summaryrefslogtreecommitdiff
path: root/Build/source/texk/dvipng
diff options
context:
space:
mode:
Diffstat (limited to 'Build/source/texk/dvipng')
-rw-r--r--Build/source/texk/dvipng/ChangeLog325
-rw-r--r--Build/source/texk/dvipng/Makefile.am106
-rw-r--r--Build/source/texk/dvipng/Makefile.in1619
-rw-r--r--Build/source/texk/dvipng/TLpatches/ChangeLog142
-rw-r--r--Build/source/texk/dvipng/TLpatches/TL-Changes18
-rw-r--r--Build/source/texk/dvipng/TLpatches/patch-08-win3228
-rw-r--r--Build/source/texk/dvipng/ac/dvipng.ac18
-rw-r--r--Build/source/texk/dvipng/ac/withenable.ac8
-rw-r--r--Build/source/texk/dvipng/aclocal.m41220
-rw-r--r--Build/source/texk/dvipng/config.h.in287
-rwxr-xr-xBuild/source/texk/dvipng/configure19151
-rw-r--r--Build/source/texk/dvipng/configure.ac188
-rw-r--r--Build/source/texk/dvipng/doc/Makefile.am53
-rw-r--r--Build/source/texk/dvipng/doc/Makefile.in909
-rw-r--r--Build/source/texk/dvipng/doc/dvipng.1506
-rw-r--r--Build/source/texk/dvipng/doc/dvipng.help43
-rw-r--r--Build/source/texk/dvipng/doc/dvipng.info1101
-rw-r--r--Build/source/texk/dvipng/doc/dvipng.texi984
-rw-r--r--Build/source/texk/dvipng/doc/install.texi194
-rw-r--r--Build/source/texk/dvipng/doc/macros.texi61
-rw-r--r--Build/source/texk/dvipng/doc/readme.texi158
-rwxr-xr-xBuild/source/texk/dvipng/doc/texi2pod.pl444
-rw-r--r--Build/source/texk/dvipng/dvipng-src/COPYING674
-rw-r--r--Build/source/texk/dvipng/dvipng-src/COPYING.LESSER165
-rw-r--r--Build/source/texk/dvipng/dvipng-src/COPYING.gd54
-rw-r--r--Build/source/texk/dvipng/dvipng-src/ChangeLog1332
-rw-r--r--Build/source/texk/dvipng/dvipng-src/ChangeLog.0903
-rw-r--r--Build/source/texk/dvipng/dvipng-src/INSTALL157
-rw-r--r--Build/source/texk/dvipng/dvipng-src/Makefile.in170
-rw-r--r--Build/source/texk/dvipng/dvipng-src/README126
-rw-r--r--Build/source/texk/dvipng/dvipng-src/RELEASE10
-rw-r--r--Build/source/texk/dvipng/dvipng-src/acinclude.m4104
-rw-r--r--Build/source/texk/dvipng/dvipng-src/aclocal.m4291
-rw-r--r--Build/source/texk/dvipng/dvipng-src/color.c440
-rw-r--r--Build/source/texk/dvipng/dvipng-src/commands.h196
-rw-r--r--Build/source/texk/dvipng/dvipng-src/config.h.in223
-rw-r--r--Build/source/texk/dvipng/dvipng-src/configure.ac223
-rw-r--r--Build/source/texk/dvipng/dvipng-src/draw.c393
-rw-r--r--Build/source/texk/dvipng/dvipng-src/dvi.c487
-rw-r--r--Build/source/texk/dvipng/dvipng-src/dvipng.1506
-rw-r--r--Build/source/texk/dvipng/dvipng-src/dvipng.c156
-rw-r--r--Build/source/texk/dvipng/dvipng-src/dvipng.h526
-rw-r--r--Build/source/texk/dvipng/dvipng-src/dvipng.texi984
-rw-r--r--Build/source/texk/dvipng/dvipng-src/enc.c129
-rw-r--r--Build/source/texk/dvipng/dvipng-src/font.c335
-rw-r--r--Build/source/texk/dvipng/dvipng-src/fontmap.c327
-rw-r--r--Build/source/texk/dvipng/dvipng-src/ft.c179
-rw-r--r--Build/source/texk/dvipng/dvipng-src/install.texi194
-rw-r--r--Build/source/texk/dvipng/dvipng-src/macros.texi61
-rw-r--r--Build/source/texk/dvipng/dvipng-src/miktex.h266
-rw-r--r--Build/source/texk/dvipng/dvipng-src/miktex.mak196
-rw-r--r--Build/source/texk/dvipng/dvipng-src/misc.c848
-rw-r--r--Build/source/texk/dvipng/dvipng-src/papersiz.c74
-rw-r--r--Build/source/texk/dvipng/dvipng-src/pk.c410
-rw-r--r--Build/source/texk/dvipng/dvipng-src/ppagelist.c189
-rw-r--r--Build/source/texk/dvipng/dvipng-src/readme.texi158
-rw-r--r--Build/source/texk/dvipng/dvipng-src/set.c292
-rw-r--r--Build/source/texk/dvipng/dvipng-src/sfd.c180
-rw-r--r--Build/source/texk/dvipng/dvipng-src/special.c895
-rw-r--r--Build/source/texk/dvipng/dvipng-src/test_dvipng.tex48
-rw-r--r--Build/source/texk/dvipng/dvipng-src/tfm.c86
-rw-r--r--Build/source/texk/dvipng/dvipng-src/vf.c144
-rw-r--r--Build/source/texk/dvipng/dvipng-test.dvibin0 -> 2564 bytes
-rwxr-xr-xBuild/source/texk/dvipng/dvipng.test31
-rw-r--r--Build/source/texk/dvipng/help/Makefile.am30
-rw-r--r--Build/source/texk/dvipng/help/Makefile.in497
-rw-r--r--Build/source/texk/dvipng/m4/gs-device.m441
-rw-r--r--Build/source/texk/dvipng/m4/makeinfo.m441
-rw-r--r--Build/source/texk/dvipng/version.ac12
69 files changed, 41346 insertions, 0 deletions
diff --git a/Build/source/texk/dvipng/ChangeLog b/Build/source/texk/dvipng/ChangeLog
new file mode 100644
index 00000000000..2608b80abee
--- /dev/null
+++ b/Build/source/texk/dvipng/ChangeLog
@@ -0,0 +1,325 @@
+2020-01-06 Akira Kakuto <kakuto@w32tex.org>
+
+ * version.ac (dvipng_version): 1.17.
+ * Import dvipng 1.17.
+
+2019-04-07 Karl Berry <karl@freefriends.org>
+
+ * version.ac (dvipng_version): 1.16.
+ * Import release 1.16 from Savannah, including these
+ among other changes:
+
+2019-04-06 Jan-Åke Larsson <jan-ake.larsson@liu.se>
+
+ * pk.c (InitPK): check for packet_length reading outside file bounds.
+ Report from Andy Nguyen of ETH Zurich.
+
+ * tfm.c (ReadTFM): check for reading outside file bounds.
+ Report from Andy Nguyen of ETH Zurich.
+
+ * dvi.c (DVIGetCommand): check for (unsigned value) overflow
+ so we don't fail to realloc buffer if needed.
+ Report from Andy Nguyen of ETH Zurich, found using afl-fuzz.
+
+2016-02-23 Akira Kakuto <kakuto@fuk.kindai.ac.jp>
+
+ * Makefile.am, configure.ac: New convention.
+
+2015-07-07 Peter Breitenlohner <peb@mppmu.mpg.de>
+
+ * Makefile.am: Better dependencies for 'make check'.
+
+2015-03-10 Peter Breitenlohner <peb@mppmu.mpg.de>
+
+ * configure.ac: Drop checks for strstr and strtol.
+
+2015-03-07 Peter Breitenlohner <peb@mppmu.mpg.de>
+
+ * configure.ac: Check for texlive_gs_init(), if Windows.
+ * Makefile.am: Add '-DTEXLIVE' to AM_CPPFLAGS.
+ Drop unused DVIPS and TEXI2HTML.
+
+2015-03-03 Peter Breitenlohner <peb@mppmu.mpg.de>
+
+ * Imported release 1.15 from savannah.nongnu.org.
+ * doc/Makefile.am, version.ac: Adapted.
+
+2015-02-16 Peter Breitenlohner <peb@mppmu.mpg.de>
+
+ * Makefile.am: Use the fragment ../../am/dist_hook.am.
+
+2014-08-22 Peter Breitenlohner <peb@mppmu.mpg.de>
+
+ * Makefile.am: Add explicit dependency on freetype2 and libpng.
+
+2014-02-26 Peter Breitenlohner <peb@mppmu.mpg.de>
+
+ * configure.ac: Drop AC_FUNC_{ALLOCA,FORK} (results not used).
+
+2013-09-03 Peter Breitenlohner <peb@mppmu.mpg.de>
+
+ * gs-device.m4, makeinfo.m4: Slightly rewrite, update Copyright.
+
+2013-09-02 Peter Breitenlohner <peb@mppmu.mpg.de>
+
+ * Makefile.am: Drop ACLOCAL_AMFLAGS.
+ * configure.ac: Use AC_CONFIG_MACRO_DIRS.
+
+2013-07-05 Peter Breitenlohner <peb@mppmu.mpg.de>
+
+ * Makefile.am, doc/Makefile.am:
+ Moved Makefile fragments to ../../am/.
+
+2013-07-05 Peter Breitenlohner <peb@mppmu.mpg.de>
+
+ * dvipng.test: ALso run 'dvipng --gif'.
+ * Makefile.am (CLEANFILES): Adapted.
+
+2013-05-19 Peter Breitenlohner <peb@mppmu.mpg.de>
+
+ * version.ac (new): Define dvipng version.
+ * configure.ac: Use version.ac. Do not use AC_FUNC_MALLOC
+ because this might redefine malloc() as rpl_malloc().
+
+2013-05-18 Peter Breitenlohner <peb@mppmu.mpg.de>
+
+ * ac/withenable.ac, Makefile.am, configure.ac: Drop t1lib.
+
+2013-01-30 Peter Breitenlohner <peb@mppmu.mpg.de>
+
+ * Makefile.am, configure.ac: Allow subdir-objects.
+
+2012-11-22 Peter Breitenlohner <peb@mppmu.mpg.de>
+
+ * Makefile.am (dvipng_dependencies): Drop indirect dependencies.
+
+2012-07-25 Peter Breitenlohner <peb@mppmu.mpg.de>
+
+ * configure.ac: Drop check for 64-bit integer types, already
+ done via KPSE_COMMON.
+
+2012-05-22 Peter Breitenlohner <peb@mppmu.mpg.de>
+
+ * dvipng.test: Cope with spaces in paths returned by kpsewhich.
+
+2011-10-04 Peter Breitenlohner <peb@mppmu.mpg.de>
+
+ * Makefile.am (CLEANFILES): Adapt to 'new' test script.
+
+2011-05-30 Peter Breitenlohner <peb@mppmu.mpg.de>
+
+ * Makefile.am: Use ../am/bin_links.am for $(bindir) links.
+
+2011-02-15 Peter Breitenlohner <peb@mppmu.mpg.de>
+
+ * Makefile.am, configure.ac [WIN32]: Add dvigif.exe wrapper.
+
+2011-02-08 Peter Breitenlohner <peb@mppmu.mpg.de>
+
+ * doc/Makefile.am: Use ../am/man1_links.am for manpage links.
+
+2010-12-16 Peter Breitenlohner <peb@mppmu.mpg.de>
+
+ * doc/Makefile.am: Check that the doc/*.texi files are copies
+ of those in the distributed tree (maintainer mode only).
+
+2010-12-15 Peter Breitenlohner <peb@mppmu.mpg.de>
+
+ * Imported release 1.14 from savannah.nongnu.org.
+ * configure.ac: Adapted.
+
+2010-05-30 Vladimir Volovich <vvv@vsu.ru>
+
+ * dvipng.test: use `...` not $(...).
+
+2010-05-01 Karl Berry <karl@tug.org>
+
+ * dvipng.texi: include full gd copyright notice; seems the
+ safe thing to do.
+
+2010-04-20 Peter Breitenlohner <peb@mppmu.mpg.de>
+
+ * dvipng.test: Check results from running kpsewhich.
+ * Makefile.am: Reactivate the test.
+
+2010-04-19 Karl Berry <karl@tug.org>
+
+ * Makefile.am: forget the tests.
+
+2010-04-19 Peter Breitenlohner <peb@mppmu.mpg.de>
+
+ * Makefile.am: Add dvipng-test.dvi.
+
+2010-04-18 Karl Berry <karl@tug.org>
+
+ * dvipng.test: do not run latex.
+ * dvipng-test.dvi: new file.
+
+2010-03-29 Peter Breitenlohner <peb@mppmu.mpg.de>
+
+ * configure.ac: Remove AC_TYPE_SIZE_T, now part of KPSE_COMMON.
+
+2010-03-18 Peter Breitenlohner <peb@mppmu.mpg.de>
+
+ * Imported release 1.13 from savannah.nongnu.org.
+ * configure.ac: Adapted.
+
+2010-03-09 Peter Breitenlohner <peb@mppmu.mpg.de>
+
+ * configure.ac: Check for kpse_set_program_name() as used in
+ dvipng.c instead of kpse_set_progname().
+
+2010-02-24 Peter Breitenlohner <peb@mppmu.mpg.de>
+
+ * configure.ac, help/Makefile.am: Do not even try to rebuild
+ doc/dvipng.help when cross compiling.
+
+2010-02-02 Peter Breitenlohner <peb@mppmu.mpg.de>
+
+ * configure.ac: Fix 'on demand' build.
+
+2010-01-19 Peter Breitenlohner <peb@mppmu.mpg.de>
+
+ * Makefile.am, configure.ac: Rearrange for 'on demand' build.
+
+2009-11-03 Peter Breitenlohner <peb@mppmu.mpg.de>
+
+ * Makefile.am, configure.ac: Proxy build system for TeX Live,
+ using the dvipng-1.12 distribution tree.
+ * dvipng-1.12-PATCHES: New directory with patches applied to
+ the dvipng-1.12 distribution.
+ * dvipng.test: Adapted.
+
+2009-06-12 Peter Breitenlohner <peb@mppmu.mpg.de>
+
+ Avoid compiler warnings.
+ * color.c, dvi.c, dvipng.h, fontmap.c, misc.c, papersiz.c,
+ ppagelist.c, special.c: ANSI C function definitions. Declare
+ various param strings as const.
+ * special.c (SetSpecial): Avoid assigning a literal string to
+ the non-const string variable 'special' (somewhat clumsy).
+
+2009-06-12 Peter Breitenlohner <peb@mppmu.mpg.de>
+
+ * help/Makefile.am: do not even try to rebuild doc/dvipng.help
+ unless dvipng$(EXEEXT) has been rebuilt.
+
+2009-06-09 Peter Breitenlohner <peb@mppmu.mpg.de>
+
+ Avoid warnings when compiling with 'gcc --Wmissing-prototypes'.
+ * color.c (NewColor, LoadColornameFile, ClearXColorPrologue,
+ LoadXColorPrologue): declare as static.
+ * draw.c (DrawPage): declare as static.
+ * dvi.c (DVIInit, SkipPage, InitPage, DelPageList): declare as
+ static.
+ * enc.c (InitEncoding): declare as static.
+ * font.c (ActualFactor, kpse_find_t1_or_tt, FontFind, DoneFont):
+ declare as static.
+ * fontmap.c (newword, find_format, SearchPSFontMap,
+ ReadPSFontMap): declare as static.
+ * ft.c (UnLoadFT): declare as static.
+ * papersiz.c (myatodim): declare as static.
+ * pk.c (getnyb, pk_packed_num, skip_specials, UnLoadPK): declare
+ as static.
+ * ppagelist.c (ListPage): declare as static.
+ * set.c (ChangeColor): declare as static.
+ * sfd.c (ReadSubfont): declare as static.
+ * special.c (PSCodeInit, writepscode, ps2png, rescale,
+ newpsheader): declare as static.
+ * t1.c (UnLoadT1): declare as static.
+
+2009-03-25 Peter Breitenlohner <peb@mppmu.mpg.de>
+
+ * dvipng-1.12-patches (new): patches applied to dvipng-1.12.
+
+2009-03-25 Peter Breitenlohner <peb@mppmu.mpg.de>
+
+ * color.c, dvipng.h, fontmap.c, ft.c, misc.c, pk.c, set.c,
+ t1.c, tfm.c: "#if HAVE_ALLOCA_H" => "#ifdef HAVE_ALLOCA_H"
+ and similar, to avoid preprocessor warnings.
+
+2009-03-24 Peter Breitenlohner <peb@mppmu.mpg.de>
+
+ * Imported release 1.12 from savannah.nongnu.org.
+ * *-1.11 (removed), *-1.12 (new): Original files.
+
+ * Makefile.am, configure.ac: New TeX Live build system.
+
+ From Vladimir Volovich <vvv@vsu.ru>
+ * special.c: portability fix - put variable declarations
+ at the beginning of the block.
+
+2008-05-15 Peter Breitenlohner <peb@mppmu.mpg.de>
+
+ * Imported release 1.11 from savannah.nongnu.org.
+ * *-1.10 (removed), *-1.11 (new): Original files.
+ * configure.ac: Updated for release 1.11.
+
+ From Vladimir Volovich <vvv@vsu.ru>
+ * misc.c: fix the field name: mmap => data (oversight from
+ old code?)
+ * special.c: portability fix - put variable declarations
+ at the beginning of the block.
+
+2008-05-14 Peter Breitenlohner <peb@mppmu.mpg.de>
+
+ * Imported release 1.10 from savannah.nongnu.org.
+
+ * Makefile.in-1.10, aclocal.m4-1.10, config.h.in-1.10,
+ configure.ac-1.10, configure-1.10 (all new): Original files
+ from release 1.10.
+
+ * acinclude.m4 (new): M4 macros extracted from aclocal.m4-1.10.
+
+ * Makefile.in, configure.ac: Adapted for TeX Live.
+
+ * aclocal.m4, config.h.in, configure: Regenerated.
+
+ * dvipng.{dvi,help,info}: Updated generated files.
+
+2008-05-01 Vladimir Volovich <vvv@vsu.ru>
+
+ * misc.c: #include dvipng.h again at the top, since the mmap
+ clash is resolved.
+
+2008-04-29 Vladimir Volovich <vvv@vsu.ru>
+
+ * misc.c: #include dvipng.h after sys/mman.h, for AIX.
+
+2008-04-06 Peter Breitenlohner <peb@mppmu.mpg.de>
+
+ * configure.ac: respect library dependencies.
+
+2008-04-02 Peter Breitenlohner <peb@mppmu.mpg.de>
+
+ * configure.ac: fix (system and included) library dependencies.
+
+2008-03-31 Peter Breitenlohner <peb@mppmu.mpg.de>
+
+ * special.c: allow for libgd without jpeg support.
+ * configure.ac, config.h.in, configure: adapt.
+
+2008-02-20 Peter Breitenlohner <peb@mppmu.mpg.de>
+
+ * configure.ac: Use AC_SEARCH_LIBS such that -lm and -lgen are
+ automatically appended to LIBS if needed.
+ Quote first arg of of AC_DEFUN.
+
+2006-12-24 Karl Berry <karl@tug.org>
+
+ * dvipng.h: don't try stdbool if we have kpathsea, Staszek's old
+ machine doesn't define false.
+
+2006-12-11 Karl Berry <karl@tug.org>
+
+ * Makefile.in (MKINSTALLDIRS): is in $(srcdir).
+
+2006-12-09 Karl Berry <karl@tug.org>
+
+ * dvipng.h (alloca) [_AIX]: #define as _alloca, per the autoconf
+ manual.
+
+2006-12-05 Karl Berry <karl@tug.org>
+
+ * Imported release 1.9.
+
diff --git a/Build/source/texk/dvipng/Makefile.am b/Build/source/texk/dvipng/Makefile.am
new file mode 100644
index 00000000000..a201f29f4a4
--- /dev/null
+++ b/Build/source/texk/dvipng/Makefile.am
@@ -0,0 +1,106 @@
+## $Id$
+## Makefile.am for the TeX Live subdirectory texk/dvipng/
+##
+## Copyright 2017 Karl Berry <tex-live@tug.org>
+## Copyright 2009-2015 Peter Breitenlohner <tex-live@tug.org>
+## You may freely use, modify and/or distribute this file.
+##
+# Adapted for TeX Live from dvipng-src/Makefile.in
+# Copyright (C) 2002-2008 Jan-Åke Larsson
+#
+## We want to re-distribute the whole original dvipng source tree.
+##
+## With current automake (1.10.2) 'make distcheck' fails when
+## DISTFILES contains a directory and files in that directory.
+## Thus nodist_* for all files in $(DVIPNG_TREE).
+EXTRA_DIST = $(DVIPNG_TREE)
+
+## Patches applied to the original source tree
+EXTRA_DIST += TLpatches
+
+# Files not to be distributed
+include $(srcdir)/../../am/dist_hook.am
+NEVER_NAMES += $(NEVER_NAMES_SUB)
+
+AM_CPPFLAGS = -DTEXLIVE -I$(top_srcdir)/$(DVIPNG_TREE)
+AM_CPPFLAGS += $(KPATHSEA_INCLUDES) $(FREETYPE2_INCLUDES) $(GD_INCLUDES)
+AM_CPPFLAGS += $(LIBPNG_INCLUDES) $(ZLIB_INCLUDES)
+AM_CFLAGS = $(WARNING_CFLAGS)
+
+# In order that `make distcheck' succeeds, we must not attempt to rebuild
+# dvipng.info if dvipng.help has not changed, Thus we delegate rebuilding
+# dvipng.help and dvipng.info, if necessary, to subdirectories.
+SUBDIRS = . help doc
+
+bin_PROGRAMS = dvipng
+
+nodist_dvipng_SOURCES = \
+ @DVIPNG_TREE@/color.c \
+ @DVIPNG_TREE@/draw.c \
+ @DVIPNG_TREE@/dvi.c \
+ @DVIPNG_TREE@/dvipng.c \
+ @DVIPNG_TREE@/font.c \
+ @DVIPNG_TREE@/misc.c \
+ @DVIPNG_TREE@/papersiz.c \
+ @DVIPNG_TREE@/pk.c \
+ @DVIPNG_TREE@/ppagelist.c \
+ @DVIPNG_TREE@/set.c \
+ @DVIPNG_TREE@/special.c \
+ @DVIPNG_TREE@/vf.c
+
+if have_ft2
+nodist_dvipng_SOURCES += \
+ @DVIPNG_TREE@/enc.c \
+ @DVIPNG_TREE@/fontmap.c \
+ @DVIPNG_TREE@/ft.c \
+ @DVIPNG_TREE@/sfd.c \
+ @DVIPNG_TREE@/tfm.c
+endif have_ft2
+
+dvipng_dependencies = $(KPATHSEA_DEPEND) $(GD_DEPEND) $(FREETYPE2_DEPEND) $(LIBPNG_DEPEND)
+
+$(dvipng_OBJECTS): config.force
+
+config.force: $(dvipng_dependencies)
+ echo timestamp >config.force
+ $(SHELL) ./config.status --recheck
+ $(SHELL) ./config.status Makefile config.h
+
+DISTCLEANFILES = config.force
+
+LDADD = $(KPATHSEA_LIBS) $(GD_LIBS) $(FREETYPE2_LIBS)
+LDADD += $(LIBPNG_LIBS) $(ZLIB_LIBS)
+
+dvigif_CPPFLAGS = -DEXEPROG=\"dvipng.exe\"
+nodist_dvigif_SOURCES = callexe.c
+dvigif_LDADD =
+
+## Rebuild libkpathsea
+@KPATHSEA_RULE@
+## Rebuild gd
+@GD_RULE@
+## Rebuild freetype2
+@FREETYPE2_RULE@
+## Rebuild libpng
+@LIBPNG_RULE@
+
+include $(srcdir)/../../am/bin_links.am
+
+bin_links = dvipng$(EXEEXT):dvigif
+
+if have_gif
+if WIN32
+bin_PROGRAMS += dvigif
+else !WIN32
+install-exec-hook: install-bin-links
+uninstall-hook: uninstall-bin-links
+endif !WIN32
+endif have_gif
+
+TESTS = dvipng.test
+dvipng.log: dvipng$(EXEEXT)
+
+EXTRA_DIST += dvipng.test dvipng-test.dvi
+
+CLEANFILES = dvipng-test*.gif dvipng-test*.png
+
diff --git a/Build/source/texk/dvipng/Makefile.in b/Build/source/texk/dvipng/Makefile.in
new file mode 100644
index 00000000000..9db2a30aec1
--- /dev/null
+++ b/Build/source/texk/dvipng/Makefile.in
@@ -0,0 +1,1619 @@
+# Makefile.in generated by automake 1.16.3 from Makefile.am.
+# @configure_input@
+
+# Copyright (C) 1994-2020 Free Software Foundation, Inc.
+
+# This Makefile.in is free software; the Free Software Foundation
+# gives unlimited permission to copy and/or distribute it,
+# with or without modifications, as long as this notice is preserved.
+
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY, to the extent permitted by law; without
+# even the implied warranty of MERCHANTABILITY or FITNESS FOR A
+# PARTICULAR PURPOSE.
+
+@SET_MAKE@
+
+# am/bin_links.am: Makefile fragment for bindir links.
+#
+# Copyright 2017-2020 Karl Berry <tex-live@tug.org>
+# Copyright 2011-2013 Peter Breitenlohner <tex-live@tug.org>
+# You may freely use, modify and/or distribute this file.
+#
+# requires conditional WIN32
+# requires $(bin_links)
+# Symlinks within $(bindir): FILE:LINK indicates LINK->FILE
+# for binaries and scripts use, e.g.,
+# binprog$(EXEEXT):foo
+# script:bar
+# respectively, such that the links created on cygwin are
+# 'foo->binprog.exe' and 'bar->script'.
+
+VPATH = @srcdir@
+am__is_gnu_make = { \
+ if test -z '$(MAKELEVEL)'; then \
+ false; \
+ elif test -n '$(MAKE_HOST)'; then \
+ true; \
+ elif test -n '$(MAKE_VERSION)' && test -n '$(CURDIR)'; then \
+ true; \
+ else \
+ false; \
+ fi; \
+}
+am__make_running_with_option = \
+ case $${target_option-} in \
+ ?) ;; \
+ *) echo "am__make_running_with_option: internal error: invalid" \
+ "target option '$${target_option-}' specified" >&2; \
+ exit 1;; \
+ esac; \
+ has_opt=no; \
+ sane_makeflags=$$MAKEFLAGS; \
+ if $(am__is_gnu_make); then \
+ sane_makeflags=$$MFLAGS; \
+ else \
+ case $$MAKEFLAGS in \
+ *\\[\ \ ]*) \
+ bs=\\; \
+ sane_makeflags=`printf '%s\n' "$$MAKEFLAGS" \
+ | sed "s/$$bs$$bs[$$bs $$bs ]*//g"`;; \
+ esac; \
+ fi; \
+ skip_next=no; \
+ strip_trailopt () \
+ { \
+ flg=`printf '%s\n' "$$flg" | sed "s/$$1.*$$//"`; \
+ }; \
+ for flg in $$sane_makeflags; do \
+ test $$skip_next = yes && { skip_next=no; continue; }; \
+ case $$flg in \
+ *=*|--*) continue;; \
+ -*I) strip_trailopt 'I'; skip_next=yes;; \
+ -*I?*) strip_trailopt 'I';; \
+ -*O) strip_trailopt 'O'; skip_next=yes;; \
+ -*O?*) strip_trailopt 'O';; \
+ -*l) strip_trailopt 'l'; skip_next=yes;; \
+ -*l?*) strip_trailopt 'l';; \
+ -[dEDm]) skip_next=yes;; \
+ -[JT]) skip_next=yes;; \
+ esac; \
+ case $$flg in \
+ *$$target_option*) has_opt=yes; break;; \
+ esac; \
+ done; \
+ test $$has_opt = yes
+am__make_dryrun = (target_option=n; $(am__make_running_with_option))
+am__make_keepgoing = (target_option=k; $(am__make_running_with_option))
+pkgdatadir = $(datadir)/@PACKAGE@
+pkgincludedir = $(includedir)/@PACKAGE@
+pkglibdir = $(libdir)/@PACKAGE@
+pkglibexecdir = $(libexecdir)/@PACKAGE@
+am__cd = CDPATH="$${ZSH_VERSION+.}$(PATH_SEPARATOR)" && cd
+install_sh_DATA = $(install_sh) -c -m 644
+install_sh_PROGRAM = $(install_sh) -c
+install_sh_SCRIPT = $(install_sh) -c
+INSTALL_HEADER = $(INSTALL_DATA)
+transform = $(program_transform_name)
+NORMAL_INSTALL = :
+PRE_INSTALL = :
+POST_INSTALL = :
+NORMAL_UNINSTALL = :
+PRE_UNINSTALL = :
+POST_UNINSTALL = :
+build_triplet = @build@
+host_triplet = @host@
+bin_PROGRAMS = dvipng$(EXEEXT) $(am__EXEEXT_1)
+@have_ft2_TRUE@am__append_1 = \
+@have_ft2_TRUE@ @DVIPNG_TREE@/enc.c \
+@have_ft2_TRUE@ @DVIPNG_TREE@/fontmap.c \
+@have_ft2_TRUE@ @DVIPNG_TREE@/ft.c \
+@have_ft2_TRUE@ @DVIPNG_TREE@/sfd.c \
+@have_ft2_TRUE@ @DVIPNG_TREE@/tfm.c
+
+@WIN32_TRUE@@have_gif_TRUE@am__append_2 = dvigif
+subdir = .
+ACLOCAL_M4 = $(top_srcdir)/aclocal.m4
+am__aclocal_m4_deps = $(top_srcdir)/m4/gs-device.m4 \
+ $(top_srcdir)/m4/makeinfo.m4 \
+ $(top_srcdir)/../../m4/kpse-common.m4 \
+ $(top_srcdir)/../../m4/kpse-freetype2-flags.m4 \
+ $(top_srcdir)/../../m4/kpse-gd-flags.m4 \
+ $(top_srcdir)/../../m4/kpse-kpathsea-flags.m4 \
+ $(top_srcdir)/../../m4/kpse-libpng-flags.m4 \
+ $(top_srcdir)/../../m4/kpse-warnings.m4 \
+ $(top_srcdir)/../../m4/kpse-win32.m4 \
+ $(top_srcdir)/../../m4/kpse-zlib-flags.m4 \
+ $(top_srcdir)/../../m4/libtool.m4 \
+ $(top_srcdir)/../../m4/ltoptions.m4 \
+ $(top_srcdir)/../../m4/ltsugar.m4 \
+ $(top_srcdir)/../../m4/ltversion.m4 \
+ $(top_srcdir)/../../m4/lt~obsolete.m4 $(top_srcdir)/version.ac \
+ $(top_srcdir)/ac/dvipng.ac $(top_srcdir)/configure.ac
+am__configure_deps = $(am__aclocal_m4_deps) $(CONFIGURE_DEPENDENCIES) \
+ $(ACLOCAL_M4)
+DIST_COMMON = $(srcdir)/Makefile.am $(top_srcdir)/configure \
+ $(am__configure_deps) $(am__DIST_COMMON)
+am__CONFIG_DISTCLEAN_FILES = config.status config.cache config.log \
+ configure.lineno config.status.lineno
+mkinstalldirs = $(install_sh) -d
+CONFIG_HEADER = config.h
+CONFIG_CLEAN_FILES = callexe.c
+CONFIG_CLEAN_VPATH_FILES =
+@WIN32_TRUE@@have_gif_TRUE@am__EXEEXT_1 = dvigif$(EXEEXT)
+am__installdirs = "$(DESTDIR)$(bindir)"
+PROGRAMS = $(bin_PROGRAMS)
+nodist_dvigif_OBJECTS = dvigif-callexe.$(OBJEXT)
+dvigif_OBJECTS = $(nodist_dvigif_OBJECTS)
+dvigif_DEPENDENCIES =
+AM_V_lt = $(am__v_lt_@AM_V@)
+am__v_lt_ = $(am__v_lt_@AM_DEFAULT_V@)
+am__v_lt_0 = --silent
+am__v_lt_1 =
+am__dirstamp = $(am__leading_dot)dirstamp
+@have_ft2_TRUE@am__objects_1 = @DVIPNG_TREE@/enc.$(OBJEXT) \
+@have_ft2_TRUE@ @DVIPNG_TREE@/fontmap.$(OBJEXT) \
+@have_ft2_TRUE@ @DVIPNG_TREE@/ft.$(OBJEXT) \
+@have_ft2_TRUE@ @DVIPNG_TREE@/sfd.$(OBJEXT) \
+@have_ft2_TRUE@ @DVIPNG_TREE@/tfm.$(OBJEXT)
+nodist_dvipng_OBJECTS = @DVIPNG_TREE@/color.$(OBJEXT) \
+ @DVIPNG_TREE@/draw.$(OBJEXT) @DVIPNG_TREE@/dvi.$(OBJEXT) \
+ @DVIPNG_TREE@/dvipng.$(OBJEXT) @DVIPNG_TREE@/font.$(OBJEXT) \
+ @DVIPNG_TREE@/misc.$(OBJEXT) @DVIPNG_TREE@/papersiz.$(OBJEXT) \
+ @DVIPNG_TREE@/pk.$(OBJEXT) @DVIPNG_TREE@/ppagelist.$(OBJEXT) \
+ @DVIPNG_TREE@/set.$(OBJEXT) @DVIPNG_TREE@/special.$(OBJEXT) \
+ @DVIPNG_TREE@/vf.$(OBJEXT) $(am__objects_1)
+dvipng_OBJECTS = $(nodist_dvipng_OBJECTS)
+dvipng_LDADD = $(LDADD)
+am__DEPENDENCIES_1 =
+dvipng_DEPENDENCIES = $(am__DEPENDENCIES_1) $(am__DEPENDENCIES_1) \
+ $(am__DEPENDENCIES_1) $(am__DEPENDENCIES_1) \
+ $(am__DEPENDENCIES_1)
+AM_V_P = $(am__v_P_@AM_V@)
+am__v_P_ = $(am__v_P_@AM_DEFAULT_V@)
+am__v_P_0 = false
+am__v_P_1 = :
+AM_V_GEN = $(am__v_GEN_@AM_V@)
+am__v_GEN_ = $(am__v_GEN_@AM_DEFAULT_V@)
+am__v_GEN_0 = @echo " GEN " $@;
+am__v_GEN_1 =
+AM_V_at = $(am__v_at_@AM_V@)
+am__v_at_ = $(am__v_at_@AM_DEFAULT_V@)
+am__v_at_0 = @
+am__v_at_1 =
+DEFAULT_INCLUDES = -I.@am__isrc@
+depcomp = $(SHELL) $(top_srcdir)/../../build-aux/depcomp
+am__maybe_remake_depfiles = depfiles
+am__depfiles_remade = ./$(DEPDIR)/dvigif-callexe.Po \
+ @DVIPNG_TREE@/$(DEPDIR)/color.Po \
+ @DVIPNG_TREE@/$(DEPDIR)/draw.Po @DVIPNG_TREE@/$(DEPDIR)/dvi.Po \
+ @DVIPNG_TREE@/$(DEPDIR)/dvipng.Po \
+ @DVIPNG_TREE@/$(DEPDIR)/enc.Po @DVIPNG_TREE@/$(DEPDIR)/font.Po \
+ @DVIPNG_TREE@/$(DEPDIR)/fontmap.Po \
+ @DVIPNG_TREE@/$(DEPDIR)/ft.Po @DVIPNG_TREE@/$(DEPDIR)/misc.Po \
+ @DVIPNG_TREE@/$(DEPDIR)/papersiz.Po \
+ @DVIPNG_TREE@/$(DEPDIR)/pk.Po \
+ @DVIPNG_TREE@/$(DEPDIR)/ppagelist.Po \
+ @DVIPNG_TREE@/$(DEPDIR)/set.Po @DVIPNG_TREE@/$(DEPDIR)/sfd.Po \
+ @DVIPNG_TREE@/$(DEPDIR)/special.Po \
+ @DVIPNG_TREE@/$(DEPDIR)/tfm.Po @DVIPNG_TREE@/$(DEPDIR)/vf.Po
+am__mv = mv -f
+COMPILE = $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) \
+ $(CPPFLAGS) $(AM_CFLAGS) $(CFLAGS)
+LTCOMPILE = $(LIBTOOL) $(AM_V_lt) --tag=CC $(AM_LIBTOOLFLAGS) \
+ $(LIBTOOLFLAGS) --mode=compile $(CC) $(DEFS) \
+ $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) \
+ $(AM_CFLAGS) $(CFLAGS)
+AM_V_CC = $(am__v_CC_@AM_V@)
+am__v_CC_ = $(am__v_CC_@AM_DEFAULT_V@)
+am__v_CC_0 = @echo " CC " $@;
+am__v_CC_1 =
+CCLD = $(CC)
+LINK = $(LIBTOOL) $(AM_V_lt) --tag=CC $(AM_LIBTOOLFLAGS) \
+ $(LIBTOOLFLAGS) --mode=link $(CCLD) $(AM_CFLAGS) $(CFLAGS) \
+ $(AM_LDFLAGS) $(LDFLAGS) -o $@
+AM_V_CCLD = $(am__v_CCLD_@AM_V@)
+am__v_CCLD_ = $(am__v_CCLD_@AM_DEFAULT_V@)
+am__v_CCLD_0 = @echo " CCLD " $@;
+am__v_CCLD_1 =
+SOURCES = $(nodist_dvigif_SOURCES) $(nodist_dvipng_SOURCES)
+DIST_SOURCES =
+RECURSIVE_TARGETS = all-recursive check-recursive cscopelist-recursive \
+ ctags-recursive dvi-recursive html-recursive info-recursive \
+ install-data-recursive install-dvi-recursive \
+ install-exec-recursive install-html-recursive \
+ install-info-recursive install-pdf-recursive \
+ install-ps-recursive install-recursive installcheck-recursive \
+ installdirs-recursive pdf-recursive ps-recursive \
+ tags-recursive uninstall-recursive
+am__can_run_installinfo = \
+ case $$AM_UPDATE_INFO_DIR in \
+ n|no|NO) false;; \
+ *) (install-info --version) >/dev/null 2>&1;; \
+ esac
+RECURSIVE_CLEAN_TARGETS = mostlyclean-recursive clean-recursive \
+ distclean-recursive maintainer-clean-recursive
+am__recursive_targets = \
+ $(RECURSIVE_TARGETS) \
+ $(RECURSIVE_CLEAN_TARGETS) \
+ $(am__extra_recursive_targets)
+AM_RECURSIVE_TARGETS = $(am__recursive_targets:-recursive=) TAGS CTAGS \
+ cscope check recheck distdir distdir-am dist dist-all \
+ distcheck
+am__tagged_files = $(HEADERS) $(SOURCES) $(TAGS_FILES) $(LISP) \
+ config.h.in
+# Read a list of newline-separated strings from the standard input,
+# and print each of them once, without duplicates. Input order is
+# *not* preserved.
+am__uniquify_input = $(AWK) '\
+ BEGIN { nonempty = 0; } \
+ { items[$$0] = 1; nonempty = 1; } \
+ END { if (nonempty) { for (i in items) print i; }; } \
+'
+# Make sure the list of sources is unique. This is necessary because,
+# e.g., the same source file might be shared among _SOURCES variables
+# for different programs/libraries.
+am__define_uniq_tagged_files = \
+ list='$(am__tagged_files)'; \
+ unique=`for i in $$list; do \
+ if test -f "$$i"; then echo $$i; else echo $(srcdir)/$$i; fi; \
+ done | $(am__uniquify_input)`
+ETAGS = etags
+CTAGS = ctags
+CSCOPE = cscope
+am__tty_colors_dummy = \
+ mgn= red= grn= lgn= blu= brg= std=; \
+ am__color_tests=no
+am__tty_colors = { \
+ $(am__tty_colors_dummy); \
+ if test "X$(AM_COLOR_TESTS)" = Xno; then \
+ am__color_tests=no; \
+ elif test "X$(AM_COLOR_TESTS)" = Xalways; then \
+ am__color_tests=yes; \
+ elif test "X$$TERM" != Xdumb && { test -t 1; } 2>/dev/null; then \
+ am__color_tests=yes; \
+ fi; \
+ if test $$am__color_tests = yes; then \
+ red=''; \
+ grn=''; \
+ lgn=''; \
+ blu=''; \
+ mgn=''; \
+ brg=''; \
+ std=''; \
+ fi; \
+}
+am__vpath_adj_setup = srcdirstrip=`echo "$(srcdir)" | sed 's|.|.|g'`;
+am__vpath_adj = case $$p in \
+ $(srcdir)/*) f=`echo "$$p" | sed "s|^$$srcdirstrip/||"`;; \
+ *) f=$$p;; \
+ esac;
+am__strip_dir = f=`echo $$p | sed -e 's|^.*/||'`;
+am__install_max = 40
+am__nobase_strip_setup = \
+ srcdirstrip=`echo "$(srcdir)" | sed 's/[].[^$$\\*|]/\\\\&/g'`
+am__nobase_strip = \
+ for p in $$list; do echo "$$p"; done | sed -e "s|$$srcdirstrip/||"
+am__nobase_list = $(am__nobase_strip_setup); \
+ for p in $$list; do echo "$$p $$p"; done | \
+ sed "s| $$srcdirstrip/| |;"' / .*\//!s/ .*/ ./; s,\( .*\)/[^/]*$$,\1,' | \
+ $(AWK) 'BEGIN { files["."] = "" } { files[$$2] = files[$$2] " " $$1; \
+ if (++n[$$2] == $(am__install_max)) \
+ { print $$2, files[$$2]; n[$$2] = 0; files[$$2] = "" } } \
+ END { for (dir in files) print dir, files[dir] }'
+am__base_list = \
+ sed '$$!N;$$!N;$$!N;$$!N;$$!N;$$!N;$$!N;s/\n/ /g' | \
+ sed '$$!N;$$!N;$$!N;$$!N;s/\n/ /g'
+am__uninstall_files_from_dir = { \
+ test -z "$$files" \
+ || { test ! -d "$$dir" && test ! -f "$$dir" && test ! -r "$$dir"; } \
+ || { echo " ( cd '$$dir' && rm -f" $$files ")"; \
+ $(am__cd) "$$dir" && rm -f $$files; }; \
+ }
+am__recheck_rx = ^[ ]*:recheck:[ ]*
+am__global_test_result_rx = ^[ ]*:global-test-result:[ ]*
+am__copy_in_global_log_rx = ^[ ]*:copy-in-global-log:[ ]*
+# A command that, given a newline-separated list of test names on the
+# standard input, print the name of the tests that are to be re-run
+# upon "make recheck".
+am__list_recheck_tests = $(AWK) '{ \
+ recheck = 1; \
+ while ((rc = (getline line < ($$0 ".trs"))) != 0) \
+ { \
+ if (rc < 0) \
+ { \
+ if ((getline line2 < ($$0 ".log")) < 0) \
+ recheck = 0; \
+ break; \
+ } \
+ else if (line ~ /$(am__recheck_rx)[nN][Oo]/) \
+ { \
+ recheck = 0; \
+ break; \
+ } \
+ else if (line ~ /$(am__recheck_rx)[yY][eE][sS]/) \
+ { \
+ break; \
+ } \
+ }; \
+ if (recheck) \
+ print $$0; \
+ close ($$0 ".trs"); \
+ close ($$0 ".log"); \
+}'
+# A command that, given a newline-separated list of test names on the
+# standard input, create the global log from their .trs and .log files.
+am__create_global_log = $(AWK) ' \
+function fatal(msg) \
+{ \
+ print "fatal: making $@: " msg | "cat >&2"; \
+ exit 1; \
+} \
+function rst_section(header) \
+{ \
+ print header; \
+ len = length(header); \
+ for (i = 1; i <= len; i = i + 1) \
+ printf "="; \
+ printf "\n\n"; \
+} \
+{ \
+ copy_in_global_log = 1; \
+ global_test_result = "RUN"; \
+ while ((rc = (getline line < ($$0 ".trs"))) != 0) \
+ { \
+ if (rc < 0) \
+ fatal("failed to read from " $$0 ".trs"); \
+ if (line ~ /$(am__global_test_result_rx)/) \
+ { \
+ sub("$(am__global_test_result_rx)", "", line); \
+ sub("[ ]*$$", "", line); \
+ global_test_result = line; \
+ } \
+ else if (line ~ /$(am__copy_in_global_log_rx)[nN][oO]/) \
+ copy_in_global_log = 0; \
+ }; \
+ if (copy_in_global_log) \
+ { \
+ rst_section(global_test_result ": " $$0); \
+ while ((rc = (getline line < ($$0 ".log"))) != 0) \
+ { \
+ if (rc < 0) \
+ fatal("failed to read from " $$0 ".log"); \
+ print line; \
+ }; \
+ printf "\n"; \
+ }; \
+ close ($$0 ".trs"); \
+ close ($$0 ".log"); \
+}'
+# Restructured Text title.
+am__rst_title = { sed 's/.*/ & /;h;s/./=/g;p;x;s/ *$$//;p;g' && echo; }
+# Solaris 10 'make', and several other traditional 'make' implementations,
+# pass "-e" to $(SHELL), and POSIX 2008 even requires this. Work around it
+# by disabling -e (using the XSI extension "set +e") if it's set.
+am__sh_e_setup = case $$- in *e*) set +e;; esac
+# Default flags passed to test drivers.
+am__common_driver_flags = \
+ --color-tests "$$am__color_tests" \
+ --enable-hard-errors "$$am__enable_hard_errors" \
+ --expect-failure "$$am__expect_failure"
+# To be inserted before the command running the test. Creates the
+# directory for the log if needed. Stores in $dir the directory
+# containing $f, in $tst the test, in $log the log. Executes the
+# developer- defined test setup AM_TESTS_ENVIRONMENT (if any), and
+# passes TESTS_ENVIRONMENT. Set up options for the wrapper that
+# will run the test scripts (or their associated LOG_COMPILER, if
+# thy have one).
+am__check_pre = \
+$(am__sh_e_setup); \
+$(am__vpath_adj_setup) $(am__vpath_adj) \
+$(am__tty_colors); \
+srcdir=$(srcdir); export srcdir; \
+case "$@" in \
+ */*) am__odir=`echo "./$@" | sed 's|/[^/]*$$||'`;; \
+ *) am__odir=.;; \
+esac; \
+test "x$$am__odir" = x"." || test -d "$$am__odir" \
+ || $(MKDIR_P) "$$am__odir" || exit $$?; \
+if test -f "./$$f"; then dir=./; \
+elif test -f "$$f"; then dir=; \
+else dir="$(srcdir)/"; fi; \
+tst=$$dir$$f; log='$@'; \
+if test -n '$(DISABLE_HARD_ERRORS)'; then \
+ am__enable_hard_errors=no; \
+else \
+ am__enable_hard_errors=yes; \
+fi; \
+case " $(XFAIL_TESTS) " in \
+ *[\ \ ]$$f[\ \ ]* | *[\ \ ]$$dir$$f[\ \ ]*) \
+ am__expect_failure=yes;; \
+ *) \
+ am__expect_failure=no;; \
+esac; \
+$(AM_TESTS_ENVIRONMENT) $(TESTS_ENVIRONMENT)
+# A shell command to get the names of the tests scripts with any registered
+# extension removed (i.e., equivalently, the names of the test logs, with
+# the '.log' extension removed). The result is saved in the shell variable
+# '$bases'. This honors runtime overriding of TESTS and TEST_LOGS. Sadly,
+# we cannot use something simpler, involving e.g., "$(TEST_LOGS:.log=)",
+# since that might cause problem with VPATH rewrites for suffix-less tests.
+# See also 'test-harness-vpath-rewrite.sh' and 'test-trs-basic.sh'.
+am__set_TESTS_bases = \
+ bases='$(TEST_LOGS)'; \
+ bases=`for i in $$bases; do echo $$i; done | sed 's/\.log$$//'`; \
+ bases=`echo $$bases`
+AM_TESTSUITE_SUMMARY_HEADER = ' for $(PACKAGE_STRING)'
+RECHECK_LOGS = $(TEST_LOGS)
+TEST_SUITE_LOG = test-suite.log
+TEST_EXTENSIONS = @EXEEXT@ .test
+am__test_logs1 = $(TESTS:=.log)
+am__test_logs2 = $(am__test_logs1:@EXEEXT@.log=.log)
+TEST_LOGS = $(am__test_logs2:.test.log=.log)
+TEST_LOG_DRIVER = $(SHELL) $(top_srcdir)/../../build-aux/test-driver
+TEST_LOG_COMPILE = $(TEST_LOG_COMPILER) $(AM_TEST_LOG_FLAGS) \
+ $(TEST_LOG_FLAGS)
+am__set_b = \
+ case '$@' in \
+ */*) \
+ case '$*' in \
+ */*) b='$*';; \
+ *) b=`echo '$@' | sed 's/\.log$$//'`; \
+ esac;; \
+ *) \
+ b='$*';; \
+ esac
+DIST_SUBDIRS = $(SUBDIRS)
+am__DIST_COMMON = $(srcdir)/../../am/bin_links.am \
+ $(srcdir)/../../am/dist_hook.am $(srcdir)/Makefile.in \
+ $(srcdir)/config.h.in $(top_srcdir)/../../build-aux/compile \
+ $(top_srcdir)/../../build-aux/config.guess \
+ $(top_srcdir)/../../build-aux/config.sub \
+ $(top_srcdir)/../../build-aux/depcomp \
+ $(top_srcdir)/../../build-aux/install-sh \
+ $(top_srcdir)/../../build-aux/ltmain.sh \
+ $(top_srcdir)/../../build-aux/missing \
+ $(top_srcdir)/../../build-aux/test-driver \
+ $(top_srcdir)/../texlive/w32_wrapper/callexe.c \
+ ../../build-aux/ar-lib ../../build-aux/compile \
+ ../../build-aux/config.guess ../../build-aux/config.sub \
+ ../../build-aux/depcomp ../../build-aux/install-sh \
+ ../../build-aux/ltmain.sh ../../build-aux/missing \
+ ../../build-aux/texinfo.tex ../../build-aux/ylwrap ChangeLog
+DISTFILES = $(DIST_COMMON) $(DIST_SOURCES) $(TEXINFOS) $(EXTRA_DIST)
+distdir = $(PACKAGE)-$(VERSION)
+top_distdir = $(distdir)
+am__remove_distdir = \
+ if test -d "$(distdir)"; then \
+ find "$(distdir)" -type d ! -perm -200 -exec chmod u+w {} ';' \
+ && rm -rf "$(distdir)" \
+ || { sleep 5 && rm -rf "$(distdir)"; }; \
+ else :; fi
+am__post_remove_distdir = $(am__remove_distdir)
+am__relativize = \
+ dir0=`pwd`; \
+ sed_first='s,^\([^/]*\)/.*$$,\1,'; \
+ sed_rest='s,^[^/]*/*,,'; \
+ sed_last='s,^.*/\([^/]*\)$$,\1,'; \
+ sed_butlast='s,/*[^/]*$$,,'; \
+ while test -n "$$dir1"; do \
+ first=`echo "$$dir1" | sed -e "$$sed_first"`; \
+ if test "$$first" != "."; then \
+ if test "$$first" = ".."; then \
+ dir2=`echo "$$dir0" | sed -e "$$sed_last"`/"$$dir2"; \
+ dir0=`echo "$$dir0" | sed -e "$$sed_butlast"`; \
+ else \
+ first2=`echo "$$dir2" | sed -e "$$sed_first"`; \
+ if test "$$first2" = "$$first"; then \
+ dir2=`echo "$$dir2" | sed -e "$$sed_rest"`; \
+ else \
+ dir2="../$$dir2"; \
+ fi; \
+ dir0="$$dir0"/"$$first"; \
+ fi; \
+ fi; \
+ dir1=`echo "$$dir1" | sed -e "$$sed_rest"`; \
+ done; \
+ reldir="$$dir2"
+DIST_ARCHIVES = $(distdir).tar.gz
+GZIP_ENV = --best
+DIST_TARGETS = dist-gzip
+# Exists only to be overridden by the user if desired.
+AM_DISTCHECK_DVI_TARGET = dvi
+distuninstallcheck_listfiles = find . -type f -print
+am__distuninstallcheck_listfiles = $(distuninstallcheck_listfiles) \
+ | sed 's|^\./|$(prefix)/|' | grep -v '$(infodir)/dir$$'
+distcleancheck_listfiles = find . -type f -print
+ACLOCAL = @ACLOCAL@
+AMTAR = @AMTAR@
+AM_DEFAULT_VERBOSITY = @AM_DEFAULT_VERBOSITY@
+AM_MAKEINFOFLAGS = @AM_MAKEINFOFLAGS@
+AR = @AR@
+AS = @AS@
+AUTOCONF = @AUTOCONF@
+AUTOHEADER = @AUTOHEADER@
+AUTOMAKE = @AUTOMAKE@
+AWK = @AWK@
+CC = @CC@
+CCDEPMODE = @CCDEPMODE@
+CFLAGS = @CFLAGS@
+CPP = @CPP@
+CPPFLAGS = @CPPFLAGS@
+CYGPATH_W = @CYGPATH_W@
+DEFS = @DEFS@
+DEPDIR = @DEPDIR@
+DLLTOOL = @DLLTOOL@
+DSYMUTIL = @DSYMUTIL@
+DUMPBIN = @DUMPBIN@
+DVIPNG_TREE = @DVIPNG_TREE@
+ECHO_C = @ECHO_C@
+ECHO_N = @ECHO_N@
+ECHO_T = @ECHO_T@
+EGREP = @EGREP@
+EXEEXT = @EXEEXT@
+FGREP = @FGREP@
+FREETYPE2_DEPEND = @FREETYPE2_DEPEND@
+FREETYPE2_INCLUDES = @FREETYPE2_INCLUDES@
+FREETYPE2_LIBS = @FREETYPE2_LIBS@
+FT2_CONFIG = @FT2_CONFIG@
+GD_DEPEND = @GD_DEPEND@
+GD_INCLUDES = @GD_INCLUDES@
+GD_LIBS = @GD_LIBS@
+GREP = @GREP@
+GS = @GS@
+INSTALL = @INSTALL@
+INSTALL_DATA = @INSTALL_DATA@
+INSTALL_INFO = @INSTALL_INFO@
+INSTALL_PROGRAM = @INSTALL_PROGRAM@
+INSTALL_SCRIPT = @INSTALL_SCRIPT@
+INSTALL_STRIP_PROGRAM = @INSTALL_STRIP_PROGRAM@
+KPATHSEA_DEPEND = @KPATHSEA_DEPEND@
+KPATHSEA_INCLUDES = @KPATHSEA_INCLUDES@
+KPATHSEA_LIBS = @KPATHSEA_LIBS@
+LD = @LD@
+LDFLAGS = @LDFLAGS@
+LIBOBJS = @LIBOBJS@
+LIBPNG_DEPEND = @LIBPNG_DEPEND@
+LIBPNG_INCLUDES = @LIBPNG_INCLUDES@
+LIBPNG_LIBS = @LIBPNG_LIBS@
+LIBS = @LIBS@
+LIBTOOL = @LIBTOOL@
+LIPO = @LIPO@
+LN_S = @LN_S@
+LTLIBOBJS = @LTLIBOBJS@
+LT_SYS_LIBRARY_PATH = @LT_SYS_LIBRARY_PATH@
+MAINT = @MAINT@
+MAKEINFO = @MAKEINFO@
+MANIFEST_TOOL = @MANIFEST_TOOL@
+MKDIR_P = @MKDIR_P@
+NM = @NM@
+NMEDIT = @NMEDIT@
+OBJDUMP = @OBJDUMP@
+OBJEXT = @OBJEXT@
+OTOOL = @OTOOL@
+OTOOL64 = @OTOOL64@
+PACKAGE = @PACKAGE@
+PACKAGE_BUGREPORT = @PACKAGE_BUGREPORT@
+PACKAGE_NAME = @PACKAGE_NAME@
+PACKAGE_STRING = @PACKAGE_STRING@
+PACKAGE_TARNAME = @PACKAGE_TARNAME@
+PACKAGE_URL = @PACKAGE_URL@
+PACKAGE_VERSION = @PACKAGE_VERSION@
+PATH_SEPARATOR = @PATH_SEPARATOR@
+PKG_CONFIG = @PKG_CONFIG@
+POW_LIB = @POW_LIB@
+RANLIB = @RANLIB@
+SED = @SED@
+SET_MAKE = @SET_MAKE@
+SHELL = @SHELL@
+STRIP = @STRIP@
+VERSION = @VERSION@
+WARNING_CFLAGS = @WARNING_CFLAGS@
+ZLIB_DEPEND = @ZLIB_DEPEND@
+ZLIB_INCLUDES = @ZLIB_INCLUDES@
+ZLIB_LIBS = @ZLIB_LIBS@
+abs_builddir = @abs_builddir@
+abs_srcdir = @abs_srcdir@
+abs_top_builddir = @abs_top_builddir@
+abs_top_srcdir = @abs_top_srcdir@
+ac_ct_AR = @ac_ct_AR@
+ac_ct_CC = @ac_ct_CC@
+ac_ct_DUMPBIN = @ac_ct_DUMPBIN@
+am__include = @am__include@
+am__leading_dot = @am__leading_dot@
+am__quote = @am__quote@
+am__tar = @am__tar@
+am__untar = @am__untar@
+bindir = @bindir@
+build = @build@
+build_alias = @build_alias@
+build_cpu = @build_cpu@
+build_os = @build_os@
+build_vendor = @build_vendor@
+builddir = @builddir@
+datadir = @datadir@
+datarootdir = @datarootdir@
+docdir = @docdir@
+dvidir = @dvidir@
+exec_prefix = @exec_prefix@
+host = @host@
+host_alias = @host_alias@
+host_cpu = @host_cpu@
+host_os = @host_os@
+host_vendor = @host_vendor@
+htmldir = @htmldir@
+includedir = @includedir@
+infodir = @infodir@
+install_sh = @install_sh@
+libdir = @libdir@
+libexecdir = @libexecdir@
+localedir = @localedir@
+localstatedir = @localstatedir@
+mandir = @mandir@
+mkdir_p = @mkdir_p@
+oldincludedir = @oldincludedir@
+pdfdir = @pdfdir@
+prefix = @prefix@
+program_transform_name = @program_transform_name@
+psdir = @psdir@
+sbindir = @sbindir@
+sharedstatedir = @sharedstatedir@
+srcdir = @srcdir@
+sysconfdir = @sysconfdir@
+target_alias = @target_alias@
+top_build_prefix = @top_build_prefix@
+top_builddir = @top_builddir@
+top_srcdir = @top_srcdir@
+
+# Adapted for TeX Live from dvipng-src/Makefile.in
+# Copyright (C) 2002-2008 Jan-Åke Larsson
+#
+EXTRA_DIST = $(DVIPNG_TREE) TLpatches dvipng.test dvipng-test.dvi
+NEVER_DIST = `find . $(NEVER_NAMES)`
+
+# Files not to be distributed
+NEVER_NAMES = -name .svn $(NEVER_NAMES_SUB)
+NEVER_NAMES_SUB = -o -name .deps -o -name .dirstamp -o -name '*.$(OBJEXT)'
+NEVER_NAMES_LT = -o -name .libs -o -name '*.lo'
+AM_CPPFLAGS = -DTEXLIVE -I$(top_srcdir)/$(DVIPNG_TREE) \
+ $(KPATHSEA_INCLUDES) $(FREETYPE2_INCLUDES) $(GD_INCLUDES) \
+ $(LIBPNG_INCLUDES) $(ZLIB_INCLUDES)
+AM_CFLAGS = $(WARNING_CFLAGS)
+
+# In order that `make distcheck' succeeds, we must not attempt to rebuild
+# dvipng.info if dvipng.help has not changed, Thus we delegate rebuilding
+# dvipng.help and dvipng.info, if necessary, to subdirectories.
+SUBDIRS = . help doc
+nodist_dvipng_SOURCES = @DVIPNG_TREE@/color.c @DVIPNG_TREE@/draw.c \
+ @DVIPNG_TREE@/dvi.c @DVIPNG_TREE@/dvipng.c \
+ @DVIPNG_TREE@/font.c @DVIPNG_TREE@/misc.c \
+ @DVIPNG_TREE@/papersiz.c @DVIPNG_TREE@/pk.c \
+ @DVIPNG_TREE@/ppagelist.c @DVIPNG_TREE@/set.c \
+ @DVIPNG_TREE@/special.c @DVIPNG_TREE@/vf.c $(am__append_1)
+dvipng_dependencies = $(KPATHSEA_DEPEND) $(GD_DEPEND) $(FREETYPE2_DEPEND) $(LIBPNG_DEPEND)
+DISTCLEANFILES = config.force
+LDADD = $(KPATHSEA_LIBS) $(GD_LIBS) $(FREETYPE2_LIBS) $(LIBPNG_LIBS) \
+ $(ZLIB_LIBS)
+dvigif_CPPFLAGS = -DEXEPROG=\"dvipng.exe\"
+nodist_dvigif_SOURCES = callexe.c
+dvigif_LDADD =
+bin_links = dvipng$(EXEEXT):dvigif
+TESTS = dvipng.test
+CLEANFILES = dvipng-test*.gif dvipng-test*.png
+all: config.h
+ $(MAKE) $(AM_MAKEFLAGS) all-recursive
+
+.SUFFIXES:
+.SUFFIXES: .c .lo .log .o .obj .test .test$(EXEEXT) .trs
+am--refresh: Makefile
+ @:
+$(srcdir)/Makefile.in: @MAINTAINER_MODE_TRUE@ $(srcdir)/Makefile.am $(srcdir)/../../am/dist_hook.am $(srcdir)/../../am/bin_links.am $(am__configure_deps)
+ @for dep in $?; do \
+ case '$(am__configure_deps)' in \
+ *$$dep*) \
+ echo ' cd $(srcdir) && $(AUTOMAKE) --foreign'; \
+ $(am__cd) $(srcdir) && $(AUTOMAKE) --foreign \
+ && exit 0; \
+ exit 1;; \
+ esac; \
+ done; \
+ echo ' cd $(top_srcdir) && $(AUTOMAKE) --foreign Makefile'; \
+ $(am__cd) $(top_srcdir) && \
+ $(AUTOMAKE) --foreign Makefile
+Makefile: $(srcdir)/Makefile.in $(top_builddir)/config.status
+ @case '$?' in \
+ *config.status*) \
+ echo ' $(SHELL) ./config.status'; \
+ $(SHELL) ./config.status;; \
+ *) \
+ echo ' cd $(top_builddir) && $(SHELL) ./config.status $@ $(am__maybe_remake_depfiles)'; \
+ cd $(top_builddir) && $(SHELL) ./config.status $@ $(am__maybe_remake_depfiles);; \
+ esac;
+$(srcdir)/../../am/dist_hook.am $(srcdir)/../../am/bin_links.am $(am__empty):
+
+$(top_builddir)/config.status: $(top_srcdir)/configure $(CONFIG_STATUS_DEPENDENCIES)
+ $(SHELL) ./config.status --recheck
+
+$(top_srcdir)/configure: @MAINTAINER_MODE_TRUE@ $(am__configure_deps)
+ $(am__cd) $(srcdir) && $(AUTOCONF)
+$(ACLOCAL_M4): @MAINTAINER_MODE_TRUE@ $(am__aclocal_m4_deps)
+ $(am__cd) $(srcdir) && $(ACLOCAL) $(ACLOCAL_AMFLAGS)
+$(am__aclocal_m4_deps):
+
+config.h: stamp-h1
+ @test -f $@ || rm -f stamp-h1
+ @test -f $@ || $(MAKE) $(AM_MAKEFLAGS) stamp-h1
+
+stamp-h1: $(srcdir)/config.h.in $(top_builddir)/config.status
+ @rm -f stamp-h1
+ cd $(top_builddir) && $(SHELL) ./config.status config.h
+$(srcdir)/config.h.in: @MAINTAINER_MODE_TRUE@ $(am__configure_deps)
+ ($(am__cd) $(top_srcdir) && $(AUTOHEADER))
+ rm -f stamp-h1
+ touch $@
+
+distclean-hdr:
+ -rm -f config.h stamp-h1
+install-binPROGRAMS: $(bin_PROGRAMS)
+ @$(NORMAL_INSTALL)
+ @list='$(bin_PROGRAMS)'; test -n "$(bindir)" || list=; \
+ if test -n "$$list"; then \
+ echo " $(MKDIR_P) '$(DESTDIR)$(bindir)'"; \
+ $(MKDIR_P) "$(DESTDIR)$(bindir)" || exit 1; \
+ fi; \
+ for p in $$list; do echo "$$p $$p"; done | \
+ sed 's/$(EXEEXT)$$//' | \
+ while read p p1; do if test -f $$p \
+ || test -f $$p1 \
+ ; then echo "$$p"; echo "$$p"; else :; fi; \
+ done | \
+ sed -e 'p;s,.*/,,;n;h' \
+ -e 's|.*|.|' \
+ -e 'p;x;s,.*/,,;s/$(EXEEXT)$$//;$(transform);s/$$/$(EXEEXT)/' | \
+ sed 'N;N;N;s,\n, ,g' | \
+ $(AWK) 'BEGIN { files["."] = ""; dirs["."] = 1 } \
+ { d=$$3; if (dirs[d] != 1) { print "d", d; dirs[d] = 1 } \
+ if ($$2 == $$4) files[d] = files[d] " " $$1; \
+ else { print "f", $$3 "/" $$4, $$1; } } \
+ END { for (d in files) print "f", d, files[d] }' | \
+ while read type dir files; do \
+ if test "$$dir" = .; then dir=; else dir=/$$dir; fi; \
+ test -z "$$files" || { \
+ echo " $(INSTALL_PROGRAM_ENV) $(LIBTOOL) $(AM_LIBTOOLFLAGS) $(LIBTOOLFLAGS) --mode=install $(INSTALL_PROGRAM) $$files '$(DESTDIR)$(bindir)$$dir'"; \
+ $(INSTALL_PROGRAM_ENV) $(LIBTOOL) $(AM_LIBTOOLFLAGS) $(LIBTOOLFLAGS) --mode=install $(INSTALL_PROGRAM) $$files "$(DESTDIR)$(bindir)$$dir" || exit $$?; \
+ } \
+ ; done
+
+uninstall-binPROGRAMS:
+ @$(NORMAL_UNINSTALL)
+ @list='$(bin_PROGRAMS)'; test -n "$(bindir)" || list=; \
+ files=`for p in $$list; do echo "$$p"; done | \
+ sed -e 'h;s,^.*/,,;s/$(EXEEXT)$$//;$(transform)' \
+ -e 's/$$/$(EXEEXT)/' \
+ `; \
+ test -n "$$list" || exit 0; \
+ echo " ( cd '$(DESTDIR)$(bindir)' && rm -f" $$files ")"; \
+ cd "$(DESTDIR)$(bindir)" && rm -f $$files
+
+clean-binPROGRAMS:
+ @list='$(bin_PROGRAMS)'; test -n "$$list" || exit 0; \
+ echo " rm -f" $$list; \
+ rm -f $$list || exit $$?; \
+ test -n "$(EXEEXT)" || exit 0; \
+ list=`for p in $$list; do echo "$$p"; done | sed 's/$(EXEEXT)$$//'`; \
+ echo " rm -f" $$list; \
+ rm -f $$list
+
+dvigif$(EXEEXT): $(dvigif_OBJECTS) $(dvigif_DEPENDENCIES) $(EXTRA_dvigif_DEPENDENCIES)
+ @rm -f dvigif$(EXEEXT)
+ $(AM_V_CCLD)$(LINK) $(dvigif_OBJECTS) $(dvigif_LDADD) $(LIBS)
+@DVIPNG_TREE@/$(am__dirstamp):
+ @$(MKDIR_P) @DVIPNG_TREE@
+ @: > @DVIPNG_TREE@/$(am__dirstamp)
+@DVIPNG_TREE@/$(DEPDIR)/$(am__dirstamp):
+ @$(MKDIR_P) @DVIPNG_TREE@/$(DEPDIR)
+ @: > @DVIPNG_TREE@/$(DEPDIR)/$(am__dirstamp)
+@DVIPNG_TREE@/color.$(OBJEXT): @DVIPNG_TREE@/$(am__dirstamp) \
+ @DVIPNG_TREE@/$(DEPDIR)/$(am__dirstamp)
+@DVIPNG_TREE@/draw.$(OBJEXT): @DVIPNG_TREE@/$(am__dirstamp) \
+ @DVIPNG_TREE@/$(DEPDIR)/$(am__dirstamp)
+@DVIPNG_TREE@/dvi.$(OBJEXT): @DVIPNG_TREE@/$(am__dirstamp) \
+ @DVIPNG_TREE@/$(DEPDIR)/$(am__dirstamp)
+@DVIPNG_TREE@/dvipng.$(OBJEXT): @DVIPNG_TREE@/$(am__dirstamp) \
+ @DVIPNG_TREE@/$(DEPDIR)/$(am__dirstamp)
+@DVIPNG_TREE@/font.$(OBJEXT): @DVIPNG_TREE@/$(am__dirstamp) \
+ @DVIPNG_TREE@/$(DEPDIR)/$(am__dirstamp)
+@DVIPNG_TREE@/misc.$(OBJEXT): @DVIPNG_TREE@/$(am__dirstamp) \
+ @DVIPNG_TREE@/$(DEPDIR)/$(am__dirstamp)
+@DVIPNG_TREE@/papersiz.$(OBJEXT): @DVIPNG_TREE@/$(am__dirstamp) \
+ @DVIPNG_TREE@/$(DEPDIR)/$(am__dirstamp)
+@DVIPNG_TREE@/pk.$(OBJEXT): @DVIPNG_TREE@/$(am__dirstamp) \
+ @DVIPNG_TREE@/$(DEPDIR)/$(am__dirstamp)
+@DVIPNG_TREE@/ppagelist.$(OBJEXT): @DVIPNG_TREE@/$(am__dirstamp) \
+ @DVIPNG_TREE@/$(DEPDIR)/$(am__dirstamp)
+@DVIPNG_TREE@/set.$(OBJEXT): @DVIPNG_TREE@/$(am__dirstamp) \
+ @DVIPNG_TREE@/$(DEPDIR)/$(am__dirstamp)
+@DVIPNG_TREE@/special.$(OBJEXT): @DVIPNG_TREE@/$(am__dirstamp) \
+ @DVIPNG_TREE@/$(DEPDIR)/$(am__dirstamp)
+@DVIPNG_TREE@/vf.$(OBJEXT): @DVIPNG_TREE@/$(am__dirstamp) \
+ @DVIPNG_TREE@/$(DEPDIR)/$(am__dirstamp)
+@DVIPNG_TREE@/enc.$(OBJEXT): @DVIPNG_TREE@/$(am__dirstamp) \
+ @DVIPNG_TREE@/$(DEPDIR)/$(am__dirstamp)
+@DVIPNG_TREE@/fontmap.$(OBJEXT): @DVIPNG_TREE@/$(am__dirstamp) \
+ @DVIPNG_TREE@/$(DEPDIR)/$(am__dirstamp)
+@DVIPNG_TREE@/ft.$(OBJEXT): @DVIPNG_TREE@/$(am__dirstamp) \
+ @DVIPNG_TREE@/$(DEPDIR)/$(am__dirstamp)
+@DVIPNG_TREE@/sfd.$(OBJEXT): @DVIPNG_TREE@/$(am__dirstamp) \
+ @DVIPNG_TREE@/$(DEPDIR)/$(am__dirstamp)
+@DVIPNG_TREE@/tfm.$(OBJEXT): @DVIPNG_TREE@/$(am__dirstamp) \
+ @DVIPNG_TREE@/$(DEPDIR)/$(am__dirstamp)
+
+dvipng$(EXEEXT): $(dvipng_OBJECTS) $(dvipng_DEPENDENCIES) $(EXTRA_dvipng_DEPENDENCIES)
+ @rm -f dvipng$(EXEEXT)
+ $(AM_V_CCLD)$(LINK) $(dvipng_OBJECTS) $(dvipng_LDADD) $(LIBS)
+
+mostlyclean-compile:
+ -rm -f *.$(OBJEXT)
+ -rm -f @DVIPNG_TREE@/*.$(OBJEXT)
+
+distclean-compile:
+ -rm -f *.tab.c
+
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/dvigif-callexe.Po@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@@DVIPNG_TREE@/$(DEPDIR)/color.Po@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@@DVIPNG_TREE@/$(DEPDIR)/draw.Po@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@@DVIPNG_TREE@/$(DEPDIR)/dvi.Po@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@@DVIPNG_TREE@/$(DEPDIR)/dvipng.Po@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@@DVIPNG_TREE@/$(DEPDIR)/enc.Po@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@@DVIPNG_TREE@/$(DEPDIR)/font.Po@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@@DVIPNG_TREE@/$(DEPDIR)/fontmap.Po@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@@DVIPNG_TREE@/$(DEPDIR)/ft.Po@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@@DVIPNG_TREE@/$(DEPDIR)/misc.Po@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@@DVIPNG_TREE@/$(DEPDIR)/papersiz.Po@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@@DVIPNG_TREE@/$(DEPDIR)/pk.Po@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@@DVIPNG_TREE@/$(DEPDIR)/ppagelist.Po@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@@DVIPNG_TREE@/$(DEPDIR)/set.Po@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@@DVIPNG_TREE@/$(DEPDIR)/sfd.Po@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@@DVIPNG_TREE@/$(DEPDIR)/special.Po@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@@DVIPNG_TREE@/$(DEPDIR)/tfm.Po@am__quote@ # am--include-marker
+@AMDEP_TRUE@@am__include@ @am__quote@@DVIPNG_TREE@/$(DEPDIR)/vf.Po@am__quote@ # am--include-marker
+
+$(am__depfiles_remade):
+ @$(MKDIR_P) $(@D)
+ @echo '# dummy' >$@-t && $(am__mv) $@-t $@
+
+am--depfiles: $(am__depfiles_remade)
+
+.c.o:
+@am__fastdepCC_TRUE@ $(AM_V_CC)depbase=`echo $@ | sed 's|[^/]*$$|$(DEPDIR)/&|;s|\.o$$||'`;\
+@am__fastdepCC_TRUE@ $(COMPILE) -MT $@ -MD -MP -MF $$depbase.Tpo -c -o $@ $< &&\
+@am__fastdepCC_TRUE@ $(am__mv) $$depbase.Tpo $$depbase.Po
+@AMDEP_TRUE@@am__fastdepCC_FALSE@ $(AM_V_CC)source='$<' object='$@' libtool=no @AMDEPBACKSLASH@
+@AMDEP_TRUE@@am__fastdepCC_FALSE@ DEPDIR=$(DEPDIR) $(CCDEPMODE) $(depcomp) @AMDEPBACKSLASH@
+@am__fastdepCC_FALSE@ $(AM_V_CC@am__nodep@)$(COMPILE) -c -o $@ $<
+
+.c.obj:
+@am__fastdepCC_TRUE@ $(AM_V_CC)depbase=`echo $@ | sed 's|[^/]*$$|$(DEPDIR)/&|;s|\.obj$$||'`;\
+@am__fastdepCC_TRUE@ $(COMPILE) -MT $@ -MD -MP -MF $$depbase.Tpo -c -o $@ `$(CYGPATH_W) '$<'` &&\
+@am__fastdepCC_TRUE@ $(am__mv) $$depbase.Tpo $$depbase.Po
+@AMDEP_TRUE@@am__fastdepCC_FALSE@ $(AM_V_CC)source='$<' object='$@' libtool=no @AMDEPBACKSLASH@
+@AMDEP_TRUE@@am__fastdepCC_FALSE@ DEPDIR=$(DEPDIR) $(CCDEPMODE) $(depcomp) @AMDEPBACKSLASH@
+@am__fastdepCC_FALSE@ $(AM_V_CC@am__nodep@)$(COMPILE) -c -o $@ `$(CYGPATH_W) '$<'`
+
+.c.lo:
+@am__fastdepCC_TRUE@ $(AM_V_CC)depbase=`echo $@ | sed 's|[^/]*$$|$(DEPDIR)/&|;s|\.lo$$||'`;\
+@am__fastdepCC_TRUE@ $(LTCOMPILE) -MT $@ -MD -MP -MF $$depbase.Tpo -c -o $@ $< &&\
+@am__fastdepCC_TRUE@ $(am__mv) $$depbase.Tpo $$depbase.Plo
+@AMDEP_TRUE@@am__fastdepCC_FALSE@ $(AM_V_CC)source='$<' object='$@' libtool=yes @AMDEPBACKSLASH@
+@AMDEP_TRUE@@am__fastdepCC_FALSE@ DEPDIR=$(DEPDIR) $(CCDEPMODE) $(depcomp) @AMDEPBACKSLASH@
+@am__fastdepCC_FALSE@ $(AM_V_CC@am__nodep@)$(LTCOMPILE) -c -o $@ $<
+
+dvigif-callexe.o: callexe.c
+@am__fastdepCC_TRUE@ $(AM_V_CC)$(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(dvigif_CPPFLAGS) $(CPPFLAGS) $(AM_CFLAGS) $(CFLAGS) -MT dvigif-callexe.o -MD -MP -MF $(DEPDIR)/dvigif-callexe.Tpo -c -o dvigif-callexe.o `test -f 'callexe.c' || echo '$(srcdir)/'`callexe.c
+@am__fastdepCC_TRUE@ $(AM_V_at)$(am__mv) $(DEPDIR)/dvigif-callexe.Tpo $(DEPDIR)/dvigif-callexe.Po
+@AMDEP_TRUE@@am__fastdepCC_FALSE@ $(AM_V_CC)source='callexe.c' object='dvigif-callexe.o' libtool=no @AMDEPBACKSLASH@
+@AMDEP_TRUE@@am__fastdepCC_FALSE@ DEPDIR=$(DEPDIR) $(CCDEPMODE) $(depcomp) @AMDEPBACKSLASH@
+@am__fastdepCC_FALSE@ $(AM_V_CC@am__nodep@)$(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(dvigif_CPPFLAGS) $(CPPFLAGS) $(AM_CFLAGS) $(CFLAGS) -c -o dvigif-callexe.o `test -f 'callexe.c' || echo '$(srcdir)/'`callexe.c
+
+dvigif-callexe.obj: callexe.c
+@am__fastdepCC_TRUE@ $(AM_V_CC)$(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(dvigif_CPPFLAGS) $(CPPFLAGS) $(AM_CFLAGS) $(CFLAGS) -MT dvigif-callexe.obj -MD -MP -MF $(DEPDIR)/dvigif-callexe.Tpo -c -o dvigif-callexe.obj `if test -f 'callexe.c'; then $(CYGPATH_W) 'callexe.c'; else $(CYGPATH_W) '$(srcdir)/callexe.c'; fi`
+@am__fastdepCC_TRUE@ $(AM_V_at)$(am__mv) $(DEPDIR)/dvigif-callexe.Tpo $(DEPDIR)/dvigif-callexe.Po
+@AMDEP_TRUE@@am__fastdepCC_FALSE@ $(AM_V_CC)source='callexe.c' object='dvigif-callexe.obj' libtool=no @AMDEPBACKSLASH@
+@AMDEP_TRUE@@am__fastdepCC_FALSE@ DEPDIR=$(DEPDIR) $(CCDEPMODE) $(depcomp) @AMDEPBACKSLASH@
+@am__fastdepCC_FALSE@ $(AM_V_CC@am__nodep@)$(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(dvigif_CPPFLAGS) $(CPPFLAGS) $(AM_CFLAGS) $(CFLAGS) -c -o dvigif-callexe.obj `if test -f 'callexe.c'; then $(CYGPATH_W) 'callexe.c'; else $(CYGPATH_W) '$(srcdir)/callexe.c'; fi`
+
+mostlyclean-libtool:
+ -rm -f *.lo
+
+clean-libtool:
+ -rm -rf .libs _libs
+
+distclean-libtool:
+ -rm -f libtool config.lt
+
+# This directory's subdirectories are mostly independent; you can cd
+# into them and run 'make' without going through this Makefile.
+# To change the values of 'make' variables: instead of editing Makefiles,
+# (1) if the variable is set in 'config.status', edit 'config.status'
+# (which will cause the Makefiles to be regenerated when you run 'make');
+# (2) otherwise, pass the desired values on the 'make' command line.
+$(am__recursive_targets):
+ @fail=; \
+ if $(am__make_keepgoing); then \
+ failcom='fail=yes'; \
+ else \
+ failcom='exit 1'; \
+ fi; \
+ dot_seen=no; \
+ target=`echo $@ | sed s/-recursive//`; \
+ case "$@" in \
+ distclean-* | maintainer-clean-*) list='$(DIST_SUBDIRS)' ;; \
+ *) list='$(SUBDIRS)' ;; \
+ esac; \
+ for subdir in $$list; do \
+ echo "Making $$target in $$subdir"; \
+ if test "$$subdir" = "."; then \
+ dot_seen=yes; \
+ local_target="$$target-am"; \
+ else \
+ local_target="$$target"; \
+ fi; \
+ ($(am__cd) $$subdir && $(MAKE) $(AM_MAKEFLAGS) $$local_target) \
+ || eval $$failcom; \
+ done; \
+ if test "$$dot_seen" = "no"; then \
+ $(MAKE) $(AM_MAKEFLAGS) "$$target-am" || exit 1; \
+ fi; test -z "$$fail"
+
+ID: $(am__tagged_files)
+ $(am__define_uniq_tagged_files); mkid -fID $$unique
+tags: tags-recursive
+TAGS: tags
+
+tags-am: $(TAGS_DEPENDENCIES) $(am__tagged_files)
+ set x; \
+ here=`pwd`; \
+ if ($(ETAGS) --etags-include --version) >/dev/null 2>&1; then \
+ include_option=--etags-include; \
+ empty_fix=.; \
+ else \
+ include_option=--include; \
+ empty_fix=; \
+ fi; \
+ list='$(SUBDIRS)'; for subdir in $$list; do \
+ if test "$$subdir" = .; then :; else \
+ test ! -f $$subdir/TAGS || \
+ set "$$@" "$$include_option=$$here/$$subdir/TAGS"; \
+ fi; \
+ done; \
+ $(am__define_uniq_tagged_files); \
+ shift; \
+ if test -z "$(ETAGS_ARGS)$$*$$unique"; then :; else \
+ test -n "$$unique" || unique=$$empty_fix; \
+ if test $$# -gt 0; then \
+ $(ETAGS) $(ETAGSFLAGS) $(AM_ETAGSFLAGS) $(ETAGS_ARGS) \
+ "$$@" $$unique; \
+ else \
+ $(ETAGS) $(ETAGSFLAGS) $(AM_ETAGSFLAGS) $(ETAGS_ARGS) \
+ $$unique; \
+ fi; \
+ fi
+ctags: ctags-recursive
+
+CTAGS: ctags
+ctags-am: $(TAGS_DEPENDENCIES) $(am__tagged_files)
+ $(am__define_uniq_tagged_files); \
+ test -z "$(CTAGS_ARGS)$$unique" \
+ || $(CTAGS) $(CTAGSFLAGS) $(AM_CTAGSFLAGS) $(CTAGS_ARGS) \
+ $$unique
+
+GTAGS:
+ here=`$(am__cd) $(top_builddir) && pwd` \
+ && $(am__cd) $(top_srcdir) \
+ && gtags -i $(GTAGS_ARGS) "$$here"
+cscope: cscope.files
+ test ! -s cscope.files \
+ || $(CSCOPE) -b -q $(AM_CSCOPEFLAGS) $(CSCOPEFLAGS) -i cscope.files $(CSCOPE_ARGS)
+clean-cscope:
+ -rm -f cscope.files
+cscope.files: clean-cscope cscopelist
+cscopelist: cscopelist-recursive
+
+cscopelist-am: $(am__tagged_files)
+ list='$(am__tagged_files)'; \
+ case "$(srcdir)" in \
+ [\\/]* | ?:[\\/]*) sdir="$(srcdir)" ;; \
+ *) sdir=$(subdir)/$(srcdir) ;; \
+ esac; \
+ for i in $$list; do \
+ if test -f "$$i"; then \
+ echo "$(subdir)/$$i"; \
+ else \
+ echo "$$sdir/$$i"; \
+ fi; \
+ done >> $(top_builddir)/cscope.files
+
+distclean-tags:
+ -rm -f TAGS ID GTAGS GRTAGS GSYMS GPATH tags
+ -rm -f cscope.out cscope.in.out cscope.po.out cscope.files
+
+# Recover from deleted '.trs' file; this should ensure that
+# "rm -f foo.log; make foo.trs" re-run 'foo.test', and re-create
+# both 'foo.log' and 'foo.trs'. Break the recipe in two subshells
+# to avoid problems with "make -n".
+.log.trs:
+ rm -f $< $@
+ $(MAKE) $(AM_MAKEFLAGS) $<
+
+# Leading 'am--fnord' is there to ensure the list of targets does not
+# expand to empty, as could happen e.g. with make check TESTS=''.
+am--fnord $(TEST_LOGS) $(TEST_LOGS:.log=.trs): $(am__force_recheck)
+am--force-recheck:
+ @:
+
+$(TEST_SUITE_LOG): $(TEST_LOGS)
+ @$(am__set_TESTS_bases); \
+ am__f_ok () { test -f "$$1" && test -r "$$1"; }; \
+ redo_bases=`for i in $$bases; do \
+ am__f_ok $$i.trs && am__f_ok $$i.log || echo $$i; \
+ done`; \
+ if test -n "$$redo_bases"; then \
+ redo_logs=`for i in $$redo_bases; do echo $$i.log; done`; \
+ redo_results=`for i in $$redo_bases; do echo $$i.trs; done`; \
+ if $(am__make_dryrun); then :; else \
+ rm -f $$redo_logs && rm -f $$redo_results || exit 1; \
+ fi; \
+ fi; \
+ if test -n "$$am__remaking_logs"; then \
+ echo "fatal: making $(TEST_SUITE_LOG): possible infinite" \
+ "recursion detected" >&2; \
+ elif test -n "$$redo_logs"; then \
+ am__remaking_logs=yes $(MAKE) $(AM_MAKEFLAGS) $$redo_logs; \
+ fi; \
+ if $(am__make_dryrun); then :; else \
+ st=0; \
+ errmsg="fatal: making $(TEST_SUITE_LOG): failed to create"; \
+ for i in $$redo_bases; do \
+ test -f $$i.trs && test -r $$i.trs \
+ || { echo "$$errmsg $$i.trs" >&2; st=1; }; \
+ test -f $$i.log && test -r $$i.log \
+ || { echo "$$errmsg $$i.log" >&2; st=1; }; \
+ done; \
+ test $$st -eq 0 || exit 1; \
+ fi
+ @$(am__sh_e_setup); $(am__tty_colors); $(am__set_TESTS_bases); \
+ ws='[ ]'; \
+ results=`for b in $$bases; do echo $$b.trs; done`; \
+ test -n "$$results" || results=/dev/null; \
+ all=` grep "^$$ws*:test-result:" $$results | wc -l`; \
+ pass=` grep "^$$ws*:test-result:$$ws*PASS" $$results | wc -l`; \
+ fail=` grep "^$$ws*:test-result:$$ws*FAIL" $$results | wc -l`; \
+ skip=` grep "^$$ws*:test-result:$$ws*SKIP" $$results | wc -l`; \
+ xfail=`grep "^$$ws*:test-result:$$ws*XFAIL" $$results | wc -l`; \
+ xpass=`grep "^$$ws*:test-result:$$ws*XPASS" $$results | wc -l`; \
+ error=`grep "^$$ws*:test-result:$$ws*ERROR" $$results | wc -l`; \
+ if test `expr $$fail + $$xpass + $$error` -eq 0; then \
+ success=true; \
+ else \
+ success=false; \
+ fi; \
+ br='==================='; br=$$br$$br$$br$$br; \
+ result_count () \
+ { \
+ if test x"$$1" = x"--maybe-color"; then \
+ maybe_colorize=yes; \
+ elif test x"$$1" = x"--no-color"; then \
+ maybe_colorize=no; \
+ else \
+ echo "$@: invalid 'result_count' usage" >&2; exit 4; \
+ fi; \
+ shift; \
+ desc=$$1 count=$$2; \
+ if test $$maybe_colorize = yes && test $$count -gt 0; then \
+ color_start=$$3 color_end=$$std; \
+ else \
+ color_start= color_end=; \
+ fi; \
+ echo "$${color_start}# $$desc $$count$${color_end}"; \
+ }; \
+ create_testsuite_report () \
+ { \
+ result_count $$1 "TOTAL:" $$all "$$brg"; \
+ result_count $$1 "PASS: " $$pass "$$grn"; \
+ result_count $$1 "SKIP: " $$skip "$$blu"; \
+ result_count $$1 "XFAIL:" $$xfail "$$lgn"; \
+ result_count $$1 "FAIL: " $$fail "$$red"; \
+ result_count $$1 "XPASS:" $$xpass "$$red"; \
+ result_count $$1 "ERROR:" $$error "$$mgn"; \
+ }; \
+ { \
+ echo "$(PACKAGE_STRING): $(subdir)/$(TEST_SUITE_LOG)" | \
+ $(am__rst_title); \
+ create_testsuite_report --no-color; \
+ echo; \
+ echo ".. contents:: :depth: 2"; \
+ echo; \
+ for b in $$bases; do echo $$b; done \
+ | $(am__create_global_log); \
+ } >$(TEST_SUITE_LOG).tmp || exit 1; \
+ mv $(TEST_SUITE_LOG).tmp $(TEST_SUITE_LOG); \
+ if $$success; then \
+ col="$$grn"; \
+ else \
+ col="$$red"; \
+ test x"$$VERBOSE" = x || cat $(TEST_SUITE_LOG); \
+ fi; \
+ echo "$${col}$$br$${std}"; \
+ echo "$${col}Testsuite summary"$(AM_TESTSUITE_SUMMARY_HEADER)"$${std}"; \
+ echo "$${col}$$br$${std}"; \
+ create_testsuite_report --maybe-color; \
+ echo "$$col$$br$$std"; \
+ if $$success; then :; else \
+ echo "$${col}See $(subdir)/$(TEST_SUITE_LOG)$${std}"; \
+ if test -n "$(PACKAGE_BUGREPORT)"; then \
+ echo "$${col}Please report to $(PACKAGE_BUGREPORT)$${std}"; \
+ fi; \
+ echo "$$col$$br$$std"; \
+ fi; \
+ $$success || exit 1
+
+check-TESTS:
+ @list='$(RECHECK_LOGS)'; test -z "$$list" || rm -f $$list
+ @list='$(RECHECK_LOGS:.log=.trs)'; test -z "$$list" || rm -f $$list
+ @test -z "$(TEST_SUITE_LOG)" || rm -f $(TEST_SUITE_LOG)
+ @set +e; $(am__set_TESTS_bases); \
+ log_list=`for i in $$bases; do echo $$i.log; done`; \
+ trs_list=`for i in $$bases; do echo $$i.trs; done`; \
+ log_list=`echo $$log_list`; trs_list=`echo $$trs_list`; \
+ $(MAKE) $(AM_MAKEFLAGS) $(TEST_SUITE_LOG) TEST_LOGS="$$log_list"; \
+ exit $$?;
+recheck: all
+ @test -z "$(TEST_SUITE_LOG)" || rm -f $(TEST_SUITE_LOG)
+ @set +e; $(am__set_TESTS_bases); \
+ bases=`for i in $$bases; do echo $$i; done \
+ | $(am__list_recheck_tests)` || exit 1; \
+ log_list=`for i in $$bases; do echo $$i.log; done`; \
+ log_list=`echo $$log_list`; \
+ $(MAKE) $(AM_MAKEFLAGS) $(TEST_SUITE_LOG) \
+ am__force_recheck=am--force-recheck \
+ TEST_LOGS="$$log_list"; \
+ exit $$?
+.test.log:
+ @p='$<'; \
+ $(am__set_b); \
+ $(am__check_pre) $(TEST_LOG_DRIVER) --test-name "$$f" \
+ --log-file $$b.log --trs-file $$b.trs \
+ $(am__common_driver_flags) $(AM_TEST_LOG_DRIVER_FLAGS) $(TEST_LOG_DRIVER_FLAGS) -- $(TEST_LOG_COMPILE) \
+ "$$tst" $(AM_TESTS_FD_REDIRECT)
+@am__EXEEXT_TRUE@.test$(EXEEXT).log:
+@am__EXEEXT_TRUE@ @p='$<'; \
+@am__EXEEXT_TRUE@ $(am__set_b); \
+@am__EXEEXT_TRUE@ $(am__check_pre) $(TEST_LOG_DRIVER) --test-name "$$f" \
+@am__EXEEXT_TRUE@ --log-file $$b.log --trs-file $$b.trs \
+@am__EXEEXT_TRUE@ $(am__common_driver_flags) $(AM_TEST_LOG_DRIVER_FLAGS) $(TEST_LOG_DRIVER_FLAGS) -- $(TEST_LOG_COMPILE) \
+@am__EXEEXT_TRUE@ "$$tst" $(AM_TESTS_FD_REDIRECT)
+
+distdir: $(BUILT_SOURCES)
+ $(MAKE) $(AM_MAKEFLAGS) distdir-am
+
+distdir-am: $(DISTFILES)
+ $(am__remove_distdir)
+ test -d "$(distdir)" || mkdir "$(distdir)"
+ @srcdirstrip=`echo "$(srcdir)" | sed 's/[].[^$$\\*]/\\\\&/g'`; \
+ topsrcdirstrip=`echo "$(top_srcdir)" | sed 's/[].[^$$\\*]/\\\\&/g'`; \
+ list='$(DISTFILES)'; \
+ dist_files=`for file in $$list; do echo $$file; done | \
+ sed -e "s|^$$srcdirstrip/||;t" \
+ -e "s|^$$topsrcdirstrip/|$(top_builddir)/|;t"`; \
+ case $$dist_files in \
+ */*) $(MKDIR_P) `echo "$$dist_files" | \
+ sed '/\//!d;s|^|$(distdir)/|;s,/[^/]*$$,,' | \
+ sort -u` ;; \
+ esac; \
+ for file in $$dist_files; do \
+ if test -f $$file || test -d $$file; then d=.; else d=$(srcdir); fi; \
+ if test -d $$d/$$file; then \
+ dir=`echo "/$$file" | sed -e 's,/[^/]*$$,,'`; \
+ if test -d "$(distdir)/$$file"; then \
+ find "$(distdir)/$$file" -type d ! -perm -700 -exec chmod u+rwx {} \;; \
+ fi; \
+ if test -d $(srcdir)/$$file && test $$d != $(srcdir); then \
+ cp -fpR $(srcdir)/$$file "$(distdir)$$dir" || exit 1; \
+ find "$(distdir)/$$file" -type d ! -perm -700 -exec chmod u+rwx {} \;; \
+ fi; \
+ cp -fpR $$d/$$file "$(distdir)$$dir" || exit 1; \
+ else \
+ test -f "$(distdir)/$$file" \
+ || cp -p $$d/$$file "$(distdir)/$$file" \
+ || exit 1; \
+ fi; \
+ done
+ @list='$(DIST_SUBDIRS)'; for subdir in $$list; do \
+ if test "$$subdir" = .; then :; else \
+ $(am__make_dryrun) \
+ || test -d "$(distdir)/$$subdir" \
+ || $(MKDIR_P) "$(distdir)/$$subdir" \
+ || exit 1; \
+ dir1=$$subdir; dir2="$(distdir)/$$subdir"; \
+ $(am__relativize); \
+ new_distdir=$$reldir; \
+ dir1=$$subdir; dir2="$(top_distdir)"; \
+ $(am__relativize); \
+ new_top_distdir=$$reldir; \
+ echo " (cd $$subdir && $(MAKE) $(AM_MAKEFLAGS) top_distdir="$$new_top_distdir" distdir="$$new_distdir" \\"; \
+ echo " am__remove_distdir=: am__skip_length_check=: am__skip_mode_fix=: distdir)"; \
+ ($(am__cd) $$subdir && \
+ $(MAKE) $(AM_MAKEFLAGS) \
+ top_distdir="$$new_top_distdir" \
+ distdir="$$new_distdir" \
+ am__remove_distdir=: \
+ am__skip_length_check=: \
+ am__skip_mode_fix=: \
+ distdir) \
+ || exit 1; \
+ fi; \
+ done
+ $(MAKE) $(AM_MAKEFLAGS) \
+ top_distdir="$(top_distdir)" distdir="$(distdir)" \
+ dist-hook
+ -test -n "$(am__skip_mode_fix)" \
+ || find "$(distdir)" -type d ! -perm -755 \
+ -exec chmod u+rwx,go+rx {} \; -o \
+ ! -type d ! -perm -444 -links 1 -exec chmod a+r {} \; -o \
+ ! -type d ! -perm -400 -exec chmod a+r {} \; -o \
+ ! -type d ! -perm -444 -exec $(install_sh) -c -m a+r {} {} \; \
+ || chmod -R a+r "$(distdir)"
+dist-gzip: distdir
+ tardir=$(distdir) && $(am__tar) | eval GZIP= gzip $(GZIP_ENV) -c >$(distdir).tar.gz
+ $(am__post_remove_distdir)
+
+dist-bzip2: distdir
+ tardir=$(distdir) && $(am__tar) | BZIP2=$${BZIP2--9} bzip2 -c >$(distdir).tar.bz2
+ $(am__post_remove_distdir)
+
+dist-lzip: distdir
+ tardir=$(distdir) && $(am__tar) | lzip -c $${LZIP_OPT--9} >$(distdir).tar.lz
+ $(am__post_remove_distdir)
+
+dist-xz: distdir
+ tardir=$(distdir) && $(am__tar) | XZ_OPT=$${XZ_OPT--e} xz -c >$(distdir).tar.xz
+ $(am__post_remove_distdir)
+
+dist-zstd: distdir
+ tardir=$(distdir) && $(am__tar) | zstd -c $${ZSTD_CLEVEL-$${ZSTD_OPT--19}} >$(distdir).tar.zst
+ $(am__post_remove_distdir)
+
+dist-tarZ: distdir
+ @echo WARNING: "Support for distribution archives compressed with" \
+ "legacy program 'compress' is deprecated." >&2
+ @echo WARNING: "It will be removed altogether in Automake 2.0" >&2
+ tardir=$(distdir) && $(am__tar) | compress -c >$(distdir).tar.Z
+ $(am__post_remove_distdir)
+
+dist-shar: distdir
+ @echo WARNING: "Support for shar distribution archives is" \
+ "deprecated." >&2
+ @echo WARNING: "It will be removed altogether in Automake 2.0" >&2
+ shar $(distdir) | eval GZIP= gzip $(GZIP_ENV) -c >$(distdir).shar.gz
+ $(am__post_remove_distdir)
+
+dist-zip: distdir
+ -rm -f $(distdir).zip
+ zip -rq $(distdir).zip $(distdir)
+ $(am__post_remove_distdir)
+
+dist dist-all:
+ $(MAKE) $(AM_MAKEFLAGS) $(DIST_TARGETS) am__post_remove_distdir='@:'
+ $(am__post_remove_distdir)
+
+# This target untars the dist file and tries a VPATH configuration. Then
+# it guarantees that the distribution is self-contained by making another
+# tarfile.
+distcheck: dist
+ case '$(DIST_ARCHIVES)' in \
+ *.tar.gz*) \
+ eval GZIP= gzip $(GZIP_ENV) -dc $(distdir).tar.gz | $(am__untar) ;;\
+ *.tar.bz2*) \
+ bzip2 -dc $(distdir).tar.bz2 | $(am__untar) ;;\
+ *.tar.lz*) \
+ lzip -dc $(distdir).tar.lz | $(am__untar) ;;\
+ *.tar.xz*) \
+ xz -dc $(distdir).tar.xz | $(am__untar) ;;\
+ *.tar.Z*) \
+ uncompress -c $(distdir).tar.Z | $(am__untar) ;;\
+ *.shar.gz*) \
+ eval GZIP= gzip $(GZIP_ENV) -dc $(distdir).shar.gz | unshar ;;\
+ *.zip*) \
+ unzip $(distdir).zip ;;\
+ *.tar.zst*) \
+ zstd -dc $(distdir).tar.zst | $(am__untar) ;;\
+ esac
+ chmod -R a-w $(distdir)
+ chmod u+w $(distdir)
+ mkdir $(distdir)/_build $(distdir)/_build/sub $(distdir)/_inst
+ chmod a-w $(distdir)
+ test -d $(distdir)/_build || exit 0; \
+ dc_install_base=`$(am__cd) $(distdir)/_inst && pwd | sed -e 's,^[^:\\/]:[\\/],/,'` \
+ && dc_destdir="$${TMPDIR-/tmp}/am-dc-$$$$/" \
+ && am__cwd=`pwd` \
+ && $(am__cd) $(distdir)/_build/sub \
+ && ../../configure \
+ $(AM_DISTCHECK_CONFIGURE_FLAGS) \
+ $(DISTCHECK_CONFIGURE_FLAGS) \
+ --srcdir=../.. --prefix="$$dc_install_base" \
+ && $(MAKE) $(AM_MAKEFLAGS) \
+ && $(MAKE) $(AM_MAKEFLAGS) $(AM_DISTCHECK_DVI_TARGET) \
+ && $(MAKE) $(AM_MAKEFLAGS) check \
+ && $(MAKE) $(AM_MAKEFLAGS) install \
+ && $(MAKE) $(AM_MAKEFLAGS) installcheck \
+ && $(MAKE) $(AM_MAKEFLAGS) uninstall \
+ && $(MAKE) $(AM_MAKEFLAGS) distuninstallcheck_dir="$$dc_install_base" \
+ distuninstallcheck \
+ && chmod -R a-w "$$dc_install_base" \
+ && ({ \
+ (cd ../.. && umask 077 && mkdir "$$dc_destdir") \
+ && $(MAKE) $(AM_MAKEFLAGS) DESTDIR="$$dc_destdir" install \
+ && $(MAKE) $(AM_MAKEFLAGS) DESTDIR="$$dc_destdir" uninstall \
+ && $(MAKE) $(AM_MAKEFLAGS) DESTDIR="$$dc_destdir" \
+ distuninstallcheck_dir="$$dc_destdir" distuninstallcheck; \
+ } || { rm -rf "$$dc_destdir"; exit 1; }) \
+ && rm -rf "$$dc_destdir" \
+ && $(MAKE) $(AM_MAKEFLAGS) dist \
+ && rm -rf $(DIST_ARCHIVES) \
+ && $(MAKE) $(AM_MAKEFLAGS) distcleancheck \
+ && cd "$$am__cwd" \
+ || exit 1
+ $(am__post_remove_distdir)
+ @(echo "$(distdir) archives ready for distribution: "; \
+ list='$(DIST_ARCHIVES)'; for i in $$list; do echo $$i; done) | \
+ sed -e 1h -e 1s/./=/g -e 1p -e 1x -e '$$p' -e '$$x'
+distuninstallcheck:
+ @test -n '$(distuninstallcheck_dir)' || { \
+ echo 'ERROR: trying to run $@ with an empty' \
+ '$$(distuninstallcheck_dir)' >&2; \
+ exit 1; \
+ }; \
+ $(am__cd) '$(distuninstallcheck_dir)' || { \
+ echo 'ERROR: cannot chdir into $(distuninstallcheck_dir)' >&2; \
+ exit 1; \
+ }; \
+ test `$(am__distuninstallcheck_listfiles) | wc -l` -eq 0 \
+ || { echo "ERROR: files left after uninstall:" ; \
+ if test -n "$(DESTDIR)"; then \
+ echo " (check DESTDIR support)"; \
+ fi ; \
+ $(distuninstallcheck_listfiles) ; \
+ exit 1; } >&2
+distcleancheck: distclean
+ @if test '$(srcdir)' = . ; then \
+ echo "ERROR: distcleancheck can only run from a VPATH build" ; \
+ exit 1 ; \
+ fi
+ @test `$(distcleancheck_listfiles) | wc -l` -eq 0 \
+ || { echo "ERROR: files left in build directory after distclean:" ; \
+ $(distcleancheck_listfiles) ; \
+ exit 1; } >&2
+check-am: all-am
+ $(MAKE) $(AM_MAKEFLAGS) check-TESTS
+check: check-recursive
+all-am: Makefile $(PROGRAMS) config.h
+installdirs: installdirs-recursive
+installdirs-am:
+ for dir in "$(DESTDIR)$(bindir)"; do \
+ test -z "$$dir" || $(MKDIR_P) "$$dir"; \
+ done
+install: install-recursive
+install-exec: install-exec-recursive
+install-data: install-data-recursive
+uninstall: uninstall-recursive
+
+install-am: all-am
+ @$(MAKE) $(AM_MAKEFLAGS) install-exec-am install-data-am
+
+installcheck: installcheck-recursive
+install-strip:
+ if test -z '$(STRIP)'; then \
+ $(MAKE) $(AM_MAKEFLAGS) INSTALL_PROGRAM="$(INSTALL_STRIP_PROGRAM)" \
+ install_sh_PROGRAM="$(INSTALL_STRIP_PROGRAM)" INSTALL_STRIP_FLAG=-s \
+ install; \
+ else \
+ $(MAKE) $(AM_MAKEFLAGS) INSTALL_PROGRAM="$(INSTALL_STRIP_PROGRAM)" \
+ install_sh_PROGRAM="$(INSTALL_STRIP_PROGRAM)" INSTALL_STRIP_FLAG=-s \
+ "INSTALL_PROGRAM_ENV=STRIPPROG='$(STRIP)'" install; \
+ fi
+mostlyclean-generic:
+ -test -z "$(TEST_LOGS)" || rm -f $(TEST_LOGS)
+ -test -z "$(TEST_LOGS:.log=.trs)" || rm -f $(TEST_LOGS:.log=.trs)
+ -test -z "$(TEST_SUITE_LOG)" || rm -f $(TEST_SUITE_LOG)
+
+clean-generic:
+ -test -z "$(CLEANFILES)" || rm -f $(CLEANFILES)
+
+distclean-generic:
+ -test -z "$(CONFIG_CLEAN_FILES)" || rm -f $(CONFIG_CLEAN_FILES)
+ -test . = "$(srcdir)" || test -z "$(CONFIG_CLEAN_VPATH_FILES)" || rm -f $(CONFIG_CLEAN_VPATH_FILES)
+ -rm -f @DVIPNG_TREE@/$(DEPDIR)/$(am__dirstamp)
+ -rm -f @DVIPNG_TREE@/$(am__dirstamp)
+ -test -z "$(DISTCLEANFILES)" || rm -f $(DISTCLEANFILES)
+
+maintainer-clean-generic:
+ @echo "This command is intended for maintainers to use"
+ @echo "it deletes files that may require special tools to rebuild."
+@WIN32_TRUE@install-exec-hook:
+@have_gif_FALSE@install-exec-hook:
+@WIN32_TRUE@uninstall-hook:
+@have_gif_FALSE@uninstall-hook:
+clean: clean-recursive
+
+clean-am: clean-binPROGRAMS clean-generic clean-libtool mostlyclean-am
+
+distclean: distclean-recursive
+ -rm -f $(am__CONFIG_DISTCLEAN_FILES)
+ -rm -f ./$(DEPDIR)/dvigif-callexe.Po
+ -rm -f @DVIPNG_TREE@/$(DEPDIR)/color.Po
+ -rm -f @DVIPNG_TREE@/$(DEPDIR)/draw.Po
+ -rm -f @DVIPNG_TREE@/$(DEPDIR)/dvi.Po
+ -rm -f @DVIPNG_TREE@/$(DEPDIR)/dvipng.Po
+ -rm -f @DVIPNG_TREE@/$(DEPDIR)/enc.Po
+ -rm -f @DVIPNG_TREE@/$(DEPDIR)/font.Po
+ -rm -f @DVIPNG_TREE@/$(DEPDIR)/fontmap.Po
+ -rm -f @DVIPNG_TREE@/$(DEPDIR)/ft.Po
+ -rm -f @DVIPNG_TREE@/$(DEPDIR)/misc.Po
+ -rm -f @DVIPNG_TREE@/$(DEPDIR)/papersiz.Po
+ -rm -f @DVIPNG_TREE@/$(DEPDIR)/pk.Po
+ -rm -f @DVIPNG_TREE@/$(DEPDIR)/ppagelist.Po
+ -rm -f @DVIPNG_TREE@/$(DEPDIR)/set.Po
+ -rm -f @DVIPNG_TREE@/$(DEPDIR)/sfd.Po
+ -rm -f @DVIPNG_TREE@/$(DEPDIR)/special.Po
+ -rm -f @DVIPNG_TREE@/$(DEPDIR)/tfm.Po
+ -rm -f @DVIPNG_TREE@/$(DEPDIR)/vf.Po
+ -rm -f Makefile
+distclean-am: clean-am distclean-compile distclean-generic \
+ distclean-hdr distclean-libtool distclean-tags
+
+dvi: dvi-recursive
+
+dvi-am:
+
+html: html-recursive
+
+html-am:
+
+info: info-recursive
+
+info-am:
+
+install-data-am:
+
+install-dvi: install-dvi-recursive
+
+install-dvi-am:
+
+install-exec-am: install-binPROGRAMS
+ @$(NORMAL_INSTALL)
+ $(MAKE) $(AM_MAKEFLAGS) install-exec-hook
+install-html: install-html-recursive
+
+install-html-am:
+
+install-info: install-info-recursive
+
+install-info-am:
+
+install-man:
+
+install-pdf: install-pdf-recursive
+
+install-pdf-am:
+
+install-ps: install-ps-recursive
+
+install-ps-am:
+
+installcheck-am:
+
+maintainer-clean: maintainer-clean-recursive
+ -rm -f $(am__CONFIG_DISTCLEAN_FILES)
+ -rm -rf $(top_srcdir)/autom4te.cache
+ -rm -f ./$(DEPDIR)/dvigif-callexe.Po
+ -rm -f @DVIPNG_TREE@/$(DEPDIR)/color.Po
+ -rm -f @DVIPNG_TREE@/$(DEPDIR)/draw.Po
+ -rm -f @DVIPNG_TREE@/$(DEPDIR)/dvi.Po
+ -rm -f @DVIPNG_TREE@/$(DEPDIR)/dvipng.Po
+ -rm -f @DVIPNG_TREE@/$(DEPDIR)/enc.Po
+ -rm -f @DVIPNG_TREE@/$(DEPDIR)/font.Po
+ -rm -f @DVIPNG_TREE@/$(DEPDIR)/fontmap.Po
+ -rm -f @DVIPNG_TREE@/$(DEPDIR)/ft.Po
+ -rm -f @DVIPNG_TREE@/$(DEPDIR)/misc.Po
+ -rm -f @DVIPNG_TREE@/$(DEPDIR)/papersiz.Po
+ -rm -f @DVIPNG_TREE@/$(DEPDIR)/pk.Po
+ -rm -f @DVIPNG_TREE@/$(DEPDIR)/ppagelist.Po
+ -rm -f @DVIPNG_TREE@/$(DEPDIR)/set.Po
+ -rm -f @DVIPNG_TREE@/$(DEPDIR)/sfd.Po
+ -rm -f @DVIPNG_TREE@/$(DEPDIR)/special.Po
+ -rm -f @DVIPNG_TREE@/$(DEPDIR)/tfm.Po
+ -rm -f @DVIPNG_TREE@/$(DEPDIR)/vf.Po
+ -rm -f Makefile
+maintainer-clean-am: distclean-am maintainer-clean-generic
+
+mostlyclean: mostlyclean-recursive
+
+mostlyclean-am: mostlyclean-compile mostlyclean-generic \
+ mostlyclean-libtool
+
+pdf: pdf-recursive
+
+pdf-am:
+
+ps: ps-recursive
+
+ps-am:
+
+uninstall-am: uninstall-binPROGRAMS
+ @$(NORMAL_INSTALL)
+ $(MAKE) $(AM_MAKEFLAGS) uninstall-hook
+.MAKE: $(am__recursive_targets) all check-am install-am \
+ install-exec-am install-strip uninstall-am
+
+.PHONY: $(am__recursive_targets) CTAGS GTAGS TAGS all all-am \
+ am--depfiles am--refresh check check-TESTS check-am clean \
+ clean-binPROGRAMS clean-cscope clean-generic clean-libtool \
+ cscope cscopelist-am ctags ctags-am dist dist-all dist-bzip2 \
+ dist-gzip dist-hook dist-lzip dist-shar dist-tarZ dist-xz \
+ dist-zip dist-zstd distcheck distclean distclean-compile \
+ distclean-generic distclean-hdr distclean-libtool \
+ distclean-tags distcleancheck distdir distuninstallcheck dvi \
+ dvi-am html html-am info info-am install install-am \
+ install-binPROGRAMS install-data install-data-am install-dvi \
+ install-dvi-am install-exec install-exec-am install-exec-hook \
+ install-html install-html-am install-info install-info-am \
+ install-man install-pdf install-pdf-am install-ps \
+ install-ps-am install-strip installcheck installcheck-am \
+ installdirs installdirs-am maintainer-clean \
+ maintainer-clean-generic mostlyclean mostlyclean-compile \
+ mostlyclean-generic mostlyclean-libtool pdf pdf-am ps ps-am \
+ recheck tags tags-am uninstall uninstall-am \
+ uninstall-binPROGRAMS uninstall-hook
+
+.PRECIOUS: Makefile
+
+dist-hook:
+ cd "$(distdir)" && rm -rf $(NEVER_DIST)
+
+$(dvipng_OBJECTS): config.force
+
+config.force: $(dvipng_dependencies)
+ echo timestamp >config.force
+ $(SHELL) ./config.status --recheck
+ $(SHELL) ./config.status Makefile config.h
+
+@KPATHSEA_RULE@
+@GD_RULE@
+@FREETYPE2_RULE@
+@LIBPNG_RULE@
+
+.PHONY: install-bin-links uninstall-bin-links
+
+install-bin-links:
+@WIN32_FALSE@ $(MKDIR_P) $(DESTDIR)$(bindir)
+@WIN32_FALSE@ @cd $(DESTDIR)$(bindir) && \
+@WIN32_FALSE@ for s in $(bin_links); do \
+@WIN32_FALSE@ link=`echo $$s | sed 's,.*:,,'`; \
+@WIN32_FALSE@ file=`echo $$s | sed 's,:.*,,'`; \
+@WIN32_FALSE@ rm -f $$link; \
+@WIN32_FALSE@ echo "creating link '$$link' -> '$$file'"; \
+@WIN32_FALSE@ $(LN_S) $$file $$link || exit 1; \
+@WIN32_FALSE@ done
+
+uninstall-bin-links:
+@WIN32_FALSE@ @for s in $(bin_links); do \
+@WIN32_FALSE@ link=`echo $$s | sed 's,.*:,,'`; \
+@WIN32_FALSE@ rm -f $(DESTDIR)$(bindir)/$$link; \
+@WIN32_FALSE@ done
+@WIN32_FALSE@@have_gif_TRUE@install-exec-hook: install-bin-links
+@WIN32_FALSE@@have_gif_TRUE@uninstall-hook: uninstall-bin-links
+dvipng.log: dvipng$(EXEEXT)
+
+# Tell versions [3.59,3.63) of GNU make to not export all variables.
+# Otherwise a system limit (for SysV at least) may be exceeded.
+.NOEXPORT:
diff --git a/Build/source/texk/dvipng/TLpatches/ChangeLog b/Build/source/texk/dvipng/TLpatches/ChangeLog
new file mode 100644
index 00000000000..33072606fa8
--- /dev/null
+++ b/Build/source/texk/dvipng/TLpatches/ChangeLog
@@ -0,0 +1,142 @@
+2020-01-06 Akira Kakuto <kakuto@w32tex.org>
+
+ Import dvipng-1.17.
+ * patch-08-win32: add to support non-ascii image file names
+ on Windows (Windows only).
+
+2019-04-07 Karl Berry <karl@freefriends.org>
+
+ * patch-02-const,
+ * patch-03-programname,
+ * patch-06-WIN32,
+ * patch-07-w64-ptr: remove; all patches were installed in 1.16.
+
+2015-03-04 Peter Breitenlohner <peb@mppmu.mpg.de>
+
+ * patch-07-w64-ptr: Better handling of WIN64 ptr->long.
+
+2015-03-03 Peter Breitenlohner <peb@mppmu.mpg.de>
+
+ * Imported release 1.15 from savannah.nongnu.org.
+ * patch-01-gd-copyright: Removed.
+ * patch-05-sys_wait (removed): Included in 1.15.
+ * patch-02-const, patch-03-programname, patch-06-WIN32,
+ patch-07-w64-ptr: Adapted.
+
+2014-11-05 Peter Breitenlohner <peb@mppmu.mpg.de>
+
+ * patch-07-w64-ptr: Fixed a typo.
+
+2014-07-15 Peter Breitenlohner <peb@mppmu.mpg.de>
+
+ * patch-07-w64-ptr: Avoid WIN64 warning due to different size.
+
+2013-07-09 Peter Breitenlohner <peb@mppmu.mpg.de>
+
+ * COPYING.gd (new): From libgd-2.1.0/COPYING, with '@' => '@@'.
+ * patch-01-gd-copyright: Refer to COPYING.gd instead of
+ including it into dvipng.texi.
+
+ * patch-04-dvigif (removed): Merged into patch-03-programname.
+ * patch-03-programname: Use kpse_program_basename().
+
+2012-08-25 Peter Breitenlohner <peb@mppmu.mpg.de>
+
+ * patch-06-WIN32: Avoid warning when redefining pipe.
+
+2012-08-01 Peter Breitenlohner <peb@mppmu.mpg.de>
+
+ * patch-06-WIN32: Do not redefine snprintf, handled by kpathsea.
+ Also, kpathsea has included <fcntl.h>, <io.h>, and <process.h>.
+
+2011-08-03 Peter Breitenlohner <peb@mppmu.mpg.de>
+
+ * patch-06-WIN32 (new): Call texlive_gs_init() for MINGW32,
+ as for native WIN32, from Akira.
+
+2011-02-07 Peter Breitenlohner <peb@mppmu.mpg.de>
+
+ * patch-05-sys_wait (new): #include <sys/wait.h>, not <wait.h>.
+ Reported by Nikola Lecic <nikola.lecic@anthesphoria.net>.
+
+2010-12-30 Peter Breitenlohner <peb@mppmu.mpg.de>
+
+ * patch-03-programname (new): Use basename() as defined in
+ <libgen.h> or xbasename() from kpathsea to extract programname
+ from argv[0]. Avoid uninitialized use of programname.
+
+ * patch-04-dvigif (new): Check for argv[0] with .exe via
+ strcasecmp(), if possible.
+
+2010-12-15 Peter Breitenlohner <peb@mppmu.mpg.de>
+
+ * Imported release 1.14 from savannah.nongnu.org.
+ * patch-2?-* (removed): Included in 1.14.
+
+ * patch-01-gd-copyright (new): Include full gd copyright notice
+ into dvipng.texi; seems the safe thing to do.
+
+ * patch-02-const (new): Avoid compiler warnings.
+
+2010-10-02 Peter Breitenlohner <peb@mppmu.mpg.de>
+
+ * patch-22-win32-bugfix (new): WIN32 bug fix from Akira Kakuto.
+
+2010-03-18 Peter Breitenlohner <peb@mppmu.mpg.de>
+
+ * Imported release 1.13 from savannah.nongnu.org.
+ * patch-[01]?-* (removed): Included in 1.13.
+
+ * patch-20-rpl_malloc (new): Avoid implicit decl of malloc().
+ * patch-21-win32 (new): Avoid unnecessary warning in WIN32 code.
+
+2010-03-09 Peter Breitenlohner <peb@mppmu.mpg.de>
+
+ * patch-12-set_program_name: Replace kpse_set_progname() by
+ kpse_set_program_name().
+
+2010-02-24 Peter Breitenlohner <peb@mppmu.mpg.de>
+
+ * patch-10-mmap-for-WIN32 (new): Former MIKTEX code for mmap
+ from Fabrice Popineau (?) now used for all WIN32 variants.
+ * patch-11-win32-fork-and-pipe (new): WIN32 specific replacement
+ for fork and pipe, using code from Akira Kakuto.
+
+2010-02-21 Peter Breitenlohner <peb@mppmu.mpg.de>
+
+ * patch-07-always-undef (new): Always undefine min/max before
+ redefining them (for MinGW32).
+ * patch-08-HAVE_MMAP (new): #include <sys/mman.h> only
+ #if defined(HAVE_MMAP) (for MinGW32).
+ * patch-09-sleep (new): Use Sleep and #include <stdlib.h>
+ (for WIN32/MinGW32).
+
+2010-01-29 Karl Berry <karl@tug.org>
+
+ * patch-06-mathptmx (new): Do not use \usepackage{mathptmx}
+ in test_dvipng.tex.
+
+2009-06-12 Peter Breitenlohner <peb@mppmu.mpg.de>
+
+ * patch-05-warnings (new): Avoid more compiler warnings.
+
+2009-06-09 Peter Breitenlohner <peb@mppmu.mpg.de>
+
+ * patch-04-static (new): Avoid warnings when compiling with
+ 'gcc --Wmissing-prototypes'.
+
+2009-02-22 Peter Breitenlohner <peb@mppmu.mpg.de>
+
+ * patch-03-have-ft2 (new): Bug fix - skip FT2 code when
+ compiling without FT2 library.
+
+2009-03-25 Peter Breitenlohner <peb@mppmu.mpg.de>
+
+ * patch-02-use-ifdef (new): Use #ifdef instead of #if to avoid
+ preprocessor warnings.
+
+2009-03-24 Peter Breitenlohner <peb@mppmu.mpg.de>
+
+ * patch-01-portability (new): Portability fix - put variable
+ declarations at the beginning of the block.
+
diff --git a/Build/source/texk/dvipng/TLpatches/TL-Changes b/Build/source/texk/dvipng/TLpatches/TL-Changes
new file mode 100644
index 00000000000..54d548f4d8b
--- /dev/null
+++ b/Build/source/texk/dvipng/TLpatches/TL-Changes
@@ -0,0 +1,18 @@
+Changes applied to the dvipng-1.17 tree as obtained from:
+ http://mirror.ctan.org/dviware/dvipng/
+
+Removed:
+ configure
+ config.h
+ install-sh
+ mkinstalldirs
+
+Created Autoconf macro files ../m4/gs-device.m4 and ../m4/makeinfo.m4
+ adapting code in aclocal.m4.
+
+Copied these files to ../doc/:
+ dvipng.1
+ dvipng.texi
+ install.texi
+ macros.texi
+ readme.texi
diff --git a/Build/source/texk/dvipng/TLpatches/patch-08-win32 b/Build/source/texk/dvipng/TLpatches/patch-08-win32
new file mode 100644
index 00000000000..eb820419d79
--- /dev/null
+++ b/Build/source/texk/dvipng/TLpatches/patch-08-win32
@@ -0,0 +1,28 @@
+--- special.c.orig Fri Aug 31 16:39:04 2018
++++ special.c Mon Jan 06 18:53:34 2020
+@@ -492,6 +492,25 @@
+
+ PSCodeInit(&image, NULL);
+ image.filename=kpse_find_file(psname,kpse_pict_format,0);
++#if !defined(MIKTEX) && defined(WIN32)
++ if (image.filename == NULL) {
++ wchar_t *wnam;
++ char *tmpnam;
++ int tmpcp;
++ tmpcp = file_system_codepage;
++ file_system_codepage = CP_UTF8;
++ tmpnam = kpse_find_file(psname,kpse_pict_format,0);
++ if (tmpnam) {
++ wnam = get_wstring_from_mbstring(CP_UTF8, tmpnam, wnam=NULL);
++ if (wnam) {
++ image.filename = get_mbstring_from_wstring(tmpcp, wnam, image.filename=NULL);
++ free(wnam);
++ }
++ free(tmpnam);
++ }
++ file_system_codepage = tmpcp;
++ }
++#endif
+ if (MmapFile(image.filename,&(image.fmmap)) || image.fmmap.size==0) {
+ Warning("Image file %s unusable, image will be left blank",
+ image.filename);
diff --git a/Build/source/texk/dvipng/ac/dvipng.ac b/Build/source/texk/dvipng/ac/dvipng.ac
new file mode 100644
index 00000000000..27d4bf31525
--- /dev/null
+++ b/Build/source/texk/dvipng/ac/dvipng.ac
@@ -0,0 +1,18 @@
+## texk/dvipng/ac/dvipng.ac: configure.ac fragment for the TeX Live subdirectory texk/dvipng/
+dnl
+dnl Copyright (C) 2009 Peter Breitenlohner <tex-live@tug.org>
+dnl You may freely use, modify and/or distribute this file.
+dnl
+## configure options for dvipng
+m4_define_default([kpse_indent_26], [26])[]dnl
+AC_ARG_ENABLE([debug],
+ AC_HELP_STRING([--disable-debug],
+ [Compile without debug (-d) option],
+ kpse_indent_26))
+AC_ARG_ENABLE([timing],
+ AC_HELP_STRING([--enable-timing],
+ [Output execution time of dvipng],
+ kpse_indent_26))
+AC_ARG_WITH([gs],
+ AC_HELP_STRING([--with-gs=/PATH/TO/gs],
+ [Hard-wire the location of GhostScript]))
diff --git a/Build/source/texk/dvipng/ac/withenable.ac b/Build/source/texk/dvipng/ac/withenable.ac
new file mode 100644
index 00000000000..c29e49af72f
--- /dev/null
+++ b/Build/source/texk/dvipng/ac/withenable.ac
@@ -0,0 +1,8 @@
+## texk/dvipng/ac/withenable.ac: configure.ac fragment for the TeX Live subdirectory texk/dvipng/
+dnl
+dnl Copyright (C) 2009-2013 Peter Breitenlohner <tex-live@tug.org>
+dnl You may freely use, modify and/or distribute this file.
+dnl
+## configure options and TL libraries required for dvipng
+KPSE_ENABLE_PROG([dvipng], [kpathsea gd])
+m4_include(kpse_TL[texk/dvipng/ac/dvipng.ac])
diff --git a/Build/source/texk/dvipng/aclocal.m4 b/Build/source/texk/dvipng/aclocal.m4
new file mode 100644
index 00000000000..b56ed915a72
--- /dev/null
+++ b/Build/source/texk/dvipng/aclocal.m4
@@ -0,0 +1,1220 @@
+# generated automatically by aclocal 1.16.3 -*- Autoconf -*-
+
+# Copyright (C) 1996-2020 Free Software Foundation, Inc.
+
+# This file is free software; the Free Software Foundation
+# gives unlimited permission to copy and/or distribute it,
+# with or without modifications, as long as this notice is preserved.
+
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY, to the extent permitted by law; without
+# even the implied warranty of MERCHANTABILITY or FITNESS FOR A
+# PARTICULAR PURPOSE.
+
+m4_ifndef([AC_CONFIG_MACRO_DIRS], [m4_defun([_AM_CONFIG_MACRO_DIRS], [])m4_defun([AC_CONFIG_MACRO_DIRS], [_AM_CONFIG_MACRO_DIRS($@)])])
+m4_ifndef([AC_AUTOCONF_VERSION],
+ [m4_copy([m4_PACKAGE_VERSION], [AC_AUTOCONF_VERSION])])dnl
+m4_if(m4_defn([AC_AUTOCONF_VERSION]), [2.69],,
+[m4_warning([this file was generated for autoconf 2.69.
+You have another version of autoconf. It may work, but is not guaranteed to.
+If you have problems, you may need to regenerate the build system entirely.
+To do so, use the procedure documented by the package, typically 'autoreconf'.])])
+
+# Copyright (C) 2002-2020 Free Software Foundation, Inc.
+#
+# This file is free software; the Free Software Foundation
+# gives unlimited permission to copy and/or distribute it,
+# with or without modifications, as long as this notice is preserved.
+
+# AM_AUTOMAKE_VERSION(VERSION)
+# ----------------------------
+# Automake X.Y traces this macro to ensure aclocal.m4 has been
+# generated from the m4 files accompanying Automake X.Y.
+# (This private macro should not be called outside this file.)
+AC_DEFUN([AM_AUTOMAKE_VERSION],
+[am__api_version='1.16'
+dnl Some users find AM_AUTOMAKE_VERSION and mistake it for a way to
+dnl require some minimum version. Point them to the right macro.
+m4_if([$1], [1.16.3], [],
+ [AC_FATAL([Do not call $0, use AM_INIT_AUTOMAKE([$1]).])])dnl
+])
+
+# _AM_AUTOCONF_VERSION(VERSION)
+# -----------------------------
+# aclocal traces this macro to find the Autoconf version.
+# This is a private macro too. Using m4_define simplifies
+# the logic in aclocal, which can simply ignore this definition.
+m4_define([_AM_AUTOCONF_VERSION], [])
+
+# AM_SET_CURRENT_AUTOMAKE_VERSION
+# -------------------------------
+# Call AM_AUTOMAKE_VERSION and AM_AUTOMAKE_VERSION so they can be traced.
+# This function is AC_REQUIREd by AM_INIT_AUTOMAKE.
+AC_DEFUN([AM_SET_CURRENT_AUTOMAKE_VERSION],
+[AM_AUTOMAKE_VERSION([1.16.3])dnl
+m4_ifndef([AC_AUTOCONF_VERSION],
+ [m4_copy([m4_PACKAGE_VERSION], [AC_AUTOCONF_VERSION])])dnl
+_AM_AUTOCONF_VERSION(m4_defn([AC_AUTOCONF_VERSION]))])
+
+# AM_AUX_DIR_EXPAND -*- Autoconf -*-
+
+# Copyright (C) 2001-2020 Free Software Foundation, Inc.
+#
+# This file is free software; the Free Software Foundation
+# gives unlimited permission to copy and/or distribute it,
+# with or without modifications, as long as this notice is preserved.
+
+# For projects using AC_CONFIG_AUX_DIR([foo]), Autoconf sets
+# $ac_aux_dir to '$srcdir/foo'. In other projects, it is set to
+# '$srcdir', '$srcdir/..', or '$srcdir/../..'.
+#
+# Of course, Automake must honor this variable whenever it calls a
+# tool from the auxiliary directory. The problem is that $srcdir (and
+# therefore $ac_aux_dir as well) can be either absolute or relative,
+# depending on how configure is run. This is pretty annoying, since
+# it makes $ac_aux_dir quite unusable in subdirectories: in the top
+# source directory, any form will work fine, but in subdirectories a
+# relative path needs to be adjusted first.
+#
+# $ac_aux_dir/missing
+# fails when called from a subdirectory if $ac_aux_dir is relative
+# $top_srcdir/$ac_aux_dir/missing
+# fails if $ac_aux_dir is absolute,
+# fails when called from a subdirectory in a VPATH build with
+# a relative $ac_aux_dir
+#
+# The reason of the latter failure is that $top_srcdir and $ac_aux_dir
+# are both prefixed by $srcdir. In an in-source build this is usually
+# harmless because $srcdir is '.', but things will broke when you
+# start a VPATH build or use an absolute $srcdir.
+#
+# So we could use something similar to $top_srcdir/$ac_aux_dir/missing,
+# iff we strip the leading $srcdir from $ac_aux_dir. That would be:
+# am_aux_dir='\$(top_srcdir)/'`expr "$ac_aux_dir" : "$srcdir//*\(.*\)"`
+# and then we would define $MISSING as
+# MISSING="\${SHELL} $am_aux_dir/missing"
+# This will work as long as MISSING is not called from configure, because
+# unfortunately $(top_srcdir) has no meaning in configure.
+# However there are other variables, like CC, which are often used in
+# configure, and could therefore not use this "fixed" $ac_aux_dir.
+#
+# Another solution, used here, is to always expand $ac_aux_dir to an
+# absolute PATH. The drawback is that using absolute paths prevent a
+# configured tree to be moved without reconfiguration.
+
+AC_DEFUN([AM_AUX_DIR_EXPAND],
+[AC_REQUIRE([AC_CONFIG_AUX_DIR_DEFAULT])dnl
+# Expand $ac_aux_dir to an absolute path.
+am_aux_dir=`cd "$ac_aux_dir" && pwd`
+])
+
+# AM_COND_IF -*- Autoconf -*-
+
+# Copyright (C) 2008-2020 Free Software Foundation, Inc.
+#
+# This file is free software; the Free Software Foundation
+# gives unlimited permission to copy and/or distribute it,
+# with or without modifications, as long as this notice is preserved.
+
+# _AM_COND_IF
+# _AM_COND_ELSE
+# _AM_COND_ENDIF
+# --------------
+# These macros are only used for tracing.
+m4_define([_AM_COND_IF])
+m4_define([_AM_COND_ELSE])
+m4_define([_AM_COND_ENDIF])
+
+# AM_COND_IF(COND, [IF-TRUE], [IF-FALSE])
+# ---------------------------------------
+# If the shell condition COND is true, execute IF-TRUE, otherwise execute
+# IF-FALSE. Allow automake to learn about conditional instantiating macros
+# (the AC_CONFIG_FOOS).
+AC_DEFUN([AM_COND_IF],
+[m4_ifndef([_AM_COND_VALUE_$1],
+ [m4_fatal([$0: no such condition "$1"])])dnl
+_AM_COND_IF([$1])dnl
+if test -z "$$1_TRUE"; then :
+ m4_n([$2])[]dnl
+m4_ifval([$3],
+[_AM_COND_ELSE([$1])dnl
+else
+ $3
+])dnl
+_AM_COND_ENDIF([$1])dnl
+fi[]dnl
+])
+
+# AM_CONDITIONAL -*- Autoconf -*-
+
+# Copyright (C) 1997-2020 Free Software Foundation, Inc.
+#
+# This file is free software; the Free Software Foundation
+# gives unlimited permission to copy and/or distribute it,
+# with or without modifications, as long as this notice is preserved.
+
+# AM_CONDITIONAL(NAME, SHELL-CONDITION)
+# -------------------------------------
+# Define a conditional.
+AC_DEFUN([AM_CONDITIONAL],
+[AC_PREREQ([2.52])dnl
+ m4_if([$1], [TRUE], [AC_FATAL([$0: invalid condition: $1])],
+ [$1], [FALSE], [AC_FATAL([$0: invalid condition: $1])])dnl
+AC_SUBST([$1_TRUE])dnl
+AC_SUBST([$1_FALSE])dnl
+_AM_SUBST_NOTMAKE([$1_TRUE])dnl
+_AM_SUBST_NOTMAKE([$1_FALSE])dnl
+m4_define([_AM_COND_VALUE_$1], [$2])dnl
+if $2; then
+ $1_TRUE=
+ $1_FALSE='#'
+else
+ $1_TRUE='#'
+ $1_FALSE=
+fi
+AC_CONFIG_COMMANDS_PRE(
+[if test -z "${$1_TRUE}" && test -z "${$1_FALSE}"; then
+ AC_MSG_ERROR([[conditional "$1" was never defined.
+Usually this means the macro was only invoked conditionally.]])
+fi])])
+
+# Copyright (C) 1999-2020 Free Software Foundation, Inc.
+#
+# This file is free software; the Free Software Foundation
+# gives unlimited permission to copy and/or distribute it,
+# with or without modifications, as long as this notice is preserved.
+
+
+# There are a few dirty hacks below to avoid letting 'AC_PROG_CC' be
+# written in clear, in which case automake, when reading aclocal.m4,
+# will think it sees a *use*, and therefore will trigger all it's
+# C support machinery. Also note that it means that autoscan, seeing
+# CC etc. in the Makefile, will ask for an AC_PROG_CC use...
+
+
+# _AM_DEPENDENCIES(NAME)
+# ----------------------
+# See how the compiler implements dependency checking.
+# NAME is "CC", "CXX", "OBJC", "OBJCXX", "UPC", or "GJC".
+# We try a few techniques and use that to set a single cache variable.
+#
+# We don't AC_REQUIRE the corresponding AC_PROG_CC since the latter was
+# modified to invoke _AM_DEPENDENCIES(CC); we would have a circular
+# dependency, and given that the user is not expected to run this macro,
+# just rely on AC_PROG_CC.
+AC_DEFUN([_AM_DEPENDENCIES],
+[AC_REQUIRE([AM_SET_DEPDIR])dnl
+AC_REQUIRE([AM_OUTPUT_DEPENDENCY_COMMANDS])dnl
+AC_REQUIRE([AM_MAKE_INCLUDE])dnl
+AC_REQUIRE([AM_DEP_TRACK])dnl
+
+m4_if([$1], [CC], [depcc="$CC" am_compiler_list=],
+ [$1], [CXX], [depcc="$CXX" am_compiler_list=],
+ [$1], [OBJC], [depcc="$OBJC" am_compiler_list='gcc3 gcc'],
+ [$1], [OBJCXX], [depcc="$OBJCXX" am_compiler_list='gcc3 gcc'],
+ [$1], [UPC], [depcc="$UPC" am_compiler_list=],
+ [$1], [GCJ], [depcc="$GCJ" am_compiler_list='gcc3 gcc'],
+ [depcc="$$1" am_compiler_list=])
+
+AC_CACHE_CHECK([dependency style of $depcc],
+ [am_cv_$1_dependencies_compiler_type],
+[if test -z "$AMDEP_TRUE" && test -f "$am_depcomp"; then
+ # We make a subdir and do the tests there. Otherwise we can end up
+ # making bogus files that we don't know about and never remove. For
+ # instance it was reported that on HP-UX the gcc test will end up
+ # making a dummy file named 'D' -- because '-MD' means "put the output
+ # in D".
+ rm -rf conftest.dir
+ mkdir conftest.dir
+ # Copy depcomp to subdir because otherwise we won't find it if we're
+ # using a relative directory.
+ cp "$am_depcomp" conftest.dir
+ cd conftest.dir
+ # We will build objects and dependencies in a subdirectory because
+ # it helps to detect inapplicable dependency modes. For instance
+ # both Tru64's cc and ICC support -MD to output dependencies as a
+ # side effect of compilation, but ICC will put the dependencies in
+ # the current directory while Tru64 will put them in the object
+ # directory.
+ mkdir sub
+
+ am_cv_$1_dependencies_compiler_type=none
+ if test "$am_compiler_list" = ""; then
+ am_compiler_list=`sed -n ['s/^#*\([a-zA-Z0-9]*\))$/\1/p'] < ./depcomp`
+ fi
+ am__universal=false
+ m4_case([$1], [CC],
+ [case " $depcc " in #(
+ *\ -arch\ *\ -arch\ *) am__universal=true ;;
+ esac],
+ [CXX],
+ [case " $depcc " in #(
+ *\ -arch\ *\ -arch\ *) am__universal=true ;;
+ esac])
+
+ for depmode in $am_compiler_list; do
+ # Setup a source with many dependencies, because some compilers
+ # like to wrap large dependency lists on column 80 (with \), and
+ # we should not choose a depcomp mode which is confused by this.
+ #
+ # We need to recreate these files for each test, as the compiler may
+ # overwrite some of them when testing with obscure command lines.
+ # This happens at least with the AIX C compiler.
+ : > sub/conftest.c
+ for i in 1 2 3 4 5 6; do
+ echo '#include "conftst'$i'.h"' >> sub/conftest.c
+ # Using ": > sub/conftst$i.h" creates only sub/conftst1.h with
+ # Solaris 10 /bin/sh.
+ echo '/* dummy */' > sub/conftst$i.h
+ done
+ echo "${am__include} ${am__quote}sub/conftest.Po${am__quote}" > confmf
+
+ # We check with '-c' and '-o' for the sake of the "dashmstdout"
+ # mode. It turns out that the SunPro C++ compiler does not properly
+ # handle '-M -o', and we need to detect this. Also, some Intel
+ # versions had trouble with output in subdirs.
+ am__obj=sub/conftest.${OBJEXT-o}
+ am__minus_obj="-o $am__obj"
+ case $depmode in
+ gcc)
+ # This depmode causes a compiler race in universal mode.
+ test "$am__universal" = false || continue
+ ;;
+ nosideeffect)
+ # After this tag, mechanisms are not by side-effect, so they'll
+ # only be used when explicitly requested.
+ if test "x$enable_dependency_tracking" = xyes; then
+ continue
+ else
+ break
+ fi
+ ;;
+ msvc7 | msvc7msys | msvisualcpp | msvcmsys)
+ # This compiler won't grok '-c -o', but also, the minuso test has
+ # not run yet. These depmodes are late enough in the game, and
+ # so weak that their functioning should not be impacted.
+ am__obj=conftest.${OBJEXT-o}
+ am__minus_obj=
+ ;;
+ none) break ;;
+ esac
+ if depmode=$depmode \
+ source=sub/conftest.c object=$am__obj \
+ depfile=sub/conftest.Po tmpdepfile=sub/conftest.TPo \
+ $SHELL ./depcomp $depcc -c $am__minus_obj sub/conftest.c \
+ >/dev/null 2>conftest.err &&
+ grep sub/conftst1.h sub/conftest.Po > /dev/null 2>&1 &&
+ grep sub/conftst6.h sub/conftest.Po > /dev/null 2>&1 &&
+ grep $am__obj sub/conftest.Po > /dev/null 2>&1 &&
+ ${MAKE-make} -s -f confmf > /dev/null 2>&1; then
+ # icc doesn't choke on unknown options, it will just issue warnings
+ # or remarks (even with -Werror). So we grep stderr for any message
+ # that says an option was ignored or not supported.
+ # When given -MP, icc 7.0 and 7.1 complain thusly:
+ # icc: Command line warning: ignoring option '-M'; no argument required
+ # The diagnosis changed in icc 8.0:
+ # icc: Command line remark: option '-MP' not supported
+ if (grep 'ignoring option' conftest.err ||
+ grep 'not supported' conftest.err) >/dev/null 2>&1; then :; else
+ am_cv_$1_dependencies_compiler_type=$depmode
+ break
+ fi
+ fi
+ done
+
+ cd ..
+ rm -rf conftest.dir
+else
+ am_cv_$1_dependencies_compiler_type=none
+fi
+])
+AC_SUBST([$1DEPMODE], [depmode=$am_cv_$1_dependencies_compiler_type])
+AM_CONDITIONAL([am__fastdep$1], [
+ test "x$enable_dependency_tracking" != xno \
+ && test "$am_cv_$1_dependencies_compiler_type" = gcc3])
+])
+
+
+# AM_SET_DEPDIR
+# -------------
+# Choose a directory name for dependency files.
+# This macro is AC_REQUIREd in _AM_DEPENDENCIES.
+AC_DEFUN([AM_SET_DEPDIR],
+[AC_REQUIRE([AM_SET_LEADING_DOT])dnl
+AC_SUBST([DEPDIR], ["${am__leading_dot}deps"])dnl
+])
+
+
+# AM_DEP_TRACK
+# ------------
+AC_DEFUN([AM_DEP_TRACK],
+[AC_ARG_ENABLE([dependency-tracking], [dnl
+AS_HELP_STRING(
+ [--enable-dependency-tracking],
+ [do not reject slow dependency extractors])
+AS_HELP_STRING(
+ [--disable-dependency-tracking],
+ [speeds up one-time build])])
+if test "x$enable_dependency_tracking" != xno; then
+ am_depcomp="$ac_aux_dir/depcomp"
+ AMDEPBACKSLASH='\'
+ am__nodep='_no'
+fi
+AM_CONDITIONAL([AMDEP], [test "x$enable_dependency_tracking" != xno])
+AC_SUBST([AMDEPBACKSLASH])dnl
+_AM_SUBST_NOTMAKE([AMDEPBACKSLASH])dnl
+AC_SUBST([am__nodep])dnl
+_AM_SUBST_NOTMAKE([am__nodep])dnl
+])
+
+# Generate code to set up dependency tracking. -*- Autoconf -*-
+
+# Copyright (C) 1999-2020 Free Software Foundation, Inc.
+#
+# This file is free software; the Free Software Foundation
+# gives unlimited permission to copy and/or distribute it,
+# with or without modifications, as long as this notice is preserved.
+
+# _AM_OUTPUT_DEPENDENCY_COMMANDS
+# ------------------------------
+AC_DEFUN([_AM_OUTPUT_DEPENDENCY_COMMANDS],
+[{
+ # Older Autoconf quotes --file arguments for eval, but not when files
+ # are listed without --file. Let's play safe and only enable the eval
+ # if we detect the quoting.
+ # TODO: see whether this extra hack can be removed once we start
+ # requiring Autoconf 2.70 or later.
+ AS_CASE([$CONFIG_FILES],
+ [*\'*], [eval set x "$CONFIG_FILES"],
+ [*], [set x $CONFIG_FILES])
+ shift
+ # Used to flag and report bootstrapping failures.
+ am_rc=0
+ for am_mf
+ do
+ # Strip MF so we end up with the name of the file.
+ am_mf=`AS_ECHO(["$am_mf"]) | sed -e 's/:.*$//'`
+ # Check whether this is an Automake generated Makefile which includes
+ # dependency-tracking related rules and includes.
+ # Grep'ing the whole file directly is not great: AIX grep has a line
+ # limit of 2048, but all sed's we know have understand at least 4000.
+ sed -n 's,^am--depfiles:.*,X,p' "$am_mf" | grep X >/dev/null 2>&1 \
+ || continue
+ am_dirpart=`AS_DIRNAME(["$am_mf"])`
+ am_filepart=`AS_BASENAME(["$am_mf"])`
+ AM_RUN_LOG([cd "$am_dirpart" \
+ && sed -e '/# am--include-marker/d' "$am_filepart" \
+ | $MAKE -f - am--depfiles]) || am_rc=$?
+ done
+ if test $am_rc -ne 0; then
+ AC_MSG_FAILURE([Something went wrong bootstrapping makefile fragments
+ for automatic dependency tracking. If GNU make was not used, consider
+ re-running the configure script with MAKE="gmake" (or whatever is
+ necessary). You can also try re-running configure with the
+ '--disable-dependency-tracking' option to at least be able to build
+ the package (albeit without support for automatic dependency tracking).])
+ fi
+ AS_UNSET([am_dirpart])
+ AS_UNSET([am_filepart])
+ AS_UNSET([am_mf])
+ AS_UNSET([am_rc])
+ rm -f conftest-deps.mk
+}
+])# _AM_OUTPUT_DEPENDENCY_COMMANDS
+
+
+# AM_OUTPUT_DEPENDENCY_COMMANDS
+# -----------------------------
+# This macro should only be invoked once -- use via AC_REQUIRE.
+#
+# This code is only required when automatic dependency tracking is enabled.
+# This creates each '.Po' and '.Plo' makefile fragment that we'll need in
+# order to bootstrap the dependency handling code.
+AC_DEFUN([AM_OUTPUT_DEPENDENCY_COMMANDS],
+[AC_CONFIG_COMMANDS([depfiles],
+ [test x"$AMDEP_TRUE" != x"" || _AM_OUTPUT_DEPENDENCY_COMMANDS],
+ [AMDEP_TRUE="$AMDEP_TRUE" MAKE="${MAKE-make}"])])
+
+# Do all the work for Automake. -*- Autoconf -*-
+
+# Copyright (C) 1996-2020 Free Software Foundation, Inc.
+#
+# This file is free software; the Free Software Foundation
+# gives unlimited permission to copy and/or distribute it,
+# with or without modifications, as long as this notice is preserved.
+
+# This macro actually does too much. Some checks are only needed if
+# your package does certain things. But this isn't really a big deal.
+
+dnl Redefine AC_PROG_CC to automatically invoke _AM_PROG_CC_C_O.
+m4_define([AC_PROG_CC],
+m4_defn([AC_PROG_CC])
+[_AM_PROG_CC_C_O
+])
+
+# AM_INIT_AUTOMAKE(PACKAGE, VERSION, [NO-DEFINE])
+# AM_INIT_AUTOMAKE([OPTIONS])
+# -----------------------------------------------
+# The call with PACKAGE and VERSION arguments is the old style
+# call (pre autoconf-2.50), which is being phased out. PACKAGE
+# and VERSION should now be passed to AC_INIT and removed from
+# the call to AM_INIT_AUTOMAKE.
+# We support both call styles for the transition. After
+# the next Automake release, Autoconf can make the AC_INIT
+# arguments mandatory, and then we can depend on a new Autoconf
+# release and drop the old call support.
+AC_DEFUN([AM_INIT_AUTOMAKE],
+[AC_PREREQ([2.65])dnl
+dnl Autoconf wants to disallow AM_ names. We explicitly allow
+dnl the ones we care about.
+m4_pattern_allow([^AM_[A-Z]+FLAGS$])dnl
+AC_REQUIRE([AM_SET_CURRENT_AUTOMAKE_VERSION])dnl
+AC_REQUIRE([AC_PROG_INSTALL])dnl
+if test "`cd $srcdir && pwd`" != "`pwd`"; then
+ # Use -I$(srcdir) only when $(srcdir) != ., so that make's output
+ # is not polluted with repeated "-I."
+ AC_SUBST([am__isrc], [' -I$(srcdir)'])_AM_SUBST_NOTMAKE([am__isrc])dnl
+ # test to see if srcdir already configured
+ if test -f $srcdir/config.status; then
+ AC_MSG_ERROR([source directory already configured; run "make distclean" there first])
+ fi
+fi
+
+# test whether we have cygpath
+if test -z "$CYGPATH_W"; then
+ if (cygpath --version) >/dev/null 2>/dev/null; then
+ CYGPATH_W='cygpath -w'
+ else
+ CYGPATH_W=echo
+ fi
+fi
+AC_SUBST([CYGPATH_W])
+
+# Define the identity of the package.
+dnl Distinguish between old-style and new-style calls.
+m4_ifval([$2],
+[AC_DIAGNOSE([obsolete],
+ [$0: two- and three-arguments forms are deprecated.])
+m4_ifval([$3], [_AM_SET_OPTION([no-define])])dnl
+ AC_SUBST([PACKAGE], [$1])dnl
+ AC_SUBST([VERSION], [$2])],
+[_AM_SET_OPTIONS([$1])dnl
+dnl Diagnose old-style AC_INIT with new-style AM_AUTOMAKE_INIT.
+m4_if(
+ m4_ifdef([AC_PACKAGE_NAME], [ok]):m4_ifdef([AC_PACKAGE_VERSION], [ok]),
+ [ok:ok],,
+ [m4_fatal([AC_INIT should be called with package and version arguments])])dnl
+ AC_SUBST([PACKAGE], ['AC_PACKAGE_TARNAME'])dnl
+ AC_SUBST([VERSION], ['AC_PACKAGE_VERSION'])])dnl
+
+_AM_IF_OPTION([no-define],,
+[AC_DEFINE_UNQUOTED([PACKAGE], ["$PACKAGE"], [Name of package])
+ AC_DEFINE_UNQUOTED([VERSION], ["$VERSION"], [Version number of package])])dnl
+
+# Some tools Automake needs.
+AC_REQUIRE([AM_SANITY_CHECK])dnl
+AC_REQUIRE([AC_ARG_PROGRAM])dnl
+AM_MISSING_PROG([ACLOCAL], [aclocal-${am__api_version}])
+AM_MISSING_PROG([AUTOCONF], [autoconf])
+AM_MISSING_PROG([AUTOMAKE], [automake-${am__api_version}])
+AM_MISSING_PROG([AUTOHEADER], [autoheader])
+AM_MISSING_PROG([MAKEINFO], [makeinfo])
+AC_REQUIRE([AM_PROG_INSTALL_SH])dnl
+AC_REQUIRE([AM_PROG_INSTALL_STRIP])dnl
+AC_REQUIRE([AC_PROG_MKDIR_P])dnl
+# For better backward compatibility. To be removed once Automake 1.9.x
+# dies out for good. For more background, see:
+# <https://lists.gnu.org/archive/html/automake/2012-07/msg00001.html>
+# <https://lists.gnu.org/archive/html/automake/2012-07/msg00014.html>
+AC_SUBST([mkdir_p], ['$(MKDIR_P)'])
+# We need awk for the "check" target (and possibly the TAP driver). The
+# system "awk" is bad on some platforms.
+AC_REQUIRE([AC_PROG_AWK])dnl
+AC_REQUIRE([AC_PROG_MAKE_SET])dnl
+AC_REQUIRE([AM_SET_LEADING_DOT])dnl
+_AM_IF_OPTION([tar-ustar], [_AM_PROG_TAR([ustar])],
+ [_AM_IF_OPTION([tar-pax], [_AM_PROG_TAR([pax])],
+ [_AM_PROG_TAR([v7])])])
+_AM_IF_OPTION([no-dependencies],,
+[AC_PROVIDE_IFELSE([AC_PROG_CC],
+ [_AM_DEPENDENCIES([CC])],
+ [m4_define([AC_PROG_CC],
+ m4_defn([AC_PROG_CC])[_AM_DEPENDENCIES([CC])])])dnl
+AC_PROVIDE_IFELSE([AC_PROG_CXX],
+ [_AM_DEPENDENCIES([CXX])],
+ [m4_define([AC_PROG_CXX],
+ m4_defn([AC_PROG_CXX])[_AM_DEPENDENCIES([CXX])])])dnl
+AC_PROVIDE_IFELSE([AC_PROG_OBJC],
+ [_AM_DEPENDENCIES([OBJC])],
+ [m4_define([AC_PROG_OBJC],
+ m4_defn([AC_PROG_OBJC])[_AM_DEPENDENCIES([OBJC])])])dnl
+AC_PROVIDE_IFELSE([AC_PROG_OBJCXX],
+ [_AM_DEPENDENCIES([OBJCXX])],
+ [m4_define([AC_PROG_OBJCXX],
+ m4_defn([AC_PROG_OBJCXX])[_AM_DEPENDENCIES([OBJCXX])])])dnl
+])
+AC_REQUIRE([AM_SILENT_RULES])dnl
+dnl The testsuite driver may need to know about EXEEXT, so add the
+dnl 'am__EXEEXT' conditional if _AM_COMPILER_EXEEXT was seen. This
+dnl macro is hooked onto _AC_COMPILER_EXEEXT early, see below.
+AC_CONFIG_COMMANDS_PRE(dnl
+[m4_provide_if([_AM_COMPILER_EXEEXT],
+ [AM_CONDITIONAL([am__EXEEXT], [test -n "$EXEEXT"])])])dnl
+
+# POSIX will say in a future version that running "rm -f" with no argument
+# is OK; and we want to be able to make that assumption in our Makefile
+# recipes. So use an aggressive probe to check that the usage we want is
+# actually supported "in the wild" to an acceptable degree.
+# See automake bug#10828.
+# To make any issue more visible, cause the running configure to be aborted
+# by default if the 'rm' program in use doesn't match our expectations; the
+# user can still override this though.
+if rm -f && rm -fr && rm -rf; then : OK; else
+ cat >&2 <<'END'
+Oops!
+
+Your 'rm' program seems unable to run without file operands specified
+on the command line, even when the '-f' option is present. This is contrary
+to the behaviour of most rm programs out there, and not conforming with
+the upcoming POSIX standard: <http://austingroupbugs.net/view.php?id=542>
+
+Please tell bug-automake@gnu.org about your system, including the value
+of your $PATH and any error possibly output before this message. This
+can help us improve future automake versions.
+
+END
+ if test x"$ACCEPT_INFERIOR_RM_PROGRAM" = x"yes"; then
+ echo 'Configuration will proceed anyway, since you have set the' >&2
+ echo 'ACCEPT_INFERIOR_RM_PROGRAM variable to "yes"' >&2
+ echo >&2
+ else
+ cat >&2 <<'END'
+Aborting the configuration process, to ensure you take notice of the issue.
+
+You can download and install GNU coreutils to get an 'rm' implementation
+that behaves properly: <https://www.gnu.org/software/coreutils/>.
+
+If you want to complete the configuration process using your problematic
+'rm' anyway, export the environment variable ACCEPT_INFERIOR_RM_PROGRAM
+to "yes", and re-run configure.
+
+END
+ AC_MSG_ERROR([Your 'rm' program is bad, sorry.])
+ fi
+fi
+dnl The trailing newline in this macro's definition is deliberate, for
+dnl backward compatibility and to allow trailing 'dnl'-style comments
+dnl after the AM_INIT_AUTOMAKE invocation. See automake bug#16841.
+])
+
+dnl Hook into '_AC_COMPILER_EXEEXT' early to learn its expansion. Do not
+dnl add the conditional right here, as _AC_COMPILER_EXEEXT may be further
+dnl mangled by Autoconf and run in a shell conditional statement.
+m4_define([_AC_COMPILER_EXEEXT],
+m4_defn([_AC_COMPILER_EXEEXT])[m4_provide([_AM_COMPILER_EXEEXT])])
+
+# When config.status generates a header, we must update the stamp-h file.
+# This file resides in the same directory as the config header
+# that is generated. The stamp files are numbered to have different names.
+
+# Autoconf calls _AC_AM_CONFIG_HEADER_HOOK (when defined) in the
+# loop where config.status creates the headers, so we can generate
+# our stamp files there.
+AC_DEFUN([_AC_AM_CONFIG_HEADER_HOOK],
+[# Compute $1's index in $config_headers.
+_am_arg=$1
+_am_stamp_count=1
+for _am_header in $config_headers :; do
+ case $_am_header in
+ $_am_arg | $_am_arg:* )
+ break ;;
+ * )
+ _am_stamp_count=`expr $_am_stamp_count + 1` ;;
+ esac
+done
+echo "timestamp for $_am_arg" >`AS_DIRNAME(["$_am_arg"])`/stamp-h[]$_am_stamp_count])
+
+# Copyright (C) 2001-2020 Free Software Foundation, Inc.
+#
+# This file is free software; the Free Software Foundation
+# gives unlimited permission to copy and/or distribute it,
+# with or without modifications, as long as this notice is preserved.
+
+# AM_PROG_INSTALL_SH
+# ------------------
+# Define $install_sh.
+AC_DEFUN([AM_PROG_INSTALL_SH],
+[AC_REQUIRE([AM_AUX_DIR_EXPAND])dnl
+if test x"${install_sh+set}" != xset; then
+ case $am_aux_dir in
+ *\ * | *\ *)
+ install_sh="\${SHELL} '$am_aux_dir/install-sh'" ;;
+ *)
+ install_sh="\${SHELL} $am_aux_dir/install-sh"
+ esac
+fi
+AC_SUBST([install_sh])])
+
+# Copyright (C) 2003-2020 Free Software Foundation, Inc.
+#
+# This file is free software; the Free Software Foundation
+# gives unlimited permission to copy and/or distribute it,
+# with or without modifications, as long as this notice is preserved.
+
+# Check whether the underlying file-system supports filenames
+# with a leading dot. For instance MS-DOS doesn't.
+AC_DEFUN([AM_SET_LEADING_DOT],
+[rm -rf .tst 2>/dev/null
+mkdir .tst 2>/dev/null
+if test -d .tst; then
+ am__leading_dot=.
+else
+ am__leading_dot=_
+fi
+rmdir .tst 2>/dev/null
+AC_SUBST([am__leading_dot])])
+
+# Add --enable-maintainer-mode option to configure. -*- Autoconf -*-
+# From Jim Meyering
+
+# Copyright (C) 1996-2020 Free Software Foundation, Inc.
+#
+# This file is free software; the Free Software Foundation
+# gives unlimited permission to copy and/or distribute it,
+# with or without modifications, as long as this notice is preserved.
+
+# AM_MAINTAINER_MODE([DEFAULT-MODE])
+# ----------------------------------
+# Control maintainer-specific portions of Makefiles.
+# Default is to disable them, unless 'enable' is passed literally.
+# For symmetry, 'disable' may be passed as well. Anyway, the user
+# can override the default with the --enable/--disable switch.
+AC_DEFUN([AM_MAINTAINER_MODE],
+[m4_case(m4_default([$1], [disable]),
+ [enable], [m4_define([am_maintainer_other], [disable])],
+ [disable], [m4_define([am_maintainer_other], [enable])],
+ [m4_define([am_maintainer_other], [enable])
+ m4_warn([syntax], [unexpected argument to AM@&t@_MAINTAINER_MODE: $1])])
+AC_MSG_CHECKING([whether to enable maintainer-specific portions of Makefiles])
+ dnl maintainer-mode's default is 'disable' unless 'enable' is passed
+ AC_ARG_ENABLE([maintainer-mode],
+ [AS_HELP_STRING([--]am_maintainer_other[-maintainer-mode],
+ am_maintainer_other[ make rules and dependencies not useful
+ (and sometimes confusing) to the casual installer])],
+ [USE_MAINTAINER_MODE=$enableval],
+ [USE_MAINTAINER_MODE=]m4_if(am_maintainer_other, [enable], [no], [yes]))
+ AC_MSG_RESULT([$USE_MAINTAINER_MODE])
+ AM_CONDITIONAL([MAINTAINER_MODE], [test $USE_MAINTAINER_MODE = yes])
+ MAINT=$MAINTAINER_MODE_TRUE
+ AC_SUBST([MAINT])dnl
+]
+)
+
+# Check to see how 'make' treats includes. -*- Autoconf -*-
+
+# Copyright (C) 2001-2020 Free Software Foundation, Inc.
+#
+# This file is free software; the Free Software Foundation
+# gives unlimited permission to copy and/or distribute it,
+# with or without modifications, as long as this notice is preserved.
+
+# AM_MAKE_INCLUDE()
+# -----------------
+# Check whether make has an 'include' directive that can support all
+# the idioms we need for our automatic dependency tracking code.
+AC_DEFUN([AM_MAKE_INCLUDE],
+[AC_MSG_CHECKING([whether ${MAKE-make} supports the include directive])
+cat > confinc.mk << 'END'
+am__doit:
+ @echo this is the am__doit target >confinc.out
+.PHONY: am__doit
+END
+am__include="#"
+am__quote=
+# BSD make does it like this.
+echo '.include "confinc.mk" # ignored' > confmf.BSD
+# Other make implementations (GNU, Solaris 10, AIX) do it like this.
+echo 'include confinc.mk # ignored' > confmf.GNU
+_am_result=no
+for s in GNU BSD; do
+ AM_RUN_LOG([${MAKE-make} -f confmf.$s && cat confinc.out])
+ AS_CASE([$?:`cat confinc.out 2>/dev/null`],
+ ['0:this is the am__doit target'],
+ [AS_CASE([$s],
+ [BSD], [am__include='.include' am__quote='"'],
+ [am__include='include' am__quote=''])])
+ if test "$am__include" != "#"; then
+ _am_result="yes ($s style)"
+ break
+ fi
+done
+rm -f confinc.* confmf.*
+AC_MSG_RESULT([${_am_result}])
+AC_SUBST([am__include])])
+AC_SUBST([am__quote])])
+
+# Fake the existence of programs that GNU maintainers use. -*- Autoconf -*-
+
+# Copyright (C) 1997-2020 Free Software Foundation, Inc.
+#
+# This file is free software; the Free Software Foundation
+# gives unlimited permission to copy and/or distribute it,
+# with or without modifications, as long as this notice is preserved.
+
+# AM_MISSING_PROG(NAME, PROGRAM)
+# ------------------------------
+AC_DEFUN([AM_MISSING_PROG],
+[AC_REQUIRE([AM_MISSING_HAS_RUN])
+$1=${$1-"${am_missing_run}$2"}
+AC_SUBST($1)])
+
+# AM_MISSING_HAS_RUN
+# ------------------
+# Define MISSING if not defined so far and test if it is modern enough.
+# If it is, set am_missing_run to use it, otherwise, to nothing.
+AC_DEFUN([AM_MISSING_HAS_RUN],
+[AC_REQUIRE([AM_AUX_DIR_EXPAND])dnl
+AC_REQUIRE_AUX_FILE([missing])dnl
+if test x"${MISSING+set}" != xset; then
+ MISSING="\${SHELL} '$am_aux_dir/missing'"
+fi
+# Use eval to expand $SHELL
+if eval "$MISSING --is-lightweight"; then
+ am_missing_run="$MISSING "
+else
+ am_missing_run=
+ AC_MSG_WARN(['missing' script is too old or missing])
+fi
+])
+
+# Helper functions for option handling. -*- Autoconf -*-
+
+# Copyright (C) 2001-2020 Free Software Foundation, Inc.
+#
+# This file is free software; the Free Software Foundation
+# gives unlimited permission to copy and/or distribute it,
+# with or without modifications, as long as this notice is preserved.
+
+# _AM_MANGLE_OPTION(NAME)
+# -----------------------
+AC_DEFUN([_AM_MANGLE_OPTION],
+[[_AM_OPTION_]m4_bpatsubst($1, [[^a-zA-Z0-9_]], [_])])
+
+# _AM_SET_OPTION(NAME)
+# --------------------
+# Set option NAME. Presently that only means defining a flag for this option.
+AC_DEFUN([_AM_SET_OPTION],
+[m4_define(_AM_MANGLE_OPTION([$1]), [1])])
+
+# _AM_SET_OPTIONS(OPTIONS)
+# ------------------------
+# OPTIONS is a space-separated list of Automake options.
+AC_DEFUN([_AM_SET_OPTIONS],
+[m4_foreach_w([_AM_Option], [$1], [_AM_SET_OPTION(_AM_Option)])])
+
+# _AM_IF_OPTION(OPTION, IF-SET, [IF-NOT-SET])
+# -------------------------------------------
+# Execute IF-SET if OPTION is set, IF-NOT-SET otherwise.
+AC_DEFUN([_AM_IF_OPTION],
+[m4_ifset(_AM_MANGLE_OPTION([$1]), [$2], [$3])])
+
+# Copyright (C) 1999-2020 Free Software Foundation, Inc.
+#
+# This file is free software; the Free Software Foundation
+# gives unlimited permission to copy and/or distribute it,
+# with or without modifications, as long as this notice is preserved.
+
+# _AM_PROG_CC_C_O
+# ---------------
+# Like AC_PROG_CC_C_O, but changed for automake. We rewrite AC_PROG_CC
+# to automatically call this.
+AC_DEFUN([_AM_PROG_CC_C_O],
+[AC_REQUIRE([AM_AUX_DIR_EXPAND])dnl
+AC_REQUIRE_AUX_FILE([compile])dnl
+AC_LANG_PUSH([C])dnl
+AC_CACHE_CHECK(
+ [whether $CC understands -c and -o together],
+ [am_cv_prog_cc_c_o],
+ [AC_LANG_CONFTEST([AC_LANG_PROGRAM([])])
+ # Make sure it works both with $CC and with simple cc.
+ # Following AC_PROG_CC_C_O, we do the test twice because some
+ # compilers refuse to overwrite an existing .o file with -o,
+ # though they will create one.
+ am_cv_prog_cc_c_o=yes
+ for am_i in 1 2; do
+ if AM_RUN_LOG([$CC -c conftest.$ac_ext -o conftest2.$ac_objext]) \
+ && test -f conftest2.$ac_objext; then
+ : OK
+ else
+ am_cv_prog_cc_c_o=no
+ break
+ fi
+ done
+ rm -f core conftest*
+ unset am_i])
+if test "$am_cv_prog_cc_c_o" != yes; then
+ # Losing compiler, so override with the script.
+ # FIXME: It is wrong to rewrite CC.
+ # But if we don't then we get into trouble of one sort or another.
+ # A longer-term fix would be to have automake use am__CC in this case,
+ # and then we could set am__CC="\$(top_srcdir)/compile \$(CC)"
+ CC="$am_aux_dir/compile $CC"
+fi
+AC_LANG_POP([C])])
+
+# For backward compatibility.
+AC_DEFUN_ONCE([AM_PROG_CC_C_O], [AC_REQUIRE([AC_PROG_CC])])
+
+# Copyright (C) 2001-2020 Free Software Foundation, Inc.
+#
+# This file is free software; the Free Software Foundation
+# gives unlimited permission to copy and/or distribute it,
+# with or without modifications, as long as this notice is preserved.
+
+# AM_RUN_LOG(COMMAND)
+# -------------------
+# Run COMMAND, save the exit status in ac_status, and log it.
+# (This has been adapted from Autoconf's _AC_RUN_LOG macro.)
+AC_DEFUN([AM_RUN_LOG],
+[{ echo "$as_me:$LINENO: $1" >&AS_MESSAGE_LOG_FD
+ ($1) >&AS_MESSAGE_LOG_FD 2>&AS_MESSAGE_LOG_FD
+ ac_status=$?
+ echo "$as_me:$LINENO: \$? = $ac_status" >&AS_MESSAGE_LOG_FD
+ (exit $ac_status); }])
+
+# Check to make sure that the build environment is sane. -*- Autoconf -*-
+
+# Copyright (C) 1996-2020 Free Software Foundation, Inc.
+#
+# This file is free software; the Free Software Foundation
+# gives unlimited permission to copy and/or distribute it,
+# with or without modifications, as long as this notice is preserved.
+
+# AM_SANITY_CHECK
+# ---------------
+AC_DEFUN([AM_SANITY_CHECK],
+[AC_MSG_CHECKING([whether build environment is sane])
+# Reject unsafe characters in $srcdir or the absolute working directory
+# name. Accept space and tab only in the latter.
+am_lf='
+'
+case `pwd` in
+ *[[\\\"\#\$\&\'\`$am_lf]]*)
+ AC_MSG_ERROR([unsafe absolute working directory name]);;
+esac
+case $srcdir in
+ *[[\\\"\#\$\&\'\`$am_lf\ \ ]]*)
+ AC_MSG_ERROR([unsafe srcdir value: '$srcdir']);;
+esac
+
+# Do 'set' in a subshell so we don't clobber the current shell's
+# arguments. Must try -L first in case configure is actually a
+# symlink; some systems play weird games with the mod time of symlinks
+# (eg FreeBSD returns the mod time of the symlink's containing
+# directory).
+if (
+ am_has_slept=no
+ for am_try in 1 2; do
+ echo "timestamp, slept: $am_has_slept" > conftest.file
+ set X `ls -Lt "$srcdir/configure" conftest.file 2> /dev/null`
+ if test "$[*]" = "X"; then
+ # -L didn't work.
+ set X `ls -t "$srcdir/configure" conftest.file`
+ fi
+ if test "$[*]" != "X $srcdir/configure conftest.file" \
+ && test "$[*]" != "X conftest.file $srcdir/configure"; then
+
+ # If neither matched, then we have a broken ls. This can happen
+ # if, for instance, CONFIG_SHELL is bash and it inherits a
+ # broken ls alias from the environment. This has actually
+ # happened. Such a system could not be considered "sane".
+ AC_MSG_ERROR([ls -t appears to fail. Make sure there is not a broken
+ alias in your environment])
+ fi
+ if test "$[2]" = conftest.file || test $am_try -eq 2; then
+ break
+ fi
+ # Just in case.
+ sleep 1
+ am_has_slept=yes
+ done
+ test "$[2]" = conftest.file
+ )
+then
+ # Ok.
+ :
+else
+ AC_MSG_ERROR([newly created file is older than distributed files!
+Check your system clock])
+fi
+AC_MSG_RESULT([yes])
+# If we didn't sleep, we still need to ensure time stamps of config.status and
+# generated files are strictly newer.
+am_sleep_pid=
+if grep 'slept: no' conftest.file >/dev/null 2>&1; then
+ ( sleep 1 ) &
+ am_sleep_pid=$!
+fi
+AC_CONFIG_COMMANDS_PRE(
+ [AC_MSG_CHECKING([that generated files are newer than configure])
+ if test -n "$am_sleep_pid"; then
+ # Hide warnings about reused PIDs.
+ wait $am_sleep_pid 2>/dev/null
+ fi
+ AC_MSG_RESULT([done])])
+rm -f conftest.file
+])
+
+# Copyright (C) 2009-2020 Free Software Foundation, Inc.
+#
+# This file is free software; the Free Software Foundation
+# gives unlimited permission to copy and/or distribute it,
+# with or without modifications, as long as this notice is preserved.
+
+# AM_SILENT_RULES([DEFAULT])
+# --------------------------
+# Enable less verbose build rules; with the default set to DEFAULT
+# ("yes" being less verbose, "no" or empty being verbose).
+AC_DEFUN([AM_SILENT_RULES],
+[AC_ARG_ENABLE([silent-rules], [dnl
+AS_HELP_STRING(
+ [--enable-silent-rules],
+ [less verbose build output (undo: "make V=1")])
+AS_HELP_STRING(
+ [--disable-silent-rules],
+ [verbose build output (undo: "make V=0")])dnl
+])
+case $enable_silent_rules in @%:@ (((
+ yes) AM_DEFAULT_VERBOSITY=0;;
+ no) AM_DEFAULT_VERBOSITY=1;;
+ *) AM_DEFAULT_VERBOSITY=m4_if([$1], [yes], [0], [1]);;
+esac
+dnl
+dnl A few 'make' implementations (e.g., NonStop OS and NextStep)
+dnl do not support nested variable expansions.
+dnl See automake bug#9928 and bug#10237.
+am_make=${MAKE-make}
+AC_CACHE_CHECK([whether $am_make supports nested variables],
+ [am_cv_make_support_nested_variables],
+ [if AS_ECHO([['TRUE=$(BAR$(V))
+BAR0=false
+BAR1=true
+V=1
+am__doit:
+ @$(TRUE)
+.PHONY: am__doit']]) | $am_make -f - >/dev/null 2>&1; then
+ am_cv_make_support_nested_variables=yes
+else
+ am_cv_make_support_nested_variables=no
+fi])
+if test $am_cv_make_support_nested_variables = yes; then
+ dnl Using '$V' instead of '$(V)' breaks IRIX make.
+ AM_V='$(V)'
+ AM_DEFAULT_V='$(AM_DEFAULT_VERBOSITY)'
+else
+ AM_V=$AM_DEFAULT_VERBOSITY
+ AM_DEFAULT_V=$AM_DEFAULT_VERBOSITY
+fi
+AC_SUBST([AM_V])dnl
+AM_SUBST_NOTMAKE([AM_V])dnl
+AC_SUBST([AM_DEFAULT_V])dnl
+AM_SUBST_NOTMAKE([AM_DEFAULT_V])dnl
+AC_SUBST([AM_DEFAULT_VERBOSITY])dnl
+AM_BACKSLASH='\'
+AC_SUBST([AM_BACKSLASH])dnl
+_AM_SUBST_NOTMAKE([AM_BACKSLASH])dnl
+])
+
+# Copyright (C) 2001-2020 Free Software Foundation, Inc.
+#
+# This file is free software; the Free Software Foundation
+# gives unlimited permission to copy and/or distribute it,
+# with or without modifications, as long as this notice is preserved.
+
+# AM_PROG_INSTALL_STRIP
+# ---------------------
+# One issue with vendor 'install' (even GNU) is that you can't
+# specify the program used to strip binaries. This is especially
+# annoying in cross-compiling environments, where the build's strip
+# is unlikely to handle the host's binaries.
+# Fortunately install-sh will honor a STRIPPROG variable, so we
+# always use install-sh in "make install-strip", and initialize
+# STRIPPROG with the value of the STRIP variable (set by the user).
+AC_DEFUN([AM_PROG_INSTALL_STRIP],
+[AC_REQUIRE([AM_PROG_INSTALL_SH])dnl
+# Installed binaries are usually stripped using 'strip' when the user
+# run "make install-strip". However 'strip' might not be the right
+# tool to use in cross-compilation environments, therefore Automake
+# will honor the 'STRIP' environment variable to overrule this program.
+dnl Don't test for $cross_compiling = yes, because it might be 'maybe'.
+if test "$cross_compiling" != no; then
+ AC_CHECK_TOOL([STRIP], [strip], :)
+fi
+INSTALL_STRIP_PROGRAM="\$(install_sh) -c -s"
+AC_SUBST([INSTALL_STRIP_PROGRAM])])
+
+# Copyright (C) 2006-2020 Free Software Foundation, Inc.
+#
+# This file is free software; the Free Software Foundation
+# gives unlimited permission to copy and/or distribute it,
+# with or without modifications, as long as this notice is preserved.
+
+# _AM_SUBST_NOTMAKE(VARIABLE)
+# ---------------------------
+# Prevent Automake from outputting VARIABLE = @VARIABLE@ in Makefile.in.
+# This macro is traced by Automake.
+AC_DEFUN([_AM_SUBST_NOTMAKE])
+
+# AM_SUBST_NOTMAKE(VARIABLE)
+# --------------------------
+# Public sister of _AM_SUBST_NOTMAKE.
+AC_DEFUN([AM_SUBST_NOTMAKE], [_AM_SUBST_NOTMAKE($@)])
+
+# Check how to create a tarball. -*- Autoconf -*-
+
+# Copyright (C) 2004-2020 Free Software Foundation, Inc.
+#
+# This file is free software; the Free Software Foundation
+# gives unlimited permission to copy and/or distribute it,
+# with or without modifications, as long as this notice is preserved.
+
+# _AM_PROG_TAR(FORMAT)
+# --------------------
+# Check how to create a tarball in format FORMAT.
+# FORMAT should be one of 'v7', 'ustar', or 'pax'.
+#
+# Substitute a variable $(am__tar) that is a command
+# writing to stdout a FORMAT-tarball containing the directory
+# $tardir.
+# tardir=directory && $(am__tar) > result.tar
+#
+# Substitute a variable $(am__untar) that extract such
+# a tarball read from stdin.
+# $(am__untar) < result.tar
+#
+AC_DEFUN([_AM_PROG_TAR],
+[# Always define AMTAR for backward compatibility. Yes, it's still used
+# in the wild :-( We should find a proper way to deprecate it ...
+AC_SUBST([AMTAR], ['$${TAR-tar}'])
+
+# We'll loop over all known methods to create a tar archive until one works.
+_am_tools='gnutar m4_if([$1], [ustar], [plaintar]) pax cpio none'
+
+m4_if([$1], [v7],
+ [am__tar='$${TAR-tar} chof - "$$tardir"' am__untar='$${TAR-tar} xf -'],
+
+ [m4_case([$1],
+ [ustar],
+ [# The POSIX 1988 'ustar' format is defined with fixed-size fields.
+ # There is notably a 21 bits limit for the UID and the GID. In fact,
+ # the 'pax' utility can hang on bigger UID/GID (see automake bug#8343
+ # and bug#13588).
+ am_max_uid=2097151 # 2^21 - 1
+ am_max_gid=$am_max_uid
+ # The $UID and $GID variables are not portable, so we need to resort
+ # to the POSIX-mandated id(1) utility. Errors in the 'id' calls
+ # below are definitely unexpected, so allow the users to see them
+ # (that is, avoid stderr redirection).
+ am_uid=`id -u || echo unknown`
+ am_gid=`id -g || echo unknown`
+ AC_MSG_CHECKING([whether UID '$am_uid' is supported by ustar format])
+ if test $am_uid -le $am_max_uid; then
+ AC_MSG_RESULT([yes])
+ else
+ AC_MSG_RESULT([no])
+ _am_tools=none
+ fi
+ AC_MSG_CHECKING([whether GID '$am_gid' is supported by ustar format])
+ if test $am_gid -le $am_max_gid; then
+ AC_MSG_RESULT([yes])
+ else
+ AC_MSG_RESULT([no])
+ _am_tools=none
+ fi],
+
+ [pax],
+ [],
+
+ [m4_fatal([Unknown tar format])])
+
+ AC_MSG_CHECKING([how to create a $1 tar archive])
+
+ # Go ahead even if we have the value already cached. We do so because we
+ # need to set the values for the 'am__tar' and 'am__untar' variables.
+ _am_tools=${am_cv_prog_tar_$1-$_am_tools}
+
+ for _am_tool in $_am_tools; do
+ case $_am_tool in
+ gnutar)
+ for _am_tar in tar gnutar gtar; do
+ AM_RUN_LOG([$_am_tar --version]) && break
+ done
+ am__tar="$_am_tar --format=m4_if([$1], [pax], [posix], [$1]) -chf - "'"$$tardir"'
+ am__tar_="$_am_tar --format=m4_if([$1], [pax], [posix], [$1]) -chf - "'"$tardir"'
+ am__untar="$_am_tar -xf -"
+ ;;
+ plaintar)
+ # Must skip GNU tar: if it does not support --format= it doesn't create
+ # ustar tarball either.
+ (tar --version) >/dev/null 2>&1 && continue
+ am__tar='tar chf - "$$tardir"'
+ am__tar_='tar chf - "$tardir"'
+ am__untar='tar xf -'
+ ;;
+ pax)
+ am__tar='pax -L -x $1 -w "$$tardir"'
+ am__tar_='pax -L -x $1 -w "$tardir"'
+ am__untar='pax -r'
+ ;;
+ cpio)
+ am__tar='find "$$tardir" -print | cpio -o -H $1 -L'
+ am__tar_='find "$tardir" -print | cpio -o -H $1 -L'
+ am__untar='cpio -i -H $1 -d'
+ ;;
+ none)
+ am__tar=false
+ am__tar_=false
+ am__untar=false
+ ;;
+ esac
+
+ # If the value was cached, stop now. We just wanted to have am__tar
+ # and am__untar set.
+ test -n "${am_cv_prog_tar_$1}" && break
+
+ # tar/untar a dummy directory, and stop if the command works.
+ rm -rf conftest.dir
+ mkdir conftest.dir
+ echo GrepMe > conftest.dir/file
+ AM_RUN_LOG([tardir=conftest.dir && eval $am__tar_ >conftest.tar])
+ rm -rf conftest.dir
+ if test -s conftest.tar; then
+ AM_RUN_LOG([$am__untar <conftest.tar])
+ AM_RUN_LOG([cat conftest.dir/file])
+ grep GrepMe conftest.dir/file >/dev/null 2>&1 && break
+ fi
+ done
+ rm -rf conftest.dir
+
+ AC_CACHE_VAL([am_cv_prog_tar_$1], [am_cv_prog_tar_$1=$_am_tool])
+ AC_MSG_RESULT([$am_cv_prog_tar_$1])])
+
+AC_SUBST([am__tar])
+AC_SUBST([am__untar])
+]) # _AM_PROG_TAR
+
+m4_include([m4/gs-device.m4])
+m4_include([m4/makeinfo.m4])
+m4_include([../../m4/kpse-common.m4])
+m4_include([../../m4/kpse-freetype2-flags.m4])
+m4_include([../../m4/kpse-gd-flags.m4])
+m4_include([../../m4/kpse-kpathsea-flags.m4])
+m4_include([../../m4/kpse-libpng-flags.m4])
+m4_include([../../m4/kpse-warnings.m4])
+m4_include([../../m4/kpse-win32.m4])
+m4_include([../../m4/kpse-zlib-flags.m4])
+m4_include([../../m4/libtool.m4])
+m4_include([../../m4/ltoptions.m4])
+m4_include([../../m4/ltsugar.m4])
+m4_include([../../m4/ltversion.m4])
+m4_include([../../m4/lt~obsolete.m4])
diff --git a/Build/source/texk/dvipng/config.h.in b/Build/source/texk/dvipng/config.h.in
new file mode 100644
index 00000000000..a88b7fbb5aa
--- /dev/null
+++ b/Build/source/texk/dvipng/config.h.in
@@ -0,0 +1,287 @@
+/* config.h.in. Generated from configure.ac by autoheader. */
+
+/* Define to 1 if the `closedir' function returns void instead of `int'. */
+#undef CLOSEDIR_VOID
+
+/* Define as 1 to get the debug (-d) option. */
+#undef DEBUG
+
+/* Define as the path to GhostScript. */
+#undef GS_PATH
+
+/* Define to 1 if you have the <assert.h> header file. */
+#undef HAVE_ASSERT_H
+
+/* Define to 1 if you have the declaration of `isascii', and to 0 if you
+ don't. */
+#undef HAVE_DECL_ISASCII
+
+/* Define to 1 if you have the <dirent.h> header file, and it defines `DIR'.
+ */
+#undef HAVE_DIRENT_H
+
+/* Define to 1 if you have the <dlfcn.h> header file. */
+#undef HAVE_DLFCN_H
+
+/* Define to 1 if you don't have `vprintf' but do have `_doprnt.' */
+#undef HAVE_DOPRNT
+
+/* Define to 1 if you have the `dup2' function. */
+#undef HAVE_DUP2
+
+/* Define to 1 if you have the <fcntl.h> header file. */
+#undef HAVE_FCNTL_H
+
+/* Define to 1 if you have the <float.h> header file. */
+#undef HAVE_FLOAT_H
+
+/* Define to 1 if fseeko (and presumably ftello) exists and is declared. */
+#undef HAVE_FSEEKO
+
+/* Define to 1 if you have freetype2. */
+#undef HAVE_FT2
+
+/* Define to 1 if you have the `ftime' function. */
+#undef HAVE_FTIME
+
+/* Define to 1 if you have the `FT_Library_Version' function. */
+#undef HAVE_FT_LIBRARY_VERSION
+
+/* Define to 1 if you have the `gdImageCreateFromJpeg' function. */
+#undef HAVE_GDIMAGECREATEFROMJPEG
+
+/* Define to 1 if you have the `gdImageCreateFromPngPtr' function. */
+#undef HAVE_GDIMAGECREATEFROMPNGPTR
+
+/* Define to 1 if you have the `gdImageCreateTrueColor' function. */
+#undef HAVE_GDIMAGECREATETRUECOLOR
+
+/* Define to 1 if you have the `gdImageGif' function. */
+#undef HAVE_GDIMAGEGIF
+
+/* Define to 1 if you have the `gdImagePngEx' function. */
+#undef HAVE_GDIMAGEPNGEX
+
+/* Define to 1 if you have the <gd.h> header file. */
+#undef HAVE_GD_H
+
+/* Define to 1 if you have the `getcwd' function. */
+#undef HAVE_GETCWD
+
+/* Define to 1 if you have the `getpagesize' function. */
+#undef HAVE_GETPAGESIZE
+
+/* Define to 1 if you have the `gettimeofday' function. */
+#undef HAVE_GETTIMEOFDAY
+
+/* Define to 1 if you have the `getwd' function. */
+#undef HAVE_GETWD
+
+/* Define to 1 if you have the <inttypes.h> header file. */
+#undef HAVE_INTTYPES_H
+
+/* Define to 1 if you have the <kpathsea/kpathsea.h> header file. */
+#undef HAVE_KPATHSEA_KPATHSEA_H
+
+/* Define to 1 if your kpathsea has kpse_enc_format. */
+#undef HAVE_KPSE_ENC_FORMATS
+
+/* Define to 1 if you have the `kpse_program_basename' function. */
+#undef HAVE_KPSE_PROGRAM_BASENAME
+
+/* Define to 1 if you have the `gd' library (-lgd). */
+#undef HAVE_LIBGD
+
+/* Define to 1 if you have the `kpathsea' library (-lkpathsea). */
+#undef HAVE_LIBKPATHSEA
+
+/* Define to 1 if you have the `png' library (-lpng). */
+#undef HAVE_LIBPNG
+
+/* Define to 1 if you have the `z' library (-lz). */
+#undef HAVE_LIBZ
+
+/* Define to 1 if you have the <limits.h> header file. */
+#undef HAVE_LIMITS_H
+
+/* Define to 1 if you have the `memcmp' function. */
+#undef HAVE_MEMCMP
+
+/* Define to 1 if you have the `memcpy' function. */
+#undef HAVE_MEMCPY
+
+/* Define to 1 if you have the <memory.h> header file. */
+#undef HAVE_MEMORY_H
+
+/* Define to 1 if you have the `memset' function. */
+#undef HAVE_MEMSET
+
+/* Define to 1 if you have the `mkstemp' function. */
+#undef HAVE_MKSTEMP
+
+/* Define to 1 if you have the `mktemp' function. */
+#undef HAVE_MKTEMP
+
+/* Define to 1 if you have a working `mmap' system call. */
+#undef HAVE_MMAP
+
+/* Define to 1 if you have the `munmap' function. */
+#undef HAVE_MUNMAP
+
+/* Define to 1 if you have the <ndir.h> header file, and it defines `DIR'. */
+#undef HAVE_NDIR_H
+
+/* Define to 1 if you have the <png.h> header file. */
+#undef HAVE_PNG_H
+
+/* Define to 1 if you have the `pow' function. */
+#undef HAVE_POW
+
+/* Define to 1 if you have the `putenv' function. */
+#undef HAVE_PUTENV
+
+/* Define to 1 if you have the <pwd.h> header file. */
+#undef HAVE_PWD_H
+
+/* Define to 1 if stdbool.h conforms to C99. */
+#undef HAVE_STDBOOL_H
+
+/* Define to 1 if you have the <stdint.h> header file. */
+#undef HAVE_STDINT_H
+
+/* Define to 1 if you have the <stdlib.h> header file. */
+#undef HAVE_STDLIB_H
+
+/* Define to 1 if you have the `strchr' function. */
+#undef HAVE_STRCHR
+
+/* Define to 1 if you have the <strings.h> header file. */
+#undef HAVE_STRINGS_H
+
+/* Define to 1 if you have the <string.h> header file. */
+#undef HAVE_STRING_H
+
+/* Define to 1 if you have the `strrchr' function. */
+#undef HAVE_STRRCHR
+
+/* Define to 1 if `st_mtim' is a member of `struct stat'. */
+#undef HAVE_STRUCT_STAT_ST_MTIM
+
+/* Define to 1 if you have the <sys/dir.h> header file, and it defines `DIR'.
+ */
+#undef HAVE_SYS_DIR_H
+
+/* Define to 1 if you have the <sys/ndir.h> header file, and it defines `DIR'.
+ */
+#undef HAVE_SYS_NDIR_H
+
+/* Define to 1 if you have the <sys/param.h> header file. */
+#undef HAVE_SYS_PARAM_H
+
+/* Define to 1 if you have the <sys/stat.h> header file. */
+#undef HAVE_SYS_STAT_H
+
+/* Define to 1 if you have the <sys/time.h> header file. */
+#undef HAVE_SYS_TIME_H
+
+/* Define to 1 if you have the <sys/types.h> header file. */
+#undef HAVE_SYS_TYPES_H
+
+/* Define to 1 if you have <sys/wait.h> that is POSIX.1 compatible. */
+#undef HAVE_SYS_WAIT_H
+
+/* Define to 1 if you have the `texlive_gs_init' function. */
+#undef HAVE_TEXLIVE_GS_INIT
+
+/* Define to 1 if you have the <unistd.h> header file. */
+#undef HAVE_UNISTD_H
+
+/* Define to 1 if you have the `vprintf' function. */
+#undef HAVE_VPRINTF
+
+/* Define to 1 if the system has the type `_Bool'. */
+#undef HAVE__BOOL
+
+/* Define to the sub-directory where libtool stores uninstalled libraries. */
+#undef LT_OBJDIR
+
+/* Name of package */
+#undef PACKAGE
+
+/* Define to the address where bug reports for this package should be sent. */
+#undef PACKAGE_BUGREPORT
+
+/* Define to the full name of this package. */
+#undef PACKAGE_NAME
+
+/* Define to the full name and version of this package. */
+#undef PACKAGE_STRING
+
+/* Define to the one symbol short name of this package. */
+#undef PACKAGE_TARNAME
+
+/* Define to the home page for this package. */
+#undef PACKAGE_URL
+
+/* Define to the version of this package. */
+#undef PACKAGE_VERSION
+
+/* Define to 1 if you have the ANSI C header files. */
+#undef STDC_HEADERS
+
+/* Define to 1 if you can safely include both <sys/time.h> and <time.h>. */
+#undef TIME_WITH_SYS_TIME
+
+/* Define as 1 to get execution time output. */
+#undef TIMING
+
+/* Version number of package */
+#undef VERSION
+
+/* Define to 1 if <zlib.h> declares 'z_const'. */
+#undef ZLIB_CONST
+
+/* Enable large inode numbers on Mac OS X 10.5. */
+#ifndef _DARWIN_USE_64_BIT_INODE
+# define _DARWIN_USE_64_BIT_INODE 1
+#endif
+
+/* Number of bits in a file offset, on hosts where this is settable. */
+#undef _FILE_OFFSET_BITS
+
+/* Define to 1 to make fseeko visible on some hosts (e.g. glibc 2.2). */
+#undef _LARGEFILE_SOURCE
+
+/* Define for large files, on AIX-style hosts. */
+#undef _LARGE_FILES
+
+/* Define for Solaris 2.5.1 so the uint64_t typedef from <sys/synch.h>,
+ <pthread.h>, or <semaphore.h> is not used. If the typedef were allowed, the
+ #define below would cause a syntax error. */
+#undef _UINT64_T
+
+/* Define to empty if `const' does not conform to ANSI C. */
+#undef const
+
+/* Define to `__inline__' or `__inline' if that's what the C compiler
+ calls it, or to nothing if 'inline' is not supported under any name. */
+#ifndef __cplusplus
+#undef inline
+#endif
+
+/* Define to the type of a signed integer type of width exactly 64 bits if
+ such a type exists and the standard includes do not define it. */
+#undef int64_t
+
+/* Define to `int' if <sys/types.h> does not define. */
+#undef pid_t
+
+/* Define to `unsigned int' if <sys/types.h> does not define. */
+#undef size_t
+
+/* Define to the type of an unsigned integer type of width exactly 64 bits if
+ such a type exists and the standard includes do not define it. */
+#undef uint64_t
+
+/* Define as empty if not declared in <zlib.h>. */
+#undef z_const
diff --git a/Build/source/texk/dvipng/configure b/Build/source/texk/dvipng/configure
new file mode 100755
index 00000000000..ddad28ab3e0
--- /dev/null
+++ b/Build/source/texk/dvipng/configure
@@ -0,0 +1,19151 @@
+#! /bin/sh
+# Guess values for system-dependent variables and create Makefiles.
+# Generated by GNU Autoconf 2.69 for dvipng (TeX Live) 1.17.
+#
+# Report bugs to <tex-k@tug.org>.
+#
+#
+# Copyright (C) 1992-1996, 1998-2012 Free Software Foundation, Inc.
+#
+#
+# This configure script is free software; the Free Software Foundation
+# gives unlimited permission to copy, distribute and modify it.
+## -------------------- ##
+## M4sh Initialization. ##
+## -------------------- ##
+
+# Be more Bourne compatible
+DUALCASE=1; export DUALCASE # for MKS sh
+if test -n "${ZSH_VERSION+set}" && (emulate sh) >/dev/null 2>&1; then :
+ emulate sh
+ NULLCMD=:
+ # Pre-4.2 versions of Zsh do word splitting on ${1+"$@"}, which
+ # is contrary to our usage. Disable this feature.
+ alias -g '${1+"$@"}'='"$@"'
+ setopt NO_GLOB_SUBST
+else
+ case `(set -o) 2>/dev/null` in #(
+ *posix*) :
+ set -o posix ;; #(
+ *) :
+ ;;
+esac
+fi
+
+
+as_nl='
+'
+export as_nl
+# Printing a long string crashes Solaris 7 /usr/bin/printf.
+as_echo='\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\'
+as_echo=$as_echo$as_echo$as_echo$as_echo$as_echo
+as_echo=$as_echo$as_echo$as_echo$as_echo$as_echo$as_echo
+# Prefer a ksh shell builtin over an external printf program on Solaris,
+# but without wasting forks for bash or zsh.
+if test -z "$BASH_VERSION$ZSH_VERSION" \
+ && (test "X`print -r -- $as_echo`" = "X$as_echo") 2>/dev/null; then
+ as_echo='print -r --'
+ as_echo_n='print -rn --'
+elif (test "X`printf %s $as_echo`" = "X$as_echo") 2>/dev/null; then
+ as_echo='printf %s\n'
+ as_echo_n='printf %s'
+else
+ if test "X`(/usr/ucb/echo -n -n $as_echo) 2>/dev/null`" = "X-n $as_echo"; then
+ as_echo_body='eval /usr/ucb/echo -n "$1$as_nl"'
+ as_echo_n='/usr/ucb/echo -n'
+ else
+ as_echo_body='eval expr "X$1" : "X\\(.*\\)"'
+ as_echo_n_body='eval
+ arg=$1;
+ case $arg in #(
+ *"$as_nl"*)
+ expr "X$arg" : "X\\(.*\\)$as_nl";
+ arg=`expr "X$arg" : ".*$as_nl\\(.*\\)"`;;
+ esac;
+ expr "X$arg" : "X\\(.*\\)" | tr -d "$as_nl"
+ '
+ export as_echo_n_body
+ as_echo_n='sh -c $as_echo_n_body as_echo'
+ fi
+ export as_echo_body
+ as_echo='sh -c $as_echo_body as_echo'
+fi
+
+# The user is always right.
+if test "${PATH_SEPARATOR+set}" != set; then
+ PATH_SEPARATOR=:
+ (PATH='/bin;/bin'; FPATH=$PATH; sh -c :) >/dev/null 2>&1 && {
+ (PATH='/bin:/bin'; FPATH=$PATH; sh -c :) >/dev/null 2>&1 ||
+ PATH_SEPARATOR=';'
+ }
+fi
+
+
+# IFS
+# We need space, tab and new line, in precisely that order. Quoting is
+# there to prevent editors from complaining about space-tab.
+# (If _AS_PATH_WALK were called with IFS unset, it would disable word
+# splitting by setting IFS to empty value.)
+IFS=" "" $as_nl"
+
+# Find who we are. Look in the path if we contain no directory separator.
+as_myself=
+case $0 in #((
+ *[\\/]* ) as_myself=$0 ;;
+ *) as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH
+do
+ IFS=$as_save_IFS
+ test -z "$as_dir" && as_dir=.
+ test -r "$as_dir/$0" && as_myself=$as_dir/$0 && break
+ done
+IFS=$as_save_IFS
+
+ ;;
+esac
+# We did not find ourselves, most probably we were run as `sh COMMAND'
+# in which case we are not to be found in the path.
+if test "x$as_myself" = x; then
+ as_myself=$0
+fi
+if test ! -f "$as_myself"; then
+ $as_echo "$as_myself: error: cannot find myself; rerun with an absolute file name" >&2
+ exit 1
+fi
+
+# Unset variables that we do not need and which cause bugs (e.g. in
+# pre-3.0 UWIN ksh). But do not cause bugs in bash 2.01; the "|| exit 1"
+# suppresses any "Segmentation fault" message there. '((' could
+# trigger a bug in pdksh 5.2.14.
+for as_var in BASH_ENV ENV MAIL MAILPATH
+do eval test x\${$as_var+set} = xset \
+ && ( (unset $as_var) || exit 1) >/dev/null 2>&1 && unset $as_var || :
+done
+PS1='$ '
+PS2='> '
+PS4='+ '
+
+# NLS nuisances.
+LC_ALL=C
+export LC_ALL
+LANGUAGE=C
+export LANGUAGE
+
+# CDPATH.
+(unset CDPATH) >/dev/null 2>&1 && unset CDPATH
+
+# Use a proper internal environment variable to ensure we don't fall
+ # into an infinite loop, continuously re-executing ourselves.
+ if test x"${_as_can_reexec}" != xno && test "x$CONFIG_SHELL" != x; then
+ _as_can_reexec=no; export _as_can_reexec;
+ # We cannot yet assume a decent shell, so we have to provide a
+# neutralization value for shells without unset; and this also
+# works around shells that cannot unset nonexistent variables.
+# Preserve -v and -x to the replacement shell.
+BASH_ENV=/dev/null
+ENV=/dev/null
+(unset BASH_ENV) >/dev/null 2>&1 && unset BASH_ENV ENV
+case $- in # ((((
+ *v*x* | *x*v* ) as_opts=-vx ;;
+ *v* ) as_opts=-v ;;
+ *x* ) as_opts=-x ;;
+ * ) as_opts= ;;
+esac
+exec $CONFIG_SHELL $as_opts "$as_myself" ${1+"$@"}
+# Admittedly, this is quite paranoid, since all the known shells bail
+# out after a failed `exec'.
+$as_echo "$0: could not re-execute with $CONFIG_SHELL" >&2
+as_fn_exit 255
+ fi
+ # We don't want this to propagate to other subprocesses.
+ { _as_can_reexec=; unset _as_can_reexec;}
+if test "x$CONFIG_SHELL" = x; then
+ as_bourne_compatible="if test -n \"\${ZSH_VERSION+set}\" && (emulate sh) >/dev/null 2>&1; then :
+ emulate sh
+ NULLCMD=:
+ # Pre-4.2 versions of Zsh do word splitting on \${1+\"\$@\"}, which
+ # is contrary to our usage. Disable this feature.
+ alias -g '\${1+\"\$@\"}'='\"\$@\"'
+ setopt NO_GLOB_SUBST
+else
+ case \`(set -o) 2>/dev/null\` in #(
+ *posix*) :
+ set -o posix ;; #(
+ *) :
+ ;;
+esac
+fi
+"
+ as_required="as_fn_return () { (exit \$1); }
+as_fn_success () { as_fn_return 0; }
+as_fn_failure () { as_fn_return 1; }
+as_fn_ret_success () { return 0; }
+as_fn_ret_failure () { return 1; }
+
+exitcode=0
+as_fn_success || { exitcode=1; echo as_fn_success failed.; }
+as_fn_failure && { exitcode=1; echo as_fn_failure succeeded.; }
+as_fn_ret_success || { exitcode=1; echo as_fn_ret_success failed.; }
+as_fn_ret_failure && { exitcode=1; echo as_fn_ret_failure succeeded.; }
+if ( set x; as_fn_ret_success y && test x = \"\$1\" ); then :
+
+else
+ exitcode=1; echo positional parameters were not saved.
+fi
+test x\$exitcode = x0 || exit 1
+test -x / || exit 1"
+ as_suggested=" as_lineno_1=";as_suggested=$as_suggested$LINENO;as_suggested=$as_suggested" as_lineno_1a=\$LINENO
+ as_lineno_2=";as_suggested=$as_suggested$LINENO;as_suggested=$as_suggested" as_lineno_2a=\$LINENO
+ eval 'test \"x\$as_lineno_1'\$as_run'\" != \"x\$as_lineno_2'\$as_run'\" &&
+ test \"x\`expr \$as_lineno_1'\$as_run' + 1\`\" = \"x\$as_lineno_2'\$as_run'\"' || exit 1
+
+ test -n \"\${ZSH_VERSION+set}\${BASH_VERSION+set}\" || (
+ ECHO='\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\'
+ ECHO=\$ECHO\$ECHO\$ECHO\$ECHO\$ECHO
+ ECHO=\$ECHO\$ECHO\$ECHO\$ECHO\$ECHO\$ECHO
+ PATH=/empty FPATH=/empty; export PATH FPATH
+ test \"X\`printf %s \$ECHO\`\" = \"X\$ECHO\" \\
+ || test \"X\`print -r -- \$ECHO\`\" = \"X\$ECHO\" ) || exit 1
+test \$(( 1 + 1 )) = 2 || exit 1"
+ if (eval "$as_required") 2>/dev/null; then :
+ as_have_required=yes
+else
+ as_have_required=no
+fi
+ if test x$as_have_required = xyes && (eval "$as_suggested") 2>/dev/null; then :
+
+else
+ as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+as_found=false
+for as_dir in /bin$PATH_SEPARATOR/usr/bin$PATH_SEPARATOR$PATH
+do
+ IFS=$as_save_IFS
+ test -z "$as_dir" && as_dir=.
+ as_found=:
+ case $as_dir in #(
+ /*)
+ for as_base in sh bash ksh sh5; do
+ # Try only shells that exist, to save several forks.
+ as_shell=$as_dir/$as_base
+ if { test -f "$as_shell" || test -f "$as_shell.exe"; } &&
+ { $as_echo "$as_bourne_compatible""$as_required" | as_run=a "$as_shell"; } 2>/dev/null; then :
+ CONFIG_SHELL=$as_shell as_have_required=yes
+ if { $as_echo "$as_bourne_compatible""$as_suggested" | as_run=a "$as_shell"; } 2>/dev/null; then :
+ break 2
+fi
+fi
+ done;;
+ esac
+ as_found=false
+done
+$as_found || { if { test -f "$SHELL" || test -f "$SHELL.exe"; } &&
+ { $as_echo "$as_bourne_compatible""$as_required" | as_run=a "$SHELL"; } 2>/dev/null; then :
+ CONFIG_SHELL=$SHELL as_have_required=yes
+fi; }
+IFS=$as_save_IFS
+
+
+ if test "x$CONFIG_SHELL" != x; then :
+ export CONFIG_SHELL
+ # We cannot yet assume a decent shell, so we have to provide a
+# neutralization value for shells without unset; and this also
+# works around shells that cannot unset nonexistent variables.
+# Preserve -v and -x to the replacement shell.
+BASH_ENV=/dev/null
+ENV=/dev/null
+(unset BASH_ENV) >/dev/null 2>&1 && unset BASH_ENV ENV
+case $- in # ((((
+ *v*x* | *x*v* ) as_opts=-vx ;;
+ *v* ) as_opts=-v ;;
+ *x* ) as_opts=-x ;;
+ * ) as_opts= ;;
+esac
+exec $CONFIG_SHELL $as_opts "$as_myself" ${1+"$@"}
+# Admittedly, this is quite paranoid, since all the known shells bail
+# out after a failed `exec'.
+$as_echo "$0: could not re-execute with $CONFIG_SHELL" >&2
+exit 255
+fi
+
+ if test x$as_have_required = xno; then :
+ $as_echo "$0: This script requires a shell more modern than all"
+ $as_echo "$0: the shells that I found on your system."
+ if test x${ZSH_VERSION+set} = xset ; then
+ $as_echo "$0: In particular, zsh $ZSH_VERSION has bugs and should"
+ $as_echo "$0: be upgraded to zsh 4.3.4 or later."
+ else
+ $as_echo "$0: Please tell bug-autoconf@gnu.org and tex-k@tug.org
+$0: about your system, including any error possibly output
+$0: before this message. Then install a modern shell, or
+$0: manually run the script under such a shell if you do
+$0: have one."
+ fi
+ exit 1
+fi
+fi
+fi
+SHELL=${CONFIG_SHELL-/bin/sh}
+export SHELL
+# Unset more variables known to interfere with behavior of common tools.
+CLICOLOR_FORCE= GREP_OPTIONS=
+unset CLICOLOR_FORCE GREP_OPTIONS
+
+## --------------------- ##
+## M4sh Shell Functions. ##
+## --------------------- ##
+# as_fn_unset VAR
+# ---------------
+# Portably unset VAR.
+as_fn_unset ()
+{
+ { eval $1=; unset $1;}
+}
+as_unset=as_fn_unset
+
+# as_fn_set_status STATUS
+# -----------------------
+# Set $? to STATUS, without forking.
+as_fn_set_status ()
+{
+ return $1
+} # as_fn_set_status
+
+# as_fn_exit STATUS
+# -----------------
+# Exit the shell with STATUS, even in a "trap 0" or "set -e" context.
+as_fn_exit ()
+{
+ set +e
+ as_fn_set_status $1
+ exit $1
+} # as_fn_exit
+
+# as_fn_mkdir_p
+# -------------
+# Create "$as_dir" as a directory, including parents if necessary.
+as_fn_mkdir_p ()
+{
+
+ case $as_dir in #(
+ -*) as_dir=./$as_dir;;
+ esac
+ test -d "$as_dir" || eval $as_mkdir_p || {
+ as_dirs=
+ while :; do
+ case $as_dir in #(
+ *\'*) as_qdir=`$as_echo "$as_dir" | sed "s/'/'\\\\\\\\''/g"`;; #'(
+ *) as_qdir=$as_dir;;
+ esac
+ as_dirs="'$as_qdir' $as_dirs"
+ as_dir=`$as_dirname -- "$as_dir" ||
+$as_expr X"$as_dir" : 'X\(.*[^/]\)//*[^/][^/]*/*$' \| \
+ X"$as_dir" : 'X\(//\)[^/]' \| \
+ X"$as_dir" : 'X\(//\)$' \| \
+ X"$as_dir" : 'X\(/\)' \| . 2>/dev/null ||
+$as_echo X"$as_dir" |
+ sed '/^X\(.*[^/]\)\/\/*[^/][^/]*\/*$/{
+ s//\1/
+ q
+ }
+ /^X\(\/\/\)[^/].*/{
+ s//\1/
+ q
+ }
+ /^X\(\/\/\)$/{
+ s//\1/
+ q
+ }
+ /^X\(\/\).*/{
+ s//\1/
+ q
+ }
+ s/.*/./; q'`
+ test -d "$as_dir" && break
+ done
+ test -z "$as_dirs" || eval "mkdir $as_dirs"
+ } || test -d "$as_dir" || as_fn_error $? "cannot create directory $as_dir"
+
+
+} # as_fn_mkdir_p
+
+# as_fn_executable_p FILE
+# -----------------------
+# Test if FILE is an executable regular file.
+as_fn_executable_p ()
+{
+ test -f "$1" && test -x "$1"
+} # as_fn_executable_p
+# as_fn_append VAR VALUE
+# ----------------------
+# Append the text in VALUE to the end of the definition contained in VAR. Take
+# advantage of any shell optimizations that allow amortized linear growth over
+# repeated appends, instead of the typical quadratic growth present in naive
+# implementations.
+if (eval "as_var=1; as_var+=2; test x\$as_var = x12") 2>/dev/null; then :
+ eval 'as_fn_append ()
+ {
+ eval $1+=\$2
+ }'
+else
+ as_fn_append ()
+ {
+ eval $1=\$$1\$2
+ }
+fi # as_fn_append
+
+# as_fn_arith ARG...
+# ------------------
+# Perform arithmetic evaluation on the ARGs, and store the result in the
+# global $as_val. Take advantage of shells that can avoid forks. The arguments
+# must be portable across $(()) and expr.
+if (eval "test \$(( 1 + 1 )) = 2") 2>/dev/null; then :
+ eval 'as_fn_arith ()
+ {
+ as_val=$(( $* ))
+ }'
+else
+ as_fn_arith ()
+ {
+ as_val=`expr "$@" || test $? -eq 1`
+ }
+fi # as_fn_arith
+
+
+# as_fn_error STATUS ERROR [LINENO LOG_FD]
+# ----------------------------------------
+# Output "`basename $0`: error: ERROR" to stderr. If LINENO and LOG_FD are
+# provided, also output the error to LOG_FD, referencing LINENO. Then exit the
+# script with STATUS, using 1 if that was 0.
+as_fn_error ()
+{
+ as_status=$1; test $as_status -eq 0 && as_status=1
+ if test "$4"; then
+ as_lineno=${as_lineno-"$3"} as_lineno_stack=as_lineno_stack=$as_lineno_stack
+ $as_echo "$as_me:${as_lineno-$LINENO}: error: $2" >&$4
+ fi
+ $as_echo "$as_me: error: $2" >&2
+ as_fn_exit $as_status
+} # as_fn_error
+
+if expr a : '\(a\)' >/dev/null 2>&1 &&
+ test "X`expr 00001 : '.*\(...\)'`" = X001; then
+ as_expr=expr
+else
+ as_expr=false
+fi
+
+if (basename -- /) >/dev/null 2>&1 && test "X`basename -- / 2>&1`" = "X/"; then
+ as_basename=basename
+else
+ as_basename=false
+fi
+
+if (as_dir=`dirname -- /` && test "X$as_dir" = X/) >/dev/null 2>&1; then
+ as_dirname=dirname
+else
+ as_dirname=false
+fi
+
+as_me=`$as_basename -- "$0" ||
+$as_expr X/"$0" : '.*/\([^/][^/]*\)/*$' \| \
+ X"$0" : 'X\(//\)$' \| \
+ X"$0" : 'X\(/\)' \| . 2>/dev/null ||
+$as_echo X/"$0" |
+ sed '/^.*\/\([^/][^/]*\)\/*$/{
+ s//\1/
+ q
+ }
+ /^X\/\(\/\/\)$/{
+ s//\1/
+ q
+ }
+ /^X\/\(\/\).*/{
+ s//\1/
+ q
+ }
+ s/.*/./; q'`
+
+# Avoid depending upon Character Ranges.
