 V +34.045 73.853 38.851 77.161 39.746 77.929 C +39.636 78.562 37.511 79.698 35.794 78.668 C +36.234 79.957 35.332 81.918 34.134 82.96 C +35.873 82.86 38.019 84.221 38.541 84.963 C +38.763 83.986 39.946 82.716 41.231 81.701 C +41.582 82.675 40.887 84.792 39.971 86.394 C +41.206 86.895 42.318 87.825 42.776 89.084 C +43.233 87.768 44.236 87.093 45.58 86.337 C +44.421 84.91 43.64 82.736 43.92 81.873 C +45.243 82.208 46.814 84.926 46.937 86.016 C +47.812 85.249 49.366 84.563 51.947 84.257 C +50.246 83.179 49.884 81.187 49.3 79.756 C +48.152 80.203 45.983 80.262 45.008 79.698 C +45.721 79.119 47.061 78.569 49.071 78.554 C +49.071 77.009 49.534 75.877 50.788 74.663 C +49.065 74.675 46.965 74.189 45.469 73.798 C +45.221 75.126 44.378 76.723 43.233 77.123 C +43.227 76.262 43.493 74.013 44.378 73.347 C +43.513 72.779 42.26 71.401 41.803 69.684 C +41.181 71.009 40.32 72.314 38.457 72.759 C +39.642 73.812 40.477 75.829 40.143 77.295 C +35.091 73.313 32.414 74.611 31.125 74.908 C +f +%AI6_EndPatternLayer +) & +] E +%AI3_EndPattern +%AI3_BeginPattern: (Polka dots) +(Polka dots) 1 1 29.8 29.8 [ +%AI3_Tile +(0 O 0 R 0.45 0.9 0 0 k + 0.45 0.9 0 0 K +) @ +( +%AI6_BeginPatternLayer +800 Ar +0 J 0 j 0.3 w 4 M []0 d +%AI3_Note: +0 D +0 XR +1 1 m +1 29.8 L +29.8 29.8 L +29.8 1 L +1 1 L +f +%AI6_EndPatternLayer +) & +(0 O 0 R 0.09 0.18 0 0 k + 0.09 0.18 0 0 K +) @ +( +%AI6_BeginPatternLayer +*u +800 Ar +0 J 0 j 1 w 4 M []0 d +%AI3_Note: +0 D +0 XR +11.08 8.2 m +11.08 9.791 9.79 11.08 8.2 11.08 c +6.609 11.08 5.32 9.791 5.32 8.2 c +5.32 6.61 6.609 5.32 8.2 5.32 c +9.79 5.32 11.08 6.61 11.08 8.2 c +f +11.08 22.6 m +11.08 24.191 9.79 25.48 8.2 25.48 c +6.609 25.48 5.32 24.191 5.32 22.6 c +5.32 21.01 6.609 19.72 8.2 19.72 c +9.79 19.72 11.08 21.01 11.08 22.6 c +f +18.28 15.4 m +18.28 16.991 16.99 18.28 15.4 18.28 c +13.809 18.28 12.52 16.991 12.52 15.4 c +12.52 13.81 13.809 12.52 15.4 12.52 c +16.99 12.52 18.28 13.81 18.28 15.4 c +f +25.48 8.2 m +25.48 9.791 24.19 11.08 22.6 11.08 c +21.009 11.08 19.72 9.791 19.72 8.2 c +19.72 6.61 21.009 5.32 22.6 5.32 c +24.19 5.32 25.48 6.61 25.48 8.2 c +f +25.48 22.6 m +25.48 24.191 24.19 25.48 22.6 25.48 c +21.009 25.48 19.72 24.191 19.72 22.6 c +19.72 21.01 21.009 19.72 22.6 19.72 c +24.19 19.72 25.48 21.01 25.48 22.6 c +f +*U +26.92 1 m +29.8 1 L +29.8 3.88 L +28.209 3.88 26.92 2.591 26.92 1 C +f +15.4 3.88 m +13.809 3.88 12.52 2.591 12.52 1 C +18.28 1 L +18.28 2.591 16.99 3.88 15.4 3.88 c +f +1 3.88 m +1 1 L +3.88 1 L +3.88 2.591 2.59 3.88 1 3.88 C +f +1 XR +26.92 15.4 m +26.92 13.81 28.209 12.52 29.8 12.52 C +29.8 18.28 L +28.209 18.28 26.92 16.991 26.92 15.4 c +f +0 XR +15.4 18.28 m +13.809 18.28 12.52 16.991 12.52 15.4 c +12.52 13.81 13.809 12.52 15.4 12.52 c +16.99 12.52 18.28 13.81 18.28 15.4 c +18.28 16.991 16.99 18.28 15.4 18.28 c +f +1 XR +3.88 15.4 m +3.88 16.991 2.59 18.28 1 18.28 C +1 12.52 L +2.59 12.52 3.88 13.81 3.88 15.4 c +f +0 XR +29.8 26.92 m +29.8 29.8 L +26.92 29.8 L +26.92 28.21 28.209 26.92 29.8 26.92 C +f +15.4 26.92 m +16.99 26.92 18.28 28.21 18.28 29.8 C +12.52 29.8 L +12.52 28.21 13.809 26.92 15.4 26.92 c +f +3.88 29.8 m +1 29.8 L +1 26.92 L +2.59 26.92 3.88 28.21 3.88 29.8 C +f +1 XR +8.2 11.08 m +6.609 11.08 5.32 9.791 5.32 8.2 c +5.32 6.61 6.609 5.32 8.2 5.32 c +9.79 5.32 11.08 6.61 11.08 8.2 c +11.08 9.791 9.79 11.08 8.2 11.08 c +f +22.6 11.08 m +21.009 11.08 19.72 9.791 19.72 8.2 c +19.72 6.61 21.009 5.32 22.6 5.32 c +24.19 5.32 25.48 6.61 25.48 8.2 c +25.48 9.791 24.19 11.08 22.6 11.08 c +f +8.2 25.48 m +6.609 25.48 5.32 24.191 5.32 22.6 c +5.32 21.01 6.609 19.72 8.2 19.72 c +9.79 19.72 11.08 21.01 11.08 22.6 c +11.08 24.191 9.79 25.48 8.2 25.48 c +f +22.6 25.48 m +21.009 25.48 19.72 24.191 19.72 22.6 c +19.72 21.01 21.009 19.72 22.6 19.72 c +24.19 19.72 25.48 21.01 25.48 22.6 c +25.48 24.191 24.19 25.48 22.6 25.48 c +f +%AI6_EndPatternLayer +) & +] E +%AI3_EndPattern +%AI3_BeginPattern: (Random circles) +(Random circles) 4.365 3.849 51.13 57.85 [ +%AI3_Tile +(0 O 0 R 0 0.1125 0.45 0 k + 0 0.1125 0.45 0 K +) @ +( +%AI6_BeginPatternLayer +800 Ar +0 J 0 j 0.3 w 4 M []0 d +%AI3_Note: +0 D +0 XR +4.365 3.849 m +4.365 57.85 L +51.13 57.85 L +51.13 3.849 L +4.365 3.849 L +f +%AI6_EndPatternLayer +) & +(0 O 0 R 0.4 0.7 1 0 k + 0.4 0.7 1 0 K +) @ +( +%AI6_BeginPatternLayer +800 Ar +0 J 0 j 0.3 w 4 M []0 d +%AI3_Note: +0 D +0 XR +45.429 36.274 m +45.843 36.991 45.598 37.908 44.88 38.323 c +44.163 38.737 43.245 38.491 42.831 37.774 c +42.417 37.056 42.663 36.139 43.38 35.725 c +44.098 35.31 45.015 35.556 45.429 36.274 c +s +44.179 27.926 m +43.765 28.643 42.848 28.889 42.13 28.475 c +41.413 28.06 41.167 27.143 41.581 26.425 c +41.995 25.708 42.913 25.462 43.63 25.876 c +44.348 26.291 44.593 27.208 44.179 27.926 c +s +35.929 41.024 m +35.515 41.741 34.598 41.987 33.88 41.573 c +33.163 41.158 32.917 40.241 33.331 39.524 c +33.745 38.806 34.663 38.56 35.38 38.975 c +36.098 39.389 36.343 40.306 35.929 41.024 c +s +28.38 34.225 m +28.794 34.942 28.549 35.859 27.831 36.274 c +27.114 36.688 26.196 36.442 25.782 35.725 c +25.368 35.007 25.614 34.09 26.331 33.675 c +27.049 33.261 27.966 33.507 28.38 34.225 c +s +31.179 28.024 m +30.765 28.741 29.848 28.987 29.13 28.573 c +28.413 28.158 28.167 27.241 28.581 26.524 c +28.995 25.806 29.913 25.56 30.63 25.975 c +31.348 26.389 31.593 27.306 31.179 28.024 c +s +36.792 23.349 m +35.963 23.349 35.292 22.678 35.292 21.849 c +35.292 21.021 35.963 20.349 36.792 20.349 c +37.62 20.349 38.292 21.021 38.292 21.849 c +38.292 22.678 37.62 23.349 36.792 23.349 c +s +10.888 34.175 m +10.474 34.893 10.72 35.81 11.437 36.225 c +12.155 36.639 13.072 36.393 13.486 35.675 c +13.901 34.958 13.655 34.041 12.937 33.626 c +12.22 33.212 11.303 33.458 10.888 34.175 c +s +11.517 26.601 m +11.931 27.318 12.848 27.564 13.566 27.15 c +14.283 26.735 14.529 25.818 14.115 25.1 c +13.701 24.383 12.783 24.137 12.066 24.551 c +11.348 24.966 11.103 25.883 11.517 26.601 c +s +16.782 41.426 m +17.196 42.143 18.114 42.389 18.831 41.975 c +19.549 41.56 19.794 40.643 19.38 39.926 c +18.966 39.208 18.049 38.962 17.331 39.377 c +16.614 39.791 16.368 40.708 16.782 41.426 c +s +22.365 24.35 m +23.194 24.35 23.865 23.678 23.865 22.85 c +23.865 22.021 23.194 21.35 22.365 21.35 c +21.537 21.35 20.865 22.021 20.865 22.85 c +20.865 23.678 21.537 24.35 22.365 24.35 c +s +45.385 7.849 m +44.971 7.132 44.053 6.886 43.336 7.3 c +42.619 7.714 42.373 8.632 42.787 9.349 c +43.201 10.067 44.119 10.312 44.836 9.898 c +45.553 9.484 45.799 8.567 45.385 7.849 c +s +29.679 7.774 m +29.265 7.056 28.348 6.81 27.63 7.225 c +26.913 7.639 26.667 8.556 27.081 9.274 c +27.495 9.991 28.413 10.237 29.13 9.823 c +29.848 9.408 30.093 8.491 29.679 7.774 c +s +35.542 11.349 m +34.713 11.349 34.042 12.021 34.042 12.849 c +34.042 13.678 34.713 14.349 35.542 14.349 c +36.37 14.349 37.042 13.678 37.042 12.849 c +37.042 12.021 36.37 11.349 35.542 11.349 c +s +10.13 7.475 m +10.544 6.757 11.462 6.511 12.179 6.926 c +12.897 7.34 13.142 8.257 12.728 8.975 c +12.314 9.692 11.397 9.938 10.679 9.524 c +9.962 9.109 9.716 8.192 10.13 7.475 c +s +20.203 13.349 m +21.031 13.349 21.703 14.021 21.703 14.849 c +21.703 15.678 21.031 16.349 20.203 16.349 c +19.375 16.349 18.703 15.678 18.703 14.849 c +18.703 14.021 19.375 13.349 20.203 13.349 c +s +44.635 54.1 m +45.049 53.382 44.803 52.465 44.086 52.051 c +43.369 51.636 42.451 51.882 42.037 52.6 c +41.623 53.317 41.869 54.234 42.586 54.649 c +43.303 55.063 44.221 54.817 44.635 54.1 c +s +36.841 48.1 m +36.427 47.382 35.509 47.136 34.792 47.551 c +34.074 47.965 33.828 48.882 34.243 49.6 c +34.657 50.317 35.574 50.563 36.292 50.149 c +37.009 49.734 37.255 48.817 36.841 48.1 c +s +29.728 54.725 m +30.143 54.007 29.897 53.09 29.179 52.675 c +28.462 52.261 27.544 52.507 27.13 53.225 c +26.716 53.942 26.962 54.859 27.679 55.274 c +28.397 55.688 29.314 55.442 29.728 54.725 c +s +10.86 54.1 m +10.446 53.382 10.691 52.465 11.409 52.051 c +12.126 51.636 13.044 51.882 13.458 52.6 c +13.872 53.317 13.626 54.234 12.909 54.649 c +12.191 55.063 11.274 54.817 10.86 54.1 c +s +19.154 49.1 m +19.568 48.382 20.486 48.136 21.203 48.551 c +21.92 48.965 22.166 49.882 21.752 50.6 c +21.338 51.317 20.42 51.563 19.703 51.149 c +18.986 50.734 18.74 49.817 19.154 49.1 c +s +51.88 38.85 m +51.052 38.85 50.38 39.521 50.38 40.35 c +50.38 41.178 51.052 41.85 51.88 41.85 c +52.709 41.85 53.38 41.178 53.38 40.35 c +53.38 39.521 52.709 38.85 51.88 38.85 c +s +51.865 11.349 m +52.693 11.349 53.365 12.021 53.365 12.849 c +53.365 13.678 52.693 14.349 51.865 14.349 c +51.036 14.349 50.365 13.678 50.365 12.849 c +50.365 12.021 51.036 11.349 51.865 11.349 c +s +30.179 18.524 m +29.765 19.241 28.848 19.487 28.13 19.073 c +27.413 18.658 27.167 17.741 27.581 17.024 c +27.995 16.306 28.913 16.06 29.63 16.475 c +30.348 16.889 30.593 17.806 30.179 18.524 c +s +21.679 31.524 m +21.265 32.241 20.348 32.487 19.63 32.073 c +18.913 31.658 18.667 30.741 19.081 30.024 c +19.495 29.306 20.413 29.06 21.13 29.475 c +21.848 29.889 22.093 30.806 21.679 31.524 c +s +37.914 33.399 m +37.5 34.116 36.583 34.362 35.865 33.948 c +35.148 33.533 34.902 32.616 35.316 31.899 c +35.73 31.181 36.648 30.935 37.365 31.35 c +38.083 31.764 38.328 32.681 37.914 33.399 c +s +28.929 45.024 m +28.515 45.741 27.598 45.987 26.88 45.573 c +26.163 45.158 25.917 44.241 26.331 43.524 c +26.745 42.806 27.663 42.56 28.38 42.975 c +29.098 43.389 29.343 44.306 28.929 45.024 c +s +12.429 45.524 m +12.015 46.241 11.098 46.487 10.38 46.073 c +9.663 45.658 9.417 44.741 9.831 44.024 c +10.245 43.306 11.163 43.06 11.88 43.475 c +12.598 43.889 12.843 44.806 12.429 45.524 c +s +44.49 45.6 m +44.075 46.317 43.158 46.563 42.441 46.149 c +41.723 45.734 41.477 44.817 41.891 44.1 c +42.306 43.382 43.223 43.136 43.941 43.55 c +44.658 43.965 44.904 44.882 44.49 45.6 c +s +12.679 18.524 m +12.265 19.241 11.348 19.487 10.63 19.073 c +9.913 18.658 9.667 17.741 10.081 17.024 c +10.495 16.306 11.413 16.06 12.13 16.475 c +12.848 16.889 13.093 17.806 12.679 18.524 c +s +21.179 5.774 m +20.765 6.491 19.848 6.737 19.13 6.323 c +18.413 5.908 18.167 4.991 18.581 4.274 c +18.995 3.557 19.913 3.311 20.63 3.725 c +21.348 4.139 21.593 5.056 21.179 5.774 c +s +38.929 5.274 m +38.515 5.991 37.598 6.237 36.88 5.823 c +36.163 5.408 35.917 4.491 36.331 3.774 c +36.745 3.057 37.663 2.811 38.38 3.225 c +39.098 3.639 39.343 4.556 38.929 5.274 c +s +43.865 18.1 m +44.694 18.1 45.365 17.429 45.365 16.6 c +45.365 15.772 44.694 15.1 43.865 15.1 c +43.037 15.1 42.365 15.772 42.365 16.6 c +42.365 17.429 43.037 18.1 43.865 18.1 c +s +51.13 4.6 m +50.302 4.6 49.63 3.928 49.63 3.1 c +49.63 2.272 50.302 1.6 51.13 1.6 c +51.959 1.6 52.63 2.272 52.63 3.1 c +52.63 3.928 51.959 4.6 51.13 4.6 c +s +52.163 31.649 m +51.748 32.366 50.831 32.612 50.114 32.198 c +49.396 31.783 49.15 30.866 49.565 30.149 c +49.979 29.431 50.896 29.185 51.614 29.6 c +52.331 30.014 52.577 30.931 52.163 31.649 c +s +51.85 51.35 m +51.021 51.35 50.35 50.678 50.35 49.85 c +50.35 49.021 51.021 48.35 51.85 48.35 c +52.678 48.35 53.35 49.021 53.35 49.85 c +53.35 50.678 52.678 51.35 51.85 51.35 c +s +49.85 23.1 m +50.679 23.1 51.35 22.428 51.35 21.6 c +51.35 20.771 50.679 20.1 49.85 20.1 c +49.022 20.1 48.35 20.771 48.35 21.6 c +48.35 22.428 49.022 23.1 49.85 23.1 c +s +5.13 38.85 m +4.302 38.85 3.63 39.521 3.63 40.35 c +3.63 41.178 4.302 41.85 5.13 41.85 c +5.959 41.85 6.63 41.178 6.63 40.35 c +6.63 39.521 5.959 38.85 5.13 38.85 c +s +5.115 11.349 m +5.943 11.349 6.615 12.021 6.615 12.849 c +6.615 13.678 5.943 14.349 5.115 14.349 c +4.286 14.349 3.615 13.678 3.615 12.849 c +3.615 12.021 4.286 11.349 5.115 11.349 c +s +4.38 4.6 m +3.552 4.6 2.88 3.928 2.88 3.1 c +2.88 2.272 3.552 1.6 4.38 1.6 c +5.209 1.6 5.88 2.272 5.88 3.1 c +5.88 3.928 5.209 4.6 4.38 4.6 c +s +5.413 31.649 m +4.998 32.366 4.081 32.612 3.364 32.198 c +2.646 31.783 2.4 30.866 2.815 30.149 c +3.229 29.431 4.146 29.185 4.864 29.6 c +5.581 30.014 5.827 30.931 5.413 31.649 c +s +5.1 51.35 m +4.271 51.35 3.6 50.678 3.6 49.85 c +3.6 49.021 4.271 48.35 5.1 48.35 c +5.928 48.35 6.6 49.021 6.6 49.85 c +6.6 50.678 5.928 51.35 5.1 51.35 c +s +3.1 23.1 m +3.929 23.1 4.6 22.428 4.6 21.6 c +4.6 20.771 3.929 20.1 3.1 20.1 c +2.272 20.1 1.6 20.771 1.6 21.6 c +1.6 22.428 2.272 23.1 3.1 23.1 c +s +21.194 59.775 m +20.78 60.492 19.863 60.738 19.145 60.324 c +18.428 59.909 18.182 58.992 18.596 58.275 c +19.01 57.558 19.928 57.312 20.645 57.726 c +21.363 58.14 21.608 59.057 21.194 59.775 c +s +38.944 59.275 m +38.53 59.992 37.613 60.238 36.895 59.824 c +36.178 59.409 35.932 58.492 36.346 57.775 c +36.76 57.058 37.678 56.812 38.395 57.226 c +39.113 57.64 39.358 58.557 38.944 59.275 c +s +51.145 58.601 m +50.317 58.601 49.645 57.929 49.645 57.101 c +49.645 56.273 50.317 55.601 51.145 55.601 c +51.974 55.601 52.645 56.273 52.645 57.101 c +52.645 57.929 51.974 58.601 51.145 58.601 c +s +4.395 58.601 m +3.567 58.601 2.895 57.929 2.895 57.101 c +2.895 56.273 3.567 55.601 4.395 55.601 c +5.224 55.601 5.895 56.273 5.895 57.101 c +5.895 57.929 5.224 58.601 4.395 58.601 c +s +%AI6_EndPatternLayer +) & +] E +%AI3_EndPattern +%AI3_BeginPattern: (Rope.side) +(Rope.side) 1 4.6 60.9998 33.3999 [ +%AI3_Tile +(0 O 0 R 0 0 0 1 k + 0 0 0 1 K +) @ +( +%AI6_BeginPatternLayer +800 Ar +1 J 1 j 0.6 w 4 M []0 d +%AI3_Note: +0 D +0 XR +24.9999 7 m +15.6521 4.663 8.125 8.6981 1 14.1407 C +S +36.9999 7 m +22.3477 3.337 12.168 15.3276 1 23.859 C +S +48.9999 7 m +29.3464 2.0866 17.7386 25.3332 1 30.6213 C +S +1 30.9999 m +24.9999 36.9999 36.9999 1 60.9998 7 C +S +13 30.9999 m +32.6534 35.9133 44.2611 12.6667 60.9998 7.3786 C +S +24.9999 30.9999 m +39.652 34.6629 49.8317 22.6722 60.9998 14.1407 C +S +36.9999 30.9999 m +46.3476 33.3369 53.8749 29.3018 60.9998 23.859 C +S +48.9999 30.9999 m +53.3464 32.0865 57.2978 31.7908 60.9998 30.6213 C +S +13 7 m +8.6535 5.9134 4.7019 6.2091 1 7.3786 C +S +%AI6_EndPatternLayer +) & +] E +%AI3_EndPattern +%AI3_BeginPattern: (Scales) +(Scales) 1.6 9.3475 48.088 55.8355 [ +%AI3_Tile +(0 O 0 R 1 g + 1 G +) @ +( +%AI6_BeginPatternLayer +800 Ar +0 J 0 j 1 w 4 M []0 d +%AI3_Note: +0 D +0 XR +1.6 9.3475 m +1.6 55.8355 L +48.088 55.8355 L +48.088 9.3475 L +1.6 9.3475 L +f +%AI6_EndPatternLayer +) & +(0 O 0 R 0 g + 0 G +) @ +( +%AI6_BeginPatternLayer +800 Ar +0 J 0 j 0.3 w 4 M []0 d +%AI3_Note: +0 D +0 XR +17.0956 9.3475 m +12.8162 9.3475 9.3475 5.8787 9.3475 1.6 C +9.3475 5.8787 5.8787 9.3475 1.6 9.3475 C +1.6 13.6262 5.0687 17.095 9.3475 17.095 c +13.6268 17.095 17.0956 13.6262 17.0956 9.3475 C +s +32.5918 9.3475 m +28.3125 9.3475 24.8437 5.8787 24.8437 1.6 C +24.8437 5.8787 21.3743 9.3475 17.0956 9.3475 C +17.0956 13.6262 20.5644 17.095 24.8437 17.095 c +29.1224 17.095 32.5918 13.6262 32.5918 9.3475 C +s +48.088 9.3475 m +43.8087 9.3475 40.3399 5.8787 40.3399 1.6 C +40.3399 5.8787 36.8705 9.3475 32.5918 9.3475 C +32.5918 13.6262 36.0606 17.095 40.3399 17.095 c +44.6186 17.095 48.088 13.6262 48.088 9.3475 C +s +17.0956 40.3393 m +12.8162 40.3393 9.3475 36.8699 9.3475 32.5912 C +9.3475 36.8699 5.8787 40.3393 1.6 40.3393 C +1.6 44.6181 5.0687 48.0874 9.3475 48.0874 c +13.6268 48.0874 17.0956 44.6181 17.0956 40.3393 C +s +17.0956 24.8431 m +12.8162 24.8431 9.3475 21.3743 9.3475 17.095 C +9.3475 21.3743 5.8787 24.8431 1.6 24.8431 C +1.6 29.1218 5.0687 32.5912 9.3475 32.5912 c +13.6268 32.5912 17.0956 29.1218 17.0956 24.8431 C +s +32.5918 24.8431 m +28.3125 24.8431 24.8437 21.3743 24.8437 17.095 C +24.8437 21.3743 21.3743 24.8431 17.0956 24.8431 C +17.0956 29.1218 20.5644 32.5912 24.8437 32.5912 c +29.1224 32.5912 32.5918 29.1218 32.5918 24.8431 C +s +48.088 24.8431 m +43.8087 24.8431 40.3399 21.3743 40.3399 17.095 C +40.3399 21.3743 36.8705 24.8431 32.5918 24.8431 C +32.5918 29.1218 36.0606 32.5912 40.3399 32.5912 c +44.6186 32.5912 48.088 29.1218 48.088 24.8431 C +s +32.5918 40.3393 m +28.3125 40.3393 24.8437 36.8699 24.8437 32.5912 C +24.8437 36.8699 21.3743 40.3393 17.0956 40.3393 C +17.0956 44.6181 20.5644 48.0874 24.8437 48.0874 c +29.1224 48.0874 32.5918 44.6181 32.5918 40.3393 C +s +48.088 40.3393 m +43.8087 40.3393 40.3399 36.8699 40.3399 32.5912 C +40.3399 36.8699 36.8705 40.3393 32.5918 40.3393 C +32.5918 44.6181 36.0606 48.0874 40.3399 48.0874 c +44.6186 48.0874 48.088 44.6181 48.088 40.3393 C +s +17.0956 55.8355 m +12.8162 55.8355 9.3475 52.3662 9.3475 48.0874 C +9.3475 52.3662 5.8787 55.8355 1.6 55.8355 C +1.6 60.1143 5.0687 63.5836 9.3475 63.5836 c +13.6268 63.5836 17.0956 60.1143 17.0956 55.8355 C +s +32.5918 55.8355 m +28.3125 55.8355 24.8437 52.3662 24.8437 48.0874 C +24.8437 52.3662 21.3743 55.8355 17.0956 55.8355 C +17.0956 60.1143 20.5644 63.5836 24.8437 63.5836 c +29.1224 63.5836 32.5918 60.1143 32.5918 55.8355 C +s +48.088 55.8355 m +43.8087 55.8355 40.3399 52.3662 40.3399 48.0874 C +40.3399 52.3662 36.8705 55.8355 32.5918 55.8355 C +32.5918 60.1143 36.0606 63.5836 40.3399 63.5836 c +44.6186 63.5836 48.088 60.1143 48.088 55.8355 C +s +%AI6_EndPatternLayer +) & +] E +%AI3_EndPattern +%AI3_BeginPattern: (SolidStar.side) +(SolidStar.side) 1 1 33.0117 33.0117 [ +%AI3_Tile +(0 O 0 R 0.05 0.2 0.95 0 k + 0.05 0.2 0.95 0 K +) @ +( +%AI6_BeginPatternLayer +800 Ar +0 J 0 j 1 w 4 M []0 d +%AI3_Note: +1 D +0 XR +7.9689 26.0458 m +14.5331 22.9874 l +17.0095 29.7904 L +19.4859 22.9874 l +26.0473 26.0458 l +22.9889 19.4815 l +29.792 17.0052 l +22.9889 14.5288 l +26.0473 7.9674 l +19.4859 11.0257 l +17.0095 4.2226 l +14.5305 11.0257 l +7.9689 7.9674 l +11.0273 14.5288 l +4.2242 17.0052 l +11.0273 19.4843 L +7.9689 26.0458 l +f +%AI6_EndPatternLayer +) & +] E +%AI3_EndPattern +%AI3_BeginPattern: (Stars) +(Stars) 1 1 63.384 84.766 [ +%AI3_Tile +(0 O 0 R 1 0.9 0.1 0 k + 1 0.9 0.1 0 K +) @ +( +%AI6_BeginPatternLayer +800 Ar +0 J 0 j 0.3 w 4 M []0 d +%AI3_Note: +0 D +0 XR +1 1 m +1 84.766 L +63.384 84.766 L +63.384 1 L +1 1 L +f +%AI6_EndPatternLayer +) & +(0 O 0 R 0 0.25 1 0 k + 0 0.25 1 0 K +) @ +( +%AI6_BeginPatternLayer +*u +800 Ar +0 J 0 j 1 w 4 M []0 d +%AI3_Note: +0 D +0 XR +37.668 67.113 m +43.924 62.567 L +41.535 55.213 L +47.791 59.757 L +54.046 55.212 L +51.657 62.566 L +57.914 67.112 L +50.18 67.112 L +47.791 74.467 L +45.402 67.113 L +37.668 67.113 L +f +16.596 59.757 m +22.851 55.212 L +20.462 62.566 L +26.719 67.112 L +18.985 67.112 L +16.596 74.467 L +14.207 67.113 L +6.473 67.113 L +12.729 62.567 L +10.34 55.213 L +16.596 59.757 L +f +20.462 20.683 m +26.719 25.229 L +18.985 25.229 L +16.596 32.584 L +14.207 25.23 L +6.473 25.23 L +12.729 20.684 L +10.34 13.33 L +16.596 17.874 L +22.851 13.329 L +20.462 20.683 L +f +38.447 34.271 m +36.058 41.625 L +42.315 46.171 L +34.581 46.171 L +32.192 53.526 L +29.803 46.172 L +22.069 46.172 L +28.325 41.626 L +25.936 34.272 L +32.192 38.816 L +38.447 34.271 L +f +51.657 20.683 m +57.914 25.229 L +50.18 25.229 L +47.791 32.584 L +45.402 25.23 L +37.668 25.23 L +43.924 20.684 L +41.535 13.33 L +47.791 17.874 L +54.046 13.329 L +51.657 20.683 L +f +*U +1 XR +34.581 4.288 m +32.192 11.643 L +29.803 4.289 L +22.069 4.289 L +26.5962 1 L +37.7885 1 L +42.315 4.288 L +34.581 4.288 L +f +53.261 4.289 m +57.7882 1 L +63.384 1 L +63.384 11.643 L +60.995 4.289 L +53.261 4.289 L +f +4.866 41.625 m +11.123 46.171 L +3.389 46.171 L +1 53.526 L +1 38.816 L +7.255 34.271 L +4.866 41.625 L +f +36.058 41.625 m +42.315 46.171 L +34.581 46.171 L +32.192 53.526 L +29.803 46.172 L +22.069 46.172 L +28.325 41.626 L +25.936 34.272 L +32.192 38.816 L +38.447 34.271 L +36.058 41.625 L +f +53.261 46.172 m +59.517 41.626 L +57.128 34.272 L +63.384 38.816 L +63.384 53.526 L +60.995 46.172 L +53.261 46.172 L +f +4.866 83.508 m +6.5974 84.766 L +1 84.766 L +1 80.699 L +7.255 76.154 L +4.866 83.508 L +f +25.936 76.155 m +32.192 80.699 L +38.447 76.154 L +36.058 83.508 L +37.7895 84.766 L +26.5951 84.766 L +28.325 83.509 L +25.936 76.155 L +f +22.851 55.212 m +20.462 62.566 L +26.719 67.112 L +18.985 67.112 L +16.596 74.467 L +14.207 67.113 L +6.473 67.113 L +12.729 62.567 L +10.34 55.213 L +16.596 59.757 L +22.851 55.212 L +f +41.535 55.213 m +47.791 59.757 L +54.046 55.212 L +51.657 62.566 L +57.914 67.112 L +50.18 67.112 L +47.791 74.467 L +45.402 67.113 L +37.668 67.113 L +43.924 62.567 L +41.535 55.213 L +f +50.18 25.229 m +47.791 32.584 L +45.402 25.23 L +37.668 25.23 L +43.924 20.684 L +41.535 13.33 L +47.791 17.874 L +54.046 13.329 L +51.657 20.683 L +57.914 25.229 L +50.18 25.229 L +f +18.985 25.229 m +16.596 32.584 L +14.207 25.23 L +6.473 25.23 L +12.729 20.684 L +10.34 13.33 L +16.596 17.874 L +22.851 13.329 L +20.462 20.683 L +26.719 25.229 L +18.985 25.229 L +f +3.388 4.289 m +1 11.643 L +1 1 L +6.5948 1 L +11.122 4.289 L +3.388 4.289 L +f +57.128 76.154 m +63.384 80.699 L +63.384 84.766 L +57.7855 84.766 L +59.517 83.508 L +57.128 76.154 L +f +%AI6_EndPatternLayer +) & +] E +%AI3_EndPattern +%AI3_BeginPattern: (Stripes) +(Stripes) 8.45 4.6001 80.45 76.6001 [ +%AI3_Tile +(0 O 0 R 1 0.07 1 0 k + 1 0.07 1 0 K +) @ +( +%AI6_BeginPatternLayer +800 Ar +0 J 0 j 3.6 w 4 M []0 d +%AI3_Note: +0 D +0 XR +8.2 8.2 m +80.7 8.2 L +S +8.2 22.6001 m +80.7 22.6001 L +S +8.2 37.0002 m +80.7 37.0002 L +S +8.2 51.4 m +80.7 51.4 L +S +8.2 65.8001 m +80.7 65.8001 L +S +8.2 15.4 m +80.7 15.4 L +S +8.2 29.8001 m +80.7 29.8001 L +S +8.2 44.2 m +80.7 44.2 L +S +8.2 58.6001 m +80.7 58.6001 L +S +8.2 73.0002 m +80.7 73.0002 L +S +%AI6_EndPatternLayer +) & +] E +%AI3_EndPattern +%AI3_BeginPattern: (TriBevel.outer) +(TriBevel.outer) 1 1.0004 31.6124 31.6127 [ +%AI3_Tile +(0 O 0 R 0 0 0 0.3 k + 0 0 0 0.3 K +) @ +( +%AI6_BeginPatternLayer +800 Ar +0 J 0 j 1 w 4 M []0 d +%AI3_Note: +0 D +0 XR +31.6118 5.4917 m +27.1221 5.4917 L +27.1205 1.0011 L +27.8031 1.0011 L +27.8031 4.8091 L +31.6118 4.8091 L +31.6118 5.4917 L +f +%AI6_EndPatternLayer +) & +(0 O 0 R 0 0 0 0.2 k + 0 0 0 0.2 K +) @ +( +%AI6_BeginPatternLayer +800 Ar +0 J 0 j 1 w 4 M []0 d +%AI3_Note: +0 D +0 XR +31.6149 9.5062 m +23.1111 9.5062 L +23.1111 1.0015 L +27.1205 1.0015 L +27.1205 5.493 L +31.6144 5.493 L +31.6149 9.5062 L +f +%AI6_EndPatternLayer +) & +(0 O 0 R 0 0 0 0.4 k + 0 0 0 0.4 K +) @ +( +%AI6_BeginPatternLayer +800 Ar +0 J 0 j 1 w 4 M []0 d +%AI3_Note: +0 D +0 XR +31.6124 10.485 m +22.1297 10.485 L +22.1292 1.0015 L +23.1084 1.0015 L +23.1084 9.5049 L +31.6124 9.5049 L +31.6124 10.485 L +f +%AI6_EndPatternLayer +) & +(0 O 0 R 0 0 0 0.3 k + 0 0 0 0.3 K +) @ +( +%AI6_BeginPatternLayer +800 Ar +0 J 0 j 1 w 4 M []0 d +%AI3_Note: +0 D +0 XR +31.6129 17.2066 m +15.4064 17.2085 L +15.4064 1 L +22.1301 1 L +22.1301 10.4868 L +31.6129 10.4868 L +31.6129 17.2066 L +f +%AI6_EndPatternLayer +) & +(0 O 0 R 0 0 0 0.5 k + 0 0 0 0.5 K +) @ +( +%AI6_BeginPatternLayer +800 Ar +0 J 0 j 1 w 4 M []0 d +%AI3_Note: +0 D +0 XR +31.6149 18.3658 m +14.2517 18.3658 L +14.2515 1.0009 L +15.4043 1.0009 L +15.4043 17.2093 L +31.6149 17.2093 L +31.6149 18.3658 L +f +%AI6_EndPatternLayer +) & +(0 O 0 R 0 0 0 0.4 k + 0 0 0 0.4 K +) @ +( +%AI6_BeginPatternLayer +800 Ar +0 J 0 j 1 w 4 M []0 d +%AI3_Note: +0 D +0 XR +31.6124 30.4755 m +2.1395 30.4755 L +2.1395 1.0015 L +14.249 1 L +14.249 18.366 L +31.6149 18.366 L +31.6124 30.4755 L +f +%AI6_EndPatternLayer +) & +(0 O 0 R 0 0 0 0.6 k + 0 0 0 0.6 K +) @ +( +%AI6_BeginPatternLayer +800 Ar +0 J 0 j 1 w 4 M []0 d +%AI3_Note: +0 D +0 XR +15.4066 16.847 m +14.2778 18.3257 l +15.4066 17.2057 l +15.4066 16.847 l +f +%AI6_EndPatternLayer +) & +(0 O 0 R 0 0 0 0.5 k + 0 0 0 0.5 K +) @ +( +%AI6_BeginPatternLayer +800 Ar +0 J 0 j 1 w 4 M []0 d +%AI3_Note: +0 D +0 XR +23.1095 9.1906 m +22.1759 10.4392 l +23.1082 9.505 l +23.1095 9.1906 l +f +%AI6_EndPatternLayer +) & +(0 O 0 R 0 0 0 0.4 k + 0 0 0 0.4 K +) @ +( +%AI6_BeginPatternLayer +800 Ar +0 J 0 j 1 w 4 M []0 d +%AI3_Note: +0 D +0 XR +27.8039 4.6026 m +27.1619 5.4533 l +27.8029 4.8093 l +27.8039 4.6026 l +f +%AI6_EndPatternLayer +) & +] E +%AI3_EndPattern +%AI3_BeginPattern: (TriBevel.side) +(TriBevel.side) 1.0006 1 29.0006 31.6124 [ +%AI3_Tile +(0 O 0 R 0 0 0 0.3 k + 0 0 0 0.3 K +) @ +( +%AI6_BeginPatternLayer +800 Ar +0 J 0 j 1 w 4 M []0 d +%AI3_Note: +0 D +0 XR +29 4.8087 m +29 4.8087 L +29.0026 5.4927 L +1.0026 5.4927 L +1 4.8087 L +1 4.8087 L +29 4.8087 L +f +%AI6_EndPatternLayer +) & +(0 O 0 R 0 0 0 0.2 k + 0 0 0 0.2 K +) @ +( +%AI6_BeginPatternLayer +800 Ar +0 J 0 j 1 w 4 M []0 d +%AI3_Note: +0 D +0 XR +29.0026 5.4927 m +29.0005 9.5045 L +1.0005 9.5045 L +1.0026 5.4927 L +29.0026 5.4927 L +f +%AI6_EndPatternLayer +) & +(0 O 0 R 0 0 0 0.4 k + 0 0 0 0.4 K +) @ +( +%AI6_BeginPatternLayer +800 Ar +0 J 0 j 1 w 4 M []0 d +%AI3_Note: +0 D +0 XR +29.0005 9.5045 m +29.0011 10.4865 L +1.0011 10.4865 L +1.0005 9.5045 L +29.0005 9.5045 L +f +%AI6_EndPatternLayer +) & +(0 O 0 R 0 0 0 0.3 k + 0 0 0 0.3 K +) @ +( +%AI6_BeginPatternLayer +800 Ar +0 J 0 j 1 w 4 M []0 d +%AI3_Note: +0 D +0 XR +29.0011 10.4865 m +29.003 17.209 L +1.003 17.209 L +1.0011 10.4865 L +29.0011 10.4865 L +f +%AI6_EndPatternLayer +) & +(0 O 0 R 0 0 0 0.5 k + 0 0 0 0.5 K +) @ +( +%AI6_BeginPatternLayer +800 Ar +0 J 0 j 1 w 4 M []0 d +%AI3_Note: +0 D +0 XR +29.003 17.209 m +29.0031 18.3656 L +1.0031 18.3656 L +1.003 17.209 L +29.003 17.209 L +f +%AI6_EndPatternLayer +) & +(0 O 0 R 0 0 0 0.4 k + 0 0 0 0.4 K +) @ +( +%AI6_BeginPatternLayer +800 Ar +0 J 0 j 1 w 4 M []0 d +%AI3_Note: +0 D +0 XR +29.0031 18.3656 m +29.0006 30.4752 L +1.0006 30.4752 L +1.0031 18.3656 L +29.0031 18.3656 L +f +%AI6_EndPatternLayer +) & +] E +%AI3_EndPattern +%AI3_BeginPattern: (Waves-scroll) +(Waves-scroll) 17.926 10.516 68.663 69.012 [ +%AI3_Tile +(0 O 0 R 1 0 0.3 0 k + 1 0 0.3 0 K +) @ +( +%AI6_BeginPatternLayer +800 Ar +0 J 0 j 1 w 4 M []0 d +%AI3_Note: +1 D +0 XR +17.926 69.012 m +17.926 10.516 L +68.663 10.516 L +68.663 69.012 L +17.926 69.012 L +f +%AI6_EndPatternLayer +) & +(0 O 0 R 0.55 0 0 0 k + 0.55 0 0 0 K +) @ +( +%AI6_BeginPatternLayer +800 Ar +0 J 0 j 0.75 w 4 M []0 d +%AI3_Note: +0 D +0 XR +65.335 70.465 m +65.881 68.746 67.444 68.168 68.663 69.012 C +67.538 69.668 68.011 71.255 69.686 70.933 c +72.124 70.464 71.894 67.213 70.53 65.589 c +68.561 63.245 64.565 60.995 53.241 71.117 C +S +39.964 70.465 m +40.511 68.746 42.074 68.168 43.293 69.012 C +42.168 69.668 42.64 71.255 44.316 70.933 c +46.753 70.464 46.524 67.213 45.16 65.589 c +43.191 63.245 39.195 60.995 27.87 71.117 c +S +14.594 70.465 m +15.141 68.746 16.704 68.168 17.923 69.012 C +16.798 69.668 17.27 71.255 18.945 70.933 c +21.382 70.464 21.153 67.213 19.789 65.589 c +17.821 63.245 13.825 60.995 2.5 71.117 c +S +10.959 51.619 m +22.282 41.497 26.278 43.747 28.247 46.09 c +29.611 47.715 29.841 50.965 27.403 51.434 c +25.728 51.757 25.255 50.169 26.38 49.513 C +25.161 48.669 23.599 49.248 23.052 50.966 c +22.723 51.997 23.38 53.966 24.872 54.903 c +27.267 56.406 31.371 56.05 36.328 51.619 c +47.653 41.497 51.649 43.746 53.618 46.09 c +54.982 47.715 55.212 50.965 52.774 51.434 c +51.099 51.757 50.626 50.169 51.751 49.513 C +50.532 48.669 48.97 49.248 48.423 50.966 c +48.094 51.997 48.751 53.966 50.243 54.903 c +52.638 56.406 56.742 56.05 61.699 51.619 C +73.024 41.497 77.02 43.747 78.988 46.09 c +S +70.156 32.12 m +65.199 36.551 61.095 36.907 58.7 35.404 c +57.208 34.468 56.552 32.499 56.88 31.468 c +57.427 29.749 58.99 29.171 60.208 30.015 C +59.083 30.671 59.556 32.258 61.231 31.936 c +63.669 31.467 63.439 28.216 62.075 26.592 c +60.106 24.248 56.11 21.998 44.786 32.12 C +39.829 36.551 35.725 36.907 33.33 35.404 c +31.838 34.468 31.182 32.499 31.51 31.468 c +32.056 29.749 33.619 29.171 34.838 30.015 C +33.713 30.671 34.186 32.258 35.861 31.936 c +38.299 31.467 38.069 28.216 36.705 26.592 c +34.737 24.248 30.74 21.998 19.415 32.12 c +14.458 36.551 10.354 36.907 7.96 35.404 c +S +19.792 7.094 m +21.157 8.719 21.386 11.968 18.949 12.437 c +17.274 12.76 16.801 11.172 17.926 10.516 C +16.708 9.673 15.145 10.252 14.598 11.969 c +14.27 13 14.926 14.969 16.418 15.906 c +18.812 17.409 22.916 17.053 27.874 12.622 c +39.199 2.5 43.195 4.75 45.163 7.094 c +46.528 8.719 46.757 11.968 44.32 12.437 c +42.644 12.76 42.172 11.172 43.297 10.516 C +42.078 9.673 40.515 10.252 39.968 11.969 c +39.64 13 40.297 14.969 41.788 15.906 c +44.183 17.409 48.287 17.053 53.245 12.622 C +64.569 2.5 68.565 4.75 70.534 7.094 c +71.898 8.719 72.127 11.968 69.69 12.437 c +68.014 12.76 67.542 11.172 68.667 10.516 C +67.448 9.673 65.885 10.252 65.338 11.969 c +65.011 13 65.667 14.969 67.159 15.906 c +69.553 17.409 73.657 17.053 78.615 12.622 c +S +%AI6_EndPatternLayer +) & +] E +%AI3_EndPattern +%AI5_End_NonPrinting-- +%AI5_Begin_NonPrinting +Np +12 Bn +%AI5_BeginGradient: (Black, White) +(Black, White) 0 2 Bd +[ +< +FFFEFDFCFBFAF9F8F7F6F5F4F3F2F1F0EFEEEDECEBEAE9E8E7E6E5E4E3E2E1E0DFDEDDDCDBDAD9D8 +D7D6D5D4D3D2D1D0CFCECDCCCBCAC9C8C7C6C5C4C3C2C1C0BFBEBDBCBBBAB9B8B7B6B5B4B3B2B1B0 +AFAEADACABAAA9A8A7A6A5A4A3A2A1A09F9E9D9C9B9A999897969594939291908F8E8D8C8B8A8988 +87868584838281807F7E7D7C7B7A797877767574737271706F6E6D6C6B6A69686766656463626160 +5F5E5D5C5B5A595857565554535251504F4E4D4C4B4A494847464544434241403F3E3D3C3B3A3938 +37363534333231302F2E2D2C2B2A292827262524232221201F1E1D1C1B1A19181716151413121110 +0F0E0D0C0B0A09080706050403020100 +> +0 %_Br +[ +0 0 50 100 %_Bs +1 0 50 0 %_Bs +BD +%AI5_EndGradient +%AI5_BeginGradient: (Chrome) +(Chrome) 0 6 Bd +[ +0 +< +464646454545444444444343434342424241414141404040403F3F3F3E3E3E3E3D3D3D3C3C3C3C3B +3B3B3B3A3A3A39393939383838383737373636363635353535343434333333333232323131313130 +3030302F2F2F2E2E2E2E2D2D2D2D2C2C2C2B2B2B2B2A2A2A2A292929282828282727272726262625 +2525252424242323232322222222212121202020201F1F1F1F1E1E1E1D1D1D1D1C1C1C1C1B1B1B1A +1A1A1A1919191818181817171717161616151515151414141413131312121212111111101010100F +0F0F0F0E0E0E0D0D0D0D0C0C0C0C0B0B0B0A0A0A0A09090909080808070707070606060505050504 +04040403030302020202010101010000 +> +< +FFFEFDFCFBFAF9F8F7F6F5F4F3F2F1F0EFEEEDECEBEAE9E8E7E6E5E4E3E2E1E0DFDEDDDCDBDAD9D8 +D7D6D5D4D3D2D1D0CFCECDCCCBCAC9C8C7C6C5C4C3C2C1C0BFBEBDBCBBBAB9B8B7B6B5B4B3B2B1B0 +AFAEADACABAAA9A8A7A6A5A4A3A2A1A09F9E9D9C9B9A999897969594939291908F8E8D8C8B8A8988 +87868584838281807F7E7D7C7B7A797877767574737271706F6E6D6C6B6A69686766656463626160 +5F5E5D5C5B5A595857565554535251504F4E4D4C4B4A494847464544434241403F3E3D3C3B3A3938 +37363534333231302F2E2D2C2B2A292827262524232221201F1E1D1C1B1A19181716151413121110 +0F0E0D0C0B0A09080706050403020100 +> +< +1F1E1E1E1E1E1E1E1E1E1D1D1D1D1D1D1D1D1C1C1C1C1C1C1C1C1B1B1B1B1B1B1B1B1B1A1A1A1A1A +1A1A1A19191919191919191818181818181818181717171717171717161616161616161615151515 +15151515151414141414141414131313131313131312121212121212121211111111111111111010 +1010101010100F0F0F0F0F0F0F0F0F0E0E0E0E0E0E0E0E0D0D0D0D0D0D0D0D0C0C0C0C0C0C0C0C0C +0B0B0B0B0B0B0B0B0A0A0A0A0A0A0A0A090909090909090909080808080808080807070707070707 +07060606060606060606050505050505050504040404040404040303030303030303030202020202 +02020201010101010101010000000000 +> +1 %_Br +0 +0.275 +1 +< +6B6A696867666564636261605F5E5D5C5B5A595857565554535251504F4E4D4C4B4A494847464544 +434241403F3E3D3C3B3A393837363534333231302F2E2D2C2B2A292827262524232221201F +> +1 %_Br +0 +< +00000101010102020202030303040404040505050506060607070707080808090909090A0A0A0A0B +0B0B0C0C0C0C0D0D0D0D0E0E0E0F0F0F0F1010101011111112121212131313141414141515151516 +161617171717181818181919191A1A1A1A1B1B1B1B1C1C1C1D1D1D1D1E1E1E1F1F1F1F2020202021 +212122222222232323232424242525252526262626272727282828282929292A2A2A2A2B2B2B2B2C +2C2C2D2D2D2D2E2E2E2E2F2F2F303030303131313132323233333333343434353535353636363637 +373738383838393939393A3A3A3B3B3B3B3C3C3C3C3D3D3D3E3E3E3E3F3F3F404040404141414142 +42424343434344444444454545464646 +> +< +000102030405060708090A0B0C0D0E0F101112131415161718191A1B1C1D1E1F2021222324252627 +28292A2B2C2D2E2F303132333435363738393A3B3C3D3E3F404142434445464748494A4B4C4D4E4F +505152535455565758595A5B5C5D5E5F606162636465666768696A6B6C6D6E6F7071727374757677 +78797A7B7C7D7E7F808182838485868788898A8B8C8D8E8F909192939495969798999A9B9C9D9E9F +A0A1A2A3A4A5A6A7A8A9AAABACADAEAFB0B1B2B3B4B5B6B7B8B9BABBBCBDBEBFC0C1C2C3C4C5C6C7 +C8C9CACBCCCDCECFD0D1D2D3D4D5D6D7D8D9DADBDCDDDEDFE0E1E2E3E4E5E6E7E8E9EAEBECEDEEEF +F0F1F2F3F4F5F6F7F8F9FAFBFCFDFEFF +> +< +00000101020203030304040505050606070708080809090A0A0A0B0B0C0C0D0D0D0E0E0F0F101010 +1111121212131314141515151616171718181819191A1A1A1B1B1C1C1D1D1D1E1E1F1F1F20202121 +222222232324242525252626272727282829292A2A2A2B2B2C2C2D2D2D2E2E2F2F2F303031313232 +32333334343435353636373737383839393A3A3A3B3B3C3C3C3D3D3E3E3F3F3F4040414142424243 +434444444545464647474748484949494A4A4B4B4C4C4C4D4D4E4E4F4F4F50505151515252535354 +54545555565657575758585959595A5A5B5B5C5C5C5D5D5E5E5F5F5F606061616162626363646464 +6565666666676768686969696A6A6B6B +> +1 %_Br +1 +0 %_Br +< +FFFEFDFCFBFAF9F8F7F6F5F4F3F2F1F0EFEEEDECEBEAE9E8E7E6E5E4E3E2E1E0DFDEDDDCDBDAD9D8 +D7D6D5D4D3D2D1D0CFCECDCCCBCAC9C8C7C6C5C4C3C2C1C0BFBEBDBCBBBAB9B8B7B6B5B4B3B2B1B0 +AFAEADACABAAA9A8A7A6A5A4A3A2A1A09F9E9D9C9B9A999897969594939291908F8E8D8C8B8A8988 +87868584838281807F7E7D7C7B7A797877767574737271706F6E6D6C6B6A69686766656463626160 +5F5E5D5C5B5A595857565554535251504F4E4D4C4B4A494847464544434241403F3E3D3C3B3A3938 +37363534333231302F2E2D2C2B2A292827262524232221201F1E1D1C1B1A19181716151413121110 +0F0E0D0C0B0A09080706050403020100 +> +< +4D4C4C4C4B4B4B4A4A4A4A4949494848484747474746464645454544444444434343424242414141 +414040403F3F3F3E3E3E3E3D3D3D3C3C3C3B3B3B3B3A3A3A39393938383838373737363636353535 +35343434333333323232323131313030302F2F2F2F2E2E2E2D2D2D2C2C2C2C2B2B2B2A2A2A292929 +292828282727272626262625252524242423232323222222212121202020201F1F1F1E1E1E1D1D1D +1D1C1C1C1B1B1B1A1A1A1A1919191818181717171716161615151514141414131313121212111111 +111010100F0F0F0E0E0E0E0D0D0D0C0C0C0B0B0B0B0A0A0A09090908080808070707060606050505 +05040404030303020202020101010000 +> +0 +0 +1 %_Br +[ +1 0 50 92 %_Bs +0 0.275 1 0.12 1 50 59 %_Bs +0 0.275 1 0.42 1 50 50 %_Bs +1 0 50 49 %_Bs +1 0 50 41 %_Bs +1 0.3 0 0 1 50 0 %_Bs +BD +%AI5_EndGradient +%AI5_BeginGradient: (Green, Blue) +(Green, Blue) 0 2 Bd +[ +< +99999A9A9B9B9B9C9C9D9D9D9E9E9F9F9FA0A0A1A1A1A2A2A3A3A3A4A4A5A5A5A6A6A7A7A7A8A8A9 +A9A9AAAAABABABACACADADADAEAEAFAFAFB0B0B1B1B1B2B2B3B3B3B4B4B5B5B5B6B6B7B7B7B8B8B9 +B9B9BABABBBBBBBCBCBDBDBDBEBEBFBFBFC0C0C1C1C1C2C2C3C3C3C4C4C5C5C5C6C6C7C7C7C8C8C9 +C9C9CACACBCBCBCCCCCDCDCDCECECFCFCFD0D0D1D1D1D2D2D3D3D3D4D4D5D5D5D6D6D7D7D7D8D8D9 +D9D9DADADBDBDBDCDCDDDDDDDEDEDFDFDFE0E0E1E1E1E2E2E3E3E3E4E4E5E5E5E6E6E7E7E7E8E8E9 +E9E9EAEAEBEBEBECECEDEDEDEEEEEFEFEFF0F0F1F1F1F2F2F3F3F3F4F4F5F5F5F6F6F7F7F7F8F8F9 +F9F9FAFAFBFBFBFCFCFDFDFDFEFEFFFF +> +< +000102020304050506070808090A0B0B0C0D0E0E0F101111121314141516171718191A1A1B1C1D1D +1E1F20202122232324252626272829292A2B2C2C2D2E2F2F303132323334353536373838393A3B3B +3C3D3E3E3F404141424344444546474748494A4A4B4C4D4D4E4F5050515253535455565657585959 +5A5B5C5C5D5E5F5F606162626364656566676868696A6B6B6C6D6E6E6F7071717273747475767777 +78797A7A7B7C7D7D7E7F80808182828384858586878888898A8B8B8C8D8E8E8F9091919293949495 +96979798999A9A9B9C9D9D9E9FA0A0A1A2A3A3A4A5A6A6A7A8A9A9AAABACACADAEAFAFB0B1B2B2B3 +B4B5B5B6B7B8B8B9BABBBBBCBDBEBEBF +> +< +FFFEFDFCFBFAF9F8F7F6F5F4F3F2F1F0EFEEEDECEBEAE9E8E7E6E5E4E3E2E1E0DFDEDDDCDBDAD9D8 +D7D6D5D4D3D2D1D0CFCECDCCCBCAC9C8C7C6C5C4C3C2C1C0BFBEBDBCBBBAB9B8B7B6B5B4B3B2B1B0 +AFAEADACABAAA9A8A7A6A5A4A3A2A1A09F9E9D9C9B9A999897969594939291908F8E8D8C8B8A8988 +87868584838281807F7E7D7C7B7A797877767574737271706F6E6D6C6B6A69686766656463626160 +5F5E5D5C5B5A595857565554535251504F4E4D4C4B4A494847464544434241403F3E3D3C3B3A3938 +37363534333231302F2E2D2C2B2A292827262524232221201F1E1D1C1B1A19181716151413121110 +0F0E0D0C0B0A09080706050403020100 +> +0 +1 %_Br +[ +1 0.75 0 0 1 50 100 %_Bs +0.6 0 1 0 1 50 0 %_Bs +BD +%AI5_EndGradient +%AI5_BeginGradient: (Orange, Green, Violet) +(Orange, Green, Violet) 0 3 Bd +[ +< +F0EFEFEFEEEEEEEDEDEDECECECEBEBEBEAEAEAE9E9E9E8E8E8E7E7E7E6E6E6E5E5E5E4E4E4E3E3E3 +E3E2E2E2E1E1E1E0E0E0DFDFDFDEDEDEDDDDDDDCDCDCDBDBDBDADADAD9D9D9D8D8D8D7D7D7D6D6D6 +D5D5D5D4D4D4D3D3D3D2D2D2D1D1D1D0D0D0CFCFCFCECECECDCDCDCCCCCCCBCBCBCACACAC9C9C9C8 +C8C8C7C7C7C6C6C6C5C5C5C4C4C4C3C3C3C2C2C2C2C1C1C1C0C0C0BFBFBFBEBEBEBDBDBDBCBCBCBB +BBBBBABABAB9B9B9B8B8B8B7B7B7B6B6B6B5B5B5B4B4B4B3B3B3B2B2B2B1B1B1B0B0B0AFAFAFAEAE +AEADADADACACACABABABAAAAAAA9A9A9A8A8A8A7A7A7A6A6A6A5A5A5A4A4A4A3A3A3A2A2A2A1A1A1 +A0A0A0A09F9F9F9E9E9E9D9D9D9C9C9C +> +< +5455555657575859595A5A5B5C5C5D5E5E5F5F6061616263636465656666676868696A6A6B6B6C6D +6D6E6F6F707171727273747475767677777879797A7B7B7C7C7D7E7E7F8080818282838384858586 +87878888898A8A8B8C8C8D8D8E8F8F909191929393949495969697989899999A9B9B9C9D9D9E9E9F +A0A0A1A2A2A3A4A4A5A5A6A7A7A8A9A9AAAAABACACADAEAEAFAFB0B1B1B2B3B3B4B5B5B6B6B7B8B8 +B9BABABBBBBCBDBDBEBFBFC0C1C1C2C2C3C4C4C5C6C6C7C7C8C9C9CACBCBCCCCCDCECECFD0D0D1D2 +D2D3D3D4D5D5D6D7D7D8D8D9DADADBDCDCDDDDDEDFDFE0E1E1E2E3E3E4E4E5E6E6E7E8E8E9E9EAEB +EBECEDEDEEEFEFF0F0F1F2F2F3F4F4F5 +> +< +FFFEFDFCFBFAF9F8F7F6F5F4F3F2F1F0EFEEEDECEBEAE9E8E7E6E5E4E3E2E1E0DFDEDDDCDBDAD9D8 +D7D6D5D4D3D2D1D0CFCECDCCCBCAC9C8C7C6C5C4C3C2C1C0BFBEBDBCBBBAB9B8B7B6B5B4B3B2B1B0 +AFAEADACABAAA9A8A7A6A5A4A3A2A1A09F9E9D9C9B9A999897969594939291908F8E8D8C8B8A8988 +87868584838281807F7E7D7C7B7A797877767574737271706F6E6D6C6B6A69686766656463626160 +5F5E5D5C5B5A595857565554535251504F4E4D4C4B4A494847464544434241403F3E3D3C3B3A3938 +37363534333231302F2E2D2C2B2A292827262524232221201F1E1D1C1B1A19181716151413121110 +0F0E0D0C0B0A09080706050403020100 +> +< +00000000000000000000000000000000000000000000000000000000000000000000000000000000 +00000000000000000000000101010101010101010101010101010101010101010101010101010101 +01010101010101010101010101010101010101010101010101010101010101010101010101010101 +01010101010101010101010101010101010101010101010101010101010101020202020202020202 +02020202020202020202020202020202020202020202020202020202020202020202020202020202 +02020202020202020202020202020202020202020202020202020202020202020202020202020202 +02020202020202020202020303030303 +> +1 %_Br +< +000102030405060708090A0B0C0D0E0F101112131415161718191A1B1C1D1E1F2021222324252627 +28292A2B2C2D2E2F303132333435363738393A3B3C3D3E3F404142434445464748494A4B4C4D4E4F +505152535455565758595A5B5C5D5E5F606162636465666768696A6B6C6D6E6F7071727374757677 +78797A7B7C7D7E7F808182838485868788898A8B8C8D8E8F909192939495969798999A9B9C9D9E9F +A0A1A2A3A4A5A6A7A8A9AAABACADAEAFB0B1B2B3B4B5B6B7B8B9BABBBCBDBEBFC0C1C2C3C4C5C6C7 +C8C9CACBCCCDCECFD0D1D2D3D4D5D6D7D8D9DADBDCDDDEDFE0E1E2E3E4E5E6E7E8E9EAEBECEDEEEF +F0 +> +< +A1A0A0A09F9F9F9E9E9E9D9D9D9D9C9C9C9B9B9B9A9A9A9999999898989797979696969595959594 +94949393939292929191919090908F8F8F8E8E8E8E8D8D8D8C8C8C8B8B8B8A8A8A89898988888887 +878787868686858585848484838383828282818181808080807F7F7F7E7E7E7D7D7D7C7C7C7B7B7B +7A7A7A79797978787878777777767676757575747474737373727272717171717070706F6F6F6E6E +6E6D6D6D6C6C6C6B6B6B6A6A6A6A6969696868686767676666666565656464646363636262626261 +61616060605F5F5F5E5E5E5D5D5D5C5C5C5B5B5B5B5A5A5A59595958585857575756565655555554 +54 +> +< +F5F5F5F5F5F5F5F5F5F5F5F5F5F5F5F5F5F6F6F6F6F6F6F6F6F6F6F6F6F6F6F6F6F6F6F6F6F6F6F6 +F7F7F7F7F7F7F7F7F7F7F7F7F7F7F7F7F7F7F7F7F7F7F7F7F8F8F8F8F8F8F8F8F8F8F8F8F8F8F8F8 +F8F8F8F8F8F8F8F8F9F9F9F9F9F9F9F9F9F9F9F9F9F9F9F9F9F9F9F9F9F9F9FAFAFAFAFAFAFAFAFA +FAFAFAFAFAFAFAFAFAFAFAFAFAFAFAFBFBFBFBFBFBFBFBFBFBFBFBFBFBFBFBFBFBFBFBFBFBFBFCFC +FCFCFCFCFCFCFCFCFCFCFCFCFCFCFCFCFCFCFCFCFCFCFDFDFDFDFDFDFDFDFDFDFDFDFDFDFDFDFDFD +FDFDFDFDFDFEFEFEFEFEFEFEFEFEFEFEFEFEFEFEFEFEFEFEFEFEFEFEFEFFFFFFFFFFFFFFFFFFFFFF +FF +> +0 +1 %_Br +[ +0.61 0.96 0 0.01 1 50 100 %_Bs +0.94 0.33 1 0 1 50 50 %_Bs +0 0.63 0.96 0 1 50 0 %_Bs +BD +%AI5_EndGradient +%AI5_BeginGradient: (Pink, Yellow, Green ) +(Pink, Yellow, Green ) 0 3 Bd +[ +< +000102030405060708090A0B0C0D0E0F101112131415161718191A1B1C1D1E1F2021222324252627 +28292A2B2C2D2E2F303132333435363738393A3B3C3D3E3F404142434445464748494A4B4C4E4F50 +5152535455565758595A5B5C5D5E5F606162636465666768696A6B6C6D6E6F70717273 +> +< +05050505050505050505050505050404040404040404040404040404040404040404040403030303 +03030303030303030303030303030303030303020202020202020202020202020202020202020202 +0201010101010101010101010101010101010101010101000000000000000000000000 +> +< +CCCCCCCCCCCBCBCBCBCBCBCBCBCBCACACACACACACACACAC9C9C9C9C9C9C9C9C9C8C8C8C8C8C8C8C8 +C8C7C7C7C7C7C7C7C7C7C6C6C6C6C6C6C6C6C6C5C5C5C5C5C5C5C5C5C4C4C4C4C4C4C4C4C3C3C3C3 +C3C3C3C3C3C2C2C2C2C2C2C2C2C2C1C1C1C1C1C1C1C1C1C0C0C0C0C0C0C0C0C0BFBFBF +> +0 +1 %_Br +< +0D0D0D0D0D0D0D0D0D0D0D0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0B +0B0B0B0B0B0B0B0B0B0B0B0B0B0B0B0B0B0B0B0B0B0B0A0A0A0A0A0A0A0A0A0A0A0A0A0A0A0A0A0A +0A0A0A09090909090909090909090909090909090909090808080808080808080808080808080808 +08080807070707070707070707070707070707070706060606060606060606060606060606060605 +05050505050505050505050505050505050404040404040404040404040404040404030303030303 +03030303030303030303030202020202020202020202020202020201010101010101010101010101 +010101000000000000000000 +> +< +B2B2B2B2B1B1B1B0B0B0AFAFAEAEAEADADACACABABAAAAA9A9A8A8A7A7A6A6A5A5A4A4A3A3A2A2A1 +A0A09F9F9E9E9D9D9C9B9B9A9A999898979796959594949392929190908F8F8E8D8D8C8B8B8A8989 +88888786868584848382828180807F7E7D7D7C7B7B7A7979787777767575747372727170706F6E6D +6D6C6B6B6A69686867666565646363626160605F5E5D5D5C5B5A5A59585757565554545352515150 +4F4E4D4D4C4B4A4A4948474646454443434241403F3F3E3D3C3B3B3A393837373635343333323130 +2F2F2E2D2C2B2B2A2928272726252423222221201F1E1D1D1C1B1A1918181716151413131211100F +0E0E0D0C0B0A090908070605 +> +< +0000010101020202030304040505060607070808090A0A0B0B0C0C0D0E0E0F0F1011111213131415 +151616171818191A1B1B1C1D1D1E1F1F202122222324242526272728292A2A2B2C2C2D2E2F303031 +323333343536363738393A3A3B3C3D3E3E3F4041424243444546464748494A4B4B4C4D4E4F505051 +5253545556565758595A5B5B5C5D5E5F6061626263646566676869696A6B6C6D6E6F707171727374 +75767778797A7B7B7C7D7E7F80818283848586868788898A8B8C8D8E8F9091929394949596979899 +9A9B9C9D9E9FA0A1A2A3A4A5A6A7A8A9AAAAABACADAEAFB0B1B2B3B4B5B6B7B8B9BABBBCBDBEBFC0 +C1C2C3C4C5C6C7C8C9CACBCC +> +0 +1 %_Br +[ +0.45 0 0.75 0 1 50 100 %_Bs +0 0.02 0.8 0 1 50 64 %_Bs +0.05 0.7 0 0 1 57 0 %_Bs +BD +%AI5_EndGradient +%AI5_BeginGradient: (Purple, Red, Yellow) +(Purple, Red, Yellow) 0 3 Bd +[ +0 +< +FFFEFDFCFBFAF9F8F7F6F5F4F3F2F1F0EFEEEDECEBEAE9E8E7E6E5E4E3E2E1E0DFDEDDDCDBDAD9D8 +D7D6D5D4D3D2D1D0CFCECDCCCBCAC9C8C7C6C5C4C3C2C1C0BFBEBDBCBBBAB9B8B7B6B5B4B3B2B1B0 +AFAEADACABAAA9A8A7A6A5A4A3A2A1A09F9E9D9C9B9A999897969594939291908F8E8D8C8B8A8988 +87868584838281807F7E7D7C7B7A797877767574737271706F6E6D6C6B6A69686766656463626160 +5F5E5D5C5B5A595857565554535251504F4E4D4C4B4A494847464544434241403F3E3D3C3B3A3938 +37363534333231302F2E2D2C2B2A292827262524232221201F1E1D1C1B1A19181716151413121110 +0F0E0D0C0B0A +> +< +CCCCCCCDCDCDCDCDCECECECECECFCFCFCFD0D0D0D0D0D1D1D1D1D1D2D2D2D2D2D3D3D3D3D3D4D4D4 +D4D5D5D5D5D5D6D6D6D6D6D7D7D7D7D7D8D8D8D8D8D9D9D9D9DADADADADADBDBDBDBDBDCDCDCDCDC +DDDDDDDDDDDEDEDEDEDFDFDFDFDFE0E0E0E0E0E1E1E1E1E1E2E2E2E2E2E3E3E3E3E4E4E4E4E4E5E5 +E5E5E5E6E6E6E6E6E7E7E7E7E7E8E8E8E8E9E9E9E9E9EAEAEAEAEAEBEBEBEBEBECECECECECEDEDED +EDEEEEEEEEEEEFEFEFEFEFF0F0F0F0F0F1F1F1F1F1F2F2F2F2F3F3F3F3F3F4F4F4F4F4F5F5F5F5F5 +F6F6F6F6F6F7F7F7F7F8F8F8F8F8F9F9F9F9F9FAFAFAFAFAFBFBFBFBFBFCFCFCFCFDFDFDFDFDFEFE +FEFEFEFFFFFF +> +0 +1 %_Br +< +E5E4E3E2E1E0DFDEDDDCDBDAD9D8D7D6D5D4D3D2D1D0CFCECDCCCBCAC9C8C7C6C5C4C3C2C1C0BFBE +BDBCBBBAB9B8B7B6B5B4B3B2B1B0AFAEADACABAAA9A8A7A6A5A4A3A2A1A09F9E9D9C9B9A99989796 +9594939291908F8E8D8C8B8A898887868584838281807F7E7D7C7B7A797877767574737271706F6E +6D6C6B6A696867666564636261605F5E5D5C5B5A595857565554535251504F4E4D4C4B4A49484746 +4544434241403F3E3D3C3B3A393837363534333231302F2E2D2C2B2A292827262524232221201F1E +1D1C1B1A191817161514131211100F0E0D0C0B0A09080706050403020100 +> +< +E5E6E6E6E6E6E6E6E6E7E7E7E7E7E7E7E7E7E8E8E8E8E8E8E8E8E8E9E9E9E9E9E9E9E9E9EAEAEAEA +EAEAEAEAEAEBEBEBEBEBEBEBEBEBECECECECECECECECECEDEDEDEDEDEDEDEDEDEEEEEEEEEEEEEEEE +EEEFEFEFEFEFEFEFEFEFF0F0F0F0F0F0F0F0F0F1F1F1F1F1F1F1F1F1F2F2F2F2F2F2F2F2F2F3F3F3 +F3F3F3F3F3F3F4F4F4F4F4F4F4F4F4F5F5F5F5F5F5F5F5F5F6F6F6F6F6F6F6F6F6F7F7F7F7F7F7F7 +F7F7F8F8F8F8F8F8F8F8F8F9F9F9F9F9F9F9F9F9FAFAFAFAFAFAFAFAFAFBFBFBFBFBFBFBFBFBFCFC +FCFCFCFCFCFCFCFDFDFDFDFDFDFDFDFDFEFEFEFEFEFEFEFEFEFFFFFFFFFF +> +< +00010203040405060708090A0B0C0C0D0E0F10111213141415161718191A1B1C1D1D1E1F20212223 +242525262728292A2B2C2D2D2E2F30313233343535363738393A3B3C3D3D3E3F4041424344454546 +4748494A4B4C4D4E4E4F50515253545556565758595A5B5C5D5E5E5F60616263646566666768696A +6B6C6D6E6E6F70717273747576767778797A7B7C7D7E7F7F80818283848586878788898A8B8C8D8E +8F8F90919293949596979798999A9B9C9D9E9F9FA0A1A2A3A4A5A6A7A7A8A9AAABACADAEAFAFB0B1 +B2B3B4B5B6B7B8B8B9BABBBCBDBEBFC0C0C1C2C3C4C5C6C7C8C8C9CACBCC +> +0 +1 %_Br +[ +0 0.04 1 0 1 50 100 %_Bs +0 1 0.8 0 1 50 50 %_Bs +0.9 0.9 0 0 1 50 0 %_Bs +BD +%AI5_EndGradient +%AI5_BeginGradient: (Rainbow) +(Rainbow) 0 6 Bd +[ +< +FFFEFDFCFBFAF9F8F7F6F5F4F3F2F1F0EFEEEDECEBEAE9E8E7E6E5E4E3E2E1E0DFDEDDDCDBDAD9D8 +D7D6D5D4D3D2D1D0CFCECDCCCBCAC9C8C7C6C5C4C3C2C1C0BFBEBDBCBBBAB9B8B7B6B5B4B3B2B1B0 +AFAEADACABAAA9A8A7A6A5A4A3A2A1A09F9E9D9C9B9A999897969594939291908F8E8D8C8B8A8988 +87868584838281807F7E7D7C7B7A797877767574737271706F6E6D6C6B6A69686766656463626160 +5F5E5D5C5B5A595857565554535251504F4E4D4C4B4A494847464544434241403F3E3D3C3B3A3938 +37363534333231302F2E2D2C2B2A292827262524232221201F1E1D1C1B1A19181716151413121110 +0F0E0D0C0B0A09080706050403020100 +> +1 +0 +0 +1 %_Br +1 +< +0708090A0B0C0D0E0F101112131415161718191A1B1C1D1E1F202122232425262728292A2B2C2D2E +2F303132333435363738393A3B3C3D3E3F404142434445464748494A4B4C4D4E4F50515253545556 +5758595A5B5C5D5E5F606162636465666768696A6B6C6D6E6F707172737475767778797A7B7C7D7E +7F808182838485868788898A8B8C8D8E8F909192939495969798999A9B9C9D9E9FA0A1A2A3A4A5A6 +A7A8A9AAABACADAEAFB0B1B2B3B4B5B6B7B8B9BABBBCBDBEBFC0C1C2C3C4C5C6C7C8C9CACBCCCDCE +CFD0D1D2D3D4D5D6D7D8D9DADBDCDDDEDFE0E1E2E3E4E5E6E7E8E9EAEBECEDEEEFF0F1F2F3F4F5F6 +F7F8F9FAFBFCFDFEFF +> +0 +0 +1 %_Br +1 +< +00000000000000000000000000000000000001010101010101010101010101010101010101010101 +01010101010101010101010101010202020202020202020202020202020202020202020202020202 +02020202020202020202030303030303030303030303030303030303030303030303030303030303 +03030303030304040404040404040404040404040404040404040404040404040404040404040404 +04040505050505050505050505050505050505050505050505050505050505050505050505050606 +06060606060606060606060606060606060606060606060606060606060606060606070707070707 +07070707070707070707070707070707 +> +< +FFFEFDFCFBFAF9F8F7F6F5F4F3F2F1F0EFEEEDECEBEAE9E8E7E6E5E4E3E2E1E0DFDEDDDCDBDAD9D8 +D7D6D5D4D3D2D1D0CFCECDCCCBCAC9C8C7C6C5C4C3C2C1C0BFBEBDBCBBBAB9B8B7B6B5B4B3B2B1B0 +AFAEADACABAAA9A8A7A6A5A4A3A2A1A09F9E9D9C9B9A999897969594939291908F8E8D8C8B8A8988 +87868584838281807F7E7D7C7B7A797877767574737271706F6E6D6C6B6A69686766656463626160 +5F5E5D5C5B5A595857565554535251504F4E4D4C4B4A494847464544434241403F3E3D3C3B3A3938 +37363534333231302F2E2D2C2B2A292827262524232221201F1E1D1C1B1A19181716151413121110 +0F0E0D0C0B0A09080706050403020100 +> +0 +1 %_Br +< +000102030405060708090A0B0C0D0E0F101112131415161718191A1B1C1D1E1F2021222324252627 +28292A2B2C2D2E2F303132333435363738393A3B3C3D3E3F404142434445464748494A4B4C4D4E4F +505152535455565758595A5B5C5D5E5F606162636465666768696A6B6C6D6E6F7071727374757677 +78797A7B7C7D7E7F808182838485868788898A8B8C8D8E8F909192939495969798999A9B9C9D9E9F +A0A1A2A3A4A5A6A7A8A9AAABACADAEAFB0B1B2B3B4B5B6B7B8B9BABBBCBDBEBFC0C1C2C3C4C5C6C7 +C8C9CACBCCCDCECFD0D1D2D3D4D5D6D7D8D9DADBDCDDDEDFE0E1E2E3E4E5E6E7E8E9EAEBECEDEEEF +F0F1F2F3F4F5F6F7F8F9FAFBFCFDFEFF +> +0 +1 +0 +1 %_Br +0 +< +FFFEFDFCFBFAF9F8F7F6F5F4F3F2F1F0EFEEEDECEBEAE9E8E7E6E5E4E3E2E1E0DFDEDDDCDBDAD9D8 +D7D6D5D4D3D2D1D0CFCECDCCCBCAC9C8C7C6C5C4C3C2C1C0BFBEBDBCBBBAB9B8B7B6B5B4B3B2B1B0 +AFAEADACABAAA9A8A7A6A5A4A3A2A1A09F9E9D9C9B9A999897969594939291908F8E8D8C8B8A8988 +87868584838281807F7E7D7C7B7A797877767574737271706F6E6D6C6B6A69686766656463626160 +5F5E5D5C5B5A595857565554535251504F4E4D4C4B4A494847464544434241403F3E3D3C3B3A3938 +37363534333231302F2E2D2C2B2A292827262524232221201F1E1D1C1B1A19181716151413121110 +0F0E0D0C0B0A09080706050403020100 +> +1 +0 +1 %_Br +[ +0 1 0 0 1 50 100 %_Bs +1 1 0 0 1 50 80 %_Bs +1 0.0279 0 0 1 50 60 %_Bs +1 0 1 0 1 50 40 %_Bs +0 0 1 0 1 50 20 %_Bs +0 1 1 0 1 50 0 %_Bs +BD +%AI5_EndGradient +%AI5_BeginGradient: (Steel Bar) +(Steel Bar) 0 3 Bd +[ +< +FFFEFDFCFBFAF9F8F7F6F5F4F3F2F1F0EFEEEDECEBEAE9E8E7E6E5E4E3E2E1E0DFDEDDDCDBDAD9D8 +D7D6D5D4D3D2D1D0CFCECDCCCBCAC9C8C7C6C5C4C3C2C1C0BFBEBDBCBBBAB9B8B7B6B5B4B3B2B1B0 +AFAEADACABAAA9A8A7A6A5A4A3A2A1A09F9E9D9C9B9A999897969594939291908F8E8D8C8B8A8988 +87868584838281807F7E7D7C7B7A797877767574737271706F6E6D6C6B6A69686766656463626160 +5F5E5D5C5B5A595857565554535251504F4E4D4C4B4A494847464544434241403F3E3D3C3B3A3938 +37363534333231302F2E2D2C2B2A292827262524232221201F1E1D1C1B1A19181716151413121110 +0F0E0D0C0B0A09080706050403020100 +> +0 %_Br +< +000102030405060708090A0B0C0D0E0F101112131415161718191A1B1C1D1E1F2021222324252627 +28292A2B2C2D2E2F303132333435363738393A3B3C3D3E3F404142434445464748494A4B4C4D4E4F +505152535455565758595A5B5C5D5E5F606162636465666768696A6B6C6D6E6F7071727374757677 +78797A7B7C7D7E7F808182838485868788898A8B8C8D8E8F909192939495969798999A9B9C9D9E9F +A0A1A2A3A4A5A6A7A8A9AAABACADAEAFB0B1B2B3B4B5B6B7B8B9BABBBCBDBEBFC0C1C2C3C4C5C6C7 +C8C9CACBCCCDCECFD0D1D2D3D4D5D6D7D8D9DADBDCDDDEDFE0E1E2E3E4E5E6E7E8E9EAEBECEDEEEF +F0F1F2F3F4F5F6F7F8F9FAFBFCFDFEFF +> +0 %_Br +[ +0 0 50 100 %_Bs +1 0 50 70 %_Bs +0 0 50 0 %_Bs +BD +%AI5_EndGradient +%AI5_BeginGradient: (White & Red Radial) +(White & Red Radial) 1 18 Bd +[ +0 +1 +1 +0 +1 %_Br +0 +1 +1 +0 +1 %_Br +0 +< +FFFEFDFCFBFAF9F8F7F6F5F4F3F2F1F0EFEEEDECEBEAE9E8E7E6E5E4E3E2E1E0DFDEDDDCDBDAD9D8 +D7D6D5D4D3D2D1D0CFCECDCCCBCAC9C8C7C6C5C4C3C2C1C0BFBEBDBCBBBAB9B8B7B6B5B4B3B2B1B0 +AFAEADACABAAA9A8A7A6A5A4A3A2A1A09F9E9D9C9B9A999897969594939291908F8E8D8C8B8A8988 +87868584838281807F7E7D7C7B7A797877767574737271706F6E6D6C6B6A69686766656463626160 +5F5E5D5C5B5A595857565554535251504F4E4D4C4B4A494847464544434241403F3E3D3C3B3A3938 +37363534333231302F2E2D2C2B2A292827262524232221201F1E1D1C1B1A19181716151413121110 +0F0E0D0C0B0A09080706050403020100 +> +< +FFFEFDFCFBFAF9F8F7F6F5F4F3F2F1F0EFEEEDECEBEAE9E8E7E6E5E4E3E2E1E0DFDEDDDCDBDAD9D8 +D7D6D5D4D3D2D1D0CFCECDCCCBCAC9C8C7C6C5C4C3C2C1C0BFBEBDBCBBBAB9B8B7B6B5B4B3B2B1B0 +AFAEADACABAAA9A8A7A6A5A4A3A2A1A09F9E9D9C9B9A999897969594939291908F8E8D8C8B8A8988 +87868584838281807F7E7D7C7B7A797877767574737271706F6E6D6C6B6A69686766656463626160 +5F5E5D5C5B5A595857565554535251504F4E4D4C4B4A494847464544434241403F3E3D3C3B3A3938 +37363534333231302F2E2D2C2B2A292827262524232221201F1E1D1C1B1A19181716151413121110 +0F0E0D0C0B0A09080706050403020100 +> +0 +1 %_Br +1 +0 %_Br +0 +< +000102030405060708090A0B0C0D0E0F101112131415161718191A1B1C1D1E1F2021222324252627 +28292A2B2C2D2E2F303132333435363738393A3B3C3D3E3F404142434445464748494A4B4C4D4E4F +505152535455565758595A5B5C5D5E5F606162636465666768696A6B6C6D6E6F7071727374757677 +78797A7B7C7D7E7F808182838485868788898A8B8C8D8E8F909192939495969798999A9B9C9D9E9F +A0A1A2A3A4A5A6A7A8A9AAABACADAEAFB0B1B2B3B4B5B6B7B8B9BABBBCBDBEBFC0C1C2C3C4C5C6C7 +C8C9CACBCCCDCECFD0D1D2D3D4D5D6D7D8D9DADBDCDDDEDFE0E1E2E3E4E5E6E7E8E9EAEBECEDEEEF +F0F1F2F3F4F5F6F7F8F9FAFBFCFDFEFF +> +< +000102030405060708090A0B0C0D0E0F101112131415161718191A1B1C1D1E1F2021222324252627 +28292A2B2C2D2E2F303132333435363738393A3B3C3D3E3F404142434445464748494A4B4C4D4E4F +505152535455565758595A5B5C5D5E5F606162636465666768696A6B6C6D6E6F7071727374757677 +78797A7B7C7D7E7F808182838485868788898A8B8C8D8E8F909192939495969798999A9B9C9D9E9F +A0A1A2A3A4A5A6A7A8A9AAABACADAEAFB0B1B2B3B4B5B6B7B8B9BABBBCBDBEBFC0C1C2C3C4C5C6C7 +C8C9CACBCCCDCECFD0D1D2D3D4D5D6D7D8D9DADBDCDDDEDFE0E1E2E3E4E5E6E7E8E9EAEBECEDEEEF +F0F1F2F3F4F5F6F7F8F9FAFBFCFDFEFF +> +0 +1 %_Br +0 +1 +1 +0 +1 %_Br +0 +< +FFFEFDFCFBFAF9F8F7F6F5F4F3F2F1F0EFEEEDECEBEAE9E8E7E6E5E4E3E2E1E0DFDEDDDCDBDAD9D8 +D7D6D5D4D3D2D1D0CFCECDCCCBCAC9C8C7C6C5C4C3C2C1C0BFBEBDBCBBBAB9B8B7B6B5B4B3B2B1B0 +AFAEADACABAAA9A8A7A6A5A4A3A2A1A09F9E9D9C9B9A999897969594939291908F8E8D8C8B8A8988 +87868584838281807F7E7D7C7B7A797877767574737271706F6E6D6C6B6A69686766656463626160 +5F5E5D5C5B5A595857565554535251504F4E4D4C4B4A494847464544434241403F3E3D3C3B3A3938 +37363534333231302F2E2D2C2B2A292827262524232221201F1E1D1C1B1A19181716151413121110 +0F0E0D0C0B0A09080706050403020100 +> +< +FFFEFDFCFBFAF9F8F7F6F5F4F3F2F1F0EFEEEDECEBEAE9E8E7E6E5E4E3E2E1E0DFDEDDDCDBDAD9D8 +D7D6D5D4D3D2D1D0CFCECDCCCBCAC9C8C7C6C5C4C3C2C1C0BFBEBDBCBBBAB9B8B7B6B5B4B3B2B1B0 +AFAEADACABAAA9A8A7A6A5A4A3A2A1A09F9E9D9C9B9A999897969594939291908F8E8D8C8B8A8988 +87868584838281807F7E7D7C7B7A797877767574737271706F6E6D6C6B6A69686766656463626160 +5F5E5D5C5B5A595857565554535251504F4E4D4C4B4A494847464544434241403F3E3D3C3B3A3938 +37363534333231302F2E2D2C2B2A292827262524232221201F1E1D1C1B1A19181716151413121110 +0F0E0D0C0B0A09080706050403020100 +> +0 +1 %_Br +1 +0 %_Br +0 +< +000102030405060708090A0B0C0D0E0F101112131415161718191A1B1C1D1E1F2021222324252627 +28292A2B2C2D2E2F303132333435363738393A3B3C3D3E3F404142434445464748494A4B4C4D4E4F +505152535455565758595A5B5C5D5E5F606162636465666768696A6B6C6D6E6F7071727374757677 +78797A7B7C7D7E7F808182838485868788898A8B8C8D8E8F909192939495969798999A9B9C9D9E9F +A0A1A2A3A4A5A6A7A8A9AAABACADAEAFB0B1B2B3B4B5B6B7B8B9BABBBCBDBEBFC0C1C2C3C4C5C6C7 +C8C9CACBCCCDCECFD0D1D2D3D4D5D6D7D8D9DADBDCDDDEDFE0E1E2E3E4E5E6E7E8E9EAEBECEDEEEF +F0F1F2F3F4F5F6F7F8F9FAFBFCFDFEFF +> +< +000102030405060708090A0B0C0D0E0F101112131415161718191A1B1C1D1E1F2021222324252627 +28292A2B2C2D2E2F303132333435363738393A3B3C3D3E3F404142434445464748494A4B4C4D4E4F +505152535455565758595A5B5C5D5E5F606162636465666768696A6B6C6D6E6F7071727374757677 +78797A7B7C7D7E7F808182838485868788898A8B8C8D8E8F909192939495969798999A9B9C9D9E9F +A0A1A2A3A4A5A6A7A8A9AAABACADAEAFB0B1B2B3B4B5B6B7B8B9BABBBCBDBEBFC0C1C2C3C4C5C6C7 +C8C9CACBCCCDCECFD0D1D2D3D4D5D6D7D8D9DADBDCDDDEDFE0E1E2E3E4E5E6E7E8E9EAEBECEDEEEF +F0F1F2F3F4F5F6F7F8F9FAFBFCFDFEFF +> +0 +1 %_Br +0 +1 +1 +0 +1 %_Br +0 +< +FFFEFDFCFBFAF9F8F7F6F5F4F3F2F1F0EFEEEDECEBEAE9E8E7E6E5E4E3E2E1E0DFDEDDDCDBDAD9D8 +D7D6D5D4D3D2D1D0CFCECDCCCBCAC9C8C7C6C5C4C3C2C1C0BFBEBDBCBBBAB9B8B7B6B5B4B3B2B1B0 +AFAEADACABAAA9A8A7A6A5A4A3A2A1A09F9E9D9C9B9A999897969594939291908F8E8D8C8B8A8988 +87868584838281807F7E7D7C7B7A797877767574737271706F6E6D6C6B6A69686766656463626160 +5F5E5D5C5B5A595857565554535251504F4E4D4C4B4A494847464544434241403F3E3D3C3B3A3938 +37363534333231302F2E2D2C2B2A292827262524232221201F1E1D1C1B1A19181716151413121110 +0F0E0D0C0B0A09080706050403020100 +> +< +FFFEFDFCFBFAF9F8F7F6F5F4F3F2F1F0EFEEEDECEBEAE9E8E7E6E5E4E3E2E1E0DFDEDDDCDBDAD9D8 +D7D6D5D4D3D2D1D0CFCECDCCCBCAC9C8C7C6C5C4C3C2C1C0BFBEBDBCBBBAB9B8B7B6B5B4B3B2B1B0 +AFAEADACABAAA9A8A7A6A5A4A3A2A1A09F9E9D9C9B9A999897969594939291908F8E8D8C8B8A8988 +87868584838281807F7E7D7C7B7A797877767574737271706F6E6D6C6B6A69686766656463626160 +5F5E5D5C5B5A595857565554535251504F4E4D4C4B4A494847464544434241403F3E3D3C3B3A3938 +37363534333231302F2E2D2C2B2A292827262524232221201F1E1D1C1B1A19181716151413121110 +0F0E0D0C0B0A09080706050403020100 +> +0 +1 %_Br +1 +0 %_Br +0 +< +000102030405060708090A0B0C0D0E0F101112131415161718191A1B1C1D1E1F2021222324252627 +28292A2B2C2D2E2F303132333435363738393A3B3C3D3E3F404142434445464748494A4B4C4D4E4F +505152535455565758595A5B5C5D5E5F606162636465666768696A6B6C6D6E6F7071727374757677 +78797A7B7C7D7E7F808182838485868788898A8B8C8D8E8F909192939495969798999A9B9C9D9E9F +A0A1A2A3A4A5A6A7A8A9AAABACADAEAFB0B1B2B3B4B5B6B7B8B9BABBBCBDBEBFC0C1C2C3C4C5C6C7 +C8C9CACBCCCDCECFD0D1D2D3D4D5D6D7D8D9DADBDCDDDEDFE0E1E2E3E4E5E6E7E8E9EAEBECEDEEEF +F0F1F2F3F4F5F6F7F8F9FAFBFCFDFEFF +> +< +000102030405060708090A0B0C0D0E0F101112131415161718191A1B1C1D1E1F2021222324252627 +28292A2B2C2D2E2F303132333435363738393A3B3C3D3E3F404142434445464748494A4B4C4D4E4F +505152535455565758595A5B5C5D5E5F606162636465666768696A6B6C6D6E6F7071727374757677 +78797A7B7C7D7E7F808182838485868788898A8B8C8D8E8F909192939495969798999A9B9C9D9E9F +A0A1A2A3A4A5A6A7A8A9AAABACADAEAFB0B1B2B3B4B5B6B7B8B9BABBBCBDBEBFC0C1C2C3C4C5C6C7 +C8C9CACBCCCDCECFD0D1D2D3D4D5D6D7D8D9DADBDCDDDEDFE0E1E2E3E4E5E6E7E8E9EAEBECEDEEEF +F0F1F2F3F4F5F6F7F8F9FAFBFCFDFEFF +> +0 +1 %_Br +0 +1 +1 +0 +1 %_Br +0 +< +FFFEFDFCFBFAF9F8F7F6F5F4F3F2F1F0EFEEEDECEBEAE9E8E7E6E5E4E3E2E1E0DFDEDDDCDBDAD9D8 +D7D6D5D4D3D2D1D0CFCECDCCCBCAC9C8C7C6C5C4C3C2C1C0BFBEBDBCBBBAB9B8B7B6B5B4B3B2B1B0 +AFAEADACABAAA9A8A7A6A5A4A3A2A1A09F9E9D9C9B9A999897969594939291908F8E8D8C8B8A8988 +87868584838281807F7E7D7C7B7A797877767574737271706F6E6D6C6B6A69686766656463626160 +5F5E5D5C5B5A595857565554535251504F4E4D4C4B4A494847464544434241403F3E3D3C3B3A3938 +37363534333231302F2E2D2C2B2A292827262524232221201F1E1D1C1B1A19181716151413121110 +0F0E0D0C0B0A09080706050403020100 +> +< +FFFEFDFCFBFAF9F8F7F6F5F4F3F2F1F0EFEEEDECEBEAE9E8E7E6E5E4E3E2E1E0DFDEDDDCDBDAD9D8 +D7D6D5D4D3D2D1D0CFCECDCCCBCAC9C8C7C6C5C4C3C2C1C0BFBEBDBCBBBAB9B8B7B6B5B4B3B2B1B0 +AFAEADACABAAA9A8A7A6A5A4A3A2A1A09F9E9D9C9B9A999897969594939291908F8E8D8C8B8A8988 +87868584838281807F7E7D7C7B7A797877767574737271706F6E6D6C6B6A69686766656463626160 +5F5E5D5C5B5A595857565554535251504F4E4D4C4B4A494847464544434241403F3E3D3C3B3A3938 +37363534333231302F2E2D2C2B2A292827262524232221201F1E1D1C1B1A19181716151413121110 +0F0E0D0C0B0A09080706050403020100 +> +0 +1 %_Br +1 +0 %_Br +0 +< +000102030405060708090A0B0C0D0E0F101112131415161718191A1B1C1D1E1F2021222324252627 +28292A2B2C2D2E2F303132333435363738393A3B3C3D3E3F404142434445464748494A4B4C4D4E4F +505152535455565758595A5B5C5D5E5F606162636465666768696A6B6C6D6E6F7071727374757677 +78797A7B7C7D7E7F808182838485868788898A8B8C8D8E8F909192939495969798999A9B9C9D9E9F +A0A1A2A3A4A5A6A7A8A9AAABACADAEAFB0B1B2B3B4B5B6B7B8B9BABBBCBDBEBFC0C1C2C3C4C5C6C7 +C8C9CACBCCCDCECFD0D1D2D3D4D5D6D7D8D9DADBDCDDDEDFE0E1E2E3E4E5E6E7E8E9EAEBECEDEEEF +F0F1F2F3F4F5F6F7F8F9FAFBFCFDFEFF +> +< +000102030405060708090A0B0C0D0E0F101112131415161718191A1B1C1D1E1F2021222324252627 +28292A2B2C2D2E2F303132333435363738393A3B3C3D3E3F404142434445464748494A4B4C4D4E4F +505152535455565758595A5B5C5D5E5F606162636465666768696A6B6C6D6E6F7071727374757677 +78797A7B7C7D7E7F808182838485868788898A8B8C8D8E8F909192939495969798999A9B9C9D9E9F +A0A1A2A3A4A5A6A7A8A9AAABACADAEAFB0B1B2B3B4B5B6B7B8B9BABBBCBDBEBFC0C1C2C3C4C5C6C7 +C8C9CACBCCCDCECFD0D1D2D3D4D5D6D7D8D9DADBDCDDDEDFE0E1E2E3E4E5E6E7E8E9EAEBECEDEEEF +F0F1F2F3F4F5F6F7F8F9FAFBFCFDFEFF +> +0 +1 %_Br +[ +0 1 1 0 1 50 0 %_Bs +0 1 1 0 1 50 0 %_Bs +0 1 1 0 1 50 12.5 %_Bs +0 0 0 0 1 50 12.5 %_Bs +0 0 0 0 1 50 25 %_Bs +0 1 1 0 1 50 25 %_Bs +0 1 1 0 1 50 37.5 %_Bs +0 0 0 0 1 50 37.5 %_Bs +0 0 0 0 1 50 50 %_Bs +0 1 1 0 1 50 50 %_Bs +0 1 1 0 1 50 62.5 %_Bs +0 0 0 0 1 50 62.5 %_Bs +0 0 0 0 1 50 75 %_Bs +0 1 1 0 1 50 75 %_Bs +0 1 1 0 1 50 87.5 %_Bs +0 0 0 0 1 50 87.5 %_Bs +0 0 0 0 1 50 100 %_Bs +0 1 1 0 1 50 100 %_Bs +BD +%AI5_EndGradient +%AI5_BeginGradient: (Yellow & Orange Radial) +(Yellow & Orange Radial) 1 2 Bd +[ +0 +< +0001010203040506060708090A0B0C0C0D0E0F10111213131415161718191A1B1C1D1D1E1F202122 +232425262728292A2B2B2C2D2E2F303132333435363738393A3B3C3D3E3E3F404142434445464748 +494A4B4C4D4E4F505152535455565758595A5B5C5D5E5F60606162636465666768696A6B6C6D6E6F +707172737475767778797A7B7C7D7E7F808182838485868788898A8B8C +> +< +FFFFFFFFFEFEFEFEFEFEFEFDFDFDFDFDFDFCFCFCFCFCFCFBFBFBFBFBFBFAFAFAFAFAFAF9F9F9F9F9 +F9F8F8F8F8F8F8F7F7F7F7F7F7F6F6F6F6F6F6F5F5F5F5F5F5F4F4F4F4F4F3F3F3F3F3F3F2F2F2F2 +F2F2F1F1F1F1F1F0F0F0F0F0F0EFEFEFEFEFEFEEEEEEEEEEEDEDEDEDEDEDECECECECECEBEBEBEBEB +EBEAEAEAEAEAE9E9E9E9E9E9E8E8E8E8E8E8E7E7E7E7E7E6E6E6E6E6E5 +> +0 +1 %_Br +[ +0 0 1 0 1 52 19 %_Bs +0 0.55 0.9 0 1 50 100 %_Bs +BD +%AI5_EndGradient +%AI5_BeginGradient: (Yellow & Purple Radial) +(Yellow & Purple Radial) 1 2 Bd +[ +< +000102030405060708090A0B0C0D0E0F101112131415161718191A1B1C1D1E1F2021222324252627 +28292A2B2C2D2E2F303132333435363738393A3B3C3D3E3F404142434445464748494A4B4C4D4E4F +505152535455565758595A5B5C5D5E5F606162636465666768696A6B6C6D6E6F7071727374757677 +78797A7B7C7D7E7F808182838485868788898A8B8C8D8E8F909192939495969798999A9B9C9D9E9F +A0A1A2A3A4A5A6A7A8A9AAABACADAEAFB0B1B2B3B4B5B6B7B8B9BABBBCBDBEBFC0C1C2C3C4C5C6C7 +C8C9CACBCCCDCECFD0D1D2D3D4D5D6D7D8D9DADBDCDDDEDFE0E1E2E3E4E5E6E7E8E9EAEBECEDEEEF +F0F1F2F3F4F5F6F7F8F9FAFBFCFDFEFF +> +< +1415161718191A1B1C1D1E1F1F202122232425262728292A2A2B2C2D2E2F30313233343536363738 +393A3B3C3D3E3F40414142434445464748494A4B4C4D4D4E4F50515253545556575858595A5B5C5D +5E5F60616263646465666768696A6B6C6D6E6F6F707172737475767778797A7B7B7C7D7E7F808182 +83848586868788898A8B8C8D8E8F90919292939495969798999A9B9C9D9D9E9FA0A1A2A3A4A5A6A7 +A8A9A9AAABACADAEAFB0B1B2B3B4B4B5B6B7B8B9BABBBCBDBEBFC0C0C1C2C3C4C5C6C7C8C9CACBCB +CCCDCECFD0D1D2D3D4D5D6D7D7D8D9DADBDCDDDEDFE0E1E2E2E3E4E5E6E7E8E9EAEBECEDEEEEEFF0 +F1F2F3F4F5F6F7F8F9F9FAFBFCFDFEFF +> +< +ABAAAAA9A8A7A7A6A5A5A4A3A3A2A1A1A09F9F9E9D9D9C9B9B9A9999989797969595949393929191 +908F8F8E8D8D8C8B8B8A8989888787868585848383828181807F7F7E7D7D7C7B7B7A797978777776 +7575747373727171706F6F6E6D6D6C6B6B6A6969686767666565646362626160605F5E5E5D5C5C5B +5A5A5958585756565554545352525150504F4E4E4D4C4C4B4A4A4948484746464544444342424140 +403F3E3E3D3C3C3B3A3A3938383736363534343332323130302F2E2E2D2C2C2B2A2A292828272626 +25242423222121201F1F1E1D1D1C1B1B1A1919181717161515141313121111100F0F0E0D0D0C0B0B +0A090908070706050504030302010100 +> +0 +1 %_Br +[ +0 0.08 0.67 0 1 50 14 %_Bs +1 1 0 0 1 50 100 %_Bs +BD +%AI5_EndGradient +%AI5_BeginGradient: (Yellow, Violet, Orange, Blue) +(Yellow, Violet, Orange, Blue) 0 4 Bd +[ +< +000102030405060708090A0B0C0D0E0F101112131415161718191A1B1C1D1E1F2021222324252627 +28292A2B2C2D2E2F303132333435363738393A3B3C3D3E3F404142434445464748494A4B4C4D4E4F +505152535455565758595A5B5C5D5E5F606162636465666768696A6B6C6D6E6F7071727374757677 +78797A7B7C7D7E7F808182838485868788898A8B8C8D8E8F909192939495969798999A9B9C9D9E9F +A0A1A2A3A4A5A6A7A8A9AAABACADAEAFB0B1B2B3B4B5B6B7B8B9BABBBCBDBEBFC0C1C2C3C4C5C6C7 +C8C9CACBCCCDCECFD0D1D2D3D4D5D6D7D8D9DADBDCDDDEDFE0E1E2E3E4E5E6E7E8E9EAEBECEDEEEF +F0F1F2F3F4F5F6F7F8F9FAFBFCFDFEFF +> +< +A1A1A1A1A2A2A2A2A3A3A3A3A4A4A4A4A4A5A5A5A5A6A6A6A6A7A7A7A7A8A8A8A8A9A9A9A9AAAAAA +AAAAABABABABACACACACADADADADAEAEAEAEAFAFAFAFB0B0B0B0B0B1B1B1B1B2B2B2B2B3B3B3B3B4 +B4B4B4B5B5B5B5B6B6B6B6B6B7B7B7B7B8B8B8B8B9B9B9B9BABABABABBBBBBBBBCBCBCBCBCBDBDBD +BDBEBEBEBEBFBFBFBFC0C0C0C0C1C1C1C1C2C2C2C2C2C3C3C3C3C4C4C4C4C5C5C5C5C6C6C6C6C7C7 +C7C7C8C8C8C8C8C9C9C9C9CACACACACBCBCBCBCCCCCCCCCDCDCDCDCECECECECECFCFCFCFD0D0D0D0 +D1D1D1D1D2D2D2D2D3D3D3D3D4D4D4D4D4D5D5D5D5D6D6D6D6D7D7D7D7D8D8D8D8D9D9D9D9DADADA +DADADBDBDBDBDCDCDCDCDDDDDDDDDEDE +> +< +F5F4F3F2F1F0EFEEEDECEBEAE9E8E7E6E5E4E4E3E2E1E0DFDEDDDCDBDAD9D8D7D6D5D4D3D2D1D0CF +CECDCCCCCBCAC9C8C7C6C5C4C3C2C1C0BFBEBDBCBBBAB9B8B7B6B5B4B4B3B2B1B0AFAEADACABAAA9 +A8A7A6A5A4A3A2A1A09F9E9D9C9C9B9A999897969594939291908F8E8D8C8B8A8988878685848483 +8281807F7E7D7C7B7A797877767574737271706F6E6D6C6C6B6A696867666564636261605F5E5D5C +5B5A59585756555454535251504F4E4D4C4B4A494847464544434241403F3E3D3C3C3B3A39383736 +3534333231302F2E2D2C2B2A29282726252424232221201F1E1D1C1B1A191817161514131211100F +0E0D0C0C0B0A09080706050403020100 +> +0 +1 %_Br +< +9C9B9A9A9998989796969595949393929191908F8F8E8E8D8C8C8B8A8A8989888787868585848383 +82828180807F7E7E7D7C7C7B7B7A797978777776757574747372727170706F6E6E6D6D6C6B6B6A69 +6968676766666564646362626161605F5F5E5D5D5C5B5B5A5A595858575656555454535352515150 +4F4F4E4D4D4C4C4B4A4A4948484746464545444343424141403F3F3E3E3D3C3C3B3A3A3939383737 +36353534333332323130302F2E2E2D2C2C2B2B2A292928272726252524242322222120201F1E1E1D +1D1C1B1B1A191918171716161514141312121111100F0F0E0D0D0C0B0B0A0A090808070606050404 +030302010100 +> +< +F5F4F4F4F3F3F3F2F2F2F1F1F1F0F0F0EFEFEFEEEEEEEDEDEDECECECEBEBEAEAEAE9E9E9E8E8E8E7 +E7E7E6E6E6E5E5E5E4E4E4E3E3E3E2E2E2E1E1E1E0E0E0DFDFDEDEDEDDDDDDDCDCDCDBDBDBDADADA +D9D9D9D8D8D8D7D7D7D6D6D6D5D5D5D4D4D3D3D3D2D2D2D1D1D1D0D0D0CFCFCFCECECECDCDCDCCCC +CCCBCBCBCACACAC9C9C8C8C8C7C7C7C6C6C6C5C5C5C4C4C4C3C3C3C2C2C2C1C1C1C0C0C0BFBFBFBE +BEBEBDBDBCBCBCBBBBBBBABABAB9B9B9B8B8B8B7B7B7B6B6B6B5B5B5B4B4B4B3B3B3B2B2B1B1B1B0 +B0B0AFAFAFAEAEAEADADADACACACABABABAAAAAAA9A9A9A8A8A8A7A7A6A6A6A5A5A5A4A4A4A3A3A3 +A2A2A2A1A1A1 +> +< +000102030405060708090A0B0C0D0E0F101112131415161718191A1B1C1D1E1F2021222324252627 +28292A2B2C2D2E2F303132333435363738393A3B3C3D3E3F404142434445464748494A4B4C4D4E4F +505152535455565758595A5B5C5D5E5F606162636465666768696A6B6C6D6E6F7071727374757677 +78797A7B7C7D7E7F808182838485868788898A8B8C8D8E8F909192939495969798999A9B9C9D9E9F +A0A1A2A3A4A5A6A7A8A9AAABACADAEAFB0B1B2B3B4B5B6B7B8B9BABBBCBDBEBFC0C1C2C3C4C5C6C7 +C8C9CACBCCCDCECFD0D1D2D3D4D5D6D7D8D9DADBDCDDDEDFE0E1E2E3E4E5E6E7E8E9EAEBECEDEEEF +F0F1F2F3F4F5 +> +< +03030303030202020202020202020202020202020202020202020202020202020202020202020202 +02020202020202020202020202020202020202020202020202020202020202020202020202020202 +02020202020202020202020202020202020202020201010101010101010101010101010101010101 +01010101010101010101010101010101010101010101010101010101010101010101010101010101 +01010101010101010101010101010101010101010101010101010101010101010101010101000000 +00000000000000000000000000000000000000000000000000000000000000000000000000000000 +000000000000 +> +1 %_Br +< +0D0D0E0F0F10101111121313141415161617171819191A1A1B1C1C1D1D1E1E1F2020212122232324 +2425262627272828292A2A2B2B2C2D2D2E2E2F30303131323333343435353637373838393A3A3B3B +3C3D3D3E3E3F3F404141424243444445454647474848494A4A4B4B4C4C4D4E4E4F4F505151525253 +54545555565757585859595A5B5B5C5C5D5E5E5F5F60616162626363646565666667686869696A6B +6B6C6C6D6E6E6F6F70707172727373747575767677787879797A7B7B7C7C7D7D7E7F7F8080818282 +8383848585868687878889898A8A8B8C8C8D8D8E8F8F90909192929393949495969697979899999A +9A9B9C +> +< +08090A0B0C0D0E0F0F101112131415161718191A1B1C1D1E1F202122232425262728292A2B2C2D2E +2F303132333435363738393A3B3C3D3E3F40404142434445464748494A4B4C4D4E4F505152535455 +565758595A5B5C5D5E5F606162636465666768696A6B6C6D6E6F70717172737475767778797A7B7C +7D7E7F808182838485868788898A8B8C8D8E8F909192939495969798999A9B9C9D9E9FA0A1A2A2A3 +A4A5A6A7A8A9AAABACADAEAFB0B1B2B3B4B5B6B7B8B9BABBBCBDBEBFC0C1C2C3C4C5C6C7C8C9CACB +CCCDCECFD0D1D2D2D3D4D5D6D7D8D9DADBDCDDDEDFE0E1E2E3E4E5E6E7E8E9EAEBECEDEEEFF0F1F2 +F3F4F5 +> +< +F2F1F0EFEEEDECEBEAE9E8E7E6E5E4E3E2E1E0DFDEDDDCDBDAD9D8D7D6D5D4D3D2D1D0CFCECDCCCB +CAC9C8C7C6C5C4C3C2C1C0BFBEBDBCBBBAB9B8B7B6B5B4B3B2B1B0AFAEADACABAAA9A8A7A6A5A4A3 +A2A1A09F9E9D9C9B9A999897969594939291908F8E8D8C8B8A898887868584838281807F7E7D7C7B +7A797877767574737271706F6E6D6C6B6A696867666564636261605F5E5D5C5B5A59585756555453 +5251504F4E4D4C4B4A494847464544434241403F3E3D3C3B3A393837363534333231302F2E2D2C2B +2A292827262524232221201F1E1D1C1B1A191817161514131211100F0E0D0C0B0A09080706050403 +020100 +> +< +00000000000000000000000000000000000000000000000000000000000000000000000000000000 +00000000000000000101010101010101010101010101010101010101010101010101010101010101 +01010101010101010101010101010101010101010101010101010101010101010101010101010101 +01010101010101010101010101010101010101010101010202020202020202020202020202020202 +02020202020202020202020202020202020202020202020202020202020202020202020202020202 +02020202020202020202020202020202020202020202020202020202020202020202020202020303 +030303 +> +1 %_Br +[ +1 0.87 0 0 1 50 95 %_Bs +0 0.63 0.96 0 1 50 65 %_Bs +0.61 0.96 0 0.01 1 50 35 %_Bs +0.05 0.03 0.95 0 1 50 5 %_Bs +BD +%AI5_EndGradient +%AI5_End_NonPrinting-- +%AI5_BeginPalette +0 0 Pb +0 0 0 0 k +(C=0 M=0 Y=0 K=0) Pc +0 0 0 1 k +(C=0 M=0 Y=0 K=100) Pc +0 0.45 0.6 0 k +(C=0 M=45 Y=60 K=0) Pc +0 0.5 0.05 0 k +(C=0 M=50 Y=5 K=0) Pc +0 0.9 1 0 k +(C=0 M=90 Y=100 K=0) Pc +1 0.2 1 0 k +(C=100 M=20 Y=100 K=0) Pc +1 0.4 0.15 0 k +(C=100 M=40 Y=15 K=0) Pc +0.2 0 1 0 k +(C=20 M=0 Y=100 K=0) Pc +0.25 1 0.25 0 k +(C=25 M=100 Y=25 K=0) Pc +0.4 0.4 0.4 0 k +(C=40 M=40 Y=40 K=0) Pc +0.4 0.7 1 0 k +(C=40 M=70 Y=100 K=0) Pc +0.75 0.9 0 0 k +(C=75 M=90 Y=0 K=0) Pc +1 0 0.55 0 (Aqua) 0 x +(Aqua) Pc +1 0.5 0 0 (Blue) 0 x +(Blue) Pc +0.5 0.4 0.3 0 (Blue Gray) 0 x +(Blue Gray) Pc +0.8 0.05 0 0 (Blue Sky) 0 x +(Blue Sky) Pc +0.5 0.85 1 0 (Brown) 0 x +(Brown) Pc +1 0.9 0.1 0 (Dark Blue) 0 x +(Dark Blue) Pc +1 0.55 1 0 (Forest Green) 0 x +(Forest Green) Pc +0.05 0.2 0.95 0 (Gold) 0 x +(Gold) Pc +0.75 0.05 1 0 (Grass Green) 0 x +(Grass Green) Pc +0 0.45 1 0 (Orange) 0 x +(Orange) Pc +0.15 1 1 0 (Red) 0 x +(Red) Pc +0.45 0.9 0 0 (Violet) 0 x +(Violet) Pc +Bb +2 (Black, White) -4014 4716 0 0 1 0 0 1 0 0 Bg +0 BB +(Black, White) Pc +Bb +2 (Chrome) -4014 4716 0 0 1 0 0 1 0 0 Bg +0 BB +(Chrome) Pc +Bb +2 (Green, Blue) -4014 4716 0 0 1 0 0 1 0 0 Bg +0 BB +(Green, Blue) Pc +Bb +2 (Orange, Green, Violet) -4014 4716 0 0 1 0 0 1 0 0 Bg +0 BB +(Orange, Green, Violet) Pc +Bb +2 (Pink, Yellow, Green ) -4014 4716 0 0 1 0 0 1 0 0 Bg +0 BB +(Pink, Yellow, Green ) Pc +Bb +2 (Purple, Red, Yellow) -4014 4716 0 0 1 0 0 1 0 0 Bg +0 BB +(Purple, Red, Yellow) Pc +Bb +2 (Rainbow) -4014 4716 0 0 1 0 0 1 0 0 Bg +0 BB +(Rainbow) Pc +Bb +2 (Steel Bar) -4014 4716 0 0 1 0 0 1 0 0 Bg +0 BB +(Steel Bar) Pc +Bb +0 0 0 0 Bh +2 (White & Red Radial) -4014 4716 0 0 1 0 0 1 0 0 Bg +0 BB +(White & Red Radial) Pc +Bb +0 0 0 0 Bh +2 (Yellow & Orange Radial) -4014 4716 0 0 1 0 0 1 0 0 Bg +0 BB +(Yellow & Orange Radial) Pc +Bb +0 0 0 0 Bh +2 (Yellow & Purple Radial) -4014 4716 0 0 1 0 0 1 0 0 Bg +0 BB +(Yellow & Purple Radial) Pc +Bb +2 (Yellow, Violet, Orange, Blue) -4014 4716 0 0 1 0 0 1 0 0 Bg +0 BB +(Yellow, Violet, Orange, Blue) Pc +(Arrow1.2.out/in) 0 0 1 1 0 0 0 0 0 [1 0 0 1 0 0] p +(Arrow1.2.out/in) Pc +(Arrow1.2.side) 0 0 1 1 0 0 0 0 0 [1 0 0 1 0 0] p +(Arrow1.2.side) Pc +(Bricks) 0 0 1 1 0 0 0 0 0 [1 0 0 1 0 0] p +(Bricks) Pc +(Checks) 0 0 1 1 0 0 0 0 0 [1 0 0 1 0 0] p +(Checks) Pc +(Confetti) 0 0 1 1 0 0 0 0 0 [1 0 0 1 0 0] p +(Confetti) Pc +(DblLine1.2.inner) 0 0 1 1 0 0 0 0 0 [1 0 0 1 0 0] p +(DblLine1.2.inner) Pc +(DblLine1.2.outer) 0 0 1 1 0 0 0 0 0 [1 0 0 1 0 0] p +(DblLine1.2.outer) Pc +(DblLine1.2.side) 0 0 1 1 0 0 0 0 0 [1 0 0 1 0 0] p +(DblLine1.2.side) Pc +(Diamonds) 0 0 1 1 0 0 0 0 0 [1 0 0 1 0 0] p +(Diamonds) Pc +(Hexagon) 0 0 1 1 0 0 0 0 0 [1 0 0 1 0 0] p +(Hexagon) Pc +(Laurel.inner) 0 0 1 1 0 0 0 0 0 [1 0 0 1 0 0] p +(Laurel.inner) Pc +(Laurel.outer) 0 0 1 1 0 0 0 0 0 [1 0 0 1 0 0] p +(Laurel.outer) Pc +(Laurel.side) 0 0 1 1 0 0 0 0 0 [1 0 0 1 0 0] p +(Laurel.side) Pc +(Leaves-fall) 0 0 1 1 0 0 0 0 0 [1 0 0 1 0 0] p +(Leaves-fall) Pc +(Polka dots) 0 0 1 1 0 0 0 0 0 [1 0 0 1 0 0] p +(Polka dots) Pc +(Random circles) 0 0 1 1 0 0 0 0 0 [1 0 0 1 0 0] p +(Random circles) Pc +(Rope.side) 0 0 1 1 0 0 0 0 0 [1 0 0 1 0 0] p +(Rope.side) Pc +(Scales) 0 0 1 1 0 0 0 0 0 [1 0 0 1 0 0] p +(Scales) Pc +(SolidStar.side) 0 0 1 1 0 0 0 0 0 [1 0 0 1 0 0] p +(SolidStar.side) Pc +(Stars) 0 0 1 1 0 0 0 0 0 [1 0 0 1 0 0] p +(Stars) Pc +(Stripes) 0 0 1 1 0 0 0 0 0 [1 0 0 1 0 0] p +(Stripes) Pc +(TriBevel.outer) 0 0 1 1 0 0 0 0 0 [1 0 0 1 0 0] p +(TriBevel.outer) Pc +(TriBevel.side) 0 0 1 1 0 0 0 0 0 [1 0 0 1 0 0] p +(TriBevel.side) Pc +(Waves-scroll) 0 0 1 1 0 0 0 0 0 [1 0 0 1 0 0] p +(Waves-scroll) Pc +PB +%AI5_EndPalette +%%EndSetup +%AI5_BeginLayer +1 1 1 1 0 0 0 79 128 255 Lb +(Layer 1) Ln +0 A +u +1 Ap +0 O +0 0 0 0 k +800 Ar +0 J 0 j 1 w 4 M []0 d +%AI3_Note: +0 D +0 XR +356.6667 387.5 m +356.6667 419.1667 L +247.1666 419.1667 L +247.1666 387.5 L +356.6667 387.5 L +f +u +u +u +u +u +0 Ap +0 g +0.1417 w +349.9796 400.7243 m +349.5877 401.2344 L +346.0138 401.2344 L +346.0883 400.7243 L +349.9796 400.7243 L +f +351.0435 399.3254 m +350.64 399.8521 L +346.2172 399.8521 L +346.3082 399.3254 L +351.0435 399.3254 L +f +352.0889 397.9355 m +351.6969 398.4622 L +346.4256 398.4622 L +346.5001 397.9355 L +352.0889 397.9355 L +f +353.1499 396.5473 m +352.8027 397.0657 L +346.6389 397.0657 L +346.7084 396.5473 L +353.1499 396.5473 L +f +354.1924 395.1701 m +353.8401 395.673 L +346.8076 395.673 L +346.897 395.1701 L +354.1924 395.1701 L +f +U +U +u +u +u +0.1362 w +261.2735 405.9461 m +264.2217 405.9461 266.6112 403.5556 266.6112 400.6074 c +266.6112 397.6591 264.2217 395.2686 261.2735 395.2686 c +258.3253 395.2686 255.9348 397.6591 255.9348 400.6074 c +255.9348 403.5556 258.3253 405.9461 261.2735 405.9461 c +f +261.2735 400.6074 m +F +U +0.1417 w +263.2787 406.4807 m +265.6917 405.6403 267.4239 403.3457 267.4239 400.6461 c +267.4239 397.235 264.6593 394.4703 261.2481 394.4703 c +257.8379 394.4703 255.0721 397.235 255.0721 400.6461 c +255.0721 403.7848 257.4809 406.1287 260.1353 406.671 C +260.1353 411.5726 L +254.6579 410.9711 250.3076 406.3287 250.3076 400.6909 c +250.3076 394.6447 255.2093 389.743 261.2555 389.743 c +267.3008 389.743 272.2025 394.6447 272.2025 400.6909 c +272.2025 405.9351 268.4668 410.3181 263.5435 411.3879 C +263.5435 412.4271 l +259.8638 409.0598 l +263.2787 405.3026 l +263.2787 406.4807 l +f +267.7419 408.8471 m +267.7419 413.7097 L +266.3056 413.7097 l +269.9043 417.257 l +273.4301 413.7097 l +272.1904 413.7097 L +272.1904 400.5408 l +F +U +U +u +u +344.9476 395.1483 m +345.2948 393.0208 L +345.5763 391.6104 346.3665 391.1944 346.4113 391.1775 C +346.4113 391.0357 L +337.5144 391.0357 l +337.5144 391.1775 L +338.1526 391.1775 338.3296 391.7801 338.2588 392.1346 C +337.8611 395.1481 L +344.9476 395.1483 L +f +U +u +330.1397 395.1447 m +328.9907 393.0208 L +328.3882 391.8865 328.6539 391.4612 329.4337 391.1775 C +329.4337 391.0357 L +321.2105 391.0357 l +321.2105 391.1775 L +321.8485 391.1775 322.6106 392.1878 323.284 393.3574 C +324.3294 395.1477 L +330.1397 395.1447 L +f +U +u +327.843 401.2529 m +333.8467 411.6119 L +334.1331 412.1072 334.6648 412.9541 333.3683 413.4728 C +333.3683 413.5967 l +341.9628 413.5967 L +343.9642 401.254 L +337.0643 401.2535 L +336.3448 406.7204 l +333.4007 401.2525 L +327.843 401.2529 L +f +U +u +344.2004 399.8667 m +344.0449 400.7109 L +327.5394 400.7109 L +327.0498 399.8667 L +344.2004 399.8667 L +f +U +u +344.4022 398.4775 m +344.283 399.3217 L +326.7356 399.3217 L +326.2295 398.4775 L +344.4022 398.4775 L +f +U +u +344.6403 397.0883 m +344.5179 397.9324 L +325.9584 397.9324 L +325.4258 397.0883 L +344.6403 397.0883 L +f +U +u +344.8586 395.6991 m +344.7395 396.5433 L +325.1281 396.5433 L +324.632 395.6991 L +344.8586 395.6991 L +f +U +U +u +u +295.6383 401.2527 m +297.8343 411.6119 L +297.8977 411.9132 298.2848 413.1005 297.3557 413.4728 C +297.3557 413.5967 l +306.3486 413.5967 L +306.3486 413.455 L +305.7814 413.2423 305.1266 412.2144 304.9848 411.3992 C +302.9603 401.2549 L +295.6383 401.2527 L +f +U +300.9135 391.0231 m +291.8972 391.0357 L +291.8972 391.1775 L +292.5351 391.1775 293.2972 392.1878 293.9707 393.3574 C +294.3531 395.148 L +301.7499 395.1638 L +300.9135 391.0396 L +300.9135 391.0231 L +f +u +302.6821 399.8667 m +302.8608 400.7109 L +295.5287 400.7109 L +295.3451 399.8667 L +302.6821 399.8667 L +f +U +u +302.4043 398.4775 m +302.5828 399.3217 L +295.236 399.3217 L +295.0524 398.4775 L +302.4043 398.4775 L +f +U +u +302.1314 397.0883 m +302.305 397.9324 L +294.9433 397.9324 L +294.7547 397.0883 L +302.1314 397.0883 L +f +U +u +301.8371 395.6991 m +302.0272 396.5433 L +294.6505 396.5433 L +294.4454 395.6991 L +301.8371 395.6991 L +f +U +U +u +u +u +324.11 395.1483 m +324.4572 393.0208 L +324.7389 391.6104 325.529 391.1944 325.5738 391.1775 C +325.5738 391.0357 L +316.6769 391.0357 l +316.6769 391.1775 L +317.3151 391.1775 317.4922 391.7801 317.4212 392.1346 C +317.0237 395.1481 L +324.11 395.1483 L +f +U +u +300.5942 391.0421 m +303.0951 395.1477 L +309.3023 395.1447 L +308.1532 393.0208 L +307.5507 391.8865 307.8165 391.4612 308.5963 391.1775 C +308.4584 391.022 L +300.5657 391.022 L +300.5942 391.0421 L +f +U +u +306.774 401.2529 m +313.0093 411.6119 L +313.2957 412.1072 313.8273 412.9541 312.5308 413.4728 C +312.5308 413.5967 l +321.1253 413.5967 L +323.1267 401.254 L +316.2268 401.2535 L +315.5073 406.7204 l +312.5632 401.2525 L +306.774 401.2529 L +f +U +u +323.3629 399.8667 m +323.2074 400.7109 L +306.4373 400.7109 L +305.9477 399.8667 L +323.3629 399.8667 L +f +U +u +323.5646 398.4775 m +323.4456 399.3217 L +305.5674 399.3217 L +305.0613 398.4775 L +323.5646 398.4775 L +f +U +u +323.8028 397.0883 m +323.6805 397.9324 L +304.757 397.9324 L +304.2245 397.0883 L +323.8028 397.0883 L +f +U +u +324.0211 395.6991 m +323.9021 396.5433 L +303.9268 396.5433 L +303.4307 395.6991 L +324.0211 395.6991 L +f +U +U +U +u +u +u +293.9453 395.1483 m +294.2925 393.0208 L +294.5741 391.6104 295.3643 391.1944 295.4091 391.1775 C +295.4091 391.0357 L +286.5122 391.0357 l +286.5122 391.1775 L +287.1503 391.1775 287.3274 391.7801 287.2566 392.1346 C +286.8589 395.1481 L +293.9453 395.1483 L +f +U +u +279.1375 395.1447 m +277.9885 393.0208 L +277.386 391.8865 277.6517 391.4612 278.4315 391.1775 C +278.4315 391.0357 L +270.2083 391.0357 l +270.2083 391.1775 L +270.8463 391.1775 271.6083 392.1878 272.2817 393.3574 C +273.3272 395.1477 L +279.1375 395.1447 L +f +U +u +276.8408 401.2529 m +282.8445 411.6119 L +283.1309 412.1072 283.6625 412.9541 282.3661 413.4728 C +282.3661 413.5967 l +290.9606 413.5967 L +292.9619 401.254 L +286.0621 401.2535 L +285.3425 406.7204 l +282.3985 401.2525 L +276.8408 401.2529 L +f +U +u +293.1982 399.8667 m +293.0427 400.7109 L +276.5371 400.7109 L +276.0476 399.8667 L +293.1982 399.8667 L +f +U +u +293.4 398.4775 m +293.2808 399.3217 L +275.7334 399.3217 L +275.2273 398.4775 L +293.4 398.4775 L +f +U +u +293.638 397.0883 m +293.5157 397.9324 L +274.9561 397.9324 L +274.4235 397.0883 L +293.638 397.0883 L +f +U +u +293.8564 395.6991 m +293.7373 396.5433 L +274.1259 396.5433 L +273.6297 395.6991 L +293.8564 395.6991 L +f +U +U +U +U +U +U +U +LB +%AI5_EndLayer-- +%%PageTrailer +gsave annotatepage grestore showpage +%%Trailer +Adobe_Illustrator_AI5 /terminate get exec +Adobe_ColorImage_AI6 /terminate get exec +Adobe_cshow /terminate get exec +Adobe_level2_AI5 /terminate get exec +%%EOF diff --git a/macros/latex/contrib/aiaa/pre2004/demos/paper/smpaiaa.ps b/macros/latex/contrib/aiaa/pre2004/demos/paper/smpaiaa.ps new file mode 100644 index 0000000000..d724d27fcb --- /dev/null +++ b/macros/latex/contrib/aiaa/pre2004/demos/paper/smpaiaa.ps @@ -0,0 +1,11083 @@ +%!PS-Adobe-2.0 +%%Creator: dvips(k) 5.83 Copyright 1998 Radical Eye Software +%%Title: smpaiaa.dvi +%%Pages: 6 +%%PageOrder: Ascend +%%BoundingBox: 0 0 612 792 +%%DocumentFonts: Helvetica-Bold Helvetica Helvetica-Oblique Courier-Bold +%%EndComments +%DVIPSWebPage: (www.radicaleye.com) +%DVIPSCommandLine: dvips smpaiaa +%DVIPSParameters: dpi=600, compressed +%DVIPSSource: TeX output 1999.02.23:1400 +%%BeginProcSet: texc.pro +%! +/TeXDict 300 dict def TeXDict begin/N{def}def/B{bind def}N/S{exch}N/X{S +N}B/A{dup}B/TR{translate}N/isls false N/vsize 11 72 mul N/hsize 8.5 72 +mul N/landplus90{false}def/@rigin{isls{[0 landplus90{1 -1}{-1 1}ifelse 0 +0 0]concat}if 72 Resolution div 72 VResolution div neg scale isls{ +landplus90{VResolution 72 div vsize mul 0 exch}{Resolution -72 div hsize +mul 0}ifelse TR}if Resolution VResolution vsize -72 div 1 add mul TR[ +matrix currentmatrix{A A round sub abs 0.00001 lt{round}if}forall round +exch round exch]setmatrix}N/@landscape{/isls true N}B/@manualfeed{ +statusdict/manualfeed true put}B/@copies{/#copies X}B/FMat[1 0 0 -1 0 0] +N/FBB[0 0 0 0]N/nn 0 N/IE 0 N/ctr 0 N/df-tail{/nn 8 dict N nn begin +/FontType 3 N/FontMatrix fntrx N/FontBBox FBB N string/base X array +/BitMaps X/BuildChar{CharBuilder}N/Encoding IE N end A{/foo setfont}2 +array copy cvx N load 0 nn put/ctr 0 N[}B/sf 0 N/df{/sf 1 N/fntrx FMat N +df-tail}B/dfs{div/sf X/fntrx[sf 0 0 sf neg 0 0]N df-tail}B/E{pop nn A +definefont setfont}B/Cw{Cd A length 5 sub get}B/Ch{Cd A length 4 sub get +}B/Cx{128 Cd A length 3 sub get sub}B/Cy{Cd A length 2 sub get 127 sub} +B/Cdx{Cd A length 1 sub get}B/Ci{Cd A type/stringtype ne{ctr get/ctr ctr +1 add N}if}B/id 0 N/rw 0 N/rc 0 N/gp 0 N/cp 0 N/G 0 N/CharBuilder{save 3 +1 roll S A/base get 2 index get S/BitMaps get S get/Cd X pop/ctr 0 N Cdx +0 Cx Cy Ch sub Cx Cw add Cy setcachedevice Cw Ch true[1 0 0 -1 -.1 Cx +sub Cy .1 sub]/id Ci N/rw Cw 7 add 8 idiv string N/rc 0 N/gp 0 N/cp 0 N{ +rc 0 ne{rc 1 sub/rc X rw}{G}ifelse}imagemask restore}B/G{{id gp get/gp +gp 1 add N A 18 mod S 18 idiv pl S get exec}loop}B/adv{cp add/cp X}B +/chg{rw cp id gp 4 index getinterval putinterval A gp add/gp X adv}B/nd{ +/cp 0 N rw exit}B/lsh{rw cp 2 copy get A 0 eq{pop 1}{A 255 eq{pop 254}{ +A A add 255 and S 1 and or}ifelse}ifelse put 1 adv}B/rsh{rw cp 2 copy +get A 0 eq{pop 128}{A 255 eq{pop 127}{A 2 idiv S 128 and or}ifelse} +ifelse put 1 adv}B/clr{rw cp 2 index string putinterval adv}B/set{rw cp +fillstr 0 4 index getinterval putinterval adv}B/fillstr 18 string 0 1 17 +{2 copy 255 put pop}for N/pl[{adv 1 chg}{adv 1 chg nd}{1 add chg}{1 add +chg nd}{adv lsh}{adv lsh nd}{adv rsh}{adv rsh nd}{1 add adv}{/rc X nd}{ +1 add set}{1 add clr}{adv 2 chg}{adv 2 chg nd}{pop nd}]A{bind pop} +forall N/D{/cc X A type/stringtype ne{]}if nn/base get cc ctr put nn +/BitMaps get S ctr S sf 1 ne{A A length 1 sub A 2 index S get sf div put +}if put/ctr ctr 1 add N}B/I{cc 1 add D}B/bop{userdict/bop-hook known{ +bop-hook}if/SI save N @rigin 0 0 moveto/V matrix currentmatrix A 1 get A +mul exch 0 get A mul add .99 lt{/QV}{/RV}ifelse load def pop pop}N/eop{ +SI restore userdict/eop-hook known{eop-hook}if showpage}N/@start{ +userdict/start-hook known{start-hook}if pop/VResolution X/Resolution X +1000 div/DVImag X/IE 256 array N 2 string 0 1 255{IE S A 360 add 36 4 +index cvrs cvn put}for pop 65781.76 div/vsize X 65781.76 div/hsize X}N +/p{show}N/RMat[1 0 0 -1 0 0]N/BDot 260 string N/Rx 0 N/Ry 0 N/V{}B/RV/v{ +/Ry X/Rx X V}B statusdict begin/product where{pop false[(Display)(NeXT) +(LaserWriter 16/600)]{A length product length le{A length product exch 0 +exch getinterval eq{pop true exit}if}{pop}ifelse}forall}{false}ifelse +end{{gsave TR -.1 .1 TR 1 1 scale Rx Ry false RMat{BDot}imagemask +grestore}}{{gsave TR -.1 .1 TR Rx Ry scale 1 1 false RMat{BDot} +imagemask grestore}}ifelse B/QV{gsave newpath transform round exch round +exch itransform moveto Rx 0 rlineto 0 Ry neg rlineto Rx neg 0 rlineto +fill grestore}B/a{moveto}B/delta 0 N/tail{A/delta X 0 rmoveto}B/M{S p +delta add tail}B/b{S p tail}B/c{-4 M}B/d{-3 M}B/e{-2 M}B/f{-1 M}B/g{0 M} +B/h{1 M}B/i{2 M}B/j{3 M}B/k{4 M}B/w{0 rmoveto}B/l{p -4 w}B/m{p -3 w}B/n{ +p -2 w}B/o{p -1 w}B/q{p 1 w}B/r{p 2 w}B/s{p 3 w}B/t{p 4 w}B/x{0 S +rmoveto}B/y{3 2 roll p a}B/bos{/SS save N}B/eos{SS restore}B end + +%%EndProcSet +%%BeginProcSet: 8r.enc +% @@psencodingfile@{ +% author = "S. Rahtz, P. MacKay, Alan Jeffrey, B. Horn, K. Berry", +% version = "0.6", +% date = "22 June 1996", +% filename = "8r.enc", +% email = "kb@@mail.tug.org", +% address = "135 Center Hill Rd. // Plymouth, MA 02360", +% codetable = "ISO/ASCII", +% checksum = "119 662 4424", +% docstring = "Encoding for TrueType or Type 1 fonts to be used with TeX." +% @} +% +% Idea is to have all the characters normally included in Type 1 fonts +% available for typesetting. This is effectively the characters in Adobe +% Standard Encoding + ISO Latin 1 + extra characters from Lucida. +% +% Character code assignments were made as follows: +% +% (1) the Windows ANSI characters are almost all in their Windows ANSI +% positions, because some Windows users cannot easily reencode the +% fonts, and it makes no difference on other systems. The only Windows +% ANSI characters not available are those that make no sense for +% typesetting -- rubout (127 decimal), nobreakspace (160), softhyphen +% (173). quotesingle and grave are moved just because it's such an +% irritation not having them in TeX positions. +% +% (2) Remaining characters are assigned arbitrarily to the lower part +% of the range, avoiding 0, 10 and 13 in case we meet dumb software. +% +% (3) Y&Y Lucida Bright includes some extra text characters; in the +% hopes that other PostScript fonts, perhaps created for public +% consumption, will include them, they are included starting at 0x12. +% +% (4) Remaining positions left undefined are for use in (hopefully) +% upward-compatible revisions, if someday more characters are generally +% available. +% +% (5) hyphen appears twice for compatibility with both ASCII and Windows. +% +/TeXBase1Encoding [ +% 0x00 (encoded characters from Adobe Standard not in Windows 3.1) + /.notdef /dotaccent /fi /fl + /fraction /hungarumlaut /Lslash /lslash + /ogonek /ring /.notdef + /breve /minus /.notdef +% These are the only two remaining unencoded characters, so may as +% well include them. + /Zcaron /zcaron +% 0x10 + /caron /dotlessi +% (unusual TeX characters available in, e.g., Lucida Bright) + /dotlessj /ff /ffi /ffl + /.notdef /.notdef /.notdef /.notdef + /.notdef /.notdef /.notdef /.notdef + % very contentious; it's so painful not having quoteleft and quoteright + % at 96 and 145 that we move the things normally found there down to here. + /grave /quotesingle +% 0x20 (ASCII begins) + /space /exclam /quotedbl /numbersign + /dollar /percent /ampersand /quoteright + /parenleft /parenright /asterisk /plus /comma /hyphen /period /slash +% 0x30 + /zero /one /two /three /four /five /six /seven + /eight /nine /colon /semicolon /less /equal /greater /question +% 0x40 + /at /A /B /C /D /E /F /G /H /I /J /K /L /M /N /O +% 0x50 + /P /Q /R /S /T /U /V /W + /X /Y /Z /bracketleft /backslash /bracketright /asciicircum /underscore +% 0x60 + /quoteleft /a /b /c /d /e /f /g /h /i /j /k /l /m /n /o +% 0x70 + /p /q /r /s /t /u /v /w + /x /y /z /braceleft /bar /braceright /asciitilde + /.notdef % rubout; ASCII ends +% 0x80 + /.notdef /.notdef /quotesinglbase /florin + /quotedblbase /ellipsis /dagger /daggerdbl + /circumflex /perthousand /Scaron /guilsinglleft + /OE /.notdef /.notdef /.notdef +% 0x90 + /.notdef /.notdef /.notdef /quotedblleft + /quotedblright /bullet /endash /emdash + /tilde /trademark /scaron /guilsinglright + /oe /.notdef /.notdef /Ydieresis +% 0xA0 + /.notdef % nobreakspace + /exclamdown /cent /sterling + /currency /yen /brokenbar /section + /dieresis /copyright /ordfeminine /guillemotleft + /logicalnot + /hyphen % Y&Y (also at 45); Windows' softhyphen + /registered + /macron +% 0xD0 + /degree /plusminus /twosuperior /threesuperior + /acute /mu /paragraph /periodcentered + /cedilla /onesuperior /ordmasculine /guillemotright + /onequarter /onehalf /threequarters /questiondown +% 0xC0 + /Agrave /Aacute /Acircumflex /Atilde /Adieresis /Aring /AE /Ccedilla + /Egrave /Eacute /Ecircumflex /Edieresis + /Igrave /Iacute /Icircumflex /Idieresis +% 0xD0 + /Eth /Ntilde /Ograve /Oacute + /Ocircumflex /Otilde /Odieresis /multiply + /Oslash /Ugrave /Uacute /Ucircumflex + /Udieresis /Yacute /Thorn /germandbls +% 0xE0 + /agrave /aacute /acircumflex /atilde + /adieresis /aring /ae /ccedilla + /egrave /eacute /ecircumflex /edieresis + /igrave /iacute /icircumflex /idieresis +% 0xF0 + /eth /ntilde /ograve /oacute + /ocircumflex /otilde /odieresis /divide + /oslash /ugrave /uacute /ucircumflex + /udieresis /yacute /thorn /ydieresis +] def + +%%EndProcSet +%%BeginProcSet: texnansi.enc +% @psencodingfile{ +% author = "Y&Y, Inc.", +% version = "1.1", +% date = "1 December 1996", +% filename = "texnansi.enc", +% email = "help@YandY.com", +% address = "45 Walden Street // Concord, MA 01742, USA", +% codetable = "ISO/ASCII", +% checksum = "xx", +% docstring = "Encoding for fonts in Adobe Type 1 format for use with TeX." +% } +% +% The idea is to have all 228 characters normally included in Type 1 text +% fonts (plus a few more) available for typesetting. This is effectively +% the character set in Adobe Standard Encoding, ISO Latin 1, plus a few more. +% +% Character code assignments were made as follows: +% +% (1) The character layout largely matches `ASCII' in the 32 -- 126 range, +% except for `circumflex' in 94 and `tilde' in 126, to match `TeX text' +% (`asciicircumflex' and `asciitilde' appear in 158 and 142 instead). +% +% (2) The character layout matches `Windows ANSI' in almost all places, +% except for `quoteright' in 39 and `quoteleft' in 96 to match ASCII +% (`quotesingle' and `grave' appear in 129 and 18 instead). +% +% (3) The character layout matches `TeX typewriter' used by CM text fonts +% in most places (except for discordant positions such as hungarumlaut +% (instead of braceright), dotaccent (instead of underscore) etc. +% +% (4) Remaining characters are assigned arbitrarily to the `control character' +% range (0 -- 31), avoiding 0, 9, 10 and 13 in case we meet dumb software +% - similarly one should really avoid 127 and 128 if possible. +% In addition, the 8 open slots in Windows ANSI between 128 and 159 are used. +% +% (5) Y&Y Lucida Bright includes some extra ligatures and such; ff, ffi, ffl, +% and `dotlessj,' these are included 11 -- 15, and 17. +% +% (6) Hyphen appears both at 45 and 173 for compatibility with both ASCII +% and Windows ANSI. +% +% (7) It doesn't really matter where ligatures appear (both real, such as ffi, +% and pseudo such as ---) since these should not be accessed directly, only +% via ligature information in the TFM file. +% +% SAMPLE USAGE (in `psfonts.map' file for DVIPS): +% +% lbr LucidaBright "TeXnANSIEncoding ReEncodeFont" <texnansi.enc <lbr.pfb +% +% This tells DVIPS that the font called `lbr' in TeX has PostScript +% FontName `LucidaBright.' It also asks DVIPS to expand the file `lbr.pfb' +% into PFA form, to include the attached `texnansi.enc' encoding vector, +% and to then actually reencode the font based on that encoding vector. +% +% Revised 1996 June 1 by adding second position for `fl' to avoid Acrobat bug. +% Revised 1996 June 1 by adding second position for `fraction' for same reason. +% +/TeXnANSIEncoding [ +/.notdef /uni20AC /.notdef /.notdef % 0, 1, 2, 3 +/fraction % 4 +/dotaccent % 5 +/hungarumlaut % 6 +/ogonek % 7 +/fl % 8 +/.notdef % /fraction % 9 not used (see 4), backward compatability only +/cwm % 10 not used, except boundary char internally maybe +/ff % 11 +/fi % 12 +/.notdef % /fl % 13 not used (see 8), backward compatability only +/ffi % 14 +/ffl % 15 +/dotlessi % 16 +/dotlessj % 17 +/grave % 18 +/acute % 19 +/caron % 20 +/breve % 21 +/macron % 22 +/ring % 23 +/cedilla % 24 +/germandbls % 25 +/ae % 26 +/oe % 27 +/oslash % 28 +/AE % 29 +/OE % 30 +/Oslash % 31 +/space % 32 % /suppress in TeX text +/exclam % 33 +/quotedbl % 34 % /quotedblright in TeX text +/numbersign % 35 +/dollar % 36 +/percent % 37 +/ampersand % 38 +/quoteright % 39 % /quotesingle in ANSI +/parenleft % 40 +/parenright % 41 +/asterisk % 42 +/plus % 43 +/comma % 44 +/hyphen % 45 +/period % 46 +/slash % 47 +/zero % 48 +/one % 49 +/two % 50 +/three % 51 +/four % 52 +/five % 53 +/six % 54 +/seven % 55 +/eight % 56 +/nine % 57 +/colon % 58 +/semicolon % 59 +/less % 60 % /exclamdown in Tex text +/equal % 61 +/greater % 62 % /questiondown in TeX text +/question % 63 +/at % 64 +/A % 65 +/B % 66 +/C % 67 +/D % 68 +/E % 69 +/F % 70 +/G % 71 +/H % 72 +/I % 73 +/J % 74 +/K % 75 +/L % 76 +/M % 77 +/N % 78 +/O % 79 +/P % 80 +/Q % 81 +/R % 82 +/S % 83 +/T % 84 +/U % 85 +/V % 86 +/W % 87 +/X % 88 +/Y % 89 +/Z % 90 +/bracketleft % 91 +/backslash % 92 % /quotedblleft in TeX text +/bracketright % 93 +/circumflex % 94 % /asciicircum in ASCII +/underscore % 95 % /dotaccent in TeX text +/quoteleft % 96 % /grave accent in ANSI +/a % 97 +/b % 98 +/c % 99 +/d % 100 +/e % 101 +/f % 102 +/g % 103 +/h % 104 +/i % 105 +/j % 106 +/k % 107 +/l % 108 +/m % 109 +/n % 110 +/o % 111 +/p % 112 +/q % 113 +/r % 114 +/s % 115 +/t % 116 +/u % 117 +/v % 118 +/w % 119 +/x % 120 +/y % 121 +/z % 122 +/braceleft % 123 % /endash in TeX text +/bar % 124 % /emdash in TeX test +/braceright % 125 % /hungarumlaut in TeX text +/tilde % 126 % /asciitilde in ASCII +/dieresis % 127 not used (see 168), use higher up instead +/Lslash % 128 this position is unfortunate, but now too late to fix +/quotesingle % 129 +/quotesinglbase % 130 +/florin % 131 +/quotedblbase % 132 +/ellipsis % 133 +/dagger % 134 +/daggerdbl % 135 +/circumflex % 136 +/perthousand % 137 +/Scaron % 138 +/guilsinglleft % 139 +/OE % 140 +/Zcaron % 141 +/asciicircum % 142 +/minus % 143 +/lslash % 144 +/quoteleft % 145 +/quoteright % 146 +/quotedblleft % 147 +/quotedblright % 148 +/bullet % 149 +/endash % 150 +/emdash % 151 +/tilde % 152 +/trademark % 153 +/scaron % 154 +/guilsinglright % 155 +/oe % 156 +/zcaron % 157 +/asciitilde % 158 +/Ydieresis % 159 +/nbspace % 160 % /space (no break space) +/exclamdown % 161 +/cent % 162 +/sterling % 163 +/currency % 164 +/yen % 165 +/brokenbar % 166 +/section % 167 +/dieresis % 168 +/copyright % 169 +/ordfeminine % 170 +/guillemotleft % 171 +/logicalnot % 172 +/sfthyphen % 173 % /hyphen (hanging hyphen) +/registered % 174 +/macron % 175 +/degree % 176 +/plusminus % 177 +/twosuperior % 178 +/threesuperior % 179 +/acute % 180 +/mu % 181 +/paragraph % 182 +/periodcentered % 183 +/cedilla % 184 +/onesuperior % 185 +/ordmasculine % 186 +/guillemotright % 187 +/onequarter % 188 +/onehalf % 189 +/threequarters % 190 +/questiondown % 191 +/Agrave % 192 +/Aacute % 193 +/Acircumflex % 194 +/Atilde % 195 +/Adieresis % 196 +/Aring % 197 +/AE % 198 +/Ccedilla % 199 +/Egrave % 200 +/Eacute % 201 +/Ecircumflex % 202 +/Edieresis % 203 +/Igrave % 204 +/Iacute % 205 +/Icircumflex % 206 +/Idieresis % 207 +/Eth % 208 +/Ntilde % 209 +/Ograve % 210 +/Oacute % 211 +/Ocircumflex % 212 +/Otilde % 213 +/Odieresis % 214 +/multiply % 215 % OE in T1 +/Oslash % 216 +/Ugrave % 217 +/Uacute % 218 +/Ucircumflex % 219 +/Udieresis % 220 +/Yacute % 221 +/Thorn % 222 +/germandbls % 223 % SS in T1 +/agrave % 224 +/aacute % 225 +/acircumflex % 226 +/atilde % 227 +/adieresis % 228 +/aring % 229 +/ae % 230 +/ccedilla % 231 +/egrave % 232 +/eacute % 233 +/ecircumflex % 234 +/edieresis % 235 +/igrave % 236 +/iacute % 237 +/icircumflex % 238 +/idieresis % 239 +/eth % 240 +/ntilde % 241 +/ograve % 242 +/oacute % 243 +/ocircumflex % 244 +/otilde % 245 +/odieresis % 246 +/divide % 247 % oe in T1 +/oslash % 248 +/ugrave % 249 +/uacute % 250 +/ucircumflex % 251 +/udieresis % 252 +/yacute % 253 +/thorn % 254 +/ydieresis % 255 % germandbls in T1 +] def + +%%EndProcSet +%%BeginProcSet: texps.pro +%! +TeXDict begin/rf{findfont dup length 1 add dict begin{1 index/FID ne 2 +index/UniqueID ne and{def}{pop pop}ifelse}forall[1 index 0 6 -1 roll +exec 0 exch 5 -1 roll VResolution Resolution div mul neg 0 0]/Metrics +exch def dict begin Encoding{exch dup type/integertype ne{pop pop 1 sub +dup 0 le{pop}{[}ifelse}{FontMatrix 0 get div Metrics 0 get div def} +ifelse}forall Metrics/Metrics currentdict end def[2 index currentdict +end definefont 3 -1 roll makefont/setfont cvx]cvx def}def/ObliqueSlant{ +dup sin S cos div neg}B/SlantFont{4 index mul add}def/ExtendFont{3 -1 +roll mul exch}def/ReEncodeFont{CharStrings rcheck{/Encoding false def +dup[exch{dup CharStrings exch known not{pop/.notdef/Encoding true def} +if}forall Encoding{]exch pop}{cleartomark}ifelse}if/Encoding exch def} +def end + +%%EndProcSet +%%BeginProcSet: special.pro +%! +TeXDict begin/SDict 200 dict N SDict begin/@SpecialDefaults{/hs 612 N +/vs 792 N/ho 0 N/vo 0 N/hsc 1 N/vsc 1 N/ang 0 N/CLIP 0 N/rwiSeen false N +/rhiSeen false N/letter{}N/note{}N/a4{}N/legal{}N}B/@scaleunit 100 N +/@hscale{@scaleunit div/hsc X}B/@vscale{@scaleunit div/vsc X}B/@hsize{ +/hs X/CLIP 1 N}B/@vsize{/vs X/CLIP 1 N}B/@clip{/CLIP 2 N}B/@hoffset{/ho +X}B/@voffset{/vo X}B/@angle{/ang X}B/@rwi{10 div/rwi X/rwiSeen true N}B +/@rhi{10 div/rhi X/rhiSeen true N}B/@llx{/llx X}B/@lly{/lly X}B/@urx{ +/urx X}B/@ury{/ury X}B/magscale true def end/@MacSetUp{userdict/md known +{userdict/md get type/dicttype eq{userdict begin md length 10 add md +maxlength ge{/md md dup length 20 add dict copy def}if end md begin +/letter{}N/note{}N/legal{}N/od{txpose 1 0 mtx defaultmatrix dtransform S +atan/pa X newpath clippath mark{transform{itransform moveto}}{transform{ +itransform lineto}}{6 -2 roll transform 6 -2 roll transform 6 -2 roll +transform{itransform 6 2 roll itransform 6 2 roll itransform 6 2 roll +curveto}}{{closepath}}pathforall newpath counttomark array astore/gc xdf +pop ct 39 0 put 10 fz 0 fs 2 F/|______Courier fnt invertflag{PaintBlack} +if}N/txpose{pxs pys scale ppr aload pop por{noflips{pop S neg S TR pop 1 +-1 scale}if xflip yflip and{pop S neg S TR 180 rotate 1 -1 scale ppr 3 +get ppr 1 get neg sub neg ppr 2 get ppr 0 get neg sub neg TR}if xflip +yflip not and{pop S neg S TR pop 180 rotate ppr 3 get ppr 1 get neg sub +neg 0 TR}if yflip xflip not and{ppr 1 get neg ppr 0 get neg TR}if}{ +noflips{TR pop pop 270 rotate 1 -1 scale}if xflip yflip and{TR pop pop +90 rotate 1 -1 scale ppr 3 get ppr 1 get neg sub neg ppr 2 get ppr 0 get +neg sub neg TR}if xflip yflip not and{TR pop pop 90 rotate ppr 3 get ppr +1 get neg sub neg 0 TR}if yflip xflip not and{TR pop pop 270 rotate ppr +2 get ppr 0 get neg sub neg 0 S TR}if}ifelse scaleby96{ppr aload pop 4 +-1 roll add 2 div 3 1 roll add 2 div 2 copy TR .96 dup scale neg S neg S +TR}if}N/cp{pop pop showpage pm restore}N end}if}if}N/normalscale{ +Resolution 72 div VResolution 72 div neg scale magscale{DVImag dup scale +}if 0 setgray}N/psfts{S 65781.76 div N}N/startTexFig{/psf$SavedState +save N userdict maxlength dict begin/magscale true def normalscale +currentpoint TR/psf$ury psfts/psf$urx psfts/psf$lly psfts/psf$llx psfts +/psf$y psfts/psf$x psfts currentpoint/psf$cy X/psf$cx X/psf$sx psf$x +psf$urx psf$llx sub div N/psf$sy psf$y psf$ury psf$lly sub div N psf$sx +psf$sy scale psf$cx psf$sx div psf$llx sub psf$cy psf$sy div psf$ury sub +TR/showpage{}N/erasepage{}N/copypage{}N/p 3 def @MacSetUp}N/doclip{ +psf$llx psf$lly psf$urx psf$ury currentpoint 6 2 roll newpath 4 copy 4 2 +roll moveto 6 -1 roll S lineto S lineto S lineto closepath clip newpath +moveto}N/endTexFig{end psf$SavedState restore}N/@beginspecial{SDict +begin/SpecialSave save N gsave normalscale currentpoint TR +@SpecialDefaults count/ocount X/dcount countdictstack N}N/@setspecial{ +CLIP 1 eq{newpath 0 0 moveto hs 0 rlineto 0 vs rlineto hs neg 0 rlineto +closepath clip}if ho vo TR hsc vsc scale ang rotate rwiSeen{rwi urx llx +sub div rhiSeen{rhi ury lly sub div}{dup}ifelse scale llx neg lly neg TR +}{rhiSeen{rhi ury lly sub div dup scale llx neg lly neg TR}if}ifelse +CLIP 2 eq{newpath llx lly moveto urx lly lineto urx ury lineto llx ury +lineto closepath clip}if/showpage{}N/erasepage{}N/copypage{}N newpath}N +/@endspecial{count ocount sub{pop}repeat countdictstack dcount sub{end} +repeat grestore SpecialSave restore end}N/@defspecial{SDict begin}N +/@fedspecial{end}B/li{lineto}B/rl{rlineto}B/rc{rcurveto}B/np{/SaveX +currentpoint/SaveY X N 1 setlinecap newpath}N/st{stroke SaveX SaveY +moveto}N/fil{fill SaveX SaveY moveto}N/ellipse{/endangle X/startangle X +/yrad X/xrad X/savematrix matrix currentmatrix N TR xrad yrad scale 0 0 +1 startangle endangle arc savematrix setmatrix}N end + +%%EndProcSet +TeXDict begin 40258431 52099146 1000 600 600 (smpaiaa.dvi) +@start +%DVIPSBitmapFont: Fa cmti8 8 43 +/Fa 43 122 df<ED3FF8913801FFFE913903F00F8091390FC003C0EC1F00160F143EA214 +7E027CEB070093C7FCA214FC5CA5017FB512FEA2903901F0007E167CA213034A13FC5EA3 +0107130102C05BA31503010F5C1480A2923807E18016C3131FA2140016C7EE87005B013E +148EED03DEED01FC6F5A017E91C7FC137CA3EA38F812FCA25B12FDEAF1E0EAF3C0EA7F80 +001ECAFC2A3D81AE28>12 D<147E49B46C131C902607C3C0137E90381F01E0EB3E004915 +7C01780170133C9038F803F0D801F015384A481378D803E015F0913903C001E091C71203 +0007ED07C049EC0F80EE1F00167E9039C7C001FF9039DFF003EF903AFC7007878001F8EB +0F03D803F0011E13C001E0EB3C010007EBF038380FF0E03B1FFFC07B81E090399F0077C0 +48C7EA3FC1A248021F13C0007EEC07011500160300FE16805A16071700160E007C151E00 +7E5D003E1538003F15F06C4A5AD80FC0495AD803E0011FC7FCD801FC13FC39007FFFF001 +0790C8FC2F3077AE37>38 D<EA0380EA0FE0121FA213F0A213E0EA0760120013E013C012 +0113801203EA07001206120E5A5A12F012C00C157B8716>44 D<387FFFC0A2B5FCA26C13 +0012057A901A>I<EC7F80903801FFE0903807C0F890381E007C49133C49133E49131EEA +01E613C701C3133E120313831387D801CE137E01FC137CD8007813F890C7FCEC01F0EC03 +E0EC0F80EC3F00EB0FFCA2EB001E141FEC0F80A215C0A41218127C141F00FC1480A24813 +3F00E01400147E6C5B387001F8387803F0383C0FC0D80FFFC7FCEA03F81F2D79AB24>51 +D<13F0EA01F812031207A3EA03F0EA01C0C7FCAD121C127F5AA45A12380D1D789C16>58 +D<16E01501821503A21507150FA2151FA2153B157B157315E382EC01C114031581EC0701 +A2140EA2141C143C143802707F15005C13015C49B5FCA249C7FCA2130E131E131C498016 +7E5B13F0485AA21203D80FF014FFD8FFFC011F13F0A22C2F7CAE35>65 +D<DA01FE133091390FFFC07091393F01E0F09138F80079D903E0133D4948EB1FE0D91F80 +130F49C7FC017E14074915C0485A485A5B00071680485AA2485A170048CAFCA25A127EA3 +12FE5AA5163848157816707E16F0007C5D15014B5A6C5D4BC7FC6C140E6C6C133C6C6C5B +6C6C485A3900F80FC0D97FFFC8FCEB0FF82C2F75AD33>67 D<011FB512FCEEFF80903A00 +FE000FC0EE03E04AEB01F0EE00F80101157C173C4A143E171E0103151FA25CA21307A25C +A2130FA24A143FA2131F173E4A147EA2013F157C17FC91C8FC17F849EC01F0A2017EEC03 +E0A201FEEC07C0EE0F8049EC1F00163E00015D5E49495AED07C00003023FC7FCB612FC15 +E0302D7BAC36>I<011FB612F8A2903900FE000716014A13001778130117705CA21303A2 +5C16E001071301170002E05B1503130F15074A485A91B5FC5BECC01F4A6CC7FCA2133FA2 +EC000EA25B92C8FC137EA213FEA25BA21201A25BA21203B512F0A22D2D7CAC2E>70 +D<03FF1318020FEBC03891393F00F07802F8EB38F8D903F0131CD907C0EB0FF0EB1F8049 +C71207137E49EC03E0485A485AA2484815C0485AA2485A178048CAFCA25A127EA312FE5A +A292B512E0A2923801FE006F5A15015EA3007C14035E127E123E001E1407001F5D6C6C13 +0F6C6C133F6C6C13793A00F803F1C090383FFF80D907FCC8FC2D2F75AD37>I<90381FFF +F8A2903800FE00A25CA21301A25CA21303A25CA21307A25CA2130FA25CA2131FA25CA213 +3FA291C7FCA25BA2137EA213FEA25BA21201A25BA21203B512C0A21D2D7CAC1B>73 +D<91387FFFE0A2913800FE00A25DA214015DA314035DA314075DA3140F5DA3141F5DA314 +3F92C7FCA35CA2147EA2003C13FE127E00FE5BA2495AEAFC0300F05B48485A38700FC0D8 +781FC8FCEA1FFCEA07F0232E7AAC25>I<D91FFFED0FFF600100EE3FC0A2F07F8018EF90 +2601EF8014FF943801DF0014CFEF039F01034B5A183E028F140E171C0107167EDA87C0EB +387C14071770010FEDE0FC60010EEC01C0EE0380011E158193380701F090381C03E0160E +013CEC1C036001381438A20178EC700704E05B90387001F0EDF1C001F09038F3800F6001 +E0EBF700A2000102FE131F4B91C7FC13C0486C6C5AD80FF05DD8FFFE9039F00FFFF815E0 +402D7BAC40>77 D<D91FFE903803FFF8A2D900FF9038003F80EF1E00A26F131C49153C6F +133814CFA201036D137802C714701487EC83F0010715F06F5B1401A2010FEBFC0102005C +130E157E011E1403037F5B011C133FA2013C1487031F90C7FC1338ED0FC7017814CF16EE +01701307A201F014FE6F5A5B150112015E491300487E120FD8FFFE1470A2352D7BAC35> +I<011FB512FCEEFF80903A00FE000FE0EE03F04AEB00F8A20101157CA25C177E130317FC +5CA20107EC01F8A24AEB03F017E0010FEC07C0EE0F804AEB3F00ED01FC91B512F04991C7 +FC0280C8FCA3133F91C9FCA35B137EA313FE5BA312015BA21203B512C0A22F2D7CAC30> +80 D<011FB512E016FC903900FE003FEE0FC04AEB07E016030101EC01F0A24A14F8A213 +03EE03F05CA20107EC07E017C04AEB0F80EE1F00010F143E16FC9138C007F091B512805B +9138C00FE091388003F06F7E133F6F7E91C7FCA2491301A2017E5CA201FE1303A2495C17 +080001163C17384914E0EEF07800031670B5D8C00113E09238007FC0C9EA1F002E2E7BAC +34>82 D<91380FF00C91383FFC1C9138F80F3C903903C007BC9039078003FC90390F0001 +F8131E491300A24914F0A313F816E0A216007F7F6D7EEB7FF8ECFF806D13E06D13F80107 +7F01017FEB001FEC01FF6E7E8181A281121CA35D003C141EA25DA2007E5C5D007F495A6D +485A26F1F01FC7FC38E07FFC38C00FF0262F7BAD28>I<000FB712F0A23A1FE00FE00701 +001401001E02C013E0481500141F12380078EC8001A20070013F14C012F0481400A25CC7 +91C7FC147EA214FEA25CA21301A25CA21303A25CA21307A25CA2130FA25CA2131FA25CA2 +133F003FB57EA22C2D74AC33>I<3B3FFFF007FFF0A2D801FCC7EA7F00163C5B16380003 +157816705BA2000715F05E5BA2000F14015E5BA2001F14035E5BA2003F140793C7FC90C7 +FCA2485C150E127EA2151E00FE141C5A153C153815781570007C5C1401007E495A003E49 +5A6C49C8FC6C133C3807C0F83801FFE06C6CC9FC2C2E72AC35>I<B53B807FFF803FFFA2 +3D0FF00007F00007F06C48EE03E04C14C019801807030F1500180E4B7E60153B037B5C03 +73147803E3147018F0DA01C35C4D5AEC03834D5A3903F00703020F4AC7FC020E5C021E14 +0E021C141E0238141C5F027013F803015B14E001F15D14C001F3ECF9C0028013FBD9F700 +5C04FFC8FC13FE5E5B00015D5B5E5B495C5E491300402E72AC47>87 +D<EB07C0EB1FF090387C39C0EBF81FEA01F03803E00FEA07C0120FD81F801380A2EA3F00 +141F481400127EA25C00FE133E5AA2EC7E18EC7C385AA214FCD878011378397C03F870A2 +393C0F78E0381E1E3D390FF81FC03903E00F001D1F799D24>97 D<EB01F8EB0FFE90383E +0780EBFC03D801F013C03803E0070007130FEA0FC001801380121F48C8FCA25A127EA312 +FE5AA5EC0180007CEB03C0EC0780EC0F006C131E001E137C380F83F03807FFC0C648C7FC +1A1F799D21>99 D<153EEC07FEA2EC007EA2157CA215FCA215F8A21401A215F0A21403EB +07C390381FF3E0EB7C3BEBF81FEA01F03903E00FC0EA07C0120FEA1F801580EA3F00141F +5A007E1400A25C12FE48133EA2EC7E18153848137CA214FCD878011378397C03F870A239 +3C0F78E0381E1E3D390FF81FC03903E00F001F2F79AD24>I<EB03F8EB0FFEEB3E0FEBF8 +073901F00380EA03E0EA07C0000F1307D81F8013005C383F001E5C387F03F8EBFFE049C7 +FC007EC8FC12FE5AA4127CEC0180EC03C0EC07806CEB0F00141E6C137C380F83F03803FF +C0C648C7FC1A1F799D21>I<EC01F0EC07FCEC0F9EEC1F1EEC1E3EEC3E7EA3EC7C381500 +A314FC5CA590387FFFF0A2903801F000A313035CA413075CA4130F5CA4131F91C7FCA45B +133EA4137E137CA3EA38F812FCA25B12FDEAF1E0EAF3C0EA7F80001EC8FC1F3D81AE16> +I<14F8EB03FE90380F873890381F03F8137EEB7C0113F81201EA03F015F0EA07E0140312 +0F01C013E0A21407121F018013C0A2140FA21580141F120F143FEC7F006C6C5AEA03C338 +01FFBF38007E3E1300147EA2147CA214FC00385BEAFC015C495A48485A38F01F80D87FFE +C7FCEA1FF01D2C7C9D21>I<131FEA03FFA2EA003FA2133EA2137EA2137CA213FCA25BA2 +1201147E9038F3FF809038F787C03903FE03E013FC13F8A2EA07F013E0A213C0000F1307 +15C01380A2001F130F15801300141F481406150E003E133F143E007E141EEC7E1C007C13 +7CEC3C3812FC157048EB1FE00070EB07801F2F7BAD24>I<130E131FEB3F80A2EB1F0013 +0E90C7FCA9EA03E0EA0FF0EA1E78EA1C7C12381278127013FCEAF0F812E012E1EAC1F012 +0112035B12075BA2120F13831387121F13075BEA3F0E123EEA1E1C133C1338EA0FF0EA03 +C0112E7AAC16>I<131FEA03FFA2EA003FA2133EA2137EA2137CA213FCA25BA21201EC01 +E09038F007F0EC1E380003EB3878EC71F8EBE0E1EBE1C13807E381EC00E049130013CEEA +0FFC13F0A213FF381F9FC0EB87E0EB03F01301003F14301570123EA2007E14F015E0007C +13E014E100FC14C0903800F38048EB7F000070131E1D2F7BAD21>107 +D<137CEA0FFCA21200A213F8A21201A213F0A21203A213E0A21207A213C0A2120FA21380 +A2121FA21300A25AA2123EA2127EA2127CA2EAFC30137012F8A213F013E012F012F113C0 +12FBEA7F80EA1E000E2F7AAD12>I<3B07801FC007F03B1FE07FF01FFC3B3DF1E0F8783E +3B38F3C078F01E3B78FF007DC01FD870FEEB7F80A2D8F1FC1400D8E1F8137EA249137C00 +C302FC5B0003163E495BA200070101147E177C01C05B17FC000F0103ECF83018700180EB +E00117F0001F010715F0040313E0010001C013E0EFE1C048010F1301EFE380003E913980 +00FF00001C6DC7123C341F7A9D3A>I<3907801FC0391FE07FF0393DF1E0F83938F3C078 +3978FF007CEA70FEA2EAF1FCEAE1F8A25B00C314FC00035C5BA2000713015D13C0140300 +0FECE0C015E1EB800715C1001F14C3020F13800100138391380787005A158E003EEB03FC +001CEB00F0221F7A9D28>I<EB03F8EB0FFE90383E0F809038FC07C03801F003D803E013 +E01207390FC001F01380121FEA3F0014035A127EA2140700FE14E05AA2EC0FC0A2EC1F80 +A2007CEB3F00143E5C6C5B381E01F0380F07C06CB4C7FCEA01FC1C1F799D24>I<90383C +01F09038FF07FC3901E79E1E9038C7BC0F000301F81380903887F00702E013C038078FC0 +130F1480A2D8061F130F12001400A249131F1680133EA2017EEB3F00A2017C133E157E01 +FC137C5DEBFE015D486C485AEC0F80D9F3FEC7FCEBF0F8000390C8FCA25BA21207A25BA2 +120FA2EAFFFCA2222B7F9D24>I<3807803E391FE0FF80393CF3C1C03938F781E03878FF +07EA70FE13FC12F139E1F8038091C7FC5B12C312035BA21207A25BA2120FA25BA2121FA2 +90C8FCA25AA2123E121C1B1F7A9D1E>114 D<EB0FC0EB7FF0EBF03C3801E01C3803C01E +EA0780143EA2000F133C1418EBC00013F813FF6C13C06C13E06C13F0EA007F1307130313 +01EA780012FCA2130100F813E012E0EB03C038F0078038781F00EA1FFCEA07F0171F7A9D +1D>I<131C133EA2137EA2137CA213FCA25BA21201A2B512E0A23803F000A25BA21207A2 +5BA2120FA25BA2121FA290C7FCA24813C01301123E130314801307003C1300130E131E6C +5AEA0FF0EA07C0132B7AA918>I<EA03C0D80FF01338D81E78137CD81C7C13FC003814F8 +12781270EBFC01D8F0F813F012E012E138C1F003000114E0120313E01407000714C013C0 +A2EC0FC3000F14871380A2141F158F0007EB3F0E147F01C0131C3903E1E7BC3901FF83F8 +39007E01E0201F7A9D26>I<3903C001C0390FF003E0391E7807F0EA1C7C123800781303 +0070130113FCD8F0F813E012E000E1130038C1F001000114C0120313E014030007148013 +C0A2EC0700120F1380140EA25C12076D5A00035B6D5AC6B45A013FC7FC1C1F7A9D21>I< +D803C01407D80FF09038700F80D81E789038F81FC0381C7C01003814F00078150F007015 +07EBFC03D8F0F801E0138012E000E1150326C1F007130700011600000314C013E0020F5B +0007150E01C01380A2161E000F011F131C01801300163C1638167800074913709039C07F +80F00003EC81E03A01E0E7C3C03A00FFC1FF8090263F007EC7FC2A1F7A9D2F>I<90383E +01F09038FF87F83903C7DE1E380783DC903803F87EEA0E01001E13F0EA1C03003C143800 +38EBE000A2EA300700005BA3130F5CA3011F1318153814001238D87C3F137012FC15E0EB +7F0139F0FF03C03970E78780393FC3FE00381F00F81F1F7C9D21>I<EA03C0D80FF01338 +D81E78137CD81C7C13FC003814F812781270EBFC01D8F0F813F012E012E138C1F0030001 +14E0120313E01407000714C013C0A2140F000F14801380A2141F150000075B5C13C03803 +E1FE3801FFBE38007E3EEB007E147CA2003E5BA2387E01F0A2387C03E0387007C06C485A +D83C3EC7FCEA1FF8EA07E01E2C7A9D23>I E +%EndDVIPSBitmapFont +%DVIPSBitmapFont: Fb cmr6 6 10 +/Fb 10 58 df<13FF000313C0380781E0380F00F0001E137848133CA248131EA400F813 +1FAD0078131EA2007C133E003C133CA26C13786C13F0380781E03803FFC0C6130018227D +A01E>48 D<13E01201120712FF12F91201B3A7487EB512C0A212217AA01E>I<EA01FC38 +07FF80381C0FC0383003E0386001F0EB00F812F86C13FCA2147C1278003013FCC7FC14F8 +A2EB01F0EB03E014C0EB0780EB0F00131E13385B5B3801C00CEA0380380600185A5A383F +FFF85AB512F0A216217CA01E>I<13FF000313C0380F03E0381C00F014F8003E13FC147C +A2001E13FC120CC712F8A2EB01F0EB03E0EB0FC03801FF00A2380003E0EB00F01478147C +143E143F1230127812FCA2143E48137E0060137C003813F8381E03F0380FFFC000011300 +18227DA01E>I<14E01301A213031307A2130D131D13391331136113E113C1EA01811203 +EA07011206120C121C12181230127012E0B6FCA2380001E0A6EB03F0EB3FFFA218227DA1 +1E>I<00101330381E01F0381FFFE014C01480EBFE00EA1BF00018C7FCA513FE381BFF80 +381F03C0381C01E0381800F014F8C71278A2147CA21230127812F8A214784813F8006013 +F0387001E01238381E07803807FF00EA01F816227CA01E>I<EB0FC0EB7FF03801F03838 +03C0183807803C380F007C121E001C1338003C1300A2127C1278EB7FC038F9FFE038FB80 +F038FE0038143C48131EA248131FA41278A36C131EA2001C133C001E13386C1370380781 +E03801FFC038007F0018227DA01E>I<1230123C003FB5FCA24813FE14FC3860001C1438 +14704813E014C0EA0001EB0380EB07001306130E5BA25BA21378A35BA41201A76C5A1823 +7CA11E>I<137F3803FFC0380781E0380E00704813380018131C1238A3123C003F133838 +1FC078EBE0F0380FF9E03807FF80120114C0000713F0380F0FF8381C03FC383801FE3870 +007E141F48130F1407A314060070130E0078130C6C1338001F13F03807FFC0C613001822 +7DA01E>I<13FE3803FFC0380781E0380E0070481378003C133848133CA200F8131EA314 +1FA40078133FA26C137F121C380F01DF3807FF9F3803FE1EC7FCA2143E143C001C133800 +3E13781470003C13E0381801C0381C0780380FFE00EA03F818227DA01E>I +E +%EndDVIPSBitmapFont +%DVIPSBitmapFont: Fc cmitt10 9 7 +/Fc 7 121 df<EC0FF0EC7FFE49B512804914C0010F14E090391FF81FF090393FC007F8 +90387F8001D97E0013FC01FE1300485A49147C485AA25BA26C4814FCC9FCED01F8A2ED03 +F01507ED1FE0ED3FC0EDFF8002031300EC0FFCEC7FF8903801FFE0010713804948C7FCEB +3FF8EB7FC049C71278D801FC14F8485A48481301485A4848EB03F06D1307D83FFE14E03A +7FFFC00FC0ECF83F91B51280D8FE3F1400D8FC0313FC48C65B0078EB1FE026307CAE27> +50 D<EB01FCEB0FFF4913C0017F13E090B5FC4813073803F80FEA07F0EA0FE0EA1FC090 +3880078048C8FCA2127EA2127CA312FCA3127CA2127E15E0007FEB01F0383F801F90B5FC +6C14E06C14C000031400C613F01C20769F27>99 D<ED1FC0ED7FF0EDFFF84A13FC5C15F1 +15E1140716F8EDC0F01600A2140FA20107B5128016C05BA26D1480D9001FC7FCA45CA214 +3EA3147EA2147CA414FCA25CA31301A25CA41303A25CA21307A25CA2EA3C0F127E38FE1F +80A249C8FCB5FC5B6C5AEA1FF06C5A263F7DAD27>102 D<147814FC1301A31300147014 +00A813FCEA03FF4813804813C05AEA3F8F1307EA7E0FA200FC1380131F12F838303F0012 +00133E137EA2137C13FC140C3801F81F143F13F00003137EA2EBE0FC13F1EBFFF814F06C +13E06C13C0EB3F00182F75AE27>105 D<EA7FFC487EA3127FEA007CA213FCA25BA21201 +A25BA21203A25BA21207A25BA2120FA25BA2121FA290C7FCA25AA2383E0180EB03E0EA7E +07A2007C13C0130FA2387E1F80EA7FFF6C13005BEA0FFCEA03F0132E71AD27>108 +D<EB03F8EB0FFEEB3FFF49138048B512C03803FE1F3907F807E013F0380FE003D81FC013 +F01380EA3F00A2127E15E0127CA2140712FCEC0FC0A2EC1F80143F007CEB7F00007E13FE +1301383F87FCEBFFF86C13E06C5B6C90C7FCEA01FC1C20779F27>111 +D<90387F01F83901FF87FE4890B5FC000F15804815C0D83FC3130FEB01FC007E141FEB00 +F8EAFC01A200F801F013800030EC0F00D8000390C7FCA25CA21307A2003CEBC003007EEC +07C0D8FE0F130FA2ED1F80011F133F00FCEC7F0090387FE0FFB65A6C5C01FD13F0D81FF0 +5B260FC03FC7FC22207A9F27>120 D E +%EndDVIPSBitmapFont +%DVIPSBitmapFont: Fd cmbxti10 6 1 +/Fd 1 66 df<15F0A21401A214031407A24A7EA2141F143F143B1473A214E31301ECC3FC +EB03831481EB0701130F130E131CEB1FFF5B5B90387001FEEBE000A2485A485A12073AFF +F81FFFF0A216E024237CA22B>65 D E +%EndDVIPSBitmapFont +%DVIPSBitmapFont: Fe cmbxti10 9 33 +/Fe 33 122 df<EEFFF0030F13FE033FEBFF8092397F801FC09239FE0007E04A48130F4A +48131F0207143F5D140F18C0A24A48EB0F0094C7FCA3143F5DA3017FB7FC90B8FCA26D5D +9039007F8001A2160302FF5C1500A216075F5B5C160F5FA30103141F4A5CA218F0EE3FE1 +0107EDC1E05CA2EFC3C0A2010F15874A158093381FCF0070B4FCEE07FC4948EB01F893C8 +FCA3001E5BEA7FBF5C12FFA291CAFC137E12FE485AEA7FF8EA3FE0EA0F80344581B432> +12 D<EEFFC003079038F07F80031FEBFCFF92387F807E9226FE00FE1300020149B5FC15 +FC02035B60EC07F882EE00F3020FEC03FC5D1707A260141F170F5D013FB75AA25B7F903B +003FC0001FE0A2173FA2027F5D5D177FA260A202FF14FF92C7FC95C7FCA25E5B4A5C180F +04035B181E010315FC5C60A2EFF87C187849486D6C5AEE00FF715AEF1F804A91C8FC130F +A2001E5BEA7F8FA238FF9FC0A25C49CBFC12FEEAFC7EEA7FFCEA3FF0EA0FC0394582B435 +>I<D801E013F03907F803FC000F1307391FFC0FFEA3003F131FA2001F130FA23907B803 +DC390038001C0178133C0170133801F01378491370000114F03903C001E0A239078003C0 +390F000780001EEB0F0048131E00F8137C48137800C013601F1A72B32E>34 +D<387FFFF0B512F8A214F0A314E0150779931F>45 D<EA0780EA1FE0123F127F13F0EAFF +E0A3EA7FC01380EA1E000C0B788A1B>I<0107B712FE5BA27F903A000FFC0007021F1401 +4B1300187EA2023F153C5DA3147FEDE0071780040F137C02FFEC007803C014384C1300A2 +49143EED80FE15FFA2495CA21501ED007C4914784A15E018F0EEF801010F02F013E04A14 +03047013C0EE0007131F4AEC0F80A2EF1F00013F5D4A143E17FE1601017FEC07FC4A133F +007FB75AB8FCA26C5E37337CB239>69 D<0107B6FC5BA26D5C9026000FFCC7FC141F5DA3 +143F5DA3147F5DA314FF5DA35B5DA35B92C8FCA35B4A1438173C177C010F15785C17F817 +F0011F14015CEE03E01607013F15C04A130F161FEE7F80017FEB01FFECE007007FB71200 +A2B8FC6C5D2E337CB234>76 D<0003B812C05AA25AD9FC03EB807F01E09138001F80D81F +C0150F495A1300003E5CA2003C010F1500A2007C5C1278021F5C00F8161E485C0070160E +C7003F91C7FCA25DA2147FA25DA214FFA25DA25BA25DA25BA292C9FCA25BA25CA2130FA2 +5C007FB6FCB77EA26C92C8FC323273B13B>84 D<0107B539F83FFFFC4D13FEA219FC903C +000FFE0003FE0018F80207EC07E06F5C170F6E6D485A4DC7FC177E6E6D5AEEC1F86EEBE3 +F0EEE7E0EEEFC06FB45AA26F90C8FC5E5E151FA2150F82151F4B7EA25D92B57EEC01FBDA +03F17FEC07E1EC0FC1DA1F807F4A5A027E6D7E5CA249486D7E495A49486D7E495A495A49 +C76C7E48B4FCB5D8F803B512FC14FC14F8A23F337BB241>88 D<B60107B5FC6F5A150070 +13FE000101C09038003F80EF7E006E5C6C4B5A4C5A6E5C017F14074C5A6D6C495A4CC7FC +6E137E011F147C16FC6E485A010F495A4B5A6E485A6D495AA26D01BFC8FC15FE5D6D5B5D +5D7F5D5DA25BA292C9FCA25BA25CA21307A25CA2130FA2000FB512F85AA27E383370B241 +>I<010C1306011E130F017C133E49137C484813F84913F03903C001E039078003C0390F +000780000E1400001E5B001C130E003C131E0038131C0078133C3977C03BE0397FE03FF0 +01F013F800FF137FA4397FE03FF0A2393F801FC0391F000F80201A6EB32E>92 +D<14FE903807FF80011F13CE90393F83FF80EBFF0148487E485AA248481400120F5B001F +5B5DEA3FE0A21403007F5C13C0A2140700FF5C1380163C020F137CEDF078A2EA7F00021F +13F01380003FEB3FE102FF13E03A1FC1F7F3C0390FFFE3FF0003018113003900FE007E26 +2379A12C>97 D<EB3F80380FFFC0A25CA2C6FCA291C7FCA25AA25BA21203A25BA2120714 +7F9038FBFFC090B512F048EB83F89038FE01FC01FC13FEEBF800485A15FF5BA2003F5BA2 +13C0A2007F5B15FE1380A2140700FF14FC1300A2EC0FF8A215F06CEB1FE0A2EC3FC06CEB +7F80903880FF00381FC3FC6CB45A000313E0C690C7FC203579B328>I<EC3FC0903801FF +F0010F13FC90381FE07E90387F803E9038FF00FE3901FE01FFEA03FC0007EB03FEEA0FF8 +13F0001FEB01FCEC00F048481300A3127F5BA4485AA3127F150C150E151F003F147E6D13 +FC001FEB03F8390FF01FE06CB512800001EBFE0038003FF0202379A128>I<ED01FCED7F +FEA216FCA21507A216F8A2150FA216F0A2151FA216E0A2153F14FE903907FFBFC0011F13 +FFEB3F83EBFF0148486C1380485AA2485A000F15005B001F5BA2D83FE05BA21403127F01 +C05BA2140712FF01805B163C020F137C167815F0EA7F00021F13F01380003FEB3FE102FF +13E03A1FC1F7F3C0390FFFE3FF0003018113003900FE007E273579B32C>I<EC7F809038 +07FFE0011F13F8EB7FC19038FF00FC4848137C485A485A485A121F4913FC003F14F81403 +397FC007F0ECFFE090B51280B5EAFC0014800180C7FCA390C8FCA41518151C153E6C14FC +90388001F8393FC007F0391FE03FC06CB51200000313FC38007FE01F2378A128>I<ED07 +E0ED1FF8ED7FFCEDFC3E020113FE913803F9FFA2913807FBFEA2EC0FF3EDF1FCEDF0F016 +00141F5DA5143F013FB512F05BA39039007FC0005DA414FF92C7FCA55B5CA413035CA413 +075CA5495AA45C131F121E387F9FC0A238FFBF80A291C8FC133FEAFE7E485AEA7FF86C5A +EA0FC0284581B41E>I<EC1FE0EC7FF8903903FFFCE0903907F83FF890381FE01F90383F +C00FEB7F80A2EBFF004815F05B0003141FA2484814E0A2153F120F4914C0A2157FA24914 +80A215FFA21600A25C00075B6D485A3803FC1F6CB5FC38007FFB90380FE3FCEB00031407 +A25D121E387F800F5D12FF4A5A143F49485A48495AD903FEC7FC387FFFF8001F13E00003 +90C8FC25327CA128>I<EB0FE03803FFF0A25CA2EA001F133F5CA3137F5CA313FF91C8FC +A348EB0FF09038FE3FFC91B5FC9039FFF07F8048EBC03F028013C014005B485A5BA2157F +000F15805BA215FF001F15005B5C5D123FEBC003EDFC0F161F007F0107131E018013F816 +3E163C00FFECF07C0100147816F0EDF1E048903803FFC0486D138000789038007E002835 +7BB32C>I<1470EB01FC13031307A4EB03F8EB01E090C7FCAA137C48B4FC4813C0EA078F +380F0FE0121E123EEA3C1F127CEA783F14C012F8137F00001380A213FF14005A5BA21203 +5B141E0007133EEBF83C120FEBF07C147814F8EBE0F0EBE1E0EA07E33803FFC06C1300EA +007C17367BB41B>I<EB0FE03803FFF0A25CA2EA001F133F5CA3137F5CA313FF91C8FCA3 +48EC0F8049EB3FC0EDFFE0EC01F10003903803C3F09038FC0F0FEC0E1F141C0007903838 +3FE0EBF87014E09039F9C01FC03A0FFF800F0091C8FC5B7F4813F014FCEBEFFEEBE1FFD8 +3FE07FEBC07F16F01581007F15E01380A2ED83C012FF0100EB8780143FED8F0048EB1FFE +48EB07FC0078EB01F024357BB328>107 D<EB1FC03803FFE05A14C07EEA007FA21480A2 +13FFA21400A25AA25BA21203A25BA21207A25BA2120FA25BA2121FA25BA2123FA25BA212 +7FA25BEB8780EAFF8F1400130FA25B131E12FE5BEA7F7C6C5A6C5AEA07C013357AB316> +I<01F890393FC001FE3D03FE01FFF007FF802607FF07D9FC1F13E03D0F3F8FC1FE3E0FF0 +271E1FDF00EBF80702FCD9FFF07F003C4914E0494814C0007C491480007816005CD8F87F +49140F4C5C00001380A201FF0103141F6102005B183F4802075DA2494A137FF181E00003 +020F158306FF13C0494A140319070007021F1680F0FE0F494A1500191E193E494AEB7FF8 +725AD803C06DC7EA0FC043237BA147>I<01F8EB7F803A03FE01FFE02607FF0713F83A0F +3F8F83FC391E1FFE0102FC7F003C13F8EB3FF0007C13E0007813C0A2D8F87F13035E0000 +1380A201FF13075E1400150F485DA249131FEEE078000316F8033F13F04914C016C10007 +16E016834915C0EE8780EE8F0049EB1FFE6F5AD803C0EB03F02D237BA131>I<EC3FE090 +3801FFF8010F13FE90381FE07F90397F803F809039FF001FC0484814E0485A4848130F00 +0F15F049131F121FA2485AA2153F007F15E05BA2157F16C0485AA2EDFF80007F15005C5D +4A5A003F495A6D485A001F495A390FF07FC06CB5C7FC000113FC38003FE0242379A12C> +I<011FEB3F8090397FC0FFE0D9FFF313F83A01E3F7E1FC3A03C3FF80FE4B7E260783FE7F +EB87FC000F4914801307A2D81F0F14FFA200005BA2011F5B170014E0A2013F5B5E14C0A2 +017F495AA202805B4B5A13FF4B5A4B5A6E485A486D48C7FCECFFFC4913F0EC3F80000390 +C9FCA25BA21207A25BA2120FA2B57EA429317EA12C>I<3901F003F83907FC0FFE3A0FFF +3FFF803A1F3F7C0FC0001EEBF807003EEBF01F003C9038E03FE0EB7FC0007CEC7FC00078 +1380A2D8F8FFEB3F80ED1E00C690C8FCA25AA25BA21203A25BA21207A25BA2120FA25BA3 +5BA2EA078023237BA125>114 D<EB01FE90380FFF804913E090387E03F0EBFC019038F8 +03F83801F007A20003EB0FF0A39038F807C001FFC7FC14F014FC6C13FF15806C14C0133F +010F13E0EB007F000E131F383F800F007F130712FF15C0A2EC0F80130000FCEB1F00007C +133E007F13FC6CB45A000F13E0000190C7FC1D237AA124>I<1307EB1FC0133FA3137FA2 +1480A213FFA21400A25AA2B512FC14FEA214FC3803FC00A21207A25BA2120FA25BA2121F +A25BA2123FA25B141E007F133E143CEB807C147814F8EB81F0EB01E0EB07C0383F8F8038 +1FFF00EA0FFCEA03F0173179AF1D>I<137E48B46C13F0489038C003F83807CFE0D80F0F +1307001F13F0121E003C140F011F5C007813E0A2D8F83F131F02C05BEA007F1480153F01 +FF5C1400A2157F485D5BEE83C0EDFF87EE07805BA2EE0F005C6D48485A0207131E6C6C48 +6C5A90397FFF3FFC90391FFC1FF0903907F007E02A237BA12E>I<017EED078048B46C90 +38F00FE048903AC003F81FF02607CFE0143FD80F0F1307001F13F0121E003C020F131F01 +1FECF00F007801E014071703D8F83F131F02C09038E001E0EA007F1480033F130301FF02 +C013C01400A2037F130748038013805BA2EF0F00A24C5A49151E6D153E9238FF803C4A5C +D800FF15F8D97F87EBC1F0903A3FFF8FFFE0010F01071380902703FC00FEC7FC34237BA1 +39>119 D<90391FC00FC090397FF83FF03A01FFFC7FF83A03E0FEF87C3907C07FF0D80F +00EBE1FE4814C3123E003CECC7FC007C1487127800F89038FF83F8ED81E0C790C7FCA25B +5CA313035CA2001E153CD87F87147C167800FF5B16F8018FEB01F0010F14E0D8FE1F1303 +00FCEC07C090397DFC1F803A7FF8FFFE00393FF03FF83907C00FE027237BA12A>I<137E +48B46C1378489038C001FC3807CFE0D80F0F1303001F13F0121E003C1407011F14F80078 +13E0A2D8F83F130F02C013F0EA007F1480151F01FF14E01400A2153F4815C05BA2157F16 +805BA215FF16006D5A00005B6D5A6DB45A131FEB07F9EB00035DEA0780390FE007F8121F +003F495AA24A5A49485A4A5AD900FEC7FC381F83FC380FFFF06C13C0C648C8FC26327BA1 +2A>I E +%EndDVIPSBitmapFont +%DVIPSBitmapFont: Ff cmbx6 6 2 +/Ff 2 50 df<EB7FC03801FFF0000713FC380FE0FE381F803F393F001F80A2007EEB0FC0 +A400FE14E0AD007E14C0A2007F131F6C1480A2391F803F00380FE0FE6CB45A6C5B38007F +C01B227DA023>48 D<130E133EEA01FE12FFA212FE1200B3A6387FFFFEA317217BA023> +I E +%EndDVIPSBitmapFont +%DVIPSBitmapFont: Fg cmcsc10 8 27 +/Fg 27 124 df<EB3FC0EBFFF03803E07C48487E48487E497E001EEB0780A2003E14C0A2 +48EB03E0A500FC14F0B0007C14E0A3007E1307003E14C0A2001E1480001F130F6C14006D +5A3807C03E3803F0FC3800FFF0EB3FC01C2D7CAB25>48 D<130C131C137CEA01FC12FFEA +FE7C1200B3B113FE387FFFFEA2172C79AB25>I<EB7F803801FFF0380781FC380E007F00 +18EB1F805A0070EB0FC00060EB07E0127800FC14F07E1403A3007C1307C7FC15E0A2140F +15C0EC1F8015005C147E14785C495A495A495A49C7FC131C5B5B4913305B485A48C71260 +12064814E0001FB5FC5A4814C0B6FCA21C2C7CAB25>I<EB3FC03801FFF03807C0FC380E +003E487F1580123FEC0FC0138013007E000E131FC71380A3EC3F00143E5C5CEB03E0EBFF +8080EB00F8143C141FEC0F8015C0A2EC07E0A215F01238127C12FEA34814E00078130F00 +6014C06C14800038EB1F00001E133E380780FC3801FFF038007FC01C2D7CAB25>I<140E +A2141E143EA2147E14FEA2EB01BE1303143E1306130E130C131813381330136013E013C0 +EA0180120313001206120E120C5A123812305A12E0B612FCA2C7EA3E00A9147F90381FFF +FCA21E2D7DAC25>I<000CEB0180380F800F90B512005C5C14F014C0D80C7CC7FC90C8FC +A8EB1FC0EB7FF8380DE07C380F801E497E000EEB0780000C14C0C7FCEC03E0A315F0A312 +38127C12FCA215E05A0060130715C0007014800030130F6CEB1F00000E133E380780F838 +01FFE038007F801C2D7CAB25>I<1230123C003FB512F8A215F05A15E00070C712C00060 +EB0180A248EB030014065CC7FC5C5C5CA25C13015C130391C7FC5BA2130EA2131EA2133E +133CA2137CA513FCA813781D2E7BAC25>55 D<EB3FC0EBFFF03801E07C3807801E48487E +000EEB07805AEC03C0123CA3123EA2003FEB0780EA1FC09038E00F00380FF81E6C6C5AEB +FF7000015B7EEB3FF8EBFFFC3803C7FE390783FF80EA0E00001EEB3FC048EB1FE0481307 +EC03F0481301A21400A415E00078130115C06C13036CEB07806CEB0F003807E03C3801FF +F838003FC01C2D7CAB25>I<EB3FC0EBFFF03803E0783807801C48487E48130F001EEB07 +80123E4814C0A2140300FC14E0A415F0A4007C1307A37E001E130F001F131B7E3807C073 +3803FFE3C6EB83E0EB0003A3EC07C0A21580001E130F003F1400A2141E5C003E5B00185B +380E03E03807FF80D801FEC7FC1C2D7CAB25>I<EC0380A34A7EA24A7EA34A7E141BA2EC +31F8A2EC71FC1460A2ECE0FEECC07EA249487EA349486C7EA249800106130FA249801507 +A2011FB57EA29038180003496D7EA201708001601300A24980167EA2484880A2486C1580 +D80FE0EC7FC0D8FFFC903807FFFEA22F2F7DAE36>65 D<B512F0A23803FC006C5AB3B3A3 +487EB512F0A2142D7DAC1B>73 D<B612F815FF3A03F8001FC00001EC07E0ED01F8150016 +FC167EA2167FA6167EA216FC16F81501ED07E0ED1FC090B6120015F801F8C8FCB2487EB5 +12F0A2282D7DAC31>80 D<14E0A2497EA3497EA3EB067CA2EB0E7EEB0C3EA2497EA3496C +7EA201707FEB6007A2496C7E90B5FC4880EB8001A2D803007F1400A20006147CA2000F14 +7E123F3AFFC003FFE0A223237EA229>97 D<903803F80290381FFE0690387E038E3901F8 +00DED803E0137E4848133E485A48C7121EA2003E140EA2127E007C1406A212FC1500A700 +7C1406A2127E123E150C7EA26C6C13186C6C13306C6C1360D801F813C039007E03809038 +1FFF00EB03F81F247DA227>99 D<B512FCECFF80390FC00FE00007EB01F06E7E157C81A2 +81A2ED0F80A316C0A91680A2151F1600151E153E5D5D4A5A000FEB07E0B6128002FCC7FC +22227EA129>I<B612F8A2380FC0010007EB007815381518151CA2150C140CA31500141C +143CEBFFFCA2EBC03C141C140CA21503A214001506A3150EA2151E153E000F14FCB6FCA2 +20227EA125>I<B612F8A2380FC0010007EB007815381518151CA2150CA2140CA21500A2 +141C143CEBFFFCA2EBC03C141C140CA491C7FCA7487EB5FCA21E227EA124>I<EAFFFEA2 +EA0FE0EA07C0B3AAEA0FE0EAFFFEA20F227EA114>105 D<D8FFC0ECFFC06D5B000FEDFC +0000075DD806F0EB0378A301781306A26D130CA36D1318A26D1330A39038078060A39038 +03C0C0A2903801E180A3903800F300A2147EA3000F133CD81F8014FCD8FFF090380FFFC0 +14182A227DA132>109 D<3AFFC001FFE013E03A07F0003F00151ED806F8130C7F137C7F +7FA2EB0F80EB07C014E01303EB01F014F81300147C143EA2141FEC0F8C15CC1407EC03EC +15FC14011400157CA2000F143C486C131CEAFFF0150C23227EA129>I<EB07F8EB3FFF90 +38FC0FC03901F003E048486C7E48486C7E4848137C48C77EA2003E80A2007E1580007C14 +0FA200FC15C0A8007C1580007E141FA3003E15006C143EA26C6C5B6C6C5B6C6C485A6C6C +485A3900FC0FC0D93FFFC7FCEB07F822247DA22A>I<B512FCECFF80390FC00FC00007EB +03E0EC01F0EC00F8A215FCA515F8A2EC01F0EC03E0EC0FC090B51280ECFC0001C0C7FCAC +487EEAFFFEA21E227EA125>I<B512F814FF390FC00FC00007EB03E06E7E81140081A45D +14015D4A5AEC0FC090B5C7FC14FCEBC01F6E7E6E7E140381A481A3163015F8380FE0013A +FFFE00FC60ED7FC0C8EA1F8024237EA128>114 D<3801F8083807FF18381E07B8383C01 +F8383800785A143812F01418A36C13007E127EEA7FE0EA3FFE381FFF806C13C0000313E0 +38007FF0EB07F81301EB007CA2143C12C0A46C133814786C137000FC13E038EF01C038C7 +FF803880FE0016247DA21E>I<007FB6FCA2397C03E01F00701407006080A200E01580A2 +00C01401A4000091C7FCB3497E48B512C0A221227EA127>I<3AFFFE01FFE0A23A0FE000 +3F006C48131E150CB3A400035C7F12015D6C6C5B01785B90383E0380D90FFFC7FCEB01F8 +23237EA129>I<B712C0A222027F9225>123 D E +%EndDVIPSBitmapFont +%DVIPSBitmapFont: Fh cmsy7 7 1 +/Fh 1 14 df<913801FFC0021F13FC91B67E499038007FC0D907F0EB07F0D91F80EB00FC +49C8127E017C151F01F0ED078048486F7E48486F7E48486F7E90CA1270481778001E8300 +1C171C003C171E0038170E0078170F007083A200F01880481703A96C170700701800A200 +785F0038170E003C171E001C171C001E173C6C5F6C17706D16F06C6C4B5A6C6C4B5A6C6C +4B5A017C031FC7FC013F157E6D6C5CD907F0EB07F0D901FFEB7FC06D90B55A021F01FCC8 +FC020113C039357CA842>13 D E +%EndDVIPSBitmapFont +%DVIPSBitmapFont: Fi cmr8 8 75 +/Fi 75 125 df<9138FF807E01079038E1FF80903A1F807FC3C0D93E00EB87E049EBFF07 +4913FE485A00039138FC018049017CC7FCAAB712FCA22703E0007CC7FCB3A6486C13FE3A +7FFF0FFFF0A22B2F7FAE29>11 D<003C13F0387E01F838FF03FCA2EB83FEA2EA7F81383D +80F600011306A30003130EEB000CA248131C00061318000E13384813704813E0387001C0 +0060138017157EAD23>34 D<123C127EB4FCA21380A2127F123D1201A312031300A25A12 +06120E5A5A5A126009157AAD14>39 D<13031307130E131C1338137013F0EA01E013C012 +03EA0780A2EA0F00A2121EA35AA45AA512F8A25AAB7EA21278A57EA47EA37EA2EA0780A2 +EA03C0120113E0EA00F013701338131C130E1307130310437AB11B>I<12C07E12707E7E +7E120FEA0780120313C0EA01E0A2EA00F0A21378A3133CA4131EA5131FA2130FAB131FA2 +131EA5133CA41378A313F0A2EA01E0A2EA03C013801207EA0F00120E5A5A5A5A5A10437C +B11B>I<123C127EB4FCA21380A2127F123D1201A312031300A25A1206120E5A5A5A1260 +09157A8714>44 D<B512C0A412047F9018>I<123C127E12FFA4127E123C08087A8714>I< +15C0140114031580A214071500A25C140EA2141E141CA2143C143814781470A214F05CA2 +13015CA213035C130791C7FCA25B130EA2131E131CA2133C1338A21378137013F05BA212 +015BA212035BA2120790C8FC5A120EA2121E121CA2123C1238A212781270A212F05AA21A +437CB123>I<EB3FC0EBFFF03803E07C48487E48487E497E001EEB0780A2003E14C0A248 +EB03E0A500FC14F0B0007C14E0A3007E1307003E14C0A36CEB0F806C14006D5A3807C03E +3803F0FC3800FFF0EB3FC01C2D7DAB23>I<130C133C137CEA03FC12FFEAFC7C1200B3B1 +13FE387FFFFEA2172C7AAB23>I<EB7F803801FFF0380780FC380E003F48EB1F8048EB0F +C05A0060EB07E012F000FC14F07E1403A3007C1307C7FCA215E0140F15C0141F1580EC3F +00147E147C5C495A495A495A495A011EC7FC5B5B4913305B485A4848136048C7FC000E14 +E0001FB5FC5A4814C0B6FCA21C2C7DAB23>I<EB3FC03801FFF03807C0FC380E007E487F +EC1F80003F14C0A2EB800F1300A2000C131FC7FC1580A2EC3F00143E5C5CEB03F0EBFFC0 +14F0EB00FC143FEC1F8015C0140F15E0A2EC07F0A21238127C12FEA3EC0FE012F8006014 +C00070131F6C1480001EEB3F00380780FC3801FFF038007FC01C2D7DAB23>I<140EA214 +1E143EA2147E14FEA2EB01BE1303143E1306130E130C131813381330136013E013C0EA01 +80120313001206120E120C5A123812305A12E0B612FCA2C7EA3E00A9147F90381FFFFCA2 +1E2D7EAC23>I<000CEB0180380FC01F90B512005C5C14F014C0D80C7EC7FC90C8FCA8EB +1FC0EB7FF8380DE07C380F801F01001380000E130F000CEB07C0C713E0A2140315F0A412 +7812FCA448EB07E012E0006014C00070130F6C14806CEB1F006C133E380780F83801FFE0 +38007F801C2D7DAB23>I<EB03F8EB0FFE90383E0780EBF8013901F007C03803E00FEA07 +C0EA0F80A2391F00078091C7FC123EA2127EA2127CEB0FC038FC3FF0EBF07C38FDC01EB4 +487E01001380EC07C04814E0A214034814F0A4127CA3127EA2003E14E01407121E001F14 +C06CEB0F803907801F003803C03E6C6C5A38007FF0EB1FC01C2D7DAB23>I<1230123C00 +3FB512F8A215F05A15E039700001C000601480140348EB0700140E140CC7121C5C143014 +705C495AA2495AA249C7FCA25B130E131EA2133EA3133C137CA413FCA913781D2E7CAC23 +>I<EB1FC0EBFFF03803E07C3807801E48487E001EEB0780A248EB03C0A4123E1407003F +1480381FC00F01E01300EBF81E6C6C5A3807FFF86C13E0C6FCEB3FF8EBFFFC3803C7FFD8 +07831380D81F0013C0001E133F48EB1FE0007C13070078EB03F012F84813011400A46C14 +E000781301007C14C0003C13036CEB0780390F800F003807E03C3801FFF038003FC01C2D +7DAB23>I<EB3F80EBFFF03803E0783807C03E48487E48487E003E14801407007E14C012 +7C00FC14E01403A315F0A5007C1307127EA2003E130F7E6C131F3807803B3803E0F33800 +FFC390383F03E013001407A215C0A2140F001E1480003F14005C143E143C003E5B001C5B +380E03E03807FF80D801FEC7FC1C2D7DAB23>I<123C127E12FFA4127E123C1200AD123C +127E12FFA4127E123C081D7A9C14>I<123C127E12FFA4127E123C1200AD123C127E12FE +12FFA3127F123F1203A312071206A2120E120C121C1218123812701260082A7A9C14>I< +B812FCA3CBFCADB812FCA32E137C9937>61 D<4A7E4A7EA34A7EA24A7EA3EC1BF81419A2 +EC30FCA2EC70FEEC607EA24A7EA349486C7EA2010380EC000FA201066D7EA3496D7EA201 +1FB57EA29038180001496D7EA349147EA201E0147F4980A20001ED1F801203000716C0D8 +0FF0EC3FE0D8FFFC0103B5FCA2302F7EAE35>65 D<B612FCEDFF803A03F8000FC00001EC +03F06F7E6F7E82167E167FA6167E16FE5E4B5A4B5AED0FE0ED7F8090B6C7FC16E09039F8 +0003F0ED01FC6F7E167F821780161F17C0A61780163F17005E16FEED03FC0003EC0FF0B7 +12C04BC7FC2A2D7DAC32>I<DA1FF013C09138FFFE01903903F00F8390390F8001E3013F +C71277017C143F4848141F4848140F48481407A248481403121F491401123F90C8FC4815 +00A300FE1600AB127F17C0A27E7F001F15016D1580120F6C6C1403EE07006C6C14066C6C +140ED8007C5C013F147890390F8001E0903903F00FC0902600FFFEC7FCEC1FF02A2F7CAD +33>I<B612F815FF3A03F8001FE00001EC03F0ED00F8167E82EE1F80160F17C0EE07E0A2 +EE03F0A217F81601A317FCAA17F8A3EE03F0A217E0160717C0160FEE1F80EE3F00167E5E +ED03F00003EC1FE0B7128003F8C7FC2E2D7DAC36>I<B712FEA23903F800010001EC003E +828282A282A3178016011518A293C7FCA31538157815F890B5FCA2EBF800157815381518 +A21760A392C712C0A4160117801603A21607160F163F0003913801FF00B8FCA22B2D7EAC +30>I<B712FCA23903F800030001EC007C163E161E160EA21606A3160716031518A21600 +A31538157815F890B5FCA2EBF800157815381518A592C7FCAB487EB512F8A2282D7EAC2E +>I<DA1FF013C09138FFFE01903903F00F8390390F8001E3013FC71277017C143F484814 +1F4848140F48481407A248481403121F491401123F90C8FC481500A300FE1600A992381F +FFFEA2007F9138001FE0EE0FC0A27E7F121F7F120F6C7EA26C7E6C6C141FEA007C013F14 +3FD90F8013F3903903F007C10100B51200DA1FF813002F2F7CAD37>I<B539F03FFFFCA2 +D803FCC713006C48147EB290B612FEA201F8C7127EB3486C14FFB5D8F03F13FCA22E2D7D +AC35>I<B512F0A23803FC006C5AB3B3A3487EB512F0A2142D7EAC19>I<90387FFFF0A201 +001300147EB3AD123812FEA314FE5C1278387001F86C485A381E07E03807FF80D801FCC7 +FC1C2E7DAC24>I<B500F0EB7FFEA2D803FCC7EA1FF06C48EC0FC01700161E16385E5E4B +5A4B5A4BC7FC150E5D5D15F0EC01C04A5A4A7E4A7E141F4A7EEC73F8ECE1FCEBF9C09038 +FF80FE9038FE007F497F49806F7E6F7E1507826F7E6F7EA26F7E167F821780EE1FC017E0 +486CEC3FF0B5D8F001B5FCA2302D7DAC37>I<B512F8A2D803FCC8FC6C5AB3A7160CA416 +18A41638A2167816F81501ED07F00003141FB7FCA2262D7EAC2C>I<D8FFF8923807FFC0 +6D5D0003EFF00000015F01BE151BA2019F1533A3D98F801463A2D987C014C3A2D983E0EB +0183A3D981F0EB0303A2D980F81306A3027C130CA26E1318A36E1330A291380F8060A291 +3807C0C0A3913803E180A2913801F300A3EC00FEA2157C487ED80FF04B7EB5D93801B512 +C0A23A2D7DAC41>I<D8FFF8903803FFFC7F00019138003FC06DEC0F006D1406EBBF80A2 +EB9FC0EB8FE0138780EB83F8138180EB80FE147E147FEC3F80EC1FC0140F15E0EC07F014 +0315F8EC01FC140015FE157FED3F86151F16C6ED0FE6150716F6ED03FE1501A21500167E +163EA2486C141ED80FF0140EB5FC16062E2D7DAC35>I<EC3FF0903801FFFE903907E01F +8090391F8007E090393E0001F001FCEB00FC4848147E4848804848EC1F8049140F000F16 +C04848EC07E0A248C8EA03F0A24816F8A2007E1501A200FE16FCAA007FED03F8A36C16F0 +6D1407001F16E0A26C6CEC0FC06D141F000716806C6CEC3F006C6C147E6C6C5C017E495A +90391F8007E0903907E01F80902601FFFEC7FC9038003FF02E2F7CAD37>I<B612FCEDFF +803A03F8000FE00001EC03F0ED00F882167E167F821780A617005E167E5E5EED03F0ED0F +E090B6128003FCC7FC01F8C9FCB2487EB512F0A2292D7EAC30>I<EC3FF0903801FFFE90 +3907E01F8090391F8007E090393E0001F001FCEB00FC4848147E4848804848EC1F804914 +0F000F16C04848EC07E0A2003F16F090C812034816F8A3007E150100FE16FCAA007E16F8 +007F1503A26C16F0A26C6CEC07E0A23B0FC007800FC0EC1FE03B07E038701F803B03F070 +183F003A01F8601C7ED800FCEB0CFC017EEB0FF8D91FF013E0903907F81F800101B5EA00 +0C9038003FF79138000780171CED03C0EEE03CEEF078EEFFF88117F0A26F13E0EE7FC0EE +1F002E3B7CAD37>I<B612C015FC3903F8007F0001EC0FC06F7E6F7E6F7E82150082A55E +15015E4B5A4B5A4B5A037FC7FC90B512FC15F09038F800FC153E6F7E150F826F7EA582A5 +170316F815031707486C903801FC0EB539F000FE1CEE3FF8C9EA07E0302E7DAC34>I<90 +383F80303901FFF0703807C07C390F000EF0001E13074813034813011400127000F01470 +A315307EA26C1400127E127FEA3FE013FE381FFFE06C13FC6C13FF00011480D8003F13E0 +13039038003FF0EC07F81401140015FC157C12C0153CA37EA215787E6C14706C14F06CEB +01E039F78003C039E3F00F0038E07FFE38C00FF01E2F7CAD27>I<007FB712F8A2903900 +0FC003007C150000701638A200601618A200E0161CA248160CA5C71500B3A94A7E011FB5 +12E0A22E2D7EAC33>I<B539F003FFFCA2D803FCC7EA3FC06C48EC0F001606B3AB160E00 +00150C7F161C017C1418017E14386D5C6D146090390F8001E0903907E00380902601F80F +C7FC9038007FFCEC0FF02E2E7DAC35>I<B500C090380FFFC0A2D807FCC73803FE006C48 +EC00F800015E5F6C7E5F6D1401017E5DA26D4AC7FCA26E5B011F140680010F5CA26D6C5B +A26E133801031430A26D6C5BA26E13E001005C8091387E0180A26E48C8FCA21583EC1F86 +A2EC0FCCA215FC6E5AA26E5AA36E5AA26E5A322E7FAC35>I<B53C801FFFF001FFF8A227 +07FC000190C7EA3FC0D803F06D48EC1F00047E140EA26C6C027F140CA26D171C0000DBDF +801318A26D1738017E9026018FC01330A2017F17706D90260307E01360A2028016E0011F +90260603F05BA202C01501010F90260C01F85BA202E01503010790261800FC90C7FCA202 +F05D010349EB7E06A202F8150E010149EB3F0CA202FC151C010049EB1F98A202FE15B8DA +7F80EB0FF0A2023F5D92C71207A26E5D021E1403A2020E5D020C1401452E7FAC48>I<3B +7FFFE003FFF8A2000390C713806C48EC7E000000157C017F14786D14706E5B6D6C5B6D6C +485A15036D6C48C7FC903803F80601015BECFC1C6D6C5AEC7F305DEC3FE06E5A140F816E +7E81140DEC1DFCEC38FEEC307F14609138E03F8049486C7EEC800FD903007F496D7E010E +6D7E130C011C6D7E496D7E49147E167F01F0EC3F80000316C0D80FF8EC7FE0D8FFFE0103 +B5FCA2302D7EAC35>I<B500C090380FFFC0A2D807FEC73801FE006C48EC00F8000116E0 +6C6C5D1601017F4A5A6D6C91C7FC5E6D6C130E6D6C130C5E6D6C13386D6C13305E6D6C13 +E06D6C5B4B5AEC7F03DA3F83C8FC1586EC1FCEEC0FEC15F814076E5AB04A7E49B512C0A2 +322D7FAC35>I<0003130C48131C000E13384813704813E0003013C0EA700100601380A2 +EAE00300C01300A300DE137800FF13FCEB83FEA2EA7F81A2383F00FC001E1378171577AD +23>92 D<13FF000713C0380F01F0381C00F8003F137C80A2143F001E7FC7FCA4EB07FF13 +7F3801FE1FEA07F0EA1FC0EA3F80EA7F00127E00FE14065AA3143F7E007E137F007FEBEF +8C391F83C7FC390FFF03F83901FC01E01F207D9E23>97 D<EA07C012FFA2120F1207AC14 +FE9038C7FF809038CF03E09038DC01F09038F8007C49137E49133E497F1680A2150F16C0 +A9ED1F80A216005D6D133E6D5B01B05B9038BC01F090380E07E0390607FF80260001FCC7 +FC222F7EAD27>I<EB1FE0EB7FFC3801F01E3803E0073907C01F80EA0F80EA1F005A003E +EB0F00007E90C7FCA2127C12FCA9127EA215C07E6C130101801380380FC0033907E00700 +3801F03E38007FF8EB1FC01A207E9E1F>I<15F8141FA214011400ACEB0FE0EB7FF83801 +F81E3803E0073807C003380F8001EA1F00481300123E127EA25AA9127C127EA2003E1301 +7EEB8003000F13073903E00EFC3A01F03CFFC038007FF090391FC0F800222F7EAD27>I< +EB1F80EBFFF03803E0783807C03E380F801E381F001FEC0F80123E007E130715C0127C12 +FCA3B6FCA200FCC8FCA5127EA2003E14C0123F6C1301390F80038001C013003803E00F38 +01F03C38007FF8EB1FC01A207E9E1F>I<EB03F0EB0FFCEB3E1EEB7C3F13F8EA01F0A238 +03E00C1400AAB512E0A23803E000B3A6487E387FFF80A2182F7FAE16>I<013F13F89038 +FFC3FE3903E1FF1E3807807C000F140C391F003E00A2003E7FA76C133EA26C6C5A000713 +78380FE1F0380CFFC0D81C3FC7FC90C8FCA3121E121F380FFFF814FF6C14C04814F0391E +0007F848130048147C12F848143CA46C147C007C14F86CEB01F06CEB03E03907E01F8039 +01FFFE0038003FF01F2D7E9D23>I<EA07C012FFA2120F1207AC14FE9038C3FF809038C7 +03E09038DE01F013F8496C7EA25BA25BB2486C487E3AFFFE1FFFC0A2222E7EAD27>I<EA +0780EA0FC0EA1FE0A4EA0FC0EA0780C7FCA8EA07C012FFA2120F1207B3A5EA0FE0EAFFFC +A20E2E7EAD14>I<EA07C012FFA2120F1207ADEC1FFEA2EC0FF0EC07C05D020EC7FC5C5C +5C5CEBC3C013C7EBCFE0EBDFF013F9EBF0F8497EEBC07E143E80816E7E14076E7E816E7E +486C487E3AFFFE07FF80A2212E7EAD25>107 D<EA07C012FFA2120F1207B3B3A3EA0FE0 +EAFFFEA20F2E7EAD14>I<2607C07FEB07F03BFFC3FFC03FFC903AC783F0783F3C0FCE01 +F8E01F803B07DC00F9C00F01F8D9FF8013C04990387F000749137EA249137CB2486C01FE +EB0FE03CFFFE0FFFE0FFFEA2371E7E9D3C>I<3807C0FE39FFC3FF809038C703E0390FDE +01F0EA07F8496C7EA25BA25BB2486C487E3AFFFE1FFFC0A2221E7E9D27>I<EB1FE0EB7F +F83801F03E3803C00F3907800780390F0003C04814E0003EEB01F0A248EB00F8A300FC14 +FCA9007C14F8A26CEB01F0A26CEB03E0A2390F8007C03907C00F803901F03E0038007FF8 +EB1FE01E207E9E23>I<3807C0FE39FFC7FF809038CF03E0390FDC01F03907F800FC4913 +7E49133E49133FED1F80A3ED0FC0A8151F1680A2ED3F00A26D137E6D137C5D9038FC01F0 +9038CE07E09038C7FF80D9C1FCC7FC01C0C8FCA9487EEAFFFEA2222B7E9D27>I<90380F +E01890387FF8383801F81C3903E00E783807C007390F8003F8001F1301EA3F00A2007E13 +00A212FE5AA8127EA36C13017EEB8003380FC0073803E00E3801F03C38007FF0EB1FC090 +C7FCA94A7E91381FFFC0A2222B7E9D25>I<380781F838FF87FEEB8E3FEA0F9CEA07B813 +B0EBF01EEBE000A45BB0487EB5FCA2181E7E9D1C>I<3801FE183807FFB8381E01F8EA3C +00481378481338A21418A27E7EB41300EA7FF06CB4FC6C13C06C13F0000113F838001FFC +130138C0007E143EA26C131EA27EA26C133CA26C137838FF01F038E3FFC000C013001720 +7E9E1C>I<1360A413E0A312011203A21207121FB512F0A23803E000AF1418A714383801 +F03014703800F860EB3FE0EB0F80152A7FA81B>I<D807C013F800FF131FA2000F130100 +071300B21401A314033803E007EC0EFC3A01F81CFFC038007FF890391FE0F800221F7E9D +27>I<3AFFFC01FFC0A23A0FE0007E000007147C15380003143015706C6C1360A26C6C5B +A390387C0180A26D48C7FCA2EB3F07EB1F06A2EB0F8CA214DCEB07D8A2EB03F0A36D5AA2 +6D5A221E7F9C25>I<3BFFFC3FFE07FFA23B0FE003F001F801C09038E000F00007010114 +E0812603E00314C0A2913807F8012701F006781380A29039F80E7C030000D90C3C1300A2 +90397C181E06A2151F6D486C5AA2168C90391F600798A216D890390FC003F0A36D486C5A +A36DC75A301E7F9C33>I<3AFFFC07FF80A23A0FF003FC000003EB01F0000114C06D485A +000091C7FCEB7C06EB3E0E6D5A14B8EB0FB0EB07E013036D7E497E1307EB067C497EEB1C +1F01387FEB700F496C7E6E7ED803C07F00076D7E391FE003FC3AFFF007FFC0A2221D7F9C +25>I<3AFFFC01FFC0A23A0FE0007E000007147C1538000314306D137000011460A26C6C +5BA2EBFC01017C5BEB7E03013E90C7FCA2EB1F06A2148EEB0F8CA2EB07D8A2EB03F0A36D +5AA26D5AA2495AA2130391C8FC1278EAFC06A25B131CEA7838EA7070EA3FE0EA0F80222B +7F9C25>I<003FB51280A2EB003F003C14000038137E00305BEA700100605B495A495A13 +0F00005B495A49C7FC5B137E9038FC0180EA01F8120313F03807E003EA0FC0001F140013 +8048485A007E5B00FE133FB6FCA2191D7E9C1F>I<B712C0A22202809223>I<BB12FCA246 +02809247>I E +%EndDVIPSBitmapFont +%DVIPSBitmapFont: Fj cmsy6 6 2 +/Fj 2 122 df<136013701360A20040132000E0137038F861F0387E67E0381FFF803807 +FE00EA00F0EA07FE381FFF80387E67E038F861F038E060700040132000001300A2137013 +6014157B9620>3 D<136013F0A81360A4387C63E0B512F0A2387C63E038006000A313F0 +B3A21360A7142F7CA31E>121 D E +%EndDVIPSBitmapFont +%DVIPSBitmapFont: Fk cmtt10 10 6 +/Fk 6 120 df<127812F87EA27E127E127F7E7F121F7F120F7F1207A27F12037F12017F +12007F137E137F7F80131FA280130F801307801303801301801300A280147E147F808114 +1F81140F811407811403A281140181140081157E157F811680151FA2150FED070021417B +B92C>92 D<EC0FFE4A7EA380EC003FAAEB07F8EB3FFE90B512BF4814FF5A3807FC0F380F +F00348487E497E48487F90C7FC007E80A212FE5AA87E007E5CA2007F5C6C7E5C6C6C5A38 +0FF0073807FC1F6CB612FC6CECBFFE6C143FEB3FFC90390FF01FFC27337DB22C>100 +D<EB07FCEB1FFF017F13C048B512F048803907FC07FC390FF001FE48486C7E0180133F00 +3F158090C7121F007EEC0FC0A348EC07E0A76C140F007E15C0A2007F141F6C15806D133F +6C6CEB7F006D5B6C6C485A3907FC07FC6CB55A6C5C6C6C13C0011F90C7FCEB07FC23247C +A32C>111 D<397FF01FE039FFF8FFF801FB13FE90B6FC6C158000019038F07FC0913880 +1FE091380007F049EB03F85BED01FC491300A216FE167EA816FE6D14FCA2ED01F86D1303 +6DEB07F0150F9138801FE09138E07FC091B51280160001FB5B01F813F8EC3FC091C8FCAD +387FFFE0B57EA36C5B27367FA32C>I<D87FFEEB3FC0B53801FFF0020713F8021F13FC6C +5B39003F7FE1ECFF019138FC00F84A13704A13005CA25C5CA391C8FCAF007FB512E0B67E +A36C5C26247EA32C>114 D<D87FFFEB7FFF6EB5FCB515806C16004A7ED807C0EB01F0A6 +6C6C495AA3143E147FA2D801F0495AECFF87A214F7A201F113C700005D9038F9E3CFA201 +FB13EFA3D97BC190C7FC017F13FFA21480A2013F5B90381F007C29247FA32C>119 +D E +%EndDVIPSBitmapFont +%DVIPSBitmapFont: Fl cmti10 10 41 +/Fl 41 123 df<EE3FFC4BB51280923907E007C092391F8001E0DB3F0013F0037E13034B +1307A24A5A18E04A48EB038094C7FCA314075DA4140F5DA3010FB7FCA25F903A001F8000 +7EA217FE023F5C92C7FCA216015F5C147E16035FA214FE4A13075FA30101140F5F4AECC1 +C0A2161F1783010316805CA2EF870013074A5CEE0F8EEE079EEE03FC010FEC00F04A91C7 +FCA35C131FA2001C90CAFC127E5BEAFE3E133C137CEAF878EA78F0EA3FE0EA0F80344C82 +BA2F>12 D<3901E003C03907F00FE0000F131F01F813F0001F133FA3000F131F3907B00F +6038003000A2017013E0016013C0EBE00101C01380000113030180130000035B3807000E +000E5B485B485B485B48485A00C05B1C1971B92B>34 D<150C151C153815F0EC01E0EC03 +C0EC0780EC0F00141E5C147C5C5C495A1303495A5C130F49C7FCA2133EA25BA25BA2485A +A212035B12075BA2120F5BA2121FA290C8FCA25AA2123EA2127EA2127CA412FC5AAD1278 +A57EA3121C121EA2120E7EA26C7E6C7EA212001E5274BD22>40 D<140C140E80EC0380A2 +EC01C015E0A2140015F0A21578A4157C153CAB157CA715FCA215F8A21401A215F0A21403 +A215E0A21407A215C0140F1580A2141F1500A2143EA25CA25CA2495AA2495A5C1307495A +91C7FC5B133E133C5B5B485A12035B48C8FC120E5A12785A12C01E527FBD22>I<EA03C0 +EA07F0120F121F13F8A313F0EA07B0EA003013701360A213E013C01201EA038013005A12 +0E5A5A5A5A5A0D197A8819>44 D<387FFFF8A2B5FCA214F0150579941E>I<120EEA3F80 +127F12FFA31300127E123C0909778819>I<15181538157815F0140114031407EC0FE014 +1F147FEB03FF90383FEFC0148FEB1C1F13001580A2143FA21500A25CA2147EA214FEA25C +A21301A25CA21303A25CA21307A25CA2130FA25CA2131FA25CA2133FA291C7FC497EB612 +80A31D3877B72A>49 D<EC03F8EC0FFE91383C0F809138F007C0903901E003E0D903C013 +F09038078001020013F8130E131E90391C6000FCEB3870EC30011370A213F013E0EC7003 +0001016013F813C014E0ECC00701C114F0903881800F018314E09039C7001FC001FEEB3F +80D80078140090C7127E5D4A5A4A5AEC07C0EC1F80023EC7FC14FCEB01F0EB07C0495A01 +1EC8FC137C4914C0484813015B485A4848130348C71380000E1407001E140F48EC1F00D8 +3FF85B397FFFC07E39783FFFFCEA700FD8F0075BD8E0015B6D13C0021FC7FC263A79B72A +>I<EC03FCEC1FFF91387E07C09138F003E0903903C001F0D9078013F849C7FC131E011C +14FC133CEB38C0EB78E0EB7060150101F014F813E0A2ECE003D971C013F090387F8007D9 +1E0013E090C7EA0FC0ED1F80ED3F00157E5D49B45A4913E092C7FC9038000FC0EC03F014 +016E7E81A381A5007E130100FE5CA31403485C00E05C14074A5A5D4A5A007049C7FC0078 +137E6C13F8381E07F03807FF80D801FCC8FC263A78B72A>I<0107B612FCEFFF8018C090 +3B000FF0001FF04BEB07F81703021F15FC17014B14FEA2023F1400A24B1301A2147F18FC +92C7120318F84A140718F04AEC0FE0EF1FC00101ED3F80EF7F004AEB01FEEE07F849B612 +E05F9139F80007F0EE01FC01076E7E177F4AEC3F80A2010F16C0171F5CA2131F173F5CA2 +133FEF7F805C1800017F5D4C5A91C7485A5F49140FEE1FE0494A5A00014AB45AB748C7FC +16F816C037397BB83A>66 D<0107B712FEA3903A000FF000074B1300187C021F153CA25D +A2143FA25D1838147FA292C8FCEE03804A130718004A91C7FCA201015CA24A131E163E01 +0314FE91B5FC5EA2903807F800167C4A1378A2130FA24A1370A2011F14F0A24A90C8FCA2 +133FA25CA2137FA291CAFCA25BA25B487EB6FCA337397BB836>70 +D<0103B500F890387FFFE0A21AC090260007F8C7380FFC004B15E061020F4BC7FC183E4B +5C18F0021F4A5A4D5A4BEB0F804DC8FC023F143C5F4B5B4C5A027FEB07C04CC9FCED001E +5E4A5BED01FCECFE0315070101497E151FECFC7C4B7E903903FDE07FDAFFC07F1580ED00 +3F49488014F84A131F83130F160F4A801607011F81A24A130383133F16014A80A2017F6E +7EA291C8FC494A7F007F01FE011F13FCB55CA243397CB840>75 D<902603FFF891B512E0 +A281D90007923807F8006F6E5A61020F5E81DA0E7F5DA2021E6D1307033F92C7FC141C82 +DA3C1F5C70130EEC380FA202786D131E0307141C147082DAF003143C70133814E0150101 +016E1378030014705C8201036E13F0604A1480163F010715C1041F5B91C7FC17E149EC0F +E360010E15F31607011E15FF95C8FC011C80A2013C805F1338160013785F01F8157CEA03 +FC267FFFE0143CB51538A243397CB83E>78 D<92383FC00E913901FFF01C020713FC9139 +1FC07E3C91393F001F7C027CEB0FF84A130749481303495A4948EB01F0A2495AA2011F15 +E091C7FCA34915C0A36E90C7FCA2806D7E14FCECFF806D13F015FE6D6D7E6D14E0010080 +023F7F14079138007FFC150F15031501A21500A2167C120EA3001E15FC5EA3003E4A5AA2 +4B5AA2007F4A5A4B5A6D49C7FC6D133ED8F9F013FC39F8FC03F839F07FFFE0D8E01F1380 +26C003FCC8FC2F3D7ABA2F>83 D<0007B812E0A25AD9F800EB001F01C049EB07C0485AD9 +00011403121E001C5C003C17801403123800785C00701607140700F01700485CA2140FC7 +92C7FC5DA2141FA25DA2143FA25DA2147FA292C9FCA25CA25CA21301A25CA21303A25CA2 +1307A25CA2130FA25CEB3FF0007FB512F8B6FCA2333971B83B>I<B5D8F80FB590381FFF +F06102F018E0D807FEC7D87FE0903803FE00D803F8DA3F806D5AF100F0A24F5A62190362 +1907047F92C7FC190E16FF4B5DA2DB03BF5C7F0001DA073F5CA2030E5D83DB1C1F495A18 +0303385D4EC8FC157003F0140E15E0DA01C05CA2DA03805CA2DA07005CA2020E5D17C14A +5DEFC3805C027802C7C9FC14704A14CE13FE6C6C4814DCA24A14F8A291C75B160F495D5F +5B5F5B4992CAFCA249140E4C3B6FB853>87 D<01181330013813709038F001E03901C003 +800180130000035B3807000E000E5B000C1318001C1338485B00301360A2007013E00060 +5BA238EF01DE38FF81FFA66CC65A003C13781C196AB92B>92 D<14F8EB07FE90381F871C +90383E03FE137CEBF801120148486C5A485A120FEBC001001F5CA2EA3F801403007F5C13 +00A21407485C5AA2140F5D48ECC1C0A2141F15831680143F1587007C017F1300ECFF076C +485B9038038F8E391F0F079E3907FE03FC3901F000F0222677A42A>97 +D<133FEA1FFFA3C67E137EA313FE5BA312015BA312035BA31207EBE0F8EBE7FE9038EF0F +80390FFC07C013F89038F003E013E0D81FC013F0A21380A2123F1300A214075A127EA214 +0F12FE4814E0A2141F15C05AEC3F80A215005C147E5C387801F8007C5B383C03E0383E07 +C0381E1F80D80FFEC7FCEA01F01C3B77B926>I<147F903803FFC090380FC1E090381F00 +70017E13784913383901F801F83803F003120713E0120FD81FC013F091C7FC485AA2127F +90C8FCA35A5AA45AA3153015381578007C14F0007EEB01E0003EEB03C0EC0F806CEB3E00 +380F81F83803FFE0C690C7FC1D2677A426>I<ED01F815FFA3150316F0A21507A216E0A2 +150FA216C0A2151FA21680A2153FA202F81300EB07FE90381F877F90383E03FF017C5BEB +F80112013803F00048485B120FEBC001121F5DEA3F801403127F01005BA214075A485CA2 +140FA248ECC1C0A2141F15C3ED8380143F1587007C017F1300ECFF076C485B9038038F8E +391F0F079E3907FE03FC3901F000F0253B77B92A>I<147F903803FFC090380FC1E09038 +3F00F0017E13785B485A485A485A120F4913F8001F14F0383F8001EC07E0EC1F80397F81 +FF00EBFFF891C7FC90C8FC5A5AA55AA21530007C14381578007E14F0003EEB01E0EC03C0 +6CEB0F806CEB3E00380781F83803FFE0C690C7FC1D2677A426>I<ED07C0ED1FF0ED3E38 +ED7C3CEDF8FC15F9140115F1020313F8EDF0F0160014075DA4140F5DA4141F5D010FB512 +C05B16809039003F800092C7FCA45C147EA414FE5CA413015CA413035CA413075CA4130F +5CA3131F5CA391C8FC5B121CEA7E3EA2EAFE3C137C1378EAF8F01278EA3FC0EA0F80264C +82BA19>I<EC07C0EC3FF09138FC38E0903901F01FF0EB03E0903807C00FEB0F80011F13 +07D93F0013E05B017E130F13FE4914C01201151F1203491480A2153F1207491400A25DA2 +49137EA215FEA25D00031301140314076C6C485A0000131FEB787BEB3FF390380FC3F0EB +00031407A25DA2140F5D121C007E131F5D00FE49C7FC147E5C387801F8387C07E0381FFF +80D803FEC8FC24367CA426>I<EB03F0EA01FFA3EA00075CA3130F5CA3131F5CA3133F91 +C8FCA35B90387E07F0EC1FFCEC783E9038FFE01F02C01380EC800F1400485A16C05B49EB +1F8012035BA2153F000715005BA25D000F147E5B15FE5D121FD98001131C15F8163C003F +01031338010013F0A216704814E0007E15F016E0EDE1C000FE903801E38048903800FF00 +0038143C263B7BB92A>I<EB01C0EB07E014F0130F14E01307EB038090C7FCAB13F0EA03 +FCEA071EEA0E1F121CA212385B1270A25BEAF07E12E013FEC65AA212015B1203A25B1207 +5BA2000F13E013C013C1001F13C01381A2EB83801303EB0700A2130E6C5AEA07F8EA01E0 +143879B619>I<EB03F0EA01FFA3EA00075CA3130F5CA3131F5CA3133F91C8FCA35B017E +EB0F80ED3FE015F09039FE01C1F09038FC0387EC0707140E0001011C13E0EBF838913830 +03800270C7FC00035BEBF1C0EBF38001FFC8FCEA07FC7FEBFFC0EBE7F8380FE1FCEBC07E +147F80001F809039801F81C0A21583003F013F138001001303A21507481500007E133EEC +1E0E151E00FE6D5A48EB07F80038EB01E0243B7BB926>107 D<EB0FC0EA07FFA3EA001F +1480A2133FA21400A25BA2137EA213FEA25BA21201A25BA21203A25BA21207A25BA2120F +A25BA2121FA25BA2123FA290C7FCA25AA2EA7E0EA212FE131EEAFC1CA2133C133812F813 +78EA7870EA7CE0121FEA0F80123B79B915>I<D801E001FEEB07F03C07F803FF801FFC3C +0E3C0F07C0783E3C1E3E3C03E1E01F261C1F78D9F3C013803C383FF001F7800F02E01400 +007801C013FE007018C002805B4A4848EB1F80EAF07FD8E07E5CA200000207143F01FE17 +00495CA2030F5C0001177E495C18FE031F5C120349DA8001131C18F8033F153C00070403 +133849020013F0A24B1570000F17E049017E15F019E003FEECE1C0001FEE01E349499038 +00FF000007C70038143C3E2679A444>I<D801E013FE3A07F803FF803A0E3C0F07C03A1E +3E3C03E0261C1F787F39383FF00114E0007813C000708114804A485AEAF07FEAE07EA200 +00140701FE5C5BA2150F00015D5B151F5E12034990383F8380160316070007027F130049 +137EA2160E000F147C49141E161C5E001FEC3C7849EB1FE00007C7EA0780292679A42F> +I<147F903803FFC090380FC1F090381F00F8017E137C5B4848137E4848133E0007143F5B +120F485AA2485A157F127F90C7FCA215FF5A4814FEA2140115FC5AEC03F8A2EC07F015E0 +140F007C14C0007EEB1F80003EEB3F00147E6C13F8380F83F03803FFC0C648C7FC202677 +A42A>I<9039078007C090391FE03FF090393CF0787C903938F8E03E9038787FC0017049 +7EECFF00D9F0FE148013E05CEA01E113C15CA2D80003143FA25CA20107147FA24A1400A2 +010F5C5E5C4B5A131F5EEC80035E013F495A6E485A5E6E48C7FC017F133EEC70FC90387E +3FF0EC0F8001FEC9FCA25BA21201A25BA21203A25B1207B512C0A3293580A42A>I<3903 +C003F0390FF01FFC391E783C0F381C7C703A3C3EE03F8038383FC0EB7F80007815000070 +1300151CD8F07E90C7FCEAE0FE5BA2120012015BA312035BA312075BA3120F5BA3121F5B +A3123F90C9FC120E212679A423>114 D<14FE903807FF8090380F83C090383E00E04913 +F00178137001F813F00001130313F0A215E00003EB01C06DC7FC7FEBFFC06C13F814FE6C +7F6D13807F010F13C01300143F141F140F123E127E00FE1480A348EB1F0012E06C133E00 +705B6C5B381E03E06CB45AD801FEC7FC1C267AA422>I<EB0380EB07C0130FA4131F1480 +A3133F1400A35B137E007FB5FCA2B6FC3800FC00A312015BA312035BA312075BA3120F5B +A3121FEB801CA2143C003F1338EB0078147014F014E0EB01C0EA3E03381F0780380F0F00 +EA07FCEA01F0183579B31C>I<13F8D803FEEB01C0D8078FEB03E0390E0F8007121E121C +0038140F131F007815C01270013F131F00F0130000E015805BD8007E133FA201FE14005B +5D120149137EA215FE120349EBFC0EA20201131E161C15F813E0163CD9F0031338140700 +01ECF07091381EF8F03A00F83C78E090393FF03FC090390FC00F00272679A42D>I<01F0 +130ED803FC133FD8071EEB7F80EA0E1F121C123C0038143F49131F0070140FA25BD8F07E +140000E08013FEC6485B150E12015B151E0003141C5BA2153C000714385B5DA35DA24A5A +140300035C6D48C7FC0001130E3800F83CEB7FF8EB0FC0212679A426>I<01F01507D803 +FC903903801F80D8071E903907C03FC0D80E1F130F121C123C0038021F131F49EC800F00 +701607A249133FD8F07E168000E0ED000313FEC64849130718000001147E5B03FE5B0003 +160E495BA2171E00070101141C01E05B173C1738A217781770020314F05F000301071301 +6D486C485A000190391E7C07802800FC3C3E0FC7FC90393FF81FFE90390FE003F0322679 +A437>I<13F0D803FCEB01C0D8071EEB03E0D80E1F1307121C123C0038140F4914C01270 +A249131FD8F07E148012E013FEC648133F160012015B5D0003147E5BA215FE00075C5BA2 +14015DA314035D14070003130FEBF01F3901F87FE038007FF7EB1FC7EB000F5DA2141F00 +3F5C48133F92C7FC147E147C007E13FC387001F8EB03E06C485A383C1F80D80FFEC8FCEA +03F0233679A428>121 D<903903C0038090380FF007D91FF81300496C5A017F130E9038 +FFFE1E9038F83FFC3901F007F849C65A495B1401C7485A4A5A4AC7FC141E5C5C5C495A49 +5A495A49C8FC131E5B49131C5B4848133C48481338491378000714F8390FF801F0391FFF +07E0383E1FFFD83C0F5B00785CD8700790C7FC38F003FC38E000F021267BA422>I +E +%EndDVIPSBitmapFont +%DVIPSBitmapFont: Fm cmbx10 27.44 1 +/Fm 1 79 df[<BA00E0962603FFFE92381FFFF07398B9FC8585A2858586868686C86C9A +C803C0C7FC74090301F0C8FC74755B86868787A28704FB8204F98204F882877181837182 +718271827182888371827281728172828972828472827282728273818973828573827382 +738273828A8574817481748274828B74828674827482758175818C758287758275827582 +75828C76818876827682768276828D8876827781778177828E7782897782778277827881 +8E7816808A7816C07816E07816F07816F823FC7816FE8B7915FF7916817916C17916E1A1 +12F18B7916F97916FD7A92B5FC8CA28C8C8C8C8C8CA28D8D8D8D8D8DA28D8D8E8E8EA28E +8E8E8E8E8FA28F8F8F8F8F4B6C8A023FEBFFF0BA00FC87A17EA17EA17EA17EA17EA2A17E +A17EA16C5B0280C70007795A>188 156 120 283 205 78 D E +%EndDVIPSBitmapFont +%DVIPSBitmapFont: Fn cmsy10 10 1 +/Fn 1 50 df<D90FF0ED07F0D93FFEED3FFE90B56C91B5FC00036E903903F807C02707F0 +7FF0903907C001E0270F801FF890390F8000F090260007FC013EC71270001E6D6C491438 +486D6C0178141C00386D6D5A48DA7FC1150E92383FE3E0006091261FF3C01406EEF78000 +E0DA0FFF1507486E90C812036F5AA26F7E6F7F707EA24C7E6C4A6D14070060DBEFF81406 +ED03CF0070912607C7FC140E92380F83FE6CDB01FF141CDB1E006D133C6C023E6D6C1378 +6C4A6D6C13F0000FD901F090381FF8016C6C484890390FFE0FE02703E01FC00103B512C0 +C6B5C76C1400D97FFC9138007FFCD90FE0ED0FF048267BA453>49 +D E +%EndDVIPSBitmapFont +%DVIPSBitmapFont: Fo cmbx9 9 46 +/Fo 46 122 df<EC07FF91B512E001078090391FFC01FC90383FE0009039FFC001FE48EB +80031400484A7E496D5AA36F5AED007093C7FCA4ED3FFFB8FCA43903FE0001B3A7277FFF +F03F13F8A42D347FB331>12 D<913807FF9F91B6FC130790381FFC0390383FE007EBFFC0 +48138014005A497FA281A8B8FCA43903FE0001B3A7277FFFF03F13F8A42D347FB331>I< +DA07FFEB07FF027FD9C07F13E00103B500F3B57E903C0FFE01FFFE01FC90261FF000EBF0 +0090267FE00349487E494848EBC00302801480484D7E02004A6C5AA2816F6E5AF0007096 +C7FCA4F03FFFBBFCA40001D90001EB0001B3A7003FD9F83FD9F83F13F8A445347FB34A> +I<12E07E127C7E7E7F6C7E12077F6C7E6C7EA26C7EA27F137E137FA2EB3F80A3EB1FC0A3 +14E0A3130FA314F0AF14E0A3131FA314C0A3EB3F80A3EB7F00A2137E13FE5BA2485AA248 +5A485A5B120F485A90C7FC123E5A12F05A144B7BB722>41 D<B512FCA816087F931D>45 +D<120FEA3FC0EA7FE0EAFFF0A6EA7FE0EA3FC0EA0F000C0C7A8B19>I<147814F8130313 +1FEA03FFB5FCA3EAFC1F1200B3B2007FB512FEA41F317AB02C>49 +D<EB1FFC90B57E000314E0000F14F8391FE03FFC393F800FFF48487E6D6C1380D8FFC014 +C06D7E16E080A36C5A6C5A6CC7FCC8FC16C05C16805C16004A5A4A5A5D4A5AEC3FC04A5A +02FEC7FC495A495A903907E001E0EB0FC0EB1F8090383E00034914C05B4848130748B6FC +5A5A5A5A5AB71280A423317CB02C>I<EB0FFC90387FFF8048B512F03903F01FF83907C0 +0FFE380F8007486C6C7E01F01480123F13F8A5D81FF014006C485AD803805BC7FC4A5A4A +5A4A5AECFFC0013F90C7FC14FCECFFC09038001FF0EC0FFC6E7E6E7E16806E13C0A2000F +15E0EA3FC0EA7FE0EAFFF0A416C0A2495AD87FC0148049481300003F5B391FF01FFE6CB5 +12F8000314E0C61480D91FFCC7FC23327CB02C>I<151F5D5DA25D5C5C5C5CA25C143D14 +7D14F9EB01F114E1EB03C1EB0781130FEB1F01133E133C137813F01201EA03E0EA07C013 +80EA0F00121E123E5A5AB712FEA4C700031300A80103B512FEA427317EB02C>I<000C14 +0ED80FE013FE90B5FC5D5D5D5D5D92C7FC14FC14F091C8FC1380A6EB87FE9038BFFFC090 +B512F09038FC0FF89038E003FE01C07F497E01001480000E6D13C0C8FCA216E0A3121FEA +7F807F487EA316C05B5CD87F801480D87C0014006C5B393F8007FE391FE01FFC0007B512 +F06C14C0C691C7FCEB1FF823327CB02C>I<EC7FC0903803FFF0010F13FC90383FE07E90 +387F801F4848485A4848EBFF8048485A13F8120FEA1FF0A2123F6E13004848133C92C7FC +A2142039FFE1FF8001E713E001EF13F89038FE03FC496C7E01F87F6E13805B16C0A24914 +E0A5127FA5123F16C0121F6D1480000F5B01F814006C6C485A6C6C485A6CB55A6C6C5B01 +1F13C0D907FEC7FC23327CB02C>I<120FEA3FC0EA7FE0EAFFF0A6EA7FE0EA3FC0EA0F00 +C7FCA9120FEA3FC0EA7FE0EAFFF0A6EA7FE0EA3FC0EA0F000C217AA019>58 +D<EB7FF80003B51280000F14E0391FC03FF0393E000FF8007FEB07FCD8FF8013FE13C0A5 +397F800FFCEA3F00C7EA1FF8EC3FF0EC7FC0ECFF80903801FE005C495A5C495A5CA2495A +A291C7FCA790C8FCA6EB1F80497E497E497EA66D5A6D5A6D5A1F347BB32A>63 +D<ED1F80A24B7EA24B7EA34B7EA24A7FA34A7FA24A7F15CFA2020F7F1587021F80150302 +3F80EC3E01A2027E80EC7C0002FC804A137FA20101814A133F0103814A131FA249B67EA2 +4981A290271F8000077F91C77EA24982013E80017E82017C80A201FC8249157FB500F001 +3FB512F0A43C347DB343>65 D<DBFFE01338021F01FE137891B6EA80F8010315E1010F90 +38E00FF7903A1FFE0001FFD97FF8EB007FD9FFE0143F4849141F4849140F4890C8120748 +5A1703485A1701123F5B007F1600A349160012FFAB127F7F1878A2123F7F001F17F818F0 +6C7E6D15016CEE03E06C7F6C6DEC07C06C6DEC0F80D97FF8EC3F00D91FFE14FE903A0FFF +E007FC010390B512F0010015C0021F49C7FC020013F035357BB340>67 +D<B812FCA4C69038E0001FEE03FE16011600177E173EA2171EA3923803C01F170FA40307 +1300A2150F153F91B5FCA4ECE03F150F1507A21503A592C8FCABB612F8A430337DB238> +70 D<B612F8A4C601E0C8FCB3A81778A417F817F0A31601A21603A21607160F161F167F +923803FFE0B8FCA42D337DB235>76 D<D90FFC137090397FFF80F048B512E1000714FB39 +0FF803FF391FE0007F4848133F49130F007F140790C7FC1503481401A36D1300A27F6D14 +0013F8387FFFC014FCECFFE06C14F86C14FE816C1580000315C06C15E06C6C14F0131F01 +0014F8140F9138007FFC153F151F150F00F01407A21503A27EA216F86C14076C15F07E6D +EB0FE001E0131F01FEEB7FC000FDB61200D8F87F5BD8F01F13F8D8E00113C026357BB331 +>83 D<003FB812F8A4D9F003EB801FD87F80ED03FC01001501007E1600007C177CA20078 +173CA400F8173E48171EA4C71600B3A9011FB612F0A437327DB13E>I<B600E090B512F8 +A4C601E0C8EAF800B3B0017F15016E5DA2013F4B5A6E1407011F5E6D6C140F6D6CEC3F80 +6D6C6C01FFC7FC6D9038F007FE6D6CB512F8021F5C020714C09126007FFCC8FC3D347DB2 +44>I<B66C90381FFFFCA4000101E0C8EA7E006C177C6E15FC017F5E6E1401A2013F5E6E +1403011F5E6E1407010F5E6E140F6D5E81171F6D93C7FC6F5B6D153E6F137E6D157C6F13 +FC027F5C811601023F5CEDFC03021F5CEDFE07020F5CEDFF0F6E5C168F169F6E91C8FC16 +FF6E5BA26E5BA26F5AA36F5AA26F5AA26F5AA23E347EB243>I<B66CB639800FFFFCA400 +019026C0000101C0C7EA1F001B1E6E6F143E6C6F163CA26E6E6C147C017F19786E4A6C14 +F8013F61A26E496D1301011F616E497F010F03CF4A5AA26E01076D13076D03875DA29226 +800F03EB800F6D96C7FCDBC01F6E5A6DDA1E01141EA2DBE03EECE03E6DDA3C00143CDBF0 +7C14F0027F0178017F5BA2DBF8F8ECF8F8023F49013F5BA2DBFDE0EB1FFD021F5F03FF15 +FF6E496D5BA36E496D5BA26E90C76C90C8FCA36E486E5AA24B140002005EA20378157856 +347EB25B>I<EB7FFE0003B512E04814F8390FF00FFC391FF803FF806E138016C0157F6C +5A6C5AEA0180C8FCEC7FFF010FB5FC90B6FC0003EBF07F000F1300EA1FF8485A485A485A +5BA315FF7F007F5B6D4813E03A3FF80FBFFF000FB5121F0003EBFC0F39007FE00728217E +A02B>97 D<EA01FC12FFA4120F1207ADEC07FC91387FFF8001FDB512E09039FFF00FF891 +38C007FC91380003FE496D7E496D1380A217C0167FA217E0A917C0A216FF1780A26D4913 +006D495A9138C007FC9039F3F01FF801E1B512E0D9C07F13809026800FF8C7FC2B347EB3 +31>I<903807FF80013F13F090B512FC3903FE01FE4848487EEA0FF8EA1FF0EA3FE0A200 +7F6D5A496C5A153000FF91C7FCA9127F7FA2003FEC07807F6C6C130F000FEC1F00D807FE +133E3903FF80FCC6EBFFF8013F13E0010790C7FC21217DA027>I<ED01FC15FFA4150F15 +07ADEB07FE90383FFFC790B512F70003EB01FF3907FC003F4848131F4848130F48481307 +A2127F5BA212FFA9127FA27F123F150F6C6C131F6C6C133F6C6C497E2603FE03B512E0C6 +B512E7013F1387903807FC072B347DB331>I<903803FF80013F13F090B512FC48EB03FE +3907FC007F4848EB3F804848EB1FC05B003FEC0FE0127F5B16F012FF150790B6FCA301C0 +C8FCA4127F7F123F16F06C7E000F14016C6CEB03E0D803FEEB0FC03A01FF807F806C6CB5 +1200011F13FC010313E024217EA029>I<EC3FE0903803FFF8010F13FC90383FF1FE9038 +7FC3FFEBFF83481303A2EA03FEEC01FEA2EC00781500A7B512FEA4D803FEC7FCB3A7387F +FFF8A420347EB31B>I<16F890390FFC07FE90387FFF9F48B6127F3907FC0FFC380FF003 +001F14FED9E001133E003FECFF1C1600A6001F5CEBF003000F5C3907FC0FF890B512E048 +6C1380D90FFCC7FC48C9FCA37F7F90B512F015FE6CECFF8016E06C15F06C15F84815FC12 +1F393F80001F48C7EA03FE481401481400A46C14016C6CEB03FC6C6CEB07F86C6CEB0FF0 +D80FFCEB7FE00003B61280C6ECFE00010F13E028327EA12C>I<EA01FC12FFA4120F1207 +ADEC03FF020F13C0023F13F09138FC0FF89039FDE007FCEBFFC04A6C7E1400A25BA25BB2 +B539E07FFFF0A42C347DB331>I<EA03F0487E487E487EA66C5A6C5A6C5AC8FCA8EA01FC +12FFA4120F1207B3A5B512C0A412357DB418>I<EA01FC12FFA4120F1207ADED7FFFA4ED +1FC04B5A037EC7FC5DEC03F8EC07E04A5AEC3F804AC8FC4A7E90B5FC8181ECBFF0EC3FF8 +9038FC1FFCEBF80F6E7E6E7E6E7F82806F7E6F7E6F7EB539C07FFFC0A42A347DB32F> +107 D<EA01FC12FFA4120F1207B3B3A6B512E0A413347DB318>I<2703F803FEEB03FE00 +FF903B1FFFC01FFFC0027FD9E07F7F913BF81FF0F81FF0903CF9E00FF9E00FF8260FFBC0 +EBFBC06CB4486CB4486C7E02001400495CA3495CB2B500E0B500E0B512E0A443217CA04A +>I<3901F803FF00FF010F13C0023F13F09138FC0FF89039F9E007FC380FFBC06CB4486C +7E1400A25BA25BB2B539E07FFFF0A42C217DA031>I<903803FF80011F13F090B512FE48 +EB01FF3A07FC007FC0D80FF0EB1FE0001F15F049130F003F15F8491307007F15FCA300FF +15FEA8007F15FCA26D130F003F15F8001F15F06D131F6C6CEB3FE06C6CEB7FC03A01FF01 +FF006CEBFFFE013F13F80103138027217EA02C>I<3901FC07FC00FF90387FFF8001FDB5 +12E09039FFF01FF89138C007FC000F90380003FE6C4880496D1380A26F13C0A3EE7FE0A9 +EEFFC0A34B1380A26D4913006D495A9138C00FFC9138F03FF801FDB512E0D9FC7F1380DA +0FF8C7FC91C9FCABB512E0A42B307EA031>I<3901F81F8000FFEB7FF0ECFFF89038F9E3 +FC9038FBC7FE380FFF876C1307A213FEEC03FCEC01F8EC0060491300B1B512F0A41F217E +A024>114 D<9038FFE1C0000713FF5A383F803F387E000F14075A14037EA26C6CC7FC13 +FCEBFFE06C13FC806CEBFF80000F14C06C14E0C6FC010F13F0EB007F140F00F013071403 +7EA26C14E06C13076CEB0FC09038C01F8090B5120000F913FC38E03FE01C217DA023>I< +133CA5137CA313FCA21201A212031207001FB51280B6FCA3D807FCC7FCB0EC03C0A79038 +FE078012033901FF0F006C13FEEB3FFCEB0FF01A2F7EAE22>I<D801FC14FE00FF147FA4 +000F140700071403B21507A2150F151F6C6C497E6C6C01FB13F06CEBFFF3013F13C39038 +07FE032C217DA031>I<B539C007FFC0A4D807FEC7EAF80000035D6D13016C5D14806C4A +5AA2ECC007017F5CECE00F013F91C7FC6E5A011F131EECF83E010F133CECFC7C01071378 +ECFEF801035B14FF6D5BA26D5BA26E5AA26EC8FCA2141E2A217EA02F>I<B53B83FFFC03 +FFE0A43D07FC001FE0003E00183C6D167C00036F1378033F14F86C6C6E5B157F9139807B +FC016C5FDAC0FB1303017FD9F1FE5B14C19139E1E0FF07013F5E9139F3C07F0F011F038F +C7FC14F7903A0FFF803FDEA29238001FFE6D5DA26D486D5AA24A130701015DA26D486D5A +4A13013B217EA040>I<B539C03FFF80A400039039000FC0006C01805B6C4AC7FC90387F +C03E6D6C5A6E5A90381FF9F0EB0FFF6D5B6D5B6D5B7F816E7E4A7E497FEB03EF903807C7 +FC90380FC3FE90381F83FFD93F017FD97E007F496D7E496D7E4848131FD8FFFE90387FFF +C0A42A217EA02F>I<B539C007FFC0A4D807FEC7EAF80000035D6D13016C5D14806C4A5A +A2ECC007017F5CECE00F013F91C7FC6E5A011F131EECF83E010F133CECFC7C01071378EC +FEF801035B14FF6D5BA26D5BA26E5AA26EC8FCA2141EA25CA2147C003E1378007F13F848 +6C5A1381EB83E0EB87C0495AD87F3FC9FCEA3FFEEA1FF8EA07E02A307EA02F>I +E +%EndDVIPSBitmapFont +%DVIPSBitmapFont: Fp cmr7 7 45 +/Fp 45 124 df<1238127C12FE12FFA2127F123B1203A31206A3120C1218123812701220 +08127B8613>44 D<B5FCA410047F8E16>I<1238127C12FEA3127C123807077B8613>I<EB +3F803801FFF03803E0F83807803C48487E001E7F003E1480A2003C1307007C14C0A400FC +14E0AE007C14C0A36CEB0F80A36CEB1F006C131E6C6C5A3803E0F86CB45A38003F801B27 +7EA521>48 D<13381378EA01F8121F12FE12E01200B3AB487EB512F8A215267BA521>I< +13FF000313E0380E03F0381800F848137C48137E00787F12FC6CEB1F80A4127CC7FC1500 +5C143E147E147C5C495A495A5C495A010EC7FC5B5B903870018013E0EA01803903000300 +12065A001FB5FC5A485BB5FCA219267DA521>I<13FF000313E0380F01F8381C007C0030 +137E003C133E007E133FA4123CC7123E147E147C5C495AEB07E03801FF8091C7FC380001 +E06D7E147C80143F801580A21238127C12FEA21500485B0078133E00705B6C5B381F01F0 +3807FFC0C690C7FC19277DA521>I<1438A2147814F81301A2130313071306130C131C13 +1813301370136013C012011380EA03005A120E120C121C5A12305A12E0B612E0A2C7EAF8 +00A7497E90383FFFE0A21B277EA621>I<0018130C001F137CEBFFF85C5C1480D819FCC7 +FC0018C8FCA7137F3819FFE0381F81F0381E0078001C7F0018133EC7FC80A21580A21230 +127C12FCA3150012F00060133E127000305B001C5B380F03E03803FFC0C648C7FC19277D +A521>I<EB0FE0EB3FF8EBF81C3801E0063803C01F48485AEA0F005A121E003E131E91C7 +FC5AA21304EB3FC038FCFFF038FDC078EB003CB4133E48131E141FA2481480A4127CA400 +3C1400123E001E131E143E6C133C6C6C5A3803C1F03801FFC06C6CC7FC19277DA521>I< +1230123C003FB512E0A215C0481480A239700007000060130E140C48131C5C5CC75A5C13 +01495AA249C7FC5B130E131EA3133E133CA2137CA413FCA813781B287DA621>I<137F38 +03FFE0380781F8380E007C48131E5A801278A3127C007E131EEA3F80EBE03C6C6C5A380F +FCF03807FFC06C5BC613E0487F38079FFC380F07FEEA1E0348C67E48133FEC1F8048130F +A21407A315001278140E6C5B6C5B380F80F03803FFE0C66CC7FC19277DA521>I<137F38 +01FFC03807C1E0380F0070001E1378003E7F003C133E007C131EA200FC131FA41580A400 +7C133FA2123C003E137F001E135F380F01DF3807FF9F3801FE1FD8001013001300A2143E +123C007E133CA25C5C007C5B383003C0381C0780D80FFFC7FCEA03F819277DA521>I<14 +0EA2141FA34A7EA3EC6FC0A2ECEFE014C7A290380183F0A390380301F8A201067F1400A2 +49137EA2011C137F01187FA24980013FB5FCA2903960000FC0A201E080491307A248486D +7EA200038115011207D81FC0497ED8FFF890383FFFE0A22B2A7EA931>65 +D<91387FC002903903FFF80690390FE01E0E90383F0007017CEB019ED801F0EB00FE4848 +147E4848143E5B000F151E48C8FC48150E123EA2007E1506A2127C00FC1500A8127C007E +1506A2123EA2003F150C7E6C7E000715186D14386C6C14306C6C1460D8007CEB01C0013F +EB038090390FE01E00903803FFF89038007FC0272A7DA82F>67 D<91387FC002903903FF +F80690390FE01E0E90383F0007017CEB019ED801F0EB00FE4848147E4848143E5B000F15 +1E48C8FC48150E123EA2007E1506A2127C00FC92C7FCA792387FFFE0127C007E02001300 +167E123EA2123F7E6C7E6C7EA26C7ED801F814FEEA007C013FEB039E90390FE00F0E9039 +03FFFC029026007FE0C7FC2B2A7DA833>71 D<B512C0A23807F8006C5AB3B0487EB512C0 +A212287EA718>73 D<D8FFF0903807FFE07FD803FC9038007E006D143C1618137F6D7E6D +7EA26D7E6D7E6D7EA26D7E6D7E147FA2EC3F80EC1FC0EC0FE015F01407EC03F8EC01FCEC +00FEA2157FED3F98ED1FD8A2ED0FF815071503A215011500486C1478487ED8FFFC143816 +182B287EA731>78 D<B612E015FC3907F0003F0003EC0FC0ED03E0ED01F016F8150016FC +A616F8150116F0ED03E0ED0FC0ED3F0090B512FC15E001F0C8FCAF487EB512C0A226287E +A72D>80 D<90387F80203903FFF06039078078E0380E000E481307481303007813010070 +130012F0A21560A27E1500127C127FEA3FE013FF6C13F06C13FC000313FFC61480010F13 +C0010013E0EC0FF014031401EC00F8A200C01478A46C1470A26C14F06C14E06CEB01C000 +EFEB078039E3E01F0038C0FFFC38801FF01D2A7DA825>83 D<007FB7FCA23A7E003F003F +0078150F007081006081A200E01680481501A5C791C7FCB3A64A7E013FB5FCA229287EA7 +2F>I<B539C007FFE0A2D807F8C7EA7E006C48143C1618B3A816386C6C143016706C6C14 +60017C14E0017E495A6D495A90260F8007C7FC903807E03E903801FFF89038003FC02B29 +7EA731>I<13FE3807FFC0380F03E0381C00F0003E1378003F137C143C143E121EC7FCA3 +EB3FFEEA01FF3807F03EEA1FC0EA3F00127EA2481418A3147E127EECDF38393F838FF039 +0FFE0FE03903F807C01D1C7E9A21>97 D<EA0F8012FFA2121F120FAAEB81FCEB8FFF9038 +BC0FC09038F003E09038C001F0EB800015F815FC157CA2157EA7157CA215FC15F89038C0 +01F015E090387003C0390E3C0F80390C0FFF00380003F81F297EA725>I<EB3FC0EBFFF8 +3803E03C3807C00E380F801F381F003F123EA2007E131E007C1300A212FCA7127C127E14 +03123E6C1306EA0F803807C00C3803F0383800FFE0EB3F80181C7E9A1E>I<EC03E0143F +A214071403AAEB3F833801FFE33803E03B3807800F380F0007481303123E127E127CA212 +FCA7127CA2127E123E001E1307001F130F390F801FF03903E073FE3801FFE339007F03E0 +1F297EA725>I<133F3801FFE03803E1F0380F80F8381F007C143E123E007E131E141F12 +7C12FCA2B6FCA200FCC7FCA4127C127E1403123E6C1307380F800E3807C01C3803E07838 +00FFE0EB3F80181C7E9A1E>I<EB07E0EB3FF0EB7C78EBF0FCEA01E01203EBC078000713 +301400A8B51280A23807C000B3A2487EEA7FFEA216297FA815>I<90387E03E03901FF9F +F03807C3FC380F00F048EBF800001E1378003E137CA6001E1378001F13F86C5BEBC3E038 +0DFF80D81C7EC7FC90C8FCA3121E380FFFF014FC6C13FF001F1480393E001FC000781307 +EC03E0481301A40078EB03C0007C13076CEB0F80390FC07E003803FFF838007FC01C277E +9921>I<EA0F8012FFA2121F120FAAEB81FCEB8FFF90389C0F809038B007C013E09038C0 +03E0A31380AF391FC007F039FFF83FFEA21F287EA725>I<120EEA3F80A5EA0E00C7FCA7 +EA078012FFA2121F120FB3121FEAFFF8A20D287EA713>I<EA0F8012FFA2121F120FB3AF +EA1FC0EAFFF8A20D287EA713>108 D<260F81FC137F3BFF8FFF03FFC0903A9C0F8703E0 +3B1FB007CC01F0D80FE013D8903AC003F000F8A301805BAF486C486C487E3CFFF83FFE0F +FF80A2311A7E9937>I<380F81FC38FF8FFF90389C0F80391FB007C0EA0FE09038C003E0 +A31380AF391FC007F039FFF83FFEA21F1A7E9925>I<EB3F80EBFFE03803E0F83807803C +48487E001E7F003E1480A248EB07C0A300FC14E0A7007C14C0A2007E130F003E1480001E +1400001F5B380F803E3803E0F86CB45A38003F801B1C7E9A21>I<380F81FC38FF8FFF90 +38BC0FC0391FF007E0390FC003F0EB800115F8EC00FCA2157C157EA7157C15FCA2EC01F8 +01C013F0EC03E09038F007C09038BC1F8090388FFF00EB83F80180C7FCA7487EEAFFF8A2 +1F257E9925>I<380F07C038FF1FF0EB38F8EA1F71EA0F6113C1EBC0F014005BAF487EEA +FFFCA2151A7E991A>114 D<3803F840380FFEC0EA3C07EA7803EA7001EAF000A37E6C13 +00EA7FC013FC6CB4FC6C1380000713C0C613E0130738C003F0130113007EA26C13E01301 +00F813C038EE078038C7FF00EA81FC141C7E9A1A>I<13C0A41201A312031207120F121F +B512E0A23807C000AC1430A73803E060A23801F0C03800FF80EB3F0014257FA31A>I<39 +0F8003E000FF133FA2001F1307000F1303B01407A20007130F9038C01BF03903E073FE38 +01FFE339007F83E01F1B7E9925>I<39FFF807FEA2390FE001F001C013E0000714C013E0 +00031480EBF00300011400A23800F806A2EB7C0CA2EB7E1CEB3E18A26D5AA2EB0FE0A36D +5AA26D5AA21F1A7F9823>I<3BFFF8FFF07FE0A23B1FC01FC01F80000F90390F800E00A2 +0007150CEC1FC02603E01B5B15E0143B2601F0315B15F0D9F86013700000156015F89039 +FCC078E0017CEB7CC0137D90393F803D80153FEC001F6D91C7FCA2011E7F010E130EA22B +1A7F982F>I<39FFF81FFCA2390FF00FE0D807E01380D803F013003801F80E00005BEB7C +386D5AEB3FE06D5A130F130780497EEB1DF8EB38FCEB707EEBE03E48487E0003EB0F8000 +0714C0001F14E039FFE01FFEA21F197F9823>I<39FFF807FEA2390FE001F001C013E000 +0714C0EA03E01580EBF003000114006D5A0000130613FCEB7C0CA26D5AA26D5AA214F06D +5AA26D5AA26D5AA291C7FCA213061230EA780EEAFC0C131C1318485AEA70E0EA3FC06CC8 +FC1F257F9823>I<B612FEA21F02808F21>123 D E +%EndDVIPSBitmapFont +%DVIPSBitmapFont: Fq cmmi7 7 1 +/Fq 1 116 df<EB0FE0EB7FF8EBF03C3801C00E0003131E3807803EA2143C000F1318EB +E0006CB4FC14C06C13E06C13F06C13F813071301EA3C00007E1378A24813F05A387001E0 +EB03C0383C0F80381FFE00EA07F8171B7C991F>115 D E +%EndDVIPSBitmapFont +%DVIPSBitmapFont: Fr cmr10 10 75 +/Fr 75 125 df<DA0FF813FC91397FFF07FF903B01F807DF83C0903A07E001FF0F903B1F +8007FE1FE090393F000FFC137E16F85B9338F007804848010790C7FC1503ACB812F8A328 +01F80003F0C7FCB3AB486C497E267FFFE0B512F0A3333B7FBA30>11 +D<EC0FF8EC7FFE903901F80780903907E001C090391F8000E090383F0007017E497EA25B +A2485A6F5AED018092C8FCA9ED03F0B7FCA33901F8000F1503B3AA486C497E267FFFE0B5 +12C0A32A3B7FBA2E>I<EC0FFC91387FFF70903901F803F0903807E00790381F800FEB3F +00137EA25B150748481303ADB7FCA33901F80003B3AB486C497E267FFFE0B512C0A32A3B +7FBA2E>I<DA0FF0EB1FF0DA7FFEEBFFFC903B01F80F83F00F903C07E001CFC00380903C +1F8000FF0001C090273F0007FE130F017E4948497EA2495CA248485C03076E5A03030203 +C7FC95C8FCA9F007E0BAFCA33C01F80003F0001F1807B3AA486C496C497E267FFFE0B500 +C1B51280A3413B7FBA45>I<001C131C007F137F39FF80FF80A26D13C0A3007F137F001C +131C00001300A40001130101801380A20003130301001300485B00061306000E130E485B +485B485B006013601A197DB92A>34 D<121C127FEAFF80A213C0A3127F121C1200A41201 +1380A2120313005A1206120E5A5A5A12600A1979B917>39 D<146014E0EB01C0EB0380EB +0700130E131E5B5BA25B485AA2485AA212075B120F90C7FCA25A121EA2123EA35AA65AB2 +127CA67EA3121EA2121F7EA27F12077F1203A26C7EA26C7E1378A27F7F130E7FEB0380EB +01C0EB00E01460135278BD20>I<12C07E12707E7E7E120F6C7E6C7EA26C7E6C7EA21378 +A2137C133C133E131EA2131F7FA21480A3EB07C0A6EB03E0B2EB07C0A6EB0F80A31400A2 +5B131EA2133E133C137C1378A25BA2485A485AA2485A48C7FC120E5A5A5A5A5A13527CBD +20>I<15301578B3A6007FB812F8B912FCA26C17F8C80078C8FCB3A6153036367BAF41> +43 D<121C127FEAFF80A213C0A3127F121C1200A412011380A2120313005A1206120E5A +5A5A12600A19798817>I<B512FCA516057F941C>I<121C127FEAFF80A5EA7F00121C0909 +798817>I<150C151E153EA2153C157CA2157815F8A215F01401A215E01403A215C01407 +A21580140FA215005CA2141E143EA2143C147CA2147814F8A25C1301A25C1303A2495AA2 +5C130FA291C7FC5BA2131E133EA2133C137CA2137813F8A25B1201A25B1203A25B1207A2 +5B120FA290C8FC5AA2121E123EA2123C127CA2127812F8A25A12601F537BBD2A>I<EB03 +F8EB1FFF90387E0FC09038F803E03901E000F0484813780007147C48487FA248C77EA248 +1580A3007EEC0FC0A600FE15E0B3007E15C0A4007F141F6C1580A36C15006D5B000F143E +A26C6C5B6C6C5B6C6C485A6C6C485A90387E0FC0D91FFFC7FCEB03F8233A7DB72A>I<EB +01C013031307131F13FFB5FCA2131F1200B3B3A8497E007FB512F0A31C3879B72A>I<EB +0FF0EB7FFE48B57E3903E03FE0390F000FF0000E6D7E486D7E486D7E123000706D7E1260 +12FCB4EC7F807FA56CC7FC121CC8FCEDFF00A34A5A5D14035D4A5A5D140F4A5A4A5A92C7 +FC147C5C495A495A495A495A91C8FC011EEB01805B5B49130348481400485A485A000EC7 +5A000FB6FC5A5A485CB6FCA321387CB72A>I<EB07F8EB3FFF4913C03901F80FF03903C0 +07F848486C7E380E0001000F80381FE0006D7FA56C5A6C5AC85A1401A25D4A5AA24A5A5D +EC0F80027EC7FCEB1FFCECFF809038000FE06E7EEC01FC816E7EED7F80A216C0A2153F16 +E0A2121EEA7F80487EA416C049137F007F1580007EC7FC0070ECFF006C495A121E390F80 +03F83907F00FF00001B512C06C6C90C7FCEB0FF8233A7DB72A>I<1538A2157815F8A214 +0114031407A2140F141F141B14331473146314C313011483EB030313071306130C131C13 +1813301370136013C01201EA038013005A120E120C5A123812305A12E0B712F8A3C73803 +F800AB4A7E0103B512F8A325397EB82A>I<0006140CD80780133C9038F003F890B5FC5D +5D158092C7FC14FC38067FE090C9FCABEB07F8EB3FFE9038780F803907E007E090388003 +F0496C7E12066E7EC87EA28181A21680A4123E127F487EA490C71300485C12E000605C12 +700030495A00385C6C1303001E495A6C6C485A3907E03F800001B5C7FC38007FFCEB1FE0 +213A7CB72A>I<EC3FC0903801FFF0010713FC90380FE03E90383F800790387E001F49EB +3F804848137F485AA2485A000FEC3F0049131E001F91C7FCA2485AA3127F90C9FCEB01FC +903807FF8039FF1E07E090383801F0496C7E01607F01E0137E497FA249148016C0151FA2 +90C713E0A57EA56C7E16C0A2121FED3F807F000F15006C6C5B15FE6C6C5B6C6C485A3900 +FE07F090383FFFC06D90C7FCEB03FC233A7DB72A>I<12301238123E003FB612E0A316C0 +5A168016000070C712060060140E5D151800E01438485C5D5DC712014A5A92C7FC5C140E +140C141C5CA25CA214F0495AA21303A25C1307A2130FA3495AA3133FA5137FA96DC8FC13 +1E233B7BB82A>I<EB03F8EB1FFF017F13C09038FC07F03901E001F848486C7E4848137C +90C77E48141E000E141F001E80A3121FA27F5D01E0131E6C6C133E01FC133C6D5B6C6C6C +5AECC1E06CEBF3C06C01FFC7FC6C5BEB3FFF6D13C081017F13F801F07F3903E07FFE3907 +801FFF48486C1380481303003E6D13C0003CEB007F007C143F0078EC0FE000F814075A15 +03A21501A36C15C012781503007C15806CEC07006C5C6C6C131ED807E0137C3903F803F0 +C6B55A013F1380D907FCC7FC233A7DB72A>I<EB03F8EB1FFF017F13C09038FC07E03903 +F803F048486C7E48486C7E49137E121F48487FA2007F158090C7FCA248EC1FC0A616E0A5 +6C143FA27F123F001F147FA26C6C13FF3907E001DF0003149F3801F0033900FC0F1FD93F +FC13C0EB07F090C7FC153F1680A316005D000F147E487E486C5BA24A5A4A5A49485A6C48 +485A001C495A260F807FC7FC3807FFFC000113F038003FC0233A7DB72A>I<121C127FEA +FF80A5EA7F00121CC7FCB2121C127FEAFF80A5EA7F00121C092479A317>I<121C127FEA +FF80A5EA7F00121CC7FCB2121C127F5A1380A4127F121D1201A412031300A25A1206A212 +0E5A121812385A1260093479A317>I<1538A3157CA315FEA34A7EA34A6C7EA202077FEC +063FA2020E7FEC0C1FA2021C7FEC180FA202387FEC3007A202707FEC6003A202C07F1501 +A2D901807F81A249C77F167FA20106810107B6FCA24981010CC7121FA2496E7EA3496E7E +A3496E7EA213E0707E1201486C81D80FFC02071380B56C90B512FEA3373C7DBB3E>65 +D<B712E016FC16FF0001903980007FC06C90C7EA1FE0707E707E707EA2707EA283A75F16 +035F4C5A4C5A4C5A4C5AEEFF8091B500FCC7FCA291C7EA7F80EE1FE0EE07F0707E707E83 +707EA21880177F18C0A7188017FFA24C13005F16034C5AEE1FF8486DEB7FF0B812C094C7 +FC16F832397DB83B>I<913A01FF800180020FEBE003027F13F8903A01FF807E07903A03 +FC000F0FD90FF0EB039F4948EB01DFD93F80EB00FF49C8127F01FE153F12014848151F48 +48150FA248481507A2485A1703123F5B007F1601A35B00FF93C7FCAD127F6DED0180A312 +3F7F001F160318006C7E5F6C7E17066C6C150E6C6C5D00001618017F15386D6C5CD91FE0 +5C6D6CEB03C0D903FCEB0F80902701FF803FC7FC9039007FFFFC020F13F002011380313D +7BBA3C>I<B712C016F816FE000190398001FF806C90C7EA3FE0EE0FF0EE03F8707E707E +177FA2EF3F8018C0171F18E0170F18F0A3EF07F8A418FCAC18F8A4EF0FF0A218E0A2171F +18C0EF3F80A2EF7F0017FE4C5A4C5AEE0FF0EE3FE0486DEBFF80B8C7FC16F816C036397D +B83F>I<B812FCA30001903880000F6C90C71201EE007E173E171E170EA31706A3170783 +16C0A394C7FCA31501A21503150F91B5FCA3EC000F15031501A21500A21860A318E093C7 +12C0A41701A3EF0380A21707A2170F173F177F486D903807FF00B9FCA333397DB839>I< +B812F8A30001903880001F6C90C71201EE00FC177C173C171CA2170CA4170E1706A2ED01 +80A21700A41503A21507151F91B5FCA3EC001F15071503A21501A692C8FCAD4813C0B612 +C0A32F397DB836>I<DBFF8013C0020FEBF001023F13FC9139FF803F03903A03FC000787 +D90FF0EB03CF4948EB00EF4948147F4948143F49C8121F485A4848150F48481507A24848 +1503A2485A1701123F5B007F1600A448481600AB93B6FCA26C7E9338007FE0EF3FC0A212 +3F7F121FA26C7EA26C7EA26C7E6C7E6C6C157F6D7E6D6C14FF6D6C14EFD90FF8EB03C7D9 +03FEEB0783903A00FFC03F0191393FFFFC00020F01F0130002001380383D7CBA41>I<B6 +48B512FEA30001902680000313006C90C76C5AB3A491B6FCA391C71201B3A6486D497EB6 +48B512FEA337397DB83E>I<B612C0A3C6EBC0006D5AB3B3AD497EB612C0A31A397EB81E> +I<B649B5FCA3000101809038007FF06C90C8EA3F80053EC7FC173C17385F5F4C5A4C5A4C +C8FC160E5E5E5E5E4B5AED0780030EC9FC5D153E157E15FF5C4A7F4A6C7E140E4A6C7E4A +6C7E14704A6C7E4A6C7E14804A6C7E6F7EA26F7F707EA2707E707EA2707EA2707E707EA2 +707E707F8484486D497FB6011FEBFF80A339397DB841>75 D<B612E0A3000101C0C8FC6C +90C9FCB3AD1718A517381730A31770A317F0A216011603160FEE1FE0486D13FFB8FCA32D +397DB834>I<B5933807FFF86E5DA20001F0FC002600DFC0ED1BF8A2D9CFE01533A3D9C7 +F01563A3D9C3F815C3A2D9C1FCEC0183A3D9C0FEEC0303A2027F1406A36E6C130CA36E6C +1318A26E6C1330A36E6C1360A26E6C13C0A3913901FC0180A3913900FE0300A2ED7F06A3 +ED3F8CA2ED1FD8A3ED0FF0A3486C6D5A487ED80FFC6D48497EB500C00203B512F8A2ED01 +8045397DB84C>I<B5913807FFFE8080C69238007FE06EEC1F80D9DFF0EC0F001706EBCF +F8EBC7FCA2EBC3FEEBC1FFA201C07F6E7EA26E7E6E7E81140F6E7E8114036E7E168080ED +7FC016E0153FED1FF0ED0FF8A2ED07FCED03FEA2ED01FF6F1386A2EE7FC6EE3FE6A2EE1F +F6EE0FFEA216071603A216011600A2177E486C153E487ED80FFC151EB500C0140EA21706 +37397DB83E>I<EC03FF021F13E09138FE01FC903901F8007ED907E0EB1F8049486D7ED9 +3F80EB07F049C76C7E01FE6E7E48486E7E49157E0003167F4848ED3F80A24848ED1FC0A2 +001F17E049150F003F17F0A3007F17F8491507A300FF17FCAC007F17F86D150FA3003F17 +F0A26C6CED1FE0A36C6CED3FC0000717806D157F000317006C6C15FEA26C6C4A5A017F4A +5A6D6C495A6D6C495AD907E0EB1F80D903F8017FC7FC903900FE01FC91381FFFE0020390 +C8FC363D7BBA41>I<B712C016F816FE000190398001FF806C90C7EA3FC0EE0FE0EE07F0 +EE03F817FC17FE1601A217FFA717FEA2EE03FCA2EE07F817F0EE0FE0EE3FC0923801FF00 +91B512FC16F091C9FCB3A5487FB6FCA330397DB839>I<B612FEEDFFE016F80001903880 +07FE6C90C76C7EEE3FC0707E707E707EA2707EA283A65FA24C5AA24C5A4C5AEE3F8004FF +C8FCED07FC91B512E05E9138000FF0ED03F8ED00FE82707E707EA2161F83A583A6F00180 +A217F8160F1803486D01071400B66D6C5A04011306933800FE0ECAEA3FFCEF07F0393B7D +B83D>82 D<D90FF813C090383FFE0190B512813903F807E33907E000F74848137F484813 +3F48C7121F003E140F007E1407A2007C140312FC1501A36C1400A37E6D14006C7E7F13F8 +6CB47E6C13F8ECFF806C14E06C14F86C14FEC680013F1480010714C0EB007F020713E0EC +007FED3FF0151F150FED07F8A200C01403A21501A37EA216F07E15036C15E06C14076C15 +C06C140F6DEB1F80D8FBF0EB3F00D8F0FE13FE39E03FFFF8010F13E0D8C00190C7FC253D +7CBA2E>I<003FB812E0A3D9C003EB001F273E0001FE130348EE01F00078160000701770 +A300601730A400E01738481718A4C71600B3B0913807FF80011FB612E0A335397DB83C> +I<B6903807FFFEA3000101809038007FE06C90C8EA1F80EF0F001706B3B2170E6D150C80 +171C133F17186D6C14385F6D6C14F06D6C5C6D6C495A6D6CEB07806D6C49C7FC91387F80 +7E91381FFFF8020713E09138007F80373B7DB83E>I<B500FC91387FFF80A30003018091 +380FFC006C90C8EA07E0715A6C705A6E1403017F93C7FCA280013F1506A26E140E011F15 +0C80010F5DA28001075DA26E147001031560A26D6C5CA2806D4A5AA2ED8003027F91C8FC +A291383FC006A215E0021F5BA2EDF01C020F1318A26E6C5AA215FC02035BA2EDFEE00201 +5BA26E6C5AA36FC9FCA3153EA2151CA3393B7EB83E>I<B5D8FC07B5D8F001B5FCA30007 +902780001FFEC7EA1FF86C48C7D80FF8EC07E000010307ED03C01B807F6C6F6C1500A26E +5F017F6E6C1406A280013F4A6C5CA280011F4A6D5BEE067FA26D6C010E6D5BEE0C3FA26D +6C011C6D5BEE181FA26D6C6F5BEE300FA26D6C6F485AEE6007A26D6C4CC7FC9338C003FC +A203805D913B7F818001FE06A203C1150EDA3FC3C7EAFF0CA203E3151CDA1FE6EC7F98A2 +15F6DA0FFCEC3FF0A302075E4B141FA202035E4B140FA202015E4B1407A2020093C8FC4B +80503B7EB855>I<007FB590383FFFFCA3C601F801071380D97FE0D903FCC7FC013FEC01 +F06D6C5C5F6D6C5C6D6C13034CC8FC6D6C1306160E6D6C5B6DEB8018163891387FC0306E +6C5A16E06E6C5A91380FF18015FB6EB4C9FC5D14036E7EA26E7F6F7EA24B7E15DF913801 +9FF09138038FF8150F91380607FC91380E03FE140C4A6C7EEC38000230804A6D7E14E04A +6D7E49486D7E130391C76C7E01066E7E130E010C6E7E011C1401013C8101FE822607FF80 +010713E0B500E0013FEBFF80A339397EB83E>I<3901800180000313033907000700000E +130E485B0018131800381338003013300070137000601360A200E013E0485BA400CE13CE +39FF80FF806D13C0A3007F137FA2393F803F80390E000E001A1974B92A>92 +D<EB1FE0EBFFFC3803E03F3907000F80390F8007E0486C6C7E13E06E7EA26E7E6C5A6C5A +C8FCA4147FEB07FFEB3FE0EBFE00EA03F8EA0FF0EA1FC0123F485A90C7FC160C12FEA314 +01A26C13036CEB077C903980063E18383FC01E3A0FE0781FF03A03FFF00FE03A007F8007 +C026277DA52A>97 D<EA03F012FFA3120F1203B0EC1FE0EC7FF89038F1E03E9039F3801F +809039F7000FC001FEEB07E049EB03F049EB01F85BED00FCA216FEA2167E167FAA167E16 +FEA216FC15016D14F8ED03F07F01EEEB07E001C6EB0FC09039C7801F00903881E07E9038 +00FFF8C7EA1FC0283B7EB92E>I<EB03FC90381FFF8090387E03E03901F80070484813F8 +3907E001FC380FC003A2EA1F80123F90380001F848EB00F01500A2127E12FEAA127E127F +A26C14067F001F140E6D130C000F141C6C6C13386C6C13706C6C13E039007C07C090381F +FF00EB07F81F277DA525>I<ED0FC0EC03FFA3EC003F150FB0EB03F8EB1FFF90387E078F +9038F801EF3903F0007F4848133F4848131FA24848130F123F90C7FC5AA2127E12FEAA12 +7E127FA27EA26C6C131FA26C6C133F6C6C137F6C6CEBEFF03A01F801CFFF39007C078F90 +381FFE0FD907F813C0283B7DB92E>I<EB07F8EB1FFF90387C0FC03901F803E03903F001 +F0D807E013F8380FC0004848137CA248C7127E153E5A153F127E12FEA3B7FCA248C8FCA5 +127EA2127FA26C14037F001F14076C6C13060007140E6D131CD801F013386C6C13709038 +7E03E090381FFF80903803FC0020277EA525>I<147E903803FF8090380FC1E0EB1F8790 +383F0FF0137EA213FCA23901F803C091C7FCADB512FCA3D801F8C7FCB3AB487E387FFFF8 +A31C3B7FBA19>I<ED03F090390FF00FF890393FFC3C3C9039F81F707C3901F00FE03903 +E007C03A07C003E010000FECF000A248486C7EA86C6C485AA200075C6C6C485A6D485A6D +48C7FC38073FFC38060FF0000EC9FCA4120FA213C06CB512C015F86C14FE6CECFF804815 +C03A0F80007FE048C7EA0FF0003E140348140116F8481400A56C1401007C15F06CEC03E0 +003F1407D80F80EB0F80D807E0EB3F003901FC01FC39007FFFF0010790C7FC26387EA52A +>I<EA03F012FFA3120F1203B0EC0FF0EC3FFCECF03F9039F1C01F809039F3800FC0EBF7 +0013FE496D7EA25BA35BB3A3486C497EB500C1B51280A3293A7EB92E>I<EA0380EA0FE0 +487EA56C5AEA0380C8FCAAEA03F012FFA312071203B3AA487EB512C0A312387EB717>I< +EB01C0EB07F0EB0FF8A5EB07F0EB01C090C7FCAAEB01F813FFA313071301B3B3A2123C12 +7E00FF13F01303A214E038FE07C0127C383C0F00EA0FFEEA03F8154984B719>I<EA03F0 +12FFA3120F1203B1913801FFFCA39138007FC01600157C15705D4A5A4A5A4AC7FC141E14 +38147814FC13F1EBF3FEEBF73F01FE7FEBF81F496C7E8114076E7E6E7E811400157E157F +811680ED1FC0486CEB3FF0B500C0B5FCA3283A7EB92C>I<EA03F012FFA3120F1203B3B3 +AD487EB512C0A3123A7EB917>I<2703F00FF0EB1FE000FFD93FFCEB7FF8913AF03F01E0 +7E903BF1C01F83803F3D0FF3800FC7001F802603F70013CE01FE14DC49D907F8EB0FC0A2 +495CA3495CB3A3486C496CEB1FE0B500C1B50083B5FCA340257EA445>I<3903F00FF000 +FFEB3FFCECF03F9039F1C01F803A0FF3800FC03803F70013FE496D7EA25BA35BB3A3486C +497EB500C1B51280A329257EA42E>I<EB03FE90380FFF8090383E03E09038F800F84848 +137C48487F48487F4848EB0F80001F15C090C712074815E0A2007EEC03F0A400FE15F8A9 +007E15F0A2007F14076C15E0A26C6CEB0FC0000F15806D131F6C6CEB3F006C6C137EC66C +13F890387E03F090381FFFC0D903FEC7FC25277EA52A>I<3903F01FE000FFEB7FF89038 +F1E07E9039F3801F803A0FF7000FC0D803FEEB07E049EB03F04914F849130116FC150016 +FEA3167FAA16FEA3ED01FCA26DEB03F816F06D13076DEB0FE001F614C09039F7803F0090 +38F1E07E9038F0FFF8EC1FC091C8FCAB487EB512C0A328357EA42E>I<D903F813C09038 +1FFE0190387E07819038FC01C33903F000E3000714774848133749133F001F141F485A15 +0F48C7FCA312FEAA127FA37E6D131F121F6D133F120F6C6C137F6C6C13EF3901F801CF39 +007E078F90381FFE0FEB07F890C7FCABED1FE00203B5FCA328357DA42C>I<3807E01F00 +FFEB7FC09038E1E3E09038E387F0380FE707EA03E613EE9038EC03E09038FC0080491300 +A45BB3A2487EB512F0A31C257EA421>I<EBFF03000313E7380F80FF381E003F487F487F +00707F12F0A2807EA27EB490C7FCEA7FE013FF6C13E06C13F86C7F00037FC67F01071380 +EB007F141F00C0EB0FC01407A26C1303A37E15806C13077EEC0F00B4131E38F3C07C38E1 +FFF038C03F801A277DA521>I<1318A51338A31378A313F8120112031207001FB5FCB6FC +A2D801F8C7FCB215C0A93800FC011580EB7C03017E13006D5AEB0FFEEB01F81A347FB220 +>I<D803F0EB07E000FFEB01FFA3000FEB001F00031407B3A4150FA3151F12016D133F00 +00EC77F86D9038E7FF8090383F03C790381FFF87903A03FC07E00029267EA42E>I<B538 +803FFEA33A0FF8000FF06C48EB07E00003EC03C06D148000011500A26C6C1306A26D130E +017E130CA26D5BA2EC8038011F1330A26D6C5AA214E001075BA2903803F180A3D901FBC7 +FCA214FF6D5AA2147CA31438A227257EA32C>I<B53A1FFFE03FFEA3260FF8009038000F +F86C48017EEB03E018C00003023EEB0180A26C6C013FEB0300A36C6CEC8006156FA2017E +9038EFC00C15C7A2D93F016D5A15830281EBF038D91F831430150102C3EBF87090260FC6 +001360A2D907E66D5A02EC137CA2D903FCEB7F804A133FA2010192C7FC4A7FA20100141E +4A130E0260130C37257EA33C>I<B538807FFFA33A03FE003FF00001EC1F80000092C7FC +017E131C6D13186D6C5AECC070010F5B6D6C5AECF180EB03FB6DB4C8FC6D5AA2147F804A +7E8114CF903801C7E090380383F090380703F8EB0601496C7E011C137E49137F01787F49 +6D7E486C80000FEC3FF0D8FFFE90B51280A329247FA32C>I<B538803FFEA33A0FF8000F +F06C48EB07C00003EC03806C7E16007F00001406A2017E5BA2137F6D5BA26D6C5AA2ECC0 +70010F1360A26D6C5AA214F101035BA2D901FBC7FCA214FF6D5AA2147CA31438A21430A2 +14701460A25CA2EA7C0100FE5B130391C8FC1306EAFC0EEA701C6C5AEA1FF0EA0FC02735 +7EA32C>I<003FB512FCA2EB8003D83E0013F8003CEB07F00038EB0FE012300070EB1FC0 +EC3F800060137F150014FE495AA2C6485A495AA2495A495A495AA290387F000613FEA248 +5A485A0007140E5B4848130C4848131CA24848133C48C7127C48EB03FC90B5FCA21F247E +A325>I<BD12C0A25202809653>124 D E +%EndDVIPSBitmapFont +%DVIPSBitmapFont: Fs cmmi10 10 21 +/Fs 21 123 df<EC3FC0ECFFF8903807E07C90380F801FD93F00EB800C017E130F499038 +07C01C4848ECE018485A484801031338000FEDF0305B001F16704848156017E0007F16C0 +90C713F1178016F34816004815F716FE5EA2485D5EA4007E1407150F003E91381DF81800 +3F14796C02E11338270F8007C013303B07E03F007CF02601FFF8EB3FC026003FC0EB0F80 +2E267DA435>11 D<D803E0137F3A07F801FFE03A0E7C0781F03A1C3E1E00F826383F3813 +FC00305B4A137C00705B00605BA200E090C712FC485A137EA20000140113FE4914F8A215 +0312014914F0A2150712034914E0A2150F12074914C0A2151F120F491480A2153F121F49 +14000007C7FCC85AA2157EA215FEA25DA21401A25DA21403A25DA2EC01C026377EA429> +17 D<1338017E14F001FEEB07FC151F49133B15F30001EB01C391380383F89039F80700 +E0020E90C7FC00035B1478EBF0E0EBF1C03807F78001FEC9FCEBFFE014FE390FE1FFC090 +38E01FE09038C007F06E7E001F6D7EA2D98000EB0180A2003F150302011400010013F8A2 +485D1606007E0100130E160C00FE151CED7C3848EC1FF00038EC07C029267CA430>20 +D<15FE913803FF8091380F83E091383E01F091387C00F85C494813FC0103147C4948137E +5C130F495AA249C7FC16FE5B137EA2150113FE4914FCA20001140316F85BED07F01203ED +0FE04914C0151F000715806DEB3F00157E6D5B390FEE01F09038E707E09038C3FF80D9C0 +FCC7FC001F90C8FCA25BA2123FA290C9FCA25AA2127EA212FEA25AA2127027377EA42B> +26 D<121C127FEAFF80A213C0A3127F121C1200A412011380A2120313005A1206120E5A +5A5A12600A19798817>59 D<902603FFF893383FFF80496081D900079438FF80000206DC +01BFC7FCA2020E4C5A1A7E020C1606190CDA1C7E16FE4F5A02181630A202381661620230 +16C1F00181DA703F158395380303F002601506A202E0ED0C076202C01518183001016D6C +140F06605B028015C0A20103923801801FDD03005B140092380FC00649173F4D91C8FC01 +065DA2010E4B5B4D137E130C6F6C5A011C17FEDCE1805B011802E3C7FCA2013802E61301 +04EC5C1330ED03F8017016034C5C01F05CD807FC4C7EB500E0D9C007B512F01680150151 +397CB851>77 D<0103B7FC4916E018F8903B0007F80007FC4BEB00FE187F020FED3F80F0 +1FC05DA2021F16E0A25DA2143FF03FC05DA2027FED7F80A292C8130018FE4A4A5A604AEC +07F04D5A0101ED3FC04CB4C7FC91B612FC17E0D903FCCAFCA25CA21307A25CA2130FA25C +A2131FA25CA2133FA25CA2137FA291CBFC497EB6FCA33B397DB835>80 +D<0103B612F849EDFF8018E0903B0007F8001FF84BEB03FCEF00FE020F157FA24BEC3F80 +A2021F16C0A25DA2143FF07F805DA2027FEDFF006092C7485A4D5A4A4A5A4D5A4AEC1F80 +057FC7FC0101EC07F891B612E094C8FC9139FC000FC00103EC03F0707E4A6D7E83130717 +7E5C177F010F5D5F5CA2011F1401A25CA2133F16034A4A1360A2017F17E019C091C71401 +496C01011480B61503933900FE0700EF7E0ECAEA1FFCEF07F03B3B7DB83F>82 +D<0003B812FEA25A903AF8003FC00101C0913880007E4848163C90C7007F141C121E001C +92C7FCA2485CA200305C007017180060130112E0485CA21403C716005DA21407A25DA214 +0FA25DA2141FA25DA2143FA25DA2147FA292C9FCA25CA25CA21301A25CA21303A25CEB0F +FC003FB6FC5AA237397EB831>84 D<267FFFFC91383FFFC0B55DA2000390C83807FC006C +48ED03E06060000094C7FC5F17065FA25F6D5DA26D5D17E05F4C5AA24CC8FC6E1306A201 +3F5C161C16185EA25E6E5BA2011F495A150393C9FC1506A25D6E5AA2010F5B157015605D +A2ECE18002E3CAFC14F3EB07F614FE5C5CA25C5CA26D5AA25C91CBFC3A3B7CB830>86 +D<147E903803FF8090390FC1C38090391F00EFC0017E137F49133F485A4848EB1F801207 +5B000F143F48481400A2485A5D007F147E90C7FCA215FE485C5AA214015D48150CA21403 +EDF01C16181407007C1538007E010F1330003E131F027B13706C01E113E03A0F83C0F9C0 +3A03FF007F80D800FCEB1F0026267DA42C>97 D<EC3FC0903801FFF0903807E03C90380F +800E90383F0007017E131F49137F484813FF485A485A120F4913FE001F143848481300A2 +127F90C8FCA35A5AA45AA315031507007E1406150E003E143C003F14706C14E0390F8007 +C03907C03F003801FFF838003FC020267DA424>99 D<EC3FC0903801FFF0903807E07890 +381F801C90387E001E49130E485A485A1207485A49131E001F141C153C484813F8EC03E0 +007FEB3FC09038FFFE0014E090C8FC5A5AA7007E140315071506003E140E153C6C14706C +6C13E0EC07C03903E03F003801FFF838003FC020267DA427>101 +D<D803E0137F3A07F801FFE03A0E3C0781F03A1C3E1E00F826383F387F00305B4A137C00 +705B00605BA200E090C712FC485A137EA20000140101FE5C5BA2150300015D5B15075E12 +0349010F133016C0031F13700007ED80605B17E0EE00C0000F15014915801603EE070000 +1FEC0F0E49EB07FC0007C7EA01F02C267EA432>110 D<3903E001F83907F807FE390E3C +1E07391C3E381F3A183F703F800038EBE07F0030EBC0FF00705B00601500EC007E153CD8 +E07F90C7FCEAC07EA2120013FE5BA312015BA312035BA312075BA3120F5BA3121F5B0007 +C9FC21267EA425>114 D<14FF010313C090380F80F090383E00380178131C153C4913FC +0001130113E0A33903F000F06D13007F3801FFE014FC14FF6C14806D13C0011F13E01303 +9038003FF014071403001E1301127FA24814E0A348EB03C012F800E0EB07800070EB0F00 +6C133E001E13F83807FFE0000190C7FC1E267CA427>I<EB01C0497E1307A4130F5CA313 +1F5CA3133F91C7FC007FB51280A2B6FCD8007EC7FCA313FE5BA312015BA312035BA31207 +5BA3120FEBC006A2140E001F130CEB801C141814385C146014E0380F81C038078780D803 +FEC7FCEA00F819357EB31E>I<01F816F0D803FE9138E001F8D8070F903801F003000ED9 +800314FC121C12180038020713010030EDE000D8701F167C1260030F143CD8E03F163800 +C001005B5BD8007E131F183001FE5C5B033F1470000117604991C7FCA218E000034A14C0 +49137E17011880170318005F03FE1306170E000101015C01F801BF5B3B00FC039F807090 +3A7E0F0FC0E0903A1FFC03FFC0902703F0007FC7FC36267EA43B>119 +D<903907E001F090391FF807FC9039783E0E0F9039E01F1C1FD801C09038383F803A0380 +0FF07F0100EBE0FF5A000E4A1300000C157E021F133C001C4AC7FC1218A2C7123FA292C8 +FCA25CA2147EA214FEA24A130CA20101141C001E1518003F5BD87F81143801835C00FF15 +60010714E03AFE0E7C01C0D87C1C495A2778383E0FC7FC391FF00FFC3907C003F029267E +A42F>I<13F8D803FE1470D8070F14F8000EEB8001121C121800381403003015F0EA701F +1260013F130700E0010013E012C05BD8007E130F16C013FE5B151F000115805BA2153F00 +0315005BA25D157EA315FE5D1401000113033800F80790387C1FF8EB3FF9EB0FE1EB0003 +5DA2000E1307D83F805B007F495AA24A5A92C7FCEB003E007C5B00705B6C485A381E07C0 +6CB4C8FCEA01FC25367EA429>I<D901E01360D90FF813E0496C13C090383FFE0190397F +FF038090B5EA07009038F81FFF3901E003FE9038C0001C495B5DC85A4A5A4A5A4AC7FC14 +0E5C5C14F0495AEB038049C8FC130E5B4913035B495B484813064848130E48C75AD80FFC +137C391FFF81F8381E0FFFD838075B486C5B00605CD8E00190C7FC38C0007C23267DA427 +>I E +%EndDVIPSBitmapFont +%DVIPSBitmapFont: Ft cmbx12 12 28 +/Ft 28 122 df<ED0FFF4AB512C0020F14F0027F80903A01FFF803FC499038C000FE010F +EB00034948497E49485B5C495A4C138001FF6E13005CA3705AEE01F893C8FCA74BB51280 +B9FCA5C69038E00003B3B0007FD9FFC1B6FCA538467EC53E>12 D<DCFFF01470031F01FF +14F04AB6EAE0010207EDF803023FEDFE0791B539E001FF0F4949C7EA3F9F010701F0EC0F +FF4901C0804990C87E4948814948814948167F4849163F4849161F5A4A160F485B190748 +90CAFC19035A5BA2007F1801A34994C7FC12FFAE127F7F1AF0A2123FA27F6C18011AE06C +7F19036C6D17C06E16077E6C6DEE0F806C6DEE1F006D6C5E6D6C167E6D6C6C5D6D6D4A5A +6D01F0EC07F0010101FEEC1FE06D903AFFF001FF80023F90B6C7FC020715FC020115F0DA +001F1480030001F8C8FC44467AC451>67 D<B9FC18F018FE727E19E026003FFEC7001F13 +F805017F9438003FFF060F7F727F727F727F84737E737EA2737EA2737EA21B80A2851BC0 +A51BE0AD1BC0A51B8061A21B006162193F624F5A19FF624E5B06075B4E5B063F90C7FC4D +B45A050F13F8BA5A19C04EC8FC18F095C9FC4B447CC356>I<DCFFF01470031F01FF14F0 +4AB6EAE0010207EDF803023FEDFE0791B539E001FF0F4949C7EA3F9F010701F0EC0FFF49 +01C0804990C87E4948814948814948167F4849163F4849161F5A4A160F485B19074890CA +FC19035A5BA2007F1801A34994C8FC12FFAD057FB612F0127F7FA3003FDC0001EBF000A2 +7F7EA26C7FA26C7F807E6C7F6C7F6D7E6D6C5D6D6C7E6D6D5C6D01F05C010101FE143F6D +903AFFF001FF9F023F90B6120F0207EDFC030201EDF000DA001F02C01330030001FCC9FC +4C467AC458>71 D<B712E0A5D8001F90C7FCB3B3B3A4B712E0A523447DC32A>73 +D<B500FE067FB512806E95B6FCA26F5EA2D8003F50C7FC013D6DEE03DFA2013C6DEE079F +A26E6CEE0F1FA26E6C161EA26E6C163CA36E6C1678A26E6C16F0A26E6DEC01E0A26E6DEC +03C0A36E6DEC0780A26F6CEC0F00A26F6C141EA26F6C5CA36F6C5CA26F6C5CA26F6D485A +A26F6D485AA26F6D485AA3706C48C7FCA293383FF81EA2706C5AA2706C5AA3706C5AA270 +5BA2705BA2705BA2B6057FB6128071C7FCA2173E171C61447CC36A>77 +D<B64BB512FE8181A281D8003F6D91C7EA780081013D7F81133C6E7E6E7F6E7F6E7F6E7F +82806E7F6E7F6F7E6F7F83816F7F6F7F6F7F6F7F6F7F8382707F707F707F707F8482707F +707F717E7113807113C019E0837113F07113F87113FC7113FE19FF847213F884848484A2 +8484197F193F191FA2190F1907B61603190119001A78A24F447CC358>I<B812F8EFFFC0 +18F818FE727ED8001F90C7003F13E005037F05007F727E727E727EA28684A286A762A24E +90C7FCA24E5A61187F943801FFF005075B053F138092B7C8FC18F818E018F892C77FEF3F +FF050F7F717F717FA2717FA2717FA785A61B0F85A2187F73131F72141EB700E06DEB803E +72EBE0FC72EBFFF8060114F0726C13E0CC0007138050457DC354>82 +D<903801FFE0011F13FE017F6D7E48B612E03A03FE007FF84848EB1FFC6D6D7E486C6D7E +A26F7FA36F7F6C5A6C5AEA00F090C7FCA40203B5FC91B6FC1307013F13F19038FFFC0100 +0313E0000F1380381FFE00485A5B127F5B12FF5BA35DA26D5B6C6C5B4B13F0D83FFE013E +EBFFC03A1FFF80FC7F0007EBFFF86CECE01FC66CEB8007D90FFCC9FC322F7DAD36>97 +D<EC3FFC49B512C0010F14F0013F14FC90397FF003FE9039FFC001FF0003495A48494813 +805B120F485AA2485A6F1300007F6E5AED00784991C7FCA212FFAC6C7EA3123F6DEC03C0 +A26C6C1407000F16806D140F6C6DEB1F006C6D133E6C01F05B3A007FFC03F86DB55A010F +14C0010391C7FC9038003FF82A2F7CAD32>99 D<EE03FEED07FFA5ED001F160FB1EC3FE0 +903803FFFC010FEBFF8F013F14CF9039FFF807FF48EBC00148903880007F4890C7123F48 +48141F49140F121F485AA3127F5BA212FFAC127FA37F123FA26C6C141FA26C6C143F0007 +157F6C6C91B5FC6CD9C00314FC6C9038F01FEF6DB5128F011FEBFE0F010713F89026007F +C0EBF80036467CC43E>I<EC3FF80103B57E010F14E0013F8090397FF83FF89039FFC007 +FC48496C7E48496C7E48486D1380485A001FED7FC05B003FED3FE0A2127F5B17F0161F12 +FFA290B7FCA401F0C9FCA5127FA27FA2123F17F06C7E16016C6C15E06C6C14036C6DEB07 +C06C6DEB0F806C01F0EB3F0090397FFE01FE011FB55A010714F0010114C09026001FFEC7 +FC2C2F7DAD33>I<EDFF80020F13E0027F13F049B512F849EB8FFC90390FFE0FFE90381F +FC1F14F8133FEB7FF0A2ED0FFCEBFFE0ED03F0ED00C01600ABB612F8A5C601E0C7FCB3B0 +007FEBFFE0A527467DC522>I<DAFFE0137E010F9039FE03FF80013FEBFF8F90B812C048 +D9C07F133F489038001FF84848EB0FFC4848903907FE1F80001F9238FF0F00496D90C7FC +A2003F82A8001F93C7FCA26D5B000F5D6C6C495A6C6C495A6C9038C07FF04890B55A1680 +D8078F49C8FC018013E0000F90CAFCA47F7F7F90B612C016FC6CEDFF8017E06C826C16FC +7E000382000F82D81FF0C77ED83FC014074848020113808248C9FC177FA46D15FF007F17 +006D5C6C6C4A5A6C6C4A5AD80FFEEC3FF83B07FFC001FFF0000190B612C06C6C92C7FC01 +0F14F8D9007F90C8FC32427DAC38>I<EB7FC0B5FCA512037EB1ED07FE92383FFF8092B5 +12E002C114F89139C7F03FFC9138CF801F9139DF000FFE14DE14FC4A6D7E5CA25CA35CB3 +A7B60083B512FEA537457CC43E>I<137C48B4FC4813804813C0A24813E0A56C13C0A26C +13806C1300EA007C90C7FCAAEB7FC0EA7FFFA512037EB3AFB6FCA518467CC520>I<EB7F +C0B5FCA512037EB293387FFFE0A593380FE0004C5A4CC7FC167E5EED03F8ED07E04B5A4B +5A037FC8FC15FEECC1FCECC3FE14C7ECDFFF91B57E82A202F97F02E17F02C07FEC807F6F +7E826F7E816F7F836F7F816F7F83707E163FB60003B512F8A535457DC43B>107 +D<EB7FC0B5FCA512037EB3B3B3A3B61280A519457CC420>I<90277F8007FEEC0FFCB590 +263FFFC090387FFF8092B5D8F001B512E002816E4880913D87F01FFC0FE03FF8913D8FC0 +0FFE1F801FFC0003D99F009026FF3E007F6C019E6D013C130F02BC5D02F86D496D7EA24A +5D4A5DA34A5DB3A7B60081B60003B512FEA5572D7CAC5E>I<90397F8007FEB590383FFF +8092B512E0028114F8913987F03FFC91388F801F000390399F000FFE6C139E14BC02F86D +7E5CA25CA35CB3A7B60083B512FEA5372D7CAC3E>I<EC1FFC49B512C0010714F0011F14 +FC90397FF80FFF9026FFC0017F48496C7F4848C7EA3FE000078248486E7E49140F001F82 +A2003F82491407007F82A400FF1780AA007F1700A46C6C4A5AA2001F5E6D141F000F5E6C +6C4A5AA26C6C6CEBFFE06C6D485B27007FF80F90C7FC6DB55A010F14F8010114C0902600 +1FFCC8FC312F7DAD38>I<90397FC00FF8B590B57E02C314E002CF14F89139DFC03FFC91 +39FF001FFE000301FCEB07FF6C496D13804A15C04A6D13E05C7013F0A2EF7FF8A4EF3FFC +ACEF7FF8A318F017FFA24C13E06E15C06E5B6E4913806E4913006E495A9139DFC07FFC02 +CFB512F002C314C002C091C7FCED1FF092C9FCADB67EA536407DAC3E>I<90387F807FB5 +3881FFE0028313F0028F13F8ED8FFC91389F1FFE000313BE6C13BC14F8A214F0ED0FFC91 +38E007F8ED01E092C7FCA35CB3A5B612E0A5272D7DAC2E>114 D<90391FFC038090B512 +87000314FF120F381FF003383FC00049133F48C7121F127E00FE140FA215077EA27F01E0 +90C7FC13FE387FFFF014FF6C14C015F06C14FC6C800003806C15806C7E010F14C0EB003F +020313E0140000F0143FA26C141F150FA27EA26C15C06C141FA26DEB3F8001E0EB7F0090 +38F803FE90B55A00FC5CD8F03F13E026E007FEC7FC232F7CAD2C>I<EB01E0A51303A413 +07A2130FA2131FA2133F137F13FF1203000F90B51280B7FCA4C601E0C7FCB3A3ED01E0A9 +150302F013C0137F150790393FF80F8090391FFC1F006DB5FC6D13FC01015B9038003FE0 +23407EBE2C>I<D97FC049B4FCB50103B5FCA50003EC000F6C81B3A85EA25EA25E7E6E49 +1380017FD901F713FE9138F807E76DB512C7010F1407010313FE9026007FF0EBFC00372E +7CAC3E>I<B6903803FFFCA5000101E09038003E006C163C80017F5D8017F8013F5D6E13 +01011F5D6E1303010F5D6E13076D5DED800F6D92C7FC15C05E6DEBE01E163E6D143CEDF0 +7C027F1378EDF8F8023F5B15FD021F5B15FF6E5BA36E5BA26E90C8FCA26E5AA26E5AA215 +78362C7EAB3B>I<B6903803FFFCA5000101E09038003E006C163C80017F5D8017F8013F +5D6E1301011F5D6E1303010F5D6E13076D5DED800F6D92C7FC15C05E6DEBE01E163E6D14 +3CEDF07C027F1378EDF8F8023F5B15FD021F5B15FF6E5BA36E5BA26E90C8FCA26E5AA26E +5AA21578A215F85D14015D001F1303D83F805B387FC007D8FFE05B140F92C9FC5C143E49 +5A387FC1F8EB07F06CB45A6C5B000790CAFCEA01FC36407EAB3B>121 +D E +%EndDVIPSBitmapFont +%DVIPSBitmapFont: Fu cmbx8 8 37 +/Fu 37 123 df<91393FF803FE0103B5381FFF80010F91B512C090263FF01F131F903BFF +803FFC3FE048010013F85B000315F05B031FEB1FC0030FEB020094C7FCA5B812F0A42803 +FC000FF0C7FCB3A4263FFFC0B57EA4332E7FAD2F>11 D<EC1FF80103B5FC010F14809039 +3FF00FC0D9FF8013E048EB001F5B0003EC3FF049EB1FE0A3ED078092C7FCA3EDFFF0B7FC +A43903FC000FB3A4263FFFC0B5FCA4282E7FAD2D>I<91383FFCF00103B5FC130F90383F +F01F9038FF803F4813005B120349131F150FA7B7FCA43903FC000FB3A4263FFFC0B5FCA4 +282E7FAD2D>I<121FEA3F80EA7FC0EAFFE0A213F0A3127F123FEA1F70120013F013E0A2 +120113C01203EA0780A2EA0F00123E123C12180C187A8A17>44 D<B512F8A715077F921B +>I<121FEA3F80EA7FC0EAFFE0A5EA7FC0EA3F80EA1F000B0B7A8A17>I<150E151FA2153F +153E157E157CA215FC15F8140115F0140315E0A2140715C0140F1580141F1500A25C143E +147E147C14FC5C13015CA213035C13075C130F5CA2131F91C7FC5B133E137E137C13FC5B +A212015B12035B12075BA2120F5B121F90C8FC5A123EA2127E127C12FC5AA2127020437C +B129>I<15FCA24A7EA24A7EA34A7FA24A7FA34A7F157F023F7FEC3E3F027E7FEC7C1FA2 +02FC7FECF80F010180ECF007A20103804A7E0107814A7EA2010F6D7F5C49B67EA24981A2 +013EC7123F017E81017C141F01FC8149140FA2000182491407B5D8C001B512FCA4362F7D +AE3D>65 D<B812C0A40001D9800013E0161F160F16071603A21601A3031E13F01600A317 +00153E157E15FE14FFA41480157E153E151EA592C8FCA9B612C0A42C2E7DAD33>70 +D<B6FCA400011380B3B3A2B6FCA4182E7DAD1E>73 D<90391FF8038090B51207000314CF +4814FF381FF00FEBC001393F80007F48C7123F007E141FA200FE140FA215077E7F6D90C7 +FC13F06CB4FC14F0ECFF806C14E06C14F86C14FE6C806C1580C615C0131F010114E0EB00 +0F020013F0153F151F150F12F01507A37E16E06C140F6C15C06C141F01C0EB3F8001FCEB +FF0090B55A00F95CD8F03F13F0D8E003138024307CAE2D>83 D<003FB8FCA4287FE00FFC +0113800180EC007FD87E00151F007C160FA200781607A448EE03C0A4C792C7FCB3A6013F +B6FCA4322D7DAC39>I<EB7FF80003B5FC000F14C0391FE01FF09038F007F86E7EA26E7E +EA0FE0EA07C0C7FCA214FF133F48B5FC000713C1381FFC01EA3FE0EA7FC0EAFF801300A3 +140313806C6C487E263FF03F13F8381FFFFE0007EBF87FC6EBC01F251E7E9D28>97 +D<EA03F012FFA4120FABEC3FE09038F1FFFC01F713FFD9FFC013809039FE003FC049EB1F +E049EB0FF05B16F8150716FCA916F8A2150F16F06D131F6D14E06DEB3FC09039DF80FF80 +9039C7FFFE00018113F89038007FC0262E7DAD2D>I<EB0FFE90387FFFC048B512F03907 +FC07F8380FF00FEA1FE0123F13C0007FEB07F090388003E091C7FC12FFA8127F7FA26C6C +133CA26C6C137C6C6C13F83907FE03F00001B512E06C6C138090380FFC001E1E7D9D24> +I<ED0FC0EC03FFA4EC003FABEB0FF8EB7FFF48B6FC3807FC07380FF001391FE0007F003F +143F5B127F5BA212FFA9127F7F123F157F6C6C13FF380FF0032607FC0F13FC0001B512BF +6CEBFE3FEB1FF0262E7DAD2D>I<EB0FFC90387FFF8048B512E03907FC0FF0390FF003F8 +391FE001FC1400484813FE007F147E5B157F12FFA290B6FCA30180C7FCA3127F7FA2003F +140F6C7E6C6C131F6C6C137E3903FE01FC6CB512F86C6C13E001071300201E7E9D25>I< +ECFF80010713E0011F13F0EB7FC79038FF0FF8EA01FEA2EA03FCA2EC07F0EC00801500A5 +B512FCA4D803FCC7FCB3A4383FFFE0A41D2E7EAD19>I<ED07C090391FF81FF090B5EA7F +F8000314FD3907F81FF3380FE007001F14F99039C003F8F0003FECFC00A6001F5CEBE007 +000F5C3907F81FE090B55A4891C7FCEB1FF8001EC9FC121FA27F90B512C06C14F815FF6C +158016C04815E0123F48C7EA3FF000FE140F4814071503A36C1407007FEC0FE06C6CEB1F +C0D81FF0EBFF800007B5EAFE00000114F8D8001F1380252D7E9E29>I<EA03F012FFA412 +0FABEC1FF0EC7FFC01F1B5FCD9F7E013809038FF807FD9FE0013C049133FA25BA25BB0B5 +3803FFFCA4262E7CAD2D>I<EA07C0EA0FE0EA1FF0EA3FF8A5EA1FF0EA0FE0EA07C0C7FC +A6EA03F012FFA4120FB3A3B5FCA4102F7CAE17>I<EB01F0EB03F8EB07FCEB0FFEA5EB07 +FCEB03F8EB01F090C7FCA6147EEB3FFEA41301B3A9121C123E127FEAFF81EB83FCA2EB87 +F8387F0FF0383FFFE06C13803807FE00173C84AE19>I<EA03F012FFA4120FAB913803FF +F0A4913800FC00EC03F84A5AEC0FC0EC3F804AC7FC14FCEBF1F8EBF7FCEBFFFE80A2497F +9038F87FC0496C7E496C7E6E7EA26E7E6E7E6E7E6E138026FFFE0313FCA4262E7DAD2B> +I<EA03F012FFA4120FB3B3B5FCA4102E7CAD17>I<2707E00FF8EB1FF000FFD97FFEEBFF +FC01E1B5008313FF9028E7E07FCFC01380903BEF803FDF007F260FFE0013FC031FEC3FC0 +495C495CA2495CB0B53B01FFFE03FFFCA43E1E7C9D45>I<3907E01FF000FFEB7FFC01E1 +B5FCD9E7E013809038EF807F260FFE0013C049133FA25BA25BB0B53803FFFCA4261E7C9D +2D>I<EB07FE90387FFFE048B512F83903FC03FC3907F000FE4848137F4848EB3F80003F +15C049131F007F15E0A200FF15F0A8007F15E0A26D133F003F15C0001F15806D137F6C6C +EBFF003903FC03FC6CB55A6C6C13E0D907FEC7FC241E7E9D29>I<3903F03FE039FFF1FF +FC01F713FFD9FFC013809039FE007FC0D80FFCEB3FE049EB1FF05BED0FF8A216FC1507A8 +ED0FF8A3ED1FF07F6DEB3FE06DEB7FC09039FF81FF809039F7FFFE0001F113F89038F07F +C091C8FCA9B5FCA4262B7D9D2D>I<90390FF003C090387FFE0748B512873907FE07CF39 +0FF803FF48487E48487E157F4848133FA3485AA87F127FA26C6C137F15FF6C7E380FF803 +3807FC0F0001B512BF39007FFE3FEB1FF090C7FCA9913803FFFCA4262B7D9D2B>I<3807 +E07E39FFE1FF8001E313E0EBE78F9038EF1FF0EA0FFE13FCA29038F80FE0EC07C091C7FC +5BAFB57EA41C1E7D9D22>I<3801FF8E000713FE121FEA3F00007C137E0078133E00F813 +1EA27EB490C7FC13F0EBFF806C13E06C13F86C13FE7E00037FD8003F13801300143F00F0 +131F140F7EA26CEB1F007E38FF807EEBFFFC00FB13F000E01380191E7D9D20>I<133CA4 +137CA313FCA2120112031207001FB5FCB6FCA3D803FCC7FCAEEC03C0A61407D801FE1380 +EBFF0F6CEBFF00EB3FFCEB0FF01A2A7FA920>I<D803F0EB0FC000FFEB03FFA4000FEB00 +3FB1157FA215FF00075BD9F80713FC6CB512BFC6EBFE3FEB3FF0261E7C9D2D>I<B5EB3F +FCA4D80FF8EB07C0000715806D130F000315006D5B0001141E6D133E6C143CEC807C017F +1378ECC0F8013F5B14E1011F5B14F3010F5B14FF6D5BA26D90C7FCA26D5AA26D5AA21478 +261E7E9D2B>I<3CFFFE0FFFC03FFCA43C0FF000FE0003C06D017F130700074A1480EE80 +0F6C6C16005CD801FEECC01E5C01FF9038CFE03E6C163CDA0787137CD97F87EBF078148F +9139CF03F8F8D93FDF5C9138DE01FDD91FFE5CA26D486CB45AA24A137F01075D4A133F01 +0392C7FCA26D48131E361E7E9D3B>I<B5EB3FFCA4D80FF8EB07C0000715806D130F0003 +15006D5B0001141E6D133E6C143CEC807C017F1378ECC0F8013F5B14E1011F5B14F3010F +5B14FF6D5BA26D90C7FCA26D5AA26D5AA21478A25CA2EA3C01007E5BEAFF03495A5C011F +C8FCEA7A3EEA7FFC6C5AEA0FC0262B7E9D2B>121 D<003FB512FCA39038C00FF8903800 +1FF0003E133F48EB7FE0ECFFC049138000781400495A1307C6485A495A5C495A017F133C +EBFFC048138014004848137C1207485A484813F8485AEBE003387FC00FB6FCA31E1E7E9D +24>I E +%EndDVIPSBitmapFont +%DVIPSBitmapFont: Fv cmbxti10 8 21 +/Fv 21 120 df<120FEA3FC0127FA212FFA31380EA7F00123C0A0A788918>46 +D<1378EA01FE1203A21207A313FCEA03F8EA01E0C7FCAA120FEA3FC0127FA212FFA31380 +EA7F00123C0F1E789D18>58 D<90261FFFF090380FFFFCA281D9007F9138003E006F143C +A28102FF157CDAFBFF147814F302F17F010116F802F06D5B5C6F7E01031501DB3FF05B14 +C0ED1FF801071503DB0FFC5B1480ED07FE010F1507DB03FF5B14006F138749158F6F01CF +C7FC131EEE7FEF013E15FF705A133C161F137C705A1378160713F8705A5B00011501B512 +E0705A5C3E2E7CAD3C>78 D<EB03F0EB0FFE90383FFF709038FE0FF83801FC07EA03F838 +07F003120FEBE007121F01C05B123F140F127F01805BA2141F12FF01005BA291383FC7C0 +A248EC8780A2EC7F8F007E1500007FEBFF0F49131ED83F8713BE391FFF9FFC0007EB0FF8 +3901F803E02220799E27>97 D<137EEA1FFEA312015BA312035BA312075BA2EBF3F8380F +FFFE809038FC1F809038F80FC0D81FF013E013E013C0A2123F1380A2141F127F1300A214 +3F4814C05AA2EC7F80A24814005C5C6C485AEA7E035C383F0FE06CB45A6C90C7FCEA01F8 +1B2F79AD23>I<EB01FCEB0FFF013F13C0EB7F073901FE03E03803FC0F3807F81F13F0EA +0FE0001F14C0A2393FC00F0091C7FC127F5BA312FF90C8FCA54814C0007FEB01E0140314 +07393F801FC0391FC0FF006CB45A000313F8C613801B20799E23>I<ED0FC0EC03FFA3EC +003F1680A2157FA21600A25DA25DA2EB03F1EB0FFF013F5BEBFE0F3801FC07EA03F84848 +6C5A120FEBE007121F01C05B123F140F127F01805BA2141F12FF01005BA291383FC7C0A2 +48EC8780A2EC7F8F007E1500007FEBFF0F49131ED83F8713BE391FFF9FFC0007EB0FF839 +01F803E0222F79AD27>I<EB01FE90380FFF80013F13C090387F07E03901FE03F03803F8 +011207EA0FF0EBE003001F14E0EBC007003FEB0FC0143F397FC3FF00EBFFFE14F049C7FC +EAFF8090C8FCA515C06CEB01E014031407393F801FC0391FC0FF006CB45A000313F8C613 +801C20799E23>I<EB1F80EA07FFA3EA007F91C8FCA25BA25BA21201A25BA20003EB3F80 +ECFFE001FB13F89038FFC1FC481301EBFE005B5B380FF001A213E0A2001F13035D13C0A2 +003F13075D1380140F007FECE1F0141F0100EBC1E0A248ECC3C0EC3F8348EC8780EC1F8F +ED9F0048EB0FFE6E5A0070EB01F0242F7BAD27>104 D<EB01C0EB07E0EB0FF0A314E014 +C0EB078090C7FCA813F8EA03FEEA0FFFEB1F80121EEA3C3FA21278137F00F8130012F05B +C65AA212015B12035BA21207EBF0F8120FEBE0F0A2EBE1E0EA1FC1EBC3C0EA0FC7EBCF80 +3807FF006C5AEA00F815307BAE18>I<15F0EC01F814031407A3EC03F0EC01C091C7FCA8 +147CEB03FF49138090380F8FC090381E0FE0133C137C13F8EBF01F120101E013C0A2C7FC +143F1580A2147FA21500A25CA25CA21301A25CA21303A25CA21307A25C121CEA7F0F00FF +5B495A133F5C48B4C7FCEAFFFCEA7FF0EA1F801D3D82AE18>I<133FEA0FFFA3C6FC13FE +A21201A213FCA21203A213F8A21207A213F0A2120FA213E0A2121FA213C0A2123FA21380 +A2127FA21300A2EAFF1FA2EAFE1EA2133E133C12FC1378EAFEF8EA7FF0EA3FE0EA0F8010 +2F7AAD14>108 D<2703E001FCEB3F80270FF80FFFEBFFE0261FFC3F01C313F83C1E7E7C +1FCFC1FC3B3C7FF00FFF0102E0EBFE000078496C5A02805B01FF90380FF00100F8130048 +4814E0A20001021F1303604914C0A20003023F130760491480170F0007027FECE1F0171F +490200EBC1E0A2000F4AECC3C0EF3F834949EC8780EF1F8FF09F004949EB0FFE715A6CC7 +0070EB01F03C207B9E3F>I<3903E003F8390FF80FFE3A1FFC3FFF803A1E7EFC1FC0383C +7FF0ECE00F007813C014809038FF001F12F8485AA20001143F16805BA20003147F16005B +5D0007ECFE1F140101F0EBFC1EA2000F153CEC03F801E01478020113F8EDF9F09039C000 +FFE0ED7FC06CC7EA1F0028207B9E2B>I<EB01FE90380FFFC0013F13F090387F03F83901 +FE01FCEA03FC3907F800FE5B485A121FA2485A1401127F1380A2140300FF14FC1300A2EC +07F8A215F048130F007FEB1FE015C0EC3F80393F807F00381FC1FE380FFFF8000313E0C6 +90C7FC1F20799E27>I<013E13FE9039FF83FF804801CF13C09039E7FF07E03A03C7FE03 +F002FC13F8380787F814F0138F120FEB0FE0A2D8001F1307A214C0A2013F130F16F01480 +A2017FEB1FE0A2020013C0153F491480ED7F005D6E5A48EBC3F8ECFFF001FD13C0D9FC7E +C7FC000390C8FCA25BA21207A25BA2120FEA7FFFB5FCA2252C7F9E27>I<3903E00FC039 +07F83FF0391FFCFFF8391E7FF07C003CEBE03EECC0FE00781381140113FF00F814FCEAF0 +FEEC00F000011400A25BA21203A25BA21207A25BA2120FA25BA35BA26CC8FC1F207B9E21 +>114 D<EB07F0EB1FFCEB7FFFEBFC1F3901F80F80EBF01F3803E03FA212071500EBF01E +6DC7FCEBFFC06C13F0806C7F6C7F133F1303EB007F123E007F133E5AA2147E48137C4813 +FC48485A387E03F06CB45A6C1380D803FCC7FC19207A9E20>I<130FEB1F80133FA2137F +A21400A25BA25BA21201B512F8A33803FC00A25BA21207A25BA2120FA25BA2121FA25BA2 +003F137CA2EB807814F814F0EB81E01303EB07C0EB8F80381FFF00EA0FFCEA03F0162C7A +AA1A>I<13F8D803FE1307D80FFFEB1FC0EB1F80001E143FD83C3F1480A21278017F137F +00F80100130012F05BC6485B5D12015B140100035C13F8A20203137C000714F801F01478 +A216F8020713F00003EB0FF09039F81FF1E03901FC3FFB9039FFFDFFC026007FF0138090 +391FC03E0026207B9E29>I<01F81570D803FE90380E01FCD80FFFEB3F83261F3F8014FE +D81E1F137FD83C3F1403127C00781501017FEBFF0000F84948137C12F05B3800FE014B13 +78120113FC020314F8000316F001F85BA216010007010714E001F013F0EE03C0A20003ED +07809038F80FF8021FEB0F003A01FC3FFC1E3A00FFFCFFFC90393FF83FF890390FE00FE0 +2F207B9E33>119 D E +%EndDVIPSBitmapFont +%DVIPSBitmapFont: Fw cmti12 12 33 +/Fw 33 122 df<DDFF80EB07FF040701E0013FEBE0FC93261F80F89038FE01F8933C7E00 +3C03F0003D4C90267C07E0EB7DF84B489026FE0FC013FF922603F00149485A05034A5ADB +07E04A15F0F0FC3E942601F87EEB01FB92270FC000F0EC00F7DE00FEEC07E061151F4C17 +0F060116C061153F93C7161F1D801803611C3F4B1900157E180791BCFC64A2DA00FCC7D8 +07E0C7127E060F15FE646114014B170164181F61020318034B60A2183F96C71207020761 +5DA24E140F067E5D140F5D1B1F06FE5D60141F4B053F13E01C01050117C060A2023FF07F +0392C7047E138017034E15071D00027E183E1C0E0507ED1E1E4EEC1F1C02FEF007F84AF0 +01E04D4891C8FCA25C13014D5AA24A92CBFCD81C031338007FD9E0FE5B00FF01E1143E01 +075D14C102815CD8FE0F49485A00F8903901F003E03B701E00E007C0D8783CD9781FCCFC +D81FF8EB3FFCD807E0EB07F05E5A83C557>15 D<13F0EA03FC1207A2EA0FFEA4EA07FCEA +03CCEA000C131C1318A2133813301370136013E0EA01C013801203EA0700120E5A5A5A5A +5A0F1D7A891E>44 D<16C01501A215031507ED0F80151F153F157F913801FF005C140F14 +7F903807FCFEEB0FF0EB0700EB00015DA314035DA314075DA3140F5DA3141F5DA3143F5D +A3147F92C7FCA35C5CA313015CA313035CA313075CA2130FA2131F133FB612FCA25D2242 +76C132>49 D<ED3FC0913801FFF0913807C07C4AC67E021CEB1F800278130F4AEB07C049 +4814E04A1303494814F0130749C7FCEB0E06D91E0714F8EB1C03133C1338137813704A13 +07D9F00614F013E0140E020C130F0001011C14E0EBC0180238131F4A14C06C6C48EB3F80 +D9E1C0137FD97F801400013EC712FE90C7485A4B5A4B5A4B5AED1F804BC7FC15FC4A5AEC +03E0EC0FC0023FC8FC147CEB01F0495AEB0780011FC9FC133E49EC03805B491407484815 +00485A48485C90C8121E5A001E5D001C157CD83FFC5C9038FFC0013A7C0FFC07F0D87803 +B55AEA700126F0007F5B486D90C7FCEC0FFEEC03F82D4478C132>I<ED1FE0EDFFFC9138 +03E03F91390F000F80023EEB07C00278EB03E05C4948EB01F0495A495A91C713F85BEB0E +0CEB1E0EEB1C061603013C15F01338A2020E1307020C14E0141CD91C78EB0FC0D90FE013 +1F6D48148090C8EA3F00167E5E4B5A4B5AED0FE091383FFF804A48C7FC15F8EC007E151F +6F7E6F7E82150382A482A34B5A121FEA7F80A2150F48C75BA2484A5A12F800E04A5AA24B +C7FC007014FE5D0078495A0038495A003CEB0FC06C495A260780FEC8FC3803FFF038007F +802D4477C132>I<ED03FCED1FFF037F13C0913801FE07913903F001E091380FE0009138 +1F800391383F000F027E131F5C495A495A010715C04948EB07004A90C7FC131F495AA249 +C9FCA213FE1201A2485AEC07F09038F83FFC0007EB781F9039F9E00F803A0FFB8007C0EB +F70001FE80491303001F815B5B82485AA3491307127F5BA2150F5E90C7FCA2151F485DA2 +5A4B5AA2007E5D157F93C7FC5D5D4A5A003E495A003F5C4A5A6C6C485A000FEB3F80D9C0 +FEC8FC3803FFFC6C13F038007F802B4475C132>54 D<ED1FE0EDFFFC020313FF913907E0 +3F8091391F800FC091393E0007E04A13034A14F049481301495AA2495AA2495AA2160301 +1F15E0A216076E14C0EE0F806E131F6EEB3F006E133E6D6C5B02FF13F0ED83E06DEBC7C0 +6D01FFC7FC6D13FC6D5B6E7E6E7E91B57ED901EF7FD907837FEB1F01D93E007F496D7E49 +133F4848131F4848130F48486D7E48481303001F140190C7FC5A003E1400007E5D127CA2 +150100FC5D5A4B5AA24B5A127C4B5A4BC7FC6C143E003F5C6C495A390FC003F03907F01F +C06CB5C8FCC613FCEB1FE02C4477C132>56 D<ED3FC0EDFFF0020313FC91380FE07E9138 +3F803F4A487E02FC14800101140F494814C0495A495AA2495A133F4A14E0137FA249C7FC +161FA24816C05BA2163F12035BA2167F17804914FFA34B130012015D5D00005D6D130F01 +7C131D153B6DEBF3FC90381F03C3903907FF83F8903801FC0790C7FC5E150F5E151F5E4B +5AA24BC7FCA2001C14FE007F5C48495A4A5A14074A5A485C00F8013FC8FC48137E5C387C +07F0383FFFE06C1380D803FCC9FC2B4476C132>I<EF03801707A24D7EA2171FA2173F17 +7FA217FFA25EA2EE03BF1607173F160F160E161C841638171F167016F016E0ED01C0A2ED +0380A2ED0700A2150E151E151C5D845D170F5D14015D14035D4AC7FC92B6FC5CA2021CC7 +120F143C14385CA24A81A249481407A2495A130791C8FC130E131EA25B137C13FC00014C +7ED807FE151FB500E00107B512F8A219F03D477BC648>65 D<DC0FF8130393B513070307 +ECC00F923A1FF803E01F923A7FC000F81E4BC7EA7C3EDA03FCEC3C7EDA0FF0EC1EFE4A48 +EC0FFC4A4814074AC8FC02FE1503494816F8130349481501495A494816F0495A137F5C01 +FF17E04890C9FCA2485A19C0485AA2485A95C7FC121F5BA2123F5BA3127F5BA4485AA418 +38A218781870A218F0007F5F1701601703003F5F17076D4BC7FC001F160E171E6C6C5D6D +5D00075E6C6C4A5A6DEC07C06C6C4A5AD8007F023EC8FCD93FC013FC90391FF807F00107 +B512C0010191C9FC9038001FF0404872C546>67 D<91B6D8803FB512E0A302010180C738 +7FE0006E90C86C5A4A167FA24B5EA219FF14034B93C7FCA26014074B5DA21803140F4B5D +A21807141F4B5DA2180F143F4B5DA2181F147F92B75AA3DAFF80C7123F92C85BA2187F5B +4A5EA218FF13034A93C8FCA25F13074A5DA21703130F4A5DA21707131F4A5DA2170F133F +4A5DA2017F151FA24A5D496C4A7EB6D8803FB512E0A34B447AC348>72 +D<91B612F0A25F020101C0C7FC6E5B4A90C8FCA25DA314035DA314075DA3140F5DA3141F +5DA3143F5DA3147F5DA314FF92C9FCA35B5CA3010316104A1538A21878010716705C18F0 +18E0010F15015C18C01703011F15074A1580170FA2013FED1F004A5C5F017F15FE16034A +130F01FFEC7FFCB8FCA25F35447AC33D>76 D<91B56C49B512E0A28202009239000FFC00 +F107F0706E5A4A5F15DF705D1907EC03CFDB8FF892C7FCA203875D02077F0303150EA270 +141EEC0F01020E161C826F153C141E021C6E1338167F1978023C800238013F1470A27113 +F00278131F02705E83040F130102F014F84A5E1607EFFC0313014A01035C17FE18070103 +14014A02FF90C8FCA2705B0107168F91C8138E177F18DE5B010EED3FDC18FCA2011E151F +011C5EA2170F133C01386F5A1378A201F81503486C5EEA07FEB500F01401A2604B447AC3 +48>78 D<91B77E18F818FE020190398001FF806E90C7EA3FC04AED1FE0F00FF04BEC07F8 +180319FC14034B15FEA314075DA3020FED07FC5DA2F00FF8141F4B15F0F01FE0F03FC002 +3F16804BEC7F0018FEEF03F8027F4A5A4BEB1FC04CB4C7FC92B512F891B612E092380003 +F8EE00FE177F496F7E4A6E7EA28413034A140FA2171F13075CA2173F130F5CA24D5A131F +5CA3013F170E5CA2017FEE801E191C4A163C496C1638B66C90383FC070051F13F094380F +E1E0CA3803FF80943800FE003F467AC347>82 D<DB03FE130C92390FFF801C037FEBE03C +9238FE03F8913A03F0007C7C4A48EB3EF84A48131F4A48130F4AC7FC027EEC07F05C1703 +495A18E0495AA213074A15C0A3130F1880A28094C7FCA280806D7EECFFE015FC6DEBFF80 +6D14F016FC6D14FF023F80020F801403DA003F7F150703007F163F161F160FA21607A312 +0716031607A2485EA2120E160F001E5EA2001F4B5AA2484BC7FC6D143E167E6D5C007F4A +5A6D495AD87CF0495AD8787CEB1F8027F03F807FC8FC90381FFFFCD8E00713F039C0007F +80364879C537>I<48B912F85AA2913B0007FC001FF0D807F84A130701E0010F14034916 +0148485C90C71500A2001E021F15E05E121C123C0038143F4C1301007818C0127000F014 +7F485DA3C800FF91C7FC93C9FCA35C5DA314035DA314075DA3140F5DA3141F5DA3143F5D +A3147F5DA314FF92CAFCA35B5CA21303A21307497E007FB612C0A25E3D446FC346>I<B6 +913807FFFEA25C000301C0020013E06C90C9EA7F00183E183C60A26C1770601701604D5A +A24DC7FC5F170E6E5CA2017F5D177817705FA24C5AA24C5A16076E91C8FC160E133F5E16 +3C16385EA25E15015E6E485AA24BC9FC131F150E151E151C5DA25D15F05DECF1C0A29038 +0FF38014F792CAFC14FEA25CA25C5CA25C13075CA25C91CBFC3F466CC348>86 +D<EC1F80EC7FE0903901F07070903907C039F890380F801D90381F001F013E6D5A137E5B +484813075E485A120749130F000F5DA2485A151F003F5D5BA2153F007F92C7FC90C7FCA2 +5D157E12FEA29238FE0380EDFC071700A2007E13015E913803F80E1407003E010F131E16 +1C6C131C02385B3A0F80F078783A07C3E07C703A01FF801FE03A007E000780292D76AB32 +>97 D<EC0FE0EC7FF8903801F81E903807E00F90390F80078090381F0003017E14C04913 +1F0001143F5B4848EB7F801207485AED3E00484890C7FCA2485AA2127F90C9FCA35A5AA4 +5AA5ED0180ED03C0ED0780A2007CEC0F00007E141E003E147C15F06CEB03E0390F800F80 +2607C07EC7FC3801FFF838007FC0222D75AB2D>99 D<EC0FE0EC7FF8903801F83E903807 +C00F90391F800780EB3F00017E14C0491303485A48481307000715805B000F140F484814 +005D4848133E15FCEC07F0007FEBFFC0D9FFFEC7FC14C090C9FC5A5AA55AA4ED0180ED03 +C0007CEC0780A2007EEC0F00003E141E157C6C14F06CEB03E03907800F802603C07EC7FC +3801FFF838003FC0222D75AB2D>101 D<15FCEC03FF91390F83838091393E01CFC09138 +7C00EF4A13FF4948137F010315804948133F495A131F4A1400133F91C75A5B167E13FE16 +FE1201495CA215011203495CA21503A2495CA21507A25EA2150F151F5E0001143F157F6C +6C13FF913801DF8090387C039F90383E0F3FEB0FFCD903F090C7FC90C7FC5DA2157EA215 +FEA25DA2001C495A127F48495A14074A5A485C023FC8FC00F8137E387C01F8381FFFE000 +0390C9FC2A407BAB2D>103 D<14FE137FA3EB01FC13001301A25CA21303A25CA21307A2 +5CA2130FA25CA2131FA25C157F90393F83FFC091388F81F091381E00F802387F4948137C +5C4A137EA2495A91C7FCA25B484814FE5E5BA2000314015E5BA2000714035E5B1507000F +5DA249130F5E001F1678031F1370491480A2003F023F13F0EE00E090C7FC160148023E13 +C01603007E1680EE070000FEEC1E0FED1F1E48EC0FF80038EC03E02D467AC432>I<143C +147E14FE1301A3EB00FC14701400AE137C48B4FC3803C780380703C0000F13E0120E121C +13071238A21278EA700F14C0131F00F0138012E0EA003F1400A25B137EA213FE5B12015B +A212035B141E0007131C13E0A2000F133CEBC038A21478EB807014F014E0EB81C0EA0783 +EBC7803803FE00EA00F8174378C11E>I<EB03F8EA01FFA3380007F013031307A214E0A2 +130FA214C0A2131FA21480A2133FA21400A25BA2137EA213FEA25BA21201A25BA21203A2 +5BA21207A25BA2120FA25BA2121FA25BA2123FA290C7FCA2387F01C01303007E1380A213 +0700FE130012FCA25B130EEA7C1E131CEA3C3CEA3E786C5AEA07C0154678C419>108 +D<D801F0D90FE0EB07F0D803FCD97FF8EB3FFC28071E01F03EEBF81F3E0E1F03C01F01E0 +0F80271E0F8700D983807F001C018E90390F870007003C019C148E003801B802DC8002F8 +14FC26781FF05C0070495CA24A5C00F0494948130FD8E03F6091C75B1200043F141F4960 +017E92C7FCA24C143F01FE95C7FC49147E6104FE147E1201494A14FE610301EE07800003 +05011400494A14F8A2030302035B0007F0F00E495C1A1E0307EDE01C000F193C494A1538 +62030F020113F0001FF0F1E0494A903800FF800007C7D80380023EC7FC492D78AB50>I< +D801F0EB0FE0D803FCEB7FF83A071E01F03E3A0E0F03C01F001ED987001380001C018E13 +0F003C139C003801B814C014F838781FF000705BA25C00F049131FD8E03F158091C7FC12 +00163F491500137EA25E01FE147E5B16FE5E12014913015E170F00030203130E4914F0A2 +0307131E0007EDE01C5B173CEEC038000F167849157017E0ED03C1001FEDE3C049903801 +FF000007C8127C302D78AB37>I<EC0FE0EC7FFC903801F83E903907E00F8090390F8007 +C0EB1F00017EEB03E04914F0A248481301484814F81207485AA2485AA2485A1503127F90 +C7FCA215074815F05AA2150F16E05AED1FC0A21680153F16005D157E5D007C495A007E49 +5A003E5C4A5A6CEB1F80260F803EC7FC3807C0FC3801FFF038003F80252D75AB32>I<D9 +03E0137E903A07F801FF80903A0E3C0783E0903A1C1E0F01F0903A3C1F1C00F801385B01 +7849137C01705BA24A48137E01E05BA292C7FC00015B13C0147EC7FC02FE14FEA25CA201 +01140117FC5CA20103140317F85CA20107EC07F0A24AEB0FE0A2010F15C0EE1F80163F17 +00496C137E5E4B5A9138B803F090393F9C07E091389E0F80DA07FEC7FCEC01F849C9FCA2 +137EA213FEA25BA21201A25BA21203A21207B512F0A25C2F3F7FAB32>I<D801F0EB3F80 +3A03FC01FFF03A071E03C0F83A0E0F0F007C001E90389E01FC001C139CECB803003813F0 +A2D91FE013F80078EC00E00070491300A200F05BEAE03F91C8FC1200A25B137EA313FE5B +A312015BA312035BA312075BA3120F5BA3121F5B0007C9FC262D78AB29>114 +D<EC0FE0EC7FF8903801F01E903803C00F90390780078090380F0003011E14C015074913 +1FA2017CEB3F801378137CED0E0092C7FC137E137F14F014FF6D13C06D13F06D7F6D7F13 +00EC0FFE14011400157F81120E003F141E487EA2153E48C7123CA200FC5C12705D007849 +5A6C495A6CEB0F80260F803EC7FC3803FFF838007FC0222D7AAB28>I<1470EB01F8A313 +035CA313075CA3130F5CA3131F5CA2007FB512E0B6FC15C0D8003FC7FCA25B137EA313FE +5BA312015BA312035BA312075BA3120F5BA2EC0780001F140013805C140E003F131EEB00 +1C143C14385C6C13F0495A6C485AEB8780D807FEC7FCEA01F81B3F78BD20>I<017CEE03 +8048B4020EEB0FC02603C780013FEB1FE0380703C0000E7F5E001C037E130F0107160712 +3804FE130300785DEA700F4A1501011F130100F001804914C012E0EA003FDA000314034C +14805B137E0307140701FE1700495CA2030F5C0001170E495CA260A24848495A60A26012 +01033F5C7F4B6C485A000002F713036D9039E7E0078090267E01C349C7FC903A1F0781F8 +1E903A0FFF007FF8D901FCEB0FE03B2D78AB41>119 D<137C48B414072603C780EB1F80 +380703C0000F7F000E153F001C1600130712385E0078157EEA700F5C011F14FE00F0495B +12E0EA003FEC00015E5B137E150301FE5C5BA2150700015D5BA2150F00035D5BA2151F5E +A2153F12014BC7FC6D5B00005BEB7C0390383E0F7EEB1FFEEB03F090C712FE5DA214015D +121F397F8003F0A24A5A4848485A5D48131F00F049C8FC0070137E007813F8383801F038 +1E07C06CB4C9FCEA01FC294078AB2F>121 D E +%EndDVIPSBitmapFont +%DVIPSBitmapFont: Fx cmsy8 8 2 +/Fx 2 122 df<130C131EA50060EB01800078130739FC0C0FC0007FEB3F80393F8C7F00 +3807CCF83801FFE038007F80011EC7FCEB7F803801FFE03807CCF8383F8C7F397F0C3F80 +00FCEB0FC039781E078000601301000090C7FCA5130C1A1D7C9E23>3 +D<1338137CA81338A7007C137CB512FEA3387C387C00001300A5137CB3A41338AD173D7C +AE20>121 D E +%EndDVIPSBitmapFont +%DVIPSBitmapFont: Fy cmr12 12 22 +/Fy 22 118 df<121EEA7F80A2EAFFC0A4EA7F80A2EA1E000A0A78891B>46 +D<16C04B7EA34B7EA34B7EA34B7EA3ED19FEA3ED30FFA203707FED607FA203E07FEDC03F +A2020180ED801FA2DA03007F160FA20206801607A24A6D7EA34A6D7EA34A6D7EA2027081 +0260147FA202E08191B7FCA249820280C7121FA249C87F170FA20106821707A2496F7EA3 +496F7EA3496F7EA201788313F8486C83D80FFF03037FB500E0027FEBFFC0A342477DC649 +>65 D<B912F0A3000101C0C7127F6C6C48EC0FF817031701170018781838A2181CA3180C +A4180E1806160CA21800A5161CA2163C167CED01FC91B5FCA3EC8001ED007C163C161CA2 +160CA793C8FCB08048487EB612F8A337447CC340>70 D<B600C049B512C0A3000101E0C8 +387FFC006C49ED3FE06D481680063EC7FC183C183860604D5A4D5A4DC8FC171E17385F5F +4C5A4C5A4CC9FC160E5E5E5E5E4B5A4B7E4B7E150F4B7E4B7E1577EDE3FE913881C1FFEC +8381DA87007F028E6D7E149C02B86D7E02F06D7E14C04A6D7E707EA2707E707EA2707F71 +7EA2717E717EA2717E717EA2717E717EA2717F8585496C82486D4A13FCB600C0011FEBFF +E0A343447CC34C>75 D<B612F8A3000101E0C9FC6C6C5A5CB3B31830A418701860A518E0 +A3EF01C0A217031707A2170F173F177FEE01FF48486C011F1380B9FCA334447CC33D>I< +B56C020FB5FC8080C6040013F06D6CED1F80D96FF8ED0F00A2D967FC1506EB63FEA2EB61 +FF01607FA26E7E6E7EA26E7E6E7EA26E7E6E7EA26E7E6E7FA26F7E6F7EA26F7E6F7EA26F +7E6F7EA26F7E6F1380A2EE7FC0EE3FE0A2EE1FF0EE0FF8A2EE07FCEE03FEA2EE01FF7013 +86A2EF7FC6EF3FE6A2EF1FF6EF0FFEA217071703A217011700A201F0167E183E487ED80F +FF161EB500F0150EA2180640447CC349>78 D<B60107B500F890380FFFFEA3000301E0D9 +001F90C813F06C0180DA0FFCED3FC091C86C48ED1F006C871C0E6D6C6E7E1C0CA26D6C6F +5DA36EDA06FF1538011F1A30A26E020E6D1470010FDB0C7F1560A26E021C7F0107DB183F +5DA2856D6CDA301F4A5AA36D6C4A6C6C49C7FCA36D6C4A6C6C1306A3DB80016E130E027F +DA8003140CA2DBC00380023FDA00015CA203E081021F01066D5CA36E6C486E6C5AA36E6C +486E6C5AA36F48EC1FE1020360A2DBFE7015F302010160020F90C8FCA2DBFFE015FB6E49 +EC07FEA36F486E5AA36FC86C5AA3031E6F5AA4030C16605F467EC364>87 +D<B66C91380FFFFCA3000101F8C8000313C026007FE0923800FE0061013F17F06D6C5E80 +010F5F6D6C4B5A18036D6C93C7FC6E15066D160E6D6D140C181C6E6C14186E6C5C18706E +6C146018E06E6C5C6E6C495A17036E6C91C8FC5F6E6C13066E6D5A171C92387FC0185FED +3FE06F6C5A17E06F6C5AEEF980ED07FF6F90C9FCA26F5AB3A6923807FF800203B6FCA346 +447FC349>89 D<EB07FC90383FFF809038F80FE03903C003F048C66C7E000E6D7ED80FC0 +137E486C137F6D6D7EA36F7EA26C5AEA0380C8FCA4EC0FFF49B5FC90380FFE1FEB3FC0EB +FF00EA03FC485A485A485A485A127F5B176048C7FCA3153FA36D137F007F14EF6D9038C7 +E0C0003F13013A1FE00783F13B07F81E03FF802701FFFC0113003A001FE0007C2B2E7CAC +31>97 D<EA01FC12FFA3120712031201B3EC03FC91380FFF8091383C07E091387001F890 +39FDE0007E02807F01FFEC1F8091C713C049EC0FE049140717F0A2EE03F8A217FCA21601 +17FEAB17FC1603A217F8A2EE07F0A26DEC0FE017C06D141F01FBEC3F80D9F380EB7E00D9 +E1C05B9039E0F001F89039C03C07E09039801FFF80C7D803FCC7FC2F467DC436>I<167F +ED3FFFA315018182B3EC7F80903803FFF090380FC07C90383F000E017E1307496D5AD803 +F87F48487F5B000F81485AA2485AA2127FA290C8FC5AAB7E7FA2123FA26C7EA2000F5D7F +6C6C5B00035C6C6C9038077F806C6C010E13C0013F011C13FE90380FC0F8903803FFE090 +26007F0013002F467DC436>100 D<EB01FE903807FFC090381F03F090387E00FC49137E +48487F485A4848EB1F80000F15C049130F121F484814E01507A2007F15F090C7FCA25AA3 +90B6FCA290C9FCA67EA27FA2123F16306C7E1670000F15606D14E06C6C14C0000314016C +6CEB03806C6CEB0700013E131E90381F80F8903803FFE0010090C7FC242E7DAC2B>I<EE +0F80D901FCEB7FE0903A0FFF81F0F090393F07E3819039FC01FF033A01F800FE01484801 +7E13E00007027FC7FC497F000F8149131F001F81A9000F5D6D133F000792C7FC6D5B0003 +147E6C6C5B6D485A3903BF07E090380FFF80260701FCC8FC90CAFCA25AA37F6C7E7F90B5 +12F86C14FF16E06C15F86C6C8048B67E3A07C0000FFF48481300003FC8EA3F80003E151F +48ED0FC0A2481507A56C150F007C1680007E151F003E16006C153E6C6C5CD807E0495AD8 +01F8EB07E0D8007FEB3F8090261FFFFEC7FC010113E02C427DAC31>103 +D<EA01FC12FFA3120712031201B3EC01FE913807FFC091381E07F091383801F802707FEC +E000D9FDC07F5C01FF147F91C7FCA25BA35BB3A8486CECFF80B5D8F83F13FEA32F457DC4 +36>I<EA01E0EA07F8A2487EA46C5AA2EA01E0C8FCADEA01FC12FFA3120712031201B3B0 +487EB512F8A315437DC21C>I<EA01FC12FFA3120712031201B3B3B3A5487EB512F8A315 +457DC41C>108 D<D801FC01FFEC1FE000FF010701E0EBFFFC913B0F03F801E07F913C3C +01FC07803F800007903C7000FE0E001FC0000349D97E1C130F2601FDC0D97F38804A1430 +01FFDA3FF06D7E91C75BA2495DA3495DB3A8486C4A6C497EB5D8F81FB50003B512E0A34B +2C7DAB52>I<3901FC01FE00FF903807FFC091381E07F091383801F8000701707F0003EB +E0002601FDC07F5C01FF147F91C7FCA25BA35BB3A8486CECFF80B5D8F83F13FEA32F2C7D +AB36>I<EC7F80903803FFF090380FC0FC90383E001F496D7E496D7E48486D7E48486D7E +48486D7E000F81A24848147E003F157FA290C87E481680A44816C0AA6C1680A26D147F00 +3F1600A2001F157E6D14FE000F5D6D130100075D6C6C495A6C6C495A6C6C495A013E49C7 +FC90381FC0FE903807FFF89038007F802A2E7DAC31>I<3903F803F000FFEB1FFCEC3C3E +EC707F0007EBE0FF3803F9C000015B13FBEC007E153C01FF13005BA45BB3A748B4FCB512 +FEA3202C7DAB26>114 D<1306A5130EA4131EA3133E137EA213FE12011207001FB512F0 +B6FCA2C648C7FCB3A4150CAA017E131C017F1318A26D133890381F8030ECC070903807E0 +E0903801FFC09038007F001E3E7EBC26>116 D<D801FC147F00FFEC3FFFA30007140100 +0380000181B3A85EA35DA212006D5B017E9038077F80017F010E13C06D011C13FE90380F +C078903803FFF09026007F8013002F2D7DAB36>I E +%EndDVIPSBitmapFont +%DVIPSBitmapFont: Fz cmbx12 20.74 23 +/Fz 23 119 df<B912E0B033107EAE41>45 D<F103F84F7E4F7EA24F7EA34F7FA24F7FA3 +96B57EA24E80A34E80A24E80A34E80A24E80A34E81A24E81A219BFDEFF9F80191F4D6D80 +A218FE05036D8018FC05076D80A218F8050F6D8018F0051F6D80A260053F6E8060057F6E +80A26005FF6E8095C7FC4C6F80A25F04036F805F04076F80A25F040F6F805F041F6F80A2 +5F043F70805F047F7080A25F04FF708094C9FC4B7180A25E030371805E4BBB7EA34B86A2 +4B86A3DB3FE0CA6C805E037F7280A25E03FF7280A24A90CB6C80A25D02037380A24A4872 +80A25D020F7380A24B84021F885D023F7480A24B85027F895D902607FFFC7380B86C031F +B912E0A8837979F892>65 D<B800C051B8128071637163A37163A27163C7003F57C8FC71 +F33FBFA203EF6DF37F3FA303E76E1AFEA203E36EF101FCA203E16EF103F8A203E06EF107 +F0A3706DF10FE0A2706DF11FC0A2706DF13F80A2706DF17F00A3706E18FEA2706E4D5AA2 +706E4D5AA3706E4D5AA2716D4D5AA2716D4D5AA2716D4D5AA3716D4DC7FCA2716E16FEA2 +716E4B5AA2716E4B5AA3716E4B5AA2726D4B5AA2726D4B5AA3726D4B5AA2726D4BC8FCA2 +726E14FEA2726E495AA3726E495AA2726E495AA2736D495AA2736D495AA3736D495AA273 +6D49C9FCA273EC80FEA2F481FC7314C1A273ECE3F8A273ECF7F0A274EBFFE0A3745CA274 +5CA27491CAFCA2745BA3745BA2902603FFFE705BB800F897BA1280745BA2755AA3755A75 +5AA97679F5B8>77 D<95380FFFFC0503B612F0053F15FF0403B812F0040F17FC047FEFFF +804BBA12E003079126FE001F14F8031F02E0010114FE4B91C8003F7F92B500FC030F14C0 +4A02F0030380020702C0030014F84A4A707F4A91CA6C7F4A01FC050F7F4A49718091B548 +7180494A71804989494A71804C8449894991CC6C7F4949737FA24949738090B589A2484A +7380A2484A7380A2488B4B85A2488BA3484A7380A3488BA4484A741480A7B61EC0B16C20 +80A36F97B6FCA46C2000A46C6E4F5CA36C676F61A26C67A26C6E4F5CA26C676F616C676F +616D666F616D9BC7FC6D6E4E5BA26D6E95B55A6D6E4D5C6D656D6E4D5C6D6E4D5C6E6D4D +5C6E6D4D91C8FC6E6D4D5B6E02C093B55A6E6E4B5C6E02F803075C02006E4B14C06FD9FF +80027F5C031F02E049B548C9FC030702FE011F14F8030191B812E06F6C1880041F4DCAFC +040317F0DC003F93CBFC050315F0DD000F01FCCCFC7A7A75F791>79 +D<BC12FCF3FFF01CFF1DE01DFC1DFF1EC08AC7003F91C8000115F8E0000F80090180756C +6D7E76801C0F76808B7680888B7680A28BA2892080A420C0AB2080A49AB61200A267A267 +6467525C64670A1F5C525C5291C7FC51B55A090F14F850B65A94BA12C09BC8FC1DFC1DF0 +9AC9FC1CF809FCCAFC0580CEFCB3B3A8BA12E0A872767AF584>I<922603FFF8150E037F +D9FFC0143F0203B600FC5C021F03FF5C027FEEC00149B8EAF00349EFFC07010FDA000F13 +FE4901F09039007FFF8F4901C0020F13DF4990C8000390B5FC494815004801F8163F4884 +4A8248498248844A8248844A834885A291CB7E5A86A286B5FC8680A28680A280A26E8380 +806E187E6E95C7FC6C8015E015FCEDFFC06C15FCEEFFE06C16FF18F06CEFFF8019F06C18 +FE737E6C856C19F06C19FC6D846D846D856D856D850101856D85023F846E841407020084 +031F18801500040F17C0EE007F050716E0EF003F1803DE007F14F0191F8585070114F8A2 +8586007E85B4FC86A286A37F86A36D1AF0A37F1CE06D60A26D1AC06D607F6D1A806E5F6E +4D13006E606E17FF02FC4C5B02FF4C5B03E04B5B03FC031F5B01FBD9FF80027F5B01F102 +FE0107B55AD9E07F90B8C7FC6E17FCD9C00F5FD9800317E090C76C168048020F4BC8FC48 +020015F00070030349C9FC557A75F76C>83 D<BA057FB71280A8C792CD000F01F0C7FC71 +070013806E5290C8FCA26E6E621F036E6E621F07836E525A836E651F1F6E6E621F3F836E +525A836E651FFF6F6E96C9FC666F6E601E03846F505AA26F6E601E0F6F6E601E1F846F50 +5AA26F6E601E7F6F6E601EFF85704E90CAFCA2706E5E1D03706E5E1D0785704E5AA2706E +5E1D1F706E5E1D3F85704E5A8570611DFF716E92CBFC6486714C5A86715F1C07716E5C1C +0F86714C5A86714C5AA2716E5C1C7F716E5C1CFF8772028190CCFCA272ECC1FE1BC372EC +E3FC1BE71BF772ECFFF8A2725DA2725DA3725DA2725DA27391CDFCA3735BA2735BA2735B +A3735BA2735BA2735BA2735B74CEFC89787CF592>86 D<92383FFFF80207B612E0027F15 +FC49B87E010717E0011F83499026F0007F13FC4948C7000F7F90B502036D7E486E6D806F +6D80727F486E6E7F8486727FA28684A26C5C72806C5C6D90C8FC6D5AEB0FF8EB03E090CA +FCA70507B6FC041FB7FC0303B8FC157F0203B9FC021FECFE0391B612800103ECF800010F +14C04991C7FC017F13FC90B512F04814C0485C4891C8FC485B5A485B5C5A5CA2B5FC5CA3 +60A36E5DA26C5F6E5D187E6C6D846E4A48806C6D4A4814FC6C6ED90FF0ECFFFC6C02E090 +263FE07F14FE00019139FC03FFC06C91B6487E013F4B487E010F4B1307010303F01301D9 +003F0280D9003F13FC020101F8CBFC57507ACE5E>97 D<93383FFFF00307B612C0033F15 +F84AB712FE0207707E021F17E0027F8391B526FC001F7F010302C001037F4991C7487F49 +495C495B4901F04A7F5B90B55A485CA2485C4891C8FCA248715B5C48715B725B4A6F5B48 +9438007FC0071FC7FC96C8FC5AA25CA3B5FCAF7E80A47E80A27E806CF11F80F23FC06C6E +167FA26C6EEEFF80816C606C6E17006D6D4B5A6D6D15076D6D4B5A6D6D6C4A5A6D02E0EC +7FF06D02F849485A01009126FF801F5B6E91B6C7FC021F5E020716F8020116E06E6C1580 +030702FCC8FCDB003F13804A507ACE56>99 D<93387FFF80030FB512FC037FECFF804AB7 +12E0020716F8021F16FE027FD9F8077F49B5D8C000804991C7003F13E04901FC020F7F49 +496E7F49498049496E7F49496E7F90B55A48727E92C914804884485B1BC048841BE0485B +A27313F05AA25C5AA21BF885A2B5FCA391BAFCA41BF002F8CCFCA67EA3807EA47E806CF1 +03F0F207F86C7F1A0F6C6E17F06C191F6F17E06C6E163F6D6DEE7FC06D6D16FF6D6D4B13 +806D6D4B13006D6D6CEC0FFE6D02E0EC3FFC6D02F8ECFFF86D9126FFC00F5B023F91B65A +020F178002034CC7FC020016F8031F15E0030392C8FCDB000F13E04D507BCE58>101 +D<EF7FFE040FB512C093B612F0030715FC031F814B8192B5D8F01F13800203DA803F13C0 +4A9026FC007F13E04A4990B5FC4A5B4A494814F04A13C091B51280A2491400A2495BA271 +14E05B4B6E13C0721380721300F007FC95C8FCB3B912C0A8D8000749CAFCB3B3B3A7007F +B712FCA844797AF83B>I<903801FFFCB6FCA8C67E131F7FB3AD95380FFFE095B512FE05 +036E7E050F15E0053F15F84D81932701FFF01F7F4CD900077FDC07FC6D80DC0FF06D80DC +1FC07F4C48824CC8FC047E6F7F5EEDFDF85E03FF707F5EA25EA25EA293C9FCA45DB3B3A6 +B8D8E003B81280A8617879F76C>104 D<EB01FCEB07FF011F13C0497F497F90B57EA248 +80A24880A76C5CA26C5CA26D5B6D5B6D5B010790C8FCEB01FC90CAFCB2903801FFFC007F +B5FCA8C67E131F7FB3B3B3A5B81280A8297979F835>I<903801FFFCB6FCA8C67E131F7F +B3B3B3B3B3ABB812C0A82A7879F735>108 D<902601FFF891260FFFE093383FFF80B692 +B500FE0303B512F805036E6C020F14FE050F03E0023F6E7E053F03F891B712E04D6F4982 +932701FFF01F6D0107D9C07F7F4CD900076D90270FFC001F7FDC07FC6D9126801FF06D7F +C66CDA0FF06D9126C03FC06D7F011FDA1FC06D4BC77E6D4A48DCE0FE834CC8ECE1FC047E +6FD9F1F86E804CEFF3F0DBF9F8EFF7E04C6003FB7001FF6F804C6015FF4C95C9FCA24C5F +A293C95CA44B60B3B3A6B8D8E003B8D8800FB712FEA8974E79CDA2>I<902601FFF89138 +0FFFE0B692B512FE05036E7E050F15E0053F15F84D81932701FFF01F7F4CD900077FDC07 +FC6D80C66CDA0FF06D80011FDA1FC07F6D4A48824CC8FC047E6F7F5EEDF9F85E03FB707F +5E15FF5EA25EA293C9FCA45DB3B3A6B8D8E003B81280A8614E79CD6C>I<93381FFFE003 +03B6FC031F15E092B712FC020316FF020F17C0023FD9FC0014F091B500C0010F13FC4991 +C700037F4901FC02007F010F496F13C049496F7F49496F7F4B8149496F7F90B5C96C7F48 +86A24849707F481B80A248497014C0A2481BE0A348497113F0A3481BF8A5B51AFCAE6C1B +F8A46C1BF06E94B5FCA36C1BE0A26C6D4C14C0A26C1B806E5E6C1B006C6E4B5BA26C6E4B +5B6D6D4B5B6D6D4B5B6D6D4B5B6D6D92B55A6D01FF02035C6D02C0010F91C7FC010002FC +90B512FC6E90B75A021F17E00207178002014CC8FCDA003F15F0030392C9FCDB001F13E0 +56507BCE61>I<902601FFFCEC7FFEB6020FB512F0057F14FE4CB712C0040716F0041F82 +047F16FE93B5C66C7F92B500F0010F14C0C66C0380010380011F4AC76C806D4A6E8004F0 +6F7F4C6F7F4C6F7F4C8193C915804B7014C0861DE0A27414F0A27414F8A47513FCA57513 +FEAF5113FCA598B512F8A31DF0621DE0621DC0621D806F5E701800704B5B505B704B5B70 +92B55A04FC4A5C704A5C706C010F5C05E0013F49C7FC9227FE7FFC01B55A70B712F0040F +16C0040393C8FC040015F8053F14C0050301F0C9FC94CCFCB3A6B812E0A85F6F7ACD6C> +I<902601FFF8EB07FEB691383FFFC094B512F00403804C14FE4C8093261FFC3F13809326 +3FE07F13C0DC7F80B5FCC66C5D011FDAFE0114E06DEBF9FC16F815FB16F016E015FF16C0 +7114C05E72138095381FFE0093C76C5AF001E095C8FCA25DA65DB3B3A2B812F8A8434E7A +CD4F>114 D<912603FFFCEB0780027F9039FFE00FC00103B6EAF83F010FEDFEFF013F92 +B5FC49EB000F2601FFF01300480180143F4890C8120F4848814848814981123F83485A18 +7FA212FF6D163FA37F7F6DEE1F8002C092C7FC14F014FEECFFF06CECFF8016FEEEFFE06C +16FC6C16FF18C06C836C17F86C836C836C83013F17806D17C0010717E0010117F0EB003F +020716F8EC001F030015FC1607EE007F051F13FE1707007E82B482836D167FA2183F7F18 +1FA27F19FC7FA26D163F6D17F86D167F19F06D16FF6E4A13E002E04A13C06E4A138002FE +023F1300913AFFC003FFFE01E790B65A01C316F0018016C026FE003F92C7FC48010714F8 +0070D9007F90C8FC3F507ACE4C>I<15FFA75CA55CA45CA25CA25CA25CA25C91B5FCA25B +5B5B131F5B90B9FC120FBAFCA6D8000791C9FCB3B3A3F01FE0AE183F7014C07F187F7014 +806D16FF826D4B13006E6D485AEEFE0F6E90B55A020F5D6E5D020115C06E6C5C031F49C7 +FC030113F03B6E7CEC4B>I<DAFFFE933803FFF8B60303B6FCA8C66CEE0001011F717E6D +84B3B3A862A497B5FCA261A2616D5F1ADF6F150F6DEF1F9F073F806D6EDA7F1F13FF6D6E +D901FEEDFF8070EB07FC023F01FEEB3FF86E90B612F06E16C0020316800200EDFE00031F +14F80300028003C0C7FC614F79CD6C>I<B892B612F8A8D8001F49C90003EBF0006D6D04 +001380A26D6E94C7FC626D61701503A26D6E4B5AA26D6E5E1A0F6E6D5E1A1F80704B5AA2 +6E6D4B5AA26E6D5E1AFF6E6E92C8FC61A26E6E495AA26E6E495AA26E6E5C190F6F6D5C19 +1FA26F6D495AA26F6D495AA26F6D5C19FF6F6E90C9FC1881A26FECC3FEA26FECE7FCA26F +ECF7F818FF705CA3705CA2705CA2705CA27091CAFCA3705BA2705BA2705BA2715AA2715A +715A5D4E7CCC66>I E +%EndDVIPSBitmapFont +/FA 105[46 28[46 46 1[46 51 28 46 32 1[51 51 51 74 23 +2[23 51 1[28 46 51 46 51 46 10[55 2[55 60 8[23 2[51 1[60 +1[60 60 7[46 46 2[46 46 46 46 46 46 3[23 44[{ +TeXBase1Encoding ReEncodeFont}38 83.022 /Helvetica-Bold +rf /FB 134[60 1[86 2[33 60 40 1[66 66 66 100 27 2[27 +66 66 33 66 1[60 1[66 10[80 1[73 80 86 3[86 1[66 3[86 +4[86 1[80 7[66 66 1[66 2[66 66 66 4[33 40[60 3[{ +TeXBase1Encoding ReEncodeFont}34 119.552 /Helvetica-Oblique +rf /FC 138[66 33 1[40 2[66 66 100 27 2[27 66 66 1[66 +66 1[66 66 7[80 1[113 8[86 1[66 80 4[73 4[80 18[33 46[{ +TeXBase1Encoding ReEncodeFont}22 119.552 /Helvetica rf +/FD 137[96 105 57 96 67 1[105 105 105 153 48 2[48 105 +1[57 96 1[96 1[96 10[115 2[115 2[115 134 1[143 11[124 +19[57 45[{TeXBase1Encoding ReEncodeFont}23 172.188 /Helvetica-Bold +rf /FE 105[115 28[115 115 2[126 69 115 80 1[126 126 126 +4[57 126 126 1[115 126 115 126 115 10[138 2[138 149 3[149 +172 2[115 57 3[138 3[149 7[115 115 115 115 115 1[115 +115 115 115 57 2[57 44[{TeXBase1Encoding ReEncodeFont}38 +206.559 /Helvetica-Bold rf end +%%EndProlog +%%BeginSetup +%%Feature: *Resolution 600dpi +TeXDict begin + +%%EndSetup +%%Page: 0 1 +0 0 bop -336 55 4537 34 v -336 5425 34 5370 v 4167 5425 +V -336 5459 4537 34 v -345 205 a @beginspecial 247 @llx +387 @lly 357 @urx 420 @ury 2160 @rwi @setspecial +%%BeginDocument: aiaalgo.eps +%!PS-Adobe-3.0 EPSF-3.0 +%%Creator: Adobe Illustrator(TM) 7.0 +%%For: (Richard A Wheless) (NASA Langley Research Center) +%%Title: (AIAALOGO) +%%CreationDate: (2/3/98) (3:59 PM) +%%BoundingBox: 247 387 357 420 +%%HiResBoundingBox: 247.1666 387.5 356.6667 419.1667 +%%DocumentProcessColors: Black +%%DocumentSuppliedResources: procset Adobe_level2_AI5 1.2 0 +%%+ procset Adobe_ColorImage_AI6 1.1 0 +%%+ procset Adobe_Illustrator_AI5 1.2 0 +%%+ procset Adobe_cshow 2.0 8 +%AI5_FileFormat 3 +%AI3_ColorUsage: Black&White +%AI3_IncludePlacedImages +%AI7_ImageSettings: 1 +%%CMYKCustomColor: 1 0 0.55 0 (Aqua) +%%+ 1 0.5 0 0 (Blue) +%%+ 0.5 0.4 0.3 0 (Blue Gray) +%%+ 0.8 0.05 0 0 (Blue Sky) +%%+ 0.5 0.85 1 0 (Brown) +%%+ 1 0.9 0.1 0 (Dark Blue) +%%+ 1 0.55 1 0 (Forest Green) +%%+ 0.05 0.2 0.95 0 (Gold) +%%+ 0.75 0.05 1 0 (Grass Green) +%%+ 0 0.45 1 0 (Orange) +%%+ 0.15 1 1 0 (Red) +%%+ 0.45 0.9 0 0 (Violet) +%%AI6_ColorSeparationSet: 1 1 (AI6 Default Color Separation Set) +%%+ Options: 1 16 0 1 0 1 1 1 0 1 1 1 1 18 0 0 0 0 0 0 0 0 -1 -1 +%%+ PPD: 1 21 0 0 60 45 2 2 1 0 0 1 0 0 0 0 0 0 0 0 0 0 () +%AI3_TemplateBox: 306 396 306 396 +%AI3_TileBox: 30 31 582 761 +%AI3_DocumentPreview: Header +%AI5_ArtSize: 612 792 +%AI5_RulerUnits: 0 +%AI5_ArtFlags: 1 0 0 1 0 0 1 1 0 +%AI5_TargetResolution: 800 +%AI5_NumLayers: 1 +%AI5_OpenToView: 218 464 6 1018 725 18 0 1 3 40 0 0 +%AI5_OpenViewLayers: 7 +%%PageOrigin:30 31 +%%AI3_PaperRect:-30 761 582 -31 +%%AI3_Margin:30 -31 -30 31 +%AI7_GridSettings: 72 8 72 8 1 0 0.768627 0.843137 1 0.884314 0.921569 1 +%%EndComments +%%BeginProlog +%%BeginResource: procset Adobe_level2_AI5 1.2 0 +%%Title: (Adobe Illustrator (R) Version 5.0 Level 2 Emulation) +%%Version: 1.2 0 +%%CreationDate: (04/10/93) () +%%Copyright: ((C) 1987-1996 Adobe Systems Incorporated All Rights Reserved) +userdict /Adobe_level2_AI5 25 dict dup begin + put + /packedarray where not + { + userdict begin + /packedarray + { + array astore readonly + } bind def + /setpacking /pop load def + /currentpacking false def + end + 0 + } if + pop + userdict /defaultpacking currentpacking put true setpacking + /initialize + { + Adobe_level2_AI5 begin + } bind def + /terminate + { + currentdict Adobe_level2_AI5 eq + { + end + } if + } bind def + mark + /setcustomcolor where not + { + /findcmykcustomcolor + { + 0 + 6 packedarray + } bind def + /findrgbcustomcolor + { + 1 + 5 packedarray + } bind def + /setcustomcolor + { + exch + aload pop + 0 eq + { + pop + 4 + { + 4 index mul + 4 1 roll + } repeat + 5 -1 roll pop + setcmykcolor + } + { + pop + 3 + { + 1 exch sub + 3 index mul + 1 exch sub + 3 1 roll + } repeat + 4 -1 roll pop + setrgbcolor + } ifelse + } + def + } if + + /gt38? mark {version cvr cvx exec} stopped {cleartomark true} {38 gt exch pop} ifelse def + userdict /deviceDPI 72 0 matrix defaultmatrix dtransform dup mul exch dup mul add sqrt put + userdict /level2? + systemdict /languagelevel known dup + { + pop systemdict /languagelevel get 2 ge + } if + put +/level2ScreenFreq +{ + begin + 60 + HalftoneType 1 eq + { + pop Frequency + } if + HalftoneType 2 eq + { + pop GrayFrequency + } if + HalftoneType 5 eq + { + pop Default level2ScreenFreq + } if + end +} bind def +userdict /currentScreenFreq + level2? {currenthalftone level2ScreenFreq} {currentscreen pop pop} ifelse put +level2? not + { + /setcmykcolor where not + { + /setcmykcolor + { + exch .11 mul add exch .59 mul add exch .3 mul add + 1 exch sub setgray + } def + } if + /currentcmykcolor where not + { + /currentcmykcolor + { + 0 0 0 1 currentgray sub + } def + } if + /setoverprint where not + { + /setoverprint /pop load def + } if + /selectfont where not + { + /selectfont + { + exch findfont exch + dup type /arraytype eq + { + makefont + } + { + scalefont + } ifelse + setfont + } bind def + } if + /cshow where not + { + /cshow + { + [ + 0 0 5 -1 roll aload pop + ] cvx bind forall + } bind def + } if + } if + cleartomark + /anyColor? + { + add add add 0 ne + } bind def + /testColor + { + gsave + setcmykcolor currentcmykcolor + grestore + } bind def + /testCMYKColorThrough + { + testColor anyColor? + } bind def + userdict /composite? + level2? + { + gsave 1 1 1 1 setcmykcolor currentcmykcolor grestore + add add add 4 eq + } + { + 1 0 0 0 testCMYKColorThrough + 0 1 0 0 testCMYKColorThrough + 0 0 1 0 testCMYKColorThrough + 0 0 0 1 testCMYKColorThrough + and and and + } ifelse + put + composite? not + { + userdict begin + gsave + /cyan? 1 0 0 0 testCMYKColorThrough def + /magenta? 0 1 0 0 testCMYKColorThrough def + /yellow? 0 0 1 0 testCMYKColorThrough def + /black? 0 0 0 1 testCMYKColorThrough def + grestore + /isCMYKSep? cyan? magenta? yellow? black? or or or def + /customColor? isCMYKSep? not def + end + } if + end defaultpacking setpacking +%%EndResource +%%BeginProcSet: Adobe_ColorImage_AI6 1.1 0 +userdict /Adobe_ColorImage_AI6 known not +{ + userdict /Adobe_ColorImage_AI6 24 dict put +} if +userdict /Adobe_ColorImage_AI6 get begin +/initialize +{ + Adobe_ColorImage_AI6 begin + Adobe_ColorImage_AI6 + { + dup type /arraytype eq + { + dup xcheck + { + bind + } if + } if + pop pop + } forall +} def +/terminate { end } def +currentdict /Adobe_ColorImage_AI6_Vars known not +{ + /Adobe_ColorImage_AI6_Vars 15 dict def +} if +Adobe_ColorImage_AI6_Vars begin + /channelcount 0 def + /sourcecount 0 def + /sourcearray 4 array def + /plateindex -1 def + /XIMask 0 def + /XIBinary 0 def + /XIChannelCount 0 def + /XIBitsPerPixel 0 def + /XIImageHeight 0 def + /XIImageWidth 0 def + /XIImageMatrix null def + /XIBuffer null def + /XIDataProc null def + /XIVersion 6 def +end +/WalkRGBString null def +/WalkCMYKString null def +/StuffRGBIntoGrayString null def +/RGBToGrayImageProc null def +/StuffCMYKIntoGrayString null def +/CMYKToGrayImageProc null def +/ColorImageCompositeEmulator null def +/SeparateCMYKImageProc null def +/FourEqual null def +/TestPlateIndex null def +currentdict /_colorimage known not +{ + /colorimage where + { + /colorimage get /_colorimage exch def + } + { + /_colorimage null def + } ifelse +} if +/_currenttransfer systemdict /currenttransfer get def +/colorimage null def +/XI null def +/WalkRGBString +{ + 0 3 index + dup length 1 sub 0 3 3 -1 roll + { + 3 getinterval { } forall + 5 index exec + 3 index + } for + + 5 { pop } repeat +} def +/WalkCMYKString +{ + 0 3 index + dup length 1 sub 0 4 3 -1 roll + { + 4 getinterval { } forall + + 6 index exec + + 3 index + + } for + + 5 { pop } repeat + +} def +/StuffRGBIntoGrayString +{ + .11 mul exch + + .59 mul add exch + + .3 mul add + + cvi 3 copy put + + pop 1 add +} def +/RGBToGrayImageProc +{ + Adobe_ColorImage_AI6_Vars begin + sourcearray 0 get exec + dup length 3 idiv string + dup 3 1 roll + + /StuffRGBIntoGrayString load exch + WalkRGBString + end +} def +/StuffCMYKIntoGrayString +{ + exch .11 mul add + + exch .59 mul add + + exch .3 mul add + + dup 255 gt { pop 255 } if + + 255 exch sub cvi 3 copy put + + pop 1 add +} def +/CMYKToGrayImageProc +{ + Adobe_ColorImage_AI6_Vars begin + sourcearray 0 get exec + dup length 4 idiv string + dup 3 1 roll + + /StuffCMYKIntoGrayString load exch + WalkCMYKString + end +} def +/ColorImageCompositeEmulator +{ + pop true eq + { + Adobe_ColorImage_AI6_Vars /sourcecount get 5 add { pop } repeat + } + { + Adobe_ColorImage_AI6_Vars /channelcount get 1 ne + { + Adobe_ColorImage_AI6_Vars begin + sourcearray 0 3 -1 roll put + + channelcount 3 eq + { + /RGBToGrayImageProc + } + { + /CMYKToGrayImageProc + } ifelse + load + end + } if + image + } ifelse +} def +/SeparateCMYKImageProc +{ + Adobe_ColorImage_AI6_Vars begin + sourcecount 0 ne + { + sourcearray plateindex get exec + } + { + sourcearray 0 get exec + + dup length 4 idiv string + + 0 2 index + + plateindex 4 2 index length 1 sub + { + get 255 exch sub + + 3 copy put pop 1 add + + 2 index + } for + pop pop exch pop + } ifelse + end +} def + +/FourEqual +{ + 4 index ne + { + pop pop pop false + } + { + 4 index ne + { + pop pop false + } + { + 4 index ne + { + pop false + } + { + 4 index eq + } ifelse + } ifelse + } ifelse +} def +/TestPlateIndex +{ + Adobe_ColorImage_AI6_Vars begin + /plateindex -1 def + /setcmykcolor where + { + pop + gsave + 1 0 0 0 setcmykcolor systemdict /currentgray get exec 1 exch sub + 0 1 0 0 setcmykcolor systemdict /currentgray get exec 1 exch sub + 0 0 1 0 setcmykcolor systemdict /currentgray get exec 1 exch sub + 0 0 0 1 setcmykcolor systemdict /currentgray get exec 1 exch sub + grestore + 1 0 0 0 FourEqual + { + /plateindex 0 def + } + { + 0 1 0 0 FourEqual + { + /plateindex 1 def + } + { + 0 0 1 0 FourEqual + { + /plateindex 2 def + } + { + 0 0 0 1 FourEqual + { + /plateindex 3 def + } + { + 0 0 0 0 FourEqual + { + /plateindex 5 def + } if + } ifelse + } ifelse + } ifelse + } ifelse + pop pop pop pop + } if + plateindex + end +} def +/colorimage +{ + Adobe_ColorImage_AI6_Vars begin + /channelcount 1 index def + /sourcecount 2 index 1 eq { channelcount 1 sub } { 0 } ifelse def + 4 sourcecount add index dup + 8 eq exch 1 eq or not + end + + { + /_colorimage load null ne + { + _colorimage + } + { + Adobe_ColorImage_AI6_Vars /sourcecount get + 7 add { pop } repeat + } ifelse + } + { + dup 3 eq + TestPlateIndex + dup -1 eq exch 5 eq or or + { + /_colorimage load null eq + { + ColorImageCompositeEmulator + } + { + dup 1 eq + { + pop pop image + } + { + Adobe_ColorImage_AI6_Vars /plateindex get 5 eq + { + gsave + + 0 _currenttransfer exec + 1 _currenttransfer exec + eq + { 0 _currenttransfer exec 0.5 lt } + { 0 _currenttransfer exec 1 _currenttransfer exec gt } ifelse + + { { pop 0 } } { { pop 1 } } ifelse + systemdict /settransfer get exec + } if + + _colorimage + + Adobe_ColorImage_AI6_Vars /plateindex get 5 eq + { + grestore + } if + } ifelse + } ifelse + } + { + dup 1 eq + { + pop pop + image + } + { + pop pop + Adobe_ColorImage_AI6_Vars begin + sourcecount -1 0 + { + exch sourcearray 3 1 roll put + } for + /SeparateCMYKImageProc load + end + systemdict /image get exec + } ifelse + } ifelse + } ifelse +} def +/XG +{ + pop pop +} def +/XF +{ + 13 {pop} repeat +} def +/Xh +{ + Adobe_ColorImage_AI6_Vars begin + gsave + /XIMask exch 0 ne def + /XIImageHeight exch def + /XIImageWidth exch def + /XIImageMatrix exch def + 0 0 moveto + XIImageMatrix concat + XIImageWidth XIImageHeight scale + + XIMask + { + /_lp /null ddef + _fc + /_lp /imagemask ddef + } + if + /XIVersion 7 def + end +} def +/XH +{ + Adobe_ColorImage_AI6_Vars begin + /XIVersion 6 def + grestore + end +} def +/XI +{ + Adobe_ColorImage_AI6_Vars begin + gsave + /XIMask exch 0 ne def + /XIBinary exch 0 ne def + pop + pop + /XIChannelCount exch def + /XIBitsPerPixel exch def + /XIImageHeight exch def + /XIImageWidth exch def + pop pop pop pop + /XIImageMatrix exch def + XIBitsPerPixel 1 eq + { + XIImageWidth 8 div ceiling cvi + } + { + XIImageWidth XIChannelCount mul + } ifelse + /XIBuffer exch string def + XIBinary + { + /XIDataProc { currentfile XIBuffer readstring pop } def + XIVersion 6 le + { + currentfile 128 string readline pop pop + } + if + } + { + /XIDataProc { currentfile XIBuffer readhexstring pop } def + } ifelse + + XIVersion 6 le + { + 0 0 moveto + XIImageMatrix concat + XIImageWidth XIImageHeight scale + XIMask + { + /_lp /null ddef + _fc + /_lp /imagemask ddef + } if + } if + + XIMask + { + XIImageWidth XIImageHeight + false + [ XIImageWidth 0 0 XIImageHeight neg 0 0 ] + /XIDataProc load + imagemask + } + { + XIImageWidth XIImageHeight + XIBitsPerPixel + [ XIImageWidth 0 0 XIImageHeight neg 0 0 ] + /XIDataProc load + + XIChannelCount 1 eq + { + gsave + 0 setgray + image + grestore + } + { + false + XIChannelCount + colorimage + } ifelse + } ifelse + grestore + end +} def +end +%%EndProcSet +%%BeginResource: procset Adobe_Illustrator_AI5 1.2 0 +%%Title: (Adobe Illustrator (R) Version 7.0 Full Prolog) +%%Version: 1.2 0 +%%CreationDate: (3/7/1994) () +%%Copyright: ((C) 1987-1996 Adobe Systems Incorporated All Rights Reserved) +currentpacking true setpacking +userdict /Adobe_Illustrator_AI5_vars 107 dict dup begin +put +/_eo false def +/_lp /none def +/_pf +{ +} def +/_ps +{ +} def +/_psf +{ +} def +/_pss +{ +} def +/_pjsf +{ +} def +/_pjss +{ +} def +/_pola 0 def +/_doClip 0 def +/cf currentflat def +/_lineorientation 0 def +/_charorientation 0 def +/_yokoorientation 0 def +/_tm matrix def +/_renderStart +[ +/e0 /r0 /a0 /o0 /e1 /r1 /a1 /i0 +] def +/_renderEnd +[ +null null null null /i1 /i1 /i1 /i1 +] def +/_render -1 def +/_shift [0 0] def +/_ax 0 def +/_ay 0 def +/_cx 0 def +/_cy 0 def +/_leading +[ +0 0 +] def +/_ctm matrix def +/_mtx matrix def +/_sp 16#020 def +/_hyphen (-) def +/_fontSize 0 def +/_fontAscent 0 def +/_fontDescent 0 def +/_fontHeight 0 def +/_fontRotateAdjust 0 def +/Ss 256 string def +Ss 0 (fonts/) putinterval +/_cnt 0 def +/_scale [1 1] def +/_nativeEncoding 0 def +/_useNativeEncoding 0 def +/_tempEncode 0 def +/_pntr 0 def +/_tDict 2 dict def +/_hfname 100 string def +/_hffound false def +/Tx +{ +} def +/Tj +{ +} def +/CRender +{ +} def +/_AI3_savepage +{ +} def +/_gf null def +/_cf 4 array def +/_rgbf 3 array def +/_if null def +/_of false def +/_fc +{ +} def +/_gs null def +/_cs 4 array def +/_rgbs 3 array def +/_is null def +/_os false def +/_sc +{ +} def +/_pd 1 dict def +/_ed 15 dict def +/_pm matrix def +/_fm null def +/_fd null def +/_fdd null def +/_sm null def +/_sd null def +/_sdd null def +/_i null def +/_lobyte 0 def +/_hibyte 0 def +/_cproc null def +/_cscript 0 def +/_hvax 0 def +/_hvay 0 def +/_hvwb 0 def +/_hvcx 0 def +/_hvcy 0 def +/_bitfont null def +/_bitlobyte 0 def +/_bithibyte 0 def +/_bitkey null def +/_bitdata null def +/_bitindex 0 def +/discardSave null def +/buffer 256 string def +/beginString null def +/endString null def +/endStringLength null def +/layerCnt 1 def +/layerCount 1 def +/perCent (%) 0 get def +/perCentSeen? false def +/newBuff null def +/newBuffButFirst null def +/newBuffLast null def +/clipForward? false def +end +userdict /Adobe_Illustrator_AI5 known not { + userdict /Adobe_Illustrator_AI5 95 dict put +} if +userdict /Adobe_Illustrator_AI5 get begin +/initialize +{ + Adobe_Illustrator_AI5 dup begin + Adobe_Illustrator_AI5_vars begin + discardDict + { + bind pop pop + } forall + dup /nc get begin + { + dup xcheck 1 index type /operatortype ne and + { + bind + } if + pop pop + } forall + end + newpath +} def +/terminate +{ + end + end +} def +/_ +null def +/ddef +{ + Adobe_Illustrator_AI5_vars 3 1 roll put +} def +/xput +{ + dup load dup length exch maxlength eq + { + dup dup load dup + length 2 mul dict copy def + } if + load begin + def + end +} def +/npop +{ + { + pop + } repeat +} def +/hswj +{ + dup stringwidth 3 2 roll + { + _hvwb eq { exch _hvcx add exch _hvcy add } if + exch _hvax add exch _hvay add + } cforall +} def +/vswj +{ + 0 0 3 -1 roll + { + dup 255 le + _charorientation 1 eq + and + { + dup cstring stringwidth 5 2 roll + _hvwb eq { exch _hvcy sub exch _hvcx sub } if + exch _hvay sub exch _hvax sub + 4 -1 roll sub exch + 3 -1 roll sub exch + } + { + _hvwb eq { exch _hvcy sub exch _hvcx sub } if + exch _hvay sub exch _hvax sub + _fontHeight sub + } ifelse + } cforall +} def +/swj +{ + 6 1 roll + /_hvay exch ddef + /_hvax exch ddef + /_hvwb exch ddef + /_hvcy exch ddef + /_hvcx exch ddef + _lineorientation 0 eq { hswj } { vswj } ifelse +} def +/sw +{ + 0 0 0 6 3 roll swj +} def +/vjss +{ + 4 1 roll + { + dup cstring + dup length 1 eq + _charorientation 1 eq + and + { + -90 rotate + currentpoint + _fontRotateAdjust add + moveto + gsave + false charpath currentpoint + 5 index setmatrix stroke + grestore + _fontRotateAdjust sub + moveto + _sp eq + { + 5 index 5 index rmoveto + } if + 2 copy rmoveto + 90 rotate + } + { + currentpoint + _fontHeight sub + 5 index sub + 3 index _sp eq + { + 9 index sub + } if + + currentpoint + exch 4 index stringwidth pop 2 div sub + exch _fontAscent sub + moveto + + gsave + 2 index false charpath + 6 index setmatrix stroke + grestore + + moveto pop pop + } ifelse + } cforall + 6 npop +} def +/hjss +{ + 4 1 roll + { + dup cstring + gsave + false charpath currentpoint + 5 index setmatrix stroke + grestore + moveto + _sp eq + { + 5 index 5 index rmoveto + } if + 2 copy rmoveto + } cforall + 6 npop +} def +/jss +{ + _lineorientation 0 eq { hjss } { vjss } ifelse +} def +/ss +{ + 0 0 0 7 3 roll jss +} def +/vjsp +{ + 4 1 roll + { + dup cstring + dup length 1 eq + _charorientation 1 eq + and + { + -90 rotate + currentpoint + _fontRotateAdjust add + moveto + false charpath + currentpoint + _fontRotateAdjust sub + moveto + _sp eq + { + 5 index 5 index rmoveto + } if + 2 copy rmoveto + 90 rotate + } + { + currentpoint + _fontHeight sub + 5 index sub + 3 index _sp eq + { + 9 index sub + } if + + currentpoint + exch 4 index stringwidth pop 2 div sub + exch _fontAscent sub + moveto + + 2 index false charpath + + moveto pop pop + } ifelse + } cforall + 6 npop +} def +/hjsp +{ + 4 1 roll + { + dup cstring + false charpath + _sp eq + { + 5 index 5 index rmoveto + } if + 2 copy rmoveto + } cforall + 6 npop +} def +/jsp +{ + matrix currentmatrix + _lineorientation 0 eq {hjsp} {vjsp} ifelse +} def +/sp +{ + matrix currentmatrix + 0 0 0 7 3 roll + _lineorientation 0 eq {hjsp} {vjsp} ifelse +} def +/pl +{ + transform + 0.25 sub round 0.25 add exch + 0.25 sub round 0.25 add exch + itransform +} def +/setstrokeadjust where +{ + pop true setstrokeadjust + /c + { + curveto + } def + /C + /c load def + /v + { + currentpoint 6 2 roll curveto + } def + /V + /v load def + /y + { + 2 copy curveto + } def + /Y + /y load def + /l + { + lineto + } def + /L + /l load def + /m + { + moveto + } def +} +{ + /c + { + pl curveto + } def + /C + /c load def + /v + { + currentpoint 6 2 roll pl curveto + } def + /V + /v load def + /y + { + pl 2 copy curveto + } def + /Y + /y load def + /l + { + pl lineto + } def + /L + /l load def + /m + { + pl moveto + } def +} ifelse +/d +{ + setdash +} def +/cf +{ +} def +/i +{ + dup 0 eq + { + pop cf + } if + setflat +} def +/j +{ + setlinejoin +} def +/J +{ + setlinecap +} def +/M +{ + setmiterlimit +} def +/w +{ + setlinewidth +} def +/XR +{ + 0 ne + /_eo exch ddef +} def +/H +{ +} def +/h +{ + closepath +} def +/N +{ + _pola 0 eq + { + _doClip 1 eq + { + _eo {eoclip} {clip} ifelse /_doClip 0 ddef + } if + newpath + } + { + /CRender + { + N + } ddef + } ifelse +} def +/n +{ + N +} def +/F +{ + _pola 0 eq + { + _doClip 1 eq + { + gsave _pf grestore _eo {eoclip} {clip} ifelse newpath /_lp /none ddef _fc + /_doClip 0 ddef + } + { + _pf + } ifelse + } + { + /CRender + { + F + } ddef + } ifelse +} def +/f +{ + closepath + F +} def +/S +{ + _pola 0 eq + { + _doClip 1 eq + { + gsave _ps grestore _eo {eoclip} {clip} ifelse newpath /_lp /none ddef _sc + /_doClip 0 ddef + } + { + _ps + } ifelse + } + { + /CRender + { + S + } ddef + } ifelse +} def +/s +{ + closepath + S +} def +/B +{ + _pola 0 eq + { + _doClip 1 eq + gsave F grestore + { + gsave S grestore _eo {eoclip} {clip} ifelse newpath /_lp /none ddef _sc + /_doClip 0 ddef + } + { + S + } ifelse + } + { + /CRender + { + B + } ddef + } ifelse +} def +/b +{ + closepath + B +} def +/W +{ + /_doClip 1 ddef +} def +/* +{ + count 0 ne + { + dup type /stringtype eq + { + pop + } if + } if + newpath +} def +/u +{ +} def +/U +{ +} def +/q +{ + _pola 0 eq + { + gsave + } if +} def +/Q +{ + _pola 0 eq + { + grestore + } if +} def +/*u +{ + _pola 1 add /_pola exch ddef +} def +/*U +{ + _pola 1 sub /_pola exch ddef + _pola 0 eq + { + CRender + } if +} def +/D +{ + pop +} def +/*w +{ +} def +/*W +{ +} def +/` +{ + /_i save ddef + clipForward? + { + nulldevice + } if + 6 1 roll 4 npop + concat pop + userdict begin + /showpage + { + } def + 0 setgray + 0 setlinecap + 1 setlinewidth + 0 setlinejoin + 10 setmiterlimit + [] 0 setdash + /setstrokeadjust where {pop false setstrokeadjust} if + newpath + 0 setgray + false setoverprint +} def +/~ +{ + end + _i restore +} def +/O +{ + 0 ne + /_of exch ddef + /_lp /none ddef +} def +/R +{ + 0 ne + /_os exch ddef + /_lp /none ddef +} def +/g +{ + /_gf exch ddef + /_fc + { + _lp /fill ne + { + _of setoverprint + _gf setgray + /_lp /fill ddef + } if + } ddef + /_pf + { + _fc + _eo {eofill} {fill} ifelse + } ddef + /_psf + { + _fc + hvashow + } ddef + /_pjsf + { + _fc + hvawidthshow + } ddef + /_lp /none ddef +} def +/G +{ + /_gs exch ddef + /_sc + { + _lp /stroke ne + { + _os setoverprint + _gs setgray + /_lp /stroke ddef + } if + } ddef + /_ps + { + _sc + stroke + } ddef + /_pss + { + _sc + ss + } ddef + /_pjss + { + _sc + jss + } ddef + /_lp /none ddef +} def +/k +{ + _cf astore pop + /_fc + { + _lp /fill ne + { + _of setoverprint + _cf aload pop setcmykcolor + /_lp /fill ddef + } if + } ddef + /_pf + { + _fc + _eo {eofill} {fill} ifelse + } ddef + /_psf + { + _fc + hvashow + } ddef + /_pjsf + { + _fc + hvawidthshow + } ddef + /_lp /none ddef +} def +/K +{ + _cs astore pop + /_sc + { + _lp /stroke ne + { + _os setoverprint + _cs aload pop setcmykcolor + /_lp /stroke ddef + } if + } ddef + /_ps + { + _sc + stroke + } ddef + /_pss + { + _sc + ss + } ddef + /_pjss + { + _sc + jss + } ddef + /_lp /none ddef +} def +/Xa +{ + _rgbf astore pop + /_fc + { + _lp /fill ne + { + _of setoverprint + _rgbf aload pop setrgbcolor + /_lp /fill ddef + } if + } ddef + /_pf + { + _fc + _eo {eofill} {fill} ifelse + } ddef + /_psf + { + _fc + hvashow + } ddef + /_pjsf + { + _fc + hvawidthshow + } ddef + /_lp /none ddef +} def +/XA +{ + _rgbs astore pop + /_sc + { + _lp /stroke ne + { + _os setoverprint + _rgbs aload pop setrgbcolor + /_lp /stroke ddef + } if + } ddef + /_ps + { + _sc + stroke + } ddef + /_pss + { + _sc + ss + } ddef + /_pjss + { + _sc + jss + } ddef + /_lp /none ddef +} def +/_rgbtocmyk +{ +3 + { + 1 exch sub 3 1 roll + } repeat +3 copy 1 4 1 roll +3 + { + 3 index 2 copy gt + { + exch + } if + pop 4 1 roll + } repeat +pop pop pop +4 1 roll +3 + { + 3 index sub + 3 1 roll + } repeat +4 -1 roll +} def +/Xx +{ + exch + /_gf exch ddef + 0 eq + { + findcmykcustomcolor + } + { + /findrgbcustomcolor where not { + 4 1 roll _rgbtocmyk + 5 -1 roll + findcmykcustomcolor + } + { + pop + findrgbcustomcolor + } ifelse + } ifelse + /_if exch ddef + /_fc + { + _lp /fill ne + { + _of setoverprint + _if _gf 1 exch sub setcustomcolor + /_lp /fill ddef + } if + } ddef + /_pf + { + _fc + _eo {eofill} {fill} ifelse + } ddef + /_psf + { + _fc + hvashow + } ddef + /_pjsf + { + _fc + hvawidthshow + } ddef + /_lp /none ddef +} def +/XX +{ + exch + /_gs exch ddef + 0 eq + { + findcmykcustomcolor + } + { + /findrgbcustomcolor where not { + 4 1 roll _rgbtocmyk + 5 -1 roll + findcmykcustomcolor + } + { + pop + findrgbcustomcolor + } ifelse + } ifelse + /_is exch ddef + /_sc + { + _lp /stroke ne + { + _os setoverprint + _is _gs 1 exch sub setcustomcolor + /_lp /stroke ddef + } if + } ddef + /_ps + { + _sc + stroke + } ddef + /_pss + { + _sc + ss + } ddef + /_pjss + { + _sc + jss + } ddef + /_lp /none ddef +} def +/x +{ + /_gf exch ddef + findcmykcustomcolor + /_if exch ddef + /_fc + { + _lp /fill ne + { + _of setoverprint + _if _gf 1 exch sub setcustomcolor + /_lp /fill ddef + } if + } ddef + /_pf + { + _fc + _eo {eofill} {fill} ifelse + } ddef + /_psf + { + _fc + hvashow + } ddef + /_pjsf + { + _fc + hvawidthshow + } ddef + /_lp /none ddef +} def +/X +{ + /_gs exch ddef + findcmykcustomcolor + /_is exch ddef + /_sc + { + _lp /stroke ne + { + _os setoverprint + _is _gs 1 exch sub setcustomcolor + /_lp /stroke ddef + } if + } ddef + /_ps + { + _sc + stroke + } ddef + /_pss + { + _sc + ss + } ddef + /_pjss + { + _sc + jss + } ddef + /_lp /none ddef +} def +/A +{ + pop +} def +/annotatepage +{ +userdict /annotatepage 2 copy known {get