diff options
35 files changed, 2283 insertions, 1971 deletions
diff --git a/FILES.byname b/FILES.byname index 64d643a00b..560f8bb2d5 100644 --- a/FILES.byname +++ b/FILES.byname @@ -2037,10 +2037,10 @@ 2022/09/23 | 591448 | biblio/citation-style-language.zip 2022/10/08 | 1476 | biblio/ctan-bibdata/biblatex-ctan/ctan.bbx 2022/10/08 | 127 | biblio/ctan-bibdata/biblatex-ctan/ctan.cbx -2022/10/08 | 2596079 | biblio/ctan-bibdata/ctan.bib -2022/10/08 | 2795675 | biblio/ctan-bibdata/ctan.pdf +2022/10/09 | 2598283 | biblio/ctan-bibdata/ctan.bib +2022/10/09 | 2139676 | biblio/ctan-bibdata/ctan.pdf 2022/10/08 | 1415 | biblio/ctan-bibdata/README -2022/10/08 | 3221509 | biblio/ctan-bibdata.zip +2022/10/09 | 2606778 | biblio/ctan-bibdata.zip 2022/02/06 | 3110 | biblio/pbibtex/pbibtex-base/cpp.awk 2022/02/06 | 1009 | biblio/pbibtex/pbibtex-base/generate.sh 2022/02/06 | 22422 | biblio/pbibtex/pbibtex-base/jabbrv.bst @@ -5414,7 +5414,7 @@ 1990/10/02 | 5440 | dviware/vutex/vaxvms.hlp 1990/10/02 | 812 | dviware/vutex/vaxvms.ins 1990/10/02 | 127576 | dviware/vutex/vutex.web -2022/10/08 | 116774 | FILES.last07days +2022/10/09 | 115585 | FILES.last07days 2021/07/24 | 1139410 | fonts/aboensis/Aboensis.glyphs 2021/07/24 | 18907382 | fonts/aboensis/aboensis.pdf 2021/07/24 | 137860 | fonts/aboensis/Aboensis-Regular.otf @@ -132853,120 +132853,120 @@ 2013/04/24 | 968 | fonts/sansmathaccent/vf/mathkerncmssxi8.vf 2013/04/24 | 968 | fonts/sansmathaccent/vf/mathkerncmssxi9.vf 2020/02/01 | 179187 | fonts/sansmathaccent.zip -2021/06/22 | 605 | fonts/sansmathfonts/README.txt +2022/10/09 | 605 | fonts/sansmathfonts/README.txt 2017/02/16 | 8925 | fonts/sansmathfonts/sansmathfonts.map -2021/06/22 | 292658 | fonts/sansmathfonts/sansmathfonts.pdf -2021/06/22 | 16766 | fonts/sansmathfonts/sansmathfonts.tex -2013/04/13 | 5184 | fonts/sansmathfonts/source/cmsmfIPiXi10.mf -2013/04/13 | 5184 | fonts/sansmathfonts/source/cmsmfIPiXi12.mf -2013/04/13 | 5187 | fonts/sansmathfonts/source/cmsmfIPiXi17.mf -2013/04/13 | 5117 | fonts/sansmathfonts/source/cmsmfIPiXi8.mf -2013/04/13 | 5117 | fonts/sansmathfonts/source/cmsmfIPiXi9.mf -2013/04/13 | 5221 | fonts/sansmathfonts/source/cmsmfIPiXibx10.mf -2013/04/13 | 5575 | fonts/sansmathfonts/source/cmsmfIPiXibx12.mf -2013/04/13 | 5590 | fonts/sansmathfonts/source/cmsmfIPiXibx17.mf -2013/04/13 | 5528 | fonts/sansmathfonts/source/cmsmfIPiXibx8.mf -2013/04/13 | 5528 | fonts/sansmathfonts/source/cmsmfIPiXibx9.mf -2013/04/22 | 7644 | fonts/sansmathfonts/source/cmsmfIPiXibxcsc10.mf -2013/04/22 | 7513 | fonts/sansmathfonts/source/cmsmfIPiXicsc10.mf -2013/04/22 | 7450 | fonts/sansmathfonts/source/cmsmfIPiXicsc8.mf -2013/04/22 | 7450 | fonts/sansmathfonts/source/cmsmfIPiXicsc9.mf -2013/04/22 | 7584 | fonts/sansmathfonts/source/cmsmfIPiXicsci10.mf -2013/04/22 | 7521 | fonts/sansmathfonts/source/cmsmfIPiXicsci8.mf -2013/04/22 | 7521 | fonts/sansmathfonts/source/cmsmfIPiXicsci9.mf -2013/04/13 | 5246 | fonts/sansmathfonts/source/cmsmfIPiXii10.mf -2013/04/13 | 5246 | fonts/sansmathfonts/source/cmsmfIPiXii12.mf -2013/04/13 | 5249 | fonts/sansmathfonts/source/cmsmfIPiXii17.mf -2013/04/13 | 5179 | fonts/sansmathfonts/source/cmsmfIPiXii8.mf -2013/04/13 | 5179 | fonts/sansmathfonts/source/cmsmfIPiXii9.mf -2013/04/13 | 5688 | fonts/sansmathfonts/source/cmsmfIPiXixi10.mf -2013/04/13 | 5685 | fonts/sansmathfonts/source/cmsmfIPiXixi12.mf -2013/04/13 | 5706 | fonts/sansmathfonts/source/cmsmfIPiXixi17.mf -2013/04/13 | 5621 | fonts/sansmathfonts/source/cmsmfIPiXixi8.mf -2013/04/13 | 5621 | fonts/sansmathfonts/source/cmsmfIPiXixi9.mf -2013/04/22 | 7658 | fonts/sansmathfonts/source/cmsmfIPiXixicsc10.mf -2013/04/13 | 7011 | fonts/sansmathfonts/source/cmssbsy10.mf -2013/04/13 | 7144 | fonts/sansmathfonts/source/cmssbsy5.mf -2013/04/13 | 7145 | fonts/sansmathfonts/source/cmssbsy6.mf -2013/04/13 | 7147 | fonts/sansmathfonts/source/cmssbsy7.mf -2013/04/13 | 7147 | fonts/sansmathfonts/source/cmssbsy8.mf -2013/04/13 | 7161 | fonts/sansmathfonts/source/cmssbsy9.mf -2013/04/22 | 7138 | fonts/sansmathfonts/source/cmssbxcsc10.mf -2013/04/22 | 7013 | fonts/sansmathfonts/source/cmsscsc10.mf -2013/04/22 | 6955 | fonts/sansmathfonts/source/cmsscsc8.mf -2013/04/22 | 6955 | fonts/sansmathfonts/source/cmsscsc9.mf -2013/04/22 | 7080 | fonts/sansmathfonts/source/cmsscsci10.mf -2013/04/22 | 7022 | fonts/sansmathfonts/source/cmsscsci8.mf -2013/04/22 | 7022 | fonts/sansmathfonts/source/cmsscsci9.mf -2013/04/13 | 5589 | fonts/sansmathfonts/source/cmssex10.mf -2013/04/13 | 5879 | fonts/sansmathfonts/source/cmssex7.mf -2013/04/13 | 5521 | fonts/sansmathfonts/source/cmssex8.mf -2013/04/13 | 5521 | fonts/sansmathfonts/source/cmssex9.mf -2013/04/13 | 5234 | fonts/sansmathfonts/source/cmssmi10.mf -2013/04/13 | 5543 | fonts/sansmathfonts/source/cmssmi5.mf -2013/04/13 | 5543 | fonts/sansmathfonts/source/cmssmi6.mf -2013/04/13 | 5543 | fonts/sansmathfonts/source/cmssmi7.mf -2013/04/13 | 5167 | fonts/sansmathfonts/source/cmssmi8.mf -2013/04/13 | 5167 | fonts/sansmathfonts/source/cmssmi9.mf -2013/04/13 | 5665 | fonts/sansmathfonts/source/cmssmib10.mf -2013/04/13 | 5598 | fonts/sansmathfonts/source/cmssmib5.mf -2013/04/13 | 5598 | fonts/sansmathfonts/source/cmssmib6.mf -2013/04/13 | 5598 | fonts/sansmathfonts/source/cmssmib7.mf -2013/04/13 | 5598 | fonts/sansmathfonts/source/cmssmib8.mf -2013/04/13 | 5598 | fonts/sansmathfonts/source/cmssmib9.mf -2013/04/13 | 6589 | fonts/sansmathfonts/source/cmsssy10.mf -2013/04/13 | 6864 | fonts/sansmathfonts/source/cmsssy5.mf -2013/04/13 | 6865 | fonts/sansmathfonts/source/cmsssy6.mf -2013/04/13 | 6867 | fonts/sansmathfonts/source/cmsssy7.mf -2013/04/13 | 6491 | fonts/sansmathfonts/source/cmsssy8.mf -2013/04/13 | 6514 | fonts/sansmathfonts/source/cmsssy9.mf -2013/04/22 | 5171 | fonts/sansmathfonts/source/cmssu10.mf -2013/04/22 | 7146 | fonts/sansmathfonts/source/cmssxicsc10.mf -2012/05/06 | 119 | fonts/sansmathfonts/source/eczi0500.mf -2012/05/06 | 119 | fonts/sansmathfonts/source/eczi0600.mf -2012/05/06 | 119 | fonts/sansmathfonts/source/eczi0700.mf -2012/05/06 | 119 | fonts/sansmathfonts/source/eczi0800.mf -2012/05/06 | 119 | fonts/sansmathfonts/source/eczi0900.mf -2012/05/06 | 120 | fonts/sansmathfonts/source/eczi1000.mf -2012/05/06 | 123 | fonts/sansmathfonts/source/eczi1095.mf -2012/05/06 | 120 | fonts/sansmathfonts/source/eczi1200.mf -2012/05/06 | 122 | fonts/sansmathfonts/source/eczi1440.mf -2012/05/06 | 123 | fonts/sansmathfonts/source/eczi1728.mf -2012/05/06 | 123 | fonts/sansmathfonts/source/eczi2074.mf -2012/05/06 | 123 | fonts/sansmathfonts/source/eczi2488.mf -2012/05/06 | 123 | fonts/sansmathfonts/source/eczi2986.mf -2012/05/06 | 123 | fonts/sansmathfonts/source/eczi3583.mf -2013/04/13 | 23725 | fonts/sansmathfonts/source/eczi.mf -2012/05/06 | 119 | fonts/sansmathfonts/source/eczo0500.mf -2012/05/06 | 119 | fonts/sansmathfonts/source/eczo0600.mf -2012/05/06 | 119 | fonts/sansmathfonts/source/eczo0700.mf -2012/05/06 | 119 | fonts/sansmathfonts/source/eczo0800.mf -2012/05/06 | 119 | fonts/sansmathfonts/source/eczo0900.mf -2012/05/06 | 120 | fonts/sansmathfonts/source/eczo1000.mf -2012/05/06 | 123 | fonts/sansmathfonts/source/eczo1095.mf -2012/05/06 | 120 | fonts/sansmathfonts/source/eczo1200.mf -2012/05/06 | 122 | fonts/sansmathfonts/source/eczo1440.mf -2012/05/06 | 123 | fonts/sansmathfonts/source/eczo1728.mf -2012/05/06 | 123 | fonts/sansmathfonts/source/eczo2074.mf -2012/05/06 | 123 | fonts/sansmathfonts/source/eczo2488.mf -2012/05/06 | 123 | fonts/sansmathfonts/source/eczo2986.mf -2012/05/06 | 123 | fonts/sansmathfonts/source/eczo3583.mf -2013/04/13 | 6839 | fonts/sansmathfonts/source/eczo.mf -2012/05/06 | 119 | fonts/sansmathfonts/source/eczx0500.mf -2012/05/06 | 119 | fonts/sansmathfonts/source/eczx0600.mf -2012/05/06 | 119 | fonts/sansmathfonts/source/eczx0700.mf -2012/05/06 | 119 | fonts/sansmathfonts/source/eczx0800.mf -2012/05/06 | 119 | fonts/sansmathfonts/source/eczx0900.mf -2012/05/06 | 120 | fonts/sansmathfonts/source/eczx1000.mf -2012/05/06 | 123 | fonts/sansmathfonts/source/eczx1095.mf -2012/05/06 | 120 | fonts/sansmathfonts/source/eczx1200.mf -2012/05/06 | 122 | fonts/sansmathfonts/source/eczx1440.mf -2012/05/06 | 123 | fonts/sansmathfonts/source/eczx1728.mf -2012/05/06 | 123 | fonts/sansmathfonts/source/eczx2074.mf -2012/05/06 | 123 | fonts/sansmathfonts/source/eczx2488.mf -2012/05/06 | 123 | fonts/sansmathfonts/source/eczx2986.mf -2012/05/06 | 123 | fonts/sansmathfonts/source/eczx3583.mf -2013/04/13 | 10488 | fonts/sansmathfonts/source/eczx.mf +2022/10/08 | 361001 | fonts/sansmathfonts/sansmathfonts.pdf +2022/10/09 | 17020 | fonts/sansmathfonts/sansmathfonts.tex +2013/04/14 | 5184 | fonts/sansmathfonts/source/cmsmfIPiXi10.mf +2013/04/14 | 5184 | fonts/sansmathfonts/source/cmsmfIPiXi12.mf +2013/04/14 | 5187 | fonts/sansmathfonts/source/cmsmfIPiXi17.mf +2013/04/14 | 5117 | fonts/sansmathfonts/source/cmsmfIPiXi8.mf +2013/04/14 | 5117 | fonts/sansmathfonts/source/cmsmfIPiXi9.mf +2013/04/14 | 5221 | fonts/sansmathfonts/source/cmsmfIPiXibx10.mf +2013/04/14 | 5575 | fonts/sansmathfonts/source/cmsmfIPiXibx12.mf +2013/04/14 | 5590 | fonts/sansmathfonts/source/cmsmfIPiXibx17.mf +2013/04/14 | 5528 | fonts/sansmathfonts/source/cmsmfIPiXibx8.mf +2013/04/14 | 5528 | fonts/sansmathfonts/source/cmsmfIPiXibx9.mf +2013/04/23 | 7644 | fonts/sansmathfonts/source/cmsmfIPiXibxcsc10.mf +2013/04/23 | 7513 | fonts/sansmathfonts/source/cmsmfIPiXicsc10.mf +2013/04/23 | 7450 | fonts/sansmathfonts/source/cmsmfIPiXicsc8.mf +2013/04/23 | 7450 | fonts/sansmathfonts/source/cmsmfIPiXicsc9.mf +2013/04/23 | 7584 | fonts/sansmathfonts/source/cmsmfIPiXicsci10.mf +2013/04/23 | 7521 | fonts/sansmathfonts/source/cmsmfIPiXicsci8.mf +2013/04/23 | 7521 | fonts/sansmathfonts/source/cmsmfIPiXicsci9.mf +2013/04/14 | 5246 | fonts/sansmathfonts/source/cmsmfIPiXii10.mf +2013/04/14 | 5246 | fonts/sansmathfonts/source/cmsmfIPiXii12.mf +2013/04/14 | 5249 | fonts/sansmathfonts/source/cmsmfIPiXii17.mf +2013/04/14 | 5179 | fonts/sansmathfonts/source/cmsmfIPiXii8.mf +2013/04/14 | 5179 | fonts/sansmathfonts/source/cmsmfIPiXii9.mf +2013/04/14 | 5688 | fonts/sansmathfonts/source/cmsmfIPiXixi10.mf +2013/04/14 | 5685 | fonts/sansmathfonts/source/cmsmfIPiXixi12.mf +2013/04/14 | 5706 | fonts/sansmathfonts/source/cmsmfIPiXixi17.mf +2013/04/14 | 5621 | fonts/sansmathfonts/source/cmsmfIPiXixi8.mf +2013/04/14 | 5621 | fonts/sansmathfonts/source/cmsmfIPiXixi9.mf +2013/04/23 | 7658 | fonts/sansmathfonts/source/cmsmfIPiXixicsc10.mf +2013/04/14 | 7011 | fonts/sansmathfonts/source/cmssbsy10.mf +2013/04/14 | 7144 | fonts/sansmathfonts/source/cmssbsy5.mf +2013/04/14 | 7145 | fonts/sansmathfonts/source/cmssbsy6.mf +2013/04/14 | 7147 | fonts/sansmathfonts/source/cmssbsy7.mf +2013/04/14 | 7147 | fonts/sansmathfonts/source/cmssbsy8.mf +2013/04/14 | 7161 | fonts/sansmathfonts/source/cmssbsy9.mf +2013/04/23 | 7138 | fonts/sansmathfonts/source/cmssbxcsc10.mf +2013/04/23 | 7013 | fonts/sansmathfonts/source/cmsscsc10.mf +2013/04/23 | 6955 | fonts/sansmathfonts/source/cmsscsc8.mf +2013/04/23 | 6955 | fonts/sansmathfonts/source/cmsscsc9.mf +2013/04/23 | 7080 | fonts/sansmathfonts/source/cmsscsci10.mf +2013/04/23 | 7022 | fonts/sansmathfonts/source/cmsscsci8.mf +2013/04/23 | 7022 | fonts/sansmathfonts/source/cmsscsci9.mf +2013/04/14 | 5589 | fonts/sansmathfonts/source/cmssex10.mf +2013/04/14 | 5879 | fonts/sansmathfonts/source/cmssex7.mf +2013/04/14 | 5521 | fonts/sansmathfonts/source/cmssex8.mf +2013/04/14 | 5521 | fonts/sansmathfonts/source/cmssex9.mf +2013/04/14 | 5234 | fonts/sansmathfonts/source/cmssmi10.mf +2013/04/14 | 5543 | fonts/sansmathfonts/source/cmssmi5.mf +2013/04/14 | 5543 | fonts/sansmathfonts/source/cmssmi6.mf +2013/04/14 | 5543 | fonts/sansmathfonts/source/cmssmi7.mf +2013/04/14 | 5167 | fonts/sansmathfonts/source/cmssmi8.mf +2013/04/14 | 5167 | fonts/sansmathfonts/source/cmssmi9.mf +2013/04/14 | 5665 | fonts/sansmathfonts/source/cmssmib10.mf +2013/04/14 | 5598 | fonts/sansmathfonts/source/cmssmib5.mf +2013/04/14 | 5598 | fonts/sansmathfonts/source/cmssmib6.mf +2013/04/14 | 5598 | fonts/sansmathfonts/source/cmssmib7.mf +2013/04/14 | 5598 | fonts/sansmathfonts/source/cmssmib8.mf +2013/04/14 | 5598 | fonts/sansmathfonts/source/cmssmib9.mf +2013/04/14 | 6589 | fonts/sansmathfonts/source/cmsssy10.mf +2013/04/14 | 6864 | fonts/sansmathfonts/source/cmsssy5.mf +2013/04/14 | 6865 | fonts/sansmathfonts/source/cmsssy6.mf +2013/04/14 | 6867 | fonts/sansmathfonts/source/cmsssy7.mf +2013/04/14 | 6491 | fonts/sansmathfonts/source/cmsssy8.mf +2013/04/14 | 6514 | fonts/sansmathfonts/source/cmsssy9.mf +2013/04/23 | 5171 | fonts/sansmathfonts/source/cmssu10.mf +2013/04/23 | 7146 | fonts/sansmathfonts/source/cmssxicsc10.mf +2012/05/07 | 119 | fonts/sansmathfonts/source/eczi0500.mf +2012/05/07 | 119 | fonts/sansmathfonts/source/eczi0600.mf +2012/05/07 | 119 | fonts/sansmathfonts/source/eczi0700.mf +2012/05/07 | 119 | fonts/sansmathfonts/source/eczi0800.mf +2012/05/07 | 119 | fonts/sansmathfonts/source/eczi0900.mf +2012/05/07 | 120 | fonts/sansmathfonts/source/eczi1000.mf +2012/05/07 | 123 | fonts/sansmathfonts/source/eczi1095.mf +2012/05/07 | 120 | fonts/sansmathfonts/source/eczi1200.mf +2012/05/07 | 122 | fonts/sansmathfonts/source/eczi1440.mf +2012/05/07 | 123 | fonts/sansmathfonts/source/eczi1728.mf +2012/05/07 | 123 | fonts/sansmathfonts/source/eczi2074.mf +2012/05/07 | 123 | fonts/sansmathfonts/source/eczi2488.mf +2012/05/07 | 123 | fonts/sansmathfonts/source/eczi2986.mf +2012/05/07 | 123 | fonts/sansmathfonts/source/eczi3583.mf +2013/04/14 | 23725 | fonts/sansmathfonts/source/eczi.mf +2012/05/07 | 119 | fonts/sansmathfonts/source/eczo0500.mf +2012/05/07 | 119 | fonts/sansmathfonts/source/eczo0600.mf +2012/05/07 | 119 | fonts/sansmathfonts/source/eczo0700.mf +2012/05/07 | 119 | fonts/sansmathfonts/source/eczo0800.mf +2012/05/07 | 119 | fonts/sansmathfonts/source/eczo0900.mf +2012/05/07 | 120 | fonts/sansmathfonts/source/eczo1000.mf +2012/05/07 | 123 | fonts/sansmathfonts/source/eczo1095.mf +2012/05/07 | 120 | fonts/sansmathfonts/source/eczo1200.mf +2012/05/07 | 122 | fonts/sansmathfonts/source/eczo1440.mf +2012/05/07 | 123 | fonts/sansmathfonts/source/eczo1728.mf +2012/05/07 | 123 | fonts/sansmathfonts/source/eczo2074.mf +2012/05/07 | 123 | fonts/sansmathfonts/source/eczo2488.mf +2012/05/07 | 123 | fonts/sansmathfonts/source/eczo2986.mf +2012/05/07 | 123 | fonts/sansmathfonts/source/eczo3583.mf +2013/04/14 | 6839 | fonts/sansmathfonts/source/eczo.mf +2012/05/07 | 119 | fonts/sansmathfonts/source/eczx0500.mf +2012/05/07 | 119 | fonts/sansmathfonts/source/eczx0600.mf +2012/05/07 | 119 | fonts/sansmathfonts/source/eczx0700.mf +2012/05/07 | 119 | fonts/sansmathfonts/source/eczx0800.mf +2012/05/07 | 119 | fonts/sansmathfonts/source/eczx0900.mf +2012/05/07 | 120 | fonts/sansmathfonts/source/eczx1000.mf +2012/05/07 | 123 | fonts/sansmathfonts/source/eczx1095.mf +2012/05/07 | 120 | fonts/sansmathfonts/source/eczx1200.mf +2012/05/07 | 122 | fonts/sansmathfonts/source/eczx1440.mf +2012/05/07 | 123 | fonts/sansmathfonts/source/eczx1728.mf +2012/05/07 | 123 | fonts/sansmathfonts/source/eczx2074.mf +2012/05/07 | 123 | fonts/sansmathfonts/source/eczx2488.mf +2012/05/07 | 123 | fonts/sansmathfonts/source/eczx2986.mf +2012/05/07 | 123 | fonts/sansmathfonts/source/eczx3583.mf +2013/04/14 | 10488 | fonts/sansmathfonts/source/eczx.mf 2012/05/06 | 119 | fonts/sansmathfonts/source/eczz0500.mf 2012/05/06 | 119 | fonts/sansmathfonts/source/eczz0600.mf 2012/05/06 | 119 | fonts/sansmathfonts/source/eczz0700.mf @@ -132981,371 +132981,371 @@ 2012/05/06 | 123 | fonts/sansmathfonts/source/eczz2488.mf 2012/05/06 | 123 | fonts/sansmathfonts/source/eczz2986.mf 2012/05/06 | 123 | fonts/sansmathfonts/source/eczz3583.mf -2013/04/13 | 91446 | fonts/sansmathfonts/source/eczz.mf +2013/04/14 | 91446 | fonts/sansmathfonts/source/eczz.mf 2013/03/24 | 1130 | fonts/sansmathfonts/source/sans-amsya.mf 2013/03/24 | 1177 | fonts/sansmathfonts/source/sans-amsyb.mf 2013/03/24 | 77036 | fonts/sansmathfonts/source/sans-asymbols.mf -2013/04/14 | 30840 | fonts/sansmathfonts/source/sans-bigdel.mf +2013/04/15 | 30840 | fonts/sansmathfonts/source/sans-bigdel.mf 2013/03/24 | 48024 | fonts/sansmathfonts/source/sans-bigint.mf -2013/04/14 | 17895 | fonts/sansmathfonts/source/sans-bigop.mf +2013/04/15 | 17895 | fonts/sansmathfonts/source/sans-bigop.mf 2013/03/24 | 66730 | fonts/sansmathfonts/source/sans-bsymbols.mf -2013/04/14 | 15903 | fonts/sansmathfonts/source/sans-calu.mf -2013/04/22 | 3339 | fonts/sansmathfonts/source/sans-csc.mf -2013/04/13 | 31705 | fonts/sansmathfonts/source/sansfontbase.mf -2013/04/14 | 27963 | fonts/sansmathfonts/source/sans-greekl.mf -2013/04/14 | 12326 | fonts/sansmathfonts/source/sans-greeku.mf -2013/04/22 | 5822 | fonts/sansmathfonts/source/sans-IPiXicsc.mf -2013/04/14 | 4122 | fonts/sansmathfonts/source/sans-IPiXi.mf -2013/04/14 | 520 | fonts/sansmathfonts/source/sans-mathex.mf -2013/04/14 | 380 | fonts/sansmathfonts/source/sans-mathint.mf +2013/04/15 | 15903 | fonts/sansmathfonts/source/sans-calu.mf +2013/04/23 | 3339 | fonts/sansmathfonts/source/sans-csc.mf +2013/04/14 | 31705 | fonts/sansmathfonts/source/sansfontbase.mf +2013/04/15 | 27963 | fonts/sansmathfonts/source/sans-greekl.mf +2013/04/15 | 12326 | fonts/sansmathfonts/source/sans-greeku.mf +2013/04/23 | 5822 | fonts/sansmathfonts/source/sans-IPiXicsc.mf +2013/04/15 | 4122 | fonts/sansmathfonts/source/sans-IPiXi.mf +2013/04/15 | 520 | fonts/sansmathfonts/source/sans-mathex.mf +2013/04/15 | 380 | fonts/sansmathfonts/source/sans-mathint.mf 2013/04/25 | 3834 | fonts/sansmathfonts/source/sans-mathsl.mf -2013/04/14 | 1199 | fonts/sansmathfonts/source/sans-mathsy.mf -2013/04/14 | 3247 | fonts/sansmathfonts/source/sans-roman.mf -2013/04/14 | 1477 | fonts/sansmathfonts/source/sans-romanu.mf -2013/04/14 | 11318 | fonts/sansmathfonts/source/sans-romms.mf -2013/04/14 | 6977 | fonts/sansmathfonts/source/sans-slantms.mf -2013/04/14 | 46549 | fonts/sansmathfonts/source/sans-symbol.mf -2013/04/14 | 18839 | fonts/sansmathfonts/source/sans-sym.mf +2013/04/15 | 1199 | fonts/sansmathfonts/source/sans-mathsy.mf +2013/04/15 | 3247 | fonts/sansmathfonts/source/sans-roman.mf +2013/04/15 | 1477 | fonts/sansmathfonts/source/sans-romanu.mf +2013/04/15 | 11318 | fonts/sansmathfonts/source/sans-romms.mf +2013/04/15 | 6977 | fonts/sansmathfonts/source/sans-slantms.mf +2013/04/15 | 46549 | fonts/sansmathfonts/source/sans-symbol.mf +2013/04/15 | 18839 | fonts/sansmathfonts/source/sans-sym.mf 2013/03/24 | 6532 | fonts/sansmathfonts/source/sans-xbbold.mf -2013/04/13 | 5773 | fonts/sansmathfonts/source/ssesint10.mf -2013/04/13 | 6063 | fonts/sansmathfonts/source/ssesint7.mf -2013/04/13 | 5705 | fonts/sansmathfonts/source/ssesint8.mf -2013/04/13 | 5705 | fonts/sansmathfonts/source/ssesint9.mf -2013/04/13 | 8082 | fonts/sansmathfonts/source/ssmsam10.mf -2013/04/13 | 8355 | fonts/sansmathfonts/source/ssmsam5.mf -2013/04/13 | 8357 | fonts/sansmathfonts/source/ssmsam6.mf -2013/04/13 | 8359 | fonts/sansmathfonts/source/ssmsam7.mf -2013/04/13 | 7993 | fonts/sansmathfonts/source/ssmsam8.mf -2013/04/13 | 8016 | fonts/sansmathfonts/source/ssmsam9.mf -2013/04/13 | 6033 | fonts/sansmathfonts/source/ssmsbm10.mf -2013/04/13 | 6314 | fonts/sansmathfonts/source/ssmsbm5.mf -2013/04/13 | 6315 | fonts/sansmathfonts/source/ssmsbm6.mf -2013/04/13 | 6317 | fonts/sansmathfonts/source/ssmsbm7.mf -2013/04/13 | 5941 | fonts/sansmathfonts/source/ssmsbm8.mf -2013/04/13 | 5964 | fonts/sansmathfonts/source/ssmsbm9.mf +2013/04/14 | 5773 | fonts/sansmathfonts/source/ssesint10.mf +2013/04/14 | 6063 | fonts/sansmathfonts/source/ssesint7.mf +2013/04/14 | 5705 | fonts/sansmathfonts/source/ssesint8.mf +2013/04/14 | 5705 | fonts/sansmathfonts/source/ssesint9.mf +2013/04/14 | 8082 | fonts/sansmathfonts/source/ssmsam10.mf +2013/04/14 | 8355 | fonts/sansmathfonts/source/ssmsam5.mf +2013/04/14 | 8357 | fonts/sansmathfonts/source/ssmsam6.mf +2013/04/14 | 8359 | fonts/sansmathfonts/source/ssmsam7.mf +2013/04/14 | 7993 | fonts/sansmathfonts/source/ssmsam8.mf +2013/04/14 | 8016 | fonts/sansmathfonts/source/ssmsam9.mf +2013/04/14 | 6033 | fonts/sansmathfonts/source/ssmsbm10.mf +2013/04/14 | 6314 | fonts/sansmathfonts/source/ssmsbm5.mf +2013/04/14 | 6315 | fonts/sansmathfonts/source/ssmsbm6.mf +2013/04/14 | 6317 | fonts/sansmathfonts/source/ssmsbm7.mf +2013/04/14 | 5941 | fonts/sansmathfonts/source/ssmsbm8.mf +2013/04/14 | 5964 | fonts/sansmathfonts/source/ssmsbm9.mf 2019/04/05 | 1047 | fonts/sansmathfonts/tex/omlcmssm.fd 2019/04/05 | 981 | fonts/sansmathfonts/tex/omscmsssy.fd -2021/06/22 | 741 | fonts/sansmathfonts/tex/omxcmssex.fd -2021/06/22 | 2675 | fonts/sansmathfonts/tex/ot1cmsmf.fd -2021/06/22 | 2634 | fonts/sansmathfonts/tex/ot1xcmss.fd -2021/06/22 | 4714 | fonts/sansmathfonts/tex/sansmathfonts.sty -2021/06/22 | 2026 | fonts/sansmathfonts/tex/t1xcmss.fd -2021/06/22 | 2650 | fonts/sansmathfonts/tex/ucmsmf.fd -2019/04/04 | 671 | fonts/sansmathfonts/tex/ussesint.fd -2019/04/04 | 693 | fonts/sansmathfonts/tex/ussmsa.fd -2019/04/04 | 693 | fonts/sansmathfonts/tex/ussmsb.fd -2021/06/22 | 2610 | fonts/sansmathfonts/tex/uxcmss.fd -2013/04/13 | 1316 | fonts/sansmathfonts/tfm/cmsmf10.tfm -2013/04/13 | 1324 | fonts/sansmathfonts/tfm/cmsmf12.tfm -2013/04/13 | 1320 | fonts/sansmathfonts/tfm/cmsmf17.tfm -2013/04/13 | 1300 | fonts/sansmathfonts/tfm/cmsmf8.tfm -2013/04/13 | 1320 | fonts/sansmathfonts/tfm/cmsmf9.tfm -2013/04/13 | 1272 | fonts/sansmathfonts/tfm/cmsmfbx10.tfm -2013/04/13 | 1272 | fonts/sansmathfonts/tfm/cmsmfbx12.tfm -2013/04/13 | 1284 | fonts/sansmathfonts/tfm/cmsmfbx17.tfm -2013/04/13 | 1272 | fonts/sansmathfonts/tfm/cmsmfbx8.tfm -2013/04/13 | 1284 | fonts/sansmathfonts/tfm/cmsmfbx9.tfm -2013/04/22 | 1352 | fonts/sansmathfonts/tfm/cmsmfbxcsc10.tfm -2013/04/22 | 1360 | fonts/sansmathfonts/tfm/cmsmfcsc10.tfm -2013/04/22 | 1364 | fonts/sansmathfonts/tfm/cmsmfcsc8.tfm -2013/04/22 | 1360 | fonts/sansmathfonts/tfm/cmsmfcsc9.tfm -2013/04/22 | 1532 | fonts/sansmathfonts/tfm/cmsmfcsci10.tfm -2013/04/22 | 1536 | fonts/sansmathfonts/tfm/cmsmfcsci8.tfm -2013/04/22 | 1532 | fonts/sansmathfonts/tfm/cmsmfcsci9.tfm -2013/04/13 | 1524 | fonts/sansmathfonts/tfm/cmsmfi10.tfm -2013/04/13 | 1536 | fonts/sansmathfonts/tfm/cmsmfi12.tfm -2013/04/13 | 1532 | fonts/sansmathfonts/tfm/cmsmfi17.tfm -2013/04/13 | 1508 | fonts/sansmathfonts/tfm/cmsmfi8.tfm -2013/04/13 | 1528 | fonts/sansmathfonts/tfm/cmsmfi9.tfm -2013/04/13 | 380 | fonts/sansmathfonts/tfm/cmsmfIPiXi10.tfm -2013/04/13 | 380 | fonts/sansmathfonts/tfm/cmsmfIPiXi12.tfm -2013/04/13 | 380 | fonts/sansmathfonts/tfm/cmsmfIPiXi17.tfm -2013/04/13 | 380 | fonts/sansmathfonts/tfm/cmsmfIPiXi8.tfm -2013/04/13 | 380 | fonts/sansmathfonts/tfm/cmsmfIPiXi9.tfm -2013/04/13 | 380 | fonts/sansmathfonts/tfm/cmsmfIPiXibx10.tfm -2013/04/13 | 380 | fonts/sansmathfonts/tfm/cmsmfIPiXibx12.tfm -2013/04/13 | 380 | fonts/sansmathfonts/tfm/cmsmfIPiXibx17.tfm -2013/04/13 | 380 | fonts/sansmathfonts/tfm/cmsmfIPiXibx8.tfm -2013/04/13 | 380 | fonts/sansmathfonts/tfm/cmsmfIPiXibx9.tfm -2013/04/22 | 524 | fonts/sansmathfonts/tfm/cmsmfIPiXibxcsc10.tfm -2013/04/22 | 524 | fonts/sansmathfonts/tfm/cmsmfIPiXicsc10.tfm -2013/04/22 | 524 | fonts/sansmathfonts/tfm/cmsmfIPiXicsc8.tfm -2013/04/22 | 524 | fonts/sansmathfonts/tfm/cmsmfIPiXicsc9.tfm -2013/04/22 | 540 | fonts/sansmathfonts/tfm/cmsmfIPiXicsci10.tfm -2013/04/22 | 540 | fonts/sansmathfonts/tfm/cmsmfIPiXicsci8.tfm -2013/04/22 | 540 | fonts/sansmathfonts/tfm/cmsmfIPiXicsci9.tfm -2013/04/13 | 392 | fonts/sansmathfonts/tfm/cmsmfIPiXii10.tfm -2013/04/13 | 392 | fonts/sansmathfonts/tfm/cmsmfIPiXii12.tfm -2013/04/13 | 392 | fonts/sansmathfonts/tfm/cmsmfIPiXii17.tfm -2013/04/13 | 392 | fonts/sansmathfonts/tfm/cmsmfIPiXii8.tfm -2013/04/13 | 392 | fonts/sansmathfonts/tfm/cmsmfIPiXii9.tfm -2013/04/13 | 392 | fonts/sansmathfonts/tfm/cmsmfIPiXixi10.tfm -2013/04/13 | 392 | fonts/sansmathfonts/tfm/cmsmfIPiXixi12.tfm -2013/04/13 | 392 | fonts/sansmathfonts/tfm/cmsmfIPiXixi17.tfm -2013/04/13 | 392 | fonts/sansmathfonts/tfm/cmsmfIPiXixi8.tfm -2013/04/13 | 392 | fonts/sansmathfonts/tfm/cmsmfIPiXixi9.tfm -2013/04/22 | 540 | fonts/sansmathfonts/tfm/cmsmfIPiXixicsc10.tfm -2013/04/13 | 1468 | fonts/sansmathfonts/tfm/cmsmfxi10.tfm -2013/04/13 | 1468 | fonts/sansmathfonts/tfm/cmsmfxi12.tfm -2013/04/13 | 1484 | fonts/sansmathfonts/tfm/cmsmfxi17.tfm -2013/04/13 | 1468 | fonts/sansmathfonts/tfm/cmsmfxi8.tfm -2013/04/13 | 1484 | fonts/sansmathfonts/tfm/cmsmfxi9.tfm -2013/04/22 | 1520 | fonts/sansmathfonts/tfm/cmsmfxicsc10.tfm -2013/04/13 | 1044 | fonts/sansmathfonts/tfm/cmssbsy10.tfm -2013/04/13 | 1044 | fonts/sansmathfonts/tfm/cmssbsy5.tfm -2013/04/13 | 1044 | fonts/sansmathfonts/tfm/cmssbsy6.tfm -2013/04/13 | 1044 | fonts/sansmathfonts/tfm/cmssbsy7.tfm -2013/04/13 | 1044 | fonts/sansmathfonts/tfm/cmssbsy8.tfm -2013/04/13 | 1044 | fonts/sansmathfonts/tfm/cmssbsy9.tfm -2013/04/13 | 1288 | fonts/sansmathfonts/tfm/cmssbxcsc10.tfm -2013/04/13 | 1296 | fonts/sansmathfonts/tfm/cmsscsc10.tfm -2013/04/13 | 1300 | fonts/sansmathfonts/tfm/cmsscsc8.tfm -2013/04/13 | 1296 | fonts/sansmathfonts/tfm/cmsscsc9.tfm -2013/04/13 | 1464 | fonts/sansmathfonts/tfm/cmsscsci10.tfm -2013/04/13 | 1468 | fonts/sansmathfonts/tfm/cmsscsci8.tfm -2013/04/13 | 1464 | fonts/sansmathfonts/tfm/cmsscsci9.tfm -2013/04/13 | 928 | fonts/sansmathfonts/tfm/cmssex10.tfm -2013/04/13 | 928 | fonts/sansmathfonts/tfm/cmssex7.tfm -2013/04/13 | 924 | fonts/sansmathfonts/tfm/cmssex8.tfm -2013/04/13 | 932 | fonts/sansmathfonts/tfm/cmssex9.tfm -2013/04/22 | 1504 | fonts/sansmathfonts/tfm/cmssmi10.tfm -2013/04/13 | 1492 | fonts/sansmathfonts/tfm/cmssmi5.tfm -2013/04/13 | 1496 | fonts/sansmathfonts/tfm/cmssmi6.tfm -2013/04/13 | 1504 | fonts/sansmathfonts/tfm/cmssmi7.tfm -2013/04/13 | 1488 | fonts/sansmathfonts/tfm/cmssmi8.tfm -2013/04/13 | 1500 | fonts/sansmathfonts/tfm/cmssmi9.tfm -2013/04/13 | 1472 | fonts/sansmathfonts/tfm/cmssmib10.tfm -2013/04/13 | 1484 | fonts/sansmathfonts/tfm/cmssmib5.tfm -2013/04/13 | 1472 | fonts/sansmathfonts/tfm/cmssmib6.tfm -2013/04/13 | 1488 | fonts/sansmathfonts/tfm/cmssmib7.tfm -2013/04/13 | 1468 | fonts/sansmathfonts/tfm/cmssmib8.tfm -2013/04/13 | 1488 | fonts/sansmathfonts/tfm/cmssmib9.tfm -2013/04/13 | 1048 | fonts/sansmathfonts/tfm/cmsssy10.tfm -2013/04/13 | 1044 | fonts/sansmathfonts/tfm/cmsssy5.tfm -2013/04/13 | 1044 | fonts/sansmathfonts/tfm/cmsssy6.tfm -2013/04/13 | 1044 | fonts/sansmathfonts/tfm/cmsssy7.tfm -2013/04/13 | 1044 | fonts/sansmathfonts/tfm/cmsssy8.tfm -2013/04/13 | 1040 | fonts/sansmathfonts/tfm/cmsssy9.tfm -2013/04/22 | 1236 | fonts/sansmathfonts/tfm/cmssu10.tfm -2013/04/13 | 1452 | fonts/sansmathfonts/tfm/cmssxicsc10.tfm -2013/04/13 | 2992 | fonts/sansmathfonts/tfm/eczi0500.tfm -2013/04/13 | 2988 | fonts/sansmathfonts/tfm/eczi0600.tfm -2013/04/13 | 2996 | fonts/sansmathfonts/tfm/eczi0700.tfm -2013/04/13 | 2988 | fonts/sansmathfonts/tfm/eczi0800.tfm -2013/04/13 | 2988 | fonts/sansmathfonts/tfm/eczi0900.tfm -2013/04/13 | 2972 | fonts/sansmathfonts/tfm/eczi1000.tfm -2013/04/13 | 3000 | fonts/sansmathfonts/tfm/eczi1095.tfm -2013/04/13 | 2996 | fonts/sansmathfonts/tfm/eczi1200.tfm -2013/04/13 | 2988 | fonts/sansmathfonts/tfm/eczi1440.tfm -2013/04/13 | 2992 | fonts/sansmathfonts/tfm/eczi1728.tfm -2013/04/13 | 3004 | fonts/sansmathfonts/tfm/eczi2074.tfm -2013/04/13 | 3000 | fonts/sansmathfonts/tfm/eczi2488.tfm -2013/04/13 | 3000 | fonts/sansmathfonts/tfm/eczi2986.tfm -2013/04/13 | 2992 | fonts/sansmathfonts/tfm/eczi3583.tfm -2013/04/13 | 2956 | fonts/sansmathfonts/tfm/eczo0500.tfm -2013/04/13 | 2992 | fonts/sansmathfonts/tfm/eczo0600.tfm -2013/04/13 | 2988 | fonts/sansmathfonts/tfm/eczo0700.tfm -2013/04/13 | 3000 | fonts/sansmathfonts/tfm/eczo0800.tfm -2013/04/13 | 2988 | fonts/sansmathfonts/tfm/eczo0900.tfm -2013/04/13 | 2988 | fonts/sansmathfonts/tfm/eczo1000.tfm -2013/04/13 | 2996 | fonts/sansmathfonts/tfm/eczo1095.tfm -2013/04/13 | 2988 | fonts/sansmathfonts/tfm/eczo1200.tfm -2013/04/13 | 2988 | fonts/sansmathfonts/tfm/eczo1440.tfm -2013/04/13 | 2992 | fonts/sansmathfonts/tfm/eczo1728.tfm -2013/04/13 | 2988 | fonts/sansmathfonts/tfm/eczo2074.tfm -2013/04/13 | 2988 | fonts/sansmathfonts/tfm/eczo2488.tfm -2013/04/13 | 2988 | fonts/sansmathfonts/tfm/eczo2986.tfm -2013/04/13 | 2988 | fonts/sansmathfonts/tfm/eczo3583.tfm -2013/04/13 | 2808 | fonts/sansmathfonts/tfm/eczx0500.tfm -2013/04/13 | 2836 | fonts/sansmathfonts/tfm/eczx0600.tfm -2013/04/13 | 2828 | fonts/sansmathfonts/tfm/eczx0700.tfm -2013/04/13 | 2836 | fonts/sansmathfonts/tfm/eczx0800.tfm -2013/04/13 | 2824 | fonts/sansmathfonts/tfm/eczx0900.tfm -2013/04/13 | 2820 | fonts/sansmathfonts/tfm/eczx1000.tfm -2013/04/13 | 2832 | fonts/sansmathfonts/tfm/eczx1095.tfm -2013/04/13 | 2824 | fonts/sansmathfonts/tfm/eczx1200.tfm -2013/04/13 | 2816 | fonts/sansmathfonts/tfm/eczx1440.tfm -2013/04/13 | 2820 | fonts/sansmathfonts/tfm/eczx1728.tfm -2013/04/13 | 2816 | fonts/sansmathfonts/tfm/eczx2074.tfm -2013/04/13 | 2816 | fonts/sansmathfonts/tfm/eczx2488.tfm -2013/04/13 | 2816 | fonts/sansmathfonts/tfm/eczx2986.tfm -2013/04/13 | 2816 | fonts/sansmathfonts/tfm/eczx3583.tfm -2013/04/13 | 2844 | fonts/sansmathfonts/tfm/eczz0500.tfm -2013/04/13 | 2824 | fonts/sansmathfonts/tfm/eczz0600.tfm -2013/04/13 | 2832 | fonts/sansmathfonts/tfm/eczz0700.tfm -2013/04/13 | 2820 | fonts/sansmathfonts/tfm/eczz0800.tfm -2013/04/13 | 2816 | fonts/sansmathfonts/tfm/eczz0900.tfm -2013/04/13 | 2796 | fonts/sansmathfonts/tfm/eczz1000.tfm -2013/04/13 | 2828 | fonts/sansmathfonts/tfm/eczz1095.tfm -2013/04/13 | 2812 | fonts/sansmathfonts/tfm/eczz1200.tfm -2013/04/13 | 2808 | fonts/sansmathfonts/tfm/eczz1440.tfm -2013/04/13 | 2808 | fonts/sansmathfonts/tfm/eczz1728.tfm -2013/04/13 | 2820 | fonts/sansmathfonts/tfm/eczz2074.tfm -2013/04/13 | 2816 | fonts/sansmathfonts/tfm/eczz2488.tfm -2013/04/13 | 2816 | fonts/sansmathfonts/tfm/eczz2986.tfm -2013/04/13 | 2804 | fonts/sansmathfonts/tfm/eczz3583.tfm -2013/04/13 | 300 | fonts/sansmathfonts/tfm/ssesint10.tfm -2013/04/13 | 300 | fonts/sansmathfonts/tfm/ssesint7.tfm -2013/04/13 | 300 | fonts/sansmathfonts/tfm/ssesint8.tfm -2013/04/13 | 300 | fonts/sansmathfonts/tfm/ssesint9.tfm -2013/04/13 | 852 | fonts/sansmathfonts/tfm/ssmsam10.tfm -2013/04/13 | 856 | fonts/sansmathfonts/tfm/ssmsam5.tfm -2013/04/13 | 856 | fonts/sansmathfonts/tfm/ssmsam6.tfm -2013/04/13 | 856 | fonts/sansmathfonts/tfm/ssmsam7.tfm -2013/04/13 | 852 | fonts/sansmathfonts/tfm/ssmsam8.tfm -2013/04/13 | 856 | fonts/sansmathfonts/tfm/ssmsam9.tfm -2013/04/13 | 844 | fonts/sansmathfonts/tfm/ssmsbm10.tfm -2013/04/13 | 876 | fonts/sansmathfonts/tfm/ssmsbm5.tfm -2013/04/13 | 876 | fonts/sansmathfonts/tfm/ssmsbm6.tfm -2013/04/13 | 876 | fonts/sansmathfonts/tfm/ssmsbm7.tfm -2013/04/13 | 876 | fonts/sansmathfonts/tfm/ssmsbm8.tfm -2013/04/13 | 876 | fonts/sansmathfonts/tfm/ssmsbm9.tfm -2013/04/13 | 2926 | fonts/sansmathfonts/type1/cmsmfIPiXi10.pfb -2013/04/13 | 2926 | fonts/sansmathfonts/type1/cmsmfIPiXi12.pfb -2013/04/13 | 2926 | fonts/sansmathfonts/type1/cmsmfIPiXi17.pfb -2013/04/13 | 2922 | fonts/sansmathfonts/type1/cmsmfIPiXi8.pfb -2013/04/13 | 2922 | fonts/sansmathfonts/type1/cmsmfIPiXi9.pfb -2013/04/13 | 8338 | fonts/sansmathfonts/type1/cmsmfIPiXibx10.pfb -2013/04/13 | 8206 | fonts/sansmathfonts/type1/cmsmfIPiXibx12.pfb -2013/04/13 | 8338 | fonts/sansmathfonts/type1/cmsmfIPiXibx17.pfb -2013/04/13 | 8334 | fonts/sansmathfonts/type1/cmsmfIPiXibx8.pfb -2013/04/13 | 8211 | fonts/sansmathfonts/type1/cmsmfIPiXibx9.pfb -2013/04/22 | 8523 | fonts/sansmathfonts/type1/cmsmfIPiXibxcsc10.pfb -2013/04/22 | 3020 | fonts/sansmathfonts/type1/cmsmfIPiXicsc10.pfb -2013/04/22 | 3014 | fonts/sansmathfonts/type1/cmsmfIPiXicsc8.pfb -2013/04/22 | 3016 | fonts/sansmathfonts/type1/cmsmfIPiXicsc9.pfb -2013/04/22 | 8139 | fonts/sansmathfonts/type1/cmsmfIPiXicsci10.pfb -2013/04/22 | 8205 | fonts/sansmathfonts/type1/cmsmfIPiXicsci8.pfb -2013/04/22 | 8241 | fonts/sansmathfonts/type1/cmsmfIPiXicsci9.pfb -2013/04/13 | 7991 | fonts/sansmathfonts/type1/cmsmfIPiXii10.pfb -2013/04/13 | 7937 | fonts/sansmathfonts/type1/cmsmfIPiXii12.pfb -2013/04/13 | 7978 | fonts/sansmathfonts/type1/cmsmfIPiXii17.pfb -2013/04/13 | 8058 | fonts/sansmathfonts/type1/cmsmfIPiXii8.pfb -2013/04/13 | 8078 | fonts/sansmathfonts/type1/cmsmfIPiXii9.pfb -2013/04/13 | 3506 | fonts/sansmathfonts/type1/cmsmfIPiXixi10.pfb -2013/04/13 | 3510 | fonts/sansmathfonts/type1/cmsmfIPiXixi12.pfb -2013/04/13 | 3500 | fonts/sansmathfonts/type1/cmsmfIPiXixi17.pfb -2013/04/13 | 3511 | fonts/sansmathfonts/type1/cmsmfIPiXixi8.pfb -2013/04/13 | 3487 | fonts/sansmathfonts/type1/cmsmfIPiXixi9.pfb -2013/04/22 | 3733 | fonts/sansmathfonts/type1/cmsmfIPiXixicsc10.pfb -2013/04/13 | 43442 | fonts/sansmathfonts/type1/cmssbsy10.pfb -2013/04/13 | 43738 | fonts/sansmathfonts/type1/cmssbsy5.pfb -2013/04/13 | 43517 | fonts/sansmathfonts/type1/cmssbsy6.pfb -2013/04/13 | 43420 | fonts/sansmathfonts/type1/cmssbsy7.pfb -2013/04/13 | 43619 | fonts/sansmathfonts/type1/cmssbsy8.pfb -2013/04/13 | 43463 | fonts/sansmathfonts/type1/cmssbsy9.pfb -2013/04/13 | 39319 | fonts/sansmathfonts/type1/cmssbx12.pfb -2013/04/13 | 39396 | fonts/sansmathfonts/type1/cmssbx17.pfb -2013/04/13 | 39465 | fonts/sansmathfonts/type1/cmssbx8.pfb -2013/04/13 | 39377 | fonts/sansmathfonts/type1/cmssbx9.pfb -2013/04/13 | 36951 | fonts/sansmathfonts/type1/cmssbxcsc10.pfb -2013/04/13 | 29140 | fonts/sansmathfonts/type1/cmsscsc10.pfb -2013/04/13 | 28572 | fonts/sansmathfonts/type1/cmsscsc8.pfb -2013/04/13 | 28903 | fonts/sansmathfonts/type1/cmsscsc9.pfb -2013/04/13 | 32889 | fonts/sansmathfonts/type1/cmsscsci10.pfb -2013/04/13 | 31824 | fonts/sansmathfonts/type1/cmsscsci8.pfb -2013/04/13 | 32246 | fonts/sansmathfonts/type1/cmsscsci9.pfb -2013/04/13 | 27911 | fonts/sansmathfonts/type1/cmssex10.pfb -2013/04/13 | 27772 | fonts/sansmathfonts/type1/cmssex7.pfb -2013/04/13 | 27775 | fonts/sansmathfonts/type1/cmssex8.pfb -2013/04/13 | 28082 | fonts/sansmathfonts/type1/cmssex9.pfb -2013/04/22 | 35623 | fonts/sansmathfonts/type1/cmssmi10.pfb -2013/04/13 | 36164 | fonts/sansmathfonts/type1/cmssmi5.pfb -2013/04/13 | 35952 | fonts/sansmathfonts/type1/cmssmi6.pfb -2013/04/13 | 36108 | fonts/sansmathfonts/type1/cmssmi7.pfb -2013/04/13 | 35866 | fonts/sansmathfonts/type1/cmssmi8.pfb -2013/04/13 | 35964 | fonts/sansmathfonts/type1/cmssmi9.pfb -2013/04/13 | 41863 | fonts/sansmathfonts/type1/cmssmib10.pfb -2013/04/13 | 41891 | fonts/sansmathfonts/type1/cmssmib5.pfb -2013/04/13 | 41933 | fonts/sansmathfonts/type1/cmssmib6.pfb -2013/04/13 | 41887 | fonts/sansmathfonts/type1/cmssmib7.pfb -2013/04/13 | 41845 | fonts/sansmathfonts/type1/cmssmib8.pfb -2013/04/13 | 41881 | fonts/sansmathfonts/type1/cmssmib9.pfb -2013/04/13 | 42737 | fonts/sansmathfonts/type1/cmsssy10.pfb -2013/04/13 | 42054 | fonts/sansmathfonts/type1/cmsssy5.pfb -2013/04/13 | 42385 | fonts/sansmathfonts/type1/cmsssy6.pfb -2013/04/13 | 43631 | fonts/sansmathfonts/type1/cmsssy7.pfb -2013/04/13 | 40734 | fonts/sansmathfonts/type1/cmsssy8.pfb -2013/04/13 | 42202 | fonts/sansmathfonts/type1/cmsssy9.pfb -2013/04/22 | 35738 | fonts/sansmathfonts/type1/cmssu10.pfb -2013/04/13 | 40073 | fonts/sansmathfonts/type1/cmssxi10.pfb -2013/04/13 | 40143 | fonts/sansmathfonts/type1/cmssxi12.pfb -2013/04/13 | 40152 | fonts/sansmathfonts/type1/cmssxi17.pfb -2013/04/13 | 40049 | fonts/sansmathfonts/type1/cmssxi8.pfb -2013/04/13 | 40157 | fonts/sansmathfonts/type1/cmssxi9.pfb -2013/04/13 | 37883 | fonts/sansmathfonts/type1/cmssxicsc10.pfb -2013/04/13 | 50621 | fonts/sansmathfonts/type1/eczi0500.pfb -2013/04/13 | 48927 | fonts/sansmathfonts/type1/eczi0600.pfb -2013/04/13 | 47926 | fonts/sansmathfonts/type1/eczi0700.pfb -2013/04/13 | 48275 | fonts/sansmathfonts/type1/eczi0800.pfb -2013/04/13 | 49060 | fonts/sansmathfonts/type1/eczi0900.pfb -2013/04/13 | 49348 | fonts/sansmathfonts/type1/eczi1000.pfb -2013/04/13 | 49028 | fonts/sansmathfonts/type1/eczi1095.pfb -2013/04/13 | 48548 | fonts/sansmathfonts/type1/eczi1200.pfb -2013/04/13 | 48555 | fonts/sansmathfonts/type1/eczi1440.pfb -2013/04/13 | 48865 | fonts/sansmathfonts/type1/eczi1728.pfb -2013/04/13 | 48387 | fonts/sansmathfonts/type1/eczi2074.pfb -2013/04/13 | 49510 | fonts/sansmathfonts/type1/eczi2488.pfb -2013/04/13 | 49081 | fonts/sansmathfonts/type1/eczi2986.pfb -2013/04/13 | 49306 | fonts/sansmathfonts/type1/eczi3583.pfb -2013/04/13 | 58631 | fonts/sansmathfonts/type1/eczo0500.pfb -2013/04/13 | 59241 | fonts/sansmathfonts/type1/eczo0600.pfb -2013/04/13 | 57741 | fonts/sansmathfonts/type1/eczo0700.pfb -2013/04/13 | 59884 | fonts/sansmathfonts/type1/eczo0800.pfb -2013/04/13 | 58489 | fonts/sansmathfonts/type1/eczo0900.pfb -2013/04/13 | 59383 | fonts/sansmathfonts/type1/eczo1000.pfb -2013/04/13 | 58421 | fonts/sansmathfonts/type1/eczo1095.pfb -2013/04/13 | 57776 | fonts/sansmathfonts/type1/eczo1200.pfb -2013/04/13 | 56632 | fonts/sansmathfonts/type1/eczo1440.pfb -2013/04/13 | 56012 | fonts/sansmathfonts/type1/eczo1728.pfb -2013/04/13 | 57586 | fonts/sansmathfonts/type1/eczo2074.pfb -2013/04/13 | 58541 | fonts/sansmathfonts/type1/eczo2488.pfb -2013/04/13 | 57164 | fonts/sansmathfonts/type1/eczo2986.pfb -2013/04/13 | 57556 | fonts/sansmathfonts/type1/eczo3583.pfb -2013/04/13 | 60289 | fonts/sansmathfonts/type1/eczx0500.pfb -2013/04/13 | 56988 | fonts/sansmathfonts/type1/eczx0600.pfb -2013/04/13 | 58803 | fonts/sansmathfonts/type1/eczx0700.pfb -2013/04/13 | 60945 | fonts/sansmathfonts/type1/eczx0800.pfb -2013/04/13 | 55600 | fonts/sansmathfonts/type1/eczx0900.pfb -2013/04/13 | 58451 | fonts/sansmathfonts/type1/eczx1000.pfb -2013/04/13 | 59768 | fonts/sansmathfonts/type1/eczx1095.pfb -2013/04/13 | 57433 | fonts/sansmathfonts/type1/eczx1200.pfb -2013/04/13 | 58591 | fonts/sansmathfonts/type1/eczx1440.pfb -2013/04/13 | 54835 | fonts/sansmathfonts/type1/eczx1728.pfb -2013/04/13 | 62393 | fonts/sansmathfonts/type1/eczx2074.pfb -2013/04/13 | 57624 | fonts/sansmathfonts/type1/eczx2488.pfb -2013/04/13 | 56729 | fonts/sansmathfonts/type1/eczx2986.pfb -2013/04/13 | 55600 | fonts/sansmathfonts/type1/eczx3583.pfb -2013/04/13 | 44897 | fonts/sansmathfonts/type1/eczz0500.pfb -2013/04/13 | 43140 | fonts/sansmathfonts/type1/eczz0600.pfb -2013/04/13 | 43434 | fonts/sansmathfonts/type1/eczz0700.pfb -2013/04/13 | 43692 | fonts/sansmathfonts/type1/eczz0800.pfb -2013/04/13 | 43375 | fonts/sansmathfonts/type1/eczz0900.pfb -2013/04/13 | 43425 | fonts/sansmathfonts/type1/eczz1000.pfb -2013/04/13 | 43458 | fonts/sansmathfonts/type1/eczz1095.pfb -2013/04/13 | 43443 | fonts/sansmathfonts/type1/eczz1200.pfb -2013/04/13 | 43437 | fonts/sansmathfonts/type1/eczz1440.pfb -2013/04/13 | 43726 | fonts/sansmathfonts/type1/eczz1728.pfb -2013/04/13 | 43198 | fonts/sansmathfonts/type1/eczz2074.pfb -2013/04/13 | 43361 | fonts/sansmathfonts/type1/eczz2488.pfb -2013/04/13 | 43356 | fonts/sansmathfonts/type1/eczz2986.pfb -2013/04/13 | 43394 | fonts/sansmathfonts/type1/eczz3583.pfb -2013/04/13 | 26307 | fonts/sansmathfonts/type1/ssesint10.pfb -2013/04/13 | 26615 | fonts/sansmathfonts/type1/ssesint7.pfb -2013/04/13 | 25607 | fonts/sansmathfonts/type1/ssesint8.pfb -2013/04/13 | 25826 | fonts/sansmathfonts/type1/ssesint9.pfb -2013/04/13 | 39292 | fonts/sansmathfonts/type1/ssmsam10.pfb -2013/04/13 | 38265 | fonts/sansmathfonts/type1/ssmsam5.pfb -2013/04/13 | 39675 | fonts/sansmathfonts/type1/ssmsam6.pfb -2013/04/13 | 41992 | fonts/sansmathfonts/type1/ssmsam7.pfb -2013/04/13 | 36482 | fonts/sansmathfonts/type1/ssmsam8.pfb -2013/04/13 | 39986 | fonts/sansmathfonts/type1/ssmsam9.pfb -2013/04/13 | 52315 | fonts/sansmathfonts/type1/ssmsbm10.pfb -2013/04/13 | 51639 | fonts/sansmathfonts/type1/ssmsbm5.pfb -2013/04/13 | 52936 | fonts/sansmathfonts/type1/ssmsbm6.pfb -2013/04/13 | 55371 | fonts/sansmathfonts/type1/ssmsbm7.pfb -2013/04/13 | 51158 | fonts/sansmathfonts/type1/ssmsbm8.pfb -2013/04/13 | 55875 | fonts/sansmathfonts/type1/ssmsbm9.pfb +2021/06/23 | 741 | fonts/sansmathfonts/tex/omxcmssex.fd +2021/06/23 | 2675 | fonts/sansmathfonts/tex/ot1cmsmf.fd +2021/06/23 | 2634 | fonts/sansmathfonts/tex/ot1xcmss.fd +2022/10/09 | 5051 | fonts/sansmathfonts/tex/sansmathfonts.sty +2021/06/23 | 2026 | fonts/sansmathfonts/tex/t1xcmss.fd +2021/06/23 | 2650 | fonts/sansmathfonts/tex/ucmsmf.fd +2019/04/05 | 671 | fonts/sansmathfonts/tex/ussesint.fd +2019/04/05 | 693 | fonts/sansmathfonts/tex/ussmsa.fd +2019/04/05 | 693 | fonts/sansmathfonts/tex/ussmsb.fd +2021/06/23 | 2610 | fonts/sansmathfonts/tex/uxcmss.fd +2013/04/14 | 1316 | fonts/sansmathfonts/tfm/cmsmf10.tfm +2013/04/14 | 1324 | fonts/sansmathfonts/tfm/cmsmf12.tfm +2013/04/14 | 1320 | fonts/sansmathfonts/tfm/cmsmf17.tfm +2013/04/14 | 1300 | fonts/sansmathfonts/tfm/cmsmf8.tfm +2013/04/14 | 1320 | fonts/sansmathfonts/tfm/cmsmf9.tfm +2013/04/14 | 1272 | fonts/sansmathfonts/tfm/cmsmfbx10.tfm +2013/04/14 | 1272 | fonts/sansmathfonts/tfm/cmsmfbx12.tfm +2013/04/14 | 1284 | fonts/sansmathfonts/tfm/cmsmfbx17.tfm +2013/04/14 | 1272 | fonts/sansmathfonts/tfm/cmsmfbx8.tfm +2013/04/14 | 1284 | fonts/sansmathfonts/tfm/cmsmfbx9.tfm +2013/04/23 | 1352 | fonts/sansmathfonts/tfm/cmsmfbxcsc10.tfm +2013/04/23 | 1360 | fonts/sansmathfonts/tfm/cmsmfcsc10.tfm +2013/04/23 | 1364 | fonts/sansmathfonts/tfm/cmsmfcsc8.tfm +2013/04/23 | 1360 | fonts/sansmathfonts/tfm/cmsmfcsc9.tfm +2013/04/23 | 1532 | fonts/sansmathfonts/tfm/cmsmfcsci10.tfm +2013/04/23 | 1536 | fonts/sansmathfonts/tfm/cmsmfcsci8.tfm +2013/04/23 | 1532 | fonts/sansmathfonts/tfm/cmsmfcsci9.tfm +2013/04/14 | 1524 | fonts/sansmathfonts/tfm/cmsmfi10.tfm +2013/04/14 | 1536 | fonts/sansmathfonts/tfm/cmsmfi12.tfm +2013/04/14 | 1532 | fonts/sansmathfonts/tfm/cmsmfi17.tfm +2013/04/14 | 1508 | fonts/sansmathfonts/tfm/cmsmfi8.tfm +2013/04/14 | 1528 | fonts/sansmathfonts/tfm/cmsmfi9.tfm +2013/04/14 | 380 | fonts/sansmathfonts/tfm/cmsmfIPiXi10.tfm +2013/04/14 | 380 | fonts/sansmathfonts/tfm/cmsmfIPiXi12.tfm +2013/04/14 | 380 | fonts/sansmathfonts/tfm/cmsmfIPiXi17.tfm +2013/04/14 | 380 | fonts/sansmathfonts/tfm/cmsmfIPiXi8.tfm +2013/04/14 | 380 | fonts/sansmathfonts/tfm/cmsmfIPiXi9.tfm +2013/04/14 | 380 | fonts/sansmathfonts/tfm/cmsmfIPiXibx10.tfm +2013/04/14 | 380 | fonts/sansmathfonts/tfm/cmsmfIPiXibx12.tfm +2013/04/14 | 380 | fonts/sansmathfonts/tfm/cmsmfIPiXibx17.tfm +2013/04/14 | 380 | fonts/sansmathfonts/tfm/cmsmfIPiXibx8.tfm +2013/04/14 | 380 | fonts/sansmathfonts/tfm/cmsmfIPiXibx9.tfm +2013/04/23 | 524 | fonts/sansmathfonts/tfm/cmsmfIPiXibxcsc10.tfm +2013/04/23 | 524 | fonts/sansmathfonts/tfm/cmsmfIPiXicsc10.tfm +2013/04/23 | 524 | fonts/sansmathfonts/tfm/cmsmfIPiXicsc8.tfm +2013/04/23 | 524 | fonts/sansmathfonts/tfm/cmsmfIPiXicsc9.tfm +2013/04/23 | 540 | fonts/sansmathfonts/tfm/cmsmfIPiXicsci10.tfm +2013/04/23 | 540 | fonts/sansmathfonts/tfm/cmsmfIPiXicsci8.tfm +2013/04/23 | 540 | fonts/sansmathfonts/tfm/cmsmfIPiXicsci9.tfm +2013/04/14 | 392 | fonts/sansmathfonts/tfm/cmsmfIPiXii10.tfm +2013/04/14 | 392 | fonts/sansmathfonts/tfm/cmsmfIPiXii12.tfm +2013/04/14 | 392 | fonts/sansmathfonts/tfm/cmsmfIPiXii17.tfm +2013/04/14 | 392 | fonts/sansmathfonts/tfm/cmsmfIPiXii8.tfm +2013/04/14 | 392 | fonts/sansmathfonts/tfm/cmsmfIPiXii9.tfm +2013/04/14 | 392 | fonts/sansmathfonts/tfm/cmsmfIPiXixi10.tfm +2013/04/14 | 392 | fonts/sansmathfonts/tfm/cmsmfIPiXixi12.tfm +2013/04/14 | 392 | fonts/sansmathfonts/tfm/cmsmfIPiXixi17.tfm +2013/04/14 | 392 | fonts/sansmathfonts/tfm/cmsmfIPiXixi8.tfm +2013/04/14 | 392 | fonts/sansmathfonts/tfm/cmsmfIPiXixi9.tfm +2013/04/23 | 540 | fonts/sansmathfonts/tfm/cmsmfIPiXixicsc10.tfm +2013/04/14 | 1468 | fonts/sansmathfonts/tfm/cmsmfxi10.tfm +2013/04/14 | 1468 | fonts/sansmathfonts/tfm/cmsmfxi12.tfm +2013/04/14 | 1484 | fonts/sansmathfonts/tfm/cmsmfxi17.tfm +2013/04/14 | 1468 | fonts/sansmathfonts/tfm/cmsmfxi8.tfm +2013/04/14 | 1484 | fonts/sansmathfonts/tfm/cmsmfxi9.tfm +2013/04/23 | 1520 | fonts/sansmathfonts/tfm/cmsmfxicsc10.tfm +2013/04/14 | 1044 | fonts/sansmathfonts/tfm/cmssbsy10.tfm +2013/04/14 | 1044 | fonts/sansmathfonts/tfm/cmssbsy5.tfm +2013/04/14 | 1044 | fonts/sansmathfonts/tfm/cmssbsy6.tfm +2013/04/14 | 1044 | fonts/sansmathfonts/tfm/cmssbsy7.tfm +2013/04/14 | 1044 | fonts/sansmathfonts/tfm/cmssbsy8.tfm +2013/04/14 | 1044 | fonts/sansmathfonts/tfm/cmssbsy9.tfm +2013/04/14 | 1288 | fonts/sansmathfonts/tfm/cmssbxcsc10.tfm +2013/04/14 | 1296 | fonts/sansmathfonts/tfm/cmsscsc10.tfm +2013/04/14 | 1300 | fonts/sansmathfonts/tfm/cmsscsc8.tfm +2013/04/14 | 1296 | fonts/sansmathfonts/tfm/cmsscsc9.tfm +2013/04/14 | 1464 | fonts/sansmathfonts/tfm/cmsscsci10.tfm +2013/04/14 | 1468 | fonts/sansmathfonts/tfm/cmsscsci8.tfm +2013/04/14 | 1464 | fonts/sansmathfonts/tfm/cmsscsci9.tfm +2013/04/14 | 928 | fonts/sansmathfonts/tfm/cmssex10.tfm +2013/04/14 | 928 | fonts/sansmathfonts/tfm/cmssex7.tfm +2013/04/14 | 924 | fonts/sansmathfonts/tfm/cmssex8.tfm +2013/04/14 | 932 | fonts/sansmathfonts/tfm/cmssex9.tfm +2013/04/23 | 1504 | fonts/sansmathfonts/tfm/cmssmi10.tfm +2013/04/14 | 1492 | fonts/sansmathfonts/tfm/cmssmi5.tfm +2013/04/14 | 1496 | fonts/sansmathfonts/tfm/cmssmi6.tfm +2013/04/14 | 1504 | fonts/sansmathfonts/tfm/cmssmi7.tfm +2013/04/14 | 1488 | fonts/sansmathfonts/tfm/cmssmi8.tfm +2013/04/14 | 1500 | fonts/sansmathfonts/tfm/cmssmi9.tfm +2013/04/14 | 1472 | fonts/sansmathfonts/tfm/cmssmib10.tfm +2013/04/14 | 1484 | fonts/sansmathfonts/tfm/cmssmib5.tfm +2013/04/14 | 1472 | fonts/sansmathfonts/tfm/cmssmib6.tfm +2013/04/14 | 1488 | fonts/sansmathfonts/tfm/cmssmib7.tfm +2013/04/14 | 1468 | fonts/sansmathfonts/tfm/cmssmib8.tfm +2013/04/14 | 1488 | fonts/sansmathfonts/tfm/cmssmib9.tfm +2013/04/14 | 1048 | fonts/sansmathfonts/tfm/cmsssy10.tfm +2013/04/14 | 1044 | fonts/sansmathfonts/tfm/cmsssy5.tfm +2013/04/14 | 1044 | fonts/sansmathfonts/tfm/cmsssy6.tfm +2013/04/14 | 1044 | fonts/sansmathfonts/tfm/cmsssy7.tfm +2013/04/14 | 1044 | fonts/sansmathfonts/tfm/cmsssy8.tfm +2013/04/14 | 1040 | fonts/sansmathfonts/tfm/cmsssy9.tfm +2013/04/23 | 1236 | fonts/sansmathfonts/tfm/cmssu10.tfm +2013/04/14 | 1452 | fonts/sansmathfonts/tfm/cmssxicsc10.tfm +2013/04/14 | 2992 | fonts/sansmathfonts/tfm/eczi0500.tfm +2013/04/14 | 2988 | fonts/sansmathfonts/tfm/eczi0600.tfm +2013/04/14 | 2996 | fonts/sansmathfonts/tfm/eczi0700.tfm +2013/04/14 | 2988 | fonts/sansmathfonts/tfm/eczi0800.tfm +2013/04/14 | 2988 | fonts/sansmathfonts/tfm/eczi0900.tfm +2013/04/14 | 2972 | fonts/sansmathfonts/tfm/eczi1000.tfm +2013/04/14 | 3000 | fonts/sansmathfonts/tfm/eczi1095.tfm +2013/04/14 | 2996 | fonts/sansmathfonts/tfm/eczi1200.tfm +2013/04/14 | 2988 | fonts/sansmathfonts/tfm/eczi1440.tfm +2013/04/14 | 2992 | fonts/sansmathfonts/tfm/eczi1728.tfm +2013/04/14 | 3004 | fonts/sansmathfonts/tfm/eczi2074.tfm +2013/04/14 | 3000 | fonts/sansmathfonts/tfm/eczi2488.tfm +2013/04/14 | 3000 | fonts/sansmathfonts/tfm/eczi2986.tfm +2013/04/14 | 2992 | fonts/sansmathfonts/tfm/eczi3583.tfm +2013/04/14 | 2956 | fonts/sansmathfonts/tfm/eczo0500.tfm +2013/04/14 | 2992 | fonts/sansmathfonts/tfm/eczo0600.tfm +2013/04/14 | 2988 | fonts/sansmathfonts/tfm/eczo0700.tfm +2013/04/14 | 3000 | fonts/sansmathfonts/tfm/eczo0800.tfm +2013/04/14 | 2988 | fonts/sansmathfonts/tfm/eczo0900.tfm +2013/04/14 | 2988 | fonts/sansmathfonts/tfm/eczo1000.tfm +2013/04/14 | 2996 | fonts/sansmathfonts/tfm/eczo1095.tfm +2013/04/14 | 2988 | fonts/sansmathfonts/tfm/eczo1200.tfm +2013/04/14 | 2988 | fonts/sansmathfonts/tfm/eczo1440.tfm +2013/04/14 | 2992 | fonts/sansmathfonts/tfm/eczo1728.tfm +2013/04/14 | 2988 | fonts/sansmathfonts/tfm/eczo2074.tfm +2013/04/14 | 2988 | fonts/sansmathfonts/tfm/eczo2488.tfm +2013/04/14 | 2988 | fonts/sansmathfonts/tfm/eczo2986.tfm +2013/04/14 | 2988 | fonts/sansmathfonts/tfm/eczo3583.tfm +2013/04/14 | 2808 | fonts/sansmathfonts/tfm/eczx0500.tfm +2013/04/14 | 2836 | fonts/sansmathfonts/tfm/eczx0600.tfm +2013/04/14 | 2828 | fonts/sansmathfonts/tfm/eczx0700.tfm +2013/04/14 | 2836 | fonts/sansmathfonts/tfm/eczx0800.tfm +2013/04/14 | 2824 | fonts/sansmathfonts/tfm/eczx0900.tfm +2013/04/14 | 2820 | fonts/sansmathfonts/tfm/eczx1000.tfm +2013/04/14 | 2832 | fonts/sansmathfonts/tfm/eczx1095.tfm +2013/04/14 | 2824 | fonts/sansmathfonts/tfm/eczx1200.tfm +2013/04/14 | 2816 | fonts/sansmathfonts/tfm/eczx1440.tfm +2013/04/14 | 2820 | fonts/sansmathfonts/tfm/eczx1728.tfm +2013/04/14 | 2816 | fonts/sansmathfonts/tfm/eczx2074.tfm +2013/04/14 | 2816 | fonts/sansmathfonts/tfm/eczx2488.tfm +2013/04/14 | 2816 | fonts/sansmathfonts/tfm/eczx2986.tfm +2013/04/14 | 2816 | fonts/sansmathfonts/tfm/eczx3583.tfm +2013/04/14 | 2844 | fonts/sansmathfonts/tfm/eczz0500.tfm +2013/04/14 | 2824 | fonts/sansmathfonts/tfm/eczz0600.tfm +2013/04/14 | 2832 | fonts/sansmathfonts/tfm/eczz0700.tfm +2013/04/14 | 2820 | fonts/sansmathfonts/tfm/eczz0800.tfm +2013/04/14 | 2816 | fonts/sansmathfonts/tfm/eczz0900.tfm +2013/04/14 | 2796 | fonts/sansmathfonts/tfm/eczz1000.tfm +2013/04/14 | 2828 | fonts/sansmathfonts/tfm/eczz1095.tfm +2013/04/14 | 2812 | fonts/sansmathfonts/tfm/eczz1200.tfm +2013/04/14 | 2808 | fonts/sansmathfonts/tfm/eczz1440.tfm +2013/04/14 | 2808 | fonts/sansmathfonts/tfm/eczz1728.tfm +2013/04/14 | 2820 | fonts/sansmathfonts/tfm/eczz2074.tfm +2013/04/14 | 2816 | fonts/sansmathfonts/tfm/eczz2488.tfm +2013/04/14 | 2816 | fonts/sansmathfonts/tfm/eczz2986.tfm +2013/04/14 | 2804 | fonts/sansmathfonts/tfm/eczz3583.tfm +2013/04/14 | 300 | fonts/sansmathfonts/tfm/ssesint10.tfm +2013/04/14 | 300 | fonts/sansmathfonts/tfm/ssesint7.tfm +2013/04/14 | 300 | fonts/sansmathfonts/tfm/ssesint8.tfm +2013/04/14 | 300 | fonts/sansmathfonts/tfm/ssesint9.tfm +2013/04/14 | 852 | fonts/sansmathfonts/tfm/ssmsam10.tfm +2013/04/14 | 856 | fonts/sansmathfonts/tfm/ssmsam5.tfm +2013/04/14 | 856 | fonts/sansmathfonts/tfm/ssmsam6.tfm +2013/04/14 | 856 | fonts/sansmathfonts/tfm/ssmsam7.tfm +2013/04/14 | 852 | fonts/sansmathfonts/tfm/ssmsam8.tfm +2013/04/14 | 856 | fonts/sansmathfonts/tfm/ssmsam9.tfm +2013/04/14 | 844 | fonts/sansmathfonts/tfm/ssmsbm10.tfm +2013/04/14 | 876 | fonts/sansmathfonts/tfm/ssmsbm5.tfm +2013/04/14 | 876 | fonts/sansmathfonts/tfm/ssmsbm6.tfm +2013/04/14 | 876 | fonts/sansmathfonts/tfm/ssmsbm7.tfm +2013/04/14 | 876 | fonts/sansmathfonts/tfm/ssmsbm8.tfm +2013/04/14 | 876 | fonts/sansmathfonts/tfm/ssmsbm9.tfm +2013/04/14 | 2926 | fonts/sansmathfonts/type1/cmsmfIPiXi10.pfb +2013/04/14 | 2926 | fonts/sansmathfonts/type1/cmsmfIPiXi12.pfb +2013/04/14 | 2926 | fonts/sansmathfonts/type1/cmsmfIPiXi17.pfb +2013/04/14 | 2922 | fonts/sansmathfonts/type1/cmsmfIPiXi8.pfb +2013/04/14 | 2922 | fonts/sansmathfonts/type1/cmsmfIPiXi9.pfb +2013/04/14 | 8338 | fonts/sansmathfonts/type1/cmsmfIPiXibx10.pfb +2013/04/14 | 8206 | fonts/sansmathfonts/type1/cmsmfIPiXibx12.pfb +2013/04/14 | 8338 | fonts/sansmathfonts/type1/cmsmfIPiXibx17.pfb +2013/04/14 | 8334 | fonts/sansmathfonts/type1/cmsmfIPiXibx8.pfb +2013/04/14 | 8211 | fonts/sansmathfonts/type1/cmsmfIPiXibx9.pfb +2013/04/23 | 8523 | fonts/sansmathfonts/type1/cmsmfIPiXibxcsc10.pfb +2013/04/23 | 3020 | fonts/sansmathfonts/type1/cmsmfIPiXicsc10.pfb +2013/04/23 | 3014 | fonts/sansmathfonts/type1/cmsmfIPiXicsc8.pfb +2013/04/23 | 3016 | fonts/sansmathfonts/type1/cmsmfIPiXicsc9.pfb +2013/04/23 | 8139 | fonts/sansmathfonts/type1/cmsmfIPiXicsci10.pfb +2013/04/23 | 8205 | fonts/sansmathfonts/type1/cmsmfIPiXicsci8.pfb +2013/04/23 | 8241 | fonts/sansmathfonts/type1/cmsmfIPiXicsci9.pfb +2013/04/14 | 7991 | fonts/sansmathfonts/type1/cmsmfIPiXii10.pfb +2013/04/14 | 7937 | fonts/sansmathfonts/type1/cmsmfIPiXii12.pfb +2013/04/14 | 7978 | fonts/sansmathfonts/type1/cmsmfIPiXii17.pfb +2013/04/14 | 8058 | fonts/sansmathfonts/type1/cmsmfIPiXii8.pfb +2013/04/14 | 8078 | fonts/sansmathfonts/type1/cmsmfIPiXii9.pfb +2013/04/14 | 3506 | fonts/sansmathfonts/type1/cmsmfIPiXixi10.pfb +2013/04/14 | 3510 | fonts/sansmathfonts/type1/cmsmfIPiXixi12.pfb +2013/04/14 | 3500 | fonts/sansmathfonts/type1/cmsmfIPiXixi17.pfb +2013/04/14 | 3511 | fonts/sansmathfonts/type1/cmsmfIPiXixi8.pfb +2013/04/14 | 3487 | fonts/sansmathfonts/type1/cmsmfIPiXixi9.pfb +2013/04/23 | 3733 | fonts/sansmathfonts/type1/cmsmfIPiXixicsc10.pfb +2013/04/14 | 43442 | fonts/sansmathfonts/type1/cmssbsy10.pfb +2013/04/14 | 43738 | fonts/sansmathfonts/type1/cmssbsy5.pfb +2013/04/14 | 43517 | fonts/sansmathfonts/type1/cmssbsy6.pfb +2013/04/14 | 43420 | fonts/sansmathfonts/type1/cmssbsy7.pfb +2013/04/14 | 43619 | fonts/sansmathfonts/type1/cmssbsy8.pfb +2013/04/14 | 43463 | fonts/sansmathfonts/type1/cmssbsy9.pfb +2013/04/14 | 39319 | fonts/sansmathfonts/type1/cmssbx12.pfb +2013/04/14 | 39396 | fonts/sansmathfonts/type1/cmssbx17.pfb +2013/04/14 | 39465 | fonts/sansmathfonts/type1/cmssbx8.pfb +2013/04/14 | 39377 | fonts/sansmathfonts/type1/cmssbx9.pfb +2013/04/14 | 36951 | fonts/sansmathfonts/type1/cmssbxcsc10.pfb +2013/04/14 | 29140 | fonts/sansmathfonts/type1/cmsscsc10.pfb +2013/04/14 | 28572 | fonts/sansmathfonts/type1/cmsscsc8.pfb +2013/04/14 | 28903 | fonts/sansmathfonts/type1/cmsscsc9.pfb +2013/04/14 | 32889 | fonts/sansmathfonts/type1/cmsscsci10.pfb +2013/04/14 | 31824 | fonts/sansmathfonts/type1/cmsscsci8.pfb +2013/04/14 | 32246 | fonts/sansmathfonts/type1/cmsscsci9.pfb +2013/04/14 | 27911 | fonts/sansmathfonts/type1/cmssex10.pfb +2013/04/14 | 27772 | fonts/sansmathfonts/type1/cmssex7.pfb +2013/04/14 | 27775 | fonts/sansmathfonts/type1/cmssex8.pfb +2013/04/14 | 28082 | fonts/sansmathfonts/type1/cmssex9.pfb +2013/04/23 | 35623 | fonts/sansmathfonts/type1/cmssmi10.pfb +2013/04/14 | 36164 | fonts/sansmathfonts/type1/cmssmi5.pfb +2013/04/14 | 35952 | fonts/sansmathfonts/type1/cmssmi6.pfb +2013/04/14 | 36108 | fonts/sansmathfonts/type1/cmssmi7.pfb +2013/04/14 | 35866 | fonts/sansmathfonts/type1/cmssmi8.pfb +2013/04/14 | 35964 | fonts/sansmathfonts/type1/cmssmi9.pfb +2013/04/14 | 41863 | fonts/sansmathfonts/type1/cmssmib10.pfb +2013/04/14 | 41891 | fonts/sansmathfonts/type1/cmssmib5.pfb +2013/04/14 | 41933 | fonts/sansmathfonts/type1/cmssmib6.pfb +2013/04/14 | 41887 | fonts/sansmathfonts/type1/cmssmib7.pfb +2013/04/14 | 41845 | fonts/sansmathfonts/type1/cmssmib8.pfb +2013/04/14 | 41881 | fonts/sansmathfonts/type1/cmssmib9.pfb +2013/04/14 | 42737 | fonts/sansmathfonts/type1/cmsssy10.pfb +2013/04/14 | 42054 | fonts/sansmathfonts/type1/cmsssy5.pfb +2013/04/14 | 42385 | fonts/sansmathfonts/type1/cmsssy6.pfb +2013/04/14 | 43631 | fonts/sansmathfonts/type1/cmsssy7.pfb +2013/04/14 | 40734 | fonts/sansmathfonts/type1/cmsssy8.pfb +2013/04/14 | 42202 | fonts/sansmathfonts/type1/cmsssy9.pfb +2013/04/23 | 35738 | fonts/sansmathfonts/type1/cmssu10.pfb +2013/04/14 | 40073 | fonts/sansmathfonts/type1/cmssxi10.pfb +2013/04/14 | 40143 | fonts/sansmathfonts/type1/cmssxi12.pfb +2013/04/14 | 40152 | fonts/sansmathfonts/type1/cmssxi17.pfb +2013/04/14 | 40049 | fonts/sansmathfonts/type1/cmssxi8.pfb +2013/04/14 | 40157 | fonts/sansmathfonts/type1/cmssxi9.pfb +2013/04/14 | 37883 | fonts/sansmathfonts/type1/cmssxicsc10.pfb +2013/04/14 | 50621 | fonts/sansmathfonts/type1/eczi0500.pfb +2013/04/14 | 48927 | fonts/sansmathfonts/type1/eczi0600.pfb +2013/04/14 | 47926 | fonts/sansmathfonts/type1/eczi0700.pfb +2013/04/14 | 48275 | fonts/sansmathfonts/type1/eczi0800.pfb +2013/04/14 | 49060 | fonts/sansmathfonts/type1/eczi0900.pfb +2013/04/14 | 49348 | fonts/sansmathfonts/type1/eczi1000.pfb +2013/04/14 | 49028 | fonts/sansmathfonts/type1/eczi1095.pfb +2013/04/14 | 48548 | fonts/sansmathfonts/type1/eczi1200.pfb +2013/04/14 | 48555 | fonts/sansmathfonts/type1/eczi1440.pfb +2013/04/14 | 48865 | fonts/sansmathfonts/type1/eczi1728.pfb +2013/04/14 | 48387 | fonts/sansmathfonts/type1/eczi2074.pfb +2013/04/14 | 49510 | fonts/sansmathfonts/type1/eczi2488.pfb +2013/04/14 | 49081 | fonts/sansmathfonts/type1/eczi2986.pfb +2013/04/14 | 49306 | fonts/sansmathfonts/type1/eczi3583.pfb +2013/04/14 | 58631 | fonts/sansmathfonts/type1/eczo0500.pfb +2013/04/14 | 59241 | fonts/sansmathfonts/type1/eczo0600.pfb +2013/04/14 | 57741 | fonts/sansmathfonts/type1/eczo0700.pfb +2013/04/14 | 59884 | fonts/sansmathfonts/type1/eczo0800.pfb +2013/04/14 | 58489 | fonts/sansmathfonts/type1/eczo0900.pfb +2013/04/14 | 59383 | fonts/sansmathfonts/type1/eczo1000.pfb +2013/04/14 | 58421 | fonts/sansmathfonts/type1/eczo1095.pfb +2013/04/14 | 57776 | fonts/sansmathfonts/type1/eczo1200.pfb +2013/04/14 | 56632 | fonts/sansmathfonts/type1/eczo1440.pfb +2013/04/14 | 56012 | fonts/sansmathfonts/type1/eczo1728.pfb +2013/04/14 | 57586 | fonts/sansmathfonts/type1/eczo2074.pfb +2013/04/14 | 58541 | fonts/sansmathfonts/type1/eczo2488.pfb +2013/04/14 | 57164 | fonts/sansmathfonts/type1/eczo2986.pfb +2013/04/14 | 57556 | fonts/sansmathfonts/type1/eczo3583.pfb +2013/04/14 | 60289 | fonts/sansmathfonts/type1/eczx0500.pfb +2013/04/14 | 56988 | fonts/sansmathfonts/type1/eczx0600.pfb +2013/04/14 | 58803 | fonts/sansmathfonts/type1/eczx0700.pfb +2013/04/14 | 60945 | fonts/sansmathfonts/type1/eczx0800.pfb +2013/04/14 | 55600 | fonts/sansmathfonts/type1/eczx0900.pfb +2013/04/14 | 58451 | fonts/sansmathfonts/type1/eczx1000.pfb +2013/04/14 | 59768 | fonts/sansmathfonts/type1/eczx1095.pfb +2013/04/14 | 57433 | fonts/sansmathfonts/type1/eczx1200.pfb +2013/04/14 | 58591 | fonts/sansmathfonts/type1/eczx1440.pfb +2013/04/14 | 54835 | fonts/sansmathfonts/type1/eczx1728.pfb +2013/04/14 | 62393 | fonts/sansmathfonts/type1/eczx2074.pfb +2013/04/14 | 57624 | fonts/sansmathfonts/type1/eczx2488.pfb +2013/04/14 | 56729 | fonts/sansmathfonts/type1/eczx2986.pfb +2013/04/14 | 55600 | fonts/sansmathfonts/type1/eczx3583.pfb +2013/04/14 | 44897 | fonts/sansmathfonts/type1/eczz0500.pfb +2013/04/14 | 43140 | fonts/sansmathfonts/type1/eczz0600.pfb +2013/04/14 | 43434 | fonts/sansmathfonts/type1/eczz0700.pfb +2013/04/14 | 43692 | fonts/sansmathfonts/type1/eczz0800.pfb +2013/04/14 | 43375 | fonts/sansmathfonts/type1/eczz0900.pfb +2013/04/14 | 43425 | fonts/sansmathfonts/type1/eczz1000.pfb +2013/04/14 | 43458 | fonts/sansmathfonts/type1/eczz1095.pfb +2013/04/14 | 43443 | fonts/sansmathfonts/type1/eczz1200.pfb +2013/04/14 | 43437 | fonts/sansmathfonts/type1/eczz1440.pfb +2013/04/14 | 43726 | fonts/sansmathfonts/type1/eczz1728.pfb +2013/04/14 | 43198 | fonts/sansmathfonts/type1/eczz2074.pfb +2013/04/14 | 43361 | fonts/sansmathfonts/type1/eczz2488.pfb +2013/04/14 | 43356 | fonts/sansmathfonts/type1/eczz2986.pfb +2013/04/14 | 43394 | fonts/sansmathfonts/type1/eczz3583.pfb +2013/04/14 | 26307 | fonts/sansmathfonts/type1/ssesint10.pfb +2013/04/14 | 26615 | fonts/sansmathfonts/type1/ssesint7.pfb +2013/04/14 | 25607 | fonts/sansmathfonts/type1/ssesint8.pfb +2013/04/14 | 25826 | fonts/sansmathfonts/type1/ssesint9.pfb +2013/04/14 | 39292 | fonts/sansmathfonts/type1/ssmsam10.pfb +2013/04/14 | 38265 | fonts/sansmathfonts/type1/ssmsam5.pfb +2013/04/14 | 39675 | fonts/sansmathfonts/type1/ssmsam6.pfb +2013/04/14 | 41992 | fonts/sansmathfonts/type1/ssmsam7.pfb +2013/04/14 | 36482 | fonts/sansmathfonts/type1/ssmsam8.pfb +2013/04/14 | 39986 | fonts/sansmathfonts/type1/ssmsam9.pfb +2013/04/14 | 52315 | fonts/sansmathfonts/type1/ssmsbm10.pfb +2013/04/14 | 51639 | fonts/sansmathfonts/type1/ssmsbm5.pfb +2013/04/14 | 52936 | fonts/sansmathfonts/type1/ssmsbm6.pfb +2013/04/14 | 55371 | fonts/sansmathfonts/type1/ssmsbm7.pfb +2013/04/14 | 51158 | fonts/sansmathfonts/type1/ssmsbm8.pfb +2013/04/14 | 55875 | fonts/sansmathfonts/type1/ssmsbm9.pfb 2013/04/25 | 836 | fonts/sansmathfonts/vf/cmsmf10.vf 2013/04/25 | 836 | fonts/sansmathfonts/vf/cmsmf12.vf 2013/04/25 | 836 | fonts/sansmathfonts/vf/cmsmf17.vf @@ -133374,7 +133374,7 @@ 2013/04/25 | 836 | fonts/sansmathfonts/vf/cmsmfxi8.vf 2013/04/25 | 836 | fonts/sansmathfonts/vf/cmsmfxi9.vf 2013/04/25 | 844 | fonts/sansmathfonts/vf/cmsmfxicsc10.vf -2021/06/22 | 5935163 | fonts/sansmathfonts.zip +2022/10/09 | 6003316 | fonts/sansmathfonts.zip 2020/03/09 | 2731 | fonts/scholax/afm/NCXFourierBMI.afm 2020/03/09 | 2625 | fonts/scholax/afm/NCXFourierBMR.afm 2020/03/09 | 3539 | fonts/scholax/afm/NCXFourierMI.afm @@ -151795,19 +151795,19 @@ 2020/05/24 | 7475 | graphics/bookshelf/README.md 2020/05/24 | 41 | graphics/bookshelf/VERSION 2020/05/24 | 1783280 | graphics/bookshelf.zip -2022/09/19 | 49194 | graphics/chemobabel/chemobabel.dtx -2022/09/19 | 548875 | graphics/chemobabel/chemobabel-en.pdf -2022/09/19 | 181 | graphics/chemobabel/chemobabel.ins -2022/09/19 | 651493 | graphics/chemobabel/chemobabel-ja.pdf -2022/09/19 | 9128 | graphics/chemobabel/chemobabel.sty -2022/09/19 | 132001 | graphics/chemobabel/example-en.pdf -2022/09/19 | 1406 | graphics/chemobabel/example-en.tex -2022/09/19 | 93393 | graphics/chemobabel/example-ja.pdf -2022/09/19 | 1741 | graphics/chemobabel/example-ja.tex -2022/09/19 | 80138 | graphics/chemobabel/images-for-doc.tar.gz -2022/09/19 | 1338 | graphics/chemobabel/LICENSE -2022/09/19 | 1387 | graphics/chemobabel/README.md -2022/09/19 | 1257630 | graphics/chemobabel.zip +2022/10/09 | 49805 | graphics/chemobabel/chemobabel.dtx +2022/10/09 | 568562 | graphics/chemobabel/chemobabel-en.pdf +2022/10/09 | 181 | graphics/chemobabel/chemobabel.ins +2022/10/09 | 672338 | graphics/chemobabel/chemobabel-ja.pdf +2022/10/09 | 14943 | graphics/chemobabel/chemobabel.sty +2022/10/09 | 132001 | graphics/chemobabel/example-en.pdf +2022/10/09 | 1473 | graphics/chemobabel/example-en.tex +2022/10/09 | 93393 | graphics/chemobabel/example-ja.pdf +2022/10/09 | 1820 | graphics/chemobabel/example-ja.tex +2022/10/09 | 81095 | graphics/chemobabel/images-for-doc.tar.gz +2022/10/09 | 1338 | graphics/chemobabel/LICENSE +2022/10/09 | 1387 | graphics/chemobabel/README.md +2022/10/09 | 1300376 | graphics/chemobabel.zip 2022/07/27 | 1185 | graphics/circuit_macros/boxdims.sty 2022/07/27 | 13500 | graphics/circuit_macros/CHANGES 2022/07/27 | 462 | graphics/circuit_macros/Copying @@ -189431,7 +189431,7 @@ 2022/06/24 | 6335831 | install/macros/latex/contrib/tcolorbox.tds.zip 2009/06/22 | 771373 | install/macros/latex/contrib/tdsfrmath.tds.zip 2019/09/29 | 5325410 | install/macros/latex/contrib/testidx.tds.zip -2022/06/15 | 498777 | install/macros/latex/contrib/thalie.tds.zip +2022/10/09 | 507609 | install/macros/latex/contrib/thalie.tds.zip 2013/01/06 | 389729 | install/macros/latex/contrib/threadcol.tds.zip 2014/03/09 | 752162 | install/macros/latex/contrib/thumbs.tds.zip 2022/10/05 | 1734686 | install/macros/latex/contrib/thuthesis.tds.zip @@ -219656,13 +219656,13 @@ 2015/08/26 | 130521 | macros/latex/contrib/IEEEtran/tools/IEEEtrantools.sty 2015/08/27 | 4190 | macros/latex/contrib/IEEEtran/tools/README 2015/08/28 | 1727001 | macros/latex/contrib/IEEEtran.zip -2022/10/01 | 40 | macros/latex/contrib/iexec/DEPENDS.txt -2022/10/01 | 8360 | macros/latex/contrib/iexec/iexec.dtx -2022/10/01 | 2641 | macros/latex/contrib/iexec/iexec.ins -2022/10/01 | 284051 | macros/latex/contrib/iexec/iexec.pdf -2022/10/01 | 1083 | macros/latex/contrib/iexec/LICENSE.txt -2022/10/01 | 1369 | macros/latex/contrib/iexec/README.md -2022/10/01 | 288137 | macros/latex/contrib/iexec.zip +2022/10/09 | 51 | macros/latex/contrib/iexec/DEPENDS.txt +2022/10/09 | 10317 | macros/latex/contrib/iexec/iexec.dtx +2022/10/09 | 2625 | macros/latex/contrib/iexec/iexec.ins +2022/10/09 | 294434 | macros/latex/contrib/iexec/iexec.pdf +2022/10/09 | 1083 | macros/latex/contrib/iexec/LICENSE.txt +2022/10/09 | 1369 | macros/latex/contrib/iexec/README.md +2022/10/09 | 298605 | macros/latex/contrib/iexec.zip 2004/10/19 | 24919 | macros/latex/contrib/ifacmtg/ifac.bst 2003/06/12 | 62063 | macros/latex/contrib/ifacmtg/ifacmtg.cls 1999/04/22 | 1681 | macros/latex/contrib/ifacmtg/ifacsam.bib @@ -231924,18 +231924,18 @@ 2017/05/01 | 3024 | macros/latex/contrib/thaienum/thaienum.sty 2017/05/01 | 25851 | macros/latex/contrib/thaienum/thaienum.tex 2017/05/01 | 188056 | macros/latex/contrib/thaienum.zip -2022/06/15 | 2986 | macros/latex/contrib/thalie/CHANGELOG.md -2022/06/15 | 1001 | macros/latex/contrib/thalie/dicts/thalie-english.trsl -2022/06/15 | 1643 | macros/latex/contrib/thalie/dicts/thalie-fallback.trsl -2022/06/15 | 1027 | macros/latex/contrib/thalie/dicts/thalie-french.trsl -2022/06/15 | 1067 | macros/latex/contrib/thalie/dicts/thalie-german.trsl -2022/06/15 | 1022 | macros/latex/contrib/thalie/dicts/thalie-italian.trsl -2022/06/15 | 19106 | macros/latex/contrib/thalie/LICENSE.txt -2022/06/15 | 1582 | macros/latex/contrib/thalie/README.md -2022/06/15 | 78190 | macros/latex/contrib/thalie/thalie.dtx -2022/06/15 | 2167 | macros/latex/contrib/thalie/thalie.ins -2022/06/15 | 475823 | macros/latex/contrib/thalie/thalie.pdf -2022/06/15 | 492890 | macros/latex/contrib/thalie.zip +2022/10/09 | 3108 | macros/latex/contrib/thalie/CHANGELOG.md +2022/10/09 | 1001 | macros/latex/contrib/thalie/dicts/thalie-english.trsl +2022/10/09 | 1643 | macros/latex/contrib/thalie/dicts/thalie-fallback.trsl +2022/10/09 | 1027 | macros/latex/contrib/thalie/dicts/thalie-french.trsl +2022/10/09 | 1067 | macros/latex/contrib/thalie/dicts/thalie-german.trsl +2022/10/09 | 1022 | macros/latex/contrib/thalie/dicts/thalie-italian.trsl +2022/10/09 | 19106 | macros/latex/contrib/thalie/LICENSE.txt +2022/10/09 | 1582 | macros/latex/contrib/thalie/README.md +2022/10/09 | 78784 | macros/latex/contrib/thalie/thalie.dtx +2022/10/09 | 2167 | macros/latex/contrib/thalie/thalie.ins +2022/10/09 | 484998 | macros/latex/contrib/thalie/thalie.pdf +2022/10/09 | 501727 | macros/latex/contrib/thalie.zip 2016/11/17 | 8537 | macros/latex/contrib/theatre/doc/help_source/createrules.tex 2016/11/17 | 9150 | macros/latex/contrib/theatre/doc/help_source/creerlesroles.tex 2016/11/17 | 5003 | macros/latex/contrib/theatre/doc/help_source/ExampleMacBeth.tex @@ -281423,8 +281423,8 @@ 2019/02/28 | 293444 | systems/texlive/tlnet/archive/algorithms.doc.r42428.tar.xz 2019/02/28 | 3472 | systems/texlive/tlnet/archive/algorithms.r42428.tar.xz 2019/02/28 | 11940 | systems/texlive/tlnet/archive/algorithms.source.r42428.tar.xz -2021/12/07 | 350956 | systems/texlive/tlnet/archive/algpseudocodex.doc.r61230.tar.xz -2021/12/07 | 6972 | systems/texlive/tlnet/archive/algpseudocodex.r61230.tar.xz +2022/10/09 | 350996 | systems/texlive/tlnet/archive/algpseudocodex.doc.r64654.tar.xz +2022/10/09 | 6984 | systems/texlive/tlnet/archive/algpseudocodex.r64654.tar.xz 2019/02/28 | 2568 | systems/texlive/tlnet/archive/alg.r15878.tar.xz 2019/02/28 | 5768 | systems/texlive/tlnet/archive/alg.source.r15878.tar.xz 2020/08/01 | 173088 | systems/texlive/tlnet/archive/algxpar.doc.r56006.tar.xz @@ -283473,7 +283473,7 @@ 2022/06/10 | 700 | systems/texlive/tlnet/archive/collection-latex.r63515.tar.xz 2022/06/12 | 736 | systems/texlive/tlnet/archive/collection-latexrecommended.r63547.tar.xz 2022/09/15 | 920 | systems/texlive/tlnet/archive/collection-luatex.r64393.tar.xz -2022/09/20 | 1624 | systems/texlive/tlnet/archive/collection-mathscience.r64444.tar.xz +2022/10/09 | 1624 | systems/texlive/tlnet/archive/collection-mathscience.r64648.tar.xz 2021/06/10 | 548 | systems/texlive/tlnet/archive/collection-metapost.r59531.tar.xz 2021/02/24 | 476 | systems/texlive/tlnet/archive/collection-music.r57878.tar.xz 2022/09/14 | 1544 | systems/texlive/tlnet/archive/collection-pictures.r64373.tar.xz @@ -284584,9 +284584,9 @@ 2019/02/28 | 340 | systems/texlive/tlnet/archive/dtxgen.x86_64-solaris.r29031.tar.xz 2019/02/28 | 313116 | systems/texlive/tlnet/archive/dtxtut.doc.r38375.tar.xz 2019/02/28 | 488 | systems/texlive/tlnet/archive/dtxtut.r38375.tar.xz -2020/10/30 | 485276 | systems/texlive/tlnet/archive/ducksay.doc.r56800.tar.xz -2020/10/30 | 9144 | systems/texlive/tlnet/archive/ducksay.r56800.tar.xz -2020/10/30 | 20352 | systems/texlive/tlnet/archive/ducksay.source.r56800.tar.xz +2022/10/09 | 528272 | systems/texlive/tlnet/archive/ducksay.doc.r64655.tar.xz +2022/10/09 | 9388 | systems/texlive/tlnet/archive/ducksay.r64655.tar.xz +2022/10/09 | 20792 | systems/texlive/tlnet/archive/ducksay.source.r64655.tar.xz 2019/10/04 | 495140 | systems/texlive/tlnet/archive/duckuments.doc.r52271.tar.xz 2019/10/04 | 484476 | systems/texlive/tlnet/archive/duckuments.r52271.tar.xz 2019/10/04 | 9108 | systems/texlive/tlnet/archive/duckuments.source.r52271.tar.xz @@ -285666,6 +285666,9 @@ 2019/02/28 | 398240 | systems/texlive/tlnet/archive/fixltxhyph.doc.r25832.tar.xz 2019/02/28 | 1468 | systems/texlive/tlnet/archive/fixltxhyph.r25832.tar.xz 2019/02/28 | 6744 | systems/texlive/tlnet/archive/fixltxhyph.source.r25832.tar.xz +2022/10/09 | 188924 | systems/texlive/tlnet/archive/fixmath.doc.r64648.tar.xz +2022/10/09 | 1496 | systems/texlive/tlnet/archive/fixmath.r64648.tar.xz +2022/10/09 | 2604 | systems/texlive/tlnet/archive/fixmath.source.r64648.tar.xz 2022/06/24 | 351976 | systems/texlive/tlnet/archive/fixme.doc.r63708.tar.xz 2022/06/24 | 8656 | systems/texlive/tlnet/archive/fixme.r63708.tar.xz 2022/06/24 | 35036 | systems/texlive/tlnet/archive/fixme.source.r63708.tar.xz @@ -287627,8 +287630,8 @@ 2022/10/05 | 7920 | systems/texlive/tlnet/archive/latex-firstaid-dev.source.r64594.tar.xz 2019/02/28 | 1128 | systems/texlive/tlnet/archive/latex-fonts.doc.r28888.tar.xz 2019/02/28 | 17972 | systems/texlive/tlnet/archive/latex-fonts.r28888.tar.xz -2022/03/08 | 2011400 | systems/texlive/tlnet/archive/latex-for-undergraduates.doc.r62505.tar.xz -2022/03/08 | 456 | systems/texlive/tlnet/archive/latex-for-undergraduates.r62505.tar.xz +2022/10/09 | 2009952 | systems/texlive/tlnet/archive/latex-for-undergraduates.doc.r64647.tar.xz +2022/10/09 | 456 | systems/texlive/tlnet/archive/latex-for-undergraduates.r64647.tar.xz 2020/04/21 | 446104 | systems/texlive/tlnet/archive/latexgit.doc.r54811.tar.xz 2019/02/28 | 344 | systems/texlive/tlnet/archive/latex-git-log.aarch64-linux.r46208.tar.xz 2019/02/28 | 348 | systems/texlive/tlnet/archive/latex-git-log.amd64-freebsd.r30983.tar.xz @@ -289486,8 +289489,8 @@ 2019/02/28 | 158552 | systems/texlive/tlnet/archive/needspace.doc.r29601.tar.xz 2019/02/28 | 828 | systems/texlive/tlnet/archive/needspace.r29601.tar.xz 2019/02/28 | 2120 | systems/texlive/tlnet/archive/needspace.source.r29601.tar.xz -2022/09/27 | 1542988 | systems/texlive/tlnet/archive/neo-euler.doc.r64517.tar.xz -2022/09/27 | 225304 | systems/texlive/tlnet/archive/neo-euler.r64517.tar.xz +2022/10/09 | 1544604 | systems/texlive/tlnet/archive/neo-euler.doc.r64652.tar.xz +2022/10/09 | 225664 | systems/texlive/tlnet/archive/neo-euler.r64652.tar.xz 2019/02/28 | 1920 | systems/texlive/tlnet/archive/nestquot.r27323.tar.xz 2019/02/28 | 641544 | systems/texlive/tlnet/archive/neuralnetwork.doc.r31500.tar.xz 2019/02/28 | 3604 | systems/texlive/tlnet/archive/neuralnetwork.r31500.tar.xz @@ -290462,9 +290465,9 @@ 2020/07/28 | 2536 | systems/texlive/tlnet/archive/pinoutikz.r55966.tar.xz 2019/02/28 | 110192 | systems/texlive/tlnet/archive/pitex.doc.r24731.tar.xz 2019/02/28 | 22664 | systems/texlive/tlnet/archive/pitex.r24731.tar.xz -2022/09/20 | 260792 | systems/texlive/tlnet/archive/piton.doc.r64446.tar.xz -2022/09/20 | 6916 | systems/texlive/tlnet/archive/piton.r64446.tar.xz -2022/09/20 | 8080 | systems/texlive/tlnet/archive/piton.source.r64446.tar.xz +2022/10/09 | 296024 | systems/texlive/tlnet/archive/piton.doc.r64656.tar.xz +2022/10/09 | 7136 | systems/texlive/tlnet/archive/piton.r64656.tar.xz +2022/10/09 | 12784 | systems/texlive/tlnet/archive/piton.source.r64656.tar.xz 2019/02/28 | 317704 | systems/texlive/tlnet/archive/pittetd.doc.r15878.tar.xz 2019/02/28 | 8884 | systems/texlive/tlnet/archive/pittetd.r15878.tar.xz 2019/02/28 | 38588 | systems/texlive/tlnet/archive/pittetd.source.r15878.tar.xz @@ -290733,8 +290736,8 @@ 2022/09/11 | 1217484 | systems/texlive/tlnet/archive/profcollege.r64334.tar.xz 2022/04/27 | 134096 | systems/texlive/tlnet/archive/proflabo.doc.r63147.tar.xz 2022/04/27 | 2748 | systems/texlive/tlnet/archive/proflabo.r63147.tar.xz -2022/10/05 | 931824 | systems/texlive/tlnet/archive/proflycee.doc.r64599.tar.xz -2022/10/05 | 17352 | systems/texlive/tlnet/archive/proflycee.r64599.tar.xz +2022/10/09 | 941476 | systems/texlive/tlnet/archive/proflycee.doc.r64649.tar.xz +2022/10/09 | 18028 | systems/texlive/tlnet/archive/proflycee.r64649.tar.xz 2019/02/28 | 49880 | systems/texlive/tlnet/archive/program.doc.r44214.tar.xz 2019/02/28 | 11780 | systems/texlive/tlnet/archive/program.r44214.tar.xz 2019/02/28 | 86236 | systems/texlive/tlnet/archive/progressbar.doc.r33822.tar.xz @@ -291922,8 +291925,8 @@ 2019/02/28 | 292656 | systems/texlive/tlnet/archive/simplecv.doc.r35537.tar.xz 2019/02/28 | 2112 | systems/texlive/tlnet/archive/simplecv.r35537.tar.xz 2019/02/28 | 5844 | systems/texlive/tlnet/archive/simplecv.source.r35537.tar.xz -2022/09/24 | 1938380 | systems/texlive/tlnet/archive/simpleicons.doc.r64491.tar.xz -2022/09/24 | 2637940 | systems/texlive/tlnet/archive/simpleicons.r64491.tar.xz +2022/10/09 | 1971700 | systems/texlive/tlnet/archive/simpleicons.doc.r64646.tar.xz +2022/10/09 | 2686828 | systems/texlive/tlnet/archive/simpleicons.r64646.tar.xz 2019/02/28 | 224844 | systems/texlive/tlnet/archive/simpleinvoice.doc.r45673.tar.xz 2019/02/28 | 2420 | systems/texlive/tlnet/archive/simpleinvoice.r45673.tar.xz 2022/10/03 | 130940 | systems/texlive/tlnet/archive/simplekv.doc.r64578.tar.xz @@ -292865,7 +292868,7 @@ 2022/09/13 | 600 | systems/texlive/tlnet/archive/texlive-scripts.amd64-freebsd.r64356.tar.xz 2022/09/13 | 596 | systems/texlive/tlnet/archive/texlive-scripts.amd64-netbsd.r64356.tar.xz 2022/09/13 | 596 | systems/texlive/tlnet/archive/texlive-scripts.armhf-linux.r64356.tar.xz -2022/10/07 | 421668 | systems/texlive/tlnet/archive/texlive-scripts.doc.r64631.tar.xz +2022/10/09 | 421700 | systems/texlive/tlnet/archive/texlive-scripts.doc.r64645.tar.xz 2020/01/27 | 916 | systems/texlive/tlnet/archive/texlive-scripts-extra.aarch64-linux.r53577.tar.xz 2020/01/27 | 924 | systems/texlive/tlnet/archive/texlive-scripts-extra.amd64-freebsd.r53577.tar.xz 2020/01/27 | 916 | systems/texlive/tlnet/archive/texlive-scripts-extra.amd64-netbsd.r53577.tar.xz @@ -292889,7 +292892,7 @@ 2022/09/13 | 592 | systems/texlive/tlnet/archive/texlive-scripts.i386-linux.r64356.tar.xz 2022/09/13 | 596 | systems/texlive/tlnet/archive/texlive-scripts.i386-netbsd.r64356.tar.xz 2022/09/13 | 596 | systems/texlive/tlnet/archive/texlive-scripts.i386-solaris.r64356.tar.xz -2022/10/07 | 113692 | systems/texlive/tlnet/archive/texlive-scripts.r64631.tar.xz +2022/10/09 | 113672 | systems/texlive/tlnet/archive/texlive-scripts.r64645.tar.xz 2022/09/13 | 580 | systems/texlive/tlnet/archive/texlive-scripts.universal-darwin.r64356.tar.xz 2022/04/19 | 36296 | systems/texlive/tlnet/archive/texlive-scripts.win32.r63068.tar.xz 2022/09/13 | 596 | systems/texlive/tlnet/archive/texlive-scripts.x86_64-cygwin.r64356.tar.xz @@ -294277,8 +294280,8 @@ 2020/01/19 | 4124 | systems/texlive/tlnet/archive/xbmks.r53448.tar.xz 2020/01/19 | 8024 | systems/texlive/tlnet/archive/xbmks.source.r53448.tar.xz 2022/04/18 | 224040 | systems/texlive/tlnet/archive/xcharter.doc.r63057.tar.xz -2022/09/29 | 1947508 | systems/texlive/tlnet/archive/xcharter-math.doc.r64544.tar.xz -2022/09/29 | 201636 | systems/texlive/tlnet/archive/xcharter-math.r64544.tar.xz +2022/10/09 | 1947500 | systems/texlive/tlnet/archive/xcharter-math.doc.r64653.tar.xz +2022/10/09 | 201872 | systems/texlive/tlnet/archive/xcharter-math.r64653.tar.xz 2022/04/18 | 2200760 | systems/texlive/tlnet/archive/xcharter.r63057.tar.xz 2020/01/22 | 159256 | systems/texlive/tlnet/archive/xcite.doc.r53486.tar.xz 2020/01/22 | 1048 | systems/texlive/tlnet/archive/xcite.r53486.tar.xz @@ -294733,16 +294736,16 @@ 2020/07/18 | 47816 | systems/texlive/tlnet/archive/zztex.doc.r55862.tar.xz 2020/07/18 | 101724 | systems/texlive/tlnet/archive/zztex.r55862.tar.xz 2022/07/17 | 124404 | systems/texlive/tlnet/install-tl -2022/10/07 | 5832287 | systems/texlive/tlnet/install-tl-unx.tar.gz -2022/10/07 | 152 | systems/texlive/tlnet/install-tl-unx.tar.gz.sha512 -2022/10/07 | 455 | systems/texlive/tlnet/install-tl-unx.tar.gz.sha512.asc +2022/10/09 | 5832291 | systems/texlive/tlnet/install-tl-unx.tar.gz +2022/10/09 | 152 | systems/texlive/tlnet/install-tl-unx.tar.gz.sha512 +2022/10/09 | 455 | systems/texlive/tlnet/install-tl-unx.tar.gz.sha512.asc 2021/04/11 | 4945 | systems/texlive/tlnet/install-tl-windows.bat -2022/10/07 | 20435659 | systems/texlive/tlnet/install-tl-windows.exe -2022/10/07 | 153 | systems/texlive/tlnet/install-tl-windows.exe.sha512 -2022/10/07 | 455 | systems/texlive/tlnet/install-tl-windows.exe.sha512.asc -2022/10/07 | 25516739 | systems/texlive/tlnet/install-tl.zip -2022/10/07 | 145 | systems/texlive/tlnet/install-tl.zip.sha512 -2022/10/07 | 455 | systems/texlive/tlnet/install-tl.zip.sha512.asc +2022/10/09 | 20433558 | systems/texlive/tlnet/install-tl-windows.exe +2022/10/09 | 153 | systems/texlive/tlnet/install-tl-windows.exe.sha512 +2022/10/09 | 455 | systems/texlive/tlnet/install-tl-windows.exe.sha512.asc +2022/10/09 | 25516720 | systems/texlive/tlnet/install-tl.zip +2022/10/09 | 145 | systems/texlive/tlnet/install-tl.zip.sha512 +2022/10/09 | 455 | systems/texlive/tlnet/install-tl.zip.sha512.asc 2022/04/03 | 1229 | systems/texlive/tlnet/README.md 2022/04/03 | 0 | systems/texlive/tlnet/TEXLIVE_2022 2022/02/28 | 7791 | systems/texlive/tlnet/tlpkg/gpg/pubring.gpg @@ -294752,7 +294755,7 @@ 2022/02/28 | 1280 | systems/texlive/tlnet/tlpkg/gpg/trustdb.gpg 2022/09/12 | 49769 | systems/texlive/tlnet/tlpkg/installer/config.guess 2010/11/11 | 11651 | systems/texlive/tlnet/tlpkg/installer/COPYING.MinGW-runtime.txt -2022/10/06 | 7271 | systems/texlive/tlnet/tlpkg/installer/ctan-mirrors.pl +2022/10/07 | 7195 | systems/texlive/tlnet/tlpkg/installer/ctan-mirrors.pl 2022/07/21 | 222477 | systems/texlive/tlnet/tlpkg/installer/curl/curl-ca-bundle.crt 2020/04/15 | 2606592 | systems/texlive/tlnet/tlpkg/installer/curl/curl.exe 2017/04/16 | 2629 | systems/texlive/tlnet/tlpkg/installer/installer-options.txt @@ -294795,12 +294798,12 @@ 2021/05/16 | 20371 | systems/texlive/tlnet/tlpkg/TeXLive/TLCrypto.pm 2021/12/21 | 5429 | systems/texlive/tlnet/tlpkg/TeXLive/TLDownload.pm 2021/12/21 | 27582 | systems/texlive/tlnet/tlpkg/TeXLive/TLPaper.pm -2022/10/07 | 17673749 | systems/texlive/tlnet/tlpkg/texlive.tlpdb -2022/10/07 | 48 | systems/texlive/tlnet/tlpkg/texlive.tlpdb.md5 +2022/10/09 | 17675849 | systems/texlive/tlnet/tlpkg/texlive.tlpdb +2022/10/09 | 48 | systems/texlive/tlnet/tlpkg/texlive.tlpdb.md5 2022/04/18 | 86658 | systems/texlive/tlnet/tlpkg/TeXLive/TLPDB.pm -2022/10/07 | 144 | systems/texlive/tlnet/tlpkg/texlive.tlpdb.sha512 -2022/10/07 | 455 | systems/texlive/tlnet/tlpkg/texlive.tlpdb.sha512.asc -2022/10/07 | 2414720 | systems/texlive/tlnet/tlpkg/texlive.tlpdb.xz +2022/10/09 | 144 | systems/texlive/tlnet/tlpkg/texlive.tlpdb.sha512 +2022/10/09 | 455 | systems/texlive/tlnet/tlpkg/texlive.tlpdb.sha512.asc +2022/10/09 | 2415668 | systems/texlive/tlnet/tlpkg/texlive.tlpdb.xz 2022/09/14 | 58922 | systems/texlive/tlnet/tlpkg/TeXLive/TLPOBJ.pm 2022/10/04 | 42404 | systems/texlive/tlnet/tlpkg/TeXLive/TLPSRC.pm 2021/12/21 | 16130 | systems/texlive/tlnet/tlpkg/TeXLive/TLTREE.pm @@ -300180,7 +300183,7 @@ 2020/10/03 | 318630 | systems/win32/miktex/tm/packages/filehook.tar.lzma 2012/12/04 | 924573 | systems/win32/miktex/tm/packages/fileinfo.tar.lzma 2011/09/21 | 281409 | systems/win32/miktex/tm/packages/filemod.tar.lzma -2022/10/08 | 668612 | systems/win32/miktex/tm/packages/files.csv.lzma +2022/10/09 | 668612 | systems/win32/miktex/tm/packages/files.csv.lzma 2001/05/14 | 5617 | systems/win32/miktex/tm/packages/finbib.tar.lzma 2015/10/20 | 44379 | systems/win32/miktex/tm/packages/findhyph.tar.lzma 2011/10/21 | 89323 | systems/win32/miktex/tm/packages/fink.tar.lzma @@ -301903,9 +301906,9 @@ 2018/01/12 | 157226 | systems/win32/miktex/tm/packages/miktex-zip-bin-x64.tar.lzma 2022/07/26 | 39695 | systems/win32/miktex/tm/packages/miktex-zlib-bin-2.9.tar.lzma 2022/08/27 | 43640 | systems/win32/miktex/tm/packages/miktex-zlib-bin-x64-2.9.tar.lzma -2022/10/08 | 297835 | systems/win32/miktex/tm/packages/miktex-zzdb1-2.9.tar.lzma -2022/10/08 | 1503017 | systems/win32/miktex/tm/packages/miktex-zzdb2-2.9.tar.lzma -2022/10/08 | 1381595 | systems/win32/miktex/tm/packages/miktex-zzdb3-2.9.tar.lzma +2022/10/09 | 297861 | systems/win32/miktex/tm/packages/miktex-zzdb1-2.9.tar.lzma +2022/10/09 | 1503141 | systems/win32/miktex/tm/packages/miktex-zzdb2-2.9.tar.lzma +2022/10/09 | 1381855 | systems/win32/miktex/tm/packages/miktex-zzdb3-2.9.tar.lzma 2022/07/26 | 13519 | systems/win32/miktex/tm/packages/miktex-zzip-bin-2.9.tar.lzma 2022/08/27 | 14450 | systems/win32/miktex/tm/packages/miktex-zzip-bin-x64-2.9.tar.lzma 2016/07/15 | 35914 | systems/win32/miktex/tm/packages/mil3.tar.lzma @@ -302154,102 +302157,102 @@ 2018/04/09 | 400132 | systems/win32/miktex/tm/packages/newunicodechar.tar.lzma 2011/09/19 | 101312 | systems/win32/miktex/tm/packages/newvbtm.tar.lzma 2021/03/17 | 232249 | systems/win32/miktex/tm/packages/newverbs.tar.lzma -2022/10/08 | 667663 | systems/win32/miktex/tm/packages/next/files.csv.lzma -2022/10/08 | 57317 | systems/win32/miktex/tm/packages/next/miktex-arctrl-bin-x64-2.9.tar.lzma -2022/10/08 | 1161749 | systems/win32/miktex/tm/packages/next/miktex-asymptote-bin-x64-2.9.tar.lzma -2022/10/08 | 31584 | systems/win32/miktex/tm/packages/next/miktex-autosp-bin-x64-2.9.tar.lzma -2022/10/08 | 35265 | systems/win32/miktex/tm/packages/next/miktex-axohelp-bin-x64-2.9.tar.lzma -2022/10/08 | 65129 | systems/win32/miktex/tm/packages/next/miktex-bibarts-bin-x64-2.9.tar.lzma -2022/10/08 | 95468 | systems/win32/miktex/tm/packages/next/miktex-bibtex8bit-bin-x64-2.9.tar.lzma -2022/10/08 | 77211 | systems/win32/miktex/tm/packages/next/miktex-bibtex-bin-x64-2.9.tar.lzma -2022/10/08 | 31562 | systems/win32/miktex/tm/packages/next/miktex-bzip2-bin-x64-2.9.tar.lzma -2022/10/08 | 394143 | systems/win32/miktex/tm/packages/next/miktex-cairo-bin-x64-2.9.tar.lzma -2022/10/08 | 37049 | systems/win32/miktex/tm/packages/next/miktex-chktex-bin-x64-2.9.tar.lzma -2022/10/08 | 57504 | systems/win32/miktex/tm/packages/next/miktex-cjkutils-bin-x64-2.9.tar.lzma -2022/10/08 | 270466 | systems/win32/miktex/tm/packages/next/miktex-console-bin-x64-2.9.tar.lzma -2022/10/08 | 196211 | systems/win32/miktex/tm/packages/next/miktex-curl-bin-x64-2.9.tar.lzma -2022/10/08 | 103247 | systems/win32/miktex/tm/packages/next/miktex-cweb-bin-x64-2.9.tar.lzma -2022/10/08 | 24210 | systems/win32/miktex/tm/packages/next/miktex-devnag-bin-x64-2.9.tar.lzma -2022/10/08 | 481895 | systems/win32/miktex/tm/packages/next/miktex-doc.tar.lzma -2022/10/08 | 52037 | systems/win32/miktex/tm/packages/next/miktex-dvicopy-bin-x64-2.9.tar.lzma -2022/10/08 | 325981 | systems/win32/miktex/tm/packages/next/miktex-dvipdfmx-bin-x64-2.9.tar.lzma -2022/10/08 | 45794 | systems/win32/miktex/tm/packages/next/miktex-dvipng-bin-x64-2.9.tar.lzma -2022/10/08 | 135465 | systems/win32/miktex/tm/packages/next/miktex-dvips-bin-x64-2.9.tar.lzma -2022/10/08 | 1458151 | systems/win32/miktex/tm/packages/next/miktex-dvisvgm-bin-x64-2.9.tar.lzma -2022/10/08 | 112980 | systems/win32/miktex/tm/packages/next/miktex-epstopdf-bin-x64-2.9.tar.lzma -2022/10/08 | 48852 | systems/win32/miktex/tm/packages/next/miktex-expat-bin-x64-2.9.tar.lzma -2022/10/08 | 28510 | systems/win32/miktex/tm/packages/next/miktex-findtexmf-bin-x64-2.9.tar.lzma -2022/10/08 | 63241 | systems/win32/miktex/tm/packages/next/miktex-fmt-bin-x64-2.9.tar.lzma -2022/10/08 | 155430 | systems/win32/miktex/tm/packages/next/miktex-fontconfig-bin-x64-2.9.tar.lzma -2022/10/08 | 79064 | systems/win32/miktex/tm/packages/next/miktex-fonts-bin-x64-2.9.tar.lzma -2022/10/08 | 81448 | systems/win32/miktex/tm/packages/next/miktex-freeglut-bin-x64-2.9.tar.lzma -2022/10/08 | 295945 | systems/win32/miktex/tm/packages/next/miktex-freetype2-bin-x64-2.9.tar.lzma -2022/10/08 | 25118 | systems/win32/miktex/tm/packages/next/miktex-fribidixetex-bin-x64-2.9.tar.lzma -2022/10/08 | 112878 | systems/win32/miktex/tm/packages/next/miktex-gd-bin-x64-2.9.tar.lzma -2022/10/08 | 73264 | systems/win32/miktex/tm/packages/next/miktex-graphite2-bin-x64-2.9.tar.lzma -2022/10/08 | 115578 | systems/win32/miktex/tm/packages/next/miktex-gregorio-bin-x64-2.9.tar.lzma -2022/10/08 | 43889 | systems/win32/miktex/tm/packages/next/miktex-gsf2pk-bin-x64-2.9.tar.lzma -2022/10/08 | 565079 | systems/win32/miktex/tm/packages/next/miktex-harfbuzz-bin-x64-2.9.tar.lzma -2022/10/08 | 247207 | systems/win32/miktex/tm/packages/next/miktex-hitex-bin-x64.tar.lzma -2022/10/08 | 169678 | systems/win32/miktex/tm/packages/next/miktex-hunspell-bin-x64-2.9.tar.lzma -2022/10/08 | 109650 | systems/win32/miktex/tm/packages/next/miktex-jpeg-bin-x64-2.9.tar.lzma -2022/10/08 | 18382 | systems/win32/miktex/tm/packages/next/miktex-kpathsea-bin-x64-2.9.tar.lzma -2022/10/08 | 30571 | systems/win32/miktex/tm/packages/next/miktex-lacheck-bin-x64-2.9.tar.lzma -2022/10/08 | 682215 | systems/win32/miktex/tm/packages/next/miktex-lcdf-typetools-bin-x64-2.9.tar.lzma -2022/10/08 | 599105 | systems/win32/miktex/tm/packages/next/miktex-libressl-bin-x64-2.9.tar.lzma -2022/10/08 | 527570 | systems/win32/miktex/tm/packages/next/miktex-log4cxx-bin-x64-2.9.tar.lzma -2022/10/08 | 103598 | systems/win32/miktex/tm/packages/next/miktex-lua53-bin-x64-2.9.tar.lzma -2022/10/08 | 2023133 | systems/win32/miktex/tm/packages/next/miktex-luatex-bin-x64-2.9.tar.lzma -2022/10/08 | 74099 | systems/win32/miktex/tm/packages/next/miktex-lzma-bin-x64-2.9.tar.lzma -2022/10/08 | 32074 | systems/win32/miktex/tm/packages/next/miktex-makeindex-bin-x64-2.9.tar.lzma -2022/10/08 | 8825 | systems/win32/miktex/tm/packages/next/miktex-md5-bin-x64-2.9.tar.lzma -2022/10/08 | 209139 | systems/win32/miktex/tm/packages/next/miktex-metafont-bin-x64-2.9.tar.lzma -2022/10/08 | 286685 | systems/win32/miktex/tm/packages/next/miktex-metapost-bin-x64-2.9.tar.lzma -2022/10/08 | 104921 | systems/win32/miktex/tm/packages/next/miktex-mfware-bin-x64-2.9.tar.lzma -2022/10/08 | 140012 | systems/win32/miktex/tm/packages/next/miktex-mktex-bin-x64-2.9.tar.lzma -2022/10/08 | 325483 | systems/win32/miktex/tm/packages/next/miktex-mo-bin-x64-2.9.tar.lzma -2022/10/08 | 181724 | systems/win32/miktex/tm/packages/next/miktex-mpfr-bin-x64-2.9.tar.lzma -2022/10/08 | 55319 | systems/win32/miktex/tm/packages/next/miktex-mpmcli-bin-x64-2.9.tar.lzma -2022/10/08 | 35231 | systems/win32/miktex/tm/packages/next/miktex-mspack-bin-x64-2.9.tar.lzma -2022/10/08 | 43618 | systems/win32/miktex/tm/packages/next/miktex-mthelp-bin-x64-2.9.tar.lzma -2022/10/08 | 48037 | systems/win32/miktex/tm/packages/next/miktex-mtprint-bin-x64-2.9.tar.lzma -2022/10/08 | 52370 | systems/win32/miktex/tm/packages/next/miktex-m-tx-bin-x64-2.9.tar.lzma -2022/10/08 | 213849 | systems/win32/miktex/tm/packages/next/miktex-omegaware-bin-x64-2.9.tar.lzma -2022/10/08 | 41178 | systems/win32/miktex/tm/packages/next/miktex-patgen-bin-x64.tar.lzma -2022/10/08 | 824997 | systems/win32/miktex/tm/packages/next/miktex-pdftex-bin-x64-2.9.tar.lzma -2022/10/08 | 203421 | systems/win32/miktex/tm/packages/next/miktex-pixman-bin-x64-2.9.tar.lzma -2022/10/08 | 245152 | systems/win32/miktex/tm/packages/next/miktex-pmx-bin-x64-2.9.tar.lzma -2022/10/08 | 88483 | systems/win32/miktex/tm/packages/next/miktex-png-bin-x64-2.9.tar.lzma -2022/10/08 | 1323744 | systems/win32/miktex/tm/packages/next/miktex-poppler-bin-x64-2.9.tar.lzma -2022/10/08 | 23950 | systems/win32/miktex/tm/packages/next/miktex-popt-bin-x64-2.9.tar.lzma -2022/10/08 | 37506 | systems/win32/miktex/tm/packages/next/miktex-posix-bin-x64-2.9.tar.lzma -2022/10/08 | 72977 | systems/win32/miktex/tm/packages/next/miktex-ps2pk-bin-x64-2.9.tar.lzma -2022/10/08 | 58633 | systems/win32/miktex/tm/packages/next/miktex-psutils-bin-x64-2.9.tar.lzma -2022/10/08 | 769652 | systems/win32/miktex/tm/packages/next/miktex-ptex-bin-x64.tar.lzma -2022/10/08 | 1503053 | systems/win32/miktex/tm/packages/next/miktex-runtime-bin-x64-2.9.tar.lzma -2022/10/08 | 52627 | systems/win32/miktex/tm/packages/next/miktex-synctex-bin-x64-2.9.tar.lzma -2022/10/08 | 63802 | systems/win32/miktex/tm/packages/next/miktex-tdsutil-bin-x64.tar.lzma -2022/10/08 | 27464 | systems/win32/miktex/tm/packages/next/miktex-teckit-bin-x64-2.9.tar.lzma -2022/10/08 | 18511 | systems/win32/miktex/tm/packages/next/miktex-tex2xindy-bin-x64-2.9.tar.lzma -2022/10/08 | 70939 | systems/win32/miktex/tm/packages/next/miktex-tex4ht-bin-x64-2.9.tar.lzma -2022/10/08 | 173177 | systems/win32/miktex/tm/packages/next/miktex-tex-bin-x64-2.9.tar.lzma -2022/10/08 | 68147 | systems/win32/miktex/tm/packages/next/miktex-texify-bin-x64-2.9.tar.lzma -2022/10/08 | 107437 | systems/win32/miktex/tm/packages/next/miktex-texware-bin-x64-2.9.tar.lzma -2022/10/08 | 2821671 | systems/win32/miktex/tm/packages/next/miktex-texworks-bin-x64-2.9.tar.lzma -2022/10/08 | 62357 | systems/win32/miktex/tm/packages/next/miktex-ttf2pk2-bin-x64-2.9.tar.lzma -2022/10/08 | 41190 | systems/win32/miktex/tm/packages/next/miktex-upmendex-bin-x64.tar.lzma -2022/10/08 | 33862 | systems/win32/miktex/tm/packages/next/miktex-uriparser-bin-x64-2.9.tar.lzma -2022/10/08 | 73685 | systems/win32/miktex/tm/packages/next/miktex-web-bin-x64-2.9.tar.lzma -2022/10/08 | 352464 | systems/win32/miktex/tm/packages/next/miktex-xetex-bin-x64-2.9.tar.lzma -2022/10/08 | 57502 | systems/win32/miktex/tm/packages/next/miktex-xml2pmx-bin-x64.tar.lzma -2022/10/08 | 630436 | systems/win32/miktex/tm/packages/next/miktex-yap-bin-x64-2.9.tar.lzma -2022/10/08 | 43527 | systems/win32/miktex/tm/packages/next/miktex-zlib-bin-x64-2.9.tar.lzma -2022/10/08 | 297870 | systems/win32/miktex/tm/packages/next/miktex-zzdb1-2.9.tar.lzma -2022/10/08 | 1501460 | systems/win32/miktex/tm/packages/next/miktex-zzdb2-2.9.tar.lzma -2022/10/08 | 1381533 | systems/win32/miktex/tm/packages/next/miktex-zzdb3-2.9.tar.lzma -2022/10/08 | 14434 | systems/win32/miktex/tm/packages/next/miktex-zzip-bin-x64-2.9.tar.lzma +2022/10/09 | 667663 | systems/win32/miktex/tm/packages/next/files.csv.lzma +2022/10/09 | 57317 | systems/win32/miktex/tm/packages/next/miktex-arctrl-bin-x64-2.9.tar.lzma +2022/10/09 | 1161748 | systems/win32/miktex/tm/packages/next/miktex-asymptote-bin-x64-2.9.tar.lzma +2022/10/09 | 31586 | systems/win32/miktex/tm/packages/next/miktex-autosp-bin-x64-2.9.tar.lzma +2022/10/09 | 35264 | systems/win32/miktex/tm/packages/next/miktex-axohelp-bin-x64-2.9.tar.lzma +2022/10/09 | 65129 | systems/win32/miktex/tm/packages/next/miktex-bibarts-bin-x64-2.9.tar.lzma +2022/10/09 | 95469 | systems/win32/miktex/tm/packages/next/miktex-bibtex8bit-bin-x64-2.9.tar.lzma +2022/10/09 | 77211 | systems/win32/miktex/tm/packages/next/miktex-bibtex-bin-x64-2.9.tar.lzma +2022/10/09 | 31563 | systems/win32/miktex/tm/packages/next/miktex-bzip2-bin-x64-2.9.tar.lzma +2022/10/09 | 394142 | systems/win32/miktex/tm/packages/next/miktex-cairo-bin-x64-2.9.tar.lzma +2022/10/09 | 37050 | systems/win32/miktex/tm/packages/next/miktex-chktex-bin-x64-2.9.tar.lzma +2022/10/09 | 57505 | systems/win32/miktex/tm/packages/next/miktex-cjkutils-bin-x64-2.9.tar.lzma +2022/10/09 | 270466 | systems/win32/miktex/tm/packages/next/miktex-console-bin-x64-2.9.tar.lzma +2022/10/09 | 196213 | systems/win32/miktex/tm/packages/next/miktex-curl-bin-x64-2.9.tar.lzma +2022/10/09 | 103245 | systems/win32/miktex/tm/packages/next/miktex-cweb-bin-x64-2.9.tar.lzma +2022/10/09 | 24212 | systems/win32/miktex/tm/packages/next/miktex-devnag-bin-x64-2.9.tar.lzma +2022/10/09 | 481895 | systems/win32/miktex/tm/packages/next/miktex-doc.tar.lzma +2022/10/09 | 52037 | systems/win32/miktex/tm/packages/next/miktex-dvicopy-bin-x64-2.9.tar.lzma +2022/10/09 | 325980 | systems/win32/miktex/tm/packages/next/miktex-dvipdfmx-bin-x64-2.9.tar.lzma +2022/10/09 | 45796 | systems/win32/miktex/tm/packages/next/miktex-dvipng-bin-x64-2.9.tar.lzma +2022/10/09 | 135464 | systems/win32/miktex/tm/packages/next/miktex-dvips-bin-x64-2.9.tar.lzma +2022/10/09 | 1458152 | systems/win32/miktex/tm/packages/next/miktex-dvisvgm-bin-x64-2.9.tar.lzma +2022/10/09 | 112980 | systems/win32/miktex/tm/packages/next/miktex-epstopdf-bin-x64-2.9.tar.lzma +2022/10/09 | 48851 | systems/win32/miktex/tm/packages/next/miktex-expat-bin-x64-2.9.tar.lzma +2022/10/09 | 28509 | systems/win32/miktex/tm/packages/next/miktex-findtexmf-bin-x64-2.9.tar.lzma +2022/10/09 | 63241 | systems/win32/miktex/tm/packages/next/miktex-fmt-bin-x64-2.9.tar.lzma +2022/10/09 | 155432 | systems/win32/miktex/tm/packages/next/miktex-fontconfig-bin-x64-2.9.tar.lzma +2022/10/09 | 79064 | systems/win32/miktex/tm/packages/next/miktex-fonts-bin-x64-2.9.tar.lzma +2022/10/09 | 81448 | systems/win32/miktex/tm/packages/next/miktex-freeglut-bin-x64-2.9.tar.lzma +2022/10/09 | 295945 | systems/win32/miktex/tm/packages/next/miktex-freetype2-bin-x64-2.9.tar.lzma +2022/10/09 | 25120 | systems/win32/miktex/tm/packages/next/miktex-fribidixetex-bin-x64-2.9.tar.lzma +2022/10/09 | 112879 | systems/win32/miktex/tm/packages/next/miktex-gd-bin-x64-2.9.tar.lzma +2022/10/09 | 73262 | systems/win32/miktex/tm/packages/next/miktex-graphite2-bin-x64-2.9.tar.lzma +2022/10/09 | 115579 | systems/win32/miktex/tm/packages/next/miktex-gregorio-bin-x64-2.9.tar.lzma +2022/10/09 | 43889 | systems/win32/miktex/tm/packages/next/miktex-gsf2pk-bin-x64-2.9.tar.lzma +2022/10/09 | 565081 | systems/win32/miktex/tm/packages/next/miktex-harfbuzz-bin-x64-2.9.tar.lzma +2022/10/09 | 247207 | systems/win32/miktex/tm/packages/next/miktex-hitex-bin-x64.tar.lzma +2022/10/09 | 169677 | systems/win32/miktex/tm/packages/next/miktex-hunspell-bin-x64-2.9.tar.lzma +2022/10/09 | 109650 | systems/win32/miktex/tm/packages/next/miktex-jpeg-bin-x64-2.9.tar.lzma +2022/10/09 | 18382 | systems/win32/miktex/tm/packages/next/miktex-kpathsea-bin-x64-2.9.tar.lzma +2022/10/09 | 30570 | systems/win32/miktex/tm/packages/next/miktex-lacheck-bin-x64-2.9.tar.lzma +2022/10/09 | 682214 | systems/win32/miktex/tm/packages/next/miktex-lcdf-typetools-bin-x64-2.9.tar.lzma +2022/10/09 | 599105 | systems/win32/miktex/tm/packages/next/miktex-libressl-bin-x64-2.9.tar.lzma +2022/10/09 | 527568 | systems/win32/miktex/tm/packages/next/miktex-log4cxx-bin-x64-2.9.tar.lzma +2022/10/09 | 103599 | systems/win32/miktex/tm/packages/next/miktex-lua53-bin-x64-2.9.tar.lzma +2022/10/09 | 2023133 | systems/win32/miktex/tm/packages/next/miktex-luatex-bin-x64-2.9.tar.lzma +2022/10/09 | 74098 | systems/win32/miktex/tm/packages/next/miktex-lzma-bin-x64-2.9.tar.lzma +2022/10/09 | 32074 | systems/win32/miktex/tm/packages/next/miktex-makeindex-bin-x64-2.9.tar.lzma +2022/10/09 | 8826 | systems/win32/miktex/tm/packages/next/miktex-md5-bin-x64-2.9.tar.lzma +2022/10/09 | 209138 | systems/win32/miktex/tm/packages/next/miktex-metafont-bin-x64-2.9.tar.lzma +2022/10/09 | 286684 | systems/win32/miktex/tm/packages/next/miktex-metapost-bin-x64-2.9.tar.lzma +2022/10/09 | 104922 | systems/win32/miktex/tm/packages/next/miktex-mfware-bin-x64-2.9.tar.lzma +2022/10/09 | 140014 | systems/win32/miktex/tm/packages/next/miktex-mktex-bin-x64-2.9.tar.lzma +2022/10/09 | 325482 | systems/win32/miktex/tm/packages/next/miktex-mo-bin-x64-2.9.tar.lzma +2022/10/09 | 181724 | systems/win32/miktex/tm/packages/next/miktex-mpfr-bin-x64-2.9.tar.lzma +2022/10/09 | 55319 | systems/win32/miktex/tm/packages/next/miktex-mpmcli-bin-x64-2.9.tar.lzma +2022/10/09 | 35231 | systems/win32/miktex/tm/packages/next/miktex-mspack-bin-x64-2.9.tar.lzma +2022/10/09 | 43617 | systems/win32/miktex/tm/packages/next/miktex-mthelp-bin-x64-2.9.tar.lzma +2022/10/09 | 48038 | systems/win32/miktex/tm/packages/next/miktex-mtprint-bin-x64-2.9.tar.lzma +2022/10/09 | 52369 | systems/win32/miktex/tm/packages/next/miktex-m-tx-bin-x64-2.9.tar.lzma +2022/10/09 | 213850 | systems/win32/miktex/tm/packages/next/miktex-omegaware-bin-x64-2.9.tar.lzma +2022/10/09 | 41180 | systems/win32/miktex/tm/packages/next/miktex-patgen-bin-x64.tar.lzma +2022/10/09 | 824995 | systems/win32/miktex/tm/packages/next/miktex-pdftex-bin-x64-2.9.tar.lzma +2022/10/09 | 203421 | systems/win32/miktex/tm/packages/next/miktex-pixman-bin-x64-2.9.tar.lzma +2022/10/09 | 245152 | systems/win32/miktex/tm/packages/next/miktex-pmx-bin-x64-2.9.tar.lzma +2022/10/09 | 88483 | systems/win32/miktex/tm/packages/next/miktex-png-bin-x64-2.9.tar.lzma +2022/10/09 | 1323743 | systems/win32/miktex/tm/packages/next/miktex-poppler-bin-x64-2.9.tar.lzma +2022/10/09 | 23951 | systems/win32/miktex/tm/packages/next/miktex-popt-bin-x64-2.9.tar.lzma +2022/10/09 | 37506 | systems/win32/miktex/tm/packages/next/miktex-posix-bin-x64-2.9.tar.lzma +2022/10/09 | 72978 | systems/win32/miktex/tm/packages/next/miktex-ps2pk-bin-x64-2.9.tar.lzma +2022/10/09 | 58631 | systems/win32/miktex/tm/packages/next/miktex-psutils-bin-x64-2.9.tar.lzma +2022/10/09 | 769654 | systems/win32/miktex/tm/packages/next/miktex-ptex-bin-x64.tar.lzma +2022/10/09 | 1503055 | systems/win32/miktex/tm/packages/next/miktex-runtime-bin-x64-2.9.tar.lzma +2022/10/09 | 52627 | systems/win32/miktex/tm/packages/next/miktex-synctex-bin-x64-2.9.tar.lzma +2022/10/09 | 63802 | systems/win32/miktex/tm/packages/next/miktex-tdsutil-bin-x64.tar.lzma +2022/10/09 | 27465 | systems/win32/miktex/tm/packages/next/miktex-teckit-bin-x64-2.9.tar.lzma +2022/10/09 | 18511 | systems/win32/miktex/tm/packages/next/miktex-tex2xindy-bin-x64-2.9.tar.lzma +2022/10/09 | 70939 | systems/win32/miktex/tm/packages/next/miktex-tex4ht-bin-x64-2.9.tar.lzma +2022/10/09 | 173177 | systems/win32/miktex/tm/packages/next/miktex-tex-bin-x64-2.9.tar.lzma +2022/10/09 | 68146 | systems/win32/miktex/tm/packages/next/miktex-texify-bin-x64-2.9.tar.lzma +2022/10/09 | 107436 | systems/win32/miktex/tm/packages/next/miktex-texware-bin-x64-2.9.tar.lzma +2022/10/09 | 2821671 | systems/win32/miktex/tm/packages/next/miktex-texworks-bin-x64-2.9.tar.lzma +2022/10/09 | 62359 | systems/win32/miktex/tm/packages/next/miktex-ttf2pk2-bin-x64-2.9.tar.lzma +2022/10/09 | 41191 | systems/win32/miktex/tm/packages/next/miktex-upmendex-bin-x64.tar.lzma +2022/10/09 | 33862 | systems/win32/miktex/tm/packages/next/miktex-uriparser-bin-x64-2.9.tar.lzma +2022/10/09 | 73685 | systems/win32/miktex/tm/packages/next/miktex-web-bin-x64-2.9.tar.lzma +2022/10/09 | 352464 | systems/win32/miktex/tm/packages/next/miktex-xetex-bin-x64-2.9.tar.lzma +2022/10/09 | 57502 | systems/win32/miktex/tm/packages/next/miktex-xml2pmx-bin-x64.tar.lzma +2022/10/09 | 630433 | systems/win32/miktex/tm/packages/next/miktex-yap-bin-x64-2.9.tar.lzma +2022/10/09 | 43528 | systems/win32/miktex/tm/packages/next/miktex-zlib-bin-x64-2.9.tar.lzma +2022/10/09 | 297813 | systems/win32/miktex/tm/packages/next/miktex-zzdb1-2.9.tar.lzma +2022/10/09 | 1500884 | systems/win32/miktex/tm/packages/next/miktex-zzdb2-2.9.tar.lzma +2022/10/09 | 1381864 | systems/win32/miktex/tm/packages/next/miktex-zzdb3-2.9.tar.lzma +2022/10/09 | 14434 | systems/win32/miktex/tm/packages/next/miktex-zzip-bin-x64-2.9.tar.lzma 2019/03/12 | 1412 | systems/win32/miktex/tm/packages/nextpage.tar.lzma -2022/10/08 | 1172 | systems/win32/miktex/tm/packages/next/pr.ini +2022/10/09 | 1172 | systems/win32/miktex/tm/packages/next/pr.ini 2018/07/06 | 145915 | systems/win32/miktex/tm/packages/nexus-otf.tar.lzma 2017/03/30 | 191149 | systems/win32/miktex/tm/packages/nfssext-cfr.tar.lzma 2012/12/20 | 612251 | systems/win32/miktex/tm/packages/nicefilelist.tar.lzma @@ -302759,7 +302762,7 @@ 2022/02/22 | 6917 | systems/win32/miktex/tm/packages/preview.tar.lzma 2019/06/20 | 375963 | systems/win32/miktex/tm/packages/prftree.tar.lzma 2021/04/23 | 274028 | systems/win32/miktex/tm/packages/principia.tar.lzma -2022/10/08 | 927 | systems/win32/miktex/tm/packages/pr.ini +2022/10/09 | 927 | systems/win32/miktex/tm/packages/pr.ini 2010/09/27 | 248469 | systems/win32/miktex/tm/packages/printlen.tar.lzma 2008/06/17 | 77313 | systems/win32/miktex/tm/packages/proba.tar.lzma 2017/07/12 | 988486 | systems/win32/miktex/tm/packages/probsoln.tar.lzma @@ -304735,7 +304738,7 @@ 2014/07/05 | 611 | systems/win32/yandy/README 2014/07/05 | 1004628 | systems/win32/yandy/yandy-src.tar.xz 2014/07/05 | 1012416 | systems/win32/yandy.zip -2022/10/09 | 186 | timestamp +2022/10/10 | 186 | timestamp 2002/08/26 | 61898 | usergrps/dante/antrag.pdf 2002/08/26 | 118217 | usergrps/dante/antrag.ps 2022/02/28 | 917 | usergrps/dante/dtk/doc/beispiel.bib diff --git a/FILES.byname.gz b/FILES.byname.gz Binary files differindex 891030a3ff..0d3365bc56 100644 --- a/FILES.byname.gz +++ b/FILES.byname.gz diff --git a/FILES.last07days b/FILES.last07days index e0da41735d..9725095305 100644 --- a/FILES.last07days +++ b/FILES.last07days @@ -1,138 +1,214 @@ -2022/10/08 | 95468 | systems/win32/miktex/tm/packages/next/miktex-bibtex8bit-bin-x64-2.9.tar.lzma +2022/10/09 | 95469 | systems/win32/miktex/tm/packages/next/miktex-bibtex8bit-bin-x64-2.9.tar.lzma +2022/10/09 | 941476 | systems/texlive/tlnet/archive/proflycee.doc.r64649.tar.xz +2022/10/09 | 9388 | systems/texlive/tlnet/archive/ducksay.r64655.tar.xz +2022/10/09 | 93393 | graphics/chemobabel/example-ja.pdf +2022/10/09 | 927 | systems/win32/miktex/tm/packages/pr.ini +2022/10/09 | 88483 | systems/win32/miktex/tm/packages/next/miktex-png-bin-x64-2.9.tar.lzma +2022/10/09 | 8826 | systems/win32/miktex/tm/packages/next/miktex-md5-bin-x64-2.9.tar.lzma +2022/10/09 | 824995 | systems/win32/miktex/tm/packages/next/miktex-pdftex-bin-x64-2.9.tar.lzma +2022/10/09 | 81448 | systems/win32/miktex/tm/packages/next/miktex-freeglut-bin-x64-2.9.tar.lzma +2022/10/09 | 81095 | graphics/chemobabel/images-for-doc.tar.gz +2022/10/09 | 79064 | systems/win32/miktex/tm/packages/next/miktex-fonts-bin-x64-2.9.tar.lzma +2022/10/09 | 78784 | macros/latex/contrib/thalie/thalie.dtx +2022/10/09 | 77211 | systems/win32/miktex/tm/packages/next/miktex-bibtex-bin-x64-2.9.tar.lzma +2022/10/09 | 769654 | systems/win32/miktex/tm/packages/next/miktex-ptex-bin-x64.tar.lzma +2022/10/09 | 74098 | systems/win32/miktex/tm/packages/next/miktex-lzma-bin-x64-2.9.tar.lzma +2022/10/09 | 73685 | systems/win32/miktex/tm/packages/next/miktex-web-bin-x64-2.9.tar.lzma +2022/10/09 | 73262 | systems/win32/miktex/tm/packages/next/miktex-graphite2-bin-x64-2.9.tar.lzma +2022/10/09 | 72978 | systems/win32/miktex/tm/packages/next/miktex-ps2pk-bin-x64-2.9.tar.lzma +2022/10/09 | 7136 | systems/texlive/tlnet/archive/piton.r64656.tar.xz +2022/10/09 | 70939 | systems/win32/miktex/tm/packages/next/miktex-tex4ht-bin-x64-2.9.tar.lzma +2022/10/09 | 6984 | systems/texlive/tlnet/archive/algpseudocodex.r64654.tar.xz +2022/10/09 | 682214 | systems/win32/miktex/tm/packages/next/miktex-lcdf-typetools-bin-x64-2.9.tar.lzma +2022/10/09 | 68146 | systems/win32/miktex/tm/packages/next/miktex-texify-bin-x64-2.9.tar.lzma +2022/10/09 | 672338 | graphics/chemobabel/chemobabel-ja.pdf +2022/10/09 | 668612 | systems/win32/miktex/tm/packages/files.csv.lzma +2022/10/09 | 667663 | systems/win32/miktex/tm/packages/next/files.csv.lzma +2022/10/09 | 65129 | systems/win32/miktex/tm/packages/next/miktex-bibarts-bin-x64-2.9.tar.lzma +2022/10/09 | 63802 | systems/win32/miktex/tm/packages/next/miktex-tdsutil-bin-x64.tar.lzma +2022/10/09 | 63241 | systems/win32/miktex/tm/packages/next/miktex-fmt-bin-x64-2.9.tar.lzma +2022/10/09 | 630433 | systems/win32/miktex/tm/packages/next/miktex-yap-bin-x64-2.9.tar.lzma +2022/10/09 | 62359 | systems/win32/miktex/tm/packages/next/miktex-ttf2pk2-bin-x64-2.9.tar.lzma +2022/10/09 | 605 | fonts/sansmathfonts/README.txt +2022/10/09 | 6003316 | fonts/sansmathfonts.zip +2022/10/09 | 599105 | systems/win32/miktex/tm/packages/next/miktex-libressl-bin-x64-2.9.tar.lzma +2022/10/09 | 58631 | systems/win32/miktex/tm/packages/next/miktex-psutils-bin-x64-2.9.tar.lzma +2022/10/09 | 5832291 | systems/texlive/tlnet/install-tl-unx.tar.gz +2022/10/09 | 57505 | systems/win32/miktex/tm/packages/next/miktex-cjkutils-bin-x64-2.9.tar.lzma +2022/10/09 | 57502 | systems/win32/miktex/tm/packages/next/miktex-xml2pmx-bin-x64.tar.lzma +2022/10/09 | 57317 | systems/win32/miktex/tm/packages/next/miktex-arctrl-bin-x64-2.9.tar.lzma +2022/10/09 | 568562 | graphics/chemobabel/chemobabel-en.pdf +2022/10/09 | 565081 | systems/win32/miktex/tm/packages/next/miktex-harfbuzz-bin-x64-2.9.tar.lzma +2022/10/09 | 55319 | systems/win32/miktex/tm/packages/next/miktex-mpmcli-bin-x64-2.9.tar.lzma +2022/10/09 | 528272 | systems/texlive/tlnet/archive/ducksay.doc.r64655.tar.xz +2022/10/09 | 527568 | systems/win32/miktex/tm/packages/next/miktex-log4cxx-bin-x64-2.9.tar.lzma +2022/10/09 | 52627 | systems/win32/miktex/tm/packages/next/miktex-synctex-bin-x64-2.9.tar.lzma +2022/10/09 | 52369 | systems/win32/miktex/tm/packages/next/miktex-m-tx-bin-x64-2.9.tar.lzma +2022/10/09 | 52037 | systems/win32/miktex/tm/packages/next/miktex-dvicopy-bin-x64-2.9.tar.lzma +2022/10/09 | 51 | macros/latex/contrib/iexec/DEPENDS.txt +2022/10/09 | 507609 | install/macros/latex/contrib/thalie.tds.zip +2022/10/09 | 5051 | fonts/sansmathfonts/tex/sansmathfonts.sty +2022/10/09 | 501727 | macros/latex/contrib/thalie.zip +2022/10/09 | 49805 | graphics/chemobabel/chemobabel.dtx +2022/10/09 | 48 | systems/texlive/tlnet/tlpkg/texlive.tlpdb.md5 +2022/10/09 | 48851 | systems/win32/miktex/tm/packages/next/miktex-expat-bin-x64-2.9.tar.lzma +2022/10/09 | 484998 | macros/latex/contrib/thalie/thalie.pdf +2022/10/09 | 481895 | systems/win32/miktex/tm/packages/next/miktex-doc.tar.lzma +2022/10/09 | 48038 | systems/win32/miktex/tm/packages/next/miktex-mtprint-bin-x64-2.9.tar.lzma +2022/10/09 | 45796 | systems/win32/miktex/tm/packages/next/miktex-dvipng-bin-x64-2.9.tar.lzma +2022/10/09 | 456 | systems/texlive/tlnet/archive/latex-for-undergraduates.r64647.tar.xz +2022/10/09 | 455 | systems/texlive/tlnet/tlpkg/texlive.tlpdb.sha512.asc +2022/10/09 | 455 | systems/texlive/tlnet/install-tl.zip.sha512.asc +2022/10/09 | 455 | systems/texlive/tlnet/install-tl-windows.exe.sha512.asc +2022/10/09 | 455 | systems/texlive/tlnet/install-tl-unx.tar.gz.sha512.asc +2022/10/09 | 43889 | systems/win32/miktex/tm/packages/next/miktex-gsf2pk-bin-x64-2.9.tar.lzma +2022/10/09 | 43617 | systems/win32/miktex/tm/packages/next/miktex-mthelp-bin-x64-2.9.tar.lzma +2022/10/09 | 43528 | systems/win32/miktex/tm/packages/next/miktex-zlib-bin-x64-2.9.tar.lzma +2022/10/09 | 421700 | systems/texlive/tlnet/archive/texlive-scripts.doc.r64645.tar.xz +2022/10/09 | 41191 | systems/win32/miktex/tm/packages/next/miktex-upmendex-bin-x64.tar.lzma +2022/10/09 | 41180 | systems/win32/miktex/tm/packages/next/miktex-patgen-bin-x64.tar.lzma +2022/10/09 | 394142 | systems/win32/miktex/tm/packages/next/miktex-cairo-bin-x64-2.9.tar.lzma +2022/10/09 | 37506 | systems/win32/miktex/tm/packages/next/miktex-posix-bin-x64-2.9.tar.lzma +2022/10/09 | 37050 | systems/win32/miktex/tm/packages/next/miktex-chktex-bin-x64-2.9.tar.lzma +2022/10/09 | 35264 | systems/win32/miktex/tm/packages/next/miktex-axohelp-bin-x64-2.9.tar.lzma +2022/10/09 | 352464 | systems/win32/miktex/tm/packages/next/miktex-xetex-bin-x64-2.9.tar.lzma +2022/10/09 | 35231 | systems/win32/miktex/tm/packages/next/miktex-mspack-bin-x64-2.9.tar.lzma +2022/10/09 | 350996 | systems/texlive/tlnet/archive/algpseudocodex.doc.r64654.tar.xz +2022/10/09 | 33862 | systems/win32/miktex/tm/packages/next/miktex-uriparser-bin-x64-2.9.tar.lzma +2022/10/09 | 325980 | systems/win32/miktex/tm/packages/next/miktex-dvipdfmx-bin-x64-2.9.tar.lzma +2022/10/09 | 325482 | systems/win32/miktex/tm/packages/next/miktex-mo-bin-x64-2.9.tar.lzma +2022/10/09 | 32074 | systems/win32/miktex/tm/packages/next/miktex-makeindex-bin-x64-2.9.tar.lzma +2022/10/09 | 31586 | systems/win32/miktex/tm/packages/next/miktex-autosp-bin-x64-2.9.tar.lzma +2022/10/09 | 31563 | systems/win32/miktex/tm/packages/next/miktex-bzip2-bin-x64-2.9.tar.lzma +2022/10/09 | 3108 | macros/latex/contrib/thalie/CHANGELOG.md +2022/10/09 | 30570 | systems/win32/miktex/tm/packages/next/miktex-lacheck-bin-x64-2.9.tar.lzma +2022/10/09 | 298605 | macros/latex/contrib/iexec.zip +2022/10/09 | 297861 | systems/win32/miktex/tm/packages/miktex-zzdb1-2.9.tar.lzma +2022/10/09 | 297813 | systems/win32/miktex/tm/packages/next/miktex-zzdb1-2.9.tar.lzma +2022/10/09 | 296024 | systems/texlive/tlnet/archive/piton.doc.r64656.tar.xz +2022/10/09 | 295945 | systems/win32/miktex/tm/packages/next/miktex-freetype2-bin-x64-2.9.tar.lzma +2022/10/09 | 294434 | macros/latex/contrib/iexec/iexec.pdf +2022/10/09 | 286684 | systems/win32/miktex/tm/packages/next/miktex-metapost-bin-x64-2.9.tar.lzma +2022/10/09 | 28509 | systems/win32/miktex/tm/packages/next/miktex-findtexmf-bin-x64-2.9.tar.lzma +2022/10/09 | 2821671 | systems/win32/miktex/tm/packages/next/miktex-texworks-bin-x64-2.9.tar.lzma +2022/10/09 | 27465 | systems/win32/miktex/tm/packages/next/miktex-teckit-bin-x64-2.9.tar.lzma +2022/10/09 | 270466 | systems/win32/miktex/tm/packages/next/miktex-console-bin-x64-2.9.tar.lzma +2022/10/09 | 2686828 | systems/texlive/tlnet/archive/simpleicons.r64646.tar.xz +2022/10/09 | 2625 | macros/latex/contrib/iexec/iexec.ins +2022/10/09 | 2606778 | biblio/ctan-bibdata.zip +2022/10/09 | 2604 | systems/texlive/tlnet/archive/fixmath.source.r64648.tar.xz +2022/10/09 | 2598283 | biblio/ctan-bibdata/ctan.bib +2022/10/09 | 25516720 | systems/texlive/tlnet/install-tl.zip +2022/10/09 | 25120 | systems/win32/miktex/tm/packages/next/miktex-fribidixetex-bin-x64-2.9.tar.lzma +2022/10/09 | 247207 | systems/win32/miktex/tm/packages/next/miktex-hitex-bin-x64.tar.lzma +2022/10/09 | 245152 | systems/win32/miktex/tm/packages/next/miktex-pmx-bin-x64-2.9.tar.lzma +2022/10/09 | 24212 | systems/win32/miktex/tm/packages/next/miktex-devnag-bin-x64-2.9.tar.lzma +2022/10/09 | 2415668 | systems/texlive/tlnet/tlpkg/texlive.tlpdb.xz +2022/10/09 | 23951 | systems/win32/miktex/tm/packages/next/miktex-popt-bin-x64-2.9.tar.lzma +2022/10/09 | 225664 | systems/texlive/tlnet/archive/neo-euler.r64652.tar.xz +2022/10/09 | 2167 | macros/latex/contrib/thalie/thalie.ins +2022/10/09 | 2139676 | biblio/ctan-bibdata/ctan.pdf +2022/10/09 | 213850 | systems/win32/miktex/tm/packages/next/miktex-omegaware-bin-x64-2.9.tar.lzma +2022/10/09 | 209138 | systems/win32/miktex/tm/packages/next/miktex-metafont-bin-x64-2.9.tar.lzma +2022/10/09 | 20792 | systems/texlive/tlnet/archive/ducksay.source.r64655.tar.xz +2022/10/09 | 20433558 | systems/texlive/tlnet/install-tl-windows.exe +2022/10/09 | 203421 | systems/win32/miktex/tm/packages/next/miktex-pixman-bin-x64-2.9.tar.lzma +2022/10/09 | 2023133 | systems/win32/miktex/tm/packages/next/miktex-luatex-bin-x64-2.9.tar.lzma +2022/10/09 | 201872 | systems/texlive/tlnet/archive/xcharter-math.r64653.tar.xz +2022/10/09 | 2009952 | systems/texlive/tlnet/archive/latex-for-undergraduates.doc.r64647.tar.xz +2022/10/09 | 1971700 | systems/texlive/tlnet/archive/simpleicons.doc.r64646.tar.xz +2022/10/09 | 196213 | systems/win32/miktex/tm/packages/next/miktex-curl-bin-x64-2.9.tar.lzma +2022/10/09 | 1947500 | systems/texlive/tlnet/archive/xcharter-math.doc.r64653.tar.xz +2022/10/09 | 19106 | macros/latex/contrib/thalie/LICENSE.txt +2022/10/09 | 188924 | systems/texlive/tlnet/archive/fixmath.doc.r64648.tar.xz +2022/10/09 | 18511 | systems/win32/miktex/tm/packages/next/miktex-tex2xindy-bin-x64-2.9.tar.lzma +2022/10/09 | 18382 | systems/win32/miktex/tm/packages/next/miktex-kpathsea-bin-x64-2.9.tar.lzma +2022/10/09 | 1820 | graphics/chemobabel/example-ja.tex +2022/10/09 | 181 | graphics/chemobabel/chemobabel.ins +2022/10/09 | 181724 | systems/win32/miktex/tm/packages/next/miktex-mpfr-bin-x64-2.9.tar.lzma +2022/10/09 | 18028 | systems/texlive/tlnet/archive/proflycee.r64649.tar.xz +2022/10/09 | 17675849 | systems/texlive/tlnet/tlpkg/texlive.tlpdb +2022/10/09 | 173177 | systems/win32/miktex/tm/packages/next/miktex-tex-bin-x64-2.9.tar.lzma +2022/10/09 | 17020 | fonts/sansmathfonts/sansmathfonts.tex +2022/10/09 | 169677 | systems/win32/miktex/tm/packages/next/miktex-hunspell-bin-x64-2.9.tar.lzma +2022/10/09 | 1643 | macros/latex/contrib/thalie/dicts/thalie-fallback.trsl +2022/10/09 | 1624 | systems/texlive/tlnet/archive/collection-mathscience.r64648.tar.xz +2022/10/09 | 1582 | macros/latex/contrib/thalie/README.md +2022/10/09 | 155432 | systems/win32/miktex/tm/packages/next/miktex-fontconfig-bin-x64-2.9.tar.lzma +2022/10/09 | 1544604 | systems/texlive/tlnet/archive/neo-euler.doc.r64652.tar.xz +2022/10/09 | 153 | systems/texlive/tlnet/install-tl-windows.exe.sha512 +2022/10/09 | 152 | systems/texlive/tlnet/install-tl-unx.tar.gz.sha512 +2022/10/09 | 1503141 | systems/win32/miktex/tm/packages/miktex-zzdb2-2.9.tar.lzma +2022/10/09 | 1503055 | systems/win32/miktex/tm/packages/next/miktex-runtime-bin-x64-2.9.tar.lzma +2022/10/09 | 1500884 | systems/win32/miktex/tm/packages/next/miktex-zzdb2-2.9.tar.lzma +2022/10/09 | 1496 | systems/texlive/tlnet/archive/fixmath.r64648.tar.xz +2022/10/09 | 14943 | graphics/chemobabel/chemobabel.sty +2022/10/09 | 1473 | graphics/chemobabel/example-en.tex +2022/10/09 | 145 | systems/texlive/tlnet/install-tl.zip.sha512 +2022/10/09 | 1458152 | systems/win32/miktex/tm/packages/next/miktex-dvisvgm-bin-x64-2.9.tar.lzma +2022/10/09 | 144 | systems/texlive/tlnet/tlpkg/texlive.tlpdb.sha512 +2022/10/09 | 14434 | systems/win32/miktex/tm/packages/next/miktex-zzip-bin-x64-2.9.tar.lzma +2022/10/09 | 140014 | systems/win32/miktex/tm/packages/next/miktex-mktex-bin-x64-2.9.tar.lzma +2022/10/09 | 1387 | graphics/chemobabel/README.md +2022/10/09 | 1381864 | systems/win32/miktex/tm/packages/next/miktex-zzdb3-2.9.tar.lzma +2022/10/09 | 1381855 | systems/win32/miktex/tm/packages/miktex-zzdb3-2.9.tar.lzma +2022/10/09 | 1369 | macros/latex/contrib/iexec/README.md +2022/10/09 | 135464 | systems/win32/miktex/tm/packages/next/miktex-dvips-bin-x64-2.9.tar.lzma +2022/10/09 | 1338 | graphics/chemobabel/LICENSE +2022/10/09 | 1323743 | systems/win32/miktex/tm/packages/next/miktex-poppler-bin-x64-2.9.tar.lzma +2022/10/09 | 132001 | graphics/chemobabel/example-en.pdf +2022/10/09 | 1300376 | graphics/chemobabel.zip +2022/10/09 | 12784 | systems/texlive/tlnet/archive/piton.source.r64656.tar.xz +2022/10/09 | 1172 | systems/win32/miktex/tm/packages/next/pr.ini +2022/10/09 | 1161748 | systems/win32/miktex/tm/packages/next/miktex-asymptote-bin-x64-2.9.tar.lzma +2022/10/09 | 115579 | systems/win32/miktex/tm/packages/next/miktex-gregorio-bin-x64-2.9.tar.lzma +2022/10/09 | 113672 | systems/texlive/tlnet/archive/texlive-scripts.r64645.tar.xz +2022/10/09 | 112980 | systems/win32/miktex/tm/packages/next/miktex-epstopdf-bin-x64-2.9.tar.lzma +2022/10/09 | 112879 | systems/win32/miktex/tm/packages/next/miktex-gd-bin-x64-2.9.tar.lzma +2022/10/09 | 109650 | systems/win32/miktex/tm/packages/next/miktex-jpeg-bin-x64-2.9.tar.lzma +2022/10/09 | 1083 | macros/latex/contrib/iexec/LICENSE.txt +2022/10/09 | 107436 | systems/win32/miktex/tm/packages/next/miktex-texware-bin-x64-2.9.tar.lzma +2022/10/09 | 1067 | macros/latex/contrib/thalie/dicts/thalie-german.trsl +2022/10/09 | 104922 | systems/win32/miktex/tm/packages/next/miktex-mfware-bin-x64-2.9.tar.lzma +2022/10/09 | 103599 | systems/win32/miktex/tm/packages/next/miktex-lua53-bin-x64-2.9.tar.lzma +2022/10/09 | 103245 | systems/win32/miktex/tm/packages/next/miktex-cweb-bin-x64-2.9.tar.lzma +2022/10/09 | 10317 | macros/latex/contrib/iexec/iexec.dtx +2022/10/09 | 1027 | macros/latex/contrib/thalie/dicts/thalie-french.trsl +2022/10/09 | 1022 | macros/latex/contrib/thalie/dicts/thalie-italian.trsl +2022/10/09 | 1001 | macros/latex/contrib/thalie/dicts/thalie-english.trsl 2022/10/08 | 94763 | macros/latex/contrib/ducksay/ducksay.dtx -2022/10/08 | 927 | systems/win32/miktex/tm/packages/pr.ini -2022/10/08 | 88483 | systems/win32/miktex/tm/packages/next/miktex-png-bin-x64-2.9.tar.lzma -2022/10/08 | 8825 | systems/win32/miktex/tm/packages/next/miktex-md5-bin-x64-2.9.tar.lzma -2022/10/08 | 824997 | systems/win32/miktex/tm/packages/next/miktex-pdftex-bin-x64-2.9.tar.lzma -2022/10/08 | 81448 | systems/win32/miktex/tm/packages/next/miktex-freeglut-bin-x64-2.9.tar.lzma -2022/10/08 | 79064 | systems/win32/miktex/tm/packages/next/miktex-fonts-bin-x64-2.9.tar.lzma -2022/10/08 | 77211 | systems/win32/miktex/tm/packages/next/miktex-bibtex-bin-x64-2.9.tar.lzma -2022/10/08 | 769652 | systems/win32/miktex/tm/packages/next/miktex-ptex-bin-x64.tar.lzma -2022/10/08 | 74099 | systems/win32/miktex/tm/packages/next/miktex-lzma-bin-x64-2.9.tar.lzma -2022/10/08 | 73685 | systems/win32/miktex/tm/packages/next/miktex-web-bin-x64-2.9.tar.lzma -2022/10/08 | 73264 | systems/win32/miktex/tm/packages/next/miktex-graphite2-bin-x64-2.9.tar.lzma -2022/10/08 | 72977 | systems/win32/miktex/tm/packages/next/miktex-ps2pk-bin-x64-2.9.tar.lzma -2022/10/08 | 70939 | systems/win32/miktex/tm/packages/next/miktex-tex4ht-bin-x64-2.9.tar.lzma -2022/10/08 | 682215 | systems/win32/miktex/tm/packages/next/miktex-lcdf-typetools-bin-x64-2.9.tar.lzma -2022/10/08 | 68147 | systems/win32/miktex/tm/packages/next/miktex-texify-bin-x64-2.9.tar.lzma -2022/10/08 | 668612 | systems/win32/miktex/tm/packages/files.csv.lzma -2022/10/08 | 667663 | systems/win32/miktex/tm/packages/next/files.csv.lzma 2022/10/08 | 6627 | fonts/xcharter-math/xcharter-otf.sty -2022/10/08 | 65129 | systems/win32/miktex/tm/packages/next/miktex-bibarts-bin-x64-2.9.tar.lzma -2022/10/08 | 63802 | systems/win32/miktex/tm/packages/next/miktex-tdsutil-bin-x64.tar.lzma -2022/10/08 | 63241 | systems/win32/miktex/tm/packages/next/miktex-fmt-bin-x64-2.9.tar.lzma -2022/10/08 | 630436 | systems/win32/miktex/tm/packages/next/miktex-yap-bin-x64-2.9.tar.lzma -2022/10/08 | 62357 | systems/win32/miktex/tm/packages/next/miktex-ttf2pk2-bin-x64-2.9.tar.lzma -2022/10/08 | 599105 | systems/win32/miktex/tm/packages/next/miktex-libressl-bin-x64-2.9.tar.lzma -2022/10/08 | 58633 | systems/win32/miktex/tm/packages/next/miktex-psutils-bin-x64-2.9.tar.lzma -2022/10/08 | 57504 | systems/win32/miktex/tm/packages/next/miktex-cjkutils-bin-x64-2.9.tar.lzma -2022/10/08 | 57502 | systems/win32/miktex/tm/packages/next/miktex-xml2pmx-bin-x64.tar.lzma -2022/10/08 | 57317 | systems/win32/miktex/tm/packages/next/miktex-arctrl-bin-x64-2.9.tar.lzma -2022/10/08 | 565079 | systems/win32/miktex/tm/packages/next/miktex-harfbuzz-bin-x64-2.9.tar.lzma 2022/10/08 | 5540 | macros/latex/contrib/gitstatus/gitstatus.dtx -2022/10/08 | 55319 | systems/win32/miktex/tm/packages/next/miktex-mpmcli-bin-x64-2.9.tar.lzma 2022/10/08 | 549243 | macros/latex/contrib/ducksay.zip 2022/10/08 | 543677 | macros/latex/contrib/ducksay/ducksay.pdf -2022/10/08 | 527570 | systems/win32/miktex/tm/packages/next/miktex-log4cxx-bin-x64-2.9.tar.lzma -2022/10/08 | 52627 | systems/win32/miktex/tm/packages/next/miktex-synctex-bin-x64-2.9.tar.lzma -2022/10/08 | 52370 | systems/win32/miktex/tm/packages/next/miktex-m-tx-bin-x64-2.9.tar.lzma -2022/10/08 | 52037 | systems/win32/miktex/tm/packages/next/miktex-dvicopy-bin-x64-2.9.tar.lzma -2022/10/08 | 48852 | systems/win32/miktex/tm/packages/next/miktex-expat-bin-x64-2.9.tar.lzma 2022/10/08 | 48244 | macros/luatex/latex/piton/piton.dtx -2022/10/08 | 481895 | systems/win32/miktex/tm/packages/next/miktex-doc.tar.lzma -2022/10/08 | 48037 | systems/win32/miktex/tm/packages/next/miktex-mtprint-bin-x64-2.9.tar.lzma 2022/10/08 | 4579 | fonts/neo-euler/neo-euler.sty -2022/10/08 | 45794 | systems/win32/miktex/tm/packages/next/miktex-dvipng-bin-x64-2.9.tar.lzma -2022/10/08 | 43889 | systems/win32/miktex/tm/packages/next/miktex-gsf2pk-bin-x64-2.9.tar.lzma 2022/10/08 | 438344 | fonts/neo-euler/Neo-Euler.otf -2022/10/08 | 43618 | systems/win32/miktex/tm/packages/next/miktex-mthelp-bin-x64-2.9.tar.lzma -2022/10/08 | 43527 | systems/win32/miktex/tm/packages/next/miktex-zlib-bin-x64-2.9.tar.lzma -2022/10/08 | 41190 | systems/win32/miktex/tm/packages/next/miktex-upmendex-bin-x64.tar.lzma -2022/10/08 | 41178 | systems/win32/miktex/tm/packages/next/miktex-patgen-bin-x64.tar.lzma -2022/10/08 | 394143 | systems/win32/miktex/tm/packages/next/miktex-cairo-bin-x64-2.9.tar.lzma -2022/10/08 | 37506 | systems/win32/miktex/tm/packages/next/miktex-posix-bin-x64-2.9.tar.lzma -2022/10/08 | 37049 | systems/win32/miktex/tm/packages/next/miktex-chktex-bin-x64-2.9.tar.lzma +2022/10/08 | 361001 | fonts/sansmathfonts/sansmathfonts.pdf 2022/10/08 | 357213 | macros/latex/contrib/algpseudocodex.zip -2022/10/08 | 35265 | systems/win32/miktex/tm/packages/next/miktex-axohelp-bin-x64-2.9.tar.lzma -2022/10/08 | 352464 | systems/win32/miktex/tm/packages/next/miktex-xetex-bin-x64-2.9.tar.lzma -2022/10/08 | 35231 | systems/win32/miktex/tm/packages/next/miktex-mspack-bin-x64-2.9.tar.lzma 2022/10/08 | 344799 | macros/luatex/latex/piton.zip -2022/10/08 | 33862 | systems/win32/miktex/tm/packages/next/miktex-uriparser-bin-x64-2.9.tar.lzma -2022/10/08 | 325981 | systems/win32/miktex/tm/packages/next/miktex-dvipdfmx-bin-x64-2.9.tar.lzma -2022/10/08 | 325483 | systems/win32/miktex/tm/packages/next/miktex-mo-bin-x64-2.9.tar.lzma 2022/10/08 | 324492 | fonts/xcharter-math/XCharter-Math.otf -2022/10/08 | 3221509 | biblio/ctan-bibdata.zip -2022/10/08 | 32074 | systems/win32/miktex/tm/packages/next/miktex-makeindex-bin-x64-2.9.tar.lzma -2022/10/08 | 31584 | systems/win32/miktex/tm/packages/next/miktex-autosp-bin-x64-2.9.tar.lzma -2022/10/08 | 31562 | systems/win32/miktex/tm/packages/next/miktex-bzip2-bin-x64-2.9.tar.lzma 2022/10/08 | 308546 | macros/luatex/latex/piton/piton.pdf -2022/10/08 | 30571 | systems/win32/miktex/tm/packages/next/miktex-lacheck-bin-x64-2.9.tar.lzma -2022/10/08 | 297870 | systems/win32/miktex/tm/packages/next/miktex-zzdb1-2.9.tar.lzma -2022/10/08 | 297835 | systems/win32/miktex/tm/packages/miktex-zzdb1-2.9.tar.lzma -2022/10/08 | 295945 | systems/win32/miktex/tm/packages/next/miktex-freetype2-bin-x64-2.9.tar.lzma 2022/10/08 | 292205 | macros/latex/contrib/gitstatus.zip -2022/10/08 | 286685 | systems/win32/miktex/tm/packages/next/miktex-metapost-bin-x64-2.9.tar.lzma -2022/10/08 | 28510 | systems/win32/miktex/tm/packages/next/miktex-findtexmf-bin-x64-2.9.tar.lzma 2022/10/08 | 283311 | macros/latex/contrib/gitstatus/gitstatus.pdf -2022/10/08 | 2821671 | systems/win32/miktex/tm/packages/next/miktex-texworks-bin-x64-2.9.tar.lzma -2022/10/08 | 2795675 | biblio/ctan-bibdata/ctan.pdf -2022/10/08 | 27464 | systems/win32/miktex/tm/packages/next/miktex-teckit-bin-x64-2.9.tar.lzma -2022/10/08 | 270466 | systems/win32/miktex/tm/packages/next/miktex-console-bin-x64-2.9.tar.lzma -2022/10/08 | 2596079 | biblio/ctan-bibdata/ctan.bib -2022/10/08 | 25118 | systems/win32/miktex/tm/packages/next/miktex-fribidixetex-bin-x64-2.9.tar.lzma 2022/10/08 | 24947 | fonts/xcharter-math/XCharter-Math.ltx 2022/10/08 | 2477 | fonts/xcharter-math/README.md -2022/10/08 | 247207 | systems/win32/miktex/tm/packages/next/miktex-hitex-bin-x64.tar.lzma -2022/10/08 | 245152 | systems/win32/miktex/tm/packages/next/miktex-pmx-bin-x64-2.9.tar.lzma -2022/10/08 | 24210 | systems/win32/miktex/tm/packages/next/miktex-devnag-bin-x64-2.9.tar.lzma -2022/10/08 | 23950 | systems/win32/miktex/tm/packages/next/miktex-popt-bin-x64-2.9.tar.lzma 2022/10/08 | 2190523 | fonts/xcharter-math.zip 2022/10/08 | 2153 | fonts/neo-euler/README.md -2022/10/08 | 213849 | systems/win32/miktex/tm/packages/next/miktex-omegaware-bin-x64-2.9.tar.lzma -2022/10/08 | 209139 | systems/win32/miktex/tm/packages/next/miktex-metafont-bin-x64-2.9.tar.lzma -2022/10/08 | 203421 | systems/win32/miktex/tm/packages/next/miktex-pixman-bin-x64-2.9.tar.lzma -2022/10/08 | 2023133 | systems/win32/miktex/tm/packages/next/miktex-luatex-bin-x64-2.9.tar.lzma -2022/10/08 | 196211 | systems/win32/miktex/tm/packages/next/miktex-curl-bin-x64-2.9.tar.lzma 2022/10/08 | 1882203 | fonts/neo-euler.zip -2022/10/08 | 18511 | systems/win32/miktex/tm/packages/next/miktex-tex2xindy-bin-x64-2.9.tar.lzma 2022/10/08 | 1847588 | fonts/xcharter-math/unimath-xcharter.pdf -2022/10/08 | 18382 | systems/win32/miktex/tm/packages/next/miktex-kpathsea-bin-x64-2.9.tar.lzma -2022/10/08 | 181724 | systems/win32/miktex/tm/packages/next/miktex-mpfr-bin-x64-2.9.tar.lzma 2022/10/08 | 18011 | fonts/neo-euler/Neo-Euler.ltx 2022/10/08 | 178625 | fonts/xcharter-math/XCharter-Math.pdf -2022/10/08 | 173177 | systems/win32/miktex/tm/packages/next/miktex-tex-bin-x64-2.9.tar.lzma 2022/10/08 | 17127 | fonts/xcharter-math/unimath-xcharter.ltx -2022/10/08 | 169678 | systems/win32/miktex/tm/packages/next/miktex-hunspell-bin-x64-2.9.tar.lzma 2022/10/08 | 16836 | fonts/neo-euler/unimath-euler.ltx 2022/10/08 | 157301 | fonts/neo-euler/Neo-Euler.pdf -2022/10/08 | 155430 | systems/win32/miktex/tm/packages/next/miktex-fontconfig-bin-x64-2.9.tar.lzma 2022/10/08 | 154819 | macros/luatex/latex/piton/piton-french.pdf -2022/10/08 | 1503053 | systems/win32/miktex/tm/packages/next/miktex-runtime-bin-x64-2.9.tar.lzma -2022/10/08 | 1503017 | systems/win32/miktex/tm/packages/miktex-zzdb2-2.9.tar.lzma -2022/10/08 | 1501460 | systems/win32/miktex/tm/packages/next/miktex-zzdb2-2.9.tar.lzma 2022/10/08 | 1476 | biblio/ctan-bibdata/biblatex-ctan/ctan.bbx 2022/10/08 | 14705 | macros/luatex/latex/piton/piton-french.tex -2022/10/08 | 1458151 | systems/win32/miktex/tm/packages/next/miktex-dvisvgm-bin-x64-2.9.tar.lzma 2022/10/08 | 1452756 | fonts/neo-euler/unimath-euler.pdf -2022/10/08 | 14434 | systems/win32/miktex/tm/packages/next/miktex-zzip-bin-x64-2.9.tar.lzma 2022/10/08 | 1415 | biblio/ctan-bibdata/README -2022/10/08 | 140012 | systems/win32/miktex/tm/packages/next/miktex-mktex-bin-x64-2.9.tar.lzma -2022/10/08 | 1381595 | systems/win32/miktex/tm/packages/miktex-zzdb3-2.9.tar.lzma -2022/10/08 | 1381533 | systems/win32/miktex/tm/packages/next/miktex-zzdb3-2.9.tar.lzma -2022/10/08 | 135465 | systems/win32/miktex/tm/packages/next/miktex-dvips-bin-x64-2.9.tar.lzma -2022/10/08 | 1323744 | systems/win32/miktex/tm/packages/next/miktex-poppler-bin-x64-2.9.tar.lzma 2022/10/08 | 127 | biblio/ctan-bibdata/biblatex-ctan/ctan.cbx 2022/10/08 | 1222 | macros/latex/contrib/gitstatus/README.md -2022/10/08 | 1172 | systems/win32/miktex/tm/packages/next/pr.ini -2022/10/08 | 1161749 | systems/win32/miktex/tm/packages/next/miktex-asymptote-bin-x64-2.9.tar.lzma -2022/10/08 | 115578 | systems/win32/miktex/tm/packages/next/miktex-gregorio-bin-x64-2.9.tar.lzma -2022/10/08 | 112980 | systems/win32/miktex/tm/packages/next/miktex-epstopdf-bin-x64-2.9.tar.lzma -2022/10/08 | 112878 | systems/win32/miktex/tm/packages/next/miktex-gd-bin-x64-2.9.tar.lzma -2022/10/08 | 109650 | systems/win32/miktex/tm/packages/next/miktex-jpeg-bin-x64-2.9.tar.lzma -2022/10/08 | 107437 | systems/win32/miktex/tm/packages/next/miktex-texware-bin-x64-2.9.tar.lzma -2022/10/08 | 104921 | systems/win32/miktex/tm/packages/next/miktex-mfware-bin-x64-2.9.tar.lzma -2022/10/08 | 103598 | systems/win32/miktex/tm/packages/next/miktex-lua53-bin-x64-2.9.tar.lzma -2022/10/08 | 103247 | systems/win32/miktex/tm/packages/next/miktex-cweb-bin-x64-2.9.tar.lzma 2022/10/07 | 968 | macros/latex/contrib/proflycee/doc/cap.csv 2022/10/07 | 964614 | macros/latex/contrib/proflycee.zip 2022/10/07 | 9616 | systems/texlive/tlnet/archive/huawei.source.r64625.tar.xz @@ -142,6 +218,7 @@ 2022/10/07 | 8183 | support/TeX4ht/source/mktex4ht-cnf.tex 2022/10/07 | 80783 | macros/latex/contrib/proflycee/tex/ProfLycee.sty 2022/10/07 | 736 | macros/latex/contrib/proflycee/doc/perroquet.csv +2022/10/07 | 7195 | systems/texlive/tlnet/tlpkg/installer/ctan-mirrors.pl 2022/10/07 | 69064 | systems/texlive/tlnet/archive/coolfn.doc.r64639.tar.xz 2022/10/07 | 6776 | systems/texlive/tlnet/archive/collection-latexextra.r64639.tar.xz 2022/10/07 | 665 | fonts/simpleicons/README.md @@ -149,24 +226,17 @@ 2022/10/07 | 624608 | systems/texlive/tlnet/archive/carlito.doc.r64624.tar.xz 2022/10/07 | 6126 | support/TeX4ht/source/tex4ht-mathjax.tex 2022/10/07 | 5908 | systems/texlive/tlnet/archive/unbtex.r64634.tar.xz -2022/10/07 | 5832287 | systems/texlive/tlnet/install-tl-unx.tar.gz 2022/10/07 | 5552 | systems/texlive/tlnet/archive/abntexto.r64638.tar.xz 2022/10/07 | 534869 | macros/latex/contrib/was.zip 2022/10/07 | 529 | macros/latex/contrib/proflycee/doc/testscript.py 2022/10/07 | 515766 | biblio/bibtex/bibtex-x.zip 2022/10/07 | 504 | fonts/simpleicons/tfm/SimpleIcons--simpleiconsOneZero.tfm -2022/10/07 | 48 | systems/texlive/tlnet/tlpkg/texlive.tlpdb.md5 2022/10/07 | 4897045 | fonts/simpleicons.zip 2022/10/07 | 4892 | systems/texlive/tlnet/archive/membranecomputing.r64627.tar.xz 2022/10/07 | 47824 | systems/texlive/tlnet/archive/thuthesis.source.r64628.tar.xz 2022/10/07 | 477608 | systems/texlive/tlnet/archive/gbt7714.doc.r64633.tar.xz -2022/10/07 | 455 | systems/texlive/tlnet/tlpkg/texlive.tlpdb.sha512.asc -2022/10/07 | 455 | systems/texlive/tlnet/install-tl.zip.sha512.asc -2022/10/07 | 455 | systems/texlive/tlnet/install-tl-windows.exe.sha512.asc -2022/10/07 | 455 | systems/texlive/tlnet/install-tl-unx.tar.gz.sha512.asc 2022/10/07 | 43556 | systems/texlive/tlnet/archive/thuthesis.r64628.tar.xz 2022/10/07 | 43152 | systems/texlive/tlnet/archive/eplain.r64637.tar.xz -2022/10/07 | 421668 | systems/texlive/tlnet/archive/texlive-scripts.doc.r64631.tar.xz 2022/10/07 | 411140 | systems/texlive/tlnet/archive/huawei.doc.r64625.tar.xz 2022/10/07 | 390776 | systems/texlive/tlnet/archive/kvsetkeys.doc.r64632.tar.xz 2022/10/07 | 38316 | systems/texlive/tlnet/archive/nicematrix.r64640.tar.xz @@ -195,18 +265,15 @@ 2022/10/07 | 259 | fonts/simpleicons/tex/usimpleiconsFive.fd 2022/10/07 | 2596 | fonts/simpleicons/enc/simpleiconsNine.enc 2022/10/07 | 2574308 | systems/texlive/tlnet/archive/carlito.r64624.tar.xz -2022/10/07 | 25516739 | systems/texlive/tlnet/install-tl.zip 2022/10/07 | 254 | fonts/simpleicons/tex/usimpleiconsTwo.fd 2022/10/07 | 254 | fonts/simpleicons/tex/usimpleiconsSix.fd 2022/10/07 | 254 | fonts/simpleicons/tex/usimpleiconsOne.fd 2022/10/07 | 2541 | fonts/simpleicons/enc/simpleiconsThree.enc 2022/10/07 | 2491 | fonts/simpleicons/enc/simpleiconsFive.enc -2022/10/07 | 2414720 | systems/texlive/tlnet/tlpkg/texlive.tlpdb.xz 2022/10/07 | 2320 | fonts/simpleicons/enc/simpleiconsOneZero.enc 2022/10/07 | 213582 | fonts/simpleicons/tex/simpleiconsglyphs-pdftex.tex 2022/10/07 | 209678 | fonts/simpleicons/tex/simpleiconsglyphs-xeluatex.tex 2022/10/07 | 2085332 | systems/texlive/tlnet/archive/kpfonts-otf.doc.r64636.tar.xz -2022/10/07 | 20435659 | systems/texlive/tlnet/install-tl-windows.exe 2022/10/07 | 203537 | support/TeX4ht/source/ChangeLog 2022/10/07 | 19796 | macros/latex/contrib/algpseudocodex/algpseudocodex.tex 2022/10/07 | 1962210 | fonts/simpleicons/doc/simpleicons.pdf @@ -216,7 +283,6 @@ 2022/10/07 | 1856412 | systems/texlive/tlnet/archive/concmath-otf.doc.r64635.tar.xz 2022/10/07 | 1844 | fonts/simpleicons/doc/simpleicons.tex 2022/10/07 | 1817972 | systems/texlive/tlnet/archive/nicematrix.doc.r64640.tar.xz -2022/10/07 | 17673749 | systems/texlive/tlnet/tlpkg/texlive.tlpdb 2022/10/07 | 1732518 | fonts/simpleicons/type1/SimpleIcons.pfb 2022/10/07 | 1712 | systems/texlive/tlnet/archive/gobble.r64642.tar.xz 2022/10/07 | 166100 | macros/latex/contrib/proflycee/doc/ProfLycee-doc.tex @@ -224,11 +290,7 @@ 2022/10/07 | 157372 | systems/texlive/tlnet/archive/gobble.doc.r64642.tar.xz 2022/10/07 | 1559 | fonts/simpleicons/tex/simpleicons.sty 2022/10/07 | 1544 | systems/texlive/tlnet/archive/coolfn.r64639.tar.xz -2022/10/07 | 153 | systems/texlive/tlnet/install-tl-windows.exe.sha512 -2022/10/07 | 152 | systems/texlive/tlnet/install-tl-unx.tar.gz.sha512 2022/10/07 | 147460 | systems/texlive/tlnet/archive/abntexto.doc.r64638.tar.xz -2022/10/07 | 145 | systems/texlive/tlnet/install-tl.zip.sha512 -2022/10/07 | 144 | systems/texlive/tlnet/tlpkg/texlive.tlpdb.sha512 2022/10/07 | 1427156 | systems/texlive/tlnet/archive/unbtex.doc.r64634.tar.xz 2022/10/07 | 136384 | systems/texlive/tlnet/archive/tex4ht.doc.r64643.tar.xz 2022/10/07 | 133876 | systems/texlive/tlnet/archive/concmath-otf.r64635.tar.xz @@ -244,7 +306,6 @@ 2022/10/07 | 1232 | fonts/simpleicons/tfm/SimpleIcons--simpleiconsEight.tfm 2022/10/07 | 1228 | fonts/simpleicons/tfm/SimpleIcons--simpleiconsOne.tfm 2022/10/07 | 120764 | systems/texlive/tlnet/archive/nicematrix.source.r64640.tar.xz -2022/10/07 | 113692 | systems/texlive/tlnet/archive/texlive-scripts.r64631.tar.xz 2022/10/07 | 11204 | systems/texlive/tlnet/archive/gbt7714.r64633.tar.xz 2022/10/07 | 1119 | fonts/simpleicons/map/simpleicons.map 2022/10/07 | 1081384 | systems/texlive/tlnet/archive/kpfonts-otf.r64636.tar.xz @@ -303,7 +364,6 @@ 2022/10/06 | 7546 | macros/luatex/generic/luatexja/src/ltj-math.lua 2022/10/06 | 7428 | systems/win32/miktex/tm/packages/udes-genie-these.tar.lzma 2022/10/06 | 7410 | systems/win32/miktex/tm/packages/lettrine.tar.lzma -2022/10/06 | 7271 | systems/texlive/tlnet/tlpkg/installer/ctan-mirrors.pl 2022/10/06 | 725721 | macros/eplain/doc/eplain.html 2022/10/06 | 7215 | biblio/bibtex/contrib/gbt7714/README.md 2022/10/06 | 717373 | macros/luatex/generic/luatexja/doc/luatexja-en.pdf @@ -717,7 +777,6 @@ 2022/10/05 | 9612 | fonts/carlito/tfm/Crlt-BoldItalic-tosf-ot1.tfm 2022/10/05 | 9576 | systems/texlive/tlnet/archive/biblatex-publist.r64595.tar.xz 2022/10/05 | 953148 | systems/texlive/tlnet/archive/bithesis.doc.r64619.tar.xz -2022/10/05 | 931824 | systems/texlive/tlnet/archive/proflycee.doc.r64599.tar.xz 2022/10/05 | 917 | fonts/carlito/doc/carlito-samples.tex 2022/10/05 | 87452 | systems/texlive/tlnet/archive/lualibs.doc.r64615.tar.xz 2022/10/05 | 872556 | systems/texlive/tlnet/archive/babel.doc.r64614.tar.xz @@ -982,7 +1041,6 @@ 2022/10/05 | 1748 | fonts/carlito/vf/Crlt-osf-t1.vf 2022/10/05 | 1748 | fonts/carlito/vf/Crlt-lf-t1.vf 2022/10/05 | 1748 | fonts/carlito/tfm/Crlt-lf-t1--base.tfm -2022/10/05 | 17352 | systems/texlive/tlnet/archive/proflycee.r64599.tar.xz 2022/10/05 | 1734686 | install/macros/latex/contrib/thuthesis.tds.zip 2022/10/05 | 1728 | fonts/carlito/tfm/Crlt-tosf-t1--base.tfm 2022/10/05 | 1728 | fonts/carlito/tfm/Crlt-tlf-t1--base.tfm @@ -1417,94 +1475,3 @@ 2022/10/03 | 102502 | macros/luatex/generic/luaotfload/luaotfload-glyphlist.lua 2022/10/03 | 10207 | macros/luatex/generic/luaotfload/fontloader-basics-nod.lua 2022/10/03 | 1004 | macros/luatex/generic/luaotfload/luaotfload-embolden.lua -2022/10/02 | 986 | macros/latex/contrib/srdp-mathematik/README.md -2022/10/02 | 9584 | macros/latex/contrib/univie-ling/README -2022/10/02 | 8540 | macros/latex/contrib/kdpcover/kdpcover-vol-1.pdf -2022/10/02 | 85180 | systems/texlive/tlnet/archive/crimsonpro.doc.r64565.tar.xz -2022/10/02 | 8172 | systems/texlive/tlnet/archive/flexipage.source.r64572.tar.xz -2022/10/02 | 78447 | macros/latex/contrib/srdp-mathematik/srdp-mathematik.sty -2022/10/02 | 7436 | systems/texlive/tlnet/archive/babel-serbian.source.r64571.tar.xz -2022/10/02 | 7256 | macros/latex/contrib/kdpcover/kdpcover-signature.pdf -2022/10/02 | 7156 | macros/latex/contrib/kdpcover/kdpcover-vol-3.pdf -2022/10/02 | 70188 | macros/latex/contrib/hvfloat/latex/hvfloat.sty -2022/10/02 | 675560 | systems/texlive/tlnet/archive/forum.r64566.tar.xz -2022/10/02 | 6723 | macros/latex/contrib/kdpcover/kdpcover-vol-4.pdf -2022/10/02 | 6504 | macros/latex/contrib/kdpcover/kdpcover-vol-2.pdf -2022/10/02 | 553 | macros/latex/contrib/univie-ling/doc/templates/template-handout-deutsch.tex -2022/10/02 | 531 | macros/latex/contrib/univie-ling/doc/templates/template-handout-english.tex -2022/10/02 | 5231 | macros/latex/contrib/univie-ling/doc/templates/template-expose-deutsch.tex -2022/10/02 | 5216 | macros/latex/contrib/yb-book/yb-book-logo.pdf -2022/10/02 | 5040712 | macros/latex/contrib/hvfloat/doc/hvfloat.pdf -2022/10/02 | 48433 | macros/latex/contrib/srdp-mathematik/srdp-mathematik.tex -2022/10/02 | 47687 | macros/latex/contrib/kdpcover/cactus.pdf -2022/10/02 | 4737 | macros/latex/contrib/univie-ling/doc/templates/template-expose-english.tex -2022/10/02 | 4727 | macros/latex/contrib/univie-ling/doc/templates/template-thesis-deutsch.tex -2022/10/02 | 458697 | macros/latex/contrib/univie-ling/doc/univie-ling-thesis.pdf -2022/10/02 | 457719 | macros/latex/contrib/univie-ling/doc/univie-ling-expose.pdf -2022/10/02 | 453762 | macros/latex/contrib/univie-ling/doc/univie-ling-paper.pdf -2022/10/02 | 447447 | macros/latex/contrib/univie-ling/doc/univie-ling-handout.pdf -2022/10/02 | 4446908 | macros/latex/contrib/univie-ling.zip -2022/10/02 | 4426 | macros/latex/contrib/univie-ling/doc/univie-ling.tex -2022/10/02 | 4390 | macros/latex/contrib/hvfloat/Changes -2022/10/02 | 4367 | macros/latex/contrib/univie-ling/doc/templates/template-paper-deutsch.tex -2022/10/02 | 4268 | macros/latex/contrib/univie-ling/doc/templates/template-thesis-english.tex -2022/10/02 | 425 | macros/latex/contrib/yb-book/DEPENDS.txt -2022/10/02 | 425624 | support/extractpdfmark.zip -2022/10/02 | 3965 | macros/latex/contrib/univie-ling/doc/templates/template-paper-english.tex -2022/10/02 | 3964 | systems/texlive/tlnet/archive/iexec.source.r64575.tar.xz -2022/10/02 | 3912 | systems/texlive/tlnet/archive/flexipage.r64572.tar.xz -2022/10/02 | 372059 | macros/latex/contrib/univie-ling/doc/templates/template-wlg-article.pdf -2022/10/02 | 364169 | macros/latex/contrib/univie-ling/doc/univie-ling.pdf -2022/10/02 | 3602 | macros/latex/contrib/univie-ling/biblatex-univie-ling/univie-ling.cbx -2022/10/02 | 342852 | macros/latex/contrib/univie-ling/doc/univie-ling-wlg.pdf -2022/10/02 | 339763 | macros/latex/contrib/kdpcover.zip -2022/10/02 | 3360 | systems/texlive/tlnet/archive/babel-serbian.r64571.tar.xz -2022/10/02 | 32604 | macros/latex/contrib/univie-ling/doc/univie-ling-thesis.tex -2022/10/02 | 3095296 | systems/texlive/tlnet/archive/imfellenglish.r64568.tar.xz -2022/10/02 | 30587 | macros/latex/contrib/univie-ling/tex/univie-ling-wlg.cls -2022/10/02 | 293533 | macros/latex/contrib/yb-book.zip -2022/10/02 | 29336 | macros/latex/contrib/univie-ling/doc/univie-ling-paper.tex -2022/10/02 | 292592 | systems/texlive/tlnet/archive/flexipage.doc.r64572.tar.xz -2022/10/02 | 284432 | systems/texlive/tlnet/archive/iexec.doc.r64575.tar.xz -2022/10/02 | 283494 | macros/latex/contrib/yb-book/yb-book.pdf -2022/10/02 | 28180 | macros/latex/contrib/univie-ling/tex/univie-ling-handout.cls -2022/10/02 | 27448 | systems/texlive/tlnet/archive/forum.doc.r64566.tar.xz -2022/10/02 | 26598 | macros/latex/contrib/univie-ling/doc/univie-ling-expose.tex -2022/10/02 | 26550 | macros/latex/contrib/univie-ling/tex/univie-ling-thesis.cls -2022/10/02 | 2648 | macros/latex/contrib/kdpcover/kdpcover.ins -2022/10/02 | 2645 | macros/latex/contrib/yb-book/yb-book.ins -2022/10/02 | 26128 | macros/latex/contrib/univie-ling/doc/univie-ling-handout.tex -2022/10/02 | 260022 | macros/latex/contrib/kdpcover/kdpcover.pdf -2022/10/02 | 256632 | systems/texlive/tlnet/archive/babel-serbian.doc.r64571.tar.xz -2022/10/02 | 2549080 | systems/texlive/tlnet/archive/crimsonpro.r64565.tar.xz -2022/10/02 | 2496 | macros/latex/contrib/teubner/README -2022/10/02 | 24779 | macros/latex/contrib/univie-ling/tex/univie-ling-paper.cls -2022/10/02 | 24366 | macros/latex/contrib/univie-ling/biblatex-univie-ling/univie-ling.bbx -2022/10/02 | 2258 | macros/latex/contrib/univie-ling/doc/templates/template-wlg-article.tex -2022/10/02 | 21363 | macros/latex/contrib/univie-ling/tex/univie-ling-expose.cls -2022/10/02 | 213588 | systems/texlive/tlnet/archive/ibarra.doc.r64567.tar.xz -2022/10/02 | 200633 | macros/latex/contrib/univie-ling/doc/templates/template-handout-english.pdf -2022/10/02 | 200629 | macros/latex/contrib/univie-ling/doc/templates/template-handout-deutsch.pdf -2022/10/02 | 190297 | macros/latex/contrib/srdp-mathematik.zip -2022/10/02 | 189870 | macros/latex/contrib/univie-ling/doc/templates/template-thesis-deutsch.pdf -2022/10/02 | 1892 | macros/latex/contrib/kdpcover/README.md -2022/10/02 | 1864 | systems/texlive/tlnet/archive/iexec.r64575.tar.xz -2022/10/02 | 186018 | macros/latex/contrib/univie-ling/doc/templates/template-thesis-english.pdf -2022/10/02 | 180179 | macros/latex/contrib/srdp-mathematik/srdp-mathematik.pdf -2022/10/02 | 17998673 | macros/latex/contrib/hvfloat.zip -2022/10/02 | 17873 | macros/latex/contrib/yb-book/yb-book.dtx -2022/10/02 | 173116 | systems/texlive/tlnet/archive/josefin.doc.r64569.tar.xz -2022/10/02 | 171999 | macros/latex/contrib/univie-ling/doc/templates/template-paper-deutsch.pdf -2022/10/02 | 167017 | macros/latex/contrib/univie-ling/doc/templates/template-paper-english.pdf -2022/10/02 | 143300 | systems/texlive/tlnet/archive/imfellenglish.doc.r64568.tar.xz -2022/10/02 | 1419488 | macros/latex/contrib/bibarts.zip -2022/10/02 | 132481 | macros/latex/contrib/univie-ling/doc/templates/template-expose-deutsch.pdf -2022/10/02 | 12878 | macros/latex/contrib/univie-ling/doc/univie-ling-wlg.tex -2022/10/02 | 1279 | macros/latex/contrib/yb-book/README.md -2022/10/02 | 127717 | macros/latex/contrib/univie-ling/doc/templates/template-expose-english.pdf -2022/10/02 | 12745 | macros/latex/contrib/kdpcover/kdpcover.dtx -2022/10/02 | 117 | macros/latex/contrib/kdpcover/DEPENDS.txt -2022/10/02 | 1106004 | systems/texlive/tlnet/archive/ibarra.r64567.tar.xz -2022/10/02 | 1097100 | systems/texlive/tlnet/archive/josefin.r64569.tar.xz -2022/10/02 | 1083 | macros/latex/contrib/yb-book/LICENSE.txt -2022/10/02 | 1083 | macros/latex/contrib/kdpcover/LICENSE.txt diff --git a/biblio/ctan-bibdata/ctan.bib b/biblio/ctan-bibdata/ctan.bib index a62eb46a90..950aa4786a 100644 --- a/biblio/ctan-bibdata/ctan.bib +++ b/biblio/ctan-bibdata/ctan.bib @@ -1,7 +1,7 @@ %% bib file of all CTAN packages %% (C) Herbert Voß %% -%% created at 09-10-2022, 02:00:19 +%% created at 10-10-2022, 02:00:14 %% %% This file is provided under the terms of the LPPL v1.3 or @@ -116,7 +116,7 @@ pkgurl = {https://ctan.org/pkg/aaai}, } -@manual{Aalok, +@manual{aalok, title = {The \texttt{Aalok} package}, subtitle = {LaTeX class file for the Marathi journal ‘Aalok’}, author = {{Unknown}}, @@ -124,7 +124,7 @@ version = {0.6}, license = {gpl3+,other-free,fdl}, url = {https://mirror.ctan.org/macros/unicodetex/latex/aalok}, - pkgurl = {https://ctan.org/pkg/Aalok}, + pkgurl = {https://ctan.org/pkg/aalok}, } @manual{aastex, @@ -231,7 +231,7 @@ pkgurl = {https://ctan.org/pkg/abntexto}, } -@manual{Aboensis, +@manual{aboensis, title = {The \texttt{Aboensis} package}, subtitle = {A late medieval OpenType cursive font}, author = {Tommi Syrjänen}, @@ -239,7 +239,7 @@ version = {}, license = {ofl,lppl1.3c,cc-by-4,pd}, url = {https://mirror.ctan.org/fonts/aboensis}, - pkgurl = {https://ctan.org/pkg/Aboensis}, + pkgurl = {https://ctan.org/pkg/aboensis}, } @manual{abraces, @@ -555,7 +555,7 @@ thereafter.}, } -@manual{AcroMemory, +@manual{acromemory, title = {The \texttt{AcroMemory} package}, subtitle = {Memory games in \LaTeX{}}, author = {Donald P. Story}, @@ -563,7 +563,7 @@ version = {}, license = {lppl1.2}, url = {https://mirror.ctan.org/macros/latex/contrib/aeb_pro/acromemory}, - pkgurl = {https://ctan.org/pkg/AcroMemory}, + pkgurl = {https://ctan.org/pkg/acromemory}, } @manual{acronym, @@ -599,7 +599,7 @@ pkgurl = {https://ctan.org/pkg/acroreloadpdf}, } -@manual{AcroSort, +@manual{acrosort, title = {The \texttt{AcroSort} package}, subtitle = {Sort sliced image into order}, author = {Donald P. Story}, @@ -607,7 +607,7 @@ version = {1.6.1}, license = {lppl}, url = {https://mirror.ctan.org/macros/latex/contrib/aeb_pro/acrosort}, - pkgurl = {https://ctan.org/pkg/AcroSort}, + pkgurl = {https://ctan.org/pkg/acrosort}, } @manual{acroterm, @@ -806,7 +806,7 @@ pkgurl = {https://ctan.org/pkg/address}, } -@manual{AddTeX2Eps, +@manual{addtex2eps, title = {The \texttt{AddTeX2Eps} package}, subtitle = {Use \LaTeX{} syntax on EPS figures, within Mathematica}, author = {Janko SlaviÄ}, @@ -814,7 +814,7 @@ version = {1.15}, license = {lppl}, url = {https://mirror.ctan.org/graphics/AddTeX2Eps}, - pkgurl = {https://ctan.org/pkg/AddTeX2Eps}, + pkgurl = {https://ctan.org/pkg/addtex2eps}, note = {This Mathematica script permits the user to write commands at the same place as the fragments for replacement are defined.}, @@ -1035,7 +1035,7 @@ pkgurl = {https://ctan.org/pkg/aeb-mobile}, } -@manual{AeB_Pro, +@manual{aeb-pro, title = {The \texttt{AeB Pro} package}, subtitle = {Items from the AeB Pro Family of Software}, author = {Donald P. Story}, @@ -1043,6 +1043,7 @@ version = {}, license = {lppl1.2}, url = {https://mirror.ctan.org/macros/latex/contrib/aeb_pro/aeb_pro}, + pkgurl = {https://ctan.org/pkg/aeb-pro}, } @manual{aeb-tilebg, @@ -1090,7 +1091,7 @@ distiller.}, } -@manual{AeB_slicing, +@manual{aebslicing, title = {The \texttt{AeB slicing} package}, subtitle = {An image slicer}, author = {Donald P. Story}, @@ -1098,9 +1099,10 @@ version = {1.0}, license = {lppl}, url = {https://mirror.ctan.org/macros/latex/contrib/aeb_pro/aebslicing}, + pkgurl = {https://ctan.org/pkg/aebslicing}, } -@manual{aebXMP, +@manual{aebxmp, title = {The \texttt{aebXMP} package}, subtitle = {Add advanced metadata to PDF files}, author = {Donald P. Story}, @@ -1108,7 +1110,7 @@ version = {}, license = {lppl1.2,lppl1.2}, url = {https://mirror.ctan.org/macros/latex/contrib/aeb_pro/aebxmp}, - pkgurl = {https://ctan.org/pkg/aebXMP}, + pkgurl = {https://ctan.org/pkg/aebxmp}, } @manual{aecc, @@ -1149,7 +1151,7 @@ pkgurl = {https://ctan.org/pkg/aesupp}, } -@manual{AFMtoPL_-Clark-, +@manual{afmtopl-clark, title = {The \texttt{AFMtoPL (Clark)} package}, subtitle = {Convert AFM files to PLs for use with dvitops}, author = {James Clark}, @@ -1157,12 +1159,13 @@ version = {}, license = {noinfo}, url = {https://mirror.ctan.org/fonts/utilities/afmtopl/clark}, + pkgurl = {https://ctan.org/pkg/afmtopl-clark}, note = {A converter that does not (as a modern application would) provide for use of virtual fonts. The conversion is tailored to work with the author's .}, } -@manual{AFMtoPL_-Elwell-, +@manual{afmtopl-elwell, title = {The \texttt{AFMtoPL (Elwell)} package}, subtitle = {An early converter from AFM to PL}, author = {Clayton M. Elwell}, @@ -1170,9 +1173,10 @@ version = {}, license = {noinfo}, url = {https://mirror.ctan.org/fonts/utilities/afmtopl/elwell}, + pkgurl = {https://ctan.org/pkg/afmtopl-elwell}, } -@manual{AFMtopl_-Wolczko-, +@manual{afmtopl-wolczko, title = {The \texttt{AFMtopl (Wolczko)} package}, subtitle = {Unix utilities for translating AFM files to PL}, author = {Mario Wolczko}, @@ -1180,6 +1184,7 @@ version = {}, license = {noinfo}, url = {https://mirror.ctan.org/fonts/utilities/afmtopl/wolczko}, + pkgurl = {https://ctan.org/pkg/afmtopl-wolczko}, } @manual{afparticle, @@ -1292,7 +1297,7 @@ pkgurl = {https://ctan.org/pkg/ajl}, } -@manual{AkkTeX, +@manual{akktex, title = {The \texttt{AkkTeX} package}, subtitle = {A collection of packages and classes}, author = {Igor Akkerman}, @@ -1300,7 +1305,7 @@ version = {0.3.2}, license = {lppl}, url = {https://mirror.ctan.org/macros/latex/contrib/akktex}, - pkgurl = {https://ctan.org/pkg/AkkTeX}, + pkgurl = {https://ctan.org/pkg/akktex}, } @manual{akletter, @@ -1383,7 +1388,7 @@ pkgurl = {https://ctan.org/pkg/alertmessage}, } -@manual{AlfaSlabOne, +@manual{alfaslabone, title = {The \texttt{AlfaSlabOne} package}, subtitle = {The Alfa Slab One font face with support for \LaTeX{} and pdfLaTeX}, author = {Carl-Clemens Ebinger}, @@ -1391,7 +1396,7 @@ version = {0.0.1}, license = {ofl}, url = {https://mirror.ctan.org/fonts/alfaslabone}, - pkgurl = {https://ctan.org/pkg/AlfaSlabOne}, + pkgurl = {https://ctan.org/pkg/alfaslabone}, } @manual{alg, @@ -2305,7 +2310,7 @@ pkgurl = {https://ctan.org/pkg/anonymous-acm}, } -@manual{AnonymousPro, +@manual{anonymouspro, title = {The \texttt{AnonymousPro} package}, subtitle = {Use AnonymousPro fonts with \LaTeX{}}, author = {Arash Esbati}, @@ -2313,7 +2318,7 @@ version = {2.2}, license = {lppl1.3c}, url = {https://mirror.ctan.org/fonts/anonymouspro}, - pkgurl = {https://ctan.org/pkg/AnonymousPro}, + pkgurl = {https://ctan.org/pkg/anonymouspro}, } @manual{ans, @@ -2438,14 +2443,14 @@ encodings, to be used with \LaTeX{}2e.}, } -@manual{ANUfinalexam, +@manual{anufinalexam, title = {The \texttt{ANUfinalexam} package}, subtitle = {LaTeX document shell for ANU final exam}, author = {Timothy Kam}, date = {2018-01-06}, license = {gpl}, url = {https://mirror.ctan.org/macros/latex/contrib/anufinalexam}, - pkgurl = {https://ctan.org/pkg/ANUfinalexam}, + pkgurl = {https://ctan.org/pkg/anufinalexam}, } @manual{anyfontsize, @@ -2988,7 +2993,7 @@ pkgurl = {https://ctan.org/pkg/archaic}, } -@manual{Archivo, +@manual{archivo, title = {The \texttt{Archivo} package}, subtitle = {The Archivo font face with support for \LaTeX{} and pdfLaTeX}, author = {Carl-Clemens Ebinger}, @@ -2996,7 +3001,7 @@ version = {0.0.2}, license = {ofl,lppl}, url = {https://mirror.ctan.org/fonts/archivo}, - pkgurl = {https://ctan.org/pkg/Archivo}, + pkgurl = {https://ctan.org/pkg/archivo}, } @manual{arcs, @@ -3178,7 +3183,7 @@ pkgurl = {https://ctan.org/pkg/arrayjobx}, } -@manual{Array_Maker, +@manual{arraymaker, title = {The \texttt{Array Maker} package}, subtitle = {A program for making \LaTeX{} and xypic arrays}, author = {Donu Arapura}, @@ -3186,6 +3191,7 @@ version = {}, license = {other-free}, url = {https://mirror.ctan.org/support/arraymaker}, + pkgurl = {https://ctan.org/pkg/arraymaker}, note = {This program is designed to take some of the tedium out of constructing arrays, diagrams and tables. \LaTeX{} code is entered into boxes and the program outputs an array that can be pasted @@ -3221,7 +3227,7 @@ in support of its aim of working within \LaTeX{} documents.}, } -@manual{ArsClassica, +@manual{arsclassica, title = {The \texttt{ArsClassica} package}, subtitle = {A different view of the ClassicThesis package}, author = {Lorenzo Pantieri}, @@ -3229,7 +3235,7 @@ version = {}, license = {lppl}, url = {https://mirror.ctan.org/macros/latex/contrib/arsclassica}, - pkgurl = {https://ctan.org/pkg/ArsClassica}, + pkgurl = {https://ctan.org/pkg/arsclassica}, note = {The package changes some typographical points of the ClassicThesis style, by André Miede. It enables the user to reproduce the look of the guide @@ -3284,7 +3290,7 @@ pkgurl = {https://ctan.org/pkg/artthreads}, } -@manual{Arvo, +@manual{arvo, title = {The \texttt{Arvo} package}, subtitle = {The Arvo font face with support for \LaTeX{} and pdfLaTeX}, author = {Carl-Clemens Ebinger}, @@ -3292,10 +3298,10 @@ version = {}, license = {ofl,lppl}, url = {https://mirror.ctan.org/fonts/arvo}, - pkgurl = {https://ctan.org/pkg/Arvo}, + pkgurl = {https://ctan.org/pkg/arvo}, } -@manual{arXivBib, +@manual{arxivbib, title = {The \texttt{arXivBib} package}, subtitle = {Get bibliography entries from arXiv.org}, author = {John Forkosh}, @@ -3303,7 +3309,7 @@ version = {1.00}, license = {gpl}, url = {https://mirror.ctan.org/support/arxivbib}, - pkgurl = {https://ctan.org/pkg/arXivBib}, + pkgurl = {https://ctan.org/pkg/arxivbib}, } @manual{arydshln, @@ -3638,7 +3644,7 @@ pkgurl = {https://ctan.org/pkg/asymptote}, } -@manual{asypictureB, +@manual{asypictureb, title = {The \texttt{asypictureB} package}, subtitle = {User-friendly integration of Asymptote into \LaTeX{}}, author = {Charles Staats III}, @@ -3646,7 +3652,7 @@ version = {0.3}, license = {lppl1.3}, url = {https://mirror.ctan.org/graphics/asypictureb}, - pkgurl = {https://ctan.org/pkg/asypictureB}, + pkgurl = {https://ctan.org/pkg/asypictureb}, } @manual{at, @@ -3998,7 +4004,7 @@ package}, } -@manual{AutoLaTeX, +@manual{autolatex, title = {The \texttt{AutoLaTeX} package}, subtitle = {Automate compilation of large scale \LaTeX{} projects}, author = {Stéphane Galland}, @@ -4006,7 +4012,7 @@ version = {41.1}, license = {gpl2}, url = {https://mirror.ctan.org/support/autolatex}, - pkgurl = {https://ctan.org/pkg/AutoLaTeX}, + pkgurl = {https://ctan.org/pkg/autolatex}, } @manual{autolist, @@ -5485,7 +5491,7 @@ pkgurl = {https://ctan.org/pkg/basicarith}, } -@manual{BasicLaTeX-ru, +@manual{basiclatex-ru, title = {The \texttt{BasicLaTeX-ru} package}, subtitle = {An introduction to \LaTeX{}, in Russian}, author = {Alexey Kuznetsov}, @@ -5493,7 +5499,7 @@ version = {1.0}, license = {cc-by-nc-sa4}, url = {https://mirror.ctan.org/info/russian/basiclatex-ru}, - pkgurl = {https://ctan.org/pkg/BasicLaTeX-ru}, + pkgurl = {https://ctan.org/pkg/basiclatex-ru}, } @manual{basix, @@ -6088,7 +6094,7 @@ It is suitable for both presentations and posters.}, } -@manual{Beamertheme-SimpleDarkBlue, +@manual{beamertheme-simpledarkblue, title = {The \texttt{Beamertheme-SimpleDarkBlue} package}, subtitle = {Template for a simple presentation}, author = {Pin-Yen Huang}, @@ -6096,7 +6102,7 @@ version = {}, license = {pd}, url = {https://mirror.ctan.org/macros/latex/contrib/beamer-contrib/themes/beamertheme-simpledarkblue}, - pkgurl = {https://ctan.org/pkg/Beamertheme-SimpleDarkBlue}, + pkgurl = {https://ctan.org/pkg/beamertheme-simpledarkblue}, } @manual{beamertheme-tcolorbox, @@ -6136,7 +6142,7 @@ pkgurl = {https://ctan.org/pkg/beamertheme-upenn-bc}, } -@manual{beamerthemeAmurmaple, +@manual{beamerthemeamurmaple, title = {The \texttt{beamerthemeAmurmaple} package}, subtitle = {A new modern beamer theme}, author = {Maxime Chupin}, @@ -6144,10 +6150,10 @@ version = {1.1}, license = {lppl1.3}, url = {https://mirror.ctan.org/macros/latex/contrib/beamer-contrib/themes/beamerthemeamurmaple}, - pkgurl = {https://ctan.org/pkg/beamerthemeAmurmaple}, + pkgurl = {https://ctan.org/pkg/beamerthemeamurmaple}, } -@manual{beamerthemeJLTree, +@manual{beamerthemejltree, title = {The \texttt{beamerthemeJLTree} package}, subtitle = {Contributed beamer theme}, author = {Jérôme Lelong}, @@ -6155,7 +6161,7 @@ version = {1.1}, license = {gpl}, url = {https://mirror.ctan.org/macros/latex/contrib/beamer-contrib/themes/beamerthemeJLTree.sty}, - pkgurl = {https://ctan.org/pkg/beamerthemeJLTree}, + pkgurl = {https://ctan.org/pkg/beamerthemejltree}, note = {A theme for presentations.}, } @@ -6181,7 +6187,7 @@ pkgurl = {https://ctan.org/pkg/beamerthemenirma}, } -@manual{beamerthemeNord, +@manual{beamerthemenord, title = {The \texttt{beamerthemeNord} package}, subtitle = {A simple beamer theme using the “Nord†color theme}, author = {Junwei Wang}, @@ -6189,7 +6195,7 @@ version = {0.2.0}, license = {lppl1.3c}, url = {https://mirror.ctan.org/macros/latex/contrib/beamer-contrib/themes/beamerthemenord}, - pkgurl = {https://ctan.org/pkg/beamerthemeNord}, + pkgurl = {https://ctan.org/pkg/beamerthemenord}, note = {This package provides a simple beamer theme using the color theme.}, } @@ -6229,7 +6235,7 @@ pkgurl = {https://ctan.org/pkg/beaulivre}, } -@manual{Beebe-DVI, +@manual{beebe-dvi, title = {The \texttt{Beebe-DVI} package}, subtitle = {A modular collection of DVI processors}, author = {Nelson H. F. Beebe}, @@ -6237,7 +6243,7 @@ version = {}, license = {noinfo}, url = {https://mirror.ctan.org/dviware/beebe}, - pkgurl = {https://ctan.org/pkg/Beebe-DVI}, + pkgurl = {https://ctan.org/pkg/beebe-dvi}, } @manual{begingreek, @@ -6319,7 +6325,7 @@ pkgurl = {https://ctan.org/pkg/bellmac}, } -@manual{Bengali_Omega, +@manual{bengali-omega, title = {The \texttt{Bengali Omega} package}, subtitle = {Bengali in Velthuis transliteration or in UTF-8}, author = {Lakshmi K. Raut}, @@ -6327,6 +6333,7 @@ version = {1.0}, license = {lppl}, url = {https://mirror.ctan.org/macros/omega/latex/contrib/bengali-omega}, + pkgurl = {https://ctan.org/pkg/bengali-omega}, } @manual{bengali-pandey, @@ -6537,7 +6544,7 @@ pkgurl = {https://ctan.org/pkg/bguq}, } -@manual{BHCexam, +@manual{bhcexam, title = {The \texttt{BHCexam} package}, subtitle = {An exam class for mathematics teachers in China}, author = {Hongchang Bao}, @@ -6545,7 +6552,7 @@ version = {1.7}, license = {lppl1.3}, url = {https://mirror.ctan.org/macros/xetex/latex/bhcexam}, - pkgurl = {https://ctan.org/pkg/BHCexam}, + pkgurl = {https://ctan.org/pkg/bhcexam}, } @manual{bib-fr, @@ -6613,7 +6620,7 @@ pkgurl = {https://ctan.org/pkg/bib2xhtml}, } -@manual{BibArts, +@manual{bibarts, title = {The \texttt{BibArts} package}, subtitle = {“Artsâ€-style bibliographical information}, author = {Timo Baumann}, @@ -6621,7 +6628,7 @@ version = {2.5}, license = {gpl}, url = {https://mirror.ctan.org/macros/latex/contrib/bibarts}, - pkgurl = {https://ctan.org/pkg/BibArts}, + pkgurl = {https://ctan.org/pkg/bibarts}, } @manual{bibbuild, @@ -6842,14 +6849,14 @@ pkgurl = {https://ctan.org/pkg/biber}, } -@manual{Bibex, +@manual{bibex, title = {The \texttt{Bibex} package}, subtitle = {Automatic extraction of references from BibTeX databases}, author = {Yann-Gaël Guéhéneuc}, date = {2016-06-24}, license = {gpl}, url = {https://mirror.ctan.org/support/bibex}, - pkgurl = {https://ctan.org/pkg/Bibex}, + pkgurl = {https://ctan.org/pkg/bibex}, note = {Bibex, BibTeX Extractor, is a 100\%-pure Java program that automates the extraction of bibliographic references from BibTeX databases using regular expressions. Using the Bibex user @@ -7801,7 +7808,7 @@ requires .}, } -@manual{BibLaTeX, +@manual{biblatex, title = {The \texttt{BibLaTeX} package}, subtitle = {Sophisticated Bibliographies in \LaTeX{}}, author = {Philipp Lehman and Philip Kime}, @@ -7809,7 +7816,7 @@ version = {3.18b}, license = {lppl1.3}, url = {https://mirror.ctan.org/macros/latex/contrib/biblatex}, - pkgurl = {https://ctan.org/pkg/BibLaTeX}, + pkgurl = {https://ctan.org/pkg/biblatex}, } @manual{biblatex2bibitem, @@ -7823,7 +7830,7 @@ pkgurl = {https://ctan.org/pkg/biblatex2bibitem}, } -@manual{BiBLE, +@manual{bible, title = {The \texttt{BiBLE} package}, subtitle = {A BibTeX library editor}, author = {Kai Schreiber}, @@ -7831,7 +7838,7 @@ version = {0.99}, license = {other-free}, url = {https://mirror.ctan.org/biblio/bibtex/utils/bible}, - pkgurl = {https://ctan.org/pkg/BiBLE}, + pkgurl = {https://ctan.org/pkg/bible}, } @manual{bibleref-french, @@ -8021,7 +8028,7 @@ pkgurl = {https://ctan.org/pkg/bibsort}, } -@manual{BibTeX-examples, +@manual{bibtex-examples, title = {The \texttt{BibTeX-examples} package}, subtitle = {Examples of BibTeX usage}, author = {Nelson H. F. Beebe}, @@ -8029,19 +8036,20 @@ version = {}, license = {noinfo}, url = {https://mirror.ctan.org/biblio/bibtex/contrib/examples}, - pkgurl = {https://ctan.org/pkg/BibTeX-examples}, + pkgurl = {https://ctan.org/pkg/bibtex-examples}, } -@manual{BibTeX_Database_Generator, +@manual{bibtex-gen, title = {The \texttt{BibTeX Database Generator} package}, subtitle = {A simple interactive script to generate BibTeX Files}, author = {Pallav Gupta}, date = {2016-06-24}, license = {pd}, url = {https://mirror.ctan.org/support/bibtex-gen}, + pkgurl = {https://ctan.org/pkg/bibtex-gen}, } -@manual{BibTeX-help, +@manual{bibtex-help, title = {The \texttt{BibTeX-help} package}, subtitle = {VMS help file for BibTeX}, author = {George Greenwade}, @@ -8049,7 +8057,7 @@ version = {}, license = {noinfo}, url = {https://mirror.ctan.org/info/bibtex/bibtex.hlp}, - pkgurl = {https://ctan.org/pkg/BibTeX-help}, + pkgurl = {https://ctan.org/pkg/bibtex-help}, } @manual{bibtex-test, @@ -8085,7 +8093,7 @@ pkgurl = {https://ctan.org/pkg/bibtex8}, } -@manual{BibTexMng, +@manual{bibtexmng, title = {The \texttt{BibTexMng} package}, subtitle = {Manipulate BibTeX database files}, author = {{VNP Comp}}, @@ -8093,7 +8101,7 @@ version = {6.0}, license = {shareware}, url = {https://mirror.ctan.org/biblio/bibtex/utils/BibTexMng}, - pkgurl = {https://ctan.org/pkg/BibTexMng}, + pkgurl = {https://ctan.org/pkg/bibtexmng}, } @manual{bibtexperllibs, @@ -8118,7 +8126,7 @@ pkgurl = {https://ctan.org/pkg/bibtexu}, } -@manual{BibTool, +@manual{bibtool, title = {The \texttt{BibTool} package}, subtitle = {A tool for manipulating BibTeX files}, author = {Gerd Neugebauer}, @@ -8126,7 +8134,7 @@ version = {2.68}, license = {gpl2,cc-by-sa-3,mit,pd}, url = {https://mirror.ctan.org/biblio/bibtex/utils/bibtool}, - pkgurl = {https://ctan.org/pkg/BibTool}, + pkgurl = {https://ctan.org/pkg/bibtool}, } @manual{bibtools, @@ -8565,7 +8573,7 @@ pkgurl = {https://ctan.org/pkg/biolist}, } -@manual{Birkhaeuser, +@manual{birkhaeuser, title = {The \texttt{Birkhaeuser} package}, subtitle = {Style for Birkhaeuser books, conference proceedings, etc}, author = {Silvano Balemi}, @@ -8573,7 +8581,7 @@ version = {}, license = {noinfo}, url = {https://mirror.ctan.org/macros/latex209/contrib/birkhaeuser}, - pkgurl = {https://ctan.org/pkg/Birkhaeuser}, + pkgurl = {https://ctan.org/pkg/birkhaeuser}, } @manual{bit2spr, @@ -9735,14 +9743,14 @@ pkgurl = {https://ctan.org/pkg/bsl}, } -@manual{BSR2dvi, +@manual{bsr2dvi, title = {The \texttt{BSR2dvi} package}, subtitle = {Convert a TeXtures working file to DVI}, author = {Laurent Siebenmann}, date = {2016-06-24}, license = {other-free}, url = {https://mirror.ctan.org/dviware/BSR2dvi}, - pkgurl = {https://ctan.org/pkg/BSR2dvi}, + pkgurl = {https://ctan.org/pkg/bsr2dvi}, } @manual{btable, @@ -9756,7 +9764,7 @@ pkgurl = {https://ctan.org/pkg/btable}, } -@manual{btOOL, +@manual{btool, title = {The \texttt{btOOL} package}, subtitle = {Perl library for parsing and processing BibTeX files}, author = {Greg Ward}, @@ -9764,7 +9772,7 @@ version = {0.32}, license = {gpl}, url = {https://mirror.ctan.org/biblio/bibtex/utils/btOOL}, - pkgurl = {https://ctan.org/pkg/btOOL}, + pkgurl = {https://ctan.org/pkg/btool}, } @manual{bubblesort, @@ -9784,7 +9792,7 @@ and applies the same permutation to a second list.}, } -@manual{BUCTthesis, +@manual{buctthesis, title = {The \texttt{BUCTthesis} package}, subtitle = {Beijing University of Chemical Technology Thesis Template}, author = {{Unknown}}, @@ -9792,7 +9800,7 @@ version = {1.4.1}, license = {lppl1.3c}, url = {https://mirror.ctan.org/macros/xetex/latex/buctthesis}, - pkgurl = {https://ctan.org/pkg/BUCTthesis}, + pkgurl = {https://ctan.org/pkg/buctthesis}, } @manual{bullcntr, @@ -9890,7 +9898,7 @@ pkgurl = {https://ctan.org/pkg/bussproofs}, } -@manual{BXbase, +@manual{bxbase, title = {The \texttt{BXbase} package}, subtitle = {BX bundle base components}, author = {Takayuki Yato}, @@ -9898,7 +9906,7 @@ version = {1.2}, license = {mit}, url = {https://mirror.ctan.org/language/japanese/BX/bxbase}, - pkgurl = {https://ctan.org/pkg/BXbase}, + pkgurl = {https://ctan.org/pkg/bxbase}, } @manual{bxcalc, @@ -9969,7 +9977,7 @@ pkgurl = {https://ctan.org/pkg/bxenclose}, } -@manual{BXghost, +@manual{bxghost, title = {The \texttt{BXghost} package}, subtitle = {Ghost insertion for proper xkanjiskip}, author = {Takuto Asakura}, @@ -9977,10 +9985,10 @@ version = {0.5.0}, license = {mit}, url = {https://mirror.ctan.org/language/japanese/BX/bxghost}, - pkgurl = {https://ctan.org/pkg/BXghost}, + pkgurl = {https://ctan.org/pkg/bxghost}, } -@manual{BXjaholiday, +@manual{bxjaholiday, title = {The \texttt{BXjaholiday} package}, subtitle = {Support for Japanese holidays}, author = {Takuto Asakura}, @@ -9988,10 +9996,10 @@ version = {1.1.1}, license = {mit}, url = {https://mirror.ctan.org/language/japanese/BX/bxjaholiday}, - pkgurl = {https://ctan.org/pkg/BXjaholiday}, + pkgurl = {https://ctan.org/pkg/bxjaholiday}, } -@manual{BXjalipsum, +@manual{bxjalipsum, title = {The \texttt{BXjalipsum} package}, subtitle = {Dummy text in Japanese}, author = {Takayuki Yato}, @@ -9999,10 +10007,10 @@ version = {0.3a}, license = {mit}, url = {https://mirror.ctan.org/language/japanese/BX/bxjalipsum}, - pkgurl = {https://ctan.org/pkg/BXjalipsum}, + pkgurl = {https://ctan.org/pkg/bxjalipsum}, } -@manual{BXjaprnind, +@manual{bxjaprnind, title = {The \texttt{BXjaprnind} package}, subtitle = {Adjust the position of parentheses at paragraph head}, author = {Takayuki Yato}, @@ -10010,7 +10018,7 @@ version = {0.4a}, license = {mit}, url = {https://mirror.ctan.org/language/japanese/BX/bxjaprnind}, - pkgurl = {https://ctan.org/pkg/BXjaprnind}, + pkgurl = {https://ctan.org/pkg/bxjaprnind}, } @manual{bxjatoucs, @@ -10024,7 +10032,7 @@ pkgurl = {https://ctan.org/pkg/bxjatoucs}, } -@manual{BXjscls, +@manual{bxjscls, title = {The \texttt{BXjscls} package}, subtitle = {Japanese document class collection for all major engines}, author = {Takayuki Yato}, @@ -10032,7 +10040,7 @@ version = {2.7a}, license = {bsd2}, url = {https://mirror.ctan.org/language/japanese/BX/bxjscls}, - pkgurl = {https://ctan.org/pkg/BXjscls}, + pkgurl = {https://ctan.org/pkg/bxjscls}, note = {This package provides an extended version of the Japanese document class collection provided by . @@ -10335,7 +10343,7 @@ pkgurl = {https://ctan.org/pkg/calculator}, } -@manual{calendar-Barr, +@manual{calendar-barr, title = {The \texttt{calendar-Barr} package}, subtitle = {A calendar document}, author = {Michael Barr}, @@ -10343,7 +10351,7 @@ version = {}, license = {noinfo}, url = {https://mirror.ctan.org/macros/latex/contrib/calendar_barr}, - pkgurl = {https://ctan.org/pkg/calendar-Barr}, + pkgurl = {https://ctan.org/pkg/calendar-barr}, } @manual{calendar, @@ -10704,7 +10712,7 @@ pkgurl = {https://ctan.org/pkg/cascade}, } -@manual{CascadiaCode, +@manual{cascadia-code, title = {The \texttt{CascadiaCode} package}, subtitle = {The Cascadia Code font with support for \LaTeX{} and pdfLaTeX}, author = {Carl-Clemens Ebinger}, @@ -10712,7 +10720,7 @@ version = {0.0.1}, license = {ofl,lppl}, url = {https://mirror.ctan.org/fonts/cascadia-code}, - pkgurl = {https://ctan.org/pkg/CascadiaCode}, + pkgurl = {https://ctan.org/pkg/cascadia-code}, } @manual{cascadilla, @@ -10842,13 +10850,13 @@ pkgurl = {https://ctan.org/pkg/catalanbib}, } -@manual{Catalogue, +@manual{catalogue, title = {The \texttt{Catalogue} package}, subtitle = {A catalogue of what’s available on CTAN}, author = {Graham Williams and {The CTAN Team}}, date = {2017-02-08}, license = {lppl}, - pkgurl = {https://ctan.org/pkg/Catalogue}, + pkgurl = {https://ctan.org/pkg/catalogue}, } @manual{catchfile, @@ -11084,14 +11092,14 @@ pkgurl = {https://ctan.org/pkg/ccicons}, } -@manual{CClicenses, +@manual{cclicenses, title = {The \texttt{CClicenses} package}, subtitle = {Typeset Creative Commons licence logos}, author = {Gianluca Pignalberi}, date = {2016-06-24}, license = {lppl}, url = {https://mirror.ctan.org/macros/latex/contrib/cclicenses}, - pkgurl = {https://ctan.org/pkg/CClicenses}, + pkgurl = {https://ctan.org/pkg/cclicenses}, } @manual{ccool, @@ -11167,7 +11175,7 @@ pkgurl = {https://ctan.org/pkg/cdlabeler}, } -@manual{C.D.P._Bundle, +@manual{cdpbundl, title = {The \texttt{C.D.P. Bundle} package}, subtitle = {Business letters in the Italian style}, author = {Gustavo Mezzetti}, @@ -11175,6 +11183,7 @@ version = {0.36d}, license = {lppl}, url = {https://mirror.ctan.org/macros/latex/contrib/cdpbundl}, + pkgurl = {https://ctan.org/pkg/cdpbundl}, } @manual{cea, @@ -11483,7 +11492,7 @@ pkgurl = {https://ctan.org/pkg/chapterfolder}, } -@manual{CharisSIL, +@manual{charissil, title = {The \texttt{CharisSIL} package}, subtitle = {CharisSIL fonts with support for all \LaTeX{} engines}, author = {Bob Tennent}, @@ -11491,7 +11500,7 @@ version = {6.101}, license = {ofl,lppl}, url = {https://mirror.ctan.org/fonts/charissil}, - pkgurl = {https://ctan.org/pkg/CharisSIL}, + pkgurl = {https://ctan.org/pkg/charissil}, } @manual{charter, @@ -11764,7 +11773,7 @@ title = {The \texttt{chemobabel} package}, subtitle = {Convert chemical structures from ChemDraw, MDL molfile or SMILES using Open Babel}, author = {Hironobu Yamashita}, - date = {2022-09-24}, + date = {2022-10-09}, version = {}, license = {bsd2}, url = {https://mirror.ctan.org/graphics/chemobabel}, @@ -12097,7 +12106,7 @@ pkgurl = {https://ctan.org/pkg/china2e}, } -@manual{ChineseJFM, +@manual{chinese-jfm, title = {The \texttt{ChineseJFM} package}, subtitle = {Luatexja-jfm files for Chinese typesetting}, author = {{Unknown}}, @@ -12105,7 +12114,7 @@ version = {1.1.1}, license = {mit}, url = {https://mirror.ctan.org/macros/luatex/generic/chinese-jfm}, - pkgurl = {https://ctan.org/pkg/ChineseJFM}, + pkgurl = {https://ctan.org/pkg/chinese-jfm}, note = {ChineseJFM is a series of luatexja-jfm files for better Chinese typesetting, providing , , and three styles and other fancy features. It can be used for both horizontal and @@ -12136,7 +12145,7 @@ pkgurl = {https://ctan.org/pkg/chitex}, } -@manual{Chivo, +@manual{chivo, title = {The \texttt{Chivo} package}, subtitle = {Using the free Chivo fonts with \LaTeX{}}, author = {Arash Esbati}, @@ -12144,7 +12153,7 @@ version = {2.1}, license = {ofl,lppl1.3c}, url = {https://mirror.ctan.org/fonts/chivo}, - pkgurl = {https://ctan.org/pkg/Chivo}, + pkgurl = {https://ctan.org/pkg/chivo}, } @manual{chkfloat, @@ -12420,7 +12429,7 @@ pkgurl = {https://ctan.org/pkg/circuit-macros}, } -@manual{CircuiTikZ, +@manual{circuitikz, title = {The \texttt{CircuiTikZ} package}, subtitle = {Draw electrical networks with TikZ}, author = {Massimo Redaelli and Stefan Lindner and Stefan Erhardt and Romano Giannetti}, @@ -12428,7 +12437,7 @@ version = {1.5.4}, license = {lppl,gpl}, url = {https://mirror.ctan.org/graphics/pgf/contrib/circuitikz}, - pkgurl = {https://ctan.org/pkg/CircuiTikZ}, + pkgurl = {https://ctan.org/pkg/circuitikz}, } @manual{cirth, @@ -12526,14 +12535,14 @@ pkgurl = {https://ctan.org/pkg/citesidx}, } -@manual{CJ, +@manual{cj, title = {The \texttt{CJ} package}, subtitle = {BibTeX style for Computer Journal}, author = {Felix Gärtner}, date = {2016-06-24}, license = {gpl}, url = {https://mirror.ctan.org/biblio/bibtex/contrib/misc/cj.bst}, - pkgurl = {https://ctan.org/pkg/CJ}, + pkgurl = {https://ctan.org/pkg/cj}, } @manual{cje, @@ -12552,7 +12561,7 @@ authors will receive for approval).}, } -@manual{CJHebrew, +@manual{cjhebrew, title = {The \texttt{CJHebrew} package}, subtitle = {Typeset Hebrew with \LaTeX{}}, author = {Christian Justen}, @@ -12560,7 +12569,7 @@ version = {0.2a}, license = {lppl}, url = {https://mirror.ctan.org/language/hebrew/cjhebrew}, - pkgurl = {https://ctan.org/pkg/CJHebrew}, + pkgurl = {https://ctan.org/pkg/cjhebrew}, } @manual{cjk-fonts, @@ -12687,7 +12696,7 @@ pkgurl = {https://ctan.org/pkg/classics}, } -@manual{ClassicThesis, +@manual{classicthesis, title = {The \texttt{ClassicThesis} package}, subtitle = {A “classically styled†thesis package}, author = {André Miede}, @@ -12695,7 +12704,7 @@ version = {4.6}, license = {gpl2+}, url = {https://mirror.ctan.org/macros/latex/contrib/classicthesis}, - pkgurl = {https://ctan.org/pkg/ClassicThesis}, + pkgurl = {https://ctan.org/pkg/classicthesis}, } @manual{classif2, @@ -13417,7 +13426,7 @@ pkgurl = {https://ctan.org/pkg/cmtt}, } -@manual{CM_Type3, +@manual{cmtype3, title = {The \texttt{CM Type3} package}, subtitle = {Type 3 outline versions of the CM fonts}, author = {Graham Toal}, @@ -13425,6 +13434,7 @@ version = {}, license = {noinfo}, url = {https://mirror.ctan.org/fonts/cm/ps-type3}, + pkgurl = {https://ctan.org/pkg/cmtype3}, } @manual{cmupint, @@ -14189,7 +14199,7 @@ for making commutative diagrams easy to design, parse and tweak.}, } -@manual{comp-fonts-FAQ, +@manual{comp-fonts-faq, title = {The \texttt{comp-fonts-FAQ} package}, subtitle = {Frequently Asked Questions from comp.fonts}, author = {Norman Walsh}, @@ -14197,7 +14207,7 @@ version = {2.1.5}, license = {other-free}, url = {https://mirror.ctan.org/help/comp-fonts-FAQ}, - pkgurl = {https://ctan.org/pkg/comp-fonts-FAQ}, + pkgurl = {https://ctan.org/pkg/comp-fonts-faq}, } @manual{compact-symbols, @@ -14268,7 +14278,7 @@ pkgurl = {https://ctan.org/pkg/components}, } -@manual{The_Comprehensive_LaTeX_Symbol_List, +@manual{comprehensive, title = {The \texttt{The Comprehensive \LaTeX{} Symbol List} package}, subtitle = {Symbols accessible from \LaTeX{}}, author = {Scott Pakin}, @@ -14276,6 +14286,7 @@ version = {14.0}, license = {lppl1.3}, url = {https://mirror.ctan.org/info/symbols/comprehensive}, + pkgurl = {https://ctan.org/pkg/comprehensive}, } @manual{compsci, @@ -14397,7 +14408,7 @@ pkgurl = {https://ctan.org/pkg/concrete}, } -@manual{CondiTeXt, +@manual{conditext, title = {The \texttt{CondiTeXt} package}, subtitle = {Define and manage conditional content}, author = {Jean-Louis Brabant}, @@ -14405,7 +14416,7 @@ version = {1.5}, license = {lppl1.3c}, url = {https://mirror.ctan.org/macros/latex/contrib/conditext}, - pkgurl = {https://ctan.org/pkg/CondiTeXt}, + pkgurl = {https://ctan.org/pkg/conditext}, } @manual{confproc, @@ -14550,7 +14561,7 @@ .}, } -@manual{ConTeXt-cmttbf, +@manual{context-cmttbf, title = {The \texttt{ConTeXt-cmttbf} package}, subtitle = {Use Computer Modern Typewriter bold font in ConTeXt}, author = {Peter Münster}, @@ -14558,7 +14569,7 @@ version = {}, license = {gpl}, url = {https://mirror.ctan.org/macros/context/contrib/context-cmttbf}, - pkgurl = {https://ctan.org/pkg/ConTeXt-cmttbf}, + pkgurl = {https://ctan.org/pkg/context-cmttbf}, note = {The module makes provision for bold typewriter CM fonts, in ConTeXt. Such a font may be found in the Computer Modern .}, @@ -14666,7 +14677,7 @@ pkgurl = {https://ctan.org/pkg/context-gantt}, } -@manual{ConTeXt-gnuplot, +@manual{context-gnuplot, title = {The \texttt{ConTeXt-gnuplot} package}, subtitle = {Inclusion of Gnuplot graphs in ConTeXt}, author = {Mojca Miklavec and Hans Hagen and Taco Hoekwater}, @@ -14674,7 +14685,7 @@ version = {}, license = {gpl}, url = {https://mirror.ctan.org/macros/context/contrib/context-gnuplot}, - pkgurl = {https://ctan.org/pkg/ConTeXt-gnuplot}, + pkgurl = {https://ctan.org/pkg/context-gnuplot}, note = {Enables simple creation and inclusion of graphs with . The package writes a script into temporary file, runs Gnuplot and includes the resulting @@ -14914,7 +14925,7 @@ each is available in a and a version.