+as_cr_letters='abcdefghijklmnopqrstuvwxyz'
+as_cr_LETTERS='ABCDEFGHIJKLMNOPQRSTUVWXYZ'
+as_cr_Letters=$as_cr_letters$as_cr_LETTERS
+as_cr_digits='0123456789'
+as_cr_alnum=$as_cr_Letters$as_cr_digits
+
+
+ as_lineno_1=$LINENO as_lineno_1a=$LINENO
+ as_lineno_2=$LINENO as_lineno_2a=$LINENO
+ eval 'test "x$as_lineno_1'$as_run'" != "x$as_lineno_2'$as_run'" &&
+ test "x`expr $as_lineno_1'$as_run' + 1`" = "x$as_lineno_2'$as_run'"' || {
+ # Blame Lee E. McMahon (1931-1989) for sed's syntax. :-)
+ sed -n '
+ p
+ /[$]LINENO/=
+ ' <$as_myself |
+ sed '
+ s/[$]LINENO.*/&-/
+ t lineno
+ b
+ :lineno
+ N
+ :loop
+ s/[$]LINENO\([^'$as_cr_alnum'_].*\n\)\(.*\)/\2\1\2/
+ t loop
+ s/-\n.*//
+ ' >$as_me.lineno &&
+ chmod +x "$as_me.lineno" ||
+ { $as_echo "$as_me: error: cannot create $as_me.lineno; rerun with a POSIX shell" >&2; as_fn_exit 1; }
+
+ # If we had to re-execute with $CONFIG_SHELL, we're ensured to have
+ # already done that, so ensure we don't try to do so again and fall
+ # in an infinite loop. This has already happened in practice.
+ _as_can_reexec=no; export _as_can_reexec
+ # Don't try to exec as it changes $[0], causing all sort of problems
+ # (the dirname of $[0] is not the place where we might find the
+ # original and so on. Autoconf is especially sensitive to this).
+ . "./$as_me.lineno"
+ # Exit status is that of the last command.
+ exit
+}
+
+ECHO_C= ECHO_N= ECHO_T=
+case `echo -n x` in #(((((
+-n*)
+ case `echo 'xy\c'` in
+ *c*) ECHO_T=' ';; # ECHO_T is single tab character.
+ xy) ECHO_C='\c';;
+ *) echo `echo ksh88 bug on AIX 6.1` > /dev/null
+ ECHO_T=' ';;
+ esac;;
+*)
+ ECHO_N='-n';;
+esac
+
+rm -f conf$$ conf$$.exe conf$$.file
+if test -d conf$$.dir; then
+ rm -f conf$$.dir/conf$$.file
+else
+ rm -f conf$$.dir
+ mkdir conf$$.dir 2>/dev/null
+fi
+if (echo >conf$$.file) 2>/dev/null; then
+ if ln -s conf$$.file conf$$ 2>/dev/null; then
+ as_ln_s='ln -s'
+ # ... but there are two gotchas:
+ # 1) On MSYS, both `ln -s file dir' and `ln file dir' fail.
+ # 2) DJGPP < 2.04 has no symlinks; `ln -s' creates a wrapper executable.
+ # In both cases, we have to default to `cp -pR'.
+ ln -s conf$$.file conf$$.dir 2>/dev/null && test ! -f conf$$.exe ||
+ as_ln_s='cp -pR'
+ elif ln conf$$.file conf$$ 2>/dev/null; then
+ as_ln_s=ln
+ else
+ as_ln_s='cp -pR'
+ fi
+else
+ as_ln_s='cp -pR'
+fi
+rm -f conf$$ conf$$.exe conf$$.dir/conf$$.file conf$$.file
+rmdir conf$$.dir 2>/dev/null
+
+if mkdir -p . 2>/dev/null; then
+ as_mkdir_p='mkdir -p "$as_dir"'
+else
+ test -d ./-p && rmdir ./-p
+ as_mkdir_p=false
+fi
+
+as_test_x='test -x'
+as_executable_p=as_fn_executable_p
+
+# Sed expression to map a string onto a valid CPP name.
+as_tr_cpp="eval sed 'y%*$as_cr_letters%P$as_cr_LETTERS%;s%[^_$as_cr_alnum]%_%g'"
+
+# Sed expression to map a string onto a valid variable name.
+as_tr_sh="eval sed 'y%*+%pp%;s%[^_$as_cr_alnum]%_%g'"
+
+SHELL=${CONFIG_SHELL-/bin/sh}
+
+
+test -n "$DJDIR" || exec 7<&0 </dev/null
+exec 6>&1
+
+# Name of the host.
+# hostname on some systems (SVR3.2, old GNU/Linux) returns a bogus exit status,
+# so uname gets run too.
+ac_hostname=`(hostname || uname -n) 2>/dev/null | sed 1q`
+
+#
+# Initializations.
+#
+ac_default_prefix=/usr/local
+ac_clean_files=
+ac_config_libobj_dir=.
+LIBOBJS=
+cross_compiling=no
+subdirs=
+MFLAGS=
+MAKEFLAGS=
+
+# Identity of this package.
+PACKAGE_NAME='dvipng (TeX Live)'
+PACKAGE_TARNAME='dvipng--tex-live-'
+PACKAGE_VERSION='1.17'
+PACKAGE_STRING='dvipng (TeX Live) 1.17'
+PACKAGE_BUGREPORT='tex-k@tug.org'
+PACKAGE_URL=''
+
+ac_unique_file="dvipng-src/dvipng.c"
+# Factoring default headers for most tests.
+ac_includes_default="\
+#include <stdio.h>
+#ifdef HAVE_SYS_TYPES_H
+# include <sys/types.h>
+#endif
+#ifdef HAVE_SYS_STAT_H
+# include <sys/stat.h>
+#endif
+#ifdef STDC_HEADERS
+# include <stdlib.h>
+# include <stddef.h>
+#else
+# ifdef HAVE_STDLIB_H
+# include <stdlib.h>
+# endif
+#endif
+#ifdef HAVE_STRING_H
+# if !defined STDC_HEADERS && defined HAVE_MEMORY_H
+# include <memory.h>
+# endif
+# include <string.h>
+#endif
+#ifdef HAVE_STRINGS_H
+# include <strings.h>
+#endif
+#ifdef HAVE_INTTYPES_H
+# include <inttypes.h>
+#endif
+#ifdef HAVE_STDINT_H
+# include <stdint.h>
+#endif
+#ifdef HAVE_UNISTD_H
+# include <unistd.h>
+#endif"
+
+ac_header_list=
+ac_subst_vars='am__EXEEXT_FALSE
+am__EXEEXT_TRUE
+LTLIBOBJS
+WIN32_CALL_FALSE
+WIN32_CALL_TRUE
+WIN32_FALSE
+WIN32_TRUE
+DVIPNG_TREE
+have_gif_FALSE
+have_gif_TRUE
+have_ft2_FALSE
+have_ft2_TRUE
+GD_RULE
+GD_DEPEND
+GD_LIBS
+GD_INCLUDES
+FREETYPE2_RULE
+FREETYPE2_DEPEND
+FREETYPE2_LIBS
+FREETYPE2_INCLUDES
+FT2_CONFIG
+LIBPNG_RULE
+LIBPNG_DEPEND
+LIBPNG_LIBS
+LIBPNG_INCLUDES
+ZLIB_RULE
+ZLIB_DEPEND
+ZLIB_LIBS
+ZLIB_INCLUDES
+KPATHSEA_RULE
+KPATHSEA_DEPEND
+KPATHSEA_LIBS
+KPATHSEA_INCLUDES
+PKG_CONFIG
+INSTALL_INFO
+AM_MAKEINFOFLAGS
+LIBOBJS
+POW_LIB
+GS
+cross_FALSE
+cross_TRUE
+CPP
+LT_SYS_LIBRARY_PATH
+OTOOL64
+OTOOL
+LIPO
+NMEDIT
+DSYMUTIL
+MANIFEST_TOOL
+RANLIB
+ac_ct_AR
+AR
+LN_S
+NM
+ac_ct_DUMPBIN
+DUMPBIN
+LD
+FGREP
+EGREP
+GREP
+SED
+host_os
+host_vendor
+host_cpu
+host
+build_os
+build_vendor
+build_cpu
+build
+LIBTOOL
+OBJDUMP
+DLLTOOL
+AS
+WARNING_CFLAGS
+am__fastdepCC_FALSE
+am__fastdepCC_TRUE
+CCDEPMODE
+am__nodep
+AMDEPBACKSLASH
+AMDEP_FALSE
+AMDEP_TRUE
+am__include
+DEPDIR
+OBJEXT
+EXEEXT
+ac_ct_CC
+CPPFLAGS
+LDFLAGS
+CFLAGS
+CC
+MAINT
+MAINTAINER_MODE_FALSE
+MAINTAINER_MODE_TRUE
+AM_BACKSLASH
+AM_DEFAULT_VERBOSITY
+AM_DEFAULT_V
+AM_V
+am__untar
+am__tar
+AMTAR
+am__leading_dot
+SET_MAKE
+AWK
+mkdir_p
+MKDIR_P
+INSTALL_STRIP_PROGRAM
+STRIP
+install_sh
+MAKEINFO
+AUTOHEADER
+AUTOMAKE
+AUTOCONF
+ACLOCAL
+VERSION
+PACKAGE
+CYGPATH_W
+am__isrc
+INSTALL_DATA
+INSTALL_SCRIPT
+INSTALL_PROGRAM
+target_alias
+host_alias
+build_alias
+LIBS
+ECHO_T
+ECHO_N
+ECHO_C
+DEFS
+mandir
+localedir
+libdir
+psdir
+pdfdir
+dvidir
+htmldir
+infodir
+docdir
+oldincludedir
+includedir
+localstatedir
+sharedstatedir
+sysconfdir
+datadir
+datarootdir
+libexecdir
+sbindir
+bindir
+program_transform_name
+prefix
+exec_prefix
+PACKAGE_URL
+PACKAGE_BUGREPORT
+PACKAGE_STRING
+PACKAGE_VERSION
+PACKAGE_TARNAME
+PACKAGE_NAME
+PATH_SEPARATOR
+SHELL
+am__quote'
+ac_subst_files=''
+ac_user_opts='
+enable_option_checking
+enable_silent_rules
+enable_maintainer_mode
+enable_dependency_tracking
+enable_compiler_warnings
+enable_shared
+enable_static
+with_pic
+enable_fast_install
+with_aix_soname
+with_gnu_ld
+with_sysroot
+enable_libtool_lock
+enable_largefile
+enable_debug
+enable_timing
+with_gs
+with_system_kpathsea
+with_system_zlib
+with_zlib_includes
+with_zlib_libdir
+with_system_libpng
+with_system_freetype2
+with_system_gd
+with_gd_includes
+with_gd_libdir
+'
+ ac_precious_vars='build_alias
+host_alias
+target_alias
+CC
+CFLAGS
+LDFLAGS
+LIBS
+CPPFLAGS
+LT_SYS_LIBRARY_PATH
+CPP'
+
+
+# Initialize some variables set by options.
+ac_init_help=
+ac_init_version=false
+ac_unrecognized_opts=
+ac_unrecognized_sep=
+# The variables have the same names as the options, with
+# dashes changed to underlines.
+cache_file=/dev/null
+exec_prefix=NONE
+no_create=
+no_recursion=
+prefix=NONE
+program_prefix=NONE
+program_suffix=NONE
+program_transform_name=s,x,x,
+silent=
+site=
+srcdir=
+verbose=
+x_includes=NONE
+x_libraries=NONE
+
+# Installation directory options.
+# These are left unexpanded so users can "make install exec_prefix=/foo"
+# and all the variables that are supposed to be based on exec_prefix
+# by default will actually change.
+# Use braces instead of parens because sh, perl, etc. also accept them.
+# (The list follows the same order as the GNU Coding Standards.)
+bindir='${exec_prefix}/bin'
+sbindir='${exec_prefix}/sbin'
+libexecdir='${exec_prefix}/libexec'
+datarootdir='${prefix}/share'
+datadir='${datarootdir}'
+sysconfdir='${prefix}/etc'
+sharedstatedir='${prefix}/com'
+localstatedir='${prefix}/var'
+includedir='${prefix}/include'
+oldincludedir='/usr/include'
+docdir='${datarootdir}/doc/${PACKAGE_TARNAME}'
+infodir='${datarootdir}/info'
+htmldir='${docdir}'
+dvidir='${docdir}'
+pdfdir='${docdir}'
+psdir='${docdir}'
+libdir='${exec_prefix}/lib'
+localedir='${datarootdir}/locale'
+mandir='${datarootdir}/man'
+
+ac_prev=
+ac_dashdash=
+for ac_option
+do
+ # If the previous option needs an argument, assign it.
+ if test -n "$ac_prev"; then
+ eval $ac_prev=\$ac_option
+ ac_prev=
+ continue
+ fi
+
+ case $ac_option in
+ *=?*) ac_optarg=`expr "X$ac_option" : '[^=]*=\(.*\)'` ;;
+ *=) ac_optarg= ;;
+ *) ac_optarg=yes ;;
+ esac
+
+ # Accept the important Cygnus configure options, so we can diagnose typos.
+
+ case $ac_dashdash$ac_option in
+ --)
+ ac_dashdash=yes ;;
+
+ -bindir | --bindir | --bindi | --bind | --bin | --bi)
+ ac_prev=bindir ;;
+ -bindir=* | --bindir=* | --bindi=* | --bind=* | --bin=* | --bi=*)
+ bindir=$ac_optarg ;;
+
+ -build | --build | --buil | --bui | --bu)
+ ac_prev=build_alias ;;
+ -build=* | --build=* | --buil=* | --bui=* | --bu=*)
+ build_alias=$ac_optarg ;;
+
+ -cache-file | --cache-file | --cache-fil | --cache-fi \
+ | --cache-f | --cache- | --cache | --cach | --cac | --ca | --c)
+ ac_prev=cache_file ;;
+ -cache-file=* | --cache-file=* | --cache-fil=* | --cache-fi=* \
+ | --cache-f=* | --cache-=* | --cache=* | --cach=* | --cac=* | --ca=* | --c=*)
+ cache_file=$ac_optarg ;;
+
+ --config-cache | -C)
+ cache_file=config.cache ;;
+
+ -datadir | --datadir | --datadi | --datad)
+ ac_prev=datadir ;;
+ -datadir=* | --datadir=* | --datadi=* | --datad=*)
+ datadir=$ac_optarg ;;
+
+ -datarootdir | --datarootdir | --datarootdi | --datarootd | --dataroot \
+ | --dataroo | --dataro | --datar)
+ ac_prev=datarootdir ;;
+ -datarootdir=* | --datarootdir=* | --datarootdi=* | --datarootd=* \
+ | --dataroot=* | --dataroo=* | --dataro=* | --datar=*)
+ datarootdir=$ac_optarg ;;
+
+ -disable-* | --disable-*)
+ ac_useropt=`expr "x$ac_option" : 'x-*disable-\(.*\)'`
+ # Reject names that are not valid shell variable names.
+ expr "x$ac_useropt" : ".*[^-+._$as_cr_alnum]" >/dev/null &&
+ as_fn_error $? "invalid feature name: $ac_useropt"
+ ac_useropt_orig=$ac_useropt
+ ac_useropt=`$as_echo "$ac_useropt" | sed 's/[-+.]/_/g'`
+ case $ac_user_opts in
+ *"
+"enable_$ac_useropt"
+"*) ;;
+ *) ac_unrecognized_opts="$ac_unrecognized_opts$ac_unrecognized_sep--disable-$ac_useropt_orig"
+ ac_unrecognized_sep=', ';;
+ esac
+ eval enable_$ac_useropt=no ;;
+
+ -docdir | --docdir | --docdi | --doc | --do)
+ ac_prev=docdir ;;
+ -docdir=* | --docdir=* | --docdi=* | --doc=* | --do=*)
+ docdir=$ac_optarg ;;
+
+ -dvidir | --dvidir | --dvidi | --dvid | --dvi | --dv)
+ ac_prev=dvidir ;;
+ -dvidir=* | --dvidir=* | --dvidi=* | --dvid=* | --dvi=* | --dv=*)
+ dvidir=$ac_optarg ;;
+
+ -enable-* | --enable-*)
+ ac_useropt=`expr "x$ac_option" : 'x-*enable-\([^=]*\)'`
+ # Reject names that are not valid shell variable names.
+ expr "x$ac_useropt" : ".*[^-+._$as_cr_alnum]" >/dev/null &&
+ as_fn_error $? "invalid feature name: $ac_useropt"
+ ac_useropt_orig=$ac_useropt
+ ac_useropt=`$as_echo "$ac_useropt" | sed 's/[-+.]/_/g'`
+ case $ac_user_opts in
+ *"
+"enable_$ac_useropt"
+"*) ;;
+ *) ac_unrecognized_opts="$ac_unrecognized_opts$ac_unrecognized_sep--enable-$ac_useropt_orig"
+ ac_unrecognized_sep=', ';;
+ esac
+ eval enable_$ac_useropt=\$ac_optarg ;;
+
+ -exec-prefix | --exec_prefix | --exec-prefix | --exec-prefi \
+ | --exec-pref | --exec-pre | --exec-pr | --exec-p | --exec- \
+ | --exec | --exe | --ex)
+ ac_prev=exec_prefix ;;
+ -exec-prefix=* | --exec_prefix=* | --exec-prefix=* | --exec-prefi=* \
+ | --exec-pref=* | --exec-pre=* | --exec-pr=* | --exec-p=* | --exec-=* \
+ | --exec=* | --exe=* | --ex=*)
+ exec_prefix=$ac_optarg ;;
+
+ -gas | --gas | --ga | --g)
+ # Obsolete; use --with-gas.
+ with_gas=yes ;;
+
+ -help | --help | --hel | --he | -h)
+ ac_init_help=long ;;
+ -help=r* | --help=r* | --hel=r* | --he=r* | -hr*)
+ ac_init_help=recursive ;;
+ -help=s* | --help=s* | --hel=s* | --he=s* | -hs*)
+ ac_init_help=short ;;
+
+ -host | --host | --hos | --ho)
+ ac_prev=host_alias ;;
+ -host=* | --host=* | --hos=* | --ho=*)
+ host_alias=$ac_optarg ;;
+
+ -htmldir | --htmldir | --htmldi | --htmld | --html | --htm | --ht)
+ ac_prev=htmldir ;;
+ -htmldir=* | --htmldir=* | --htmldi=* | --htmld=* | --html=* | --htm=* \
+ | --ht=*)
+ htmldir=$ac_optarg ;;
+
+ -includedir | --includedir | --includedi | --included | --include \
+ | --includ | --inclu | --incl | --inc)
+ ac_prev=includedir ;;
+ -includedir=* | --includedir=* | --includedi=* | --included=* | --include=* \
+ | --includ=* | --inclu=* | --incl=* | --inc=*)
+ includedir=$ac_optarg ;;
+
+ -infodir | --infodir | --infodi | --infod | --info | --inf)
+ ac_prev=infodir ;;
+ -infodir=* | --infodir=* | --infodi=* | --infod=* | --info=* | --inf=*)
+ infodir=$ac_optarg ;;
+
+ -libdir | --libdir | --libdi | --libd)
+ ac_prev=libdir ;;
+ -libdir=* | --libdir=* | --libdi=* | --libd=*)
+ libdir=$ac_optarg ;;
+
+ -libexecdir | --libexecdir | --libexecdi | --libexecd | --libexec \
+ | --libexe | --libex | --libe)
+ ac_prev=libexecdir ;;
+ -libexecdir=* | --libexecdir=* | --libexecdi=* | --libexecd=* | --libexec=* \
+ | --libexe=* | --libex=* | --libe=*)
+ libexecdir=$ac_optarg ;;
+
+ -localedir | --localedir | --localedi | --localed | --locale)
+ ac_prev=localedir ;;
+ -localedir=* | --localedir=* | --localedi=* | --localed=* | --locale=*)
+ localedir=$ac_optarg ;;
+
+ -localstatedir | --localstatedir | --localstatedi | --localstated \
+ | --localstate | --localstat | --localsta | --localst | --locals)
+ ac_prev=localstatedir ;;
+ -localstatedir=* | --localstatedir=* | --localstatedi=* | --localstated=* \
+ | --localstate=* | --localstat=* | --localsta=* | --localst=* | --locals=*)
+ localstatedir=$ac_optarg ;;
+
+ -mandir | --mandir | --mandi | --mand | --man | --ma | --m)
+ ac_prev=mandir ;;
+ -mandir=* | --mandir=* | --mandi=* | --mand=* | --man=* | --ma=* | --m=*)
+ mandir=$ac_optarg ;;
+
+ -nfp | --nfp | --nf)
+ # Obsolete; use --without-fp.
+ with_fp=no ;;
+
+ -no-create | --no-create | --no-creat | --no-crea | --no-cre \
+ | --no-cr | --no-c | -n)
+ no_create=yes ;;
+
+ -no-recursion | --no-recursion | --no-recursio | --no-recursi \
+ | --no-recurs | --no-recur | --no-recu | --no-rec | --no-re | --no-r)
+ no_recursion=yes ;;
+
+ -oldincludedir | --oldincludedir | --oldincludedi | --oldincluded \
+ | --oldinclude | --oldinclud | --oldinclu | --oldincl | --oldinc \
+ | --oldin | --oldi | --old | --ol | --o)
+ ac_prev=oldincludedir ;;
+ -oldincludedir=* | --oldincludedir=* | --oldincludedi=* | --oldincluded=* \
+ | --oldinclude=* | --oldinclud=* | --oldinclu=* | --oldincl=* | --oldinc=* \
+ | --oldin=* | --oldi=* | --old=* | --ol=* | --o=*)
+ oldincludedir=$ac_optarg ;;
+
+ -prefix | --prefix | --prefi | --pref | --pre | --pr | --p)
+ ac_prev=prefix ;;
+ -prefix=* | --prefix=* | --prefi=* | --pref=* | --pre=* | --pr=* | --p=*)
+ prefix=$ac_optarg ;;
+
+ -program-prefix | --program-prefix | --program-prefi | --program-pref \
+ | --program-pre | --program-pr | --program-p)
+ ac_prev=program_prefix ;;
+ -program-prefix=* | --program-prefix=* | --program-prefi=* \
+ | --program-pref=* | --program-pre=* | --program-pr=* | --program-p=*)
+ program_prefix=$ac_optarg ;;
+
+ -program-suffix | --program-suffix | --program-suffi | --program-suff \
+ | --program-suf | --program-su | --program-s)
+ ac_prev=program_suffix ;;
+ -program-suffix=* | --program-suffix=* | --program-suffi=* \
+ | --program-suff=* | --program-suf=* | --program-su=* | --program-s=*)
+ program_suffix=$ac_optarg ;;
+
+ -program-transform-name | --program-transform-name \
+ | --program-transform-nam | --program-transform-na \
+ | --program-transform-n | --program-transform- \
+ | --program-transform | --program-transfor \
+ | --program-transfo | --program-transf \
+ | --program-trans | --program-tran \
+ | --progr-tra | --program-tr | --program-t)
+ ac_prev=program_transform_name ;;
+ -program-transform-name=* | --program-transform-name=* \
+ | --program-transform-nam=* | --program-transform-na=* \
+ | --program-transform-n=* | --program-transform-=* \
+ | --program-transform=* | --program-transfor=* \
+ | --program-transfo=* | --program-transf=* \
+ | --program-trans=* | --program-tran=* \
+ | --progr-tra=* | --program-tr=* | --program-t=*)
+ program_transform_name=$ac_optarg ;;
+
+ -pdfdir | --pdfdir | --pdfdi | --pdfd | --pdf | --pd)
+ ac_prev=pdfdir ;;
+ -pdfdir=* | --pdfdir=* | --pdfdi=* | --pdfd=* | --pdf=* | --pd=*)
+ pdfdir=$ac_optarg ;;
+
+ -psdir | --psdir | --psdi | --psd | --ps)
+ ac_prev=psdir ;;
+ -psdir=* | --psdir=* | --psdi=* | --psd=* | --ps=*)
+ psdir=$ac_optarg ;;
+
+ -q | -quiet | --quiet | --quie | --qui | --qu | --q \
+ | -silent | --silent | --silen | --sile | --sil)
+ silent=yes ;;
+
+ -sbindir | --sbindir | --sbindi | --sbind | --sbin | --sbi | --sb)
+ ac_prev=sbindir ;;
+ -sbindir=* | --sbindir=* | --sbindi=* | --sbind=* | --sbin=* \
+ | --sbi=* | --sb=*)
+ sbindir=$ac_optarg ;;
+
+ -sharedstatedir | --sharedstatedir | --sharedstatedi \
+ | --sharedstated | --sharedstate | --sharedstat | --sharedsta \
+ | --sharedst | --shareds | --shared | --share | --shar \
+ | --sha | --sh)
+ ac_prev=sharedstatedir ;;
+ -sharedstatedir=* | --sharedstatedir=* | --sharedstatedi=* \
+ | --sharedstated=* | --sharedstate=* | --sharedstat=* | --sharedsta=* \
+ | --sharedst=* | --shareds=* | --shared=* | --share=* | --shar=* \
+ | --sha=* | --sh=*)
+ sharedstatedir=$ac_optarg ;;
+
+ -site | --site | --sit)
+ ac_prev=site ;;
+ -site=* | --site=* | --sit=*)
+ site=$ac_optarg ;;
+
+ -srcdir | --srcdir | --srcdi | --srcd | --src | --sr)
+ ac_prev=srcdir ;;
+ -srcdir=* | --srcdir=* | --srcdi=* | --srcd=* | --src=* | --sr=*)
+ srcdir=$ac_optarg ;;
+
+ -sysconfdir | --sysconfdir | --sysconfdi | --sysconfd | --sysconf \
+ | --syscon | --sysco | --sysc | --sys | --sy)
+ ac_prev=sysconfdir ;;
+ -sysconfdir=* | --sysconfdir=* | --sysconfdi=* | --sysconfd=* | --sysconf=* \
+ | --syscon=* | --sysco=* | --sysc=* | --sys=* | --sy=*)
+ sysconfdir=$ac_optarg ;;
+
+ -target | --target | --targe | --targ | --tar | --ta | --t)
+ ac_prev=target_alias ;;
+ -target=* | --target=* | --targe=* | --targ=* | --tar=* | --ta=* | --t=*)
+ target_alias=$ac_optarg ;;
+
+ -v | -verbose | --verbose | --verbos | --verbo | --verb)
+ verbose=yes ;;
+
+ -version | --version | --versio | --versi | --vers | -V)
+ ac_init_version=: ;;
+
+ -with-* | --with-*)
+ ac_useropt=`expr "x$ac_option" : 'x-*with-\([^=]*\)'`
+ # Reject names that are not valid shell variable names.
+ expr "x$ac_useropt" : ".*[^-+._$as_cr_alnum]" >/dev/null &&
+ as_fn_error $? "invalid package name: $ac_useropt"
+ ac_useropt_orig=$ac_useropt
+ ac_useropt=`$as_echo "$ac_useropt" | sed 's/[-+.]/_/g'`
+ case $ac_user_opts in
+ *"
+"with_$ac_useropt"
+"*) ;;
+ *) ac_unrecognized_opts="$ac_unrecognized_opts$ac_unrecognized_sep--with-$ac_useropt_orig"
+ ac_unrecognized_sep=', ';;
+ esac
+ eval with_$ac_useropt=\$ac_optarg ;;
+
+ -without-* | --without-*)
+ ac_useropt=`expr "x$ac_option" : 'x-*without-\(.*\)'`
+ # Reject names that are not valid shell variable names.
+ expr "x$ac_useropt" : ".*[^-+._$as_cr_alnum]" >/dev/null &&
+ as_fn_error $? "invalid package name: $ac_useropt"
+ ac_useropt_orig=$ac_useropt
+ ac_useropt=`$as_echo "$ac_useropt" | sed 's/[-+.]/_/g'`
+ case $ac_user_opts in
+ *"
+"with_$ac_useropt"
+"*) ;;
+ *) ac_unrecognized_opts="$ac_unrecognized_opts$ac_unrecognized_sep--without-$ac_useropt_orig"
+ ac_unrecognized_sep=', ';;
+ esac
+ eval with_$ac_useropt=no ;;
+
+ --x)
+ # Obsolete; use --with-x.
+ with_x=yes ;;
+
+ -x-includes | --x-includes | --x-include | --x-includ | --x-inclu \
+ | --x-incl | --x-inc | --x-in | --x-i)
+ ac_prev=x_includes ;;
+ -x-includes=* | --x-includes=* | --x-include=* | --x-includ=* | --x-inclu=* \
+ | --x-incl=* | --x-inc=* | --x-in=* | --x-i=*)
+ x_includes=$ac_optarg ;;
+
+ -x-libraries | --x-libraries | --x-librarie | --x-librari \
+ | --x-librar | --x-libra | --x-libr | --x-lib | --x-li | --x-l)
+ ac_prev=x_libraries ;;
+ -x-libraries=* | --x-libraries=* | --x-librarie=* | --x-librari=* \
+ | --x-librar=* | --x-libra=* | --x-libr=* | --x-lib=* | --x-li=* | --x-l=*)
+ x_libraries=$ac_optarg ;;
+
+ -*) as_fn_error $? "unrecognized option: \`$ac_option'
+Try \`$0 --help' for more information"
+ ;;
+
+ *=*)
+ ac_envvar=`expr "x$ac_option" : 'x\([^=]*\)='`
+ # Reject names that are not valid shell variable names.
+ case $ac_envvar in #(
+ '' | [0-9]* | *[!_$as_cr_alnum]* )
+ as_fn_error $? "invalid variable name: \`$ac_envvar'" ;;
+ esac
+ eval $ac_envvar=\$ac_optarg
+ export $ac_envvar ;;
+
+ *)
+ # FIXME: should be removed in autoconf 3.0.
+ $as_echo "$as_me: WARNING: you should use --build, --host, --target" >&2
+ expr "x$ac_option" : ".*[^-._$as_cr_alnum]" >/dev/null &&
+ $as_echo "$as_me: WARNING: invalid host type: $ac_option" >&2
+ : "${build_alias=$ac_option} ${host_alias=$ac_option} ${target_alias=$ac_option}"
+ ;;
+
+ esac
+done
+
+if test -n "$ac_prev"; then
+ ac_option=--`echo $ac_prev | sed 's/_/-/g'`
+ as_fn_error $? "missing argument to $ac_option"
+fi
+
+if test -n "$ac_unrecognized_opts"; then
+ case $enable_option_checking in
+ no) ;;
+ fatal) as_fn_error $? "unrecognized options: $ac_unrecognized_opts" ;;
+ *) $as_echo "$as_me: WARNING: unrecognized options: $ac_unrecognized_opts" >&2 ;;
+ esac
+fi
+
+# Check all directory arguments for consistency.
+for ac_var in exec_prefix prefix bindir sbindir libexecdir datarootdir \
+ datadir sysconfdir sharedstatedir localstatedir includedir \
+ oldincludedir docdir infodir htmldir dvidir pdfdir psdir \
+ libdir localedir mandir
+do
+ eval ac_val=\$$ac_var
+ # Remove trailing slashes.
+ case $ac_val in
+ */ )
+ ac_val=`expr "X$ac_val" : 'X\(.*[^/]\)' \| "X$ac_val" : 'X\(.*\)'`
+ eval $ac_var=\$ac_val;;
+ esac
+ # Be sure to have absolute directory names.
+ case $ac_val in
+ [\\/$]* | ?:[\\/]* ) continue;;
+ NONE | '' ) case $ac_var in *prefix ) continue;; esac;;
+ esac
+ as_fn_error $? "expected an absolute directory name for --$ac_var: $ac_val"
+done
+
+# There might be people who depend on the old broken behavior: `$host'
+# used to hold the argument of --host etc.
+# FIXME: To remove some day.
+build=$build_alias
+host=$host_alias
+target=$target_alias
+
+# FIXME: To remove some day.
+if test "x$host_alias" != x; then
+ if test "x$build_alias" = x; then
+ cross_compiling=maybe
+ elif test "x$build_alias" != "x$host_alias"; then
+ cross_compiling=yes
+ fi
+fi
+
+ac_tool_prefix=
+test -n "$host_alias" && ac_tool_prefix=$host_alias-
+
+test "$silent" = yes && exec 6>/dev/null
+
+
+ac_pwd=`pwd` && test -n "$ac_pwd" &&
+ac_ls_di=`ls -di .` &&
+ac_pwd_ls_di=`cd "$ac_pwd" && ls -di .` ||
+ as_fn_error $? "working directory cannot be determined"
+test "X$ac_ls_di" = "X$ac_pwd_ls_di" ||
+ as_fn_error $? "pwd does not report name of working directory"
+
+
+# Find the source files, if location was not specified.
+if test -z "$srcdir"; then
+ ac_srcdir_defaulted=yes
+ # Try the directory containing this script, then the parent directory.
+ ac_confdir=`$as_dirname -- "$as_myself" ||
+$as_expr X"$as_myself" : 'X\(.*[^/]\)//*[^/][^/]*/*$' \| \
+ X"$as_myself" : 'X\(//\)[^/]' \| \
+ X"$as_myself" : 'X\(//\)$' \| \
+ X"$as_myself" : 'X\(/\)' \| . 2>/dev/null ||
+$as_echo X"$as_myself" |
+ sed '/^X\(.*[^/]\)\/\/*[^/][^/]*\/*$/{
+ s//\1/
+ q
+ }
+ /^X\(\/\/\)[^/].*/{
+ s//\1/
+ q
+ }
+ /^X\(\/\/\)$/{
+ s//\1/
+ q
+ }
+ /^X\(\/\).*/{
+ s//\1/
+ q
+ }
+ s/.*/./; q'`
+ srcdir=$ac_confdir
+ if test ! -r "$srcdir/$ac_unique_file"; then
+ srcdir=..
+ fi
+else
+ ac_srcdir_defaulted=no
+fi
+if test ! -r "$srcdir/$ac_unique_file"; then
+ test "$ac_srcdir_defaulted" = yes && srcdir="$ac_confdir or .."
+ as_fn_error $? "cannot find sources ($ac_unique_file) in $srcdir"
+fi
+ac_msg="sources are in $srcdir, but \`cd $srcdir' does not work"
+ac_abs_confdir=`(
+ cd "$srcdir" && test -r "./$ac_unique_file" || as_fn_error $? "$ac_msg"
+ pwd)`
+# When building in place, set srcdir=.
+if test "$ac_abs_confdir" = "$ac_pwd"; then
+ srcdir=.
+fi
+# Remove unnecessary trailing slashes from srcdir.
+# Double slashes in file names in object file debugging info
+# mess up M-x gdb in Emacs.
+case $srcdir in
+*/) srcdir=`expr "X$srcdir" : 'X\(.*[^/]\)' \| "X$srcdir" : 'X\(.*\)'`;;
+esac
+for ac_var in $ac_precious_vars; do
+ eval ac_env_${ac_var}_set=\${${ac_var}+set}
+ eval ac_env_${ac_var}_value=\$${ac_var}
+ eval ac_cv_env_${ac_var}_set=\${${ac_var}+set}
+ eval ac_cv_env_${ac_var}_value=\$${ac_var}
+done
+
+#
+# Report the --help message.
+#
+if test "$ac_init_help" = "long"; then
+ # Omit some internal or obsolete options to make the list less imposing.
+ # This message is too long to be a string in the A/UX 3.1 sh.
+ cat <<_ACEOF
+\`configure' configures dvipng (TeX Live) 1.17 to adapt to many kinds of systems.
+
+Usage: $0 [OPTION]... [VAR=VALUE]...
+
+To assign environment variables (e.g., CC, CFLAGS...), specify them as
+VAR=VALUE. See below for descriptions of some of the useful variables.
+
+Defaults for the options are specified in brackets.
+
+Configuration:
+ -h, --help display this help and exit
+ --help=short display options specific to this package
+ --help=recursive display the short help of all the included packages
+ -V, --version display version information and exit
+ -q, --quiet, --silent do not print \`checking ...' messages
+ --cache-file=FILE cache test results in FILE [disabled]
+ -C, --config-cache alias for \`--cache-file=config.cache'
+ -n, --no-create do not create output files
+ --srcdir=DIR find the sources in DIR [configure dir or \`..']
+
+Installation directories:
+ --prefix=PREFIX install architecture-independent files in PREFIX
+ [$ac_default_prefix]
+ --exec-prefix=EPREFIX install architecture-dependent files in EPREFIX
+ [PREFIX]
+
+By default, \`make install' will install all the files in
+\`$ac_default_prefix/bin', \`$ac_default_prefix/lib' etc. You can specify
+an installation prefix other than \`$ac_default_prefix' using \`--prefix',
+for instance \`--prefix=\$HOME'.
+
+For better control, use the options below.
+
+Fine tuning of the installation directories:
+ --bindir=DIR user executables [EPREFIX/bin]
+ --sbindir=DIR system admin executables [EPREFIX/sbin]
+ --libexecdir=DIR program executables [EPREFIX/libexec]
+ --sysconfdir=DIR read-only single-machine data [PREFIX/etc]
+ --sharedstatedir=DIR modifiable architecture-independent data [PREFIX/com]
+ --localstatedir=DIR modifiable single-machine data [PREFIX/var]
+ --libdir=DIR object code libraries [EPREFIX/lib]
+ --includedir=DIR C header files [PREFIX/include]
+ --oldincludedir=DIR C header files for non-gcc [/usr/include]
+ --datarootdir=DIR read-only arch.-independent data root [PREFIX/share]
+ --datadir=DIR read-only architecture-independent data [DATAROOTDIR]
+ --infodir=DIR info documentation [DATAROOTDIR/info]
+ --localedir=DIR locale-dependent data [DATAROOTDIR/locale]
+ --mandir=DIR man documentation [DATAROOTDIR/man]
+ --docdir=DIR documentation root
+ [DATAROOTDIR/doc/dvipng--tex-live-]
+ --htmldir=DIR html documentation [DOCDIR]
+ --dvidir=DIR dvi documentation [DOCDIR]
+ --pdfdir=DIR pdf documentation [DOCDIR]
+ --psdir=DIR ps documentation [DOCDIR]
+_ACEOF
+
+ cat <<\_ACEOF
+
+Program names:
+ --program-prefix=PREFIX prepend PREFIX to installed program names
+ --program-suffix=SUFFIX append SUFFIX to installed program names
+ --program-transform-name=PROGRAM run sed PROGRAM on installed program names
+
+System types:
+ --build=BUILD configure for building on BUILD [guessed]
+ --host=HOST cross-compile to build programs to run on HOST [BUILD]
+_ACEOF
+fi
+
+if test -n "$ac_init_help"; then
+ case $ac_init_help in
+ short | recursive ) echo "Configuration of dvipng (TeX Live) 1.17:";;
+ esac
+ cat <<\_ACEOF
+
+Optional Features:
+ --disable-option-checking ignore unrecognized --enable/--with options
+ --disable-FEATURE do not include FEATURE (same as --enable-FEATURE=no)
+ --enable-FEATURE[=ARG] include FEATURE [ARG=yes]
+ --enable-silent-rules less verbose build output (undo: "make V=1")
+ --disable-silent-rules verbose build output (undo: "make V=0")
+ --enable-maintainer-mode
+ enable make rules and dependencies not useful (and
+ sometimes confusing) to the casual installer
+ --enable-dependency-tracking
+ do not reject slow dependency extractors
+ --disable-dependency-tracking
+ speeds up one-time build
+ --enable-compiler-warnings=[no|min|yes|max|all]
+ Turn on compiler warnings [default: yes if
+ maintainer-mode, min otherwise]
+ --enable-shared[=PKGS] build shared libraries [default=yes]
+ --enable-static[=PKGS] build static libraries [default=yes]
+ --enable-fast-install[=PKGS]
+ optimize for fast installation [default=yes]
+ --disable-libtool-lock avoid locking (might break parallel builds)
+ --disable-largefile omit support for large files
+ --disable-debug Compile without debug (-d) option
+ --enable-timing Output execution time of dvipng
+
+Optional Packages:
+ --with-PACKAGE[=ARG] use PACKAGE [ARG=yes]
+ --without-PACKAGE do not use PACKAGE (same as --with-PACKAGE=no)
+ --with-pic[=PKGS] try to use only PIC/non-PIC objects [default=use
+ both]
+ --with-aix-soname=aix|svr4|both
+ shared library versioning (aka "SONAME") variant to
+ provide on AIX, [default=aix].
+ --with-gnu-ld assume the C compiler uses GNU ld [default=no]
+ --with-sysroot[=DIR] Search for dependent libraries within DIR (or the
+ compiler's sysroot if not specified).
+ --with-gs=/PATH/TO/gs Hard-wire the location of GhostScript
+ --with-system-kpathsea use installed kpathsea headers and library (requires
+ pkg-config)
+ --with-system-zlib use installed zlib headers and library
+ --with-zlib-includes=DIR
+ zlib headers installed in DIR
+ --with-zlib-libdir=DIR zlib library installed in DIR
+ --with-system-libpng use installed libpng headers and library (requires
+ pkg-config)
+ --with-system-freetype2 use installed freetype2 headers and library
+ (requires freetype-config)
+ --with-system-gd use installed gd headers and library
+ --with-gd-includes=DIR gd headers installed in DIR
+ --with-gd-libdir=DIR gd library installed in DIR
+
+Some influential environment variables:
+ CC C compiler command
+ CFLAGS C compiler flags
+ LDFLAGS linker flags, e.g. -L<lib dir> if you have libraries in a
+ nonstandard directory <lib dir>
+ LIBS libraries to pass to the linker, e.g. -l<library>
+ CPPFLAGS (Objective) C/C++ preprocessor flags, e.g. -I<include dir> if
+ you have headers in a nonstandard directory <include dir>
+ LT_SYS_LIBRARY_PATH
+ User-defined run-time library search path.
+ CPP C preprocessor
+
+Use these variables to override the choices made by `configure' or to help
+it to find libraries and programs with nonstandard names/locations.
+
+Report bugs to <tex-k@tug.org>.
+_ACEOF
+ac_status=$?
+fi
+
+if test "$ac_init_help" = "recursive"; then
+ # If there are subdirs, report their specific --help.
+ for ac_dir in : $ac_subdirs_all; do test "x$ac_dir" = x: && continue
+ test -d "$ac_dir" ||
+ { cd "$srcdir" && ac_pwd=`pwd` && srcdir=. && test -d "$ac_dir"; } ||
+ continue
+ ac_builddir=.
+
+case "$ac_dir" in
+.) ac_dir_suffix= ac_top_builddir_sub=. ac_top_build_prefix= ;;
+*)
+ ac_dir_suffix=/`$as_echo "$ac_dir" | sed 's|^\.[\\/]||'`
+ # A ".." for each directory in $ac_dir_suffix.
+ ac_top_builddir_sub=`$as_echo "$ac_dir_suffix" | sed 's|/[^\\/]*|/..|g;s|/||'`
+ case $ac_top_builddir_sub in
+ "") ac_top_builddir_sub=. ac_top_build_prefix= ;;
+ *) ac_top_build_prefix=$ac_top_builddir_sub/ ;;
+ esac ;;
+esac
+ac_abs_top_builddir=$ac_pwd
+ac_abs_builddir=$ac_pwd$ac_dir_suffix
+# for backward compatibility:
+ac_top_builddir=$ac_top_build_prefix
+
+case $srcdir in
+ .) # We are building in place.
+ ac_srcdir=.
+ ac_top_srcdir=$ac_top_builddir_sub
+ ac_abs_top_srcdir=$ac_pwd ;;
+ [\\/]* | ?:[\\/]* ) # Absolute name.
+ ac_srcdir=$srcdir$ac_dir_suffix;
+ ac_top_srcdir=$srcdir
+ ac_abs_top_srcdir=$srcdir ;;
+ *) # Relative name.
+ ac_srcdir=$ac_top_build_prefix$srcdir$ac_dir_suffix
+ ac_top_srcdir=$ac_top_build_prefix$srcdir
+ ac_abs_top_srcdir=$ac_pwd/$srcdir ;;
+esac
+ac_abs_srcdir=$ac_abs_top_srcdir$ac_dir_suffix
+
+ cd "$ac_dir" || { ac_status=$?; continue; }
+ # Check for guested configure.
+ if test -f "$ac_srcdir/configure.gnu"; then
+ echo &&
+ $SHELL "$ac_srcdir/configure.gnu" --help=recursive
+ elif test -f "$ac_srcdir/configure"; then
+ echo &&
+ $SHELL "$ac_srcdir/configure" --help=recursive
+ else
+ $as_echo "$as_me: WARNING: no configuration information is in $ac_dir" >&2
+ fi || ac_status=$?
+ cd "$ac_pwd" || { ac_status=$?; break; }
+ done
+fi
+
+test -n "$ac_init_help" && exit $ac_status
+if $ac_init_version; then
+ cat <<\_ACEOF
+dvipng (TeX Live) configure 1.17
+generated by GNU Autoconf 2.69
+
+Copyright (C) 2012 Free Software Foundation, Inc.
+This configure script is free software; the Free Software Foundation
+gives unlimited permission to copy, distribute and modify it.
+_ACEOF
+ exit
+fi
+
+## ------------------------ ##
+## Autoconf initialization. ##
+## ------------------------ ##
+
+# ac_fn_c_try_compile LINENO
+# --------------------------
+# Try to compile conftest.$ac_ext, and return whether this succeeded.
+ac_fn_c_try_compile ()
+{
+ as_lineno=${as_lineno-"$1"} as_lineno_stack=as_lineno_stack=$as_lineno_stack
+ rm -f conftest.$ac_objext
+ if { { ac_try="$ac_compile"
+case "(($ac_try" in
+ *\"* | *\`* | *\\*) ac_try_echo=\$ac_try;;
+ *) ac_try_echo=$ac_try;;
+esac
+eval ac_try_echo="\"\$as_me:${as_lineno-$LINENO}: $ac_try_echo\""
+$as_echo "$ac_try_echo"; } >&5
+ (eval "$ac_compile") 2>conftest.err
+ ac_status=$?
+ if test -s conftest.err; then
+ grep -v '^ *+' conftest.err >conftest.er1
+ cat conftest.er1 >&5
+ mv -f conftest.er1 conftest.err
+ fi
+ $as_echo "$as_me:${as_lineno-$LINENO}: \$? = $ac_status" >&5
+ test $ac_status = 0; } && {
+ test -z "$ac_c_werror_flag" ||
+ test ! -s conftest.err
+ } && test -s conftest.$ac_objext; then :
+ ac_retval=0
+else
+ $as_echo "$as_me: failed program was:" >&5
+sed 's/^/| /' conftest.$ac_ext >&5
+
+ ac_retval=1
+fi
+ eval $as_lineno_stack; ${as_lineno_stack:+:} unset as_lineno
+ as_fn_set_status $ac_retval
+
+} # ac_fn_c_try_compile
+
+# ac_fn_c_try_link LINENO
+# -----------------------
+# Try to link conftest.$ac_ext, and return whether this succeeded.
+ac_fn_c_try_link ()
+{
+ as_lineno=${as_lineno-"$1"} as_lineno_stack=as_lineno_stack=$as_lineno_stack
+ rm -f conftest.$ac_objext conftest$ac_exeext
+ if { { ac_try="$ac_link"
+case "(($ac_try" in
+ *\"* | *\`* | *\\*) ac_try_echo=\$ac_try;;
+ *) ac_try_echo=$ac_try;;
+esac
+eval ac_try_echo="\"\$as_me:${as_lineno-$LINENO}: $ac_try_echo\""
+$as_echo "$ac_try_echo"; } >&5
+ (eval "$ac_link") 2>conftest.err
+ ac_status=$?
+ if test -s conftest.err; then
+ grep -v '^ *+' conftest.err >conftest.er1
+ cat conftest.er1 >&5
+ mv -f conftest.er1 conftest.err
+ fi
+ $as_echo "$as_me:${as_lineno-$LINENO}: \$? = $ac_status" >&5
+ test $ac_status = 0; } && {
+ test -z "$ac_c_werror_flag" ||
+ test ! -s conftest.err
+ } && test -s conftest$ac_exeext && {
+ test "$cross_compiling" = yes ||
+ test -x conftest$ac_exeext
+ }; then :
+ ac_retval=0
+else
+ $as_echo "$as_me: failed program was:" >&5
+sed 's/^/| /' conftest.$ac_ext >&5
+
+ ac_retval=1
+fi
+ # Delete the IPA/IPO (Inter Procedural Analysis/Optimization) information
+ # created by the PGI compiler (conftest_ipa8_conftest.oo), as it would
+ # interfere with the next link command; also delete a directory that is
+ # left behind by Apple's compiler. We do this before executing the actions.
+ rm -rf conftest.dSYM conftest_ipa8_conftest.oo
+ eval $as_lineno_stack; ${as_lineno_stack:+:} unset as_lineno
+ as_fn_set_status $ac_retval
+
+} # ac_fn_c_try_link
+
+# ac_fn_c_check_header_compile LINENO HEADER VAR INCLUDES
+# -------------------------------------------------------
+# Tests whether HEADER exists and can be compiled using the include files in
+# INCLUDES, setting the cache variable VAR accordingly.
+ac_fn_c_check_header_compile ()
+{
+ as_lineno=${as_lineno-"$1"} as_lineno_stack=as_lineno_stack=$as_lineno_stack
+ { $as_echo "$as_me:${as_lineno-$LINENO}: checking for $2" >&5
+$as_echo_n "checking for $2... " >&6; }
+if eval \${$3+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ cat confdefs.h - <<_ACEOF >conftest.$ac_ext
+/* end confdefs.h. */
+$4
+#include <$2>
+_ACEOF
+if ac_fn_c_try_compile "$LINENO"; then :
+ eval "$3=yes"
+else
+ eval "$3=no"
+fi
+rm -f core conftest.err conftest.$ac_objext conftest.$ac_ext
+fi
+eval ac_res=\$$3
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_res" >&5
+$as_echo "$ac_res" >&6; }
+ eval $as_lineno_stack; ${as_lineno_stack:+:} unset as_lineno
+
+} # ac_fn_c_check_header_compile
+
+# ac_fn_c_try_cpp LINENO
+# ----------------------
+# Try to preprocess conftest.$ac_ext, and return whether this succeeded.
+ac_fn_c_try_cpp ()
+{
+ as_lineno=${as_lineno-"$1"} as_lineno_stack=as_lineno_stack=$as_lineno_stack
+ if { { ac_try="$ac_cpp conftest.$ac_ext"
+case "(($ac_try" in
+ *\"* | *\`* | *\\*) ac_try_echo=\$ac_try;;
+ *) ac_try_echo=$ac_try;;
+esac
+eval ac_try_echo="\"\$as_me:${as_lineno-$LINENO}: $ac_try_echo\""
+$as_echo "$ac_try_echo"; } >&5
+ (eval "$ac_cpp conftest.$ac_ext") 2>conftest.err
+ ac_status=$?
+ if test -s conftest.err; then
+ grep -v '^ *+' conftest.err >conftest.er1
+ cat conftest.er1 >&5
+ mv -f conftest.er1 conftest.err
+ fi
+ $as_echo "$as_me:${as_lineno-$LINENO}: \$? = $ac_status" >&5
+ test $ac_status = 0; } > conftest.i && {
+ test -z "$ac_c_preproc_warn_flag$ac_c_werror_flag" ||
+ test ! -s conftest.err
+ }; then :
+ ac_retval=0
+else
+ $as_echo "$as_me: failed program was:" >&5
+sed 's/^/| /' conftest.$ac_ext >&5
+
+ ac_retval=1
+fi
+ eval $as_lineno_stack; ${as_lineno_stack:+:} unset as_lineno
+ as_fn_set_status $ac_retval
+
+} # ac_fn_c_try_cpp
+
+# ac_fn_c_try_run LINENO
+# ----------------------
+# Try to link conftest.$ac_ext, and return whether this succeeded. Assumes
+# that executables *can* be run.
+ac_fn_c_try_run ()
+{
+ as_lineno=${as_lineno-"$1"} as_lineno_stack=as_lineno_stack=$as_lineno_stack
+ if { { ac_try="$ac_link"
+case "(($ac_try" in
+ *\"* | *\`* | *\\*) ac_try_echo=\$ac_try;;
+ *) ac_try_echo=$ac_try;;
+esac
+eval ac_try_echo="\"\$as_me:${as_lineno-$LINENO}: $ac_try_echo\""
+$as_echo "$ac_try_echo"; } >&5
+ (eval "$ac_link") 2>&5
+ ac_status=$?
+ $as_echo "$as_me:${as_lineno-$LINENO}: \$? = $ac_status" >&5
+ test $ac_status = 0; } && { ac_try='./conftest$ac_exeext'
+ { { case "(($ac_try" in
+ *\"* | *\`* | *\\*) ac_try_echo=\$ac_try;;
+ *) ac_try_echo=$ac_try;;
+esac
+eval ac_try_echo="\"\$as_me:${as_lineno-$LINENO}: $ac_try_echo\""
+$as_echo "$ac_try_echo"; } >&5
+ (eval "$ac_try") 2>&5
+ ac_status=$?
+ $as_echo "$as_me:${as_lineno-$LINENO}: \$? = $ac_status" >&5
+ test $ac_status = 0; }; }; then :
+ ac_retval=0
+else
+ $as_echo "$as_me: program exited with status $ac_status" >&5
+ $as_echo "$as_me: failed program was:" >&5
+sed 's/^/| /' conftest.$ac_ext >&5
+
+ ac_retval=$ac_status
+fi
+ rm -rf conftest.dSYM conftest_ipa8_conftest.oo
+ eval $as_lineno_stack; ${as_lineno_stack:+:} unset as_lineno
+ as_fn_set_status $ac_retval
+
+} # ac_fn_c_try_run
+
+# ac_fn_c_check_func LINENO FUNC VAR
+# ----------------------------------
+# Tests whether FUNC exists, setting the cache variable VAR accordingly
+ac_fn_c_check_func ()
+{
+ as_lineno=${as_lineno-"$1"} as_lineno_stack=as_lineno_stack=$as_lineno_stack
+ { $as_echo "$as_me:${as_lineno-$LINENO}: checking for $2" >&5
+$as_echo_n "checking for $2... " >&6; }
+if eval \${$3+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ cat confdefs.h - <<_ACEOF >conftest.$ac_ext
+/* end confdefs.h. */
+/* Define $2 to an innocuous variant, in case <limits.h> declares $2.
+ For example, HP-UX 11i <limits.h> declares gettimeofday. */
+#define $2 innocuous_$2
+
+/* System header to define __stub macros and hopefully few prototypes,
+ which can conflict with char $2 (); below.
+ Prefer <limits.h> to <assert.h> if __STDC__ is defined, since
+ <limits.h> exists even on freestanding compilers. */
+
+#ifdef __STDC__
+# include <limits.h>
+#else
+# include <assert.h>
+#endif
+
+#undef $2
+
+/* Override any GCC internal prototype to avoid an error.
+ Use char because int might match the return type of a GCC
+ builtin and then its argument prototype would still apply. */
+#ifdef __cplusplus
+extern "C"
+#endif
+char $2 ();
+/* The GNU C library defines this for functions which it implements
+ to always fail with ENOSYS. Some functions are actually named
+ something starting with __ and the normal name is an alias. */
+#if defined __stub_$2 || defined __stub___$2
+choke me
+#endif
+
+int
+main ()
+{
+return $2 ();
+ ;
+ return 0;
+}
+_ACEOF
+if ac_fn_c_try_link "$LINENO"; then :
+ eval "$3=yes"
+else
+ eval "$3=no"
+fi
+rm -f core conftest.err conftest.$ac_objext \
+ conftest$ac_exeext conftest.$ac_ext
+fi
+eval ac_res=\$$3
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_res" >&5
+$as_echo "$ac_res" >&6; }
+ eval $as_lineno_stack; ${as_lineno_stack:+:} unset as_lineno
+
+} # ac_fn_c_check_func
+
+# ac_fn_c_check_header_mongrel LINENO HEADER VAR INCLUDES
+# -------------------------------------------------------
+# Tests whether HEADER exists, giving a warning if it cannot be compiled using
+# the include files in INCLUDES and setting the cache variable VAR
+# accordingly.
+ac_fn_c_check_header_mongrel ()
+{
+ as_lineno=${as_lineno-"$1"} as_lineno_stack=as_lineno_stack=$as_lineno_stack
+ if eval \${$3+:} false; then :
+ { $as_echo "$as_me:${as_lineno-$LINENO}: checking for $2" >&5
+$as_echo_n "checking for $2... " >&6; }
+if eval \${$3+:} false; then :
+ $as_echo_n "(cached) " >&6
+fi
+eval ac_res=\$$3
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_res" >&5
+$as_echo "$ac_res" >&6; }
+else
+ # Is the header compilable?
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking $2 usability" >&5
+$as_echo_n "checking $2 usability... " >&6; }
+cat confdefs.h - <<_ACEOF >conftest.$ac_ext
+/* end confdefs.h. */
+$4
+#include <$2>
+_ACEOF
+if ac_fn_c_try_compile "$LINENO"; then :
+ ac_header_compiler=yes
+else
+ ac_header_compiler=no
+fi
+rm -f core conftest.err conftest.$ac_objext conftest.$ac_ext
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_header_compiler" >&5
+$as_echo "$ac_header_compiler" >&6; }
+
+# Is the header present?
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking $2 presence" >&5
+$as_echo_n "checking $2 presence... " >&6; }
+cat confdefs.h - <<_ACEOF >conftest.$ac_ext
+/* end confdefs.h. */
+#include <$2>
+_ACEOF
+if ac_fn_c_try_cpp "$LINENO"; then :
+ ac_header_preproc=yes
+else
+ ac_header_preproc=no
+fi
+rm -f conftest.err conftest.i conftest.$ac_ext
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_header_preproc" >&5
+$as_echo "$ac_header_preproc" >&6; }
+
+# So? What about this header?
+case $ac_header_compiler:$ac_header_preproc:$ac_c_preproc_warn_flag in #((
+ yes:no: )
+ { $as_echo "$as_me:${as_lineno-$LINENO}: WARNING: $2: accepted by the compiler, rejected by the preprocessor!" >&5
+$as_echo "$as_me: WARNING: $2: accepted by the compiler, rejected by the preprocessor!" >&2;}
+ { $as_echo "$as_me:${as_lineno-$LINENO}: WARNING: $2: proceeding with the compiler's result" >&5
+$as_echo "$as_me: WARNING: $2: proceeding with the compiler's result" >&2;}
+ ;;
+ no:yes:* )
+ { $as_echo "$as_me:${as_lineno-$LINENO}: WARNING: $2: present but cannot be compiled" >&5
+$as_echo "$as_me: WARNING: $2: present but cannot be compiled" >&2;}
+ { $as_echo "$as_me:${as_lineno-$LINENO}: WARNING: $2: check for missing prerequisite headers?" >&5
+$as_echo "$as_me: WARNING: $2: check for missing prerequisite headers?" >&2;}
+ { $as_echo "$as_me:${as_lineno-$LINENO}: WARNING: $2: see the Autoconf documentation" >&5
+$as_echo "$as_me: WARNING: $2: see the Autoconf documentation" >&2;}
+ { $as_echo "$as_me:${as_lineno-$LINENO}: WARNING: $2: section \"Present But Cannot Be Compiled\"" >&5
+$as_echo "$as_me: WARNING: $2: section \"Present But Cannot Be Compiled\"" >&2;}
+ { $as_echo "$as_me:${as_lineno-$LINENO}: WARNING: $2: proceeding with the compiler's result" >&5
+$as_echo "$as_me: WARNING: $2: proceeding with the compiler's result" >&2;}
+( $as_echo "## ---------------------------- ##
+## Report this to tex-k@tug.org ##
+## ---------------------------- ##"
+ ) | sed "s/^/$as_me: WARNING: /" >&2
+ ;;
+esac
+ { $as_echo "$as_me:${as_lineno-$LINENO}: checking for $2" >&5
+$as_echo_n "checking for $2... " >&6; }
+if eval \${$3+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ eval "$3=\$ac_header_compiler"
+fi
+eval ac_res=\$$3
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_res" >&5
+$as_echo "$ac_res" >&6; }
+fi
+ eval $as_lineno_stack; ${as_lineno_stack:+:} unset as_lineno
+
+} # ac_fn_c_check_header_mongrel
+
+# ac_fn_c_check_type LINENO TYPE VAR INCLUDES
+# -------------------------------------------
+# Tests whether TYPE exists after having included INCLUDES, setting cache
+# variable VAR accordingly.
+ac_fn_c_check_type ()
+{
+ as_lineno=${as_lineno-"$1"} as_lineno_stack=as_lineno_stack=$as_lineno_stack
+ { $as_echo "$as_me:${as_lineno-$LINENO}: checking for $2" >&5
+$as_echo_n "checking for $2... " >&6; }
+if eval \${$3+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ eval "$3=no"
+ cat confdefs.h - <<_ACEOF >conftest.$ac_ext
+/* end confdefs.h. */
+$4
+int
+main ()
+{
+if (sizeof ($2))
+ return 0;
+ ;
+ return 0;
+}
+_ACEOF
+if ac_fn_c_try_compile "$LINENO"; then :
+ cat confdefs.h - <<_ACEOF >conftest.$ac_ext
+/* end confdefs.h. */
+$4
+int
+main ()
+{
+if (sizeof (($2)))
+ return 0;
+ ;
+ return 0;
+}
+_ACEOF
+if ac_fn_c_try_compile "$LINENO"; then :
+
+else
+ eval "$3=yes"
+fi
+rm -f core conftest.err conftest.$ac_objext conftest.$ac_ext
+fi
+rm -f core conftest.err conftest.$ac_objext conftest.$ac_ext
+fi
+eval ac_res=\$$3
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_res" >&5
+$as_echo "$ac_res" >&6; }
+ eval $as_lineno_stack; ${as_lineno_stack:+:} unset as_lineno
+
+} # ac_fn_c_check_type
+
+# ac_fn_c_find_intX_t LINENO BITS VAR
+# -----------------------------------
+# Finds a signed integer type with width BITS, setting cache variable VAR
+# accordingly.
+ac_fn_c_find_intX_t ()
+{
+ as_lineno=${as_lineno-"$1"} as_lineno_stack=as_lineno_stack=$as_lineno_stack
+ { $as_echo "$as_me:${as_lineno-$LINENO}: checking for int$2_t" >&5
+$as_echo_n "checking for int$2_t... " >&6; }
+if eval \${$3+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ eval "$3=no"
+ # Order is important - never check a type that is potentially smaller
+ # than half of the expected target width.
+ for ac_type in int$2_t 'int' 'long int' \
+ 'long long int' 'short int' 'signed char'; do
+ cat confdefs.h - <<_ACEOF >conftest.$ac_ext
+/* end confdefs.h. */
+$ac_includes_default
+ enum { N = $2 / 2 - 1 };
+int
+main ()
+{
+static int test_array [1 - 2 * !(0 < ($ac_type) ((((($ac_type) 1 << N) << N) - 1) * 2 + 1))];
+test_array [0] = 0;
+return test_array [0];
+
+ ;
+ return 0;
+}
+_ACEOF
+if ac_fn_c_try_compile "$LINENO"; then :
+ cat confdefs.h - <<_ACEOF >conftest.$ac_ext
+/* end confdefs.h. */
+$ac_includes_default
+ enum { N = $2 / 2 - 1 };
+int
+main ()
+{
+static int test_array [1 - 2 * !(($ac_type) ((((($ac_type) 1 << N) << N) - 1) * 2 + 1)
+ < ($ac_type) ((((($ac_type) 1 << N) << N) - 1) * 2 + 2))];
+test_array [0] = 0;
+return test_array [0];
+
+ ;
+ return 0;
+}
+_ACEOF
+if ac_fn_c_try_compile "$LINENO"; then :
+
+else
+ case $ac_type in #(
+ int$2_t) :
+ eval "$3=yes" ;; #(
+ *) :
+ eval "$3=\$ac_type" ;;
+esac
+fi
+rm -f core conftest.err conftest.$ac_objext conftest.$ac_ext
+fi
+rm -f core conftest.err conftest.$ac_objext conftest.$ac_ext
+ if eval test \"x\$"$3"\" = x"no"; then :
+
+else
+ break
+fi
+ done
+fi
+eval ac_res=\$$3
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_res" >&5
+$as_echo "$ac_res" >&6; }
+ eval $as_lineno_stack; ${as_lineno_stack:+:} unset as_lineno
+
+} # ac_fn_c_find_intX_t
+
+# ac_fn_c_find_uintX_t LINENO BITS VAR
+# ------------------------------------
+# Finds an unsigned integer type with width BITS, setting cache variable VAR
+# accordingly.
+ac_fn_c_find_uintX_t ()
+{
+ as_lineno=${as_lineno-"$1"} as_lineno_stack=as_lineno_stack=$as_lineno_stack
+ { $as_echo "$as_me:${as_lineno-$LINENO}: checking for uint$2_t" >&5
+$as_echo_n "checking for uint$2_t... " >&6; }
+if eval \${$3+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ eval "$3=no"
+ # Order is important - never check a type that is potentially smaller
+ # than half of the expected target width.
+ for ac_type in uint$2_t 'unsigned int' 'unsigned long int' \
+ 'unsigned long long int' 'unsigned short int' 'unsigned char'; do
+ cat confdefs.h - <<_ACEOF >conftest.$ac_ext
+/* end confdefs.h. */
+$ac_includes_default
+int
+main ()
+{
+static int test_array [1 - 2 * !((($ac_type) -1 >> ($2 / 2 - 1)) >> ($2 / 2 - 1) == 3)];
+test_array [0] = 0;
+return test_array [0];
+
+ ;
+ return 0;
+}
+_ACEOF
+if ac_fn_c_try_compile "$LINENO"; then :
+ case $ac_type in #(
+ uint$2_t) :
+ eval "$3=yes" ;; #(
+ *) :
+ eval "$3=\$ac_type" ;;
+esac
+fi
+rm -f core conftest.err conftest.$ac_objext conftest.$ac_ext
+ if eval test \"x\$"$3"\" = x"no"; then :
+
+else
+ break
+fi
+ done
+fi
+eval ac_res=\$$3
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_res" >&5
+$as_echo "$ac_res" >&6; }
+ eval $as_lineno_stack; ${as_lineno_stack:+:} unset as_lineno
+
+} # ac_fn_c_find_uintX_t
+
+# ac_fn_c_check_decl LINENO SYMBOL VAR INCLUDES
+# ---------------------------------------------
+# Tests whether SYMBOL is declared in INCLUDES, setting cache variable VAR
+# accordingly.
+ac_fn_c_check_decl ()
+{
+ as_lineno=${as_lineno-"$1"} as_lineno_stack=as_lineno_stack=$as_lineno_stack
+ as_decl_name=`echo $2|sed 's/ *(.*//'`
+ as_decl_use=`echo $2|sed -e 's/(/((/' -e 's/)/) 0&/' -e 's/,/) 0& (/g'`
+ { $as_echo "$as_me:${as_lineno-$LINENO}: checking whether $as_decl_name is declared" >&5
+$as_echo_n "checking whether $as_decl_name is declared... " >&6; }
+if eval \${$3+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ cat confdefs.h - <<_ACEOF >conftest.$ac_ext
+/* end confdefs.h. */
+$4
+int
+main ()
+{
+#ifndef $as_decl_name
+#ifdef __cplusplus
+ (void) $as_decl_use;
+#else
+ (void) $as_decl_name;
+#endif
+#endif
+
+ ;
+ return 0;
+}
+_ACEOF
+if ac_fn_c_try_compile "$LINENO"; then :
+ eval "$3=yes"
+else
+ eval "$3=no"
+fi
+rm -f core conftest.err conftest.$ac_objext conftest.$ac_ext
+fi
+eval ac_res=\$$3
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_res" >&5
+$as_echo "$ac_res" >&6; }
+ eval $as_lineno_stack; ${as_lineno_stack:+:} unset as_lineno
+
+} # ac_fn_c_check_decl
+
+# ac_fn_c_check_member LINENO AGGR MEMBER VAR INCLUDES
+# ----------------------------------------------------
+# Tries to find if the field MEMBER exists in type AGGR, after including
+# INCLUDES, setting cache variable VAR accordingly.
+ac_fn_c_check_member ()
+{
+ as_lineno=${as_lineno-"$1"} as_lineno_stack=as_lineno_stack=$as_lineno_stack
+ { $as_echo "$as_me:${as_lineno-$LINENO}: checking for $2.$3" >&5
+$as_echo_n "checking for $2.$3... " >&6; }
+if eval \${$4+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ cat confdefs.h - <<_ACEOF >conftest.$ac_ext
+/* end confdefs.h. */
+$5
+int
+main ()
+{
+static $2 ac_aggr;
+if (ac_aggr.$3)
+return 0;
+ ;
+ return 0;
+}
+_ACEOF
+if ac_fn_c_try_compile "$LINENO"; then :
+ eval "$4=yes"
+else
+ cat confdefs.h - <<_ACEOF >conftest.$ac_ext
+/* end confdefs.h. */
+$5
+int
+main ()
+{
+static $2 ac_aggr;
+if (sizeof ac_aggr.$3)
+return 0;
+ ;
+ return 0;
+}
+_ACEOF
+if ac_fn_c_try_compile "$LINENO"; then :
+ eval "$4=yes"
+else
+ eval "$4=no"
+fi
+rm -f core conftest.err conftest.$ac_objext conftest.$ac_ext
+fi
+rm -f core conftest.err conftest.$ac_objext conftest.$ac_ext
+fi
+eval ac_res=\$$4
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_res" >&5
+$as_echo "$ac_res" >&6; }
+ eval $as_lineno_stack; ${as_lineno_stack:+:} unset as_lineno
+
+} # ac_fn_c_check_member
+cat >config.log <<_ACEOF
+This file contains any messages produced by compilers while
+running configure, to aid debugging if configure makes a mistake.
+
+It was created by dvipng (TeX Live) $as_me 1.17, which was
+generated by GNU Autoconf 2.69. Invocation command line was
+
+ $ $0 $@
+
+_ACEOF
+exec 5>>config.log
+{
+cat <<_ASUNAME
+## --------- ##
+## Platform. ##
+## --------- ##
+
+hostname = `(hostname || uname -n) 2>/dev/null | sed 1q`
+uname -m = `(uname -m) 2>/dev/null || echo unknown`
+uname -r = `(uname -r) 2>/dev/null || echo unknown`
+uname -s = `(uname -s) 2>/dev/null || echo unknown`
+uname -v = `(uname -v) 2>/dev/null || echo unknown`
+
+/usr/bin/uname -p = `(/usr/bin/uname -p) 2>/dev/null || echo unknown`
+/bin/uname -X = `(/bin/uname -X) 2>/dev/null || echo unknown`
+
+/bin/arch = `(/bin/arch) 2>/dev/null || echo unknown`
+/usr/bin/arch -k = `(/usr/bin/arch -k) 2>/dev/null || echo unknown`
+/usr/convex/getsysinfo = `(/usr/convex/getsysinfo) 2>/dev/null || echo unknown`
+/usr/bin/hostinfo = `(/usr/bin/hostinfo) 2>/dev/null || echo unknown`
+/bin/machine = `(/bin/machine) 2>/dev/null || echo unknown`
+/usr/bin/oslevel = `(/usr/bin/oslevel) 2>/dev/null || echo unknown`
+/bin/universe = `(/bin/universe) 2>/dev/null || echo unknown`
+
+_ASUNAME
+
+as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH
+do
+ IFS=$as_save_IFS
+ test -z "$as_dir" && as_dir=.
+ $as_echo "PATH: $as_dir"
+ done
+IFS=$as_save_IFS
+
+} >&5
+
+cat >&5 <<_ACEOF
+
+
+## ----------- ##
+## Core tests. ##
+## ----------- ##
+
+_ACEOF
+
+
+# Keep a trace of the command line.
+# Strip out --no-create and --no-recursion so they do not pile up.
+# Strip out --silent because we don't want to record it for future runs.
+# Also quote any args containing shell meta-characters.
+# Make two passes to allow for proper duplicate-argument suppression.
+ac_configure_args=
+ac_configure_args0=
+ac_configure_args1=
+ac_must_keep_next=false
+for ac_pass in 1 2
+do
+ for ac_arg
+ do
+ case $ac_arg in
+ -no-create | --no-c* | -n | -no-recursion | --no-r*) continue ;;
+ -q | -quiet | --quiet | --quie | --qui | --qu | --q \
+ | -silent | --silent | --silen | --sile | --sil)
+ continue ;;
+ *\'*)
+ ac_arg=`$as_echo "$ac_arg" | sed "s/'/'\\\\\\\\''/g"` ;;
+ esac
+ case $ac_pass in
+ 1) as_fn_append ac_configure_args0 " '$ac_arg'" ;;
+ 2)
+ as_fn_append ac_configure_args1 " '$ac_arg'"
+ if test $ac_must_keep_next = true; then
+ ac_must_keep_next=false # Got value, back to normal.
+ else
+ case $ac_arg in
+ *=* | --config-cache | -C | -disable-* | --disable-* \
+ | -enable-* | --enable-* | -gas | --g* | -nfp | --nf* \
+ | -q | -quiet | --q* | -silent | --sil* | -v | -verb* \
+ | -with-* | --with-* | -without-* | --without-* | --x)
+ case "$ac_configure_args0 " in
+ "$ac_configure_args1"*" '$ac_arg' "* ) continue ;;
+ esac
+ ;;
+ -* ) ac_must_keep_next=true ;;
+ esac
+ fi
+ as_fn_append ac_configure_args " '$ac_arg'"
+ ;;
+ esac
+ done
+done
+{ ac_configure_args0=; unset ac_configure_args0;}
+{ ac_configure_args1=; unset ac_configure_args1;}
+
+# When interrupted or exit'd, cleanup temporary files, and complete
+# config.log. We remove comments because anyway the quotes in there
+# would cause problems or look ugly.
+# WARNING: Use '\'' to represent an apostrophe within the trap.
+# WARNING: Do not start the trap code with a newline, due to a FreeBSD 4.0 bug.
+trap 'exit_status=$?
+ # Save into config.log some information that might help in debugging.
+ {
+ echo
+
+ $as_echo "## ---------------- ##
+## Cache variables. ##
+## ---------------- ##"
+ echo
+ # The following way of writing the cache mishandles newlines in values,
+(
+ for ac_var in `(set) 2>&1 | sed -n '\''s/^\([a-zA-Z_][a-zA-Z0-9_]*\)=.*/\1/p'\''`; do
+ eval ac_val=\$$ac_var
+ case $ac_val in #(
+ *${as_nl}*)
+ case $ac_var in #(
+ *_cv_*) { $as_echo "$as_me:${as_lineno-$LINENO}: WARNING: cache variable $ac_var contains a newline" >&5
+$as_echo "$as_me: WARNING: cache variable $ac_var contains a newline" >&2;} ;;
+ esac
+ case $ac_var in #(
+ _ | IFS | as_nl) ;; #(
+ BASH_ARGV | BASH_SOURCE) eval $ac_var= ;; #(
+ *) { eval $ac_var=; unset $ac_var;} ;;
+ esac ;;
+ esac
+ done
+ (set) 2>&1 |
+ case $as_nl`(ac_space='\'' '\''; set) 2>&1` in #(
+ *${as_nl}ac_space=\ *)
+ sed -n \
+ "s/'\''/'\''\\\\'\'''\''/g;
+ s/^\\([_$as_cr_alnum]*_cv_[_$as_cr_alnum]*\\)=\\(.*\\)/\\1='\''\\2'\''/p"
+ ;; #(
+ *)
+ sed -n "/^[_$as_cr_alnum]*_cv_[_$as_cr_alnum]*=/p"
+ ;;
+ esac |
+ sort
+)
+ echo
+
+ $as_echo "## ----------------- ##
+## Output variables. ##
+## ----------------- ##"
+ echo
+ for ac_var in $ac_subst_vars
+ do
+ eval ac_val=\$$ac_var
+ case $ac_val in
+ *\'\''*) ac_val=`$as_echo "$ac_val" | sed "s/'\''/'\''\\\\\\\\'\'''\''/g"`;;
+ esac
+ $as_echo "$ac_var='\''$ac_val'\''"
+ done | sort
+ echo
+
+ if test -n "$ac_subst_files"; then
+ $as_echo "## ------------------- ##
+## File substitutions. ##
+## ------------------- ##"
+ echo
+ for ac_var in $ac_subst_files
+ do
+ eval ac_val=\$$ac_var
+ case $ac_val in
+ *\'\''*) ac_val=`$as_echo "$ac_val" | sed "s/'\''/'\''\\\\\\\\'\'''\''/g"`;;
+ esac
+ $as_echo "$ac_var='\''$ac_val'\''"
+ done | sort
+ echo
+ fi
+
+ if test -s confdefs.h; then
+ $as_echo "## ----------- ##
+## confdefs.h. ##
+## ----------- ##"
+ echo
+ cat confdefs.h
+ echo
+ fi
+ test "$ac_signal" != 0 &&
+ $as_echo "$as_me: caught signal $ac_signal"
+ $as_echo "$as_me: exit $exit_status"
+ } >&5
+ rm -f core *.core core.conftest.* &&
+ rm -f -r conftest* confdefs* conf$$* $ac_clean_files &&
+ exit $exit_status
+' 0
+for ac_signal in 1 2 13 15; do
+ trap 'ac_signal='$ac_signal'; as_fn_exit 1' $ac_signal
+done
+ac_signal=0
+
+# confdefs.h avoids OS command line length limits that DEFS can exceed.
+rm -f -r conftest* confdefs.h
+
+$as_echo "/* confdefs.h */" > confdefs.h
+
+# Predefined preprocessor variables.
+
+cat >>confdefs.h <<_ACEOF
+#define PACKAGE_NAME "$PACKAGE_NAME"
+_ACEOF
+
+cat >>confdefs.h <<_ACEOF
+#define PACKAGE_TARNAME "$PACKAGE_TARNAME"
+_ACEOF
+
+cat >>confdefs.h <<_ACEOF
+#define PACKAGE_VERSION "$PACKAGE_VERSION"
+_ACEOF
+
+cat >>confdefs.h <<_ACEOF
+#define PACKAGE_STRING "$PACKAGE_STRING"
+_ACEOF
+
+cat >>confdefs.h <<_ACEOF
+#define PACKAGE_BUGREPORT "$PACKAGE_BUGREPORT"
+_ACEOF
+
+cat >>confdefs.h <<_ACEOF
+#define PACKAGE_URL "$PACKAGE_URL"
+_ACEOF
+
+
+# Let the site file select an alternate cache file if it wants to.
+# Prefer an explicitly selected file to automatically selected ones.
+ac_site_file1=NONE
+ac_site_file2=NONE
+if test -n "$CONFIG_SITE"; then
+ # We do not want a PATH search for config.site.
+ case $CONFIG_SITE in #((
+ -*) ac_site_file1=./$CONFIG_SITE;;
+ */*) ac_site_file1=$CONFIG_SITE;;
+ *) ac_site_file1=./$CONFIG_SITE;;
+ esac
+elif test "x$prefix" != xNONE; then
+ ac_site_file1=$prefix/share/config.site
+ ac_site_file2=$prefix/etc/config.site
+else
+ ac_site_file1=$ac_default_prefix/share/config.site
+ ac_site_file2=$ac_default_prefix/etc/config.site
+fi
+for ac_site_file in "$ac_site_file1" "$ac_site_file2"
+do
+ test "x$ac_site_file" = xNONE && continue
+ if test /dev/null != "$ac_site_file" && test -r "$ac_site_file"; then
+ { $as_echo "$as_me:${as_lineno-$LINENO}: loading site script $ac_site_file" >&5
+$as_echo "$as_me: loading site script $ac_site_file" >&6;}
+ sed 's/^/| /' "$ac_site_file" >&5
+ . "$ac_site_file" \
+ || { { $as_echo "$as_me:${as_lineno-$LINENO}: error: in \`$ac_pwd':" >&5
+$as_echo "$as_me: error: in \`$ac_pwd':" >&2;}
+as_fn_error $? "failed to load site script $ac_site_file
+See \`config.log' for more details" "$LINENO" 5; }
+ fi
+done
+
+if test -r "$cache_file"; then
+ # Some versions of bash will fail to source /dev/null (special files
+ # actually), so we avoid doing that. DJGPP emulates it as a regular file.
+ if test /dev/null != "$cache_file" && test -f "$cache_file"; then
+ { $as_echo "$as_me:${as_lineno-$LINENO}: loading cache $cache_file" >&5
+$as_echo "$as_me: loading cache $cache_file" >&6;}
+ case $cache_file in
+ [\\/]* | ?:[\\/]* ) . "$cache_file";;
+ *) . "./$cache_file";;
+ esac
+ fi
+else
+ { $as_echo "$as_me:${as_lineno-$LINENO}: creating cache $cache_file" >&5
+$as_echo "$as_me: creating cache $cache_file" >&6;}
+ >$cache_file
+fi
+
+as_fn_append ac_header_list " stdlib.h"
+as_fn_append ac_header_list " unistd.h"
+as_fn_append ac_header_list " sys/param.h"
+# Check that the precious variables saved in the cache have kept the same
+# value.
+ac_cache_corrupted=false
+for ac_var in $ac_precious_vars; do
+ eval ac_old_set=\$ac_cv_env_${ac_var}_set
+ eval ac_new_set=\$ac_env_${ac_var}_set
+ eval ac_old_val=\$ac_cv_env_${ac_var}_value
+ eval ac_new_val=\$ac_env_${ac_var}_value
+ case $ac_old_set,$ac_new_set in
+ set,)
+ { $as_echo "$as_me:${as_lineno-$LINENO}: error: \`$ac_var' was set to \`$ac_old_val' in the previous run" >&5
+$as_echo "$as_me: error: \`$ac_var' was set to \`$ac_old_val' in the previous run" >&2;}
+ ac_cache_corrupted=: ;;
+ ,set)
+ { $as_echo "$as_me:${as_lineno-$LINENO}: error: \`$ac_var' was not set in the previous run" >&5
+$as_echo "$as_me: error: \`$ac_var' was not set in the previous run" >&2;}
+ ac_cache_corrupted=: ;;
+ ,);;
+ *)
+ if test "x$ac_old_val" != "x$ac_new_val"; then
+ # differences in whitespace do not lead to failure.
+ ac_old_val_w=`echo x $ac_old_val`
+ ac_new_val_w=`echo x $ac_new_val`
+ if test "$ac_old_val_w" != "$ac_new_val_w"; then
+ { $as_echo "$as_me:${as_lineno-$LINENO}: error: \`$ac_var' has changed since the previous run:" >&5
+$as_echo "$as_me: error: \`$ac_var' has changed since the previous run:" >&2;}
+ ac_cache_corrupted=:
+ else
+ { $as_echo "$as_me:${as_lineno-$LINENO}: warning: ignoring whitespace changes in \`$ac_var' since the previous run:" >&5
+$as_echo "$as_me: warning: ignoring whitespace changes in \`$ac_var' since the previous run:" >&2;}
+ eval $ac_var=\$ac_old_val
+ fi
+ { $as_echo "$as_me:${as_lineno-$LINENO}: former value: \`$ac_old_val'" >&5
+$as_echo "$as_me: former value: \`$ac_old_val'" >&2;}
+ { $as_echo "$as_me:${as_lineno-$LINENO}: current value: \`$ac_new_val'" >&5
+$as_echo "$as_me: current value: \`$ac_new_val'" >&2;}
+ fi;;
+ esac
+ # Pass precious variables to config.status.
+ if test "$ac_new_set" = set; then
+ case $ac_new_val in
+ *\'*) ac_arg=$ac_var=`$as_echo "$ac_new_val" | sed "s/'/'\\\\\\\\''/g"` ;;
+ *) ac_arg=$ac_var=$ac_new_val ;;
+ esac
+ case " $ac_configure_args " in
+ *" '$ac_arg' "*) ;; # Avoid dups. Use of quotes ensures accuracy.
+ *) as_fn_append ac_configure_args " '$ac_arg'" ;;
+ esac
+ fi
+done
+if $ac_cache_corrupted; then
+ { $as_echo "$as_me:${as_lineno-$LINENO}: error: in \`$ac_pwd':" >&5
+$as_echo "$as_me: error: in \`$ac_pwd':" >&2;}
+ { $as_echo "$as_me:${as_lineno-$LINENO}: error: changes in the environment can compromise the build" >&5
+$as_echo "$as_me: error: changes in the environment can compromise the build" >&2;}
+ as_fn_error $? "run \`make distclean' and/or \`rm $cache_file' and start over" "$LINENO" 5
+fi
+## -------------------- ##
+## Main body of script. ##
+## -------------------- ##
+
+ac_ext=c
+ac_cpp='$CPP $CPPFLAGS'
+ac_compile='$CC -c $CFLAGS $CPPFLAGS conftest.$ac_ext >&5'
+ac_link='$CC -o conftest$ac_exeext $CFLAGS $CPPFLAGS $LDFLAGS conftest.$ac_ext $LIBS >&5'
+ac_compiler_gnu=$ac_cv_c_compiler_gnu
+
+
+
+
+ac_aux_dir=
+for ac_dir in ../../build-aux "$srcdir"/../../build-aux; do
+ if test -f "$ac_dir/install-sh"; then
+ ac_aux_dir=$ac_dir
+ ac_install_sh="$ac_aux_dir/install-sh -c"
+ break
+ elif test -f "$ac_dir/install.sh"; then
+ ac_aux_dir=$ac_dir
+ ac_install_sh="$ac_aux_dir/install.sh -c"
+ break
+ elif test -f "$ac_dir/shtool"; then
+ ac_aux_dir=$ac_dir
+ ac_install_sh="$ac_aux_dir/shtool install -c"
+ break
+ fi
+done
+if test -z "$ac_aux_dir"; then
+ as_fn_error $? "cannot find install-sh, install.sh, or shtool in ../../build-aux \"$srcdir\"/../../build-aux" "$LINENO" 5
+fi
+
+# These three variables are undocumented and unsupported,
+# and are intended to be withdrawn in a future Autoconf release.
+# They can cause serious problems if a builder's source tree is in a directory
+# whose full name contains unusual characters.
+ac_config_guess="$SHELL $ac_aux_dir/config.guess" # Please don't use this var.
+ac_config_sub="$SHELL $ac_aux_dir/config.sub" # Please don't use this var.
+ac_configure="$SHELL $ac_aux_dir/configure" # Please don't use this var.
+
+
+
+
+# Common code for all programs using libkpathsea.
+am__api_version='1.16'
+
+# Find a good install program. We prefer a C program (faster),
+# so one script is as good as another. But avoid the broken or
+# incompatible versions:
+# SysV /etc/install, /usr/sbin/install
+# SunOS /usr/etc/install
+# IRIX /sbin/install
+# AIX /bin/install
+# AmigaOS /C/install, which installs bootblocks on floppy discs
+# AIX 4 /usr/bin/installbsd, which doesn't work without a -g flag
+# AFS /usr/afsws/bin/install, which mishandles nonexistent args
+# SVR4 /usr/ucb/install, which tries to use the nonexistent group "staff"
+# OS/2's system install, which has a completely different semantic
+# ./install, which can be erroneously created by make from ./install.sh.
+# Reject install programs that cannot install multiple files.
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for a BSD-compatible install" >&5
+$as_echo_n "checking for a BSD-compatible install... " >&6; }
+if test -z "$INSTALL"; then
+if ${ac_cv_path_install+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH
+do
+ IFS=$as_save_IFS
+ test -z "$as_dir" && as_dir=.
+ # Account for people who put trailing slashes in PATH elements.
+case $as_dir/ in #((
+ ./ | .// | /[cC]/* | \
+ /etc/* | /usr/sbin/* | /usr/etc/* | /sbin/* | /usr/afsws/bin/* | \
+ ?:[\\/]os2[\\/]install[\\/]* | ?:[\\/]OS2[\\/]INSTALL[\\/]* | \
+ /usr/ucb/* ) ;;
+ *)
+ # OSF1 and SCO ODT 3.0 have their own names for install.
+ # Don't use installbsd from OSF since it installs stuff as root
+ # by default.
+ for ac_prog in ginstall scoinst install; do
+ for ac_exec_ext in '' $ac_executable_extensions; do
+ if as_fn_executable_p "$as_dir/$ac_prog$ac_exec_ext"; then
+ if test $ac_prog = install &&
+ grep dspmsg "$as_dir/$ac_prog$ac_exec_ext" >/dev/null 2>&1; then
+ # AIX install. It has an incompatible calling convention.
+ :
+ elif test $ac_prog = install &&
+ grep pwplus "$as_dir/$ac_prog$ac_exec_ext" >/dev/null 2>&1; then
+ # program-specific install script used by HP pwplus--don't use.
+ :
+ else
+ rm -rf conftest.one conftest.two conftest.dir
+ echo one > conftest.one
+ echo two > conftest.two
+ mkdir conftest.dir
+ if "$as_dir/$ac_prog$ac_exec_ext" -c conftest.one conftest.two "`pwd`/conftest.dir" &&
+ test -s conftest.one && test -s conftest.two &&
+ test -s conftest.dir/conftest.one &&
+ test -s conftest.dir/conftest.two
+ then
+ ac_cv_path_install="$as_dir/$ac_prog$ac_exec_ext -c"
+ break 3
+ fi
+ fi
+ fi
+ done
+ done
+ ;;
+esac
+
+ done
+IFS=$as_save_IFS
+
+rm -rf conftest.one conftest.two conftest.dir
+
+fi
+ if test "${ac_cv_path_install+set}" = set; then
+ INSTALL=$ac_cv_path_install
+ else
+ # As a last resort, use the slow shell script. Don't cache a
+ # value for INSTALL within a source directory, because that will
+ # break other packages using the cache if that directory is
+ # removed, or if the value is a relative name.
+ INSTALL=$ac_install_sh
+ fi
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $INSTALL" >&5
+$as_echo "$INSTALL" >&6; }
+
+# Use test -z because SunOS4 sh mishandles braces in ${var-val}.
+# It thinks the first close brace ends the variable substitution.
+test -z "$INSTALL_PROGRAM" && INSTALL_PROGRAM='${INSTALL}'
+
+test -z "$INSTALL_SCRIPT" && INSTALL_SCRIPT='${INSTALL}'
+
+test -z "$INSTALL_DATA" && INSTALL_DATA='${INSTALL} -m 644'
+
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking whether build environment is sane" >&5
+$as_echo_n "checking whether build environment is sane... " >&6; }
+# Reject unsafe characters in $srcdir or the absolute working directory
+# name. Accept space and tab only in the latter.
+am_lf='
+'
+case `pwd` in
+ *[\\\"\#\$\&\'\`$am_lf]*)
+ as_fn_error $? "unsafe absolute working directory name" "$LINENO" 5;;
+esac
+case $srcdir in
+ *[\\\"\#\$\&\'\`$am_lf\ \ ]*)
+ as_fn_error $? "unsafe srcdir value: '$srcdir'" "$LINENO" 5;;
+esac
+
+# Do 'set' in a subshell so we don't clobber the current shell's
+# arguments. Must try -L first in case configure is actually a
+# symlink; some systems play weird games with the mod time of symlinks
+# (eg FreeBSD returns the mod time of the symlink's containing
+# directory).
+if (
+ am_has_slept=no
+ for am_try in 1 2; do
+ echo "timestamp, slept: $am_has_slept" > conftest.file
+ set X `ls -Lt "$srcdir/configure" conftest.file 2> /dev/null`
+ if test "$*" = "X"; then
+ # -L didn't work.
+ set X `ls -t "$srcdir/configure" conftest.file`
+ fi
+ if test "$*" != "X $srcdir/configure conftest.file" \
+ && test "$*" != "X conftest.file $srcdir/configure"; then
+
+ # If neither matched, then we have a broken ls. This can happen
+ # if, for instance, CONFIG_SHELL is bash and it inherits a
+ # broken ls alias from the environment. This has actually
+ # happened. Such a system could not be considered "sane".
+ as_fn_error $? "ls -t appears to fail. Make sure there is not a broken
+ alias in your environment" "$LINENO" 5
+ fi
+ if test "$2" = conftest.file || test $am_try -eq 2; then
+ break
+ fi
+ # Just in case.
+ sleep 1
+ am_has_slept=yes
+ done
+ test "$2" = conftest.file
+ )
+then
+ # Ok.
+ :
+else
+ as_fn_error $? "newly created file is older than distributed files!
+Check your system clock" "$LINENO" 5
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: yes" >&5
+$as_echo "yes" >&6; }
+# If we didn't sleep, we still need to ensure time stamps of config.status and
+# generated files are strictly newer.
+am_sleep_pid=
+if grep 'slept: no' conftest.file >/dev/null 2>&1; then
+ ( sleep 1 ) &
+ am_sleep_pid=$!
+fi
+
+rm -f conftest.file
+
+test "$program_prefix" != NONE &&
+ program_transform_name="s&^&$program_prefix&;$program_transform_name"
+# Use a double $ so make ignores it.
+test "$program_suffix" != NONE &&
+ program_transform_name="s&\$&$program_suffix&;$program_transform_name"
+# Double any \ or $.
+# By default was `s,x,x', remove it if useless.
+ac_script='s/[\\$]/&&/g;s/;s,x,x,$//'
+program_transform_name=`$as_echo "$program_transform_name" | sed "$ac_script"`
+
+# Expand $ac_aux_dir to an absolute path.
+am_aux_dir=`cd "$ac_aux_dir" && pwd`
+
+if test x"${MISSING+set}" != xset; then
+ MISSING="\${SHELL} '$am_aux_dir/missing'"
+fi
+# Use eval to expand $SHELL
+if eval "$MISSING --is-lightweight"; then
+ am_missing_run="$MISSING "
+else
+ am_missing_run=
+ { $as_echo "$as_me:${as_lineno-$LINENO}: WARNING: 'missing' script is too old or missing" >&5
+$as_echo "$as_me: WARNING: 'missing' script is too old or missing" >&2;}
+fi
+
+if test x"${install_sh+set}" != xset; then
+ case $am_aux_dir in
+ *\ * | *\ *)
+ install_sh="\${SHELL} '$am_aux_dir/install-sh'" ;;
+ *)
+ install_sh="\${SHELL} $am_aux_dir/install-sh"
+ esac
+fi
+
+# Installed binaries are usually stripped using 'strip' when the user
+# run "make install-strip". However 'strip' might not be the right
+# tool to use in cross-compilation environments, therefore Automake
+# will honor the 'STRIP' environment variable to overrule this program.
+if test "$cross_compiling" != no; then
+ if test -n "$ac_tool_prefix"; then
+ # Extract the first word of "${ac_tool_prefix}strip", so it can be a program name with args.
+set dummy ${ac_tool_prefix}strip; ac_word=$2
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $ac_word" >&5
+$as_echo_n "checking for $ac_word... " >&6; }
+if ${ac_cv_prog_STRIP+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ if test -n "$STRIP"; then
+ ac_cv_prog_STRIP="$STRIP" # Let the user override the test.
+else
+as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH
+do
+ IFS=$as_save_IFS
+ test -z "$as_dir" && as_dir=.
+ for ac_exec_ext in '' $ac_executable_extensions; do
+ if as_fn_executable_p "$as_dir/$ac_word$ac_exec_ext"; then
+ ac_cv_prog_STRIP="${ac_tool_prefix}strip"
+ $as_echo "$as_me:${as_lineno-$LINENO}: found $as_dir/$ac_word$ac_exec_ext" >&5
+ break 2
+ fi
+done
+ done
+IFS=$as_save_IFS
+
+fi
+fi
+STRIP=$ac_cv_prog_STRIP
+if test -n "$STRIP"; then
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: $STRIP" >&5
+$as_echo "$STRIP" >&6; }
+else
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5
+$as_echo "no" >&6; }
+fi
+
+
+fi
+if test -z "$ac_cv_prog_STRIP"; then
+ ac_ct_STRIP=$STRIP
+ # Extract the first word of "strip", so it can be a program name with args.
+set dummy strip; ac_word=$2
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $ac_word" >&5
+$as_echo_n "checking for $ac_word... " >&6; }
+if ${ac_cv_prog_ac_ct_STRIP+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ if test -n "$ac_ct_STRIP"; then
+ ac_cv_prog_ac_ct_STRIP="$ac_ct_STRIP" # Let the user override the test.
+else
+as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH
+do
+ IFS=$as_save_IFS
+ test -z "$as_dir" && as_dir=.
+ for ac_exec_ext in '' $ac_executable_extensions; do
+ if as_fn_executable_p "$as_dir/$ac_word$ac_exec_ext"; then
+ ac_cv_prog_ac_ct_STRIP="strip"
+ $as_echo "$as_me:${as_lineno-$LINENO}: found $as_dir/$ac_word$ac_exec_ext" >&5
+ break 2
+ fi
+done
+ done
+IFS=$as_save_IFS
+
+fi
+fi
+ac_ct_STRIP=$ac_cv_prog_ac_ct_STRIP
+if test -n "$ac_ct_STRIP"; then
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_ct_STRIP" >&5
+$as_echo "$ac_ct_STRIP" >&6; }
+else
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5
+$as_echo "no" >&6; }
+fi
+
+ if test "x$ac_ct_STRIP" = x; then
+ STRIP=":"
+ else
+ case $cross_compiling:$ac_tool_warned in
+yes:)
+{ $as_echo "$as_me:${as_lineno-$LINENO}: WARNING: using cross tools not prefixed with host triplet" >&5
+$as_echo "$as_me: WARNING: using cross tools not prefixed with host triplet" >&2;}
+ac_tool_warned=yes ;;
+esac
+ STRIP=$ac_ct_STRIP
+ fi
+else
+ STRIP="$ac_cv_prog_STRIP"
+fi
+
+fi
+INSTALL_STRIP_PROGRAM="\$(install_sh) -c -s"
+
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for a thread-safe mkdir -p" >&5
+$as_echo_n "checking for a thread-safe mkdir -p... " >&6; }
+if test -z "$MKDIR_P"; then
+ if ${ac_cv_path_mkdir+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH$PATH_SEPARATOR/opt/sfw/bin
+do
+ IFS=$as_save_IFS
+ test -z "$as_dir" && as_dir=.
+ for ac_prog in mkdir gmkdir; do
+ for ac_exec_ext in '' $ac_executable_extensions; do
+ as_fn_executable_p "$as_dir/$ac_prog$ac_exec_ext" || continue
+ case `"$as_dir/$ac_prog$ac_exec_ext" --version 2>&1` in #(
+ 'mkdir (GNU coreutils) '* | \
+ 'mkdir (coreutils) '* | \
+ 'mkdir (fileutils) '4.1*)
+ ac_cv_path_mkdir=$as_dir/$ac_prog$ac_exec_ext
+ break 3;;
+ esac
+ done
+ done
+ done
+IFS=$as_save_IFS
+
+fi
+
+ test -d ./--version && rmdir ./--version
+ if test "${ac_cv_path_mkdir+set}" = set; then
+ MKDIR_P="$ac_cv_path_mkdir -p"
+ else
+ # As a last resort, use the slow shell script. Don't cache a
+ # value for MKDIR_P within a source directory, because that will
+ # break other packages using the cache if that directory is
+ # removed, or if the value is a relative name.
+ MKDIR_P="$ac_install_sh -d"
+ fi
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $MKDIR_P" >&5
+$as_echo "$MKDIR_P" >&6; }
+
+for ac_prog in gawk mawk nawk awk
+do
+ # Extract the first word of "$ac_prog", so it can be a program name with args.
+set dummy $ac_prog; ac_word=$2
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $ac_word" >&5
+$as_echo_n "checking for $ac_word... " >&6; }
+if ${ac_cv_prog_AWK+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ if test -n "$AWK"; then
+ ac_cv_prog_AWK="$AWK" # Let the user override the test.
+else
+as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH
+do
+ IFS=$as_save_IFS
+ test -z "$as_dir" && as_dir=.
+ for ac_exec_ext in '' $ac_executable_extensions; do
+ if as_fn_executable_p "$as_dir/$ac_word$ac_exec_ext"; then
+ ac_cv_prog_AWK="$ac_prog"
+ $as_echo "$as_me:${as_lineno-$LINENO}: found $as_dir/$ac_word$ac_exec_ext" >&5
+ break 2
+ fi
+done
+ done
+IFS=$as_save_IFS
+
+fi
+fi
+AWK=$ac_cv_prog_AWK
+if test -n "$AWK"; then
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: $AWK" >&5
+$as_echo "$AWK" >&6; }
+else
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5
+$as_echo "no" >&6; }
+fi
+
+
+ test -n "$AWK" && break
+done
+
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking whether ${MAKE-make} sets \$(MAKE)" >&5
+$as_echo_n "checking whether ${MAKE-make} sets \$(MAKE)... " >&6; }
+set x ${MAKE-make}
+ac_make=`$as_echo "$2" | sed 's/+/p/g; s/[^a-zA-Z0-9_]/_/g'`
+if eval \${ac_cv_prog_make_${ac_make}_set+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ cat >conftest.make <<\_ACEOF
+SHELL = /bin/sh
+all:
+ @echo '@@@%%%=$(MAKE)=@@@%%%'
+_ACEOF
+# GNU make sometimes prints "make[1]: Entering ...", which would confuse us.
+case `${MAKE-make} -f conftest.make 2>/dev/null` in
+ *@@@%%%=?*=@@@%%%*)
+ eval ac_cv_prog_make_${ac_make}_set=yes;;
+ *)
+ eval ac_cv_prog_make_${ac_make}_set=no;;
+esac
+rm -f conftest.make
+fi
+if eval test \$ac_cv_prog_make_${ac_make}_set = yes; then
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: yes" >&5
+$as_echo "yes" >&6; }
+ SET_MAKE=
+else
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5
+$as_echo "no" >&6; }
+ SET_MAKE="MAKE=${MAKE-make}"
+fi
+
+rm -rf .tst 2>/dev/null
+mkdir .tst 2>/dev/null
+if test -d .tst; then
+ am__leading_dot=.
+else
+ am__leading_dot=_
+fi
+rmdir .tst 2>/dev/null
+
+# Check whether --enable-silent-rules was given.
+if test "${enable_silent_rules+set}" = set; then :
+ enableval=$enable_silent_rules;
+fi
+
+case $enable_silent_rules in # (((
+ yes) AM_DEFAULT_VERBOSITY=0;;
+ no) AM_DEFAULT_VERBOSITY=1;;
+ *) AM_DEFAULT_VERBOSITY=1;;
+esac
+am_make=${MAKE-make}
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking whether $am_make supports nested variables" >&5
+$as_echo_n "checking whether $am_make supports nested variables... " >&6; }
+if ${am_cv_make_support_nested_variables+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ if $as_echo 'TRUE=$(BAR$(V))
+BAR0=false
+BAR1=true
+V=1
+am__doit:
+ @$(TRUE)
+.PHONY: am__doit' | $am_make -f - >/dev/null 2>&1; then
+ am_cv_make_support_nested_variables=yes
+else
+ am_cv_make_support_nested_variables=no
+fi
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $am_cv_make_support_nested_variables" >&5
+$as_echo "$am_cv_make_support_nested_variables" >&6; }
+if test $am_cv_make_support_nested_variables = yes; then
+ AM_V='$(V)'
+ AM_DEFAULT_V='$(AM_DEFAULT_VERBOSITY)'
+else
+ AM_V=$AM_DEFAULT_VERBOSITY
+ AM_DEFAULT_V=$AM_DEFAULT_VERBOSITY
+fi
+AM_BACKSLASH='\'
+
+DEPDIR="${am__leading_dot}deps"
+
+ac_config_commands="$ac_config_commands depfiles"
+
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking whether ${MAKE-make} supports the include directive" >&5
+$as_echo_n "checking whether ${MAKE-make} supports the include directive... " >&6; }
+cat > confinc.mk << 'END'
+am__doit:
+ @echo this is the am__doit target >confinc.out
+.PHONY: am__doit
+END
+am__include="#"
+am__quote=
+# BSD make does it like this.
+echo '.include "confinc.mk" # ignored' > confmf.BSD
+# Other make implementations (GNU, Solaris 10, AIX) do it like this.
+echo 'include confinc.mk # ignored' > confmf.GNU
+_am_result=no
+for s in GNU BSD; do
+ { echo "$as_me:$LINENO: ${MAKE-make} -f confmf.$s && cat confinc.out" >&5
+ (${MAKE-make} -f confmf.$s && cat confinc.out) >&5 2>&5
+ ac_status=$?
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); }
+ case $?:`cat confinc.out 2>/dev/null` in #(
+ '0:this is the am__doit target') :
+ case $s in #(
+ BSD) :
+ am__include='.include' am__quote='"' ;; #(
+ *) :
+ am__include='include' am__quote='' ;;
+esac ;; #(
+ *) :
+ ;;
+esac
+ if test "$am__include" != "#"; then
+ _am_result="yes ($s style)"
+ break
+ fi
+done
+rm -f confinc.* confmf.*
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: ${_am_result}" >&5
+$as_echo "${_am_result}" >&6; }
+
+# Check whether --enable-dependency-tracking was given.
+if test "${enable_dependency_tracking+set}" = set; then :
+ enableval=$enable_dependency_tracking;
+fi
+
+if test "x$enable_dependency_tracking" != xno; then
+ am_depcomp="$ac_aux_dir/depcomp"
+ AMDEPBACKSLASH='\'
+ am__nodep='_no'
+fi
+ if test "x$enable_dependency_tracking" != xno; then
+ AMDEP_TRUE=
+ AMDEP_FALSE='#'
+else
+ AMDEP_TRUE='#'
+ AMDEP_FALSE=
+fi
+
+
+ac_ext=c
+ac_cpp='$CPP $CPPFLAGS'
+ac_compile='$CC -c $CFLAGS $CPPFLAGS conftest.$ac_ext >&5'
+ac_link='$CC -o conftest$ac_exeext $CFLAGS $CPPFLAGS $LDFLAGS conftest.$ac_ext $LIBS >&5'
+ac_compiler_gnu=$ac_cv_c_compiler_gnu
+if test -n "$ac_tool_prefix"; then
+ # Extract the first word of "${ac_tool_prefix}gcc", so it can be a program name with args.
+set dummy ${ac_tool_prefix}gcc; ac_word=$2
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $ac_word" >&5
+$as_echo_n "checking for $ac_word... " >&6; }
+if ${ac_cv_prog_CC+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ if test -n "$CC"; then
+ ac_cv_prog_CC="$CC" # Let the user override the test.
+else
+as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH
+do
+ IFS=$as_save_IFS
+ test -z "$as_dir" && as_dir=.
+ for ac_exec_ext in '' $ac_executable_extensions; do
+ if as_fn_executable_p "$as_dir/$ac_word$ac_exec_ext"; then
+ ac_cv_prog_CC="${ac_tool_prefix}gcc"
+ $as_echo "$as_me:${as_lineno-$LINENO}: found $as_dir/$ac_word$ac_exec_ext" >&5
+ break 2
+ fi
+done
+ done
+IFS=$as_save_IFS
+
+fi
+fi
+CC=$ac_cv_prog_CC
+if test -n "$CC"; then
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: $CC" >&5
+$as_echo "$CC" >&6; }
+else
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5
+$as_echo "no" >&6; }
+fi
+
+
+fi
+if test -z "$ac_cv_prog_CC"; then
+ ac_ct_CC=$CC
+ # Extract the first word of "gcc", so it can be a program name with args.
+set dummy gcc; ac_word=$2
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $ac_word" >&5
+$as_echo_n "checking for $ac_word... " >&6; }
+if ${ac_cv_prog_ac_ct_CC+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ if test -n "$ac_ct_CC"; then
+ ac_cv_prog_ac_ct_CC="$ac_ct_CC" # Let the user override the test.
+else
+as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH
+do
+ IFS=$as_save_IFS
+ test -z "$as_dir" && as_dir=.
+ for ac_exec_ext in '' $ac_executable_extensions; do
+ if as_fn_executable_p "$as_dir/$ac_word$ac_exec_ext"; then
+ ac_cv_prog_ac_ct_CC="gcc"
+ $as_echo "$as_me:${as_lineno-$LINENO}: found $as_dir/$ac_word$ac_exec_ext" >&5
+ break 2
+ fi
+done
+ done
+IFS=$as_save_IFS
+
+fi
+fi
+ac_ct_CC=$ac_cv_prog_ac_ct_CC
+if test -n "$ac_ct_CC"; then
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_ct_CC" >&5
+$as_echo "$ac_ct_CC" >&6; }
+else
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5
+$as_echo "no" >&6; }
+fi
+
+ if test "x$ac_ct_CC" = x; then
+ CC=""
+ else
+ case $cross_compiling:$ac_tool_warned in
+yes:)
+{ $as_echo "$as_me:${as_lineno-$LINENO}: WARNING: using cross tools not prefixed with host triplet" >&5
+$as_echo "$as_me: WARNING: using cross tools not prefixed with host triplet" >&2;}
+ac_tool_warned=yes ;;
+esac
+ CC=$ac_ct_CC
+ fi
+else
+ CC="$ac_cv_prog_CC"
+fi
+
+if test -z "$CC"; then
+ if test -n "$ac_tool_prefix"; then
+ # Extract the first word of "${ac_tool_prefix}cc", so it can be a program name with args.
+set dummy ${ac_tool_prefix}cc; ac_word=$2
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $ac_word" >&5
+$as_echo_n "checking for $ac_word... " >&6; }
+if ${ac_cv_prog_CC+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ if test -n "$CC"; then
+ ac_cv_prog_CC="$CC" # Let the user override the test.
+else
+as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH
+do
+ IFS=$as_save_IFS
+ test -z "$as_dir" && as_dir=.
+ for ac_exec_ext in '' $ac_executable_extensions; do
+ if as_fn_executable_p "$as_dir/$ac_word$ac_exec_ext"; then
+ ac_cv_prog_CC="${ac_tool_prefix}cc"
+ $as_echo "$as_me:${as_lineno-$LINENO}: found $as_dir/$ac_word$ac_exec_ext" >&5
+ break 2
+ fi
+done
+ done
+IFS=$as_save_IFS
+
+fi
+fi
+CC=$ac_cv_prog_CC
+if test -n "$CC"; then
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: $CC" >&5
+$as_echo "$CC" >&6; }
+else
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5
+$as_echo "no" >&6; }
+fi
+
+
+ fi
+fi
+if test -z "$CC"; then
+ # Extract the first word of "cc", so it can be a program name with args.
+set dummy cc; ac_word=$2
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $ac_word" >&5
+$as_echo_n "checking for $ac_word... " >&6; }
+if ${ac_cv_prog_CC+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ if test -n "$CC"; then
+ ac_cv_prog_CC="$CC" # Let the user override the test.
+else
+ ac_prog_rejected=no
+as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH
+do
+ IFS=$as_save_IFS
+ test -z "$as_dir" && as_dir=.
+ for ac_exec_ext in '' $ac_executable_extensions; do
+ if as_fn_executable_p "$as_dir/$ac_word$ac_exec_ext"; then
+ if test "$as_dir/$ac_word$ac_exec_ext" = "/usr/ucb/cc"; then
+ ac_prog_rejected=yes
+ continue
+ fi
+ ac_cv_prog_CC="cc"
+ $as_echo "$as_me:${as_lineno-$LINENO}: found $as_dir/$ac_word$ac_exec_ext" >&5
+ break 2
+ fi
+done
+ done
+IFS=$as_save_IFS
+
+if test $ac_prog_rejected = yes; then
+ # We found a bogon in the path, so make sure we never use it.
+ set dummy $ac_cv_prog_CC
+ shift
+ if test $# != 0; then
+ # We chose a different compiler from the bogus one.
+ # However, it has the same basename, so the bogon will be chosen
+ # first if we set CC to just the basename; use the full file name.
+ shift
+ ac_cv_prog_CC="$as_dir/$ac_word${1+' '}$@"
+ fi
+fi
+fi
+fi
+CC=$ac_cv_prog_CC
+if test -n "$CC"; then
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: $CC" >&5
+$as_echo "$CC" >&6; }
+else
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5
+$as_echo "no" >&6; }
+fi
+
+
+fi
+if test -z "$CC"; then
+ if test -n "$ac_tool_prefix"; then
+ for ac_prog in cl.exe
+ do
+ # Extract the first word of "$ac_tool_prefix$ac_prog", so it can be a program name with args.
+set dummy $ac_tool_prefix$ac_prog; ac_word=$2
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $ac_word" >&5
+$as_echo_n "checking for $ac_word... " >&6; }
+if ${ac_cv_prog_CC+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ if test -n "$CC"; then
+ ac_cv_prog_CC="$CC" # Let the user override the test.
+else
+as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH
+do
+ IFS=$as_save_IFS
+ test -z "$as_dir" && as_dir=.
+ for ac_exec_ext in '' $ac_executable_extensions; do
+ if as_fn_executable_p "$as_dir/$ac_word$ac_exec_ext"; then
+ ac_cv_prog_CC="$ac_tool_prefix$ac_prog"
+ $as_echo "$as_me:${as_lineno-$LINENO}: found $as_dir/$ac_word$ac_exec_ext" >&5
+ break 2
+ fi
+done
+ done
+IFS=$as_save_IFS
+
+fi
+fi
+CC=$ac_cv_prog_CC
+if test -n "$CC"; then
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: $CC" >&5
+$as_echo "$CC" >&6; }
+else
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5
+$as_echo "no" >&6; }
+fi
+
+
+ test -n "$CC" && break
+ done
+fi
+if test -z "$CC"; then
+ ac_ct_CC=$CC
+ for ac_prog in cl.exe
+do
+ # Extract the first word of "$ac_prog", so it can be a program name with args.
+set dummy $ac_prog; ac_word=$2
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $ac_word" >&5
+$as_echo_n "checking for $ac_word... " >&6; }
+if ${ac_cv_prog_ac_ct_CC+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ if test -n "$ac_ct_CC"; then
+ ac_cv_prog_ac_ct_CC="$ac_ct_CC" # Let the user override the test.
+else
+as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH
+do
+ IFS=$as_save_IFS
+ test -z "$as_dir" && as_dir=.
+ for ac_exec_ext in '' $ac_executable_extensions; do
+ if as_fn_executable_p "$as_dir/$ac_word$ac_exec_ext"; then
+ ac_cv_prog_ac_ct_CC="$ac_prog"
+ $as_echo "$as_me:${as_lineno-$LINENO}: found $as_dir/$ac_word$ac_exec_ext" >&5
+ break 2
+ fi
+done
+ done
+IFS=$as_save_IFS
+
+fi
+fi
+ac_ct_CC=$ac_cv_prog_ac_ct_CC
+if test -n "$ac_ct_CC"; then
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_ct_CC" >&5
+$as_echo "$ac_ct_CC" >&6; }
+else
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5
+$as_echo "no" >&6; }
+fi
+
+
+ test -n "$ac_ct_CC" && break
+done
+
+ if test "x$ac_ct_CC" = x; then
+ CC=""
+ else
+ case $cross_compiling:$ac_tool_warned in
+yes:)
+{ $as_echo "$as_me:${as_lineno-$LINENO}: WARNING: using cross tools not prefixed with host triplet" >&5
+$as_echo "$as_me: WARNING: using cross tools not prefixed with host triplet" >&2;}
+ac_tool_warned=yes ;;
+esac
+ CC=$ac_ct_CC
+ fi
+fi
+
+fi
+
+
+test -z "$CC" && { { $as_echo "$as_me:${as_lineno-$LINENO}: error: in \`$ac_pwd':" >&5
+$as_echo "$as_me: error: in \`$ac_pwd':" >&2;}
+as_fn_error $? "no acceptable C compiler found in \$PATH
+See \`config.log' for more details" "$LINENO" 5; }
+
+# Provide some information about the compiler.
+$as_echo "$as_me:${as_lineno-$LINENO}: checking for C compiler version" >&5
+set X $ac_compile
+ac_compiler=$2
+for ac_option in --version -v -V -qversion; do
+ { { ac_try="$ac_compiler $ac_option >&5"
+case "(($ac_try" in
+ *\"* | *\`* | *\\*) ac_try_echo=\$ac_try;;
+ *) ac_try_echo=$ac_try;;
+esac
+eval ac_try_echo="\"\$as_me:${as_lineno-$LINENO}: $ac_try_echo\""
+$as_echo "$ac_try_echo"; } >&5
+ (eval "$ac_compiler $ac_option >&5") 2>conftest.err
+ ac_status=$?
+ if test -s conftest.err; then
+ sed '10a\
+... rest of stderr output deleted ...
+ 10q' conftest.err >conftest.er1
+ cat conftest.er1 >&5
+ fi
+ rm -f conftest.er1 conftest.err
+ $as_echo "$as_me:${as_lineno-$LINENO}: \$? = $ac_status" >&5
+ test $ac_status = 0; }
+done
+
+cat confdefs.h - <<_ACEOF >conftest.$ac_ext
+/* end confdefs.h. */
+
+int
+main ()
+{
+
+ ;
+ return 0;
+}
+_ACEOF
+ac_clean_files_save=$ac_clean_files
+ac_clean_files="$ac_clean_files a.out a.out.dSYM a.exe b.out"
+# Try to create an executable without -o first, disregard a.out.
+# It will help us diagnose broken compilers, and finding out an intuition
+# of exeext.
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking whether the C compiler works" >&5
+$as_echo_n "checking whether the C compiler works... " >&6; }
+ac_link_default=`$as_echo "$ac_link" | sed 's/ -o *conftest[^ ]*//'`
+
+# The possible output files:
+ac_files="a.out conftest.exe conftest a.exe a_out.exe b.out conftest.*"
+
+ac_rmfiles=
+for ac_file in $ac_files
+do
+ case $ac_file in
+ *.$ac_ext | *.xcoff | *.tds | *.d | *.pdb | *.xSYM | *.bb | *.bbg | *.map | *.inf | *.dSYM | *.o | *.obj ) ;;
+ * ) ac_rmfiles="$ac_rmfiles $ac_file";;
+ esac
+done
+rm -f $ac_rmfiles
+
+if { { ac_try="$ac_link_default"
+case "(($ac_try" in
+ *\"* | *\`* | *\\*) ac_try_echo=\$ac_try;;
+ *) ac_try_echo=$ac_try;;
+esac
+eval ac_try_echo="\"\$as_me:${as_lineno-$LINENO}: $ac_try_echo\""
+$as_echo "$ac_try_echo"; } >&5
+ (eval "$ac_link_default") 2>&5
+ ac_status=$?
+ $as_echo "$as_me:${as_lineno-$LINENO}: \$? = $ac_status" >&5
+ test $ac_status = 0; }; then :
+ # Autoconf-2.13 could set the ac_cv_exeext variable to `no'.
+# So ignore a value of `no', otherwise this would lead to `EXEEXT = no'
+# in a Makefile. We should not override ac_cv_exeext if it was cached,
+# so that the user can short-circuit this test for compilers unknown to
+# Autoconf.
+for ac_file in $ac_files ''
+do
+ test -f "$ac_file" || continue
+ case $ac_file in
+ *.$ac_ext | *.xcoff | *.tds | *.d | *.pdb | *.xSYM | *.bb | *.bbg | *.map | *.inf | *.dSYM | *.o | *.obj )
+ ;;
+ [ab].out )
+ # We found the default executable, but exeext='' is most
+ # certainly right.
+ break;;
+ *.* )
+ if test "${ac_cv_exeext+set}" = set && test "$ac_cv_exeext" != no;
+ then :; else
+ ac_cv_exeext=`expr "$ac_file" : '[^.]*\(\..*\)'`
+ fi
+ # We set ac_cv_exeext here because the later test for it is not
+ # safe: cross compilers may not add the suffix if given an `-o'
+ # argument, so we may need to know it at that point already.
+ # Even if this section looks crufty: it has the advantage of
+ # actually working.
+ break;;
+ * )
+ break;;
+ esac
+done
+test "$ac_cv_exeext" = no && ac_cv_exeext=
+
+else
+ ac_file=''
+fi
+if test -z "$ac_file"; then :
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5
+$as_echo "no" >&6; }
+$as_echo "$as_me: failed program was:" >&5
+sed 's/^/| /' conftest.$ac_ext >&5
+
+{ { $as_echo "$as_me:${as_lineno-$LINENO}: error: in \`$ac_pwd':" >&5
+$as_echo "$as_me: error: in \`$ac_pwd':" >&2;}
+as_fn_error 77 "C compiler cannot create executables
+See \`config.log' for more details" "$LINENO" 5; }
+else
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: yes" >&5
+$as_echo "yes" >&6; }
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for C compiler default output file name" >&5
+$as_echo_n "checking for C compiler default output file name... " >&6; }
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_file" >&5
+$as_echo "$ac_file" >&6; }
+ac_exeext=$ac_cv_exeext
+
+rm -f -r a.out a.out.dSYM a.exe conftest$ac_cv_exeext b.out
+ac_clean_files=$ac_clean_files_save
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for suffix of executables" >&5
+$as_echo_n "checking for suffix of executables... " >&6; }
+if { { ac_try="$ac_link"
+case "(($ac_try" in
+ *\"* | *\`* | *\\*) ac_try_echo=\$ac_try;;
+ *) ac_try_echo=$ac_try;;
+esac
+eval ac_try_echo="\"\$as_me:${as_lineno-$LINENO}: $ac_try_echo\""
+$as_echo "$ac_try_echo"; } >&5
+ (eval "$ac_link") 2>&5
+ ac_status=$?
+ $as_echo "$as_me:${as_lineno-$LINENO}: \$? = $ac_status" >&5
+ test $ac_status = 0; }; then :
+ # If both `conftest.exe' and `conftest' are `present' (well, observable)
+# catch `conftest.exe'. For instance with Cygwin, `ls conftest' will
+# work properly (i.e., refer to `conftest.exe'), while it won't with
+# `rm'.
+for ac_file in conftest.exe conftest conftest.*; do
+ test -f "$ac_file" || continue
+ case $ac_file in
+ *.$ac_ext | *.xcoff | *.tds | *.d | *.pdb | *.xSYM | *.bb | *.bbg | *.map | *.inf | *.dSYM | *.o | *.obj ) ;;
+ *.* ) ac_cv_exeext=`expr "$ac_file" : '[^.]*\(\..*\)'`
+ break;;
+ * ) break;;
+ esac
+done
+else
+ { { $as_echo "$as_me:${as_lineno-$LINENO}: error: in \`$ac_pwd':" >&5
+$as_echo "$as_me: error: in \`$ac_pwd':" >&2;}
+as_fn_error $? "cannot compute suffix of executables: cannot compile and link
+See \`config.log' for more details" "$LINENO" 5; }
+fi
+rm -f conftest conftest$ac_cv_exeext
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_cv_exeext" >&5
+$as_echo "$ac_cv_exeext" >&6; }
+
+rm -f conftest.$ac_ext
+EXEEXT=$ac_cv_exeext
+ac_exeext=$EXEEXT
+cat confdefs.h - <<_ACEOF >conftest.$ac_ext
+/* end confdefs.h. */
+#include <stdio.h>
+int
+main ()
+{
+FILE *f = fopen ("conftest.out", "w");
+ return ferror (f) || fclose (f) != 0;
+
+ ;
+ return 0;
+}
+_ACEOF
+ac_clean_files="$ac_clean_files conftest.out"
+# Check that the compiler produces executables we can run. If not, either
+# the compiler is broken, or we cross compile.
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking whether we are cross compiling" >&5
+$as_echo_n "checking whether we are cross compiling... " >&6; }
+if test "$cross_compiling" != yes; then
+ { { ac_try="$ac_link"
+case "(($ac_try" in
+ *\"* | *\`* | *\\*) ac_try_echo=\$ac_try;;
+ *) ac_try_echo=$ac_try;;
+esac
+eval ac_try_echo="\"\$as_me:${as_lineno-$LINENO}: $ac_try_echo\""
+$as_echo "$ac_try_echo"; } >&5
+ (eval "$ac_link") 2>&5
+ ac_status=$?
+ $as_echo "$as_me:${as_lineno-$LINENO}: \$? = $ac_status" >&5
+ test $ac_status = 0; }
+ if { ac_try='./conftest$ac_cv_exeext'
+ { { case "(($ac_try" in
+ *\"* | *\`* | *\\*) ac_try_echo=\$ac_try;;
+ *) ac_try_echo=$ac_try;;
+esac
+eval ac_try_echo="\"\$as_me:${as_lineno-$LINENO}: $ac_try_echo\""
+$as_echo "$ac_try_echo"; } >&5
+ (eval "$ac_try") 2>&5
+ ac_status=$?
+ $as_echo "$as_me:${as_lineno-$LINENO}: \$? = $ac_status" >&5
+ test $ac_status = 0; }; }; then
+ cross_compiling=no
+ else
+ if test "$cross_compiling" = maybe; then
+ cross_compiling=yes
+ else
+ { { $as_echo "$as_me:${as_lineno-$LINENO}: error: in \`$ac_pwd':" >&5
+$as_echo "$as_me: error: in \`$ac_pwd':" >&2;}
+as_fn_error $? "cannot run C compiled programs.
+If you meant to cross compile, use \`--host'.
+See \`config.log' for more details" "$LINENO" 5; }
+ fi
+ fi
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $cross_compiling" >&5
+$as_echo "$cross_compiling" >&6; }
+
+rm -f conftest.$ac_ext conftest$ac_cv_exeext conftest.out
+ac_clean_files=$ac_clean_files_save
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for suffix of object files" >&5
+$as_echo_n "checking for suffix of object files... " >&6; }
+if ${ac_cv_objext+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ cat confdefs.h - <<_ACEOF >conftest.$ac_ext
+/* end confdefs.h. */
+
+int
+main ()
+{
+
+ ;
+ return 0;
+}
+_ACEOF
+rm -f conftest.o conftest.obj
+if { { ac_try="$ac_compile"
+case "(($ac_try" in
+ *\"* | *\`* | *\\*) ac_try_echo=\$ac_try;;
+ *) ac_try_echo=$ac_try;;
+esac
+eval ac_try_echo="\"\$as_me:${as_lineno-$LINENO}: $ac_try_echo\""
+$as_echo "$ac_try_echo"; } >&5
+ (eval "$ac_compile") 2>&5
+ ac_status=$?
+ $as_echo "$as_me:${as_lineno-$LINENO}: \$? = $ac_status" >&5
+ test $ac_status = 0; }; then :
+ for ac_file in conftest.o conftest.obj conftest.*; do
+ test -f "$ac_file" || continue;
+ case $ac_file in
+ *.$ac_ext | *.xcoff | *.tds | *.d | *.pdb | *.xSYM | *.bb | *.bbg | *.map | *.inf | *.dSYM ) ;;
+ *) ac_cv_objext=`expr "$ac_file" : '.*\.\(.*\)'`
+ break;;
+ esac
+done
+else
+ $as_echo "$as_me: failed program was:" >&5
+sed 's/^/| /' conftest.$ac_ext >&5
+
+{ { $as_echo "$as_me:${as_lineno-$LINENO}: error: in \`$ac_pwd':" >&5
+$as_echo "$as_me: error: in \`$ac_pwd':" >&2;}
+as_fn_error $? "cannot compute suffix of object files: cannot compile
+See \`config.log' for more details" "$LINENO" 5; }
+fi
+rm -f conftest.$ac_cv_objext conftest.$ac_ext
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_cv_objext" >&5
+$as_echo "$ac_cv_objext" >&6; }
+OBJEXT=$ac_cv_objext
+ac_objext=$OBJEXT
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking whether we are using the GNU C compiler" >&5
+$as_echo_n "checking whether we are using the GNU C compiler... " >&6; }
+if ${ac_cv_c_compiler_gnu+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ cat confdefs.h - <<_ACEOF >conftest.$ac_ext
+/* end confdefs.h. */
+
+int
+main ()
+{
+#ifndef __GNUC__
+ choke me
+#endif
+
+ ;
+ return 0;
+}
+_ACEOF
+if ac_fn_c_try_compile "$LINENO"; then :
+ ac_compiler_gnu=yes
+else
+ ac_compiler_gnu=no
+fi
+rm -f core conftest.err conftest.$ac_objext conftest.$ac_ext
+ac_cv_c_compiler_gnu=$ac_compiler_gnu
+
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_cv_c_compiler_gnu" >&5
+$as_echo "$ac_cv_c_compiler_gnu" >&6; }
+if test $ac_compiler_gnu = yes; then
+ GCC=yes
+else
+ GCC=
+fi
+ac_test_CFLAGS=${CFLAGS+set}
+ac_save_CFLAGS=$CFLAGS
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking whether $CC accepts -g" >&5
+$as_echo_n "checking whether $CC accepts -g... " >&6; }
+if ${ac_cv_prog_cc_g+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ ac_save_c_werror_flag=$ac_c_werror_flag
+ ac_c_werror_flag=yes
+ ac_cv_prog_cc_g=no
+ CFLAGS="-g"
+ cat confdefs.h - <<_ACEOF >conftest.$ac_ext
+/* end confdefs.h. */
+
+int
+main ()
+{
+
+ ;
+ return 0;
+}
+_ACEOF
+if ac_fn_c_try_compile "$LINENO"; then :
+ ac_cv_prog_cc_g=yes
+else
+ CFLAGS=""
+ cat confdefs.h - <<_ACEOF >conftest.$ac_ext
+/* end confdefs.h. */
+
+int
+main ()
+{
+
+ ;
+ return 0;
+}
+_ACEOF
+if ac_fn_c_try_compile "$LINENO"; then :
+
+else
+ ac_c_werror_flag=$ac_save_c_werror_flag
+ CFLAGS="-g"
+ cat confdefs.h - <<_ACEOF >conftest.$ac_ext
+/* end confdefs.h. */
+
+int
+main ()
+{
+
+ ;
+ return 0;
+}
+_ACEOF
+if ac_fn_c_try_compile "$LINENO"; then :
+ ac_cv_prog_cc_g=yes
+fi
+rm -f core conftest.err conftest.$ac_objext conftest.$ac_ext
+fi
+rm -f core conftest.err conftest.$ac_objext conftest.$ac_ext
+fi
+rm -f core conftest.err conftest.$ac_objext conftest.$ac_ext
+ ac_c_werror_flag=$ac_save_c_werror_flag
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_cv_prog_cc_g" >&5
+$as_echo "$ac_cv_prog_cc_g" >&6; }
+if test "$ac_test_CFLAGS" = set; then
+ CFLAGS=$ac_save_CFLAGS
+elif test $ac_cv_prog_cc_g = yes; then
+ if test "$GCC" = yes; then
+ CFLAGS="-g -O2"
+ else
+ CFLAGS="-g"
+ fi
+else
+ if test "$GCC" = yes; then
+ CFLAGS="-O2"
+ else
+ CFLAGS=
+ fi
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $CC option to accept ISO C89" >&5
+$as_echo_n "checking for $CC option to accept ISO C89... " >&6; }
+if ${ac_cv_prog_cc_c89+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ ac_cv_prog_cc_c89=no
+ac_save_CC=$CC
+cat confdefs.h - <<_ACEOF >conftest.$ac_ext
+/* end confdefs.h. */
+#include <stdarg.h>
+#include <stdio.h>
+struct stat;
+/* Most of the following tests are stolen from RCS 5.7's src/conf.sh. */
+struct buf { int x; };
+FILE * (*rcsopen) (struct buf *, struct stat *, int);
+static char *e (p, i)
+ char **p;
+ int i;
+{
+ return p[i];
+}
+static char *f (char * (*g) (char **, int), char **p, ...)
+{
+ char *s;
+ va_list v;
+ va_start (v,p);
+ s = g (p, va_arg (v,int));
+ va_end (v);
+ return s;
+}
+
+/* OSF 4.0 Compaq cc is some sort of almost-ANSI by default. It has
+ function prototypes and stuff, but not '\xHH' hex character constants.
+ These don't provoke an error unfortunately, instead are silently treated
+ as 'x'. The following induces an error, until -std is added to get
+ proper ANSI mode. Curiously '\x00'!='x' always comes out true, for an
+ array size at least. It's necessary to write '\x00'==0 to get something
+ that's true only with -std. */
+int osf4_cc_array ['\x00' == 0 ? 1 : -1];
+
+/* IBM C 6 for AIX is almost-ANSI by default, but it replaces macro parameters
+ inside strings and character constants. */
+#define FOO(x) 'x'
+int xlc6_cc_array[FOO(a) == 'x' ? 1 : -1];
+
+int test (int i, double x);
+struct s1 {int (*f) (int a);};
+struct s2 {int (*f) (double a);};
+int pairnames (int, char **, FILE *(*)(struct buf *, struct stat *, int), int, int);
+int argc;
+char **argv;
+int
+main ()
+{
+return f (e, argv, 0) != argv[0] || f (e, argv, 1) != argv[1];
+ ;
+ return 0;
+}
+_ACEOF
+for ac_arg in '' -qlanglvl=extc89 -qlanglvl=ansi -std \
+ -Ae "-Aa -D_HPUX_SOURCE" "-Xc -D__EXTENSIONS__"
+do
+ CC="$ac_save_CC $ac_arg"
+ if ac_fn_c_try_compile "$LINENO"; then :
+ ac_cv_prog_cc_c89=$ac_arg
+fi
+rm -f core conftest.err conftest.$ac_objext
+ test "x$ac_cv_prog_cc_c89" != "xno" && break
+done
+rm -f conftest.$ac_ext
+CC=$ac_save_CC
+
+fi
+# AC_CACHE_VAL
+case "x$ac_cv_prog_cc_c89" in
+ x)
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: none needed" >&5
+$as_echo "none needed" >&6; } ;;
+ xno)
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: unsupported" >&5
+$as_echo "unsupported" >&6; } ;;
+ *)
+ CC="$CC $ac_cv_prog_cc_c89"
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_cv_prog_cc_c89" >&5
+$as_echo "$ac_cv_prog_cc_c89" >&6; } ;;
+esac
+if test "x$ac_cv_prog_cc_c89" != xno; then :
+
+fi
+
+ac_ext=c
+ac_cpp='$CPP $CPPFLAGS'
+ac_compile='$CC -c $CFLAGS $CPPFLAGS conftest.$ac_ext >&5'
+ac_link='$CC -o conftest$ac_exeext $CFLAGS $CPPFLAGS $LDFLAGS conftest.$ac_ext $LIBS >&5'
+ac_compiler_gnu=$ac_cv_c_compiler_gnu
+
+ac_ext=c
+ac_cpp='$CPP $CPPFLAGS'
+ac_compile='$CC -c $CFLAGS $CPPFLAGS conftest.$ac_ext >&5'
+ac_link='$CC -o conftest$ac_exeext $CFLAGS $CPPFLAGS $LDFLAGS conftest.$ac_ext $LIBS >&5'
+ac_compiler_gnu=$ac_cv_c_compiler_gnu
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking whether $CC understands -c and -o together" >&5
+$as_echo_n "checking whether $CC understands -c and -o together... " >&6; }
+if ${am_cv_prog_cc_c_o+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ cat confdefs.h - <<_ACEOF >conftest.$ac_ext
+/* end confdefs.h. */
+
+int
+main ()
+{
+
+ ;
+ return 0;
+}
+_ACEOF
+ # Make sure it works both with $CC and with simple cc.
+ # Following AC_PROG_CC_C_O, we do the test twice because some
+ # compilers refuse to overwrite an existing .o file with -o,
+ # though they will create one.
+ am_cv_prog_cc_c_o=yes
+ for am_i in 1 2; do
+ if { echo "$as_me:$LINENO: $CC -c conftest.$ac_ext -o conftest2.$ac_objext" >&5
+ ($CC -c conftest.$ac_ext -o conftest2.$ac_objext) >&5 2>&5
+ ac_status=$?
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); } \
+ && test -f conftest2.$ac_objext; then
+ : OK
+ else
+ am_cv_prog_cc_c_o=no
+ break
+ fi
+ done
+ rm -f core conftest*
+ unset am_i
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $am_cv_prog_cc_c_o" >&5
+$as_echo "$am_cv_prog_cc_c_o" >&6; }
+if test "$am_cv_prog_cc_c_o" != yes; then
+ # Losing compiler, so override with the script.
+ # FIXME: It is wrong to rewrite CC.
+ # But if we don't then we get into trouble of one sort or another.
+ # A longer-term fix would be to have automake use am__CC in this case,
+ # and then we could set am__CC="\$(top_srcdir)/compile \$(CC)"
+ CC="$am_aux_dir/compile $CC"
+fi
+ac_ext=c
+ac_cpp='$CPP $CPPFLAGS'
+ac_compile='$CC -c $CFLAGS $CPPFLAGS conftest.$ac_ext >&5'
+ac_link='$CC -o conftest$ac_exeext $CFLAGS $CPPFLAGS $LDFLAGS conftest.$ac_ext $LIBS >&5'
+ac_compiler_gnu=$ac_cv_c_compiler_gnu
+
+
+depcc="$CC" am_compiler_list=
+
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking dependency style of $depcc" >&5
+$as_echo_n "checking dependency style of $depcc... " >&6; }
+if ${am_cv_CC_dependencies_compiler_type+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ if test -z "$AMDEP_TRUE" && test -f "$am_depcomp"; then
+ # We make a subdir and do the tests there. Otherwise we can end up
+ # making bogus files that we don't know about and never remove. For
+ # instance it was reported that on HP-UX the gcc test will end up
+ # making a dummy file named 'D' -- because '-MD' means "put the output
+ # in D".
+ rm -rf conftest.dir
+ mkdir conftest.dir
+ # Copy depcomp to subdir because otherwise we won't find it if we're
+ # using a relative directory.
+ cp "$am_depcomp" conftest.dir
+ cd conftest.dir
+ # We will build objects and dependencies in a subdirectory because
+ # it helps to detect inapplicable dependency modes. For instance
+ # both Tru64's cc and ICC support -MD to output dependencies as a
+ # side effect of compilation, but ICC will put the dependencies in
+ # the current directory while Tru64 will put them in the object
+ # directory.
+ mkdir sub
+
+ am_cv_CC_dependencies_compiler_type=none
+ if test "$am_compiler_list" = ""; then
+ am_compiler_list=`sed -n 's/^#*\([a-zA-Z0-9]*\))$/\1/p' < ./depcomp`
+ fi
+ am__universal=false
+ case " $depcc " in #(
+ *\ -arch\ *\ -arch\ *) am__universal=true ;;
+ esac
+
+ for depmode in $am_compiler_list; do
+ # Setup a source with many dependencies, because some compilers
+ # like to wrap large dependency lists on column 80 (with \), and
+ # we should not choose a depcomp mode which is confused by this.
+ #
+ # We need to recreate these files for each test, as the compiler may
+ # overwrite some of them when testing with obscure command lines.
+ # This happens at least with the AIX C compiler.
+ : > sub/conftest.c
+ for i in 1 2 3 4 5 6; do
+ echo '#include "conftst'$i'.h"' >> sub/conftest.c
+ # Using ": > sub/conftst$i.h" creates only sub/conftst1.h with
+ # Solaris 10 /bin/sh.
+ echo '/* dummy */' > sub/conftst$i.h
+ done
+ echo "${am__include} ${am__quote}sub/conftest.Po${am__quote}" > confmf
+
+ # We check with '-c' and '-o' for the sake of the "dashmstdout"
+ # mode. It turns out that the SunPro C++ compiler does not properly
+ # handle '-M -o', and we need to detect this. Also, some Intel
+ # versions had trouble with output in subdirs.
+ am__obj=sub/conftest.${OBJEXT-o}
+ am__minus_obj="-o $am__obj"
+ case $depmode in
+ gcc)
+ # This depmode causes a compiler race in universal mode.
+ test "$am__universal" = false || continue
+ ;;
+ nosideeffect)
+ # After this tag, mechanisms are not by side-effect, so they'll
+ # only be used when explicitly requested.
+ if test "x$enable_dependency_tracking" = xyes; then
+ continue
+ else
+ break
+ fi
+ ;;
+ msvc7 | msvc7msys | msvisualcpp | msvcmsys)
+ # This compiler won't grok '-c -o', but also, the minuso test has
+ # not run yet. These depmodes are late enough in the game, and
+ # so weak that their functioning should not be impacted.
+ am__obj=conftest.${OBJEXT-o}
+ am__minus_obj=
+ ;;
+ none) break ;;
+ esac
+ if depmode=$depmode \
+ source=sub/conftest.c object=$am__obj \
+ depfile=sub/conftest.Po tmpdepfile=sub/conftest.TPo \
+ $SHELL ./depcomp $depcc -c $am__minus_obj sub/conftest.c \
+ >/dev/null 2>conftest.err &&
+ grep sub/conftst1.h sub/conftest.Po > /dev/null 2>&1 &&
+ grep sub/conftst6.h sub/conftest.Po > /dev/null 2>&1 &&
+ grep $am__obj sub/conftest.Po > /dev/null 2>&1 &&
+ ${MAKE-make} -s -f confmf > /dev/null 2>&1; then
+ # icc doesn't choke on unknown options, it will just issue warnings
+ # or remarks (even with -Werror). So we grep stderr for any message
+ # that says an option was ignored or not supported.
+ # When given -MP, icc 7.0 and 7.1 complain thusly:
+ # icc: Command line warning: ignoring option '-M'; no argument required
+ # The diagnosis changed in icc 8.0:
+ # icc: Command line remark: option '-MP' not supported
+ if (grep 'ignoring option' conftest.err ||
+ grep 'not supported' conftest.err) >/dev/null 2>&1; then :; else
+ am_cv_CC_dependencies_compiler_type=$depmode
+ break
+ fi
+ fi
+ done
+
+ cd ..
+ rm -rf conftest.dir
+else
+ am_cv_CC_dependencies_compiler_type=none
+fi
+
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $am_cv_CC_dependencies_compiler_type" >&5
+$as_echo "$am_cv_CC_dependencies_compiler_type" >&6; }
+CCDEPMODE=depmode=$am_cv_CC_dependencies_compiler_type
+
+ if
+ test "x$enable_dependency_tracking" != xno \
+ && test "$am_cv_CC_dependencies_compiler_type" = gcc3; then
+ am__fastdepCC_TRUE=
+ am__fastdepCC_FALSE='#'
+else
+ am__fastdepCC_TRUE='#'
+ am__fastdepCC_FALSE=
+fi
+
+
+
+# Check whether --enable-compiler-warnings was given.
+if test "${enable_compiler_warnings+set}" = set; then :
+ enableval=$enable_compiler_warnings;
+fi
+case $enable_compiler_warnings in #(
+ no | min | yes | max | all) :
+ ;; #(
+ *) :
+ if test "x$enable_maintainer_mode" = xyes; then :
+ enable_compiler_warnings=yes
+else
+ enable_compiler_warnings=min
+fi ;;
+esac
+
+case `pwd` in
+ *\ * | *\ *)
+ { $as_echo "$as_me:${as_lineno-$LINENO}: WARNING: Libtool does not cope well with whitespace in \`pwd\`" >&5
+$as_echo "$as_me: WARNING: Libtool does not cope well with whitespace in \`pwd\`" >&2;} ;;
+esac
+
+
+
+macro_version='2.4.6'
+macro_revision='2.4.6'
+
+
+
+
+
+
+
+
+
+
+
+
+
+ltmain=$ac_aux_dir/ltmain.sh
+
+# Make sure we can run config.sub.
+$SHELL "$ac_aux_dir/config.sub" sun4 >/dev/null 2>&1 ||
+ as_fn_error $? "cannot run $SHELL $ac_aux_dir/config.sub" "$LINENO" 5
+
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking build system type" >&5
+$as_echo_n "checking build system type... " >&6; }
+if ${ac_cv_build+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ ac_build_alias=$build_alias
+test "x$ac_build_alias" = x &&
+ ac_build_alias=`$SHELL "$ac_aux_dir/config.guess"`
+test "x$ac_build_alias" = x &&
+ as_fn_error $? "cannot guess build type; you must specify one" "$LINENO" 5
+ac_cv_build=`$SHELL "$ac_aux_dir/config.sub" $ac_build_alias` ||
+ as_fn_error $? "$SHELL $ac_aux_dir/config.sub $ac_build_alias failed" "$LINENO" 5
+
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_cv_build" >&5
+$as_echo "$ac_cv_build" >&6; }
+case $ac_cv_build in
+*-*-*) ;;
+*) as_fn_error $? "invalid value of canonical build" "$LINENO" 5;;
+esac
+build=$ac_cv_build
+ac_save_IFS=$IFS; IFS='-'
+set x $ac_cv_build
+shift
+build_cpu=$1
+build_vendor=$2
+shift; shift
+# Remember, the first character of IFS is used to create $*,
+# except with old shells:
+build_os=$*
+IFS=$ac_save_IFS
+case $build_os in *\ *) build_os=`echo "$build_os" | sed 's/ /-/g'`;; esac
+
+
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking host system type" >&5
+$as_echo_n "checking host system type... " >&6; }
+if ${ac_cv_host+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ if test "x$host_alias" = x; then
+ ac_cv_host=$ac_cv_build
+else
+ ac_cv_host=`$SHELL "$ac_aux_dir/config.sub" $host_alias` ||
+ as_fn_error $? "$SHELL $ac_aux_dir/config.sub $host_alias failed" "$LINENO" 5
+fi
+
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_cv_host" >&5
+$as_echo "$ac_cv_host" >&6; }
+case $ac_cv_host in
+*-*-*) ;;
+*) as_fn_error $? "invalid value of canonical host" "$LINENO" 5;;
+esac
+host=$ac_cv_host
+ac_save_IFS=$IFS; IFS='-'
+set x $ac_cv_host
+shift
+host_cpu=$1
+host_vendor=$2
+shift; shift
+# Remember, the first character of IFS is used to create $*,
+# except with old shells:
+host_os=$*
+IFS=$ac_save_IFS
+case $host_os in *\ *) host_os=`echo "$host_os" | sed 's/ /-/g'`;; esac
+
+
+# Backslashify metacharacters that are still active within
+# double-quoted strings.
+sed_quote_subst='s/\(["`$\\]\)/\\\1/g'
+
+# Same as above, but do not quote variable references.
+double_quote_subst='s/\(["`\\]\)/\\\1/g'
+
+# Sed substitution to delay expansion of an escaped shell variable in a
+# double_quote_subst'ed string.
+delay_variable_subst='s/\\\\\\\\\\\$/\\\\\\$/g'
+
+# Sed substitution to delay expansion of an escaped single quote.
+delay_single_quote_subst='s/'\''/'\'\\\\\\\'\''/g'
+
+# Sed substitution to avoid accidental globbing in evaled expressions
+no_glob_subst='s/\*/\\\*/g'
+
+ECHO='\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\'
+ECHO=$ECHO$ECHO$ECHO$ECHO$ECHO
+ECHO=$ECHO$ECHO$ECHO$ECHO$ECHO$ECHO
+
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking how to print strings" >&5
+$as_echo_n "checking how to print strings... " >&6; }
+# Test print first, because it will be a builtin if present.
+if test "X`( print -r -- -n ) 2>/dev/null`" = X-n && \
+ test "X`print -r -- $ECHO 2>/dev/null`" = "X$ECHO"; then
+ ECHO='print -r --'
+elif test "X`printf %s $ECHO 2>/dev/null`" = "X$ECHO"; then
+ ECHO='printf %s\n'
+else
+ # Use this function as a fallback that always works.
+ func_fallback_echo ()
+ {
+ eval 'cat <<_LTECHO_EOF
+$1
+_LTECHO_EOF'
+ }
+ ECHO='func_fallback_echo'
+fi
+
+# func_echo_all arg...
+# Invoke $ECHO with all args, space-separated.
+func_echo_all ()
+{
+ $ECHO ""
+}
+
+case $ECHO in
+ printf*) { $as_echo "$as_me:${as_lineno-$LINENO}: result: printf" >&5
+$as_echo "printf" >&6; } ;;
+ print*) { $as_echo "$as_me:${as_lineno-$LINENO}: result: print -r" >&5
+$as_echo "print -r" >&6; } ;;
+ *) { $as_echo "$as_me:${as_lineno-$LINENO}: result: cat" >&5
+$as_echo "cat" >&6; } ;;
+esac
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for a sed that does not truncate output" >&5
+$as_echo_n "checking for a sed that does not truncate output... " >&6; }
+if ${ac_cv_path_SED+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ ac_script=s/aaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaa/bbbbbbbbbbbbbbbbbbbbbbbbbbbbbbbbb/
+ for ac_i in 1 2 3 4 5 6 7; do
+ ac_script="$ac_script$as_nl$ac_script"
+ done
+ echo "$ac_script" 2>/dev/null | sed 99q >conftest.sed
+ { ac_script=; unset ac_script;}
+ if test -z "$SED"; then
+ ac_path_SED_found=false
+ # Loop through the user's path and test for each of PROGNAME-LIST
+ as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH
+do
+ IFS=$as_save_IFS
+ test -z "$as_dir" && as_dir=.
+ for ac_prog in sed gsed; do
+ for ac_exec_ext in '' $ac_executable_extensions; do
+ ac_path_SED="$as_dir/$ac_prog$ac_exec_ext"
+ as_fn_executable_p "$ac_path_SED" || continue
+# Check for GNU ac_path_SED and select it if it is found.
+ # Check for GNU $ac_path_SED
+case `"$ac_path_SED" --version 2>&1` in
+*GNU*)
+ ac_cv_path_SED="$ac_path_SED" ac_path_SED_found=:;;
+*)
+ ac_count=0
+ $as_echo_n 0123456789 >"conftest.in"
+ while :
+ do
+ cat "conftest.in" "conftest.in" >"conftest.tmp"
+ mv "conftest.tmp" "conftest.in"
+ cp "conftest.in" "conftest.nl"
+ $as_echo '' >> "conftest.nl"
+ "$ac_path_SED" -f conftest.sed < "conftest.nl" >"conftest.out" 2>/dev/null || break
+ diff "conftest.out" "conftest.nl" >/dev/null 2>&1 || break
+ as_fn_arith $ac_count + 1 && ac_count=$as_val
+ if test $ac_count -gt ${ac_path_SED_max-0}; then
+ # Best one so far, save it but keep looking for a better one
+ ac_cv_path_SED="$ac_path_SED"
+ ac_path_SED_max=$ac_count
+ fi
+ # 10*(2^10) chars as input seems more than enough
+ test $ac_count -gt 10 && break
+ done
+ rm -f conftest.in conftest.tmp conftest.nl conftest.out;;
+esac
+
+ $ac_path_SED_found && break 3
+ done
+ done
+ done
+IFS=$as_save_IFS
+ if test -z "$ac_cv_path_SED"; then
+ as_fn_error $? "no acceptable sed could be found in \$PATH" "$LINENO" 5
+ fi
+else
+ ac_cv_path_SED=$SED
+fi
+
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_cv_path_SED" >&5
+$as_echo "$ac_cv_path_SED" >&6; }
+ SED="$ac_cv_path_SED"
+ rm -f conftest.sed
+
+test -z "$SED" && SED=sed
+Xsed="$SED -e 1s/^X//"
+
+
+
+
+
+
+
+
+
+
+
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for grep that handles long lines and -e" >&5
+$as_echo_n "checking for grep that handles long lines and -e... " >&6; }
+if ${ac_cv_path_GREP+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ if test -z "$GREP"; then
+ ac_path_GREP_found=false
+ # Loop through the user's path and test for each of PROGNAME-LIST
+ as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH$PATH_SEPARATOR/usr/xpg4/bin
+do
+ IFS=$as_save_IFS
+ test -z "$as_dir" && as_dir=.
+ for ac_prog in grep ggrep; do
+ for ac_exec_ext in '' $ac_executable_extensions; do
+ ac_path_GREP="$as_dir/$ac_prog$ac_exec_ext"
+ as_fn_executable_p "$ac_path_GREP" || continue
+# Check for GNU ac_path_GREP and select it if it is found.
+ # Check for GNU $ac_path_GREP
+case `"$ac_path_GREP" --version 2>&1` in
+*GNU*)
+ ac_cv_path_GREP="$ac_path_GREP" ac_path_GREP_found=:;;
+*)
+ ac_count=0
+ $as_echo_n 0123456789 >"conftest.in"
+ while :
+ do
+ cat "conftest.in" "conftest.in" >"conftest.tmp"
+ mv "conftest.tmp" "conftest.in"
+ cp "conftest.in" "conftest.nl"
+ $as_echo 'GREP' >> "conftest.nl"
+ "$ac_path_GREP" -e 'GREP$' -e '-(cannot match)-' < "conftest.nl" >"conftest.out" 2>/dev/null || break
+ diff "conftest.out" "conftest.nl" >/dev/null 2>&1 || break
+ as_fn_arith $ac_count + 1 && ac_count=$as_val
+ if test $ac_count -gt ${ac_path_GREP_max-0}; then
+ # Best one so far, save it but keep looking for a better one
+ ac_cv_path_GREP="$ac_path_GREP"
+ ac_path_GREP_max=$ac_count
+ fi
+ # 10*(2^10) chars as input seems more than enough
+ test $ac_count -gt 10 && break
+ done
+ rm -f conftest.in conftest.tmp conftest.nl conftest.out;;
+esac
+
+ $ac_path_GREP_found && break 3
+ done
+ done
+ done
+IFS=$as_save_IFS
+ if test -z "$ac_cv_path_GREP"; then
+ as_fn_error $? "no acceptable grep could be found in $PATH$PATH_SEPARATOR/usr/xpg4/bin" "$LINENO" 5
+ fi
+else
+ ac_cv_path_GREP=$GREP
+fi
+
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_cv_path_GREP" >&5
+$as_echo "$ac_cv_path_GREP" >&6; }
+ GREP="$ac_cv_path_GREP"
+
+
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for egrep" >&5
+$as_echo_n "checking for egrep... " >&6; }
+if ${ac_cv_path_EGREP+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ if echo a | $GREP -E '(a|b)' >/dev/null 2>&1
+ then ac_cv_path_EGREP="$GREP -E"
+ else
+ if test -z "$EGREP"; then
+ ac_path_EGREP_found=false
+ # Loop through the user's path and test for each of PROGNAME-LIST
+ as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH$PATH_SEPARATOR/usr/xpg4/bin
+do
+ IFS=$as_save_IFS
+ test -z "$as_dir" && as_dir=.
+ for ac_prog in egrep; do
+ for ac_exec_ext in '' $ac_executable_extensions; do
+ ac_path_EGREP="$as_dir/$ac_prog$ac_exec_ext"
+ as_fn_executable_p "$ac_path_EGREP" || continue
+# Check for GNU ac_path_EGREP and select it if it is found.
+ # Check for GNU $ac_path_EGREP
+case `"$ac_path_EGREP" --version 2>&1` in
+*GNU*)
+ ac_cv_path_EGREP="$ac_path_EGREP" ac_path_EGREP_found=:;;
+*)
+ ac_count=0
+ $as_echo_n 0123456789 >"conftest.in"
+ while :
+ do
+ cat "conftest.in" "conftest.in" >"conftest.tmp"
+ mv "conftest.tmp" "conftest.in"
+ cp "conftest.in" "conftest.nl"
+ $as_echo 'EGREP' >> "conftest.nl"
+ "$ac_path_EGREP" 'EGREP$' < "conftest.nl" >"conftest.out" 2>/dev/null || break
+ diff "conftest.out" "conftest.nl" >/dev/null 2>&1 || break
+ as_fn_arith $ac_count + 1 && ac_count=$as_val
+ if test $ac_count -gt ${ac_path_EGREP_max-0}; then
+ # Best one so far, save it but keep looking for a better one
+ ac_cv_path_EGREP="$ac_path_EGREP"
+ ac_path_EGREP_max=$ac_count
+ fi
+ # 10*(2^10) chars as input seems more than enough
+ test $ac_count -gt 10 && break
+ done
+ rm -f conftest.in conftest.tmp conftest.nl conftest.out;;
+esac
+
+ $ac_path_EGREP_found && break 3
+ done
+ done
+ done
+IFS=$as_save_IFS
+ if test -z "$ac_cv_path_EGREP"; then
+ as_fn_error $? "no acceptable egrep could be found in $PATH$PATH_SEPARATOR/usr/xpg4/bin" "$LINENO" 5
+ fi
+else
+ ac_cv_path_EGREP=$EGREP
+fi
+
+ fi
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_cv_path_EGREP" >&5
+$as_echo "$ac_cv_path_EGREP" >&6; }
+ EGREP="$ac_cv_path_EGREP"
+
+
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for fgrep" >&5
+$as_echo_n "checking for fgrep... " >&6; }
+if ${ac_cv_path_FGREP+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ if echo 'ab*c' | $GREP -F 'ab*c' >/dev/null 2>&1
+ then ac_cv_path_FGREP="$GREP -F"
+ else
+ if test -z "$FGREP"; then
+ ac_path_FGREP_found=false
+ # Loop through the user's path and test for each of PROGNAME-LIST
+ as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH$PATH_SEPARATOR/usr/xpg4/bin
+do
+ IFS=$as_save_IFS
+ test -z "$as_dir" && as_dir=.
+ for ac_prog in fgrep; do
+ for ac_exec_ext in '' $ac_executable_extensions; do
+ ac_path_FGREP="$as_dir/$ac_prog$ac_exec_ext"
+ as_fn_executable_p "$ac_path_FGREP" || continue
+# Check for GNU ac_path_FGREP and select it if it is found.
+ # Check for GNU $ac_path_FGREP
+case `"$ac_path_FGREP" --version 2>&1` in
+*GNU*)
+ ac_cv_path_FGREP="$ac_path_FGREP" ac_path_FGREP_found=:;;
+*)
+ ac_count=0
+ $as_echo_n 0123456789 >"conftest.in"
+ while :
+ do
+ cat "conftest.in" "conftest.in" >"conftest.tmp"
+ mv "conftest.tmp" "conftest.in"
+ cp "conftest.in" "conftest.nl"
+ $as_echo 'FGREP' >> "conftest.nl"
+ "$ac_path_FGREP" FGREP < "conftest.nl" >"conftest.out" 2>/dev/null || break
+ diff "conftest.out" "conftest.nl" >/dev/null 2>&1 || break
+ as_fn_arith $ac_count + 1 && ac_count=$as_val
+ if test $ac_count -gt ${ac_path_FGREP_max-0}; then
+ # Best one so far, save it but keep looking for a better one
+ ac_cv_path_FGREP="$ac_path_FGREP"
+ ac_path_FGREP_max=$ac_count
+ fi
+ # 10*(2^10) chars as input seems more than enough
+ test $ac_count -gt 10 && break
+ done
+ rm -f conftest.in conftest.tmp conftest.nl conftest.out;;
+esac
+
+ $ac_path_FGREP_found && break 3
+ done
+ done
+ done
+IFS=$as_save_IFS
+ if test -z "$ac_cv_path_FGREP"; then
+ as_fn_error $? "no acceptable fgrep could be found in $PATH$PATH_SEPARATOR/usr/xpg4/bin" "$LINENO" 5
+ fi
+else
+ ac_cv_path_FGREP=$FGREP
+fi
+
+ fi
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_cv_path_FGREP" >&5
+$as_echo "$ac_cv_path_FGREP" >&6; }
+ FGREP="$ac_cv_path_FGREP"
+
+
+test -z "$GREP" && GREP=grep
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+# Check whether --with-gnu-ld was given.
+if test "${with_gnu_ld+set}" = set; then :
+ withval=$with_gnu_ld; test no = "$withval" || with_gnu_ld=yes
+else
+ with_gnu_ld=no
+fi
+
+ac_prog=ld
+if test yes = "$GCC"; then
+ # Check if gcc -print-prog-name=ld gives a path.
+ { $as_echo "$as_me:${as_lineno-$LINENO}: checking for ld used by $CC" >&5
+$as_echo_n "checking for ld used by $CC... " >&6; }
+ case $host in
+ *-*-mingw*)
+ # gcc leaves a trailing carriage return, which upsets mingw
+ ac_prog=`($CC -print-prog-name=ld) 2>&5 | tr -d '\015'` ;;
+ *)
+ ac_prog=`($CC -print-prog-name=ld) 2>&5` ;;
+ esac
+ case $ac_prog in
+ # Accept absolute paths.
+ [\\/]* | ?:[\\/]*)
+ re_direlt='/[^/][^/]*/\.\./'
+ # Canonicalize the pathname of ld
+ ac_prog=`$ECHO "$ac_prog"| $SED 's%\\\\%/%g'`
+ while $ECHO "$ac_prog" | $GREP "$re_direlt" > /dev/null 2>&1; do
+ ac_prog=`$ECHO $ac_prog| $SED "s%$re_direlt%/%"`
+ done
+ test -z "$LD" && LD=$ac_prog
+ ;;
+ "")
+ # If it fails, then pretend we aren't using GCC.
+ ac_prog=ld
+ ;;
+ *)
+ # If it is relative, then search for the first ld in PATH.
+ with_gnu_ld=unknown
+ ;;
+ esac
+elif test yes = "$with_gnu_ld"; then
+ { $as_echo "$as_me:${as_lineno-$LINENO}: checking for GNU ld" >&5
+$as_echo_n "checking for GNU ld... " >&6; }
+else
+ { $as_echo "$as_me:${as_lineno-$LINENO}: checking for non-GNU ld" >&5
+$as_echo_n "checking for non-GNU ld... " >&6; }
+fi
+if ${lt_cv_path_LD+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ if test -z "$LD"; then
+ lt_save_ifs=$IFS; IFS=$PATH_SEPARATOR
+ for ac_dir in $PATH; do
+ IFS=$lt_save_ifs
+ test -z "$ac_dir" && ac_dir=.
+ if test -f "$ac_dir/$ac_prog" || test -f "$ac_dir/$ac_prog$ac_exeext"; then
+ lt_cv_path_LD=$ac_dir/$ac_prog
+ # Check to see if the program is GNU ld. I'd rather use --version,
+ # but apparently some variants of GNU ld only accept -v.
+ # Break only if it was the GNU/non-GNU ld that we prefer.
+ case `"$lt_cv_path_LD" -v 2>&1 </dev/null` in
+ *GNU* | *'with BFD'*)
+ test no != "$with_gnu_ld" && break
+ ;;
+ *)
+ test yes != "$with_gnu_ld" && break
+ ;;
+ esac
+ fi
+ done
+ IFS=$lt_save_ifs
+else
+ lt_cv_path_LD=$LD # Let the user override the test with a path.
+fi
+fi
+
+LD=$lt_cv_path_LD
+if test -n "$LD"; then
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: $LD" >&5
+$as_echo "$LD" >&6; }
+else
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5
+$as_echo "no" >&6; }
+fi
+test -z "$LD" && as_fn_error $? "no acceptable ld found in \$PATH" "$LINENO" 5
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking if the linker ($LD) is GNU ld" >&5
+$as_echo_n "checking if the linker ($LD) is GNU ld... " >&6; }
+if ${lt_cv_prog_gnu_ld+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ # I'd rather use --version here, but apparently some GNU lds only accept -v.
+case `$LD -v 2>&1 </dev/null` in
+*GNU* | *'with BFD'*)
+ lt_cv_prog_gnu_ld=yes
+ ;;
+*)
+ lt_cv_prog_gnu_ld=no
+ ;;
+esac
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $lt_cv_prog_gnu_ld" >&5
+$as_echo "$lt_cv_prog_gnu_ld" >&6; }
+with_gnu_ld=$lt_cv_prog_gnu_ld
+
+
+
+
+
+
+
+
+
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for BSD- or MS-compatible name lister (nm)" >&5
+$as_echo_n "checking for BSD- or MS-compatible name lister (nm)... " >&6; }
+if ${lt_cv_path_NM+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ if test -n "$NM"; then
+ # Let the user override the test.
+ lt_cv_path_NM=$NM
+else
+ lt_nm_to_check=${ac_tool_prefix}nm
+ if test -n "$ac_tool_prefix" && test "$build" = "$host"; then
+ lt_nm_to_check="$lt_nm_to_check nm"
+ fi
+ for lt_tmp_nm in $lt_nm_to_check; do
+ lt_save_ifs=$IFS; IFS=$PATH_SEPARATOR
+ for ac_dir in $PATH /usr/ccs/bin/elf /usr/ccs/bin /usr/ucb /bin; do
+ IFS=$lt_save_ifs
+ test -z "$ac_dir" && ac_dir=.
+ tmp_nm=$ac_dir/$lt_tmp_nm
+ if test -f "$tmp_nm" || test -f "$tmp_nm$ac_exeext"; then
+ # Check to see if the nm accepts a BSD-compat flag.
+ # Adding the 'sed 1q' prevents false positives on HP-UX, which says:
+ # nm: unknown option "B" ignored
+ # Tru64's nm complains that /dev/null is an invalid object file
+ # MSYS converts /dev/null to NUL, MinGW nm treats NUL as empty
+ case $build_os in
+ mingw*) lt_bad_file=conftest.nm/nofile ;;
+ *) lt_bad_file=/dev/null ;;
+ esac
+ case `"$tmp_nm" -B $lt_bad_file 2>&1 | sed '1q'` in
+ *$lt_bad_file* | *'Invalid file or object type'*)
+ lt_cv_path_NM="$tmp_nm -B"
+ break 2
+ ;;
+ *)
+ case `"$tmp_nm" -p /dev/null 2>&1 | sed '1q'` in
+ */dev/null*)
+ lt_cv_path_NM="$tmp_nm -p"
+ break 2
+ ;;
+ *)
+ lt_cv_path_NM=${lt_cv_path_NM="$tmp_nm"} # keep the first match, but
+ continue # so that we can try to find one that supports BSD flags
+ ;;
+ esac
+ ;;
+ esac
+ fi
+ done
+ IFS=$lt_save_ifs
+ done
+ : ${lt_cv_path_NM=no}
+fi
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $lt_cv_path_NM" >&5
+$as_echo "$lt_cv_path_NM" >&6; }
+if test no != "$lt_cv_path_NM"; then
+ NM=$lt_cv_path_NM
+else
+ # Didn't find any BSD compatible name lister, look for dumpbin.
+ if test -n "$DUMPBIN"; then :
+ # Let the user override the test.
+ else
+ if test -n "$ac_tool_prefix"; then
+ for ac_prog in dumpbin "link -dump"
+ do
+ # Extract the first word of "$ac_tool_prefix$ac_prog", so it can be a program name with args.
+set dummy $ac_tool_prefix$ac_prog; ac_word=$2
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $ac_word" >&5
+$as_echo_n "checking for $ac_word... " >&6; }
+if ${ac_cv_prog_DUMPBIN+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ if test -n "$DUMPBIN"; then
+ ac_cv_prog_DUMPBIN="$DUMPBIN" # Let the user override the test.
+else
+as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH
+do
+ IFS=$as_save_IFS
+ test -z "$as_dir" && as_dir=.
+ for ac_exec_ext in '' $ac_executable_extensions; do
+ if as_fn_executable_p "$as_dir/$ac_word$ac_exec_ext"; then
+ ac_cv_prog_DUMPBIN="$ac_tool_prefix$ac_prog"
+ $as_echo "$as_me:${as_lineno-$LINENO}: found $as_dir/$ac_word$ac_exec_ext" >&5
+ break 2
+ fi
+done
+ done
+IFS=$as_save_IFS
+
+fi
+fi
+DUMPBIN=$ac_cv_prog_DUMPBIN
+if test -n "$DUMPBIN"; then
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: $DUMPBIN" >&5
+$as_echo "$DUMPBIN" >&6; }
+else
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5
+$as_echo "no" >&6; }
+fi
+
+
+ test -n "$DUMPBIN" && break
+ done
+fi
+if test -z "$DUMPBIN"; then
+ ac_ct_DUMPBIN=$DUMPBIN
+ for ac_prog in dumpbin "link -dump"
+do
+ # Extract the first word of "$ac_prog", so it can be a program name with args.
+set dummy $ac_prog; ac_word=$2
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $ac_word" >&5
+$as_echo_n "checking for $ac_word... " >&6; }
+if ${ac_cv_prog_ac_ct_DUMPBIN+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ if test -n "$ac_ct_DUMPBIN"; then
+ ac_cv_prog_ac_ct_DUMPBIN="$ac_ct_DUMPBIN" # Let the user override the test.
+else
+as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH
+do
+ IFS=$as_save_IFS
+ test -z "$as_dir" && as_dir=.
+ for ac_exec_ext in '' $ac_executable_extensions; do
+ if as_fn_executable_p "$as_dir/$ac_word$ac_exec_ext"; then
+ ac_cv_prog_ac_ct_DUMPBIN="$ac_prog"
+ $as_echo "$as_me:${as_lineno-$LINENO}: found $as_dir/$ac_word$ac_exec_ext" >&5
+ break 2
+ fi
+done
+ done
+IFS=$as_save_IFS
+
+fi
+fi
+ac_ct_DUMPBIN=$ac_cv_prog_ac_ct_DUMPBIN
+if test -n "$ac_ct_DUMPBIN"; then
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_ct_DUMPBIN" >&5
+$as_echo "$ac_ct_DUMPBIN" >&6; }
+else
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5
+$as_echo "no" >&6; }
+fi
+
+
+ test -n "$ac_ct_DUMPBIN" && break
+done
+
+ if test "x$ac_ct_DUMPBIN" = x; then
+ DUMPBIN=":"
+ else
+ case $cross_compiling:$ac_tool_warned in
+yes:)
+{ $as_echo "$as_me:${as_lineno-$LINENO}: WARNING: using cross tools not prefixed with host triplet" >&5
+$as_echo "$as_me: WARNING: using cross tools not prefixed with host triplet" >&2;}
+ac_tool_warned=yes ;;
+esac
+ DUMPBIN=$ac_ct_DUMPBIN
+ fi
+fi
+
+ case `$DUMPBIN -symbols -headers /dev/null 2>&1 | sed '1q'` in
+ *COFF*)
+ DUMPBIN="$DUMPBIN -symbols -headers"
+ ;;
+ *)
+ DUMPBIN=:
+ ;;
+ esac
+ fi
+
+ if test : != "$DUMPBIN"; then
+ NM=$DUMPBIN
+ fi
+fi
+test -z "$NM" && NM=nm
+
+
+
+
+
+
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking the name lister ($NM) interface" >&5
+$as_echo_n "checking the name lister ($NM) interface... " >&6; }
+if ${lt_cv_nm_interface+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ lt_cv_nm_interface="BSD nm"
+ echo "int some_variable = 0;" > conftest.$ac_ext
+ (eval echo "\"\$as_me:$LINENO: $ac_compile\"" >&5)
+ (eval "$ac_compile" 2>conftest.err)
+ cat conftest.err >&5
+ (eval echo "\"\$as_me:$LINENO: $NM \\\"conftest.$ac_objext\\\"\"" >&5)
+ (eval "$NM \"conftest.$ac_objext\"" 2>conftest.err > conftest.out)
+ cat conftest.err >&5
+ (eval echo "\"\$as_me:$LINENO: output\"" >&5)
+ cat conftest.out >&5
+ if $GREP 'External.*some_variable' conftest.out > /dev/null; then
+ lt_cv_nm_interface="MS dumpbin"
+ fi
+ rm -f conftest*
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $lt_cv_nm_interface" >&5
+$as_echo "$lt_cv_nm_interface" >&6; }
+
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking whether ln -s works" >&5
+$as_echo_n "checking whether ln -s works... " >&6; }
+LN_S=$as_ln_s
+if test "$LN_S" = "ln -s"; then
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: yes" >&5
+$as_echo "yes" >&6; }
+else
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: no, using $LN_S" >&5
+$as_echo "no, using $LN_S" >&6; }
+fi
+
+# find the maximum length of command line arguments
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking the maximum length of command line arguments" >&5
+$as_echo_n "checking the maximum length of command line arguments... " >&6; }
+if ${lt_cv_sys_max_cmd_len+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ i=0
+ teststring=ABCD
+
+ case $build_os in
+ msdosdjgpp*)
+ # On DJGPP, this test can blow up pretty badly due to problems in libc
+ # (any single argument exceeding 2000 bytes causes a buffer overrun
+ # during glob expansion). Even if it were fixed, the result of this
+ # check would be larger than it should be.
+ lt_cv_sys_max_cmd_len=12288; # 12K is about right
+ ;;
+
+ gnu*)
+ # Under GNU Hurd, this test is not required because there is
+ # no limit to the length of command line arguments.
+ # Libtool will interpret -1 as no limit whatsoever
+ lt_cv_sys_max_cmd_len=-1;
+ ;;
+
+ cygwin* | mingw* | cegcc*)
+ # On Win9x/ME, this test blows up -- it succeeds, but takes
+ # about 5 minutes as the teststring grows exponentially.
+ # Worse, since 9x/ME are not pre-emptively multitasking,
+ # you end up with a "frozen" computer, even though with patience
+ # the test eventually succeeds (with a max line length of 256k).
+ # Instead, let's just punt: use the minimum linelength reported by
+ # all of the supported platforms: 8192 (on NT/2K/XP).
+ lt_cv_sys_max_cmd_len=8192;
+ ;;
+
+ mint*)
+ # On MiNT this can take a long time and run out of memory.
+ lt_cv_sys_max_cmd_len=8192;
+ ;;
+
+ amigaos*)
+ # On AmigaOS with pdksh, this test takes hours, literally.
+ # So we just punt and use a minimum line length of 8192.
+ lt_cv_sys_max_cmd_len=8192;
+ ;;
+
+ bitrig* | darwin* | dragonfly* | freebsd* | netbsd* | openbsd*)
+ # This has been around since 386BSD, at least. Likely further.
+ if test -x /sbin/sysctl; then
+ lt_cv_sys_max_cmd_len=`/sbin/sysctl -n kern.argmax`
+ elif test -x /usr/sbin/sysctl; then
+ lt_cv_sys_max_cmd_len=`/usr/sbin/sysctl -n kern.argmax`
+ else
+ lt_cv_sys_max_cmd_len=65536 # usable default for all BSDs
+ fi
+ # And add a safety zone
+ lt_cv_sys_max_cmd_len=`expr $lt_cv_sys_max_cmd_len \/ 4`
+ lt_cv_sys_max_cmd_len=`expr $lt_cv_sys_max_cmd_len \* 3`
+ ;;
+
+ interix*)
+ # We know the value 262144 and hardcode it with a safety zone (like BSD)
+ lt_cv_sys_max_cmd_len=196608
+ ;;
+
+ os2*)
+ # The test takes a long time on OS/2.
+ lt_cv_sys_max_cmd_len=8192
+ ;;
+
+ osf*)
+ # Dr. Hans Ekkehard Plesser reports seeing a kernel panic running configure
+ # due to this test when exec_disable_arg_limit is 1 on Tru64. It is not
+ # nice to cause kernel panics so lets avoid the loop below.
+ # First set a reasonable default.
+ lt_cv_sys_max_cmd_len=16384
+ #
+ if test -x /sbin/sysconfig; then
+ case `/sbin/sysconfig -q proc exec_disable_arg_limit` in
+ *1*) lt_cv_sys_max_cmd_len=-1 ;;
+ esac
+ fi
+ ;;
+ sco3.2v5*)
+ lt_cv_sys_max_cmd_len=102400
+ ;;
+ sysv5* | sco5v6* | sysv4.2uw2*)
+ kargmax=`grep ARG_MAX /etc/conf/cf.d/stune 2>/dev/null`
+ if test -n "$kargmax"; then
+ lt_cv_sys_max_cmd_len=`echo $kargmax | sed 's/.*[ ]//'`
+ else
+ lt_cv_sys_max_cmd_len=32768
+ fi
+ ;;
+ *)
+ lt_cv_sys_max_cmd_len=`(getconf ARG_MAX) 2> /dev/null`
+ if test -n "$lt_cv_sys_max_cmd_len" && \
+ test undefined != "$lt_cv_sys_max_cmd_len"; then
+ lt_cv_sys_max_cmd_len=`expr $lt_cv_sys_max_cmd_len \/ 4`
+ lt_cv_sys_max_cmd_len=`expr $lt_cv_sys_max_cmd_len \* 3`
+ else
+ # Make teststring a little bigger before we do anything with it.
+ # a 1K string should be a reasonable start.
+ for i in 1 2 3 4 5 6 7 8; do
+ teststring=$teststring$teststring
+ done
+ SHELL=${SHELL-${CONFIG_SHELL-/bin/sh}}
+ # If test is not a shell built-in, we'll probably end up computing a
+ # maximum length that is only half of the actual maximum length, but
+ # we can't tell.
+ while { test X`env echo "$teststring$teststring" 2>/dev/null` \
+ = "X$teststring$teststring"; } >/dev/null 2>&1 &&
+ test 17 != "$i" # 1/2 MB should be enough
+ do
+ i=`expr $i + 1`
+ teststring=$teststring$teststring
+ done
+ # Only check the string length outside the loop.
+ lt_cv_sys_max_cmd_len=`expr "X$teststring" : ".*" 2>&1`
+ teststring=
+ # Add a significant safety factor because C++ compilers can tack on
+ # massive amounts of additional arguments before passing them to the
+ # linker. It appears as though 1/2 is a usable value.
+ lt_cv_sys_max_cmd_len=`expr $lt_cv_sys_max_cmd_len \/ 2`
+ fi
+ ;;
+ esac
+
+fi
+
+if test -n "$lt_cv_sys_max_cmd_len"; then
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: $lt_cv_sys_max_cmd_len" >&5
+$as_echo "$lt_cv_sys_max_cmd_len" >&6; }
+else
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: none" >&5
+$as_echo "none" >&6; }
+fi
+max_cmd_len=$lt_cv_sys_max_cmd_len
+
+
+
+
+
+
+: ${CP="cp -f"}
+: ${MV="mv -f"}
+: ${RM="rm -f"}
+
+if ( (MAIL=60; unset MAIL) || exit) >/dev/null 2>&1; then
+ lt_unset=unset
+else
+ lt_unset=false
+fi
+
+
+
+
+
+# test EBCDIC or ASCII
+case `echo X|tr X '\101'` in
+ A) # ASCII based system
+ # \n is not interpreted correctly by Solaris 8 /usr/ucb/tr
+ lt_SP2NL='tr \040 \012'
+ lt_NL2SP='tr \015\012 \040\040'
+ ;;
+ *) # EBCDIC based system
+ lt_SP2NL='tr \100 \n'
+ lt_NL2SP='tr \r\n \100\100'
+ ;;
+esac
+
+
+
+
+
+
+
+
+
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking how to convert $build file names to $host format" >&5
+$as_echo_n "checking how to convert $build file names to $host format... " >&6; }
+if ${lt_cv_to_host_file_cmd+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ case $host in
+ *-*-mingw* )
+ case $build in
+ *-*-mingw* ) # actually msys
+ lt_cv_to_host_file_cmd=func_convert_file_msys_to_w32
+ ;;
+ *-*-cygwin* )
+ lt_cv_to_host_file_cmd=func_convert_file_cygwin_to_w32
+ ;;
+ * ) # otherwise, assume *nix
+ lt_cv_to_host_file_cmd=func_convert_file_nix_to_w32
+ ;;
+ esac
+ ;;
+ *-*-cygwin* )
+ case $build in
+ *-*-mingw* ) # actually msys
+ lt_cv_to_host_file_cmd=func_convert_file_msys_to_cygwin
+ ;;
+ *-*-cygwin* )
+ lt_cv_to_host_file_cmd=func_convert_file_noop
+ ;;
+ * ) # otherwise, assume *nix
+ lt_cv_to_host_file_cmd=func_convert_file_nix_to_cygwin
+ ;;
+ esac
+ ;;
+ * ) # unhandled hosts (and "normal" native builds)
+ lt_cv_to_host_file_cmd=func_convert_file_noop
+ ;;
+esac
+
+fi
+
+to_host_file_cmd=$lt_cv_to_host_file_cmd
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $lt_cv_to_host_file_cmd" >&5
+$as_echo "$lt_cv_to_host_file_cmd" >&6; }
+
+
+
+
+
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking how to convert $build file names to toolchain format" >&5
+$as_echo_n "checking how to convert $build file names to toolchain format... " >&6; }
+if ${lt_cv_to_tool_file_cmd+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ #assume ordinary cross tools, or native build.
+lt_cv_to_tool_file_cmd=func_convert_file_noop
+case $host in
+ *-*-mingw* )
+ case $build in
+ *-*-mingw* ) # actually msys
+ lt_cv_to_tool_file_cmd=func_convert_file_msys_to_w32
+ ;;
+ esac
+ ;;
+esac
+
+fi
+
+to_tool_file_cmd=$lt_cv_to_tool_file_cmd
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $lt_cv_to_tool_file_cmd" >&5
+$as_echo "$lt_cv_to_tool_file_cmd" >&6; }
+
+
+
+
+
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $LD option to reload object files" >&5
+$as_echo_n "checking for $LD option to reload object files... " >&6; }
+if ${lt_cv_ld_reload_flag+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ lt_cv_ld_reload_flag='-r'
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $lt_cv_ld_reload_flag" >&5
+$as_echo "$lt_cv_ld_reload_flag" >&6; }
+reload_flag=$lt_cv_ld_reload_flag
+case $reload_flag in
+"" | " "*) ;;
+*) reload_flag=" $reload_flag" ;;
+esac
+reload_cmds='$LD$reload_flag -o $output$reload_objs'
+case $host_os in
+ cygwin* | mingw* | pw32* | cegcc*)
+ if test yes != "$GCC"; then
+ reload_cmds=false
+ fi
+ ;;
+ darwin*)
+ if test yes = "$GCC"; then
+ reload_cmds='$LTCC $LTCFLAGS -nostdlib $wl-r -o $output$reload_objs'
+ else
+ reload_cmds='$LD$reload_flag -o $output$reload_objs'
+ fi
+ ;;
+esac
+
+
+
+
+
+
+
+
+
+if test -n "$ac_tool_prefix"; then
+ # Extract the first word of "${ac_tool_prefix}objdump", so it can be a program name with args.
+set dummy ${ac_tool_prefix}objdump; ac_word=$2
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $ac_word" >&5
+$as_echo_n "checking for $ac_word... " >&6; }
+if ${ac_cv_prog_OBJDUMP+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ if test -n "$OBJDUMP"; then
+ ac_cv_prog_OBJDUMP="$OBJDUMP" # Let the user override the test.
+else
+as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH
+do
+ IFS=$as_save_IFS
+ test -z "$as_dir" && as_dir=.
+ for ac_exec_ext in '' $ac_executable_extensions; do
+ if as_fn_executable_p "$as_dir/$ac_word$ac_exec_ext"; then
+ ac_cv_prog_OBJDUMP="${ac_tool_prefix}objdump"
+ $as_echo "$as_me:${as_lineno-$LINENO}: found $as_dir/$ac_word$ac_exec_ext" >&5
+ break 2
+ fi
+done
+ done
+IFS=$as_save_IFS
+
+fi
+fi
+OBJDUMP=$ac_cv_prog_OBJDUMP
+if test -n "$OBJDUMP"; then
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: $OBJDUMP" >&5
+$as_echo "$OBJDUMP" >&6; }
+else
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5
+$as_echo "no" >&6; }
+fi
+
+
+fi
+if test -z "$ac_cv_prog_OBJDUMP"; then
+ ac_ct_OBJDUMP=$OBJDUMP
+ # Extract the first word of "objdump", so it can be a program name with args.
+set dummy objdump; ac_word=$2
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $ac_word" >&5
+$as_echo_n "checking for $ac_word... " >&6; }
+if ${ac_cv_prog_ac_ct_OBJDUMP+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ if test -n "$ac_ct_OBJDUMP"; then
+ ac_cv_prog_ac_ct_OBJDUMP="$ac_ct_OBJDUMP" # Let the user override the test.
+else
+as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH
+do
+ IFS=$as_save_IFS
+ test -z "$as_dir" && as_dir=.
+ for ac_exec_ext in '' $ac_executable_extensions; do
+ if as_fn_executable_p "$as_dir/$ac_word$ac_exec_ext"; then
+ ac_cv_prog_ac_ct_OBJDUMP="objdump"
+ $as_echo "$as_me:${as_lineno-$LINENO}: found $as_dir/$ac_word$ac_exec_ext" >&5
+ break 2
+ fi
+done
+ done
+IFS=$as_save_IFS
+
+fi
+fi
+ac_ct_OBJDUMP=$ac_cv_prog_ac_ct_OBJDUMP
+if test -n "$ac_ct_OBJDUMP"; then
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_ct_OBJDUMP" >&5
+$as_echo "$ac_ct_OBJDUMP" >&6; }
+else
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5
+$as_echo "no" >&6; }
+fi
+
+ if test "x$ac_ct_OBJDUMP" = x; then
+ OBJDUMP="false"
+ else
+ case $cross_compiling:$ac_tool_warned in
+yes:)
+{ $as_echo "$as_me:${as_lineno-$LINENO}: WARNING: using cross tools not prefixed with host triplet" >&5
+$as_echo "$as_me: WARNING: using cross tools not prefixed with host triplet" >&2;}
+ac_tool_warned=yes ;;
+esac
+ OBJDUMP=$ac_ct_OBJDUMP
+ fi
+else
+ OBJDUMP="$ac_cv_prog_OBJDUMP"
+fi
+
+test -z "$OBJDUMP" && OBJDUMP=objdump
+
+
+
+
+
+
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking how to recognize dependent libraries" >&5
+$as_echo_n "checking how to recognize dependent libraries... " >&6; }
+if ${lt_cv_deplibs_check_method+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ lt_cv_file_magic_cmd='$MAGIC_CMD'
+lt_cv_file_magic_test_file=
+lt_cv_deplibs_check_method='unknown'
+# Need to set the preceding variable on all platforms that support
+# interlibrary dependencies.
+# 'none' -- dependencies not supported.
+# 'unknown' -- same as none, but documents that we really don't know.
+# 'pass_all' -- all dependencies passed with no checks.
+# 'test_compile' -- check by making test program.
+# 'file_magic [[regex]]' -- check by looking for files in library path
+# that responds to the $file_magic_cmd with a given extended regex.
+# If you have 'file' or equivalent on your system and you're not sure
+# whether 'pass_all' will *always* work, you probably want this one.
+
+case $host_os in
+aix[4-9]*)
+ lt_cv_deplibs_check_method=pass_all
+ ;;
+
+beos*)
+ lt_cv_deplibs_check_method=pass_all
+ ;;
+
+bsdi[45]*)
+ lt_cv_deplibs_check_method='file_magic ELF [0-9][0-9]*-bit [ML]SB (shared object|dynamic lib)'
+ lt_cv_file_magic_cmd='/usr/bin/file -L'
+ lt_cv_file_magic_test_file=/shlib/libc.so
+ ;;
+
+cygwin*)
+ # func_win32_libid is a shell function defined in ltmain.sh
+ lt_cv_deplibs_check_method='file_magic ^x86 archive import|^x86 DLL'
+ lt_cv_file_magic_cmd='func_win32_libid'
+ ;;
+
+mingw* | pw32*)
+ # Base MSYS/MinGW do not provide the 'file' command needed by
+ # func_win32_libid shell function, so use a weaker test based on 'objdump',
+ # unless we find 'file', for example because we are cross-compiling.
+ if ( file / ) >/dev/null 2>&1; then
+ lt_cv_deplibs_check_method='file_magic ^x86 archive import|^x86 DLL'
+ lt_cv_file_magic_cmd='func_win32_libid'
+ else
+ # Keep this pattern in sync with the one in func_win32_libid.
+ lt_cv_deplibs_check_method='file_magic file format (pei*-i386(.*architecture: i386)?|pe-arm-wince|pe-x86-64)'
+ lt_cv_file_magic_cmd='$OBJDUMP -f'
+ fi
+ ;;
+
+cegcc*)
+ # use the weaker test based on 'objdump'. See mingw*.
+ lt_cv_deplibs_check_method='file_magic file format pe-arm-.*little(.*architecture: arm)?'
+ lt_cv_file_magic_cmd='$OBJDUMP -f'
+ ;;
+
+darwin* | rhapsody*)
+ lt_cv_deplibs_check_method=pass_all
+ ;;
+
+freebsd* | dragonfly*)
+ if echo __ELF__ | $CC -E - | $GREP __ELF__ > /dev/null; then
+ case $host_cpu in
+ i*86 )
+ # Not sure whether the presence of OpenBSD here was a mistake.
+ # Let's accept both of them until this is cleared up.
+ lt_cv_deplibs_check_method='file_magic (FreeBSD|OpenBSD|DragonFly)/i[3-9]86 (compact )?demand paged shared library'
+ lt_cv_file_magic_cmd=/usr/bin/file
+ lt_cv_file_magic_test_file=`echo /usr/lib/libc.so.*`
+ ;;
+ esac
+ else
+ lt_cv_deplibs_check_method=pass_all
+ fi
+ ;;
+
+haiku*)
+ lt_cv_deplibs_check_method=pass_all
+ ;;
+
+hpux10.20* | hpux11*)
+ lt_cv_file_magic_cmd=/usr/bin/file
+ case $host_cpu in
+ ia64*)
+ lt_cv_deplibs_check_method='file_magic (s[0-9][0-9][0-9]|ELF-[0-9][0-9]) shared object file - IA64'
+ lt_cv_file_magic_test_file=/usr/lib/hpux32/libc.so
+ ;;
+ hppa*64*)
+ lt_cv_deplibs_check_method='file_magic (s[0-9][0-9][0-9]|ELF[ -][0-9][0-9])(-bit)?( [LM]SB)? shared object( file)?[, -]* PA-RISC [0-9]\.[0-9]'
+ lt_cv_file_magic_test_file=/usr/lib/pa20_64/libc.sl
+ ;;
+ *)
+ lt_cv_deplibs_check_method='file_magic (s[0-9][0-9][0-9]|PA-RISC[0-9]\.[0-9]) shared library'
+ lt_cv_file_magic_test_file=/usr/lib/libc.sl
+ ;;
+ esac
+ ;;
+
+interix[3-9]*)
+ # PIC code is broken on Interix 3.x, that's why |\.a not |_pic\.a here
+ lt_cv_deplibs_check_method='match_pattern /lib[^/]+(\.so|\.a)$'
+ ;;
+
+irix5* | irix6* | nonstopux*)
+ case $LD in
+ *-32|*"-32 ") libmagic=32-bit;;
+ *-n32|*"-n32 ") libmagic=N32;;
+ *-64|*"-64 ") libmagic=64-bit;;
+ *) libmagic=never-match;;
+ esac
+ lt_cv_deplibs_check_method=pass_all
+ ;;
+
+# This must be glibc/ELF.
+linux* | k*bsd*-gnu | kopensolaris*-gnu | gnu*)
+ lt_cv_deplibs_check_method=pass_all
+ ;;
+
+netbsd*)
+ if echo __ELF__ | $CC -E - | $GREP __ELF__ > /dev/null; then
+ lt_cv_deplibs_check_method='match_pattern /lib[^/]+(\.so\.[0-9]+\.[0-9]+|_pic\.a)$'
+ else
+ lt_cv_deplibs_check_method='match_pattern /lib[^/]+(\.so|_pic\.a)$'
+ fi
+ ;;
+
+newos6*)
+ lt_cv_deplibs_check_method='file_magic ELF [0-9][0-9]*-bit [ML]SB (executable|dynamic lib)'
+ lt_cv_file_magic_cmd=/usr/bin/file
+ lt_cv_file_magic_test_file=/usr/lib/libnls.so
+ ;;
+
+*nto* | *qnx*)
+ lt_cv_deplibs_check_method=pass_all
+ ;;
+
+openbsd* | bitrig*)
+ if test -z "`echo __ELF__ | $CC -E - | $GREP __ELF__`"; then
+ lt_cv_deplibs_check_method='match_pattern /lib[^/]+(\.so\.[0-9]+\.[0-9]+|\.so|_pic\.a)$'
+ else
+ lt_cv_deplibs_check_method='match_pattern /lib[^/]+(\.so\.[0-9]+\.[0-9]+|_pic\.a)$'
+ fi
+ ;;
+
+osf3* | osf4* | osf5*)
+ lt_cv_deplibs_check_method=pass_all
+ ;;
+
+rdos*)
+ lt_cv_deplibs_check_method=pass_all
+ ;;
+
+solaris*)
+ lt_cv_deplibs_check_method=pass_all
+ ;;
+
+sysv5* | sco3.2v5* | sco5v6* | unixware* | OpenUNIX* | sysv4*uw2*)
+ lt_cv_deplibs_check_method=pass_all
+ ;;
+
+sysv4 | sysv4.3*)
+ case $host_vendor in
+ motorola)
+ lt_cv_deplibs_check_method='file_magic ELF [0-9][0-9]*-bit [ML]SB (shared object|dynamic lib) M[0-9][0-9]* Version [0-9]'
+ lt_cv_file_magic_test_file=`echo /usr/lib/libc.so*`
+ ;;
+ ncr)
+ lt_cv_deplibs_check_method=pass_all
+ ;;
+ sequent)
+ lt_cv_file_magic_cmd='/bin/file'
+ lt_cv_deplibs_check_method='file_magic ELF [0-9][0-9]*-bit [LM]SB (shared object|dynamic lib )'
+ ;;
+ sni)
+ lt_cv_file_magic_cmd='/bin/file'
+ lt_cv_deplibs_check_method="file_magic ELF [0-9][0-9]*-bit [LM]SB dynamic lib"
+ lt_cv_file_magic_test_file=/lib/libc.so
+ ;;
+ siemens)
+ lt_cv_deplibs_check_method=pass_all
+ ;;
+ pc)
+ lt_cv_deplibs_check_method=pass_all
+ ;;
+ esac
+ ;;
+
+tpf*)
+ lt_cv_deplibs_check_method=pass_all
+ ;;
+os2*)
+ lt_cv_deplibs_check_method=pass_all
+ ;;
+esac
+
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $lt_cv_deplibs_check_method" >&5
+$as_echo "$lt_cv_deplibs_check_method" >&6; }
+
+file_magic_glob=
+want_nocaseglob=no
+if test "$build" = "$host"; then
+ case $host_os in
+ mingw* | pw32*)
+ if ( shopt | grep nocaseglob ) >/dev/null 2>&1; then
+ want_nocaseglob=yes
+ else
+ file_magic_glob=`echo aAbBcCdDeEfFgGhHiIjJkKlLmMnNoOpPqQrRsStTuUvVwWxXyYzZ | $SED -e "s/\(..\)/s\/[\1]\/[\1]\/g;/g"`
+ fi
+ ;;
+ esac
+fi
+
+file_magic_cmd=$lt_cv_file_magic_cmd
+deplibs_check_method=$lt_cv_deplibs_check_method
+test -z "$deplibs_check_method" && deplibs_check_method=unknown
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+if test -n "$ac_tool_prefix"; then
+ # Extract the first word of "${ac_tool_prefix}dlltool", so it can be a program name with args.
+set dummy ${ac_tool_prefix}dlltool; ac_word=$2
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $ac_word" >&5
+$as_echo_n "checking for $ac_word... " >&6; }
+if ${ac_cv_prog_DLLTOOL+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ if test -n "$DLLTOOL"; then
+ ac_cv_prog_DLLTOOL="$DLLTOOL" # Let the user override the test.
+else
+as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH
+do
+ IFS=$as_save_IFS
+ test -z "$as_dir" && as_dir=.
+ for ac_exec_ext in '' $ac_executable_extensions; do
+ if as_fn_executable_p "$as_dir/$ac_word$ac_exec_ext"; then
+ ac_cv_prog_DLLTOOL="${ac_tool_prefix}dlltool"
+ $as_echo "$as_me:${as_lineno-$LINENO}: found $as_dir/$ac_word$ac_exec_ext" >&5
+ break 2
+ fi
+done
+ done
+IFS=$as_save_IFS
+
+fi
+fi
+DLLTOOL=$ac_cv_prog_DLLTOOL
+if test -n "$DLLTOOL"; then
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: $DLLTOOL" >&5
+$as_echo "$DLLTOOL" >&6; }
+else
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5
+$as_echo "no" >&6; }
+fi
+
+
+fi
+if test -z "$ac_cv_prog_DLLTOOL"; then
+ ac_ct_DLLTOOL=$DLLTOOL
+ # Extract the first word of "dlltool", so it can be a program name with args.
+set dummy dlltool; ac_word=$2
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $ac_word" >&5
+$as_echo_n "checking for $ac_word... " >&6; }
+if ${ac_cv_prog_ac_ct_DLLTOOL+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ if test -n "$ac_ct_DLLTOOL"; then
+ ac_cv_prog_ac_ct_DLLTOOL="$ac_ct_DLLTOOL" # Let the user override the test.
+else
+as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH
+do
+ IFS=$as_save_IFS
+ test -z "$as_dir" && as_dir=.
+ for ac_exec_ext in '' $ac_executable_extensions; do
+ if as_fn_executable_p "$as_dir/$ac_word$ac_exec_ext"; then
+ ac_cv_prog_ac_ct_DLLTOOL="dlltool"
+ $as_echo "$as_me:${as_lineno-$LINENO}: found $as_dir/$ac_word$ac_exec_ext" >&5
+ break 2
+ fi
+done
+ done
+IFS=$as_save_IFS
+
+fi
+fi
+ac_ct_DLLTOOL=$ac_cv_prog_ac_ct_DLLTOOL
+if test -n "$ac_ct_DLLTOOL"; then
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_ct_DLLTOOL" >&5
+$as_echo "$ac_ct_DLLTOOL" >&6; }
+else
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5
+$as_echo "no" >&6; }
+fi
+
+ if test "x$ac_ct_DLLTOOL" = x; then
+ DLLTOOL="false"
+ else
+ case $cross_compiling:$ac_tool_warned in
+yes:)
+{ $as_echo "$as_me:${as_lineno-$LINENO}: WARNING: using cross tools not prefixed with host triplet" >&5
+$as_echo "$as_me: WARNING: using cross tools not prefixed with host triplet" >&2;}
+ac_tool_warned=yes ;;
+esac
+ DLLTOOL=$ac_ct_DLLTOOL
+ fi
+else
+ DLLTOOL="$ac_cv_prog_DLLTOOL"
+fi
+
+test -z "$DLLTOOL" && DLLTOOL=dlltool
+
+
+
+
+
+
+
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking how to associate runtime and link libraries" >&5
+$as_echo_n "checking how to associate runtime and link libraries... " >&6; }
+if ${lt_cv_sharedlib_from_linklib_cmd+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ lt_cv_sharedlib_from_linklib_cmd='unknown'
+
+case $host_os in
+cygwin* | mingw* | pw32* | cegcc*)
+ # two different shell functions defined in ltmain.sh;
+ # decide which one to use based on capabilities of $DLLTOOL
+ case `$DLLTOOL --help 2>&1` in
+ *--identify-strict*)
+ lt_cv_sharedlib_from_linklib_cmd=func_cygming_dll_for_implib
+ ;;
+ *)
+ lt_cv_sharedlib_from_linklib_cmd=func_cygming_dll_for_implib_fallback
+ ;;
+ esac
+ ;;
+*)
+ # fallback: assume linklib IS sharedlib
+ lt_cv_sharedlib_from_linklib_cmd=$ECHO
+ ;;
+esac
+
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $lt_cv_sharedlib_from_linklib_cmd" >&5
+$as_echo "$lt_cv_sharedlib_from_linklib_cmd" >&6; }
+sharedlib_from_linklib_cmd=$lt_cv_sharedlib_from_linklib_cmd
+test -z "$sharedlib_from_linklib_cmd" && sharedlib_from_linklib_cmd=$ECHO
+
+
+
+
+
+
+
+if test -n "$ac_tool_prefix"; then
+ for ac_prog in ar
+ do
+ # Extract the first word of "$ac_tool_prefix$ac_prog", so it can be a program name with args.
+set dummy $ac_tool_prefix$ac_prog; ac_word=$2
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $ac_word" >&5
+$as_echo_n "checking for $ac_word... " >&6; }
+if ${ac_cv_prog_AR+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ if test -n "$AR"; then
+ ac_cv_prog_AR="$AR" # Let the user override the test.
+else
+as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH
+do
+ IFS=$as_save_IFS
+ test -z "$as_dir" && as_dir=.
+ for ac_exec_ext in '' $ac_executable_extensions; do
+ if as_fn_executable_p "$as_dir/$ac_word$ac_exec_ext"; then
+ ac_cv_prog_AR="$ac_tool_prefix$ac_prog"
+ $as_echo "$as_me:${as_lineno-$LINENO}: found $as_dir/$ac_word$ac_exec_ext" >&5
+ break 2
+ fi
+done
+ done
+IFS=$as_save_IFS
+
+fi
+fi
+AR=$ac_cv_prog_AR
+if test -n "$AR"; then
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: $AR" >&5
+$as_echo "$AR" >&6; }
+else
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5
+$as_echo "no" >&6; }
+fi
+
+
+ test -n "$AR" && break
+ done
+fi
+if test -z "$AR"; then
+ ac_ct_AR=$AR
+ for ac_prog in ar
+do
+ # Extract the first word of "$ac_prog", so it can be a program name with args.
+set dummy $ac_prog; ac_word=$2
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $ac_word" >&5
+$as_echo_n "checking for $ac_word... " >&6; }
+if ${ac_cv_prog_ac_ct_AR+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ if test -n "$ac_ct_AR"; then
+ ac_cv_prog_ac_ct_AR="$ac_ct_AR" # Let the user override the test.
+else
+as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH
+do
+ IFS=$as_save_IFS
+ test -z "$as_dir" && as_dir=.
+ for ac_exec_ext in '' $ac_executable_extensions; do
+ if as_fn_executable_p "$as_dir/$ac_word$ac_exec_ext"; then
+ ac_cv_prog_ac_ct_AR="$ac_prog"
+ $as_echo "$as_me:${as_lineno-$LINENO}: found $as_dir/$ac_word$ac_exec_ext" >&5
+ break 2
+ fi
+done
+ done
+IFS=$as_save_IFS
+
+fi
+fi
+ac_ct_AR=$ac_cv_prog_ac_ct_AR
+if test -n "$ac_ct_AR"; then
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_ct_AR" >&5
+$as_echo "$ac_ct_AR" >&6; }
+else
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5
+$as_echo "no" >&6; }
+fi
+
+
+ test -n "$ac_ct_AR" && break
+done
+
+ if test "x$ac_ct_AR" = x; then
+ AR="false"
+ else
+ case $cross_compiling:$ac_tool_warned in
+yes:)
+{ $as_echo "$as_me:${as_lineno-$LINENO}: WARNING: using cross tools not prefixed with host triplet" >&5
+$as_echo "$as_me: WARNING: using cross tools not prefixed with host triplet" >&2;}
+ac_tool_warned=yes ;;
+esac
+ AR=$ac_ct_AR
+ fi
+fi
+
+: ${AR=ar}
+: ${AR_FLAGS=cru}
+
+
+
+
+
+
+
+
+
+
+
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for archiver @FILE support" >&5
+$as_echo_n "checking for archiver @FILE support... " >&6; }
+if ${lt_cv_ar_at_file+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ lt_cv_ar_at_file=no
+ cat confdefs.h - <<_ACEOF >conftest.$ac_ext
+/* end confdefs.h. */
+
+int
+main ()
+{
+
+ ;
+ return 0;
+}
+_ACEOF
+if ac_fn_c_try_compile "$LINENO"; then :
+ echo conftest.$ac_objext > conftest.lst
+ lt_ar_try='$AR $AR_FLAGS libconftest.a @conftest.lst >&5'
+ { { eval echo "\"\$as_me\":${as_lineno-$LINENO}: \"$lt_ar_try\""; } >&5
+ (eval $lt_ar_try) 2>&5
+ ac_status=$?
+ $as_echo "$as_me:${as_lineno-$LINENO}: \$? = $ac_status" >&5
+ test $ac_status = 0; }
+ if test 0 -eq "$ac_status"; then
+ # Ensure the archiver fails upon bogus file names.
+ rm -f conftest.$ac_objext libconftest.a
+ { { eval echo "\"\$as_me\":${as_lineno-$LINENO}: \"$lt_ar_try\""; } >&5
+ (eval $lt_ar_try) 2>&5
+ ac_status=$?
+ $as_echo "$as_me:${as_lineno-$LINENO}: \$? = $ac_status" >&5
+ test $ac_status = 0; }
+ if test 0 -ne "$ac_status"; then
+ lt_cv_ar_at_file=@
+ fi
+ fi
+ rm -f conftest.* libconftest.a
+
+fi
+rm -f core conftest.err conftest.$ac_objext conftest.$ac_ext
+
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $lt_cv_ar_at_file" >&5
+$as_echo "$lt_cv_ar_at_file" >&6; }
+
+if test no = "$lt_cv_ar_at_file"; then
+ archiver_list_spec=
+else
+ archiver_list_spec=$lt_cv_ar_at_file
+fi
+
+
+
+
+
+
+
+if test -n "$ac_tool_prefix"; then
+ # Extract the first word of "${ac_tool_prefix}strip", so it can be a program name with args.
+set dummy ${ac_tool_prefix}strip; ac_word=$2
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $ac_word" >&5
+$as_echo_n "checking for $ac_word... " >&6; }
+if ${ac_cv_prog_STRIP+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ if test -n "$STRIP"; then
+ ac_cv_prog_STRIP="$STRIP" # Let the user override the test.
+else
+as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH
+do
+ IFS=$as_save_IFS
+ test -z "$as_dir" && as_dir=.
+ for ac_exec_ext in '' $ac_executable_extensions; do
+ if as_fn_executable_p "$as_dir/$ac_word$ac_exec_ext"; then
+ ac_cv_prog_STRIP="${ac_tool_prefix}strip"
+ $as_echo "$as_me:${as_lineno-$LINENO}: found $as_dir/$ac_word$ac_exec_ext" >&5
+ break 2
+ fi
+done
+ done
+IFS=$as_save_IFS
+
+fi
+fi
+STRIP=$ac_cv_prog_STRIP
+if test -n "$STRIP"; then
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: $STRIP" >&5
+$as_echo "$STRIP" >&6; }
+else
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5
+$as_echo "no" >&6; }
+fi
+
+
+fi
+if test -z "$ac_cv_prog_STRIP"; then
+ ac_ct_STRIP=$STRIP
+ # Extract the first word of "strip", so it can be a program name with args.
+set dummy strip; ac_word=$2
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $ac_word" >&5
+$as_echo_n "checking for $ac_word... " >&6; }
+if ${ac_cv_prog_ac_ct_STRIP+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ if test -n "$ac_ct_STRIP"; then
+ ac_cv_prog_ac_ct_STRIP="$ac_ct_STRIP" # Let the user override the test.
+else
+as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH
+do
+ IFS=$as_save_IFS
+ test -z "$as_dir" && as_dir=.
+ for ac_exec_ext in '' $ac_executable_extensions; do
+ if as_fn_executable_p "$as_dir/$ac_word$ac_exec_ext"; then
+ ac_cv_prog_ac_ct_STRIP="strip"
+ $as_echo "$as_me:${as_lineno-$LINENO}: found $as_dir/$ac_word$ac_exec_ext" >&5
+ break 2
+ fi
+done
+ done
+IFS=$as_save_IFS
+
+fi
+fi
+ac_ct_STRIP=$ac_cv_prog_ac_ct_STRIP
+if test -n "$ac_ct_STRIP"; then
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_ct_STRIP" >&5
+$as_echo "$ac_ct_STRIP" >&6; }
+else
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5
+$as_echo "no" >&6; }
+fi
+
+ if test "x$ac_ct_STRIP" = x; then
+ STRIP=":"
+ else
+ case $cross_compiling:$ac_tool_warned in
+yes:)
+{ $as_echo "$as_me:${as_lineno-$LINENO}: WARNING: using cross tools not prefixed with host triplet" >&5
+$as_echo "$as_me: WARNING: using cross tools not prefixed with host triplet" >&2;}
+ac_tool_warned=yes ;;
+esac
+ STRIP=$ac_ct_STRIP
+ fi
+else
+ STRIP="$ac_cv_prog_STRIP"
+fi
+
+test -z "$STRIP" && STRIP=:
+
+
+
+
+
+
+if test -n "$ac_tool_prefix"; then
+ # Extract the first word of "${ac_tool_prefix}ranlib", so it can be a program name with args.
+set dummy ${ac_tool_prefix}ranlib; ac_word=$2
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $ac_word" >&5
+$as_echo_n "checking for $ac_word... " >&6; }
+if ${ac_cv_prog_RANLIB+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ if test -n "$RANLIB"; then
+ ac_cv_prog_RANLIB="$RANLIB" # Let the user override the test.
+else
+as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH
+do
+ IFS=$as_save_IFS
+ test -z "$as_dir" && as_dir=.
+ for ac_exec_ext in '' $ac_executable_extensions; do
+ if as_fn_executable_p "$as_dir/$ac_word$ac_exec_ext"; then
+ ac_cv_prog_RANLIB="${ac_tool_prefix}ranlib"
+ $as_echo "$as_me:${as_lineno-$LINENO}: found $as_dir/$ac_word$ac_exec_ext" >&5
+ break 2
+ fi
+done
+ done
+IFS=$as_save_IFS
+
+fi
+fi
+RANLIB=$ac_cv_prog_RANLIB
+if test -n "$RANLIB"; then
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: $RANLIB" >&5
+$as_echo "$RANLIB" >&6; }
+else
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5
+$as_echo "no" >&6; }
+fi
+
+
+fi
+if test -z "$ac_cv_prog_RANLIB"; then
+ ac_ct_RANLIB=$RANLIB
+ # Extract the first word of "ranlib", so it can be a program name with args.
+set dummy ranlib; ac_word=$2
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $ac_word" >&5
+$as_echo_n "checking for $ac_word... " >&6; }
+if ${ac_cv_prog_ac_ct_RANLIB+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ if test -n "$ac_ct_RANLIB"; then
+ ac_cv_prog_ac_ct_RANLIB="$ac_ct_RANLIB" # Let the user override the test.
+else
+as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH
+do
+ IFS=$as_save_IFS
+ test -z "$as_dir" && as_dir=.
+ for ac_exec_ext in '' $ac_executable_extensions; do
+ if as_fn_executable_p "$as_dir/$ac_word$ac_exec_ext"; then
+ ac_cv_prog_ac_ct_RANLIB="ranlib"
+ $as_echo "$as_me:${as_lineno-$LINENO}: found $as_dir/$ac_word$ac_exec_ext" >&5
+ break 2
+ fi
+done
+ done
+IFS=$as_save_IFS
+
+fi
+fi
+ac_ct_RANLIB=$ac_cv_prog_ac_ct_RANLIB
+if test -n "$ac_ct_RANLIB"; then
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_ct_RANLIB" >&5
+$as_echo "$ac_ct_RANLIB" >&6; }
+else
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5
+$as_echo "no" >&6; }
+fi
+
+ if test "x$ac_ct_RANLIB" = x; then
+ RANLIB=":"
+ else
+ case $cross_compiling:$ac_tool_warned in
+yes:)
+{ $as_echo "$as_me:${as_lineno-$LINENO}: WARNING: using cross tools not prefixed with host triplet" >&5
+$as_echo "$as_me: WARNING: using cross tools not prefixed with host triplet" >&2;}
+ac_tool_warned=yes ;;
+esac
+ RANLIB=$ac_ct_RANLIB
+ fi
+else
+ RANLIB="$ac_cv_prog_RANLIB"
+fi
+
+test -z "$RANLIB" && RANLIB=:
+
+
+
+
+
+
+# Determine commands to create old-style static archives.