exec} {pop pop} ifelse +} def +/XT { + pop pop +} def +/discard +{ + save /discardSave exch store + discardDict begin + /endString exch store + gt38? + { + 2 add + } if + load + stopped + pop + end + discardSave restore +} bind def +userdict /discardDict 7 dict dup begin +put +/pre38Initialize +{ + /endStringLength endString length store + /newBuff buffer 0 endStringLength getinterval store + /newBuffButFirst newBuff 1 endStringLength 1 sub getinterval store + /newBuffLast newBuff endStringLength 1 sub 1 getinterval store +} def +/shiftBuffer +{ + newBuff 0 newBuffButFirst putinterval + newBuffLast 0 + currentfile read not + { + stop + } if + put +} def +0 +{ + pre38Initialize + mark + currentfile newBuff readstring exch pop + { + { + newBuff endString eq + { + cleartomark stop + } if + shiftBuffer + } loop + } + { + stop + } ifelse +} def +1 +{ + pre38Initialize + /beginString exch store + mark + currentfile newBuff readstring exch pop + { + { + newBuff beginString eq + { + /layerCount dup load 1 add store + } + { + newBuff endString eq + { + /layerCount dup load 1 sub store + layerCount 0 eq + { + cleartomark stop + } if + } if + } ifelse + shiftBuffer + } loop + } if +} def +2 +{ + mark + { + currentfile buffer readline not + { + stop + } if + endString eq + { + cleartomark stop + } if + } loop +} def +3 +{ + /beginString exch store + /layerCnt 1 store + mark + { + currentfile buffer readline not + { + stop + } if + dup beginString eq + { + pop /layerCnt dup load 1 add store + } + { + endString eq + { + layerCnt 1 eq + { + cleartomark stop + } + { + /layerCnt dup load 1 sub store + } ifelse + } if + } ifelse + } loop +} def +end +userdict /clipRenderOff 15 dict dup begin +put +{ + /n /N /s /S /f /F /b /B +} +{ + { + _doClip 1 eq + { + /_doClip 0 ddef _eo {eoclip} {clip} ifelse + } if + newpath + } def +} forall +/Tr /pop load def +/Bb {} def +/BB /pop load def +/Bg {12 npop} def +/Bm {6 npop} def +/Bc /Bm load def +/Bh {4 npop} def +end +/Lb +{ + 4 npop + 6 1 roll + pop + 4 1 roll + pop pop pop + 0 eq + { + 0 eq + { + (%AI5_BeginLayer) 1 (%AI5_EndLayer--) discard + } + { + + /clipForward? true def + + /Tx /pop load def + /Tj /pop load def + + currentdict end clipRenderOff begin begin + } ifelse + } + { + 0 eq + { + save /discardSave exch store + } if + } ifelse +} bind def +/LB +{ + discardSave dup null ne + { + restore + } + { + pop + clipForward? + { + currentdict + end + end + begin + + /clipForward? false ddef + } if + } ifelse +} bind def +/Pb +{ + pop pop + 0 (%AI5_EndPalette) discard +} bind def +/Np +{ + 0 (%AI5_End_NonPrinting--) discard +} bind def +/Ln /pop load def +/Ap +/pop load def +/Ar +{ + 72 exch div + 0 dtransform dup mul exch dup mul add sqrt + dup 1 lt + { + pop 1 + } if + setflat +} def +/Mb +{ + q +} def +/Md +{ +} def +/MB +{ + Q +} def +/nc 4 dict def +nc begin +/setgray +{ + pop +} bind def +/setcmykcolor +{ + 4 npop +} bind def +/setrgbcolor +{ + 3 npop +} bind def +/setcustomcolor +{ + 2 npop +} bind def +currentdict readonly pop +end +end +setpacking +%%EndResource +%%BeginResource: procset Adobe_cshow 2.0 8 +%%Title: (Writing System Operators) +%%Version: 2.0 8 +%%CreationDate: (1/23/89) () +%%Copyright: ((C) 1992-1996 Adobe Systems Incorporated All Rights Reserved) +currentpacking true setpacking +userdict /Adobe_cshow 14 dict dup begin put +/initialize +{ + Adobe_cshow begin + Adobe_cshow + { + dup xcheck + { + bind + } if + pop pop + } forall + end + Adobe_cshow begin +} def +/terminate +{ +currentdict Adobe_cshow eq + { + end + } if +} def +/cforall +{ + /_lobyte 0 ddef + /_hibyte 0 ddef + /_cproc exch ddef + /_cscript currentfont /FontScript known { currentfont /FontScript get } { -1 } ifelse ddef + { + /_lobyte exch ddef + _hibyte 0 eq + _cscript 1 eq + _lobyte 129 ge _lobyte 159 le and + _lobyte 224 ge _lobyte 252 le and or and + _cscript 2 eq + _lobyte 161 ge _lobyte 254 le and and + _cscript 3 eq + _lobyte 161 ge _lobyte 254 le and and + _cscript 25 eq + _lobyte 161 ge _lobyte 254 le and and + _cscript -1 eq + or or or or and + { + /_hibyte _lobyte ddef + } + { + _hibyte 256 mul _lobyte add + _cproc + /_hibyte 0 ddef + } ifelse + } forall +} def +/cstring +{ + dup 256 lt + { + (s) dup 0 4 3 roll put + } + { + dup 256 idiv exch 256 mod + (hl) dup dup 0 6 5 roll put 1 4 3 roll put + } ifelse +} def +/clength +{ + 0 exch + { 256 lt { 1 } { 2 } ifelse add } cforall +} def +/hawidthshow +{ + { + dup cstring + show + _hvax _hvay rmoveto + _hvwb eq { _hvcx _hvcy rmoveto } if + } cforall +} def +/vawidthshow +{ + { + dup 255 le + _charorientation 1 eq + and + { + -90 rotate + 0 _fontRotateAdjust rmoveto + cstring + _hvcx _hvcy _hvwb _hvax _hvay 6 -1 roll awidthshow + 0 _fontRotateAdjust neg rmoveto + 90 rotate + } + { + currentpoint + _fontHeight sub + exch _hvay sub exch _hvax sub + 2 index _hvwb eq { exch _hvcy sub exch _hvcx sub } if + 3 2 roll + cstring + dup stringwidth pop 2 div neg _fontAscent neg rmoveto + show + moveto + } ifelse + } cforall +} def +/hvawidthshow +{ + 6 1 roll + /_hvay exch ddef + /_hvax exch ddef + /_hvwb exch ddef + /_hvcy exch ddef + /_hvcx exch ddef + _lineorientation 0 eq { hawidthshow } { vawidthshow } ifelse +} def +/hvwidthshow +{ + 0 0 3 -1 roll hvawidthshow +} def +/hvashow +{ + 0 0 0 6 -3 roll hvawidthshow +} def +/hvshow +{ + 0 0 0 0 0 6 -1 roll hvawidthshow +} def +currentdict readonly pop end +setpacking +%%EndResource +%%EndProlog +%%BeginSetup +Adobe_level2_AI5 /initialize get exec +Adobe_cshow /initialize get exec +Adobe_ColorImage_AI6 /initialize get exec +Adobe_Illustrator_AI5 /initialize get exec +%AI5_Begin_NonPrinting +Np +%AI3_BeginPattern: (Arrow1.2.out/in) +(Arrow1.2.out/in) 1 1 39.4039 39.4039 [ +%AI3_Tile +(0 O 0 R 0.75 0.75 0.375 0 k + 0.75 0.75 0.375 0 K +) @ +( +%AI6_BeginPatternLayer +800 Ar +1 J 0 j 1 w 4 M []0 d +%AI3_Note: +0 D +0 XR +33.9039 15.6187 m +39.4247 20.202 L +39.4247 20.202 L +33.8869 24.6252 L +S +39.2997 20.202 m +24.5706 20.202 l +20.4039 20.4792 20.4039 16.8125 v +20.4039 13.1458 20.4039 12.5625 y +S +%AI6_EndPatternLayer +) & +] E +%AI3_EndPattern +%AI3_BeginPattern: (Arrow1.2.side) +(Arrow1.2.side) 1 1 39.404 39.4039 [ +%AI3_Tile +(0 O 0 R 0.75 0.75 0.375 0 k + 0.75 0.75 0.375 0 K +) @ +( +%AI6_BeginPatternLayer +800 Ar +1 J 0 j 1 w 4 M []0 d +%AI3_Note: +0 D +0 XR +20.202 20.202 m +39.404 20.202 l +S +33.904 15.6187 m +39.4248 20.202 L +39.4248 20.202 L +33.887 24.6252 L +S +%AI6_EndPatternLayer +) & +] E +%AI3_EndPattern +%AI3_BeginPattern: (Bricks) +(Bricks) 1.6 1.6 73.6 73.6 [ +%AI3_Tile +(0 O 0 R 0.3 0.85 0.85 0 k + 0.3 0.85 0.85 0 K +) @ +( +%AI6_BeginPatternLayer +800 Ar +0 J 0 j 1 w 4 M []0 d +%AI3_Note: +0 D +0 XR +1.6 1.6 m +1.6 73.6 L +73.6 73.6 L +73.6 1.6 L +1.6 1.6 L +f +%AI6_EndPatternLayer +) & +(0 O 0 R 1 g + 1 G +) @ +( +%AI6_BeginPatternLayer +800 Ar +0 J 0 j 0.3 w 4 M []0 d +%AI3_Note: +0 D +0 XR +1.6 70.01 m +73.6 70.01 l +S +1.6 62.809 m +73.6 62.809 L +S +1.6 55.609 m +73.6 55.609 L +S +1.6 48.408 m +73.6 48.408 L +S +1.6 41.208 m +73.6 41.208 L +S +1.6 34.007 m +73.6 34.007 L +S +1.6 26.807 m +73.6 26.807 L +S +1.6 19.606 m +73.6 19.606 L +S +1.6 12.406 m +73.6 12.406 L +S +1.6 5.206 m +73.6 5.206 L +S +70.01 70.01 m +70.01 62.822 l +S +55.61 70.01 m +55.61 62.822 L +S +41.21 70.01 m +41.21 62.822 L +S +26.81 70.01 m +26.81 62.822 L +S +12.41 70.01 m +12.41 62.822 L +S +70.01 55.572 m +70.01 48.385 l +S +55.61 55.572 m +55.61 48.385 L +S +41.21 55.572 m +41.21 48.385 L +S +26.81 55.572 m +26.81 48.385 L +S +12.41 55.572 m +12.41 48.385 L +S +70.01 41.197 m +70.01 34.01 l +S +55.61 41.197 m +55.61 34.01 L +S +41.21 41.197 m +41.21 34.01 L +S +26.81 41.197 m +26.81 34.01 L +S +12.41 41.197 m +12.41 34.01 L +S +70.01 26.822 m +70.01 19.635 l +S +55.61 26.822 m +55.61 19.635 L +S +41.21 26.822 m +41.21 19.635 L +S +26.81 26.822 m +26.81 19.635 L +S +12.41 26.822 m +12.41 19.635 L +S +70.01 12.385 m +70.01 5.197 l +S +55.61 12.385 m +55.61 5.197 L +S +41.21 12.385 m +41.21 5.197 L +S +26.81 12.385 m +26.81 5.197 L +S +12.41 12.385 m +12.41 5.197 L +S +62.797 5.197 m +62.797 1.6 L +S +48.397 5.197 m +48.397 1.6 L +S +33.997 5.197 m +33.997 1.6 L +S +19.597 5.197 m +19.597 1.6 L +S +5.197 5.197 m +5.197 1.6 l +S +62.797 19.635 m +62.797 12.447 L +S +48.397 19.635 m +48.397 12.447 L +S +33.997 19.635 m +33.997 12.447 L +S +19.597 19.635 m +19.597 12.447 L +S +5.197 19.635 m +5.197 12.447 l +S +62.797 34.01 m +62.797 26.822 L +S +48.397 34.01 m +48.397 26.822 L +S +19.597 34.01 m +19.597 26.822 L +S +5.197 34.01 m +5.197 26.822 l +S +62.797 48.385 m +62.797 41.197 L +S +48.397 48.385 m +48.397 41.197 L +S +33.997 48.385 m +33.997 41.197 L +S +19.597 48.385 m +19.597 41.197 L +S +5.197 48.385 m +5.197 41.197 l +S +62.797 62.822 m +62.797 55.635 L +S +48.397 62.822 m +48.397 55.635 L +S +33.997 62.822 m +33.997 55.635 L +S +19.597 62.822 m +19.597 55.635 L +S +5.197 62.822 m +5.197 55.635 l +S +62.797 73.5589 m +62.797 70.072 L +S +48.397 73.5589 m +48.397 70.072 L +S +33.997 73.5589 m +33.997 70.072 L +S +19.597 73.5589 m +19.597 70.072 L +S +5.197 73.5589 m +5.197 70.072 l +S +33.997 34.01 m +33.997 26.822 L +S +%AI6_EndPatternLayer +) & +] E +%AI3_EndPattern +%AI3_BeginPattern: (Checks) +(Checks) 1 1 31.3995 31.3995 [ +%AI3_Tile +(0 O 0 R 0 0.9 1 0 k + 0 0.9 1 0 K +) @ +( +%AI6_BeginPatternLayer +800 Ar +0 J 0 j 1 w 4 M []0 d +%AI3_Note: +0 D +1 XR +19.9995 4.8 m +27.5995 4.8 L +27.5995 12.3995 L +19.9995 12.3995 L +19.9995 4.8 L +f +31.3995 27.5995 m +31.3995 31.3995 L +27.5995 31.3995 L +27.5995 27.5995 L +31.3995 27.5995 L +f +19.9995 27.5995 m +19.9995 19.9995 L +27.5995 19.9995 L +27.5995 27.5995 L +19.9995 27.5995 L +f +0 XR +12.3995 12.3995 m +19.9995 12.3995 L +19.9995 19.9995 L +12.3995 19.9995 L +12.3995 12.3995 L +f +1 XR +12.3995 27.5995 m +4.8 27.5995 L +4.8 19.9995 L +12.3995 19.9995 L +12.3995 27.5995 L +f +4.8 12.3995 m +4.8 4.8 L +12.3995 4.8 L +12.3995 12.3995 L +4.8 12.3995 L +f +19.9995 27.5995 m +19.9995 31.3995 L +12.3995 31.3995 L +12.3995 27.5995 L +19.9995 27.5995 L +f +12.3995 4.8 m +12.3995 1 L +19.9995 1 L +19.9995 4.8 L +12.3995 4.8 L +f +4.8 19.9995 m +1 19.9995 L +1 12.3995 L +4.8 12.3995 L +4.8 19.9995 L +f +27.5995 19.9995 m +27.5995 12.3995 L +31.3995 12.3995 L +31.3995 19.9995 L +27.5995 19.9995 L +f +4.8 31.3995 m +1 31.3995 L +1 27.5995 L +4.8 27.5995 L +4.8 31.3995 L +f +27.5995 1 m +31.3995 1 L +31.3995 4.8 L +27.5995 4.8 L +27.5995 1 L +f +1 4.8 m +1 1 L +4.8 1 L +4.8 4.8 L +1 4.8 L +f +%AI6_EndPatternLayer +) & +(0 O 0 R 0 0.05 0.2 0 k + 0 0.05 0.2 0 K +) @ +( +%AI6_BeginPatternLayer +800 Ar +0 J 0 j 1 w 4 M []0 d +%AI3_Note: +0 D +1 XR +4.8 4.8 m +4.8 1 L +12.3995 1 L +12.3995 4.8 L +4.8 4.8 L +f +4.8 12.3995 m +1 12.3995 L +1 4.8 L +4.8 4.8 L +4.8 12.3995 L +f +19.9995 4.8 m +19.9995 1 L +27.5995 1 L +27.5995 4.8 L +19.9995 4.8 L +f +12.3995 12.3995 m +12.3995 4.8 L +19.9995 4.8 L +19.9995 12.3995 L +12.3995 12.3995 L +f +27.5995 4.8 m +31.3995 4.8 L +31.3995 12.3995 L +27.5995 12.3995 L +27.5995 4.8 L +f +12.3995 19.9995 m +4.8 19.9995 L +4.8 12.3995 L +12.3995 12.3995 L +12.3995 19.9995 L +f +4.8 27.5995 m +1 27.5995 L +1 19.9995 L +4.8 19.9995 L +4.8 27.5995 L +f +19.9995 12.3995 m +27.5995 12.3995 L +27.5995 19.9995 L +19.9995 19.9995 L +19.9995 12.3995 L +f +19.9995 19.9995 m +19.9995 27.5995 L +12.3995 27.5995 L +12.3995 19.9995 L +19.9995 19.9995 L +f +27.5995 19.9995 m +31.3995 19.9995 L +31.3995 27.5995 L +27.5995 27.5995 L +27.5995 19.9995 L +f +12.3995 27.5995 m +12.3995 31.3995 L +4.8 31.3995 L +4.8 27.5995 L +12.3995 27.5995 L +f +27.5995 27.5995 m +27.5995 31.3995 L +19.9995 31.3995 L +19.9995 27.5995 L +27.5995 27.5995 L +f +%AI6_EndPatternLayer +) & +] E +%AI3_EndPattern +%AI3_BeginPattern: (Confetti) +(Confetti) 4.85 3.617 76.85 75.617 [ +%AI3_Tile +(0 O 0 R 1 g + 1 G +) @ +( +%AI6_BeginPatternLayer +800 Ar +0 J 0 j 1 w 4 M []0 d +%AI3_Note: +0 D +0 XR +4.85 3.617 m +4.85 75.617 L +76.85 75.617 L +76.85 3.617 L +4.85 3.617 L +f +%AI6_EndPatternLayer +) & +(0 O 0 R 0 g + 0 G +) @ +( +%AI6_BeginPatternLayer +800 Ar +0 J 0 j 0.3 w 4 M []0 d +%AI3_Note: +0 D +0 XR +10.6 64.867 m +7.85 62.867 l +S +9.1 8.617 m +6.85 6.867 l +S +78.1 68.617 m +74.85 67.867 l +S +76.85 56.867 m +74.35 55.117 l +S +79.6 51.617 m +76.6 51.617 l +S +76.35 44.117 m +73.6 45.867 l +S +78.6 35.867 m +76.6 34.367 l +S +76.1 23.867 m +73.35 26.117 l +S +78.1 12.867 m +73.85 13.617 l +S +68.35 14.617 m +66.1 12.867 l +S +76.6 30.617 m +73.6 30.617 l +S +62.85 58.117 m +60.956 60.941 l +S +32.85 59.617 m +31.196 62.181 l +S +47.891 64.061 m +49.744 66.742 l +S +72.814 2.769 m +73.928 5.729 l +S +67.976 2.633 m +67.35 5.909 l +S +61.85 27.617 m +59.956 30.441 l +S +53.504 56.053 m +51.85 58.617 l +S +52.762 1.779 m +52.876 4.776 l +S +45.391 5.311 m +47.244 7.992 l +S +37.062 3.375 m +35.639 5.43 l +S +55.165 34.828 m +57.518 37.491 l +S +20.795 3.242 m +22.12 5.193 l +S +14.097 4.747 m +15.008 8.965 l +S +9.736 1.91 m +8.073 4.225 l +S +31.891 5.573 m +32.005 8.571 l +S +12.1 70.367 m +15.6 68.867 l +S +9.35 54.867 m +9.6 58.117 l +S +12.85 31.867 m +14.35 28.117 l +S +10.1 37.367 m +12.35 41.117 l +S +34.1 71.117 m +31.85 68.617 l +S +38.35 71.117 m +41.6 68.367 l +S +55.1 71.117 m +58.35 69.117 l +S +57.35 65.117 m +55.35 61.867 l +S +64.35 66.367 m +69.35 68.617 l +S +71.85 62.867 m +69.35 61.117 l +S +23.6 70.867 m +23.6 67.867 l +S +20.6 65.867 m +17.35 65.367 l +S +24.85 61.367 m +25.35 58.117 l +S +25.85 65.867 m +29.35 66.617 l +S +14.1 54.117 m +16.85 56.117 l +S +12.35 11.617 m +12.6 15.617 l +S +12.1 19.867 m +14.35 22.367 l +S +26.1 9.867 m +23.6 13.367 l +S +34.6 47.117 m +32.1 45.367 l +S +62.6 41.867 m +59.85 43.367 l +S +31.6 35.617 m +27.85 36.367 l +S +36.35 26.117 m +34.35 24.617 l +S +33.85 14.117 m +31.1 16.367 l +S +37.1 9.867 m +35.1 11.117 l +S +34.35 20.867 m +31.35 20.867 l +S +44.6 56.617 m +42.1 54.867 l +S +47.35 51.367 m +44.35 51.367 l +S +44.1 43.867 m +41.35 45.617 l +S +43.35 33.117 m +42.6 30.617 l +S +43.85 23.617 m +41.1 25.867 l +S +44.35 15.617 m +42.35 16.867 l +S +67.823 31.1 m +64.823 31.1 l +S +27.1 32.617 m +29.6 30.867 l +S +31.85 55.117 m +34.85 55.117 l +S +19.6 40.867 m +22.1 39.117 l +S +16.85 35.617 m +19.85 35.617 l +S +20.1 28.117 m +22.85 29.867 l +S +52.1 42.617 m +54.484 44.178 l +S +52.437 50.146 m +54.821 48.325 l +S +59.572 54.133 m +59.35 51.117 l +S +50.185 10.055 m +53.234 9.928 l +S +51.187 15.896 m +53.571 14.075 l +S +58.322 19.883 m +59.445 16.823 l +S +53.1 32.117 m +50.6 30.367 l +S +52.85 24.617 m +49.6 25.617 l +S +61.85 9.117 m +59.1 10.867 l +S +69.35 34.617 m +66.6 36.367 l +S +67.1 23.617 m +65.1 22.117 l +S +24.435 46.055 m +27.484 45.928 l +S +25.437 51.896 m +27.821 50.075 l +S +62.6 47.117 m +65.321 46.575 l +S +19.85 19.867 m +20.35 16.617 l +S +21.85 21.867 m +25.35 22.617 l +S +37.6 62.867 m +41.6 62.117 l +S +38.323 42.1 m +38.823 38.6 l +S +69.35 52.617 m +66.85 53.867 l +S +14.85 62.117 m +18.1 59.367 l +S +9.6 46.117 m +7.1 44.367 l +S +20.6 51.617 m +18.6 50.117 l +S +46.141 70.811 m +47.994 73.492 l +S +69.391 40.561 m +71.244 43.242 l +S +38.641 49.311 m +39.35 52.117 l +S +25.141 16.811 m +25.85 19.617 l +S +36.6 32.867 m +34.6 31.367 l +S +6.1 68.617 m +2.85 67.867 l +S +4.85 56.867 m +2.35 55.117 l +S +7.6 51.617 m +4.6 51.617 l +S +6.6 35.867 m +4.6 34.367 l +S +6.1 12.867 m +1.85 13.617 l +S +4.6 30.617 m +1.6 30.617 l +S +72.814 74.769 m +73.928 77.729 l +S +67.976 74.633 m +67.35 77.909 l +S +52.762 73.779 m +52.876 76.776 l +S +37.062 75.375 m +35.639 77.43 l +S +20.795 75.242 m +22.12 77.193 l +S +9.736 73.91 m +8.073 76.225 l +S +10.1 23.617 m +6.35 24.367 l +S +73.217 18.276 m +71.323 21.1 l +S +28.823 39.6 m +29.505 42.389 l +S +49.6 38.617 m +47.6 37.117 l +S +60.323 73.6 m +62.323 76.6 l +S +60.323 1.6 m +62.323 4.6 l +S +%AI6_EndPatternLayer +) & +] E +%AI3_EndPattern +%AI3_BeginPattern: (DblLine1.2.inner) +(DblLine1.2.inner) 1 1 39.2705 39.2706 [ +%AI3_Tile +(0 O 0 R 1 0.14 0.09 0 k + 1 0.14 0.09 0 K +) @ +( +%AI6_BeginPatternLayer +800 Ar +0 J 0 j 1 w 4 M []0 d +%AI3_Note: +0 D +0 XR +39.2702 22.175 m +39.2702 13.6108 L +26.66 13.6108 L +26.66 1.0003 L +18.0958 1.0003 L +18.0948 22.175 L +18.0958 22.175 L +18.0958 22.1752 L +39.2702 22.175 L +f +39.2708 24.6929 m +15.5779 24.6929 L +15.5779 1.0003 L +14.9037 1.0003 L +14.9032 25.3675 L +39.2708 25.3675 L +39.2708 24.6929 L +f +%AI6_EndPatternLayer +) & +] E +%AI3_EndPattern +%AI3_BeginPattern: (DblLine1.2.outer) +(DblLine1.2.outer) 1 1.0003 39.2706 39.271 [ +%AI3_Tile +(0 O 0 R 1 0.14 0.09 0 k + 1 0.14 0.09 0 K +) @ +( +%AI6_BeginPatternLayer +800 Ar +0 J 0 j 0.3 w 4 M []0 d +%AI3_Note: +0 D +0 XR +39.2708 26.6602 m +13.6111 26.6602 L +13.6111 1.0005 L +22.1751 1 L +22.1751 18.096 L +39.2708 18.096 L +39.2708 26.6602 L +f +39.2708 15.578 m +24.6928 15.578 L +24.6928 1 L +25.367 1 L +25.367 14.9038 L +39.2708 14.9038 L +39.2708 15.578 L +f +%AI6_EndPatternLayer +) & +] E +%AI3_EndPattern +%AI3_BeginPattern: (DblLine1.2.side) +(DblLine1.2.side) 1 1 39.2706 39.2706 [ +%AI3_Tile +(0 O 0 R 1 0.14 0.09 0 k + 1 0.14 0.09 0 K +) @ +( +%AI6_BeginPatternLayer +800 Ar +0 J 0 j 0.3 w 4 M []0 d +%AI3_Note: +0 D +0 XR +39.2704 18.0958 m +39.2704 26.6598 L +1.0001 26.6598 L +1.0001 18.0958 L +39.2704 18.0958 L +f +39.2704 14.9037 m +39.2704 15.5776 L +1.0001 15.5776 L +1.0001 14.9037 L +39.2704 14.9037 L +f +%AI6_EndPatternLayer +) & +] E +%AI3_EndPattern +%AI3_BeginPattern: (Diamonds) +(Diamonds) 1 1 37.1865 41.9411 [ +%AI3_Tile +(0 O 0 R 0.2 0 1 0 k + 0.2 0 1 0 K +) @ +( +%AI6_BeginPatternLayer +800 Ar +0 J 0 j 0.3 w 4 M []0 d +%AI3_Note: +0 D +0 XR +1.0002 1.0004 m +1.0002 41.9411 L +37.1865 41.9411 L +37.1865 1.0004 L +1.0002 1.0004 L +f +%AI6_EndPatternLayer +) & +(0 O 0 R 0 g + 0 G +) @ +( +%AI6_BeginPatternLayer +800 Ar +0 J 0 j 1 w 4 M []0 d +%AI3_Note: +0 D +1 XR +19.0936 41.9408 m +19.0929 41.9408 L +19.0933 41.9402 L +19.0936 41.9408 L +f +7.0311 41.9408 m +7.0304 41.9408 L +7.0308 41.9402 L +7.0311 41.9408 L +f +31.1556 41.9408 m +31.1548 41.9408 L +31.1552 41.9402 L +31.1556 41.9408 L +f +%AI6_EndPatternLayer +) & +(0 O 0 R 0.75 0.9 0 0 k + 0.75 0.9 0 0 K +) @ +( +%AI6_BeginPatternLayer +800 Ar +0 J 0 j 0.3 w 4 M []0 d +%AI3_Note: +0 D +1 XR +37.1865 1 m +37.1865 11.2349 L +31.1552 1 L +37.1865 1 L +f +19.0933 1 m +31.1552 1 L +25.124 11.2349 L +19.0933 1 L +f +7.0308 1 m +19.0933 1 L +13.062 11.2349 L +7.0308 1 L +f +1 1 m +7.0308 1 L +1 11.2349 L +1 1 L +f +37.1859 11.2349 m +37.1865 11.236 L +37.1865 31.7059 L +31.1552 21.4704 L +37.1859 11.2349 L +f +19.0933 21.4704 m +25.124 11.2349 L +31.1552 21.4704 L +25.124 31.7059 L +19.0933 21.4704 L +f +7.0308 21.4704 m +13.062 11.2349 L +19.0933 21.4704 L +13.062 31.7059 L +7.0308 21.4704 L +f +1 31.7059 m +1 11.2349 L +7.0308 21.4704 L +1 31.7059 L +f +37.1859 31.7059 m +37.1865 31.707 L +37.1865 41.9408 L +31.1556 41.9408 L +31.1552 41.9402 L +37.1859 31.7059 L +f +25.124 31.7059 m +31.1552 41.9402 L +31.1548 41.9408 L +19.0936 41.9408 L +19.0933 41.9402 L +25.124 31.7059 L +f +13.062 31.7059 m +19.0933 41.9402 L +19.0929 41.9408 L +7.0311 41.9408 L +7.0308 41.9402 L +13.062 31.7059 L +f +7.0304 41.9408 m +1 41.9408 L +1 31.7059 L +7.0308 41.9402 L +7.0304 41.9408 L +f +%AI6_EndPatternLayer +) & +] E +%AI3_EndPattern +%AI3_BeginPattern: (Hexagon) +(Hexagon) 4 1.6 70.151 77.983 [ +%AI3_Tile +(0 O 0 R 0 1 0.35 0 k + 0 1 0.35 0 K +) @ +( +%AI6_BeginPatternLayer +800 Ar +0 J 0 j 1 w 4 M []0 d +%AI3_Note: +0 D +0 XR +70.151 77.983 m +70.151 1.6 L +4 1.6 L +4 77.983 L +70.151 77.983 L +f +%AI6_EndPatternLayer +) & +(0 O 0 R 0.9921 1 0 0 k + 0.9921 1 0 0 K +) @ +( +%AI6_BeginPatternLayer +800 Ar +0 J 0 j 0.3 w 4 M []0 d +%AI3_Note: +0 D +0 XR +20.538 30.244 m +S +26.05 20.696 m +15.025 20.696 L +9.513 30.244 L +15.025 39.792 L +26.05 39.792 L +31.564 30.244 L +26.05 20.696 L +s +20.537 11.148 m +S +26.05 1.6 m +15.024 1.6 L +9.512 11.148 L +15.024 20.696 L +26.05 20.696 L +31.563 11.148 L +26.05 1.6 L +s +53.614 30.244 m +S +59.126 20.696 m +48.101 20.696 L +42.589 30.244 L +48.101 39.792 L +59.126 39.792 L +64.639 30.244 L +59.126 20.696 L +s +53.614 11.148 m +S +59.126 1.6 m +48.101 1.6 L +42.588 11.148 L +48.101 20.696 L +59.126 20.696 L +64.638 11.148 L +59.126 1.6 L +s +20.538 68.436 m +S +26.051 58.888 m +15.025 58.888 L +9.513 68.436 L +15.025 77.984 L +26.051 77.984 L +31.564 68.436 L +26.051 58.888 L +s +20.538 49.34 m +S +26.051 39.792 m +15.025 39.792 L +9.513 49.34 L +15.025 58.888 L +26.05 58.888 L +31.564 49.34 L +26.051 39.792 L +s +53.614 68.436 m +S +59.127 58.888 m +48.102 58.888 L +42.589 68.436 L +48.101 77.985 L +59.127 77.985 L +64.639 68.436 L +59.127 58.888 L +s +53.614 49.34 m +S +59.127 39.792 m +48.101 39.792 L +42.589 49.34 L +48.101 58.888 L +59.127 58.888 L +64.639 49.341 L +59.127 39.792 L +s +4 20.696 m +S +3.876 30.244 m +9.512 30.244 L +15.024 20.696 L +9.512 11.147 L +3.876 11.147 L +S +37.075 20.696 m +S +42.588 11.148 m +31.563 11.148 L +26.05 20.696 L +31.563 30.244 L +42.589 30.244 L +48.101 20.696 L +42.588 11.148 L +s +37.076 58.888 m +S +42.589 49.34 m +31.564 49.34 L +26.05 58.888 L +31.564 68.436 L +42.589 68.436 L +48.101 58.888 L +42.589 49.34 L +s +70.151 20.696 m +S +70.2094 11.147 m +64.639 11.147 L +59.127 20.696 L +64.639 30.244 L +70.2094 30.244 L +S +70.152 58.888 m +S +70.0427 49.34 m +64.639 49.34 L +59.127 58.888 L +64.639 68.436 L +70.0427 68.436 L +S +4 58.888 m +S +3.876 68.436 m +9.513 68.436 L +15.025 58.888 L +9.513 49.34 L +3.876 49.34 L +S +%AI6_EndPatternLayer +) & +] E +%AI3_EndPattern +%AI3_BeginPattern: (Laurel.inner) +(Laurel.inner) 1 1 28.5392 28.5392 [ +%AI3_Tile +(0 O 0 R 0 0.55 1 0.12 k + 0 0.55 1 0.12 K +) @ +( +%AI6_BeginPatternLayer +800 Ar +0 J 0 j 0.3 w 4 M []0 d +%AI3_Note: +0 D +0 XR +19.2768 15.3585 m +28.9144 15.3585 L +28.9144 14.2335 L +19.2768 14.2335 L +19.2768 15.3585 L +f +%AI6_EndPatternLayer +) & +(0 O 0 R 0 0.55 1 0.3 k + 0 0.55 1 0.3 K +) @ +( +%AI6_BeginPatternLayer +800 Ar +0 J 0 j 0.3 w 4 M []0 d +%AI3_Note: +0 D +0 XR +14.7461 18.9624 m +13.0264 17.8486 11.3273 14.4193 11.3273 10.0362 c +11.3273 5.6547 12.9768 2.1518 14.744 1.1112 C +14.7443 1.1112 L +16.4707 2.1518 18.1679 5.6547 18.1679 10.0362 c +18.1679 14.4143 16.432 17.8633 14.7461 18.9624 C +f +%AI6_EndPatternLayer +) & +] E +%AI3_EndPattern +%AI3_BeginPattern: (Laurel.outer) +(Laurel.outer) 1 1.3751 28.5393 28.9143 [ +%AI3_Tile +(0 O 0 R 0 0.55 1 0.12 k + 0 0.55 1 0.12 K +) @ +( +%AI6_BeginPatternLayer +800 Ar +0 J 0 j 0.3 w 4 M []0 d +%AI3_Note: +0 D +0 XR +14.2395 10.6375 m +14.2395 1 L +15.3645 1 L +15.3645 10.6375 L +14.2395 10.6375 L +f +%AI6_EndPatternLayer +) & +(0 O 0 R 0 0.55 1 0.3 k + 0 0.55 1 0.3 K +) @ +( +%AI6_BeginPatternLayer +800 Ar +0 J 0 j 0.3 w 4 M []0 d +%AI3_Note: +0 D +0 XR +10.5769 15.124 m +11.6906 16.8438 15.1198 18.5429 19.503 18.5429 c +23.8844 18.5429 27.3874 16.8935 28.428 15.1262 C +28.428 15.1259 L +27.3874 13.3995 23.8844 11.7023 19.503 11.7023 c +15.1249 11.7023 11.676 13.4382 10.5769 15.124 C +f +%AI6_EndPatternLayer +) & +] E +%AI3_EndPattern +%AI3_BeginPattern: (Laurel.side) +(Laurel.side) 1.3972 1 28.9364 28.5392 [ +%AI3_Tile +(0 O 0 R 0 0.55 1 0.12 k + 0 0.55 1 0.12 K +) @ +( +%AI6_BeginPatternLayer +800 Ar +0 J 0 j 0.3 w 4 M []0 d +%AI3_Note: +0 D +0 XR +29.1571 15.2998 m +1 15.2998 L +1 14.1748 L +29.1571 14.1748 L +29.1571 15.2998 L +f +%AI6_EndPatternLayer +) & +(0 O 0 R 0 0.55 1 0.3 k + 0 0.55 1 0.3 K +) @ +( +%AI6_BeginPatternLayer +800 Ar +0 J 0 j 0.3 w 4 M []0 d +%AI3_Note: +0 D +0 XR +2.0183 27.4787 m +1.5899 25.4751 2.8132 21.8488 5.9125 18.7494 c +9.0107 15.6513 12.654 14.3407 14.6395 14.8545 C +14.6398 14.8547 L +15.1246 16.8113 13.8478 20.4883 10.7496 23.5865 c +7.6538 26.6824 3.9876 27.8936 2.0183 27.4787 C +f +%AI6_EndPatternLayer +) & +(0 O 0 R 0 0.39 0.7 0.12 k + 0 0.39 0.7 0.12 K +) @ +( +%AI6_BeginPatternLayer +800 Ar +0 J 0 j 0.3 w 4 M []0 d +%AI3_Note: +0 D +0 XR +2.0183 2.0091 m +1.5899 4.0126 2.8132 7.6389 5.9125 10.7382 c +9.0107 13.8365 12.654 15.147 14.6395 14.6332 C +14.6398 14.633 L +15.1246 12.6765 13.8478 8.9993 10.7496 5.9011 c +7.6538 2.8054 3.9876 1.5941 2.0183 2.0091 C +f +%AI6_EndPatternLayer +) & +(0 O 0 R 0 0.55 1 0.3 k + 0 0.55 1 0.3 K +) @ +( +%AI6_BeginPatternLayer +800 Ar +0 J 0 j 0.3 w 4 M []0 d +%AI3_Note: +0 D +0 XR +15.821 2.0091 m +15.3925 4.0126 16.6159 7.6389 19.7152 10.7382 c +22.8134 13.8365 26.4567 15.147 28.4422 14.6332 C +28.4424 14.633 L +28.9273 12.6765 27.6505 8.9993 24.5523 5.9011 c +21.4565 2.8054 17.7903 1.5941 15.821 2.0091 C +f +%AI6_EndPatternLayer +) & +(0 O 0 R 0 0.39 0.7 0.12 k + 0 0.39 0.7 0.12 K +) @ +( +%AI6_BeginPatternLayer +800 Ar +0 J 0 j 0.3 w 4 M []0 d +%AI3_Note: +0 D +0 XR +15.821 27.4787 m +15.3925 25.4751 16.6159 21.8488 19.7152 18.7494 c +22.8134 15.6513 26.4567 14.3407 28.4422 14.8545 C +28.4424 14.8547 L +28.9273 16.8113 27.6505 20.4883 24.5523 23.5865 c +21.4565 26.6824 17.7903 27.8936 15.821 27.4787 C +f +%AI6_EndPatternLayer +) & +] E +%AI3_EndPattern +%AI3_BeginPattern: (Leaves-fall) +(Leaves-fall) 1 1 52.733 89.816 [ +%AI3_Tile +(0 O 0 R 0.05 0.2 1 0 k + 0.05 0.2 1 0 K +) @ +( +%AI6_BeginPatternLayer +800 Ar +0 J 0 j 1 w 4 M []0 d +%AI3_Note: +0 D +0 XR +52.733 89.816 m +52.733 1 L +1 1 L +1 89.816 L +52.733 89.816 L +f +%AI6_EndPatternLayer +) & +(0 O 0 R 0.83 0 1 0 k + 0.83 0 1 0 K +) @ +( +%AI6_BeginPatternLayer +800 Ar +0 J 0 j 1 w 4 M []0 d +%AI3_Note: +1 D +0 XR +25.317 2.083 m +25.994 2.283 26.284 2.435 V +24.815 5.147 29.266 9.428 30.186 10.168 C +30.787 9.943 30.907 7.41 30.23 6.073 C +31.073 6.196 33.262 4.818 34.02 3.529 C +34.085 4.217 35.655 7.158 36.481 7.535 C +35.561 7.933 34.896 9.406 34.134 10.854 C +35.156 11.021 36.555 10.1 38.026 9.195 C +38.541 9.996 39.915 10.968 41.174 11.484 C +40.086 12.171 39.591 12.912 39.094 14.372 C +38.052 13.806 35.865 13.657 35.336 13.944 C +35.85 15.057 38.096 15.6 38.827 15.547 C +38.573 16.409 38.425 18.562 38.598 21.155 C +36.939 19.839 35.393 18.522 33.734 18.58 C +34.003 17.158 33.367 15.353 32.99 14.86 C +32.417 15.604 32.006 16.431 32.361 18.408 C +30.908 18.893 29.671 19.439 28.297 20.697 C +28.297 18.866 27.725 17.664 26.857 16.388 C +28.117 15.9 29.389 14.697 29.385 13.658 C +28.537 13.81 26.845 14.554 26.352 15.547 C +25.634 14.8 23.95 13.491 22.346 13.487 C +23.534 12.632 24.454 11.598 24.549 9.686 C +25.802 10.657 28.255 11.272 29.635 10.674 C +24.794 6.438 25.262 3.405 25.317 2.083 C +f +12.412 33.743 m +11.887 33.272 11.691 33.01 V +14.182 31.192 11.928 25.366 11.415 24.303 C +10.776 24.247 9.369 26.988 9.405 28.486 C +8.273 27.73 6.608 27.851 5.006 28.137 C +5.578 27.049 5.177 25.104 4.376 24.303 C +5.378 24.339 6.729 23.624 8.038 22.643 C +7.203 21.823 5.376 21.984 3.46 22.643 C +3.46 21.27 2.638 19.533 1.801 18.351 C +3.117 18.408 4.262 17.722 5.12 16.691 C +5.785 18.26 7.819 19.373 8.725 19.324 C +8.742 17.959 7.169 15.869 6.147 15.47 C +6.747 14.801 7.766 13.27 8.725 10.854 C +9.524 12.78 10.694 14.022 11.927 14.955 C +10.785 16.517 10.959 17.388 11.358 18.866 C +12.101 18.325 13.132 17.893 13.303 15.89 C +15.02 16.176 16.156 16.104 17.653 15.203 C +17.198 16.865 17.195 18.466 17.515 20.166 C +15.665 20.026 14.105 20.239 13.075 21.728 C +13.905 21.955 16.165 22.014 17.039 21.082 C +17.366 22.064 18.261 23.47 19.707 24.164 C +18.267 24.424 17.282 25.523 16.373 27.209 C +15.66 25.793 13.433 24.128 11.93 24.073 C +13.933 28.137 13.933 31.055 12.412 33.743 C +f +31.125 30.5 m +31.445 31.128 31.648 31.385 V +34.045 29.444 38.851 32.752 39.746 33.521 C +39.636 34.153 37.511 35.29 35.794 34.26 C +36.234 35.549 35.332 37.51 34.134 38.552 C +35.873 38.451 38.019 39.813 38.541 40.555 C +38.763 39.577 39.946 38.307 41.231 37.293 C +41.582 38.266 40.887 40.384 39.971 41.986 C +41.206 42.487 42.318 43.417 42.776 44.676 C +43.233 43.359 44.236 42.685 45.58 41.929 C +44.421 40.502 43.64 38.328 43.92 37.465 C +45.243 37.8 46.814 40.518 46.937 41.607 C +47.812 40.841 49.366 40.154 51.947 39.848 C +50.246 38.77 49.884 36.778 49.3 35.347 C +48.152 35.794 45.983 35.853 45.008 35.29 C +45.721 34.711 47.061 34.16 49.071 34.146 C +49.071 32.601 49.534 31.469 50.788 30.254 C +49.065 30.267 46.965 29.781 45.469 29.389 C +45.221 30.718 44.378 32.314 43.233 32.715 C +43.227 31.854 43.493 29.605 44.378 28.938 C +43.513 28.37 42.26 26.993 41.803 25.276 C +41.181 26.601 40.32 27.906 38.457 28.35 C +39.642 29.403 40.477 31.42 40.143 32.887 C +35.091 28.905 32.414 30.203 31.125 30.5 C +f +25.317 46.491 m +25.994 46.691 26.284 46.843 V +24.815 49.556 29.266 53.837 30.186 54.576 C +30.787 54.351 30.907 51.818 30.23 50.482 C +31.073 50.605 33.262 49.227 34.02 47.938 C +34.085 48.625 35.655 51.566 36.481 51.944 C +35.561 52.341 34.896 53.814 34.134 55.263 C +35.156 55.43 36.555 54.508 38.026 53.603 C +38.541 54.404 39.915 55.377 41.174 55.892 C +40.086 56.579 39.591 57.321 39.094 58.78 C +38.052 58.215 35.865 58.065 35.336 58.353 C +35.85 59.465 38.096 60.008 38.827 59.955 C +38.573 60.817 38.425 62.97 38.598 65.563 C +36.939 64.247 35.393 62.931 33.734 62.988 C +34.003 61.567 33.367 59.761 32.99 59.268 C +32.417 60.012 32.006 60.839 32.361 62.817 C +30.908 63.302 29.671 63.847 28.297 65.106 C +28.297 63.274 27.725 62.073 26.857 60.796 C +28.117 60.308 29.389 59.106 29.385 58.067 C +28.537 58.219 26.845 58.963 26.352 59.955 C +25.634 59.209 23.95 57.899 22.346 57.895 C +23.534 57.041 24.454 56.006 24.549 54.094 C +25.802 55.065 28.255 55.68 29.635 55.083 C +24.794 50.846 25.262 47.814 25.317 46.491 C +f +12.412 78.151 m +11.887 77.68 11.691 77.418 V +14.182 75.601 11.928 69.774 11.415 68.711 C +10.776 68.655 9.369 71.396 9.405 72.894 C +8.273 72.138 6.608 72.259 5.006 72.545 C +5.578 71.458 5.177 69.512 4.376 68.711 C +5.378 68.747 6.729 68.032 8.038 67.052 C +7.203 66.231 5.376 66.393 3.46 67.052 C +3.46 65.678 2.638 63.941 1.801 62.759 C +3.117 62.817 4.262 62.13 5.12 61.1 C +5.785 62.669 7.819 63.781 8.725 63.732 C +8.742 62.367 7.169 60.277 6.147 59.878 C +6.747 59.209 7.766 57.678 8.725 55.263 C +9.524 57.189 10.694 58.431 11.927 59.364 C +10.785 60.925 10.959 61.796 11.358 63.274 C +12.101 62.734 13.132 62.301 13.303 60.298 C +15.02 60.584 16.156 60.512 17.653 59.612 C +17.198 61.273 17.195 62.874 17.515 64.574 C +15.665 64.434 14.105 64.648 13.075 66.136 C +13.905 66.363 16.165 66.422 17.039 65.49 C +17.366 66.472 18.261 67.878 19.707 68.572 C +18.267 68.832 17.282 69.931 16.373 71.617 C +15.66 70.202 13.433 68.536 11.93 68.482 C +13.933 72.545 13.933 75.464 12.412 78.151 C +f +31.125 74.908 m +31.445 75.537 31.648 75.794 V +34.045 73.853 38.851 77.161 39.746 77.929 C +39.636 78.562 37.511 79.698 35.794 78.668 C +36.234 79.957 35.332 81.918 34.134 82.96 C +35.873 82.86 38.019 84.221 38.541 84.963 C +38.763 83.986 39.946 82.716 41.231 81.701 C +41.582 82.675 40.887 84.792 39.971 86.394 C +41.206 86.895 42.318 87.825 42.776 89.084 C +43.233 87.768 44.236 87.093 45.58 86.337 C +44.421 84.91 43.64 82.736 43.92 81.873 C +45.243 82.208 46.814 84.926 46.937 86.016 C +47.812 85.249 49.366 84.563 51.947 84.257 C +50.246 83.179 49.884 81.187 49.3 79.756 C +48.152 80.203 45.983 80.262 45.008 79.698 C +45.721 79.119 47.061 78.569 49.071 78.554 C +49.071 77.009 49.534 75.877 50.788 74.663 C +49.065 74.675 46.965 74.189 45.469 73.798 C +45.221 75.126 44.378 76.723 43.233 77.123 C +43.227 76.262 43.493 74.013 44.378 73.347 C +43.513 72.779 42.26 71.401 41.803 69.684 C +41.181 71.009 40.32 72.314 38.457 72.759 C +39.642 73.812 40.477 75.829 40.143 77.295 C +35.091 73.313 32.414 74.611 31.125 74.908 C +f +%AI6_EndPatternLayer +) & +] E +%AI3_EndPattern +%AI3_BeginPattern: (Polka dots) +(Polka dots) 1 1 29.8 29.8 [ +%AI3_Tile +(0 O 0 R 0.45 0.9 0 0 k + 0.45 0.9 0 0 K +) @ +( +%AI6_BeginPatternLayer +800 Ar +0 J 0 j 0.3 w 4 M []0 d +%AI3_Note: +0 D +0 XR +1 1 m +1 29.8 L +29.8 29.8 L +29.8 1 L +1 1 L +f +%AI6_EndPatternLayer +) & +(0 O 0 R 0.09 0.18 0 0 k + 0.09 0.18 0 0 K +) @ +( +%AI6_BeginPatternLayer +*u +800 Ar +0 J 0 j 1 w 4 M []0 d +%AI3_Note: +0 D +0 XR +11.08 8.2 m +11.08 9.791 9.79 11.08 8.2 11.08 c +6.609 11.08 5.32 9.791 5.32 8.2 c +5.32 6.61 6.609 5.32 8.2 5.32 c +9.79 5.32 11.08 6.61 11.08 8.2 c +f +11.08 22.6 m +11.08 24.191 9.79 25.48 8.2 25.48 c +6.609 25.48 5.32 24.191 5.32 22.6 c +5.32 21.01 6.609 19.72 8.2 19.72 c +9.79 19.72 11.08 21.01 11.08 22.6 c +f +18.28 15.4 m +18.28 16.991 16.99 18.28 15.4 18.28 c +13.809 18.28 12.52 16.991 12.52 15.4 c +12.52 13.81 13.809 12.52 15.4 12.52 c +16.99 12.52 18.28 13.81 18.28 15.4 c +f +25.48 8.2 m +25.48 9.791 24.19 11.08 22.6 11.08 c +21.009 11.08 19.72 9.791 19.72 8.2 c +19.72 6.61 21.009 5.32 22.6 5.32 c +24.19 5.32 25.48 6.61 25.48 8.2 c +f +25.48 22.6 m +25.48 24.191 24.19 25.48 22.6 25.48 c +21.009 25.48 19.72 24.191 19.72 22.6 c +19.72 21.01 21.009 19.72 22.6 19.72 c +24.19 19.72 25.48 21.01 25.48 22.6 c +f +*U +26.92 1 m +29.8 1 L +29.8 3.88 L +28.209 3.88 26.92 2.591 26.92 1 C +f +15.4 3.88 m +13.809 3.88 12.52 2.591 12.52 1 C +18.28 1 L +18.28 2.591 16.99 3.88 15.4 3.88 c +f +1 3.88 m +1 1 L +3.88 1 L +3.88 2.591 2.59 3.88 1 3.88 C +f +1 XR +26.92 15.4 m +26.92 13.81 28.209 12.52 29.8 12.52 C +29.8 18.28 L +28.209 18.28 26.92 16.991 26.92 15.4 c +f +0 XR +15.4 18.28 m +13.809 18.28 12.52 16.991 12.52 15.4 c +12.52 13.81 13.809 12.52 15.4 12.52 c +16.99 12.52 18.28 13.81 18.28 15.4 c +18.28 16.991 16.99 18.28 15.4 18.28 c +f +1 XR +3.88 15.4 m +3.88 16.991 2.59 18.28 1 18.28 C +1 12.52 L +2.59 12.52 3.88 13.81 3.88 15.4 c +f +0 XR +29.8 26.92 m +29.8 29.8 L +26.92 29.8 L +26.92 28.21 28.209 26.92 29.8 26.92 C +f +15.4 26.92 m +16.99 26.92 18.28 28.21 18.28 29.8 C +12.52 29.8 L +12.52 28.21 13.809 26.92 15.4 26.92 c +f +3.88 29.8 m +1 29.8 L +1 26.92 L +2.59 26.92 3.88 28.21 3.88 29.8 C +f +1 XR +8.2 11.08 m +6.609 11.08 5.32 9.791 5.32 8.2 c +5.32 6.61 6.609 5.32 8.2 5.32 c +9.79 5.32 11.08 6.61 11.08 8.2 c +11.08 9.791 9.79 11.08 8.2 11.08 c +f +22.6 11.08 m +21.009 11.08 19.72 9.791 19.72 8.2 c +19.72 6.61 21.009 5.32 22.6 5.32 c +24.19 5.32 25.48 6.61 25.48 8.2 c +25.48 9.791 24.19 11.08 22.6 11.08 c +f +8.2 25.48 m +6.609 25.48 5.32 24.191 5.32 22.6 c +5.32 21.01 6.609 19.72 8.2 19.72 c +9.79 19.72 11.08 21.01 11.08 22.6 c +11.08 24.191 9.79 25.48 8.2 25.48 c +f +22.6 25.48 m +21.009 25.48 19.72 24.191 19.72 22.6 c +19.72 21.01 21.009 19.72 22.6 19.72 c +24.19 19.72 25.48 21.01 25.48 22.6 c +25.48 24.191 24.19 25.48 22.6 25.48 c +f +%AI6_EndPatternLayer +) & +] E +%AI3_EndPattern +%AI3_BeginPattern: (Random circles) +(Random circles) 4.365 3.849 51.13 57.85 [ +%AI3_Tile +(0 O 0 R 0 0.1125 0.45 0 k + 0 0.1125 0.45 0 K +) @ +( +%AI6_BeginPatternLayer +800 Ar +0 J 0 j 0.3 w 4 M []0 d +%AI3_Note: +0 D +0 XR +4.365 3.849 m +4.365 57.85 L +51.13 57.85 L +51.13 3.849 L +4.365 3.849 L +f +%AI6_EndPatternLayer +) & +(0 O 0 R 0.4 0.7 1 0 k + 0.4 0.7 1 0 K +) @ +( +%AI6_BeginPatternLayer +800 Ar +0 J 0 j 0.3 w 4 M []0 d +%AI3_Note: +0 D +0 XR +45.429 36.274 m +45.843 36.991 45.598 37.908 44.88 38.323 c +44.163 38.737 43.245 38.491 42.831 37.774 c +42.417 37.056 42.663 36.139 43.38 35.725 c +44.098 35.31 45.015 35.556 45.429 36.274 c +s +44.179 27.926 m +43.765 28.643 42.848 28.889 42.13 28.475 c +41.413 28.06 41.167 27.143 41.581 26.425 c +41.995 25.708 42.913 25.462 43.63 25.876 c +44.348 26.291 44.593 27.208 44.179 27.926 c +s +35.929 41.024 m +35.515 41.741 34.598 41.987 33.88 41.573 c +33.163 41.158 32.917 40.241 33.331 39.524 c +33.745 38.806 34.663 38.56 35.38 38.975 c +36.098 39.389 36.343 40.306 35.929 41.024 c +s +28.38 34.225 m +28.794 34.942 28.549 35.859 27.831 36.274 c +27.114 36.688 26.196 36.442 25.782 35.725 c +25.368 35.007 25.614 34.09 26.331 33.675 c +27.049 33.261 27.966 33.507 28.38 34.225 c +s +31.179 28.024 m +30.765 28.741 29.848 28.987 29.13 28.573 c +28.413 28.158 28.167 27.241 28.581 26.524 c +28.995 25.806 29.913 25.56 30.63 25.975 c +31.348 26.389 31.593 27.306 31.179 28.024 c +s +36.792 23.349 m +35.963 23.349 35.292 22.678 35.292 21.849 c +35.292 21.021 35.963 20.349 36.792 20.349 c +37.62 20.349 38.292 21.021 38.292 21.849 c +38.292 22.678 37.62 23.349 36.792 23.349 c +s +10.888 34.175 m +10.474 34.893 10.72 35.81 11.437 36.225 c +12.155 36.639 13.072 36.393 13.486 35.675 c +13.901 34.958 13.655 34.041 12.937 33.626 c +12.22 33.212 11.303 33.458 10.888 34.175 c +s +11.517 26.601 m +11.931 27.318 12.848 27.564 13.566 27.15 c +14.283 26.735 14.529 25.818 14.115 25.1 c +13.701 24.383 12.783 24.137 12.066 24.551 c +11.348 24.966 11.103 25.883 11.517 26.601 c +s +16.782 41.426 m +17.196 42.143 18.114 42.389 18.831 41.975 c +19.549 41.56 19.794 40.643 19.38 39.926 c +18.966 39.208 18.049 38.962 17.331 39.377 c +16.614 39.791 16.368 40.708 16.782 41.426 c +s +22.365 24.35 m +23.194 24.35 23.865 23.678 23.865 22.85 c +23.865 22.021 23.194 21.35 22.365 21.35 c +21.537 21.35 20.865 22.021 20.865 22.85 c +20.865 23.678 21.537 24.35 22.365 24.35 c +s +45.385 7.849 m +44.971 7.132 44.053 6.886 43.336 7.3 c +42.619 7.714 42.373 8.632 42.787 9.349 c +43.201 10.067 44.119 10.312 44.836 9.898 c +45.553 9.484 45.799 8.567 45.385 7.849 c +s +29.679 7.774 m +29.265 7.056 28.348 6.81 27.63 7.225 c +26.913 7.639 26.667 8.556 27.081 9.274 c +27.495 9.991 28.413 10.237 29.13 9.823 c +29.848 9.408 30.093 8.491 29.679 7.774 c +s +35.542 11.349 m +34.713 11.349 34.042 12.021 34.042 12.849 c +34.042 13.678 34.713 14.349 35.542 14.349 c +36.37 14.349 37.042 13.678 37.042 12.849 c +37.042 12.021 36.37 11.349 35.542 11.349 c +s +10.13 7.475 m +10.544 6.757 11.462 6.511 12.179 6.926 c +12.897 7.34 13.142 8.257 12.728 8.975 c +12.314 9.692 11.397 9.938 10.679 9.524 c +9.962 9.109 9.716 8.192 10.13 7.475 c +s +20.203 13.349 m +21.031 13.349 21.703 14.021 21.703 14.849 c +21.703 15.678 21.031 16.349 20.203 16.349 c +19.375 16.349 18.703 15.678 18.703 14.849 c +18.703 14.021 19.375 13.349 20.203 13.349 c +s +44.635 54.1 m +45.049 53.382 44.803 52.465 44.086 52.051 c +43.369 51.636 42.451 51.882 42.037 52.6 c +41.623 53.317 41.869 54.234 42.586 54.649 c +43.303 55.063 44.221 54.817 44.635 54.1 c +s +36.841 48.1 m +36.427 47.382 35.509 47.136 34.792 47.551 c +34.074 47.965 33.828 48.882 34.243 49.6 c +34.657 50.317 35.574 50.563 36.292 50.149 c +37.009 49.734 37.255 48.817 36.841 48.1 c +s +29.728 54.725 m +30.143 54.007 29.897 53.09 29.179 52.675 c +28.462 52.261 27.544 52.507 27.13 53.225 c +26.716 53.942 26.962 54.859 27.679 55.274 c +28.397 55.688 29.314 55.442 29.728 54.725 c +s +10.86 54.1 m +10.446 53.382 10.691 52.465 11.409 52.051 c +12.126 51.636 13.044 51.882 13.458 52.6 c +13.872 53.317 13.626 54.234 12.909 54.649 c +12.191 55.063 11.274 54.817 10.86 54.1 c +s +19.154 49.1 m +19.568 48.382 20.486 48.136 21.203 48.551 c +21.92 48.965 22.166 49.882 21.752 50.6 c +21.338 51.317 20.42 51.563 19.703 51.149 c +18.986 50.734 18.74 49.817 19.154 49.1 c +s +51.88 38.85 m +51.052 38.85 50.38 39.521 50.38 40.35 c +50.38 41.178 51.052 41.85 51.88 41.85 c +52.709 41.85 53.38 41.178 53.38 40.35 c +53.38 39.521 52.709 38.85 51.88 38.85 c +s +51.865 11.349 m +52.693 11.349 53.365 12.021 53.365 12.849 c +53.365 13.678 52.693 14.349 51.865 14.349 c +51.036 14.349 50.365 13.678 50.365 12.849 c +50.365 12.021 51.036 11.349 51.865 11.349 c +s +30.179 18.524 m +29.765 19.241 28.848 19.487 28.13 19.073 c +27.413 18.658 27.167 17.741 27.581 17.024 c +27.995 16.306 28.913 16.06 29.63 16.475 c +30.348 16.889 30.593 17.806 30.179 18.524 c +s +21.679 31.524 m +21.265 32.241 20.348 32.487 19.63 32.073 c +18.913 31.658 18.667 30.741 19.081 30.024 c +19.495 29.306 20.413 29.06 21.13 29.475 c +21.848 29.889 22.093 30.806 21.679 31.524 c +s +37.914 33.399 m +37.5 34.116 36.583 34.362 35.865 33.948 c +35.148 33.533 34.902 32.616 35.316 31.899 c +35.73 31.181 36.648 30.935 37.365 31.35 c +38.083 31.764 38.328 32.681 37.914 33.399 c +s +28.929 45.024 m +28.515 45.741 27.598 45.987 26.88 45.573 c +26.163 45.158 25.917 44.241 26.331 43.524 c +26.745 42.806 27.663 42.56 28.38 42.975 c +29.098 43.389 29.343 44.306 28.929 45.024 c +s +12.429 45.524 m +12.015 46.241 11.098 46.487 10.38 46.073 c +9.663 45.658 9.417 44.741 9.831 44.024 c +10.245 43.306 11.163 43.06 11.88 43.475 c +12.598 43.889 12.843 44.806 12.429 45.524 c +s +44.49 45.6 m +44.075 46.317 43.158 46.563 42.441 46.149 c +41.723 45.734 41.477 44.817 41.891 44.1 c +42.306 43.382 43.223 43.136 43.941 43.55 c +44.658 43.965 44.904 44.882 44.49 45.6 c +s +12.679 18.524 m +12.265 19.241 11.348 19.487 10.63 19.073 c +9.913 18.658 9.667 17.741 10.081 17.024 c +10.495 16.306 11.413 16.06 12.13 16.475 c +12.848 16.889 13.093 17.806 12.679 18.524 c +s +21.179 5.774 m +20.765 6.491 19.848 6.737 19.13 6.323 c +18.413 5.908 18.167 4.991 18.581 4.274 c +18.995 3.557 19.913 3.311 20.63 3.725 c +21.348 4.139 21.593 5.056 21.179 5.774 c +s +38.929 5.274 m +38.515 5.991 37.598 6.237 36.88 5.823 c +36.163 5.408 35.917 4.491 36.331 3.774 c +36.745 3.057 37.663 2.811 38.38 3.225 c +39.098 3.639 39.343 4.556 38.929 5.274 c +s +43.865 18.1 m +44.694 18.1 45.365 17.429 45.365 16.6 c +45.365 15.772 44.694 15.1 43.865 15.1 c +43.037 15.1 42.365 15.772 42.365 16.6 c +42.365 17.429 43.037 18.1 43.865 18.1 c +s +51.13 4.6 m +50.302 4.6 49.63 3.928 49.63 3.1 c +49.63 2.272 50.302 1.6 51.13 1.6 c +51.959 1.6 52.63 2.272 52.63 3.1 c +52.63 3.928 51.959 4.6 51.13 4.6 c +s +52.163 31.649 m +51.748 32.366 50.831 32.612 50.114 32.198 c +49.396 31.783 49.15 30.866 49.565 30.149 c +49.979 29.431 50.896 29.185 51.614 29.6 c +52.331 30.014 52.577 30.931 52.163 31.649 c +s +51.85 51.35 m +51.021 51.35 50.35 50.678 50.35 49.85 c +50.35 49.021 51.021 48.35 51.85 48.35 c +52.678 48.35 53.35 49.021 53.35 49.85 c +53.35 50.678 52.678 51.35 51.85 51.35 c +s +49.85 23.1 m +50.679 23.1 51.35 22.428 51.35 21.6 c +51.35 20.771 50.679 20.1 49.85 20.1 c +49.022 20.1 48.35 20.771 48.35 21.6 c +48.35 22.428 49.022 23.1 49.85 23.1 c +s +5.13 38.85 m +4.302 38.85 3.63 39.521 3.63 40.35 c +3.63 41.178 4.302 41.85 5.13 41.85 c +5.959 41.85 6.63 41.178 6.63 40.35 c +6.63 39.521 5.959 38.85 5.13 38.85 c +s +5.115 11.349 m +5.943 11.349 6.615 12.021 6.615 12.849 c +6.615 13.678 5.943 14.349 5.115 14.349 c +4.286 14.349 3.615 13.678 3.615 12.849 c +3.615 12.021 4.286 11.349 5.115 11.349 c +s +4.38 4.6 m +3.552 4.6 2.88 3.928 2.88 3.1 c +2.88 2.272 3.552 1.6 4.38 1.6 c +5.209 1.6 5.88 2.272 5.88 3.1 c +5.88 3.928 5.209 4.6 4.38 4.6 c +s +5.413 31.649 m +4.998 32.366 4.081 32.612 3.364 32.198 c +2.646 31.783 2.4 30.866 2.815 30.149 c +3.229 29.431 4.146 29.185 4.864 29.6 c +5.581 30.014 5.827 30.931 5.413 31.649 c +s +5.1 51.35 m +4.271 51.35 3.6 50.678 3.6 49.85 c +3.6 49.021 4.271 48.35 5.1 48.35 c +5.928 48.35 6.6 49.021 6.6 49.85 c +6.6 50.678 5.928 51.35 5.1 51.35 c +s +3.1 23.1 m +3.929 23.1 4.6 22.428 4.6 21.6 c +4.6 20.771 3.929 20.1 3.1 20.1 c +2.272 20.1 1.6 20.771 1.6 21.6 c +1.6 22.428 2.272 23.1 3.1 23.1 c +s +21.194 59.775 m +20.78 60.492 19.863 60.738 19.145 60.324 c +18.428 59.909 18.182 58.992 18.596 58.275 c +19.01 57.558 19.928 57.312 20.645 57.726 c +21.363 58.14 21.608 59.057 21.194 59.775 c +s +38.944 59.275 m +38.53 59.992 37.613 60.238 36.895 59.824 c +36.178 59.409 35.932 58.492 36.346 57.775 c +36.76 57.058 37.678 56.812 38.395 57.226 c +39.113 57.64 39.358 58.557 38.944 59.275 c +s +51.145 58.601 m +50.317 58.601 49.645 57.929 49.645 57.101 c +49.645 56.273 50.317 55.601 51.145 55.601 c +51.974 55.601 52.645 56.273 52.645 57.101 c +52.645 57.929 51.974 58.601 51.145 58.601 c +s +4.395 58.601 m +3.567 58.601 2.895 57.929 2.895 57.101 c +2.895 56.273 3.567 55.601 4.395 55.601 c +5.224 55.601 5.895 56.273 5.895 57.101 c +5.895 57.929 5.224 58.601 4.395 58.601 c +s +%AI6_EndPatternLayer +) & +] E +%AI3_EndPattern +%AI3_BeginPattern: (Rope.side) +(Rope.side) 1 4.6 60.9998 33.3999 [ +%AI3_Tile +(0 O 0 R 0 0 0 1 k + 0 0 0 1 K +) @ +( +%AI6_BeginPatternLayer +800 Ar +1 J 1 j 0.6 w 4 M []0 d +%AI3_Note: +0 D +0 XR +24.9999 7 m +15.6521 4.663 8.125 8.6981 1 14.1407 C +S +36.9999 7 m +22.3477 3.337 12.168 15.3276 1 23.859 C +S +48.9999 7 m +29.3464 2.0866 17.7386 25.3332 1 30.6213 C +S +1 30.9999 m +24.9999 36.9999 36.9999 1 60.9998 7 C +S +13 30.9999 m +32.6534 35.9133 44.2611 12.6667 60.9998 7.3786 C +S +24.9999 30.9999 m +39.652 34.6629 49.8317 22.6722 60.9998 14.1407 C +S +36.9999 30.9999 m +46.3476 33.3369 53.8749 29.3018 60.9998 23.859 C +S +48.9999 30.9999 m +53.3464 32.0865 57.2978 31.7908 60.9998 30.6213 C +S +13 7 m +8.6535 5.9134 4.7019 6.2091 1 7.3786 C +S +%AI6_EndPatternLayer +) & +] E +%AI3_EndPattern +%AI3_BeginPattern: (Scales) +(Scales) 1.6 9.3475 48.088 55.8355 [ +%AI3_Tile +(0 O 0 R 1 g + 1 G +) @ +( +%AI6_BeginPatternLayer +800 Ar +0 J 0 j 1 w 4 M []0 d +%AI3_Note: +0 D +0 XR +1.6 9.3475 m +1.6 55.8355 L +48.088 55.8355 L +48.088 9.3475 L +1.6 9.3475 L +f +%AI6_EndPatternLayer +) & +(0 O 0 R 0 g + 0 G +) @ +( +%AI6_BeginPatternLayer +800 Ar +0 J 0 j 0.3 w 4 M []0 d +%AI3_Note: +0 D +0 XR +17.0956 9.3475 m +12.8162 9.3475 9.3475 5.8787 9.3475 1.6 C +9.3475 5.8787 5.8787 9.3475 1.6 9.3475 C +1.6 13.6262 5.0687 17.095 9.3475 17.095 c +13.6268 17.095 17.0956 13.6262 17.0956 9.3475 C +s +32.5918 9.3475 m +28.3125 9.3475 24.8437 5.8787 24.8437 1.6 C +24.8437 5.8787 21.3743 9.3475 17.0956 9.3475 C +17.0956 13.6262 20.5644 17.095 24.8437 17.095 c +29.1224 17.095 32.5918 13.6262 32.5918 9.3475 C +s +48.088 9.3475 m +43.8087 9.3475 40.3399 5.8787 40.3399 1.6 C +40.3399 5.8787 36.8705 9.3475 32.5918 9.3475 C +32.5918 13.6262 36.0606 17.095 40.3399 17.095 c +44.6186 17.095 48.088 13.6262 48.088 9.3475 C +s +17.0956 40.3393 m +12.8162 40.3393 9.3475 36.8699 9.3475 32.5912 C +9.3475 36.8699 5.8787 40.3393 1.6 40.3393 C +1.6 44.6181 5.0687 48.0874 9.3475 48.0874 c +13.6268 48.0874 17.0956 44.6181 17.0956 40.3393 C +s +17.0956 24.8431 m +12.8162 24.8431 9.3475 21.3743 9.3475 17.095 C +9.3475 21.3743 5.8787 24.8431 1.6 24.8431 C +1.6 29.1218 5.0687 32.5912 9.3475 32.5912 c +13.6268 32.5912 17.0956 29.1218 17.0956 24.8431 C +s +32.5918 24.8431 m +28.3125 24.8431 24.8437 21.3743 24.8437 17.095 C +24.8437 21.3743 21.3743 24.8431 17.0956 24.8431 C +17.0956 29.1218 20.5644 32.5912 24.8437 32.5912 c +29.1224 32.5912 32.5918 29.1218 32.5918 24.8431 C +s +48.088 24.8431 m +43.8087 24.8431 40.3399 21.3743 40.3399 17.095 C +40.3399 21.3743 36.8705 24.8431 32.5918 24.8431 C +32.5918 29.1218 36.0606 32.5912 40.3399 32.5912 c +44.6186 32.5912 48.088 29.1218 48.088 24.8431 C +s +32.5918 40.3393 m +28.3125 40.3393 24.8437 36.8699 24.8437 32.5912 C +24.8437 36.8699 21.3743 40.3393 17.0956 40.3393 C +17.0956 44.6181 20.5644 48.0874 24.8437 48.0874 c +29.1224 48.0874 32.5918 44.6181 32.5918 40.3393 C +s +48.088 40.3393 m +43.8087 40.3393 40.3399 36.8699 40.3399 32.5912 C +40.3399 36.8699 36.8705 40.3393 32.5918 40.3393 C +32.5918 44.6181 36.0606 48.0874 40.3399 48.0874 c +44.6186 48.0874 48.088 44.6181 48.088 40.3393 C +s +17.0956 55.8355 m +12.8162 55.8355 9.3475 52.3662 9.3475 48.0874 C +9.3475 52.3662 5.8787 55.8355 1.6 55.8355 C +1.6 60.1143 5.0687 63.5836 9.3475 63.5836 c +13.6268 63.5836 17.0956 60.1143 17.0956 55.8355 C +s +32.5918 55.8355 m +28.3125 55.8355 24.8437 52.3662 24.8437 48.0874 C +24.8437 52.3662 21.3743 55.8355 17.0956 55.8355 C +17.0956 60.1143 20.5644 63.5836 24.8437 63.5836 c +29.1224 63.5836 32.5918 60.1143 32.5918 55.8355 C +s +48.088 55.8355 m +43.8087 55.8355 40.3399 52.3662 40.3399 48.0874 C +40.3399 52.3662 36.8705 55.8355 32.5918 55.8355 C +32.5918 60.1143 36.0606 63.5836 40.3399 63.5836 c +44.6186 63.5836 48.088 60.1143 48.088 55.8355 C +s +%AI6_EndPatternLayer +) & +] E +%AI3_EndPattern +%AI3_BeginPattern: (SolidStar.side) +(SolidStar.side) 1 1 33.0117 33.0117 [ +%AI3_Tile +(0 O 0 R 0.05 0.2 0.95 0 k + 0.05 0.2 0.95 0 K +) @ +( +%AI6_BeginPatternLayer +800 Ar +0 J 0 j 1 w 4 M []0 d +%AI3_Note: +1 D +0 XR +7.9689 26.0458 m +14.5331 22.9874 l +17.0095 29.7904 L +19.4859 22.9874 l +26.0473 26.0458 l +22.9889 19.4815 l +29.792 17.0052 l +22.9889 14.5288 l +26.0473 7.9674 l +19.4859 11.0257 l +17.0095 4.2226 l +14.5305 11.0257 l +7.9689 7.9674 l +11.0273 14.5288 l +4.2242 17.0052 l +11.0273 19.4843 L +7.9689 26.0458 l +f +%AI6_EndPatternLayer +) & +] E +%AI3_EndPattern +%AI3_BeginPattern: (Stars) +(Stars) 1 1 63.384 84.766 [ +%AI3_Tile +(0 O 0 R 1 0.9 0.1 0 k + 1 0.9 0.1 0 K +) @ +( +%AI6_BeginPatternLayer +800 Ar +0 J 0 j 0.3 w 4 M []0 d +%AI3_Note: +0 D +0 XR +1 1 m +1 84.766 L +63.384 84.766 L +63.384 1 L +1 1 L +f +%AI6_EndPatternLayer +) & +(0 O 0 R 0 0.25 1 0 k + 0 0.25 1 0 K +) @ +( +%AI6_BeginPatternLayer +*u +800 Ar +0 J 0 j 1 w 4 M []0 d +%AI3_Note: +0 D +0 XR +37.668 67.113 m +43.924 62.567 L +41.535 55.213 L +47.791 59.757 L +54.046 55.212 L +51.657 62.566 L +57.914 67.112 L +50.18 67.112 L +47.791 74.467 L +45.402 67.113 L +37.668 67.113 L +f +16.596 59.757 m +22.851 55.212 L +20.462 62.566 L +26.719 67.112 L +18.985 67.112 L +16.596 74.467 L +14.207 67.113 L +6.473 67.113 L +12.729 62.567 L +10.34 55.213 L +16.596 59.757 L +f +20.462 20.683 m +26.719 25.229 L +18.985 25.229 L +16.596 32.584 L +14.207 25.23 L +6.473 25.23 L +12.729 20.684 L +10.34 13.33 L +16.596 17.874 L +22.851 13.329 L +20.462 20.683 L +f +38.447 34.271 m +36.058 41.625 L +42.315 46.171 L +34.581 46.171 L +32.192 53.526 L +29.803 46.172 L +22.069 46.172 L +28.325 41.626 L +25.936 34.272 L +32.192 38.816 L +38.447 34.271 L +f +51.657 20.683 m +57.914 25.229 L +50.18 25.229 L +47.791 32.584 L +45.402 25.23 L +37.668 25.23 L +43.924 20.684 L +41.535 13.33 L +47.791 17.874 L +54.046 13.329 L +51.657 20.683 L +f +*U +1 XR +34.581 4.288 m +32.192 11.643 L +29.803 4.289 L +22.069 4.289 L +26.5962 1 L +37.7885 1 L +42.315 4.288 L +34.581 4.288 L +f +53.261 4.289 m +57.7882 1 L +63.384 1 L +63.384 11.643 L +60.995 4.289 L +53.261 4.289 L +f +4.866 41.625 m +11.123 46.171 L +3.389 46.171 L +1 53.526 L +1 38.816 L +7.255 34.271 L +4.866 41.625 L +f +36.058 41.625 m +42.315 46.171 L +34.581 46.171 L +32.192 53.526 L +29.803 46.172 L +22.069 46.172 L +28.325 41.626 L +25.936 34.272 L +32.192 38.816 L +38.447 34.271 L +36.058 41.625 L +f +53.261 46.172 m +59.517 41.626 L +57.128 34.272 L +63.384 38.816 L +63.384 53.526 L +60.995 46.172 L +53.261 46.172 L +f +4.866 83.508 m +6.5974 84.766 L +1 84.766 L +1 80.699 L +7.255 76.154 L +4.866 83.508 L +f +25.936 76.155 m +32.192 80.699 L +38.447 76.154 L +36.058 83.508 L +37.7895 84.766 L +26.5951 84.766 L +28.325 83.509 L +25.936 76.155 L +f +22.851 55.212 m +20.462 62.566 L +26.719 67.112 L +18.985 67.112 L +16.596 74.467 L +14.207 67.113 L +6.473 67.113 L +12.729 62.567 L +10.34 55.213 L +16.596 59.757 L +22.851 55.212 L +f +41.535 55.213 m +47.791 59.757 L +54.046 55.212 L +51.657 62.566 L +57.914 67.112 L +50.18 67.112 L +47.791 74.467 L +45.402 67.113 L +37.668 67.113 L +43.924 62.567 L +41.535 55.213 L +f +50.18 25.229 m +47.791 32.584 L +45.402 25.23 L +37.668 25.23 L +43.924 20.684 L +41.535 13.33 L +47.791 17.874 L +54.046 13.329 L +51.657 20.683 L +57.914 25.229 L +50.18 25.229 L +f +18.985 25.229 m +16.596 32.584 L +14.207 25.23 L +6.473 25.23 L +12.729 20.684 L +10.34 13.33 L +16.596 17.874 L +22.851 13.329 L +20.462 20.683 L +26.719 25.229 L +18.985 25.229 L +f +3.388 4.289 m +1 11.643 L +1 1 L +6.5948 1 L +11.122 4.289 L +3.388 4.289 L +f +57.128 76.154 m +63.384 80.699 L +63.384 84.766 L +57.7855 84.766 L +59.517 83.508 L +57.128 76.154 L +f +%AI6_EndPatternLayer +) & +] E +%AI3_EndPattern +%AI3_BeginPattern: (Stripes) +(Stripes) 8.45 4.6001 80.45 76.6001 [ +%AI3_Tile +(0 O 0 R 1 0.07 1 0 k + 1 0.07 1 0 K +) @ +( +%AI6_BeginPatternLayer +800 Ar +0 J 0 j 3.6 w 4 M []0 d +%AI3_Note: +0 D +0 XR +8.2 8.2 m +80.7 8.2 L +S +8.2 22.6001 m +80.7 22.6001 L +S +8.2 37.0002 m +80.7 37.0002 L +S +8.2 51.4 m +80.7 51.4 L +S +8.2 65.8001 m +80.7 65.8001 L +S +8.2 15.4 m +80.7 15.4 L +S +8.2 29.8001 m +80.7 29.8001 L +S +8.2 44.2 m +80.7 44.2 L +S +8.2 58.6001 m +80.7 58.6001 L +S +8.2 73.0002 m +80.7 73.0002 L +S +%AI6_EndPatternLayer +) & +] E +%AI3_EndPattern +%AI3_BeginPattern: (TriBevel.outer) +(TriBevel.outer) 1 1.0004 31.6124 31.6127 [ +%AI3_Tile +(0 O 0 R 0 0 0 0.3 k + 0 0 0 0.3 K +) @ +( +%AI6_BeginPatternLayer +800 Ar +0 J 0 j 1 w 4 M []0 d +%AI3_Note: +0 D +0 XR +31.6118 5.4917 m +27.1221 5.4917 L +27.1205 1.0011 L +27.8031 1.0011 L +27.8031 4.8091 L +31.6118 4.8091 L +31.6118 5.4917 L +f +%AI6_EndPatternLayer +) & +(0 O 0 R 0 0 0 0.2 k + 0 0 0 0.2 K +) @ +( +%AI6_BeginPatternLayer +800 Ar +0 J 0 j 1 w 4 M []0 d +%AI3_Note: +0 D +0 XR +31.6149 9.5062 m +23.1111 9.5062 L +23.1111 1.0015 L +27.1205 1.0015 L +27.1205 5.493 L +31.6144 5.493 L +31.6149 9.5062 L +f +%AI6_EndPatternLayer +) & +(0 O 0 R 0 0 0 0.4 k + 0 0 0 0.4 K +) @ +( +%AI6_BeginPatternLayer +800 Ar +0 J 0 j 1 w 4 M []0 d +%AI3_Note: +0 D +0 XR +31.6124 10.485 m +22.1297 10.485 L +22.1292 1.0015 L +23.1084 1.0015 L +23.1084 9.5049 L +31.6124 9.5049 L +31.6124 10.485 L +f +%AI6_EndPatternLayer +) & +(0 O 0 R 0 0 0 0.3 k + 0 0 0 0.3 K +) @ +( +%AI6_BeginPatternLayer +800 Ar +0 J 0 j 1 w 4 M []0 d +%AI3_Note: +0 D +0 XR +31.6129 17.2066 m +15.4064 17.2085 L +15.4064 1 L +22.1301 1 L +22.1301 10.4868 L +31.6129 10.4868 L +31.6129 17.2066 L +f +%AI6_EndPatternLayer +) & +(0 O 0 R 0 0 0 0.5 k + 0 0 0 0.5 K +) @ +( +%AI6_BeginPatternLayer +800 Ar +0 J 0 j 1 w 4 M []0 d +%AI3_Note: +0 D +0 XR +31.6149 18.3658 m +14.2517 18.3658 L +14.2515 1.0009 L +15.4043 1.0009 L +15.4043 17.2093 L +31.6149 17.2093 L +31.6149 18.3658 L +f +%AI6_EndPatternLayer +) & +(0 O 0 R 0 0 0 0.4 k + 0 0 0 0.4 K +) @ +( +%AI6_BeginPatternLayer +800 Ar +0 J 0 j 1 w 4 M []0 d +%AI3_Note: +0 D +0 XR +31.6124 30.4755 m +2.1395 30.4755 L +2.1395 1.0015 L +14.249 1 L +14.249 18.366 L +31.6149 18.366 L +31.6124 30.4755 L +f +%AI6_EndPatternLayer +) & +(0 O 0 R 0 0 0 0.6 k + 0 0 0 0.6 K +) @ +( +%AI6_BeginPatternLayer +800 Ar +0 J 0 j 1 w 4 M []0 d +%AI3_Note: +0 D +0 XR +15.4066 16.847 m +14.2778 18.3257 l +15.4066 17.2057 l +15.4066 16.847 l +f +%AI6_EndPatternLayer +) & +(0 O 0 R 0 0 0 0.5 k + 0 0 0 0.5 K +) @ +( +%AI6_BeginPatternLayer +800 Ar +0 J 0 j 1 w 4 M []0 d +%AI3_Note: +0 D +0 XR +23.1095 9.1906 m +22.1759 10.4392 l +23.1082 9.505 l +23.1095 9.1906 l +f +%AI6_EndPatternLayer +) & +(0 O 0 R 0 0 0 0.4 k + 0 0 0 0.4 K +) @ +( +%AI6_BeginPatternLayer +800 Ar +0 J 0 j 1 w 4 M []0 d +%AI3_Note: +0 D +0 XR +27.8039 4.6026 m +27.1619 5.4533 l +27.8029 4.8093 l +27.8039 4.6026 l +f +%AI6_EndPatternLayer +) & +] E +%AI3_EndPattern +%AI3_BeginPattern: (TriBevel.side) +(TriBevel.side) 1.0006 1 29.0006 31.6124 [ +%AI3_Tile +(0 O 0 R 0 0 0 0.3 k + 0 0 0 0.3 K +) @ +( +%AI6_BeginPatternLayer +800 Ar +0 J 0 j 1 w 4 M []0 d +%AI3_Note: +0 D +0 XR +29 4.8087 m +29 4.8087 L +29.0026 5.4927 L +1.0026 5.4927 L +1 4.8087 L +1 4.8087 L +29 4.8087 L +f +%AI6_EndPatternLayer +) & +(0 O 0 R 0 0 0 0.2 k + 0 0 0 0.2 K +) @ +( +%AI6_BeginPatternLayer +800 Ar +0 J 0 j 1 w 4 M []0 d +%AI3_Note: +0 D +0 XR +29.0026 5.4927 m +29.0005 9.5045 L +1.0005 9.5045 L +1.0026 5.4927 L +29.0026 5.4927 L +f +%AI6_EndPatternLayer +) & +(0 O 0 R 0 0 0 0.4 k + 0 0 0 0.4 K +) @ +( +%AI6_BeginPatternLayer +800 Ar +0 J 0 j 1 w 4 M []0 d +%AI3_Note: +0 D +0 XR +29.0005 9.5045 m +29.0011 10.4865 L +1.0011 10.4865 L +1.0005 9.5045 L +29.0005 9.5045 L +f +%AI6_EndPatternLayer +) & +(0 O 0 R 0 0 0 0.3 k + 0 0 0 0.3 K +) @ +( +%AI6_BeginPatternLayer +800 Ar +0 J 0 j 1 w 4 M []0 d +%AI3_Note: +0 D +0 XR +29.0011 10.4865 m +29.003 17.209 L +1.003 17.209 L +1.0011 10.4865 L +29.0011 10.4865 L +f +%AI6_EndPatternLayer +) & +(0 O 0 R 0 0 0 0.5 k + 0 0 0 0.5 K +) @ +( +%AI6_BeginPatternLayer +800 Ar +0 J 0 j 1 w 4 M []0 d +%AI3_Note: +0 D +0 XR +29.003 17.209 m +29.0031 18.3656 L +1.0031 18.3656 L +1.003 17.209 L +29.003 17.209 L +f +%AI6_EndPatternLayer +) & +(0 O 0 R 0 0 0 0.4 k + 0 0 0 0.4 K +) @ +( +%AI6_BeginPatternLayer +800 Ar +0 J 0 j 1 w 4 M []0 d +%AI3_Note: +0 D +0 XR +29.0031 18.3656 m +29.0006 30.4752 L +1.0006 30.4752 L +1.0031 18.3656 L +29.0031 18.3656 L +f +%AI6_EndPatternLayer +) & +] E +%AI3_EndPattern +%AI3_BeginPattern: (Waves-scroll) +(Waves-scroll) 17.926 10.516 68.663 69.012 [ +%AI3_Tile +(0 O 0 R 1 0 0.3 0 k + 1 0 0.3 0 K +) @ +( +%AI6_BeginPatternLayer +800 Ar +0 J 0 j 1 w 4 M []0 d +%AI3_Note: +1 D +0 XR +17.926 69.012 m +17.926 10.516 L +68.663 10.516 L +68.663 69.012 L +17.926 69.012 L +f +%AI6_EndPatternLayer +) & +(0 O 0 R 0.55 0 0 0 k + 0.55 0 0 0 K +) @ +( +%AI6_BeginPatternLayer +800 Ar +0 J 0 j 0.75 w 4 M []0 d +%AI3_Note: +0 D +0 XR +65.335 70.465 m +65.881 68.746 67.444 68.168 68.663 69.012 C +67.538 69.668 68.011 71.255 69.686 70.933 c +72.124 70.464 71.894 67.213 70.53 65.589 c +68.561 63.245 64.565 60.995 53.241 71.117 C +S +39.964 70.465 m +40.511 68.746 42.074 68.168 43.293 69.012 C +42.168 69.668 42.64 71.255 44.316 70.933 c +46.753 70.464 46.524 67.213 45.16 65.589 c +43.191 63.245 39.195 60.995 27.87 71.117 c +S +14.594 70.465 m +15.141 68.746 16.704 68.168 17.923 69.012 C +16.798 69.668 17.27 71.255 18.945 70.933 c +21.382 70.464 21.153 67.213 19.789 65.589 c +17.821 63.245 13.825 60.995 2.5 71.117 c +S +10.959 51.619 m +22.282 41.497 26.278 43.747 28.247 46.09 c +29.611 47.715 29.841 50.965 27.403 51.434 c +25.728 51.757 25.255 50.169 26.38 49.513 C +25.161 48.669 23.599 49.248 23.052 50.966 c +22.723 51.997 23.38 53.966 24.872 54.903 c +27.267 56.406 31.371 56.05 36.328 51.619 c +47.653 41.497 51.649 43.746 53.618 46.09 c +54.982 47.715 55.212 50.965 52.774 51.434 c +51.099 51.757 50.626 50.169 51.751 49.513 C +50.532 48.669 48.97 49.248 48.423 50.966 c +48.094 51.997 48.751 53.966 50.243 54.903 c +52.638 56.406 56.742 56.05 61.699 51.619 C +73.024 41.497 77.02 43.747 78.988 46.09 c +S +70.156 32.12 m +65.199 36.551 61.095 36.907 58.7 35.404 c +57.208 34.468 56.552 32.499 56.88 31.468 c +57.427 29.749 58.99 29.171 60.208 30.015 C +59.083 30.671 59.556 32.258 61.231 31.936 c +63.669 31.467 63.439 28.216 62.075 26.592 c +60.106 24.248 56.11 21.998 44.786 32.12 C +39.829 36.551 35.725 36.907 33.33 35.404 c +31.838 34.468 31.182 32.499 31.51 31.468 c +32.056 29.749 33.619 29.171 34.838 30.015 C +33.713 30.671 34.186 32.258 35.861 31.936 c +38.299 31.467 38.069 28.216 36.705 26.592 c +34.737 24.248 30.74 21.998 19.415 32.12 c +14.458 36.551 10.354 36.907 7.96 35.404 c +S +19.792 7.094 m +21.157 8.719 21.386 11.968 18.949 12.437 c +17.274 12.76 16.801 11.172 17.926 10.516 C +16.708 9.673 15.145 10.252 14.598 11.969 c +14.27 13 14.926 14.969 16.418 15.906 c +18.812 17.409 22.916 17.053 27.874 12.622 c +39.199 2.5 43.195 4.75 45.163 7.094 c +46.528 8.719 46.757 11.968 44.32 12.437 c +42.644 12.76 42.172 11.172 43.297 10.516 C +42.078 9.673 40.515 10.252 39.968 11.969 c +39.64 13 40.297 14.969 41.788 15.906 c +44.183 17.409 48.287 17.053 53.245 12.622 C +64.569 2.5 68.565 4.75 70.534 7.094 c +71.898 8.719 72.127 11.968 69.69 12.437 c +68.014 12.76 67.542 11.172 68.667 10.516 C +67.448 9.673 65.885 10.252 65.338 11.969 c +65.011 13 65.667 14.969 67.159 15.906 c +69.553 17.409 73.657 17.053 78.615 12.622 c +S +%AI6_EndPatternLayer +) & +] E +%AI3_EndPattern +%AI5_End_NonPrinting-- +%AI5_Begin_NonPrinting +Np +12 Bn +%AI5_BeginGradient: (Black, White) +(Black, White) 0 2 Bd +[ +< +FFFEFDFCFBFAF9F8F7F6F5F4F3F2F1F0EFEEEDECEBEAE9E8E7E6E5E4E3E2E1E0DFDEDDDCDBDAD9D8 +D7D6D5D4D3D2D1D0CFCECDCCCBCAC9C8C7C6C5C4C3C2C1C0BFBEBDBCBBBAB9B8B7B6B5B4B3B2B1B0 +AFAEADACABAAA9A8A7A6A5A4A3A2A1A09F9E9D9C9B9A999897969594939291908F8E8D8C8B8A8988 +87868584838281807F7E7D7C7B7A797877767574737271706F6E6D6C6B6A69686766656463626160 +5F5E5D5C5B5A595857565554535251504F4E4D4C4B4A494847464544434241403F3E3D3C3B3A3938 +37363534333231302F2E2D2C2B2A292827262524232221201F1E1D1C1B1A19181716151413121110 +0F0E0D0C0B0A09080706050403020100 +> +0 %_Br +[ +0 0 50 100 %_Bs +1 0 50 0 %_Bs +BD +%AI5_EndGradient +%AI5_BeginGradient: (Chrome) +(Chrome) 0 6 Bd +[ +0 +< +464646454545444444444343434342424241414141404040403F3F3F3E3E3E3E3D3D3D3C3C3C3C3B +3B3B3B3A3A3A39393939383838383737373636363635353535343434333333333232323131313130 +3030302F2F2F2E2E2E2E2D2D2D2D2C2C2C2B2B2B2B2A2A2A2A292929282828282727272726262625 +2525252424242323232322222222212121202020201F1F1F1F1E1E1E1D1D1D1D1C1C1C1C1B1B1B1A +1A1A1A1919191818181817171717161616151515151414141413131312121212111111101010100F +0F0F0F0E0E0E0D0D0D0D0C0C0C0C0B0B0B0A0A0A0A09090909080808070707070606060505050504 +04040403030302020202010101010000 +> +< +FFFEFDFCFBFAF9F8F7F6F5F4F3F2F1F0EFEEEDECEBEAE9E8E7E6E5E4E3E2E1E0DFDEDDDCDBDAD9D8 +D7D6D5D4D3D2D1D0CFCECDCCCBCAC9C8C7C6C5C4C3C2C1C0BFBEBDBCBBBAB9B8B7B6B5B4B3B2B1B0 +AFAEADACABAAA9A8A7A6A5A4A3A2A1A09F9E9D9C9B9A999897969594939291908F8E8D8C8B8A8988 +87868584838281807F7E7D7C7B7A797877767574737271706F6E6D6C6B6A69686766656463626160 +5F5E5D5C5B5A595857565554535251504F4E4D4C4B4A494847464544434241403F3E3D3C3B3A3938 +37363534333231302F2E2D2C2B2A292827262524232221201F1E1D1C1B1A19181716151413121110 +0F0E0D0C0B0A09080706050403020100 +> +< +1F1E1E1E1E1E1E1E1E1E1D1D1D1D1D1D1D1D1C1C1C1C1C1C1C1C1B1B1B1B1B1B1B1B1B1A1A1A1A1A +1A1A1A19191919191919191818181818181818181717171717171717161616161616161615151515 +15151515151414141414141414131313131313131312121212121212121211111111111111111010 +1010101010100F0F0F0F0F0F0F0F0F0E0E0E0E0E0E0E0E0D0D0D0D0D0D0D0D0C0C0C0C0C0C0C0C0C +0B0B0B0B0B0B0B0B0A0A0A0A0A0A0A0A090909090909090909080808080808080807070707070707 +07060606060606060606050505050505050504040404040404040303030303030303030202020202 +02020201010101010101010000000000 +> +1 %_Br +0 +0.275 +1 +< +6B6A696867666564636261605F5E5D5C5B5A595857565554535251504F4E4D4C4B4A494847464544 +434241403F3E3D3C3B3A393837363534333231302F2E2D2C2B2A292827262524232221201F +> +1 %_Br +0 +< +00000101010102020202030303040404040505050506060607070707080808090909090A0A0A0A0B +0B0B0C0C0C0C0D0D0D0D0E0E0E0F0F0F0F1010101011111112121212131313141414141515151516 +161617171717181818181919191A1A1A1A1B1B1B1B1C1C1C1D1D1D1D1E1E1E1F1F1F1F2020202021 +212122222222232323232424242525252526262626272727282828282929292A2A2A2A2B2B2B2B2C +2C2C2D2D2D2D2E2E2E2E2F2F2F303030303131313132323233333333343434353535353636363637 +373738383838393939393A3A3A3B3B3B3B3C3C3C3C3D3D3D3E3E3E3E3F3F3F404040404141414142 +42424343434344444444454545464646 +> +< +000102030405060708090A0B0C0D0E0F101112131415161718191A1B1C1D1E1F2021222324252627 +28292A2B2C2D2E2F303132333435363738393A3B3C3D3E3F404142434445464748494A4B4C4D4E4F +505152535455565758595A5B5C5D5E5F606162636465666768696A6B6C6D6E6F7071727374757677 +78797A7B7C7D7E7F808182838485868788898A8B8C8D8E8F909192939495969798999A9B9C9D9E9F +A0A1A2A3A4A5A6A7A8A9AAABACADAEAFB0B1B2B3B4B5B6B7B8B9BABBBCBDBEBFC0C1C2C3C4C5C6C7 +C8C9CACBCCCDCECFD0D1D2D3D4D5D6D7D8D9DADBDCDDDEDFE0E1E2E3E4E5E6E7E8E9EAEBECEDEEEF +F0F1F2F3F4F5F6F7F8F9FAFBFCFDFEFF +> +< +00000101020203030304040505050606070708080809090A0A0A0B0B0C0C0D0D0D0E0E0F0F101010 +1111121212131314141515151616171718181819191A1A1A1B1B1C1C1D1D1D1E1E1F1F1F20202121 +222222232324242525252626272727282829292A2A2A2B2B2C2C2D2D2D2E2E2F2F2F303031313232 +32333334343435353636373737383839393A3A3A3B3B3C3C3C3D3D3E3E3F3F3F4040414142424243 +434444444545464647474748484949494A4A4B4B4C4C4C4D4D4E4E4F4F4F50505151515252535354 +54545555565657575758585959595A5A5B5B5C5C5C5D5D5E5E5F5F5F606061616162626363646464 +6565666666676768686969696A6A6B6B +> +1 %_Br +1 +0 %_Br +< +FFFEFDFCFBFAF9F8F7F6F5F4F3F2F1F0EFEEEDECEBEAE9E8E7E6E5E4E3E2E1E0DFDEDDDCDBDAD9D8 +D7D6D5D4D3D2D1D0CFCECDCCCBCAC9C8C7C6C5C4C3C2C1C0BFBEBDBCBBBAB9B8B7B6B5B4B3B2B1B0 +AFAEADACABAAA9A8A7A6A5A4A3A2A1A09F9E9D9C9B9A999897969594939291908F8E8D8C8B8A8988 +87868584838281807F7E7D7C7B7A797877767574737271706F6E6D6C6B6A69686766656463626160 +5F5E5D5C5B5A595857565554535251504F4E4D4C4B4A494847464544434241403F3E3D3C3B3A3938 +37363534333231302F2E2D2C2B2A292827262524232221201F1E1D1C1B1A19181716151413121110 +0F0E0D0C0B0A09080706050403020100 +> +< +4D4C4C4C4B4B4B4A4A4A4A4949494848484747474746464645454544444444434343424242414141 +414040403F3F3F3E3E3E3E3D3D3D3C3C3C3B3B3B3B3A3A3A39393938383838373737363636353535 +35343434333333323232323131313030302F2F2F2F2E2E2E2D2D2D2C2C2C2C2B2B2B2A2A2A292929 +292828282727272626262625252524242423232323222222212121202020201F1F1F1E1E1E1D1D1D +1D1C1C1C1B1B1B1A1A1A1A1919191818181717171716161615151514141414131313121212111111 +111010100F0F0F0E0E0E0E0D0D0D0C0C0C0B0B0B0B0A0A0A09090908080808070707060606050505 +05040404030303020202020101010000 +> +0 +0 +1 %_Br +[ +1 0 50 92 %_Bs +0 0.275 1 0.12 1 50 59 %_Bs +0 0.275 1 0.42 1 50 50 %_Bs +1 0 50 49 %_Bs +1 0 50 41 %_Bs +1 0.3 0 0 1 50 0 %_Bs +BD +%AI5_EndGradient +%AI5_BeginGradient: (Green, Blue) +(Green, Blue) 0 2 Bd +[ +< +99999A9A9B9B9B9C9C9D9D9D9E9E9F9F9FA0A0A1A1A1A2A2A3A3A3A4A4A5A5A5A6A6A7A7A7A8A8A9 +A9A9AAAAABABABACACADADADAEAEAFAFAFB0B0B1B1B1B2B2B3B3B3B4B4B5B5B5B6B6B7B7B7B8B8B9 +B9B9BABABBBBBBBCBCBDBDBDBEBEBFBFBFC0C0C1C1C1C2C2C3C3C3C4C4C5C5C5C6C6C7C7C7C8C8C9 +C9C9CACACBCBCBCCCCCDCDCDCECECFCFCFD0D0D1D1D1D2D2D3D3D3D4D4D5D5D5D6D6D7D7D7D8D8D9 +D9D9DADADBDBDBDCDCDDDDDDDEDEDFDFDFE0E0E1E1E1E2E2E3E3E3E4E4E5E5E5E6E6E7E7E7E8E8E9 +E9E9EAEAEBEBEBECECEDEDEDEEEEEFEFEFF0F0F1F1F1F2F2F3F3F3F4F4F5F5F5F6F6F7F7F7F8F8F9 +F9F9FAFAFBFBFBFCFCFDFDFDFEFEFFFF +> +< +000102020304050506070808090A0B0B0C0D0E0E0F101111121314141516171718191A1A1B1C1D1D +1E1F20202122232324252626272829292A2B2C2C2D2E2F2F303132323334353536373838393A3B3B +3C3D3E3E3F404141424344444546474748494A4A4B4C4D4D4E4F5050515253535455565657585959 +5A5B5C5C5D5E5F5F606162626364656566676868696A6B6B6C6D6E6E6F7071717273747475767777 +78797A7A7B7C7D7D7E7F80808182828384858586878888898A8B8B8C8D8E8E8F9091919293949495 +96979798999A9A9B9C9D9D9E9FA0A0A1A2A3A3A4A5A6A6A7A8A9A9AAABACACADAEAFAFB0B1B2B2B3 +B4B5B5B6B7B8B8B9BABBBBBCBDBEBEBF +> +< +FFFEFDFCFBFAF9F8F7F6F5F4F3F2F1F0EFEEEDECEBEAE9E8E7E6E5E4E3E2E1E0DFDEDDDCDBDAD9D8 +D7D6D5D4D3D2D1D0CFCECDCCCBCAC9C8C7C6C5C4C3C2C1C0BFBEBDBCBBBAB9B8B7B6B5B4B3B2B1B0 +AFAEADACABAAA9A8A7A6A5A4A3A2A1A09F9E9D9C9B9A999897969594939291908F8E8D8C8B8A8988 +87868584838281807F7E7D7C7B7A797877767574737271706F6E6D6C6B6A69686766656463626160 +5F5E5D5C5B5A595857565554535251504F4E4D4C4B4A494847464544434241403F3E3D3C3B3A3938 +37363534333231302F2E2D2C2B2A292827262524232221201F1E1D1C1B1A19181716151413121110 +0F0E0D0C0B0A09080706050403020100 +> +0 +1 %_Br +[ +1 0.75 0 0 1 50 100 %_Bs +0.6 0 1 0 1 50 0 %_Bs +BD +%AI5_EndGradient +%AI5_BeginGradient: (Orange, Green, Violet) +(Orange, Green, Violet) 0 3 Bd +[ +< +F0EFEFEFEEEEEEEDEDEDECECECEBEBEBEAEAEAE9E9E9E8E8E8E7E7E7E6E6E6E5E5E5E4E4E4E3E3E3 +E3E2E2E2E1E1E1E0E0E0DFDFDFDEDEDEDDDDDDDCDCDCDBDBDBDADADAD9D9D9D8D8D8D7D7D7D6D6D6 +D5D5D5D4D4D4D3D3D3D2D2D2D1D1D1D0D0D0CFCFCFCECECECDCDCDCCCCCCCBCBCBCACACAC9C9C9C8 +C8C8C7C7C7C6C6C6C5C5C5C4C4C4C3C3C3C2C2C2C2C1C1C1C0C0C0BFBFBFBEBEBEBDBDBDBCBCBCBB +BBBBBABABAB9B9B9B8B8B8B7B7B7B6B6B6B5B5B5B4B4B4B3B3B3B2B2B2B1B1B1B0B0B0AFAFAFAEAE +AEADADADACACACABABABAAAAAAA9A9A9A8A8A8A7A7A7A6A6A6A5A5A5A4A4A4A3A3A3A2A2A2A1A1A1 +A0A0A0A09F9F9F9E9E9E9D9D9D9C9C9C +> +< +5455555657575859595A5A5B5C5C5D5E5E5F5F6061616263636465656666676868696A6A6B6B6C6D +6D6E6F6F707171727273747475767677777879797A7B7B7C7C7D7E7E7F8080818282838384858586 +87878888898A8A8B8C8C8D8D8E8F8F909191929393949495969697989899999A9B9B9C9D9D9E9E9F +A0A0A1A2A2A3A4A4A5A5A6A7A7A8A9A9AAAAABACACADAEAEAFAFB0B1B1B2B3B3B4B5B5B6B6B7B8B8 +B9BABABBBBBCBDBDBEBFBFC0C1C1C2C2C3C4C4C5C6C6C7C7C8C9C9CACBCBCCCCCDCECECFD0D0D1D2 +D2D3D3D4D5D5D6D7D7D8D8D9DADADBDCDCDDDDDEDFDFE0E1E1E2E3E3E4E4E5E6E6E7E8E8E9E9EAEB +EBECEDEDEEEFEFF0F0F1F2F2F3F4F4F5 +> +< +FFFEFDFCFBFAF9F8F7F6F5F4F3F2F1F0EFEEEDECEBEAE9E8E7E6E5E4E3E2E1E0DFDEDDDCDBDAD9D8 +D7D6D5D4D3D2D1D0CFCECDCCCBCAC9C8C7C6C5C4C3C2C1C0BFBEBDBCBBBAB9B8B7B6B5B4B3B2B1B0 +AFAEADACABAAA9A8A7A6A5A4A3A2A1A09F9E9D9C9B9A999897969594939291908F8E8D8C8B8A8988 +87868584838281807F7E7D7C7B7A797877767574737271706F6E6D6C6B6A69686766656463626160 +5F5E5D5C5B5A595857565554535251504F4E4D4C4B4A494847464544434241403F3E3D3C3B3A3938 +37363534333231302F2E2D2C2B2A292827262524232221201F1E1D1C1B1A19181716151413121110 +0F0E0D0C0B0A09080706050403020100 +> +< +00000000000000000000000000000000000000000000000000000000000000000000000000000000 +00000000000000000000000101010101010101010101010101010101010101010101010101010101 +01010101010101010101010101010101010101010101010101010101010101010101010101010101 +01010101010101010101010101010101010101010101010101010101010101020202020202020202 +02020202020202020202020202020202020202020202020202020202020202020202020202020202 +02020202020202020202020202020202020202020202020202020202020202020202020202020202 +02020202020202020202020303030303 +> +1 %_Br +< +000102030405060708090A0B0C0D0E0F101112131415161718191A1B1C1D1E1F2021222324252627 +28292A2B2C2D2E2F303132333435363738393A3B3C3D3E3F404142434445464748494A4B4C4D4E4F +505152535455565758595A5B5C5D5E5F606162636465666768696A6B6C6D6E6F7071727374757677 +78797A7B7C7D7E7F808182838485868788898A8B8C8D8E8F909192939495969798999A9B9C9D9E9F +A0A1A2A3A4A5A6A7A8A9AAABACADAEAFB0B1B2B3B4B5B6B7B8B9BABBBCBDBEBFC0C1C2C3C4C5C6C7 +C8C9CACBCCCDCECFD0D1D2D3D4D5D6D7D8D9DADBDCDDDEDFE0E1E2E3E4E5E6E7E8E9EAEBECEDEEEF +F0 +> +< +A1A0A0A09F9F9F9E9E9E9D9D9D9D9C9C9C9B9B9B9A9A9A9999999898989797979696969595959594 +94949393939292929191919090908F8F8F8E8E8E8E8D8D8D8C8C8C8B8B8B8A8A8A89898988888887 +878787868686858585848484838383828282818181808080807F7F7F7E7E7E7D7D7D7C7C7C7B7B7B +7A7A7A79797978787878777777767676757575747474737373727272717171717070706F6F6F6E6E +6E6D6D6D6C6C6C6B6B6B6A6A6A6A6969696868686767676666666565656464646363636262626261 +61616060605F5F5F5E5E5E5D5D5D5C5C5C5B5B5B5B5A5A5A59595958585857575756565655555554 +54 +> +< +F5F5F5F5F5F5F5F5F5F5F5F5F5F5F5F5F5F6F6F6F6F6F6F6F6F6F6F6F6F6F6F6F6F6F6F6F6F6F6F6 +F7F7F7F7F7F7F7F7F7F7F7F7F7F7F7F7F7F7F7F7F7F7F7F7F8F8F8F8F8F8F8F8F8F8F8F8F8F8F8F8 +F8F8F8F8F8F8F8F8F9F9F9F9F9F9F9F9F9F9F9F9F9F9F9F9F9F9F9F9F9F9F9FAFAFAFAFAFAFAFAFA +FAFAFAFAFAFAFAFAFAFAFAFAFAFAFAFBFBFBFBFBFBFBFBFBFBFBFBFBFBFBFBFBFBFBFBFBFBFBFCFC +FCFCFCFCFCFCFCFCFCFCFCFCFCFCFCFCFCFCFCFCFCFCFDFDFDFDFDFDFDFDFDFDFDFDFDFDFDFDFDFD +FDFDFDFDFDFEFEFEFEFEFEFEFEFEFEFEFEFEFEFEFEFEFEFEFEFEFEFEFEFFFFFFFFFFFFFFFFFFFFFF +FF +> +0 +1 %_Br +[ +0.61 0.96 0 0.01 1 50 100 %_Bs +0.94 0.33 1 0 1 50 50 %_Bs +0 0.63 0.96 0 1 50 0 %_Bs +BD +%AI5_EndGradient +%AI5_BeginGradient: (Pink, Yellow, Green ) +(Pink, Yellow, Green ) 0 3 Bd +[ +< +000102030405060708090A0B0C0D0E0F101112131415161718191A1B1C1D1E1F2021222324252627 +28292A2B2C2D2E2F303132333435363738393A3B3C3D3E3F404142434445464748494A4B4C4E4F50 +5152535455565758595A5B5C5D5E5F606162636465666768696A6B6C6D6E6F70717273 +> +< +05050505050505050505050505050404040404040404040404040404040404040404040403030303 +03030303030303030303030303030303030303020202020202020202020202020202020202020202 +0201010101010101010101010101010101010101010101000000000000000000000000 +> +< +CCCCCCCCCCCBCBCBCBCBCBCBCBCBCACACACACACACACACAC9C9C9C9C9C9C9C9C9C8C8C8C8C8C8C8C8 +C8C7C7C7C7C7C7C7C7C7C6C6C6C6C6C6C6C6C6C5C5C5C5C5C5C5C5C5C4C4C4C4C4C4C4C4C3C3C3C3 +C3C3C3C3C3C2C2C2C2C2C2C2C2C2C1C1C1C1C1C1C1C1C1C0C0C0C0C0C0C0C0C0BFBFBF +> +0 +1 %_Br +< +0D0D0D0D0D0D0D0D0D0D0D0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0B +0B0B0B0B0B0B0B0B0B0B0B0B0B0B0B0B0B0B0B0B0B0B0A0A0A0A0A0A0A0A0A0A0A0A0A0A0A0A0A0A +0A0A0A09090909090909090909090909090909090909090808080808080808080808080808080808 +08080807070707070707070707070707070707070706060606060606060606060606060606060605 +05050505050505050505050505050505050404040404040404040404040404040404030303030303 +03030303030303030303030202020202020202020202020202020201010101010101010101010101 +010101000000000000000000 +> +< +B2B2B2B2B1B1B1B0B0B0AFAFAEAEAEADADACACABABAAAAA9A9A8A8A7A7A6A6A5A5A4A4A3A3A2A2A1 +A0A09F9F9E9E9D9D9C9B9B9A9A999898979796959594949392929190908F8F8E8D8D8C8B8B8A8989 +88888786868584848382828180807F7E7D7D7C7B7B7A7979787777767575747372727170706F6E6D +6D6C6B6B6A69686867666565646363626160605F5E5D5D5C5B5A5A59585757565554545352515150 +4F4E4D4D4C4B4A4A4948474646454443434241403F3F3E3D3C3B3B3A393837373635343333323130 +2F2F2E2D2C2B2B2A2928272726252423222221201F1E1D1D1C1B1A1918181716151413131211100F +0E0E0D0C0B0A090908070605 +> +< +0000010101020202030304040505060607070808090A0A0B0B0C0C0D0E0E0F0F1011111213131415 +151616171818191A1B1B1C1D1D1E1F1F202122222324242526272728292A2A2B2C2C2D2E2F303031 +323333343536363738393A3A3B3C3D3E3E3F4041424243444546464748494A4B4B4C4D4E4F505051 +5253545556565758595A5B5B5C5D5E5F6061626263646566676869696A6B6C6D6E6F707171727374 +75767778797A7B7B7C7D7E7F80818283848586868788898A8B8C8D8E8F9091929394949596979899 +9A9B9C9D9E9FA0A1A2A3A4A5A6A7A8A9AAAAABACADAEAFB0B1B2B3B4B5B6B7B8B9BABBBCBDBEBFC0 +C1C2C3C4C5C6C7C8C9CACBCC +> +0 +1 %_Br +[ +0.45 0 0.75 0 1 50 100 %_Bs +0 0.02 0.8 0 1 50 64 %_Bs +0.05 0.7 0 0 1 57 0 %_Bs +BD +%AI5_EndGradient +%AI5_BeginGradient: (Purple, Red, Yellow) +(Purple, Red, Yellow) 0 3 Bd +[ +0 +< +FFFEFDFCFBFAF9F8F7F6F5F4F3F2F1F0EFEEEDECEBEAE9E8E7E6E5E4E3E2E1E0DFDEDDDCDBDAD9D8 +D7D6D5D4D3D2D1D0CFCECDCCCBCAC9C8C7C6C5C4C3C2C1C0BFBEBDBCBBBAB9B8B7B6B5B4B3B2B1B0 +AFAEADACABAAA9A8A7A6A5A4A3A2A1A09F9E9D9C9B9A999897969594939291908F8E8D8C8B8A8988 +87868584838281807F7E7D7C7B7A797877767574737271706F6E6D6C6B6A69686766656463626160 +5F5E5D5C5B5A595857565554535251504F4E4D4C4B4A494847464544434241403F3E3D3C3B3A3938 +37363534333231302F2E2D2C2B2A292827262524232221201F1E1D1C1B1A19181716151413121110 +0F0E0D0C0B0A +> +< +CCCCCCCDCDCDCDCDCECECECECECFCFCFCFD0D0D0D0D0D1D1D1D1D1D2D2D2D2D2D3D3D3D3D3D4D4D4 +D4D5D5D5D5D5D6D6D6D6D6D7D7D7D7D7D8D8D8D8D8D9D9D9D9DADADADADADBDBDBDBDBDCDCDCDCDC +DDDDDDDDDDDEDEDEDEDFDFDFDFDFE0E0E0E0E0E1E1E1E1E1E2E2E2E2E2E3E3E3E3E4E4E4E4E4E5E5 +E5E5E5E6E6E6E6E6E7E7E7E7E7E8E8E8E8E9E9E9E9E9EAEAEAEAEAEBEBEBEBEBECECECECECEDEDED +EDEEEEEEEEEEEFEFEFEFEFF0F0F0F0F0F1F1F1F1F1F2F2F2F2F3F3F3F3F3F4F4F4F4F4F5F5F5F5F5 +F6F6F6F6F6F7F7F7F7F8F8F8F8F8F9F9F9F9F9FAFAFAFAFAFBFBFBFBFBFCFCFCFCFDFDFDFDFDFEFE +FEFEFEFFFFFF +> +0 +1 %_Br +< +E5E4E3E2E1E0DFDEDDDCDBDAD9D8D7D6D5D4D3D2D1D0CFCECDCCCBCAC9C8C7C6C5C4C3C2C1C0BFBE +BDBCBBBAB9B8B7B6B5B4B3B2B1B0AFAEADACABAAA9A8A7A6A5A4A3A2A1A09F9E9D9C9B9A99989796 +9594939291908F8E8D8C8B8A898887868584838281807F7E7D7C7B7A797877767574737271706F6E +6D6C6B6A696867666564636261605F5E5D5C5B5A595857565554535251504F4E4D4C4B4A49484746 +4544434241403F3E3D3C3B3A393837363534333231302F2E2D2C2B2A292827262524232221201F1E +1D1C1B1A191817161514131211100F0E0D0C0B0A09080706050403020100 +> +< +E5E6E6E6E6E6E6E6E6E7E7E7E7E7E7E7E7E7E8E8E8E8E8E8E8E8E8E9E9E9E9E9E9E9E9E9EAEAEAEA +EAEAEAEAEAEBEBEBEBEBEBEBEBEBECECECECECECECECECEDEDEDEDEDEDEDEDEDEEEEEEEEEEEEEEEE +EEEFEFEFEFEFEFEFEFEFF0F0F0F0F0F0F0F0F0F1F1F1F1F1F1F1F1F1F2F2F2F2F2F2F2F2F2F3F3F3 +F3F3F3F3F3F3F4F4F4F4F4F4F4F4F4F5F5F5F5F5F5F5F5F5F6F6F6F6F6F6F6F6F6F7F7F7F7F7F7F7 +F7F7F8F8F8F8F8F8F8F8F8F9F9F9F9F9F9F9F9F9FAFAFAFAFAFAFAFAFAFBFBFBFBFBFBFBFBFBFCFC +FCFCFCFCFCFCFCFDFDFDFDFDFDFDFDFDFEFEFEFEFEFEFEFEFEFFFFFFFFFF +> +< +00010203040405060708090A0B0C0C0D0E0F10111213141415161718191A1B1C1D1D1E1F20212223 +242525262728292A2B2C2D2D2E2F30313233343535363738393A3B3C3D3D3E3F4041424344454546 +4748494A4B4C4D4E4E4F50515253545556565758595A5B5C5D5E5E5F60616263646566666768696A +6B6C6D6E6E6F70717273747576767778797A7B7C7D7E7F7F80818283848586878788898A8B8C8D8E +8F8F90919293949596979798999A9B9C9D9E9F9FA0A1A2A3A4A5A6A7A7A8A9AAABACADAEAFAFB0B1 +B2B3B4B5B6B7B8B8B9BABBBCBDBEBFC0C0C1C2C3C4C5C6C7C8C8C9CACBCC +> +0 +1 %_Br +[ +0 0.04 1 0 1 50 100 %_Bs +0 1 0.8 0 1 50 50 %_Bs +0.9 0.9 0 0 1 50 0 %_Bs +BD +%AI5_EndGradient +%AI5_BeginGradient: (Rainbow) +(Rainbow) 0 6 Bd +[ +< +FFFEFDFCFBFAF9F8F7F6F5F4F3F2F1F0EFEEEDECEBEAE9E8E7E6E5E4E3E2E1E0DFDEDDDCDBDAD9D8 +D7D6D5D4D3D2D1D0CFCECDCCCBCAC9C8C7C6C5C4C3C2C1C0BFBEBDBCBBBAB9B8B7B6B5B4B3B2B1B0 +AFAEADACABAAA9A8A7A6A5A4A3A2A1A09F9E9D9C9B9A999897969594939291908F8E8D8C8B8A8988 +87868584838281807F7E7D7C7B7A797877767574737271706F6E6D6C6B6A69686766656463626160 +5F5E5D5C5B5A595857565554535251504F4E4D4C4B4A494847464544434241403F3E3D3C3B3A3938 +37363534333231302F2E2D2C2B2A292827262524232221201F1E1D1C1B1A19181716151413121110 +0F0E0D0C0B0A09080706050403020100 +> +1 +0 +0 +1 %_Br +1 +< +0708090A0B0C0D0E0F101112131415161718191A1B1C1D1E1F202122232425262728292A2B2C2D2E +2F303132333435363738393A3B3C3D3E3F404142434445464748494A4B4C4D4E4F50515253545556 +5758595A5B5C5D5E5F606162636465666768696A6B6C6D6E6F707172737475767778797A7B7C7D7E +7F808182838485868788898A8B8C8D8E8F909192939495969798999A9B9C9D9E9FA0A1A2A3A4A5A6 +A7A8A9AAABACADAEAFB0B1B2B3B4B5B6B7B8B9BABBBCBDBEBFC0C1C2C3C4C5C6C7C8C9CACBCCCDCE +CFD0D1D2D3D4D5D6D7D8D9DADBDCDDDEDFE0E1E2E3E4E5E6E7E8E9EAEBECEDEEEFF0F1F2F3F4F5F6 +F7F8F9FAFBFCFDFEFF +> +0 +0 +1 %_Br +1 +< +00000000000000000000000000000000000001010101010101010101010101010101010101010101 +01010101010101010101010101010202020202020202020202020202020202020202020202020202 +02020202020202020202030303030303030303030303030303030303030303030303030303030303 +03030303030304040404040404040404040404040404040404040404040404040404040404040404 +04040505050505050505050505050505050505050505050505050505050505050505050505050606 +06060606060606060606060606060606060606060606060606060606060606060606070707070707 +07070707070707070707070707070707 +> +< +FFFEFDFCFBFAF9F8F7F6F5F4F3F2F1F0EFEEEDECEBEAE9E8E7E6E5E4E3E2E1E0DFDEDDDCDBDAD9D8 +D7D6D5D4D3D2D1D0CFCECDCCCBCAC9C8C7C6C5C4C3C2C1C0BFBEBDBCBBBAB9B8B7B6B5B4B3B2B1B0 +AFAEADACABAAA9A8A7A6A5A4A3A2A1A09F9E9D9C9B9A999897969594939291908F8E8D8C8B8A8988 +87868584838281807F7E7D7C7B7A797877767574737271706F6E6D6C6B6A69686766656463626160 +5F5E5D5C5B5A595857565554535251504F4E4D4C4B4A494847464544434241403F3E3D3C3B3A3938 +37363534333231302F2E2D2C2B2A292827262524232221201F1E1D1C1B1A19181716151413121110 +0F0E0D0C0B0A09080706050403020100 +> +0 +1 %_Br +< +000102030405060708090A0B0C0D0E0F101112131415161718191A1B1C1D1E1F2021222324252627 +28292A2B2C2D2E2F303132333435363738393A3B3C3D3E3F404142434445464748494A4B4C4D4E4F +505152535455565758595A5B5C5D5E5F606162636465666768696A6B6C6D6E6F7071727374757677 +78797A7B7C7D7E7F808182838485868788898A8B8C8D8E8F909192939495969798999A9B9C9D9E9F +A0A1A2A3A4A5A6A7A8A9AAABACADAEAFB0B1B2B3B4B5B6B7B8B9BABBBCBDBEBFC0C1C2C3C4C5C6C7 +C8C9CACBCCCDCECFD0D1D2D3D4D5D6D7D8D9DADBDCDDDEDFE0E1E2E3E4E5E6E7E8E9EAEBECEDEEEF +F0F1F2F3F4F5F6F7F8F9FAFBFCFDFEFF +> +0 +1 +0 +1 %_Br +0 +< +FFFEFDFCFBFAF9F8F7F6F5F4F3F2F1F0EFEEEDECEBEAE9E8E7E6E5E4E3E2E1E0DFDEDDDCDBDAD9D8 +D7D6D5D4D3D2D1D0CFCECDCCCBCAC9C8C7C6C5C4C3C2C1C0BFBEBDBCBBBAB9B8B7B6B5B4B3B2B1B0 +AFAEADACABAAA9A8A7A6A5A4A3A2A1A09F9E9D9C9B9A999897969594939291908F8E8D8C8B8A8988 +87868584838281807F7E7D7C7B7A797877767574737271706F6E6D6C6B6A69686766656463626160 +5F5E5D5C5B5A595857565554535251504F4E4D4C4B4A494847464544434241403F3E3D3C3B3A3938 +37363534333231302F2E2D2C2B2A292827262524232221201F1E1D1C1B1A19181716151413121110 +0F0E0D0C0B0A09080706050403020100 +> +1 +0 +1 %_Br +[ +0 1 0 0 1 50 100 %_Bs +1 1 0 0 1 50 80 %_Bs +1 0.0279 0 0 1 50 60 %_Bs +1 0 1 0 1 50 40 %_Bs +0 0 1 0 1 50 20 %_Bs +0 1 1 0 1 50 0 %_Bs +BD +%AI5_EndGradient +%AI5_BeginGradient: (Steel Bar) +(Steel Bar) 0 3 Bd +[ +< +FFFEFDFCFBFAF9F8F7F6F5F4F3F2F1F0EFEEEDECEBEAE9E8E7E6E5E4E3E2E1E0DFDEDDDCDBDAD9D8 +D7D6D5D4D3D2D1D0CFCECDCCCBCAC9C8C7C6C5C4C3C2C1C0BFBEBDBCBBBAB9B8B7B6B5B4B3B2B1B0 +AFAEADACABAAA9A8A7A6A5A4A3A2A1A09F9E9D9C9B9A999897969594939291908F8E8D8C8B8A8988 +87868584838281807F7E7D7C7B7A797877767574737271706F6E6D6C6B6A69686766656463626160 +5F5E5D5C5B5A595857565554535251504F4E4D4C4B4A494847464544434241403F3E3D3C3B3A3938 +37363534333231302F2E2D2C2B2A292827262524232221201F1E1D1C1B1A19181716151413121110 +0F0E0D0C0B0A09080706050403020100 +> +0 %_Br +< +000102030405060708090A0B0C0D0E0F101112131415161718191A1B1C1D1E1F2021222324252627 +28292A2B2C2D2E2F303132333435363738393A3B3C3D3E3F404142434445464748494A4B4C4D4E4F +505152535455565758595A5B5C5D5E5F606162636465666768696A6B6C6D6E6F7071727374757677 +78797A7B7C7D7E7F808182838485868788898A8B8C8D8E8F909192939495969798999A9B9C9D9E9F +A0A1A2A3A4A5A6A7A8A9AAABACADAEAFB0B1B2B3B4B5B6B7B8B9BABBBCBDBEBFC0C1C2C3C4C5C6C7 +C8C9CACBCCCDCECFD0D1D2D3D4D5D6D7D8D9DADBDCDDDEDFE0E1E2E3E4E5E6E7E8E9EAEBECEDEEEF +F0F1F2F3F4F5F6F7F8F9FAFBFCFDFEFF +> +0 %_Br +[ +0 0 50 100 %_Bs +1 0 50 70 %_Bs +0 0 50 0 %_Bs +BD +%AI5_EndGradient +%AI5_BeginGradient: (White & Red Radial) +(White & Red Radial) 1 18 Bd +[ +0 +1 +1 +0 +1 %_Br +0 +1 +1 +0 +1 %_Br +0 +< +FFFEFDFCFBFAF9F8F7F6F5F4F3F2F1F0EFEEEDECEBEAE9E8E7E6E5E4E3E2E1E0DFDEDDDCDBDAD9D8 +D7D6D5D4D3D2D1D0CFCECDCCCBCAC9C8C7C6C5C4C3C2C1C0BFBEBDBCBBBAB9B8B7B6B5B4B3B2B1B0 +AFAEADACABAAA9A8A7A6A5A4A3A2A1A09F9E9D9C9B9A999897969594939291908F8E8D8C8B8A8988 +87868584838281807F7E7D7C7B7A797877767574737271706F6E6D6C6B6A69686766656463626160 +5F5E5D5C5B5A595857565554535251504F4E4D4C4B4A494847464544434241403F3E3D3C3B3A3938 +37363534333231302F2E2D2C2B2A292827262524232221201F1E1D1C1B1A19181716151413121110 +0F0E0D0C0B0A09080706050403020100 +> +< +FFFEFDFCFBFAF9F8F7F6F5F4F3F2F1F0EFEEEDECEBEAE9E8E7E6E5E4E3E2E1E0DFDEDDDCDBDAD9D8 +D7D6D5D4D3D2D1D0CFCECDCCCBCAC9C8C7C6C5C4C3C2C1C0BFBEBDBCBBBAB9B8B7B6B5B4B3B2B1B0 +AFAEADACABAAA9A8A7A6A5A4A3A2A1A09F9E9D9C9B9A999897969594939291908F8E8D8C8B8A8988 +87868584838281807F7E7D7C7B7A797877767574737271706F6E6D6C6B6A69686766656463626160 +5F5E5D5C5B5A595857565554535251504F4E4D4C4B4A494847464544434241403F3E3D3C3B3A3938 +37363534333231302F2E2D2C2B2A292827262524232221201F1E1D1C1B1A19181716151413121110 +0F0E0D0C0B0A09080706050403020100 +> +0 +1 %_Br +1 +0 %_Br +0 +< +000102030405060708090A0B0C0D0E0F101112131415161718191A1B1C1D1E1F2021222324252627 +28292A2B2C2D2E2F303132333435363738393A3B3C3D3E3F404142434445464748494A4B4C4D4E4F +505152535455565758595A5B5C5D5E5F606162636465666768696A6B6C6D6E6F7071727374757677 +78797A7B7C7D7E7F808182838485868788898A8B8C8D8E8F909192939495969798999A9B9C9D9E9F +A0A1A2A3A4A5A6A7A8A9AAABACADAEAFB0B1B2B3B4B5B6B7B8B9BABBBCBDBEBFC0C1C2C3C4C5C6C7 +C8C9CACBCCCDCECFD0D1D2D3D4D5D6D7D8D9DADBDCDDDEDFE0E1E2E3E4E5E6E7E8E9EAEBECEDEEEF +F0F1F2F3F4F5F6F7F8F9FAFBFCFDFEFF +> +< +000102030405060708090A0B0C0D0E0F101112131415161718191A1B1C1D1E1F2021222324252627 +28292A2B2C2D2E2F303132333435363738393A3B3C3D3E3F404142434445464748494A4B4C4D4E4F +505152535455565758595A5B5C5D5E5F606162636465666768696A6B6C6D6E6F7071727374757677 +78797A7B7C7D7E7F808182838485868788898A8B8C8D8E8F909192939495969798999A9B9C9D9E9F +A0A1A2A3A4A5A6A7A8A9AAABACADAEAFB0B1B2B3B4B5B6B7B8B9BABBBCBDBEBFC0C1C2C3C4C5C6C7 +C8C9CACBCCCDCECFD0D1D2D3D4D5D6D7D8D9DADBDCDDDEDFE0E1E2E3E4E5E6E7E8E9EAEBECEDEEEF +F0F1F2F3F4F5F6F7F8F9FAFBFCFDFEFF +> +0 +1 %_Br +0 +1 +1 +0 +1 %_Br +0 +< +FFFEFDFCFBFAF9F8F7F6F5F4F3F2F1F0EFEEEDECEBEAE9E8E7E6E5E4E3E2E1E0DFDEDDDCDBDAD9D8 +D7D6D5D4D3D2D1D0CFCECDCCCBCAC9C8C7C6C5C4C3C2C1C0BFBEBDBCBBBAB9B8B7B6B5B4B3B2B1B0 +AFAEADACABAAA9A8A7A6A5A4A3A2A1A09F9E9D9C9B9A999897969594939291908F8E8D8C8B8A8988 +87868584838281807F7E7D7C7B7A797877767574737271706F6E6D6C6B6A69686766656463626160 +5F5E5D5C5B5A595857565554535251504F4E4D4C4B4A494847464544434241403F3E3D3C3B3A3938 +37363534333231302F2E2D2C2B2A292827262524232221201F1E1D1C1B1A19181716151413121110 +0F0E0D0C0B0A09080706050403020100 +> +< +FFFEFDFCFBFAF9F8F7F6F5F4F3F2F1F0EFEEEDECEBEAE9E8E7E6E5E4E3E2E1E0DFDEDDDCDBDAD9D8 +D7D6D5D4D3D2D1D0CFCECDCCCBCAC9C8C7C6C5C4C3C2C1C0BFBEBDBCBBBAB9B8B7B6B5B4B3B2B1B0 +AFAEADACABAAA9A8A7A6A5A4A3A2A1A09F9E9D9C9B9A999897969594939291908F8E8D8C8B8A8988 +87868584838281807F7E7D7C7B7A797877767574737271706F6E6D6C6B6A69686766656463626160 +5F5E5D5C5B5A595857565554535251504F4E4D4C4B4A494847464544434241403F3E3D3C3B3A3938 +37363534333231302F2E2D2C2B2A292827262524232221201F1E1D1C1B1A19181716151413121110 +0F0E0D0C0B0A09080706050403020100 +> +0 +1 %_Br +1 +0 %_Br +0 +< +000102030405060708090A0B0C0D0E0F101112131415161718191A1B1C1D1E1F2021222324252627 +28292A2B2C2D2E2F303132333435363738393A3B3C3D3E3F404142434445464748494A4B4C4D4E4F +505152535455565758595A5B5C5D5E5F606162636465666768696A6B6C6D6E6F7071727374757677 +78797A7B7C7D7E7F808182838485868788898A8B8C8D8E8F909192939495969798999A9B9C9D9E9F +A0A1A2A3A4A5A6A7A8A9AAABACADAEAFB0B1B2B3B4B5B6B7B8B9BABBBCBDBEBFC0C1C2C3C4C5C6C7 +C8C9CACBCCCDCECFD0D1D2D3D4D5D6D7D8D9DADBDCDDDEDFE0E1E2E3E4E5E6E7E8E9EAEBECEDEEEF +F0F1F2F3F4F5F6F7F8F9FAFBFCFDFEFF +> +< +000102030405060708090A0B0C0D0E0F101112131415161718191A1B1C1D1E1F2021222324252627 +28292A2B2C2D2E2F303132333435363738393A3B3C3D3E3F404142434445464748494A4B4C4D4E4F +505152535455565758595A5B5C5D5E5F606162636465666768696A6B6C6D6E6F7071727374757677 +78797A7B7C7D7E7F808182838485868788898A8B8C8D8E8F909192939495969798999A9B9C9D9E9F +A0A1A2A3A4A5A6A7A8A9AAABACADAEAFB0B1B2B3B4B5B6B7B8B9BABBBCBDBEBFC0C1C2C3C4C5C6C7 +C8C9CACBCCCDCECFD0D1D2D3D4D5D6D7D8D9DADBDCDDDEDFE0E1E2E3E4E5E6E7E8E9EAEBECEDEEEF +F0F1F2F3F4F5F6F7F8F9FAFBFCFDFEFF +> +0 +1 %_Br +0 +1 +1 +0 +1 %_Br +0 +< +FFFEFDFCFBFAF9F8F7F6F5F4F3F2F1F0EFEEEDECEBEAE9E8E7E6E5E4E3E2E1E0DFDEDDDCDBDAD9D8 +D7D6D5D4D3D2D1D0CFCECDCCCBCAC9C8C7C6C5C4C3C2C1C0BFBEBDBCBBBAB9B8B7B6B5B4B3B2B1B0 +AFAEADACABAAA9A8A7A6A5A4A3A2A1A09F9E9D9C9B9A999897969594939291908F8E8D8C8B8A8988 +87868584838281807F7E7D7C7B7A797877767574737271706F6E6D6C6B6A69686766656463626160 +5F5E5D5C5B5A595857565554535251504F4E4D4C4B4A494847464544434241403F3E3D3C3B3A3938 +37363534333231302F2E2D2C2B2A292827262524232221201F1E1D1C1B1A19181716151413121110 +0F0E0D0C0B0A09080706050403020100 +> +< +FFFEFDFCFBFAF9F8F7F6F5F4F3F2F1F0EFEEEDECEBEAE9E8E7E6E5E4E3E2E1E0DFDEDDDCDBDAD9D8 +D7D6D5D4D3D2D1D0CFCECDCCCBCAC9C8C7C6C5C4C3C2C1C0BFBEBDBCBBBAB9B8B7B6B5B4B3B2B1B0 +AFAEADACABAAA9A8A7A6A5A4A3A2A1A09F9E9D9C9B9A999897969594939291908F8E8D8C8B8A8988 +87868584838281807F7E7D7C7B7A797877767574737271706F6E6D6C6B6A69686766656463626160 +5F5E5D5C5B5A595857565554535251504F4E4D4C4B4A494847464544434241403F3E3D3C3B3A3938 +37363534333231302F2E2D2C2B2A292827262524232221201F1E1D1C1B1A19181716151413121110 +0F0E0D0C0B0A09080706050403020100 +> +0 +1 %_Br +1 +0 %_Br +0 +< +000102030405060708090A0B0C0D0E0F101112131415161718191A1B1C1D1E1F2021222324252627 +28292A2B2C2D2E2F303132333435363738393A3B3C3D3E3F404142434445464748494A4B4C4D4E4F +505152535455565758595A5B5C5D5E5F606162636465666768696A6B6C6D6E6F7071727374757677 +78797A7B7C7D7E7F808182838485868788898A8B8C8D8E8F909192939495969798999A9B9C9D9E9F +A0A1A2A3A4A5A6A7A8A9AAABACADAEAFB0B1B2B3B4B5B6B7B8B9BABBBCBDBEBFC0C1C2C3C4C5C6C7 +C8C9CACBCCCDCECFD0D1D2D3D4D5D6D7D8D9DADBDCDDDEDFE0E1E2E3E4E5E6E7E8E9EAEBECEDEEEF +F0F1F2F3F4F5F6F7F8F9FAFBFCFDFEFF +> +< +000102030405060708090A0B0C0D0E0F101112131415161718191A1B1C1D1E1F2021222324252627 +28292A2B2C2D2E2F303132333435363738393A3B3C3D3E3F404142434445464748494A4B4C4D4E4F +505152535455565758595A5B5C5D5E5F606162636465666768696A6B6C6D6E6F7071727374757677 +78797A7B7C7D7E7F808182838485868788898A8B8C8D8E8F909192939495969798999A9B9C9D9E9F +A0A1A2A3A4A5A6A7A8A9AAABACADAEAFB0B1B2B3B4B5B6B7B8B9BABBBCBDBEBFC0C1C2C3C4C5C6C7 +C8C9CACBCCCDCECFD0D1D2D3D4D5D6D7D8D9DADBDCDDDEDFE0E1E2E3E4E5E6E7E8E9EAEBECEDEEEF +F0F1F2F3F4F5F6F7F8F9FAFBFCFDFEFF +> +0 +1 %_Br +0 +1 +1 +0 +1 %_Br +0 +< +FFFEFDFCFBFAF9F8F7F6F5F4F3F2F1F0EFEEEDECEBEAE9E8E7E6E5E4E3E2E1E0DFDEDDDCDBDAD9D8 +D7D6D5D4D3D2D1D0CFCECDCCCBCAC9C8C7C6C5C4C3C2C1C0BFBEBDBCBBBAB9B8B7B6B5B4B3B2B1B0 +AFAEADACABAAA9A8A7A6A5A4A3A2A1A09F9E9D9C9B9A999897969594939291908F8E8D8C8B8A8988 +87868584838281807F7E7D7C7B7A797877767574737271706F6E6D6C6B6A69686766656463626160 +5F5E5D5C5B5A595857565554535251504F4E4D4C4B4A494847464544434241403F3E3D3C3B3A3938 +37363534333231302F2E2D2C2B2A292827262524232221201F1E1D1C1B1A19181716151413121110 +0F0E0D0C0B0A09080706050403020100 +> +< +FFFEFDFCFBFAF9F8F7F6F5F4F3F2F1F0EFEEEDECEBEAE9E8E7E6E5E4E3E2E1E0DFDEDDDCDBDAD9D8 +D7D6D5D4D3D2D1D0CFCECDCCCBCAC9C8C7C6C5C4C3C2C1C0BFBEBDBCBBBAB9B8B7B6B5B4B3B2B1B0 +AFAEADACABAAA9A8A7A6A5A4A3A2A1A09F9E9D9C9B9A999897969594939291908F8E8D8C8B8A8988 +87868584838281807F7E7D7C7B7A797877767574737271706F6E6D6C6B6A69686766656463626160 +5F5E5D5C5B5A595857565554535251504F4E4D4C4B4A494847464544434241403F3E3D3C3B3A3938 +37363534333231302F2E2D2C2B2A292827262524232221201F1E1D1C1B1A19181716151413121110 +0F0E0D0C0B0A09080706050403020100 +> +0 +1 %_Br +1 +0 %_Br +0 +< +000102030405060708090A0B0C0D0E0F101112131415161718191A1B1C1D1E1F2021222324252627 +28292A2B2C2D2E2F303132333435363738393A3B3C3D3E3F404142434445464748494A4B4C4D4E4F +505152535455565758595A5B5C5D5E5F606162636465666768696A6B6C6D6E6F7071727374757677 +78797A7B7C7D7E7F808182838485868788898A8B8C8D8E8F909192939495969798999A9B9C9D9E9F +A0A1A2A3A4A5A6A7A8A9AAABACADAEAFB0B1B2B3B4B5B6B7B8B9BABBBCBDBEBFC0C1C2C3C4C5C6C7 +C8C9CACBCCCDCECFD0D1D2D3D4D5D6D7D8D9DADBDCDDDEDFE0E1E2E3E4E5E6E7E8E9EAEBECEDEEEF +F0F1F2F3F4F5F6F7F8F9FAFBFCFDFEFF +> +< +000102030405060708090A0B0C0D0E0F101112131415161718191A1B1C1D1E1F2021222324252627 +28292A2B2C2D2E2F303132333435363738393A3B3C3D3E3F404142434445464748494A4B4C4D4E4F +505152535455565758595A5B5C5D5E5F606162636465666768696A6B6C6D6E6F7071727374757677 +78797A7B7C7D7E7F808182838485868788898A8B8C8D8E8F909192939495969798999A9B9C9D9E9F +A0A1A2A3A4A5A6A7A8A9AAABACADAEAFB0B1B2B3B4B5B6B7B8B9BABBBCBDBEBFC0C1C2C3C4C5C6C7 +C8C9CACBCCCDCECFD0D1D2D3D4D5D6D7D8D9DADBDCDDDEDFE0E1E2E3E4E5E6E7E8E9EAEBECEDEEEF +F0F1F2F3F4F5F6F7F8F9FAFBFCFDFEFF +> +0 +1 %_Br +[ +0 1 1 0 1 50 0 %_Bs +0 1 1 0 1 50 0 %_Bs +0 1 1 0 1 50 12.5 %_Bs +0 0 0 0 1 50 12.5 %_Bs +0 0 0 0 1 50 25 %_Bs +0 1 1 0 1 50 25 %_Bs +0 1 1 0 1 50 37.5 %_Bs +0 0 0 0 1 50 37.5 %_Bs +0 0 0 0 1 50 50 %_Bs +0 1 1 0 1 50 50 %_Bs +0 1 1 0 1 50 62.5 %_Bs +0 0 0 0 1 50 62.5 %_Bs +0 0 0 0 1 50 75 %_Bs +0 1 1 0 1 50 75 %_Bs +0 1 1 0 1 50 87.5 %_Bs +0 0 0 0 1 50 87.5 %_Bs +0 0 0 0 1 50 100 %_Bs +0 1 1 0 1 50 100 %_Bs +BD +%AI5_EndGradient +%AI5_BeginGradient: (Yellow & Orange Radial) +(Yellow & Orange Radial) 1 2 Bd +[ +0 +< +0001010203040506060708090A0B0C0C0D0E0F10111213131415161718191A1B1C1D1D1E1F202122 +232425262728292A2B2B2C2D2E2F303132333435363738393A3B3C3D3E3E3F404142434445464748 +494A4B4C4D4E4F505152535455565758595A5B5C5D5E5F60606162636465666768696A6B6C6D6E6F +707172737475767778797A7B7C7D7E7F808182838485868788898A8B8C +> +< +FFFFFFFFFEFEFEFEFEFEFEFDFDFDFDFDFDFCFCFCFCFCFCFBFBFBFBFBFBFAFAFAFAFAFAF9F9F9F9F9 +F9F8F8F8F8F8F8F7F7F7F7F7F7F6F6F6F6F6F6F5F5F5F5F5F5F4F4F4F4F4F3F3F3F3F3F3F2F2F2F2 +F2F2F1F1F1F1F1F0F0F0F0F0F0EFEFEFEFEFEFEEEEEEEEEEEDEDEDEDEDEDECECECECECEBEBEBEBEB +EBEAEAEAEAEAE9E9E9E9E9E9E8E8E8E8E8E8E7E7E7E7E7E6E6E6E6E6E5 +> +0 +1 %_Br +[ +0 0 1 0 1 52 19 %_Bs +0 0.55 0.9 0 1 50 100 %_Bs +BD +%AI5_EndGradient +%AI5_BeginGradient: (Yellow & Purple Radial) +(Yellow & Purple Radial) 1 2 Bd +[ +< +000102030405060708090A0B0C0D0E0F101112131415161718191A1B1C1D1E1F2021222324252627 +28292A2B2C2D2E2F303132333435363738393A3B3C3D3E3F404142434445464748494A4B4C4D4E4F +505152535455565758595A5B5C5D5E5F606162636465666768696A6B6C6D6E6F7071727374757677 +78797A7B7C7D7E7F808182838485868788898A8B8C8D8E8F909192939495969798999A9B9C9D9E9F +A0A1A2A3A4A5A6A7A8A9AAABACADAEAFB0B1B2B3B4B5B6B7B8B9BABBBCBDBEBFC0C1C2C3C4C5C6C7 +C8C9CACBCCCDCECFD0D1D2D3D4D5D6D7D8D9DADBDCDDDEDFE0E1E2E3E4E5E6E7E8E9EAEBECEDEEEF +F0F1F2F3F4F5F6F7F8F9FAFBFCFDFEFF +> +< +1415161718191A1B1C1D1E1F1F202122232425262728292A2A2B2C2D2E2F30313233343536363738 +393A3B3C3D3E3F40414142434445464748494A4B4C4D4D4E4F50515253545556575858595A5B5C5D +5E5F60616263646465666768696A6B6C6D6E6F6F707172737475767778797A7B7B7C7D7E7F808182 +83848586868788898A8B8C8D8E8F90919292939495969798999A9B9C9D9D9E9FA0A1A2A3A4A5A6A7 +A8A9A9AAABACADAEAFB0B1B2B3B4B4B5B6B7B8B9BABBBCBDBEBFC0C0C1C2C3C4C5C6C7C8C9CACBCB +CCCDCECFD0D1D2D3D4D5D6D7D7D8D9DADBDCDDDEDFE0E1E2E2E3E4E5E6E7E8E9EAEBECEDEEEEEFF0 +F1F2F3F4F5F6F7F8F9F9FAFBFCFDFEFF +> +< +ABAAAAA9A8A7A7A6A5A5A4A3A3A2A1A1A09F9F9E9D9D9C9B9B9A9999989797969595949393929191 +908F8F8E8D8D8C8B8B8A8989888787868585848383828181807F7F7E7D7D7C7B7B7A797978777776 +7575747373727171706F6F6E6D6D6C6B6B6A6969686767666565646362626160605F5E5E5D5C5C5B +5A5A5958585756565554545352525150504F4E4E4D4C4C4B4A4A4948484746464544444342424140 +403F3E3E3D3C3C3B3A3A3938383736363534343332323130302F2E2E2D2C2C2B2A2A292828272626 +25242423222121201F1F1E1D1D1C1B1B1A1919181717161515141313121111100F0F0E0D0D0C0B0B +0A090908070706050504030302010100 +> +0 +1 %_Br +[ +0 0.08 0.67 0 1 50 14 %_Bs +1 1 0 0 1 50 100 %_Bs +BD +%AI5_EndGradient +%AI5_BeginGradient: (Yellow, Violet, Orange, Blue) +(Yellow, Violet, Orange, Blue) 0 4 Bd +[ +< +000102030405060708090A0B0C0D0E0F101112131415161718191A1B1C1D1E1F2021222324252627 +28292A2B2C2D2E2F303132333435363738393A3B3C3D3E3F404142434445464748494A4B4C4D4E4F +505152535455565758595A5B5C5D5E5F606162636465666768696A6B6C6D6E6F7071727374757677 +78797A7B7C7D7E7F808182838485868788898A8B8C8D8E8F909192939495969798999A9B9C9D9E9F +A0A1A2A3A4A5A6A7A8A9AAABACADAEAFB0B1B2B3B4B5B6B7B8B9BABBBCBDBEBFC0C1C2C3C4C5C6C7 +C8C9CACBCCCDCECFD0D1D2D3D4D5D6D7D8D9DADBDCDDDEDFE0E1E2E3E4E5E6E7E8E9EAEBECEDEEEF +F0F1F2F3F4F5F6F7F8F9FAFBFCFDFEFF +> +< +A1A1A1A1A2A2A2A2A3A3A3A3A4A4A4A4A4A5A5A5A5A6A6A6A6A7A7A7A7A8A8A8A8A9A9A9A9AAAAAA +AAAAABABABABACACACACADADADADAEAEAEAEAFAFAFAFB0B0B0B0B0B1B1B1B1B2B2B2B2B3B3B3B3B4 +B4B4B4B5B5B5B5B6B6B6B6B6B7B7B7B7B8B8B8B8B9B9B9B9BABABABABBBBBBBBBCBCBCBCBCBDBDBD +BDBEBEBEBEBFBFBFBFC0C0C0C0C1C1C1C1C2C2C2C2C2C3C3C3C3C4C4C4C4C5C5C5C5C6C6C6C6C7C7 +C7C7C8C8C8C8C8C9C9C9C9CACACACACBCBCBCBCCCCCCCCCDCDCDCDCECECECECECFCFCFCFD0D0D0D0 +D1D1D1D1D2D2D2D2D3D3D3D3D4D4D4D4D4D5D5D5D5D6D6D6D6D7D7D7D7D8D8D8D8D9D9D9D9DADADA +DADADBDBDBDBDCDCDCDCDDDDDDDDDEDE +> +< +F5F4F3F2F1F0EFEEEDECEBEAE9E8E7E6E5E4E4E3E2E1E0DFDEDDDCDBDAD9D8D7D6D5D4D3D2D1D0CF +CECDCCCCCBCAC9C8C7C6C5C4C3C2C1C0BFBEBDBCBBBAB9B8B7B6B5B4B4B3B2B1B0AFAEADACABAAA9 +A8A7A6A5A4A3A2A1A09F9E9D9C9C9B9A999897969594939291908F8E8D8C8B8A8988878685848483 +8281807F7E7D7C7B7A797877767574737271706F6E6D6C6C6B6A696867666564636261605F5E5D5C +5B5A59585756555454535251504F4E4D4C4B4A494847464544434241403F3E3D3C3C3B3A39383736 +3534333231302F2E2D2C2B2A29282726252424232221201F1E1D1C1B1A191817161514131211100F +0E0D0C0C0B0A09080706050403020100 +> +0 +1 %_Br +< +9C9B9A9A9998989796969595949393929191908F8F8E8E8D8C8C8B8A8A8989888787868585848383 +82828180807F7E7E7D7C7C7B7B7A797978777776757574747372727170706F6E6E6D6D6C6B6B6A69 +6968676766666564646362626161605F5F5E5D5D5C5B5B5A5A595858575656555454535352515150 +4F4F4E4D4D4C4C4B4A4A4948484746464545444343424141403F3F3E3E3D3C3C3B3A3A3939383737 +36353534333332323130302F2E2E2D2C2C2B2B2A292928272726252524242322222120201F1E1E1D +1D1C1B1B1A191918171716161514141312121111100F0F0E0D0D0C0B0B0A0A090808070606050404 +030302010100 +> +< +F5F4F4F4F3F3F3F2F2F2F1F1F1F0F0F0EFEFEFEEEEEEEDEDEDECECECEBEBEAEAEAE9E9E9E8E8E8E7 +E7E7E6E6E6E5E5E5E4E4E4E3E3E3E2E2E2E1E1E1E0E0E0DFDFDEDEDEDDDDDDDCDCDCDBDBDBDADADA +D9D9D9D8D8D8D7D7D7D6D6D6D5D5D5D4D4D3D3D3D2D2D2D1D1D1D0D0D0CFCFCFCECECECDCDCDCCCC +CCCBCBCBCACACAC9C9C8C8C8C7C7C7C6C6C6C5C5C5C4C4C4C3C3C3C2C2C2C1C1C1C0C0C0BFBFBFBE +BEBEBDBDBCBCBCBBBBBBBABABAB9B9B9B8B8B8B7B7B7B6B6B6B5B5B5B4B4B4B3B3B3B2B2B1B1B1B0 +B0B0AFAFAFAEAEAEADADADACACACABABABAAAAAAA9A9A9A8A8A8A7A7A6A6A6A5A5A5A4A4A4A3A3A3 +A2A2A2A1A1A1 +> +< +000102030405060708090A0B0C0D0E0F101112131415161718191A1B1C1D1E1F2021222324252627 +28292A2B2C2D2E2F303132333435363738393A3B3C3D3E3F404142434445464748494A4B4C4D4E4F +505152535455565758595A5B5C5D5E5F606162636465666768696A6B6C6D6E6F7071727374757677 +78797A7B7C7D7E7F808182838485868788898A8B8C8D8E8F909192939495969798999A9B9C9D9E9F +A0A1A2A3A4A5A6A7A8A9AAABACADAEAFB0B1B2B3B4B5B6B7B8B9BABBBCBDBEBFC0C1C2C3C4C5C6C7 +C8C9CACBCCCDCECFD0D1D2D3D4D5D6D7D8D9DADBDCDDDEDFE0E1E2E3E4E5E6E7E8E9EAEBECEDEEEF +F0F1F2F3F4F5 +> +< +03030303030202020202020202020202020202020202020202020202020202020202020202020202 +02020202020202020202020202020202020202020202020202020202020202020202020202020202 +02020202020202020202020202020202020202020201010101010101010101010101010101010101 +01010101010101010101010101010101010101010101010101010101010101010101010101010101 +01010101010101010101010101010101010101010101010101010101010101010101010101000000 +00000000000000000000000000000000000000000000000000000000000000000000000000000000 +000000000000 +> +1 %_Br +< +0D0D0E0F0F10101111121313141415161617171819191A1A1B1C1C1D1D1E1E1F2020212122232324 +2425262627272828292A2A2B2B2C2D2D2E2E2F30303131323333343435353637373838393A3A3B3B +3C3D3D3E3E3F3F404141424243444445454647474848494A4A4B4B4C4C4D4E4E4F4F505151525253 +54545555565757585859595A5B5B5C5C5D5E5E5F5F60616162626363646565666667686869696A6B +6B6C6C6D6E6E6F6F70707172727373747575767677787879797A7B7B7C7C7D7D7E7F7F8080818282 +8383848585868687878889898A8A8B8C8C8D8D8E8F8F90909192929393949495969697979899999A +9A9B9C +> +< +08090A0B0C0D0E0F0F101112131415161718191A1B1C1D1E1F202122232425262728292A2B2C2D2E +2F303132333435363738393A3B3C3D3E3F40404142434445464748494A4B4C4D4E4F505152535455 +565758595A5B5C5D5E5F606162636465666768696A6B6C6D6E6F70717172737475767778797A7B7C +7D7E7F808182838485868788898A8B8C8D8E8F909192939495969798999A9B9C9D9E9FA0A1A2A2A3 +A4A5A6A7A8A9AAABACADAEAFB0B1B2B3B4B5B6B7B8B9BABBBCBDBEBFC0C1C2C3C4C5C6C7C8C9CACB +CCCDCECFD0D1D2D2D3D4D5D6D7D8D9DADBDCDDDEDFE0E1E2E3E4E5E6E7E8E9EAEBECEDEEEFF0F1F2 +F3F4F5 +> +< +F2F1F0EFEEEDECEBEAE9E8E7E6E5E4E3E2E1E0DFDEDDDCDBDAD9D8D7D6D5D4D3D2D1D0CFCECDCCCB +CAC9C8C7C6C5C4C3C2C1C0BFBEBDBCBBBAB9B8B7B6B5B4B3B2B1B0AFAEADACABAAA9A8A7A6A5A4A3 +A2A1A09F9E9D9C9B9A999897969594939291908F8E8D8C8B8A898887868584838281807F7E7D7C7B +7A797877767574737271706F6E6D6C6B6A696867666564636261605F5E5D5C5B5A59585756555453 +5251504F4E4D4C4B4A494847464544434241403F3E3D3C3B3A393837363534333231302F2E2D2C2B +2A292827262524232221201F1E1D1C1B1A191817161514131211100F0E0D0C0B0A09080706050403 +020100 +> +< +00000000000000000000000000000000000000000000000000000000000000000000000000000000 +00000000000000000101010101010101010101010101010101010101010101010101010101010101 +01010101010101010101010101010101010101010101010101010101010101010101010101010101 +01010101010101010101010101010101010101010101010202020202020202020202020202020202 +02020202020202020202020202020202020202020202020202020202020202020202020202020202 +02020202020202020202020202020202020202020202020202020202020202020202020202020303 +030303 +> +1 %_Br +[ +1 0.87 0 0 1 50 95 %_Bs +0 0.63 0.96 0 1 50 65 %_Bs +0.61 0.96 0 0.01 1 50 35 %_Bs +0.05 0.03 0.95 0 1 50 5 %_Bs +BD +%AI5_EndGradient +%AI5_End_NonPrinting-- +%AI5_BeginPalette +0 0 Pb +0 0 0 0 k +(C=0 M=0 Y=0 K=0) Pc +0 0 0 1 k +(C=0 M=0 Y=0 K=100) Pc +0 0.45 0.6 0 k +(C=0 M=45 Y=60 K=0) Pc +0 0.5 0.05 0 k +(C=0 M=50 Y=5 K=0) Pc +0 0.9 1 0 k +(C=0 M=90 Y=100 K=0) Pc +1 0.2 1 0 k +(C=100 M=20 Y=100 K=0) Pc +1 0.4 0.15 0 k +(C=100 M=40 Y=15 K=0) Pc +0.2 0 1 0 k +(C=20 M=0 Y=100 K=0) Pc +0.25 1 0.25 0 k +(C=25 M=100 Y=25 K=0) Pc +0.4 0.4 0.4 0 k +(C=40 M=40 Y=40 K=0) Pc +0.4 0.7 1 0 k +(C=40 M=70 Y=100 K=0) Pc +0.75 0.9 0 0 k +(C=75 M=90 Y=0 K=0) Pc +1 0 0.55 0 (Aqua) 0 x +(Aqua) Pc +1 0.5 0 0 (Blue) 0 x +(Blue) Pc +0.5 0.4 0.3 0 (Blue Gray) 0 x +(Blue Gray) Pc +0.8 0.05 0 0 (Blue Sky) 0 x +(Blue Sky) Pc +0.5 0.85 1 0 (Brown) 0 x +(Brown) Pc +1 0.9 0.1 0 (Dark Blue) 0 x +(Dark Blue) Pc +1 0.55 1 0 (Forest Green) 0 x +(Forest Green) Pc +0.05 0.2 0.95 0 (Gold) 0 x +(Gold) Pc +0.75 0.05 1 0 (Grass Green) 0 x +(Grass Green) Pc +0 0.45 1 0 (Orange) 0 x +(Orange) Pc +0.15 1 1 0 (Red) 0 x +(Red) Pc +0.45 0.9 0 0 (Violet) 0 x +(Violet) Pc +Bb +2 (Black, White) -4014 4716 0 0 1 0 0 1 0 0 Bg +0 BB +(Black, White) Pc +Bb +2 (Chrome) -4014 4716 0 0 1 0 0 1 0 0 Bg +0 BB +(Chrome) Pc +Bb +2 (Green, Blue) -4014 4716 0 0 1 0 0 1 0 0 Bg +0 BB +(Green, Blue) Pc +Bb +2 (Orange, Green, Violet) -4014 4716 0 0 1 0 0 1 0 0 Bg +0 BB +(Orange, Green, Violet) Pc +Bb +2 (Pink, Yellow, Green ) -4014 4716 0 0 1 0 0 1 0 0 Bg +0 BB +(Pink, Yellow, Green ) Pc +Bb +2 (Purple, Red, Yellow) -4014 4716 0 0 1 0 0 1 0 0 Bg +0 BB +(Purple, Red, Yellow) Pc +Bb +2 (Rainbow) -4014 4716 0 0 1 0 0 1 0 0 Bg +0 BB +(Rainbow) Pc +Bb +2 (Steel Bar) -4014 4716 0 0 1 0 0 1 0 0 Bg +0 BB +(Steel Bar) Pc +Bb +0 0 0 0 Bh +2 (White & Red Radial) -4014 4716 0 0 1 0 0 1 0 0 Bg +0 BB +(White & Red Radial) Pc +Bb +0 0 0 0 Bh +2 (Yellow & Orange Radial) -4014 4716 0 0 1 0 0 1 0 0 Bg +0 BB +(Yellow & Orange Radial) Pc +Bb +0 0 0 0 Bh +2 (Yellow & Purple Radial) -4014 4716 0 0 1 0 0 1 0 0 Bg +0 BB +(Yellow & Purple Radial) Pc +Bb +2 (Yellow, Violet, Orange, Blue) -4014 4716 0 0 1 0 0 1 0 0 Bg +0 BB +(Yellow, Violet, Orange, Blue) Pc +(Arrow1.2.out/in) 0 0 1 1 0 0 0 0 0 [1 0 0 1 0 0] p +(Arrow1.2.out/in) Pc +(Arrow1.2.side) 0 0 1 1 0 0 0 0 0 [1 0 0 1 0 0] p +(Arrow1.2.side) Pc +(Bricks) 0 0 1 1 0 0 0 0 0 [1 0 0 1 0 0] p +(Bricks) Pc +(Checks) 0 0 1 1 0 0 0 0 0 [1 0 0 1 0 0] p +(Checks) Pc +(Confetti) 0 0 1 1 0 0 0 0 0 [1 0 0 1 0 0] p +(Confetti) Pc +(DblLine1.2.inner) 0 0 1 1 0 0 0 0 0 [1 0 0 1 0 0] p +(DblLine1.2.inner) Pc +(DblLine1.2.outer) 0 0 1 1 0 0 0 0 0 [1 0 0 1 0 0] p +(DblLine1.2.outer) Pc +(DblLine1.2.side) 0 0 1 1 0 0 0 0 0 [1 0 0 1 0 0] p +(DblLine1.2.side) Pc +(Diamonds) 0 0 1 1 0 0 0 0 0 [1 0 0 1 0 0] p +(Diamonds) Pc +(Hexagon) 0 0 1 1 0 0 0 0 0 [1 0 0 1 0 0] p +(Hexagon) Pc +(Laurel.inner) 0 0 1 1 0 0 0 0 0 [1 0 0 1 0 0] p +(Laurel.inner) Pc +(Laurel.outer) 0 0 1 1 0 0 0 0 0 [1 0 0 1 0 0] p +(Laurel.outer) Pc +(Laurel.side) 0 0 1 1 0 0 0 0 0 [1 0 0 1 0 0] p +(Laurel.side) Pc +(Leaves-fall) 0 0 1 1 0 0 0 0 0 [1 0 0 1 0 0] p +(Leaves-fall) Pc +(Polka dots) 0 0 1 1 0 0 0 0 0 [1 0 0 1 0 0] p +(Polka dots) Pc +(Random circles) 0 0 1 1 0 0 0 0 0 [1 0 0 1 0 0] p +(Random circles) Pc +(Rope.side) 0 0 1 1 0 0 0 0 0 [1 0 0 1 0 0] p +(Rope.side) Pc +(Scales) 0 0 1 1 0 0 0 0 0 [1 0 0 1 0 0] p +(Scales) Pc +(SolidStar.side) 0 0 1 1 0 0 0 0 0 [1 0 0 1 0 0] p +(SolidStar.side) Pc +(Stars) 0 0 1 1 0 0 0 0 0 [1 0 0 1 0 0] p +(Stars) Pc +(Stripes) 0 0 1 1 0 0 0 0 0 [1 0 0 1 0 0] p +(Stripes) Pc +(TriBevel.outer) 0 0 1 1 0 0 0 0 0 [1 0 0 1 0 0] p +(TriBevel.outer) Pc +(TriBevel.side) 0 0 1 1 0 0 0 0 0 [1 0 0 1 0 0] p +(TriBevel.side) Pc +(Waves-scroll) 0 0 1 1 0 0 0 0 0 [1 0 0 1 0 0] p +(Waves-scroll) Pc +PB +%AI5_EndPalette +%%EndSetup +%AI5_BeginLayer +1 1 1 1 0 0 0 79 128 255 Lb +(Layer 1) Ln +0 A +u +1 Ap +0 O +0 0 0 0 k +800 Ar +0 J 0 j 1 w 4 M []0 d +%AI3_Note: +0 D +0 XR +356.6667 387.5 m +356.6667 419.1667 L +247.1666 419.1667 L +247.1666 387.5 L +356.6667 387.5 L +f +u +u +u +u +u +0 Ap +0 g +0.1417 w +349.9796 400.7243 m +349.5877 401.2344 L +346.0138 401.2344 L +346.0883 400.7243 L +349.9796 400.7243 L +f +351.0435 399.3254 m +350.64 399.8521 L +346.2172 399.8521 L +346.3082 399.3254 L +351.0435 399.3254 L +f +352.0889 397.9355 m +351.6969 398.4622 L +346.4256 398.4622 L +346.5001 397.9355 L +352.0889 397.9355 L +f +353.1499 396.5473 m +352.8027 397.0657 L +346.6389 397.0657 L +346.7084 396.5473 L +353.1499 396.5473 L +f +354.1924 395.1701 m +353.8401 395.673 L +346.8076 395.673 L +346.897 395.1701 L +354.1924 395.1701 L +f +U +U +u +u +u +0.1362 w +261.2735 405.9461 m +264.2217 405.9461 266.6112 403.5556 266.6112 400.6074 c +266.6112 397.6591 264.2217 395.2686 261.2735 395.2686 c +258.3253 395.2686 255.9348 397.6591 255.9348 400.6074 c +255.9348 403.5556 258.3253 405.9461 261.2735 405.9461 c +f +261.2735 400.6074 m +F +U +0.1417 w +263.2787 406.4807 m +265.6917 405.6403 267.4239 403.3457 267.4239 400.6461 c +267.4239 397.235 264.6593 394.4703 261.2481 394.4703 c +257.8379 394.4703 255.0721 397.235 255.0721 400.6461 c +255.0721 403.7848 257.4809 406.1287 260.1353 406.671 C +260.1353 411.5726 L +254.6579 410.9711 250.3076 406.3287 250.3076 400.6909 c +250.3076 394.6447 255.2093 389.743 261.2555 389.743 c +267.3008 389.743 272.2025 394.6447 272.2025 400.6909 c +272.2025 405.9351 268.4668 410.3181 263.5435 411.3879 C +263.5435 412.4271 l +259.8638 409.0598 l +263.2787 405.3026 l +263.2787 406.4807 l +f +267.7419 408.8471 m +267.7419 413.7097 L +266.3056 413.7097 l +269.9043 417.257 l +273.4301 413.7097 l +272.1904 413.7097 L +272.1904 400.5408 l +F +U +U +u +u +344.9476 395.1483 m +345.2948 393.0208 L +345.5763 391.6104 346.3665 391.1944 346.4113 391.1775 C +346.4113 391.0357 L +337.5144 391.0357 l +337.5144 391.1775 L +338.1526 391.1775 338.3296 391.7801 338.2588 392.1346 C +337.8611 395.1481 L +344.9476 395.1483 L +f +U +u +330.1397 395.1447 m +328.9907 393.0208 L +328.3882 391.8865 328.6539 391.4612 329.4337 391.1775 C +329.4337 391.0357 L +321.2105 391.0357 l +321.2105 391.1775 L +321.8485 391.1775 322.6106 392.1878 323.284 393.3574 C +324.3294 395.1477 L +330.1397 395.1447 L +f +U +u +327.843 401.2529 m +333.8467 411.6119 L +334.1331 412.1072 334.6648 412.9541 333.3683 413.4728 C +333.3683 413.5967 l +341.9628 413.5967 L +343.9642 401.254 L +337.0643 401.2535 L +336.3448 406.7204 l +333.4007 401.2525 L +327.843 401.2529 L +f +U +u +344.2004 399.8667 m +344.0449 400.7109 L +327.5394 400.7109 L +327.0498 399.8667 L +344.2004 399.8667 L +f +U +u +344.4022 398.4775 m +344.283 399.3217 L +326.7356 399.3217 L +326.2295 398.4775 L +344.4022 398.4775 L +f +U +u +344.6403 397.0883 m +344.5179 397.9324 L +325.9584 397.9324 L +325.4258 397.0883 L +344.6403 397.0883 L +f +U +u +344.8586 395.6991 m +344.7395 396.5433 L +325.1281 396.5433 L +324.632 395.6991 L +344.8586 395.6991 L +f +U +U +u +u +295.6383 401.2527 m +297.8343 411.6119 L +297.8977 411.9132 298.2848 413.1005 297.3557 413.4728 C +297.3557 413.5967 l +306.3486 413.5967 L +306.3486 413.455 L +305.7814 413.2423 305.1266 412.2144 304.9848 411.3992 C +302.9603 401.2549 L +295.6383 401.2527 L +f +U +300.9135 391.0231 m +291.8972 391.0357 L +291.8972 391.1775 L +292.5351 391.1775 293.2972 392.1878 293.9707 393.3574 C +294.3531 395.148 L +301.7499 395.1638 L +300.9135 391.0396 L +300.9135 391.0231 L +f +u +302.6821 399.8667 m +302.8608 400.7109 L +295.5287 400.7109 L +295.3451 399.8667 L +302.6821 399.8667 L +f +U +u +302.4043 398.4775 m +302.5828 399.3217 L +295.236 399.3217 L +295.0524 398.4775 L +302.4043 398.4775 L +f +U +u +302.1314 397.0883 m +302.305 397.9324 L +294.9433 397.9324 L +294.7547 397.0883 L +302.1314 397.0883 L +f +U +u +301.8371 395.6991 m +302.0272 396.5433 L +294.6505 396.5433 L +294.4454 395.6991 L +301.8371 395.6991 L +f +U +U +u +u +u +324.11 395.1483 m +324.4572 393.0208 L +324.7389 391.6104 325.529 391.1944 325.5738 391.1775 C +325.5738 391.0357 L +316.6769 391.0357 l +316.6769 391.1775 L +317.3151 391.1775 317.4922 391.7801 317.4212 392.1346 C +317.0237 395.1481 L +324.11 395.1483 L +f +U +u +300.5942 391.0421 m +303.0951 395.1477 L +309.3023 395.1447 L +308.1532 393.0208 L +307.5507 391.8865 307.8165 391.4612 308.5963 391.1775 C +308.4584 391.022 L +300.5657 391.022 L +300.5942 391.0421 L +f +U +u +306.774 401.2529 m +313.0093 411.6119 L +313.2957 412.1072 313.8273 412.9541 312.5308 413.4728 C +312.5308 413.5967 l +321.1253 413.5967 L +323.1267 401.254 L +316.2268 401.2535 L +315.5073 406.7204 l +312.5632 401.2525 L +306.774 401.2529 L +f +U +u +323.3629 399.8667 m +323.2074 400.7109 L +306.4373 400.7109 L +305.9477 399.8667 L +323.3629 399.8667 L +f +U +u +323.5646 398.4775 m +323.4456 399.3217 L +305.5674 399.3217 L +305.0613 398.4775 L +323.5646 398.4775 L +f +U +u +323.8028 397.0883 m +323.6805 397.9324 L +304.757 397.9324 L +304.2245 397.0883 L +323.8028 397.0883 L +f +U +u +324.0211 395.6991 m +323.9021 396.5433 L +303.9268 396.5433 L +303.4307 395.6991 L +324.0211 395.6991 L +f +U +U +U +u +u +u +293.9453 395.1483 m +294.2925 393.0208 L +294.5741 391.6104 295.3643 391.1944 295.4091 391.1775 C +295.4091 391.0357 L +286.5122 391.0357 l +286.5122 391.1775 L +287.1503 391.1775 287.3274 391.7801 287.2566 392.1346 C +286.8589 395.1481 L +293.9453 395.1483 L +f +U +u +279.1375 395.1447 m +277.9885 393.0208 L +277.386 391.8865 277.6517 391.4612 278.4315 391.1775 C +278.4315 391.0357 L +270.2083 391.0357 l +270.2083 391.1775 L +270.8463 391.1775 271.6083 392.1878 272.2817 393.3574 C +273.3272 395.1477 L +279.1375 395.1447 L +f +U +u +276.8408 401.2529 m +282.8445 411.6119 L +283.1309 412.1072 283.6625 412.9541 282.3661 413.4728 C +282.3661 413.5967 l +290.9606 413.5967 L +292.9619 401.254 L +286.0621 401.2535 L +285.3425 406.7204 l +282.3985 401.2525 L +276.8408 401.2529 L +f +U +u +293.1982 399.8667 m +293.0427 400.7109 L +276.5371 400.7109 L +276.0476 399.8667 L +293.1982 399.8667 L +f +U +u +293.4 398.4775 m +293.2808 399.3217 L +275.7334 399.3217 L +275.2273 398.4775 L +293.4 398.4775 L +f +U +u +293.638 397.0883 m +293.5157 397.9324 L +274.9561 397.9324 L +274.4235 397.0883 L +293.638 397.0883 L +f +U +u +293.8564 395.6991 m +293.7373 396.5433 L +274.1259 396.5433 L +273.6297 395.6991 L +293.8564 395.6991 L +f +U +U +U +U +U +U +U +LB +%AI5_EndLayer-- +%%PageTrailer +gsave annotatepage grestore showpage +%%Trailer +Adobe_Illustrator_AI5 /terminate get exec +Adobe_ColorImage_AI6 /terminate get exec +Adobe_cshow /terminate get exec +Adobe_level2_AI5 /terminate get exec +%%EOF + +%%EndDocument + @endspecial 417 773 a FE(AIAA)58 b(98\2260879)417 1022 +y FD(Sim)m(ulation)47 b(of)i(an)f(Aer)m(ospace)e(V)-9 +b(ehic)m(le)417 1230 y(Pitc)n(h-Over)48 b(Maneuver)417 +1421 y FC(William)31 b(L.)j(Kleb)417 1570 y FB(NASA)f(Langle)n(y)h +(Research)h(Center)-6 b(,)35 b(Hampton,)h(V)-10 b(A)33 +b(23681)417 1761 y FC(A.)g(N.)h(A)l(uthor)68 b(and)35 +b(Y)-17 b(.)33 b(F)-18 b(.)34 b(Another)r(longer)s(name)417 +1911 y FB(Someother)h(Af\003iation,)f(Ato)n(wn,)h(ST)e(98293)432 +4405 y @beginspecial 144 @llx 367 @lly 488 @urx 602 @ury +3600 @rwi 2459 @rhi @setspecial +%%BeginDocument: smpfig.eps +%!PS-Adobe-2.0 EPSF-1.2 +%%Creator:Adobe Illustrator(TM) 1.1 +%%For: (RICHARD A WHELESS) (NASA LANGLEY) +%%Title: (EPS) +%%CreationDate: (2/9/99) (3:01 PM) +%%DocumentProcessColors: Black +%%DocumentFonts: Courier-Bold +%%DocumentProcSets: Adobe_Illustrator_1.1 0 0 +%%BoundingBox:144 367 488 602 +%%ColorUsage: Black&White +%AI3_IncludePlacedImages +%%TemplateBox:306 396 306 396 +%%TileBox: 30 31 582 761 +%%DocumentPreview: Header +%%EndComments +%%BeginProcSet:Adobe_Illustrator_1.1 0 0 +/Adobe_Illustrator_1.1 dup 100 dict def load begin +/Version 0 def +/Revision 0 def +/bdef {bind def} bind def +/ldef {load def} bdef +/xdef {exch def} bdef +/_K {3 index add neg dup 0 lt {pop 0} if 3 1 roll} bdef +/_k /setcmybcolor where +{/setcmybcolor get} {{1 sub 4 1 roll _K _K _K setrgbcolor pop} bind} ifelse def +/g {/_b xdef /p {_b setgray} def} bdef +/G {/_B xdef /P {_B setgray} def} bdef +/k {/_b xdef /_y xdef /_m xdef /_c xdef /p {_c _m _y _b _k} def} bdef +/K {/_B xdef /_Y xdef /_M xdef /_C xdef /P {_C _M _Y _B _k} def} bdef +/d /setdash ldef +/_i currentflat def +/i {dup 0 eq {pop _i} if setflat} bdef +/j /setlinejoin ldef +/J /setlinecap ldef +/M /setmiterlimit ldef +/w /setlinewidth ldef +/_R {.25 sub round .25 add} bdef +/_r {transform _R exch _R exch itransform} bdef +/c {_r curveto} bdef +/C /c ldef +/v {currentpoint 6 2 roll _r curveto} bdef +/V /v ldef +/y {_r 2 copy curveto} bdef +/Y /y ldef +/l {_r lineto} bdef +/L /l ldef +/m {_r moveto} bdef +/_e [] def +/_E {_e length 0 ne {gsave 0 g 0 G 0 i 0 J 0 j 1 w 10 M [] 0 d +/Courier 20 0 0 1 z [0.966 0.259 -0.259 0.966 +_e 0 get _e 2 get add 2 div _e 1 get _e 3 get add 2 div] e _f t T grestore} if} bdef +/_fill {{fill} stopped +{/_e [pathbbox] def /_f (ERROR: can't fill, increase flatness) def n _E} if} bdef +/_stroke {{stroke} stopped +{/_e [pathbbox] def /_f (ERROR: can't stroke, increase flatness) def n _E} if} bdef +/n /newpath ldef +/N /n ldef +/F {p _fill} bdef +/f {closepath F} bdef +/S {P _stroke} bdef +/s {closepath S} bdef +/B {gsave F grestore S} bdef +/b {closepath B} bdef +/_s /ashow ldef +/_S {(?) exch {2 copy 0 exch put pop dup false charpath currentpoint _g setmatrix +_stroke _G setmatrix moveto 3 copy pop rmoveto} forall pop pop pop n} bdef +/_A {_a moveto _t exch 0 exch} bdef +/_L {0 _l neg translate _G currentmatrix pop} bdef +/_w {dup stringwidth exch 3 -1 roll length 1 sub _t mul add exch} bdef +/_z [{0 0} bind {dup _w exch neg 2 div exch neg 2 div} bind {dup _w exch neg exch neg} bind] def +/z {_z exch get /_a xdef /_t xdef /_l xdef exch findfont exch scalefont setfont} bdef +/_g matrix def +/_G matrix def +/_D {_g currentmatrix pop gsave concat _G currentmatrix pop} bdef +/e {_D p /t {_A _s _L} def} bdef +/r {_D P /t {_A _S _L} def} bdef +/a {_D /t {dup p _A _s P _A _S _L} def} bdef +/o {_D /t {pop _L} def} bdef +/T {grestore} bdef +/u {} bdef +/U {} bdef +/Z {findfont begin currentdict dup length dict begin +{1 index /FID ne {def} {pop pop} ifelse} forall /FontName exch def dup length 0 ne +{/Encoding Encoding 256 array copy def 0 exch {dup type /nametype eq +{Encoding 2 index 2 index put pop 1 add} {exch pop} ifelse} forall} if pop +currentdict dup end end /FontName get exch definefont pop} bdef +end +%%EndProcSet +%%EndProlog +%%BeginSetup +Adobe_Illustrator_1.1 begin +n +%%BeginEncoding: _Courier-Bold Courier-Bold +[39/quotesingle 96/grave 128/Adieresis/Aring/Ccedilla/Eacute/Ntilde/Odieresis +/Udieresis/aacute/agrave/acircumflex/adieresis/atilde/aring/ccedilla/eacute +/egrave/ecircumflex/edieresis/iacute/igrave/icircumflex/idieresis/ntilde +/oacute/ograve/ocircumflex/odieresis/otilde/uacute/ugrave/ucircumflex +/udieresis/dagger/degree/cent/sterling/section/bullet/paragraph/germandbls +/registered/copyright/trademark/acute/dieresis/.notdef/AE/Oslash +/.notdef/plusminus/.notdef/.notdef/yen/mu/.notdef/.notdef +/.notdef/.notdef/.notdef/ordfeminine/ordmasculine/.notdef/ae/oslash +/questiondown/exclamdown/logicalnot/.notdef/florin/.notdef/.notdef +/guillemotleft/guillemotright/ellipsis/.notdef/Agrave/Atilde/Otilde/OE/oe +/endash/emdash/quotedblleft/quotedblright/quoteleft/quoteright/divide +/.notdef/ydieresis/Ydieresis/fraction/currency/guilsinglleft/guilsinglright +/fi/fl/daggerdbl/periodcentered/quotesinglbase/quotedblbase/perthousand +/Acircumflex/Ecircumflex/Aacute/Edieresis/Egrave/Iacute/Icircumflex +/Idieresis/Igrave/Oacute/Ocircumflex/.notdef/Ograve/Uacute/Ucircumflex +/Ugrave/dotlessi/circumflex/tilde/macron/breve/dotaccent/ring/cedilla +/hungarumlaut/ogonek/caron +]/_Courier-Bold/Courier-Bold Z +%%EndEncoding +%%EndSetup +0 0 0 0 k +0 0 0 1 K +0 i +0 J 0 j 1 w 4 M []0 d +%%Note: +487.5 367.5 m +487.5 601.5 L +145.5 601.5 L +145.5 367.5 L +487.5 367.5 L +b +145.5 601.5 m +487 368 l +B +487 601.5 m +145 368 l +B +0.5 w +450.5 478 m +450.5 494 L +182 494 L +182 478 L +450.5 478 L +b +u +0 0 0 1 k +1 w +/_Courier-Bold 12 14.5 0 0 z +[1 0 0 1 187.402 482]e +(Encapsulated Postscript \(EPS\) Figure)t +T +U +%%PageTrailer +%%Trailer +_E end +%%EOF + +%%EndDocument + @endspecial 407 4854 a FE(36th)57 b(AIAA)h(Aer)l(ospace)g(Sciences)956 +5103 y(Meeting)g(and)g(Exhibit)445 5352 y(Jan)n(uar)r(y)g(12\22615,)f +(1998/Reno,)h(NV)-336 5641 y FA(For)23 b(permission)g(to)f(cop)o(y)h +(or)g(repub)o(lish,)g(contact)f(the)h(American)g(Institute)f(of)h(Aer)n +(onautics)g(and)f(Astr)n(onautics)-336 5741 y(1801)i(Ale)o(xander)f +(Bell)g(Drive)q(,)h(Suite)f(500,)g(Reston,)g(V)-7 b(A)24 +b(20191\2264344)p eop +%%Page: 1 2 +1 1 bop 412 -69 a Fz(Sim)-5 b(ulation)65 b(of)f(an)h(Aerospace)h(V)-16 +b(ehicle)991 139 y(Pitc)-5 b(h-Ov)g(er)66 b(Maneuv)-5 +b(er)1563 379 y Fy(William)28 b(L.)k(Kleb)2255 343 y +Fx(\003)761 496 y Fw(NASA)k(L)-5 b(angley)35 b(R)-5 b(ese)g(ar)g(ch)34 +b(Center,)g(Hampton,)h(V)-10 b(A)35 b(23681)949 654 y +Fy(A.)e(N.)f(Author)1520 618 y Fx(y)1586 654 y Fy(and)g(Y.)h(F.)f +(Anotherlongername)2869 618 y Fx(y)1062 771 y Fw(Some)-5 +b(other)34 b(A\017iation,)h(A)n(town,)g(ST)f(98293)458 +943 y Fv(Note:)41 b(this)30 b(abstr)l(act)h(do)l(es)h(not)e(app)l(e)l +(ar)i(when)f(a)g(journal)g(note)f(simulation)g(is)g(the)h(chosen)h +(option.)334 1022 y Fu(The)g(ob)5 b(jectiv)n(e)31 b(of)g(the)h(presen)n +(t)g(w)n(ork)f(is)h(to)f(summarize)e(the)j(application)e(of)i(unsteady) +g(compu-)334 1101 y(tational)j(\015uid)k(dynamic)d(metho)r(ds)i(to)f +(the)h(problem)f(of)g(predicting)h(v)n(erticle)f(tak)n(e-o\013/v)n +(ertical)334 1179 y(landing)24 b(v)n(ehicle)i(aero)r(dynamics)d(during) +i(an)h(un-p)r(o)n(w)n(ered)g(pitc)n(h-o)n(v)n(er)e(maneuv)n(er.)34 +b(In)26 b(addition)e(to)334 1258 y(the)31 b(time-dep)r(enden)n(t)f(sim) +n(ulation)e(of)i(a)g(pitc)n(h-o)n(v)n(er)g(maneuv)n(er,)f(a)i(series)f +(of)h(steady)f(solutions)g(at)334 1337 y(discrete)24 +b(p)r(oin)n(ts)g(are)g(also)f(computed)h(for)g(comparison)e(with)h +(wind-tunnel)i(measuremen)n(ts)d(and)i(as)334 1416 y(a)29 +b(means)g(of)h(quan)n(tifying)e(unsteady)i(e\013ects.)45 +b(As)30 b(this)g(application)e(represen)n(ts)i(a)f(new)h(c)n(hallenge) +334 1495 y(to)f(unsteady)i(computational)c(\015uid)j(dynamics,)f +(observ)-5 b(ations)30 b(concerning)g(grid)f(resolution,)h(far-)334 +1574 y(\014eld)d(b)r(oundary)g(placemen)n(t,)e(temp)r(oral)g +(resolution,)g(and)i(the)h(suitabilit)n(y)c(of)j(assuming)e(\015o)n +(w-\014eld)334 1653 y(symmetry)f(are)j(discussed.)514 +1915 y Ft(Nomenclature)-116 2036 y Fs(c)324 b Fr(Sound)27 +b(sp)r(eed,)h(m/s)-116 2136 y Fs(M)279 b Fr(Mac)n(h)27 +b(n)n(um)n(b)r(er)-116 2236 y Fs(P)307 b Fr(Pressure,)25 +b(P)n(a)-116 2335 y Fs(R)q(e)-13 2347 y Fq(s)244 2335 +y Fr(Reynolds)i(n)n(um)n(b)r(er)g(based)g(on)g(length)h +Fs(s)-116 2435 y(T)311 b Fr(T)-7 b(emp)r(erature,)27 +b(K)-116 2535 y Fs(V)312 b Fr(V)-7 b(elo)r(cit)n(y)g(,)27 +b(m/s)-116 2634 y Fs(x;)14 b(y)s(;)g(z)156 b Fr(Cartesian)26 +b(b)r(o)r(dy)i(axes,)e(m)-116 2734 y Fs(\013)307 b Fr(Angle)27 +b(of)h(attac)n(k,)e(deg)-116 2833 y Fs(\021)319 b Fr(W)-7 +b(all-normal)26 b(distance,)h(m)-116 2933 y Fs(\032)317 +b Fr(Densit)n(y)-7 b(,)27 b(kg/m)760 2903 y Fp(3)-116 +3124 y Fo(Subscripts)-116 3246 y Fs(tr)r(an)197 b Fr(T)-7 +b(ransition)-116 3346 y Fs(w)301 b Fr(W)-7 b(all)-116 +3445 y Fn(1)277 b Fr(F)-7 b(reestream)-116 3637 y Fo(Sup)r(erscripts) +-116 3758 y Fr(0)318 b(Fiduciary)27 b(p)r(oin)n(t)-116 +3858 y Fs(n)5 b Fr(+)g(1)193 b(Time)27 b(lev)n(el)550 +4074 y Ft(In)m(tro)s(duction)-116 4295 y Fm(N)89 4196 +y Fr(ASA'S)i(Access)e(to)h(Space)g(Study)1176 4166 y +Fp(1)1242 4196 y Fr(recommends)f(the)89 4295 y(dev)n(elopmen)n(t)34 +b(of)h(a)g Fl(ful)t(ly)h Fr(reusable)e(launc)n(h)g(v)n(ehicle)1797 +4265 y Fp(2)-116 4395 y Fr(to)40 b(replace)f(the)i(aged)e(Space)h(Sh)n +(uttle.)75 b Fl(The)42 b Fk(\\dropword)-116 4495 y Fl(c)l(ommand)33 +b(cr)l(e)l(ate)l(d)g(the)f(hanging)i(c)l(apital)g(letter)e(and)h(auto-) +-116 4594 y(matic)l(al)t(ly)28 b(c)l(apitalizes)g(the)f(r)l(est)f(of)h +(the)f(wor)l(d.)37 b Fr(A)24 b(metho)r(d)h(of)-116 4694 +y(reac)n(hing)17 b(this)i(goal)f(is)g(to)h(dev)n(elop)f(a)g(v)n(ehicle) +h(whic)n(h)f(do)r(es)h(not)p -116 4780 780 4 v -25 4834 +a Fj(\003)11 4857 y Fi(Researc)n(h)46 b(Engineer,)k(Aerothermo)r +(dynamics)44 b(Branc)n(h,)50 b(Aero-)-116 4936 y(and)24 +b(Gas-Dynamics)f(Division,)f(Researc)n(h)j(and)f(T)-6 +b(ec)n(hnology)25 b(Group.)-22 4994 y Fj(y)11 5018 y +Fi(Deligen)n(t)f(w)n(ork)n(er,)f(AIAA)h(mem)n(b)r(er.)11 +5096 y Fp(Cop)n(yrigh)n(t)334 5094 y(c)315 5096 y Fh(\015)16 +b Fp(1999)h(b)n(y)e(the)g(American)f(Institute)h(of)g(Aeronautics)f +(and)-116 5163 y(Astronautics,)32 b(Inc.)53 b(No)31 b(cop)n(yrigh)n(t)e +(is)i(asserted)f(in)g(the)g(United)f(States)-116 5229 +y(under)f(Title)i(17,)i(U.S.)d(Co)r(de.)53 b(The)29 b(U.S.)h(Go)n(v)n +(ernmen)n(t)f(has)h(a)g(ro)n(y)n(alt)n(y-)-116 5296 y(free)19 +b(license)g(to)i(exercise)e(all)i(righ)n(ts)g(under)f(the)g(cop)n +(yrigh)n(t)g(claimed)f(herein)-116 5362 y(for)30 b(Go)n(v)n(ernmen)n +(tal)f(Purp)r(oses.)52 b(All)30 b(other)f(righ)n(ts)i(are)f(reserv)n +(ed)f(b)n(y)h(the)-116 5428 y(cop)n(yrigh)n(t)21 b(o)n(wner.)1984 +3164 y @beginspecial 144 @llx 367 @lly 488 @urx 602 @ury +2340 @rwi @setspecial +%%BeginDocument: smpfig.eps +%!PS-Adobe-2.0 EPSF-1.2 +%%Creator:Adobe Illustrator(TM) 1.1 +%%For: (RICHARD A WHELESS) (NASA LANGLEY) +%%Title: (EPS) +%%CreationDate: (2/9/99) (3:01 PM) +%%DocumentProcessColors: Black +%%DocumentFonts: Courier-Bold +%%DocumentProcSets: Adobe_Illustrator_1.1 0 0 +%%BoundingBox:144 367 488 602 +%%ColorUsage: Black&White +%AI3_IncludePlacedImages +%%TemplateBox:306 396 306 396 +%%TileBox: 30 31 582 761 +%%DocumentPreview: Header +%%EndComments +%%BeginProcSet:Adobe_Illustrator_1.1 0 0 +/Adobe_Illustrator_1.1 dup 100 dict def load begin +/Version 0 def +/Revision 0 def +/bdef {bind def} bind def +/ldef {load def} bdef +/xdef {exch def} bdef +/_K {3 index add neg dup 0 lt {pop 0} if 3 1 roll} bdef +/_k /setcmybcolor where +{/setcmybcolor get} {{1 sub 4 1 roll _K _K _K setrgbcolor pop} bind} ifelse def +/g {/_b xdef /p {_b setgray} def} bdef +/G {/_B xdef /P {_B setgray} def} bdef +/k {/_b xdef /_y xdef /_m xdef /_c xdef /p {_c _m _y _b _k} def} bdef +/K {/_B xdef /_Y xdef /_M xdef /_C xdef /P {_C _M _Y _B _k} def} bdef +/d /setdash ldef +/_i currentflat def +/i {dup 0 eq {pop _i} if setflat} bdef +/j /setlinejoin ldef +/J /setlinecap ldef +/M /setmiterlimit ldef +/w /setlinewidth ldef +/_R {.25 sub round .25 add} bdef +/_r {transform _R exch _R exch itransform} bdef +/c {_r curveto} bdef +/C /c ldef +/v {currentpoint 6 2 roll _r curveto} bdef +/V /v ldef +/y {_r 2 copy curveto} bdef +/Y /y ldef +/l {_r lineto} bdef +/L /l ldef +/m {_r moveto} bdef +/_e [] def +/_E {_e length 0 ne {gsave 0 g 0 G 0 i 0 J 0 j 1 w 10 M [] 0 d +/Courier 20 0 0 1 z [0.966 0.259 -0.259 0.966 +_e 0 get _e 2 get add 2 div _e 1 get _e 3 get add 2 div] e _f t T grestore} if} bdef +/_fill {{fill} stopped +{/_e [pathbbox] def /_f (ERROR: can't fill, increase flatness) def n _E} if} bdef +/_stroke {{stroke} stopped +{/_e [pathbbox] def /_f (ERROR: can't stroke, increase flatness) def n _E} if} bdef +/n /newpath ldef +/N /n ldef +/F {p _fill} bdef +/f {closepath F} bdef +/S {P _stroke} bdef +/s {closepath S} bdef +/B {gsave F grestore S} bdef +/b {closepath B} bdef +/_s /ashow ldef +/_S {(?) exch {2 copy 0 exch put pop dup false charpath currentpoint _g setmatrix +_stroke _G setmatrix moveto 3 copy pop rmoveto} forall pop pop pop n} bdef +/_A {_a moveto _t exch 0 exch} bdef +/_L {0 _l neg translate _G currentmatrix pop} bdef +/_w {dup stringwidth exch 3 -1 roll length 1 sub _t mul add exch} bdef +/_z [{0 0} bind {dup _w exch neg 2 div exch neg 2 div} bind {dup _w exch neg exch neg} bind] def +/z {_z exch get /_a xdef /_t xdef /_l xdef exch findfont exch scalefont setfont} bdef +/_g matrix def +/_G matrix def +/_D {_g currentmatrix pop gsave concat _G currentmatrix pop} bdef +/e {_D p /t {_A _s _L} def} bdef +/r {_D P /t {_A _S _L} def} bdef +/a {_D /t {dup p _A _s P _A _S _L} def} bdef +/o {_D /t {pop _L} def} bdef +/T {grestore} bdef +/u {} bdef +/U {} bdef +/Z {findfont begin currentdict dup length dict begin +{1 index /FID ne {def} {pop pop} ifelse} forall /FontName exch def dup length 0 ne +{/Encoding Encoding 256 array copy def 0 exch {dup type /nametype eq +{Encoding 2 index 2 index put pop 1 add} {exch pop} ifelse} forall} if pop +currentdict dup end end /FontName get exch definefont pop} bdef +end +%%EndProcSet +%%EndProlog +%%BeginSetup +Adobe_Illustrator_1.1 begin +n +%%BeginEncoding: _Courier-Bold Courier-Bold +[39/quotesingle 96/grave 128/Adieresis/Aring/Ccedilla/Eacute/Ntilde/Odieresis +/Udieresis/aacute/agrave/acircumflex/adieresis/atilde/aring/ccedilla/eacute +/egrave/ecircumflex/edieresis/iacute/igrave/icircumflex/idieresis/ntilde +/oacute/ograve/ocircumflex/odieresis/otilde/uacute/ugrave/ucircumflex +/udieresis/dagger/degree/cent/sterling/section/bullet/paragraph/germandbls +/registered/copyright/trademark/acute/dieresis/.notdef/AE/Oslash +/.notdef/plusminus/.notdef/.notdef/yen/mu/.notdef/.notdef +/.notdef/.notdef/.notdef/ordfeminine/ordmasculine/.notdef/ae/oslash +/questiondown/exclamdown/logicalnot/.notdef/florin/.notdef/.notdef +/guillemotleft/guillemotright/ellipsis/.notdef/Agrave/Atilde/Otilde/OE/oe +/endash/emdash/quotedblleft/quotedblright/quoteleft/quoteright/divide +/.notdef/ydieresis/Ydieresis/fraction/currency/guilsinglleft/guilsinglright +/fi/fl/daggerdbl/periodcentered/quotesinglbase/quotedblbase/perthousand +/Acircumflex/Ecircumflex/Aacute/Edieresis/Egrave/Iacute/Icircumflex +/Idieresis/Igrave/Oacute/Ocircumflex/.notdef/Ograve/Uacute/Ucircumflex +/Ugrave/dotlessi/circumflex/tilde/macron/breve/dotaccent/ring/cedilla +/hungarumlaut/ogonek/caron +]/_Courier-Bold/Courier-Bold Z +%%EndEncoding +%%EndSetup +0 0 0 0 k +0 0 0 1 K +0 i +0 J 0 j 1 w 4 M []0 d +%%Note: +487.5 367.5 m +487.5 601.5 L +145.5 601.5 L +145.5 367.5 L +487.5 367.5 L +b +145.5 601.5 m +487 368 l +B +487 601.5 m +145 368 l +B +0.5 w +450.5 478 m +450.5 494 L +182 494 L +182 478 L +450.5 478 L +b +u +0 0 0 1 k +1 w +/_Courier-Bold 12 14.5 0 0 z +[1 0 0 1 187.402 482]e +(Encapsulated Postscript \(EPS\) Figure)t +T +U +%%PageTrailer +%%Trailer +_E end +%%EOF + +%%EndDocument + @endspecial 1994 3305 a Fo(Fig.)30 b(1)87 b(T)-7 b(ransition)30 +b(to)g(landing)i(for)e(a)f(VTVL)g(v)n(ehicle.)1984 3513 +y Fr(rely)34 b(on)h(exp)r(endable)g(b)r(o)r(osters)f(to)h(reac)n(h)f +(orbit,)i(a)f(single-)1984 3613 y(stage-to-orbit)29 b(v)n(ehicle.)2773 +3583 y Fp(3)2860 3613 y Fr(One)i(suc)n(h)h(con\014guration)e(b)r(eing) +1984 3713 y(in)n(v)n(estigated)18 b(is)h(a)h(V)-7 b(ertical)19 +b(T)-7 b(ak)n(e-o\013)18 b(and)h(V)-7 b(ertical)19 b(Landing)1984 +3812 y(\(VTVL\))36 b(concept.)2620 3782 y Fp(3)2715 3812 +y Fr(In)f(one)g(scenario,)g(the)g(VTVL)h(v)n(ehi-)1984 +3912 y(cle,)25 b(up)r(on)h(completion)e(of)h(its)g(mission)g(in)g(lo)n +(w-Earth)e(orbit,)1984 4011 y(reen)n(ters)h(nose)g(\014rst,)i +(decelerates)e(to)h(subsonic)g(sp)r(eeds,)h(and)1984 +4111 y(then)37 b(p)r(erforms)f(a)h(rotation)e(maneuv)n(er)3296 +4081 y Fp(4{)o(6)3435 4111 y Fr(to)i(land)g(v)n(erti-)1984 +4211 y(cally)-7 b(.)2067 4333 y(Figure)40 b(1)g(presen)n(ts)g(a)g(sc)n +(hematic)g(of)g(the)h(last)f(p)r(ortion)1984 4432 y(of)c(a)f(t)n +(ypical)h(VTVL)g(en)n(try)-7 b(.)62 b(The)36 b(pitc)n(h-o)n(v)n(er)e +(maneuv)n(er,)1984 4532 y(whic)n(h)d(o)r(ccurs)f(near)g(Mac)n(h)g(0.2,) +h(is)g(c)n(haracterized)d(b)n(y)j(high)1984 4631 y(angle)38 +b(of)g(attac)n(k,)j(unsteady)-7 b(,)42 b(v)n(ortical)37 +b(\015o)n(w.)69 b(Accurately)1984 4731 y(predicting)50 +b(v)n(ehicle)f(p)r(erformance)g(during)h(this)g(aero)r(dy-)1984 +4831 y(namic)21 b(pitc)n(h-o)n(v)n(er)f(maneuv)n(er)g(is)i(quite)g(c)n +(hallenging.)33 b(While)1984 4930 y(ground-based)19 b(facilities)i(can) +f(readily)g(predict)h(the)h(v)n(ehicle's)1984 5030 y(aero)r(dynamics)i +(at)i(discrete)g(p)r(oin)n(ts)g(during)g(the)h(maneuv)n(er,)1984 +5130 y(sim)n(ulating)38 b(the)h(transien)n(t)f(motion)h(in)g(a)f(wind)h +(tunnel)h(is)1984 5229 y(di\016cult.)2283 5199 y Fp(7)2359 +5229 y Fr(Time-dep)r(enden)n(t)e(Computational)f(Fluid)h(Dy-)1984 +5329 y(namics)33 b(\(CFD\))i(o\013ers)e(another)g(means)g(of)h +(analyzing)e(the)1984 5428 y(pitc)n(h-o)n(v)n(er)40 b(maneuv)n(er.)78 +b(The)41 b(ma)5 b(jorit)n(y)41 b(of)h(w)n(ork)e(in)i(un-)1808 +5578 y Fg(1)25 b(of)g(5)p 1759 5642 300 2 v 737 5736 +a(American)g(Institute)h(of)f(Aer)o(ona)o(utics)f(and)h(Astr)o(ona)o +(utics)h(P)-6 b(aper)25 b(98{0879)p eop +%%Page: 2 3 +2 2 bop -116 -188 a Fr(steady)42 b(CFD)h(has,)k(ho)n(w)n(ev)n(er,)d(b)r +(een)f(restricted)g(to)f(small)-116 -89 y(amplitude,)c(harmonic)c(v)-5 +b(ariations)35 b(in)h(angle)e(of)i(attac)n(k)f(in)-116 +11 y(supp)r(ort)27 b(of)h(aero)r(elastic)e(\015utter)i(predictions.) +1370 -19 y Fp(8)-33 111 y Fr(The)33 b(ob)5 b(jectiv)n(e)31 +b(of)i(the)g(presen)n(t)f(w)n(ork)g(is)g(to)h(summarize)-116 +210 y(the)22 b(application)f(of)g(unsteady)g(CFD)i(metho)r(ds)e(to)h +(the)g(prob-)-116 310 y(lem)30 b(of)f(predicting)h(VTVL)g(v)n(ehicle)f +(aero)r(dynamics)f(during)-116 409 y(an)42 b(un-p)r(o)n(w)n(ered)g +(pitc)n(h-o)n(v)n(er)f(maneuv)n(er)g(\(further)i(details)-116 +509 y(are)26 b(a)n(v)-5 b(ailable)25 b(in)i(the)h(companion)e +(conference)g(pap)r(er)1629 479 y Fp(9)1666 509 y Fr(\).)37 +b(In)-116 609 y(addition)29 b(to)g(the)g(time-dep)r(enden)n(t)h(sim)n +(ulation)e(of)h(a)g(pitc)n(h-)-116 708 y(o)n(v)n(er)c(maneuv)n(er,)i(a) +f(series)h(of)g(steady)g(solutions)f(at)h(discrete)-116 +808 y(p)r(oin)n(ts)35 b(are)f(also)h(computed)g(for)g(comparison)f +(with)i(wind-)-116 908 y(tunnel)h(measuremen)n(ts)e(and)h(as)g(a)g +(means)g(of)g(quan)n(tifying)-116 1007 y(unsteady)26 +b(e\013ects.)37 b(As)27 b(this)h(application)e(represen)n(ts)f(a)i(new) +-116 1107 y(c)n(hallenge)36 b(to)h(unsteady)g(CFD,)h(observ)-5 +b(ations)35 b(concerning)-116 1206 y(grid)30 b(resolution,)h +(far-\014eld)f(b)r(oundary)g(placemen)n(t,)i(temp)r(o-)-116 +1306 y(ral)18 b(resolution,)i(and)e(the)i(suitabilit)n(y)f(of)g +(assuming)f(\015o)n(w-\014eld)-116 1406 y(symmetry)27 +b(are)f(do)r(cumen)n(ted)i(in)g(Ref.)g(9.)615 1606 y +Ft(Geometry)-33 1723 y Fr(The)23 b(v)n(ehicle's)g(fore)g(b)r(o)r(dy)h +(is)f(an)g(8)g(deg)g(half-angle)f(sphere)-116 1823 y(cone)28 +b(with)i(nose)e(radius)h(equal)f(to)h(0.3)g(of)g(the)g(base)g(radius.) +-116 1923 y(The)41 b(aft)g(b)r(o)r(dy)-7 b(,)45 b(b)r(eginning)c(at)g +(the)h(85)e(p)r(ercen)n(t)h(fuselage)-116 2022 y(station,)23 +b(is)f(a)g(cylinder)g(with)h(a)f(partially)f(squared-o\013)g(cross-) +-116 2122 y(section)h(pro)r(ducing)f(\015at)h(\\slices")f(extending)h +(from)g(the)g(base)-116 2221 y(of)g(the)h(v)n(ehicle)f(to)g(appro)n +(ximately)f(the)i(60)e(p)r(ercen)n(t)i(fuselage)-116 +2321 y(station.)72 b(The)39 b(v)n(ehicle)g(has)g(a)g(\014neness)g +(ratio)g(of)g(6.4.)72 b(A)-116 2421 y(complete)27 b(description)g(of)h +(the)g(v)n(ehicle)f(geometry)g(mo)r(deled)-116 2520 y(has)g(b)r(een)h +(giv)n(en)f(b)n(y)g(W)-7 b(o)r(o)r(ds)28 b(in)f(Ref.)i(10.)-33 +2620 y Fl(Thr)l(ough)41 b(the)g(gener)l(osity)g(of)g(Kar)l(en)f(Bibb,)k +(we)d(have)g(a)-116 2720 y(demonstr)l(ation)29 b(of)g(a)g(sub\014gur)l +(e)e(situation.)38 b(Note)29 b(that)f(with)-116 2819 +y(imb)l(e)l(dde)l(d)35 b(lab)l(els)f(you)g(c)l(an)f(r)l(efer)h(to)f +(Fig.)i(2)f(as)g(a)g(whole)g(or)-116 2919 y(sp)l(e)l(ci\014c)l(al)t +(ly,)f(things)d(in)h(Fig.)h(2\(a\))f(or)g(Fig.)h(2\(b\).)40 +b Fr(An)29 b(early)-116 3019 y(Lo)r(c)n(kheed-Martin)j(X-33)h +(con\014guration)f(w)n(as)h(used)h(in)g(the)-116 3118 +y(remainder)c(of)h(the)g(examples.)46 b(The)31 b(full)h(v)n(ehicle)f +(is)g(sho)n(wn)-116 3218 y(in)d(Fig.)h(2.)39 b(This)28 +b(con\014guration)f(\(B1001A\))g(w)n(as)g(ev)-5 b(aluated)-116 +3317 y(during)29 b(Phase)f(I)h(of)h(the)f(X-33)g(program.)40 +b(It)30 b(has)f(t)n(win)g(v)n(er-)-116 3417 y(tical)e(tails,)g(\014ns,) +g(and)g(outb)r(oard)f(b)r(o)r(dy)i(\015aps.)36 b(The)27 +b(engines)-116 3517 y(are)e(mo)r(deled)i(b)n(y)f(the)g(b)r(o)n(x-shap)r +(ed)g(structure)g(on)g(the)g(base.)-116 3616 y Fl(We)35 +b(c)l(an)f(also)i(have)g(a)f(\\table")g(of)g(two,)i(or)e(four,)h(or)f +(mor)l(e)-116 3716 y(\014gur)l(es)29 b(as)h(in)g(Fig.)h(3.)342 +3916 y Ft(Computational)36 b(Mesh)-33 4034 y Fr(The)24 +b(underlying)f(surface)f(de\014nition)i(database)f(w)n(as)g(gen-)-116 +4133 y(erated)39 b(from)g(structured)g(surface)g(patc)n(hes)g(obtained) +g(us-)-116 4233 y(ing)52 b(GRIDGEN,)473 4203 y Fp(11)603 +4233 y Fr(GridT)-7 b(o)r(ol,)955 4203 y Fp(12)1084 4233 +y Fr(and)53 b(simple)g(analyti-)-116 4332 y(cal)c(metho)r(ds.)102 +b(The)50 b(unstructured)f(surface)g(and)g(\015o)n(w-)-116 +4432 y(\014eld)36 b(grids)f(w)n(ere)f(then)j(generated)d(using)i +(FELISA)1594 4402 y Fp(13)1700 4432 y Fr(and)-116 4532 +y(TETMESH.)325 4502 y Fp(14)426 4532 y Fr(The)31 b(coarsest)e(mesh)i +(has)g(32,374)e(tetrahe-)-116 4631 y(dra)20 b(with)h(6,634)e(no)r(des.) +35 b(Additional)21 b(meshes)f(are)g(describ)r(ed)-116 +4731 y(in)31 b(Ref.)h(9;)g(ho)n(w)n(ev)n(er,)e(all)h(the)g(results)g +(sho)n(wn)f(here)g(are)g(the)-116 4831 y(result)d(of)h(the)g(coarsest)d +(meshes.)-33 4930 y(Since)41 b(the)h(\015o)n(w)f(ab)r(out)g(symmetric)g +(con\014gurations)f(at)-116 5030 y(high)35 b(angles)f(of)i(attac)n(k,)g +(ev)n(en)f(with)h(zero)f(side-slip,)i(often)-116 5130 +y(in)n(v)n(olv)n(e)f(asymmetric,)j(v)n(ortex-dominated,)g(features,) +1665 5099 y Fp(15{)o(18)-116 5229 y Fr(t)n(w)n(o)i(di\013eren)n(t)i +(options)e(for)h(the)h(computational)e(domain)-116 5329 +y(w)n(ere)19 b(emplo)n(y)n(ed:)32 b(one)19 b(mo)r(deling)h(the)h +(complete)f(v)n(ehicle)f(and)-116 5428 y(another)37 b(mo)r(deling)h +(only)g(half)g(of)g(the)g(v)n(ehicle,)j(assuming)1984 +1158 y @beginspecial 144 @llx 367 @lly 488 @urx 602 @ury +2340 @rwi @setspecial +%%BeginDocument: smpfig.eps +%!PS-Adobe-2.0 EPSF-1.2 +%%Creator:Adobe Illustrator(TM) 1.1 +%%For: (RICHARD A WHELESS) (NASA LANGLEY) +%%Title: (EPS) +%%CreationDate: (2/9/99) (3:01 PM) +%%DocumentProcessColors: Black +%%DocumentFonts: Courier-Bold +%%DocumentProcSets: Adobe_Illustrator_1.1 0 0 +%%BoundingBox:144 367 488 602 +%%ColorUsage: Black&White +%AI3_IncludePlacedImages +%%TemplateBox:306 396 306 396 +%%TileBox: 30 31 582 761 +%%DocumentPreview: Header +%%EndComments +%%BeginProcSet:Adobe_Illustrator_1.1 0 0 +/Adobe_Illustrator_1.1 dup 100 dict def load begin +/Version 0 def +/Revision 0 def +/bdef {bind def} bind def +/ldef {load def} bdef +/xdef {exch def} bdef +/_K {3 index add neg dup 0 lt {pop 0} if 3 1 roll} bdef +/_k /setcmybcolor where +{/setcmybcolor get} {{1 sub 4 1 roll _K _K _K setrgbcolor pop} bind} ifelse def +/g {/_b xdef /p {_b setgray} def} bdef +/G {/_B xdef /P {_B setgray} def} bdef +/k {/_b xdef /_y xdef /_m xdef /_c xdef /p {_c _m _y _b _k} def} bdef +/K {/_B xdef /_Y xdef /_M xdef /_C xdef /P {_C _M _Y _B _k} def} bdef +/d /setdash ldef +/_i currentflat def +/i {dup 0 eq {pop _i} if setflat} bdef +/j /setlinejoin ldef +/J /setlinecap ldef +/M /setmiterlimit ldef +/w /setlinewidth ldef +/_R {.25 sub round .25 add} bdef +/_r {transform _R exch _R exch itransform} bdef +/c {_r curveto} bdef +/C /c ldef +/v {currentpoint 6 2 roll _r curveto} bdef +/V /v ldef +/y {_r 2 copy curveto} bdef +/Y /y ldef +/l {_r lineto} bdef +/L /l ldef +/m {_r moveto} bdef +/_e [] def +/_E {_e length 0 ne {gsave 0 g 0 G 0 i 0 J 0 j 1 w 10 M [] 0 d +/Courier 20 0 0 1 z [0.966 0.259 -0.259 0.966 +_e 0 get _e 2 get add 2 div _e 1 get _e 3 get add 2 div] e _f t T grestore} if} bdef +/_fill {{fill} stopped +{/_e [pathbbox] def /_f (ERROR: can't fill, increase flatness) def n _E} if} bdef +/_stroke {{stroke} stopped +{/_e [pathbbox] def /_f (ERROR: can't stroke, increase flatness) def n _E} if} bdef +/n /newpath ldef +/N /n ldef +/F {p _fill} bdef +/f {closepath F} bdef +/S {P _stroke} bdef +/s {closepath S} bdef +/B {gsave F grestore S} bdef +/b {closepath B} bdef +/_s /ashow ldef +/_S {(?) exch {2 copy 0 exch put pop dup false charpath currentpoint _g setmatrix +_stroke _G setmatrix moveto 3 copy pop rmoveto} forall pop pop pop n} bdef +/_A {_a moveto _t exch 0 exch} bdef +/_L {0 _l neg translate _G currentmatrix pop} bdef +/_w {dup stringwidth exch 3 -1 roll length 1 sub _t mul add exch} bdef +/_z [{0 0} bind {dup _w exch neg 2 div exch neg 2 div} bind {dup _w exch neg exch neg} bind] def +/z {_z exch get /_a xdef /_t xdef /_l xdef exch findfont exch scalefont setfont} bdef +/_g matrix def +/_G matrix def +/_D {_g currentmatrix pop gsave concat _G currentmatrix pop} bdef +/e {_D p /t {_A _s _L} def} bdef +/r {_D P /t {_A _S _L} def} bdef +/a {_D /t {dup p _A _s P _A _S _L} def} bdef +/o {_D /t {pop _L} def} bdef +/T {grestore} bdef +/u {} bdef +/U {} bdef +/Z {findfont begin currentdict dup length dict begin +{1 index /FID ne {def} {pop pop} ifelse} forall /FontName exch def dup length 0 ne +{/Encoding Encoding 256 array copy def 0 exch {dup type /nametype eq +{Encoding 2 index 2 index put pop 1 add} {exch pop} ifelse} forall} if pop +currentdict dup end end /FontName get exch definefont pop} bdef +end +%%EndProcSet +%%EndProlog +%%BeginSetup +Adobe_Illustrator_1.1 begin +n +%%BeginEncoding: _Courier-Bold Courier-Bold +[39/quotesingle 96/grave 128/Adieresis/Aring/Ccedilla/Eacute/Ntilde/Odieresis +/Udieresis/aacute/agrave/acircumflex/adieresis/atilde/aring/ccedilla/eacute +/egrave/ecircumflex/edieresis/iacute/igrave/icircumflex/idieresis/ntilde +/oacute/ograve/ocircumflex/odieresis/otilde/uacute/ugrave/ucircumflex +/udieresis/dagger/degree/cent/sterling/section/bullet/paragraph/germandbls +/registered/copyright/trademark/acute/dieresis/.notdef/AE/Oslash +/.notdef/plusminus/.notdef/.notdef/yen/mu/.notdef/.notdef +/.notdef/.notdef/.notdef/ordfeminine/ordmasculine/.notdef/ae/oslash +/questiondown/exclamdown/logicalnot/.notdef/florin/.notdef/.notdef +/guillemotleft/guillemotright/ellipsis/.notdef/Agrave/Atilde/Otilde/OE/oe +/endash/emdash/quotedblleft/quotedblright/quoteleft/quoteright/divide +/.notdef/ydieresis/Ydieresis/fraction/currency/guilsinglleft/guilsinglright +/fi/fl/daggerdbl/periodcentered/quotesinglbase/quotedblbase/perthousand +/Acircumflex/Ecircumflex/Aacute/Edieresis/Egrave/Iacute/Icircumflex +/Idieresis/Igrave/Oacute/Ocircumflex/.notdef/Ograve/Uacute/Ucircumflex +/Ugrave/dotlessi/circumflex/tilde/macron/breve/dotaccent/ring/cedilla +/hungarumlaut/ogonek/caron +]/_Courier-Bold/Courier-Bold Z +%%EndEncoding +%%EndSetup +0 0 0 0 k +0 0 0 1 K +0 i +0 J 0 j 1 w 4 M []0 d +%%Note: +487.5 367.5 m +487.5 601.5 L +145.5 601.5 L +145.5 367.5 L +487.5 367.5 L +b +145.5 601.5 m +487 368 l +B +487 601.5 m +145 368 l +B +0.5 w +450.5 478 m +450.5 494 L +182 494 L +182 478 L +450.5 478 L +b +u +0 0 0 1 k +1 w +/_Courier-Bold 12 14.5 0 0 z +[1 0 0 1 187.402 482]e +(Encapsulated Postscript \(EPS\) Figure)t +T +U +%%PageTrailer +%%Trailer +_E end +%%EOF + +%%EndDocument + @endspecial 2549 1267 a Fo(a\))23 b Fu(First)k(prett)n(y)f(picture.) +1984 2727 y @beginspecial 144 @llx 367 @lly 488 @urx +602 @ury 2340 @rwi @setspecial +%%BeginDocument: smpfig.eps +%!PS-Adobe-2.0 EPSF-1.2 +%%Creator:Adobe Illustrator(TM) 1.1 +%%For: (RICHARD A WHELESS) (NASA LANGLEY) +%%Title: (EPS) +%%CreationDate: (2/9/99) (3:01 PM) +%%DocumentProcessColors: Black +%%DocumentFonts: Courier-Bold +%%DocumentProcSets: Adobe_Illustrator_1.1 0 0 +%%BoundingBox:144 367 488 602 +%%ColorUsage: Black&White +%AI3_IncludePlacedImages +%%TemplateBox:306 396 306 396 +%%TileBox: 30 31 582 761 +%%DocumentPreview: Header +%%EndComments +%%BeginProcSet:Adobe_Illustrator_1.1 0 0 +/Adobe_Illustrator_1.1 dup 100 dict def load begin +/Version 0 def +/Revision 0 def +/bdef {bind def} bind def +/ldef {load def} bdef +/xdef {exch def} bdef +/_K {3 index add neg dup 0 lt {pop 0} if 3 1 roll} bdef +/_k /setcmybcolor where +{/setcmybcolor get} {{1 sub 4 1 roll _K _K _K setrgbcolor pop} bind} ifelse def +/g {/_b xdef /p {_b setgray} def} bdef +/G {/_B xdef /P {_B setgray} def} bdef +/k {/_b xdef /_y xdef /_m xdef /_c xdef /p {_c _m _y _b _k} def} bdef +/K {/_B xdef /_Y xdef /_M xdef /_C xdef /P {_C _M _Y _B _k} def} bdef +/d /setdash ldef +/_i currentflat def +/i {dup 0 eq {pop _i} if setflat} bdef +/j /setlinejoin ldef +/J /setlinecap ldef +/M /setmiterlimit ldef +/w /setlinewidth ldef +/_R {.25 sub round .25 add} bdef +/_r {transform _R exch _R exch itransform} bdef +/c {_r curveto} bdef +/C /c ldef +/v {currentpoint 6 2 roll _r curveto} bdef +/V /v ldef +/y {_r 2 copy curveto} bdef +/Y /y ldef +/l {_r lineto} bdef +/L /l ldef +/m {_r moveto} bdef +/_e [] def +/_E {_e length 0 ne {gsave 0 g 0 G 0 i 0 J 0 j 1 w 10 M [] 0 d +/Courier 20 0 0 1 z [0.966 0.259 -0.259 0.966 +_e 0 get _e 2 get add 2 div _e 1 get _e 3 get add 2 div] e _f t T grestore} if} bdef +/_fill {{fill} stopped +{/_e [pathbbox] def /_f (ERROR: can't fill, increase flatness) def n _E} if} bdef +/_stroke {{stroke} stopped +{/_e [pathbbox] def /_f (ERROR: can't stroke, increase flatness) def n _E} if} bdef +/n /newpath ldef +/N /n ldef +/F {p _fill} bdef +/f {closepath F} bdef +/S {P _stroke} bdef +/s {closepath S} bdef +/B {gsave F grestore S} bdef +/b {closepath B} bdef +/_s /ashow ldef +/_S {(?) exch {2 copy 0 exch put pop dup false charpath currentpoint _g setmatrix +_stroke _G setmatrix moveto 3 copy pop rmoveto} forall pop pop pop n} bdef +/_A {_a moveto _t exch 0 exch} bdef +/_L {0 _l neg translate _G currentmatrix pop} bdef +/_w {dup stringwidth exch 3 -1 roll length 1 sub _t mul add exch} bdef +/_z [{0 0} bind {dup _w exch neg 2 div exch neg 2 div} bind {dup _w exch neg exch neg} bind] def +/z {_z exch get /_a xdef /_t xdef /_l xdef exch findfont exch scalefont setfont} bdef +/_g matrix def +/_G matrix def +/_D {_g currentmatrix pop gsave concat _G currentmatrix pop} bdef +/e {_D p /t {_A _s _L} def} bdef +/r {_D P /t {_A _S _L} def} bdef +/a {_D /t {dup p _A _s P _A _S _L} def} bdef +/o {_D /t {pop _L} def} bdef +/T {grestore} bdef +/u {} bdef +/U {} bdef +/Z {findfont begin currentdict dup length dict begin +{1 index /FID ne {def} {pop pop} ifelse} forall /FontName exch def dup length 0 ne +{/Encoding Encoding 256 array copy def 0 exch {dup type /nametype eq +{Encoding 2 index 2 index put pop 1 add} {exch pop} ifelse} forall} if pop +currentdict dup end end /FontName get exch definefont pop} bdef +end +%%EndProcSet +%%EndProlog +%%BeginSetup +Adobe_Illustrator_1.1 begin +n +%%BeginEncoding: _Courier-Bold Courier-Bold +[39/quotesingle 96/grave 128/Adieresis/Aring/Ccedilla/Eacute/Ntilde/Odieresis +/Udieresis/aacute/agrave/acircumflex/adieresis/atilde/aring/ccedilla/eacute +/egrave/ecircumflex/edieresis/iacute/igrave/icircumflex/idieresis/ntilde +/oacute/ograve/ocircumflex/odieresis/otilde/uacute/ugrave/ucircumflex +/udieresis/dagger/degree/cent/sterling/section/bullet/paragraph/germandbls +/registered/copyright/trademark/acute/dieresis/.notdef/AE/Oslash +/.notdef/plusminus/.notdef/.notdef/yen/mu/.notdef/.notdef +/.notdef/.notdef/.notdef/ordfeminine/ordmasculine/.notdef/ae/oslash +/questiondown/exclamdown/logicalnot/.notdef/florin/.notdef/.notdef +/guillemotleft/guillemotright/ellipsis/.notdef/Agrave/Atilde/Otilde/OE/oe +/endash/emdash/quotedblleft/quotedblright/quoteleft/quoteright/divide +/.notdef/ydieresis/Ydieresis/fraction/currency/guilsinglleft/guilsinglright +/fi/fl/daggerdbl/periodcentered/quotesinglbase/quotedblbase/perthousand +/Acircumflex/Ecircumflex/Aacute/Edieresis/Egrave/Iacute/Icircumflex +/Idieresis/Igrave/Oacute/Ocircumflex/.notdef/Ograve/Uacute/Ucircumflex +/Ugrave/dotlessi/circumflex/tilde/macron/breve/dotaccent/ring/cedilla +/hungarumlaut/ogonek/caron +]/_Courier-Bold/Courier-Bold Z +%%EndEncoding +%%EndSetup +0 0 0 0 k +0 0 0 1 K +0 i +0 J 0 j 1 w 4 M []0 d +%%Note: +487.5 367.5 m +487.5 601.5 L +145.5 601.5 L +145.5 367.5 L +487.5 367.5 L +b +145.5 601.5 m +487 368 l +B +487 601.5 m +145 368 l +B +0.5 w +450.5 478 m +450.5 494 L +182 494 L +182 478 L +450.5 478 L +b +u +0 0 0 1 k +1 w +/_Courier-Bold 12 14.5 0 0 z +[1 0 0 1 187.402 482]e +(Encapsulated Postscript \(EPS\) Figure)t +T +U +%%PageTrailer +%%Trailer +_E end +%%EOF + +%%EndDocument + @endspecial 2506 2836 a Fo(b\))e Fu(Second)k(prett)n(y)e(picture.)1984 +2983 y Fo(Fig.)37 b(2)102 b(T)-7 b(emp)r(erature)37 b(distribution)k +(comparisons)d(at)1984 3074 y(v)-5 b(arious)45 b(wing)f(semi-span)g +(stations)h(as)f(a)g(function)i(of)1984 3165 y(c)n(hord.)39 +b(Wh)n(uh?)1984 4083 y @beginspecial 144 @llx 367 @lly +488 @urx 602 @ury 1110 @rwi @setspecial +%%BeginDocument: smpfig.eps +%!PS-Adobe-2.0 EPSF-1.2 +%%Creator:Adobe Illustrator(TM) 1.1 +%%For: (RICHARD A WHELESS) (NASA LANGLEY) +%%Title: (EPS) +%%CreationDate: (2/9/99) (3:01 PM) +%%DocumentProcessColors: Black +%%DocumentFonts: Courier-Bold +%%DocumentProcSets: Adobe_Illustrator_1.1 0 0 +%%BoundingBox:144 367 488 602 +%%ColorUsage: Black&White +%AI3_IncludePlacedImages +%%TemplateBox:306 396 306 396 +%%TileBox: 30 31 582 761 +%%DocumentPreview: Header +%%EndComments +%%BeginProcSet:Adobe_Illustrator_1.1 0 0 +/Adobe_Illustrator_1.1 dup 100 dict def load begin +/Version 0 def +/Revision 0 def +/bdef {bind def} bind def +/ldef {load def} bdef +/xdef {exch def} bdef +/_K {3 index add neg dup 0 lt {pop 0} if 3 1 roll} bdef +/_k /setcmybcolor where +{/setcmybcolor get} {{1 sub 4 1 roll _K _K _K setrgbcolor pop} bind} ifelse def +/g {/_b xdef /p {_b setgray} def} bdef +/G {/_B xdef /P {_B setgray} def} bdef +/k {/_b xdef /_y xdef /_m xdef /_c xdef /p {_c _m _y _b _k} def} bdef +/K {/_B xdef /_Y xdef /_M xdef /_C xdef /P {_C _M _Y _B _k} def} bdef +/d /setdash ldef +/_i currentflat def +/i {dup 0 eq {pop _i} if setflat} bdef +/j /setlinejoin ldef +/J /setlinecap ldef +/M /setmiterlimit ldef +/w /setlinewidth ldef +/_R {.25 sub round .25 add} bdef +/_r {transform _R exch _R exch itransform} bdef +/c {_r curveto} bdef +/C /c ldef +/v {currentpoint 6 2 roll _r curveto} bdef +/V /v ldef +/y {_r 2 copy curveto} bdef +/Y /y ldef +/l {_r lineto} bdef +/L /l ldef +/m {_r moveto} bdef +/_e [] def +/_E {_e length 0 ne {gsave 0 g 0 G 0 i 0 J 0 j 1 w 10 M [] 0 d +/Courier 20 0 0 1 z [0.966 0.259 -0.259 0.966 +_e 0 get _e 2 get add 2 div _e 1 get _e 3 get add 2 div] e _f t T grestore} if} bdef +/_fill {{fill} stopped +{/_e [pathbbox] def /_f (ERROR: can't fill, increase flatness) def n _E} if} bdef +/_stroke {{stroke} stopped +{/_e [pathbbox] def /_f (ERROR: can't stroke, increase flatness) def n _E} if} bdef +/n /newpath ldef +/N /n ldef +/F {p _fill} bdef +/f {closepath F} bdef +/S {P _stroke} bdef +/s {closepath S} bdef +/B {gsave F grestore S} bdef +/b {closepath B} bdef +/_s /ashow ldef +/_S {(?) exch {2 copy 0 exch put pop dup false charpath currentpoint _g setmatrix +_stroke _G setmatrix moveto 3 copy pop rmoveto} forall pop pop pop n} bdef +/_A {_a moveto _t exch 0 exch} bdef +/_L {0 _l neg translate _G currentmatrix pop} bdef +/_w {dup stringwidth exch 3 -1 roll length 1 sub _t mul add exch} bdef +/_z [{0 0} bind {dup _w exch neg 2 div exch neg 2 div} bind {dup _w exch neg exch neg} bind] def +/z {_z exch get /_a xdef /_t xdef /_l xdef exch findfont exch scalefont setfont} bdef +/_g matrix def +/_G matrix def +/_D {_g currentmatrix pop gsave concat _G currentmatrix pop} bdef +/e {_D p /t {_A _s _L} def} bdef +/r {_D P /t {_A _S _L} def} bdef +/a {_D /t {dup p _A _s P _A _S _L} def} bdef +/o {_D /t {pop _L} def} bdef +/T {grestore} bdef +/u {} bdef +/U {} bdef +/Z {findfont begin currentdict dup length dict begin +{1 index /FID ne {def} {pop pop} ifelse} forall /FontName exch def dup length 0 ne +{/Encoding Encoding 256 array copy def 0 exch {dup type /nametype eq +{Encoding 2 index 2 index put pop 1 add} {exch pop} ifelse} forall} if pop +currentdict dup end end /FontName get exch definefont pop} bdef +end +%%EndProcSet +%%EndProlog +%%BeginSetup +Adobe_Illustrator_1.1 begin +n +%%BeginEncoding: _Courier-Bold Courier-Bold +[39/quotesingle 96/grave 128/Adieresis/Aring/Ccedilla/Eacute/Ntilde/Odieresis +/Udieresis/aacute/agrave/acircumflex/adieresis/atilde/aring/ccedilla/eacute +/egrave/ecircumflex/edieresis/iacute/igrave/icircumflex/idieresis/ntilde +/oacute/ograve/ocircumflex/odieresis/otilde/uacute/ugrave/ucircumflex +/udieresis/dagger/degree/cent/sterling/section/bullet/paragraph/germandbls +/registered/copyright/trademark/acute/dieresis/.notdef/AE/Oslash +/.notdef/plusminus/.notdef/.notdef/yen/mu/.notdef/.notdef +/.notdef/.notdef/.notdef/ordfeminine/ordmasculine/.notdef/ae/oslash +/questiondown/exclamdown/logicalnot/.notdef/florin/.notdef/.notdef +/guillemotleft/guillemotright/ellipsis/.notdef/Agrave/Atilde/Otilde/OE/oe +/endash/emdash/quotedblleft/quotedblright/quoteleft/quoteright/divide +/.notdef/ydieresis/Ydieresis/fraction/currency/guilsinglleft/guilsinglright +/fi/fl/daggerdbl/periodcentered/quotesinglbase/quotedblbase/perthousand +/Acircumflex/Ecircumflex/Aacute/Edieresis/Egrave/Iacute/Icircumflex +/Idieresis/Igrave/Oacute/Ocircumflex/.notdef/Ograve/Uacute/Ucircumflex +/Ugrave/dotlessi/circumflex/tilde/macron/breve/dotaccent/ring/cedilla +/hungarumlaut/ogonek/caron +]/_Courier-Bold/Courier-Bold Z +%%EndEncoding +%%EndSetup +0 0 0 0 k +0 0 0 1 K +0 i +0 J 0 j 1 w 4 M []0 d +%%Note: +487.5 367.5 m +487.5 601.5 L +145.5 601.5 L +145.5 367.5 L +487.5 367.5 L +b +145.5 601.5 m +487 368 l +B +487 601.5 m +145 368 l +B +0.5 w +450.5 478 m +450.5 494 L +182 494 L +182 478 L +450.5 478 L +b +u +0 0 0 1 k +1 w +/_Courier-Bold 12 14.5 0 0 z +[1 0 0 1 187.402 482]e +(Encapsulated Postscript \(EPS\) Figure)t +T +U +%%PageTrailer +%%Trailer +_E end +%%EOF + +%%EndDocument + @endspecial 2036 4192 a(a\))24 b Fu(First)i(prett)n(y)g(picture.)3009 +4083 y @beginspecial 144 @llx 367 @lly 488 @urx 602 @ury +1110 @rwi @setspecial +%%BeginDocument: smpfig.eps +%!PS-Adobe-2.0 EPSF-1.2 +%%Creator:Adobe Illustrator(TM) 1.1 +%%For: (RICHARD A WHELESS) (NASA LANGLEY) +%%Title: (EPS) +%%CreationDate: (2/9/99) (3:01 PM) +%%DocumentProcessColors: Black +%%DocumentFonts: Courier-Bold +%%DocumentProcSets: Adobe_Illustrator_1.1 0 0 +%%BoundingBox:144 367 488 602 +%%ColorUsage: Black&White +%AI3_IncludePlacedImages +%%TemplateBox:306 396 306 396 +%%TileBox: 30 31 582 761 +%%DocumentPreview: Header +%%EndComments +%%BeginProcSet:Adobe_Illustrator_1.1 0 0 +/Adobe_Illustrator_1.1 dup 100 dict def load begin +/Version 0 def +/Revision 0 def +/bdef {bind def} bind def +/ldef {load def} bdef +/xdef {exch def} bdef +/_K {3 index add neg dup 0 lt {pop 0} if 3 1 roll} bdef +/_k /setcmybcolor where +{/setcmybcolor get} {{1 sub 4 1 roll _K _K _K setrgbcolor pop} bind} ifelse def +/g {/_b xdef /p {_b setgray} def} bdef +/G {/_B xdef /P {_B setgray} def} bdef +/k {/_b xdef /_y xdef /_m xdef /_c xdef /p {_c _m _y _b _k} def} bdef +/K {/_B xdef /_Y xdef /_M xdef /_C xdef /P {_C _M _Y _B _k} def} bdef +/d /setdash ldef +/_i currentflat def +/i {dup 0 eq {pop _i} if setflat} bdef +/j /setlinejoin ldef +/J /setlinecap ldef +/M /setmiterlimit ldef +/w /setlinewidth ldef +/_R {.25 sub round .25 add} bdef +/_r {transform _R exch _R exch itransform} bdef +/c {_r curveto} bdef +/C /c ldef +/v {currentpoint 6 2 roll _r curveto} bdef +/V /v ldef +/y {_r 2 copy curveto} bdef +/Y /y ldef +/l {_r lineto} bdef +/L /l ldef +/m {_r moveto} bdef +/_e [] def +/_E {_e length 0 ne {gsave 0 g 0 G 0 i 0 J 0 j 1 w 10 M [] 0 d +/Courier 20 0 0 1 z [0.966 0.259 -0.259 0.966 +_e 0 get _e 2 get add 2 div _e 1 get _e 3 get add 2 div] e _f t T grestore} if} bdef +/_fill {{fill} stopped +{/_e [pathbbox] def /_f (ERROR: can't fill, increase flatness) def n _E} if} bdef +/_stroke {{stroke} stopped +{/_e [pathbbox] def /_f (ERROR: can't stroke, increase flatness) def n _E} if} bdef +/n /newpath ldef +/N /n ldef +/F {p _fill} bdef +/f {closepath F} bdef +/S {P _stroke} bdef +/s {closepath S} bdef +/B {gsave F grestore S} bdef +/b {closepath B} bdef +/_s /ashow ldef +/_S {(?) exch {2 copy 0 exch put pop dup false charpath currentpoint _g setmatrix +_stroke _G setmatrix moveto 3 copy pop rmoveto} forall pop pop pop n} bdef +/_A {_a moveto _t exch 0 exch} bdef +/_L {0 _l neg translate _G currentmatrix pop} bdef +/_w {dup stringwidth exch 3 -1 roll length 1 sub _t mul add exch} bdef +/_z [{0 0} bind {dup _w exch neg 2 div exch neg 2 div} bind {dup _w exch neg exch neg} bind] def +/z {_z exch get /_a xdef /_t xdef /_l xdef exch findfont exch scalefont setfont} bdef +/_g matrix def +/_G matrix def +/_D {_g currentmatrix pop gsave concat _G currentmatrix pop} bdef +/e {_D p /t {_A _s _L} def} bdef +/r {_D P /t {_A _S _L} def} bdef +/a {_D /t {dup p _A _s P _A _S _L} def} bdef +/o {_D /t {pop _L} def} bdef +/T {grestore} bdef +/u {} bdef +/U {} bdef +/Z {findfont begin currentdict dup length dict begin +{1 index /FID ne {def} {pop pop} ifelse} forall /FontName exch def dup length 0 ne +{/Encoding Encoding 256 array copy def 0 exch {dup type /nametype eq +{Encoding 2 index 2 index put pop 1 add} {exch pop} ifelse} forall} if pop +currentdict dup end end /FontName get exch definefont pop} bdef +end +%%EndProcSet +%%EndProlog +%%BeginSetup +Adobe_Illustrator_1.1 begin +n +%%BeginEncoding: _Courier-Bold Courier-Bold +[39/quotesingle 96/grave 128/Adieresis/Aring/Ccedilla/Eacute/Ntilde/Odieresis +/Udieresis/aacute/agrave/acircumflex/adieresis/atilde/aring/ccedilla/eacute +/egrave/ecircumflex/edieresis/iacute/igrave/icircumflex/idieresis/ntilde +/oacute/ograve/ocircumflex/odieresis/otilde/uacute/ugrave/ucircumflex +/udieresis/dagger/degree/cent/sterling/section/bullet/paragraph/germandbls +/registered/copyright/trademark/acute/dieresis/.notdef/AE/Oslash +/.notdef/plusminus/.notdef/.notdef/yen/mu/.notdef/.notdef +/.notdef/.notdef/.notdef/ordfeminine/ordmasculine/.notdef/ae/oslash +/questiondown/exclamdown/logicalnot/.notdef/florin/.notdef/.notdef +/guillemotleft/guillemotright/ellipsis/.notdef/Agrave/Atilde/Otilde/OE/oe +/endash/emdash/quotedblleft/quotedblright/quoteleft/quoteright/divide +/.notdef/ydieresis/Ydieresis/fraction/currency/guilsinglleft/guilsinglright +/fi/fl/daggerdbl/periodcentered/quotesinglbase/quotedblbase/perthousand +/Acircumflex/Ecircumflex/Aacute/Edieresis/Egrave/Iacute/Icircumflex +/Idieresis/Igrave/Oacute/Ocircumflex/.notdef/Ograve/Uacute/Ucircumflex +/Ugrave/dotlessi/circumflex/tilde/macron/breve/dotaccent/ring/cedilla +/hungarumlaut/ogonek/caron +]/_Courier-Bold/Courier-Bold Z +%%EndEncoding +%%EndSetup +0 0 0 0 k +0 0 0 1 K +0 i +0 J 0 j 1 w 4 M []0 d +%%Note: +487.5 367.5 m +487.5 601.5 L +145.5 601.5 L +145.5 367.5 L +487.5 367.5 L +b +145.5 601.5 m +487 368 l +B +487 601.5 m +145 368 l +B +0.5 w +450.5 478 m +450.5 494 L +182 494 L +182 478 L +450.5 478 L +b +u +0 0 0 1 k +1 w +/_Courier-Bold 12 14.5 0 0 z +[1 0 0 1 187.402 482]e +(Encapsulated Postscript \(EPS\) Figure)t +T +U +%%PageTrailer +%%Trailer +_E end +%%EOF + +%%EndDocument + @endspecial 3025 4192 a Fo(b\))20 b Fu(Second)j(prett)n(y)f(picture.) +1984 4963 y @beginspecial 144 @llx 367 @lly 488 @urx +602 @ury 1110 @rwi @setspecial +%%BeginDocument: smpfig.eps +%!PS-Adobe-2.0 EPSF-1.2 +%%Creator:Adobe Illustrator(TM) 1.1 +%%For: (RICHARD A WHELESS) (NASA LANGLEY) +%%Title: (EPS) +%%CreationDate: (2/9/99) (3:01 PM) +%%DocumentProcessColors: Black +%%DocumentFonts: Courier-Bold +%%DocumentProcSets: Adobe_Illustrator_1.1 0 0 +%%BoundingBox:144 367 488 602 +%%ColorUsage: Black&White +%AI3_IncludePlacedImages +%%TemplateBox:306 396 306 396 +%%TileBox: 30 31 582 761 +%%DocumentPreview: Header +%%EndComments +%%BeginProcSet:Adobe_Illustrator_1.1 0 0 +/Adobe_Illustrator_1.1 dup 100 dict def load begin +/Version 0 def +/Revision 0 def +/bdef {bind def} bind def +/ldef {load def} bdef +/xdef {exch def} bdef +/_K {3 index add neg dup 0 lt {pop 0} if 3 1 roll} bdef +/_k /setcmybcolor where +{/setcmybcolor get} {{1 sub 4 1 roll _K _K _K setrgbcolor pop} bind} ifelse def +/g {/_b xdef /p {_b setgray} def} bdef +/G {/_B xdef /P {_B setgray} def} bdef +/k {/_b xdef /_y xdef /_m xdef /_c xdef /p {_c _m _y _b _k} def} bdef +/K {/_B xdef /_Y xdef /_M xdef /_C xdef /P {_C _M _Y _B _k} def} bdef +/d /setdash ldef +/_i currentflat def +/i {dup 0 eq {pop _i} if setflat} bdef +/j /setlinejoin ldef +/J /setlinecap ldef +/M /setmiterlimit ldef +/w /setlinewidth ldef +/_R {.25 sub round .25 add} bdef +/_r {transform _R exch _R exch itransform} bdef +/c {_r curveto} bdef +/C /c ldef +/v {currentpoint 6 2 roll _r curveto} bdef +/V /v ldef +/y {_r 2 copy curveto} bdef +/Y /y ldef +/l {_r lineto} bdef +/L /l ldef +/m {_r moveto} bdef +/_e [] def +/_E {_e length 0 ne {gsave 0 g 0 G 0 i 0 J 0 j 1 w 10 M [] 0 d +/Courier 20 0 0 1 z [0.966 0.259 -0.259 0.966 +_e 0 get _e 2 get add 2 div _e 1 get _e 3 get add 2 div] e _f t T grestore} if} bdef +/_fill {{fill} stopped +{/_e [pathbbox] def /_f (ERROR: can't fill, increase flatness) def n _E} if} bdef +/_stroke {{stroke} stopped +{/_e [pathbbox] def /_f (ERROR: can't stroke, increase flatness) def n _E} if} bdef +/n /newpath ldef +/N /n ldef +/F {p _fill} bdef +/f {closepath F} bdef +/S {P _stroke} bdef +/s {closepath S} bdef +/B {gsave F grestore S} bdef +/b {closepath B} bdef +/_s /ashow ldef +/_S {(?) exch {2 copy 0 exch put pop dup false charpath currentpoint _g setmatrix +_stroke _G setmatrix moveto 3 copy pop rmoveto} forall pop pop pop n} bdef +/_A {_a moveto _t exch 0 exch} bdef +/_L {0 _l neg translate _G currentmatrix pop} bdef +/_w {dup stringwidth exch 3 -1 roll length 1 sub _t mul add exch} bdef +/_z [{0 0} bind {dup _w exch neg 2 div exch neg 2 div} bind {dup _w exch neg exch neg} bind] def +/z {_z exch get /_a xdef /_t xdef /_l xdef exch findfont exch scalefont setfont} bdef +/_g matrix def +/_G matrix def +/_D {_g currentmatrix pop gsave concat _G currentmatrix pop} bdef +/e {_D p /t {_A _s _L} def} bdef +/r {_D P /t {_A _S _L} def} bdef +/a {_D /t {dup p _A _s P _A _S _L} def} bdef +/o {_D /t {pop _L} def} bdef +/T {grestore} bdef +/u {} bdef +/U {} bdef +/Z {findfont begin currentdict dup length dict begin +{1 index /FID ne {def} {pop pop} ifelse} forall /FontName exch def dup length 0 ne +{/Encoding Encoding 256 array copy def 0 exch {dup type /nametype eq +{Encoding 2 index 2 index put pop 1 add} {exch pop} ifelse} forall} if pop +currentdict dup end end /FontName get exch definefont pop} bdef +end +%%EndProcSet +%%EndProlog +%%BeginSetup +Adobe_Illustrator_1.1 begin +n +%%BeginEncoding: _Courier-Bold Courier-Bold +[39/quotesingle 96/grave 128/Adieresis/Aring/Ccedilla/Eacute/Ntilde/Odieresis +/Udieresis/aacute/agrave/acircumflex/adieresis/atilde/aring/ccedilla/eacute +/egrave/ecircumflex/edieresis/iacute/igrave/icircumflex/idieresis/ntilde +/oacute/ograve/ocircumflex/odieresis/otilde/uacute/ugrave/ucircumflex +/udieresis/dagger/degree/cent/sterling/section/bullet/paragraph/germandbls +/registered/copyright/trademark/acute/dieresis/.notdef/AE/Oslash +/.notdef/plusminus/.notdef/.notdef/yen/mu/.notdef/.notdef +/.notdef/.notdef/.notdef/ordfeminine/ordmasculine/.notdef/ae/oslash +/questiondown/exclamdown/logicalnot/.notdef/florin/.notdef/.notdef +/guillemotleft/guillemotright/ellipsis/.notdef/Agrave/Atilde/Otilde/OE/oe +/endash/emdash/quotedblleft/quotedblright/quoteleft/quoteright/divide +/.notdef/ydieresis/Ydieresis/fraction/currency/guilsinglleft/guilsinglright +/fi/fl/daggerdbl/periodcentered/quotesinglbase/quotedblbase/perthousand +/Acircumflex/Ecircumflex/Aacute/Edieresis/Egrave/Iacute/Icircumflex +/Idieresis/Igrave/Oacute/Ocircumflex/.notdef/Ograve/Uacute/Ucircumflex +/Ugrave/dotlessi/circumflex/tilde/macron/breve/dotaccent/ring/cedilla +/hungarumlaut/ogonek/caron +]/_Courier-Bold/Courier-Bold Z +%%EndEncoding +%%EndSetup +0 0 0 0 k +0 0 0 1 K +0 i +0 J 0 j 1 w 4 M []0 d +%%Note: +487.5 367.5 m +487.5 601.5 L +145.5 601.5 L +145.5 367.5 L +487.5 367.5 L +b +145.5 601.5 m +487 368 l +B +487 601.5 m +145 368 l +B +0.5 w +450.5 478 m +450.5 494 L +182 494 L +182 478 L +450.5 478 L +b +u +0 0 0 1 k +1 w +/_Courier-Bold 12 14.5 0 0 z +[1 0 0 1 187.402 482]e +(Encapsulated Postscript \(EPS\) Figure)t +T +U +%%PageTrailer +%%Trailer +_E end +%%EOF + +%%EndDocument + @endspecial 2000 5073 a Fo(c\))i Fu(Second)i(prett)n(y)f(picture,)2000 +5152 y(again.)3009 4963 y @beginspecial 144 @llx 367 +@lly 488 @urx 602 @ury 1110 @rwi @setspecial +%%BeginDocument: smpfig.eps +%!PS-Adobe-2.0 EPSF-1.2 +%%Creator:Adobe Illustrator(TM) 1.1 +%%For: (RICHARD A WHELESS) (NASA LANGLEY) +%%Title: (EPS) +%%CreationDate: (2/9/99) (3:01 PM) +%%DocumentProcessColors: Black +%%DocumentFonts: Courier-Bold +%%DocumentProcSets: Adobe_Illustrator_1.1 0 0 +%%BoundingBox:144 367 488 602 +%%ColorUsage: Black&White +%AI3_IncludePlacedImages +%%TemplateBox:306 396 306 396 +%%TileBox: 30 31 582 761 +%%DocumentPreview: Header +%%EndComments +%%BeginProcSet:Adobe_Illustrator_1.1 0 0 +/Adobe_Illustrator_1.1 dup 100 dict def load begin +/Version 0 def +/Revision 0 def +/bdef {bind def} bind def +/ldef {load def} bdef +/xdef {exch def} bdef +/_K {3 index add neg dup 0 lt {pop 0} if 3 1 roll} bdef +/_k /setcmybcolor where +{/setcmybcolor get} {{1 sub 4 1 roll _K _K _K setrgbcolor pop} bind} ifelse def +/g {/_b xdef /p {_b setgray} def} bdef +/G {/_B xdef /P {_B setgray} def} bdef +/k {/_b xdef /_y xdef /_m xdef /_c xdef /p {_c _m _y _b _k} def} bdef +/K {/_B xdef /_Y xdef /_M xdef /_C xdef /P {_C _M _Y _B _k} def} bdef +/d /setdash ldef +/_i currentflat def +/i {dup 0 eq {pop _i} if setflat} bdef +/j /setlinejoin ldef +/J /setlinecap ldef +/M /setmiterlimit ldef +/w /setlinewidth ldef +/_R {.25 sub round .25 add} bdef +/_r {transform _R exch _R exch itransform} bdef +/c {_r curveto} bdef +/C /c ldef +/v {currentpoint 6 2 roll _r curveto} bdef +/V /v ldef +/y {_r 2 copy curveto} bdef +/Y /y ldef +/l {_r lineto} bdef +/L /l ldef +/m {_r moveto} bdef +/_e [] def +/_E {_e length 0 ne {gsave 0 g 0 G 0 i 0 J 0 j 1 w 10 M [] 0 d +/Courier 20 0 0 1 z [0.966 0.259 -0.259 0.966 +_e 0 get _e 2 get add 2 div _e 1 get _e 3 get add 2 div] e _f t T grestore} if} bdef +/_fill {{fill} stopped +{/_e [pathbbox] def /_f (ERROR: can't fill, increase flatness) def n _E} if} bdef +/_stroke {{stroke} stopped +{/_e [pathbbox] def /_f (ERROR: can't stroke, increase flatness) def n _E} if} bdef +/n /newpath ldef +/N /n ldef +/F {p _fill} bdef +/f {closepath F} bdef +/S {P _stroke} bdef +/s {closepath S} bdef +/B {gsave F grestore S} bdef +/b {closepath B} bdef +/_s /ashow ldef +/_S {(?) exch {2 copy 0 exch put pop dup false charpath currentpoint _g setmatrix +_stroke _G setmatrix moveto 3 copy pop rmoveto} forall pop pop pop n} bdef +/_A {_a moveto _t exch 0 exch} bdef +/_L {0 _l neg translate _G currentmatrix pop} bdef +/_w {dup stringwidth exch 3 -1 roll length 1 sub _t mul add exch} bdef +/_z [{0 0} bind {dup _w exch neg 2 div exch neg 2 div} bind {dup _w exch neg exch neg} bind] def +/z {_z exch get /_a xdef /_t xdef /_l xdef exch findfont exch scalefont setfont} bdef +/_g matrix def +/_G matrix def +/_D {_g currentmatrix pop gsave concat _G currentmatrix pop} bdef +/e {_D p /t {_A _s _L} def} bdef +/r {_D P /t {_A _S _L} def} bdef +/a {_D /t {dup p _A _s P _A _S _L} def} bdef +/o {_D /t {pop _L} def} bdef +/T {grestore} bdef +/u {} bdef +/U {} bdef +/Z {findfont begin currentdict dup length dict begin +{1 index /FID ne {def} {pop pop} ifelse} forall /FontName exch def dup length 0 ne +{/Encoding Encoding 256 array copy def 0 exch {dup type /nametype eq +{Encoding 2 index 2 index put pop 1 add} {exch pop} ifelse} forall} if pop +currentdict dup end end /FontName get exch definefont pop} bdef +end +%%EndProcSet +%%EndProlog +%%BeginSetup +Adobe_Illustrator_1.1 begin +n +%%BeginEncoding: _Courier-Bold Courier-Bold +[39/quotesingle 96/grave 128/Adieresis/Aring/Ccedilla/Eacute/Ntilde/Odieresis +/Udieresis/aacute/agrave/acircumflex/adieresis/atilde/aring/ccedilla/eacute +/egrave/ecircumflex/edieresis/iacute/igrave/icircumflex/idieresis/ntilde +/oacute/ograve/ocircumflex/odieresis/otilde/uacute/ugrave/ucircumflex +/udieresis/dagger/degree/cent/sterling/section/bullet/paragraph/germandbls +/registered/copyright/trademark/acute/dieresis/.notdef/AE/Oslash +/.notdef/plusminus/.notdef/.notdef/yen/mu/.notdef/.notdef +/.notdef/.notdef/.notdef/ordfeminine/ordmasculine/.notdef/ae/oslash +/questiondown/exclamdown/logicalnot/.notdef/florin/.notdef/.notdef +/guillemotleft/guillemotright/ellipsis/.notdef/Agrave/Atilde/Otilde/OE/oe +/endash/emdash/quotedblleft/quotedblright/quoteleft/quoteright/divide +/.notdef/ydieresis/Ydieresis/fraction/currency/guilsinglleft/guilsinglright +/fi/fl/daggerdbl/periodcentered/quotesinglbase/quotedblbase/perthousand +/Acircumflex/Ecircumflex/Aacute/Edieresis/Egrave/Iacute/Icircumflex +/Idieresis/Igrave/Oacute/Ocircumflex/.notdef/Ograve/Uacute/Ucircumflex +/Ugrave/dotlessi/circumflex/tilde/macron/breve/dotaccent/ring/cedilla +/hungarumlaut/ogonek/caron +]/_Courier-Bold/Courier-Bold Z +%%EndEncoding +%%EndSetup +0 0 0 0 k +0 0 0 1 K +0 i +0 J 0 j 1 w 4 M []0 d +%%Note: +487.5 367.5 m +487.5 601.5 L +145.5 601.5 L +145.5 367.5 L +487.5 367.5 L +b +145.5 601.5 m +487 368 l +B +487 601.5 m +145 368 l +B +0.5 w +450.5 478 m +450.5 494 L +182 494 L +182 478 L +450.5 478 L +b +u +0 0 0 1 k +1 w +/_Courier-Bold 12 14.5 0 0 z +[1 0 0 1 187.402 482]e +(Encapsulated Postscript \(EPS\) Figure)t +T +U +%%PageTrailer +%%Trailer +_E end +%%EOF + +%%EndDocument + @endspecial 3025 5073 a Fo(d\))44 b Fu(First)49 b(prett)n(y)g +(picture,)3025 5152 y(again.)2020 5292 y Fo(Fig.)29 b(3)87 +b(F)-7 b(our)30 b(small)g(\014gures)g(in)g(a)f(table-lik)n(e)i +(setting.)1808 5578 y Fg(2)25 b(of)g(5)p 1759 5642 300 +2 v 737 5736 a(American)g(Institute)h(of)f(Aer)o(ona)o(utics)f(and)h +(Astr)o(ona)o(utics)h(P)-6 b(aper)25 b(98{0879)p eop +%%Page: 3 4 +3 3 bop -116 -188 a Fr(symmetry)33 b(across)e(the)j(pitc)n(h-plane.)55 +b(This)33 b(asp)r(ect)h(of)f(the)-116 -89 y(study)28 +b(is)f(co)n(v)n(ered)f(in)i(Ref.)g(9.)394 100 y Ft(Numerical)35 +b(Metho)s(d)-33 218 y Fr(The)27 b(3D3U)h(co)r(de)f(of)g(Batina)903 +187 y Fp(19)1000 218 y Fr(w)n(as)g(used)g(exclusiv)n(ely)g(in)-116 +317 y(this)21 b(study)-7 b(.)35 b(The)21 b(3D3U)f(co)r(de)h(w)n(as)f +(originally)f(dev)n(elop)r(ed)h(to)-116 417 y(study)25 +b(harmonically)f(pitc)n(hing)h(wings)g(and)g(wing-b)r(o)r(dies)g(in) +-116 516 y(transonic)32 b(\015o)n(w.)54 b(The)34 b(co)r(de)f(can)h +(incorp)r(orate)e(aero)r(elastic)-116 616 y(e\013ects)c(through)f +(assumed)h(mo)r(de)g(shap)r(es,)g(coupled)g(with)g(a)-116 +716 y(deforming)f(mesh)g(via)g(the)h(linear)f(spring)g(analogy)-7 +b(.)-33 815 y(The)31 b(follo)n(wing)g(defaults)h(w)n(ere)e(used)i(for)f +(the)h(computed)-116 915 y(results)22 b(in)g(this)h(study:)34 +b(Ro)r(e's)22 b(\015ux-di\013erence)g(splitting,)i(an)-116 +1015 y(eigen)n(v)-5 b(alue)26 b(limiter)h(threshold)g(v)-5 +b(alue)27 b(of)g(0.3,)f(second-order)-116 1114 y(\015ux)j +(reconstruction)e(using)h(a)g Fs(\024)h Fr(of)f(0.5,)g(and)h +(Gauss-Seidel)-116 1214 y(implicit)36 b(time)f(in)n(tegration)f(with)i +(a)f(CFL)g(n)n(um)n(b)r(er)g(of)g(one)-116 1314 y(million.)353 +1502 y Ft(Maneuv)m(er)j(De\014nition)-33 1620 y Fr(The)28 +b(pitc)n(h)g(sc)n(hedule)f(c)n(hosen)g(for)h(this)g(study)g(is)g(the)g +(\014rst)-116 1720 y(half)21 b(of)g(a)g(sine)f(function.)36 +b(Initially)-7 b(,)22 b(the)g(v)n(ehicle)e(is)h(in)g(steady)-116 +1819 y(\015igh)n(t)36 b(at)g(17.5)e(degrees)h(angle)g(of)h(attac)n(k,)i +(Mac)n(h)d(0.2.)62 b(A)n(t)-116 1919 y(time)41 b(zero,)h(the)f(v)n +(ehicle)f(b)r(egins)g(the)h(pitc)n(h-o)n(v)n(er)d(maneu-)-116 +2018 y(v)n(er,)32 b(reac)n(hing)e(a)h(maxim)n(um)h(pitc)n(h)g(rate)f +(exactly)g(half-w)n(a)n(y)-116 2118 y(through)22 b(the)h(maneuv)n(er)f +(and)g(\014nishing)h(at)g(a)f(180)f(deg)i(angle)-116 +2218 y(of)f(attac)n(k.)34 b(F)-7 b(or)21 b(this)h(study)-7 +b(,)24 b(the)e(time)g(to)g(complete)g(the)g(ma-)-116 +2317 y(neuv)n(er)32 b(w)n(as)g(c)n(hosen)g(as)g(90)h(seconds,)g(giving) +f(a)h(maxim)n(um)-116 2417 y(rotation)j(rate)g(of)h(3.1)f(deg)h(p)r(er) +g(second)g(halfw)n(a)n(y)f(through)-116 2517 y(the)d(maneuv)n(er.)53 +b(F)-7 b(or)33 b(simplicit)n(y)-7 b(,)35 b(it)e(is)g(assumed)g(that)g +(the)-116 2616 y(free-stream)f(Mac)n(h)h(n)n(um)n(b)r(er)h(remains)f +(constan)n(t)g(through-)-116 2716 y(out)27 b(the)h(maneuv)n(er.)-33 +2816 y Fl(Sticking)56 b(in)h(a)f(table)h(for)g(guidanc)l(e)g(\(se)l(e)f +(T)-6 b(able)57 b(1\).)-116 2915 y Fr(Normally)32 b(there)h(w)n(ould)g +(b)r(e)g(text)h(follo)n(wing)e(the)i(table,)h(so)381 +3070 y Fo(T)-7 b(able)29 b(1)87 b(A)29 b(sample)h(table)p +420 3121 851 4 v 420 3138 V 470 3208 a Fr(Header)d(1)99 +b(Header)27 b(2)p 420 3241 V 472 3311 a(a)168 b(b)311 +b(c)470 3410 y(d)171 b(e)321 b(f)p 420 3444 V 420 3460 +V -116 3664 a(that)28 b(it)g(is)f(not)h(left)g(\\hanging")e(in)n(to)h +(the)h(next)g(section.)679 3853 y Ft(Results)-33 3971 +y Fr(The)g(main)g(results)g(are)f(presen)n(ted)h(in)g(t)n(w)n(o)g +(stages)f(whic)n(h)-116 4070 y(are)43 b(follo)n(w)n(ed)h(b)n(y)g +(commen)n(ts)h(on)f(\015o)n(w)g(asymmetries)f(for)-116 +4170 y(b)r(oth)e(steady)f(and)g(unsteady)g(\015o)n(ws.)75 +b(The)41 b(\014rst)f(stage)g(is)-116 4269 y(computed)27 +b(steady)g(data)g(as)f(it)i(compares)d(to)i(exp)r(erimen)n(tal)-116 +4369 y(results.)37 b(while)29 b(the)f(second)g(is)g(a)f(comparison)f +(of)i(steady)g(to)-116 4469 y(unsteady)f(data.)