}, } -@manual{context-URWGaramond, +@manual{context-urwgaramond, title = {The \texttt{context-URWGaramond} package}, subtitle = {ConTeXt support for URW Garamond font}, author = {Peter Münster}, @@ -14922,12 +14933,12 @@ version = {}, license = {pd}, url = {https://mirror.ctan.org/macros/context/contrib/context-urwgaramond}, - pkgurl = {https://ctan.org/pkg/context-URWGaramond}, + pkgurl = {https://ctan.org/pkg/context-urwgaramond}, note = {The required may also be found on CTAN.}, } -@manual{context-URWGothic, +@manual{context-urwgothic, title = {The \texttt{context-URWGothic} package}, subtitle = {ConTeXt support for URW Gothic}, author = {Taco Hoekwater}, @@ -14935,7 +14946,7 @@ version = {}, license = {pd}, url = {https://mirror.ctan.org/macros/context/contrib/context-urwgothic}, - pkgurl = {https://ctan.org/pkg/context-URWGothic}, + pkgurl = {https://ctan.org/pkg/context-urwgothic}, } @manual{context-vim, @@ -15272,7 +15283,7 @@ pkgurl = {https://ctan.org/pkg/corelpak}, } -@manual{CormorantGaramond, +@manual{cormorantgaramond, title = {The \texttt{CormorantGaramond} package}, subtitle = {Cormorant Garamond family of fonts}, author = {Bob Tennent}, @@ -15280,7 +15291,7 @@ version = {3.601}, license = {ofl,lppl}, url = {https://mirror.ctan.org/fonts/cormorantgaramond}, - pkgurl = {https://ctan.org/pkg/CormorantGaramond}, + pkgurl = {https://ctan.org/pkg/cormorantgaramond}, } @manual{correctmathalign, @@ -15385,7 +15396,7 @@ macro .}, } -@manual{courier_scaled, +@manual{courier-scaled, title = {The \texttt{courier scaled} package}, subtitle = {Provides a scaled Courier font}, author = {Herbert Schulz}, @@ -15393,16 +15404,17 @@ version = {}, license = {lppl1.2}, url = {https://mirror.ctan.org/fonts/psfonts/courier-scaled}, + pkgurl = {https://ctan.org/pkg/courier-scaled}, } -@manual{Courier, +@manual{courier, title = {The \texttt{Courier} package}, subtitle = {Adobe Type 1 “free†copies of Courier}, author = {{IBM Corporation}}, date = {2020-06-06}, license = {other-nonfree}, url = {https://mirror.ctan.org/obsolete/fonts/psfonts/ibm/courier}, - pkgurl = {https://ctan.org/pkg/Courier}, + pkgurl = {https://ctan.org/pkg/courier}, } @manual{courierten, @@ -15534,7 +15546,7 @@ pkgurl = {https://ctan.org/pkg/cptex}, } -@manual{CQUBeamer, +@manual{cqubeamer, title = {The \texttt{CQUBeamer} package}, subtitle = {LaTeX Beamer Template for Chongqing University}, author = {Zhen Wan}, @@ -15542,10 +15554,10 @@ version = {1.0}, license = {mit,cc-by-4}, url = {https://mirror.ctan.org/macros/xetex/latex/cqubeamer}, - pkgurl = {https://ctan.org/pkg/CQUBeamer}, + pkgurl = {https://ctan.org/pkg/cqubeamer}, } -@manual{CQUThesis, +@manual{cquthesis, title = {The \texttt{CQUThesis} package}, subtitle = {LaTeX Thesis Template for Chongqing University}, author = {Li Zhennan}, @@ -15553,7 +15565,7 @@ version = {1.50}, license = {lppl1.3}, url = {https://mirror.ctan.org/macros/latex/contrib/cquthesis}, - pkgurl = {https://ctan.org/pkg/CQUThesis}, + pkgurl = {https://ctan.org/pkg/cquthesis}, } @manual{crbox, @@ -15623,7 +15635,7 @@ pkgurl = {https://ctan.org/pkg/crimson}, } -@manual{CrimsonPro, +@manual{crimsonpro, title = {The \texttt{CrimsonPro} package}, subtitle = {CrimsonPro fonts with \LaTeX{} support}, author = {Bob Tennent}, @@ -15631,7 +15643,7 @@ version = {}, license = {ofl,lppl}, url = {https://mirror.ctan.org/fonts/crimsonpro}, - pkgurl = {https://ctan.org/pkg/CrimsonPro}, + pkgurl = {https://ctan.org/pkg/crimsonpro}, note = {The CrimsonPro fonts are designed by Jacques Le Bailly and derived from the designed by Sebastian Kosch. The family includes eight weights and italics for each weight.}, @@ -15973,14 +15985,14 @@ to create color themes).}, } -@manual{CSTeX, +@manual{cstex, title = {The \texttt{CSTeX} package}, subtitle = {Support for Czech/Slovak languages}, author = {Petr Olšák}, date = {2022-08-19}, license = {other-free}, url = {https://mirror.ctan.org/macros/cstex}, - pkgurl = {https://ctan.org/pkg/CSTeX}, + pkgurl = {https://ctan.org/pkg/cstex}, } @manual{cstypo, @@ -16137,7 +16149,7 @@ pkgurl = {https://ctan.org/pkg/ctanify}, } -@manual{CTAN_tools, +@manual{ctantools, title = {The \texttt{CTAN tools} package}, subtitle = {A jiffy to search CTAN file list}, author = {Ky-Anh Huynh}, @@ -16145,6 +16157,7 @@ version = {1.5.2}, license = {lppl}, url = {https://mirror.ctan.org/support/ctantools}, + pkgurl = {https://ctan.org/pkg/ctantools}, } @manual{ctanupload, @@ -16305,7 +16318,7 @@ pkgurl = {https://ctan.org/pkg/cursor}, } -@manual{CurVe, +@manual{curve, title = {The \texttt{CurVe} package}, subtitle = {A class for making curriculum vitae}, author = {Didier Verna}, @@ -16313,7 +16326,7 @@ version = {1.16}, license = {lppl}, url = {https://mirror.ctan.org/macros/latex/contrib/curve}, - pkgurl = {https://ctan.org/pkg/CurVe}, + pkgurl = {https://ctan.org/pkg/curve}, } @manual{curve2e, @@ -16412,14 +16425,14 @@ pkgurl = {https://ctan.org/pkg/cv4tw}, } -@manual{CVsty, +@manual{cvsty, title = {The \texttt{CVsty} package}, subtitle = {Yet another style for easy CV pagination}, author = {Gilles Pereira}, date = {2019-02-03}, license = {pd}, url = {https://mirror.ctan.org/macros/latex/contrib/cvsty}, - pkgurl = {https://ctan.org/pkg/CVsty}, + pkgurl = {https://ctan.org/pkg/cvsty}, } @manual{cweb-latex, @@ -16457,14 +16470,14 @@ pkgurl = {https://ctan.org/pkg/cwebbin}, } -@manual{cweb-hy, +@manual{cwebhy, title = {The \texttt{cweb-hy} package}, subtitle = {Insert hyperlinks for included files}, author = {Enrique Melendez}, date = {2016-06-24}, license = {lppl}, url = {https://mirror.ctan.org/macros/latex/contrib/cweb/contrib/cweb-hy}, - pkgurl = {https://ctan.org/pkg/cweb-hy}, + pkgurl = {https://ctan.org/pkg/cwebhy}, } @manual{cwebx, @@ -17385,7 +17398,7 @@ “new†to “full†and back again.}, } -@manual{DayRoman, +@manual{dayroman, title = {The \texttt{DayRoman} package}, subtitle = {The Day Roman typeface}, author = {Walter A. Schmidt and Keiran Harcombe}, @@ -17393,7 +17406,7 @@ version = {}, license = {other-free}, url = {https://mirror.ctan.org/fonts/DayRoman}, - pkgurl = {https://ctan.org/pkg/DayRoman}, + pkgurl = {https://ctan.org/pkg/dayroman}, } @manual{daytime, @@ -17459,7 +17472,7 @@ pkgurl = {https://ctan.org/pkg/dblfont}, } -@manual{DB_process, +@manual{dbprocess, title = {The \texttt{DB\_process} package}, subtitle = {Process database output}, author = {Victor Eijkhout}, @@ -17467,7 +17480,7 @@ version = {0.91}, license = {gpl}, url = {https://mirror.ctan.org/macros/generic/eijkhout/DB_process.tex}, - pkgurl = {https://ctan.org/pkg/DB_process}, + pkgurl = {https://ctan.org/pkg/dbprocess}, } @manual{dbshow, @@ -17525,7 +17538,7 @@ pkgurl = {https://ctan.org/pkg/dcounter}, } -@manual{DCpic, +@manual{dcpic, title = {The \texttt{DCpic} package}, subtitle = {Commutative diagrams in a \LaTeX{} and TeX documents}, author = {Pedro Quaresma}, @@ -17533,7 +17546,7 @@ version = {5.0.0}, license = {lppl1.3}, url = {https://mirror.ctan.org/macros/generic/diagrams/dcpic}, - pkgurl = {https://ctan.org/pkg/DCpic}, + pkgurl = {https://ctan.org/pkg/dcpic}, } @manual{ddphonism, @@ -18895,7 +18908,7 @@ pkgurl = {https://ctan.org/pkg/dozenal}, } -@manual{DPcircling, +@manual{dpcircling, title = {The \texttt{DPcircling} package}, subtitle = {Decorated text boxes using TikZ}, author = {Oura Mitsuaki}, @@ -18903,7 +18916,7 @@ version = {1.0}, license = {mit}, url = {https://mirror.ctan.org/graphics/pgf/contrib/dpcircling}, - pkgurl = {https://ctan.org/pkg/DPcircling}, + pkgurl = {https://ctan.org/pkg/dpcircling}, } @manual{dpfloat, @@ -19222,7 +19235,7 @@ pkgurl = {https://ctan.org/pkg/dsptricks}, } -@manual{DSSerif, +@manual{dsserif, title = {The \texttt{DSSerif} package}, subtitle = {A double-struck serifed font for mathematical use}, author = {Michael Sharpe}, @@ -19230,7 +19243,7 @@ version = {1.031}, license = {ofl,lppl1.3}, url = {https://mirror.ctan.org/fonts/dsserif}, - pkgurl = {https://ctan.org/pkg/DSSerif}, + pkgurl = {https://ctan.org/pkg/dsserif}, } @manual{dtk-1.32, @@ -19288,7 +19301,7 @@ pkgurl = {https://ctan.org/pkg/dtxdescribe}, } -@manual{DTX_gallery, +@manual{dtxgallery, title = {The \texttt{DTX gallery} package}, subtitle = {A small collection of minimal DTX examples}, author = {Will Robertson}, @@ -19296,6 +19309,7 @@ version = {1}, license = {lppl}, url = {https://mirror.ctan.org/info/dtxgallery}, + pkgurl = {https://ctan.org/pkg/dtxgallery}, } @manual{dtxgen, @@ -19349,7 +19363,7 @@ pkgurl = {https://ctan.org/pkg/duckuments}, } -@manual{duerer-LaTeX, +@manual{duerer-latex, title = {The \texttt{duerer-LaTeX} package}, subtitle = {LaTeX support for the Duerer fonts}, author = {Palle Jørgensen}, @@ -19357,7 +19371,7 @@ version = {1.1}, license = {gpl}, url = {https://mirror.ctan.org/macros/latex/contrib/duerer-latex}, - pkgurl = {https://ctan.org/pkg/duerer-LaTeX}, + pkgurl = {https://ctan.org/pkg/duerer-latex}, note = {LaTeX support for Hoenig’s fonts, using their standard names.}, @@ -19519,7 +19533,7 @@ be no update that covers the IBM printer).}, } -@manual{DVIasm, +@manual{dviasm, title = {The \texttt{DVIasm} package}, subtitle = {A utility for editing DVI files}, author = {Jin-Hwan Cho and Khaled Hosny and Hironobu Yamashita}, @@ -19527,7 +19541,7 @@ version = {}, license = {gpl3+}, url = {https://mirror.ctan.org/dviware/dviasm}, - pkgurl = {https://ctan.org/pkg/DVIasm}, + pkgurl = {https://ctan.org/pkg/dviasm}, } @manual{dvibit, @@ -19852,7 +19866,7 @@ pkgurl = {https://ctan.org/pkg/dvisvgm}, } -@manual{DVItoLN03, +@manual{dvitoln03, title = {The \texttt{DVItoLN03} package}, subtitle = {DVI output to Digital LN03 printer}, author = {Brian Hamilton Kelly}, @@ -19860,7 +19874,7 @@ version = {4.1}, license = {noinfo}, url = {https://mirror.ctan.org/dviware/ln03/rmcs}, - pkgurl = {https://ctan.org/pkg/DVItoLN03}, + pkgurl = {https://ctan.org/pkg/dvitoln03}, } @manual{dvitops, @@ -19901,7 +19915,7 @@ pkgurl = {https://ctan.org/pkg/dvitype}, } -@manual{DVIVue, +@manual{dvivue, title = {The \texttt{DVIVue} package}, subtitle = {A DVI/PDF viewer for Windows}, author = {Peter Frane Jr}, @@ -19909,7 +19923,7 @@ version = {1.0}, license = {gpl3+}, url = {https://mirror.ctan.org/dviware/dvivue}, - pkgurl = {https://ctan.org/pkg/DVIVue}, + pkgurl = {https://ctan.org/pkg/dvivue}, note = {This program is a DVI/PDF viewer. It uses to convert a DVI file to PDF, thus allowing the text in the document to be searched or selected.}, @@ -20141,7 +20155,7 @@ pkgurl = {https://ctan.org/pkg/easyformat}, } -@manual{easyLaTeX, +@manual{easylatex, title = {The \texttt{easyLaTeX} package}, subtitle = {Faster and simpler writing of \LaTeX{} documents}, author = {Bayle Shanks}, @@ -20149,7 +20163,7 @@ version = {0.062}, license = {gpl2}, url = {https://mirror.ctan.org/support/easylatex}, - pkgurl = {https://ctan.org/pkg/easyLaTeX}, + pkgurl = {https://ctan.org/pkg/easylatex}, } @manual{easylist, @@ -20174,7 +20188,7 @@ pkgurl = {https://ctan.org/pkg/easymat}, } -@manual{easyReview, +@manual{easyreview, title = {The \texttt{easyReview} package}, subtitle = {Package to provide a way to review (or perform editorial process) in \LaTeX{}}, author = {Jody Matos}, @@ -20182,7 +20196,7 @@ version = {1.0}, license = {lppl}, url = {https://mirror.ctan.org/macros/latex/contrib/easyreview}, - pkgurl = {https://ctan.org/pkg/easyReview}, + pkgurl = {https://ctan.org/pkg/easyreview}, } @manual{easytable, @@ -20265,14 +20279,14 @@ macros are also provided for the right-hand side of productions.}, } -@manual{EBONG, +@manual{ebong, title = {The \texttt{EBONG} package}, subtitle = {Utility for writing Bengali in Rapid Roman Format}, author = {Shibaji Banerjee}, date = {2020-06-07}, license = {pd}, url = {https://mirror.ctan.org/language/ebong}, - pkgurl = {https://ctan.org/pkg/EBONG}, + pkgurl = {https://ctan.org/pkg/ebong}, note = {A tool (preprocessor) for writing your pRaa-ne-r ka-thaa in the bengali langauage. It allows one to write the text in Rapid Roman Bangla and convert it to the @@ -20461,14 +20475,14 @@ pkgurl = {https://ctan.org/pkg/econlipsum}, } -@manual{Econometrica, +@manual{econometrica, title = {The \texttt{Econometrica} package}, subtitle = {BibTeX support for Econometrica}, author = {Kim C Border and Guillaume Horny}, date = {2016-06-24}, license = {nosell}, url = {https://mirror.ctan.org/biblio/bibtex/contrib/economic}, - pkgurl = {https://ctan.org/pkg/Econometrica}, + pkgurl = {https://ctan.org/pkg/econometrica}, note = {BibTeX styles (derived from ) for Econometrica (both in English and French).}, @@ -20525,7 +20539,7 @@ pkgurl = {https://ctan.org/pkg/ecta}, } -@manual{ECV, +@manual{ecv, title = {The \texttt{ECV} package}, subtitle = {A fancy Curriculum Vitae class}, author = {Bernd Haberstumpf and Christoph Neumann}, @@ -20533,7 +20547,7 @@ version = {0.3}, license = {other-free}, url = {https://mirror.ctan.org/macros/latex/contrib/ecv}, - pkgurl = {https://ctan.org/pkg/ECV}, + pkgurl = {https://ctan.org/pkg/ecv}, } @manual{eczar, @@ -20889,7 +20903,7 @@ variant readings, translations or annotated borrowings between texts.}, } -@manual{EkType-Tanka, +@manual{ektype-tanka, title = {The \texttt{EkType-Tanka} package}, subtitle = {Devanagari fonts by EkType}, author = {{Unknown}}, @@ -20897,7 +20911,7 @@ version = {0.2}, license = {lppl1.3c}, url = {https://mirror.ctan.org/fonts/ektype-tanka}, - pkgurl = {https://ctan.org/pkg/EkType-Tanka}, + pkgurl = {https://ctan.org/pkg/ektype-tanka}, } @manual{elbioimp, @@ -20957,7 +20971,7 @@ pkgurl = {https://ctan.org/pkg/eledpar}, } -@manual{ElegantBook, +@manual{elegantbook, title = {The \texttt{ElegantBook} package}, subtitle = {An Elegant \LaTeX{} Template for Books}, author = {Dongsheng Deng and Liam Huang}, @@ -20965,10 +20979,10 @@ version = {4.4}, license = {lppl1.3c}, url = {https://mirror.ctan.org/macros/latex/contrib/elegantbook}, - pkgurl = {https://ctan.org/pkg/ElegantBook}, + pkgurl = {https://ctan.org/pkg/elegantbook}, } -@manual{ElegantNote, +@manual{elegantnote, title = {The \texttt{ElegantNote} package}, subtitle = {Elegant \LaTeX{} Template for Notes}, author = {Dongsheng Deng}, @@ -20976,10 +20990,10 @@ version = {2.40}, license = {lppl1.3c}, url = {https://mirror.ctan.org/macros/latex/contrib/elegantnote}, - pkgurl = {https://ctan.org/pkg/ElegantNote}, + pkgurl = {https://ctan.org/pkg/elegantnote}, } -@manual{ElegantPaper, +@manual{elegantpaper, title = {The \texttt{ElegantPaper} package}, subtitle = {An Elegant \LaTeX{} Template for Working Papers}, author = {Dongsheng Deng}, @@ -20987,7 +21001,7 @@ version = {0.10}, license = {lppl1.3c}, url = {https://mirror.ctan.org/macros/latex/contrib/elegantpaper}, - pkgurl = {https://ctan.org/pkg/ElegantPaper}, + pkgurl = {https://ctan.org/pkg/elegantpaper}, } @manual{elements, @@ -21370,7 +21384,7 @@ pkgurl = {https://ctan.org/pkg/encguide}, } -@manual{encTeX, +@manual{enctex, title = {The \texttt{encTeX} package}, subtitle = {A TeX extension that translates input on its way into TeX}, author = {Petr Olšák}, @@ -21378,7 +21392,7 @@ version = {}, license = {gpl}, url = {https://mirror.ctan.org/systems/enctex}, - pkgurl = {https://ctan.org/pkg/encTeX}, + pkgurl = {https://ctan.org/pkg/enctex}, } @manual{encxvlna, @@ -21452,7 +21466,7 @@ pkgurl = {https://ctan.org/pkg/endnote}, } -@manual{EndNote2bib, +@manual{endnote2bib, title = {The \texttt{EndNote2bib} package}, subtitle = {Convert EndNote files to BibTeX}, author = {Richard J Mathar}, @@ -21460,7 +21474,7 @@ version = {}, license = {lppl}, url = {https://mirror.ctan.org/biblio/bibtex/utils/r2bib}, - pkgurl = {https://ctan.org/pkg/EndNote2bib}, + pkgurl = {https://ctan.org/pkg/endnote2bib}, } @manual{endnotes-hy, @@ -21765,7 +21779,7 @@ tpic commands for full functionality.}, } -@manual{Epigrafica, +@manual{epigrafica, title = {The \texttt{Epigrafica} package}, subtitle = {A Greek and Latin font}, author = {Antonis Tsolomitis}, @@ -21773,7 +21787,7 @@ version = {1.01}, license = {gpl}, url = {https://mirror.ctan.org/fonts/greek/epigrafica}, - pkgurl = {https://ctan.org/pkg/Epigrafica}, + pkgurl = {https://ctan.org/pkg/epigrafica}, } @manual{epigram, @@ -21819,13 +21833,13 @@ pkgurl = {https://ctan.org/pkg/epiolmec}, } -@manual{ePiX, +@manual{epix, title = {The \texttt{ePiX} package}, subtitle = {Utility for mathematically accurate, camera quality plots and line figures}, author = {Andrew D. Hwang}, date = {2020-06-12}, license = {gpl}, - pkgurl = {https://ctan.org/pkg/ePiX}, + pkgurl = {https://ctan.org/pkg/epix}, } @manual{eplain, @@ -22198,7 +22212,7 @@ pkgurl = {https://ctan.org/pkg/eqmark}, } -@manual{Eqmlite/Free, +@manual{eqmlite, title = {The \texttt{Eqmlite/Free} package}, subtitle = {TeX system and PDF support for Linux and OS/2}, author = {{MicroPress}}, @@ -22206,7 +22220,7 @@ version = {2.31}, license = {other-nonfree}, url = {https://mirror.ctan.org/systems/win32/micropress/eqmlite}, - pkgurl = {https://ctan.org/pkg/Eqmlite/Free}, + pkgurl = {https://ctan.org/pkg/eqmlite}, } @manual{eqnalign, @@ -22391,14 +22405,14 @@ pkgurl = {https://ctan.org/pkg/esami}, } -@manual{escapeTeXt, +@manual{escapetext, title = {The \texttt{escapeTeXt} package}, subtitle = {Make plain text safe for use in \LaTeX{}}, author = {Jim Hefferon}, date = {2016-06-24}, license = {lppl}, url = {https://mirror.ctan.org/support/escapeTeXt}, - pkgurl = {https://ctan.org/pkg/escapeTeXt}, + pkgurl = {https://ctan.org/pkg/escapetext}, } @manual{esdiff, @@ -22614,7 +22628,7 @@ pkgurl = {https://ctan.org/pkg/etaremune}, } -@manual{ETbb, +@manual{etbb, title = {The \texttt{ETbb} package}, subtitle = {An expansion of Edward Tufte’s ET-Bembo family}, author = {Michael Sharpe}, @@ -22622,7 +22636,7 @@ version = {1.056}, license = {mit,lppl1.3}, url = {https://mirror.ctan.org/fonts/etbb}, - pkgurl = {https://ctan.org/pkg/ETbb}, + pkgurl = {https://ctan.org/pkg/etbb}, } @manual{etdipa, @@ -22647,13 +22661,13 @@ pkgurl = {https://ctan.org/pkg/etex-pkg}, } -@manual{e-TeX, +@manual{etex, title = {The \texttt{e-TeX} package}, subtitle = {An extended version of TeX, from the NTS project}, author = {Peter Breitenlohner and {The TeX Live Team}}, date = {2020-08-30}, license = {knuth}, - pkgurl = {https://ctan.org/pkg/e-TeX}, + pkgurl = {https://ctan.org/pkg/etex}, } @manual{etexcmds, @@ -22798,7 +22812,7 @@ pkgurl = {https://ctan.org/pkg/euclideangeometry}, } -@manual{EUenc, +@manual{euenc, title = {The \texttt{EUenc} package}, subtitle = {Unicode font encoding definitions for XeTeX}, author = {Will Robertson and Élie Roux and Khaled Hosny}, @@ -22806,7 +22820,7 @@ version = {0.1h}, license = {lppl1.3}, url = {https://mirror.ctan.org/macros/latex/contrib/euenc}, - pkgurl = {https://ctan.org/pkg/EUenc}, + pkgurl = {https://ctan.org/pkg/euenc}, } @manual{euflag, @@ -22988,7 +23002,7 @@ pkgurl = {https://ctan.org/pkg/europasscv}, } -@manual{EuropeCV, +@manual{europecv, title = {The \texttt{EuropeCV} package}, subtitle = {Unofficial class for European curricula vitae}, author = {Nicola Vitacolonna and Giuseppe Silano}, @@ -22996,7 +23010,7 @@ version = {}, license = {lppl}, url = {https://mirror.ctan.org/macros/latex/contrib/europecv}, - pkgurl = {https://ctan.org/pkg/EuropeCV}, + pkgurl = {https://ctan.org/pkg/europecv}, } @manual{europs, @@ -23202,7 +23216,7 @@ pkgurl = {https://ctan.org/pkg/exam209}, } -@manual{Exam_design, +@manual{examdesign, title = {The \texttt{Exam design} package}, subtitle = {LaTeX class for typesetting exams}, author = {Jason Alexander}, @@ -23210,6 +23224,7 @@ version = {1.101}, license = {gpl}, url = {https://mirror.ctan.org/macros/latex/contrib/examdesign}, + pkgurl = {https://ctan.org/pkg/examdesign}, } @manual{example, @@ -23259,7 +23274,7 @@ pkgurl = {https://ctan.org/pkg/excalibur}, } -@manual{Excel2LaTeX, +@manual{excel2latex, title = {The \texttt{Excel2LaTeX} package}, subtitle = {Convert Excel spreadsheets to \LaTeX{} tables}, author = {Joachim Marder and Kirill Müller and George Pearson and Andrew Hawryluk and Chelsea Hughes and Ivan Kokan}, @@ -23267,7 +23282,7 @@ version = {3.5.0}, license = {lppl1.3}, url = {https://mirror.ctan.org/support/excel2latex}, - pkgurl = {https://ctan.org/pkg/Excel2LaTeX}, + pkgurl = {https://ctan.org/pkg/excel2latex}, note = {Making tables in \LaTeX{} can be tedious, especially if some columns are calculated. This converter allows you to write a table in Excel instead, @@ -23277,7 +23292,7 @@ command.}, } -@manual{Exceltex, +@manual{exceltex, title = {The \texttt{Exceltex} package}, subtitle = {Get data from Excel files into \LaTeX{}}, author = {Hans-Peter Doerr}, @@ -23285,7 +23300,7 @@ version = {0.5.1}, license = {gpl}, url = {https://mirror.ctan.org/macros/latex/contrib/exceltex}, - pkgurl = {https://ctan.org/pkg/Exceltex}, + pkgurl = {https://ctan.org/pkg/exceltex}, } @manual{excludeonly, @@ -24610,14 +24625,14 @@ pkgurl = {https://ctan.org/pkg/figbas}, } -@manual{FigBib, +@manual{figbib, title = {The \texttt{FigBib} package}, subtitle = {Organize figure databases with BibTeX}, author = {Jan Poland}, date = {2016-06-24}, license = {lppl}, url = {https://mirror.ctan.org/macros/latex/contrib/figbib}, - pkgurl = {https://ctan.org/pkg/FigBib}, + pkgurl = {https://ctan.org/pkg/figbib}, } @manual{figcaps, @@ -24704,7 +24719,7 @@ pkgurl = {https://ctan.org/pkg/figsinltx}, } -@manual{FigSize, +@manual{figsize, title = {The \texttt{FigSize} package}, subtitle = {Auto-size graphics}, author = {Anthony A. Tanbakuchi}, @@ -24712,7 +24727,7 @@ version = {0.1}, license = {lppl}, url = {https://mirror.ctan.org/macros/latex/contrib/figsize}, - pkgurl = {https://ctan.org/pkg/FigSize}, + pkgurl = {https://ctan.org/pkg/figsize}, note = {The FigSize package enables automatic sizing of graphics, especially when including graphics with the package. The @@ -24887,7 +24902,7 @@ hyphenated word that’s being referenced.}, } -@manual{FiNK, +@manual{fink, title = {The \texttt{FiNK} package}, subtitle = {The \LaTeX{}2e File Name Keeper}, author = {Didier Verna}, @@ -24895,10 +24910,10 @@ version = {2.2.1}, license = {lppl}, url = {https://mirror.ctan.org/macros/latex/contrib/fink}, - pkgurl = {https://ctan.org/pkg/FiNK}, + pkgurl = {https://ctan.org/pkg/fink}, } -@manual{Finomaton, +@manual{finomaton, title = {The \texttt{Finomaton} package}, subtitle = {Comfortably draw and typeset finite state machines}, author = {Markus Triska}, @@ -24906,7 +24921,7 @@ version = {1.0}, license = {gpl}, url = {https://mirror.ctan.org/graphics/finomaton}, - pkgurl = {https://ctan.org/pkg/Finomaton}, + pkgurl = {https://ctan.org/pkg/finomaton}, } @manual{finplain, @@ -25057,7 +25072,7 @@ pkgurl = {https://ctan.org/pkg/fithesis}, } -@manual{FitR, +@manual{fitr, title = {The \texttt{FitR} package}, subtitle = {Set a rectangular destination and jump to it}, author = {Donald P. Story}, @@ -25065,7 +25080,7 @@ version = {1.3.2}, license = {lppl}, url = {https://mirror.ctan.org/macros/latex/contrib/fitr}, - pkgurl = {https://ctan.org/pkg/FitR}, + pkgurl = {https://ctan.org/pkg/fitr}, } @manual{fix-cm, @@ -25195,7 +25210,7 @@ pkgurl = {https://ctan.org/pkg/fixmath}, } -@manual{FiXme, +@manual{fixme, title = {The \texttt{FiXme} package}, subtitle = {Collaborative annotation tool for \LaTeX{}}, author = {Didier Verna}, @@ -25203,7 +25218,7 @@ version = {4.5}, license = {lppl1.3}, url = {https://mirror.ctan.org/macros/latex/contrib/fixme}, - pkgurl = {https://ctan.org/pkg/FiXme}, + pkgurl = {https://ctan.org/pkg/fixme}, } @manual{fixmetodonotes, @@ -25549,7 +25564,7 @@ pkgurl = {https://ctan.org/pkg/flowfram}, } -@manual{FlowframTk, +@manual{flowframtk, title = {The \texttt{FlowframTk} package}, subtitle = {Vector graphics application with support for flowfram.sty}, author = {Nicola Talbot}, @@ -25557,7 +25572,7 @@ version = {0.8.4}, license = {gpl}, url = {https://mirror.ctan.org/graphics/flowframtk}, - pkgurl = {https://ctan.org/pkg/FlowframTk}, + pkgurl = {https://ctan.org/pkg/flowframtk}, } @manual{fltpage, @@ -25885,14 +25900,14 @@ pkgurl = {https://ctan.org/pkg/font-change}, } -@manual{font_selection, +@manual{font-selection, title = {The \texttt{font\_selection} package}, subtitle = {Font selection for plain TeX}, author = {Harold de Wijn}, date = {2016-06-24}, license = {gpl}, url = {https://mirror.ctan.org/macros/plain/contrib/font_selection}, - pkgurl = {https://ctan.org/pkg/font_selection}, + pkgurl = {https://ctan.org/pkg/font-selection}, } @manual{fontawesome, @@ -26531,7 +26546,7 @@ pkgurl = {https://ctan.org/pkg/fourier}, } -@manual{FourierNC, +@manual{fouriernc, title = {The \texttt{FourierNC} package}, subtitle = {Use New Century Schoolbook text with Fourier maths fonts}, author = {Michael Zedler and Michael Sharpe}, @@ -26539,7 +26554,7 @@ version = {}, license = {lppl}, url = {https://mirror.ctan.org/fonts/fouriernc}, - pkgurl = {https://ctan.org/pkg/FourierNC}, + pkgurl = {https://ctan.org/pkg/fouriernc}, note = {This package provides a \LaTeX{} mathematics font setup for use with New Century Schoolbook text. In order to use it you need to have the fonts installed.}, @@ -26593,7 +26608,7 @@ pkgurl = {https://ctan.org/pkg/fpl}, } -@manual{fpTeX, +@manual{fptex, title = {The \texttt{fpTeX} package}, subtitle = {A web2C-based TeX system for MS-Windows32}, author = {Fabrice Popineau}, @@ -26601,7 +26616,7 @@ version = {0.7}, license = {gpl}, url = {https://mirror.ctan.org/obsolete/systems/win32/fptex}, - pkgurl = {https://ctan.org/pkg/fpTeX}, + pkgurl = {https://ctan.org/pkg/fptex}, } @manual{fragmaster, @@ -26865,7 +26880,7 @@ pkgurl = {https://ctan.org/pkg/frhyph}, } -@manual{FriBidiXeTeX, +@manual{fribidixetex, title = {The \texttt{FriBidiXeTeX} package}, subtitle = {A pre-processor for XeTeX files to support unicode bidirectional algorithm}, author = {Vafa Khalighi and {bidi-tex GitHub Organisation}}, @@ -26873,7 +26888,7 @@ version = {0.0.2}, license = {gpl2}, url = {https://mirror.ctan.org/support/fribidixetex}, - pkgurl = {https://ctan.org/pkg/FriBidiXeTeX}, + pkgurl = {https://ctan.org/pkg/fribidixetex}, } @manual{fribrief, @@ -27369,7 +27384,7 @@ and acts as a tutorial.}, } -@manual{Gamebooklib, +@manual{gamebooklib, title = {The \texttt{Gamebooklib} package}, subtitle = {Macros for setting numbered entries in shuffled order}, author = {Robert J Lee}, @@ -27377,7 +27392,7 @@ version = {1.3}, license = {lppl1.3}, url = {https://mirror.ctan.org/macros/latex/contrib/gamebooklib}, - pkgurl = {https://ctan.org/pkg/Gamebooklib}, + pkgurl = {https://ctan.org/pkg/gamebooklib}, } @manual{gammas, @@ -27469,7 +27484,7 @@ pkgurl = {https://ctan.org/pkg/garrigues}, } -@manual{GasTeX, +@manual{gastex, title = {The \texttt{GasTeX} package}, subtitle = {Graphs and Automata Simplified in TeX}, author = {Paul Gastin}, @@ -27477,7 +27492,7 @@ version = {3.0}, license = {lppl}, url = {https://mirror.ctan.org/graphics/gastex}, - pkgurl = {https://ctan.org/pkg/GasTeX}, + pkgurl = {https://ctan.org/pkg/gastex}, } @manual{gatech-thesis, @@ -27619,7 +27634,7 @@ pkgurl = {https://ctan.org/pkg/gckanbun}, } -@manual{GELLMU, +@manual{gellmu, title = {The \texttt{GELLMU} package}, subtitle = {LaTeX-like markup for writing XML documents}, author = {William F. Hammond}, @@ -27627,7 +27642,7 @@ version = {0.8.4.1}, license = {gpl}, url = {https://mirror.ctan.org/support/gellmu}, - pkgurl = {https://ctan.org/pkg/GELLMU}, + pkgurl = {https://ctan.org/pkg/gellmu}, } @manual{gen, @@ -28036,17 +28051,17 @@ pkgurl = {https://ctan.org/pkg/gfnotation}, } -@manual{GFS, +@manual{gfs, title = {The \texttt{GFS} package}, subtitle = {The GFS font collection}, author = {Antonis Tsolomitis and George D. Matthiopoulos and {The Greek Font Society}}, date = {2019-06-09}, license = {other-free}, url = {https://mirror.ctan.org/fonts/greek/gfs}, - pkgurl = {https://ctan.org/pkg/GFS}, + pkgurl = {https://ctan.org/pkg/gfs}, } -@manual{GFS_Artemisia, +@manual{gfsartemisia, title = {The \texttt{GFS Artemisia} package}, subtitle = {A modern Greek font design}, author = {Antonis Tsolomitis and George D. Matthiopoulos and {The Greek Font Society}}, @@ -28054,9 +28069,10 @@ version = {1.0}, license = {other-free}, url = {https://mirror.ctan.org/fonts/greek/gfs/gfsartemisia}, + pkgurl = {https://ctan.org/pkg/gfsartemisia}, } -@manual{GFS_Baskerville, +@manual{gfsbaskerville, title = {The \texttt{GFS Baskerville} package}, subtitle = {A Greek font, from one such by Baskerville}, author = {Antonis Tsolomitis and {The Greek Font Society}}, @@ -28064,6 +28080,7 @@ version = {1.0}, license = {other-free}, url = {https://mirror.ctan.org/fonts/greek/gfs/gfsbaskerville}, + pkgurl = {https://ctan.org/pkg/gfsbaskerville}, note = {The font is a digital implementation of Baskerville’s classic Greek font, provided by the . @@ -28071,7 +28088,7 @@ of LGR encoding.}, } -@manual{GFS_Bodoni, +@manual{gfsbodoni, title = {The \texttt{GFS Bodoni} package}, subtitle = {A Greek and Latin font based on Bodoni}, author = {Antonis Tsolomitis and {The Greek Font Society}}, @@ -28079,9 +28096,10 @@ version = {1.01}, license = {ofl}, url = {https://mirror.ctan.org/fonts/greek/gfs/gfsbodoni}, + pkgurl = {https://ctan.org/pkg/gfsbodoni}, } -@manual{GFS_Complutum, +@manual{gfscomplutum, title = {The \texttt{GFS Complutum} package}, subtitle = {A Greek font with a long history}, author = {Antonis Tsolomitis and George D. Matthiopoulos}, @@ -28089,9 +28107,10 @@ version = {1.0}, license = {ofl}, url = {https://mirror.ctan.org/fonts/greek/gfs/gfscomplutum}, + pkgurl = {https://ctan.org/pkg/gfscomplutum}, } -@manual{GFSDidot, +@manual{gfsdidot, title = {The \texttt{GFSDidot} package}, subtitle = {A Greek font based on Didot’s work}, author = {Antonis Tsolomitis and Alain Aubord and George D. Matthiopoulos and {The Greek Font Society}}, @@ -28099,10 +28118,10 @@ version = {}, license = {other-free}, url = {https://mirror.ctan.org/fonts/greek/gfs/gfsdidot}, - pkgurl = {https://ctan.org/pkg/GFSDidot}, + pkgurl = {https://ctan.org/pkg/gfsdidot}, } -@manual{GFSDidotClassic, +@manual{gfsdidotclassic, title = {The \texttt{GFSDidotClassic} package}, subtitle = {The classic version of GFSDidot}, author = {Antonis Tsolomitis}, @@ -28110,10 +28129,10 @@ version = {001.001}, license = {ofl}, url = {https://mirror.ctan.org/fonts/greek/gfs/gfsdidotclassic}, - pkgurl = {https://ctan.org/pkg/GFSDidotClassic}, + pkgurl = {https://ctan.org/pkg/gfsdidotclassic}, } -@manual{GFS_NeoHellenic, +@manual{gfsneohellenic, title = {The \texttt{GFS NeoHellenic} package}, subtitle = {A font in the Neo-Hellenic style}, author = {Antonis Tsolomitis and {The Greek Font Society}}, @@ -28121,9 +28140,10 @@ version = {1.02}, license = {other-free}, url = {https://mirror.ctan.org/fonts/greek/gfs/gfsneohellenic}, + pkgurl = {https://ctan.org/pkg/gfsneohellenic}, } -@manual{GFSNeohellenicMath, +@manual{gfsneohellenicmath, title = {The \texttt{GFSNeohellenicMath} package}, subtitle = {A math font in the Neo-Hellenic style}, author = {Antonis Tsolomitis}, @@ -28131,10 +28151,10 @@ version = {1.02}, license = {ofl}, url = {https://mirror.ctan.org/fonts/gfsneohellenicmath}, - pkgurl = {https://ctan.org/pkg/GFSNeohellenicMath}, + pkgurl = {https://ctan.org/pkg/gfsneohellenicmath}, } -@manual{GFS_Porson, +@manual{gfsporson, title = {The \texttt{GFS Porson} package}, subtitle = {A Greek font, originally from Porson}, author = {Antonis Tsolomitis and {The Greek Font Society}}, @@ -28142,9 +28162,10 @@ version = {1.01}, license = {other-free}, url = {https://mirror.ctan.org/fonts/greek/gfs/gfsporson}, + pkgurl = {https://ctan.org/pkg/gfsporson}, } -@manual{GFS_Solomos, +@manual{gfssolomos, title = {The \texttt{GFS Solomos} package}, subtitle = {A Greek-alphabet font}, author = {Antonis Tsolomitis}, @@ -28152,6 +28173,7 @@ version = {1.0}, license = {ofl}, url = {https://mirror.ctan.org/fonts/greek/gfs/gfssolomos}, + pkgurl = {https://ctan.org/pkg/gfssolomos}, } @manual{ghab, @@ -28351,7 +28373,7 @@ pkgurl = {https://ctan.org/pkg/gl-tree}, } -@manual{GladTeX, +@manual{gladtex, title = {The \texttt{GladTeX} package}, subtitle = {LaTeX equations in HTML}, author = {Martin G. Gulbrandsen and Sebastian Humenda}, @@ -28359,7 +28381,7 @@ version = {3.0.0}, license = {lgpl3}, url = {https://mirror.ctan.org/support/gladtex}, - pkgurl = {https://ctan.org/pkg/GladTeX}, + pkgurl = {https://ctan.org/pkg/gladtex}, } @manual{gleitobjekte, @@ -29079,14 +29101,14 @@ pkgurl = {https://ctan.org/pkg/graph35}, } -@manual{GraphBase, +@manual{graphbase, title = {The \texttt{GraphBase} package}, subtitle = {A platform for combinatorial algorithms}, author = {Donald E. Knuth}, date = {2016-06-24}, license = {knuth}, url = {https://mirror.ctan.org/support/graphbase}, - pkgurl = {https://ctan.org/pkg/GraphBase}, + pkgurl = {https://ctan.org/pkg/graphbase}, note = {A program developed (presumably) in pursuit of work on ‘’.}, } @@ -29102,7 +29124,7 @@ pkgurl = {https://ctan.org/pkg/graphbox}, } -@manual{GraphConv, +@manual{graphconv, title = {The \texttt{GraphConv} package}, subtitle = {Convert graph files to PSTricks}, author = {Martin Chicoine}, @@ -29110,7 +29132,7 @@ version = {1.01}, license = {nosource}, url = {https://mirror.ctan.org/support/graphconv}, - pkgurl = {https://ctan.org/pkg/GraphConv}, + pkgurl = {https://ctan.org/pkg/graphconv}, note = {is a very easy to use program to create simple graphs. GraphConv is a small Windows program to convert Graph files to @@ -29263,7 +29285,7 @@ command.}, } -@manual{GraphicxSP, +@manual{graphicxsp, title = {The \texttt{GraphicxSP} package}, subtitle = {An extension of the graphicx package}, author = {Donald P. Story}, @@ -29271,7 +29293,7 @@ version = {}, license = {lppl1.2}, url = {https://mirror.ctan.org/macros/latex/contrib/graphicxsp}, - pkgurl = {https://ctan.org/pkg/GraphicxSP}, + pkgurl = {https://ctan.org/pkg/graphicxsp}, } @manual{graphpap, @@ -29296,7 +29318,7 @@ pkgurl = {https://ctan.org/pkg/graphpaper}, } -@manual{GraphTeX, +@manual{graphtex, title = {The \texttt{GraphTeX} package}, subtitle = {Graphs theory and related diagrams in a TeX document}, author = {John Pliam}, @@ -29304,7 +29326,7 @@ version = {1.0.1beta}, license = {gpl}, url = {https://mirror.ctan.org/graphics/graphtex}, - pkgurl = {https://ctan.org/pkg/GraphTeX}, + pkgurl = {https://ctan.org/pkg/graphtex}, note = {GraphTeX is a Perl library (graphtex.pl) along with a preprocessor (gt) which can be used to generate commands producing graphs and related diagrams inside a TeX @@ -29728,7 +29750,7 @@ for its use are provided.}, } -@manual{GS1, +@manual{gs1, title = {The \texttt{GS1} package}, subtitle = {Typeset EAN barcodes using TeX rules, only}, author = {Markus Kohm}, @@ -29736,7 +29758,7 @@ version = {23}, license = {lppl1.3c}, url = {https://mirror.ctan.org/macros/latex/contrib/gs1}, - pkgurl = {https://ctan.org/pkg/GS1}, + pkgurl = {https://ctan.org/pkg/gs1}, note = {The (LaTeX3) package typesets EAN-8 and EAN-13 barcodes, using the facilities of the package.}, } @@ -29810,7 +29832,7 @@ pkgurl = {https://ctan.org/pkg/gtrcrd}, } -@manual{gtrlib.largetrees, +@manual{gtrlib-largetrees, title = {The \texttt{gtrlib.largetrees} package}, subtitle = {Library for genealogytree aiming at large trees}, author = {Richard Grewe}, @@ -29818,7 +29840,7 @@ version = {1.2b}, license = {lppl1.2}, url = {https://mirror.ctan.org/macros/latex/contrib/gtrlib-largetrees}, - pkgurl = {https://ctan.org/pkg/gtrlib.largetrees}, + pkgurl = {https://ctan.org/pkg/gtrlib-largetrees}, } @manual{gu, @@ -29885,7 +29907,7 @@ pkgurl = {https://ctan.org/pkg/guide-latex-fr}, } -@manual{GuIT-corso, +@manual{guit-corso, title = {The \texttt{GuIT-corso} package}, subtitle = {Introduzione al mondo di \LaTeX{}}, author = {Maurizio W. Himmelmann and Emiliano Giovanni Vavassori and Fabiano Busdraghi}, @@ -29893,7 +29915,7 @@ version = {1.0}, license = {nocommercial}, url = {https://mirror.ctan.org/info/italian/GuIT/corso_guit}, - pkgurl = {https://ctan.org/pkg/GuIT-corso}, + pkgurl = {https://ctan.org/pkg/guit-corso}, } @manual{guitar, @@ -29935,7 +29957,7 @@ pkgurl = {https://ctan.org/pkg/guitartabs}, } -@manual{GuITbeamer, +@manual{guitbeamer, title = {The \texttt{GuITbeamer} package}, subtitle = {Beamer-based class for GuIT presentations}, author = {Emiliano Giovanni Vavassori}, @@ -29943,13 +29965,13 @@ version = {0.4}, license = {nocommercial}, url = {https://mirror.ctan.org/macros/latex/contrib/GuIT/guitbeamer}, - pkgurl = {https://ctan.org/pkg/GuITbeamer}, + pkgurl = {https://ctan.org/pkg/guitbeamer}, note = {The guitbeamer class is written to simplify the preparation of presentations on \LaTeX{} to members of GuIT. The class is based on .}, } -@manual{GuITlogo, +@manual{guitlogo, title = {The \texttt{GuITlogo} package}, subtitle = {Macros for typesetting the GuIT logo}, author = {Emanuele Vicentini}, @@ -29957,7 +29979,7 @@ version = {1.0.0-alpha.4}, license = {lppl1.3a}, url = {https://mirror.ctan.org/macros/latex/contrib/GuIT/GuITlogo}, - pkgurl = {https://ctan.org/pkg/GuITlogo}, + pkgurl = {https://ctan.org/pkg/guitlogo}, } @manual{gurmukhi-singh, @@ -29992,7 +30014,7 @@ pkgurl = {https://ctan.org/pkg/gurps}, } -@manual{GUTenberg, +@manual{gutenberg, title = {The \texttt{GUTenberg} package}, subtitle = {French TeX Users Group information}, author = {Jérémy Just}, @@ -30000,7 +30022,7 @@ version = {}, license = {cc-by-4}, url = {https://mirror.ctan.org/usergrps/gutenberg}, - pkgurl = {https://ctan.org/pkg/GUTenberg}, + pkgurl = {https://ctan.org/pkg/gutenberg}, } @manual{gv-savepos, @@ -30166,7 +30188,7 @@ pkgurl = {https://ctan.org/pkg/handout}, } -@manual{handoutWithNotes, +@manual{handoutwithnotes, title = {The \texttt{handoutWithNotes} package}, subtitle = {Create Handouts with notes from your \LaTeX{} beamer presentation}, author = {Guido Diepen and Marei Peischl}, @@ -30174,7 +30196,7 @@ version = {1.3}, license = {lppl1.3c}, url = {https://mirror.ctan.org/macros/latex/contrib/handoutwithnotes}, - pkgurl = {https://ctan.org/pkg/handoutWithNotes}, + pkgurl = {https://ctan.org/pkg/handoutwithnotes}, } @manual{hands, @@ -30422,14 +30444,14 @@ pkgurl = {https://ctan.org/pkg/havannah}, } -@manual{hcbundle, +@manual{hc, title = {The \texttt{hcbundle} package}, subtitle = {Replacement for the \LaTeX{} classes}, author = {Christian Siefkes}, date = {2016-06-24}, license = {other-free}, url = {https://mirror.ctan.org/macros/latex/contrib/hc}, - pkgurl = {https://ctan.org/pkg/hcbundle}, + pkgurl = {https://ctan.org/pkg/hc}, note = {A set of replacements for the default \LaTeX{} classes, based upon the bundle and the seminar class. Includes , , @@ -30666,7 +30688,7 @@ pkgurl = {https://ctan.org/pkg/hepnames}, } -@manual{HEPparticles, +@manual{hepparticles, title = {The \texttt{HEPparticles} package}, subtitle = {Macros for typesetting high energy physics particle names}, author = {Andy Buckley}, @@ -30674,7 +30696,7 @@ version = {2.0}, license = {lppl}, url = {https://mirror.ctan.org/macros/latex/contrib/hepparticles}, - pkgurl = {https://ctan.org/pkg/HEPparticles}, + pkgurl = {https://ctan.org/pkg/hepparticles}, } @manual{hepthesis, @@ -30688,7 +30710,7 @@ pkgurl = {https://ctan.org/pkg/hepthesis}, } -@manual{Hepunits, +@manual{hepunits, title = {The \texttt{Hepunits} package}, subtitle = {A set of units useful in high energy physics applications}, author = {Andy Buckley}, @@ -30696,7 +30718,7 @@ version = {2.0.0}, license = {lppl}, url = {https://mirror.ctan.org/macros/latex/contrib/hepunits}, - pkgurl = {https://ctan.org/pkg/Hepunits}, + pkgurl = {https://ctan.org/pkg/hepunits}, note = {Hepunits is a \LaTeX{} package built on the package which adds a collection of useful HEP units to the existing SIunits set. These @@ -31083,7 +31105,7 @@ pkgurl = {https://ctan.org/pkg/hitszbeamer}, } -@manual{HITSZThesis, +@manual{hitszthesis, title = {The \texttt{HITSZThesis} package}, subtitle = {A dissertation template for Harbin Institute of Technology, ShenZhen}, author = {Jingxuan Yang}, @@ -31091,7 +31113,7 @@ version = {3.2.1}, license = {lppl1.3c}, url = {https://mirror.ctan.org/macros/latex/contrib/hitszthesis}, - pkgurl = {https://ctan.org/pkg/HITSZThesis}, + pkgurl = {https://ctan.org/pkg/hitszthesis}, } @manual{hktex, @@ -31105,13 +31127,14 @@ pkgurl = {https://ctan.org/pkg/hktex}, } -@manual{HLaTeX_fonts, +@manual{hlatex-fonts, title = {The \texttt{HLaTeX fonts} package}, subtitle = {A collection of Korean (Hangul) fonts}, author = {Koaunghi Un}, date = {2016-06-24}, license = {other-free}, url = {https://mirror.ctan.org/fonts/korean/HLaTeX}, + pkgurl = {https://ctan.org/pkg/hlatex-fonts}, } @manual{hlatex, @@ -31287,7 +31310,7 @@ positions.}, } -@manual{HPtfm2pl, +@manual{hp2pl, title = {The \texttt{HPtfm2pl} package}, subtitle = {Create TeX PL files from HP AutoFont Support}, author = {Norman Walsh}, @@ -31295,7 +31318,7 @@ version = {1.0b beta}, license = {pd}, url = {https://mirror.ctan.org/support/hp2pl}, - pkgurl = {https://ctan.org/pkg/HPtfm2pl}, + pkgurl = {https://ctan.org/pkg/hp2pl}, } @manual{hp2xx, @@ -31985,7 +32008,7 @@ pkgurl = {https://ctan.org/pkg/hypht1}, } -@manual{HyPlain, +@manual{hyplain, title = {The \texttt{HyPlain} package}, subtitle = {Basic support for multiple languages in Plain TeX}, author = {Enrico Gregorio}, @@ -31993,7 +32016,7 @@ version = {1.0}, license = {pd}, url = {https://mirror.ctan.org/macros/plain/contrib/hyplain}, - pkgurl = {https://ctan.org/pkg/HyPlain}, + pkgurl = {https://ctan.org/pkg/hyplain}, } @manual{i-ching, @@ -32273,7 +32296,7 @@ pkgurl = {https://ctan.org/pkg/idxtex}, } -@manual{IEEEannot, +@manual{ieeeannot, title = {The \texttt{IEEEannot} package}, subtitle = {A sorting version of IEEEtran.bst}, author = {Titus Barik and Michael Shell}, @@ -32281,10 +32304,10 @@ version = {1.11}, license = {artistic}, url = {https://mirror.ctan.org/biblio/bibtex/contrib/misc/IEEEannot.bst}, - pkgurl = {https://ctan.org/pkg/IEEEannot}, + pkgurl = {https://ctan.org/pkg/ieeeannot}, } -@manual{IEEEconf, +@manual{ieeeconf, title = {The \texttt{IEEEconf} package}, subtitle = {Macros for IEEE conference proceedings}, author = {Scott Pakin}, @@ -32292,7 +32315,7 @@ version = {1.4}, license = {lppl}, url = {https://mirror.ctan.org/macros/latex/contrib/IEEEconf}, - pkgurl = {https://ctan.org/pkg/IEEEconf}, + pkgurl = {https://ctan.org/pkg/ieeeconf}, note = {The IEEEconf class implements the dictated by the IEEE Computer Society Press for conference proceedings.}, @@ -32309,7 +32332,7 @@ pkgurl = {https://ctan.org/pkg/ieeepes}, } -@manual{IEEEtran, +@manual{ieeetran, title = {The \texttt{IEEEtran} package}, subtitle = {Document class for IEEE Transactions journals and conferences}, author = {Michael Shell}, @@ -32317,7 +32340,7 @@ version = {1.8b}, license = {lppl1.3}, url = {https://mirror.ctan.org/macros/latex/contrib/IEEEtran}, - pkgurl = {https://ctan.org/pkg/IEEEtran}, + pkgurl = {https://ctan.org/pkg/ieeetran}, } @manual{ieeetrantools, @@ -32338,7 +32361,7 @@ documentation for the package.