+old_archive_cmds='$AR $AR_FLAGS $oldlib$oldobjs'
+old_postinstall_cmds='chmod 644 $oldlib'
+old_postuninstall_cmds=
+
+if test -n "$RANLIB"; then
+ case $host_os in
+ bitrig* | openbsd*)
+ old_postinstall_cmds="$old_postinstall_cmds~\$RANLIB -t \$tool_oldlib"
+ ;;
+ *)
+ old_postinstall_cmds="$old_postinstall_cmds~\$RANLIB \$tool_oldlib"
+ ;;
+ esac
+ old_archive_cmds="$old_archive_cmds~\$RANLIB \$tool_oldlib"
+fi
+
+case $host_os in
+ darwin*)
+ lock_old_archive_extraction=yes ;;
+ *)
+ lock_old_archive_extraction=no ;;
+esac
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+# If no C compiler was specified, use CC.
+LTCC=${LTCC-"$CC"}
+
+# If no C compiler flags were specified, use CFLAGS.
+LTCFLAGS=${LTCFLAGS-"$CFLAGS"}
+
+# Allow CC to be a program name with arguments.
+compiler=$CC
+
+
+# Check for command to grab the raw symbol name followed by C symbol from nm.
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking command to parse $NM output from $compiler object" >&5
+$as_echo_n "checking command to parse $NM output from $compiler object... " >&6; }
+if ${lt_cv_sys_global_symbol_pipe+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+
+# These are sane defaults that work on at least a few old systems.
+# [They come from Ultrix. What could be older than Ultrix?!! ;)]
+
+# Character class describing NM global symbol codes.
+symcode='[BCDEGRST]'
+
+# Regexp to match symbols that can be accessed directly from C.
+sympat='\([_A-Za-z][_A-Za-z0-9]*\)'
+
+# Define system-specific variables.
+case $host_os in
+aix*)
+ symcode='[BCDT]'
+ ;;
+cygwin* | mingw* | pw32* | cegcc*)
+ symcode='[ABCDGISTW]'
+ ;;
+hpux*)
+ if test ia64 = "$host_cpu"; then
+ symcode='[ABCDEGRST]'
+ fi
+ ;;
+irix* | nonstopux*)
+ symcode='[BCDEGRST]'
+ ;;
+osf*)
+ symcode='[BCDEGQRST]'
+ ;;
+solaris*)
+ symcode='[BDRT]'
+ ;;
+sco3.2v5*)
+ symcode='[DT]'
+ ;;
+sysv4.2uw2*)
+ symcode='[DT]'
+ ;;
+sysv5* | sco5v6* | unixware* | OpenUNIX*)
+ symcode='[ABDT]'
+ ;;
+sysv4)
+ symcode='[DFNSTU]'
+ ;;
+esac
+
+# If we're using GNU nm, then use its standard symbol codes.
+case `$NM -V 2>&1` in
+*GNU* | *'with BFD'*)
+ symcode='[ABCDGIRSTW]' ;;
+esac
+
+if test "$lt_cv_nm_interface" = "MS dumpbin"; then
+ # Gets list of data symbols to import.
+ lt_cv_sys_global_symbol_to_import="sed -n -e 's/^I .* \(.*\)$/\1/p'"
+ # Adjust the below global symbol transforms to fixup imported variables.
+ lt_cdecl_hook=" -e 's/^I .* \(.*\)$/extern __declspec(dllimport) char \1;/p'"
+ lt_c_name_hook=" -e 's/^I .* \(.*\)$/ {\"\1\", (void *) 0},/p'"
+ lt_c_name_lib_hook="\
+ -e 's/^I .* \(lib.*\)$/ {\"\1\", (void *) 0},/p'\
+ -e 's/^I .* \(.*\)$/ {\"lib\1\", (void *) 0},/p'"
+else
+ # Disable hooks by default.
+ lt_cv_sys_global_symbol_to_import=
+ lt_cdecl_hook=
+ lt_c_name_hook=
+ lt_c_name_lib_hook=
+fi
+
+# Transform an extracted symbol line into a proper C declaration.
+# Some systems (esp. on ia64) link data and code symbols differently,
+# so use this general approach.
+lt_cv_sys_global_symbol_to_cdecl="sed -n"\
+$lt_cdecl_hook\
+" -e 's/^T .* \(.*\)$/extern int \1();/p'"\
+" -e 's/^$symcode$symcode* .* \(.*\)$/extern char \1;/p'"
+
+# Transform an extracted symbol line into symbol name and symbol address
+lt_cv_sys_global_symbol_to_c_name_address="sed -n"\
+$lt_c_name_hook\
+" -e 's/^: \(.*\) .*$/ {\"\1\", (void *) 0},/p'"\
+" -e 's/^$symcode$symcode* .* \(.*\)$/ {\"\1\", (void *) \&\1},/p'"
+
+# Transform an extracted symbol line into symbol name with lib prefix and
+# symbol address.
+lt_cv_sys_global_symbol_to_c_name_address_lib_prefix="sed -n"\
+$lt_c_name_lib_hook\
+" -e 's/^: \(.*\) .*$/ {\"\1\", (void *) 0},/p'"\
+" -e 's/^$symcode$symcode* .* \(lib.*\)$/ {\"\1\", (void *) \&\1},/p'"\
+" -e 's/^$symcode$symcode* .* \(.*\)$/ {\"lib\1\", (void *) \&\1},/p'"
+
+# Handle CRLF in mingw tool chain
+opt_cr=
+case $build_os in
+mingw*)
+ opt_cr=`$ECHO 'x\{0,1\}' | tr x '\015'` # option cr in regexp
+ ;;
+esac
+
+# Try without a prefix underscore, then with it.
+for ac_symprfx in "" "_"; do
+
+ # Transform symcode, sympat, and symprfx into a raw symbol and a C symbol.
+ symxfrm="\\1 $ac_symprfx\\2 \\2"
+
+ # Write the raw and C identifiers.
+ if test "$lt_cv_nm_interface" = "MS dumpbin"; then
+ # Fake it for dumpbin and say T for any non-static function,
+ # D for any global variable and I for any imported variable.
+ # Also find C++ and __fastcall symbols from MSVC++,
+ # which start with @ or ?.
+ lt_cv_sys_global_symbol_pipe="$AWK '"\
+" {last_section=section; section=\$ 3};"\
+" /^COFF SYMBOL TABLE/{for(i in hide) delete hide[i]};"\
+" /Section length .*#relocs.*(pick any)/{hide[last_section]=1};"\
+" /^ *Symbol name *: /{split(\$ 0,sn,\":\"); si=substr(sn[2],2)};"\
+" /^ *Type *: code/{print \"T\",si,substr(si,length(prfx))};"\
+" /^ *Type *: data/{print \"I\",si,substr(si,length(prfx))};"\
+" \$ 0!~/External *\|/{next};"\
+" / 0+ UNDEF /{next}; / UNDEF \([^|]\)*()/{next};"\
+" {if(hide[section]) next};"\
+" {f=\"D\"}; \$ 0~/\(\).*\|/{f=\"T\"};"\
+" {split(\$ 0,a,/\||\r/); split(a[2],s)};"\
+" s[1]~/^[@?]/{print f,s[1],s[1]; next};"\
+" s[1]~prfx {split(s[1],t,\"@\"); print f,t[1],substr(t[1],length(prfx))}"\
+" ' prfx=^$ac_symprfx"
+ else
+ lt_cv_sys_global_symbol_pipe="sed -n -e 's/^.*[ ]\($symcode$symcode*\)[ ][ ]*$ac_symprfx$sympat$opt_cr$/$symxfrm/p'"
+ fi
+ lt_cv_sys_global_symbol_pipe="$lt_cv_sys_global_symbol_pipe | sed '/ __gnu_lto/d'"
+
+ # Check to see that the pipe works correctly.
+ pipe_works=no
+
+ rm -f conftest*
+ cat > conftest.$ac_ext <<_LT_EOF
+#ifdef __cplusplus
+extern "C" {
+#endif
+char nm_test_var;
+void nm_test_func(void);
+void nm_test_func(void){}
+#ifdef __cplusplus
+}
+#endif
+int main(){nm_test_var='a';nm_test_func();return(0);}
+_LT_EOF
+
+ if { { eval echo "\"\$as_me\":${as_lineno-$LINENO}: \"$ac_compile\""; } >&5
+ (eval $ac_compile) 2>&5
+ ac_status=$?
+ $as_echo "$as_me:${as_lineno-$LINENO}: \$? = $ac_status" >&5
+ test $ac_status = 0; }; then
+ # Now try to grab the symbols.
+ nlist=conftest.nm
+ if { { eval echo "\"\$as_me\":${as_lineno-$LINENO}: \"$NM conftest.$ac_objext \| "$lt_cv_sys_global_symbol_pipe" \> $nlist\""; } >&5
+ (eval $NM conftest.$ac_objext \| "$lt_cv_sys_global_symbol_pipe" \> $nlist) 2>&5
+ ac_status=$?
+ $as_echo "$as_me:${as_lineno-$LINENO}: \$? = $ac_status" >&5
+ test $ac_status = 0; } && test -s "$nlist"; then
+ # Try sorting and uniquifying the output.
+ if sort "$nlist" | uniq > "$nlist"T; then
+ mv -f "$nlist"T "$nlist"
+ else
+ rm -f "$nlist"T
+ fi
+
+ # Make sure that we snagged all the symbols we need.
+ if $GREP ' nm_test_var$' "$nlist" >/dev/null; then
+ if $GREP ' nm_test_func$' "$nlist" >/dev/null; then
+ cat <<_LT_EOF > conftest.$ac_ext
+/* Keep this code in sync between libtool.m4, ltmain, lt_system.h, and tests. */
+#if defined _WIN32 || defined __CYGWIN__ || defined _WIN32_WCE
+/* DATA imports from DLLs on WIN32 can't be const, because runtime
+ relocations are performed -- see ld's documentation on pseudo-relocs. */
+# define LT_DLSYM_CONST
+#elif defined __osf__
+/* This system does not cope well with relocations in const data. */
+# define LT_DLSYM_CONST
+#else
+# define LT_DLSYM_CONST const
+#endif
+
+#ifdef __cplusplus
+extern "C" {
+#endif
+
+_LT_EOF
+ # Now generate the symbol file.
+ eval "$lt_cv_sys_global_symbol_to_cdecl"' < "$nlist" | $GREP -v main >> conftest.$ac_ext'
+
+ cat <<_LT_EOF >> conftest.$ac_ext
+
+/* The mapping between symbol names and symbols. */
+LT_DLSYM_CONST struct {
+ const char *name;
+ void *address;
+}
+lt__PROGRAM__LTX_preloaded_symbols[] =
+{
+ { "@PROGRAM@", (void *) 0 },
+_LT_EOF
+ $SED "s/^$symcode$symcode* .* \(.*\)$/ {\"\1\", (void *) \&\1},/" < "$nlist" | $GREP -v main >> conftest.$ac_ext
+ cat <<\_LT_EOF >> conftest.$ac_ext
+ {0, (void *) 0}
+};
+
+/* This works around a problem in FreeBSD linker */
+#ifdef FREEBSD_WORKAROUND
+static const void *lt_preloaded_setup() {
+ return lt__PROGRAM__LTX_preloaded_symbols;
+}
+#endif
+
+#ifdef __cplusplus
+}
+#endif
+_LT_EOF
+ # Now try linking the two files.
+ mv conftest.$ac_objext conftstm.$ac_objext
+ lt_globsym_save_LIBS=$LIBS
+ lt_globsym_save_CFLAGS=$CFLAGS
+ LIBS=conftstm.$ac_objext
+ CFLAGS="$CFLAGS$lt_prog_compiler_no_builtin_flag"
+ if { { eval echo "\"\$as_me\":${as_lineno-$LINENO}: \"$ac_link\""; } >&5
+ (eval $ac_link) 2>&5
+ ac_status=$?
+ $as_echo "$as_me:${as_lineno-$LINENO}: \$? = $ac_status" >&5
+ test $ac_status = 0; } && test -s conftest$ac_exeext; then
+ pipe_works=yes
+ fi
+ LIBS=$lt_globsym_save_LIBS
+ CFLAGS=$lt_globsym_save_CFLAGS
+ else
+ echo "cannot find nm_test_func in $nlist" >&5
+ fi
+ else
+ echo "cannot find nm_test_var in $nlist" >&5
+ fi
+ else
+ echo "cannot run $lt_cv_sys_global_symbol_pipe" >&5
+ fi
+ else
+ echo "$progname: failed program was:" >&5
+ cat conftest.$ac_ext >&5
+ fi
+ rm -rf conftest* conftst*
+
+ # Do not use the global_symbol_pipe unless it works.
+ if test yes = "$pipe_works"; then
+ break
+ else
+ lt_cv_sys_global_symbol_pipe=
+ fi
+done
+
+fi
+
+if test -z "$lt_cv_sys_global_symbol_pipe"; then
+ lt_cv_sys_global_symbol_to_cdecl=
+fi
+if test -z "$lt_cv_sys_global_symbol_pipe$lt_cv_sys_global_symbol_to_cdecl"; then
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: failed" >&5
+$as_echo "failed" >&6; }
+else
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: ok" >&5
+$as_echo "ok" >&6; }
+fi
+
+# Response file support.
+if test "$lt_cv_nm_interface" = "MS dumpbin"; then
+ nm_file_list_spec='@'
+elif $NM --help 2>/dev/null | grep '[@]FILE' >/dev/null; then
+ nm_file_list_spec='@'
+fi
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for sysroot" >&5
+$as_echo_n "checking for sysroot... " >&6; }
+
+# Check whether --with-sysroot was given.
+if test "${with_sysroot+set}" = set; then :
+ withval=$with_sysroot;
+else
+ with_sysroot=no
+fi
+
+
+lt_sysroot=
+case $with_sysroot in #(
+ yes)
+ if test yes = "$GCC"; then
+ lt_sysroot=`$CC --print-sysroot 2>/dev/null`
+ fi
+ ;; #(
+ /*)
+ lt_sysroot=`echo "$with_sysroot" | sed -e "$sed_quote_subst"`
+ ;; #(
+ no|'')
+ ;; #(
+ *)
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: $with_sysroot" >&5
+$as_echo "$with_sysroot" >&6; }
+ as_fn_error $? "The sysroot must be an absolute path." "$LINENO" 5
+ ;;
+esac
+
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: ${lt_sysroot:-no}" >&5
+$as_echo "${lt_sysroot:-no}" >&6; }
+
+
+
+
+
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for a working dd" >&5
+$as_echo_n "checking for a working dd... " >&6; }
+if ${ac_cv_path_lt_DD+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ printf 0123456789abcdef0123456789abcdef >conftest.i
+cat conftest.i conftest.i >conftest2.i
+: ${lt_DD:=$DD}
+if test -z "$lt_DD"; then
+ ac_path_lt_DD_found=false
+ # Loop through the user's path and test for each of PROGNAME-LIST
+ as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH
+do
+ IFS=$as_save_IFS
+ test -z "$as_dir" && as_dir=.
+ for ac_prog in dd; do
+ for ac_exec_ext in '' $ac_executable_extensions; do
+ ac_path_lt_DD="$as_dir/$ac_prog$ac_exec_ext"
+ as_fn_executable_p "$ac_path_lt_DD" || continue
+if "$ac_path_lt_DD" bs=32 count=1 <conftest2.i >conftest.out 2>/dev/null; then
+ cmp -s conftest.i conftest.out \
+ && ac_cv_path_lt_DD="$ac_path_lt_DD" ac_path_lt_DD_found=:
+fi
+ $ac_path_lt_DD_found && break 3
+ done
+ done
+ done
+IFS=$as_save_IFS
+ if test -z "$ac_cv_path_lt_DD"; then
+ :
+ fi
+else
+ ac_cv_path_lt_DD=$lt_DD
+fi
+
+rm -f conftest.i conftest2.i conftest.out
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_cv_path_lt_DD" >&5
+$as_echo "$ac_cv_path_lt_DD" >&6; }
+
+
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking how to truncate binary pipes" >&5
+$as_echo_n "checking how to truncate binary pipes... " >&6; }
+if ${lt_cv_truncate_bin+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ printf 0123456789abcdef0123456789abcdef >conftest.i
+cat conftest.i conftest.i >conftest2.i
+lt_cv_truncate_bin=
+if "$ac_cv_path_lt_DD" bs=32 count=1 <conftest2.i >conftest.out 2>/dev/null; then
+ cmp -s conftest.i conftest.out \
+ && lt_cv_truncate_bin="$ac_cv_path_lt_DD bs=4096 count=1"
+fi
+rm -f conftest.i conftest2.i conftest.out
+test -z "$lt_cv_truncate_bin" && lt_cv_truncate_bin="$SED -e 4q"
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $lt_cv_truncate_bin" >&5
+$as_echo "$lt_cv_truncate_bin" >&6; }
+
+
+
+
+
+
+
+# Calculate cc_basename. Skip known compiler wrappers and cross-prefix.
+func_cc_basename ()
+{
+ for cc_temp in $*""; do
+ case $cc_temp in
+ compile | *[\\/]compile | ccache | *[\\/]ccache ) ;;
+ distcc | *[\\/]distcc | purify | *[\\/]purify ) ;;
+ \-*) ;;
+ *) break;;
+ esac
+ done
+ func_cc_basename_result=`$ECHO "$cc_temp" | $SED "s%.*/%%; s%^$host_alias-%%"`
+}
+
+# Check whether --enable-libtool-lock was given.
+if test "${enable_libtool_lock+set}" = set; then :
+ enableval=$enable_libtool_lock;
+fi
+
+test no = "$enable_libtool_lock" || enable_libtool_lock=yes
+
+# Some flags need to be propagated to the compiler or linker for good
+# libtool support.
+case $host in
+ia64-*-hpux*)
+ # Find out what ABI is being produced by ac_compile, and set mode
+ # options accordingly.
+ echo 'int i;' > conftest.$ac_ext
+ if { { eval echo "\"\$as_me\":${as_lineno-$LINENO}: \"$ac_compile\""; } >&5
+ (eval $ac_compile) 2>&5
+ ac_status=$?
+ $as_echo "$as_me:${as_lineno-$LINENO}: \$? = $ac_status" >&5
+ test $ac_status = 0; }; then
+ case `/usr/bin/file conftest.$ac_objext` in
+ *ELF-32*)
+ HPUX_IA64_MODE=32
+ ;;
+ *ELF-64*)
+ HPUX_IA64_MODE=64
+ ;;
+ esac
+ fi
+ rm -rf conftest*
+ ;;
+*-*-irix6*)
+ # Find out what ABI is being produced by ac_compile, and set linker
+ # options accordingly.
+ echo '#line '$LINENO' "configure"' > conftest.$ac_ext
+ if { { eval echo "\"\$as_me\":${as_lineno-$LINENO}: \"$ac_compile\""; } >&5
+ (eval $ac_compile) 2>&5
+ ac_status=$?
+ $as_echo "$as_me:${as_lineno-$LINENO}: \$? = $ac_status" >&5
+ test $ac_status = 0; }; then
+ if test yes = "$lt_cv_prog_gnu_ld"; then
+ case `/usr/bin/file conftest.$ac_objext` in
+ *32-bit*)
+ LD="${LD-ld} -melf32bsmip"
+ ;;
+ *N32*)
+ LD="${LD-ld} -melf32bmipn32"
+ ;;
+ *64-bit*)
+ LD="${LD-ld} -melf64bmip"
+ ;;
+ esac
+ else
+ case `/usr/bin/file conftest.$ac_objext` in
+ *32-bit*)
+ LD="${LD-ld} -32"
+ ;;
+ *N32*)
+ LD="${LD-ld} -n32"
+ ;;
+ *64-bit*)
+ LD="${LD-ld} -64"
+ ;;
+ esac
+ fi
+ fi
+ rm -rf conftest*
+ ;;
+
+mips64*-*linux*)
+ # Find out what ABI is being produced by ac_compile, and set linker
+ # options accordingly.
+ echo '#line '$LINENO' "configure"' > conftest.$ac_ext
+ if { { eval echo "\"\$as_me\":${as_lineno-$LINENO}: \"$ac_compile\""; } >&5
+ (eval $ac_compile) 2>&5
+ ac_status=$?
+ $as_echo "$as_me:${as_lineno-$LINENO}: \$? = $ac_status" >&5
+ test $ac_status = 0; }; then
+ emul=elf
+ case `/usr/bin/file conftest.$ac_objext` in
+ *32-bit*)
+ emul="${emul}32"
+ ;;
+ *64-bit*)
+ emul="${emul}64"
+ ;;
+ esac
+ case `/usr/bin/file conftest.$ac_objext` in
+ *MSB*)
+ emul="${emul}btsmip"
+ ;;
+ *LSB*)
+ emul="${emul}ltsmip"
+ ;;
+ esac
+ case `/usr/bin/file conftest.$ac_objext` in
+ *N32*)
+ emul="${emul}n32"
+ ;;
+ esac
+ LD="${LD-ld} -m $emul"
+ fi
+ rm -rf conftest*
+ ;;
+
+x86_64-*kfreebsd*-gnu|x86_64-*linux*|powerpc*-*linux*| \
+s390*-*linux*|s390*-*tpf*|sparc*-*linux*)
+ # Find out what ABI is being produced by ac_compile, and set linker
+ # options accordingly. Note that the listed cases only cover the
+ # situations where additional linker options are needed (such as when
+ # doing 32-bit compilation for a host where ld defaults to 64-bit, or
+ # vice versa); the common cases where no linker options are needed do
+ # not appear in the list.
+ echo 'int i;' > conftest.$ac_ext
+ if { { eval echo "\"\$as_me\":${as_lineno-$LINENO}: \"$ac_compile\""; } >&5
+ (eval $ac_compile) 2>&5
+ ac_status=$?
+ $as_echo "$as_me:${as_lineno-$LINENO}: \$? = $ac_status" >&5
+ test $ac_status = 0; }; then
+ case `/usr/bin/file conftest.o` in
+ *32-bit*)
+ case $host in
+ x86_64-*kfreebsd*-gnu)
+ LD="${LD-ld} -m elf_i386_fbsd"
+ ;;
+ x86_64-*linux*)
+ case `/usr/bin/file conftest.o` in
+ *x86-64*)
+ LD="${LD-ld} -m elf32_x86_64"
+ ;;
+ *)
+ LD="${LD-ld} -m elf_i386"
+ ;;
+ esac
+ ;;
+ powerpc64le-*linux*)
+ LD="${LD-ld} -m elf32lppclinux"
+ ;;
+ powerpc64-*linux*)
+ LD="${LD-ld} -m elf32ppclinux"
+ ;;
+ s390x-*linux*)
+ LD="${LD-ld} -m elf_s390"
+ ;;
+ sparc64-*linux*)
+ LD="${LD-ld} -m elf32_sparc"
+ ;;
+ esac
+ ;;
+ *64-bit*)
+ case $host in
+ x86_64-*kfreebsd*-gnu)
+ LD="${LD-ld} -m elf_x86_64_fbsd"
+ ;;
+ x86_64-*linux*)
+ LD="${LD-ld} -m elf_x86_64"
+ ;;
+ powerpcle-*linux*)
+ LD="${LD-ld} -m elf64lppc"
+ ;;
+ powerpc-*linux*)
+ LD="${LD-ld} -m elf64ppc"
+ ;;
+ s390*-*linux*|s390*-*tpf*)
+ LD="${LD-ld} -m elf64_s390"
+ ;;
+ sparc*-*linux*)
+ LD="${LD-ld} -m elf64_sparc"
+ ;;
+ esac
+ ;;
+ esac
+ fi
+ rm -rf conftest*
+ ;;
+
+*-*-sco3.2v5*)
+ # On SCO OpenServer 5, we need -belf to get full-featured binaries.
+ SAVE_CFLAGS=$CFLAGS
+ CFLAGS="$CFLAGS -belf"
+ { $as_echo "$as_me:${as_lineno-$LINENO}: checking whether the C compiler needs -belf" >&5
+$as_echo_n "checking whether the C compiler needs -belf... " >&6; }
+if ${lt_cv_cc_needs_belf+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ ac_ext=c
+ac_cpp='$CPP $CPPFLAGS'
+ac_compile='$CC -c $CFLAGS $CPPFLAGS conftest.$ac_ext >&5'
+ac_link='$CC -o conftest$ac_exeext $CFLAGS $CPPFLAGS $LDFLAGS conftest.$ac_ext $LIBS >&5'
+ac_compiler_gnu=$ac_cv_c_compiler_gnu
+
+ cat confdefs.h - <<_ACEOF >conftest.$ac_ext
+/* end confdefs.h. */
+
+int
+main ()
+{
+
+ ;
+ return 0;
+}
+_ACEOF
+if ac_fn_c_try_link "$LINENO"; then :
+ lt_cv_cc_needs_belf=yes
+else
+ lt_cv_cc_needs_belf=no
+fi
+rm -f core conftest.err conftest.$ac_objext \
+ conftest$ac_exeext conftest.$ac_ext
+ ac_ext=c
+ac_cpp='$CPP $CPPFLAGS'
+ac_compile='$CC -c $CFLAGS $CPPFLAGS conftest.$ac_ext >&5'
+ac_link='$CC -o conftest$ac_exeext $CFLAGS $CPPFLAGS $LDFLAGS conftest.$ac_ext $LIBS >&5'
+ac_compiler_gnu=$ac_cv_c_compiler_gnu
+
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $lt_cv_cc_needs_belf" >&5
+$as_echo "$lt_cv_cc_needs_belf" >&6; }
+ if test yes != "$lt_cv_cc_needs_belf"; then
+ # this is probably gcc 2.8.0, egcs 1.0 or newer; no need for -belf
+ CFLAGS=$SAVE_CFLAGS
+ fi
+ ;;
+*-*solaris*)
+ # Find out what ABI is being produced by ac_compile, and set linker
+ # options accordingly.
+ echo 'int i;' > conftest.$ac_ext
+ if { { eval echo "\"\$as_me\":${as_lineno-$LINENO}: \"$ac_compile\""; } >&5
+ (eval $ac_compile) 2>&5
+ ac_status=$?
+ $as_echo "$as_me:${as_lineno-$LINENO}: \$? = $ac_status" >&5
+ test $ac_status = 0; }; then
+ case `/usr/bin/file conftest.o` in
+ *64-bit*)
+ case $lt_cv_prog_gnu_ld in
+ yes*)
+ case $host in
+ i?86-*-solaris*|x86_64-*-solaris*)
+ LD="${LD-ld} -m elf_x86_64"
+ ;;
+ sparc*-*-solaris*)
+ LD="${LD-ld} -m elf64_sparc"
+ ;;
+ esac
+ # GNU ld 2.21 introduced _sol2 emulations. Use them if available.
+ if ${LD-ld} -V | grep _sol2 >/dev/null 2>&1; then
+ LD=${LD-ld}_sol2
+ fi
+ ;;
+ *)
+ if ${LD-ld} -64 -r -o conftest2.o conftest.o >/dev/null 2>&1; then
+ LD="${LD-ld} -64"
+ fi
+ ;;
+ esac
+ ;;
+ esac
+ fi
+ rm -rf conftest*
+ ;;
+esac
+
+need_locks=$enable_libtool_lock
+
+if test -n "$ac_tool_prefix"; then
+ # Extract the first word of "${ac_tool_prefix}mt", so it can be a program name with args.
+set dummy ${ac_tool_prefix}mt; ac_word=$2
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $ac_word" >&5
+$as_echo_n "checking for $ac_word... " >&6; }
+if ${ac_cv_prog_MANIFEST_TOOL+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ if test -n "$MANIFEST_TOOL"; then
+ ac_cv_prog_MANIFEST_TOOL="$MANIFEST_TOOL" # Let the user override the test.
+else
+as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH
+do
+ IFS=$as_save_IFS
+ test -z "$as_dir" && as_dir=.
+ for ac_exec_ext in '' $ac_executable_extensions; do
+ if as_fn_executable_p "$as_dir/$ac_word$ac_exec_ext"; then
+ ac_cv_prog_MANIFEST_TOOL="${ac_tool_prefix}mt"
+ $as_echo "$as_me:${as_lineno-$LINENO}: found $as_dir/$ac_word$ac_exec_ext" >&5
+ break 2
+ fi
+done
+ done
+IFS=$as_save_IFS
+
+fi
+fi
+MANIFEST_TOOL=$ac_cv_prog_MANIFEST_TOOL
+if test -n "$MANIFEST_TOOL"; then
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: $MANIFEST_TOOL" >&5
+$as_echo "$MANIFEST_TOOL" >&6; }
+else
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5
+$as_echo "no" >&6; }
+fi
+
+
+fi
+if test -z "$ac_cv_prog_MANIFEST_TOOL"; then
+ ac_ct_MANIFEST_TOOL=$MANIFEST_TOOL
+ # Extract the first word of "mt", so it can be a program name with args.
+set dummy mt; ac_word=$2
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $ac_word" >&5
+$as_echo_n "checking for $ac_word... " >&6; }
+if ${ac_cv_prog_ac_ct_MANIFEST_TOOL+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ if test -n "$ac_ct_MANIFEST_TOOL"; then
+ ac_cv_prog_ac_ct_MANIFEST_TOOL="$ac_ct_MANIFEST_TOOL" # Let the user override the test.
+else
+as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH
+do
+ IFS=$as_save_IFS
+ test -z "$as_dir" && as_dir=.
+ for ac_exec_ext in '' $ac_executable_extensions; do
+ if as_fn_executable_p "$as_dir/$ac_word$ac_exec_ext"; then
+ ac_cv_prog_ac_ct_MANIFEST_TOOL="mt"
+ $as_echo "$as_me:${as_lineno-$LINENO}: found $as_dir/$ac_word$ac_exec_ext" >&5
+ break 2
+ fi
+done
+ done
+IFS=$as_save_IFS
+
+fi
+fi
+ac_ct_MANIFEST_TOOL=$ac_cv_prog_ac_ct_MANIFEST_TOOL
+if test -n "$ac_ct_MANIFEST_TOOL"; then
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_ct_MANIFEST_TOOL" >&5
+$as_echo "$ac_ct_MANIFEST_TOOL" >&6; }
+else
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5
+$as_echo "no" >&6; }
+fi
+
+ if test "x$ac_ct_MANIFEST_TOOL" = x; then
+ MANIFEST_TOOL=":"
+ else
+ case $cross_compiling:$ac_tool_warned in
+yes:)
+{ $as_echo "$as_me:${as_lineno-$LINENO}: WARNING: using cross tools not prefixed with host triplet" >&5
+$as_echo "$as_me: WARNING: using cross tools not prefixed with host triplet" >&2;}
+ac_tool_warned=yes ;;
+esac
+ MANIFEST_TOOL=$ac_ct_MANIFEST_TOOL
+ fi
+else
+ MANIFEST_TOOL="$ac_cv_prog_MANIFEST_TOOL"
+fi
+
+test -z "$MANIFEST_TOOL" && MANIFEST_TOOL=mt
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking if $MANIFEST_TOOL is a manifest tool" >&5
+$as_echo_n "checking if $MANIFEST_TOOL is a manifest tool... " >&6; }
+if ${lt_cv_path_mainfest_tool+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ lt_cv_path_mainfest_tool=no
+ echo "$as_me:$LINENO: $MANIFEST_TOOL '-?'" >&5
+ $MANIFEST_TOOL '-?' 2>conftest.err > conftest.out
+ cat conftest.err >&5
+ if $GREP 'Manifest Tool' conftest.out > /dev/null; then
+ lt_cv_path_mainfest_tool=yes
+ fi
+ rm -f conftest*
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $lt_cv_path_mainfest_tool" >&5
+$as_echo "$lt_cv_path_mainfest_tool" >&6; }
+if test yes != "$lt_cv_path_mainfest_tool"; then
+ MANIFEST_TOOL=:
+fi
+
+
+
+
+
+
+ case $host_os in
+ rhapsody* | darwin*)
+ if test -n "$ac_tool_prefix"; then
+ # Extract the first word of "${ac_tool_prefix}dsymutil", so it can be a program name with args.
+set dummy ${ac_tool_prefix}dsymutil; ac_word=$2
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $ac_word" >&5
+$as_echo_n "checking for $ac_word... " >&6; }
+if ${ac_cv_prog_DSYMUTIL+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ if test -n "$DSYMUTIL"; then
+ ac_cv_prog_DSYMUTIL="$DSYMUTIL" # Let the user override the test.
+else
+as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH
+do
+ IFS=$as_save_IFS
+ test -z "$as_dir" && as_dir=.
+ for ac_exec_ext in '' $ac_executable_extensions; do
+ if as_fn_executable_p "$as_dir/$ac_word$ac_exec_ext"; then
+ ac_cv_prog_DSYMUTIL="${ac_tool_prefix}dsymutil"
+ $as_echo "$as_me:${as_lineno-$LINENO}: found $as_dir/$ac_word$ac_exec_ext" >&5
+ break 2
+ fi
+done
+ done
+IFS=$as_save_IFS
+
+fi
+fi
+DSYMUTIL=$ac_cv_prog_DSYMUTIL
+if test -n "$DSYMUTIL"; then
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: $DSYMUTIL" >&5
+$as_echo "$DSYMUTIL" >&6; }
+else
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5
+$as_echo "no" >&6; }
+fi
+
+
+fi
+if test -z "$ac_cv_prog_DSYMUTIL"; then
+ ac_ct_DSYMUTIL=$DSYMUTIL
+ # Extract the first word of "dsymutil", so it can be a program name with args.
+set dummy dsymutil; ac_word=$2
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $ac_word" >&5
+$as_echo_n "checking for $ac_word... " >&6; }
+if ${ac_cv_prog_ac_ct_DSYMUTIL+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ if test -n "$ac_ct_DSYMUTIL"; then
+ ac_cv_prog_ac_ct_DSYMUTIL="$ac_ct_DSYMUTIL" # Let the user override the test.
+else
+as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH
+do
+ IFS=$as_save_IFS
+ test -z "$as_dir" && as_dir=.
+ for ac_exec_ext in '' $ac_executable_extensions; do
+ if as_fn_executable_p "$as_dir/$ac_word$ac_exec_ext"; then
+ ac_cv_prog_ac_ct_DSYMUTIL="dsymutil"
+ $as_echo "$as_me:${as_lineno-$LINENO}: found $as_dir/$ac_word$ac_exec_ext" >&5
+ break 2
+ fi
+done
+ done
+IFS=$as_save_IFS
+
+fi
+fi
+ac_ct_DSYMUTIL=$ac_cv_prog_ac_ct_DSYMUTIL
+if test -n "$ac_ct_DSYMUTIL"; then
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_ct_DSYMUTIL" >&5
+$as_echo "$ac_ct_DSYMUTIL" >&6; }
+else
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5
+$as_echo "no" >&6; }
+fi
+
+ if test "x$ac_ct_DSYMUTIL" = x; then
+ DSYMUTIL=":"
+ else
+ case $cross_compiling:$ac_tool_warned in
+yes:)
+{ $as_echo "$as_me:${as_lineno-$LINENO}: WARNING: using cross tools not prefixed with host triplet" >&5
+$as_echo "$as_me: WARNING: using cross tools not prefixed with host triplet" >&2;}
+ac_tool_warned=yes ;;
+esac
+ DSYMUTIL=$ac_ct_DSYMUTIL
+ fi
+else
+ DSYMUTIL="$ac_cv_prog_DSYMUTIL"
+fi
+
+ if test -n "$ac_tool_prefix"; then
+ # Extract the first word of "${ac_tool_prefix}nmedit", so it can be a program name with args.
+set dummy ${ac_tool_prefix}nmedit; ac_word=$2
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $ac_word" >&5
+$as_echo_n "checking for $ac_word... " >&6; }
+if ${ac_cv_prog_NMEDIT+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ if test -n "$NMEDIT"; then
+ ac_cv_prog_NMEDIT="$NMEDIT" # Let the user override the test.
+else
+as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH
+do
+ IFS=$as_save_IFS
+ test -z "$as_dir" && as_dir=.
+ for ac_exec_ext in '' $ac_executable_extensions; do
+ if as_fn_executable_p "$as_dir/$ac_word$ac_exec_ext"; then
+ ac_cv_prog_NMEDIT="${ac_tool_prefix}nmedit"
+ $as_echo "$as_me:${as_lineno-$LINENO}: found $as_dir/$ac_word$ac_exec_ext" >&5
+ break 2
+ fi
+done
+ done
+IFS=$as_save_IFS
+
+fi
+fi
+NMEDIT=$ac_cv_prog_NMEDIT
+if test -n "$NMEDIT"; then
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: $NMEDIT" >&5
+$as_echo "$NMEDIT" >&6; }
+else
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5
+$as_echo "no" >&6; }
+fi
+
+
+fi
+if test -z "$ac_cv_prog_NMEDIT"; then
+ ac_ct_NMEDIT=$NMEDIT
+ # Extract the first word of "nmedit", so it can be a program name with args.
+set dummy nmedit; ac_word=$2
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $ac_word" >&5
+$as_echo_n "checking for $ac_word... " >&6; }
+if ${ac_cv_prog_ac_ct_NMEDIT+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ if test -n "$ac_ct_NMEDIT"; then
+ ac_cv_prog_ac_ct_NMEDIT="$ac_ct_NMEDIT" # Let the user override the test.
+else
+as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH
+do
+ IFS=$as_save_IFS
+ test -z "$as_dir" && as_dir=.
+ for ac_exec_ext in '' $ac_executable_extensions; do
+ if as_fn_executable_p "$as_dir/$ac_word$ac_exec_ext"; then
+ ac_cv_prog_ac_ct_NMEDIT="nmedit"
+ $as_echo "$as_me:${as_lineno-$LINENO}: found $as_dir/$ac_word$ac_exec_ext" >&5
+ break 2
+ fi
+done
+ done
+IFS=$as_save_IFS
+
+fi
+fi
+ac_ct_NMEDIT=$ac_cv_prog_ac_ct_NMEDIT
+if test -n "$ac_ct_NMEDIT"; then
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_ct_NMEDIT" >&5
+$as_echo "$ac_ct_NMEDIT" >&6; }
+else
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5
+$as_echo "no" >&6; }
+fi
+
+ if test "x$ac_ct_NMEDIT" = x; then
+ NMEDIT=":"
+ else
+ case $cross_compiling:$ac_tool_warned in
+yes:)
+{ $as_echo "$as_me:${as_lineno-$LINENO}: WARNING: using cross tools not prefixed with host triplet" >&5
+$as_echo "$as_me: WARNING: using cross tools not prefixed with host triplet" >&2;}
+ac_tool_warned=yes ;;
+esac
+ NMEDIT=$ac_ct_NMEDIT
+ fi
+else
+ NMEDIT="$ac_cv_prog_NMEDIT"
+fi
+
+ if test -n "$ac_tool_prefix"; then
+ # Extract the first word of "${ac_tool_prefix}lipo", so it can be a program name with args.
+set dummy ${ac_tool_prefix}lipo; ac_word=$2
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $ac_word" >&5
+$as_echo_n "checking for $ac_word... " >&6; }
+if ${ac_cv_prog_LIPO+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ if test -n "$LIPO"; then
+ ac_cv_prog_LIPO="$LIPO" # Let the user override the test.
+else
+as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH
+do
+ IFS=$as_save_IFS
+ test -z "$as_dir" && as_dir=.
+ for ac_exec_ext in '' $ac_executable_extensions; do
+ if as_fn_executable_p "$as_dir/$ac_word$ac_exec_ext"; then
+ ac_cv_prog_LIPO="${ac_tool_prefix}lipo"
+ $as_echo "$as_me:${as_lineno-$LINENO}: found $as_dir/$ac_word$ac_exec_ext" >&5
+ break 2
+ fi
+done
+ done
+IFS=$as_save_IFS
+
+fi
+fi
+LIPO=$ac_cv_prog_LIPO
+if test -n "$LIPO"; then
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: $LIPO" >&5
+$as_echo "$LIPO" >&6; }
+else
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5
+$as_echo "no" >&6; }
+fi
+
+
+fi
+if test -z "$ac_cv_prog_LIPO"; then
+ ac_ct_LIPO=$LIPO
+ # Extract the first word of "lipo", so it can be a program name with args.
+set dummy lipo; ac_word=$2
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $ac_word" >&5
+$as_echo_n "checking for $ac_word... " >&6; }
+if ${ac_cv_prog_ac_ct_LIPO+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ if test -n "$ac_ct_LIPO"; then
+ ac_cv_prog_ac_ct_LIPO="$ac_ct_LIPO" # Let the user override the test.
+else
+as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH
+do
+ IFS=$as_save_IFS
+ test -z "$as_dir" && as_dir=.
+ for ac_exec_ext in '' $ac_executable_extensions; do
+ if as_fn_executable_p "$as_dir/$ac_word$ac_exec_ext"; then
+ ac_cv_prog_ac_ct_LIPO="lipo"
+ $as_echo "$as_me:${as_lineno-$LINENO}: found $as_dir/$ac_word$ac_exec_ext" >&5
+ break 2
+ fi
+done
+ done
+IFS=$as_save_IFS
+
+fi
+fi
+ac_ct_LIPO=$ac_cv_prog_ac_ct_LIPO
+if test -n "$ac_ct_LIPO"; then
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_ct_LIPO" >&5
+$as_echo "$ac_ct_LIPO" >&6; }
+else
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5
+$as_echo "no" >&6; }
+fi
+
+ if test "x$ac_ct_LIPO" = x; then
+ LIPO=":"
+ else
+ case $cross_compiling:$ac_tool_warned in
+yes:)
+{ $as_echo "$as_me:${as_lineno-$LINENO}: WARNING: using cross tools not prefixed with host triplet" >&5
+$as_echo "$as_me: WARNING: using cross tools not prefixed with host triplet" >&2;}
+ac_tool_warned=yes ;;
+esac
+ LIPO=$ac_ct_LIPO
+ fi
+else
+ LIPO="$ac_cv_prog_LIPO"
+fi
+
+ if test -n "$ac_tool_prefix"; then
+ # Extract the first word of "${ac_tool_prefix}otool", so it can be a program name with args.
+set dummy ${ac_tool_prefix}otool; ac_word=$2
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $ac_word" >&5
+$as_echo_n "checking for $ac_word... " >&6; }
+if ${ac_cv_prog_OTOOL+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ if test -n "$OTOOL"; then
+ ac_cv_prog_OTOOL="$OTOOL" # Let the user override the test.
+else
+as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH
+do
+ IFS=$as_save_IFS
+ test -z "$as_dir" && as_dir=.
+ for ac_exec_ext in '' $ac_executable_extensions; do
+ if as_fn_executable_p "$as_dir/$ac_word$ac_exec_ext"; then
+ ac_cv_prog_OTOOL="${ac_tool_prefix}otool"
+ $as_echo "$as_me:${as_lineno-$LINENO}: found $as_dir/$ac_word$ac_exec_ext" >&5
+ break 2
+ fi
+done
+ done
+IFS=$as_save_IFS
+
+fi
+fi
+OTOOL=$ac_cv_prog_OTOOL
+if test -n "$OTOOL"; then
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: $OTOOL" >&5
+$as_echo "$OTOOL" >&6; }
+else
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5
+$as_echo "no" >&6; }
+fi
+
+
+fi
+if test -z "$ac_cv_prog_OTOOL"; then
+ ac_ct_OTOOL=$OTOOL
+ # Extract the first word of "otool", so it can be a program name with args.
+set dummy otool; ac_word=$2
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $ac_word" >&5
+$as_echo_n "checking for $ac_word... " >&6; }
+if ${ac_cv_prog_ac_ct_OTOOL+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ if test -n "$ac_ct_OTOOL"; then
+ ac_cv_prog_ac_ct_OTOOL="$ac_ct_OTOOL" # Let the user override the test.
+else
+as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH
+do
+ IFS=$as_save_IFS
+ test -z "$as_dir" && as_dir=.
+ for ac_exec_ext in '' $ac_executable_extensions; do
+ if as_fn_executable_p "$as_dir/$ac_word$ac_exec_ext"; then
+ ac_cv_prog_ac_ct_OTOOL="otool"
+ $as_echo "$as_me:${as_lineno-$LINENO}: found $as_dir/$ac_word$ac_exec_ext" >&5
+ break 2
+ fi
+done
+ done
+IFS=$as_save_IFS
+
+fi
+fi
+ac_ct_OTOOL=$ac_cv_prog_ac_ct_OTOOL
+if test -n "$ac_ct_OTOOL"; then
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_ct_OTOOL" >&5
+$as_echo "$ac_ct_OTOOL" >&6; }
+else
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5
+$as_echo "no" >&6; }
+fi
+
+ if test "x$ac_ct_OTOOL" = x; then
+ OTOOL=":"
+ else
+ case $cross_compiling:$ac_tool_warned in
+yes:)
+{ $as_echo "$as_me:${as_lineno-$LINENO}: WARNING: using cross tools not prefixed with host triplet" >&5
+$as_echo "$as_me: WARNING: using cross tools not prefixed with host triplet" >&2;}
+ac_tool_warned=yes ;;
+esac
+ OTOOL=$ac_ct_OTOOL
+ fi
+else
+ OTOOL="$ac_cv_prog_OTOOL"
+fi
+
+ if test -n "$ac_tool_prefix"; then
+ # Extract the first word of "${ac_tool_prefix}otool64", so it can be a program name with args.
+set dummy ${ac_tool_prefix}otool64; ac_word=$2
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $ac_word" >&5
+$as_echo_n "checking for $ac_word... " >&6; }
+if ${ac_cv_prog_OTOOL64+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ if test -n "$OTOOL64"; then
+ ac_cv_prog_OTOOL64="$OTOOL64" # Let the user override the test.
+else
+as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH
+do
+ IFS=$as_save_IFS
+ test -z "$as_dir" && as_dir=.
+ for ac_exec_ext in '' $ac_executable_extensions; do
+ if as_fn_executable_p "$as_dir/$ac_word$ac_exec_ext"; then
+ ac_cv_prog_OTOOL64="${ac_tool_prefix}otool64"
+ $as_echo "$as_me:${as_lineno-$LINENO}: found $as_dir/$ac_word$ac_exec_ext" >&5
+ break 2
+ fi
+done
+ done
+IFS=$as_save_IFS
+
+fi
+fi
+OTOOL64=$ac_cv_prog_OTOOL64
+if test -n "$OTOOL64"; then
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: $OTOOL64" >&5
+$as_echo "$OTOOL64" >&6; }
+else
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5
+$as_echo "no" >&6; }
+fi
+
+
+fi
+if test -z "$ac_cv_prog_OTOOL64"; then
+ ac_ct_OTOOL64=$OTOOL64
+ # Extract the first word of "otool64", so it can be a program name with args.
+set dummy otool64; ac_word=$2
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $ac_word" >&5
+$as_echo_n "checking for $ac_word... " >&6; }
+if ${ac_cv_prog_ac_ct_OTOOL64+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ if test -n "$ac_ct_OTOOL64"; then
+ ac_cv_prog_ac_ct_OTOOL64="$ac_ct_OTOOL64" # Let the user override the test.
+else
+as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH
+do
+ IFS=$as_save_IFS
+ test -z "$as_dir" && as_dir=.
+ for ac_exec_ext in '' $ac_executable_extensions; do
+ if as_fn_executable_p "$as_dir/$ac_word$ac_exec_ext"; then
+ ac_cv_prog_ac_ct_OTOOL64="otool64"
+ $as_echo "$as_me:${as_lineno-$LINENO}: found $as_dir/$ac_word$ac_exec_ext" >&5
+ break 2
+ fi
+done
+ done
+IFS=$as_save_IFS
+
+fi
+fi
+ac_ct_OTOOL64=$ac_cv_prog_ac_ct_OTOOL64
+if test -n "$ac_ct_OTOOL64"; then
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_ct_OTOOL64" >&5
+$as_echo "$ac_ct_OTOOL64" >&6; }
+else
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5
+$as_echo "no" >&6; }
+fi
+
+ if test "x$ac_ct_OTOOL64" = x; then
+ OTOOL64=":"
+ else
+ case $cross_compiling:$ac_tool_warned in
+yes:)
+{ $as_echo "$as_me:${as_lineno-$LINENO}: WARNING: using cross tools not prefixed with host triplet" >&5
+$as_echo "$as_me: WARNING: using cross tools not prefixed with host triplet" >&2;}
+ac_tool_warned=yes ;;
+esac
+ OTOOL64=$ac_ct_OTOOL64
+ fi
+else
+ OTOOL64="$ac_cv_prog_OTOOL64"
+fi
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ { $as_echo "$as_me:${as_lineno-$LINENO}: checking for -single_module linker flag" >&5
+$as_echo_n "checking for -single_module linker flag... " >&6; }
+if ${lt_cv_apple_cc_single_mod+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ lt_cv_apple_cc_single_mod=no
+ if test -z "$LT_MULTI_MODULE"; then
+ # By default we will add the -single_module flag. You can override
+ # by either setting the environment variable LT_MULTI_MODULE
+ # non-empty at configure time, or by adding -multi_module to the
+ # link flags.
+ rm -rf libconftest.dylib*
+ echo "int foo(void){return 1;}" > conftest.c
+ echo "$LTCC $LTCFLAGS $LDFLAGS -o libconftest.dylib \
+-dynamiclib -Wl,-single_module conftest.c" >&5
+ $LTCC $LTCFLAGS $LDFLAGS -o libconftest.dylib \
+ -dynamiclib -Wl,-single_module conftest.c 2>conftest.err
+ _lt_result=$?
+ # If there is a non-empty error log, and "single_module"
+ # appears in it, assume the flag caused a linker warning
+ if test -s conftest.err && $GREP single_module conftest.err; then
+ cat conftest.err >&5
+ # Otherwise, if the output was created with a 0 exit code from
+ # the compiler, it worked.
+ elif test -f libconftest.dylib && test 0 = "$_lt_result"; then
+ lt_cv_apple_cc_single_mod=yes
+ else
+ cat conftest.err >&5
+ fi
+ rm -rf libconftest.dylib*
+ rm -f conftest.*
+ fi
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $lt_cv_apple_cc_single_mod" >&5
+$as_echo "$lt_cv_apple_cc_single_mod" >&6; }
+
+ { $as_echo "$as_me:${as_lineno-$LINENO}: checking for -exported_symbols_list linker flag" >&5
+$as_echo_n "checking for -exported_symbols_list linker flag... " >&6; }
+if ${lt_cv_ld_exported_symbols_list+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ lt_cv_ld_exported_symbols_list=no
+ save_LDFLAGS=$LDFLAGS
+ echo "_main" > conftest.sym
+ LDFLAGS="$LDFLAGS -Wl,-exported_symbols_list,conftest.sym"
+ cat confdefs.h - <<_ACEOF >conftest.$ac_ext
+/* end confdefs.h. */
+
+int
+main ()
+{
+
+ ;
+ return 0;
+}
+_ACEOF
+if ac_fn_c_try_link "$LINENO"; then :
+ lt_cv_ld_exported_symbols_list=yes
+else
+ lt_cv_ld_exported_symbols_list=no
+fi
+rm -f core conftest.err conftest.$ac_objext \
+ conftest$ac_exeext conftest.$ac_ext
+ LDFLAGS=$save_LDFLAGS
+
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $lt_cv_ld_exported_symbols_list" >&5
+$as_echo "$lt_cv_ld_exported_symbols_list" >&6; }
+
+ { $as_echo "$as_me:${as_lineno-$LINENO}: checking for -force_load linker flag" >&5
+$as_echo_n "checking for -force_load linker flag... " >&6; }
+if ${lt_cv_ld_force_load+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ lt_cv_ld_force_load=no
+ cat > conftest.c << _LT_EOF
+int forced_loaded() { return 2;}
+_LT_EOF
+ echo "$LTCC $LTCFLAGS -c -o conftest.o conftest.c" >&5
+ $LTCC $LTCFLAGS -c -o conftest.o conftest.c 2>&5
+ echo "$AR cru libconftest.a conftest.o" >&5
+ $AR cru libconftest.a conftest.o 2>&5
+ echo "$RANLIB libconftest.a" >&5
+ $RANLIB libconftest.a 2>&5
+ cat > conftest.c << _LT_EOF
+int main() { return 0;}
+_LT_EOF
+ echo "$LTCC $LTCFLAGS $LDFLAGS -o conftest conftest.c -Wl,-force_load,./libconftest.a" >&5
+ $LTCC $LTCFLAGS $LDFLAGS -o conftest conftest.c -Wl,-force_load,./libconftest.a 2>conftest.err
+ _lt_result=$?
+ if test -s conftest.err && $GREP force_load conftest.err; then
+ cat conftest.err >&5
+ elif test -f conftest && test 0 = "$_lt_result" && $GREP forced_load conftest >/dev/null 2>&1; then
+ lt_cv_ld_force_load=yes
+ else
+ cat conftest.err >&5
+ fi
+ rm -f conftest.err libconftest.a conftest conftest.c
+ rm -rf conftest.dSYM
+
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $lt_cv_ld_force_load" >&5
+$as_echo "$lt_cv_ld_force_load" >&6; }
+ case $host_os in
+ rhapsody* | darwin1.[012])
+ _lt_dar_allow_undefined='$wl-undefined ${wl}suppress' ;;
+ darwin1.*)
+ _lt_dar_allow_undefined='$wl-flat_namespace $wl-undefined ${wl}suppress' ;;
+ darwin*) # darwin 5.x on
+ # if running on 10.5 or later, the deployment target defaults
+ # to the OS version, if on x86, and 10.4, the deployment
+ # target defaults to 10.4. Don't you love it?
+ case ${MACOSX_DEPLOYMENT_TARGET-10.0},$host in
+ 10.0,*86*-darwin8*|10.0,*-darwin[91]*)
+ _lt_dar_allow_undefined='$wl-undefined ${wl}dynamic_lookup' ;;
+ 10.[012][,.]*)
+ _lt_dar_allow_undefined='$wl-flat_namespace $wl-undefined ${wl}suppress' ;;
+ 10.*)
+ _lt_dar_allow_undefined='$wl-undefined ${wl}dynamic_lookup' ;;
+ esac
+ ;;
+ esac
+ if test yes = "$lt_cv_apple_cc_single_mod"; then
+ _lt_dar_single_mod='$single_module'
+ fi
+ if test yes = "$lt_cv_ld_exported_symbols_list"; then
+ _lt_dar_export_syms=' $wl-exported_symbols_list,$output_objdir/$libname-symbols.expsym'
+ else
+ _lt_dar_export_syms='~$NMEDIT -s $output_objdir/$libname-symbols.expsym $lib'
+ fi
+ if test : != "$DSYMUTIL" && test no = "$lt_cv_ld_force_load"; then
+ _lt_dsymutil='~$DSYMUTIL $lib || :'
+ else
+ _lt_dsymutil=
+ fi
+ ;;
+ esac
+
+# func_munge_path_list VARIABLE PATH
+# -----------------------------------
+# VARIABLE is name of variable containing _space_ separated list of
+# directories to be munged by the contents of PATH, which is string
+# having a format:
+# "DIR[:DIR]:"
+# string "DIR[ DIR]" will be prepended to VARIABLE
+# ":DIR[:DIR]"
+# string "DIR[ DIR]" will be appended to VARIABLE
+# "DIRP[:DIRP]::[DIRA:]DIRA"
+# string "DIRP[ DIRP]" will be prepended to VARIABLE and string
+# "DIRA[ DIRA]" will be appended to VARIABLE
+# "DIR[:DIR]"
+# VARIABLE will be replaced by "DIR[ DIR]"
+func_munge_path_list ()
+{
+ case x$2 in
+ x)
+ ;;
+ *:)
+ eval $1=\"`$ECHO $2 | $SED 's/:/ /g'` \$$1\"
+ ;;
+ x:*)
+ eval $1=\"\$$1 `$ECHO $2 | $SED 's/:/ /g'`\"
+ ;;
+ *::*)
+ eval $1=\"\$$1\ `$ECHO $2 | $SED -e 's/.*:://' -e 's/:/ /g'`\"
+ eval $1=\"`$ECHO $2 | $SED -e 's/::.*//' -e 's/:/ /g'`\ \$$1\"
+ ;;
+ *)
+ eval $1=\"`$ECHO $2 | $SED 's/:/ /g'`\"
+ ;;
+ esac
+}
+
+ac_ext=c
+ac_cpp='$CPP $CPPFLAGS'
+ac_compile='$CC -c $CFLAGS $CPPFLAGS conftest.$ac_ext >&5'
+ac_link='$CC -o conftest$ac_exeext $CFLAGS $CPPFLAGS $LDFLAGS conftest.$ac_ext $LIBS >&5'
+ac_compiler_gnu=$ac_cv_c_compiler_gnu
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking how to run the C preprocessor" >&5
+$as_echo_n "checking how to run the C preprocessor... " >&6; }
+# On Suns, sometimes $CPP names a directory.
+if test -n "$CPP" && test -d "$CPP"; then
+ CPP=
+fi
+if test -z "$CPP"; then
+ if ${ac_cv_prog_CPP+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ # Double quotes because CPP needs to be expanded
+ for CPP in "$CC -E" "$CC -E -traditional-cpp" "/lib/cpp"
+ do
+ ac_preproc_ok=false
+for ac_c_preproc_warn_flag in '' yes
+do
+ # Use a header file that comes with gcc, so configuring glibc
+ # with a fresh cross-compiler works.
+ # Prefer <limits.h> to <assert.h> if __STDC__ is defined, since
+ # <limits.h> exists even on freestanding compilers.
+ # On the NeXT, cc -E runs the code through the compiler's parser,
+ # not just through cpp. "Syntax error" is here to catch this case.
+ cat confdefs.h - <<_ACEOF >conftest.$ac_ext
+/* end confdefs.h. */
+#ifdef __STDC__
+# include <limits.h>
+#else
+# include <assert.h>
+#endif
+ Syntax error
+_ACEOF
+if ac_fn_c_try_cpp "$LINENO"; then :
+
+else
+ # Broken: fails on valid input.
+continue
+fi
+rm -f conftest.err conftest.i conftest.$ac_ext
+
+ # OK, works on sane cases. Now check whether nonexistent headers
+ # can be detected and how.
+ cat confdefs.h - <<_ACEOF >conftest.$ac_ext
+/* end confdefs.h. */
+#include <ac_nonexistent.h>
+_ACEOF
+if ac_fn_c_try_cpp "$LINENO"; then :
+ # Broken: success on invalid input.
+continue
+else
+ # Passes both tests.
+ac_preproc_ok=:
+break
+fi
+rm -f conftest.err conftest.i conftest.$ac_ext
+
+done
+# Because of `break', _AC_PREPROC_IFELSE's cleaning code was skipped.
+rm -f conftest.i conftest.err conftest.$ac_ext
+if $ac_preproc_ok; then :
+ break
+fi
+
+ done
+ ac_cv_prog_CPP=$CPP
+
+fi
+ CPP=$ac_cv_prog_CPP
+else
+ ac_cv_prog_CPP=$CPP
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $CPP" >&5
+$as_echo "$CPP" >&6; }
+ac_preproc_ok=false
+for ac_c_preproc_warn_flag in '' yes
+do
+ # Use a header file that comes with gcc, so configuring glibc
+ # with a fresh cross-compiler works.
+ # Prefer <limits.h> to <assert.h> if __STDC__ is defined, since
+ # <limits.h> exists even on freestanding compilers.
+ # On the NeXT, cc -E runs the code through the compiler's parser,
+ # not just through cpp. "Syntax error" is here to catch this case.
+ cat confdefs.h - <<_ACEOF >conftest.$ac_ext
+/* end confdefs.h. */
+#ifdef __STDC__
+# include <limits.h>
+#else
+# include <assert.h>
+#endif
+ Syntax error
+_ACEOF
+if ac_fn_c_try_cpp "$LINENO"; then :
+
+else
+ # Broken: fails on valid input.
+continue
+fi
+rm -f conftest.err conftest.i conftest.$ac_ext
+
+ # OK, works on sane cases. Now check whether nonexistent headers
+ # can be detected and how.
+ cat confdefs.h - <<_ACEOF >conftest.$ac_ext
+/* end confdefs.h. */
+#include <ac_nonexistent.h>
+_ACEOF
+if ac_fn_c_try_cpp "$LINENO"; then :
+ # Broken: success on invalid input.
+continue
+else
+ # Passes both tests.
+ac_preproc_ok=:
+break
+fi
+rm -f conftest.err conftest.i conftest.$ac_ext
+
+done
+# Because of `break', _AC_PREPROC_IFELSE's cleaning code was skipped.
+rm -f conftest.i conftest.err conftest.$ac_ext
+if $ac_preproc_ok; then :
+
+else
+ { { $as_echo "$as_me:${as_lineno-$LINENO}: error: in \`$ac_pwd':" >&5
+$as_echo "$as_me: error: in \`$ac_pwd':" >&2;}
+as_fn_error $? "C preprocessor \"$CPP\" fails sanity check
+See \`config.log' for more details" "$LINENO" 5; }
+fi
+
+ac_ext=c
+ac_cpp='$CPP $CPPFLAGS'
+ac_compile='$CC -c $CFLAGS $CPPFLAGS conftest.$ac_ext >&5'
+ac_link='$CC -o conftest$ac_exeext $CFLAGS $CPPFLAGS $LDFLAGS conftest.$ac_ext $LIBS >&5'
+ac_compiler_gnu=$ac_cv_c_compiler_gnu
+
+
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for ANSI C header files" >&5
+$as_echo_n "checking for ANSI C header files... " >&6; }
+if ${ac_cv_header_stdc+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ cat confdefs.h - <<_ACEOF >conftest.$ac_ext
+/* end confdefs.h. */
+#include <stdlib.h>
+#include <stdarg.h>
+#include <string.h>
+#include <float.h>
+
+int
+main ()
+{
+
+ ;
+ return 0;
+}
+_ACEOF
+if ac_fn_c_try_compile "$LINENO"; then :
+ ac_cv_header_stdc=yes
+else
+ ac_cv_header_stdc=no
+fi
+rm -f core conftest.err conftest.$ac_objext conftest.$ac_ext
+
+if test $ac_cv_header_stdc = yes; then
+ # SunOS 4.x string.h does not declare mem*, contrary to ANSI.
+ cat confdefs.h - <<_ACEOF >conftest.$ac_ext
+/* end confdefs.h. */
+#include <string.h>
+
+_ACEOF
+if (eval "$ac_cpp conftest.$ac_ext") 2>&5 |
+ $EGREP "memchr" >/dev/null 2>&1; then :
+
+else
+ ac_cv_header_stdc=no
+fi
+rm -f conftest*
+
+fi
+
+if test $ac_cv_header_stdc = yes; then
+ # ISC 2.0.2 stdlib.h does not declare free, contrary to ANSI.
+ cat confdefs.h - <<_ACEOF >conftest.$ac_ext
+/* end confdefs.h. */
+#include <stdlib.h>
+
+_ACEOF
+if (eval "$ac_cpp conftest.$ac_ext") 2>&5 |
+ $EGREP "free" >/dev/null 2>&1; then :
+
+else
+ ac_cv_header_stdc=no
+fi
+rm -f conftest*
+
+fi
+
+if test $ac_cv_header_stdc = yes; then
+ # /bin/cc in Irix-4.0.5 gets non-ANSI ctype macros unless using -ansi.
+ if test "$cross_compiling" = yes; then :
+ :
+else
+ cat confdefs.h - <<_ACEOF >conftest.$ac_ext
+/* end confdefs.h. */
+#include <ctype.h>
+#include <stdlib.h>
+#if ((' ' & 0x0FF) == 0x020)
+# define ISLOWER(c) ('a' <= (c) && (c) <= 'z')
+# define TOUPPER(c) (ISLOWER(c) ? 'A' + ((c) - 'a') : (c))
+#else
+# define ISLOWER(c) \
+ (('a' <= (c) && (c) <= 'i') \
+ || ('j' <= (c) && (c) <= 'r') \
+ || ('s' <= (c) && (c) <= 'z'))
+# define TOUPPER(c) (ISLOWER(c) ? ((c) | 0x40) : (c))
+#endif
+
+#define XOR(e, f) (((e) && !(f)) || (!(e) && (f)))
+int
+main ()
+{
+ int i;
+ for (i = 0; i < 256; i++)
+ if (XOR (islower (i), ISLOWER (i))
+ || toupper (i) != TOUPPER (i))
+ return 2;
+ return 0;
+}
+_ACEOF
+if ac_fn_c_try_run "$LINENO"; then :
+
+else
+ ac_cv_header_stdc=no
+fi
+rm -f core *.core core.conftest.* gmon.out bb.out conftest$ac_exeext \
+ conftest.$ac_objext conftest.beam conftest.$ac_ext
+fi
+
+fi
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_cv_header_stdc" >&5
+$as_echo "$ac_cv_header_stdc" >&6; }
+if test $ac_cv_header_stdc = yes; then
+
+$as_echo "#define STDC_HEADERS 1" >>confdefs.h
+
+fi
+
+# On IRIX 5.3, sys/types and inttypes.h are conflicting.
+for ac_header in sys/types.h sys/stat.h stdlib.h string.h memory.h strings.h \
+ inttypes.h stdint.h unistd.h
+do :
+ as_ac_Header=`$as_echo "ac_cv_header_$ac_header" | $as_tr_sh`
+ac_fn_c_check_header_compile "$LINENO" "$ac_header" "$as_ac_Header" "$ac_includes_default
+"
+if eval test \"x\$"$as_ac_Header"\" = x"yes"; then :
+ cat >>confdefs.h <<_ACEOF
+#define `$as_echo "HAVE_$ac_header" | $as_tr_cpp` 1
+_ACEOF
+
+fi
+
+done
+
+
+for ac_header in dlfcn.h
+do :
+ ac_fn_c_check_header_compile "$LINENO" "dlfcn.h" "ac_cv_header_dlfcn_h" "$ac_includes_default
+"
+if test "x$ac_cv_header_dlfcn_h" = xyes; then :
+ cat >>confdefs.h <<_ACEOF
+#define HAVE_DLFCN_H 1
+_ACEOF
+
+fi
+
+done
+
+##tldbg KPSE_COMMON: dvipng ().
+##tldbg KPSE_BASIC: Remember dvipng () as Kpse_Package (for future messages).
+
+if test "`cd $srcdir && pwd`" != "`pwd`"; then
+ # Use -I$(srcdir) only when $(srcdir) != ., so that make's output
+ # is not polluted with repeated "-I."
+ am__isrc=' -I$(srcdir)'
+ # test to see if srcdir already configured
+ if test -f $srcdir/config.status; then
+ as_fn_error $? "source directory already configured; run \"make distclean\" there first" "$LINENO" 5
+ fi
+fi
+
+# test whether we have cygpath
+if test -z "$CYGPATH_W"; then
+ if (cygpath --version) >/dev/null 2>/dev/null; then
+ CYGPATH_W='cygpath -w'
+ else
+ CYGPATH_W=echo
+ fi
+fi
+
+
+# Define the identity of the package.
+ PACKAGE='dvipng--tex-live-'
+ VERSION='1.17'
+
+
+cat >>confdefs.h <<_ACEOF
+#define PACKAGE "$PACKAGE"
+_ACEOF
+
+
+cat >>confdefs.h <<_ACEOF
+#define VERSION "$VERSION"
+_ACEOF
+
+# Some tools Automake needs.
+
+ACLOCAL=${ACLOCAL-"${am_missing_run}aclocal-${am__api_version}"}
+
+
+AUTOCONF=${AUTOCONF-"${am_missing_run}autoconf"}
+
+
+AUTOMAKE=${AUTOMAKE-"${am_missing_run}automake-${am__api_version}"}
+
+
+AUTOHEADER=${AUTOHEADER-"${am_missing_run}autoheader"}
+
+
+MAKEINFO=${MAKEINFO-"${am_missing_run}makeinfo"}
+
+# For better backward compatibility. To be removed once Automake 1.9.x
+# dies out for good. For more background, see:
+# <https://lists.gnu.org/archive/html/automake/2012-07/msg00001.html>
+# <https://lists.gnu.org/archive/html/automake/2012-07/msg00014.html>
+mkdir_p='$(MKDIR_P)'
+
+# We need awk for the "check" target (and possibly the TAP driver). The
+# system "awk" is bad on some platforms.
+# Always define AMTAR for backward compatibility. Yes, it's still used
+# in the wild :-( We should find a proper way to deprecate it ...
+AMTAR='$${TAR-tar}'
+
+
+# We'll loop over all known methods to create a tar archive until one works.
+_am_tools='gnutar pax cpio none'
+
+am__tar='$${TAR-tar} chof - "$$tardir"' am__untar='$${TAR-tar} xf -'
+
+
+
+
+
+
+# POSIX will say in a future version that running "rm -f" with no argument
+# is OK; and we want to be able to make that assumption in our Makefile
+# recipes. So use an aggressive probe to check that the usage we want is
+# actually supported "in the wild" to an acceptable degree.
+# See automake bug#10828.
+# To make any issue more visible, cause the running configure to be aborted
+# by default if the 'rm' program in use doesn't match our expectations; the
+# user can still override this though.
+if rm -f && rm -fr && rm -rf; then : OK; else
+ cat >&2 <<'END'
+Oops!
+
+Your 'rm' program seems unable to run without file operands specified
+on the command line, even when the '-f' option is present. This is contrary
+to the behaviour of most rm programs out there, and not conforming with
+the upcoming POSIX standard: <http://austingroupbugs.net/view.php?id=542>
+
+Please tell bug-automake@gnu.org about your system, including the value
+of your $PATH and any error possibly output before this message. This
+can help us improve future automake versions.
+
+END
+ if test x"$ACCEPT_INFERIOR_RM_PROGRAM" = x"yes"; then
+ echo 'Configuration will proceed anyway, since you have set the' >&2
+ echo 'ACCEPT_INFERIOR_RM_PROGRAM variable to "yes"' >&2
+ echo >&2
+ else
+ cat >&2 <<'END'
+Aborting the configuration process, to ensure you take notice of the issue.
+
+You can download and install GNU coreutils to get an 'rm' implementation
+that behaves properly: <https://www.gnu.org/software/coreutils/>.
+
+If you want to complete the configuration process using your problematic
+'rm' anyway, export the environment variable ACCEPT_INFERIOR_RM_PROGRAM
+to "yes", and re-run configure.
+
+END
+ as_fn_error $? "Your 'rm' program is bad, sorry." "$LINENO" 5
+ fi
+fi
+
+
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking whether to enable maintainer-specific portions of Makefiles" >&5
+$as_echo_n "checking whether to enable maintainer-specific portions of Makefiles... " >&6; }
+ # Check whether --enable-maintainer-mode was given.
+if test "${enable_maintainer_mode+set}" = set; then :
+ enableval=$enable_maintainer_mode; USE_MAINTAINER_MODE=$enableval
+else
+ USE_MAINTAINER_MODE=no
+fi
+
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: $USE_MAINTAINER_MODE" >&5
+$as_echo "$USE_MAINTAINER_MODE" >&6; }
+ if test $USE_MAINTAINER_MODE = yes; then
+ MAINTAINER_MODE_TRUE=
+ MAINTAINER_MODE_FALSE='#'
+else
+ MAINTAINER_MODE_TRUE='#'
+ MAINTAINER_MODE_FALSE=
+fi
+
+ MAINT=$MAINTAINER_MODE_TRUE
+
+
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking whether the compiler accepts prototypes" >&5
+$as_echo_n "checking whether the compiler accepts prototypes... " >&6; }
+if ${kb_cv_c_prototypes+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ cat confdefs.h - <<_ACEOF >conftest.$ac_ext
+/* end confdefs.h. */
+#include <stdarg.h>
+int
+main ()
+{
+extern void foo(int i,...);
+ ;
+ return 0;
+}
+_ACEOF
+if ac_fn_c_try_link "$LINENO"; then :
+ kb_cv_c_prototypes=yes
+else
+ kb_cv_c_prototypes=no
+fi
+rm -f core conftest.err conftest.$ac_objext \
+ conftest$ac_exeext conftest.$ac_ext
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $kb_cv_c_prototypes" >&5
+$as_echo "$kb_cv_c_prototypes" >&6; }
+if test "x$kb_cv_c_prototypes" = xno; then
+ as_fn_error $? "Sorry, your compiler does not understand prototypes." "$LINENO" 5
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking what warning flags to pass to the C compiler" >&5
+$as_echo_n "checking what warning flags to pass to the C compiler... " >&6; }
+if ${kpse_cv_warning_cflags+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ if test "x$GCC" = xyes; then
+ kpse_cv_warning_cflags=
+if test "x$enable_compiler_warnings" != xno; then
+ kpse_cv_warning_cflags="-Wimplicit -Wreturn-type"
+ case `$CC -dumpversion` in #(
+ 3.4.* | 4.* | 5.*) :
+ kpse_cv_warning_cflags="$kpse_cv_warning_cflags -Wdeclaration-after-statement" ;; #(
+ *) :
+ ;;
+esac
+ case `$CC -dumpversion` in #(
+ 3.[234].* | 4.* | 5.*) :
+ kpse_cv_warning_cflags="$kpse_cv_warning_cflags -Wno-unknown-pragmas" ;; #(
+ *) :
+ ;;
+esac
+ if test "x$enable_compiler_warnings" != xmin; then
+ kpse_cv_warning_cflags="-Wall -Wunused $kpse_cv_warning_cflags"
+ kpse_cv_warning_cflags="$kpse_cv_warning_cflags -Wmissing-prototypes -Wmissing-declarations"
+ if test "x$enable_compiler_warnings" != xyes; then
+ kpse_cv_warning_cflags="$kpse_cv_warning_cflags -Wparentheses -Wswitch -Wtrigraphs -Wpointer-arith"
+ kpse_cv_warning_cflags="$kpse_cv_warning_cflags -Wcast-qual -Wcast-align -Wwrite-strings"
+ case `$CC -dumpversion` in #(
+ 3.4.* | 4.* | 5.*) :
+ kpse_cv_warning_cflags="$kpse_cv_warning_cflags -Wold-style-definition" ;; #(
+ *) :
+ ;;
+esac
+ if test "x$enable_compiler_warnings" != xmax; then
+ kpse_cv_warning_cflags="$kpse_cv_warning_cflags -Wshadow"
+ fi
+ fi
+ fi
+fi
+elif test "x$enable_compiler_warnings" = xno; then
+ kpse_cv_warning_cflags=
+else
+ kpse_cv_warning_cflags= # FIXME: warning flags for non-GNU C compilers
+fi
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $kpse_cv_warning_cflags" >&5
+$as_echo "$kpse_cv_warning_cflags" >&6; }
+WARNING_CFLAGS=$kpse_cv_warning_cflags
+
+
+
+
+
+
+
+
+
+
+
+
+# Set options
+enable_win32_dll=yes
+
+case $host in
+*-*-cygwin* | *-*-mingw* | *-*-pw32* | *-*-cegcc*)
+ if test -n "$ac_tool_prefix"; then
+ # Extract the first word of "${ac_tool_prefix}as", so it can be a program name with args.
+set dummy ${ac_tool_prefix}as; ac_word=$2
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $ac_word" >&5
+$as_echo_n "checking for $ac_word... " >&6; }
+if ${ac_cv_prog_AS+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ if test -n "$AS"; then
+ ac_cv_prog_AS="$AS" # Let the user override the test.
+else
+as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH
+do
+ IFS=$as_save_IFS
+ test -z "$as_dir" && as_dir=.
+ for ac_exec_ext in '' $ac_executable_extensions; do
+ if as_fn_executable_p "$as_dir/$ac_word$ac_exec_ext"; then
+ ac_cv_prog_AS="${ac_tool_prefix}as"
+ $as_echo "$as_me:${as_lineno-$LINENO}: found $as_dir/$ac_word$ac_exec_ext" >&5
+ break 2
+ fi
+done
+ done
+IFS=$as_save_IFS
+
+fi
+fi
+AS=$ac_cv_prog_AS
+if test -n "$AS"; then
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: $AS" >&5
+$as_echo "$AS" >&6; }
+else
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5
+$as_echo "no" >&6; }
+fi
+
+
+fi
+if test -z "$ac_cv_prog_AS"; then
+ ac_ct_AS=$AS
+ # Extract the first word of "as", so it can be a program name with args.
+set dummy as; ac_word=$2
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $ac_word" >&5
+$as_echo_n "checking for $ac_word... " >&6; }
+if ${ac_cv_prog_ac_ct_AS+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ if test -n "$ac_ct_AS"; then
+ ac_cv_prog_ac_ct_AS="$ac_ct_AS" # Let the user override the test.
+else
+as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH
+do
+ IFS=$as_save_IFS
+ test -z "$as_dir" && as_dir=.
+ for ac_exec_ext in '' $ac_executable_extensions; do
+ if as_fn_executable_p "$as_dir/$ac_word$ac_exec_ext"; then
+ ac_cv_prog_ac_ct_AS="as"
+ $as_echo "$as_me:${as_lineno-$LINENO}: found $as_dir/$ac_word$ac_exec_ext" >&5
+ break 2
+ fi
+done
+ done
+IFS=$as_save_IFS
+
+fi
+fi
+ac_ct_AS=$ac_cv_prog_ac_ct_AS
+if test -n "$ac_ct_AS"; then
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_ct_AS" >&5
+$as_echo "$ac_ct_AS" >&6; }
+else
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5
+$as_echo "no" >&6; }
+fi
+
+ if test "x$ac_ct_AS" = x; then
+ AS="false"
+ else
+ case $cross_compiling:$ac_tool_warned in
+yes:)
+{ $as_echo "$as_me:${as_lineno-$LINENO}: WARNING: using cross tools not prefixed with host triplet" >&5
+$as_echo "$as_me: WARNING: using cross tools not prefixed with host triplet" >&2;}
+ac_tool_warned=yes ;;
+esac
+ AS=$ac_ct_AS
+ fi
+else
+ AS="$ac_cv_prog_AS"
+fi
+
+ if test -n "$ac_tool_prefix"; then
+ # Extract the first word of "${ac_tool_prefix}dlltool", so it can be a program name with args.
+set dummy ${ac_tool_prefix}dlltool; ac_word=$2
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $ac_word" >&5
+$as_echo_n "checking for $ac_word... " >&6; }
+if ${ac_cv_prog_DLLTOOL+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ if test -n "$DLLTOOL"; then
+ ac_cv_prog_DLLTOOL="$DLLTOOL" # Let the user override the test.
+else
+as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH
+do
+ IFS=$as_save_IFS
+ test -z "$as_dir" && as_dir=.
+ for ac_exec_ext in '' $ac_executable_extensions; do
+ if as_fn_executable_p "$as_dir/$ac_word$ac_exec_ext"; then
+ ac_cv_prog_DLLTOOL="${ac_tool_prefix}dlltool"
+ $as_echo "$as_me:${as_lineno-$LINENO}: found $as_dir/$ac_word$ac_exec_ext" >&5
+ break 2
+ fi
+done
+ done
+IFS=$as_save_IFS
+
+fi
+fi
+DLLTOOL=$ac_cv_prog_DLLTOOL
+if test -n "$DLLTOOL"; then
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: $DLLTOOL" >&5
+$as_echo "$DLLTOOL" >&6; }
+else
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5
+$as_echo "no" >&6; }
+fi
+
+
+fi
+if test -z "$ac_cv_prog_DLLTOOL"; then
+ ac_ct_DLLTOOL=$DLLTOOL
+ # Extract the first word of "dlltool", so it can be a program name with args.
+set dummy dlltool; ac_word=$2
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $ac_word" >&5
+$as_echo_n "checking for $ac_word... " >&6; }
+if ${ac_cv_prog_ac_ct_DLLTOOL+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ if test -n "$ac_ct_DLLTOOL"; then
+ ac_cv_prog_ac_ct_DLLTOOL="$ac_ct_DLLTOOL" # Let the user override the test.
+else
+as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH
+do
+ IFS=$as_save_IFS
+ test -z "$as_dir" && as_dir=.
+ for ac_exec_ext in '' $ac_executable_extensions; do
+ if as_fn_executable_p "$as_dir/$ac_word$ac_exec_ext"; then
+ ac_cv_prog_ac_ct_DLLTOOL="dlltool"
+ $as_echo "$as_me:${as_lineno-$LINENO}: found $as_dir/$ac_word$ac_exec_ext" >&5
+ break 2
+ fi
+done
+ done
+IFS=$as_save_IFS
+
+fi
+fi
+ac_ct_DLLTOOL=$ac_cv_prog_ac_ct_DLLTOOL
+if test -n "$ac_ct_DLLTOOL"; then
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_ct_DLLTOOL" >&5
+$as_echo "$ac_ct_DLLTOOL" >&6; }
+else
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5
+$as_echo "no" >&6; }
+fi
+
+ if test "x$ac_ct_DLLTOOL" = x; then
+ DLLTOOL="false"
+ else
+ case $cross_compiling:$ac_tool_warned in
+yes:)
+{ $as_echo "$as_me:${as_lineno-$LINENO}: WARNING: using cross tools not prefixed with host triplet" >&5
+$as_echo "$as_me: WARNING: using cross tools not prefixed with host triplet" >&2;}
+ac_tool_warned=yes ;;
+esac
+ DLLTOOL=$ac_ct_DLLTOOL
+ fi
+else
+ DLLTOOL="$ac_cv_prog_DLLTOOL"
+fi
+
+ if test -n "$ac_tool_prefix"; then
+ # Extract the first word of "${ac_tool_prefix}objdump", so it can be a program name with args.
+set dummy ${ac_tool_prefix}objdump; ac_word=$2
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $ac_word" >&5
+$as_echo_n "checking for $ac_word... " >&6; }
+if ${ac_cv_prog_OBJDUMP+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ if test -n "$OBJDUMP"; then
+ ac_cv_prog_OBJDUMP="$OBJDUMP" # Let the user override the test.
+else
+as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH
+do
+ IFS=$as_save_IFS
+ test -z "$as_dir" && as_dir=.
+ for ac_exec_ext in '' $ac_executable_extensions; do
+ if as_fn_executable_p "$as_dir/$ac_word$ac_exec_ext"; then
+ ac_cv_prog_OBJDUMP="${ac_tool_prefix}objdump"
+ $as_echo "$as_me:${as_lineno-$LINENO}: found $as_dir/$ac_word$ac_exec_ext" >&5
+ break 2
+ fi
+done
+ done
+IFS=$as_save_IFS
+
+fi
+fi
+OBJDUMP=$ac_cv_prog_OBJDUMP
+if test -n "$OBJDUMP"; then
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: $OBJDUMP" >&5
+$as_echo "$OBJDUMP" >&6; }
+else
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5
+$as_echo "no" >&6; }
+fi
+
+
+fi
+if test -z "$ac_cv_prog_OBJDUMP"; then
+ ac_ct_OBJDUMP=$OBJDUMP
+ # Extract the first word of "objdump", so it can be a program name with args.
+set dummy objdump; ac_word=$2
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $ac_word" >&5
+$as_echo_n "checking for $ac_word... " >&6; }
+if ${ac_cv_prog_ac_ct_OBJDUMP+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ if test -n "$ac_ct_OBJDUMP"; then
+ ac_cv_prog_ac_ct_OBJDUMP="$ac_ct_OBJDUMP" # Let the user override the test.
+else
+as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH
+do
+ IFS=$as_save_IFS
+ test -z "$as_dir" && as_dir=.
+ for ac_exec_ext in '' $ac_executable_extensions; do
+ if as_fn_executable_p "$as_dir/$ac_word$ac_exec_ext"; then
+ ac_cv_prog_ac_ct_OBJDUMP="objdump"
+ $as_echo "$as_me:${as_lineno-$LINENO}: found $as_dir/$ac_word$ac_exec_ext" >&5
+ break 2
+ fi
+done
+ done
+IFS=$as_save_IFS
+
+fi
+fi
+ac_ct_OBJDUMP=$ac_cv_prog_ac_ct_OBJDUMP
+if test -n "$ac_ct_OBJDUMP"; then
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_ct_OBJDUMP" >&5
+$as_echo "$ac_ct_OBJDUMP" >&6; }
+else
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5
+$as_echo "no" >&6; }
+fi
+
+ if test "x$ac_ct_OBJDUMP" = x; then
+ OBJDUMP="false"
+ else
+ case $cross_compiling:$ac_tool_warned in
+yes:)
+{ $as_echo "$as_me:${as_lineno-$LINENO}: WARNING: using cross tools not prefixed with host triplet" >&5
+$as_echo "$as_me: WARNING: using cross tools not prefixed with host triplet" >&2;}
+ac_tool_warned=yes ;;
+esac
+ OBJDUMP=$ac_ct_OBJDUMP
+ fi
+else
+ OBJDUMP="$ac_cv_prog_OBJDUMP"
+fi
+
+ ;;
+esac
+
+test -z "$AS" && AS=as
+
+
+
+
+
+test -z "$DLLTOOL" && DLLTOOL=dlltool
+
+
+
+
+
+test -z "$OBJDUMP" && OBJDUMP=objdump
+
+
+
+
+
+
+
+ enable_dlopen=no
+
+
+
+ # Check whether --enable-shared was given.
+if test "${enable_shared+set}" = set; then :
+ enableval=$enable_shared; p=${PACKAGE-default}
+ case $enableval in
+ yes) enable_shared=yes ;;
+ no) enable_shared=no ;;
+ *)
+ enable_shared=no
+ # Look at the argument we got. We use all the common list separators.
+ lt_save_ifs=$IFS; IFS=$IFS$PATH_SEPARATOR,
+ for pkg in $enableval; do
+ IFS=$lt_save_ifs
+ if test "X$pkg" = "X$p"; then
+ enable_shared=yes
+ fi
+ done
+ IFS=$lt_save_ifs
+ ;;
+ esac
+else
+ enable_shared=yes
+fi
+
+
+
+
+
+
+
+
+
+ # Check whether --enable-static was given.
+if test "${enable_static+set}" = set; then :
+ enableval=$enable_static; p=${PACKAGE-default}
+ case $enableval in
+ yes) enable_static=yes ;;
+ no) enable_static=no ;;
+ *)
+ enable_static=no
+ # Look at the argument we got. We use all the common list separators.
+ lt_save_ifs=$IFS; IFS=$IFS$PATH_SEPARATOR,
+ for pkg in $enableval; do
+ IFS=$lt_save_ifs
+ if test "X$pkg" = "X$p"; then
+ enable_static=yes
+ fi
+ done
+ IFS=$lt_save_ifs
+ ;;
+ esac
+else
+ enable_static=yes
+fi
+
+
+
+
+
+
+
+
+
+
+# Check whether --with-pic was given.
+if test "${with_pic+set}" = set; then :
+ withval=$with_pic; lt_p=${PACKAGE-default}
+ case $withval in
+ yes|no) pic_mode=$withval ;;
+ *)
+ pic_mode=default
+ # Look at the argument we got. We use all the common list separators.
+ lt_save_ifs=$IFS; IFS=$IFS$PATH_SEPARATOR,
+ for lt_pkg in $withval; do
+ IFS=$lt_save_ifs
+ if test "X$lt_pkg" = "X$lt_p"; then
+ pic_mode=yes
+ fi
+ done
+ IFS=$lt_save_ifs
+ ;;
+ esac
+else
+ pic_mode=default
+fi
+
+
+
+
+
+
+
+
+ # Check whether --enable-fast-install was given.
+if test "${enable_fast_install+set}" = set; then :
+ enableval=$enable_fast_install; p=${PACKAGE-default}
+ case $enableval in
+ yes) enable_fast_install=yes ;;
+ no) enable_fast_install=no ;;
+ *)
+ enable_fast_install=no
+ # Look at the argument we got. We use all the common list separators.
+ lt_save_ifs=$IFS; IFS=$IFS$PATH_SEPARATOR,
+ for pkg in $enableval; do
+ IFS=$lt_save_ifs
+ if test "X$pkg" = "X$p"; then
+ enable_fast_install=yes
+ fi
+ done
+ IFS=$lt_save_ifs
+ ;;
+ esac
+else
+ enable_fast_install=yes
+fi
+
+
+
+
+
+
+
+
+ shared_archive_member_spec=
+case $host,$enable_shared in
+power*-*-aix[5-9]*,yes)
+ { $as_echo "$as_me:${as_lineno-$LINENO}: checking which variant of shared library versioning to provide" >&5
+$as_echo_n "checking which variant of shared library versioning to provide... " >&6; }
+
+# Check whether --with-aix-soname was given.
+if test "${with_aix_soname+set}" = set; then :
+ withval=$with_aix_soname; case $withval in
+ aix|svr4|both)
+ ;;
+ *)
+ as_fn_error $? "Unknown argument to --with-aix-soname" "$LINENO" 5
+ ;;
+ esac
+ lt_cv_with_aix_soname=$with_aix_soname
+else
+ if ${lt_cv_with_aix_soname+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ lt_cv_with_aix_soname=aix
+fi
+
+ with_aix_soname=$lt_cv_with_aix_soname
+fi
+
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: $with_aix_soname" >&5
+$as_echo "$with_aix_soname" >&6; }
+ if test aix != "$with_aix_soname"; then
+ # For the AIX way of multilib, we name the shared archive member
+ # based on the bitwidth used, traditionally 'shr.o' or 'shr_64.o',
+ # and 'shr.imp' or 'shr_64.imp', respectively, for the Import File.
+ # Even when GNU compilers ignore OBJECT_MODE but need '-maix64' flag,
+ # the AIX toolchain works better with OBJECT_MODE set (default 32).
+ if test 64 = "${OBJECT_MODE-32}"; then
+ shared_archive_member_spec=shr_64
+ else
+ shared_archive_member_spec=shr
+ fi
+ fi
+ ;;
+*)
+ with_aix_soname=aix
+ ;;
+esac
+
+
+
+
+
+
+
+
+
+
+# This can be used to rebuild libtool when needed
+LIBTOOL_DEPS=$ltmain
+
+# Always use our own libtool.
+LIBTOOL='$(SHELL) $(top_builddir)/libtool'
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+test -z "$LN_S" && LN_S="ln -s"
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+if test -n "${ZSH_VERSION+set}"; then
+ setopt NO_GLOB_SUBST
+fi
+
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for objdir" >&5
+$as_echo_n "checking for objdir... " >&6; }
+if ${lt_cv_objdir+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ rm -f .libs 2>/dev/null
+mkdir .libs 2>/dev/null
+if test -d .libs; then
+ lt_cv_objdir=.libs
+else
+ # MS-DOS does not allow filenames that begin with a dot.
+ lt_cv_objdir=_libs
+fi
+rmdir .libs 2>/dev/null
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $lt_cv_objdir" >&5
+$as_echo "$lt_cv_objdir" >&6; }
+objdir=$lt_cv_objdir
+
+
+
+
+
+cat >>confdefs.h <<_ACEOF
+#define LT_OBJDIR "$lt_cv_objdir/"
+_ACEOF
+
+
+
+
+case $host_os in
+aix3*)
+ # AIX sometimes has problems with the GCC collect2 program. For some
+ # reason, if we set the COLLECT_NAMES environment variable, the problems
+ # vanish in a puff of smoke.
+ if test set != "${COLLECT_NAMES+set}"; then
+ COLLECT_NAMES=
+ export COLLECT_NAMES
+ fi
+ ;;
+esac
+
+# Global variables:
+ofile=libtool
+can_build_shared=yes
+
+# All known linkers require a '.a' archive for static linking (except MSVC,
+# which needs '.lib').
+libext=a
+
+with_gnu_ld=$lt_cv_prog_gnu_ld
+
+old_CC=$CC
+old_CFLAGS=$CFLAGS
+
+# Set sane defaults for various variables
+test -z "$CC" && CC=cc
+test -z "$LTCC" && LTCC=$CC
+test -z "$LTCFLAGS" && LTCFLAGS=$CFLAGS
+test -z "$LD" && LD=ld
+test -z "$ac_objext" && ac_objext=o
+
+func_cc_basename $compiler
+cc_basename=$func_cc_basename_result
+
+
+# Only perform the check for file, if the check method requires it
+test -z "$MAGIC_CMD" && MAGIC_CMD=file
+case $deplibs_check_method in
+file_magic*)
+ if test "$file_magic_cmd" = '$MAGIC_CMD'; then
+ { $as_echo "$as_me:${as_lineno-$LINENO}: checking for ${ac_tool_prefix}file" >&5
+$as_echo_n "checking for ${ac_tool_prefix}file... " >&6; }
+if ${lt_cv_path_MAGIC_CMD+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ case $MAGIC_CMD in
+[\\/*] | ?:[\\/]*)
+ lt_cv_path_MAGIC_CMD=$MAGIC_CMD # Let the user override the test with a path.
+ ;;
+*)
+ lt_save_MAGIC_CMD=$MAGIC_CMD
+ lt_save_ifs=$IFS; IFS=$PATH_SEPARATOR
+ ac_dummy="/usr/bin$PATH_SEPARATOR$PATH"
+ for ac_dir in $ac_dummy; do
+ IFS=$lt_save_ifs
+ test -z "$ac_dir" && ac_dir=.
+ if test -f "$ac_dir/${ac_tool_prefix}file"; then
+ lt_cv_path_MAGIC_CMD=$ac_dir/"${ac_tool_prefix}file"
+ if test -n "$file_magic_test_file"; then
+ case $deplibs_check_method in
+ "file_magic "*)
+ file_magic_regex=`expr "$deplibs_check_method" : "file_magic \(.*\)"`
+ MAGIC_CMD=$lt_cv_path_MAGIC_CMD
+ if eval $file_magic_cmd \$file_magic_test_file 2> /dev/null |
+ $EGREP "$file_magic_regex" > /dev/null; then
+ :
+ else
+ cat <<_LT_EOF 1>&2
+
+*** Warning: the command libtool uses to detect shared libraries,
+*** $file_magic_cmd, produces output that libtool cannot recognize.
+*** The result is that libtool may fail to recognize shared libraries
+*** as such. This will affect the creation of libtool libraries that
+*** depend on shared libraries, but programs linked with such libtool
+*** libraries will work regardless of this problem. Nevertheless, you
+*** may want to report the problem to your system manager and/or to
+*** bug-libtool@gnu.org
+
+_LT_EOF
+ fi ;;
+ esac
+ fi
+ break
+ fi
+ done
+ IFS=$lt_save_ifs
+ MAGIC_CMD=$lt_save_MAGIC_CMD
+ ;;
+esac
+fi
+
+MAGIC_CMD=$lt_cv_path_MAGIC_CMD
+if test -n "$MAGIC_CMD"; then
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: $MAGIC_CMD" >&5
+$as_echo "$MAGIC_CMD" >&6; }
+else
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5
+$as_echo "no" >&6; }
+fi
+
+
+
+
+
+if test -z "$lt_cv_path_MAGIC_CMD"; then
+ if test -n "$ac_tool_prefix"; then
+ { $as_echo "$as_me:${as_lineno-$LINENO}: checking for file" >&5
+$as_echo_n "checking for file... " >&6; }
+if ${lt_cv_path_MAGIC_CMD+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ case $MAGIC_CMD in
+[\\/*] | ?:[\\/]*)
+ lt_cv_path_MAGIC_CMD=$MAGIC_CMD # Let the user override the test with a path.
+ ;;
+*)
+ lt_save_MAGIC_CMD=$MAGIC_CMD
+ lt_save_ifs=$IFS; IFS=$PATH_SEPARATOR
+ ac_dummy="/usr/bin$PATH_SEPARATOR$PATH"
+ for ac_dir in $ac_dummy; do
+ IFS=$lt_save_ifs
+ test -z "$ac_dir" && ac_dir=.
+ if test -f "$ac_dir/file"; then
+ lt_cv_path_MAGIC_CMD=$ac_dir/"file"
+ if test -n "$file_magic_test_file"; then
+ case $deplibs_check_method in
+ "file_magic "*)
+ file_magic_regex=`expr "$deplibs_check_method" : "file_magic \(.*\)"`
+ MAGIC_CMD=$lt_cv_path_MAGIC_CMD
+ if eval $file_magic_cmd \$file_magic_test_file 2> /dev/null |
+ $EGREP "$file_magic_regex" > /dev/null; then
+ :
+ else
+ cat <<_LT_EOF 1>&2
+
+*** Warning: the command libtool uses to detect shared libraries,
+*** $file_magic_cmd, produces output that libtool cannot recognize.
+*** The result is that libtool may fail to recognize shared libraries
+*** as such. This will affect the creation of libtool libraries that
+*** depend on shared libraries, but programs linked with such libtool
+*** libraries will work regardless of this problem. Nevertheless, you
+*** may want to report the problem to your system manager and/or to
+*** bug-libtool@gnu.org
+
+_LT_EOF
+ fi ;;
+ esac
+ fi
+ break
+ fi
+ done
+ IFS=$lt_save_ifs
+ MAGIC_CMD=$lt_save_MAGIC_CMD
+ ;;
+esac
+fi
+
+MAGIC_CMD=$lt_cv_path_MAGIC_CMD
+if test -n "$MAGIC_CMD"; then
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: $MAGIC_CMD" >&5
+$as_echo "$MAGIC_CMD" >&6; }
+else
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5
+$as_echo "no" >&6; }
+fi
+
+
+ else
+ MAGIC_CMD=:
+ fi
+fi
+
+ fi
+ ;;
+esac
+
+# Use C for the default configuration in the libtool script
+
+lt_save_CC=$CC
+ac_ext=c
+ac_cpp='$CPP $CPPFLAGS'
+ac_compile='$CC -c $CFLAGS $CPPFLAGS conftest.$ac_ext >&5'
+ac_link='$CC -o conftest$ac_exeext $CFLAGS $CPPFLAGS $LDFLAGS conftest.$ac_ext $LIBS >&5'
+ac_compiler_gnu=$ac_cv_c_compiler_gnu
+
+
+# Source file extension for C test sources.
+ac_ext=c
+
+# Object file extension for compiled C test sources.
+objext=o
+objext=$objext
+
+# Code to be used in simple compile tests
+lt_simple_compile_test_code="int some_variable = 0;"
+
+# Code to be used in simple link tests
+lt_simple_link_test_code='int main(){return(0);}'
+
+
+
+
+
+
+
+# If no C compiler was specified, use CC.
+LTCC=${LTCC-"$CC"}
+
+# If no C compiler flags were specified, use CFLAGS.
+LTCFLAGS=${LTCFLAGS-"$CFLAGS"}
+
+# Allow CC to be a program name with arguments.
+compiler=$CC
+
+# Save the default compiler, since it gets overwritten when the other
+# tags are being tested, and _LT_TAGVAR(compiler, []) is a NOP.
+compiler_DEFAULT=$CC
+
+# save warnings/boilerplate of simple test code
+ac_outfile=conftest.$ac_objext
+echo "$lt_simple_compile_test_code" >conftest.$ac_ext
+eval "$ac_compile" 2>&1 >/dev/null | $SED '/^$/d; /^ *+/d' >conftest.err
+_lt_compiler_boilerplate=`cat conftest.err`
+$RM conftest*
+
+ac_outfile=conftest.$ac_objext
+echo "$lt_simple_link_test_code" >conftest.$ac_ext
+eval "$ac_link" 2>&1 >/dev/null | $SED '/^$/d; /^ *+/d' >conftest.err
+_lt_linker_boilerplate=`cat conftest.err`
+$RM -r conftest*
+
+
+## CAVEAT EMPTOR:
+## There is no encapsulation within the following macros, do not change
+## the running order or otherwise move them around unless you know exactly
+## what you are doing...
+if test -n "$compiler"; then
+
+lt_prog_compiler_no_builtin_flag=
+
+if test yes = "$GCC"; then
+ case $cc_basename in
+ nvcc*)
+ lt_prog_compiler_no_builtin_flag=' -Xcompiler -fno-builtin' ;;
+ *)
+ lt_prog_compiler_no_builtin_flag=' -fno-builtin' ;;
+ esac
+
+ { $as_echo "$as_me:${as_lineno-$LINENO}: checking if $compiler supports -fno-rtti -fno-exceptions" >&5
+$as_echo_n "checking if $compiler supports -fno-rtti -fno-exceptions... " >&6; }
+if ${lt_cv_prog_compiler_rtti_exceptions+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ lt_cv_prog_compiler_rtti_exceptions=no
+ ac_outfile=conftest.$ac_objext
+ echo "$lt_simple_compile_test_code" > conftest.$ac_ext
+ lt_compiler_flag="-fno-rtti -fno-exceptions" ## exclude from sc_useless_quotes_in_assignment
+ # Insert the option either (1) after the last *FLAGS variable, or
+ # (2) before a word containing "conftest.", or (3) at the end.
+ # Note that $ac_compile itself does not contain backslashes and begins
+ # with a dollar sign (not a hyphen), so the echo should work correctly.
+ # The option is referenced via a variable to avoid confusing sed.
+ lt_compile=`echo "$ac_compile" | $SED \
+ -e 's:.*FLAGS}\{0,1\} :&$lt_compiler_flag :; t' \
+ -e 's: [^ ]*conftest\.: $lt_compiler_flag&:; t' \
+ -e 's:$: $lt_compiler_flag:'`
+ (eval echo "\"\$as_me:$LINENO: $lt_compile\"" >&5)
+ (eval "$lt_compile" 2>conftest.err)
+ ac_status=$?
+ cat conftest.err >&5
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ if (exit $ac_status) && test -s "$ac_outfile"; then
+ # The compiler can only warn and ignore the option if not recognized
+ # So say no if there are warnings other than the usual output.
+ $ECHO "$_lt_compiler_boilerplate" | $SED '/^$/d' >conftest.exp
+ $SED '/^$/d; /^ *+/d' conftest.err >conftest.er2
+ if test ! -s conftest.er2 || diff conftest.exp conftest.er2 >/dev/null; then
+ lt_cv_prog_compiler_rtti_exceptions=yes
+ fi
+ fi
+ $RM conftest*
+
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $lt_cv_prog_compiler_rtti_exceptions" >&5
+$as_echo "$lt_cv_prog_compiler_rtti_exceptions" >&6; }
+
+if test yes = "$lt_cv_prog_compiler_rtti_exceptions"; then
+ lt_prog_compiler_no_builtin_flag="$lt_prog_compiler_no_builtin_flag -fno-rtti -fno-exceptions"
+else
+ :
+fi
+
+fi
+
+
+
+
+
+
+ lt_prog_compiler_wl=
+lt_prog_compiler_pic=
+lt_prog_compiler_static=
+
+
+ if test yes = "$GCC"; then
+ lt_prog_compiler_wl='-Wl,'
+ lt_prog_compiler_static='-static'
+
+ case $host_os in
+ aix*)
+ # All AIX code is PIC.
+ if test ia64 = "$host_cpu"; then
+ # AIX 5 now supports IA64 processor
+ lt_prog_compiler_static='-Bstatic'
+ fi
+ lt_prog_compiler_pic='-fPIC'
+ ;;
+
+ amigaos*)
+ case $host_cpu in
+ powerpc)
+ # see comment about AmigaOS4 .so support
+ lt_prog_compiler_pic='-fPIC'
+ ;;
+ m68k)
+ # FIXME: we need at least 68020 code to build shared libraries, but
+ # adding the '-m68020' flag to GCC prevents building anything better,
+ # like '-m68040'.
+ lt_prog_compiler_pic='-m68020 -resident32 -malways-restore-a4'
+ ;;
+ esac
+ ;;
+
+ beos* | irix5* | irix6* | nonstopux* | osf3* | osf4* | osf5*)
+ # PIC is the default for these OSes.
+ ;;
+
+ mingw* | cygwin* | pw32* | os2* | cegcc*)
+ # This hack is so that the source file can tell whether it is being
+ # built for inclusion in a dll (and should export symbols for example).
+ # Although the cygwin gcc ignores -fPIC, still need this for old-style
+ # (--disable-auto-import) libraries
+ lt_prog_compiler_pic='-DDLL_EXPORT'
+ case $host_os in
+ os2*)
+ lt_prog_compiler_static='$wl-static'
+ ;;
+ esac
+ ;;
+
+ darwin* | rhapsody*)
+ # PIC is the default on this platform
+ # Common symbols not allowed in MH_DYLIB files
+ lt_prog_compiler_pic='-fno-common'
+ ;;
+
+ haiku*)
+ # PIC is the default for Haiku.
+ # The "-static" flag exists, but is broken.
+ lt_prog_compiler_static=
+ ;;
+
+ hpux*)
+ # PIC is the default for 64-bit PA HP-UX, but not for 32-bit
+ # PA HP-UX. On IA64 HP-UX, PIC is the default but the pic flag
+ # sets the default TLS model and affects inlining.
+ case $host_cpu in
+ hppa*64*)
+ # +Z the default
+ ;;
+ *)
+ lt_prog_compiler_pic='-fPIC'
+ ;;
+ esac
+ ;;
+
+ interix[3-9]*)
+ # Interix 3.x gcc -fpic/-fPIC options generate broken code.
+ # Instead, we relocate shared libraries at runtime.
+ ;;
+
+ msdosdjgpp*)
+ # Just because we use GCC doesn't mean we suddenly get shared libraries
+ # on systems that don't support them.
+ lt_prog_compiler_can_build_shared=no
+ enable_shared=no
+ ;;
+
+ *nto* | *qnx*)
+ # QNX uses GNU C++, but need to define -shared option too, otherwise
+ # it will coredump.
+ lt_prog_compiler_pic='-fPIC -shared'
+ ;;
+
+ sysv4*MP*)
+ if test -d /usr/nec; then
+ lt_prog_compiler_pic=-Kconform_pic
+ fi
+ ;;
+
+ *)
+ lt_prog_compiler_pic='-fPIC'
+ ;;
+ esac
+
+ case $cc_basename in
+ nvcc*) # Cuda Compiler Driver 2.2
+ lt_prog_compiler_wl='-Xlinker '
+ if test -n "$lt_prog_compiler_pic"; then
+ lt_prog_compiler_pic="-Xcompiler $lt_prog_compiler_pic"
+ fi
+ ;;
+ esac
+ else
+ # PORTME Check for flag to pass linker flags through the system compiler.
+ case $host_os in
+ aix*)
+ lt_prog_compiler_wl='-Wl,'
+ if test ia64 = "$host_cpu"; then
+ # AIX 5 now supports IA64 processor
+ lt_prog_compiler_static='-Bstatic'
+ else
+ lt_prog_compiler_static='-bnso -bI:/lib/syscalls.exp'
+ fi
+ ;;
+
+ darwin* | rhapsody*)
+ # PIC is the default on this platform
+ # Common symbols not allowed in MH_DYLIB files
+ lt_prog_compiler_pic='-fno-common'
+ case $cc_basename in
+ nagfor*)
+ # NAG Fortran compiler
+ lt_prog_compiler_wl='-Wl,-Wl,,'
+ lt_prog_compiler_pic='-PIC'
+ lt_prog_compiler_static='-Bstatic'
+ ;;
+ esac
+ ;;
+
+ mingw* | cygwin* | pw32* | os2* | cegcc*)
+ # This hack is so that the source file can tell whether it is being
+ # built for inclusion in a dll (and should export symbols for example).
+ lt_prog_compiler_pic='-DDLL_EXPORT'
+ case $host_os in
+ os2*)
+ lt_prog_compiler_static='$wl-static'
+ ;;
+ esac
+ ;;
+
+ hpux9* | hpux10* | hpux11*)
+ lt_prog_compiler_wl='-Wl,'
+ # PIC is the default for IA64 HP-UX and 64-bit HP-UX, but
+ # not for PA HP-UX.
+ case $host_cpu in
+ hppa*64*|ia64*)
+ # +Z the default
+ ;;
+ *)
+ lt_prog_compiler_pic='+Z'
+ ;;
+ esac
+ # Is there a better lt_prog_compiler_static that works with the bundled CC?
+ lt_prog_compiler_static='$wl-a ${wl}archive'
+ ;;
+
+ irix5* | irix6* | nonstopux*)
+ lt_prog_compiler_wl='-Wl,'
+ # PIC (with -KPIC) is the default.
+ lt_prog_compiler_static='-non_shared'
+ ;;
+
+ linux* | k*bsd*-gnu | kopensolaris*-gnu | gnu*)
+ case $cc_basename in
+ # old Intel for x86_64, which still supported -KPIC.
+ ecc*)
+ lt_prog_compiler_wl='-Wl,'
+ lt_prog_compiler_pic='-KPIC'
+ lt_prog_compiler_static='-static'
+ ;;
+ # icc used to be incompatible with GCC.
+ # ICC 10 doesn't accept -KPIC any more.
+ icc* | ifort*)
+ lt_prog_compiler_wl='-Wl,'
+ lt_prog_compiler_pic='-fPIC'
+ lt_prog_compiler_static='-static'
+ ;;
+ # Lahey Fortran 8.1.
+ lf95*)
+ lt_prog_compiler_wl='-Wl,'
+ lt_prog_compiler_pic='--shared'
+ lt_prog_compiler_static='--static'
+ ;;
+ nagfor*)
+ # NAG Fortran compiler
+ lt_prog_compiler_wl='-Wl,-Wl,,'
+ lt_prog_compiler_pic='-PIC'
+ lt_prog_compiler_static='-Bstatic'
+ ;;
+ tcc*)
+ # Fabrice Bellard et al's Tiny C Compiler
+ lt_prog_compiler_wl='-Wl,'
+ lt_prog_compiler_pic='-fPIC'
+ lt_prog_compiler_static='-static'
+ ;;
+ pgcc* | pgf77* | pgf90* | pgf95* | pgfortran*)
+ # Portland Group compilers (*not* the Pentium gcc compiler,
+ # which looks to be a dead project)
+ lt_prog_compiler_wl='-Wl,'
+ lt_prog_compiler_pic='-fpic'
+ lt_prog_compiler_static='-Bstatic'
+ ;;
+ ccc*)
+ lt_prog_compiler_wl='-Wl,'
+ # All Alpha code is PIC.
+ lt_prog_compiler_static='-non_shared'
+ ;;
+ xl* | bgxl* | bgf* | mpixl*)
+ # IBM XL C 8.0/Fortran 10.1, 11.1 on PPC and BlueGene
+ lt_prog_compiler_wl='-Wl,'
+ lt_prog_compiler_pic='-qpic'
+ lt_prog_compiler_static='-qstaticlink'
+ ;;
+ *)
+ case `$CC -V 2>&1 | sed 5q` in
+ *Sun\ Ceres\ Fortran* | *Sun*Fortran*\ [1-7].* | *Sun*Fortran*\ 8.[0-3]*)
+ # Sun Fortran 8.3 passes all unrecognized flags to the linker
+ lt_prog_compiler_pic='-KPIC'
+ lt_prog_compiler_static='-Bstatic'
+ lt_prog_compiler_wl=''
+ ;;
+ *Sun\ F* | *Sun*Fortran*)
+ lt_prog_compiler_pic='-KPIC'
+ lt_prog_compiler_static='-Bstatic'
+ lt_prog_compiler_wl='-Qoption ld '
+ ;;
+ *Sun\ C*)
+ # Sun C 5.9
+ lt_prog_compiler_pic='-KPIC'
+ lt_prog_compiler_static='-Bstatic'
+ lt_prog_compiler_wl='-Wl,'
+ ;;
+ *Intel*\ [CF]*Compiler*)
+ lt_prog_compiler_wl='-Wl,'
+ lt_prog_compiler_pic='-fPIC'
+ lt_prog_compiler_static='-static'
+ ;;
+ *Portland\ Group*)
+ lt_prog_compiler_wl='-Wl,'
+ lt_prog_compiler_pic='-fpic'
+ lt_prog_compiler_static='-Bstatic'
+ ;;
+ esac
+ ;;
+ esac
+ ;;
+
+ newsos6)
+ lt_prog_compiler_pic='-KPIC'
+ lt_prog_compiler_static='-Bstatic'
+ ;;
+
+ *nto* | *qnx*)
+ # QNX uses GNU C++, but need to define -shared option too, otherwise
+ # it will coredump.
+ lt_prog_compiler_pic='-fPIC -shared'
+ ;;
+
+ osf3* | osf4* | osf5*)
+ lt_prog_compiler_wl='-Wl,'
+ # All OSF/1 code is PIC.
+ lt_prog_compiler_static='-non_shared'
+ ;;
+
+ rdos*)
+ lt_prog_compiler_static='-non_shared'
+ ;;
+
+ solaris*)
+ lt_prog_compiler_pic='-KPIC'
+ lt_prog_compiler_static='-Bstatic'
+ case $cc_basename in
+ f77* | f90* | f95* | sunf77* | sunf90* | sunf95*)
+ lt_prog_compiler_wl='-Qoption ld ';;
+ *)
+ lt_prog_compiler_wl='-Wl,';;
+ esac
+ ;;
+
+ sunos4*)
+ lt_prog_compiler_wl='-Qoption ld '
+ lt_prog_compiler_pic='-PIC'
+ lt_prog_compiler_static='-Bstatic'
+ ;;
+
+ sysv4 | sysv4.2uw2* | sysv4.3*)
+ lt_prog_compiler_wl='-Wl,'
+ lt_prog_compiler_pic='-KPIC'
+ lt_prog_compiler_static='-Bstatic'
+ ;;
+
+ sysv4*MP*)
+ if test -d /usr/nec; then
+ lt_prog_compiler_pic='-Kconform_pic'
+ lt_prog_compiler_static='-Bstatic'
+ fi
+ ;;
+
+ sysv5* | unixware* | sco3.2v5* | sco5v6* | OpenUNIX*)
+ lt_prog_compiler_wl='-Wl,'
+ lt_prog_compiler_pic='-KPIC'
+ lt_prog_compiler_static='-Bstatic'
+ ;;
+
+ unicos*)
+ lt_prog_compiler_wl='-Wl,'
+ lt_prog_compiler_can_build_shared=no
+ ;;
+
+ uts4*)
+ lt_prog_compiler_pic='-pic'
+ lt_prog_compiler_static='-Bstatic'
+ ;;
+
+ *)
+ lt_prog_compiler_can_build_shared=no
+ ;;
+ esac
+ fi
+
+case $host_os in
+ # For platforms that do not support PIC, -DPIC is meaningless:
+ *djgpp*)
+ lt_prog_compiler_pic=
+ ;;
+ *)
+ lt_prog_compiler_pic="$lt_prog_compiler_pic -DPIC"
+ ;;
+esac
+
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $compiler option to produce PIC" >&5
+$as_echo_n "checking for $compiler option to produce PIC... " >&6; }
+if ${lt_cv_prog_compiler_pic+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ lt_cv_prog_compiler_pic=$lt_prog_compiler_pic
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $lt_cv_prog_compiler_pic" >&5
+$as_echo "$lt_cv_prog_compiler_pic" >&6; }
+lt_prog_compiler_pic=$lt_cv_prog_compiler_pic
+
+#
+# Check to make sure the PIC flag actually works.
+#
+if test -n "$lt_prog_compiler_pic"; then
+ { $as_echo "$as_me:${as_lineno-$LINENO}: checking if $compiler PIC flag $lt_prog_compiler_pic works" >&5
+$as_echo_n "checking if $compiler PIC flag $lt_prog_compiler_pic works... " >&6; }
+if ${lt_cv_prog_compiler_pic_works+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ lt_cv_prog_compiler_pic_works=no
+ ac_outfile=conftest.$ac_objext
+ echo "$lt_simple_compile_test_code" > conftest.$ac_ext
+ lt_compiler_flag="$lt_prog_compiler_pic -DPIC" ## exclude from sc_useless_quotes_in_assignment
+ # Insert the option either (1) after the last *FLAGS variable, or
+ # (2) before a word containing "conftest.", or (3) at the end.
+ # Note that $ac_compile itself does not contain backslashes and begins
+ # with a dollar sign (not a hyphen), so the echo should work correctly.
+ # The option is referenced via a variable to avoid confusing sed.
+ lt_compile=`echo "$ac_compile" | $SED \
+ -e 's:.*FLAGS}\{0,1\} :&$lt_compiler_flag :; t' \
+ -e 's: [^ ]*conftest\.: $lt_compiler_flag&:; t' \
+ -e 's:$: $lt_compiler_flag:'`
+ (eval echo "\"\$as_me:$LINENO: $lt_compile\"" >&5)
+ (eval "$lt_compile" 2>conftest.err)
+ ac_status=$?
+ cat conftest.err >&5
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ if (exit $ac_status) && test -s "$ac_outfile"; then
+ # The compiler can only warn and ignore the option if not recognized
+ # So say no if there are warnings other than the usual output.
+ $ECHO "$_lt_compiler_boilerplate" | $SED '/^$/d' >conftest.exp
+ $SED '/^$/d; /^ *+/d' conftest.err >conftest.er2
+ if test ! -s conftest.er2 || diff conftest.exp conftest.er2 >/dev/null; then
+ lt_cv_prog_compiler_pic_works=yes
+ fi
+ fi
+ $RM conftest*
+
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $lt_cv_prog_compiler_pic_works" >&5
+$as_echo "$lt_cv_prog_compiler_pic_works" >&6; }
+
+if test yes = "$lt_cv_prog_compiler_pic_works"; then
+ case $lt_prog_compiler_pic in
+ "" | " "*) ;;
+ *) lt_prog_compiler_pic=" $lt_prog_compiler_pic" ;;
+ esac
+else
+ lt_prog_compiler_pic=
+ lt_prog_compiler_can_build_shared=no
+fi
+
+fi
+
+
+
+
+
+
+
+
+
+
+
+#
+# Check to make sure the static flag actually works.
+#
+wl=$lt_prog_compiler_wl eval lt_tmp_static_flag=\"$lt_prog_compiler_static\"
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking if $compiler static flag $lt_tmp_static_flag works" >&5
+$as_echo_n "checking if $compiler static flag $lt_tmp_static_flag works... " >&6; }
+if ${lt_cv_prog_compiler_static_works+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ lt_cv_prog_compiler_static_works=no
+ save_LDFLAGS=$LDFLAGS
+ LDFLAGS="$LDFLAGS $lt_tmp_static_flag"
+ echo "$lt_simple_link_test_code" > conftest.$ac_ext
+ if (eval $ac_link 2>conftest.err) && test -s conftest$ac_exeext; then
+ # The linker can only warn and ignore the option if not recognized
+ # So say no if there are warnings
+ if test -s conftest.err; then
+ # Append any errors to the config.log.
+ cat conftest.err 1>&5
+ $ECHO "$_lt_linker_boilerplate" | $SED '/^$/d' > conftest.exp
+ $SED '/^$/d; /^ *+/d' conftest.err >conftest.er2
+ if diff conftest.exp conftest.er2 >/dev/null; then
+ lt_cv_prog_compiler_static_works=yes
+ fi
+ else
+ lt_cv_prog_compiler_static_works=yes
+ fi
+ fi
+ $RM -r conftest*
+ LDFLAGS=$save_LDFLAGS
+
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $lt_cv_prog_compiler_static_works" >&5
+$as_echo "$lt_cv_prog_compiler_static_works" >&6; }
+
+if test yes = "$lt_cv_prog_compiler_static_works"; then
+ :
+else
+ lt_prog_compiler_static=
+fi
+
+
+
+
+
+
+
+ { $as_echo "$as_me:${as_lineno-$LINENO}: checking if $compiler supports -c -o file.$ac_objext" >&5
+$as_echo_n "checking if $compiler supports -c -o file.$ac_objext... " >&6; }
+if ${lt_cv_prog_compiler_c_o+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ lt_cv_prog_compiler_c_o=no
+ $RM -r conftest 2>/dev/null
+ mkdir conftest
+ cd conftest
+ mkdir out
+ echo "$lt_simple_compile_test_code" > conftest.$ac_ext
+
+ lt_compiler_flag="-o out/conftest2.$ac_objext"
+ # Insert the option either (1) after the last *FLAGS variable, or
+ # (2) before a word containing "conftest.", or (3) at the end.
+ # Note that $ac_compile itself does not contain backslashes and begins
+ # with a dollar sign (not a hyphen), so the echo should work correctly.
+ lt_compile=`echo "$ac_compile" | $SED \
+ -e 's:.*FLAGS}\{0,1\} :&$lt_compiler_flag :; t' \
+ -e 's: [^ ]*conftest\.: $lt_compiler_flag&:; t' \
+ -e 's:$: $lt_compiler_flag:'`
+ (eval echo "\"\$as_me:$LINENO: $lt_compile\"" >&5)
+ (eval "$lt_compile" 2>out/conftest.err)
+ ac_status=$?
+ cat out/conftest.err >&5
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ if (exit $ac_status) && test -s out/conftest2.$ac_objext
+ then
+ # The compiler can only warn and ignore the option if not recognized
+ # So say no if there are warnings
+ $ECHO "$_lt_compiler_boilerplate" | $SED '/^$/d' > out/conftest.exp
+ $SED '/^$/d; /^ *+/d' out/conftest.err >out/conftest.er2
+ if test ! -s out/conftest.er2 || diff out/conftest.exp out/conftest.er2 >/dev/null; then
+ lt_cv_prog_compiler_c_o=yes
+ fi
+ fi
+ chmod u+w . 2>&5
+ $RM conftest*
+ # SGI C++ compiler will create directory out/ii_files/ for
+ # template instantiation
+ test -d out/ii_files && $RM out/ii_files/* && rmdir out/ii_files
+ $RM out/* && rmdir out
+ cd ..
+ $RM -r conftest
+ $RM conftest*
+
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $lt_cv_prog_compiler_c_o" >&5
+$as_echo "$lt_cv_prog_compiler_c_o" >&6; }
+
+
+
+
+
+
+ { $as_echo "$as_me:${as_lineno-$LINENO}: checking if $compiler supports -c -o file.$ac_objext" >&5
+$as_echo_n "checking if $compiler supports -c -o file.$ac_objext... " >&6; }
+if ${lt_cv_prog_compiler_c_o+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ lt_cv_prog_compiler_c_o=no
+ $RM -r conftest 2>/dev/null
+ mkdir conftest
+ cd conftest
+ mkdir out
+ echo "$lt_simple_compile_test_code" > conftest.$ac_ext
+
+ lt_compiler_flag="-o out/conftest2.$ac_objext"
+ # Insert the option either (1) after the last *FLAGS variable, or
+ # (2) before a word containing "conftest.", or (3) at the end.
+ # Note that $ac_compile itself does not contain backslashes and begins
+ # with a dollar sign (not a hyphen), so the echo should work correctly.
+ lt_compile=`echo "$ac_compile" | $SED \
+ -e 's:.*FLAGS}\{0,1\} :&$lt_compiler_flag :; t' \
+ -e 's: [^ ]*conftest\.: $lt_compiler_flag&:; t' \
+ -e 's:$: $lt_compiler_flag:'`
+ (eval echo "\"\$as_me:$LINENO: $lt_compile\"" >&5)
+ (eval "$lt_compile" 2>out/conftest.err)
+ ac_status=$?
+ cat out/conftest.err >&5
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ if (exit $ac_status) && test -s out/conftest2.$ac_objext
+ then
+ # The compiler can only warn and ignore the option if not recognized
+ # So say no if there are warnings
+ $ECHO "$_lt_compiler_boilerplate" | $SED '/^$/d' > out/conftest.exp
+ $SED '/^$/d; /^ *+/d' out/conftest.err >out/conftest.er2
+ if test ! -s out/conftest.er2 || diff out/conftest.exp out/conftest.er2 >/dev/null; then
+ lt_cv_prog_compiler_c_o=yes
+ fi
+ fi
+ chmod u+w . 2>&5
+ $RM conftest*
+ # SGI C++ compiler will create directory out/ii_files/ for
+ # template instantiation
+ test -d out/ii_files && $RM out/ii_files/* && rmdir out/ii_files
+ $RM out/* && rmdir out
+ cd ..
+ $RM -r conftest
+ $RM conftest*
+
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $lt_cv_prog_compiler_c_o" >&5
+$as_echo "$lt_cv_prog_compiler_c_o" >&6; }
+
+
+
+
+hard_links=nottested
+if test no = "$lt_cv_prog_compiler_c_o" && test no != "$need_locks"; then
+ # do not overwrite the value of need_locks provided by the user
+ { $as_echo "$as_me:${as_lineno-$LINENO}: checking if we can lock with hard links" >&5
+$as_echo_n "checking if we can lock with hard links... " >&6; }
+ hard_links=yes
+ $RM conftest*
+ ln conftest.a conftest.b 2>/dev/null && hard_links=no
+ touch conftest.a
+ ln conftest.a conftest.b 2>&5 || hard_links=no
+ ln conftest.a conftest.b 2>/dev/null && hard_links=no
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: $hard_links" >&5
+$as_echo "$hard_links" >&6; }
+ if test no = "$hard_links"; then
+ { $as_echo "$as_me:${as_lineno-$LINENO}: WARNING: '$CC' does not support '-c -o', so 'make -j' may be unsafe" >&5
+$as_echo "$as_me: WARNING: '$CC' does not support '-c -o', so 'make -j' may be unsafe" >&2;}
+ need_locks=warn
+ fi
+else
+ need_locks=no
+fi
+
+
+
+
+
+
+ { $as_echo "$as_me:${as_lineno-$LINENO}: checking whether the $compiler linker ($LD) supports shared libraries" >&5
+$as_echo_n "checking whether the $compiler linker ($LD) supports shared libraries... " >&6; }
+
+ runpath_var=
+ allow_undefined_flag=
+ always_export_symbols=no
+ archive_cmds=
+ archive_expsym_cmds=
+ compiler_needs_object=no
+ enable_shared_with_static_runtimes=no
+ export_dynamic_flag_spec=
+ export_symbols_cmds='$NM $libobjs $convenience | $global_symbol_pipe | $SED '\''s/.* //'\'' | sort | uniq > $export_symbols'
+ hardcode_automatic=no
+ hardcode_direct=no
+ hardcode_direct_absolute=no
+ hardcode_libdir_flag_spec=
+ hardcode_libdir_separator=
+ hardcode_minus_L=no
+ hardcode_shlibpath_var=unsupported
+ inherit_rpath=no
+ link_all_deplibs=unknown
+ module_cmds=
+ module_expsym_cmds=
+ old_archive_from_new_cmds=
+ old_archive_from_expsyms_cmds=
+ thread_safe_flag_spec=
+ whole_archive_flag_spec=
+ # include_expsyms should be a list of space-separated symbols to be *always*
+ # included in the symbol list
+ include_expsyms=
+ # exclude_expsyms can be an extended regexp of symbols to exclude
+ # it will be wrapped by ' (' and ')$', so one must not match beginning or
+ # end of line. Example: 'a|bc|.*d.*' will exclude the symbols 'a' and 'bc',
+ # as well as any symbol that contains 'd'.
+ exclude_expsyms='_GLOBAL_OFFSET_TABLE_|_GLOBAL__F[ID]_.*'
+ # Although _GLOBAL_OFFSET_TABLE_ is a valid symbol C name, most a.out
+ # platforms (ab)use it in PIC code, but their linkers get confused if
+ # the symbol is explicitly referenced. Since portable code cannot
+ # rely on this symbol name, it's probably fine to never include it in
+ # preloaded symbol tables.
+ # Exclude shared library initialization/finalization symbols.
+ extract_expsyms_cmds=
+
+ case $host_os in
+ cygwin* | mingw* | pw32* | cegcc*)
+ # FIXME: the MSVC++ port hasn't been tested in a loooong time
+ # When not using gcc, we currently assume that we are using
+ # Microsoft Visual C++.
+ if test yes != "$GCC"; then
+ with_gnu_ld=no
+ fi
+ ;;
+ interix*)
+ # we just hope/assume this is gcc and not c89 (= MSVC++)
+ with_gnu_ld=yes
+ ;;
+ openbsd* | bitrig*)
+ with_gnu_ld=no
+ ;;
+ esac
+
+ ld_shlibs=yes
+
+ # On some targets, GNU ld is compatible enough with the native linker
+ # that we're better off using the native interface for both.
+ lt_use_gnu_ld_interface=no
+ if test yes = "$with_gnu_ld"; then
+ case $host_os in
+ aix*)
+ # The AIX port of GNU ld has always aspired to compatibility
+ # with the native linker. However, as the warning in the GNU ld
+ # block says, versions before 2.19.5* couldn't really create working
+ # shared libraries, regardless of the interface used.
+ case `$LD -v 2>&1` in
+ *\ \(GNU\ Binutils\)\ 2.19.5*) ;;
+ *\ \(GNU\ Binutils\)\ 2.[2-9]*) ;;
+ *\ \(GNU\ Binutils\)\ [3-9]*) ;;
+ *)
+ lt_use_gnu_ld_interface=yes
+ ;;
+ esac
+ ;;
+ *)
+ lt_use_gnu_ld_interface=yes
+ ;;
+ esac
+ fi
+
+ if test yes = "$lt_use_gnu_ld_interface"; then
+ # If archive_cmds runs LD, not CC, wlarc should be empty
+ wlarc='$wl'
+
+ # Set some defaults for GNU ld with shared library support. These
+ # are reset later if shared libraries are not supported. Putting them
+ # here allows them to be overridden if necessary.
+ runpath_var=LD_RUN_PATH
+ hardcode_libdir_flag_spec='$wl-rpath $wl$libdir'
+ export_dynamic_flag_spec='$wl--export-dynamic'
+ # ancient GNU ld didn't support --whole-archive et. al.
+ if $LD --help 2>&1 | $GREP 'no-whole-archive' > /dev/null; then
+ whole_archive_flag_spec=$wlarc'--whole-archive$convenience '$wlarc'--no-whole-archive'
+ else
+ whole_archive_flag_spec=
+ fi
+ supports_anon_versioning=no
+ case `$LD -v | $SED -e 's/(^)\+)\s\+//' 2>&1` in
+ *GNU\ gold*) supports_anon_versioning=yes ;;
+ *\ [01].* | *\ 2.[0-9].* | *\ 2.10.*) ;; # catch versions < 2.11
+ *\ 2.11.93.0.2\ *) supports_anon_versioning=yes ;; # RH7.3 ...
+ *\ 2.11.92.0.12\ *) supports_anon_versioning=yes ;; # Mandrake 8.2 ...
+ *\ 2.11.*) ;; # other 2.11 versions
+ *) supports_anon_versioning=yes ;;
+ esac
+
+ # See if GNU ld supports shared libraries.
+ case $host_os in
+ aix[3-9]*)
+ # On AIX/PPC, the GNU linker is very broken
+ if test ia64 != "$host_cpu"; then
+ ld_shlibs=no
+ cat <<_LT_EOF 1>&2
+
+*** Warning: the GNU linker, at least up to release 2.19, is reported
+*** to be unable to reliably create shared libraries on AIX.
+*** Therefore, libtool is disabling shared libraries support. If you
+*** really care for shared libraries, you may want to install binutils
+*** 2.20 or above, or modify your PATH so that a non-GNU linker is found.
+*** You will then need to restart the configuration process.
+
+_LT_EOF
+ fi
+ ;;
+
+ amigaos*)
+ case $host_cpu in
+ powerpc)
+ # see comment about AmigaOS4 .so support
+ archive_cmds='$CC -shared $libobjs $deplibs $compiler_flags $wl-soname $wl$soname -o $lib'
+ archive_expsym_cmds=''
+ ;;
+ m68k)
+ archive_cmds='$RM $output_objdir/a2ixlibrary.data~$ECHO "#define NAME $libname" > $output_objdir/a2ixlibrary.data~$ECHO "#define LIBRARY_ID 1" >> $output_objdir/a2ixlibrary.data~$ECHO "#define VERSION $major" >> $output_objdir/a2ixlibrary.data~$ECHO "#define REVISION $revision" >> $output_objdir/a2ixlibrary.data~$AR $AR_FLAGS $lib $libobjs~$RANLIB $lib~(cd $output_objdir && a2ixlibrary -32)'
+ hardcode_libdir_flag_spec='-L$libdir'
+ hardcode_minus_L=yes
+ ;;
+ esac
+ ;;
+
+ beos*)
+ if $LD --help 2>&1 | $GREP ': supported targets:.* elf' > /dev/null; then
+ allow_undefined_flag=unsupported
+ # Joseph Beckenbach <jrb3@best.com> says some releases of gcc
+ # support --undefined. This deserves some investigation. FIXME
+ archive_cmds='$CC -nostart $libobjs $deplibs $compiler_flags $wl-soname $wl$soname -o $lib'
+ else
+ ld_shlibs=no
+ fi
+ ;;
+
+ cygwin* | mingw* | pw32* | cegcc*)
+ # _LT_TAGVAR(hardcode_libdir_flag_spec, ) is actually meaningless,
+ # as there is no search path for DLLs.
+ hardcode_libdir_flag_spec='-L$libdir'
+ export_dynamic_flag_spec='$wl--export-all-symbols'
+ allow_undefined_flag=unsupported
+ always_export_symbols=no
+ enable_shared_with_static_runtimes=yes
+ export_symbols_cmds='$NM $libobjs $convenience | $global_symbol_pipe | $SED -e '\''/^[BCDGRS][ ]/s/.*[ ]\([^ ]*\)/\1 DATA/;s/^.*[ ]__nm__\([^ ]*\)[ ][^ ]*/\1 DATA/;/^I[ ]/d;/^[AITW][ ]/s/.* //'\'' | sort | uniq > $export_symbols'
+ exclude_expsyms='[_]+GLOBAL_OFFSET_TABLE_|[_]+GLOBAL__[FID]_.*|[_]+head_[A-Za-z0-9_]+_dll|[A-Za-z0-9_]+_dll_iname'
+
+ if $LD --help 2>&1 | $GREP 'auto-import' > /dev/null; then
+ archive_cmds='$CC -shared $libobjs $deplibs $compiler_flags -o $output_objdir/$soname $wl--enable-auto-image-base -Xlinker --out-implib -Xlinker $lib'
+ # If the export-symbols file already is a .def file, use it as
+ # is; otherwise, prepend EXPORTS...
+ archive_expsym_cmds='if test DEF = "`$SED -n -e '\''s/^[ ]*//'\'' -e '\''/^\(;.*\)*$/d'\'' -e '\''s/^\(EXPORTS\|LIBRARY\)\([ ].*\)*$/DEF/p'\'' -e q $export_symbols`" ; then
+ cp $export_symbols $output_objdir/$soname.def;
+ else
+ echo EXPORTS > $output_objdir/$soname.def;
+ cat $export_symbols >> $output_objdir/$soname.def;
+ fi~
+ $CC -shared $output_objdir/$soname.def $libobjs $deplibs $compiler_flags -o $output_objdir/$soname $wl--enable-auto-image-base -Xlinker --out-implib -Xlinker $lib'
+ else
+ ld_shlibs=no
+ fi
+ ;;
+
+ haiku*)
+ archive_cmds='$CC -shared $libobjs $deplibs $compiler_flags $wl-soname $wl$soname -o $lib'
+ link_all_deplibs=yes
+ ;;
+
+ os2*)
+ hardcode_libdir_flag_spec='-L$libdir'
+ hardcode_minus_L=yes
+ allow_undefined_flag=unsupported
+ shrext_cmds=.dll
+ archive_cmds='$ECHO "LIBRARY ${soname%$shared_ext} INITINSTANCE TERMINSTANCE" > $output_objdir/$libname.def~
+ $ECHO "DESCRIPTION \"$libname\"" >> $output_objdir/$libname.def~
+ $ECHO "DATA MULTIPLE NONSHARED" >> $output_objdir/$libname.def~
+ $ECHO EXPORTS >> $output_objdir/$libname.def~
+ emxexp $libobjs | $SED /"_DLL_InitTerm"/d >> $output_objdir/$libname.def~
+ $CC -Zdll -Zcrtdll -o $output_objdir/$soname $libobjs $deplibs $compiler_flags $output_objdir/$libname.def~
+ emximp -o $lib $output_objdir/$libname.def'
+ archive_expsym_cmds='$ECHO "LIBRARY ${soname%$shared_ext} INITINSTANCE TERMINSTANCE" > $output_objdir/$libname.def~
+ $ECHO "DESCRIPTION \"$libname\"" >> $output_objdir/$libname.def~
+ $ECHO "DATA MULTIPLE NONSHARED" >> $output_objdir/$libname.def~
+ $ECHO EXPORTS >> $output_objdir/$libname.def~
+ prefix_cmds="$SED"~
+ if test EXPORTS = "`$SED 1q $export_symbols`"; then
+ prefix_cmds="$prefix_cmds -e 1d";
+ fi~
+ prefix_cmds="$prefix_cmds -e \"s/^\(.*\)$/_\1/g\""~
+ cat $export_symbols | $prefix_cmds >> $output_objdir/$libname.def~
+ $CC -Zdll -Zcrtdll -o $output_objdir/$soname $libobjs $deplibs $compiler_flags $output_objdir/$libname.def~
+ emximp -o $lib $output_objdir/$libname.def'
+ old_archive_From_new_cmds='emximp -o $output_objdir/${libname}_dll.a $output_objdir/$libname.def'
+ enable_shared_with_static_runtimes=yes
+ ;;
+
+ interix[3-9]*)
+ hardcode_direct=no
+ hardcode_shlibpath_var=no
+ hardcode_libdir_flag_spec='$wl-rpath,$libdir'
+ export_dynamic_flag_spec='$wl-E'
+ # Hack: On Interix 3.x, we cannot compile PIC because of a broken gcc.
+ # Instead, shared libraries are loaded at an image base (0x10000000 by
+ # default) and relocated if they conflict, which is a slow very memory
+ # consuming and fragmenting process. To avoid this, we pick a random,
+ # 256 KiB-aligned image base between 0x50000000 and 0x6FFC0000 at link
+ # time. Moving up from 0x10000000 also allows more sbrk(2) space.
+ archive_cmds='$CC -shared $pic_flag $libobjs $deplibs $compiler_flags $wl-h,$soname $wl--image-base,`expr ${RANDOM-$$} % 4096 / 2 \* 262144 + 1342177280` -o $lib'
+ archive_expsym_cmds='sed "s|^|_|" $export_symbols >$output_objdir/$soname.expsym~$CC -shared $pic_flag $libobjs $deplibs $compiler_flags $wl-h,$soname $wl--retain-symbols-file,$output_objdir/$soname.expsym $wl--image-base,`expr ${RANDOM-$$} % 4096 / 2 \* 262144 + 1342177280` -o $lib'
+ ;;
+
+ gnu* | linux* | tpf* | k*bsd*-gnu | kopensolaris*-gnu)
+ tmp_diet=no
+ if test linux-dietlibc = "$host_os"; then
+ case $cc_basename in
+ diet\ *) tmp_diet=yes;; # linux-dietlibc with static linking (!diet-dyn)
+ esac
+ fi
+ if $LD --help 2>&1 | $EGREP ': supported targets:.* elf' > /dev/null \
+ && test no = "$tmp_diet"
+ then
+ tmp_addflag=' $pic_flag'
+ tmp_sharedflag='-shared'
+ case $cc_basename,$host_cpu in
+ pgcc*) # Portland Group C compiler
+ whole_archive_flag_spec='$wl--whole-archive`for conv in $convenience\"\"; do test -n \"$conv\" && new_convenience=\"$new_convenience,$conv\"; done; func_echo_all \"$new_convenience\"` $wl--no-whole-archive'
+ tmp_addflag=' $pic_flag'
+ ;;
+ pgf77* | pgf90* | pgf95* | pgfortran*)
+ # Portland Group f77 and f90 compilers
+ whole_archive_flag_spec='$wl--whole-archive`for conv in $convenience\"\"; do test -n \"$conv\" && new_convenience=\"$new_convenience,$conv\"; done; func_echo_all \"$new_convenience\"` $wl--no-whole-archive'
+ tmp_addflag=' $pic_flag -Mnomain' ;;
+ ecc*,ia64* | icc*,ia64*) # Intel C compiler on ia64
+ tmp_addflag=' -i_dynamic' ;;
+ efc*,ia64* | ifort*,ia64*) # Intel Fortran compiler on ia64
+ tmp_addflag=' -i_dynamic -nofor_main' ;;
+ ifc* | ifort*) # Intel Fortran compiler
+ tmp_addflag=' -nofor_main' ;;
+ lf95*) # Lahey Fortran 8.1
+ whole_archive_flag_spec=
+ tmp_sharedflag='--shared' ;;
+ nagfor*) # NAGFOR 5.3
+ tmp_sharedflag='-Wl,-shared' ;;
+ xl[cC]* | bgxl[cC]* | mpixl[cC]*) # IBM XL C 8.0 on PPC (deal with xlf below)
+ tmp_sharedflag='-qmkshrobj'
+ tmp_addflag= ;;
+ nvcc*) # Cuda Compiler Driver 2.2
+ whole_archive_flag_spec='$wl--whole-archive`for conv in $convenience\"\"; do test -n \"$conv\" && new_convenience=\"$new_convenience,$conv\"; done; func_echo_all \"$new_convenience\"` $wl--no-whole-archive'
+ compiler_needs_object=yes
+ ;;
+ esac
+ case `$CC -V 2>&1 | sed 5q` in
+ *Sun\ C*) # Sun C 5.9
+ whole_archive_flag_spec='$wl--whole-archive`new_convenience=; for conv in $convenience\"\"; do test -z \"$conv\" || new_convenience=\"$new_convenience,$conv\"; done; func_echo_all \"$new_convenience\"` $wl--no-whole-archive'
+ compiler_needs_object=yes
+ tmp_sharedflag='-G' ;;
+ *Sun\ F*) # Sun Fortran 8.3
+ tmp_sharedflag='-G' ;;
+ esac
+ archive_cmds='$CC '"$tmp_sharedflag""$tmp_addflag"' $libobjs $deplibs $compiler_flags $wl-soname $wl$soname -o $lib'
+
+ if test yes = "$supports_anon_versioning"; then
+ archive_expsym_cmds='echo "{ global:" > $output_objdir/$libname.ver~
+ cat $export_symbols | sed -e "s/\(.*\)/\1;/" >> $output_objdir/$libname.ver~
+ echo "local: *; };" >> $output_objdir/$libname.ver~
+ $CC '"$tmp_sharedflag""$tmp_addflag"' $libobjs $deplibs $compiler_flags $wl-soname $wl$soname $wl-version-script $wl$output_objdir/$libname.ver -o $lib'
+ fi
+
+ case $cc_basename in
+ tcc*)
+ export_dynamic_flag_spec='-rdynamic'
+ ;;
+ xlf* | bgf* | bgxlf* | mpixlf*)
+ # IBM XL Fortran 10.1 on PPC cannot create shared libs itself
+ whole_archive_flag_spec='--whole-archive$convenience --no-whole-archive'
+ hardcode_libdir_flag_spec='$wl-rpath $wl$libdir'
+ archive_cmds='$LD -shared $libobjs $deplibs $linker_flags -soname $soname -o $lib'
+ if test yes = "$supports_anon_versioning"; then
+ archive_expsym_cmds='echo "{ global:" > $output_objdir/$libname.ver~
+ cat $export_symbols | sed -e "s/\(.*\)/\1;/" >> $output_objdir/$libname.ver~
+ echo "local: *; };" >> $output_objdir/$libname.ver~
+ $LD -shared $libobjs $deplibs $linker_flags -soname $soname -version-script $output_objdir/$libname.ver -o $lib'
+ fi
+ ;;
+ esac
+ else
+ ld_shlibs=no
+ fi
+ ;;
+
+ netbsd*)
+ if echo __ELF__ | $CC -E - | $GREP __ELF__ >/dev/null; then
+ archive_cmds='$LD -Bshareable $libobjs $deplibs $linker_flags -o $lib'
+ wlarc=
+ else
+ archive_cmds='$CC -shared $pic_flag $libobjs $deplibs $compiler_flags $wl-soname $wl$soname -o $lib'
+ archive_expsym_cmds='$CC -shared $pic_flag $libobjs $deplibs $compiler_flags $wl-soname $wl$soname $wl-retain-symbols-file $wl$export_symbols -o $lib'
+ fi
+ ;;
+
+ solaris*)
+ if $LD -v 2>&1 | $GREP 'BFD 2\.8' > /dev/null; then
+ ld_shlibs=no
+ cat <<_LT_EOF 1>&2
+
+*** Warning: The releases 2.8.* of the GNU linker cannot reliably
+*** create shared libraries on Solaris systems. Therefore, libtool
+*** is disabling shared libraries support. We urge you to upgrade GNU
+*** binutils to release 2.9.1 or newer. Another option is to modify
+*** your PATH or compiler configuration so that the native linker is
+*** used, and then restart.
+
+_LT_EOF
+ elif $LD --help 2>&1 | $GREP ': supported targets:.* elf' > /dev/null; then
+ archive_cmds='$CC -shared $pic_flag $libobjs $deplibs $compiler_flags $wl-soname $wl$soname -o $lib'
+ archive_expsym_cmds='$CC -shared $pic_flag $libobjs $deplibs $compiler_flags $wl-soname $wl$soname $wl-retain-symbols-file $wl$export_symbols -o $lib'
+ else
+ ld_shlibs=no
+ fi
+ ;;
+
+ sysv5* | sco3.2v5* | sco5v6* | unixware* | OpenUNIX*)
+ case `$LD -v 2>&1` in
+ *\ [01].* | *\ 2.[0-9].* | *\ 2.1[0-5].*)
+ ld_shlibs=no
+ cat <<_LT_EOF 1>&2
+
+*** Warning: Releases of the GNU linker prior to 2.16.91.0.3 cannot
+*** reliably create shared libraries on SCO systems. Therefore, libtool
+*** is disabling shared libraries support. We urge you to upgrade GNU
+*** binutils to release 2.16.91.0.3 or newer. Another option is to modify
+*** your PATH or compiler configuration so that the native linker is
+*** used, and then restart.
+
+_LT_EOF
+ ;;
+ *)
+ # For security reasons, it is highly recommended that you always
+ # use absolute paths for naming shared libraries, and exclude the
+ # DT_RUNPATH tag from executables and libraries. But doing so
+ # requires that you compile everything twice, which is a pain.
+ if $LD --help 2>&1 | $GREP ': supported targets:.* elf' > /dev/null; then
+ hardcode_libdir_flag_spec='$wl-rpath $wl$libdir'
+ archive_cmds='$CC -shared $libobjs $deplibs $compiler_flags $wl-soname $wl$soname -o $lib'
+ archive_expsym_cmds='$CC -shared $libobjs $deplibs $compiler_flags $wl-soname $wl$soname $wl-retain-symbols-file $wl$export_symbols -o $lib'
+ else
+ ld_shlibs=no
+ fi
+ ;;
+ esac
+ ;;
+
+ sunos4*)
+ archive_cmds='$LD -assert pure-text -Bshareable -o $lib $libobjs $deplibs $linker_flags'
+ wlarc=
+ hardcode_direct=yes
+ hardcode_shlibpath_var=no
+ ;;
+
+ *)
+ if $LD --help 2>&1 | $GREP ': supported targets:.* elf' > /dev/null; then
+ archive_cmds='$CC -shared $pic_flag $libobjs $deplibs $compiler_flags $wl-soname $wl$soname -o $lib'
+ archive_expsym_cmds='$CC -shared $pic_flag $libobjs $deplibs $compiler_flags $wl-soname $wl$soname $wl-retain-symbols-file $wl$export_symbols -o $lib'
+ else
+ ld_shlibs=no
+ fi
+ ;;
+ esac
+
+ if test no = "$ld_shlibs"; then
+ runpath_var=
+ hardcode_libdir_flag_spec=
+ export_dynamic_flag_spec=
+ whole_archive_flag_spec=
+ fi
+ else
+ # PORTME fill in a description of your system's linker (not GNU ld)
+ case $host_os in
+ aix3*)
+ allow_undefined_flag=unsupported
+ always_export_symbols=yes
+ archive_expsym_cmds='$LD -o $output_objdir/$soname $libobjs $deplibs $linker_flags -bE:$export_symbols -T512 -H512 -bM:SRE~$AR $AR_FLAGS $lib $output_objdir/$soname'
+ # Note: this linker hardcodes the directories in LIBPATH if there
+ # are no directories specified by -L.
+ hardcode_minus_L=yes
+ if test yes = "$GCC" && test -z "$lt_prog_compiler_static"; then
+ # Neither direct hardcoding nor static linking is supported with a
+ # broken collect2.
+ hardcode_direct=unsupported
+ fi
+ ;;
+
+ aix[4-9]*)
+ if test ia64 = "$host_cpu"; then
+ # On IA64, the linker does run time linking by default, so we don't
+ # have to do anything special.
+ aix_use_runtimelinking=no
+ exp_sym_flag='-Bexport'
+ no_entry_flag=
+ else
+ # If we're using GNU nm, then we don't want the "-C" option.
+ # -C means demangle to GNU nm, but means don't demangle to AIX nm.
+ # Without the "-l" option, or with the "-B" option, AIX nm treats
+ # weak defined symbols like other global defined symbols, whereas
+ # GNU nm marks them as "W".
+ # While the 'weak' keyword is ignored in the Export File, we need
+ # it in the Import File for the 'aix-soname' feature, so we have
+ # to replace the "-B" option with "-P" for AIX nm.
+ if $NM -V 2>&1 | $GREP 'GNU' > /dev/null; then
+ export_symbols_cmds='$NM -Bpg $libobjs $convenience | awk '\''{ if (((\$ 2 == "T") || (\$ 2 == "D") || (\$ 2 == "B") || (\$ 2 == "W")) && (substr(\$ 3,1,1) != ".")) { if (\$ 2 == "W") { print \$ 3 " weak" } else { print \$ 3 } } }'\'' | sort -u > $export_symbols'
+ else
+ export_symbols_cmds='`func_echo_all $NM | $SED -e '\''s/B\([^B]*\)$/P\1/'\''` -PCpgl $libobjs $convenience | awk '\''{ if (((\$ 2 == "T") || (\$ 2 == "D") || (\$ 2 == "B") || (\$ 2 == "W") || (\$ 2 == "V") || (\$ 2 == "Z")) && (substr(\$ 1,1,1) != ".")) { if ((\$ 2 == "W") || (\$ 2 == "V") || (\$ 2 == "Z")) { print \$ 1 " weak" } else { print \$ 1 } } }'\'' | sort -u > $export_symbols'
+ fi
+ aix_use_runtimelinking=no
+
+ # Test if we are trying to use run time linking or normal
+ # AIX style linking. If -brtl is somewhere in LDFLAGS, we
+ # have runtime linking enabled, and use it for executables.
+ # For shared libraries, we enable/disable runtime linking
+ # depending on the kind of the shared library created -
+ # when "with_aix_soname,aix_use_runtimelinking" is:
+ # "aix,no" lib.a(lib.so.V) shared, rtl:no, for executables
+ # "aix,yes" lib.so shared, rtl:yes, for executables
+ # lib.a static archive
+ # "both,no" lib.so.V(shr.o) shared, rtl:yes
+ # lib.a(lib.so.V) shared, rtl:no, for executables
+ # "both,yes" lib.so.V(shr.o) shared, rtl:yes, for executables
+ # lib.a(lib.so.V) shared, rtl:no
+ # "svr4,*" lib.so.V(shr.o) shared, rtl:yes, for executables
+ # lib.a static archive
+ case $host_os in aix4.[23]|aix4.[23].*|aix[5-9]*)
+ for ld_flag in $LDFLAGS; do
+ if (test x-brtl = "x$ld_flag" || test x-Wl,-brtl = "x$ld_flag"); then
+ aix_use_runtimelinking=yes
+ break
+ fi
+ done
+ if test svr4,no = "$with_aix_soname,$aix_use_runtimelinking"; then
+ # With aix-soname=svr4, we create the lib.so.V shared archives only,
+ # so we don't have lib.a shared libs to link our executables.
+ # We have to force runtime linking in this case.
+ aix_use_runtimelinking=yes
+ LDFLAGS="$LDFLAGS -Wl,-brtl"
+ fi
+ ;;
+ esac
+
+ exp_sym_flag='-bexport'
+ no_entry_flag='-bnoentry'
+ fi
+
+ # When large executables or shared objects are built, AIX ld can
+ # have problems creating the table of contents. If linking a library
+ # or program results in "error TOC overflow" add -mminimal-toc to
+ # CXXFLAGS/CFLAGS for g++/gcc. In the cases where that is not
+ # enough to fix the problem, add -Wl,-bbigtoc to LDFLAGS.
+
+ archive_cmds=''
+ hardcode_direct=yes
+ hardcode_direct_absolute=yes
+ hardcode_libdir_separator=':'
+ link_all_deplibs=yes
+ file_list_spec='$wl-f,'
+ case $with_aix_soname,$aix_use_runtimelinking in
+ aix,*) ;; # traditional, no import file
+ svr4,* | *,yes) # use import file
+ # The Import File defines what to hardcode.
+ hardcode_direct=no
+ hardcode_direct_absolute=no
+ ;;
+ esac
+
+ if test yes = "$GCC"; then
+ case $host_os in aix4.[012]|aix4.[012].*)
+ # We only want to do this on AIX 4.2 and lower, the check
+ # below for broken collect2 doesn't work under 4.3+
+ collect2name=`$CC -print-prog-name=collect2`
+ if test -f "$collect2name" &&
+ strings "$collect2name" | $GREP resolve_lib_name >/dev/null
+ then
+ # We have reworked collect2
+ :
+ else
+ # We have old collect2
+ hardcode_direct=unsupported
+ # It fails to find uninstalled libraries when the uninstalled
+ # path is not listed in the libpath. Setting hardcode_minus_L
+ # to unsupported forces relinking
+ hardcode_minus_L=yes
+ hardcode_libdir_flag_spec='-L$libdir'
+ hardcode_libdir_separator=
+ fi
+ ;;
+ esac
+ shared_flag='-shared'
+ if test yes = "$aix_use_runtimelinking"; then
+ shared_flag="$shared_flag "'$wl-G'
+ fi
+ # Need to ensure runtime linking is disabled for the traditional
+ # shared library, or the linker may eventually find shared libraries
+ # /with/ Import File - we do not want to mix them.
+ shared_flag_aix='-shared'
+ shared_flag_svr4='-shared $wl-G'
+ else
+ # not using gcc
+ if test ia64 = "$host_cpu"; then
+ # VisualAge C++, Version 5.5 for AIX 5L for IA-64, Beta 3 Release
+ # chokes on -Wl,-G. The following line is correct:
+ shared_flag='-G'
+ else
+ if test yes = "$aix_use_runtimelinking"; then
+ shared_flag='$wl-G'
+ else
+ shared_flag='$wl-bM:SRE'
+ fi
+ shared_flag_aix='$wl-bM:SRE'
+ shared_flag_svr4='$wl-G'
+ fi
+ fi
+
+ export_dynamic_flag_spec='$wl-bexpall'
+ # It seems that -bexpall does not export symbols beginning with
+ # underscore (_), so it is better to generate a list of symbols to export.
+ always_export_symbols=yes
+ if test aix,yes = "$with_aix_soname,$aix_use_runtimelinking"; then
+ # Warning - without using the other runtime loading flags (-brtl),
+ # -berok will link without error, but may produce a broken library.
+ allow_undefined_flag='-berok'
+ # Determine the default libpath from the value encoded in an
+ # empty executable.
+ if test set = "${lt_cv_aix_libpath+set}"; then
+ aix_libpath=$lt_cv_aix_libpath
+else
+ if ${lt_cv_aix_libpath_+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ cat confdefs.h - <<_ACEOF >conftest.$ac_ext
+/* end confdefs.h. */
+
+int
+main ()
+{
+
+ ;
+ return 0;
+}
+_ACEOF
+if ac_fn_c_try_link "$LINENO"; then :
+
+ lt_aix_libpath_sed='
+ /Import File Strings/,/^$/ {
+ /^0/ {
+ s/^0 *\([^ ]*\) *$/\1/
+ p
+ }
+ }'
+ lt_cv_aix_libpath_=`dump -H conftest$ac_exeext 2>/dev/null | $SED -n -e "$lt_aix_libpath_sed"`
+ # Check for a 64-bit object if we didn't find anything.
+ if test -z "$lt_cv_aix_libpath_"; then
+ lt_cv_aix_libpath_=`dump -HX64 conftest$ac_exeext 2>/dev/null | $SED -n -e "$lt_aix_libpath_sed"`
+ fi
+fi
+rm -f core conftest.err conftest.$ac_objext \
+ conftest$ac_exeext conftest.$ac_ext
+ if test -z "$lt_cv_aix_libpath_"; then
+ lt_cv_aix_libpath_=/usr/lib:/lib
+ fi
+
+fi
+
+ aix_libpath=$lt_cv_aix_libpath_
+fi
+
+ hardcode_libdir_flag_spec='$wl-blibpath:$libdir:'"$aix_libpath"
+ archive_expsym_cmds='$CC -o $output_objdir/$soname $libobjs $deplibs $wl'$no_entry_flag' $compiler_flags `if test -n "$allow_undefined_flag"; then func_echo_all "$wl$allow_undefined_flag"; else :; fi` $wl'$exp_sym_flag:\$export_symbols' '$shared_flag
+ else
+ if test ia64 = "$host_cpu"; then
+ hardcode_libdir_flag_spec='$wl-R $libdir:/usr/lib:/lib'
+ allow_undefined_flag="-z nodefs"
+ archive_expsym_cmds="\$CC $shared_flag"' -o $output_objdir/$soname $libobjs $deplibs '"\$wl$no_entry_flag"' $compiler_flags $wl$allow_undefined_flag '"\$wl$exp_sym_flag:\$export_symbols"
+ else
+ # Determine the default libpath from the value encoded in an
+ # empty executable.
+ if test set = "${lt_cv_aix_libpath+set}"; then
+ aix_libpath=$lt_cv_aix_libpath
+else
+ if ${lt_cv_aix_libpath_+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ cat confdefs.h - <<_ACEOF >conftest.$ac_ext
+/* end confdefs.h. */
+
+int
+main ()
+{
+
+ ;
+ return 0;
+}
+_ACEOF
+if ac_fn_c_try_link "$LINENO"; then :
+
+ lt_aix_libpath_sed='
+ /Import File Strings/,/^$/ {
+ /^0/ {
+ s/^0 *\([^ ]*\) *$/\1/
+ p
+ }
+ }'
+ lt_cv_aix_libpath_=`dump -H conftest$ac_exeext 2>/dev/null | $SED -n -e "$lt_aix_libpath_sed"`
+ # Check for a 64-bit object if we didn't find anything.
+ if test -z "$lt_cv_aix_libpath_"; then
+ lt_cv_aix_libpath_=`dump -HX64 conftest$ac_exeext 2>/dev/null | $SED -n -e "$lt_aix_libpath_sed"`
+ fi
+fi
+rm -f core conftest.err conftest.$ac_objext \
+ conftest$ac_exeext conftest.$ac_ext
+ if test -z "$lt_cv_aix_libpath_"; then
+ lt_cv_aix_libpath_=/usr/lib:/lib
+ fi
+
+fi
+
+ aix_libpath=$lt_cv_aix_libpath_
+fi
+
+ hardcode_libdir_flag_spec='$wl-blibpath:$libdir:'"$aix_libpath"
+ # Warning - without using the other run time loading flags,
+ # -berok will link without error, but may produce a broken library.
+ no_undefined_flag=' $wl-bernotok'
+ allow_undefined_flag=' $wl-berok'
+ if test yes = "$with_gnu_ld"; then
+ # We only use this code for GNU lds that support --whole-archive.
+ whole_archive_flag_spec='$wl--whole-archive$convenience $wl--no-whole-archive'
+ else
+ # Exported symbols can be pulled into shared objects from archives
+ whole_archive_flag_spec='$convenience'
+ fi
+ archive_cmds_need_lc=yes
+ archive_expsym_cmds='$RM -r $output_objdir/$realname.d~$MKDIR $output_objdir/$realname.d'
+ # -brtl affects multiple linker settings, -berok does not and is overridden later
+ compiler_flags_filtered='`func_echo_all "$compiler_flags " | $SED -e "s%-brtl\\([, ]\\)%-berok\\1%g"`'
+ if test svr4 != "$with_aix_soname"; then
+ # This is similar to how AIX traditionally builds its shared libraries.
+ archive_expsym_cmds="$archive_expsym_cmds"'~$CC '$shared_flag_aix' -o $output_objdir/$realname.d/$soname $libobjs $deplibs $wl-bnoentry '$compiler_flags_filtered'$wl-bE:$export_symbols$allow_undefined_flag~$AR $AR_FLAGS $output_objdir/$libname$release.a $output_objdir/$realname.d/$soname'
+ fi
+ if test aix != "$with_aix_soname"; then
+ archive_expsym_cmds="$archive_expsym_cmds"'~$CC '$shared_flag_svr4' -o $output_objdir/$realname.d/$shared_archive_member_spec.o $libobjs $deplibs $wl-bnoentry '$compiler_flags_filtered'$wl-bE:$export_symbols$allow_undefined_flag~$STRIP -e $output_objdir/$realname.d/$shared_archive_member_spec.o~( func_echo_all "#! $soname($shared_archive_member_spec.o)"; if test shr_64 = "$shared_archive_member_spec"; then func_echo_all "# 64"; else func_echo_all "# 32"; fi; cat $export_symbols ) > $output_objdir/$realname.d/$shared_archive_member_spec.imp~$AR $AR_FLAGS $output_objdir/$soname $output_objdir/$realname.d/$shared_archive_member_spec.o $output_objdir/$realname.d/$shared_archive_member_spec.imp'
+ else
+ # used by -dlpreopen to get the symbols
+ archive_expsym_cmds="$archive_expsym_cmds"'~$MV $output_objdir/$realname.d/$soname $output_objdir'
+ fi
+ archive_expsym_cmds="$archive_expsym_cmds"'~$RM -r $output_objdir/$realname.d'
+ fi
+ fi
+ ;;
+
+ amigaos*)
+ case $host_cpu in
+ powerpc)
+ # see comment about AmigaOS4 .so support
+ archive_cmds='$CC -shared $libobjs $deplibs $compiler_flags $wl-soname $wl$soname -o $lib'
+ archive_expsym_cmds=''
+ ;;
+ m68k)
+ archive_cmds='$RM $output_objdir/a2ixlibrary.data~$ECHO "#define NAME $libname" > $output_objdir/a2ixlibrary.data~$ECHO "#define LIBRARY_ID 1" >> $output_objdir/a2ixlibrary.data~$ECHO "#define VERSION $major" >> $output_objdir/a2ixlibrary.data~$ECHO "#define REVISION $revision" >> $output_objdir/a2ixlibrary.data~$AR $AR_FLAGS $lib $libobjs~$RANLIB $lib~(cd $output_objdir && a2ixlibrary -32)'
+ hardcode_libdir_flag_spec='-L$libdir'
+ hardcode_minus_L=yes
+ ;;
+ esac
+ ;;
+
+ bsdi[45]*)
+ export_dynamic_flag_spec=-rdynamic
+ ;;
+
+ cygwin* | mingw* | pw32* | cegcc*)
+ # When not using gcc, we currently assume that we are using
+ # Microsoft Visual C++.
+ # hardcode_libdir_flag_spec is actually meaningless, as there is
+ # no search path for DLLs.
+ case $cc_basename in
+ cl*)
+ # Native MSVC
+ hardcode_libdir_flag_spec=' '
+ allow_undefined_flag=unsupported
+ always_export_symbols=yes
+ file_list_spec='@'
+ # Tell ltmain to make .lib files, not .a files.
+ libext=lib
+ # Tell ltmain to make .dll files, not .so files.
+ shrext_cmds=.dll
+ # FIXME: Setting linknames here is a bad hack.
+ archive_cmds='$CC -o $output_objdir/$soname $libobjs $compiler_flags $deplibs -Wl,-DLL,-IMPLIB:"$tool_output_objdir$libname.dll.lib"~linknames='
+ archive_expsym_cmds='if test DEF = "`$SED -n -e '\''s/^[ ]*//'\'' -e '\''/^\(;.*\)*$/d'\'' -e '\''s/^\(EXPORTS\|LIBRARY\)\([ ].*\)*$/DEF/p'\'' -e q $export_symbols`" ; then
+ cp "$export_symbols" "$output_objdir/$soname.def";
+ echo "$tool_output_objdir$soname.def" > "$output_objdir/$soname.exp";
+ else
+ $SED -e '\''s/^/-link -EXPORT:/'\'' < $export_symbols > $output_objdir/$soname.exp;
+ fi~
+ $CC -o $tool_output_objdir$soname $libobjs $compiler_flags $deplibs "@$tool_output_objdir$soname.exp" -Wl,-DLL,-IMPLIB:"$tool_output_objdir$libname.dll.lib"~
+ linknames='
+ # The linker will not automatically build a static lib if we build a DLL.
+ # _LT_TAGVAR(old_archive_from_new_cmds, )='true'
+ enable_shared_with_static_runtimes=yes
+ exclude_expsyms='_NULL_IMPORT_DESCRIPTOR|_IMPORT_DESCRIPTOR_.*'
+ export_symbols_cmds='$NM $libobjs $convenience | $global_symbol_pipe | $SED -e '\''/^[BCDGRS][ ]/s/.*[ ]\([^ ]*\)/\1,DATA/'\'' | $SED -e '\''/^[AITW][ ]/s/.*[ ]//'\'' | sort | uniq > $export_symbols'
+ # Don't use ranlib
+ old_postinstall_cmds='chmod 644 $oldlib'
+ postlink_cmds='lt_outputfile="@OUTPUT@"~
+ lt_tool_outputfile="@TOOL_OUTPUT@"~
+ case $lt_outputfile in
+ *.exe|*.EXE) ;;
+ *)
+ lt_outputfile=$lt_outputfile.exe
+ lt_tool_outputfile=$lt_tool_outputfile.exe
+ ;;
+ esac~
+ if test : != "$MANIFEST_TOOL" && test -f "$lt_outputfile.manifest"; then
+ $MANIFEST_TOOL -manifest "$lt_tool_outputfile.manifest" -outputresource:"$lt_tool_outputfile" || exit 1;
+ $RM "$lt_outputfile.manifest";
+ fi'
+ ;;
+ *)
+ # Assume MSVC wrapper
+ hardcode_libdir_flag_spec=' '
+ allow_undefined_flag=unsupported
+ # Tell ltmain to make .lib files, not .a files.
+ libext=lib
+ # Tell ltmain to make .dll files, not .so files.
+ shrext_cmds=.dll
+ # FIXME: Setting linknames here is a bad hack.
+ archive_cmds='$CC -o $lib $libobjs $compiler_flags `func_echo_all "$deplibs" | $SED '\''s/ -lc$//'\''` -link -dll~linknames='
+ # The linker will automatically build a .lib file if we build a DLL.
+ old_archive_from_new_cmds='true'
+ # FIXME: Should let the user specify the lib program.
+ old_archive_cmds='lib -OUT:$oldlib$oldobjs$old_deplibs'
+ enable_shared_with_static_runtimes=yes
+ ;;
+ esac
+ ;;
+
+ darwin* | rhapsody*)
+
+
+ archive_cmds_need_lc=no
+ hardcode_direct=no
+ hardcode_automatic=yes
+ hardcode_shlibpath_var=unsupported
+ if test yes = "$lt_cv_ld_force_load"; then
+ whole_archive_flag_spec='`for conv in $convenience\"\"; do test -n \"$conv\" && new_convenience=\"$new_convenience $wl-force_load,$conv\"; done; func_echo_all \"$new_convenience\"`'
+
+ else
+ whole_archive_flag_spec=''
+ fi
+ link_all_deplibs=yes
+ allow_undefined_flag=$_lt_dar_allow_undefined
+ case $cc_basename in
+ ifort*|nagfor*) _lt_dar_can_shared=yes ;;
+ *) _lt_dar_can_shared=$GCC ;;
+ esac
+ if test yes = "$_lt_dar_can_shared"; then
+ output_verbose_link_cmd=func_echo_all
+ archive_cmds="\$CC -dynamiclib \$allow_undefined_flag -o \$lib \$libobjs \$deplibs \$compiler_flags -install_name \$rpath/\$soname \$verstring $_lt_dar_single_mod$_lt_dsymutil"
+ module_cmds="\$CC \$allow_undefined_flag -o \$lib -bundle \$libobjs \$deplibs \$compiler_flags$_lt_dsymutil"
+ archive_expsym_cmds="sed 's|^|_|' < \$export_symbols > \$output_objdir/\$libname-symbols.expsym~\$CC -dynamiclib \$allow_undefined_flag -o \$lib \$libobjs \$deplibs \$compiler_flags -install_name \$rpath/\$soname \$verstring $_lt_dar_single_mod$_lt_dar_export_syms$_lt_dsymutil"
+ module_expsym_cmds="sed -e 's|^|_|' < \$export_symbols > \$output_objdir/\$libname-symbols.expsym~\$CC \$allow_undefined_flag -o \$lib -bundle \$libobjs \$deplibs \$compiler_flags$_lt_dar_export_syms$_lt_dsymutil"
+
+ else
+ ld_shlibs=no
+ fi
+
+ ;;
+
+ dgux*)
+ archive_cmds='$LD -G -h $soname -o $lib $libobjs $deplibs $linker_flags'
+ hardcode_libdir_flag_spec='-L$libdir'
+ hardcode_shlibpath_var=no
+ ;;
+
+ # FreeBSD 2.2.[012] allows us to include c++rt0.o to get C++ constructor
+ # support. Future versions do this automatically, but an explicit c++rt0.o
+ # does not break anything, and helps significantly (at the cost of a little
+ # extra space).
+ freebsd2.2*)
+ archive_cmds='$LD -Bshareable -o $lib $libobjs $deplibs $linker_flags /usr/lib/c++rt0.o'
+ hardcode_libdir_flag_spec='-R$libdir'
+ hardcode_direct=yes
+ hardcode_shlibpath_var=no
+ ;;
+
+ # Unfortunately, older versions of FreeBSD 2 do not have this feature.
+ freebsd2.*)
+ archive_cmds='$LD -Bshareable -o $lib $libobjs $deplibs $linker_flags'
+ hardcode_direct=yes
+ hardcode_minus_L=yes
+ hardcode_shlibpath_var=no
+ ;;
+
+ # FreeBSD 3 and greater uses gcc -shared to do shared libraries.
+ freebsd* | dragonfly*)
+ archive_cmds='$CC -shared $pic_flag -o $lib $libobjs $deplibs $compiler_flags'
+ hardcode_libdir_flag_spec='-R$libdir'
+ hardcode_direct=yes
+ hardcode_shlibpath_var=no
+ ;;
+
+ hpux9*)
+ if test yes = "$GCC"; then
+ archive_cmds='$RM $output_objdir/$soname~$CC -shared $pic_flag $wl+b $wl$install_libdir -o $output_objdir/$soname $libobjs $deplibs $compiler_flags~test "x$output_objdir/$soname" = "x$lib" || mv $output_objdir/$soname $lib'
+ else
+ archive_cmds='$RM $output_objdir/$soname~$LD -b +b $install_libdir -o $output_objdir/$soname $libobjs $deplibs $linker_flags~test "x$output_objdir/$soname" = "x$lib" || mv $output_objdir/$soname $lib'
+ fi
+ hardcode_libdir_flag_spec='$wl+b $wl$libdir'
+ hardcode_libdir_separator=:
+ hardcode_direct=yes
+
+ # hardcode_minus_L: Not really in the search PATH,
+ # but as the default location of the library.
+ hardcode_minus_L=yes
+ export_dynamic_flag_spec='$wl-E'
+ ;;
+
+ hpux10*)
+ if test yes,no = "$GCC,$with_gnu_ld"; then
+ archive_cmds='$CC -shared $pic_flag $wl+h $wl$soname $wl+b $wl$install_libdir -o $lib $libobjs $deplibs $compiler_flags'
+ else
+ archive_cmds='$LD -b +h $soname +b $install_libdir -o $lib $libobjs $deplibs $linker_flags'
+ fi
+ if test no = "$with_gnu_ld"; then
+ hardcode_libdir_flag_spec='$wl+b $wl$libdir'
+ hardcode_libdir_separator=:
+ hardcode_direct=yes
+ hardcode_direct_absolute=yes
+ export_dynamic_flag_spec='$wl-E'
+ # hardcode_minus_L: Not really in the search PATH,
+ # but as the default location of the library.
+ hardcode_minus_L=yes
+ fi
+ ;;
+
+ hpux11*)
+ if test yes,no = "$GCC,$with_gnu_ld"; then
+ case $host_cpu in
+ hppa*64*)
+ archive_cmds='$CC -shared $wl+h $wl$soname -o $lib $libobjs $deplibs $compiler_flags'
+ ;;
+ ia64*)
+ archive_cmds='$CC -shared $pic_flag $wl+h $wl$soname $wl+nodefaultrpath -o $lib $libobjs $deplibs $compiler_flags'
+ ;;
+ *)
+ archive_cmds='$CC -shared $pic_flag $wl+h $wl$soname $wl+b $wl$install_libdir -o $lib $libobjs $deplibs $compiler_flags'
+ ;;
+ esac
+ else
+ case $host_cpu in
+ hppa*64*)
+ archive_cmds='$CC -b $wl+h $wl$soname -o $lib $libobjs $deplibs $compiler_flags'
+ ;;
+ ia64*)
+ archive_cmds='$CC -b $wl+h $wl$soname $wl+nodefaultrpath -o $lib $libobjs $deplibs $compiler_flags'
+ ;;
+ *)
+
+ # Older versions of the 11.00 compiler do not understand -b yet
+ # (HP92453-01 A.11.01.20 doesn't, HP92453-01 B.11.X.35175-35176.GP does)
+ { $as_echo "$as_me:${as_lineno-$LINENO}: checking if $CC understands -b" >&5
+$as_echo_n "checking if $CC understands -b... " >&6; }
+if ${lt_cv_prog_compiler__b+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ lt_cv_prog_compiler__b=no
+ save_LDFLAGS=$LDFLAGS
+ LDFLAGS="$LDFLAGS -b"
+ echo "$lt_simple_link_test_code" > conftest.$ac_ext
+ if (eval $ac_link 2>conftest.err) && test -s conftest$ac_exeext; then
+ # The linker can only warn and ignore the option if not recognized
+ # So say no if there are warnings
+ if test -s conftest.err; then
+ # Append any errors to the config.log.
+ cat conftest.err 1>&5
+ $ECHO "$_lt_linker_boilerplate" | $SED '/^$/d' > conftest.exp
+ $SED '/^$/d; /^ *+/d' conftest.err >conftest.er2
+ if diff conftest.exp conftest.er2 >/dev/null; then
+ lt_cv_prog_compiler__b=yes
+ fi
+ else
+ lt_cv_prog_compiler__b=yes
+ fi
+ fi
+ $RM -r conftest*
+ LDFLAGS=$save_LDFLAGS
+
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $lt_cv_prog_compiler__b" >&5
+$as_echo "$lt_cv_prog_compiler__b" >&6; }
+
+if test yes = "$lt_cv_prog_compiler__b"; then
+ archive_cmds='$CC -b $wl+h $wl$soname $wl+b $wl$install_libdir -o $lib $libobjs $deplibs $compiler_flags'
+else
+ archive_cmds='$LD -b +h $soname +b $install_libdir -o $lib $libobjs $deplibs $linker_flags'
+fi
+
+ ;;
+ esac
+ fi
+ if test no = "$with_gnu_ld"; then
+ hardcode_libdir_flag_spec='$wl+b $wl$libdir'
+ hardcode_libdir_separator=:
+
+ case $host_cpu in
+ hppa*64*|ia64*)
+ hardcode_direct=no
+ hardcode_shlibpath_var=no
+ ;;
+ *)
+ hardcode_direct=yes
+ hardcode_direct_absolute=yes
+ export_dynamic_flag_spec='$wl-E'
+
+ # hardcode_minus_L: Not really in the search PATH,
+ # but as the default location of the library.
+ hardcode_minus_L=yes
+ ;;
+ esac
+ fi
+ ;;
+
+ irix5* | irix6* | nonstopux*)
+ if test yes = "$GCC"; then
+ archive_cmds='$CC -shared $pic_flag $libobjs $deplibs $compiler_flags $wl-soname $wl$soname `test -n "$verstring" && func_echo_all "$wl-set_version $wl$verstring"` $wl-update_registry $wl$output_objdir/so_locations -o $lib'
+ # Try to use the -exported_symbol ld option, if it does not
+ # work, assume that -exports_file does not work either and
+ # implicitly export all symbols.
+ # This should be the same for all languages, so no per-tag cache variable.
+ { $as_echo "$as_me:${as_lineno-$LINENO}: checking whether the $host_os linker accepts -exported_symbol" >&5
+$as_echo_n "checking whether the $host_os linker accepts -exported_symbol... " >&6; }
+if ${lt_cv_irix_exported_symbol+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ save_LDFLAGS=$LDFLAGS
+ LDFLAGS="$LDFLAGS -shared $wl-exported_symbol ${wl}foo $wl-update_registry $wl/dev/null"
+ cat confdefs.h - <<_ACEOF >conftest.$ac_ext
+/* end confdefs.h. */
+int foo (void) { return 0; }
+_ACEOF
+if ac_fn_c_try_link "$LINENO"; then :
+ lt_cv_irix_exported_symbol=yes
+else
+ lt_cv_irix_exported_symbol=no
+fi
+rm -f core conftest.err conftest.$ac_objext \
+ conftest$ac_exeext conftest.$ac_ext
+ LDFLAGS=$save_LDFLAGS
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $lt_cv_irix_exported_symbol" >&5
+$as_echo "$lt_cv_irix_exported_symbol" >&6; }
+ if test yes = "$lt_cv_irix_exported_symbol"; then
+ archive_expsym_cmds='$CC -shared $pic_flag $libobjs $deplibs $compiler_flags $wl-soname $wl$soname `test -n "$verstring" && func_echo_all "$wl-set_version $wl$verstring"` $wl-update_registry $wl$output_objdir/so_locations $wl-exports_file $wl$export_symbols -o $lib'
+ fi
+ else
+ archive_cmds='$CC -shared $libobjs $deplibs $compiler_flags -soname $soname `test -n "$verstring" && func_echo_all "-set_version $verstring"` -update_registry $output_objdir/so_locations -o $lib'
+ archive_expsym_cmds='$CC -shared $libobjs $deplibs $compiler_flags -soname $soname `test -n "$verstring" && func_echo_all "-set_version $verstring"` -update_registry $output_objdir/so_locations -exports_file $export_symbols -o $lib'
+ fi
+ archive_cmds_need_lc='no'
+ hardcode_libdir_flag_spec='$wl-rpath $wl$libdir'
+ hardcode_libdir_separator=:
+ inherit_rpath=yes
+ link_all_deplibs=yes
+ ;;
+
+ linux*)
+ case $cc_basename in
+ tcc*)
+ # Fabrice Bellard et al's Tiny C Compiler
+ ld_shlibs=yes
+ archive_cmds='$CC -shared $pic_flag -o $lib $libobjs $deplibs $compiler_flags'
+ ;;
+ esac
+ ;;
+
+ netbsd*)
+ if echo __ELF__ | $CC -E - | $GREP __ELF__ >/dev/null; then
+ archive_cmds='$LD -Bshareable -o $lib $libobjs $deplibs $linker_flags' # a.out
+ else
+ archive_cmds='$LD -shared -o $lib $libobjs $deplibs $linker_flags' # ELF
+ fi
+ hardcode_libdir_flag_spec='-R$libdir'
+ hardcode_direct=yes
+ hardcode_shlibpath_var=no
+ ;;
+
+ newsos6)
+ archive_cmds='$LD -G -h $soname -o $lib $libobjs $deplibs $linker_flags'
+ hardcode_direct=yes
+ hardcode_libdir_flag_spec='$wl-rpath $wl$libdir'
+ hardcode_libdir_separator=:
+ hardcode_shlibpath_var=no
+ ;;
+
+ *nto* | *qnx*)
+ ;;
+
+ openbsd* | bitrig*)
+ if test -f /usr/libexec/ld.so; then
+ hardcode_direct=yes
+ hardcode_shlibpath_var=no
+ hardcode_direct_absolute=yes
+ if test -z "`echo __ELF__ | $CC -E - | $GREP __ELF__`"; then
+ archive_cmds='$CC -shared $pic_flag -o $lib $libobjs $deplibs $compiler_flags'
+ archive_expsym_cmds='$CC -shared $pic_flag -o $lib $libobjs $deplibs $compiler_flags $wl-retain-symbols-file,$export_symbols'
+ hardcode_libdir_flag_spec='$wl-rpath,$libdir'
+ export_dynamic_flag_spec='$wl-E'
+ else
+ archive_cmds='$CC -shared $pic_flag -o $lib $libobjs $deplibs $compiler_flags'
+ hardcode_libdir_flag_spec='$wl-rpath,$libdir'
+ fi
+ else
+ ld_shlibs=no
+ fi
+ ;;
+
+ os2*)
+ hardcode_libdir_flag_spec='-L$libdir'
+ hardcode_minus_L=yes
+ allow_undefined_flag=unsupported
+ shrext_cmds=.dll
+ archive_cmds='$ECHO "LIBRARY ${soname%$shared_ext} INITINSTANCE TERMINSTANCE" > $output_objdir/$libname.def~
+ $ECHO "DESCRIPTION \"$libname\"" >> $output_objdir/$libname.def~
+ $ECHO "DATA MULTIPLE NONSHARED" >> $output_objdir/$libname.def~
+ $ECHO EXPORTS >> $output_objdir/$libname.def~
+ emxexp $libobjs | $SED /"_DLL_InitTerm"/d >> $output_objdir/$libname.def~
+ $CC -Zdll -Zcrtdll -o $output_objdir/$soname $libobjs $deplibs $compiler_flags $output_objdir/$libname.def~
+ emximp -o $lib $output_objdir/$libname.def'
+ archive_expsym_cmds='$ECHO "LIBRARY ${soname%$shared_ext} INITINSTANCE TERMINSTANCE" > $output_objdir/$libname.def~
+ $ECHO "DESCRIPTION \"$libname\"" >> $output_objdir/$libname.def~
+ $ECHO "DATA MULTIPLE NONSHARED" >> $output_objdir/$libname.def~
+ $ECHO EXPORTS >> $output_objdir/$libname.def~
+ prefix_cmds="$SED"~
+ if test EXPORTS = "`$SED 1q $export_symbols`"; then
+ prefix_cmds="$prefix_cmds -e 1d";
+ fi~
+ prefix_cmds="$prefix_cmds -e \"s/^\(.*\)$/_\1/g\""~
+ cat $export_symbols | $prefix_cmds >> $output_objdir/$libname.def~
+ $CC -Zdll -Zcrtdll -o $output_objdir/$soname $libobjs $deplibs $compiler_flags $output_objdir/$libname.def~
+ emximp -o $lib $output_objdir/$libname.def'
+ old_archive_From_new_cmds='emximp -o $output_objdir/${libname}_dll.a $output_objdir/$libname.def'
+ enable_shared_with_static_runtimes=yes
+ ;;
+
+ osf3*)
+ if test yes = "$GCC"; then
+ allow_undefined_flag=' $wl-expect_unresolved $wl\*'
+ archive_cmds='$CC -shared$allow_undefined_flag $libobjs $deplibs $compiler_flags $wl-soname $wl$soname `test -n "$verstring" && func_echo_all "$wl-set_version $wl$verstring"` $wl-update_registry $wl$output_objdir/so_locations -o $lib'
+ else
+ allow_undefined_flag=' -expect_unresolved \*'
+ archive_cmds='$CC -shared$allow_undefined_flag $libobjs $deplibs $compiler_flags -soname $soname `test -n "$verstring" && func_echo_all "-set_version $verstring"` -update_registry $output_objdir/so_locations -o $lib'
+ fi
+ archive_cmds_need_lc='no'
+ hardcode_libdir_flag_spec='$wl-rpath $wl$libdir'
+ hardcode_libdir_separator=:
+ ;;
+
+ osf4* | osf5*) # as osf3* with the addition of -msym flag
+ if test yes = "$GCC"; then
+ allow_undefined_flag=' $wl-expect_unresolved $wl\*'
+ archive_cmds='$CC -shared$allow_undefined_flag $pic_flag $libobjs $deplibs $compiler_flags $wl-msym $wl-soname $wl$soname `test -n "$verstring" && func_echo_all "$wl-set_version $wl$verstring"` $wl-update_registry $wl$output_objdir/so_locations -o $lib'
+ hardcode_libdir_flag_spec='$wl-rpath $wl$libdir'
+ else
+ allow_undefined_flag=' -expect_unresolved \*'
+ archive_cmds='$CC -shared$allow_undefined_flag $libobjs $deplibs $compiler_flags -msym -soname $soname `test -n "$verstring" && func_echo_all "-set_version $verstring"` -update_registry $output_objdir/so_locations -o $lib'
+ archive_expsym_cmds='for i in `cat $export_symbols`; do printf "%s %s\\n" -exported_symbol "\$i" >> $lib.exp; done; printf "%s\\n" "-hidden">> $lib.exp~
+ $CC -shared$allow_undefined_flag $wl-input $wl$lib.exp $compiler_flags $libobjs $deplibs -soname $soname `test -n "$verstring" && $ECHO "-set_version $verstring"` -update_registry $output_objdir/so_locations -o $lib~$RM $lib.exp'
+
+ # Both c and cxx compiler support -rpath directly
+ hardcode_libdir_flag_spec='-rpath $libdir'
+ fi
+ archive_cmds_need_lc='no'
+ hardcode_libdir_separator=:
+ ;;
+
+ solaris*)
+ no_undefined_flag=' -z defs'
+ if test yes = "$GCC"; then
+ wlarc='$wl'
+ archive_cmds='$CC -shared $pic_flag $wl-z ${wl}text $wl-h $wl$soname -o $lib $libobjs $deplibs $compiler_flags'
+ archive_expsym_cmds='echo "{ global:" > $lib.exp~cat $export_symbols | $SED -e "s/\(.*\)/\1;/" >> $lib.exp~echo "local: *; };" >> $lib.exp~
+ $CC -shared $pic_flag $wl-z ${wl}text $wl-M $wl$lib.exp $wl-h $wl$soname -o $lib $libobjs $deplibs $compiler_flags~$RM $lib.exp'
+ else
+ case `$CC -V 2>&1` in
+ *"Compilers 5.0"*)
+ wlarc=''
+ archive_cmds='$LD -G$allow_undefined_flag -h $soname -o $lib $libobjs $deplibs $linker_flags'
+ archive_expsym_cmds='echo "{ global:" > $lib.exp~cat $export_symbols | $SED -e "s/\(.*\)/\1;/" >> $lib.exp~echo "local: *; };" >> $lib.exp~
+ $LD -G$allow_undefined_flag -M $lib.exp -h $soname -o $lib $libobjs $deplibs $linker_flags~$RM $lib.exp'
+ ;;
+ *)
+ wlarc='$wl'
+ archive_cmds='$CC -G$allow_undefined_flag -h $soname -o $lib $libobjs $deplibs $compiler_flags'
+ archive_expsym_cmds='echo "{ global:" > $lib.exp~cat $export_symbols | $SED -e "s/\(.*\)/\1;/" >> $lib.exp~echo "local: *; };" >> $lib.exp~
+ $CC -G$allow_undefined_flag -M $lib.exp -h $soname -o $lib $libobjs $deplibs $compiler_flags~$RM $lib.exp'
+ ;;
+ esac
+ fi
+ hardcode_libdir_flag_spec='-R$libdir'
+ hardcode_shlibpath_var=no
+ case $host_os in
+ solaris2.[0-5] | solaris2.[0-5].*) ;;
+ *)
+ # The compiler driver will combine and reorder linker options,
+ # but understands '-z linker_flag'. GCC discards it without '$wl',
+ # but is careful enough not to reorder.
+ # Supported since Solaris 2.6 (maybe 2.5.1?)
+ if test yes = "$GCC"; then
+ whole_archive_flag_spec='$wl-z ${wl}allextract$convenience $wl-z ${wl}defaultextract'
+ else
+ whole_archive_flag_spec='-z allextract$convenience -z defaultextract'
+ fi
+ ;;
+ esac
+ link_all_deplibs=yes
+ ;;
+
+ sunos4*)
+ if test sequent = "$host_vendor"; then
+ # Use $CC to link under sequent, because it throws in some extra .o
+ # files that make .init and .fini sections work.
+ archive_cmds='$CC -G $wl-h $soname -o $lib $libobjs $deplibs $compiler_flags'
+ else
+ archive_cmds='$LD -assert pure-text -Bstatic -o $lib $libobjs $deplibs $linker_flags'
+ fi
+ hardcode_libdir_flag_spec='-L$libdir'
+ hardcode_direct=yes
+ hardcode_minus_L=yes
+ hardcode_shlibpath_var=no
+ ;;
+
+ sysv4)
+ case $host_vendor in
+ sni)
+ archive_cmds='$LD -G -h $soname -o $lib $libobjs $deplibs $linker_flags'
+ hardcode_direct=yes # is this really true???
+ ;;
+ siemens)
+ ## LD is ld it makes a PLAMLIB
+ ## CC just makes a GrossModule.
+ archive_cmds='$LD -G -o $lib $libobjs $deplibs $linker_flags'
+ reload_cmds='$CC -r -o $output$reload_objs'
+ hardcode_direct=no
+ ;;
+ motorola)
+ archive_cmds='$LD -G -h $soname -o $lib $libobjs $deplibs $linker_flags'
+ hardcode_direct=no #Motorola manual says yes, but my tests say they lie
+ ;;
+ esac
+ runpath_var='LD_RUN_PATH'
+ hardcode_shlibpath_var=no
+ ;;
+
+ sysv4.3*)
+ archive_cmds='$LD -G -h $soname -o $lib $libobjs $deplibs $linker_flags'
+ hardcode_shlibpath_var=no
+ export_dynamic_flag_spec='-Bexport'
+ ;;
+
+ sysv4*MP*)
+ if test -d /usr/nec; then
+ archive_cmds='$LD -G -h $soname -o $lib $libobjs $deplibs $linker_flags'
+ hardcode_shlibpath_var=no
+ runpath_var=LD_RUN_PATH
+ hardcode_runpath_var=yes
+ ld_shlibs=yes
+ fi
+ ;;
+
+ sysv4*uw2* | sysv5OpenUNIX* | sysv5UnixWare7.[01].[10]* | unixware7* | sco3.2v5.0.[024]*)
+ no_undefined_flag='$wl-z,text'
+ archive_cmds_need_lc=no
+ hardcode_shlibpath_var=no
+ runpath_var='LD_RUN_PATH'
+
+ if test yes = "$GCC"; then
+ archive_cmds='$CC -shared $wl-h,$soname -o $lib $libobjs $deplibs $compiler_flags'
+ archive_expsym_cmds='$CC -shared $wl-Bexport:$export_symbols $wl-h,$soname -o $lib $libobjs $deplibs $compiler_flags'
+ else
+ archive_cmds='$CC -G $wl-h,$soname -o $lib $libobjs $deplibs $compiler_flags'
+ archive_expsym_cmds='$CC -G $wl-Bexport:$export_symbols $wl-h,$soname -o $lib $libobjs $deplibs $compiler_flags'
+ fi
+ ;;
+
+ sysv5* | sco3.2v5* | sco5v6*)
+ # Note: We CANNOT use -z defs as we might desire, because we do not
+ # link with -lc, and that would cause any symbols used from libc to
+ # always be unresolved, which means just about no library would
+ # ever link correctly. If we're not using GNU ld we use -z text
+ # though, which does catch some bad symbols but isn't as heavy-handed
+ # as -z defs.
+ no_undefined_flag='$wl-z,text'
+ allow_undefined_flag='$wl-z,nodefs'
+ archive_cmds_need_lc=no
+ hardcode_shlibpath_var=no
+ hardcode_libdir_flag_spec='$wl-R,$libdir'
+ hardcode_libdir_separator=':'
+ link_all_deplibs=yes
+ export_dynamic_flag_spec='$wl-Bexport'
+ runpath_var='LD_RUN_PATH'
+
+ if test yes = "$GCC"; then
+ archive_cmds='$CC -shared $wl-h,$soname -o $lib $libobjs $deplibs $compiler_flags'
+ archive_expsym_cmds='$CC -shared $wl-Bexport:$export_symbols $wl-h,$soname -o $lib $libobjs $deplibs $compiler_flags'
+ else
+ archive_cmds='$CC -G $wl-h,$soname -o $lib $libobjs $deplibs $compiler_flags'
+ archive_expsym_cmds='$CC -G $wl-Bexport:$export_symbols $wl-h,$soname -o $lib $libobjs $deplibs $compiler_flags'
+ fi
+ ;;
+
+ uts4*)
+ archive_cmds='$LD -G -h $soname -o $lib $libobjs $deplibs $linker_flags'
+ hardcode_libdir_flag_spec='-L$libdir'
+ hardcode_shlibpath_var=no
+ ;;
+
+ *)
+ ld_shlibs=no
+ ;;
+ esac
+
+ if test sni = "$host_vendor"; then
+ case $host in
+ sysv4 | sysv4.2uw2* | sysv4.3* | sysv5*)
+ export_dynamic_flag_spec='$wl-Blargedynsym'
+ ;;
+ esac
+ fi
+ fi
+
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $ld_shlibs" >&5
+$as_echo "$ld_shlibs" >&6; }
+test no = "$ld_shlibs" && can_build_shared=no
+
+with_gnu_ld=$with_gnu_ld
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+#
+# Do we need to explicitly link libc?
+#
+case "x$archive_cmds_need_lc" in
+x|xyes)
+ # Assume -lc should be added
+ archive_cmds_need_lc=yes
+
+ if test yes,yes = "$GCC,$enable_shared"; then
+ case $archive_cmds in
+ *'~'*)
+ # FIXME: we may have to deal with multi-command sequences.
+ ;;
+ '$CC '*)
+ # Test whether the compiler implicitly links with -lc since on some
+ # systems, -lgcc has to come before -lc. If gcc already passes -lc
+ # to ld, don't add -lc before -lgcc.
+ { $as_echo "$as_me:${as_lineno-$LINENO}: checking whether -lc should be explicitly linked in" >&5
+$as_echo_n "checking whether -lc should be explicitly linked in... " >&6; }
+if ${lt_cv_archive_cmds_need_lc+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ $RM conftest*
+ echo "$lt_simple_compile_test_code" > conftest.$ac_ext
+
+ if { { eval echo "\"\$as_me\":${as_lineno-$LINENO}: \"$ac_compile\""; } >&5
+ (eval $ac_compile) 2>&5
+ ac_status=$?
+ $as_echo "$as_me:${as_lineno-$LINENO}: \$? = $ac_status" >&5
+ test $ac_status = 0; } 2>conftest.err; then
+ soname=conftest
+ lib=conftest
+ libobjs=conftest.$ac_objext
+ deplibs=
+ wl=$lt_prog_compiler_wl
+ pic_flag=$lt_prog_compiler_pic
+ compiler_flags=-v
+ linker_flags=-v
+ verstring=
+ output_objdir=.
+ libname=conftest
+ lt_save_allow_undefined_flag=$allow_undefined_flag
+ allow_undefined_flag=
+ if { { eval echo "\"\$as_me\":${as_lineno-$LINENO}: \"$archive_cmds 2\>\&1 \| $GREP \" -lc \" \>/dev/null 2\>\&1\""; } >&5
+ (eval $archive_cmds 2\>\&1 \| $GREP \" -lc \" \>/dev/null 2\>\&1) 2>&5
+ ac_status=$?
+ $as_echo "$as_me:${as_lineno-$LINENO}: \$? = $ac_status" >&5
+ test $ac_status = 0; }
+ then
+ lt_cv_archive_cmds_need_lc=no
+ else
+ lt_cv_archive_cmds_need_lc=yes
+ fi
+ allow_undefined_flag=$lt_save_allow_undefined_flag
+ else
+ cat conftest.err 1>&5
+ fi
+ $RM conftest*
+
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $lt_cv_archive_cmds_need_lc" >&5
+$as_echo "$lt_cv_archive_cmds_need_lc" >&6; }
+ archive_cmds_need_lc=$lt_cv_archive_cmds_need_lc
+ ;;
+ esac
+ fi
+ ;;
+esac
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ { $as_echo "$as_me:${as_lineno-$LINENO}: checking dynamic linker characteristics" >&5
+$as_echo_n "checking dynamic linker characteristics... " >&6; }
+
+if test yes = "$GCC"; then
+ case $host_os in
+ darwin*) lt_awk_arg='/^libraries:/,/LR/' ;;
+ *) lt_awk_arg='/^libraries:/' ;;
+ esac
+ case $host_os in
+ mingw* | cegcc*) lt_sed_strip_eq='s|=\([A-Za-z]:\)|\1|g' ;;
+ *) lt_sed_strip_eq='s|=/|/|g' ;;
+ esac
+ lt_search_path_spec=`$CC -print-search-dirs | awk $lt_awk_arg | $SED -e "s/^libraries://" -e $lt_sed_strip_eq`
+ case $lt_search_path_spec in
+ *\;*)
+ # if the path contains ";" then we assume it to be the separator
+ # otherwise default to the standard path separator (i.e. ":") - it is
+ # assumed that no part of a normal pathname contains ";" but that should
+ # okay in the real world where ";" in dirpaths is itself problematic.
+ lt_search_path_spec=`$ECHO "$lt_search_path_spec" | $SED 's/;/ /g'`
+ ;;
+ *)
+ lt_search_path_spec=`$ECHO "$lt_search_path_spec" | $SED "s/$PATH_SEPARATOR/ /g"`
+ ;;
+ esac
+ # Ok, now we have the path, separated by spaces, we can step through it
+ # and add multilib dir if necessary...
+ lt_tmp_lt_search_path_spec=
+ lt_multi_os_dir=/`$CC $CPPFLAGS $CFLAGS $LDFLAGS -print-multi-os-directory 2>/dev/null`
+ # ...but if some path component already ends with the multilib dir we assume
+ # that all is fine and trust -print-search-dirs as is (GCC 4.2? or newer).
+ case "$lt_multi_os_dir; $lt_search_path_spec " in
+ "/; "* | "/.; "* | "/./; "* | *"$lt_multi_os_dir "* | *"$lt_multi_os_dir/ "*)
+ lt_multi_os_dir=
+ ;;
+ esac
+ for lt_sys_path in $lt_search_path_spec; do
+ if test -d "$lt_sys_path$lt_multi_os_dir"; then
+ lt_tmp_lt_search_path_spec="$lt_tmp_lt_search_path_spec $lt_sys_path$lt_multi_os_dir"
+ elif test -n "$lt_multi_os_dir"; then
+ test -d "$lt_sys_path" && \
+ lt_tmp_lt_search_path_spec="$lt_tmp_lt_search_path_spec $lt_sys_path"
+ fi
+ done
+ lt_search_path_spec=`$ECHO "$lt_tmp_lt_search_path_spec" | awk '
+BEGIN {RS = " "; FS = "/|\n";} {
+ lt_foo = "";
+ lt_count = 0;
+ for (lt_i = NF; lt_i > 0; lt_i--) {
+ if ($lt_i != "" && $lt_i != ".") {
+ if ($lt_i == "..") {
+ lt_count++;
+ } else {
+ if (lt_count == 0) {
+ lt_foo = "/" $lt_i lt_foo;
+ } else {
+ lt_count--;
+ }
+ }
+ }
+ }
+ if (lt_foo != "") { lt_freq[lt_foo]++; }
+ if (lt_freq[lt_foo] == 1) { print lt_foo; }
+}'`
+ # AWK program above erroneously prepends '/' to C:/dos/paths
+ # for these hosts.
+ case $host_os in
+ mingw* | cegcc*) lt_search_path_spec=`$ECHO "$lt_search_path_spec" |\
+ $SED 's|/\([A-Za-z]:\)|\1|g'` ;;
+ esac
+ sys_lib_search_path_spec=`$ECHO "$lt_search_path_spec" | $lt_NL2SP`
+else
+ sys_lib_search_path_spec="/lib /usr/lib /usr/local/lib"
+fi
+library_names_spec=
+libname_spec='lib$name'
+soname_spec=
+shrext_cmds=.so
+postinstall_cmds=
+postuninstall_cmds=
+finish_cmds=
+finish_eval=
+shlibpath_var=
+shlibpath_overrides_runpath=unknown
+version_type=none
+dynamic_linker="$host_os ld.so"
+sys_lib_dlsearch_path_spec="/lib /usr/lib"
+need_lib_prefix=unknown
+hardcode_into_libs=no
+
+# when you set need_version to no, make sure it does not cause -set_version
+# flags to be left without arguments
+need_version=unknown
+
+
+
+case $host_os in
+aix3*)
+ version_type=linux # correct to gnu/linux during the next big refactor
+ library_names_spec='$libname$release$shared_ext$versuffix $libname.a'
+ shlibpath_var=LIBPATH
+
+ # AIX 3 has no versioning support, so we append a major version to the name.
+ soname_spec='$libname$release$shared_ext$major'
+ ;;
+
+aix[4-9]*)
+ version_type=linux # correct to gnu/linux during the next big refactor
+ need_lib_prefix=no
+ need_version=no
+ hardcode_into_libs=yes
+ if test ia64 = "$host_cpu"; then
+ # AIX 5 supports IA64
+ library_names_spec='$libname$release$shared_ext$major $libname$release$shared_ext$versuffix $libname$shared_ext'
+ shlibpath_var=LD_LIBRARY_PATH
+ else
+ # With GCC up to 2.95.x, collect2 would create an import file
+ # for dependence libraries. The import file would start with
+ # the line '#! .'. This would cause the generated library to
+ # depend on '.', always an invalid library. This was fixed in
+ # development snapshots of GCC prior to 3.0.
+ case $host_os in
+ aix4 | aix4.[01] | aix4.[01].*)
+ if { echo '#if __GNUC__ > 2 || (__GNUC__ == 2 && __GNUC_MINOR__ >= 97)'
+ echo ' yes '
+ echo '#endif'; } | $CC -E - | $GREP yes > /dev/null; then
+ :
+ else
+ can_build_shared=no
+ fi
+ ;;
+ esac
+ # Using Import Files as archive members, it is possible to support
+ # filename-based versioning of shared library archives on AIX. While
+ # this would work for both with and without runtime linking, it will
+ # prevent static linking of such archives. So we do filename-based
+ # shared library versioning with .so extension only, which is used
+ # when both runtime linking and shared linking is enabled.
+ # Unfortunately, runtime linking may impact performance, so we do
+ # not want this to be the default eventually. Also, we use the
+ # versioned .so libs for executables only if there is the -brtl
+ # linker flag in LDFLAGS as well, or --with-aix-soname=svr4 only.
+ # To allow for filename-based versioning support, we need to create
+ # libNAME.so.V as an archive file, containing:
+ # *) an Import File, referring to the versioned filename of the
+ # archive as well as the shared archive member, telling the
+ # bitwidth (32 or 64) of that shared object, and providing the
+ # list of exported symbols of that shared object, eventually
+ # decorated with the 'weak' keyword
+ # *) the shared object with the F_LOADONLY flag set, to really avoid
+ # it being seen by the linker.
+ # At run time we better use the real file rather than another symlink,
+ # but for link time we create the symlink libNAME.so -> libNAME.so.V
+
+ case $with_aix_soname,$aix_use_runtimelinking in
+ # AIX (on Power*) has no versioning support, so currently we cannot hardcode correct
+ # soname into executable. Probably we can add versioning support to
+ # collect2, so additional links can be useful in future.
+ aix,yes) # traditional libtool
+ dynamic_linker='AIX unversionable lib.so'
+ # If using run time linking (on AIX 4.2 or later) use lib<name>.so
+ # instead of lib<name>.a to let people know that these are not
+ # typical AIX shared libraries.
+ library_names_spec='$libname$release$shared_ext$versuffix $libname$release$shared_ext$major $libname$shared_ext'
+ ;;
+ aix,no) # traditional AIX only
+ dynamic_linker='AIX lib.a(lib.so.V)'
+ # We preserve .a as extension for shared libraries through AIX4.2
+ # and later when we are not doing run time linking.
+ library_names_spec='$libname$release.a $libname.a'
+ soname_spec='$libname$release$shared_ext$major'
+ ;;
+ svr4,*) # full svr4 only
+ dynamic_linker="AIX lib.so.V($shared_archive_member_spec.o)"
+ library_names_spec='$libname$release$shared_ext$major $libname$shared_ext'
+ # We do not specify a path in Import Files, so LIBPATH fires.
+ shlibpath_overrides_runpath=yes
+ ;;
+ *,yes) # both, prefer svr4
+ dynamic_linker="AIX lib.so.V($shared_archive_member_spec.o), lib.a(lib.so.V)"
+ library_names_spec='$libname$release$shared_ext$major $libname$shared_ext'
+ # unpreferred sharedlib libNAME.a needs extra handling
+ postinstall_cmds='test -n "$linkname" || linkname="$realname"~func_stripname "" ".so" "$linkname"~$install_shared_prog "$dir/$func_stripname_result.$libext" "$destdir/$func_stripname_result.$libext"~test -z "$tstripme" || test -z "$striplib" || $striplib "$destdir/$func_stripname_result.$libext"'
+ postuninstall_cmds='for n in $library_names $old_library; do :; done~func_stripname "" ".so" "$n"~test "$func_stripname_result" = "$n" || func_append rmfiles " $odir/$func_stripname_result.$libext"'
+ # We do not specify a path in Import Files, so LIBPATH fires.
+ shlibpath_overrides_runpath=yes
+ ;;
+ *,no) # both, prefer aix
+ dynamic_linker="AIX lib.a(lib.so.V), lib.so.V($shared_archive_member_spec.o)"
+ library_names_spec='$libname$release.a $libname.a'
+ soname_spec='$libname$release$shared_ext$major'
+ # unpreferred sharedlib libNAME.so.V and symlink libNAME.so need extra handling
+ postinstall_cmds='test -z "$dlname" || $install_shared_prog $dir/$dlname $destdir/$dlname~test -z "$tstripme" || test -z "$striplib" || $striplib $destdir/$dlname~test -n "$linkname" || linkname=$realname~func_stripname "" ".a" "$linkname"~(cd "$destdir" && $LN_S -f $dlname $func_stripname_result.so)'
+ postuninstall_cmds='test -z "$dlname" || func_append rmfiles " $odir/$dlname"~for n in $old_library $library_names; do :; done~func_stripname "" ".a" "$n"~func_append rmfiles " $odir/$func_stripname_result.so"'
+ ;;
+ esac
+ shlibpath_var=LIBPATH
+ fi
+ ;;
+
+amigaos*)
+ case $host_cpu in
+ powerpc)
+ # Since July 2007 AmigaOS4 officially supports .so libraries.
+ # When compiling the executable, add -use-dynld -Lsobjs: to the compileline.
+ library_names_spec='$libname$release$shared_ext$versuffix $libname$release$shared_ext$major $libname$shared_ext'
+ ;;
+ m68k)
+ library_names_spec='$libname.ixlibrary $libname.a'
+ # Create ${libname}_ixlibrary.a entries in /sys/libs.
+ finish_eval='for lib in `ls $libdir/*.ixlibrary 2>/dev/null`; do libname=`func_echo_all "$lib" | $SED '\''s%^.*/\([^/]*\)\.ixlibrary$%\1%'\''`; $RM /sys/libs/${libname}_ixlibrary.a; $show "cd /sys/libs && $LN_S $lib ${libname}_ixlibrary.a"; cd /sys/libs && $LN_S $lib ${libname}_ixlibrary.a || exit 1; done'
+ ;;
+ esac
+ ;;
+
+beos*)
+ library_names_spec='$libname$shared_ext'
+ dynamic_linker="$host_os ld.so"
+ shlibpath_var=LIBRARY_PATH
+ ;;
+
+bsdi[45]*)
+ version_type=linux # correct to gnu/linux during the next big refactor
+ need_version=no
+ library_names_spec='$libname$release$shared_ext$versuffix $libname$release$shared_ext$major $libname$shared_ext'
+ soname_spec='$libname$release$shared_ext$major'
+ finish_cmds='PATH="\$PATH:/sbin" ldconfig $libdir'
+ shlibpath_var=LD_LIBRARY_PATH
+ sys_lib_search_path_spec="/shlib /usr/lib /usr/X11/lib /usr/contrib/lib /lib /usr/local/lib"
+ sys_lib_dlsearch_path_spec="/shlib /usr/lib /usr/local/lib"
+ # the default ld.so.conf also contains /usr/contrib/lib and
+ # /usr/X11R6/lib (/usr/X11 is a link to /usr/X11R6), but let us allow
+ # libtool to hard-code these into programs
+ ;;
+
+cygwin* | mingw* | pw32* | cegcc*)
+ version_type=windows
+ shrext_cmds=.dll
+ need_version=no
+ need_lib_prefix=no
+
+ case $GCC,$cc_basename in
+ yes,*)
+ # gcc
+ library_names_spec='$libname.dll.a'
+ # DLL is installed to $(libdir)/../bin by postinstall_cmds
+ postinstall_cmds='base_file=`basename \$file`~
+ dlpath=`$SHELL 2>&1 -c '\''. $dir/'\''\$base_file'\''i; echo \$dlname'\''`~
+ dldir=$destdir/`dirname \$dlpath`~
+ test -d \$dldir || mkdir -p \$dldir~
+ $install_prog $dir/$dlname \$dldir/$dlname~
+ chmod a+x \$dldir/$dlname~
+ if test -n '\''$stripme'\'' && test -n '\''$striplib'\''; then
+ eval '\''$striplib \$dldir/$dlname'\'' || exit \$?;
+ fi'
+ postuninstall_cmds='dldll=`$SHELL 2>&1 -c '\''. $file; echo \$dlname'\''`~
+ dlpath=$dir/\$dldll~
+ $RM \$dlpath'
+ shlibpath_overrides_runpath=yes
+
+ case $host_os in
+ cygwin*)
+ # Cygwin DLLs use 'cyg' prefix rather than 'lib'
+ soname_spec='`echo $libname | sed -e 's/^lib/cyg/'``echo $release | $SED -e 's/[.]/-/g'`$versuffix$shared_ext'
+
+ sys_lib_search_path_spec="$sys_lib_search_path_spec /usr/lib/w32api"
+ ;;
+ mingw* | cegcc*)
+ # MinGW DLLs use traditional 'lib' prefix
+ soname_spec='$libname`echo $release | $SED -e 's/[.]/-/g'`$versuffix$shared_ext'
+ ;;
+ pw32*)
+ # pw32 DLLs use 'pw' prefix rather than 'lib'
+ library_names_spec='`echo $libname | sed -e 's/^lib/pw/'``echo $release | $SED -e 's/[.]/-/g'`$versuffix$shared_ext'
+ ;;
+ esac
+ dynamic_linker='Win32 ld.exe'
+ ;;
+
+ *,cl*)
+ # Native MSVC
+ libname_spec='$name'
+ soname_spec='$libname`echo $release | $SED -e 's/[.]/-/g'`$versuffix$shared_ext'
+ library_names_spec='$libname.dll.lib'
+
+ case $build_os in
+ mingw*)
+ sys_lib_search_path_spec=
+ lt_save_ifs=$IFS
+ IFS=';'
+ for lt_path in $LIB
+ do
+ IFS=$lt_save_ifs
+ # Let DOS variable expansion print the short 8.3 style file name.