-116 4614 +y Fo(Steady)i(Flo)n(w)-33 4731 y Fr(As)42 b(a)h(baseline)f(to)g +(examine)g(the)h(unsteady)f(e\013ects)h(of)-116 4831 +y(the)28 b(pitc)n(h-o)n(v)n(er)d(maneuv)n(er)i(itself,)h(steady)f +(\015o)n(w)g(at)g(selected)-116 4930 y(angles)40 b(of)h(attac)n(k)f(w)n +(ere)g(computed.)77 b(Figure)41 b(4)f(sho)n(ws)g(a)-116 +5030 y(comparison)21 b(of)i(the)g(normal)f(force)h(co)r(e\016cien)n(t)f +(with)i(the)f(ex-)-116 5130 y(p)r(erimen)n(tal)e(data)g(of)h(W)-7 +b(o)r(o)r(ds)810 5099 y Fp(10)901 5130 y Fr(for)21 b(angles)g(of)g +(attac)n(k)g(from)g(0)-116 5229 y(to)j(60)g(deg.)36 b(The)25 +b(computed)g(results)f(agree)f(w)n(ell)i(\(within)h(20)-116 +5329 y(p)r(ercen)n(t\))19 b(at)g(small)f(angles)g(of)h(attac)n(k,)h +(and)e(div)n(erge)g(from)g(the)-116 5428 y(exp)r(erimen)n(tal)35 +b(results)h(as)g(the)g(angle)g(of)g(attac)n(k)f(increases)1984 +1061 y @beginspecial 144 @llx 367 @lly 488 @urx 602 @ury +2340 @rwi @setspecial +%%BeginDocument: smpfig.eps +%!PS-Adobe-2.0 EPSF-1.2 +%%Creator:Adobe Illustrator(TM) 1.1 +%%For: (RICHARD A WHELESS) (NASA LANGLEY) +%%Title: (EPS) +%%CreationDate: (2/9/99) (3:01 PM) +%%DocumentProcessColors: Black +%%DocumentFonts: Courier-Bold +%%DocumentProcSets: Adobe_Illustrator_1.1 0 0 +%%BoundingBox:144 367 488 602 +%%ColorUsage: Black&White +%AI3_IncludePlacedImages +%%TemplateBox:306 396 306 396 +%%TileBox: 30 31 582 761 +%%DocumentPreview: Header +%%EndComments +%%BeginProcSet:Adobe_Illustrator_1.1 0 0 +/Adobe_Illustrator_1.1 dup 100 dict def load begin +/Version 0 def +/Revision 0 def +/bdef {bind def} bind def +/ldef {load def} bdef +/xdef {exch def} bdef +/_K {3 index add neg dup 0 lt {pop 0} if 3 1 roll} bdef +/_k /setcmybcolor where +{/setcmybcolor get} {{1 sub 4 1 roll _K _K _K setrgbcolor pop} bind} ifelse def +/g {/_b xdef /p {_b setgray} def} bdef +/G {/_B xdef /P {_B setgray} def} bdef +/k {/_b xdef /_y xdef /_m xdef /_c xdef /p {_c _m _y _b _k} def} bdef +/K {/_B xdef /_Y xdef /_M xdef /_C xdef /P {_C _M _Y _B _k} def} bdef +/d /setdash ldef +/_i currentflat def +/i {dup 0 eq {pop _i} if setflat} bdef +/j /setlinejoin ldef +/J /setlinecap ldef +/M /setmiterlimit ldef +/w /setlinewidth ldef +/_R {.25 sub round .25 add} bdef +/_r {transform _R exch _R exch itransform} bdef +/c {_r curveto} bdef +/C /c ldef +/v {currentpoint 6 2 roll _r curveto} bdef +/V /v ldef +/y {_r 2 copy curveto} bdef +/Y /y ldef +/l {_r lineto} bdef +/L /l ldef +/m {_r moveto} bdef +/_e [] def +/_E {_e length 0 ne {gsave 0 g 0 G 0 i 0 J 0 j 1 w 10 M [] 0 d +/Courier 20 0 0 1 z [0.966 0.259 -0.259 0.966 +_e 0 get _e 2 get add 2 div _e 1 get _e 3 get add 2 div] e _f t T grestore} if} bdef +/_fill {{fill} stopped +{/_e [pathbbox] def /_f (ERROR: can't fill, increase flatness) def n _E} if} bdef +/_stroke {{stroke} stopped +{/_e [pathbbox] def /_f (ERROR: can't stroke, increase flatness) def n _E} if} bdef +/n /newpath ldef +/N /n ldef +/F {p _fill} bdef +/f {closepath F} bdef +/S {P _stroke} bdef +/s {closepath S} bdef +/B {gsave F grestore S} bdef +/b {closepath B} bdef +/_s /ashow ldef +/_S {(?) exch {2 copy 0 exch put pop dup false charpath currentpoint _g setmatrix +_stroke _G setmatrix moveto 3 copy pop rmoveto} forall pop pop pop n} bdef +/_A {_a moveto _t exch 0 exch} bdef +/_L {0 _l neg translate _G currentmatrix pop} bdef +/_w {dup stringwidth exch 3 -1 roll length 1 sub _t mul add exch} bdef +/_z [{0 0} bind {dup _w exch neg 2 div exch neg 2 div} bind {dup _w exch neg exch neg} bind] def +/z {_z exch get /_a xdef /_t xdef /_l xdef exch findfont exch scalefont setfont} bdef +/_g matrix def +/_G matrix def +/_D {_g currentmatrix pop gsave concat _G currentmatrix pop} bdef +/e {_D p /t {_A _s _L} def} bdef +/r {_D P /t {_A _S _L} def} bdef +/a {_D /t {dup p _A _s P _A _S _L} def} bdef +/o {_D /t {pop _L} def} bdef +/T {grestore} bdef +/u {} bdef +/U {} bdef +/Z {findfont begin currentdict dup length dict begin +{1 index /FID ne {def} {pop pop} ifelse} forall /FontName exch def dup length 0 ne +{/Encoding Encoding 256 array copy def 0 exch {dup type /nametype eq +{Encoding 2 index 2 index put pop 1 add} {exch pop} ifelse} forall} if pop +currentdict dup end end /FontName get exch definefont pop} bdef +end +%%EndProcSet +%%EndProlog +%%BeginSetup +Adobe_Illustrator_1.1 begin +n +%%BeginEncoding: _Courier-Bold Courier-Bold +[39/quotesingle 96/grave 128/Adieresis/Aring/Ccedilla/Eacute/Ntilde/Odieresis +/Udieresis/aacute/agrave/acircumflex/adieresis/atilde/aring/ccedilla/eacute +/egrave/ecircumflex/edieresis/iacute/igrave/icircumflex/idieresis/ntilde +/oacute/ograve/ocircumflex/odieresis/otilde/uacute/ugrave/ucircumflex +/udieresis/dagger/degree/cent/sterling/section/bullet/paragraph/germandbls +/registered/copyright/trademark/acute/dieresis/.notdef/AE/Oslash +/.notdef/plusminus/.notdef/.notdef/yen/mu/.notdef/.notdef +/.notdef/.notdef/.notdef/ordfeminine/ordmasculine/.notdef/ae/oslash +/questiondown/exclamdown/logicalnot/.notdef/florin/.notdef/.notdef +/guillemotleft/guillemotright/ellipsis/.notdef/Agrave/Atilde/Otilde/OE/oe +/endash/emdash/quotedblleft/quotedblright/quoteleft/quoteright/divide +/.notdef/ydieresis/Ydieresis/fraction/currency/guilsinglleft/guilsinglright +/fi/fl/daggerdbl/periodcentered/quotesinglbase/quotedblbase/perthousand +/Acircumflex/Ecircumflex/Aacute/Edieresis/Egrave/Iacute/Icircumflex +/Idieresis/Igrave/Oacute/Ocircumflex/.notdef/Ograve/Uacute/Ucircumflex +/Ugrave/dotlessi/circumflex/tilde/macron/breve/dotaccent/ring/cedilla +/hungarumlaut/ogonek/caron +]/_Courier-Bold/Courier-Bold Z +%%EndEncoding +%%EndSetup +0 0 0 0 k +0 0 0 1 K +0 i +0 J 0 j 1 w 4 M []0 d +%%Note: +487.5 367.5 m +487.5 601.5 L +145.5 601.5 L +145.5 367.5 L +487.5 367.5 L +b +145.5 601.5 m +487 368 l +B +487 601.5 m +145 368 l +B +0.5 w +450.5 478 m +450.5 494 L +182 494 L +182 478 L +450.5 478 L +b +u +0 0 0 1 k +1 w +/_Courier-Bold 12 14.5 0 0 z +[1 0 0 1 187.402 482]e +(Encapsulated Postscript \(EPS\) Figure)t +T +U +%%PageTrailer +%%Trailer +_E end +%%EOF + +%%EndDocument + @endspecial 141 x Fo(Fig.)d(4)92 b(Comparison)34 b(of)e(steady)g +(normal)h(force)g(co)r(e\016-)1984 1293 y(cien)n(t)h(as)f(a)h(function) +i(of)d(angle)i(of)e(attac)n(k)h(with)h(exp)r(eri-)1984 +1384 y(men)n(tal)29 b(data)h(of)g(W)-7 b(o)r(o)r(ds)2836 +1353 y Ff(10)1984 1545 y Fr(largely)33 b(due)i(to)g(the)h(p)r(osition)f +(of)g(the)g(lee-side)f(separation)1984 1644 y(line|a)d(viscous)f +(phenomenon.)47 b(Since)31 b(the)g(computed)h(re-)1984 +1744 y(sults)h(are)f(mo)r(deling)g(in)n(viscid)h(\015o)n(w,)h(the)f +(only)f(mec)n(hanism)1984 1843 y(for)c(\015o)n(w)h(separation)e(is)j +(the)f(n)n(umerical)f(dissipation)h(in)g(the)1984 1943 +y(sc)n(heme.)78 b(Th)n(us,)45 b(the)d(exact)f(lo)r(cation)g(of)h(the)g +(computed)1984 2043 y(separation)32 b(line)i(is)g(highly)f(grid)g(and)h +(sc)n(heme)f(dep)r(enden)n(t.)1984 2142 y(Comp)r(ounding)26 +b(this)g(is)g(the)g(fact)h(that)f(the)g(lee-side)g(separa-)1984 +2242 y(tion)g(line)g(nearly)f(encompasses)g(the)h(length)h(of)f(the)g +(v)n(ehicle;)1984 2342 y(and)21 b(th)n(us,)h(a)f(sligh)n(t)f(deviation) +h(can)f(mak)n(e)h(a)f(large)g(di\013erence)1984 2441 +y(in)28 b(the)g(in)n(tegrated)e(co)r(e\016cien)n(ts.)1984 +2591 y Fo(Unsteady)j(Flo)n(w)2067 2714 y Fr(Figure)40 +b(5)g(compares)f(the)i(normal)f(force)f(co)r(e\016cien)n(t)i(of)1984 +2814 y(b)r(oth)29 b(the)h(steady)e(and)h(unsteady)g(calculations.)40 +b(The)29 b(solid)1984 2914 y(line)34 b(represen)n(ts)f(the)i(unsteady)f +(results)g(and)h(the)g(sym)n(b)r(ols)1984 3013 y(are)29 +b(the)i(steady-\015o)n(w)e(results.)44 b(Readily)30 b(discernible)g(is) +g(the)1984 3113 y(fact)36 b(that)g(the)g(steady)f(and)h(unsteady)f +(results)g(are)g(signif-)1984 3212 y(ican)n(tly)45 b(di\013eren)n(t.)93 +b(The)46 b(time-dep)r(enden)n(t)h(results)e(ha)n(v)n(e)1984 +3312 y(the)g(time)g(lag)e(b)r(eha)n(vior)g(exp)r(ected)i(for)f(mo)r +(derately)g(un-)1984 3412 y(steady)k(\015o)n(w:)77 b(sho)n(wing)47 +b(the)i(same)f(general)f(qualitativ)n(e)1984 3511 y(trend)31 +b(throughout)g(the)h(angle-of-attac)n(k)c(range,)j(but)h(with)1984 +3611 y(the)46 b(unsteady)g(results)f(lagging)f(b)r(ehind)j(the)f +(steady)g(re-)1984 3711 y(sults.)89 b(Other)45 b(aero)r(dynamic)f(co)r +(e\016cien)n(ts)g(sho)n(w)h(similar)1984 3810 y(di\013erences.)2384 +3780 y Fp(9)1984 3961 y Fo(Flo)n(w)29 b(Asymmetry)2067 +4083 y Fr(As)k(do)r(cumen)n(ted)g(in)h(Ref.)g(9,)g(no)f(appreciable)f +(asymme-)1984 4183 y(tries)k(w)n(ere)g(found)h(for)f(the)h(steady)f +(\015o)n(w)g(cases)g(computed)1984 4283 y(although)c(they)i(w)n(ere)e +(presen)n(t)h(in)g(the)h(exp)r(erimen)n(tal)e(data)1984 +4382 y(of)18 b(W)-7 b(o)r(o)r(ds.)2337 4352 y Fp(10)2442 +4382 y Fr(Ho)n(w)n(ev)n(er,)18 b(for)g(the)h(unsteady)g(case,)g +(asymmet-)1984 4482 y(ric)31 b(\015o)n(w)f(is)h(apparen)n(t)f(as)h(sho) +n(wn)f(in)i(Figuref:uasym.)47 b(This)1984 4582 y(\014gure)35 +b(sho)n(ws)h(the)g(app)r(earance)f(of)h(a)g(non-zero)f(side-force)1984 +4681 y(similar)f(to)h(that)g(rep)r(orted)f(for)h Fl(ste)l(ady)g +Fr(\015o)n(w)g(b)n(y)f(W)-7 b(o)r(o)r(ds.)3863 4651 y +Fp(10)1984 4781 y Fr(The)39 b(most)g(signi\014can)n(t)g(manifestations) +g(of)g(the)h(asymme-)1984 4880 y(tries)27 b(o)r(ccur)f(in)i(the)g(90)e +(to)h(135)f(deg)h(angle-of-attac)n(k)e(range.)2447 5106 +y Ft(Concluding)37 b(Remarks)2067 5229 y Fr(The)c(ob)5 +b(jectiv)n(e)33 b(of)g(the)h(presen)n(t)f(w)n(ork)f(w)n(as)g(to)i(fo)r +(cus)f(an)1984 5329 y(unsteady)42 b(CFD)i(metho)r(d)g(on)e(the)i +(prediction)e(of)h(VTVL)1984 5428 y(v)n(ehicle)c(aero)r(dynamics)g +(during)g(a)h(pitc)n(h-o)n(v)n(er)e(maneuv)n(er.)1808 +5578 y Fg(3)25 b(of)g(5)p 1759 5642 300 2 v 737 5736 +a(American)g(Institute)h(of)f(Aer)o(ona)o(utics)f(and)h(Astr)o(ona)o +(utics)h(P)-6 b(aper)25 b(98{0879)p eop +%%Page: 4 5 +4 4 bop -116 2495 a @beginspecial 144 @llx 367 @lly 488 +@urx 602 @ury 4860 @rwi @setspecial +%%BeginDocument: smpfig.eps +%!PS-Adobe-2.0 EPSF-1.2 +%%Creator:Adobe Illustrator(TM) 1.1 +%%For: (RICHARD A WHELESS) (NASA LANGLEY) +%%Title: (EPS) +%%CreationDate: (2/9/99) (3:01 PM) +%%DocumentProcessColors: Black +%%DocumentFonts: Courier-Bold +%%DocumentProcSets: Adobe_Illustrator_1.1 0 0 +%%BoundingBox:144 367 488 602 +%%ColorUsage: Black&White +%AI3_IncludePlacedImages +%%TemplateBox:306 396 306 396 +%%TileBox: 30 31 582 761 +%%DocumentPreview: Header +%%EndComments +%%BeginProcSet:Adobe_Illustrator_1.1 0 0 +/Adobe_Illustrator_1.1 dup 100 dict def load begin +/Version 0 def +/Revision 0 def +/bdef {bind def} bind def +/ldef {load def} bdef +/xdef {exch def} bdef +/_K {3 index add neg dup 0 lt {pop 0} if 3 1 roll} bdef +/_k /setcmybcolor where +{/setcmybcolor get} {{1 sub 4 1 roll _K _K _K setrgbcolor pop} bind} ifelse def +/g {/_b xdef /p {_b setgray} def} bdef +/G {/_B xdef /P {_B setgray} def} bdef +/k {/_b xdef /_y xdef /_m xdef /_c xdef /p {_c _m _y _b _k} def} bdef +/K {/_B xdef /_Y xdef /_M xdef /_C xdef /P {_C _M _Y _B _k} def} bdef +/d /setdash ldef +/_i currentflat def +/i {dup 0 eq {pop _i} if setflat} bdef +/j /setlinejoin ldef +/J /setlinecap ldef +/M /setmiterlimit ldef +/w /setlinewidth ldef +/_R {.25 sub round .25 add} bdef +/_r {transform _R exch _R exch itransform} bdef +/c {_r curveto} bdef +/C /c ldef +/v {currentpoint 6 2 roll _r curveto} bdef +/V /v ldef +/y {_r 2 copy curveto} bdef +/Y /y ldef +/l {_r lineto} bdef +/L /l ldef +/m {_r moveto} bdef +/_e [] def +/_E {_e length 0 ne {gsave 0 g 0 G 0 i 0 J 0 j 1 w 10 M [] 0 d +/Courier 20 0 0 1 z [0.966 0.259 -0.259 0.966 +_e 0 get _e 2 get add 2 div _e 1 get _e 3 get add 2 div] e _f t T grestore} if} bdef +/_fill {{fill} stopped +{/_e [pathbbox] def /_f (ERROR: can't fill, increase flatness) def n _E} if} bdef +/_stroke {{stroke} stopped +{/_e [pathbbox] def /_f (ERROR: can't stroke, increase flatness) def n _E} if} bdef +/n /newpath ldef +/N /n ldef +/F {p _fill} bdef +/f {closepath F} bdef +/S {P _stroke} bdef +/s {closepath S} bdef +/B {gsave F grestore S} bdef +/b {closepath B} bdef +/_s /ashow ldef +/_S {(?) exch {2 copy 0 exch put pop dup false charpath currentpoint _g setmatrix +_stroke _G setmatrix moveto 3 copy pop rmoveto} forall pop pop pop n} bdef +/_A {_a moveto _t exch 0 exch} bdef +/_L {0 _l neg translate _G currentmatrix pop} bdef +/_w {dup stringwidth exch 3 -1 roll length 1 sub _t mul add exch} bdef +/_z [{0 0} bind {dup _w exch neg 2 div exch neg 2 div} bind {dup _w exch neg exch neg} bind] def +/z {_z exch get /_a xdef /_t xdef /_l xdef exch findfont exch scalefont setfont} bdef +/_g matrix def +/_G matrix def +/_D {_g currentmatrix pop gsave concat _G currentmatrix pop} bdef +/e {_D p /t {_A _s _L} def} bdef +/r {_D P /t {_A _S _L} def} bdef +/a {_D /t {dup p _A _s P _A _S _L} def} bdef +/o {_D /t {pop _L} def} bdef +/T {grestore} bdef +/u {} bdef +/U {} bdef +/Z {findfont begin currentdict dup length dict begin +{1 index /FID ne {def} {pop pop} ifelse} forall /FontName exch def dup length 0 ne +{/Encoding Encoding 256 array copy def 0 exch {dup type /nametype eq +{Encoding 2 index 2 index put pop 1 add} {exch pop} ifelse} forall} if pop +currentdict dup end end /FontName get exch definefont pop} bdef +end +%%EndProcSet +%%EndProlog +%%BeginSetup +Adobe_Illustrator_1.1 begin +n +%%BeginEncoding: _Courier-Bold Courier-Bold +[39/quotesingle 96/grave 128/Adieresis/Aring/Ccedilla/Eacute/Ntilde/Odieresis +/Udieresis/aacute/agrave/acircumflex/adieresis/atilde/aring/ccedilla/eacute +/egrave/ecircumflex/edieresis/iacute/igrave/icircumflex/idieresis/ntilde +/oacute/ograve/ocircumflex/odieresis/otilde/uacute/ugrave/ucircumflex +/udieresis/dagger/degree/cent/sterling/section/bullet/paragraph/germandbls +/registered/copyright/trademark/acute/dieresis/.notdef/AE/Oslash +/.notdef/plusminus/.notdef/.notdef/yen/mu/.notdef/.notdef +/.notdef/.notdef/.notdef/ordfeminine/ordmasculine/.notdef/ae/oslash +/questiondown/exclamdown/logicalnot/.notdef/florin/.notdef/.notdef +/guillemotleft/guillemotright/ellipsis/.notdef/Agrave/Atilde/Otilde/OE/oe +/endash/emdash/quotedblleft/quotedblright/quoteleft/quoteright/divide +/.notdef/ydieresis/Ydieresis/fraction/currency/guilsinglleft/guilsinglright +/fi/fl/daggerdbl/periodcentered/quotesinglbase/quotedblbase/perthousand +/Acircumflex/Ecircumflex/Aacute/Edieresis/Egrave/Iacute/Icircumflex +/Idieresis/Igrave/Oacute/Ocircumflex/.notdef/Ograve/Uacute/Ucircumflex +/Ugrave/dotlessi/circumflex/tilde/macron/breve/dotaccent/ring/cedilla +/hungarumlaut/ogonek/caron +]/_Courier-Bold/Courier-Bold Z +%%EndEncoding +%%EndSetup +0 0 0 0 k +0 0 0 1 K +0 i +0 J 0 j 1 w 4 M []0 d +%%Note: +487.5 367.5 m +487.5 601.5 L +145.5 601.5 L +145.5 367.5 L +487.5 367.5 L +b +145.5 601.5 m +487 368 l +B +487 601.5 m +145 368 l +B +0.5 w +450.5 478 m +450.5 494 L +182 494 L +182 478 L +450.5 478 L +b +u +0 0 0 1 k +1 w +/_Courier-Bold 12 14.5 0 0 z +[1 0 0 1 187.402 482]e +(Encapsulated Postscript \(EPS\) Figure)t +T +U +%%PageTrailer +%%Trailer +_E end +%%EOF + +%%EndDocument + @endspecial 141 x Fo(Fig.)37 b(5)103 b(Comparison)38 +b(of)g(steady)e(and)i(unsteady)f(normal)i(force)e(co)r(e\016cien)n(ts)h +(as)g(a)f(function)i(of)f(angle)f(of)h(attac)n(k.)-116 +2728 y Fe(Example)43 b(of)h(a)g(\014gur)l(e)g(that)g(sp)l(ans)g(b)l +(oth)f(c)l(olumns.)77 b(The)45 b(danger)e(is)h(that)g(the)f(\014gur)l +(e)h(numb)l(ering)e(may)i(b)l(e)f(out)h(of)-116 2819 +y(or)l(der)39 b(sinc)l(e)e(the)i(single-c)l(olumn)d(\015o)l(at)i(and)h +(double-c)l(olumn)f(\015o)l(at)g(c)l(ounters)g(ar)l(e)h(not)f(c)l(onne) +l(cte)l(d)e(when)i(it)g(c)l(omes)g(to)-116 2910 y(determining)28 +b(plac)l(ement)i(or)l(der.)40 b(Y)-7 b(ou)31 b(c)l(an)f(c)l(orr)l(e)l +(ct)g(this)h(known)f(\\fe)l(atur)l(e")i(of)f(L)2601 2893 +y Fd(A)2631 2910 y Fe(T)2675 2927 y(E)2721 2910 y(X)g(by)f(using)h(the) +g Fc(fix2col)h Fe(p)l(ackage.)-116 4326 y @beginspecial +144 @llx 367 @lly 488 @urx 602 @ury 2340 @rwi @setspecial +%%BeginDocument: smpfig.eps +%!PS-Adobe-2.0 EPSF-1.2 +%%Creator:Adobe Illustrator(TM) 1.1 +%%For: (RICHARD A WHELESS) (NASA LANGLEY) +%%Title: (EPS) +%%CreationDate: (2/9/99) (3:01 PM) +%%DocumentProcessColors: Black +%%DocumentFonts: Courier-Bold +%%DocumentProcSets: Adobe_Illustrator_1.1 0 0 +%%BoundingBox:144 367 488 602 +%%ColorUsage: Black&White +%AI3_IncludePlacedImages +%%TemplateBox:306 396 306 396 +%%TileBox: 30 31 582 761 +%%DocumentPreview: Header +%%EndComments +%%BeginProcSet:Adobe_Illustrator_1.1 0 0 +/Adobe_Illustrator_1.1 dup 100 dict def load begin +/Version 0 def +/Revision 0 def +/bdef {bind def} bind def +/ldef {load def} bdef +/xdef {exch def} bdef +/_K {3 index add neg dup 0 lt {pop 0} if 3 1 roll} bdef +/_k /setcmybcolor where +{/setcmybcolor get} {{1 sub 4 1 roll _K _K _K setrgbcolor pop} bind} ifelse def +/g {/_b xdef /p {_b setgray} def} bdef +/G {/_B xdef /P {_B setgray} def} bdef +/k {/_b xdef /_y xdef /_m xdef /_c xdef /p {_c _m _y _b _k} def} bdef +/K {/_B xdef /_Y xdef /_M xdef /_C xdef /P {_C _M _Y _B _k} def} bdef +/d /setdash ldef +/_i currentflat def +/i {dup 0 eq {pop _i} if setflat} bdef +/j /setlinejoin ldef +/J /setlinecap ldef +/M /setmiterlimit ldef +/w /setlinewidth ldef +/_R {.25 sub round .25 add} bdef +/_r {transform _R exch _R exch itransform} bdef +/c {_r curveto} bdef +/C /c ldef +/v {currentpoint 6 2 roll _r curveto} bdef +/V /v ldef +/y {_r 2 copy curveto} bdef +/Y /y ldef +/l {_r lineto} bdef +/L /l ldef +/m {_r moveto} bdef +/_e [] def +/_E {_e length 0 ne {gsave 0 g 0 G 0 i 0 J 0 j 1 w 10 M [] 0 d +/Courier 20 0 0 1 z [0.966 0.259 -0.259 0.966 +_e 0 get _e 2 get add 2 div _e 1 get _e 3 get add 2 div] e _f t T grestore} if} bdef +/_fill {{fill} stopped +{/_e [pathbbox] def /_f (ERROR: can't fill, increase flatness) def n _E} if} bdef +/_stroke {{stroke} stopped +{/_e [pathbbox] def /_f (ERROR: can't stroke, increase flatness) def n _E} if} bdef +/n /newpath ldef +/N /n ldef +/F {p _fill} bdef +/f {closepath F} bdef +/S {P _stroke} bdef +/s {closepath S} bdef +/B {gsave F grestore S} bdef +/b {closepath B} bdef +/_s /ashow ldef +/_S {(?) exch {2 copy 0 exch put pop dup false charpath currentpoint _g setmatrix +_stroke _G setmatrix moveto 3 copy pop rmoveto} forall pop pop pop n} bdef +/_A {_a moveto _t exch 0 exch} bdef +/_L {0 _l neg translate _G currentmatrix pop} bdef +/_w {dup stringwidth exch 3 -1 roll length 1 sub _t mul add exch} bdef +/_z [{0 0} bind {dup _w exch neg 2 div exch neg 2 div} bind {dup _w exch neg exch neg} bind] def +/z {_z exch get /_a xdef /_t xdef /_l xdef exch findfont exch scalefont setfont} bdef +/_g matrix def +/_G matrix def +/_D {_g currentmatrix pop gsave concat _G currentmatrix pop} bdef +/e {_D p /t {_A _s _L} def} bdef +/r {_D P /t {_A _S _L} def} bdef +/a {_D /t {dup p _A _s P _A _S _L} def} bdef +/o {_D /t {pop _L} def} bdef +/T {grestore} bdef +/u {} bdef +/U {} bdef +/Z {findfont begin currentdict dup length dict begin +{1 index /FID ne {def} {pop pop} ifelse} forall /FontName exch def dup length 0 ne +{/Encoding Encoding 256 array copy def 0 exch {dup type /nametype eq +{Encoding 2 index 2 index put pop 1 add} {exch pop} ifelse} forall} if pop +currentdict dup end end /FontName get exch definefont pop} bdef +end +%%EndProcSet +%%EndProlog +%%BeginSetup +Adobe_Illustrator_1.1 begin +n +%%BeginEncoding: _Courier-Bold Courier-Bold +[39/quotesingle 96/grave 128/Adieresis/Aring/Ccedilla/Eacute/Ntilde/Odieresis +/Udieresis/aacute/agrave/acircumflex/adieresis/atilde/aring/ccedilla/eacute +/egrave/ecircumflex/edieresis/iacute/igrave/icircumflex/idieresis/ntilde +/oacute/ograve/ocircumflex/odieresis/otilde/uacute/ugrave/ucircumflex +/udieresis/dagger/degree/cent/sterling/section/bullet/paragraph/germandbls +/registered/copyright/trademark/acute/dieresis/.notdef/AE/Oslash +/.notdef/plusminus/.notdef/.notdef/yen/mu/.notdef/.notdef +/.notdef/.notdef/.notdef/ordfeminine/ordmasculine/.notdef/ae/oslash +/questiondown/exclamdown/logicalnot/.notdef/florin/.notdef/.notdef +/guillemotleft/guillemotright/ellipsis/.notdef/Agrave/Atilde/Otilde/OE/oe +/endash/emdash/quotedblleft/quotedblright/quoteleft/quoteright/divide +/.notdef/ydieresis/Ydieresis/fraction/currency/guilsinglleft/guilsinglright +/fi/fl/daggerdbl/periodcentered/quotesinglbase/quotedblbase/perthousand +/Acircumflex/Ecircumflex/Aacute/Edieresis/Egrave/Iacute/Icircumflex +/Idieresis/Igrave/Oacute/Ocircumflex/.notdef/Ograve/Uacute/Ucircumflex +/Ugrave/dotlessi/circumflex/tilde/macron/breve/dotaccent/ring/cedilla +/hungarumlaut/ogonek/caron +]/_Courier-Bold/Courier-Bold Z +%%EndEncoding +%%EndSetup +0 0 0 0 k +0 0 0 1 K +0 i +0 J 0 j 1 w 4 M []0 d +%%Note: +487.5 367.5 m +487.5 601.5 L +145.5 601.5 L +145.5 367.5 L +487.5 367.5 L +b +145.5 601.5 m +487 368 l +B +487 601.5 m +145 368 l +B +0.5 w +450.5 478 m +450.5 494 L +182 494 L +182 478 L +450.5 478 L +b +u +0 0 0 1 k +1 w +/_Courier-Bold 12 14.5 0 0 z +[1 0 0 1 187.402 482]e +(Encapsulated Postscript \(EPS\) Figure)t +T +U +%%PageTrailer +%%Trailer +_E end +%%EOF + +%%EndDocument + @endspecial 141 x Fo(Fig.)c(6)84 b(Unsteady)27 b(\015o)n(w)h +(asymmetry:)37 b(side)28 b(force)h(co)r(ef-)-116 4558 +y(\014cien)n(t)h(as)f(a)h(function)h(of)f(angle)g(of)f(attac)n(k.)-116 +4731 y Fr(This)c(w)n(as)g(accomplished)f(through)h(the)h(use)f(of)g +(the)h(in)n(viscid)-116 4831 y(3D3U)34 b(co)r(de)291 +4801 y Fp(19)396 4831 y Fr(A)i(series)d(of)i(steady)g(solutions)f(at)g +(discrete)-116 4930 y(p)r(oin)n(ts)44 b(in)g(the)g(maneuv)n(er)f(w)n +(ere)g(computed)i(and)e(it)i(w)n(as)-116 5030 y(sho)n(wn)21 +b(that,)i(ev)n(en)e(for)g(the)h(unrealistically)f(slo)n(w)g(pitc)n(h-o) +n(v)n(er)-116 5130 y(rate)i(studied,)i(unsteady)e(e\013ects)h(w)n(ere)f +(large.)34 b(More)22 b(imp)r(or-)-116 5229 y(tan)n(tly)-7 +b(,)20 b(the)f(rotation)f(maneuv)n(er)f(creates)h(\015o)n(w)g +(asymmetries)-116 5329 y(whic)n(h)31 b(lead)h(to)f(side)h(forces)e(not) +i(apparen)n(t)e(for)h(the)h(steady)-116 5428 y(cases.)2067 +3076 y(As)38 b(this)g(is)f(an)h(exploratory)d(study)-7 +b(,)40 b(there)e(is)g(certainly)1984 3176 y(ro)r(om)28 +b(for)g(future)h(w)n(ork.)39 b(The)29 b(follo)n(wing)f(is)h(just)g(a)f +(handful)1984 3276 y(of)35 b(extensions)g(whic)n(h)g(w)n(ould)g(b)r(e)g +(necessary)f(to)h(create)f(an)1984 3375 y(e\013ectiv)n(e)28 +b(design)h(to)r(ol:)39 b(incorp)r(orating)26 b(viscous)i(e\013ects,)i +(al-)1984 3475 y(lo)n(wing)20 b(mo)n(v)-5 b(able)21 b(con)n(trol)f +(surfaces,)i(coupling)f(a)g(six-degree-)1984 3575 y(of-freedom)j(rigid) +g(b)r(o)r(dy)i(dynamics)f(solv)n(er,)f(adding)g(con)n(trol)1984 +3674 y(la)n(w,)j(and)g(incorp)r(orating)f(an)h(adaptiv)n(e)g(grid)g +(capabilit)n(y)-7 b(.)2697 3854 y Ft(References)2103 +3927 y Fb(1)2137 3951 y Fi(Bek)n(ey)h(,)27 b(I.,)e(P)n(o)n(w)n(ell,)g +(R.,)f(and)i(Austin,)f(R.,)g(\\NASA)g(Studies)h(Ac-)1984 +4030 y(cess)e(to)g(Space,")h Fa(A)l(er)l(osp)l(ac)l(e)j(A)n(meric)l(a)5 +b Fi(,)24 b(Ma)n(y)g(1994,)g(pp.)f(38{43.)2103 4093 y +Fb(2)2137 4117 y Fi(Dornheim,)g(M.)g(A.,)g(\\NASA)g(Aw)n(ards)h(RL)-8 +b(V)24 b(Con)n(tracts,")h Fa(A)n(via-)1984 4196 y(tion)g(We)l(ek)h(&)f +(Sp)l(ac)l(e)i(T)-5 b(e)l(chnolo)l(gy)6 b Fi(,)23 b(June)i(1994,)f(pp.) +g(22{23.)2103 4259 y Fb(3)2137 4283 y Fi(Austin,)c(R.)f(E.)g(and)g(Co)r +(ok,)i(S.)e(A.,)g(\\SSTO)h(Ro)r(c)n(k)n(ets:)30 b(Streamlin-)1984 +4362 y(ing)18 b(Access)h(to)h(Space,")g Fa(A)l(er)l(osp)l(ac)l(e)j(A)n +(meric)l(a)5 b Fi(,)21 b(No)n(v.)d(1994,)i(pp.)f(34{38.)2103 +4425 y Fb(4)2137 4449 y Fi(Dornheim,)28 b(M.)g(A.,)h(\\DC-X)f +(Demonstrates)h(Key)g(Maneuv)n(er,")1984 4528 y Fa(A)n(viation)d(We)l +(ek)f(&)g(Sp)l(ac)l(e)i(T)-5 b(e)l(chnolo)l(gy)6 b Fi(,)24 +b(July)f(1995,)i(pp.)e(56{59.)2103 4591 y Fb(5)2137 4615 +y Fi(Da)n(vid,)52 b(L.,)f(\\DC-X)46 b(Completes)g(Piv)n(ot)h(T)-6 +b(est)47 b(Ov)n(er)g(White)1984 4694 y(Sands,")24 b Fa(Sp)l(ac)l(e)j +(News)5 b Fi(,)23 b(V)-6 b(ol.)23 b(6,)h(No.)f(27,)h(July)g(1995,)g +(pp.)f(1,20.)2103 4757 y Fb(6)2137 4781 y Fi(Dornheim,)32 +b(M.)f(A.,)i(\\DC-X)e(Holds)g(Promise;)j(Big)d(Questions)1984 +4860 y(Remain,")50 b Fa(A)n(viation)c(We)l(ek)g(&)f(Sp)l(ac)l(e)i(T)-5 +b(e)l(chnolo)l(gy)6 b Fi(,)52 b(Aug.)45 b(1995,)1984 +4939 y(pp.)23 b(56{59.)2103 5002 y Fb(7)2137 5026 y Fi(O'Leary)-6 +b(,)25 b(C.)f(O.,)h(W)-6 b(eir,)25 b(B.,)f(and)i(W)-6 +b(alk)n(er,)25 b(J.)g(M.,)f(\\A)h(New)g(Rig)1984 5105 +y(for)e(the)i(Measuremen)n(t)f(of)f(Rotary)i(and)f(T)-6 +b(ranslational)24 b(Deriv)l(ativ)n(es,")1984 5184 y(ICAS)18 +b(94{3.4.1,)h(Sept.)g(1994,)g(In)g(19th)g(Congress)f(of)f(the)i(In)n +(ternational)1984 5262 y(Council)24 b(of)f(the)h(Aeronautical)h +(Sciences)g(ICAS)f(Pro)r(ceedings.)2103 5326 y Fb(8)2137 +5350 y Fi(Edw)n(ards,)38 b(J.)e(W.)g(and)g(Malone,)i(J.)e(B.,)i +(\\Curren)n(t)e(Status)h(of)1984 5428 y(Computational)22 +b(Metho)r(ds)g(for)f(T)-6 b(ransonic)22 b(Unsteady)h(Aero)r(dynamics) +1808 5578 y Fg(4)i(of)g(5)p 1759 5642 300 2 v 737 5736 +a(American)g(Institute)h(of)f(Aer)o(ona)o(utics)f(and)h(Astr)o(ona)o +(utics)h(P)-6 b(aper)25 b(98{0879)p eop +%%Page: 5 6 +5 5 bop -116 -188 a Fi(and)37 b(Aero)r(elastic)g(Applications,")j +Fa(A)n(GARD)e(Confer)l(enc)l(e)g(Pr)l(o)l(c)l(e)l(e)l(d-)-116 +-110 y(ings:)29 b(T)-5 b(r)l(ansonic)19 b(Unste)l(ady)g(A)l(er)l(o)l +(dynamics)h(and)f(A)l(er)l(o)l(elasticity)6 b Fi(,)17 +b(No.)-116 -31 y(507,)24 b(Marc)n(h)f(1992,)i(pp.)e(1{1|1{24.)3 +33 y Fb(9)37 56 y Fi(Kleb,)77 b(W.)67 b(L.,)76 b(\\Aero)r(dynamic)67 +b(Characteristics)g(of)f(an)-116 135 y(Aerospace)35 b(V)-6 +b(ehicle)34 b(During)f(a)h(Subsonic)h(Pitc)n(h-Ov)n(er)f(Maneuv)n(er,") +-116 214 y(AIAA)23 b(P)n(ap)r(er)h(96{0825,)h(Jan.)f(1996.)-28 +278 y Fb(10)37 301 y Fi(W)-6 b(o)r(o)r(ds,)28 b(W.)e(C.)g(and)h +(Merski,)f(N.)g(R.,)g(\\Aero)r(dynamic)h(Charac-)-116 +380 y(teristics)21 b(of)g(a)g(V)-6 b(ertical)21 b(T)-6 +b(ak)n(eo\013)23 b(/)e(V)-6 b(ertical)21 b(Landing)h(\(VTVL\))g(Single) +-116 459 y(Stage)28 b(to)f(Orbit)f(V)-6 b(ehicle)27 b(from)e(M)h(=)g +(0.1)h(to)g(10,")h(AIAA)e(P)n(ap)r(er)h(95{)-116 538 +y(1828,)d(1995.)-28 602 y Fb(11)37 625 y Fi(Stein)n(brenner,)42 +b(J.)37 b(P)-6 b(.,)40 b(Cha)n(wner,)h(J.)c(R.,)j(and)e(F)-6 +b(outs,)42 b(C.)36 b(L.,)-116 704 y(\\The)24 b(GRIDGEN)h(3D)f(Multiple) +g(Blo)r(c)n(k)g(Grid)f(Generation)j(System,")-116 783 +y(W)-6 b(righ)n(t)21 b(Researc)n(h)h(and)f(Dev)n(elopmen)n(t)h(Cen)n +(ter)g(Rep)r(ort)f(WRDC{TR{)-116 862 y(90{3022,)k(Oct.)f(1989.)-28 +925 y Fb(12)37 949 y Fi(Samareh-Ab)r(olhassani,)h(J.,)h(\\GridT)-6 +b(o)r(ol:)36 b(A)25 b(Surface)i(Mo)r(deling)-116 1028 +y(and)33 b(Grid)f(Generation)j(T)-6 b(o)r(ol,")35 b Fa(Pr)l(o)l(c)l(e)l +(e)l(dings)h(of)e(the)g(Workshop)i(on)-116 1107 y(Surfac)l(e)22 +b(Mo)l(deling,)h(Grid)e(Gener)l(ation,)i(and)g(R)l(elate)l(d)f(Issues)g +(in)f(CFD)-116 1186 y(Solutions)5 b Fi(,)24 b(NASA)g(CP{3291,)g(Ma)n(y) +g(1995,)g(pp.)g(821{831.)-28 1249 y Fb(13)37 1273 y Fi(P)n(eraire,)k +(J.,)h(Morgan,)f(K.,)g(and)h(P)n(eiro,)f(J.,)g(\\Unstructured)i(Fi-) +-116 1352 y(nite)37 b(Elemen)n(t)f(Mesh)h(Generation)h(and)f(Adaptiv)n +(e)g(Pro)r(cedures)g(for)-116 1430 y(CFD,")27 b Fa(A)n(GARD)i(Confer)l +(enc)l(e)h(Pr)l(o)l(c)l(e)l(e)l(dings:)42 b(Applic)l(ation)31 +b(of)f(Mesh)-116 1509 y(Gener)l(ation)c(to)f(Complex)h(3-D)f +(Con\014gur)l(ations)5 b Fi(,)24 b(No.)f(464,)h(1990,)g(pp.)-116 +1588 y(18.1{18.12.)-28 1652 y Fb(14)37 1675 y Fi(Kennon,)j(S.)e(R.,)g +(Mey)n(ering,)h(J.)f(M.,)g(Berry)-6 b(,)25 b(C.)g(W.,)g(and)i(Oden,) +-116 1754 y(J.)20 b(T.,)h(\\Geometry-Based)g(Delauna)n(y)h(T)-6 +b(etrahedralization)22 b(and)g(Mesh)-116 1833 y(Mo)n(v)n(emen)n(t)30 +b(Strategies)h(for)f(Multi-Bo)r(dy)f(CFD,")h(AIAA)g(P)n(ap)r(er)g(92{) +-116 1912 y(4575,)24 b(Aug.)g(1992.)-28 1976 y Fb(15)37 +1999 y Fi(Y)-6 b(oshinaga,)36 b(T.,)f(T)-6 b(ate,)36 +b(A.,)e(and)g(Sekine,)i(H.,)f(\\Side)e(F)-6 b(orce)34 +b(of)-116 2078 y(Blun)n(ted)i(Circular)f(Cylinders)g(at)i(High)f +(Angles)f(of)h(A)n(ttac)n(k)h(in)f(Su-)-116 2157 y(p)r(ersonic)h(Flo)n +(w,")j(AIAA)c(P)n(ap)r(er)h(94{3520,)42 b(Aug.)37 b(1994,)j(In)e(AIAA) +-116 2236 y(A)n(tmospheric)23 b(Fligh)n(t)h(Mec)n(hanics)g(Conference)h +(Pro)r(ceedings.)-28 2299 y Fb(16)37 2323 y Fi(Cobleigh,)36 +b(B.)c(R.,)j(\\High-Angle-of-A)n(ttac)n(k)f(Y)-6 b(a)n(wing)33 +b(Momen)n(t)-116 2402 y(Asymmetry)25 b(of)h(the)i(X-31)f(Aircraft)f +(from)f(Fligh)n(t)i(T)-6 b(est,")28 b(AIAA)f(P)n(a-)-116 +2481 y(p)r(er)f(94{1803,)j(June)e(1994,)h(In)f(12th)h(AIAA)e(Applied)g +(Aero)r(dynamics)-116 2560 y(Conference)e(Pro)r(ceedings.)-28 +2623 y Fb(17)37 2647 y Fi(Dusing,)f(D.)g(W.)g(and)h(Orkwis,)e(P)-6 +b(.)23 b(D.,)g(\\On)h(Computing)f(V)-6 b(ortex)-116 2726 +y(Asymmetries)15 b(Ab)r(out)k(Cones)f(at)g(Angle)g(of)g(A)n(ttac)n(k)h +(Using)f(the)g(Conical)-116 2804 y(Na)n(vier-Stok)n(es)23 +b(Equations,")h(AIAA)f(P)n(ap)r(er)g(93{3628,)i(Aug.)d(1993,)i(In)-116 +2883 y(AIAA)f(A)n(tmospheric)g(Fligh)n(t)h(Mec)n(hanics)g(Conference)h +(Pro)r(ceedings.)-28 2947 y Fb(18)37 2971 y Fi(Fisher,)h(D.)g(F.)f(and) +i(Cobleigh,)g(B.)e(R.,)h(\\Con)n(trolling)h(F)-6 b(oreb)r(o)r(dy)-116 +3049 y(Asymmetries)16 b(in)j(Fligh)n(t|Exp)r(erience)h(with)g(Boundary) +g(La)n(y)n(er)f(T)-6 b(ran-)-116 3128 y(sition)24 b(Strips,")h(AIAA)f +(P)n(ap)r(er)h(94{1826,)h(June)g(1994,)f(In)g(12th)h(AIAA)-116 +3207 y(Applied)d(Aero)r(dynamics)g(Conference)i(Pro)r(ceedings.)-28 +3271 y Fb(19)37 3294 y Fi(Batina,)57 b(J.)49 b(T.,)55 +b(\\Implicit)49 b(Up)n(wind)h(Solution)g(Algorithms)-116 +3373 y(for)28 b(Three-Dimensional)f(Unstructured)j(Meshes,")f +Fa(AIAA)i(Journal)7 b Fi(,)-116 3452 y(V)-6 b(ol.)29 +b(31,)i(No.)e(5,)i(Ma)n(y)e(1993,)j(pp.)e(801{805,)i(See)f(also)e(AIAA) +g(P)n(ap)r(er)-116 3531 y(92{0447.)1808 5578 y Fg(5)c(of)g(5)p +1759 5642 300 2 v 737 5736 a(American)g(Institute)h(of)f(Aer)o(ona)o +(utics)f(and)h(Astr)o(ona)o(utics)h(P)-6 b(aper)25 b(98{0879)p +eop +%%Trailer +end +userdict /end-hook known{end-hook}if +%%EOF diff --git a/macros/latex/contrib/aiaa/pre2004/demos/paper/smpaiaa.tex b/macros/latex/contrib/aiaa/pre2004/demos/paper/smpaiaa.tex new file mode 100644 index 0000000000..7f6216014c --- /dev/null +++ b/macros/latex/contrib/aiaa/pre2004/demos/paper/smpaiaa.tex @@ -0,0 +1,391 @@ +% +% latex2e adocument: smpaiaa.tex +% +% sample AIAA conference paper, journal article, +% journal note, and journal submission +% +% -- bil kleb <10 jan 97> +% + +\documentclass[cover]{aiaa}% options: paper, article, note, + % cover, and/or submit + +% note: until we reach \begin{document}, we're in the `preamble' + +% load items used by the aiaa class: + +% for a conference paper (`paper' option [default]): +\PaperNumber{98--0879} +\PaperNotice{\CopyrightD{1999}} +\CoverFigure{smpfig}% [optional cover figure] +\Conference{{\bfseries 36th AIAA Aerospace Sciences \\ + Meeting and Exhibit} \\ + January~12--15,~1998/Reno,~NV} + +% for journal submission (`submit' option): +\SubmitName{Kleb ET AL.\ (A10659)} + +% for journal simulation (`article' or `note' options): +\JournalName{Journal of Spacecraft and Rockets} +\JournalPage{39} +\JournalIssue{Volume~36, Number~2} +\JournalNotice{Presented as Paper~98--0879 at the AIAA + 36th Aerospace Sciences Meeting, Reno,~NV, + Jan.~12--15,~1998; received Feb.~13,~1998; + revision received Sept.~18,~1998; + accepted for publication Oct.~1,~1998. + \CopyrightD{1999}} + +% specific to journal article: +\ArticleIssue{Vol.~36, No.~2, March--April 1999}% first page +\ArticleHeader{Kleb ET AL.}% subsequent pages + +% specific to journal note: +\NoteHeader{J.Spacecraft, Vol.~36, No.~2: Engineering Notes} + +% load the title, author, and abstract for use with the \maketitle command + +\title{Simulation of an Aerospace Vehicle \\ + Pitch-Over Maneuver} + +\author{ +% +William L.~Kleb% +% + \thanks{Research Engineer, Aerothermodynamics Branch, + Aero- and Gas-Dynamics Division, + Research and Technology Group.} \\ +% + {\itshape NASA Langley Research Center, + Hampton,~VA~23681}\\[5pt] +% +A.~N.~Author% +% + \thanks{Deligent worker, + AIAA member.} +% +\ and Y.~F.~Anotherlongername% +% + \thanksibid{2} \\ % use same footnote as second author +% + {\itshape Someother Affliation, + Atown,~ST~98293} +} + +\abstract{{\em Note: this abstract does not appear when a +journal note simulation is the chosen option.} The objective of +the present work is to summarize the application of unsteady +computational fluid dynamic methods to the problem of predicting +verticle take-off/vertical landing vehicle aerodynamics during an +un-powered pitch-over maneuver. In addition to the +time-dependent simulation of a pitch-over maneuver, a series of +steady solutions at discrete points are also computed for +comparison with wind-tunnel measurements and as a means of +quantifying unsteady effects. As this application represents a +new challenge to unsteady computational fluid dynamics, +observations concerning grid resolution, far-field boundary +placement, temporal resolution, and the suitability of assuming +flow-field symmetry are discussed.} + + +\begin{document} + +\maketitle% create the cover page, title block, and notices + +\section{Nomenclature}% you could have this generated + % automatically via the nomenclature package + +\begin{tabbing} +12345678 \= Reynolds number based on length $s$ \kill +$c$ \> Sound speed, m/s \\ +$M$ \> Mach number \\ +$P$ \> Pressure, Pa \\ +$Re_s$ \> Reynolds number based on length $s$ \\ +$T$ \> Temperature, K \\ +$V$ \> Velocity, m/s \\ +$x,y,z$ \> Cartesian body axes, m \\ +$\alpha$ \> Angle of attack, deg \\ +$\eta$ \> Wall-normal distance, m \\ +$\rho$ \> Density, kg/m$^3$ +\end{tabbing} + +\subsection{Subscripts} +\begin{tabbing} +12345678 \= \kill +$tran$ \> Transition \\ +$w$ \> Wall \\ +$\infty$ \> Freestream +\end{tabbing} + +\subsection{Superscripts} +\begin{tabbing} +12345678 \= \kill +$0$ \> Fiduciary point \\ +$n\!+\!1$ \> Time level +\end{tabbing} + +\section{Introduction} + +\dropword NASA's Access to Space Study\cite{bekey:94ja} +recommends the development of a {\em fully}\ reusable launch +vehicle\cite{dornheim:94awst} to replace the aged Space +Shuttle. {\em The \verb+\dropword+ command created the hanging +capital letter and automatically capitalizes the rest of the +word.} A method of reaching this goal is to develop a vehicle +which does not rely on expendable boosters to reach orbit, a +single-stage-to-orbit vehicle\cite{austin:94ja}. One such +configuration being investigated is a Vertical Take-off and +Vertical Landing (VTVL) concept\cite{austin:94ja}. In one +scenario, the VTVL vehicle, upon completion of its mission in +low-Earth orbit, reenters nose first, decelerates to subsonic +speeds, and then performs a rotation +maneuver\cite{dornheim:95awst,david:95sn,dornheim:95awst2} to +land vertically. + + +Figure~\ref{f:trn2lndg} presents a schematic of the last portion +of a typical VTVL entry. +\begin{figure} + \incfig{smpfig} + \caption{Transition to landing for a VTVL vehicle.} + \label{f:trn2lndg} +\end{figure} +The pitch-over maneuver, which occurs near Mach 0.2, is +characterized by high angle of attack, unsteady, vortical flow. +Accurately predicting vehicle performance during this aerodynamic +pitch-over maneuver is quite challenging. While ground-based +facilities can readily predict the vehicle's aerodynamics at +discrete points during the maneuver, simulating the transient +motion in a wind tunnel is difficult.\cite{oleary:94cp} +Time-dependent Computational Fluid Dynamics (CFD) offers another +means of analyzing the pitch-over maneuver. The majority of work +in unsteady CFD has, however, been restricted to small amplitude, +harmonic variations in angle of attack in support of aeroelastic +flutter predictions.\cite{edwards:92cp} + +The objective of the present work is to summarize the application +of unsteady CFD methods to the problem of predicting VTVL vehicle +aerodynamics during an un-powered pitch-over maneuver (further +details are available in the companion conference +paper\cite{kleb:96cp}). In addition to the time-dependent +simulation of a pitch-over maneuver, a series of steady solutions +at discrete points are also computed for comparison with +wind-tunnel measurements and as a means of quantifying unsteady +effects. As this application represents a new challenge to +unsteady CFD, observations concerning grid resolution, far-field +boundary placement, temporal resolution, and the suitability of +assuming flow-field symmetry are documented in +Ref.~\citen{kleb:96cp}. + +\section{Geometry} + +The vehicle's fore body is an 8 deg half-angle sphere cone with +nose radius equal to 0.3 of the base radius. The aft body, +beginning at the 85 percent fuselage station, is a cylinder with +a partially squared-off cross-section producing flat ``slices'' +extending from the base of the vehicle to approximately the 60 +percent fuselage station. The vehicle has a fineness ratio of +6.4. A complete description of the vehicle geometry modeled has +been given by Woods in Ref.~\citen{woods:95cp}. + +{\em Through the generosity of Karen Bibb, we have a +demonstration of a subfigure situation. Note that with imbedded +labels you can refer to Fig.~\ref{fig:both} as a whole or +specifically, things in Fig.~\ref{fig:first} or +Fig.~\ref{fig:second}.} An early Lockheed-Martin X-33 +configuration was used in the remainder of the examples. The +full vehicle is shown in Fig.~\ref{fig:both}. +\begin{figure} + \begin{subfigmatrix}{1} + \subfigure[\bf First pretty picture.] + {\incfig{smpfig}\label{fig:first}} + \subfigure[\bf Second pretty picture.] + {\incfig{smpfig}\label{fig:second}} + \end{subfigmatrix} + \caption{Temperature distribution comparisons at various wing + semi-span stations as a function of chord. Whuh?} + \label{fig:both} +\end{figure} +This configuration (B1001A) was evaluated during +Phase I of the X-33 program. It has twin vertical tails, fins, +and outboard body flaps. The engines are modeled by the box-shaped +structure on the base. {\em We can also have a ``table'' of two, +or four, or more figures as in Fig.~\ref{fig:four}.} +\begin{figure} + \begin{subfigmatrix}{2} + \subfigure[\bf First pretty picture.] + {\incfig{smpfig}} + \subfigure[\bf Second pretty picture.] + {\incfig{smpfig}} + \subfigure[\bf Second pretty picture, again.] + {\incfig{smpfig}} + \subfigure[\bf First pretty picture, again.] + {\incfig{smpfig}} + \end{subfigmatrix} + \caption{Four small figures in a table-like setting.} + \label{fig:four} +\end{figure} + +\section{Computational Mesh} + +The underlying surface definition database was generated from +structured surface patches obtained using +GRIDGEN\cite{GRIDGEN3D_release}, GridTool\cite{GridTool}, and +simple analytical methods. The unstructured surface and +flow-field grids were then generated using +FELISA\cite{peraire:90cp} and TETMESH.\cite{kennon:92cp} The +coarsest mesh has 32,374 tetrahedra with 6,634 nodes. Additional +meshes are described in Ref.~\citen{kleb:96cp}; however, all the +results shown here are the result of the coarsest meshes. + +Since the flow about symmetric configurations at high angles of attack, +even with zero side-slip, often involve asymmetric, vortex-dominated, +features,\cite{yoshinaga:94cp,cobleigh:94cp,dusing:93cp,fisher:94cp} +two different options for the computational domain were employed: +one modeling the complete vehicle and another modeling only half +of the vehicle, assuming symmetry across the pitch-plane. This +aspect of the study is covered in Ref.~\citen{kleb:96cp}. + +\section{Numerical Method} + +The 3D3U code of Batina\cite{batina:93aij} was used exclusively in this +study. The 3D3U code was originally developed to study harmonically +pitching wings and wing-bodies in transonic flow. The code can +incorporate aeroelastic effects through assumed mode shapes, coupled +with a deforming mesh via the linear spring analogy. + +The following defaults were used for the computed results in this +study: Roe's flux-difference splitting, an eigenvalue limiter +threshold value of 0.3, second-order flux reconstruction using a +$\kappa$ of 0.5, and Gauss-Seidel implicit time integration with +a CFL number of one million. + +\section{Maneuver Definition} + +The pitch schedule chosen for this study is the first half of a +sine function. Initially, the vehicle is in steady flight at +17.5 degrees angle of attack, Mach 0.2. At time zero, the +vehicle begins the pitch-over maneuver, reaching a maximum pitch +rate exactly half-way through the maneuver and finishing at a 180 +deg angle of attack. For this study, the time to complete the +maneuver was chosen as 90 seconds, giving a maximum rotation rate +of 3.1 deg per second halfway through the maneuver. For +simplicity, it is assumed that the free-stream Mach number +remains constant throughout the maneuver. + +{\em Sticking in a table for guidance (see Table~\ref{tab:sample}).} +\begin{table}[htbp] + \begin{center} + \caption{A sample table} + \begin{tabular}{ccc} \hline\hline + \multicolumn{2}{c}{Header 1} & Header 2 \\ \hline + a & b & c \\ + d & e & f \\ \hline\hline + \end{tabular} + \label{tab:sample} + \end{center} +\end{table} +Normally there would be text following the table, so that it +is not left ``hanging'' into the next section. + +\section{Results} + +The main results are presented in two stages which are followed +by comments on flow asymmetries for both steady and unsteady +flows. The first stage is computed steady data as it compares to +experimental results. while the second is a comparison of steady +to unsteady data. + +\subsection{Steady Flow} + +As a baseline to examine the unsteady effects of the pitch-over +maneuver itself, steady flow at selected angles of attack were +computed. Figure~\ref{f:expcomp} shows a comparison of the +normal force coefficient with the experimental data of +Woods\cite{woods:95cp} for angles of attack from 0 to 60 deg. +\begin{figure} + \incfig{smpfig} + \caption{Comparison of steady normal force coefficient as a + function of angle of attack with experimental data of + Woods\protect{\cite{woods:95cp}}} + \label{f:expcomp} +\end{figure} +The computed results agree well (within 20 percent) at small angles of attack, +and diverge from the experimental results as the angle +of attack increases largely due to the position of the lee-side +separation line---a viscous phenomenon. +Since the computed results are modeling inviscid +flow, the only mechanism for flow separation is the numerical +dissipation in the scheme. Thus, the exact location of the computed +separation line is highly grid and scheme dependent. Compounding +this is the fact that the lee-side separation line nearly +encompasses the length of the vehicle; and thus, a slight +deviation can make a large difference in the integrated coefficients. + +\subsection{Unsteady Flow} + +Figure~\ref{f:aerocomp} compares the normal force coefficient of +both the steady and unsteady calculations. +\begin{figure*} + \incfig{smpfig} + \caption{Comparison of steady and unsteady normal force + coefficients as a function of angle of attack. {\em Example + of a figure that spans both columns. The danger is that the + figure numbering may be out of order since the single-column + float and double-column float counters are not connected when + it comes to determining placement order. You can correct this + known ``feature'' of \LaTeX{} by using the \texttt{fix2col} package.}} + \label{f:aerocomp} +\end{figure*} +The solid line represents the unsteady results and the symbols +are the steady-flow results. Readily discernible is the fact +that the steady and unsteady results are significantly different. +The time-dependent results have the time lag behavior expected +for moderately unsteady flow: showing the same general +qualitative trend throughout the angle-of-attack range, but with +the unsteady results lagging behind the steady results. Other +aerodynamic coefficients show similar +differences.\cite{kleb:96cp} + +\subsection{Flow Asymmetry} + +As documented in Ref.~\citen{kleb:96cp}, no appreciable +asymmetries were found for the steady flow cases computed +although they were present in the experimental data of +Woods\cite{woods:95cp}. However, for the unsteady case, +asymmetric flow is apparent as shown in Figure{f:uasym}. +\begin{figure}[t] + \incfig{smpfig} + \caption{Unsteady flow asymmetry: side force coefficient as a + function of angle of attack.} + \label{f:uasym} +\end{figure} +This figure shows the appearance of a non-zero side-force similar +to that reported for {\em steady} flow by Woods\cite{woods:95cp}. +The most significant manifestations of the asymmetries occur in +the 90 to 135 deg angle-of-attack range. + +\section{Concluding Remarks} + +The objective of the present work was to focus an unsteady CFD +method on the prediction of VTVL vehicle aerodynamics during a +pitch-over maneuver. This was accomplished through the use of +the inviscid 3D3U code\cite{batina:93aij} A series of steady +solutions at discrete points in the maneuver were computed and it +was shown that, even for the unrealistically slow pitch-over rate +studied, unsteady effects were large. More importantly, the +rotation maneuver creates flow asymmetries which lead to side +forces not apparent for the steady cases. + +As this is an exploratory study, there is certainly room for +future work. The following is just a handful of extensions which +would be necessary to create an effective design tool: +incorporating viscous effects, allowing movable control surfaces, +coupling a six-degree-of-freedom rigid body dynamics solver, +adding control law, and incorporating an adaptive grid +capability. + +\bibliography{smpbtx} +\bibliographystyle{aiaa} + +\end{document} diff --git a/macros/latex/contrib/aiaa/pre2004/demos/paper/smpbtx.bib b/macros/latex/contrib/aiaa/pre2004/demos/paper/smpbtx.bib new file mode 100644 index 0000000000..652f6d94db --- /dev/null +++ b/macros/latex/contrib/aiaa/pre2004/demos/paper/smpbtx.bib @@ -0,0 +1,222 @@ + +`smpbtx.bib' sample bibtex database: + +to be used from a LaTeX2e document via the, + + \thebibliography{smpbtx} + +command. to process the LaTeX file to include +the references, a command sequence like, + + latex file + bibtex file + latex file + latex file + +would be used. + +bil kleb <w.l.kleb(at)larc.nasa.gov> [13 dec 96] + +@techreport{GRIDGEN3D_release, + author = {J. P. Steinbrenner and J. R. Chawner and C. L. Fouts}, + title = {The GRIDGEN 3D Multiple Block Grid Generation System}, + type = {Wright Research and Development Center Report}, + number = {WRDC--TR--90--3022}, + month = oct, + year = 1989 +} + +@inproceedings{GridTool, + author = {Samareh-Abolhassani, J.}, + title = {GridTool: A Surface Modeling and Grid + Generation Tool}, + booktitle = {Proceedings of the Workshop on Surface Modeling, Grid + Generation, and Related Issues in CFD Solutions}, + publisher = {NASA CP--3291}, + pages = {821--831}, + month = may, + year = 1995 +} + +@article{austin:94ja, + author = {Robert E. Austin and Stephen A. Cook}, + title = {SSTO Rockets: Streamlining Access to Space}, + journal= {Aerospace America}, + month = nov, + year = 1994, + pages = {34--38} +} + +@article{batina:93aij, + author = {John T. Batina}, + title = {Implicit Upwind Solution Algorithms for Three-Dimensional +Unstructured Meshes}, + journal= {AIAA Journal}, + volume = 31, + number = 5, + pages = {801--805}, + month = may, + year = 1993, + note = {See also AIAA Paper 92--0447.} +} + +@article{bekey:94ja, + author = {Ivan Bekey and Richard Powell and Robert Austin}, + title = {NASA Studies Access to Space}, + journal= {Aerospace America}, + month = may, + year = 1994, + pages = {38--43} +} + +@techreport{cobleigh:94cp, + author = {Brent R. Cobleigh}, + title = {High-Angle-of-Attack Yawing Moment Asymmetry of the X-31 + Aircraft from Flight Test}, + type = {AIAA Paper}, + number = {94--1803}, + month = jun, + year = 1994, + note = {In 12th AIAA Applied Aerodynamics Conference Proceedings} +} + +@article{david:95sn, + author = {Leonard David}, + title = {DC-X Completes Pivot Test Over White Sands}, + journal= {Space News}, + month = jul, + volume = 6, + number = 27, + year = 1995, + pages = {1,20}, + mynote = {pitchover maneuver} +} + +@article{dornheim:94awst, + author = {Michael A. Dornheim}, + title = {NASA Awards RLV Contracts}, + journal= {Aviation Week \& Space Technology}, + month = jun, + year = 1994, + pages = {22--23} +} + +@article{dornheim:95awst, + author = {Michael A. Dornheim}, + title = {DC-X Demonstrates Key Maneuver}, + journal= {Aviation Week \& Space Technology}, + month = jul, + year = 1995, + pages = {56--59}, + mynote = {pitchover maneuver} +} + +@article{dornheim:95awst2, + author = {Michael A. Dornheim}, + title = {DC-X Holds Promise; Big Questions Remain}, + journal= {Aviation Week \& Space Technology}, + month = aug, + year = 1995, + pages = {56--59}, + mynote = {pitchover maneuver} +} + +@techreport{dusing:93cp, + author = {Douglas W. Dusing and Paul D. Orkwis}, + title = {On Computing Vortex Asymmetries About Cones at Angle of + Attack Using the Conical Navier-Stokes Equations}, + type = {AIAA Paper}, + number = {93--3628}, + month = aug, + year = 1993, + note = {In AIAA Atmospheric Flight Mechanics Conference Proceedings} +} + +@inproceedings{edwards:92cp, + author = {John W. Edwards and John B. Malone}, + title = {Current Status of Computational Methods for Transonic + Unsteady Aerodynamics and Aeroelastic Applications}, + booktitle = {AGARD Conference Proceedings: Transonic Unsteady + Aerodynamics and Aeroelasticity}, + number = 507, + pages = {{1-1---1-24}}, + month = mar, + year = 1992 +} + +@techreport{fisher:94cp, + author = {David F. Fisher and Brent R. Cobleigh}, + title = {Controlling Forebody Asymmetries in Flight---Experience with + Boundary Layer Transition Strips}, + type = {AIAA Paper}, + number = {94--1826}, + month = jun, + year = 1994, + note = {In 12th AIAA Applied Aerodynamics Conference Proceedings}, + mynote = {asymmetry} +} + +@techreport{kennon:92cp, + author = {Steve R. Kennon and J. M. Meyering and C. W. Berry and J. T. Oden}, + title = {Geometry-Based Delaunay Tetrahedralization and Mesh + Movement Strategies for Multi-Body CFD}, + type = {AIAA Paper}, + number = {92--4575}, + month = aug, + year = 1992 +} + +@techreport{kleb:96cp, + author = {William L. Kleb}, + title = {Aerodynamic Characteristics of an Aerospace Vehicle + During a Subsonic Pitch-Over Maneuver}, + type = {AIAA Paper}, + number = {96--0825}, + month = jan, + year = 1996 +} + +@techreport{oleary:94cp, + author = {C. O. O'Leary and B. Weir and J. M. Walker}, + title = {A New Rig for the Measurement of Rotary and Translational + Derivatives}, + type = {ICAS}, + number = {94--3.4.1}, + month = sep, + year = 1994, + note = {In 19th Congress of the International Council of the + Aeronautical Sciences ICAS Proceedings} +} + +@inproceedings{peraire:90cp, + author = {J. Peraire and Kenneth Morgan and J. Peiro}, + title = {Unstructured Finite Element Mesh Generation and Adaptive + Procedures for CFD}, + booktitle = {AGARD Conference Proceedings: Application of Mesh + Generation to Complex 3-D Configurations}, + number = 464, + pages = {18.1--18.12}, + year = 1990 +} + +@techreport{woods:95cp, + author = {William C. Woods and Norman R. Merski}, + title = {Aerodynamic Characteristics of a Vertical Takeoff / Vertical + Landing (VTVL) Single Stage to Orbit Vehicle from + M = 0.1 to 10}, + type = {AIAA Paper}, + number = {95--1828}, + year = 1995 +} + +@techreport{yoshinaga:94cp, + author = {Takashi Yoshinaga and Atsushi Tate and Hideo Sekine}, + title = {Side Force of Blunted Circular Cylinders at High Angles of + Attack in Supersonic Flow}, + type = {AIAA Paper}, + number = {94--3520}, + month = aug, + year = 1994, + note = {In AIAA Atmospheric Flight Mechanics Conference Proceedings}, + mynote = {asymmetry} +} diff --git a/macros/latex/contrib/aiaa/pre2004/demos/paper/smpfig.eps b/macros/latex/contrib/aiaa/pre2004/demos/paper/smpfig.eps new file mode 100644 index 0000000000..498eff7173 --- /dev/null +++ b/macros/latex/contrib/aiaa/pre2004/demos/paper/smpfig.eps @@ -0,0 +1,340 @@ +%!PS-Adobe-2.0 EPSF-1.2 +%%Creator: TECPLOT +%%Pages:1 +%%BoundingBox: 32 199 575 580 +%%DocumentFonts: Helvetica Helvetica-Bold Symbol Times-Roman Times-Bold Times-Italic Times-BoldItalic Courier Courier-Bold +%%EndComments +/tecplotdict 120 dict def +tecplotdict begin +/ed {exch def} def +/ftl {findfont exch scalefont setfont} def +/ftr {/Times-Roman ftl} def +/ftb {/Times-Bold ftl} def +/fti {/Times-Italic ftl} def +/ftib {/Times-BoldItalic ftl} def +/fcr {/Courier ftl} def +/fcb {/Courier-Bold ftl} def +/fhn {/Helvetica ftl} def +/fhb {/Helvetica-Bold ftl} def +/fsy {/Symbol ftl} def +/gs /gsave load def +/gr /grestore load def +/np /newpath load def +/cp /closepath load def +/sg /setgray load def +/lc {stroke setlinecap} def +/lj /setlinejoin load def +/x /setrgbcolor load def +/y {x moveto} def +/g /get load def +/sd /setdash load def +/s {stroke setlinewidth} def +/cpt /currentpoint load def +/m {stroke moveto} def +/rm /rmoveto load def +/l /lineto load def +/r /rlineto load def +/sf /setflat load def +/st /stroke load def +/ct {cpt st} def +/stg {st sg} def +/scg {cpt m sg} def +/ro /rotate load def +/sh /show load def +/clp {st cp gr gs np moveto l l l cp clip np cp} def +/er {cpt cp np moveto r r r cp sg fill 0 sg cp} def +/erc {cpt cp np moveto r r r cp x fill 0 sg cp} def +/br {cpt cp np moveto r r r cp sg cp} def +/brc {cpt cp np moveto r r r cp x cp} def +/cir1 {cpt cp m} def +/cir2 {cp fill cp} def +/ii 0 def +/n 0 def +/CurA 0 def +/Ry 0 def +/Rx 0 def +/CA 0 def +/SA 0 def +/SJ 0 def +/SI 0 def +/bi 0 def +/i 0 def +/ib 0 def +/ig 0 def +/ir 0 def +/ishade 0 def +/bshade 0 def + +/z +{ + /ii ed + rea ii get + gra ii get + bla ii get +} def + +/lrgb +{ + /ii ed + /blue ed + /green ed + /red ed + bla ii blue put + gra ii green put + rea ii red put +} def + +/trace +{ + cp np + m + 1 1 n + { + pop + r + } for + cp +} def + +/f +{ + /ishade ed + /n ed + st + trace + ishade sg fill +} def + +/b +{ + /bshade ed + /n ed + m + 1 1 n + { + pop + r + } for + bshade sg stroke +} def + +/fb +{ + /bshade ed + /ishade ed + /n ed + st + n 2 mul 2 add copy + trace + ishade sg fill + trace + bshade sg stroke +} def + +/c +{ + /n ed + st + trace + stroke +} def + +/fc +{ + /i ed + /n ed + st + trace + i z x fill +} def + +/fd +{ + /ib ed + /ig ed + /ir ed + /n ed + st + trace + ir ig ib x fill +} def + +/bc +{ + /i ed + /n ed + m + 1 1 n + { + pop + r + } for + i z x stroke +} def + +/fbc +{ + /ii ed + /bi ed + /n ed + st + n 2 mul 2 add copy + trace + ii z x fill + trace + bi z x stroke +} def +/fbd +{ + /ib ed + /ig ed + /ir ed + /bi ed + /n ed + st + n 2 mul 2 add copy + trace + ir ig ib x fill + trace + bi z x stroke +} def +/e +{ + /Ry ed + /Rx ed + /CA ed + /SA ed + /SJ ed + /SI ed + + /DelX SA cos Rx mul def + /DelY SA sin Ry mul def + /XI SI DelX add def + /YI SJ DelY add def + /OCX DelX def + /OCY DelY def + /N 0 def + SA CA add + CA + SA 360 add + { + /CurA ed + /CX CurA cos Rx mul def + /CY CurA sin Ry mul def + OCX CX sub + OCY CY sub + /OCX CX def + /OCY CY def + /N N 1 add def + } + for + XI YI N +} def +%%EndProlog +%%Page:? 1 +5 setmiterlimit +0.0708661 0.0708661 scale np +gs +2 lc +0 lj +455 2817 455 8195 8118 8195 8118 2817 clp +456 2818 m +1 0 -5376 7661 0 0 5376 er +494 2844 494 8168 8080 8168 8080 2844 clp +455 2817 455 8195 8118 8195 8118 2817 clp +494 2844 494 8168 8080 8168 8080 2844 clp +455 2817 455 8195 8118 8195 8118 2817 clp +0 stg +494 2844 494 8168 8080 8168 8080 2844 clp +0 stg +26.8787 s +514 2868 m +0 0 -5259 7536 0 0 5259 br +0 stg +7536 5259 514 2868 1 0 b +0 stg +7536 -5259 514 8128 1 0 b +5.37574 s +0 -430 6344 0 0 430 1099 5281 3 1 0 fb +1179 5402 m +268.787 fcb +0 sg +(E) sh +1351 5402 m +(n) sh +1523 5402 m +(c) sh +1694 5402 m +(a) sh +1866 5402 m +(p) sh +2038 5402 m +(s) sh +2210 5402 m +(u) sh +2381 5402 m +(l) sh +2553 5402 m +(a) sh +2725 5402 m +(t) sh +2896 5402 m +(e) sh +3068 5402 m +(d) sh +3240 5402 m +( ) sh +3412 5402 m +(P) sh +3583 5402 m +(o) sh +3755 5402 m +(s) sh +3927 5402 m +(t) sh +4099 5402 m +(s) sh +4270 5402 m +(c) sh +4442 5402 m +(r) sh +4614 5402 m +(i) sh +4786 5402 m +(p) sh +4957 5402 m +(t) sh +5129 5402 m +( ) sh +5301 5402 m +(\() sh +5472 5402 m +(E) sh +5644 5402 m +(P) sh +5816 5402 m +(S) sh +5988 5402 m +(\)) sh +6159 5402 m +( ) sh +6331 5402 m +(F) sh +6503 5402 m +(i) sh +6675 5402 m +(g) sh +6846 5402 m +(u) sh +7018 5402 m +(r) sh +7190 5402 m +(e) sh +455 2817 455 8195 8118 8195 8118 2817 clp +0 stg +494 2844 494 8168 8080 8168 8080 2844 clp +455 2817 455 8195 8118 8195 8118 2817 clp +5.37574 s +494 2844 494 8168 8080 8168 8080 2844 clp +st gr end +showpage diff --git a/macros/latex/contrib/aiaa/pre2004/demos/refs/tstbtx.bib b/macros/latex/contrib/aiaa/pre2004/demos/refs/tstbtx.bib new file mode 100644 index 0000000000..f34c6c8e6a --- /dev/null +++ b/macros/latex/contrib/aiaa/pre2004/demos/refs/tstbtx.bib @@ -0,0 +1,105 @@ +@InCollection{turner:64a, + author = {M. J. Turner and H. C. Martin and R. C. Leible}, + title = {Further Development and Applications of Stiffness Methods}, + booktitle = {Matrix Methods of Structural Analysis}, + year = 1964, + edition = {1st}, + publisher = {Macmillian}, + address = {New York}, + volume = 1, + pages = {203-266} + } + +@Article{bhutta:90jsr, + author = {B. A. Bhutta and C. H. Lewis}, + title = {Large-Angle-of-Attack Vicous Hypersonic Flows over + Complex Lifting Configurations}, + journal = {Journal of Spacecraft and Rockets}, + year = 1990, + volume = 27, + number = 2, + pages = {194-204}, + note = {also AIAA Paper 89--0269, Jan. 1989} +} + +@InCollection{blottner:70cp, + author = {F. G. Blottner}, + title = {Prediction of Electron Density in the Boundary Layer + of Entry Vehicles with Ablation}, + booktitle = {The Entry Plasma Sheath and Its Effects}, + type = {NASA SP--252}, + volume = 1, + year = 1970, + month = oct, + pages = {219--240} +} + +@InProceedings{wirin:90cp, + author = {W. B. Wirin}, + title = {Space Debris 1989}, + booktitle = {Proceedings of the Thrity-Second Colloquium + on the Law of Outer Space}, + year = 1990, + publisher = {AIAA}, + address = {Wahington, DC}, + pages = {184--196} +} + +@TechReport{bhutta:90vra, + author = {B. A. Bhutta and C. H. Lewis}, + title = {PNS Predictions of External/Internal Hypersonic Flows + for NASP Propulsion Applications}, + institution = {VRA, Inc.}, + type = {VRA--TR--90--01}, + year = 1990, + address = {Blacksburg, VA}, + month = jun +} + +@TechReport{miner:75ncr, + author = {E. W. Miner and C. H. Lewis}, + title = {Hypersonic Ionizing Air Viscous Shock-Layer Flows + over Nonanlytic Blunt Bodies}, + year = 1975, + type = {NASA CR--2250}, + month = may +} + +@TechReport{bhutta:90cp, + author = {B. A. Bhutta and C. H. Lewis}, + title = {Aerothermodynamic Performance of 3-D and Bent-Nose RVs + Hypersonic Conditions}, + year = 1990, + type = {AIAA Paper 90--3068}, + month = aug +} + + +@InCollection{sutton:85ar, + author = {K. Sutton}, + title = {Air Radiation Revisted}, + booktitle = {Thermal Design of Aeroassisted Orbital Transfer Vehicles}, + publisher = {AIAA}, + year = 1985, + editor = {H. F. Nelson}, + volume = 96, + type = {Progress in Astronautics and Aeronautics}, + address = {New York}, + pages = {419--441} +} + +@TechReport{anon:53, + author = {Anon.}, + title = {Equations, Tables, and Charts for Compressible Flow}, + year = 1953, + type = {NACA Rept.~1135} +} + +@Misc{moss:90pc, + author = {J. N. Moss}, + howpublished = {private communication, + NASA Langley Research Center, + Hampton, VA}, + year = 1990, + month = jun +} diff --git a/macros/latex/contrib/aiaa/pre2004/demos/refs/tstref.tex b/macros/latex/contrib/aiaa/pre2004/demos/refs/tstref.tex new file mode 100644 index 0000000000..f418c8db54 --- /dev/null +++ b/macros/latex/contrib/aiaa/pre2004/demos/refs/tstref.tex @@ -0,0 +1,150 @@ +% +% aiaaref.tex +% +% contents: specifications for AIAA journal reference format, +% including examples +% +% use: to test bibliographic style sheets generated with makebst +% +% bil kleb <w.l.kleb@larc.nasa.gov> (96 nov 13) +% +\documentclass{article} +\usepackage{overcite} +% +\pagestyle{empty} +% +\setcounter{secnumdepth}{-1} +\setlength\topmargin{-.5in} +\setlength\textheight{9.0in} +\setlength\textwidth{6.0in} +\setlength\oddsidemargin{0.25in} +\setlength\parindent{0em} +% +% modify section headers: +% +\makeatletter\renewcommand\section{\@startsection{section}{1}{0pt} +{1.2ex}{0.2ex}{\normalfont\bfseries}}\makeatother +% +% modify bibliography output to do superscripted reference list +% with required indentation +% +\makeatletter +\renewcommand{\@biblabel}[1]{$^{#1}$} +\renewenvironment{thebibliography}[1] + {\section*{\refname\@mkboth{\MakeUppercase\refname}% + {\MakeUppercase\refname}}% + \list{\@biblabel{\@arabic\c@enumiv}}% + {\setlength{\leftmargin}{0pt}% + \settowidth{\labelwidth}{\@biblabel{#1}}% + \setlength{\itemindent}{\parindent}% + \advance\itemindent by \labelwidth% + \setlength{\labelsep}{0.0em}% + \setlength{\itemsep}{-\smallskipamount}% + \@openbib@code% + \usecounter{enumiv}% + \let\p@enumiv\@empty% + \renewcommand\theenumiv{\@arabic\c@enumiv}% + \normalsize} + \sloppy\clubpenalty4000\widowpenalty4000% + \sfcode`\.\@m} + {\def\@noitemerr + {\@latex@warning{Empty `thebibliography' environment}}% + \endlist} +\makeatother + +\begin{document} + +\begin{center} + {\bfseries\LARGE Reference Format for AIAA Journals} +\end{center} + +{\bfseries All references must be complete prior to acceptance of a + manuscript.} The following list gives examples of commonly lacking +information: +\begin{itemize}\setlength{\itemsep}{0.0ex} + \item Name of publishers (for books and {\bfseries proceedings}) + and their locations. + \item Inclusive page numbers or (for books) chapters. + \item Complete journal names ({\bfseries no abbreviations} + unless part of actual title. + \item Journal volume and issue numbers (or months). + \item Locations of companies, universities, and societies in + reports and papers. +\end{itemize} + +Note for {\bfseries all} references: Spell out {\bfseries +everything}. AIAA, NASA, NACA, AGARD, NATO are exceptions; +months may be abbreviated. All references must be numbered and +cited in numerical order in the text. Classified or +export-restricted references are not permitted. List +{\bfseries all} authors. Follow these examples for format: + +\setlength\parindent{2em} + +\section{Article in a Book:} + \cite{turner:64a}Turner, M.~J., Martin, H.~C., and + Leible, R.~C., ``Further Development and Applications of + Stiffness Methods,'' {\itshape Matrix Methods of Structural + Analysis}, 1st ed., Vol.~1, Macmillan, New York, 1964, + pp.~203--266. + +\section{Journal Article:} + \cite{bhutta:90jsr}Bhutta, B.~A., and Lewis, C.~H., + ``Large-Angle-of-Attack Viscous Hypersonic Flows over Complex + Lifting Configurations,'' {\itshape Journal of Spacecraft and + Rockets}, Vol.~27, No.~2, 1990, pp.~194--204; also AIAA Paper + 89--0269, Jan.~1989. [{\itshape Note:} Month acceptable if + number is not available.] + +\section{Proceedings/Transactions Articles:} + \cite{blottner:70cp}Blottner, B.~A., + ``Prediction of Electron Density in the Boundary Layer of Entry + Vehicles with Ablation,'' {\itshape The Entry Plasma Sheath and + Its Effects on Space Vehicle Electromagnetic Systems}, NASA + SP--252, Vol.~1, Oct.~1970, pp.~219--240. + + \cite{wirin:90cp}Wirin, W.~B., ``Space Debris 1989,'' {\itshape Proceedings + of the Thirty-Second Colloquium on the Law of Outer Space}, + AIAA, Washington, DC, 1990, pp.~184--196. + +\section{Company Report:} + \cite{bhutta:90vra}Bhutta, B.~A., and Lewis, C.~H., + ``PNS Predictions of External/Internal Hypersonic Flows + for NASP Propulsion Applications,'' VRA, Inc., VRA--TR--90--01, + Blacksburg, VA, June, 1990. + +\section{NACA Report:} + \cite{miner:75ncr}Miner, E.~W., and Lewis, C.~H., + ``Hypersonic Ionizing Air Viscous Shock-Layer Flows over + Nonanalytic Blunt Bodies,'' NASA CR--2550, May 1975. + +\section{Meeting Paper:} + \cite{bhutta:90cp}Bhutta, B.~A., and Lewis, C.~H., + ``Aerothermodynamic Performance of 3-D and Bent-Nose RVs under + Hypersonic Conditions,'' AIAA Paper 90--3068, Aug. 1990. + +\section{AIAA Book Series:} + \cite{sutton:85ar}Sutton, K., ``Air Radiation + Revisted,'' {\itshape Thermal Design of Aeroassisted Orbital + Transfer Vehicles}, edited by H.~F.~Nelson, Vol.~96, Progress + in Astronautics and Aeronautics, AIAA, New York, 1985, + pp.~419--441. + +\section{Anonymous Report:} + \cite{anon:53}Anon., ``Equations, Tables, and + Charts for Compressible Flow,'' NACA Rept.~1135, + 1953. [{\itshape Note:} Month preferred but not available for + this report.] + +\section{Private Communication:} + \cite{moss:90pc}Moss, J.~N., private + communication, NASA Langley Research Center, Hampton, VA, June + 1990. [{\itshape Note:} Use of private communication is + {\bfseries strongly} discouraged.] + +\newpage% try the citations contained in testrefs.bib + +\bibliography{tstbtx} +\bibliographystyle{aiaa} + +\end{document} diff --git a/macros/latex/contrib/aiaa/pre2004/demos/subfigs/smpfig.eps b/macros/latex/contrib/aiaa/pre2004/demos/subfigs/smpfig.eps new file mode 100644 index 0000000000..498eff7173 --- /dev/null +++ b/macros/latex/contrib/aiaa/pre2004/demos/subfigs/smpfig.eps @@ -0,0 +1,340 @@ +%!PS-Adobe-2.0 EPSF-1.2 +%%Creator: TECPLOT +%%Pages:1 +%%BoundingBox: 32 199 575 580 +%%DocumentFonts: Helvetica Helvetica-Bold Symbol Times-Roman Times-Bold Times-Italic Times-BoldItalic Courier Courier-Bold +%%EndComments +/tecplotdict 120 dict def +tecplotdict begin +/ed {exch def} def +/ftl {findfont exch scalefont setfont} def +/ftr {/Times-Roman ftl} def +/ftb {/Times-Bold ftl} def +/fti {/Times-Italic ftl} def +/ftib {/Times-BoldItalic ftl} def +/fcr {/Courier ftl} def +/fcb {/Courier-Bold ftl} def +/fhn {/Helvetica ftl} def +/fhb {/Helvetica-Bold ftl} def +/fsy {/Symbol ftl} def +/gs /gsave load def +/gr /grestore load def +/np /newpath load def +/cp /closepath load def +/sg /setgray load def +/lc {stroke setlinecap} def +/lj /setlinejoin load def +/x /setrgbcolor load def +/y {x moveto} def +/g /get load def +/sd /setdash load def +/s {stroke setlinewidth} def +/cpt /currentpoint load def +/m {stroke moveto} def +/rm /rmoveto load def +/l /lineto load def +/r /rlineto load def +/sf /setflat load def +/st /stroke load def +/ct {cpt st} def +/stg {st sg} def +/scg {cpt m sg} def +/ro /rotate load def +/sh /show load def +/clp {st cp gr gs np moveto l l l cp clip np cp} def +/er {cpt cp np moveto r r r cp sg fill 0 sg cp} def +/erc {cpt cp np moveto r r r cp x fill 0 sg cp} def +/br {cpt cp np moveto r r r cp sg cp} def +/brc {cpt cp np moveto r r r cp x cp} def +/cir1 {cpt cp m} def +/cir2 {cp fill cp} def +/ii 0 def +/n 0 def +/CurA 0 def +/Ry 0 def +/Rx 0 def +/CA 0 def +/SA 0 def +/SJ 0 def +/SI 0 def +/bi 0 def +/i 0 def +/ib 0 def +/ig 0 def +/ir 0 def +/ishade 0 def +/bshade 0 def + +/z +{ + /ii ed + rea ii get + gra ii get + bla ii get +} def + +/lrgb +{ + /ii ed + /blue ed + /green ed + /red ed + bla ii blue put + gra ii green put + rea ii red put +} def + +/trace +{ + cp np + m + 1 1 n + { + pop + r + } for + cp +} def + +/f +{ + /ishade ed + /n ed + st + trace + ishade sg fill +} def + +/b +{ + /bshade ed + /n ed + m + 1 1 n + { + pop + r + } for + bshade sg stroke +} def + +/fb +{ + /bshade ed + /ishade ed + /n ed + st + n 2 mul 2 add copy + trace + ishade sg fill + trace + bshade sg stroke +} def + +/c +{ + /n ed + st + trace + stroke +} def + +/fc +{ + /i ed + /n ed + st + trace + i z x fill +} def + +/fd +{ + /ib ed + /ig ed + /ir ed + /n ed + st + trace + ir ig ib x fill +} def + +/bc +{ + /i ed + /n ed + m + 1 1 n + { + pop + r + } for + i z x stroke +} def + +/fbc +{ + /ii ed + /bi ed + /n ed + st + n 2 mul 2 add copy + trace + ii z x fill + trace + bi z x stroke +} def +/fbd +{ + /ib ed + /ig ed + /ir ed + /bi ed + /n ed + st + n 2 mul 2 add copy + trace + ir ig ib x fill + trace + bi z x stroke +} def +/e +{ + /Ry ed + /Rx ed + /CA ed + /SA ed + /SJ ed + /SI ed + + /DelX SA cos Rx mul def + /DelY SA sin Ry mul def + /XI SI DelX add def + /YI SJ DelY add def + /OCX DelX def + /OCY DelY def + /N 0 def + SA CA add + CA + SA 360 add + { + /CurA ed + /CX CurA cos Rx mul def + /CY CurA sin Ry mul def + OCX CX sub + OCY CY sub + /OCX CX def + /OCY CY def + /N N 1 add def + } + for + XI YI N +} def +%%EndProlog +%%Page:? 1 +5 setmiterlimit +0.0708661 0.0708661 scale np +gs +2 lc +0 lj +455 2817 455 8195 8118 8195 8118 2817 clp +456 2818 m +1 0 -5376 7661 0 0 5376 er +494 2844 494 8168 8080 8168 8080 2844 clp +455 2817 455 8195 8118 8195 8118 2817 clp +494 2844 494 8168 8080 8168 8080 2844 clp +455 2817 455 8195 8118 8195 8118 2817 clp +0 stg +494 2844 494 8168 8080 8168 8080 2844 clp +0 stg +26.8787 s +514 2868 m +0 0 -5259 7536 0 0 5259 br +0 stg +7536 5259 514 2868 1 0 b +0 stg +7536 -5259 514 8128 1 0 b +5.37574 s +0 -430 6344 0 0 430 1099 5281 3 1 0 fb +1179 5402 m +268.787 fcb +0 sg +(E) sh +1351 5402 m +(n) sh +1523 5402 m +(c) sh +1694 5402 m +(a) sh +1866 5402 m +(p) sh +2038 5402 m +(s) sh +2210 5402 m +(u) sh +2381 5402 m +(l) sh +2553 5402 m +(a) sh +2725 5402 m +(t) sh +2896 5402 m +(e) sh +3068 5402 m +(d) sh +3240 5402 m +( ) sh +3412 5402 m +(P) sh +3583 5402 m +(o) sh +3755 5402 m +(s) sh +3927 5402 m +(t) sh +4099 5402 m +(s) sh +4270 5402 m +(c) sh +4442 5402 m +(r) sh +4614 5402 m +(i) sh +4786 5402 m +(p) sh +4957 5402 m +(t) sh +5129 5402 m +( ) sh +5301 5402 m +(\() sh +5472 5402 m +(E) sh +5644 5402 m +(P) sh +5816 5402 m +(S) sh +5988 5402 m +(\)) sh +6159 5402 m +( ) sh +6331 5402 m +(F) sh +6503 5402 m +(i) sh +6675 5402 m +(g) sh +6846 5402 m +(u) sh +7018 5402 m +(r) sh +7190 5402 m +(e) sh +455 2817 455 8195 8118 8195 8118 2817 clp +0 stg +494 2844 494 8168 8080 8168 8080 2844 clp +455 2817 455 8195 8118 8195 8118 2817 clp +5.37574 s +494 2844 494 8168 8080 8168 8080 2844 clp +st gr end +showpage diff --git a/macros/latex/contrib/aiaa/pre2004/demos/subfigs/smpsubf.tex b/macros/latex/contrib/aiaa/pre2004/demos/subfigs/smpsubf.tex new file mode 100644 index 0000000000..495e12508b --- /dev/null +++ b/macros/latex/contrib/aiaa/pre2004/demos/subfigs/smpsubf.tex @@ -0,0 +1,366 @@ +% `smpsubf.tex' - a sample of subfigure usage +% +% see epslatex.{ps,pdf} in the info directory of the CTAN for +% more discussion on figure placement, usage, etc. +% +\documentclass{aiaa}% use draft mode to check for + % over-full boxes (big black lines). + +% declare new lengths that are used for computing subfigure +% layouts when doing up-down, left-right ordered tables of subfigures. + +\newlength{\subfigwidth}% subfigure width +\newlength{\subfigcolsep}% separation between subfigures +\setlength{\subfigcolsep}{2\tabcolsep}% tie to that used for tabular + +% define a command that creates meaningless blocks of text. +% use is, for example, \replicate{4}{text} where `4' is the +% number of times to repeat the filler `text'. + +\makeatletter +\newcounter{numrepeat} +\newcommand{\replicate}[2]{\par + \setcounter{numrepeat}{#1}\relax + \@whilenum \value{numrepeat} > 0 \do + {{#2}\addtocounter{numrepeat}{-1}}\par} +\makeatother + +% make a command to be the filler text +% for the replicate command above: + +\newcommand{\filler}% + {\em More text and even more text and even more text. + Followed by some other stuff. + Then adding yet additional material. + Lets now change gears and talk about some other stuff for a while. + I am sick-to-death of this other bit of rambling, + and besides I need more material.} + +\title{Some Subfigure Layout Choices} +\author{Bil Kleb\\ + {\it NASA Langley Research Center, Hampton,~Virginia,~23681}} + +\begin{document} + +\maketitle + +The purpose of this document is to present a number +of different subfigure layout options. The methods are currently +rather {\em ad hoc}, but future versions should make this sort +of thing more automatic and remove the requirement for +fiddling on a case-by-case basis. + + +\section{Two stacked figures} + +Let's start off with a simple one: two figures stacked one atop the +other as shown in Fig.~\ref{fig:3f}. +\begin{figure} + \begin{subfigmatrix}{1} + \subfigure[The first one. ]{\incfig{smpfig}} + \subfigure[The second one.]{\incfig{smpfig}} + \end{subfigmatrix} + \caption{Two, stacked subfigures.} + \label{fig:3f} +\end{figure} +\replicate{3}{\filler} + + +\section{Six Figures} + +\subsection{Up-down, Left-right Ordering} + +This is some text, referencing Fig.~\ref{fig:udlr}. Note that +the order of the sub figures is up-down, then left-right. +Beware that alignment will be thrown off if the subcaptions are +typeset with differing numbers of lines, i.e., a long subcaption +and a short subcaption and the \texttt{[b]} alignment option for the +minipages are not used. +\begin{figure} + \setlength{\subfigwidth}{.5\linewidth} + \addtolength{\subfigwidth}{-.5\subfigcolsep} + \vspace*{-\subfigtopskip} + \begin{minipage}[b]{\subfigwidth} + \subfigure[The first one. ]{\incfig{smpfig}} + \end{minipage} + \begin{minipage}[b]{\subfigwidth} + \setcounter{subfigure}{3} + \subfigure[The fourth one.]{\incfig{smpfig}} + \end{minipage} + \begin{minipage}[b]{\subfigwidth} + \setcounter{subfigure}{1} + \subfigure[The second one.]{\incfig{smpfig}} + \end{minipage} + \begin{minipage}[b]{\subfigwidth} + \setcounter{subfigure}{4} + \subfigure[The fifth one. ]{\incfig{smpfig}} + \end{minipage} + \begin{minipage}[b]{\subfigwidth} + \setcounter{subfigure}{2} + \subfigure[The third one. ]{\incfig{smpfig}} + \end{minipage}\hfill + \begin{minipage}[b]{\subfigwidth} + \setcounter{subfigure}{5} + \subfigure[The sixth one. ]{\incfig{smpfig}} + \end{minipage} + \caption{Up-down ordering of the subfigures + using the minipage environment.} + \label{fig:udlr} +\end{figure} +\replicate{4}{\filler} + +\subsection{Left-Right, Up-Down Ordering} + +Now, if we wanted the ordering to be left-right, then +up-down, we could use the tabular environment. This +is how Fig.~\ref{fig:lrud} was generated. +\begin{figure} + \begin{subfigmatrix}{2} + \subfigure[The first one. ]{\incfig{smpfig}} + \subfigure[The second one.]{\incfig{smpfig}} + \subfigure[The third one. ]{\incfig{smpfig}} + \subfigure[The fourth one.]{\incfig{smpfig}} + \subfigure[The fifth one. ]{\incfig{smpfig}} + \subfigure[The sixth one. ]{\incfig{smpfig}} + \end{subfigmatrix} + \caption{Ordering the subfigures from left-to-right, then + up-down using the tabular environment.} + \label{fig:lrud} +\end{figure} +\replicate{4}{\filler} + +\section{Eight Figures Spanning Both Columns} + +This Fig.~\ref{fig:long} shows the method of `continuing' +the figure onto another page. +\begin{figure*} + \begin{subfigmatrix}{2} + \subfigure[The first one. ]{\incfig{smpfig}} + \subfigure[The second one.]{\incfig{smpfig}} + \subfigure[The third one. ]{\incfig{smpfig}} + \subfigure[The fourth one.]{\incfig{smpfig}} + \subfigure[The fifth one. ]{\incfig{smpfig}} + \subfigure[The sixth one. ]{\incfig{smpfig}} + \end{subfigmatrix} + \caption{Ordering the subfigures from left-to-right, then + up-down using the tabular environment.} + \label{fig:long} +\end{figure*} +\addtocounter{figure}{-1} +\setcounter{subfigure}{6} +\begin{figure*} + \begin{subfigmatrix}{2} + \subfigure[The seventh one.]{\incfig{smpfig}} + \subfigure[The eighth one. ]{\incfig{smpfig}} + \end{subfigmatrix} + \caption{Concluded.} +\end{figure*} +\replicate{4}{\filler} + + +\section{Nine Subfigures} + +\subsection{Up-down, Left-right Ordering} + +This is some text, referencing Fig.~\ref{fig:3ud3lr}. Note that +the order of the sub figures is up-down, then left-right. +\begin{figure}[htb!] + \setlength{\subfigwidth}{.333\linewidth} + \addtolength{\subfigwidth}{-.667\subfigcolsep} + \vspace*{-\subfigtopskip} + \begin{minipage}[b]{\subfigwidth} + \subfigure[The first.]{\incfig{smpfig}} + \end{minipage} + \begin{minipage}[b]{\subfigwidth} + \setcounter{subfigure}{3} + \subfigure[The fourth.]{\incfig{smpfig}} + \end{minipage} + \begin{minipage}[b]{\subfigwidth} + \setcounter{subfigure}{6} + \subfigure[The seventh.]{\incfig{smpfig}} + \end{minipage} + \begin{minipage}[b]{\subfigwidth} + \setcounter{subfigure}{1} + \subfigure[The second.]{\incfig{smpfig}} + \end{minipage} + \begin{minipage}[b]{\subfigwidth} + \setcounter{subfigure}{4} + \subfigure[The fifth.]{\incfig{smpfig}} + \end{minipage} + \begin{minipage}[b]{\subfigwidth} + \setcounter{subfigure}{7} + \subfigure[The eighth.]{\incfig{smpfig}} + \end{minipage} + \begin{minipage}[b]{\subfigwidth} + \setcounter{subfigure}{2} + \subfigure[The third.]{\incfig{smpfig}} + \end{minipage}\hfill + \begin{minipage}[b]{\subfigwidth} + \setcounter{subfigure}{5} + \subfigure[The sixth.]{\incfig{smpfig}} + \end{minipage}\hfill + \begin{minipage}[b]{\subfigwidth} + \setcounter{subfigure}{8} + \subfigure[The ninth.]{\incfig{smpfig}} + \end{minipage} + \caption{Up-down ordering of the subfigures + using the minipage environment.} + \label{fig:3ud3lr} +\end{figure} +\replicate{4}{\filler} + +\subsection{Left-Right, Up-Down Ordering} + +Now, if we wanted the ordering to be left-right, then +up-down, we could use the tabular environment. This +is how Fig.~\ref{fig:3lr3ud} was generated. This figure spans both +columns, so it is most likely out of order (and appears near or +at the end of this document). +\begin{figure*} + \begin{subfigmatrix}{3} + \subfigure[The first. ]{\incfig{smpfig}} + \subfigure[The second. ]{\incfig{smpfig}} + \subfigure[The third. ]{\incfig{smpfig}} + \subfigure[The fourth. ]{\incfig{smpfig}} + \subfigure[The fifth. ]{\incfig{smpfig}} + \subfigure[The sixth. ]{\incfig{smpfig}} + \subfigure[The seventh.]{\incfig{smpfig}} + \subfigure[The eighth. ]{\incfig{smpfig}} + \subfigure[The ninth. ]{\incfig{smpfig}} + \end{subfigmatrix} + \caption{Ordering the subfigures from + left-to-right, then up-down + using the tabular environment.} + \label{fig:3lr3ud} +\end{figure*} +\replicate{4}{\filler} + + +\section{Two Small Subfigures and One Large One} + +\subsection{A} + +Next, we try two small figures with one large one. This attempt +is shown in Fig.~\ref{fig:2s1l}. +\begin{figure}[htb!] + \setlength{\subfigwidth}{.284\linewidth}% have to FIDDLE with this + \addtolength{\subfigwidth}{-.5\subfigcolsep} + \begin{minipage}[b]{\subfigwidth} + \begin{subfigmatrix}{1} + \subfigure[One.]{\incfig{smpfig}} + \subfigure[Two.]{\incfig{smpfig}} + \end{subfigmatrix} + \end{minipage} + \addtolength{\subfigwidth}{.5\subfigcolsep} + \addtolength{\subfigwidth}{-\linewidth} + \setlength{\subfigwidth}{-\subfigwidth} + \addtolength{\subfigwidth}{-.5\subfigcolsep} + \begin{minipage}[b]{\subfigwidth} + \subfigure[The large one.]{\incfig{smpfig}} + \end{minipage} + \caption{Two small subfigures and a large one.} + \label{fig:2s1l} +\end{figure} +\replicate{3}{\filler} + +\subsection{B} + +Figure~\ref{fig:1l2s} is the same, only with the large/small +positions swapped about the vertical axis. +\begin{figure}[htb!] + \setlength{\subfigwidth}{.716\linewidth}% have to FIDDLE with this + \addtolength{\subfigwidth}{-.5\subfigcolsep} + \begin{minipage}[b]{\subfigwidth} + \subfigure[The large one.]{\incfig{smpfig}} + \end{minipage} + \addtolength{\subfigwidth}{.5\subfigcolsep} + \addtolength{\subfigwidth}{-\linewidth} + \setlength{\subfigwidth}{-\subfigwidth} + \addtolength{\subfigwidth}{-.5\subfigcolsep} + \begin{minipage}[b]{\subfigwidth} + \begin{subfigmatrix}{1} + \subfigure[One.]{\incfig{smpfig}} + \subfigure[Two.]{\incfig{smpfig}} + \end{subfigmatrix} + \end{minipage} + \caption{One large subfigure beside two small ones.} + \label{fig:1l2s} +\end{figure} +\replicate{1}{\filler} + +\subsection{C} + +Now, for a slightly different effect, two subfigures on top with +a large one on the bottom, see Fig.~\ref{fig:2st1l}. +\begin{figure}[htb!] + \begin{subfigmatrix}{2} + \subfigure[One.]{\incfig{smpfig}} + \subfigure[Two.]{\incfig{smpfig}} + \end{subfigmatrix}% + \begin{subfigmatrix}{1} + \centering\subfigure[The large one.]{\incfig{smpfig}} + \end{subfigmatrix} + \caption{Two smaller subfigures over a larger one.} + \label{fig:2st1l} +\end{figure} +\replicate{1}{\filler} + +\subsection{D} + +And, of coarse the old large subfigure on top with +two subfigures beneath. Fig.~\ref{fig:1lt2sb} demonstrates +this one. +\begin{figure*}[htb!] + \begin{subfigmatrix}{1} + \subfigure[The large one.]{\incfig{smpfig}} + \end{subfigmatrix} + \begin{subfigmatrix}{2} + \subfigure[One.]{\incfig{smpfig}} + \subfigure[Two.]{\incfig{smpfig}} + \end{subfigmatrix} + \caption{One large subfigure above two smaller ones.} + \label{fig:1lt2sb} +\end{figure*} +\replicate{2}{\filler} + +\subsection{E} + +Steve Alter prompted Figure~\ref{f:twobytwo}: two with two on the side. +\begin{figure*} +% + \newlength{\firstfigwidth} + \newlength{\secondfigwidth} + \newlength{\thirdfigwidth} +% + \setlength{\firstfigwidth}{0.39745\linewidth}% FIDDLE with these + \setlength{\secondfigwidth}{0.39745\linewidth}% two numbers +% + \setlength{\thirdfigwidth}{\linewidth} + \addtolength{\thirdfigwidth}{-4\tabcolsep} + \addtolength{\thirdfigwidth}{-\firstfigwidth} + \addtolength{\thirdfigwidth}{-\secondfigwidth} +% + \begin{minipage}[t]{\firstfigwidth} + \subfigure[Representative planes of X34 viscous grid.] + {\incfig{smpfig}} + \end{minipage}% note: `%'s are important in this region + \hspace{2\tabcolsep}% + \begin{minipage}[t]{\secondfigwidth} + \subfigure[Meridnal plane.] + {\incfig{smpfig}} + \end{minipage}% note: `%'s are important in this region + \hspace{2\tabcolsep}% + \begin{minipage}[b]{\thirdfigwidth} + \begin{subfigmatrix}{1} + \subfigure[Wing root.]{\incfig{smpfig}} + \subfigure[Wing tip.]{\incfig{smpfig}} + \end{subfigmatrix} + \end{minipage} +% + \caption{X34 volume grid used for viscous computations.} + \label{f:twobytwo} +% +\end{figure*} +\replicate{3}{\filler} + +\end{document} diff --git a/macros/latex/contrib/aiaa/pre2004/demos/talk/smpfig.eps b/macros/latex/contrib/aiaa/pre2004/demos/talk/smpfig.eps new file mode 100644 index 0000000000..498eff7173 --- /dev/null +++ b/macros/latex/contrib/aiaa/pre2004/demos/talk/smpfig.eps @@ -0,0 +1,340 @@ +%!PS-Adobe-2.0 EPSF-1.2 +%%Creator: TECPLOT +%%Pages:1 +%%BoundingBox: 32 199 575 580 +%%DocumentFonts: Helvetica Helvetica-Bold Symbol Times-Roman Times-Bold Times-Italic Times-BoldItalic Courier Courier-Bold +%%EndComments +/tecplotdict 120 dict def +tecplotdict begin +/ed {exch def} def +/ftl {findfont exch scalefont setfont} def +/ftr {/Times-Roman ftl} def +/ftb {/Times-Bold ftl} def +/fti {/Times-Italic ftl} def +/ftib {/Times-BoldItalic ftl} def +/fcr {/Courier ftl} def +/fcb {/Courier-Bold ftl} def +/fhn {/Helvetica ftl} def +/fhb {/Helvetica-Bold ftl} def +/fsy {/Symbol ftl} def +/gs /gsave load def +/gr /grestore load def +/np /newpath load def +/cp /closepath load def +/sg /setgray load def +/lc {stroke setlinecap} def +/lj /setlinejoin load def +/x /setrgbcolor load def +/y {x moveto} def +/g /get load def +/sd /setdash load def +/s {stroke setlinewidth} def +/cpt /currentpoint load def +/m {stroke moveto} def +/rm /rmoveto load def +/l /lineto load def +/r /rlineto load def +/sf /setflat load def +/st /stroke load def +/ct {cpt st} def +/stg {st sg} def +/scg {cpt m sg} def +/ro /rotate load def +/sh /show load def +/clp {st cp gr gs np moveto l l l cp clip np cp} def +/er {cpt cp np moveto r r r cp sg fill 0 sg cp} def +/erc {cpt cp np moveto r r r cp x fill 0 sg cp} def +/br {cpt cp np moveto r r r cp sg cp} def +/brc {cpt cp np moveto r r r cp x cp} def +/cir1 {cpt cp m} def +/cir2 {cp fill cp} def +/ii 0 def +/n 0 def +/CurA 0 def +/Ry 0 def +/Rx 0 def +/CA 0 def +/SA 0 def +/SJ 0 def +/SI 0 def +/bi 0 def +/i 0 def +/ib 0 def +/ig 0 def +/ir 0 def +/ishade 0 def +/bshade 0 def + +/z +{ + /ii ed + rea ii get + gra ii get + bla ii get +} def + +/lrgb +{ + /ii ed + /blue ed + /green ed + /red ed + bla ii blue put + gra ii green put + rea ii red put +} def + +/trace +{ + cp np + m + 1 1 n + { + pop + r + } for + cp +} def + +/f +{ + /ishade ed + /n ed + st + trace + ishade sg fill +} def + +/b +{ + /bshade ed + /n ed + m + 1 1 n + { + pop + r + } for + bshade sg stroke +} def + +/fb +{ + /bshade ed + /ishade ed + /n ed + st + n 2 mul 2 add copy + trace + ishade sg fill + trace + bshade sg stroke +} def + +/c +{ + /n ed + st + trace + stroke +} def + +/fc +{ + /i ed + /n ed + st + trace + i z x fill +} def + +/fd +{ + /ib ed + /ig ed + /ir ed + /n ed + st + trace + ir ig ib x fill +} def + +/bc +{ + /i ed + /n ed + m + 1 1 n + { + pop + r + } for + i z x stroke +} def + +/fbc +{ + /ii ed + /bi ed + /n ed + st + n 2 mul 2 add copy + trace + ii z x fill + trace + bi z x stroke +} def +/fbd +{ + /ib ed + /ig ed + /ir ed + /bi ed + /n ed + st + n 2 mul 2 add copy + trace + ir ig ib x fill + trace + bi z x stroke +} def +/e +{ + /Ry ed + /Rx ed + /CA ed + /SA ed + /SJ ed + /SI ed + + /DelX SA cos Rx mul def + /DelY SA sin Ry mul def + /XI SI DelX add def + /YI SJ DelY add def + /OCX DelX def + /OCY DelY def + /N 0 def + SA CA add + CA + SA 360 add + { + /CurA ed + /CX CurA cos Rx mul def + /CY CurA sin Ry mul def + OCX CX sub + OCY CY sub + /OCX CX def + /OCY CY def + /N N 1 add def + } + for + XI YI N +} def +%%EndProlog +%%Page:? 