}, } -@manual{IEEJtran, +@manual{ieejtran, title = {The \texttt{IEEJtran} package}, subtitle = {Unofficial bibliography style file for the Institute of Electrical Engineers of Japan}, author = {Haruki Ejiri}, @@ -32346,7 +32369,7 @@ version = {0.18}, license = {mit}, url = {https://mirror.ctan.org/biblio/bibtex/contrib/ieejtran}, - pkgurl = {https://ctan.org/pkg/IEEJtran}, + pkgurl = {https://ctan.org/pkg/ieejtran}, note = {This package provides an BibTeX style for authors of the Institute of Electrical Engineers of Japan (IEEJ) transactions journals and conferences.}, @@ -32367,8 +32390,8 @@ title = {The \texttt{iexec} package}, subtitle = {Execute shell commands and input their output}, author = {Yegor Bugayenko}, - date = {2022-10-01}, - version = {0.6.1}, + date = {2022-10-09}, + version = {0.7.0}, license = {mit}, url = {https://mirror.ctan.org/macros/latex/contrib/iexec}, pkgurl = {https://ctan.org/pkg/iexec}, @@ -32773,7 +32796,7 @@ is used.}, } -@manual{Imake-TeX, +@manual{imaketex, title = {The \texttt{Imake-TeX} package}, subtitle = {An Imake system for TeX}, author = {Rainer Klute}, @@ -32781,10 +32804,10 @@ version = {1.0}, license = {noinfo}, url = {https://mirror.ctan.org/support/imaketex}, - pkgurl = {https://ctan.org/pkg/Imake-TeX}, + pkgurl = {https://ctan.org/pkg/imaketex}, } -@manual{imfellEnglish, +@manual{imfellenglish, title = {The \texttt{imfellEnglish} package}, subtitle = {IM Fell English fonts with \LaTeX{} support}, author = {Bob Tennent}, @@ -32792,7 +32815,7 @@ version = {}, license = {ofl}, url = {https://mirror.ctan.org/fonts/imfellenglish}, - pkgurl = {https://ctan.org/pkg/imfellEnglish}, + pkgurl = {https://ctan.org/pkg/imfellenglish}, } @manual{imfellflowers, @@ -32872,7 +32895,7 @@ pkgurl = {https://ctan.org/pkg/imsproc}, } -@manual{IMTEKda, +@manual{imtekda, title = {The \texttt{IMTEKda} package}, subtitle = {IMTEK thesis class}, author = {Simon Dreher}, @@ -32880,7 +32903,7 @@ version = {1.7}, license = {lppl}, url = {https://mirror.ctan.org/macros/latex/contrib/imtekda}, - pkgurl = {https://ctan.org/pkg/IMTEKda}, + pkgurl = {https://ctan.org/pkg/imtekda}, } @manual{incgraph, @@ -32894,7 +32917,7 @@ pkgurl = {https://ctan.org/pkg/incgraph}, } -@manual{includeRnw, +@manual{includernw, title = {The \texttt{includeRnw} package}, subtitle = {Include .Rnw inside .tex}, author = {Andreas Storvik Strauman}, @@ -32902,7 +32925,7 @@ version = {0.1.0}, license = {lppl1.3c}, url = {https://mirror.ctan.org/macros/latex/contrib/includernw}, - pkgurl = {https://ctan.org/pkg/includeRnw}, + pkgurl = {https://ctan.org/pkg/includernw}, } @manual{includex, @@ -33298,7 +33321,7 @@ pkgurl = {https://ctan.org/pkg/inslrmin}, } -@manual{Install-LaTeX-Guide-zh-cn, +@manual{install-latex-guide-zh-cn, title = {The \texttt{Install-LaTeX-Guide-zh-cn} package}, subtitle = {A short introduction to \LaTeX{} installation written in Chinese}, author = {Ran Wang}, @@ -33306,7 +33329,7 @@ version = {2022.10.1}, license = {lppl1.3c}, url = {https://mirror.ctan.org/info/install-latex-guide-zh-cn}, - pkgurl = {https://ctan.org/pkg/Install-LaTeX-Guide-zh-cn}, + pkgurl = {https://ctan.org/pkg/install-latex-guide-zh-cn}, } @manual{installfont, @@ -33649,14 +33672,14 @@ is probably a better bet, nowadays.}, } -@manual{isi2bib-vim, +@manual{isi2bib, title = {The \texttt{isi2bib-vim} package}, subtitle = {Vim script to convert bib database from ISI to BibTeX format}, author = {Ajit Thakkar}, date = {2016-06-24}, license = {lppl}, url = {https://mirror.ctan.org/support/vim/isi2bib.vim}, - pkgurl = {https://ctan.org/pkg/isi2bib-vim}, + pkgurl = {https://ctan.org/pkg/isi2bib}, } @manual{isi2bibtex, @@ -33670,14 +33693,14 @@ pkgurl = {https://ctan.org/pkg/isi2bibtex}, } -@manual{ISO-TeX, +@manual{iso-tex, title = {The \texttt{ISO-TeX} package}, subtitle = {Display (La)TeX accented letters in GNU Emacs}, author = {Gerd Neugebauer}, date = {2016-06-24}, license = {gpl}, url = {https://mirror.ctan.org/support/iso-tex}, - pkgurl = {https://ctan.org/pkg/ISO-TeX}, + pkgurl = {https://ctan.org/pkg/iso-tex}, } @manual{iso, @@ -33893,14 +33916,14 @@ which package has wider coverage.}, } -@manual{iTe, +@manual{ite, title = {The \texttt{iTe} package}, subtitle = {Interactive TeX editor}, author = {Wolfgang Kühn}, date = {2016-06-24}, license = {gpl2}, url = {https://mirror.ctan.org/support/ite}, - pkgurl = {https://ctan.org/pkg/iTe}, + pkgurl = {https://ctan.org/pkg/ite}, } @manual{ithyph, @@ -34098,14 +34121,14 @@ superseded by .}, } -@manual{jas99_m, +@manual{jas99m, title = {The \texttt{jas99\_m} package}, subtitle = {BibTeX style for American Meteorological Society (AMS)}, author = {Ryo Furue}, date = {2016-06-24}, license = {pd}, url = {https://mirror.ctan.org/obsolete/biblio/bibtex/contrib/misc/jas99_m.bst}, - pkgurl = {https://ctan.org/pkg/jas99_m}, + pkgurl = {https://ctan.org/pkg/jas99m}, } @manual{jasthesis, @@ -34119,7 +34142,7 @@ pkgurl = {https://ctan.org/pkg/jasthesis}, } -@manual{JavaBib, +@manual{javabib, title = {The \texttt{JavaBib} package}, subtitle = {A BibTeX file manager written in Java}, author = {{Unknown}}, @@ -34127,7 +34150,7 @@ version = {III}, license = {noinfo}, url = {https://mirror.ctan.org/biblio/bibtex/utils/JavaBib}, - pkgurl = {https://ctan.org/pkg/JavaBib}, + pkgurl = {https://ctan.org/pkg/javabib}, } @manual{javadoc, @@ -34140,14 +34163,14 @@ pkgurl = {https://ctan.org/pkg/javadoc}, } -@manual{javaDVI, +@manual{javadvi, title = {The \texttt{javaDVI} package}, subtitle = {DVI viewer and printer coded in Java}, author = {James Hurt}, date = {2016-06-24}, license = {lppl}, url = {https://mirror.ctan.org/dviware/javadvi}, - pkgurl = {https://ctan.org/pkg/javaDVI}, + pkgurl = {https://ctan.org/pkg/javadvi}, note = {javaDVI is a DVI viewer and printer coded in Java, and running under the Java RTE 1.3 using the . @@ -34155,14 +34178,14 @@ for use with javaDVI.}, } -@manual{javascript_TeXed, +@manual{javascript-texed, title = {The \texttt{javascript\_TeXed} package}, subtitle = {Small MikTeX-editor for Win32 Intel platform}, author = {Nick Yasko}, date = {2016-06-24}, license = {nocommercial}, url = {https://mirror.ctan.org/support/javascript_TeXed}, - pkgurl = {https://ctan.org/pkg/javascript_TeXed}, + pkgurl = {https://ctan.org/pkg/javascript-texed}, } @manual{javatex, @@ -34187,14 +34210,14 @@ pkgurl = {https://ctan.org/pkg/jbact}, } -@manual{JBibtexManager, +@manual{jbibtexmanager, title = {The \texttt{JBibtexManager} package}, subtitle = {Managing citations in BibTeX format}, author = {Nizar Batada}, date = {2017-04-18}, license = {lppl}, url = {https://mirror.ctan.org/biblio/bibtex/utils/jbibtexmanager}, - pkgurl = {https://ctan.org/pkg/JBibtexManager}, + pkgurl = {https://ctan.org/pkg/jbibtexmanager}, } @manual{jcc, @@ -34282,7 +34305,7 @@ pkgurl = {https://ctan.org/pkg/jhep}, } -@manual{jIEEEtran, +@manual{jieeetran, title = {The \texttt{jIEEEtran} package}, subtitle = {UnofficiaL BibTeX style for citing Japanese articles in IEEE format}, author = {Haruki Ejiri}, @@ -34290,7 +34313,7 @@ version = {0.18}, license = {mit}, url = {https://mirror.ctan.org/biblio/bibtex/contrib/jieeetran}, - pkgurl = {https://ctan.org/pkg/jIEEEtran}, + pkgurl = {https://ctan.org/pkg/jieeetran}, note = {This package provides an BibTeX style for authors trying to cite Japanese articles in the Institute of Electrical and Electronics Engineers (IEEE) format.}, @@ -34528,6 +34551,7 @@ version = {1.8}, license = {nosell}, url = {https://mirror.ctan.org/support/jpeg2ps}, + pkgurl = {https://ctan.org/pkg/jpeg2ps}, } @manual{jphysiol, @@ -34541,7 +34565,7 @@ pkgurl = {https://ctan.org/pkg/jphysiol}, } -@manual{JPicEdt, +@manual{jpicedt, title = {The \texttt{JPicEdt} package}, subtitle = {A graphical editor generating \LaTeX{} commands}, author = {Sylvain Reynal and Vincent Belaïche}, @@ -34549,7 +34573,7 @@ version = {1.3.2}, license = {gpl}, url = {https://mirror.ctan.org/graphics/jpicedt}, - pkgurl = {https://ctan.org/pkg/JPicEdt}, + pkgurl = {https://ctan.org/pkg/jpicedt}, } @manual{jpneduenumerate, @@ -34760,7 +34784,7 @@ pkgurl = {https://ctan.org/pkg/jurarsp}, } -@manual{JustFontItTE, +@manual{justfontitte, title = {The \texttt{JustFontItTE} package}, subtitle = {JustFontIt TeX Edition}, author = {Alexei Kostin}, @@ -34768,7 +34792,7 @@ version = {1.1}, license = {nosell}, url = {https://mirror.ctan.org/fonts/utilities/JustFontItTE}, - pkgurl = {https://ctan.org/pkg/JustFontItTE}, + pkgurl = {https://ctan.org/pkg/justfontitte}, } @manual{jvlisting, @@ -35193,14 +35217,14 @@ pkgurl = {https://ctan.org/pkg/kix}, } -@manual{KIXfont, +@manual{kixfont, title = {The \texttt{KIXfont} package}, subtitle = {A font for KIX codes}, author = {Rick van Rein}, date = {2016-06-24}, license = {other-free}, url = {https://mirror.ctan.org/fonts/kixfont}, - pkgurl = {https://ctan.org/pkg/KIXfont}, + pkgurl = {https://ctan.org/pkg/kixfont}, } @manual{klinz, @@ -35654,7 +35678,7 @@ pkgurl = {https://ctan.org/pkg/ksp-thesis}, } -@manual{KTeXShell, +@manual{ktexshell, title = {The \texttt{KTeXShell} package}, subtitle = {Graphical frontend to TeX}, author = {Arnd Fischer}, @@ -35662,7 +35686,7 @@ version = {0.4.0}, license = {gpl}, url = {https://mirror.ctan.org/obsolete/support/ktexshell}, - pkgurl = {https://ctan.org/pkg/KTeXShell}, + pkgurl = {https://ctan.org/pkg/ktexshell}, } @manual{ktv-texdata, @@ -36219,7 +36243,7 @@ pkgurl = {https://ctan.org/pkg/lamstex-index}, } -@manual{LamsTeX, +@manual{lamstex, title = {The \texttt{LamsTeX} package}, subtitle = {A merge of the best in AMS-TeX and \LaTeX{}}, author = {Michael Spivak}, @@ -36227,7 +36251,7 @@ version = {2.01}, license = {pd}, url = {https://mirror.ctan.org/macros/lamstex}, - pkgurl = {https://ctan.org/pkg/LamsTeX}, + pkgurl = {https://ctan.org/pkg/lamstex}, } @manual{landscape, @@ -36359,7 +36383,7 @@ says: Page N of M.}, } -@manual{LaTable, +@manual{latable, title = {The \texttt{LaTable} package}, subtitle = {A near-WYSIWYG editor for \LaTeX{} tables}, author = {Alex A. Denisov}, @@ -36367,7 +36391,7 @@ version = {0.7}, license = {nosell}, url = {https://mirror.ctan.org/support/latable}, - pkgurl = {https://ctan.org/pkg/LaTable}, + pkgurl = {https://ctan.org/pkg/latable}, } @manual{lated, @@ -36478,7 +36502,7 @@ environment will pretty-print it.}, } -@manual{LaTeX-brochure, +@manual{latex-brochure, title = {The \texttt{LaTeX-brochure} package}, subtitle = {A publicity flyer for \LaTeX{}}, author = {Peter Flynn}, @@ -36486,7 +36510,7 @@ version = {}, license = {lppl}, url = {https://mirror.ctan.org/info/latex-brochure}, - pkgurl = {https://ctan.org/pkg/LaTeX-brochure}, + pkgurl = {https://ctan.org/pkg/latex-brochure}, } @manual{latex-course, @@ -36505,7 +36529,7 @@ .}, } -@manual{cyrillic, +@manual{latex-cyrillic, title = {The \texttt{cyrillic} package}, subtitle = {Support for Cyrillic fonts in \LaTeX{}}, author = {{The LaTeX Project Team}}, @@ -36513,7 +36537,7 @@ version = {2022-06-01-PL1}, license = {lppl1.3}, url = {https://mirror.ctan.org/macros/latex/required/cyrillic}, - pkgurl = {https://ctan.org/pkg/cyrillic}, + pkgurl = {https://ctan.org/pkg/latex-cyrillic}, } @manual{latex-doc-ptr, @@ -36771,7 +36795,7 @@ pkgurl = {https://ctan.org/pkg/latex-pro-pragmatiky}, } -@manual{LaTeX-Referenz, +@manual{latex-referenz, title = {The \texttt{LaTeX-Referenz} package}, subtitle = {Examples from the book "LaTeX Referenz"}, author = {Herbert Voß}, @@ -36779,7 +36803,7 @@ version = {2}, license = {lppl1.3}, url = {https://mirror.ctan.org/info/examples/LaTeX-Referenz}, - pkgurl = {https://ctan.org/pkg/LaTeX-Referenz}, + pkgurl = {https://ctan.org/pkg/latex-referenz}, } @manual{latex-refsheet, @@ -36821,7 +36845,7 @@ pkgurl = {https://ctan.org/pkg/latex-tabellen}, } -@manual{LaTeX-tds, +@manual{latex-tds, title = {The \texttt{LaTeX-tds} package}, subtitle = {A structured copy of the \LaTeX{} distribution}, author = {Heiko Oberdiek}, @@ -36829,7 +36853,7 @@ version = {}, license = {lppl1.3}, url = {https://mirror.ctan.org/obsolete/macros/latex/contrib/latex-tds}, - pkgurl = {https://ctan.org/pkg/LaTeX-tds}, + pkgurl = {https://ctan.org/pkg/latex-tds}, } @manual{latex-tools-dev, @@ -36907,7 +36931,7 @@ and paper sizes correctly with both pdfLaTeX and LuaLaTeX.}, } -@manual{LaTeX-veryshortguide, +@manual{latex-veryshortguide, title = {The \texttt{LaTeX-veryshortguide} package}, subtitle = {The Very Short Guide to \LaTeX{}}, author = {Peter Flynn}, @@ -36915,7 +36939,7 @@ version = {0.7}, license = {lppl1.3}, url = {https://mirror.ctan.org/info/latex-veryshortguide}, - pkgurl = {https://ctan.org/pkg/LaTeX-veryshortguide}, + pkgurl = {https://ctan.org/pkg/latex-veryshortguide}, } @manual{latex-via-exemplos, @@ -37004,7 +37028,7 @@ pkgurl = {https://ctan.org/pkg/latex2man}, } -@manual{Latex2Nemeth, +@manual{latex2nemeth, title = {The \texttt{Latex2Nemeth} package}, subtitle = {Convert \LaTeX{} source to Braille with math in Nemeth}, author = {Andreas Papasalouros and Antonis Tsolomitis}, @@ -37012,7 +37036,7 @@ version = {1.1.1}, license = {gpl3}, url = {https://mirror.ctan.org/support/latex2nemeth}, - pkgurl = {https://ctan.org/pkg/Latex2Nemeth}, + pkgurl = {https://ctan.org/pkg/latex2nemeth}, } @manual{latex2rtf, @@ -37049,7 +37073,7 @@ beginner and the advanced \LaTeX{} user in mind.}, } -@manual{LaTeX4Musicians, +@manual{latex4musicians, title = {The \texttt{LaTeX4Musicians} package}, subtitle = {A guide for combining \LaTeX{} and music}, author = {Guido Gonzato}, @@ -37057,7 +37081,7 @@ version = {1.0.1}, license = {fdl}, url = {https://mirror.ctan.org/info/latex4musicians}, - pkgurl = {https://ctan.org/pkg/LaTeX4Musicians}, + pkgurl = {https://ctan.org/pkg/latex4musicians}, } @manual{latex4wp-it, @@ -37212,7 +37236,7 @@ pkgurl = {https://ctan.org/pkg/latexcourse-rug}, } -@manual{LaTeXDB, +@manual{latexdb, title = {The \texttt{LaTeXDB} package}, subtitle = {Integrates \LaTeX{} and SQL databases}, author = {Hans-Georg Eßer}, @@ -37220,7 +37244,7 @@ version = {0.3}, license = {gpl}, url = {https://mirror.ctan.org/support/latexdb}, - pkgurl = {https://ctan.org/pkg/LaTeXDB}, + pkgurl = {https://ctan.org/pkg/latexdb}, } @manual{latexdemo, @@ -37295,7 +37319,7 @@ pkgurl = {https://ctan.org/pkg/latexfileversion}, } -@manual{LaTeXgit, +@manual{latexgit, title = {The \texttt{LaTeXgit} package}, subtitle = {A \LaTeX{} git wrapper}, author = {Camil Staps}, @@ -37303,7 +37327,7 @@ version = {}, license = {gpl3}, url = {https://mirror.ctan.org/macros/latex/contrib/latexgit}, - pkgurl = {https://ctan.org/pkg/LaTeXgit}, + pkgurl = {https://ctan.org/pkg/latexgit}, } @manual{latexindent, @@ -37349,7 +37373,7 @@ pkgurl = {https://ctan.org/pkg/latexmk}, } -@manual{LaTexMng, +@manual{latexmng, title = {The \texttt{LaTexMng} package}, subtitle = {An integrated development environment for Windows}, author = {Petr Vabishchevich}, @@ -37357,10 +37381,10 @@ version = {2.0}, license = {shareware}, url = {https://mirror.ctan.org/systems/win32/latexmng}, - pkgurl = {https://ctan.org/pkg/LaTexMng}, + pkgurl = {https://ctan.org/pkg/latexmng}, } -@manual{latexMP, +@manual{latexmp, title = {The \texttt{latexMP} package}, subtitle = {Interface for \LaTeX{}-based typesetting in MetaPost}, author = {Jens-Uwe Morawski}, @@ -37368,7 +37392,7 @@ version = {1.2.1}, license = {pd}, url = {https://mirror.ctan.org/graphics/metapost/contrib/macros/latexmp}, - pkgurl = {https://ctan.org/pkg/latexMP}, + pkgurl = {https://ctan.org/pkg/latexmp}, note = {The MetaPost package latexMP implements a user-friendly interface to access \LaTeX{}-based typesetting capabilities in MetaPost. The text to be typeset is given as string. This @@ -37404,7 +37428,7 @@ commands.}, } -@manual{LaTeXPiX, +@manual{latexpix, title = {The \texttt{LaTeXPiX} package}, subtitle = {LaTeX picture editor for Windows}, author = {N. J. H. M. van Beurden}, @@ -37412,7 +37436,7 @@ version = {}, license = {nosource}, url = {https://mirror.ctan.org/systems/win32/latexpix}, - pkgurl = {https://ctan.org/pkg/LaTeXPiX}, + pkgurl = {https://ctan.org/pkg/latexpix}, } @manual{latexrelease, @@ -37426,7 +37450,7 @@ pkgurl = {https://ctan.org/pkg/latexrelease}, } -@manual{LatexRender, +@manual{latexrender, title = {The \texttt{LatexRender} package}, subtitle = {Use \LaTeX{} in PHP programs}, author = {Steve Mayer and Benjamin Zeiss}, @@ -37434,7 +37458,7 @@ version = {0.8}, license = {gpl}, url = {https://mirror.ctan.org/support/latexrender}, - pkgurl = {https://ctan.org/pkg/LatexRender}, + pkgurl = {https://ctan.org/pkg/latexrender}, note = {LatexRender is a set of scripts that allows one to call \LaTeX{} from PHP programs; in particular, this allows users to enter \LaTeX{} commands in a forum and, on posting, have it replaced by @@ -37446,14 +37470,14 @@ .}, } -@manual{LaTeX-WIDE, +@manual{latexwide, title = {The \texttt{LaTeX-WIDE} package}, subtitle = {Multifunctional editor for \LaTeX{}}, author = {Yuri Lubenets}, date = {2016-06-24}, license = {nocommercial}, url = {https://mirror.ctan.org/systems/win32/LaTeX_WIDE}, - pkgurl = {https://ctan.org/pkg/LaTeX-WIDE}, + pkgurl = {https://ctan.org/pkg/latexwide}, } @manual{latexwizard, @@ -37533,7 +37557,7 @@ pkgurl = {https://ctan.org/pkg/lato}, } -@manual{Layaureo, +@manual{layaureo, title = {The \texttt{Layaureo} package}, subtitle = {A package to improve the A4 page layout}, author = {Fabiano Busdraghi}, @@ -37541,7 +37565,7 @@ version = {0.2}, license = {lppl}, url = {https://mirror.ctan.org/macros/latex/contrib/layaureo}, - pkgurl = {https://ctan.org/pkg/Layaureo}, + pkgurl = {https://ctan.org/pkg/layaureo}, note = {This package produces a wide page layout for documents that use A4 paper size. Moreover, LayAureo provides both a simple hook for leaving an empty space which is required if pages are @@ -37614,14 +37638,14 @@ pkgurl = {https://ctan.org/pkg/lcd}, } -@manual{LCDF-typetools, +@manual{lcdf-typetools, title = {The \texttt{LCDF-typetools} package}, subtitle = {A bundle of outline font manipulation tools}, author = {Eddie Kohler}, date = {2020-02-20}, license = {gpl}, url = {https://mirror.ctan.org/fonts/utilities/lcdf-typetools}, - pkgurl = {https://ctan.org/pkg/LCDF-typetools}, + pkgurl = {https://ctan.org/pkg/lcdf-typetools}, } @manual{lcg, @@ -37768,7 +37792,7 @@ pkgurl = {https://ctan.org/pkg/lectureslides}, } -@manual{LEd, +@manual{led, title = {The \texttt{LEd} package}, subtitle = {An environment for \LaTeX{} document development}, author = {Sebastian Deorowicz and Adam Skorczynski}, @@ -37776,7 +37800,7 @@ version = {0.46 beta}, license = {nosource}, url = {https://mirror.ctan.org/support/LEd}, - pkgurl = {https://ctan.org/pkg/LEd}, + pkgurl = {https://ctan.org/pkg/led}, } @manual{ledarab, @@ -37833,7 +37857,7 @@ pkgurl = {https://ctan.org/pkg/leftindex}, } -@manual{LEIletter, +@manual{leiletter, title = {The \texttt{LEIletter} package}, subtitle = {A letter class for Leiden University}, author = {Michiel Kreutzer}, @@ -37841,7 +37865,7 @@ version = {1.3}, license = {lppl1.3c,cc-by-sa-3}, url = {https://mirror.ctan.org/macros/latex/contrib/leiletter}, - pkgurl = {https://ctan.org/pkg/LEIletter}, + pkgurl = {https://ctan.org/pkg/leiletter}, } @manual{leipzig, @@ -38324,7 +38348,7 @@ pkgurl = {https://ctan.org/pkg/libertinus}, } -@manual{LibertinusT1Math, +@manual{libertinust1math, title = {The \texttt{LibertinusT1Math} package}, subtitle = {A Type 1 font and \LaTeX{} support for Libertinus Math}, author = {Michael Sharpe}, @@ -38332,7 +38356,7 @@ version = {2.0.2}, license = {ofl,lppl}, url = {https://mirror.ctan.org/fonts/libertinust1math}, - pkgurl = {https://ctan.org/pkg/LibertinusT1Math}, + pkgurl = {https://ctan.org/pkg/libertinust1math}, } @manual{libgreek, @@ -38454,14 +38478,14 @@ pkgurl = {https://ctan.org/pkg/liftarm}, } -@manual{LigaTeX, +@manual{ligatex, title = {The \texttt{LigaTeX} package}, subtitle = {Remove unnecessary ligatures}, author = {Gerhard Killesreiter}, date = {2016-06-24}, license = {gpl}, url = {https://mirror.ctan.org/support/ligatex}, - pkgurl = {https://ctan.org/pkg/LigaTeX}, + pkgurl = {https://ctan.org/pkg/ligatex}, note = {LigaTeX removes unnecessary ligatures (accented characters written out as more than one letter) from TeX files (for example, it translates Ҡto “â€). The program @@ -38470,7 +38494,7 @@ language.}, } -@manual{Light_LaTeX_Make, +@manual{light-latex-make, title = {The \texttt{Light \LaTeX{} Make} package}, subtitle = {llmk: A build tool for \LaTeX{} documents}, author = {Takuto Asakura}, @@ -38478,6 +38502,7 @@ version = {1.1.0}, license = {mit}, url = {https://mirror.ctan.org/support/light-latex-make}, + pkgurl = {https://ctan.org/pkg/light-latex-make}, } @manual{ligtype, @@ -38528,14 +38553,14 @@ environments and macros for convenience.}, } -@manual{linearA, +@manual{lineara, title = {The \texttt{linearA} package}, subtitle = {Linear A script fonts}, author = {Apostolos Syropoulos}, date = {2022-04-29}, license = {lppl}, url = {https://mirror.ctan.org/fonts/archaic/linearA}, - pkgurl = {https://ctan.org/pkg/linearA}, + pkgurl = {https://ctan.org/pkg/lineara}, } @manual{linearb, @@ -38965,7 +38990,7 @@ pkgurl = {https://ctan.org/pkg/lkort}, } -@manual{LKproof, +@manual{lkproof, title = {The \texttt{LKproof} package}, subtitle = {LK Proof figure macros}, author = {Makoto Tatsuta}, @@ -38973,7 +38998,7 @@ version = {3.1}, license = {gpl}, url = {https://mirror.ctan.org/macros/latex/contrib/lkproof}, - pkgurl = {https://ctan.org/pkg/LKproof}, + pkgurl = {https://ctan.org/pkg/lkproof}, note = {The package defines a pair of commands and , that are used in constructing LK proof diagrams.}, @@ -40360,7 +40385,7 @@ pkgurl = {https://ctan.org/pkg/lua-typo}, } -@manual{Lua-UCA, +@manual{lua-uca, title = {The \texttt{Lua-UCA} package}, subtitle = {Unicode Collation Algorithm library for Lua}, author = {Michal Hoftich}, @@ -40368,10 +40393,10 @@ version = {0.1b}, license = {mit}, url = {https://mirror.ctan.org/support/lualibs/lua-uca}, - pkgurl = {https://ctan.org/pkg/Lua-UCA}, + pkgurl = {https://ctan.org/pkg/lua-uca}, } -@manual{LuauL, +@manual{lua-ul, title = {The \texttt{LuauL} package}, subtitle = {Underlining for LuaLaTeX}, author = {Marcel Krüger}, @@ -40379,7 +40404,7 @@ version = {0.2.0}, license = {lppl1.3c}, url = {https://mirror.ctan.org/macros/luatex/latex/lua-ul}, - pkgurl = {https://ctan.org/pkg/LuauL}, + pkgurl = {https://ctan.org/pkg/lua-ul}, } @manual{lua-uni-algos, @@ -40640,7 +40665,7 @@ typesetting.}, } -@manual{luaLaTeX-platform, +@manual{lualatex-platform, title = {The \texttt{luaLaTeX-platform} package}, subtitle = {Load platform-specific code into LuaTeX}, author = {Philipp Stephani}, @@ -40648,7 +40673,7 @@ version = {0.1}, license = {other-free}, url = {https://mirror.ctan.org/obsolete/systems/luatex/contrib/lualatex-platform}, - pkgurl = {https://ctan.org/pkg/luaLaTeX-platform}, + pkgurl = {https://ctan.org/pkg/lualatex-platform}, } @manual{lualatex-truncate, @@ -41008,7 +41033,7 @@ pkgurl = {https://ctan.org/pkg/lutabulartools}, } -@manual{LuxiMono, +@manual{luximono, title = {The \texttt{LuxiMono} package}, subtitle = {Free monospace fonts}, author = {Walter A. Schmidt and Keiran Harcombe and Charles Bigelow and Kris Holmes}, @@ -41016,7 +41041,7 @@ version = {}, license = {other-nonfree}, url = {https://mirror.ctan.org/fonts/LuxiMono}, - pkgurl = {https://ctan.org/pkg/LuxiMono}, + pkgurl = {https://ctan.org/pkg/luximono}, note = {LuxiMono is a family of general-purpose monospaced (typewriter) fonts. This distribution contains the fonts in Adobe Type 1 format, and , and \LaTeX{}-related files are @@ -41044,7 +41069,7 @@ pkgurl = {https://ctan.org/pkg/lwc-examples}, } -@manual{LXfonts, +@manual{lxfonts, title = {The \texttt{LXfonts} package}, subtitle = {Set of slide fonts based on CM}, author = {Claudio Beccari}, @@ -41052,7 +41077,7 @@ version = {2.0b}, license = {lppl}, url = {https://mirror.ctan.org/fonts/lxfonts}, - pkgurl = {https://ctan.org/pkg/LXfonts}, + pkgurl = {https://ctan.org/pkg/lxfonts}, } @manual{lxmail, @@ -41106,7 +41131,7 @@ pkgurl = {https://ctan.org/pkg/m-pictex}, } -@manual{M-Tx, +@manual{m-tx, title = {The \texttt{M-Tx} package}, subtitle = {A preprocessor for pmx}, author = {Bob Tennent and Dirk Laurie}, @@ -41114,7 +41139,7 @@ version = {0.63d}, license = {mit}, url = {https://mirror.ctan.org/support/m-tx}, - pkgurl = {https://ctan.org/pkg/M-Tx}, + pkgurl = {https://ctan.org/pkg/m-tx}, note = {M-Tx is a preprocessor to , which is itself a preprocessor to , a music typesetting system. The prime motivation to the @@ -41123,14 +41148,14 @@ continues in use by those who prefer its language.}, } -@manual{m3D, +@manual{m3d, title = {The \texttt{m3D} package}, subtitle = {Extension of plain MetaPost for 3D graphics}, author = {Anthony Phan}, date = {2016-06-24}, license = {lppl}, url = {https://mirror.ctan.org/graphics/metapost/contrib/macros/m3D}, - pkgurl = {https://ctan.org/pkg/m3D}, + pkgurl = {https://ctan.org/pkg/m3d}, } @manual{maad, @@ -41403,7 +41428,7 @@ packages.}, } -@manual{make_latex, +@manual{make-latex, title = {The \texttt{make\_latex} package}, subtitle = {LaTeX Makefile}, author = {David Beasley}, @@ -41411,7 +41436,7 @@ version = {}, license = {noinfo}, url = {https://mirror.ctan.org/support/make_latex}, - pkgurl = {https://ctan.org/pkg/make_latex}, + pkgurl = {https://ctan.org/pkg/make-latex}, } @manual{make4ht, @@ -41476,14 +41501,14 @@ pkgurl = {https://ctan.org/pkg/makecell}, } -@manual{MakeCirc, +@manual{makecirc, title = {The \texttt{MakeCirc} package}, subtitle = {A MetaPost library for drawing electrical circuit diagrams}, author = {Gustavo Sebastián Bustamante Argañaraz}, date = {2016-06-24}, license = {lppl}, url = {https://mirror.ctan.org/graphics/metapost/contrib/macros/makecirc}, - pkgurl = {https://ctan.org/pkg/MakeCirc}, + pkgurl = {https://ctan.org/pkg/makecirc}, } @manual{makecmds, @@ -41559,7 +41584,7 @@ pkgurl = {https://ctan.org/pkg/makeglos}, } -@manual{MakeGlossariesGUI, +@manual{makeglossariesgui, title = {The \texttt{MakeGlossariesGUI} package}, subtitle = {Java GUI alternative to makeglossaries script}, author = {Nicola Talbot}, @@ -41567,7 +41592,7 @@ version = {2.2}, license = {gpl3}, url = {https://mirror.ctan.org/support/makeglossariesgui}, - pkgurl = {https://ctan.org/pkg/MakeGlossariesGUI}, + pkgurl = {https://ctan.org/pkg/makeglossariesgui}, note = {The package provides a Java GUI alternative to the makeglossaries Perl script (supplied by the package). The package @@ -41707,13 +41732,14 @@ pkgurl = {https://ctan.org/pkg/maketable}, } -@manual{Makor_2, +@manual{makor2, title = {The \texttt{Makor 2} package}, subtitle = {Typeset pointed Hebrew using Omega}, author = {Alan Hoenig}, date = {2021-08-26}, license = {lppl}, url = {https://mirror.ctan.org/language/hebrew/makor}, + pkgurl = {https://ctan.org/pkg/makor2}, } @manual{malayalam-latex, @@ -41854,7 +41880,7 @@ package).}, } -@manual{Manuscript, +@manual{manuscript, title = {The \texttt{Manuscript} package}, subtitle = {Emulate look of a document typed on a typewriter}, author = {Matej Cepl}, @@ -41862,7 +41888,7 @@ version = {1.7}, license = {lppl}, url = {https://mirror.ctan.org/macros/latex/contrib/manuscript}, - pkgurl = {https://ctan.org/pkg/Manuscript}, + pkgurl = {https://ctan.org/pkg/manuscript}, } @manual{manyfoot, @@ -41924,7 +41950,7 @@ pkgurl = {https://ctan.org/pkg/marathi}, } -@manual{Marcellus, +@manual{marcellus, title = {The \texttt{Marcellus} package}, subtitle = {Marcellus fonts with \LaTeX{} support}, author = {Bob Tennent}, @@ -41932,7 +41958,7 @@ version = {}, license = {ofl,lppl}, url = {https://mirror.ctan.org/fonts/marcellus}, - pkgurl = {https://ctan.org/pkg/Marcellus}, + pkgurl = {https://ctan.org/pkg/marcellus}, note = {This package provides \LaTeX{}, pdfLaTeX, \XeLaTeX{} and LuaLaTeX support for the Marcellus family of fonts, designed by Brian J. Bonislawsky. @@ -42504,7 +42530,7 @@ pkgurl = {https://ctan.org/pkg/mathsemantics}, } -@manual{MathSpad, +@manual{mathspad, title = {The \texttt{MathSpad} package}, subtitle = {A mathematics-capable word processor with \LaTeX{} output}, author = {Richard Verhoeven}, @@ -42512,7 +42538,7 @@ version = {0.60}, license = {other-free}, url = {https://mirror.ctan.org/support/mathspad}, - pkgurl = {https://ctan.org/pkg/MathSpad}, + pkgurl = {https://ctan.org/pkg/mathspad}, } @manual{mathspec, @@ -42613,7 +42639,7 @@ pkgurl = {https://ctan.org/pkg/mathtools}, } -@manual{MathTrip, +@manual{mathtrip, title = {The \texttt{MathTrip} package}, subtitle = {A trip to the wonderful world of mathematics}, author = {Alain Aubord}, @@ -42621,10 +42647,10 @@ version = {2.8}, license = {nocommercial,lppl,bsd}, url = {https://mirror.ctan.org/info/mathtrip}, - pkgurl = {https://ctan.org/pkg/MathTrip}, + pkgurl = {https://ctan.org/pkg/mathtrip}, } -@manual{MathType, +@manual{mathtype, title = {The \texttt{MathType} package}, subtitle = {Evaluation version of a commercial equation editor}, author = {Bruce Virga and Bob Mathews}, @@ -42632,7 +42658,7 @@ version = {7}, license = {other-nonfree}, url = {https://mirror.ctan.org/support/mathtype}, - pkgurl = {https://ctan.org/pkg/MathType}, + pkgurl = {https://ctan.org/pkg/mathtype}, } @manual{matlab-prettifier, @@ -43140,7 +43166,7 @@ pkgurl = {https://ctan.org/pkg/memoir}, } -@manual{MemoirChapterStyles, +@manual{memoirchapterstyles, title = {The \texttt{MemoirChapterStyles} package}, subtitle = {Chapter styles in memoir class}, author = {Lars Madsen}, @@ -43148,7 +43174,7 @@ version = {1.7e}, license = {lppl}, url = {https://mirror.ctan.org/info/latex-samples/MemoirChapStyles}, - pkgurl = {https://ctan.org/pkg/MemoirChapterStyles}, + pkgurl = {https://ctan.org/pkg/memoirchapterstyles}, } @manual{memory, @@ -43246,7 +43272,7 @@ pkgurl = {https://ctan.org/pkg/menukeys}, } -@manual{MEP_article, +@manual{meparticle, title = {The \texttt{MEP article} package}, subtitle = {Class for Mechanical Engineering Publications}, author = {Silvano Balemi}, @@ -43254,6 +43280,7 @@ version = {}, license = {noinfo}, url = {https://mirror.ctan.org/macros/latex209/contrib/misc/meparticle.sty}, + pkgurl = {https://ctan.org/pkg/meparticle}, } @manual{meper, @@ -43354,7 +43381,7 @@ pkgurl = {https://ctan.org/pkg/metafont-beginners}, } -@manual{Metafont, +@manual{metafont, title = {The \texttt{Metafont} package}, subtitle = {A system for specifying fonts}, author = {Donald E. Knuth}, @@ -43362,7 +43389,7 @@ version = {2.71828182}, license = {knuth}, url = {https://mirror.ctan.org/systems/knuth/dist/mf}, - pkgurl = {https://ctan.org/pkg/Metafont}, + pkgurl = {https://ctan.org/pkg/metafont}, } @manual{metafp, @@ -43445,7 +43472,7 @@ pkgurl = {https://ctan.org/pkg/metaobj}, } -@manual{MetaPlot, +@manual{metaplot, title = {The \texttt{MetaPlot} package}, subtitle = {Plot-manipulation macros for use in MetaPost}, author = {Brooks Moses}, @@ -43453,7 +43480,7 @@ version = {0.91}, license = {lppl}, url = {https://mirror.ctan.org/graphics/metaplot}, - pkgurl = {https://ctan.org/pkg/MetaPlot}, + pkgurl = {https://ctan.org/pkg/metaplot}, note = {MetaPlot is a set of MetaPost macros for manipulating}, } @@ -43468,13 +43495,14 @@ pkgurl = {https://ctan.org/pkg/metapost-colorbrewer}, } -@manual{MetaPost_examples, +@manual{metapost-examples, title = {The \texttt{MetaPost examples} package}, subtitle = {Example drawings using MetaPost}, author = {Vincent Zoonekynd}, date = {2016-06-24}, license = {other-free}, url = {https://mirror.ctan.org/info/metapost/examples}, + pkgurl = {https://ctan.org/pkg/metapost-examples}, } @manual{metapost-matlab, @@ -43511,7 +43539,7 @@ pkgurl = {https://ctan.org/pkg/metastr}, } -@manual{METATeX, +@manual{metatex, title = {The \texttt{METATeX} package}, subtitle = {Incorporate Metafont pictures in TeX source}, author = {Ramón Casares}, @@ -43519,7 +43547,7 @@ version = {1.1}, license = {gpl}, url = {https://mirror.ctan.org/macros/plain/contrib/metatex}, - pkgurl = {https://ctan.org/pkg/METATeX}, + pkgurl = {https://ctan.org/pkg/metatex}, } @manual{metatype1, @@ -43826,7 +43854,7 @@ of .}, } -@manual{MFwL, +@manual{mfwl, title = {The \texttt{MFwL} package}, subtitle = {Making friends with \LaTeX{}}, author = {Rohit Vishal Kumar}, @@ -43834,10 +43862,10 @@ version = {2.00}, license = {gpl}, url = {https://mirror.ctan.org/info/MFwL}, - pkgurl = {https://ctan.org/pkg/MFwL}, + pkgurl = {https://ctan.org/pkg/mfwl}, } -@manual{mglTeX, +@manual{mgltex, title = {The \texttt{mglTeX} package}, subtitle = {High-quality graphics from MGL scripts embedded in \LaTeX{} documents}, author = {Diego Sejas Viscarra and Alexey Balakin}, @@ -43845,7 +43873,7 @@ version = {4.2}, license = {gpl3,cc-by-sa-3}, url = {https://mirror.ctan.org/graphics/mgltex}, - pkgurl = {https://ctan.org/pkg/mglTeX}, + pkgurl = {https://ctan.org/pkg/mgltex}, } @manual{mh, @@ -43940,7 +43968,7 @@ pkgurl = {https://ctan.org/pkg/miama}, } -@manual{MicroIMP, +@manual{microimp, title = {The \texttt{MicroIMP} package}, subtitle = {A TeX-based word processor}, author = {{MicroPress}}, @@ -43948,7 +43976,7 @@ version = {0.18}, license = {nocommercial}, url = {https://mirror.ctan.org/systems/win32/microimp}, - pkgurl = {https://ctan.org/pkg/MicroIMP}, + pkgurl = {https://ctan.org/pkg/microimp}, } @manual{microtype-de, @@ -43973,7 +44001,7 @@ pkgurl = {https://ctan.org/pkg/microtype}, } -@manual{Mid2TeX/Free, +@manual{mid2tex, title = {The \texttt{Mid2TeX/Free} package}, subtitle = {Convert MIDI to MusicTeX input}, author = {Andreas Köhler}, @@ -43981,7 +44009,7 @@ version = {}, license = {noinfo}, url = {https://mirror.ctan.org/support/mid2tex}, - pkgurl = {https://ctan.org/pkg/Mid2TeX/Free}, + pkgurl = {https://ctan.org/pkg/mid2tex}, } @manual{midfloat, @@ -43995,7 +44023,7 @@ pkgurl = {https://ctan.org/pkg/midfloat}, } -@manual{Midi2TeX/Free, +@manual{midi2tex, title = {The \texttt{Midi2TeX/Free} package}, subtitle = {Convert MIDI to MusicTeX input}, author = {Hans Kuykens and Ad Verbruggen}, @@ -44003,7 +44031,7 @@ version = {1.3}, license = {noinfo}, url = {https://mirror.ctan.org/support/midi2tex}, - pkgurl = {https://ctan.org/pkg/Midi2TeX/Free}, + pkgurl = {https://ctan.org/pkg/midi2tex}, } @manual{midnight, @@ -44135,7 +44163,7 @@ pkgurl = {https://ctan.org/pkg/milstd}, } -@manual{MilSymb, +@manual{milsymb, title = {The \texttt{MilSymb} package}, subtitle = {LaTeX package for TikZ based drawing of military symbols as per NATO APP-6(C)}, author = {Damian Crosby}, @@ -44143,7 +44171,7 @@ version = {1.02}, license = {cc-by-sa-4}, url = {https://mirror.ctan.org/graphics/pgf/contrib/milsymb}, - pkgurl = {https://ctan.org/pkg/MilSymb}, + pkgurl = {https://ctan.org/pkg/milsymb}, note = {The package offers commands to draw military symbols as per . It has a set of commands for drawing all symbols found in the document @@ -44357,14 +44385,14 @@ pkgurl = {https://ctan.org/pkg/minipage-marginpar}, } -@manual{MiniPlot, +@manual{miniplot, title = {The \texttt{MiniPlot} package}, subtitle = {A package for easy figure arrangement}, author = {Tobias Wahl}, date = {2016-06-24}, license = {lppl}, url = {https://mirror.ctan.org/macros/latex/contrib/miniplot}, - pkgurl = {https://ctan.org/pkg/MiniPlot}, + pkgurl = {https://ctan.org/pkg/miniplot}, } @manual{minitoc, @@ -44572,7 +44600,7 @@ pkgurl = {https://ctan.org/pkg/mkpkfontdir}, } -@manual{mkstmp, +@manual{mkstmp_pro, title = {The \texttt{mkstmp} package}, subtitle = {Provides a simple workflow for creating custom stamps}, author = {Donald P. Story}, @@ -44580,7 +44608,7 @@ version = {1.1}, license = {lppl}, url = {https://mirror.ctan.org/macros/latex/contrib/mkstmpdad}, - pkgurl = {https://ctan.org/pkg/mkstmp}, + pkgurl = {https://ctan.org/pkg/mkstmp_pro}, } @manual{mla-paper, @@ -44659,7 +44687,7 @@ pkgurl = {https://ctan.org/pkg/mlist}, } -@manual{MLMath, +@manual{mlmath, title = {The \texttt{MLMath} package}, subtitle = {Mathematical notation for Machine Learning}, author = {Zheng Ma}, @@ -44667,10 +44695,10 @@ version = {1.0.0}, license = {lppl1.3c}, url = {https://mirror.ctan.org/macros/latex/contrib/mlmath}, - pkgurl = {https://ctan.org/pkg/MLMath}, + pkgurl = {https://ctan.org/pkg/mlmath}, } -@manual{MLModern, +@manual{mlmodern, title = {The \texttt{MLModern} package}, subtitle = {A blacker Type 1 version of Computer Modern, with multilingual support}, author = {Daniel Benjamin Miller}, @@ -44678,7 +44706,7 @@ version = {1.2}, license = {lppl1.3c}, url = {https://mirror.ctan.org/fonts/mlmodern}, - pkgurl = {https://ctan.org/pkg/MLModern}, + pkgurl = {https://ctan.org/pkg/mlmodern}, } @manual{mltex-ltx, @@ -44834,7 +44862,7 @@ pkgurl = {https://ctan.org/pkg/mnras}, } -@manual{MnSymbol, +@manual{mnsymbol, title = {The \texttt{MnSymbol} package}, subtitle = {Mathematical symbol font for Adobe MinionPro}, author = {Achim Blumensath}, @@ -44842,7 +44870,7 @@ version = {1.4}, license = {pd}, url = {https://mirror.ctan.org/fonts/mnsymbol}, - pkgurl = {https://ctan.org/pkg/MnSymbol}, + pkgurl = {https://ctan.org/pkg/mnsymbol}, } @manual{mnttex, @@ -45223,7 +45251,7 @@ pkgurl = {https://ctan.org/pkg/movie15}, } -@manual{threed, +@manual{mp3d, title = {The \texttt{threed} package}, subtitle = {3D animations}, author = {Denis B. Roegel}, @@ -45231,7 +45259,7 @@ version = {1.34}, license = {lppl}, url = {https://mirror.ctan.org/graphics/metapost/contrib/macros/mp3d}, - pkgurl = {https://ctan.org/pkg/threed}, + pkgurl = {https://ctan.org/pkg/mp3d}, note = {Create animations of 3-dimensional objects (such as polyhedra) in .}, } @@ -45304,14 +45332,14 @@ (Deutsches Institut für Normung, German standardisation institute).}, } -@manual{MPEdit, +@manual{mpedit, title = {The \texttt{MPEdit} package}, subtitle = {MetaPost text editor for Win32}, author = {Petr Vabishchevich}, date = {2016-06-24}, license = {other-free}, url = {https://mirror.ctan.org/graphics/metapost/contrib/tools/MPEdit}, - pkgurl = {https://ctan.org/pkg/MPEdit}, + pkgurl = {https://ctan.org/pkg/mpedit}, } @manual{mpfonts, @@ -45360,14 +45388,14 @@ pkgurl = {https://ctan.org/pkg/mpostinl}, } -@manual{MPStoEPS, +@manual{mpstoeps, title = {The \texttt{MPStoEPS} package}, subtitle = {A convertor from MetaPost output to Encapsulated PostScript}, author = {Troy L. Henderson}, date = {2016-06-24}, license = {lppl}, url = {https://mirror.ctan.org/graphics/metapost/contrib/tools/mpstoeps}, - pkgurl = {https://ctan.org/pkg/MPStoEPS}, + pkgurl = {https://ctan.org/pkg/mpstoeps}, } @manual{mptrees, @@ -45947,7 +45975,7 @@ pkgurl = {https://ctan.org/pkg/musixtex-t1fonts}, } -@manual{MusiXTeX, +@manual{musixtex, title = {The \texttt{MusiXTeX} package}, subtitle = {Sophisticated music typesetting}, author = {Bob Tennent and Don Simons and Jean-Pierre Coulon and Hiroaki Morimoto and Olivier Vogel and Daniel Taupin and Andreas Egler and Ross Mitchell}, @@ -45955,7 +45983,7 @@ version = {1.35}, license = {gpl2+,ofl}, url = {https://mirror.ctan.org/macros/musixtex}, - pkgurl = {https://ctan.org/pkg/MusiXTeX}, + pkgurl = {https://ctan.org/pkg/musixtex}, } @manual{musixtnt, @@ -46400,14 +46428,14 @@ pkgurl = {https://ctan.org/pkg/natded}, } -@manual{Nath, +@manual{nath, title = {The \texttt{Nath} package}, subtitle = {Natural mathematics notation}, author = {Michal Marvan}, date = {2016-06-24}, license = {gpl}, url = {https://mirror.ctan.org/macros/latex/contrib/nath}, - pkgurl = {https://ctan.org/pkg/Nath}, + pkgurl = {https://ctan.org/pkg/nath}, note = {Nath is a \LaTeX{} (both 2e and 2.09) style to separate presentation and content in mathematical typography. The style delivers a particular context-dependent @@ -46585,7 +46613,7 @@ pkgurl = {https://ctan.org/pkg/nccfoots}, } -@manual{NCC-LaTeX, +@manual{ncclatex, title = {The \texttt{NCC-LaTeX} package}, subtitle = {An extended general-purpose class}, author = {Alexander I. Rozhenko}, @@ -46593,7 +46621,7 @@ version = {1.5}, license = {lppl}, url = {https://mirror.ctan.org/macros/latex/contrib/ncclatex}, - pkgurl = {https://ctan.org/pkg/NCC-LaTeX}, + pkgurl = {https://ctan.org/pkg/ncclatex}, note = {The ncc class provides a framework for a common class to replace the standard article, book and report classes, and providing a “preprint†class. The class’s extensions @@ -46703,7 +46731,7 @@ The bundle includes tools for:}, } -@manual{nChairX, +@manual{nchairx, title = {The \texttt{nChairX} package}, subtitle = {Maths macros from chair X of Würzburg University}, author = {Marvin Dippell}, @@ -46711,7 +46739,7 @@ version = {1.0.0}, license = {lppl1.3}, url = {https://mirror.ctan.org/macros/latex/contrib/nchairx}, - pkgurl = {https://ctan.org/pkg/nChairX}, + pkgurl = {https://ctan.org/pkg/nchairx}, } @manual{nddiss, @@ -46747,7 +46775,7 @@ pkgurl = {https://ctan.org/pkg/ndsu-thesis}, } -@manual{NEdit-LaTeX-Extensions, +@manual{nedit-latex-extensions, title = {The \texttt{NEdit-LaTeX-Extensions} package}, subtitle = {The \LaTeX{}-Mode is a set of macros for the NEdit text editor}, author = {Jörg Fischer}, @@ -46755,7 +46783,7 @@ version = {0.9.1}, license = {gpl}, url = {https://mirror.ctan.org/support/NEdit-LaTeX-Extensions}, - pkgurl = {https://ctan.org/pkg/NEdit-LaTeX-Extensions}, + pkgurl = {https://ctan.org/pkg/nedit-latex-extensions}, } @manual{needspace, @@ -46769,7 +46797,7 @@ pkgurl = {https://ctan.org/pkg/needspace}, } -@manual{NL_hyphenation, +@manual{nehyph, title = {The \texttt{NL hyphenation} package}, subtitle = {Hyphenation patterns for Dutch}, author = {Piet Tutelaers}, @@ -46777,6 +46805,7 @@ version = {1.1}, license = {lppl}, url = {https://mirror.ctan.org/language/hyphenation/nehyph.tex}, + pkgurl = {https://ctan.org/pkg/nehyph}, } @manual{nemocal, @@ -46925,7 +46954,7 @@ style; the script then generates macros to define the command.}, } -@manual{NewComputerModern, +@manual{newcomputermodern, title = {The \texttt{NewComputerModern} package}, subtitle = {Computer Modern fonts including matching non-latin alphabets}, author = {Antonis Tsolomitis}, @@ -46933,7 +46962,7 @@ version = {4.1}, license = {gfl}, url = {https://mirror.ctan.org/fonts/newcomputermodern}, - pkgurl = {https://ctan.org/pkg/NewComputerModern}, + pkgurl = {https://ctan.org/pkg/newcomputermodern}, } @manual{newenviron, @@ -47363,7 +47392,7 @@ pkgurl = {https://ctan.org/pkg/ninecolors}, } -@manual{NJUrepo, +@manual{njurepo, title = {The \texttt{NJUrepo} package}, subtitle = {Reports for Nanjing University}, author = {Zangwei Zheng}, @@ -47371,7 +47400,7 @@ version = {1.1.2}, license = {lppl1.3c}, url = {https://mirror.ctan.org/macros/latex/contrib/njurepo}, - pkgurl = {https://ctan.org/pkg/NJUrepo}, + pkgurl = {https://ctan.org/pkg/njurepo}, } @manual{njustthesis, @@ -47784,7 +47813,7 @@ pkgurl = {https://ctan.org/pkg/notes2bib}, } -@manual{NotesPages, +@manual{notespages, title = {The \texttt{NotesPages} package}, subtitle = {Filling documents with notes pages and notes areas}, author = {Mike Kaufmann}, @@ -47792,10 +47821,10 @@ version = {0.8.1}, license = {lppl1.3}, url = {https://mirror.ctan.org/macros/latex/contrib/notespages}, - pkgurl = {https://ctan.org/pkg/NotesPages}, + pkgurl = {https://ctan.org/pkg/notespages}, } -@manual{NotesTeX, +@manual{notestex, title = {The \texttt{NotesTeX} package}, subtitle = {An all-in-one \LaTeX{} notes package for students}, author = {Aditya Dhumuntarao}, @@ -47803,17 +47832,17 @@ version = {1.0}, license = {lppl1.3}, url = {https://mirror.ctan.org/macros/latex/contrib/notestex}, - pkgurl = {https://ctan.org/pkg/NotesTeX}, + pkgurl = {https://ctan.org/pkg/notestex}, } -@manual{noTeX-bst, +@manual{notex-bst, title = {The \texttt{noTeX-bst} package}, subtitle = {A BibTeX style that outputs HTML}, author = {Sebastiano Vigna}, date = {2016-10-28}, license = {pd}, url = {https://mirror.ctan.org/biblio/bibtex/utils/misc/noTeX.bst}, - pkgurl = {https://ctan.org/pkg/noTeX-bst}, + pkgurl = {https://ctan.org/pkg/notex-bst}, } @manual{noto-emoji, @@ -47854,7 +47883,7 @@ package suppresses the effect.