+ lt_path=`cd "$lt_path" 2>/dev/null && cmd //C "for %i in (".") do @echo %~si"`
+ sys_lib_search_path_spec="$sys_lib_search_path_spec $lt_path"
+ done
+ IFS=$lt_save_ifs
+ # Convert to MSYS style.
+ sys_lib_search_path_spec=`$ECHO "$sys_lib_search_path_spec" | sed -e 's|\\\\|/|g' -e 's| \\([a-zA-Z]\\):| /\\1|g' -e 's|^ ||'`
+ ;;
+ cygwin*)
+ # Convert to unix form, then to dos form, then back to unix form
+ # but this time dos style (no spaces!) so that the unix form looks
+ # like /cygdrive/c/PROGRA~1:/cygdr...
+ sys_lib_search_path_spec=`cygpath --path --unix "$LIB"`
+ sys_lib_search_path_spec=`cygpath --path --dos "$sys_lib_search_path_spec" 2>/dev/null`
+ sys_lib_search_path_spec=`cygpath --path --unix "$sys_lib_search_path_spec" | $SED -e "s/$PATH_SEPARATOR/ /g"`
+ ;;
+ *)
+ sys_lib_search_path_spec=$LIB
+ if $ECHO "$sys_lib_search_path_spec" | $GREP ';[c-zC-Z]:/' >/dev/null; then
+ # It is most probably a Windows format PATH.
+ sys_lib_search_path_spec=`$ECHO "$sys_lib_search_path_spec" | $SED -e 's/;/ /g'`
+ else
+ sys_lib_search_path_spec=`$ECHO "$sys_lib_search_path_spec" | $SED -e "s/$PATH_SEPARATOR/ /g"`
+ fi
+ # FIXME: find the short name or the path components, as spaces are
+ # common. (e.g. "Program Files" -> "PROGRA~1")
+ ;;
+ esac
+
+ # DLL is installed to $(libdir)/../bin by postinstall_cmds
+ postinstall_cmds='base_file=`basename \$file`~
+ dlpath=`$SHELL 2>&1 -c '\''. $dir/'\''\$base_file'\''i; echo \$dlname'\''`~
+ dldir=$destdir/`dirname \$dlpath`~
+ test -d \$dldir || mkdir -p \$dldir~
+ $install_prog $dir/$dlname \$dldir/$dlname'
+ postuninstall_cmds='dldll=`$SHELL 2>&1 -c '\''. $file; echo \$dlname'\''`~
+ dlpath=$dir/\$dldll~
+ $RM \$dlpath'
+ shlibpath_overrides_runpath=yes
+ dynamic_linker='Win32 link.exe'
+ ;;
+
+ *)
+ # Assume MSVC wrapper
+ library_names_spec='$libname`echo $release | $SED -e 's/[.]/-/g'`$versuffix$shared_ext $libname.lib'
+ dynamic_linker='Win32 ld.exe'
+ ;;
+ esac
+ # FIXME: first we should search . and the directory the executable is in
+ shlibpath_var=PATH
+ ;;
+
+darwin* | rhapsody*)
+ dynamic_linker="$host_os dyld"
+ version_type=darwin
+ need_lib_prefix=no
+ need_version=no
+ library_names_spec='$libname$release$major$shared_ext $libname$shared_ext'
+ soname_spec='$libname$release$major$shared_ext'
+ shlibpath_overrides_runpath=yes
+ shlibpath_var=DYLD_LIBRARY_PATH
+ shrext_cmds='`test .$module = .yes && echo .so || echo .dylib`'
+
+ sys_lib_search_path_spec="$sys_lib_search_path_spec /usr/local/lib"
+ sys_lib_dlsearch_path_spec='/usr/local/lib /lib /usr/lib'
+ ;;
+
+dgux*)
+ version_type=linux # correct to gnu/linux during the next big refactor
+ need_lib_prefix=no
+ need_version=no
+ library_names_spec='$libname$release$shared_ext$versuffix $libname$release$shared_ext$major $libname$shared_ext'
+ soname_spec='$libname$release$shared_ext$major'
+ shlibpath_var=LD_LIBRARY_PATH
+ ;;
+
+freebsd* | dragonfly*)
+ # DragonFly does not have aout. When/if they implement a new
+ # versioning mechanism, adjust this.
+ if test -x /usr/bin/objformat; then
+ objformat=`/usr/bin/objformat`
+ else
+ case $host_os in
+ freebsd[23].*) objformat=aout ;;
+ *) objformat=elf ;;
+ esac
+ fi
+ version_type=freebsd-$objformat
+ case $version_type in
+ freebsd-elf*)
+ library_names_spec='$libname$release$shared_ext$versuffix $libname$release$shared_ext$major $libname$shared_ext'
+ soname_spec='$libname$release$shared_ext$major'
+ need_version=no
+ need_lib_prefix=no
+ ;;
+ freebsd-*)
+ library_names_spec='$libname$release$shared_ext$versuffix $libname$shared_ext$versuffix'
+ need_version=yes
+ ;;
+ esac
+ shlibpath_var=LD_LIBRARY_PATH
+ case $host_os in
+ freebsd2.*)
+ shlibpath_overrides_runpath=yes
+ ;;
+ freebsd3.[01]* | freebsdelf3.[01]*)
+ shlibpath_overrides_runpath=yes
+ hardcode_into_libs=yes
+ ;;
+ freebsd3.[2-9]* | freebsdelf3.[2-9]* | \
+ freebsd4.[0-5] | freebsdelf4.[0-5] | freebsd4.1.1 | freebsdelf4.1.1)
+ shlibpath_overrides_runpath=no
+ hardcode_into_libs=yes
+ ;;
+ *) # from 4.6 on, and DragonFly
+ shlibpath_overrides_runpath=yes
+ hardcode_into_libs=yes
+ ;;
+ esac
+ ;;
+
+haiku*)
+ version_type=linux # correct to gnu/linux during the next big refactor
+ need_lib_prefix=no
+ need_version=no
+ dynamic_linker="$host_os runtime_loader"
+ library_names_spec='$libname$release$shared_ext$versuffix $libname$release$shared_ext$major $libname$shared_ext'
+ soname_spec='$libname$release$shared_ext$major'
+ shlibpath_var=LIBRARY_PATH
+ shlibpath_overrides_runpath=no
+ sys_lib_dlsearch_path_spec='/boot/home/config/lib /boot/common/lib /boot/system/lib'
+ hardcode_into_libs=yes
+ ;;
+
+hpux9* | hpux10* | hpux11*)
+ # Give a soname corresponding to the major version so that dld.sl refuses to
+ # link against other versions.
+ version_type=sunos
+ need_lib_prefix=no
+ need_version=no
+ case $host_cpu in
+ ia64*)
+ shrext_cmds='.so'
+ hardcode_into_libs=yes
+ dynamic_linker="$host_os dld.so"
+ shlibpath_var=LD_LIBRARY_PATH
+ shlibpath_overrides_runpath=yes # Unless +noenvvar is specified.
+ library_names_spec='$libname$release$shared_ext$versuffix $libname$release$shared_ext$major $libname$shared_ext'
+ soname_spec='$libname$release$shared_ext$major'
+ if test 32 = "$HPUX_IA64_MODE"; then
+ sys_lib_search_path_spec="/usr/lib/hpux32 /usr/local/lib/hpux32 /usr/local/lib"
+ sys_lib_dlsearch_path_spec=/usr/lib/hpux32
+ else
+ sys_lib_search_path_spec="/usr/lib/hpux64 /usr/local/lib/hpux64"
+ sys_lib_dlsearch_path_spec=/usr/lib/hpux64
+ fi
+ ;;
+ hppa*64*)
+ shrext_cmds='.sl'
+ hardcode_into_libs=yes
+ dynamic_linker="$host_os dld.sl"
+ shlibpath_var=LD_LIBRARY_PATH # How should we handle SHLIB_PATH
+ shlibpath_overrides_runpath=yes # Unless +noenvvar is specified.
+ library_names_spec='$libname$release$shared_ext$versuffix $libname$release$shared_ext$major $libname$shared_ext'
+ soname_spec='$libname$release$shared_ext$major'
+ sys_lib_search_path_spec="/usr/lib/pa20_64 /usr/ccs/lib/pa20_64"
+ sys_lib_dlsearch_path_spec=$sys_lib_search_path_spec
+ ;;
+ *)
+ shrext_cmds='.sl'
+ dynamic_linker="$host_os dld.sl"
+ shlibpath_var=SHLIB_PATH
+ shlibpath_overrides_runpath=no # +s is required to enable SHLIB_PATH
+ library_names_spec='$libname$release$shared_ext$versuffix $libname$release$shared_ext$major $libname$shared_ext'
+ soname_spec='$libname$release$shared_ext$major'
+ ;;
+ esac
+ # HP-UX runs *really* slowly unless shared libraries are mode 555, ...
+ postinstall_cmds='chmod 555 $lib'
+ # or fails outright, so override atomically:
+ install_override_mode=555
+ ;;
+
+interix[3-9]*)
+ version_type=linux # correct to gnu/linux during the next big refactor
+ need_lib_prefix=no
+ need_version=no
+ library_names_spec='$libname$release$shared_ext$versuffix $libname$release$shared_ext$major $libname$shared_ext'
+ soname_spec='$libname$release$shared_ext$major'
+ dynamic_linker='Interix 3.x ld.so.1 (PE, like ELF)'
+ shlibpath_var=LD_LIBRARY_PATH
+ shlibpath_overrides_runpath=no
+ hardcode_into_libs=yes
+ ;;
+
+irix5* | irix6* | nonstopux*)
+ case $host_os in
+ nonstopux*) version_type=nonstopux ;;
+ *)
+ if test yes = "$lt_cv_prog_gnu_ld"; then
+ version_type=linux # correct to gnu/linux during the next big refactor
+ else
+ version_type=irix
+ fi ;;
+ esac
+ need_lib_prefix=no
+ need_version=no
+ soname_spec='$libname$release$shared_ext$major'
+ library_names_spec='$libname$release$shared_ext$versuffix $libname$release$shared_ext$major $libname$release$shared_ext $libname$shared_ext'
+ case $host_os in
+ irix5* | nonstopux*)
+ libsuff= shlibsuff=
+ ;;
+ *)
+ case $LD in # libtool.m4 will add one of these switches to LD
+ *-32|*"-32 "|*-melf32bsmip|*"-melf32bsmip ")
+ libsuff= shlibsuff= libmagic=32-bit;;
+ *-n32|*"-n32 "|*-melf32bmipn32|*"-melf32bmipn32 ")
+ libsuff=32 shlibsuff=N32 libmagic=N32;;
+ *-64|*"-64 "|*-melf64bmip|*"-melf64bmip ")
+ libsuff=64 shlibsuff=64 libmagic=64-bit;;
+ *) libsuff= shlibsuff= libmagic=never-match;;
+ esac
+ ;;
+ esac
+ shlibpath_var=LD_LIBRARY${shlibsuff}_PATH
+ shlibpath_overrides_runpath=no
+ sys_lib_search_path_spec="/usr/lib$libsuff /lib$libsuff /usr/local/lib$libsuff"
+ sys_lib_dlsearch_path_spec="/usr/lib$libsuff /lib$libsuff"
+ hardcode_into_libs=yes
+ ;;
+
+# No shared lib support for Linux oldld, aout, or coff.
+linux*oldld* | linux*aout* | linux*coff*)
+ dynamic_linker=no
+ ;;
+
+linux*android*)
+ version_type=none # Android doesn't support versioned libraries.
+ need_lib_prefix=no
+ need_version=no
+ library_names_spec='$libname$release$shared_ext'
+ soname_spec='$libname$release$shared_ext'
+ finish_cmds=
+ shlibpath_var=LD_LIBRARY_PATH
+ shlibpath_overrides_runpath=yes
+
+ # This implies no fast_install, which is unacceptable.
+ # Some rework will be needed to allow for fast_install
+ # before this can be enabled.
+ hardcode_into_libs=yes
+
+ dynamic_linker='Android linker'
+ # Don't embed -rpath directories since the linker doesn't support them.
+ hardcode_libdir_flag_spec='-L$libdir'
+ ;;
+
+# This must be glibc/ELF.
+linux* | k*bsd*-gnu | kopensolaris*-gnu | gnu*)
+ version_type=linux # correct to gnu/linux during the next big refactor
+ need_lib_prefix=no
+ need_version=no
+ library_names_spec='$libname$release$shared_ext$versuffix $libname$release$shared_ext$major $libname$shared_ext'
+ soname_spec='$libname$release$shared_ext$major'
+ finish_cmds='PATH="\$PATH:/sbin" ldconfig -n $libdir'
+ shlibpath_var=LD_LIBRARY_PATH
+ shlibpath_overrides_runpath=no
+
+ # Some binutils ld are patched to set DT_RUNPATH
+ if ${lt_cv_shlibpath_overrides_runpath+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ lt_cv_shlibpath_overrides_runpath=no
+ save_LDFLAGS=$LDFLAGS
+ save_libdir=$libdir
+ eval "libdir=/foo; wl=\"$lt_prog_compiler_wl\"; \
+ LDFLAGS=\"\$LDFLAGS $hardcode_libdir_flag_spec\""
+ cat confdefs.h - <<_ACEOF >conftest.$ac_ext
+/* end confdefs.h. */
+
+int
+main ()
+{
+
+ ;
+ return 0;
+}
+_ACEOF
+if ac_fn_c_try_link "$LINENO"; then :
+ if ($OBJDUMP -p conftest$ac_exeext) 2>/dev/null | grep "RUNPATH.*$libdir" >/dev/null; then :
+ lt_cv_shlibpath_overrides_runpath=yes
+fi
+fi
+rm -f core conftest.err conftest.$ac_objext \
+ conftest$ac_exeext conftest.$ac_ext
+ LDFLAGS=$save_LDFLAGS
+ libdir=$save_libdir
+
+fi
+
+ shlibpath_overrides_runpath=$lt_cv_shlibpath_overrides_runpath
+
+ # This implies no fast_install, which is unacceptable.
+ # Some rework will be needed to allow for fast_install
+ # before this can be enabled.
+ hardcode_into_libs=yes
+
+ # Ideally, we could use ldconfig to report *all* directores which are
+ # searched for libraries, however this is still not possible. Aside from not
+ # being certain /sbin/ldconfig is available, command
+ # 'ldconfig -N -X -v | grep ^/' on 64bit Fedora does not report /usr/lib64,
+ # even though it is searched at run-time. Try to do the best guess by
+ # appending ld.so.conf contents (and includes) to the search path.
+ if test -f /etc/ld.so.conf; then
+ lt_ld_extra=`awk '/^include / { system(sprintf("cd /etc; cat %s 2>/dev/null", \$2)); skip = 1; } { if (!skip) print \$0; skip = 0; }' < /etc/ld.so.conf | $SED -e 's/#.*//;/^[ ]*hwcap[ ]/d;s/[:, ]/ /g;s/=[^=]*$//;s/=[^= ]* / /g;s/"//g;/^$/d' | tr '\n' ' '`
+ sys_lib_dlsearch_path_spec="/lib /usr/lib $lt_ld_extra"
+ fi
+
+ # We used to test for /lib/ld.so.1 and disable shared libraries on
+ # powerpc, because MkLinux only supported shared libraries with the
+ # GNU dynamic linker. Since this was broken with cross compilers,
+ # most powerpc-linux boxes support dynamic linking these days and
+ # people can always --disable-shared, the test was removed, and we
+ # assume the GNU/Linux dynamic linker is in use.
+ dynamic_linker='GNU/Linux ld.so'
+ ;;
+
+netbsd*)
+ version_type=sunos
+ need_lib_prefix=no
+ need_version=no
+ if echo __ELF__ | $CC -E - | $GREP __ELF__ >/dev/null; then
+ library_names_spec='$libname$release$shared_ext$versuffix $libname$shared_ext$versuffix'
+ finish_cmds='PATH="\$PATH:/sbin" ldconfig -m $libdir'
+ dynamic_linker='NetBSD (a.out) ld.so'
+ else
+ library_names_spec='$libname$release$shared_ext$versuffix $libname$release$shared_ext$major $libname$shared_ext'
+ soname_spec='$libname$release$shared_ext$major'
+ dynamic_linker='NetBSD ld.elf_so'
+ fi
+ shlibpath_var=LD_LIBRARY_PATH
+ shlibpath_overrides_runpath=yes
+ hardcode_into_libs=yes
+ ;;
+
+newsos6)
+ version_type=linux # correct to gnu/linux during the next big refactor
+ library_names_spec='$libname$release$shared_ext$versuffix $libname$release$shared_ext$major $libname$shared_ext'
+ shlibpath_var=LD_LIBRARY_PATH
+ shlibpath_overrides_runpath=yes
+ ;;
+
+*nto* | *qnx*)
+ version_type=qnx
+ need_lib_prefix=no
+ need_version=no
+ library_names_spec='$libname$release$shared_ext$versuffix $libname$release$shared_ext$major $libname$shared_ext'
+ soname_spec='$libname$release$shared_ext$major'
+ shlibpath_var=LD_LIBRARY_PATH
+ shlibpath_overrides_runpath=no
+ hardcode_into_libs=yes
+ dynamic_linker='ldqnx.so'
+ ;;
+
+openbsd* | bitrig*)
+ version_type=sunos
+ sys_lib_dlsearch_path_spec=/usr/lib
+ need_lib_prefix=no
+ if test -z "`echo __ELF__ | $CC -E - | $GREP __ELF__`"; then
+ need_version=no
+ else
+ need_version=yes
+ fi
+ library_names_spec='$libname$release$shared_ext$versuffix $libname$shared_ext$versuffix'
+ finish_cmds='PATH="\$PATH:/sbin" ldconfig -m $libdir'
+ shlibpath_var=LD_LIBRARY_PATH
+ shlibpath_overrides_runpath=yes
+ ;;
+
+os2*)
+ libname_spec='$name'
+ version_type=windows
+ shrext_cmds=.dll
+ need_version=no
+ need_lib_prefix=no
+ # OS/2 can only load a DLL with a base name of 8 characters or less.
+ soname_spec='`test -n "$os2dllname" && libname="$os2dllname";
+ v=$($ECHO $release$versuffix | tr -d .-);
+ n=$($ECHO $libname | cut -b -$((8 - ${#v})) | tr . _);
+ $ECHO $n$v`$shared_ext'
+ library_names_spec='${libname}_dll.$libext'
+ dynamic_linker='OS/2 ld.exe'
+ shlibpath_var=BEGINLIBPATH
+ sys_lib_search_path_spec="/lib /usr/lib /usr/local/lib"
+ sys_lib_dlsearch_path_spec=$sys_lib_search_path_spec
+ postinstall_cmds='base_file=`basename \$file`~
+ dlpath=`$SHELL 2>&1 -c '\''. $dir/'\''\$base_file'\''i; $ECHO \$dlname'\''`~
+ dldir=$destdir/`dirname \$dlpath`~
+ test -d \$dldir || mkdir -p \$dldir~
+ $install_prog $dir/$dlname \$dldir/$dlname~
+ chmod a+x \$dldir/$dlname~
+ if test -n '\''$stripme'\'' && test -n '\''$striplib'\''; then
+ eval '\''$striplib \$dldir/$dlname'\'' || exit \$?;
+ fi'
+ postuninstall_cmds='dldll=`$SHELL 2>&1 -c '\''. $file; $ECHO \$dlname'\''`~
+ dlpath=$dir/\$dldll~
+ $RM \$dlpath'
+ ;;
+
+osf3* | osf4* | osf5*)
+ version_type=osf
+ need_lib_prefix=no
+ need_version=no
+ soname_spec='$libname$release$shared_ext$major'
+ library_names_spec='$libname$release$shared_ext$versuffix $libname$release$shared_ext$major $libname$shared_ext'
+ shlibpath_var=LD_LIBRARY_PATH
+ sys_lib_search_path_spec="/usr/shlib /usr/ccs/lib /usr/lib/cmplrs/cc /usr/lib /usr/local/lib /var/shlib"
+ sys_lib_dlsearch_path_spec=$sys_lib_search_path_spec
+ ;;
+
+rdos*)
+ dynamic_linker=no
+ ;;
+
+solaris*)
+ version_type=linux # correct to gnu/linux during the next big refactor
+ need_lib_prefix=no
+ need_version=no
+ library_names_spec='$libname$release$shared_ext$versuffix $libname$release$shared_ext$major $libname$shared_ext'
+ soname_spec='$libname$release$shared_ext$major'
+ shlibpath_var=LD_LIBRARY_PATH
+ shlibpath_overrides_runpath=yes
+ hardcode_into_libs=yes
+ # ldd complains unless libraries are executable
+ postinstall_cmds='chmod +x $lib'
+ ;;
+
+sunos4*)
+ version_type=sunos
+ library_names_spec='$libname$release$shared_ext$versuffix $libname$shared_ext$versuffix'
+ finish_cmds='PATH="\$PATH:/usr/etc" ldconfig $libdir'
+ shlibpath_var=LD_LIBRARY_PATH
+ shlibpath_overrides_runpath=yes
+ if test yes = "$with_gnu_ld"; then
+ need_lib_prefix=no
+ fi
+ need_version=yes
+ ;;
+
+sysv4 | sysv4.3*)
+ version_type=linux # correct to gnu/linux during the next big refactor
+ library_names_spec='$libname$release$shared_ext$versuffix $libname$release$shared_ext$major $libname$shared_ext'
+ soname_spec='$libname$release$shared_ext$major'
+ shlibpath_var=LD_LIBRARY_PATH
+ case $host_vendor in
+ sni)
+ shlibpath_overrides_runpath=no
+ need_lib_prefix=no
+ runpath_var=LD_RUN_PATH
+ ;;
+ siemens)
+ need_lib_prefix=no
+ ;;
+ motorola)
+ need_lib_prefix=no
+ need_version=no
+ shlibpath_overrides_runpath=no
+ sys_lib_search_path_spec='/lib /usr/lib /usr/ccs/lib'
+ ;;
+ esac
+ ;;
+
+sysv4*MP*)
+ if test -d /usr/nec; then
+ version_type=linux # correct to gnu/linux during the next big refactor
+ library_names_spec='$libname$shared_ext.$versuffix $libname$shared_ext.$major $libname$shared_ext'
+ soname_spec='$libname$shared_ext.$major'
+ shlibpath_var=LD_LIBRARY_PATH
+ fi
+ ;;
+
+sysv5* | sco3.2v5* | sco5v6* | unixware* | OpenUNIX* | sysv4*uw2*)
+ version_type=sco
+ need_lib_prefix=no
+ need_version=no
+ library_names_spec='$libname$release$shared_ext$versuffix $libname$release$shared_ext $libname$shared_ext'
+ soname_spec='$libname$release$shared_ext$major'
+ shlibpath_var=LD_LIBRARY_PATH
+ shlibpath_overrides_runpath=yes
+ hardcode_into_libs=yes
+ if test yes = "$with_gnu_ld"; then
+ sys_lib_search_path_spec='/usr/local/lib /usr/gnu/lib /usr/ccs/lib /usr/lib /lib'
+ else
+ sys_lib_search_path_spec='/usr/ccs/lib /usr/lib'
+ case $host_os in
+ sco3.2v5*)
+ sys_lib_search_path_spec="$sys_lib_search_path_spec /lib"
+ ;;
+ esac
+ fi
+ sys_lib_dlsearch_path_spec='/usr/lib'
+ ;;
+
+tpf*)
+ # TPF is a cross-target only. Preferred cross-host = GNU/Linux.
+ version_type=linux # correct to gnu/linux during the next big refactor
+ need_lib_prefix=no
+ need_version=no
+ library_names_spec='$libname$release$shared_ext$versuffix $libname$release$shared_ext$major $libname$shared_ext'
+ shlibpath_var=LD_LIBRARY_PATH
+ shlibpath_overrides_runpath=no
+ hardcode_into_libs=yes
+ ;;
+
+uts4*)
+ version_type=linux # correct to gnu/linux during the next big refactor
+ library_names_spec='$libname$release$shared_ext$versuffix $libname$release$shared_ext$major $libname$shared_ext'
+ soname_spec='$libname$release$shared_ext$major'
+ shlibpath_var=LD_LIBRARY_PATH
+ ;;
+
+*)
+ dynamic_linker=no
+ ;;
+esac
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $dynamic_linker" >&5
+$as_echo "$dynamic_linker" >&6; }
+test no = "$dynamic_linker" && can_build_shared=no
+
+variables_saved_for_relink="PATH $shlibpath_var $runpath_var"
+if test yes = "$GCC"; then
+ variables_saved_for_relink="$variables_saved_for_relink GCC_EXEC_PREFIX COMPILER_PATH LIBRARY_PATH"
+fi
+
+if test set = "${lt_cv_sys_lib_search_path_spec+set}"; then
+ sys_lib_search_path_spec=$lt_cv_sys_lib_search_path_spec
+fi
+
+if test set = "${lt_cv_sys_lib_dlsearch_path_spec+set}"; then
+ sys_lib_dlsearch_path_spec=$lt_cv_sys_lib_dlsearch_path_spec
+fi
+
+# remember unaugmented sys_lib_dlsearch_path content for libtool script decls...
+configure_time_dlsearch_path=$sys_lib_dlsearch_path_spec
+
+# ... but it needs LT_SYS_LIBRARY_PATH munging for other configure-time code
+func_munge_path_list sys_lib_dlsearch_path_spec "$LT_SYS_LIBRARY_PATH"
+
+# to be used as default LT_SYS_LIBRARY_PATH value in generated libtool
+configure_time_lt_sys_library_path=$LT_SYS_LIBRARY_PATH
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ { $as_echo "$as_me:${as_lineno-$LINENO}: checking how to hardcode library paths into programs" >&5
+$as_echo_n "checking how to hardcode library paths into programs... " >&6; }
+hardcode_action=
+if test -n "$hardcode_libdir_flag_spec" ||
+ test -n "$runpath_var" ||
+ test yes = "$hardcode_automatic"; then
+
+ # We can hardcode non-existent directories.
+ if test no != "$hardcode_direct" &&
+ # If the only mechanism to avoid hardcoding is shlibpath_var, we
+ # have to relink, otherwise we might link with an installed library
+ # when we should be linking with a yet-to-be-installed one
+ ## test no != "$_LT_TAGVAR(hardcode_shlibpath_var, )" &&
+ test no != "$hardcode_minus_L"; then
+ # Linking always hardcodes the temporary library directory.
+ hardcode_action=relink
+ else
+ # We can link without hardcoding, and we can hardcode nonexisting dirs.
+ hardcode_action=immediate
+ fi
+else
+ # We cannot hardcode anything, or else we can only hardcode existing
+ # directories.
+ hardcode_action=unsupported
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $hardcode_action" >&5
+$as_echo "$hardcode_action" >&6; }
+
+if test relink = "$hardcode_action" ||
+ test yes = "$inherit_rpath"; then
+ # Fast installation is not supported
+ enable_fast_install=no
+elif test yes = "$shlibpath_overrides_runpath" ||
+ test no = "$enable_shared"; then
+ # Fast installation is not necessary
+ enable_fast_install=needless
+fi
+
+
+
+
+
+
+ if test yes != "$enable_dlopen"; then
+ enable_dlopen=unknown
+ enable_dlopen_self=unknown
+ enable_dlopen_self_static=unknown
+else
+ lt_cv_dlopen=no
+ lt_cv_dlopen_libs=
+
+ case $host_os in
+ beos*)
+ lt_cv_dlopen=load_add_on
+ lt_cv_dlopen_libs=
+ lt_cv_dlopen_self=yes
+ ;;
+
+ mingw* | pw32* | cegcc*)
+ lt_cv_dlopen=LoadLibrary
+ lt_cv_dlopen_libs=
+ ;;
+
+ cygwin*)
+ lt_cv_dlopen=dlopen
+ lt_cv_dlopen_libs=
+ ;;
+
+ darwin*)
+ # if libdl is installed we need to link against it
+ { $as_echo "$as_me:${as_lineno-$LINENO}: checking for dlopen in -ldl" >&5
+$as_echo_n "checking for dlopen in -ldl... " >&6; }
+if ${ac_cv_lib_dl_dlopen+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ ac_check_lib_save_LIBS=$LIBS
+LIBS="-ldl $LIBS"
+cat confdefs.h - <<_ACEOF >conftest.$ac_ext
+/* end confdefs.h. */
+
+/* Override any GCC internal prototype to avoid an error.
+ Use char because int might match the return type of a GCC
+ builtin and then its argument prototype would still apply. */
+#ifdef __cplusplus
+extern "C"
+#endif
+char dlopen ();
+int
+main ()
+{
+return dlopen ();
+ ;
+ return 0;
+}
+_ACEOF
+if ac_fn_c_try_link "$LINENO"; then :
+ ac_cv_lib_dl_dlopen=yes
+else
+ ac_cv_lib_dl_dlopen=no
+fi
+rm -f core conftest.err conftest.$ac_objext \
+ conftest$ac_exeext conftest.$ac_ext
+LIBS=$ac_check_lib_save_LIBS
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_cv_lib_dl_dlopen" >&5
+$as_echo "$ac_cv_lib_dl_dlopen" >&6; }
+if test "x$ac_cv_lib_dl_dlopen" = xyes; then :
+ lt_cv_dlopen=dlopen lt_cv_dlopen_libs=-ldl
+else
+
+ lt_cv_dlopen=dyld
+ lt_cv_dlopen_libs=
+ lt_cv_dlopen_self=yes
+
+fi
+
+ ;;
+
+ tpf*)
+ # Don't try to run any link tests for TPF. We know it's impossible
+ # because TPF is a cross-compiler, and we know how we open DSOs.
+ lt_cv_dlopen=dlopen
+ lt_cv_dlopen_libs=
+ lt_cv_dlopen_self=no
+ ;;
+
+ *)
+ ac_fn_c_check_func "$LINENO" "shl_load" "ac_cv_func_shl_load"
+if test "x$ac_cv_func_shl_load" = xyes; then :
+ lt_cv_dlopen=shl_load
+else
+ { $as_echo "$as_me:${as_lineno-$LINENO}: checking for shl_load in -ldld" >&5
+$as_echo_n "checking for shl_load in -ldld... " >&6; }
+if ${ac_cv_lib_dld_shl_load+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ ac_check_lib_save_LIBS=$LIBS
+LIBS="-ldld $LIBS"
+cat confdefs.h - <<_ACEOF >conftest.$ac_ext
+/* end confdefs.h. */
+
+/* Override any GCC internal prototype to avoid an error.
+ Use char because int might match the return type of a GCC
+ builtin and then its argument prototype would still apply. */
+#ifdef __cplusplus
+extern "C"
+#endif
+char shl_load ();
+int
+main ()
+{
+return shl_load ();
+ ;
+ return 0;
+}
+_ACEOF
+if ac_fn_c_try_link "$LINENO"; then :
+ ac_cv_lib_dld_shl_load=yes
+else
+ ac_cv_lib_dld_shl_load=no
+fi
+rm -f core conftest.err conftest.$ac_objext \
+ conftest$ac_exeext conftest.$ac_ext
+LIBS=$ac_check_lib_save_LIBS
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_cv_lib_dld_shl_load" >&5
+$as_echo "$ac_cv_lib_dld_shl_load" >&6; }
+if test "x$ac_cv_lib_dld_shl_load" = xyes; then :
+ lt_cv_dlopen=shl_load lt_cv_dlopen_libs=-ldld
+else
+ ac_fn_c_check_func "$LINENO" "dlopen" "ac_cv_func_dlopen"
+if test "x$ac_cv_func_dlopen" = xyes; then :
+ lt_cv_dlopen=dlopen
+else
+ { $as_echo "$as_me:${as_lineno-$LINENO}: checking for dlopen in -ldl" >&5
+$as_echo_n "checking for dlopen in -ldl... " >&6; }
+if ${ac_cv_lib_dl_dlopen+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ ac_check_lib_save_LIBS=$LIBS
+LIBS="-ldl $LIBS"
+cat confdefs.h - <<_ACEOF >conftest.$ac_ext
+/* end confdefs.h. */
+
+/* Override any GCC internal prototype to avoid an error.
+ Use char because int might match the return type of a GCC
+ builtin and then its argument prototype would still apply. */
+#ifdef __cplusplus
+extern "C"
+#endif
+char dlopen ();
+int
+main ()
+{
+return dlopen ();
+ ;
+ return 0;
+}
+_ACEOF
+if ac_fn_c_try_link "$LINENO"; then :
+ ac_cv_lib_dl_dlopen=yes
+else
+ ac_cv_lib_dl_dlopen=no
+fi
+rm -f core conftest.err conftest.$ac_objext \
+ conftest$ac_exeext conftest.$ac_ext
+LIBS=$ac_check_lib_save_LIBS
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_cv_lib_dl_dlopen" >&5
+$as_echo "$ac_cv_lib_dl_dlopen" >&6; }
+if test "x$ac_cv_lib_dl_dlopen" = xyes; then :
+ lt_cv_dlopen=dlopen lt_cv_dlopen_libs=-ldl
+else
+ { $as_echo "$as_me:${as_lineno-$LINENO}: checking for dlopen in -lsvld" >&5
+$as_echo_n "checking for dlopen in -lsvld... " >&6; }
+if ${ac_cv_lib_svld_dlopen+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ ac_check_lib_save_LIBS=$LIBS
+LIBS="-lsvld $LIBS"
+cat confdefs.h - <<_ACEOF >conftest.$ac_ext
+/* end confdefs.h. */
+
+/* Override any GCC internal prototype to avoid an error.
+ Use char because int might match the return type of a GCC
+ builtin and then its argument prototype would still apply. */
+#ifdef __cplusplus
+extern "C"
+#endif
+char dlopen ();
+int
+main ()
+{
+return dlopen ();
+ ;
+ return 0;
+}
+_ACEOF
+if ac_fn_c_try_link "$LINENO"; then :
+ ac_cv_lib_svld_dlopen=yes
+else
+ ac_cv_lib_svld_dlopen=no
+fi
+rm -f core conftest.err conftest.$ac_objext \
+ conftest$ac_exeext conftest.$ac_ext
+LIBS=$ac_check_lib_save_LIBS
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_cv_lib_svld_dlopen" >&5
+$as_echo "$ac_cv_lib_svld_dlopen" >&6; }
+if test "x$ac_cv_lib_svld_dlopen" = xyes; then :
+ lt_cv_dlopen=dlopen lt_cv_dlopen_libs=-lsvld
+else
+ { $as_echo "$as_me:${as_lineno-$LINENO}: checking for dld_link in -ldld" >&5
+$as_echo_n "checking for dld_link in -ldld... " >&6; }
+if ${ac_cv_lib_dld_dld_link+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ ac_check_lib_save_LIBS=$LIBS
+LIBS="-ldld $LIBS"
+cat confdefs.h - <<_ACEOF >conftest.$ac_ext
+/* end confdefs.h. */
+
+/* Override any GCC internal prototype to avoid an error.
+ Use char because int might match the return type of a GCC
+ builtin and then its argument prototype would still apply. */
+#ifdef __cplusplus
+extern "C"
+#endif
+char dld_link ();
+int
+main ()
+{
+return dld_link ();
+ ;
+ return 0;
+}
+_ACEOF
+if ac_fn_c_try_link "$LINENO"; then :
+ ac_cv_lib_dld_dld_link=yes
+else
+ ac_cv_lib_dld_dld_link=no
+fi
+rm -f core conftest.err conftest.$ac_objext \
+ conftest$ac_exeext conftest.$ac_ext
+LIBS=$ac_check_lib_save_LIBS
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_cv_lib_dld_dld_link" >&5
+$as_echo "$ac_cv_lib_dld_dld_link" >&6; }
+if test "x$ac_cv_lib_dld_dld_link" = xyes; then :
+ lt_cv_dlopen=dld_link lt_cv_dlopen_libs=-ldld
+fi
+
+
+fi
+
+
+fi
+
+
+fi
+
+
+fi
+
+
+fi
+
+ ;;
+ esac
+
+ if test no = "$lt_cv_dlopen"; then
+ enable_dlopen=no
+ else
+ enable_dlopen=yes
+ fi
+
+ case $lt_cv_dlopen in
+ dlopen)
+ save_CPPFLAGS=$CPPFLAGS
+ test yes = "$ac_cv_header_dlfcn_h" && CPPFLAGS="$CPPFLAGS -DHAVE_DLFCN_H"
+
+ save_LDFLAGS=$LDFLAGS
+ wl=$lt_prog_compiler_wl eval LDFLAGS=\"\$LDFLAGS $export_dynamic_flag_spec\"
+
+ save_LIBS=$LIBS
+ LIBS="$lt_cv_dlopen_libs $LIBS"
+
+ { $as_echo "$as_me:${as_lineno-$LINENO}: checking whether a program can dlopen itself" >&5
+$as_echo_n "checking whether a program can dlopen itself... " >&6; }
+if ${lt_cv_dlopen_self+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ if test yes = "$cross_compiling"; then :
+ lt_cv_dlopen_self=cross
+else
+ lt_dlunknown=0; lt_dlno_uscore=1; lt_dlneed_uscore=2
+ lt_status=$lt_dlunknown
+ cat > conftest.$ac_ext <<_LT_EOF
+#line $LINENO "configure"
+#include "confdefs.h"
+
+#if HAVE_DLFCN_H
+#include <dlfcn.h>
+#endif
+
+#include <stdio.h>
+
+#ifdef RTLD_GLOBAL
+# define LT_DLGLOBAL RTLD_GLOBAL
+#else
+# ifdef DL_GLOBAL
+# define LT_DLGLOBAL DL_GLOBAL
+# else
+# define LT_DLGLOBAL 0
+# endif
+#endif
+
+/* We may have to define LT_DLLAZY_OR_NOW in the command line if we
+ find out it does not work in some platform. */
+#ifndef LT_DLLAZY_OR_NOW
+# ifdef RTLD_LAZY
+# define LT_DLLAZY_OR_NOW RTLD_LAZY
+# else
+# ifdef DL_LAZY
+# define LT_DLLAZY_OR_NOW DL_LAZY
+# else
+# ifdef RTLD_NOW
+# define LT_DLLAZY_OR_NOW RTLD_NOW
+# else
+# ifdef DL_NOW
+# define LT_DLLAZY_OR_NOW DL_NOW
+# else
+# define LT_DLLAZY_OR_NOW 0
+# endif
+# endif
+# endif
+# endif
+#endif
+
+/* When -fvisibility=hidden is used, assume the code has been annotated
+ correspondingly for the symbols needed. */
+#if defined __GNUC__ && (((__GNUC__ == 3) && (__GNUC_MINOR__ >= 3)) || (__GNUC__ > 3))
+int fnord () __attribute__((visibility("default")));
+#endif
+
+int fnord () { return 42; }
+int main ()
+{
+ void *self = dlopen (0, LT_DLGLOBAL|LT_DLLAZY_OR_NOW);
+ int status = $lt_dlunknown;
+
+ if (self)
+ {
+ if (dlsym (self,"fnord")) status = $lt_dlno_uscore;
+ else
+ {
+ if (dlsym( self,"_fnord")) status = $lt_dlneed_uscore;
+ else puts (dlerror ());
+ }
+ /* dlclose (self); */
+ }
+ else
+ puts (dlerror ());
+
+ return status;
+}
+_LT_EOF
+ if { { eval echo "\"\$as_me\":${as_lineno-$LINENO}: \"$ac_link\""; } >&5
+ (eval $ac_link) 2>&5
+ ac_status=$?
+ $as_echo "$as_me:${as_lineno-$LINENO}: \$? = $ac_status" >&5
+ test $ac_status = 0; } && test -s "conftest$ac_exeext" 2>/dev/null; then
+ (./conftest; exit; ) >&5 2>/dev/null
+ lt_status=$?
+ case x$lt_status in
+ x$lt_dlno_uscore) lt_cv_dlopen_self=yes ;;
+ x$lt_dlneed_uscore) lt_cv_dlopen_self=yes ;;
+ x$lt_dlunknown|x*) lt_cv_dlopen_self=no ;;
+ esac
+ else :
+ # compilation failed
+ lt_cv_dlopen_self=no
+ fi
+fi
+rm -fr conftest*
+
+
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $lt_cv_dlopen_self" >&5
+$as_echo "$lt_cv_dlopen_self" >&6; }
+
+ if test yes = "$lt_cv_dlopen_self"; then
+ wl=$lt_prog_compiler_wl eval LDFLAGS=\"\$LDFLAGS $lt_prog_compiler_static\"
+ { $as_echo "$as_me:${as_lineno-$LINENO}: checking whether a statically linked program can dlopen itself" >&5
+$as_echo_n "checking whether a statically linked program can dlopen itself... " >&6; }
+if ${lt_cv_dlopen_self_static+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ if test yes = "$cross_compiling"; then :
+ lt_cv_dlopen_self_static=cross
+else
+ lt_dlunknown=0; lt_dlno_uscore=1; lt_dlneed_uscore=2
+ lt_status=$lt_dlunknown
+ cat > conftest.$ac_ext <<_LT_EOF
+#line $LINENO "configure"
+#include "confdefs.h"
+
+#if HAVE_DLFCN_H
+#include <dlfcn.h>
+#endif
+
+#include <stdio.h>
+
+#ifdef RTLD_GLOBAL
+# define LT_DLGLOBAL RTLD_GLOBAL
+#else
+# ifdef DL_GLOBAL
+# define LT_DLGLOBAL DL_GLOBAL
+# else
+# define LT_DLGLOBAL 0
+# endif
+#endif
+
+/* We may have to define LT_DLLAZY_OR_NOW in the command line if we
+ find out it does not work in some platform. */
+#ifndef LT_DLLAZY_OR_NOW
+# ifdef RTLD_LAZY
+# define LT_DLLAZY_OR_NOW RTLD_LAZY
+# else
+# ifdef DL_LAZY
+# define LT_DLLAZY_OR_NOW DL_LAZY
+# else
+# ifdef RTLD_NOW
+# define LT_DLLAZY_OR_NOW RTLD_NOW
+# else
+# ifdef DL_NOW
+# define LT_DLLAZY_OR_NOW DL_NOW
+# else
+# define LT_DLLAZY_OR_NOW 0
+# endif
+# endif
+# endif
+# endif
+#endif
+
+/* When -fvisibility=hidden is used, assume the code has been annotated
+ correspondingly for the symbols needed. */
+#if defined __GNUC__ && (((__GNUC__ == 3) && (__GNUC_MINOR__ >= 3)) || (__GNUC__ > 3))
+int fnord () __attribute__((visibility("default")));
+#endif
+
+int fnord () { return 42; }
+int main ()
+{
+ void *self = dlopen (0, LT_DLGLOBAL|LT_DLLAZY_OR_NOW);
+ int status = $lt_dlunknown;
+
+ if (self)
+ {
+ if (dlsym (self,"fnord")) status = $lt_dlno_uscore;
+ else
+ {
+ if (dlsym( self,"_fnord")) status = $lt_dlneed_uscore;
+ else puts (dlerror ());
+ }
+ /* dlclose (self); */
+ }
+ else
+ puts (dlerror ());
+
+ return status;
+}
+_LT_EOF
+ if { { eval echo "\"\$as_me\":${as_lineno-$LINENO}: \"$ac_link\""; } >&5
+ (eval $ac_link) 2>&5
+ ac_status=$?
+ $as_echo "$as_me:${as_lineno-$LINENO}: \$? = $ac_status" >&5
+ test $ac_status = 0; } && test -s "conftest$ac_exeext" 2>/dev/null; then
+ (./conftest; exit; ) >&5 2>/dev/null
+ lt_status=$?
+ case x$lt_status in
+ x$lt_dlno_uscore) lt_cv_dlopen_self_static=yes ;;
+ x$lt_dlneed_uscore) lt_cv_dlopen_self_static=yes ;;
+ x$lt_dlunknown|x*) lt_cv_dlopen_self_static=no ;;
+ esac
+ else :
+ # compilation failed
+ lt_cv_dlopen_self_static=no
+ fi
+fi
+rm -fr conftest*
+
+
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $lt_cv_dlopen_self_static" >&5
+$as_echo "$lt_cv_dlopen_self_static" >&6; }
+ fi
+
+ CPPFLAGS=$save_CPPFLAGS
+ LDFLAGS=$save_LDFLAGS
+ LIBS=$save_LIBS
+ ;;
+ esac
+
+ case $lt_cv_dlopen_self in
+ yes|no) enable_dlopen_self=$lt_cv_dlopen_self ;;
+ *) enable_dlopen_self=unknown ;;
+ esac
+
+ case $lt_cv_dlopen_self_static in
+ yes|no) enable_dlopen_self_static=$lt_cv_dlopen_self_static ;;
+ *) enable_dlopen_self_static=unknown ;;
+ esac
+fi
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+striplib=
+old_striplib=
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking whether stripping libraries is possible" >&5
+$as_echo_n "checking whether stripping libraries is possible... " >&6; }
+if test -n "$STRIP" && $STRIP -V 2>&1 | $GREP "GNU strip" >/dev/null; then
+ test -z "$old_striplib" && old_striplib="$STRIP --strip-debug"
+ test -z "$striplib" && striplib="$STRIP --strip-unneeded"
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: yes" >&5
+$as_echo "yes" >&6; }
+else
+# FIXME - insert some real tests, host_os isn't really good enough
+ case $host_os in
+ darwin*)
+ if test -n "$STRIP"; then
+ striplib="$STRIP -x"
+ old_striplib="$STRIP -S"
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: yes" >&5
+$as_echo "yes" >&6; }
+ else
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5
+$as_echo "no" >&6; }
+ fi
+ ;;
+ *)
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5
+$as_echo "no" >&6; }
+ ;;
+ esac
+fi
+
+
+
+
+
+
+
+
+
+
+
+
+ # Report what library types will actually be built
+ { $as_echo "$as_me:${as_lineno-$LINENO}: checking if libtool supports shared libraries" >&5
+$as_echo_n "checking if libtool supports shared libraries... " >&6; }
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: $can_build_shared" >&5
+$as_echo "$can_build_shared" >&6; }
+
+ { $as_echo "$as_me:${as_lineno-$LINENO}: checking whether to build shared libraries" >&5
+$as_echo_n "checking whether to build shared libraries... " >&6; }
+ test no = "$can_build_shared" && enable_shared=no
+
+ # On AIX, shared libraries and static libraries use the same namespace, and
+ # are all built from PIC.
+ case $host_os in
+ aix3*)
+ test yes = "$enable_shared" && enable_static=no
+ if test -n "$RANLIB"; then
+ archive_cmds="$archive_cmds~\$RANLIB \$lib"
+ postinstall_cmds='$RANLIB $lib'
+ fi
+ ;;
+
+ aix[4-9]*)
+ if test ia64 != "$host_cpu"; then
+ case $enable_shared,$with_aix_soname,$aix_use_runtimelinking in
+ yes,aix,yes) ;; # shared object as lib.so file only
+ yes,svr4,*) ;; # shared object as lib.so archive member only
+ yes,*) enable_static=no ;; # shared object in lib.a archive as well
+ esac
+ fi
+ ;;
+ esac
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: $enable_shared" >&5
+$as_echo "$enable_shared" >&6; }
+
+ { $as_echo "$as_me:${as_lineno-$LINENO}: checking whether to build static libraries" >&5
+$as_echo_n "checking whether to build static libraries... " >&6; }
+ # Make sure either enable_shared or enable_static is yes.
+ test yes = "$enable_shared" || enable_static=yes
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: $enable_static" >&5
+$as_echo "$enable_static" >&6; }
+
+
+
+
+fi
+ac_ext=c
+ac_cpp='$CPP $CPPFLAGS'
+ac_compile='$CC -c $CFLAGS $CPPFLAGS conftest.$ac_ext >&5'
+ac_link='$CC -o conftest$ac_exeext $CFLAGS $CPPFLAGS $LDFLAGS conftest.$ac_ext $LIBS >&5'
+ac_compiler_gnu=$ac_cv_c_compiler_gnu
+
+CC=$lt_save_CC
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ ac_config_commands="$ac_config_commands libtool"
+
+
+
+
+# Only expand once:
+
+
+# Check whether --enable-largefile was given.
+if test "${enable_largefile+set}" = set; then :
+ enableval=$enable_largefile;
+fi
+
+if test "$enable_largefile" != no; then
+
+ { $as_echo "$as_me:${as_lineno-$LINENO}: checking for special C compiler options needed for large files" >&5
+$as_echo_n "checking for special C compiler options needed for large files... " >&6; }
+if ${ac_cv_sys_largefile_CC+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ ac_cv_sys_largefile_CC=no
+ if test "$GCC" != yes; then
+ ac_save_CC=$CC
+ while :; do
+ # IRIX 6.2 and later do not support large files by default,
+ # so use the C compiler's -n32 option if that helps.
+ cat confdefs.h - <<_ACEOF >conftest.$ac_ext
+/* end confdefs.h. */
+#include <sys/types.h>
+ /* Check that off_t can represent 2**63 - 1 correctly.
+ We can't simply define LARGE_OFF_T to be 9223372036854775807,
+ since some C++ compilers masquerading as C compilers
+ incorrectly reject 9223372036854775807. */
+#define LARGE_OFF_T (((off_t) 1 << 62) - 1 + ((off_t) 1 << 62))
+ int off_t_is_large[(LARGE_OFF_T % 2147483629 == 721
+ && LARGE_OFF_T % 2147483647 == 1)
+ ? 1 : -1];
+int
+main ()
+{
+
+ ;
+ return 0;
+}
+_ACEOF
+ if ac_fn_c_try_compile "$LINENO"; then :
+ break
+fi
+rm -f core conftest.err conftest.$ac_objext
+ CC="$CC -n32"
+ if ac_fn_c_try_compile "$LINENO"; then :
+ ac_cv_sys_largefile_CC=' -n32'; break
+fi
+rm -f core conftest.err conftest.$ac_objext
+ break
+ done
+ CC=$ac_save_CC
+ rm -f conftest.$ac_ext
+ fi
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_cv_sys_largefile_CC" >&5
+$as_echo "$ac_cv_sys_largefile_CC" >&6; }
+ if test "$ac_cv_sys_largefile_CC" != no; then
+ CC=$CC$ac_cv_sys_largefile_CC
+ fi
+
+ { $as_echo "$as_me:${as_lineno-$LINENO}: checking for _FILE_OFFSET_BITS value needed for large files" >&5
+$as_echo_n "checking for _FILE_OFFSET_BITS value needed for large files... " >&6; }
+if ${ac_cv_sys_file_offset_bits+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ while :; do
+ cat confdefs.h - <<_ACEOF >conftest.$ac_ext
+/* end confdefs.h. */
+#include <sys/types.h>
+ /* Check that off_t can represent 2**63 - 1 correctly.
+ We can't simply define LARGE_OFF_T to be 9223372036854775807,
+ since some C++ compilers masquerading as C compilers
+ incorrectly reject 9223372036854775807. */
+#define LARGE_OFF_T (((off_t) 1 << 62) - 1 + ((off_t) 1 << 62))
+ int off_t_is_large[(LARGE_OFF_T % 2147483629 == 721
+ && LARGE_OFF_T % 2147483647 == 1)
+ ? 1 : -1];
+int
+main ()
+{
+
+ ;
+ return 0;
+}
+_ACEOF
+if ac_fn_c_try_compile "$LINENO"; then :
+ ac_cv_sys_file_offset_bits=no; break
+fi
+rm -f core conftest.err conftest.$ac_objext conftest.$ac_ext
+ cat confdefs.h - <<_ACEOF >conftest.$ac_ext
+/* end confdefs.h. */
+#define _FILE_OFFSET_BITS 64
+#include <sys/types.h>
+ /* Check that off_t can represent 2**63 - 1 correctly.
+ We can't simply define LARGE_OFF_T to be 9223372036854775807,
+ since some C++ compilers masquerading as C compilers
+ incorrectly reject 9223372036854775807. */
+#define LARGE_OFF_T (((off_t) 1 << 62) - 1 + ((off_t) 1 << 62))
+ int off_t_is_large[(LARGE_OFF_T % 2147483629 == 721
+ && LARGE_OFF_T % 2147483647 == 1)
+ ? 1 : -1];
+int
+main ()
+{
+
+ ;
+ return 0;
+}
+_ACEOF
+if ac_fn_c_try_compile "$LINENO"; then :
+ ac_cv_sys_file_offset_bits=64; break
+fi
+rm -f core conftest.err conftest.$ac_objext conftest.$ac_ext
+ ac_cv_sys_file_offset_bits=unknown
+ break
+done
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_cv_sys_file_offset_bits" >&5
+$as_echo "$ac_cv_sys_file_offset_bits" >&6; }
+case $ac_cv_sys_file_offset_bits in #(
+ no | unknown) ;;
+ *)
+cat >>confdefs.h <<_ACEOF
+#define _FILE_OFFSET_BITS $ac_cv_sys_file_offset_bits
+_ACEOF
+;;
+esac
+rm -rf conftest*
+ if test $ac_cv_sys_file_offset_bits = unknown; then
+ { $as_echo "$as_me:${as_lineno-$LINENO}: checking for _LARGE_FILES value needed for large files" >&5
+$as_echo_n "checking for _LARGE_FILES value needed for large files... " >&6; }
+if ${ac_cv_sys_large_files+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ while :; do
+ cat confdefs.h - <<_ACEOF >conftest.$ac_ext
+/* end confdefs.h. */
+#include <sys/types.h>
+ /* Check that off_t can represent 2**63 - 1 correctly.
+ We can't simply define LARGE_OFF_T to be 9223372036854775807,
+ since some C++ compilers masquerading as C compilers
+ incorrectly reject 9223372036854775807. */
+#define LARGE_OFF_T (((off_t) 1 << 62) - 1 + ((off_t) 1 << 62))
+ int off_t_is_large[(LARGE_OFF_T % 2147483629 == 721
+ && LARGE_OFF_T % 2147483647 == 1)
+ ? 1 : -1];
+int
+main ()
+{
+
+ ;
+ return 0;
+}
+_ACEOF
+if ac_fn_c_try_compile "$LINENO"; then :
+ ac_cv_sys_large_files=no; break
+fi
+rm -f core conftest.err conftest.$ac_objext conftest.$ac_ext
+ cat confdefs.h - <<_ACEOF >conftest.$ac_ext
+/* end confdefs.h. */
+#define _LARGE_FILES 1
+#include <sys/types.h>
+ /* Check that off_t can represent 2**63 - 1 correctly.
+ We can't simply define LARGE_OFF_T to be 9223372036854775807,
+ since some C++ compilers masquerading as C compilers
+ incorrectly reject 9223372036854775807. */
+#define LARGE_OFF_T (((off_t) 1 << 62) - 1 + ((off_t) 1 << 62))
+ int off_t_is_large[(LARGE_OFF_T % 2147483629 == 721
+ && LARGE_OFF_T % 2147483647 == 1)
+ ? 1 : -1];
+int
+main ()
+{
+
+ ;
+ return 0;
+}
+_ACEOF
+if ac_fn_c_try_compile "$LINENO"; then :
+ ac_cv_sys_large_files=1; break
+fi
+rm -f core conftest.err conftest.$ac_objext conftest.$ac_ext
+ ac_cv_sys_large_files=unknown
+ break
+done
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_cv_sys_large_files" >&5
+$as_echo "$ac_cv_sys_large_files" >&6; }
+case $ac_cv_sys_large_files in #(
+ no | unknown) ;;
+ *)
+cat >>confdefs.h <<_ACEOF
+#define _LARGE_FILES $ac_cv_sys_large_files
+_ACEOF
+;;
+esac
+rm -rf conftest*
+ fi
+
+
+fi
+
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for _LARGEFILE_SOURCE value needed for large files" >&5
+$as_echo_n "checking for _LARGEFILE_SOURCE value needed for large files... " >&6; }
+if ${ac_cv_sys_largefile_source+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ while :; do
+ cat confdefs.h - <<_ACEOF >conftest.$ac_ext
+/* end confdefs.h. */
+#include <sys/types.h> /* for off_t */
+ #include <stdio.h>
+int
+main ()
+{
+int (*fp) (FILE *, off_t, int) = fseeko;
+ return fseeko (stdin, 0, 0) && fp (stdin, 0, 0);
+ ;
+ return 0;
+}
+_ACEOF
+if ac_fn_c_try_link "$LINENO"; then :
+ ac_cv_sys_largefile_source=no; break
+fi
+rm -f core conftest.err conftest.$ac_objext \
+ conftest$ac_exeext conftest.$ac_ext
+ cat confdefs.h - <<_ACEOF >conftest.$ac_ext
+/* end confdefs.h. */
+#define _LARGEFILE_SOURCE 1
+#include <sys/types.h> /* for off_t */
+ #include <stdio.h>
+int
+main ()
+{
+int (*fp) (FILE *, off_t, int) = fseeko;
+ return fseeko (stdin, 0, 0) && fp (stdin, 0, 0);
+ ;
+ return 0;
+}
+_ACEOF
+if ac_fn_c_try_link "$LINENO"; then :
+ ac_cv_sys_largefile_source=1; break
+fi
+rm -f core conftest.err conftest.$ac_objext \
+ conftest$ac_exeext conftest.$ac_ext
+ ac_cv_sys_largefile_source=unknown
+ break
+done
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_cv_sys_largefile_source" >&5
+$as_echo "$ac_cv_sys_largefile_source" >&6; }
+case $ac_cv_sys_largefile_source in #(
+ no | unknown) ;;
+ *)
+cat >>confdefs.h <<_ACEOF
+#define _LARGEFILE_SOURCE $ac_cv_sys_largefile_source
+_ACEOF
+;;
+esac
+rm -rf conftest*
+
+# We used to try defining _XOPEN_SOURCE=500 too, to work around a bug
+# in glibc 2.1.3, but that breaks too many other things.
+# If you want fseeko and ftello with glibc, upgrade to a fixed glibc.
+if test $ac_cv_sys_largefile_source != unknown; then
+
+$as_echo "#define HAVE_FSEEKO 1" >>confdefs.h
+
+fi
+
+ac_header_dirent=no
+for ac_hdr in dirent.h sys/ndir.h sys/dir.h ndir.h; do
+ as_ac_Header=`$as_echo "ac_cv_header_dirent_$ac_hdr" | $as_tr_sh`
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $ac_hdr that defines DIR" >&5
+$as_echo_n "checking for $ac_hdr that defines DIR... " >&6; }
+if eval \${$as_ac_Header+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ cat confdefs.h - <<_ACEOF >conftest.$ac_ext
+/* end confdefs.h. */
+#include <sys/types.h>
+#include <$ac_hdr>
+
+int
+main ()
+{
+if ((DIR *) 0)
+return 0;
+ ;
+ return 0;
+}
+_ACEOF
+if ac_fn_c_try_compile "$LINENO"; then :
+ eval "$as_ac_Header=yes"
+else
+ eval "$as_ac_Header=no"
+fi
+rm -f core conftest.err conftest.$ac_objext conftest.$ac_ext
+fi
+eval ac_res=\$$as_ac_Header
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_res" >&5
+$as_echo "$ac_res" >&6; }
+if eval test \"x\$"$as_ac_Header"\" = x"yes"; then :
+ cat >>confdefs.h <<_ACEOF
+#define `$as_echo "HAVE_$ac_hdr" | $as_tr_cpp` 1
+_ACEOF
+
+ac_header_dirent=$ac_hdr; break
+fi
+
+done
+# Two versions of opendir et al. are in -ldir and -lx on SCO Xenix.
+if test $ac_header_dirent = dirent.h; then
+ { $as_echo "$as_me:${as_lineno-$LINENO}: checking for library containing opendir" >&5
+$as_echo_n "checking for library containing opendir... " >&6; }
+if ${ac_cv_search_opendir+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ ac_func_search_save_LIBS=$LIBS
+cat confdefs.h - <<_ACEOF >conftest.$ac_ext
+/* end confdefs.h. */
+
+/* Override any GCC internal prototype to avoid an error.
+ Use char because int might match the return type of a GCC
+ builtin and then its argument prototype would still apply. */
+#ifdef __cplusplus
+extern "C"
+#endif
+char opendir ();
+int
+main ()
+{
+return opendir ();
+ ;
+ return 0;
+}
+_ACEOF
+for ac_lib in '' dir; do
+ if test -z "$ac_lib"; then
+ ac_res="none required"
+ else
+ ac_res=-l$ac_lib
+ LIBS="-l$ac_lib $ac_func_search_save_LIBS"
+ fi
+ if ac_fn_c_try_link "$LINENO"; then :
+ ac_cv_search_opendir=$ac_res
+fi
+rm -f core conftest.err conftest.$ac_objext \
+ conftest$ac_exeext
+ if ${ac_cv_search_opendir+:} false; then :
+ break
+fi
+done
+if ${ac_cv_search_opendir+:} false; then :
+
+else
+ ac_cv_search_opendir=no
+fi
+rm conftest.$ac_ext
+LIBS=$ac_func_search_save_LIBS
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_cv_search_opendir" >&5
+$as_echo "$ac_cv_search_opendir" >&6; }
+ac_res=$ac_cv_search_opendir
+if test "$ac_res" != no; then :
+ test "$ac_res" = "none required" || LIBS="$ac_res $LIBS"
+
+fi
+
+else
+ { $as_echo "$as_me:${as_lineno-$LINENO}: checking for library containing opendir" >&5
+$as_echo_n "checking for library containing opendir... " >&6; }
+if ${ac_cv_search_opendir+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ ac_func_search_save_LIBS=$LIBS
+cat confdefs.h - <<_ACEOF >conftest.$ac_ext
+/* end confdefs.h. */
+
+/* Override any GCC internal prototype to avoid an error.
+ Use char because int might match the return type of a GCC
+ builtin and then its argument prototype would still apply. */
+#ifdef __cplusplus
+extern "C"
+#endif
+char opendir ();
+int
+main ()
+{
+return opendir ();
+ ;
+ return 0;
+}
+_ACEOF
+for ac_lib in '' x; do
+ if test -z "$ac_lib"; then
+ ac_res="none required"
+ else
+ ac_res=-l$ac_lib
+ LIBS="-l$ac_lib $ac_func_search_save_LIBS"
+ fi
+ if ac_fn_c_try_link "$LINENO"; then :
+ ac_cv_search_opendir=$ac_res
+fi
+rm -f core conftest.err conftest.$ac_objext \
+ conftest$ac_exeext
+ if ${ac_cv_search_opendir+:} false; then :
+ break
+fi
+done
+if ${ac_cv_search_opendir+:} false; then :
+
+else
+ ac_cv_search_opendir=no
+fi
+rm conftest.$ac_ext
+LIBS=$ac_func_search_save_LIBS
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_cv_search_opendir" >&5
+$as_echo "$ac_cv_search_opendir" >&6; }
+ac_res=$ac_cv_search_opendir
+if test "$ac_res" != no; then :
+ test "$ac_res" = "none required" || LIBS="$ac_res $LIBS"
+
+fi
+
+fi
+
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for ANSI C header files" >&5
+$as_echo_n "checking for ANSI C header files... " >&6; }
+if ${ac_cv_header_stdc+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ cat confdefs.h - <<_ACEOF >conftest.$ac_ext
+/* end confdefs.h. */
+#include <stdlib.h>
+#include <stdarg.h>
+#include <string.h>
+#include <float.h>
+
+int
+main ()
+{
+
+ ;
+ return 0;
+}
+_ACEOF
+if ac_fn_c_try_compile "$LINENO"; then :
+ ac_cv_header_stdc=yes
+else
+ ac_cv_header_stdc=no
+fi
+rm -f core conftest.err conftest.$ac_objext conftest.$ac_ext
+
+if test $ac_cv_header_stdc = yes; then
+ # SunOS 4.x string.h does not declare mem*, contrary to ANSI.
+ cat confdefs.h - <<_ACEOF >conftest.$ac_ext
+/* end confdefs.h. */
+#include <string.h>
+
+_ACEOF
+if (eval "$ac_cpp conftest.$ac_ext") 2>&5 |
+ $EGREP "memchr" >/dev/null 2>&1; then :
+
+else
+ ac_cv_header_stdc=no
+fi
+rm -f conftest*
+
+fi
+
+if test $ac_cv_header_stdc = yes; then
+ # ISC 2.0.2 stdlib.h does not declare free, contrary to ANSI.
+ cat confdefs.h - <<_ACEOF >conftest.$ac_ext
+/* end confdefs.h. */
+#include <stdlib.h>
+
+_ACEOF
+if (eval "$ac_cpp conftest.$ac_ext") 2>&5 |
+ $EGREP "free" >/dev/null 2>&1; then :
+
+else
+ ac_cv_header_stdc=no
+fi
+rm -f conftest*
+
+fi
+
+if test $ac_cv_header_stdc = yes; then
+ # /bin/cc in Irix-4.0.5 gets non-ANSI ctype macros unless using -ansi.
+ if test "$cross_compiling" = yes; then :
+ :
+else
+ cat confdefs.h - <<_ACEOF >conftest.$ac_ext
+/* end confdefs.h. */
+#include <ctype.h>
+#include <stdlib.h>
+#if ((' ' & 0x0FF) == 0x020)
+# define ISLOWER(c) ('a' <= (c) && (c) <= 'z')
+# define TOUPPER(c) (ISLOWER(c) ? 'A' + ((c) - 'a') : (c))
+#else
+# define ISLOWER(c) \
+ (('a' <= (c) && (c) <= 'i') \
+ || ('j' <= (c) && (c) <= 'r') \
+ || ('s' <= (c) && (c) <= 'z'))
+# define TOUPPER(c) (ISLOWER(c) ? ((c) | 0x40) : (c))
+#endif
+
+#define XOR(e, f) (((e) && !(f)) || (!(e) && (f)))
+int
+main ()
+{
+ int i;
+ for (i = 0; i < 256; i++)
+ if (XOR (islower (i), ISLOWER (i))
+ || toupper (i) != TOUPPER (i))
+ return 2;
+ return 0;
+}
+_ACEOF
+if ac_fn_c_try_run "$LINENO"; then :
+
+else
+ ac_cv_header_stdc=no
+fi
+rm -f core *.core core.conftest.* gmon.out bb.out conftest$ac_exeext \
+ conftest.$ac_objext conftest.beam conftest.$ac_ext
+fi
+
+fi
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_cv_header_stdc" >&5
+$as_echo "$ac_cv_header_stdc" >&6; }
+if test $ac_cv_header_stdc = yes; then
+
+$as_echo "#define STDC_HEADERS 1" >>confdefs.h
+
+fi
+
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking whether closedir returns void" >&5
+$as_echo_n "checking whether closedir returns void... " >&6; }
+if ${ac_cv_func_closedir_void+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ if test "$cross_compiling" = yes; then :
+ ac_cv_func_closedir_void=yes
+else
+ cat confdefs.h - <<_ACEOF >conftest.$ac_ext
+/* end confdefs.h. */
+$ac_includes_default
+#include <$ac_header_dirent>
+#ifndef __cplusplus
+int closedir ();
+#endif
+
+int
+main ()
+{
+return closedir (opendir (".")) != 0;
+ ;
+ return 0;
+}
+_ACEOF
+if ac_fn_c_try_run "$LINENO"; then :
+ ac_cv_func_closedir_void=no
+else
+ ac_cv_func_closedir_void=yes
+fi
+rm -f core *.core core.conftest.* gmon.out bb.out conftest$ac_exeext \
+ conftest.$ac_objext conftest.beam conftest.$ac_ext
+fi
+
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_cv_func_closedir_void" >&5
+$as_echo "$ac_cv_func_closedir_void" >&6; }
+if test $ac_cv_func_closedir_void = yes; then
+
+$as_echo "#define CLOSEDIR_VOID 1" >>confdefs.h
+
+fi
+
+for ac_header in assert.h float.h limits.h pwd.h stdlib.h sys/param.h
+do :
+ as_ac_Header=`$as_echo "ac_cv_header_$ac_header" | $as_tr_sh`
+ac_fn_c_check_header_mongrel "$LINENO" "$ac_header" "$as_ac_Header" "$ac_includes_default"
+if eval test \"x\$"$as_ac_Header"\" = x"yes"; then :
+ cat >>confdefs.h <<_ACEOF
+#define `$as_echo "HAVE_$ac_header" | $as_tr_cpp` 1
+_ACEOF
+
+fi
+
+done
+
+for ac_func in putenv
+do :
+ ac_fn_c_check_func "$LINENO" "putenv" "ac_cv_func_putenv"
+if test "x$ac_cv_func_putenv" = xyes; then :
+ cat >>confdefs.h <<_ACEOF
+#define HAVE_PUTENV 1
+_ACEOF
+
+fi
+done
+
+for ac_func in getcwd getwd memcmp memcpy mkstemp mktemp strchr strrchr
+do :
+ as_ac_var=`$as_echo "ac_cv_func_$ac_func" | $as_tr_sh`
+ac_fn_c_check_func "$LINENO" "$ac_func" "$as_ac_var"
+if eval test \"x\$"$as_ac_var"\" = x"yes"; then :
+ cat >>confdefs.h <<_ACEOF
+#define `$as_echo "HAVE_$ac_func" | $as_tr_cpp` 1
+_ACEOF
+
+fi
+done
+
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for an ANSI C-conforming const" >&5
+$as_echo_n "checking for an ANSI C-conforming const... " >&6; }
+if ${ac_cv_c_const+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ cat confdefs.h - <<_ACEOF >conftest.$ac_ext
+/* end confdefs.h. */
+
+int
+main ()
+{
+
+#ifndef __cplusplus
+ /* Ultrix mips cc rejects this sort of thing. */
+ typedef int charset[2];
+ const charset cs = { 0, 0 };
+ /* SunOS 4.1.1 cc rejects this. */
+ char const *const *pcpcc;
+ char **ppc;
+ /* NEC SVR4.0.2 mips cc rejects this. */
+ struct point {int x, y;};
+ static struct point const zero = {0,0};
+ /* AIX XL C 1.02.0.0 rejects this.
+ It does not let you subtract one const X* pointer from another in
+ an arm of an if-expression whose if-part is not a constant
+ expression */
+ const char *g = "string";
+ pcpcc = &g + (g ? g-g : 0);
+ /* HPUX 7.0 cc rejects these. */
+ ++pcpcc;
+ ppc = (char**) pcpcc;
+ pcpcc = (char const *const *) ppc;
+ { /* SCO 3.2v4 cc rejects this sort of thing. */
+ char tx;
+ char *t = &tx;
+ char const *s = 0 ? (char *) 0 : (char const *) 0;
+
+ *t++ = 0;
+ if (s) return 0;
+ }
+ { /* Someone thinks the Sun supposedly-ANSI compiler will reject this. */
+ int x[] = {25, 17};
+ const int *foo = &x[0];
+ ++foo;
+ }
+ { /* Sun SC1.0 ANSI compiler rejects this -- but not the above. */
+ typedef const int *iptr;
+ iptr p = 0;
+ ++p;
+ }
+ { /* AIX XL C 1.02.0.0 rejects this sort of thing, saying
+ "k.c", line 2.27: 1506-025 (S) Operand must be a modifiable lvalue. */
+ struct s { int j; const int *ap[3]; } bx;
+ struct s *b = &bx; b->j = 5;
+ }
+ { /* ULTRIX-32 V3.1 (Rev 9) vcc rejects this */
+ const int foo = 10;
+ if (!foo) return 0;
+ }
+ return !cs[0] && !zero.x;
+#endif
+
+ ;
+ return 0;
+}
+_ACEOF
+if ac_fn_c_try_compile "$LINENO"; then :
+ ac_cv_c_const=yes
+else
+ ac_cv_c_const=no
+fi
+rm -f core conftest.err conftest.$ac_objext conftest.$ac_ext
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_cv_c_const" >&5
+$as_echo "$ac_cv_c_const" >&6; }
+if test $ac_cv_c_const = no; then
+
+$as_echo "#define const /**/" >>confdefs.h
+
+fi
+
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for inline" >&5
+$as_echo_n "checking for inline... " >&6; }
+if ${ac_cv_c_inline+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ ac_cv_c_inline=no
+for ac_kw in inline __inline__ __inline; do
+ cat confdefs.h - <<_ACEOF >conftest.$ac_ext
+/* end confdefs.h. */
+#ifndef __cplusplus
+typedef int foo_t;
+static $ac_kw foo_t static_foo () {return 0; }
+$ac_kw foo_t foo () {return 0; }
+#endif
+
+_ACEOF
+if ac_fn_c_try_compile "$LINENO"; then :
+ ac_cv_c_inline=$ac_kw
+fi
+rm -f core conftest.err conftest.$ac_objext conftest.$ac_ext
+ test "$ac_cv_c_inline" != no && break
+done
+
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_cv_c_inline" >&5
+$as_echo "$ac_cv_c_inline" >&6; }
+
+case $ac_cv_c_inline in
+ inline | yes) ;;
+ *)
+ case $ac_cv_c_inline in
+ no) ac_val=;;
+ *) ac_val=$ac_cv_c_inline;;
+ esac
+ cat >>confdefs.h <<_ACEOF
+#ifndef __cplusplus
+#define inline $ac_val
+#endif
+_ACEOF
+ ;;
+esac
+
+ac_fn_c_check_type "$LINENO" "size_t" "ac_cv_type_size_t" "$ac_includes_default"
+if test "x$ac_cv_type_size_t" = xyes; then :
+
+else
+
+cat >>confdefs.h <<_ACEOF
+#define size_t unsigned int
+_ACEOF
+
+fi
+
+ac_fn_c_find_intX_t "$LINENO" "64" "ac_cv_c_int64_t"
+case $ac_cv_c_int64_t in #(
+ no|yes) ;; #(
+ *)
+
+cat >>confdefs.h <<_ACEOF
+#define int64_t $ac_cv_c_int64_t
+_ACEOF
+;;
+esac
+
+ac_fn_c_find_uintX_t "$LINENO" "64" "ac_cv_c_uint64_t"
+case $ac_cv_c_uint64_t in #(
+ no|yes) ;; #(
+ *)
+
+$as_echo "#define _UINT64_T 1" >>confdefs.h
+
+
+cat >>confdefs.h <<_ACEOF
+#define uint64_t $ac_cv_c_uint64_t
+_ACEOF
+;;
+ esac
+
+case :$ac_cv_c_int64_t:$ac_cv_c_int64_t: in #(
+ *':no:'*) :
+ as_fn_error $? "Sorry, your compiler does not support 64-bit integer types." "$LINENO" 5 ;; #(
+ *) :
+ ;;
+esac
+ac_fn_c_check_decl "$LINENO" "isascii" "ac_cv_have_decl_isascii" "#include <ctype.h>
+"
+if test "x$ac_cv_have_decl_isascii" = xyes; then :
+ ac_have_decl=1
+else
+ ac_have_decl=0
+fi
+
+cat >>confdefs.h <<_ACEOF
+#define HAVE_DECL_ISASCII $ac_have_decl
+_ACEOF
+
+ac_fn_c_check_member "$LINENO" "struct stat" "st_mtim" "ac_cv_member_struct_stat_st_mtim" "$ac_includes_default"
+if test "x$ac_cv_member_struct_stat_st_mtim" = xyes; then :
+
+cat >>confdefs.h <<_ACEOF
+#define HAVE_STRUCT_STAT_ST_MTIM 1
+_ACEOF
+
+
+fi
+
+
+# Configure options for dvipng also shown at the TeX Live top-level.
+## texk/dvipng/ac/dvipng.ac: configure.ac fragment for the TeX Live subdirectory texk/dvipng/
+## configure options for dvipng
+# Check whether --enable-debug was given.
+if test "${enable_debug+set}" = set; then :
+ enableval=$enable_debug;
+fi
+
+# Check whether --enable-timing was given.
+if test "${enable_timing+set}" = set; then :
+ enableval=$enable_timing;
+fi
+
+
+# Check whether --with-gs was given.
+if test "${with_gs+set}" = set; then :
+ withval=$with_gs;
+fi
+
+
+
+
+
+ if test "x$cross_compiling" = xyes; then
+ cross_TRUE=
+ cross_FALSE='#'
+else
+ cross_TRUE='#'
+ cross_FALSE=
+fi
+
+
+if test "x$enable_debug" != xno; then
+ enable_debug=yes
+
+$as_echo "#define DEBUG 1" >>confdefs.h
+
+fi
+
+if test "x$enable_timing" = xyes; then
+
+$as_echo "#define TIMING 1" >>confdefs.h
+
+fi
+
+# Checks for programs.
+# For a native TeX Live build '--with-gs' is ignored.
+if test "x$enable_native_texlive_build" = xyes; then :
+ with_gs=
+fi
+case $with_gs in #(
+ "" | yes | no) :
+ # Extract the first word of "gs", so it can be a program name with args.
+set dummy gs; ac_word=$2
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $ac_word" >&5
+$as_echo_n "checking for $ac_word... " >&6; }
+if ${ac_cv_prog_GS+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ if test -n "$GS"; then
+ ac_cv_prog_GS="$GS" # Let the user override the test.
+else
+as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH
+do
+ IFS=$as_save_IFS
+ test -z "$as_dir" && as_dir=.
+ for ac_exec_ext in '' $ac_executable_extensions; do
+ if as_fn_executable_p "$as_dir/$ac_word$ac_exec_ext"; then
+ ac_cv_prog_GS="gs"
+ $as_echo "$as_me:${as_lineno-$LINENO}: found $as_dir/$ac_word$ac_exec_ext" >&5
+ break 2
+ fi
+done
+ done
+IFS=$as_save_IFS
+
+fi
+fi
+GS=$ac_cv_prog_GS
+if test -n "$GS"; then
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: $GS" >&5
+$as_echo "$GS" >&6; }
+else
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5
+$as_echo "no" >&6; }
+fi
+
+ ;; #(
+ *) :
+ # Extract the first word of ""$with_gs"", so it can be a program name with args.
+set dummy "$with_gs"; ac_word=$2
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $ac_word" >&5
+$as_echo_n "checking for $ac_word... " >&6; }
+if ${ac_cv_path_GS+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ case $GS in
+ [\\/]* | ?:[\\/]*)
+ ac_cv_path_GS="$GS" # Let the user override the test with a path.
+ ;;
+ *)
+ as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH
+do
+ IFS=$as_save_IFS
+ test -z "$as_dir" && as_dir=.
+ for ac_exec_ext in '' $ac_executable_extensions; do
+ if as_fn_executable_p "$as_dir/$ac_word$ac_exec_ext"; then
+ ac_cv_path_GS="$as_dir/$ac_word$ac_exec_ext"
+ $as_echo "$as_me:${as_lineno-$LINENO}: found $as_dir/$ac_word$ac_exec_ext" >&5
+ break 2
+ fi
+done
+ done
+IFS=$as_save_IFS
+
+ ;;
+esac
+fi
+GS=$ac_cv_path_GS
+if test -n "$GS"; then
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: $GS" >&5
+$as_echo "$GS" >&6; }
+else
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5
+$as_echo "no" >&6; }
+fi
+
+ ;;
+esac
+if test -n "$GS"; then :
+ GS_WARN=
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking whether $GS has the pngalpha device" >&5
+$as_echo_n "checking whether $GS has the pngalpha device... " >&6; }
+if $GS -h | grep pngalpha >/dev/null; then
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: yes" >&5
+$as_echo "yes" >&6; }
+else
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5
+$as_echo "no" >&6; }
+ GS_WARN="Your EPS inclusions will be cropped to the
+ boundingbox, and rendered on an opaque background.
+ Upgrade GhostScript to avoid this."
+ { $as_echo "$as_me:${as_lineno-$LINENO}: checking whether $GS has the png16m device" >&5
+$as_echo_n "checking whether $GS has the png16m device... " >&6; }
+if $GS -h | grep png16m >/dev/null; then
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: yes" >&5
+$as_echo "yes" >&6; }
+else
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5
+$as_echo "no" >&6; }
+ GS_WARN="Your EPS inclusions may not work.
+ Upgrade/install GhostScript to avoid this."
+fi
+
+fi
+
+if test -n "$GS_WARN"; then
+ { $as_echo "$as_me:${as_lineno-$LINENO}: WARNING: $GS_WARN" >&5
+$as_echo "$as_me: WARNING: $GS_WARN" >&2;}
+fi
+
+else
+ { $as_echo "$as_me:${as_lineno-$LINENO}: WARNING: Cannot find GhostScript in your PATH" >&5
+$as_echo "$as_me: WARNING: Cannot find GhostScript in your PATH" >&2;}
+ GS=gs
+fi
+
+cat >>confdefs.h <<_ACEOF
+#define GS_PATH "$GS"
+_ACEOF
+
+
+# Checks for libraries.
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for library containing pow" >&5
+$as_echo_n "checking for library containing pow... " >&6; }
+if ${ac_cv_search_pow+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ ac_func_search_save_LIBS=$LIBS
+cat confdefs.h - <<_ACEOF >conftest.$ac_ext
+/* end confdefs.h. */
+
+/* Override any GCC internal prototype to avoid an error.
+ Use char because int might match the return type of a GCC
+ builtin and then its argument prototype would still apply. */
+#ifdef __cplusplus
+extern "C"
+#endif
+char pow ();
+int
+main ()
+{
+return pow ();
+ ;
+ return 0;
+}
+_ACEOF
+for ac_lib in '' m; do
+ if test -z "$ac_lib"; then
+ ac_res="none required"
+ else
+ ac_res=-l$ac_lib
+ LIBS="-l$ac_lib $ac_func_search_save_LIBS"
+ fi
+ if ac_fn_c_try_link "$LINENO"; then :
+ ac_cv_search_pow=$ac_res
+fi
+rm -f core conftest.err conftest.$ac_objext \
+ conftest$ac_exeext
+ if ${ac_cv_search_pow+:} false; then :
+ break
+fi
+done
+if ${ac_cv_search_pow+:} false; then :
+
+else
+ ac_cv_search_pow=no
+fi
+rm conftest.$ac_ext
+LIBS=$ac_func_search_save_LIBS
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_cv_search_pow" >&5
+$as_echo "$ac_cv_search_pow" >&6; }
+ac_res=$ac_cv_search_pow
+if test "$ac_res" != no; then :
+ test "$ac_res" = "none required" || LIBS="$ac_res $LIBS"
+
+fi
+
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for library containing basename" >&5
+$as_echo_n "checking for library containing basename... " >&6; }
+if ${ac_cv_search_basename+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ ac_func_search_save_LIBS=$LIBS
+cat confdefs.h - <<_ACEOF >conftest.$ac_ext
+/* end confdefs.h. */
+
+/* Override any GCC internal prototype to avoid an error.
+ Use char because int might match the return type of a GCC
+ builtin and then its argument prototype would still apply. */
+#ifdef __cplusplus
+extern "C"
+#endif
+char basename ();
+int
+main ()
+{
+return basename ();
+ ;
+ return 0;
+}
+_ACEOF
+for ac_lib in '' gen; do
+ if test -z "$ac_lib"; then
+ ac_res="none required"
+ else
+ ac_res=-l$ac_lib
+ LIBS="-l$ac_lib $ac_func_search_save_LIBS"
+ fi
+ if ac_fn_c_try_link "$LINENO"; then :
+ ac_cv_search_basename=$ac_res
+fi
+rm -f core conftest.err conftest.$ac_objext \
+ conftest$ac_exeext
+ if ${ac_cv_search_basename+:} false; then :
+ break
+fi
+done
+if ${ac_cv_search_basename+:} false; then :
+
+else
+ ac_cv_search_basename=no
+fi
+rm conftest.$ac_ext
+LIBS=$ac_func_search_save_LIBS
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_cv_search_basename" >&5
+$as_echo "$ac_cv_search_basename" >&6; }
+ac_res=$ac_cv_search_basename
+if test "$ac_res" != no; then :
+ test "$ac_res" = "none required" || LIBS="$ac_res $LIBS"
+
+fi
+
+
+# Checks for header files.
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for ANSI C header files" >&5
+$as_echo_n "checking for ANSI C header files... " >&6; }
+if ${ac_cv_header_stdc+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ cat confdefs.h - <<_ACEOF >conftest.$ac_ext
+/* end confdefs.h. */
+#include <stdlib.h>
+#include <stdarg.h>
+#include <string.h>
+#include <float.h>
+
+int
+main ()
+{
+
+ ;
+ return 0;
+}
+_ACEOF
+if ac_fn_c_try_compile "$LINENO"; then :
+ ac_cv_header_stdc=yes
+else
+ ac_cv_header_stdc=no
+fi
+rm -f core conftest.err conftest.$ac_objext conftest.$ac_ext
+
+if test $ac_cv_header_stdc = yes; then
+ # SunOS 4.x string.h does not declare mem*, contrary to ANSI.
+ cat confdefs.h - <<_ACEOF >conftest.$ac_ext
+/* end confdefs.h. */
+#include <string.h>
+
+_ACEOF
+if (eval "$ac_cpp conftest.$ac_ext") 2>&5 |
+ $EGREP "memchr" >/dev/null 2>&1; then :
+
+else
+ ac_cv_header_stdc=no
+fi
+rm -f conftest*
+
+fi
+
+if test $ac_cv_header_stdc = yes; then
+ # ISC 2.0.2 stdlib.h does not declare free, contrary to ANSI.
+ cat confdefs.h - <<_ACEOF >conftest.$ac_ext
+/* end confdefs.h. */
+#include <stdlib.h>
+
+_ACEOF
+if (eval "$ac_cpp conftest.$ac_ext") 2>&5 |
+ $EGREP "free" >/dev/null 2>&1; then :
+
+else
+ ac_cv_header_stdc=no
+fi
+rm -f conftest*
+
+fi
+
+if test $ac_cv_header_stdc = yes; then
+ # /bin/cc in Irix-4.0.5 gets non-ANSI ctype macros unless using -ansi.
+ if test "$cross_compiling" = yes; then :
+ :
+else
+ cat confdefs.h - <<_ACEOF >conftest.$ac_ext
+/* end confdefs.h. */
+#include <ctype.h>
+#include <stdlib.h>
+#if ((' ' & 0x0FF) == 0x020)
+# define ISLOWER(c) ('a' <= (c) && (c) <= 'z')
+# define TOUPPER(c) (ISLOWER(c) ? 'A' + ((c) - 'a') : (c))
+#else
+# define ISLOWER(c) \
+ (('a' <= (c) && (c) <= 'i') \
+ || ('j' <= (c) && (c) <= 'r') \
+ || ('s' <= (c) && (c) <= 'z'))
+# define TOUPPER(c) (ISLOWER(c) ? ((c) | 0x40) : (c))
+#endif
+
+#define XOR(e, f) (((e) && !(f)) || (!(e) && (f)))
+int
+main ()
+{
+ int i;
+ for (i = 0; i < 256; i++)
+ if (XOR (islower (i), ISLOWER (i))
+ || toupper (i) != TOUPPER (i))
+ return 2;
+ return 0;
+}
+_ACEOF
+if ac_fn_c_try_run "$LINENO"; then :
+
+else
+ ac_cv_header_stdc=no
+fi
+rm -f core *.core core.conftest.* gmon.out bb.out conftest$ac_exeext \
+ conftest.$ac_objext conftest.beam conftest.$ac_ext
+fi
+
+fi
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_cv_header_stdc" >&5
+$as_echo "$ac_cv_header_stdc" >&6; }
+if test $ac_cv_header_stdc = yes; then
+
+$as_echo "#define STDC_HEADERS 1" >>confdefs.h
+
+fi
+
+for ac_header in fcntl.h sys/time.h
+do :
+ as_ac_Header=`$as_echo "ac_cv_header_$ac_header" | $as_tr_sh`
+ac_fn_c_check_header_mongrel "$LINENO" "$ac_header" "$as_ac_Header" "$ac_includes_default"
+if eval test \"x\$"$as_ac_Header"\" = x"yes"; then :
+ cat >>confdefs.h <<_ACEOF
+#define `$as_echo "HAVE_$ac_header" | $as_tr_cpp` 1
+_ACEOF
+
+fi
+
+done
+
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for sys/wait.h that is POSIX.1 compatible" >&5
+$as_echo_n "checking for sys/wait.h that is POSIX.1 compatible... " >&6; }
+if ${ac_cv_header_sys_wait_h+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ cat confdefs.h - <<_ACEOF >conftest.$ac_ext
+/* end confdefs.h. */
+#include <sys/types.h>
+#include <sys/wait.h>
+#ifndef WEXITSTATUS
+# define WEXITSTATUS(stat_val) ((unsigned int) (stat_val) >> 8)
+#endif
+#ifndef WIFEXITED
+# define WIFEXITED(stat_val) (((stat_val) & 255) == 0)
+#endif
+
+int
+main ()
+{
+ int s;
+ wait (&s);
+ s = WIFEXITED (s) ? WEXITSTATUS (s) : 1;
+ ;
+ return 0;
+}
+_ACEOF
+if ac_fn_c_try_compile "$LINENO"; then :
+ ac_cv_header_sys_wait_h=yes
+else
+ ac_cv_header_sys_wait_h=no
+fi
+rm -f core conftest.err conftest.$ac_objext conftest.$ac_ext
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_cv_header_sys_wait_h" >&5
+$as_echo "$ac_cv_header_sys_wait_h" >&6; }
+if test $ac_cv_header_sys_wait_h = yes; then
+
+$as_echo "#define HAVE_SYS_WAIT_H 1" >>confdefs.h
+
+fi
+
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking whether time.h and sys/time.h may both be included" >&5
+$as_echo_n "checking whether time.h and sys/time.h may both be included... " >&6; }
+if ${ac_cv_header_time+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ cat confdefs.h - <<_ACEOF >conftest.$ac_ext
+/* end confdefs.h. */
+#include <sys/types.h>
+#include <sys/time.h>
+#include <time.h>
+
+int
+main ()
+{
+if ((struct tm *) 0)
+return 0;
+ ;
+ return 0;
+}
+_ACEOF
+if ac_fn_c_try_compile "$LINENO"; then :
+ ac_cv_header_time=yes
+else
+ ac_cv_header_time=no
+fi
+rm -f core conftest.err conftest.$ac_objext conftest.$ac_ext
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_cv_header_time" >&5
+$as_echo "$ac_cv_header_time" >&6; }
+if test $ac_cv_header_time = yes; then
+
+$as_echo "#define TIME_WITH_SYS_TIME 1" >>confdefs.h
+
+fi
+
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for stdbool.h that conforms to C99" >&5
+$as_echo_n "checking for stdbool.h that conforms to C99... " >&6; }
+if ${ac_cv_header_stdbool_h+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ cat confdefs.h - <<_ACEOF >conftest.$ac_ext
+/* end confdefs.h. */
+
+ #include <stdbool.h>
+ #ifndef bool
+ "error: bool is not defined"
+ #endif
+ #ifndef false
+ "error: false is not defined"
+ #endif
+ #if false
+ "error: false is not 0"
+ #endif
+ #ifndef true
+ "error: true is not defined"
+ #endif
+ #if true != 1
+ "error: true is not 1"
+ #endif
+ #ifndef __bool_true_false_are_defined
+ "error: __bool_true_false_are_defined is not defined"
+ #endif
+
+ struct s { _Bool s: 1; _Bool t; } s;
+
+ char a[true == 1 ? 1 : -1];
+ char b[false == 0 ? 1 : -1];
+ char c[__bool_true_false_are_defined == 1 ? 1 : -1];
+ char d[(bool) 0.5 == true ? 1 : -1];
+ /* See body of main program for 'e'. */
+ char f[(_Bool) 0.0 == false ? 1 : -1];
+ char g[true];
+ char h[sizeof (_Bool)];
+ char i[sizeof s.t];
+ enum { j = false, k = true, l = false * true, m = true * 256 };
+ /* The following fails for
+ HP aC++/ANSI C B3910B A.05.55 [Dec 04 2003]. */
+ _Bool n[m];
+ char o[sizeof n == m * sizeof n[0] ? 1 : -1];
+ char p[-1 - (_Bool) 0 < 0 && -1 - (bool) 0 < 0 ? 1 : -1];
+ /* Catch a bug in an HP-UX C compiler. See
+ http://gcc.gnu.org/ml/gcc-patches/2003-12/msg02303.html
+ http://lists.gnu.org/archive/html/bug-coreutils/2005-11/msg00161.html
+ */
+ _Bool q = true;
+ _Bool *pq = &q;
+
+int
+main ()
+{
+
+ bool e = &s;
+ *pq |= q;
+ *pq |= ! q;
+ /* Refer to every declared value, to avoid compiler optimizations. */
+ return (!a + !b + !c + !d + !e + !f + !g + !h + !i + !!j + !k + !!l
+ + !m + !n + !o + !p + !q + !pq);
+
+ ;
+ return 0;
+}
+_ACEOF
+if ac_fn_c_try_compile "$LINENO"; then :
+ ac_cv_header_stdbool_h=yes
+else
+ ac_cv_header_stdbool_h=no
+fi
+rm -f core conftest.err conftest.$ac_objext conftest.$ac_ext
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_cv_header_stdbool_h" >&5
+$as_echo "$ac_cv_header_stdbool_h" >&6; }
+ ac_fn_c_check_type "$LINENO" "_Bool" "ac_cv_type__Bool" "$ac_includes_default"
+if test "x$ac_cv_type__Bool" = xyes; then :
+
+cat >>confdefs.h <<_ACEOF
+#define HAVE__BOOL 1
+_ACEOF
+
+
+fi
+
+
+if test $ac_cv_header_stdbool_h = yes; then
+
+$as_echo "#define HAVE_STDBOOL_H 1" >>confdefs.h
+
+fi
+
+
+# Checks for typedefs, structures, and compiler characteristics.
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for an ANSI C-conforming const" >&5
+$as_echo_n "checking for an ANSI C-conforming const... " >&6; }
+if ${ac_cv_c_const+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ cat confdefs.h - <<_ACEOF >conftest.$ac_ext
+/* end confdefs.h. */
+
+int
+main ()
+{
+
+#ifndef __cplusplus
+ /* Ultrix mips cc rejects this sort of thing. */
+ typedef int charset[2];
+ const charset cs = { 0, 0 };
+ /* SunOS 4.1.1 cc rejects this. */
+ char const *const *pcpcc;
+ char **ppc;
+ /* NEC SVR4.0.2 mips cc rejects this. */
+ struct point {int x, y;};
+ static struct point const zero = {0,0};
+ /* AIX XL C 1.02.0.0 rejects this.
+ It does not let you subtract one const X* pointer from another in
+ an arm of an if-expression whose if-part is not a constant
+ expression */
+ const char *g = "string";
+ pcpcc = &g + (g ? g-g : 0);
+ /* HPUX 7.0 cc rejects these. */
+ ++pcpcc;
+ ppc = (char**) pcpcc;
+ pcpcc = (char const *const *) ppc;
+ { /* SCO 3.2v4 cc rejects this sort of thing. */
+ char tx;
+ char *t = &tx;
+ char const *s = 0 ? (char *) 0 : (char const *) 0;
+
+ *t++ = 0;
+ if (s) return 0;
+ }
+ { /* Someone thinks the Sun supposedly-ANSI compiler will reject this. */
+ int x[] = {25, 17};
+ const int *foo = &x[0];
+ ++foo;
+ }
+ { /* Sun SC1.0 ANSI compiler rejects this -- but not the above. */
+ typedef const int *iptr;
+ iptr p = 0;
+ ++p;
+ }
+ { /* AIX XL C 1.02.0.0 rejects this sort of thing, saying
+ "k.c", line 2.27: 1506-025 (S) Operand must be a modifiable lvalue. */
+ struct s { int j; const int *ap[3]; } bx;
+ struct s *b = &bx; b->j = 5;
+ }
+ { /* ULTRIX-32 V3.1 (Rev 9) vcc rejects this */
+ const int foo = 10;
+ if (!foo) return 0;
+ }
+ return !cs[0] && !zero.x;
+#endif
+
+ ;
+ return 0;
+}
+_ACEOF
+if ac_fn_c_try_compile "$LINENO"; then :
+ ac_cv_c_const=yes
+else
+ ac_cv_c_const=no
+fi
+rm -f core conftest.err conftest.$ac_objext conftest.$ac_ext
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_cv_c_const" >&5
+$as_echo "$ac_cv_c_const" >&6; }
+if test $ac_cv_c_const = no; then
+
+$as_echo "#define const /**/" >>confdefs.h
+
+fi
+
+ac_fn_c_check_type "$LINENO" "pid_t" "ac_cv_type_pid_t" "$ac_includes_default"
+if test "x$ac_cv_type_pid_t" = xyes; then :
+
+else
+
+cat >>confdefs.h <<_ACEOF
+#define pid_t int
+_ACEOF
+
+fi
+
+
+# Checks for library functions.
+
+
+
+ for ac_header in $ac_header_list
+do :
+ as_ac_Header=`$as_echo "ac_cv_header_$ac_header" | $as_tr_sh`
+ac_fn_c_check_header_compile "$LINENO" "$ac_header" "$as_ac_Header" "$ac_includes_default
+"
+if eval test \"x\$"$as_ac_Header"\" = x"yes"; then :
+ cat >>confdefs.h <<_ACEOF
+#define `$as_echo "HAVE_$ac_header" | $as_tr_cpp` 1
+_ACEOF
+
+fi
+
+done
+
+
+
+
+
+
+
+
+for ac_func in getpagesize
+do :
+ ac_fn_c_check_func "$LINENO" "getpagesize" "ac_cv_func_getpagesize"
+if test "x$ac_cv_func_getpagesize" = xyes; then :
+ cat >>confdefs.h <<_ACEOF
+#define HAVE_GETPAGESIZE 1
+_ACEOF
+
+fi
+done
+
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for working mmap" >&5
+$as_echo_n "checking for working mmap... " >&6; }
+if ${ac_cv_func_mmap_fixed_mapped+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ if test "$cross_compiling" = yes; then :
+ ac_cv_func_mmap_fixed_mapped=no
+else
+ cat confdefs.h - <<_ACEOF >conftest.$ac_ext
+/* end confdefs.h. */
+$ac_includes_default
+/* malloc might have been renamed as rpl_malloc. */
+#undef malloc
+
+/* Thanks to Mike Haertel and Jim Avera for this test.
+ Here is a matrix of mmap possibilities:
+ mmap private not fixed
+ mmap private fixed at somewhere currently unmapped
+ mmap private fixed at somewhere already mapped
+ mmap shared not fixed
+ mmap shared fixed at somewhere currently unmapped
+ mmap shared fixed at somewhere already mapped
+ For private mappings, we should verify that changes cannot be read()
+ back from the file, nor mmap's back from the file at a different
+ address. (There have been systems where private was not correctly
+ implemented like the infamous i386 svr4.0, and systems where the
+ VM page cache was not coherent with the file system buffer cache
+ like early versions of FreeBSD and possibly contemporary NetBSD.)
+ For shared mappings, we should conversely verify that changes get
+ propagated back to all the places they're supposed to be.
+
+ Grep wants private fixed already mapped.
+ The main things grep needs to know about mmap are:
+ * does it exist and is it safe to write into the mmap'd area
+ * how to use it (BSD variants) */
+
+#include <fcntl.h>
+#include <sys/mman.h>
+
+#if !defined STDC_HEADERS && !defined HAVE_STDLIB_H
+char *malloc ();
+#endif
+
+/* This mess was copied from the GNU getpagesize.h. */
+#ifndef HAVE_GETPAGESIZE
+# ifdef _SC_PAGESIZE
+# define getpagesize() sysconf(_SC_PAGESIZE)
+# else /* no _SC_PAGESIZE */
+# ifdef HAVE_SYS_PARAM_H
+# include <sys/param.h>
+# ifdef EXEC_PAGESIZE
+# define getpagesize() EXEC_PAGESIZE
+# else /* no EXEC_PAGESIZE */
+# ifdef NBPG
+# define getpagesize() NBPG * CLSIZE
+# ifndef CLSIZE
+# define CLSIZE 1
+# endif /* no CLSIZE */
+# else /* no NBPG */
+# ifdef NBPC
+# define getpagesize() NBPC
+# else /* no NBPC */
+# ifdef PAGESIZE
+# define getpagesize() PAGESIZE
+# endif /* PAGESIZE */
+# endif /* no NBPC */
+# endif /* no NBPG */
+# endif /* no EXEC_PAGESIZE */
+# else /* no HAVE_SYS_PARAM_H */
+# define getpagesize() 8192 /* punt totally */
+# endif /* no HAVE_SYS_PARAM_H */
+# endif /* no _SC_PAGESIZE */
+
+#endif /* no HAVE_GETPAGESIZE */
+
+int
+main ()
+{
+ char *data, *data2, *data3;
+ const char *cdata2;
+ int i, pagesize;
+ int fd, fd2;
+
+ pagesize = getpagesize ();
+
+ /* First, make a file with some known garbage in it. */
+ data = (char *) malloc (pagesize);
+ if (!data)
+ return 1;
+ for (i = 0; i < pagesize; ++i)
+ *(data + i) = rand ();
+ umask (0);
+ fd = creat ("conftest.mmap", 0600);
+ if (fd < 0)
+ return 2;
+ if (write (fd, data, pagesize) != pagesize)
+ return 3;
+ close (fd);
+
+ /* Next, check that the tail of a page is zero-filled. File must have
+ non-zero length, otherwise we risk SIGBUS for entire page. */
+ fd2 = open ("conftest.txt", O_RDWR | O_CREAT | O_TRUNC, 0600);
+ if (fd2 < 0)
+ return 4;
+ cdata2 = "";
+ if (write (fd2, cdata2, 1) != 1)
+ return 5;
+ data2 = (char *) mmap (0, pagesize, PROT_READ | PROT_WRITE, MAP_SHARED, fd2, 0L);
+ if (data2 == MAP_FAILED)
+ return 6;
+ for (i = 0; i < pagesize; ++i)
+ if (*(data2 + i))
+ return 7;
+ close (fd2);
+ if (munmap (data2, pagesize))
+ return 8;
+
+ /* Next, try to mmap the file at a fixed address which already has
+ something else allocated at it. If we can, also make sure that
+ we see the same garbage. */
+ fd = open ("conftest.mmap", O_RDWR);
+ if (fd < 0)
+ return 9;
+ if (data2 != mmap (data2, pagesize, PROT_READ | PROT_WRITE,
+ MAP_PRIVATE | MAP_FIXED, fd, 0L))
+ return 10;
+ for (i = 0; i < pagesize; ++i)
+ if (*(data + i) != *(data2 + i))
+ return 11;
+
+ /* Finally, make sure that changes to the mapped area do not
+ percolate back to the file as seen by read(). (This is a bug on
+ some variants of i386 svr4.0.) */
+ for (i = 0; i < pagesize; ++i)
+ *(data2 + i) = *(data2 + i) + 1;
+ data3 = (char *) malloc (pagesize);
+ if (!data3)
+ return 12;
+ if (read (fd, data3, pagesize) != pagesize)
+ return 13;
+ for (i = 0; i < pagesize; ++i)
+ if (*(data + i) != *(data3 + i))
+ return 14;
+ close (fd);
+ return 0;
+}
+_ACEOF
+if ac_fn_c_try_run "$LINENO"; then :
+ ac_cv_func_mmap_fixed_mapped=yes
+else
+ ac_cv_func_mmap_fixed_mapped=no
+fi
+rm -f core *.core core.conftest.* gmon.out bb.out conftest$ac_exeext \
+ conftest.$ac_objext conftest.beam conftest.$ac_ext
+fi
+
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_cv_func_mmap_fixed_mapped" >&5
+$as_echo "$ac_cv_func_mmap_fixed_mapped" >&6; }
+if test $ac_cv_func_mmap_fixed_mapped = yes; then
+
+$as_echo "#define HAVE_MMAP 1" >>confdefs.h
+
+fi
+rm -f conftest.mmap conftest.txt
+
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for working strtod" >&5
+$as_echo_n "checking for working strtod... " >&6; }
+if ${ac_cv_func_strtod+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ if test "$cross_compiling" = yes; then :
+ ac_cv_func_strtod=no
+else
+ cat confdefs.h - <<_ACEOF >conftest.$ac_ext
+/* end confdefs.h. */
+
+$ac_includes_default
+#ifndef strtod
+double strtod ();
+#endif
+int
+main()
+{
+ {
+ /* Some versions of Linux strtod mis-parse strings with leading '+'. */
+ char *string = " +69";
+ char *term;
+ double value;
+ value = strtod (string, &term);
+ if (value != 69 || term != (string + 4))
+ return 1;
+ }
+
+ {
+ /* Under Solaris 2.4, strtod returns the wrong value for the
+ terminating character under some conditions. */
+ char *string = "NaN";
+ char *term;
+ strtod (string, &term);
+ if (term != string && *(term - 1) == 0)
+ return 1;
+ }
+ return 0;
+}
+
+_ACEOF
+if ac_fn_c_try_run "$LINENO"; then :
+ ac_cv_func_strtod=yes
+else
+ ac_cv_func_strtod=no
+fi
+rm -f core *.core core.conftest.* gmon.out bb.out conftest$ac_exeext \
+ conftest.$ac_objext conftest.beam conftest.$ac_ext
+fi
+
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_cv_func_strtod" >&5
+$as_echo "$ac_cv_func_strtod" >&6; }
+if test $ac_cv_func_strtod = no; then
+ case " $LIBOBJS " in
+ *" strtod.$ac_objext "* ) ;;
+ *) LIBOBJS="$LIBOBJS strtod.$ac_objext"
+ ;;
+esac
+
+ac_fn_c_check_func "$LINENO" "pow" "ac_cv_func_pow"
+if test "x$ac_cv_func_pow" = xyes; then :
+
+fi
+
+if test $ac_cv_func_pow = no; then
+ { $as_echo "$as_me:${as_lineno-$LINENO}: checking for pow in -lm" >&5
+$as_echo_n "checking for pow in -lm... " >&6; }
+if ${ac_cv_lib_m_pow+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ ac_check_lib_save_LIBS=$LIBS
+LIBS="-lm $LIBS"
+cat confdefs.h - <<_ACEOF >conftest.$ac_ext
+/* end confdefs.h. */
+
+/* Override any GCC internal prototype to avoid an error.
+ Use char because int might match the return type of a GCC
+ builtin and then its argument prototype would still apply. */
+#ifdef __cplusplus
+extern "C"
+#endif
+char pow ();
+int
+main ()
+{
+return pow ();
+ ;
+ return 0;
+}
+_ACEOF
+if ac_fn_c_try_link "$LINENO"; then :
+ ac_cv_lib_m_pow=yes
+else
+ ac_cv_lib_m_pow=no
+fi
+rm -f core conftest.err conftest.$ac_objext \
+ conftest$ac_exeext conftest.$ac_ext
+LIBS=$ac_check_lib_save_LIBS
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_cv_lib_m_pow" >&5
+$as_echo "$ac_cv_lib_m_pow" >&6; }
+if test "x$ac_cv_lib_m_pow" = xyes; then :
+ POW_LIB=-lm
+else
+ { $as_echo "$as_me:${as_lineno-$LINENO}: WARNING: cannot find library containing definition of pow" >&5
+$as_echo "$as_me: WARNING: cannot find library containing definition of pow" >&2;}
+fi
+
+fi
+
+fi
+
+for ac_func in vprintf
+do :
+ ac_fn_c_check_func "$LINENO" "vprintf" "ac_cv_func_vprintf"
+if test "x$ac_cv_func_vprintf" = xyes; then :
+ cat >>confdefs.h <<_ACEOF
+#define HAVE_VPRINTF 1
+_ACEOF
+
+ac_fn_c_check_func "$LINENO" "_doprnt" "ac_cv_func__doprnt"
+if test "x$ac_cv_func__doprnt" = xyes; then :
+
+$as_echo "#define HAVE_DOPRNT 1" >>confdefs.h
+
+fi
+
+fi
+done
+
+
+for ac_func in dup2 memset munmap pow putenv strchr strrchr
+do :
+ as_ac_var=`$as_echo "ac_cv_func_$ac_func" | $as_tr_sh`
+ac_fn_c_check_func "$LINENO" "$ac_func" "$as_ac_var"
+if eval test \"x\$"$as_ac_var"\" = x"yes"; then :
+ cat >>confdefs.h <<_ACEOF
+#define `$as_echo "HAVE_$ac_func" | $as_tr_cpp` 1
+_ACEOF
+
+fi
+done
+
+
+if test "x$enable_timing" = xyes; then
+ for ac_func in ftime gettimeofday
+do :
+ as_ac_var=`$as_echo "ac_cv_func_$ac_func" | $as_tr_sh`
+ac_fn_c_check_func "$LINENO" "$ac_func" "$as_ac_var"
+if eval test \"x\$"$as_ac_var"\" = x"yes"; then :
+ cat >>confdefs.h <<_ACEOF
+#define `$as_echo "HAVE_$ac_func" | $as_tr_cpp` 1
+_ACEOF
+
+fi
+done
+
+fi
+
+# Documentation-related checks.
+# Extract the first word of "makeinfo", so it can be a program name with args.
+set dummy makeinfo; ac_word=$2
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $ac_word" >&5
+$as_echo_n "checking for $ac_word... " >&6; }
+if ${ac_cv_path_MAKEINFO+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ case $MAKEINFO in
+ [\\/]* | ?:[\\/]*)
+ ac_cv_path_MAKEINFO="$MAKEINFO" # Let the user override the test with a path.
+ ;;
+ *)
+ as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH
+do
+ IFS=$as_save_IFS
+ test -z "$as_dir" && as_dir=.
+ for ac_exec_ext in '' $ac_executable_extensions; do
+ if as_fn_executable_p "$as_dir/$ac_word$ac_exec_ext"; then
+ ac_cv_path_MAKEINFO="$as_dir/$ac_word$ac_exec_ext"
+ $as_echo "$as_me:${as_lineno-$LINENO}: found $as_dir/$ac_word$ac_exec_ext" >&5
+ break 2
+ fi
+done
+ done
+IFS=$as_save_IFS
+
+ test -z "$ac_cv_path_MAKEINFO" && ac_cv_path_MAKEINFO=":"
+ ;;
+esac
+fi
+MAKEINFO=$ac_cv_path_MAKEINFO
+if test -n "$MAKEINFO"; then
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: $MAKEINFO" >&5
+$as_echo "$MAKEINFO" >&6; }
+else
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5
+$as_echo "no" >&6; }
+fi
+
+
+if test -n "$MAKEINFO" -a "$MAKEINFO" != ":"; then
+ for ac_macro in acronym env option; do
+ { $as_echo "$as_me:${as_lineno-$LINENO}: checking if $MAKEINFO understands @$ac_macro{}" >&5
+$as_echo_n "checking if $MAKEINFO understands @$ac_macro{}... " >&6; }
+echo \\\\input texinfo > conftest.texi
+echo @$ac_macro{test} >> conftest.texi
+if $MAKEINFO conftest.texi > /dev/null 2> /dev/null; then
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: yes" >&5
+$as_echo "yes" >&6; }
+else
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5
+$as_echo "no" >&6; }
+ AM_MAKEINFOFLAGS="-D no-$ac_macro $AM_MAKEINFOFLAGS"
+fi
+rm -f conftest.texi conftest.info
+
+ done
+fi
+
+
+# Extract the first word of "install-info", so it can be a program name with args.
+set dummy install-info; ac_word=$2
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $ac_word" >&5
+$as_echo_n "checking for $ac_word... " >&6; }
+if ${ac_cv_path_INSTALL_INFO+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ case $INSTALL_INFO in
+ [\\/]* | ?:[\\/]*)
+ ac_cv_path_INSTALL_INFO="$INSTALL_INFO" # Let the user override the test with a path.
+ ;;
+ *)
+ as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH /usr/sbin /sbin
+do
+ IFS=$as_save_IFS
+ test -z "$as_dir" && as_dir=.
+ for ac_exec_ext in '' $ac_executable_extensions; do
+ if as_fn_executable_p "$as_dir/$ac_word$ac_exec_ext"; then
+ ac_cv_path_INSTALL_INFO="$as_dir/$ac_word$ac_exec_ext"
+ $as_echo "$as_me:${as_lineno-$LINENO}: found $as_dir/$ac_word$ac_exec_ext" >&5
+ break 2
+ fi
+done
+ done
+IFS=$as_save_IFS
+
+ test -z "$ac_cv_path_INSTALL_INFO" && ac_cv_path_INSTALL_INFO=":"
+ ;;
+esac
+fi
+INSTALL_INFO=$ac_cv_path_INSTALL_INFO
+if test -n "$INSTALL_INFO"; then
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: $INSTALL_INFO" >&5
+$as_echo "$INSTALL_INFO" >&6; }
+else
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5
+$as_echo "no" >&6; }
+fi
+
+
+
+# SELFAUTO -- not used when built as part of the TeX Live tree.
+
+# We have to check properties of libraries, either installed (system)
+# libraries or unistalled (possibly libtool) ones from the TeX Live tree.
+# Thus we can not use, e.g., AC_CHECK_LIB(LIB, FUNCTION)
+
+kpse_save_CPPFLAGS=$CPPFLAGS
+kpse_save_LIBS=$LIBS
+
+##tldbg _KPSE_INIT: Initialize TL infrastructure.
+kpse_BLD=`(cd "./../../." && pwd)`
+kpse_SRC=`(cd "$srcdir/../../." && pwd)`
+
+##tldbg _KPSE_USE_LIBTOOL: Generate a libtool script for use in configure tests.
+: ${CONFIG_LT=./config.lt}
+{ $as_echo "$as_me:${as_lineno-$LINENO}: creating $CONFIG_LT" >&5
+$as_echo "$as_me: creating $CONFIG_LT" >&6;}
+as_write_fail=0
+cat >"$CONFIG_LT" <<_ASEOF || as_write_fail=1
+#! $SHELL
+# Generated by $as_me.
+# Run this file to recreate a libtool stub with the current configuration.
+SHELL=\${CONFIG_SHELL-$SHELL}
+export SHELL
+_ASEOF
+cat >>"$CONFIG_LT" <<\_ASEOF || as_write_fail=1
+## -------------------- ##
+## M4sh Initialization. ##
+## -------------------- ##
+
+# Be more Bourne compatible
+DUALCASE=1; export DUALCASE # for MKS sh
+if test -n "${ZSH_VERSION+set}" && (emulate sh) >/dev/null 2>&1; then :
+ emulate sh
+ NULLCMD=:
+ # Pre-4.2 versions of Zsh do word splitting on ${1+"$@"}, which
+ # is contrary to our usage. Disable this feature.
+ alias -g '${1+"$@"}'='"$@"'
+ setopt NO_GLOB_SUBST
+else
+ case `(set -o) 2>/dev/null` in #(
+ *posix*) :
+ set -o posix ;; #(
+ *) :
+ ;;
+esac
+fi
+
+
+as_nl='
+'
+export as_nl
+# Printing a long string crashes Solaris 7 /usr/bin/printf.
+as_echo='\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\'
+as_echo=$as_echo$as_echo$as_echo$as_echo$as_echo
+as_echo=$as_echo$as_echo$as_echo$as_echo$as_echo$as_echo
+# Prefer a ksh shell builtin over an external printf program on Solaris,
+# but without wasting forks for bash or zsh.
+if test -z "$BASH_VERSION$ZSH_VERSION" \
+ && (test "X`print -r -- $as_echo`" = "X$as_echo") 2>/dev/null; then
+ as_echo='print -r --'
+ as_echo_n='print -rn --'
+elif (test "X`printf %s $as_echo`" = "X$as_echo") 2>/dev/null; then
+ as_echo='printf %s\n'
+ as_echo_n='printf %s'
+else
+ if test "X`(/usr/ucb/echo -n -n $as_echo) 2>/dev/null`" = "X-n $as_echo"; then
+ as_echo_body='eval /usr/ucb/echo -n "$1$as_nl"'
+ as_echo_n='/usr/ucb/echo -n'
+ else
+ as_echo_body='eval expr "X$1" : "X\\(.*\\)"'
+ as_echo_n_body='eval
+ arg=$1;
+ case $arg in #(
+ *"$as_nl"*)
+ expr "X$arg" : "X\\(.*\\)$as_nl";
+ arg=`expr "X$arg" : ".*$as_nl\\(.*\\)"`;;
+ esac;
+ expr "X$arg" : "X\\(.*\\)" | tr -d "$as_nl"
+ '
+ export as_echo_n_body
+ as_echo_n='sh -c $as_echo_n_body as_echo'
+ fi
+ export as_echo_body
+ as_echo='sh -c $as_echo_body as_echo'
+fi
+
+# The user is always right.
+if test "${PATH_SEPARATOR+set}" != set; then
+ PATH_SEPARATOR=:
+ (PATH='/bin;/bin'; FPATH=$PATH; sh -c :) >/dev/null 2>&1 && {
+ (PATH='/bin:/bin'; FPATH=$PATH; sh -c :) >/dev/null 2>&1 ||
+ PATH_SEPARATOR=';'
+ }
+fi
+
+
+# IFS
+# We need space, tab and new line, in precisely that order. Quoting is
+# there to prevent editors from complaining about space-tab.
+# (If _AS_PATH_WALK were called with IFS unset, it would disable word
+# splitting by setting IFS to empty value.)
+IFS=" "" $as_nl"
+
+# Find who we are. Look in the path if we contain no directory separator.
+as_myself=
+case $0 in #((
+ *[\\/]* ) as_myself=$0 ;;
+ *) as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH
+do
+ IFS=$as_save_IFS
+ test -z "$as_dir" && as_dir=.
+ test -r "$as_dir/$0" && as_myself=$as_dir/$0 && break
+ done
+IFS=$as_save_IFS
+
+ ;;
+esac
+# We did not find ourselves, most probably we were run as `sh COMMAND'
+# in which case we are not to be found in the path.
+if test "x$as_myself" = x; then
+ as_myself=$0
+fi
+if test ! -f "$as_myself"; then
+ $as_echo "$as_myself: error: cannot find myself; rerun with an absolute file name" >&2
+ exit 1
+fi
+
+# Unset variables that we do not need and which cause bugs (e.g. in
+# pre-3.0 UWIN ksh). But do not cause bugs in bash 2.01; the "|| exit 1"
+# suppresses any "Segmentation fault" message there. '((' could
+# trigger a bug in pdksh 5.2.14.
+for as_var in BASH_ENV ENV MAIL MAILPATH
+do eval test x\${$as_var+set} = xset \
+ && ( (unset $as_var) || exit 1) >/dev/null 2>&1 && unset $as_var || :
+done
+PS1='$ '
+PS2='> '
+PS4='+ '
+
+# NLS nuisances.
+LC_ALL=C
+export LC_ALL
+LANGUAGE=C
+export LANGUAGE
+
+# CDPATH.
+(unset CDPATH) >/dev/null 2>&1 && unset CDPATH
+
+
+# as_fn_error STATUS ERROR [LINENO LOG_FD]
+# ----------------------------------------
+# Output "`basename $0`: error: ERROR" to stderr. If LINENO and LOG_FD are
+# provided, also output the error to LOG_FD, referencing LINENO. Then exit the
+# script with STATUS, using 1 if that was 0.
+as_fn_error ()
+{
+ as_status=$1; test $as_status -eq 0 && as_status=1
+ if test "$4"; then
+ as_lineno=${as_lineno-"$3"} as_lineno_stack=as_lineno_stack=$as_lineno_stack
+ $as_echo "$as_me:${as_lineno-$LINENO}: error: $2" >&$4
+ fi
+ $as_echo "$as_me: error: $2" >&2
+ as_fn_exit $as_status
+} # as_fn_error
+
+
+# as_fn_set_status STATUS
+# -----------------------
+# Set $? to STATUS, without forking.
+as_fn_set_status ()
+{
+ return $1
+} # as_fn_set_status
+
+# as_fn_exit STATUS
+# -----------------
+# Exit the shell with STATUS, even in a "trap 0" or "set -e" context.
+as_fn_exit ()
+{
+ set +e
+ as_fn_set_status $1
+ exit $1
+} # as_fn_exit
+
+# as_fn_unset VAR
+# ---------------
+# Portably unset VAR.
+as_fn_unset ()
+{
+ { eval $1=; unset $1;}
+}
+as_unset=as_fn_unset
+# as_fn_append VAR VALUE
+# ----------------------
+# Append the text in VALUE to the end of the definition contained in VAR. Take
+# advantage of any shell optimizations that allow amortized linear growth over
+# repeated appends, instead of the typical quadratic growth present in naive
+# implementations.
+if (eval "as_var=1; as_var+=2; test x\$as_var = x12") 2>/dev/null; then :
+ eval 'as_fn_append ()
+ {
+ eval $1+=\$2
+ }'
+else
+ as_fn_append ()
+ {
+ eval $1=\$$1\$2
+ }
+fi # as_fn_append
+
+# as_fn_arith ARG...
+# ------------------
+# Perform arithmetic evaluation on the ARGs, and store the result in the
+# global $as_val. Take advantage of shells that can avoid forks. The arguments
+# must be portable across $(()) and expr.
+if (eval "test \$(( 1 + 1 )) = 2") 2>/dev/null; then :
+ eval 'as_fn_arith ()
+ {
+ as_val=$(( $* ))
+ }'
+else
+ as_fn_arith ()
+ {
+ as_val=`expr "$@" || test $? -eq 1`
+ }
+fi # as_fn_arith
+
+
+if expr a : '\(a\)' >/dev/null 2>&1 &&
+ test "X`expr 00001 : '.*\(...\)'`" = X001; then
+ as_expr=expr
+else
+ as_expr=false
+fi
+
+if (basename -- /) >/dev/null 2>&1 && test "X`basename -- / 2>&1`" = "X/"; then
+ as_basename=basename
+else
+ as_basename=false
+fi
+
+if (as_dir=`dirname -- /` && test "X$as_dir" = X/) >/dev/null 2>&1; then
+ as_dirname=dirname
+else
+ as_dirname=false
+fi
+
+as_me=`$as_basename -- "$0" ||
+$as_expr X/"$0" : '.*/\([^/][^/]*\)/*$' \| \
+ X"$0" : 'X\(//\)$' \| \
+ X"$0" : 'X\(/\)' \| . 2>/dev/null ||
+$as_echo X/"$0" |
+ sed '/^.*\/\([^/][^/]*\)\/*$/{
+ s//\1/
+ q
+ }
+ /^X\/\(\/\/\)$/{
+ s//\1/
+ q
+ }
+ /^X\/\(\/\).*/{
+ s//\1/
+ q
+ }
+ s/.*/./; q'`
+
+# Avoid depending upon Character Ranges.
+as_cr_letters='abcdefghijklmnopqrstuvwxyz'
+as_cr_LETTERS='ABCDEFGHIJKLMNOPQRSTUVWXYZ'
+as_cr_Letters=$as_cr_letters$as_cr_LETTERS
+as_cr_digits='0123456789'
+as_cr_alnum=$as_cr_Letters$as_cr_digits
+
+ECHO_C= ECHO_N= ECHO_T=
+case `echo -n x` in #(((((
+-n*)
+ case `echo 'xy\c'` in
+ *c*) ECHO_T=' ';; # ECHO_T is single tab character.
+ xy) ECHO_C='\c';;
+ *) echo `echo ksh88 bug on AIX 6.1` > /dev/null
+ ECHO_T=' ';;
+ esac;;
+*)
+ ECHO_N='-n';;
+esac
+
+rm -f conf$$ conf$$.exe conf$$.file
+if test -d conf$$.dir; then
+ rm -f conf$$.dir/conf$$.file
+else
+ rm -f conf$$.dir
+ mkdir conf$$.dir 2>/dev/null
+fi
+if (echo >conf$$.file) 2>/dev/null; then
+ if ln -s conf$$.file conf$$ 2>/dev/null; then
+ as_ln_s='ln -s'
+ # ... but there are two gotchas:
+ # 1) On MSYS, both `ln -s file dir' and `ln file dir' fail.
+ # 2) DJGPP < 2.04 has no symlinks; `ln -s' creates a wrapper executable.
+ # In both cases, we have to default to `cp -pR'.
+ ln -s conf$$.file conf$$.dir 2>/dev/null && test ! -f conf$$.exe ||
+ as_ln_s='cp -pR'
+ elif ln conf$$.file conf$$ 2>/dev/null; then
+ as_ln_s=ln
+ else
+ as_ln_s='cp -pR'
+ fi
+else
+ as_ln_s='cp -pR'
+fi
+rm -f conf$$ conf$$.exe conf$$.dir/conf$$.file conf$$.file
+rmdir conf$$.dir 2>/dev/null
+
+
+# as_fn_mkdir_p
+# -------------
+# Create "$as_dir" as a directory, including parents if necessary.
+as_fn_mkdir_p ()
+{
+
+ case $as_dir in #(
+ -*) as_dir=./$as_dir;;
+ esac
+ test -d "$as_dir" || eval $as_mkdir_p || {
+ as_dirs=
+ while :; do
+ case $as_dir in #(
+ *\'*) as_qdir=`$as_echo "$as_dir" | sed "s/'/'\\\\\\\\''/g"`;; #'(
+ *) as_qdir=$as_dir;;
+ esac
+ as_dirs="'$as_qdir' $as_dirs"
+ as_dir=`$as_dirname -- "$as_dir" ||
+$as_expr X"$as_dir" : 'X\(.*[^/]\)//*[^/][^/]*/*$' \| \
+ X"$as_dir" : 'X\(//\)[^/]' \| \
+ X"$as_dir" : 'X\(//\)$' \| \
+ X"$as_dir" : 'X\(/\)' \| . 2>/dev/null ||
+$as_echo X"$as_dir" |
+ sed '/^X\(.*[^/]\)\/\/*[^/][^/]*\/*$/{
+ s//\1/
+ q
+ }
+ /^X\(\/\/\)[^/].*/{
+ s//\1/
+ q
+ }
+ /^X\(\/\/\)$/{
+ s//\1/
+ q
+ }
+ /^X\(\/\).*/{
+ s//\1/
+ q
+ }
+ s/.*/./; q'`
+ test -d "$as_dir" && break
+ done
+ test -z "$as_dirs" || eval "mkdir $as_dirs"
+ } || test -d "$as_dir" || as_fn_error $? "cannot create directory $as_dir"
+
+
+} # as_fn_mkdir_p
+if mkdir -p . 2>/dev/null; then
+ as_mkdir_p='mkdir -p "$as_dir"'
+else
+ test -d ./-p && rmdir ./-p
+ as_mkdir_p=false
+fi
+
+
+# as_fn_executable_p FILE
+# -----------------------
+# Test if FILE is an executable regular file.
+as_fn_executable_p ()
+{
+ test -f "$1" && test -x "$1"
+} # as_fn_executable_p
+as_test_x='test -x'
+as_executable_p=as_fn_executable_p
+
+# Sed expression to map a string onto a valid CPP name.
+as_tr_cpp="eval sed 'y%*$as_cr_letters%P$as_cr_LETTERS%;s%[^_$as_cr_alnum]%_%g'"
+
+# Sed expression to map a string onto a valid variable name.
+as_tr_sh="eval sed 'y%*+%pp%;s%[^_$as_cr_alnum]%_%g'"
+
+
+exec 6>&1
+## --------------------------------- ##
+## Main body of "$CONFIG_LT" script. ##
+## --------------------------------- ##
+_ASEOF
+test $as_write_fail = 0 && chmod +x "$CONFIG_LT"
+
+cat >>"$CONFIG_LT" <<\_LTEOF
+lt_cl_silent=false
+exec 5>>config.log
+{
+ echo
+ sed 'h;s/./-/g;s/^.../## /;s/...$/ ##/;p;x;p;x' <<_ASBOX
+## Running $as_me. ##
+_ASBOX
+} >&5
+
+lt_cl_help="\
+'$as_me' creates a local libtool stub from the current configuration,
+for use in further configure time tests before the real libtool is
+generated.
+
+Usage: $0 [OPTIONS]
+
+ -h, --help print this help, then exit
+ -V, --version print version number, then exit
+ -q, --quiet do not print progress messages
+ -d, --debug don't remove temporary files
+
+Report bugs to <bug-libtool@gnu.org>."
+
+lt_cl_version="\
+dvipng (TeX Live) config.lt 1.17
+configured by $0, generated by GNU Autoconf 2.69.
+
+Copyright (C) 2011 Free Software Foundation, Inc.
+This config.lt script is free software; the Free Software Foundation
+gives unlimited permision to copy, distribute and modify it."
+
+while test 0 != $#
+do
+ case $1 in
+ --version | --v* | -V )
+ echo "$lt_cl_version"; exit 0 ;;
+ --help | --h* | -h )
+ echo "$lt_cl_help"; exit 0 ;;
+ --debug | --d* | -d )
+ debug=: ;;
+ --quiet | --q* | --silent | --s* | -q )
+ lt_cl_silent=: ;;
+
+ -*) as_fn_error $? "unrecognized option: $1
+Try '$0 --help' for more information." "$LINENO" 5 ;;
+
+ *) as_fn_error $? "unrecognized argument: $1
+Try '$0 --help' for more information." "$LINENO" 5 ;;
+ esac
+ shift
+done
+
+if $lt_cl_silent; then
+ exec 6>/dev/null
+fi
+_LTEOF
+
+cat >>"$CONFIG_LT" <<_LTEOF
+
+
+# The HP-UX ksh and POSIX shell print the target directory to stdout
+# if CDPATH is set.
+(unset CDPATH) >/dev/null 2>&1 && unset CDPATH
+
+sed_quote_subst='$sed_quote_subst'
+double_quote_subst='$double_quote_subst'
+delay_variable_subst='$delay_variable_subst'
+macro_version='`$ECHO "$macro_version" | $SED "$delay_single_quote_subst"`'
+macro_revision='`$ECHO "$macro_revision" | $SED "$delay_single_quote_subst"`'
+AS='`$ECHO "$AS" | $SED "$delay_single_quote_subst"`'
+DLLTOOL='`$ECHO "$DLLTOOL" | $SED "$delay_single_quote_subst"`'
+OBJDUMP='`$ECHO "$OBJDUMP" | $SED "$delay_single_quote_subst"`'
+enable_shared='`$ECHO "$enable_shared" | $SED "$delay_single_quote_subst"`'
+enable_static='`$ECHO "$enable_static" | $SED "$delay_single_quote_subst"`'
+pic_mode='`$ECHO "$pic_mode" | $SED "$delay_single_quote_subst"`'
+enable_fast_install='`$ECHO "$enable_fast_install" | $SED "$delay_single_quote_subst"`'
+shared_archive_member_spec='`$ECHO "$shared_archive_member_spec" | $SED "$delay_single_quote_subst"`'
+SHELL='`$ECHO "$SHELL" | $SED "$delay_single_quote_subst"`'
+ECHO='`$ECHO "$ECHO" | $SED "$delay_single_quote_subst"`'
+PATH_SEPARATOR='`$ECHO "$PATH_SEPARATOR" | $SED "$delay_single_quote_subst"`'
+host_alias='`$ECHO "$host_alias" | $SED "$delay_single_quote_subst"`'
+host='`$ECHO "$host" | $SED "$delay_single_quote_subst"`'
+host_os='`$ECHO "$host_os" | $SED "$delay_single_quote_subst"`'
+build_alias='`$ECHO "$build_alias" | $SED "$delay_single_quote_subst"`'
+build='`$ECHO "$build" | $SED "$delay_single_quote_subst"`'
+build_os='`$ECHO "$build_os" | $SED "$delay_single_quote_subst"`'
+SED='`$ECHO "$SED" | $SED "$delay_single_quote_subst"`'
+Xsed='`$ECHO "$Xsed" | $SED "$delay_single_quote_subst"`'
+GREP='`$ECHO "$GREP" | $SED "$delay_single_quote_subst"`'
+EGREP='`$ECHO "$EGREP" | $SED "$delay_single_quote_subst"`'
+FGREP='`$ECHO "$FGREP" | $SED "$delay_single_quote_subst"`'
+LD='`$ECHO "$LD" | $SED "$delay_single_quote_subst"`'
+NM='`$ECHO "$NM" | $SED "$delay_single_quote_subst"`'
+LN_S='`$ECHO "$LN_S" | $SED "$delay_single_quote_subst"`'
+max_cmd_len='`$ECHO "$max_cmd_len" | $SED "$delay_single_quote_subst"`'
+ac_objext='`$ECHO "$ac_objext" | $SED "$delay_single_quote_subst"`'
+exeext='`$ECHO "$exeext" | $SED "$delay_single_quote_subst"`'
+lt_unset='`$ECHO "$lt_unset" | $SED "$delay_single_quote_subst"`'
+lt_SP2NL='`$ECHO "$lt_SP2NL" | $SED "$delay_single_quote_subst"`'
+lt_NL2SP='`$ECHO "$lt_NL2SP" | $SED "$delay_single_quote_subst"`'
+lt_cv_to_host_file_cmd='`$ECHO "$lt_cv_to_host_file_cmd" | $SED "$delay_single_quote_subst"`'
+lt_cv_to_tool_file_cmd='`$ECHO "$lt_cv_to_tool_file_cmd" | $SED "$delay_single_quote_subst"`'
+reload_flag='`$ECHO "$reload_flag" | $SED "$delay_single_quote_subst"`'
+reload_cmds='`$ECHO "$reload_cmds" | $SED "$delay_single_quote_subst"`'
+deplibs_check_method='`$ECHO "$deplibs_check_method" | $SED "$delay_single_quote_subst"`'
+file_magic_cmd='`$ECHO "$file_magic_cmd" | $SED "$delay_single_quote_subst"`'
+file_magic_glob='`$ECHO "$file_magic_glob" | $SED "$delay_single_quote_subst"`'
+want_nocaseglob='`$ECHO "$want_nocaseglob" | $SED "$delay_single_quote_subst"`'
+sharedlib_from_linklib_cmd='`$ECHO "$sharedlib_from_linklib_cmd" | $SED "$delay_single_quote_subst"`'
+AR='`$ECHO "$AR" | $SED "$delay_single_quote_subst"`'
+AR_FLAGS='`$ECHO "$AR_FLAGS" | $SED "$delay_single_quote_subst"`'
+archiver_list_spec='`$ECHO "$archiver_list_spec" | $SED "$delay_single_quote_subst"`'
+STRIP='`$ECHO "$STRIP" | $SED "$delay_single_quote_subst"`'
+RANLIB='`$ECHO "$RANLIB" | $SED "$delay_single_quote_subst"`'
+old_postinstall_cmds='`$ECHO "$old_postinstall_cmds" | $SED "$delay_single_quote_subst"`'
+old_postuninstall_cmds='`$ECHO "$old_postuninstall_cmds" | $SED "$delay_single_quote_subst"`'
+old_archive_cmds='`$ECHO "$old_archive_cmds" | $SED "$delay_single_quote_subst"`'
+lock_old_archive_extraction='`$ECHO "$lock_old_archive_extraction" | $SED "$delay_single_quote_subst"`'
+CC='`$ECHO "$CC" | $SED "$delay_single_quote_subst"`'
+CFLAGS='`$ECHO "$CFLAGS" | $SED "$delay_single_quote_subst"`'
+compiler='`$ECHO "$compiler" | $SED "$delay_single_quote_subst"`'
+GCC='`$ECHO "$GCC" | $SED "$delay_single_quote_subst"`'
+lt_cv_sys_global_symbol_pipe='`$ECHO "$lt_cv_sys_global_symbol_pipe" | $SED "$delay_single_quote_subst"`'
+lt_cv_sys_global_symbol_to_cdecl='`$ECHO "$lt_cv_sys_global_symbol_to_cdecl" | $SED "$delay_single_quote_subst"`'
+lt_cv_sys_global_symbol_to_import='`$ECHO "$lt_cv_sys_global_symbol_to_import" | $SED "$delay_single_quote_subst"`'
+lt_cv_sys_global_symbol_to_c_name_address='`$ECHO "$lt_cv_sys_global_symbol_to_c_name_address" | $SED "$delay_single_quote_subst"`'
+lt_cv_sys_global_symbol_to_c_name_address_lib_prefix='`$ECHO "$lt_cv_sys_global_symbol_to_c_name_address_lib_prefix" | $SED "$delay_single_quote_subst"`'
+lt_cv_nm_interface='`$ECHO "$lt_cv_nm_interface" | $SED "$delay_single_quote_subst"`'
+nm_file_list_spec='`$ECHO "$nm_file_list_spec" | $SED "$delay_single_quote_subst"`'
+lt_sysroot='`$ECHO "$lt_sysroot" | $SED "$delay_single_quote_subst"`'
+lt_cv_truncate_bin='`$ECHO "$lt_cv_truncate_bin" | $SED "$delay_single_quote_subst"`'
+objdir='`$ECHO "$objdir" | $SED "$delay_single_quote_subst"`'
+MAGIC_CMD='`$ECHO "$MAGIC_CMD" | $SED "$delay_single_quote_subst"`'
+lt_prog_compiler_no_builtin_flag='`$ECHO "$lt_prog_compiler_no_builtin_flag" | $SED "$delay_single_quote_subst"`'
+lt_prog_compiler_pic='`$ECHO "$lt_prog_compiler_pic" | $SED "$delay_single_quote_subst"`'
+lt_prog_compiler_wl='`$ECHO "$lt_prog_compiler_wl" | $SED "$delay_single_quote_subst"`'
+lt_prog_compiler_static='`$ECHO "$lt_prog_compiler_static" | $SED "$delay_single_quote_subst"`'
+lt_cv_prog_compiler_c_o='`$ECHO "$lt_cv_prog_compiler_c_o" | $SED "$delay_single_quote_subst"`'
+need_locks='`$ECHO "$need_locks" | $SED "$delay_single_quote_subst"`'
+MANIFEST_TOOL='`$ECHO "$MANIFEST_TOOL" | $SED "$delay_single_quote_subst"`'
+DSYMUTIL='`$ECHO "$DSYMUTIL" | $SED "$delay_single_quote_subst"`'
+NMEDIT='`$ECHO "$NMEDIT" | $SED "$delay_single_quote_subst"`'
+LIPO='`$ECHO "$LIPO" | $SED "$delay_single_quote_subst"`'
+OTOOL='`$ECHO "$OTOOL" | $SED "$delay_single_quote_subst"`'
+OTOOL64='`$ECHO "$OTOOL64" | $SED "$delay_single_quote_subst"`'
+libext='`$ECHO "$libext" | $SED "$delay_single_quote_subst"`'
+shrext_cmds='`$ECHO "$shrext_cmds" | $SED "$delay_single_quote_subst"`'
+extract_expsyms_cmds='`$ECHO "$extract_expsyms_cmds" | $SED "$delay_single_quote_subst"`'
+archive_cmds_need_lc='`$ECHO "$archive_cmds_need_lc" | $SED "$delay_single_quote_subst"`'
+enable_shared_with_static_runtimes='`$ECHO "$enable_shared_with_static_runtimes" | $SED "$delay_single_quote_subst"`'
+export_dynamic_flag_spec='`$ECHO "$export_dynamic_flag_spec" | $SED "$delay_single_quote_subst"`'
+whole_archive_flag_spec='`$ECHO "$whole_archive_flag_spec" | $SED "$delay_single_quote_subst"`'
+compiler_needs_object='`$ECHO "$compiler_needs_object" | $SED "$delay_single_quote_subst"`'
+old_archive_from_new_cmds='`$ECHO "$old_archive_from_new_cmds" | $SED "$delay_single_quote_subst"`'
+old_archive_from_expsyms_cmds='`$ECHO "$old_archive_from_expsyms_cmds" | $SED "$delay_single_quote_subst"`'
+archive_cmds='`$ECHO "$archive_cmds" | $SED "$delay_single_quote_subst"`'
+archive_expsym_cmds='`$ECHO "$archive_expsym_cmds" | $SED "$delay_single_quote_subst"`'
+module_cmds='`$ECHO "$module_cmds" | $SED "$delay_single_quote_subst"`'
+module_expsym_cmds='`$ECHO "$module_expsym_cmds" | $SED "$delay_single_quote_subst"`'
+with_gnu_ld='`$ECHO "$with_gnu_ld" | $SED "$delay_single_quote_subst"`'
+allow_undefined_flag='`$ECHO "$allow_undefined_flag" | $SED "$delay_single_quote_subst"`'
+no_undefined_flag='`$ECHO "$no_undefined_flag" | $SED "$delay_single_quote_subst"`'
+hardcode_libdir_flag_spec='`$ECHO "$hardcode_libdir_flag_spec" | $SED "$delay_single_quote_subst"`'
+hardcode_libdir_separator='`$ECHO "$hardcode_libdir_separator" | $SED "$delay_single_quote_subst"`'
+hardcode_direct='`$ECHO "$hardcode_direct" | $SED "$delay_single_quote_subst"`'
+hardcode_direct_absolute='`$ECHO "$hardcode_direct_absolute" | $SED "$delay_single_quote_subst"`'
+hardcode_minus_L='`$ECHO "$hardcode_minus_L" | $SED "$delay_single_quote_subst"`'
+hardcode_shlibpath_var='`$ECHO "$hardcode_shlibpath_var" | $SED "$delay_single_quote_subst"`'
+hardcode_automatic='`$ECHO "$hardcode_automatic" | $SED "$delay_single_quote_subst"`'
+inherit_rpath='`$ECHO "$inherit_rpath" | $SED "$delay_single_quote_subst"`'
+link_all_deplibs='`$ECHO "$link_all_deplibs" | $SED "$delay_single_quote_subst"`'
+always_export_symbols='`$ECHO "$always_export_symbols" | $SED "$delay_single_quote_subst"`'
+export_symbols_cmds='`$ECHO "$export_symbols_cmds" | $SED "$delay_single_quote_subst"`'
+exclude_expsyms='`$ECHO "$exclude_expsyms" | $SED "$delay_single_quote_subst"`'
+include_expsyms='`$ECHO "$include_expsyms" | $SED "$delay_single_quote_subst"`'
+prelink_cmds='`$ECHO "$prelink_cmds" | $SED "$delay_single_quote_subst"`'
+postlink_cmds='`$ECHO "$postlink_cmds" | $SED "$delay_single_quote_subst"`'
+file_list_spec='`$ECHO "$file_list_spec" | $SED "$delay_single_quote_subst"`'
+variables_saved_for_relink='`$ECHO "$variables_saved_for_relink" | $SED "$delay_single_quote_subst"`'
+need_lib_prefix='`$ECHO "$need_lib_prefix" | $SED "$delay_single_quote_subst"`'
+need_version='`$ECHO "$need_version" | $SED "$delay_single_quote_subst"`'
+version_type='`$ECHO "$version_type" | $SED "$delay_single_quote_subst"`'
+runpath_var='`$ECHO "$runpath_var" | $SED "$delay_single_quote_subst"`'
+shlibpath_var='`$ECHO "$shlibpath_var" | $SED "$delay_single_quote_subst"`'
+shlibpath_overrides_runpath='`$ECHO "$shlibpath_overrides_runpath" | $SED "$delay_single_quote_subst"`'
+libname_spec='`$ECHO "$libname_spec" | $SED "$delay_single_quote_subst"`'
+library_names_spec='`$ECHO "$library_names_spec" | $SED "$delay_single_quote_subst"`'
+soname_spec='`$ECHO "$soname_spec" | $SED "$delay_single_quote_subst"`'
+install_override_mode='`$ECHO "$install_override_mode" | $SED "$delay_single_quote_subst"`'
+postinstall_cmds='`$ECHO "$postinstall_cmds" | $SED "$delay_single_quote_subst"`'
+postuninstall_cmds='`$ECHO "$postuninstall_cmds" | $SED "$delay_single_quote_subst"`'
+finish_cmds='`$ECHO "$finish_cmds" | $SED "$delay_single_quote_subst"`'
+finish_eval='`$ECHO "$finish_eval" | $SED "$delay_single_quote_subst"`'
+hardcode_into_libs='`$ECHO "$hardcode_into_libs" | $SED "$delay_single_quote_subst"`'
+sys_lib_search_path_spec='`$ECHO "$sys_lib_search_path_spec" | $SED "$delay_single_quote_subst"`'
+configure_time_dlsearch_path='`$ECHO "$configure_time_dlsearch_path" | $SED "$delay_single_quote_subst"`'
+configure_time_lt_sys_library_path='`$ECHO "$configure_time_lt_sys_library_path" | $SED "$delay_single_quote_subst"`'
+hardcode_action='`$ECHO "$hardcode_action" | $SED "$delay_single_quote_subst"`'
+enable_dlopen='`$ECHO "$enable_dlopen" | $SED "$delay_single_quote_subst"`'
+enable_dlopen_self='`$ECHO "$enable_dlopen_self" | $SED "$delay_single_quote_subst"`'
+enable_dlopen_self_static='`$ECHO "$enable_dlopen_self_static" | $SED "$delay_single_quote_subst"`'
+old_striplib='`$ECHO "$old_striplib" | $SED "$delay_single_quote_subst"`'
+striplib='`$ECHO "$striplib" | $SED "$delay_single_quote_subst"`'
+
+LTCC='$LTCC'
+LTCFLAGS='$LTCFLAGS'
+compiler='$compiler_DEFAULT'
+
+# A function that is used when there is no print builtin or printf.
+func_fallback_echo ()
+{
+ eval 'cat <<_LTECHO_EOF
+\$1
+_LTECHO_EOF'
+}
+
+# Quote evaled strings.
+for var in AS \
+DLLTOOL \
+OBJDUMP \
+SHELL \
+ECHO \
+PATH_SEPARATOR \
+SED \
+GREP \
+EGREP \
+FGREP \
+LD \
+NM \
+LN_S \
+lt_SP2NL \
+lt_NL2SP \
+reload_flag \
+deplibs_check_method \
+file_magic_cmd \
+file_magic_glob \
+want_nocaseglob \
+sharedlib_from_linklib_cmd \
+AR \
+AR_FLAGS \
+archiver_list_spec \
+STRIP \
+RANLIB \
+CC \
+CFLAGS \
+compiler \
+lt_cv_sys_global_symbol_pipe \
+lt_cv_sys_global_symbol_to_cdecl \
+lt_cv_sys_global_symbol_to_import \
+lt_cv_sys_global_symbol_to_c_name_address \
+lt_cv_sys_global_symbol_to_c_name_address_lib_prefix \
+lt_cv_nm_interface \
+nm_file_list_spec \
+lt_cv_truncate_bin \
+lt_prog_compiler_no_builtin_flag \
+lt_prog_compiler_pic \
+lt_prog_compiler_wl \
+lt_prog_compiler_static \
+lt_cv_prog_compiler_c_o \
+need_locks \
+MANIFEST_TOOL \
+DSYMUTIL \
+NMEDIT \
+LIPO \
+OTOOL \
+OTOOL64 \
+shrext_cmds \
+export_dynamic_flag_spec \
+whole_archive_flag_spec \
+compiler_needs_object \
+with_gnu_ld \
+allow_undefined_flag \
+no_undefined_flag \
+hardcode_libdir_flag_spec \
+hardcode_libdir_separator \
+exclude_expsyms \
+include_expsyms \
+file_list_spec \
+variables_saved_for_relink \
+libname_spec \
+library_names_spec \
+soname_spec \
+install_override_mode \
+finish_eval \
+old_striplib \
+striplib; do
+ case \`eval \\\\\$ECHO \\\\""\\\\\$\$var"\\\\"\` in
+ *[\\\\\\\`\\"\\\$]*)
+ eval "lt_\$var=\\\\\\"\\\`\\\$ECHO \\"\\\$\$var\\" | \\\$SED \\"\\\$sed_quote_subst\\"\\\`\\\\\\"" ## exclude from sc_prohibit_nested_quotes
+ ;;
+ *)
+ eval "lt_\$var=\\\\\\"\\\$\$var\\\\\\""
+ ;;
+ esac
+done
+
+# Double-quote double-evaled strings.
+for var in reload_cmds \
+old_postinstall_cmds \
+old_postuninstall_cmds \
+old_archive_cmds \
+extract_expsyms_cmds \
+old_archive_from_new_cmds \
+old_archive_from_expsyms_cmds \
+archive_cmds \
+archive_expsym_cmds \
+module_cmds \
+module_expsym_cmds \
+export_symbols_cmds \
+prelink_cmds \
+postlink_cmds \
+postinstall_cmds \
+postuninstall_cmds \
+finish_cmds \
+sys_lib_search_path_spec \
+configure_time_dlsearch_path \
+configure_time_lt_sys_library_path; do
+ case \`eval \\\\\$ECHO \\\\""\\\\\$\$var"\\\\"\` in
+ *[\\\\\\\`\\"\\\$]*)
+ eval "lt_\$var=\\\\\\"\\\`\\\$ECHO \\"\\\$\$var\\" | \\\$SED -e \\"\\\$double_quote_subst\\" -e \\"\\\$sed_quote_subst\\" -e \\"\\\$delay_variable_subst\\"\\\`\\\\\\"" ## exclude from sc_prohibit_nested_quotes
+ ;;
+ *)
+ eval "lt_\$var=\\\\\\"\\\$\$var\\\\\\""
+ ;;
+ esac
+done
+
+ac_aux_dir='$ac_aux_dir'
+
+# See if we are running on zsh, and set the options that allow our
+# commands through without removal of \ escapes INIT.
+if test -n "\${ZSH_VERSION+set}"; then
+ setopt NO_GLOB_SUBST
+fi
+
+
+ PACKAGE='$PACKAGE'
+ VERSION='$VERSION'
+ RM='$RM'
+ ofile='$ofile'
+
+
+
+_LTEOF
+
+cat >>"$CONFIG_LT" <<\_LTEOF
+{ $as_echo "$as_me:${as_lineno-$LINENO}: creating $ofile" >&5
+$as_echo "$as_me: creating $ofile" >&6;}
+
+
+ # See if we are running on zsh, and set the options that allow our
+ # commands through without removal of \ escapes.
+ if test -n "${ZSH_VERSION+set}"; then
+ setopt NO_GLOB_SUBST
+ fi
+
+ cfgfile=${ofile}T
+ trap "$RM \"$cfgfile\"; exit 1" 1 2 15
+ $RM "$cfgfile"
+
+ cat <<_LT_EOF >> "$cfgfile"
+#! $SHELL
+# Generated automatically by $as_me ($PACKAGE) $VERSION
+# Libtool was configured on host `(hostname || uname -n) 2>/dev/null | sed 1q`:
+# NOTE: Changes made to this file will be lost: look at ltmain.sh.
+
+# Provide generalized library-building support services.
+# Written by Gordon Matzigkeit, 1996
+
+# Copyright (C) 2014 Free Software Foundation, Inc.
+# This is free software; see the source for copying conditions. There is NO
+# warranty; not even for MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.
+
+# GNU Libtool is free software; you can redistribute it and/or modify
+# it under the terms of the GNU General Public License as published by
+# the Free Software Foundation; either version 2 of of the License, or
+# (at your option) any later version.
+#
+# As a special exception to the GNU General Public License, if you
+# distribute this file as part of a program or library that is built
+# using GNU Libtool, you may include this file under the same
+# distribution terms that you use for the rest of that program.
+#
+# GNU Libtool is distributed in the hope that it will be useful, but
+# WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
+# GNU General Public License for more details.
+#
+# You should have received a copy of the GNU General Public License
+# along with this program. If not, see <http://www.gnu.org/licenses/>.
+
+
+# The names of the tagged configurations supported by this script.
+available_tags=''
+
+# Configured defaults for sys_lib_dlsearch_path munging.
+: \${LT_SYS_LIBRARY_PATH="$configure_time_lt_sys_library_path"}
+
+# ### BEGIN LIBTOOL CONFIG
+
+# Which release of libtool.m4 was used?
+macro_version=$macro_version
+macro_revision=$macro_revision
+
+# Assembler program.
+AS=$lt_AS
+
+# DLL creation program.
+DLLTOOL=$lt_DLLTOOL
+
+# Object dumper program.
+OBJDUMP=$lt_OBJDUMP
+
+# Whether or not to build shared libraries.
+build_libtool_libs=$enable_shared
+
+# Whether or not to build static libraries.
+build_old_libs=$enable_static
+
+# What type of objects to build.
+pic_mode=$pic_mode
+
+# Whether or not to optimize for fast installation.
+fast_install=$enable_fast_install
+
+# Shared archive member basename,for filename based shared library versioning on AIX.
+shared_archive_member_spec=$shared_archive_member_spec
+
+# Shell to use when invoking shell scripts.
+SHELL=$lt_SHELL
+
+# An echo program that protects backslashes.
+ECHO=$lt_ECHO
+
+# The PATH separator for the build system.
+PATH_SEPARATOR=$lt_PATH_SEPARATOR
+
+# The host system.
+host_alias=$host_alias
+host=$host
+host_os=$host_os
+
+# The build system.
+build_alias=$build_alias
+build=$build
+build_os=$build_os
+
+# A sed program that does not truncate output.
+SED=$lt_SED
+
+# Sed that helps us avoid accidentally triggering echo(1) options like -n.
+Xsed="\$SED -e 1s/^X//"
+
+# A grep program that handles long lines.
+GREP=$lt_GREP
+
+# An ERE matcher.
+EGREP=$lt_EGREP
+
+# A literal string matcher.
+FGREP=$lt_FGREP
+
+# A BSD- or MS-compatible name lister.
+NM=$lt_NM
+
+# Whether we need soft or hard links.
+LN_S=$lt_LN_S
+
+# What is the maximum length of a command?
+max_cmd_len=$max_cmd_len
+
+# Object file suffix (normally "o").
+objext=$ac_objext
+
+# Executable file suffix (normally "").
+exeext=$exeext
+
+# whether the shell understands "unset".
+lt_unset=$lt_unset
+
+# turn spaces into newlines.
+SP2NL=$lt_lt_SP2NL
+
+# turn newlines into spaces.
+NL2SP=$lt_lt_NL2SP
+
+# convert \$build file names to \$host format.
+to_host_file_cmd=$lt_cv_to_host_file_cmd
+
+# convert \$build files to toolchain format.
+to_tool_file_cmd=$lt_cv_to_tool_file_cmd
+
+# Method to check whether dependent libraries are shared objects.
+deplibs_check_method=$lt_deplibs_check_method
+
+# Command to use when deplibs_check_method = "file_magic".
+file_magic_cmd=$lt_file_magic_cmd
+
+# How to find potential files when deplibs_check_method = "file_magic".
+file_magic_glob=$lt_file_magic_glob
+
+# Find potential files using nocaseglob when deplibs_check_method = "file_magic".
+want_nocaseglob=$lt_want_nocaseglob
+
+# Command to associate shared and link libraries.
+sharedlib_from_linklib_cmd=$lt_sharedlib_from_linklib_cmd
+
+# The archiver.
+AR=$lt_AR
+
+# Flags to create an archive.
+AR_FLAGS=$lt_AR_FLAGS
+
+# How to feed a file listing to the archiver.
+archiver_list_spec=$lt_archiver_list_spec
+
+# A symbol stripping program.
+STRIP=$lt_STRIP
+
+# Commands used to install an old-style archive.
+RANLIB=$lt_RANLIB
+old_postinstall_cmds=$lt_old_postinstall_cmds
+old_postuninstall_cmds=$lt_old_postuninstall_cmds
+
+# Whether to use a lock for old archive extraction.
+lock_old_archive_extraction=$lock_old_archive_extraction
+
+# A C compiler.
+LTCC=$lt_CC
+
+# LTCC compiler flags.
+LTCFLAGS=$lt_CFLAGS
+
+# Take the output of nm and produce a listing of raw symbols and C names.
+global_symbol_pipe=$lt_lt_cv_sys_global_symbol_pipe
+
+# Transform the output of nm in a proper C declaration.
+global_symbol_to_cdecl=$lt_lt_cv_sys_global_symbol_to_cdecl
+
+# Transform the output of nm into a list of symbols to manually relocate.
+global_symbol_to_import=$lt_lt_cv_sys_global_symbol_to_import
+
+# Transform the output of nm in a C name address pair.
+global_symbol_to_c_name_address=$lt_lt_cv_sys_global_symbol_to_c_name_address
+
+# Transform the output of nm in a C name address pair when lib prefix is needed.
+global_symbol_to_c_name_address_lib_prefix=$lt_lt_cv_sys_global_symbol_to_c_name_address_lib_prefix
+
+# The name lister interface.
+nm_interface=$lt_lt_cv_nm_interface
+
+# Specify filename containing input files for \$NM.
+nm_file_list_spec=$lt_nm_file_list_spec
+
+# The root where to search for dependent libraries,and where our libraries should be installed.
+lt_sysroot=$lt_sysroot
+
+# Command to truncate a binary pipe.
+lt_truncate_bin=$lt_lt_cv_truncate_bin
+
+# The name of the directory that contains temporary libtool files.
+objdir=$objdir
+
+# Used to examine libraries when file_magic_cmd begins with "file".
+MAGIC_CMD=$MAGIC_CMD
+
+# Must we lock files when doing compilation?
+need_locks=$lt_need_locks
+
+# Manifest tool.
+MANIFEST_TOOL=$lt_MANIFEST_TOOL
+
+# Tool to manipulate archived DWARF debug symbol files on Mac OS X.
+DSYMUTIL=$lt_DSYMUTIL
+
+# Tool to change global to local symbols on Mac OS X.
+NMEDIT=$lt_NMEDIT
+
+# Tool to manipulate fat objects and archives on Mac OS X.
+LIPO=$lt_LIPO
+
+# ldd/readelf like tool for Mach-O binaries on Mac OS X.
+OTOOL=$lt_OTOOL
+
+# ldd/readelf like tool for 64 bit Mach-O binaries on Mac OS X 10.4.
+OTOOL64=$lt_OTOOL64
+
+# Old archive suffix (normally "a").
+libext=$libext
+
+# Shared library suffix (normally ".so").
+shrext_cmds=$lt_shrext_cmds
+
+# The commands to extract the exported symbol list from a shared archive.
+extract_expsyms_cmds=$lt_extract_expsyms_cmds
+
+# Variables whose values should be saved in libtool wrapper scripts and
+# restored at link time.
+variables_saved_for_relink=$lt_variables_saved_for_relink
+
+# Do we need the "lib" prefix for modules?
+need_lib_prefix=$need_lib_prefix
+
+# Do we need a version for libraries?
+need_version=$need_version
+
+# Library versioning type.
+version_type=$version_type
+
+# Shared library runtime path variable.
+runpath_var=$runpath_var
+
+# Shared library path variable.
+shlibpath_var=$shlibpath_var
+
+# Is shlibpath searched before the hard-coded library search path?
+shlibpath_overrides_runpath=$shlibpath_overrides_runpath
+
+# Format of library name prefix.
+libname_spec=$lt_libname_spec
+
+# List of archive names. First name is the real one, the rest are links.
+# The last name is the one that the linker finds with -lNAME
+library_names_spec=$lt_library_names_spec
+
+# The coded name of the library, if different from the real name.
+soname_spec=$lt_soname_spec
+
+# Permission mode override for installation of shared libraries.
+install_override_mode=$lt_install_override_mode
+
+# Command to use after installation of a shared archive.
+postinstall_cmds=$lt_postinstall_cmds
+
+# Command to use after uninstallation of a shared archive.
+postuninstall_cmds=$lt_postuninstall_cmds
+
+# Commands used to finish a libtool library installation in a directory.
+finish_cmds=$lt_finish_cmds
+
+# As "finish_cmds", except a single script fragment to be evaled but
+# not shown.
+finish_eval=$lt_finish_eval
+
+# Whether we should hardcode library paths into libraries.
+hardcode_into_libs=$hardcode_into_libs
+
+# Compile-time system search path for libraries.
+sys_lib_search_path_spec=$lt_sys_lib_search_path_spec
+
+# Detected run-time system search path for libraries.
+sys_lib_dlsearch_path_spec=$lt_configure_time_dlsearch_path
+
+# Explicit LT_SYS_LIBRARY_PATH set during ./configure time.
+configure_time_lt_sys_library_path=$lt_configure_time_lt_sys_library_path
+
+# Whether dlopen is supported.
+dlopen_support=$enable_dlopen
+
+# Whether dlopen of programs is supported.
+dlopen_self=$enable_dlopen_self
+
+# Whether dlopen of statically linked programs is supported.
+dlopen_self_static=$enable_dlopen_self_static
+
+# Commands to strip libraries.
+old_striplib=$lt_old_striplib
+striplib=$lt_striplib
+
+
+# The linker used to build libraries.
+LD=$lt_LD
+
+# How to create reloadable object files.
+reload_flag=$lt_reload_flag
+reload_cmds=$lt_reload_cmds
+
+# Commands used to build an old-style archive.
+old_archive_cmds=$lt_old_archive_cmds
+
+# A language specific compiler.
+CC=$lt_compiler
+
+# Is the compiler the GNU compiler?
+with_gcc=$GCC
+
+# Compiler flag to turn off builtin functions.
+no_builtin_flag=$lt_lt_prog_compiler_no_builtin_flag
+
+# Additional compiler flags for building library objects.
+pic_flag=$lt_lt_prog_compiler_pic
+
+# How to pass a linker flag through the compiler.
+wl=$lt_lt_prog_compiler_wl
+
+# Compiler flag to prevent dynamic linking.
+link_static_flag=$lt_lt_prog_compiler_static
+
+# Does compiler simultaneously support -c and -o options?
+compiler_c_o=$lt_lt_cv_prog_compiler_c_o
+
+# Whether or not to add -lc for building shared libraries.
+build_libtool_need_lc=$archive_cmds_need_lc
+
+# Whether or not to disallow shared libs when runtime libs are static.
+allow_libtool_libs_with_static_runtimes=$enable_shared_with_static_runtimes
+
+# Compiler flag to allow reflexive dlopens.
+export_dynamic_flag_spec=$lt_export_dynamic_flag_spec
+
+# Compiler flag to generate shared objects directly from archives.
+whole_archive_flag_spec=$lt_whole_archive_flag_spec
+
+# Whether the compiler copes with passing no objects directly.
+compiler_needs_object=$lt_compiler_needs_object
+
+# Create an old-style archive from a shared archive.
+old_archive_from_new_cmds=$lt_old_archive_from_new_cmds
+
+# Create a temporary old-style archive to link instead of a shared archive.
+old_archive_from_expsyms_cmds=$lt_old_archive_from_expsyms_cmds
+
+# Commands used to build a shared archive.
+archive_cmds=$lt_archive_cmds
+archive_expsym_cmds=$lt_archive_expsym_cmds
+
+# Commands used to build a loadable module if different from building
+# a shared archive.
+module_cmds=$lt_module_cmds
+module_expsym_cmds=$lt_module_expsym_cmds
+
+# Whether we are building with GNU ld or not.
+with_gnu_ld=$lt_with_gnu_ld
+
+# Flag that allows shared libraries with undefined symbols to be built.
+allow_undefined_flag=$lt_allow_undefined_flag
+
+# Flag that enforces no undefined symbols.
+no_undefined_flag=$lt_no_undefined_flag
+
+# Flag to hardcode \$libdir into a binary during linking.
+# This must work even if \$libdir does not exist
+hardcode_libdir_flag_spec=$lt_hardcode_libdir_flag_spec
+
+# Whether we need a single "-rpath" flag with a separated argument.
+hardcode_libdir_separator=$lt_hardcode_libdir_separator
+
+# Set to "yes" if using DIR/libNAME\$shared_ext during linking hardcodes
+# DIR into the resulting binary.
+hardcode_direct=$hardcode_direct
+
+# Set to "yes" if using DIR/libNAME\$shared_ext during linking hardcodes
+# DIR into the resulting binary and the resulting library dependency is
+# "absolute",i.e impossible to change by setting \$shlibpath_var if the
+# library is relocated.
+hardcode_direct_absolute=$hardcode_direct_absolute
+
+# Set to "yes" if using the -LDIR flag during linking hardcodes DIR
+# into the resulting binary.
+hardcode_minus_L=$hardcode_minus_L
+
+# Set to "yes" if using SHLIBPATH_VAR=DIR during linking hardcodes DIR
+# into the resulting binary.
+hardcode_shlibpath_var=$hardcode_shlibpath_var
+
+# Set to "yes" if building a shared library automatically hardcodes DIR
+# into the library and all subsequent libraries and executables linked
+# against it.
+hardcode_automatic=$hardcode_automatic
+
+# Set to yes if linker adds runtime paths of dependent libraries
+# to runtime path list.
+inherit_rpath=$inherit_rpath
+
+# Whether libtool must link a program against all its dependency libraries.
+link_all_deplibs=$link_all_deplibs
+
+# Set to "yes" if exported symbols are required.
+always_export_symbols=$always_export_symbols
+
+# The commands to list exported symbols.
+export_symbols_cmds=$lt_export_symbols_cmds
+
+# Symbols that should not be listed in the preloaded symbols.
+exclude_expsyms=$lt_exclude_expsyms
+
+# Symbols that must always be exported.
+include_expsyms=$lt_include_expsyms
+
+# Commands necessary for linking programs (against libraries) with templates.
+prelink_cmds=$lt_prelink_cmds
+
+# Commands necessary for finishing linking programs.
+postlink_cmds=$lt_postlink_cmds
+
+# Specify filename containing input files.
+file_list_spec=$lt_file_list_spec
+
+# How to hardcode a shared library path into an executable.
+hardcode_action=$hardcode_action
+
+# ### END LIBTOOL CONFIG
+
+_LT_EOF
+
+ cat <<'_LT_EOF' >> "$cfgfile"
+
+# ### BEGIN FUNCTIONS SHARED WITH CONFIGURE
+
+# func_munge_path_list VARIABLE PATH
+# -----------------------------------
+# VARIABLE is name of variable containing _space_ separated list of
+# directories to be munged by the contents of PATH, which is string
+# having a format:
+# "DIR[:DIR]:"
+# string "DIR[ DIR]" will be prepended to VARIABLE
+# ":DIR[:DIR]"
+# string "DIR[ DIR]" will be appended to VARIABLE
+# "DIRP[:DIRP]::[DIRA:]DIRA"
+# string "DIRP[ DIRP]" will be prepended to VARIABLE and string
+# "DIRA[ DIRA]" will be appended to VARIABLE
+# "DIR[:DIR]"
+# VARIABLE will be replaced by "DIR[ DIR]"
+func_munge_path_list ()
+{
+ case x$2 in
+ x)
+ ;;
+ *:)
+ eval $1=\"`$ECHO $2 | $SED 's/:/ /g'` \$$1\"
+ ;;
+ x:*)
+ eval $1=\"\$$1 `$ECHO $2 | $SED 's/:/ /g'`\"
+ ;;
+ *::*)
+ eval $1=\"\$$1\ `$ECHO $2 | $SED -e 's/.*:://' -e 's/:/ /g'`\"
+ eval $1=\"`$ECHO $2 | $SED -e 's/::.*//' -e 's/:/ /g'`\ \$$1\"
+ ;;
+ *)
+ eval $1=\"`$ECHO $2 | $SED 's/:/ /g'`\"
+ ;;
+ esac
+}
+
+
+# Calculate cc_basename. Skip known compiler wrappers and cross-prefix.
+func_cc_basename ()
+{
+ for cc_temp in $*""; do
+ case $cc_temp in
+ compile | *[\\/]compile | ccache | *[\\/]ccache ) ;;
+ distcc | *[\\/]distcc | purify | *[\\/]purify ) ;;
+ \-*) ;;
+ *) break;;
+ esac
+ done
+ func_cc_basename_result=`$ECHO "$cc_temp" | $SED "s%.*/%%; s%^$host_alias-%%"`
+}
+
+
+# ### END FUNCTIONS SHARED WITH CONFIGURE
+
+_LT_EOF
+
+ case $host_os in
+ aix3*)
+ cat <<\_LT_EOF >> "$cfgfile"
+# AIX sometimes has problems with the GCC collect2 program. For some
+# reason, if we set the COLLECT_NAMES environment variable, the problems
+# vanish in a puff of smoke.
+if test set != "${COLLECT_NAMES+set}"; then
+ COLLECT_NAMES=
+ export COLLECT_NAMES
+fi
+_LT_EOF
+ ;;
+ esac
+
+
+ltmain=$ac_aux_dir/ltmain.sh
+
+
+ # We use sed instead of cat because bash on DJGPP gets confused if
+ # if finds mixed CR/LF and LF-only lines. Since sed operates in
+ # text mode, it properly converts lines to CR/LF. This bash problem
+ # is reportedly fixed, but why not run on old versions too?
+ sed '$q' "$ltmain" >> "$cfgfile" \
+ || (rm -f "$cfgfile"; exit 1)
+
+ mv -f "$cfgfile" "$ofile" ||
+ (rm -f "$ofile" && cp "$cfgfile" "$ofile" && rm -f "$cfgfile")
+ chmod +x "$ofile"
+
+
+as_fn_exit 0
+_LTEOF
+chmod +x "$CONFIG_LT"
+
+# configure is writing to config.log, but config.lt does its own redirection,
+# appending to config.log, which fails on DOS, as config.log is still kept
+# open by configure. Here we exec the FD to /dev/null, effectively closing
+# config.log, so it can be properly (re)opened and appended to by config.lt.
+lt_cl_success=:
+test yes = "$silent" &&
+ lt_config_lt_args="$lt_config_lt_args --quiet"
+exec 5>/dev/null
+$SHELL "$CONFIG_LT" $lt_config_lt_args || lt_cl_success=false
+exec 5>>config.log
+$lt_cl_success || as_fn_exit 1
+
+ac_ext=c
+ac_cpp='$CPP $CPPFLAGS'
+ac_compile='$CC -c $CFLAGS $CPPFLAGS conftest.$ac_ext >&5'
+ac_link='$CC -o conftest$ac_exeext $CFLAGS $CPPFLAGS $LDFLAGS conftest.$ac_ext $LIBS >&5'
+ac_compiler_gnu=$ac_cv_c_compiler_gnu
+ac_link="./libtool --mode=link --tag=CC $ac_link"
+
+if test -n "$ac_tool_prefix"; then
+ # Extract the first word of "${ac_tool_prefix}pkg-config", so it can be a program name with args.
+set dummy ${ac_tool_prefix}pkg-config; ac_word=$2
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $ac_word" >&5
+$as_echo_n "checking for $ac_word... " >&6; }
+if ${ac_cv_prog_PKG_CONFIG+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ if test -n "$PKG_CONFIG"; then
+ ac_cv_prog_PKG_CONFIG="$PKG_CONFIG" # Let the user override the test.
+else
+as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH
+do
+ IFS=$as_save_IFS
+ test -z "$as_dir" && as_dir=.
+ for ac_exec_ext in '' $ac_executable_extensions; do
+ if as_fn_executable_p "$as_dir/$ac_word$ac_exec_ext"; then
+ ac_cv_prog_PKG_CONFIG="${ac_tool_prefix}pkg-config"
+ $as_echo "$as_me:${as_lineno-$LINENO}: found $as_dir/$ac_word$ac_exec_ext" >&5
+ break 2
+ fi
+done
+ done
+IFS=$as_save_IFS
+
+fi
+fi
+PKG_CONFIG=$ac_cv_prog_PKG_CONFIG
+if test -n "$PKG_CONFIG"; then
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: $PKG_CONFIG" >&5
+$as_echo "$PKG_CONFIG" >&6; }
+else
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5
+$as_echo "no" >&6; }
+fi
+
+
+fi
+if test -z "$ac_cv_prog_PKG_CONFIG"; then
+ ac_ct_PKG_CONFIG=$PKG_CONFIG
+ # Extract the first word of "pkg-config", so it can be a program name with args.
+set dummy pkg-config; ac_word=$2
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $ac_word" >&5
+$as_echo_n "checking for $ac_word... " >&6; }
+if ${ac_cv_prog_ac_ct_PKG_CONFIG+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ if test -n "$ac_ct_PKG_CONFIG"; then
+ ac_cv_prog_ac_ct_PKG_CONFIG="$ac_ct_PKG_CONFIG" # Let the user override the test.
+else
+as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH
+do
+ IFS=$as_save_IFS
+ test -z "$as_dir" && as_dir=.
+ for ac_exec_ext in '' $ac_executable_extensions; do
+ if as_fn_executable_p "$as_dir/$ac_word$ac_exec_ext"; then
+ ac_cv_prog_ac_ct_PKG_CONFIG="pkg-config"
+ $as_echo "$as_me:${as_lineno-$LINENO}: found $as_dir/$ac_word$ac_exec_ext" >&5
+ break 2
+ fi
+done
+ done
+IFS=$as_save_IFS
+
+fi
+fi
+ac_ct_PKG_CONFIG=$ac_cv_prog_ac_ct_PKG_CONFIG
+if test -n "$ac_ct_PKG_CONFIG"; then
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_ct_PKG_CONFIG" >&5
+$as_echo "$ac_ct_PKG_CONFIG" >&6; }
+else
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5
+$as_echo "no" >&6; }
+fi
+
+ if test "x$ac_ct_PKG_CONFIG" = x; then
+ PKG_CONFIG="false"
+ else
+ case $cross_compiling:$ac_tool_warned in
+yes:)
+{ $as_echo "$as_me:${as_lineno-$LINENO}: WARNING: using cross tools not prefixed with host triplet" >&5
+$as_echo "$as_me: WARNING: using cross tools not prefixed with host triplet" >&2;}
+ac_tool_warned=yes ;;
+esac
+ PKG_CONFIG=$ac_ct_PKG_CONFIG
+ fi
+else
+ PKG_CONFIG="$ac_cv_prog_PKG_CONFIG"
+fi
+
+##tldbg _KPSE_LIB_FLAGS: Setup kpathsea (-lkpathsea) flags.
+echo 'tldbg:_KPSE_LIB_FLAGS called: libdir=kpathsea, libname=kpathsea, options=lt, tlincl=-IBLD/texk -ISRC/texk, tllib=BLD/texk/kpathsea/libkpathsea.la, tlextra=, rebuildsrcdeps=${top_srcdir}/../kpathsea/*.[ch], rebuildblddeps=${top_builddir}/../kpathsea/paths.h.' >&5
+##tldbg _KPSE_LIB_FLAGS_TL: kpathsea (kpathsea) lt.
+
+# Check whether --with-system-kpathsea was given.
+if test "${with_system_kpathsea+set}" = set; then :
+ withval=$with_system_kpathsea;
+fi
+if test "x$with_system_kpathsea" = xyes; then
+ if $PKG_CONFIG kpathsea; then
+ KPATHSEA_INCLUDES=`$PKG_CONFIG kpathsea --cflags`
+ KPATHSEA_LIBS=`$PKG_CONFIG kpathsea --libs`
+elif test "x$need_kpathsea:$with_system_kpathsea" = xyes:yes; then
+ as_fn_error $? "did not find kpathsea" "$LINENO" 5
+fi
+else
+ KPATHSEA_INCLUDES="-I$kpse_BLD/texk -I$kpse_SRC/texk"
+ KPATHSEA_LIBS="$kpse_BLD/texk/kpathsea/libkpathsea.la"
+ KPATHSEA_DEPEND='${top_builddir}/../kpathsea/libkpathsea.la'
+ KPATHSEA_RULE='# Rebuild libkpathsea
+$(KPATHSEA_DEPEND): ${top_srcdir}/../kpathsea/*.[ch] ${top_builddir}/../kpathsea/paths.h
+ cd ${top_builddir}/../kpathsea && $(MAKE) $(AM_MAKEFLAGS) rebuild
+${top_builddir}/../kpathsea/paths.h:
+ cd ${top_builddir}/../kpathsea && $(MAKE) $(AM_MAKEFLAGS) rebuild'
+fi
+
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking if libkpathsea supports debugging" >&5
+$as_echo_n "checking if libkpathsea supports debugging... " >&6; }
+if ${kpse_cv_kpse_debug+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ eval CPPFLAGS=\"$KPATHSEA_INCLUDES \$CPPFLAGS\"
+eval LIBS=\"$KPATHSEA_LIBS \$LIBS\"
+
+ cat confdefs.h - <<_ACEOF >conftest.$ac_ext
+/* end confdefs.h. */
+#include <kpathsea/kpathsea.h>
+int
+main ()
+{
+FILE *f = fopen("f", "r")
+ ;
+ return 0;
+}
+_ACEOF
+if ac_fn_c_try_link "$LINENO"; then :
+ kpse_cv_kpse_debug=yes
+else
+ kpse_cv_kpse_debug=no
+fi
+rm -f core conftest.err conftest.$ac_objext \
+ conftest$ac_exeext conftest.$ac_ext
+ CPPFLAGS=$kpse_save_CPPFLAGS
+LIBS=$kpse_save_LIBS
+
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $kpse_cv_kpse_debug" >&5
+$as_echo "$kpse_cv_kpse_debug" >&6; }
+if test "x$kpse_cv_kpse_debug" != xyes; then :
+ KPATHSEA_INCLUDES="$KPATHSEA_INCLUDES -DNO_DEBUG"
+fi
+
+##tldbg _KPSE_LIB_FLAGS: Setup zlib (-lz) flags.
+echo 'tldbg:_KPSE_LIB_FLAGS called: libdir=zlib, libname=z, options=, tlincl=-IBLD/libs/zlib/include, tllib=BLD/libs/zlib/libz.a, tlextra=, rebuildsrcdeps=, rebuildblddeps=${top_builddir}/../../libs/zlib/include/zconf.h.' >&5
+##tldbg _KPSE_LIB_FLAGS_TL: zlib (z) .
+
+# Check whether --with-system-zlib was given.
+if test "${with_system_zlib+set}" = set; then :
+ withval=$with_system_zlib;
+fi
+
+# Check whether --with-zlib-includes was given.
+if test "${with_zlib_includes+set}" = set; then :
+ withval=$with_zlib_includes;
+fi
+
+# Check whether --with-zlib-libdir was given.
+if test "${with_zlib_libdir+set}" = set; then :
+ withval=$with_zlib_libdir;
+fi
+if test "x$with_system_zlib" = xyes; then
+ ##tldbg _KPSE_LIB_FLAGS_SYSTEM: zlib (z).
+if test "x$with_zlib_includes" != x && test "x$with_zlib_includes" != xyes; then
+ ZLIB_INCLUDES="-I$with_zlib_includes"
+fi
+ZLIB_LIBS="-lz"
+if test "x$with_zlib_libdir" != x && test "x$with_zlib_libdir" != xyes; then
+ ZLIB_LIBS="-L$with_zlib_libdir $ZLIB_LIBS"
+fi
+else
+ ZLIB_INCLUDES="-I$kpse_BLD/libs/zlib/include"
+ ZLIB_LIBS="$kpse_BLD/libs/zlib/libz.a"
+ ZLIB_DEPEND='${top_builddir}/../../libs/zlib/libz.a'
+ ZLIB_RULE='# Rebuild libz
+$(ZLIB_DEPEND): ${top_builddir}/../../libs/zlib/include/zconf.h
+ cd ${top_builddir}/../../libs/zlib && $(MAKE) $(AM_MAKEFLAGS) rebuild
+${top_builddir}/../../libs/zlib/include/zconf.h:
+ cd ${top_builddir}/../../libs/zlib && $(MAKE) $(AM_MAKEFLAGS) rebuild'
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking if <zlib.h> defines 'z_const'" >&5
+$as_echo_n "checking if <zlib.h> defines 'z_const'... " >&6; }
+if ${kpse_cv_have_decl_z_const+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ eval CPPFLAGS=\"$ZLIB_INCLUDES \$CPPFLAGS\"
+eval LIBS=\"$ZLIB_LIBS \$LIBS\"
+
+ cat confdefs.h - <<_ACEOF >conftest.$ac_ext
+/* end confdefs.h. */
+#include <zlib.h>
+int
+main ()
+{
+z_const char * foo();
+ ;
+ return 0;
+}
+_ACEOF
+if ac_fn_c_try_compile "$LINENO"; then :
+ kpse_cv_have_decl_z_const=yes
+else
+ kpse_cv_have_decl_z_const=no
+fi
+rm -f core conftest.err conftest.$ac_objext conftest.$ac_ext
+ CPPFLAGS=$kpse_save_CPPFLAGS
+LIBS=$kpse_save_LIBS
+
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $kpse_cv_have_decl_z_const" >&5
+$as_echo "$kpse_cv_have_decl_z_const" >&6; }
+case $kpse_cv_have_decl_z_const in #(
+ yes) :
+
+$as_echo "#define ZLIB_CONST 1" >>confdefs.h
+ ;; #(
+ *) :
+
+$as_echo "#define z_const /**/" >>confdefs.h
+ ;;
+esac
+
+##tldbg _KPSE_LIB_FLAGS: Setup libpng (-lpng) flags.
+echo 'tldbg:_KPSE_LIB_FLAGS called: libdir=libpng, libname=png, options=, tlincl=-IBLD/libs/libpng/include, tllib=BLD/libs/libpng/libpng.a, tlextra=, rebuildsrcdeps=, rebuildblddeps=${top_builddir}/../../libs/libpng/include/png.h.' >&5
+##tldbg _KPSE_LIB_FLAGS_TL: libpng (png) .
+
+# Check whether --with-system-libpng was given.
+if test "${with_system_libpng+set}" = set; then :
+ withval=$with_system_libpng;
+fi
+if test "x$with_system_libpng" = xyes; then
+ if $PKG_CONFIG libpng; then
+ LIBPNG_INCLUDES=`$PKG_CONFIG libpng --cflags`
+ LIBPNG_LIBS=`$PKG_CONFIG libpng --libs`
+elif test "x$need_libpng:$with_system_libpng" = xyes:yes; then
+ as_fn_error $? "did not find libpng" "$LINENO" 5
+fi
+else
+ LIBPNG_INCLUDES="-I$kpse_BLD/libs/libpng/include"
+ LIBPNG_LIBS="$kpse_BLD/libs/libpng/libpng.a"
+ LIBPNG_DEPEND='${top_builddir}/../../libs/libpng/libpng.a'
+ LIBPNG_RULE='# Rebuild libpng
+$(LIBPNG_DEPEND): ${top_builddir}/../../libs/libpng/include/png.h
+ cd ${top_builddir}/../../libs/libpng && $(MAKE) $(AM_MAKEFLAGS) rebuild
+${top_builddir}/../../libs/libpng/include/png.h:
+ cd ${top_builddir}/../../libs/libpng && $(MAKE) $(AM_MAKEFLAGS) rebuild'
+fi
+
+##tldbg _KPSE_LIB_FLAGS: Setup freetype2 (-lfreetype) flags.
+echo 'tldbg:_KPSE_LIB_FLAGS called: libdir=freetype2, libname=freetype, options=, tlincl=-IBLD/libs/freetype2/freetype2, tllib=BLD/libs/freetype2/libfreetype.a, tlextra=, rebuildsrcdeps=, rebuildblddeps=${top_builddir}/../../libs/freetype2/freetype2/ft2build.h.' >&5
+##tldbg _KPSE_LIB_FLAGS_TL: freetype2 (freetype) .
+
+# Check whether --with-system-freetype2 was given.
+if test "${with_system_freetype2+set}" = set; then :
+ withval=$with_system_freetype2;
+fi
+if test "x$with_system_freetype2" = xyes; then
+ if test -n "$ac_tool_prefix"; then
+ # Extract the first word of "${ac_tool_prefix}freetype-config", so it can be a program name with args.
+set dummy ${ac_tool_prefix}freetype-config; ac_word=$2
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $ac_word" >&5
+$as_echo_n "checking for $ac_word... " >&6; }
+if ${ac_cv_prog_FT2_CONFIG+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ if test -n "$FT2_CONFIG"; then
+ ac_cv_prog_FT2_CONFIG="$FT2_CONFIG" # Let the user override the test.
+else
+as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH
+do
+ IFS=$as_save_IFS
+ test -z "$as_dir" && as_dir=.
+ for ac_exec_ext in '' $ac_executable_extensions; do
+ if as_fn_executable_p "$as_dir/$ac_word$ac_exec_ext"; then
+ ac_cv_prog_FT2_CONFIG="${ac_tool_prefix}freetype-config"
+ $as_echo "$as_me:${as_lineno-$LINENO}: found $as_dir/$ac_word$ac_exec_ext" >&5
+ break 2
+ fi
+done
+ done
+IFS=$as_save_IFS
+
+fi
+fi
+FT2_CONFIG=$ac_cv_prog_FT2_CONFIG
+if test -n "$FT2_CONFIG"; then
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: $FT2_CONFIG" >&5
+$as_echo "$FT2_CONFIG" >&6; }
+else
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5
+$as_echo "no" >&6; }
+fi
+
+
+fi
+if test -z "$ac_cv_prog_FT2_CONFIG"; then
+ ac_ct_FT2_CONFIG=$FT2_CONFIG
+ # Extract the first word of "freetype-config", so it can be a program name with args.
+set dummy freetype-config; ac_word=$2
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $ac_word" >&5
+$as_echo_n "checking for $ac_word... " >&6; }
+if ${ac_cv_prog_ac_ct_FT2_CONFIG+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ if test -n "$ac_ct_FT2_CONFIG"; then
+ ac_cv_prog_ac_ct_FT2_CONFIG="$ac_ct_FT2_CONFIG" # Let the user override the test.
+else
+as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH
+do
+ IFS=$as_save_IFS
+ test -z "$as_dir" && as_dir=.
+ for ac_exec_ext in '' $ac_executable_extensions; do
+ if as_fn_executable_p "$as_dir/$ac_word$ac_exec_ext"; then
+ ac_cv_prog_ac_ct_FT2_CONFIG="freetype-config"
+ $as_echo "$as_me:${as_lineno-$LINENO}: found $as_dir/$ac_word$ac_exec_ext" >&5
+ break 2
+ fi
+done
+ done
+IFS=$as_save_IFS
+
+fi
+fi
+ac_ct_FT2_CONFIG=$ac_cv_prog_ac_ct_FT2_CONFIG
+if test -n "$ac_ct_FT2_CONFIG"; then
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_ct_FT2_CONFIG" >&5
+$as_echo "$ac_ct_FT2_CONFIG" >&6; }
+else
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5
+$as_echo "no" >&6; }
+fi
+
+ if test "x$ac_ct_FT2_CONFIG" = x; then
+ FT2_CONFIG="false"
+ else
+ case $cross_compiling:$ac_tool_warned in
+yes:)
+{ $as_echo "$as_me:${as_lineno-$LINENO}: WARNING: using cross tools not prefixed with host triplet" >&5
+$as_echo "$as_me: WARNING: using cross tools not prefixed with host triplet" >&2;}
+ac_tool_warned=yes ;;
+esac
+ FT2_CONFIG=$ac_ct_FT2_CONFIG
+ fi
+else
+ FT2_CONFIG="$ac_cv_prog_FT2_CONFIG"
+fi
+if test -n "$ac_tool_prefix"; then
+ # Extract the first word of "${ac_tool_prefix}pkg-config", so it can be a program name with args.
+set dummy ${ac_tool_prefix}pkg-config; ac_word=$2
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $ac_word" >&5
+$as_echo_n "checking for $ac_word... " >&6; }
+if ${ac_cv_prog_PKG_CONFIG+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ if test -n "$PKG_CONFIG"; then
+ ac_cv_prog_PKG_CONFIG="$PKG_CONFIG" # Let the user override the test.
+else
+as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH
+do
+ IFS=$as_save_IFS
+ test -z "$as_dir" && as_dir=.
+ for ac_exec_ext in '' $ac_executable_extensions; do
+ if as_fn_executable_p "$as_dir/$ac_word$ac_exec_ext"; then
+ ac_cv_prog_PKG_CONFIG="${ac_tool_prefix}pkg-config"
+ $as_echo "$as_me:${as_lineno-$LINENO}: found $as_dir/$ac_word$ac_exec_ext" >&5
+ break 2
+ fi
+done
+ done
+IFS=$as_save_IFS
+
+fi
+fi
+PKG_CONFIG=$ac_cv_prog_PKG_CONFIG
+if test -n "$PKG_CONFIG"; then
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: $PKG_CONFIG" >&5
+$as_echo "$PKG_CONFIG" >&6; }
+else
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5
+$as_echo "no" >&6; }
+fi
+
+
+fi
+if test -z "$ac_cv_prog_PKG_CONFIG"; then
+ ac_ct_PKG_CONFIG=$PKG_CONFIG
+ # Extract the first word of "pkg-config", so it can be a program name with args.
+set dummy pkg-config; ac_word=$2
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $ac_word" >&5
+$as_echo_n "checking for $ac_word... " >&6; }
+if ${ac_cv_prog_ac_ct_PKG_CONFIG+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ if test -n "$ac_ct_PKG_CONFIG"; then
+ ac_cv_prog_ac_ct_PKG_CONFIG="$ac_ct_PKG_CONFIG" # Let the user override the test.
+else
+as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH
+do
+ IFS=$as_save_IFS
+ test -z "$as_dir" && as_dir=.
+ for ac_exec_ext in '' $ac_executable_extensions; do
+ if as_fn_executable_p "$as_dir/$ac_word$ac_exec_ext"; then
+ ac_cv_prog_ac_ct_PKG_CONFIG="pkg-config"
+ $as_echo "$as_me:${as_lineno-$LINENO}: found $as_dir/$ac_word$ac_exec_ext" >&5
+ break 2
+ fi
+done
+ done
+IFS=$as_save_IFS
+
+fi
+fi
+ac_ct_PKG_CONFIG=$ac_cv_prog_ac_ct_PKG_CONFIG
+if test -n "$ac_ct_PKG_CONFIG"; then
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_ct_PKG_CONFIG" >&5
+$as_echo "$ac_ct_PKG_CONFIG" >&6; }
+else
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5
+$as_echo "no" >&6; }
+fi
+
+ if test "x$ac_ct_PKG_CONFIG" = x; then
+ PKG_CONFIG="false"
+ else
+ case $cross_compiling:$ac_tool_warned in
+yes:)
+{ $as_echo "$as_me:${as_lineno-$LINENO}: WARNING: using cross tools not prefixed with host triplet" >&5
+$as_echo "$as_me: WARNING: using cross tools not prefixed with host triplet" >&2;}
+ac_tool_warned=yes ;;
+esac
+ PKG_CONFIG=$ac_ct_PKG_CONFIG
+ fi
+else
+ PKG_CONFIG="$ac_cv_prog_PKG_CONFIG"
+fi
+if $FT2_CONFIG --ftversion >/dev/null 2>&1; then
+ FREETYPE2_INCLUDES=`$FT2_CONFIG --cflags`
+ FREETYPE2_LIBS=`$FT2_CONFIG --libs`
+elif $PKG_CONFIG --libs freetype2 >/dev/null 2>&1; then
+ FREETYPE2_INCLUDES=`$PKG_CONFIG --cflags freetype2`
+ FREETYPE2_LIBS=`$PKG_CONFIG --libs freetype2`
+elif test "x$need_freetype2:$with_system_freetype2" = xyes:yes; then
+ as_fn_error $? "did not find freetype-config required for system freetype2 library" "$LINENO" 5
+fi
+else
+ FREETYPE2_INCLUDES="-I$kpse_BLD/libs/freetype2/freetype2"
+ FREETYPE2_LIBS="$kpse_BLD/libs/freetype2/libfreetype.a"
+ FREETYPE2_DEPEND='${top_builddir}/../../libs/freetype2/libfreetype.a'
+ FREETYPE2_RULE='# Rebuild libfreetype
+$(FREETYPE2_DEPEND): ${top_builddir}/../../libs/freetype2/freetype2/ft2build.h
+ cd ${top_builddir}/../../libs/freetype2 && $(MAKE) $(AM_MAKEFLAGS) rebuild
+${top_builddir}/../../libs/freetype2/freetype2/ft2build.h:
+ cd ${top_builddir}/../../libs/freetype2 && $(MAKE) $(AM_MAKEFLAGS) rebuild'
+fi
+
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for native WIN32 or MINGW32" >&5
+$as_echo_n "checking for native WIN32 or MINGW32... " >&6; }
+if ${kpse_cv_have_win32+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ cat confdefs.h - <<_ACEOF >conftest.$ac_ext
+/* end confdefs.h. */
+#ifndef WIN32
+ choke me
+#endif
+int
+main ()
+{
+
+ ;
+ return 0;
+}
+_ACEOF
+if ac_fn_c_try_compile "$LINENO"; then :
+ cat confdefs.h - <<_ACEOF >conftest.$ac_ext
+/* end confdefs.h. */
+#ifndef __MINGW32__
+ choke me
+#endif
+int
+main ()
+{
+
+ ;
+ return 0;
+}
+_ACEOF
+if ac_fn_c_try_compile "$LINENO"; then :
+ kpse_cv_have_win32=mingw32
+else
+ kpse_cv_have_win32=native
+fi
+rm -f core conftest.err conftest.$ac_objext conftest.$ac_ext
+else
+ kpse_cv_have_win32=no
+fi
+rm -f core conftest.err conftest.$ac_objext conftest.$ac_ext
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $kpse_cv_have_win32" >&5
+$as_echo "$kpse_cv_have_win32" >&6; }
+
+##tldbg _KPSE_LIB_FLAGS: Setup gd (-lgd) flags.
+echo 'tldbg:_KPSE_LIB_FLAGS called: libdir=gd, libname=gd, options=, tlincl=-IBLD/libs/gd/include, tllib=BLD/libs/gd/libgd.a, tlextra=test "x$kpse_cv_have_win32" = xno || GD_INCLUDES="$GD_INCLUDES -DBGDWIN32 -DNONDLL", rebuildsrcdeps=, rebuildblddeps=${top_builddir}/../../libs/gd/include/gd.h.' >&5
+##tldbg _KPSE_LIB_FLAGS_TL: gd (gd) .
+
+# Check whether --with-system-gd was given.
+if test "${with_system_gd+set}" = set; then :
+ withval=$with_system_gd;
+fi
+
+# Check whether --with-gd-includes was given.
+if test "${with_gd_includes+set}" = set; then :
+ withval=$with_gd_includes;
+fi
+
+# Check whether --with-gd-libdir was given.
+if test "${with_gd_libdir+set}" = set; then :
+ withval=$with_gd_libdir;
+fi
+if test "x$with_system_gd" = xyes; then
+ ##tldbg _KPSE_LIB_FLAGS_SYSTEM: gd (gd).
+if test "x$with_gd_includes" != x && test "x$with_gd_includes" != xyes; then
+ GD_INCLUDES="-I$with_gd_includes"
+fi
+GD_LIBS="-lgd"
+if test "x$with_gd_libdir" != x && test "x$with_gd_libdir" != xyes; then
+ GD_LIBS="-L$with_gd_libdir $GD_LIBS"
+fi
+else
+ GD_INCLUDES="-I$kpse_BLD/libs/gd/include"
+ GD_LIBS="$kpse_BLD/libs/gd/libgd.a"
+ test "x$kpse_cv_have_win32" = xno || GD_INCLUDES="$GD_INCLUDES -DBGDWIN32 -DNONDLL"
+ GD_DEPEND='${top_builddir}/../../libs/gd/libgd.a'
+ GD_RULE='# Rebuild libgd
+$(GD_DEPEND): ${top_builddir}/../../libs/gd/include/gd.h
+ cd ${top_builddir}/../../libs/gd && $(MAKE) $(AM_MAKEFLAGS) rebuild
+${top_builddir}/../../libs/gd/include/gd.h:
+ cd ${top_builddir}/../../libs/gd && $(MAKE) $(AM_MAKEFLAGS) rebuild'
+fi
+
+
+# Assume we have freetype2.
+have_ft2=yes
+
+if test "x$enable_build" != xno || test -f config.force; then
+
+# Checks for more libraries.
+eval CPPFLAGS=\"$ZLIB_INCLUDES \$CPPFLAGS\"
+eval LIBS=\"$ZLIB_LIBS \$LIBS\"
+
+ac_fn_c_check_func "$LINENO" "deflate" "ac_cv_func_deflate"
+if test "x$ac_cv_func_deflate" = xyes; then :
+
+$as_echo "#define HAVE_LIBZ 1" >>confdefs.h
+
+fi
+
+
+eval CPPFLAGS=\"$LIBPNG_INCLUDES \$CPPFLAGS\"
+eval LIBS=\"$LIBPNG_LIBS \$LIBS\"
+
+ac_fn_c_check_func "$LINENO" "png_read_image" "ac_cv_func_png_read_image"
+if test "x$ac_cv_func_png_read_image" = xyes; then :
+
+$as_echo "#define HAVE_LIBPNG 1" >>confdefs.h
+
+else
+ as_fn_error $? "cannot find/use libpng" "$LINENO" 5
+fi
+
+
+eval CPPFLAGS=\"$FREETYPE2_INCLUDES \$CPPFLAGS\"
+eval LIBS=\"$FREETYPE2_LIBS \$LIBS\"
+
+ac_fn_c_check_func "$LINENO" "FT_Init_FreeType" "ac_cv_func_FT_Init_FreeType"
+if test "x$ac_cv_func_FT_Init_FreeType" = xyes; then :
+
+$as_echo "#define HAVE_FT2 1" >>confdefs.h
+
+else
+ have_ft2=no
+fi
+
+
+eval CPPFLAGS=\"$GD_INCLUDES \$CPPFLAGS\"
+eval LIBS=\"$GD_LIBS \$LIBS\"
+
+ac_fn_c_check_func "$LINENO" "gdImageCreate" "ac_cv_func_gdImageCreate"
+if test "x$ac_cv_func_gdImageCreate" = xyes; then :
+
+$as_echo "#define HAVE_LIBGD 1" >>confdefs.h
+
+else
+ as_fn_error $? "cannot find/use gd
+This drawing library can be downloaded at http://www.boutell.com/gd" "$LINENO" 5
+fi
+
+
+eval CPPFLAGS=\"$KPATHSEA_INCLUDES \$CPPFLAGS\"
+eval LIBS=\"$KPATHSEA_LIBS \$LIBS\"
+
+ac_fn_c_check_func "$LINENO" "kpse_set_program_name" "ac_cv_func_kpse_set_program_name"
+if test "x$ac_cv_func_kpse_set_program_name" = xyes; then :
+
+$as_echo "#define HAVE_LIBKPATHSEA 1" >>confdefs.h
+
+else
+ as_fn_error $? "cannot find/use libkpathsea" "$LINENO" 5
+fi
+
+
+for ac_func in kpse_program_basename
+do :
+ ac_fn_c_check_func "$LINENO" "kpse_program_basename" "ac_cv_func_kpse_program_basename"
+if test "x$ac_cv_func_kpse_program_basename" = xyes; then :
+ cat >>confdefs.h <<_ACEOF
+#define HAVE_KPSE_PROGRAM_BASENAME 1
+_ACEOF
+
+fi
+done
+
+
+if test "x$kpse_cv_have_win32" != xno; then :
+ for ac_func in texlive_gs_init
+do :
+ ac_fn_c_check_func "$LINENO" "texlive_gs_init" "ac_cv_func_texlive_gs_init"
+if test "x$ac_cv_func_texlive_gs_init" = xyes; then :
+ cat >>confdefs.h <<_ACEOF
+#define HAVE_TEXLIVE_GS_INIT 1
+_ACEOF
+
+fi
+done
+
+fi
+
+
+# We need enc, cmap, and sfd formats.
+# Introduced together with opentype format (Dec 2003).
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking whether kpathsea declares the kpse_opentype_format" >&5
+$as_echo_n "checking whether kpathsea declares the kpse_opentype_format... " >&6; }
+if ${kpse_cv_have_opentype_format+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ cat confdefs.h - <<_ACEOF >conftest.$ac_ext
+/* end confdefs.h. */
+#include <kpathsea/kpathsea.h>
+int
+main ()
+{
+kpse_opentype_format
+ ;
+ return 0;
+}
+_ACEOF
+if ac_fn_c_try_link "$LINENO"; then :
+ kpse_cv_have_opentype_format=yes
+else
+ kpse_cv_have_opentype_format=no
+fi
+rm -f core conftest.err conftest.$ac_objext \
+ conftest$ac_exeext conftest.$ac_ext
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $kpse_cv_have_opentype_format" >&5
+$as_echo "$kpse_cv_have_opentype_format" >&6; }
+if test "x$kpse_cv_have_opentype_format" = xyes; then :
+
+$as_echo "#define HAVE_KPSE_ENC_FORMATS 1" >>confdefs.h
+
+fi
+
+
+# Checks for more header files.
+for ac_header in gd.h png.h kpathsea/kpathsea.h
+do :
+ as_ac_Header=`$as_echo "ac_cv_header_$ac_header" | $as_tr_sh`
+ac_fn_c_check_header_mongrel "$LINENO" "$ac_header" "$as_ac_Header" "$ac_includes_default"
+if eval test \"x\$"$as_ac_Header"\" = x"yes"; then :
+ cat >>confdefs.h <<_ACEOF
+#define `$as_echo "HAVE_$ac_header" | $as_tr_cpp` 1
+_ACEOF
+
+else
+ as_fn_error $? "cannot find/use $ac_header" "$LINENO" 5
+fi
+
+done
+
+
+# Checks for more library functions.
+for ac_func in gdImageCreateTrueColor gdImageCreateFromJpeg gdImagePngEx gdImageCreateFromPngPtr gdImageGif FT_Library_Version
+do :
+ as_ac_var=`$as_echo "ac_cv_func_$ac_func" | $as_tr_sh`
+ac_fn_c_check_func "$LINENO" "$ac_func" "$as_ac_var"
+if eval test \"x\$"$as_ac_var"\" = x"yes"; then :
+ cat >>confdefs.h <<_ACEOF
+#define `$as_echo "HAVE_$ac_func" | $as_tr_cpp` 1
+_ACEOF
+
+fi
+done
+
+
+CPPFLAGS=$kpse_save_CPPFLAGS
+LIBS=$kpse_save_LIBS
+
+
+echo timestamp >config.force
+
+fi
+
+ if test "x$have_ft2" = xyes; then
+ have_ft2_TRUE=
+ have_ft2_FALSE='#'
+else
+ have_ft2_TRUE='#'
+ have_ft2_FALSE=
+fi
+
+ if test "x$ac_cv_func_gdImageGif" = xyes; then
+ have_gif_TRUE=
+ have_gif_FALSE='#'
+else
+ have_gif_TRUE='#'
+ have_gif_FALSE=
+fi
+
+
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result:
+** Configuration summary for $PACKAGE_STRING:
+
+ The -d (debug) switch is enabled: $enable_debug
+ Your gd is new enough (>=2.0) to enable
+ the --truecolor switch, full alpha
+ transparency, proper rescaling of
+ included bitmaps, and jpeg inclusion: $ac_cv_func_gdImageCreateTrueColor
+ Your gd has jpeg inclusion enabled: $ac_cv_func_gdImageCreateFromJpeg
+ Your gd is new enough (>=2.0.12) to
+ enable transparent backgrounds for EPS
+ inclusion and the -z (compression)
+ switch: $ac_cv_func_gdImagePngEx
+ Your gd is new enough (>=2.0.21) to
+ allow image creation from memory $ac_cv_func_gdImageCreateFromPngPtr
+ Your gd is new enough (>=2.0.28) to
+ enable gif inclusion and output
+ (dvigif): $ac_cv_func_gdImageGif
+ FreeType font rendering available: $ac_cv_func_FT_Init_FreeType
+ Support for subfonts (CJK-LaTeX): $ac_cv_func_FT_Init_FreeType
+" >&5
+$as_echo "
+** Configuration summary for $PACKAGE_STRING:
+
+ The -d (debug) switch is enabled: $enable_debug
+ Your gd is new enough (>=2.0) to enable
+ the --truecolor switch, full alpha
+ transparency, proper rescaling of
+ included bitmaps, and jpeg inclusion: $ac_cv_func_gdImageCreateTrueColor
+ Your gd has jpeg inclusion enabled: $ac_cv_func_gdImageCreateFromJpeg
+ Your gd is new enough (>=2.0.12) to
+ enable transparent backgrounds for EPS
+ inclusion and the -z (compression)
+ switch: $ac_cv_func_gdImagePngEx
+ Your gd is new enough (>=2.0.21) to
+ allow image creation from memory $ac_cv_func_gdImageCreateFromPngPtr
+ Your gd is new enough (>=2.0.28) to
+ enable gif inclusion and output
+ (dvigif): $ac_cv_func_gdImageGif
+ FreeType font rendering available: $ac_cv_func_FT_Init_FreeType
+ Support for subfonts (CJK-LaTeX): $ac_cv_func_FT_Init_FreeType
+" >&6; }
+
+ac_config_headers="$ac_config_headers config.h"
+
+
+DVIPNG_TREE=dvipng-src
+
+
+ if test "x$kpse_cv_have_win32" != xno; then
+ WIN32_TRUE=
+ WIN32_FALSE='#'
+else
+ WIN32_TRUE='#'
+ WIN32_FALSE=
+fi
+
+
+ if test -r "$srcdir/../texlive/w32_wrapper/callexe.c"; then
+ WIN32_CALL_TRUE=
+ WIN32_CALL_FALSE='#'
+else
+ WIN32_CALL_TRUE='#'
+ WIN32_CALL_FALSE=
+fi
+
+if test -z "$WIN32_TRUE"; then :
+ ac_config_links="$ac_config_links callexe.c:../texlive/w32_wrapper/callexe.c"
+
+fi
+
+
+ac_config_files="$ac_config_files Makefile help/Makefile doc/Makefile"
+
+
+cat >confcache <<\_ACEOF
+# This file is a shell script that caches the results of configure
+# tests run on this system so they can be shared between configure
+# scripts and configure runs, see configure's option --config-cache.
+# It is not useful on other systems. If it contains results you don't
+# want to keep, you may remove or edit it.
+#
+# config.status only pays attention to the cache file if you give it
+# the --recheck option to rerun configure.
+#
+# `ac_cv_env_foo' variables (set or unset) will be overridden when
+# loading this file, other *unset* `ac_cv_foo' will be assigned the
+# following values.
+
+_ACEOF
+
+# The following way of writing the cache mishandles newlines in values,
+# but we know of no workaround that is simple, portable, and efficient.
+# So, we kill variables containing newlines.
+# Ultrix sh set writes to stderr and can't be redirected directly,
+# and sets the high bit in the cache file unless we assign to the vars.
+(
+ for ac_var in `(set) 2>&1 | sed -n 's/^\([a-zA-Z_][a-zA-Z0-9_]*\)=.*/\1/p'`; do
+ eval ac_val=\$$ac_var
+ case $ac_val in #(
+ *${as_nl}*)
+ case $ac_var in #(
+ *_cv_*) { $as_echo "$as_me:${as_lineno-$LINENO}: WARNING: cache variable $ac_var contains a newline" >&5
+$as_echo "$as_me: WARNING: cache variable $ac_var contains a newline" >&2;} ;;
+ esac
+ case $ac_var in #(
+ _ | IFS | as_nl) ;; #(
+ BASH_ARGV | BASH_SOURCE) eval $ac_var= ;; #(
+ *) { eval $ac_var=; unset $ac_var;} ;;
+ esac ;;
+ esac
+ done
+
+ (set) 2>&1 |
+ case $as_nl`(ac_space=' '; set) 2>&1` in #(
+ *${as_nl}ac_space=\ *)
+ # `set' does not quote correctly, so add quotes: double-quote
+ # substitution turns \\\\ into \\, and sed turns \\ into \.
+ sed -n \
+ "s/'/'\\\\''/g;
+ s/^\\([_$as_cr_alnum]*_cv_[_$as_cr_alnum]*\\)=\\(.*\\)/\\1='\\2'/p"
+ ;; #(
+ *)
+ # `set' quotes correctly as required by POSIX, so do not add quotes.
+ sed -n "/^[_$as_cr_alnum]*_cv_[_$as_cr_alnum]*=/p"
+ ;;
+ esac |
+ sort
+) |
+ sed '
+ /^ac_cv_env_/b end
+ t clear
+ :clear
+ s/^\([^=]*\)=\(.*[{}].*\)$/test "${\1+set}" = set || &/
+ t end
+ s/^\([^=]*\)=\(.*\)$/\1=${\1=\2}/
+ :end' >>confcache
+if diff "$cache_file" confcache >/dev/null 2>&1; then :; else
+ if test -w "$cache_file"; then
+ if test "x$cache_file" != "x/dev/null"; then
+ { $as_echo "$as_me:${as_lineno-$LINENO}: updating cache $cache_file" >&5
+$as_echo "$as_me: updating cache $cache_file" >&6;}
+ if test ! -f "$cache_file" || test -h "$cache_file"; then
+ cat confcache >"$cache_file"
+ else
+ case $cache_file in #(
+ */* | ?:*)
+ mv -f confcache "$cache_file"$$ &&
+ mv -f "$cache_file"$$ "$cache_file" ;; #(
+ *)
+ mv -f confcache "$cache_file" ;;
+ esac
+ fi
+ fi
+ else
+ { $as_echo "$as_me:${as_lineno-$LINENO}: not updating unwritable cache $cache_file" >&5
+$as_echo "$as_me: not updating unwritable cache $cache_file" >&6;}
+ fi
+fi
+rm -f confcache
+
+test "x$prefix" = xNONE && prefix=$ac_default_prefix
+# Let make expand exec_prefix.
+test "x$exec_prefix" = xNONE && exec_prefix='${prefix}'
+
+DEFS=-DHAVE_CONFIG_H
+
+ac_libobjs=
+ac_ltlibobjs=
+U=
+for ac_i in : $LIBOBJS; do test "x$ac_i" = x: && continue
+ # 1. Remove the extension, and $U if already installed.
+ ac_script='s/\$U\././;s/\.o$//;s/\.obj$//'
+ ac_i=`$as_echo "$ac_i" | sed "$ac_script"`
+ # 2. Prepend LIBOBJDIR. When used with automake>=1.10 LIBOBJDIR
+ # will be set to the directory where LIBOBJS objects are built.
+ as_fn_append ac_libobjs " \${LIBOBJDIR}$ac_i\$U.$ac_objext"
+ as_fn_append ac_ltlibobjs " \${LIBOBJDIR}$ac_i"'$U.lo'
+done
+LIBOBJS=$ac_libobjs
+
+LTLIBOBJS=$ac_ltlibobjs
+
+
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking that generated files are newer than configure" >&5
+$as_echo_n "checking that generated files are newer than configure... " >&6; }
+ if test -n "$am_sleep_pid"; then
+ # Hide warnings about reused PIDs.
+ wait $am_sleep_pid 2>/dev/null
+ fi
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: done" >&5
+$as_echo "done" >&6; }
+ if test -n "$EXEEXT"; then
+ am__EXEEXT_TRUE=
+ am__EXEEXT_FALSE='#'
+else
+ am__EXEEXT_TRUE='#'
+ am__EXEEXT_FALSE=
+fi
+
+if test -z "${MAINTAINER_MODE_TRUE}" && test -z "${MAINTAINER_MODE_FALSE}"; then
+ as_fn_error $? "conditional \"MAINTAINER_MODE\" was never defined.
+Usually this means the macro was only invoked conditionally." "$LINENO" 5
+fi
+if test -z "${AMDEP_TRUE}" && test -z "${AMDEP_FALSE}"; then
+ as_fn_error $? "conditional \"AMDEP\" was never defined.
+Usually this means the macro was only invoked conditionally." "$LINENO" 5
+fi
+if test -z "${am__fastdepCC_TRUE}" && test -z "${am__fastdepCC_FALSE}"; then
+ as_fn_error $? "conditional \"am__fastdepCC\" was never defined.