1 +5 setmiterlimit +0.0708661 0.0708661 scale np +gs +2 lc +0 lj +455 2817 455 8195 8118 8195 8118 2817 clp +456 2818 m +1 0 -5376 7661 0 0 5376 er +494 2844 494 8168 8080 8168 8080 2844 clp +455 2817 455 8195 8118 8195 8118 2817 clp +494 2844 494 8168 8080 8168 8080 2844 clp +455 2817 455 8195 8118 8195 8118 2817 clp +0 stg +494 2844 494 8168 8080 8168 8080 2844 clp +0 stg +26.8787 s +514 2868 m +0 0 -5259 7536 0 0 5259 br +0 stg +7536 5259 514 2868 1 0 b +0 stg +7536 -5259 514 8128 1 0 b +5.37574 s +0 -430 6344 0 0 430 1099 5281 3 1 0 fb +1179 5402 m +268.787 fcb +0 sg +(E) sh +1351 5402 m +(n) sh +1523 5402 m +(c) sh +1694 5402 m +(a) sh +1866 5402 m +(p) sh +2038 5402 m +(s) sh +2210 5402 m +(u) sh +2381 5402 m +(l) sh +2553 5402 m +(a) sh +2725 5402 m +(t) sh +2896 5402 m +(e) sh +3068 5402 m +(d) sh +3240 5402 m +( ) sh +3412 5402 m +(P) sh +3583 5402 m +(o) sh +3755 5402 m +(s) sh +3927 5402 m +(t) sh +4099 5402 m +(s) sh +4270 5402 m +(c) sh +4442 5402 m +(r) sh +4614 5402 m +(i) sh +4786 5402 m +(p) sh +4957 5402 m +(t) sh +5129 5402 m +( ) sh +5301 5402 m +(\() sh +5472 5402 m +(E) sh +5644 5402 m +(P) sh +5816 5402 m +(S) sh +5988 5402 m +(\)) sh +6159 5402 m +( ) sh +6331 5402 m +(F) sh +6503 5402 m +(i) sh +6675 5402 m +(g) sh +6846 5402 m +(u) sh +7018 5402 m +(r) sh +7190 5402 m +(e) sh +455 2817 455 8195 8118 8195 8118 2817 clp +0 stg +494 2844 494 8168 8080 8168 8080 2844 clp +455 2817 455 8195 8118 8195 8118 2817 clp +5.37574 s +494 2844 494 8168 8080 8168 8080 2844 clp +st gr end +showpage diff --git a/macros/latex/contrib/aiaa/pre2004/demos/talk/smptalk.ps b/macros/latex/contrib/aiaa/pre2004/demos/talk/smptalk.ps new file mode 100644 index 0000000000..a62be378d8 --- /dev/null +++ b/macros/latex/contrib/aiaa/pre2004/demos/talk/smptalk.ps @@ -0,0 +1,2622 @@ +%!PS-Adobe-2.0 +%%Creator: dvips(k) 5.83 Copyright 1998 Radical Eye Software +%%Title: smptalk.dvi +%%Pages: 21 +%%PageOrder: Ascend +%%Orientation: Landscape +%%BoundingBox: 0 0 612 792 +%%DocumentFonts: Courier-Bold +%%EndComments +%DVIPSWebPage: (www.radicaleye.com) +%DVIPSCommandLine: dvips -t landscape smptalk +%DVIPSParameters: dpi=600, compressed +%DVIPSSource: TeX output 1999.03.25:0954 +%%BeginProcSet: texc.pro +%! +/TeXDict 300 dict def TeXDict begin/N{def}def/B{bind def}N/S{exch}N/X{S +N}B/A{dup}B/TR{translate}N/isls false N/vsize 11 72 mul N/hsize 8.5 72 +mul N/landplus90{false}def/@rigin{isls{[0 landplus90{1 -1}{-1 1}ifelse 0 +0 0]concat}if 72 Resolution div 72 VResolution div neg scale isls{ +landplus90{VResolution 72 div vsize mul 0 exch}{Resolution -72 div hsize +mul 0}ifelse TR}if Resolution VResolution vsize -72 div 1 add mul TR[ +matrix currentmatrix{A A round sub abs 0.00001 lt{round}if}forall round +exch round exch]setmatrix}N/@landscape{/isls true N}B/@manualfeed{ +statusdict/manualfeed true put}B/@copies{/#copies X}B/FMat[1 0 0 -1 0 0] +N/FBB[0 0 0 0]N/nn 0 N/IE 0 N/ctr 0 N/df-tail{/nn 8 dict N nn begin +/FontType 3 N/FontMatrix fntrx N/FontBBox FBB N string/base X array +/BitMaps X/BuildChar{CharBuilder}N/Encoding IE N end A{/foo setfont}2 +array copy cvx N load 0 nn put/ctr 0 N[}B/sf 0 N/df{/sf 1 N/fntrx FMat N +df-tail}B/dfs{div/sf X/fntrx[sf 0 0 sf neg 0 0]N df-tail}B/E{pop nn A +definefont setfont}B/Cw{Cd A length 5 sub get}B/Ch{Cd A length 4 sub get +}B/Cx{128 Cd A length 3 sub get sub}B/Cy{Cd A length 2 sub get 127 sub} +B/Cdx{Cd A length 1 sub get}B/Ci{Cd A type/stringtype ne{ctr get/ctr ctr +1 add N}if}B/id 0 N/rw 0 N/rc 0 N/gp 0 N/cp 0 N/G 0 N/CharBuilder{save 3 +1 roll S A/base get 2 index get S/BitMaps get S get/Cd X pop/ctr 0 N Cdx +0 Cx Cy Ch sub Cx Cw add Cy setcachedevice Cw Ch true[1 0 0 -1 -.1 Cx +sub Cy .1 sub]/id Ci N/rw Cw 7 add 8 idiv string N/rc 0 N/gp 0 N/cp 0 N{ +rc 0 ne{rc 1 sub/rc X rw}{G}ifelse}imagemask restore}B/G{{id gp get/gp +gp 1 add N A 18 mod S 18 idiv pl S get exec}loop}B/adv{cp add/cp X}B +/chg{rw cp id gp 4 index getinterval putinterval A gp add/gp X adv}B/nd{ +/cp 0 N rw exit}B/lsh{rw cp 2 copy get A 0 eq{pop 1}{A 255 eq{pop 254}{ +A A add 255 and S 1 and or}ifelse}ifelse put 1 adv}B/rsh{rw cp 2 copy +get A 0 eq{pop 128}{A 255 eq{pop 127}{A 2 idiv S 128 and or}ifelse} +ifelse put 1 adv}B/clr{rw cp 2 index string putinterval adv}B/set{rw cp +fillstr 0 4 index getinterval putinterval adv}B/fillstr 18 string 0 1 17 +{2 copy 255 put pop}for N/pl[{adv 1 chg}{adv 1 chg nd}{1 add chg}{1 add +chg nd}{adv lsh}{adv lsh nd}{adv rsh}{adv rsh nd}{1 add adv}{/rc X nd}{ +1 add set}{1 add clr}{adv 2 chg}{adv 2 chg nd}{pop nd}]A{bind pop} +forall N/D{/cc X A type/stringtype ne{]}if nn/base get cc ctr put nn +/BitMaps get S ctr S sf 1 ne{A A length 1 sub A 2 index S get sf div put +}if put/ctr ctr 1 add N}B/I{cc 1 add D}B/bop{userdict/bop-hook known{ +bop-hook}if/SI save N @rigin 0 0 moveto/V matrix currentmatrix A 1 get A +mul exch 0 get A mul add .99 lt{/QV}{/RV}ifelse load def pop pop}N/eop{ +SI restore userdict/eop-hook known{eop-hook}if showpage}N/@start{ +userdict/start-hook known{start-hook}if pop/VResolution X/Resolution X +1000 div/DVImag X/IE 256 array N 2 string 0 1 255{IE S A 360 add 36 4 +index cvrs cvn put}for pop 65781.76 div/vsize X 65781.76 div/hsize X}N +/p{show}N/RMat[1 0 0 -1 0 0]N/BDot 260 string N/Rx 0 N/Ry 0 N/V{}B/RV/v{ +/Ry X/Rx X V}B statusdict begin/product where{pop false[(Display)(NeXT) +(LaserWriter 16/600)]{A length product length le{A length product exch 0 +exch getinterval eq{pop true exit}if}{pop}ifelse}forall}{false}ifelse +end{{gsave TR -.1 .1 TR 1 1 scale Rx Ry false RMat{BDot}imagemask +grestore}}{{gsave TR -.1 .1 TR Rx Ry scale 1 1 false RMat{BDot} +imagemask grestore}}ifelse B/QV{gsave newpath transform round exch round +exch itransform moveto Rx 0 rlineto 0 Ry neg rlineto Rx neg 0 rlineto +fill grestore}B/a{moveto}B/delta 0 N/tail{A/delta X 0 rmoveto}B/M{S p +delta add tail}B/b{S p tail}B/c{-4 M}B/d{-3 M}B/e{-2 M}B/f{-1 M}B/g{0 M} +B/h{1 M}B/i{2 M}B/j{3 M}B/k{4 M}B/w{0 rmoveto}B/l{p -4 w}B/m{p -3 w}B/n{ +p -2 w}B/o{p -1 w}B/q{p 1 w}B/r{p 2 w}B/s{p 3 w}B/t{p 4 w}B/x{0 S +rmoveto}B/y{3 2 roll p a}B/bos{/SS save N}B/eos{SS restore}B end + +%%EndProcSet +%%BeginProcSet: texnansi.enc +% @psencodingfile{ +% author = "Y&Y, Inc.", +% version = "1.1", +% date = "1 December 1996", +% filename = "texnansi.enc", +% email = "help@YandY.com", +% address = "45 Walden Street // Concord, MA 01742, USA", +% codetable = "ISO/ASCII", +% checksum = "xx", +% docstring = "Encoding for fonts in Adobe Type 1 format for use with TeX." +% } +% +% The idea is to have all 228 characters normally included in Type 1 text +% fonts (plus a few more) available for typesetting. This is effectively +% the character set in Adobe Standard Encoding, ISO Latin 1, plus a few more. +% +% Character code assignments were made as follows: +% +% (1) The character layout largely matches `ASCII' in the 32 -- 126 range, +% except for `circumflex' in 94 and `tilde' in 126, to match `TeX text' +% (`asciicircumflex' and `asciitilde' appear in 158 and 142 instead). +% +% (2) The character layout matches `Windows ANSI' in almost all places, +% except for `quoteright' in 39 and `quoteleft' in 96 to match ASCII +% (`quotesingle' and `grave' appear in 129 and 18 instead). +% +% (3) The character layout matches `TeX typewriter' used by CM text fonts +% in most places (except for discordant positions such as hungarumlaut +% (instead of braceright), dotaccent (instead of underscore) etc. +% +% (4) Remaining characters are assigned arbitrarily to the `control character' +% range (0 -- 31), avoiding 0, 9, 10 and 13 in case we meet dumb software +% - similarly one should really avoid 127 and 128 if possible. +% In addition, the 8 open slots in Windows ANSI between 128 and 159 are used. +% +% (5) Y&Y Lucida Bright includes some extra ligatures and such; ff, ffi, ffl, +% and `dotlessj,' these are included 11 -- 15, and 17. +% +% (6) Hyphen appears both at 45 and 173 for compatibility with both ASCII +% and Windows ANSI. +% +% (7) It doesn't really matter where ligatures appear (both real, such as ffi, +% and pseudo such as ---) since these should not be accessed directly, only +% via ligature information in the TFM file. +% +% SAMPLE USAGE (in `psfonts.map' file for DVIPS): +% +% lbr LucidaBright "TeXnANSIEncoding ReEncodeFont" <texnansi.enc <lbr.pfb +% +% This tells DVIPS that the font called `lbr' in TeX has PostScript +% FontName `LucidaBright.' It also asks DVIPS to expand the file `lbr.pfb' +% into PFA form, to include the attached `texnansi.enc' encoding vector, +% and to then actually reencode the font based on that encoding vector. +% +% Revised 1996 June 1 by adding second position for `fl' to avoid Acrobat bug. +% Revised 1996 June 1 by adding second position for `fraction' for same reason. +% +/TeXnANSIEncoding [ +/.notdef /uni20AC /.notdef /.notdef % 0, 1, 2, 3 +/fraction % 4 +/dotaccent % 5 +/hungarumlaut % 6 +/ogonek % 7 +/fl % 8 +/.notdef % /fraction % 9 not used (see 4), backward compatability only +/cwm % 10 not used, except boundary char internally maybe +/ff % 11 +/fi % 12 +/.notdef % /fl % 13 not used (see 8), backward compatability only +/ffi % 14 +/ffl % 15 +/dotlessi % 16 +/dotlessj % 17 +/grave % 18 +/acute % 19 +/caron % 20 +/breve % 21 +/macron % 22 +/ring % 23 +/cedilla % 24 +/germandbls % 25 +/ae % 26 +/oe % 27 +/oslash % 28 +/AE % 29 +/OE % 30 +/Oslash % 31 +/space % 32 % /suppress in TeX text +/exclam % 33 +/quotedbl % 34 % /quotedblright in TeX text +/numbersign % 35 +/dollar % 36 +/percent % 37 +/ampersand % 38 +/quoteright % 39 % /quotesingle in ANSI +/parenleft % 40 +/parenright % 41 +/asterisk % 42 +/plus % 43 +/comma % 44 +/hyphen % 45 +/period % 46 +/slash % 47 +/zero % 48 +/one % 49 +/two % 50 +/three % 51 +/four % 52 +/five % 53 +/six % 54 +/seven % 55 +/eight % 56 +/nine % 57 +/colon % 58 +/semicolon % 59 +/less % 60 % /exclamdown in Tex text +/equal % 61 +/greater % 62 % /questiondown in TeX text +/question % 63 +/at % 64 +/A % 65 +/B % 66 +/C % 67 +/D % 68 +/E % 69 +/F % 70 +/G % 71 +/H % 72 +/I % 73 +/J % 74 +/K % 75 +/L % 76 +/M % 77 +/N % 78 +/O % 79 +/P % 80 +/Q % 81 +/R % 82 +/S % 83 +/T % 84 +/U % 85 +/V % 86 +/W % 87 +/X % 88 +/Y % 89 +/Z % 90 +/bracketleft % 91 +/backslash % 92 % /quotedblleft in TeX text +/bracketright % 93 +/circumflex % 94 % /asciicircum in ASCII +/underscore % 95 % /dotaccent in TeX text +/quoteleft % 96 % /grave accent in ANSI +/a % 97 +/b % 98 +/c % 99 +/d % 100 +/e % 101 +/f % 102 +/g % 103 +/h % 104 +/i % 105 +/j % 106 +/k % 107 +/l % 108 +/m % 109 +/n % 110 +/o % 111 +/p % 112 +/q % 113 +/r % 114 +/s % 115 +/t % 116 +/u % 117 +/v % 118 +/w % 119 +/x % 120 +/y % 121 +/z % 122 +/braceleft % 123 % /endash in TeX text +/bar % 124 % /emdash in TeX test +/braceright % 125 % /hungarumlaut in TeX text +/tilde % 126 % /asciitilde in ASCII +/dieresis % 127 not used (see 168), use higher up instead +/Lslash % 128 this position is unfortunate, but now too late to fix +/quotesingle % 129 +/quotesinglbase % 130 +/florin % 131 +/quotedblbase % 132 +/ellipsis % 133 +/dagger % 134 +/daggerdbl % 135 +/circumflex % 136 +/perthousand % 137 +/Scaron % 138 +/guilsinglleft % 139 +/OE % 140 +/Zcaron % 141 +/asciicircum % 142 +/minus % 143 +/lslash % 144 +/quoteleft % 145 +/quoteright % 146 +/quotedblleft % 147 +/quotedblright % 148 +/bullet % 149 +/endash % 150 +/emdash % 151 +/tilde % 152 +/trademark % 153 +/scaron % 154 +/guilsinglright % 155 +/oe % 156 +/zcaron % 157 +/asciitilde % 158 +/Ydieresis % 159 +/nbspace % 160 % /space (no break space) +/exclamdown % 161 +/cent % 162 +/sterling % 163 +/currency % 164 +/yen % 165 +/brokenbar % 166 +/section % 167 +/dieresis % 168 +/copyright % 169 +/ordfeminine % 170 +/guillemotleft % 171 +/logicalnot % 172 +/sfthyphen % 173 % /hyphen (hanging hyphen) +/registered % 174 +/macron % 175 +/degree % 176 +/plusminus % 177 +/twosuperior % 178 +/threesuperior % 179 +/acute % 180 +/mu % 181 +/paragraph % 182 +/periodcentered % 183 +/cedilla % 184 +/onesuperior % 185 +/ordmasculine % 186 +/guillemotright % 187 +/onequarter % 188 +/onehalf % 189 +/threequarters % 190 +/questiondown % 191 +/Agrave % 192 +/Aacute % 193 +/Acircumflex % 194 +/Atilde % 195 +/Adieresis % 196 +/Aring % 197 +/AE % 198 +/Ccedilla % 199 +/Egrave % 200 +/Eacute % 201 +/Ecircumflex % 202 +/Edieresis % 203 +/Igrave % 204 +/Iacute % 205 +/Icircumflex % 206 +/Idieresis % 207 +/Eth % 208 +/Ntilde % 209 +/Ograve % 210 +/Oacute % 211 +/Ocircumflex % 212 +/Otilde % 213 +/Odieresis % 214 +/multiply % 215 % OE in T1 +/Oslash % 216 +/Ugrave % 217 +/Uacute % 218 +/Ucircumflex % 219 +/Udieresis % 220 +/Yacute % 221 +/Thorn % 222 +/germandbls % 223 % SS in T1 +/agrave % 224 +/aacute % 225 +/acircumflex % 226 +/atilde % 227 +/adieresis % 228 +/aring % 229 +/ae % 230 +/ccedilla % 231 +/egrave % 232 +/eacute % 233 +/ecircumflex % 234 +/edieresis % 235 +/igrave % 236 +/iacute % 237 +/icircumflex % 238 +/idieresis % 239 +/eth % 240 +/ntilde % 241 +/ograve % 242 +/oacute % 243 +/ocircumflex % 244 +/otilde % 245 +/odieresis % 246 +/divide % 247 % oe in T1 +/oslash % 248 +/ugrave % 249 +/uacute % 250 +/ucircumflex % 251 +/udieresis % 252 +/yacute % 253 +/thorn % 254 +/ydieresis % 255 % germandbls in T1 +] def + +%%EndProcSet +%%BeginProcSet: special.pro +%! +TeXDict begin/SDict 200 dict N SDict begin/@SpecialDefaults{/hs 612 N +/vs 792 N/ho 0 N/vo 0 N/hsc 1 N/vsc 1 N/ang 0 N/CLIP 0 N/rwiSeen false N +/rhiSeen false N/letter{}N/note{}N/a4{}N/legal{}N}B/@scaleunit 100 N +/@hscale{@scaleunit div/hsc X}B/@vscale{@scaleunit div/vsc X}B/@hsize{ +/hs X/CLIP 1 N}B/@vsize{/vs X/CLIP 1 N}B/@clip{/CLIP 2 N}B/@hoffset{/ho +X}B/@voffset{/vo X}B/@angle{/ang X}B/@rwi{10 div/rwi X/rwiSeen true N}B +/@rhi{10 div/rhi X/rhiSeen true N}B/@llx{/llx X}B/@lly{/lly X}B/@urx{ +/urx X}B/@ury{/ury X}B/magscale true def end/@MacSetUp{userdict/md known +{userdict/md get type/dicttype eq{userdict begin md length 10 add md +maxlength ge{/md md dup length 20 add dict copy def}if end md begin +/letter{}N/note{}N/legal{}N/od{txpose 1 0 mtx defaultmatrix dtransform S +atan/pa X newpath clippath mark{transform{itransform moveto}}{transform{ +itransform lineto}}{6 -2 roll transform 6 -2 roll transform 6 -2 roll +transform{itransform 6 2 roll itransform 6 2 roll itransform 6 2 roll +curveto}}{{closepath}}pathforall newpath counttomark array astore/gc xdf +pop ct 39 0 put 10 fz 0 fs 2 F/|______Courier fnt invertflag{PaintBlack} +if}N/txpose{pxs pys scale ppr aload pop por{noflips{pop S neg S TR pop 1 +-1 scale}if xflip yflip and{pop S neg S TR 180 rotate 1 -1 scale ppr 3 +get ppr 1 get neg sub neg ppr 2 get ppr 0 get neg sub neg TR}if xflip +yflip not and{pop S neg S TR pop 180 rotate ppr 3 get ppr 1 get neg sub +neg 0 TR}if yflip xflip not and{ppr 1 get neg ppr 0 get neg TR}if}{ +noflips{TR pop pop 270 rotate 1 -1 scale}if xflip yflip and{TR pop pop +90 rotate 1 -1 scale ppr 3 get ppr 1 get neg sub neg ppr 2 get ppr 0 get +neg sub neg TR}if xflip yflip not and{TR pop pop 90 rotate ppr 3 get ppr +1 get neg sub neg 0 TR}if yflip xflip not and{TR pop pop 270 rotate ppr +2 get ppr 0 get neg sub neg 0 S TR}if}ifelse scaleby96{ppr aload pop 4 +-1 roll add 2 div 3 1 roll add 2 div 2 copy TR .96 dup scale neg S neg S +TR}if}N/cp{pop pop showpage pm restore}N end}if}if}N/normalscale{ +Resolution 72 div VResolution 72 div neg scale magscale{DVImag dup scale +}if 0 setgray}N/psfts{S 65781.76 div N}N/startTexFig{/psf$SavedState +save N userdict maxlength dict begin/magscale true def normalscale +currentpoint TR/psf$ury psfts/psf$urx psfts/psf$lly psfts/psf$llx psfts +/psf$y psfts/psf$x psfts currentpoint/psf$cy X/psf$cx X/psf$sx psf$x +psf$urx psf$llx sub div N/psf$sy psf$y psf$ury psf$lly sub div N psf$sx +psf$sy scale psf$cx psf$sx div psf$llx sub psf$cy psf$sy div psf$ury sub +TR/showpage{}N/erasepage{}N/copypage{}N/p 3 def @MacSetUp}N/doclip{ +psf$llx psf$lly psf$urx psf$ury currentpoint 6 2 roll newpath 4 copy 4 2 +roll moveto 6 -1 roll S lineto S lineto S lineto closepath clip newpath +moveto}N/endTexFig{end psf$SavedState restore}N/@beginspecial{SDict +begin/SpecialSave save N gsave normalscale currentpoint TR +@SpecialDefaults count/ocount X/dcount countdictstack N}N/@setspecial{ +CLIP 1 eq{newpath 0 0 moveto hs 0 rlineto 0 vs rlineto hs neg 0 rlineto +closepath clip}if ho vo TR hsc vsc scale ang rotate rwiSeen{rwi urx llx +sub div rhiSeen{rhi ury lly sub div}{dup}ifelse scale llx neg lly neg TR +}{rhiSeen{rhi ury lly sub div dup scale llx neg lly neg TR}if}ifelse +CLIP 2 eq{newpath llx lly moveto urx lly lineto urx ury lineto llx ury +lineto closepath clip}if/showpage{}N/erasepage{}N/copypage{}N newpath}N +/@endspecial{count ocount sub{pop}repeat countdictstack dcount sub{end} +repeat grestore SpecialSave restore end}N/@defspecial{SDict begin}N +/@fedspecial{end}B/li{lineto}B/rl{rlineto}B/rc{rcurveto}B/np{/SaveX +currentpoint/SaveY X N 1 setlinecap newpath}N/st{stroke SaveX SaveY +moveto}N/fil{fill SaveX SaveY moveto}N/ellipse{/endangle X/startangle X +/yrad X/xrad X/savematrix matrix currentmatrix N TR xrad yrad scale 0 0 +1 startangle endangle arc savematrix setmatrix}N end + +%%EndProcSet +TeXDict begin 52099146 40258431 1000 600 600 (smptalk.dvi) +@start +%DVIPSBitmapFont: Fa cmsy8 16.59 2 +/Fa 2 50 df<4AB47E021F13F891B6FC010315C04981011F15F849814901007FD9FFF0EB +0FFF4801C00103138048496D13C049C8127F4848ED3FE04848ED1FF049150F4848ED07F8 +003F17FC491503491501007F17FEA290CAFC4817FFA248177FA86C17FFA26C17FE6D1501 +A2003F17FC6D15036D1507001F17F86C6CED0FF06D151F6C6CED3FE06C6CED7FC06D6CEB +01FF6C6D4913806C01F0010F13006DB4EBFFFE6D90B55A6D5D010715E06D5D010092C7FC +021F13F802011380383878BE49>14 D<912601FFE0953801FFE0021F01FE061F13FC027F +D9FFC094B67E49B600F0040381010703FC040F15F04903FF4C9038E03FF84904C0923A7F +FC0003FC4970DBFFF0EB00FE90267FF0006E02030180143FD9FF80011F01FC4A90C86C7E +4848C700076DDA0FFC6F7E48486E6DDA1FF0ED03E0D807F002006E494882496F6D494815 +0148486F6D49486F7E49030F6D4848CA127C001F706D485A90C96CD9FC07183C003E704B +173E716D4848171E48724848171F72EBBFC0007871D9FF80838400F87191CB1380725B48 +2007725B727F84737E737F87737F4F7F6C200F4F7F007895B56C180087007C4D486D5F4E +486C7F003C4D486C183E003E4D486C7F001E051F6F5E001F4E6C6D16FC4E486C6D5E6C6C +9326FF800301FE15016C6C4B496C6D4B5A6D4B486D6E140700034C486E01E0EC1FE0D801 +F8DB1FF86E6D4A5A6C6CDB7FF06E01FCECFF80017E4B4802079026FF800790C7FC6D6C01 +0701806E91B55AD91FE0011F90C86C5E90280FFE03FFFC6F6C5D6DB648041F5D010103E0 +040715C06D0380040192C8FC021F01FCCB003F13FC020301C0060313C0813D78BB92>49 +D E +%EndDVIPSBitmapFont +%DVIPSBitmapFont: Fb cmmi8 16.59 1 +/Fb 1 102 df<923801FFE0031F13FC92B6FC020315C0020F9038807FE0913A3FFC000F +F0DAFFF013074901C0EB03F84990C71201D90FFE15FC49481400495A495A4948140118F8 +485B484914034817F091C8120748EE0FE04848ED1FC0EF7F80933803FF004848EC3FFE92 +387FFFF890B712E04893C7FC16F003E0C8FC01F8CAFC12FF5BA55BA5127FA2180C181E00 +3F173F6D167E18FE001FEE01FC6DED03F8000FEE0FF06C6CED1FE0EF7FC06C6C913801FF +006C6CEC07FE6C01C0EB3FF8903A7FF007FFE0011FB612806D4AC7FC010114E09026003F +FEC8FC383D7ABB44>101 D E +%EndDVIPSBitmapFont +%DVIPSBitmapFont: Fc cmmi8 19.907 6 +/Fc 6 106 df<EFFFF0041F13FF93B612E0030315F8030F81033F9038C03FFF9227FFFC +00077F4A01F06D7F020701C06D6D140F4A496D6D1580DA3FFEC86C6C141F4A486F7E4A48 +7015004949031F5D49498249496F6D133E495B491B7E4990C96C7F494862874948624872 +14015C4874485A485B525A485B734A5A5A4A4F5A5A52C7FC5C481B7E1CFE91CA5D1BF1B5 +F1F9F8F3FBF04919FF6464A2644997C8FC6363A263A485127FA2611907003F606D5F001F +187F6D4D6C6C131E6CDD03FE153E6C6DED0FF895383FF03F6C6DDBFFE0157E6C6D020390 +26801FFE13FE6C6D91261FFE004A5AD97FFCDAFFF86D6C485A90271FFF801F01E06D130F +6D90B600806DEBFFF001034BC76C14C0010003F06E6C5B023F02806F48C7FC020301F0C9 +EA07F8614B79C871>11 D<EA03F8EA0FFE487E4813804813C0A2B512E0A76C13C0A26C13 +806C13006C5AEA03F81313719231>58 D<F10780F10FC0F11FE0A3193F1AC0197FA21A80 +19FF1A00A260611803A261180761A2180F61181FA261183F61A2187F6118FFA296C7FC5F +60A21703601707A260170F60A2171F60173FA260177F60A217FF95C8FC5EA25F16035FA2 +16075F160FA25F161F5FA2163F5F167FA25F16FF94C9FCA25D5E1503A25E15075E150FA2 +5E151F5EA2153F5E157FA25E15FF93CAFCA25C5D1403A25D14075DA2140F5D141FA25D14 +3F5DA2147F5D14FFA292CBFC5B5CA213035C1307A25C130F5CA2131F5C133FA25C137F5C +A213FF91CCFC5AA25B12035BA212075B120FA25B121F5BA2123F5B127FA25B12FF90CDFC +A3127E123C43A576FB58>61 D<030FB600E0090FB612804B6F093F15C0856BA0B7FC6F23 +80DB00015302F8C7FCDC003FE203DF13C0726C65E8079F90C8FC057F525AA2057E0A1E5B +223C726C1B7F05FE1C7805FC0AF05BA29E3801E0FF0401525A05F866726C4F5AF90F0116 +0305F0091E5C213C6A04076D6D187805E06621F056485A160F05C0E003C05C726DEF0780 +6A041FF30F000580081E5DA2565B043F634D6C6D98C9FC6855485B5E047E50485C555A72 +6D197F04FE50C7FC4C081E5DA25514FF0301634C66726D5E54485B15034C4F485D545A69 +03076F6C4BC7FC4C071E5EA2545C150F4C4F5E736C5D69031F4F5A4C4E485EA253485C03 +3F4FC8FC93C86C6C97CAFC1D1E535D5D037E4F5E65736D177F03FE4E5A4B4E485EA25248 +15FF02014FC9FC4B6F01C0601C1E525D14034B4E5F6468020770EBE1E04BDDE3C05FA2E1 +E7805D020F06EFC9FC4B667313FE021F6563023F4E60A2027F4E5E02FF705B01036D5290 +CBFC010F6D4D84017F01FE4D0303B512E0007FB600FE073FB712FEB794C85A704B864C03 +7E621A7C287FF8007FFC03306FD900015BAA7177F0A9>77 D<DFFFF81570061FD9FFC0EB +01F895B612F0050303FCEB03F0050F03FF1307053FD9800FEBC00FDDFFF8C7EBE01F4C01 +E091391FF03FE004070180913807F87F4C48C83803FCFFDC1FF8ED00FEDC7FF0047F13C0 +4C5A4B49824B49824B90CA6C13804B5A4C834B5A033F1A004C83157F4B5A654A491701A2 +5C4C60A25CA265A35C65821C03A270715A7094C8FCA2826E7F82707E17E06E14FEEFFFE0 +6E15FEF0FFE06E16FE6FEDFFE01AFC6F16FF6F17C06F17F00303836F836F6C82041F8204 +0783DC007F821707DD007F811807DE007F8019071900083F7F868686747F86A286A30138 +197F137C13FC645BA21201A264A200031AFF64A2505B1207A2505B6D4E90C8FC120F505A +6D611A1F486C4E5A505A6E4D5A6E4C5B486D4C5B6E4C90C9FC6E4C5A02FEEE3FFC277FF3 +FF804B5A01E101E0913803FFE09026C07FFE020F5B9027803FFFF090B5CAFC26FF000F90 +B65A486D16F8020116E048D9003F158048020702FCCBFC48DA001F1380657776F36B>83 +D<163FEE7F80923801FFE05D5DA25DA417C0A26F1380923803FE00ED00F893C7FCB3A4EC +3FE0ECFFF8010313FE010F6D7E4980D93FE07FEB7F809039FE007FF0485A4848805B1207 +5B485AA2484813FFA248C7FC5C127E5E007C5B12FC4A5B5A5E5C1270C7485BA293C7FC5C +A25D147FA24A5AA25D5BA2495BA25D5BA25D491538177C495B17FC92C7FC4915F8160149 +5A17F04A1303A2EE07E0495AEE0FC0A2EE1F80017F143F4AEB7F00167E6E13FE013F495A +ED07F890391FFC1FF06DB55A6D1480010191C7FC6D13FCEC1FF02E707AED3C>105 +D E +%EndDVIPSBitmapFont +%DVIPSBitmapFont: Fd lcmss8 16.59 1 +/Fd 1 53 df<EF0FFF4D7F4D7F5FA294B5FC5E5EA2EE07FB160FA2EE1FF3163FEE7FE3A2 +EEFFC35D4B138317035DED0FFE151F16FCED3FF8157F16F0EDFFE05C4A13C016805C4A13 +004A5A5D143F4A5A4A5AA2495B495BA2495B4990C7FC495AA2495A495A13FF5C485B485B +5A5C4890C8FC485AA2485A485A12FF90BB12801BC01BE0A56C1AC06C1A80CA000301C0C7 +FCB3A3715B7190C8FC4B5C7BDB56>52 D E +%EndDVIPSBitmapFont +%DVIPSBitmapFont: Fe cmsy8 19.907 3 +/Fe 3 108 df<ED1FFF4AB512F0020714FC023FECFF8091B712E04982010716FC498249 +824983498390B97E48844884A248844884A24884A3481980A24819C0A4BB12E0AD6C19C0 +A46C1980A26C1900A36C60A26C606C60A26C606C606D5F6D5F6D94C7FC6D5E6D5E010116 +F06D5E023F1580020702FCC8FC020114F0DA001F90C9FC434376CA58>15 +D<F51F80537EA28A777EA2777E1D078A777EA2777E8B89787E8B787E1E1F787E8B787E78 +7E787F787F797E797E003FC07E488BC17E7A7E8D8D6C20F86C8CD3EA1FFF7A7F0E0313E0 +7A13F89D38007FFE7B6C7E0F0F13E07B13FC0F0113FF7B6C13E0101F13FE1007EBFFC010 +0114E07C7E58B5FC100714C0101FEBFE00107F13F09FB512800F0301FCC7FC0F0F13F057 +1380E77FFEC8FC575A5613F00E0713C05690C9FC565A003FC112F84868C25A21809ECAFC +686C676C67D26C5A555A68545B5490CBFC545A545A67545A545A1E7F67545A5390CCFCA2 +535A661D07661D0F535AA2535A66A2775A9B6076D8B0>41 D<003CED01E0007EED03F000 +7F15074816F8B3B3B3B3B3B3B3B3B06C16F0007E1503003CED01E02DA66BFB58>107 +D E +%EndDVIPSBitmapFont +%DVIPSBitmapFont: Ff lcmssb8 19.907 17 +/Ff 17 124 df<387FFFFEB6FCB3A46C13FEC8FCB3B3A5387FFFFEB6FCB3A46C13FE1859 +6DD83F>58 D<001FB500FC9AB612E04802FF0A0315F8486F63B76C5115FC7063A27063A2 +7063A27098B7FCA27062A27062A27161A37161A27161A202FB6E4F5BA202F96E4F5BA202 +F86E96B55AA26F6D4E5CA26F6D4E5CA26F6E4D5CA26F6E4D5CA26F6E4D5CA26F6E4D5BA2 +6F6E4D5BA26F6E94B55AA2706D4C5CA2706D4C5CA2706E4B5CA2706E4B5CA2706E4B91C7 +FCA3706E4B5BA2706E4B5BA2706E92B55AA2716D4A5CA2716D4A5CA2716E495CA2716E49 +5CA2716E4991C8FCA2716E495BA2716E495BA2716E90B55AA2726D485CA2726D485CA272 +02875CA27202CF5CA27291B6C9FCA2725EA2725EA3725EA2735DA2735DA2735DA2735DA2 +7392CAFCA2735CA2735C736C13F0081F13C06C4994CD6C13F87E6C01C00D1F13E096716E +F0BB>77 D<051FB57E0407B7FC047F16F80303B9FC031F18F0037F18FE4ABB7E02071AF0 +021F1AFC4A8691BCFC5B5B5B49635B499238F8000F4992C87E90B600F015074803C01501 +484ACA6C5B4B171F4802F017074B83484A834B716C5A481B3F92CC121F1C0F1C07481B03 +765A6F725A9AC7FC8181818115FEEDFFC06C15F8EEFFC017FEEFFFF86CEFFFC019FF6C19 +F81AFF6C1AE01BFC6C1AFF6C1BC01CF06D866D1AFE6D866D1BC00103876D876D87023F86 +6E8602078602011B80EC003F030F1AC003011AE0ED003F040119F0EE000FDD003F17F818 +01DE000716FCF1007F1A071A01E0003F14FE871B078787A2871206000F87EA1FC07F6D1C +FC7F7F01FF97B5FC486D1BF802E06002F84E14F06E6002FF4E14E04802C0173F03F84D14 +C003FF4CB6FC04E0030F158004FE037F1500DCFFF8010FB65ABE5AA2651DE0656C64001F +99C7FC00071BFCC663013F1AE001071A8001004FC8FC020F18F8020118C0DA000F4CC9FC +DB007F15E0DC007F01F8CAFC677776F37E>83 D<001FC312FC4822FF5AC51280A86C2300 +A2001F22FCCC001F02FCCDFCB3B3B3B3B3A5735C857314E0917078EFA2>I<93380FFFFE +0307B612F0037F15FE0207B812C0023F17F091B912FC010718FF011F19C0017F8590BB12 +F887879326FE001F8004C0010315804BC76C15C003F06E7E03C06F14E092C96C14F0D97F +FC824A19F802E0824A19FC4A8291CAFC017E1AFE017C83131090CBFCA996B6FC0507B7FC +4CB8FC163F0303B9FC153F4ABAFC140F023F160191B712800103EDF800010F15C0494AC7 +FC017F14F090B612C0485D484AC8FC485C485C485C5D485C5D5A92C9FCA2B6FC5CA561A2 +806C606F5DA26F5D6C6E5D6F92B6FC6C6E5C03FE14076C6E6C133F9339F003FFFD6C92B6 +12F96C18F119E16C18C16C18816D1701011F16FC6D16F06DDCC00014FC010193C7FC6D6C +02F8023F13F0020F02C091C8FC020001F8CBFC575E79DB6B>97 D<94387FFF80040FB512 +FE047FECFFC00303B712F0030F16FE033F707E92B97E020318F04A84021F844A18FF4A85 +91BB7E49EDF80749922680007F80494AC7001F804902F8020780494A80494A6E80494A80 +90B6486F7F93C9FC484A707F5D48731480485C4B82481CC05DA2484A82A2481CE05DA248 +91BBFCA5BEFCA21DC0A21D004ACEFCA780A27EA381A27E81A27E817E816C1B0E6F181F6C +6E60646C6E606C6E5F7016076D6E5E6D6E043F13806D6E5E04FC4BB5FC6D6E15076D6E6C +143F6D03F049B6FC6D03FE133F6D6C91B9FC6E1A006E61020719F86E19E002001980033F +95C7FC030F17F8030317E003001780041F03F8C8FC040315C0DC000F01F0C9FC5B5E7ADB +68>101 D<94381FFFFC0407B612F0043F15FE4BB8FC1507151F157F4AB9FC5C140F5C5C +5C9438FC007F91B600E0130F4992C712034C14004C157F49183F1A1F1A041A00A7001FB9 +FC4818C05ABA7EA76C60A2001F95C7FCD8000302FCC9FCB3B3B3B36D5C7F6E13E048757B +F445>I<001FB5FC4814C05AB612E0A76C14C0A2001F1400C9FCAE3807FFFE48EBFF805A +4814C0B3B3B3B3AB6C14807E6CEBFE001B7476F331>105 D<381FFFF84813FE5AB6FCB3 +B3B3B3B3B36C13FE7E6C13F8187374F231>108 D<95267FFF8094387FFF800507B500FC +0407B512FC261FFFF0023FDAFF80033FECFF804801FC91B700E092B712E048030304F802 +0316F8B56C010F04FE020F16FE043F70023F824C7149178093B96C90B912C04B724818E0 +0307DEF00718F04B610AF819F84BD9E0034CEBE0034B48C76C6E4848C76C14FCDB7FF002 +1FDB7FF0141F4B486E6E48486E14FE04806E04808091B5C86C91B5C87E4B6F4B814B4F18 +FF4B614B6F4B814B61A24B61A24B61A392CA92CAFCB3B3B3A46C4971497113FE6C73856C +01F87101F87113F8985B74DAB1>I<95387FFF800507B512F8261FFFF0023F14FF4801FC +91B712C048030316F0B56C010F16FC043F824C8293B91280030318C04B18E05D4B18F0EF +C0074B48C715F8DB7FF0143FDBFFC0020F14FC5E91B5C87E4B814B18FE5D4B815DA25DA2 +5DA392C9FCB3B3B3A46C497014FC7E6C01F8053F13F0575B74DA70>I<94381FFFC00403 +B512FE043FECFFE093B712F8030716FF031F17C0037F17F04AB912FC4A84020F727E4A85 +4A854A8549B6D8F80015FC490380010F804902FCC70001804902F06E6C8004C0151F494A +6F804991C96C804949708090B54870804B824888484A717F4B8348884B83481D80A24B83 +481DC0A2481DE0A34891CB6C14F0A5B61BF8AD6C1DF0A36F5FA26C1DE0A36C6E4D14C0A3 +6C6E4D1480A26C6E4D1400A26C6E94B55AA26C6E4C5C6C6E4C5C6F5E6D6E4B5C6D02E003 +3F5C6D6E4B5C6D02FC4AB65A6DDAFF80010F92C7FC6D03F890B65A6D92B85A6D626E616E +61020F19806E96C8FC020118FC6E6C17F06F5F030794C9FC030116FCDB003F15E004034A +CAFCDC001F13C0655E7ADB72>I<F03FC0943803FFE0261FFFF0140F4801FC147F484BB5 +FCB56C5B160F5E5E5E93B6FC5D5D5D5D5DA25D4B15C0F0C00092B500F8C7FC178091B548 +C8FC16F816E0168093C9FC5D5D5D5D5DA25DA25DA392CAFCB3B3AE6C5B7E6C13F83B5B74 +DA4B>114 D<0303B57E92B7FC020716F0023F16FE91B912C0010318F84918FE4984133F +5B90BBFCA24861489138FC000703E0EB003F4891C812074A15014849ED007F4AEE1FFC48 +18074A16031901F1007848193097C7FCA2808080808115F015FE6CECFFF8EEFFC017FF6C +17F018FCF0FF806C18E06C8419FC6C846C727E6D846D846D846D846D8413016D84023F83 +140F02031880EC007F1507DB001F16C0EE007F1703DD007F14E0181F18078484000C8312 +1E001F847F487E7F6D19C013FC6D94B5FC486C7E6E4B148002F05D02FC5DDAFF804A1400 +03F0147FB70107B55A93B75AA262626C61001F61000761000196C7FCD8003F17FC010F17 +F0010117C0D9001F93C8FC020115F0DA000749C9FC4B5E7ADB57>I<91381FFFF04A13FC +5C91B57EB3A4001FBAFC4819C05ABB12E0A76C19C0A2001F1900C74AC9FCB3B3B282A21A +701AF86E6E13011907F10FFC71133F7113FF6EECF00F94B612FEA280A26E17FC1AF06E17 +C06E17006E16FC6E16F06F15806F02FCC7FC030F14C0030101F0C8FC47747CF152>I<26 +1FFFF894383FFFF04801FE94B512FC5AB64C14FEB3B3B3A261A461A361A261617E616F92 +B6FC606CEF07FD6F140F6C6EEC3FF96FECFFF16C02FF130793B612E16C18C16C18816C18 +016C17FE6D16F86D16F0010FDCC00014FC010393C7FC010003FC023F13F0021F02F091C8 +FC020091CBFC575B74D870>I<001FBF12FC007F1EFFA2C11280A76C1F00A2001F1EFC71 +0D80BD72>123 D E +%EndDVIPSBitmapFont +%DVIPSBitmapFont: Fg lcmssi8 19.907 31 +/Fg 31 122 df<EB7FFE90B5FCA35A14FEA35A14FCA514F87E38007FF013FF14E014C05A +14805A14005A5B485AA25B121F5B485AA2485AA2485AA290C7FC127E1827718F39>44 +D<F307FF091F7F517F98B57EA2508062A2625080A262628962F2FFFB1BF34F814F13E31B +C34F13C14F138109017F61F13FFE507E077F824F5AA24E497F4E4981A24E5B4E5B767F4E +90C7FC4E5AA24E486E7F4E5AA24D5B4D496E7FA24D5B4D5B8A4D90C87E4D5AA24D48834D +4881A24C5B4C4983884C5B4C5B4C8695CAFC4C5A167F4D854C48835D5F4B5B4B874D834B +5B5D94CB804B4884157F93BCFC92BD7E5CA25C4A88A25C5C8B5C4A48CC12035D4A488749 +875D495B491E804B85495B5B92CE14C0494887137F5C49481DE05A4A87485B481FF05C48 +49875A91CFFC48481EF8007F895B485A49886C487613F001800A0013E0757378F285>65 +D<0807B512C00703B77E073F16FC4EB97E060F18F0067F18FE4DBB12C0170F053F1AE094 +BC12C05E04079238FC0007041F92C8001F14804C02F0150393B60080DB007F13004B4ACA +120F030702F017034B02C0715A4B91CC127E037F49191C92B500F896C7FC4A14E04A5C4A +5C4A49CFFC4A5B4A5B4A5B91B55A495C5E4991D0FC495B495B5D495B5B5D495B90B55AA2 +4891D1FC5C5A5C5A5C5A5CA25A5C5A5CA35A5CA4B5FC91D2FCAD80A27EA380A27E80A26C +7FA26C7FA26C7F807E806C80816C806D6DF103806D6D190F03FEF17FC06D6D4E485A6D02 +C017076D6E171F6D02FC94B5FC6D02FF16076D03E0157F023F02FF023FB6FC6E92B9FC6E +98C8FC02031AFC02001AF0033F1980030F4EC9FC030318F003001880041F04FCCAFC0401 +16C0DC000702E0CBFC737566F284>67 D<DB7FE0F23FF04A486CF2FFF8701BFC4A6D4F13 +FEA34A63A24C1BFCA34A63A24C1BF8A34A63A24C1BF0A24A63A24C1BE0A34A63A24C1BC0 +A391B562A293CD1480A24999B5FCA24B1C00A34963A24B63A34963A24B63A2496392BDFC +67A35BA267A35BA203C0CC001F5BA34963A24B63A290B562A292CD5CA34899B5FCA24A99 +C7FCA34863A24A63A24863A24A63A34863A24A63A34863A24A63A34863A24A63A24863A2 +4A63A3B562A291CD5CA36C487490C8FC003F87D81FF8F20FFC77716DF086>72 +D<037FB712804AB812C01AE04A17F0A41AE0A26E17C06E6C1680DB001F01F0C7FCA260A3 +5EA260A25EA260A393B5FCA295C8FCA35DA25FA25DA25FA35DA25FA35DA25FA25DA25FA3 +5DA25FA35DA25FA392B5FCA294C9FCA25CA25EA35CA25EA35CA25EA25CA25EA35CA25EA3 +5CA25EA35CA25EA291B5FC001FB712E04816F84882A2B8FCA56C5E7E6C16E044717CF035 +>I<ED7FE04A487E824A7FA35CA25EA35CA25EA35CA25EA25CA25EA35CA25EA391B5FCA2 +93CDFCA25BA25DA35BA25DA35BA25DA25BA25DA35BA25DA35BA25DA35BA25DA290B5FCA2 +92CEFCA35AA25CA35AA25CA25AA25CA35AA25CA35AA25CA35AA25CA25AA291BB12FC1CFF +1D80BEFCA56C1C007E6C1BFC59716DF075>76 D<92267FFF80993801FFF84AB500E00A07 +13FC710A1F13FE4A5513FF7164A24A9CB6FC69711EFE69695C716304BF524813FCA2575A +4AD99FFFF37FF9A2041FE2FFF113F8684A6F63705113C303FE5215F0721B83561303027F +6D515BF83FFE03FC6E08FC14E0207FF8FFF802FF6D525A726003F85101E014C021C0496E +505C724E138003F00B0014806770505A49704F5B1F7F4B51481500057F62725F4952495B +684B013F4E5E724D5B499BC712FF664B6D4E485D735F1E7F4952485B716192C76E4B5F53 +5B535B496F63734B5B4A5090C75CA2714D5A017F714B485CA24A50485E714C5B01FF7161 +525B4A4F495E7160735C485190C85A654A037F033F60734A5A654809FF5E063F4A5B4A50 +94C7FC735B4850495D725E4A4E60744890C9FC644871023F17FF644A7148485F1BFF725D +4807C1495D1AC391C902E3495F7201E75BA24807EF90C95AF2FFFE49704A60A2007F505E +63497063636300FF726063497190CA5CF11FFCF10FF06C4894CC6C5B003F8BD81FC07848 +C8FC98716CF0A9>I<92267FFFC0F11FC04AB500F0F17FE0711AF04A6EF1FFF8A2834A63 +A2711AF0A2844A63A2049F6D19E0A34A018F6D5FA204076D19C0A24A63707F03FE1C80A2 +707F027F63707F4B1C00A2717E02FF63717F4B63A2496F6D167FA24B63717FA2496F6D16 +FFA24B63717FA24963717F4B63717F4963A24B6E6C5FA349706D5CA292C86C6D5EA34970 +6D5CA24A6F6D5EA3017F706D5CA24A99C7FC727F01FF63727F4A63A2737E481C7FA24A70 +6D5CA2737F481CFFA24A706D5CA248726D5AA24A637313F8A248637313FC4A637313FEA2 +4863F27FFF91CB5EA2741387481B8F7413CF4964A2007F7390B5FCA2497292C8FCA300FF +85A2496386A26C48725C003F86D81FC0071F13F075716CF086>I<037FB912F04ABB12E0 +1DFE4AF2FFC01EF81EFF4A1CC01FF08B1FFE8B4A01F8CA003F810A0015E04C060F800B01 +80777E4A091F7F0C077F4C737F8A4A877913805E8B21C05CA24C86A391B563218093CEFC +A249531300A24B515A66545B5B545B4B081F5B545B545B4951B55A0B0791C7FC4B071F5B +9AB55A49080714F00A7F5C4B053FB6128092BDC8FC1EFC491CF01EC053C9FC1DF81DC049 +50CAFC1CE009FCCBFCA203C0C800017F4983874B707F8690B5858692CA80747F86488786 +4A85747FA248737F874A86757F5A757F4A8489757F5A757F4A8489757F5A767F4A858A76 +7F5A767F5C767F48757FA24A737FA2767FB5757FA291CE6C7FA2896C4887123FD81FF809 +0390C8FC7A716DF087>82 D<0707B57E4EB612FE061FEDFFE095B812FC0507EFFF80051F +18E0057F18F84CBA12FE0407F1FF80041F1AC05E93BCFC4B9238F800074B92C8003F1480 +4B02F015034B0280ED007F4B49CA001F13004B01F017074B498392B50080EF00FE4A91CC +127E4A01FC193C4C96C7FC4A5B5E5C5E4A5BA25C93CFFCA45CA282A282A26E7F8216FC82 +6EEBFFC017F06E14FF18F06EEDFF806E16FCF1FFE06E17FF6E18E06F17FC6FEFFF80030F +18E06F18F80301846F6C17FF041F84040784040084051F83050083060782DE003F811903 +DF001F80080181F2003F090F80871B017580888888A288A488A36466A3525BA25290C7FC +646500071BFFD80FC04F5B6D61486C4F5B01FC071F5B48B44F5B02C095B55A02F005035C +4801FE050F91C8FC6E6C043F5BB600F84BB55ADBFF80020F5C04FE0103B65A6C92B95A00 +1F1B80000798C9FC00011AFC6C6C19F0011F19C0010396CAFCD9007F17FC020F17E00200 +94CBFC030F15F0DB000F01FCCCFC6A7775F373>I<001FC212C0007F21E0C312F0A222F8 +A322F0A26C21E0001F21C0CC6C01C0CCFC63A396B5FCA298CDFCA260A262A360A262A360 +A262A260A262A360A262A360A262A260A262A395B5FCA297CEFCA35FA261A35FA261A25F +A261A35FA261A35FA261A25FA261A35FA261A394B5FCA296CFFCA35EA260A25EA260A35E +A260A3705B827013C0857062EF94>I<D81FFCF63F80D87FFEF6FFC06D1D03B56C646E64 +21806C665513006E525AA26C545A545B6E656C65545B6E65666C535B5490C7FC80545A6C +535AA26E505B6C525B67656E505B6C66656F4F90C8FC535A7E535A6F4E5B666D62525B6F +626D62525B6F97C9FC646D505A525A81515B6D4F5B656F5F6D4F5B65636F4D90CAFC6D62 +1B7F6F4D5A505B6D6262704B5B6D6262505B7094CBFC6E5F505A63704B5A6E5E4F5B636E +6D5C4F5B63705C6E4C90CCFC62197F704A5A6E5F4E5B60705D6E4B5B60626E6D4990CDFC +60614E5A6E6E485AA205815B05835B8105C75B05CF5B8105DF90CEFCEFFFFEA26F5C6060 +A26F5C60A26F5C95CFFC6F5B6F5B6F13E07A7264F085>86 D<94383FFFE0040FB512FC93 +B77E030716E0033F16F84AB87E020783021F83027F188091BA12C0DDFC0314E04CC7123F +04E0020F13F04949C86C13F803F88103C06F13FC92CAFC14FCD900F0EF7FFE146091CBFC +1A3FA91A7F1BFCA31AFF1BF8A296B5FC0507B6FC4CB7FC043F16F00303B8FC151F92B9FC +0203EDFE03020FDAFE0014E0023F148091B500F8C7FC010314C04949C85A011F01F817C0 +4913C0495B4948C95A4801F81880485B485B485B4A5E4890CA14005B123F495F127F4960 +A2197FA200FF18FF4E5BA260606D161F6C6C4C5B6D93B5FC6E14036E140F6C01F891B65A +02FF010F13FD92B612F96C17E318C36C05035B6C16FE6C16F86CDCC0015B6C93C7FC013F +02F86EC7FC010F028091C8FC010301E0CBFC4F5B71D862>97 D<157FEDFFC04A7FA25CA4 +5CA25EA35CA25EA35CA293CCFCA25CA25DA3027FED1FFE4DB512E04B010F14F8053F14FE +94B77E02FF010382040F824B48824C824991B87E03F9834BD9FC008003F701C0130F92B5 +C7000314804902FC020014C004F08104C06F13E04C150F93C914F04949824B824B18F84B +82495B4B824B18FCA21B7F5BA292CBFCA35BA25CA3137FA25CA213FF1BFF4A19F8A34861 +1CF05C621CE05A624A19C0A248611C804A5F501300A2484F5A505AA24F5B61484E5B4F5B +6E5E4F5B6E4C5B484DB5C7FC6E4B5B060F5B6E4B5B486D037F5B6E0203B55A01FC01C001 +1F5CDBF801B65A6EB8C8FC00FF18FC6E5E496C5E6E16C06E93C9FC6C486C15FC003F6D15 +F0271FC0007F14C0C8001F49CAFC030113C056756FF267>I<943803FFFE057FEBFFF004 +03B612FE040FEDFFC0043F16F093B812FC030383030FEFFF80033F18E05D92BA12F00203 +9126FC000F14E04A02C0EB007F4A49C8120F4A01F8030313C04A01E015004A49163F91B5 +CAEA1F8049491707494994C7FC4913F05D495B495B5B92CDFC495A495AA2485B5C5A5C5A +5C5A5CA24890CEFCA25A5BA3127F5BA412FF5BAA7FA2127FA37F123F1A1C6D183E6C197E +6EEE01FE6E16036C6D1607191F6C6D167F6C01FCED01FF6E15076C6D6C023F5B6C02E049 +B5FC03FE013F14F06D90B85A6D18806D95C8FC6D17FC010317F06D17C06D6C93C9FC021F +15FC020715E002004ACAFC030F13C0545B6FD85C>I<F43F80F47FE0F4FFF0A263A463A2 +1DE0A363A21DC0A363A21D80A263A21D00A3DD1FFE5C4CB512E0040F02F85C043F14FE93 +B7FC0303EEC07F030F16E0033F04F05B4B16F84AB813FF4A834A9226007FFE5B4A02E013 +074A91C76CB5FC4A01FC14004A01F08191B500C06F5B4991C97E495B4901F882495B4B70 +5B495B495B92CAFC49486113FF5C48495FA24849615C5A4A5F5A4A96C7FC5A91CBFC625A +4961A21A7F127F4961A31AFF12FF4961A361A263A261A263A36D5FA2007F4E5B617F6100 +3F606D94B55A606C6D5D6E5D6E5D6C6D4B91C8FC6E157F6C6D92B6FC02FF020313BF6C02 +E0010FEB3FFE6C02FEEBFFFE6C91B612FCF0F87F6D16F06D04E05B010F16806D16006D03 +FC6D5A010003F0131F023F02C0EB0FE0020F49CCFC020013F05C756FF267>I<94380FFF +804CB512F8040F14FF043F15C093B712F0030382030F16FE4B82037F178092B912C01403 +4ADAFC0114E04A9126C0001F13F04A49C712074A01F8020113F84A01E08091B50080ED7F +FC4991C9123F4949EE1FFE4913F84B160F495B4949EE07FF495B92CAFC495A13FF4A8348 +5B5C5A5C5A5C485B62A24890CBFCA291BBFC481AFEA35AA21BFC1BF81BF001F8CDFC12FF +A45BA37FA4127FA27FA3123F7FA26C6C181C1A3E6C6D17FE6E16016C6D16076E160F6C6D +163F6E16FF6C6D15036C6D6C021F5B03F049B5FC6D01FE011F14F06D90B85A6D18806D95 +C7FC6D17FC010117F06D17C0023F93C8FC020F15FC020315E0DA007F91C9FC030713E050 +5B70D85C>I<943801FFFE051FEBFFF094B612FE040715FF161F167F93B8FC030316FE5D +5D5D4B9038FE000F4B01C0EB00FC92B5C812184A01F815005E4A5B5E5CA25C5EA45C93CA +FCA35C5D001FB812C04817F05AB97EA56C5F7E6C17C0C701F8CAFC5BA25DA35BA25DA25B +A25DA35BA25DA35BA292CBFCA35BA25CA2137FA25CA313FFA25CA35AA25CA25AA25CA35A +A25CA35AA25CA35AA291CCFCA25AA25BA3127FA25BA36C5A121FEA0FE048756AF43F>I< +DE1FFEEC0FE04DB500C0EB3FF0050F02F0EB7FF8057F14FC4CB66C14FC04076F13FF041F +824C7013F893B87E4B17E1030717F14B4AC601F913F04B02E0131F4B91C7120F4B01FC02 +03B5FC92B500F0804A02C017E04A91C9FC4A49824A5B16F04A497013C04A5B4A5B93CA7E +4A481980495BA2495B5D49491900A2495B63495B6492CBFC5B4A187F137F645C1BFF13FF +4A61A262A3484F5BA362A2505BA2627E6E4D5B62A26E94B5FC6D6C5E4F5C6F5D6D6D5D6F +5D6D6D5D6FDB7FDF90C7FC6D6D913801FF9F03FF4A131F6D02E090381FFE3F6D02FEEBFF +FC93B600F85B6D17F06DEFE07F6E16C0021F04805B6EEDFE006E5D020103F013FF6E6C14 +C0030F49C75B030013F093C9FC6163A34F5BA263614F5B614F90C8FC4F5A4F5A003C5F00 +3F05075BD87FF04C5B01FE043F5BD9FFF04AB55ADAFFC0011F5CBBC9FC6119F86119C06C +60001F4DCAFC000117F8D8001F16C001004BCBFC020114E05E7376D767>I<157FEDFFC0 +4A7FA25CA45CA25EA35CA25EA35CA293CCFCA25CA25DA3027F923807FFC0067F13FC4B01 +03B67E050F15E0053F8102FF91B77E0403824B48824C8249143F4C17804BB5EA001F03F1 +01F0010114C003F301806D7E4901F790C87EDBFFFC81DBEFF06F13E0EDFFE04C81495C93 +C9FC5D5D495B1CC05D5DA249495EA24B1880A292CAFC4960A24A1900A3017F60A24A60A2 +01FF187FA24A60A34819FFA24A60A34860A24A60A24860A24A60A34860A24A60A34860A2 +91CA5CA34860A24996C7FCA2007F60A24960A300FF187FA24960A36C48715A003F181FD8 +1FC0EF0FE053736FF267>I<EDFFC0020313E04A13F0A24A13F8A216F0A35CA216E080A2 +6E13C06E130091C8FCAEEC1FC0EC3FF0147F4A7EA45BA25DA35BA25DA35BA25DA25BA25D +A35BA292C7FCA35BA25CA3137FA25CA213FFA25CA35AA25CA35AA25CA25AA25CA35AA25C +A35AA291C8FCA35AA25BA2127FA25BA312FFA25BA36C5A123FEA1FC025746FF32E>I<15 +7FEDFFC04A13E0A25CA45CA216C0A35CA21680A35CA21600A25CA25DA3147FA25DA314FF +A25DA25BA25DA35BA25DA35BA25DA25BA25DA35BA292C7FCA35BA25CA3137FA25CA213FF +A25CA35AA25CA35AA25CA25AA25CA35AA25CA35AA291C8FCA35AA25BA2127FA25BA312FF +A25BA36C5A123FEA1FC023736FF22E>108 D<952607FFE0933801FFF8067F01FE041FEB +FF80DA1F800103B600C092B612F0DA3FE0010F6F020381027F023F03F8020F15FE4A6C90 +B76C023F814C704A168004077049B812C04C714817E0494A60047FDDC01F17F04BB5D800 +1F4BEBC00703E101F001009126E07FFCC7003F13F803E301C0023FDAFFF0140F4901E790 +C86C01E101C080DBEFFC6F01E390C87EDBCFF86FD9F3FE6F13FCDBDFE0EFF7F8DBFFC06F +D9FFF081494A6093C95D4B614B96CAFC49496023F84B604B60A249494C495EA24B4E18F0 +A292CA5C494E60A24A4F18E0A3017F4E60A24A96CA14C0A201FF4E60A24A4E1980A34807 +7F60A24A4E1900A34807FF60A24A4E60A2484E197FA24A4E60A3484E19FFA24A4E60A348 +4E60A291CA4A60A3484E60A2494F60A2007F4E60A24996CA5CA300FF4E60A2494E61A36C +4871487190C7FC003F060F84D81FC0DD07F0EF01FC8E586FD7A2>I<953807FFC0067F13 +FCDA1F800103B67EDA3FE0010F15E0027F023F814A6C90B77E0403824C824C8249143F4C +17804BB5EA001F03E101F0010114C003E301806D7E4901E790C87EDBEFFC81DBCFF06F13 +E0EDDFE0DBFFC081495C93C9FC5D5D495B1CC05D5DA249495EA24B1880A292CAFC4960A2 +4A1900A3017F60A24A60A201FF187FA24A60A34819FFA24A60A34860A24A60A24860A24A +60A34860A24A60A34860A291CA5CA34860A24996C7FCA2007F60A24960A300FF187FA249 +60A36C48715A003F181FD81FC0EF0FE053586FD767>I<F0FFF0051F13FF4CB612E00407 +15FC043F8193B87E4B83030717F0031F834B8392B97E4A9126FC007F7F4A028001071480 +4A01FCC8FC4A01F0033F13C04A01C06F13E0027F90C912074B7013F0DAFFF882494918F8 +4949824949EF7FFC495B4990CB123F4A19FE133F4948181F5C01FF1AFF5C485B48865C5A +A25C5A91CCFC4862A25B123FA34848F13FFEA41B7F1CFC485AA2F3FFF8A2621CF0A25013 +E0A25013C0A26D4E1380007F611C00505A6D187F63003F4F5A6D5F4F5B6C6D4C5B6E4C5B +6C4E5B6E047F90C7FC6C6D4C5A02FC03035B6C6D030F5B6C6D6C023F5B03E049B55A6C02 +FE011F5C6D90B8C8FC6D5F6D5F6D17F0010317C06D94C9FC6D6C15FC021F15F002071580 +020002FCCAFC030F1380585B70D867>I<F1FFF0060F13FF03FE027F14C04A6C6C48B612 +F04A020715FC4AD9C01F81057F8194B87E04C1834A01C78304CF834CD9E00F80DCBFFEC7 +FCDCFFF8023F7F4A02E0020F7F0580804CC86C7F4C814C6F14804A49824C824C18C04C82 +4A90CAFC4B834B19E087A214FFA24B83A35BA25DA35BA25DA25B634B19C0A349611D805D +631D005B6392CB5B1B7F5B515A4A5F6462017F4E5B6462505B6201FF4E5B97B5C7FC6E5E +4F5B6F4B5B48061F5B6F4B5B96B55A6F4A5C486E02075C6F023F91C8FCDAE7FE49B55A92 +26FFC01F5C02E390B75A4819E002E15F02C05F6F4BC9FC6F15F8486E15E06F1580DA8003 +4ACAFC030014F048DB0FFECBFC93CDFC91CFFCA35AA25BA3127FA25BA212FFA25BA36C5A +123FEA1FC05B6F74D767>I<F17F80953807FFC0DA1F80143FDA3FE091B5FC027F14034A +6C130F053F14805F4CB6FC495C4C1500EDE01F4C14804C01F0C7FC4991B5128003E101FC +C8FC4B13F003C713C05F49D9CFFEC9FCEDDFFCEDBFF05E49EBFFC05E93CAFC5D5D495BA2 +5D5D5D5B5DA292CBFCA2495AA35C13FFA25CA35AA25CA35AA25CA25AA25CA35AA25CA35A +A291CCFCA35AA25BA2127FA25BA312FFA25BA36C5A123FEA1FC042586FD745>114 +D<94383FFFF0040FB67E047F15F04BB712FE0307EEFF80031F17E0037F17F892B912FC14 +035C5C4A912680007F13F84A01F8C7120704C0020013F04A90C9121F4A48160703F8EE01 +E0494993C7FCA2495B5D5B5DA35BA581816D7F81816DEBFF8016F8EEFFC06D15FE6DEDFF +F06E15FE727E021F16E06E16F86E820201826E6C6F7E031F821507DB003F81040181EE00 +0F050080181F06077F848484737E193FA462A4197F6219FF000C61001F5F6D5ED83FE04C +5B6D4C5BD87FFC5E01FF047F5B02E04AB5FCB500FC020791C7FCDAFFE090B55A92B75A6C +606C60000F6000031880C64DC8FC013F5E010F16E001011680D9001F02FCC9FC02001480 +4E5B78D84F>I<ED0FC0ED3FE04B7EA24B7EA25EA35CA25EA35CA25EA25CA25EA35CA200 +1FB912C04818F05ABA12F8A56C18F07E6C18C0C7D83FFCC9FCA2147F5DA314FF5DA45B5D +A45B5DA35B5DA45B92CAFCA45B5CA4133F5CA3137F5CA413FF5CA45A5CA35AA25CA41707 +6EEC1F80177FEE01FF16076E133FDAF803B5FC91B77EA26C5F95C7FC6C16FC17F06D15C0 +6D4AC8FC6D14F06D91C9FC010113E03D716BEE4B>I<02FE187F496C6CEFFFC04960496D +4C13E0A44960A24B18C0A34960A292CA1480A34960A24A1900A2017F60A24A60A301FF18 +7FA24A60A34819FFA24A60A34860A24A60A24860A24A60A34860A24A60A34860A291CA5C +A24860A24996C7FCA261127FA2494D5AA219FF6048485E626060606095B55A5F6D1507EF +1FFD6C6CDB7FF95B6D6C903803FFF102F8013F13E16C90B75A18036C04FE5C6C16F86C16 +E06C4C6C5B6C4BC7FC6C6C02F86EC8FC011F02C091C9FC010101F8CCFC53586CD567>I< +03FEF103FC912603FF80F00FFE70181F4A6D183F1D7F1EFC6E6DF0FFF8641EF05213E080 +704D13C0641E805213006E6D5F65525AA2037F4E5A705E65515B033F5F7060515BA25190 +C7FC6F5F715E515A1BFF6F60714A5BA2505B6F5E64714A5BA25090C8FC6F4C5A83505A50 +5A814F5B834F5B4F5B814F5B98C9FC715B047F4A5AA24F5A62706C13FF624E5B6062041F +5B05FF5C4E90CAFCA270495A61183F6170137F614E5AA261705CA296CBFCA2705B60A260 +705BA2604C5B5E605E4C90CCFC5F161F4C5A4C5A4C5A1503003C020F5BD87FE090B55A90 +B75A94CDFC16FCB75A5E16C05E4BCEFC15F06C14C0000301FCCFFC676F7FD55C>121 +D E +%EndDVIPSBitmapFont +%DVIPSBitmapFont: Fh lcmss8 19.907 75 +/Fh 75 128 df<DD7FFF94383FFFC0040FB500FC0307B6FC047FDAFF80023F15E04BB76C +91B712F003071803031F180F4B604B604AB85C4A4EB8FC5CDD80034AECE0004A01F8C700 +1F4901FCC712074A01C0912603000F01E0EC00C093CA028015004A484D90CAFC4B60A202 +7F183FAD001FB800E092B612F04805F818FC5AB96C84A56C4D60A2001F05E018F0C7D87F +FCCA49CAFCB3B3B3B26E48715A141FDA0FE0EF07F07C757BF479>11 +D<EE0FFF93B500F0EC1FF8030302FCEC7FFE030F80033F94B5FC5D92B6FC5C5C5CA24AEB +F8034A9038C0007E93C7121C4A4891C8EA7FFEA24BEF1FF8027F95C7FCAE001FB800F0EC +07F04805FCEC1FFC5AB96CEC3FFEA56C5FA2001F17F0C7D87FFCCAFCB3B3B3B26E48EF1F +FC141FDA0FE0EF07F058757BF46D>I<EE0FFF93B512F0030302FCEC07F0030F6EEC1FFC +153F4BEF3FFE92B6FC5C5C5CA24AEBF8034A9038C0007E93C712084A4891C8FCA25D147F +AE001FB812F04817FC5AB97EA56C5FA2001F17F0C7D87FFCCAFCB3B3B3B26E48EF1FFC14 +1FDA0FE0EF07F057757BF46D>I<932603FFF0933807FF80043FD9FF80037F01F8EC0FFC +93B600F04AB500FEEC3FFF03036F020780030F061F4D1380033F604B6092B792B7FC4A60 +4A605C4A9026FE001F4AEBFC0104F001014A9038E0003F4A0180D900600380130E93CA48 +90CA6C13004A5A4B4EEF0FFC093F95C8FC147FAD001FB800F092B600F8EC03F84805FC06 +FEEC0FFE5AB96C724A7EA56C4D60A2001F05F018F8C7D87FFCCA49CAFCB3B3B3B26E4871 +48715A021F180FDA0FE0DD07F0EF03F891757BF4A6>I<943801FFC0050F13F8053F13FE +94B67E040315E0040F814C814C814C8193B8FC5D4B02C0809438FC003F4B49010F7F4B01 +E07F4D6D7F4B5B94C76C7FA24B4880875E037F167FA71AFFA24F5BA24F5B6163705C033F +4B5B4FF003804F90CAEA07F04F4818FE704949844E616F020F5B4E5B7148494D5A4E5B6F +0181B55A05C391CB485A05C75B05DF01F8187F6F90B54861616F4B4E5A96CCFC4E606F4A +6206F0606F4A6203035C4B91CC485B031F49614B6D98C7FC92B66C605C02076F4E5A4A65 +4A6F187F027F6F4E5A91B500E77F010302C34F5B4902037F011F496C6D4D5B49D9F80061 +49496E4D5B90B500C06D6D60484A6D6D5E4849C76E4C90C8FC48496E6D4C5A4801F0804A +704C5A48496E6D4B5B4A6E6D4B5B4890C86C6D5D496F6E4A5B007F734A5B49706D4A5B72 +6D4A90C9FC00FF716D91B5FC49706D495B726D495B726D495B726E485B726E485B73D9E0 +7F5B7301F8B55A6D7101FD91CAFC7390B55A007F725D6D715D6D7115E06C725D6E715C6C +6D7191CBFC6E94B612C06C01F8040715F06E041F03FC16386C01FF4BB86CEC01FC6C02E0 +021F05F0141F6C02FF0107BA388003FF6C92BFFC6D19E36D19806D9538FE003F010706F8 +130F6D06C01303010095C8FC021F04F8031F16F802070480030316C0020003F8CA6CECFC +00030701FCCB000191C7FC867977F59B>38 D<EA3FFF481380AE6C13001207A25B120FA2 +5BA2485AA35BA2123F5BA3485AA25BA212FF6CC7FCA211276DF239>I<EF7FC0933801FF +E05E5E041F13C04C138093387FFE004C5A4B5B030713E04B5B4B5B4B90C7FC4B5A4B5A5E +4A5B4A5B4A5B5C4A5B93C8FC4A5A4A5AA24A5A495BA2495B495BA2495BA24990C9FCA249 +5AA2495AA2495AA2485BA3485BA3485BA3485BA34890CAFCA4485AA5127F5BA612FF5BB3 +A27F127FA67F123FA56C7EA46C7FA36C7FA36C7FA36C7FA36C7FA26D7EA26D7EA26D7EA2 +6D7FA26D7FA26D7F6D7FA26D7F6E7EA26E7E6E7E826E7F806E7F6E7F6E7F826F7E6F7E6F +7F6F7F6F7F030113F86F7F707E93383FFF807013C0040713E082829338007FC033A06FFD +50>I<EA7FC0EAFFF07F7F6CB4FC6C7F000F7F6C7F6C7FC613FC6D7E6D7E6D7F6D7F6D7F +7F6D7F6D7F6E7E816E7E806E7F6E7FA26E7F6E7FA26E7F6F7EA26F7EA26F7EA26F7FA26F +7FA26F7FA26F7FA36F7FA3707EA3707EA3707EA4701380A518C082A618E082B3A25E18C0 +A65E1880A54C1300A44C5AA34C5AA34C5AA34B5BA34B5BA24B5BA24B5BA24B90C7FCA24B +5AA24B5AA24B5A4A5BA24A5B4A5BA24A5B4A90C8FC5C4A5A5D4A5A495B495B5B495B495B +4990C9FC495A495A000313F0485B485B003F5B4890CAFCEAFFFC5B5BEA7FC033A075FD50 +>I<EA3FFF481380AE6C13001207A25B120FA25BA2485AA35BA2123F5BA3485AA25BA212 +FF6CC7FCA211276D8F39>44 D<001FB812F0007F17FCA2B912FEA56C17FCA2001F17F037 +0B7EB045>I<EA7FFEB5FCAEEA7FFE10106C8F39>I<F201F8F203FCF207FE1BFF62A262A2 +621BFE1A7F1BFC1AFF1BF8611BF0A24F13E0A24F13C0A2611B80611B006162197F62A24F +5AA24E5BA2606260626062A24E90C7FCA24E5AA2187F6118FF615F615F61A24D5BA24D5B +A25F96C8FC5F60177F6017FF60A24C5BA24C5BA25E605E605E95C9FC5E5FA24C5AA24C5A +A25D5F5D5F5D5FA24B5BA24B90CAFCA25D5E157F5E15FF5E5C5EA24A5BA24A5BA25C5E5C +93CBFC5C5D147F5DA24A5AA2495BA25B5D5B5D5B5DA24990CCFCA2495AA2137F5C13FF5C +5A5C5A5CA2485BA2485BA25A91CDFC5A5B127F5B12FF5BA25BA25B127F6C5A6C5A50A075 +FD67>I<EE3FFF0303B512F0031F14FE92B712C0020316F0020F16FC4A82027F707E91B9 +7E4984498449DAE001804949C7001F7F4901F002037F4901C002007F4B814990C96C7FD9 +FFFC040F7F4A824849707FA24849707F4A8248864A177FA2488691CB123FA24848727EA3 +003F864984A4007F1B80A34984A500FF1BC0B3A8007F1B806D60A6003F1B00A26D60A300 +1F626D183FA36C6D4D5AA26C6D4D5AA36C6D4C5B6E5E6C626E5E6C6D4C5B6E5E6D6C4C5B +6D01C092B5C7FC6F5C6D01F802075B6D01FF023F5B6DDAE001B55A6D91B75A6D606D606E +5F021F4CC8FC6E5E020316F0020016C0033F92C9FC030314F0DB003F90CAFC527376EF67 +>I<167C16FF5D4B7F150F5D157F4AB5FC1407147F011FB6FC001FB7FC5A5AA2B8FCA36C +149FECFE1F6C13E0380FF800C8FCB3B3B3B3A70007BAFC001F19804819C0A21AE0A31AC0 +A26C19806C190043706DEF67>I<93B57E031F14FC92B712C0020316F0020F16FE023F70 +7E91B912E04984010718FC4984498449DA000F814901F0D9007F8090B500800207804849 +C80001804A6F6C7F4849041F7F4801E0707F4A16034849707F488491CB6C1380485A7413 +C04848845B7413E0485A86A26C481AF0123F6C4884120F12076C5ACDFCA362A31CE0A262 +1CC0A2621C8062501300A2505A61634F5B4F5B614F5B4F5B4F5B96B5C7FC4E5B06075B4E +5B4E5B4E13C095B55A4D91C8FC4D5B4D13F8051F5B4D5B94B512804C91C9FC4C13FC4C5B +041F13E04C5B4C5B4B4848CAFC4B5B4B5B4B13E0033F5B4B5B4B48CBFC4A5B02075B4A13 +E04A5B4A5BDAFFFECCFC495B495B010F13E0495B495B4948CDFC48485A4890BB1280481B +E05A003F1BF0A66C1BE07E6C1B80547078EF67>I<93380FFFE04BB6FC031F15F092B712 +FC020316FF020F17C0023F17F091B912FC4984010784499126F8007F80013F0280010380 +4901FCC88090B500E0033F7F480280030F7F4849C97E4849707F4801F0824849707F5C91 +CB127F6C48856C5A12035B6C5A6C5A90CCFCA4505AA34F5B61A24F5B614F5B4F5B6196B5 +5A06035C060F91C7FC067F5B0503B55A040FB65A031FB75A4B5E1A8097C8FC19FC19F085 +19FF1AC01AF06F16FC92C86C13FF060780060014E0073F7F070F7F737F07017F737F7413 +801CC0867413E0A27413F0A27413F8A37413FCA9621CF81238007C61007E1BF0127F01C0 +60486C4E13E07F01FC4E13C001FF95B512806E5E6C01E04C14006C01FC040F5B6C01FF04 +3F5B000702E092B5FC6C02FE02035C6CDAFFF0017F5C6C6C91B812C06D61010F96C7FC01 +0318FC010060023F17E0020F178002014CC8FCDA003F15F0030392C9FCDB001F13E05673 +78EF67>I<953807FFC0061F13F060866095B5FC5FA25F5FA25F4D5A173F60177F4D5A4C +5BA24C5B5E604C5B5E4C5B5F167F4C5A5F5D4B5B4B5BA24B5B4B5B5D94C7FC4B5A15FF5E +4A5B4A5B5C5E4A5B5C4A5B93C8FC4A5A14FF5D495B5B495B5D495B5B5D4990C9FC5B495A +5C485B5A485B5C5A485B5C4890CAFC5A485A90BC12FEF4FF80A21DC0A56C1C80A2001FF3 +FE00CB000101F8C8FCB3A7725BA2F13FC05A6F7AEE67>I<010FBA7E013F19E0A24985A5 +63A21B8002F8CDFCB3AA93380FFFF04BB6FC030F15E0033F15F802F9B712FE91B97E1AE0 +86861AFE869326FC003F80048001078003FCC8FC03E06F7F4B031F7F92C96C7F4A824A70 +7F4A846D48824A707FEB0F8090CC6C1380A37413C0A47413E0AC5013C0A4501380120748 +6C95B5FC486C1A006D5F486C61486C4D5B486C5F01FF4D5B6E5E6C01E04C5B6C6D93B55A +6C01FC03035C6CD9FF80020F5C6C02F0027F91C7FC6C9126FF8007B55AC692B75A6D606D +18E0010F60010395C8FC010017FC023F16F0020F16C002014BC9FCDA003F14F0030101FC +CAFC537077EC67>I<943807FFF894B612E0040715FC043FEDFF8093B87E1503150F153F +5D4AB9FC4A9138FE000F4A02C0EB003F4A49C8EA07804A01F892C8FC4A13E04A138091B5 +CCFC4913FC495B495B495B495B5D4990CDFC495AA2495A5C5A5C5A5C5A5C5AA25C5AEF7F +FC91C70007B512C048033F14F84BB612FE0307814848011F16C04B8292B87E4A834A834A +8326FFFC1F9026F8007F7F0480010780DA3FFCC7000180DA7FF06E6C7FDAFFC08101FD49 +030F7F4AC96C7FD9FFFC824A707F5C737F4A177F4A844A83A291CB6C1380A35BA2007F73 +13C0A8123FA37F7EA36E4D13807EA2806C4F1300806C616E606C19FF6E606C606E4C5B6D +6C4C5B6E5E6D6D4B5B6D6D4B5B03F092B55A6D01FC020391C7FC6D01FF020F5B6D02F090 +B55A6D91B75A6D606E5F6E5F020F94C8FC6E5E020116F86E6C15E0031F92C9FC030314FC +DB003F1380527376EF67>I<93381FFFE00303B6FC031F15E092B712FC0207EEFF80021F +17E04A8391B912FC49840107727E499126E0001F804901FCC8804901E0031F7F49018003 +077F4948C900017F02F8EE007F4849717E4849717E4A83481B804A83481BC091CB7EA248 +1BE04984A86C6C4E13C0A36C6D4D1380A26C6D4D13006C6D4D5A6E173F6C6D4D5A6D6C4D +5A6DB404035B6D01C0030F5B6D01F0033F5B010301FF0203B5C7FC6DDAFE01B55A6D6C90 +B712F8021F17E002071780020004FCC8FC031F15E06F5D92B712FC020316FF021F17E002 +7F17F849B912FE499126C0000F7F010F01FCC814C04901E0031F7F49018003077F4948C9 +00017F4948707F4849717E4849717E484971138048497113C04A83481BE04890CB6C13F0 +A24984007F1BF8A2498400FF1BFCA96C6C4E13F8A46C6C4E13F0A26E5F6C1BE06E5F6C6D +4D13C06C6D4D13806E5F6C6D94B512006C6D4C5B6C6D6C03075B6D01E0031F5B6D01FC92 +B55A6DD9FFE0011F5C6D91B85A6D616D96C7FC010018FC023F17F06E5F02071780020004 +FCC8FC031F15E0030392C9FCDB001F13E0567378EF67>56 D<EE3FFF0307B512F8033F14 +FE92B712C0020316F0020F82023F16FE4A8291B912C001038449DAE001804949C7003F7F +4901F002077F49498049018002007F90B5C96C7E4849824849707F4A707F484982484984 +4A824849707FA24890CB7FA34848727EA3747E485AA28786A41C80A71CC06C7E62A36D60 +7E97B5FC806C606E5E6C7F616C6D5E6EEE3FEF6C6D167F6C01FFEEFFCF6F0203138F6C02 +E0020F130F6D01F8EC7FFE6D903AFF8007FFFC6D91B6484813806D17F06D17E06D17C06D +17006D5E023F03F815006E03E05B020792C7FC020014F8030F01805D92CA127FA2631AFF +6361A263614F5BA24F5BA24F5B4F90C7FC614F5A4E5B604E5B01704C5B01FC4C5B6D047F +5B486C6C4AB55A4801E0020791C8FC02FC023F5B489026FFC003B55A92B75A616C18C06C +606C6C4CC9FC011F16F801075E010116806D6C4ACAFC020F14F09126007FFECBFC527376 +EF67>I<EA7FFEB5FCAEEA7FFEC7FCB3B3B2EA7FFEB5FCAEEA7FFE10566CD539>I<EA3FFF +481380AE6C1300C8FCB3B3B2EA3FFF481380AE6C13001207A25B120FA25BA2485AA35BA2 +123F5BA3485AA25BA212FF6CC7FCA2116D6DD539>I<001FC212FE488D482280C412C0A6 +6C22806C2200000F21FCD7FCB3AA000FC212FC003F21FF482280C412C0A66C22806C2200 +6C698A3475C7A1>61 D<F007FE95381FFF804E7F4E7F95B57EA24D80A24D80A24D80A24D +80A34D6D7F18FE053F814E7E057F81A24D486C7FA24C496C7FA24E7E4C82A24C496C7FA2 +4C496C7FA24C90C780A24C6F7F5FA24C486E7FA24C486E7FA24B496E7FA24B496E7FA24B +844D80A24B496E7FA24B90C980A24B48707FA2037F717F5E03FF854C824A864C82A24A49 +707FA24A49707FA24A864C824A8793CBFC4A874B84A24A48727FA291BD7EA24988A24988 +A24988A34988A24990CD80A249894A86017F894A8601FF894A86A24849747FA24849747F +A248767F5C488A4A86481F8091CFFC481FC04988A248487613E0A200FF7713F05B4988A2 +01C01C036CD113E0747378F285>65 D<001FB97E4818FF4819F0BCFC1BE01BF81BFE757E +1CE01CF88849C9000F15FFDE001F81070181DF003F80080780080080093F7F090F7F8775 +7F1B00761380A2881EC088A7521380A26499B51200515B63515B091F5B515B98B55A0803 +5C081F5C97B548C7FC07075C96B612F095B712C090BCC8FC1BFC1BE098C9FC1AF01AFEF2 +FFE01BFCF3FF801CF01CFC49CA15FF070315C0DF003F80080714F8080080093F7F090F7F +09031480090014C07613E00A1F13F07613F8887613FCA27613FE88A21EFF89A69AB5FC1E +FE64A25213FC645213F8640A7F13F099B5FC090314E0090F14C0097F148050B61200081F +5C4FB65A077F5D90BD12E0659AC7FC1CFC1CF01CC051C8FC1BF86C1A806C07F8C9FC6C06 +FCCAFC68716DF087>I<96B512F8063FECFFF00503B87E053F17F894BAFC040719F0041F +19FC047F854BBBFC15075D033F9238C0003F4B02F8C85C4AB60080151F4A02FCC912034A +02F0EE007F4A02C0171F4A91CB12074A01FCF001F84A49F0007891B500E096C7FC495C49 +5C4991CFFC495B495B5D495B495B5D90B55A5A92D0FC485BA2485BA2485BA25C5A5C5AA2 +5CA25A5CA4B5FC91D1FCAD807EA4807EA280A27E807E80A26C7FA26C7FA26C7F817E6D7F +816D7F6D7F816D7F6D7F6D806D806D6E19076E01F8F11F806E6D197F6E01FF19FF6E02C0 +17076E02F0171F6E02FC057F13C06EDAFF800303B5FC6E6C02F8153F6FDAFFC0010FB6FC +030F92B9FC6F1B800301F2FE006F6C19F8041F19E0040796C7FC040018FC053F17E00503 +94C8FCDD003F15F0060002FCC9FC6A7571F284>I<001FB912FC48F0FFF04819FFBC12F0 +1BFCF3FF801CE01CF81CFE767E8991CA003F15F0070081080F14FE080080093F80090F80 +0903800900800A3F7F767F0A077F767F7680768089777F777F89777F8B89777FA2777FA2 +781380A28A20C0A28A20E0A28A20F0A38AA220F8AE20F0A266A320E066A320C066A25413 +80A29BB51200A2535BA2535B65535B6765535B535B9AB55A640A0791C7FC525B0A3F5B52 +5B51B55A09075C091F5C98B6C8FC08075C087F5C071FB612F091BC5A1D8052C9FC641CF0 +1C8051CAFC1BF06C1A806C07F8CBFC6C06FCCCFC75716EF093>I<001FBEFC481DC05ABF +12E0A51EC0A21E0091D0FCB3B3A291BC12C01DF0A289A565A21DC091D0FCB3B3A591BD12 +C01EF0A21EF8A66C1DF07E6C1DC065716EF081>I<001FBD12F0481CFC5ABE12FEA51DFC +A21DF091CFFCB3B3A491BB12F01CFCA288A564A21CF091CFFCB3B3AC6C5A123FEA1FF85F +716EF07B>I<D81FF8F20FFCD83FFEF23FFF127FB5501380B3B3AA91BDFCAB91CD7EB3B3 +AE6C48741300123FD81FF8F20FFC61716EF086>72 D<001FB712E04816F85AB812FCA56C +16F8A2001F16E0D8000149C7FCB3B3B3B3B2001FB712E0007F16F8A2B812FCA66C16F87E +6C16E02E717DF035>I<F13FF0F1FFFCA24E13FEB3B3B3B3B260A21AFC003C5F123E007F +4D13F801C05E01F05E01FC93B512F0D9FF801403B500F0020F14E09126FF8001B612C092 +B812801A00616C60001F60000318E0C61880011F4CC7FC010116F8D9001F1580DA003F01 +F0C8FC477478F05F>I<D81FF0983803FFE0D83FFC090F13F0007F64486C1B7F9AB5FC52 +14C05214800A0F1400525B5213F899B55A515C515C5191C7FC091F5B515B5113F050B55A +505C505C5049C8FC083F5B505B97B512E04F5C07075C4F91C9FC4F13FC077F5B96B55A4E +5C4E1480060F91CAFC4E5B4E13F895B55A4D5C4D5C4D91CBFC051F5B4D5B4D5B94B512E0 +04035C4C5C4C49CCFC043F5B5E93B57E4B800307814B814B814B8192B77E5C4A029F7F02 +0F020F7F4A496C7F4A496C804AD9F0018090B6486C804C6D7F93C77E4B6E7F4B824B6E7F +03E06E7F4B6E804B6E8092C98002FC824A707F4A8402C0707F4A707F91CA6C7F49718073 +8073808688747F747F747F747F7480748086757F89757F757F757F757F75807580878A76 +7F767F767F767F767F761480887614C01FE07713F0896C4887003F88D81FF0090313E06C +716DF08B>I<EA1FF8EA3FFE127FB5FCB3B3B3B3B3A991BB12FC1CFFA21D80A56C1C007E +6C1BFC59716EF075>I<261FFFC0F5FFFE4801F00A03EBFF80486D64B56C5214C06E64A2 +6E64A36F63A26F98B6FCA201FB6D5013EFA201F96D5013CFA26F6201F81E8F6F62027F1D +0F6F62023F1CFEA26F1A3F6E1CFC70197F6E1CF87019FF6E1CF070606E1CE070606E1CC0 +7060A26E6D4E1380A2037F1B007060033F6270183F6F6271177F6F627117FFA26F6D4C5B +A26F6D4C5BA26F6D4C5BA26F62715E047F96C7FC715E043F6071163FA2706D4B5AA2706D +4B5AA2706D4A5BA27060725C7060725C7060725CA2716C4A90C8FCA2716C4A5AA2715E73 +137F715E7313FF715E735A715E735A715EA2735A715E735A067F92C9FC735A063F5CA272 +6C485AA2725C1AFF725CA2725CA3725CA2725C7390CAFCA2F11FFCF107F06C4894CC6C13 +80123FD81FC09B3801FE0082716DF0A9>I<261FFFE0F107F04801F8F11FFC487FB56CF1 +3FFE8081A28181A281A201FB7F01F97FA201F87FA26E7EA26E7F6E7FA26E7FA26E7F6E7F +A26E7FA26E7F6F7EA26F7FA26F7F6F7FA26F7FA26F7F6F7FA26F7FA2707EA2707F707FA2 +707FA2707F707FA2707FA2707F717EA2717FA2717F717FA2717FA2717F717FA2717FA272 +7EA2727F727FA2727FA2727F727FA2727FA2727F737EA2731380A27313C07313E0A27313 +F0A27313F87313FCA27313FEA2F27FFFA27413BF7413FFA286A28686A286866C487313FC +003F86D81FC0070F13F05F716DF086>I<96380FFFF80607B612F0067F15FF0507B812F0 +053F17FE94BA7E040719F0041F19FC047F19FF4BBC12C04B87030F9226F0000715F84B02 +FCC8001F80037F02E0030314FF92B548CA003F80020302F8050F14E04A02E00503804A02 +800500804A49CC003F7F4A01F8070F7F4A49737F91B500C0070180494A73804991CE6C7F +4901FC091F7F4949757F4B874949757F498B4949757F4B8790B5D06C7FA24849777F4849 +777FA24849777FA24A89488D4A89488DA24A89488DA24A89488DA491D27EA2B52180AC6E +9BB5FCA26C2200A36E65A26C69A26E65A26C6D535BA26C696E65A26C6D535BA26C6D535B +6E656C696F99B5FC6C6E515C6D9DC7FC6F636D6D515B6D6D515B6F636D6D515B6D6D515B +6D6E97B55A6D6E4F5C6D6E4F5C6E01F8070F91C8FC6E6D4F5B6E01FF077F5B6E02C04DB5 +5A6E02F005075C6E02FC051F5C020002FF057F14806F02E00303B6C9FC6F02FE033F5C03 +0FDAFFF8010FB612F8030392B912E06F636F6C97CAFC041F19FC040719F004001980053F +4DCBFC050717F0DD007F93CCFC060715F0DE000F01F8CDFC897775F3A0>I<001FB912F0 +48F0FFC04819FCBC7E1BF01BFC1BFF1CC01CF0881CFE91CA003F80070081080F80080380 +E0007F7F757F090F7F757F1B01757F1E80887613C0881EE0A288A21EF088A7641EE0A264 +A21EC06452138099B5FC1E00515B1B07515B093F5B515B0803B55A080F5C97B65A073F92 +C7FC91BB5A1CF8641CC099C8FC1BFC1BF01B8008FCC9FC1AC007F0CAFC91D0FCB3B3A76C +5A123FEA1FF864716EF082>I<001FB912F848F0FFF04819FFBC12F01BFEF3FFC01CF01C +FC1CFF1DC08991CA000715F8DF000F80080014FF091F80090380090080767F1C1F767F76 +7F88767F888A89A21F8089A6651F00A29AB5FC6664525B64525B525B1C7F99B55A09035C +091F5C98B6C7FC080F14FC0707B65A91BC12E0659AC8FC1CFC1CF01CC051C9FC1BF098CA +FC1AF0A291C900037F86727F84737E737F87737F85737F737F87737F737F86747F88747F +747F86747F88747F747F87757F89757F757F757F8789757F757F767F888A767F767F767F +888A767F767F7713807713C0A27713E06C4887003F7613C0D81FF8090113806B716EF087 +>82 D<4CB512E0043FECFF800303B712FC031FEEFF8092B912F0020318FC020FF0FF8002 +3F19E04A19F849BB7E5B5B49ED8000013F02E0C712034991C9003F5B03F8160790B500E0 +1601480280EE007F4891CB121F02FC18074849725A4A1800484996C7FC5C5A5CA24890CF +FCA680A3806C7FA28014FC6C7F6E7E6C14E015F86C14FF6C15E016FF6C16F86DEDFFC06D +16FE6DEEFFF06D17FF6D18F0010118FC6D18FF023F18C0020F18F0020318FC020018FF03 +1F84030384DB007F83040383DC001F82050082060781DE003F8007031580F1007F081F14 +C0080714E01A01746C13F087877513F887A27513FC87A387A75113F8A35113F0003C6212 +3F486C4F13E001E06101F84F13C001FE4F13806D6C4DB5FC02E04D1400B500FC050F5BDA +FF80043F5B03F84BB5FCDBFF80020F5C04FF49B65A6C93B812C0001F63000798C7FC0001 +1AFCD8003F61010F19E001011980D9003F4DC8FC020717F0DA007F16C0030303FCC9FCDB +000391CAFC5E7777F373>I<001FC212C04821F05AC312F8A56C21F0A2001F21C0CC001F +01E0CCFCB3B3B3B3B3A8735B857390CDFC857079EF94>I<D81FF8F201FCD83FFEF207FF +127FB5501380B3B3B3B3A56E61A26C1D00A26E617E656E197F6C646E19FF6C505B806C6D +4E5B6E606C505B6E606C6E4D5B6C02E04D5B6D6D4CB5C7FC6D6D5E6D01FE040F5B6D6D6C +033F5B6D02F04AB55A6D02FE020F5C6D9126FFF001B65A6D92B81280023F96C8FC6E18FC +020760020118E06E6C1780031F4CC9FC030716F8030016C0041F4ACAFCDC007F13806174 +6EF086>I<D83FF81E7FD87FFE9A3801FF80B55313C06E64676C6D1E8067806C54130080 +6C545A806C545A806C535B806C535B806C535B816C535B816D525B816D9BC7FC6F626D65 +6F1A7F6D656F1AFF6D656F616D65656D6D6365826D515B826E505B826E5090C8FC826E50 +5A826E505A826E4F5B826E4F5B826E63715E6E63715E6F62715E6F97C9FC646F6D5F1C7F +6F6D5F1CFF6F6D5F636F6D5F63836F4D5B846F4D5B847060725C7095CAFC725C705F1B7F +706D5D1BFF706D5D62706D5D62706D5D627002805C627101C05CA2716D4890CBFCA2714A +5A19F0714A5A19F8505A717FA27101FD5B96B5FC715DA2715DA2725CA27291CCFCA2725B +A2725B060313F0060013C07A727BF085>I<D83FF0972603FF80F207F0D87FFC5001E0F2 +1FF86D506D1A3FB5506DF27FFC6C516DF2FFF880A26C516D4F13F08099B5626C771BE080 +51646C0ADF6D1AC0805101CF6D606C6D088F1C80A26C506F4E13006E1A87510107626C78 +616E86E11FFE1B7F6C78616E86E13FFC6E18FF6DA15B6F856D4F486E4D5B8109FF147F6D +506E4D5B81506F606D506F606F8650715E6D50646F866D4E496F4C90C7FC818A6D4E90C7 +6E4C5A81506F187F6D4F705F81083F6F18FF6E4E705F826E057F6F6D4B5B63826E05FF70 +6C4B5B6370866E4C49714A5B824F715E6E4E715E826E4C714C90C8FC5183826E4C714C5A +98C980826E4C716D4A5A6270866F4B48724A5AA26F6D735F4F48725BA26F6D087F5E4F48 +725BA26F6D745E4E49735AA26F01F0745E4E49735A6F7693C9FC05F85C4E755A6F765D05 +FC91CBFC4EF3F03F6F765D05FE5B061FF3F87F047F755D05FF5B70756D485A4E5AA27001 +BF087F5C4F1AFD06FF98B5FC70765C61A270765C618D704A99CAFCA270765B96CDFC7049 +745B7148745BDD1FF89738007FE0B6727CF0BF>I<260FFFE0F37FF84801F8F201FF6E50 +7F6E62535B6C6D626C6E4F5B6C6E636C6E4F5B6C6E96B55A6D6D4E91C7FC6D6D4E5B6D50 +5B6D6D4E5B6D6D4E5B6D6E5F70616D6E4D5B6D6E94B55A6E6D4C91C8FC6E4E5B6E6D4C5B +6E6D4C5B6E6D4C5B6E6E4B5B6E806E6E4B5B6F6D92B55A6F4C91C9FC6F6D4A5B6F6D4A5B +6F6D4A5B6F6D4A5B6F6E495B6F6E5D706D5B7092B55A706D4891CAFC706D485B72485B70 +6D485B706D485B7002BF5B7091B55A715D7192CBFC83715C715C715C715C715C725B8460 +95B57E4D804D804D804D804D804D814D01BF7F071F7F4D486C7F4C824C496C7F4C496C7F +4C496C7F4C496C804C496D7F4C496D7F93B58295C76C7F4B496E7F4B49804B496E7F4B49 +6E7F4B496E804B49834B717F92B5486F7F4A91C96C7F4A49707F4C707F4A49707F4A4970 +804A49854A72804A49717F91B548717F4991CB6C7F4949727F4949727F4B874949728049 +86494972804949737F90B548737F4891CD6C7F4849884849747F487614804A7414C04849 +7414E048497414F048497513F8B5481DFC91CF7E498849886C480A0313F8767179F085> +I<D87FFCF63FE0D9FF80F401FFB500E05213F06E1C0F6E646C6D5213E06C6D1EC06C6D52 +13806C9BB512006C6E505B6F505B6C6E626C6E646C6E505B6D525B6D6D505B6D6D505B6F +97B5FC6D6E4E91C7FC6D6E626D6E4E5B6D515B6D6E4E5B704E5B6E6D606E6D4E5B6E6D62 +6E97B5C8FC6E6E4C5B6E6E4C5B714C5B6E6E5E6E6E4C5B6F6D606F4E5B6F6D4C5B7193B5 +C9FC6F6E5C6F6E4A5B6F6E5E6F4D5B6F6E4A5B706D4A5B724A5B706D5C706D91B55A706E +92CAFC704B5B706E485B73485B706E485B706E5A716D485B715E716D485B7190B6CBFC63 +715D83715D715D725C725C63847291CCFC725B725BB3B3A6628462726C5A7C717CF085> +I<137FA2EBFF801400A25AA2485AA312075BA2120FA3485AA2123FA25B127FA213FEB5FC +AE6C5A11276CF239>96 D<92380FFFF00203B6FC023F15E049B712F8010716FE013F707E +90B97E000384000F844884DC007F7F03C001077F02FCC700017F02E06E6C13806C90C97E +01FC7013C001F07013E0498201807013F00002CAFCCB7E1AF884A21AFC197FACF03FFF4C +B6FC167F030FB7FC157F0203B8FC141F027FED807F49B6EA8000010702F0C7FC011F91C8 +FC4913F84913C048B5C9FC4813FC4813F05C485B485B91CAFC485A5B127F5B12FF5BA519 +FFA27F606C6C5EA26D160F6D5E6C6D5D02E092B5FC6C6D140302FE021F137F6C9026FFE0 +03B5FC92B612FE6C17F86C17F06C17E06C17806DEDFE006D03F8EB3FF86D15E0010792C7 +EA0FE0010102F891C7FC9026003FFECAFC465B75D862>I<EA1FC0EA3FF0127F487EB3A6 +EE3FFC0303B512C0030F14F0033F14FC92B7FC020316C04A82021F16F84A824A8291B9FC +01F9D9FC008101FB01E0010F8090B5C70001804A6E7E02F86F7F4A030F7F4A814A6F7F4A +6F7F91CAFC49717E854919804983851BC0851BE0A285A21BF085A41BF885AD611BF0A461 +1BE0A3611BC0611B806D5FA26D4D1300616D4D5A606E4B5B6E4B5B6E5D6E4B5B6E037F5B +6E92B55A6E02075C9026FBFF80133F01F9D9F003B6C7FC01F890B75A19F86E5E6E5E020F +5E6E93C8FC6C486C15FC003F010015F0D81FC0013F14C0C8000F49C9FC030113E04D7570 +F267>I<93380FFFF84BB612C0030F15FC033F15FF92B812C0020317F04A17FC021F17FF +4A18C04A18E049BAFC499138F8001F490280EB007F4949C8120F4901F8030313C003E015 +004949163F4949161F4948CAEA07804A94C7FC5A485B5C485BA2485B5CA24890CDFCA25A +5BA3485AA5485AAD7F127FA47F123FA27F7EA2807E806C7FF201C06C6DEF03E06E17076C +190F6E171F6C6D177F6D6C6CEEFFF06D6D5D6F15076D01F8151F6D01FE157F6D6D6C0107 +B512E06D02F8017F14C06D91B812806DF0FE00023F5F6E5F6E17E00203178002004CC7FC +033F15F8030F15C003014AC8FCDB000F13C04C5B77D85C>I<F21FC0F27FF0A2F2FFF8B3 +A6EE7FF80307B57E033F14E092B612F8020315FE4A81021F16C04A8291B87E4983498349 +4AC66C7E4902E0010FB5FC4991C712034901F814004B814901C08190B5488192C97E4801 +FC8248845C4849825C484982A2485BA291CBFC5A5BA2127FA25BA312FF5BAE7F127FA47F +123FA27F7EA26E5E7E6E5E6C7F616C6D5E806C6D5E6E5E6C6D5E6F92B5FC6D01E05C6D6D +4A5A6D01FC140F6DD9FF80EB3FFC9339F803FFF86D91B65A01015F6D5F6E5E6E5E020F5D +6E03F8EB7FF0020115E06E6C0280EB1FC0030F49C9FC030013E04D7577F267>I<EE3FFE +0303B512F0031F14FC037FECFF804AB712E00207824A16FC023F824A8291B97E498449DA +F007804991C7003F7F4901FC020F7F4901F002037F4901C0140049496F7E92C9123F4948 +707E4849824A701380485B4A7013C048845C48497013E0A24890CBFCF27FF0485AA34918 +3F127F1BF85BA312FF90BBFCA61BF0A21BC001F0CDFCA27FA3127FA27FA3123F7FA26C7E +A26C7FA2806C7FA26C6DEF01C06C6DEF03E06E17076C6D170F6E173F6D6DEE7FF06D6DED +01FF6D01F05D6D01FC151F6D01FF157F6D02C00103B512E06D02FC017F14C06D91B81280 +6EEFFE006E5F6E5F020717E0020117806E6C4BC7FC031F15F8030715C003004AC8FC040F +13C04D5B78D85C>I<94B5FC040F14F8047F14FF4BB712801507151F5D92B8FC5C5C5CEF +80034A01F8C7123F4A01C0EC060093CAFC4A5A5DA2147FAD001FB812C04817F05AB97EA5 +6C5FA2001F17C0C7D87FFCCAFCB3B3B3B26E5A141FEC0FE041757BF43F>I<DC3FFCEC1F +C00303B56CEB7FF0031F14E0037F02F8EBFFF84AB612FE020781021F824A824A8291B87E +010383494AC67F4902E0131F0480EB07FE4949C712014901F86EB5FC4901E08190B54881 +4B814891C9FC4849825C4849824A82485BA24A82485BA24890CBFCA35B127FA25BA312FF +5BAA617FA2127F617FA26C7E61806C60806C6D5EA26C6D5E806C6D5E6E16FE6C6D6C1401 +6C6E4A5A03F014076D01FCEC1FF86DD9FF80137F6D9139F803FFF06D91B65A6D5F6D5F01 +005F6E5D6E5D020F5D020315E002001580031F49C7FC030013E093C9FCA51BF0A2611BE0 +A2614F13C0A24F1380D803805FD807F0057F130001FF4D5A02E0150302FF031F5B03FE49 +B55A92B85A6262624FC7FC6C60C66C17F0010F17C0D9007F93C8FC020315F8DA00071480 +4D7377D767>I<EA1FC0EA3FF0127F487EB3A693380FFF8093B512F8030714FF031F15C0 +037F15F092B77E0203824A824A824A17804A17C04AEB001FDAFFF0010114E003C0EB003F +01F990C86C13F0D9FBFE814A81D9FFF86F13F84A815C4A811AFC5C91CAFC197F5BA35BA4 +5BB3B3B16C48EF3FF8123FD81FC0EF0FE0467370F267>I<EA1FF8EA3FFE127FB5FCAAEA +7FFEA2EA1FF8C7FCAEEA07F0EA0FFC121FEA3FFEB3B3B3B3A8EA1FFC120FEA07F0107472 +F32E>I<EE07FE93381FFF80A24C13C0AA701380A2933807FE0093C8FCAE17FE933803FF +80A24C13C0B3B3B3B3B24C13805E5E001C4B1300D83F8091B5FC01F801075B267FFFE0B5 +FC91B65A5FB8FC5F5F17806C93C7FC001F15FC000115F0D8001F14C0010049C8FC328D8F +F334>I<EA1FC0EA3FF0127F487EB3A8F10FFEF13FFF96B512804E1400604E5B4E5B4E5B +067F5B95B512C04D5C4D91C7FC4D5B4D5B053F5B4D5B94B512C04C5C4C91C8FC4C5B4C5B +043F5B4C5B93B512C04B5C4B91C9FC4B5B4B5B033F5B4B5B92B512C04A5C4A91CAFC4A5B +4A5B023F7F4A7F91B6FC01F98101FB8190B77E83A203E37F03C17F03817F03007F4A7F4A +6D7F4A6D7F02E0814A6D7F4A7F91C76C7F496E7F4982496E7F4981717F717F717F85717F +83717F717F85727F84727F727F86727F84727F727F86731380857313C07313E01BF0856C +4883003F84D81F809438007FE04C7370F262>I<EA1FC0EA3FF0127FEAFFF8B3B3B3B3B3 +B3EA7FF0123FEA1FC00D7370F22E>I<93260FFFC0933803FFF093B500FC043F13FFD81F +800103DAFF8092B612E0D83FE0010F03E0020315F8007F023F03F8020F15FE486C90B76C +023F814A704A8202077049B87E4A7148834A7148834A7148834AD9000F4BEBC00303F801 +0002F049C7003F7FDAFFC0023FDA3FF0140F01F149020F6D484802037FD9F3FEC86CDAFF +80804A6F92C9FCD9F7F86FD9FDFE707E4A6F4A82D9FFE0EFFFF84A70498222804A6091CA +5C73844961A34996CAFCA44960B3B3B16C487148711300003F060F84D81FC0DD07F0EF01 +FC815870D7A2>I<93380FFF8093B512F8D81F80010714FFD83FE0011F15C0007F027F15 +F0486C90B77E0203824A824A824A17804A17C04AEB001FDAFFF0010114E003C0EB003F01 +F190C86C13F0D9F3FE814A81D9F7F86F13F84A81EBFFE04A811AFC5C91CAFC197F5BA35B +A45BB3B3B16C48EF3FF8123FD81FC0EF0FE0465870D767>I<933807FF8093B512FC0307 +ECFF80031F15E0037F15F84AB712FE0207707E4A83023F17F04A8391B97E499126F8007F +7F49028001077F4901FCC8804901F0033F7F4901C0030F7F49496F7F4990C96C7F02FC16 +004948717E4849717EA24849717E4A83481B804A83481BC091CB7E481BE04984A2003F1B +F04984A2007F1BF8A349197FA200FF1BFCAD6D19FF007F1BF8A46D60003F1BF0A36C6C4E +13E0A26E5F6C1BC06E5F6C1B806E5F6C1B006E5F6C6D4D5A6E17FF6C6D4C5B6D6C4C5B6D +6D4B5B03E0151F6D6D4B5B6D01FE4AB55A6D6D6C01075C6D02F8017F91C7FC6D91B75A6D +6C17F86E5F6E5F020717806E94C8FC020016FC033F15F003071580030002FCC9FC040713 +80565B78D867>I<EE3FFC0303B512C0D81FC0010F14F0D83FF0013F14FC007F91B7FC26 +FFF80316C04A82021F16F84A824A8291B9FC01F9D9FC008101FB01E0011F8090B5C70003 +804A140002F86F7F4A031F7F4A814A6F7F4A6F7F91C97E49707F854919804983851BC085 +1BE085A2851BF0A285A31BF8A285AC611BF0A361A21BE061A34F13C0A24F13806D5FA26D +4D130096B5FC6D4C5B606E4B5B6E4B5B6E5D6E4B5B6E92B55A6E02035C6E020F5C9026FB +FF80133F01F9D9F003B6C7FC01F890B75A19F86E5E6E5E020F5E6E93C8FC6E15FC020015 +F0033F14C0030F49C9FC030113E092CCFCB26C5A123FEA1FC04D6F70D767>I<DC3FFCEC +1FC00303B56CEB7FF0031F14E0037F02F8EBFFF84AB612FE020781021F824A824A8291B8 +7E010383494AC67F4902E0131F0480EB07FE4949C712014901F86EB5FC4901E08190B548 +814B814891C9FC4849825C4849824A82485BA24A82485BA24890CBFCA35B127FA25BA312 +FF5BAC7FA2127FA37FA2123F7FA26C6D5EA26E5E7E806C6D5E616C7F6E5E6C6D5E806C6E +5D6D6D92B5FC03F04A5A6D6D14076D01FE4A5A6DD9FFC0EB3FF86D9138F803FF6D91B65A +6D5F6D5F6E5E6E5E020F5D020315F86E5DDA003F14C0030F49C7FC030013F093C9FCB2F2 +7FF0A2F21FC04D6F77D767>I<17FF040F1380D81F80143FD83FE049B5FC007F1407486C +5B153F5D92B6FC5C5C4A15004A14804A01F8C7FC4A13C04A48C8FCECFFF85D01F113C05D +01F390C9FC5CEBF7FC5CEBFFF05CA25C5CA291CAFCA25BA35BA45BB3B3AA6C5A123FEA1F +C0315870D745>I<92387FFFE0020FB67E027F15F049B712FE0107EEFFC0011F17F04917 +FC498390B9FC5A5A489138C0003F4801FCC700015B02E0EC003F484915074A15014890CA +12784994C7FC5BA2127F5BA67FA27F6C7E80806C7F14F86C13FF6C14F0EDFFC06C15FE6C +EDFFF06C16FE6DEDFFC06D16F0010F16FC6D820101707E6D6C82021F82020382DA001F81 +030081040780EE003F05077F1701716C1380847213C084847213E0A384A660003819C012 +3C007F5F01C05E6D188001F85EB5047F130002E092B5FC02FC02075BDAFFE0137F92B75A +6C60001F606C60000360C695C7FC011F5E010716F8010016C0020F4AC8FCDA003F13C043 +5B7AD84F>I<EC03F0EC07FC140F4A7EB3A4001FB912C04818F05ABA7EA56C60A2001F18 +C0C7D81FFECAFCB3B3B3A281A3191C6E6D143E19FE70EB03FF180F6E6D137FDCF807B512 +8093B7FC80A26E170019FC6E16F06F15C06F4AC7FC6F14F003071480030101F0C8FC4171 +7CEE4B>I<D81FC0EF0FE0D83FF0EF3FF8127F486CEF7FFCB3B3B3A319FFA360A260A260 +607F007F5F606D93B5FC4D137F6C6CED07FE02C0140F6C01F0EC7FFC02FF903807FFF86C +91B612F06C17E018806C17006C16FC6C6C4BEB3FF86D15E0010F92C7EA0FE0010102F891 +C7FCD9001F1380465870D567>I<D87F8019FFD8FFE0060313806D607F627F626C6C1A00 +62003F627F1A7F6C6D601AFF6C6280616C6D60616C6280616C6D60616C6280616D6C95C7 +FC61013F6080197F6D6D5E19FF6D6081606D6D5E606D6081606D6D5E606D6081606E6C93 +C8FC60023F5E81187F6E6D5C18FF6E5E825F6E01E05C5F6E5E16F05F6E01F85C5F6E5E16 +FC5FDB7FFE91C9FC5F033F5C16FF177F6F495AA26F5CA36F5CA26F5CA36F5CA26F5C7090 +CAFCEE1FFC51577BD55C>I<D83FC0DD0FF018FE486CDD1FFCEF03FF6D4D6C5F486C057F +4E13806D94B5FC007F551300876D5E003F555A876D5E6C555A876E4B5A6C555A747E6E15 +0F6C545B07FC7F806C051F013F4C5B876E16F86C053F011F4C5B87806CDD7FF04D5B1A0F +876EDBFFE05F017F9CC7FC747F6E5C013F05C04D5A747F6E5C6D05804D5A747F6F5B6D05 +004D5A747F6F5B6D525B4E816F177F6D031F4E5B4E816F173F6D033F4E5B4E811B1F6D6D +017F4E5B60757E6E6C01FF4E90C8FC607513806E6C634C49173F1DC0021F725D6F48197F +4E16E06E725D048719FF95C8FC6E726D5BA2DCCFFE17F16EDF7FF95BA24D17FB04EF173F +6E01FF95B55A5F886E645F886F98C9FC5F886F625F6F49705B6F90CA6C5BDB03FE943800 +7FE081577CD58A>I<D83FF0F007FED87FFCF01FFF6D606D606E94B5FC6C6D4C5B6C626C +6D4C5B6C6D4C5B6C6D4C5B6C6D4C5B6C6D4C5B806D6D4B90C7FC6D4D5A6D6D4A5B6D6D4A +5B6D6D4A5B6D6D5E6D6D4A5B6D6D5C027F4B5B6F4A90C8FC6E6D495A6E6D5C6E6D485B6E +6D485B6E6D485B6E6D5A6E4A5BDB7FFE5C6F6C4890C9FCEFFFFE6F5C6F5C6F5C816F5C6F +5C705B7090CAFC705A4C7E4C7F93B57E4B805D844B804B804BEB3FFE4B486C7E4B486C7F +4B486C7F854A496C7F4A497E4A496C7F4A496D7E4A6F7E4A90C77F4A486E7F4B6E7F4A48 +6E7F49707F49498249498049496E7F49496F7E49717E92C96C7F4948844948707F484970 +7F48727F4849707F4849824849844A717E487313804890CB6C13C048487213E05B498449 +846C48060013C053567CD55C>I<D83F8019FFD8FFE0060313806D607F6D60A26C6C4E13 +00A26C6C60631A7F6C6D60A26C6D17FF636C6D5E637E6E4C5BA26C6D5E636C7F4F5B6D7E +61013F96C7FC6E5E626D7F4F5A6D7F19FF6D60816D4C5B81606D6D5EA26D4C5B81027F4B +5B81143F6F4A90C8FCA26E4B5A828070495A80617013FF8070485B80616E6D5A61ED7FFC +5F61ED3FFE4D90C9FC151F16FF6F495AA26FEB9FFC17BF608117FF6F5CA26F5CA28260A2 +705BA27090CAFCA2825F161F5F163FA25F167F5F16FF4B5B5D030F5B0078023F5B26FFE0 +01B5FC90B7CBFC5E5E5E5E16C05E6C4ACCFC15F86C14E0000149CDFC516F7BD55C>I<00 +1FBE12E0007F1DF8A2BF12FCA56C1DF8A2001F1DE0660B80BA67>123 +D<D81FF0ED3FE0D87FF8ED7FF8486CEDFFFCA26D5CA74980A26C48ED7FF8D81FF0ED3FE0 +360F68F367>127 D E +%EndDVIPSBitmapFont +%DVIPSBitmapFont: Fi lcmssb8 23.89 56 +/Fi 56 128 df[<943801FFFE057FD9FFF84AB512F80403B7020714FE041F82047F4E80 +4BB8FC03074F15805D153F5D92B9FC5C5C5CA24AEDE01F4ADB80036F15004D487E4A706F +5C4D147F083F020114F84A97CAFC1A1FA274CCFC1A0697CDFCA7000FBA00FC4AB512FC00 +3F734A8048734A8075491580BCFCA86C97C7FC6C616C61C76C02FCCAFCB3B3B3B3B0804D +7115006E4A715C02074A715C>121 140 122 267 143 12 D[<953807FFC04E13E0183F +604DB5FC4D14804D1400051F5B4D5B4D5B94B55A04035C4C5C4C5C4C91C7FC4C5B4C5B93 +B5FC4B5C4B5C4B5C5D4B5C604B91C8FC5D92B55A5C5F4A5C5C4A5CA24A5C5C5F5C5F91B6 +FC4992C9FCA2495CA25B5E5B5E5BA2495CA25B5E90B6FCA3485DA3485DA35AA293CAFC5A +A35A5DA45AA25DA35AA65DA2B6FCB3A47EA281A67EA381A27EA4817EA37E82A27EA36C81 +A36C81A37F827FA26D80A27F827F827FA26D80A26D8180838083806E80A26E80806E8083 +806F7F816F80846F80816F806F806F8082707F707F708070807080040080717F717F717F +05077F7114C07114E0717E84180F7213C0>67 194 105 279 106 +40 D[<EA3FFC487EB57E806C13F06C7F6C7F6C13FF6C806C806C806C14F86D7F6D7F6D7F +6D806D80826D806D806D80826E7F806E80836E8083806E80836E80A26E8084818481846F +80A26F80A28481848184A26F81A2858185A37080A37080A385A28285A38582A41A80A282 +A31AC0A682A21AE0B3A41AC0A25EA61A80A35EA21A00A45E61A3615EA261A34C5CA393B6 +5AA3615D61A24B92C7FCA2605D605D60A24B5CA24B5C605D6092B6FC95C8FC4A5CA24A5C +5F4A5C5C5F4A5C5F4A91C9FC5C91B55A5E495C495C495C5E495C4991CAFC495B495B90B5 +5A4814E0485C485C4891CBFC4813FC485B485BB512C05C6C48CCFC6C5A>67 +194 113 279 106 I<001FBA12F84819FC4819FEBCFCA96C19FE6C19FC6C19F8480F7DBC +5B>45 D<007FB512E0B612F0B3A77E6C14E01C1C689B4C>I[<95387FFFC0051FB6FC4CB7 +12F0040F16FE047FEEFFC04BB912F0030718FC031F18FF4B8592BB12E04A8602071AFC4A +864A864A874ADBF0018291B7C7001F814903F802038105E01400490380033F804992C96C +80494A70804C82494A7080494A70814C82494A7180A290B6487180A2488A93CB7EA2488A +4B84488AA3488A4B84A2488AA5481F80A24B84A3481FC0A9B61DE0B3A96C1FC0A76F60A2 +6C1F80A56C1F00A36F606C66A46C666F60A26C66A26C6F4D5CA26C6F4D5CA26D6E94B65A +A26D6E4C5D705E6D9AC7FC705E6D6E4C5C6D6E6C033F5C6D6F4B5C05F04AB6FC6D03FC02 +075D6D03FF021F5D6EDBF001B75A6E92B95A6E98C8FC6E626E6202011AF06E626F61031F +96C9FC030718FC030118F06F6C17C0040F4CCAFC040116F0DC001F92CBFCDD007F13C0> +115 146 118 269 136 48 D[<94381FFFFE0407B612F8047FEDFF800303B812F8031F17 +FF037F18C04ABA12F0020719FC021F19FF4A1AC091BC7E491BF849874987011F757E4988 +498890B7D8E00183484BC7000F824803F00201824803C06E7E4C031F81484AC900078148 +4A82484A701680484A706C15C0B65A4B7115E04B836C7415F092CB7E6C1EF86C49846C5B +6C7415FC7E6C5B6C866D5A013F1DFE131F6D5A01078613036D5A90CEFCA599B6FCA21FFC +A363A21FF8631FF0A25115E0A25115C0631F80635115006698B65A62505D505D505D505D +505D5092C7FC97B65A4F5D4F15F04F5D4F5D4F5D077F4AC8FC96B65A4E15F04E5D4E1580 +061F92C9FC4E14FC4E5C4DB612E04D5D4D92CAFC4D5C053F14F84D5C94B612C04C5D0407 +4ACBFC4C5C4C14F04C5C4C14804BB6CCFC4B5C4B14F84B5C4B5C037F148092B6CDFC4A5C +4A14F8020F5C4A5C4A14804A91CEFC91B512FC01035C495C4914C0495C4991CFFC90B512 +FC4891BD12F0481EF8481EFC001F1EFE5AAA7E1FFC6C1EF800031EF0>111 +142 117 269 136 50 D[<0507B5FC4CB612FC041FEDFFC04BB812F8030F17FF033F18C0 +4ABA12F0020719FC021F19FF027F1AC091BC7E01031BF8010F874987017F8790BE7E48DD +000F82000704E0010082484BC8003F8104F0150F04C00303816C92C96C8115FC6C4A7081 +6C02E0836C4A866D5B4ACB7E6D48886D5A6D5A6D5A6D48846D5A90CD5AA59CC7FCA263A2 +98B65AA3505D626662505D505D62505D97B75A070393C8FC070F5D073F5D4EB75A0507B8 +5A041FB95A4C609AC9FC641CF81CE01C8051CAFC871CE01CF81CFEF4FFC0897018F893C8 +000F15FE07006F7E081F810807817415F808008175807580758175818B8775818B878BA2 +7581A28BA3761580AB200099B7FCA2120C001F66486C617F6D65D87FF8616D6501FF616E +6402E060B500F84E5D6E4E5DDAFF805F03E094B75A03F84C93C7FC6C02FF04075D001F03 +F0031F5D6C03FF92B75A6C04FC010F5E000193BA5A6C656D64011F51C8FC0107636D1BF0 +010063023F1A80020F4FC9FC020319F8DA007F18E0030F95CAFC030117FCDB003F16C004 +0303FCCBFCDC000791CCFC>113 146 117 269 136 I[<49BD12F801078849888A5BAA66 +66664CCFFCB3AE953807FFF895B612C0050F15FC057FEDFF8093B912E01CFC1CFF891DE0 +891DFC89891EC08A9526FC007F81068001078105FCC700018105E06E7E05806F8094C96C +8004FC70814C70815E4C70815E4C70816D91CAFC8B6D4983010101F88790CEFC8BA2888B +A52080AC2000A299B7FC1338137C01FC65487E486C4F5DA2487F486D4E5D487F6E64486D +4E5D486D6002FF64B66C4D5D6F5F03F04D92C7FC6C02FC4CB65A6C02FF4C5D6C03C0030F +5D6C03F8033F5D000303FF4AB75A6C04F8013F5E6C93BA5A6D99C8FC6D63010F1BF86D63 +01011BC06D6C626E4FC9FC020F19F8020319E0DA007F1880031F05FCCAFC030317E0DB00 +7F93CBFC040715E0DC001F01F8CCFC>113 142 119 265 136 53 +D[<4FB57E077F14FC0607B712C0063F16F84DB9FC050F84173F94BAFC1603160F5E167F +93BBFC15035D5D033FEE80014B03F0C7120F92B7008014014A03FCC9123F4A03F0040FC8 +FC4A03C093C9FC4A5D4A4ACEFC4A5C4A5C5F91B65A495D495D4992CFFC5E5B495C5E5B5E +5B5E90B6FC5E5AA2485DA25AA293C912404895387FFFF00607B6FC48051F15E0067F15F8 +4B49B712FE0507707E484C83053F17F04D8394B97E484B844B48844C854C854C854C9026 +E0001F81B692C7000181DC7FFC6E6C80DCFFF06F804D6F8003FD018003078192B5C9FC4C +70814C7081874C864C838B5E4C7180A25E8BA293CBFC7680A25D7EA22080A45DA27EA281 +A37EA47E2000A2817EA2525C7E826C66A26C6370627F7094B65A6D65705E6D65705E6D6E +4C5D6D6E4C92C7FC704C5C6D03C04B5C6D6F4B5C6D03F84AB65A05FF020F5D6E03F090B7 +5A6E92B95A6E98C8FC6E626E620201626E1AE06F61031F96C9FC6F60030318F8030018E0 +043F178004074CCAFC040016F0051F92CBFCDD007F13C0>113 146 +117 269 136 I[<001FBF12FC488A488AC11280AB20006C666C666C66CF6C5C99B65A51 +5D5192C7FC515C091F5C515C6398B65A505D505D505D5092C8FC505C505C505C97B6FC4F +5D654F5D4F5D614F92C9FC4F5C646196B65A4E5DA24E5D4E5DA24E5D4E92CAFC60636063 +95B65A5F635F635F4D5DA24D5DA24D92CBFCA24D5CA294B65AA25E625E62A25E625E62A2 +5E625EA297CCFC5EA261A293B6FCA2615DA261A25DA3615DA4615DA5615DA94B5DAF6F92 +CDFC6F5C6F5C>113 140 117 265 136 I[<95B512C0053F14FE0403B712C0041F16F804 +7F16FF4BB912C0030718F0031F84037F18FE92BBFC02031AC04A864A86023F864A8691BC +7E49DCC001814903FCC7003F814903E00207814903800201814992C9FC4902FC043F8049 +4A708090B648824C85487480484B824C85488693CA8248868B485C8B4887A28B485CA276 +80A3B688A48BA388A38BA264A47EA2208064A26C8099B7FCA27E63A26C6E5F637E705E6C +62826C6F5E6C6F5E973801FFDF6D02FC4B139F6D6E5D6D6E031F131F6D03C0EC7FFE6D03 +FCD903FF17006D92B712FC6D19F86D19F06E18E06E18C06E4E5A6E06005D6E5F020117F8 +6E5F033F04C05E030F93C7FC030315FCDB007F02F04A5C040791C8FCDC0001C9FC94CA5D +A299B6FC67A2515DA267639CC7FCA2515CA2515C6366515C636698B65A505D62D901E04D +92C8FC496C051F5CD907FC4D5C6E4D5C496C6C4BB65A4901E003075D03FC031F5D49D9FF +8091B75A04FC011F93C9FC4991B95A6490BC12F064646D97CAFC011F19FC010761010119 +E06D1980023F4DCBFC020717F8020117C0DA003F4BCCFC030315E0DB000F01F8CDFC> +113 146 117 269 136 57 D[<0707B612FC073FEDFF804F8296B87E4E83A24E83A24E83 +A34E83A24E83A24E84A34E84A295BA7EA24D85A34D85A24D851BEF4D851BC7A24D851B83 +4D861B014D86507EA294B684507F4C87507F4C87507F4C87A2507F4C87507F4C87507F4C +8897C7FC884C884F8093B6864F814B894F81A24B894F814B894F814B894F81A24B894F81 +4B8A96C97E4B8A4E82A292B6884E834A8B4E834A8B4E834A8BA24E834A8B4E834A8B4E83 +4A8CA295CB7E4A92BE7EA291C27EA2498DA3498DA2498DA2498DA3498DA2498EA2498EA3 +90B648CE824C87488F4C87488F4C87488FA24C87488F4C87488F4C8748A11280A293CF7E +48A112C04B88B622E04B89A24B894B896C4A7715C06C02800B031580>155 +138 118 265 176 65 D[<000FBCFC003F1BFF481CF8F5FF80BF12F81EFF1FC01FF81FFE +797E20E020F88C20FF8D21E08D8D8D8D8D4BCA850900840A07831C000B1F820B0382F500 +7F1E1F78818A8A78818AA8545DA2545D66545D66545D545D53B75A5393C7FC0B0F5D0B7F +15F852B75A0A0F16C00A7F5E090FB748C8FC080FB812F892BE12E020800DFCC9FC1FE09C +CAFC1EF89BCBFC1EF0F6FF801FF81FFF20E020F820FF21C04BCA000F17F0E1003F16FC0A +0116FFE2003F820B0716E00B0182776C810C1F15FE0C07810C0116807816C08B0D1F15E0 +7915F023F88B7915FCA28BA27915FEA767A25515FC67675515F81F7F9CB712F01E030C0F +16E01E7F0B03B812C00B3F17800A03B9FC51BA120092C05A6A6A6A6A22809FC7FC21FC69 +21E021809EC8FC20FC20E020800DFCC9FC1FE06C9BCAFC1EF06C52CBFC000F51CCFC> +143 136 108 263 179 I[<51B67E50B812C0083F17FF0703BA12F8073FF1FF804EBC12 +F8060FF3FF80067F1CF04DBE12F81707171F177F4CBFFC04071EF0161F5E93C0FC4B9538 +E0001F030705F8C87E4B0580030F15E04B04F8C91201037F04E0EE003F92B8CB120F4A04 +FC18034A04F0844A04C0726C13C04A4C854A4BCD7E4A4B1A074A4B8691B700E074138049 +4C86494C1B7F4993CF123F4D1C1F494BF40F00494B1C06494B99C7FC5F5B5F90B75A4893 +D2FCA2485DA2485D5E5A5EA25A5EA25A5EA25A5EA4B7FC93D3FCAE827EA4827EA2827EA2 +827EA2827E826C81A26C81A26C826D81837F836D816D6F1D386D6F1DFC711C016D701B03 +6D701B076D701B0F6E03F81B1F6E6FF37FFE6E6F1BFF6E6F6C616E7019076E04F0616E04 +FC193F6E04FF96B5FC6F04E01703031F04F8170F6FDCFF80167F6F05F80307B7FC0301DD +FFE00103B8FC6F95BBFC163F8216071601706C1DFE051F1DF005071DC005011D00716C1B +F8060F1BE0060198C7FCDE003F19FC070319C0DF003F4DC8FC080117C0E0000103C0C9FC +>144 140 113 265 174 I[<000FBC12F8003FF3FFF848F4FFC01EF8C07E1FF01FFCF7FF +8020E020F820FE7A7E21E08D21FC8D7B7E8E22F08E8E93CA000184E1000383E2001F830B +0183E3003F820C0F820C03820C00820D3F810D0F8179821F0179827A818C7A817A818C7A +81A17E8C7A81A27B1580A28DA113C08DA113E0A28DA113F0A28DA2A113F8A38DA3A113FC +AEA113F8A369A3A113F069A2A113E0A269A113C069A2571580A29EB71200A2565D68A15A +68565D565D68565D55B75A555E670D1F93C7FC0D7F5D54B75A0C075E0C3F5E53B85A0B0F +5F52B95A51BAC8FC93BF5A6A22F06A6A9FC9FC6921F86921C09ECAFC20FC20F020C055CB +FC1FF01F806C0BFCCCFC1EC06C0AF8CDFC000F09FCCEFC>158 136 +108 263 194 I[<000FC212C0003F8D488D8EC3FCAA6A6A6A93D3FCB3B3A593BE12C08D +8D8DAA69696993D3FCB3B3A893BF12FC8E8E2380AB7E23006C69000F69>137 +136 108 263 169 I[<000FC112FE003F8C48218022C0C3FCAA228022006993D2FCB3B3 +A793BD12E08C8C8CAA68686893D2FCB3B3B3A27E5D6C5C000F5C>130 +136 108 263 162 I[<51B67E50B87E083F17FE0703BA12F0073F19FE4EBC12E0060F1B +FC063FF3FF804DBE12F005071DFC051FF5FF80057F1EC04CC0FC1607161F5E93C112804B +9538E0001F030705F8C87E4B058015074B04FCCA7E037F04E0171F92B8CB000715004A04 +FC18014A04F0727E4A4C191F4A0480854A4BCD7E4A4B08015B4A4B8691B700E01B7F494C +1B3F494C1B1F4993CF6C5A4D1C07494B1C03494B1C01494B1C004D1D784921304D9AC7FC +90B75A4893D3FCA2485DA2485D5E5AA25E5A5EA25A5EA25A5E0B07B912E05318F065B7FC +93CCFCAB899AC81201A2827EA4827EA2827EA2827E82A27E826C81A26C81A26C826D8183 +7F836D816D816D81836D826D826D826E15F86E816E816E6F7E6E16E06E826E16FC6E16FF +6F04E05F031F04FC171F6FDCFF804BB7FC6F05F8151F0301DDFFE0010FB8FC6F95BBFC16 +3F8216071601707E051F1EE005071E0005011DF8DD003F1CC0060F51C7FC06011BF0DE00 +3F97C8FC070319F0DF003F4DC9FC080194CAFCE000014ACBFC>148 +140 113 265 182 I[<000FB500F8090FB512FC003F6E5180486E51806F511580B7FCB3 +B3B193C0FCB093CE7EB3B3B3A57E4B7515006C4A755C000F4A755C>137 +136 108 263 178 I[<000FB912C0003F18E04818F019F8BAFCAA6C18F06C18E06C18C0 +D800014BC7FCB3B3B3B3B3AB001FB912C04818E04818F0BA12F8AB7E19F06C18E0000F18 +C0>61 136 123 263 72 I[<000FB512F8003F80488081B7FCB3B3B3B3B3B3A793BD12FE +8C218021C0AA7E21806C2000000F67>122 136 108 263 154 76 +D[<000FB600E09CB7FC003F03F80C0316804803FE0C0F16C0705416E0B86C65A27165A2 +719AB8FCA27164A27164A27164A27164A37164A27263A27263A27298B9FCA203BF6E5081 +A2039F6E5014FEA2038F6E5014FCA203876E5014F8A203836E5014F0A203816F4F14E0A2 +03806F4F14C0A2706E96B61280A2706E4E1500A2706E4E5CA2706E4E5CA2706E4E5CA370 +6E4E5CA2706F4D5CA2706F4D5CA2716E94B65AA2716E4C92C7FCA2716E4C5CA2716E4C5C +A2716E4C5CA2716E4C5CA2716F4B5CA2716F4B5CA2726E92B65AA2726E4A92C8FCA2726E +4A5CA2726E4A5CA2726E4A5CA3726E4A5CA2726F495CA2726F495CA2736E90B65AA2736E +4892C9FCA2736E485CA2736E485CA2736E485CA2736E485CA27303BF5CA27392B65AA274 +5FA27494CAFCA2745EA2745EA2745EA3745EA2745EA2745EA2755DA27592CBFCA2755C75 +5C090314F0090014C06C98CEFC92D56C14C06C497C1480000F497C1400>179 +136 106 263 224 I[<51B512F050B712F0083FEEFF800703B912F8073FF0FF804EBB12 +F0060F1AFE063F747E4DBD12F005071CFC051F1CFF057F1DC04CBF12F004071EFC4C8A04 +3F787E4C942680003F834BB800E0C817F04B4CC9000F82030F04E0040016FE4B0480053F +814B03FCCB0007824B03F006018292B700C0726C814A93CD001F8102074B7415FC4A03F8 +0803814A4B74814A4B748206801B3F4A92CF6C8191B6487681494B7681494B7681494B76 +814D8849A17E494B77804D894992D16C8149A17F4C8A90B68F4C8A48A1804C8A48A1804C +8A48A1804C8A48A180A24C8B48A180A3484B791580A448A115C0A293D37EA3B7A112E0AD +7067A26CA115C0A47067A26CA11580A2709CB7FC6CA11500A270666CA15CA270666CA15C +A26C6F545DA26C6F545DA26C6F545D71656DA15B71656D6F9AB75A6DA190C7FC71646D6F +525D6D6F525D6D6F525D71646D70515D6D70515D6E6F98B75A6E6F505E6E6F5093C8FC6E +03FE080F5D6E6F505D6E04C0077F5D6E7096B75A6E04F806035E6F03FE060F5E031FDBFF +C0057F93C9FC6F04F04CB75A6F04FE040F5E0301DCFFE092B812F06FDDFF80013F5F043F +94BB1280709CCAFC04071EFC04011EF0706C1DC0051F9ACBFC05071CFC05011CF0716C1B +C0060F50CCFC06011AF0DE003F1980070306F8CDFCDF003F1780080104F0CEFCE0000102 +F0CFFC>179 144 113 267 210 79 D[<000FBC12C0003FF3FF80481CF8F5FF80BF12F0 +1EFE787E1FF01FFC1FFF8C20E08C20FC8C8C21C08D8D8D8D93CA000183E1000382F4007F +0B0F16800B0316C01D000C3F15E07815F08A7815F8A27815FCA28A22FE8AA37914FFAB9C +B612FEA35415FCA26622F8665415F0A20C3F15E05415C09BB7FC0B0316800B0F16000B7F +5D0A07B75A51B85A93BE5A69696956C7FC6820F068208055C8FC1FF81FC09CC9FC1EF81E +C00BFCCAFC1D800AC0CBFC93D2FCB3B3AA7E5D6C5C000F5C>136 +136 108 263 172 I[<000FBC12E0003FF3FFE0481CFF1EF0C0FC1FE01FFC1FFF20E020 +F820FE7A7E8D21F08D21FE8D8E22E08E8E93CB000783E2000F821D000C1F810C03827882 +787E79818B7981A27981A28BA27981A8676BA2676B67555D555D679CB75A5493C7FC0C07 +5D0C3F5D53B75A0B1F5E0A0FB812C093BF5A57C8FC6921F021C09EC9FC20FC20E020800D +FCCAFC1FC054CBFC1EC08A8A93C900078186748174818A758187758175818B7581877581 +8B758176818876818C768176818876818C768177818977818D77817781898D7781778178 +818A8E7881788178818A8E7881788179818B8F798179817981A27981798179817A1580A2 +6C8B4B886C4A761500000F4A0A035C>145 136 108 263 178 82 +D[<0603B512F84DB712F8053FEEFFC04CB912FC040FF0FFC0047F19F84BBCFC03071BC0 +031F1BF8037F1BFE92BE12C00203895C141F5C5C91BF5A5B5B494CC7FC49048014034903 +F8C9123F4903C0040F5D4992CA120104FC717E90B600F0181F484B84048018034892CC6C +91C7FC4B737E48894B868A484A745A1E031E01481D001F7E1F3C6F1B189CC8FC81818282 +8216F816FE6CEDFFC017FCEFFFC018FE6CEFFFF8F1FFC01AFF6C1AF8F3FFC06C1BFC6CF3 +FF801DF06D1BFC1DFF6D1CC06D1CF06D1CFC6D1CFF6D896D896D1DF06E88021F886E886E +880201896E6C88031F880307880301886F7E040F87040187EE003F050186EF000FDE003F +19801901DF000718C0F2003F1B01E1003F16E01C071C01767E0B1F15F0891D0389A2898A +1203487E486C887F7F01FC1FE07F487E6E6302E01EC08002FC98B6FC486D5015806E7E03 +E04F15006F190F03FC4F5CDBFF80604803E095B65A04FC05035DDCFF80160F05F0047F5D +DDFF800207B75A06FE49B85AC15A9DC7FC6767676C66000F6600031E80C69BC8FC013F1C +FC01076401011CE0D9003F1B80020750C9FC02001AF8030F19C003004ECAFC040717F0DC +001F93CBFCDD001F1480>124 144 116 267 152 I[<000FC5B512E0003FA114F048A114 +F8A115FCC5B6FCAA6CA114F86CA114F06CA114E0CD00014BCEFCB3B3B3B3B3B3A6866675 +5C091F5C>174 135 118 262 195 I[<000FB500F80903B512F8003F6E5114FC486E5114 +FE6F5114FFB7FCB3B3B3B3B3A270626C21FEA370626C21FC9CB6FC826C5315F8826C6F61 +5415F06C6F61704F15E06C6F4F15C071606C04E04DB712806C704D160005FC170F6DDBFF +80043F5D6D04E04BB75A6D04FC031F5E6DDCFFF00107B85A6D94BB5A6D676D676D9CC7FC +6E65021F656E1DF06E650201656E9AC8FC033F1BFC030F6303031BE003001B80043F4FC9 +FC040719F004001980051F05FCCAFC050117C0DD000F03FCCBFCDE003F49CCFC>136 +140 108 263 177 I[<003FB500F80D3FB512804802FE54B612C0B76C5315E070657065 +A26C6F5315C0A26C6F531580A26C571500826C9EB65A82696C6F68696C7067A26C70515D +A26C565D836D555D83696D6F67696D6F9CC7FCA26D6F98B65AA26D6F505DA26D545D846D +545D84686D7065686E6F65A26E6F4F5DA26E6F4F92C8FCA26E9AB65A846E525D84676E70 +63676E7063A26E704D5DA26F6F4D5DA26F515D856F5192C9FC859CB7FC6F6F62666F6F62 +A26F704B5DA26F704B5DA26F505D8666706F6166706F6166706F96CAFCA2706F92B65AA2 +704E5D86704E5D876570705F6570705FA2716F495DA2716F495DA2714D92CBFC877194B6 +5A87647103FF5E647104835DA27104C75DA27104EF5DA27292B75AA27261A37296CCFCA2 +7260A27260A27260A27260A27260A3735FA2735FA27394CDFC735E735E735E070016E0> +163 137 122 263 176 I[<0003B7091FB612C04804C0087F814804F04FB7FC718A555E +6C70616C704F5E6C704F5E6C714E93C7FC6D704E5D6D829CB75A6D704D5E6D704D5E6D70 +4D5E6D704D5E6D704D5E6D714C93C8FC6E70626E636E7093B75A6E704B5E6E704B5E6E70 +4B5E6E704B5E6E70626F4F93C9FC6F704A5D6F704A5D6F7091B7FC6F70495E6F70495E74 +495E6F70606F4E5E706F4993CAFC7070485D7070485D7070B75A7016F17004F95E7004FB +5E7093B85A71627197CBFC7161716171618371617161726072607295CCFC66725F725F72 +5F84725F735E735E7393CDFC735D89614F824F8296B87E4E834E834E834E838A4E844E84 +4E8495BA7E4D854D854D854D858C4D864D15FB4D03F18294B700E0824C4C6C814C71814C +0480824C4C6C81506D824C4B6D824C4B6D824C718293B748844B4C6D824B4C6E814B4C6E +814B93C86C824B73824F864B4B6F824B4B8192B7486F824A4C6F824A75814A4C864A4C70 +824A93CA6C824E71824A4B71824A758291B74888494C7182494C7182494C7282494C7282 +4977824993CC834D7382494B738290B74885487882484C7382484C1F80484C7416C0484C +7416E04893CE6C16F07A16F8484B7516FCB75A4C7516FE4C7516FC6C4B876C03800A3F15 +F8>159 136 120 263 176 88 D[<003FB600C053B612E04803F80B0715F0B700FE0B1F +15F8701D7F05C099B7FC6C705116F0696C705116E06C705116C06C705116806C7020006C +70515D6C71505D6C7197B7FC565E6D704F5E6D704F5E6D70666D704F5E6D704F93C7FC6D +70616D714E5D9DB75A6D714D5E6E704D5E6E70646E704D5E6E704D5E6E705F6E704D93C8 +FC555D6E7193B75A6E71626F704B5E6F704B5E6F705D6F704B5E744B5E6F5093C9FC6F70 +4B5D6F71606F7191B75A7070495E70705B7070495E75495E704E5E707095CAFC7070495D +7071485D7071B7FC7104E15E7104F35E0AF75E7193B85A71637198CBFC83716271627261 +68726172617261847296CCFC7260726067735F735F85735F735F7394CDFC735E66735E74 +5D86745DB3B3AE6686A2745D08014ACEFC>165 136 123 263 176 +I<050FB57E0407B612FE93B812E0030F17FC92BAFC020719C0021F19F091BB12FC01031A +FF010F87491BE0498789899426FE000781058001008104FCC8003F158004E06F15C093C9 +7E03FC7015E04B7015F06D01E08203807015F892CBFC4A7214FC14F84A7214FE5C5C4A1B +FF6DCC7E90CDFCAC081FB7FC4EB9FC95BAFC171F0403BBFC161F4BBCFC150F157F4AB8EA +FC1F0207EEFC00021F1680027F03F8C7FC49B712C001074BC8FC4915F84915E049158090 +B648C9FC485D4815F05E485D485D4892CAFC5D5A5D5A5DA2B6FC5DA663A281637E6F94B7 +FC626C806F5E1A0F6C6F5D04E05D6C6F92B8FC04FC14036C03FF141F6CDCF003B512DF94 +B7129F6C1A1F6C19FE6D18FC6D18F86D18E06D18C06D180001015F6D17F8023F04E06D14 +FE020F93C76C14FC020103F86E14F8DA003F02C091C9FC030301F0CCFC687078ED80>97 +D<063FB5FC0507B612FE057FEDFFE00403B812FC040FEFFF80047F18F04BBA12FC4B19FF +030F1AC0033F1AF84B1AFC4ABCFC5C5C5C023F1BF84A9238FC000791B700C0EB003F494B +C812034903F8150005E0163F494B040F13F0494B16034992CA7E494AEF007F4C183F494A +181F90B648F007E04C180348F401C04C95C7FC5A5E5A93CEFC5AA2485CA35A5DA35AA35D +A2B6FCAF7E81A47EA281A27E817EA2827E1E1C6C6F197E1EFE6C6F18017018036C1C076D +6E180F70183F6D6E187F6D6EEF01FF6D6F040713FF715E6D03F0167F6D6F4BB6FC6D03FE +150F6DDBFFC091B7FC6E03FC133F6E92BAFC808002031BFC6E1BF86E1BE0033F1A80030F +F1FE006F19F8030119E06F6C1880041F05FCC7FC040317E0DC007F93C8FC050715E0DD00 +3F01F8C9FC687077ED79>99 D[<0A0FB512E05214F05214F85214FCB3A8943807FFE094 +B6FC040715E0043F15F893B712FE0303EEFF80030F17E0033F17F84B17FC4AB912FE4A18 +FF4A96B6FC141F5C5C91B8EA001F4904E013014993C87E05FC151F4903F015074903C081 +494B15004992CA7E5E495C90B65A5E485DA2485DA2485DA24892CBFCA3485CA25A5DA35A +A45DA2B6FCB07EA281A37EA46C80A37E817E827EA26C81827E7094B6FC6D6E5E705E6D6E +5E6D6E5E6D6F5D05E05D6D6F92B7FC6D03FC14036DDBFF80131F6D04F890B8FC6E92BAFC +806E856E18FE6E18FC020118F06E18E0033F17C06F170003075E030104F86D14F86F6C03 +E06D14F0040F03806D14E0040102FCCBFCDC000F1380>110 140 +119 265 135 I<95383FFFE00507B67E057F15F80403B8FC041F17E0047F17F84BB912FE +0307727E031F854B19F092BB7E4A864A86020F864A874ADBFC00824A03C0011F8191B7C7 +0007814903FC1401494B6E6C804903E06F80494B814D6F804992C96C80495C494A701580 +4C8290B6FC4C7015C0485D5A4C7114E0485DA2488793CB15F0A2485CA288484A1BF8A392 +BDFC5AA5C0FCA21FF01FE01FC003F0CFFCA96C80A56C80A46C80A2817E827E826CF50380 +70F107C06C1D0F70191F6C6F197F6D6E19FF656D6E606D6E180F6D6F5F71057F13E06D03 +F094B5FC6D6F16036D03FE161F6D6F167F6E03C00203B6FC6E03F8143F6E9226FF8007B7 +FC6E93B9FC02031C806E1C006E1BFC033F626F1AE003071A8003014FC7FC6F6C18F8041F +18E0040795C8FC040017F8050F16C0050003F8C9FC060349CAFC6D7079ED7C>I[<0607B5 +12E00503B712C0053F16FC4CB812FE160F163F93B9FC1503150F5D157F92BAFC5C5C5C4A +EE800706F0C7FC4A0380141F95C812074A02FC15031B014A18001C7E1C3C1C00A9000FBA +12F0003F85488586BBFCA86C616C616C61C76C02FCCAFCB3B3B3B3B0805F6E5C02075C> +87 140 122 267 83 I<942601FFF8020FB512E0053F01FF4A14F04CB600E04914F8040F +03F84914FC047F15FE4BB8FC030717C04B17E0033F17F092B912F84A18FC4A18FE020F18 +FF5C4A96B6FC4AEE803F91B738F800074904C013014993C87E494B814903F8814D81494B +81490380814992C97EA290B648825E484B835A5E485DA25E5A5E5A93CBFCA25A5DA25A5D +A5B6FC5DA899B6FCA4817EA263A2817EA26F5F7E82636C81A26C6F5EA26C6F5E6C81705E +6C81705E6D6F92B7FC6D6F5C6D03F04A7F6D6F5C6D03FEEC0FFE6DDBFFC0133F6D9339FC +01FFFC6D93B6FC6E18F86E18F0806E18E0020318C06E18806E6C1700031F5E03075E0301 +16F06F6C5D040F158004004AC7FC050713E094CAFCA51FF8A31FF099B6FCA2010E1DE001 +1F61D93FC04E15C014F002FC4E158002FF4E150003E05F03FC4D5CDBFF8093B65A04F003 +035DDCFF80020F5D05FF91B75A95B95A669BC7FC65651DF06D636D1B80010350C8FCD900 +7F19F8020719E0DA007F95C9FC030317F8DB001F1680DC000F02E0CAFC6E8E77EC87>I[< +000FB512C0003F80488081B6FCB3A796381FFFF04EB612C0060F15F8067F15FF4DB812C0 +050783051F17F84D8394B97E4C844C19804C19C04C19E05E4C19F04CEBF00193B5C7001F +15F803F901F8140703FB01E06E15FC05808092B5C915FE04FC825E4C825E4C19FFA24C82 +93CAFCA25DA35DA45DB3B3B3AE7E4B7114FE6C4A7114FC000F4A7114F8>104 +138 113 265 135 I[<000FB512F8003F14FC4814FE15FFB7FCA86C14FE6C14FC6C14F8 +C9FCB10003B512F0000F14F84814FC15FE5AB3B3B3B3B3A97E15FC6C14F8000314F0>32 +139 115 266 60 I[<380FFFFC003F7F487F81B6FCB3A90807B61280083F15C0624FB7FC +61614F16804FEDFE004F5D96B75A4E5E4E5E4E5E4E5E4E4BC7FC4E5D95B75A4D5E4D5E4D +5E4D93C8FC4D5D4D5D94B75A4C5E4C5E4C5E4C93C9FC4C5D047F5D93B75A03815E03835E +03875E038F93CAFC039F5D92B75A616161198096CBFCA28585A285858585A2858586A286 +868604FB8116F104C0814C814C6C804B7F4B6D814B6D814B8303C06D814B7F92C76C8187 +718184728072818872818472818872818473807380897381857381897381857381748089 +741580867415C01EE07415F0867415F87415FCA26C864A846C4984000F49060714F8> +102 138 111 265 127 107 D[<000FB512C0003F14E04814F015F8B6FCB3B3B3B3B3B3 +B3A47E15F06C14E0000F14C0>29 138 113 265 60 I<96260FFFF896B57E4EB600E005 +1F14FE000FB56C020F03FC94B712C0003F6E027F03FF040716F0486E49B800C0031F16FC +6F010705F0037F16FFB6021F05FC4AB912C04D714A8494BA020F844C7349844C7349844C +7349844C7390BBFC4C624C73481A804CD9F0004DEC000F93B5C7000F6F4801F0010016C0 +03F101F802034C0180143F03F301E06E6F4848C86C15E005806E05F88103F790C96C6E48 +486F15F0DBFFFE704B488104F81B804C7093C97E4C62A116F84C624C704B8293CA5EA24B +63A34B63A44B63B3B3B3AE6C74874B98CB15F06C4A714A7214E0000F4A05004A060F14C0 +B56D71ECD4>I<96381FFFF04EB612C0000FB56C020F15F8003F6E027F15FF486E49B812 +C06F010783B6021F17F84D8394B97E4C844C19804C19C04C19E05E4C19F04CEBF00193B5 +C7001F15F803F101F8140703F301E06E15FC05808003F790C915FEDBFFFC825E4C825E4C +19FFA24C8293CAFCA25DA35DA45DB3B3B3AE7E4B7114FE6C4A7114FC000F4A7114F8686D +71EC87>I<95380FFFF84DB612C0051F15FC94B87E040717F0041F17FC93BA7E4B850307 +19F0031F19FC4B8592BC7E4A8702071BF04A874A9226FC001F814A03C00101814A4AC800 +3F8091B600F8030F814903E00303814903800300814992CA6C80494A71804C83494A7180 +494A7180494A71804C8390B6884C83488B4892CC6C80A2488B4B85A2488B4B85488BA348 +8BA24B85A2488BA5B61E80AE6C2000A36F61A26C67A46C6E4F5CA36C676F616C677095B6 +FC6C67705F6C67705F6C676D6E4D92C7FC705F6D6E4D5C6D6E4D5C6D6E4D5C05C04BB6FC +6D6F4B5D6D03F8030F5D6D03FE033F5D6DDBFFC049B75A6E03FC011F93C8FC6E92B95A02 +0F1BF86E636E636E636E6C97C9FC6F61030F19F8030319E003001980043F4DCAFC040F17 +F8040117C0DC003F4BCBFC050315E0DD000F01F8CCFC797079ED88>I<953801FFFC063F +EBFFC0000FB500C049B612F8003F6E010F15FE486E017F6F7E6F48B812E0B6010717F84C +83043F17FF4C8403F9BA7E03FB8592BB7E898989DDFC00820580011F8204FCC700038204 +F002008204C08193C9001F814B70814B824B70818674818A87751580A2877515C0A27515 +E0A37515F0A3871FF8A287A41FFC88AE99B6FC1FF8A5631FF0A2631FE0A2631FC0631F80 +63A2511500636698B65A62505DA26F4C5D6F041F5D6F4C5D705D04E04AB75A704A93C7FC +04FC020F5D04FF027F5DDDF007B75A94B95A656503FB6103F94EC8FC03F8607017F0705F +70178004074CC9FC040116F87016C0051F92CAFC050714F09426007FFECBFC95CDFCB3A4 +7E5D6C5C000F5C6E8971EC87>I<F10FF8F1FFFC000FB56C1407003F6E141F486E147F6F +49B5FCB614075F173F5F94B6FC5E5E5E5E5E5EA25E93B7FCA215F103F316F8F1F00003F7 +02FCC7FC18E092B6C8FC17F817E05F94C9FC5E16F85E5E5EA25E93CAFCA25DA25DA35DB3 +B3B3A67E5D6C5C000F5C466D71EC5A>114 D<041FB57E0307B7FC033F16F84AB97E020F +18F0023F18FE91BB7E491AF00107865B5B5B5B90BC5A5A9338F000074892C8123F4802F8 +15074B15004802C0043F5B4B160F48190392CA7EF2007F4849183FF30FC01B07755A4897 +C8FCA280A28181818115FCEDFF8016F06CEDFFC017FEEFFFF8F0FFC06C18FCF1FF806C19 +E01AF86C19FE747E6C866C1AF06C866D856D856D856D866D866D866D866D6C85141F0207 +8514016E6C84150F030184ED001FDC007F17801701EF000F1800071F15C0190719018586 +000685D80F8084121F6D847F7F7F486C1B807F7F6E5F02E01A006E5F4813FC02FF4D5B03 +C093B5FC03F003035C03FE150FDBFFC0023F5CB700FE0107B6FC93B95A6464646C98C7FC +001F62000762000162D8003F61010F19C0010396C8FCD9007F17FC020F17F00200178003 +0703F8C9FCDB000F49CAFC5A7078ED69>I[<0203B512E0020F804A80835CB3A8000FBB12 +FC003F8648861C80BDFCA86C1B006C626C62C7003F02FCCAFCB3B3B3AC83A2F301C0F307 +E06E6E150F1B1F1B3F72ECFFF01A036E6F130F72133FDEF807B512F86E92B7FCA2801CF0 +6E19E01C806EF0FE00636F17F06F17806F4CC7FC6F16F8030316C06F03FCC8FCDB003F14 +C0040701E0C9FC>85 139 123 264 98 I<000FB500C00503B512F8003F6E4D14FC486E +4D14FE6F4D14FFB6FCB3B3B3AD63A463A398B7FCA262A2627E62626F5E6C6162F2FFDF6C +6E5D0707139F6C6E6C021F131F04E0147F6C03FE903807FFFE93B712FC6C19F86C19F06C +19E06D18C06D18806DEFFE006D5F010317F001004D6D14FE023F04806D14FC020703FCC7 +6C14F8020003F091C9FC030349CCFC686D71EA87>I<263FFFF04FB512804801FC070714 +C0B64F14E06F60648164A26C6E1BC099B6FC816C501580A2816C501500A26C6E6263A26C +6E6263A26C6E6263A26C6F6163A26C6F6163826D96B65AA2826D4E5DA26D6E96C7FC62A2 +6D6E6062A26D6E6062A26D6E6062A26D6F5F62836D4E5CA2836E94B65AA26E6E5F61A26E +6E94C8FC61A26E6E5E61A26E6E5E61A26E6E5E6118806E4C5CA218C06E4C5CA218E06F92 +B65AA26F6E5D18F1A26F02F992C9FC18FBA26F91B65AA36F5FA36F5FA36F5FA36F5FA270 +5EA3705EA27093CAFC705D705D040115F06B6C7AEA78>I<261FFFF8952607FFE095380F +FFFC4801FE061F01F8063F7F486D4E6D4E7FB66C4D6D95B612806F8598B65F6CA114006F +8650626CA15B6F865062A26C6E7461626B6CA15B6F8650626CA15B6F865062A26C6E7461 +626B6CA15B70855097B6FC6CA15B708597B85DA26D6E716E95C7FC4F13FE6A6D6B707180 +4F01FC606D6B70864F6E5F1BF86D6E745F61516C5F6D6B70864F6E5F6D07E06370864F62 +517E6D6F735F617694B6FC6D078063718596B56D5E6E95C797C8FC711A804E62896E02F0 +4A05C05D60775D6E4D6305F81AE04E626E746005FC4A17F04E62896E02FE4A05F85D6077 +5D6E4D6305FF1AFC4E626E746006BF4917FE95B596B6FC896E4D94B75AA36F93C995C9FC +A36F745E61A28A6F4B63A36F4B705EA36F745E61A26F745E616F745E4F826F6C4A7093CA +FC041F49CB003F14FCA96C7BEAB4>I<000FB500E0067FB5FC4802F895B612C0486E1703 +816F5F636C6F4C15806C6F4C15006C6F616C6F4C5C6C6F93B6FC6C4F5D70616D6E4B5D6D +6E4B5D6D6F4A5D6D6F5C6D99C7FC6D6F4A5C6D6F4A5C7191B65A6D6F495D6E626E6E5B6E +6E495D6E6F485D6E03C093C8FC6E6F485C4F5C6E6F5A6E6FB65A6F6E5D6F91B75A6F606F +606F95C9FCA26F5F6F5F6F5F705E705E705E82637093CAFC705D705D705D83715C715C4D +805F94B67E4C81864C814C824C825E4C82874C8293B87E4B834B834B02FD814B14FC4E6C +804B02F0814B4A6C804B6F8092B6486C804A03808173804A4B7E4A4A6D814A4A834A7081 +4A4A6E804D6E804A8691B6486E80494B80494B6E8049884992C86C814C6F81497281494A +85494A8290B64870804874804C85484B701580487415C0484B1AE04892CA6C15F0484A83 +487415F84B1BFCB6487214FE884B7214FC6C4A846C0280060314F86F6B7CEA78>I<263F +FFF84FB512804801FF070714C0B66C4E14E06F606F60646C80A26C6E95B612C0A26C6E1B +8063816C1E006F5F7E515C6C81A26C6F4C5CA26C6F61636D8066705E7F666D6E5EA26D6E +93B65AA26D6E61626D819BC7FC715C7F656D6F5CA26E6E5F626E6E5F626E80656E5F8365 +6E6E5CA26E6F5E97B6FC6E6F5EA26E5E06E093C8FC81725A646F14F8616F6018FC6F4B5C +18FE814F5C6F14FFA26F4B5C19BFA26F92B65AA282648299C9FC82A2705EA3705EA28263 +826382A2715DA28363A283638398CAFC83A2715CA283625FA2625F62001C5E123FD87FC0 +4B5C01F8157FD9FFC0010FB65A91B9FC6297CBFCA26C60616161616196CCFC6018F818E0 +188005FCCDFC6C16E06C4BCEFCD8003F91CFFC6B897AEA78>I<001FC212F04821F84821 +FCC312FEA96C21FC6C21F86C21F0870F80C988>123 D[<001FB500E092B6FC4802F80203 +1580486E4A15C0B619E0A26F5CA34B806C1BC06C4A6E15806C02E002001500>83 +12 102 266 136 127 D E +%EndDVIPSBitmapFont +%DVIPSBitmapFont: Fj lcmssb8 28.66 23 +/Fj 23 122 df[<9BB612FC52B9FC0A3F18FE0907BB12F8097FF2FF800807BD12FC083F +F4FF804FBF12F8070FF6FF80193F4EC112C01807181F187F4DC2FC05072180171F5F94C3 +FC5E04079638F000034C06F8C800071700043F0680ED007F4C05F8CA120F93B900C01701 +030395CC7E4B05FC191F4B05E007075C4B0580854B94CEFC4B04FC1B3F92B800F0874A4D +755B4A05801B034A94CF7E4A4C884A04F81D7F4A4C1D3F4A4C775A91B8481D0F4F1D0749 +94D11203494C785A494CF600404E9CC7FC495E495E605B495E95D5FC90B8FC5F485EA248 +5EA2485EA2485EA3485EA25F5AA294D6FCA25AA25EA4B7FCA25EAD82A27EA482A27EA283 +A27E83A26C82A36C82A26C82A26C82A26C82837F846D827F846D826D82846D70F701E06D +701F076D71F60FF0731E1F6E701E3F6E701E7F6E701EFF6E04FE1D036E705313F86E7164 +6E05E01C3F6E71646F04FC51B5FC6F04FF636F711A0F6F05E0626F05FC1A7F6F05FF4FB6 +FC030006C0180F7005F8183F70DDFF800403B712FC040F06F8163F70DEFFF0023FB8FC04 +0196BCFC82173F831707050121F8717E061F20C00607200006011FF8DE003F1EE0070F9B +C7FC07011DFCDF003F1CE0080799C8FCE0007F1AF809071A80E1003F06F8C9FC0A014DCA +FC99C703FCCBFC>174 167 110 292 209 67 D[<0007C412FC001F23FF48A1128048A1 +12C0A2C5B412E0AAA113C0A2A11380A11300A112FC04FCD4FCB3B3B093C07E23E08F8FA2 +8FA96BA26B6B238004FCD4FCB3B3B3AD6C5DA26C5D6C5D00071580>155 +163 104 290 194 70 D[<0007B66C0B0FB6FC001F03E00B3F15C0486F5315E0486F9AB7 +12F0A2B76C5216F8B3B3B3AA93C3FCB304FCCF1201B3B3B3B06C4B7616F0A26C4B7715E0 +6C4B7715C0000703800B0F1500>165 163 104 290 214 72 D[<0007B76C0F03B712E0 +001F04F00F1F16F848705716FC4804FE9EB812FE7168B9A114FF72677267A27267A27267 +A27267A27267A2729CBAFCA27266A37365A27365A27365A27365A27365A203FD6F535CA2 +03FC6F9AB65AA2706E525DA2706F515DA2706F515DA2706F515DA2706F515DA2706F515D +A2706F515CA2706F98B65AA2716E505DA2716F4F5DA2716F4F5DA2716F4F5DA3716F4F5D +A2716F4F92C7FCA2716F4F5CA2716F96B65AA2726E4E5DA2726F4D5DA2726F4D5DA2726F +4D5DA2726F4D5DA2726F4D92C8FCA2726F4D5CA2726F94B65AA2736E4C5DA2736F4B5DA2 +736F4B5DA2736F4B5DA2736F4B5DA2736F4B92C9FCA2736F4B5CA3736F92B65AA2746E4A +5DA2746F495DA2746F495DA2746F495DA2746F495DA2746F4992CAFCA2746F495CA2746F +90B65AA2756E485DA27503835DA27503C75DA27503EF5DA27592B75AA27596CBFCA27560 +A27560A2765FA2765FA3765FA2765FA2765FA27694CCFCA2765EA2765EA2775D775DA277 +5D0B0715807792CDFCE3007F13F86C4A97D06C14FEA26C4AA16D14FC6C4AA16D14F80007 +0280A1010714E0>216 163 102 290 269 77 D[<9BB512FE52B8FC0A3F17F80907BA12 +C0097F19FC0803BC7E081F1BF097BD12FE0707F4FFC0071F1DF096BF12FE0603787E060F +1FE0063F1FF895C112FE05037A7E4D8D051F21F0057F21FC94BA26C0000784040306E0C8 +000F717E4C4DCA84041F05E0050F17F04C94CB0001834C04F8DE003F8293B800E0070F82 +030305800703707E4B4CCE834B04F8093F824B04E0090F824B04800903824B93CF6C8292 +B74876824A04F80B3F814A4C77824A4C77824A4C77824A93D10001824A4B78824E8B4AA1 +8191B7487981494C79814E8B494C7982494C7982A24993D36C82494B7A82A2494B7B81A2 +494B7B8190B7A1804D8D48A1844D8DA248A119804D8D48A119C04D8D48A119E0A34893D5 +6C16F0A4484B7C16F8A448A119FCA24C8FA4B7A116FEAE70A0B7FCA36CA119FCA4706A6C +A119F8A37169A26CA119F0A271696CA119E0A271696CA119C071696CA11980A271696CA1 +190071696CA160719EB7FC6DA15F6D6F565E72676DA15F72676D70555E6DA15F72676D70 +555E6D705593C7FCA26D709CB75A6E6F545E6E70535E6E70535E6E70535E73656E04FC0B +7F5E6E709AB85A6E705294C8FC6E05C009075E6F70515E6F04F8093F5E6F70515E030704 +FF50B812C06F05C007075F6F05F0071F94C9FC6F05FE96B85A043F706C050317F87005F0 +051F5F7005FF4CB95A040306F0031F188070DEFFC00107BACAFC706C95BC12FC7169050F +21E005032180050056CBFC7267061F1FF006031F80060054CCFC073F1DF807071DC00701 +9ACDFCDF003F1BF808071BC0E0007F07FCCEFC090719C0E1007F05FCCFFC0A0194D0FC99 +C74AD1FC>215 173 110 295 252 79 D[<0007B66C0B03B512FE001F03E00B0FECFF80 +486F5315C0486F5315E0A2B76C5315F0B3B3B3B3B3B2709AB7FCA46CA113E07064A36C70 +5116C0A2696C702080696C702000696C70515D836C70515D7198B7FC6C7008035E6C7161 +06E04F5E6D70073F5E6D04FC96B8FC06FF06035F6D05C0050F5F6D05F0053F94C7FC6D05 +FE4CB85A6DDDFFE0033F5F6DDEFFC0010FB9FC6D96BC5A6E696E696E21806E9EC8FC6E68 +6E680200686F1FE0031F676F9CC9FC0303666F1EF86F6C1DE0041F1D80040752CAFC0400 +1CF8053F1BE0050798CBFC05001AF8061F19C006034ECCFCDE003F17E0070104FCCDFCDF +000102FCCEFC>164 168 104 290 213 85 D[<0603B512F80503B712F094B9FC040F18 +E0047F18FC0307BB7E033F1AE04ABC12F802071BFE023F757E91BE12E00103894989491D +FE8B8C8C96C7003F8206C0020F8205FCC80003826D03F00300820580824CCA6C8104F871 +8104E0834C71168093CB6C16C05D03F87216E05D6D498403801DF092CD7E5C5C4A1EF86D +488690CFFCAE0903B8FC081FB9FC070FBAFC0603BBFC187F0507BCFC177F0403BDFC161F +93BEFC1507033FF0003F92B912C0020305F8C7FC020F1780023F04F8C8FC4A16E049B8C9 +FC4916FC010F16F04916C04993CAFC4915FC90B75A485E485E17804893CBFC5A5E485D48 +5DA25E5A5EA2B7FCA25EA565A282A29AB7FC7E705FA2705F6C63705F705F6C6F5F7193B8 +FC6C705D7115076C04F8151F05FE157F6C706C0107B512BF6C05F890B6FC95B8123F6C1B +FE6D1AFC6D1AF86D1AF06D1AE06D1A806D1A006D19FC6D61023F18E06E06806D15F00207 +4DC7FC020105F06E15E06E6C04806E15C0030F03FCC800011500030103C092CAFCDB000F +01F0CEFC>125 133 118 258 154 97 D[<0707B512F84EB712F8061FEEFFC095B912FC +0507F0FF80053F19F094BB12FE0403747E040F1BF0043F1BFC93BE12805D03071DC05D15 +3F5D92BFFC4A1E805C4A943880007F4A04F0C8FC4A04C0150F4A93C912014A03FC706C14 +0091B700F0171F494C1707490480834993CCFC4D85494BF11FFE494B190F4D1907491D01 +494B735A4D1A7890B798C7FC5F5A94D0FC5A5E5AA2485DA3485DA35A5EA35AA45EB7FCB2 +6C81A57E82A37E82A27EA2827E826CF70780711A0F6CF71FC0711A3F6C1F7F71F101FF6D +656D6F4F13E071616D6F193F6D6F617196B5FC6D7017036D70170F6D70173F6D04F894B6 +FC7216036E03FF040F15F06E04C0157F6E04F0020FB7FC6E9326FF8003B8FC6E94BAFC80 +14006F1DE06F1DC06F1D800307F4FE006F1CF803001CE0043F1B807050C7FC04071AF804 +001AC0053F96C8FC050718F805001880061F04F8C9FC06011680DE00070280CAFC>124 +133 117 258 145 99 D[<0C03B512FE0C0FECFF805415C05415E0A25415F0B3AC953801 +FFFC067FEBFFE00503B612FE051F6F7E94B812F0040717FC041F17FF047F18C093BA12E0 +030319F84B19FC031F19FE4B96B8FC5D4AC0FC5C5C5C4AEFE0004A04FCC7120F4A04E014 +0191B800806E7E494CC9121F06F8824904E01603494C82494C824DCB7E495D495D5F5B5F +90B75A5A5F4893CCFCA3485DA2485DA3485DA35AA25EA25AA45EA2B7FCB27EA382A37EA4 +6C81A46C81A27E82A27E827E837E836D816D99B7FC715F6D6F5F715F6D6F5F6D6F5F6D04 +C05E7293B8FC6D04F85D6D04FE15076E6F6C141F6E04F091B9FC6E04FF130F6E94BBFC80 +6E876E1AFE6E1AFC6F19F86F19F0030F19E06F19C0030119006F6C5F7005F86D15E0040F +17E0040105806D15C0706C4BC76C1580050F03F00203ECFE000500038091CAFC060701F0 +CDFC>132 167 117 292 162 I[<070FB5FC4EB612FC061FEDFFC04DB812FC050FEFFF80 +053F18E04CBA12FC040719FF041F86047F1AE093BC7E03031BFC4B87031F874B884B8892 +BE7E0203894ADD801F824A9326F80001824A04E0D9003F814A0480020F814A4BC87E06F8 +03018291B7486F82494C8249048070814993CA7E494B71815F497581495D4D7181495D77 +8190B75A484C838D4893CCFCA248894C1D805A5E8A5A4C1DC0A25A5E93BFFCA25AA5C3FC +A22280A222006921F804C0D1FCAA82A27EA4827EA2827EA2827EA2827E827E836C203C71 +1B7C6CF701FE6D6F1A03711A076D6F1A0F201F6D6F1A3F6D6F1AFF6D6F617218076D704E +7F6D70183F6D04F895B6FC6E6F17036E03FF170F6E70163F6E04E04BB7FC6E04F8150F6E +04FF92B8FC6E05F8133F6E94BBFC6F656F65030F656F1DE00301656F9AC7FC043F1BFC04 +0F1BF0701BC0040050C8FC053F19F8050F19C005014EC9FCDD003F17F0060394CAFCDE00 +3F15E0070002F0CBFC>130 133 119 258 149 I[<0007B512FC001F14FF48814881A2B7 +7EB3AC98B512E0081FECFF8097B712F8070716FF073F17C096B912F8060384060F18FF06 +3F854E8595BB7E0503864D864D864D865F4D8694BD128004E19138FE001F04E302C00101 +17C04EC8123F04E701F88104EF01E0030716E04E8193B5C97E4D1BF005F8825F4D835F21 +F85F94CB7E5EA25EA25EA35EA45EB3B3B3B3A96C4B7215F0A26C4B7215E06C92CC6C15C0 +000702FC07011500>125 165 110 292 162 104 D[<0007B61280001F15E04815F04815 +F8A2B712FCA86C15F8A26C15F06C15E000071580CAFCB3A248B6FC000715C04815E04815 +F0A24815F8B3B3B3B3B3B3AA6C15F0A26C15E06C15C000011500>38 +166 112 293 72 I[<0007B512FC001F14FF4815804815C0A2B712E0B3B3B3B3B3B3B3B3 +AB6C15C0A26C15806C1500000714FC>35 165 110 292 72 108 +D[<98267FFFF097380FFFFE081FB600C00603B612F80007B500F893B700FC061FEDFF80 +001F02FE0307DCFF8094B812F0486E033F05E0040717FC486F91B900F8041F17FF060306 +FE047F18C0B76C010F726C4ABA12F04E734A85067F73020F8595BB6C4A85050374027F85 +4D7491BC7E4D7449874D7449874D644D75488794BD5B04C19126FE000F7148DAC0018304 +C302C00100714801F8C7001F824EC8003F07C0140704C701F8030F94B5C8120104CF01E0 +6F04F101FC6F824E03014E163F04DF90CA04F301E082DCFFFE98B548864D714D8205F052 +CAFC4D644D714C83A11B804D6494CB5F4C724C83A24C65A24C9ACBFCA34C64A44C64B3B3 +B3B3A96C4B724B721600A26C4B724B725D6C92CC6C4B735C000702FC07000380071F14F0 +>217 130 110 257 254 I[<98B512E0081FECFF800007B500F893B712F8001F02FE0307 +16FF486E033F17C0486F91B912F8060384B76C010F18FF063F854E8595BB7E0503864D86 +4D864D865F4D8694BD128004C19138FE001F04C302C0010117C04EC8123F04C701F88104 +CF01E0030716E04E8104DF90C97EDCFFFE1BF005F8825F4D835F21F85F94CB7E5EA25EA2 +5EA35EA45EB3B3B3B3A96C4B7215F0A26C4B7215E06C92CC6C15C0000702FC07011500> +125 130 110 257 162 I[<97B57E077F14FF0607B712F0067F16FF0503B912E0050F18 +F8057F18FF4CBB12C004071AF0041F1AFC4C8693BD7E4B8803071CF04B88033F1CFE4B88 +92BF7E4ADD8000834A04F8C7000F824A04800200824A4BC9003F814A03F8040F814A03E0 +0403814A4B708191B7CB6C81494B7281494B7281494B72814D84494B7281494B7281A249 +4B72814992CD6C80A290B6487481A2484B7481A2488E4C86488EA2488E4C86A2488EA348 +8EA24C86A2488EA6B72080AF6C2300A37062A36C6AA46C6F505DA36C6A70626C6AA27062 +6C6AA26C6F505DA26C7096B75A6D9EC7FC71606D6F4E5D71606D686D6F4E5D6D6F4E5D71 +606D6F6C94B75A6D704C5E6D704C5E6E03F8040F93C8FC6E03FE043F5D6EDBFFC04AB75A +6E04F8020F5E6E9326FFC001B85A6E94BA5A6E666E66033F52C9FC6F646F6403031CE06F +646F6C98CAFC041F1AFC04071AF004011AC0706C96CBFC051F18FC050318E0DD007F94CC +FC060716F0DE007F92CDFC070114C0>145 133 119 258 164 I[<97381FFFE00703B6FC +0007B500FC033F15E0001F02FF0203B712FC486F010F16FF486F017F17C04DB912F0B7D8 +E00718FC051F18FF4D8594BB7E04E11AF004E78604EF8693BC7E8B8C8C8C9526FE001F83 +06C00103834DC87E05F8031F8205E06F82058015034CC96C824C706C824C8304E0718276 +82887682A27682887781A27781A2898D89228089A37716C0A38922E0A389A322F0A38AAE +9BB7FCA222E0A465A222C0A265A2228065A2531600A2535DA2656965699AB7FC525EA252 +5E525E64525E704D93C7FC705F7094B75A704C5E70160705C04B5E71033F5E05F892B85A +05FE02035F716C010F5FDEF801B9C8FC95BA5A67676704EF1AC004E76204E397C9FC04E1 +19FC04E0617118E0051F1880714DCAFC050317F8050017C0063F93CBFC060F15F8060015 +80070F01E0CCFC96CFFCB3A86C5DA26C5D6C92D2FC000714FC>132 +163 110 257 162 I[<F37FE0F20FFF0007B500F8047F13F0001F02FE0303B5FC486E15 +0F486F143F96B6FCB76C13036060183F6095B7FC5F5F5F5F5F5F5FA294B8FC16C1A216C3 +04C717E0A204CFEE800004DF03E0C7FC07FCC8FC93B612E019804EC9FC18F818E0188095 +CAFC17FC5F5F5F5F5F94CBFC5EA25EA25EA35EA45EB3B3B3B06C5DA26C5D6C92CCFC0007 +14FC>84 130 110 257 108 114 D[<050FB512F00407B712E0047F16FF0303B912F003 +1F18FF92BB12E002031AFC020FF2FF804A1BE0027F1BFC91BDFC49885B5B5B5B49645BA2 +90B738F000014893C8120704F8ED007F4803E0040F5C4C1603484B160093CB123F484A18 +0F4B840A015B48874B193F1D1F775A481C039AC8FC81A38181828216F016FC16FF17F0EF +FF806C17FCF0FFF0F1FFC06C19FEF2FFC01BF86C1AFF1CC06C1BF01CFC6C1BFF6C881DE0 +6D876D876D1BFE896D886D8813016D886E876E87020F87800201876E6C86151F03071B80 +1500041F1AC01601EE000FDD007F18E01801F00007F1003F080716F01A01747E1B1F8787 +4886D807C085486C857F7F6D86487E7F6E1CE080804801F896B6FC806E4E15C06E7E03E0 +5F03F84D15804802FE5F6F6C4C150004E0167F04FC4BB65ADCFFC0140F05FF49B75ABFFC +666666A26C6566001F9AC7FC00076400011CF8D8003F63010F6301011B806D6C4FC8FC02 +0F19F8020019E0031F95C9FC030117F0DB000793CAFCDC000F14C0>108 +133 119 258 125 I[<031FB512E0037F14F892B67E4A81A24A81B3AE0007BD12F0001F +1CFC48884888A2BF1280A86C1D00A26C646C6400071CF0C7000393CBFCB3B3B3B3A585A5 +F503C06E70150FF51FE01D3F73EDFFF0647314076E70141F0A7F13F807FE0103B5FC6F6F +137F97B712FCA281A2811EF86F1AF06F1AC01E006F19FC6F19F06F1980704DC7FC7017F0 +701780040704FCC8FC040116C0706C02F8C9FC050701F8CAFC>102 +167 122 292 118 I<0007B500FC4FB6FC001F02FF070715C0486F4E15E0486F4E15F0A2 +B76C4E15F8B3B3B3B3A765A59AB7FCA364A264A264A2647E646482646C98B8FC635113BF +6C6F160F51133F6C6FEE7FFE7016FF6C6F6C020313FC05E0021F13F86C04FF49B512F06C +94B7FC1CE06C1BC06D1A806D1A006D616D19F80103616D616D6C06806D15F0021F4DC7FC +020705F86E15E0020005E06E15C0031F93C800011500030103F892CAFCDB000714807D82 +6EFFA2>I<001FB5972607FFF097381FFFFE007F02C0071F01FC97B612806F4F01FF61B6 +6C4F6E4E15C06F96B6616F4E817A606F60A15DA26C6E4E6F1C80A15DA26C6F4D6F1C00A2 +A15D6C6F756364A192B6FC8C6C6F4D67A15CA26C6F4D6F63A15CA26C6F94B86C62A2A15C +6C7A62705EA15C8D6C6F4C68A15CA26D6E4C7162A2A15C6D6F7597C7FC515BA15C78806D +6F4B670BFC97B6FCA26D6F4B6E6E610BF861A26D6F4B6E6E61A20BF0616D7A607192B57F +A15B0BE0826D6F4A6F64A15B1DC06D6F4A73608AA15B6E6E4A028070608AA15B0B00826E +6F499DC8FC7860646E6F49735F7994B6FCA26E6F4949715FA2795E6E4F715F725B795E23 +806E6F90B54865795EA26E6F484A06C05EA2795E6E6F484A06E05EA2795E6F0DF05E7248 +5C795EA26F038F91C804F893C9FCA15A8B6F03DF4907FC5DA27A92B6FC6F4D735D96B5FC +7A91B7FCA26F4D658CA26F4D65A28C6F4D65A28C6F6B638CA2704C65A28C7093CA96CAFC +A28C7069628D704B65704B725E704B725E704B06075E706C028006011680CA8179FFD9> +119 D<000FB56C98387FFFFC003F02F050B57E486E08078003FE5015806F62B7FC6C6F61 +825415007E826C9AB65A827E704E5D7E70646C64826C525D82A26C525D837F714D5D7F71 +636D63836D5192C7FC83A26D98B65A837F714C5D7F71626D62846E4F5D8480525D848072 +4B5D8072616E61846E9AC8FC725D8099B65A6E81A273495D81735F6F5F856F63636F8167 +6F6F5BA26F6F5F63676F81636F6F94C9FCA2706F5A668274B6FC7061867003E15DA21AF1 +7003F35D1AFB8297B75A82A27061A27160A2839BCAFCA2836583A2715FA2715FA28365A2 +836584A2725EA2725EA2849ACBFC84A26484A2725DA2725DA364A2606460A2001E63003F +5FD87FE04C5D01F85ED9FF8092B7CCFC02FC141F91BA5AA263636C62A263636350CDFC62 +621AE06297CEFC6C18FC19F0198006FCCFFC18C06C04FCD0FCD8000F4AD1FC81A379FF90 +>121 D E +%EndDVIPSBitmapFont +end +%%EndProlog +%%BeginSetup +%%Feature: *Resolution 600dpi +TeXDict begin + @landscape +%%EndSetup +%%Page: 1 1 +1 0 bop 354 668 a Fj(Hyp)9 b(ersonic)109 b(Flo)-9 b(w)107 +b(Computations)f(On)1289 901 y(Unstructured)k(Meshes)1877 +1465 y Fi(AIAA)91 b(97{0625)1045 1872 y Fh(K.)69 b(L.)h(Bibb)1466 +b(J.)69 b(P)-6 b(eraire)465 2131 y Fg(NASA)69 b(Langley)g(Resea)-6 +b(rch)294 b(Massachusetts)68 b(Institute)1212 2330 y(Center)1435 +b(of)69 b(T)-17 b(echnology)720 2530 y(Hampton,)68 b(Virginia)421 +b(Camb)-6 b(ridge,)68 b(Massachusetts)2255 2968 y Fh(C.)h(J.)h(Riley) +1356 3261 y Fg(NASA)f(Langley)g(Resea)-6 b(rch)68 b(Center)1926 +3493 y(Hampton,)h(Virginia)p eop +%%Page: 1 2 +1 1 bop 2 1494 a Ff(Session:)241 b Fh(Applied)69 b(Computational)e +(Aero)2 1760 y Ff(Time:)428 b Fh(w)-6 b(ed)69 b(afterno)6 +b(on)2 2026 y Ff(Mention:)160 b Fh(colleagues)1063 2283 +y Fe(\017)83 b Fh(Ram)67 b(Prabhu)i(fo)-6 b(r)69 b(running)h(co)6 +b(des)1063 2565 y Fe(\017)83 b Fh(Bill)69 b(Scallion)f(&)h(Matt)e(Rho)6 +b(de)70 b(fo)-6 b(r)69 b(UPWT)f(data)p eop +%%Page: 2 3 +2 2 bop 2039 893 a Fi(Background)146 1500 y Fe(\017)83 +b Fh(Rapid,)69 b(accurate)f(aero)6 b(dynamic)66 b(screening)j +(capabilit)-6 b(y)68 b(is)h(needed:)370 1782 y Ff({)82 +b Fh(aero)6 b(dynamic)67 b(p)6 b(erfo)-6 b(rmance)67 +b(co)6 b(e\016cients)370 2064 y Ff({)82 b Fh(p)-6 b(ressure)70 +b(loads)f(fo)-6 b(r)69 b(p)-6 b(relimina)g(ry)68 b(structural)f +(analysis)370 2346 y Ff({)82 b Fh(general)69 b(\015o)-6 +b(w)69 b(features,)f(fo)-6 b(r)70 b(example,)d(sho)6 +b(ck)69 b(lo)6 b(cation)146 2629 y Fe(\017)83 b Fh(Unstructured)69 +b(grids)g(o\013er)g(\015exible)f(and)h(rapid)g(grid)g(generation)146 +2911 y Fe(\017)83 b Fh(Histo)-6 b(rically)-17 b(,)69 +b(unstructured)g(Euler)f(schemes)g(a)-6 b(re)68 b(not)h(robust)317 +3143 y(hyp)6 b(ersonically)p eop +%%Page: 3 4 +3 3 bop 2289 1176 a Fi(Outline)146 1782 y Fe(\017)83 +b Fh(Computational)67 b(algo)-6 b(rithm)146 2064 y Fe(\017)83 +b Fh(Compa)-6 b(risons)69 b(to)g(other)f(co)6 b(des)317 +2297 y(and)69 b(exp)6 b(eriment)146 2579 y Fe(\017)83 +b Fh(Use)69 b(as)f(a)h(screening)g(to)6 b(ol)146 2861 +y Fe(\017)83 b Fh(Concluding)71 b(rema)-6 b(rks)p eop +%%Page: 3 5 +3 4 bop 146 1877 a Fe(\017)83 b Fh(details)68 b(a)-6 +b(re)69 b(in)g(the)f(pap)6 b(er)69 b(fo)-6 b(r)69 b(the)g(algo)-6 +b(rithm)146 2160 y Fe(\017)83 b Fh(screening)69 b(to)6 +b(ols)69 b(a)-6 b(re)69 b(talk)-6 b(ed)68 b(ab)6 b(out)68 +b(throughout)p eop +%%Page: 4 6 +4 5 bop 1807 880 a Fi(FELISA)91 b(System)146 1486 y Fe(\017)83 +b Fh(Unstructured)69 b(mesh)f(generation)146 1768 y Fe(\017)83 +b Fh(`Standa)-6 b(rd')69 b(Euler)g(\015o)-6 b(w)69 b(solver,)g(fo)-6 +b(r)69 b(subsonic)i Fe(\))d Fh(lo)-6 b(w)69 b(sup)6 b(ersonic)146 +2051 y Fe(\017)83 b Fh(Hyp)6 b(ersonic)69 b(Euler)g(\015o)-6 +b(w)69 b(solver,)g(FELISA)p 3515 2051 62 4 v 74 w(HYP)370 +2333 y Ff({)82 b Fh(p)6 b(erfect)68 b(gas)370 2615 y +Ff({)82 b Fh(equilib)-6 b(rium)69 b(air)370 2897 y Ff({)82 +b Fh(CF)821 2931 y Fd(4)146 3180 y Fe(\017)h Fh(P)-6 +b(a)g(rallel)68 b(versions)h(of)g(\015o)-6 b(w)70 b(solvers)p +eop +%%Page: 4 7 +4 6 bop 146 1877 a Fe(\017)83 b Fh(fo)-6 b(r)70 b(pa)-6 +b(rallel:)91 b(w)-6 b(o)g(rk)69 b(on)g(IBM)g(sP2,)g(J90,)i(w)-6 +b(o)g(rkstation)68 b(clusters.)146 2160 y Fe(\017)83 +b Fh(not)69 b(used)h(fo)-6 b(r)69 b(the)g(calculations)f(in)h(the)f +(pap)6 b(er)p eop +%%Page: 5 8 +5 7 bop 1529 661 a Fi(Unstructured)93 b(Inviscid)1397 +1010 y(Hyp)8 b(ersonic)91 b(Flo)-8 b(w)91 b(Solver)1839 +1358 y(\(FELISA)p 2846 1358 82 4 v 98 w(HYP\))146 1964 +y Fe(\017)83 b Fh(Euler)69 b(equations)146 2247 y Fe(\017)83 +b Fh(Finite)68 b(volume)g(fo)-6 b(rmulation)146 2529 +y Fe(\017)83 b Fh(Edge)69 b(data)f(structure)146 2811 +y Fe(\017)83 b Fh(H)m(\177)-100 b(anel)69 b(\015ux)g(vecto)-6 +b(r)68 b(splitting)146 3094 y Fe(\017)83 b Fh(MUSCL)68 +b(reconstruction)146 3376 y Fe(\017)83 b Fh(Explicit)68 +b(time)f(stepping)p eop +%%Page: 5 9 +5 8 bop 1873 1574 a Fi(Time)89 b(Stepping)146 2180 y +Fe(\017)83 b Fh(check)68 b(to)h(ensure)g(monotonicit)-6 +b(y)146 2463 y Fe(\017)83 b Fh(eliminate)67 b(limit)g(cycle)h(b)6 +b(ehavio)-6 b(r)p eop +%%Page: 6 10 +6 9 bop 1531 1013 a Fi(Edge)91 b(Data)h(Structure)68 +3068 y @beginspecial 144 @llx 367 @lly 488 @urx 602 @ury +2914 @rwi @setspecial +%%BeginDocument: smpfig.eps +%!PS-Adobe-2.0 EPSF-1.2 +%%Creator:Adobe Illustrator(TM) 1.1 +%%For: (RICHARD A WHELESS) (NASA LANGLEY) +%%Title: (EPS) +%%CreationDate: (2/9/99) (3:01 PM) +%%DocumentProcessColors: Black +%%DocumentFonts: Courier-Bold +%%DocumentProcSets: Adobe_Illustrator_1.1 0 0 +%%BoundingBox:144 367 488 602 +%%ColorUsage: Black&White +%AI3_IncludePlacedImages +%%TemplateBox:306 396 306 396 +%%TileBox: 30 31 582 761 +%%DocumentPreview: Header +%%EndComments +%%BeginProcSet:Adobe_Illustrator_1.1 0 0 +/Adobe_Illustrator_1.1 dup 100 dict def load begin +/Version 0 def +/Revision 0 def +/bdef {bind def} bind def +/ldef {load def} bdef +/xdef {exch def} bdef +/_K {3 index add neg dup 0 lt {pop 0} if 3 1 roll} bdef +/_k /setcmybcolor where +{/setcmybcolor get} {{1 sub 4 1 roll _K _K _K setrgbcolor pop} bind} ifelse def +/g {/_b xdef /p {_b setgray} def} bdef +/G {/_B xdef /P {_B setgray} def} bdef +/k {/_b xdef /_y xdef /_m xdef /_c xdef /p {_c _m _y _b _k} def} bdef +/K {/_B xdef /_Y xdef /_M xdef /_C xdef /P {_C _M _Y _B _k} def} bdef +/d /setdash ldef +/_i currentflat def +/i {dup 0 eq {pop _i} if setflat} bdef +/j /setlinejoin ldef +/J /setlinecap ldef +/M /setmiterlimit ldef +/w /setlinewidth ldef +/_R {.25 sub round .25 add} bdef +/_r {transform _R exch _R exch itransform} bdef +/c {_r curveto} bdef +/C /c ldef +/v {currentpoint 6 2 roll _r curveto} bdef +/V /v ldef +/y {_r 2 copy curveto} bdef +/Y /y ldef +/l {_r lineto} bdef +/L /l ldef +/m {_r moveto} bdef +/_e [] def +/_E {_e length 0 ne {gsave 0 g 0 G 0 i 0 J 0 j 1 w 10 M [] 0 d +/Courier 20 0 0 1 z [0.966 0.259 -0.259 0.966 +_e 0 get _e 2 get add 2 div _e 1 get _e 3 get add 2 div] e _f t T grestore} if} bdef +/_fill {{fill} stopped +{/_e [pathbbox] def /_f (ERROR: can't fill, increase flatness) def n _E} if} bdef +/_stroke {{stroke} stopped +{/_e [pathbbox] def /_f (ERROR: can't stroke, increase flatness) def n _E} if} bdef +/n /newpath ldef +/N /n ldef +/F {p _fill} bdef +/f {closepath F} bdef +/S {P _stroke} bdef +/s {closepath S} bdef +/B {gsave F grestore S} bdef +/b {closepath B} bdef +/_s /ashow ldef +/_S {(?) exch {2 copy 0 exch put pop dup false charpath currentpoint _g setmatrix +_stroke _G setmatrix moveto 3 copy pop rmoveto} forall pop pop pop n} bdef +/_A {_a moveto _t exch 0 exch} bdef +/_L {0 _l neg translate _G currentmatrix pop} bdef +/_w {dup stringwidth exch 3 -1 roll length 1 sub _t mul add exch} bdef +/_z [{0 0} bind {dup _w exch neg 2 div exch neg 2 div} bind {dup _w exch neg exch neg} bind] def +/z {_z exch get /_a xdef /_t xdef /_l xdef exch findfont exch scalefont setfont} bdef +/_g matrix def +/_G matrix def +/_D {_g currentmatrix pop gsave concat _G currentmatrix pop} bdef +/e {_D p /t {_A _s _L} def} bdef +/r {_D P /t {_A _S _L} def} bdef +/a {_D /t {dup p _A _s P _A _S _L} def} bdef +/o {_D /t {pop _L} def} bdef +/T {grestore} bdef +/u {} bdef +/U {} bdef +/Z {findfont begin currentdict dup length dict begin +{1 index /FID ne {def} {pop pop} ifelse} forall /FontName exch def dup length 0 ne +{/Encoding Encoding 256 array copy def 0 exch {dup type /nametype eq +{Encoding 2 index 2 index put pop 1 add} {exch pop} ifelse} forall} if pop +currentdict dup end end /FontName get exch definefont pop} bdef +end +%%EndProcSet +%%EndProlog +%%BeginSetup +Adobe_Illustrator_1.1 begin +n +%%BeginEncoding: _Courier-Bold Courier-Bold +[39/quotesingle 96/grave 128/Adieresis/Aring/Ccedilla/Eacute/Ntilde/Odieresis +/Udieresis/aacute/agrave/acircumflex/adieresis/atilde/aring/ccedilla/eacute +/egrave/ecircumflex/edieresis/iacute/igrave/icircumflex/idieresis/ntilde +/oacute/ograve/ocircumflex/odieresis/otilde/uacute/ugrave/ucircumflex +/udieresis/dagger/degree/cent/sterling/section/bullet/paragraph/germandbls +/registered/copyright/trademark/acute/dieresis/.notdef/AE/Oslash +/.notdef/plusminus/.notdef/.notdef/yen/mu/.notdef/.notdef +/.notdef/.notdef/.notdef/ordfeminine/ordmasculine/.notdef/ae/oslash +/questiondown/exclamdown/logicalnot/.notdef/florin/.notdef/.notdef +/guillemotleft/guillemotright/ellipsis/.notdef/Agrave/Atilde/Otilde/OE/oe +/endash/emdash/quotedblleft/quotedblright/quoteleft/quoteright/divide +/.notdef/ydieresis/Ydieresis/fraction/currency/guilsinglleft/guilsinglright +/fi/fl/daggerdbl/periodcentered/quotesinglbase/quotedblbase/perthousand +/Acircumflex/Ecircumflex/Aacute/Edieresis/Egrave/Iacute/Icircumflex +/Idieresis/Igrave/Oacute/Ocircumflex/.notdef/Ograve/Uacute/Ucircumflex +/Ugrave/dotlessi/circumflex/tilde/macron/breve/dotaccent/ring/cedilla +/hungarumlaut/ogonek/caron +]/_Courier-Bold/Courier-Bold Z +%%EndEncoding +%%EndSetup +0 0 0 0 k +0 0 0 1 K +0 i +0 J 0 j 1 w 4 M []0 d +%%Note: +487.5 367.5 m +487.5 601.5 L +145.5 601.5 L +145.5 367.5 L +487.5 367.5 L +b +145.5 601.5 m +487 368 l +B +487 601.5 m +145 368 l +B +0.5 w +450.5 478 m +450.5 494 L +182 494 L +182 478 L +450.5 478 L +b +u +0 0 0 1 k +1 w +/_Courier-Bold 12 14.5 0 0 z +[1 0 0 1 187.402 482]e +(Encapsulated Postscript \(EPS\) Figure)t +T +U +%%PageTrailer +%%Trailer +_E end +%%EOF + +%%EndDocument + @endspecial 3048 1421 a Fe(\017)83 b Fh(control)69 b(volumes)f(a)-6 +b(re)3219 1654 y(tetrahedra)67 b(surrounding)3219 1886 +y(each)i(no)6 b(de)3048 2168 y Fe(\017)83 b Fh(\015uxes)69 +b(computed)f(across)3219 2401 y(outer)h(faces)f(of)i(control)3219 +2633 y(volume)3048 2916 y Fe(\017)83 b Fh(\015ux)69 b(computations)3219 +3148 y(group)6 b(ed)70 b(b)-6 b(y)69 b(edge)p eop +%%Page: 6 11 +6 10 bop 756 678 a Fi(Old)91 b(Edge)g(Data)h(Structure)g(notes.)46 +b(.)f(.)146 1284 y Fe(\017)83 b Fh(edge)69 b(il)g(is)g(used)g(in)h(all) +e(of)h(the)g(\014gures.)35 b(.)g(.)229 1953 y Fe(\017)83 +b Fh(\015uxes)69 b(computed)f(across)400 2186 y(faces)h(of)g +(tetrahedra)229 2468 y Fe(\017)83 b Fh(control)69 b(volume)f(is)400 +2701 y(tetrahedra)229 2983 y Fe(\017)83 b Fh(no)6 b(dal)69 +b(info)h(fo)-6 b(r)69 b(cells)g(is)400 3215 y(sto)-6 +b(red)2824 1953 y Fe(\017)83 b Fh(\015uxes)69 b(computed)f(across)2995 +2186 y Fc(S)3111 2128 y Fb(e)3250 2186 y Fh(fo)-6 b(r)68 +b(all)e(edges)i(of)f(no)6 b(de)68 b Fc(i)2824 2468 y +Fe(\017)83 b Fh(control)69 b(volume)2995 2701 y(surrounds)h(no)6 +b(de)2824 2983 y Fe(\017)83 b Fh(w)-6 b(eights)69 b(fo)-6 +b(r)69 b Fc(S)4108 2925 y Fb(e)4249 2983 y Fh(sto)-6 +b(red)p eop +%%Page: 7 12 +7 11 bop 1182 1201 a Fi(H)l(\177)-132 b(anel)91 b(Flux)e(V)-8 +b(ecto)g(r)94 b(Splitting)146 1807 y Fe(\017)83 b Fh(Up)-6 +b(wind)70 b(fo)-6 b(rmulation;)68 b(allo)-6 b(ws)69 b(fo)-6 +b(r)69 b(stable)f(computations)g(across)317 2039 y(strong)i(sho)6 +b(cks)146 2321 y Fe(\017)83 b Fh(No)70 b('free')f(pa)-6 +b(rameters)66 b(a)-6 b(re)69 b(required)146 2604 y Fe(\017)83 +b Fh(Allo)-6 b(ws)70 b(fo)-6 b(r)69 b(constant)f(enthalp)-6 +b(y)69 b(solution)h(where)e(solution)i(is)f(fully)317 +2836 y(converged)p eop +%%Page: 8 13 +8 12 bop 1342 485 a Fi(Gradient)91 b(Reconstruction)541 +3700 y @beginspecial 144 @llx 367 @lly 488 @urx 602 @ury +5180 @rwi @setspecial +%%BeginDocument: smpfig.eps +%!PS-Adobe-2.0 EPSF-1.2 +%%Creator:Adobe Illustrator(TM) 1.1 +%%For: (RICHARD A WHELESS) (NASA LANGLEY) +%%Title: (EPS) +%%CreationDate: (2/9/99) (3:01 PM) +%%DocumentProcessColors: Black +%%DocumentFonts: Courier-Bold +%%DocumentProcSets: Adobe_Illustrator_1.1 0 0 +%%BoundingBox:144 367 488 602 +%%ColorUsage: Black&White +%AI3_IncludePlacedImages +%%TemplateBox:306 396 306 396 +%%TileBox: 30 31 582 761 +%%DocumentPreview: Header +%%EndComments +%%BeginProcSet:Adobe_Illustrator_1.1 0 0 +/Adobe_Illustrator_1.1 dup 100 dict def load begin +/Version 0 def +/Revision 0 def +/bdef {bind def} bind def +/ldef {load def} bdef +/xdef {exch def} bdef +/_K {3 index add neg dup 0 lt {pop 0} if 3 1 roll} bdef +/_k /setcmybcolor where +{/setcmybcolor get} {{1 sub 4 1 roll _K _K _K setrgbcolor pop} bind} ifelse def +/g {/_b xdef /p {_b setgray} def} bdef +/G {/_B xdef /P {_B setgray} def} bdef +/k {/_b xdef /_y xdef /_m xdef /_c xdef /p {_c _m _y _b _k} def} bdef +/K {/_B xdef /_Y xdef /_M xdef /_C xdef /P {_C _M _Y _B _k} def} bdef +/d /setdash ldef +/_i currentflat def +/i {dup 0 eq {pop _i} if setflat} bdef +/j /setlinejoin ldef +/J /setlinecap ldef +/M /setmiterlimit ldef +/w /setlinewidth ldef +/_R {.25 sub round .25 add} bdef +/_r {transform _R exch _R exch itransform} bdef +/c {_r curveto} bdef +/C /c ldef +/v {currentpoint 6 2 roll _r curveto} bdef +/V /v ldef +/y {_r 2 copy curveto} bdef +/Y /y ldef +/l {_r lineto} bdef +/L /l ldef +/m {_r moveto} bdef +/_e [] def +/_E {_e length 0 ne {gsave 0 g 0 G 0 i 0 J 0 j 1 w 10 M [] 0 d +/Courier 20 0 0 1 z [0.966 0.259 -0.259 0.966 +_e 0 get _e 2 get add 2 div _e 1 get _e 3 get add 2 div] e _f t T grestore} if} bdef +/_fill {{fill} stopped +{/_e [pathbbox] def /_f (ERROR: can't fill, increase flatness) def n _E} if} bdef +/_stroke {{stroke} stopped +{/_e [pathbbox] def /_f (ERROR: can't stroke, increase flatness) def n _E} if} bdef +/n /newpath ldef +/N /n ldef +/F {p _fill} bdef +/f {closepath F} bdef +/S {P _stroke} bdef +/s {closepath S} bdef +/B {gsave F grestore S} bdef +/b {closepath B} bdef +/_s /ashow ldef +/_S {(?) exch {2 copy 0 exch put pop dup false charpath currentpoint _g setmatrix +_stroke _G setmatrix moveto 3 copy pop rmoveto} forall pop pop pop n} bdef +/_A {_a moveto _t exch 0 exch} bdef +/_L {0 _l neg translate _G currentmatrix pop} bdef +/_w {dup stringwidth exch 3 -1 roll length 1 sub _t mul add exch} bdef +/_z [{0 0} bind {dup _w exch neg 2 div exch neg 2 div} bind {dup _w exch neg exch neg} bind] def +/z {_z exch get /_a xdef /_t xdef /_l xdef exch findfont exch scalefont setfont} bdef +/_g matrix def +/_G matrix def +/_D {_g currentmatrix pop gsave concat _G currentmatrix pop} bdef +/e {_D p /t {_A _s _L} def} bdef +/r {_D P /t {_A _S _L} def} bdef +/a {_D /t {dup p _A _s P _A _S _L} def} bdef +/o {_D /t {pop _L} def} bdef +/T {grestore} bdef +/u {} bdef +/U {} bdef +/Z {findfont begin currentdict dup length dict begin +{1 index /FID ne {def} {pop pop} ifelse} forall /FontName exch def dup length 0 ne +{/Encoding Encoding 256 array copy def 0 exch {dup type /nametype eq +{Encoding 2 index 2 index put pop 1 add} {exch pop} ifelse} forall} if pop +currentdict dup end end /FontName get exch definefont pop} bdef +end +%%EndProcSet +%%EndProlog +%%BeginSetup +Adobe_Illustrator_1.1 begin +n +%%BeginEncoding: _Courier-Bold Courier-Bold +[39/quotesingle 96/grave 128/Adieresis/Aring/Ccedilla/Eacute/Ntilde/Odieresis +/Udieresis/aacute/agrave/acircumflex/adieresis/atilde/aring/ccedilla/eacute +/egrave/ecircumflex/edieresis/iacute/igrave/icircumflex/idieresis/ntilde +/oacute/ograve/ocircumflex/odieresis/otilde/uacute/ugrave/ucircumflex +/udieresis/dagger/degree/cent/sterling/section/bullet/paragraph/germandbls +/registered/copyright/trademark/acute/dieresis/.notdef/AE/Oslash +/.notdef/plusminus/.notdef/.notdef/yen/mu/.notdef/.notdef +/.notdef/.notdef/.notdef/ordfeminine/ordmasculine/.notdef/ae/oslash +/questiondown/exclamdown/logicalnot/.notdef/florin/.notdef/.notdef +/guillemotleft/guillemotright/ellipsis/.notdef/Agrave/Atilde/Otilde/OE/oe +/endash/emdash/quotedblleft/quotedblright/quoteleft/quoteright/divide +/.notdef/ydieresis/Ydieresis/fraction/currency/guilsinglleft/guilsinglright +/fi/fl/daggerdbl/periodcentered/quotesinglbase/quotedblbase/perthousand +/Acircumflex/Ecircumflex/Aacute/Edieresis/Egrave/Iacute/Icircumflex +/Idieresis/Igrave/Oacute/Ocircumflex/.notdef/Ograve/Uacute/Ucircumflex +/Ugrave/dotlessi/circumflex/tilde/macron/breve/dotaccent/ring/cedilla +/hungarumlaut/ogonek/caron +]/_Courier-Bold/Courier-Bold Z +%%EndEncoding +%%EndSetup +0 0 0 0 k +0 0 0 1 K +0 i +0 J 0 j 1 w 4 M []0 d +%%Note: +487.5 367.5 m +487.5 601.5 L +145.5 601.5 L +145.5 367.5 L +487.5 367.5 L +b +145.5 601.5 m +487 368 l +B +487 601.5 m +145 368 l +B +0.5 w +450.5 478 m +450.5 494 L +182 494 L +182 478 L +450.5 478 L +b +u +0 0 0 1 k +1 w +/_Courier-Bold 12 14.5 0 0 z +[1 0 0 1 187.402 482]e +(Encapsulated Postscript \(EPS\) Figure)t +T +U +%%PageTrailer +%%Trailer +_E end +%%EOF + +%%EndDocument + @endspecial eop +%%Page: 8 14 +8 13 bop 997 1311 a Fi(Gradient)91 b(Reconstruction)h(notes)146 +1917 y Fe(\017)83 b Fh(compa)-6 b(re)68 b(to)g(structured)h(grid)g +(gradient)g(calculation)146 2199 y Fe(\017)83 b Fh(edge)69 +b(il)g(is)g(used)g(in)h(all)e(of)h(the)g(\014gures...)146 +2482 y Fe(\017)83 b Fh(MUSCL)68 b(reconstruction)h(\(Monotone)h(Up)-6 +b(wind)69 b(Scheme)317 2714 y(Conservation)g(La)-6 b(w\))p +eop +%%Page: 9 15 +9 14 bop 272 943 a Fi(Recent)93 b(Applications)c(of)j(the)f(FELISA)g +(System)146 1549 y Fe(\017)83 b Fh(Lo)6 b(ckheed-Ma)-6 +b(rtin)68 b(RL)-23 b(V/X-33)70 b(Phase)e(I;)h(aero)6 +b(dynamics)146 1832 y Fe(\017)83 b Fh(Lo)6 b(ckheed-Ma)-6 +b(rtin)68 b(RL)-23 b(V/X-33)70 b(Phase)e(I)6 b(I;)69 +b(Ascent)f(sho)6 b(ck)317 2064 y(interaction)68 b(study;)i(transonic)e +(aero)6 b(dynamic)67 b(screening)146 2346 y Fe(\017)83 +b Fh(McDonnell)69 b(Douglas)g(Phase)g(I)f(RL)-23 b(V/X-33;)71 +b(control)e(surface)317 2579 y(loading)h(\(NASA)f(CR)g(201606\))i(and)e +(aero)6 b(dynamics)317 2811 y(\(subsonic)71 b Fe(\))d +Fh(hyp)6 b(ersonic\))146 3094 y Fe(\017)83 b Fh(OSC)68 +b(X-34,)i(transonic)f(screening,)h(control)e(surface)h(loading)p +eop +%%Page: 10 16 +10 15 bop 969 678 a Fi(Co)8 b(de)91 b(to)h(Co)8 b(de)91 +b(Compa)-8 b(risons)90 b(fo)-8 b(r)313 1026 y(Prelimina)g(ry)88 +b(Lo)8 b(ckheed{Ma)-8 b(rtin)93 b(X-33)f(V)-8 b(ehicle)146 +1632 y Fe(\017)83 b Fh(Co)6 b(des:)317 1865 y({)69 b(FELISA)p +1171 1865 62 4 v 74 w(HYP:)g(inviscid,)h(unstructured)f(mesh)317 +2097 y({)g(LA)-6 b(URA:)70 b(viscous,)g(structured)e(grid)317 +2330 y({)h(DPLUR:)g(inviscid,)g(structured)g(grid,)g(pa)-6 +b(rallel)146 2612 y Fe(\017)83 b Fh(Flo)-6 b(w)69 b(feature,)f(surface) +h(p)-6 b(ressure)69 b(compa)-6 b(risons:)317 2844 y({)69 +b Fc(M)658 2865 y Fa(1)857 2844 y Fh(=)49 b(9)p Fc(:)p +Fh(8,)69 b Fc(\013)49 b Fh(=)f(40)2025 2786 y Fa(\016)146 +3127 y Fe(\017)83 b Fh(Aero)6 b(dynamic)67 b(fo)-6 b(rce)69 +b(and)g(moment)e(compa)-6 b(risons:)317 3359 y({)69 b +Fc(M)658 3380 y Fa(1)857 3359 y Fh(=)49 b(4)p Fc(:)p +Fh(5,)69 b(exp)6 b(erimental)66 b(data)i(from)g(LaRC)g(UPWT)p +eop +%%Page: 11 17 +11 16 bop 1677 1087 a Fi(X33)92 b(Con\014guration)189 +3039 y @beginspecial 144 @llx 367 @lly 488 @urx 602 @ury +2914 @rwi @setspecial +%%BeginDocument: smpfig.eps +%!PS-Adobe-2.0 EPSF-1.2 +%%Creator:Adobe Illustrator(TM) 1.1 +%%For: (RICHARD A WHELESS) (NASA LANGLEY) +%%Title: (EPS) +%%CreationDate: (2/9/99) (3:01 PM) +%%DocumentProcessColors: Black +%%DocumentFonts: Courier-Bold +%%DocumentProcSets: Adobe_Illustrator_1.1 0 0 +%%BoundingBox:144 367 488 602 +%%ColorUsage: Black&White +%AI3_IncludePlacedImages +%%TemplateBox:306 396 306 396 +%%TileBox: 30 31 582 761 +%%DocumentPreview: Header +%%EndComments +%%BeginProcSet:Adobe_Illustrator_1.1 0 0 +/Adobe_Illustrator_1.1 dup 100 dict def load begin +/Version 0 def +/Revision 0 def +/bdef {bind def} bind def +/ldef {load def} bdef +/xdef {exch def} bdef +/_K {3 index add neg dup 0 lt {pop 0} if 3 1 roll} bdef +/_k /setcmybcolor where +{/setcmybcolor get} {{1 sub 4 1 roll _K _K _K setrgbcolor pop} bind} ifelse def +/g {/_b xdef /p {_b setgray} def} bdef +/G {/_B xdef /P {_B setgray} def} bdef +/k {/_b xdef /_y xdef /_m xdef /_c xdef /p {_c _m _y _b _k} def} bdef +/K {/_B xdef /_Y xdef /_M xdef /_C xdef /P {_C _M _Y _B _k} def} bdef +/d /setdash ldef +/_i currentflat def +/i {dup 0 eq {pop _i} if setflat} bdef +/j /setlinejoin ldef +/J /setlinecap ldef +/M /setmiterlimit ldef +/w /setlinewidth ldef +/_R {.25 sub round .25 add} bdef +/_r {transform _R exch _R exch itransform} bdef +/c {_r curveto} bdef +/C /c ldef +/v {currentpoint 6 2 roll _r curveto} bdef +/V /v ldef +/y {_r 2 copy curveto} bdef +/Y /y ldef +/l {_r lineto} bdef +/L /l ldef +/m {_r moveto} bdef +/_e [] def +/_E {_e length 0 ne {gsave 0 g 0 G 0 i 0 J 0 j 1 w 10 M [] 0 d +/Courier 20 0 0 1 z [0.966 0.259 -0.259 0.966 +_e 0 get _e 2 get add 2 div _e 1 get _e 3 get add 2 div] e _f t T grestore} if} bdef +/_fill {{fill} stopped +{/_e [pathbbox] def /_f (ERROR: can't fill, increase flatness) def n _E} if} bdef +/_stroke {{stroke} stopped +{/_e [pathbbox] def /_f (ERROR: can't stroke, increase flatness) def n _E} if} bdef +/n /newpath ldef +/N /n ldef +/F {p _fill} bdef +/f {closepath F} bdef +/S {P _stroke} bdef +/s {closepath S} bdef +/B {gsave F grestore S} bdef +/b {closepath B} bdef +/_s /ashow ldef +/_S {(?) exch {2 copy 0 exch put pop dup false charpath currentpoint _g setmatrix +_stroke _G setmatrix moveto 3 copy pop rmoveto} forall pop pop pop n} bdef +/_A {_a moveto _t exch 0 exch} bdef +/_L {0 _l neg translate _G currentmatrix pop} bdef +/_w {dup stringwidth exch 3 -1 roll length 1 sub _t mul add exch} bdef +/_z [{0 0} bind {dup _w exch neg 2 div exch neg 2 div} bind {dup _w exch neg exch neg} bind] def +/z {_z exch get /_a xdef /_t xdef /_l xdef exch findfont exch scalefont setfont} bdef +/_g matrix def +/_G matrix def +/_D {_g currentmatrix pop gsave concat _G currentmatrix pop} bdef +/e {_D p /t {_A _s _L} def} bdef +/r {_D P /t {_A _S _L} def} bdef +/a {_D /t {dup p _A _s P _A _S _L} def} bdef +/o {_D /t {pop _L} def} bdef +/T {grestore} bdef +/u {} bdef +/U {} bdef +/Z {findfont begin currentdict dup length dict begin +{1 index /FID ne {def} {pop pop} ifelse} forall /FontName exch def dup length 0 ne +{/Encoding Encoding 256 array copy def 0 exch {dup type /nametype eq +{Encoding 2 index 2 index put pop 1 add} {exch pop} ifelse} forall} if pop +currentdict dup end end /FontName get exch definefont pop} bdef +end +%%EndProcSet +%%EndProlog +%%BeginSetup +Adobe_Illustrator_1.1 begin +n +%%BeginEncoding: _Courier-Bold Courier-Bold +[39/quotesingle 96/grave 128/Adieresis/Aring/Ccedilla/Eacute/Ntilde/Odieresis +/Udieresis/aacute/agrave/acircumflex/adieresis/atilde/aring/ccedilla/eacute +/egrave/ecircumflex/edieresis/iacute/igrave/icircumflex/idieresis/ntilde +/oacute/ograve/ocircumflex/odieresis/otilde/uacute/ugrave/ucircumflex +/udieresis/dagger/degree/cent/sterling/section/bullet/paragraph/germandbls +/registered/copyright/trademark/acute/dieresis/.notdef/AE/Oslash +/.notdef/plusminus/.notdef/.notdef/yen/mu/.notdef/.notdef +/.notdef/.notdef/.notdef/ordfeminine/ordmasculine/.notdef/ae/oslash +/questiondown/exclamdown/logicalnot/.notdef/florin/.notdef/.notdef +/guillemotleft/guillemotright/ellipsis/.notdef/Agrave/Atilde/Otilde/OE/oe +/endash/emdash/quotedblleft/quotedblright/quoteleft/quoteright/divide +/.notdef/ydieresis/Ydieresis/fraction/currency/guilsinglleft/guilsinglright +/fi/fl/daggerdbl/periodcentered/quotesinglbase/quotedblbase/perthousand +/Acircumflex/Ecircumflex/Aacute/Edieresis/Egrave/Iacute/Icircumflex +/Idieresis/Igrave/Oacute/Ocircumflex/.notdef/Ograve/Uacute/Ucircumflex +/Ugrave/dotlessi/circumflex/tilde/macron/breve/dotaccent/ring/cedilla +/hungarumlaut/ogonek/caron +]/_Courier-Bold/Courier-Bold Z +%%EndEncoding +%%EndSetup +0 0 0 0 k +0 0 0 1 K +0 i +0 J 0 j 1 w 4 M []0 d +%%Note: +487.5 367.5 m +487.5 601.5 L +145.5 601.5 L +145.5 367.5 L +487.5 367.5 L +b +145.5 601.5 m +487 368 l +B +487 601.5 m +145 368 l +B +0.5 w +450.5 478 m +450.5 494 L +182 494 L +182 478 L +450.5 478 L +b +u +0 0 0 1 k +1 w +/_Courier-Bold 12 14.5 0 0 z +[1 0 0 1 187.402 482]e +(Encapsulated Postscript \(EPS\) Figure)t +T +U +%%PageTrailer +%%Trailer +_E end +%%EOF + +%%EndDocument + @endspecial 2594 w @beginspecial 144 @llx 367 @lly 488 +@urx 602 @ury 2914 @rwi @setspecial +%%BeginDocument: smpfig.eps +%!PS-Adobe-2.0 EPSF-1.2 +%%Creator:Adobe Illustrator(TM) 1.1 +%%For: (RICHARD A WHELESS) (NASA LANGLEY) +%%Title: (EPS) +%%CreationDate: (2/9/99) (3:01 PM) +%%DocumentProcessColors: Black +%%DocumentFonts: Courier-Bold +%%DocumentProcSets: Adobe_Illustrator_1.1 0 0 +%%BoundingBox:144 367 488 602 +%%ColorUsage: Black&White +%AI3_IncludePlacedImages +%%TemplateBox:306 396 306 396 +%%TileBox: 30 31 582 761 +%%DocumentPreview: Header +%%EndComments +%%BeginProcSet:Adobe_Illustrator_1.1 0 0 +/Adobe_Illustrator_1.1 dup 100 dict def load begin +/Version 0 def +/Revision 0 def +/bdef {bind def} bind def +/ldef {load def} bdef +/xdef {exch def} bdef +/_K {3 index add neg dup 0 lt {pop 0} if 3 1 roll} bdef +/_k /setcmybcolor where +{/setcmybcolor get} {{1 sub 4 1 roll _K _K _K setrgbcolor pop} bind} ifelse def +/g {/_b xdef /p {_b setgray} def} bdef +/G {/_B xdef /P {_B setgray} def} bdef +/k {/_b xdef /_y xdef /_m xdef /_c xdef /p {_c _m _y _b _k} def} bdef +/K {/_B xdef /_Y xdef /_M xdef /_C xdef /P {_C _M _Y _B _k} def} bdef +/d /setdash ldef +/_i currentflat def +/i {dup 0 eq {pop _i} if setflat} bdef +/j /setlinejoin ldef +/J /setlinecap ldef +/M /setmiterlimit ldef +/w /setlinewidth ldef +/_R {.25 sub round .25 add} bdef +/_r {transform _R exch _R exch itransform} bdef +/c {_r curveto} bdef +/C /c ldef +/v {currentpoint 6 2 roll _r curveto} bdef +/V /v ldef +/y {_r 2 copy curveto} bdef +/Y /y ldef +/l {_r lineto} bdef +/L /l ldef +/m {_r moveto} bdef +/_e [] def +/_E {_e length 0 ne {gsave 0 g 0 G 0 i 0 J 0 j 1 w 10 M [] 0 d +/Courier 20 0 0 1 z [0.966 0.259 -0.259 0.966 +_e 0 get _e 2 get add 2 div _e 1 get _e 3 get add 2 div] e _f t T grestore} if} bdef +/_fill {{fill} stopped +{/_e [pathbbox] def /_f (ERROR: can't fill, increase flatness) def n _E} if} bdef +/_stroke {{stroke} stopped +{/_e [pathbbox] def /_f (ERROR: can't stroke, increase flatness) def n _E} if} bdef +/n /newpath ldef +/N /n ldef +/F {p _fill} bdef +/f {closepath F} bdef +/S {P _stroke} bdef +/s {closepath S} bdef +/B {gsave F grestore S} bdef +/b {closepath B} bdef +/_s /ashow ldef +/_S {(?) exch {2 copy 0 exch put pop dup false charpath currentpoint _g setmatrix +_stroke _G setmatrix moveto 3 copy pop rmoveto} forall pop pop pop n} bdef +/_A {_a moveto _t exch 0 exch} bdef +/_L {0 _l neg translate _G currentmatrix pop} bdef +/_w {dup stringwidth exch 3 -1 roll length 1 sub _t mul add exch} bdef +/_z [{0 0} bind {dup _w exch neg 2 div exch neg 2 div} bind {dup _w exch neg exch neg} bind] def +/z {_z exch get /_a xdef /_t xdef /_l xdef exch findfont exch scalefont setfont} bdef +/_g matrix def +/_G matrix def +/_D {_g currentmatrix pop gsave concat _G currentmatrix pop} bdef +/e {_D p /t {_A _s _L} def} bdef +/r {_D P /t {_A _S _L} def} bdef +/a {_D /t {dup p _A _s P _A _S _L} def} bdef +/o {_D /t {pop _L} def} bdef +/T {grestore} bdef +/u {} bdef +/U {} bdef +/Z {findfont begin currentdict dup length dict begin +{1 index /FID ne {def} {pop pop} ifelse} forall /FontName exch def dup length 0 ne +{/Encoding Encoding 256 array copy def 0 exch {dup type /nametype eq +{Encoding 2 index 2 index put pop 1 add} {exch pop} ifelse} forall} if pop +currentdict dup end end /FontName get exch definefont pop} bdef +end +%%EndProcSet +%%EndProlog +%%BeginSetup +Adobe_Illustrator_1.1 begin +n +%%BeginEncoding: _Courier-Bold Courier-Bold +[39/quotesingle 96/grave 128/Adieresis/Aring/Ccedilla/Eacute/Ntilde/Odieresis +/Udieresis/aacute/agrave/acircumflex/adieresis/atilde/aring/ccedilla/eacute +/egrave/ecircumflex/edieresis/iacute/igrave/icircumflex/idieresis/ntilde +/oacute/ograve/ocircumflex/odieresis/otilde/uacute/ugrave/ucircumflex +/udieresis/dagger/degree/cent/sterling/section/bullet/paragraph/germandbls +/registered/copyright/trademark/acute/dieresis/.notdef/AE/Oslash +/.notdef/plusminus/.notdef/.notdef/yen/mu/.notdef/.notdef +/.notdef/.notdef/.notdef/ordfeminine/ordmasculine/.notdef/ae/oslash +/questiondown/exclamdown/logicalnot/.notdef/florin/.notdef/.notdef +/guillemotleft/guillemotright/ellipsis/.notdef/Agrave/Atilde/Otilde/OE/oe +/endash/emdash/quotedblleft/quotedblright/quoteleft/quoteright/divide +/.notdef/ydieresis/Ydieresis/fraction/currency/guilsinglleft/guilsinglright +/fi/fl/daggerdbl/periodcentered/quotesinglbase/quotedblbase/perthousand +/Acircumflex/Ecircumflex/Aacute/Edieresis/Egrave/Iacute/Icircumflex +/Idieresis/Igrave/Oacute/Ocircumflex/.notdef/Ograve/Uacute/Ucircumflex +/Ugrave/dotlessi/circumflex/tilde/macron/breve/dotaccent/ring/cedilla +/hungarumlaut/ogonek/caron +]/_Courier-Bold/Courier-Bold Z +%%EndEncoding +%%EndSetup +0 0 0 0 k +0 0 0 1 K +0 i +0 J 0 j 1 w 4 M []0 d +%%Note: +487.5 367.5 m +487.5 601.5 L +145.5 601.5 L +145.5 367.5 L +487.5 367.5 L +b +145.5 601.5 m +487 368 l +B +487 601.5 m +145 368 l +B +0.5 w +450.5 478 m +450.5 494 L +182 494 L +182 478 L +450.5 478 L +b +u +0 0 0 1 k +1 w +/_Courier-Bold 12 14.5 0 0 z +[1 0 0 1 187.402 482]e +(Encapsulated Postscript \(EPS\) Figure)t +T +U +%%PageTrailer +%%Trailer +_E end +%%EOF + +%%EndDocument + @endspecial eop +%%Page: 11 18 +11 17 bop 303 1553 a Fi(Co)8 b(de)92 b(to)f(Co)8 b(de)92 +b(Compa)-8 b(risons)89 b(fo)-8 b(r)93 b(Prelimina)-8 +b(ry)979 1901 y(Lo)8 b(ckheed{Ma)-8 b(rtin)93 b(X-33)e(V)-8 +b(ehicle)146 2507 y Fe(\017)83 b Fh(mention)68 b(co)6 +b(de)69 b(autho)-6 b(rs)p eop +%%Page: 12 19 +12 18 bop 726 652 a Fi(Grid)90 b(Generation)i(Time)d(Compa)-8 +b(risons)146 1258 y Fe(\017)83 b Fh(Initial)68 b(geometry)f +(de\014nition,)j(surface)e(and)h(volume)f(mesh)317 1490 +y(generation)h(fo)-6 b(r)69 b(an)g(X-33)g(con\014guration,)h(\014rst)f +(time)e Fe(k)317 1723 y Fh(most)h(recent:)370 2005 y +Ff({)82 b Fh(FELISA:)69 b(1.5)h(w)-6 b(eeks)68 b Fe(k)g +Fh(4)i(da)-6 b(ys)370 2287 y Ff({)82 b Fh(structured:)92 +b(6)69 b(w)-6 b(eeks)69 b Fe(k)f Fh(3.5)i(w)-6 b(eeks)146 +2570 y Fe(\017)83 b Fh(Case-sp)6 b(eci\014c)68 b(grid)h(generation:)92 +b(b)6 b(o)-6 b(w)70 b(sho)6 b(ck)68 b(spacing:)93 b(time)317 +2802 y(consuming)65 b(fo)-6 b(r)65 b(FELISA,)f(1-2)h(da)-6 +b(ys)64 b(control)h(surface)f(de\015ections:)370 3084 +y Ff({)82 b Fh(1)p Fc(=)p Fh(2)70 b(da)-6 b(y)68 b(fo)-6 +b(r)70 b(unstructured)370 3367 y Ff({)82 b Fh(1)p Fc(=)p +Fh(2)70 b(w)-6 b(eek)68 b(fo)-6 b(r)69 b(LA)-6 b(URA)p +eop +%%Page: 12 20 +12 19 bop 726 1702 a Fi(Grid)90 b(Generation)i(Time)d(Compa)-8 +b(risons)2 2092 y Ff(felisa:)95 b Fh(put)69 b(together)f(surfaces,)h +(intersection)g(curves,)g(top)6 b(ology)2 2358 y Ff(laura:)110 +b Fh(build)69 b(surface)g(on)g(cad)p eop +%%Page: 13 21 +13 20 bop 1564 1035 a Fi(Concluding)90 b(Rema)-8 b(rks)146 +1641 y Fe(\017)83 b Fh(FELISA)p 999 1641 62 4 v 74 w(HYP)69 +b(\015o)-6 b(w)69 b(solver)g(develop)6 b(ed)146 1923 +y Fe(\017)83 b Fh(Applied)70 b(FELISA)e(System)f(with)h(FELISA)p +3545 1923 V 73 w(HYP)h(to)g(complex)317 2155 y(con\014gurations)370 +2438 y Ff({)82 b Fh(Compa)-6 b(rable)68 b(accuracy)f(to)i(structured)f +(grid)i(solvers)370 2720 y Ff({)82 b Fh(F)-6 b(aster)68 +b(turn{a)-6 b(round)70 b(time)d(than)i(structured)f(grid)i(metho)6 +b(ds)146 3002 y Fe(\017)83 b Fh(Signi\014cant)69 b(impact)d(on)k(majo) +-6 b(r)67 b(NASA)i(p)-6 b(rograms)p eop +%%Trailer +end +userdict /end-hook known{end-hook}if +%%EOF diff --git a/macros/latex/contrib/aiaa/pre2004/demos/talk/smptalk.sty b/macros/latex/contrib/aiaa/pre2004/demos/talk/smptalk.sty new file mode 100644 index 0000000000..585f5ce0b8 --- /dev/null +++ b/macros/latex/contrib/aiaa/pre2004/demos/talk/smptalk.sty @@ -0,0 +1,97 @@ +% +% `smptalk.sty' custom commands and settings used to make slides +% +% for use with `smptalk.tex' via \usepackage{smptalk} +% +% this is an example of a `package'. in this case, it merely +% defines some macros which are useful when making slides. +% one doesn't really need the next three, or the last command +% in this package, these are just formalities. + +\NeedsTeXFormat{LaTeX2e} +\ProvidesPackage{smptalk}[1997/02/20 v0.1a Sample user-developed package (BK)] +\typeout{Package: smptalk v0.1a <1997/02/20> (Bil Kleb)} + +% turn off page numbers: + +\pagestyle{empty} + +% in general, we don't want filled and hyphenated output on slides: + +\raggedright + +% make sure we have the graphicx package loaded +% since it is used to include figures: + +\RequirePackage{graphicx} + +% define a command to include figures: +% use: \incfig{epsfigure} or \incfig[2in]{epsfigure} + +\newcommand{\incfig}% - name of command + [2]% - number of arguments + [\linewidth]% - default value for optional 1st argument + {% - begin definition + \centering% - center figure + \includegraphics% - graphicx's include command + [width=#1,% - set graphic width + keepaspectratio]% - leave aspect ratio alone + {#2}% - name of figure + }% - end definition + +% un-comment one of the following to use Helvetica or Times +% fonts in place of Computer Modern (requires psfont distribution): +%\RequirePackage{times} +%\RequirePackage{helvetic} + +% redefine an old command to make titles for each slide: +% use: \title{This is the Large, Centered Slide Title} + +\renewcommand{\title}% - name of command + [1]% - number of arguments + {% - begin definition + \bgroup% - begin a local group + \centering% - turn on centering + \large\bf% - select font + #1% - insert title text + \par% - end a paragraph (skip \parsep) + \egroup% - terminate local group + }% - complete definition + +% define new itemize-like environment +% to make the vertical spacing tighter: + +\newenvironment{items}% - define a new environment + {% - begin beginning definition + \begin{itemize}% - revamp the itemize environment + \raggedright% - don't hyphenate/fill lines + \setlength{\itemsep}% - space between items + {2pt plus 2pt minus 1pt}% (rubber length) + \setlength{\parskip}% - space between list and body + {4pt plus 2pt minus 2pt}% (rubber length) + \setlength{\parsep}% - paragraphs within items + {2pt plus 2pt minus 1pt}% (rubber length) + }% - close beginning definition + {\end{itemize}}% - ending definition + +% make a description-like environment which +% justifies the labels according to an optional +% parameter and allows hyphenation of the labels + +\newenvironment{describe}[1][1.25in]% + {\begin{list}{}% + {\renewcommand{\makelabel}{\describelabel}% + \setlength{\labelwidth}{#1}% + \setlength{\leftmargin}{\labelwidth}% + \addtolength{\leftmargin}{\labelsep}% + \setlength{\itemsep}{2pt plus 2pt minus 1pt}% + \setlength{\parskip}{4pt plus 2pt minus 2pt}% + \setlength{\parsep}{2pt plus 2pt minus 1pt}}}% + {\end{list}} +\newcommand{\describelabel}[1]% + {\raisebox{0pt}[1ex][0pt]{\makebox[\labelwidth][l]% + {\parbox[t]{\labelwidth}{\hspace{0pt}\textbf{#1:}}}}} + +% tell them we're through messing around, and get on with it: + +\endinput
\ No newline at end of file diff --git a/macros/latex/contrib/aiaa/pre2004/demos/talk/smptalk.tex b/macros/latex/contrib/aiaa/pre2004/demos/talk/smptalk.tex new file mode 100644 index 0000000000..4dba1b85ff --- /dev/null +++ b/macros/latex/contrib/aiaa/pre2004/demos/talk/smptalk.tex @@ -0,0 +1,296 @@ +% +% 'smptalk.tex' sample slide presentation - courtesy of karen bibb +% +% typical (unix) processing sequence for postscript printer: +% +% latex smptalk - create dvi file +% xdvi -paper usr smptalk - preview dvi file +% dvips -t landscape smptalk - transform dvi file to postscript +% ghostview -landscape -swap smptalk.ps - check postscript output +% lpr smptalk.ps - print postscript file + +\documentclass[landscape]{slides} + +% load custom command definitions and other default settings: +\usepackage{smptalk} + +% un-comment for ``page'' numbers: +%\pagestyle{plain} + +% un-comment for processing only a select few slides or notes: +%\onlyslides{1-2,5,10-999} +%\onlynotes{1-2,12} +% or, for interactive prompting, un-comment the following: +%\typein[\slides]{Which slides to do?} +%\onlyslides{\slides} +%\onlynotes{\slides} + +\begin{document} + +\begin{slide}\typeout{Title:} + \begin{center} + {\Large\bf Hypersonic Flow Computations On Unstructured Meshes} + + {\large\bf AIAA 97--0625} + + \begin{tabular}{cc} + K. L. Bibb & J. Peraire \\[.1in] + \it NASA Langley Research & \it Massachusetts Institute \\ + \it Center & \it of Technology \\ + \it Hampton, Virginia & \it Cambridge, Massachusetts + \end{tabular} + + C. J. Riley \\[.1in] + \it NASA Langley Research Center \\ + Hampton, Virginia + \end{center} +\end{slide} + +\begin{note} + \begin{describe}[1.5in] + \item [Session] Applied Computational Aero + \item [Time] wed afternoon + \item [Mention] colleagues + \begin{items} + \item Ram Prabhu for running codes + \item Bill Scallion \& Matt Rhode for UPWT data + \end{items} + \end{describe} +\end{note} + +\begin{slide}\typeout{Background:} + \title{Background} + \begin{items} + \item Rapid, accurate aerodynamic screening capability is + needed: + \begin{items} + \item aerodynamic performance coefficients + \item pressure loads for preliminary structural analysis + \item general flow features, for example, shock location + \end{items} + \item Unstructured grids offer flexible and rapid grid generation + \item Historically, unstructured Euler schemes + are not robust hypersonically + \end{items} +\end{slide} + +\begin{slide}\typeout{Outline:} + \title{Outline} + \leftmargin 3in + \begin{items} + \item Computational algorithm + \item Comparisons to other codes\\ + and experiment + \item Use as a screening tool + \item Concluding remarks + \end{items} +\end{slide} + +\begin{note} + \begin{items} + \item details are in the paper for the algorithm + \item screening tools are talked about throughout + \end{items} +\end{note} + +\begin{slide}\typeout{Flow solver (overview):} + \title{FELISA System} + \begin{items} + \item Unstructured mesh generation + \item `Standard' Euler flow solver, + for subsonic $\Rightarrow$ low supersonic + \item Hypersonic Euler flow solver, FELISA\_HYP + \begin{items} + \item perfect gas + \item equilibrium air + \item CF$_4$ + \end{items} + \item Parallel versions of flow solvers + \end{items} +\end{slide} + +\begin{note} + \begin{items} + \item for parallel: work on IBM sP2, J90, workstation clusters. + \item not used for the calculations in the paper + \end{items} +\end{note} + +\begin{slide}\typeout{Flow solver (FELISA):} + + \title{Unstructured Inviscid\\ Hypersonic Flow Solver\\ (FELISA\_HYP)} + \leftmargin 3in + \begin{items} + \item Euler equations + \item Finite volume formulation + \item Edge data structure + \item H\"{a}nel flux vector splitting + \item MUSCL reconstruction + \item Explicit time stepping + \end{items} +\end{slide} + +\begin{note} + \title{Time Stepping} + \leftmargin 2.5in + \begin{items} + \item check to ensure monotonicity + \item eliminate limit cycle behavior + \end{items} +\end{note} + +\begin{slide}\typeout{Edge Data Structure:} + \title{Edge Data Structure} + \begin{center} + \begin{minipage}{.45\linewidth} + \incfig[\linewidth]{smpfig} + \end{minipage} + \hspace{0.05\linewidth} + \begin{minipage}{.45\linewidth} + \begin{items} + \item control volumes are tetrahedra surrounding each node + \item fluxes computed across outer faces of control volume + \item flux computations grouped by edge + \end{items} + \end{minipage} + \end{center} +\end{slide} + +\begin{note} + \title{Old Edge Data Structure notes\ldots} + \leftmargin 2in + \begin{items} + \item edge il is used in all of the figures\ldots\ + \end{items} + \leftmargin 0in + \begin{tabular}{p{.45\linewidth}p{.45\linewidth}} + \begin{items} + \item fluxes computed across faces of tetrahedra + \item control volume is tetrahedra + \item nodal info for cells is stored + \end{items}& + \begin{items} + \item fluxes computed across $S^e$ for all edges of node~$i$ + \item control volume surrounds node + \item weights for $S^e$ stored + \end{items} + \end{tabular} +\end{note} + +\begin{slide} + \typeout{Flux vector splitting:} + \title{H\"anel Flux Vector Splitting} + \begin{items} + \item Upwind formulation; allows for stable computations + across strong shocks + \item No 'free' parameters are required + \item Allows for constant enthalpy solution where solution is + fully converged + \end{items} +\end{slide} + +\begin{slide}\typeout{Reconstruction:} + \title{Gradient Reconstruction} + \incfig[.8\linewidth]{smpfig} +\end{slide} + +\begin{note} + \title{Gradient Reconstruction notes} + \begin{items} + \item compare to structured grid gradient calculation\\ + \item edge il is used in all of the figures...\\ + \item MUSCL reconstruction + (Monotone Upwind Scheme Conservation Law) + \end{items} +\end{note} + +\begin{slide}\typeout{NASA's use of FELISA:} + \title{Recent Applications of the FELISA System} + \leftmargin 1in + \begin{items} + \item Lockheed-Martin RLV/X-33 Phase I; aerodynamics + \item Lockheed-Martin RLV/X-33 Phase II; + Ascent shock interaction study; transonic aerodynamic screening + \item McDonnell Douglas Phase I RLV/X-33; + control surface loading (NASA CR 201606) + and aerodynamics\\ + (subsonic $\Rightarrow$ hypersonic) + \item OSC X-34, transonic screening, control surface loading + \end{items} +\end{slide} + +\begin{slide}\typeout{X-33 body:} + \title{Code to Code Comparisons for\\ + Preliminary Lockheed--Martin X-33 Vehicle} + \begin{items} + \item Codes:\\ + -- FELISA\_HYP: inviscid, unstructured mesh\\ + -- LAURA: viscous, structured grid\\ + -- DPLUR: inviscid, structured grid, parallel + \item Flow feature, surface pressure comparisons:\\ + -- $M_\infty = 9.8$, $\alpha = 40^{\circ}$ + \item Aerodynamic force and moment comparisons:\\ + -- $M_\infty = 4.5$, experimental data from LaRC UPWT + \end{items} +\end{slide} + +\begin{slide} + \title{X33 Configuration} + \begin{center} + \begin{tabular}{cc} + \incfig[.45\linewidth]{smpfig}& + \incfig[.45\linewidth]{smpfig} + \end{tabular} + \end{center} +\end{slide} + +\begin{note} + \title{Code to Code Comparisons for + Preliminary Lockheed--Martin X-33 Vehicle} + \leftmargin 3in + \begin{items} + \item mention code authors + \end{items} +\end{note} + +\begin{slide}\typeout{How has FELISAHYP been used?} + \title{Grid Generation Time Comparisons} + \begin{items} + \item Initial geometry definition, surface and volume mesh generation + for an X-33 configuration, first~time~$\|$ most~recent: + \begin{items} + \item FELISA: 1.5 weeks $\|$ 4 days + \item structured: 6 weeks $\|$ 3.5 weeks + \end{items} + \item Case-specific grid generation: + bow shock spacing: time consuming for FELISA, 1-2 days + control surface deflections: + \begin{items} + \item $1/2$ day for unstructured + \item $1/2$ week for LAURA + \end{items} + \end{items} +\end{slide} + +\begin{note} + \title{Grid Generation Time Comparisons} + \begin{describe}[.9in] + \item[felisa] put together surfaces, intersection curves, topology + \item[laura] build surface on cad + \end{describe} +\end{note} + +\begin{slide}\typeout{Concluding Remarks:} + \title{Concluding Remarks} + \begin{items} + \item FELISA\_HYP flow solver developed\\ + \item Applied FELISA System with FELISA\_HYP to complex \\configurations + \begin{items} + \item Comparable accuracy to structured grid solvers + \item Faster turn--around time than structured grid methods + \end{items} + \item Significant impact on major NASA programs + \end{items} +\end{slide} + +\end{document} diff --git a/macros/latex/contrib/aiaa/template_advanced.pdf b/macros/latex/contrib/aiaa/template_advanced.pdf Binary files differnew file mode 100644 index 0000000000..6f8e903369 --- /dev/null +++ b/macros/latex/contrib/aiaa/template_advanced.pdf diff --git a/macros/latex/contrib/aiaa/template_advanced.tex b/macros/latex/contrib/aiaa/template_advanced.tex new file mode 100644 index 0000000000..a8631d4c37 --- /dev/null +++ b/macros/latex/contrib/aiaa/template_advanced.tex @@ -0,0 +1,254 @@ +% +% `template_advanced.tex' - An advanced example of using the AIAA class. +% For a bare-bones usage, see `template_basic.tex'. +% +% Typical processing for PostScript (PS) output: +% +% latex template_advanced +% bibtex template_advanced (bibliography) +% makeindex -s nomencl.ist -o template_advanced.gls template_advanced.glo +% (nomenclature) +% latex template_advanced (repeat as needed to resolve references) +% +% xdvi template_advanced (onscreen draft display) +% dvips template_advanced (postscript) +% gv template_advanced.ps (onscreen display) +% lpr template_advanced.ps (hardcopy) +% +% With the above, only Encapsulated PostScript (EPS) images can be used. +% +% Typical processing for Portable Document Format (PDF) output: +% +% pdflatex template_advanced +% bibtex template_advanced (bibliography) +% makeindex -s nomencl.ist -o template_advanced.gls template_advanced.glo +% (nomenclature) +% pdflatex template_advanced (repeat as needed to resolve references) +% +% acroread template_advanced.pdf (onscreen display) +% +% If you have EPS figures, you will need to use the epstopdf script +% to convert them to PDF because PDF is a limmited subset of EPS. +% pdflatex accepts a variety of other image formats such as JPG, TIFF, +% PNG, and so forth -- check the documentation for your version. +% +% If you do *not* specify suffixes when using the graphicx package's +% \includegraphics command, latex and pdflatex will automatically select +% the appropriate figure format from those available. This allows you +% to produce PS and PDF output from the same LaTeX source file. +% +% To generate a large format (e.g., 11"x17") PostScript copy for editing +% purposes, use +% +% dvips -x 1467 -O -0.65in,0.85in -t tabloid template_advanced +% +% For further details and support, read the Users Manual, aiaa.pdf. +% +% This software is released under the terms of the LaTeX Project Public +% License. Copyright (C) 2004 by Bil Kleb, Bill Wood, and Erich Knausenberger. + + +\documentclass{aiaa-tc}% insert '[draft]' option to show overfull boxes + + \usepackage{varioref}% smart page, figure, table, and equation referencing + \usepackage{wrapfig}% wrap figures/tables in text (i.e., Di Vinci style) + \usepackage{threeparttable}% tables with footnotes + \usepackage{dcolumn}% decimal-aligned tabular math columns + \newcolumntype{d}{D{.}{.}{-1}} + \usepackage{nomencl}% nomenclature generation via makeindex + \makeglossary + \usepackage{subfigure}% subcaptions for subfigures + \usepackage{subfigmat}% matrices of similar subfigures, aka small mulitples + \usepackage{fancyvrb}% extended verbatim environments + \fvset{fontsize=\footnotesize,xleftmargin=2em} + \usepackage{lettrine}% dropped capital letter at beginning of paragraph + \usepackage[dvips]{dropping}% alternative dropped capital package + \usepackage[colorlinks]{hyperref}% hyperlinks [must be loaded after dropping] + + \title{Advanced AIAA Technical Conference Paper Template} + + \author{ + First A. Author\thanks{Job Title, Department, Address, and AIAA Member Grade.} + \ and Second B. Author\thanksibid{1}\\ + {\normalsize\itshape + Business or Academic Affiliation, City, Province, Zipcode, Country}\\ + \and + Third C. Author\thanks{Job Title, Department, Address, + and AIAA Member Grade.}\\ + {\normalsize\itshape + Business or Academic Affiliation, City, Province, Zipcode, Country} + } + + % Data used by 'handcarry' option + \AIAApapernumber{YEAR-NUMBER} + \AIAAconference{Conference Name, Date, and Location} + \AIAAcopyright{\AIAAcopyrightD{YEAR}} + + % Define commands to assure consistent treatment throughout document + \newcommand{\eqnref}[1]{(\ref{#1})} + \newcommand{\class}[1]{\texttt{#1}} + \newcommand{\package}[1]{\texttt{#1}} + \newcommand{\file}[1]{\texttt{#1}} + \newcommand{\BibTeX}{\textsc{Bib}\TeX} + +\begin{document} + +\maketitle + +\begin{abstract} +This is the advanced \LaTeX\ template of an AIAA technical conference paper. +It is intended to demonstrate advanced \LaTeX\ capabilities for +producing an AIAA technical conference paper. +Fundamental topics are covered in the bare-bones template. +For detailed AIAA layout and style guidelines, please refer to the AIAA +\LaTeX\ Package Users Manual, \file{aiaa.pdf}. +\end{abstract} + +\printglossary% creates nomenclature section produced by MakeIndex + +\section{Introduction} + +\lettrine[nindent=0pt]{T}{his} is an example of a dropped capital letter +at the beginning of a paragraph using the \package{lettrine} package. +This package is usually included with the more comprehensive \TeX\ +distributions, but those with more trim installations may need to +retrieve this package from the Comprehensive \TeX\ Archive Network +(CTAN), which is located at \href{http://www.ctan.org}{www.ctan.org}. +This package does not gracefully handle the AIAA class' \verb|submit| +option. + +\dropping{2}{A}{\textsc{nd}} this is an example of a dropped capital +letter at the beginning of a paragraph using the \package{dropping} +package. +This package is a bit less refined than the \package{lettrine} package, +but some authors may already have it around if they used the old +(unofficial) \LaTeX\ AIAA distribution. +This package accommodates the AIAA class' \verb|submit| option. + +\begin{wrapfigure}{R}{0.3\linewidth} + \includegraphics{figure_magnet} + \caption{Magnetization as a function of applied field.} + \label{f:magnetic_field} +\end{wrapfigure} + +In an effort to more tightly integrate text and image, the +\package{wrapfig} package is employed. +This package works by modifying paragraph shape to accommodate a figure +(or a table or other items). +Typically one inserts its \verb|wrapfigure| or \verb|wraptable| +environment just before the paragraph in which it is to be placed. +Also specified is the width of the item to be inserted and the +placement, for example, left or right side. +(This package does not provide for center placement.) +The rest of this paragraph is filler so that the \verb|wrapfigure| +example will be placed in this paragraph. +Documentation of the \package{wrapfigure} package is available at the +end of the style file itself (check the package loading lines shown +during \LaTeX\ processing to find its location). + +Code listings and other such artifacts can be typeset in a large variety +of styles by using the \package{fancyvrb} package. +\begin{Verbatim}[numbers=left] + def testCircularAdvection + position.each_index do |i| + @position = position[i] + assert_equal speed[i], waveSpeed + end + end +\end{Verbatim} + +Tables with footnotes, such as table~\vref{t:threepart}, +can be coded using the \package{threeparttable} package. +Note: This table was purposely placed on another page through the use of +the \verb|[p]| placement specifier to demonstrate the automated page +reference mechanism provided by the \package{varioref} package. +Of course, one would normally have the table integrated into the text +that describes it. +\begin{table}[p] + \begin{center} + \begin{threeparttable} + \caption{This is an example of a \package{threeparttable} which uses the + \package{dcolumn} package to allow for columns to be aligned on decimal + points.} + \label{t:threepart} + \begin{tabular}{lcdd} + First head\tnote{*} & + Second head & + \multicolumn{1}{c}{Third head} & + \multicolumn{1}{c}{$V_M(r)$} \\\hline + center & doctor & 0.2 & 10.55 \\ + tab & dentist & 0.15 & 33.12 \\ + worse & man\tnote{\ensuremath{\dagger}} & 10.58 & 45.10 \\ + better & home & 43.9 & 12.34 \\ + \end{tabular} + \begin{tablenotes} + \item[*] This is a table footnote, which to span multiple lines, has + been greatly extended in length contrary to reason. + \item[\ensuremath{\dagger}] A much shorter table footnote. + \end{tablenotes} + \end{threeparttable} + \end{center} +\end{table} + +Equation~\eqnref{e:displace} is serving as a demonstration of the +\package{nomenclature} package. +\begin{equation} + \label{e:displace} + \mathbf{J}_i\cdot\Delta\underline{x}_{i+1}=-\underline{f}_i +\end{equation}% +\nomenclature{$J$}{Jacobian Matrix}% +\nomenclature[b$i$]{$i$}{Variable number}% +\nomenclature[g$\Delta$]{$\Delta x$}{Variable displacement vector}% +\nomenclature{$f$}{Residual value vector}% +\nomenclature{$x$}{Variable value vector}% +The same can be said for Eq.~\eqnref{e:newton} that uses $\alpha$ to add +another Greek letter to the mix. +\begin{equation} + \label{e:newton} + F=m\alpha +\end{equation}% +\nomenclature{$F$}{Force, N}% +\nomenclature{$m$}{Mass, kg}% +\nomenclature[g$\alpha$]{$\alpha$}{Acceleration, m/s\textsuperscript{2}}% +The \package{nomencl} package is fed entries with the +\verb|\nomenclature| command. +These entries are then collected and sorted using \verb|makeindex|. +The optional sorting argument to the \verb|\nomenclature| command uses +a key of `b' for subscripts, `g' for Greek symbols, `c' for conventions, +and `t' for superscripts. + +When many figures share a similar style and beg to be compared to one +another, the \package{subfigmat} and \package{subfigure} packages can be +used to create a matrix of subfigures as shown by +figure~\vref{f:small_multiple}. +\begin{figure} + \begin{subfigmatrix}{4}% number of columns + \subfigure[2 AM.]{\includegraphics{figure_magnet}} + \subfigure[3 AM.]{\includegraphics{figure_magnet}} + \subfigure[4 AM.]{\includegraphics{figure_magnet}} + \subfigure[5 AM.]{\includegraphics{figure_magnet}} + \subfigure[6 AM.]{\includegraphics{figure_magnet}} + \subfigure[7 AM.]{\includegraphics{figure_magnet}} + \subfigure[8 AM.]{\includegraphics{figure_magnet}} + \subfigure[9 AM.]{\includegraphics{figure_magnet}} + \end{subfigmatrix} + \caption{A time series shown of magnetic field that does not change + because we are using the same figure each time.} + \label{f:small_multiple} +\end{figure} +These are called ``small multiples'' by Tufte.\cite{tufte:83bk} + +\section{Conclusion} + +This had been a brief example of some of the more advanced options +available for \LaTeX. +Please see the documentation for each package for extended discussion or +usage. + +% produces the bibliography section when processed by BibTeX +\bibliography{bibtex_database} +\bibliographystyle{aiaa} + +\end{document} + +% $Id: template_advanced.tex,v 1.6 2004/05/23 12:49:44 kleb Exp $ diff --git a/macros/latex/contrib/aiaa/template_basic.pdf b/macros/latex/contrib/aiaa/template_basic.pdf Binary files differnew file mode 100644 index 0000000000..3888ed660c --- /dev/null +++ b/macros/latex/contrib/aiaa/template_basic.pdf diff --git a/macros/latex/contrib/aiaa/template_basic.tex b/macros/latex/contrib/aiaa/template_basic.tex new file mode 100644 index 0000000000..2ec4f957f1 --- /dev/null +++ b/macros/latex/contrib/aiaa/template_basic.tex @@ -0,0 +1,197 @@ +% +% `template_basic.tex' - A bare-bones example of using the AIAA class. +% For a more advanced usage, see `template_advanced.tex'. +% +% Typical processing for PostScript (PS) output: +% +% latex template_basic +% latex template_basic (repeat as needed to resolve references) +% +% xdvi template_basic (onscreen draft display) +% dvips template_basic (postscript) +% gv template_basic.ps (onscreen display) +% lpr template_basic.ps (hardcopy) +% +% With the above, only Encapsulated PostScript (EPS) images can be used. +% +% Typical processing for Portable Document Format (PDF) output: +% +% pdflatex template_basic +% pdflatex template_basic (repeat as needed to resolve references) +% +% acroread template_basic.pdf (onscreen display) +% +% If you have EPS figures, you will need to use the epstopdf script +% to convert them to PDF because PDF is a limmited subset of EPS. +% pdflatex accepts a variety of other image formats such as JPG, TIF, +% PNG, and so forth -- check the documentation for your version. +% +% If you do *not* specify suffixes when using the graphicx package's +% \includegraphics command, latex and pdflatex will automatically select +% the appropriate figure format from those available. This allows you +% to produce PS and PDF output from the same LaTeX source file. +% +% To generate a large format (e.g., 11"x17") PostScript copy for editing +% purposes, use +% +% dvips -x 1467 -O -0.65in,0.85in -t tabloid template_basic +% +% For further details and support, read the Users Manual, aiaa.pdf. +% +% This software is released under the terms of the LaTeX Project Public +% License. Copyright (C) 2004 by Bil Kleb, Bill Wood, and Erich Knausenberger. + +\documentclass[]{aiaa-tc}% insert '[draft]' option to show overfull boxes + + \title{Bare-Bones \LaTeX\ Template for\\ + AIAA Technical Conference Papers} + + \author{ + First A. Author% + \thanks{Job Title, Department, Address, and AIAA Member Grade.} + \ and Second B. Author\thanksibid{1}\\ + {\normalsize\itshape + Business or Academic Affiliation, City, Province, Zipcode, Country}\\ + \and + Third C. Author% + \thanks{Job Title, Department, Address, and AIAA Member Grade.}\\ + {\normalsize\itshape + Business or Academic Affiliation, City, Province, Zipcode, Country} + } + + % Data used by 'handcarry' option if invoked + \AIAApapernumber{YEAR-NUMBER} + \AIAAconference{Conference Name, Date, and Location} + \AIAAcopyright{\AIAAcopyrightD{YEAR}} + + % Define commands to assure consistent treatment throughout document + \newcommand{\eqnref}[1]{(\ref{#1})} + \newcommand{\class}[1]{\texttt{#1}} + \newcommand{\package}[1]{\texttt{#1}} + \newcommand{\file}[1]{\texttt{#1}} + \newcommand{\BibTeX}{\textsc{Bib}\TeX} + +\begin{document} + +\maketitle + +\begin{abstract} +This is a bare-bones \LaTeX\ template of an AIAA technical conference paper. +It is intended to demonstrate the bare minimum set of \LaTeX\ commands +to produce an AIAA technical conference paper. +To explore more \LaTeX\ capabilities, see the advanced template. +For detailed AIAA layout and style guidelines, please refer to the AIAA +author guide for paper submission, format, and other procedures. +\end{abstract} + +\section*{Nomenclature} + +\begin{tabbing} + XXX \= \kill% this line sets tab stop + $J$ \> Jacobian Matrix \\ + $f$ \> Residual value vector \\ + $x$ \> Variable value vector \\ + $F$ \> Force, N \\ + $m$ \> Mass, kg \\ + $\Delta x$ \> Variable displacement vector \\ + $\alpha$ \> Acceleration, m/s\textsuperscript{2} \\[5pt] + \textit{Subscript}\\ + $i$ \> Variable number \\ + \end{tabbing} + +\section{Introduction} + +This would be a good place to insert some text that make sense relative +to the paper being written. +Of course, for example purposes, the text is quite meaningless. + +\subsection{Background} + +This background section is here only to demonstrate \verb|\subsection| +usage. +And following this, the next section level will need to be demonstrated. + +\subsubsection{Detail} + +Here is a \verb|\subsubsection| that would normally come in pairs of two +according to the requirements of an outline, but for the sake of +demonstration, we are only showing a single \verb|\subsubsection|. + +\section{Model} + +We should probably include some math. +Here we begin with Eq.~(\ref{e:function}) that demonstrates some math +typesetting. +\begin{equation} + \label{e:function} + \int_{0}^{r_{2}} F(r,\varphi) \, dr \, d\varphi = + \left[ \sigma r_{2}/(2\mu_{0}) \right] \cdot + \int_{0}^{\infty} \exp(-\rho|z_{j}-z_{i}|) \, \lambda^{-1} +\end{equation} +Eq.~(\ref{e:function}) is grand. +Some say it is due to Rebek.\cite{rebek:82bk} + +\section{Results} + +In this section we will introduce some figures and tables. +It can be seen in figure~\ref{f:magnetic_field} that magnetization is a +function of applied field. +\begin{figure}[htb]% order of placement preference: here, top, bottom + \includegraphics{figure_magnet} + \caption{Magnetization as a function of applied field, which has + borders so thick that they overwhelm the data and for some reason the + ordinate label is rotated 90 degrees to make it difficult to + read. This figure also demonstrates the dangers of using a bitmap + as opposed to a vector image.} + \label{f:magnetic_field} +\end{figure} +Sometimes writing meaningless text can be quiet easy, but other times +one is hard pressed to keep the words flowing.\footnote{And sometimes +things get carried away in endless detail.} +Meanwhile back in the other world, table~\ref{t:scheme_comparison} shows +a nifty comparison. +\begin{table}% no placement specified: defaults to here, top, bottom, page + \begin{center} + \caption{Variable and Fixed Coefficient Runge-Kutta Schemes as a + Function of Reynolds Number} + \label{t:scheme_comparison} + \begin{tabular}{rrr} + Re & Vary & Fixed \\\hline + 1 & 868 & 4,271 \\ + 10 & 422 & 2,736 \\ + 25 & 252 & 1,374 \\ + 50 & 151 & 736 \\ + 100 & 110 & 387 \\ + 500 & 85 & 136 \\ + 1,000 & 77 & 117 \\ + 5,000 & 81 & 98 \\ + 10,000 & 82 & 99 + \end{tabular} + \end{center} +\end{table} + +\section{Conclusion} + +After much typing, the paper can now conclude. +Four rocks were next to the channel. +This caused a few standing waves during the rip that one could ride on +the way in or jump on the way out. + +\section*{Appendix} + +An appendix, if needed, should appear before the acknowledgments. +Use the 'starred' version of the \verb|\section| commands to avoid +section numbering. + +\section*{Acknowledgments} + +A place to recognize others. + +\begin{thebibliography}{9}% maximum number of references (for label width) + \bibitem{rebek:82bk} + Rebek, A., {\it Fickle Rocks}, Fink Publishing, Chesapeake, 1982. +\end{thebibliography} + +\end{document} + +% $Id: template_basic.tex,v 1.5 2004/05/23 12:49:44 kleb Exp $ |