}, } -@manual{notoCJKsc, +@manual{notocjksc, title = {The \texttt{notoCJKsc} package}, subtitle = {This package provides Noto CJK fonts}, author = {Harry Zhou}, @@ -47862,7 +47891,7 @@ version = {1.004}, license = {ofl}, url = {https://mirror.ctan.org/fonts/notocjksc}, - pkgurl = {https://ctan.org/pkg/notoCJKsc}, + pkgurl = {https://ctan.org/pkg/notocjksc}, } @manual{notocondensed, @@ -48045,7 +48074,7 @@ pkgurl = {https://ctan.org/pkg/ntheorem}, } -@manual{NTS-L, +@manual{nts-l, title = {The \texttt{NTS-L} package}, subtitle = {NTS mailing list digests}, author = {{Unknown}}, @@ -48053,12 +48082,12 @@ version = {}, license = {digest}, url = {https://mirror.ctan.org/info/digests/nts-l}, - pkgurl = {https://ctan.org/pkg/NTS-L}, + pkgurl = {https://ctan.org/pkg/nts-l}, note = {This bundle holds postings from the mailing list , from 1992-05 to 1995-01.}, } -@manual{NTS, +@manual{nts, title = {The \texttt{NTS} package}, subtitle = {New Typesetting System}, author = {{The NTS Project}}, @@ -48066,7 +48095,7 @@ version = {1.00-beta}, license = {other-free}, url = {https://mirror.ctan.org/systems/nts}, - pkgurl = {https://ctan.org/pkg/NTS}, + pkgurl = {https://ctan.org/pkg/nts}, } @manual{ntsfaq, @@ -48249,7 +48278,7 @@ pkgurl = {https://ctan.org/pkg/numspell}, } -@manual{Nunito, +@manual{nunito, title = {The \texttt{Nunito} package}, subtitle = {The Nunito font face with support for \LaTeX{} and pdfLaTeX}, author = {Carl-Clemens Ebinger}, @@ -48257,7 +48286,7 @@ version = {0.0.1}, license = {ofl,lppl}, url = {https://mirror.ctan.org/fonts/nunito}, - pkgurl = {https://ctan.org/pkg/Nunito}, + pkgurl = {https://ctan.org/pkg/nunito}, } @manual{nwafuthesis, @@ -48682,7 +48711,7 @@ pkgurl = {https://ctan.org/pkg/oldstandard}, } -@manual{OldStandardT1, +@manual{oldstandardt1, title = {The \texttt{OldStandardT1} package}, subtitle = {Type 1 versions of Old Standard fonts with \LaTeX{} support}, author = {Bob Tennent}, @@ -48690,7 +48719,7 @@ version = {}, license = {ofl}, url = {https://mirror.ctan.org/obsolete/fonts/oldstandardt1}, - pkgurl = {https://ctan.org/pkg/OldStandardT1}, + pkgurl = {https://ctan.org/pkg/oldstandardt1}, } @manual{oldstyle, @@ -48738,7 +48767,7 @@ pkgurl = {https://ctan.org/pkg/omega}, } -@manual{12many, +@manual{one2many, title = {The \texttt{12many} package}, subtitle = {Generalising mathematical index sets}, author = {Ulrich M. Schwarz}, @@ -48746,7 +48775,7 @@ version = {0.3}, license = {lppl}, url = {https://mirror.ctan.org/macros/latex/contrib/12many}, - pkgurl = {https://ctan.org/pkg/12many}, + pkgurl = {https://ctan.org/pkg/one2many}, note = {In the discrete branches of mathematics and the computer sciences, it will only take some seconds before you're faced with a set like {1,...,m}. Some people write , others @@ -48756,7 +48785,7 @@ change.}, } -@manual{OneDown, +@manual{onedown, title = {The \texttt{OneDown} package}, subtitle = {Typeset Bridge Diagrams}, author = {Jacob Wiersma}, @@ -48764,7 +48793,7 @@ version = {1.6}, license = {lppl1.3}, url = {https://mirror.ctan.org/macros/latex/contrib/onedown}, - pkgurl = {https://ctan.org/pkg/OneDown}, + pkgurl = {https://ctan.org/pkg/onedown}, } @manual{onepagem, @@ -48870,7 +48899,7 @@ converted for this package using FontForge for full support with}, } -@manual{oPlotSymbl, +@manual{oplotsymbl, title = {The \texttt{oPlotSymbl} package}, subtitle = {Some symbols which are not easily available}, author = {B. Michel Döhring}, @@ -48878,7 +48907,7 @@ version = {1.4}, license = {lppl1.3}, url = {https://mirror.ctan.org/macros/latex/contrib/oplotsymbl}, - pkgurl = {https://ctan.org/pkg/oPlotSymbl}, + pkgurl = {https://ctan.org/pkg/oplotsymbl}, } @manual{opteng, @@ -48899,7 +48928,7 @@ simple instructions on how to prepare the manuscript.}, } -@manual{OpTeX, +@manual{optex, title = {The \texttt{OpTeX} package}, subtitle = {LuaTeX format based on Plain TeX and OPmac}, author = {Petr Olšák}, @@ -48907,10 +48936,10 @@ version = {1.08}, license = {pd}, url = {https://mirror.ctan.org/macros/optex}, - pkgurl = {https://ctan.org/pkg/OpTeX}, + pkgurl = {https://ctan.org/pkg/optex}, } -@manual{OpTeXcount, +@manual{optexcount, title = {The \texttt{OpTeXcount} package}, subtitle = {Python script for counting words in OpTeX documents}, author = {Richard Hartmann}, @@ -48918,7 +48947,7 @@ version = {1.1}, license = {mit}, url = {https://mirror.ctan.org/support/optexcount}, - pkgurl = {https://ctan.org/pkg/OpTeXcount}, + pkgurl = {https://ctan.org/pkg/optexcount}, } @manual{optidef, @@ -48980,14 +49009,14 @@ pkgurl = {https://ctan.org/pkg/orcidlink}, } -@manual{Orderer, +@manual{orderer, title = {The \texttt{Orderer} package}, subtitle = {Order references in a TeX file}, author = {M. Siddikov}, date = {2016-06-24}, license = {lppl}, url = {https://mirror.ctan.org/support/orderer}, - pkgurl = {https://ctan.org/pkg/Orderer}, + pkgurl = {https://ctan.org/pkg/orderer}, note = {Orderer is a small Perl script that will take a TeX document and re-order the references in it. This saves the user from building a database.}, @@ -49106,7 +49135,7 @@ pkgurl = {https://ctan.org/pkg/osmanian}, } -@manual{Oswald, +@manual{oswald, title = {The \texttt{Oswald} package}, subtitle = {The Oswald family of fonts with support for \LaTeX{} and pdfLaTeX}, author = {Carl-Clemens Ebinger}, @@ -49114,7 +49143,7 @@ version = {}, license = {ofl,lppl}, url = {https://mirror.ctan.org/fonts/oswald}, - pkgurl = {https://ctan.org/pkg/Oswald}, + pkgurl = {https://ctan.org/pkg/oswald}, } @manual{ot-tableau, @@ -49139,7 +49168,7 @@ pkgurl = {https://ctan.org/pkg/ot2cyr}, } -@manual{OT2Woff, +@manual{ot2woff, title = {The \texttt{OT2Woff} package}, subtitle = {OpenType to Woff converter}, author = {Peter Frane Jr}, @@ -49147,7 +49176,7 @@ version = {1.0}, license = {gpl3+}, url = {https://mirror.ctan.org/fonts/utilities/ot2woff}, - pkgurl = {https://ctan.org/pkg/OT2Woff}, + pkgurl = {https://ctan.org/pkg/ot2woff}, } @manual{otfinst, @@ -49440,14 +49469,14 @@ pkgurl = {https://ctan.org/pkg/oztex-fonts}, } -@manual{OzTeX-german, +@manual{oztex-german, title = {The \texttt{OzTeX-german} package}, subtitle = {German packaging of OzTeX}, author = {Lothar Meyer-Lerbs}, date = {2016-06-18}, license = {pd}, url = {https://mirror.ctan.org/obsolete/systems/mac/oztex-german}, - pkgurl = {https://ctan.org/pkg/OzTeX-german}, + pkgurl = {https://ctan.org/pkg/oztex-german}, } @manual{oztex, @@ -50191,7 +50220,7 @@ pkgurl = {https://ctan.org/pkg/pbmtogf}, } -@manual{PBMtoPK, +@manual{pbmtopk, title = {The \texttt{PBMtoPK} package}, subtitle = {Conversion between PBM and PK formats}, author = {Angus Duggan}, @@ -50199,7 +50228,7 @@ version = {}, license = {noinfo}, url = {https://mirror.ctan.org/graphics/pbmtopk}, - pkgurl = {https://ctan.org/pkg/PBMtoPK}, + pkgurl = {https://ctan.org/pkg/pbmtopk}, } @manual{pbox, @@ -50634,7 +50663,7 @@ pkgurl = {https://ctan.org/pkg/pdfprivacy}, } -@manual{PDFrack, +@manual{pdfrack, title = {The \texttt{PDFrack} package}, subtitle = {Use psfrag with pdfLaTeX}, author = {Marc Boyer}, @@ -50642,7 +50671,7 @@ version = {1.0}, license = {noinfo}, url = {https://mirror.ctan.org/support/pdfrack}, - pkgurl = {https://ctan.org/pkg/PDFrack}, + pkgurl = {https://ctan.org/pkg/pdfrack}, } @manual{pdfrender, @@ -50833,7 +50862,7 @@ pkgurl = {https://ctan.org/pkg/pdfxup}, } -@manual{Pecha, +@manual{pecha, title = {The \texttt{Pecha} package}, subtitle = {Print Tibetan text in the classic pecha layout style}, author = {Dieter Jäger}, @@ -50841,7 +50870,7 @@ version = {0.1}, license = {gpl}, url = {https://mirror.ctan.org/language/tibetan/pecha}, - pkgurl = {https://ctan.org/pkg/Pecha}, + pkgurl = {https://ctan.org/pkg/pecha}, note = {The pecha class provides an environment for writing Tibetan on \LaTeX{}2e in the traditional Tibetan Pecha layout used for spiritual or philosophical texts, using the @@ -50974,14 +51003,14 @@ pkgurl = {https://ctan.org/pkg/petiteannonce}, } -@manual{Petri-nets, +@manual{petri-nets, title = {The \texttt{Petri-nets} package}, subtitle = {A set TeX/LaTeX packages for drawing Petri nets}, author = {Franck Pommereau}, date = {2016-06-24}, license = {gpl}, url = {https://mirror.ctan.org/macros/generic/petri-nets}, - pkgurl = {https://ctan.org/pkg/Petri-nets}, + pkgurl = {https://ctan.org/pkg/petri-nets}, } @manual{pf2afm, @@ -51708,7 +51737,7 @@ pkgurl = {https://ctan.org/pkg/pictex-autoarea}, } -@manual{PicTeX, +@manual{pictex, title = {The \texttt{PicTeX} package}, subtitle = {Picture drawing macros for TeX and \LaTeX{}}, author = {Michael Wichura}, @@ -51716,7 +51745,7 @@ version = {1.1b}, license = {lppl1}, url = {https://mirror.ctan.org/graphics/pictex}, - pkgurl = {https://ctan.org/pkg/PicTeX}, + pkgurl = {https://ctan.org/pkg/pictex}, note = {PicTeX is an early and very comprehensive drawing package that mostly draws by placing myriads of small dots to make up pictures. It has a tendency to run out of space; packages @@ -51741,7 +51770,7 @@ segment is horizontal or vertical.}, } -@manual{PicTeXsum, +@manual{pictexsum, title = {The \texttt{PicTeXsum} package}, subtitle = {A summary of PicTeX commands}, author = {Angus Duggan}, @@ -51749,7 +51778,7 @@ version = {}, license = {other-free}, url = {https://mirror.ctan.org/info/pictex/summary}, - pkgurl = {https://ctan.org/pkg/PicTeXsum}, + pkgurl = {https://ctan.org/pkg/pictexsum}, note = {The document summarises the commands of PicTeX. While it is no substitute for the PicTeX manual itself (available from ), the document @@ -51870,7 +51899,7 @@ pkgurl = {https://ctan.org/pkg/pinlabel}, } -@manual{pinouTikZ, +@manual{pinoutikz, title = {The \texttt{pinouTikZ} package}, subtitle = {Draw chip pinouts with TikZ}, author = {Robert Blazek}, @@ -51878,7 +51907,7 @@ version = {1.1.2}, license = {lppl1.3c}, url = {https://mirror.ctan.org/graphics/pgf/contrib/pinoutikz}, - pkgurl = {https://ctan.org/pkg/pinouTikZ}, + pkgurl = {https://ctan.org/pkg/pinoutikz}, } @manual{pitex, @@ -52577,7 +52606,7 @@ pkgurl = {https://ctan.org/pkg/pmxchords}, } -@manual{PNAS, +@manual{pnas, title = {The \texttt{PNAS} package}, subtitle = {BibTeX style for PNAS (old version)}, author = {Alan Rogers}, @@ -52585,10 +52614,10 @@ version = {1.0}, license = {other-free}, url = {https://mirror.ctan.org/biblio/bibtex/contrib/misc/pnas.bst}, - pkgurl = {https://ctan.org/pkg/PNAS}, + pkgurl = {https://ctan.org/pkg/pnas}, } -@manual{PNAS_2009, +@manual{pnas2009, title = {The \texttt{PNAS 2009} package}, subtitle = {BibTeX style for PNAS (newer version)}, author = {Alan Rogers}, @@ -52596,6 +52625,7 @@ version = {1.0}, license = {other-free}, url = {https://mirror.ctan.org/biblio/bibtex/contrib/misc/pnas2009.bst}, + pkgurl = {https://ctan.org/pkg/pnas2009}, note = {This style produces bibliographies in the format of “Proceedings of the National Academy of Sciences, USAâ€. The style was derived from the standard @@ -52827,7 +52857,7 @@ pkgurl = {https://ctan.org/pkg/popupmenu}, } -@manual{Portable_MikTeX, +@manual{portable-miktex, title = {The \texttt{Portable MikTeX} package}, subtitle = {Instructions for setting up MikTeX on a portable device}, author = {Alexander Grahn}, @@ -52835,6 +52865,7 @@ version = {1.05}, license = {fdl}, url = {https://mirror.ctan.org/obsolete/info/MiKTeX+Ghostscript+GSview+USB-drive-HOWTO.txt}, + pkgurl = {https://ctan.org/pkg/portable-miktex}, } @manual{portland, @@ -53346,7 +53377,7 @@ pkgurl = {https://ctan.org/pkg/processkv}, } -@manual{procIAGssymp, +@manual{prociagssymp, title = {The \texttt{procIAGssymp} package}, subtitle = {Macros for IAG symposium papers}, author = {Battista Benciolini}, @@ -53354,7 +53385,7 @@ version = {}, license = {lppl}, url = {https://mirror.ctan.org/macros/latex/contrib/prociagssymp}, - pkgurl = {https://ctan.org/pkg/procIAGssymp}, + pkgurl = {https://ctan.org/pkg/prociagssymp}, } @manual{prodint, @@ -53379,7 +53410,7 @@ pkgurl = {https://ctan.org/pkg/productbox}, } -@manual{ProfCollege, +@manual{profcollege, title = {The \texttt{ProfCollege} package}, subtitle = {A \LaTeX{} package for French maths teachers in college}, author = {Christophe Poulain}, @@ -53387,7 +53418,7 @@ version = {0.99-z}, license = {lppl1.3c}, url = {https://mirror.ctan.org/macros/latex/contrib/profcollege}, - pkgurl = {https://ctan.org/pkg/ProfCollege}, + pkgurl = {https://ctan.org/pkg/profcollege}, } @manual{proflabo, @@ -53401,7 +53432,7 @@ pkgurl = {https://ctan.org/pkg/proflabo}, } -@manual{ProfLycee, +@manual{proflycee, title = {The \texttt{ProfLycee} package}, subtitle = {A \LaTeX{} package for French maths teachers in high school}, author = {Cédric Pierquet}, @@ -53409,7 +53440,7 @@ version = {1.3.1}, license = {lppl1.3c}, url = {https://mirror.ctan.org/macros/latex/contrib/proflycee}, - pkgurl = {https://ctan.org/pkg/ProfLycee}, + pkgurl = {https://ctan.org/pkg/proflycee}, } @manual{progkeys, @@ -53461,7 +53492,7 @@ pkgurl = {https://ctan.org/pkg/progressbar}, } -@manual{ProjLib, +@manual{projlib, title = {The \texttt{ProjLib} package}, subtitle = {A series of tools to simplify your workflow}, author = {Jinwen XU}, @@ -53469,7 +53500,7 @@ version = {}, license = {lppl1.3c}, url = {https://mirror.ctan.org/macros/latex/contrib/projlib}, - pkgurl = {https://ctan.org/pkg/ProjLib}, + pkgurl = {https://ctan.org/pkg/projlib}, note = {ProjLib is a collection of tools to help you write \LaTeX{} documents. With the main package loaded, you no longer need to set up the theorem-like environments, nor to manually configure @@ -53869,13 +53900,14 @@ pkgurl = {https://ctan.org/pkg/psfonts}, } -@manual{Il_sistema_PSfrag, +@manual{psfrag-italian, title = {The \texttt{Il sistema PSfrag} package}, subtitle = {PSfrag documentation in Italian}, author = {Flavio Casadei Della Chiesa}, date = {2016-06-24}, license = {gpl}, url = {https://mirror.ctan.org/info/italian/psfrag}, + pkgurl = {https://ctan.org/pkg/psfrag-italian}, note = {This is a translation of the documentation that comes with the documentation.}, } @@ -54697,7 +54729,7 @@ pkgurl = {https://ctan.org/pkg/pst-intersect}, } -@manual{pst-Jtree, +@manual{pst-jtree, title = {The \texttt{pst-Jtree} package}, subtitle = {Typeset complex trees for linguists}, author = {John Frampton}, @@ -54705,7 +54737,7 @@ version = {2.6}, license = {lppl1.3}, url = {https://mirror.ctan.org/graphics/pstricks/contrib/pst-jtree}, - pkgurl = {https://ctan.org/pkg/pst-Jtree}, + pkgurl = {https://ctan.org/pkg/pst-jtree}, } @manual{pst-knot, @@ -55740,7 +55772,7 @@ pkgurl = {https://ctan.org/pkg/ptserif}, } -@manual{Punk-LaTeX, +@manual{punk-latex, title = {The \texttt{Punk-LaTeX} package}, subtitle = {LaTeX support for punk fonts}, author = {Palle Jørgensen}, @@ -55748,7 +55780,7 @@ version = {1.1}, license = {gpl}, url = {https://mirror.ctan.org/macros/latex/contrib/punk-latex}, - pkgurl = {https://ctan.org/pkg/Punk-LaTeX}, + pkgurl = {https://ctan.org/pkg/punk-latex}, note = {The package and .fd file provide support for Knuth's fonts. That bundle also offers support within \LaTeX{}; the present package is to be preferred.}, @@ -55786,7 +55818,7 @@ pkgurl = {https://ctan.org/pkg/purifyeps}, } -@manual{PuyoTikZ, +@manual{puyotikz, title = {The \texttt{PuyoTikZ} package}, subtitle = {Quickly typeset board states of Puyo Puyo games}, author = {Alexander Osborne}, @@ -55794,7 +55826,7 @@ version = {1.0.1}, license = {mit}, url = {https://mirror.ctan.org/graphics/pgf/contrib/puyotikz}, - pkgurl = {https://ctan.org/pkg/PuyoTikZ}, + pkgurl = {https://ctan.org/pkg/puyotikz}, } @manual{pwebmac, @@ -55808,14 +55840,14 @@ pkgurl = {https://ctan.org/pkg/pwebmac}, } -@manual{PWT, +@manual{pwt, title = {The \texttt{PWT} package}, subtitle = {An outline of publishing with TeX}, author = {Kees van der Laan}, date = {2016-06-24}, license = {nosell}, url = {https://mirror.ctan.org/info/laan/pwt}, - pkgurl = {https://ctan.org/pkg/PWT}, + pkgurl = {https://ctan.org/pkg/pwt}, } @manual{pxbase, @@ -56028,7 +56060,7 @@ pkgurl = {https://ctan.org/pkg/pygmentex}, } -@manual{PyLuaTeX, +@manual{pyluatex, title = {The \texttt{PyLuaTeX} package}, subtitle = {Execute Python code on the fly in your \LaTeX{} documents}, author = {Tobias Enderle}, @@ -56036,7 +56068,7 @@ version = {0.5.0}, license = {mit,lppl1.3c}, url = {https://mirror.ctan.org/macros/luatex/latex/pyluatex}, - pkgurl = {https://ctan.org/pkg/PyLuaTeX}, + pkgurl = {https://ctan.org/pkg/pyluatex}, } @manual{python, @@ -56109,7 +56141,7 @@ designed to help users generate circuits.}, } -@manual{QCM, +@manual{qcm, title = {The \texttt{QCM} package}, subtitle = {A \LaTeX{}2e class for making multiple choice questionnaires}, author = {Didier Verna}, @@ -56117,7 +56149,7 @@ version = {2.1}, license = {lppl}, url = {https://mirror.ctan.org/macros/latex/contrib/qcm}, - pkgurl = {https://ctan.org/pkg/QCM}, + pkgurl = {https://ctan.org/pkg/qcm}, note = {QCM is a package for making multiple choices questionnaires under \LaTeX{}2e (“QCM†is the French acronym for this style of test). A special environment allows you to define @@ -56505,7 +56537,7 @@ pkgurl = {https://ctan.org/pkg/qyxf-book}, } -@manual{r_und_s, +@manual{r-und-s, title = {The \texttt{r\_und\_s} package}, subtitle = {Chemical hazard codes}, author = {Thiemo Nordenholz}, @@ -56513,7 +56545,7 @@ version = {1.3i}, license = {other-free}, url = {https://mirror.ctan.org/macros/latex/contrib/r_und_s}, - pkgurl = {https://ctan.org/pkg/r_und_s}, + pkgurl = {https://ctan.org/pkg/r-und-s}, } @manual{r2bib, @@ -56831,7 +56863,7 @@ pkgurl = {https://ctan.org/pkg/rcsinfo}, } -@manual{ReadableCV, +@manual{readablecv, title = {The \texttt{ReadableCV} package}, subtitle = {A highly readable and good looking CV and letter class}, author = {Philip Stone}, @@ -56839,7 +56871,7 @@ version = {3.0}, license = {lppl1.3}, url = {https://mirror.ctan.org/macros/latex/contrib/readablecv}, - pkgurl = {https://ctan.org/pkg/ReadableCV}, + pkgurl = {https://ctan.org/pkg/readablecv}, } @manual{readarray, @@ -57026,7 +57058,7 @@ the distribution.}, } -@manual{REdit, +@manual{redit, title = {The \texttt{REdit} package}, subtitle = {Menu-based editor}, author = {Michael Rogalla}, @@ -57034,7 +57066,7 @@ version = {2.10}, license = {nocommercial}, url = {https://mirror.ctan.org/support/redit}, - pkgurl = {https://ctan.org/pkg/REdit}, + pkgurl = {https://ctan.org/pkg/redit}, } @manual{refcheck, @@ -57594,7 +57626,7 @@ pkgurl = {https://ctan.org/pkg/rfil}, } -@manual{RGB, +@manual{rgb, title = {The \texttt{RGB} package}, subtitle = {Tables of RGB colour parameters}, author = {Maurizio Loreti}, @@ -57602,7 +57634,7 @@ version = {1.2}, license = {other-free}, url = {https://mirror.ctan.org/info/colour/rgb}, - pkgurl = {https://ctan.org/pkg/RGB}, + pkgurl = {https://ctan.org/pkg/rgb}, note = {The Linux (distributed as part of X11 distributions) is mechanically converted to a \LaTeX{} file, which has been compiled to make the distribution. For details of the @@ -57747,13 +57779,14 @@ pkgurl = {https://ctan.org/pkg/rnototex}, } -@manual{Robot_Man, +@manual{robot-man, title = {The \texttt{Robot Man} package}, subtitle = {A fun demo of AcroTeX eDucation Bundle facilities}, author = {Donald P. Story}, date = {2017-04-18}, license = {lppl}, url = {https://mirror.ctan.org/macros/latex/contrib/aeb_pro/robot_man}, + pkgurl = {https://ctan.org/pkg/robot-man}, note = {Robot man is distributed as part of the bundle (just for fun); the source is attached to the PDF file.}, @@ -58054,7 +58087,7 @@ pkgurl = {https://ctan.org/pkg/rputover}, } -@manual{RRGtrees, +@manual{rrgtrees, title = {The \texttt{RRGtrees} package}, subtitle = {Linguistic tree diagrams for Role and Reference Grammar (RRG) with \LaTeX{}}, author = {David Gardner}, @@ -58062,7 +58095,7 @@ version = {1.1}, license = {lppl}, url = {https://mirror.ctan.org/macros/latex/contrib/rrgtrees}, - pkgurl = {https://ctan.org/pkg/RRGtrees}, + pkgurl = {https://ctan.org/pkg/rrgtrees}, } @manual{rsc, @@ -58112,7 +58145,7 @@ the Adobe Mathematical Pi script font.}, } -@manual{RST, +@manual{rst, title = {The \texttt{RST} package}, subtitle = {Drawing rhetorical structure analysis diagrams in \LaTeX{}}, author = {David Reitter}, @@ -58120,7 +58153,7 @@ version = {1.3}, license = {other-nonfree}, url = {https://mirror.ctan.org/macros/latex/contrib/rst}, - pkgurl = {https://ctan.org/pkg/RST}, + pkgurl = {https://ctan.org/pkg/rst}, } @manual{rterface, @@ -58424,7 +58457,7 @@ pkgurl = {https://ctan.org/pkg/rvwrite}, } -@manual{ryersonSGSThesis, +@manual{ryersonsgsthesis, title = {The \texttt{ryersonSGSThesis} package}, subtitle = {Ryerson School of Graduate Studies thesis template}, author = {Yasir Shoaib}, @@ -58432,7 +58465,7 @@ version = {1.0.3}, license = {apache2}, url = {https://mirror.ctan.org/macros/latex/contrib/ryersonsgsthesis}, - pkgurl = {https://ctan.org/pkg/ryersonSGSThesis}, + pkgurl = {https://ctan.org/pkg/ryersonsgsthesis}, } @manual{ryethesis, @@ -58500,7 +58533,7 @@ pkgurl = {https://ctan.org/pkg/sageep}, } -@manual{SageTeX, +@manual{sagetex, title = {The \texttt{SageTeX} package}, subtitle = {Embed Sage code and plots into \LaTeX{}}, author = {Dima Pasechnik and Dan Drake}, @@ -58508,7 +58541,7 @@ version = {3.5}, license = {gpl2+}, url = {https://mirror.ctan.org/macros/latex/contrib/sagetex}, - pkgurl = {https://ctan.org/pkg/SageTeX}, + pkgurl = {https://ctan.org/pkg/sagetex}, note = {SageTeX allows you to embed code, the results of computations, plots, and graphics from the @@ -58634,9 +58667,9 @@ @manual{sansmathfonts, title = {The \texttt{sansmathfonts} package}, - subtitle = {Correct placement of accents in sans-serif maths}, + subtitle = {Extended Computer Modern sans serif fonts}, author = {Ariel Barton}, - date = {2021-06-22}, + date = {2022-10-09}, version = {}, license = {lppl1.3c}, url = {https://mirror.ctan.org/fonts/sansmathfonts}, @@ -58665,7 +58698,7 @@ pkgurl = {https://ctan.org/pkg/sarabian}, } -@manual{SASnRdisplay, +@manual{sasnrdisplay, title = {The \texttt{SASnRdisplay} package}, subtitle = {Typeset SAS or R code or output}, author = {Lars Madsen}, @@ -58673,7 +58706,7 @@ version = {0.95}, license = {lppl1.3}, url = {https://mirror.ctan.org/macros/latex/contrib/sasnrdisplay}, - pkgurl = {https://ctan.org/pkg/SASnRdisplay}, + pkgurl = {https://ctan.org/pkg/sasnrdisplay}, } @manual{sauerj, @@ -58915,7 +58948,7 @@ pkgurl = {https://ctan.org/pkg/schemata}, } -@manual{schemeTeX, +@manual{schemetex, title = {The \texttt{schemeTeX} package}, subtitle = {Typesetting Scheme programs with \LaTeX{}}, author = {John D Ramsdell}, @@ -58923,7 +58956,7 @@ version = {}, license = {other-free}, url = {https://mirror.ctan.org/support/schemetex}, - pkgurl = {https://ctan.org/pkg/schemeTeX}, + pkgurl = {https://ctan.org/pkg/schemetex}, } @manual{schemeweb, @@ -58937,7 +58970,7 @@ pkgurl = {https://ctan.org/pkg/schemeweb}, } -@manual{ScholaX, +@manual{scholax, title = {The \texttt{ScholaX} package}, subtitle = {Extension of TeXGyreSchola (New Century Schoolbook) with math support}, author = {Michael Sharpe}, @@ -58945,7 +58978,7 @@ version = {1.033}, license = {lppl}, url = {https://mirror.ctan.org/fonts/scholax}, - pkgurl = {https://ctan.org/pkg/ScholaX}, + pkgurl = {https://ctan.org/pkg/scholax}, } @manual{schooldocs, @@ -59086,14 +59119,14 @@ pkgurl = {https://ctan.org/pkg/sciposter}, } -@manual{SciWordConv, +@manual{sciwordconv, title = {The \texttt{SciWordConv} package}, subtitle = {Use Scientific Word/WorkPlace files with another TeX}, author = {Berik I. Tuleuov}, date = {2016-06-24}, license = {lppl}, url = {https://mirror.ctan.org/macros/latex/contrib/sciwordconv}, - pkgurl = {https://ctan.org/pkg/SciWordConv}, + pkgurl = {https://ctan.org/pkg/sciwordconv}, } @manual{sclang-prettifier, @@ -59209,7 +59242,7 @@ pkgurl = {https://ctan.org/pkg/scratch3}, } -@manual{ScratchX, +@manual{scratchx, title = {The \texttt{ScratchX} package}, subtitle = {Include Scratch programs in \LaTeX{} documents}, author = {Thibault Ralet}, @@ -59217,7 +59250,7 @@ version = {1.1}, license = {lppl1.3c}, url = {https://mirror.ctan.org/macros/latex/contrib/scratchx}, - pkgurl = {https://ctan.org/pkg/ScratchX}, + pkgurl = {https://ctan.org/pkg/scratchx}, } @manual{scrbase, @@ -59343,7 +59376,7 @@ pkgurl = {https://ctan.org/pkg/scriptfonts}, } -@manual{ScriptTeX, +@manual{scripttex, title = {The \texttt{ScriptTeX} package}, subtitle = {Macros for scripts and screenplays}, author = {Adrian McCarthy}, @@ -59351,7 +59384,7 @@ version = {1.04}, license = {nocommercial}, url = {https://mirror.ctan.org/macros/scripttex}, - pkgurl = {https://ctan.org/pkg/ScriptTeX}, + pkgurl = {https://ctan.org/pkg/scripttex}, } @manual{scripture, @@ -59788,7 +59821,7 @@ pkgurl = {https://ctan.org/pkg/selnolig}, } -@manual{SemanTeX, +@manual{semantex, title = {The \texttt{SemanTeX} package}, subtitle = {Semantic, keyval-based mathematics}, author = {Sebastian Ørsted}, @@ -59796,7 +59829,7 @@ version = {0.522}, license = {lppl1.3c}, url = {https://mirror.ctan.org/macros/latex/contrib/semantex}, - pkgurl = {https://ctan.org/pkg/SemanTeX}, + pkgurl = {https://ctan.org/pkg/semantex}, } @manual{semantic-markup, @@ -59875,7 +59908,7 @@ pkgurl = {https://ctan.org/pkg/semproc}, } -@manual{SemTeX, +@manual{semtex, title = {The \texttt{SemTeX} package}, subtitle = {Deals with stripped SemanTeX documents}, author = {Sebastian Ørsted}, @@ -59883,7 +59916,7 @@ version = {0.45}, license = {lppl1.3c}, url = {https://mirror.ctan.org/macros/latex/contrib/semtex}, - pkgurl = {https://ctan.org/pkg/SemTeX}, + pkgurl = {https://ctan.org/pkg/semtex}, } @manual{semtrans, @@ -60363,7 +60396,7 @@ pkgurl = {https://ctan.org/pkg/shadebox}, } -@manual{Shaded_theorems, +@manual{shadethm, title = {The \texttt{Shaded theorems} package}, subtitle = {Theorem environments that are shaded}, author = {Jim Hefferon}, @@ -60371,6 +60404,7 @@ version = {}, license = {lppl}, url = {https://mirror.ctan.org/macros/latex/contrib/shadethm}, + pkgurl = {https://ctan.org/pkg/shadethm}, } @manual{shading, @@ -60751,7 +60785,7 @@ pkgurl = {https://ctan.org/pkg/shsulet}, } -@manual{ShtThesis, +@manual{shtthesis, title = {The \texttt{ShtThesis} package}, subtitle = {An unofficial \LaTeX{} thesis template for ShanghaiTech University}, author = {Rundong Li}, @@ -60759,7 +60793,7 @@ version = {0.3.3}, license = {gpl3}, url = {https://mirror.ctan.org/macros/latex/contrib/shtthesis}, - pkgurl = {https://ctan.org/pkg/ShtThesis}, + pkgurl = {https://ctan.org/pkg/shtthesis}, note = {This package, forked from , is an \LaTeX{} thesis template for ShanghaiTech @@ -60883,7 +60917,7 @@ pkgurl = {https://ctan.org/pkg/signchart}, } -@manual{Sikumuna, +@manual{sikumuna, title = {The \texttt{Sikumuna} package}, subtitle = {Lyx template for Hebrew article format}, author = {Guy Rutenberg}, @@ -60891,7 +60925,7 @@ version = {1.1}, license = {gpl}, url = {https://mirror.ctan.org/macros/latex/contrib/lyx/sikumuna}, - pkgurl = {https://ctan.org/pkg/Sikumuna}, + pkgurl = {https://ctan.org/pkg/sikumuna}, } @manual{silence, @@ -61156,7 +61190,7 @@ pkgurl = {https://ctan.org/pkg/sirlin}, } -@manual{SIstyle, +@manual{sistyle, title = {The \texttt{SIstyle} package}, subtitle = {Package to typeset SI units, numbers and angles}, author = {Danie Els and Joseph Wright}, @@ -61164,7 +61198,7 @@ version = {2.3a}, license = {lppl}, url = {https://mirror.ctan.org/macros/latex/contrib/sistyle}, - pkgurl = {https://ctan.org/pkg/SIstyle}, + pkgurl = {https://ctan.org/pkg/sistyle}, } @manual{sitem, @@ -61213,7 +61247,7 @@ pkgurl = {https://ctan.org/pkg/skak}, } -@manual{SkakNew, +@manual{skaknew, title = {The \texttt{SkakNew} package}, subtitle = {The skak chess fonts redone in Adobe Type 1}, author = {Ulrich Dirr}, @@ -61221,7 +61255,7 @@ version = {}, license = {lppl}, url = {https://mirror.ctan.org/fonts/chess/skaknew}, - pkgurl = {https://ctan.org/pkg/SkakNew}, + pkgurl = {https://ctan.org/pkg/skaknew}, note = {This package offers Adobe Type 1 versions of the fonts provided as Metafont source by the bundle.}, } @@ -61624,14 +61658,14 @@ , amongst others.}, } -@manual{SmileTeX, +@manual{smiletex, title = {The \texttt{SmileTeX} package}, subtitle = {Create \LaTeX{} documents and more from simple texts}, author = {Christian Schüler}, date = {2016-06-24}, license = {nosource}, url = {https://mirror.ctan.org/support/smiletex}, - pkgurl = {https://ctan.org/pkg/SmileTeX}, + pkgurl = {https://ctan.org/pkg/smiletex}, } @manual{snapshot, @@ -62209,7 +62243,7 @@ pkgurl = {https://ctan.org/pkg/sourcecodepro}, } -@manual{SourceSansPro, +@manual{sourcesanspro, title = {The \texttt{SourceSansPro} package}, subtitle = {Use SourceSansPro with TeX(-alike) systems}, author = {Silke Hofstra}, @@ -62217,7 +62251,7 @@ version = {2.8}, license = {ofl,lppl1.3}, url = {https://mirror.ctan.org/fonts/sourcesanspro}, - pkgurl = {https://ctan.org/pkg/SourceSansPro}, + pkgurl = {https://ctan.org/pkg/sourcesanspro}, } @manual{sourceserifpro, @@ -62231,7 +62265,7 @@ pkgurl = {https://ctan.org/pkg/sourceserifpro}, } -@manual{SouthArabian, +@manual{southarabian, title = {The \texttt{SouthArabian} package}, subtitle = {A font for an archaic South Arabia script}, author = {Alan Stanier}, @@ -62239,7 +62273,7 @@ version = {}, license = {noinfo}, url = {https://mirror.ctan.org/fonts/southarabian}, - pkgurl = {https://ctan.org/pkg/SouthArabian}, + pkgurl = {https://ctan.org/pkg/southarabian}, } @manual{soyombo, @@ -62444,7 +62478,7 @@ pkgurl = {https://ctan.org/pkg/spie}, } -@manual{SpiX, +@manual{spix, title = {The \texttt{SpiX} package}, subtitle = {Yet another TeX compilation tool: simple, human readable, no option, no magic}, author = {Louis Paternault}, @@ -62452,7 +62486,7 @@ version = {1.1.0}, license = {gpl3+}, url = {https://mirror.ctan.org/support/spix}, - pkgurl = {https://ctan.org/pkg/SpiX}, + pkgurl = {https://ctan.org/pkg/spix}, } @manual{splines, @@ -62595,7 +62629,7 @@ and allow \LaTeX{} to break lines at space characters.}, } -@manual{SQLTeX, +@manual{sqltex, title = {The \texttt{SQLTeX} package}, subtitle = {An SQL Preprocessor for \LaTeX{}}, author = {Oscar van Eijk}, @@ -62603,7 +62637,7 @@ version = {2.1}, license = {lppl}, url = {https://mirror.ctan.org/support/SQLTeX}, - pkgurl = {https://ctan.org/pkg/SQLTeX}, + pkgurl = {https://ctan.org/pkg/sqltex}, } @manual{sqrcaps, @@ -63079,7 +63113,7 @@ The font supports polytonic Greek.}, } -@manual{sTeX, +@manual{stex, title = {The \texttt{sTeX} package}, subtitle = {An Infrastructure for Semantic Preloading of \LaTeX{} Documents}, author = {Michael Kohlhase and Dennis Müller}, @@ -63087,7 +63121,7 @@ version = {3.2.0}, license = {lppl}, url = {https://mirror.ctan.org/macros/latex/contrib/stex}, - pkgurl = {https://ctan.org/pkg/sTeX}, + pkgurl = {https://ctan.org/pkg/stex}, } @manual{stfloats, @@ -63101,7 +63135,7 @@ pkgurl = {https://ctan.org/pkg/stfloats}, } -@manual{SticksToo, +@manual{stickstoo, title = {The \texttt{SticksToo} package}, subtitle = {A reworking of STIX2}, author = {Michael Sharpe}, @@ -63109,7 +63143,7 @@ version = {1.035}, license = {ofl,lppl1.3}, url = {https://mirror.ctan.org/fonts/stickstoo}, - pkgurl = {https://ctan.org/pkg/SticksToo}, + pkgurl = {https://ctan.org/pkg/stickstoo}, note = {SticksToo is a reworking of the STIX2 fonts with support files focussing on enhancements of support for \LaTeX{} users wishing to be able to access more of its features. A companion addition @@ -63305,7 +63339,7 @@ may be used (for example) for contact information.}, } -@manual{Student_Handouts, +@manual{studenthandouts, title = {The \texttt{Student Handouts} package}, subtitle = {Management and styling of student handout projects}, author = {James Fennell}, @@ -63313,6 +63347,7 @@ version = {1.0}, license = {lppl1.3}, url = {https://mirror.ctan.org/macros/latex/contrib/studenthandouts}, + pkgurl = {https://ctan.org/pkg/studenthandouts}, } @manual{studies-lm, @@ -63866,7 +63901,7 @@ .}, } -@manual{Swimgraf, +@manual{swimgraf, title = {The \texttt{Swimgraf} package}, subtitle = {Graphical/textual representations of swimming performances}, author = {Martin J. Osborne}, @@ -63874,7 +63909,7 @@ version = {}, license = {lppl}, url = {https://mirror.ctan.org/macros/latex/contrib/swimgraf}, - pkgurl = {https://ctan.org/pkg/Swimgraf}, + pkgurl = {https://ctan.org/pkg/swimgraf}, } @manual{switcheml, @@ -63955,7 +63990,7 @@ pkgurl = {https://ctan.org/pkg/sympytex}, } -@manual{Synapsen, +@manual{synapsen, title = {The \texttt{Synapsen} package}, subtitle = {Reference management tool for BibTeX}, author = {Markus Krajewski}, @@ -63963,7 +63998,7 @@ version = {3.0}, license = {shareware}, url = {https://mirror.ctan.org/biblio/bibtex/utils/Synapsen}, - pkgurl = {https://ctan.org/pkg/Synapsen}, + pkgurl = {https://ctan.org/pkg/synapsen}, } @manual{synctex-parser, @@ -64159,7 +64194,7 @@ pkgurl = {https://ctan.org/pkg/t1infos}, } -@manual{T1Subset, +@manual{t1subset, title = {The \texttt{T1Subset} package}, subtitle = {A C++ library for subsetting PostScript Type 1 fonts}, author = {Peter Frane Jr}, @@ -64167,7 +64202,7 @@ version = {1.0}, license = {gpl3+}, url = {https://mirror.ctan.org/fonts/utilities/t1subset}, - pkgurl = {https://ctan.org/pkg/T1Subset}, + pkgurl = {https://ctan.org/pkg/t1subset}, } @manual{t1tools, @@ -64270,14 +64305,14 @@ pkgurl = {https://ctan.org/pkg/table-fct}, } -@manual{tableauVariations, +@manual{tableauvariations, title = {The \texttt{tableauVariations} package}, subtitle = {Variation tables in MetaPost}, author = {Frédéric Mazoit}, date = {2016-06-24}, license = {gpl}, url = {https://mirror.ctan.org/graphics/metapost/contrib/macros/tableauvariations}, - pkgurl = {https://ctan.org/pkg/tableauVariations}, + pkgurl = {https://ctan.org/pkg/tableauvariations}, note = {Utility macros for creating tables of signs and of variations. The \LaTeX{} package provides an interface to this package.}, @@ -64686,7 +64721,7 @@ work). The files provide further information.}, } -@manual{TameTheBeast, +@manual{tamethebeast, title = {The \texttt{TameTheBeast} package}, subtitle = {A manual about bibliographies and especially BibTeX}, author = {Nicolas Markey}, @@ -64694,7 +64729,7 @@ version = {1.4}, license = {lppl1.3}, url = {https://mirror.ctan.org/info/bibtex/tamethebeast}, - pkgurl = {https://ctan.org/pkg/TameTheBeast}, + pkgurl = {https://ctan.org/pkg/tamethebeast}, } @manual{tamil-omega, @@ -64922,7 +64957,7 @@ pkgurl = {https://ctan.org/pkg/techexplorer}, } -@manual{Technica, +@manual{technica, title = {The \texttt{Technica} package}, subtitle = {Typesetting for the humanities}, author = {Gianfranco Boggio-Togna}, @@ -64930,7 +64965,7 @@ version = {0.99}, license = {nocommercial}, url = {https://mirror.ctan.org/macros/latex/contrib/technica}, - pkgurl = {https://ctan.org/pkg/Technica}, + pkgurl = {https://ctan.org/pkg/technica}, } @manual{technics, @@ -64980,14 +65015,14 @@ pkgurl = {https://ctan.org/pkg/ted}, } -@manual{TeEncontreX, +@manual{teencontrex, title = {The \texttt{TeEncontreX} package}, subtitle = {Help for users of TeX and \LaTeX{}}, author = {Manuel Gutierrez Algaba}, date = {2016-06-24}, license = {gpl}, url = {https://mirror.ctan.org/info/spanish/TeEncontreX}, - pkgurl = {https://ctan.org/pkg/TeEncontreX}, + pkgurl = {https://ctan.org/pkg/teencontrex}, } @manual{telprint, @@ -65102,7 +65137,7 @@ support the use of this font.}, } -@manual{TengwarScript, +@manual{tengwarscript, title = {The \texttt{TengwarScript} package}, subtitle = {LaTeX support for using Tengwar fonts}, author = {Ignacio Fernández Galván}, @@ -65110,7 +65145,7 @@ version = {1.3.1}, license = {lppl}, url = {https://mirror.ctan.org/macros/latex/contrib/tengwarscript}, - pkgurl = {https://ctan.org/pkg/TengwarScript}, + pkgurl = {https://ctan.org/pkg/tengwarscript}, } @manual{tensind, @@ -65321,7 +65356,7 @@ pkgurl = {https://ctan.org/pkg/tex--xet}, } -@manual{TeX_Converter, +@manual{tex-converter, title = {The \texttt{TeX Converter} package}, subtitle = {Windows front-end to various \LaTeX{} to HTML converters}, author = {Steve Mayer}, @@ -65329,6 +65364,7 @@ version = {2.6}, license = {other-free}, url = {https://mirror.ctan.org/support/tex-converter}, + pkgurl = {https://ctan.org/pkg/tex-converter}, } @manual{tex-ewd, @@ -65369,7 +65405,7 @@ pkgurl = {https://ctan.org/pkg/tex-font-errors-cheatsheet}, } -@manual{TeX-FPC, +@manual{tex-fpc, title = {The \texttt{TeX-FPC} package}, subtitle = {A collection of change files for a TeX system based on Free Pascal}, author = {Wolfgang Helbig}, @@ -65377,7 +65413,7 @@ version = {4th ed.}, license = {bsd2}, url = {https://mirror.ctan.org/systems/unix/tex-fpc}, - pkgurl = {https://ctan.org/pkg/TeX-FPC}, + pkgurl = {https://ctan.org/pkg/tex-fpc}, note = {This is the followup to , which is based on the GNU Pascal Compiler. GPC is not installable any more, so I switched to FPC, @@ -65385,7 +65421,7 @@ pascal compiler nowadays.}, } -@manual{TeX-GPC, +@manual{tex-gpc, title = {The \texttt{TeX-GPC} package}, subtitle = {A collection of change files for a TeX system based on GNU Pascal}, author = {Wolfgang Helbig}, @@ -65393,7 +65429,7 @@ version = {3rd edition}, license = {noinfo}, url = {https://mirror.ctan.org/systems/unix/tex-gpc}, - pkgurl = {https://ctan.org/pkg/TeX-GPC}, + pkgurl = {https://ctan.org/pkg/tex-gpc}, } @manual{tex-gyre-adventor, @@ -65631,7 +65667,7 @@ pkgurl = {https://ctan.org/pkg/tex-locale}, } -@manual{TeX-mag, +@manual{tex-mag, title = {The \texttt{TeX-mag} package}, subtitle = {An on-line TeX magazine}, author = {Don Hosek}, @@ -65639,7 +65675,7 @@ version = {}, license = {digest}, url = {https://mirror.ctan.org/info/digests/tex-mag}, - pkgurl = {https://ctan.org/pkg/TeX-mag}, + pkgurl = {https://ctan.org/pkg/tex-mag}, } @manual{tex-math, @@ -65653,7 +65689,7 @@ pkgurl = {https://ctan.org/pkg/tex-math}, } -@manual{TeX-nutshell, +@manual{tex-nutshell, title = {The \texttt{TeX-nutshell} package}, subtitle = {A short document about TeX principles}, author = {Petr Olšák}, @@ -65661,7 +65697,7 @@ version = {0.8}, license = {pd}, url = {https://mirror.ctan.org/info/tex-nutshell}, - pkgurl = {https://ctan.org/pkg/TeX-nutshell}, + pkgurl = {https://ctan.org/pkg/tex-nutshell}, } @manual{tex-overview, @@ -65718,7 +65754,7 @@ pkgurl = {https://ctan.org/pkg/tex-vpat}, } -@manual{TeX, +@manual{tex, title = {The \texttt{TeX} package}, subtitle = {A sophisticated typesetting engine}, author = {Donald E. Knuth}, @@ -65726,7 +65762,7 @@ version = {3.141592653}, license = {knuth}, url = {https://mirror.ctan.org/systems/knuth/dist/tex}, - pkgurl = {https://ctan.org/pkg/TeX}, + pkgurl = {https://ctan.org/pkg/tex}, } @manual{tex2bib, @@ -65821,14 +65857,14 @@ conversion engine.}, } -@manual{TeX4ht, +@manual{tex4ht, title = {The \texttt{TeX4ht} package}, subtitle = {Convert (La)TeX to HTML/XML}, author = {{The TeX4ht Team} and Eitan M. Gurari}, date = {2021-10-11}, license = {lppl}, url = {https://mirror.ctan.org/support/TeX4ht}, - pkgurl = {https://ctan.org/pkg/TeX4ht}, + pkgurl = {https://ctan.org/pkg/tex4ht}, } @manual{texaccents, @@ -65889,7 +65925,7 @@ pkgurl = {https://ctan.org/pkg/texbuch}, } -@manual{TeXbyTopic, +@manual{texbytopic, title = {The \texttt{TeXbyTopic} package}, subtitle = {Freed version of the book TeX by Topic}, author = {Victor Eijkhout}, @@ -65897,7 +65933,7 @@ version = {}, license = {fdl}, url = {https://mirror.ctan.org/info/texbytopic}, - pkgurl = {https://ctan.org/pkg/TeXbyTopic}, + pkgurl = {https://ctan.org/pkg/texbytopic}, } @manual{texcad32, @@ -65925,7 +65961,7 @@ pkgurl = {https://ctan.org/pkg/texchord}, } -@manual{TeXcount, +@manual{texcount, title = {The \texttt{TeXcount} package}, subtitle = {Count words in a \LaTeX{} document}, author = {Einar Andreas Rødland}, @@ -65933,7 +65969,7 @@ version = {3.1.1}, license = {lppl}, url = {https://mirror.ctan.org/support/texcount}, - pkgurl = {https://ctan.org/pkg/TeXcount}, + pkgurl = {https://ctan.org/pkg/texcount}, } @manual{texdate, @@ -66140,14 +66176,14 @@ pkgurl = {https://ctan.org/pkg/texfot}, } -@manual{TeXhax, +@manual{texhax, title = {The \texttt{TeXhax} package}, subtitle = {Digests of a general TeX mailing list}, author = {{Unknown}}, date = {2021-08-26}, license = {pd}, url = {https://mirror.ctan.org/info/digests/texhax}, - pkgurl = {https://ctan.org/pkg/TeXhax}, + pkgurl = {https://ctan.org/pkg/texhax}, } @manual{texi2dvi-latest, @@ -66207,7 +66243,7 @@ pkgurl = {https://ctan.org/pkg/texilikechaps}, } -@manual{texi-like_cover, +@manual{texilikecover, title = {The \texttt{texi-like cover} package}, subtitle = {A cover-page package, like TeXinfo}, author = {Alberto Manuel Brandão Simões}, @@ -66215,6 +66251,7 @@ version = {0.1}, license = {lppl}, url = {https://mirror.ctan.org/macros/latex/contrib/misc/texilikecover.sty}, + pkgurl = {https://ctan.org/pkg/texilikecover}, note = {The package creates document cover pages, like those that produces.}, } @@ -66258,7 +66295,7 @@ pkgurl = {https://ctan.org/pkg/texinfo}, } -@manual{TeXLab, +@manual{texlab, title = {The \texttt{TeXLab} package}, subtitle = {LaTeX Language Server}, author = {Eric Förster}, @@ -66266,10 +66303,10 @@ version = {4.2.0}, license = {gpl3}, url = {https://mirror.ctan.org/support/texlab}, - pkgurl = {https://ctan.org/pkg/TeXLab}, + pkgurl = {https://ctan.org/pkg/texlab}, } -@manual{TeXline, +@manual{texline, title = {The \texttt{TeXline} package}, subtitle = {A TeX-based magazine}, author = {Malcolm Clark}, @@ -66277,7 +66314,7 @@ version = {}, license = {digest}, url = {https://mirror.ctan.org/info/digests/texline}, - pkgurl = {https://ctan.org/pkg/TeXline}, + pkgurl = {https://ctan.org/pkg/texline}, } @manual{texlipse, @@ -66384,13 +66421,14 @@ pkgurl = {https://ctan.org/pkg/texlive-repo}, } -@manual{TeX_Live_source_tree, +@manual{texlive-source, title = {The \texttt{TeX Live source tree} package}, subtitle = {Sources of the TeX Live distribution}, author = {{The TeX Live Team}}, date = {2021-08-26}, license = {other-free}, url = {https://mirror.ctan.org/systems/texlive/Source}, + pkgurl = {https://ctan.org/pkg/texlive-source}, } @manual{texlive, @@ -66479,7 +66517,7 @@ , and others. Highlights:}, } -@manual{TeXmacs, +@manual{texmacs, title = {The \texttt{TeXmacs} package}, subtitle = {Structured text editor for TeX}, author = {Joris van der Hoeven}, @@ -66487,7 +66525,7 @@ version = {1.0.7.20}, license = {gpl}, url = {https://mirror.ctan.org/support/TeXmacs}, - pkgurl = {https://ctan.org/pkg/TeXmacs}, + pkgurl = {https://ctan.org/pkg/texmacs}, } @manual{texmalli, @@ -66501,7 +66539,7 @@ pkgurl = {https://ctan.org/pkg/texmalli}, } -@manual{TeXmate, +@manual{texmate, title = {The \texttt{TeXmate} package}, subtitle = {Comprehensive chess annotation in \LaTeX{}}, author = {Federico Garcia-De Castro}, @@ -66509,7 +66547,7 @@ version = {2}, license = {lppl}, url = {https://mirror.ctan.org/macros/latex/contrib/texmate}, - pkgurl = {https://ctan.org/pkg/TeXmate}, + pkgurl = {https://ctan.org/pkg/texmate}, } @manual{texments, @@ -66527,14 +66565,14 @@ with multiple colour schemes.