+Usually this means the macro was only invoked conditionally." "$LINENO" 5
+fi
+if test -z "${cross_TRUE}" && test -z "${cross_FALSE}"; then
+ as_fn_error $? "conditional \"cross\" was never defined.
+Usually this means the macro was only invoked conditionally." "$LINENO" 5
+fi
+if test -z "${have_ft2_TRUE}" && test -z "${have_ft2_FALSE}"; then
+ as_fn_error $? "conditional \"have_ft2\" was never defined.
+Usually this means the macro was only invoked conditionally." "$LINENO" 5
+fi
+if test -z "${have_gif_TRUE}" && test -z "${have_gif_FALSE}"; then
+ as_fn_error $? "conditional \"have_gif\" was never defined.
+Usually this means the macro was only invoked conditionally." "$LINENO" 5
+fi
+if test -z "${WIN32_TRUE}" && test -z "${WIN32_FALSE}"; then
+ as_fn_error $? "conditional \"WIN32\" was never defined.
+Usually this means the macro was only invoked conditionally." "$LINENO" 5
+fi
+if test -z "${WIN32_CALL_TRUE}" && test -z "${WIN32_CALL_FALSE}"; then
+ as_fn_error $? "conditional \"WIN32_CALL\" was never defined.
+Usually this means the macro was only invoked conditionally." "$LINENO" 5
+fi
+
+: "${CONFIG_STATUS=./config.status}"
+ac_write_fail=0
+ac_clean_files_save=$ac_clean_files
+ac_clean_files="$ac_clean_files $CONFIG_STATUS"
+{ $as_echo "$as_me:${as_lineno-$LINENO}: creating $CONFIG_STATUS" >&5
+$as_echo "$as_me: creating $CONFIG_STATUS" >&6;}
+as_write_fail=0
+cat >$CONFIG_STATUS <<_ASEOF || as_write_fail=1
+#! $SHELL
+# Generated by $as_me.
+# Run this file to recreate the current configuration.
+# Compiler output produced by configure, useful for debugging
+# configure, is in config.log if it exists.
+
+debug=false
+ac_cs_recheck=false
+ac_cs_silent=false
+
+SHELL=\${CONFIG_SHELL-$SHELL}
+export SHELL
+_ASEOF
+cat >>$CONFIG_STATUS <<\_ASEOF || as_write_fail=1
+## -------------------- ##
+## M4sh Initialization. ##
+## -------------------- ##
+
+# Be more Bourne compatible
+DUALCASE=1; export DUALCASE # for MKS sh
+if test -n "${ZSH_VERSION+set}" && (emulate sh) >/dev/null 2>&1; then :
+ emulate sh
+ NULLCMD=:
+ # Pre-4.2 versions of Zsh do word splitting on ${1+"$@"}, which
+ # is contrary to our usage. Disable this feature.
+ alias -g '${1+"$@"}'='"$@"'
+ setopt NO_GLOB_SUBST
+else
+ case `(set -o) 2>/dev/null` in #(
+ *posix*) :
+ set -o posix ;; #(
+ *) :
+ ;;
+esac
+fi
+
+
+as_nl='
+'
+export as_nl
+# Printing a long string crashes Solaris 7 /usr/bin/printf.
+as_echo='\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\'
+as_echo=$as_echo$as_echo$as_echo$as_echo$as_echo
+as_echo=$as_echo$as_echo$as_echo$as_echo$as_echo$as_echo
+# Prefer a ksh shell builtin over an external printf program on Solaris,
+# but without wasting forks for bash or zsh.
+if test -z "$BASH_VERSION$ZSH_VERSION" \
+ && (test "X`print -r -- $as_echo`" = "X$as_echo") 2>/dev/null; then
+ as_echo='print -r --'
+ as_echo_n='print -rn --'
+elif (test "X`printf %s $as_echo`" = "X$as_echo") 2>/dev/null; then
+ as_echo='printf %s\n'
+ as_echo_n='printf %s'
+else
+ if test "X`(/usr/ucb/echo -n -n $as_echo) 2>/dev/null`" = "X-n $as_echo"; then
+ as_echo_body='eval /usr/ucb/echo -n "$1$as_nl"'
+ as_echo_n='/usr/ucb/echo -n'
+ else
+ as_echo_body='eval expr "X$1" : "X\\(.*\\)"'
+ as_echo_n_body='eval
+ arg=$1;
+ case $arg in #(
+ *"$as_nl"*)
+ expr "X$arg" : "X\\(.*\\)$as_nl";
+ arg=`expr "X$arg" : ".*$as_nl\\(.*\\)"`;;
+ esac;
+ expr "X$arg" : "X\\(.*\\)" | tr -d "$as_nl"
+ '
+ export as_echo_n_body
+ as_echo_n='sh -c $as_echo_n_body as_echo'
+ fi
+ export as_echo_body
+ as_echo='sh -c $as_echo_body as_echo'
+fi
+
+# The user is always right.
+if test "${PATH_SEPARATOR+set}" != set; then
+ PATH_SEPARATOR=:
+ (PATH='/bin;/bin'; FPATH=$PATH; sh -c :) >/dev/null 2>&1 && {
+ (PATH='/bin:/bin'; FPATH=$PATH; sh -c :) >/dev/null 2>&1 ||
+ PATH_SEPARATOR=';'
+ }
+fi
+
+
+# IFS
+# We need space, tab and new line, in precisely that order. Quoting is
+# there to prevent editors from complaining about space-tab.
+# (If _AS_PATH_WALK were called with IFS unset, it would disable word
+# splitting by setting IFS to empty value.)
+IFS=" "" $as_nl"
+
+# Find who we are. Look in the path if we contain no directory separator.
+as_myself=
+case $0 in #((
+ *[\\/]* ) as_myself=$0 ;;
+ *) as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH
+do
+ IFS=$as_save_IFS
+ test -z "$as_dir" && as_dir=.
+ test -r "$as_dir/$0" && as_myself=$as_dir/$0 && break
+ done
+IFS=$as_save_IFS
+
+ ;;
+esac
+# We did not find ourselves, most probably we were run as `sh COMMAND'
+# in which case we are not to be found in the path.
+if test "x$as_myself" = x; then
+ as_myself=$0
+fi
+if test ! -f "$as_myself"; then
+ $as_echo "$as_myself: error: cannot find myself; rerun with an absolute file name" >&2
+ exit 1
+fi
+
+# Unset variables that we do not need and which cause bugs (e.g. in
+# pre-3.0 UWIN ksh). But do not cause bugs in bash 2.01; the "|| exit 1"
+# suppresses any "Segmentation fault" message there. '((' could
+# trigger a bug in pdksh 5.2.14.
+for as_var in BASH_ENV ENV MAIL MAILPATH
+do eval test x\${$as_var+set} = xset \
+ && ( (unset $as_var) || exit 1) >/dev/null 2>&1 && unset $as_var || :
+done
+PS1='$ '
+PS2='> '
+PS4='+ '
+
+# NLS nuisances.
+LC_ALL=C
+export LC_ALL
+LANGUAGE=C
+export LANGUAGE
+
+# CDPATH.
+(unset CDPATH) >/dev/null 2>&1 && unset CDPATH
+
+
+# as_fn_error STATUS ERROR [LINENO LOG_FD]
+# ----------------------------------------
+# Output "`basename $0`: error: ERROR" to stderr. If LINENO and LOG_FD are
+# provided, also output the error to LOG_FD, referencing LINENO. Then exit the
+# script with STATUS, using 1 if that was 0.
+as_fn_error ()
+{
+ as_status=$1; test $as_status -eq 0 && as_status=1
+ if test "$4"; then
+ as_lineno=${as_lineno-"$3"} as_lineno_stack=as_lineno_stack=$as_lineno_stack
+ $as_echo "$as_me:${as_lineno-$LINENO}: error: $2" >&$4
+ fi
+ $as_echo "$as_me: error: $2" >&2
+ as_fn_exit $as_status
+} # as_fn_error
+
+
+# as_fn_set_status STATUS
+# -----------------------
+# Set $? to STATUS, without forking.
+as_fn_set_status ()
+{
+ return $1
+} # as_fn_set_status
+
+# as_fn_exit STATUS
+# -----------------
+# Exit the shell with STATUS, even in a "trap 0" or "set -e" context.
+as_fn_exit ()
+{
+ set +e
+ as_fn_set_status $1
+ exit $1
+} # as_fn_exit
+
+# as_fn_unset VAR
+# ---------------
+# Portably unset VAR.
+as_fn_unset ()
+{
+ { eval $1=; unset $1;}
+}
+as_unset=as_fn_unset
+# as_fn_append VAR VALUE
+# ----------------------
+# Append the text in VALUE to the end of the definition contained in VAR. Take
+# advantage of any shell optimizations that allow amortized linear growth over
+# repeated appends, instead of the typical quadratic growth present in naive
+# implementations.
+if (eval "as_var=1; as_var+=2; test x\$as_var = x12") 2>/dev/null; then :
+ eval 'as_fn_append ()
+ {
+ eval $1+=\$2
+ }'
+else
+ as_fn_append ()
+ {
+ eval $1=\$$1\$2
+ }
+fi # as_fn_append
+
+# as_fn_arith ARG...
+# ------------------
+# Perform arithmetic evaluation on the ARGs, and store the result in the
+# global $as_val. Take advantage of shells that can avoid forks. The arguments
+# must be portable across $(()) and expr.
+if (eval "test \$(( 1 + 1 )) = 2") 2>/dev/null; then :
+ eval 'as_fn_arith ()
+ {
+ as_val=$(( $* ))
+ }'
+else
+ as_fn_arith ()
+ {
+ as_val=`expr "$@" || test $? -eq 1`
+ }
+fi # as_fn_arith
+
+
+if expr a : '\(a\)' >/dev/null 2>&1 &&
+ test "X`expr 00001 : '.*\(...\)'`" = X001; then
+ as_expr=expr
+else
+ as_expr=false
+fi
+
+if (basename -- /) >/dev/null 2>&1 && test "X`basename -- / 2>&1`" = "X/"; then
+ as_basename=basename
+else
+ as_basename=false
+fi
+
+if (as_dir=`dirname -- /` && test "X$as_dir" = X/) >/dev/null 2>&1; then
+ as_dirname=dirname
+else
+ as_dirname=false
+fi
+
+as_me=`$as_basename -- "$0" ||
+$as_expr X/"$0" : '.*/\([^/][^/]*\)/*$' \| \
+ X"$0" : 'X\(//\)$' \| \
+ X"$0" : 'X\(/\)' \| . 2>/dev/null ||
+$as_echo X/"$0" |
+ sed '/^.*\/\([^/][^/]*\)\/*$/{
+ s//\1/
+ q
+ }
+ /^X\/\(\/\/\)$/{
+ s//\1/
+ q
+ }
+ /^X\/\(\/\).*/{
+ s//\1/
+ q
+ }
+ s/.*/./; q'`
+
+# Avoid depending upon Character Ranges.
+as_cr_letters='abcdefghijklmnopqrstuvwxyz'
+as_cr_LETTERS='ABCDEFGHIJKLMNOPQRSTUVWXYZ'
+as_cr_Letters=$as_cr_letters$as_cr_LETTERS
+as_cr_digits='0123456789'
+as_cr_alnum=$as_cr_Letters$as_cr_digits
+
+ECHO_C= ECHO_N= ECHO_T=
+case `echo -n x` in #(((((
+-n*)
+ case `echo 'xy\c'` in
+ *c*) ECHO_T=' ';; # ECHO_T is single tab character.
+ xy) ECHO_C='\c';;
+ *) echo `echo ksh88 bug on AIX 6.1` > /dev/null
+ ECHO_T=' ';;
+ esac;;
+*)
+ ECHO_N='-n';;
+esac
+
+rm -f conf$$ conf$$.exe conf$$.file
+if test -d conf$$.dir; then
+ rm -f conf$$.dir/conf$$.file
+else
+ rm -f conf$$.dir
+ mkdir conf$$.dir 2>/dev/null
+fi
+if (echo >conf$$.file) 2>/dev/null; then
+ if ln -s conf$$.file conf$$ 2>/dev/null; then
+ as_ln_s='ln -s'
+ # ... but there are two gotchas:
+ # 1) On MSYS, both `ln -s file dir' and `ln file dir' fail.
+ # 2) DJGPP < 2.04 has no symlinks; `ln -s' creates a wrapper executable.
+ # In both cases, we have to default to `cp -pR'.
+ ln -s conf$$.file conf$$.dir 2>/dev/null && test ! -f conf$$.exe ||
+ as_ln_s='cp -pR'
+ elif ln conf$$.file conf$$ 2>/dev/null; then
+ as_ln_s=ln
+ else
+ as_ln_s='cp -pR'
+ fi
+else
+ as_ln_s='cp -pR'
+fi
+rm -f conf$$ conf$$.exe conf$$.dir/conf$$.file conf$$.file
+rmdir conf$$.dir 2>/dev/null
+
+
+# as_fn_mkdir_p
+# -------------
+# Create "$as_dir" as a directory, including parents if necessary.
+as_fn_mkdir_p ()
+{
+
+ case $as_dir in #(
+ -*) as_dir=./$as_dir;;
+ esac
+ test -d "$as_dir" || eval $as_mkdir_p || {
+ as_dirs=
+ while :; do
+ case $as_dir in #(
+ *\'*) as_qdir=`$as_echo "$as_dir" | sed "s/'/'\\\\\\\\''/g"`;; #'(
+ *) as_qdir=$as_dir;;
+ esac
+ as_dirs="'$as_qdir' $as_dirs"
+ as_dir=`$as_dirname -- "$as_dir" ||
+$as_expr X"$as_dir" : 'X\(.*[^/]\)//*[^/][^/]*/*$' \| \
+ X"$as_dir" : 'X\(//\)[^/]' \| \
+ X"$as_dir" : 'X\(//\)$' \| \
+ X"$as_dir" : 'X\(/\)' \| . 2>/dev/null ||
+$as_echo X"$as_dir" |
+ sed '/^X\(.*[^/]\)\/\/*[^/][^/]*\/*$/{
+ s//\1/
+ q
+ }
+ /^X\(\/\/\)[^/].*/{
+ s//\1/
+ q
+ }
+ /^X\(\/\/\)$/{
+ s//\1/
+ q
+ }
+ /^X\(\/\).*/{
+ s//\1/
+ q
+ }
+ s/.*/./; q'`
+ test -d "$as_dir" && break
+ done
+ test -z "$as_dirs" || eval "mkdir $as_dirs"
+ } || test -d "$as_dir" || as_fn_error $? "cannot create directory $as_dir"
+
+
+} # as_fn_mkdir_p
+if mkdir -p . 2>/dev/null; then
+ as_mkdir_p='mkdir -p "$as_dir"'
+else
+ test -d ./-p && rmdir ./-p
+ as_mkdir_p=false
+fi
+
+
+# as_fn_executable_p FILE
+# -----------------------
+# Test if FILE is an executable regular file.
+as_fn_executable_p ()
+{
+ test -f "$1" && test -x "$1"
+} # as_fn_executable_p
+as_test_x='test -x'
+as_executable_p=as_fn_executable_p
+
+# Sed expression to map a string onto a valid CPP name.
+as_tr_cpp="eval sed 'y%*$as_cr_letters%P$as_cr_LETTERS%;s%[^_$as_cr_alnum]%_%g'"
+
+# Sed expression to map a string onto a valid variable name.
+as_tr_sh="eval sed 'y%*+%pp%;s%[^_$as_cr_alnum]%_%g'"
+
+
+exec 6>&1
+## ----------------------------------- ##
+## Main body of $CONFIG_STATUS script. ##
+## ----------------------------------- ##
+_ASEOF
+test $as_write_fail = 0 && chmod +x $CONFIG_STATUS || ac_write_fail=1
+
+cat >>$CONFIG_STATUS <<\_ACEOF || ac_write_fail=1
+# Save the log message, to keep $0 and so on meaningful, and to
+# report actual input values of CONFIG_FILES etc. instead of their
+# values after options handling.
+ac_log="
+This file was extended by dvipng (TeX Live) $as_me 1.17, which was
+generated by GNU Autoconf 2.69. Invocation command line was
+
+ CONFIG_FILES = $CONFIG_FILES
+ CONFIG_HEADERS = $CONFIG_HEADERS
+ CONFIG_LINKS = $CONFIG_LINKS
+ CONFIG_COMMANDS = $CONFIG_COMMANDS
+ $ $0 $@
+
+on `(hostname || uname -n) 2>/dev/null | sed 1q`
+"
+
+_ACEOF
+
+case $ac_config_files in *"
+"*) set x $ac_config_files; shift; ac_config_files=$*;;
+esac
+
+case $ac_config_headers in *"
+"*) set x $ac_config_headers; shift; ac_config_headers=$*;;
+esac
+
+
+cat >>$CONFIG_STATUS <<_ACEOF || ac_write_fail=1
+# Files that config.status was made for.
+config_files="$ac_config_files"
+config_headers="$ac_config_headers"
+config_links="$ac_config_links"
+config_commands="$ac_config_commands"
+
+_ACEOF
+
+cat >>$CONFIG_STATUS <<\_ACEOF || ac_write_fail=1
+ac_cs_usage="\
+\`$as_me' instantiates files and other configuration actions
+from templates according to the current configuration. Unless the files
+and actions are specified as TAGs, all are instantiated by default.
+
+Usage: $0 [OPTION]... [TAG]...
+
+ -h, --help print this help, then exit
+ -V, --version print version number and configuration settings, then exit
+ --config print configuration, then exit
+ -q, --quiet, --silent
+ do not print progress messages
+ -d, --debug don't remove temporary files
+ --recheck update $as_me by reconfiguring in the same conditions
+ --file=FILE[:TEMPLATE]
+ instantiate the configuration file FILE
+ --header=FILE[:TEMPLATE]
+ instantiate the configuration header FILE
+
+Configuration files:
+$config_files
+
+Configuration headers:
+$config_headers
+
+Configuration links:
+$config_links
+
+Configuration commands:
+$config_commands
+
+Report bugs to <tex-k@tug.org>."
+
+_ACEOF
+cat >>$CONFIG_STATUS <<_ACEOF || ac_write_fail=1
+ac_cs_config="`$as_echo "$ac_configure_args" | sed 's/^ //; s/[\\""\`\$]/\\\\&/g'`"
+ac_cs_version="\\
+dvipng (TeX Live) config.status 1.17
+configured by $0, generated by GNU Autoconf 2.69,
+ with options \\"\$ac_cs_config\\"
+
+Copyright (C) 2012 Free Software Foundation, Inc.
+This config.status script is free software; the Free Software Foundation
+gives unlimited permission to copy, distribute and modify it."
+
+ac_pwd='$ac_pwd'
+srcdir='$srcdir'
+INSTALL='$INSTALL'
+MKDIR_P='$MKDIR_P'
+AWK='$AWK'
+test -n "\$AWK" || AWK=awk
+_ACEOF
+
+cat >>$CONFIG_STATUS <<\_ACEOF || ac_write_fail=1
+# The default lists apply if the user does not specify any file.
+ac_need_defaults=:
+while test $# != 0
+do
+ case $1 in
+ --*=?*)
+ ac_option=`expr "X$1" : 'X\([^=]*\)='`
+ ac_optarg=`expr "X$1" : 'X[^=]*=\(.*\)'`
+ ac_shift=:
+ ;;
+ --*=)
+ ac_option=`expr "X$1" : 'X\([^=]*\)='`
+ ac_optarg=
+ ac_shift=:
+ ;;
+ *)
+ ac_option=$1
+ ac_optarg=$2
+ ac_shift=shift
+ ;;
+ esac
+
+ case $ac_option in
+ # Handling of the options.
+ -recheck | --recheck | --rechec | --reche | --rech | --rec | --re | --r)
+ ac_cs_recheck=: ;;
+ --version | --versio | --versi | --vers | --ver | --ve | --v | -V )
+ $as_echo "$ac_cs_version"; exit ;;
+ --config | --confi | --conf | --con | --co | --c )
+ $as_echo "$ac_cs_config"; exit ;;
+ --debug | --debu | --deb | --de | --d | -d )
+ debug=: ;;
+ --file | --fil | --fi | --f )
+ $ac_shift
+ case $ac_optarg in
+ *\'*) ac_optarg=`$as_echo "$ac_optarg" | sed "s/'/'\\\\\\\\''/g"` ;;
+ '') as_fn_error $? "missing file argument" ;;
+ esac
+ as_fn_append CONFIG_FILES " '$ac_optarg'"
+ ac_need_defaults=false;;
+ --header | --heade | --head | --hea )
+ $ac_shift
+ case $ac_optarg in
+ *\'*) ac_optarg=`$as_echo "$ac_optarg" | sed "s/'/'\\\\\\\\''/g"` ;;
+ esac
+ as_fn_append CONFIG_HEADERS " '$ac_optarg'"
+ ac_need_defaults=false;;
+ --he | --h)
+ # Conflict between --help and --header
+ as_fn_error $? "ambiguous option: \`$1'
+Try \`$0 --help' for more information.";;
+ --help | --hel | -h )
+ $as_echo "$ac_cs_usage"; exit ;;
+ -q | -quiet | --quiet | --quie | --qui | --qu | --q \
+ | -silent | --silent | --silen | --sile | --sil | --si | --s)
+ ac_cs_silent=: ;;
+
+ # This is an error.
+ -*) as_fn_error $? "unrecognized option: \`$1'
+Try \`$0 --help' for more information." ;;
+
+ *) as_fn_append ac_config_targets " $1"
+ ac_need_defaults=false ;;
+
+ esac
+ shift
+done
+
+ac_configure_extra_args=
+
+if $ac_cs_silent; then
+ exec 6>/dev/null
+ ac_configure_extra_args="$ac_configure_extra_args --silent"
+fi
+
+_ACEOF
+cat >>$CONFIG_STATUS <<_ACEOF || ac_write_fail=1
+if \$ac_cs_recheck; then
+ set X $SHELL '$0' $ac_configure_args \$ac_configure_extra_args --no-create --no-recursion
+ shift
+ \$as_echo "running CONFIG_SHELL=$SHELL \$*" >&6
+ CONFIG_SHELL='$SHELL'
+ export CONFIG_SHELL
+ exec "\$@"
+fi
+
+_ACEOF
+cat >>$CONFIG_STATUS <<\_ACEOF || ac_write_fail=1
+exec 5>>config.log
+{
+ echo
+ sed 'h;s/./-/g;s/^.../## /;s/...$/ ##/;p;x;p;x' <<_ASBOX
+## Running $as_me. ##
+_ASBOX
+ $as_echo "$ac_log"
+} >&5
+
+_ACEOF
+cat >>$CONFIG_STATUS <<_ACEOF || ac_write_fail=1
+#
+# INIT-COMMANDS
+#
+AMDEP_TRUE="$AMDEP_TRUE" MAKE="${MAKE-make}"
+
+
+# The HP-UX ksh and POSIX shell print the target directory to stdout
+# if CDPATH is set.
+(unset CDPATH) >/dev/null 2>&1 && unset CDPATH
+
+sed_quote_subst='$sed_quote_subst'
+double_quote_subst='$double_quote_subst'
+delay_variable_subst='$delay_variable_subst'
+macro_version='`$ECHO "$macro_version" | $SED "$delay_single_quote_subst"`'
+macro_revision='`$ECHO "$macro_revision" | $SED "$delay_single_quote_subst"`'
+AS='`$ECHO "$AS" | $SED "$delay_single_quote_subst"`'
+DLLTOOL='`$ECHO "$DLLTOOL" | $SED "$delay_single_quote_subst"`'
+OBJDUMP='`$ECHO "$OBJDUMP" | $SED "$delay_single_quote_subst"`'
+enable_shared='`$ECHO "$enable_shared" | $SED "$delay_single_quote_subst"`'
+enable_static='`$ECHO "$enable_static" | $SED "$delay_single_quote_subst"`'
+pic_mode='`$ECHO "$pic_mode" | $SED "$delay_single_quote_subst"`'
+enable_fast_install='`$ECHO "$enable_fast_install" | $SED "$delay_single_quote_subst"`'
+shared_archive_member_spec='`$ECHO "$shared_archive_member_spec" | $SED "$delay_single_quote_subst"`'
+SHELL='`$ECHO "$SHELL" | $SED "$delay_single_quote_subst"`'
+ECHO='`$ECHO "$ECHO" | $SED "$delay_single_quote_subst"`'
+PATH_SEPARATOR='`$ECHO "$PATH_SEPARATOR" | $SED "$delay_single_quote_subst"`'
+host_alias='`$ECHO "$host_alias" | $SED "$delay_single_quote_subst"`'
+host='`$ECHO "$host" | $SED "$delay_single_quote_subst"`'
+host_os='`$ECHO "$host_os" | $SED "$delay_single_quote_subst"`'
+build_alias='`$ECHO "$build_alias" | $SED "$delay_single_quote_subst"`'
+build='`$ECHO "$build" | $SED "$delay_single_quote_subst"`'
+build_os='`$ECHO "$build_os" | $SED "$delay_single_quote_subst"`'
+SED='`$ECHO "$SED" | $SED "$delay_single_quote_subst"`'
+Xsed='`$ECHO "$Xsed" | $SED "$delay_single_quote_subst"`'
+GREP='`$ECHO "$GREP" | $SED "$delay_single_quote_subst"`'
+EGREP='`$ECHO "$EGREP" | $SED "$delay_single_quote_subst"`'
+FGREP='`$ECHO "$FGREP" | $SED "$delay_single_quote_subst"`'
+LD='`$ECHO "$LD" | $SED "$delay_single_quote_subst"`'
+NM='`$ECHO "$NM" | $SED "$delay_single_quote_subst"`'
+LN_S='`$ECHO "$LN_S" | $SED "$delay_single_quote_subst"`'
+max_cmd_len='`$ECHO "$max_cmd_len" | $SED "$delay_single_quote_subst"`'
+ac_objext='`$ECHO "$ac_objext" | $SED "$delay_single_quote_subst"`'
+exeext='`$ECHO "$exeext" | $SED "$delay_single_quote_subst"`'
+lt_unset='`$ECHO "$lt_unset" | $SED "$delay_single_quote_subst"`'
+lt_SP2NL='`$ECHO "$lt_SP2NL" | $SED "$delay_single_quote_subst"`'
+lt_NL2SP='`$ECHO "$lt_NL2SP" | $SED "$delay_single_quote_subst"`'
+lt_cv_to_host_file_cmd='`$ECHO "$lt_cv_to_host_file_cmd" | $SED "$delay_single_quote_subst"`'
+lt_cv_to_tool_file_cmd='`$ECHO "$lt_cv_to_tool_file_cmd" | $SED "$delay_single_quote_subst"`'
+reload_flag='`$ECHO "$reload_flag" | $SED "$delay_single_quote_subst"`'
+reload_cmds='`$ECHO "$reload_cmds" | $SED "$delay_single_quote_subst"`'
+deplibs_check_method='`$ECHO "$deplibs_check_method" | $SED "$delay_single_quote_subst"`'
+file_magic_cmd='`$ECHO "$file_magic_cmd" | $SED "$delay_single_quote_subst"`'
+file_magic_glob='`$ECHO "$file_magic_glob" | $SED "$delay_single_quote_subst"`'
+want_nocaseglob='`$ECHO "$want_nocaseglob" | $SED "$delay_single_quote_subst"`'
+sharedlib_from_linklib_cmd='`$ECHO "$sharedlib_from_linklib_cmd" | $SED "$delay_single_quote_subst"`'
+AR='`$ECHO "$AR" | $SED "$delay_single_quote_subst"`'
+AR_FLAGS='`$ECHO "$AR_FLAGS" | $SED "$delay_single_quote_subst"`'
+archiver_list_spec='`$ECHO "$archiver_list_spec" | $SED "$delay_single_quote_subst"`'
+STRIP='`$ECHO "$STRIP" | $SED "$delay_single_quote_subst"`'
+RANLIB='`$ECHO "$RANLIB" | $SED "$delay_single_quote_subst"`'
+old_postinstall_cmds='`$ECHO "$old_postinstall_cmds" | $SED "$delay_single_quote_subst"`'
+old_postuninstall_cmds='`$ECHO "$old_postuninstall_cmds" | $SED "$delay_single_quote_subst"`'
+old_archive_cmds='`$ECHO "$old_archive_cmds" | $SED "$delay_single_quote_subst"`'
+lock_old_archive_extraction='`$ECHO "$lock_old_archive_extraction" | $SED "$delay_single_quote_subst"`'
+CC='`$ECHO "$CC" | $SED "$delay_single_quote_subst"`'
+CFLAGS='`$ECHO "$CFLAGS" | $SED "$delay_single_quote_subst"`'
+compiler='`$ECHO "$compiler" | $SED "$delay_single_quote_subst"`'
+GCC='`$ECHO "$GCC" | $SED "$delay_single_quote_subst"`'
+lt_cv_sys_global_symbol_pipe='`$ECHO "$lt_cv_sys_global_symbol_pipe" | $SED "$delay_single_quote_subst"`'
+lt_cv_sys_global_symbol_to_cdecl='`$ECHO "$lt_cv_sys_global_symbol_to_cdecl" | $SED "$delay_single_quote_subst"`'
+lt_cv_sys_global_symbol_to_import='`$ECHO "$lt_cv_sys_global_symbol_to_import" | $SED "$delay_single_quote_subst"`'
+lt_cv_sys_global_symbol_to_c_name_address='`$ECHO "$lt_cv_sys_global_symbol_to_c_name_address" | $SED "$delay_single_quote_subst"`'
+lt_cv_sys_global_symbol_to_c_name_address_lib_prefix='`$ECHO "$lt_cv_sys_global_symbol_to_c_name_address_lib_prefix" | $SED "$delay_single_quote_subst"`'
+lt_cv_nm_interface='`$ECHO "$lt_cv_nm_interface" | $SED "$delay_single_quote_subst"`'
+nm_file_list_spec='`$ECHO "$nm_file_list_spec" | $SED "$delay_single_quote_subst"`'
+lt_sysroot='`$ECHO "$lt_sysroot" | $SED "$delay_single_quote_subst"`'
+lt_cv_truncate_bin='`$ECHO "$lt_cv_truncate_bin" | $SED "$delay_single_quote_subst"`'
+objdir='`$ECHO "$objdir" | $SED "$delay_single_quote_subst"`'
+MAGIC_CMD='`$ECHO "$MAGIC_CMD" | $SED "$delay_single_quote_subst"`'
+lt_prog_compiler_no_builtin_flag='`$ECHO "$lt_prog_compiler_no_builtin_flag" | $SED "$delay_single_quote_subst"`'
+lt_prog_compiler_pic='`$ECHO "$lt_prog_compiler_pic" | $SED "$delay_single_quote_subst"`'
+lt_prog_compiler_wl='`$ECHO "$lt_prog_compiler_wl" | $SED "$delay_single_quote_subst"`'
+lt_prog_compiler_static='`$ECHO "$lt_prog_compiler_static" | $SED "$delay_single_quote_subst"`'
+lt_cv_prog_compiler_c_o='`$ECHO "$lt_cv_prog_compiler_c_o" | $SED "$delay_single_quote_subst"`'
+need_locks='`$ECHO "$need_locks" | $SED "$delay_single_quote_subst"`'
+MANIFEST_TOOL='`$ECHO "$MANIFEST_TOOL" | $SED "$delay_single_quote_subst"`'
+DSYMUTIL='`$ECHO "$DSYMUTIL" | $SED "$delay_single_quote_subst"`'
+NMEDIT='`$ECHO "$NMEDIT" | $SED "$delay_single_quote_subst"`'
+LIPO='`$ECHO "$LIPO" | $SED "$delay_single_quote_subst"`'
+OTOOL='`$ECHO "$OTOOL" | $SED "$delay_single_quote_subst"`'
+OTOOL64='`$ECHO "$OTOOL64" | $SED "$delay_single_quote_subst"`'
+libext='`$ECHO "$libext" | $SED "$delay_single_quote_subst"`'
+shrext_cmds='`$ECHO "$shrext_cmds" | $SED "$delay_single_quote_subst"`'
+extract_expsyms_cmds='`$ECHO "$extract_expsyms_cmds" | $SED "$delay_single_quote_subst"`'
+archive_cmds_need_lc='`$ECHO "$archive_cmds_need_lc" | $SED "$delay_single_quote_subst"`'
+enable_shared_with_static_runtimes='`$ECHO "$enable_shared_with_static_runtimes" | $SED "$delay_single_quote_subst"`'
+export_dynamic_flag_spec='`$ECHO "$export_dynamic_flag_spec" | $SED "$delay_single_quote_subst"`'
+whole_archive_flag_spec='`$ECHO "$whole_archive_flag_spec" | $SED "$delay_single_quote_subst"`'
+compiler_needs_object='`$ECHO "$compiler_needs_object" | $SED "$delay_single_quote_subst"`'
+old_archive_from_new_cmds='`$ECHO "$old_archive_from_new_cmds" | $SED "$delay_single_quote_subst"`'
+old_archive_from_expsyms_cmds='`$ECHO "$old_archive_from_expsyms_cmds" | $SED "$delay_single_quote_subst"`'
+archive_cmds='`$ECHO "$archive_cmds" | $SED "$delay_single_quote_subst"`'
+archive_expsym_cmds='`$ECHO "$archive_expsym_cmds" | $SED "$delay_single_quote_subst"`'
+module_cmds='`$ECHO "$module_cmds" | $SED "$delay_single_quote_subst"`'
+module_expsym_cmds='`$ECHO "$module_expsym_cmds" | $SED "$delay_single_quote_subst"`'
+with_gnu_ld='`$ECHO "$with_gnu_ld" | $SED "$delay_single_quote_subst"`'
+allow_undefined_flag='`$ECHO "$allow_undefined_flag" | $SED "$delay_single_quote_subst"`'
+no_undefined_flag='`$ECHO "$no_undefined_flag" | $SED "$delay_single_quote_subst"`'
+hardcode_libdir_flag_spec='`$ECHO "$hardcode_libdir_flag_spec" | $SED "$delay_single_quote_subst"`'
+hardcode_libdir_separator='`$ECHO "$hardcode_libdir_separator" | $SED "$delay_single_quote_subst"`'
+hardcode_direct='`$ECHO "$hardcode_direct" | $SED "$delay_single_quote_subst"`'
+hardcode_direct_absolute='`$ECHO "$hardcode_direct_absolute" | $SED "$delay_single_quote_subst"`'
+hardcode_minus_L='`$ECHO "$hardcode_minus_L" | $SED "$delay_single_quote_subst"`'
+hardcode_shlibpath_var='`$ECHO "$hardcode_shlibpath_var" | $SED "$delay_single_quote_subst"`'
+hardcode_automatic='`$ECHO "$hardcode_automatic" | $SED "$delay_single_quote_subst"`'
+inherit_rpath='`$ECHO "$inherit_rpath" | $SED "$delay_single_quote_subst"`'
+link_all_deplibs='`$ECHO "$link_all_deplibs" | $SED "$delay_single_quote_subst"`'
+always_export_symbols='`$ECHO "$always_export_symbols" | $SED "$delay_single_quote_subst"`'
+export_symbols_cmds='`$ECHO "$export_symbols_cmds" | $SED "$delay_single_quote_subst"`'
+exclude_expsyms='`$ECHO "$exclude_expsyms" | $SED "$delay_single_quote_subst"`'
+include_expsyms='`$ECHO "$include_expsyms" | $SED "$delay_single_quote_subst"`'
+prelink_cmds='`$ECHO "$prelink_cmds" | $SED "$delay_single_quote_subst"`'
+postlink_cmds='`$ECHO "$postlink_cmds" | $SED "$delay_single_quote_subst"`'
+file_list_spec='`$ECHO "$file_list_spec" | $SED "$delay_single_quote_subst"`'
+variables_saved_for_relink='`$ECHO "$variables_saved_for_relink" | $SED "$delay_single_quote_subst"`'
+need_lib_prefix='`$ECHO "$need_lib_prefix" | $SED "$delay_single_quote_subst"`'
+need_version='`$ECHO "$need_version" | $SED "$delay_single_quote_subst"`'
+version_type='`$ECHO "$version_type" | $SED "$delay_single_quote_subst"`'
+runpath_var='`$ECHO "$runpath_var" | $SED "$delay_single_quote_subst"`'
+shlibpath_var='`$ECHO "$shlibpath_var" | $SED "$delay_single_quote_subst"`'
+shlibpath_overrides_runpath='`$ECHO "$shlibpath_overrides_runpath" | $SED "$delay_single_quote_subst"`'
+libname_spec='`$ECHO "$libname_spec" | $SED "$delay_single_quote_subst"`'
+library_names_spec='`$ECHO "$library_names_spec" | $SED "$delay_single_quote_subst"`'
+soname_spec='`$ECHO "$soname_spec" | $SED "$delay_single_quote_subst"`'
+install_override_mode='`$ECHO "$install_override_mode" | $SED "$delay_single_quote_subst"`'
+postinstall_cmds='`$ECHO "$postinstall_cmds" | $SED "$delay_single_quote_subst"`'
+postuninstall_cmds='`$ECHO "$postuninstall_cmds" | $SED "$delay_single_quote_subst"`'
+finish_cmds='`$ECHO "$finish_cmds" | $SED "$delay_single_quote_subst"`'
+finish_eval='`$ECHO "$finish_eval" | $SED "$delay_single_quote_subst"`'
+hardcode_into_libs='`$ECHO "$hardcode_into_libs" | $SED "$delay_single_quote_subst"`'
+sys_lib_search_path_spec='`$ECHO "$sys_lib_search_path_spec" | $SED "$delay_single_quote_subst"`'
+configure_time_dlsearch_path='`$ECHO "$configure_time_dlsearch_path" | $SED "$delay_single_quote_subst"`'
+configure_time_lt_sys_library_path='`$ECHO "$configure_time_lt_sys_library_path" | $SED "$delay_single_quote_subst"`'
+hardcode_action='`$ECHO "$hardcode_action" | $SED "$delay_single_quote_subst"`'
+enable_dlopen='`$ECHO "$enable_dlopen" | $SED "$delay_single_quote_subst"`'
+enable_dlopen_self='`$ECHO "$enable_dlopen_self" | $SED "$delay_single_quote_subst"`'
+enable_dlopen_self_static='`$ECHO "$enable_dlopen_self_static" | $SED "$delay_single_quote_subst"`'
+old_striplib='`$ECHO "$old_striplib" | $SED "$delay_single_quote_subst"`'
+striplib='`$ECHO "$striplib" | $SED "$delay_single_quote_subst"`'
+
+LTCC='$LTCC'
+LTCFLAGS='$LTCFLAGS'
+compiler='$compiler_DEFAULT'
+
+# A function that is used when there is no print builtin or printf.
+func_fallback_echo ()
+{
+ eval 'cat <<_LTECHO_EOF
+\$1
+_LTECHO_EOF'
+}
+
+# Quote evaled strings.
+for var in AS \
+DLLTOOL \
+OBJDUMP \
+SHELL \
+ECHO \
+PATH_SEPARATOR \
+SED \
+GREP \
+EGREP \
+FGREP \
+LD \
+NM \
+LN_S \
+lt_SP2NL \
+lt_NL2SP \
+reload_flag \
+deplibs_check_method \
+file_magic_cmd \
+file_magic_glob \
+want_nocaseglob \
+sharedlib_from_linklib_cmd \
+AR \
+AR_FLAGS \
+archiver_list_spec \
+STRIP \
+RANLIB \
+CC \
+CFLAGS \
+compiler \
+lt_cv_sys_global_symbol_pipe \
+lt_cv_sys_global_symbol_to_cdecl \
+lt_cv_sys_global_symbol_to_import \
+lt_cv_sys_global_symbol_to_c_name_address \
+lt_cv_sys_global_symbol_to_c_name_address_lib_prefix \
+lt_cv_nm_interface \
+nm_file_list_spec \
+lt_cv_truncate_bin \
+lt_prog_compiler_no_builtin_flag \
+lt_prog_compiler_pic \
+lt_prog_compiler_wl \
+lt_prog_compiler_static \
+lt_cv_prog_compiler_c_o \
+need_locks \
+MANIFEST_TOOL \
+DSYMUTIL \
+NMEDIT \
+LIPO \
+OTOOL \
+OTOOL64 \
+shrext_cmds \
+export_dynamic_flag_spec \
+whole_archive_flag_spec \
+compiler_needs_object \
+with_gnu_ld \
+allow_undefined_flag \
+no_undefined_flag \
+hardcode_libdir_flag_spec \
+hardcode_libdir_separator \
+exclude_expsyms \
+include_expsyms \
+file_list_spec \
+variables_saved_for_relink \
+libname_spec \
+library_names_spec \
+soname_spec \
+install_override_mode \
+finish_eval \
+old_striplib \
+striplib; do
+ case \`eval \\\\\$ECHO \\\\""\\\\\$\$var"\\\\"\` in
+ *[\\\\\\\`\\"\\\$]*)
+ eval "lt_\$var=\\\\\\"\\\`\\\$ECHO \\"\\\$\$var\\" | \\\$SED \\"\\\$sed_quote_subst\\"\\\`\\\\\\"" ## exclude from sc_prohibit_nested_quotes
+ ;;
+ *)
+ eval "lt_\$var=\\\\\\"\\\$\$var\\\\\\""
+ ;;
+ esac
+done
+
+# Double-quote double-evaled strings.
+for var in reload_cmds \
+old_postinstall_cmds \
+old_postuninstall_cmds \
+old_archive_cmds \
+extract_expsyms_cmds \
+old_archive_from_new_cmds \
+old_archive_from_expsyms_cmds \
+archive_cmds \
+archive_expsym_cmds \
+module_cmds \
+module_expsym_cmds \
+export_symbols_cmds \
+prelink_cmds \
+postlink_cmds \
+postinstall_cmds \
+postuninstall_cmds \
+finish_cmds \
+sys_lib_search_path_spec \
+configure_time_dlsearch_path \
+configure_time_lt_sys_library_path; do
+ case \`eval \\\\\$ECHO \\\\""\\\\\$\$var"\\\\"\` in
+ *[\\\\\\\`\\"\\\$]*)
+ eval "lt_\$var=\\\\\\"\\\`\\\$ECHO \\"\\\$\$var\\" | \\\$SED -e \\"\\\$double_quote_subst\\" -e \\"\\\$sed_quote_subst\\" -e \\"\\\$delay_variable_subst\\"\\\`\\\\\\"" ## exclude from sc_prohibit_nested_quotes
+ ;;
+ *)
+ eval "lt_\$var=\\\\\\"\\\$\$var\\\\\\""
+ ;;
+ esac
+done
+
+ac_aux_dir='$ac_aux_dir'
+
+# See if we are running on zsh, and set the options that allow our
+# commands through without removal of \ escapes INIT.
+if test -n "\${ZSH_VERSION+set}"; then
+ setopt NO_GLOB_SUBST
+fi
+
+
+ PACKAGE='$PACKAGE'
+ VERSION='$VERSION'
+ RM='$RM'
+ ofile='$ofile'
+
+ac_aux_dir='$ac_aux_dir'
+
+
+
+_ACEOF
+
+cat >>$CONFIG_STATUS <<\_ACEOF || ac_write_fail=1
+
+# Handling of arguments.
+for ac_config_target in $ac_config_targets
+do
+ case $ac_config_target in
+ "depfiles") CONFIG_COMMANDS="$CONFIG_COMMANDS depfiles" ;;
+ "libtool") CONFIG_COMMANDS="$CONFIG_COMMANDS libtool" ;;
+ "config.h") CONFIG_HEADERS="$CONFIG_HEADERS config.h" ;;
+ "callexe.c") CONFIG_LINKS="$CONFIG_LINKS callexe.c:../texlive/w32_wrapper/callexe.c" ;;
+ "Makefile") CONFIG_FILES="$CONFIG_FILES Makefile" ;;
+ "help/Makefile") CONFIG_FILES="$CONFIG_FILES help/Makefile" ;;
+ "doc/Makefile") CONFIG_FILES="$CONFIG_FILES doc/Makefile" ;;
+
+ *) as_fn_error $? "invalid argument: \`$ac_config_target'" "$LINENO" 5;;
+ esac
+done
+
+
+# If the user did not use the arguments to specify the items to instantiate,
+# then the envvar interface is used. Set only those that are not.
+# We use the long form for the default assignment because of an extremely
+# bizarre bug on SunOS 4.1.3.
+if $ac_need_defaults; then
+ test "${CONFIG_FILES+set}" = set || CONFIG_FILES=$config_files
+ test "${CONFIG_HEADERS+set}" = set || CONFIG_HEADERS=$config_headers
+ test "${CONFIG_LINKS+set}" = set || CONFIG_LINKS=$config_links
+ test "${CONFIG_COMMANDS+set}" = set || CONFIG_COMMANDS=$config_commands
+fi
+
+# Have a temporary directory for convenience. Make it in the build tree
+# simply because there is no reason against having it here, and in addition,
+# creating and moving files from /tmp can sometimes cause problems.
+# Hook for its removal unless debugging.
+# Note that there is a small window in which the directory will not be cleaned:
+# after its creation but before its name has been assigned to `$tmp'.
+$debug ||
+{
+ tmp= ac_tmp=
+ trap 'exit_status=$?
+ : "${ac_tmp:=$tmp}"
+ { test ! -d "$ac_tmp" || rm -fr "$ac_tmp"; } && exit $exit_status
+' 0
+ trap 'as_fn_exit 1' 1 2 13 15
+}
+# Create a (secure) tmp directory for tmp files.
+
+{
+ tmp=`(umask 077 && mktemp -d "./confXXXXXX") 2>/dev/null` &&
+ test -d "$tmp"
+} ||
+{
+ tmp=./conf$$-$RANDOM
+ (umask 077 && mkdir "$tmp")
+} || as_fn_error $? "cannot create a temporary directory in ." "$LINENO" 5
+ac_tmp=$tmp
+
+# Set up the scripts for CONFIG_FILES section.
+# No need to generate them if there are no CONFIG_FILES.
+# This happens for instance with `./config.status config.h'.
+if test -n "$CONFIG_FILES"; then
+
+
+ac_cr=`echo X | tr X '\015'`
+# On cygwin, bash can eat \r inside `` if the user requested igncr.
+# But we know of no other shell where ac_cr would be empty at this
+# point, so we can use a bashism as a fallback.
+if test "x$ac_cr" = x; then
+ eval ac_cr=\$\'\\r\'
+fi
+ac_cs_awk_cr=`$AWK 'BEGIN { print "a\rb" }' </dev/null 2>/dev/null`
+if test "$ac_cs_awk_cr" = "a${ac_cr}b"; then
+ ac_cs_awk_cr='\\r'
+else
+ ac_cs_awk_cr=$ac_cr
+fi
+
+echo 'BEGIN {' >"$ac_tmp/subs1.awk" &&
+_ACEOF
+
+
+{
+ echo "cat >conf$$subs.awk <<_ACEOF" &&
+ echo "$ac_subst_vars" | sed 's/.*/&!$&$ac_delim/' &&
+ echo "_ACEOF"
+} >conf$$subs.sh ||
+ as_fn_error $? "could not make $CONFIG_STATUS" "$LINENO" 5
+ac_delim_num=`echo "$ac_subst_vars" | grep -c '^'`
+ac_delim='%!_!# '
+for ac_last_try in false false false false false :; do
+ . ./conf$$subs.sh ||
+ as_fn_error $? "could not make $CONFIG_STATUS" "$LINENO" 5
+
+ ac_delim_n=`sed -n "s/.*$ac_delim\$/X/p" conf$$subs.awk | grep -c X`
+ if test $ac_delim_n = $ac_delim_num; then
+ break
+ elif $ac_last_try; then
+ as_fn_error $? "could not make $CONFIG_STATUS" "$LINENO" 5
+ else
+ ac_delim="$ac_delim!$ac_delim _$ac_delim!! "
+ fi
+done
+rm -f conf$$subs.sh
+
+cat >>$CONFIG_STATUS <<_ACEOF || ac_write_fail=1
+cat >>"\$ac_tmp/subs1.awk" <<\\_ACAWK &&
+_ACEOF
+sed -n '
+h
+s/^/S["/; s/!.*/"]=/
+p
+g
+s/^[^!]*!//
+:repl
+t repl
+s/'"$ac_delim"'$//
+t delim
+:nl
+h
+s/\(.\{148\}\)..*/\1/
+t more1
+s/["\\]/\\&/g; s/^/"/; s/$/\\n"\\/
+p
+n
+b repl
+:more1
+s/["\\]/\\&/g; s/^/"/; s/$/"\\/
+p
+g
+s/.\{148\}//
+t nl
+:delim
+h
+s/\(.\{148\}\)..*/\1/
+t more2
+s/["\\]/\\&/g; s/^/"/; s/$/"/
+p
+b
+:more2
+s/["\\]/\\&/g; s/^/"/; s/$/"\\/
+p
+g
+s/.\{148\}//
+t delim
+' <conf$$subs.awk | sed '
+/^[^""]/{
+ N
+ s/\n//
+}
+' >>$CONFIG_STATUS || ac_write_fail=1
+rm -f conf$$subs.awk
+cat >>$CONFIG_STATUS <<_ACEOF || ac_write_fail=1
+_ACAWK
+cat >>"\$ac_tmp/subs1.awk" <<_ACAWK &&
+ for (key in S) S_is_set[key] = 1
+ FS = ""
+
+}
+{
+ line = $ 0
+ nfields = split(line, field, "@")
+ substed = 0
+ len = length(field[1])
+ for (i = 2; i < nfields; i++) {
+ key = field[i]
+ keylen = length(key)
+ if (S_is_set[key]) {
+ value = S[key]
+ line = substr(line, 1, len) "" value "" substr(line, len + keylen + 3)
+ len += length(value) + length(field[++i])
+ substed = 1
+ } else
+ len += 1 + keylen
+ }
+
+ print line
+}
+
+_ACAWK
+_ACEOF
+cat >>$CONFIG_STATUS <<\_ACEOF || ac_write_fail=1
+if sed "s/$ac_cr//" < /dev/null > /dev/null 2>&1; then
+ sed "s/$ac_cr\$//; s/$ac_cr/$ac_cs_awk_cr/g"
+else
+ cat
+fi < "$ac_tmp/subs1.awk" > "$ac_tmp/subs.awk" \
+ || as_fn_error $? "could not setup config files machinery" "$LINENO" 5
+_ACEOF
+
+# VPATH may cause trouble with some makes, so we remove sole $(srcdir),
+# ${srcdir} and @srcdir@ entries from VPATH if srcdir is ".", strip leading and
+# trailing colons and then remove the whole line if VPATH becomes empty
+# (actually we leave an empty line to preserve line numbers).
+if test "x$srcdir" = x.; then
+ ac_vpsub='/^[ ]*VPATH[ ]*=[ ]*/{
+h
+s///
+s/^/:/
+s/[ ]*$/:/
+s/:\$(srcdir):/:/g
+s/:\${srcdir}:/:/g
+s/:@srcdir@:/:/g
+s/^:*//
+s/:*$//
+x
+s/\(=[ ]*\).*/\1/
+G
+s/\n//
+s/^[^=]*=[ ]*$//
+}'
+fi
+
+cat >>$CONFIG_STATUS <<\_ACEOF || ac_write_fail=1
+fi # test -n "$CONFIG_FILES"
+
+# Set up the scripts for CONFIG_HEADERS section.
+# No need to generate them if there are no CONFIG_HEADERS.
+# This happens for instance with `./config.status Makefile'.
+if test -n "$CONFIG_HEADERS"; then
+cat >"$ac_tmp/defines.awk" <<\_ACAWK ||
+BEGIN {
+_ACEOF
+
+# Transform confdefs.h into an awk script `defines.awk', embedded as
+# here-document in config.status, that substitutes the proper values into
+# config.h.in to produce config.h.
+
+# Create a delimiter string that does not exist in confdefs.h, to ease
+# handling of long lines.
+ac_delim='%!_!# '
+for ac_last_try in false false :; do
+ ac_tt=`sed -n "/$ac_delim/p" confdefs.h`
+ if test -z "$ac_tt"; then
+ break
+ elif $ac_last_try; then
+ as_fn_error $? "could not make $CONFIG_HEADERS" "$LINENO" 5
+ else
+ ac_delim="$ac_delim!$ac_delim _$ac_delim!! "
+ fi
+done
+
+# For the awk script, D is an array of macro values keyed by name,
+# likewise P contains macro parameters if any. Preserve backslash
+# newline sequences.
+
+ac_word_re=[_$as_cr_Letters][_$as_cr_alnum]*
+sed -n '
+s/.\{148\}/&'"$ac_delim"'/g
+t rset
+:rset
+s/^[ ]*#[ ]*define[ ][ ]*/ /
+t def
+d
+:def
+s/\\$//
+t bsnl
+s/["\\]/\\&/g
+s/^ \('"$ac_word_re"'\)\(([^()]*)\)[ ]*\(.*\)/P["\1"]="\2"\
+D["\1"]=" \3"/p
+s/^ \('"$ac_word_re"'\)[ ]*\(.*\)/D["\1"]=" \2"/p
+d
+:bsnl
+s/["\\]/\\&/g
+s/^ \('"$ac_word_re"'\)\(([^()]*)\)[ ]*\(.*\)/P["\1"]="\2"\
+D["\1"]=" \3\\\\\\n"\\/p
+t cont
+s/^ \('"$ac_word_re"'\)[ ]*\(.*\)/D["\1"]=" \2\\\\\\n"\\/p
+t cont
+d
+:cont
+n
+s/.\{148\}/&'"$ac_delim"'/g
+t clear
+:clear
+s/\\$//
+t bsnlc
+s/["\\]/\\&/g; s/^/"/; s/$/"/p
+d
+:bsnlc
+s/["\\]/\\&/g; s/^/"/; s/$/\\\\\\n"\\/p
+b cont
+' <confdefs.h | sed '
+s/'"$ac_delim"'/"\\\
+"/g' >>$CONFIG_STATUS || ac_write_fail=1
+
+cat >>$CONFIG_STATUS <<_ACEOF || ac_write_fail=1
+ for (key in D) D_is_set[key] = 1
+ FS = ""
+}
+/^[\t ]*#[\t ]*(define|undef)[\t ]+$ac_word_re([\t (]|\$)/ {
+ line = \$ 0
+ split(line, arg, " ")
+ if (arg[1] == "#") {
+ defundef = arg[2]
+ mac1 = arg[3]
+ } else {
+ defundef = substr(arg[1], 2)
+ mac1 = arg[2]
+ }
+ split(mac1, mac2, "(") #)
+ macro = mac2[1]
+ prefix = substr(line, 1, index(line, defundef) - 1)
+ if (D_is_set[macro]) {
+ # Preserve the white space surrounding the "#".
+ print prefix "define", macro P[macro] D[macro]
+ next
+ } else {
+ # Replace #undef with comments. This is necessary, for example,
+ # in the case of _POSIX_SOURCE, which is predefined and required
+ # on some systems where configure will not decide to define it.
+ if (defundef == "undef") {
+ print "/*", prefix defundef, macro, "*/"
+ next
+ }
+ }
+}
+{ print }
+_ACAWK
+_ACEOF
+cat >>$CONFIG_STATUS <<\_ACEOF || ac_write_fail=1
+ as_fn_error $? "could not setup config headers machinery" "$LINENO" 5
+fi # test -n "$CONFIG_HEADERS"
+
+
+eval set X " :F $CONFIG_FILES :H $CONFIG_HEADERS :L $CONFIG_LINKS :C $CONFIG_COMMANDS"
+shift
+for ac_tag
+do
+ case $ac_tag in
+ :[FHLC]) ac_mode=$ac_tag; continue;;
+ esac
+ case $ac_mode$ac_tag in
+ :[FHL]*:*);;
+ :L* | :C*:*) as_fn_error $? "invalid tag \`$ac_tag'" "$LINENO" 5;;
+ :[FH]-) ac_tag=-:-;;
+ :[FH]*) ac_tag=$ac_tag:$ac_tag.in;;
+ esac
+ ac_save_IFS=$IFS
+ IFS=:
+ set x $ac_tag
+ IFS=$ac_save_IFS
+ shift
+ ac_file=$1
+ shift
+
+ case $ac_mode in
+ :L) ac_source=$1;;
+ :[FH])
+ ac_file_inputs=
+ for ac_f
+ do
+ case $ac_f in
+ -) ac_f="$ac_tmp/stdin";;
+ *) # Look for the file first in the build tree, then in the source tree
+ # (if the path is not absolute). The absolute path cannot be DOS-style,
+ # because $ac_f cannot contain `:'.
+ test -f "$ac_f" ||
+ case $ac_f in
+ [\\/$]*) false;;
+ *) test -f "$srcdir/$ac_f" && ac_f="$srcdir/$ac_f";;
+ esac ||
+ as_fn_error 1 "cannot find input file: \`$ac_f'" "$LINENO" 5;;
+ esac
+ case $ac_f in *\'*) ac_f=`$as_echo "$ac_f" | sed "s/'/'\\\\\\\\''/g"`;; esac
+ as_fn_append ac_file_inputs " '$ac_f'"
+ done
+
+ # Let's still pretend it is `configure' which instantiates (i.e., don't
+ # use $as_me), people would be surprised to read:
+ # /* config.h. Generated by config.status. */
+ configure_input='Generated from '`
+ $as_echo "$*" | sed 's|^[^:]*/||;s|:[^:]*/|, |g'
+ `' by configure.'
+ if test x"$ac_file" != x-; then
+ configure_input="$ac_file. $configure_input"
+ { $as_echo "$as_me:${as_lineno-$LINENO}: creating $ac_file" >&5
+$as_echo "$as_me: creating $ac_file" >&6;}
+ fi
+ # Neutralize special characters interpreted by sed in replacement strings.
+ case $configure_input in #(
+ *\&* | *\|* | *\\* )
+ ac_sed_conf_input=`$as_echo "$configure_input" |
+ sed 's/[\\\\&|]/\\\\&/g'`;; #(
+ *) ac_sed_conf_input=$configure_input;;
+ esac
+
+ case $ac_tag in
+ *:-:* | *:-) cat >"$ac_tmp/stdin" \
+ || as_fn_error $? "could not create $ac_file" "$LINENO" 5 ;;
+ esac
+ ;;
+ esac
+
+ ac_dir=`$as_dirname -- "$ac_file" ||
+$as_expr X"$ac_file" : 'X\(.*[^/]\)//*[^/][^/]*/*$' \| \
+ X"$ac_file" : 'X\(//\)[^/]' \| \
+ X"$ac_file" : 'X\(//\)$' \| \
+ X"$ac_file" : 'X\(/\)' \| . 2>/dev/null ||
+$as_echo X"$ac_file" |
+ sed '/^X\(.*[^/]\)\/\/*[^/][^/]*\/*$/{
+ s//\1/
+ q
+ }
+ /^X\(\/\/\)[^/].*/{
+ s//\1/
+ q
+ }
+ /^X\(\/\/\)$/{
+ s//\1/
+ q
+ }
+ /^X\(\/\).*/{
+ s//\1/
+ q
+ }
+ s/.*/./; q'`
+ as_dir="$ac_dir"; as_fn_mkdir_p
+ ac_builddir=.
+
+case "$ac_dir" in
+.) ac_dir_suffix= ac_top_builddir_sub=. ac_top_build_prefix= ;;
+*)
+ ac_dir_suffix=/`$as_echo "$ac_dir" | sed 's|^\.[\\/]||'`
+ # A ".." for each directory in $ac_dir_suffix.
+ ac_top_builddir_sub=`$as_echo "$ac_dir_suffix" | sed 's|/[^\\/]*|/..|g;s|/||'`
+ case $ac_top_builddir_sub in
+ "") ac_top_builddir_sub=. ac_top_build_prefix= ;;
+ *) ac_top_build_prefix=$ac_top_builddir_sub/ ;;
+ esac ;;
+esac
+ac_abs_top_builddir=$ac_pwd
+ac_abs_builddir=$ac_pwd$ac_dir_suffix
+# for backward compatibility:
+ac_top_builddir=$ac_top_build_prefix
+
+case $srcdir in
+ .) # We are building in place.
+ ac_srcdir=.
+ ac_top_srcdir=$ac_top_builddir_sub
+ ac_abs_top_srcdir=$ac_pwd ;;
+ [\\/]* | ?:[\\/]* ) # Absolute name.
+ ac_srcdir=$srcdir$ac_dir_suffix;
+ ac_top_srcdir=$srcdir
+ ac_abs_top_srcdir=$srcdir ;;
+ *) # Relative name.
+ ac_srcdir=$ac_top_build_prefix$srcdir$ac_dir_suffix
+ ac_top_srcdir=$ac_top_build_prefix$srcdir
+ ac_abs_top_srcdir=$ac_pwd/$srcdir ;;
+esac
+ac_abs_srcdir=$ac_abs_top_srcdir$ac_dir_suffix
+
+
+ case $ac_mode in
+ :F)
+ #
+ # CONFIG_FILE
+ #
+
+ case $INSTALL in
+ [\\/$]* | ?:[\\/]* ) ac_INSTALL=$INSTALL ;;
+ *) ac_INSTALL=$ac_top_build_prefix$INSTALL ;;
+ esac
+ ac_MKDIR_P=$MKDIR_P
+ case $MKDIR_P in
+ [\\/$]* | ?:[\\/]* ) ;;
+ */*) ac_MKDIR_P=$ac_top_build_prefix$MKDIR_P ;;
+ esac
+_ACEOF
+
+cat >>$CONFIG_STATUS <<\_ACEOF || ac_write_fail=1
+# If the template does not know about datarootdir, expand it.
+# FIXME: This hack should be removed a few years after 2.60.
+ac_datarootdir_hack=; ac_datarootdir_seen=
+ac_sed_dataroot='
+/datarootdir/ {
+ p
+ q
+}
+/@datadir@/p
+/@docdir@/p
+/@infodir@/p
+/@localedir@/p
+/@mandir@/p'
+case `eval "sed -n \"\$ac_sed_dataroot\" $ac_file_inputs"` in
+*datarootdir*) ac_datarootdir_seen=yes;;
+*@datadir@*|*@docdir@*|*@infodir@*|*@localedir@*|*@mandir@*)
+ { $as_echo "$as_me:${as_lineno-$LINENO}: WARNING: $ac_file_inputs seems to ignore the --datarootdir setting" >&5
+$as_echo "$as_me: WARNING: $ac_file_inputs seems to ignore the --datarootdir setting" >&2;}
+_ACEOF
+cat >>$CONFIG_STATUS <<_ACEOF || ac_write_fail=1
+ ac_datarootdir_hack='
+ s&@datadir@&$datadir&g
+ s&@docdir@&$docdir&g
+ s&@infodir@&$infodir&g
+ s&@localedir@&$localedir&g
+ s&@mandir@&$mandir&g
+ s&\\\${datarootdir}&$datarootdir&g' ;;
+esac
+_ACEOF
+
+# Neutralize VPATH when `$srcdir' = `.'.
+# Shell code in configure.ac might set extrasub.
+# FIXME: do we really want to maintain this feature?
+cat >>$CONFIG_STATUS <<_ACEOF || ac_write_fail=1
+ac_sed_extra="$ac_vpsub
+$extrasub
+_ACEOF
+cat >>$CONFIG_STATUS <<\_ACEOF || ac_write_fail=1
+:t
+/@[a-zA-Z_][a-zA-Z_0-9]*@/!b
+s|@configure_input@|$ac_sed_conf_input|;t t
+s&@top_builddir@&$ac_top_builddir_sub&;t t
+s&@top_build_prefix@&$ac_top_build_prefix&;t t
+s&@srcdir@&$ac_srcdir&;t t
+s&@abs_srcdir@&$ac_abs_srcdir&;t t
+s&@top_srcdir@&$ac_top_srcdir&;t t
+s&@abs_top_srcdir@&$ac_abs_top_srcdir&;t t
+s&@builddir@&$ac_builddir&;t t
+s&@abs_builddir@&$ac_abs_builddir&;t t
+s&@abs_top_builddir@&$ac_abs_top_builddir&;t t
+s&@INSTALL@&$ac_INSTALL&;t t
+s&@MKDIR_P@&$ac_MKDIR_P&;t t
+$ac_datarootdir_hack
+"
+eval sed \"\$ac_sed_extra\" "$ac_file_inputs" | $AWK -f "$ac_tmp/subs.awk" \
+ >$ac_tmp/out || as_fn_error $? "could not create $ac_file" "$LINENO" 5
+
+test -z "$ac_datarootdir_hack$ac_datarootdir_seen" &&
+ { ac_out=`sed -n '/\${datarootdir}/p' "$ac_tmp/out"`; test -n "$ac_out"; } &&
+ { ac_out=`sed -n '/^[ ]*datarootdir[ ]*:*=/p' \
+ "$ac_tmp/out"`; test -z "$ac_out"; } &&
+ { $as_echo "$as_me:${as_lineno-$LINENO}: WARNING: $ac_file contains a reference to the variable \`datarootdir'
+which seems to be undefined. Please make sure it is defined" >&5
+$as_echo "$as_me: WARNING: $ac_file contains a reference to the variable \`datarootdir'
+which seems to be undefined. Please make sure it is defined" >&2;}
+
+ rm -f "$ac_tmp/stdin"
+ case $ac_file in
+ -) cat "$ac_tmp/out" && rm -f "$ac_tmp/out";;
+ *) rm -f "$ac_file" && mv "$ac_tmp/out" "$ac_file";;
+ esac \
+ || as_fn_error $? "could not create $ac_file" "$LINENO" 5
+ ;;
+ :H)
+ #
+ # CONFIG_HEADER
+ #
+ if test x"$ac_file" != x-; then
+ {
+ $as_echo "/* $configure_input */" \
+ && eval '$AWK -f "$ac_tmp/defines.awk"' "$ac_file_inputs"
+ } >"$ac_tmp/config.h" \
+ || as_fn_error $? "could not create $ac_file" "$LINENO" 5
+ if diff "$ac_file" "$ac_tmp/config.h" >/dev/null 2>&1; then
+ { $as_echo "$as_me:${as_lineno-$LINENO}: $ac_file is unchanged" >&5
+$as_echo "$as_me: $ac_file is unchanged" >&6;}
+ else
+ rm -f "$ac_file"
+ mv "$ac_tmp/config.h" "$ac_file" \
+ || as_fn_error $? "could not create $ac_file" "$LINENO" 5
+ fi
+ else
+ $as_echo "/* $configure_input */" \
+ && eval '$AWK -f "$ac_tmp/defines.awk"' "$ac_file_inputs" \
+ || as_fn_error $? "could not create -" "$LINENO" 5
+ fi
+# Compute "$ac_file"'s index in $config_headers.
+_am_arg="$ac_file"
+_am_stamp_count=1
+for _am_header in $config_headers :; do
+ case $_am_header in
+ $_am_arg | $_am_arg:* )
+ break ;;
+ * )
+ _am_stamp_count=`expr $_am_stamp_count + 1` ;;
+ esac
+done
+echo "timestamp for $_am_arg" >`$as_dirname -- "$_am_arg" ||
+$as_expr X"$_am_arg" : 'X\(.*[^/]\)//*[^/][^/]*/*$' \| \
+ X"$_am_arg" : 'X\(//\)[^/]' \| \
+ X"$_am_arg" : 'X\(//\)$' \| \
+ X"$_am_arg" : 'X\(/\)' \| . 2>/dev/null ||
+$as_echo X"$_am_arg" |
+ sed '/^X\(.*[^/]\)\/\/*[^/][^/]*\/*$/{
+ s//\1/
+ q
+ }
+ /^X\(\/\/\)[^/].*/{
+ s//\1/
+ q
+ }
+ /^X\(\/\/\)$/{
+ s//\1/
+ q
+ }
+ /^X\(\/\).*/{
+ s//\1/
+ q
+ }
+ s/.*/./; q'`/stamp-h$_am_stamp_count
+ ;;
+ :L)
+ #
+ # CONFIG_LINK
+ #
+
+ if test "$ac_source" = "$ac_file" && test "$srcdir" = '.'; then
+ :
+ else
+ # Prefer the file from the source tree if names are identical.
+ if test "$ac_source" = "$ac_file" || test ! -r "$ac_source"; then
+ ac_source=$srcdir/$ac_source
+ fi
+
+ { $as_echo "$as_me:${as_lineno-$LINENO}: linking $ac_source to $ac_file" >&5
+$as_echo "$as_me: linking $ac_source to $ac_file" >&6;}
+
+ if test ! -r "$ac_source"; then
+ as_fn_error $? "$ac_source: file not found" "$LINENO" 5
+ fi
+ rm -f "$ac_file"
+
+ # Try a relative symlink, then a hard link, then a copy.
+ case $ac_source in
+ [\\/$]* | ?:[\\/]* ) ac_rel_source=$ac_source ;;
+ *) ac_rel_source=$ac_top_build_prefix$ac_source ;;
+ esac
+ ln -s "$ac_rel_source" "$ac_file" 2>/dev/null ||
+ ln "$ac_source" "$ac_file" 2>/dev/null ||
+ cp -p "$ac_source" "$ac_file" ||
+ as_fn_error $? "cannot link or copy $ac_source to $ac_file" "$LINENO" 5
+ fi
+ ;;
+ :C) { $as_echo "$as_me:${as_lineno-$LINENO}: executing $ac_file commands" >&5
+$as_echo "$as_me: executing $ac_file commands" >&6;}
+ ;;
+ esac
+
+
+ case $ac_file$ac_mode in
+ "depfiles":C) test x"$AMDEP_TRUE" != x"" || {
+ # Older Autoconf quotes --file arguments for eval, but not when files
+ # are listed without --file. Let's play safe and only enable the eval
+ # if we detect the quoting.
+ # TODO: see whether this extra hack can be removed once we start
+ # requiring Autoconf 2.70 or later.
+ case $CONFIG_FILES in #(
+ *\'*) :
+ eval set x "$CONFIG_FILES" ;; #(
+ *) :
+ set x $CONFIG_FILES ;; #(
+ *) :
+ ;;
+esac
+ shift
+ # Used to flag and report bootstrapping failures.
+ am_rc=0
+ for am_mf
+ do
+ # Strip MF so we end up with the name of the file.
+ am_mf=`$as_echo "$am_mf" | sed -e 's/:.*$//'`
+ # Check whether this is an Automake generated Makefile which includes
+ # dependency-tracking related rules and includes.
+ # Grep'ing the whole file directly is not great: AIX grep has a line
+ # limit of 2048, but all sed's we know have understand at least 4000.
+ sed -n 's,^am--depfiles:.*,X,p' "$am_mf" | grep X >/dev/null 2>&1 \
+ || continue
+ am_dirpart=`$as_dirname -- "$am_mf" ||
+$as_expr X"$am_mf" : 'X\(.*[^/]\)//*[^/][^/]*/*$' \| \
+ X"$am_mf" : 'X\(//\)[^/]' \| \
+ X"$am_mf" : 'X\(//\)$' \| \
+ X"$am_mf" : 'X\(/\)' \| . 2>/dev/null ||
+$as_echo X"$am_mf" |
+ sed '/^X\(.*[^/]\)\/\/*[^/][^/]*\/*$/{
+ s//\1/
+ q
+ }
+ /^X\(\/\/\)[^/].*/{
+ s//\1/
+ q
+ }
+ /^X\(\/\/\)$/{
+ s//\1/
+ q
+ }
+ /^X\(\/\).*/{
+ s//\1/
+ q
+ }
+ s/.*/./; q'`
+ am_filepart=`$as_basename -- "$am_mf" ||
+$as_expr X/"$am_mf" : '.*/\([^/][^/]*\)/*$' \| \
+ X"$am_mf" : 'X\(//\)$' \| \
+ X"$am_mf" : 'X\(/\)' \| . 2>/dev/null ||
+$as_echo X/"$am_mf" |
+ sed '/^.*\/\([^/][^/]*\)\/*$/{
+ s//\1/
+ q
+ }
+ /^X\/\(\/\/\)$/{
+ s//\1/
+ q
+ }
+ /^X\/\(\/\).*/{
+ s//\1/
+ q
+ }
+ s/.*/./; q'`
+ { echo "$as_me:$LINENO: cd "$am_dirpart" \
+ && sed -e '/# am--include-marker/d' "$am_filepart" \
+ | $MAKE -f - am--depfiles" >&5
+ (cd "$am_dirpart" \
+ && sed -e '/# am--include-marker/d' "$am_filepart" \
+ | $MAKE -f - am--depfiles) >&5 2>&5
+ ac_status=$?
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); } || am_rc=$?
+ done
+ if test $am_rc -ne 0; then
+ { { $as_echo "$as_me:${as_lineno-$LINENO}: error: in \`$ac_pwd':" >&5
+$as_echo "$as_me: error: in \`$ac_pwd':" >&2;}
+as_fn_error $? "Something went wrong bootstrapping makefile fragments
+ for automatic dependency tracking. If GNU make was not used, consider
+ re-running the configure script with MAKE=\"gmake\" (or whatever is
+ necessary). You can also try re-running configure with the
+ '--disable-dependency-tracking' option to at least be able to build
+ the package (albeit without support for automatic dependency tracking).
+See \`config.log' for more details" "$LINENO" 5; }
+ fi
+ { am_dirpart=; unset am_dirpart;}
+ { am_filepart=; unset am_filepart;}
+ { am_mf=; unset am_mf;}
+ { am_rc=; unset am_rc;}
+ rm -f conftest-deps.mk
+}
+ ;;
+ "libtool":C)
+
+ # See if we are running on zsh, and set the options that allow our
+ # commands through without removal of \ escapes.
+ if test -n "${ZSH_VERSION+set}"; then
+ setopt NO_GLOB_SUBST
+ fi
+
+ cfgfile=${ofile}T
+ trap "$RM \"$cfgfile\"; exit 1" 1 2 15
+ $RM "$cfgfile"
+
+ cat <<_LT_EOF >> "$cfgfile"
+#! $SHELL
+# Generated automatically by $as_me ($PACKAGE) $VERSION
+# Libtool was configured on host `(hostname || uname -n) 2>/dev/null | sed 1q`:
+# NOTE: Changes made to this file will be lost: look at ltmain.sh.
+
+# Provide generalized library-building support services.
+# Written by Gordon Matzigkeit, 1996
+
+# Copyright (C) 2014 Free Software Foundation, Inc.
+# This is free software; see the source for copying conditions. There is NO
+# warranty; not even for MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.
+
+# GNU Libtool is free software; you can redistribute it and/or modify
+# it under the terms of the GNU General Public License as published by
+# the Free Software Foundation; either version 2 of of the License, or
+# (at your option) any later version.
+#
+# As a special exception to the GNU General Public License, if you
+# distribute this file as part of a program or library that is built
+# using GNU Libtool, you may include this file under the same
+# distribution terms that you use for the rest of that program.
+#
+# GNU Libtool is distributed in the hope that it will be useful, but
+# WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
+# GNU General Public License for more details.
+#
+# You should have received a copy of the GNU General Public License
+# along with this program. If not, see <http://www.gnu.org/licenses/>.
+
+
+# The names of the tagged configurations supported by this script.
+available_tags=''
+
+# Configured defaults for sys_lib_dlsearch_path munging.
+: \${LT_SYS_LIBRARY_PATH="$configure_time_lt_sys_library_path"}
+
+# ### BEGIN LIBTOOL CONFIG
+
+# Which release of libtool.m4 was used?
+macro_version=$macro_version
+macro_revision=$macro_revision
+
+# Assembler program.
+AS=$lt_AS
+
+# DLL creation program.
+DLLTOOL=$lt_DLLTOOL
+
+# Object dumper program.
+OBJDUMP=$lt_OBJDUMP
+
+# Whether or not to build shared libraries.
+build_libtool_libs=$enable_shared
+
+# Whether or not to build static libraries.
+build_old_libs=$enable_static
+
+# What type of objects to build.
+pic_mode=$pic_mode
+
+# Whether or not to optimize for fast installation.
+fast_install=$enable_fast_install
+
+# Shared archive member basename,for filename based shared library versioning on AIX.
+shared_archive_member_spec=$shared_archive_member_spec
+
+# Shell to use when invoking shell scripts.
+SHELL=$lt_SHELL
+
+# An echo program that protects backslashes.
+ECHO=$lt_ECHO
+
+# The PATH separator for the build system.
+PATH_SEPARATOR=$lt_PATH_SEPARATOR
+
+# The host system.
+host_alias=$host_alias
+host=$host
+host_os=$host_os
+
+# The build system.
+build_alias=$build_alias
+build=$build
+build_os=$build_os
+
+# A sed program that does not truncate output.
+SED=$lt_SED
+
+# Sed that helps us avoid accidentally triggering echo(1) options like -n.
+Xsed="\$SED -e 1s/^X//"
+
+# A grep program that handles long lines.
+GREP=$lt_GREP
+
+# An ERE matcher.
+EGREP=$lt_EGREP
+
+# A literal string matcher.
+FGREP=$lt_FGREP
+
+# A BSD- or MS-compatible name lister.
+NM=$lt_NM
+
+# Whether we need soft or hard links.
+LN_S=$lt_LN_S
+
+# What is the maximum length of a command?
+max_cmd_len=$max_cmd_len
+
+# Object file suffix (normally "o").
+objext=$ac_objext
+
+# Executable file suffix (normally "").
+exeext=$exeext
+
+# whether the shell understands "unset".
+lt_unset=$lt_unset
+
+# turn spaces into newlines.
+SP2NL=$lt_lt_SP2NL
+
+# turn newlines into spaces.
+NL2SP=$lt_lt_NL2SP
+
+# convert \$build file names to \$host format.
+to_host_file_cmd=$lt_cv_to_host_file_cmd
+
+# convert \$build files to toolchain format.
+to_tool_file_cmd=$lt_cv_to_tool_file_cmd
+
+# Method to check whether dependent libraries are shared objects.
+deplibs_check_method=$lt_deplibs_check_method
+
+# Command to use when deplibs_check_method = "file_magic".
+file_magic_cmd=$lt_file_magic_cmd
+
+# How to find potential files when deplibs_check_method = "file_magic".
+file_magic_glob=$lt_file_magic_glob
+
+# Find potential files using nocaseglob when deplibs_check_method = "file_magic".
+want_nocaseglob=$lt_want_nocaseglob
+
+# Command to associate shared and link libraries.
+sharedlib_from_linklib_cmd=$lt_sharedlib_from_linklib_cmd
+
+# The archiver.
+AR=$lt_AR
+
+# Flags to create an archive.
+AR_FLAGS=$lt_AR_FLAGS
+
+# How to feed a file listing to the archiver.
+archiver_list_spec=$lt_archiver_list_spec
+
+# A symbol stripping program.
+STRIP=$lt_STRIP
+
+# Commands used to install an old-style archive.
+RANLIB=$lt_RANLIB
+old_postinstall_cmds=$lt_old_postinstall_cmds
+old_postuninstall_cmds=$lt_old_postuninstall_cmds
+
+# Whether to use a lock for old archive extraction.
+lock_old_archive_extraction=$lock_old_archive_extraction
+
+# A C compiler.
+LTCC=$lt_CC
+
+# LTCC compiler flags.
+LTCFLAGS=$lt_CFLAGS
+
+# Take the output of nm and produce a listing of raw symbols and C names.
+global_symbol_pipe=$lt_lt_cv_sys_global_symbol_pipe
+
+# Transform the output of nm in a proper C declaration.
+global_symbol_to_cdecl=$lt_lt_cv_sys_global_symbol_to_cdecl
+
+# Transform the output of nm into a list of symbols to manually relocate.
+global_symbol_to_import=$lt_lt_cv_sys_global_symbol_to_import
+
+# Transform the output of nm in a C name address pair.
+global_symbol_to_c_name_address=$lt_lt_cv_sys_global_symbol_to_c_name_address
+
+# Transform the output of nm in a C name address pair when lib prefix is needed.
+global_symbol_to_c_name_address_lib_prefix=$lt_lt_cv_sys_global_symbol_to_c_name_address_lib_prefix
+
+# The name lister interface.
+nm_interface=$lt_lt_cv_nm_interface
+
+# Specify filename containing input files for \$NM.
+nm_file_list_spec=$lt_nm_file_list_spec
+
+# The root where to search for dependent libraries,and where our libraries should be installed.
+lt_sysroot=$lt_sysroot
+
+# Command to truncate a binary pipe.
+lt_truncate_bin=$lt_lt_cv_truncate_bin
+
+# The name of the directory that contains temporary libtool files.
+objdir=$objdir
+
+# Used to examine libraries when file_magic_cmd begins with "file".
+MAGIC_CMD=$MAGIC_CMD
+
+# Must we lock files when doing compilation?
+need_locks=$lt_need_locks
+
+# Manifest tool.
+MANIFEST_TOOL=$lt_MANIFEST_TOOL
+
+# Tool to manipulate archived DWARF debug symbol files on Mac OS X.
+DSYMUTIL=$lt_DSYMUTIL
+
+# Tool to change global to local symbols on Mac OS X.
+NMEDIT=$lt_NMEDIT
+
+# Tool to manipulate fat objects and archives on Mac OS X.
+LIPO=$lt_LIPO
+
+# ldd/readelf like tool for Mach-O binaries on Mac OS X.
+OTOOL=$lt_OTOOL
+
+# ldd/readelf like tool for 64 bit Mach-O binaries on Mac OS X 10.4.
+OTOOL64=$lt_OTOOL64
+
+# Old archive suffix (normally "a").
+libext=$libext
+
+# Shared library suffix (normally ".so").
+shrext_cmds=$lt_shrext_cmds
+
+# The commands to extract the exported symbol list from a shared archive.
+extract_expsyms_cmds=$lt_extract_expsyms_cmds
+
+# Variables whose values should be saved in libtool wrapper scripts and
+# restored at link time.
+variables_saved_for_relink=$lt_variables_saved_for_relink
+
+# Do we need the "lib" prefix for modules?
+need_lib_prefix=$need_lib_prefix
+
+# Do we need a version for libraries?
+need_version=$need_version
+
+# Library versioning type.
+version_type=$version_type
+
+# Shared library runtime path variable.
+runpath_var=$runpath_var
+
+# Shared library path variable.
+shlibpath_var=$shlibpath_var
+
+# Is shlibpath searched before the hard-coded library search path?
+shlibpath_overrides_runpath=$shlibpath_overrides_runpath
+
+# Format of library name prefix.
+libname_spec=$lt_libname_spec
+
+# List of archive names. First name is the real one, the rest are links.
+# The last name is the one that the linker finds with -lNAME
+library_names_spec=$lt_library_names_spec
+
+# The coded name of the library, if different from the real name.
+soname_spec=$lt_soname_spec
+
+# Permission mode override for installation of shared libraries.
+install_override_mode=$lt_install_override_mode
+
+# Command to use after installation of a shared archive.
+postinstall_cmds=$lt_postinstall_cmds
+
+# Command to use after uninstallation of a shared archive.
+postuninstall_cmds=$lt_postuninstall_cmds
+
+# Commands used to finish a libtool library installation in a directory.
+finish_cmds=$lt_finish_cmds
+
+# As "finish_cmds", except a single script fragment to be evaled but
+# not shown.
+finish_eval=$lt_finish_eval
+
+# Whether we should hardcode library paths into libraries.
+hardcode_into_libs=$hardcode_into_libs
+
+# Compile-time system search path for libraries.
+sys_lib_search_path_spec=$lt_sys_lib_search_path_spec
+
+# Detected run-time system search path for libraries.
+sys_lib_dlsearch_path_spec=$lt_configure_time_dlsearch_path
+
+# Explicit LT_SYS_LIBRARY_PATH set during ./configure time.
+configure_time_lt_sys_library_path=$lt_configure_time_lt_sys_library_path
+
+# Whether dlopen is supported.
+dlopen_support=$enable_dlopen
+
+# Whether dlopen of programs is supported.
+dlopen_self=$enable_dlopen_self
+
+# Whether dlopen of statically linked programs is supported.
+dlopen_self_static=$enable_dlopen_self_static
+
+# Commands to strip libraries.
+old_striplib=$lt_old_striplib
+striplib=$lt_striplib
+
+
+# The linker used to build libraries.
+LD=$lt_LD
+
+# How to create reloadable object files.
+reload_flag=$lt_reload_flag
+reload_cmds=$lt_reload_cmds
+
+# Commands used to build an old-style archive.
+old_archive_cmds=$lt_old_archive_cmds
+
+# A language specific compiler.
+CC=$lt_compiler
+
+# Is the compiler the GNU compiler?
+with_gcc=$GCC
+
+# Compiler flag to turn off builtin functions.
+no_builtin_flag=$lt_lt_prog_compiler_no_builtin_flag
+
+# Additional compiler flags for building library objects.
+pic_flag=$lt_lt_prog_compiler_pic
+
+# How to pass a linker flag through the compiler.
+wl=$lt_lt_prog_compiler_wl
+
+# Compiler flag to prevent dynamic linking.
+link_static_flag=$lt_lt_prog_compiler_static
+
+# Does compiler simultaneously support -c and -o options?
+compiler_c_o=$lt_lt_cv_prog_compiler_c_o
+
+# Whether or not to add -lc for building shared libraries.
+build_libtool_need_lc=$archive_cmds_need_lc
+
+# Whether or not to disallow shared libs when runtime libs are static.
+allow_libtool_libs_with_static_runtimes=$enable_shared_with_static_runtimes
+
+# Compiler flag to allow reflexive dlopens.
+export_dynamic_flag_spec=$lt_export_dynamic_flag_spec
+
+# Compiler flag to generate shared objects directly from archives.
+whole_archive_flag_spec=$lt_whole_archive_flag_spec
+
+# Whether the compiler copes with passing no objects directly.
+compiler_needs_object=$lt_compiler_needs_object
+
+# Create an old-style archive from a shared archive.
+old_archive_from_new_cmds=$lt_old_archive_from_new_cmds
+
+# Create a temporary old-style archive to link instead of a shared archive.
+old_archive_from_expsyms_cmds=$lt_old_archive_from_expsyms_cmds
+
+# Commands used to build a shared archive.
+archive_cmds=$lt_archive_cmds
+archive_expsym_cmds=$lt_archive_expsym_cmds
+
+# Commands used to build a loadable module if different from building
+# a shared archive.
+module_cmds=$lt_module_cmds
+module_expsym_cmds=$lt_module_expsym_cmds
+
+# Whether we are building with GNU ld or not.
+with_gnu_ld=$lt_with_gnu_ld
+
+# Flag that allows shared libraries with undefined symbols to be built.
+allow_undefined_flag=$lt_allow_undefined_flag
+
+# Flag that enforces no undefined symbols.
+no_undefined_flag=$lt_no_undefined_flag
+
+# Flag to hardcode \$libdir into a binary during linking.
+# This must work even if \$libdir does not exist
+hardcode_libdir_flag_spec=$lt_hardcode_libdir_flag_spec
+
+# Whether we need a single "-rpath" flag with a separated argument.
+hardcode_libdir_separator=$lt_hardcode_libdir_separator
+
+# Set to "yes" if using DIR/libNAME\$shared_ext during linking hardcodes
+# DIR into the resulting binary.
+hardcode_direct=$hardcode_direct
+
+# Set to "yes" if using DIR/libNAME\$shared_ext during linking hardcodes
+# DIR into the resulting binary and the resulting library dependency is
+# "absolute",i.e impossible to change by setting \$shlibpath_var if the
+# library is relocated.
+hardcode_direct_absolute=$hardcode_direct_absolute
+
+# Set to "yes" if using the -LDIR flag during linking hardcodes DIR
+# into the resulting binary.
+hardcode_minus_L=$hardcode_minus_L
+
+# Set to "yes" if using SHLIBPATH_VAR=DIR during linking hardcodes DIR
+# into the resulting binary.
+hardcode_shlibpath_var=$hardcode_shlibpath_var
+
+# Set to "yes" if building a shared library automatically hardcodes DIR
+# into the library and all subsequent libraries and executables linked
+# against it.
+hardcode_automatic=$hardcode_automatic
+
+# Set to yes if linker adds runtime paths of dependent libraries
+# to runtime path list.
+inherit_rpath=$inherit_rpath
+
+# Whether libtool must link a program against all its dependency libraries.
+link_all_deplibs=$link_all_deplibs
+
+# Set to "yes" if exported symbols are required.
+always_export_symbols=$always_export_symbols
+
+# The commands to list exported symbols.
+export_symbols_cmds=$lt_export_symbols_cmds
+
+# Symbols that should not be listed in the preloaded symbols.
+exclude_expsyms=$lt_exclude_expsyms
+
+# Symbols that must always be exported.
+include_expsyms=$lt_include_expsyms
+
+# Commands necessary for linking programs (against libraries) with templates.
+prelink_cmds=$lt_prelink_cmds
+
+# Commands necessary for finishing linking programs.
+postlink_cmds=$lt_postlink_cmds
+
+# Specify filename containing input files.
+file_list_spec=$lt_file_list_spec
+
+# How to hardcode a shared library path into an executable.
+hardcode_action=$hardcode_action
+
+# ### END LIBTOOL CONFIG
+
+_LT_EOF
+
+ cat <<'_LT_EOF' >> "$cfgfile"
+
+# ### BEGIN FUNCTIONS SHARED WITH CONFIGURE
+
+# func_munge_path_list VARIABLE PATH
+# -----------------------------------
+# VARIABLE is name of variable containing _space_ separated list of
+# directories to be munged by the contents of PATH, which is string
+# having a format:
+# "DIR[:DIR]:"
+# string "DIR[ DIR]" will be prepended to VARIABLE
+# ":DIR[:DIR]"
+# string "DIR[ DIR]" will be appended to VARIABLE
+# "DIRP[:DIRP]::[DIRA:]DIRA"
+# string "DIRP[ DIRP]" will be prepended to VARIABLE and string
+# "DIRA[ DIRA]" will be appended to VARIABLE
+# "DIR[:DIR]"
+# VARIABLE will be replaced by "DIR[ DIR]"
+func_munge_path_list ()
+{
+ case x$2 in
+ x)
+ ;;
+ *:)
+ eval $1=\"`$ECHO $2 | $SED 's/:/ /g'` \$$1\"
+ ;;
+ x:*)
+ eval $1=\"\$$1 `$ECHO $2 | $SED 's/:/ /g'`\"
+ ;;
+ *::*)
+ eval $1=\"\$$1\ `$ECHO $2 | $SED -e 's/.*:://' -e 's/:/ /g'`\"
+ eval $1=\"`$ECHO $2 | $SED -e 's/::.*//' -e 's/:/ /g'`\ \$$1\"
+ ;;
+ *)
+ eval $1=\"`$ECHO $2 | $SED 's/:/ /g'`\"
+ ;;
+ esac
+}
+
+
+# Calculate cc_basename. Skip known compiler wrappers and cross-prefix.
+func_cc_basename ()
+{
+ for cc_temp in $*""; do
+ case $cc_temp in
+ compile | *[\\/]compile | ccache | *[\\/]ccache ) ;;
+ distcc | *[\\/]distcc | purify | *[\\/]purify ) ;;
+ \-*) ;;
+ *) break;;
+ esac
+ done
+ func_cc_basename_result=`$ECHO "$cc_temp" | $SED "s%.*/%%; s%^$host_alias-%%"`
+}
+
+
+# ### END FUNCTIONS SHARED WITH CONFIGURE
+
+_LT_EOF
+
+ case $host_os in
+ aix3*)
+ cat <<\_LT_EOF >> "$cfgfile"
+# AIX sometimes has problems with the GCC collect2 program. For some
+# reason, if we set the COLLECT_NAMES environment variable, the problems
+# vanish in a puff of smoke.
+if test set != "${COLLECT_NAMES+set}"; then
+ COLLECT_NAMES=
+ export COLLECT_NAMES
+fi
+_LT_EOF
+ ;;
+ esac
+
+
+ltmain=$ac_aux_dir/ltmain.sh
+
+
+ # We use sed instead of cat because bash on DJGPP gets confused if
+ # if finds mixed CR/LF and LF-only lines. Since sed operates in
+ # text mode, it properly converts lines to CR/LF. This bash problem
+ # is reportedly fixed, but why not run on old versions too?
+ sed '$q' "$ltmain" >> "$cfgfile" \
+ || (rm -f "$cfgfile"; exit 1)
+
+ mv -f "$cfgfile" "$ofile" ||
+ (rm -f "$ofile" && cp "$cfgfile" "$ofile" && rm -f "$cfgfile")
+ chmod +x "$ofile"
+
+ ;;
+
+ esac
+done # for ac_tag
+
+
+as_fn_exit 0
+_ACEOF
+ac_clean_files=$ac_clean_files_save
+
+test $ac_write_fail = 0 ||
+ as_fn_error $? "write failure creating $CONFIG_STATUS" "$LINENO" 5
+
+
+# configure is writing to config.log, and then calls config.status.
+# config.status does its own redirection, appending to config.log.
+# Unfortunately, on DOS this fails, as config.log is still kept open
+# by configure, so config.status won't be able to write to it; its
+# output is simply discarded. So we exec the FD to /dev/null,
+# effectively closing config.log, so it can be properly (re)opened and
+# appended to by config.status. When coming back to configure, we
+# need to make the FD available again.
+if test "$no_create" != yes; then
+ ac_cs_success=:
+ ac_config_status_args=
+ test "$silent" = yes &&
+ ac_config_status_args="$ac_config_status_args --quiet"
+ exec 5>/dev/null
+ $SHELL $CONFIG_STATUS $ac_config_status_args || ac_cs_success=false
+ exec 5>>config.log
+ # Use ||, not &&, to avoid exiting from the if with $? = 1, which
+ # would make configure fail if this is the last instruction.
+ $ac_cs_success || as_fn_exit 1
+fi
+if test -n "$ac_unrecognized_opts" && test "$enable_option_checking" != no; then
+ { $as_echo "$as_me:${as_lineno-$LINENO}: WARNING: unrecognized options: $ac_unrecognized_opts" >&5
+$as_echo "$as_me: WARNING: unrecognized options: $ac_unrecognized_opts" >&2;}
+fi
+
diff --git a/Build/source/texk/dvipng/configure.ac b/Build/source/texk/dvipng/configure.ac
new file mode 100644
index 00000000000..a04da46a9a1
--- /dev/null
+++ b/Build/source/texk/dvipng/configure.ac
@@ -0,0 +1,188 @@
+dnl Process this file with autoconf to produce a configure script.
+dnl
+dnl Copyright (C) 2009-2015 Peter Breitenlohner <tex-live@tug.org>
+dnl
+dnl This file is free software; the copyright holder
+dnl gives unlimited permission to copy and/or distribute it,
+dnl with or without modifications, as long as this notice is preserved.
+dnl
+dnl *********************************************************************
+dnl
+dnl Adapted for TeX Live from dvipng-1.12/configure.ac
+dnl Copyright (C) 2002-2008 Jan-Åke Larsson
+dnl
+dnl *********************************************************************
+dnl
+m4_include([version.ac])[] dnl define dvipng_version
+AC_INIT([dvipng (TeX Live)], dvipng_version, [tex-k@tug.org])
+AC_PREREQ([2.65])
+AC_CONFIG_SRCDIR([dvipng-src/dvipng.c])
+AC_CONFIG_AUX_DIR([../../build-aux])
+AC_CONFIG_MACRO_DIRS([../../m4 m4])
+
+# Common code for all programs using libkpathsea.
+KPSE_COMMON([dvipng])
+# Configure options for dvipng also shown at the TeX Live top-level.
+m4_include([ac/dvipng.ac])
+
+AC_CANONICAL_HOST
+
+AM_CONDITIONAL([cross], [test "x$cross_compiling" = xyes])
+
+if test "x$enable_debug" != xno; then
+ enable_debug=yes
+ AC_DEFINE([DEBUG], 1, [Define as 1 to get the debug (-d) option.])
+fi
+
+if test "x$enable_timing" = xyes; then
+ AC_DEFINE([TIMING], 1, [Define as 1 to get execution time output.])
+fi
+
+# Checks for programs.
+# For a native TeX Live build '--with-gs' is ignored.
+AS_IF([test "x$enable_native_texlive_build" = xyes],
+ [with_gs=])
+AS_CASE([$with_gs],
+ ["" | yes | no], [AC_CHECK_PROG([GS], [gs], [gs])],
+ [AC_PATH_PROG([GS], ["$with_gs"])])
+AS_IF([test -n "$GS"],
+ [GS_CHECK_DEVICES],
+ [AC_MSG_WARN([Cannot find GhostScript in your PATH])
+ GS=gs])
+AC_DEFINE_UNQUOTED([GS_PATH], ["$GS"], [Define as the path to GhostScript.])
+
+# Checks for libraries.
+AC_SEARCH_LIBS([pow], [m])
+AC_SEARCH_LIBS([basename], [gen])
+
+# Checks for header files.
+AC_HEADER_STDC
+AC_CHECK_HEADERS([fcntl.h sys/time.h])
+AC_HEADER_SYS_WAIT
+AC_HEADER_TIME
+AC_HEADER_STDBOOL
+
+# Checks for typedefs, structures, and compiler characteristics.
+AC_C_CONST
+AC_TYPE_PID_T
+
+# Checks for library functions.
+AC_FUNC_MMAP
+AC_FUNC_STRTOD
+AC_FUNC_VPRINTF
+AC_CHECK_FUNCS([dup2 memset munmap pow putenv strchr strrchr])
+
+if test "x$enable_timing" = xyes; then
+ AC_CHECK_FUNCS([ftime gettimeofday])
+fi
+
+# Documentation-related checks.
+AC_PATH_PROG([MAKEINFO], [makeinfo], [:])
+MAKEINFO_CHECK_MACROS([acronym env option])
+AC_PATH_PROG([INSTALL_INFO], [install-info], [:], [$PATH /usr/sbin /sbin])
+
+# SELFAUTO -- not used when built as part of the TeX Live tree.
+
+# We have to check properties of libraries, either installed (system)
+# libraries or unistalled (possibly libtool) ones from the TeX Live tree.
+# Thus we can not use, e.g., AC_CHECK_LIB(LIB, FUNCTION)
+
+KPSE_KPATHSEA_FLAGS
+KPSE_ZLIB_FLAGS
+KPSE_LIBPNG_FLAGS
+KPSE_FREETYPE2_FLAGS
+KPSE_GD_FLAGS
+
+# Assume we have freetype2.
+have_ft2=yes
+
+if test "x$enable_build" != xno || test -f config.force; then
+
+# Checks for more libraries.
+KPSE_ADD_FLAGS([zlib])
+AC_CHECK_FUNC([deflate],
+ [AC_DEFINE([HAVE_LIBZ], 1,
+ [Define to 1 if you have the `z' library (-lz).])])
+
+KPSE_ADD_FLAGS([libpng])
+AC_CHECK_FUNC([png_read_image],
+ [AC_DEFINE([HAVE_LIBPNG], 1,
+ [Define to 1 if you have the `png' library (-lpng).])],
+ [AC_MSG_ERROR([cannot find/use libpng])])
+
+KPSE_ADD_FLAGS([freetype2])
+AC_CHECK_FUNC([FT_Init_FreeType],
+ [AC_DEFINE([HAVE_FT2], 1,
+ [Define to 1 if you have freetype2.])],
+ [have_ft2=no])
+
+KPSE_ADD_FLAGS([gd])
+AC_CHECK_FUNC([gdImageCreate],
+ [AC_DEFINE([HAVE_LIBGD], 1,
+ [Define to 1 if you have the `gd' library (-lgd).])],
+ [AC_MSG_ERROR([cannot find/use gd
+This drawing library can be downloaded at http://www.boutell.com/gd])])
+
+KPSE_ADD_FLAGS([kpathsea])
+AC_CHECK_FUNC([kpse_set_program_name],
+ [AC_DEFINE([HAVE_LIBKPATHSEA], 1,
+ [Define to 1 if you have the `kpathsea' library (-lkpathsea).])],
+ [AC_MSG_ERROR([cannot find/use libkpathsea])])
+
+AC_CHECK_FUNCS([kpse_program_basename])
+
+KPSE_DO_IF_WIN32([AC_CHECK_FUNCS([texlive_gs_init])])
+
+# We need enc, cmap, and sfd formats.
+# Introduced together with opentype format (Dec 2003).
+KPSE_CHECK_KPSE_FORMAT([opentype],
+ [AC_DEFINE([HAVE_KPSE_ENC_FORMATS], 1,
+ [Define to 1 if your kpathsea has kpse_enc_format.])])
+
+# Checks for more header files.
+AC_CHECK_HEADERS([gd.h png.h kpathsea/kpathsea.h], ,
+ [AC_MSG_ERROR([cannot find/use $ac_header])])
+
+# Checks for more library functions.
+AC_CHECK_FUNCS([gdImageCreateTrueColor gdImageCreateFromJpeg gdImagePngEx gdImageCreateFromPngPtr gdImageGif FT_Library_Version])
+
+KPSE_RESTORE_FLAGS
+
+echo timestamp >config.force
+
+fi
+
+AM_CONDITIONAL([have_ft2], [test "x$have_ft2" = xyes])
+AM_CONDITIONAL([have_gif], [test "x$ac_cv_func_gdImageGif" = xyes])
+
+AC_MSG_RESULT([
+** Configuration summary for $PACKAGE_STRING:
+
+ The -d (debug) switch is enabled: $enable_debug
+ Your gd is new enough (>=2.0) to enable
+ the --truecolor switch, full alpha
+ transparency, proper rescaling of
+ included bitmaps, and jpeg inclusion: $ac_cv_func_gdImageCreateTrueColor
+ Your gd has jpeg inclusion enabled: $ac_cv_func_gdImageCreateFromJpeg
+ Your gd is new enough (>=2.0.12) to
+ enable transparent backgrounds for EPS
+ inclusion and the -z (compression)
+ switch: $ac_cv_func_gdImagePngEx
+ Your gd is new enough (>=2.0.21) to
+ allow image creation from memory $ac_cv_func_gdImageCreateFromPngPtr
+ Your gd is new enough (>=2.0.28) to
+ enable gif inclusion and output
+ (dvigif): $ac_cv_func_gdImageGif
+ FreeType font rendering available: $ac_cv_func_FT_Init_FreeType
+ Support for subfonts (CJK-LaTeX): $ac_cv_func_FT_Init_FreeType
+])
+
+AC_CONFIG_HEADERS([config.h])
+
+AC_SUBST([DVIPNG_TREE], [dvipng-src])
+
+KPSE_WIN32_CALL
+
+AC_CONFIG_FILES([Makefile help/Makefile doc/Makefile])
+
+AC_OUTPUT
diff --git a/Build/source/texk/dvipng/doc/Makefile.am b/Build/source/texk/dvipng/doc/Makefile.am
new file mode 100644
index 00000000000..e61015bb4d5
--- /dev/null
+++ b/Build/source/texk/dvipng/doc/Makefile.am
@@ -0,0 +1,53 @@
+## Makefile.am for the TeX Live subdirectory texk/dvipng/doc/
+##
+## Copyright (C) 2009-2015 Peter Breitenlohner <tex-live@tug.org>
+## You may freely use, modify and/or distribute this file.
+#
+info_TEXINFOS = \
+ dvipng.texi
+dvipng_TEXINFOS = \
+ dvipng.help \
+ install.texi \
+ macros.texi \
+ readme.texi
+
+BUILT_SOURCES = doc-stamp
+
+doc-stamp:
+if MAINTAINER_MODE
+## Check that the .texi files here are copies of those in ../$(DVIPNG_TREE)/.
+ @for f in dvipng install macros readme; do \
+ f1="$(top_srcdir)/$(DVIPNG_TREE)/$$f.texi"; \
+ f2="$(srcdir)/$$f.texi"; \
+ echo "diff '$$f1' '$$f2'"; \
+ if diff "$$f1" "$$f2"; then :; \
+ else \
+ echo "cp -p '$$f1' '$$f2'"; \
+ cp -p "$$f1" "$$f2"; \
+ fi; \
+ done
+endif MAINTAINER_MODE
+ echo timestamp >$@
+
+dist_noinst_SCRIPTS = texi2pod.pl
+
+dist_man1_MANS = dvipng.1
+dvipng.1: dvipng.texi readme.texi
+ $(srcdir)/texi2pod.pl -D man $(srcdir)/dvipng.texi | \
+ sed -es/@//g -es/previewlatex/preview-latex/g -es/{}//g > dvipng.pod
+ pod2man --center="User commands" --release="$(PACKAGE_STRING)" \
+ dvipng.pod > dvipng.1
+ rm dvipng.pod
+
+# Symlinks within $(man1dir): FILE:LINK indicates LINK.1->FILE.1
+man1_links = dvipng:dvigif
+
+include $(top_srcdir)/../../am/man1_links.am
+
+if have_gif
+install-data-hook: install-man1-links
+uninstall-hook: uninstall-man1-links
+endif have_gif
+
+DISTCLEANFILES = doc-stamp
+
diff --git a/Build/source/texk/dvipng/doc/Makefile.in b/Build/source/texk/dvipng/doc/Makefile.in
new file mode 100644
index 00000000000..d2135706454
--- /dev/null
+++ b/Build/source/texk/dvipng/doc/Makefile.in
@@ -0,0 +1,909 @@
+# Makefile.in generated by automake 1.16.3 from Makefile.am.
+# @configure_input@
+
+# Copyright (C) 1994-2020 Free Software Foundation, Inc.
+
+# This Makefile.in is free software; the Free Software Foundation
+# gives unlimited permission to copy and/or distribute it,
+# with or without modifications, as long as this notice is preserved.
+
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY, to the extent permitted by law; without
+# even the implied warranty of MERCHANTABILITY or FITNESS FOR A
+# PARTICULAR PURPOSE.
+
+@SET_MAKE@
+
+VPATH = @srcdir@
+am__is_gnu_make = { \
+ if test -z '$(MAKELEVEL)'; then \
+ false; \
+ elif test -n '$(MAKE_HOST)'; then \
+ true; \
+ elif test -n '$(MAKE_VERSION)' && test -n '$(CURDIR)'; then \
+ true; \
+ else \
+ false; \
+ fi; \
+}
+am__make_running_with_option = \
+ case $${target_option-} in \
+ ?) ;; \
+ *) echo "am__make_running_with_option: internal error: invalid" \
+ "target option '$${target_option-}' specified" >&2; \
+ exit 1;; \
+ esac; \
+ has_opt=no; \
+ sane_makeflags=$$MAKEFLAGS; \
+ if $(am__is_gnu_make); then \
+ sane_makeflags=$$MFLAGS; \
+ else \
+ case $$MAKEFLAGS in \
+ *\\[\ \ ]*) \
+ bs=\\; \
+ sane_makeflags=`printf '%s\n' "$$MAKEFLAGS" \
+ | sed "s/$$bs$$bs[$$bs $$bs ]*//g"`;; \
+ esac; \
+ fi; \
+ skip_next=no; \
+ strip_trailopt () \
+ { \
+ flg=`printf '%s\n' "$$flg" | sed "s/$$1.*$$//"`; \
+ }; \
+ for flg in $$sane_makeflags; do \
+ test $$skip_next = yes && { skip_next=no; continue; }; \
+ case $$flg in \
+ *=*|--*) continue;; \
+ -*I) strip_trailopt 'I'; skip_next=yes;; \
+ -*I?*) strip_trailopt 'I';; \
+ -*O) strip_trailopt 'O'; skip_next=yes;; \
+ -*O?*) strip_trailopt 'O';; \
+ -*l) strip_trailopt 'l'; skip_next=yes;; \
+ -*l?*) strip_trailopt 'l';; \
+ -[dEDm]) skip_next=yes;; \
+ -[JT]) skip_next=yes;; \
+ esac; \
+ case $$flg in \
+ *$$target_option*) has_opt=yes; break;; \
+ esac; \
+ done; \
+ test $$has_opt = yes
+am__make_dryrun = (target_option=n; $(am__make_running_with_option))
+am__make_keepgoing = (target_option=k; $(am__make_running_with_option))
+pkgdatadir = $(datadir)/@PACKAGE@
+pkgincludedir = $(includedir)/@PACKAGE@
+pkglibdir = $(libdir)/@PACKAGE@
+pkglibexecdir = $(libexecdir)/@PACKAGE@
+am__cd = CDPATH="$${ZSH_VERSION+.}$(PATH_SEPARATOR)" && cd
+install_sh_DATA = $(install_sh) -c -m 644
+install_sh_PROGRAM = $(install_sh) -c
+install_sh_SCRIPT = $(install_sh) -c
+INSTALL_HEADER = $(INSTALL_DATA)
+transform = $(program_transform_name)
+NORMAL_INSTALL = :
+PRE_INSTALL = :
+POST_INSTALL = :
+NORMAL_UNINSTALL = :
+PRE_UNINSTALL = :
+POST_UNINSTALL = :
+build_triplet = @build@
+host_triplet = @host@
+subdir = doc
+ACLOCAL_M4 = $(top_srcdir)/aclocal.m4
+am__aclocal_m4_deps = $(top_srcdir)/m4/gs-device.m4 \
+ $(top_srcdir)/m4/makeinfo.m4 \
+ $(top_srcdir)/../../m4/kpse-common.m4 \
+ $(top_srcdir)/../../m4/kpse-freetype2-flags.m4 \
+ $(top_srcdir)/../../m4/kpse-gd-flags.m4 \
+ $(top_srcdir)/../../m4/kpse-kpathsea-flags.m4 \
+ $(top_srcdir)/../../m4/kpse-libpng-flags.m4 \
+ $(top_srcdir)/../../m4/kpse-warnings.m4 \
+ $(top_srcdir)/../../m4/kpse-win32.m4 \
+ $(top_srcdir)/../../m4/kpse-zlib-flags.m4 \
+ $(top_srcdir)/../../m4/libtool.m4 \
+ $(top_srcdir)/../../m4/ltoptions.m4 \
+ $(top_srcdir)/../../m4/ltsugar.m4 \
+ $(top_srcdir)/../../m4/ltversion.m4 \
+ $(top_srcdir)/../../m4/lt~obsolete.m4 $(top_srcdir)/version.ac \
+ $(top_srcdir)/ac/dvipng.ac $(top_srcdir)/configure.ac
+am__configure_deps = $(am__aclocal_m4_deps) $(CONFIGURE_DEPENDENCIES) \
+ $(ACLOCAL_M4)
+DIST_COMMON = $(srcdir)/Makefile.am $(dist_noinst_SCRIPTS) \
+ $(am__DIST_COMMON)
+mkinstalldirs = $(install_sh) -d
+CONFIG_HEADER = $(top_builddir)/config.h
+CONFIG_CLEAN_FILES =
+CONFIG_CLEAN_VPATH_FILES =
+SCRIPTS = $(dist_noinst_SCRIPTS)
+AM_V_P = $(am__v_P_@AM_V@)
+am__v_P_ = $(am__v_P_@AM_DEFAULT_V@)
+am__v_P_0 = false
+am__v_P_1 = :
+AM_V_GEN = $(am__v_GEN_@AM_V@)
+am__v_GEN_ = $(am__v_GEN_@AM_DEFAULT_V@)
+am__v_GEN_0 = @echo " GEN " $@;
+am__v_GEN_1 =
+AM_V_at = $(am__v_at_@AM_V@)
+am__v_at_ = $(am__v_at_@AM_DEFAULT_V@)
+am__v_at_0 = @
+am__v_at_1 =
+SOURCES =
+DIST_SOURCES =
+AM_V_DVIPS = $(am__v_DVIPS_@AM_V@)
+am__v_DVIPS_ = $(am__v_DVIPS_@AM_DEFAULT_V@)
+am__v_DVIPS_0 = @echo " DVIPS " $@;
+am__v_DVIPS_1 =
+AM_V_MAKEINFO = $(am__v_MAKEINFO_@AM_V@)
+am__v_MAKEINFO_ = $(am__v_MAKEINFO_@AM_DEFAULT_V@)
+am__v_MAKEINFO_0 = @echo " MAKEINFO" $@;
+am__v_MAKEINFO_1 =
+AM_V_INFOHTML = $(am__v_INFOHTML_@AM_V@)
+am__v_INFOHTML_ = $(am__v_INFOHTML_@AM_DEFAULT_V@)
+am__v_INFOHTML_0 = @echo " INFOHTML" $@;
+am__v_INFOHTML_1 =
+AM_V_TEXI2DVI = $(am__v_TEXI2DVI_@AM_V@)
+am__v_TEXI2DVI_ = $(am__v_TEXI2DVI_@AM_DEFAULT_V@)
+am__v_TEXI2DVI_0 = @echo " TEXI2DVI" $@;
+am__v_TEXI2DVI_1 =
+AM_V_TEXI2PDF = $(am__v_TEXI2PDF_@AM_V@)
+am__v_TEXI2PDF_ = $(am__v_TEXI2PDF_@AM_DEFAULT_V@)
+am__v_TEXI2PDF_0 = @echo " TEXI2PDF" $@;
+am__v_TEXI2PDF_1 =
+AM_V_texinfo = $(am__v_texinfo_@AM_V@)
+am__v_texinfo_ = $(am__v_texinfo_@AM_DEFAULT_V@)
+am__v_texinfo_0 = -q
+am__v_texinfo_1 =
+AM_V_texidevnull = $(am__v_texidevnull_@AM_V@)
+am__v_texidevnull_ = $(am__v_texidevnull_@AM_DEFAULT_V@)
+am__v_texidevnull_0 = > /dev/null
+am__v_texidevnull_1 =
+INFO_DEPS = $(srcdir)/dvipng.info
+TEXINFO_TEX = $(top_srcdir)/../../build-aux/texinfo.tex
+am__TEXINFO_TEX_DIR = $(top_srcdir)/../../build-aux
+DVIS = dvipng.dvi
+PDFS = dvipng.pdf
+PSS = dvipng.ps
+HTMLS = dvipng.html
+TEXINFOS = dvipng.texi
+TEXI2DVI = texi2dvi
+TEXI2PDF = $(TEXI2DVI) --pdf --batch
+MAKEINFOHTML = $(MAKEINFO) --html
+AM_MAKEINFOHTMLFLAGS = $(AM_MAKEINFOFLAGS)
+DVIPS = dvips
+am__can_run_installinfo = \
+ case $$AM_UPDATE_INFO_DIR in \
+ n|no|NO) false;; \
+ *) (install-info --version) >/dev/null 2>&1;; \
+ esac
+am__installdirs = "$(DESTDIR)$(infodir)" "$(DESTDIR)$(man1dir)"
+am__vpath_adj_setup = srcdirstrip=`echo "$(srcdir)" | sed 's|.|.|g'`;
+am__vpath_adj = case $$p in \
+ $(srcdir)/*) f=`echo "$$p" | sed "s|^$$srcdirstrip/||"`;; \
+ *) f=$$p;; \
+ esac;
+am__strip_dir = f=`echo $$p | sed -e 's|^.*/||'`;
+am__install_max = 40
+am__nobase_strip_setup = \
+ srcdirstrip=`echo "$(srcdir)" | sed 's/[].[^$$\\*|]/\\\\&/g'`
+am__nobase_strip = \
+ for p in $$list; do echo "$$p"; done | sed -e "s|$$srcdirstrip/||"
+am__nobase_list = $(am__nobase_strip_setup); \
+ for p in $$list; do echo "$$p $$p"; done | \
+ sed "s| $$srcdirstrip/| |;"' / .*\//!s/ .*/ ./; s,\( .*\)/[^/]*$$,\1,' | \
+ $(AWK) 'BEGIN { files["."] = "" } { files[$$2] = files[$$2] " " $$1; \
+ if (++n[$$2] == $(am__install_max)) \
+ { print $$2, files[$$2]; n[$$2] = 0; files[$$2] = "" } } \
+ END { for (dir in files) print dir, files[dir] }'
+am__base_list = \
+ sed '$$!N;$$!N;$$!N;$$!N;$$!N;$$!N;$$!N;s/\n/ /g' | \
+ sed '$$!N;$$!N;$$!N;$$!N;s/\n/ /g'
+am__uninstall_files_from_dir = { \
+ test -z "$$files" \
+ || { test ! -d "$$dir" && test ! -f "$$dir" && test ! -r "$$dir"; } \
+ || { echo " ( cd '$$dir' && rm -f" $$files ")"; \
+ $(am__cd) "$$dir" && rm -f $$files; }; \
+ }
+man1dir = $(mandir)/man1
+NROFF = nroff
+MANS = $(dist_man1_MANS)
+am__tagged_files = $(HEADERS) $(SOURCES) $(TAGS_FILES) $(LISP)
+am__DIST_COMMON = $(dist_man1_MANS) $(dvipng_TEXINFOS) \
+ $(srcdir)/Makefile.in $(top_srcdir)/../../am/man1_links.am \
+ $(top_srcdir)/../../build-aux/texinfo.tex
+DISTFILES = $(DIST_COMMON) $(DIST_SOURCES) $(TEXINFOS) $(EXTRA_DIST)
+ACLOCAL = @ACLOCAL@
+AMTAR = @AMTAR@
+AM_DEFAULT_VERBOSITY = @AM_DEFAULT_VERBOSITY@
+AM_MAKEINFOFLAGS = @AM_MAKEINFOFLAGS@
+AR = @AR@
+AS = @AS@
+AUTOCONF = @AUTOCONF@
+AUTOHEADER = @AUTOHEADER@
+AUTOMAKE = @AUTOMAKE@
+AWK = @AWK@
+CC = @CC@
+CCDEPMODE = @CCDEPMODE@
+CFLAGS = @CFLAGS@
+CPP = @CPP@
+CPPFLAGS = @CPPFLAGS@
+CYGPATH_W = @CYGPATH_W@
+DEFS = @DEFS@
+DEPDIR = @DEPDIR@
+DLLTOOL = @DLLTOOL@
+DSYMUTIL = @DSYMUTIL@
+DUMPBIN = @DUMPBIN@
+DVIPNG_TREE = @DVIPNG_TREE@
+ECHO_C = @ECHO_C@
+ECHO_N = @ECHO_N@
+ECHO_T = @ECHO_T@
+EGREP = @EGREP@
+EXEEXT = @EXEEXT@
+FGREP = @FGREP@
+FREETYPE2_DEPEND = @FREETYPE2_DEPEND@
+FREETYPE2_INCLUDES = @FREETYPE2_INCLUDES@
+FREETYPE2_LIBS = @FREETYPE2_LIBS@
+FT2_CONFIG = @FT2_CONFIG@
+GD_DEPEND = @GD_DEPEND@
+GD_INCLUDES = @GD_INCLUDES@
+GD_LIBS = @GD_LIBS@
+GREP = @GREP@
+GS = @GS@
+INSTALL = @INSTALL@
+INSTALL_DATA = @INSTALL_DATA@
+INSTALL_INFO = @INSTALL_INFO@
+INSTALL_PROGRAM = @INSTALL_PROGRAM@
+INSTALL_SCRIPT = @INSTALL_SCRIPT@
+INSTALL_STRIP_PROGRAM = @INSTALL_STRIP_PROGRAM@
+KPATHSEA_DEPEND = @KPATHSEA_DEPEND@
+KPATHSEA_INCLUDES = @KPATHSEA_INCLUDES@
+KPATHSEA_LIBS = @KPATHSEA_LIBS@
+LD = @LD@
+LDFLAGS = @LDFLAGS@
+LIBOBJS = @LIBOBJS@
+LIBPNG_DEPEND = @LIBPNG_DEPEND@
+LIBPNG_INCLUDES = @LIBPNG_INCLUDES@
+LIBPNG_LIBS = @LIBPNG_LIBS@
+LIBS = @LIBS@
+LIBTOOL = @LIBTOOL@
+LIPO = @LIPO@
+LN_S = @LN_S@
+LTLIBOBJS = @LTLIBOBJS@
+LT_SYS_LIBRARY_PATH = @LT_SYS_LIBRARY_PATH@
+MAINT = @MAINT@
+MAKEINFO = @MAKEINFO@
+MANIFEST_TOOL = @MANIFEST_TOOL@
+MKDIR_P = @MKDIR_P@
+NM = @NM@
+NMEDIT = @NMEDIT@
+OBJDUMP = @OBJDUMP@
+OBJEXT = @OBJEXT@
+OTOOL = @OTOOL@
+OTOOL64 = @OTOOL64@
+PACKAGE = @PACKAGE@
+PACKAGE_BUGREPORT = @PACKAGE_BUGREPORT@
+PACKAGE_NAME = @PACKAGE_NAME@
+PACKAGE_STRING = @PACKAGE_STRING@
+PACKAGE_TARNAME = @PACKAGE_TARNAME@
+PACKAGE_URL = @PACKAGE_URL@
+PACKAGE_VERSION = @PACKAGE_VERSION@
+PATH_SEPARATOR = @PATH_SEPARATOR@
+PKG_CONFIG = @PKG_CONFIG@
+POW_LIB = @POW_LIB@
+RANLIB = @RANLIB@
+SED = @SED@
+SET_MAKE = @SET_MAKE@
+SHELL = @SHELL@
+STRIP = @STRIP@
+VERSION = @VERSION@
+WARNING_CFLAGS = @WARNING_CFLAGS@
+ZLIB_DEPEND = @ZLIB_DEPEND@
+ZLIB_INCLUDES = @ZLIB_INCLUDES@
+ZLIB_LIBS = @ZLIB_LIBS@
+abs_builddir = @abs_builddir@
+abs_srcdir = @abs_srcdir@
+abs_top_builddir = @abs_top_builddir@
+abs_top_srcdir = @abs_top_srcdir@
+ac_ct_AR = @ac_ct_AR@
+ac_ct_CC = @ac_ct_CC@
+ac_ct_DUMPBIN = @ac_ct_DUMPBIN@
+am__include = @am__include@
+am__leading_dot = @am__leading_dot@
+am__quote = @am__quote@
+am__tar = @am__tar@
+am__untar = @am__untar@
+bindir = @bindir@
+build = @build@
+build_alias = @build_alias@
+build_cpu = @build_cpu@
+build_os = @build_os@
+build_vendor = @build_vendor@
+builddir = @builddir@
+datadir = @datadir@
+datarootdir = @datarootdir@
+docdir = @docdir@
+dvidir = @dvidir@
+exec_prefix = @exec_prefix@
+host = @host@
+host_alias = @host_alias@
+host_cpu = @host_cpu@
+host_os = @host_os@
+host_vendor = @host_vendor@
+htmldir = @htmldir@
+includedir = @includedir@
+infodir = @infodir@
+install_sh = @install_sh@
+libdir = @libdir@
+libexecdir = @libexecdir@
+localedir = @localedir@
+localstatedir = @localstatedir@
+mandir = @mandir@
+mkdir_p = @mkdir_p@
+oldincludedir = @oldincludedir@
+pdfdir = @pdfdir@
+prefix = @prefix@
+program_transform_name = @program_transform_name@
+psdir = @psdir@
+sbindir = @sbindir@
+sharedstatedir = @sharedstatedir@
+srcdir = @srcdir@
+sysconfdir = @sysconfdir@
+target_alias = @target_alias@
+top_build_prefix = @top_build_prefix@
+top_builddir = @top_builddir@
+top_srcdir = @top_srcdir@
+
+#
+info_TEXINFOS = \
+ dvipng.texi
+
+dvipng_TEXINFOS = \
+ dvipng.help \
+ install.texi \
+ macros.texi \
+ readme.texi
+
+BUILT_SOURCES = doc-stamp
+dist_noinst_SCRIPTS = texi2pod.pl
+dist_man1_MANS = dvipng.1
+
+# Symlinks within $(man1dir): FILE:LINK indicates LINK.1->FILE.1
+man1_links = dvipng:dvigif
+DISTCLEANFILES = doc-stamp
+all: $(BUILT_SOURCES)
+ $(MAKE) $(AM_MAKEFLAGS) all-am
+
+.SUFFIXES:
+.SUFFIXES: .dvi .html .info .pdf .ps .texi
+$(srcdir)/Makefile.in: @MAINTAINER_MODE_TRUE@ $(srcdir)/Makefile.am $(top_srcdir)/../../am/man1_links.am $(am__configure_deps)
+ @for dep in $?; do \
+ case '$(am__configure_deps)' in \
+ *$$dep*) \
+ ( cd $(top_builddir) && $(MAKE) $(AM_MAKEFLAGS) am--refresh ) \
+ && { if test -f $@; then exit 0; else break; fi; }; \
+ exit 1;; \
+ esac; \
+ done; \
+ echo ' cd $(top_srcdir) && $(AUTOMAKE) --foreign doc/Makefile'; \
+ $(am__cd) $(top_srcdir) && \
+ $(AUTOMAKE) --foreign doc/Makefile
+Makefile: $(srcdir)/Makefile.in $(top_builddir)/config.status
+ @case '$?' in \
+ *config.status*) \
+ cd $(top_builddir) && $(MAKE) $(AM_MAKEFLAGS) am--refresh;; \
+ *) \
+ echo ' cd $(top_builddir) && $(SHELL) ./config.status $(subdir)/$@ $(am__maybe_remake_depfiles)'; \
+ cd $(top_builddir) && $(SHELL) ./config.status $(subdir)/$@ $(am__maybe_remake_depfiles);; \
+ esac;
+$(top_srcdir)/../../am/man1_links.am $(am__empty):
+
+$(top_builddir)/config.status: $(top_srcdir)/configure $(CONFIG_STATUS_DEPENDENCIES)
+ cd $(top_builddir) && $(MAKE) $(AM_MAKEFLAGS) am--refresh
+
+$(top_srcdir)/configure: @MAINTAINER_MODE_TRUE@ $(am__configure_deps)
+ cd $(top_builddir) && $(MAKE) $(AM_MAKEFLAGS) am--refresh
+$(ACLOCAL_M4): @MAINTAINER_MODE_TRUE@ $(am__aclocal_m4_deps)
+ cd $(top_builddir) && $(MAKE) $(AM_MAKEFLAGS) am--refresh
+$(am__aclocal_m4_deps):
+
+mostlyclean-libtool:
+ -rm -f *.lo
+
+clean-libtool:
+ -rm -rf .libs _libs
+
+.texi.info:
+ $(AM_V_MAKEINFO)restore=: && backupdir="$(am__leading_dot)am$$$$" && \
+ am__cwd=`pwd` && $(am__cd) $(srcdir) && \
+ rm -rf $$backupdir && mkdir $$backupdir && \
+ if ($(MAKEINFO) --version) >/dev/null 2>&1; then \
+ for f in $@ $@-[0-9] $@-[0-9][0-9] $(@:.info=).i[0-9] $(@:.info=).i[0-9][0-9]; do \
+ if test -f $$f; then mv $$f $$backupdir; restore=mv; else :; fi; \
+ done; \
+ else :; fi && \
+ cd "$$am__cwd"; \
+ if $(MAKEINFO) $(AM_MAKEINFOFLAGS) $(MAKEINFOFLAGS) -I $(srcdir) \
+ -o $@ $<; \
+ then \
+ rc=0; \
+ $(am__cd) $(srcdir); \
+ else \
+ rc=$$?; \
+ $(am__cd) $(srcdir) && \
+ $$restore $$backupdir/* `echo "./$@" | sed 's|[^/]*$$||'`; \
+ fi; \
+ rm -rf $$backupdir; exit $$rc
+
+.texi.dvi:
+ $(AM_V_TEXI2DVI)TEXINPUTS="$(am__TEXINFO_TEX_DIR)$(PATH_SEPARATOR)$$TEXINPUTS" \
+ MAKEINFO='$(MAKEINFO) $(AM_MAKEINFOFLAGS) $(MAKEINFOFLAGS) -I $(srcdir)' \
+ $(TEXI2DVI) $(AM_V_texinfo) --build-dir=$(@:.dvi=.t2d) -o $@ $(AM_V_texidevnull) \
+ $<
+
+.texi.pdf:
+ $(AM_V_TEXI2PDF)TEXINPUTS="$(am__TEXINFO_TEX_DIR)$(PATH_SEPARATOR)$$TEXINPUTS" \
+ MAKEINFO='$(MAKEINFO) $(AM_MAKEINFOFLAGS) $(MAKEINFOFLAGS) -I $(srcdir)' \
+ $(TEXI2PDF) $(AM_V_texinfo) --build-dir=$(@:.pdf=.t2p) -o $@ $(AM_V_texidevnull) \
+ $<
+
+.texi.html:
+ $(AM_V_MAKEINFO)rm -rf $(@:.html=.htp)
+ $(AM_V_at)if $(MAKEINFOHTML) $(AM_MAKEINFOHTMLFLAGS) $(MAKEINFOFLAGS) -I $(srcdir) \
+ -o $(@:.html=.htp) $<; \
+ then \
+ rm -rf $@ && mv $(@:.html=.htp) $@; \
+ else \
+ rm -rf $(@:.html=.htp); exit 1; \
+ fi
+$(srcdir)/dvipng.info: dvipng.texi $(dvipng_TEXINFOS)
+dvipng.dvi: dvipng.texi $(dvipng_TEXINFOS)
+dvipng.pdf: dvipng.texi $(dvipng_TEXINFOS)
+dvipng.html: dvipng.texi $(dvipng_TEXINFOS)
+.dvi.ps:
+ $(AM_V_DVIPS)TEXINPUTS="$(am__TEXINFO_TEX_DIR)$(PATH_SEPARATOR)$$TEXINPUTS" \
+ $(DVIPS) $(AM_V_texinfo) -o $@ $<
+
+uninstall-dvi-am:
+ @$(NORMAL_UNINSTALL)
+ @list='$(DVIS)'; test -n "$(dvidir)" || list=; \
+ for p in $$list; do \
+ $(am__strip_dir) \
+ echo " rm -f '$(DESTDIR)$(dvidir)/$$f'"; \
+ rm -f "$(DESTDIR)$(dvidir)/$$f"; \
+ done
+
+uninstall-html-am:
+ @$(NORMAL_UNINSTALL)
+ @list='$(HTMLS)'; test -n "$(htmldir)" || list=; \
+ for p in $$list; do \
+ $(am__strip_dir) \
+ echo " rm -rf '$(DESTDIR)$(htmldir)/$$f'"; \
+ rm -rf "$(DESTDIR)$(htmldir)/$$f"; \
+ done
+
+uninstall-info-am:
+ @$(PRE_UNINSTALL)
+ @if test -d '$(DESTDIR)$(infodir)' && $(am__can_run_installinfo); then \
+ list='$(INFO_DEPS)'; \
+ for file in $$list; do \
+ relfile=`echo "$$file" | sed 's|^.*/||'`; \
+ echo " install-info --info-dir='$(DESTDIR)$(infodir)' --remove '$(DESTDIR)$(infodir)/$$relfile'"; \
+ if install-info --info-dir="$(DESTDIR)$(infodir)" --remove "$(DESTDIR)$(infodir)/$$relfile"; \
+ then :; else test ! -f "$(DESTDIR)$(infodir)/$$relfile" || exit 1; fi; \
+ done; \
+ else :; fi
+ @$(NORMAL_UNINSTALL)
+ @list='$(INFO_DEPS)'; \
+ for file in $$list; do \
+ relfile=`echo "$$file" | sed 's|^.*/||'`; \
+ relfile_i=`echo "$$relfile" | sed 's|\.info$$||;s|$$|.i|'`; \
+ (if test -d "$(DESTDIR)$(infodir)" && cd "$(DESTDIR)$(infodir)"; then \
+ echo " cd '$(DESTDIR)$(infodir)' && rm -f $$relfile $$relfile-[0-9] $$relfile-[0-9][0-9] $$relfile_i[0-9] $$relfile_i[0-9][0-9]"; \
+ rm -f $$relfile $$relfile-[0-9] $$relfile-[0-9][0-9] $$relfile_i[0-9] $$relfile_i[0-9][0-9]; \
+ else :; fi); \
+ done
+
+uninstall-pdf-am:
+ @$(NORMAL_UNINSTALL)
+ @list='$(PDFS)'; test -n "$(pdfdir)" || list=; \
+ for p in $$list; do \
+ $(am__strip_dir) \
+ echo " rm -f '$(DESTDIR)$(pdfdir)/$$f'"; \
+ rm -f "$(DESTDIR)$(pdfdir)/$$f"; \
+ done
+
+uninstall-ps-am:
+ @$(NORMAL_UNINSTALL)
+ @list='$(PSS)'; test -n "$(psdir)" || list=; \
+ for p in $$list; do \
+ $(am__strip_dir) \
+ echo " rm -f '$(DESTDIR)$(psdir)/$$f'"; \
+ rm -f "$(DESTDIR)$(psdir)/$$f"; \
+ done
+
+dist-info: $(INFO_DEPS)
+ @srcdirstrip=`echo "$(srcdir)" | sed 's|.|.|g'`; \
+ list='$(INFO_DEPS)'; \
+ for base in $$list; do \
+ case $$base in \
+ $(srcdir)/*) base=`echo "$$base" | sed "s|^$$srcdirstrip/||"`;; \
+ esac; \
+ if test -f $$base; then d=.; else d=$(srcdir); fi; \
+ base_i=`echo "$$base" | sed 's|\.info$$||;s|$$|.i|'`; \
+ for file in $$d/$$base $$d/$$base-[0-9] $$d/$$base-[0-9][0-9] $$d/$$base_i[0-9] $$d/$$base_i[0-9][0-9]; do \
+ if test -f $$file; then \
+ relfile=`expr "$$file" : "$$d/\(.*\)"`; \
+ test -f "$(distdir)/$$relfile" || \
+ cp -p $$file "$(distdir)/$$relfile"; \
+ else :; fi; \
+ done; \
+ done
+
+mostlyclean-aminfo:
+ -rm -rf dvipng.t2d dvipng.t2p
+
+clean-aminfo:
+ -test -z "dvipng.dvi dvipng.pdf dvipng.ps dvipng.html" \
+ || rm -rf dvipng.dvi dvipng.pdf dvipng.ps dvipng.html
+
+maintainer-clean-aminfo:
+ @list='$(INFO_DEPS)'; for i in $$list; do \
+ i_i=`echo "$$i" | sed 's|\.info$$||;s|$$|.i|'`; \
+ echo " rm -f $$i $$i-[0-9] $$i-[0-9][0-9] $$i_i[0-9] $$i_i[0-9][0-9]"; \
+ rm -f $$i $$i-[0-9] $$i-[0-9][0-9] $$i_i[0-9] $$i_i[0-9][0-9]; \
+ done
+install-man1: $(dist_man1_MANS)
+ @$(NORMAL_INSTALL)
+ @list1='$(dist_man1_MANS)'; \
+ list2=''; \
+ test -n "$(man1dir)" \
+ && test -n "`echo $$list1$$list2`" \
+ || exit 0; \
+ echo " $(MKDIR_P) '$(DESTDIR)$(man1dir)'"; \
+ $(MKDIR_P) "$(DESTDIR)$(man1dir)" || exit 1; \
+ { for i in $$list1; do echo "$$i"; done; \
+ if test -n "$$list2"; then \
+ for i in $$list2; do echo "$$i"; done \
+ | sed -n '/\.1[a-z]*$$/p'; \
+ fi; \
+ } | while read p; do \
+ if test -f $$p; then d=; else d="$(srcdir)/"; fi; \
+ echo "$$d$$p"; echo "$$p"; \
+ done | \
+ sed -e 'n;s,.*/,,;p;h;s,.*\.,,;s,^[^1][0-9a-z]*$$,1,;x' \
+ -e 's,\.[0-9a-z]*$$,,;$(transform);G;s,\n,.,' | \
+ sed 'N;N;s,\n, ,g' | { \
+ list=; while read file base inst; do \
+ if test "$$base" = "$$inst"; then list="$$list $$file"; else \
+ echo " $(INSTALL_DATA) '$$file' '$(DESTDIR)$(man1dir)/$$inst'"; \
+ $(INSTALL_DATA) "$$file" "$(DESTDIR)$(man1dir)/$$inst" || exit $$?; \
+ fi; \
+ done; \
+ for i in $$list; do echo "$$i"; done | $(am__base_list) | \
+ while read files; do \
+ test -z "$$files" || { \
+ echo " $(INSTALL_DATA) $$files '$(DESTDIR)$(man1dir)'"; \
+ $(INSTALL_DATA) $$files "$(DESTDIR)$(man1dir)" || exit $$?; }; \
+ done; }
+
+uninstall-man1:
+ @$(NORMAL_UNINSTALL)
+ @list='$(dist_man1_MANS)'; test -n "$(man1dir)" || exit 0; \
+ files=`{ for i in $$list; do echo "$$i"; done; \
+ } | sed -e 's,.*/,,;h;s,.*\.,,;s,^[^1][0-9a-z]*$$,1,;x' \
+ -e 's,\.[0-9a-z]*$$,,;$(transform);G;s,\n,.,'`; \
+ dir='$(DESTDIR)$(man1dir)'; $(am__uninstall_files_from_dir)
+tags TAGS:
+
+ctags CTAGS:
+
+cscope cscopelist:
+
+
+distdir: $(BUILT_SOURCES)
+ $(MAKE) $(AM_MAKEFLAGS) distdir-am
+
+distdir-am: $(DISTFILES)
+ @srcdirstrip=`echo "$(srcdir)" | sed 's/[].[^$$\\*]/\\\\&/g'`; \
+ topsrcdirstrip=`echo "$(top_srcdir)" | sed 's/[].[^$$\\*]/\\\\&/g'`; \
+ list='$(DISTFILES)'; \
+ dist_files=`for file in $$list; do echo $$file; done | \
+ sed -e "s|^$$srcdirstrip/||;t" \
+ -e "s|^$$topsrcdirstrip/|$(top_builddir)/|;t"`; \
+ case $$dist_files in \
+ */*) $(MKDIR_P) `echo "$$dist_files" | \
+ sed '/\//!d;s|^|$(distdir)/|;s,/[^/]*$$,,' | \
+ sort -u` ;; \
+ esac; \
+ for file in $$dist_files; do \
+ if test -f $$file || test -d $$file; then d=.; else d=$(srcdir); fi; \
+ if test -d $$d/$$file; then \
+ dir=`echo "/$$file" | sed -e 's,/[^/]*$$,,'`; \
+ if test -d "$(distdir)/$$file"; then \
+ find "$(distdir)/$$file" -type d ! -perm -700 -exec chmod u+rwx {} \;; \
+ fi; \
+ if test -d $(srcdir)/$$file && test $$d != $(srcdir); then \
+ cp -fpR $(srcdir)/$$file "$(distdir)$$dir" || exit 1; \
+ find "$(distdir)/$$file" -type d ! -perm -700 -exec chmod u+rwx {} \;; \
+ fi; \
+ cp -fpR $$d/$$file "$(distdir)$$dir" || exit 1; \
+ else \
+ test -f "$(distdir)/$$file" \
+ || cp -p $$d/$$file "$(distdir)/$$file" \
+ || exit 1; \
+ fi; \
+ done
+ $(MAKE) $(AM_MAKEFLAGS) \
+ top_distdir="$(top_distdir)" distdir="$(distdir)" \
+ dist-info
+check-am: all-am
+check: $(BUILT_SOURCES)
+ $(MAKE) $(AM_MAKEFLAGS) check-am
+all-am: Makefile $(INFO_DEPS) $(SCRIPTS) $(MANS)
+installdirs:
+ for dir in "$(DESTDIR)$(infodir)" "$(DESTDIR)$(man1dir)"; do \
+ test -z "$$dir" || $(MKDIR_P) "$$dir"; \
+ done
+install: $(BUILT_SOURCES)
+ $(MAKE) $(AM_MAKEFLAGS) install-am
+install-exec: $(BUILT_SOURCES)
+ $(MAKE) $(AM_MAKEFLAGS) install-exec-am
+install-data: install-data-am
+uninstall: uninstall-am
+
+install-am: all-am
+ @$(MAKE) $(AM_MAKEFLAGS) install-exec-am install-data-am
+
+installcheck: installcheck-am
+install-strip:
+ if test -z '$(STRIP)'; then \
+ $(MAKE) $(AM_MAKEFLAGS) INSTALL_PROGRAM="$(INSTALL_STRIP_PROGRAM)" \
+ install_sh_PROGRAM="$(INSTALL_STRIP_PROGRAM)" INSTALL_STRIP_FLAG=-s \
+ install; \
+ else \
+ $(MAKE) $(AM_MAKEFLAGS) INSTALL_PROGRAM="$(INSTALL_STRIP_PROGRAM)" \
+ install_sh_PROGRAM="$(INSTALL_STRIP_PROGRAM)" INSTALL_STRIP_FLAG=-s \
+ "INSTALL_PROGRAM_ENV=STRIPPROG='$(STRIP)'" install; \
+ fi
+mostlyclean-generic:
+
+clean-generic:
+
+distclean-generic:
+ -test -z "$(CONFIG_CLEAN_FILES)" || rm -f $(CONFIG_CLEAN_FILES)
+ -test . = "$(srcdir)" || test -z "$(CONFIG_CLEAN_VPATH_FILES)" || rm -f $(CONFIG_CLEAN_VPATH_FILES)
+ -test -z "$(DISTCLEANFILES)" || rm -f $(DISTCLEANFILES)
+
+maintainer-clean-generic:
+ @echo "This command is intended for maintainers to use"
+ @echo "it deletes files that may require special tools to rebuild."
+ -test -z "$(BUILT_SOURCES)" || rm -f $(BUILT_SOURCES)
+@have_gif_FALSE@install-data-hook:
+@have_gif_FALSE@uninstall-hook:
+clean: clean-am
+
+clean-am: clean-aminfo clean-generic clean-libtool mostlyclean-am
+
+distclean: distclean-am
+ -rm -f Makefile
+distclean-am: clean-am distclean-generic
+
+dvi: dvi-am
+
+dvi-am: $(DVIS)
+
+html: html-am
+
+html-am: $(HTMLS)
+
+info: info-am
+
+info-am: $(INFO_DEPS)
+
+install-data-am: install-info-am install-man
+ @$(NORMAL_INSTALL)
+ $(MAKE) $(AM_MAKEFLAGS) install-data-hook
+install-dvi: install-dvi-am
+
+install-dvi-am: $(DVIS)
+ @$(NORMAL_INSTALL)
+ @list='$(DVIS)'; test -n "$(dvidir)" || list=; \
+ if test -n "$$list"; then \
+ echo " $(MKDIR_P) '$(DESTDIR)$(dvidir)'"; \
+ $(MKDIR_P) "$(DESTDIR)$(dvidir)" || exit 1; \
+ fi; \
+ for p in $$list; do \
+ if test -f "$$p"; then d=; else d="$(srcdir)/"; fi; \
+ echo "$$d$$p"; \
+ done | $(am__base_list) | \
+ while read files; do \
+ echo " $(INSTALL_DATA) $$files '$(DESTDIR)$(dvidir)'"; \
+ $(INSTALL_DATA) $$files "$(DESTDIR)$(dvidir)" || exit $$?; \
+ done
+install-exec-am:
+
+install-html: install-html-am
+
+install-html-am: $(HTMLS)
+ @$(NORMAL_INSTALL)
+ @list='$(HTMLS)'; list2=; test -n "$(htmldir)" || list=; \
+ if test -n "$$list"; then \
+ echo " $(MKDIR_P) '$(DESTDIR)$(htmldir)'"; \
+ $(MKDIR_P) "$(DESTDIR)$(htmldir)" || exit 1; \
+ fi; \
+ for p in $$list; do \
+ if test -f "$$p" || test -d "$$p"; then d=; else d="$(srcdir)/"; fi; \
+ $(am__strip_dir) \
+ d2=$$d$$p; \
+ if test -d "$$d2"; then \
+ echo " $(MKDIR_P) '$(DESTDIR)$(htmldir)/$$f'"; \
+ $(MKDIR_P) "$(DESTDIR)$(htmldir)/$$f" || exit 1; \
+ echo " $(INSTALL_DATA) '$$d2'/* '$(DESTDIR)$(htmldir)/$$f'"; \
+ $(INSTALL_DATA) "$$d2"/* "$(DESTDIR)$(htmldir)/$$f" || exit $$?; \
+ else \
+ list2="$$list2 $$d2"; \
+ fi; \
+ done; \
+ test -z "$$list2" || { echo "$$list2" | $(am__base_list) | \
+ while read files; do \
+ echo " $(INSTALL_DATA) $$files '$(DESTDIR)$(htmldir)'"; \
+ $(INSTALL_DATA) $$files "$(DESTDIR)$(htmldir)" || exit $$?; \
+ done; }
+install-info: install-info-am
+
+install-info-am: $(INFO_DEPS)
+ @$(NORMAL_INSTALL)
+ @srcdirstrip=`echo "$(srcdir)" | sed 's|.|.|g'`; \
+ list='$(INFO_DEPS)'; test -n "$(infodir)" || list=; \
+ if test -n "$$list"; then \
+ echo " $(MKDIR_P) '$(DESTDIR)$(infodir)'"; \
+ $(MKDIR_P) "$(DESTDIR)$(infodir)" || exit 1; \
+ fi; \
+ for file in $$list; do \
+ case $$file in \
+ $(srcdir)/*) file=`echo "$$file" | sed "s|^$$srcdirstrip/||"`;; \
+ esac; \
+ if test -f $$file; then d=.; else d=$(srcdir); fi; \
+ file_i=`echo "$$file" | sed 's|\.info$$||;s|$$|.i|'`; \
+ for ifile in $$d/$$file $$d/$$file-[0-9] $$d/$$file-[0-9][0-9] \
+ $$d/$$file_i[0-9] $$d/$$file_i[0-9][0-9] ; do \
+ if test -f $$ifile; then \
+ echo "$$ifile"; \
+ else : ; fi; \
+ done; \
+ done | $(am__base_list) | \
+ while read files; do \
+ echo " $(INSTALL_DATA) $$files '$(DESTDIR)$(infodir)'"; \
+ $(INSTALL_DATA) $$files "$(DESTDIR)$(infodir)" || exit $$?; done
+ @$(POST_INSTALL)
+ @if $(am__can_run_installinfo); then \
+ list='$(INFO_DEPS)'; test -n "$(infodir)" || list=; \
+ for file in $$list; do \
+ relfile=`echo "$$file" | sed 's|^.*/||'`; \
+ echo " install-info --info-dir='$(DESTDIR)$(infodir)' '$(DESTDIR)$(infodir)/$$relfile'";\
+ install-info --info-dir="$(DESTDIR)$(infodir)" "$(DESTDIR)$(infodir)/$$relfile" || :;\
+ done; \
+ else : ; fi
+install-man: install-man1
+
+install-pdf: install-pdf-am
+
+install-pdf-am: $(PDFS)
+ @$(NORMAL_INSTALL)
+ @list='$(PDFS)'; test -n "$(pdfdir)" || list=; \
+ if test -n "$$list"; then \
+ echo " $(MKDIR_P) '$(DESTDIR)$(pdfdir)'"; \
+ $(MKDIR_P) "$(DESTDIR)$(pdfdir)" || exit 1; \
+ fi; \
+ for p in $$list; do \
+ if test -f "$$p"; then d=; else d="$(srcdir)/"; fi; \
+ echo "$$d$$p"; \
+ done | $(am__base_list) | \
+ while read files; do \
+ echo " $(INSTALL_DATA) $$files '$(DESTDIR)$(pdfdir)'"; \
+ $(INSTALL_DATA) $$files "$(DESTDIR)$(pdfdir)" || exit $$?; done
+install-ps: install-ps-am
+
+install-ps-am: $(PSS)
+ @$(NORMAL_INSTALL)
+ @list='$(PSS)'; test -n "$(psdir)" || list=; \
+ if test -n "$$list"; then \
+ echo " $(MKDIR_P) '$(DESTDIR)$(psdir)'"; \
+ $(MKDIR_P) "$(DESTDIR)$(psdir)" || exit 1; \
+ fi; \
+ for p in $$list; do \
+ if test -f "$$p"; then d=; else d="$(srcdir)/"; fi; \
+ echo "$$d$$p"; \
+ done | $(am__base_list) | \
+ while read files; do \
+ echo " $(INSTALL_DATA) $$files '$(DESTDIR)$(psdir)'"; \
+ $(INSTALL_DATA) $$files "$(DESTDIR)$(psdir)" || exit $$?; done
+installcheck-am:
+
+maintainer-clean: maintainer-clean-am
+ -rm -f Makefile
+maintainer-clean-am: distclean-am maintainer-clean-aminfo \
+ maintainer-clean-generic
+
+mostlyclean: mostlyclean-am
+
+mostlyclean-am: mostlyclean-aminfo mostlyclean-generic \
+ mostlyclean-libtool
+
+pdf: pdf-am
+
+pdf-am: $(PDFS)
+
+ps: ps-am
+
+ps-am: $(PSS)
+
+uninstall-am: uninstall-dvi-am uninstall-html-am uninstall-info-am \
+ uninstall-man uninstall-pdf-am uninstall-ps-am
+ @$(NORMAL_INSTALL)
+ $(MAKE) $(AM_MAKEFLAGS) uninstall-hook
+uninstall-man: uninstall-man1
+
+.MAKE: all check install install-am install-data-am install-exec \
+ install-strip uninstall-am
+
+.PHONY: all all-am check check-am clean clean-aminfo clean-generic \
+ clean-libtool cscopelist-am ctags-am dist-info distclean \
+ distclean-generic distclean-libtool distdir dvi dvi-am html \
+ html-am info info-am install install-am install-data \
+ install-data-am install-data-hook install-dvi install-dvi-am \
+ install-exec install-exec-am install-html install-html-am \
+ install-info install-info-am install-man install-man1 \
+ install-pdf install-pdf-am install-ps install-ps-am \
+ install-strip installcheck installcheck-am installdirs \
+ maintainer-clean maintainer-clean-aminfo \
+ maintainer-clean-generic mostlyclean mostlyclean-aminfo \
+ mostlyclean-generic mostlyclean-libtool pdf pdf-am ps ps-am \
+ tags-am uninstall uninstall-am uninstall-dvi-am uninstall-hook \
+ uninstall-html-am uninstall-info-am uninstall-man \
+ uninstall-man1 uninstall-pdf-am uninstall-ps-am
+
+.PRECIOUS: Makefile
+
+
+doc-stamp:
+@MAINTAINER_MODE_TRUE@ @for f in dvipng install macros readme; do \
+@MAINTAINER_MODE_TRUE@ f1="$(top_srcdir)/$(DVIPNG_TREE)/$$f.texi"; \
+@MAINTAINER_MODE_TRUE@ f2="$(srcdir)/$$f.texi"; \
+@MAINTAINER_MODE_TRUE@ echo "diff '$$f1' '$$f2'"; \
+@MAINTAINER_MODE_TRUE@ if diff "$$f1" "$$f2"; then :; \
+@MAINTAINER_MODE_TRUE@ else \
+@MAINTAINER_MODE_TRUE@ echo "cp -p '$$f1' '$$f2'"; \
+@MAINTAINER_MODE_TRUE@ cp -p "$$f1" "$$f2"; \
+@MAINTAINER_MODE_TRUE@ fi; \
+@MAINTAINER_MODE_TRUE@ done
+ echo timestamp >$@
+dvipng.1: dvipng.texi readme.texi
+ $(srcdir)/texi2pod.pl -D man $(srcdir)/dvipng.texi | \
+ sed -es/@//g -es/previewlatex/preview-latex/g -es/{}//g > dvipng.pod
+ pod2man --center="User commands" --release="$(PACKAGE_STRING)" \
+ dvipng.pod > dvipng.1
+ rm dvipng.pod
+.PHONY: install-man1-links uninstall-man1-links
+
+install-man1-links:
+ @cd $(DESTDIR)$(man1dir) && \
+ for s in $(man1_links); do \
+ link=`echo $$s | sed 's,.*:,,'`; \
+ file=`echo $$s | sed 's,:.*,,'`; \
+ rm -f $$link.1; \
+ echo "creating link '$$link.1' -> '$$file.1'"; \
+ echo ".so man1/$$file.1" >$$link.1; \
+ done
+
+uninstall-man1-links:
+ @for s in $(man1_links); do \
+ link=`echo $$s | sed 's,.*:,,'`; \
+ rm -f $(DESTDIR)$(man1dir)/$$link.1; \
+ done
+
+@have_gif_TRUE@install-data-hook: install-man1-links
+@have_gif_TRUE@uninstall-hook: uninstall-man1-links
+
+# Tell versions [3.59,3.63) of GNU make to not export all variables.
+# Otherwise a system limit (for SysV at least) may be exceeded.
+.NOEXPORT:
diff --git a/Build/source/texk/dvipng/doc/dvipng.1 b/Build/source/texk/dvipng/doc/dvipng.1
new file mode 100644
index 00000000000..613912fea6d
--- /dev/null
+++ b/Build/source/texk/dvipng/doc/dvipng.1
@@ -0,0 +1,506 @@
+.\" Automatically generated by Pod::Man 4.09 (Pod::Simple 3.35)
+.\"
+.\" Standard preamble:
+.\" ========================================================================
+.de Sp \" Vertical space (when we can't use .PP)
+.if t .sp .5v
+.if n .sp
+..
+.de Vb \" Begin verbatim text
+.ft CW
+.nf
+.ne \\$1
+..
+.de Ve \" End verbatim text
+.ft R
+.fi
+..
+.\" Set up some character translations and predefined strings. \*(-- will
+.\" give an unbreakable dash, \*(PI will give pi, \*(L" will give a left
+.\" double quote, and \*(R" will give a right double quote. \*(C+ will
+.\" give a nicer C++. Capital omega is used to do unbreakable dashes and
+.\" therefore won't be available. \*(C` and \*(C' expand to `' in nroff,
+.\" nothing in troff, for use with C<>.
+.tr \(*W-
+.ds C+ C\v'-.1v'\h'-1p'\s-2+\h'-1p'+\s0\v'.1v'\h'-1p'
+.ie n \{\
+. ds -- \(*W-
+. ds PI pi
+. if (\n(.H=4u)&(1m=24u) .ds -- \(*W\h'-12u'\(*W\h'-12u'-\" diablo 10 pitch
+. if (\n(.H=4u)&(1m=20u) .ds -- \(*W\h'-12u'\(*W\h'-8u'-\" diablo 12 pitch
+. ds L" ""
+. ds R" ""
+. ds C` ""
+. ds C' ""
+'br\}
+.el\{\
+. ds -- \|\(em\|
+. ds PI \(*p
+. ds L" ``
+. ds R" ''
+. ds C`
+. ds C'
+'br\}
+.\"
+.\" Escape single quotes in literal strings from groff's Unicode transform.
+.ie \n(.g .ds Aq \(aq
+.el .ds Aq '
+.\"
+.\" If the F register is >0, we'll generate index entries on stderr for
+.\" titles (.TH), headers (.SH), subsections (.SS), items (.Ip), and index
+.\" entries marked with X<> in POD. Of course, you'll have to process the
+.\" output yourself in some meaningful fashion.
+.\"
+.\" Avoid warning from groff about undefined register 'F'.
+.de IX
+..
+.if !\nF .nr F 0
+.if \nF>0 \{\
+. de IX
+. tm Index:\\$1\t\\n%\t"\\$2"
+..
+. if !\nF==2 \{\
+. nr % 0
+. nr F 2
+. \}
+.\}
+.\"
+.\" Accent mark definitions (@(#)ms.acc 1.5 88/02/08 SMI; from UCB 4.2).
+.\" Fear. Run. Save yourself. No user-serviceable parts.
+. \" fudge factors for nroff and troff
+.if n \{\
+. ds #H 0
+. ds #V .8m
+. ds #F .3m
+. ds #[ \f1
+. ds #] \fP
+.\}
+.if t \{\
+. ds #H ((1u-(\\\\n(.fu%2u))*.13m)
+. ds #V .6m
+. ds #F 0
+. ds #[ \&
+. ds #] \&
+.\}
+. \" simple accents for nroff and troff
+.if n \{\
+. ds ' \&
+. ds ` \&
+. ds ^ \&
+. ds , \&
+. ds ~ ~
+. ds /
+.\}
+.if t \{\
+. ds ' \\k:\h'-(\\n(.wu*8/10-\*(#H)'\'\h"|\\n:u"
+. ds ` \\k:\h'-(\\n(.wu*8/10-\*(#H)'\`\h'|\\n:u'
+. ds ^ \\k:\h'-(\\n(.wu*10/11-\*(#H)'^\h'|\\n:u'
+. ds , \\k:\h'-(\\n(.wu*8/10)',\h'|\\n:u'
+. ds ~ \\k:\h'-(\\n(.wu-\*(#H-.1m)'~\h'|\\n:u'
+. ds / \\k:\h'-(\\n(.wu*8/10-\*(#H)'\z\(sl\h'|\\n:u'
+.\}
+. \" troff and (daisy-wheel) nroff accents
+.ds : \\k:\h'-(\\n(.wu*8/10-\*(#H+.1m+\*(#F)'\v'-\*(#V'\z.\h'.2m+\*(#F'.\h'|\\n:u'\v'\*(#V'
+.ds 8 \h'\*(#H'\(*b\h'-\*(#H'
+.ds o \\k:\h'-(\\n(.wu+\w'\(de'u-\*(#H)/2u'\v'-.3n'\*(#[\z\(de\v'.3n'\h'|\\n:u'\*(#]
+.ds d- \h'\*(#H'\(pd\h'-\w'~'u'\v'-.25m'\f2\(hy\fP\v'.25m'\h'-\*(#H'
+.ds D- D\\k:\h'-\w'D'u'\v'-.11m'\z\(hy\v'.11m'\h'|\\n:u'
+.ds th \*(#[\v'.3m'\s+1I\s-1\v'-.3m'\h'-(\w'I'u*2/3)'\s-1o\s+1\*(#]
+.ds Th \*(#[\s+2I\s-2\h'-\w'I'u*3/5'\v'-.3m'o\v'.3m'\*(#]
+.ds ae a\h'-(\w'a'u*4/10)'e
+.ds Ae A\h'-(\w'A'u*4/10)'E
+. \" corrections for vroff
+.if v .ds ~ \\k:\h'-(\\n(.wu*9/10-\*(#H)'\s-2\u~\d\s+2\h'|\\n:u'
+.if v .ds ^ \\k:\h'-(\\n(.wu*10/11-\*(#H)'\v'-.4m'^\v'.4m'\h'|\\n:u'
+. \" for low resolution devices (crt and lpr)
+.if \n(.H>23 .if \n(.V>19 \
+\{\
+. ds : e
+. ds 8 ss
+. ds o a
+. ds d- d\h'-1'\(ga
+. ds D- D\h'-1'\(hy
+. ds th \o'bp'
+. ds Th \o'LP'
+. ds ae ae
+. ds Ae AE
+.\}
+.rm #[ #] #H #V #F C
+.\" ========================================================================
+.\"
+.IX Title "DVIPNG 1"
+.TH DVIPNG 1 "2020-01-05" "dvipng 1.17" "User commands"
+.\" For nroff, turn off justification. Always turn off hyphenation; it makes
+.\" way too many mistakes in technical documents.
+.if n .ad l
+.nh
+.SH "NAME"
+dvipng \- A DVI\-to\-PNG translator
+.SH "SYNOPSIS"
+.IX Header "SYNOPSIS"
+dvipng [options] filename
+.PP
+dvipng [options] [filename] \-
+.SH "DESCRIPTION"
+.IX Header "DESCRIPTION"
+This program makes \s-1PNG\s0 and/or \s-1GIF\s0 graphics from \s-1DVI\s0 files as obtained
+from TeX and its relatives.
+.PP
+If \s-1GIF\s0 support is enabled, \s-1GIF\s0 output is chosen by using the
+\&\fBdvigif\fR binary or with the \fB\-\-gif\fR option.
+.PP
+The benefits of \fBdvipng\fR/\fBdvigif\fR include
+.IP "*" 4
+Speed. It is a very fast bitmap-rendering code for \s-1DVI\s0 files, which
+makes it suitable for generating large amounts of images on-the-fly,
+as needed in preview-latex, WeBWorK and others.
+.IP "*" 4
+It does not read the postamble, so it can be started before TeX
+finishes. There is a \fB\-\-follow\fR switch that makes dvipng wait at
+end-of-file for further output, unless it finds the \s-1POST\s0 marker that
+indicates the end of the \s-1DVI.\s0
+.IP "*" 4
+Interactive query of options. dvipng can read options interactively
+through stdin, and all options are usable. It is even possible to change
+the input file through this interface.
+.IP "*" 4
+Supports \s-1PK, VF,\s0 PostScript Type1, and TrueType fonts, subfonts (i.e.,
+as used in CJK-LaTeX), color specials, and inclusion of PostScript,
+\&\s-1PNG, JPEG\s0 or \s-1GIF\s0 images.
+.IP "*" 4
+and more...
+.SH "OPTIONS"
+.IX Header "OPTIONS"
+Many of the parameterless options listed here can be turned off by
+suffixing the option with a zero (\fB0\fR); for instance, to turn off
+page reversal, use \fB\-r0\fR. Such options are marked with a trailing
+\&\fB*\fR.
+.IP "\fB\-\fR" 4
+.IX Item "-"
+Read additional options from standard input after processing the command
+line.
+.IP "\fB\-\-help\fR" 4
+.IX Item "--help"
+Print a usage message and exit.
+.IP "\fB\-\-version\fR" 4
+.IX Item "--version"
+Print the version number and exit.
+.IP "\fB\-bd\fR \fInum\fR" 4
+.IX Item "-bd num"
+.PD 0
+.IP "\fB\-bd\fR \fIcolor_spec\fR" 4
+.IX Item "-bd color_spec"
+.IP "\fB\-bd '\fR\fInum\fR\fB \fR\fIcolor_spec\fR\fB'\fR" 4
+.IX Item "-bd 'num color_spec'"
+.PD
+Set the pixel width of the transparent border (default 0). Using this
+option will make the image edges transparent, but it only affects pixels
+with the background color. Giving a \fIcolor_spec\fR will set the
+fallback color, to be used in viewers that cannot handle transparency
+(the default is the background color). The color spec should be in
+TeX color \especial syntax, e.g., 'rgb 1.0 0.0 0.0'. Setting the
+fallback color makes the default border width 1 px.
+.IP "\fB\-\-bdpi\fR \fInum\fR" 4
+.IX Item "--bdpi num"
+This option only has an effect when using bitmapped (\s-1PK\s0) fonts. The
+option sets the base (Metafont) resolution, both horizontal and
+vertical, to \fInum\fR dpi (dots per inch). This option is necessary
+when manually selecting Metafont mode with the \-\-mode option (see
+below).
+.IP "\fB\-bg\fR \fIcolor_spec\fR" 4
+.IX Item "-bg color_spec"
+Choose background color for the images. This option will be ignored if
+there is a background color \especial in the \s-1DVI.\s0 The color spec should
+be in TeX color \especial syntax, e.g., 'rgb 1.0 0.0 0.0'. You can
+also specify 'Transparent' or 'transparent' which will give you a
+transparent background with the normal background as a fallback color. A
+capitalized 'Transparent' will give a full-alpha transparency, while an
+all-lowercase 'transparent' will give a simple fully transparent
+background with non-transparent antialiased pixels. The latter would be
+suitable for viewers who cannot cope with a true alpha channel. \s-1GIF\s0
+images do not support full alpha transparency, so in case of \s-1GIF\s0 output,
+both variants will use the latter behaviour.
+.IP "\fB\-d\fR \fInum\fR" 4
+.IX Item "-d num"
+Set the debug flags, showing what dvipng (thinks it) is doing. This will
+work unless dvipng has been compiled without the \f(CW\*(C`DEBUG\*(C'\fR option
+(not recommended). Set the flags as you need them, use \fB\-d \-1\fR as
+the first option for maximum output.
+.IP "\fB\-D\fR \fInum\fR" 4
+.IX Item "-D num"
+Set the output resolution, both horizontal and vertical, to \fInum\fR
+dpi (dots per inch).
+.Sp
+One may want to adjust this to fit a certain text font size (e.g., on
+a web page), and for a text font height of \fIfont_px\fR pixels (in
+Mozilla) the correct formula is
+.Sp
+.Vb 1
+\& <dpi> = <font_px> * 72.27 / 10 [px * TeXpt/in / TeXpt]
+.Ve
+.Sp
+The last division by ten is due to the standard font height 10pt in
+your document, if you use 12pt, divide by 12. Unfortunately, some
+proprietary browsers have font height in pt (points), not pixels. You
+have to rescale that to pixels, using the screen resolution (default
+is usually 96 dpi) which means the formula is
+.Sp
+.Vb 1
+\& <font_px> = <font_pt> * 96 / 72 [pt * px/in / (pt/in)]
+.Ve
+.Sp
+On some high-res screens, the value is instead 120 dpi. Good luck!
+.IP "\fB\-\-depth*\fR" 4
+.IX Item "--depth*"
+Report the depth of the image. This only works reliably when the
+LaTeX style \fIpreview.sty\fR from preview-latex is used with
+the \fBactive\fR option. It reports the number of pixels from the
+bottom of the image to the baseline of the image. This can be used for
+vertical positioning of the image in, e.g., web documents, where one
+would use (Cascading StyleSheets 1)
+.Sp
+.Vb 1
+\& <IMG SRC="<filename.png>" STYLE="vertical\-align: \-<depth>px">
+.Ve
+.Sp
+The depth is a negative offset in this case, so the minus sign is
+necessary, and the unit is pixels (px).
+.IP "\fB\-\-dvinum*\fR" 4
+.IX Item "--dvinum*"
+Set this option to make the output page number be the TeX page
+numbers rather than the physical page number. See the \fB\-o\fR switch.
+.IP "\fB\-fg\fR \fIcolor_spec\fR" 4
+.IX Item "-fg color_spec"
+Choose foreground color for the images. This option will be ignored if
+there is a foreground color \especial in the \s-1DVI.\s0 The color spec should
+be in TeX color \especial syntax, e.g., 'rgb 1.0 0.0 0.0'.
+.IP "\fB\-\-follow*\fR" 4
+.IX Item "--follow*"
+Wait for data at end-of-file. One of the benefits of dvipng is that it
+does not read the postamble, so it can be started before TeX
+finishes. This switch makes dvipng wait at end-of-file for further
+output, unless it finds the \s-1POST\s0 marker that indicates the end of the
+\&\s-1DVI.\s0 This is similar to \fBtail \-f\fR but for DVI-to-PNG conversion.
+.IP "\fB\-\-freetype*\fR" 4
+.IX Item "--freetype*"
+Enable/disable FreeType font rendering (default on). This option is
+available if the FreeType2 font library was present at compilation time.
+If this is the case, dvipng will have direct support for PostScript
+Type1 and TrueType fonts internally, rather than using \fBgsftopk\fR
+for rendering the fonts. If you have PostScript versions of Computer
+Modern installed, there will be no need to generate bitmapped (\s-1PK\s0)
+variants on disk of these. Then, you can render images at different (and
+unusual) resolutions without cluttering the disk with lots of bitmapped
+fonts.
+One reason to disable FreeType font rendering would be to generate
+identical output on different platforms, since FreeType uses the native
+renderer and therefore can give slightly different output on each platform.
+.IP "\fB\-\-gamma\fR \fInum\fR" 4
+.IX Item "--gamma num"
+Control the interpolation of colors in the greyscale anti-aliasing
+color palette. Default value is 1.0. For 0 < \fInum\fR < 1, the
+fonts will be lighter (more like the background), and for \fInum\fR >
+1, the fonts will be darker (more like the foreground).
+.IP "\fB\-\-gif*\fR" 4
+.IX Item "--gif*"
+The images are output in the \s-1GIF\s0 format, if \s-1GIF\s0 support is enabled.
+This is the default for the \fBdvigif\fR binary, which only will be
+available when \s-1GIF\s0 support is enabled. \s-1GIF\s0 images are palette images
+(see the \fB\-\-palette\fR option) and does not support true alpha
+channels (see the \fB\-\-bg\fR option). See also the \fB\-\-png\fR
+option.
+.IP "\fB\-\-height*\fR" 4
+.IX Item "--height*"
+Report the height of the image. This only works reliably when the
+LaTeX style \fIpreview.sty\fR from preview-latex is used with
+the \fBactive\fR option. It reports the number of pixels from the top
+of the image to the baseline of the image. The total height of the
+image is obtained as the sum of the values reported from
+\&\fB\-\-height\fR and \fB\-\-depth\fR.
+.IP "\fB\-l [=]\fR\fInum\fR" 4
+.IX Item "-l [=]num"
+The last page printed will be the first one numbered \fInum\fR. Default
+is the last page in the document. If \fInum\fR is prefixed by an equals
+sign, then it (and the argument to the \fB\-p\fR option, if specified)
+is treated as a physical (absolute) page number, rather than a value to
+compare with the TeX \fB\ecount0\fR values stored in the \s-1DVI\s0 file.
+Thus, using \fB\-l =9\fR will end with the ninth page of the document,
+no matter what the pages are actually numbered.
+.IP "\fB\-\-mode\fR \fImode\fR" 4
+.IX Item "--mode mode"
+This option only has an effect when using bitmapped (\s-1PK\s0) fonts. Use
+\&\fImode\fR as the Metafont device name for the \s-1PK\s0 fonts (both for path
+searching and font generation). This needs to be augmented with the base
+device resolution, given with the \fB\-\-bdpi\fR option. See the file
+<\fBftp://ftp.tug.org/tex/modes.mf\fR> for a list of resolutions and mode
+names for most devices.
+.IP "\fB\-M*\fR" 4
+.IX Item "-M*"
+This option only has an effect when using bitmapped (\s-1PK\s0) fonts. It turns
+off automatic \s-1PK\s0 font generation (\fImktexpk\fR).
+.IP "\fB\-\-nogs*\fR" 4
+.IX Item "--nogs*"
+This switch prohibits the internal call to GhostScript for displaying
+PostScript specials. \fB\-\-nogs0\fR turns the call back on.
+.IP "\fB\-\-nogssafer*\fR" 4
+.IX Item "--nogssafer*"
+Normally, if GhostScript is used to render PostScript specials, the
+GhostScript interpreter is run with the option \fB\-dSAFER\fR. The
+\&\fB\-\-nogssafer\fR option runs GhostScript without \fB\-dSAFER\fR. The
+\&\fB\-dSAFER\fR option in Ghostscript disables PostScript operators such
+as deletefile, to prevent possibly malicious PostScript programs from
+having any effect.
+.IP "\fB\-\-norawps*\fR" 4
+.IX Item "--norawps*"
+Some packages generate raw PostScript specials, even non-rendering such
+specials. This switch turns off the internal call to GhostScript
+intended to display these raw PostScript specials. \fB\-\-norawps0\fR
+turns the call back on.
+.IP "\fB\-o\fR \fIname\fR" 4
+.IX Item "-o name"
+Send output to the file \fIname\fR. A single occurrence of \fB\f(CB%d\fB\fR or
+\&\fB\f(CB%01d\fB\fR, ..., \fB\f(CB%09d\fB\fR will be exchanged for the physical
+page number (this can be changed, see the \fB\-\-dvinum\fR switch). The
+default output filename is \fIfile\fR\fB\f(CB%d\fB.png\fR where the input \s-1DVI\s0
+file was \fIfile\fR\fB.dvi\fR.
+.IP "\fB\-O\fR \fIx\-offset\fR\fB,\fR\fIy\-offset\fR" 4
+.IX Item "-O x-offset,y-offset"
+Move the origin by \fIx\-offset\fR,\fIy\-offset\fR, a comma-separated
+pair of dimensions such as \fB.1in,\-.3cm\fR.
+The origin of the page is shifted from the default position
+(of one inch down, one inch to the right from the upper left corner of
+the paper) by this amount.
+.IP "\fB\-p [=]\fR\fInum\fR" 4
+.IX Item "-p [=]num"
+The first page printed will be the first one numbered \fInum\fR. Default
+is the first page in the document. If \fInum\fR is prefixed by an
+equals sign, then it (and the argument to the \fB\-l\fR option, if
+specified) is treated as a physical (absolute) page number, rather than
+a value to compare with the TeX \fB\ecount0\fR values stored in the
+\&\s-1DVI\s0 file. Thus, using \fB\-p =3\fR will start with the third page of
+the document, no matter what the pages are actually numbered.
+.IP "\fB\-\-palette*\fR" 4
+.IX Item "--palette*"
+When an external image is included, \fBdvipng\fR will automatically
+switch to truecolor mode, to avoid unnecessary delay and quality
+reduction, and enable the \s-1EPS\s0 translator to draw on a transparent
+background and outside of the boundingbox. This switch will force
+palette (256\-color) output and make \fBdvipng\fR revert to opaque
+clipped image inclusion. This will also override the \fB\-\-truecolor\fR
+switch if present.
+.IP "\fB\-\-picky*\fR" 4
+.IX Item "--picky*"
+No images are output when a warning occurs. Normally, dvipng will
+output an image in spite of a warning, but there may be something
+missing in this image. One reason to use this option would be if you
+have a more complete but slower fallback converter. Mainly, this is
+useful for failed figure inclusion and unknown \especial occurrences,
+but warnings will also occur for missing or unknown color specs and
+missing \s-1PK\s0 fonts.
+.IP "\fB\-\-png*\fR" 4
+.IX Item "--png*"
+The images are output in the \s-1PNG\s0 format. This is the default for the
+\&\fBdvipng\fR binary. See also the \fB\-\-gif\fR option.
+.IP "\fB\-pp\fR \fIfirstpage\fR\fB\-\fR\fIlastpage\fR" 4
+.IX Item "-pp firstpage-lastpage"
+Print pages \fIfirstpage\fR through \fIlastpage\fR; but not quite
+equivalent to \fB\-p\fR \fIfirstpage\fR \fB\-l\fR \fIlastpage\fR. For example,
+when rendering a book, there may be several instances of a page in the
+\&\s-1DVI\s0 file (one in \f(CW\*(C`\efrontmatter\*(C'\fR, one in \f(CW\*(C`\emainmatter\*(C'\fR, and one
+in \f(CW\*(C`\ebackmatter\*(C'\fR). In case of several pages matching, \fB\-pp\fR
+\&\fIfirstpage\fR\fB\-\fR\fIlastpage\fR will render \fIall\fR pages that
+matches the specified range, while \fB\-p\fR \fIfirstpage\fR \fB\-l\fR
+\&\fIlastpage\fR will render the pages from the \fIfirst\fR occurrence
+of \fIfirstpage\fR to the \fIfirst\fR occurrence of \fIlastpage\fR.
+This is the (undocumented) behaviour of dvips. In dvipng you can give
+both kinds of options, in which case you get all pages that matches the
+range in \fB\-pp\fR between the pages from \fB\-p\fR to \fB\-l\fR. Also
+multiple \fB\-pp\fR options accumulate, unlike \fB\-p\fR and \fB\-l\fR.
+The \fB\-\fR separator can also be \fB:\fR. Note that \fB\-pp \-1\fR
+will be interpreted as \*(L"all pages up to and including 1\*(R", if you want a
+page numbered \-1 (only the table of contents, say) put \fB\-pp \-1\-\-1\fR,
+or more readable, \fB\-pp \-1:\-1\fR.
+.IP "\fB\-q*\fR" 4
+.IX Item "-q*"
+Run quietly. Don't chatter about pages converted, etc. to standard
+output; report no warnings (only errors) to standard error.
+.IP "\fB\-Q\fR \fInum\fR" 4
+.IX Item "-Q num"
+Set the quality to \fInum\fR. That is, choose the number of antialiasing
+levels for bitmapped fonts (\s-1PK\s0), to be
+\&\fInum\fR*\fInum\fR+1. The default value is 4 which gives 17 levels of
+antialiasing for antialiased fonts from these two. If FreeType is
+available, its rendering is unaffected by this option.
+.IP "\fB\-r*\fR" 4
+.IX Item "-r*"
+Toggle output of pages in reverse/forward order. By default, the first
+page in the \s-1DVI\s0 is output first.
+.IP "\fB\-\-strict*\fR" 4
+.IX Item "--strict*"
+The program exits when a warning occurs. Normally, dvipng will output
+an image in spite of a warning, but there may be something missing in
+this image. One reason to use this option would be if you have a more
+complete but slower fallback converter. See the \fB\-\-picky\fR option
+above for a list of when warnings occur.
+.IP "\fB\-T\fR \fIimage_size\fR" 4
+.IX Item "-T image_size"
+Set the image size to \fIimage_size\fR which can be either of
+\&\fBbbox\fR, \fBtight\fR, or a comma-separated pair of dimensions
+\&\fIhsize\fR,\fIvsize\fR such as \fB.1in,.3cm\fR. The default is
+\&\fBbbox\fR which produces a \s-1PNG\s0 that includes all ink put on the page
+and in addition the \s-1DVI\s0 origin, located 1in from the top and 1in from
+the left edge of the paper. This usually gives whitespace above and to
+the left in the produced image. The value \fBtight\fR will make dvipng
+only include all ink put on the page, producing neat images.
+.IP "\fB\-\-truecolor*\fR" 4
+.IX Item "--truecolor*"
+This will make \fBdvipng\fR generate truecolor output. Note that
+truecolor output is automatic if you include an external image in your
+\&\s-1DVI,\s0 e.g., via a PostScript special (i.e., the \fBgraphics\fR or
+\&\fBgraphicx\fR package). This switch is overridden by the
+\&\fB\-\-palette\fR switch.
+.IP "\fB\-v*\fR" 4
+.IX Item "-v*"
+Enable verbose operation. This will currently indicate what fonts is
+used, in addition to the usual output.
+.IP "\fB\-\-width*\fR" 4
+.IX Item "--width*"
+Report the width of the image. See also \fB\-\-height\fR and
+\&\fB\-\-depth\fR.
+.IP "\fB\-x\fR \fInum\fR" 4
+.IX Item "-x num"
+This option is deprecated; it should not be used. It is much better to
+select the output resolution directly with the \fB\-D\fR option. This
+option sets the magnification ratio to \fInum\fR/1000 and
+overrides the magnification specified in the \s-1DVI\s0 file. Must be between
+10 and 100000. It is recommended that you use standard magstep values
+(1095, 1200, 1440, 1728, 2074, 2488, 2986, and so on) to help reduce the
+total number of \s-1PK\s0 files generated. \fInum\fR may be a real number, not
+an integer, for increased precision.
+.IP "\fB\-z\fR \fInum\fR" 4
+.IX Item "-z num"
+Set the \s-1PNG\s0 compression level to \fInum\fR. This option is enabled if
+your \fBlibgd\fR is new enough. The default compression level is 1,
+which selects maximum speed at the price of slightly larger PNGs. For an
+older \fBlibgd\fR, the hard-soldered value 5 is used. The include file
+\&\fBpng.h\fR says
+\&\*(L"Currently, valid values range from 0 \- 9, corresponding directly to
+the zlib compression levels 0 \- 9 (0 \- no compression, 9 \- \*(R"maximal\*(L"
+compression). Note that tests have shown that zlib compression levels
+3\-6 usually perform as well as level 9 for \s-1PNG\s0 images, and do
+considerably fewer calculations. In the future, these values may not
+correspond directly to the zlib compression levels.\*(R"
+.SH "NOTES"
+.IX Header "NOTES"
+The full manual is accessible in info format, on most systems by typing
+.PP
+.Vb 1
+\& info dvipng
+.Ve
+.SH "COPYRIGHT"
+.IX Header "COPYRIGHT"
+This program is released under the \s-1GNU\s0 Lesser General Public License
+version 3, see the \s-1COPYING\s0 file in the dvipng distribution or
+<\fBhttp://www.gnu.org/licenses/gpl.html\fR>.
+.PP
+Copyright (c) 2002\-2015, 2019 Jan-AAke Larsson
diff --git a/Build/source/texk/dvipng/doc/dvipng.help b/Build/source/texk/dvipng/doc/dvipng.help
new file mode 100644
index 00000000000..b8cd13354a3
--- /dev/null
+++ b/Build/source/texk/dvipng/doc/dvipng.help
@@ -0,0 +1,43 @@
+This is ./dvipng 1.17 Copyright 2002-2015, 2019 Jan-Ake Larsson
+
+Usage: ./dvipng [OPTION]... FILENAME[.dvi]
+Options are chosen to be similar to dvips' options where possible:
+ -d # Debug (# is the debug bitmap, 1 if not given)
+ -D # Output resolution
+ -l # Last page to be output
+ -o f Output file, '%d' is pagenumber
+ -O c Image offset
+ -p # First page to be output
+ -pp #,#.. Page list to be output
+ -q* Quiet operation
+ -T c Image size (also accepts '-T bbox' and '-T tight')
+ -v* Verbose operation
+ - Interactive query of options
+
+These do not correspond to dvips options:
+ -bd # Transparent border width in dots
+ -bd s Transparent border fallback color (TeX-style color)
+ -bg s Background color (TeX-style color or 'Transparent')
+ --depth* Output the image depth on stdout
+ --dvinum* Use TeX page numbers in output filenames
+ -fg s Foreground color (TeX-style color)
+ --follow* Wait for data at end-of-file
+ --freetype* FreeType font rendering (preferred, default on)
+ --gamma # Control color interpolation
+ --gif Output GIF images (dvigif default)
+ --height* Output the image height on stdout
+ --nogs* Don't use ghostscript for PostScript specials
+ --nogssafer* Don't use -dSAFER in ghostscript calls
+ --norawps* Don't convert raw PostScript specials
+ --palette* Force palette output
+ --picky When a warning occurs, don't output image
+ --png Output PNG images (dvipng default)
+ --strict When a warning occurs, exit
+ --truecolor* Truecolor output
+ -Q # Quality (PK subsampling)
+ --width* Output the image width on stdout
+ -z # PNG compression level
+
+ # = number f = file s = string * = suffix, '0' to turn off
+ c = comma-separated dimension pair (e.g., 3.2in,-32.1cm)
+
diff --git a/Build/source/texk/dvipng/doc/dvipng.info b/Build/source/texk/dvipng/doc/dvipng.info
new file mode 100644
index 00000000000..142b5b9f9e4
--- /dev/null
+++ b/Build/source/texk/dvipng/doc/dvipng.info
@@ -0,0 +1,1101 @@
+This is dvipng.info, produced by makeinfo version 5.1 from dvipng.texi.
+
+INFO-DIR-SECTION TeX
+START-INFO-DIR-ENTRY
+* DVI-to-PNG: (dvipng). Translating TeX DVI files to Portable Network Graphics (PNG).
+* dvipng: (dvipng). A DVI-to-PNG translator.
+END-INFO-DIR-ENTRY
+
+
+File: dvipng.info, Node: Top, Next: Introduction, Up: (dir)
+
+dvipng
+******
+
+This manual documents dvipng, a program to translate a DVI (DeVice
+Independent) file into PNG (Portable Network Graphics).
+
+ This file documents dvipng version 1.17
+
+ Corrections or perhaps rewrites of sections are _very welcome_.
+
+ Jan-AAke Larsson
+
+* Menu:
+
+* Introduction:: Introduction
+* Installation:: How to compile and install dvipng
+* Basic usage:: First things first
+* Command-line options:: Advanced usage
+* Graphics:: Including PostScript and/or bitmaps
+* Color:: Using color with dvipng
+* Diagnosing problems:: Problems?
+* Credits:: People who have contributed
+* Copying:: GNU Lesser General Public License
+* Index:: General index
+
+
+File: dvipng.info, Node: Introduction, Next: Installation, Prev: Top, Up: Top
+
+1 Introduction
+**************
+
+This program makes PNG and/or GIF graphics from DVI files as obtained
+from TeX and its relatives.
+
+ If GIF support is enabled, GIF output is chosen by using the 'dvigif'
+binary or with the '--gif' option.
+
+ It is intended to produce anti-aliased screen-resolution images as
+fast as is possible. The target audience is people who need to generate
+and regenerate many images again and again. The primary target is the
+preview-latex (X)Emacs package, a package to preview formulas from
+within (X)Emacs. Yes, you get to see your formulas in the (X)Emacs
+buffer, see <http://www.gnu.org/software/auctex/preview-latex.html>.
+
+ Another example is WeBWorK, an internet-based method for delivering
+homework problems to students over the internet, giving students instant
+feedback as to whether or not their answers are correct, see
+<http://webwork.math.rochester.edu>.
+
+ A more recent addition to the dvipng-using applications out there is
+MediaWiki, the software behind Wikipedia and many other wikis out there.
+Dvipng is used to render mathematical formulae from version 1.8.0 of
+MediaWiki, see <http://www.mediawiki.org>.
+
+ Other applications may also benefit, like web applications as
+latex2html and WYSIWYG editors like LyX.
+
+ The benefits of 'dvipng'/'dvigif' include
+
+ * Speed. It is a very fast bitmap-rendering code for DVI files,
+ which makes it suitable for generating large amounts of images
+ on-the-fly, as needed in preview-latex, WeBWorK and others.
+
+ * It does not read the postamble, so it can be started before TeX
+ finishes. There is a '--follow' switch that makes dvipng wait at
+ end-of-file for further output, unless it finds the POST marker
+ that indicates the end of the DVI.
+
+ * Interactive query of options. dvipng can read options
+ interactively through stdin, and all options are usable. It is
+ even possible to change the input file through this interface.
+
+ * Supports PK, VF, PostScript Type1, and TrueType fonts, subfonts
+ (i.e., as used in CJK-LaTeX), color specials, and inclusion of
+ PostScript, PNG, JPEG or GIF images.
+
+ * and more...
+
+
+File: dvipng.info, Node: Installation, Next: Basic usage, Prev: Introduction, Up: Top
+
+2 Installation
+**************
+
+Installing dvipng should be simple: merely './configure', 'make', and
+'make install'.
+
+* Menu:
+
+* Prerequisites::
+* Configure::
+* Build/install::
+* Installation outside the texmf tree::
+* Advice for non-privileged users::
+
+
+File: dvipng.info, Node: Prerequisites, Next: Configure, Up: Installation
+
+2.1 Prerequisites
+=================
+
+ * The GD Graphics Draw library, libgd
+
+ The drawing library 'libgd' is necessary, and is downloadable at
+ <https://bitbucket.org/libgd/gd-libgd/downloads>, and there are
+ binary packages for most operating systems from their respective
+ distributors. In any case, the library installs using 'autoconf'
+ so it should not be difficult for you to install it from source,
+ and then proceed with installing dvipng.
+
+ * The path-searching library kpathsea
+
+ Kpathsea is most likely included in your LaTeX installation, but it
+ may happen that ./configure does not find it; see below. If you do
+ not have it, download it from <http://www.ctan.org> and compile it.
+ I have no experience with this, so I cannot help much here.
+
+ * The font-rendering library FreeType 2
+
+ While not strictly necessary, a recent FreeType 2 is recommended
+ since dvipng currently will produce better-quality images when this
+ library is available. To take advantage of this, you should have
+ at least FreeType 2.1.9.
+
+ FreeType 2 will enable direct support for PostScript and TrueType
+ fonts, so that dvipng will not need to generate bitmapped variants
+ on disk of the TeX fonts since modern TeX distributions include
+ PostScript versions of them. Then, you can render images at
+ different (and unusual) resolutions without cluttering the disk
+ with lots of bitmapped fonts.
+
+ Finally, it will enable subfont support in dvipng. That is, if you
+ want to render CJK-LaTeX characters, you must have FreeType 2
+ installed.
+
+ * libpng and libz
+
+ To be able to compress and write PNG files to disk, dvipng (or
+ really libgd) uses libpng which in turn uses libz. These should be
+ available on any modern system, if not, download them and install
+ them.
+
+ * The 'texinfo' package
+
+ This is needed for building the documentation.
+
+
+File: dvipng.info, Node: Configure, Next: Build/install, Prev: Prerequisites, Up: Installation
+
+2.2 Configure
+=============
+
+The first step is to configure the source code, telling it where various
+files will be. To do so, run
+
+ ./configure OPTIONS
+
+ (Note: if you have fetched dvipng from CVS rather than a regular
+release, you will have to first generate './configure' by running
+'autoconf' 2.53 or later.)
+
+ On many machines, you will not need to specify any options, but if
+'configure' cannot determine something on its own, you'll need to help
+it out. For a list of the options type
+
+ ./configure --help
+
+ On some machines, the libraries will be installed in directories that
+are not in the linker's search path. This will generate an error when
+running './configure', indicating that it cannot find libgd or
+libkpathsea (most likely). You then need to specify the path to the
+respective library's object files. They are typically called e.g.,
+'libgd.a' or 'libgd.so'. If they are located in e.g., '/sw/local/lib',
+do
+
+ ./configure LDFLAGS=-L/sw/local/lib
+
+ If the library is available as a shared object file ('.so'), the
+runtime linker may also need to be told where to find the library, then
+use
+
+ ./configure LDFLAGS='-L/sw/local/lib -R/sw/local/lib'
+
+ When either of these is necessary, it is likely that the C header
+files are also installed in directories that are not in the C
+preprocessor's search path. This will also generate an error when
+running './configure', indicating that it cannot find e.g., 'gd.h' or
+'kpathsea.h' (most likely). You then need to specify the path to the
+respective library's C header files. If they are located in e.g.,
+'/sw/local/include', do
+
+ ./configure CPPFLAGS=-I/sw/local/include
+
+ On my SUN Solaris workstation, I had to combine this into
+
+ ./configure CPPFLAGS='-I/sw/local/include -I/sw/tex/teTeX/1.0/include'\
+ LDFLAGS='-L/sw/local/lib -R/sw/local/lib -L/sw/tex/teTeX/1.0/lib/'
+
+where the backslash denotes a continuation of the line.
+
+
+File: dvipng.info, Node: Build/install, Next: Installation outside the texmf tree, Prev: Configure, Up: Installation
+
+2.3 Build/install
+=================
+
+Once 'configure' has been run, simply enter
+
+ make
+
+at the prompt to compile the C code, and build the documentation files.
+To install the files into the locations chosen earlier, type
+
+ make install
+
+You may need special privileges to install, e.g., if you are installing
+into system directories.
+
+
+File: dvipng.info, Node: Installation outside the texmf tree, Next: Advice for non-privileged users, Prev: Build/install, Up: Installation
+
+2.4 Installation outside the texmf tree
+=======================================
+
+In some cases, a dvipng binary installed outside the texmf tree will not
+be able to find virtual fonts, or the PostScript font maps (normally
+used by dvips). This may be because _only_ $SELFAUTOLOC, $SELFAUTODIR,
+and $SELFAUTOPARENT are used in the texmf tree configuration file
+'texmf.cnf'. If so, give the switch '--enable-selfauto-set' to
+'./configure'. This will make dvipng adjust these three internally so
+that kpathsea thinks that dvipng _is_ installed in the texmf tree.
+
+
+File: dvipng.info, Node: Advice for non-privileged users, Prev: Installation outside the texmf tree, Up: Installation
+
+2.5 Installation for non-privileged users
+=========================================
+
+Often people without system administration privileges want to install
+software for their private use. In that case you need to specify more
+options to the 'configure' script, usually this is done by using the
+'--prefix' option to the 'configure' script, and let it point to the
+personal home directory. In that way, resulting binaries will be
+installed under the 'bin' subdirectory of your home directory, manual
+pages under 'man' and so on. That way, it is reasonably easy to
+maintain a bunch of additional packages, since the prefix argument is
+supported by most 'configure' scripts.
+
+ You'll have to add something like '/home/myself/bin' to your 'PATH'
+shell variable, if it isn't there already, and similarly set the
+'INFOPATH' and 'MANPATH' variables to be able to access the
+documentation.
+
+
+File: dvipng.info, Node: Basic usage, Next: Command-line options, Prev: Installation, Up: Top
+
+3 Basic usage of dvipng
+***********************
+
+To use dvipng at its simplest, simply type
+
+ dvipng foo
+
+where 'foo.dvi' is the output of TeX that you want to convert to PNG
+format. If there are four pages in 'foo.dvi', those pages will be
+output as 'foo1.png', 'foo2.png', 'foo3.png', and 'foo4.png',
+respectively.
+
+ If you have enabled the PostScript font support (via FreeType), fonts
+will be rendered as they are needed. Otherwise, dvipng will use
+bitmapped (PK) fonts, and if you use PK fonts that have not been used on
+your system before, they may be automatically generated; this process
+can take a few minutes, so progress reports appear by default. The next
+time the same font is used, it will have been saved on disk, so
+rendering will go much faster. (If dvipng tries to endlessly generate
+the same fonts over and over again, something is wrong. *Note
+(kpathsea)Unable to generate fonts::.)
+
+ Many options are available (see the next section). For a brief
+summary of available options, just type
+
+ dvipng --help
+
+
+File: dvipng.info, Node: Command-line options, Next: Graphics, Prev: Basic usage, Up: Top
+
+4 Command-line options
+**********************
+
+dvipng has a plethora of command line options. Reading through this
+section will give a good idea of the capabilities of the driver.
+
+* Menu:
+
+* Option summary:: Quick listing, from dvipng -help.
+* Option details:: More information about each option.
+
+
+File: dvipng.info, Node: Option summary, Next: Option details, Up: Command-line options
+
+4.1 Option summary
+==================
+
+Here is a handy summary of the options; it is printed out when you run
+dvipng with no arguments or with the standard '--help' option.
+
+ This is ./dvipng 1.17 Copyright 2002-2015, 2019 Jan-Ake Larsson
+
+ Usage: ./dvipng [OPTION]... FILENAME[.dvi]
+ Options are chosen to be similar to dvips' options where possible:
+ -d # Debug (# is the debug bitmap, 1 if not given)
+ -D # Output resolution
+ -l # Last page to be output
+ -o f Output file, '%d' is pagenumber
+ -O c Image offset
+ -p # First page to be output
+ -pp #,#.. Page list to be output
+ -q* Quiet operation
+ -T c Image size (also accepts '-T bbox' and '-T tight')
+ -v* Verbose operation
+ - Interactive query of options
+
+ These do not correspond to dvips options:
+ -bd # Transparent border width in dots
+ -bd s Transparent border fallback color (TeX-style color)
+ -bg s Background color (TeX-style color or 'Transparent')
+ --depth* Output the image depth on stdout
+ --dvinum* Use TeX page numbers in output filenames
+ -fg s Foreground color (TeX-style color)
+ --follow* Wait for data at end-of-file
+ --freetype* FreeType font rendering (preferred, default on)
+ --gamma # Control color interpolation
+ --gif Output GIF images (dvigif default)
+ --height* Output the image height on stdout
+ --nogs* Don't use ghostscript for PostScript specials
+ --nogssafer* Don't use -dSAFER in ghostscript calls
+ --norawps* Don't convert raw PostScript specials
+ --palette* Force palette output
+ --picky When a warning occurs, don't output image
+ --png Output PNG images (dvipng default)
+ --strict When a warning occurs, exit
+ --truecolor* Truecolor output
+ -Q # Quality (PK subsampling)
+ --width* Output the image width on stdout
+ -z # PNG compression level
+
+ # = number f = file s = string * = suffix, '0' to turn off
+ c = comma-separated dimension pair (e.g., 3.2in,-32.1cm)
+
+
+File: dvipng.info, Node: Option details, Prev: Option summary, Up: Command-line options
+
+4.2 Option details
+==================
+
+Many of the parameterless options listed here can be turned off by
+suffixing the option with a zero ('0'); for instance, to turn off page
+reversal, use '-r0'. Such options are marked with a trailing '*'.
+
+'-'
+ Read additional options from standard input after processing the
+ command line.
+
+'--help'
+ Print a usage message and exit.
+
+'--version'
+ Print the version number and exit.
+
+'-bd NUM'
+'-bd COLOR_SPEC'
+'-bd 'NUM COLOR_SPEC''
+ Set the pixel width of the transparent border (default 0). Using
+ this option will make the image edges transparent, but it only
+ affects pixels with the background color. Giving a COLOR_SPEC will
+ set the fallback color, to be used in viewers that cannot handle
+ transparency (the default is the background color). The color spec
+ should be in TeX color \special syntax, e.g., 'rgb 1.0 0.0 0.0'.
+ Setting the fallback color makes the default border width 1 px.
+ *Note Color::.
+
+'--bdpi NUM'
+ This option only has an effect when using bitmapped (PK) fonts.
+ The option sets the base (Metafont) resolution, both horizontal and
+ vertical, to NUM dpi (dots per inch). This option is necessary
+ when manually selecting Metafont mode with the -mode option (see
+ below).
+
+'-bg COLOR_SPEC'
+ Choose background color for the images. This option will be
+ ignored if there is a background color \special in the DVI. The
+ color spec should be in TeX color \special syntax, e.g., 'rgb 1.0
+ 0.0 0.0'. You can also specify 'Transparent' or 'transparent'
+ which will give you a transparent background with the normal
+ background as a fallback color. A capitalized 'Transparent' will
+ give a full-alpha transparency, while an all-lowercase
+ 'transparent' will give a simple fully transparent background with
+ non-transparent antialiased pixels. The latter would be suitable
+ for viewers who cannot cope with a true alpha channel. GIF images
+ do not support full alpha transparency, so in case of GIF output,
+ both variants will use the latter behaviour. *Note Color::.
+
+'-d NUM'
+ Set the debug flags, showing what dvipng (thinks it) is doing.
+ This will work unless dvipng has been compiled without the 'DEBUG'
+ option (not recommended). Set the flags as you need them, use '-d
+ -1' as the first option for maximum output. *Note Debug options::.
+
+'-D NUM'
+ Set the output resolution, both horizontal and vertical, to NUM dpi
+ (dots per inch).
+
+ One may want to adjust this to fit a certain text font size (e.g.,
+ on a web page), and for a text font height of FONT_PX pixels (in
+ Mozilla) the correct formula is
+ DPI = FONT_PX * 72.27 / 10 [px * TeXpt/in / TeXpt]
+ The last division by ten is due to the standard font height 10pt in
+ your document, if you use 12pt, divide by 12. Unfortunately, some
+ proprietary browsers have font height in pt (points), not pixels.
+ You have to rescale that to pixels, using the screen resolution
+ (default is usually 96 dpi) which means the formula is
+ FONT_PX = FONT_PT * 96 / 72 [pt * px/in / (pt/in)]
+ On some high-res screens, the value is instead 120 dpi. Good luck!
+
+'--depth*'
+ Report the depth of the image. This only works reliably when the
+ LaTeX style 'preview.sty' from preview-latex is used with the
+ 'active' option. It reports the number of pixels from the bottom
+ of the image to the baseline of the image. This can be used for
+ vertical positioning of the image in, e.g., web documents, where
+ one would use (Cascading StyleSheets 1)
+ <IMG SRC="FILENAME.PNG" STYLE="vertical-align: -DEPTHpx">
+ The depth is a negative offset in this case, so the minus sign is
+ necessary, and the unit is pixels (px).
+
+'--dvinum*'
+ Set this option to make the output page number be the TeX page
+ numbers rather than the physical page number. See the '-o' switch.
+
+'-fg COLOR_SPEC'
+ Choose foreground color for the images. This option will be
+ ignored if there is a foreground color \special in the DVI. The
+ color spec should be in TeX color \special syntax, e.g., 'rgb 1.0
+ 0.0 0.0'. *Note Color::.
+
+'--follow*'
+ Wait for data at end-of-file. One of the benefits of dvipng is
+ that it does not read the postamble, so it can be started before
+ TeX finishes. This switch makes dvipng wait at end-of-file for
+ further output, unless it finds the POST marker that indicates the
+ end of the DVI. This is similar to 'tail -f' but for DVI-to-PNG
+ conversion.
+
+'--freetype*'
+ Enable/disable FreeType font rendering (default on). This option
+ is available if the FreeType2 font library was present at
+ compilation time. If this is the case, dvipng will have direct
+ support for PostScript Type1 and TrueType fonts internally, rather
+ than using 'gsftopk' for rendering the fonts. If you have
+ PostScript versions of Computer Modern installed, there will be no
+ need to generate bitmapped (PK) variants on disk of these. Then,
+ you can render images at different (and unusual) resolutions
+ without cluttering the disk with lots of bitmapped fonts. One
+ reason to disable FreeType font rendering would be to generate
+ identical output on different platforms, since FreeType uses the
+ native renderer and therefore can give slightly different output on
+ each platform.
+
+'--gamma NUM'
+ Control the interpolation of colors in the greyscale anti-aliasing
+ color palette. Default value is 1.0. For 0 < NUM < 1, the fonts
+ will be lighter (more like the background), and for NUM > 1, the
+ fonts will be darker (more like the foreground).
+
+'--gif*'
+ The images are output in the GIF format, if GIF support is enabled.
+ This is the default for the 'dvigif' binary, which only will be
+ available when GIF support is enabled. GIF images are palette
+ images (see the '--palette' option) and does not support true alpha
+ channels (see the '--bg' option). See also the '--png' option.
+
+'--height*'
+ Report the height of the image. This only works reliably when the
+ LaTeX style 'preview.sty' from preview-latex is used with the
+ 'active' option. It reports the number of pixels from the top of
+ the image to the baseline of the image. The total height of the
+ image is obtained as the sum of the values reported from '--height'
+ and '--depth'.
+
+'-l [=]NUM'
+ The last page printed will be the first one numbered NUM. Default
+ is the last page in the document. If NUM is prefixed by an equals
+ sign, then it (and the argument to the '-p' option, if specified)
+ is treated as a physical (absolute) page number, rather than a
+ value to compare with the TeX '\count0' values stored in the DVI
+ file. Thus, using '-l =9' will end with the ninth page of the
+ document, no matter what the pages are actually numbered.
+
+'--mode MODE'
+ This option only has an effect when using bitmapped (PK) fonts.
+ Use MODE as the Metafont device name for the PK fonts (both for
+ path searching and font generation). This needs to be augmented
+ with the base device resolution, given with the '--bdpi' option.
+ See the file <ftp://ftp.tug.org/tex/modes.mf> for a list of
+ resolutions and mode names for most devices. *Note
+ (kpathsea)Unable to generate fonts::.
+
+'-M*'
+ This option only has an effect when using bitmapped (PK) fonts. It
+ turns off automatic PK font generation ('mktexpk').
+
+'--nogs*'
+ This switch prohibits the internal call to GhostScript for
+ displaying PostScript specials. '--nogs0' turns the call back on.
+
+'--nogssafer*'
+ Normally, if GhostScript is used to render PostScript specials, the
+ GhostScript interpreter is run with the option '-dSAFER'. The
+ '--nogssafer' option runs GhostScript without '-dSAFER'. The
+ '-dSAFER' option in Ghostscript disables PostScript operators such
+ as deletefile, to prevent possibly malicious PostScript programs
+ from having any effect.
+
+'--norawps*'
+ Some packages generate raw PostScript specials, even non-rendering
+ such specials. This switch turns off the internal call to
+ GhostScript intended to display these raw PostScript specials.
+ '--norawps0' turns the call back on.
+
+'-o NAME'
+ Send output to the file NAME. A single occurrence of '%d' or
+ '%01d', ..., '%09d' will be exchanged for the physical page number
+ (this can be changed, see the '--dvinum' switch). The default
+ output filename is 'FILE%d.png' where the input DVI file was
+ 'FILE.dvi'.
+
+'-O X-OFFSET,Y-OFFSET'
+ Move the origin by X-OFFSET,Y-OFFSET, a comma-separated pair of
+ dimensions such as '.1in,-.3cm'. The origin of the page is shifted
+ from the default position (of one inch down, one inch to the right
+ from the upper left corner of the paper) by this amount.
+
+'-p [=]NUM'
+ The first page printed will be the first one numbered NUM. Default
+ is the first page in the document. If NUM is prefixed by an equals
+ sign, then it (and the argument to the '-l' option, if specified)
+ is treated as a physical (absolute) page number, rather than a
+ value to compare with the TeX '\count0' values stored in the DVI
+ file. Thus, using '-p =3' will start with the third page of the
+ document, no matter what the pages are actually numbered.
+
+'--palette*'
+ When an external image is included, 'dvipng' will automatically
+ switch to truecolor mode, to avoid unnecessary delay and quality
+ reduction, and enable the EPS translator to draw on a transparent
+ background and outside of the boundingbox. This switch will force
+ palette (256-color) output and make 'dvipng' revert to opaque
+ clipped image inclusion. This will also override the '--truecolor'
+ switch if present.
+
+'--picky*'
+ No images are output when a warning occurs. Normally, dvipng will
+ output an image in spite of a warning, but there may be something
+ missing in this image. One reason to use this option would be if
+ you have a more complete but slower fallback converter. Mainly,
+ this is useful for failed figure inclusion and unknown \special
+ occurrences, but warnings will also occur for missing or unknown
+ color specs and missing PK fonts.
+
+'--png*'
+ The images are output in the PNG format. This is the default for
+ the 'dvipng' binary. See also the '--gif' option.
+
+'-pp FIRSTPAGE-LASTPAGE'
+ Print pages FIRSTPAGE through LASTPAGE; but not quite equivalent to
+ '-p FIRSTPAGE -l LASTPAGE'. For example, when rendering a book,
+ there may be several instances of a page in the DVI file (one in
+ '\frontmatter', one in '\mainmatter', and one in '\backmatter').
+ In case of several pages matching, '-pp FIRSTPAGE-LASTPAGE' will
+ render _all_ pages that matches the specified range, while '-p
+ FIRSTPAGE -l LASTPAGE' will render the pages from the _first_
+ occurrence of FIRSTPAGE to the _first_ occurrence of LASTPAGE.
+ This is the (undocumented) behaviour of dvips. In dvipng you can
+ give both kinds of options, in which case you get all pages that
+ matches the range in '-pp' between the pages from '-p' to '-l'.
+ Also multiple '-pp' options accumulate, unlike '-p' and '-l'. The
+ '-' separator can also be ':'. Note that '-pp -1' will be
+ interpreted as "all pages up to and including 1", if you want a
+ page numbered -1 (only the table of contents, say) put '-pp -1--1',
+ or more readable, '-pp -1:-1'.
+
+'-q*'
+ Run quietly. Don't chatter about pages converted, etc. to standard
+ output; report no warnings (only errors) to standard error.
+
+'-Q NUM'
+ Set the quality to NUM. That is, choose the number of antialiasing
+ levels for bitmapped fonts (PK), to be NUM*NUM+1. The default
+ value is 4 which gives 17 levels of antialiasing for antialiased
+ fonts from these two. If FreeType is available, its rendering is
+ unaffected by this option.
+
+'-r*'
+ Toggle output of pages in reverse/forward order. By default, the
+ first page in the DVI is output first.
+
+'--strict*'
+ The program exits when a warning occurs. Normally, dvipng will
+ output an image in spite of a warning, but there may be something
+ missing in this image. One reason to use this option would be if
+ you have a more complete but slower fallback converter. See the
+ '--picky' option above for a list of when warnings occur.
+
+'-T IMAGE_SIZE'
+ Set the image size to IMAGE_SIZE which can be either of 'bbox',
+ 'tight', or a comma-separated pair of dimensions HSIZE,VSIZE such
+ as '.1in,.3cm'. The default is 'bbox' which produces a PNG that
+ includes all ink put on the page and in addition the DVI origin,
+ located 1in from the top and 1in from the left edge of the paper.
+ This usually gives whitespace above and to the left in the produced
+ image. The value 'tight' will make dvipng only include all ink put
+ on the page, producing neat images.
+
+'--truecolor*'
+ This will make 'dvipng' generate truecolor output. Note that
+ truecolor output is automatic if you include an external image in
+ your DVI, e.g., via a PostScript special (i.e., the 'graphics' or
+ 'graphicx' package). This switch is overridden by the '--palette'
+ switch.
+
+'-v*'
+ Enable verbose operation. This will currently indicate what fonts
+ is used, in addition to the usual output.
+
+'--width*'
+ Report the width of the image. See also '--height' and '--depth'.
+
+'-x NUM'
+ This option is deprecated; it should not be used. It is much
+ better to select the output resolution directly with the '-D'
+ option. This option sets the magnification ratio to NUM/1000 and
+ overrides the magnification specified in the DVI file. Must be
+ between 10 and 100000. It is recommended that you use standard
+ magstep values (1095, 1200, 1440, 1728, 2074, 2488, 2986, and so
+ on) to help reduce the total number of PK files generated. NUM may
+ be a real number, not an integer, for increased precision.
+
+'-z NUM'
+ Set the PNG compression level to NUM. This option is enabled if
+ your 'libgd' is new enough. The default compression level is 1,
+ which selects maximum speed at the price of slightly larger PNGs.
+ For an older 'libgd', the hard-soldered value 5 is used. The
+ include file 'png.h' says
+ Currently, valid values range from 0 - 9, corresponding
+ directly to the zlib compression levels 0 - 9 (0 - no
+ compression, 9 - "maximal" compression). Note that tests have
+ shown that zlib compression levels 3-6 usually perform as well
+ as level 9 for PNG images, and do considerably fewer
+ calculations. In the future, these values may not correspond
+ directly to the zlib compression levels.
+
+
+File: dvipng.info, Node: Graphics, Next: Color, Prev: Command-line options, Up: Top
+
+5 Graphics
+**********
+
+'dvipng' attempts to handle graphics as included by the 'graphicx' and
+'graphics' packages, without the need of specifying a driver to these
+packages. This means that it recognizes the encapsulated postscript
+inclusion meant for 'dvips', but is also able (from version 1.8) to
+include bitmapped graphics. It also tries to handle some of the raw
+PostScript that is output from various packages. Some of the
+possibilities and problems are mentioned below.
+
+* Menu:
+
+* Encapsulated PostScript:: An internal call to GhostScript
+* Bitmapped graphics:: PNG, JPEG and GIF
+* Raw PostScript:: Ignore or give to GhostScript
+
+
+File: dvipng.info, Node: Encapsulated PostScript, Next: Bitmapped graphics, Up: Graphics
+
+5.1 Encapsulated PostScript
+===========================
+
+When an EPS file is included, a call to GhostScript is performed to
+produce a bitmapped image that can be included. The default is to
+produce an image with transparent background, at the same size as the
+DVI page currently being converted to PNG, and include that as
+foreground on the PNG. Of course, if the image is to be cropped, that is
+done. The included image will be a truecolor image, so for maximum
+performance the output PNG will be in truecolor mode as well.
+
+ This conversion needs the 'pngalpha' output device to be present in
+your copy of GhostScript. If that device is not present, or you use the
+'--palette' switch or request GIF output, the fallback is to use the
+'png16m' device to produce a cropped opaque image for inclusion. Other
+relevant switches are '--noghostscript' and '--nogssafer'. *Note Option
+details::.
+
+ The most common problem with including graphics is an incorrect
+bounding box. Complain to whoever wrote the software that generated the
+file if the bounding box is indeed incorrect. An adjusted boundingbox
+can be specified in the '\includegraphics' call, as in this example
+(using 'graphicx'):
+
+ \includegraphics[bb=10 20 100 200]{imagename.eps}
+
+
+File: dvipng.info, Node: Bitmapped graphics, Next: Raw PostScript, Prev: Encapsulated PostScript, Up: Graphics
+
+5.2 Bitmapped graphics
+======================
+
+dvipng can include PNG, JPEG and GIF graphics. When including such
+images via '\includegraphics' you need to specify the bounding box since
+TeX itself cannot read them from the files in question. The bounding
+box size should be given as '0 0 w h' in pixels, e.g., if the file
+'imagename.png' is 300x400 pixels, the inclusion would read
+
+ \includegraphics[bb=0 0 300 400]{imagename.png}
+
+ The default size is the image size in bp ("big points" in TeX
+nomenclature or PostScript points as other people have it, 72 per inch).
+That is, default resolution will be 72 dpi for included bitmaps, which
+is the default size in the few other bitmap-capable drivers that are
+known to me (dvipdfm and PDFLaTeX).
+
+ If you want 100 dpi you need to specify the width accordingly. You
+just divide your image width by 100: a 135 pixel wide image at 100 dpi
+will take up 1.35 inches. If you want 200 dpi you divide by 200, and so
+on. Simple, eh? The example above at 200 dpi would be 1.5 inches wide:
+
+ \includegraphics[bb=0 0 300 400,witdh=1.5in]{imagename.png}
+
+
+File: dvipng.info, Node: Raw PostScript, Prev: Bitmapped graphics, Up: Graphics
+
+5.3 Raw PostScript
+==================
+
+dvipng attempts to handle raw PostScript. Rendering raw PostScript
+specials is done on top of the page by including a transparent image
+generated by the 'pngalpha' device in GhostScript (automatically
+selecting 'truecolor' mode in dvipng).
+
+ Included PostScript headers are respected, and if the header
+'tex.pro' is included, dvipng also throws in 'color.pro' and
+'special.pro'. The package 'xcolor' includes its own headers with color
+names, and this is not only kept as a PostScript header, but is also
+read and interpreted by dvipng itself. An attempt is also made to
+respect the PGF header. The non-rendering specials from 'hyperref' are
+handled via some heuristics and do not give an error.
+
+ Really rendering and moving things with raw PostScript specials is
+more troublesome. The \rotatebox macro serves as a good example. The
+dvips driver of the graphicx package surrounds DVI glyphs with
+PostScript code so that after conversion by dvips, the glyphs (now
+themselves in PostScript) will be rotated in the desired way. dvipng
+does not handle this, at present. An attempt has been made to handle
+the rendering specials output by PGF (tikz), and also PSTricks. Some
+things work, but others do not. This is especially clear when mixing
+PostScript and DVI rendering commands such as glyphs. dvipng cannot at
+present detect if PostScript code moves 'currentpoint' or rotates the
+frame since GhostScript does not return such information. A
+recommendation would be to produce images from these packages as EPS
+files and include them into your document in the standard manner.
+
+ Another way to handle this would be to use a slower fallback (with
+dvips and gs, for example). If you want to disable raw PostScript
+handling in dvipng, use the switch '--norawps'. This switch turns off
+the internal call to GhostScript intended to display these raw
+PostScript specials. Further, when dvipng encounters raw PostScript and
+the gs call is turned off, it gives a warning. It is now possible to
+use the switch '--picky' to disable page rendering of pages with
+warnings, and use the slower fallback for these pages.
+
+
+File: dvipng.info, Node: Color, Next: Diagnosing problems, Prev: Graphics, Up: Top
+
+6 Color
+*******
+
+To support color, dvipng recognizes a certain set of specials as
+generated by the 'color' and 'xcolor' style files. These specials start
+with the keyword 'color' or the keyword 'background', followed by a
+color specification.
+
+* Menu:
+
+* Color specifications::
+* Color specials::
+
+
+File: dvipng.info, Node: Color specifications, Next: Color specials, Up: Color
+
+6.1 Color specifications
+========================
+
+The color specification supported by dvipng is by-value or by-name. The
+by-value spec starts with the name of a color model (one of 'rgb',
+'hsb', 'cmy', 'cmyk', or 'gray') followed by the appropriate number of
+parameters. Thus, the color specification 'rgb 0.3 0.4 0.5' would
+correspond to the color that is '0.3 0.4 0.5' in its red, blue and green
+values. The color model used internally in dvipng is 'RGB' (discretized
+to 256 levels), for details on the formulas used in conversion, see the
+'xcolor' documentation.
+
+ By-name color specifications are single (case-dependent) words and
+are compared with color names defined in 'dvipsnam.def' (from the
+'graphics' bundle), 'svgnam.def' and 'xcolor.sty' (from the 'xcolor'
+bundle). See the 'xcolor' documentation for a list of names and the
+corresponding colors.
+
+ On the command-line, the name 'Transparent' can also be used as an
+argument to '--bg' to choose transparent background. *Note Option
+details::.
+
+
+File: dvipng.info, Node: Color specials, Prev: Color specifications, Up: Color
+
+6.2 Color specials
+==================
+
+We will describe 'background' first, since it is the simplest. The
+'background' keyword must be followed by a color specification. That
+color specification is used as a fill color for the background. The
+last 'background' special on a page is the one that gets used, and is
+used for the whole of the page image. (This is possible because the
+prescan phase of dvipng notices all of the color specials so that the
+appropriate information can be written out during the second phase.)
+
+ The 'color' special itself has three forms. The first is just
+'color' followed by a color specification. In this case, the current
+global color is set to that color; the color stack must be empty when
+such a command is executed.
+
+ The second form is 'color push' followed by a color specification.
+This saves the current color on the color stack and sets the color to be
+that given by the color specification. This is the most common way to
+set a color.
+
+ The final form of the 'color' special is just 'color pop', with no
+color specification; this says to pop the color last pushed on the color
+stack from the color stack and set the current color to be that color.
+
+ dvipng correctly handles these color specials across pages, even when
+the pages are rendered repeatedly or in reverse order.
+
+
+File: dvipng.info, Node: Diagnosing problems, Next: Credits, Prev: Color, Up: Top
+
+7 Diagnosing problems
+*********************
+
+You've gone through all the trouble of installing dvipng, carefully read
+all the instructions in this manual, and still can't get something to
+work. The following sections provide some helpful hints if you find
+yourself in such a situation.
+
+* Menu:
+
+* Contact information:: Who to ask.
+* Debug options:: Getting diagnostics.
+
+
+File: dvipng.info, Node: Contact information, Next: Debug options, Up: Diagnosing problems
+
+7.1 Contact information
+=======================
+
+Bug reports should be sent to <dvipng@nongnu.org>.
+
+ Questions, suggestions for new features, pleas for help, and/or
+praise should go to <dvipng@nongnu.org>. For more information on this
+mailing list, send a message with just the word 'help' as subject or
+body to <dvipng-request@nongnu.org> or look at
+<http://lists.nongnu.org/mailman/listinfo/dvipng>.
+
+ Offers to support further development will be appreciated. For
+developer access, ask on <dvipng@nongnu.org>.
+
+ For details on the TeX path-searching library, and 'mktexpk'
+problems, *note (kpathsea)Common problems::.
+
+
+File: dvipng.info, Node: Debug options, Prev: Contact information, Up: Diagnosing problems
+
+7.2 Debug options
+=================
+
+The '-d' flag to dvipng helps in tracking down certain errors. The
+parameter to this flag is an integer that tells what errors are
+currently being tracked. To track a certain class of debug messages,
+simply provide the appropriate number given below; if you wish to track
+multiple classes, sum the numbers of the classes you wish to track. To
+track all classes, you can use '-1'.
+
+ Some of these debugging options are actually provided by Kpathsea
+(*note (kpathsea)Debugging::).
+
+ The classes are:
+1
+ Normal dvi op-codes
+2
+ Virtual fonts
+4
+ PK fonts
+8
+ TFM files
+16
+ Glyph rendering
+32
+ FreeType calls
+64
+ Encoding loads
+128
+ Color specials
+256
+ GhostScript specials
+512
+ Kpathsea 'stat' calls
+1024
+ Kpathsea hash table lookups
+2048
+ Kpathsea path element expansion
+4096
+ Kpathsea path searches
+
+
+File: dvipng.info, Node: Credits, Next: Copying, Prev: Diagnosing problems, Up: Top
+
+8 Credits
+*********
+
+A number of persons have contributed, if I forget to mention someone, I
+apologize. First and foremost we have David Kastrup whose preview-latex
+project provided the incentive to write this program. There is also a
+number of people who have contributed by reporting bugs and suggesting
+improvements as the thing has evolved. These include but is perhaps not
+limited to (in semi-random order): Thomas Esser (teTeX), Christian
+Schenk (MIKTeX), Brian R Furry (debian package), Angus Leeming (LyX),
+Thomas Boutell (libgd), John Jones (first user report), Uwe Kern
+(xcolor), Karl Berry and Peter Breitenlohner (TeX Live), David Harvey
+(hinting in Freetype), Neal Harmon, Alan Shutko, Reiner Stieb, Nick
+Alcock, Adam Buchbinder, Svend Tollak Munkejord, James Longstreet,
+Bernhard Simon, Bob McElrath, Georg Schwarz, Jason Farmer, Brian V.
+Smith, Samuel Hathaway, Thomas R. Shemanske, Stephen Gibson, Christian
+Ridderstro"m, Ezra Peisach, William H Wheeler, Thomas Klausner, Harald
+Koenig, Adrian Bunk, Kevin Smith, Jason Riedy, Wolfram Krause, Reinhard
+Kotucha, Takeshi Abe, Waldeck Schutzer, Ahzo, and Andy Nguyen.
+
+
+File: dvipng.info, Node: Copying, Next: Index, Prev: Credits, Up: Top
+
+9 Copying
+*********
+
+This program is free software: you can redistribute it and/or modify it
+under the terms of the GNU Lesser General Public License as published by
+the Free Software Foundation, either version 3 of the License, or (at
+your option) any later version.
+
+ This program is distributed in the hope that it will be useful, but
+WITHOUT ANY WARRANTY; without even the implied warranty of
+MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU Lesser
+General Public License for more details.
+
+ You should have received a copy of the GNU Lesser General Public
+License along with this program. If not, see
+<http://www.gnu.org/licenses/>.
+
+
+
+Copyright (C) 2002-2015, 2019 Jan-AAke Larsson
+
+
+File: dvipng.info, Node: Index, Prev: Copying, Up: Top
+
+Index
+*****
+
+
+* Menu:
+
+* -dSAFER: Option details. (line 167)
+* absolute page number, and '-l': Option details. (line 141)
+* absolute page number, and '-p': Option details. (line 194)
+* antialiasing levels, number of: Option details. (line 247)
+* background color (option): Option details. (line 40)
+* base resolution, setting: Option details. (line 33)
+* baseline reporting: Option details. (line 76)
+* baseline reporting <1>: Option details. (line 133)
+* color specifications: Color specifications.
+ (line 6)
+* command-line options: Command-line options.
+ (line 6)
+* compilation: Installation. (line 6)
+* compression: Option details. (line 299)
+* configuration, of dvipng: Installation. (line 6)
+* dark fonts: Option details. (line 120)
+* debugging: Option details. (line 54)
+* debugging <1>: Diagnosing problems. (line 6)
+* depth reporting: Option details. (line 76)
+* exit on erroneous images: Option details. (line 258)
+* first page printed: Option details. (line 194)
+* follow mode: Option details. (line 97)
+* font generation, avoiding: Option details. (line 159)
+* forcing palette output: Option details. (line 203)
+* foreground color (option): Option details. (line 91)
+* FreeType font rendering: Option details. (line 105)
+* fuzzy images: Option details. (line 120)
+* gamma: Option details. (line 120)
+* GhostScript and -dSAFER: Option details. (line 167)
+* GhostScript, turning off: Option details. (line 163)
+* GIF image format: Option details. (line 126)
+* height reporting: Option details. (line 133)
+* installation, of dvipng: Installation. (line 6)
+* invoking dvipng: Basic usage. (line 6)
+* last page printed: Option details. (line 141)
+* light fonts: Option details. (line 120)
+* magnification, overriding DVI: Option details. (line 289)
+* Metafont mode, specifying: Option details. (line 150)
+* mktexpk, avoiding: Option details. (line 159)
+* mode name, specifying: Option details. (line 150)
+* no erroneous images: Option details. (line 212)
+* offset pages: Option details. (line 188)
+* option, details of: Option details. (line 6)
+* options, dvipng: Command-line options.
+ (line 6)
+* options, reading from standard input: Option details. (line 11)
+* options, summary: Option summary. (line 6)
+* output resolution, setting: Option details. (line 60)
+* output, redirecting: Option details. (line 181)
+* page range: Option details. (line 225)
+* page, first printed: Option details. (line 194)
+* page, last printed: Option details. (line 141)
+* physical page number, and '-l': Option details. (line 141)
+* physical page number, and '-p': Option details. (line 194)
+* PNG image format: Option details. (line 221)
+* PostScript inclusion problems: Encapsulated PostScript.
+ (line 21)
+* PostScript, turning off raw PostScript specials: Option details.
+ (line 175)
+* problems: Diagnosing problems. (line 6)
+* quality: Option details. (line 247)
+* quiet operation: Option details. (line 243)
+* reverse pagination: Option details. (line 254)
+* silent operation: Option details. (line 243)
+* standard input, reading options from: Option details. (line 11)
+* standard output, output to: Option details. (line 181)
+* transparent border fallback color: Option details. (line 23)
+* transparent border width: Option details. (line 23)
+* trouble: Diagnosing problems. (line 6)
+* truecolor output: Option details. (line 275)
+* warnings, suppressing: Option details. (line 243)
+* width reporting: Option details. (line 286)
+
+
+
+Tag Table:
+Node: Top296
+Node: Introduction1191
+Node: Installation3436
+Node: Prerequisites3783
+Node: Configure5822
+Node: Build/install7869
+Node: Installation outside the texmf tree8337
+Node: Advice for non-privileged users9047
+Node: Basic usage10058
+Node: Command-line options11202
+Node: Option summary11625
+Node: Option details13993
+Node: Graphics29167
+Node: Encapsulated PostScript29922
+Node: Bitmapped graphics31272
+Node: Raw PostScript32500
+Node: Color34753
+Node: Color specifications35142
+Node: Color specials36245
+Node: Diagnosing problems37662
+Node: Contact information38146
+Node: Debug options38874
+Node: Credits39863
+Node: Copying41088
+Node: Index41875
+
+End Tag Table
diff --git a/Build/source/texk/dvipng/doc/dvipng.texi b/Build/source/texk/dvipng/doc/dvipng.texi
new file mode 100644
index 00000000000..2b8e157bdc2
--- /dev/null
+++ b/Build/source/texk/dvipng/doc/dvipng.texi
@@ -0,0 +1,984 @@
+\input texinfo
+@setfilename dvipng.info
+@settitle A DVI-to-PNG translator
+@ifset man
+@c man begin SYNOPSIS
+dvipng [options] filename
+
+dvipng [options] [filename] -
+@c man end
+@end ifset
+
+@set version 1.17
+@set month-year January 2020
+
+@c Put everything in one index (arbitrarily chosen to be the concept index).
+@syncodeindex fn cp
+@syncodeindex ky cp
+@syncodeindex pg cp
+@syncodeindex vr cp
+
+@include macros.texi
+@iftex
+@tolerance 10000 @emergencystretch 3em
+@end iftex
+
+@dircategory TeX
+@direntry
+* DVI-to-PNG: (dvipng). Translating TeX DVI files to Portable Network Graphics (PNG).
+* dvipng: (dvipng). A DVI-to-PNG translator.
+@end direntry
+
+@finalout
+@titlepage
+@title dvipng
+@subtitle A DVI-to-PNG Translator
+@subtitle Version @value{version}
+
+
+@author by Jan-@AA{}ke Larsson.
+@page
+@vskip 0pt plus 1filll
+Copyright @copyright{} 2002-2020 Jan-@AA{}ke Larsson
+
+Permission is granted to make and distribute verbatim copies of
+this manual provided the copyright notice and this permission notice
+are preserved on all copies.
+
+@ignore
+Permission is granted to process this file through TeX and print the
+results, provided the printed document carries copying permission
+notice identical to this one except for the removal of this paragraph
+(this paragraph not being relevant to the printed manual).
+@end ignore
+
+Permission is granted to copy and distribute modified versions of this
+manual under the conditions for verbatim copying, provided also that the
+section entitled ``Copying'' is included exactly as in the original, and
+provided that the entire resulting derived work is distributed under the
+terms of a permission notice identical to this one.
+
+Permission is granted to copy and distribute translations of this manual
+into another language, under the above conditions for modified versions,
+except that this permission notice may be stated in a translation
+approved by the Free Software Foundation.
+@end titlepage
+@page
+
+@c @summarycontents
+@contents
+
+@ifnottex
+@node Top
+@top dvipng
+
+This manual documents dvipng, a program to translate a DVI (DeVice
+Independent) file into PNG (Portable Network Graphics).
+
+This file documents dvipng version @value{version}
+
+Corrections or perhaps rewrites of sections are @emph{very welcome}.
+
+Jan-@AA{}ke Larsson
+
+@end ifnottex
+
+@menu
+* Introduction:: Introduction
+* Installation:: How to compile and install dvipng
+* Basic usage:: First things first
+* Command-line options:: Advanced usage
+* Graphics:: Including PostScript and/or bitmaps
+* Color:: Using color with dvipng
+* Diagnosing problems:: Problems?
+* Credits:: People who have contributed
+* Copying:: GNU Lesser General Public License
+* Index:: General index
+@end menu
+
+
+
+@node Introduction
+@chapter Introduction
+
+@c man begin DESCRIPTION
+@include readme.texi
+@c man end
+
+@node Installation
+@chapter Installation
+
+@cindex configuration, of dvipng
+@cindex compilation
+@cindex installation, of dvipng
+
+@include install.texi
+
+@node Basic usage
+@chapter Basic usage of dvipng
+
+@cindex invoking dvipng
+
+To use dvipng at its simplest, simply type
+
+@example
+dvipng foo
+@end example
+
+@noindent
+where @file{foo.dvi} is the output of @TeX{} that you want to convert to
+PNG format. If there are four pages in @file{foo.dvi}, those pages will
+be output as @file{foo1.png}, @file{foo2.png}, @file{foo3.png}, and
+@file{foo4.png}, respectively.
+
+If you have enabled the PostScript font support (via FreeType),
+fonts will be rendered as they are needed. Otherwise, dvipng will use
+bitmapped (PK) fonts, and if you use PK fonts that have not been used on
+your system before, they may be automatically generated; this process
+can take a few minutes, so progress reports appear by default. The next
+time the same font is used, it will have been saved on disk, so
+rendering will go much faster. (If dvipng tries to endlessly generate
+the same fonts over and over again, something is wrong. @xref{Unable to
+generate fonts,,, kpathsea, Kpathsea}.)
+
+Many options are available (see the next section). For a brief summary
+of available options, just type
+
+@example
+dvipng --help
+@end example
+
+@node Command-line options
+@chapter Command-line options
+
+@cindex command-line options
+@cindex options, dvipng
+
+dvipng has a plethora of command line options. Reading through this
+section will give a good idea of the capabilities of the driver.
+
+@menu
+* Option summary:: Quick listing, from dvipng --help.
+* Option details:: More information about each option.
+@end menu
+
+
+@node Option summary
+@section Option summary
+
+@cindex options, summary
+Here is a handy summary of the options; it is printed out when you run
+dvipng with no arguments or with the standard @samp{--help} option.
+
+@example
+@include dvipng.help
+@end example
+
+
+@node Option details
+@section Option details
+
+@cindex option, details of
+@c man begin OPTIONS
+
+Many of the parameterless options listed here can be turned off by
+suffixing the option with a zero (@samp{0}); for instance, to turn off
+page reversal, use @samp{-r0}. Such options are marked with a trailing
+@samp{*}.
+
+@table @samp
+@item -
+@cindex options, reading from standard input
+@cindex standard input, reading options from
+Read additional options from standard input after processing the command
+line.
+
+@item --help
+Print a usage message and exit.
+
+@item --version
+Print the version number and exit.
+
+@item -bd @var{num}
+@item -bd @var{color_spec}
+@item -bd '@var{num} @var{color_spec}'
+@cindex transparent border width
+@cindex transparent border fallback color
+Set the pixel width of the transparent border (default 0). Using this
+option will make the image edges transparent, but it only affects pixels
+with the background color. Giving a @var{color_spec} will set the
+fallback color, to be used in viewers that cannot handle transparency
+(the default is the background color). The color spec should be in
+@TeX{} color \special syntax, e.g., 'rgb 1.0 0.0 0.0'. Setting the
+fallback color makes the default border width 1 px. @xref{Color}.
+
+@item --bdpi @var{num}
+@cindex base resolution, setting
+This option only has an effect when using bitmapped (PK) fonts. The
+option sets the base (Metafont) resolution, both horizontal and
+vertical, to @var{num} dpi (dots per inch). This option is necessary
+when manually selecting Metafont mode with the --mode option (see
+below).
+
+@item -bg @var{color_spec}
+@cindex background color (option)
+Choose background color for the images. This option will be ignored if
+there is a background color \special in the DVI. The color spec should
+be in @TeX{} color \special syntax, e.g., 'rgb 1.0 0.0 0.0'. You can
+also specify 'Transparent' or 'transparent' which will give you a
+transparent background with the normal background as a fallback color. A
+capitalized 'Transparent' will give a full-alpha transparency, while an
+all-lowercase 'transparent' will give a simple fully transparent
+background with non-transparent antialiased pixels. The latter would be
+suitable for viewers who cannot cope with a true alpha channel. GIF
+images do not support full alpha transparency, so in case of GIF output,
+both variants will use the latter behaviour. @xref{Color}.
+
+@item -d @var{num}
+@cindex debugging
+Set the debug flags, showing what dvipng (thinks it) is doing. This will
+work unless dvipng has been compiled without the @code{DEBUG} option
+(not recommended). Set the flags as you need them, use @samp{-d -1} as
+the first option for maximum output. @xref{Debug options}.
+
+@item -D @var{num}
+@cindex output resolution, setting
+Set the output resolution, both horizontal and vertical, to @var{num}
+dpi (dots per inch).
+
+One may want to adjust this to fit a certain text font size (e.g., on
+a web page), and for a text font height of @var{font_px} pixels (in
+Mozilla) the correct formula is
+@example
+@var{dpi} = @var{font_px} * 72.27 / 10 [px * @TeX{}pt/in / @TeX{}pt]
+@end example
+The last division by ten is due to the standard font height 10pt in
+your document, if you use 12pt, divide by 12. Unfortunately, some
+proprietary browsers have font height in pt (points), not pixels. You
+have to rescale that to pixels, using the screen resolution (default
+is usually 96 dpi) which means the formula is
+@example
+@var{font_px} = @var{font_pt} * 96 / 72 [pt * px/in / (pt/in)]
+@end example
+On some high-res screens, the value is instead 120 dpi. Good luck!
+
+@item --depth*
+@cindex baseline reporting
+@cindex depth reporting
+Report the depth of the image. This only works reliably when the
+@LaTeX{} style @file{preview.sty} from @previewlatex{} is used with
+the @samp{active} option. It reports the number of pixels from the
+bottom of the image to the baseline of the image. This can be used for
+vertical positioning of the image in, e.g., web documents, where one
+would use (Cascading StyleSheets 1)
+@example
+<IMG SRC="@var{filename.png}" STYLE="vertical-align: -@var{depth}px">
+@end example
+The depth is a negative offset in this case, so the minus sign is
+necessary, and the unit is pixels (px).
+
+@item --dvinum*
+Set this option to make the output page number be the @TeX{} page
+numbers rather than the physical page number. See the @samp{-o} switch.
+
+@ignore
+@item -e @var{num}
+@cindex maxdrift
+@cindex accuracy in positioning
+@cindex positioning accuracy
+Maximum drift in pixels of each character from its `true'
+resolution-independent position on the page. The default value of this
+parameter is resolution dependent (it is the number of entries in the
+list [100, 200, 300, 400, 500, 600, 800, 1000, 1200, 1600, 2000, 2400,
+2800, 3200, @dots{}] that are less than or equal to the resolution in
+dots per inch). Allowing individual characters to `drift' from their
+correctly rounded positions by a few pixels, while regaining the true
+position at the beginning of each new word, improves the spacing of
+letters in words.
+
+@item -f*
+@cindex filter, running as a
+@cindex standard I/O
+@cindex pipes, not readable
+@vindex PRINTER@r{, avoided with @samp{-f}}
+Run as a filter. Read the DVI file from standard input and write the
+PostScript to standard output. The standard input must be seekable, so
+it cannot be a pipe. If your input must be a pipe, write a shell script
+that copies the pipe output to a temporary file and then points dvipng at
+this file. This option also disables the automatic reading of the
+@code{PRINTER} environment variable; use @samp{-P$PRINTER} after the
+@samp{-f} to read it anyway. It also turns off the automatic sending of
+control-D if it was turned on with the @samp{-F} option or in the
+configuration file; use @samp{-F} after the @samp{-f} to send it anyway.
+
+@item -k*
+@cindex cropmarks
+Print crop marks. This option increases the paper size (which should be
+specified, either with a paper size special or with the @samp{-T}
+option) by a half inch in each dimension. It translates each page by a
+quarter inch and draws cross-style crop marks. It is mostly useful with
+typesetters that can set the page size automatically. This works by
+downloading @file{crop.pro}.
+@end ignore
+
+@item -fg @var{color_spec}
+@cindex foreground color (option)
+Choose foreground color for the images. This option will be ignored if
+there is a foreground color \special in the DVI. The color spec should
+be in @TeX{} color \special syntax, e.g., 'rgb 1.0 0.0 0.0'.
+@xref{Color}.
+
+@item --follow*
+@cindex follow mode
+Wait for data at end-of-file. One of the benefits of dvipng is that it
+does not read the postamble, so it can be started before @TeX{}
+finishes. This switch makes dvipng wait at end-of-file for further
+output, unless it finds the POST marker that indicates the end of the
+DVI. This is similar to @samp{tail -f} but for DVI-to-PNG conversion.
+
+@item --freetype*
+@cindex FreeType font rendering
+Enable/disable FreeType font rendering (default on). This option is
+available if the FreeType2 font library was present at compilation time.
+If this is the case, dvipng will have direct support for PostScript
+Type1 and TrueType fonts internally, rather than using @samp{gsftopk}
+for rendering the fonts. If you have PostScript versions of Computer
+Modern installed, there will be no need to generate bitmapped (PK)
+variants on disk of these. Then, you can render images at different (and
+unusual) resolutions without cluttering the disk with lots of bitmapped
+fonts.
+One reason to disable FreeType font rendering would be to generate
+identical output on different platforms, since FreeType uses the native
+renderer and therefore can give slightly different output on each platform.
+
+@item --gamma @var{num}
+@cindex gamma
+@cindex dark fonts
+@cindex light fonts
+@cindex fuzzy images
+Control the interpolation of colors in the greyscale anti-aliasing
+color palette. Default value is 1.0. For 0 < @var{num} < 1, the
+fonts will be lighter (more like the background), and for @var{num} >
+1, the fonts will be darker (more like the foreground).
+
+@item --gif*
+@cindex GIF image format
+The images are output in the GIF format, if GIF support is enabled.
+This is the default for the @samp{dvigif} binary, which only will be
+available when GIF support is enabled. GIF images are palette images
+(see the @samp{--palette} option) and does not support true alpha
+channels (see the @samp{--bg} option). See also the @samp{--png}
+option.
+
+@item --height*
+@cindex baseline reporting
+@cindex height reporting
+Report the height of the image. This only works reliably when the
+@LaTeX{} style @file{preview.sty} from @previewlatex{} is used with
+the @samp{active} option. It reports the number of pixels from the top
+of the image to the baseline of the image. The total height of the
+image is obtained as the sum of the values reported from
+@samp{--height} and @samp{--depth}.
+
+@item -l [=]@var{num}
+@cindex last page printed
+@cindex page, last printed
+@cindex physical page number, and @samp{-l}
+@cindex absolute page number, and @samp{-l}
+The last page printed will be the first one numbered @var{num}. Default
+is the last page in the document. If @var{num} is prefixed by an equals
+sign, then it (and the argument to the @samp{-p} option, if specified)
+is treated as a physical (absolute) page number, rather than a value to
+compare with the @TeX{} @samp{\count0} values stored in the DVI file.
+Thus, using @samp{-l =9} will end with the ninth page of the document,
+no matter what the pages are actually numbered.
+
+@item --mode @var{mode}
+@cindex mode name, specifying
+@cindex Metafont mode, specifying
+This option only has an effect when using bitmapped (PK) fonts. Use
+@var{mode} as the Metafont device name for the PK fonts (both for path
+searching and font generation). This needs to be augmented with the base
+device resolution, given with the @samp{--bdpi} option. See the file
+@url{ftp://ftp.tug.org/tex/modes.mf} for a list of resolutions and mode
+names for most devices. @xref{Unable to generate fonts,,, kpathsea,
+Kpathsea}.
+
+@item -M*
+@cindex font generation, avoiding
+@pindex mktexpk@r{, avoiding}
+@c this description repeated in kpathsea.texi
+This option only has an effect when using bitmapped (PK) fonts. It turns
+off automatic PK font generation (@file{mktexpk}).
+@ignore
+@flindex missfont.log
+If @code{mktexpk}, the invocation is appended to a file
+@file{missfont.log} (by default) in the current directory. You can then
+execute the log file to create the missing files after fixing the
+problem.
+@vindex TEXMFOUTPUT
+@vindex MISSFONT_LOG
+If the current directory is not writable and the environment variable or
+configuration file value @samp{TEXMFOUTPUT} is set, its value is used.
+Otherwise, nothing is written. The name @samp{missfont.log} is
+overridden by the @samp{MISSFONT_LOG} environment variable or
+configuration file value.
+@end ignore
+
+@item --nogs*
+@cindex GhostScript, turning off
+This switch prohibits the internal call to GhostScript for displaying
+PostScript specials. @samp{--nogs0} turns the call back on.
+
+@item --nogssafer*
+@cindex GhostScript and -dSAFER
+@cindex -dSAFER
+Normally, if GhostScript is used to render PostScript specials, the
+GhostScript interpreter is run with the option @samp{-dSAFER}. The
+@samp{--nogssafer} option runs GhostScript without @samp{-dSAFER}. The
+@samp{-dSAFER} option in Ghostscript disables PostScript operators such
+as deletefile, to prevent possibly malicious PostScript programs from
+having any effect.
+
+@item --norawps*
+@cindex PostScript, turning off raw PostScript specials
+Some packages generate raw PostScript specials, even non-rendering such
+specials. This switch turns off the internal call to GhostScript
+intended to display these raw PostScript specials. @samp{--norawps0}
+turns the call back on.
+
+@item -o @var{name}
+@cindex output, redirecting
+@cindex standard output, output to
+Send output to the file @var{name}. A single occurrence of @samp{%d} or
+@samp{%01d}, @dots{}, @samp{%09d} will be exchanged for the physical
+page number (this can be changed, see the @samp{--dvinum} switch). The
+default output filename is @samp{@var{file}%d.png} where the input DVI
+file was @samp{@var{file}.dvi}.
+
+@item -O @var{x-offset},@var{y-offset}
+@cindex offset pages
+Move the origin by @var{x-offset},@var{y-offset}, a comma-separated
+pair of dimensions such as @samp{.1in,-.3cm}.
+@c (@pxref{papersize special}).
+The origin of the page is shifted from the default position
+(of one inch down, one inch to the right from the upper left corner of
+the paper) by this amount.
+
+@item -p [=]@var{num}
+@cindex first page printed
+@cindex page, first printed
+@cindex physical page number, and @samp{-p}
+@cindex absolute page number, and @samp{-p}
+The first page printed will be the first one numbered @var{num}. Default
+is the first page in the document. If @var{num} is prefixed by an
+equals sign, then it (and the argument to the @samp{-l} option, if
+specified) is treated as a physical (absolute) page number, rather than
+a value to compare with the @TeX{} @samp{\count0} values stored in the
+DVI file. Thus, using @samp{-p =3} will start with the third page of
+the document, no matter what the pages are actually numbered.
+
+@item --palette*
+@cindex forcing palette output
+When an external image is included, @samp{dvipng} will automatically
+switch to truecolor mode, to avoid unnecessary delay and quality
+reduction, and enable the EPS translator to draw on a transparent
+background and outside of the boundingbox. This switch will force
+palette (256-color) output and make @samp{dvipng} revert to opaque
+clipped image inclusion. This will also override the @samp{--truecolor}
+switch if present.
+
+@item --picky*
+@cindex no erroneous images
+No images are output when a warning occurs. Normally, dvipng will
+output an image in spite of a warning, but there may be something
+missing in this image. One reason to use this option would be if you
+have a more complete but slower fallback converter. Mainly, this is
+useful for failed figure inclusion and unknown \special occurrences,
+but warnings will also occur for missing or unknown color specs and
+missing PK fonts.
+
+@item --png*
+@cindex PNG image format
+The images are output in the PNG format. This is the default for the
+@samp{dvipng} binary. See also the @samp{--gif} option.
+
+@item -pp @var{firstpage}-@var{lastpage}
+@cindex page range
+Print pages @var{firstpage} through @var{lastpage}; but not quite
+equivalent to @samp{-p @var{firstpage} -l @var{lastpage}}. For example,
+when rendering a book, there may be several instances of a page in the
+DVI file (one in @code{\frontmatter}, one in @code{\mainmatter}, and one
+in @code{\backmatter}). In case of several pages matching, @samp{-pp
+@var{firstpage}-@var{lastpage}} will render @emph{all} pages that
+matches the specified range, while @samp{-p @var{firstpage} -l
+@var{lastpage}} will render the pages from the @emph{first} occurrence
+of @var{firstpage} to the @emph{first} occurrence of @var{lastpage}.
+This is the (undocumented) behaviour of dvips. In dvipng you can give
+both kinds of options, in which case you get all pages that matches the
+range in @samp{-pp} between the pages from @samp{-p} to @samp{-l}. Also
+multiple @samp{-pp} options accumulate, unlike @samp{-p} and @samp{-l}.
+The @samp{-} separator can also be @samp{:}. Note that @samp{-pp -1}
+will be interpreted as "all pages up to and including 1", if you want a
+page numbered -1 (only the table of contents, say) put @samp{-pp -1--1},
+or more readable, @samp{-pp -1:-1}.
+
+@item -q*
+@cindex quiet operation
+@cindex silent operation
+@cindex warnings, suppressing
+Run quietly. Don't chatter about pages converted, etc.@: to standard
+output; report no warnings (only errors) to standard error.
+
+@item -Q @var{num}
+@cindex antialiasing levels@r{, number of}
+@cindex quality
+Set the quality to @var{num}. That is, choose the number of antialiasing
+levels for bitmapped fonts (PK), to be
+@var{num}*@var{num}+1. The default value is 4 which gives 17 levels of
+antialiasing for antialiased fonts from these two. If FreeType is
+available, its rendering is unaffected by this option.
+
+@item -r*
+@cindex reverse pagination
+Toggle output of pages in reverse/forward order. By default, the first
+page in the DVI is output first.
+
+@ignore
+@item -R
+@cindex security
+@cindex shell command execution, disabling
+@cindex absolute filenames, disabling
+@cindex pipes, disabling output to
+Run securely. This disables shell command execution in @code{\special}
+(via @samp{`}, @pxref{Dynamic creation of graphics}) and config files
+(via the @samp{E} option, @pxref{Configuration file commands}), pipes as
+output files, and opening of any absolute filenames.
+
+@item -t @var{papertype}
+@cindex paper type
+@cindex media
+@cindex letter papertype
+@cindex legal papertype
+@cindex ledger papertype
+@cindex a4 papertype
+@cindex a3 papertype
+@cindex landscape papertype
+Set the paper type to @var{papertype}.
+@c usually defined in one of the
+@c configuration files, along with the appropriate PostScript code to
+@c select it (@pxref{Config file paper sizes}).
+You can also specify a @var{papertype} of @samp{landscape}, which
+rotates a document by 90 degrees. To rotate a document whose paper type
+is not the default, you can use the @samp{-t} option twice, once for the
+paper type, and once for @samp{landscape}.
+@end ignore
+
+@item --strict*
+@cindex exit on erroneous images
+The program exits when a warning occurs. Normally, dvipng will output
+an image in spite of a warning, but there may be something missing in
+this image. One reason to use this option would be if you have a more
+complete but slower fallback converter. See the @samp{--picky} option
+above for a list of when warnings occur.
+
+@item -T @var{image_size}
+Set the image size to @var{image_size} which can be either of
+@samp{bbox}, @samp{tight}, or a comma-separated pair of dimensions
+@var{hsize},@var{vsize} such as @samp{.1in,.3cm}. The default is
+@samp{bbox} which produces a PNG that includes all ink put on the page
+and in addition the DVI origin, located 1in from the top and 1in from
+the left edge of the paper. This usually gives whitespace above and to
+the left in the produced image. The value @samp{tight} will make dvipng
+only include all ink put on the page, producing neat images.
+@c (@pxref{papersize special}).
+@c This option overrides any papersize special in the DVI file.
+
+@item --truecolor*
+@cindex truecolor output
+This will make @samp{dvipng} generate truecolor output. Note that
+truecolor output is automatic if you include an external image in your
+DVI, e.g., via a PostScript special (i.e., the @samp{graphics} or
+@samp{graphicx} package). This switch is overridden by the
+@samp{--palette} switch.
+
+@item -v*
+Enable verbose operation. This will currently indicate what fonts is
+used, in addition to the usual output.
+
+@item --width*
+@cindex width reporting
+Report the width of the image. See also @samp{--height} and
+@samp{--depth}.
+
+@item -x @var{num}
+@cindex magnification, overriding DVI
+This option is deprecated; it should not be used. It is much better to
+select the output resolution directly with the @samp{-D} option. This
+option sets the magnification ratio to @math{@var{num}/1000} and
+overrides the magnification specified in the DVI file. Must be between
+10 and 100000. It is recommended that you use standard magstep values
+(1095, 1200, 1440, 1728, 2074, 2488, 2986, and so on) to help reduce the
+total number of PK files generated. @var{num} may be a real number, not
+an integer, for increased precision.
+
+@item -z @var{num}
+@cindex compression
+Set the PNG compression level to @var{num}. This option is enabled if
+your @samp{libgd} is new enough. The default compression level is 1,
+which selects maximum speed at the price of slightly larger PNGs. For an
+older @samp{libgd}, the hard-soldered value 5 is used. The include file
+@samp{png.h} says
+@ifclear man
+@quotation
+Currently, valid values range from 0 - 9, corresponding directly to the
+zlib compression levels 0 - 9 (0 - no compression, 9 - "maximal"
+compression). Note that tests have shown that zlib compression levels
+3-6 usually perform as well as level 9 for PNG images, and do
+considerably fewer calculations. In the future, these values may not
+correspond directly to the zlib compression levels.
+@end quotation
+@end ifclear
+@ifset man
+``Currently, valid values range from 0 - 9, corresponding directly to
+the zlib compression levels 0 - 9 (0 - no compression, 9 - "maximal"
+compression). Note that tests have shown that zlib compression levels
+3-6 usually perform as well as level 9 for PNG images, and do
+considerably fewer calculations. In the future, these values may not
+correspond directly to the zlib compression levels.''
+@end ifset
+@end table
+@c man end
+
+@node Graphics
+@chapter Graphics
+
+@samp{dvipng} attempts to handle graphics as included by the
+@samp{graphicx} and @samp{graphics} packages, without the need of
+specifying a driver to these packages. This means that it recognizes
+the encapsulated postscript inclusion meant for @samp{dvips}, but is
+also able (from version 1.8) to include bitmapped graphics. It also
+tries to handle some of the raw PostScript that is output from various
+packages. Some of the possibilities and problems are mentioned below.
+
+@menu
+* Encapsulated PostScript:: An internal call to GhostScript
+* Bitmapped graphics:: PNG, JPEG and GIF
+* Raw PostScript:: Ignore or give to GhostScript
+@end menu
+
+@node Encapsulated PostScript
+@section Encapsulated PostScript
+
+When an EPS file is included, a call to GhostScript is performed to
+produce a bitmapped image that can be included. The default is to
+produce an image with transparent background, at the same size as the
+DVI page currently being converted to PNG, and include that as
+foreground on the PNG. Of course, if the image is to be cropped, that
+is done. The included image will be a truecolor image, so for maximum
+performance the output PNG will be in truecolor mode as well.
+
+This conversion needs the @samp{pngalpha} output device to be present
+in your copy of GhostScript. If that device is not present, or you use
+the @samp{--palette} switch or request GIF output, the fallback is to
+use the @samp{png16m} device to produce a cropped opaque image for
+inclusion. Other relevant switches are @samp{--noghostscript} and
+@samp{--nogssafer}. @xref{Option details}.
+
+@cindex PostScript inclusion problems
+The most common problem with including graphics is an incorrect
+bounding box. Complain to whoever wrote the software that generated
+the file if the bounding box is indeed incorrect. An adjusted
+boundingbox can be specified in the @samp{\includegraphics} call, as
+in this example (using @samp{graphicx}):
+
+@example
+\includegraphics[bb=10 20 100 200]@{imagename.eps@}
+@end example
+
+
+@node Bitmapped graphics
+@section Bitmapped graphics
+
+dvipng can include PNG, JPEG and GIF graphics. When including such
+images via @samp{\includegraphics} you need to specify the bounding
+box since @TeX{} itself cannot read them from the files in question.
+The bounding box size should be given as @samp{0 0 w h} in pixels,
+e.g., if the file @samp{imagename.png} is 300x400 pixels, the
+inclusion would read
+
+@example
+\includegraphics[bb=0 0 300 400]@{imagename.png@}
+@end example
+
+The default size is the image size in bp (``big points'' in TeX
+nomenclature or PostScript points as other people have it, 72 per inch).
+That is, default resolution will be 72 dpi for included bitmaps, which
+is the default size in the few other bitmap-capable drivers that are
+known to me (dvipdfm and PDFLaTeX).
+
+If you want 100 dpi you need to specify the width accordingly. You
+just divide your image width by 100: a 135 pixel wide image at 100 dpi
+will take up 1.35 inches. If you want 200 dpi you divide by 200, and
+so on. Simple, eh? The example above at 200 dpi would be 1.5 inches
+wide:
+
+@example
+\includegraphics[bb=0 0 300 400,witdh=1.5in]@{imagename.png@}
+@end example
+
+@node Raw PostScript
+@section Raw PostScript
+
+dvipng attempts to handle raw PostScript. Rendering raw PostScript
+specials is done on top of the page by including a transparent image
+generated by the @samp{pngalpha} device in GhostScript (automatically
+selecting @samp{truecolor} mode in dvipng).
+
+Included PostScript headers are respected, and if the header
+@samp{tex.pro} is included, dvipng also throws in @samp{color.pro} and
+@samp{special.pro}. The package @samp{xcolor} includes its own headers
+with color names, and this is not only kept as a PostScript header, but
+is also read and interpreted by dvipng itself. An attempt is also made
+to respect the PGF header. The non-rendering specials from
+@samp{hyperref} are handled via some heuristics and do not give an
+error.
+
+Really rendering and moving things with raw PostScript specials is more
+troublesome. The \rotatebox macro serves as a good example. The dvips
+driver of the graphicx package surrounds DVI glyphs with PostScript code
+so that after conversion by dvips, the glyphs (now themselves in
+PostScript) will be rotated in the desired way. dvipng does not handle
+this, at present. An attempt has been made to handle the rendering
+specials output by PGF (tikz), and also PSTricks. Some things work, but
+others do not. This is especially clear when mixing PostScript and DVI
+rendering commands such as glyphs. dvipng cannot at present detect if
+PostScript code moves @samp{currentpoint} or rotates the frame since
+GhostScript does not return such information. A recommendation would be
+to produce images from these packages as EPS files and include them into
+your document in the standard manner.
+
+Another way to handle this would be to use a slower fallback (with dvips
+and gs, for example). If you want to disable raw PostScript handling in
+dvipng, use the switch @samp{--norawps}. This switch turns off the
+internal call to GhostScript intended to display these raw PostScript
+specials. Further, when dvipng encounters raw PostScript and the gs call
+is turned off, it gives a warning. It is now possible to use the switch
+@samp{--picky} to disable page rendering of pages with warnings, and use
+the slower fallback for these pages.
+
+@node Color
+@chapter Color
+
+To support color, dvipng recognizes a certain set of specials as
+generated by the @samp{color} and @samp{xcolor} style files. These
+specials start with the keyword @samp{color} or the keyword
+@samp{background}, followed by a color specification.
+
+@menu
+* Color specifications::
+* Color specials::
+@end menu
+
+
+@node Color specifications
+@section Color specifications
+
+@cindex color specifications
+
+The color specification supported by dvipng is by-value or by-name. The
+by-value spec starts with the name of a color model (one of @samp{rgb},
+@samp{hsb}, @samp{cmy}, @samp{cmyk}, or @samp{gray}) followed by the
+appropriate number of parameters. Thus, the color specification
+@samp{rgb 0.3 0.4 0.5} would correspond to the color that is @samp{0.3
+0.4 0.5} in its red, blue and green values. The color model used
+internally in dvipng is @samp{RGB} (discretized to 256 levels), for
+details on the formulas used in conversion, see the @samp{xcolor}
+documentation.
+
+By-name color specifications are single (case-dependent) words and are
+compared with color names defined in @samp{dvipsnam.def} (from the
+@samp{graphics} bundle), @samp{svgnam.def} and @samp{xcolor.sty} (from
+the @samp{xcolor} bundle). See the @samp{xcolor} documentation for a
+list of names and the corresponding colors.
+
+On the command-line, the name @samp{Transparent} can also be used as
+an argument to @samp{--bg} to choose transparent background.
+@xref{Option details}.
+
+@node Color specials
+@section Color specials
+
+We will describe @samp{background} first, since it is the simplest. The
+@samp{background} keyword must be followed by a color specification.
+That color specification is used as a fill color for the background. The
+last @samp{background} special on a page is the one that gets used, and
+is used for the whole of the page image. (This is possible because the
+prescan phase of dvipng notices all of the color specials so that the
+appropriate information can be written out during the second phase.)
+
+The @samp{color} special itself has three forms. The first is just
+@samp{color} followed by a color specification. In this case, the
+current global color is set to that color; the color stack must be empty
+when such a command is executed.
+
+The second form is @samp{color push} followed by a color specification.
+This saves the current color on the color stack and sets the color to be
+that given by the color specification. This is the most common way to
+set a color.
+
+The final form of the @samp{color} special is just @samp{color pop},
+with no color specification; this says to pop the color last pushed on
+the color stack from the color stack and set the current color to be
+that color.
+
+dvipng correctly handles these color specials across pages, even when
+the pages are rendered repeatedly or in reverse order.
+
+@node Diagnosing problems
+@chapter Diagnosing problems
+
+@cindex problems
+@cindex trouble
+@cindex debugging
+
+You've gone through all the trouble of installing dvipng, carefully read
+all the instructions in this manual, and still can't get something to
+work. The following sections provide some helpful hints if you find
+yourself in such a situation.
+
+@menu
+* Contact information:: Who to ask.
+* Debug options:: Getting diagnostics.
+@end menu
+
+@node Contact information
+@section Contact information
+
+Bug reports should be sent to
+@email{dvipng@@nongnu.org}.
+
+Questions, suggestions for new features, pleas for help, and/or praise
+should go to @email{dvipng@@nongnu.org}. For more information on this
+mailing list, send a message with just the word `help' as subject or
+body to @email{dvipng-request@@nongnu.org} or look at
+@url{http://lists.nongnu.org/mailman/listinfo/dvipng}.
+
+Offers to support further development will be appreciated. For developer
+access, ask on @email{dvipng@@nongnu.org}.
+
+For details on the @TeX{} path-searching library, and @code{mktexpk}
+problems, @pxref{Common problems,,, kpathsea, Kpathsea}.
+
+
+@node Debug options
+@section Debug options
+
+The @samp{-d} flag to dvipng helps in tracking down certain errors. The
+parameter to this flag is an integer that tells what errors are
+currently being tracked. To track a certain class of debug messages,
+simply provide the appropriate number given below; if you wish to track
+multiple classes, sum the numbers of the classes you wish to track. To
+track all classes, you can use @code{-1}.
+
+Some of these debugging options are actually provided by Kpathsea
+(@pxref{Debugging, , , kpathsea, Kpathsea}).
+
+The classes are:
+@table @asis
+@item 1
+Normal dvi op-codes
+@item 2
+Virtual fonts
+@item 4
+PK fonts
+@item 8
+TFM files
+@item 16
+Glyph rendering
+@item 32
+FreeType calls
+@item 64
+Encoding loads
+@item 128
+Color specials
+@item 256
+GhostScript specials
+@item 512
+Kpathsea @code{stat} calls
+@item 1024
+Kpathsea hash table lookups
+@item 2048
+Kpathsea path element expansion
+@item 4096
+Kpathsea path searches
+@ignore
+@item 8192
+@item 16384
+@end ignore
+
+@end table
+
+@node Credits
+@chapter Credits
+
+A number of persons have contributed, if I forget to mention someone,
+I apologize. First and foremost we have David Kastrup whose
+@previewlatex{} project provided the incentive to write this program.
+There is also a number of people who have contributed by reporting
+bugs and suggesting improvements as the thing has evolved. These
+include but is perhaps not limited to (in semi-random order): Thomas
+Esser (te@TeX{}), Christian Schenk (MIK@TeX{}), Brian R Furry (debian
+package), Angus Leeming (LyX), Thomas Boutell (libgd), John Jones
+(first user report), Uwe Kern (xcolor), Karl Berry and Peter
+Breitenlohner (@TeX{} Live), David Harvey (hinting in Freetype), Neal
+Harmon, Alan Shutko, Reiner Stieb, Nick Alcock, Adam Buchbinder, Svend
+Tollak Munkejord, James Longstreet, Bernhard Simon, Bob McElrath,
+Georg Schwarz, Jason Farmer, Brian V. Smith, Samuel Hathaway, Thomas
+R. Shemanske, Stephen Gibson, Christian Ridderstr@"om, Ezra Peisach,
+William H Wheeler, Thomas Klausner, Harald Koenig, Adrian Bunk, Kevin
+Smith, Jason Riedy, Wolfram Krause, Reinhard Kotucha, Takeshi Abe,
+Waldeck Schutzer, Ahzo, and Andy Nguyen.
+
+@ifset man
+@c man begin NOTES
+The full manual is accessible in info format, on most systems by typing
+@example
+info dvipng
+@end example
+@c man end
+@c man begin COPYRIGHT
+This program is released under the GNU Lesser General Public License
+version 3, see the COPYING file in the dvipng distribution or
+@url{http://www.gnu.org/licenses/gpl.html}.
+
+Copyright @copyright{} 2002-2015, 2019 Jan-@AA{}ke Larsson
+@c man end
+@end ifset
+
+@node Copying
+@chapter Copying
+
+This program is free software: you can redistribute it and/or modify
+it under the terms of the GNU Lesser General Public License as
+published by the Free Software Foundation, either version 3 of the
+License, or (at your option) any later version.
+
+This program is distributed in the hope that it will be useful, but
+WITHOUT ANY WARRANTY; without even the implied warranty of
+MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU
+Lesser General Public License for more details.
+
+You should have received a copy of the GNU Lesser General Public
+License along with this program. If not, see
+<http://www.gnu.org/licenses/>.
+
+@sp 2
+@noindent
+Copyright @copyright{} 2002-2015, 2019 Jan-@AA{}ke Larsson
+
+@node Index
+@unnumbered Index
+
+@printindex cp
+@bye
diff --git a/Build/source/texk/dvipng/doc/install.texi b/Build/source/texk/dvipng/doc/install.texi
new file mode 100644
index 00000000000..61e47e565b9
--- /dev/null
+++ b/Build/source/texk/dvipng/doc/install.texi
@@ -0,0 +1,194 @@
+@c install.texi
+@c
+@c Part of the dvipng distribution
+
+@include macros.texi
+@ifset rawfile
+@chapter Installing dvipng
+
+@end ifset
+@c -----------------------
+Installing dvipng should be simple: merely @code{./configure},
+@code{make}, and @code{make install}.
+
+@ifclear rawfile
+@menu
+* Prerequisites::
+* Configure::
+* Build/install::
+* Installation outside the texmf tree::
+* Advice for non-privileged users::
+@end menu
+@end ifclear
+
+@node Prerequisites
+@section Prerequisites
+
+@itemize @bullet
+@item The GD Graphics Draw library, libgd
+
+The drawing library @samp{libgd} is necessary, and is downloadable at
+@uref{https://bitbucket.org/libgd/gd-libgd/downloads}, and there are
+binary packages for most operating systems from their respective
+distributors. In any case, the library installs using @samp{autoconf} so
+it should not be difficult for you to install it from source, and then
+proceed with installing dvipng.
+
+@item The path-searching library kpathsea
+
+Kpathsea is most likely included in your @LaTeX{} installation, but it
+may happen that ./configure does not find it; see below. If you do not
+have it, download it from @uref{http://www.ctan.org} and compile it.
+I have no experience with this, so I cannot help much here.
+
+@item The font-rendering library FreeType 2
+
+While not strictly necessary, a recent FreeType 2 is recommended since
+dvipng currently will produce better-quality images when this library is
+available. To take advantage of this, you should have at least FreeType
+2.1.9.
+
+FreeType 2 will enable direct support for PostScript and TrueType fonts,
+so that dvipng will not need to generate bitmapped variants on disk of
+the @TeX{} fonts since modern @TeX{} distributions include PostScript
+versions of them. Then, you can render images at different (and unusual)
+resolutions without cluttering the disk with lots of bitmapped fonts.
+
+Finally, it will enable subfont support in dvipng. That is, if you want
+to render CJK-@LaTeX{} characters, you must have FreeType 2 installed.
+
+@item libpng and libz
+
+To be able to compress and write PNG files to disk, dvipng (or really
+libgd) uses libpng which in turn uses libz. These should be available on
+any modern system, if not, download them and install them.
+
+@item The @code{texinfo} package
+
+This is needed for building the documentation.
+@end itemize
+
+@node Configure
+@section Configure
+
+The first step is to configure the source code, telling it where
+various files will be. To do so, run
+
+@example
+./configure @var{options}
+@end example
+
+(Note: if you have fetched dvipng from CVS rather than a regular
+release, you will have to first generate @file{./configure} by running
+@code{autoconf} 2.53 or later.)
+
+On many machines, you will not need to specify any options, but if
+@code{configure} cannot determine something on its own, you'll need to
+help it out. For a list of the options type
+
+@example
+./configure --help
+@end example
+
+On some machines, the libraries will be installed in directories that
+are not in the linker's search path. This will generate an error when
+running @file{./configure}, indicating that it cannot find libgd or
+libkpathsea (most likely). You then need to specify the path to the
+respective library's object files. They are typically called e.g.,
+@file{libgd.a} or @file{libgd.so}. If they are located in e.g.,
+@file{/sw/local/lib}, do
+
+@example
+./configure LDFLAGS=-L/sw/local/lib
+@end example
+
+If the library is available as a shared object file (@file{.so}), the
+runtime linker may also need to be told where to find the library,
+then use
+
+@example
+./configure LDFLAGS='-L/sw/local/lib -R/sw/local/lib'
+@end example
+
+When either of these is necessary, it is likely that the C header
+files are also installed in directories that are not in the C
+preprocessor's search path. This will also generate an error when
+running @file{./configure}, indicating that it cannot find e.g.,
+@file{gd.h} or @file{kpathsea.h} (most likely). You then need to
+specify the path to the respective library's C header files. If they
+are located in e.g., @file{/sw/local/include}, do
+
+@example
+./configure CPPFLAGS=-I/sw/local/include
+@end example
+
+On my SUN Solaris workstation, I had to combine this into
+
+@example
+./configure CPPFLAGS='-I/sw/local/include -I/sw/tex/teTeX/1.0/include'\
+ LDFLAGS='-L/sw/local/lib -R/sw/local/lib -L/sw/tex/teTeX/1.0/lib/'
+@end example
+
+@noindent
+where the backslash denotes a continuation of the line.
+
+@node Build/install
+@section Build/install
+
+Once @file{configure} has been run, simply enter
+
+@example
+make
+@end example
+
+@noindent
+at the prompt to compile the C code, and build the documentation files.
+To install the files into the locations chosen earlier, type
+
+@example
+make install
+@end example
+
+@noindent
+You may need special privileges to install, e.g., if you are installing
+into system directories.
+
+@node Installation outside the texmf tree
+@section Installation outside the texmf tree
+
+In some cases, a dvipng binary installed outside the texmf tree will
+not be able to find virtual fonts, or the PostScript font maps
+(normally used by dvips). This may be because @emph{only}
+$SELFAUTOLOC, $SELFAUTODIR, and $SELFAUTOPARENT are used in the texmf
+tree configuration file @samp{texmf.cnf}. If so, give the switch
+@samp{--enable-selfauto-set} to @samp{./configure}. This will make
+dvipng adjust these three internally so that kpathsea thinks that
+dvipng @emph{is} installed in the texmf tree.
+
+@node Advice for non-privileged users
+@section Installation for non-privileged users
+
+Often people without system administration privileges want to install
+software for their private use. In that case you need to specify more
+options to the @file{configure} script, usually this is done by using
+the @samp{--prefix} option to the @file{configure} script, and let it
+point to the personal home directory. In that way, resulting binaries
+will be installed under the @file{bin} subdirectory of your home
+directory, manual pages under @file{man} and so on. That way, it is
+reasonably easy to maintain a bunch of additional packages, since the
+prefix argument is supported by most @file{configure} scripts.
+
+You'll have to add something like @file{/home/myself/bin} to your
+@code{PATH} shell variable, if it isn't there already, and similarly
+set the @code{INFOPATH} and @code{MANPATH} variables to be able to
+access the documentation.
+
+@ifset rawfile
+@section Copying
+
+This program is released under the GNU Lesser General Public License
+version 3, see the COPYING file in the dvipng distribution or
+@url{http://www.gnu.org/licenses/}.
+
+Copyright @copyright{} 2002-2015, 2019 Jan-@AA{}ke Larsson
+@end ifset
diff --git a/Build/source/texk/dvipng/doc/macros.texi b/Build/source/texk/dvipng/doc/macros.texi
new file mode 100644
index 00000000000..3c90a59eb15
--- /dev/null
+++ b/Build/source/texk/dvipng/doc/macros.texi
@@ -0,0 +1,61 @@
+@ignore
+macros.texi
+
+Part of the dvipng distribution
+
+This program is free software: you can redistribute it and/or modify
+it under the terms of the GNU Lesser General Public License as
+published by the Free Software Foundation, either version 3 of the
+License, or (at your option) any later version.
+
+This program is distributed in the hope that it will be useful, but
+WITHOUT ANY WARRANTY; without even the implied warranty of
+MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU
+Lesser General Public License for more details.
+
+You should have received a copy of the GNU Lesser General Public
+License along with this program. If not, see
+<http://www.gnu.org/licenses/>.
+
+Copyright @copyright{} 2002-2008 Jan-@AA{}ke Larsson
+@end ignore
+
+@ifclear macros
+@set macros
+@macro AUCTeX {}
+AUC@TeX{}
+@end macro
+@ifnottex
+@macro LaTeX {}
+La@TeX{}
+@end macro
+@macro previewlatex {}
+preview-latex
+@end macro
+@ifset no-acronym
+@clear no-acronym
+@macro acronym {text}
+@sc{\text\}
+@end macro
+@end ifset
+@ifset no-env
+@clear no-env
+@macro env {text}
+@code{\text\}
+@end macro
+@end ifset
+@ifset no-option
+@clear no-option
+@macro option {text}
+@samp{\text\}
+@end macro
+@end ifset
+@end ifnottex
+@tex
+\gdef\LaTeX{L\kern-.36em\raise.3ex\hbox{\sc{a}}\kern-.15em\TeX}
+\gdef\previewlatex{Preview-\LaTeX}
+\ifx\acronym\undefined \gdef\acronym#1{{\smallcaps \lowercase{#1}}} \fi
+\ifx\env\undefined \global\let\env=\code \fi
+\ifx\option\undefined \global\let\option=\samp \fi
+@end tex
+@end ifclear
diff --git a/Build/source/texk/dvipng/doc/readme.texi b/Build/source/texk/dvipng/doc/readme.texi
new file mode 100644
index 00000000000..32faa64c02b
--- /dev/null
+++ b/Build/source/texk/dvipng/doc/readme.texi
@@ -0,0 +1,158 @@
+@c readme.texi
+@c
+@c Part of the dvipng distribution
+
+@ifclear man
+@include macros.texi
+@ifset rawfile
+@chapter dvipng
+
+@end ifset
+@end ifclear
+@c -----------------------
+
+This program makes PNG and/or GIF graphics from DVI files as obtained
+from @TeX{} and its relatives.
+
+If GIF support is enabled, GIF output is chosen by using the
+@samp{dvigif} binary or with the @samp{--gif} option.
+
+@ifclear man
+
+It is intended to produce anti-aliased screen-resolution images as fast
+as is possible. The target audience is people who need to generate and
+regenerate many images again and again. The primary target is the
+@previewlatex{} (X)Emacs package, a package to preview formulas from
+within (X)Emacs. Yes, you get to see your formulas in the (X)Emacs
+buffer, see @url{http://www.gnu.org/software/auctex/preview-latex.html}.
+
+Another example is WeBWorK, an internet-based method for delivering
+homework problems to students over the internet, giving students
+instant feedback as to whether or not their answers are correct, see
+@url{http://webwork.math.rochester.edu}.
+
+A more recent addition to the dvipng-using applications out there is
+MediaWiki, the software behind Wikipedia and many other wikis out
+there. Dvipng is used to render mathematical formulae from version
+1.8.0 of MediaWiki, see @url{http://www.mediawiki.org}.
+
+Other applications may also benefit, like web applications as latex2html
+and WYSIWYG editors like LyX.
+
+@ifset rawfile
+@section Benefits of dvipng
+@end ifset
+@end ifclear
+
+The benefits of @samp{dvipng}/@samp{dvigif} include
+
+@itemize @bullet
+@item
+Speed. It is a very fast bitmap-rendering code for DVI files, which
+makes it suitable for generating large amounts of images on-the-fly,
+as needed in @previewlatex{}, WeBWorK and others.
+
+@item
+It does not read the postamble, so it can be started before @TeX{}
+finishes. There is a @samp{--follow} switch that makes dvipng wait at
+end-of-file for further output, unless it finds the POST marker that
+indicates the end of the DVI.
+
+@item
+Interactive query of options. dvipng can read options interactively
+through stdin, and all options are usable. It is even possible to change
+the input file through this interface.
+
+@item
+Supports PK, VF, PostScript Type1, and TrueType fonts, subfonts (i.e.,
+as used in CJK-@LaTeX{}), color specials, and inclusion of PostScript,
+PNG, JPEG or GIF images.
+
+@item
+and more...
+
+@end itemize
+
+@ifset rawfile
+@section Installation
+
+Read @file{INSTALL}, included in the distribution.
+
+@section Usage
+
+To use dvipng at its simplest, simply type
+
+@example
+dvipng foo
+@end example
+
+@noindent
+where @file{foo.dvi} is the output of @TeX{} that you want to convert to
+PNG format. If there are four pages in @file{foo.dvi}, those pages will
+be output as @file{foo1.png}, @file{foo2.png}, @file{foo3.png}, and
+@file{foo4.png}, respectively.
+
+Many options are available (see the info manual). For a brief summary
+of available options, just type
+
+@example
+dvipng --help
+@end example
+
+@section Availability
+
+The dvipng package is available at Savannah, the GNU project site. Since
+dvipng is not part of the GNU project, although released under the GNU
+GPL, the web address is
+@url{http://savannah.nongnu.org/projects/dvipng}. Instructions for
+anonymous CVS access can be found at
+@url{http://savannah.nongnu.org/cvs/?group=dvipng}.
+
+@section Contacts
+
+Bug reports should be sent to @email{dvipng@@nongnu.org}.
+
+Questions, suggestions for new features, pleas for help, and/or praise
+should go to @email{dvipng@@nongnu.org}. For more information on this
+mailing list, send a message with just the word `help' as subject or
+body to @email{dvipng-request@@nongnu.org} or look at
+@url{http://lists.nongnu.org/mailman/listinfo/dvipng}.
+
+Offers to support further development will be appreciated. For developer
+access, ask on @email{dvipng@@nongnu.org}.
+
+@section Copying
+
+This program is released under the GNU Lesser General Public License
+version 3, see the COPYING file in the dvipng distribution or
+@url{http://www.gnu.org/licenses/}.
+
+Copyright @copyright{} 2002-2014 Jan-@AA{}ke Larsson
+
+@section Todo
+
+@itemize @bullet
+@item
+Use gs interpreter library for speed and possibly for functionality.
+
+@item
+Add more color models for xcolor compatibility
+
+@item
+Enable a named pipe as DVI
+
+@item
+Further speed improvements.
+
+@item
+Other output specials and source specials.
+
+@item
+Clean internal structures. Overhaul file handling.
+
+@item
+Fix the SELFAUTO stuff at runtime rather than at build time
+@end itemize
+
+
+@end ifset
diff --git a/Build/source/texk/dvipng/doc/texi2pod.pl b/Build/source/texk/dvipng/doc/texi2pod.pl
new file mode 100755
index 00000000000..9c6d8cc2792
--- /dev/null
+++ b/Build/source/texk/dvipng/doc/texi2pod.pl
@@ -0,0 +1,444 @@
+#! /usr/bin/env perl
+
+# Copyright (C) 1999, 2000, 2001, 2003, 2007 Free Software
+# Foundation, Inc.
+
+# This file is part of GCC.
+
+# GCC is free software; you can redistribute it and/or modify
+# it under the terms of the GNU General Public License as published by
+# the Free Software Foundation; either version 3, or (at your option)
+# any later version.
+
+# GCC is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
+# GNU General Public License for more details.
+
+# You should have received a copy of the GNU General Public License
+# along with GCC. If not, see <http://www.gnu.org/licenses/>.
+
+# This does trivial (and I mean _trivial_) conversion of Texinfo
+# markup to Perl POD format. It's intended to be used to extract
+# something suitable for a manpage from a Texinfo document.
+
+use warnings;
+
+$output = 0;
+$skipping = 0;
+%sects = ();
+$section = "";
+@icstack = ();
+@endwstack = ();
+@skstack = ();
+@instack = ();
+$shift = "";
+%defs = ();
+$fnno = 1;
+$inf = "";
+$ibase = "";
+
+while ($_ = shift) {
+ if (/^-D(.*)$/) {
+ if ($1 ne "") {
+ $flag = $1;
+ } else {
+ $flag = shift;
+ }
+ $value = "";
+ ($flag, $value) = ($flag =~ /^([^=]+)(?:=(.+))?/);
+ die "no flag specified for -D\n"
+ unless $flag ne "";
+ die "flags may only contain letters, digits, hyphens, dashes and underscores\n"
+ unless $flag =~ /^[a-zA-Z0-9_-]+$/;
+ $defs{$flag} = $value;
+ } elsif (/^-/) {
+ usage();
+ } else {
+ $in = $_, next unless defined $in;
+ $out = $_, next unless defined $out;
+ usage();
+ }
+}
+
+if (defined $in) {
+ $inf = gensym();
+ open($inf, "<$in") or die "opening \"$in\": $!\n";
+ $ibase = $1 if $in =~ m|^(.+)/[^/]+$|;
+} else {
+ $inf = \*STDIN;
+}
+
+if (defined $out) {
+ open(STDOUT, ">$out") or die "opening \"$out\": $!\n";
+}
+
+while(defined $inf) {
+while(<$inf>) {
+ # Certain commands are discarded without further processing.
+ /^\@(?:
+ [a-z]+index # @*index: useful only in complete manual
+ |need # @need: useful only in printed manual
+ |(?:end\s+)?group # @group .. @end group: ditto
+ |page # @page: ditto
+ |node # @node: useful only in .info file
+ |(?:end\s+)?ifnottex # @ifnottex .. @end ifnottex: use contents
+ )\b/x and next;
+
+ chomp;
+
+ # Look for filename and title markers.
+ /^\@setfilename\s+([^.]+)/ and $fn = $1, next;
+ /^\@settitle\s+([^.]+)/ and $tl = postprocess($1), next;
+
+ # Identify a man title but keep only the one we are interested in.
+ /^\@c\s+man\s+title\s+([A-Za-z0-9-]+)\s+(.+)/ and do {
+ if (exists $defs{$1}) {
+ $fn = $1;
+ $tl = postprocess($2);
+ }
+ next;
+ };
+
+ # Look for blocks surrounded by @c man begin SECTION ... @c man end.
+ # This really oughta be @ifman ... @end ifman and the like, but such
+ # would require rev'ing all other Texinfo translators.
+ /^\@c\s+man\s+begin\s+([A-Z]+)\s+([A-Za-z0-9-]+)/ and do {
+ $output = 1 if exists $defs{$2};
+ $sect = $1;
+ next;
+ };
+ /^\@c\s+man\s+begin\s+([A-Z]+)/ and $sect = $1, $output = 1, next;
+ /^\@c\s+man\s+end/ and do {
+ $sects{$sect} = "" unless exists $sects{$sect};
+ $sects{$sect} .= postprocess($section);
+ $section = "";
+ $output = 0;
+ next;
+ };
+
+ # handle variables
+ /^\@set\s+([a-zA-Z0-9_-]+)\s*(.*)$/ and do {
+ $defs{$1} = $2;
+ next;
+ };
+ /^\@clear\s+([a-zA-Z0-9_-]+)/ and do {
+ delete $defs{$1};
+ next;
+ };
+
+ next unless $output;
+
+ # Discard comments. (Can't do it above, because then we'd never see
+ # @c man lines.)
+ /^\@c\b/ and next;
+
+ # End-block handler goes up here because it needs to operate even
+ # if we are skipping.
+ /^\@end\s+([a-z]+)/ and do {
+ # Ignore @end foo, where foo is not an operation which may
+ # cause us to skip, if we are presently skipping.
+ my $ended = $1;
+ next if $skipping && $ended !~ /^(?:ifset|ifclear|ignore|menu|iftex|copying)$/;
+
+ die "\@end $ended without \@$ended at line $.\n" unless defined $endw;
+ die "\@$endw ended by \@end $ended at line $.\n" unless $ended eq $endw;
+
+ $endw = pop @endwstack;
+
+ if ($ended =~ /^(?:ifset|ifclear|ignore|menu|iftex)$/) {
+ $skipping = pop @skstack;
+ next;
+ } elsif ($ended =~ /^(?:example|smallexample|display)$/) {
+ $shift = "";
+ $_ = ""; # need a paragraph break
+ } elsif ($ended =~ /^(?:itemize|enumerate|[fv]?table)$/) {
+ $_ = "\n=back\n";
+ $ic = pop @icstack;
+ } else {
+ die "unknown command \@end $ended at line $.\n";
+ }
+ };
+
+ # We must handle commands which can cause skipping even while we
+ # are skipping, otherwise we will not process nested conditionals
+ # correctly.
+ /^\@ifset\s+([a-zA-Z0-9_-]+)/ and do {
+ push @endwstack, $endw;
+ push @skstack, $skipping;
+ $endw = "ifset";
+ $skipping = 1 unless exists $defs{$1};
+ next;
+ };
+
+ /^\@ifclear\s+([a-zA-Z0-9_-]+)/ and do {
+ push @endwstack, $endw;
+ push @skstack, $skipping;
+ $endw = "ifclear";
+ $skipping = 1 if exists $defs{$1};
+ next;
+ };
+
+ /^\@(ignore|menu|iftex|copying)\b/ and do {
+ push @endwstack, $endw;
+ push @skstack, $skipping;
+ $endw = $1;
+ $skipping = 1;
+ next;
+ };
+
+ next if $skipping;
+
+ # Character entities. First the ones that can be replaced by raw text
+ # or discarded outright:
+ s/\@copyright\{\}/(c)/g;
+ s/\@dots\{\}/.../g;
+ s/\@enddots\{\}/..../g;
+ s/\@([.!? ])/$1/g;
+ s/\@[:-]//g;
+ s/\@bullet(?:\{\})?/*/g;
+ s/\@TeX\{\}/TeX/g;
+ s/\@pounds\{\}/\#/g;
+ s/\@minus(?:\{\})?/-/g;
+ s/\\,/,/g;
+
+ # Now the ones that have to be replaced by special escapes
+ # (which will be turned back into text by unmunge())
+ s/&/&amp;/g;
+ s/\@\@/&at;/g;
+ s/\@\{/&lbrace;/g;
+ s/\@\}/&rbrace;/g;
+
+ # Inside a verbatim block, handle @var specially.
+ if ($shift ne "") {
+ s/\@var\{([^\}]*)\}/<$1>/g;
+ }
+
+ # POD doesn't interpret E<> inside a verbatim block.
+ if ($shift eq "") {
+ s/</&lt;/g;
+ s/>/&gt;/g;
+ } else {
+ s/</&LT;/g;
+ s/>/&GT;/g;
+ }
+
+ # Single line command handlers.
+
+ /^\@include\s+(.+)$/ and do {
+ push @instack, $inf;
+ $inf = gensym();
+ $file = postprocess($1);
+
+ # Try cwd and $ibase.
+ open($inf, "<" . $file)
+ or open($inf, "<" . $ibase . "/" . $file)
+ or die "cannot open $file or $ibase/$file: $!\n";
+ next;
+ };
+
+ /^\@(?:section|unnumbered|unnumberedsec|center)\s+(.+)$/
+ and $_ = "\n=head2 $1\n";
+ /^\@subsection\s+(.+)$/
+ and $_ = "\n=head3 $1\n";
+
+ # Block command handlers:
+ /^\@itemize(?:\s+(\@[a-z]+|\*|-))?/ and do {
+ push @endwstack, $endw;
+ push @icstack, $ic;
+ if (defined $1) {
+ $ic = $1;
+ } else {
+ $ic = '@bullet';
+ }
+ $_ = "\n=over 4\n";
+ $endw = "itemize";
+ };
+
+ /^\@enumerate(?:\s+([a-zA-Z0-9]+))?/ and do {
+ push @endwstack, $endw;
+ push @icstack, $ic;
+ if (defined $1) {
+ $ic = $1 . ".";
+ } else {
+ $ic = "1.";
+ }
+ $_ = "\n=over 4\n";
+ $endw = "enumerate";
+ };
+
+ /^\@([fv]?table)\s+(\@[a-z]+)/ and do {
+ push @endwstack, $endw;
+ push @icstack, $ic;
+ $endw = $1;
+ $ic = $2;
+ $ic =~ s/\@(?:samp|strong|key|gcctabopt|env)/B/;
+ $ic =~ s/\@(?:code|kbd)/C/;
+ $ic =~ s/\@(?:dfn|var|emph|cite|i)/I/;
+ $ic =~ s/\@(?:file)/F/;
+ $_ = "\n=over 4\n";
+ };
+
+ /^\@((?:small)?example|display)/ and do {
+ push @endwstack, $endw;
+ $endw = $1;
+ $shift = "\t";
+ $_ = ""; # need a paragraph break
+ };
+
+ /^\@itemx?\s*(.+)?$/ and do {
+ if (defined $1) {
+ # Entity escapes prevent munging by the <> processing below.
+ $_ = "\n=item $ic\&LT;$1\&GT;\n";
+ } else {
+ $_ = "\n=item $ic\n";
+ $ic =~ y/A-Ya-y/B-Zb-z/;
+ $ic =~ s/(\d+)/$1 + 1/eg;
+ }
+ };
+
+ $section .= $shift.$_."\n";
+}
+# End of current file.
+close($inf);
+$inf = pop @instack;
+}
+
+die "No filename or title\n" unless defined $fn && defined $tl;
+
+$sects{NAME} = "$fn \- $tl\n";
+$sects{FOOTNOTES} .= "=back\n" if exists $sects{FOOTNOTES};
+
+for $sect (qw(NAME SYNOPSIS DESCRIPTION OPTIONS ENVIRONMENT FILES
+ BUGS NOTES FOOTNOTES SEEALSO AUTHOR COPYRIGHT)) {
+ if(exists $sects{$sect}) {
+ $head = $sect;
+ $head =~ s/SEEALSO/SEE ALSO/;
+ print "=head1 $head\n\n";
+ print scalar unmunge ($sects{$sect});
+ print "\n";
+ }
+}
+
+sub usage
+{
+ die "usage: $0 [-D toggle...] [infile [outfile]]\n";
+}
+
+sub postprocess
+{
+ local $_ = $_[0];
+
+ # @value{foo} is replaced by whatever 'foo' is defined as.
+ while (m/(\@value\{([a-zA-Z0-9_-]+)\})/g) {
+ if (! exists $defs{$2}) {
+ print STDERR "Option $2 not defined\n";
+ s/\Q$1\E//;
+ } else {
+ $value = $defs{$2};
+ s/\Q$1\E/$value/;
+ }
+ }
+
+ # Formatting commands.
+ # Temporary escape for @r.
+ s/\@r\{([^\}]*)\}/R<$1>/g;
+ s/\@(?:dfn|var|emph|cite|i)\{([^\}]*)\}/I<$1>/g;
+ s/\@(?:code|kbd)\{([^\}]*)\}/C<$1>/g;
+ s/\@(?:gccoptlist|samp|strong|key|option|env|command|b)\{([^\}]*)\}/B<$1>/g;
+ s/\@sc\{([^\}]*)\}/\U$1/g;
+ s/\@file\{([^\}]*)\}/F<$1>/g;
+ s/\@w\{([^\}]*)\}/S<$1>/g;
+ s/\@(?:dmn|math)\{([^\}]*)\}/$1/g;
+
+ # keep references of the form @ref{...}, print them bold
+ s/\@(?:ref)\{([^\}]*)\}/B<$1>/g;
+
+ # Change double single quotes to double quotes.
+ s/''/"/g;
+ s/``/"/g;
+
+ # Cross references are thrown away, as are @noindent and @refill.
+ # (@noindent is impossible in .pod, and @refill is unnecessary.)
+ # @* is also impossible in .pod; we discard it and any newline that
+ # follows it. Similarly, our macro @gol must be discarded.
+
+ s/\(?\@xref\{(?:[^\}]*)\}(?:[^.<]|(?:<[^<>]*>))*\.\)?//g;
+ s/\s+\(\@pxref\{(?:[^\}]*)\}\)//g;
+ s/;\s+\@pxref\{(?:[^\}]*)\}//g;
+ s/\@noindent\s*//g;
+ s/\@refill//g;
+ s/\@gol//g;
+ s/\@\*\s*\n?//g;
+
+ # @uref can take one, two, or three arguments, with different
+ # semantics each time. @url and @email are just like @uref with
+ # one argument, for our purposes.
+ s/\@(?:uref|url|email)\{([^\},]*)\}/&lt;B<$1>&gt;/g;
+ s/\@uref\{([^\},]*),([^\},]*)\}/$2 (C<$1>)/g;
+ s/\@uref\{([^\},]*),([^\},]*),([^\},]*)\}/$3/g;
+
+ # Un-escape <> at this point.
+ s/&LT;/</g;
+ s/&GT;/>/g;
+
+ # Now un-nest all B<>, I<>, R<>. Theoretically we could have
+ # indefinitely deep nesting; in practice, one level suffices.
+ 1 while s/([BIR])<([^<>]*)([BIR])<([^<>]*)>/$1<$2>$3<$4>$1</g;
+
+ # Replace R<...> with bare ...; eliminate empty markup, B<>;
+ # shift white space at the ends of [BI]<...> expressions outside
+ # the expression.
+ s/R<([^<>]*)>/$1/g;
+ s/[BI]<>//g;
+ s/([BI])<(\s+)([^>]+)>/$2$1<$3>/g;
+ s/([BI])<([^>]+?)(\s+)>/$1<$2>$3/g;
+
+ # Extract footnotes. This has to be done after all other
+ # processing because otherwise the regexp will choke on formatting
+ # inside @footnote.
+ while (/\@footnote/g) {
+ s/\@footnote\{([^\}]+)\}/[$fnno]/;
+ add_footnote($1, $fnno);
+ $fnno++;
+ }
+
+ return $_;
+}
+
+sub unmunge
+{
+ # Replace escaped symbols with their equivalents.
+ local $_ = $_[0];
+
+ s/&lt;/E<lt>/g;
+ s/&gt;/E<gt>/g;
+ s/&lbrace;/\{/g;
+ s/&rbrace;/\}/g;
+ s/&at;/\@/g;
+ s/&amp;/&/g;
+ return $_;
+}
+
+sub add_footnote
+{
+ unless (exists $sects{FOOTNOTES}) {
+ $sects{FOOTNOTES} = "\n=over 4\n\n";
+ }
+
+ $sects{FOOTNOTES} .= "=item $fnno.\n\n"; $fnno++;
+ $sects{FOOTNOTES} .= $_[0];
+ $sects{FOOTNOTES} .= "\n\n";
+}
+
+# stolen from Symbol.pm
+{
+ my $genseq = 0;
+ sub gensym
+ {
+ my $name = "GEN" . $genseq++;
+ my $ref = \*{$name};
+ delete $::{$name};
+ return $ref;
+ }
+}
diff --git a/Build/source/texk/dvipng/dvipng-src/COPYING b/Build/source/texk/dvipng/dvipng-src/COPYING
new file mode 100644
index 00000000000..94a9ed024d3
--- /dev/null
+++ b/Build/source/texk/dvipng/dvipng-src/COPYING
@@ -0,0 +1,674 @@
+ GNU GENERAL PUBLIC LICENSE
+ Version 3, 29 June 2007
+
+ Copyright (C) 2007 Free Software Foundation, Inc. <http://fsf.org/>
+ Everyone is permitted to copy and distribute verbatim copies
+ of this license document, but changing it is not allowed.
+
+ Preamble
+
+ The GNU General Public License is a free, copyleft license for
+software and other kinds of works.
+
+ The licenses for most software and other practical works are designed
+to take away your freedom to share and change the works. By contrast,
+the GNU General Public License is intended to guarantee your freedom to
+share and change all versions of a program--to make sure it remains free
+software for all its users. We, the Free Software Foundation, use the
+GNU General Public License for most of our software; it applies also to
+any other work released this way by its authors. You can apply it to
+your programs, too.
+
+ When we speak of free software, we are referring to freedom, not
+price. Our General Public Licenses are designed to make sure that you
+have the freedom to distribute copies of free software (and charge for
+them if you wish), that you receive source code or can get it if you
+want it, that you can change the software or use pieces of it in new
+free programs, and that you know you can do these things.
+
+ To protect your rights, we need to prevent others from denying you
+these rights or asking you to surrender the rights. Therefore, you have
+certain responsibilities if you distribute copies of the software, or if
+you modify it: responsibilities to respect the freedom of others.
+
+ For example, if you distribute copies of such a program, whether
+gratis or for a fee, you must pass on to the recipients the same
+freedoms that you received. You must make sure that they, too, receive
+or can get the source code. And you must show them these terms so they
+know their rights.
+
+ Developers that use the GNU GPL protect your rights with two steps:
+(1) assert copyright on the software, and (2) offer you this License
+giving you legal permission to copy, distribute and/or modify it.
+
+ For the developers' and authors' protection, the GPL clearly explains
+that there is no warranty for this free software. For both users' and
+authors' sake, the GPL requires that modified versions be marked as
+changed, so that their problems will not be attributed erroneously to
+authors of previous versions.
+
+ Some devices are designed to deny users access to install or run
+modified versions of the software inside them, although the manufacturer
+can do so. This is fundamentally incompatible with the aim of
+protecting users' freedom to change the software. The systematic
+pattern of such abuse occurs in the area of products for individuals to
+use, which is precisely where it is most unacceptable. Therefore, we
+have designed this version of the GPL to prohibit the practice for those
+products. If such problems arise substantially in other domains, we
+stand ready to extend this provision to those domains in future versions
+of the GPL, as needed to protect the freedom of users.
+
+ Finally, every program is threatened constantly by software patents.
+States should not allow patents to restrict development and use of
+software on general-purpose computers, but in those that do, we wish to
+avoid the special danger that patents applied to a free program could
+make it effectively proprietary. To prevent this, the GPL assures that
+patents cannot be used to render the program non-free.
+
+ The precise terms and conditions for copying, distribution and
+modification follow.
+
+ TERMS AND CONDITIONS
+
+ 0. Definitions.
+
+ "This License" refers to version 3 of the GNU General Public License.
+
+ "Copyright" also means copyright-like laws that apply to other kinds of
+works, such as semiconductor masks.
+
+ "The Program" refers to any copyrightable work licensed under this
+License. Each licensee is addressed as "you". "Licensees" and
+"recipients" may be individuals or organizations.
+
+ To "modify" a work means to copy from or adapt all or part of the work
+in a fashion requiring copyright permission, other than the making of an
+exact copy. The resulting work is called a "modified version" of the
+earlier work or a work "based on" the earlier work.
+
+ A "covered work" means either the unmodified Program or a work based
+on the Program.
+
+ To "propagate" a work means to do anything with it that, without
+permission, would make you directly or secondarily liable for
+infringement under applicable copyright law, except executing it on a
+computer or modifying a private copy. Propagation includes copying,
+distribution (with or without modification), making available to the
+public, and in some countries other activities as well.
+
+ To "convey" a work means any kind of propagation that enables other
+parties to make or receive copies. Mere interaction with a user through
+a computer network, with no transfer of a copy, is not conveying.
+
+ An interactive user interface displays "Appropriate Legal Notices"
+to the extent that it includes a convenient and prominently visible
+feature that (1) displays an appropriate copyright notice, and (2)
+tells the user that there is no warranty for the work (except to the
+extent that warranties are provided), that licensees may convey the
+work under this License, and how to view a copy of this License. If
+the interface presents a list of user commands or options, such as a
+menu, a prominent item in the list meets this criterion.
+
+ 1. Source Code.
+
+ The "source code" for a work means the preferred form of the work
+for making modifications to it. "Object code" means any non-source
+form of a work.
+
+ A "Standard Interface" means an interface that either is an official
+standard defined by a recognized standards body, or, in the case of
+interfaces specified for a particular programming language, one that
+is widely used among developers working in that language.
+
+ The "System Libraries" of an executable work include anything, other
+than the work as a whole, that (a) is included in the normal form of
+packaging a Major Component, but which is not part of that Major
+Component, and (b) serves only to enable use of the work with that
+Major Component, or to implement a Standard Interface for which an
+implementation is available to the public in source code form. A
+"Major Component", in this context, means a major essential component
+(kernel, window system, and so on) of the specific operating system
+(if any) on which the executable work runs, or a compiler used to
+produce the work, or an object code interpreter used to run it.
+
+ The "Corresponding Source" for a work in object code form means all
+the source code needed to generate, install, and (for an executable
+work) run the object code and to modify the work, including scripts to
+control those activities. However, it does not include the work's
+System Libraries, or general-purpose tools or generally available free
+programs which are used unmodified in performing those activities but
+which are not part of the work. For example, Corresponding Source
+includes interface definition files associated with source files for
+the work, and the source code for shared libraries and dynamically
+linked subprograms that the work is specifically designed to require,
+such as by intimate data communication or control flow between those
+subprograms and other parts of the work.
+
+ The Corresponding Source need not include anything that users
+can regenerate automatically from other parts of the Corresponding
+Source.
+
+ The Corresponding Source for a work in source code form is that
+same work.
+
+ 2. Basic Permissions.
+
+ All rights granted under this License are granted for the term of
+copyright on the Program, and are irrevocable provided the stated
+conditions are met. This License explicitly affirms your unlimited
+permission to run the unmodified Program. The output from running a
+covered work is covered by this License only if the output, given its
+content, constitutes a covered work. This License acknowledges your
+rights of fair use or other equivalent, as provided by copyright law.
+
+ You may make, run and propagate covered works that you do not
+convey, without conditions so long as your license otherwise remains
+in force. You may convey covered works to others for the sole purpose
+of having them make modifications exclusively for you, or provide you
+with facilities for running those works, provided that you comply with
+the terms of this License in conveying all material for which you do
+not control copyright. Those thus making or running the covered works
+for you must do so exclusively on your behalf, under your direction
+and control, on terms that prohibit them from making any copies of
+your copyrighted material outside their relationship with you.
+
+ Conveying under any other circumstances is permitted solely under
+the conditions stated below. Sublicensing is not allowed; section 10
+makes it unnecessary.
+
+ 3. Protecting Users' Legal Rights From Anti-Circumvention Law.
+
+ No covered work shall be deemed part of an effective technological
+measure under any applicable law fulfilling obligations under article
+11 of the WIPO copyright treaty adopted on 20 December 1996, or
+similar laws prohibiting or restricting circumvention of such
+measures.
+
+ When you convey a covered work, you waive any legal power to forbid
+circumvention of technological measures to the extent such circumvention
+is effected by exercising rights under this License with respect to
+the covered work, and you disclaim any intention to limit operation or
+modification of the work as a means of enforcing, against the work's
+users, your or third parties' legal rights to forbid circumvention of
+technological measures.
+
+ 4. Conveying Verbatim Copies.
+
+ You may convey verbatim copies of the Program's source code as you
+receive it, in any medium, provided that you conspicuously and
+appropriately publish on each copy an appropriate copyright notice;
+keep intact all notices stating that this License and any
+non-permissive terms added in accord with section 7 apply to the code;
+keep intact all notices of the absence of any warranty; and give all
+recipients a copy of this License along with the Program.
+
+ You may charge any price or no price for each copy that you convey,
+and you may offer support or warranty protection for a fee.
+
+ 5. Conveying Modified Source Versions.
+
+ You may convey a work based on the Program, or the modifications to
+produce it from the Program, in the form of source code under the
+terms of section 4, provided that you also meet all of these conditions:
+
+ a) The work must carry prominent notices stating that you modified
+ it, and giving a relevant date.
+
+ b) The work must carry prominent notices stating that it is
+ released under this License and any conditions added under section
+ 7. This requirement modifies the requirement in section 4 to
+ "keep intact all notices".
+
+ c) You must license the entire work, as a whole, under this
+ License to anyone who comes into possession of a copy. This
+ License will therefore apply, along with any applicable section 7
+ additional terms, to the whole of the work, and all its parts,
+ regardless of how they are packaged. This License gives no
+ permission to license the work in any other way, but it does not
+ invalidate such permission if you have separately received it.
+
+ d) If the work has interactive user interfaces, each must display
+ Appropriate Legal Notices; however, if the Program has interactive
+ interfaces that do not display Appropriate Legal Notices, your
+ work need not make them do so.
+
+ A compilation of a covered work with other separate and independent
+works, which are not by their nature extensions of the covered work,
+and which are not combined with it such as to form a larger program,
+in or on a volume of a storage or distribution medium, is called an
+"aggregate" if the compilation and its resulting copyright are not
+used to limit the access or legal rights of the compilation's users
+beyond what the individual works permit. Inclusion of a covered work
+in an aggregate does not cause this License to apply to the other
+parts of the aggregate.
+
+ 6. Conveying Non-Source Forms.
+
+ You may convey a covered work in object code form under the terms
+of sections 4 and 5, provided that you also convey the
+machine-readable Corresponding Source under the terms of this License,
+in one of these ways:
+
+ a) Convey the object code in, or embodied in, a physical product
+ (including a physical distribution medium), accompanied by the
+ Corresponding Source fixed on a durable physical medium
+ customarily used for software interchange.
+
+ b) Convey the object code in, or embodied in, a physical product
+ (including a physical distribution medium), accompanied by a
+ written offer, valid for at least three years and valid for as
+ long as you offer spare parts or customer support for that product
+ model, to give anyone who possesses the object code either (1) a
+ copy of the Corresponding Source for all the software in the
+ product that is covered by this License, on a durable physical
+ medium customarily used for software interchange, for a price no
+ more than your reasonable cost of physically performing this
+ conveying of source, or (2) access to copy the
+ Corresponding Source from a network server at no charge.
+
+ c) Convey individual copies of the object code with a copy of the
+ written offer to provide the Corresponding Source. This
+ alternative is allowed only occasionally and noncommercially, and
+ only if you received the object code with such an offer, in accord
+ with subsection 6b.
+
+ d) Convey the object code by offering access from a designated
+ place (gratis or for a charge), and offer equivalent access to the
+ Corresponding Source in the same way through the same place at no
+ further charge. You need not require recipients to copy the
+ Corresponding Source along with the object code. If the place to
+ copy the object code is a network server, the Corresponding Source
+ may be on a different server (operated by you or a third party)
+ that supports equivalent copying facilities, provided you maintain
+ clear directions next to the object code saying where to find the
+ Corresponding Source. Regardless of what server hosts the
+ Corresponding Source, you remain obligated to ensure that it is
+ available for as long as needed to satisfy these requirements.
+
+ e) Convey the object code using peer-to-peer transmission, provided
+ you inform other peers where the object code and Corresponding
+ Source of the work are being offered to the general public at no
+ charge under subsection 6d.
+
+ A separable portion of the object code, whose source code is excluded
+from the Corresponding Source as a System Library, need not be
+included in conveying the object code work.
+
+ A "User Product" is either (1) a "consumer product", which means any
+tangible personal property which is normally used for personal, family,
+or household purposes, or (2) anything designed or sold for incorporation
+into a dwelling. In determining whether a product is a consumer product,
+doubtful cases shall be resolved in favor of coverage. For a particular
+product received by a particular user, "normally used" refers to a
+typical or common use of that class of product, regardless of the status
+of the particular user or of the way in which the particular user
+actually uses, or expects or is expected to use, the product. A product
+is a consumer product regardless of whether the product has substantial
+commercial, industrial or non-consumer uses, unless such uses represent
+the only significant mode of use of the product.
+
+ "Installation Information" for a User Product means any methods,
+procedures, authorization keys, or other information required to install
+and execute modified versions of a covered work in that User Product from
+a modified version of its Corresponding Source. The information must
+suffice to ensure that the continued functioning of the modified object
+code is in no case prevented or interfered with solely because
+modification has been made.
+
+ If you convey an object code work under this section in, or with, or
+specifically for use in, a User Product, and the conveying occurs as
+part of a transaction in which the right of possession and use of the
+User Product is transferred to the recipient in perpetuity or for a
+fixed term (regardless of how the transaction is characterized), the
+Corresponding Source conveyed under this section must be accompanied
+by the Installation Information. But this requirement does not apply
+if neither you nor any third party retains the ability to install
+modified object code on the User Product (for example, the work has
+been installed in ROM).
+
+ The requirement to provide Installation Information does not include a
+requirement to continue to provide support service, warranty, or updates
+for a work that has been modified or installed by the recipient, or for
+the User Product in which it has been modified or installed. Access to a
+network may be denied when the modification itself materially and
+adversely affects the operation of the network or violates the rules and
+protocols for communication across the network.
+
+ Corresponding Source conveyed, and Installation Information provided,
+in accord with this section must be in a format that is publicly
+documented (and with an implementation available to the public in
+source code form), and must require no special password or key for
+unpacking, reading or copying.
+
+ 7. Additional Terms.
+
+ "Additional permissions" are terms that supplement the terms of this
+License by making exceptions from one or more of its conditions.
+Additional permissions that are applicable to the entire Program shall
+be treated as though they were included in this License, to the extent
+that they are valid under applicable law. If additional permissions
+apply only to part of the Program, that part may be used separately
+under those permissions, but the entire Program remains governed by
+this License without regard to the additional permissions.
+
+ When you convey a copy of a covered work, you may at your option
+remove any additional permissions from that copy, or from any part of
+it. (Additional permissions may be written to require their own
+removal in certain cases when you modify the work.) You may place
+additional permissions on material, added by you to a covered work,
+for which you have or can give appropriate copyright permission.
+
+ Notwithstanding any other provision of this License, for material you
+add to a covered work, you may (if authorized by the copyright holders of
+that material) supplement the terms of this License with terms:
+
+ a) Disclaiming warranty or limiting liability differently from the
+ terms of sections 15 and 16 of this License; or
+
+ b) Requiring preservation of specified reasonable legal notices or
+ author attributions in that material or in the Appropriate Legal
+ Notices displayed by works containing it; or
+
+ c) Prohibiting misrepresentation of the origin of that material, or
+ requiring that modified versions of such material be marked in
+ reasonable ways as different from the original version; or
+
+ d) Limiting the use for publicity purposes of names of licensors or
+ authors of the material; or
+
+ e) Declining to grant rights under trademark law for use of some
+ trade names, trademarks, or service marks; or
+
+ f) Requiring indemnification of licensors and authors of that
+ material by anyone who conveys the material (or modified versions of
+ it) with contractual assumptions of liability to the recipient, for
+ any liability that these contractual assumptions directly impose on
+ those licensors and authors.
+
+ All other non-permissive additional terms are considered "further
+restrictions" within the meaning of section 10. If the Program as you
+received it, or any part of it, contains a notice stating that it is
+governed by this License along with a term that is a further
+restriction, you may remove that term. If a license document contains
+a further restriction but permits relicensing or conveying under this
+License, you may add to a covered work material governed by the terms
+of that license document, provided that the further restriction does
+not survive such relicensing or conveying.
+
+ If you add terms to a covered work in accord with this section, you
+must place, in the relevant source files, a statement of the
+additional terms that apply to those files, or a notice indicating
+where to find the applicable terms.
+
+ Additional terms, permissive or non-permissive, may be stated in the
+form of a separately written license, or stated as exceptions;
+the above requirements apply either way.
+
+ 8. Termination.
+
+ You may not propagate or modify a covered work except as expressly
+provided under this License. Any attempt otherwise to propagate or
+modify it is void, and will automatically terminate your rights under
+this License (including any patent licenses granted under the third
+paragraph of section 11).
+
+ However, if you cease all violation of this License, then your
+license from a particular copyright holder is reinstated (a)
+provisionally, unless and until the copyright holder explicitly and
+finally terminates your license, and (b) permanently, if the copyright
+holder fails to notify you of the violation by some reasonable means
+prior to 60 days after the cessation.
+
+ Moreover, your license from a particular copyright holder is
+reinstated permanently if the copyright holder notifies you of the
+violation by some reasonable means, this is the first time you have
+received notice of violation of this License (for any work) from that
+copyright holder, and you cure the violation prior to 30 days after
+your receipt of the notice.
+
+ Termination of your rights under this section does not terminate the
+licenses of parties who have received copies or rights from you under
+this License. If your rights have been terminated and not permanently
+reinstated, you do not qualify to receive new licenses for the same
+material under section 10.
+
+ 9. Acceptance Not Required for Having Copies.
+
+ You are not required to accept this License in order to receive or
+run a copy of the Program. Ancillary propagation of a covered work
+occurring solely as a consequence of using peer-to-peer transmission
+to receive a copy likewise does not require acceptance. However,
+nothing other than this License grants you permission to propagate or
+modify any covered work. These actions infringe copyright if you do
+not accept this License. Therefore, by modifying or propagating a
+covered work, you indicate your acceptance of this License to do so.
+
+ 10. Automatic Licensing of Downstream Recipients.
+
+ Each time you convey a covered work, the recipient automatically
+receives a license from the original licensors, to run, modify and
+propagate that work, subject to this License. You are not responsible
+for enforcing compliance by third parties with this License.
+
+ An "entity transaction" is a transaction transferring control of an
+organization, or substantially all assets of one, or subdividing an
+organization, or merging organizations. If propagation of a covered
+work results from an entity transaction, each party to that
+transaction who receives a copy of the work also receives whatever
+licenses to the work the party's predecessor in interest had or could
+give under the previous paragraph, plus a right to possession of the
+Corresponding Source of the work from the predecessor in interest, if
+the predecessor has it or can get it with reasonable efforts.
+
+ You may not impose any further restrictions on the exercise of the
+rights granted or affirmed under this License. For example, you may
+not impose a license fee, royalty, or other charge for exercise of
+rights granted under this License, and you may not initiate litigation
+(including a cross-claim or counterclaim in a lawsuit) alleging that
+any patent claim is infringed by making, using, selling, offering for
+sale, or importing the Program or any portion of it.
+
+ 11. Patents.
+
+ A "contributor" is a copyright holder who authorizes use under this
+License of the Program or a work on which the Program is based. The
+work thus licensed is called the contributor's "contributor version".
+
+ A contributor's "essential patent claims" are all patent claims
+owned or controlled by the contributor, whether already acquired or
+hereafter acquired, that would be infringed by some manner, permitted
+by this License, of making, using, or selling its contributor version,
+but do not include claims that would be infringed only as a
+consequence of further modification of the contributor version. For
+purposes of this definition, "control" includes the right to grant
+patent sublicenses in a manner consistent with the requirements of
+this License.
+
+ Each contributor grants you a non-exclusive, worldwide, royalty-free
+patent license under the contributor's essential patent claims, to
+make, use, sell, offer for sale, import and otherwise run, modify and
+propagate the contents of its contributor version.
+
+ In the following three paragraphs, a "patent license" is any express
+agreement or commitment, however denominated, not to enforce a patent
+(such as an express permission to practice a patent or covenant not to
+sue for patent infringement). To "grant" such a patent license to a
+party means to make such an agreement or commitment not to enforce a
+patent against the party.
+
+ If you convey a covered work, knowingly relying on a patent license,
+and the Corresponding Source of the work is not available for anyone
+to copy, free of charge and under the terms of this License, through a
+publicly available network server or other readily accessible means,
+then you must either (1) cause the Corresponding Source to be so
+available, or (2) arrange to deprive yourself of the benefit of the
+patent license for this particular work, or (3) arrange, in a manner
+consistent with the requirements of this License, to extend the patent
+license to downstream recipients. "Knowingly relying" means you have
+actual knowledge that, but for the patent license, your conveying the
+covered work in a country, or your recipient's use of the covered work
+in a country, would infringe one or more identifiable patents in that
+country that you have reason to believe are valid.
+
+ If, pursuant to or in connection with a single transaction or
+arrangement, you convey, or propagate by procuring conveyance of, a
+covered work, and grant a patent license to some of the parties
+receiving the covered work authorizing them to use, propagate, modify
+or convey a specific copy of the covered work, then the patent license
+you grant is automatically extended to all recipients of the covered
+work and works based on it.
+
+ A patent license is "discriminatory" if it does not include within
+the scope of its coverage, prohibits the exercise of, or is
+conditioned on the non-exercise of one or more of the rights that are
+specifically granted under this License. You may not convey a covered
+work if you are a party to an arrangement with a third party that is
+in the business of distributing software, under which you make payment
+to the third party based on the extent of your activity of conveying
+the work, and under which the third party grants, to any of the
+parties who would receive the covered work from you, a discriminatory
+patent license (a) in connection with copies of the covered work
+conveyed by you (or copies made from those copies), or (b) primarily
+for and in connection with specific products or compilations that
+contain the covered work, unless you entered into that arrangement,
+or that patent license was granted, prior to 28 March 2007.
+
+ Nothing in this License shall be construed as excluding or limiting
+any implied license or other defenses to infringement that may
+otherwise be available to you under applicable patent law.
+
+ 12. No Surrender of Others' Freedom.
+
+ If conditions are imposed on you (whether by court order, agreement or
+otherwise) that contradict the conditions of this License, they do not
+excuse you from the conditions of this License. If you cannot convey a
+covered work so as to satisfy simultaneously your obligations under this
+License and any other pertinent obligations, then as a consequence you may
+not convey it at all. For example, if you agree to terms that obligate you
+to collect a royalty for further conveying from those to whom you convey
+the Program, the only way you could satisfy both those terms and this
+License would be to refrain entirely from conveying the Program.
+
+ 13. Use with the GNU Affero General Public License.
+
+ Notwithstanding any other provision of this License, you have
+permission to link or combine any covered work with a work licensed
+under version 3 of the GNU Affero General Public License into a single
+combined work, and to convey the resulting work. The terms of this
+License will continue to apply to the part which is the covered work,
+but the special requirements of the GNU Affero General Public License,
+section 13, concerning interaction through a network will apply to the
+combination as such.
+
+ 14. Revised Versions of this License.
+
+ The Free Software Foundation may publish revised and/or new versions of
+the GNU General Public License from time to time. Such new versions will
+be similar in spirit to the present version, but may differ in detail to
+address new problems or concerns.
+
+ Each version is given a distinguishing version number. If the
+Program specifies that a certain numbered version of the GNU General
+Public License "or any later version" applies to it, you have the
+option of following the terms and conditions either of that numbered
+version or of any later version published by the Free Software
+Foundation. If the Program does not specify a version number of the
+GNU General Public License, you may choose any version ever published
+by the Free Software Foundation.
+
+ If the Program specifies that a proxy can decide which future
+versions of the GNU General Public License can be used, that proxy's
+public statement of acceptance of a version permanently authorizes you
+to choose that version for the Program.
+
+ Later license versions may give you additional or different
+permissions. However, no additional obligations are imposed on any
+author or copyright holder as a result of your choosing to follow a
+later version.
+
+ 15. Disclaimer of Warranty.
+
+ THERE IS NO WARRANTY FOR THE PROGRAM, TO THE EXTENT PERMITTED BY
+APPLICABLE LAW. EXCEPT WHEN OTHERWISE STATED IN WRITING THE COPYRIGHT
+HOLDERS AND/OR OTHER PARTIES PROVIDE THE PROGRAM "AS IS" WITHOUT WARRANTY
+OF ANY KIND, EITHER EXPRESSED OR IMPLIED, INCLUDING, BUT NOT LIMITED TO,
+THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR
+PURPOSE. THE ENTIRE RISK AS TO THE QUALITY AND PERFORMANCE OF THE PROGRAM
+IS WITH YOU. SHOULD THE PROGRAM PROVE DEFECTIVE, YOU ASSUME THE COST OF
+ALL NECESSARY SERVICING, REPAIR OR CORRECTION.
+
+ 16. Limitation of Liability.
+
+ IN NO EVENT UNLESS REQUIRED BY APPLICABLE LAW OR AGREED TO IN WRITING
+WILL ANY COPYRIGHT HOLDER, OR ANY OTHER PARTY WHO MODIFIES AND/OR CONVEYS
+THE PROGRAM AS PERMITTED ABOVE, BE LIABLE TO YOU FOR DAMAGES, INCLUDING ANY
+GENERAL, SPECIAL, INCIDENTAL OR CONSEQUENTIAL DAMAGES ARISING OUT OF THE
+USE OR INABILITY TO USE THE PROGRAM (INCLUDING BUT NOT LIMITED TO LOSS OF
+DATA OR DATA BEING RENDERED INACCURATE OR LOSSES SUSTAINED BY YOU OR THIRD
+PARTIES OR A FAILURE OF THE PROGRAM TO OPERATE WITH ANY OTHER PROGRAMS),
+EVEN IF SUCH HOLDER OR OTHER PARTY HAS BEEN ADVISED OF THE POSSIBILITY OF
+SUCH DAMAGES.
+
+ 17. Interpretation of Sections 15 and 16.
+
+ If the disclaimer of warranty and limitation of liability provided
+above cannot be given local legal effect according to their terms,
+reviewing courts shall apply local law that most closely approximates
+an absolute waiver of all civil liability in connection with the
+Program, unless a warranty or assumption of liability accompanies a
+copy of the Program in return for a fee.
+
+ END OF TERMS AND CONDITIONS
+
+ How to Apply These Terms to Your New Programs
+
+ If you develop a new program, and you want it to be of the greatest
+possible use to the public, the best way to achieve this is to make it
+free software which everyone can redistribute and change under these terms.
+
+ To do so, attach the following notices to the program. It is safest
+to attach them to the start of each source file to most effectively
+state the exclusion of warranty; and each file should have at least
+the "copyright" line and a pointer to where the full notice is found.
+
+ <one line to give the program's name and a brief idea of what it does.>
+ Copyright (C) <year> <name of author>
+
+ This program is free software: you can redistribute it and/or modify
+ it under the terms of the GNU General Public License as published by
+ the Free Software Foundation, either version 3 of the License, or
+ (at your option) any later version.
+
+ This program is distributed in the hope that it will be useful,
+ but WITHOUT ANY WARRANTY; without even the implied warranty of
+ MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
+ GNU General Public License for more details.
+
+ You should have received a copy of the GNU General Public License
+ along with this program. If not, see <http://www.gnu.org/licenses/>.
+
+Also add information on how to contact you by electronic and paper mail.
+
+ If the program does terminal interaction, make it output a short
+notice like this when it starts in an interactive mode:
+
+ <program> Copyright (C) <year> <name of author>
+ This program comes with ABSOLUTELY NO WARRANTY; for details type `show w'.
+ This is free software, and you are welcome to redistribute it
+ under certain conditions; type `show c' for details.
+
+The hypothetical commands `show w' and `show c' should show the appropriate
+parts of the General Public License. Of course, your program's commands
+might be different; for a GUI interface, you would use an "about box".
+
+ You should also get your employer (if you work as a programmer) or school,
+if any, to sign a "copyright disclaimer" for the program, if necessary.
+For more information on this, and how to apply and follow the GNU GPL, see
+<http://www.gnu.org/licenses/>.
+
+ The GNU General Public License does not permit incorporating your program
+into proprietary programs. If your program is a subroutine library, you
+may consider it more useful to permit linking proprietary applications with
+the library. If this is what you want to do, use the GNU Lesser General
+Public License instead of this License. But first, please read
+<http://www.gnu.org/philosophy/why-not-lgpl.html>.
diff --git a/Build/source/texk/dvipng/dvipng-src/COPYING.LESSER b/Build/source/texk/dvipng/dvipng-src/COPYING.LESSER
new file mode 100644
index 00000000000..fc8a5de7edf
--- /dev/null
+++ b/Build/source/texk/dvipng/dvipng-src/COPYING.LESSER
@@ -0,0 +1,165 @@
+ GNU LESSER GENERAL PUBLIC LICENSE
+ Version 3, 29 June 2007
+
+ Copyright (C) 2007 Free Software Foundation, Inc. <http://fsf.org/>
+ Everyone is permitted to copy and distribute verbatim copies
+ of this license document, but changing it is not allowed.
+
+
+ This version of the GNU Lesser General Public License incorporates
+the terms and conditions of version 3 of the GNU General Public
+License, supplemented by the additional permissions listed below.
+
+ 0. Additional Definitions.
+
+ As used herein, "this License" refers to version 3 of the GNU Lesser
+General Public License, and the "GNU GPL" refers to version 3 of the GNU
+General Public License.
+
+ "The Library" refers to a covered work governed by this License,
+other than an Application or a Combined Work as defined below.
+
+ An "Application" is any work that makes use of an interface provided
+by the Library, but which is not otherwise based on the Library.
+Defining a subclass of a class defined by the Library is deemed a mode
+of using an interface provided by the Library.
+
+ A "Combined Work" is a work produced by combining or linking an
+Application with the Library. The particular version of the Library
+with which the Combined Work was made is also called the "Linked
+Version".
+
+ The "Minimal Corresponding Source" for a Combined Work means the
+Corresponding Source for the Combined Work, excluding any source code
+for portions of the Combined Work that, considered in isolation, are
+based on the Application, and not on the Linked Version.
+
+ The "Corresponding Application Code" for a Combined Work means the
+object code and/or source code for the Application, including any data
+and utility programs needed for reproducing the Combined Work from the
+Application, but excluding the System Libraries of the Combined Work.
+
+ 1. Exception to Section 3 of the GNU GPL.
+
+ You may convey a covered work under sections 3 and 4 of this License
+without being bound by section 3 of the GNU GPL.
+
+ 2. Conveying Modified Versions.
+
+ If you modify a copy of the Library, and, in your modifications, a
+facility refers to a function or data to be supplied by an Application
+that uses the facility (other than as an argument passed when the
+facility is invoked), then you may convey a copy of the modified
+version:
+
+ a) under this License, provided that you make a good faith effort to
+ ensure that, in the event an Application does not supply the
+ function or data, the facility still operates, and performs
+ whatever part of its purpose remains meaningful, or
+
+ b) under the GNU GPL, with none of the additional permissions of
+ this License applicable to that copy.
+
+ 3. Object Code Incorporating Material from Library Header Files.
+
+ The object code form of an Application may incorporate material from
+a header file that is part of the Library. You may convey such object
+code under terms of your choice, provided that, if the incorporated
+material is not limited to numerical parameters, data structure
+layouts and accessors, or small macros, inline functions and templates
+(ten or fewer lines in length), you do both of the following:
+
+ a) Give prominent notice with each copy of the object code that the
+ Library is used in it and that the Library and its use are
+ covered by this License.
+
+ b) Accompany the object code with a copy of the GNU GPL and this license
+ document.
+
+ 4. Combined Works.
+
+ You may convey a Combined Work under terms of your choice that,
+taken together, effectively do not restrict modification of the
+portions of the Library contained in the Combined Work and reverse
+engineering for debugging such modifications, if you also do each of
+the following:
+
+ a) Give prominent notice with each copy of the Combined Work that
+ the Library is used in it and that the Library and its use are
+ covered by this License.
+
+ b) Accompany the Combined Work with a copy of the GNU GPL and this license
+ document.
+
+ c) For a Combined Work that displays copyright notices during
+ execution, include the copyright notice for the Library among
+ these notices, as well as a reference directing the user to the
+ copies of the GNU GPL and this license document.
+
+ d) Do one of the following:
+
+ 0) Convey the Minimal Corresponding Source under the terms of this
+ License, and the Corresponding Application Code in a form
+ suitable for, and under terms that permit, the user to
+ recombine or relink the Application with a modified version of
+ the Linked Version to produce a modified Combined Work, in the
+ manner specified by section 6 of the GNU GPL for conveying
+ Corresponding Source.
+
+ 1) Use a suitable shared library mechanism for linking with the
+ Library. A suitable mechanism is one that (a) uses at run time
+ a copy of the Library already present on the user's computer
+ system, and (b) will operate properly with a modified version
+ of the Library that is interface-compatible with the Linked
+ Version.
+
+ e) Provide Installation Information, but only if you would otherwise
+ be required to provide such information under section 6 of the
+ GNU GPL, and only to the extent that such information is
+ necessary to install and execute a modified version of the
+ Combined Work produced by recombining or relinking the
+ Application with a modified version of the Linked Version. (If
+ you use option 4d0, the Installation Information must accompany
+ the Minimal Corresponding Source and Corresponding Application
+ Code. If you use option 4d1, you must provide the Installation
+ Information in the manner specified by section 6 of the GNU GPL
+ for conveying Corresponding Source.)
+
+ 5. Combined Libraries.
+
+ You may place library facilities that are a work based on the
+Library side by side in a single library together with other library
+facilities that are not Applications and are not covered by this
+License, and convey such a combined library under terms of your
+choice, if you do both of the following:
+
+ a) Accompany the combined library with a copy of the same work based
+ on the Library, uncombined with any other library facilities,
+ conveyed under the terms of this License.
+
+ b) Give prominent notice with the combined library that part of it
+ is a work based on the Library, and explaining where to find the
+ accompanying uncombined form of the same work.
+
+ 6. Revised Versions of the GNU Lesser General Public License.
+
+ The Free Software Foundation may publish revised and/or new versions
+of the GNU Lesser General Public License from time to time. Such new
+versions will be similar in spirit to the present version, but may
+differ in detail to address new problems or concerns.
+
+ Each version is given a distinguishing version number. If the
+Library as you received it specifies that a certain numbered version
+of the GNU Lesser General Public License "or any later version"
+applies to it, you have the option of following the terms and
+conditions either of that published version or of any later version
+published by the Free Software Foundation. If the Library as you
+received it does not specify a version number of the GNU Lesser
+General Public License, you may choose any version of the GNU Lesser
+General Public License ever published by the Free Software Foundation.
+
+ If the Library as you received it specifies that a proxy can decide
+whether future versions of the GNU Lesser General Public License shall
+apply, that proxy's public statement of acceptance of any version is
+permanent authorization for you to choose that version for the
+Library.
diff --git a/Build/source/texk/dvipng/dvipng-src/COPYING.gd b/Build/source/texk/dvipng/dvipng-src/COPYING.gd
new file mode 100644
index 00000000000..db6a326580c
--- /dev/null
+++ b/Build/source/texk/dvipng/dvipng-src/COPYING.gd
@@ -0,0 +1,54 @@
+The below is the copyright notice of the gd library.
+----------------------------------------------------
+
+Portions copyright 1994, 1995, 1996, 1997, 1998, 1999, 2000, 2001,
+2002 by Cold Spring Harbor Laboratory. Funded under Grant P41-RR02188
+by the National Institutes of Health.
+
+Portions copyright 1996, 1997, 1998, 1999, 2000, 2001, 2002 by
+Boutell.Com, Inc.
+
+Portions relating to GD2 format copyright 1999, 2000, 2001, 2002
+Philip Warner.
+
+Portions relating to PNG copyright 1999, 2000, 2001, 2002 Greg
+Roelofs.
+
+Portions relating to gdttf.c copyright 1999, 2000, 2001, 2002 John
+Ellson (ellson@lucent.com).
+
+Portions relating to gdft.c copyright 2001, 2002 John Ellson
+(ellson@lucent.com).
+
+Portions copyright 2000, 2001, 2002, 2003, 2004, 2005, 2006, 2007
+Pierre-Alain Joye (pierre@libgd.org).
+
+Portions relating to JPEG and to color quantization copyright 2000,
+2001, 2002, Doug Becker and copyright (C) 1994, 1995, 1996, 1997,
+1998, 1999, 2000, 2001, 2002, Thomas G. Lane. This software is
+based in part on the work of the Independent JPEG Group. See the
+file README-JPEG.TXT for more information.
+
+Portions relating to WBMP copyright 2000, 2001, 2002 Maurice
+Szmurlo and Johan Van den Brande.
+
+Permission has been granted to copy, distribute and modify gd in
+any context without fee, including a commercial application,
+provided that this notice is present in user-accessible supporting
+documentation.
+
+This does not affect your ownership of the derived work itself, and
+the intent is to assure proper credit for the authors of gd, not to
+interfere with your productive use of gd. If you have questions,
+ask. "Derived works" includes all programs that utilize the
+library. Credit must be given in user-accessible documentation.
+
+This software is provided "AS IS." The copyright holders disclaim
+all warranties, either express or implied, including but not
+limited to implied warranties of merchantability and fitness for a
+particular purpose, with respect to this code and accompanying
+documentation.
+
+Although their code does not appear in gd, the authors wish to thank
+David Koblas, David Rowley, and Hutchison Avenue Software Corporation
+for their prior contributions.
diff --git a/Build/source/texk/dvipng/dvipng-src/ChangeLog b/Build/source/texk/dvipng/dvipng-src/ChangeLog
new file mode 100644
index 00000000000..f30d538bda1
--- /dev/null
+++ b/Build/source/texk/dvipng/dvipng-src/ChangeLog
@@ -0,0 +1,1332 @@
+2020-01-05 Jan-Åke Larsson <jan-ake.larsson@liu.se>
+
+ Prepare for 1.17
+
+2019-11-29 Jan-Åke Larsson <jan-ake.larsson@liu.se>
+
+ Fix typo that cause PK files to fail
+
+2019-07-03 Jan-Åke Larsson <jan-ake.larsson@liu.se>
+
+ Fix format for gamma interactive printout. Add credit.
+
+2019-07-01 Jan-Åke Larsson <jan-ake.larsson@liu.se>
+
+ Fix segfault when starting interactive mode without DVI. Thanks to Ahzo for finding the issue.
+
+2019-06-29 Jan-Åke Larsson <jan-ake.larsson@liu.se>
+
+ Revert change for acinclude.m4, and add test for strncasecmp
+
+2019-06-27 Jan-Åke Larsson <jan-ake.larsson@liu.se>
+
+ Remove segfault for invalid color names
+
+2019-04-06 Jan-Åke Larsson <jan-ake.larsson@liu.se>
+
+ Release 1.16
+
+2019-04-06 Jan-Åke Larsson <jan-ake.larsson@liu.se>
+
+ Check for a possible integer addition overflow
+ Check bounds for mmap access
+ Update copyright notice
+
+2019-02-26 Jan-Åke Larsson <jan-ake.larsson@liu.se>
+
+ Add sentence on disabling Freetype for identical output on different platforms.
+ Amend FT2 test, move remaining local scripts to acinclude.m4, regenerate aclocal.m4
+
+2015-03-28 Jan-Åke Larsson <jan-ake.larsson@liu.se>
+
+ Add const where needed
+ Don't re-define pipe and snprintf
+ Test for and use texlive_gs_init()
+ Use WIN32 _spawnlp
+ Use char* in debug printout calculations
+ Don't use basename, ignore case, and use correct directory delimiter
+
+2015-03-05 Jan-Åke Larsson <jan-ake.larsson@liu.se>
+
+ Change libgd download address
+
+2015-03-02 Jan-Åke Larsson <jan-ake.larsson@liu.se>
+
+ Remove datarootdir configure warning, adjust distclean target
+ Remove texi2pod.pl, we only use that for building the man page
+ Remove cvs remnants
+ Adjust distclean target
+
+2015-03-01 Jan-Åke Larsson <jan-ake.larsson@liu.se>
+
+ * RELEASE: Release 1.15
+
+ * color.c, config.h.in, configure.ac, dvi.c, dvipng.h, misc.c,
+ pk.c, set.c, sfd.c, tfm.c, vf.c: Remove references to kpathsea
+ xmalloc, and enable non-GNU malloc
+
+ * dvi.c: Fix long sleep interval in --follow
+
+ * INSTALL, Makefile.in, README, config.h.in, configure.ac, draw.c,
+ dvipng.1, dvipng.c, dvipng.h, dvipng.texi, font.c, fontmap.c,
+ install.texi, miktex.h, misc.c, readme.texi, t1.c: Remove support
+ for the now dead libt1
+
+ * special.c: Use <sys/wait.h>
+
+ * color.c: Fix segfault at missing xcolor.sty
+
+ * set.c: Added check for out of memory in libgd allocate
+
+2012-09-15 Jan-Åke Larsson <jan-ake.larsson@liu.se>
+
+ * ft.c: Add warning for missing target_light hinting
+
+2012-09-15 Jan-Åke Larsson <jan-ake.larsson@liu.se>
+
+ * dvipng.c: Use return value of fgets better
+
+2010-12-17 Jan-Åke Larsson <jan-ake.larsson@liu.se>
+
+ * COPYING.gd: Inclusion of the gd copyright notice
+
+2010-12-14 Jan-Åke Larsson <jan-ake.larsson@liu.se>
+
+ * RELEASE: Spell correctly
+
+2010-12-06 Jan-Åke Larsson <jan-ake.larsson@liu.se>
+
+ * special.c: Warn when --norawps hinders output
+ * dvipng.texi: Document usage of a fallback
+ * Makefile.in: Add www directory
+
+2010-10-23 Jan-Åke Larsson <jan-ake.larsson@liu.se>
+
+ * dvipng.1, RELEASE: Prepare for 1.14
+
+2010-10-22 Jan-Åke Larsson <jan-ake.larsson@liu.se>
+
+ * configure.ac: Prepare for 1.14
+
+ * special.c: Tidy up the three different calls to gs on different
+ systems.
+
+ * dvipng.texi: Some adjustments, document handling of raw
+ PostScript
+
+2010-10-21 Jan-Åke Larsson <jan-ake.larsson@liu.se>
+
+ * special.c: Code cleanup
+
+2010-10-14 Jan-Åke Larsson <jan-ake.larsson@liu.se>
+
+ * dvipng.h (malloc): Put malloc def first
+
+ * special.c (ps2png): Ensure one and only one showpage, and do it
+ in PostScript instead of in C as suggested by Akira's previous patch
+
+2010-10-02 Peter Breitenlohner <peb@mppmu.mpg.de>
+
+ * special.c (ps2png): Drop unused 'bool showpage' for WIN32.
+
+2010-10-01 Jan-Åke Larsson <jan-ake.larsson@liu.se>
+
+ * special.c: Add heuristics to ignore non-rendering specials from
+ hyperref
+
+2010-09-30 Jan-Åke Larsson <jan-ake.larsson@liu.se>
+
+ * special.c, misc.c, dvipng.h, dvipng.texi: Add option to not try
+ converting raw PostScript
+
+2010-09-29 Jan-Åke Larsson <jan-ake.larsson@liu.se>
+
+ * special.c (ps2png): Reap zombies
+
+ * papersiz.c: Fix bug in length decoder
+
+2010-09-22 Jan-Åke Larsson <jan-ake.larsson@liu.se>
+
+ * color.c, enc.c, fontmap.c, misc.c, sfd.c: Handle CRLF correctly
+
+2010-09-20 Akira Kakuto <kakuto@fuk.kindai.ac.jp>
+
+ * special.c (ps2png): fix WIN32 bug that dvipng.exe waits
+ infinitely for some kind of eps files.
+
+2010-03-17 Jan-Ake Larsson <jalar@mai.liu.se>
+
+ * Release 1.13
+
+ * misc.c: Correct copyright year
+
+ * RELEASE: Prepare for 1.13
+
+2010-03-17 Peter Breitenlohner <peb@mppmu.mpg.de>
+
+ * configure.ac: Check for kpse_set_program_name() as used in
+ dvipng.c instead of kpse_set_progname().
+
+ Support WIN32 builds (native or MinGW32).
+ * dvipng.h (min, max): Always undefine before defining.
+ * dvi.c: For WIN32 use Sleep(1000) instead of sleeep(1).
+ * misc.c: #include <sys/mman.h> depends on HAVE_MMAP.
+ * dvipng.h, font.c, misc.c: For mmap code use '#ifdef WIN32'
+ instead of '#ifdef MIKTEX'.
+ * special.c: WIN32 specific replacement for fork and pipe, using
+ code from Akira Kakuto, (e-mail from 23 Feb 2010 23:33:58).
+
+2010-03-17 Jan-Ake Larsson <jalar@mai.liu.se>
+
+ * test_dvipng.tex: Don't use mathptmx
+
+ * color.c, dvi.c, dvipng.h, fontmap.c, misc.c, papersiz.c,
+ ppagelist.c, special.c: Avoid compiler warnings
+
+ * dvipng.texi, configure.ac: Prepare for 1.13
+
+ * draw.c, dvipng.h, set.c, vf.c: Adjust glyph-index bounds
+ test. Remove possible segfault from isprint().
+
+2010-02-11 Jan-Ake Larsson <jalar@mai.liu.se>
+
+ * color.c, draw.c, dvi.c, enc.c, font.c, fontmap.c, ft.c,
+ papersiz.c, pk.c, ppagelist.c, set.c, sfd.c, special.c, t1.c:
+ Declare functions used only in one file as static to avoid
+ warnings when compiling with 'gcc --Wmissing-prototypes',
+ suggested by Peter Breitenlohner <peb@mppmu.mpg.de>
+
+2010-01-28 Jan-Ake Larsson <jalar@mai.liu.se>
+
+ * draw.c, dvipng.h, dvipng.texi, misc.c: Add width reporting
+
+2009-04-14 Jan-Ake Larsson <jalar@mai.liu.se>
+
+ * fontmap.c: Make the thing build without FT2
+
+2009-03-28 Jan-Ake Larsson <jalar@mai.liu.se>
+
+ * config.h.in: Remove the last remnants of alloca
+
+2009-03-26 Jan-Ake Larsson <jalar@mai.liu.se>
+
+ * configure.ac, dvipng.h: Remove the last remnants of alloca
+
+ * draw.c, font.c, ft.c, pk.c, t1.c, vf.c: Make the name element of
+ the font struct a pointer, not an array
+
+ * dvi.c, ppagelist.c: Change error msg to mention malloc
+
+ * color.c, enc.c, pk.c, set.c, sfd.c, special.c, tfm.c: Don't use
+ alloca
+
+2009-03-25 Jan-Ake Larsson <jalar@mai.liu.se>
+
+ * config.h.in, configure.ac: Check for libgen.h, not libgen
+
+ * special.c: Put declarations before code
+
+ * color.c, dvipng.h, fontmap.c, ft.c, misc.c, pk.c, set.c, t1.c,
+ tfm.c: Exchange #if for #ifdef
+
+2009-02-23 Jan-Ake Larsson <jalar@mai.liu.se>
+
+ * Release 1.12
+
+ * INSTALL, README, install.texi, readme.texi, special.c: Correct
+ date for copyright
+
+ * RELEASE, configure.ac, dvipng.1, dvipng.texi: Prepare for 1.12
+
+2009-01-23 Jan-Ake Larsson <jalar@mai.liu.se>
+
+ * special.c: Keep transparent background in rescaled included
+ bitmaps
+
+2008-06-04 Jan-Ake Larsson <jalar@mai.liu.se>
+
+ * special.c: Add the color PostScript prologue
+
+2008-06-03 Jan-Ake Larsson <jalar@mai.liu.se>
+
+ * dvipng.h, special.c: Support xcolor PostScript prologue
+
+ * color.c: Support x11nam.def, fix handling of xcolor
+ multiple-model color values, and xcolor PostScript prologue
+
+2008-06-02 Jan-Ake Larsson <jalar@mai.liu.se>
+
+ * special.c: Some (most?) literal PostScript specials seem to
+ depend on tex.pro and possibly special.pro, always load these
+
+ * configure.ac: Fix gs checks
+
+ * misc.c: Correct last mmap element
+
+2008-05-27 Jan-Ake Larsson <jalar@mai.liu.se>
+
+ * readme.texi: Mention new color models in xcolor
+
+ * color.c: Adjust for new version of xcolor, mainly color prefixes
+
+2008-05-14 Jan-Ake Larsson <jalar@mai.liu.se>
+
+ * Release 1.11
+
+ * configure.ac, dvipng.1, dvipng.texi, RELEASE: Prepare for 1.11
+
+ * special.c: Fix PS inclusion regression
+
+2008-05-09 Jan-Ake Larsson <jalar@mai.liu.se>
+
+ * Release 1.10
+
+ * RELEASE: Prepare for 1.10
+
+2008-05-08 Jan-Ake Larsson <jalar@mai.liu.se>
+
+ * special.c: Add warning about DVI code in PS environment
+
+2008-05-07 Jan-Ake Larsson <jalar@mai.liu.se>
+
+ * README, readme.texi: Mention gs interpreter lib in TODO
+
+ * aclocal.m4, configure.ac: Move gs device check so that it can be
+ called from different points
+
+2008-05-05 Jan-Ake Larsson <jalar@mai.liu.se>
+
+ * draw.c, dvi.c, dvipng.h: Revert creation of dvi command struct
+
+ * draw.c, dvi.c: Init dvi command struct
+
+ * draw.c, dvi.c, dvipng.h: Create dvi command struct
+
+ * special.c: Rearrange code
+
+ * color.c, dvipng.h, enc.c, fontmap.c, misc.c, pk.c, sfd.c,
+ special.c, tfm.c, vf.c: Change name of fmmap struct element
+
+2008-04-29 Jan-Ake Larsson <jalar@mai.liu.se>
+
+ * dvipng.1: Prepare for 1.10
+
+ * configure.ac: Prepare for 1.10, check for gdImageCreateJpeg
+
+ * aclocal.m4: Cosmetic changes
+
+ * special.c: Change to HAVE_...JPEG
+
+ * dvipng.h: Remove c++ comment
+
+ * dvipng.texi: Prepare for 1.10. Use 'active' in the 'preview'
+ package, remove unused text
+
+ * Makefile.in:
+ Install dvipng.1 from the tarball, mark maintainer targets
+
+2008-02-08 Jan-Ake Larsson <jalar@mai.liu.se>
+
+ * Makefile.in, INSTALL, README, color.c, commands.h, configure.ac,
+ * draw.c, dvi.c, dvipng.1, dvipng.c, dvipng.h, dvipng.texi, enc.c,
+ * font.c, fontmap.c, ft.c, install.texi, macros.texi, miktex.h,
+ * misc.c, papersiz.c, pk.c, ppagelist.c, readme.texi, set.c, sfd.c,
+ * special.c, t1.c, test_dvipng.tex, tfm.c, vf.c, COPYING,
+ * COPYING.LESSER: Change to LGPLv3
+
+ * install.texi:
+ * README:
+ * dvipng.texi: Add blurb about MediaWiki, and cosmetic changes
+
+2008-01-10 Jan-Ake Larsson <jalar@mai.liu.se>
+
+ * set.c: Correct typo
+
+2007-12-12 Jan-Ake Larsson <jalar@mai.liu.se>
+
+ * special.c: Correct header test, add proper ps::[start] and
+ ps::[end] detection, add code to make tikz/pgf dvips (~PostScript)
+ specials work
+
+2007-10-26 Jan-Ake Larsson <jalar@mai.liu.se>
+
+ * draw.c:
+ * dvi.c:
+ * special.c: Change DVIGetCommand so that the command is
+ zero-terminated. This simplifies string operations on specials and
+ makes the length argument to SetSpecial unnecessary. Handle
+ preview-bop-hook correctly
+
+ * special.c: Simplify PostScript header and multi-special
+ handling
+
+ * color.c:
+ * draw.c:
+ * dvi.c:
+ * dvipng.h:
+ * font.c:
+ * ft.c:
+ * misc.c:
+ * set.c:
+ * special.c:
+ * t1.c: Split the flags variable into page_flags, option_flags and
+ dvi->flags
+
+ * dvi.c:
+ * dvipng.c: dvi->flags resets now when the dvi is reopened
+
+2007-08-06 Jan-Ake Larsson <jalar@mai.liu.se>
+
+ * ft.c:
+ * misc.c:
+ * t1.c:
+ * tfm.c:
+ * vf.c: Memory fixes
+
+2007-07-24 Jan-Ake Larsson <jalar@mai.liu.se>
+
+ * special.c: Fix PostScript header usage
+
+2007-07-22 Jan-Ake Larsson <jalar@mai.liu.se>
+
+ * misc.c: Change version info slightly
+
+ * ft.c: Change debug info slightly
+
+2007-07-21 Jan-Ake Larsson <jalar@mai.liu.se>
+
+ * special.c: Rewrite to allow for raw PostScript specials, also
+ use PostScript headers
+
+ * dvipng.h:
+ * dvi.c: Add read-ahead for PostScript specials
+
+ * config.h.in:
+ * configure.ac: Add test for gd pointer->image conversion
+
+2007-03-19 Jan-Ake Larsson <jalar@mai.liu.se>
+
+ * draw.c: Better handling of glyph index bounds
+
+ * set.c: Check bounds for glyph index
+
+2006-12-11 Jan-Ake Larsson <jalar@mai.liu.se>
+
+ * readme.texi: Fix TODO, mention MediaWiki
+
+ * dvipng.h: Fix for alloca under AIX
+
+ * Makefile.in: mkinstalldirs is in $(srcdir)
+
+2006-11-11 Jan-Ake Larsson <jalar@mai.liu.se>
+
+ * Release 1.9
+
+ * INSTALL:
+ * README: Update for 1.9
+
+ * Makefile.in: Make the test fail if fonts not found
+
+ * configure.ac: Don't use "which". Add info about the selfauto
+ stuff. Report if CJK support present
+
+ * test_dvipng.tex: Remove the (intentional) failing special
+
+2006-11-07 Jan-Ake Larsson <jalar@mai.liu.se>
+
+ * fontmap.c: Don't warn if ttfonts.map is missing, fix pointer
+
+ * Makefile.in: Adjust manpage target so manual intervention isn't
+ needed anymore
+
+ * dvipng.1: Update manpage
+
+ * dvipng.texi: Update for 1.9
+
+ * COPYING, Makefile.in, color.c, commands.h, configure.ac, draw.c,
+ dvi.c, dvipng.c, dvipng.h, dvipng.texi, enc.c, font.c, fontmap.c,
+ ft.c, macros.texi, miktex.h, miktex.mak, misc.c, papersiz.c, pk.c,
+ ppagelist.c, set.c, sfd.c, special.c, t1.c, test_dvipng.tex,
+ tfm.c, vf.c: Update FSF address
+
+ * fontmap.c: Add ttfonts.map to the searched font maps
+
+ * RELEASE: Prepare for 1.9
+
+2006-11-02 Jan-Ake Larsson <jalar@mai.liu.se>
+
+ * dvipng.texi: Nitpicking on bitmapped graphics
+
+2006-10-13 Jan-Ake Larsson <jalar@mai.liu.se>
+
+ * readme.texi: Add note about subfont (CJK) support
+
+ * install.texi: Add that FreeType2 is needed for subfont (CJK) support
+
+2006-10-12 Jan-Ake Larsson <jalar@mai.liu.se>
+
+ * readme.texi: Fix todo
+
+2006-10-11 Jan-Ake Larsson <jalar@mai.liu.se>
+
+ * sfd.c: Change && to || so that multiple subfonts work
+
+ * ft.c: Adjust debug output
+
+ * configure.ac: Add sfd.o
+
+2006-10-04 Jan-Ake Larsson <jalar@mai.liu.se>
+
+ * configure.ac: Prepare for 1.9
+
+ * sfd.c: Only look for subfont file on recent kpathsea
+
+ * dvipng.c, ft.c, fontmap.c, dvipng.h: Prepare for subfonts (CJK)
+
+ * sfd.c: Added. Used for subfonts (CJK)
+
+ * configure.ac: Change wording of gs helptext
+
+ * ft.c: Adjust debug message, and encoding selection
+
+ * special.c: Adjust debug messages
+
+ * dvipng.texi: Document the --strict option
+
+ * dvipng.c: Fix timer
+
+ * Makefile.in: Add dist target, simplify distclean
+
+ * fontmap.c: Remove segfault occuring for non-existent font
+
+2006-08-08 Jan-Ake Larsson <jalar@mai.liu.se>
+
+ * special.c: Make showpage flag static
+
+ * special.c:
+ Fix bug with -dSAFER and non-. paths, and bug with pngalpha and
+ background color
+
+2006-05-17 Jan-Ake Larsson <jalar@mai.liu.se>
+
+ * fontmap.c: Rearrange, simplify, speed up
+
+2006-05-16 Jan-Ake Larsson <jalar@mai.liu.se>
+
+ * ft.c: FT_LOAD_TARGET_LIGHT does not work in some cases, fall
+ back to FT_LOAD_NO_HINTING
+
+2006-05-08 Jan-Ake Larsson <jalar@mai.liu.se>
+
+ * dvipng.texi: Add credit
+
+ * Makefile.in: add www target
+
+ * README:
+ * readme.texi: Update capabilities info and preview-latex link
+
+2006-03-30 Jan-Ake Larsson <jalar@mai.liu.se>
+
+ * Release 1.8
+
+ * RELEASE: Update for 1.8
+
+ * set.c:
+ * readme.texi:
+ * install.texi:
+ * ft.c:
+ * dvi.c:
+ * draw.c:
+ * README:
+ * INSTALL: Update copyright
+
+2006-03-29 Jan-Ake Larsson <jalar@mai.liu.se>
+
+ * dvipng.1:
+ * dvipng.texi: Document new switch, new PostScript inclusion,
+ rearrange and adjust
+
+ * misc.c:
+ * INSTALL:
+ * README:
+ * install.texi:
+ * readme.texi: Minimal documentation adjustments
+
+2006-03-27 Jan-Ake Larsson <jalar@mai.liu.se>
+
+ * ft.c: Change to FT_LOAD_TARGET_LIGHT
+
+ * draw.c: Fix segfault in debug mode
+
+ * aclocal.m4: Make sure the kpse_enc_format test fails for the
+ right reason only
+
+2006-02-27 Jan-Ake Larsson <jalar@mai.liu.se>
+
+ * special.c: Use gs' pngalpha device, render without clipping,
+ adjust image position
+
+ * set.c: Simplify code, make color cache (page-)persistent
+
+ * draw.c: Reset new flag
+
+ * misc.c: New switch, remove some old switches from fast-help, use
+ new flag name
+
+ * dvipng.h: New flags
+
+ * configure.ac:
+ * config.h.in: Simplify gd tests
+
+ * configure.ac:
+ * aclocal.m4: Check gs devices
+
+2006-02-10 Jan-Ake Larsson <jalar@mai.liu.se>
+
+ * special.c: Use execlp for gs call
+
+2006-02-03 Jan-Ake Larsson <jalar@mai.liu.se>
+ * special.c:
+ Revert message about file type, debug information is enough
+
+ * special.c: Warn for nonexistent image decoder
+
+2006-02-01 Jan-Ake Larsson <jalar@mai.liu.se>
+
+ * special.c: Warn with file type when unable to load included image
+
+ * special.c: Read the first byte of file to be included and
+ compare with magic number
+
+2006-01-31 Jan-Ake Larsson <jalar@mai.liu.se>
+
+ * special.c: Temporary version, just try the different image
+ decoders and see
+
+ * special.c: Use correct variables
+
+2006-01-29 Jan-Ake Larsson <jalar@mai.liu.se>
+
+ * special.c: Add code to check image access permission
+
+2006-01-28 Jan-Ake Larsson <jalar@mai.liu.se>
+
+ * special.c: Simplify some code
+
+ * papersiz.c: Fix rounding error for length calculation
+
+2006-01-26 Jan-Ake Larsson <jalar@mai.liu.se>
+
+ * color.c: Fix typo that gave a segfault
+
+ * config.h.in: Remove unneeded function check
+
+ * configure.ac: Update for 1.8, remove unneeded function check
+
+ * dvipng.h: Switch debug numbers to coincide with the manual
+
+ * misc.c: Remove isdigit
+
+ * special.c: Add code to include PNG, JPEG and GIF images
+
+2006-01-12 Jan-Ake Larsson <jalar@mai.liu.se>
+
+ * special.c: Add a space in message
+
+ * misc.c: Do more tests for numeric-parameter options
+
+ * dvi.c: Outfilename: only remove .dvi extension, not others
+
+2005-10-11 Jan-Ake Larsson <jalar@mai.liu.se>
+
+ * Release 1.7
+
+ * INSTALL: Typographic changes
+
+ * README:
+ * RELEASE:
+ * configure.ac:
+ * dvipng.1:
+ * dvipng.texi: Adjust for 1.7
+
+ * install.texi: Insert space
+
+ * miktex.h: Adjust for 1.7, I am uncertain which of the new calls
+ are available in the MIKTeX environment
+
+ * readme.texi: Remove reference to my old laptop
+
+2005-09-30 Jan-Ake Larsson <jalar@mai.liu.se>
+
+ * config.h.in, configure.ac, ft.c:
+ Only use FT_Library_Version if available
+
+2005-07-05 jalar <jalar@mai.liu.se>
+
+ * Makefile.in: Enable srcdir != builddir
+
+2005-07-04 jalar <jalar@mai.liu.se>
+
+ * font.c: Add length check for font name
+
+2005-06-28 Jan-Ake Larsson <jalar@mai.liu.se>
+
+ * special.c: Read preview-latex version
+
+2005-06-27 Jan-Ake Larsson <jalar@mai.liu.se>
+
+ * Release 1.6
+
+ * RELEASE: Report what fixes have been done
+
+ * dvipng.texi: Document xcolor adaptations
+
+ * misc.c: Add 'Transparent' in the quick-help
+
+ * special.c: Cosmetics, do a _small_ message for bop-hook redef
+
+2005-06-16 Jan-Ake Larsson <jalar@mai.liu.se>
+
+ * dvipng.h:
+ * dvipng.c:
+ * color.c: Revamp colorname interpreter for xcolor
+
+2005-06-14 Jan-Ake Larsson <jalar@mai.liu.se>
+
+ * misc.c: Adjust MIKTeX stuff
+
+2005-06-13 Jan-Ake Larsson <jalar@mai.liu.se>
+
+ * color.c: Don't use strtok, adjust for xcolor
+
+ * special.c: Don't use strtok
+
+2005-04-25 Jan-Ake Larsson <jalar@mai.liu.se>
+
+ * config.h.in:
+ * configure.ac:
+ * set.c: Don't do alpha blending in truecolor mode, write alpha
+ channel to file
+
+2005-04-20 Jan-Ake Larsson <jalar@mai.liu.se>
+
+ * dvipng.texi: Add Credits
+
+2005-04-19 Jan-Ake Larsson <jalar@mai.liu.se>
+
+ * dvipng.h: Fix for sys/types.h conflict in old IRIX systems
+
+ * special.c: Adjust tightpage test
+
+2005-04-04 Jan-Ake Larsson <jalar@mai.liu.se>
+
+ * special.c: Make tightpage option backwards compatible
+
+ * RELEASE: Prepare for 1.6
+
+ * dvipng.1: Regenerate man page
+
+ * configure.ac:
+ * dvipng.texi:
+ * miktex.h: Update version info
+
+ * configure.ac:
+ * dvipng.texi:
+ * README:
+ * readme.texi: Update mailing list address
+
+ * configure.ac:
+ * config.h.in:
+ * special.c: Simplify string search
+
+2005-04-03 Jan-Ake Larsson <jalar@mai.liu.se>
+
+ * special.c: Try to detect all preview-latex versions tightpage
+ code
+
+2005-03-02 Jan-Ake Larsson <jalar@mai.liu.se>
+
+ * set.c: Remove extra debug printout
+
+ * t1.c: Sizes are given in big points in T1lib, in TeX points in
+ DVI files
+
+ * ft.c: Sizes are given in big points in FreeType, in TeX points
+ in DVI files
+
+ * dvipng.h: Fix boolean type again
+
+2005-02-10 Jan-Ake Larsson <jalar@mai.liu.se>
+
+ * config.h.in:
+ * configure.ac:
+ * dvipng.texi:
+ * dvipng.h:
+ * misc.c:
+ * set.c: Add proper alpha channel
+
+2005-02-04 Jan-Ake Larsson <jalar@mai.liu.se>
+
+ * color.c:
+ * draw.c:
+ * dvi.c:
+ * dvipng.c:
+ * font.c:
+ * ft.c:
+ * misc.c:
+ * papersiz.c:
+ * pk.c:
+ * set.c:
+ * special.c:
+ * t1.c:
+ * tfm.c:
+ * vf.c: Cosmetic changes to warnings and fatals
+
+ * Release 1.5
+
+ * RELEASE: Prepare for 1.5
+
+ * INSTALL:
+ * Makefile.in:
+ * README:
+ * color.c:
+ * commands.h:
+ * configure.ac:
+ * draw.c:
+ * dvi.c:
+ * dvipng.1:
+ * dvipng.c:
+ * dvipng.h:
+ * dvipng.texi:
+ * enc.c:
+ * font.c:
+ * fontmap.c:
+ * ft.c:
+ * install.texi:
+ * macros.texi:
+ * miktex.h:
+ * misc.c:
+ * papersiz.c:
+ * pk.c:
+ * ppagelist.c:
+ * readme.texi:
+ * set.c:
+ * special.c:
+ * t1.c:
+ * test_dvipng.tex:
+ * tfm.c:
+ * vf.c: Update Copyright, set version 1.5
+
+2005-02-03 Jan-Ake Larsson <jalar@mai.liu.se>
+
+ * draw.c:
+ * dvipng.h:
+ * set.c: Fix bug in --picky mode
+
+2005-01-27 Jan-Ake Larsson <jalar@mai.liu.se>
+
+ * dvipng.c: Restore --mfmode and --bdpi functionality
+
+2005-01-25 Jan-Ake Larsson <jalar@mai.liu.se>
+
+ * color.c: Fix segfault when trying to find nonexisting dvipsnam
+ color
+
+ * dvipng.c: Make dvipsnam colors available on command line
+
+2004-12-10 Jan-Ake Larsson <jalar@mai.liu.se>
+
+ * Release 1.4
+
+ * RELEASE:
+ * configure.ac:
+ * dvipng.1:
+ * dvipng.texi: Set version 1.4
+
+ * README: Fix formatting
+
+ * misc.c: Use mmap test. Hopefully, it will fail on ULTRIX, mmap
+ only works on character special devices (and not on regular files)
+
+2004-12-02 Jan-Ake Larsson <jalar@mai.liu.se>
+
+ * config.h.in:
+ * configure.ac:
+ * dvipng.h: Move int64_t and uint64_t tests entirely to autoconf
+
+ * dvi.c: Fix signedness
+
+2004-11-30 Jan-Ake Larsson <jalar@mai.liu.se>
+
+ * misc.c: Fix NULL dereference.
+
+2004-11-25 Jan-Ake Larsson <jalar@mai.liu.se>
+
+ * Release 1.3
+
+ * Makefile.in, README, dvipng.1, readme.texi: Fix dvigif
+ installation and docs
+
+ * INSTALL:
+ * README: Add license
+
+ * dvipng.c: Remove duplicate copyright
+
+ * config.h.in:
+ * configure.ac: Add some tests
+
+ * dvipng.1:
+ * dvipng.texi: Add some minor things
+
+2004-11-24 Jan-Ake Larsson <jalar@mai.liu.se>
+
+ * config.h.in:
+ * configure.ac: Test for 64-bit types.
+
+ * dvipng.h: Use char* arithmetic, not void*. And enable use of
+ gcc -ansi -pedantic.
+
+ * special.c: Don't use C++ comments.
+
+ * papersiz.c: Rewrite
+
+ * draw.c:
+ * dvi.c:
+ * font.c:
+ * ft.c:
+ * misc.c:
+ * pk.c:
+ * tfm.c:
+ * vf.c: Fix signedness
+
+2004-11-15 Reiner Steib <Reiner.Steib@gmx.de>
+
+ * draw.c, dvipng.c, enc.c, font.c, ft.c, pk.c, special.c, t1.c:
+ Don't use C++ comments.
+
+2004-11-05 David Kastrup <dakas@users.sourceforge.net>
+
+ * Makefile.in (install-dvigif): Don't fail if dvigif already
+ exists.
+
+2004-11-02 Jan-Åke Larsson <jalar@mai.liu.se>
+
+ * dvipng.h: Fix boolean type
+
+2004-11-01 Jan-Åke Larsson <jalar@mai.liu.se>
+
+ * RELEASE: Update for 1.3
+
+ * dvipng.h: Load alloca.h when available
+
+ * font.c:
+ * fontmap.c: Remove inline
+
+ * Makefile.in:
+ * commands.h:
+ * config.h.in:
+ * configure.ac:
+ * install.texi:
+ * macros.texi:
+ * miktex.h:
+ * readme.texi:
+ * test_dvipng.tex: Add copyright notice
+
+ * color.c:
+ * draw.c:
+ * dvi.c:
+ * dvipng.c:
+ * dvipng.h:
+ * enc.c:
+ * font.c:
+ * fontmap.c:
+ * ft.c:
+ * misc.c:
+ * papersiz.c:
+ * pk.c:
+ * ppagelist.c:
+ * set.c:
+ * special.c:
+ * t1.c:
+ * tfm.c:
+ * vf.c: Change c-in-a-circle to (C)
+
+2004-10-27 Jan-Åke Larsson <jalar@mai.liu.se>
+
+ * dvipng.1:
+ * dvipng.texi: Amend docs
+
+ * misc.c: Amend helptext
+
+2004-10-26 Jan-Åke Larsson <jalar@mai.liu.se>
+
+ * set.c:
+ * misc.c:
+ * dvipng.h: Change background transparency
+
+ * configure.ac: Bump version, add test for libz
+
+2004-10-07 Jan-Åke Larsson <jalar@mai.liu.se>
+
+ * dvipng.texi: document change in -o switch
+
+2004-10-06 Jan-Åke Larsson <jalar@mai.liu.se>
+
+ * set.c: Allow longer pagenumbers in output file (e.g., %06d)
+
+2004-08-18 Jan-Åke Larsson <jalar@mai.liu.se>
+
+ * Release 1.2
+
+ * RELEASE: Change for 1.2
+
+ * config.h.in: Update
+
+ * dvipng.1: change help text
+
+ * dvipng.texi: update mailing list text. And version.
+
+ * README:
+ * readme.texi: update info and todo list
+
+ * draw.c, misc.c, dvipng.c, dvipng.h:
+ Add an intermediate exit status
+
+2004-08-17 Jan-Åke Larsson <jalar@mai.liu.se>
+
+ * misc.c: add --gamma switch
+
+ * special.c: Fix comment
+
+ * set.c:
+ * dvipng.h: new Gamma function
+
+ * configure.ac: libm is needed by new gamma code
+
+ * dvipng.1:
+ * dvipng.texi: document new switches
+
+ * draw.c: change name of picky flag
+
+ * special.c: do not call ghostscript when switch given
+
+ * misc.c: add picky and ghostscript switches
+
+ * dvipng.h: add picky and ghostscript flags
+
+2004-08-06 Jan-Åke Larsson <jalar@mai.liu.se>
+
+ * dvipng.texi: Document --png, --gif, and --picky
+
+ * .cvsignore: Add *.gif
+
+ * Makefile.in: Install 'dvigif' if we have GIF support
+
+ * configure.ac: Test for gdImageGif and 'ln -s'
+
+ * config.h.in: GIF support
+
+ * set.c: GIF writing
+
+ * misc.c: basename fixes, --png and --gif fixes,
+ --no-image-on-warn changes name to --picky
+
+ * dvi.c: basename fixes
+
+ * dvipng.h: Portability fixes, add GIF image flag
+
+2004-08-02 Jan-Åke Larsson <jalar@mai.liu.se>
+
+ * draw.c: Fix behaviour of --no-image-on-warn
+
+2004-07-01 Jan-Åke Larsson <jalar@mai.liu.se>
+
+ * miktex.mak: New, for MIKTeX
+
+ * dvi.c:
+ * dvipng.c:
+ * dvipng.h:
+ * special.c: Adjust for MIKTeX
+
+ * color.c:
+ * enc.c:
+ * font.c:
+ * fontmap.c:
+ * misc.c:
+ * pk.c:
+ * tfm.c:
+ * vf.c: Move file-mmapping to misc.c, adjust it for MIKTeX
+
+2004-06-29 Jan-Åke Larsson <jalar@mai.liu.se>
+
+ * configure.ac:
+ * dvipng.h: inttypes.h not available on all platforms
+
+ * special.c: Remove snprintf, not available on certain platforms
+
+2004-06-27 Jan-Åke Larsson <jalar@mai.liu.se>
+
+ * dvipng.c: Fix case of missing font libs
+
+ * fontmap.c: Remove debug printf
+
+ * draw.c: Fix for case of absent font lib(s), correct typo
+
+2004-06-24 Jan-Åke Larsson <jalar@mai.liu.se>
+
+ * fontmap.c:
+ * pk.c:
+ * vf.c: More memory fixes
+
+2004-06-21 Jan-Åke Larsson <jalar@mai.liu.se>
+
+ * config.h.in:
+ * configure.ac: Test for stdbool, munmap and strtol
+
+ * test_dvipng.tex: Change color test
+
+ * dvipng.h:
+ * misc.c:
+ * ppagelist.c: Fix -r switch
+
+ * dvipng.h:
+ * font.c:
+ * misc.c:
+ * ppagelist.c:
+ * special.c:
+ * t1.c:
+ * tfm.c: Use stdbool
+
+ * color.c:
+ * dvi.c:
+ * dvipng.c:
+ * dvipng.h:
+ * enc.c:
+ * font.c:
+ * fontmap.c:
+ * ppagelist.c:
+ * special.c: Fix memory leak(s)
+
+ * color.c:
+ * draw.c:
+ * dvi.c:
+ * dvipng.h:
+ * misc.c:
+ * set.c:
+ * special.c: Fix color stack
+
+ * draw.c:
+ * dvipng.h:
+ * ft.c:
+ * pk.c:
+ * set.c:
+ * t1.c:
+ * tfm.c:
+ * vf.c: Simplify char structs
+
+ * color.c:
+ * draw.c:
+ * dvi.c:
+ * dvipng.c:
+ * dvipng.h:
+ * enc.c:
+ * font.c:
+ * fontmap.c:
+ * ft.c:
+ * misc.c:
+ * papersiz.c:
+ * pk.c:
+ * ppagelist.c:
+ * set.c:
+ * special.c:
+ * t1.c:
+ * tfm.c:
+ * vf.c: Add copyright notice
+
+2004-05-31 Jan-Åke Larsson <jalar@mai.liu.se>
+
+ * dvipng.1:
+ * configure.ac:
+ * RELEASE:
+ * INSTALL: Release 1.1
+
+2004-05-26 Jan-Åke Larsson <jalar@mai.liu.se>
+
+ * special.c: Handle source specials
+
+ * test_dvipng.tex: Add failing special and color test
+
+ * dvipng.c: Adjust coment about SELFAUTO...
+
+ * dvi.c: Fix possible overflow
+
+2004-05-24 Jan-Åke Larsson <jalar@mai.liu.se>
+
+ * misc.c: Remove -t, it is not implemented yet
+
+ * dvipng.h: Undef malloc, if defined
+
+2004-05-18 Jan-Åke Larsson <jalar@mai.liu.se>
+
+ * dvipng.texi: Fix build
+
+2004-05-14 Jan-Åke Larsson <jalar@mai.liu.se>
+
+ * config.h.in: Use more tests
+
+ * dvipng.1: Add documentation
+
+ * dvipng.texi: Fix build. Revert to four-argument @node, my
+ makeinfo cannot handle the one-argument form (yet).
+
+2004-05-11 Jan-Åke Larsson <jalar@mai.liu.se>
+
+ * configure.ac: More tests
+
+2004-05-09 Jan-Åke Larsson <jalar@mai.liu.se>
+
+ * install.texi: T1lib docs
+
+ * dvipng.1:
+ * dvipng.texi: Add documentation, and spellcheck
+
+ * special.c:
+ * color.c: Make colors work again.
+
+2004-05-08 David Kastrup <dakas@users.sourceforge.net>
+
+ * Create new ChangeLog for dvipng
+
+2004-05-05 Jan-Åke Larsson <jalar@mai.liu.se>
+
+ * fontmap.c: Use both kpse_fontmap_format and
+ _dvips_header_
+
+ * enc.c: Use configure test
+
+ * configure.ac: Add test for kpse_enc_format, reorder gd
+ and png tests
+
+ * aclocal.m4: Add test for kpse_enc_format
+
+ * special.c: More informative warnings
+
+2004-05-04 Jan-Åke Larsson <jalar@mai.liu.se>
+
+ * enc.c:
+ Use the new kpathsea search format kpse_enc_format if available,
+ otherwise use kpse_tex_ps_header_format
+
+ * fontmap.c:
+ Fix new kpathsea search type kpse_fontmap_format, use
+ kpse_dvips_config_format if not available
+
+ * ft.c: Fix sizing
+
+ * draw.c: Simplify LoadT1 call
+
+ * t1.c: Shorten call, fix sizing
+
+ * dvipng.h: Simplify char-storing structure
+
+2004-05-03 Jan-Åke Larsson <jalar@mai.liu.se>
+
+ * fontmap.c, font.c, t1.c, ft.c:
+ Fix for ps fonts not in psfontmap
+
+2004-05-02 Jan-Åke Larsson <jalar@mai.liu.se>
+
+ * Makefile.in:
+ * config.h.in:
+ * configure.ac:
+ * draw.c:
+ * dvipng.c:
+ * dvipng.h:
+ * enc.c:
+ * font.c:
+ * fontmap.c:
+ * ft.c:
+ * t1.c:
+ * misc.c: Add t1lib support
+
+2004-04-05 Jan-Åke Larsson <jalar@mai.liu.se>
+
+ * dvipng.1:
+ * readme.texi:
+ * dvipng.texi:
+ * Makefile.in: Add man page
+
+2004-03-27 Jan-Åke Larsson <jalar@mai.liu.se>
+
+ * dvipng.texi: Fix debug documentations
+
+ * dvipng.c: Dont fail on --mode without --bdpi, output a warning.
+
+2004-03-26 Jan-Åke Larsson <jalar@mai.liu.se>
+
+ * papersiz.c: Remove compiler warning
+
+ * dvipng.texi:
+ * misc.c: Change year
+
+2004-03-25 Jan-Åke Larsson <jalar@mai.liu.se>
+
+ * special.c: Revert change, not only resolution but also
+ offset is needed when generating png from ps
+
+ * misc.c: Change helptext
+
+ * configure.ac: Change version number
+
+ * README: Checkin updated README
+
+ * pk.c:
+ * ft.c: Speed up color cache
+
+ * dvipng.texi: Add info on resolution, change version number
+
+2004-03-24 Jan-Åke Larsson <jalar@mai.liu.se>
+
+ * special.c: Fix missing 'showpage' and a memory leak
+
+ * font.c: Adjust error message
+
+ * dvipng.h:
+ * ft.c:
+ * pk.c: Change ink darkness map
+
+ * draw.c: Output page numbers more often. If the user has a
+ slow terminal he's to blame himself, not me.
+
+ * tfm.c: Include alloca.h if present
+
+2004-03-23 Jan-Åke Larsson <jalar@mai.liu.se>
+
+ * dvipng.texi: Adjust for the new -D option
+
+2004-03-19 dakas <dakas@users.sourceforge.net>
+
+ * RELEASE: Remove spurious blanks.
+
+2004-03-19 Jan-Åke Larsson <jalar@mai.liu.se>
+
+ * RELEASE: Update, shorten
+
+2004-03-18 Jan-Åke Larsson <jalar@mai.liu.se>
+
+ * RELEASE:
+ * dvi.c:
+ * dvipng.c:
+ * dvipng.h:
+ * font.c:
+ * misc.c:
+ * papersiz.c:
+ * special.c: Change the behaviour of the -D switch
+
+2004-03-08 Jan-Åke Larsson <jalar@mai.liu.se>
+
+ * font.c: Don't retry on PK generation failure
+
+2004-03-02 David Kastrup <dakas@users.sourceforge.net>
+
+ * dvi.c (DVIOpen): Fix a buffer overrun error.
diff --git a/Build/source/texk/dvipng/dvipng-src/ChangeLog.0 b/Build/source/texk/dvipng/dvipng-src/ChangeLog.0
new file mode 100644
index 00000000000..3c4689ad8c4
--- /dev/null
+++ b/Build/source/texk/dvipng/dvipng-src/ChangeLog.0
@@ -0,0 +1,903 @@
+2004-01-16 Jan-Åke Larsson <jalar@mai.liu.se>
+
+ * font.c: fix compile without FT2
+
+2004-01-12 Jan-Ake Larsson <jalar@mai.liu.se>
+
+ * RELEASE: Prepare for 0.9
+
+ * misc.c: Enable --expand-bbox
+
+ * color.c:
+ * draw.c:
+ * dvipng.h:
+ * font.c:
+ * misc.c:
+ * special.c: Enable --no-image-on-warn
+
+ * draw.c:
+ * dvi.c:
+ * dvipng.c:
+ * dvipng.h:
+ * readme.texi:
+ * special.c: Fix tightpage behaviour
+
+2004-01-09 Jan-Ake Larsson <jalar@mai.liu.se>
+
+ * special.c: Add preview-latex's "tightpage" code
+
+2004-01-08 Jan-Ake Larsson <jalar@mai.liu.se>
+
+ * dvipng.texi:
+ * configure.ac: Prepare for 0.9
+
+ * Makefile.in: clean target
+
+2004-01-07 Jan-Ake Larsson <jalar@mai.liu.se>
+
+ * color.c:
+ * draw.c:
+ * dvi.c:
+ * dvipng.c:
+ * dvipng.h:
+ * enc.c:
+ * font.c:
+ * fontmap.c:
+ * ft.c:
+ * pk.c:
+ * set.c:
+ * special.c:
+ * tfm.c:
+ * vf.c: Speedup DEBUG
+
+ * pk.c: Fix subpixel offsets
+
+ * dvipng.c:
+ * dvipng.h:
+ * font.c:
+ * misc.c:
+ * set.c:
+ * special.c: Fix flags
+
+ * draw.c: Fix bbox
+
+ * dvipng.h: Adjust for freetype >= 2.1.6
+
+2003-12-15 Jan-Ake Larsson <jalar@mai.liu.se>
+
+ * tfm.c:
+ * fontmap.c:
+ * font.c: Fix freeeeeeeeeing
+
+2003-12-08 Jan-Ake Larsson <jalar@mai.liu.se>
+
+ * dvipng.texi:
+ * configure.ac:
+ * RELEASE: Prepare for 0.8
+
+ * ft.c: Fix debug output
+
+ * draw.c:
+ * dvipng.h:
+ * dvipng.texi:
+ * misc.c: Add --height option
+
+ * test_dvipng.tex: A nice equation is true. Behave!
+
+2003-12-07 Jan-Ake Larsson <jalar@mai.liu.se>
+
+ * enc.c: Encodings are _ps_header_s
+
+2003-12-05 Jan-Åke Larsson <jalar@mai.liu.se>
+
+ * misc.c:
+ * dvipng.texi:
+ * dvipng.h:
+ * draw.c: Change --baseline to --depth
+
+2003-12-01 Jan-Ake Larsson <jalar@mai.liu.se>
+
+ * draw.c:
+ * dvipng.h:
+ * misc.c: Change to physical pagenumbers, instead of DVI
+ pagenumbers. DVI pagenumbers will be indicated on STDOUT if they
+ differ from physical pagenumbers, but the numbering of PNG files
+ is physical pagenumbers. Old behaviour can be chosen with the
+ option -dvinum.
+
+ * ppagelist.c:
+ * misc.c:
+ * dvipng.texi: Make negative pages render. Now -pp handles
+ negative pages gracefully too. Remove -pp code taken from dvips.
+
+2003-11-30 Jan-Ake Larsson <jalar@mai.liu.se>
+
+ * draw.c:
+ * dvipng.c:
+ * dvipng.h:
+ * font.c:
+ * ft.c:
+ * misc.c:
+ * pk.c:
+ * set.c:
+ * tfm.c:
+ * vf.c: Include alloca.h when necessary, start preparing
+ transition to subpixel rendering, do proper cleanup on exit
+
+2003-11-18 Jan-Åke Larsson <jalar@mai.liu.se>
+
+ * enc.c: Fix bug
+
+ * ft.c:
+ * tfm.c:
+ * font.c:
+ * dvipng.h: Add fallback from FT to PK
+
+2003-11-14 Jan-Åke Larsson <jalar@mai.liu.se>
+
+ * Makefile.in: Use $DESTDIR
+
+2003-11-06 Jan-Åke Larsson <jalar@mai.liu.se>
+
+ * special.c: Fix postscript inclusion: placement and
+ background color
+
+2003-10-17 Jan-Åke Larsson <jalar@mai.liu.se>
+
+ * misc.c:
+ * font.c:
+ * dvipng.texi:
+ * dvipng.h: Add option for freetype activation
+
+ * configure.ac: Add message when freetype is present
+
+ * ft.c: Apparently FreeType hinting is a no-no. Load glyphs
+ with FT_LOAD_NO_HINTING. Only then output is acceptable.
+
+2003-10-15 Jan-Åke Larsson <jalar@mai.liu.se>
+
+ * fontmap.c: Remove erroneous match
+
+2003-10-13 Jan-Åke Larsson <jalar@mai.liu.se>
+
+ * font.c: Fix font searching order
+
+ * RELEASE: Prepare for 0.7
+
+ * fontmap.c:
+ * psfontmap.c:
+ * configure.ac: Rename psfontmap.c to fontmap.c
+
+2003-10-08 Jan-Ake Larsson <jalar@mai.liu.se>
+
+ * psfontmap.c: Add third bare word: encoding
+
+2003-10-07 Jan-Ake Larsson <jalar@mai.liu.se>
+
+ * misc.c:
+ * dvipng.texi: Allow for -- on options
+
+ * configure.ac: Prepare for 0.7
+
+ * Makefile.in: Adjust hint
+
+ * configure.ac:
+ * config.h.in: Fix helptext in config.h.in
+
+ * test_dvipng.tex: Add some tests for ligatures and sizes
+
+2003-10-03 Jan-Åke Larsson <jalar@mai.liu.se>
+
+ * readme.texi: Document new font support and switches
+
+ * psfontmap.c: Redesign psfontmap loading to use the syntax
+ from dvips' docs
+
+ * font.c: Enhance TrueType font finding
+
+ * draw.c: Warn if setting char from null font
+
+ * dvipng.h:
+ * color.c: Load and use psnames.def
+
+2003-09-28 Jan-Ake Larsson <jalar@mai.liu.se>
+
+ * misc.c: Warn for all bad options
+
+2003-09-24 Jan-Ake Larsson <jalar@mai.liu.se>
+
+ * dvipng.texi:
+ * install.texi:
+ * misc.c: Fix documentation
+
+2003-09-23 Jan-Ake Larsson <jalar@mai.liu.se>
+
+ * ft.c:
+ * enc.c:
+ * dvipng.h: Only load encodings once
+
+2003-09-18 Jan-Åke Larsson <jalar@mai.liu.se>
+
+ * draw.c:
+ * dvipng.h:
+ * misc.c: Add -baseline switch
+
+2003-09-17 Jan-Ake Larsson <jalar@mai.liu.se>
+
+ * font.c: Remove compiler warning
+
+ * config.h.in:
+ * psfontmap.c:
+ * dvipng.c:
+ * configure.ac: Fix SELFAUTO... variables if dvipng is not
+ being installed in main texmf tree. This will make it find config
+ files and fonts anyway.
+
+2003-09-16 Jan-Ake Larsson <jalar@mai.liu.se>
+
+ * tfm.c:
+ * psfontmap.c:
+ * ft.c:
+ * enc.c: Added for postscript font handling with freetype
+
+ * font.c: Use freetype font loading
+
+ * dvipng.h: Add freetype-related types and declarations,
+ and simplify glyph rendering
+
+ * pk.c: Simplify glyph rendering
+
+ * dvipng.c: Init freetype
+
+ * dvi.c: Fix strlen bugs
+
+ * draw.c: Add FONT_TYPE_FT drawing
+
+ * configure.ac:
+ * config.h.in:
+ * Makefile.in: Adjust for freetype things
+
+2003-08-29 Jan-Åke Larsson <jalar@mai.liu.se>
+
+ * special.c: fix color handling
+
+ * dvipng.c: Increase TIMING output
+
+ * misc.c:
+ * draw.c: small speedups
+
+ * dvipng.h:
+ * configure.ac:
+ * config.h.in:
+ * Makefile.in: Change handling of the DEBUG and TIMING
+ flags
+
+2003-08-26 Jan-Åke Larsson <jalar@mai.liu.se>
+
+ * RELEASE, dvipng.texi, configure.ac:
+ prepare for 0.6
+
+ * Makefile.in: another install-docs fix
+
+2003-08-13 Jan-Åke Larsson <jalar@mai.liu.se>
+
+ * configure.ac: new test (ps inclusion speedup)
+
+ * draw.c: simplify preprocessor processing, fix SetSpecial
+ call
+
+ * special.c: speedup for ps image inclusion, fix SetSpecial
+ call
+
+ * Makefile.in: fix install-docs
+
+2003-08-04 Jan-Åke Larsson <jalar@mai.liu.se>
+
+ * special.c: Argh!, fix compilation for non-truecolor version
+
+ * dvipng.h: Argh!, fix image cache
+
+ * dvipng.texi:
+ * configure.ac:
+ * RELEASE: Prepare for 0.5
+
+ * misc.c:
+ * dvipng.h:
+ * set.c: Add preliminary truecolor support
+
+ * pk.c: Benchmark truecolor rendering, no real code change
+
+ * special.c:
+ * misc.c:
+ * dvipng.h: Add preliminary image cacheing
+
+ * draw.c: Small adjustments
+
+2003-07-30 Jan-Åke Larsson <jalar@mai.liu.se>
+
+ * draw.c: Fix two bugs so that bounding box again is
+ correct
+
+ * configure.ac: configuration printout improved
+
+
+2003-07-02 Jan-Åke Larsson <jalar@mai.liu.se>
+
+ * dvipng.h: Add prototypes
+
+ * draw.c: minor change
+
+ * RELEASE: prepare for 0.4
+
+2003-07-01 Jan-Åke Larsson <jalar@mai.liu.se>
+
+ * draw.c, set.c:
+ Fix rules (again), this time taking maxdrift into account.
+
+ * pk.c: Unfortunately gdImageColorResolveAlpha only works
+ on truecolor images. Some other day, then. I did fix the
+ performance of PROPER_OVERSTRIKE, though.
+
+ * readme.texi: Add todo
+
+2003-06-30 Jan-Åke Larsson <jalar@mai.liu.se>
+
+ * dvipng.texi: small fixes
+
+ * vf.c: Speedup macro start/end
+
+ * set.c: Handle offset in draw.c only, allow choice of
+ compression if gd can do this
+
+ * pk.c: Handle overstrike, either with gd alpha level, if
+ support exists for that, or "manually". The latter is active if
+ PROPER_OVERSTRIKE is #defined, currently yes, at roughly 5%
+ performance loss.
+
+ * misc.c: -z option: choose compression if gd can do this
+
+ * dvipng.h: Proper rounding, gd bells and whistles
+
+ * draw.c: Allow drift a la dvitype, maxdrift=1, handle
+ offset here only, speedup vf macro start/end
+
+ * config.h.in:
+ * configure.ac: New tests for gd bells and whistles
+
+ * Makefile.in: Clean README
+
+ * .cvsignore: More files
+
+2003-06-23 Jan-Åke Larsson <jalar@mai.liu.se>
+
+ * configure.ac:
+ * config.h.in: Added tests for newly added C code
+
+ * Makefile.in:
+ * dvipng.texi: Reflect move of readme
+
+ * README:
+ * readme.texi: Moved from README to readme.texi
+
+2003-06-19 Jan-Åke Larsson <jalar@mai.liu.se>
+
+ * special.c: Fix crash on file not found
+
+ * set.c: Code reformatting
+
+ * misc.c: Fix switches, and send warnings/errors to stderr.
+
+ * vf.c:
+ * pk.c:
+ * draw.c: Include header only used in this file, here.
+
+ * commands.h: Make draw.c compile without -DDEBUG
+
+ * Makefile.in: Use --disable-debug, fix docs
+ generation/install, and add 'test' target.
+
+ * README: Update info
+
+ * configure.ac: Add --disable-debug
+
+ * install.texi: Minor changes
+
+ * dvipng.texi: Document difference between -pp and -p + -l
+
+ * dvipng.h: Fix FreeBSD non-C99 header issue
+
+2003-06-12 Jan-Åke Larsson <jalar@mai.liu.se>
+
+ * Makefile.in: Fix SunOS make suffix rule wierdness
+
+ * color.c: Change comment
+
+ * dvi.c (DVIOpen): bugfix ".dvi" completion
+
+ * dvipng.h (PIXROUND): Round down instead of up, SetRule
+ now has its own rounding mechanism
+
+ * set.c (SetRule): Refine rule drawing, make sure rule is
+ inside bounding box
+
+2003-06-10 Jan-Åke Larsson <jalar@mai.liu.se>
+
+ * README:
+ * RELEASE:
+ * Makefile.in:
+ * configure.ac:
+ * dvipng.texi: Prepare for 0.3
+
+ * vf.c:
+ * set.c:
+ * pk.c:
+ * font.c:
+ * dvi.c:
+ * draw.c: simplify DEBUG_PRINT
+
+ * configure.ac: Look for gs
+
+ * special.c: Fixes to gs interaction
+
+ * set.c: Enable -o for output file, no segfault on empty
+ image, reposition rule to match dvips
+
+ * draw.c: simplify DEBUG_PRINT macro
+
+ * dvi.c:
+ * misc.c: Enable -o for output file
+
+ * dvipng.h: Enable -o for output file, simplify DEBUG_PRINT
+ macro
+
+2003-04-17 Jan-Ake Larsson <jalar@mai.liu.se>
+
+ * install.texi:
+ * dvipng.texi: Rewrite stuff
+
+ * dvipng.h: New debug flag
+
+ * configure.ac:
+ * config.h.in: Configure GS_PATH
+
+ * special.c: No tempfiles anymore. Communicate with child
+ through two pipes.
+
+ * configure.ac:
+ * Makefile.in: Make docs
+
+2003-04-15 Jan-Åke Larsson <jalar@mai.liu.se>
+
+ * macros.texi: Added
+
+ * install.texi, dvipng.texi: Initial version
+
+2003-03-28 Jan-Åke Larsson <jalar@mai.liu.se>
+
+ * README:
+ * RELEASE: Release 0.2, PostScript type1 font support and
+ PostScript inclusion.
+
+ * configure.ac: Added configure error message about where
+ to find libgd.
+
+ * dvipng.h:
+ * draw.c (DrawCommand):
+ * special.c (SetSpecial): Postscript inclusion now works.
+
+ * misc.c (DecodeArgs): Fix --help message
+
+ * COPYING:
+ * RELEASE:
+ * README: Added files to repository
+
+2003-03-12 Jan-Åke Larsson <jalar@mai.liu.se>
+
+ * dvi.c (DVIFollowToggle):
+ * misc.c (DecodeArgs):
+ * dvipng.h: Added '-follow' switch, and code that
+ implements a follow mode.
+
+2003-02-27 Jan-Åke Larsson <jalar@mai.liu.se>
+
+ * draw.c (DrawPages):
+ * misc.c (Message): Speed up slightly when not in DEBUG
+ mode.
+
+ * misc.c (DecodeArgs): Adjust copyright notice.
+
+ * set.c (SetRule): Reposition rules, one dot up.
+
+2003-01-30 Jan-Åke Larsson <jalar@mai.liu.se>
+
+ * Makefile.in:
+ * configure.ac: Fix includes and linking
+
+ * draw.c:
+ * font.c:
+ * pk.c:
+ * vf.c:
+ * dvipng.h (font_entry): remove unnamed union
+
+ * dvipng.h: simplify includes
+
+2003-01-15 Jan-Ake Larsson <jalar@mai.liu.se>
+
+ * misc.c: Use autoconf's stuff, use atoi, fix warning
+ message
+
+ * dvipng.c:
+ * dvipng.h: Localize position and spacing to draw.c. Fix
+ timing
+
+ * pk.c:
+ * set.c:
+ * special.c:
+ * vf.c:
+ * draw.c: Localize position and spacing to draw.c
+
+ * configure.ac: Require gd and kpathsea
+
+2002-12-03 Jan-Ake Larsson <jalar@mai.liu.se>
+
+ * draw.c: unfinished change: repairing
+
+ * draw.c:
+ * font.c:
+ * vf.c: use void* in function call
+
+ * dvipng.h:
+ * draw.c:
+ * color.c:
+ * set.c: change names of some functions
+
+ * dvipng.h:
+ * draw.c:
+ * dvi.c:
+ * ppagelist.c: make dvi data more local
+
+ * .cvsignore:
+ * dvipng.h:
+ * special.c:
+ * font.c:
+ * misc.c:
+ * dvipng.c:
+ * configure.ac:
+ * config.h.in:
+ * Makefile.in: autoconfiscate
+
+2002-11-07 Jan-Ake Larsson <jalar@mai.liu.se>
+
+ * dvipng.h:
+ * dvipng.c (main):
+ * dvi.c (DVIReOpen): Don't re-init, re-open
+
+2002-10-31 Jan-Ake Larsson <jalar@mai.liu.se>
+
+ * dvipng.h:
+ * dvi.c: Remove globals and Reopen DVI on change (check
+ mtime)
+
+ * dvipng.c: Reopen DVI on change (check mtime)
+
+2002-10-30 Jan-Ake Larsson <jalar@mai.liu.se>
+
+ * pk.c: Declaration moved here from dvipng.h
+
+ * Makefile: No io.c, no pagequeue.c but ppagelist.c
+
+ * dvipng.h: Rearranged, some new declarations
+
+ * dvipng.c (main): minor changes
+
+ * draw.c (DoPages): use new page-finding mechanisms
+
+ * dvi.c: outfilename handling fixed, page-finding
+ mechanisms added.
+
+ * misc.c: Ppagelist handling improved, outfilename now
+ works, added functionality from io.c
+
+ * ppagelist.c: Added. Functionality slightly different from
+ pagequeue.c
+
+ * pagequeue.c: Revamped. Functionality changed and moved to
+ ppagelist.c
+
+ * io.c: Removed. Functionality in misc.c
+
+ * .cvsignore: Additions
+
+2002-10-24 Jan-Ake Larsson <jalar@mai.liu.se>
+
+ * dvipng.c (main):
+ * dvipng.h:
+ * misc.c (DecodeString): Improve stdin parser
+
+2002-10-21 Jan-Ake Larsson <jalar@mai.liu.se>
+
+ * dvipng.h: Remove globals, fix message output
+
+ * vf.c (SetVF, InitVF),
+ * font.c (FontDef),
+ * draw.c (DrawCommand): Bugfix VF handling, fix message
+ output
+
+ * pk.c (SetPK, InitPK),
+ * dvi.c (DVIOpen): Fix message output
+
+ * papersiz.c: use int32_t, fix overflow
+
+ * misc.c (DecodeArgs, Message): Fix -d option, remove
+ globals, fix message output
+
+2002-10-16 Jan-Ake Larsson <jalar@mai.liu.se>
+
+ * dvipng.h: Remove globals
+
+ * dvipng.c (main): Remove globals, improve stdin parser
+
+ * misc.c (DecodeArgs): remove globals, fix helptext
+
+ * pagequeue.c (FindQdPage, QueuePage, QueueParse):
+ remove globals
+
+ * dvi.c (FindPage): Remove unnecessary test
+
+ * draw.c (DoPages): Do more normal read-ahead
+
+2002-10-15 Jan-Ake Larsson <jalar@mai.liu.se>
+
+ * pk.c, font.c: Minor change
+
+ * misc.c: Simplify, remove (some) globals, fix helptext
+
+ * pagequeue.c, dvipng.h, dvipng.c,
+ dvi.c, draw.c: Simplify, remove (some) globals
+
+2002-10-14 Jan-Ake Larsson <jalar@mai.liu.se>
+
+ * misc.c, dvipng.h, draw.c:
+ Added '-T tight' switch
+
+2002-10-11 Angus Leeming <leeming@lyx.org>
+
+ * draw.c:
+ * dvi.c:
+ * dvipng.[ch]:
+ * font.c:
+ * io.c:
+ * misc.c:
+ * pagequeue.c:
+ * papersiz.c:
+ * pk.c:
+ * set.c:
+ * special.c:
+ * vf.c: remove function prototype macros.
+
+ * dvi.c (DVIGetCommand, CommandLength):
+ * set.c (SetChar): add a 'break' to the end of the switch
+ statements (prevents a warning with gcc 3.2).
+
+2002-10-11 Jan-Ake Larsson <jalar@mai.liu.se>
+
+ * special.c: Fix DEBUG, prototypes, and code pruning
+
+ * vf.c, set.c, pk.c, io.c,
+ font.c, draw.c: Fix DEBUG
+
+ * misc.c, dvi.c, pagequeue.c,
+ dvipng.h, dvipng.c: Fix pagelist and DEBUG
+
+
+2002-09-20 Jan-Ake Larsson <jalar@imf.au.dk>
+
+ * dvipng.h: change font structures, add dvi struct, remove old
+ global variables, include relevant bits of config.h, restructure
+ somewhat
+
+ * dvipng.c: remove explicit vf stack
+
+ * special.c: use dvi struct
+
+ * misc.c: minor changes
+
+ * io.c: close file descriptors, not FILE pointers.
+
+ * draw.c: simplify, remove explicit vf stack.
+
+ * set.c: use dvi struct, remove explicit dvi stack.
+
+ * vf.c: use mmap, remove explicit vf stack.
+
+ * pk.c: use mmap
+
+ * font.c: enable dvi struct, prepare for mmap (file descriptors,
+ not FILE pointers), explicit vf stack removed.
+
+ * dvi.c: use dvi struct
+
+ * Makefile: config.h removed
+
+ * config.h, klibtool, klibtool.config: removed.
+
+2002-08-30 Jan-Ake Larsson <jalar@imf.au.dk>
+
+ * dvi.c: fix bug in STRSIZE zap
+
+ * vf.c: simplify, fix debug info, zap STRSIZE limit
+
+ * misc.c: Fix background transparency
+
+ * dvipng.h, draw.c: Fix FormFeed bug (outfilename
+ wrong)
+
+ * set.c: Fix FormFeed bug (outfilename wrong), and background
+ transparency
+
+2002-08-29 Jan-Ake Larsson <jalar@imf.au.dk>
+
+ * dvipng.h: type changes, dvi-io abstraction
+
+ * color.c: comment changed
+
+ * dvipng.c: dvi-io abstraction
+
+ * font.c: type changes, STRSIZE killed
+
+ * io.c: ReadCommand and CommandLength moved to dvi.c, preparations
+ for mmap
+
+ * set.c: type changes
+
+ * vf.c, pk.c: prepare for mmap, type changes
+
+ * pagequeue.c: type change
+
+ * misc.c: dvi fopen moved to dvi.c, type changes
+
+ * Makefile: pagelist.o gone, dvi.o new
+
+ * draw.c: SetVF moved to vf.c, type and dvi-io abstraction
+ changes
+
+ * commands.h: added length and debug texts
+
+ * dvi.c: Functionality moved from pagelist.c and misc.c to
+ dvi.c. Still needs work, but is initial stab at proper abstraction
+ of dvi-reading stuff. STRSIZE killed.
+
+ * pagelist.c: Functionality moved to dvi.c
+
+ * special.c: DoSpecial now takes a const char* argument, as
+ opposed to before.
+
+2002-08-19 Jan-Ake Larsson <jalar@imf.au.dk>
+
+ * misc.c: Added -mode switch
+
+2002-08-14 Jan-Ake Larsson <jalar@imf.au.dk>
+
+ * dvipng.h: VF additions, general cleanup
+
+ * dvipng.c: Small adjustments connected to the VF support
+
+ * config.h: Remove unnecessary things
+
+ * pagelist.c: Simplifications
+
+ * color.c: Comment changed
+
+ * special.c, set.c: Scale always equal h/v
+
+ * Makefile: Make vf.o
+
+ * io.c: Start pre-conversion to mmap. Much still to be done.
+
+ * misc.c, set.c, font.c, pk.c, draw.c: Adjust for VF support
+
+ * vf.c: VF support added to dvipng
+
+2002-06-24 Jan-Ake Larsson <jalar@imf.au.dk>
+
+ * Makefile: Cleaned. Vacuumed, in fact.
+
+2002-06-19 Jan-Ake Larsson <jalar@imf.au.dk>
+
+ * pagelist.c: remove Debug bug (!)
+
+2002-06-13 Jan-Ake Larsson <jalar@imf.au.dk>
+
+ * Makefile: new object files
+
+ * special.c, set.c, dvipng.h: cleanup
+
+ * misc.c (ActualFactor): moved to font.c + cleanup
+
+ * font.c (ActualFactor): moved here from misc.c
+
+ * draw.c, dvipng.c, pagelist.c: functionality from dvipng.c spread
+ to these three
+
+ * pagequeue.c, pages.c: functionality moved from pages.c to
+ pagequeue.c
+
+ * commands.h: minor adjustments
+
+2002-06-12 Jan-Ake Larsson <jalar@imf.au.dk>
+
+ * special.c: on unimplemented \special, give pixel position
+
+ * misc.c: Bugfix + literal response on stdin interface
+
+ * font.c, dvipng.h: Font handling fixed
+
+ * dvipng.c: prompt on stdin interface
+
+2002-06-11 Jan-Ake Larsson <jalar@imf.au.dk>
+
+ * set.c (SetChar): load chars on PASS_DRAW <sigh>
+ -T -O bug fixed
+
+2002-06-11 Jan-Ake Larsson <jalar@imf.au.dk>
+
+ * set.c: Cleanup. Still buggy wrt -O, though.
+
+ * Makefile: DEBUG on for now, postamble.? removed
+
+ * postamble.c: Postamble is no longer read
+
+ * pages.c: Improve page handling: now a queue, not an unordered
+ set
+
+ * font.c: Improve font handling: search for fonts only when used
+
+ * dvipng.h: Cleanup
+
+ * dvipng.c: Major rewrite: page handling improved
+
+ * misc.c: Fix DVI init + cleanup
+
+2002-05-30 Jan-Ake Larsson <jalar@imf.au.dk>
+
+ * misc.c: Transparent border: '-bd'
+
+ * dvipng.h, set.c: Tiding up + transparent border
+
+ * dvipng.c, font.c: Tidying up
+
+2002-05-29 Jan-Ake Larsson <jalar@imf.au.dk>
+
+ * color.c: Fix cmyk->rgb.
+
+ * misc.c: Add '-fg' and '-bg'.
+
+ * font.c: Tidy up
+
+2002-05-29 Jan-Ake Larsson <jalar@imf.au.dk>
+
+ * dvipng.h: Tidying up, and new global vars
+
+ * io.c: Tidying up
+
+ * papersiz.c: Pagesize matters, adapted from dvips
+
+ * pages.c: Page choosing, from dvips. Not sufficient for our
+ purposes, but a start
+
+ * dvipng.c, color.c, Makefile, misc.c, set.c: Changed to make
+ pagesize (-T), offset (-O), page choosing (-pp), and output file
+ (-o) work.
+
+2002-05-27 Jan-Ake Larsson <jalar@imf.au.dk>
+
+ * pk.c: Changed comments
+
+ * .cvsignore, special.c, set.c, postamble.c, pk.c, misc.c, io.c,
+ font.c, dvipng.c, color.c, commands.h, dvipng.h: Initial version
+
+ * config.h, Makefile: Initial version, to be replaced by
+ autoconf'ism
+
+ * klibtool.config, klibtool: Included for now. To be
+ removed.
diff --git a/Build/source/texk/dvipng/dvipng-src/INSTALL b/Build/source/texk/dvipng/dvipng-src/INSTALL
new file mode 100644
index 00000000000..0fecfaa2a29
--- /dev/null
+++ b/Build/source/texk/dvipng/dvipng-src/INSTALL
@@ -0,0 +1,157 @@
+Installing dvipng
+*****************
+
+Installing dvipng should be simple: merely './configure', 'make', and
+'make install'.
+
+Prerequisites
+=============
+
+ * The GD Graphics Draw library, libgd
+
+ The drawing library 'libgd' is necessary, and is downloadable at
+ <https://bitbucket.org/libgd/gd-libgd/downloads>, and there are
+ binary packages for most operating systems from their respective
+ distributors. In any case, the library installs using 'autoconf'
+ so it should not be difficult for you to install it from source,
+ and then proceed with installing dvipng.
+
+ * The path-searching library kpathsea
+
+ Kpathsea is most likely included in your LaTeX installation, but it
+ may happen that ./configure does not find it; see below. If you do
+ not have it, download it from <http://www.ctan.org> and compile it.
+ I have no experience with this, so I cannot help much here.
+
+ * The font-rendering library FreeType 2
+
+ While not strictly necessary, a recent FreeType 2 is recommended
+ since dvipng currently will produce better-quality images when this
+ library is available. To take advantage of this, you should have
+ at least FreeType 2.1.9.
+
+ FreeType 2 will enable direct support for PostScript and TrueType
+ fonts, so that dvipng will not need to generate bitmapped variants
+ on disk of the TeX fonts since modern TeX distributions include
+ PostScript versions of them. Then, you can render images at
+ different (and unusual) resolutions without cluttering the disk
+ with lots of bitmapped fonts.
+
+ Finally, it will enable subfont support in dvipng. That is, if you
+ want to render CJK-LaTeX characters, you must have FreeType 2
+ installed.
+
+ * libpng and libz
+
+ To be able to compress and write PNG files to disk, dvipng (or
+ really libgd) uses libpng which in turn uses libz. These should be
+ available on any modern system, if not, download them and install
+ them.
+
+ * The 'texinfo' package
+
+ This is needed for building the documentation.
+
+Configure
+=========
+
+The first step is to configure the source code, telling it where various
+files will be. To do so, run
+
+ ./configure OPTIONS
+
+ (Note: if you have fetched dvipng from CVS rather than a regular
+release, you will have to first generate './configure' by running
+'autoconf' 2.53 or later.)
+
+ On many machines, you will not need to specify any options, but if
+'configure' cannot determine something on its own, you'll need to help
+it out. For a list of the options type
+
+ ./configure --help
+
+ On some machines, the libraries will be installed in directories that
+are not in the linker's search path. This will generate an error when
+running './configure', indicating that it cannot find libgd or
+libkpathsea (most likely). You then need to specify the path to the
+respective library's object files. They are typically called e.g.,
+'libgd.a' or 'libgd.so'. If they are located in e.g., '/sw/local/lib',
+do
+
+ ./configure LDFLAGS=-L/sw/local/lib
+
+ If the library is available as a shared object file ('.so'), the
+runtime linker may also need to be told where to find the library, then
+use
+
+ ./configure LDFLAGS='-L/sw/local/lib -R/sw/local/lib'
+
+ When either of these is necessary, it is likely that the C header
+files are also installed in directories that are not in the C
+preprocessor's search path. This will also generate an error when
+running './configure', indicating that it cannot find e.g., 'gd.h' or
+'kpathsea.h' (most likely). You then need to specify the path to the
+respective library's C header files. If they are located in e.g.,
+'/sw/local/include', do
+
+ ./configure CPPFLAGS=-I/sw/local/include
+
+ On my SUN Solaris workstation, I had to combine this into
+
+ ./configure CPPFLAGS='-I/sw/local/include -I/sw/tex/teTeX/1.0/include'\
+ LDFLAGS='-L/sw/local/lib -R/sw/local/lib -L/sw/tex/teTeX/1.0/lib/'
+
+where the backslash denotes a continuation of the line.
+
+Build/install
+=============
+
+Once 'configure' has been run, simply enter
+
+ make
+
+at the prompt to compile the C code, and build the documentation files.
+To install the files into the locations chosen earlier, type
+
+ make install
+
+You may need special privileges to install, e.g., if you are installing
+into system directories.
+
+Installation outside the texmf tree
+===================================
+
+In some cases, a dvipng binary installed outside the texmf tree will not
+be able to find virtual fonts, or the PostScript font maps (normally
+used by dvips). This may be because _only_ $SELFAUTOLOC, $SELFAUTODIR,
+and $SELFAUTOPARENT are used in the texmf tree configuration file
+'texmf.cnf'. If so, give the switch '--enable-selfauto-set' to
+'./configure'. This will make dvipng adjust these three internally so
+that kpathsea thinks that dvipng _is_ installed in the texmf tree.
+
+Installation for non-privileged users
+=====================================
+
+Often people without system administration privileges want to install
+software for their private use. In that case you need to specify more
+options to the 'configure' script, usually this is done by using the
+'--prefix' option to the 'configure' script, and let it point to the
+personal home directory. In that way, resulting binaries will be
+installed under the 'bin' subdirectory of your home directory, manual
+pages under 'man' and so on. That way, it is reasonably easy to
+maintain a bunch of additional packages, since the prefix argument is
+supported by most 'configure' scripts.
+
+ You'll have to add something like '/home/myself/bin' to your 'PATH'
+shell variable, if it isn't there already, and similarly set the
+'INFOPATH' and 'MANPATH' variables to be able to access the
+documentation.
+
+Copying
+=======
+
+This program is released under the GNU Lesser General Public License
+version 3, see the COPYING file in the dvipng distribution or
+<http://www.gnu.org/licenses/>.
+
+ Copyright (C) 2002-2015, 2019 Jan-AAke Larsson
diff --git a/Build/source/texk/dvipng/dvipng-src/Makefile.in b/Build/source/texk/dvipng/dvipng-src/Makefile.in
new file mode 100644
index 00000000000..d57b925324a
--- /dev/null
+++ b/Build/source/texk/dvipng/dvipng-src/Makefile.in
@@ -0,0 +1,170 @@
+# Makefile is generated by 'configure' from Makefile.in
+
+#************************************************************************
+#
+# Part of the dvipng distribution
+#
+# This program is free software: you can redistribute it and/or modify
+# it under the terms of the GNU Lesser General Public License as
+# published by the Free Software Foundation, either version 3 of the
+# License, or (at your option) any later version.
+#
+# This program is distributed in the hope that it will be useful, but
+# WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU
+# Lesser General Public License for more details.
+#
+# You should have received a copy of the GNU Lesser General Public
+# License along with this program. If not, see
+# <http://www.gnu.org/licenses/>.
+#
+# Copyright (C) 2002-2015 Jan-Åke Larsson
+#
+#************************************************************************
+
+PACKAGE_STRING="@PACKAGE_STRING@"
+
+CC = @CC@
+CFLAGS = @CFLAGS@ -Wall
+CPPFLAGS = @CPPFLAGS@ -I.
+LN_S = @LN_S@
+
+LIBS = @LIBS@
+LDFLAGS = @LDFLAGS@
+
+srcdir = @srcdir@
+VPATH = @srcdir@
+
+prefix = @prefix@
+exec_prefix = @exec_prefix@
+bindir = @bindir@
+infodir = @infodir@
+mandir = @mandir@
+datarootdir = @datarootdir@
+DESTDIR=
+INSTALL = @INSTALL@
+INSTALL_DATA = @INSTALL_DATA@
+MKINSTALLDIRS = $(srcdir)/mkinstalldirs
+
+MAKEINFO=@MAKEINFO@ @MAKEINFO_MACROS@
+INSTALL_INFO=@INSTALL_INFO@
+TEX=tex
+TEXIDVI=texi2dvi
+TEXIHTML=texi2html
+DVIPS=dvips
+TEXIFILES = dvipng.texi readme.texi install.texi macros.texi dvipng.help
+
+objects = dvipng.o color.o draw.o dvi.o font.o misc.o pk.o \
+ set.o special.o papersiz.o ppagelist.o \
+ vf.o @PSFONTS_O@
+
+all: dvipng docs
+
+install: @INSTALL_BIN_TARGET@ @INSTALL_BIN_TARGET@-docs
+
+####################################### The program
+
+dvipng: $(objects)
+ $(CC) $(LDFLAGS) $(objects) -o dvipng $(LIBS)
+
+$(objects): dvipng.h commands.h config.h
+
+install-dvipng: dvipng
+ -$(MKINSTALLDIRS) $(DESTDIR)$(bindir)
+ $(INSTALL) dvipng $(DESTDIR)$(bindir)
+
+install-dvigif: install-dvipng
+ (cd $(DESTDIR)$(bindir) && rm -f dvigif && $(LN_S) dvipng dvigif)
+
+####################################### The documentation
+
+docs: dvipng.dvi dvipng.info
+
+dvipng.dvi: $(TEXIFILES)
+ -$(TEXIDVI) -I $(srcdir) $(srcdir)/dvipng.texi
+
+dvipng.ps: dvipng.dvi
+ $(DVIPS) -Ppdf dvipng.dvi
+
+dvipng.info: $(TEXIFILES) dvipng.help
+ -$(MAKEINFO) -I$(srcdir) $(srcdir)/dvipng.texi
+
+dvipng.help: dvipng
+ -./dvipng > dvipng.tmp
+ ( test -r dvipng.help && diff dvipng.tmp dvipng.help ) \
+ || cp dvipng.tmp dvipng.help
+ rm -f dvipng.tmp
+
+www: $(TEXIFILES) dvipng.help
+ mkdir -p www
+ texi2html -split chapter -nosec-nav -subdir html \
+ -I $(srcdir) $(srcdir)/dvipng.texi
+ (cd html; for i in *; do \
+ sed -e "s/Jan-A/Jan-\&Aring\;/g" $$i > ../www/$$i; \
+ done)
+ cp www/dvipng.html www/index.html
+ rm -rf html
+
+dvipng_mono.html: $(TEXIFILES) dvipng.help
+ texi2html --monolithic -nomenu -nosec_nav -o dvipng_mono.html \
+ -I $(srcdir) $(srcdir)/dvipng.texi
+
+install-docs: docs
+ -$(MKINSTALLDIRS) $(DESTDIR)$(infodir)
+ for x in dvipng.info* ; do \
+ $(INSTALL_DATA) $$x $(DESTDIR)$(infodir) ; \
+ done
+ -$(INSTALL_INFO) --info-dir=$(DESTDIR)$(infodir) dvipng.info
+ -$(MKINSTALLDIRS) $(DESTDIR)$(mandir)/man1
+ $(INSTALL_DATA) $(srcdir)/dvipng.1 $(DESTDIR)$(mandir)/man1
+
+install-dvipng-docs: install-docs
+
+install-dvigif-docs: install-docs
+ (cd $(DESTDIR)$(mandir)/man1 && rm -f dvigif.1 && $(LN_S) dvipng.1 dvigif.1)
+
+####################################### The test
+
+test: test_dvipng.dvi dvipng
+ ./dvipng -T tight -strict test_dvipng
+ echo View the result e.g. with xv test_dvipng\*.png
+
+test_dvipng.dvi: test_dvipng.tex
+ latex $(srcdir)/test_dvipng.tex
+
+####################################### The cleaning up
+
+clean:
+ rm -f *.o dvipng *.help *.info* *dvipng.dvi *.aux *.log
+ rm -f *dvipng*.png *.cp *.fn *.ky *~ \#*\# \
+ *.tp *.vr *.pg *.toc *.tp *.bak *.cps *.kys *.tps \
+ *.fns *.vrs *.pgs *.html *.tmp
+
+distclean: clean
+ rm -f Makefile
+ rm -f config.status config.log config.cache c-auto.h
+ rm -rf autom4te.cache
+
+####################################### Maintainer targets
+
+INSTALL: install.texi
+ -$(MAKEINFO) -D rawfile --no-headers --no-validate \
+ --no-number-sections \
+ -I$(srcdir) $(srcdir)/install.texi --output INSTALL
+
+README: readme.texi
+ -$(MAKEINFO) -D rawfile --no-headers --no-validate \
+ --no-number-sections \
+ -I$(srcdir) $(srcdir)/readme.texi --output README
+
+dvipng.1: dvipng.texi readme.texi
+ ~/bin/texi2pod.pl -D man $(srcdir)/dvipng.texi | \
+ sed -es/@//g -es/previewlatex/preview-latex/g -es/{}//g > dvipng.pod
+ pod2man --center="User commands" --release=$(PACKAGE_STRING)\
+ dvipng.pod > dvipng.1
+ rm dvipng.pod
+
+dist: INSTALL README dvipng.1 distclean
+
+# SunOS make suffix rule wierdness
+.cps.h:
diff --git a/Build/source/texk/dvipng/dvipng-src/README b/Build/source/texk/dvipng/dvipng-src/README
new file mode 100644
index 00000000000..a4e78345058
--- /dev/null
+++ b/Build/source/texk/dvipng/dvipng-src/README
@@ -0,0 +1,126 @@
+dvipng
+******
+
+This program makes PNG and/or GIF graphics from DVI files as obtained
+from TeX and its relatives.
+
+ If GIF support is enabled, GIF output is chosen by using the 'dvigif'
+binary or with the '--gif' option.
+
+ It is intended to produce anti-aliased screen-resolution images as
+fast as is possible. The target audience is people who need to generate
+and regenerate many images again and again. The primary target is the
+preview-latex (X)Emacs package, a package to preview formulas from
+within (X)Emacs. Yes, you get to see your formulas in the (X)Emacs
+buffer, see <http://www.gnu.org/software/auctex/preview-latex.html>.
+
+ Another example is WeBWorK, an internet-based method for delivering
+homework problems to students over the internet, giving students instant
+feedback as to whether or not their answers are correct, see
+<http://webwork.math.rochester.edu>.
+
+ A more recent addition to the dvipng-using applications out there is
+MediaWiki, the software behind Wikipedia and many other wikis out there.
+Dvipng is used to render mathematical formulae from version 1.8.0 of
+MediaWiki, see <http://www.mediawiki.org>.
+
+ Other applications may also benefit, like web applications as
+latex2html and WYSIWYG editors like LyX.
+
+Benefits of dvipng
+==================
+
+The benefits of 'dvipng'/'dvigif' include
+
+ * Speed. It is a very fast bitmap-rendering code for DVI files,
+ which makes it suitable for generating large amounts of images
+ on-the-fly, as needed in preview-latex, WeBWorK and others.
+
+ * It does not read the postamble, so it can be started before TeX
+ finishes. There is a '--follow' switch that makes dvipng wait at
+ end-of-file for further output, unless it finds the POST marker
+ that indicates the end of the DVI.
+
+ * Interactive query of options. dvipng can read options
+ interactively through stdin, and all options are usable. It is
+ even possible to change the input file through this interface.
+
+ * Supports PK, VF, PostScript Type1, and TrueType fonts, subfonts
+ (i.e., as used in CJK-LaTeX), color specials, and inclusion of
+ PostScript, PNG, JPEG or GIF images.
+
+ * and more...
+
+Installation
+============
+
+Read 'INSTALL', included in the distribution.
+
+Usage
+=====
+
+To use dvipng at its simplest, simply type
+
+ dvipng foo
+
+where 'foo.dvi' is the output of TeX that you want to convert to PNG
+format. If there are four pages in 'foo.dvi', those pages will be
+output as 'foo1.png', 'foo2.png', 'foo3.png', and 'foo4.png',
+respectively.
+
+ Many options are available (see the info manual). For a brief
+summary of available options, just type
+
+ dvipng --help
+
+Availability
+============
+
+The dvipng package is available at Savannah, the GNU project site.
+Since dvipng is not part of the GNU project, although released under the
+GNU GPL, the web address is
+<http://savannah.nongnu.org/projects/dvipng>. Instructions for
+anonymous CVS access can be found at
+<http://savannah.nongnu.org/cvs/?group=dvipng>.
+
+Contacts
+========
+
+Bug reports should be sent to <dvipng@nongnu.org>.
+
+ Questions, suggestions for new features, pleas for help, and/or
+praise should go to <dvipng@nongnu.org>. For more information on this
+mailing list, send a message with just the word 'help' as subject or
+body to <dvipng-request@nongnu.org> or look at
+<http://lists.nongnu.org/mailman/listinfo/dvipng>.
+
+ Offers to support further development will be appreciated. For
+developer access, ask on <dvipng@nongnu.org>.
+
+Copying
+=======
+
+This program is released under the GNU Lesser General Public License
+version 3, see the COPYING file in the dvipng distribution or
+<http://www.gnu.org/licenses/>.
+
+ Copyright (C) 2002-2014 Jan-AAke Larsson
+
+Todo
+====
+
+ * Use gs interpreter library for speed and possibly for
+ functionality.
+
+ * Add more color models for xcolor compatibility
+
+ * Enable a named pipe as DVI
+
+ * Further speed improvements.
+
+ * Other output specials and source specials.
+
+ * Clean internal structures. Overhaul file handling.
+
+ * Fix the SELFAUTO stuff at runtime rather than at build time
+
diff --git a/Build/source/texk/dvipng/dvipng-src/RELEASE b/Build/source/texk/dvipng/dvipng-src/RELEASE
new file mode 100644
index 00000000000..5417af0f867
--- /dev/null
+++ b/Build/source/texk/dvipng/dvipng-src/RELEASE
@@ -0,0 +1,10 @@
+Release notes for version 1.17 of the dvipng package:
+
+This program makes PNG graphics from DVI files as obtained from TeX
+and its relatives.
+
+
+This is a bugfix release that re-enables PK font rendering and enables gamma printout and interactive mode startup without DVI.
+
+
+Report any bugs you find, see README for instructions.
diff --git a/Build/source/texk/dvipng/dvipng-src/acinclude.m4 b/Build/source/texk/dvipng/dvipng-src/acinclude.m4
new file mode 100644
index 00000000000..2bc2d6cd870
--- /dev/null
+++ b/Build/source/texk/dvipng/dvipng-src/acinclude.m4
@@ -0,0 +1,104 @@
+# acinclude.m4
+
+#************************************************************************
+#
+# Part of the dvipng distribution
+#
+# This program is free software: you can redistribute it and/or modify
+# it under the terms of the GNU Lesser General Public License as
+# published by the Free Software Foundation, either version 3 of the
+# License, or (at your option) any later version.
+#
+# This program is distributed in the hope that it will be useful, but
+# WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU
+# Lesser General Public License for more details.
+#
+# You should have received a copy of the GNU Lesser General Public
+# License along with this program. If not, see
+# <http://www.gnu.org/licenses/>.
+#
+# Copyright (C) 2002-2015,2019 Jan-Åke Larsson
+#
+#************************************************************************
+
+
+dnl
+dnl MAKEINFO_CHECK_MACRO( MACRO, [ACTION-IF-FOUND
+dnl [, ACTION-IF-NOT-FOUND]])
+dnl
+AC_DEFUN([MAKEINFO_CHECK_MACRO],
+[if test -n "$MAKEINFO" -a "$makeinfo" != ":"; then
+ AC_MSG_CHECKING([for @$1{}])
+ echo \\\\input texinfo > conftest.texi
+ echo @$1{test} >> conftest.texi
+ if $MAKEINFO conftest.texi > /dev/null 2> /dev/null; then
+ AC_MSG_RESULT(yes)
+ ifelse([$2], , :, [$2])
+ else
+ AC_MSG_RESULT(no)
+ ifelse([$3], , :, [$3])
+ fi
+ rm -f conftest.texi conftest.info
+fi
+])
+
+dnl
+dnl MAKEINFO_CHECK_MACROS( MACRO ... [, ACTION-IF-FOUND
+dnl [, ACTION-IF-NOT-FOUND]])
+dnl
+AC_DEFUN([MAKEINFO_CHECK_MACROS],
+[for ac_macro in $1; do
+ MAKEINFO_CHECK_MACRO($ac_macro, $2,
+ [MAKEINFO_MACROS="-D no-$ac_macro $MAKEINFO_MACROS"
+ $3])dnl
+ done
+AC_SUBST(MAKEINFO_MACROS)
+])
+
+
+dnl
+dnl Check for enc, cmap, sfd formats
+dnl
+AC_DEFUN([AC_HAS_KPSE_ENC_FORMATS],
+ [AC_MSG_CHECKING([for kpse_enc_format])
+ AC_TRY_COMPILE([
+ #include <stdio.h>
+ #include <kpathsea/kpathsea.h>],
+ [kpse_enc_format;kpse_cmap_format;kpse_sfd_format],
+ [AC_MSG_RESULT(yes)
+ AC_DEFINE(HAVE_KPSE_ENC_FORMATS, 1,
+ [Define to 1 if your kpathsea has kpse_enc_format])],
+ [AC_MSG_RESULT(no)])])
+
+
+dnl
+dnl Check devices for GS
+dnl AC_GS_HAS_DEVICE(DEVICE,ACTION-IF-FAILED)
+dnl
+AC_DEFUN([AC_GS_HAS_DEVICE],
+ [AC_MSG_CHECKING([whether $GS has the $1 device])
+ if $GS -h | grep $1 >/dev/null; then
+ AC_MSG_RESULT(yes)
+ else
+ AC_MSG_RESULT(no)
+ $2
+ fi
+])
+
+dnl
+dnl GS_CHECK_DEVICES
+dnl
+AC_DEFUN([GS_CHECK_DEVICES],
+ [GS_WARN=""
+ AC_GS_HAS_DEVICE(pngalpha,
+ [GS_WARN="Your EPS inclusions will be cropped to the
+ boundingbox, and rendered on an opaque background.
+ Upgrade GhostScript to avoid this."
+ AC_GS_HAS_DEVICE(png16m,
+ [GS_WARN="Your EPS inclusions may not work.
+ Upgrade/install GhostScript to avoid this."])])
+ if test -n "$GS_WARN"; then
+ AC_MSG_WARN([$GS_WARN])
+ fi
+])
diff --git a/Build/source/texk/dvipng/dvipng-src/aclocal.m4 b/Build/source/texk/dvipng/dvipng-src/aclocal.m4
new file mode 100644
index 00000000000..a8189afc3f3
--- /dev/null
+++ b/Build/source/texk/dvipng/dvipng-src/aclocal.m4
@@ -0,0 +1,291 @@
+# generated automatically by aclocal 1.15.1 -*- Autoconf -*-
+
+# Copyright (C) 1996-2017 Free Software Foundation, Inc.
+
+# This file is free software; the Free Software Foundation
+# gives unlimited permission to copy and/or distribute it,
+# with or without modifications, as long as this notice is preserved.
+
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY, to the extent permitted by law; without
+# even the implied warranty of MERCHANTABILITY or FITNESS FOR A
+# PARTICULAR PURPOSE.
+
+m4_ifndef([AC_CONFIG_MACRO_DIRS], [m4_defun([_AM_CONFIG_MACRO_DIRS], [])m4_defun([AC_CONFIG_MACRO_DIRS], [_AM_CONFIG_MACRO_DIRS($@)])])
+dnl pkg.m4 - Macros to locate and utilise pkg-config. -*- Autoconf -*-
+dnl serial 11 (pkg-config-0.29.1)
+dnl
+dnl Copyright © 2004 Scott James Remnant <scott@netsplit.com>.
+dnl Copyright © 2012-2015 Dan Nicholson <dbn.lists@gmail.com>
+dnl
+dnl This program is free software; you can redistribute it and/or modify
+dnl it under the terms of the GNU General Public License as published by
+dnl the Free Software Foundation; either version 2 of the License, or
+dnl (at your option) any later version.
+dnl
+dnl This program is distributed in the hope that it will be useful, but
+dnl WITHOUT ANY WARRANTY; without even the implied warranty of
+dnl MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU
+dnl General Public License for more details.
+dnl
+dnl You should have received a copy of the GNU General Public License
+dnl along with this program; if not, write to the Free Software
+dnl Foundation, Inc., 59 Temple Place - Suite 330, Boston, MA
+dnl 02111-1307, USA.
+dnl
+dnl As a special exception to the GNU General Public License, if you
+dnl distribute this file as part of a program that contains a
+dnl configuration script generated by Autoconf, you may include it under
+dnl the same distribution terms that you use for the rest of that
+dnl program.
+
+dnl PKG_PREREQ(MIN-VERSION)
+dnl -----------------------
+dnl Since: 0.29
+dnl
+dnl Verify that the version of the pkg-config macros are at least
+dnl MIN-VERSION. Unlike PKG_PROG_PKG_CONFIG, which checks the user's
+dnl installed version of pkg-config, this checks the developer's version
+dnl of pkg.m4 when generating configure.
+dnl
+dnl To ensure that this macro is defined, also add:
+dnl m4_ifndef([PKG_PREREQ],
+dnl [m4_fatal([must install pkg-config 0.29 or later before running autoconf/autogen])])
+dnl
+dnl See the "Since" comment for each macro you use to see what version
+dnl of the macros you require.
+m4_defun([PKG_PREREQ],
+[m4_define([PKG_MACROS_VERSION], [0.29.1])
+m4_if(m4_version_compare(PKG_MACROS_VERSION, [$1]), -1,
+ [m4_fatal([pkg.m4 version $1 or higher is required but ]PKG_MACROS_VERSION[ found])])
+])dnl PKG_PREREQ
+
+dnl PKG_PROG_PKG_CONFIG([MIN-VERSION])
+dnl ----------------------------------
+dnl Since: 0.16
+dnl
+dnl Search for the pkg-config tool and set the PKG_CONFIG variable to
+dnl first found in the path. Checks that the version of pkg-config found
+dnl is at least MIN-VERSION. If MIN-VERSION is not specified, 0.9.0 is
+dnl used since that's the first version where most current features of
+dnl pkg-config existed.
+AC_DEFUN([PKG_PROG_PKG_CONFIG],
+[m4_pattern_forbid([^_?PKG_[A-Z_]+$])
+m4_pattern_allow([^PKG_CONFIG(_(PATH|LIBDIR|SYSROOT_DIR|ALLOW_SYSTEM_(CFLAGS|LIBS)))?$])
+m4_pattern_allow([^PKG_CONFIG_(DISABLE_UNINSTALLED|TOP_BUILD_DIR|DEBUG_SPEW)$])
+AC_ARG_VAR([PKG_CONFIG], [path to pkg-config utility])
+AC_ARG_VAR([PKG_CONFIG_PATH], [directories to add to pkg-config's search path])
+AC_ARG_VAR([PKG_CONFIG_LIBDIR], [path overriding pkg-config's built-in search path])
+
+if test "x$ac_cv_env_PKG_CONFIG_set" != "xset"; then
+ AC_PATH_TOOL([PKG_CONFIG], [pkg-config])
+fi
+if test -n "$PKG_CONFIG"; then
+ _pkg_min_version=m4_default([$1], [0.9.0])
+ AC_MSG_CHECKING([pkg-config is at least version $_pkg_min_version])
+ if $PKG_CONFIG --atleast-pkgconfig-version $_pkg_min_version; then
+ AC_MSG_RESULT([yes])
+ else
+ AC_MSG_RESULT([no])
+ PKG_CONFIG=""
+ fi
+fi[]dnl
+])dnl PKG_PROG_PKG_CONFIG
+
+dnl PKG_CHECK_EXISTS(MODULES, [ACTION-IF-FOUND], [ACTION-IF-NOT-FOUND])
+dnl -------------------------------------------------------------------
+dnl Since: 0.18
+dnl
+dnl Check to see whether a particular set of modules exists. Similar to
+dnl PKG_CHECK_MODULES(), but does not set variables or print errors.
+dnl
+dnl Please remember that m4 expands AC_REQUIRE([PKG_PROG_PKG_CONFIG])
+dnl only at the first occurence in configure.ac, so if the first place
+dnl it's called might be skipped (such as if it is within an "if", you
+dnl have to call PKG_CHECK_EXISTS manually
+AC_DEFUN([PKG_CHECK_EXISTS],
+[AC_REQUIRE([PKG_PROG_PKG_CONFIG])dnl
+if test -n "$PKG_CONFIG" && \
+ AC_RUN_LOG([$PKG_CONFIG --exists --print-errors "$1"]); then
+ m4_default([$2], [:])
+m4_ifvaln([$3], [else
+ $3])dnl
+fi])
+
+dnl _PKG_CONFIG([VARIABLE], [COMMAND], [MODULES])
+dnl ---------------------------------------------
+dnl Internal wrapper calling pkg-config via PKG_CONFIG and setting
+dnl pkg_failed based on the result.
+m4_define([_PKG_CONFIG],
+[if test -n "$$1"; then
+ pkg_cv_[]$1="$$1"
+ elif test -n "$PKG_CONFIG"; then
+ PKG_CHECK_EXISTS([$3],
+ [pkg_cv_[]$1=`$PKG_CONFIG --[]$2 "$3" 2>/dev/null`
+ test "x$?" != "x0" && pkg_failed=yes ],
+ [pkg_failed=yes])
+ else
+ pkg_failed=untried
+fi[]dnl
+])dnl _PKG_CONFIG
+
+dnl _PKG_SHORT_ERRORS_SUPPORTED
+dnl ---------------------------
+dnl Internal check to see if pkg-config supports short errors.
+AC_DEFUN([_PKG_SHORT_ERRORS_SUPPORTED],
+[AC_REQUIRE([PKG_PROG_PKG_CONFIG])
+if $PKG_CONFIG --atleast-pkgconfig-version 0.20; then
+ _pkg_short_errors_supported=yes
+else
+ _pkg_short_errors_supported=no
+fi[]dnl
+])dnl _PKG_SHORT_ERRORS_SUPPORTED
+
+
+dnl PKG_CHECK_MODULES(VARIABLE-PREFIX, MODULES, [ACTION-IF-FOUND],
+dnl [ACTION-IF-NOT-FOUND])
+dnl --------------------------------------------------------------
+dnl Since: 0.4.0
+dnl
+dnl Note that if there is a possibility the first call to
+dnl PKG_CHECK_MODULES might not happen, you should be sure to include an
+dnl explicit call to PKG_PROG_PKG_CONFIG in your configure.ac
+AC_DEFUN([PKG_CHECK_MODULES],
+[AC_REQUIRE([PKG_PROG_PKG_CONFIG])dnl
+AC_ARG_VAR([$1][_CFLAGS], [C compiler flags for $1, overriding pkg-config])dnl
+AC_ARG_VAR([$1][_LIBS], [linker flags for $1, overriding pkg-config])dnl
+
+pkg_failed=no
+AC_MSG_CHECKING([for $1])
+
+_PKG_CONFIG([$1][_CFLAGS], [cflags], [$2])
+_PKG_CONFIG([$1][_LIBS], [libs], [$2])
+
+m4_define([_PKG_TEXT], [Alternatively, you may set the environment variables $1[]_CFLAGS
+and $1[]_LIBS to avoid the need to call pkg-config.
+See the pkg-config man page for more details.])
+
+if test $pkg_failed = yes; then
+ AC_MSG_RESULT([no])
+ _PKG_SHORT_ERRORS_SUPPORTED
+ if test $_pkg_short_errors_supported = yes; then
+ $1[]_PKG_ERRORS=`$PKG_CONFIG --short-errors --print-errors --cflags --libs "$2" 2>&1`
+ else
+ $1[]_PKG_ERRORS=`$PKG_CONFIG --print-errors --cflags --libs "$2" 2>&1`
+ fi
+ # Put the nasty error message in config.log where it belongs
+ echo "$$1[]_PKG_ERRORS" >&AS_MESSAGE_LOG_FD
+
+ m4_default([$4], [AC_MSG_ERROR(
+[Package requirements ($2) were not met:
+
+$$1_PKG_ERRORS
+
+Consider adjusting the PKG_CONFIG_PATH environment variable if you
+installed software in a non-standard prefix.
+
+_PKG_TEXT])[]dnl
+ ])
+elif test $pkg_failed = untried; then
+ AC_MSG_RESULT([no])
+ m4_default([$4], [AC_MSG_FAILURE(
+[The pkg-config script could not be found or is too old. Make sure it
+is in your PATH or set the PKG_CONFIG environment variable to the full
+path to pkg-config.
+
+_PKG_TEXT
+
+To get pkg-config, see <http://pkg-config.freedesktop.org/>.])[]dnl
+ ])
+else
+ $1[]_CFLAGS=$pkg_cv_[]$1[]_CFLAGS
+ $1[]_LIBS=$pkg_cv_[]$1[]_LIBS
+ AC_MSG_RESULT([yes])
+ $3
+fi[]dnl
+])dnl PKG_CHECK_MODULES
+
+
+dnl PKG_CHECK_MODULES_STATIC(VARIABLE-PREFIX, MODULES, [ACTION-IF-FOUND],
+dnl [ACTION-IF-NOT-FOUND])
+dnl ---------------------------------------------------------------------
+dnl Since: 0.29
+dnl
+dnl Checks for existence of MODULES and gathers its build flags with
+dnl static libraries enabled. Sets VARIABLE-PREFIX_CFLAGS from --cflags
+dnl and VARIABLE-PREFIX_LIBS from --libs.
+dnl
+dnl Note that if there is a possibility the first call to
+dnl PKG_CHECK_MODULES_STATIC might not happen, you should be sure to
+dnl include an explicit call to PKG_PROG_PKG_CONFIG in your
+dnl configure.ac.
+AC_DEFUN([PKG_CHECK_MODULES_STATIC],
+[AC_REQUIRE([PKG_PROG_PKG_CONFIG])dnl
+_save_PKG_CONFIG=$PKG_CONFIG
+PKG_CONFIG="$PKG_CONFIG --static"
+PKG_CHECK_MODULES($@)
+PKG_CONFIG=$_save_PKG_CONFIG[]dnl
+])dnl PKG_CHECK_MODULES_STATIC
+
+
+dnl PKG_INSTALLDIR([DIRECTORY])
+dnl -------------------------
+dnl Since: 0.27
+dnl
+dnl Substitutes the variable pkgconfigdir as the location where a module
+dnl should install pkg-config .pc files. By default the directory is
+dnl $libdir/pkgconfig, but the default can be changed by passing
+dnl DIRECTORY. The user can override through the --with-pkgconfigdir
+dnl parameter.
+AC_DEFUN([PKG_INSTALLDIR],
+[m4_pushdef([pkg_default], [m4_default([$1], ['${libdir}/pkgconfig'])])
+m4_pushdef([pkg_description],
+ [pkg-config installation directory @<:@]pkg_default[@:>@])
+AC_ARG_WITH([pkgconfigdir],
+ [AS_HELP_STRING([--with-pkgconfigdir], pkg_description)],,
+ [with_pkgconfigdir=]pkg_default)
+AC_SUBST([pkgconfigdir], [$with_pkgconfigdir])
+m4_popdef([pkg_default])
+m4_popdef([pkg_description])
+])dnl PKG_INSTALLDIR
+
+
+dnl PKG_NOARCH_INSTALLDIR([DIRECTORY])
+dnl --------------------------------
+dnl Since: 0.27
+dnl
+dnl Substitutes the variable noarch_pkgconfigdir as the location where a
+dnl module should install arch-independent pkg-config .pc files. By
+dnl default the directory is $datadir/pkgconfig, but the default can be
+dnl changed by passing DIRECTORY. The user can override through the
+dnl --with-noarch-pkgconfigdir parameter.
+AC_DEFUN([PKG_NOARCH_INSTALLDIR],
+[m4_pushdef([pkg_default], [m4_default([$1], ['${datadir}/pkgconfig'])])
+m4_pushdef([pkg_description],
+ [pkg-config arch-independent installation directory @<:@]pkg_default[@:>@])
+AC_ARG_WITH([noarch-pkgconfigdir],
+ [AS_HELP_STRING([--with-noarch-pkgconfigdir], pkg_description)],,
+ [with_noarch_pkgconfigdir=]pkg_default)
+AC_SUBST([noarch_pkgconfigdir], [$with_noarch_pkgconfigdir])
+m4_popdef([pkg_default])
+m4_popdef([pkg_description])
+])dnl PKG_NOARCH_INSTALLDIR
+
+
+dnl PKG_CHECK_VAR(VARIABLE, MODULE, CONFIG-VARIABLE,
+dnl [ACTION-IF-FOUND], [ACTION-IF-NOT-FOUND])
+dnl -------------------------------------------
+dnl Since: 0.28
+dnl
+dnl Retrieves the value of the pkg-config variable for the given module.
+AC_DEFUN([PKG_CHECK_VAR],
+[AC_REQUIRE([PKG_PROG_PKG_CONFIG])dnl
+AC_ARG_VAR([$1], [value of $3 for $2, overriding pkg-config])dnl
+
+_PKG_CONFIG([$1], [variable="][$3]["], [$2])
+AS_VAR_COPY([$1], [pkg_cv_][$1])
+
+AS_VAR_IF([$1], [""], [$5], [$4])dnl
+])dnl PKG_CHECK_VAR
+
+m4_include([acinclude.m4])
diff --git a/Build/source/texk/dvipng/dvipng-src/color.c b/Build/source/texk/dvipng/dvipng-src/color.c
new file mode 100644
index 00000000000..76cb7004a4a
--- /dev/null
+++ b/Build/source/texk/dvipng/dvipng-src/color.c
@@ -0,0 +1,440 @@
+/* color.c */
+
+/************************************************************************
+
+ Part of the dvipng distribution
+
+ This program is free software: you can redistribute it and/or modify
+ it under the terms of the GNU Lesser General Public License as
+ published by the Free Software Foundation, either version 3 of the
+ License, or (at your option) any later version.
+
+ This program is distributed in the hope that it will be useful, but
+ WITHOUT ANY WARRANTY; without even the implied warranty of
+ MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU
+ Lesser General Public License for more details.
+
+ You should have received a copy of the GNU Lesser General Public
+ License along with this program. If not, see
+ <http://www.gnu.org/licenses/>.
+
+ Copyright (C) 2002-2015,2019 Jan-Åke Larsson
+
+************************************************************************/
+
+#include "dvipng.h"
+
+/*
+ * Color. We delete and recreate the gdImage for each new page. This
+ * means that the stack must contain rgb value not color index.
+ * Besides, the current antialiasing implementation needs rgb anyway.
+*/
+
+struct colorname {
+ struct colorname *next;
+ char* color;
+ char name[1];
+} *colornamep=NULL,*xcp=NULL;
+
+const char *colordef[]={"xcolor.sty","dvipsnam.def",
+ "svgnam.def","x11nam.def",NULL};
+char *xcpname=NULL;
+
+void initcolor(void)
+{
+ csp = 1;
+ cstack[0].red=255;
+ cstack[0].green=255;
+ cstack[0].blue=255;
+ cstack[1].red=0;
+ cstack[1].green=0;
+ cstack[1].blue=0;
+}
+
+static struct colorname * NewColor(const char* prefix, int nprefix,
+ char* name, int nname,
+ char* model, int nmodel,
+ char* values, int nvalues)
+{
+ struct colorname *tmp;
+ if ((tmp=malloc(sizeof(struct colorname)+3+nprefix+nname+nmodel+nvalues))==NULL)
+ Fatal("Cannot malloc space for color name");
+ tmp->color=tmp->name+nprefix+nname+1;
+ strncpy(tmp->name,prefix,nprefix);
+ strncpy(tmp->name+nprefix,name,nname);
+ tmp->name[nprefix+nname]='\0';
+ strncpy(tmp->color,model,nmodel);
+ tmp->color[nmodel]=' ';
+ strncpy(tmp->color+nmodel+1,values,nvalues);
+ tmp->color[nmodel+nvalues+1]='\0';
+ model=tmp->color;
+ while(*model!='\0') {
+ if (*model==',')
+ *model=' ';
+ model++;
+ }
+ DEBUG_PRINT(DEBUG_COLOR,("\n COLOR NAME:\t'%s' '%s'",
+ tmp->name,tmp->color));
+ return(tmp);
+}
+
+#define FINDWORD(s) while(s<max && \
+ (*s=='{'||*s==' '||*s=='%'||*s==';'||*s=='\r'||*s=='\n')) s++
+#define FINDARG(s) while(s<max && *s!='{') s++; FINDWORD(s)
+#define FINDMODELEND(s,n) n=0; while(s<max && *s!='}' && *s!='/') { s++; n++; }
+#define FINDNAMEEND(s,n) n=0; while(s<max && *s!='}' && *s!=',') { s++; n++; }
+#define FINDVALEND(s,n) n=0; while(s<max && *s!='}' && *s!='/' && *s!=';') { s++; n++; }
+#define FINDLASTVALEND(s) while(s<max && *s!='}' && *s!=';') s++
+#define FINDPSNAMEEND(s,n) n=0; while(s<max && *s!='{') { s++; n++; }
+#define BLANKCOMMAS(s)
+
+static struct colorname* LoadColornameFile(const char* filename)
+{
+ struct colorname *list=NULL,*tmp=NULL;
+ char *filepath,*pos,*max;
+ const char *prefix="";
+ char *name,*values,*model;
+ int nprefix=0,nname,nvalues,nmodel;
+ struct filemmap fmmap;
+ boolean mmapfailed;
+
+ filepath=kpse_find_file(filename,kpse_tex_format,false);
+ if (filepath == NULL)
+ return NULL;
+ DEBUG_PRINT(DEBUG_COLOR,("\n OPEN COLOR NAMES:\t'%s'", filepath));
+ mmapfailed=MmapFile(filepath,&fmmap);
+ free(filepath);
+ if (mmapfailed)
+ return NULL;
+ pos=fmmap.data;
+ max=fmmap.data+fmmap.size;
+ while (pos<max && *pos!='\\') pos++;
+ while(pos+9<max && strncmp(pos,"\\endinput",9)!=0) {
+ if ((pos+20<max && strncmp(pos,"\\def\\colornameprefix",20)==0)
+ || (pos+32<max
+ && strncmp(pos,"\\providecommand*\\colornameprefix",32)==0)) {
+ DEBUG_PRINT(DEBUG_COLOR,("\n \t'%.20s'", pos));
+ FINDARG(pos);
+ prefix=pos;
+ FINDNAMEEND(pos,nprefix);
+ DEBUG_PRINT(DEBUG_COLOR,("\n \tCOLOR PREFIX '%.*s'",nprefix,prefix));
+ } else if (pos+17<max && strncmp(pos,"\\DefineNamedColor",17)==0) {
+ DEBUG_PRINT(DEBUG_COLOR,("\n \t'%.17s'", pos));
+ model=NULL;
+ nname=nmodel=nvalues=0;
+ FINDARG(pos); /* skip first argument */
+ FINDARG(pos); /* find second argument: color name */
+ name=pos;
+ FINDNAMEEND(pos,nname);
+ FINDARG(pos); /* find third argument: color model */
+ model=pos;
+ FINDMODELEND(pos,nmodel);
+ FINDARG(pos); /* find fourth argument: color values */
+ values=pos;
+ FINDVALEND(pos,nvalues);
+ tmp=NewColor(prefix,nprefix,name,nname,model,nmodel,values,nvalues);
+ tmp->next=list;
+ list=tmp;
+ } else if ((pos+15<max && strncmp(pos,"\\definecolorset",15)==0)
+ || (pos+16<max && strncmp(pos,"\\preparecolorset",16)==0)) {
+ char *model;
+ DEBUG_PRINT(DEBUG_COLOR,("\n \t'%.15s'", pos));
+ FINDARG(pos); /* find first argument: color model */
+ model=pos;
+ FINDMODELEND(pos,nmodel);
+ FINDARG(pos); /* skip second argument */
+ FINDARG(pos); /* skip third argument */
+ FINDARG(pos); /* find fourth argument: names, values */
+ while(pos<max && *pos!='}'){
+ name=pos;
+ FINDNAMEEND(pos,nname);
+ pos++;
+ values=pos;
+ FINDVALEND(pos,nvalues);
+ FINDLASTVALEND(pos);
+ tmp=NewColor(prefix,nprefix,name,nname,model,nmodel,values,nvalues);
+ tmp->next=list;
+ list=tmp;
+ FINDWORD(pos);
+ }
+ } else {
+ pos++;
+ while (pos<max && *pos!='\\') pos++;
+ }
+ }
+ UnMmapFile(&fmmap);
+ return(list);
+}
+
+static void ClearXColorPrologue(void)
+{
+ struct colorname *next;
+ while (xcp) {
+ next=xcp->next;
+ free(xcp);
+ xcp=next;
+ }
+ if (xcpname!=NULL) {
+ free(xcpname);
+ xcpname=NULL;
+ }
+}
+
+void ClearColorNames(void)
+{
+ struct colorname *next;
+ while (colornamep) {
+ next=colornamep->next;
+ free(colornamep);
+ colornamep=next;
+ }
+ ClearXColorPrologue();
+}
+
+void InitXColorPrologue(const char* name)
+{
+ ClearXColorPrologue();
+ if ((xcpname=malloc(strlen(name)+1))==NULL)
+ Fatal("cannot malloc memory for xcolor prologue name");
+ strcpy(xcpname,name);
+}
+
+static struct colorname* LoadXColorPrologue(void)
+{
+ struct colorname *list=NULL,*tmp=NULL;
+ char *filepath,*pos,*max;
+ const char *prefix="";
+ char *name,*values,*model;
+ int nprefix=0,nname,nvalues,nmodel;
+ struct filemmap fmmap;
+ boolean mmapfailed;
+
+ filepath=kpse_find_file(xcpname,kpse_program_text_format,false);
+ if (filepath == NULL)
+ return NULL;
+ DEBUG_PRINT(DEBUG_COLOR,("\n OPEN XCOLOR PROLOGUE:\t'%s'", filepath));
+ mmapfailed = MmapFile(filepath,&fmmap);
+ free(filepath);
+ if (mmapfailed)
+ return NULL;
+ pos=fmmap.data;
+ max=fmmap.data+fmmap.size;
+ while(pos<max) {
+ while (pos<max && *pos!='/') pos++;
+ if (*pos=='/') {
+ nname=nmodel=nvalues=0;
+ name=++pos; /* first argument: color name */
+ FINDPSNAMEEND(pos,nname);
+ values=++pos; /* second argument: color values */
+ FINDVALEND(pos,nvalues);
+ model=pos+3; /* third argument: color model, prefixed by 'XC' */
+ while(pos<max && *pos!=' ' && *pos!='\r' && *pos!='\n') pos++;
+ nmodel=pos-model;
+ tmp=NewColor(prefix,nprefix,name,nname,model,nmodel,values,nvalues);
+ tmp->next=list;
+ list=tmp;
+ }
+ }
+ UnMmapFile(&fmmap);
+ return(list);
+}
+
+#define FTO255(a) ((int) (255*a+0.5))
+#define WARN_IF_FAILED(a,b) if (a==b) { page_flags |= PAGE_GAVE_WARN; \
+ Warning("missing color-specification value, treated as zero"); }
+
+#define SKIPSPACES(s) while(s && *s==' ' && *s!='\0') s++
+#define NEXTFLOAT255(c) FTO255(strtod(c,&end)); WARN_IF_FAILED(c,end); c=end
+#define NEXTFLOAT(c) strtod(c,&end); WARN_IF_FAILED(c,end); c=end
+#define NEXTINT(c) strtol(c,&end,10); WARN_IF_FAILED(c,end); c=end
+#define NEXTHEX(c) strtol(c,&end,16); WARN_IF_FAILED(c,end); c=end
+
+void stringrgb(const char* color,int *r,int *g,int *b)
+{
+ char* end;
+ static int unloaded=0;
+
+ DEBUG_PRINT(DEBUG_COLOR,("\n COLOR SPEC:\t'%s' (",color));
+ SKIPSPACES(color);
+ if (strcmp(color,"Black")==0) {
+ *r = *g = *b = 0;
+ } else if (strcmp(color,"White")==0) {
+ *r = *g = *b = 255;
+ } else if (strncmp(color,"gray ",5)==0) {
+ color+=5;
+ *r = *g = *b = NEXTFLOAT255(color);
+ } else if (strncmp(color,"rgb ",4)==0) {
+ color+=4;
+ *r = NEXTFLOAT255(color);
+ *g = NEXTFLOAT255(color);
+ *b = NEXTFLOAT255(color);
+ } else if (strncmp(color,"Gray ",5)==0) {
+ color+=5;
+ *r = *g = *b = NEXTINT(color);
+ } else if (strncmp(color,"RGB ",4)==0) {
+ color+=4;
+ *r = NEXTINT(color);
+ *g = NEXTINT(color);
+ *b = NEXTINT(color);
+ } else if (strncmp(color,"HTML ",5)==0) {
+ color+=5;
+ *b = NEXTHEX(color);
+ *r = *b/65536;
+ *g = *b/256;
+ *b -= *g*256;
+ *g -= *r*256;
+ } else if (strncmp(color,"cmy ",4)==0
+ || strncmp(color,"cmyk ",5)==0) {
+ int c,m,y,k;
+ color+=3;
+ k=(*color=='k');
+ if (k)
+ color++;
+ c = NEXTFLOAT255(color);
+ m = NEXTFLOAT255(color);
+ y = NEXTFLOAT255(color);
+ if (k)
+ k = NEXTFLOAT255(color);
+ *r = c+k<255 ? 255-(c+k) : 0;
+ *g = m+k<255 ? 255-(m+k) : 0;
+ *b = y+k<255 ? 255-(y+k) : 0;
+ } else if (strncmp(color,"hsb ",4)==0
+ || strncmp(color,"HSB ",4)==0) {
+ /* The hsb and HSB models really need more presicion.
+ Use double and convert back*/
+ double hu,sa,br,f,R,G,B;
+ int i;
+ if (*color=='h') {
+ color+=4;
+ hu = NEXTFLOAT(color);
+ sa = NEXTFLOAT(color);
+ br = NEXTFLOAT(color);
+ } else {
+ color+=4;
+ hu = (float)NEXTINT(color); hu /= 255;
+ sa = (float)NEXTINT(color); sa /= 255;
+ br = (float)NEXTINT(color); br /= 255;
+ }
+ i=6*hu;
+ f=6*hu-i;
+ switch(i) {
+ case 0:
+ R = br*(1-sa*0); G = br*(1-sa*(1-f)); B = br*(1-sa*1); break;
+ case 1:
+ R = br*(1-sa*f); G = br*(1-sa*0); B = br*(1-sa*1); break;
+ case 2:
+ R = br*(1-sa*1); G = br*(1-sa*0); B = br*(1-sa*(1-f)); break;
+ case 3:
+ R = br*(1-sa*1); G = br*(1-sa*f); B = br*(1-sa*0); break;
+ case 4:
+ R = br*(1-sa*(1-f)); G = br*(1-sa*1); B = br*(1-sa*0); break;
+ case 5:
+ R = br*(1-sa*0); G = br*(1-sa*1); B = br*(1-sa*f); break;
+ default:
+ R = br*(1-sa*0); G = br*(1-sa*1); B = br*(1-sa*1);
+ }
+ *r=FTO255(R);
+ *g=FTO255(G);
+ *b=FTO255(B);
+ } else {
+ /* Model not found, probably a color name */
+ struct colorname *tmp;
+
+ if (xcp==NULL && xcpname!=NULL)
+ xcp=LoadXColorPrologue();
+ tmp=xcp;
+ while(tmp!=NULL && strcmp(color,tmp->name)!=0)
+ tmp=tmp->next;
+ if (tmp==NULL) {
+ while (colornamep==NULL && colordef[unloaded]!=NULL)
+ colornamep=LoadColornameFile(colordef[unloaded++]);
+ tmp=colornamep;
+ while(tmp!=NULL && strcmp(color,tmp->name)!=0) {
+ while (tmp->next==NULL && colordef[unloaded]!=NULL)
+ tmp->next=LoadColornameFile(colordef[unloaded++]);
+ tmp=tmp->next;
+ }
+ }
+ if (tmp!=NULL) {
+ /* Found: one-level recursion */
+ DEBUG_PRINT(DEBUG_COLOR,("\n ---RECURSION--- "))
+ stringrgb(tmp->color,r,g,b);
+ } else {
+ /* Not found, warn */
+ page_flags |= PAGE_GAVE_WARN;
+ Warning("unimplemented color specification '%s'",color);
+ }
+ }
+ DEBUG_PRINT(DEBUG_COLOR,("%d %d %d) ",*r,*g,*b))
+}
+
+void background(const char* p)
+{
+ stringrgb(p, &cstack[0].red, &cstack[0].green, &cstack[0].blue);
+ DEBUG_PRINT(DEBUG_COLOR,("\n BACKGROUND:\t(%d %d %d) ",
+ cstack[0].red, cstack[0].green, cstack[0].blue));
+}
+
+void pushcolor(const char * p)
+{
+ if ( ++csp == STACK_SIZE )
+ Fatal("out of color stack space") ;
+ stringrgb(p, &cstack[csp].red, &cstack[csp].green, &cstack[csp].blue);
+ DEBUG_PRINT(DEBUG_COLOR,("\n COLOR PUSH:\t(%d %d %d) ",
+ cstack[csp].red, cstack[csp].green, cstack[csp].blue))
+}
+
+void popcolor(void)
+{
+ if (csp > 1) csp--; /* Last color is global */
+ DEBUG_PRINT(DEBUG_COLOR,("\n COLOR POP\t"))
+}
+
+void resetcolorstack(const char * p)
+{
+ if ( csp > 1 )
+ Warning("global color change within nested colors");
+ csp=0;
+ pushcolor(p) ;
+ DEBUG_PRINT(DEBUG_COLOR,("\n RESET COLOR:\tbottom of stack:"))
+}
+
+void StoreColorStack(struct page_list *tpagep)
+{
+ int i=0;
+
+ DEBUG_PRINT(DEBUG_COLOR,("\n STORE COLOR STACK:\t %d ", csp));
+ tpagep->csp=csp;
+ while ( i <= csp ) {
+ DEBUG_PRINT(DEBUG_COLOR,("\n COLOR STACK:\t %d (%d %d %d) ",i,
+ cstack[i].red, cstack[i].green, cstack[i].blue));
+ tpagep->cstack[i].red = cstack[i].red;
+ tpagep->cstack[i].green = cstack[i].green;
+ tpagep->cstack[i].blue = cstack[i].blue;
+ i++;
+ }
+}
+
+void ReadColorStack(struct page_list *tpagep)
+{
+ int i=0;
+
+ DEBUG_PRINT(DEBUG_COLOR,("\n READ COLOR STACK:\t %d ", tpagep->csp));
+ csp=tpagep->csp;
+ while ( i <= tpagep->csp ) {
+ DEBUG_PRINT(DEBUG_COLOR,("\n COLOR STACK:\t %d (%d %d %d) ",i,
+ cstack[i].red, cstack[i].green, cstack[i].blue));
+ cstack[i].red = tpagep->cstack[i].red;
+ cstack[i].green = tpagep->cstack[i].green;
+ cstack[i].blue = tpagep->cstack[i].blue;
+ i++;
+ }
+}
+
+void StoreBackgroundColor(struct page_list *tpagep)
+{
+ /* Background color changes affect the _whole_ page */
+ tpagep->cstack[0].red = cstack[0].red;
+ tpagep->cstack[0].green = cstack[0].green;
+ tpagep->cstack[0].blue = cstack[0].blue;
+}
diff --git a/Build/source/texk/dvipng/dvipng-src/commands.h b/Build/source/texk/dvipng/dvipng-src/commands.h
new file mode 100644
index 00000000000..e2a5404bb32
--- /dev/null
+++ b/Build/source/texk/dvipng/dvipng-src/commands.h
@@ -0,0 +1,196 @@
+/* commands.h */
+
+/************************************************************************
+
+ Part of the dvipng distribution
+
+ This program is free software: you can redistribute it and/or modify
+ it under the terms of the GNU Lesser General Public License as
+ published by the Free Software Foundation, either version 3 of the
+ License, or (at your option) any later version.
+
+ This program is distributed in the hope that it will be useful, but
+ WITHOUT ANY WARRANTY; without even the implied warranty of
+ MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU
+ Lesser General Public License for more details.
+
+ You should have received a copy of the GNU Lesser General Public
+ License along with this program. If not, see
+ <http://www.gnu.org/licenses/>.
+
+ Copyright (C) 2002-2008 Jan-Åke Larsson
+
+************************************************************************/
+
+/* DVI COMMANDS */
+#define DVIFORMAT 2
+
+#define SETC_000 0 /* typeset character 0 and move right */
+#define SETC_127 127 /* typeset character 127 and move right */
+#define SET1 128 /* typeset a character and move right */
+#define SET2 129 /* ??? */
+#define SET3 130 /* ??? */
+#define SET4 131 /* ??? */
+#define SET_RULE 132 /* typeset a rule and move right */
+#define PUT1 133 /* typeset a character */
+#define PUT2 134 /* ??? */
+#define PUT3 135 /* ??? */
+#define PUT4 136 /* ??? */
+#define PUT_RULE 137 /* typeset a rule */
+#define NOP 138 /* no operation */
+#define BOP 139 /* beginning of page */
+#define EOP 140 /* ending of page */
+#define PUSH 141 /* save the current positions */
+#define POP 142 /* restore previous positions */
+#define RIGHT1 143 /* move right */
+#define RIGHT2 144 /* ??? */
+#define RIGHT3 145 /* ??? */
+#define RIGHT4 146 /* ??? */
+#define W0 147 /* move right by |w| */
+#define W1 148 /* move right and set |w| */
+#define W2 149 /* ??? */
+#define W3 150 /* ??? */
+#define W4 151 /* ??? */
+#define X0 152 /* move right by |x| */
+#define X1 153 /* move right and set |x| */
+#define X2 154 /* ??? */
+#define X3 155 /* ??? */
+#define X4 156 /* ??? */
+#define DOWN1 157 /* move down */
+#define DOWN2 158 /* ??? */
+#define DOWN3 159 /* ??? */
+#define DOWN4 160 /* ??? */
+#define Y0 161 /* move down by |y| */
+#define Y1 162 /* move down and set |y| */
+#define Y2 163 /* ??? */
+#define Y3 164 /* ??? */
+#define Y4 165 /* ??? */
+#define Z0 166 /* move down by |z| */
+#define Z1 167 /* move down and set |z| */
+#define Z2 168 /* ??? */
+#define Z3 169 /* ??? */
+#define Z4 170 /* ??? */
+#define FONT_00 171 /* set current font to 0 */
+#define FONT_63 234 /* set current font to 63 */
+#define FNT1 235 /* set current font */
+#define FNT2 236 /* Same as FNT1, except that arg is 2 bytes */
+#define FNT3 237 /* Same as FNT1, except that arg is 3 bytes */
+#define FNT4 238 /* Same as FNT1, except that arg is 4 bytes */
+#define XXX1 239 /* extension to \.DVI primitives */
+#define XXX2 240 /* Like XXX1, but 0<=k<65536 */
+#define XXX3 241 /* Like XXX1, but 0<=k<@t$2^{24}$@> */
+#define XXX4 242 /* potentially long extension to \.DVI
+ primitives */
+#define FNT_DEF1 243 /* define the meaning of a font number */
+#define FNT_DEF2 244 /* ??? */
+#define FNT_DEF3 245 /* ??? */
+#define FNT_DEF4 246 /* ??? */
+#define PRE 247 /* preamble */
+#define POST 248 /* postamble beginning */
+#define POST_POST 249 /* postamble ending */
+
+/* undefined_commands 250,251,252,253,254,255 */
+
+EXTERN const int8_t dvi_commandlength[256]
+#ifdef MAIN
+={
+ 1,1,1,1,1,1,1,1,1,1,
+ 1,1,1,1,1,1,1,1,1,1,
+ 1,1,1,1,1,1,1,1,1,1,
+ 1,1,1,1,1,1,1,1,1,1,
+ 1,1,1,1,1,1,1,1,1,1,
+ 1,1,1,1,1,1,1,1,1,1,
+ 1,1,1,1,1,1,1,1,1,1,
+ 1,1,1,1,1,1,1,1,1,1,
+ 1,1,1,1,1,1,1,1,1,1,
+ 1,1,1,1,1,1,1,1,1,1,
+ 1,1,1,1,1,1,1,1,1,1,
+ 1,1,1,1,1,1,1,1,1,1,
+ 1,1,1,1,1,1,1,1, /* SETC_000 --- SETC_127 */
+ 2,3,4,5,9, /* SET1 --- SET4, SET_RULE */
+ 2,3,4,5,9, /* PUT1 --- PUT4, PUT_RULE */
+ 1,45,1,1,1, /* NOP, BOP, EOP, PUSH, POP */
+ 2,3,4,5, /* RIGHT1 --- RIGHT4 */
+ 1,2,3,4,5, /* W0 --- W4 */
+ 1,2,3,4,5, /* X0 --- X4 */
+ 2,3,4,5, /* DOWN1 --- DOWN4 */
+ 1,2,3,4,5, /* Y0 --- Y4 */
+ 1,2,3,4,5, /* Z0 --- Z4 */
+ 1,1,1,1,1,1,1,1,1,1,
+ 1,1,1,1,1,1,1,1,1,1,
+ 1,1,1,1,1,1,1,1,1,1,
+ 1,1,1,1,1,1,1,1,1,1,
+ 1,1,1,1,1,1,1,1,1,1,
+ 1,1,1,1,1,1,1,1,1,1,
+ 1,1,1,1, /* FONT_00 --- FONT_63 */
+ 2,3,4,5, /* FNT1 --- FNT4 */
+ 2,3,4,5, /* XXX1 --- XXX4 + special string */
+ 16,17,18,19, /* FNT_DEF1 --- FNT_DEF4 + font name */
+ 15, /* PRE + TeX comment */
+ 29, /* POST */
+ 10, /* POST_POST minimum */
+ -1,-1,-1,-1,-1,-1 /* undefined */
+}
+#endif
+;
+
+EXTERN const char* dvi_commands[256]
+#ifdef MAIN
+={
+"SETC_000","SETC_001","SETC_002","SETC_003","SETC_004",
+"SETC_005","SETC_006","SETC_007","SETC_008","SETC_009",
+"SETC_010","SETC_011","SETC_012","SETC_013","SETC_014",
+"SETC_015","SETC_016","SETC_017","SETC_018","SETC_019",
+"SETC_020","SETC_021","SETC_022","SETC_023","SETC_024",
+"SETC_025","SETC_026","SETC_027","SETC_028","SETC_029",
+"SETC_030","SETC_031","SETC_032","SETC_033","SETC_034",
+"SETC_035","SETC_036","SETC_037","SETC_038","SETC_039",
+"SETC_040","SETC_041","SETC_042","SETC_043","SETC_044",
+"SETC_045","SETC_046","SETC_047","SETC_048","SETC_049",
+"SETC_050","SETC_051","SETC_052","SETC_053","SETC_054",
+"SETC_055","SETC_056","SETC_057","SETC_058","SETC_059",
+"SETC_060","SETC_061","SETC_062","SETC_063","SETC_064",
+"SETC_065","SETC_066","SETC_067","SETC_068","SETC_069",
+"SETC_070","SETC_071","SETC_072","SETC_073","SETC_074",
+"SETC_075","SETC_076","SETC_077","SETC_078","SETC_079",
+"SETC_080","SETC_081","SETC_082","SETC_083","SETC_084",
+"SETC_085","SETC_086","SETC_087","SETC_088","SETC_089",
+"SETC_090","SETC_091","SETC_092","SETC_093","SETC_094",
+"SETC_095","SETC_096","SETC_097","SETC_098","SETC_099",
+"SETC_100","SETC_101","SETC_102","SETC_103","SETC_104",
+"SETC_105","SETC_106","SETC_107","SETC_108","SETC_109",
+"SETC_110","SETC_111","SETC_112","SETC_113","SETC_114",
+"SETC_115","SETC_116","SETC_117","SETC_118","SETC_119",
+"SETC_120","SETC_121","SETC_122","SETC_123","SETC_124",
+"SETC_125","SETC_126","SETC_127",
+"SET1","SET2","SET3","SET4","SET_RULE",
+"PUT1","PUT2","PUT3","PUT4","PUT_RULE",
+"NOP","BOP","EOP","PUSH","POP",
+"RIGHT1","RIGHT2","RIGHT3","RIGHT4",
+"W0","W1","W2","W3","W4",
+"X0","X1","X2","X3","X4",
+"DOWN1","DOWN2","DOWN3","DOWN4",
+"Y0","Y1","Y2","Y3","Y4",
+"Z0","Z1","Z2","Z3","Z4",
+"FONT_00","FONT_01","FONT_02","FONT_03","FONT_04",
+"FONT_05","FONT_06","FONT_07","FONT_08","FONT_09",
+"FONT_10","FONT_11","FONT_12","FONT_13","FONT_14",
+"FONT_15","FONT_16","FONT_17","FONT_18","FONT_19",
+"FONT_20","FONT_21","FONT_22","FONT_23","FONT_24",
+"FONT_25","FONT_26","FONT_27","FONT_28","FONT_29",
+"FONT_30","FONT_31","FONT_32","FONT_33","FONT_34",
+"FONT_35","FONT_36","FONT_37","FONT_38","FONT_39",
+"FONT_40","FONT_41","FONT_42","FONT_43","FONT_44",
+"FONT_45","FONT_46","FONT_47","FONT_48","FONT_49",
+"FONT_50","FONT_51","FONT_52","FONT_53","FONT_54",
+"FONT_55","FONT_56","FONT_57","FONT_58","FONT_59",
+"FONT_60","FONT_61","FONT_62","FONT_63",
+"FNT1","FNT2","FNT3","FNT4",
+"XXX1","XXX2","XXX3","XXX4",
+"FNT_DEF1","FNT_DEF2","FNT_DEF3","FNT_DEF4",
+"PRE","POST","POST_POST",
+"UNDEF_250","UNDEF_251","UNDEF_252","UNDEF_253","UNDEF_254","UNDEF_255"
+}
+#endif
+;
+
diff --git a/Build/source/texk/dvipng/dvipng-src/config.h.in b/Build/source/texk/dvipng/dvipng-src/config.h.in
new file mode 100644
index 00000000000..a8ba47bb6e1
--- /dev/null
+++ b/Build/source/texk/dvipng/dvipng-src/config.h.in
@@ -0,0 +1,223 @@
+/* config.h.in. Generated from configure.ac by autoheader. */
+
+/* Define as 1 to get the debug (-d) option. */
+#undef DEBUG
+
+/* The environment setting for $SELFAUTODIR */
+#undef ENV_SELFAUTODIR
+
+/* The environment setting for $SELFAUTOLOC */
+#undef ENV_SELFAUTOLOC
+
+/* The environment setting for $SELFAUTOPARENT */
+#undef ENV_SELFAUTOPARENT
+
+/* Define as the path to GhostScript. */
+#undef GS_PATH
+
+/* Define to 1 if you don't have `vprintf' but do have `_doprnt.' */
+#undef HAVE_DOPRNT
+
+/* Define to 1 if you have the `dup2' function. */
+#undef HAVE_DUP2
+
+/* Define to 1 if you have the <fcntl.h> header file. */
+#undef HAVE_FCNTL_H
+
+/* Define to 1 if you have the `fork' function. */
+#undef HAVE_FORK
+
+/* Define to 1 if you have freetype2 */
+#undef HAVE_FT2
+
+/* Define to 1 if you have the `ftime' function. */
+#undef HAVE_FTIME
+
+/* Define to 1 if you have the `FT_Library_Version' function. */
+#undef HAVE_FT_LIBRARY_VERSION
+
+/* Define to 1 if you have the `gdImageCreateFromJpeg' function. */
+#undef HAVE_GDIMAGECREATEFROMJPEG
+
+/* Define to 1 if you have the `gdImageCreateFromPngPtr' function. */
+#undef HAVE_GDIMAGECREATEFROMPNGPTR
+
+/* Define to 1 if you have the `gdImageCreateTrueColor' function. */
+#undef HAVE_GDIMAGECREATETRUECOLOR
+
+/* Define to 1 if you have the `gdImageGif' function. */
+#undef HAVE_GDIMAGEGIF
+
+/* Define to 1 if you have the `gdImagePngEx' function. */
+#undef HAVE_GDIMAGEPNGEX
+
+/* Define to 1 if you have the <gd.h> header file. */
+#undef HAVE_GD_H
+
+/* Define to 1 if you have the `getpagesize' function. */
+#undef HAVE_GETPAGESIZE
+
+/* Define to 1 if you have the `gettimeofday' function. */
+#undef HAVE_GETTIMEOFDAY
+
+/* Define to 1 if you have the <inttypes.h> header file. */
+#undef HAVE_INTTYPES_H
+
+/* Define to 1 if you have the <kpathsea/kpathsea.h> header file. */
+#undef HAVE_KPATHSEA_KPATHSEA_H
+
+/* Define to 1 if your kpathsea has kpse_enc_format */
+#undef HAVE_KPSE_ENC_FORMATS
+
+/* Define to 1 if you have the `gd' library (-lgd). */
+#undef HAVE_LIBGD
+
+/* Define to 1 if you have the <libgen.h> header file. */
+#undef HAVE_LIBGEN_H
+
+/* Define to 1 if you have the `kpathsea' library (-lkpathsea). */
+#undef HAVE_LIBKPATHSEA
+
+/* Define to 1 if you have the `m' library (-lm). */
+#undef HAVE_LIBM
+
+/* Define to 1 if you have the `png' library (-lpng). */
+#undef HAVE_LIBPNG
+
+/* Define to 1 if you have the `z' library (-lz). */
+#undef HAVE_LIBZ
+
+/* Define to 1 if you have the <memory.h> header file. */
+#undef HAVE_MEMORY_H
+
+/* Define to 1 if you have the `memset' function. */
+#undef HAVE_MEMSET
+
+/* Define to 1 if you have a working `mmap' system call. */
+#undef HAVE_MMAP
+
+/* Define to 1 if you have the `munmap' function. */
+#undef HAVE_MUNMAP
+
+/* Define to 1 if you have the <png.h> header file. */
+#undef HAVE_PNG_H
+
+/* Define to 1 if you have the `pow' function. */
+#undef HAVE_POW
+
+/* Define to 1 if you have the `putenv' function. */
+#undef HAVE_PUTENV
+
+/* Define to 1 if stdbool.h conforms to C99. */
+#undef HAVE_STDBOOL_H
+
+/* Define to 1 if you have the <stdint.h> header file. */
+#undef HAVE_STDINT_H
+
+/* Define to 1 if you have the <stdlib.h> header file. */
+#undef HAVE_STDLIB_H
+
+/* Define to 1 if you have the `strchr' function. */
+#undef HAVE_STRCHR
+
+/* Define to 1 if you have the <strings.h> header file. */
+#undef HAVE_STRINGS_H
+
+/* Define to 1 if you have the <string.h> header file. */
+#undef HAVE_STRING_H
+
+/* Define to 1 if you have the `strncasecmp' function. */
+#undef HAVE_STRNCASECMP
+
+/* Define to 1 if you have the `strrchr' function. */
+#undef HAVE_STRRCHR
+
+/* Define to 1 if you have the `strstr' function. */
+#undef HAVE_STRSTR
+
+/* Define to 1 if you have the `strtol' function. */
+#undef HAVE_STRTOL
+
+/* Define to 1 if you have the <sys/param.h> header file. */
+#undef HAVE_SYS_PARAM_H
+
+/* Define to 1 if you have the <sys/stat.h> header file. */
+#undef HAVE_SYS_STAT_H
+
+/* Define to 1 if you have the <sys/time.h> header file. */
+#undef HAVE_SYS_TIME_H
+
+/* Define to 1 if you have the <sys/types.h> header file. */
+#undef HAVE_SYS_TYPES_H
+
+/* Define to 1 if you have <sys/wait.h> that is POSIX.1 compatible. */
+#undef HAVE_SYS_WAIT_H
+
+/* Define to 1 if you have the `texlive_gs_init' function. */
+#undef HAVE_TEXLIVE_GS_INIT
+
+/* Define to 1 if you have the <unistd.h> header file. */
+#undef HAVE_UNISTD_H
+
+/* Define to 1 if you have the `vfork' function. */
+#undef HAVE_VFORK
+
+/* Define to 1 if you have the <vfork.h> header file. */
+#undef HAVE_VFORK_H
+
+/* Define to 1 if you have the `vprintf' function. */
+#undef HAVE_VPRINTF
+
+/* Define to 1 if `fork' works. */
+#undef HAVE_WORKING_FORK
+
+/* Define to 1 if `vfork' works. */
+#undef HAVE_WORKING_VFORK
+
+/* Define to 1 if the system has the type `_Bool'. */
+#undef HAVE__BOOL
+
+/* Define to the address where bug reports for this package should be sent. */
+#undef PACKAGE_BUGREPORT
+
+/* Define to the full name of this package. */
+#undef PACKAGE_NAME
+
+/* Define to the full name and version of this package. */
+#undef PACKAGE_STRING
+
+/* Define to the one symbol short name of this package. */
+#undef PACKAGE_TARNAME
+
+/* Define to the home page for this package. */
+#undef PACKAGE_URL
+
+/* Define to the version of this package. */
+#undef PACKAGE_VERSION
+
+/* Define to 1 if you have the ANSI C header files. */
+#undef STDC_HEADERS
+
+/* Define to 1 if you can safely include both <sys/time.h> and <time.h>. */
+#undef TIME_WITH_SYS_TIME
+
+/* Define as 1 to get execution time output. */
+#undef TIMING
+
+/* Define to empty if `const' does not conform to ANSI C. */
+#undef const
+
+/* Define to `long long' if <inttypes.h> does not define it. */
+#undef int64_t
+
+/* Define to `int' if <sys/types.h> does not define. */
+#undef pid_t
+
+/* Define to `unsigned int' if <sys/types.h> does not define. */
+#undef size_t
+
+/* Define to `unsigned long long' if <inttypes.h> does not define it. */
+#undef uint64_t
+
+/* Define as `fork' if `vfork' does not work. */
+#undef vfork
diff --git a/Build/source/texk/dvipng/dvipng-src/configure.ac b/Build/source/texk/dvipng/dvipng-src/configure.ac
new file mode 100644
index 00000000000..62e252deab5
--- /dev/null
+++ b/Build/source/texk/dvipng/dvipng-src/configure.ac
@@ -0,0 +1,223 @@
+# configure.ac
+
+#************************************************************************
+#
+# Part of the dvipng distribution
+#
+# This program is free software: you can redistribute it and/or modify
+# it under the terms of the GNU Lesser General Public License as
+# published by the Free Software Foundation, either version 3 of the
+# License, or (at your option) any later version.
+#
+# This program is distributed in the hope that it will be useful, but
+# WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU
+# Lesser General Public License for more details.
+#
+# You should have received a copy of the GNU Lesser General Public
+# License along with this program. If not, see
+# <http://www.gnu.org/licenses/>.
+#
+# Copyright (C) 2002-2015,2019 Jan-Åke Larsson
+#
+#************************************************************************
+
+# Process this file with autoconf to produce a configure script.
+AC_INIT([dvipng], [1.17], [dvipng@nongnu.org])
+AC_CONFIG_SRCDIR([dvipng.c])
+
+AC_ARG_ENABLE(debug,
+ AC_HELP_STRING([--disable-debug],[Compile without debug (-d) option]),
+ [ if test "$enableval" = yes ; then
+ AC_DEFINE(DEBUG, 1, [Define as 1 to get the debug (-d) option.])
+ fi ],
+ [ enable_debug="yes";
+ AC_DEFINE(DEBUG, 1, [Define as 1 to get the debug (-d) option.])])
+AC_ARG_ENABLE(timing,
+ AC_HELP_STRING([--enable-timing],[Output execution time of dvipng]),
+ [ if test "$enableval" = yes ; then
+ AC_DEFINE(TIMING, 1, [Define as 1 to get execution time output.])
+ fi ])
+
+# Checks for programs.
+AC_SET_MAKE
+AC_PROG_CC
+AC_PROG_INSTALL
+AC_PROG_LN_S
+AC_ARG_WITH(gs,
+ AC_HELP_STRING([--with-gs=/PATH/TO/gs],[Hard-wire the location of GhostScript]),
+ [if test "x$withval" != xno ; then
+ AC_PATH_PROG(GS,["$withval"])
+ AC_DEFINE_UNQUOTED(GS_PATH, "$GS", [Define as the path to GhostScript.])
+ GS_CHECK_DEVICES
+ fi],
+ [AC_CHECK_PROG(GS,gs,gs)
+ AC_DEFINE_UNQUOTED(GS_PATH, "gs", [Define as the path to GhostScript.])
+ if test -n "$GS"; then
+ GS_CHECK_DEVICES
+ else
+ AC_MSG_WARN([Cannot find GhostScript in your PATH])
+ fi
+])
+
+# Checks for libraries.
+AC_CHECK_LIB(m, pow)
+AC_CHECK_LIB(z, deflate)
+AC_CHECK_LIB([png], [png_read_image],,
+ [AC_MSG_ERROR([cannot find/use libpng])])
+AC_CHECK_LIB([gd], [gdImageCreate],,
+ [AC_MSG_ERROR([cannot find/use libgd
+This drawing library can be downloaded at
+https://bitbucket.org/libgd/gd-libgd/downloads])])
+AC_CHECK_LIB([kpathsea], [kpse_set_program_name],,
+ AC_MSG_ERROR([cannot find/use libkpathsea]))
+
+# Checks for header files.
+AC_HEADER_STDC
+AC_CHECK_HEADERS([gd.h png.h kpathsea/kpathsea.h],,
+ [AC_MSG_ERROR([cannot find/use $ac_header])])
+AC_CHECK_HEADERS([libgen.h])
+PSFONTS_O=""
+AC_SUBST(PSFONTS_O)
+PKG_CHECK_MODULES([FT2], [freetype2 >= 6.1.0],
+ [CFLAGS="$FT2_CFLAGS $CFLAGS"
+ LIBS="$FT2_LIBS $LIBS"
+ PSFONTS_O="sfd.o ft.o enc.o fontmap.o tfm.o"
+ AC_DEFINE(HAVE_FT2, 1, [Define to 1 if you have freetype2])
+ ac_have_freetype2="yes"],
+ [ac_have_freetype2="no"])
+AC_HEADER_SYS_WAIT
+AC_HEADER_TIME
+AC_HEADER_STDBOOL
+AC_CHECK_HEADERS([fcntl.h sys/time.h])
+
+# Checks for typedefs, structures, and compiler characteristics.
+AC_C_CONST
+AC_TYPE_PID_T
+AC_TYPE_SIZE_T
+if test "$ac_cv_header_inttypes_h" = "yes"; then
+ # Sometimes we want to use gcc -ansi -pedantic as a portability test
+ # The typedef of int64_t is not in the system header file in that
+ # case. Then, #define int64_t as "long long", which is non-ansi, but
+ # is present in most modern compilers. Using a #define rather than a
+ # typedef can be a problem, but in dvipng int64_t is only used as
+ # typecast, and there are no problems. autoconf 2.13 equivalent:
+ # AC_CHECK_TYPE(int64_t, long long)
+ # AC_CHECK_TYPE(uint64_t, unsigned long long)
+ AC_CHECK_TYPE([int64_t],,
+ [AC_DEFINE_UNQUOTED([int64_t], [long long],
+ [Define to `long long' if
+ <inttypes.h> does not define it.])])
+ AC_CHECK_TYPE([uint64_t],,
+ [AC_DEFINE_UNQUOTED([uint64_t], [unsigned long long],
+ [Define to `unsigned long long' if
+ <inttypes.h> does not define it.])])
+fi
+AC_HAS_KPSE_ENC_FORMATS
+
+
+# Checks for library functions.
+AC_FUNC_FORK
+# We always allocate nonzero chunks
+# AC_FUNC_MALLOC
+AC_FUNC_MMAP
+# AC_FUNC_REALLOC
+AC_FUNC_STRTOD
+AC_FUNC_VPRINTF
+AC_CHECK_FUNCS([dup2 memset munmap pow putenv strchr strrchr strtol strstr strncasecmp])
+if test "$enable_timing" = "yes"; then
+ AC_CHECK_FUNCS([ftime gettimeofday])
+fi
+AC_CHECK_FUNCS([gdImageCreateTrueColor gdImageCreateFromJpeg gdImagePngEx gdImageCreateFromPngPtr gdImageGif FT_Library_Version])
+if test "$ac_cv_func_gdImageGif" = "yes"; then
+ INSTALL_BIN_TARGET="install-dvigif"
+else
+ INSTALL_BIN_TARGET="install-dvipng"
+fi
+AC_CHECK_FUNCS([texlive_gs_init])
+AC_SUBST(INSTALL_BIN_TARGET)
+
+# Documentation-related checks
+AC_PATH_PROG(MAKEINFO, makeinfo, :)
+MAKEINFO_CHECK_MACROS(acronym env option)
+AC_PATH_PROG(INSTALL_INFO, install-info, :, $PATH /usr/sbin /sbin)
+
+# SELFAUTO
+AC_ARG_ENABLE(selfauto-set,
+ AC_HELP_STRING([--enable-selfauto-set],
+ [This option will make the final binary explicitly set the
+ $SELFAUTO... variables to make it look as dvipng is installed in the
+ main texmf tree, even if it isn't. This is necessary when texmf.cnf
+ only uses $SELFAUTO... variables and dvipng is not installed in the
+ texmf tree. Otherwise, dvipng may not be able to find virtual
+ fonts, or psfonts.map. To find out, first build the binary and do
+ 'make test'. If the test fails, you need this switch.]),
+ [ if test "$enableval" = yes ; then
+ AC_MSG_CHECKING([for \$SELFAUTOLOC])
+ SELFAUTOLOC=`kpsewhich -expand-var=\\\$SELFAUTOLOC`
+ AC_DEFINE_UNQUOTED(ENV_SELFAUTOLOC,["SELFAUTOLOC=$SELFAUTOLOC"],
+ [The environment setting for $SELFAUTOLOC])
+ AC_MSG_RESULT([$SELFAUTOLOC])
+ AC_MSG_CHECKING([for \$SELFAUTODIR])
+ SELFAUTODIR=`kpsewhich -expand-var=\\\$SELFAUTODIR`
+ AC_DEFINE_UNQUOTED(ENV_SELFAUTODIR,["SELFAUTODIR=$SELFAUTODIR"],
+ [The environment setting for $SELFAUTODIR])
+ AC_MSG_RESULT([$SELFAUTODIR])
+ AC_MSG_CHECKING([for \$SELFAUTOPARENT])
+ SELFAUTOPARENT=`kpsewhich -expand-var=\\\$SELFAUTOPARENT`
+ AC_DEFINE_UNQUOTED(ENV_SELFAUTOPARENT,["SELFAUTOPARENT=$SELFAUTOPARENT"],
+ [The environment setting for $SELFAUTOPARENT])
+ AC_MSG_RESULT([$SELFAUTOPARENT])
+ fi ],
+ [AC_MSG_CHECKING([for texmf.cnf])
+ TEXMF_CNF=`kpsewhich texmf.cnf`
+ AC_MSG_RESULT([$TEXMF_CNF])
+ AC_PATH_PROG(KPSEWHICH, kpsewhich)
+ AC_MSG_CHECKING([for psfonts.map])
+ cp $KPSEWHICH .
+ PSFONTS_MAP=`./kpsewhich psfonts.map`
+ rm -f ./kpsewhich
+ if test -n "$PSFONTS_MAP"; then
+ AC_MSG_RESULT([$PSFONTS_MAP])
+ else
+ AC_MSG_RESULT([not found from outside the texmf tree])
+ AC_MSG_CHECKING([for \$SELFAUTO in texmf.cnf])
+ if grep SELFAUTO "$TEXMF_CNF" > /dev/null 2> /dev/null; then
+ AC_MSG_RESULT([yes
+***************************************************************
+texmf.cnf is using \$SELFAUTO... variables. If you are going to
+install dvipng outside the texmf tree, you may need to use
+--enable-selfauto-set. To find out, do 'make ; make test'. If the test
+is unsuccessful, add the mentioned switch and rebuild.
+***************************************************************])
+ else
+ AC_MSG_RESULT([no])
+ fi
+ fi])
+
+AC_MSG_RESULT([
+** Configuration summary for $PACKAGE_STRING:
+
+ The -d (debug) switch is enabled: $enable_debug
+ Your gd is new enough (>=2.0) to enable
+ the --truecolor switch, full alpha
+ transparency, proper rescaling of
+ included bitmaps, and jpeg inclusion: $ac_cv_func_gdImageCreateTrueColor
+ Your gd has jpeg inclusion enabled: $ac_cv_func_gdImageCreateFromJpeg
+ Your gd is new enough (>=2.0.12) to
+ enable transparent backgrounds for EPS
+ inclusion and the -z (compression)
+ switch: $ac_cv_func_gdImagePngEx
+ Your gd is new enough (>=2.0.21) to
+ allow image creation from memory $ac_cv_func_gdImageCreateFromPngPtr
+ Your gd is new enough (>=2.0.28) to
+ enable gif inclusion and output
+ (dvigif): $ac_cv_func_gdImageGif
+ FreeType font rendering available: $ac_have_freetype2
+ Support for subfonts (CJK-LaTeX): $ac_have_freetype2
+ Building within TeX Live: $ac_cv_func_texlive_gs_init
+])
+
+AC_CONFIG_HEADER([config.h])
+AC_CONFIG_FILES([Makefile])
+AC_OUTPUT
diff --git a/Build/source/texk/dvipng/dvipng-src/draw.c b/Build/source/texk/dvipng/dvipng-src/draw.c
new file mode 100644
index 00000000000..6f772b92204
--- /dev/null
+++ b/Build/source/texk/dvipng/dvipng-src/draw.c
@@ -0,0 +1,393 @@
+/* draw.c */
+
+/************************************************************************
+
+ Part of the dvipng distribution
+
+ This program is free software: you can redistribute it and/or modify
+ it under the terms of the GNU Lesser General Public License as
+ published by the Free Software Foundation, either version 3 of the
+ License, or (at your option) any later version.
+
+ This program is distributed in the hope that it will be useful, but
+ WITHOUT ANY WARRANTY; without even the implied warranty of
+ MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU
+ Lesser General Public License for more details.
+
+ You should have received a copy of the GNU Lesser General Public
+ License along with this program. If not, see
+ <http://www.gnu.org/licenses/>.
+
+ Copyright (C) 2002-2015 Jan-Åke Larsson
+
+************************************************************************/
+
+#include "dvipng.h"
+
+#ifdef DEBUG
+#include <ctype.h> /* isprint */
+#endif
+
+struct stack_entry {
+ dviunits h, v, w, x, y, z; /* stack entry */
+ subpixels hh,vv;
+} stack[STACK_SIZE+1]; /* stack + space for current pos */
+struct stack_entry* dvi_stack=stack;
+
+#define MAXDRIFT 1
+#define CHECK_MAXDRIFT(x,xx) \
+ if ( xx-PIXROUND(x,dvi->conv*shrinkfactor) < -MAXDRIFT ) { \
+ DEBUG_PRINT(DEBUG_DVI,(" add 1 to")); \
+ xx += 1; \
+ } \
+ if ( xx-PIXROUND(x,dvi->conv*shrinkfactor) > MAXDRIFT ) { \
+ DEBUG_PRINT(DEBUG_DVI,(" sub 1 to")); \
+ xx -= 1; \
+ } \
+ if (PIXROUND(dvi_stack->h,dvi->conv*shrinkfactor) != dvi_stack->hh \
+ || PIXROUND(dvi_stack->v,dvi->conv*shrinkfactor) != dvi_stack->vv)\
+ DEBUG_PRINT(DEBUG_DVI, \
+ (" drift (%d,%d)", \
+ dvi_stack->hh-PIXROUND(dvi_stack->h,dvi->conv*shrinkfactor), \
+ dvi_stack->vv-PIXROUND(dvi_stack->v,dvi->conv*shrinkfactor)));
+
+#define MoveRight(x) \
+ temp=x; dvi_stack->h += temp; \
+ if ( currentfont==NULL \
+ || temp > currentfont->s/6 || temp < -currentfont->s/6*4 ) \
+ dvi_stack->hh = PIXROUND(dvi_stack->h,dvi->conv*shrinkfactor); \
+ else \
+ dvi_stack->hh += PIXROUND( temp,dvi->conv*shrinkfactor ); \
+ CHECK_MAXDRIFT(dvi_stack->h,dvi_stack->hh)
+
+#define MoveDown(x) \
+ temp=x; dvi_stack->v += temp; \
+ if ( currentfont==NULL \
+ || temp > currentfont->s/6*5 || temp < currentfont->s/6*(-5) ) \
+ dvi_stack->vv = PIXROUND(dvi_stack->v,dvi->conv*shrinkfactor); \
+ else \
+ dvi_stack->vv += PIXROUND( temp,dvi->conv*shrinkfactor ); \
+ CHECK_MAXDRIFT(dvi_stack->v,dvi_stack->vv)
+
+#define DO_VFCONV(a) ((((struct font_entry*) parent)->type==DVI_TYPE)?a:\
+ (dviunits)((int64_t) a * ((struct font_entry*) parent)->s / (1 << 20)))
+
+
+dviunits SetChar(int32_t c)
+{
+ struct char_entry* ptr=NULL;
+
+ if (currentfont==NULL)
+ Fatal("faulty DVI, trying to set character from null font");
+ if (c<0 || c>LASTFNTCHAR) {
+ Warning("glyph index out of range (%d), skipping",c);
+ return(0);
+ }
+ ptr=currentfont->chr[c];
+ if (ptr==NULL) {
+ Warning("unable to draw glyph %d, skipping",c);
+ return(0);
+ }
+#ifdef DEBUG
+ switch (currentfont->type) {
+ case FONT_TYPE_VF: DEBUG_PRINT(DEBUG_DVI,("\n VF CHAR:\t")); break;
+ case FONT_TYPE_PK: DEBUG_PRINT(DEBUG_DVI,("\n PK CHAR:\t")); break;
+ case FONT_TYPE_FT: DEBUG_PRINT(DEBUG_DVI,("\n FT CHAR:\t")); break;
+ default: DEBUG_PRINT(DEBUG_DVI,("\n NO CHAR:\t"))
+ }
+ if (debug & DEBUG_DVI && c>=0 && c<=UCHAR_MAX && isprint(c))
+ DEBUG_PRINT(DEBUG_DVI,("'%c' ",c));
+ DEBUG_PRINT(DEBUG_DVI,("%d at (%d,%d) tfmw %d", c,
+ dvi_stack->hh,dvi_stack->vv,ptr?ptr->tfmw:0));
+#endif
+ if (currentfont->type==FONT_TYPE_VF) {
+ return(SetVF(ptr));
+ } else {
+ if (ptr->data == NULL)
+ switch(currentfont->type) {
+ case FONT_TYPE_PK: LoadPK(c, ptr); break;
+#ifdef HAVE_FT2
+ case FONT_TYPE_FT: LoadFT(c, ptr); break;
+#endif
+ default:
+ Fatal("undefined fonttype %d",currentfont->type);
+ }
+ if (page_imagep != NULL)
+ return(SetGlyph(ptr, dvi_stack->hh, dvi_stack->vv));
+ else {
+ /* Expand bounding box if necessary */
+ min(x_min,dvi_stack->hh - ptr->xOffset/shrinkfactor);
+ min(y_min,dvi_stack->vv - ptr->yOffset/shrinkfactor);
+ max(x_max,dvi_stack->hh - ptr->xOffset/shrinkfactor + ptr->w);
+ max(y_max,dvi_stack->vv - ptr->yOffset/shrinkfactor + ptr->h);
+ return(ptr->tfmw);
+ }
+ }
+ return(0);
+}
+
+void DrawCommand(unsigned char* command, void* parent /* dvi/vf */)
+ /* To be used both in plain DVI drawing and VF drawing */
+{
+ dviunits temp;
+
+ if (/*command >= SETC_000 &&*/ *command <= SETC_127) {
+ temp = SetChar((int32_t)*command);
+ dvi_stack->h += temp;
+ dvi_stack->hh += PIXROUND(temp,dvi->conv*shrinkfactor);
+ CHECK_MAXDRIFT(dvi_stack->h,dvi_stack->hh);
+ } else if (*command >= FONT_00 && *command <= FONT_63) {
+ SetFntNum((int32_t)*command - FONT_00,parent);
+ } else switch (*command) {
+ case PUT1: case PUT2: case PUT3: case PUT4:
+ DEBUG_PRINT(DEBUG_DVI,(" %d",
+ UNumRead(command+1, dvi_commandlength[*command]-1)));
+ (void) SetChar(UNumRead(command+1, dvi_commandlength[*command]-1));
+ break;
+ case SET1: case SET2: case SET3: case SET4:
+ DEBUG_PRINT(DEBUG_DVI,(" %d",
+ UNumRead(command+1, dvi_commandlength[*command]-1)));
+ {
+ temp = SetChar(UNumRead(command+1, dvi_commandlength[*command]-1));
+ dvi_stack->h += temp;
+ dvi_stack->hh += PIXROUND(temp,dvi->conv*shrinkfactor);
+ CHECK_MAXDRIFT(dvi_stack->h,dvi_stack->hh);
+ }
+ break;
+ case SET_RULE:
+ DEBUG_PRINT(DEBUG_DVI,(" %d %d",
+ UNumRead(command+1, 4), UNumRead(command+5, 4)));
+ temp = SetRule(DO_VFCONV(UNumRead(command+1, 4)),
+ DO_VFCONV(UNumRead(command+5, 4)),
+ dvi_stack->hh, dvi_stack->vv);
+ dvi_stack->h += temp;
+ dvi_stack->hh += PIXROUND(temp,dvi->conv*shrinkfactor);
+ CHECK_MAXDRIFT(dvi_stack->h,dvi_stack->hh);
+ break;
+ case PUT_RULE:
+ DEBUG_PRINT(DEBUG_DVI,(" %d %d",
+ UNumRead(command+1, 4), UNumRead(command+5, 4)));
+ (void) SetRule(DO_VFCONV(UNumRead(command+1, 4)),
+ DO_VFCONV(UNumRead(command+5, 4)),
+ dvi_stack->hh, dvi_stack->vv);
+ break;
+ case BOP:
+ Fatal("BOP occurs within page");
+ break;
+ case EOP:
+ break;
+ case PUSH:
+ /* is next item on stack? */
+ if (dvi_stack == &stack[STACK_SIZE-1])
+ Fatal("DVI stack overflow");
+ {
+ struct stack_entry *next=dvi_stack+1;
+ next->h = dvi_stack->h;
+ next->v = dvi_stack->v;
+ next->w = dvi_stack->w;
+ next->x = dvi_stack->x;
+ next->y = dvi_stack->y;
+ next->z = dvi_stack->z;
+ next->hh = dvi_stack->hh;
+ next->vv = dvi_stack->vv;
+ dvi_stack=next;
+ }
+ break;
+ case POP:
+ if (dvi_stack == stack)
+ Fatal("DVI stack underflow");
+ dvi_stack--;
+ break;
+ case RIGHT1: case RIGHT2: case RIGHT3: case RIGHT4:
+ DEBUG_PRINT(DEBUG_DVI,(" %d",
+ SNumRead(command+1, dvi_commandlength[*command]-1)));
+ MoveRight(DO_VFCONV(SNumRead(command+1, dvi_commandlength[*command]-1)));
+ break;
+ case W1: case W2: case W3: case W4:
+ dvi_stack->w = SNumRead(command+1, dvi_commandlength[*command]-1);
+ DEBUG_PRINT(DEBUG_DVI,(" %d",dvi_stack->w));
+ case W0:
+ MoveRight(DO_VFCONV(dvi_stack->w));
+ break;
+ case X1: case X2: case X3: case X4:
+ dvi_stack->x = SNumRead(command+1, dvi_commandlength[*command]-1);
+ DEBUG_PRINT(DEBUG_DVI,(" %d",dvi_stack->x));
+ case X0:
+ MoveRight(DO_VFCONV(dvi_stack->x));
+ break;
+ case DOWN1: case DOWN2: case DOWN3: case DOWN4:
+ DEBUG_PRINT(DEBUG_DVI,(" %d",
+ SNumRead(command+1, dvi_commandlength[*command]-1)));
+ MoveDown(DO_VFCONV(SNumRead(command+1, dvi_commandlength[*command]-1)));
+ break;
+ case Y1: case Y2: case Y3: case Y4:
+ dvi_stack->y = SNumRead(command+1, dvi_commandlength[*command]-1);
+ DEBUG_PRINT(DEBUG_DVI,(" %d",dvi_stack->y));
+ case Y0:
+ MoveDown(DO_VFCONV(dvi_stack->y));
+ break;
+ case Z1: case Z2: case Z3: case Z4:
+ dvi_stack->z = SNumRead(command+1, dvi_commandlength[*command]-1);
+ DEBUG_PRINT(DEBUG_DVI,(" %d",dvi_stack->z));
+ case Z0:
+ MoveDown(DO_VFCONV(dvi_stack->z));
+ break;
+ case FNT1: case FNT2: case FNT3: case FNT4:
+ DEBUG_PRINT(DEBUG_DVI,(" %d",
+ UNumRead(command+1, dvi_commandlength[*command]-1)));
+ SetFntNum(UNumRead(command+1, dvi_commandlength[*command]-1),parent);
+ break;
+ case XXX1: case XXX2: case XXX3: case XXX4:
+ DEBUG_PRINT(DEBUG_DVI,(" %d",
+ UNumRead(command+1, dvi_commandlength[*command]-1)));
+ SetSpecial((char*)command + dvi_commandlength[*command],
+ (char*)command + dvi_commandlength[*command]
+ +UNumRead(command+1, dvi_commandlength[*command]-1),
+ dvi_stack->hh,dvi_stack->vv);
+ break;
+ case FNT_DEF1: case FNT_DEF2: case FNT_DEF3: case FNT_DEF4:
+ if (((struct font_entry*)parent)->type==DVI_TYPE) {
+ FontDef(command, parent);
+ } else {
+ Fatal("%s within VF macro from %s",dvi_commands[*command],
+ ((struct font_entry*)parent)->n);
+ }
+ break;
+ case PRE: case POST: case POST_POST:
+ Fatal("%s occurs within page",dvi_commands[*command]);
+ break;
+ case NOP:
+ break;
+ default:
+ Fatal("%s is an undefined command",dvi_commands[*command]);
+ break;
+ }
+}
+
+void BeginVFMacro(struct font_entry* currentvf)
+{
+ struct stack_entry *next=dvi_stack+1;
+ if (dvi_stack == &stack[STACK_SIZE-1])
+ Fatal("DVI stack overflow");
+ next->h = dvi_stack->h;
+ next->v = dvi_stack->v;
+ next->w = next->x = next->y = next->z = 0;
+ next->hh = dvi_stack->hh;
+ next->vv = dvi_stack->vv;
+ dvi_stack = next;
+ DEBUG_PRINT(DEBUG_DVI,("\n START VF:\tPUSH, W = X = Y = Z = 0"));
+ SetFntNum(currentvf->defaultfont,currentvf);
+}
+
+void EndVFMacro(void)
+{
+ if (dvi_stack == stack)
+ Fatal("DVI stack underflow");
+ dvi_stack--;
+ DEBUG_PRINT(DEBUG_DVI,("\n END VF:\tPOP "));
+}
+
+
+static void DrawPage(dviunits hoffset, dviunits voffset)
+ /* To be used after having read BOP and will exit cleanly when
+ * encountering EOP.
+ */
+{
+ unsigned char* command; /* current command */
+
+ dvi_stack->h = hoffset;
+ dvi_stack->v = voffset;
+ dvi_stack->w = dvi_stack->x = dvi_stack->y = dvi_stack->z = 0;
+ dvi_stack->hh = PIXROUND( dvi_stack->h , dvi->conv*shrinkfactor );
+ dvi_stack->vv = PIXROUND( dvi_stack->v , dvi->conv*shrinkfactor );
+ currentfont = NULL; /* No default font */
+
+ command=DVIGetCommand(dvi);
+ DEBUG_PRINT(DEBUG_DVI,("DRAW CMD:\t%s", dvi_commands[*command]));
+ while (*command != EOP) {
+ DrawCommand(command,dvi);
+ command=DVIGetCommand(dvi);
+ DEBUG_PRINT(DEBUG_DVI,("DRAW CMD:\t%s", dvi_commands[*command]));
+ }
+}
+
+void DrawPages(void)
+{
+ struct page_list *dvi_pos;
+ pixels x_width,y_width,x_offset,y_offset;
+ int pagecounter=(option_flags & DVI_PAGENUM)?0:10;
+
+ dvi_pos=NextPPage(dvi,NULL);
+ if (dvi_pos!=NULL) {
+ while(dvi_pos!=NULL) {
+ SeekPage(dvi,dvi_pos);
+ Message(BE_NONQUIET,"[%d", dvi_pos->count[pagecounter]);
+ if (dvi_pos->count[pagecounter]!=dvi_pos->count[0])
+ Message(BE_NONQUIET," (%d)", dvi_pos->count[0]);
+ x_max = y_max = INT32_MIN;
+ x_min = y_min = INT32_MAX;
+ DrawPage((dviunits)0,(dviunits)0);
+ /* Store background color. Background color of a page is given
+ by the color at EOP rather than the color at BOP. */
+ StoreBackgroundColor(dvi_pos);
+ /* Store pagesize */
+ if (dvi->flags & DVI_PREVIEW_LATEX_TIGHTPAGE) {
+ x_width_def=x_width_tightpage;
+ y_width_def=y_width_tightpage;
+ x_offset_def=x_offset_tightpage;
+ y_offset_def=y_offset_tightpage;
+ }
+ if (x_width_def >= 0) { /* extend BBOX */
+ min(x_min,-x_offset_def);
+ max(x_max,x_min + x_width_def);
+ min(y_min,-y_offset_def);
+ max(y_max,y_min + y_width_def);
+ }
+ if (x_width_def <= 0 || option_flags & EXPAND_BBOX) {
+ x_width = x_max-x_min;
+ y_width = y_max-y_min;
+ x_offset = -x_min; /* offset by moving topleft corner */
+ y_offset = -y_min; /* offset by moving topleft corner */
+ } else {
+ x_width=x_width_def;
+ y_width=y_width_def;
+ x_offset=x_offset_def;
+ y_offset=y_offset_def;
+ }
+ DEBUG_PRINT(DEBUG_DVI,("\n IMAGE:\t%dx%d",x_width,y_width));
+ SeekPage(dvi,dvi_pos);
+ CreateImage(x_width,y_width);
+#ifdef DEBUG
+ DEBUG_PRINT(DEBUG_DVI,("\n@%d PAGE START:\tBOP",dvi_pos->offset));
+ {
+ int i;
+ for (i=0;i<10;i++)
+ DEBUG_PRINT(DEBUG_DVI,(" %d",dvi_pos->count[i]));
+ DEBUG_PRINT(DEBUG_DVI,(" (%d)\n",dvi_pos->count[10]));
+ }
+#endif
+ Message(REPORT_DEPTH," depth=%d", y_width-y_offset-1);
+ Message(REPORT_HEIGHT," height=%d", y_offset+1);
+ Message(REPORT_WIDTH," width=%d", x_width);
+ page_flags &= ~PAGE_PREVIEW_BOP;
+ DrawPage(x_offset*dvi->conv*shrinkfactor,
+ y_offset*dvi->conv*shrinkfactor);
+ if ( ! (option_flags & MODE_PICKY && page_flags & PAGE_GAVE_WARN )) {
+ WriteImage(dvi->outname,dvi_pos->count[pagecounter]);
+#ifdef TIMING
+ ++ndone;
+#endif
+ } else {
+ exitcode=EXIT_FAILURE;
+ Message(BE_NONQUIET,"(page not rendered)");
+ DestroyImage();
+ }
+ Message(BE_NONQUIET,"] ");
+ fflush(stdout);
+ page_flags = 0;
+ dvi_pos=NextPPage(dvi,dvi_pos);
+ }
+ Message(BE_NONQUIET,"\n");
+ ClearPpList();
+ }
+}
diff --git a/Build/source/texk/dvipng/dvipng-src/dvi.c b/Build/source/texk/dvipng/dvipng-src/dvi.c
new file mode 100644
index 00000000000..139d0ea13c4
--- /dev/null
+++ b/Build/source/texk/dvipng/dvipng-src/dvi.c
@@ -0,0 +1,487 @@
+/* dvi.c */
+
+/************************************************************************
+
+ Part of the dvipng distribution
+
+ This program is free software: you can redistribute it and/or modify
+ it under the terms of the GNU Lesser General Public License as
+ published by the Free Software Foundation, either version 3 of the
+ License, or (at your option) any later version.
+
+ This program is distributed in the hope that it will be useful, but
+ WITHOUT ANY WARRANTY; without even the implied warranty of
+ MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU
+ Lesser General Public License for more details.
+
+ You should have received a copy of the GNU Lesser General Public
+ License along with this program. If not, see
+ <http://www.gnu.org/licenses/>.
+
+ Copyright (C) 2002-2015, 2019 Jan-Åke Larsson
+
+************************************************************************/
+
+#include "dvipng.h"
+#ifdef MIKTEX
+# include <gnu-miktex.h>
+# define USLEEP Sleep
+#else /* MIKTEX */
+# ifdef HAVE_LIBGEN_H
+# include <libgen.h>
+# else
+# define basename xbasename
+# endif
+# ifdef WIN32
+# define USLEEP Sleep
+# include <stdlib.h>
+# else
+# include <unistd.h>
+# define USLEEP usleep
+# endif /* WIN32 */
+#endif /* MIKTEX */
+#include <sys/stat.h>
+#include <fcntl.h>
+
+bool followmode=0;
+
+bool DVIFollowToggle(void)
+{
+ return followmode = ! followmode;
+}
+
+static unsigned char fgetc_follow(FILE* fp)
+{
+ int got=fgetc(fp),nsleep=1;
+
+ while(followmode && got==EOF) {
+ USLEEP(nsleep/1310); /* After a few trials, poll every 65536/1310=50 usec */
+ clearerr(fp);
+ got=fgetc(fp);
+ if (nsleep<50000)
+ nsleep*=2;
+ }
+ if (got==EOF)
+ Fatal("DVI file ends prematurely");
+ return (unsigned char)got;
+}
+
+static void DVIInit(struct dvi_data* dvi)
+{
+ int k;
+ unsigned char* pre;
+ struct stat stat;
+
+ fseek(dvi->filep,0,SEEK_SET);
+ pre=DVIGetCommand(dvi);
+ if (*pre != PRE) {
+ Fatal("PRE does not occur first - are you sure this is a DVI file?");
+ }
+ k = UNumRead(pre+1,1);
+ DEBUG_PRINT(DEBUG_DVI,("DVI START:\tPRE %d",k));
+ if (k != DVIFORMAT) {
+ Fatal("DVI format = %d, can only process DVI format %d files",
+ k, DVIFORMAT);
+ }
+ dvi->num = UNumRead(pre+2, 4);
+ dvi->den = UNumRead(pre+6, 4);
+ DEBUG_PRINT(DEBUG_DVI,(" %d/%d",dvi->num,dvi->den));
+ dvi->mag = UNumRead(pre+10, 4); /*FIXME, see font.c*/
+ DEBUG_PRINT(DEBUG_DVI,(" %d",dvi->mag));
+ if ( usermag > 0 && usermag != dvi->mag ) {
+ Warning("DVI magnification of %d over-ridden by user (%ld)",
+ (long)dvi->mag, usermag );
+ dvi->mag = usermag;
+ }
+ dvi->conv = (1.0/(((double)dvi->num / (double)dvi->den) *
+ ((double)dvi->mag / 1000.0) *
+ ((double)dpi*shrinkfactor/254000.0)))+0.5;
+ DEBUG_PRINT(DEBUG_DVI,(" (%d)",dvi->conv));
+ k = UNumRead(pre+14,1);
+ DEBUG_PRINT(DEBUG_DVI,(" '%.*s'",k,pre+15));
+ Message(BE_VERBOSE,"'%.*s' -> %s\n",k,pre+15,dvi->outname);
+ fstat(fileno(dvi->filep), &stat);
+ dvi->mtime = stat.st_mtime;
+ dvi->pagelistp=NULL;
+ dvi->flags = 0;
+}
+
+struct dvi_data* DVIOpen(char* dviname,char* outname)
+{
+ char* tmpstring;
+ struct dvi_data* dvi;
+
+ if ((dvi = calloc(1,sizeof(struct dvi_data)))==NULL)
+ Fatal("cannot allocate memory for DVI struct");
+ dvi->type = DVI_TYPE;
+ dvi->fontnump=NULL;
+ if ((dvi->name = malloc(strlen(dviname)+5))==NULL)
+ Fatal("cannot allocate space for DVI filename");
+ strcpy(dvi->name, dviname);
+ tmpstring = strrchr(dvi->name, '.');
+ if (tmpstring == NULL || strcmp(tmpstring,".dvi") != 0)
+ strcat(dvi->name, ".dvi");
+ if (outname==NULL) {
+ if ((dvi->outname = malloc(strlen(basename(dviname))+7))==NULL) {
+ free(dvi->name);
+ free(dvi);
+ Fatal("cannot allocate space for output filename");
+ }
+ strcpy(dvi->outname,basename(dviname));
+ tmpstring = strrchr(dvi->outname, '.');
+ if (tmpstring != NULL && strcmp(tmpstring,".dvi") == 0)
+ *tmpstring = '\0';
+ strcat(dvi->outname, "%d.png");
+ } else {
+ if ((dvi->outname = malloc(strlen(outname)+1))==NULL) {
+ free(dvi->name);
+ free(dvi);
+ Fatal("cannot allocate space for output filename");
+ }
+ strcpy(dvi->outname,outname);
+ }
+ if ((dvi->filep = fopen(dvi->name,"rb")) == NULL) {
+ /* do not insist on .dvi */
+ tmpstring = strrchr(dvi->name, '.');
+ *tmpstring='\0';
+ dvi->filep = fopen(dvi->name,"rb");
+ }
+ while((dvi->filep == NULL) && followmode) {
+ USLEEP(50);
+ *tmpstring='.';
+ if ((dvi->filep = fopen(dvi->name,"rb")) == NULL) {
+ /* do not insist on .dvi */
+ *tmpstring='\0';
+ dvi->filep = fopen(dvi->name,"rb");
+ }
+ }
+ if (dvi->filep == NULL) {
+ free(dvi->name);
+ free(dvi->outname);
+ free(dvi);
+ perror(dviname);
+ exit (EXIT_FAILURE);
+ }
+ DEBUG_PRINT(DEBUG_DVI,("OPEN FILE\t%s", dvi->name));
+ DVIInit(dvi);
+ return(dvi);
+}
+
+unsigned char* DVIGetCommand(struct dvi_data* dvi)
+ /* This function reads in and stores the next dvi command. */
+ /* Mmap is not appropriate here, we may want to read from
+ half-written files. */
+{
+ static unsigned char* command=NULL;
+ static uint32_t commlen=0;
+ unsigned char *current = command;
+ int length;
+ uint32_t strlength=0;
+
+ if (commlen==0) {
+ commlen=STRSIZE;
+ if ((current=command=malloc(commlen))==NULL)
+ Fatal("cannot allocate memory for DVI command");
+ }
+ DEBUG_PRINT(DEBUG_DVI,("\n@%ld ", ftell(dvi->filep)));
+ *(current++) = fgetc_follow(dvi->filep);
+ length = dvi_commandlength[*command];
+ if (length < 0)
+ Fatal("undefined DVI op-code %d",*command);
+ while(current < command+length)
+ *(current++) = fgetc_follow(dvi->filep);
+ switch (*command) {
+ case XXX4:
+ strlength = *(current - 4);
+ case XXX3:
+ strlength = strlength * 256 + *(current - 3);
+ case XXX2:
+ strlength = strlength * 256 + *(current - 2);
+ case XXX1:
+ strlength = strlength * 256 + *(current - 1);
+ break;
+ case FNT_DEF1: case FNT_DEF2: case FNT_DEF3: case FNT_DEF4:
+ strlength = *(current - 1) + *(current - 2);
+ break;
+ case PRE:
+ strlength = *(current - 1);
+ break;
+ }
+ if (strlength > 0) { /* Read string */
+ if (strlength > UINT32_MAX - (uint32_t)length - 1)
+ Fatal("integer overflow in DVI command length");
+ if (strlength+1 + (uint32_t)length > commlen) {
+ /* string + command length exceeds that of buffer */
+ commlen=strlength+1 + (uint32_t)length;
+ if ((command=realloc(command,commlen))==NULL)
+ Fatal("cannot allocate memory for DVI command");
+ current = command + length;
+ }
+ while(current < command+length+strlength)
+ *(current++) = fgetc_follow(dvi->filep);
+ *current='\0';
+ }
+ return(command);
+}
+
+bool DVIIsNextPSSpecial(struct dvi_data* dvi)
+ /* This function checks if the next dvi command is a raw PS
+ special */
+ /* Mmap is not appropriate here, we may want to read from
+ half-written files. */
+{
+ long fpos;
+ uint32_t strlength=0;
+ bool israwps=false;
+
+ DEBUG_PRINT(DEBUG_DVI,("\n CHECKING NEXT DVI COMMAND "));
+ fpos=ftell(dvi->filep);
+ switch (fgetc_follow(dvi->filep)) {
+ case XXX4:
+ strlength = fgetc_follow(dvi->filep);
+ case XXX3:
+ strlength = strlength * 256 + fgetc_follow(dvi->filep);
+ case XXX2:
+ strlength = strlength * 256 + fgetc_follow(dvi->filep);
+ case XXX1:
+ strlength = strlength * 256 + fgetc_follow(dvi->filep);
+ }
+ if (strlength > 0) {
+ switch(fgetc_follow(dvi->filep)) {
+ case 'p':
+ if (strlength > 2
+ && fgetc_follow(dvi->filep)=='s'
+ && fgetc_follow(dvi->filep)==':')
+ israwps=true;
+ break;
+ case '"':
+ israwps=true;
+ }
+ }
+ fseek(dvi->filep,fpos,SEEK_SET);
+ return(israwps);
+}
+
+uint32_t CommandLength(unsigned char* command)
+{
+ /* generally 2^32+5 bytes max, but in practice 32 bit numbers suffice */
+ uint32_t length=0;
+
+ length = dvi_commandlength[*command];
+ switch (*command) {
+ case XXX1: case XXX2: case XXX3: case XXX4:
+ length += UNumRead(command + 1,length - 1);
+ break;
+ case FNT_DEF1: case FNT_DEF2: case FNT_DEF3: case FNT_DEF4:
+ length += *(command + length - 1) + *(command + length - 2);
+ break;
+ case PRE:
+ length += *(command + length - 1);
+ break;
+ }
+ return(length);
+}
+
+static void SkipPage(struct dvi_data* dvi)
+{
+ /* Skip present page */
+ unsigned char* command;
+
+ command=DVIGetCommand(dvi);
+ while (*command != EOP) {
+ switch (*command) {
+ case FNT_DEF1: case FNT_DEF2: case FNT_DEF3: case FNT_DEF4:
+ DEBUG_PRINT(DEBUG_DVI,("NOSKIP CMD:\t%s", dvi_commands[*command]));
+ FontDef(command,dvi);
+ break;
+ case XXX1: case XXX2: case XXX3: case XXX4:
+ DEBUG_PRINT(DEBUG_DVI,("NOSKIP CMD:\t%s %d", dvi_commands[*command],
+ UNumRead(command+1, dvi_commandlength[*command]-1)));
+ SetSpecial((char*)command + dvi_commandlength[*command],
+ (char*)command + dvi_commandlength[*command]
+ +UNumRead(command+1, dvi_commandlength[*command]-1),
+ 0,0);
+ break;
+ case BOP: case PRE: case POST: case POST_POST:
+ Fatal("%s occurs within page", dvi_commands[*command]);
+ break;
+#ifdef DEBUG
+ default:
+ DEBUG_PRINT(DEBUG_DVI,("SKIP CMD:\t%s", dvi_commands[*command]));
+#endif
+ }
+ command=DVIGetCommand(dvi);
+ } /* while */
+ DEBUG_PRINT(DEBUG_DVI,("SKIP CMD:\t%s", dvi_commands[*command]));
+}
+
+static struct page_list* InitPage(struct dvi_data* dvi)
+{
+ /* Find page start, return pointer to page_list entry if found */
+ struct page_list* tpagelistp=NULL;
+ unsigned char* command;
+
+ command=DVIGetCommand(dvi);
+ /* Skip until page start or postamble */
+ while((*command != BOP) && (*command != POST)) {
+ switch(*command) {
+ case FNT_DEF1: case FNT_DEF2: case FNT_DEF3: case FNT_DEF4:
+ DEBUG_PRINT(DEBUG_DVI,("NOPAGE CMD:\t%s", dvi_commands[*command]));
+ FontDef(command,dvi);
+ break;
+ case NOP:
+ DEBUG_PRINT(DEBUG_DVI,("NOPAGE CMD:\tNOP"));
+ break;
+ default:
+ Fatal("%s occurs outside page", dvi_commands[*command]);
+ }
+ command=DVIGetCommand(dvi);
+ }
+ if ((tpagelistp =
+ malloc(sizeof(struct page_list)
+ +(csp+1-2)*sizeof(struct dvi_color)))==NULL)
+ Fatal("cannot allocate memory for new page entry");
+ tpagelistp->next = NULL;
+ if ( *command == BOP ) { /* Init page */
+ int i;
+ DEBUG_PRINT(DEBUG_DVI,("PAGE START:\tBOP"));
+ StoreColorStack(tpagelistp);
+ tpagelistp->offset = ftell(dvi->filep)-45;
+ for (i = 0; i <= 9; i++) {
+ tpagelistp->count[i] = UNumRead(command + 1 + i*4, 4);
+ DEBUG_PRINT(DEBUG_DVI,(" %d",tpagelistp->count[i]));
+ }
+ if (dvi->pagelistp==NULL)
+ tpagelistp->count[10] = 1;
+ else
+ tpagelistp->count[10] = dvi->pagelistp->count[10]+1;
+ DEBUG_PRINT(DEBUG_DVI,(" (%d)", tpagelistp->count[10]));
+ } else {
+ DEBUG_PRINT(DEBUG_DVI,("DVI END:\tPOST"));
+ tpagelistp->offset = ftell(dvi->filep)-1;
+ tpagelistp->count[0] = PAGE_POST; /* POST */
+ tpagelistp->count[10] = PAGE_POST; /* POST */
+ }
+ return(tpagelistp);
+}
+
+int SeekPage(struct dvi_data* dvi, struct page_list* page)
+{
+ ReadColorStack(page);
+ return(fseek(dvi->filep,
+ page->offset+((page->count[0]==PAGE_POST) ? 1L : 45L),
+ SEEK_SET));
+}
+
+struct page_list* NextPage(struct dvi_data* dvi, struct page_list* page)
+{
+ struct page_list* tpagelistp;
+
+ /* if page points to POST there is no next page */
+ if (page!=NULL && page->count[0]==PAGE_POST)
+ return(NULL);
+
+ /* If we have read past the last page in our current list or the
+ * list is empty, sneak a look at the next page
+ */
+ if (dvi->pagelistp==NULL
+ || dvi->pagelistp->offset+45L < ftell(dvi->filep)) {
+ tpagelistp=dvi->pagelistp;
+ dvi->pagelistp=InitPage(dvi);
+ dvi->pagelistp->next=tpagelistp;
+ }
+
+ if (page!=dvi->pagelistp) {
+ /* also works if page==NULL, we'll get the first page then */
+ tpagelistp=dvi->pagelistp;
+ while(tpagelistp!=NULL && tpagelistp->next!=page)
+ tpagelistp=tpagelistp->next;
+ } else {
+ /* dvi->pagelistp points to the last page we've read so far,
+ * the last page that we know where it is, so to speak
+ * So look at the next
+ */
+ (void)SeekPage(dvi,dvi->pagelistp);
+ SkipPage(dvi);
+ tpagelistp=dvi->pagelistp;
+ dvi->pagelistp=InitPage(dvi);
+ dvi->pagelistp->next=tpagelistp;
+ tpagelistp=dvi->pagelistp;
+ }
+ return(tpagelistp);
+}
+
+struct page_list* PrevPage(struct dvi_data* dvi, struct page_list* page)
+{
+ return(page->next);
+}
+
+
+struct page_list* FindPage(struct dvi_data* dvi, int32_t pagenum, bool abspage)
+ /* Find first page of certain number,
+ absolute number if abspage is set */
+{
+ struct page_list* page=NextPage(dvi, NULL);
+
+ if (pagenum==PAGE_LASTPAGE || pagenum==PAGE_POST) {
+ while(page!=NULL && page->count[0]!=PAGE_POST)
+ page=NextPage(dvi,page);
+ if (pagenum==PAGE_LASTPAGE)
+ page=PrevPage(dvi,page);
+ } else
+ if (pagenum!=PAGE_FIRSTPAGE)
+ while(page != NULL && pagenum != page->count[abspage ? 0 : 10])
+ page=NextPage(dvi,page);
+ return(page);
+}
+
+
+static void DelPageList(struct dvi_data* dvi)
+{
+ struct page_list* temp;
+
+ /* Delete the page list */
+
+ temp=dvi->pagelistp;
+ while(temp!=NULL) {
+ dvi->pagelistp=dvi->pagelistp->next;
+ free(temp);
+ temp=dvi->pagelistp;
+ }
+}
+
+void DVIClose(struct dvi_data* dvi)
+{
+ if (dvi!=NULL) {
+ fclose(dvi->filep);
+ DelPageList(dvi);
+ ClearPSHeaders();
+ free(dvi->outname);
+ free(dvi->name);
+ free(dvi);
+ }
+}
+
+bool DVIReOpen(struct dvi_data* dvi)
+{
+ struct stat stat;
+ fstat(fileno(dvi->filep), &stat);
+ if (dvi->mtime != stat.st_mtime) {
+ fclose(dvi->filep);
+ dvi->filep=NULL;
+ DelPageList(dvi);
+ ClearPSHeaders();
+ while(((dvi->filep = fopen(dvi->name,"rb")) == NULL) && followmode) {
+ USLEEP(50);
+ }
+ if (dvi->filep == NULL) {
+ perror(dvi->name);
+ exit(EXIT_FAILURE);
+ }
+ Message(PARSE_STDIN,"Reopened file\n");
+ DEBUG_PRINT(DEBUG_DVI,("\nREOPEN FILE\t%s", dvi->name));
+ DVIInit(dvi);
+ return(true);
+ }
+ return(false);
+}
diff --git a/Build/source/texk/dvipng/dvipng-src/dvipng.1 b/Build/source/texk/dvipng/dvipng-src/dvipng.1
new file mode 100644
index 00000000000..613912fea6d
--- /dev/null
+++ b/Build/source/texk/dvipng/dvipng-src/dvipng.1
@@ -0,0 +1,506 @@
+.\" Automatically generated by Pod::Man 4.09 (Pod::Simple 3.35)
+.\"
+.\" Standard preamble:
+.\" ========================================================================
+.de Sp \" Vertical space (when we can't use .PP)
+.if t .sp .5v
+.if n .sp
+..
+.de Vb \" Begin verbatim text
+.ft CW
+.nf
+.ne \\$1
+..
+.de Ve \" End verbatim text
+.ft R
+.fi
+..
+.\" Set up some character translations and predefined strings. \*(-- will
+.\" give an unbreakable dash, \*(PI will give pi, \*(L" will give a left
+.\" double quote, and \*(R" will give a right double quote. \*(C+ will
+.\" give a nicer C++. Capital omega is used to do unbreakable dashes and
+.\" therefore won't be available. \*(C` and \*(C' expand to `' in nroff,
+.\" nothing in troff, for use with C<>.
+.tr \(*W-
+.ds C+ C\v'-.1v'\h'-1p'\s-2+\h'-1p'+\s0\v'.1v'\h'-1p'
+.ie n \{\
+. ds -- \(*W-
+. ds PI pi
+. if (\n(.H=4u)&(1m=24u) .ds -- \(*W\h'-12u'\(*W\h'-12u'-\" diablo 10 pitch
+. if (\n(.H=4u)&(1m=20u) .ds -- \(*W\h'-12u'\(*W\h'-8u'-\" diablo 12 pitch
+. ds L" ""
+. ds R" ""
+. ds C` ""
+. ds C' ""
+'br\}
+.el\{\
+. ds -- \|\(em\|
+. ds PI \(*p
+. ds L" ``
+. ds R" ''
+. ds C`
+. ds C'
+'br\}
+.\"
+.\" Escape single quotes in literal strings from groff's Unicode transform.
+.ie \n(.g .ds Aq \(aq
+.el .ds Aq '
+.\"
+.\" If the F register is >0, we'll generate index entries on stderr for
+.\" titles (.TH), headers (.SH), subsections (.SS), items (.Ip), and index
+.\" entries marked with X<> in POD. Of course, you'll have to process the
+.\" output yourself in some meaningful fashion.
+.\"
+.\" Avoid warning from groff about undefined register 'F'.
+.de IX
+..
+.if !\nF .nr F 0
+.if \nF>0 \{\
+. de IX
+. tm Index:\\$1\t\\n%\t"\\$2"
+..
+. if !\nF==2 \{\
+. nr % 0
+. nr F 2
+. \}
+.\}
+.\"
+.\" Accent mark definitions (@(#)ms.acc 1.5 88/02/08 SMI; from UCB 4.2).
+.\" Fear. Run. Save yourself. No user-serviceable parts.
+. \" fudge factors for nroff and troff
+.if n \{\
+. ds #H 0
+. ds #V .8m
+. ds #F .3m
+. ds #[ \f1
+. ds #] \fP
+.\}
+.if t \{\
+. ds #H ((1u-(\\\\n(.fu%2u))*.13m)
+. ds #V .6m
+. ds #F 0
+. ds #[ \&
+. ds #] \&
+.\}
+. \" simple accents for nroff and troff
+.if n \{\
+. ds ' \&
+. ds ` \&
+. ds ^ \&
+. ds , \&
+. ds ~ ~
+. ds /
+.\}
+.if t \{\
+. ds ' \\k:\h'-(\\n(.wu*8/10-\*(#H)'\'\h"|\\n:u"
+. ds ` \\k:\h'-(\\n(.wu*8/10-\*(#H)'\`\h'|\\n:u'
+. ds ^ \\k:\h'-(\\n(.wu*10/11-\*(#H)'^\h'|\\n:u'
+. ds , \\k:\h'-(\\n(.wu*8/10)',\h'|\\n:u'
+. ds ~ \\k:\h'-(\\n(.wu-\*(#H-.1m)'~\h'|\\n:u'
+. ds / \\k:\h'-(\\n(.wu*8/10-\*(#H)'\z\(sl\h'|\\n:u'
+.\}
+. \" troff and (daisy-wheel) nroff accents
+.ds : \\k:\h'-(\\n(.wu*8/10-\*(#H+.1m+\*(#F)'\v'-\*(#V'\z.\h'.2m+\*(#F'.\h'|\\n:u'\v'\*(#V'
+.ds 8 \h'\*(#H'\(*b\h'-\*(#H'
+.ds o \\k:\h'-(\\n(.wu+\w'\(de'u-\*(#H)/2u'\v'-.3n'\*(#[\z\(de\v'.3n'\h'|\\n:u'\*(#]
+.ds d- \h'\*(#H'\(pd\h'-\w'~'u'\v'-.25m'\f2\(hy\fP\v'.25m'\h'-\*(#H'
+.ds D- D\\k:\h'-\w'D'u'\v'-.11m'\z\(hy\v'.11m'\h'|\\n:u'
+.ds th \*(#[\v'.3m'\s+1I\s-1\v'-.3m'\h'-(\w'I'u*2/3)'\s-1o\s+1\*(#]
+.ds Th \*(#[\s+2I\s-2\h'-\w'I'u*3/5'\v'-.3m'o\v'.3m'\*(#]
+.ds ae a\h'-(\w'a'u*4/10)'e
+.ds Ae A\h'-(\w'A'u*4/10)'E
+. \" corrections for vroff
+.if v .ds ~ \\k:\h'-(\\n(.wu*9/10-\*(#H)'\s-2\u~\d\s+2\h'|\\n:u'
+.if v .ds ^ \\k:\h'-(\\n(.wu*10/11-\*(#H)'\v'-.4m'^\v'.4m'\h'|\\n:u'
+. \" for low resolution devices (crt and lpr)
+.if \n(.H>23 .if \n(.V>19 \
+\{\
+. ds : e
+. ds 8 ss
+. ds o a
+. ds d- d\h'-1'\(ga
+. ds D- D\h'-1'\(hy
+. ds th \o'bp'
+. ds Th \o'LP'
+. ds ae ae
+. ds Ae AE
+.\}
+.rm #[ #] #H #V #F C
+.\" ========================================================================
+.\"
+.IX Title "DVIPNG 1"
+.TH DVIPNG 1 "2020-01-05" "dvipng 1.17" "User commands"
+.\" For nroff, turn off justification. Always turn off hyphenation; it makes
+.\" way too many mistakes in technical documents.
+.if n .ad l
+.nh
+.SH "NAME"
+dvipng \- A DVI\-to\-PNG translator
+.SH "SYNOPSIS"
+.IX Header "SYNOPSIS"
+dvipng [options] filename
+.PP
+dvipng [options] [filename] \-
+.SH "DESCRIPTION"
+.IX Header "DESCRIPTION"
+This program makes \s-1PNG\s0 and/or \s-1GIF\s0 graphics from \s-1DVI\s0 files as obtained
+from TeX and its relatives.
+.PP
+If \s-1GIF\s0 support is enabled, \s-1GIF\s0 output is chosen by using the
+\&\fBdvigif\fR binary or with the \fB\-\-gif\fR option.
+.PP
+The benefits of \fBdvipng\fR/\fBdvigif\fR include
+.IP "*" 4
+Speed. It is a very fast bitmap-rendering code for \s-1DVI\s0 files, which
+makes it suitable for generating large amounts of images on-the-fly,
+as needed in preview-latex, WeBWorK and others.
+.IP "*" 4
+It does not read the postamble, so it can be started before TeX
+finishes. There is a \fB\-\-follow\fR switch that makes dvipng wait at
+end-of-file for further output, unless it finds the \s-1POST\s0 marker that
+indicates the end of the \s-1DVI.\s0
+.IP "*" 4
+Interactive query of options. dvipng can read options interactively
+through stdin, and all options are usable. It is even possible to change
+the input file through this interface.
+.IP "*" 4
+Supports \s-1PK, VF,\s0 PostScript Type1, and TrueType fonts, subfonts (i.e.,
+as used in CJK-LaTeX), color specials, and inclusion of PostScript,
+\&\s-1PNG, JPEG\s0 or \s-1GIF\s0 images.
+.IP "*" 4
+and more...
+.SH "OPTIONS"
+.IX Header "OPTIONS"
+Many of the parameterless options listed here can be turned off by
+suffixing the option with a zero (\fB0\fR); for instance, to turn off
+page reversal, use \fB\-r0\fR. Such options are marked with a trailing
+\&\fB*\fR.
+.IP "\fB\-\fR" 4
+.IX Item "-"
+Read additional options from standard input after processing the command
+line.
+.IP "\fB\-\-help\fR" 4
+.IX Item "--help"
+Print a usage message and exit.
+.IP "\fB\-\-version\fR" 4
+.IX Item "--version"
+Print the version number and exit.
+.IP "\fB\-bd\fR \fInum\fR" 4
+.IX Item "-bd num"
+.PD 0
+.IP "\fB\-bd\fR \fIcolor_spec\fR" 4
+.IX Item "-bd color_spec"
+.IP "\fB\-bd '\fR\fInum\fR\fB \fR\fIcolor_spec\fR\fB'\fR" 4
+.IX Item "-bd 'num color_spec'"
+.PD
+Set the pixel width of the transparent border (default 0). Using this
+option will make the image edges transparent, but it only affects pixels
+with the background color. Giving a \fIcolor_spec\fR will set the
+fallback color, to be used in viewers that cannot handle transparency
+(the default is the background color). The color spec should be in
+TeX color \especial syntax, e.g., 'rgb 1.0 0.0 0.0'. Setting the
+fallback color makes the default border width 1 px.
+.IP "\fB\-\-bdpi\fR \fInum\fR" 4
+.IX Item "--bdpi num"
+This option only has an effect when using bitmapped (\s-1PK\s0) fonts. The
+option sets the base (Metafont) resolution, both horizontal and
+vertical, to \fInum\fR dpi (dots per inch). This option is necessary
+when manually selecting Metafont mode with the \-\-mode option (see
+below).
+.IP "\fB\-bg\fR \fIcolor_spec\fR" 4
+.IX Item "-bg color_spec"
+Choose background color for the images. This option will be ignored if
+there is a background color \especial in the \s-1DVI.\s0 The color spec should
+be in TeX color \especial syntax, e.g., 'rgb 1.0 0.0 0.0'. You can
+also specify 'Transparent' or 'transparent' which will give you a
+transparent background with the normal background as a fallback color. A
+capitalized 'Transparent' will give a full-alpha transparency, while an
+all-lowercase 'transparent' will give a simple fully transparent
+background with non-transparent antialiased pixels. The latter would be
+suitable for viewers who cannot cope with a true alpha channel. \s-1GIF\s0
+images do not support full alpha transparency, so in case of \s-1GIF\s0 output,
+both variants will use the latter behaviour.
+.IP "\fB\-d\fR \fInum\fR" 4
+.IX Item "-d num"
+Set the debug flags, showing what dvipng (thinks it) is doing. This will
+work unless dvipng has been compiled without the \f(CW\*(C`DEBUG\*(C'\fR option
+(not recommended). Set the flags as you need them, use \fB\-d \-1\fR as
+the first option for maximum output.
+.IP "\fB\-D\fR \fInum\fR" 4
+.IX Item "-D num"
+Set the output resolution, both horizontal and vertical, to \fInum\fR
+dpi (dots per inch).
+.Sp
+One may want to adjust this to fit a certain text font size (e.g., on
+a web page), and for a text font height of \fIfont_px\fR pixels (in
+Mozilla) the correct formula is
+.Sp
+.Vb 1
+\& <dpi> = <font_px> * 72.27 / 10 [px * TeXpt/in / TeXpt]
+.Ve
+.Sp
+The last division by ten is due to the standard font height 10pt in
+your document, if you use 12pt, divide by 12. Unfortunately, some
+proprietary browsers have font height in pt (points), not pixels. You
+have to rescale that to pixels, using the screen resolution (default
+is usually 96 dpi) which means the formula is
+.Sp
+.Vb 1
+\& <font_px> = <font_pt> * 96 / 72 [pt * px/in / (pt/in)]
+.Ve
+.Sp
+On some high-res screens, the value is instead 120 dpi. Good luck!
+.IP "\fB\-\-depth*\fR" 4
+.IX Item "--depth*"
+Report the depth of the image. This only works reliably when the
+LaTeX style \fIpreview.sty\fR from preview-latex is used with
+the \fBactive\fR option. It reports the number of pixels from the
+bottom of the image to the baseline of the image. This can be used for
+vertical positioning of the image in, e.g., web documents, where one
+would use (Cascading StyleSheets 1)
+.Sp
+.Vb 1
+\& <IMG SRC="<filename.png>" STYLE="vertical\-align: \-<depth>px">
+.Ve
+.Sp
+The depth is a negative offset in this case, so the minus sign is
+necessary, and the unit is pixels (px).
+.IP "\fB\-\-dvinum*\fR" 4
+.IX Item "--dvinum*"
+Set this option to make the output page number be the TeX page
+numbers rather than the physical page number. See the \fB\-o\fR switch.
+.IP "\fB\-fg\fR \fIcolor_spec\fR" 4
+.IX Item "-fg color_spec"
+Choose foreground color for the images. This option will be ignored if
+there is a foreground color \especial in the \s-1DVI.\s0 The color spec should
+be in TeX color \especial syntax, e.g., 'rgb 1.0 0.0 0.0'.
+.IP "\fB\-\-follow*\fR" 4
+.IX Item "--follow*"
+Wait for data at end-of-file. One of the benefits of dvipng is that it
+does not read the postamble, so it can be started before TeX
+finishes. This switch makes dvipng wait at end-of-file for further
+output, unless it finds the \s-1POST\s0 marker that indicates the end of the
+\&\s-1DVI.\s0 This is similar to \fBtail \-f\fR but for DVI-to-PNG conversion.
+.IP "\fB\-\-freetype*\fR" 4
+.IX Item "--freetype*"
+Enable/disable FreeType font rendering (default on). This option is
+available if the FreeType2 font library was present at compilation time.
+If this is the case, dvipng will have direct support for PostScript
+Type1 and TrueType fonts internally, rather than using \fBgsftopk\fR
+for rendering the fonts. If you have PostScript versions of Computer
+Modern installed, there will be no need to generate bitmapped (\s-1PK\s0)
+variants on disk of these. Then, you can render images at different (and
+unusual) resolutions without cluttering the disk with lots of bitmapped
+fonts.
+One reason to disable FreeType font rendering would be to generate
+identical output on different platforms, since FreeType uses the native
+renderer and therefore can give slightly different output on each platform.
+.IP "\fB\-\-gamma\fR \fInum\fR" 4
+.IX Item "--gamma num"
+Control the interpolation of colors in the greyscale anti-aliasing
+color palette. Default value is 1.0. For 0 < \fInum\fR < 1, the
+fonts will be lighter (more like the background), and for \fInum\fR >
+1, the fonts will be darker (more like the foreground).
+.IP "\fB\-\-gif*\fR" 4
+.IX Item "--gif*"
+The images are output in the \s-1GIF\s0 format, if \s-1GIF\s0 support is enabled.
+This is the default for the \fBdvigif\fR binary, which only will be
+available when \s-1GIF\s0 support is enabled. \s-1GIF\s0 images are palette images
+(see the \fB\-\-palette\fR option) and does not support true alpha
+channels (see the \fB\-\-bg\fR option). See also the \fB\-\-png\fR
+option.
+.IP "\fB\-\-height*\fR" 4
+.IX Item "--height*"
+Report the height of the image. This only works reliably when the
+LaTeX style \fIpreview.sty\fR from preview-latex is used with
+the \fBactive\fR option. It reports the number of pixels from the top
+of the image to the baseline of the image. The total height of the
+image is obtained as the sum of the values reported from
+\&\fB\-\-height\fR and \fB\-\-depth\fR.
+.IP "\fB\-l [=]\fR\fInum\fR" 4
+.IX Item "-l [=]num"
+The last page printed will be the first one numbered \fInum\fR. Default
+is the last page in the document. If \fInum\fR is prefixed by an equals
+sign, then it (and the argument to the \fB\-p\fR option, if specified)
+is treated as a physical (absolute) page number, rather than a value to
+compare with the TeX \fB\ecount0\fR values stored in the \s-1DVI\s0 file.
+Thus, using \fB\-l =9\fR will end with the ninth page of the document,
+no matter what the pages are actually numbered.
+.IP "\fB\-\-mode\fR \fImode\fR" 4
+.IX Item "--mode mode"
+This option only has an effect when using bitmapped (\s-1PK\s0) fonts. Use
+\&\fImode\fR as the Metafont device name for the \s-1PK\s0 fonts (both for path
+searching and font generation). This needs to be augmented with the base
+device resolution, given with the \fB\-\-bdpi\fR option. See the file
+<\fBftp://ftp.tug.org/tex/modes.mf\fR> for a list of resolutions and mode
+names for most devices.
+.IP "\fB\-M*\fR" 4
+.IX Item "-M*"
+This option only has an effect when using bitmapped (\s-1PK\s0) fonts. It turns
+off automatic \s-1PK\s0 font generation (\fImktexpk\fR).
+.IP "\fB\-\-nogs*\fR" 4
+.IX Item "--nogs*"
+This switch prohibits the internal call to GhostScript for displaying
+PostScript specials. \fB\-\-nogs0\fR turns the call back on.
+.IP "\fB\-\-nogssafer*\fR" 4
+.IX Item "--nogssafer*"
+Normally, if GhostScript is used to render PostScript specials, the
+GhostScript interpreter is run with the option \fB\-dSAFER\fR. The
+\&\fB\-\-nogssafer\fR option runs GhostScript without \fB\-dSAFER\fR. The
+\&\fB\-dSAFER\fR option in Ghostscript disables PostScript operators such
+as deletefile, to prevent possibly malicious PostScript programs from
+having any effect.
+.IP "\fB\-\-norawps*\fR" 4
+.IX Item "--norawps*"
+Some packages generate raw PostScript specials, even non-rendering such
+specials. This switch turns off the internal call to GhostScript
+intended to display these raw PostScript specials. \fB\-\-norawps0\fR
+turns the call back on.
+.IP "\fB\-o\fR \fIname\fR" 4
+.IX Item "-o name"
+Send output to the file \fIname\fR. A single occurrence of \fB\f(CB%d\fB\fR or
+\&\fB\f(CB%01d\fB\fR, ..., \fB\f(CB%09d\fB\fR will be exchanged for the physical
+page number (this can be changed, see the \fB\-\-dvinum\fR switch). The
+default output filename is \fIfile\fR\fB\f(CB%d\fB.png\fR where the input \s-1DVI\s0
+file was \fIfile\fR\fB.dvi\fR.
+.IP "\fB\-O\fR \fIx\-offset\fR\fB,\fR\fIy\-offset\fR" 4
+.IX Item "-O x-offset,y-offset"
+Move the origin by \fIx\-offset\fR,\fIy\-offset\fR, a comma-separated
+pair of dimensions such as \fB.1in,\-.3cm\fR.
+The origin of the page is shifted from the default position
+(of one inch down, one inch to the right from the upper left corner of
+the paper) by this amount.
+.IP "\fB\-p [=]\fR\fInum\fR" 4
+.IX Item "-p [=]num"
+The first page printed will be the first one numbered \fInum\fR. Default
+is the first page in the document. If \fInum\fR is prefixed by an
+equals sign, then it (and the argument to the \fB\-l\fR option, if
+specified) is treated as a physical (absolute) page number, rather than
+a value to compare with the TeX \fB\ecount0\fR values stored in the
+\&\s-1DVI\s0 file. Thus, using \fB\-p =3\fR will start with the third page of
+the document, no matter what the pages are actually numbered.
+.IP "\fB\-\-palette*\fR" 4
+.IX Item "--palette*"
+When an external image is included, \fBdvipng\fR will automatically
+switch to truecolor mode, to avoid unnecessary delay and quality
+reduction, and enable the \s-1EPS\s0 translator to draw on a transparent
+background and outside of the boundingbox. This switch will force
+palette (256\-color) output and make \fBdvipng\fR revert to opaque
+clipped image inclusion. This will also override the \fB\-\-truecolor\fR
+switch if present.
+.IP "\fB\-\-picky*\fR" 4
+.IX Item "--picky*"
+No images are output when a warning occurs. Normally, dvipng will
+output an image in spite of a warning, but there may be something
+missing in this image. One reason to use this option would be if you
+have a more complete but slower fallback converter. Mainly, this is
+useful for failed figure inclusion and unknown \especial occurrences,
+but warnings will also occur for missing or unknown color specs and
+missing \s-1PK\s0 fonts.
+.IP "\fB\-\-png*\fR" 4
+.IX Item "--png*"
+The images are output in the \s-1PNG\s0 format. This is the default for the
+\&\fBdvipng\fR binary. See also the \fB\-\-gif\fR option.
+.IP "\fB\-pp\fR \fIfirstpage\fR\fB\-\fR\fIlastpage\fR" 4
+.IX Item "-pp firstpage-lastpage"
+Print pages \fIfirstpage\fR through \fIlastpage\fR; but not quite
+equivalent to \fB\-p\fR \fIfirstpage\fR \fB\-l\fR \fIlastpage\fR. For example,
+when rendering a book, there may be several instances of a page in the
+\&\s-1DVI\s0 file (one in \f(CW\*(C`\efrontmatter\*(C'\fR, one in \f(CW\*(C`\emainmatter\*(C'\fR, and one
+in \f(CW\*(C`\ebackmatter\*(C'\fR). In case of several pages matching, \fB\-pp\fR
+\&\fIfirstpage\fR\fB\-\fR\fIlastpage\fR will render \fIall\fR pages that
+matches the specified range, while \fB\-p\fR \fIfirstpage\fR \fB\-l\fR
+\&\fIlastpage\fR will render the pages from the \fIfirst\fR occurrence
+of \fIfirstpage\fR to the \fIfirst\fR occurrence of \fIlastpage\fR.
+This is the (undocumented) behaviour of dvips. In dvipng you can give
+both kinds of options, in which case you get all pages that matches the
+range in \fB\-pp\fR between the pages from \fB\-p\fR to \fB\-l\fR. Also
+multiple \fB\-pp\fR options accumulate, unlike \fB\-p\fR and \fB\-l\fR.
+The \fB\-\fR separator can also be \fB:\fR. Note that \fB\-pp \-1\fR
+will be interpreted as \*(L"all pages up to and including 1\*(R", if you want a
+page numbered \-1 (only the table of contents, say) put \fB\-pp \-1\-\-1\fR,
+or more readable, \fB\-pp \-1:\-1\fR.
+.IP "\fB\-q*\fR" 4
+.IX Item "-q*"
+Run quietly. Don't chatter about pages converted, etc. to standard
+output; report no warnings (only errors) to standard error.
+.IP "\fB\-Q\fR \fInum\fR" 4
+.IX Item "-Q num"
+Set the quality to \fInum\fR. That is, choose the number of antialiasing
+levels for bitmapped fonts (\s-1PK\s0), to be
+\&\fInum\fR*\fInum\fR+1. The default value is 4 which gives 17 levels of
+antialiasing for antialiased fonts from these two. If FreeType is
+available, its rendering is unaffected by this option.
+.IP "\fB\-r*\fR" 4
+.IX Item "-r*"
+Toggle output of pages in reverse/forward order. By default, the first
+page in the \s-1DVI\s0 is output first.
+.IP "\fB\-\-strict*\fR" 4
+.IX Item "--strict*"
+The program exits when a warning occurs. Normally, dvipng will output
+an image in spite of a warning, but there may be something missing in
+this image. One reason to use this option would be if you have a more
+complete but slower fallback converter. See the \fB\-\-picky\fR option
+above for a list of when warnings occur.
+.IP "\fB\-T\fR \fIimage_size\fR" 4
+.IX Item "-T image_size"
+Set the image size to \fIimage_size\fR which can be either of
+\&\fBbbox\fR, \fBtight\fR, or a comma-separated pair of dimensions
+\&\fIhsize\fR,\fIvsize\fR such as \fB.1in,.3cm\fR. The default is
+\&\fBbbox\fR which produces a \s-1PNG\s0 that includes all ink put on the page
+and in addition the \s-1DVI\s0 origin, located 1in from the top and 1in from
+the left edge of the paper. This usually gives whitespace above and to
+the left in the produced image. The value \fBtight\fR will make dvipng
+only include all ink put on the page, producing neat images.
+.IP "\fB\-\-truecolor*\fR" 4
+.IX Item "--truecolor*"
+This will make \fBdvipng\fR generate truecolor output. Note that
+truecolor output is automatic if you include an external image in your
+\&\s-1DVI,\s0 e.g., via a PostScript special (i.e., the \fBgraphics\fR or
+\&\fBgraphicx\fR package). This switch is overridden by the
+\&\fB\-\-palette\fR switch.
+.IP "\fB\-v*\fR" 4
+.IX Item "-v*"
+Enable verbose operation. This will currently indicate what fonts is
+used, in addition to the usual output.
+.IP "\fB\-\-width*\fR" 4
+.IX Item "--width*"
+Report the width of the image. See also \fB\-\-height\fR and
+\&\fB\-\-depth\fR.
+.IP "\fB\-x\fR \fInum\fR" 4
+.IX Item "-x num"
+This option is deprecated; it should not be used. It is much better to
+select the output resolution directly with the \fB\-D\fR option. This
+option sets the magnification ratio to \fInum\fR/1000 and
+overrides the magnification specified in the \s-1DVI\s0 file. Must be between
+10 and 100000. It is recommended that you use standard magstep values
+(1095, 1200, 1440, 1728, 2074, 2488, 2986, and so on) to help reduce the
+total number of \s-1PK\s0 files generated. \fInum\fR may be a real number, not
+an integer, for increased precision.
+.IP "\fB\-z\fR \fInum\fR" 4
+.IX Item "-z num"
+Set the \s-1PNG\s0 compression level to \fInum\fR. This option is enabled if
+your \fBlibgd\fR is new enough. The default compression level is 1,
+which selects maximum speed at the price of slightly larger PNGs. For an
+older \fBlibgd\fR, the hard-soldered value 5 is used. The include file
+\&\fBpng.h\fR says
+\&\*(L"Currently, valid values range from 0 \- 9, corresponding directly to
+the zlib compression levels 0 \- 9 (0 \- no compression, 9 \- \*(R"maximal\*(L"
+compression). Note that tests have shown that zlib compression levels
+3\-6 usually perform as well as level 9 for \s-1PNG\s0 images, and do
+considerably fewer calculations. In the future, these values may not
+correspond directly to the zlib compression levels.\*(R"
+.SH "NOTES"
+.IX Header "NOTES"
+The full manual is accessible in info format, on most systems by typing
+.PP
+.Vb 1
+\& info dvipng
+.Ve
+.SH "COPYRIGHT"
+.IX Header "COPYRIGHT"
+This program is released under the \s-1GNU\s0 Lesser General Public License
+version 3, see the \s-1COPYING\s0 file in the dvipng distribution or
+<\fBhttp://www.gnu.org/licenses/gpl.html\fR>.
+.PP
+Copyright (c) 2002\-2015, 2019 Jan-AAke Larsson
diff --git a/Build/source/texk/dvipng/dvipng-src/dvipng.c b/Build/source/texk/dvipng/dvipng-src/dvipng.c
new file mode 100644
index 00000000000..c71d1a26695
--- /dev/null
+++ b/Build/source/texk/dvipng/dvipng-src/dvipng.c
@@ -0,0 +1,156 @@
+/* dvipng.c */
+
+/************************************************************************
+
+ Part of the dvipng distribution
+
+ This program is free software: you can redistribute it and/or modify
+ it under the terms of the GNU Lesser General Public License as
+ published by the Free Software Foundation, either version 3 of the
+ License, or (at your option) any later version.
+
+ This program is distributed in the hope that it will be useful, but
+ WITHOUT ANY WARRANTY; without even the implied warranty of
+ MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU
+ Lesser General Public License for more details.
+
+ You should have received a copy of the GNU Lesser General Public
+ License along with this program. If not, see
+ <http://www.gnu.org/licenses/>.
+
+ Copyright (C) 2002-2015,2019 Jan-Åke Larsson
+
+************************************************************************/
+
+/* This program translates TeX's DVI-Code into Portable Network Graphics. */
+
+#define MAIN
+#include "dvipng.h"
+
+#ifdef MIKTEX
+# define main __cdecl Main
+#endif /* MIKTEX */
+/**********************************************************************/
+/******************************* main *******************************/
+/**********************************************************************/
+int main(int argc, char ** argv)
+{
+ bool parsestdin;
+
+#ifdef TIMING
+# ifdef HAVE_GETTIMEOFDAY
+ gettimeofday(&Tp, NULL);
+ timer = Tp.tv_sec + Tp.tv_usec / 1000000.0;
+# else
+# ifdef HAVE_FTIME
+ ftime(&timebuffer);
+ timer = timebuffer.time + timebuffer.millitm / 1000.0;
+# endif
+# endif
+#endif
+ /* setbuf(stderr, NULL); */
+
+#ifdef HAVE_LIBKPATHSEA
+ /* Use extra paths as used by dvips */
+ kpse_set_program_name(argv[0],"dvips");
+ /* If dvipng is not installed in the texmf tree, and _only_
+ * SELFAUTO... is used in texmf.cnf, kpathsea will not find a)
+ * Virtual fonts b) ps2pk.map or psfonts.map c) PostScript fonts
+ *
+ * We adjust these things here
+ */
+ /* char selfautodir[MAXPATHLEN];
+ FILE *self;
+ self = popen("kpsewhich -expand-var='$SELFAUTODIR'", "r");
+ if (!self)
+ ...
+ if (!fgets(selfautodir, MAXPATHLEN, self))
+ ...
+ fclose(self); */
+# ifdef ENV_SELFAUTOLOC
+ putenv(ENV_SELFAUTOLOC);
+# endif
+# ifdef ENV_SELFAUTODIR
+ putenv(ENV_SELFAUTODIR);
+# endif
+# ifdef ENV_SELFAUTOPARENT
+ putenv(ENV_SELFAUTOPARENT);
+# endif
+ kpse_set_program_enabled (kpse_pk_format, makeTexPK, kpse_src_compile);
+#endif
+
+#ifdef HAVE_TEXLIVE_GS_INIT
+ texlive_gs_init();
+#endif
+
+ initcolor();
+ parsestdin = DecodeArgs(argc, argv);
+
+#ifdef HAVE_LIBKPATHSEA
+ if (user_mfmode)
+ if (user_bdpi)
+ kpse_init_prog("DVIPNG", user_bdpi, user_mfmode, "cmr10");
+ else {
+ Warning("--mfmode given without --bdpi");
+ /* this will give a lot of warnings but... */
+ kpse_init_prog("DVIPNG", 300, user_mfmode, "cmr10");
+ }
+ else
+ kpse_init_prog("DVIPNG", 300, "cx", "cmr10");
+#endif
+
+#ifdef HAVE_FT2
+ InitPSFontMap();
+#endif
+
+ if (dvi!=NULL) DrawPages();
+
+ if (parsestdin) {
+ char line[STRSIZE];
+
+ printf("%s> ",dvi!=NULL?dvi->name:"");
+ while(fgets(line,STRSIZE,stdin)) {
+ DecodeString(line);
+ if (dvi!=NULL) {
+ DVIReOpen(dvi);
+ DrawPages();
+ }
+ printf("%s> ",dvi!=NULL?dvi->name:"");
+ }
+ printf("\n");
+ }
+
+#ifdef TIMING
+# ifdef HAVE_GETTIMEOFDAY
+ gettimeofday(&Tp, NULL);
+ timer = Tp.tv_sec + Tp.tv_usec/1000000.0 - timer;
+# else
+# ifdef HAVE_FTIME
+ ftime(&timebuffer);
+ timer = timebuffer.time + timebuffer.millitm/1000.0 - timer;
+# endif
+# endif
+
+ if (ndone > 0)
+ fprintf(stderr,
+ "Time of complete run: %.2f s, %d page(s), %.4f s/page.\n",
+ timer, ndone, timer / ndone);
+ if (my_toc >= 0.0001)
+ fprintf(stderr,
+ "Thereof in TIC/TOC region %.5f s.\n",my_toc);
+#endif
+
+ ClearFonts();
+ DVIClose(dvi);
+ ClearColorNames();
+#ifdef HAVE_FT2
+ ClearPSFontMap();
+ ClearEncoding();
+ ClearSubfont();
+ if (libfreetype!=NULL && FT_Done_FreeType(libfreetype))
+ Fatal("an error occured during freetype destruction");
+ libfreetype = NULL;
+#endif
+
+ exit(exitcode);
+}
diff --git a/Build/source/texk/dvipng/dvipng-src/dvipng.h b/Build/source/texk/dvipng/dvipng-src/dvipng.h
new file mode 100644
index 00000000000..9b5c5684730
--- /dev/null
+++ b/Build/source/texk/dvipng/dvipng-src/dvipng.h
@@ -0,0 +1,526 @@
+/* dvipng.h */
+
+/************************************************************************
+
+ Part of the dvipng distribution
+
+ This program is free software: you can redistribute it and/or modify
+ it under the terms of the GNU Lesser General Public License as
+ published by the Free Software Foundation, either version 3 of the
+ License, or (at your option) any later version.
+
+ This program is distributed in the hope that it will be useful, but
+ WITHOUT ANY WARRANTY; without even the implied warranty of
+ MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU
+ Lesser General Public License for more details.
+
+ You should have received a copy of the GNU Lesser General Public
+ License along with this program. If not, see
+ <http://www.gnu.org/licenses/>.
+
+ Copyright (C) 2002-2015 Jan-Åke Larsson
+
+************************************************************************/
+
+#ifndef DVIPNG_H
+#define DVIPNG_H
+#include "config.h"
+
+#define STRSIZE 255 /* stringsize for file specifications */
+
+#define FIRSTFNTCHAR 0
+#define LASTFNTCHAR 255
+#define NFNTCHARS LASTFNTCHAR+1
+
+#define STACK_SIZE 100 /* DVI-stack size */
+
+#define DEFAULT_GAMMA 1.0
+
+/* Name of the program which is called to generate missing pk files */
+#define MAKETEXPK "mktexpk"
+
+#ifdef HAVE_INTTYPES_H
+# include <inttypes.h>
+#else /* HAVE_INTTYPES_H */
+# ifndef __sgi
+/* IRIX has the following types typedef'd in sys/types.h already,
+ * i.e., _old_ IRIX systems; newer ones have a working inttypes.h */
+typedef signed char int8_t;
+typedef short int16_t;
+typedef int int32_t;
+#endif /* ! __sgi */
+typedef unsigned char uint8_t;
+typedef unsigned short uint16_t;
+typedef unsigned int uint32_t;
+typedef long long int64_t;
+typedef unsigned long long uint64_t;
+#endif /* HAVE_INTTYPES_H */
+
+#ifndef INT32_MIN
+#define INT32_MIN (-2147483647-1)
+#endif
+#ifndef INT32_MAX
+#define INT32_MAX (2147483647)
+#endif
+
+#include <gd.h>
+
+#ifdef HAVE_KPATHSEA_KPATHSEA_H
+# include <kpathsea/kpathsea.h>
+#else
+# error: kpathsea/kpathsea.h is missing from your system
+#endif
+
+#ifdef HAVE_FT2
+#include <ft2build.h>
+#include FT_FREETYPE_H
+#endif
+
+#ifdef HAVE_STDBOOL_H
+# include <stdbool.h>
+#else
+# ifdef HAVE_KPATHSEA_KPATHSEA_H
+/* boolean is an enum type from kpathsea/types.h loaded in
+ kpathsea/kpathsea.h, use it as fallback */
+# define bool boolean
+# else
+typedef int bool;
+# define true (bool) 1
+# define false (bool) 0
+# endif
+#endif
+
+#ifndef HAVE_VPRINTF
+# ifdef HAVE_DOPRNT
+# define vfprintf(stream, message, args) _doprnt(message, args, stream)
+# else
+# error: vfprintf AND _doprnt are missing!!!
+ /* If we have neither, should fall back to fprintf with fixed args. */
+# endif
+#endif
+
+/*************************************************************/
+/************************* protos.h ************************/
+/*************************************************************/
+
+typedef int pixels;
+typedef int32_t subpixels;
+typedef int32_t dviunits;
+
+#define MM_TO_PXL(x) (int)(((x)*resolution*10)/254)
+#define PT_TO_PXL(x) (int)((int32_t)((x)*resolution*100l)/7224)
+#define PT_TO_DVI(x) (int32_t)((x)*65536l)
+
+/*#define PIXROUND(x,c) ((((double)x+(double)(c>>1))/(double)c)+0.5)*/
+/*#define PIXROUND(x,c) (((x)+c)/(c))*/
+/*#define PIXROUND(x,c) ((x+c-1)/(c))*/
+/*#define PIXROUND(x,c) ((x)/(c))*/
+/* integer round to the nearest number, not towards zero */
+#define PIXROUND(num,den) ((num)>0 ? ((num)+(den)/2)/(den) : -(((den)/2-(num))/(den)))
+
+
+/********************************************************/
+/*********************** dvi.h ************************/
+/********************************************************/
+
+#define DVI_TYPE 0
+struct dvi_data { /* dvi entry */
+ int type; /* This is a DVI */
+ struct dvi_data *next;
+ uint32_t num, den, mag; /* PRE command parameters */
+ int32_t conv; /* computed from num and den */
+ /* divide dvi units (sp) with conv to get mf device resolution */
+ /* divide further with shrinkfactor to get true resolution */
+ char * name; /* full name of DVI file */
+ char * outname; /* output filename (basename) */
+ FILE * filep; /* file pointer */
+ time_t mtime; /* modification time */
+ struct font_num *fontnump; /* DVI font numbering */
+ struct page_list *pagelistp; /* DVI page list */
+#define DVI_PREVIEW_LATEX_TIGHTPAGE 1
+#define DVI_PREVIEW_BOP_HOOK (1<<1)
+ uint32_t flags; /* Preview-latex flags */
+};
+
+#define PAGE_POST INT32_MAX
+#define PAGE_LASTPAGE INT32_MAX-1
+#define PAGE_MAXPAGE INT32_MAX-2 /* assume no pages out of this range */
+#define PAGE_FIRSTPAGE INT32_MIN
+#define PAGE_MINPAGE INT32_MIN+1 /* assume no pages out of this range */
+
+struct dvi_color {
+ int red,green,blue;
+};
+
+struct page_list {
+ struct page_list* next;
+ int offset; /* file offset to BOP */
+ int32_t count[11]; /* 10 dvi counters + absolute pagenum in file */
+ int csp; /* color stack pointer at BOP */
+ struct dvi_color cstack[2]; /* color stack at BOP, may be longer */
+};
+
+
+
+
+struct dvi_data* DVIOpen(char*,char*);
+void DVIClose(struct dvi_data*);
+bool DVIReOpen(struct dvi_data*);
+struct page_list*FindPage(struct dvi_data*, int32_t, bool);
+struct page_list*NextPage(struct dvi_data*, struct page_list*);
+struct page_list*PrevPage(struct dvi_data*, struct page_list*);
+int SeekPage(struct dvi_data*, struct page_list*);
+bool DVIFollowToggle(void);
+unsigned char* DVIGetCommand(struct dvi_data*);
+bool DVIIsNextPSSpecial(struct dvi_data*);
+uint32_t CommandLength(unsigned char*);
+void ClearPSHeaders(void);
+
+/********************************************************/
+/********************** misc.h ************************/
+/********************************************************/
+
+struct filemmap {
+#ifdef WIN32
+ HANDLE hFile;
+ HANDLE hMap;
+#else /* WIN32 */
+ int fd;
+#endif /* WIN32 */
+ char* data;
+ size_t size;
+};
+
+bool DecodeArgs(int, char *[]);
+void DecodeString(char *);
+bool MmapFile (char *filename,struct filemmap *fmmap);
+void UnMmapFile(struct filemmap* fmmap);
+
+void Message(int, const char *fmt, ...);
+void Warning(const char *fmt, ...);
+void Fatal(const char *fmt, ...);
+
+int32_t SNumRead(unsigned char*, register int);
+uint32_t UNumRead(unsigned char*, register int);
+
+bool MmapFile (char *filename,struct filemmap *fmmap);
+void UnMmapFile(struct filemmap* fmmap);
+
+
+/********************************************************/
+/*********************** font.h ***********************/
+/********************************************************/
+struct encoding {
+ struct encoding* next;
+ char* name;
+ char* charname[257];
+};
+
+struct subfont {
+ struct subfont* next;
+ char* name;
+ char* infix;
+ int encoding;
+ int32_t charindex[256];
+};
+
+#ifdef HAVE_FT2
+struct psfontmap {
+ struct psfontmap *next;
+ char *line,*psfile,*tfmname,*encname,*end;
+ struct encoding* encoding;
+ FT_Matrix* ft_transformp;
+ FT_Matrix ft_transform;
+ struct subfont* subfont;
+};
+#endif
+
+#define FONT_TYPE_PK 1
+#define FONT_TYPE_VF 2
+#define FONT_TYPE_FT 3
+struct char_entry { /* PK/FT Glyph/VF Macro */
+ dviunits tfmw; /* TFM width */
+ unsigned char *data; /* glyph data, either pixel data
+ * (0=transp, 255=max ink) or VF macro */
+ uint32_t length; /* Length of PK data or VF macro */
+ /* Only used in pixel fonts */
+ pixels w,h; /* width and height in pixels */
+ subpixels xOffset, yOffset; /* x offset and y offset in subpixels */
+ /* Only used in PK fonts */
+ unsigned char *pkdata; /* Points to beginning of PK data */
+ unsigned char flag_byte; /* PK flagbyte */
+};
+
+struct font_entry { /* font entry */
+ int type; /* PK/VF/Type1 ... */
+ struct font_entry *next;
+ uint32_t c, s, d;
+ uint8_t a, l;
+ char n[STRSIZE]; /* FNT_DEF command parameters */
+ int dpi; /* computed from s and d */
+ char * name; /* full name of PK/VF file */
+ struct filemmap fmmap; /* file memory map */
+ uint32_t magnification; /* magnification read from font file */
+ uint32_t designsize; /* design size read from font file */
+ void * chr[NFNTCHARS]; /* character information */
+#ifdef HAVE_FT2
+ FT_Face face; /* Freetype2 face */
+ struct psfontmap* psfontmap; /* Font transformation */
+#endif
+ struct font_num *vffontnump; /* VF local font numbering */
+ int32_t defaultfont; /* VF default font number */
+};
+
+struct font_num { /* Font number. Different for VF/DVI, and several
+ font_num can point to one font_entry */
+ struct font_num *next;
+ int32_t k;
+ struct font_entry *fontp;
+};
+
+void CheckChecksum(uint32_t, uint32_t, const char*);
+void InitPK (struct font_entry *newfontp);
+void DonePK(struct font_entry *oldfontp);
+void InitVF (struct font_entry *newfontp);
+void DoneVF(struct font_entry *oldfontp);
+
+void FontDef(unsigned char*, void* /* dvi/vf */);
+void ClearFonts(void);
+void SetFntNum(int32_t, void* /* dvi/vf */);
+void FreeFontNumP(struct font_num *hfontnump);
+
+#ifdef HAVE_FT2
+char* copyword(char* orig);
+struct psfontmap *NewPSFont(struct psfontmap* copyfrom);
+void InitPSFontMap(void);
+void ClearPSFontMap(void);
+struct psfontmap* FindPSFontMap(char*);
+struct encoding* FindEncoding(char*);
+void ClearEncoding(void);
+bool ReadTFM(struct font_entry *, char*);
+bool InitFT(struct font_entry *);
+void DoneFT(struct font_entry *tfontp);
+void LoadFT(int32_t, struct char_entry *);
+struct psfontmap* FindSubFont(struct psfontmap* entry, char* fontname);
+void ClearSubfont(void);
+#endif
+
+/********************************************************/
+/********************* ppagelist.h ********************/
+/********************************************************/
+
+bool ParsePages(const char*);
+void FirstPage(int32_t,bool);
+void LastPage(int32_t,bool);
+void ClearPpList(void);
+void Reverse(bool);
+struct page_list* NextPPage(void* /* dvi */, struct page_list*);
+
+
+
+
+#ifdef MAIN
+#define EXTERN
+#define INIT(x) =x
+#else
+#define EXTERN extern
+#define INIT(x)
+#endif
+
+/********************************************************/
+/********************** draw.h ************************/
+/********************************************************/
+#include "commands.h"
+
+void CreateImage(pixels width, pixels height);
+void DestroyImage(void);
+void DrawCommand(unsigned char*, void* /* dvi/vf */);
+void DrawPages(void);
+void WriteImage(char*, int);
+void LoadPK(int32_t, register struct char_entry *);
+int32_t SetChar(int32_t);
+dviunits SetGlyph(struct char_entry *ptr, int32_t hh,int32_t vv);
+void Gamma(double gamma);
+int32_t SetVF(struct char_entry *ptr);
+int32_t SetRule(int32_t, int32_t, int32_t, int32_t);
+void SetSpecial(char *, char *, int32_t, int32_t);
+void BeginVFMacro(struct font_entry*);
+void EndVFMacro(void);
+
+/**************************************************/
+void handlepapersize(const char*,int32_t*,int32_t*);
+
+void stringrgb(const char* colorstring,int *r,int *g,int *b);
+void background(const char *);
+void initcolor(void);
+void popcolor(void);
+void pushcolor(const char *);
+void resetcolorstack(const char *);
+void StoreColorStack(struct page_list *tpagep);
+void ReadColorStack(struct page_list *tpagep);
+void StoreBackgroundColor(struct page_list *tpagep);
+void ClearColorNames(void);
+void InitXColorPrologue(const char* prologuename);
+
+/**********************************************************************/
+/************************* Global Variables *************************/
+/**********************************************************************/
+
+#ifdef MAKETEXPK
+#ifdef HAVE_LIBKPATHSEA
+EXTERN bool makeTexPK INIT(MAKE_TEX_PK_BY_DEFAULT);
+#else
+EXTERN bool makeTexPK INIT(_TRUE);
+#endif
+#endif
+
+EXTERN uint32_t usermag INIT(0); /* user specified magstep */
+EXTERN struct font_entry *hfontptr INIT(NULL); /* font list pointer */
+
+EXTERN struct internal_state {
+ struct font_entry* currentfont;
+} current_state;
+
+#define BE_NONQUIET 1
+#define BE_VERBOSE (1<<1)
+#define PARSE_STDIN (1<<2)
+#define EXPAND_BBOX (1<<3)
+#define TIGHT_BBOX (1<<4)
+#define FORCE_TRUECOLOR (1<<5)
+#define USE_FREETYPE (1<<6)
+#define REPORT_HEIGHT (1<<7)
+#define REPORT_DEPTH (1<<8)
+#define REPORT_WIDTH (1<<9)
+#define DVI_PAGENUM (1<<10)
+#define MODE_PICKY (1<<11)
+#define GIF_OUTPUT (1<<12)
+#define MODE_STRICT (1<<13)
+#define NO_GHOSTSCRIPT (1<<14)
+#define NO_GSSAFER (1<<15)
+#define BG_TRANSPARENT (1<<16)
+#define BG_TRANSPARENT_ALPHA (1<<17)
+#define FORCE_PALETTE (1<<18)
+#define NO_RAW_PS (1<<19)
+EXTERN uint32_t option_flags INIT(BE_NONQUIET | USE_FREETYPE);
+
+#define PAGE_GAVE_WARN 1
+#define PAGE_PREVIEW_BOP (1<<1)
+#define PAGE_TRUECOLOR (1<<2)
+EXTERN uint32_t page_flags INIT(0);
+
+
+#ifdef DEBUG
+EXTERN unsigned int debug INIT(0);
+#define DEBUG_PRINT(a,b) if (debug & a) { printf b; fflush(stdout); }
+#define DEBUG_DVI 1
+#define DEBUG_VF (1<<1)
+#define DEBUG_PK (1<<2)
+#define DEBUG_TFM (1<<3)
+#define DEBUG_GLYPH (1<<4)
+#define DEBUG_FT (1<<5)
+#define DEBUG_ENC (1<<6)
+#define DEBUG_COLOR (1<<7)
+#define DEBUG_GS (1<<8)
+#define LASTDEBUG DEBUG_GS
+#define DEBUG_DEFAULT DEBUG_DVI
+#else
+#define DEBUG_PRINT(a,b)
+#endif
+
+/************************timing stuff*********************/
+#ifdef TIMING
+# ifdef TIME_WITH_SYS_TIME
+# include <sys/time.h>
+# include <time.h>
+# else
+# ifdef HAVE_SYS_TIME_H
+# include <sys/time.h>
+# else
+# include <time.h>
+# endif
+# endif
+EXTERN double timer INIT(0);
+EXTERN double my_tic,my_toc INIT(0);
+EXTERN int ndone INIT(0); /* number of pages converted */
+# ifdef HAVE_GETTIMEOFDAY
+EXTERN struct timeval Tp;
+# define TIC { gettimeofday(&Tp, NULL); \
+ my_tic= Tp.tv_sec + Tp.tv_usec/1000000.0;}
+# define TOC { gettimeofday(&Tp, NULL); \
+ my_toc += Tp.tv_sec + Tp.tv_usec/1000000.0 - my_tic;}
+# else
+# ifdef HAVE_FTIME
+EXTERN struct timeb timebuffer;
+# define TIC() { ftime(&timebuffer); \
+ my_tic= timebuffer.time + timebuffer.millitm/1000.0;
+# define TOC() { ftime(&timebuffer); \
+ my_toc += timebuffer.time + timebuffer.millitm/1000.0 - my_tic;}
+# else
+# define TIC()
+# define TOC()
+# endif
+# endif
+#endif /* TIMING */
+
+EXTERN char* user_mfmode INIT(NULL);
+EXTERN int user_bdpi INIT(0);
+EXTERN int dpi INIT(100);
+
+#ifdef HAVE_GDIMAGEPNGEX
+EXTERN int compression INIT(1);
+#endif
+#undef min
+#undef max
+# define max(x,y) if ((y)>(x)) x = y
+# define min(x,y) if ((y)<(x)) x = y
+
+/* These are in pixels*/
+EXTERN int x_min INIT(0);
+EXTERN int y_min INIT(0);
+EXTERN int x_max INIT(0);
+EXTERN int y_max INIT(0);
+
+/* Page size: default set by -T */
+EXTERN int x_width_def INIT(0);
+EXTERN int y_width_def INIT(0);
+
+/* Offset: default set by -O and -T bbox */
+EXTERN int x_offset_def INIT(0);
+EXTERN int y_offset_def INIT(0);
+
+/* Preview-latex's tightpage */
+EXTERN int x_width_tightpage INIT(0);
+EXTERN int y_width_tightpage INIT(0);
+EXTERN int x_offset_tightpage INIT(0);
+EXTERN int y_offset_tightpage INIT(0);
+
+/* Paper size: set by -t, for cropmark purposes only */
+/* This has yet to be written */
+EXTERN int x_pwidth INIT(0);
+EXTERN int y_pwidth INIT(0);
+
+/* The transparent border preview-latex desires */
+EXTERN int borderwidth INIT(0);
+
+/* fallback color for transparent background */
+EXTERN bool userbordercolor INIT(FALSE); /* if true, use user-supplied color */
+EXTERN struct dvi_color bordercolor;
+
+
+EXTERN gdImagePtr page_imagep INIT(NULL);
+EXTERN int32_t shrinkfactor INIT(4);
+
+EXTERN struct dvi_color cstack[STACK_SIZE];
+EXTERN int csp INIT(1);
+
+EXTERN struct font_entry* currentfont;
+EXTERN struct dvi_data* dvi INIT(NULL);
+
+#ifdef HAVE_FT2
+EXTERN FT_Library libfreetype INIT(NULL);
+#endif
+
+#define EXIT_FATAL EXIT_FAILURE+1
+EXTERN int exitcode INIT(EXIT_SUCCESS);
+
+#endif /* DVIPNG_H */
diff --git a/Build/source/texk/dvipng/dvipng-src/dvipng.texi b/Build/source/texk/dvipng/dvipng-src/dvipng.texi
new file mode 100644
index 00000000000..2b8e157bdc2
--- /dev/null
+++ b/Build/source/texk/dvipng/dvipng-src/dvipng.texi
@@ -0,0 +1,984 @@
+\input texinfo
+@setfilename dvipng.info
+@settitle A DVI-to-PNG translator
+@ifset man
+@c man begin SYNOPSIS
+dvipng [options] filename
+
+dvipng [options] [filename] -
+@c man end
+@end ifset
+
+@set version 1.17
+@set month-year January 2020
+
+@c Put everything in one index (arbitrarily chosen to be the concept index).
+@syncodeindex fn cp
+@syncodeindex ky cp
+@syncodeindex pg cp
+@syncodeindex vr cp
+
+@include macros.texi
+@iftex
+@tolerance 10000 @emergencystretch 3em
+@end iftex
+
+@dircategory TeX
+@direntry
+* DVI-to-PNG: (dvipng). Translating TeX DVI files to Portable Network Graphics (PNG).
+* dvipng: (dvipng). A DVI-to-PNG translator.
+@end direntry
+
+@finalout
+@titlepage
+@title dvipng
+@subtitle A DVI-to-PNG Translator
+@subtitle Version @value{version}
+
+
+@author by Jan-@AA{}ke Larsson.
+@page
+@vskip 0pt plus 1filll
+Copyright @copyright{} 2002-2020 Jan-@AA{}ke Larsson
+
+Permission is granted to make and distribute verbatim copies of
+this manual provided the copyright notice and this permission notice
+are preserved on all copies.
+
+@ignore
+Permission is granted to process this file through TeX and print the
+results, provided the printed document carries copying permission
+notice identical to this one except for the removal of this paragraph
+(this paragraph not being relevant to the printed manual).
+@end ignore
+
+Permission is granted to copy and distribute modified versions of this
+manual under the conditions for verbatim copying, provided also that the
+section entitled ``Copying'' is included exactly as in the original, and
+provided that the entire resulting derived work is distributed under the
+terms of a permission notice identical to this one.
+
+Permission is granted to copy and distribute translations of this manual
+into another language, under the above conditions for modified versions,
+except that this permission notice may be stated in a translation
+approved by the Free Software Foundation.
+@end titlepage
+@page
+
+@c @summarycontents
+@contents
+
+@ifnottex
+@node Top
+@top dvipng
+
+This manual documents dvipng, a program to translate a DVI (DeVice
+Independent) file into PNG (Portable Network Graphics).
+
+This file documents dvipng version @value{version}
+
+Corrections or perhaps rewrites of sections are @emph{very welcome}.
+
+Jan-@AA{}ke Larsson
+
+@end ifnottex
+
+@menu
+* Introduction:: Introduction
+* Installation:: How to compile and install dvipng
+* Basic usage:: First things first
+* Command-line options:: Advanced usage
+* Graphics:: Including PostScript and/or bitmaps
+* Color:: Using color with dvipng
+* Diagnosing problems:: Problems?
+* Credits:: People who have contributed
+* Copying:: GNU Lesser General Public License
+* Index:: General index
+@end menu
+
+
+
+@node Introduction
+@chapter Introduction
+
+@c man begin DESCRIPTION
+@include readme.texi
+@c man end
+
+@node Installation
+@chapter Installation
+
+@cindex configuration, of dvipng
+@cindex compilation
+@cindex installation, of dvipng
+
+@include install.texi
+
+@node Basic usage
+@chapter Basic usage of dvipng
+
+@cindex invoking dvipng
+
+To use dvipng at its simplest, simply type
+
+@example
+dvipng foo
+@end example
+
+@noindent
+where @file{foo.dvi} is the output of @TeX{} that you want to convert to
+PNG format. If there are four pages in @file{foo.dvi}, those pages will
+be output as @file{foo1.png}, @file{foo2.png}, @file{foo3.png}, and
+@file{foo4.png}, respectively.
+
+If you have enabled the PostScript font support (via FreeType),
+fonts will be rendered as they are needed. Otherwise, dvipng will use
+bitmapped (PK) fonts, and if you use PK fonts that have not been used on
+your system before, they may be automatically generated; this process
+can take a few minutes, so progress reports appear by default. The next
+time the same font is used, it will have been saved on disk, so
+rendering will go much faster. (If dvipng tries to endlessly generate
+the same fonts over and over again, something is wrong. @xref{Unable to
+generate fonts,,, kpathsea, Kpathsea}.)
+
+Many options are available (see the next section). For a brief summary
+of available options, just type
+
+@example
+dvipng --help
+@end example
+
+@node Command-line options
+@chapter Command-line options
+
+@cindex command-line options
+@cindex options, dvipng
+
+dvipng has a plethora of command line options. Reading through this
+section will give a good idea of the capabilities of the driver.
+
+@menu
+* Option summary:: Quick listing, from dvipng --help.
+* Option details:: More information about each option.
+@end menu
+
+
+@node Option summary
+@section Option summary
+
+@cindex options, summary
+Here is a handy summary of the options; it is printed out when you run
+dvipng with no arguments or with the standard @samp{--help} option.
+
+@example
+@include dvipng.help
+@end example
+
+
+@node Option details
+@section Option details
+
+@cindex option, details of
+@c man begin OPTIONS
+
+Many of the parameterless options listed here can be turned off by
+suffixing the option with a zero (@samp{0}); for instance, to turn off
+page reversal, use @samp{-r0}. Such options are marked with a trailing
+@samp{*}.
+
+@table @samp
+@item -
+@cindex options, reading from standard input
+@cindex standard input, reading options from
+Read additional options from standard input after processing the command
+line.
+
+@item --help
+Print a usage message and exit.
+
+@item --version
+Print the version number and exit.
+
+@item -bd @var{num}
+@item -bd @var{color_spec}
+@item -bd '@var{num} @var{color_spec}'
+@cindex transparent border width
+@cindex transparent border fallback color
+Set the pixel width of the transparent border (default 0). Using this
+option will make the image edges transparent, but it only affects pixels
+with the background color. Giving a @var{color_spec} will set the
+fallback color, to be used in viewers that cannot handle transparency
+(the default is the background color). The color spec should be in
+@TeX{} color \special syntax, e.g., 'rgb 1.0 0.0 0.0'. Setting the
+fallback color makes the default border width 1 px. @xref{Color}.
+
+@item --bdpi @var{num}
+@cindex base resolution, setting
+This option only has an effect when using bitmapped (PK) fonts. The
+option sets the base (Metafont) resolution, both horizontal and
+vertical, to @var{num} dpi (dots per inch). This option is necessary
+when manually selecting Metafont mode with the --mode option (see
+below).
+
+@item -bg @var{color_spec}
+@cindex background color (option)
+Choose background color for the images. This option will be ignored if
+there is a background color \special in the DVI. The color spec should
+be in @TeX{} color \special syntax, e.g., 'rgb 1.0 0.0 0.0'. You can
+also specify 'Transparent' or 'transparent' which will give you a
+transparent background with the normal background as a fallback color. A
+capitalized 'Transparent' will give a full-alpha transparency, while an
+all-lowercase 'transparent' will give a simple fully transparent
+background with non-transparent antialiased pixels. The latter would be
+suitable for viewers who cannot cope with a true alpha channel. GIF
+images do not support full alpha transparency, so in case of GIF output,
+both variants will use the latter behaviour. @xref{Color}.
+
+@item -d @var{num}
+@cindex debugging
+Set the debug flags, showing what dvipng (thinks it) is doing. This will
+work unless dvipng has been compiled without the @code{DEBUG} option
+(not recommended). Set the flags as you need them, use @samp{-d -1} as
+the first option for maximum output. @xref{Debug options}.
+
+@item -D @var{num}
+@cindex output resolution, setting
+Set the output resolution, both horizontal and vertical, to @var{num}
+dpi (dots per inch).
+
+One may want to adjust this to fit a certain text font size (e.g., on
+a web page), and for a text font height of @var{font_px} pixels (in
+Mozilla) the correct formula is
+@example
+@var{dpi} = @var{font_px} * 72.27 / 10 [px * @TeX{}pt/in / @TeX{}pt]
+@end example
+The last division by ten is due to the standard font height 10pt in
+your document, if you use 12pt, divide by 12. Unfortunately, some
+proprietary browsers have font height in pt (points), not pixels. You
+have to rescale that to pixels, using the screen resolution (default
+is usually 96 dpi) which means the formula is
+@example
+@var{font_px} = @var{font_pt} * 96 / 72 [pt * px/in / (pt/in)]
+@end example
+On some high-res screens, the value is instead 120 dpi. Good luck!
+
+@item --depth*
+@cindex baseline reporting
+@cindex depth reporting
+Report the depth of the image. This only works reliably when the
+@LaTeX{} style @file{preview.sty} from @previewlatex{} is used with
+the @samp{active} option. It reports the number of pixels from the
+bottom of the image to the baseline of the image. This can be used for
+vertical positioning of the image in, e.g., web documents, where one
+would use (Cascading StyleSheets 1)
+@example
+<IMG SRC="@var{filename.png}" STYLE="vertical-align: -@var{depth}px">
+@end example
+The depth is a negative offset in this case, so the minus sign is
+necessary, and the unit is pixels (px).
+
+@item --dvinum*
+Set this option to make the output page number be the @TeX{} page
+numbers rather than the physical page number. See the @samp{-o} switch.
+
+@ignore
+@item -e @var{num}
+@cindex maxdrift
+@cindex accuracy in positioning
+@cindex positioning accuracy
+Maximum drift in pixels of each character from its `true'
+resolution-independent position on the page. The default value of this
+parameter is resolution dependent (it is the number of entries in the
+list [100, 200, 300, 400, 500, 600, 800, 1000, 1200, 1600, 2000, 2400,
+2800, 3200, @dots{}] that are less than or equal to the resolution in
+dots per inch). Allowing individual characters to `drift' from their
+correctly rounded positions by a few pixels, while regaining the true
+position at the beginning of each new word, improves the spacing of
+letters in words.
+
+@item -f*
+@cindex filter, running as a
+@cindex standard I/O
+@cindex pipes, not readable
+@vindex PRINTER@r{, avoided with @samp{-f}}
+Run as a filter. Read the DVI file from standard input and write the
+PostScript to standard output. The standard input must be seekable, so
+it cannot be a pipe. If your input must be a pipe, write a shell script
+that copies the pipe output to a temporary file and then points dvipng at
+this file. This option also disables the automatic reading of the
+@code{PRINTER} environment variable; use @samp{-P$PRINTER} after the
+@samp{-f} to read it anyway. It also turns off the automatic sending of
+control-D if it was turned on with the @samp{-F} option or in the
+configuration file; use @samp{-F} after the @samp{-f} to send it anyway.
+
+@item -k*
+@cindex cropmarks
+Print crop marks. This option increases the paper size (which should be
+specified, either with a paper size special or with the @samp{-T}
+option) by a half inch in each dimension. It translates each page by a
+quarter inch and draws cross-style crop marks. It is mostly useful with
+typesetters that can set the page size automatically. This works by
+downloading @file{crop.pro}.
+@end ignore
+
+@item -fg @var{color_spec}
+@cindex foreground color (option)
+Choose foreground color for the images. This option will be ignored if
+there is a foreground color \special in the DVI. The color spec should
+be in @TeX{} color \special syntax, e.g., 'rgb 1.0 0.0 0.0'.
+@xref{Color}.
+
+@item --follow*
+@cindex follow mode
+Wait for data at end-of-file. One of the benefits of dvipng is that it
+does not read the postamble, so it can be started before @TeX{}
+finishes. This switch makes dvipng wait at end-of-file for further
+output, unless it finds the POST marker that indicates the end of the
+DVI. This is similar to @samp{tail -f} but for DVI-to-PNG conversion.
+
+@item --freetype*
+@cindex FreeType font rendering
+Enable/disable FreeType font rendering (default on). This option is
+available if the FreeType2 font library was present at compilation time.
+If this is the case, dvipng will have direct support for PostScript
+Type1 and TrueType fonts internally, rather than using @samp{gsftopk}
+for rendering the fonts. If you have PostScript versions of Computer
+Modern installed, there will be no need to generate bitmapped (PK)
+variants on disk of these. Then, you can render images at different (and
+unusual) resolutions without cluttering the disk with lots of bitmapped
+fonts.
+One reason to disable FreeType font rendering would be to generate
+identical output on different platforms, since FreeType uses the native
+renderer and therefore can give slightly different output on each platform.
+
+@item --gamma @var{num}
+@cindex gamma
+@cindex dark fonts
+@cindex light fonts
+@cindex fuzzy images
+Control the interpolation of colors in the greyscale anti-aliasing
+color palette. Default value is 1.0. For 0 < @var{num} < 1, the
+fonts will be lighter (more like the background), and for @var{num} >
+1, the fonts will be darker (more like the foreground).
+
+@item --gif*
+@cindex GIF image format
+The images are output in the GIF format, if GIF support is enabled.
+This is the default for the @samp{dvigif} binary, which only will be
+available when GIF support is enabled. GIF images are palette images
+(see the @samp{--palette} option) and does not support true alpha
+channels (see the @samp{--bg} option). See also the @samp{--png}
+option.
+
+@item --height*
+@cindex baseline reporting
+@cindex height reporting
+Report the height of the image. This only works reliably when the
+@LaTeX{} style @file{preview.sty} from @previewlatex{} is used with
+the @samp{active} option. It reports the number of pixels from the top
+of the image to the baseline of the image. The total height of the
+image is obtained as the sum of the values reported from
+@samp{--height} and @samp{--depth}.
+
+@item -l [=]@var{num}
+@cindex last page printed
+@cindex page, last printed
+@cindex physical page number, and @samp{-l}
+@cindex absolute page number, and @samp{-l}
+The last page printed will be the first one numbered @var{num}. Default
+is the last page in the document. If @var{num} is prefixed by an equals
+sign, then it (and the argument to the @samp{-p} option, if specified)
+is treated as a physical (absolute) page number, rather than a value to
+compare with the @TeX{} @samp{\count0} values stored in the DVI file.
+Thus, using @samp{-l =9} will end with the ninth page of the document,
+no matter what the pages are actually numbered.
+
+@item --mode @var{mode}
+@cindex mode name, specifying
+@cindex Metafont mode, specifying
+This option only has an effect when using bitmapped (PK) fonts. Use
+@var{mode} as the Metafont device name for the PK fonts (both for path
+searching and font generation). This needs to be augmented with the base
+device resolution, given with the @samp{--bdpi} option. See the file
+@url{ftp://ftp.tug.org/tex/modes.mf} for a list of resolutions and mode
+names for most devices. @xref{Unable to generate fonts,,, kpathsea,
+Kpathsea}.
+
+@item -M*
+@cindex font generation, avoiding
+@pindex mktexpk@r{, avoiding}
+@c this description repeated in kpathsea.texi
+This option only has an effect when using bitmapped (PK) fonts. It turns
+off automatic PK font generation (@file{mktexpk}).
+@ignore
+@flindex missfont.log
+If @code{mktexpk}, the invocation is appended to a file
+@file{missfont.log} (by default) in the current directory. You can then
+execute the log file to create the missing files after fixing the
+problem.
+@vindex TEXMFOUTPUT
+@vindex MISSFONT_LOG
+If the current directory is not writable and the environment variable or
+configuration file value @samp{TEXMFOUTPUT} is set, its value is used.
+Otherwise, nothing is written. The name @samp{missfont.log} is
+overridden by the @samp{MISSFONT_LOG} environment variable or
+configuration file value.
+@end ignore
+
+@item --nogs*
+@cindex GhostScript, turning off
+This switch prohibits the internal call to GhostScript for displaying
+PostScript specials. @samp{--nogs0} turns the call back on.
+
+@item --nogssafer*
+@cindex GhostScript and -dSAFER
+@cindex -dSAFER
+Normally, if GhostScript is used to render PostScript specials, the
+GhostScript interpreter is run with the option @samp{-dSAFER}. The
+@samp{--nogssafer} option runs GhostScript without @samp{-dSAFER}. The
+@samp{-dSAFER} option in Ghostscript disables PostScript operators such
+as deletefile, to prevent possibly malicious PostScript programs from
+having any effect.
+
+@item --norawps*
+@cindex PostScript, turning off raw PostScript specials
+Some packages generate raw PostScript specials, even non-rendering such
+specials. This switch turns off the internal call to GhostScript
+intended to display these raw PostScript specials. @samp{--norawps0}
+turns the call back on.
+
+@item -o @var{name}
+@cindex output, redirecting
+@cindex standard output, output to
+Send output to the file @var{name}. A single occurrence of @samp{%d} or
+@samp{%01d}, @dots{}, @samp{%09d} will be exchanged for the physical
+page number (this can be changed, see the @samp{--dvinum} switch). The
+default output filename is @samp{@var{file}%d.png} where the input DVI
+file was @samp{@var{file}.dvi}.
+
+@item -O @var{x-offset},@var{y-offset}
+@cindex offset pages
+Move the origin by @var{x-offset},@var{y-offset}, a comma-separated
+pair of dimensions such as @samp{.1in,-.3cm}.
+@c (@pxref{papersize special}).
+The origin of the page is shifted from the default position
+(of one inch down, one inch to the right from the upper left corner of
+the paper) by this amount.
+
+@item -p [=]@var{num}
+@cindex first page printed
+@cindex page, first printed
+@cindex physical page number, and @samp{-p}
+@cindex absolute page number, and @samp{-p}
+The first page printed will be the first one numbered @var{num}. Default
+is the first page in the document. If @var{num} is prefixed by an
+equals sign, then it (and the argument to the @samp{-l} option, if
+specified) is treated as a physical (absolute) page number, rather than
+a value to compare with the @TeX{} @samp{\count0} values stored in the
+DVI file. Thus, using @samp{-p =3} will start with the third page of
+the document, no matter what the pages are actually numbered.
+
+@item --palette*
+@cindex forcing palette output
+When an external image is included, @samp{dvipng} will automatically
+switch to truecolor mode, to avoid unnecessary delay and quality
+reduction, and enable the EPS translator to draw on a transparent
+background and outside of the boundingbox. This switch will force
+palette (256-color) output and make @samp{dvipng} revert to opaque
+clipped image inclusion. This will also override the @samp{--truecolor}
+switch if present.
+
+@item --picky*
+@cindex no erroneous images
+No images are output when a warning occurs. Normally, dvipng will
+output an image in spite of a warning, but there may be something
+missing in this image. One reason to use this option would be if you
+have a more complete but slower fallback converter. Mainly, this is
+useful for failed figure inclusion and unknown \special occurrences,
+but warnings will also occur for missing or unknown color specs and
+missing PK fonts.
+
+@item --png*
+@cindex PNG image format
+The images are output in the PNG format. This is the default for the
+@samp{dvipng} binary. See also the @samp{--gif} option.
+
+@item -pp @var{firstpage}-@var{lastpage}
+@cindex page range
+Print pages @var{firstpage} through @var{lastpage}; but not quite
+equivalent to @samp{-p @var{firstpage} -l @var{lastpage}}. For example,
+when rendering a book, there may be several instances of a page in the
+DVI file (one in @code{\frontmatter}, one in @code{\mainmatter}, and one
+in @code{\backmatter}). In case of several pages matching, @samp{-pp
+@var{firstpage}-@var{lastpage}} will render @emph{all} pages that
+matches the specified range, while @samp{-p @var{firstpage} -l
+@var{lastpage}} will render the pages from the @emph{first} occurrence
+of @var{firstpage} to the @emph{first} occurrence of @var{lastpage}.
+This is the (undocumented) behaviour of dvips. In dvipng you can give
+both kinds of options, in which case you get all pages that matches the
+range in @samp{-pp} between the pages from @samp{-p} to @samp{-l}. Also
+multiple @samp{-pp} options accumulate, unlike @samp{-p} and @samp{-l}.
+The @samp{-} separator can also be @samp{:}. Note that @samp{-pp -1}
+will be interpreted as "all pages up to and including 1", if you want a
+page numbered -1 (only the table of contents, say) put @samp{-pp -1--1},
+or more readable, @samp{-pp -1:-1}.
+
+@item -q*
+@cindex quiet operation
+@cindex silent operation
+@cindex warnings, suppressing
+Run quietly. Don't chatter about pages converted, etc.@: to standard
+output; report no warnings (only errors) to standard error.
+
+@item -Q @var{num}
+@cindex antialiasing levels@r{, number of}
+@cindex quality
+Set the quality to @var{num}. That is, choose the number of antialiasing
+levels for bitmapped fonts (PK), to be
+@var{num}*@var{num}+1. The default value is 4 which gives 17 levels of
+antialiasing for antialiased fonts from these two. If FreeType is
+available, its rendering is unaffected by this option.
+
+@item -r*
+@cindex reverse pagination
+Toggle output of pages in reverse/forward order. By default, the first
+page in the DVI is output first.
+
+@ignore
+@item -R
+@cindex security
+@cindex shell command execution, disabling
+@cindex absolute filenames, disabling
+@cindex pipes, disabling output to
+Run securely. This disables shell command execution in @code{\special}
+(via @samp{`}, @pxref{Dynamic creation of graphics}) and config files
+(via the @samp{E} option, @pxref{Configuration file commands}), pipes as
+output files, and opening of any absolute filenames.
+
+@item -t @var{papertype}
+@cindex paper type
+@cindex media
+@cindex letter papertype
+@cindex legal papertype
+@cindex ledger papertype
+@cindex a4 papertype
+@cindex a3 papertype
+@cindex landscape papertype
+Set the paper type to @var{papertype}.
+@c usually defined in one of the
+@c configuration files, along with the appropriate PostScript code to
+@c select it (@pxref{Config file paper sizes}).
+You can also specify a @var{papertype} of @samp{landscape}, which
+rotates a document by 90 degrees. To rotate a document whose paper type
+is not the default, you can use the @samp{-t} option twice, once for the
+paper type, and once for @samp{landscape}.
+@end ignore
+
+@item --strict*
+@cindex exit on erroneous images
+The program exits when a warning occurs. Normally, dvipng will output
+an image in spite of a warning, but there may be something missing in
+this image. One reason to use this option would be if you have a more
+complete but slower fallback converter. See the @samp{--picky} option
+above for a list of when warnings occur.
+
+@item -T @var{image_size}
+Set the image size to @var{image_size} which can be either of
+@samp{bbox}, @samp{tight}, or a comma-separated pair of dimensions
+@var{hsize},@var{vsize} such as @samp{.1in,.3cm}. The default is
+@samp{bbox} which produces a PNG that includes all ink put on the page
+and in addition the DVI origin, located 1in from the top and 1in from
+the left edge of the paper. This usually gives whitespace above and to
+the left in the produced image. The value @samp{tight} will make dvipng
+only include all ink put on the page, producing neat images.
+@c (@pxref{papersize special}).
+@c This option overrides any papersize special in the DVI file.
+
+@item --truecolor*
+@cindex truecolor output
+This will make @samp{dvipng} generate truecolor output. Note that
+truecolor output is automatic if you include an external image in your
+DVI, e.g., via a PostScript special (i.e., the @samp{graphics} or
+@samp{graphicx} package). This switch is overridden by the
+@samp{--palette} switch.
+
+@item -v*
+Enable verbose operation. This will currently indicate what fonts is
+used, in addition to the usual output.
+
+@item --width*
+@cindex width reporting
+Report the width of the image. See also @samp{--height} and
+@samp{--depth}.
+
+@item -x @var{num}
+@cindex magnification, overriding DVI
+This option is deprecated; it should not be used. It is much better to
+select the output resolution directly with the @samp{-D} option. This
+option sets the magnification ratio to @math{@var{num}/1000} and
+overrides the magnification specified in the DVI file. Must be between
+10 and 100000. It is recommended that you use standard magstep values
+(1095, 1200, 1440, 1728, 2074, 2488, 2986, and so on) to help reduce the
+total number of PK files generated. @var{num} may be a real number, not
+an integer, for increased precision.
+
+@item -z @var{num}
+@cindex compression
+Set the PNG compression level to @var{num}. This option is enabled if
+your @samp{libgd} is new enough. The default compression level is 1,
+which selects maximum speed at the price of slightly larger PNGs. For an
+older @samp{libgd}, the hard-soldered value 5 is used. The include file
+@samp{png.h} says
+@ifclear man
+@quotation
+Currently, valid values range from 0 - 9, corresponding directly to the
+zlib compression levels 0 - 9 (0 - no compression, 9 - "maximal"
+compression). Note that tests have shown that zlib compression levels
+3-6 usually perform as well as level 9 for PNG images, and do
+considerably fewer calculations. In the future, these values may not
+correspond directly to the zlib compression levels.
+@end quotation
+@end ifclear
+@ifset man
+``Currently, valid values range from 0 - 9, corresponding directly to
+the zlib compression levels 0 - 9 (0 - no compression, 9 - "maximal"
+compression). Note that tests have shown that zlib compression levels
+3-6 usually perform as well as level 9 for PNG images, and do
+considerably fewer calculations. In the future, these values may not
+correspond directly to the zlib compression levels.''
+@end ifset
+@end table
+@c man end
+
+@node Graphics
+@chapter Graphics
+
+@samp{dvipng} attempts to handle graphics as included by the
+@samp{graphicx} and @samp{graphics} packages, without the need of
+specifying a driver to these packages. This means that it recognizes
+the encapsulated postscript inclusion meant for @samp{dvips}, but is
+also able (from version 1.8) to include bitmapped graphics. It also
+tries to handle some of the raw PostScript that is output from various
+packages. Some of the possibilities and problems are mentioned below.
+
+@menu
+* Encapsulated PostScript:: An internal call to GhostScript
+* Bitmapped graphics:: PNG, JPEG and GIF
+* Raw PostScript:: Ignore or give to GhostScript
+@end menu
+
+@node Encapsulated PostScript
+@section Encapsulated PostScript
+
+When an EPS file is included, a call to GhostScript is performed to
+produce a bitmapped image that can be included. The default is to
+produce an image with transparent background, at the same size as the
+DVI page currently being converted to PNG, and include that as
+foreground on the PNG. Of course, if the image is to be cropped, that
+is done. The included image will be a truecolor image, so for maximum
+performance the output PNG will be in truecolor mode as well.
+
+This conversion needs the @samp{pngalpha} output device to be present
+in your copy of GhostScript. If that device is not present, or you use
+the @samp{--palette} switch or request GIF output, the fallback is to
+use the @samp{png16m} device to produce a cropped opaque image for
+inclusion. Other relevant switches are @samp{--noghostscript} and
+@samp{--nogssafer}. @xref{Option details}.
+
+@cindex PostScript inclusion problems
+The most common problem with including graphics is an incorrect
+bounding box. Complain to whoever wrote the software that generated
+the file if the bounding box is indeed incorrect. An adjusted
+boundingbox can be specified in the @samp{\includegraphics} call, as
+in this example (using @samp{graphicx}):
+
+@example
+\includegraphics[bb=10 20 100 200]@{imagename.eps@}
+@end example
+
+
+@node Bitmapped graphics
+@section Bitmapped graphics
+
+dvipng can include PNG, JPEG and GIF graphics. When including such
+images via @samp{\includegraphics} you need to specify the bounding
+box since @TeX{} itself cannot read them from the files in question.
+The bounding box size should be given as @samp{0 0 w h} in pixels,
+e.g., if the file @samp{imagename.png} is 300x400 pixels, the
+inclusion would read
+
+@example
+\includegraphics[bb=0 0 300 400]@{imagename.png@}
+@end example
+
+The default size is the image size in bp (``big points'' in TeX
+nomenclature or PostScript points as other people have it, 72 per inch).
+That is, default resolution will be 72 dpi for included bitmaps, which
+is the default size in the few other bitmap-capable drivers that are
+known to me (dvipdfm and PDFLaTeX).
+
+If you want 100 dpi you need to specify the width accordingly. You
+just divide your image width by 100: a 135 pixel wide image at 100 dpi
+will take up 1.35 inches. If you want 200 dpi you divide by 200, and
+so on. Simple, eh? The example above at 200 dpi would be 1.5 inches
+wide:
+
+@example
+\includegraphics[bb=0 0 300 400,witdh=1.5in]@{imagename.png@}
+@end example
+
+@node Raw PostScript
+@section Raw PostScript
+
+dvipng attempts to handle raw PostScript. Rendering raw PostScript
+specials is done on top of the page by including a transparent image
+generated by the @samp{pngalpha} device in GhostScript (automatically
+selecting @samp{truecolor} mode in dvipng).
+
+Included PostScript headers are respected, and if the header
+@samp{tex.pro} is included, dvipng also throws in @samp{color.pro} and
+@samp{special.pro}. The package @samp{xcolor} includes its own headers
+with color names, and this is not only kept as a PostScript header, but
+is also read and interpreted by dvipng itself. An attempt is also made
+to respect the PGF header. The non-rendering specials from
+@samp{hyperref} are handled via some heuristics and do not give an
+error.
+
+Really rendering and moving things with raw PostScript specials is more
+troublesome. The \rotatebox macro serves as a good example. The dvips
+driver of the graphicx package surrounds DVI glyphs with PostScript code
+so that after conversion by dvips, the glyphs (now themselves in
+PostScript) will be rotated in the desired way. dvipng does not handle
+this, at present. An attempt has been made to handle the rendering
+specials output by PGF (tikz), and also PSTricks. Some things work, but
+others do not. This is especially clear when mixing PostScript and DVI
+rendering commands such as glyphs. dvipng cannot at present detect if
+PostScript code moves @samp{currentpoint} or rotates the frame since
+GhostScript does not return such information. A recommendation would be
+to produce images from these packages as EPS files and include them into
+your document in the standard manner.
+
+Another way to handle this would be to use a slower fallback (with dvips
+and gs, for example). If you want to disable raw PostScript handling in
+dvipng, use the switch @samp{--norawps}. This switch turns off the
+internal call to GhostScript intended to display these raw PostScript
+specials. Further, when dvipng encounters raw PostScript and the gs call
+is turned off, it gives a warning. It is now possible to use the switch
+@samp{--picky} to disable page rendering of pages with warnings, and use
+the slower fallback for these pages.
+
+@node Color
+@chapter Color
+
+To support color, dvipng recognizes a certain set of specials as
+generated by the @samp{color} and @samp{xcolor} style files. These
+specials start with the keyword @samp{color} or the keyword
+@samp{background}, followed by a color specification.
+
+@menu
+* Color specifications::
+* Color specials::
+@end menu
+
+
+@node Color specifications
+@section Color specifications
+
+@cindex color specifications
+
+The color specification supported by dvipng is by-value or by-name. The
+by-value spec starts with the name of a color model (one of @samp{rgb},
+@samp{hsb}, @samp{cmy}, @samp{cmyk}, or @samp{gray}) followed by the
+appropriate number of parameters. Thus, the color specification
+@samp{rgb 0.3 0.4 0.5} would correspond to the color that is @samp{0.3
+0.4 0.5} in its red, blue and green values. The color model used
+internally in dvipng is @samp{RGB} (discretized to 256 levels), for
+details on the formulas used in conversion, see the @samp{xcolor}
+documentation.
+
+By-name color specifications are single (case-dependent) words and are
+compared with color names defined in @samp{dvipsnam.def} (from the
+@samp{graphics} bundle), @samp{svgnam.def} and @samp{xcolor.sty} (from
+the @samp{xcolor} bundle). See the @samp{xcolor} documentation for a
+list of names and the corresponding colors.
+
+On the command-line, the name @samp{Transparent} can also be used as
+an argument to @samp{--bg} to choose transparent background.
+@xref{Option details}.
+
+@node Color specials
+@section Color specials
+
+We will describe @samp{background} first, since it is the simplest. The
+@samp{background} keyword must be followed by a color specification.
+That color specification is used as a fill color for the background. The
+last @samp{background} special on a page is the one that gets used, and
+is used for the whole of the page image. (This is possible because the
+prescan phase of dvipng notices all of the color specials so that the
+appropriate information can be written out during the second phase.)
+
+The @samp{color} special itself has three forms. The first is just
+@samp{color} followed by a color specification. In this case, the
+current global color is set to that color; the color stack must be empty
+when such a command is executed.
+
+The second form is @samp{color push} followed by a color specification.
+This saves the current color on the color stack and sets the color to be
+that given by the color specification. This is the most common way to
+set a color.
+
+The final form of the @samp{color} special is just @samp{color pop},
+with no color specification; this says to pop the color last pushed on
+the color stack from the color stack and set the current color to be
+that color.
+
+dvipng correctly handles these color specials across pages, even when
+the pages are rendered repeatedly or in reverse order.
+
+@node Diagnosing problems
+@chapter Diagnosing problems
+
+@cindex problems
+@cindex trouble
+@cindex debugging
+
+You've gone through all the trouble of installing dvipng, carefully read
+all the instructions in this manual, and still can't get something to
+work. The following sections provide some helpful hints if you find
+yourself in such a situation.
+
+@menu
+* Contact information:: Who to ask.
+* Debug options:: Getting diagnostics.
+@end menu
+
+@node Contact information
+@section Contact information
+
+Bug reports should be sent to
+@email{dvipng@@nongnu.org}.
+
+Questions, suggestions for new features, pleas for help, and/or praise
+should go to @email{dvipng@@nongnu.org}. For more information on this
+mailing list, send a message with just the word `help' as subject or
+body to @email{dvipng-request@@nongnu.org} or look at
+@url{http://lists.nongnu.org/mailman/listinfo/dvipng}.
+
+Offers to support further development will be appreciated. For developer
+access, ask on @email{dvipng@@nongnu.org}.
+
+For details on the @TeX{} path-searching library, and @code{mktexpk}
+problems, @pxref{Common problems,,, kpathsea, Kpathsea}.
+
+
+@node Debug options
+@section Debug options
+
+The @samp{-d} flag to dvipng helps in tracking down certain errors. The
+parameter to this flag is an integer that tells what errors are
+currently being tracked. To track a certain class of debug messages,
+simply provide the appropriate number given below; if you wish to track
+multiple classes, sum the numbers of the classes you wish to track. To
+track all classes, you can use @code{-1}.
+
+Some of these debugging options are actually provided by Kpathsea
+(@pxref{Debugging, , , kpathsea, Kpathsea}).
+
+The classes are:
+@table @asis
+@item 1
+Normal dvi op-codes
+@item 2
+Virtual fonts
+@item 4
+PK fonts
+@item 8
+TFM files
+@item 16
+Glyph rendering
+@item 32
+FreeType calls
+@item 64
+Encoding loads
+@item 128
+Color specials
+@item 256
+GhostScript specials
+@item 512
+Kpathsea @code{stat} calls
+@item 1024
+Kpathsea hash table lookups
+@item 2048
+Kpathsea path element expansion
+@item 4096
+Kpathsea path searches
+@ignore
+@item 8192
+@item 16384
+@end ignore
+
+@end table
+
+@node Credits
+@chapter Credits
+
+A number of persons have contributed, if I forget to mention someone,
+I apologize. First and foremost we have David Kastrup whose
+@previewlatex{} project provided the incentive to write this program.
+There is also a number of people who have contributed by reporting
+bugs and suggesting improvements as the thing has evolved. These
+include but is perhaps not limited to (in semi-random order): Thomas
+Esser (te@TeX{}), Christian Schenk (MIK@TeX{}), Brian R Furry (debian
+package), Angus Leeming (LyX), Thomas Boutell (libgd), John Jones
+(first user report), Uwe Kern (xcolor), Karl Berry and Peter
+Breitenlohner (@TeX{} Live), David Harvey (hinting in Freetype), Neal
+Harmon, Alan Shutko, Reiner Stieb, Nick Alcock, Adam Buchbinder, Svend
+Tollak Munkejord, James Longstreet, Bernhard Simon, Bob McElrath,
+Georg Schwarz, Jason Farmer, Brian V. Smith, Samuel Hathaway, Thomas
+R. Shemanske, Stephen Gibson, Christian Ridderstr@"om, Ezra Peisach,
+William H Wheeler, Thomas Klausner, Harald Koenig, Adrian Bunk, Kevin
+Smith, Jason Riedy, Wolfram Krause, Reinhard Kotucha, Takeshi Abe,
+Waldeck Schutzer, Ahzo, and Andy Nguyen.
+
+@ifset man
+@c man begin NOTES
+The full manual is accessible in info format, on most systems by typing
+@example
+info dvipng
+@end example
+@c man end
+@c man begin COPYRIGHT
+This program is released under the GNU Lesser General Public License
+version 3, see the COPYING file in the dvipng distribution or
+@url{http://www.gnu.org/licenses/gpl.html}.
+
+Copyright @copyright{} 2002-2015, 2019 Jan-@AA{}ke Larsson
+@c man end
+@end ifset
+
+@node Copying
+@chapter Copying
+
+This program is free software: you can redistribute it and/or modify
+it under the terms of the GNU Lesser General Public License as
+published by the Free Software Foundation, either version 3 of the
+License, or (at your option) any later version.
+
+This program is distributed in the hope that it will be useful, but
+WITHOUT ANY WARRANTY; without even the implied warranty of
+MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU
+Lesser General Public License for more details.
+
+You should have received a copy of the GNU Lesser General Public
+License along with this program. If not, see
+<http://www.gnu.org/licenses/>.
+
+@sp 2
+@noindent
+Copyright @copyright{} 2002-2015, 2019 Jan-@AA{}ke Larsson
+
+@node Index
+@unnumbered Index
+
+@printindex cp
+@bye
diff --git a/Build/source/texk/dvipng/dvipng-src/enc.c b/Build/source/texk/dvipng/dvipng-src/enc.c
new file mode 100644
index 00000000000..03224769c78
--- /dev/null
+++ b/Build/source/texk/dvipng/dvipng-src/enc.c
@@ -0,0 +1,129 @@
+/* enc.c */
+
+/************************************************************************
+
+ Part of the dvipng distribution
+
+ This program is free software: you can redistribute it and/or modify
+ it under the terms of the GNU Lesser General Public License as
+ published by the Free Software Foundation, either version 3 of the
+ License, or (at your option) any later version.
+
+ This program is distributed in the hope that it will be useful, but
+ WITHOUT ANY WARRANTY; without even the implied warranty of
+ MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU
+ Lesser General Public License for more details.
+
+ You should have received a copy of the GNU Lesser General Public
+ License along with this program. If not, see
+ <http://www.gnu.org/licenses/>.
+
+ Copyright (C) 2002-2008 Jan-Åke Larsson
+
+************************************************************************/
+
+#include "dvipng.h"
+
+struct encoding* encodingp=NULL;
+
+static struct encoding* InitEncoding(char* encoding)
+{
+ char *pos,*max,*buf,*enc_file;
+ int i;
+ struct encoding* encp=NULL;
+ struct filemmap fmmap;
+ boolean mmapfailed;
+
+#ifdef HAVE_KPSE_ENC_FORMATS
+ enc_file=kpse_find_file(encoding,kpse_enc_format,false);
+#else
+ enc_file=kpse_find_file(encoding,kpse_tex_ps_header_format,false);
+#endif
+ if (enc_file == NULL) {
+ Warning("encoding file %s could not be found",encoding);
+ return(NULL);
+ }
+ DEBUG_PRINT((DEBUG_FT|DEBUG_ENC),("\n OPEN ENCODING:\t'%s'", enc_file));
+ mmapfailed = MmapFile(enc_file,&fmmap);
+ free(enc_file);
+ if (mmapfailed)
+ return(NULL);
+ if ((encp = calloc(sizeof(struct encoding)+strlen(encoding)+1
+ +fmmap.size,1))==NULL) {
+ Warning("cannot alloc space for encoding",encoding);
+ UnMmapFile(&fmmap);
+ return(NULL);
+ }
+ encp->name=(char*)encp+sizeof(struct encoding);
+ strcpy(encp->name,encoding);
+ pos=fmmap.data;
+ max=fmmap.data+fmmap.size;
+ buf=encp->name+strlen(encoding)+1;
+#define SKIPCOMMENT(x) if (*x=='%') while (x<max && *x!='\r' && *x!='\n') x++;
+ while(pos<max && *pos!='/') {
+ SKIPCOMMENT(pos);
+ pos++;
+ }
+ pos++;
+ encp->charname[256]=buf;
+ while(pos<max && *pos!='[' && *pos!='%'
+ && *pos!=' ' && *pos!='\t' && *pos!='\r' && *pos!='\n')
+ *buf++=*pos++;
+ *buf++='\0';
+ DEBUG_PRINT(DEBUG_ENC,("\n PS ENCODING '%s'",
+ encp->charname[256]));
+ while (pos < max && *pos!='[') {
+ SKIPCOMMENT(pos);
+ pos++;
+ }
+ while(pos<max && *pos!='/') {
+ SKIPCOMMENT(pos);
+ pos++;
+ }
+ i=0;
+ while(pos<max && *pos!=']') {
+ pos++;
+ encp->charname[i++]=buf;
+ while(pos<max && *pos!='%' && *pos!=' ' \
+ && *pos!='\t' && *pos!='\r' && *pos!='\n')
+ *buf++=*pos++;
+ *buf++='\0';
+ DEBUG_PRINT(DEBUG_ENC,("\n PS ENCODING %d '%s'",
+ i-1,encp->charname[i-1]));
+ while(pos<max && *pos!='/' && *pos!=']') {
+ SKIPCOMMENT(pos);
+ pos++;
+ }
+ }
+ UnMmapFile(&fmmap);
+ return(encp);
+}
+
+
+struct encoding* FindEncoding(char* encoding)
+{
+ struct encoding *temp=encodingp;
+
+ /* printf("{%s} \n",encoding); */
+ while(temp!=NULL && strcmp(encoding,temp->name)!=0)
+ temp=temp->next;
+ if (temp==NULL) {
+ temp=InitEncoding(encoding);
+ if (temp!=NULL) {
+ temp->next=encodingp;
+ encodingp=temp;
+ }
+ }
+ return(temp);
+}
+
+void ClearEncoding(void)
+{
+ struct encoding *temp=encodingp;
+
+ while(temp!=NULL) {
+ encodingp=encodingp->next;
+ free(temp);
+ temp=encodingp;
+ }
+}
diff --git a/Build/source/texk/dvipng/dvipng-src/font.c b/Build/source/texk/dvipng/dvipng-src/font.c
new file mode 100644
index 00000000000..d8a374e473a
--- /dev/null
+++ b/Build/source/texk/dvipng/dvipng-src/font.c
@@ -0,0 +1,335 @@
+/* font.c */
+
+/************************************************************************
+
+ Part of the dvipng distribution
+
+ This program is free software: you can redistribute it and/or modify
+ it under the terms of the GNU Lesser General Public License as
+ published by the Free Software Foundation, either version 3 of the
+ License, or (at your option) any later version.
+
+ This program is distributed in the hope that it will be useful, but
+ WITHOUT ANY WARRANTY; without even the implied warranty of
+ MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU
+ Lesser General Public License for more details.
+
+ You should have received a copy of the GNU Lesser General Public
+ License along with this program. If not, see
+ <http://www.gnu.org/licenses/>.
+
+ Copyright (C) 2002-2015 Jan-Åke Larsson
+
+************************************************************************/
+
+#include "dvipng.h"
+
+void CheckChecksum(uint32_t c1, uint32_t c2, const char* name)
+{
+ /* Report a warning if both checksums are nonzero, they don't match,
+ and the user hasn't turned it off. */
+ if (c1 && c2 && c1 != c2
+#ifdef HAVE_LIBKPATHSEA
+ && !kpse_tex_hush ("checksum")
+#endif
+ ) {
+ Warning ("checksum mismatch in %s", name) ;
+ }
+}
+
+
+static double ActualFactor(uint32_t unmodsize)
+/* compute the actual size factor given the approximation */
+/* actually factor * 1000 */
+{
+ double realsize; /* the actual magnification factor */
+ realsize = (double)unmodsize / 1000.0;
+ if (abs((int)(unmodsize - 1095l))<2)
+ realsize = 1.095445115; /*stephalf*/
+ else if (abs((int)(unmodsize - 1315l))<2)
+ realsize = 1.31453414; /*stepihalf*/
+ else if (abs((int)(unmodsize - 1577l))<2)
+ realsize = 1.57744097; /*stepiihalf*/
+ else if (abs((int)(unmodsize - 1893l))<2)
+ realsize = 1.89292916; /*stepiiihalf*/
+ else if (abs((int)(unmodsize - 2074l))<2)
+ realsize = 2.0736; /*stepiv*/
+ else if (abs((int)(unmodsize - 2488l))<2)
+ realsize = 2.48832; /*stepv*/
+ else if (abs((int)(unmodsize - 2986l))<2)
+ realsize = 2.985984; /*stepvi*/
+ /* the remaining magnification steps are represented with sufficient
+ accuracy already */
+ return(realsize);
+}
+
+
+void FontDef(unsigned char* command, void* parent)
+{
+ int32_t k;
+ uint32_t c, s, d;
+ uint8_t a, l;
+ unsigned char* current;
+ struct font_entry *tfontptr; /* temporary font_entry pointer */
+ struct font_num *tfontnump = NULL; /* temporary font_num pointer */
+ unsigned short i;
+
+ current = command + 1;
+ k = UNumRead(current, (int)*command - FNT_DEF1 + 1);
+ current += (int)*command - FNT_DEF1 + 1;
+ c = UNumRead(current, 4); /* checksum */
+ s = UNumRead(current+4, 4); /* space size */
+ d = UNumRead(current+8, 4); /* design size */
+ a = UNumRead(current+12, 1); /* length for font name */
+ l = UNumRead(current+13, 1); /* device length */
+ if (((struct font_entry*)parent)->type==FONT_TYPE_VF) {
+ DEBUG_PRINT(DEBUG_VF,(" %d %d %d",k,c,s));
+ /* Rescale. s is relative to the actual scale /(1<<20) */
+ s = (uint32_t)((uint64_t) s * (((struct font_entry*) parent)->s)
+ / (1<<20));
+ DEBUG_PRINT(DEBUG_VF,(" (%d) %d",s,d));
+ /* Oddly, d differs in the DVI and the VF that my system produces */
+ d = (uint32_t)((uint64_t) d * ((struct font_entry*)parent)->d
+ / ((struct font_entry*)parent)->designsize);
+ DEBUG_PRINT(DEBUG_VF,(" (%d)",d));
+ DEBUG_PRINT(DEBUG_VF,(" %d %d '%.*s'",a,l,a+l,current+14));
+#ifdef DEBUG
+ } else {
+ DEBUG_PRINT(DEBUG_DVI,(" %d %d %d %d %d %d '%.*s'",k,c,s,d,a,l,
+ a+l,current+14));
+#endif
+ }
+ if (a+l > STRSIZE-1)
+ Fatal("too long font name for font %ld",k);
+
+ /* Find entry with this font number in use */
+ switch (((struct font_entry*)parent)->type) {
+ case FONT_TYPE_VF:
+ tfontnump = ((struct font_entry*)parent)->vffontnump;
+ break;
+ case DVI_TYPE:
+ tfontnump = ((struct dvi_data*)parent)->fontnump;
+ }
+ while (tfontnump != NULL && tfontnump->k != k) {
+ tfontnump = tfontnump->next;
+ }
+ /* If found, return if it is correct */
+ if (tfontnump!=NULL
+ && tfontnump->fontp->s == s
+ && tfontnump->fontp->d == d
+ && strlen(tfontnump->fontp->n) == a+l
+ && strncmp(tfontnump->fontp->n,(char*)current+14,a+l) == 0) {
+ DEBUG_PRINT((DEBUG_DVI|DEBUG_VF),("\n FONT %d:\tMatch found",k));
+ return;
+ }
+ /* If not found, create new */
+ if (tfontnump==NULL) {
+ if ((tfontnump=malloc(sizeof(struct font_num)))==NULL)
+ Fatal("cannot malloc memory for new font number");
+ tfontnump->k=k;
+ switch (((struct font_entry*)parent)->type) {
+ case FONT_TYPE_VF:
+ tfontnump->next=((struct font_entry*)parent)->vffontnump;
+ ((struct font_entry*)parent)->vffontnump=tfontnump;
+ break;
+ case DVI_TYPE:
+ tfontnump->next=((struct dvi_data*)parent)->fontnump;
+ ((struct dvi_data*)parent)->fontnump=tfontnump;
+ }
+ }
+
+ /* Search font list for possible match */
+ tfontptr = hfontptr;
+ while (tfontptr != NULL
+ && (tfontptr->s != s
+ || tfontptr->d != d
+ || strlen(tfontptr->n) != a+l
+ || strncmp(tfontptr->n,(char*)current+14,a+l) != 0 ) ) {
+ tfontptr = tfontptr->next;
+ }
+ /* If found, set its number and return */
+ if (tfontptr!=NULL) {
+ DEBUG_PRINT((DEBUG_DVI|DEBUG_VF),("\n FONT %d:\tMatch found, number set",k));
+ tfontnump->fontp = tfontptr;
+ return;
+ }
+
+ DEBUG_PRINT((DEBUG_DVI|DEBUG_VF),("\n FONT %d:\tNew entry created",k));
+ /* No fitting font found, create new entry. */
+ if ((tfontptr = calloc(1,sizeof(struct font_entry))) == NULL)
+ Fatal("cannot malloc space for font_entry");
+ tfontptr->next = hfontptr;
+ hfontptr = tfontptr;
+ tfontnump->fontp = tfontptr;
+#ifndef WIN32
+ tfontptr->fmmap.fd = 0;
+#else /* WIN32 */
+ tfontptr->fmmap.hFile = INVALID_HANDLE_VALUE;
+#endif
+ tfontptr->c = c; /* checksum */
+ tfontptr->s = s; /* space size */
+ tfontptr->d = d; /* design size */
+ tfontptr->a = a; /* length for font name */
+ tfontptr->l = l; /* device length */
+ strncpy(tfontptr->n,(char*)current+14,a+l); /* full font name */
+ tfontptr->n[a+l] = '\0';
+
+ tfontptr->name = NULL;
+ for (i = FIRSTFNTCHAR; i <= LASTFNTCHAR; i++) {
+ tfontptr->chr[i] = NULL;
+ }
+
+ tfontptr->dpi =
+ (uint32_t)((ActualFactor((uint32_t)(1000.0*tfontptr->s
+ /(double)tfontptr->d+0.5))
+ * ActualFactor(dvi->mag) * dpi*shrinkfactor) + 0.5);
+#ifdef HAVE_FT2
+ tfontptr->psfontmap=NULL;
+#endif
+}
+
+#ifdef HAVE_FT2
+static char* kpse_find_t1_or_tt(char* filename)
+{
+ char* filepath = kpse_find_file(filename, kpse_type1_format, false);
+ if ((option_flags & USE_FREETYPE) && filepath==NULL)
+ filepath = kpse_find_file(filename, kpse_truetype_format, false);
+ return(filepath);
+}
+#endif
+
+static void FontFind(struct font_entry * tfontptr)
+{
+ kpse_glyph_file_type font_ret;
+
+ /* tfontptr->dpi = kpse_magstep_fix (tfontptr->dpi, resolution, NULL); */
+ DEBUG_PRINT(DEBUG_DVI,("\n FIND FONT:\t%s %d",tfontptr->n,tfontptr->dpi));
+
+ tfontptr->name = kpse_find_vf (tfontptr->n);
+ if (tfontptr->name!=NULL)
+ InitVF(tfontptr);
+#ifdef HAVE_FT2
+ else if (option_flags & USE_FREETYPE) {
+ tfontptr->psfontmap = FindPSFontMap(tfontptr->n);
+ if (tfontptr->psfontmap!=NULL)
+ tfontptr->name=kpse_find_t1_or_tt(tfontptr->psfontmap->psfile);
+ else
+ tfontptr->name=kpse_find_t1_or_tt(tfontptr->n);
+ if (tfontptr->name!=NULL) {
+ char* tfmname=kpse_find_file(tfontptr->n, kpse_tfm_format, false);
+ if (tfmname!=NULL) {
+ if (!ReadTFM(tfontptr,tfmname)) {
+ Warning("unable to read tfm file %s", tfmname);
+ free(tfontptr->name);
+ tfontptr->name=NULL;
+ } else if ((option_flags & USE_FREETYPE)==0 || !InitFT(tfontptr)) {
+ /* if Freetype loading fails for some reason, fall back to PK font */
+ free(tfontptr->name);
+ tfontptr->name=NULL;
+ }
+ free(tfmname);
+ }
+ }
+ }
+#endif /* HAVE_FT2 */
+ if (tfontptr->name==NULL) {
+ tfontptr->name=kpse_find_pk (tfontptr->n, tfontptr->dpi, &font_ret);
+ if (tfontptr->name!=NULL) {
+ if (!FILESTRCASEEQ (tfontptr->n, font_ret.name)) {
+ page_flags |= PAGE_GAVE_WARN;
+ Warning("font %s not found, using %s at %d dpi instead",
+ tfontptr->n, font_ret.name, font_ret.dpi);
+ tfontptr->c = 0; /* no checksum warning */
+ } else if (!kpse_bitmap_tolerance ((double)font_ret.dpi,
+ (double) tfontptr->dpi)) {
+ page_flags |= PAGE_GAVE_WARN;
+ Warning("font %s at %d dpi not found, using %d dpi instead",
+ tfontptr->n, tfontptr->dpi, font_ret.dpi);
+ }
+ InitPK(tfontptr);
+ } else {
+ page_flags |= PAGE_GAVE_WARN;
+ Warning("font %s at %d dpi not found, characters will be left blank",
+ tfontptr->n, tfontptr->dpi);
+#ifndef WIN32
+ tfontptr->fmmap.fd = 0;
+#else /* WIN32 */
+ tfontptr->fmmap.hFile = INVALID_HANDLE_VALUE;
+#endif
+ tfontptr->magnification = 0;
+ tfontptr->designsize = 0;
+ }
+ }
+}
+
+
+static void DoneFont(struct font_entry *tfontp)
+{
+ switch (tfontp->type) {
+ case FONT_TYPE_PK:
+ DonePK(tfontp);
+ break;
+ case FONT_TYPE_VF:
+ DoneVF(tfontp);
+ break;
+#ifdef HAVE_FT2
+ case FONT_TYPE_FT:
+ DoneFT(tfontp);
+ break;
+#endif
+ }
+}
+
+
+void FreeFontNumP(struct font_num *hfontnump)
+{
+ struct font_num *tmp;
+ while(hfontnump!=NULL) {
+ tmp=hfontnump->next;
+ free(hfontnump);
+ hfontnump=tmp;
+ }
+}
+
+void ClearFonts(void)
+{
+ struct font_entry *tmp;
+
+ while(hfontptr!=NULL) {
+ tmp=hfontptr->next;
+ DoneFont(hfontptr);
+ if (hfontptr->name != NULL)
+ free(hfontptr->name);
+ free(hfontptr);
+ hfontptr=tmp;
+ }
+ if (dvi!=NULL)
+ FreeFontNumP(dvi->fontnump);
+}
+
+/*-->SetFntNum*/
+/**********************************************************************/
+/**************************** SetFntNum *****************************/
+/**********************************************************************/
+void SetFntNum(int32_t k, void* parent /* dvi/vf */)
+/* this routine is used to specify the font to be used in printing future
+ characters */
+{
+ struct font_num *tfontnump=NULL; /* temporary font_num pointer */
+
+ switch (((struct font_entry*)parent)->type) {
+ case FONT_TYPE_VF:
+ tfontnump = ((struct font_entry*)parent)->vffontnump;
+ break;
+ case DVI_TYPE:
+ tfontnump = ((struct dvi_data*)parent)->fontnump;
+ }
+ while (tfontnump != NULL && tfontnump->k != k)
+ tfontnump = tfontnump->next;
+ if (tfontnump == NULL)
+ Fatal("font %d undefined", k);
+
+ currentfont = tfontnump->fontp;
+ if (currentfont->name==NULL)
+ FontFind(currentfont);
+}
diff --git a/Build/source/texk/dvipng/dvipng-src/fontmap.c b/Build/source/texk/dvipng/dvipng-src/fontmap.c
new file mode 100644
index 00000000000..f362a57defa
--- /dev/null
+++ b/Build/source/texk/dvipng/dvipng-src/fontmap.c
@@ -0,0 +1,327 @@
+/* fontmap.c */
+
+/************************************************************************
+
+ Part of the dvipng distribution
+
+ This program is free software: you can redistribute it and/or modify
+ it under the terms of the GNU Lesser General Public License as
+ published by the Free Software Foundation, either version 3 of the
+ License, or (at your option) any later version.
+
+ This program is distributed in the hope that it will be useful, but
+ WITHOUT ANY WARRANTY; without even the implied warranty of
+ MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU
+ Lesser General Public License for more details.
+
+ You should have received a copy of the GNU Lesser General Public
+ License along with this program. If not, see
+ <http://www.gnu.org/licenses/>.
+
+ Copyright (C) 2002-2015 Jan-Åke Larsson
+
+************************************************************************/
+
+#include "dvipng.h"
+
+static struct filemmap psfont_mmap;
+#ifdef HAVE_FT2
+static struct filemmap ttfont_mmap;
+#endif
+static struct psfontmap *psfontmap=NULL;
+
+static char* newword(char** buffer, char* end)
+{
+ char *word,*pos=*buffer;
+
+ while(pos<end && *pos!=' ' && *pos!='\t' && *pos!='"') pos++;
+ if ((word=malloc(pos-*buffer+1))==NULL)
+ Fatal("cannot malloc space for string");
+ strncpy(word,*buffer,pos-*buffer);
+ word[pos-*buffer]='\0';
+ *buffer=pos;
+ return(word);
+}
+
+char* copyword(char* orig)
+{
+ char *word;
+
+ if (orig==NULL)
+ return(NULL);
+ if ((word=malloc(strlen(orig)+1))==NULL)
+ Fatal("cannot malloc space for string");
+ strcpy(word,orig);
+ return(word);
+}
+
+static char* find_format(const char* name)
+{
+ /* Cater for both new (first case) and old (second case) kpathsea */
+ char* format =
+ kpse_find_file(name,kpse_fontmap_format,false);
+
+ if (format==NULL)
+ format = kpse_find_file(name,kpse_dvips_config_format,false);
+ return(format);
+}
+
+void InitPSFontMap(void)
+{
+ char* psfont_name=NULL;
+ /* Prefer ps2pk.map, fonts are present more often */
+ psfont_name=find_format("ps2pk.map");
+ if (psfont_name==NULL)
+ psfont_name=find_format("psfonts.map");
+ if (psfont_name==NULL) {
+ Warning("cannot find ps2pk.map, nor psfonts.map");
+ } else {
+ DEBUG_PRINT(DEBUG_FT,
+ ("\n OPEN PSFONT MAP:\t'%s'", psfont_name));
+ if (MmapFile(psfont_name,&psfont_mmap)) {
+ Warning("psfonts map %s could not be opened", psfont_name);
+ }
+ free(psfont_name);
+ }
+#ifdef HAVE_FT2
+ psfont_name=find_format("ttfonts.map");
+ if (psfont_name!=NULL) {
+ DEBUG_PRINT(DEBUG_FT,("\n OPEN TTFONT MAP:\t'%s'", psfont_name));
+ if (MmapFile(psfont_name,&ttfont_mmap)) {
+ Warning("ttfonts map %s could not be opened", psfont_name);
+ }
+ free(psfont_name);
+ }
+#endif
+}
+
+struct psfontmap *NewPSFont(struct psfontmap* copyfrom)
+{
+ struct psfontmap *newentry=NULL;
+ if ((newentry=malloc(sizeof(struct psfontmap)))==NULL)
+ Fatal("cannot malloc psfontmap space");
+ if (copyfrom!=NULL) {
+ newentry->line = copyfrom->line;
+ newentry->tfmname = copyword(copyfrom->tfmname);
+ newentry->psfile = copyword(copyfrom->psfile);
+ newentry->encname = copyword(copyfrom->encname);
+ newentry->encoding = copyfrom->encoding;
+#ifdef HAVE_FT2
+ newentry->ft_transformp = copyfrom->ft_transformp;
+ newentry->subfont = copyfrom->subfont;
+#endif
+ newentry->end = copyfrom->end;
+ } else {
+ newentry->line = NULL;
+ newentry->tfmname = NULL;
+ newentry->psfile = NULL;
+ newentry->encname = NULL;
+ newentry->encoding = NULL;
+#ifdef HAVE_FT2
+ newentry->ft_transformp = NULL;
+ newentry->subfont = NULL;
+#endif
+ newentry->end = NULL;
+ }
+ newentry->next=psfontmap;
+ psfontmap=newentry;
+ return(newentry);
+}
+
+static struct psfontmap *SearchPSFontMap(char* fontname,
+ struct filemmap* search_mmap)
+{
+ static char *pos=NULL,*end=NULL;
+ static struct filemmap* searching_mmap=NULL;
+ struct psfontmap *entry=NULL;
+
+ if (pos==end && search_mmap!=searching_mmap) {
+ searching_mmap=search_mmap;
+ pos=searching_mmap->data;
+ end=searching_mmap->data+searching_mmap->size;
+ }
+ while(pos<end && (entry==NULL || strcmp(entry->tfmname,fontname)!=0)) {
+ while(pos < end
+ && (*pos=='\r' || *pos=='\n' || *pos==' ' || *pos=='\t'
+ || *pos=='%' || *pos=='*' || *pos==';' || *pos=='#')) {
+ while(pos < end && *pos!='\r' && *pos!='\n') pos++; /* skip comments/empty rows */
+ pos++;
+ }
+ if (pos < end) {
+ entry=NewPSFont(NULL);
+ entry->line = pos;
+ /* skip <something and quoted entries */
+ while(pos < end && (*pos=='<' || *pos=='"')) {
+ if (*pos=='<')
+ while(pos < end && *pos!=' ' && *pos!='\t') pos++;
+ else
+ while(pos < end && *pos!='"') pos++;
+ while(pos < end && (*pos==' ' || *pos=='\t')) pos++;
+ }
+ /* first word is font name */
+ entry->tfmname = newword(&pos,end);
+ while(pos < end && *pos!='\r' && *pos!='\n') pos++;
+ entry->end = pos;
+ }
+ pos++;
+ }
+ if (entry!=NULL && strcmp(entry->tfmname,fontname)!=0)
+ entry=NULL;
+ return(entry);
+}
+
+void ClearPSFontMap(void)
+{
+ struct psfontmap *entry;
+
+ while(psfontmap!=NULL) {
+ entry=psfontmap;
+ psfontmap=psfontmap->next;
+ free(entry->tfmname);
+ if (entry->psfile!=NULL)
+ free(entry->psfile);
+ if (entry->encname!=NULL)
+ free(entry->encname);
+ free(entry);
+ }
+ UnMmapFile(&psfont_mmap);
+#ifdef HAVE_FT2
+ UnMmapFile(&ttfont_mmap);
+#endif
+}
+
+static void ReadPSFontMap(struct psfontmap *entry)
+{
+ char *pos,*end,*psname;
+ int nameno = 0;
+
+ DEBUG_PRINT(DEBUG_FT,("\n PSFONTMAP: %s ",entry->tfmname));
+ pos=entry->line;
+ end=entry->end;
+ while(pos < end) {
+ if (*pos=='<') { /* filename follows */
+ pos++;
+ if (pos<end && *pos=='<') { /* <<download.font */
+ pos++;
+ entry->psfile = newword((char**)&pos,end);
+ DEBUG_PRINT(DEBUG_FT,("<%s ",entry->psfile));
+ } else if (pos<end && *pos=='[') { /* <[encoding.file */
+ pos++;
+ entry->encname = newword((char**)&pos,end);
+ DEBUG_PRINT(DEBUG_FT,("<[%s ",entry->encname));
+ } else { /* <some.file */
+ char* word =newword((char**)&pos,end);
+ if (strncmp(word+strlen(word)-4,".enc",4)==0) {/* <some.enc */
+ entry->encname=word;
+ DEBUG_PRINT(DEBUG_FT,("<[%s ",entry->encname));
+ } else { /* <font */
+ entry->psfile=word;
+ DEBUG_PRINT(DEBUG_FT,("<%s ",entry->psfile));
+ }
+ }
+ } else if (*pos=='"') { /* PS code: reencoding/tranformation exists */
+ char *word;
+ double cxx=1.0,cxy=0.0;
+ pos++;
+ DEBUG_PRINT(DEBUG_FT,("\""));
+ while(pos < end && *pos!='"') {
+ word=newword((char**)&pos,end);
+ while(pos < end && (*pos==' ' || *pos=='\t')) pos++;
+ if (pos+10<end && strncmp(pos,"ExtendFont",10)==0) {
+ cxx=strtod(word,NULL);
+ pos+=10;
+ DEBUG_PRINT(DEBUG_FT,("%f ExtendFont ",cxx));
+ } else if (pos+9<end && strncmp(pos,"SlantFont",9)==0) {
+ pos+=9;
+ cxy=strtod(word,NULL);
+ DEBUG_PRINT(DEBUG_FT,("%f SlantFont ",cxy));
+ } else if (pos+12<end && strncmp(pos,"ReEncodeFont",12)==0) {
+ pos+=12;
+ DEBUG_PRINT(DEBUG_FT,("%s ReEncodeFont ",word));
+ } else {
+ DEBUG_PRINT(DEBUG_FT,("(?:%s) ",word));
+ }
+ free(word);
+ }
+#ifdef HAVE_FT2
+ entry->ft_transformp=&(entry->ft_transform);
+ entry->ft_transform.xx=(FT_Fixed)(cxx*0x10000);
+ entry->ft_transform.xy=(FT_Fixed)(cxy*0x10000);
+ entry->ft_transform.yx=0;
+ entry->ft_transform.yy=0x10000;
+#endif
+ DEBUG_PRINT(DEBUG_FT,("\" "));
+ pos++;
+ } else { /* bare word */
+ switch (++nameno) {
+ case 1: /* first word is tfmname and perhaps psname, NOT psfile */
+ while(pos<end && *pos!=' ' && *pos!='\t') pos++;
+ psname=entry->tfmname;
+ break;
+ case 2: /* second word is psname, NOT psfile */
+ psname = newword((char**)&pos,end);
+ DEBUG_PRINT(DEBUG_FT,("(%s) ",psname));
+ free(psname);
+ break;
+ case 3: /* third word is encoding */
+ entry->encname = newword((char**)&pos,end);
+ DEBUG_PRINT(DEBUG_FT,("<[%s ",entry->encname));
+ break;
+ default:
+ while(pos<end && *pos!=' ' && *pos!='\t') pos++;
+ Warning("more than three bare words in font map entry");
+ }
+ }
+ while(pos < end && (*pos==' ' || *pos=='\t')) pos++;
+ }
+ if (entry->psfile==NULL) {
+ /* No psfile-name given, use tfmname */
+ entry->psfile=copyword(entry->tfmname);
+ DEBUG_PRINT(DEBUG_FT,(" <%s ",entry->psfile));
+ }
+ if (entry->encname!=NULL
+ && (entry->encoding=FindEncoding(entry->encname))==NULL)
+ Warning("unable to load font encoding '%s' for %s",
+ entry->encname,entry->tfmname);
+}
+
+
+struct psfontmap* FindPSFontMap(char* fontname)
+{
+ struct psfontmap *entry;
+ static struct filemmap* search_mmap_p=&psfont_mmap;
+
+ entry=psfontmap;
+ while(entry!=NULL && strcmp(entry->tfmname,fontname)!=0)
+ entry=entry->next;
+ if(entry==NULL) {
+ entry=SearchPSFontMap(fontname,search_mmap_p);
+#ifdef HAVE_FT2
+ if(entry==NULL && search_mmap_p!=&ttfont_mmap) {
+ search_mmap_p=&ttfont_mmap;
+ entry=SearchPSFontMap(fontname,search_mmap_p);
+ }
+ }
+ if(entry==NULL) {
+ struct psfontmap* entry_subfont=NULL;
+ entry=psfontmap;
+ while(entry!=NULL && strcmp(entry->tfmname,fontname)!=0) {
+ while(entry!=NULL && strchr(entry->tfmname,'@')==NULL)
+ entry=entry->next;
+ if (entry!=NULL) {
+ entry_subfont=FindSubFont(entry,fontname);
+ if (entry_subfont!=NULL)
+ entry=entry_subfont;
+ else
+ entry=entry->next;
+ }
+ }
+#endif
+ }
+ if (entry!=NULL && entry->psfile==NULL)
+ ReadPSFontMap(entry);
+ if (entry!=NULL && entry->encname!=NULL && entry->encoding==NULL)
+ /* Encoding given but it cannot be found. Unusable font */
+ return(NULL);
+ return(entry);
+}
diff --git a/Build/source/texk/dvipng/dvipng-src/ft.c b/Build/source/texk/dvipng/dvipng-src/ft.c
new file mode 100644
index 00000000000..9609b10a10e
--- /dev/null
+++ b/Build/source/texk/dvipng/dvipng-src/ft.c
@@ -0,0 +1,179 @@
+/* ft.c */
+
+/************************************************************************
+
+ Part of the dvipng distribution
+
+ This program is free software: you can redistribute it and/or modify
+ it under the terms of the GNU Lesser General Public License as
+ published by the Free Software Foundation, either version 3 of the
+ License, or (at your option) any later version.
+
+ This program is distributed in the hope that it will be useful, but
+ WITHOUT ANY WARRANTY; without even the implied warranty of
+ MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU
+ Lesser General Public License for more details.
+
+ You should have received a copy of the GNU Lesser General Public
+ License along with this program. If not, see
+ <http://www.gnu.org/licenses/>.
+
+ Copyright (C) 2002-2009 Jan-Åke Larsson
+
+************************************************************************/
+
+#include "dvipng.h"
+
+void LoadFT(int32_t c, struct char_entry * ptr)
+{
+ FT_Bitmap bitmap;
+ FT_UInt glyph_i;
+ int i,j,k;
+ unsigned char* bit;
+ static bool hintwarning=false;
+
+ DEBUG_PRINT(DEBUG_FT,("\n LOAD FT CHAR\t%d (%d)",c,ptr->tfmw));
+ if (currentfont->psfontmap!=NULL
+ && currentfont->psfontmap->encoding != NULL) {
+ DEBUG_PRINT(DEBUG_FT,(" %s",currentfont->psfontmap->encoding->charname[c]));
+ glyph_i = FT_Get_Name_Index(currentfont->face,
+ currentfont->psfontmap->encoding->charname[c]);
+ } else if (currentfont->psfontmap!=NULL
+ && currentfont->psfontmap->subfont != NULL) {
+ glyph_i = FT_Get_Char_Index( currentfont->face,
+ currentfont->psfontmap->subfont->charindex[c] );
+ DEBUG_PRINT(DEBUG_FT,(" 0x%X",currentfont->psfontmap->subfont->charindex[c]));
+ } else
+ glyph_i = FT_Get_Char_Index( currentfont->face, c );
+ if (FT_Load_Glyph( currentfont->face, glyph_i,
+ FT_LOAD_RENDER | FT_LOAD_TARGET_LIGHT )) {
+ /* On some configurations (with FreeType <= 2.1.7) the above
+ fails, while the below works */
+ if (!hintwarning) {
+ hintwarning=true;
+ Warning("the used FreeType does not have target_light hinting");
+ }
+ if (FT_Load_Glyph( currentfont->face, glyph_i,
+ FT_LOAD_RENDER | FT_LOAD_NO_HINTING ))
+ Fatal("cannot load FT char %d",c);
+ }
+ ptr->xOffset = -currentfont->face->glyph->bitmap_left*shrinkfactor;
+ ptr->yOffset = (currentfont->face->glyph->bitmap_top-1)*shrinkfactor;
+ bitmap=currentfont->face->glyph->bitmap;
+ DEBUG_PRINT(DEBUG_FT,(" (%dx%d)",bitmap.width,bitmap.rows));
+
+ if ((ptr->data = calloc(bitmap.width*bitmap.rows,sizeof(char))) == NULL)
+ Fatal("unable to malloc image space for char %c", (char)c);
+ ptr->w = bitmap.width;
+ ptr->h = bitmap.rows;
+
+#define GREYLEVELS 16
+ DEBUG_PRINT(DEBUG_GLYPH,("\nDRAW GLYPH %d\n", (int)c));
+ bit=ptr->data;
+ for(i=0;i<bitmap.rows;i++) {
+ for(j=0;j<bitmap.width;j++) {
+ k=bitmap.buffer[i*bitmap.pitch+j]/(256/GREYLEVELS)*17;
+ /* k=(bitmap.buffer[i*bitmap.pitch+j]+1)/16; */
+ /* k= k>0 ? k*16-1 : 0; */
+ DEBUG_PRINT(DEBUG_GLYPH,("%3u ",k));
+ bit[i*bitmap.width+j]=k;
+ }
+ DEBUG_PRINT(DEBUG_GLYPH,("|\n"));
+ }
+}
+
+bool InitFT(struct font_entry * tfontp)
+{
+ int error;
+
+ if (libfreetype==NULL) {
+ if (FT_Init_FreeType( &libfreetype )) {
+ Warning("an error occured during freetype initialisation, disabling it");
+ option_flags &= ~USE_FREETYPE;
+ return(false);
+ }
+# ifdef DEBUG
+ else {
+ FT_Int amajor, aminor, apatch;
+
+ DEBUG_PRINT(DEBUG_FT,("\n COMPILED WITH FREETYPE %d.%d.%d",
+ FREETYPE_MAJOR, FREETYPE_MINOR, FREETYPE_PATCH));
+# ifdef HAVE_FT_LIBRARY_VERSION
+ FT_Library_Version( libfreetype, &amajor, &aminor, &apatch );
+ DEBUG_PRINT(DEBUG_FT,("\n USING LIBFT %d.%d.%d",
+ amajor, aminor, apatch));
+# endif
+ }
+# endif
+ }
+ DEBUG_PRINT((DEBUG_DVI|DEBUG_FT),("\n OPEN FT FONT:\t'%s'", tfontp->name));
+ error = FT_New_Face( libfreetype, tfontp->name, 0, &tfontp->face );
+ if (error == FT_Err_Unknown_File_Format) {
+ Warning("font file %s has unknown format", tfontp->name);
+ return(false);
+ } else if (error) {
+ Warning("font file %s could not be opened", tfontp->name);
+ return(false);
+ }
+ Message(BE_VERBOSE,"<%s>", tfontp->name);
+ if (tfontp->psfontmap != NULL && tfontp->psfontmap->subfont != NULL)
+ error=FT_Select_Charmap(tfontp->face, tfontp->psfontmap->subfont->encoding);
+ else if (tfontp->psfontmap == NULL || tfontp->psfontmap->encoding == NULL)
+#ifndef FT_ENCODING_ADOBE_CUSTOM
+# define FT_ENCODING_ADOBE_CUSTOM ft_encoding_adobe_custom
+# define FT_ENCODING_ADOBE_STANDARD ft_encoding_adobe_standard
+#endif
+ error=FT_Select_Charmap(tfontp->face, FT_ENCODING_ADOBE_CUSTOM);
+ if (error) {
+ Warning("unable to set font encoding for %s", tfontp->name);
+ if(FT_Select_Charmap( tfontp->face, FT_ENCODING_ADOBE_STANDARD )) {
+ Warning("unable to set fallback font encoding for %s", tfontp->name);
+ return(false);
+ }
+ }
+ if (FT_Set_Char_Size( tfontp->face, /* handle to face object */
+ 0, /* char_width in 1/64th of points */
+ ((int64_t)tfontp->d*64*7200)/7227/65536,
+ /* char_height in 1/64th of _big_points,
+ not TeX points */
+ tfontp->dpi/shrinkfactor, /* horizontal resolution */
+ tfontp->dpi/shrinkfactor )) /* vertical resolution */ {
+ Warning("unable to set font size for %s", tfontp->name);
+ return(false);
+ }
+ if (tfontp->psfontmap!=NULL)
+ FT_Set_Transform(tfontp->face, tfontp->psfontmap->ft_transformp, NULL);
+ tfontp->type = FONT_TYPE_FT;
+ return(true);
+}
+
+
+static void UnLoadFT(struct char_entry *ptr)
+{
+ if (ptr->data!=NULL)
+ free(ptr->data);
+ ptr->data=NULL;
+}
+
+
+void DoneFT(struct font_entry *tfontp)
+{
+ int c=0;
+
+ int error = FT_Done_Face( tfontp->face );
+ if (error)
+ Warning("font file %s could not be closed", tfontp->name);
+ while(c<NFNTCHARS) {
+ if (tfontp->chr[c]!=NULL) {
+ UnLoadFT((struct char_entry*)tfontp->chr[c]);
+ free(tfontp->chr[c]);
+ tfontp->chr[c]=NULL;
+ }
+ c++;
+ }
+ if (tfontp->name!=NULL)
+ free(tfontp->name);
+ tfontp->name=NULL;
+}
+
+
diff --git a/Build/source/texk/dvipng/dvipng-src/install.texi b/Build/source/texk/dvipng/dvipng-src/install.texi
new file mode 100644
index 00000000000..61e47e565b9
--- /dev/null
+++ b/Build/source/texk/dvipng/dvipng-src/install.texi
@@ -0,0 +1,194 @@
+@c install.texi
+@c
+@c Part of the dvipng distribution
+
+@include macros.texi
+@ifset rawfile
+@chapter Installing dvipng
+
+@end ifset
+@c -----------------------
+Installing dvipng should be simple: merely @code{./configure},
+@code{make}, and @code{make install}.
+
+@ifclear rawfile
+@menu
+* Prerequisites::
+* Configure::
+* Build/install::
+* Installation outside the texmf tree::
+* Advice for non-privileged users::
+@end menu
+@end ifclear
+
+@node Prerequisites
+@section Prerequisites
+
+@itemize @bullet
+@item The GD Graphics Draw library, libgd
+
+The drawing library @samp{libgd} is necessary, and is downloadable at
+@uref{https://bitbucket.org/libgd/gd-libgd/downloads}, and there are
+binary packages for most operating systems from their respective
+distributors. In any case, the library installs using @samp{autoconf} so
+it should not be difficult for you to install it from source, and then
+proceed with installing dvipng.
+
+@item The path-searching library kpathsea
+
+Kpathsea is most likely included in your @LaTeX{} installation, but it
+may happen that ./configure does not find it; see below. If you do not
+have it, download it from @uref{http://www.ctan.org} and compile it.
+I have no experience with this, so I cannot help much here.
+
+@item The font-rendering library FreeType 2
+
+While not strictly necessary, a recent FreeType 2 is recommended since
+dvipng currently will produce better-quality images when this library is
+available. To take advantage of this, you should have at least FreeType
+2.1.9.
+
+FreeType 2 will enable direct support for PostScript and TrueType fonts,
+so that dvipng will not need to generate bitmapped variants on disk of
+the @TeX{} fonts since modern @TeX{} distributions include PostScript
+versions of them. Then, you can render images at different (and unusual)
+resolutions without cluttering the disk with lots of bitmapped fonts.
+
+Finally, it will enable subfont support in dvipng. That is, if you want
+to render CJK-@LaTeX{} characters, you must have FreeType 2 installed.
+
+@item libpng and libz
+
+To be able to compress and write PNG files to disk, dvipng (or really
+libgd) uses libpng which in turn uses libz. These should be available on
+any modern system, if not, download them and install them.
+
+@item The @code{texinfo} package
+
+This is needed for building the documentation.
+@end itemize
+
+@node Configure
+@section Configure
+
+The first step is to configure the source code, telling it where
+various files will be. To do so, run
+
+@example
+./configure @var{options}
+@end example
+
+(Note: if you have fetched dvipng from CVS rather than a regular
+release, you will have to first generate @file{./configure} by running
+@code{autoconf} 2.53 or later.)
+
+On many machines, you will not need to specify any options, but if
+@code{configure} cannot determine something on its own, you'll need to
+help it out. For a list of the options type
+
+@example
+./configure --help
+@end example
+
+On some machines, the libraries will be installed in directories that
+are not in the linker's search path. This will generate an error when
+running @file{./configure}, indicating that it cannot find libgd or
+libkpathsea (most likely). You then need to specify the path to the
+respective library's object files. They are typically called e.g.,
+@file{libgd.a} or @file{libgd.so}. If they are located in e.g.,
+@file{/sw/local/lib}, do
+
+@example
+./configure LDFLAGS=-L/sw/local/lib
+@end example
+
+If the library is available as a shared object file (@file{.so}), the
+runtime linker may also need to be told where to find the library,
+then use
+
+@example
+./configure LDFLAGS='-L/sw/local/lib -R/sw/local/lib'
+@end example
+
+When either of these is necessary, it is likely that the C header
+files are also installed in directories that are not in the C
+preprocessor's search path. This will also generate an error when
+running @file{./configure}, indicating that it cannot find e.g.,
+@file{gd.h} or @file{kpathsea.h} (most likely). You then need to
+specify the path to the respective library's C header files. If they
+are located in e.g., @file{/sw/local/include}, do
+
+@example
+./configure CPPFLAGS=-I/sw/local/include
+@end example
+
+On my SUN Solaris workstation, I had to combine this into
+
+@example
+./configure CPPFLAGS='-I/sw/local/include -I/sw/tex/teTeX/1.0/include'\
+ LDFLAGS='-L/sw/local/lib -R/sw/local/lib -L/sw/tex/teTeX/1.0/lib/'
+@end example
+
+@noindent
+where the backslash denotes a continuation of the line.
+
+@node Build/install
+@section Build/install
+
+Once @file{configure} has been run, simply enter
+
+@example
+make
+@end example
+
+@noindent
+at the prompt to compile the C code, and build the documentation files.
+To install the files into the locations chosen earlier, type
+
+@example
+make install
+@end example
+
+@noindent
+You may need special privileges to install, e.g., if you are installing
+into system directories.
+
+@node Installation outside the texmf tree
+@section Installation outside the texmf tree
+
+In some cases, a dvipng binary installed outside the texmf tree will
+not be able to find virtual fonts, or the PostScript font maps
+(normally used by dvips). This may be because @emph{only}
+$SELFAUTOLOC, $SELFAUTODIR, and $SELFAUTOPARENT are used in the texmf
+tree configuration file @samp{texmf.cnf}. If so, give the switch
+@samp{--enable-selfauto-set} to @samp{./configure}. This will make
+dvipng adjust these three internally so that kpathsea thinks that
+dvipng @emph{is} installed in the texmf tree.
+
+@node Advice for non-privileged users
+@section Installation for non-privileged users
+
+Often people without system administration privileges want to install
+software for their private use. In that case you need to specify more
+options to the @file{configure} script, usually this is done by using
+the @samp{--prefix} option to the @file{configure} script, and let it
+point to the personal home directory. In that way, resulting binaries
+will be installed under the @file{bin} subdirectory of your home
+directory, manual pages under @file{man} and so on. That way, it is
+reasonably easy to maintain a bunch of additional packages, since the
+prefix argument is supported by most @file{configure} scripts.
+
+You'll have to add something like @file{/home/myself/bin} to your
+@code{PATH} shell variable, if it isn't there already, and similarly
+set the @code{INFOPATH} and @code{MANPATH} variables to be able to
+access the documentation.
+
+@ifset rawfile
+@section Copying
+
+This program is released under the GNU Lesser General Public License
+version 3, see the COPYING file in the dvipng distribution or
+@url{http://www.gnu.org/licenses/}.
+
+Copyright @copyright{} 2002-2015, 2019 Jan-@AA{}ke Larsson
+@end ifset
diff --git a/Build/source/texk/dvipng/dvipng-src/macros.texi b/Build/source/texk/dvipng/dvipng-src/macros.texi
new file mode 100644
index 00000000000..3c90a59eb15
--- /dev/null
+++ b/Build/source/texk/dvipng/dvipng-src/macros.texi
@@ -0,0 +1,61 @@
+@ignore
+macros.texi
+
+Part of the dvipng distribution
+
+This program is free software: you can redistribute it and/or modify
+it under the terms of the GNU Lesser General Public License as
+published by the Free Software Foundation, either version 3 of the
+License, or (at your option) any later version.
+
+This program is distributed in the hope that it will be useful, but
+WITHOUT ANY WARRANTY; without even the implied warranty of
+MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU
+Lesser General Public License for more details.
+
+You should have received a copy of the GNU Lesser General Public
+License along with this program. If not, see
+<http://www.gnu.org/licenses/>.
+
+Copyright @copyright{} 2002-2008 Jan-@AA{}ke Larsson
+@end ignore
+
+@ifclear macros
+@set macros
+@macro AUCTeX {}
+AUC@TeX{}
+@end macro
+@ifnottex
+@macro LaTeX {}
+La@TeX{}
+@end macro
+@macro previewlatex {}
+preview-latex
+@end macro
+@ifset no-acronym
+@clear no-acronym
+@macro acronym {text}
+@sc{\text\}
+@end macro
+@end ifset
+@ifset no-env
+@clear no-env
+@macro env {text}
+@code{\text\}
+@end macro
+@end ifset
+@ifset no-option
+@clear no-option
+@macro option {text}
+@samp{\text\}
+@end macro
+@end ifset
+@end ifnottex
+@tex
+\gdef\LaTeX{L\kern-.36em\raise.3ex\hbox{\sc{a}}\kern-.15em\TeX}
+\gdef\previewlatex{Preview-\LaTeX}
+\ifx\acronym\undefined \gdef\acronym#1{{\smallcaps \lowercase{#1}}} \fi
+\ifx\env\undefined \global\let\env=\code \fi
+\ifx\option\undefined \global\let\option=\samp \fi
+@end tex
+@end ifclear
diff --git a/Build/source/texk/dvipng/dvipng-src/miktex.h b/Build/source/texk/dvipng/dvipng-src/miktex.h
new file mode 100644
index 00000000000..f609a69a4db
--- /dev/null
+++ b/Build/source/texk/dvipng/dvipng-src/miktex.h
@@ -0,0 +1,266 @@
+/* config.h. Edited for MiKTeX. */
+
+/************************************************************************
+
+ Part of the dvipng distribution
+
+ This program is free software: you can redistribute it and/or modify
+ it under the terms of the GNU Lesser General Public License as
+ published by the Free Software Foundation, either version 3 of the
+ License, or (at your option) any later version.
+
+ This program is distributed in the hope that it will be useful, but
+ WITHOUT ANY WARRANTY; without even the implied warranty of
+ MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU
+ Lesser General Public License for more details.
+
+ You should have received a copy of the GNU Lesser General Public
+ License along with this program. If not, see
+ <http://www.gnu.org/licenses/>.
+
+ Copyright (C) 2002-2015 Jan-Åke Larsson
+
+************************************************************************/
+
+/* Define to one of `_getb67', `GETB67', `getb67' for Cray-2 and Cray-YMP
+ systems. This function is required for `alloca.c' support on those systems.
+ */
+#undef CRAY_STACKSEG_END
+
+/* Define to 1 if using `alloca.c'. */
+#undef C_ALLOCA
+
+/* Define as 1 to get the debug (-d) option. */
+#define DEBUG 1
+
+/* The environment setting for $SELFAUTODIR */
+#undef ENV_SELFAUTODIR
+
+/* The environment setting for $SELFAUTOLOC */
+#undef ENV_SELFAUTOLOC
+
+/* The environment setting for $SELFAUTOPARENT */
+#undef ENV_SELFAUTOPARENT
+
+/* Define as the path to GhostScript. */
+#undef GS_PATH
+
+/* Define to 1 if you have `alloca', as a function or macro. */
+#define HAVE_ALLOCA 1
+
+/* Define to 1 if you have <alloca.h> and it should be used (not on Ultrix).
+ */
+#undef HAVE_ALLOCA_H
+
+/* Define to 1 if you don't have `vprintf' but do have `_doprnt.' */
+#undef HAVE_DOPRNT
+
+/* Define to 1 if you have the `dup2' function. */
+#undef HAVE_DUP2
+
+/* Define to 1 if you have the <fcntl.h> header file. */
+#define HAVE_FCNTL_H 1
+
+/* Define to 1 if you have the `fork' function. */
+#undef HAVE_FORK
+
+/* Define to 1 if you have freetype2 */
+#undef HAVE_FT2
+
+/* Define to 1 if you have the `ftime' function. */
+#undef HAVE_FTIME
+
+/* Define to 1 if you have the `FT_Library_Version' function. */
+#undef HAVE_FT_LIBRARY_VERSION
+
+/* Define to 1 if you have the `gdImageAlphaBlending' function. */
+#undef HAVE_GDIMAGEALPHABLENDING
+
+/* Define to 1 if you have the `gdImageColorResolveAlpha' function. */
+#undef HAVE_GDIMAGECOLORRESOLVEALPHA
+
+/* Define to 1 if you have the `gdImageCreateTrueColor' function. */
+#define HAVE_GDIMAGECREATETRUECOLOR 1
+
+/* Define to 1 if you have the `gdImageGif' function. */
+#undef HAVE_GDIMAGEGIF
+
+/* Define to 1 if you have the `gdImagePngEx' function. */
+#define HAVE_GDIMAGEPNGEX 1
+
+/* Define to 1 if you have the `gdImageTrueColorToPalette' function. */
+#define HAVE_GDIMAGETRUECOLORTOPALETTE 1
+
+/* Define to 1 if you have the <gd.h> header file. */
+#define HAVE_GD_H 1
+
+/* Define to 1 if you have the `getpagesize' function. */
+#undef HAVE_GETPAGESIZE
+
+/* Define to 1 if you have the `gettimeofday' function. */
+#undef HAVE_GETTIMEOFDAY
+
+/* Define to 1 if you have the <inttypes.h> header file. */
+#define HAVE_INTTYPES_H 1
+
+/* Define to 1 if you have the <kpathsea/kpathsea.h> header file. */
+#define HAVE_KPATHSEA_KPATHSEA_H 1
+
+/* Define to 1 if your kpathsea has kpse_enc_format */
+#define HAVE_KPSE_ENC_FORMATS 1
+
+/* Define to 1 if you have the `gd' library (-lgd). */
+#define HAVE_LIBGD 1
+
+/* Define to 1 if you have the `gen' library (-lgen). */
+#undef HAVE_LIBGEN
+
+/* Define to 1 if you have the `kpathsea' library (-lkpathsea). */
+#define HAVE_LIBKPATHSEA 1
+
+/* Define to 1 if you have the `m' library (-lm). */
+#define HAVE_LIBM 1
+
+/* Define to 1 if you have the `png' library (-lpng). */
+#define HAVE_LIBPNG 1
+
+/* Define to 1 if you have the `z' library (-lz). */
+#undef HAVE_LIBZ
+
+/* Define to 1 if your system has a GNU libc compatible `malloc' function, and
+ to 0 otherwise. */
+#undef HAVE_MALLOC
+
+/* Define to 1 if you have the <memory.h> header file. */
+#undef HAVE_MEMORY_H
+
+/* Define to 1 if you have the `memset' function. */
+#define HAVE_MEMSET 1
+
+/* Define to 1 if you have a working `mmap' system call. */
+#undef HAVE_MMAP
+
+/* Define to 1 if you have the `munmap' function. */
+#undef HAVE_MUNMAP
+
+/* Define to 1 if you have the <png.h> header file. */
+#define HAVE_PNG_H 1
+
+/* Define to 1 if you have the `pow' function. */
+#undef HAVE_POW
+
+/* Define to 1 if you have the `putenv' function. */
+#undef HAVE_PUTENV
+
+/* Define to 1 if stdbool.h conforms to C99. */
+#undef HAVE_STDBOOL_H 1
+
+/* Define to 1 if you have the <stdint.h> header file. */
+#undef HAVE_STDINT_H
+
+/* Define to 1 if you have the <stdlib.h> header file. */
+#define HAVE_STDLIB_H 1
+
+/* Define to 1 if you have the `strchr' function. */
+#define HAVE_STRCHR 1
+
+/* Define to 1 if you have the <strings.h> header file. */
+#undef HAVE_STRINGS_H
+
+/* Define to 1 if you have the <string.h> header file. */
+#define HAVE_STRING_H 1
+
+/* Define to 1 if you have the `strrchr' function. */
+#undef HAVE_STRRCHR
+
+/* Define to 1 if you have the `strstr' function. */
+#undef HAVE_STRSTR
+
+/* Define to 1 if you have the `strtol' function. */
+#undef HAVE_STRTOL
+
+/* Define to 1 if you have the <sys/stat.h> header file. */
+#define HAVE_SYS_STAT_H 1
+
+/* Define to 1 if you have the <sys/time.h> header file. */
+#undef HAVE_SYS_TIME_H
+
+/* Define to 1 if you have the <sys/types.h> header file. */
+#undef HAVE_SYS_TYPES_H
+
+/* Define to 1 if you have <sys/wait.h> that is POSIX.1 compatible. */
+#undef HAVE_SYS_WAIT_H
+
+/* Define to 1 if you have the <unistd.h> header file. */
+#undef HAVE_UNISTD_H
+
+/* Define to 1 if you have the `vfork' function. */
+#undef HAVE_VFORK
+
+/* Define to 1 if you have the <vfork.h> header file. */
+#undef HAVE_VFORK_H
+
+/* Define to 1 if you have the `vprintf' function. */
+#define HAVE_VPRINTF 1
+
+/* Define to 1 if `fork' works. */
+#undef HAVE_WORKING_FORK
+
+/* Define to 1 if `vfork' works. */
+#undef HAVE_WORKING_VFORK
+
+/* Define to 1 if the system has the type `_Bool'. */
+#undef HAVE__BOOL 1
+
+/* Define to the address where bug reports for this package should be sent. */
+#define PACKAGE_BUGREPORT "dvipng@nongnu.org"
+
+/* Define to the full name of this package. */
+#define PACKAGE_NAME "dvipng"
+
+/* Define to the full name and version of this package. */
+#define PACKAGE_STRING "dvipng 1.7"
+
+/* Define to the one symbol short name of this package. */
+#define PACKAGE_TARNAME "dvipng"
+
+/* Define to the version of this package. */
+#define PACKAGE_VERSION "1.7"
+
+/* If using the C implementation of alloca, define if you know the
+ direction of stack growth for your system; otherwise it will be
+ automatically deduced at run-time.
+ STACK_DIRECTION > 0 => grows toward higher addresses
+ STACK_DIRECTION < 0 => grows toward lower addresses
+ STACK_DIRECTION = 0 => direction of growth unknown */
+#undef STACK_DIRECTION
+
+/* Define to 1 if you have the ANSI C header files. */
+#undef STDC_HEADERS
+
+/* Define to 1 if you can safely include both <sys/time.h> and <time.h>. */
+#undef TIME_WITH_SYS_TIME
+
+/* Define as 1 to get execution time output. */
+#undef TIMING
+
+/* Define to empty if `const' does not conform to ANSI C. */
+#undef const
+
+/* Define to `long long' if <inttypes.h> does not define it. */
+#undef int64_t
+
+/* Define to rpl_malloc if the replacement function should be used. */
+#undef malloc
+
+/* Define to `int' if <sys/types.h> does not define. */
+#undef pid_t
+
+/* Define to `unsigned' if <sys/types.h> does not define. */
+#undef size_t
+
+/* Define to `unsigned long long' if <inttypes.h> does not define it. */
+#undef uint64_t
+
+/* Define as `fork' if `vfork' does not work. */
+#undef vfork
diff --git a/Build/source/texk/dvipng/dvipng-src/miktex.mak b/Build/source/texk/dvipng/dvipng-src/miktex.mak
new file mode 100644
index 00000000000..b291ba67207
--- /dev/null
+++ b/Build/source/texk/dvipng/dvipng-src/miktex.mak
@@ -0,0 +1,196 @@
+## miktex.mak: dvipng
+##
+## Copyright (C) 2004 Christian Schenk <cs@miktex.org>
+##
+## This file is free software; you can redistribute it and/or modify
+## it under the terms of the GNU General Public License as published
+## by the Free Software Foundation; either version 2, or (at your
+## option) any later version.
+##
+## This file is distributed in the hope that it will be useful, but
+## WITHOUT ANY WARRANTY; without even the implied warranty of
+## MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU
+## General Public License for more details.
+##
+## You should have received a copy of the GNU General Public License
+## along with this file; if not, write to the Free Software
+## Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA
+## 02110-1301 USA.
+
+miktex_cc_no_warnings = 1
+miktex_cc_disable_optimization = 1
+
+!include ..\miktex.inc
+
+objects = \
+ $(outdir)\color.obj \
+ $(outdir)\draw.obj \
+ $(outdir)\dvi.obj \
+ $(outdir)\dvipng.obj \
+ $(outdir)\font.obj \
+ $(outdir)\misc.obj \
+ $(outdir)\papersiz.obj \
+ $(outdir)\pk.obj \
+ $(outdir)\ppagelist.obj \
+ $(outdir)\set.obj \
+ $(outdir)\special.obj \
+ $(outdir)\vf.obj \
+ $(wrapper_obj) \
+
+sources = \
+ color.c \
+ draw.c \
+ dvi.c \
+ dvipng.c \
+ font.c \
+ misc.c \
+ papersiz.c \
+ pk.c \
+ ppagelist.c \
+ set.c \
+ special.c \
+ vf.c \
+
+extra_cdefines = \
+ -Dalloca=_alloca \
+ -DUSE_MIKTEX_EXIT \
+
+extra_cincludes = \
+ -I$(gdlibdir) \
+ -I$(kpslibdir) \
+
+.c{$(outdir)\}.obj:
+ $(cc) $(cstandard) \
+ $(extra_cdefines) \
+ $(extra_cincludes) \
+ $(ccopt_output_directory)$(outdir)\ $<
+
+binaries = $(outdir)\dvipng.exe
+
+all: common-all $(binaries)
+
+install: common-install install-binaries
+
+qrt: common-qrt
+
+# -----------------------------------------------------------------------------
+# dvipng
+# -----------------------------------------------------------------------------
+
+libs = \
+ $(miktex_lib) \
+ $(gd_lib) \
+ $(kps_lib) \
+ $(gnu_lib) \
+ $(texmf_lib) \
+
+$(outdir)\dvipng.exe: \
+ $(outdir) \
+ $(objects) \
+ $(libs) \
+ $(outdir)\dvipng.res \
+
+ $(link) $(lstandard) \
+ -out:$@ \
+ $(objects) \
+ $(libs) \
+ $(outdir)\dvipng.res \
+
+$(outdir)\dvipng.res: \
+ $(libdir)\miktex-version.h \
+ $(outdir) \
+ dvipng-version.h \
+ dvipng.rc \
+
+ $(rc) $(rcstandard) $(rcopt_output_file)$@ dvipng.rc
+
+# -----------------------------------------------------------------------------
+# clean-up
+# -----------------------------------------------------------------------------
+
+mostlyclean: common-mostlyclean
+
+clean: common-clean mostlyclean
+
+distclean: common-distclean clean
+
+realclean: common-realclean distclean
+
+# -----------------------------------------------------------------------------
+# dependencies
+# -----------------------------------------------------------------------------
+
+!include ..\common-dependencies.inc
+
+depend: $(sources)
+ $(MAKEDEPEND1) $(extra_cincludes) $(extra_cdefines) $(sources)
+
+# DO NOT DELETE
+
+$(outdir)\color.obj: dvipng.h config.h .\inttypes.h $(gdlibdir)\gd.h
+$(outdir)\color.obj: $(gdlibdir)\gd_io.h $(gdlibdir)\gdfx.h
+$(outdir)\color.obj: $(kpslibdir)\kpathsea\kpathsea.h
+$(outdir)\color.obj: $(kpslibdir)\web2c-miktex.h ..\lib\miktex.h
+$(outdir)\color.obj: ..\lib\miktex-features.h commands.h
+$(outdir)\draw.obj: dvipng.h config.h .\inttypes.h $(gdlibdir)\gd.h
+$(outdir)\draw.obj: $(gdlibdir)\gd_io.h $(gdlibdir)\gdfx.h
+$(outdir)\draw.obj: $(kpslibdir)\kpathsea\kpathsea.h
+$(outdir)\draw.obj: $(kpslibdir)\web2c-miktex.h ..\lib\miktex.h
+$(outdir)\draw.obj: ..\lib\miktex-features.h commands.h
+$(outdir)\dvi.obj: dvipng.h config.h .\inttypes.h $(gdlibdir)\gd.h
+$(outdir)\dvi.obj: $(gdlibdir)\gd_io.h $(gdlibdir)\gdfx.h
+$(outdir)\dvi.obj: $(kpslibdir)\kpathsea\kpathsea.h
+$(outdir)\dvi.obj: $(kpslibdir)\web2c-miktex.h ..\lib\miktex.h
+$(outdir)\dvi.obj: ..\lib\miktex-features.h commands.h ..\libgnu\gnu-miktex.h
+$(outdir)\dvipng.obj: dvipng.h config.h .\inttypes.h
+$(outdir)\dvipng.obj: $(gdlibdir)\gd.h $(gdlibdir)\gd_io.h
+$(outdir)\dvipng.obj: $(gdlibdir)\gdfx.h
+$(outdir)\dvipng.obj: $(kpslibdir)\kpathsea\kpathsea.h
+$(outdir)\dvipng.obj: $(kpslibdir)\web2c-miktex.h ..\lib\miktex.h
+$(outdir)\dvipng.obj: ..\lib\miktex-features.h commands.h
+$(outdir)\font.obj: dvipng.h config.h .\inttypes.h $(gdlibdir)\gd.h
+$(outdir)\font.obj: $(gdlibdir)\gd_io.h $(gdlibdir)\gdfx.h
+$(outdir)\font.obj: $(kpslibdir)\kpathsea\kpathsea.h
+$(outdir)\font.obj: $(kpslibdir)\web2c-miktex.h ..\lib\miktex.h
+$(outdir)\font.obj: ..\lib\miktex-features.h commands.h
+$(outdir)\misc.obj: dvipng.h config.h .\inttypes.h $(gdlibdir)\gd.h
+$(outdir)\misc.obj: $(gdlibdir)\gd_io.h $(gdlibdir)\gdfx.h
+$(outdir)\misc.obj: $(kpslibdir)\kpathsea\kpathsea.h
+$(outdir)\misc.obj: $(kpslibdir)\web2c-miktex.h ..\lib\miktex.h
+$(outdir)\misc.obj: ..\lib\miktex-features.h commands.h
+$(outdir)\misc.obj: ..\libgnu\gnu-miktex.h
+$(outdir)\papersiz.obj: dvipng.h config.h .\inttypes.h
+$(outdir)\papersiz.obj: $(gdlibdir)\gd.h
+$(outdir)\papersiz.obj: $(gdlibdir)\gd_io.h
+$(outdir)\papersiz.obj: $(gdlibdir)\gdfx.h
+$(outdir)\papersiz.obj: $(kpslibdir)\kpathsea\kpathsea.h
+$(outdir)\papersiz.obj: $(kpslibdir)\web2c-miktex.h ..\lib\miktex.h
+$(outdir)\papersiz.obj: ..\lib\miktex-features.h commands.h
+$(outdir)\pk.obj: dvipng.h config.h .\inttypes.h $(gdlibdir)\gd.h
+$(outdir)\pk.obj: $(gdlibdir)\gd_io.h $(gdlibdir)\gdfx.h
+$(outdir)\pk.obj: $(kpslibdir)\kpathsea\kpathsea.h
+$(outdir)\pk.obj: $(kpslibdir)\web2c-miktex.h ..\lib\miktex.h
+$(outdir)\pk.obj: ..\lib\miktex-features.h commands.h
+$(outdir)\ppagelist.obj: dvipng.h config.h .\inttypes.h
+$(outdir)\ppagelist.obj: $(gdlibdir)\gd.h
+$(outdir)\ppagelist.obj: $(gdlibdir)\gd_io.h
+$(outdir)\ppagelist.obj: $(gdlibdir)\gdfx.h
+$(outdir)\ppagelist.obj: $(kpslibdir)\kpathsea\kpathsea.h
+$(outdir)\ppagelist.obj: $(kpslibdir)\web2c-miktex.h ..\lib\miktex.h
+$(outdir)\ppagelist.obj: ..\lib\miktex-features.h commands.h
+$(outdir)\set.obj: dvipng.h config.h .\inttypes.h $(gdlibdir)\gd.h
+$(outdir)\set.obj: $(gdlibdir)\gd_io.h $(gdlibdir)\gdfx.h
+$(outdir)\set.obj: $(kpslibdir)\kpathsea\kpathsea.h
+$(outdir)\set.obj: $(kpslibdir)\web2c-miktex.h ..\lib\miktex.h
+$(outdir)\set.obj: ..\lib\miktex-features.h commands.h
+$(outdir)\special.obj: dvipng.h config.h .\inttypes.h
+$(outdir)\special.obj: $(gdlibdir)\gd.h $(gdlibdir)\gd_io.h
+$(outdir)\special.obj: $(gdlibdir)\gdfx.h
+$(outdir)\special.obj: $(kpslibdir)\kpathsea\kpathsea.h
+$(outdir)\special.obj: $(kpslibdir)\web2c-miktex.h ..\lib\miktex.h
+$(outdir)\special.obj: ..\lib\miktex-features.h commands.h
+$(outdir)\vf.obj: dvipng.h config.h .\inttypes.h $(gdlibdir)\gd.h
+$(outdir)\vf.obj: $(gdlibdir)\gd_io.h $(gdlibdir)\gdfx.h
+$(outdir)\vf.obj: $(kpslibdir)\kpathsea\kpathsea.h
+$(outdir)\vf.obj: $(kpslibdir)\web2c-miktex.h ..\lib\miktex.h
+$(outdir)\vf.obj: ..\lib\miktex-features.h commands.h
diff --git a/Build/source/texk/dvipng/dvipng-src/misc.c b/Build/source/texk/dvipng/dvipng-src/misc.c
new file mode 100644
index 00000000000..01bd94d33a7
--- /dev/null
+++ b/Build/source/texk/dvipng/dvipng-src/misc.c
@@ -0,0 +1,848 @@
+/* misc.c */
+
+/************************************************************************
+
+ Part of the dvipng distribution
+
+ This program is free software: you can redistribute it and/or modify
+ it under the terms of the GNU Lesser General Public License as
+ published by the Free Software Foundation, either version 3 of the
+ License, or (at your option) any later version.
+
+ This program is distributed in the hope that it will be useful, but
+ WITHOUT ANY WARRANTY; without even the implied warranty of
+ MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU
+ Lesser General Public License for more details.
+
+ You should have received a copy of the GNU Lesser General Public
+ License along with this program. If not, see
+ <http://www.gnu.org/licenses/>.
+
+ Copyright (C) 2002-2015, 2019 Jan-Åke Larsson
+
+************************************************************************/
+
+#include "dvipng.h"
+#ifdef HAVE_LIBGEN_H
+# include <libgen.h>
+#endif
+#include <fcntl.h> /* open/close */
+#ifdef HAVE_MMAP
+#include <sys/mman.h>
+#endif
+#include <sys/stat.h>
+
+#if defined _WIN32 && !defined __CYGWIN__ && !defined __CYGWIN32__
+ /* Use Windows separators on all _WIN32 defining
+ environments, except Cygwin. */
+# define DIR_SEPARATOR_CHAR '\\'
+#endif
+#ifndef DIR_SEPARATOR_CHAR
+# define DIR_SEPARATOR_CHAR '/'
+#endif /* !DIR_SEPARATOR_CHAR */
+
+static char *programname;
+
+/*-->DecodeArgs*/
+/*********************************************************************/
+/***************************** DecodeArgs ****************************/
+/*********************************************************************/
+bool DecodeArgs(int argc, char ** argv)
+{
+ int i; /* argument index for options */
+ bool ppused=false; /* Flag when -pp is used */
+ int32_t number; /* Temporary storage for numeric parameter */
+ char *dviname=NULL; /* Name of dvi file */
+ char *outname=NULL; /* Name of output file */
+
+ programname=PACKAGE_NAME;
+ if (argv[0]) {
+#ifdef HAVE_GDIMAGEGIF
+ programname=strrchr(argv[0],DIR_SEPARATOR_CHAR);
+ if (programname!=NULL)
+ programname++;
+ else
+ programname=argv[0];
+ if (strncasecmp(programname,"dvigif",6)==0)
+ option_flags |= GIF_OUTPUT;
+#endif
+ programname=argv[0];
+ }
+ Message(BE_NONQUIET,"This is %s",programname);
+ if (option_flags & GIF_OUTPUT)
+ Message(BE_NONQUIET," (%s)", PACKAGE_NAME);
+ Message(BE_NONQUIET," %s Copyright 2002-2015, 2019 Jan-Ake Larsson\n",
+ PACKAGE_VERSION);
+
+ for (i=1; i<argc; i++) {
+ if (*argv[i]=='-') {
+ char *p=argv[i]+2 ;
+ char c=argv[i][1] ;
+ if (c=='-') {
+ p++;
+ c=argv[i][2];
+ }
+ switch (c) {
+ case 'd': /* selects Debug output */
+ if (*p>'9' && *p!='-') {
+ if (strncmp(p,"vinum",5)==0) {
+ if (p[5] != '0') {
+ option_flags |= DVI_PAGENUM;
+ Message(PARSE_STDIN,"DVI page number output on\n",p);
+ } else {
+ option_flags &= ~DVI_PAGENUM;
+ Message(PARSE_STDIN,"DVI page number output off\n");
+ }
+ break;
+ } else if (strncmp(p,"epth",4)==0) { /* Depth reporting */
+ if (p[4] != '0') {
+ option_flags |= REPORT_DEPTH;
+ Message(PARSE_STDIN,"Depth reporting on\n",p);
+ } else {
+ option_flags &= ~REPORT_DEPTH;
+ Message(PARSE_STDIN,"Depth reporting off\n");
+ }
+ break;
+ }
+ goto DEFAULT;
+ } else {
+#ifdef DEBUG
+ if (*p == 0 && argv[i+1])
+ p = argv[i+1];
+ debug = atoi(p);
+ if (debug > 0) {
+ if (p == argv[i+1]) i++;
+ } else
+ debug = DEBUG_DEFAULT;
+ Message(PARSE_STDIN,"Debug output enabled\n");
+#ifdef HAVE_LIBKPATHSEA
+ kpathsea_debug = debug / LASTDEBUG / 2 ;
+#endif
+#else
+ Warning("This instance of %s was compiled without the debug (-d) option",
+ programname);
+#endif
+ break;
+ }
+ case 'o': /* Output file is specified */
+ if (*p == 0 && argv[i+1])
+ p = argv[++i] ;
+ outname=p;
+ /* remove .png extension */
+ Message(PARSE_STDIN,"Output file: %s\n",
+ outname);
+ break;
+#ifdef MAKETEXPK
+ case 'M':
+ /* -M, -M1 => don't make font; -M0 => do. */
+ makeTexPK = (*p == '0');
+#ifdef HAVE_LIBKPATHSEA
+ kpse_set_program_enabled (kpse_pk_format, makeTexPK, kpse_src_cmdline);
+#endif
+ if (makeTexPK)
+ Message(PARSE_STDIN,"MakeTeXPK enabled\n");
+ else
+ Message(PARSE_STDIN,"MakeTeXPK disabled\n");
+ break;
+#endif /* MAKETEXPK */
+ case 'm':
+ if (strcmp(p,"ode") == 0 ) {
+ if (argv[i+1])
+ user_mfmode = argv[++i] ;
+ Message(PARSE_STDIN,"MetaFont mode: %s\n",user_mfmode);
+ break;
+ }
+ goto DEFAULT;
+ case 'h':
+ if (strcmp(p,"elp") == 0 ) {
+ break;
+ } else if (strncmp(p,"eight",5) == 0 ) { /* Height reporting */
+ if (p[5] != '0') {
+ option_flags |= REPORT_HEIGHT;
+ Message(PARSE_STDIN,"Height reporting on\n",p);
+ } else {
+ option_flags &= ~REPORT_HEIGHT;
+ Message(PARSE_STDIN,"Height reporting off\n");
+ }
+ break;
+ }
+ goto DEFAULT;
+ case 'O' : /* Offset */
+ if (*p == 0 && argv[i+1])
+ p = argv[++i] ;
+ handlepapersize(p, &x_offset_def, &y_offset_def) ;
+ Message(PARSE_STDIN,"Offset: (%d,%d)\n",x_offset_def,y_offset_def);
+ break ;
+ case 'e':
+ if (strncmp(p,"xpand-bbox",10) == 0 ) {
+ if (p[10] != '0') {
+ option_flags |= EXPAND_BBOX;
+ Message(PARSE_STDIN,"BBox expansion on\n",p);
+ } else {
+ option_flags &= ~EXPAND_BBOX;
+ Message(PARSE_STDIN,"BBox expansion off\n");
+ }
+ break;
+ }
+ goto DEFAULT;
+ case 'T' :
+ if (*p == 0 && argv[i+1])
+ p = argv[++i];
+ if (strcmp(p,"bbox")==0) {
+ x_width_def=0;
+ y_width_def=0;
+ Message(PARSE_STDIN,"Pagesize: (bbox)\n");
+ } else if (strcmp(p,"tight")==0) {
+ x_width_def=-1;
+ y_width_def=-1;
+ Message(PARSE_STDIN,"Pagesize: (tight bbox)\n");
+ } else {
+ handlepapersize(p, &x_width_def, &y_width_def) ;
+ Message(PARSE_STDIN,"Pagesize: (%d,%d)\n",
+ x_width_def,y_width_def);
+ }
+ break ;
+ case 't': /* specify paper format, only for cropmarks */
+#ifdef HAVE_GDIMAGECREATETRUECOLOR
+ /* Truecolor */
+ if (strncmp(p,"ruecolor",8)==0) {
+ if (p[8] != '0') {
+ option_flags |= FORCE_TRUECOLOR;
+ Message(PARSE_STDIN,"Truecolor mode on\n",p);
+ } else {
+ option_flags &= ~FORCE_TRUECOLOR;
+ Message(PARSE_STDIN,"Truecolor mode off\n");
+ }
+ } else
+#endif
+ { /* cropmarks not implemented yet */
+ if (*p == 0 && argv[i+1])
+ p = argv[++i] ;
+ if (strcmp(p,"a4")==0) {
+ handlepapersize("210mm,297mm",&x_pwidth,&y_pwidth);
+ } else if (strcmp(p,"letter")==0) {
+ handlepapersize("8.5in,11in",&x_pwidth,&y_pwidth);
+ } else if (strcmp(p,"legal")==0) {
+ handlepapersize("8.5in,14in",&x_pwidth,&y_pwidth);
+ } else if (strcmp(p,"executive")==0) {
+ handlepapersize("7.25in,10.5in",&x_pwidth,&y_pwidth);
+ } else
+ Fatal("papersize %s is not implemented",p);
+ Message(PARSE_STDIN,"Papersize: %s\n",p);
+ }
+ break;
+/* case 'c': */
+/* if (strncmp(p,"acheimages",10)==0) { */
+/* if (p[10] != '0') { */
+/* option_flags |= CACHE_IMAGES; */
+/* Message(PARSE_STDIN,"Caching images\n",p); */
+/* } else { */
+/* option_flags &= ~CACHE_IMAGES; */
+/* Message(PARSE_STDIN,"Not caching images\n"); */
+/* } */
+/* break; */
+/* } */
+/* goto DEFAULT; */
+ case 'b':
+ if ( *p == 'g' ) { /* -bg background color */
+ p++;
+ if (*p == 0 && argv[i+1])
+ p = argv[++i] ;
+ if (strncmp(p,"Transparent",11) == 0 )
+ option_flags |= BG_TRANSPARENT_ALPHA;
+ else if (strncmp(p,"transparent",11) == 0 )
+ option_flags |= BG_TRANSPARENT;
+ else
+ background(p);
+ if (option_flags & BG_TRANSPARENT)
+ Message(PARSE_STDIN,"Transp. background (fallback rgb %d,%d,%d)\n",
+ cstack[0].red,cstack[0].green,cstack[0].blue);
+ else
+ Message(PARSE_STDIN,"Background: rgb %d,%d,%d\n",
+ cstack[0].red,cstack[0].green,cstack[0].blue);
+ break;
+ } else if (strcmp(p, "dpi")==0) {
+ p+=3;
+ if (*p == 0 && argv[i+1])
+ p = argv[++i];
+ number = atoi(p);
+ if (number < 10 || number > 10000)
+ Warning("Bad --bdpi parameter, ignored");
+ else {
+ user_bdpi=number;
+ Message(PARSE_STDIN,"Bdpi: %d\n",user_bdpi);
+ }
+ break;
+ } else if ( *p == 'd' ) { /* -bd border width */
+ int tmpi;
+ char* tmps;
+ p++;
+ if (*p == 0 && argv[i+1])
+ p = argv[++i] ;
+ tmpi = strtol(p, &tmps, 10);
+ if (p<tmps) {
+ borderwidth=tmpi;
+ Message(PARSE_STDIN,"Transp. border: %d dots\n",borderwidth);
+ }
+ if (*tmps) {
+ stringrgb(tmps, &bordercolor.red, &bordercolor.green, &bordercolor.blue);
+ userbordercolor=TRUE;
+ if (borderwidth==0) {
+ borderwidth=1;
+ Message(PARSE_STDIN,"Transp. border: %d dots\n",borderwidth);
+ }
+ Message(PARSE_STDIN,"Transp. border: rgb %d,%d,%d\n",
+ bordercolor.red, bordercolor.green, bordercolor.blue);
+ }
+ break;
+ }
+ goto DEFAULT;
+ case 'f':
+ if ( *p == 'g' ) { /* -fg foreground color */
+ p++;
+ if (*p == 0 && argv[i+1])
+ p = argv[++i] ;
+ resetcolorstack(p);
+ Message(PARSE_STDIN,"Foreground: rgb %d,%d,%d\n",
+ cstack[1].red,cstack[1].green,cstack[1].blue);
+ break;
+#ifdef HAVE_FT2
+ } else if ( strncmp(p,"reetype",7) == 0 ) { /* -freetype activation */
+ if (p[7] != '0') {
+ option_flags |= USE_FREETYPE;
+ Message(PARSE_STDIN,"FreeType rendering on\n",p);
+ } else {
+ option_flags &= ~USE_FREETYPE;
+ Message(PARSE_STDIN,"FreeType rendering off\n");
+ }
+ break;
+#endif
+ } else if (strcmp(p,"ollow") == 0 ) {
+ if (DVIFollowToggle())
+ Message(PARSE_STDIN,"Follow mode on\n");
+ else
+ Message(PARSE_STDIN,"Follow mode off\n");
+ break;
+ }
+ goto DEFAULT;
+ case 'x' : case 'y' :
+ if (*p == 0 && argv[i+1])
+ p = argv[++i] ;
+ number = atoi(p);
+ if (number < 1 || number > 1000000)
+ Warning("Bad magnification parameter (-x or -y), ignored");
+ else {
+ usermag=number;
+ Message(PARSE_STDIN,"Magstep: %d\n",usermag);
+ /*overridemag = (c == 'x' ? 1 : -1) ;*/
+ }
+ break ;
+ case 'g' :
+ if (strncmp(p,"amma",4)==0) { /* --gamma correction */
+ double gamma=0.0;
+
+ p+=4;
+ if (*p == 0 && argv[i+1])
+ p = argv[++i];
+ if (p!=NULL)
+ gamma=atof(p);
+ if (gamma==0.0) {
+ Warning("Bad gamma value, default is %f",DEFAULT_GAMMA);
+ gamma=DEFAULT_GAMMA;
+ }
+ Gamma(gamma);
+ Message(PARSE_STDIN,"Gamma value is %f\n", gamma);
+ break;
+#ifdef HAVE_GDIMAGEGIF
+ } else if (strncmp(p,"if",2)==0) { /* --gif output */
+ option_flags |= GIF_OUTPUT;
+ Message(PARSE_STDIN,"GIF output\n");
+ break;
+#endif
+ }
+ goto DEFAULT;
+ case 'p' :
+ if (*p == 'p') { /* a -pp specifier for a page list */
+ ppused=true;
+ p++ ;
+ if (*p == 0 && argv[i+1])
+ p = argv[++i];
+ Message(PARSE_STDIN,"Page list: %s\n",p);
+ if (ParsePages(p))
+ Fatal("bad page list specifier (-pp)");
+ } else if (strncmp(p,"ng",2)==0) { /* --png output */
+ option_flags &= ~GIF_OUTPUT;
+ Message(PARSE_STDIN,"PNG output\n");
+ } else if (strncmp(p,"icky",4)==0) {
+ if (p[4] != '0') {
+ option_flags |= MODE_PICKY;
+ Message(PARSE_STDIN,"No images output for pages with warnings\n",p);
+ } else {
+ option_flags &= ~MODE_PICKY;
+ Message(PARSE_STDIN,"Images output even for pages with warnings\n");
+ }
+ } else if (strncmp(p,"alette",6)==0) {
+ if (p[6] != '0') {
+ option_flags |= FORCE_PALETTE;
+ Message(PARSE_STDIN,"Forcing 256-color PNG output\n",p);
+ } else {
+ option_flags &= ~FORCE_PALETTE;
+ Message(PARSE_STDIN,"Allows truecolor PNG output\n");
+ }
+ } else { /* a -p specifier for first page */
+ int32_t firstpage;
+ bool abspage=false;
+
+ if (*p == 0 && argv[i+1])
+ p = argv[++i] ;
+ if (*p == '=') {
+ abspage=true;
+ p++ ;
+ }
+ if ((*p>='0'&&*p<='9') || (*p=='-' && *(p+1)>='0' && *(p+1)<='9')) {
+ firstpage = atoi(p);
+ FirstPage(firstpage,abspage);
+ Message(PARSE_STDIN,"First page: %d\n",firstpage);
+ } else
+ Warning("Bad firstpage (-p) parameter, ignored");
+ }
+ break ;
+ case 's' :
+ if (strncmp(p,"trict",5)==0) {
+ if (p[5] != '0') {
+ option_flags |= MODE_STRICT;
+ Message(PARSE_STDIN,"Warnings are fatal\n",p);
+ } else {
+ option_flags &= ~MODE_STRICT;
+ Message(PARSE_STDIN,"Warnings are not fatal\n");
+ }
+ } else
+ goto DEFAULT;
+ break ;
+ case 'n' :
+ if (strncmp(p,"oghostscript",12)==0) {
+ if (p[12] != '0') {
+ option_flags |= NO_GHOSTSCRIPT;
+ Message(PARSE_STDIN,"No GhostScript calls\n",p);
+ } else {
+ option_flags &= ~NO_GHOSTSCRIPT;
+ Message(PARSE_STDIN,"GhostScript calls made\n");
+ }
+ } else if (strncmp(p,"ogssafer",8)==0) {
+ if (p[8] != '0') {
+ option_flags |= NO_GSSAFER;
+ Message(PARSE_STDIN,"GhostScript calls does not use -dSAFER\n",p);
+ } else {
+ option_flags &= ~NO_GSSAFER;
+ Message(PARSE_STDIN,"GhostScript calls use -dSAFER\n");
+ }
+ } else if (strncmp(p,"ogs",3)==0) {
+ if (p[3] != '0') {
+ option_flags |= NO_GHOSTSCRIPT;
+ Message(PARSE_STDIN,"No GhostScript calls\n",p);
+ } else {
+ option_flags &= ~NO_GHOSTSCRIPT;
+ Message(PARSE_STDIN,"GhostScript calls made\n");
+ }
+ } else if (strncmp(p,"orawps",6)==0) {
+ if (p[6] != '0') {
+ option_flags |= NO_RAW_PS;
+ Message(PARSE_STDIN,"Conversion of raw PostScript will not be attempted\n",p);
+ } else {
+ option_flags &= ~NO_RAW_PS;
+ Message(PARSE_STDIN,"Conversion of raw PostScript will be attempted\n",p);
+ }
+ } else
+ goto DEFAULT;
+ break ;
+ case 'l':
+ {
+ int32_t lastpage;
+ bool abspage=false;
+
+ if (*p == 0 && argv[i+1])
+ p = argv[++i] ;
+ if (*p == '=') {
+ abspage=true;
+ p++ ;
+ }
+ if ((*p>='0'&&*p<='9') || (*p=='-' && *(p+1)>='0' && *(p+1)<='9')) {
+ lastpage = atoi(p);
+ LastPage(lastpage,abspage);
+ Message(PARSE_STDIN,"Last page: %d\n",lastpage);
+ } else
+ Warning("Bad lastpage (-l) parameter, ignored");
+ }
+ break ;
+ case 'q': /* quiet operation */
+ if (*p != '0')
+ option_flags &= (~BE_NONQUIET & ~BE_VERBOSE);
+ else
+ option_flags |= BE_NONQUIET;
+ break;
+ case 'r': /* process pages in reverse order */
+ if (*p != '0') {
+ Message(PARSE_STDIN,"Reverse order\n");
+ Reverse(true);
+ } else {
+ Message(PARSE_STDIN,"Normal order\n");
+ Reverse(false);
+ }
+ break;
+ case 'v': /* verbatim mode */
+ if (strcmp(p, "ersion")==0) {
+ puts(PACKAGE_STRING);
+#ifdef HAVE_LIBKPATHSEA
+ puts (KPSEVERSION);
+#endif
+#ifdef HAVE_FT2
+ printf("Compiled with Freetype %d.%d.%d\n",
+ FREETYPE_MAJOR, FREETYPE_MINOR, FREETYPE_PATCH);
+# ifdef HAVE_FT_LIBRARY_VERSION
+ if (FT_Init_FreeType( &libfreetype ))
+ Warning("the Freetype library seems unusable");
+ else {
+ FT_Int amajor, aminor, apatch;
+
+ FT_Library_Version( libfreetype, &amajor, &aminor, &apatch );
+ printf("Using libft %d.%d.%d\n",amajor, aminor, apatch);
+ FT_Done_FreeType(libfreetype);
+ }
+# endif
+#endif
+ puts ("Copyright (C) 2002-2015, 2019 Jan-Ake Larsson.\n\
+There is NO warranty. You may redistribute this software\n\
+under the terms of the GNU Lesser General Public License\n\
+version 3, see the COPYING file in the dvipng distribution\n\
+or <http://www.gnu.org/licenses/>.");
+ exit (EXIT_SUCCESS);
+ }
+ if (*p != '0')
+ option_flags |= BE_NONQUIET | BE_VERBOSE;
+ else
+ option_flags &= ~BE_VERBOSE;
+ break;
+ case 'D' :
+ if (*p == 0 && argv[i+1])
+ p = argv[++i] ;
+ number = atoi(p);
+ if (number < 10 || number > 10000)
+ Warning("Bad resolution (-D) parameter, ignored") ;
+ else {
+ dpi=number;
+ Message(PARSE_STDIN,"Dpi: %d\n",dpi);
+ }
+ break;
+ case 'Q': /* quality (= shrinkfactor) */
+ if (*p == 0 && argv[i+1])
+ p = argv[++i];
+ if (*p>='0'&&*p<='9') {
+ shrinkfactor = atoi(p);
+ Message(PARSE_STDIN,"Quality: %d\n",shrinkfactor);
+ } else {
+ Warning("Non-numeric quality (-Q) value, ignored");
+ }
+ break;
+ case 'w':
+ if (strncmp(p,"idth",4) == 0 ) { /* Width reporting */
+ if (p[4] != '0') {
+ option_flags |= REPORT_WIDTH;
+ Message(PARSE_STDIN,"Width reporting on\n",p);
+ } else {
+ option_flags &= ~REPORT_WIDTH;
+ Message(PARSE_STDIN,"Width reporting off\n");
+ }
+ break;
+ }
+ goto DEFAULT;
+#ifdef HAVE_GDIMAGEPNGEX
+ case 'z':
+ if (*p == 0 && argv[i+1])
+ p = argv[++i];
+ number = atoi(p);
+ if (number<1 || number>9)
+ Warning("Bad compression (-z) value, ignored");
+ else {
+ compression=number;
+ Message(PARSE_STDIN,"Compression: %d\n",shrinkfactor);
+ }
+ break;
+#endif
+ case '\0':
+ option_flags |= PARSE_STDIN;
+ break;
+ DEFAULT: default:
+ Warning("%s is not a valid option", argv[i]);
+ }
+ } else {
+ dviname=argv[i];
+ }
+ }
+ if (dviname != NULL) {
+ if (dvi != NULL && dvi->filep != NULL)
+ DVIClose(dvi);
+ dvi=DVIOpen(dviname,outname);
+ }
+
+ if (dvi==NULL) {
+ fprintf(stdout,"\nUsage: %s [OPTION]... FILENAME[.dvi]\n", programname);
+ fprintf(stdout,"Options are chosen to be similar to dvips' options where possible:\n");
+#ifdef DEBUG
+ fprintf(stdout," -d # Debug (# is the debug bitmap, 1 if not given)\n");
+#endif
+ fprintf(stdout," -D # Output resolution\n");
+ fprintf(stdout," -l # Last page to be output\n");
+ fprintf(stdout," -o f Output file, '%%d' is pagenumber\n");
+ fprintf(stdout," -O c Image offset\n");
+ fprintf(stdout," -p # First page to be output\n");
+ fprintf(stdout," -pp #,#.. Page list to be output\n");
+ fprintf(stdout," -q* Quiet operation\n");
+ fprintf(stdout," -T c Image size (also accepts '-T bbox' and '-T tight')\n");
+ fprintf(stdout," -v* Verbose operation\n");
+ fprintf(stdout," - Interactive query of options\n");
+ fprintf(stdout,"\nThese do not correspond to dvips options:\n");
+ fprintf(stdout," -bd # Transparent border width in dots\n");
+ fprintf(stdout," -bd s Transparent border fallback color (TeX-style color)\n");
+ fprintf(stdout," -bg s Background color (TeX-style color or 'Transparent')\n");
+ fprintf(stdout," --depth* Output the image depth on stdout\n");
+ fprintf(stdout," --dvinum* Use TeX page numbers in output filenames\n");
+ fprintf(stdout," -fg s Foreground color (TeX-style color)\n");
+ fprintf(stdout," --follow* Wait for data at end-of-file\n");
+#ifdef HAVE_FT2
+ fprintf(stdout," --freetype* FreeType font rendering (preferred, default on)\n");
+#endif
+ fprintf(stdout," --gamma # Control color interpolation\n");
+#ifdef HAVE_GDIMAGEGIF
+ fprintf(stdout," --gif Output GIF images (dvigif default)\n");
+#endif
+ fprintf(stdout," --height* Output the image height on stdout\n");
+ fprintf(stdout," --nogs* Don't use ghostscript for PostScript specials\n");
+ fprintf(stdout," --nogssafer* Don't use -dSAFER in ghostscript calls\n");
+ fprintf(stdout," --norawps* Don't convert raw PostScript specials\n");
+#ifdef HAVE_GDIMAGECREATETRUECOLOR
+ fprintf(stdout," --palette* Force palette output\n");
+#endif
+ fprintf(stdout," --picky When a warning occurs, don't output image\n");
+#ifdef HAVE_GDIMAGEGIF
+ fprintf(stdout," --png Output PNG images (dvipng default)\n");
+#endif
+ fprintf(stdout," --strict When a warning occurs, exit\n");
+#ifdef HAVE_GDIMAGECREATETRUECOLOR
+ fprintf(stdout," --truecolor* Truecolor output\n");
+#endif
+ fprintf(stdout," -Q # Quality (PK subsampling)\n");
+ fprintf(stdout," --width* Output the image width on stdout\n");
+#ifdef HAVE_GDIMAGEPNGEX
+ fprintf(stdout," -z # PNG compression level\n");
+#endif
+
+ fprintf(stdout,"\n # = number f = file s = string * = suffix, '0' to turn off\n");
+ fprintf(stdout," c = comma-separated dimension pair (e.g., 3.2in,-32.1cm)\n\n");
+ /*#ifdef HAVE_LIBKPATHSEA
+ {
+ extern DllImport char *kpse_bug_address;
+ putc ('\n', stdout);
+ fputs (kpse_bug_address, stdout);
+ }
+ #endif*/
+ if ((option_flags & PARSE_STDIN) == 0) {
+ exit(EXIT_SUCCESS);
+ }
+ }
+ if ((option_flags & PARSE_STDIN) == 0 && (!ppused))
+ ParsePages("-");
+ return((option_flags & PARSE_STDIN) != 0);
+}
+
+void DecodeString(char *string)
+{
+#define PARSEARGS 10
+ char *strv[PARSEARGS];
+ int strc=1;
+ strv[0]=NULL; /* No program name */
+
+ while (*string==' ' || *string=='\t' || *string=='\r' || *string=='\n')
+ string++;
+ while (*string!='\0') {
+ strv[strc++]=string;
+ if (*string!='\'') {
+ /* Normal split at whitespace */
+ while (*string!=' ' && *string!='\t' \
+ && *string!='\n' && *string!='\r' && *string!='\0')
+ string++;
+ } else {
+ /* String delimiter found , so search for next */
+ strv[strc-1]=++string;
+ while (*string!='\'' && *string!='\0')
+ string++;
+ }
+ if (*string!='\0')
+ *string++='\0';
+ while (*string==' ' || *string=='\t' || *string=='\r' || *string=='\n')
+ string++;
+ }
+ if (strc>1) /* Nonempty */
+ (void) DecodeArgs(strc,strv);
+}
+
+
+
+uint32_t UNumRead(unsigned char* current, register int n)
+{
+ uint32_t x = (unsigned char) *(current)++; /* number being constructed */
+ while(--n)
+ x = (x << 8) | *(current)++;
+ return(x);
+}
+
+int32_t SNumRead(unsigned char* current, register int n)
+{
+ int32_t x = (signed char) *(current)++; /* number being constructed */
+ while(--n)
+ x = (x << 8) | *(current)++;
+ return(x);
+}
+
+
+/**********************************************************************/
+/****************************** Fatal *******************************/
+/**********************************************************************/
+void Fatal (const char *fmt, ...)
+{
+ va_list args;
+
+ va_start(args, fmt);
+ fflush(stdout);
+ fprintf(stderr, "\n");
+ fprintf(stderr, "%s: Fatal error, ", programname);
+ vfprintf(stderr, fmt, args);
+
+ fprintf(stderr, "\n\n");
+ va_end(args);
+
+ ClearFonts();
+#ifdef HAVE_FT2
+ if (libfreetype)
+ (void) FT_Done_FreeType(libfreetype); /* at this point, ignore error */
+#endif
+ exit(EXIT_FATAL);
+}
+
+/*-->Warning*/
+/**********************************************************************/
+/***************************** Warning ******************************/
+/**********************************************************************/
+void Warning(const char *fmt, ...)
+{
+ va_list args;
+
+ va_start(args, fmt);
+
+ if ( option_flags & BE_NONQUIET ) {
+ fflush(stdout);
+ fprintf(stderr, "%s warning: ", programname);
+ vfprintf(stderr, fmt, args);
+ fprintf(stderr, " ");
+ }
+ va_end(args);
+}
+
+/*-->Message*/
+/**********************************************************************/
+/***************************** Message ******************************/
+/**********************************************************************/
+void Message(int activeflags, const char *fmt, ...)
+{
+ va_list args;
+
+ va_start(args, fmt);
+ if ( option_flags & activeflags ) {
+ vfprintf(stdout, fmt, args);
+ }
+ va_end(args);
+}
+
+
+bool MmapFile (char *filename,struct filemmap *fmmap)
+{
+#ifndef WIN32
+ struct stat stat;
+#endif
+
+ DEBUG_PRINT(DEBUG_DVI,("\n OPEN FILE:\t'%s'", filename));
+ fmmap->data=NULL;
+#ifndef WIN32
+ if ((fmmap->fd = open(filename,O_RDONLY)) == -1) {
+ Warning("cannot open file <%s>", filename);
+ return(true);
+ }
+ fstat(fmmap->fd,&stat);
+ fmmap->size=stat.st_size;
+# ifdef HAVE_MMAP
+ fmmap->data = mmap(NULL,fmmap->size, PROT_READ, MAP_SHARED,fmmap->fd,0);
+ if (fmmap->data == (char*)-1) {
+ Warning("cannot mmap file <%s>",filename);
+ fmmap->data=NULL;
+ close(fmmap->fd);
+ return(true);
+ }
+# else /* HAVE_MMAP */
+ if ((fmmap->data = malloc(fmmap->size+1)) == NULL) {
+ Warning("cannot malloc space for <%s>",filename);
+ close(fmmap->fd);
+ return(true);
+ }
+ if (read(fmmap->fd,fmmap->data,fmmap->size)<fmmap->size) {
+ Warning("too little data in <%s>",filename);
+ free(fmmap->data);
+ fmmap->data=NULL;
+ close(fmmap->fd);
+ return(true);
+ }
+ close(fmmap->fd);
+# endif /* HAVE_MMAP */
+#else /* WIN32 */
+ fmmap->hFile = CreateFile(filename, GENERIC_READ, FILE_SHARE_READ, 0,
+ OPEN_EXISTING, FILE_FLAG_RANDOM_ACCESS, 0);
+ if (fmmap->hFile == INVALID_HANDLE_VALUE) {
+ Warning("cannot open file <%s>", filename);
+ return(true);
+ }
+ fmmap->size = GetFileSize(fmmap->hFile, 0);
+ fmmap->hMap = CreateFileMapping(fmmap->hFile, 0, PAGE_READONLY, 0, 0, 0);
+ if (fmmap->hMap == 0) {
+ CloseHandle (fmmap->hFile);
+ Warning("cannot CreateFileMapping() file <%s>", filename);
+ return(true);
+ }
+ fmmap->data = MapViewOfFile(fmmap->hMap, FILE_MAP_READ, 0, 0, 0);
+ if (fmmap->data == NULL) {
+ Warning("cannot MapViewOfFile() file <%s>", filename);
+ CloseHandle (fmmap->hMap);
+ CloseHandle (fmmap->hFile);
+ return(true);
+ }
+#endif /* WIN32 */
+ return(false);
+}
+
+void UnMmapFile(struct filemmap* fmmap)
+{
+ if (fmmap->data!=NULL) {
+#ifndef WIN32
+# ifdef HAVE_MMAP
+ if (munmap(fmmap->data,fmmap->size))
+ Warning("cannot munmap file at 0x%X",fmmap->data);
+ if (close(fmmap->fd))
+ Warning("cannot close file descriptor %d",fmmap->fd);
+# else /* HAVE_MMAP */
+ free(fmmap->data);
+# endif /* HAVE_MMAP */
+#else /* WIN32 */
+ UnmapViewOfFile (fmmap->data);
+ CloseHandle (fmmap->hMap);
+ CloseHandle (fmmap->hFile);
+#endif /* WIN32 */
+ }
+ fmmap->data=NULL;
+}
diff --git a/Build/source/texk/dvipng/dvipng-src/papersiz.c b/Build/source/texk/dvipng/dvipng-src/papersiz.c
new file mode 100644
index 00000000000..6f5e99794d2
--- /dev/null
+++ b/Build/source/texk/dvipng/dvipng-src/papersiz.c
@@ -0,0 +1,74 @@
+/* papersiz.c */
+
+/************************************************************************
+
+ Part of the dvipng distribution
+
+ This program is free software: you can redistribute it and/or modify
+ it under the terms of the GNU Lesser General Public License as
+ published by the Free Software Foundation, either version 3 of the
+ License, or (at your option) any later version.
+
+ This program is distributed in the hope that it will be useful, but
+ WITHOUT ANY WARRANTY; without even the implied warranty of
+ MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU
+ Lesser General Public License for more details.
+
+ You should have received a copy of the GNU Lesser General Public
+ License along with this program. If not, see
+ <http://www.gnu.org/licenses/>.
+
+ Copyright (C) 2002-2010 Jan-Åke Larsson
+
+************************************************************************/
+
+#include "dvipng.h"
+
+const char *lengthnames[]={ "sp", "pt", "bp",
+ "dd", "mm", "pc",
+ "cc", "cm", "in" };
+const int32_t lengthsp[]={ 1L, 65536L, 65782L,
+ 70124L, 186468L, 786432L,
+ 841489L, 1864680L, 4736286L };
+
+/*
+ * Convert a double[unit], e.g., "3.2cm" or "1.0in" into length in pixels.
+ * Advance the passed pointer as well.
+ */
+
+static int32_t myatodim(const char ** p)
+{
+ double tmp; /* double accuracy is enough, I think */
+ int i=0;
+ char *q;
+
+ tmp = strtod(*p,&q);
+ while (*q == ' ')
+ q++;
+ while (i<8 && (q[0]!=lengthnames[i][0] || q[1]!=lengthnames[i][1]))
+ i++;
+ if (i==8 && (q[0]!=lengthnames[i][0] || q[1]!=lengthnames[i][1]))
+ Warning("unrecognized length unit \"%.2s\", assuming inches",q);
+ while (*q != ',' && *q !='\0')
+ q++;
+ tmp = tmp*lengthsp[i]*dpi/4736286L; /* sp * dots/in / (sp/in), convert sp to pixels */
+ *p=q;
+ return((int32_t) tmp);
+}
+
+
+/*
+ * The routine where we handle the paper size special. We need to pass in
+ * the string after the `papersize=' specification.
+ */
+
+void handlepapersize(const char * p, int32_t * x, int32_t * y)
+{
+ while (*p == ' ')
+ p++ ;
+ *x = myatodim(&p) ;
+ while (*p == ' ' || *p == ',')
+ p++ ;
+ *y = myatodim(&p) ;
+}
+
diff --git a/Build/source/texk/dvipng/dvipng-src/pk.c b/Build/source/texk/dvipng/dvipng-src/pk.c
new file mode 100644
index 00000000000..4e0b0c0e1b1
--- /dev/null
+++ b/Build/source/texk/dvipng/dvipng-src/pk.c
@@ -0,0 +1,410 @@
+/* pk.c */
+
+/************************************************************************
+
+ Part of the dvipng distribution
+
+ This program is free software: you can redistribute it and/or modify
+ it under the terms of the GNU Lesser General Public License as
+ published by the Free Software Foundation, either version 3 of the
+ License, or (at your option) any later version.
+
+ This program is distributed in the hope that it will be useful, but
+ WITHOUT ANY WARRANTY; without even the implied warranty of
+ MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU
+ Lesser General Public License for more details.
+
+ You should have received a copy of the GNU Lesser General Public
+ License along with this program. If not, see
+ <http://www.gnu.org/licenses/>.
+
+ Copyright (C) 2002-2009, 2019 Jan-Åke Larsson
+
+************************************************************************/
+
+#include "dvipng.h"
+
+#define PK_POST 245
+#define PK_PRE 247
+#define PK_ID 89
+
+unsigned char dyn_f;
+int repeatcount;
+int poshalf;
+
+static unsigned char getnyb(unsigned char** pos)
+{
+ if (poshalf == 0) {
+ poshalf=1;
+ return(**pos / 16);
+ } else {
+ poshalf=0;
+ return(*(*pos)++ & 15);
+ }
+}
+
+static uint32_t pk_packed_num(unsigned char** pos)
+{
+ register int i;
+ uint32_t j;
+
+ i = (int)getnyb(pos);
+ if (i == 0) {
+ do {
+ j = (uint32_t)getnyb(pos);
+ i++;
+ } while (j == 0);
+ while (i > 0) {
+ j = j * 16 + (uint32_t)getnyb(pos);
+ i--;
+ };
+ return (j - 15 + (13 - dyn_f) * 16 + dyn_f);
+ } else if (i <= (int)dyn_f) {
+ return ((uint32_t)i);
+ } else if (i < 14) {
+ return ((i-(uint32_t)dyn_f - 1) * 16 + (uint32_t)getnyb(pos)
+ + dyn_f + 1);
+ } else {
+ if (i == 14) {
+ repeatcount = (int)pk_packed_num(pos);
+ } else {
+ repeatcount = 1;
+ }
+ return (pk_packed_num(pos)); /* tail end recursion !! */
+ }
+}
+
+static unsigned char* skip_specials(unsigned char* pos, unsigned char* end)
+{
+ uint32_t i;
+
+ while (pos < end && *pos >= 240 && *pos != PK_POST) {
+ i=0;
+ switch (*pos++) {
+ case 243:
+ i = *pos++;
+ case 242:
+ if (pos >= end) break;
+ i = 256 * i + *pos++;
+ case 241:
+ if (pos >= end) break;
+ i = 256 * i + *pos++;
+ case 240:
+ if (pos >= end) break;
+ i = 256 * i + *pos++;
+ DEBUG_PRINT(DEBUG_PK,("\n PK SPECIAL\t'%.*s' ",(int)i,pos));
+ pos += i;
+ break;
+ case 244:
+#ifdef DEBUG
+ {
+ uint32_t c;
+ c=UNumRead(pos,4);
+ DEBUG_PRINT(DEBUG_PK,("\n PK SPECIAL\t%d",c));
+ }
+#endif
+ pos += 4;
+ break;
+ case 245:
+ break;
+ case 246:
+ DEBUG_PRINT(DEBUG_PK,("\n PK\tNOP "));
+ break;
+ case 247: case 248: case 249: case 250:
+ case 251: case 252: case 253: case 254:
+ case 255:
+ Fatal("unexpected PK flagbyte %d", (int)*pos);
+ }
+ }
+ return(pos);
+}
+
+
+void LoadPK(int32_t c, register struct char_entry * ptr)
+{
+ unsigned short shrunk_width,shrunk_height;
+ unsigned short width,height;
+ short xoffset,yoffset;
+ unsigned short i_offset,j_offset;
+ int i,j,k,n;
+ int count=0;
+ bool paint_switch;
+ unsigned char *pos,*buffer;
+
+ DEBUG_PRINT(DEBUG_PK,("\n LOAD PK CHAR\t%d",c));
+ pos=ptr->pkdata;
+ if ((ptr->flag_byte & 7) == 7) n=4;
+ else if ((ptr->flag_byte & 4) == 4) n=2;
+ else n=1;
+ dyn_f = ptr->flag_byte / 16;
+ paint_switch = ((ptr->flag_byte & 8) != 0);
+ /*
+ * Read character preamble
+ */
+ if (n != 4) {
+ ptr->tfmw = UNumRead(pos, 3);
+ /* +n: vertical escapement not used */
+ pos+=3+n;
+ } else {
+ ptr->tfmw = UNumRead(pos, 4);
+ /* +4: horizontal escapement not used */
+ /* +n: vertical escapement not used */
+ pos+=8+n;
+ }
+ DEBUG_PRINT(DEBUG_PK,(" %d",ptr->tfmw));
+ ptr->tfmw = (dviunits)
+ ((int64_t) ptr->tfmw * currentfont->s / 0x100000 );
+ DEBUG_PRINT(DEBUG_PK,(" (%d)",ptr->tfmw));
+
+ width = UNumRead(pos, n);
+ height = UNumRead(pos+=n, n);
+ DEBUG_PRINT(DEBUG_PK,(" %dx%d",width,height));
+
+ if (width > 0x7fff || height > 0x7fff)
+ Fatal("character %d too large in file %s", c, currentfont->name);
+
+ /*
+ * Hotspot issues: Shrinking to the topleft corner rather than the
+ hotspot will displace glyphs a fraction of a pixel. We deal with
+ this in as follows: The glyph is shrunk to its hotspot by
+ offsetting the bitmap somewhat to put the hotspot in the lower
+ left corner of a "shrink square". Shrinking to the topleft corner
+ will then act as shrinking to the hotspot. This may enlarge the
+ bitmap somewhat, of course. (Also remember that the below
+ calculation of i/j_offset is in integer arithmetics.)
+
+ There will still be a displacement from rounding the dvi
+ position, but vertically it will be equal for all glyphs on a
+ line, so we displace a whole line vertically by fractions of a
+ pixel. This is acceptible, IMHO. Sometime there will be support
+ for subpixel positioning, horizontally. Will do for now, I
+ suppose.
+ */
+ xoffset = SNumRead(pos+=n, n);
+ i_offset = ( shrinkfactor - xoffset % shrinkfactor ) % shrinkfactor;
+ width += i_offset;
+ ptr->xOffset = xoffset+i_offset;
+
+ yoffset = SNumRead(pos+=n, n);
+ j_offset = ( shrinkfactor - (yoffset-(shrinkfactor-1)) % shrinkfactor )
+ % shrinkfactor;
+ height += j_offset;
+ ptr->yOffset = yoffset+j_offset;
+
+ DEBUG_PRINT(DEBUG_PK,(" (%dx%d)",width,height));
+ /*
+ Extra marginal so that we do not crop the image when shrinking.
+ */
+ shrunk_width = (width + shrinkfactor - 1) / shrinkfactor;
+ shrunk_height = (height + shrinkfactor - 1) / shrinkfactor;
+ ptr->w = shrunk_width;
+ ptr->h = shrunk_height;
+ pos+=n;
+ if ((buffer = calloc(shrunk_width*shrunk_height*
+ shrinkfactor*shrinkfactor,sizeof(char)))==NULL)
+ Fatal("cannot allocate space for pk buffer");
+ DEBUG_PRINT(DEBUG_GLYPH,("\nDRAW GLYPH %d\n", (int)c));
+ /* Raster char */
+ if (dyn_f == 14) { /* get raster by bits */
+ int bitweight = 0;
+ for (j = j_offset; j < (int) height; j++) { /* get all rows */
+ for (i = i_offset; i < (int) width; i++) { /* get one row */
+ bitweight /= 2;
+ if (bitweight == 0) {
+ count = *pos++;
+ bitweight = 128;
+ }
+ if (count & bitweight) {
+ buffer[i+j*width]=1;
+#ifdef DEBUG
+ DEBUG_PRINT(DEBUG_GLYPH,("+"));
+ } else {
+ DEBUG_PRINT(DEBUG_GLYPH,(" "));
+#endif
+ }
+ }
+ DEBUG_PRINT(DEBUG_GLYPH,("|\n"));
+ }
+ } else { /* get packed raster */
+ poshalf=0;
+ repeatcount = 0;
+ for(i=i_offset, j=j_offset; j<height; ) {
+ count = pk_packed_num(&pos);
+ while (count > 0) {
+ if (i+count < width) {
+ if (paint_switch)
+ for(k=0;k<count;k++) {
+ buffer[k+i+j*width]=1;
+ DEBUG_PRINT(DEBUG_GLYPH,("*"));
+ }
+#ifdef DEBUG
+ else for(k=0;k<count;k++)
+ DEBUG_PRINT(DEBUG_GLYPH,(" "));
+#endif
+ i += count;
+ count = 0;
+ } else {
+ if (paint_switch)
+ for(k=i;k<width;k++) {
+ buffer[k+j*width]=1;
+ DEBUG_PRINT(DEBUG_GLYPH,("#"));
+ }
+#ifdef DEBUG
+ else for(k=i;k<width;k++)
+ DEBUG_PRINT(DEBUG_GLYPH,(" "));
+#endif
+ DEBUG_PRINT(DEBUG_GLYPH,("|\n"));
+ j++;
+ count -= width-i;
+ /* Repeat row(s) */
+ for (;repeatcount>0; repeatcount--,j++) {
+ for (i = i_offset; i<width; i++) {
+ buffer[i+j*width]=buffer[i+(j-1)*width];
+#ifdef DEBUG
+ if (buffer[i+j*width]>0) {
+ DEBUG_PRINT(DEBUG_GLYPH,("="));
+ } else {
+ DEBUG_PRINT(DEBUG_GLYPH,(" "));
+ }
+#endif
+ }
+ DEBUG_PRINT(DEBUG_GLYPH,("|\n"));
+ }
+ i=i_offset;
+ }
+ }
+ paint_switch = 1 - paint_switch;
+ }
+ if (i>i_offset)
+ Fatal("wrong number of bits stored: char. %c, font %s",
+ (char)c, currentfont->name);
+ if (j>height)
+ Fatal("bad PK file %s, too many bits", currentfont->name);
+ }
+ /*
+ Shrink raster while doing antialiasing. (See above. The
+ single-glyph output seems better than what xdvi at 300 dpi,
+ shrinkfactor 3 produces.)
+ */
+ if ((ptr->data = calloc(shrunk_width*shrunk_height,sizeof(char))) == NULL)
+ Fatal("unable to malloc image space for char %c", (char)c);
+ for (j = 0; j < (int) height; j++) {
+ for (i = 0; i < (int) width; i++) {
+ /* if (((i % shrinkfactor) == 0) && ((j % shrinkfactor) == 0))
+ ptr->data[i/shrinkfactor+j/shrinkfactor*shrunk_width] =
+ buffer[i+j*width];
+ else */
+ ptr->data[i/shrinkfactor+j/shrinkfactor*shrunk_width] +=
+ buffer[i+j*width];
+ }
+ }
+ for (j = 0; j < shrunk_height; j++) {
+ for (i = 0; i < shrunk_width; i++) {
+ ptr->data[i+j*shrunk_width] = ptr->data[i+j*shrunk_width]
+ *255/shrinkfactor/shrinkfactor;
+ DEBUG_PRINT(DEBUG_GLYPH,("%3u ",ptr->data[i+j*shrunk_width]));
+ }
+ DEBUG_PRINT(DEBUG_GLYPH,("|\n"));
+ }
+ free(buffer);
+}
+
+void InitPK(struct font_entry * tfontp)
+{
+ unsigned char* position, *end;
+ struct char_entry *tcharptr; /* temporary char_entry pointer */
+ uint32_t hppp, vppp, packet_length;
+ uint32_t c;
+
+ DEBUG_PRINT((DEBUG_DVI|DEBUG_PK),("\n OPEN FONT:\t'%s'", tfontp->name));
+ Message(BE_VERBOSE,"<%s>", tfontp->name);
+ if (MmapFile(tfontp->name,&(tfontp->fmmap)))
+ Fatal("font file %s unusable", tfontp->name);
+ position=(unsigned char*)tfontp->fmmap.data;
+ if (tfontp->fmmap.size < 3 || tfontp->fmmap.size < 3+*(position+2)+16)
+ Fatal("PK file %s ends prematurely",tfontp->name);
+ if (*position++ != PK_PRE)
+ Fatal("unknown font format in file %s",tfontp->name);
+ if (*position++ != PK_ID)
+ Fatal( "wrong version %d of PK file %s (should be 89)",
+ (int)*(position-1),tfontp->name);
+ DEBUG_PRINT(DEBUG_PK,("\n PK_PRE:\t'%.*s'",(int)*position, position+1));
+ position += *position + 1;
+
+ tfontp->designsize = UNumRead(position, 4);
+ DEBUG_PRINT(DEBUG_PK,(" %d", tfontp->designsize));
+ tfontp->type = FONT_TYPE_PK;
+
+ c = UNumRead(position+4, 4);
+ DEBUG_PRINT(DEBUG_PK,(" %d", c));
+ CheckChecksum (tfontp->c, c, tfontp->name);
+
+ hppp = UNumRead(position+8, 4);
+ vppp = UNumRead(position+12, 4);
+ DEBUG_PRINT(DEBUG_PK,(" %d %d", hppp,vppp));
+ if (hppp != vppp)
+ Warning("aspect ratio is %d:%d (should be 1:1)", hppp, vppp);
+ tfontp->magnification = (uint32_t)((uint64_t)hppp * 7227 * 5 / 65536l + 50)/100;
+ position+=16;
+ /* Read char definitions */
+ end=(unsigned char *) tfontp->fmmap.data+tfontp->fmmap.size;
+ position = skip_specials(position,end);
+ while (position < end && *position != PK_POST) {
+ DEBUG_PRINT(DEBUG_PK,("\n @%ld PK CHAR:\t%d",
+ (long)((char *)position - tfontp->fmmap.data), *position));
+ if ((tcharptr = malloc(sizeof(struct char_entry))) == NULL)
+ Fatal("cannot allocate space for char_entry");
+ tcharptr->flag_byte = *position;
+ tcharptr->data = NULL;
+ tcharptr->tfmw = 0;
+ if ((*position & 7) == 7) {
+ if (position >= end - 9) Fatal("PK file %s ends prematurely",tfontp->name);
+ packet_length = UNumRead(position+1,4);
+ c = UNumRead(position+5, 4);
+ position += 9;
+ } else if (*position & 4) {
+ if (position >= end - 4) Fatal("PK file %s ends prematurely",tfontp->name);
+ packet_length = (*position & 3) * 65536l + UNumRead(position+1, 2);
+ c = UNumRead(position+3, 1);
+ position += 4;
+ } else {
+ if (position >= end - 3) Fatal("PK file %s ends prematurely",tfontp->name);
+ packet_length = (*position & 3) * 256 + UNumRead(position+1, 1);
+ c = UNumRead(position+2, 1);
+ position += 3;
+ }
+ DEBUG_PRINT(DEBUG_PK,(" %d %d",packet_length,c));
+ if (c > (LASTFNTCHAR))
+ Fatal("PK font %s exceeds char numbering limit",tfontp->name);
+ tcharptr->length = packet_length;
+ tcharptr->pkdata = position;
+ tfontp->chr[c]=tcharptr;
+ position += packet_length;
+ position = skip_specials(position, end);
+ }
+ if (position >= end) Fatal("PK file %s ends prematurely",tfontp->name);
+}
+
+static void UnLoadPK(struct char_entry *ptr)
+{
+ if (ptr->data!=NULL)
+ free(ptr->data);
+ ptr->data=NULL;
+}
+
+void DonePK(struct font_entry *tfontp)
+{
+ int c=FIRSTFNTCHAR;
+
+ UnMmapFile(&(tfontp->fmmap));
+ while(c<=LASTFNTCHAR) {
+ if (tfontp->chr[c]!=NULL) {
+ UnLoadPK((struct char_entry*)tfontp->chr[c]);
+ free(tfontp->chr[c]);
+ }
+ c++;
+ }
+ if (tfontp->name!=NULL)
+ free(tfontp->name);
+ tfontp->name=NULL;
+}
diff --git a/Build/source/texk/dvipng/dvipng-src/ppagelist.c b/Build/source/texk/dvipng/dvipng-src/ppagelist.c
new file mode 100644
index 00000000000..b7467a98539
--- /dev/null
+++ b/Build/source/texk/dvipng/dvipng-src/ppagelist.c
@@ -0,0 +1,189 @@
+/* ppagelist.c */
+
+/************************************************************************
+
+ Part of the dvipng distribution
+
+ This program is free software: you can redistribute it and/or modify
+ it under the terms of the GNU Lesser General Public License as
+ published by the Free Software Foundation, either version 3 of the
+ License, or (at your option) any later version.
+
+ This program is distributed in the hope that it will be useful, but
+ WITHOUT ANY WARRANTY; without even the implied warranty of
+ MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU
+ Lesser General Public License for more details.
+
+ You should have received a copy of the GNU Lesser General Public
+ License along with this program. If not, see
+ <http://www.gnu.org/licenses/>.
+
+ Copyright (C) 2002-2010 Jan-Åke Larsson
+
+************************************************************************/
+
+#include "dvipng.h"
+
+/* Some code at the end of this file is adapted from dvips */
+
+static int32_t first=PAGE_FIRSTPAGE, last=PAGE_LASTPAGE;
+static bool abspage=false, reverse=false;
+bool no_ppage=true;
+
+/* dvips' behaviour:
+ * -pp outputs _all_ pages with the correct numbers,
+ * -p, -l outputs from the first occurrence of firstpage to the first
+ * occurrence of lastpage. Using '=' means absolute pagenumbers
+ */
+
+void FirstPage(int32_t page, bool data)
+{
+ first=page;
+ abspage |= data;
+}
+void LastPage(int32_t page,bool data)
+{
+ last=page;
+ abspage |= data;
+}
+void Reverse(bool new)
+{
+ reverse=new;
+}
+/*-->NextPPage*/
+/**********************************************************************/
+/**************************** NextPPage *****************************/
+/**********************************************************************/
+/* Return the page in turn on our queue */
+/* (Implicitly, PAGE_POST is never in the pagelist) */
+bool InPageList(int32_t i);
+
+struct page_list* NextPPage(void* dvi, struct page_list* page)
+{
+ if (! reverse) { /*********** normal order */
+ if (page == NULL) { /* first call: find first page */
+ if (no_ppage)
+ return(NULL);
+ page=FindPage(dvi,first,abspage);
+ } else /* later calls: count up, except "last" page */
+ page=(last==page->count[abspage ? 0 : 10]) ? NULL : NextPage(dvi,page);
+ /* seek for pages in pagelist */
+ while (page!=NULL && ! InPageList(page->count[0]))
+ page=(last==page->count[abspage ? 0 : 10]) ? NULL : NextPage(dvi,page);
+ } else { /******************** reverse order */
+ if (page == NULL) { /* first call: find "last" page */
+ if (no_ppage)
+ return(NULL);
+ page=FindPage(dvi,last,abspage);
+ } else /* later calls: count down, except "first" page */
+ page=(first==page->count[abspage ? 0 : 10]) ? NULL : PrevPage(dvi,page);
+ /* seek for pages in pagelist */
+ while (page!=NULL && ! InPageList(page->count[0]))
+ page=(first==page->count[abspage ? 0 : 10]) ? NULL : PrevPage(dvi,page);
+ }
+ return(page);
+}
+
+struct pp_list {
+ struct pp_list *next; /* next in a series of alternates */
+ int32_t ps_low, ps_high; /* allowed range */
+} *ppages = 0; /* the list of allowed pages */
+
+/*-->InPageList*/
+/**********************************************************************/
+/****************************** InPageList **************************/
+/**********************************************************************/
+/* Return true iff i is one of the desired output pages */
+
+bool InPageList(int32_t i)
+{
+ register struct pp_list *pl = ppages;
+
+ while (pl) {
+ if ( i >= pl -> ps_low && i <= pl -> ps_high)
+ return(true); /* success */
+ pl = pl -> next;
+ }
+ return(false);
+}
+
+static void ListPage(int32_t pslow, int32_t pshigh)
+{
+ register struct pp_list *pl;
+
+ /* Some added code, we want to reuse the list */
+ no_ppage=false;
+ pl = ppages;
+ while (pl != NULL && pl->ps_low <= pl->ps_high)
+ pl = pl->next;
+ if (pl == NULL) {
+ if ((pl = (struct pp_list *)malloc(sizeof(struct pp_list)))
+ ==NULL)
+ Fatal("cannot malloc memory for page queue");
+ pl -> next = ppages;
+ ppages = pl;
+ }
+ pl -> ps_low = pslow;
+ pl -> ps_high = pshigh;
+}
+
+/* Parse a string representing a list of pages. Return 0 iff ok. As a
+ side effect, the page selection(s) is (are) prepended to ppages. */
+
+bool ParsePages(const char *s)
+{
+ const char *c; /* conversion start */
+ char *t;
+ long int ps_low = PAGE_MINPAGE, ps_high = PAGE_MAXPAGE;
+
+ while (*s==' ' || *s=='\t') s++;
+ while (*s!='\0') {
+ if (*s=='-' || *s==':') { /* range with no starting value */
+ ps_low = PAGE_MINPAGE;
+ c=s+1;
+ ps_high = strtol(c,&t,10);
+ s = t;
+ if (c==s) ps_high=PAGE_MAXPAGE; /* no number */
+ while (*s==' ' || *s=='\t') s++;
+ if (*s=='-' || *s==':') { /* Oh, range with negative starting value */
+ ps_low = -ps_high;
+ c=s+1;
+ ps_high = strtol(c,&t,10);
+ s = t;
+ if (c==s) ps_high=PAGE_MAXPAGE; /* no number */
+ }
+ } else { /* range with starting value, or singleton */
+ c=s;
+ ps_low = ps_high = strtol(c,&t,10);
+ s = t;
+ if (c==s)
+ return(true);
+ if (*s=='-' || *s==':') { /* range */
+ c=s+1;
+ ps_high = strtol(c,&t,10);
+ s = t;
+ if (c==s) ps_high=PAGE_MAXPAGE; /* no number */
+ }
+ }
+ ListPage(ps_low, ps_high);
+ while (*s==' ' || *s=='\t' || *s==',') s++;
+ }
+ return(false);
+}
+
+/* Addition, we want to be able to clear the pplist */
+void ClearPpList(void)
+{
+ register struct pp_list *pl = ppages;
+
+ while (pl) {
+ ppages=ppages->next;
+ free(pl);
+ pl = ppages;
+ }
+ first=PAGE_FIRSTPAGE;
+ last=PAGE_LASTPAGE;
+ abspage = false;
+ no_ppage=true;
+}
+
diff --git a/Build/source/texk/dvipng/dvipng-src/readme.texi b/Build/source/texk/dvipng/dvipng-src/readme.texi
new file mode 100644
index 00000000000..32faa64c02b
--- /dev/null
+++ b/Build/source/texk/dvipng/dvipng-src/readme.texi
@@ -0,0 +1,158 @@
+@c readme.texi
+@c
+@c Part of the dvipng distribution
+
+@ifclear man
+@include macros.texi
+@ifset rawfile
+@chapter dvipng
+
+@end ifset
+@end ifclear
+@c -----------------------
+
+This program makes PNG and/or GIF graphics from DVI files as obtained
+from @TeX{} and its relatives.
+
+If GIF support is enabled, GIF output is chosen by using the
+@samp{dvigif} binary or with the @samp{--gif} option.
+
+@ifclear man
+
+It is intended to produce anti-aliased screen-resolution images as fast
+as is possible. The target audience is people who need to generate and
+regenerate many images again and again. The primary target is the
+@previewlatex{} (X)Emacs package, a package to preview formulas from
+within (X)Emacs. Yes, you get to see your formulas in the (X)Emacs
+buffer, see @url{http://www.gnu.org/software/auctex/preview-latex.html}.
+
+Another example is WeBWorK, an internet-based method for delivering
+homework problems to students over the internet, giving students
+instant feedback as to whether or not their answers are correct, see
+@url{http://webwork.math.rochester.edu}.
+
+A more recent addition to the dvipng-using applications out there is
+MediaWiki, the software behind Wikipedia and many other wikis out
+there. Dvipng is used to render mathematical formulae from version
+1.8.0 of MediaWiki, see @url{http://www.mediawiki.org}.
+
+Other applications may also benefit, like web applications as latex2html
+and WYSIWYG editors like LyX.
+
+@ifset rawfile
+@section Benefits of dvipng
+@end ifset
+@end ifclear
+
+The benefits of @samp{dvipng}/@samp{dvigif} include
+
+@itemize @bullet
+@item
+Speed. It is a very fast bitmap-rendering code for DVI files, which
+makes it suitable for generating large amounts of images on-the-fly,
+as needed in @previewlatex{}, WeBWorK and others.
+
+@item
+It does not read the postamble, so it can be started before @TeX{}
+finishes. There is a @samp{--follow} switch that makes dvipng wait at
+end-of-file for further output, unless it finds the POST marker that
+indicates the end of the DVI.
+
+@item
+Interactive query of options. dvipng can read options interactively
+through stdin, and all options are usable. It is even possible to change
+the input file through this interface.
+
+@item
+Supports PK, VF, PostScript Type1, and TrueType fonts, subfonts (i.e.,
+as used in CJK-@LaTeX{}), color specials, and inclusion of PostScript,
+PNG, JPEG or GIF images.
+
+@item
+and more...
+
+@end itemize
+
+@ifset rawfile
+@section Installation
+
+Read @file{INSTALL}, included in the distribution.
+
+@section Usage
+
+To use dvipng at its simplest, simply type
+
+@example
+dvipng foo
+@end example
+
+@noindent
+where @file{foo.dvi} is the output of @TeX{} that you want to convert to
+PNG format. If there are four pages in @file{foo.dvi}, those pages will
+be output as @file{foo1.png}, @file{foo2.png}, @file{foo3.png}, and
+@file{foo4.png}, respectively.
+
+Many options are available (see the info manual). For a brief summary
+of available options, just type
+
+@example
+dvipng --help
+@end example
+
+@section Availability
+
+The dvipng package is available at Savannah, the GNU project site. Since
+dvipng is not part of the GNU project, although released under the GNU
+GPL, the web address is
+@url{http://savannah.nongnu.org/projects/dvipng}. Instructions for
+anonymous CVS access can be found at
+@url{http://savannah.nongnu.org/cvs/?group=dvipng}.
+
+@section Contacts
+
+Bug reports should be sent to @email{dvipng@@nongnu.org}.
+
+Questions, suggestions for new features, pleas for help, and/or praise
+should go to @email{dvipng@@nongnu.org}. For more information on this
+mailing list, send a message with just the word `help' as subject or
+body to @email{dvipng-request@@nongnu.org} or look at
+@url{http://lists.nongnu.org/mailman/listinfo/dvipng}.
+
+Offers to support further development will be appreciated. For developer
+access, ask on @email{dvipng@@nongnu.org}.
+
+@section Copying
+
+This program is released under the GNU Lesser General Public License
+version 3, see the COPYING file in the dvipng distribution or
+@url{http://www.gnu.org/licenses/}.
+
+Copyright @copyright{} 2002-2014 Jan-@AA{}ke Larsson
+
+@section Todo
+
+@itemize @bullet
+@item
+Use gs interpreter library for speed and possibly for functionality.
+
+@item
+Add more color models for xcolor compatibility
+
+@item
+Enable a named pipe as DVI
+
+@item
+Further speed improvements.
+
+@item
+Other output specials and source specials.
+
+@item
+Clean internal structures. Overhaul file handling.
+
+@item
+Fix the SELFAUTO stuff at runtime rather than at build time
+@end itemize
+
+
+@end ifset
diff --git a/Build/source/texk/dvipng/dvipng-src/set.c b/Build/source/texk/dvipng/dvipng-src/set.c
new file mode 100644
index 00000000000..9f3ce99b05a
--- /dev/null
+++ b/Build/source/texk/dvipng/dvipng-src/set.c
@@ -0,0 +1,292 @@
+/* set.c */
+
+/************************************************************************
+
+ Part of the dvipng distribution
+
+ This program is free software: you can redistribute it and/or modify
+ it under the terms of the GNU Lesser General Public License as
+ published by the Free Software Foundation, either version 3 of the
+ License, or (at your option) any later version.
+
+ This program is distributed in the hope that it will be useful, but
+ WITHOUT ANY WARRANTY; without even the implied warranty of
+ MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU
+ Lesser General Public License for more details.
+
+ You should have received a copy of the GNU Lesser General Public
+ License along with this program. If not, see
+ <http://www.gnu.org/licenses/>.
+
+ Copyright (C) 2002-2015 Jan-Åke Larsson
+
+************************************************************************/
+
+#include "dvipng.h"
+#include <math.h>
+
+#ifndef HAVE_GDIMAGECREATETRUECOLOR
+#define gdImageColorAllocateAlpha(i,r,g,b,a) gdImageColorAllocate(i,r,g,b)
+#define gdImageColorResolveAlpha(i,r,g,b,a) gdImageColorResolve(i,r,g,b)
+#define gdImageAlpha(i,c) 0
+#define gdAlphaMax 127
+#endif
+#ifndef HAVE_GDIMAGEPNGEX
+#define gdImagePngEx(i,f,z) gdImagePng(i,f)
+#endif
+
+/* Persistent color cache. Index is ink thickness,
+ 0=no ink, 127=total coverage */
+static int ColorCache[gdAlphaMax+1];
+
+void CreateImage(pixels x_width,pixels y_width)
+{
+ if (page_imagep)
+ gdImageDestroy(page_imagep);
+ if (x_width <= 0) x_width=1;
+ if (y_width <= 0) y_width=1;
+#ifdef HAVE_GDIMAGECREATETRUECOLOR
+ /* GIFs are 256-color */
+ if ((option_flags & FORCE_TRUECOLOR
+ || page_flags & PAGE_TRUECOLOR)
+ && ~option_flags & GIF_OUTPUT
+ && ~option_flags & FORCE_PALETTE)
+ page_imagep=gdImageCreateTrueColor(x_width,y_width);
+ else
+#endif
+ page_imagep=gdImageCreate(x_width,y_width);
+ /* Set bg color. GIFs cannot handle an alpha channel, resort to
+ transparent color index, set in WriteImage */
+ if (!page_imagep)
+ Fatal("cannot allocate GD image for DVI");
+ ColorCache[0]
+ = gdImageColorAllocateAlpha(page_imagep,
+ cstack[0].red,
+ cstack[0].green,
+ cstack[0].blue,
+ (option_flags & BG_TRANSPARENT_ALPHA
+ && ~option_flags & GIF_OUTPUT) ? 127 : 0);
+ ColorCache[gdAlphaMax]=-1;
+#ifdef HAVE_GDIMAGECREATETRUECOLOR
+ /* Alpha blending in libgd is only performed for truecolor images.
+ We need it for palette images also. Turn libgd alpha blending off
+ and calculate color blending where needed. We turn it back on
+ briefly for image inclusion. */
+ gdImageAlphaBlending(page_imagep, 0);
+ if (option_flags & BG_TRANSPARENT_ALPHA)
+ gdImageSaveAlpha(page_imagep, 1);
+ if (page_imagep->trueColor)
+ /* Truecolor: there is no background color index, fill image instead. */
+ gdImageFilledRectangle(page_imagep, 0, 0,
+ x_width-1, y_width-1, ColorCache[0]);
+#endif
+}
+
+
+static void ChangeColor(gdImagePtr imagep,int x1,int y1,
+ int x2,int y2,int color1,int color2)
+/* In the given rectangle, change color1 to color2 */
+{
+ int x,y;
+ for( y=y1; y<=y2; y++) {
+ for( x=x1; x<=x2; x++) {
+ if (gdImageGetPixel(imagep, x, y)==color1)
+ gdImageSetPixel(imagep, x, y, color2);
+ }
+ }
+}
+
+void WriteImage(char *pngname, int pagenum)
+{
+ char* pos, *freeme=NULL;
+ FILE* outfp=NULL;
+
+ /* Set transparent background. Maybe alpha is not available or
+ perhaps we are producing GIFs, so test for BG_TRANSPARENT_ALPHA
+ too */
+ if (option_flags & (BG_TRANSPARENT|BG_TRANSPARENT_ALPHA))
+ gdImageColorTransparent(page_imagep,ColorCache[0]);
+ /* Transparent border */
+ if (borderwidth>0) {
+ int Transparent;
+ pixels x_width,y_width;
+
+ x_width=gdImageSX(page_imagep);
+ y_width=gdImageSY(page_imagep);
+
+ /* Set ANOTHER bg color, transparent this time */
+ /* No semi-transparency here, given the motivation for this code
+ * (box cursor visibility in Emacs) */
+ if (userbordercolor)
+ Transparent = gdImageColorAllocate(page_imagep,
+ bordercolor.red,
+ bordercolor.green,
+ bordercolor.blue);
+ else
+ Transparent = gdImageColorAllocate(page_imagep,
+ gdImageRed(page_imagep,ColorCache[0]),
+ gdImageGreen(page_imagep,ColorCache[0]),
+ gdImageBlue(page_imagep,ColorCache[0]));
+ gdImageColorTransparent(page_imagep,Transparent);
+ ChangeColor(page_imagep,0,0,x_width-1,borderwidth-1,
+ ColorCache[0],Transparent);
+ ChangeColor(page_imagep,0,0,borderwidth-1,y_width-1,
+ ColorCache[0],Transparent);
+ ChangeColor(page_imagep,x_width-borderwidth,0,x_width-1,y_width-1,
+ ColorCache[0],Transparent);
+ ChangeColor(page_imagep,0,y_width-borderwidth,x_width-1,y_width-1,
+ ColorCache[0],Transparent);
+ }
+
+ if ((pos=strchr(pngname,'%')) != NULL) {
+ if (strchr(++pos,'%'))
+ Fatal("too many %%s in output file name");
+ if (*pos == 'd'
+ || (*pos=='0' && pos[1]>='1' && pos[1]<='9' && pos[2]=='d')) {
+ /* %d -> pagenumber, so add 9 string positions
+ since pagenumber max +-2^31 or +-2*10^9 */
+ if ((freeme = malloc(strlen(pngname)+9))==NULL)
+ Fatal("cannot allocate memory for output file name");
+ sprintf(freeme,pngname,pagenum);
+ pngname = freeme;
+ } else {
+ Fatal("unacceptible format spec in output file name");
+ }
+ }
+#ifdef HAVE_GDIMAGEGIF
+ if (option_flags & GIF_OUTPUT && (pos=strrchr(pngname,'.')) != NULL
+ && strcmp(pos,".png")==0) {
+ *(pos+1)='g';
+ *(pos+2)='i';
+ *(pos+3)='f';
+ }
+#endif
+ if ((outfp = fopen(pngname,"wb")) == NULL)
+ Fatal("cannot open output file %s",pngname);
+#ifdef HAVE_GDIMAGEGIF
+ if (option_flags & GIF_OUTPUT)
+ gdImageGif(page_imagep,outfp);
+ else
+#endif
+ gdImagePngEx(page_imagep,outfp,compression);
+ fclose(outfp);
+ DEBUG_PRINT(DEBUG_DVI,("\n WROTE: \t%s\n",pngname));
+ if (freeme)
+ free(freeme);
+ DestroyImage();
+}
+
+void DestroyImage(void)
+{
+ gdImageDestroy(page_imagep);
+ page_imagep=NULL;
+}
+
+static int gammatable[]=
+ {0,1,2,3,4,5,6,7,8,9,10,11,12,13,14,15,16,17,18,19,
+ 20,21,22,23,24,25,26,27,28,29,30,31,32,33,34,35,36,37,38,39,
+ 40,41,42,43,44,45,46,47,48,49,50,51,52,53,54,55,56,57,58,59,
+ 60,61,62,63,64,65,66,67,68,69,70,71,72,73,74,75,76,77,78,79,
+ 80,81,82,83,84,85,86,87,88,89,90,91,92,93,94,95,96,97,98,99,
+ 100,101,102,103,104,105,106,107,108,109,
+ 110,111,112,113,114,115,116,117,118,119,
+ 120,121,122,123,124,125,126,127};
+
+void Gamma(double gamma)
+{
+ int i=0;
+
+ while (i<=gdAlphaMax) {
+ gammatable[i]=gdAlphaMax-
+ (int)(pow((gdAlphaMax-i)/((double)gdAlphaMax),gamma)*gdAlphaMax);
+ DEBUG_PRINT(DEBUG_GLYPH,
+ ("\n GAMMA GREYSCALE: %d -> %d ",i,gammatable[i]));
+ i++;
+ }
+}
+
+dviunits SetGlyph(struct char_entry *ptr, int32_t hh,int32_t vv)
+/* gdImageChar can only do monochrome glyphs */
+{
+ int dst_alpha,dst_weight,tot_weight,alpha;
+ int x,y,pos=0;
+ int bgColor,pixelgrey,pixelcolor;
+
+ hh -= ptr->xOffset/shrinkfactor;
+ vv -= ptr->yOffset/shrinkfactor;
+ /* Initialize persistent color cache. Perhaps this should be in
+ color.c? */
+ pixelcolor=gdImageColorResolve(page_imagep,
+ cstack[csp].red,
+ cstack[csp].green,
+ cstack[csp].blue);
+ if (ColorCache[gdAlphaMax]!=pixelcolor) {
+ for( x=1; x<gdAlphaMax; x++ )
+ ColorCache[x]=-1;
+ ColorCache[gdAlphaMax]=pixelcolor;
+ }
+ for( y=0; y<ptr->h; y++) {
+ for( x=0; x<ptr->w; x++) {
+ if (ptr->data[pos]>0) {
+ pixelgrey=gammatable[(int)ptr->data[pos]/2];
+ bgColor = gdImageGetPixel(page_imagep, hh + x, vv + y);
+ if (ColorCache[0]!=bgColor || ColorCache[pixelgrey]==-1) {
+ DEBUG_PRINT(DEBUG_GLYPH,("\n GAMMA GREYSCALE: %d -> %d ",
+ ptr->data[pos]/2,pixelgrey));
+ alpha = gdAlphaMax-pixelgrey;
+ dst_alpha = gdImageAlpha(page_imagep,bgColor);
+ dst_weight = (gdAlphaMax - dst_alpha) * alpha / gdAlphaMax;
+ tot_weight = pixelgrey + dst_weight;
+ pixelcolor = gdImageColorResolveAlpha(page_imagep,
+ (cstack[csp].red*pixelgrey
+ + gdImageRed(page_imagep,bgColor)*dst_weight)/tot_weight,
+ (cstack[csp].green*pixelgrey
+ + gdImageGreen(page_imagep,bgColor)*dst_weight)/tot_weight,
+ (cstack[csp].blue*pixelgrey
+ + gdImageBlue(page_imagep,bgColor)*dst_weight)/tot_weight,
+ alpha*dst_alpha/gdAlphaMax);
+ if (ColorCache[0]==bgColor)
+ ColorCache[pixelgrey]=pixelcolor;
+ } else
+ pixelcolor=ColorCache[pixelgrey];
+ gdImageSetPixel(page_imagep, hh + x, vv + y, pixelcolor);
+ }
+ pos++;
+ }
+ }
+ return(ptr->tfmw);
+}
+
+dviunits SetRule(dviunits a, dviunits b, subpixels hh,subpixels vv)
+{
+ /* This routine will draw a \rule */
+ int Color;
+ pixels width=0, height=0;
+
+ if ( a > 0 && b > 0 ) {
+ /* Calculate width and height, round up */
+ width = (b+dvi->conv*shrinkfactor-1)/dvi->conv/shrinkfactor;
+ height = (a+dvi->conv*shrinkfactor-1)/dvi->conv/shrinkfactor;
+ }
+ if (page_imagep != NULL) {
+ if ((height>0) && (width>0)) {
+ /* This code produces too dark rules. But what the hell. Grey
+ * rules look fuzzy. */
+ Color = gdImageColorResolve(page_imagep,
+ cstack[csp].red,
+ cstack[csp].green,
+ cstack[csp].blue);
+ /* +1 and -1 are because the Rectangle coords include last pixels */
+ gdImageFilledRectangle(page_imagep,hh,vv-height+1,hh+width-1,vv,Color);
+ DEBUG_PRINT(DEBUG_DVI,("\n RULE \t%dx%d at (%d,%d)",
+ width, height, hh, vv));
+ }
+ } else {
+ /* The +1's are because things are cut _at_that_coordinate_. */
+ min(x_min,hh);
+ min(y_min,vv-height+1);
+ max(x_max,hh+width);
+ max(y_max,vv+1);
+ }
+ return(b);
+}
diff --git a/Build/source/texk/dvipng/dvipng-src/sfd.c b/Build/source/texk/dvipng/dvipng-src/sfd.c
new file mode 100644
index 00000000000..5c059e9add9
--- /dev/null
+++ b/Build/source/texk/dvipng/dvipng-src/sfd.c
@@ -0,0 +1,180 @@
+/* sfd.c */
+
+/************************************************************************
+
+ Part of the dvipng distribution
+
+ This program is free software: you can redistribute it and/or modify
+ it under the terms of the GNU Lesser General Public License as
+ published by the Free Software Foundation, either version 3 of the
+ License, or (at your option) any later version.
+
+ This program is distributed in the hope that it will be useful, but
+ WITHOUT ANY WARRANTY; without even the implied warranty of
+ MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU
+ Lesser General Public License for more details.
+
+ You should have received a copy of the GNU Lesser General Public
+ License along with this program. If not, see
+ <http://www.gnu.org/licenses/>.
+
+ Copyright (C) 2002-2008 Jan-Åke Larsson
+
+************************************************************************/
+
+#include "dvipng.h"
+struct subfont* subfontp=NULL;
+
+static struct subfont* ReadSubfont(char* sfdname, char *infix)
+{
+ char *pos,*max,*sfdfile=NULL;
+ struct subfont* sfdp=NULL;
+ struct filemmap fmmap;
+ boolean mmapfailed;
+
+ /* OK, find subfont and look for correct infix */
+#ifdef HAVE_KPSE_ENC_FORMATS
+ sfdfile=kpse_find_file(sfdname,kpse_sfd_format,false);
+#endif
+ if (sfdfile == NULL) {
+ Warning("subfont file %s could not be found",sfdname);
+ return(NULL);
+ }
+ DEBUG_PRINT((DEBUG_FT|DEBUG_ENC),("\n OPEN SUBFONT:\t'%s'", sfdfile));
+ mmapfailed = MmapFile(sfdfile,&fmmap);
+ free(sfdfile);
+ if (mmapfailed)
+ return(NULL);
+ pos=fmmap.data;
+ max=fmmap.data+fmmap.size;
+ while(pos<max && (*pos==' ' || *pos=='\r' || *pos=='\n' || *pos=='\t')) pos++;
+ while (pos<max && *pos=='#') {
+ while(pos<max && *pos!='\r' && *pos!='\n') pos++;
+ while(pos<max && (*pos==' ' || *pos=='\r' || *pos=='\n' || *pos=='\t')) pos++;
+ }
+ while(pos+strlen(infix)<max
+ && (strncmp(pos,infix,strlen(infix))!=0
+ || (pos[strlen(infix)]!=' ' && pos[strlen(infix)]!='\t'))) {
+ /* skip lines, taking line continuation into account */
+ while(pos+1<max && (*(pos+1)!='\r' || *(pos+1)!='\n' || *pos=='\\'))
+ pos++;
+ pos++;
+ while(pos<max && (*pos==' ' || *pos=='\r' || *pos=='\n' || *pos=='\t')) pos++;
+ while (pos<max && *pos=='#') {
+ while(pos<max && *pos!='\r' && *pos!='\n') pos++;
+ while(pos<max && (*pos==' ' || *pos=='\r' || *pos=='\n' || *pos=='\t')) pos++;
+ }
+ }
+ pos=pos+strlen(infix);
+ if (pos<max) {
+ int number,range,codepoint=0;
+
+ if ((sfdp = calloc(sizeof(struct subfont)+strlen(sfdname)+1
+ +strlen(infix)+1,1))==NULL) {
+ Warning("cannot allocate memory for subfont",sfdname);
+ UnMmapFile(&fmmap);
+ return(NULL);
+ }
+ sfdp->name=(char*)sfdp+sizeof(struct subfont);
+ strcpy(sfdp->name,sfdname);
+ sfdp->infix=(char*)sfdp+sizeof(struct subfont)+strlen(sfdname)+1;
+ strcpy(sfdp->infix,infix);
+ sfdp->encoding=FT_ENCODING_UNICODE;
+ while (pos<max && *pos != '\r' && *pos != '\n') {
+ number=strtol(pos,&pos,0);
+ while(pos<max && (*pos==' ' || *pos=='\t')) pos++;
+ switch(*pos) {
+ case ':':
+ codepoint=number;
+ pos++;
+ break;
+ case '_':
+ range=strtol(pos+1,&pos,0);
+ while(codepoint<256 && number<range) {
+ sfdp->charindex[codepoint]=number;
+ DEBUG_PRINT(DEBUG_ENC,("\n SUBFONT MAP %d %d",codepoint,number));
+ number++;
+ codepoint++;
+ }
+ default:
+ if (codepoint<256)
+ sfdp->charindex[codepoint]=number;
+ DEBUG_PRINT(DEBUG_ENC,("\n SUBFONT MAP %d %d",codepoint,number));
+ }
+ while(pos<max && (*pos==' ' || *pos=='\t')) pos++;
+ /* take line continuation into account */
+ while(pos+1<max && *pos=='\\' && (*(pos+1)=='\r' || *(pos+1)=='\n')) {
+ if (pos+2<max && *(pos+1)=='\r' && *(pos+2)=='\n') pos++;
+ pos+=2;
+ while(pos<max && (*pos==' ' || *pos=='\t')) pos++;
+ }
+ }
+ }
+ return (sfdp);
+}
+
+struct psfontmap* FindSubFont(struct psfontmap* entry, char* fontname)
+{
+ struct subfont *temp=subfontp;
+ char *sfdspec=entry->tfmname,*sfdwant=fontname,
+ *sfdname,*infix,*postfix;
+
+ while (*sfdspec!='\0' && *sfdspec==*sfdwant) {
+ sfdspec++;
+ sfdwant++;
+ }
+ /* Find delimiter */
+ if (*sfdspec!='@')
+ return(NULL);
+ sfdspec++;
+ postfix=sfdspec;
+ while (*postfix!='\0' && *postfix!='@')
+ postfix++;
+ if (*postfix!='@')
+ return(NULL);
+ /* Extract subfont name */
+ if ((sfdname=malloc(postfix-sfdspec+1))==NULL)
+ Fatal("cannot allocate memory for subfont name");
+ strncpy(sfdname,sfdspec,postfix-sfdspec);
+ sfdname[postfix-sfdspec]='\0';
+ /* Check postfix */
+ postfix++;
+ if (strcmp(sfdwant+strlen(sfdwant)-strlen(postfix),postfix)!=0)
+ return(NULL);
+ /* Extract infix */
+ if ((infix=malloc(strlen(sfdwant)-strlen(postfix)+1))==NULL)
+ Fatal("cannot allocate memory for subfont infix");
+ strncpy(infix,sfdwant,strlen(sfdwant)-strlen(postfix));
+ infix[strlen(sfdwant)-strlen(postfix)]='\0';
+ DEBUG_PRINT(DEBUG_ENC,("\n SUBFONT %s %s %s",fontname,sfdname,infix));
+ /* Find subfont */
+ while(temp!=NULL
+ && (strcmp(sfdname,temp->name)!=0 || strcmp(infix,temp->infix)!=0))
+ temp=temp->next;
+ if (temp==NULL) {
+ temp=ReadSubfont(sfdname,infix);
+ if (temp!=NULL) {
+ temp->next=subfontp;
+ subfontp=temp;
+ }
+ }
+ entry=NewPSFont(entry);
+ if (entry!=NULL) {
+ entry->tfmname=copyword(fontname);
+ entry->subfont=temp;
+ }
+ free(infix);
+ free(sfdname);
+ return(entry);
+}
+
+void ClearSubfont(void)
+{
+ struct subfont *temp=subfontp;
+
+ while(temp!=NULL) {
+ subfontp=subfontp->next;
+ free(temp);
+ temp=subfontp;
+ }
+}
diff --git a/Build/source/texk/dvipng/dvipng-src/special.c b/Build/source/texk/dvipng/dvipng-src/special.c
new file mode 100644
index 00000000000..544bbabd307
--- /dev/null
+++ b/Build/source/texk/dvipng/dvipng-src/special.c
@@ -0,0 +1,895 @@
+/* special.c */
+
+/************************************************************************
+
+ Part of the dvipng distribution
+
+ This program is free software: you can redistribute it and/or modify
+ it under the terms of the GNU Lesser General Public License as
+ published by the Free Software Foundation, either version 3 of the
+ License, or (at your option) any later version.
+
+ This program is distributed in the hope that it will be useful, but
+ WITHOUT ANY WARRANTY; without even the implied warranty of
+ MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU
+ Lesser General Public License for more details.
+
+ You should have received a copy of the GNU Lesser General Public
+ License along with this program. If not, see
+ <http://www.gnu.org/licenses/>.
+
+ Copyright (C) 2002-2015 Jan-Åke Larsson
+
+************************************************************************/
+
+#include "dvipng.h"
+
+#ifndef MIKTEX
+#ifndef WIN32
+#include <sys/wait.h>
+#else /* WIN32 */
+#include <fcntl.h>
+#include <io.h>
+#include <process.h>
+#ifndef pipe
+#define pipe(p) _pipe(p, 65536, O_BINARY | _O_NOINHERIT)
+#endif
+#ifndef snprintf
+#define snprintf _snprintf
+#endif
+#endif /* WIN32 */
+#endif
+
+#define SKIPSPACES(s) while(s && *s==' ' && *s!='\0') s++
+
+/* PostScript can come as a string (headers and raw specials) or
+ a memory-mapped file (headers and included EPS figures). */
+
+struct pscode {
+ struct pscode* next;
+ char* special; /* complete special */
+ const char* code; /* PS string, null if a file */
+ char* filename; /* file name, null if a string */
+ const char* postcode; /* post PS string */
+ struct filemmap fmmap; /* file mmap */
+};
+
+struct pscode* psheaderp=NULL; /* static, DVI-specific header list */
+
+static void PSCodeInit(struct pscode *entry, char *special)
+{
+ entry->next=NULL;
+ entry->special=special;
+ entry->code=NULL;
+ entry->filename=NULL;
+ entry->postcode=NULL;
+ entry->fmmap.data=NULL;
+ if (special==NULL)
+ return;
+ if (strncmp(special,"header=",7)==0)
+ entry->filename=special+7;
+ else if (strncmp(special,"ps:: plotfile ",14)==0)
+ entry->filename=special+14;
+ else if (special[0]=='"' || special[0]=='!')
+ entry->code=special+1;
+ else if (strncmp(special,"ps::[begin]",11)==0)
+ entry->code=special+11;
+ else if (strncmp(special,"ps::[end]",9)==0)
+ entry->code=special+9;
+ else if (strncmp(special,"ps::",4)==0)
+ entry->code=special+4;
+ else if (strncmp(special,"ps:",3)==0)
+ entry->code=special+3;
+ else
+ entry->code=special;
+#ifdef DEBUG
+ if (entry->code!=NULL)
+ DEBUG_PRINT(DEBUG_GS,(" '%s'",entry->code));
+ if (entry->filename!=NULL)
+ DEBUG_PRINT(DEBUG_GS,(" {%s}",entry->filename));
+ if (entry->postcode!=NULL)
+ DEBUG_PRINT(DEBUG_GS,(" '%s'",entry->postcode));
+#endif
+}
+
+
+
+void ClearPSHeaders(void)
+{
+ struct pscode *temp=psheaderp;
+
+ while(temp!=NULL) {
+ psheaderp=psheaderp->next;
+ if (temp->fmmap.data!=NULL)
+ UnMmapFile(&(temp->fmmap));
+ free(temp);
+ temp=psheaderp;
+ }
+}
+
+static void writepscode(FILE* psstream,struct pscode* pscodep)
+{
+ while (pscodep!=NULL) {
+ if (pscodep->code!=NULL) {
+ fputs(pscodep->code,psstream);
+ putc('\n',psstream);
+ DEBUG_PRINT(DEBUG_GS,("\n PS CODE:\t%s",pscodep->code));
+ }
+ if (pscodep->filename!=NULL && pscodep->fmmap.data==NULL) {
+ char* filepath=
+ kpse_find_file(pscodep->filename,kpse_tex_ps_header_format,false);
+ if (filepath==NULL) {
+ Warning("Cannot find PostScript file %s, ignored", pscodep->filename);
+ page_flags |= PAGE_GAVE_WARN;
+ } else if (MmapFile(filepath,&(pscodep->fmmap))) {
+ Warning("PostScript file %s unusable, ignored", pscodep->filename);
+ page_flags |= PAGE_GAVE_WARN;
+ }
+ }
+ if (pscodep->fmmap.data!=NULL) {
+ unsigned char* position;
+
+ DEBUG_PRINT(DEBUG_GS,("\n PS FILE:\t%s",pscodep->filename));
+ position=(unsigned char*)pscodep->fmmap.data;
+ while(position
+ < (unsigned char*)pscodep->fmmap.data + pscodep->fmmap.size) {
+ putc(*position,psstream);
+ position++;
+ }
+ }
+ if (pscodep->postcode!=NULL) {
+ fputs(pscodep->postcode,psstream);
+ putc('\n',psstream);
+ DEBUG_PRINT(DEBUG_GS,("\n PS POST CODE:\t%s",pscodep->postcode));
+ }
+ pscodep=pscodep->next;
+ }
+}
+
+
+static gdImagePtr
+ps2png(struct pscode* pscodep, const char *device, int hresolution, int vresolution,
+ int llx, int lly, int urx, int ury, int bgred, int bggreen, int bgblue)
+{
+ int pspipe[2], pngpipe[2];
+#define READ_END 0
+#define WRITE_END 1
+ FILE *psstream=NULL, *pngstream=NULL;
+ char resolution[STRSIZE];
+ /* char devicesize[STRSIZE]; */
+ gdImagePtr psimage=NULL;
+#ifndef MIKTEX
+#ifndef WIN32
+ pid_t pid;
+#else /* WIN32 */
+ unsigned long nexitcode = STILL_ACTIVE;
+ HANDLE hchild;
+ int savestdin, savestdout;
+#endif /* WIN32 */
+#else /* MIKTEX */
+ HANDLE hPngStream;
+ HANDLE hPsStream;
+ HANDLE hStdErr;
+ PROCESS_INFORMATION pi;
+ _TCHAR szCommandLine[2048];
+ _TCHAR szGsPath[_MAX_PATH];
+#define GS_PATH szGsPath
+#define fdopen _tfdopen
+#define close _close
+#endif /* MIKTEX */
+
+ snprintf(resolution,STRSIZE,"-r%dx%d",hresolution,vresolution);
+ /* Future extension for \rotatebox
+ status=sprintf(devicesize, "-g%dx%d",
+ //(int)((sin(atan(1.0))+1)*
+ (urx - llx)*hresolution/72,//),
+ //(int)((sin(atan(1.0))+1)*
+ (ury - lly)*vresolution/72);//);
+ */
+ DEBUG_PRINT(DEBUG_GS,
+ ("\n GS CALL:\t%s %s %s %s %s %s %s %s %s %s %s",/* %s", */
+ GS_PATH, device, resolution, /*devicesize,*/
+ "-dBATCH", "-dNOPAUSE", "-q", "-sOutputFile=-",
+ "-dTextAlphaBits=4", "-dGraphicsAlphaBits=4",
+ (option_flags & NO_GSSAFER) ? "-": "-dSAFER",
+ (option_flags & NO_GSSAFER) ? "": "- "));
+#ifndef MIKTEX
+ if (pipe(pspipe) || pipe(pngpipe)) return(NULL);
+#ifndef WIN32
+ /* We have fork: execute gs in child */
+ pid = fork();
+ if (pid == 0) { /* Child, execute gs. */
+ close(pspipe[WRITE_END]);
+ dup2(pspipe[READ_END], STDIN_FILENO);
+ close(pspipe[READ_END]);
+ close(pngpipe[READ_END]);
+ dup2(pngpipe[WRITE_END], STDOUT_FILENO);
+ close(pngpipe[WRITE_END]);
+ execlp(GS_PATH, GS_PATH, device, resolution, /*devicesize,*/
+ "-dBATCH", "-dNOPAUSE", "-q", "-sOutputFile=-",
+ "-dTextAlphaBits=4", "-dGraphicsAlphaBits=4",
+ (option_flags & NO_GSSAFER) ? "-": "-dSAFER",
+ (option_flags & NO_GSSAFER) ? NULL: "-",
+ NULL);
+ _exit (EXIT_FAILURE);
+ }
+#else /* WIN32 */
+ /* No fork but spawn: execute gs in present process environment.
+ Save fileno's, attach pipes to this process' stdin and stdout. */
+ savestdin = _dup(fileno(stdin));
+ _dup2(pspipe[READ_END], fileno(stdin));
+ savestdout = _dup(fileno(stdout));
+ _dup2(pngpipe[WRITE_END], fileno(stdout));
+ if ((hchild=
+ (HANDLE)_spawnlp(_P_NOWAIT, GS_PATH, GS_PATH, device, resolution,
+ "-dBATCH", "-dNOPAUSE", "-q", "-sOutputFile=-",
+ "-dTextAlphaBits=4", "-dGraphicsAlphaBits=4",
+ (option_flags & NO_GSSAFER) ? "-": "-dSAFER",
+ (option_flags & NO_GSSAFER) ? NULL : "-", NULL))==0)
+ return NULL;
+#endif /* WIN32 */
+ close(pspipe[READ_END]);
+ close(pngpipe[WRITE_END]);
+#else /* MIKTEX */
+ /* No fork but miktex_start_process3: execute gs using that.
+ Attach file descriptors to that process' stdin and stdout. */
+ if (! miktex_find_miktex_executable("mgs.exe", szGsPath)) {
+ Warning("Ghostscript could not be found");
+ return(NULL);
+ }
+ snprintf(szCommandLine,2048,"\"%s\" %s %s %s %s %s %s %s %s %s %s",/* %s",*/
+ szGsPath, device, resolution, /*devicesize,*/
+ "-dBATCH", "-dNOPAUSE", "-q", "-sOutputFile=-",
+ "-dTextAlphaBits=4", "-dGraphicsAlphaBits=4",
+ (option_flags & NO_GSSAFER) ? "-": "-dSAFER",
+ (option_flags & NO_GSSAFER) ? "": "-");
+ if (! miktex_start_process_3(szCommandLine, &pi, INVALID_HANDLE_VALUE,
+ &hPsStream, &hPngStream, &hStdErr, 0)) {
+ Warning("Ghostscript could not be started");
+ return(NULL);
+ }
+ CloseHandle (pi.hThread);
+ pspipe[WRITE_END] = _open_osfhandle((intptr_t)hPsStream, _O_WRONLY);
+ pngpipe[READ_END] = _open_osfhandle((intptr_t)hPngStream, _O_RDONLY);
+#endif /* MIKTEX */
+ if (pspipe[WRITE_END] >= 0) {
+ if ((psstream=fdopen(pspipe[WRITE_END],"wb")) == NULL)
+ close(pspipe[WRITE_END]);
+ else {
+ writepscode(psstream,psheaderp);
+ /* Page size */
+ DEBUG_PRINT(DEBUG_GS,("\n PS CODE:\t<</PageSize[%d %d]/PageOffset[%d %d[1 1 dtransform exch]{0 ge{neg}if exch}forall]>>setpagedevice",
+ urx - llx, ury - lly,llx,lly));
+ fprintf(psstream, "<</PageSize[%d %d]/PageOffset[%d %d[1 1 dtransform exch]{0 ge{neg}if exch}forall]>>setpagedevice\n",
+ urx - llx, ury - lly,llx,lly);
+ /* Background color */
+ if ( bgred < 255 || bggreen < 255 || bgblue < 255 ) {
+ DEBUG_PRINT(DEBUG_GS,("\n PS CODE:\tgsave %f %f %f setrgbcolor clippath fill grestore",
+ bgred/255.0, bggreen/255.0, bgblue/255.0));
+ fprintf(psstream, "gsave %f %f %f setrgbcolor clippath fill grestore\n",
+ bgred/255.0, bggreen/255.0, bgblue/255.0);
+ }
+ writepscode(psstream,pscodep);
+ fclose(psstream);
+ }
+ }
+ if (pngpipe[READ_END] >= 0) {
+ if((pngstream=fdopen(pngpipe[READ_END],"rb")) == NULL)
+ close(pngpipe[READ_END]);
+ else {
+ psimage = gdImageCreateFromPng(pngstream);
+ fclose(pngstream);
+ }
+ }
+#ifndef MIKTEX
+#ifndef WIN32
+ /* Wait for child */
+ waitpid(pid,NULL,0);
+#else
+ /* Wait for spawned process, restore stdin and stdout */
+ while(nexitcode == STILL_ACTIVE)
+ GetExitCodeProcess((HANDLE)hchild, &nexitcode);
+ CloseHandle((HANDLE)hchild);
+ _dup2(savestdin, fileno(stdin));
+ _dup2(savestdout, fileno(stdout));
+ close(savestdin);
+ close(savestdout);
+#endif /* WIN32 */
+#else /* MIKTEX */
+ /* Close miktex process */
+ CloseHandle(pi.hProcess);
+#endif /* MIKTEX */
+#ifdef DEBUG
+ if (psimage == NULL) {
+ DEBUG_PRINT(DEBUG_GS,("\n GS OUTPUT:\tNO IMAGE "));
+ } else {
+ DEBUG_PRINT(DEBUG_GS,("\n GS OUTPUT:\t%dx%d image ",
+ gdImageSX(psimage),gdImageSY(psimage)));
+ }
+#endif
+ return psimage;
+}
+
+static gdImagePtr
+rescale(gdImagePtr psimage, int pngwidth, int pngheight)
+{
+ gdImagePtr scaledimage=psimage;
+ /* Rescale unless correct size */
+ if (psimage!=NULL
+ && gdImageSX(psimage)!=pngwidth
+ && gdImageSY(psimage)!=pngheight) {
+ DEBUG_PRINT(DEBUG_DVI,
+ ("\n RESCALE INCLUDED BITMAP \t(%d,%d) -> (%d,%d)",
+ gdImageSX(psimage),gdImageSY(psimage),
+ pngwidth,pngheight));
+#ifdef HAVE_GDIMAGECREATETRUECOLOR
+ scaledimage=gdImageCreateTrueColor(pngwidth,pngheight);
+ /* Copy with overwrite, remember that this is the rescaled source
+ image. The real target has alpha blending on. */
+ gdImageAlphaBlending(scaledimage,0);
+ gdImageCopyResampled(scaledimage,psimage,0,0,0,0,
+ pngwidth,pngheight,
+ gdImageSX(psimage),gdImageSY(psimage));
+#else
+ scaledimage=gdImageCreate(pngwidth,pngheight);
+ gdImageCopyResized(scaledimage,psimage,0,0,0,0,
+ pngwidth,pngheight,
+ gdImageSX(psimage),gdImageSY(psimage));
+#endif
+ gdImageDestroy(psimage);
+ }
+ return(scaledimage);
+}
+
+static void newpsheader(const char* special) {
+ struct pscode* tmp;
+ char* txt;
+
+ if (psheaderp==NULL && strcmp(special,"header=tex.pro")!=0) {
+ newpsheader("header=tex.pro");
+ newpsheader("header=color.pro");
+ newpsheader("header=special.pro");
+ }
+ if (strcmp(special+strlen(special)-4,".xcp")==0
+ && strncmp(special,"header=",7)==0)
+ InitXColorPrologue(special+7);
+ if (strncmp(special,"! /pgfH",7)==0)
+ newpsheader("! TeXDict begin");
+ if (psheaderp==NULL) {
+ if ((tmp=psheaderp=malloc(sizeof(struct pscode)))==NULL)
+ Fatal("cannot malloc space for PostScript header struct");
+ } else {
+ /* No duplicates. This still misses pre=..., because we still
+ change that. To be fixed */
+ tmp=psheaderp;
+ if (strcmp(tmp->special,special)==0)
+ return;
+ while(tmp->next!=NULL) {
+ tmp=tmp->next;
+ if (strcmp(tmp->special,special)==0)
+ return;
+ }
+ if ((tmp->next=malloc(sizeof(struct pscode)))==NULL)
+ Fatal("cannot malloc space for PostScript header struct");
+ tmp=tmp->next;
+ }
+ DEBUG_PRINT(DEBUG_GS,("\n PS HEADER "));
+ if ((txt=malloc(strlen(special)+1))==NULL)
+ Fatal("cannot malloc space for PostScript header");
+ strcpy(txt,special);
+ PSCodeInit(tmp,txt);
+}
+
+/*********************************************************************/
+/**************************** SetSpecial ***************************/
+/*********************************************************************/
+
+void SetSpecial(char *start, char *end, int32_t hh, int32_t vv)
+/* interpret a \special command, made up of keyword=value pairs,
+ * or !header or ps:raw_PostScript
+ */
+{
+ char *buffer,*special;
+
+ if ((buffer=malloc(end-start+1))==NULL)
+ Fatal("Cannot allocate space for special");
+ special=memcpy(buffer,start,end-start);
+ special[end-start]='\0';
+ DEBUG_PRINT(DEBUG_DVI,(" '%s'",special));
+ SKIPSPACES(special);
+ /********************** Color specials ***********************/
+ if (strncmp(special,"background ",11)==0) {
+ background(special+11);
+ free(buffer);
+ return;
+ }
+ if (strncmp(special,"color ",6)==0) {
+ special+=6;
+ SKIPSPACES(special);
+ if (strncmp(special,"push ",5)==0) {
+ pushcolor(special+5);
+ } else {
+ if (strcmp(special,"pop")==0)
+ popcolor();
+ else
+ resetcolorstack(special);
+ }
+ free(buffer);
+ return;
+ }
+
+ /******************* Image inclusion ********************/
+
+ /* Needed tests for regression: PNG, GIF, JPEG and EPS inclusion,
+ * for different gd versions */
+
+ if (strncmp(special,"PSfile=",7)==0) { /* PSfile */
+ char* psname = special+7;
+ int llx=0,lly=0,urx=0,ury=0,rwi=0,rhi=0;
+ bool clip=false;
+ int hresolution,vresolution;
+ int pngheight,pngwidth;
+
+ /* Remove quotation marks around filename. If no quotation marks,
+ use first word as filename */
+ if (*psname=='"') {
+ psname++;
+ special=strrchr(psname,'"');
+ } else {
+ special=strchr(psname,' ');
+ }
+ if (special!=NULL) {
+ *special='\0';
+ special++;
+ }
+
+ /* Retrieve parameters */
+ SKIPSPACES(special);
+ while(special && *special) {
+ if (strncmp(special,"llx=",4)==0)
+ llx = strtol(special+4,&special,10);
+ else if (strncmp(special,"lly=",4)==0)
+ lly = strtol(special+4,&special,10);
+ else if (strncmp(special,"urx=",4)==0)
+ urx = strtol(special+4,&special,10);
+ else if (strncmp(special,"ury=",4)==0)
+ ury = strtol(special+4,&special,10);
+ else if (strncmp(special,"rwi=",4)==0)
+ rwi = strtol(special+4,&special,10);
+ else if (strncmp(special,"rhi=",4)==0)
+ rhi = strtol(special+4,&special,10);
+ else if (strncmp(special,"clip",4)==0)
+ {clip = true; special=special+4;}
+ while (*special && *special!=' ') special++;
+ SKIPSPACES(special);
+ }
+
+ /* Calculate resolution, and use our base resolution as a fallback. */
+ /* The factor 10 is magic, the dvips graphicx driver needs this. */
+ hresolution = ((dpi*rwi+urx-llx-1)/(urx - llx)+9)/10;
+ vresolution = ((dpi*rhi+ury-lly-1)/(ury - lly)+9)/10;
+ if (vresolution==0) vresolution = hresolution;
+ if (hresolution==0) hresolution = vresolution;
+ if (hresolution==0) hresolution = vresolution = dpi;
+
+ /* Convert from postscript 72 dpi resolution to our given resolution */
+ pngwidth = (dpi*rwi+719)/720; /* +719: round up */
+ pngheight = (dpi*rhi+719)/720;
+ if (pngwidth==0)
+ pngwidth = ((dpi*rhi*(urx-llx)+ury-lly-1)/(ury-lly)+719)/720;
+ if (pngheight==0)
+ pngheight = ((dpi*rwi*(ury-lly)+urx-llx-1)/(urx-llx)+719)/720;
+ if (pngheight==0) {
+ pngwidth = (dpi*(urx-llx)+71)/72;
+ pngheight = (dpi*(ury-lly)+71)/72;
+ }
+ if (page_imagep != NULL) { /* Draw into image */
+ struct pscode image;
+ gdImagePtr psimage=NULL;
+#ifndef HAVE_GDIMAGECREATEFROMPNGPTR
+ FILE* psstream;
+#endif
+
+ PSCodeInit(&image, NULL);
+ image.filename=kpse_find_file(psname,kpse_pict_format,0);
+#if !defined(MIKTEX) && defined(WIN32)
+ if (image.filename == NULL) {
+ wchar_t *wnam;
+ char *tmpnam;
+ int tmpcp;
+ tmpcp = file_system_codepage;
+ file_system_codepage = CP_UTF8;
+ tmpnam = kpse_find_file(psname,kpse_pict_format,0);
+ if (tmpnam) {
+ wnam = get_wstring_from_mbstring(CP_UTF8, tmpnam, wnam=NULL);
+ if (wnam) {
+ image.filename = get_mbstring_from_wstring(tmpcp, wnam, image.filename=NULL);
+ free(wnam);
+ }
+ free(tmpnam);
+ }
+ file_system_codepage = tmpcp;
+ }
+#endif
+ if (MmapFile(image.filename,&(image.fmmap)) || image.fmmap.size==0) {
+ Warning("Image file %s unusable, image will be left blank",
+ image.filename);
+ page_flags |= PAGE_GAVE_WARN;
+ free(buffer);
+ return;
+ }
+ Message(BE_NONQUIET," <%s",psname);
+ switch ((unsigned char)*image.fmmap.data) {
+ case 0x89: /* PNG magic: "\211PNG\r\n\032\n" */
+ DEBUG_PRINT(DEBUG_DVI,("\n INCLUDE PNG \t%s",image.filename));
+#ifdef HAVE_GDIMAGECREATEFROMPNGPTR
+ psimage=gdImageCreateFromPngPtr(image.fmmap.size,image.fmmap.data);
+#else
+ psstream=fopen(image.filename,"rb");
+ psimage=gdImageCreateFromPng(psstream);
+ fclose(psstream);
+#endif
+ psimage=rescale(psimage,pngwidth,pngheight);
+ break;
+ case 'G': /* GIF magic: "GIF87" or "GIF89" */
+ DEBUG_PRINT(DEBUG_DVI,("\n INCLUDE GIF \t%s",image.filename));
+#ifdef HAVE_GDIMAGEGIF
+ psimage=rescale(gdImageCreateFromGifPtr(image.fmmap.size,
+ image.fmmap.data),
+ pngwidth,pngheight);
+#else
+ DEBUG_PRINT(DEBUG_DVI,(" (NO GIF DECODER)"));
+#endif
+ break;
+ case 0xff: /* JPEG magic: 0xffd8 */
+ DEBUG_PRINT(DEBUG_DVI,("\n INCLUDE JPEG \t%s",image.filename));
+#ifdef HAVE_GDIMAGECREATEFROMJPEG
+#ifdef HAVE_GDIMAGECREATEFROMPNGPTR
+ psimage=gdImageCreateFromJpegPtr(image.fmmap.size,image.fmmap.data);
+#else
+ psstream=fopen(image.filename,"rb");
+ psimage=gdImageCreateFromJpeg(psstream);
+ fclose(psstream);
+#endif
+ psimage=rescale(psimage,pngwidth,pngheight);
+#else
+ DEBUG_PRINT(DEBUG_DVI,(" (NO JPEG DECODER)"));
+#endif
+ break;
+ default: /* Default, PostScript magic: "%!PS-Adobe" */
+ if (option_flags & NO_GHOSTSCRIPT) {
+ Warning("GhostScript calls disallowed by --nogs" );
+ page_flags |= PAGE_GAVE_WARN;
+ } else {
+ /* Ensure one (and only one) showpage */
+ image.code=" /DVIPNGDICT 100 dict def DVIPNGDICT begin /showpage {} def ";
+ image.postcode=" end showpage\n";
+ /* Use alpha blending, and render transparent postscript
+ images. The alpha blending works correctly only from
+ libgd 2.0.12 upwards */
+#ifdef HAVE_GDIMAGEPNGEX
+ if (page_imagep->trueColor) {
+ int tllx=llx,tlly=lly,turx=urx,tury=ury;
+
+ DEBUG_PRINT((DEBUG_DVI | DEBUG_GS),
+ ("\n GS RENDER \t%s -> pngalpha ",image.filename));
+ if (!clip) {
+ /* Render across the whole image */
+ tllx=llx-(hh+1)*72/hresolution;
+ tlly=lly-(gdImageSY(page_imagep)-vv-1)*72/vresolution;
+ turx=llx+(gdImageSX(page_imagep)-hh)*72/hresolution;
+ tury=lly+(vv+1)*72/vresolution;
+ DEBUG_PRINT((DEBUG_DVI | DEBUG_GS),
+ ("\n EXPAND BBOX \t%d %d %d %d -> %d %d %d %d",
+ llx,lly,urx,ury,tllx,tlly,turx,tury));
+#ifdef DEBUG
+ } else {
+ DEBUG_PRINT((DEBUG_DVI | DEBUG_GS),(", CLIPPED TO BBOX"));
+#endif
+ }
+ psimage = ps2png(&image, "-sDEVICE=pngalpha",
+ hresolution, vresolution,
+ tllx, tlly, turx, tury,
+ 255,255,255);
+ if (psimage==NULL)
+ Warning("No GhostScript pngalpha output, opaque image inclusion");
+ } else
+ Warning("Palette output, opaque image inclusion");
+#endif
+ if (psimage==NULL) {
+ /* png256 gives inferior result */
+ DEBUG_PRINT((DEBUG_DVI | DEBUG_GS),
+ ("\n GS RENDER \t%s -> png16m", image.filename));
+ psimage = ps2png(&image, "-sDEVICE=png16m",
+ hresolution, vresolution,
+ llx, lly, urx, ury,
+ cstack[0].red,cstack[0].green,cstack[0].blue);
+ clip=true;
+ page_flags |= PAGE_GAVE_WARN;
+ }
+ if (!clip) {
+ /* Rendering across the whole image */
+ hh=0;
+ vv=gdImageSY(psimage)-1;
+ }
+ }
+ }
+ UnMmapFile(&(image.fmmap));
+ if (psimage!=NULL) {
+ DEBUG_PRINT(DEBUG_DVI,
+ ("\n GRAPHIC(X|S) INCLUDE \t%s (%d,%d) res %dx%d at (%d,%d)",
+ psname,gdImageSX(psimage),gdImageSY(psimage),
+ hresolution,vresolution,hh,vv));
+#ifdef HAVE_GDIMAGECREATETRUECOLOR
+ if (psimage->trueColor && !page_imagep->trueColor)
+ gdImageTrueColorToPalette(psimage,0,256);
+#endif
+#ifdef HAVE_GDIMAGEPNGEX
+ gdImageAlphaBlending(page_imagep,1);
+#else
+ Warning("Using libgd < 2.0.12, opaque image inclusion");
+ page_flags |= PAGE_GAVE_WARN;
+#endif
+ gdImageCopy(page_imagep, psimage,
+ hh, vv-gdImageSY(psimage)+1,
+ 0,0,
+ gdImageSX(psimage),gdImageSY(psimage));
+#ifdef HAVE_GDIMAGEPNGEX
+ gdImageAlphaBlending(page_imagep,0);
+#endif
+ gdImageDestroy(psimage);
+ } else {
+ Warning("Unable to load %s, image will be left blank",image.filename);
+ page_flags |= PAGE_GAVE_WARN;
+ }
+ free(image.filename);
+ Message(BE_NONQUIET,">");
+ } else { /* Don't draw */
+ page_flags |= PAGE_TRUECOLOR;
+ DEBUG_PRINT(DEBUG_DVI,
+ ("\n GRAPHIC(X|S) INCLUDE \t%s (%d,%d) res %dx%d at (%d,%d)",
+ psname,pngheight,pngwidth,
+ hresolution,vresolution,hh,vv));
+ min(x_min,hh);
+ min(y_min,vv-pngheight+1);
+ max(x_max,hh+pngwidth);
+ max(y_max,vv+1);
+ }
+ free(buffer);
+ return;
+ }
+
+ /******************* Raw PostScript ********************/
+
+ if (strncmp(special,"!/preview@version(",18)==0) {
+ int length=0;
+ special+=18;
+ while (special[length]!='\0' && special[length]!=')')
+ length++;
+ if (page_imagep==NULL)
+ Message(BE_NONQUIET," (preview-latex version %.*s)",length,special);
+ free(buffer);
+ return;
+ }
+
+ /* preview-latex' tightpage option */
+ if (strncmp(special,"!/preview@tightpage",19)==0) {
+ special+=19;
+ SKIPSPACES(special);
+ if (strncmp(special,"true",4)==0) {
+ if (page_imagep==NULL)
+ Message(BE_NONQUIET," (preview-latex tightpage option detected, will use its bounding box)");
+ dvi->flags |= DVI_PREVIEW_LATEX_TIGHTPAGE;
+ }
+ free(buffer);
+ return;
+ }
+ if (strncmp(special,"!userdict",9)==0
+ && strstr(special+10,"7{currentfile token not{stop}if 65781.76 div")!=NULL) {
+ if (page_imagep==NULL && ~dvi->flags & DVI_PREVIEW_LATEX_TIGHTPAGE)
+ Message(BE_NONQUIET," (preview-latex <= 0.9.1 tightpage option detected, will use its bounding box)");
+ dvi->flags |= DVI_PREVIEW_LATEX_TIGHTPAGE;
+ free(buffer);
+ return;
+ }
+
+ /* preview-latex' dvips bop-hook redefinition */
+ if (strncmp(special,"!userdict",9)==0
+ && strstr(special+10,"preview-bop-")!=NULL) {
+ dvi->flags |= DVI_PREVIEW_BOP_HOOK;
+ if (page_imagep==NULL)
+ Message(BE_VERBOSE," (preview-latex beginning-of-page-hook detected)");
+ free(buffer);
+ return;
+ }
+
+ if (dvi->flags & DVI_PREVIEW_BOP_HOOK && ~page_flags & PAGE_PREVIEW_BOP
+ && strncmp(special,"ps::",4)==0) {
+ /* Hokay, decode bounding box */
+ dviunits adj_llx,adj_lly,adj_urx,adj_ury,ht,dp,wd;
+ adj_llx = strtol(special+4,&special,10);
+ adj_lly = strtol(special,&special,10);
+ adj_urx = strtol(special,&special,10);
+ adj_ury = strtol(special,&special,10);
+ ht = strtol(special,&special,10);
+ dp = strtol(special,&special,10);
+ wd = strtol(special,&special,10);
+ page_flags |= PAGE_PREVIEW_BOP;
+ if (wd>0) {
+ x_offset_tightpage =
+ (-adj_llx+dvi->conv*shrinkfactor-1)/dvi->conv/shrinkfactor;
+ x_width_tightpage = x_offset_tightpage
+ +(wd+adj_urx+dvi->conv*shrinkfactor-1)/dvi->conv/shrinkfactor;
+ } else {
+ x_offset_tightpage =
+ (-wd+adj_urx+dvi->conv*shrinkfactor-1)/dvi->conv/shrinkfactor;
+ x_width_tightpage = x_offset_tightpage
+ +(-adj_llx+dvi->conv*shrinkfactor-1)/dvi->conv/shrinkfactor;
+ }
+ /* y-offset = height - 1 */
+ y_offset_tightpage =
+ (((ht>0)?ht:0)+adj_ury+dvi->conv*shrinkfactor-1)/dvi->conv/shrinkfactor-1;
+ y_width_tightpage = y_offset_tightpage+1
+ +(((dp>0)?dp:0)-adj_lly+dvi->conv*shrinkfactor-1)/dvi->conv/shrinkfactor;
+ free(buffer);
+ return;
+ }
+
+ if (special[0]=='"' || strncmp(special,"ps:",3)==0) { /* Raw PostScript */
+ if (option_flags & NO_RAW_PS) {
+ Warning("Raw PostScript rendering disallowed by --norawps" );
+ page_flags |= PAGE_GAVE_WARN;
+ free(buffer);
+ return;
+ }
+ if (page_imagep != NULL) { /* Draw into image */
+ static struct pscode *pscodep=NULL;
+ static bool psenvironment=false;
+ bool nextisps;
+ struct pscode *tmp;
+ gdImagePtr psimage=NULL;
+ char *txt;
+ const char *specialend=special+strlen(special);
+ const char *newspecial=NULL;
+
+ /* hyperref non-rendering PostScript specials. */
+ if (strcmp(specialend-11,"pdfmark end")==0
+ || strcmp(specialend-7,"H.A end")==0
+ || strcmp(specialend-7,"H.B end")==0
+ || strcmp(specialend-7,"H.L end")==0
+ || strcmp(specialend-7,"H.R end")==0
+ || strcmp(specialend-7,"H.S end")==0
+ || strcmp(specialend-7,"H.V end")==0
+ || strncmp(special,"ps:SDict begin /product",23)==0)
+ if (pscodep==NULL) {
+ free(buffer);
+ return;
+ } else
+ newspecial="";
+ /* pgf PostScript specials. */
+ else if (strcmp(special,"ps:: pgfo")==0)
+ /* pgf page start. The first numbers are generally valid for
+ the bop instruction, and the latter code is to move the
+ origin to the right place. */
+ newspecial="ps:: 39139632 55387786 1000 600 600 (tikzdefault.dvi) @start 1 0 bop pgfo 0 0 matrix defaultmatrix transform itransform translate";
+ else if (strcmp(special,"ps:: pgfc")==0)
+ newspecial="ps:: pgfc eop end";
+ /* Some packages split their raw PostScript code into
+ several specials. Check for those, and concatenate them so
+ that they're given to one and the same invocation of gs */
+ else if (strncmp(special,"ps::[begin]",11)==0)
+ psenvironment=true;
+ else if (strncmp(special,"ps::[end]",9)==0)
+ psenvironment=false;
+ if (pscodep==NULL) {
+ Message(BE_NONQUIET," <raw PostScript");
+ if ((tmp=pscodep=malloc(sizeof(struct pscode)))==NULL)
+ Fatal("cannot malloc space for raw PostScript struct");
+ } else {
+ tmp=pscodep;
+ while(tmp->next != NULL)
+ tmp=tmp->next;
+ if ((tmp->next=malloc(sizeof(struct pscode)))==NULL)
+ Fatal("cannot malloc space for raw PostScript struct");
+ tmp=tmp->next;
+ }
+ nextisps=DVIIsNextPSSpecial(dvi);
+ if (psenvironment || nextisps) {
+ if (!nextisps) {
+ Warning("PostScript environment contains DVI commands");
+ page_flags |= PAGE_GAVE_WARN;
+ }
+ DEBUG_PRINT(DEBUG_GS,("\n PS SPECIAL "));
+ if (newspecial == NULL)
+ newspecial=special;
+ if ((txt=malloc(strlen(newspecial)+1))==NULL)
+ Fatal("cannot allocate space for raw PostScript special");
+ strcpy(txt,newspecial);
+ PSCodeInit(tmp,txt);
+ free(buffer);
+ return;
+ }
+ DEBUG_PRINT(DEBUG_DVI,("\n LAST PS SPECIAL "));
+ if (newspecial != NULL) {
+ if ((special=malloc(strlen(newspecial)+1))==NULL)
+ Fatal("cannot allocate space for raw PostScript special");
+ strcpy(special,newspecial);
+ }
+ PSCodeInit(tmp,special);
+ /* Now, render image */
+ if (option_flags & NO_GHOSTSCRIPT)
+ Warning("GhostScript calls disallowed by --nogs" );
+ else {
+ /* Use alpha blending, and render transparent postscript
+ images. The alpha blending works correctly only from
+ libgd 2.0.12 upwards */
+#ifdef HAVE_GDIMAGEPNGEX
+ if (page_imagep->trueColor) {
+ /* Render across the whole image */
+ psimage = ps2png(pscodep, "-sDEVICE=pngalpha",
+ dpi,dpi,
+ -(hh+1)*72/dpi,
+ -(gdImageSY(page_imagep)-vv-1)*72/dpi,
+ (gdImageSX(page_imagep)-hh)*72/dpi,
+ (vv+1)*72/dpi,
+ 255,255,255);
+ if (psimage!=NULL) {
+ gdImageAlphaBlending(page_imagep,1);
+ gdImageCopy(page_imagep, psimage,
+ 0,0,0,0,
+ gdImageSX(psimage),gdImageSY(psimage));
+ gdImageAlphaBlending(page_imagep,0);
+ gdImageDestroy(psimage);
+ } else
+ Warning("No image output from inclusion of raw PostScript");
+ } else
+ Warning("Palette output, cannot include raw PostScript");
+#else
+ Warning("Using libgd < 2.0.12, unable to include raw PostScript");
+#endif
+ }
+ while(pscodep->next != NULL) {
+ tmp=pscodep->next;
+ free(pscodep->special);
+ free(pscodep);
+ pscodep=tmp;
+ }
+ free(pscodep);
+ pscodep=NULL;
+ if (newspecial != NULL)
+ free(special);
+ if (psimage==NULL)
+ page_flags |= PAGE_GAVE_WARN;
+ Message(BE_NONQUIET,">");
+ } else { /* Don't draw */
+ page_flags |= PAGE_TRUECOLOR;
+ }
+ free(buffer);
+ return;
+ }
+
+ if (strncmp(special,"papersize=",10)==0) { /* papersize spec, ignored */
+ free(buffer);
+ return;
+ }
+
+ if (special[0]=='!' || strncmp(special,"header=",7)==0) { /* PS header */
+ newpsheader(special);
+ free(buffer);
+ return;
+ }
+
+ if (strncmp(special,"src:",4)==0) { /* source special */
+ if ( page_imagep != NULL )
+ Message(BE_NONQUIET," at (%ld,%ld) source \\special{%s}",
+ hh, vv, special);
+ free(buffer);
+ return;
+ }
+ if ( page_imagep != NULL ) {
+ Warning("at (%ld,%ld) unimplemented \\special{%s}",
+ hh, vv, special);
+ page_flags |= PAGE_GAVE_WARN;
+ }
+ free(buffer);
+}
diff --git a/Build/source/texk/dvipng/dvipng-src/test_dvipng.tex b/Build/source/texk/dvipng/dvipng-src/test_dvipng.tex
new file mode 100644
index 00000000000..34814776070
--- /dev/null
+++ b/Build/source/texk/dvipng/dvipng-src/test_dvipng.tex
@@ -0,0 +1,48 @@
+% test_dvipng.tex
+%
+% Part of the dvipng distribution
+%
+% This program is free software: you can redistribute it and/or modify
+% it under the terms of the GNU Lesser General Public License as
+% published by the Free Software Foundation, either version 3 of the
+% License, or (at your option) any later version.
+%
+% This program is distributed in the hope that it will be useful, but
+% WITHOUT ANY WARRANTY; without even the implied warranty of
+% MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU
+% Lesser General Public License for more details.
+%
+% You should have received a copy of the GNU Lesser General Public
+% License along with this program. If not, see
+% <http://www.gnu.org/licenses/>.
+%
+% Copyright (C) 2002-2010 Jan-{\AA}ke Larsson
+
+\documentclass{article}
+%\usepackage[active,textmath]{preview}
+\usepackage{color}
+\pagestyle{empty}
+
+\begin{document}
+\begin{equation}
+ \int dx
+\end{equation}
+\newpage
+$\int dx$
+\newpage
+$\sqrt2+1=\frac1{\sqrt2-1}$
+\newpage
+\framebox{\textbackslash\ttfamily framebox}
+\newpage
+\( \begin{array}{|r|} \hline a \cr \hline \end{array} \)
+\newpage
+fig, pig, flask, efficiency, effluent
+\newpage
+\Huge A \LARGE A \Large A \large A \normalsize A \small A
+\footnotesize A \scriptsize A \tiny A
+\newpage
+\color{yellow}
+
+\section*{Hello world}
+\pagecolor{blue}
+\end{document}
diff --git a/Build/source/texk/dvipng/dvipng-src/tfm.c b/Build/source/texk/dvipng/dvipng-src/tfm.c
new file mode 100644
index 00000000000..ee04383cb45
--- /dev/null
+++ b/Build/source/texk/dvipng/dvipng-src/tfm.c
@@ -0,0 +1,86 @@
+/* tfm.c */
+
+/************************************************************************
+
+ Part of the dvipng distribution
+
+ This program is free software: you can redistribute it and/or modify
+ it under the terms of the GNU Lesser General Public License as
+ published by the Free Software Foundation, either version 3 of the
+ License, or (at your option) any later version.
+
+ This program is distributed in the hope that it will be useful, but
+ WITHOUT ANY WARRANTY; without even the implied warranty of
+ MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU
+ Lesser General Public License for more details.
+
+ You should have received a copy of the GNU Lesser General Public
+ License along with this program. If not, see
+ <http://www.gnu.org/licenses/>.
+
+ Copyright (C) 2002-2009, 2019 Jan-Åke Larsson
+
+************************************************************************/
+
+#include "dvipng.h"
+
+bool ReadTFM(struct font_entry * tfontp, char* tfmname)
+{
+ struct filemmap fmmap;
+ struct char_entry *tcharptr;
+ unsigned char *position;
+ int lh,bc,ec,nw, c;
+ dviunits* width;
+
+ DEBUG_PRINT((DEBUG_DVI|DEBUG_FT|DEBUG_TFM),
+ ("\n OPEN METRICS:\t'%s'", tfmname));
+ if (MmapFile(tfmname,&fmmap)) return(false);
+ position=(unsigned char*)fmmap.data;
+ if (fmmap.size<10) Fatal("TFM file %s ends prematurely",tfmname);
+ lh = UNumRead(position+2,2);
+ bc = UNumRead(position+4,2);
+ ec = UNumRead(position+6,2);
+ nw = UNumRead(position+8,2);
+ DEBUG_PRINT(DEBUG_TFM,(" %d %d %d %d",lh,bc,ec,nw));
+ if (nw>0) {
+ unsigned char *end=(unsigned char *) fmmap.data+fmmap.size;
+ if ((width=malloc(nw*sizeof(dviunits)))==NULL)
+ Fatal("cannot allocate memory for TFM widths");
+ c=0;
+ position=position+24+(lh+ec-bc+1)*4;
+ while( c < nw ) {
+ if (position >= end - 4) Fatal("TFM file %s ends prematurely",tfmname);
+ width[c] = SNumRead(position,4);
+ c++;
+ position += 4;
+ }
+ /* Read char widths */
+ c=bc;
+ position=(unsigned char*)fmmap.data+24+lh*4;
+ while(c <= ec) {
+ if (position >= end) Fatal("TFM file %s ends prematurely",tfmname);
+ DEBUG_PRINT(DEBUG_TFM,("\n@%ld TFM METRICS:\t",
+ (long)((char *)position - fmmap.data)));
+ if ((tcharptr=malloc(sizeof(struct char_entry)))==NULL)
+ Fatal("cannot allocate memory for TFM char entry");
+ tcharptr->data=NULL;
+ if (*position < nw) {
+ tcharptr->tfmw=width[*position];
+ } else {
+ Fatal("TFM file %s lacks width for char %u", tfmname, *position);
+ }
+ DEBUG_PRINT(DEBUG_TFM,("%d [%d] %d",c,*position,tcharptr->tfmw));
+ tcharptr->tfmw = (dviunits)
+ ((int64_t) tcharptr->tfmw * tfontp->s / (1 << 20));
+ DEBUG_PRINT(DEBUG_TFM,(" (%d)",tcharptr->tfmw));
+ if (c >= NFNTCHARS) /* Only positive for now */
+ Fatal("tfm file %s exceeds char numbering limit %u",tfmname,NFNTCHARS);
+ tfontp->chr[c] = tcharptr;
+ c++;
+ position += 4;
+ }
+ free(width);
+ }
+ UnMmapFile(&fmmap);
+ return(true);
+}
diff --git a/Build/source/texk/dvipng/dvipng-src/vf.c b/Build/source/texk/dvipng/dvipng-src/vf.c
new file mode 100644
index 00000000000..28e429eb264
--- /dev/null
+++ b/Build/source/texk/dvipng/dvipng-src/vf.c
@@ -0,0 +1,144 @@
+/* vf.c */
+
+/************************************************************************
+
+ Part of the dvipng distribution
+
+ This program is free software: you can redistribute it and/or modify
+ it under the terms of the GNU Lesser General Public License as
+ published by the Free Software Foundation, either version 3 of the
+ License, or (at your option) any later version.
+
+ This program is distributed in the hope that it will be useful, but
+ WITHOUT ANY WARRANTY; without even the implied warranty of
+ MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU
+ Lesser General Public License for more details.
+
+ You should have received a copy of the GNU Lesser General Public
+ License along with this program. If not, see
+ <http://www.gnu.org/licenses/>.
+
+ Copyright (C) 2002-2015 Jan-Åke Larsson
+
+************************************************************************/
+
+#include "dvipng.h"
+
+#define VF_ID 202
+#define LONG_CHAR 242
+
+int32_t SetVF(struct char_entry* ptr)
+{
+ struct font_entry* currentvf;
+ unsigned char *command,*end;
+
+ currentvf=currentfont;
+ BeginVFMacro(currentvf);
+ command = ptr->data;
+ end = command + ptr->length;
+ while (command < end) {
+ DEBUG_PRINT(DEBUG_DVI,("\n VF MACRO:\t%s ", dvi_commands[*command]));
+ DrawCommand(command,currentvf);
+ command += CommandLength(command);
+ }
+ EndVFMacro();
+ currentfont=currentvf;
+ return(ptr->tfmw);
+}
+
+
+
+void InitVF(struct font_entry * tfontp)
+{
+ unsigned char* position;
+ int length;
+ struct char_entry *tcharptr;
+ uint32_t c=0;
+ struct font_num *tfontnump; /* temporary font_num pointer */
+
+ DEBUG_PRINT((DEBUG_DVI|DEBUG_VF),("\n OPEN FONT:\t'%s'", tfontp->name));
+ Message(BE_VERBOSE,"<%s>", tfontp->name);
+ if (MmapFile(tfontp->name,&(tfontp->fmmap)))
+ Fatal("font file %s unusable", tfontp->name);
+ position=(unsigned char*)tfontp->fmmap.data;
+ if (*(position) != PRE)
+ Fatal("unknown font format in file %s",tfontp->name);
+ if (*(position+1) != VF_ID)
+ Fatal( "wrong version %d of vf file %s (should be 202)",
+ (int)*(position+1),tfontp->name);
+ DEBUG_PRINT(DEBUG_VF,("\n VF_PRE:\t'%.*s'",
+ (int)*(position+2), position+3));
+ position = position+3 + *(position+2);
+ c=UNumRead(position, 4);
+ DEBUG_PRINT(DEBUG_VF,(" %d", c));
+ CheckChecksum (tfontp->c, c, tfontp->name);
+ tfontp->designsize = UNumRead(position+4,4);
+ DEBUG_PRINT(DEBUG_VF,(" %d", tfontp->designsize));
+ tfontp->type = FONT_TYPE_VF;
+ tfontp->vffontnump=NULL;
+ /* Read font definitions */
+ position += 8;
+ while(*position >= FNT_DEF1 && *position <= FNT_DEF4) {
+ DEBUG_PRINT(DEBUG_VF,("\n @%ld VF:\t%s",
+ (long)((char *)position - tfontp->fmmap.data),
+ dvi_commands[*position]));
+ FontDef(position,tfontp);
+ length = dvi_commandlength[*position];
+ position += length + *(position + length-1) + *(position+length-2);
+ }
+ /* Default font is the first defined */
+ tfontnump = tfontp->vffontnump;
+ while (tfontnump->next != NULL) {
+ tfontnump = tfontnump->next;
+ }
+ tfontp->defaultfont=tfontnump->k;
+ /* Read char definitions */
+ while(*position < FNT_DEF1) {
+ DEBUG_PRINT(DEBUG_VF,("\n@%ld VF CHAR:\t",
+ (long)((char *)position - tfontp->fmmap.data)));
+ if ((tcharptr=malloc(sizeof(struct char_entry)))==NULL)
+ Fatal("cannot allocate memory for VF char entry");
+ switch (*position) {
+ case LONG_CHAR:
+ tcharptr->length = UNumRead(position+1,4);
+ c = UNumRead(position+5,4);
+ tcharptr->tfmw = UNumRead(position+9,4);
+ position += 13;
+ break;
+ default:
+ tcharptr->length = UNumRead(position,1);
+ c = UNumRead(position+1,1);
+ tcharptr->tfmw = UNumRead(position+2,3);
+ position += 5;
+ }
+ DEBUG_PRINT(DEBUG_VF,("%d %d %d",tcharptr->length,c,tcharptr->tfmw));
+ tcharptr->tfmw = (int32_t)
+ ((int64_t) tcharptr->tfmw * tfontp->s / (1 << 20));
+ DEBUG_PRINT(DEBUG_VF,(" (%d)",tcharptr->tfmw));
+ if (c >= NFNTCHARS) /* Only positive for now */
+ Fatal("VF font %s exceeds char numbering limit",tfontp->name);
+ tfontp->chr[c] = tcharptr;
+ tcharptr->data=position;
+ position += tcharptr->length;
+ }
+}
+
+
+void DoneVF(struct font_entry *tfontp)
+{
+ int c=FIRSTFNTCHAR;
+
+ UnMmapFile(&(tfontp->fmmap));
+ while(c<=LASTFNTCHAR) {
+ if (tfontp->chr[c]!=NULL) {
+ free(tfontp->chr[c]);
+ tfontp->chr[c]=NULL;
+ }
+ c++;
+ }
+ FreeFontNumP(tfontp->vffontnump);
+ tfontp->vffontnump=NULL;
+ if (tfontp->name!=NULL)
+ free(tfontp->name);
+ tfontp->name=NULL;
+}
diff --git a/Build/source/texk/dvipng/dvipng-test.dvi b/Build/source/texk/dvipng/dvipng-test.dvi
new file mode 100644
index 00000000000..50c00c67bf0
--- /dev/null
+++ b/Build/source/texk/dvipng/dvipng-test.dvi
Binary files differ
diff --git a/Build/source/texk/dvipng/dvipng.test b/Build/source/texk/dvipng/dvipng.test
new file mode 100755
index 00000000000..f40c793e859
--- /dev/null
+++ b/Build/source/texk/dvipng/dvipng.test
@@ -0,0 +1,31 @@
+#! /bin/sh -vx
+# $Id$
+# Public domain. Originally written by Peter Breitenlohner, 2009.
+
+get_val () {
+ res=`kpsewhich "$@"` || { echo "\"kpsewhich $@\" failed"; exit 77; }
+}
+
+get_val mktex.cnf
+TEXMFCNF=`dirname "$res"`
+get_val psfonts.map
+par=`dirname "$res"`
+TEXFONTMAPS=`dirname "$par"`//
+get_val 8r.enc
+par=`dirname "$res"`
+ENCFONTS=`dirname "$par"`//
+get_val --expand-var='$TEXMFMAIN'
+TEXMFMAIN=$res
+get_val --expand-var='$TEXMFDIST'
+TEXMFDIST=$res
+TEXMFLOCAL=`kpsewhich --expand-var='$TEXMFLOCAL'`
+
+export TEXMFCNF TEXFONTMAPS ENCFONTS TEXMFMAIN TEXMFDIST TEXMFLOCAL
+
+./dvipng -T tight -strict $srcdir/dvipng-test.dvi || exit 1
+
+echo View the result e.g. with display dvipng-test\*.png
+
+./dvipng --gif -T tight -strict $srcdir/dvipng-test.dvi || exit 1
+
+echo View the result e.g. with display dvipng-test\*.gif
diff --git a/Build/source/texk/dvipng/help/Makefile.am b/Build/source/texk/dvipng/help/Makefile.am
new file mode 100644
index 00000000000..b9e7f8aea7d
--- /dev/null
+++ b/Build/source/texk/dvipng/help/Makefile.am
@@ -0,0 +1,30 @@
+## Makefile.am for the TeX Live subdirectory texk/dvipng/help/
+##
+## Copyright (C) 2009-2013 Peter Breitenlohner <tex-live@tug.org>
+## You may freely use, modify and/or distribute this file.
+##
+DVIPNG_HELP = $(top_srcdir)/doc/dvipng.help
+
+all-local: help-stamp $(DVIPNG_HELP)
+
+# If dvipng.help is to be rebuilt, this would fail for a read-only source
+# directory, but rebuilding dvipng.info would equally fail.
+# Do not even try to rebuild dvipng.help if help-stamp is up to date.
+$(DVIPNG_HELP): help-stamp
+help-stamp: ../dvipng$(EXEEXT)
+if !cross
+ -(cd .. && ./dvipng$(EXEEXT)) | \
+ sed -e's/dvipng.exe/dvipng/' \
+ -e's/ (dvipng) / /' \
+ -e's/ (dvipng (TeX Live)) / (TeX Live) /' \
+ -e's,/lt-dvipng ,/dvipng ,' \
+ -e's,^This is .*/dvipng ,This is ./dvipng ,' \
+ -e's,^Usage: .*/dvipng ,Usage: ./dvipng ,' > dvipng.tmp
+ ( test -r $(DVIPNG_HELP) && diff dvipng.tmp $(DVIPNG_HELP) ) \
+ || cp dvipng.tmp $(DVIPNG_HELP)
+ rm -f dvipng.tmp
+endif !cross
+ echo timestamp >$@
+
+DISTCLEANFILES = help-stamp
+
diff --git a/Build/source/texk/dvipng/help/Makefile.in b/Build/source/texk/dvipng/help/Makefile.in
new file mode 100644
index 00000000000..c28bca1e956
--- /dev/null
+++ b/Build/source/texk/dvipng/help/Makefile.in
@@ -0,0 +1,497 @@
+# Makefile.in generated by automake 1.16.3 from Makefile.am.
+# @configure_input@
+
+# Copyright (C) 1994-2020 Free Software Foundation, Inc.
+
+# This Makefile.in is free software; the Free Software Foundation
+# gives unlimited permission to copy and/or distribute it,
+# with or without modifications, as long as this notice is preserved.
+
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY, to the extent permitted by law; without
+# even the implied warranty of MERCHANTABILITY or FITNESS FOR A
+# PARTICULAR PURPOSE.
+
+@SET_MAKE@
+VPATH = @srcdir@
+am__is_gnu_make = { \
+ if test -z '$(MAKELEVEL)'; then \
+ false; \
+ elif test -n '$(MAKE_HOST)'; then \
+ true; \
+ elif test -n '$(MAKE_VERSION)' && test -n '$(CURDIR)'; then \
+ true; \
+ else \
+ false; \
+ fi; \
+}
+am__make_running_with_option = \
+ case $${target_option-} in \
+ ?) ;; \
+ *) echo "am__make_running_with_option: internal error: invalid" \
+ "target option '$${target_option-}' specified" >&2; \
+ exit 1;; \
+ esac; \
+ has_opt=no; \
+ sane_makeflags=$$MAKEFLAGS; \
+ if $(am__is_gnu_make); then \
+ sane_makeflags=$$MFLAGS; \
+ else \
+ case $$MAKEFLAGS in \
+ *\\[\ \ ]*) \
+ bs=\\; \
+ sane_makeflags=`printf '%s\n' "$$MAKEFLAGS" \
+ | sed "s/$$bs$$bs[$$bs $$bs ]*//g"`;; \
+ esac; \
+ fi; \
+ skip_next=no; \
+ strip_trailopt () \
+ { \
+ flg=`printf '%s\n' "$$flg" | sed "s/$$1.*$$//"`; \
+ }; \
+ for flg in $$sane_makeflags; do \
+ test $$skip_next = yes && { skip_next=no; continue; }; \
+ case $$flg in \
+ *=*|--*) continue;; \
+ -*I) strip_trailopt 'I'; skip_next=yes;; \
+ -*I?*) strip_trailopt 'I';; \
+ -*O) strip_trailopt 'O'; skip_next=yes;; \
+ -*O?*) strip_trailopt 'O';; \
+ -*l) strip_trailopt 'l'; skip_next=yes;; \
+ -*l?*) strip_trailopt 'l';; \
+ -[dEDm]) skip_next=yes;; \
+ -[JT]) skip_next=yes;; \
+ esac; \
+ case $$flg in \
+ *$$target_option*) has_opt=yes; break;; \
+ esac; \
+ done; \
+ test $$has_opt = yes
+am__make_dryrun = (target_option=n; $(am__make_running_with_option))
+am__make_keepgoing = (target_option=k; $(am__make_running_with_option))
+pkgdatadir = $(datadir)/@PACKAGE@
+pkgincludedir = $(includedir)/@PACKAGE@
+pkglibdir = $(libdir)/@PACKAGE@
+pkglibexecdir = $(libexecdir)/@PACKAGE@
+am__cd = CDPATH="$${ZSH_VERSION+.}$(PATH_SEPARATOR)" && cd
+install_sh_DATA = $(install_sh) -c -m 644
+install_sh_PROGRAM = $(install_sh) -c
+install_sh_SCRIPT = $(install_sh) -c
+INSTALL_HEADER = $(INSTALL_DATA)
+transform = $(program_transform_name)
+NORMAL_INSTALL = :
+PRE_INSTALL = :
+POST_INSTALL = :
+NORMAL_UNINSTALL = :
+PRE_UNINSTALL = :
+POST_UNINSTALL = :
+build_triplet = @build@
+host_triplet = @host@
+subdir = help
+ACLOCAL_M4 = $(top_srcdir)/aclocal.m4
+am__aclocal_m4_deps = $(top_srcdir)/m4/gs-device.m4 \
+ $(top_srcdir)/m4/makeinfo.m4 \
+ $(top_srcdir)/../../m4/kpse-common.m4 \
+ $(top_srcdir)/../../m4/kpse-freetype2-flags.m4 \
+ $(top_srcdir)/../../m4/kpse-gd-flags.m4 \
+ $(top_srcdir)/../../m4/kpse-kpathsea-flags.m4 \
+ $(top_srcdir)/../../m4/kpse-libpng-flags.m4 \
+ $(top_srcdir)/../../m4/kpse-warnings.m4 \
+ $(top_srcdir)/../../m4/kpse-win32.m4 \
+ $(top_srcdir)/../../m4/kpse-zlib-flags.m4 \
+ $(top_srcdir)/../../m4/libtool.m4 \
+ $(top_srcdir)/../../m4/ltoptions.m4 \
+ $(top_srcdir)/../../m4/ltsugar.m4 \
+ $(top_srcdir)/../../m4/ltversion.m4 \
+ $(top_srcdir)/../../m4/lt~obsolete.m4 $(top_srcdir)/version.ac \
+ $(top_srcdir)/ac/dvipng.ac $(top_srcdir)/configure.ac
+am__configure_deps = $(am__aclocal_m4_deps) $(CONFIGURE_DEPENDENCIES) \
+ $(ACLOCAL_M4)
+DIST_COMMON = $(srcdir)/Makefile.am $(am__DIST_COMMON)
+mkinstalldirs = $(install_sh) -d
+CONFIG_HEADER = $(top_builddir)/config.h
+CONFIG_CLEAN_FILES =
+CONFIG_CLEAN_VPATH_FILES =
+AM_V_P = $(am__v_P_@AM_V@)
+am__v_P_ = $(am__v_P_@AM_DEFAULT_V@)
+am__v_P_0 = false
+am__v_P_1 = :
+AM_V_GEN = $(am__v_GEN_@AM_V@)
+am__v_GEN_ = $(am__v_GEN_@AM_DEFAULT_V@)
+am__v_GEN_0 = @echo " GEN " $@;
+am__v_GEN_1 =
+AM_V_at = $(am__v_at_@AM_V@)
+am__v_at_ = $(am__v_at_@AM_DEFAULT_V@)
+am__v_at_0 = @
+am__v_at_1 =
+SOURCES =
+DIST_SOURCES =
+am__can_run_installinfo = \
+ case $$AM_UPDATE_INFO_DIR in \
+ n|no|NO) false;; \
+ *) (install-info --version) >/dev/null 2>&1;; \
+ esac
+am__tagged_files = $(HEADERS) $(SOURCES) $(TAGS_FILES) $(LISP)
+am__DIST_COMMON = $(srcdir)/Makefile.in
+DISTFILES = $(DIST_COMMON) $(DIST_SOURCES) $(TEXINFOS) $(EXTRA_DIST)
+ACLOCAL = @ACLOCAL@
+AMTAR = @AMTAR@
+AM_DEFAULT_VERBOSITY = @AM_DEFAULT_VERBOSITY@
+AM_MAKEINFOFLAGS = @AM_MAKEINFOFLAGS@
+AR = @AR@
+AS = @AS@
+AUTOCONF = @AUTOCONF@
+AUTOHEADER = @AUTOHEADER@
+AUTOMAKE = @AUTOMAKE@
+AWK = @AWK@
+CC = @CC@
+CCDEPMODE = @CCDEPMODE@
+CFLAGS = @CFLAGS@
+CPP = @CPP@
+CPPFLAGS = @CPPFLAGS@
+CYGPATH_W = @CYGPATH_W@
+DEFS = @DEFS@
+DEPDIR = @DEPDIR@
+DLLTOOL = @DLLTOOL@
+DSYMUTIL = @DSYMUTIL@
+DUMPBIN = @DUMPBIN@
+DVIPNG_TREE = @DVIPNG_TREE@
+ECHO_C = @ECHO_C@
+ECHO_N = @ECHO_N@
+ECHO_T = @ECHO_T@
+EGREP = @EGREP@
+EXEEXT = @EXEEXT@
+FGREP = @FGREP@
+FREETYPE2_DEPEND = @FREETYPE2_DEPEND@
+FREETYPE2_INCLUDES = @FREETYPE2_INCLUDES@
+FREETYPE2_LIBS = @FREETYPE2_LIBS@
+FT2_CONFIG = @FT2_CONFIG@
+GD_DEPEND = @GD_DEPEND@
+GD_INCLUDES = @GD_INCLUDES@
+GD_LIBS = @GD_LIBS@
+GREP = @GREP@
+GS = @GS@
+INSTALL = @INSTALL@
+INSTALL_DATA = @INSTALL_DATA@
+INSTALL_INFO = @INSTALL_INFO@
+INSTALL_PROGRAM = @INSTALL_PROGRAM@
+INSTALL_SCRIPT = @INSTALL_SCRIPT@
+INSTALL_STRIP_PROGRAM = @INSTALL_STRIP_PROGRAM@
+KPATHSEA_DEPEND = @KPATHSEA_DEPEND@
+KPATHSEA_INCLUDES = @KPATHSEA_INCLUDES@
+KPATHSEA_LIBS = @KPATHSEA_LIBS@
+LD = @LD@
+LDFLAGS = @LDFLAGS@
+LIBOBJS = @LIBOBJS@
+LIBPNG_DEPEND = @LIBPNG_DEPEND@
+LIBPNG_INCLUDES = @LIBPNG_INCLUDES@
+LIBPNG_LIBS = @LIBPNG_LIBS@
+LIBS = @LIBS@
+LIBTOOL = @LIBTOOL@
+LIPO = @LIPO@
+LN_S = @LN_S@
+LTLIBOBJS = @LTLIBOBJS@
+LT_SYS_LIBRARY_PATH = @LT_SYS_LIBRARY_PATH@
+MAINT = @MAINT@
+MAKEINFO = @MAKEINFO@
+MANIFEST_TOOL = @MANIFEST_TOOL@
+MKDIR_P = @MKDIR_P@
+NM = @NM@
+NMEDIT = @NMEDIT@
+OBJDUMP = @OBJDUMP@
+OBJEXT = @OBJEXT@
+OTOOL = @OTOOL@
+OTOOL64 = @OTOOL64@
+PACKAGE = @PACKAGE@
+PACKAGE_BUGREPORT = @PACKAGE_BUGREPORT@
+PACKAGE_NAME = @PACKAGE_NAME@
+PACKAGE_STRING = @PACKAGE_STRING@
+PACKAGE_TARNAME = @PACKAGE_TARNAME@
+PACKAGE_URL = @PACKAGE_URL@
+PACKAGE_VERSION = @PACKAGE_VERSION@
+PATH_SEPARATOR = @PATH_SEPARATOR@
+PKG_CONFIG = @PKG_CONFIG@
+POW_LIB = @POW_LIB@
+RANLIB = @RANLIB@
+SED = @SED@
+SET_MAKE = @SET_MAKE@
+SHELL = @SHELL@
+STRIP = @STRIP@
+VERSION = @VERSION@
+WARNING_CFLAGS = @WARNING_CFLAGS@
+ZLIB_DEPEND = @ZLIB_DEPEND@
+ZLIB_INCLUDES = @ZLIB_INCLUDES@
+ZLIB_LIBS = @ZLIB_LIBS@
+abs_builddir = @abs_builddir@
+abs_srcdir = @abs_srcdir@
+abs_top_builddir = @abs_top_builddir@
+abs_top_srcdir = @abs_top_srcdir@
+ac_ct_AR = @ac_ct_AR@
+ac_ct_CC = @ac_ct_CC@
+ac_ct_DUMPBIN = @ac_ct_DUMPBIN@
+am__include = @am__include@
+am__leading_dot = @am__leading_dot@
+am__quote = @am__quote@
+am__tar = @am__tar@
+am__untar = @am__untar@
+bindir = @bindir@
+build = @build@
+build_alias = @build_alias@
+build_cpu = @build_cpu@
+build_os = @build_os@
+build_vendor = @build_vendor@
+builddir = @builddir@
+datadir = @datadir@
+datarootdir = @datarootdir@
+docdir = @docdir@
+dvidir = @dvidir@
+exec_prefix = @exec_prefix@
+host = @host@
+host_alias = @host_alias@
+host_cpu = @host_cpu@
+host_os = @host_os@
+host_vendor = @host_vendor@
+htmldir = @htmldir@
+includedir = @includedir@
+infodir = @infodir@
+install_sh = @install_sh@
+libdir = @libdir@
+libexecdir = @libexecdir@
+localedir = @localedir@
+localstatedir = @localstatedir@
+mandir = @mandir@
+mkdir_p = @mkdir_p@
+oldincludedir = @oldincludedir@
+pdfdir = @pdfdir@
+prefix = @prefix@
+program_transform_name = @program_transform_name@
+psdir = @psdir@
+sbindir = @sbindir@
+sharedstatedir = @sharedstatedir@
+srcdir = @srcdir@
+sysconfdir = @sysconfdir@
+target_alias = @target_alias@
+top_build_prefix = @top_build_prefix@
+top_builddir = @top_builddir@
+top_srcdir = @top_srcdir@
+DVIPNG_HELP = $(top_srcdir)/doc/dvipng.help
+DISTCLEANFILES = help-stamp
+all: all-am
+
+.SUFFIXES:
+$(srcdir)/Makefile.in: @MAINTAINER_MODE_TRUE@ $(srcdir)/Makefile.am $(am__configure_deps)
+ @for dep in $?; do \
+ case '$(am__configure_deps)' in \
+ *$$dep*) \
+ ( cd $(top_builddir) && $(MAKE) $(AM_MAKEFLAGS) am--refresh ) \
+ && { if test -f $@; then exit 0; else break; fi; }; \
+ exit 1;; \
+ esac; \
+ done; \
+ echo ' cd $(top_srcdir) && $(AUTOMAKE) --foreign help/Makefile'; \
+ $(am__cd) $(top_srcdir) && \
+ $(AUTOMAKE) --foreign help/Makefile
+Makefile: $(srcdir)/Makefile.in $(top_builddir)/config.status
+ @case '$?' in \
+ *config.status*) \
+ cd $(top_builddir) && $(MAKE) $(AM_MAKEFLAGS) am--refresh;; \
+ *) \
+ echo ' cd $(top_builddir) && $(SHELL) ./config.status $(subdir)/$@ $(am__maybe_remake_depfiles)'; \
+ cd $(top_builddir) && $(SHELL) ./config.status $(subdir)/$@ $(am__maybe_remake_depfiles);; \
+ esac;
+
+$(top_builddir)/config.status: $(top_srcdir)/configure $(CONFIG_STATUS_DEPENDENCIES)
+ cd $(top_builddir) && $(MAKE) $(AM_MAKEFLAGS) am--refresh
+
+$(top_srcdir)/configure: @MAINTAINER_MODE_TRUE@ $(am__configure_deps)
+ cd $(top_builddir) && $(MAKE) $(AM_MAKEFLAGS) am--refresh
+$(ACLOCAL_M4): @MAINTAINER_MODE_TRUE@ $(am__aclocal_m4_deps)
+ cd $(top_builddir) && $(MAKE) $(AM_MAKEFLAGS) am--refresh
+$(am__aclocal_m4_deps):
+
+mostlyclean-libtool:
+ -rm -f *.lo
+
+clean-libtool:
+ -rm -rf .libs _libs
+tags TAGS:
+
+ctags CTAGS:
+
+cscope cscopelist:
+
+
+distdir: $(BUILT_SOURCES)
+ $(MAKE) $(AM_MAKEFLAGS) distdir-am
+
+distdir-am: $(DISTFILES)
+ @srcdirstrip=`echo "$(srcdir)" | sed 's/[].[^$$\\*]/\\\\&/g'`; \
+ topsrcdirstrip=`echo "$(top_srcdir)" | sed 's/[].[^$$\\*]/\\\\&/g'`; \
+ list='$(DISTFILES)'; \
+ dist_files=`for file in $$list; do echo $$file; done | \
+ sed -e "s|^$$srcdirstrip/||;t" \
+ -e "s|^$$topsrcdirstrip/|$(top_builddir)/|;t"`; \
+ case $$dist_files in \
+ */*) $(MKDIR_P) `echo "$$dist_files" | \
+ sed '/\//!d;s|^|$(distdir)/|;s,/[^/]*$$,,' | \
+ sort -u` ;; \
+ esac; \
+ for file in $$dist_files; do \
+ if test -f $$file || test -d $$file; then d=.; else d=$(srcdir); fi; \
+ if test -d $$d/$$file; then \
+ dir=`echo "/$$file" | sed -e 's,/[^/]*$$,,'`; \
+ if test -d "$(distdir)/$$file"; then \
+ find "$(distdir)/$$file" -type d ! -perm -700 -exec chmod u+rwx {} \;; \
+ fi; \
+ if test -d $(srcdir)/$$file && test $$d != $(srcdir); then \
+ cp -fpR $(srcdir)/$$file "$(distdir)$$dir" || exit 1; \
+ find "$(distdir)/$$file" -type d ! -perm -700 -exec chmod u+rwx {} \;; \
+ fi; \
+ cp -fpR $$d/$$file "$(distdir)$$dir" || exit 1; \
+ else \
+ test -f "$(distdir)/$$file" \
+ || cp -p $$d/$$file "$(distdir)/$$file" \
+ || exit 1; \
+ fi; \
+ done
+check-am: all-am
+check: check-am
+all-am: Makefile all-local
+installdirs:
+install: install-am
+install-exec: install-exec-am
+install-data: install-data-am
+uninstall: uninstall-am
+
+install-am: all-am
+ @$(MAKE) $(AM_MAKEFLAGS) install-exec-am install-data-am
+
+installcheck: installcheck-am
+install-strip:
+ if test -z '$(STRIP)'; then \
+ $(MAKE) $(AM_MAKEFLAGS) INSTALL_PROGRAM="$(INSTALL_STRIP_PROGRAM)" \
+ install_sh_PROGRAM="$(INSTALL_STRIP_PROGRAM)" INSTALL_STRIP_FLAG=-s \
+ install; \
+ else \
+ $(MAKE) $(AM_MAKEFLAGS) INSTALL_PROGRAM="$(INSTALL_STRIP_PROGRAM)" \
+ install_sh_PROGRAM="$(INSTALL_STRIP_PROGRAM)" INSTALL_STRIP_FLAG=-s \
+ "INSTALL_PROGRAM_ENV=STRIPPROG='$(STRIP)'" install; \
+ fi
+mostlyclean-generic:
+
+clean-generic:
+
+distclean-generic:
+ -test -z "$(CONFIG_CLEAN_FILES)" || rm -f $(CONFIG_CLEAN_FILES)
+ -test . = "$(srcdir)" || test -z "$(CONFIG_CLEAN_VPATH_FILES)" || rm -f $(CONFIG_CLEAN_VPATH_FILES)
+ -test -z "$(DISTCLEANFILES)" || rm -f $(DISTCLEANFILES)
+
+maintainer-clean-generic:
+ @echo "This command is intended for maintainers to use"
+ @echo "it deletes files that may require special tools to rebuild."
+clean: clean-am
+
+clean-am: clean-generic clean-libtool mostlyclean-am
+
+distclean: distclean-am
+ -rm -f Makefile
+distclean-am: clean-am distclean-generic
+
+dvi: dvi-am
+
+dvi-am:
+
+html: html-am
+
+html-am:
+
+info: info-am
+
+info-am:
+
+install-data-am:
+
+install-dvi: install-dvi-am
+
+install-dvi-am:
+
+install-exec-am:
+
+install-html: install-html-am
+
+install-html-am:
+
+install-info: install-info-am
+
+install-info-am:
+
+install-man:
+
+install-pdf: install-pdf-am
+
+install-pdf-am:
+
+install-ps: install-ps-am
+
+install-ps-am:
+
+installcheck-am:
+
+maintainer-clean: maintainer-clean-am
+ -rm -f Makefile
+maintainer-clean-am: distclean-am maintainer-clean-generic
+
+mostlyclean: mostlyclean-am
+
+mostlyclean-am: mostlyclean-generic mostlyclean-libtool
+
+pdf: pdf-am
+
+pdf-am:
+
+ps: ps-am
+
+ps-am:
+
+uninstall-am:
+
+.MAKE: install-am install-strip
+
+.PHONY: all all-am all-local check check-am clean clean-generic \
+ clean-libtool cscopelist-am ctags-am distclean \
+ distclean-generic distclean-libtool distdir dvi dvi-am html \
+ html-am info info-am install install-am install-data \
+ install-data-am install-dvi install-dvi-am install-exec \
+ install-exec-am install-html install-html-am install-info \
+ install-info-am install-man install-pdf install-pdf-am \
+ install-ps install-ps-am install-strip installcheck \
+ installcheck-am installdirs maintainer-clean \
+ maintainer-clean-generic mostlyclean mostlyclean-generic \
+ mostlyclean-libtool pdf pdf-am ps ps-am tags-am uninstall \
+ uninstall-am
+
+.PRECIOUS: Makefile
+
+
+all-local: help-stamp $(DVIPNG_HELP)
+
+# If dvipng.help is to be rebuilt, this would fail for a read-only source
+# directory, but rebuilding dvipng.info would equally fail.
+# Do not even try to rebuild dvipng.help if help-stamp is up to date.
+$(DVIPNG_HELP): help-stamp
+help-stamp: ../dvipng$(EXEEXT)
+@cross_FALSE@ -(cd .. && ./dvipng$(EXEEXT)) | \
+@cross_FALSE@ sed -e's/dvipng.exe/dvipng/' \
+@cross_FALSE@ -e's/ (dvipng) / /' \
+@cross_FALSE@ -e's/ (dvipng (TeX Live)) / (TeX Live) /' \
+@cross_FALSE@ -e's,/lt-dvipng ,/dvipng ,' \
+@cross_FALSE@ -e's,^This is .*/dvipng ,This is ./dvipng ,' \
+@cross_FALSE@ -e's,^Usage: .*/dvipng ,Usage: ./dvipng ,' > dvipng.tmp
+@cross_FALSE@ ( test -r $(DVIPNG_HELP) && diff dvipng.tmp $(DVIPNG_HELP) ) \
+@cross_FALSE@ || cp dvipng.tmp $(DVIPNG_HELP)
+@cross_FALSE@ rm -f dvipng.tmp
+ echo timestamp >$@
+
+# Tell versions [3.59,3.63) of GNU make to not export all variables.
+# Otherwise a system limit (for SysV at least) may be exceeded.
+.NOEXPORT:
diff --git a/Build/source/texk/dvipng/m4/gs-device.m4 b/Build/source/texk/dvipng/m4/gs-device.m4
new file mode 100644
index 00000000000..6b726f2e91f
--- /dev/null
+++ b/Build/source/texk/dvipng/m4/gs-device.m4
@@ -0,0 +1,41 @@
+# Autoconf macros for dvipng.
+# Copyright (C) 2002-2010 Jan-Åke Larsson <jan-ake.larsson@liu.se>
+# Copyright (C) 2010-2013 Peter Breitenlohner <tex-live@tug.org>
+#
+# This file is free software; the copyright holders
+# give unlimited permission to copy and/or distribute it,
+# with or without modifications, as long as this notice is preserved.
+#
+# Extracted from dvipng-1.12/aclocal.m4 and adapted for use in TeX Live.
+
+# GS_CHECK_DEVICES
+# ----------------
+# Check GS (ghostscript) devices.
+AC_DEFUN([GS_CHECK_DEVICES], [dnl
+GS_WARN=
+_GS_HAS_DEVICE([pngalpha],
+ [GS_WARN="Your EPS inclusions will be cropped to the
+ boundingbox, and rendered on an opaque background.
+ Upgrade GhostScript to avoid this."
+ _GS_HAS_DEVICE([png16m],
+ [GS_WARN="Your EPS inclusions may not work.
+ Upgrade/install GhostScript to avoid this."])])
+if test -n "$GS_WARN"; then
+ AC_MSG_WARN([$GS_WARN])
+fi
+]) # GS_CHECK_DEVICES
+
+# _GS_HAS_DEVICE(DEVICE, ACTION-IF-FAILED)
+# ----------------------------------------
+# Internal subroutine. Check if GS has the device DEVICE and
+# execute the shell code ACTION-IF-FAILED if not.
+m4_define([_GS_HAS_DEVICE], [dnl
+AC_MSG_CHECKING([whether $GS has the $1 device])
+if $GS -h | grep $1 >/dev/null; then
+ AC_MSG_RESULT([yes])
+else
+ AC_MSG_RESULT([no])
+ $2
+fi
+])# _GS_HAS_DEVICE
+
diff --git a/Build/source/texk/dvipng/m4/makeinfo.m4 b/Build/source/texk/dvipng/m4/makeinfo.m4
new file mode 100644
index 00000000000..0ddff45ecde
--- /dev/null
+++ b/Build/source/texk/dvipng/m4/makeinfo.m4
@@ -0,0 +1,41 @@
+# Autoconf macros for dvipng.
+# Copyright (C) 2002-2008 Jan-Åke Larsson <jan-ake.larsson@liu.se>
+# Copyright (C) 2008-2013 Peter Breitenlohner <tex-live@tug.org>
+#
+# This file is free software; the copyright holders
+# give unlimited permission to copy and/or distribute it,
+# with or without modifications, as long as this notice is preserved.
+#
+# Extracted from dvipng-1.9/aclocal.m4 and adapted for use in TeX Live.
+
+# MAKEINFO_CHECK_MACROS(MACRO ...)
+# --------------------------------
+# For each MACRO check if makeinfo understands @MACRO{}.
+# Prepend '-D no-MACRO' for each MACRO not understood to the
+# output variable AM_MAKEINFOFLAGS.
+AC_DEFUN([MAKEINFO_CHECK_MACROS], [dnl
+if test -n "$MAKEINFO" -a "$MAKEINFO" != ":"; then
+ for ac_macro in $1; do
+ _MAKEINFO_CHECK_MACRO([$ac_macro])
+ done
+fi
+AC_SUBST([AM_MAKEINFOFLAGS])
+])# MAKEINFO_CHECK_MACROS
+
+# _MAKEINFO_CHECK_MACRO(MACRO)
+# ----------------------------
+# Internal subroutine. Check if makeinfo understands @MACRO{}
+# and prepend '-D no-MACRO' to AM_MAKEINFOFLAGS if not.
+m4_define([_MAKEINFO_CHECK_MACRO], [dnl
+AC_MSG_CHECKING([if $MAKEINFO understands @$1{}])
+echo \\\\input texinfo > conftest.texi
+echo @$1{test} >> conftest.texi
+if $MAKEINFO conftest.texi > /dev/null 2> /dev/null; then
+ AC_MSG_RESULT([yes])
+else
+ AC_MSG_RESULT([no])
+ AM_MAKEINFOFLAGS="-D no-$1 $AM_MAKEINFOFLAGS"
+fi
+rm -f conftest.texi conftest.info
+])# _MAKEINFO_CHECK_MACRO
+
diff --git a/Build/source/texk/dvipng/version.ac b/Build/source/texk/dvipng/version.ac
new file mode 100644
index 00000000000..63e89299a64
--- /dev/null
+++ b/Build/source/texk/dvipng/version.ac
@@ -0,0 +1,12 @@
+dnl
+dnl Copyright 2016-2019 Karl Berry <tex-live@tug.org>
+dnl Copyright 2013-2015 Peter Breitenlohner <tex-live@tug.org>
+dnl
+dnl This file is free software; the copyright holder
+dnl gives unlimited permission to copy and/or distribute it,
+dnl with or without modifications, as long as this notice is preserved.
+dnl
+dnl --------------------------------------------------------
+dnl
+dnl m4-include this file to define the current dvipng version
+m4_define([dvipng_version], [1.17])