}, } -@manual{TeXmuse, +@manual{texmuse, title = {The \texttt{TeXmuse} package}, subtitle = {Music typesetting system using TeX and Metafont}, author = {Federico Garcia-De Castro}, date = {2016-06-24}, license = {lppl}, url = {https://mirror.ctan.org/macros/texmuse}, - pkgurl = {https://ctan.org/pkg/TeXmuse}, + pkgurl = {https://ctan.org/pkg/texmuse}, } @manual{texnegar, @@ -66548,14 +66586,14 @@ pkgurl = {https://ctan.org/pkg/texnegar}, } -@manual{TeXnicCenter, +@manual{texniccenter, title = {The \texttt{TeXnicCenter} package}, subtitle = {An IDE for \LaTeX{} on MSWindows}, author = {Sven Wiegand}, date = {2016-06-24}, license = {gpl}, url = {https://mirror.ctan.org/systems/win32/TeXnicCenter}, - pkgurl = {https://ctan.org/pkg/TeXnicCenter}, + pkgurl = {https://ctan.org/pkg/texniccenter}, } @manual{texonly, @@ -66672,7 +66710,7 @@ pkgurl = {https://ctan.org/pkg/texpower}, } -@manual{TeXProject, +@manual{texproject, title = {The \texttt{TeXProject} package}, subtitle = {A package for project management}, author = {Stéphane Bressan and Eitan M. Gurari}, @@ -66680,10 +66718,10 @@ version = {}, license = {lppl}, url = {https://mirror.ctan.org/graphics/dratex/TeXProject.sty}, - pkgurl = {https://ctan.org/pkg/TeXProject}, + pkgurl = {https://ctan.org/pkg/texproject}, } -@manual{TeXProposal, +@manual{texproposal, title = {The \texttt{TeXProposal} package}, subtitle = {A proposal prototype for \LaTeX{} promotion in Chinese universities}, author = {Li Zhennan}, @@ -66691,7 +66729,7 @@ version = {1.4}, license = {other-free}, url = {https://mirror.ctan.org/info/texproposal}, - pkgurl = {https://ctan.org/pkg/TeXProposal}, + pkgurl = {https://ctan.org/pkg/texproposal}, } @manual{texref, @@ -66731,7 +66769,7 @@ development time of the user.}, } -@manual{TeXshell, +@manual{texshell, title = {The \texttt{TeXshell} package}, subtitle = {X-Window Shell for TeX}, author = {Marc Mittelbach}, @@ -66739,7 +66777,7 @@ version = {2.8}, license = {gpl}, url = {https://mirror.ctan.org/support/TeXshell}, - pkgurl = {https://ctan.org/pkg/TeXshell}, + pkgurl = {https://ctan.org/pkg/texshell}, } @manual{texshell32, @@ -66768,7 +66806,7 @@ PDF.}, } -@manual{TeXsis, +@manual{texsis, title = {The \texttt{TeXsis} package}, subtitle = {Plain TeX macros for Physicists}, author = {Eric Myers and Frank Paige}, @@ -66776,7 +66814,7 @@ version = {2.18}, license = {lppl}, url = {https://mirror.ctan.org/macros/texsis}, - pkgurl = {https://ctan.org/pkg/TeXsis}, + pkgurl = {https://ctan.org/pkg/texsis}, } @manual{texsketch, @@ -66828,7 +66866,7 @@ always in tandem with the package.}, } -@manual{TeX_T1, +@manual{text1, title = {The \texttt{TeX T1} package}, subtitle = {TeX format from Washington State University}, author = {Dean Guenther}, @@ -66836,6 +66874,7 @@ version = {}, license = {nocommercial}, url = {https://mirror.ctan.org/macros/text1}, + pkgurl = {https://ctan.org/pkg/text1}, } @manual{text2bib, @@ -67069,7 +67108,7 @@ pkgurl = {https://ctan.org/pkg/tfmpk}, } -@manual{TFMPKtest, +@manual{tfmpktest, title = {The \texttt{TFMPKtest} package}, subtitle = {Check and correct checksums of TFM and PK files}, author = {Dominique Larchey and Denis B. Roegel and Christian Rossi}, @@ -67077,7 +67116,7 @@ version = {0.1}, license = {lppl}, url = {https://mirror.ctan.org/fonts/utilities/tfmpktest}, - pkgurl = {https://ctan.org/pkg/TFMPKtest}, + pkgurl = {https://ctan.org/pkg/tfmpktest}, note = {TFMPKtest checks font checksums. It can delete a PK font whose checksum does not match that of the corresponding TFM, then regenerate using ; similarly it can delete and @@ -67174,7 +67213,7 @@ pkgurl = {https://ctan.org/pkg/thaifonts-arundina}, } -@manual{ThaiLaTeX, +@manual{thailatex, title = {The \texttt{ThaiLaTeX} package}, subtitle = {Typeset Thai texts with standard \LaTeX{} classes}, author = {Theppitak Karoonboonyanan}, @@ -67182,7 +67221,7 @@ version = {0.5.1}, license = {lppl}, url = {https://mirror.ctan.org/obsolete/language/thai/thailatex}, - pkgurl = {https://ctan.org/pkg/ThaiLaTeX}, + pkgurl = {https://ctan.org/pkg/thailatex}, } @manual{thaispec, @@ -67200,8 +67239,8 @@ title = {The \texttt{thalie} package}, subtitle = {Typeset drama plays}, author = {Louis Paternault}, - date = {2022-06-15}, - version = {0.11b}, + date = {2022-10-09}, + version = {0.12a}, license = {lppl1.3}, url = {https://mirror.ctan.org/macros/latex/contrib/thalie}, pkgurl = {https://ctan.org/pkg/thalie}, @@ -67484,7 +67523,7 @@ pkgurl = {https://ctan.org/pkg/threeddice}, } -@manual{3DLDF, +@manual{threedldf, title = {The \texttt{3DLDF} package}, subtitle = {Three-dimensional drawing with MetaPost output}, author = {Laurence Finston}, @@ -67492,7 +67531,7 @@ version = {1.1.5.1}, license = {gpl}, url = {https://mirror.ctan.org/graphics/3DLDF}, - pkgurl = {https://ctan.org/pkg/3DLDF}, + pkgurl = {https://ctan.org/pkg/threedldf}, } @manual{threeparttable, @@ -67753,7 +67792,7 @@ pkgurl = {https://ctan.org/pkg/tikz-among-us}, } -@manual{TikZ-Bagua, +@manual{tikz-bagua, title = {The \texttt{TikZ-Bagua} package}, subtitle = {Draw Bagua symbols in Yijing}, author = {Xu WANG}, @@ -67761,7 +67800,7 @@ version = {1.01}, license = {lppl1.3c}, url = {https://mirror.ctan.org/graphics/pgf/contrib/tikz-bagua}, - pkgurl = {https://ctan.org/pkg/TikZ-Bagua}, + pkgurl = {https://ctan.org/pkg/tikz-bagua}, } @manual{tikz-bayesnet, @@ -67837,7 +67876,7 @@ pkgurl = {https://ctan.org/pkg/tikz-ext}, } -@manual{TikZ-FeynHand, +@manual{tikz-feynhand, title = {The \texttt{TikZ-FeynHand} package}, subtitle = {Feynman diagrams with TikZ}, author = {Max Dohse}, @@ -67845,7 +67884,7 @@ version = {1.1.0}, license = {gpl3+}, url = {https://mirror.ctan.org/graphics/pgf/contrib/tikz-feynhand}, - pkgurl = {https://ctan.org/pkg/TikZ-FeynHand}, + pkgurl = {https://ctan.org/pkg/tikz-feynhand}, } @manual{tikz-feynman, @@ -68021,7 +68060,7 @@ pkgurl = {https://ctan.org/pkg/tikz-palattice}, } -@manual{TikZ-planets, +@manual{tikz-planets, title = {The \texttt{TikZ-planets} package}, subtitle = {Illustrate celestial mechanics and the solar system}, author = {Isabelle M. Santos}, @@ -68029,7 +68068,7 @@ version = {1.0.2}, license = {cc-by-sa-4}, url = {https://mirror.ctan.org/graphics/pgf/contrib/tikz-planets}, - pkgurl = {https://ctan.org/pkg/TikZ-planets}, + pkgurl = {https://ctan.org/pkg/tikz-planets}, } @manual{tikz-qtree, @@ -68126,7 +68165,7 @@ Colin Beveridge's article in issue 08 of Chalkdust.}, } -@manual{TikZbricks, +@manual{tikzbricks, title = {The \texttt{TikZbricks} package}, subtitle = {Drawing bricks with TikZ}, author = {{Unknown}}, @@ -68134,7 +68173,7 @@ version = {0.4}, license = {lppl1.3c}, url = {https://mirror.ctan.org/graphics/pgf/contrib/tikzbricks}, - pkgurl = {https://ctan.org/pkg/TikZbricks}, + pkgurl = {https://ctan.org/pkg/tikzbricks}, } @manual{tikzcodeblocks, @@ -68150,7 +68189,7 @@ blockwise graphic programming languages like scratch, nepo or pxt.}, } -@manual{TikZducks, +@manual{tikzducks, title = {The \texttt{TikZducks} package}, subtitle = {A little fun package for using rubber ducks in TikZ}, author = {{Unknown}}, @@ -68158,7 +68197,7 @@ version = {1.5}, license = {lppl1.3c}, url = {https://mirror.ctan.org/graphics/pgf/contrib/tikzducks}, - pkgurl = {https://ctan.org/pkg/TikZducks}, + pkgurl = {https://ctan.org/pkg/tikzducks}, note = {The package is a \LaTeX{} package for ducks to be used in TikZ pictures. This project is a continuation of an answer at StackExchange}, } @@ -68191,7 +68230,7 @@ pkgurl = {https://ctan.org/pkg/tikzinclude}, } -@manual{TikZlings, +@manual{tikzlings, title = {The \texttt{TikZlings} package}, subtitle = {A collection of cute little animals and similar creatures}, author = {{Unknown}}, @@ -68199,7 +68238,7 @@ version = {1.0}, license = {lppl1.3c}, url = {https://mirror.ctan.org/graphics/pgf/contrib/tikzlings}, - pkgurl = {https://ctan.org/pkg/TikZlings}, + pkgurl = {https://ctan.org/pkg/tikzlings}, } @manual{tikzmark, @@ -68213,7 +68252,7 @@ pkgurl = {https://ctan.org/pkg/tikzmark}, } -@manual{TikZmarmots, +@manual{tikzmarmots, title = {The \texttt{TikZmarmots} package}, subtitle = {Drawing little marmots in TikZ}, author = {{Unknown}}, @@ -68221,7 +68260,7 @@ version = {1.0}, license = {lppl1.3c}, url = {https://mirror.ctan.org/graphics/pgf/contrib/tikzmarmots}, - pkgurl = {https://ctan.org/pkg/TikZmarmots}, + pkgurl = {https://ctan.org/pkg/tikzmarmots}, } @manual{tikzorbital, @@ -68288,7 +68327,7 @@ arrows using PGF/TikZ, so as to avoid the problem.}, } -@manual{Tikzpingus, +@manual{tikzpingus, title = {The \texttt{Tikzpingus} package}, subtitle = {Penguins with TikZ}, author = {Florian Sihler}, @@ -68296,7 +68335,7 @@ version = {1.0}, license = {gpl3}, url = {https://mirror.ctan.org/graphics/pgf/contrib/tikzpingus}, - pkgurl = {https://ctan.org/pkg/Tikzpingus}, + pkgurl = {https://ctan.org/pkg/tikzpingus}, note = {tikzpingus is a package similar to but with penguins and a vast set of gadgets and extras (capable of changing the wing-positions, @@ -68951,7 +68990,7 @@ pkgurl = {https://ctan.org/pkg/tlc2-examples}, } -@manual{TLCockpit, +@manual{tlcockpit, title = {The \texttt{TLCockpit} package}, subtitle = {A GUI frontend to TeX Live Manager (tlmgr)}, author = {Norbert Preining}, @@ -68959,7 +68998,7 @@ version = {1.2}, license = {gpl3+}, url = {https://mirror.ctan.org/support/tlcockpit}, - pkgurl = {https://ctan.org/pkg/TLCockpit}, + pkgurl = {https://ctan.org/pkg/tlcockpit}, note = {This package aims at being a GUI for , the Manager, @@ -68991,7 +69030,7 @@ pkgurl = {https://ctan.org/pkg/tlmgr-intro-zh-cn}, } -@manual{tlmgrBasics, +@manual{tlmgrbasics, title = {The \texttt{tlmgrBasics} package}, subtitle = {A simplified documentation for tlmgr}, author = {Bob Tennent}, @@ -68999,7 +69038,7 @@ version = {}, license = {gpl2+}, url = {https://mirror.ctan.org/info/tlmgrbasics}, - pkgurl = {https://ctan.org/pkg/tlmgrBasics}, + pkgurl = {https://ctan.org/pkg/tlmgrbasics}, note = {This package provides simplified documentation for , the Manager. @@ -69247,7 +69286,7 @@ pkgurl = {https://ctan.org/pkg/tolkienfonts}, } -@manual{toneval, +@manual{tonevalue, title = {The \texttt{toneval} package}, subtitle = {Tool for linguists and phoneticians to visualize tone value patterns}, author = {Yuanhao Chen}, @@ -69255,7 +69294,7 @@ version = {1.0}, license = {apache2}, url = {https://mirror.ctan.org/graphics/pgf/contrib/tonevalue}, - pkgurl = {https://ctan.org/pkg/toneval}, + pkgurl = {https://ctan.org/pkg/tonevalue}, } @manual{toolbox, @@ -69304,7 +69343,7 @@ pkgurl = {https://ctan.org/pkg/topiclongtable}, } -@manual{TOPletter, +@manual{topletter, title = {The \texttt{TOPletter} package}, subtitle = {Letter class for the Politecnico di Torino}, author = {Marco Torchiano}, @@ -69312,7 +69351,7 @@ version = {0.3.0}, license = {apache2}, url = {https://mirror.ctan.org/macros/latex/contrib/topletter}, - pkgurl = {https://ctan.org/pkg/TOPletter}, + pkgurl = {https://ctan.org/pkg/topletter}, note = {This package provides a \LaTeX{} class for typesetting letters conforming to the official . @@ -69330,7 +69369,7 @@ pkgurl = {https://ctan.org/pkg/topsection}, } -@manual{TOPtesi, +@manual{toptesi, title = {The \texttt{TOPtesi} package}, subtitle = {Bundle for typesetting multilanguage theses}, author = {Claudio Beccari}, @@ -69338,7 +69377,7 @@ version = {6.4.06}, license = {lppl1.3c}, url = {https://mirror.ctan.org/macros/latex/contrib/toptesi}, - pkgurl = {https://ctan.org/pkg/TOPtesi}, + pkgurl = {https://ctan.org/pkg/toptesi}, } @manual{totalcount, @@ -69414,7 +69453,7 @@ pkgurl = {https://ctan.org/pkg/tpslifonts}, } -@manual{TpX, +@manual{tpx, title = {The \texttt{TpX} package}, subtitle = {A drawing tool for Windows}, author = {Alexander Tsyplakov}, @@ -69422,7 +69461,7 @@ version = {1.5}, license = {gpl}, url = {https://mirror.ctan.org/graphics/tpx}, - pkgurl = {https://ctan.org/pkg/TpX}, + pkgurl = {https://ctan.org/pkg/tpx}, } @manual{tqft, @@ -69757,7 +69796,7 @@ pkgurl = {https://ctan.org/pkg/translator}, } -@manual{Transparent-IO, +@manual{transparent-io, title = {The \texttt{Transparent-IO} package}, subtitle = {Show for approval the filenames used in \textbackslash{}input, \textbackslash{}openin, or \textbackslash{}openout}, author = {Udo Wermuth}, @@ -69765,7 +69804,7 @@ version = {}, license = {gpl3}, url = {https://mirror.ctan.org/macros/plain/contrib/transparent-io}, - pkgurl = {https://ctan.org/pkg/Transparent-IO}, + pkgurl = {https://ctan.org/pkg/transparent-io}, } @manual{transparent, @@ -69935,7 +69974,7 @@ pkgurl = {https://ctan.org/pkg/truetypemetrics}, } -@manual{TrueTypeToType42, +@manual{truetypetotype42, title = {The \texttt{TrueTypeToType42} package}, subtitle = {Generate a Type 42 font from a TrueType font}, author = {Thomas H. Barton}, @@ -69943,7 +69982,7 @@ version = {}, license = {noinfo}, url = {https://mirror.ctan.org/fonts/utilities/TrueTypeToType42}, - pkgurl = {https://ctan.org/pkg/TrueTypeToType42}, + pkgurl = {https://ctan.org/pkg/truetypetotype42}, note = {The package provides a PostScript program, to run under , that will read a TrueType font and produce an Adobe Type 42 (PFA) font as output.}, @@ -69976,7 +70015,7 @@ package.}, } -@manual{TrY, +@manual{try, title = {The \texttt{TrY} package}, subtitle = {Automation of TeX/LaTeX compilation}, author = {Ajabu Tex}, @@ -69984,7 +70023,7 @@ version = {4.0}, license = {lppl1.3}, url = {https://mirror.ctan.org/support/try}, - pkgurl = {https://ctan.org/pkg/TrY}, + pkgurl = {https://ctan.org/pkg/try}, note = {The package offers a script that automates the compilation of TeX/LaTeX documents. TrY reads commands from the comment lines of the document and executes them automatically. TrY may be compared @@ -70322,7 +70361,7 @@ pkgurl = {https://ctan.org/pkg/turnthepage}, } -@manual{TVS, +@manual{tvs, title = {The \texttt{TVS} package}, subtitle = {TeX Versioning System}, author = {David Antos}, @@ -70330,7 +70369,7 @@ version = {1.28}, license = {gpl}, url = {https://mirror.ctan.org/support/TVS}, - pkgurl = {https://ctan.org/pkg/TVS}, + pkgurl = {https://ctan.org/pkg/tvs}, } @manual{twcal, @@ -70396,7 +70435,7 @@ pkgurl = {https://ctan.org/pkg/twocolumns}, } -@manual{2in1, +@manual{twoinone, title = {The \texttt{2in1} package}, subtitle = {Print two pages on a single page}, author = {Sanjeev Saxena}, @@ -70404,7 +70443,7 @@ version = {}, license = {pd}, url = {https://mirror.ctan.org/macros/latex/contrib/twoinone}, - pkgurl = {https://ctan.org/pkg/2in1}, + pkgurl = {https://ctan.org/pkg/twoinone}, } @manual{twoopt, @@ -70545,7 +70584,7 @@ pkgurl = {https://ctan.org/pkg/txt2tex}, } -@manual{TXUprCal, +@manual{txuprcal, title = {The \texttt{TXUprCal} package}, subtitle = {Upright calligraphic font based on TX calligraphic}, author = {Michael Sharpe}, @@ -70553,7 +70592,7 @@ version = {1.00}, license = {gpl3}, url = {https://mirror.ctan.org/fonts/txuprcal}, - pkgurl = {https://ctan.org/pkg/TXUprCal}, + pkgurl = {https://ctan.org/pkg/txuprcal}, note = {This small package provides a means of loading as an uprighted version of the calligraphic fonts from the TX font package. A scaled option to provided to @@ -71086,14 +71125,14 @@ pkgurl = {https://ctan.org/pkg/ukrhyph}, } -@manual{UK-TeX, +@manual{uktex, title = {The \texttt{UK-TeX} package}, subtitle = {The UK TeX digest}, author = {{Unknown}}, date = {2016-06-24}, license = {pd}, url = {https://mirror.ctan.org/info/digests/uktex}, - pkgurl = {https://ctan.org/pkg/UK-TeX}, + pkgurl = {https://ctan.org/pkg/uktex}, } @manual{uktug-bask, @@ -71174,14 +71213,14 @@ are all written in French, the language of the target audience.}, } -@manual{Ultra-TeX, +@manual{ultratex, title = {The \texttt{Ultra-TeX} package}, subtitle = {An emacs TeX mode with "lightning completion'}, author = {John H. Palmieri}, date = {2016-06-24}, license = {gpl}, url = {https://mirror.ctan.org/support/ultratex}, - pkgurl = {https://ctan.org/pkg/Ultra-TeX}, + pkgurl = {https://ctan.org/pkg/ultratex}, note = {Ultra-TeX is an Emacs mode, a distant relation of , with several enhancements (relative to the version it started from) and with a @@ -71213,7 +71252,7 @@ pkgurl = {https://ctan.org/pkg/umich-thesis}, } -@manual{UML, +@manual{uml, title = {The \texttt{UML} package}, subtitle = {UML diagrams in \LaTeX{}}, author = {Ellef Gjelstad}, @@ -71221,7 +71260,7 @@ version = {0.11}, license = {lppl}, url = {https://mirror.ctan.org/graphics/pstricks/contrib/uml}, - pkgurl = {https://ctan.org/pkg/UML}, + pkgurl = {https://ctan.org/pkg/uml}, } @manual{umlaute, @@ -71320,7 +71359,7 @@ using the package.}, } -@manual{UnBTeX, +@manual{unbtex, title = {The \texttt{UnBTeX} package}, subtitle = {A class for theses at University of Brasilia (UnB)}, author = {Henrique Cezar Ferreira}, @@ -71328,7 +71367,7 @@ version = {1.2}, license = {lppl1.3}, url = {https://mirror.ctan.org/macros/latex/contrib/unbtex}, - pkgurl = {https://ctan.org/pkg/UnBTeX}, + pkgurl = {https://ctan.org/pkg/unbtex}, } @manual{uncial, @@ -71352,7 +71391,7 @@ pkgurl = {https://ctan.org/pkg/undergradmath}, } -@manual{underlin-generic, +@manual{underlin-gen, title = {The \texttt{underlin-generic} package}, subtitle = {Multi-word underlining}, author = {Stephen Gildea}, @@ -71360,7 +71399,7 @@ version = {}, license = {noinfo}, url = {https://mirror.ctan.org/macros/generic/misc/underlin.tex}, - pkgurl = {https://ctan.org/pkg/underlin-generic}, + pkgurl = {https://ctan.org/pkg/underlin-gen}, } @manual{underlin, @@ -71591,7 +71630,7 @@ pkgurl = {https://ctan.org/pkg/unicodefonttable}, } -@manual{UniFiTh, +@manual{unifith, title = {The \texttt{UniFiTh} package}, subtitle = {Typeset theses for University of Florence (Italy)}, author = {Francesco Biccari}, @@ -71599,7 +71638,7 @@ version = {1.6}, license = {lppl1.3c}, url = {https://mirror.ctan.org/macros/latex/contrib/unifith}, - pkgurl = {https://ctan.org/pkg/UniFiTh}, + pkgurl = {https://ctan.org/pkg/unifith}, } @manual{uninormalize, @@ -71922,7 +71961,7 @@ pkgurl = {https://ctan.org/pkg/upmendex}, } -@manual{UPmethodology, +@manual{upmethodology, title = {The \texttt{UPmethodology} package}, subtitle = {Writing specifications such as for UP-based methodologies}, author = {Stéphane Galland}, @@ -71930,7 +71969,7 @@ version = {20221004}, license = {lgpl3}, url = {https://mirror.ctan.org/macros/latex/contrib/upmethodology}, - pkgurl = {https://ctan.org/pkg/UPmethodology}, + pkgurl = {https://ctan.org/pkg/upmethodology}, } @manual{uppunctlm, @@ -72098,14 +72137,14 @@ pkgurl = {https://ctan.org/pkg/urw-arial}, } -@manual{URW-base35, +@manual{urw-base35, title = {The \texttt{URW-base35} package}, subtitle = {URW ‘Base 35’ font pack for \LaTeX{}}, author = {{URW GmbH} and Primoz Peterlin and Walter A. Schmidt}, date = {2021-12-07}, license = {gpl}, url = {https://mirror.ctan.org/fonts/urw/base35}, - pkgurl = {https://ctan.org/pkg/URW-base35}, + pkgurl = {https://ctan.org/pkg/urw-base35}, } @manual{urw-garamond, @@ -72118,14 +72157,14 @@ pkgurl = {https://ctan.org/pkg/urw-garamond}, } -@manual{URW-Grotesq, +@manual{urw-grotesq, title = {The \texttt{URW-Grotesq} package}, subtitle = {URW Grotesq font pack for \LaTeX{}}, author = {{URW GmbH} and Walter A. Schmidt and Keiran Harcombe}, date = {2021-12-07}, license = {gpl}, url = {https://mirror.ctan.org/fonts/urw/grotesq}, - pkgurl = {https://ctan.org/pkg/URW-Grotesq}, + pkgurl = {https://ctan.org/pkg/urw-grotesq}, } @manual{urw, @@ -72497,7 +72536,7 @@ pkgurl = {https://ctan.org/pkg/vak}, } -@manual{Vancouver, +@manual{vancouver, title = {The \texttt{Vancouver} package}, subtitle = {Bibliographic style file for Biomedical Journals}, author = {Folkert van der Beek}, @@ -72505,7 +72544,7 @@ version = {1.0}, license = {lppl1.3}, url = {https://mirror.ctan.org/biblio/bibtex/contrib/vancouver}, - pkgurl = {https://ctan.org/pkg/Vancouver}, + pkgurl = {https://ctan.org/pkg/vancouver}, note = {This BibTeX style file is generated with the docstrip utility and modified manually to meet the as published in N Engl J Med 1997;336:309-315 (also known as the Vancouver @@ -72723,7 +72762,7 @@ pkgurl = {https://ctan.org/pkg/venndiagram}, } -@manual{venturisADF, +@manual{venturisadf, title = {The \texttt{venturisADF} package}, subtitle = {Venturis ADF fonts collection}, author = {Hirwen Harendal and Clea F. Rees}, @@ -72731,7 +72770,7 @@ version = {1.005}, license = {other-free}, url = {https://mirror.ctan.org/fonts/venturisadf}, - pkgurl = {https://ctan.org/pkg/venturisADF}, + pkgurl = {https://ctan.org/pkg/venturisadf}, note = {Serif and sans serif complete text font families, in both Adobe Type 1 and OpenType formats for publication. The family is based on Utopia family, and has been modified and developed by the Arkandis @@ -73142,7 +73181,7 @@ pkgurl = {https://ctan.org/pkg/vispeech}, } -@manual{visualFAQ-fr, +@manual{visualfaq-fr, title = {The \texttt{visualFAQ-fr} package}, subtitle = {FAQ \LaTeX{} visuelle francophone}, author = {Jérémy Just}, @@ -73150,10 +73189,10 @@ version = {}, license = {lppl1.3c}, url = {https://mirror.ctan.org/info/visualfaq-fr}, - pkgurl = {https://ctan.org/pkg/visualFAQ-fr}, + pkgurl = {https://ctan.org/pkg/visualfaq-fr}, } -@manual{visualFAQ, +@manual{visualfaq, title = {The \texttt{visualFAQ} package}, subtitle = {A Visual \LaTeX{} FAQ}, author = {Scott Pakin}, @@ -73161,7 +73200,7 @@ version = {}, license = {lppl}, url = {https://mirror.ctan.org/info/visualfaq}, - pkgurl = {https://ctan.org/pkg/visualFAQ}, + pkgurl = {https://ctan.org/pkg/visualfaq}, note = {Having trouble finding the answer to a \LaTeX{} question? The Visual \LaTeX{} FAQ is an innovative new search interface that presents over a hundred typeset samples of frequently requested document @@ -73170,7 +73209,7 @@ page in the .}, } -@manual{VisualPSTricks, +@manual{visualpstricks, title = {The \texttt{VisualPSTricks} package}, subtitle = {Visual help for PSTricks based on images with minimum text}, author = {Jean Pierre Casteleyn}, @@ -73178,7 +73217,7 @@ version = {2.3}, license = {gpl}, url = {https://mirror.ctan.org/info/visualpstricks}, - pkgurl = {https://ctan.org/pkg/VisualPSTricks}, + pkgurl = {https://ctan.org/pkg/visualpstricks}, } @manual{visualtex, @@ -73192,7 +73231,7 @@ pkgurl = {https://ctan.org/pkg/visualtex}, } -@manual{VisualTikZ, +@manual{visualtikz, title = {The \texttt{VisualTikZ} package}, subtitle = {Visual help for TikZ based on images with minimum text}, author = {Jean Pierre Casteleyn}, @@ -73200,7 +73239,7 @@ version = {0.65}, license = {lppl1.3}, url = {https://mirror.ctan.org/info/visualtikz}, - pkgurl = {https://ctan.org/pkg/VisualTikZ}, + pkgurl = {https://ctan.org/pkg/visualtikz}, } @manual{vita, @@ -73453,7 +73492,7 @@ pkgurl = {https://ctan.org/pkg/vruler}, } -@manual{VSliTeX, +@manual{vslitex, title = {The \texttt{VSliTeX} package}, subtitle = {Virtual invisible fonts for use with \LaTeX{} Slides class}, author = {Armin Koellner}, @@ -73461,7 +73500,7 @@ version = {0.4}, license = {noinfo}, url = {https://mirror.ctan.org/fonts/vf-files/vslitex}, - pkgurl = {https://ctan.org/pkg/VSliTeX}, + pkgurl = {https://ctan.org/pkg/vslitex}, note = {The \LaTeX{} 2.09-based program SliTeX, and the corresponding \LaTeX{} class, use invisible fonts when producing multi-coloured overlays on foils. SliTeX distributions @@ -73485,7 +73524,7 @@ note = {The package allows vertical alignement of table cell by providing:}, } -@manual{VTeX/Free, +@manual{vtex-free, title = {The \texttt{VTeX/Free} package}, subtitle = {TeX system and PDF support for Linux and OS/2}, author = {{MicroPress}}, @@ -73493,7 +73532,7 @@ version = {8.46}, license = {other-nonfree}, url = {https://mirror.ctan.org/systems/vtex}, - pkgurl = {https://ctan.org/pkg/VTeX/Free}, + pkgurl = {https://ctan.org/pkg/vtex-free}, } @manual{vutex, @@ -73739,13 +73778,13 @@ comfortable reading.}, } -@manual{Web2C, +@manual{web2c, title = {The \texttt{Web2C} package}, subtitle = {Conversion programs and supporting code to compile TeX in C}, author = {Olaf Weber and {The TeX Live Team}}, date = {2022-01-17}, license = {gpl}, - pkgurl = {https://ctan.org/pkg/Web2C}, + pkgurl = {https://ctan.org/pkg/web2c}, } @manual{web2w, @@ -73838,7 +73877,7 @@ the distribution, as are test (demonstration) files.}, } -@manual{WebQuiz, +@manual{webquiz, title = {The \texttt{WebQuiz} package}, subtitle = {Write interactive web based quizzes}, author = {Andrew Mathas}, @@ -73846,7 +73885,7 @@ version = {5.2}, license = {gpl3+}, url = {https://mirror.ctan.org/macros/latex/contrib/webquiz}, - pkgurl = {https://ctan.org/pkg/WebQuiz}, + pkgurl = {https://ctan.org/pkg/webquiz}, note = {WebQuiz makes it possible to use \LaTeX{} to write interactive web based quizzes. The quizzes are first written in \LaTeX{} and then converted into HTML files using WebQuiz, which is written in @@ -74015,7 +74054,7 @@ according to the 17th edition of .}, } -@manual{WinEdt, +@manual{winedt, title = {The \texttt{WinEdt} package}, subtitle = {MS-Windows shell and editor for TeX}, author = {Aleksander Simonic}, @@ -74023,7 +74062,7 @@ version = {6.0}, license = {shareware}, url = {https://mirror.ctan.org/systems/win32/winedt}, - pkgurl = {https://ctan.org/pkg/WinEdt}, + pkgurl = {https://ctan.org/pkg/winedt}, } @manual{winemtex, @@ -74038,7 +74077,7 @@ preconfigured to work with TeX.}, } -@manual{Winfonts, +@manual{winfonts, title = {The \texttt{Winfonts} package}, subtitle = {Use fonts distributed with Windows XP}, author = {Paul Pichaureau}, @@ -74046,7 +74085,7 @@ version = {1.1}, license = {gpl}, url = {https://mirror.ctan.org/fonts/winfonts}, - pkgurl = {https://ctan.org/pkg/Winfonts}, + pkgurl = {https://ctan.org/pkg/winfonts}, } @manual{winlatex, @@ -74071,13 +74110,14 @@ pkgurl = {https://ctan.org/pkg/winshell}, } -@manual{WinTeX_XP, +@manual{wintex2000, title = {The \texttt{WinTeX XP} package}, subtitle = {A Win32 TeX Editor with the MS Office look and feel}, author = {Michael Muecke}, date = {2017-05-21}, license = {shareware}, url = {https://mirror.ctan.org/systems/win32/wintex2000}, + pkgurl = {https://ctan.org/pkg/wintex2000}, } @manual{withargs, @@ -74198,7 +74238,7 @@ that produces a day name, in German.}, } -@manual{Woff2OT, +@manual{woff2ot, title = {The \texttt{Woff2OT} package}, subtitle = {Woff to OpenType converter}, author = {Peter Frane Jr}, @@ -74206,7 +74246,7 @@ version = {1.0}, license = {gpl3+}, url = {https://mirror.ctan.org/fonts/utilities/woff2ot}, - pkgurl = {https://ctan.org/pkg/Woff2OT}, + pkgurl = {https://ctan.org/pkg/woff2ot}, } @manual{word2latex, @@ -74270,7 +74310,7 @@ pkgurl = {https://ctan.org/pkg/wordlike}, } -@manual{WordML2LaTeX, +@manual{wordml2latex, title = {The \texttt{WordML2LaTeX} package}, subtitle = {XSLT to transform a WordML file to a \LaTeX{}2e source}, author = {Ruggero Dambra}, @@ -74278,7 +74318,7 @@ version = {1.0}, license = {gpl}, url = {https://mirror.ctan.org/support/WordML2LaTeX}, - pkgurl = {https://ctan.org/pkg/WordML2LaTeX}, + pkgurl = {https://ctan.org/pkg/wordml2latex}, } @manual{wordweb, @@ -74337,7 +74377,7 @@ note = {Draws the diagrams using .}, } -@manual{WP2LaTeX, +@manual{wp2latex, title = {The \texttt{WP2LaTeX} package}, subtitle = {Convert WordPerfect documents to \LaTeX{}}, author = {Jaroslav FojtÃk}, @@ -74345,7 +74385,7 @@ version = {3.88}, license = {other-free}, url = {https://mirror.ctan.org/support/wp2latex}, - pkgurl = {https://ctan.org/pkg/WP2LaTeX}, + pkgurl = {https://ctan.org/pkg/wp2latex}, note = {This is a long established, supported, converter. A patch is available to use its code as an HTML to \LaTeX{} convertor (see documentation link, below; this code is unrelated to the @@ -74454,7 +74494,7 @@ wsuipa font commands with tipa font commands.}, } -@manual{WTRef, +@manual{wtref, title = {The \texttt{WTRef} package}, subtitle = {Extend \LaTeX{}’s cross-reference system}, author = {Takuto Asakura}, @@ -74462,7 +74502,7 @@ version = {0.4.0}, license = {mit}, url = {https://mirror.ctan.org/macros/latex/contrib/wtref}, - pkgurl = {https://ctan.org/pkg/WTRef}, + pkgurl = {https://ctan.org/pkg/wtref}, note = {Prerequisite packages: and .}, @@ -74559,7 +74599,7 @@ (extension of Bitstream Charter) in LuaLaTeX or \XeLaTeX{} documents.}, } -@manual{XCharter, +@manual{xcharter, title = {The \texttt{XCharter} package}, subtitle = {Extension of Bitstream Charter fonts}, author = {Michael Sharpe}, @@ -74567,7 +74607,7 @@ version = {1.24}, license = {other-free,lppl1.3}, url = {https://mirror.ctan.org/fonts/xcharter}, - pkgurl = {https://ctan.org/pkg/XCharter}, + pkgurl = {https://ctan.org/pkg/xcharter}, } @manual{xcite, @@ -74889,7 +74929,7 @@ pkgurl = {https://ctan.org/pkg/xepersian-hm}, } -@manual{XePersian, +@manual{xepersian, title = {The \texttt{XePersian} package}, subtitle = {Persian for \LaTeX{}, using XeTeX}, author = {Vafa Khalighi and {bidi-tex GitHub Organisation}}, @@ -74897,7 +74937,7 @@ version = {24.7}, license = {lppl1.3c}, url = {https://mirror.ctan.org/macros/xetex/latex/xepersian}, - pkgurl = {https://ctan.org/pkg/XePersian}, + pkgurl = {https://ctan.org/pkg/xepersian}, } @manual{xesearch, @@ -74935,7 +74975,7 @@ pkgurl = {https://ctan.org/pkg/xespotcolor}, } -@manual{XeT-TeX, +@manual{xet-tex, title = {The \texttt{XeT-TeX} package}, subtitle = {A bi-directional version of TeX}, author = {Pierre A. MacKay}, @@ -74943,7 +74983,7 @@ version = {}, license = {other-free}, url = {https://mirror.ctan.org/language/xettex}, - pkgurl = {https://ctan.org/pkg/XeT-TeX}, + pkgurl = {https://ctan.org/pkg/xet-tex}, } @manual{xetal, @@ -75058,7 +75098,7 @@ pkgurl = {https://ctan.org/pkg/xetexko}, } -@manual{XeTeXref, +@manual{xetexref, title = {The \texttt{XeTeXref} package}, subtitle = {Reference documentation of XeTeX}, author = {Will Robertson}, @@ -75066,7 +75106,7 @@ version = {}, license = {lppl1.3c}, url = {https://mirror.ctan.org/info/xetexref}, - pkgurl = {https://ctan.org/pkg/XeTeXref}, + pkgurl = {https://ctan.org/pkg/xetexref}, } @manual{xevlna, @@ -75797,14 +75837,14 @@ pkgurl = {https://ctan.org/pkg/xtexcad}, } -@manual{XteXShell, +@manual{xtexshell, title = {The \texttt{XteXShell} package}, subtitle = {A shell/editor}, author = {Michael T. Hofmann}, date = {2016-06-24}, license = {gpl2}, url = {https://mirror.ctan.org/support/xtexshell}, - pkgurl = {https://ctan.org/pkg/XteXShell}, + pkgurl = {https://ctan.org/pkg/xtexshell}, } @manual{xtrcode, @@ -76004,7 +76044,7 @@ of the more common styles and sizes.}, } -@manual{YAMLvars, +@manual{yamlvars, title = {The \texttt{YAMLvars} package}, subtitle = {A YAML parser and tool for easy \LaTeX{} definition creation}, author = {Kale Ewasiuk}, @@ -76012,7 +76052,7 @@ version = {}, license = {mit}, url = {https://mirror.ctan.org/macros/luatex/latex/yamlvars}, - pkgurl = {https://ctan.org/pkg/YAMLvars}, + pkgurl = {https://ctan.org/pkg/yamlvars}, } @manual{yandy, @@ -76112,7 +76152,7 @@ pkgurl = {https://ctan.org/pkg/ydoc}, } -@manual{Yet-Another-Guide-LaTeX2e, +@manual{yet-another-guide-latex2e, title = {The \texttt{Yet-Another-Guide-LaTeX2e} package}, subtitle = {A short guide to using \LaTeX{}2e to typeset high quality documents}, author = {Michael P. Morris}, @@ -76120,7 +76160,7 @@ version = {1.0}, license = {fdl}, url = {https://mirror.ctan.org/info/yet-another-guide-latex2e}, - pkgurl = {https://ctan.org/pkg/Yet-Another-Guide-LaTeX2e}, + pkgurl = {https://ctan.org/pkg/yet-another-guide-latex2e}, } @manual{yfonts-otf, @@ -76492,7 +76532,7 @@ pkgurl = {https://ctan.org/pkg/zhmakeindex}, } -@manual{zhmCJK, +@manual{zhmcjk, title = {The \texttt{zhmCJK} package}, subtitle = {Simplify configuration of CJK installations for Chinese}, author = {Leo Liu}, @@ -76500,7 +76540,7 @@ version = {0.9c}, license = {lppl}, url = {https://mirror.ctan.org/language/chinese/zhmcjk}, - pkgurl = {https://ctan.org/pkg/zhmCJK}, + pkgurl = {https://ctan.org/pkg/zhmcjk}, } @manual{zhmetrics-uptex, @@ -76748,7 +76788,7 @@ pkgurl = {https://ctan.org/pkg/zxjafbfont}, } -@manual{ZXjafont, +@manual{zxjafont, title = {The \texttt{ZXjafont} package}, subtitle = {Set up Japanese font families for \XeLaTeX{}}, author = {Takayuki Yato}, @@ -76756,10 +76796,10 @@ version = {1.3}, license = {mit}, url = {https://mirror.ctan.org/language/japanese/zxjafont}, - pkgurl = {https://ctan.org/pkg/ZXjafont}, + pkgurl = {https://ctan.org/pkg/zxjafont}, } -@manual{ZXjatype, +@manual{zxjatype, title = {The \texttt{ZXjatype} package}, subtitle = {Standard conforming typesetting of Japanese, for \XeLaTeX{}}, author = {Takayuki Yato}, @@ -76767,10 +76807,10 @@ version = {0.7}, license = {mit}, url = {https://mirror.ctan.org/language/japanese/zxjatype}, - pkgurl = {https://ctan.org/pkg/ZXjatype}, + pkgurl = {https://ctan.org/pkg/zxjatype}, } -@manual{ZzTeX, +@manual{zztex, title = {The \texttt{ZzTeX} package}, subtitle = {A full-featured TeX macro package for producing books, journals, and manuals}, author = {Paul C. Anagnostopoulos}, @@ -76778,6 +76818,6 @@ version = {17.7}, license = {mit}, url = {https://mirror.ctan.org/macros/plain/contrib/zztex}, - pkgurl = {https://ctan.org/pkg/ZzTeX}, + pkgurl = {https://ctan.org/pkg/zztex}, } diff --git a/biblio/ctan-bibdata/ctan.pdf b/biblio/ctan-bibdata/ctan.pdf Binary files differindex b103a9f730..0ace0b636b 100644 --- a/biblio/ctan-bibdata/ctan.pdf +++ b/biblio/ctan-bibdata/ctan.pdf diff --git a/fonts/sansmathfonts/README.txt b/fonts/sansmathfonts/README.txt index aa27d12846..9739dc19f8 100644 --- a/fonts/sansmathfonts/README.txt +++ b/fonts/sansmathfonts/README.txt @@ -1,6 +1,6 @@ The sansmathfonts package provides math fonts designed to work with the Computer Modern sans serif typeface, as well as some missing Computer Modern sans serif text fonts. -This version was released 2021/06/22. +This version was released 2022/10/09. This package is released under the LaTeX Project Public License. See https://www.latex-project.org//lppl/ diff --git a/fonts/sansmathfonts/sansmathfonts.pdf b/fonts/sansmathfonts/sansmathfonts.pdf Binary files differindex aac794de4f..6e52c9dbc9 100644 --- a/fonts/sansmathfonts/sansmathfonts.pdf +++ b/fonts/sansmathfonts/sansmathfonts.pdf diff --git a/fonts/sansmathfonts/sansmathfonts.tex b/fonts/sansmathfonts/sansmathfonts.tex index a565329640..08b721de50 100644 --- a/fonts/sansmathfonts/sansmathfonts.tex +++ b/fonts/sansmathfonts/sansmathfonts.tex @@ -1,4 +1,4 @@ -% !TEX TS-program = pdflatex +% !TEX TS-program = LuaLaTeX % sansmathfonts.tex % @@ -6,11 +6,11 @@ % % author: Ariel Barton % -% Copyright Ariel Barton, 2013--2021 +% Copyright Ariel Barton, 2013--2022 % % This work may be distributed and/or modified under the % conditions of the LaTeX Project Public License, either -% version 1.3 of this license or (at your option) any +% version 1.3c of this license or (at your option) any % later version. % The latest version of the license is in % http://www.latex-project.org/lppl.txt @@ -22,13 +22,13 @@ % The complete list of files considered part of this work is in % the file `sansmathfonts.pdf' and its source code `sansmathfonts.tex'. % -% Date: 2021/06/22 +% Date: 2022/10/09 \documentclass{amsart} \raggedbottom -\usepackage[T1]{fontenc} +\usepackage[OT1]{fontenc} \usepackage[I]{sansmathfonts} %\renewcommand{\sfdefault}{xcmss}\let\mathserif\mathrm \usepackage{hyperref, amsfonts, esint, slantsc, bm} @@ -84,7 +84,7 @@ Feedback is appreciated and may be sent to \texttt{origamist@gmail.com}. \section{Package options} \begin{itemize} -\item \texttt{[I]} The \texttt{[I]} package option puts the serifs back on the capital I even in text mode. This option only works with the OT1 and U font encodings. +\item \texttt{[I]} The \texttt{[I]} package option puts the serifs back on the capital I even in text mode. This option only works with the OT1 and U font encodings. It will work under \textsf{pdflatex}'s defaults; in Lua\LaTeX\ or Xe\LaTeX, you will need to change the text encoding by saying \texttt{\string\usepackage[OT1]{fontenc}}. \item \texttt{[onlymath]}, \texttt{[nottext]}. These options provide sans serif math but do not change the text sans serif font. \item \texttt{[onlytext]}, \texttt{[notmath]}. These options provide sans serif text fonts and improve the behavior of \texttt{\char`\\mathsf} but do not change the default math font from roman to sans serif. You can get a similar effect by not using the \textsf{sansmathfonts} package and using the line \texttt{\char`\\renewcommand\char`\{\char`\\sfdefault\char`\}\char `\{xcmss\char`\}} or @@ -517,5 +517,7 @@ April 2019: Fixed a bug in the file \texttt{ucmsmf.fd} that prevented the \textt June 2019: Rewrote the file \texttt{omxcmssex.fd} to allow the math extended characters to be loaded at arbitrary sizes. \item June 2021: Rewrote the OT1, T1, and U font definition files to substitute bold-extended fonts for bold fonts as necessary. Added some package errors and warnings if the document font encoding is not supported. +\item +October 2022: Bug fix to allow compatibility with Lua\LaTeX\ and Xe\LaTeX. \end{itemize} \end{document}
\ No newline at end of file diff --git a/fonts/sansmathfonts/tex/sansmathfonts.sty b/fonts/sansmathfonts/tex/sansmathfonts.sty index 3c2dfd41b8..ef8566c5ad 100644 --- a/fonts/sansmathfonts/tex/sansmathfonts.sty +++ b/fonts/sansmathfonts/tex/sansmathfonts.sty @@ -4,11 +4,11 @@ % % author: Ariel Barton % -% Copyright Ariel Barton, 2013 +% Copyright Ariel Barton, 2013--2022 % % This work may be distributed and/or modified under the % conditions of the LaTeX Project Public License, either -% version 1.3 of this license or (at your option) any +% version 1.3c of this license or (at your option) any % later version. % The latest version of the license is in % http://www.latex-project.org/lppl.txt @@ -21,7 +21,7 @@ % the file `sansmathfonts.pdf' and its source code `sansmathfonts.tex'. % -\ProvidesPackage{sansmathfonts}[2021/06/22] +\ProvidesPackage{sansmathfonts}[2022/10/09] \newif \ifmath@sansmathfonts \math@sansmathfontstrue \newif \iftext@sansmathfonts \text@sansmathfontstrue @@ -43,8 +43,10 @@ \ifx\U@sansmathfonts \f@encoding \else \I@sansmathfontsfalse \PackageWarning{sansmathfonts} - {The [I] package option is only compatible with the OT1 and U - font encodings. I will ignore the [I] package option.} + {The [I] package option is only + compatible with the OT1 and U font encodings. + To use the [I] option, please use the fontenc + package with OT1 encoding: \string\usepackage[OT1]\string{fontenc\string}} \ifx\TOne@sansmathfonts \f@encoding \else \text@sansmathfontsfalse \PackageWarning{sansmathfonts} @@ -54,10 +56,13 @@ \fi\fi \let\sfdefault@sansmathfonts\sfdefault +\def\Usfdefault@sansmathfonts{cmss} \iftext@sansmathfonts \def\sfdefault@sansmathfonts{xcmss} + \def\Usfdefault@sansmathfonts{xcmss} \ifI@sansmathfonts \def\sfdefault@sansmathfonts{cmsmf}% + \def\Usfdefault@sansmathfonts{cmsmf}% \fi \fi @@ -72,7 +77,7 @@ \DeclareFontSubstitution{OML}{cmssm}{m}{it} \DeclareFontSubstitution{OMS}{cmsssy}{m}{n} \DeclareFontSubstitution{OMX}{cmssex}{m}{n} -\DeclareFontSubstitution{U}{\sfdefault@sansmathfonts}{m}{n} +\DeclareFontSubstitution{U}{\Usfdefault@sansmathfonts}{m}{n} \DeclareSymbolFont{operators} {OT1}{cmsmf} {m}{n} \DeclareSymbolFont{letters} {OML}{cmssm} {m}{it} \DeclareSymbolFont{symbols} {OMS}{cmsssy}{m}{n} @@ -96,7 +101,9 @@ \ifI@sansmathfonts \PackageError{sansmathfonts} {The [I] package option is only compatible with - the OT1 and U font encodings.} + the OT1 and U font encodings. To use the [I] option, + please use the fontenc package with OT1 encoding: + \string\usepackage[OT1]\string{fontenc\string}} {Please do not use the [I] option for the sansmathfonts package, or select your font encoding before you load the sansmathfonts package.} diff --git a/graphics/chemobabel/README.md b/graphics/chemobabel/README.md index dc09ba6836..397c15cad3 100644 --- a/graphics/chemobabel/README.md +++ b/graphics/chemobabel/README.md @@ -43,7 +43,7 @@ This work is based on a lot of resources published online: ## Release Date -2022-09-19 +2022-10-09 -------------------- Hironobu YAMASHITA (aka. "Acetaminophen" or "@aminophen") diff --git a/graphics/chemobabel/chemobabel-en.pdf b/graphics/chemobabel/chemobabel-en.pdf Binary files differindex 773b7fc51b..381d065821 100644 --- a/graphics/chemobabel/chemobabel-en.pdf +++ b/graphics/chemobabel/chemobabel-en.pdf diff --git a/graphics/chemobabel/chemobabel-ja.pdf b/graphics/chemobabel/chemobabel-ja.pdf Binary files differindex 3c08f8d315..f1a7cdc368 100644 --- a/graphics/chemobabel/chemobabel-ja.pdf +++ b/graphics/chemobabel/chemobabel-ja.pdf diff --git a/graphics/chemobabel/chemobabel.dtx b/graphics/chemobabel/chemobabel.dtx index ba4bf4df70..2158f591a9 100644 --- a/graphics/chemobabel/chemobabel.dtx +++ b/graphics/chemobabel/chemobabel.dtx @@ -28,20 +28,26 @@ % --- (Japanese jsarticle style => English style) \makeatletter \long\def\@makecaption#1#2{% -\vskip\abovecaptionskip -\sbox\@tempboxa{#1: #2} -\global\@minipagefalse -\hbox to\hsize{\hfil\box\@tempboxa\hfil} -\vskip\belowcaptionskip} + \vskip\abovecaptionskip + \sbox\@tempboxa{#1: #2}% + \global\@minipagefalse + \hbox to\hsize{\hfil\box\@tempboxa\hfil}% + \vskip\belowcaptionskip} \makeatother % --- XyMTeX logo definition \newcount\TestCount -\def\XyM{\ifnum\fam=-1\relax\fam=0\relax\fi\TestCount=\fam% -X\kern-.30em\smash{\raise.50ex\hbox{$\fam\TestCount\Upsilon$}}% -\kern-.30em{M}} +\def\XyM{\ifnum\fam=-1\relax\fam=0\relax\fi\TestCount=\fam + X\kern-.30em\smash{\raise.50ex\hbox{$\fam\TestCount\Upsilon$}}% + \kern-.30em{M}} \def\XyMTeX{\XyM\kern-.1em\TeX} +% --- misc +\def\Lpack#1{\textsf{#1}} +\def\Lcode#1{\texttt{#1}} +\def\Lmeta#1{\textit{#1}} +\def\Lver#1{\Lpack{chemobabel} #1} +\def\TikZ{Ti\textit{k}Z} % ------ -\title{\textsf{chemobabel} \\[1ex] +\title{\Lpack{chemobabel} \\[1ex] \normalsize --- Chemical Structures from MDL Molfiles, ChemDraw Files or SMILES Notations --- \\ %<ja> 化å¦æ§‹é€ å¼ã‚’MOLファイルやChemDrawファイル,SMILES表記法ã‹ã‚‰è‡ªå‹•ç”Ÿæˆ @@ -53,7 +59,7 @@ X\kern-.30em\smash{\raise.50ex\hbox{$\fam\TestCount\Upsilon$}}% \maketitle %<*en> -This document (\jobname.pdf) describes the usage of \textsf{chemobabel.sty}, +This document (\jobname.pdf) describes the usage of \Lpack{chemobabel.sty}, a \LaTeX\ package for \textbf{generating chemical structural formulas} to be inserted in your documents. The formulas can be generated \textbf{from many kinds of chemical data @@ -65,7 +71,7 @@ The formulas below are generated using this method. %</en> %<*ja> ã“ã®æ–‡æ›¸ã§ã¯ï¼Œ\textbf{化å¦æ§‹é€ å¼ã‚’生æˆ}ã—ã¦\LaTeX ã®æ–‡æ›¸ä¸ã«æŒ¿å…¥ã™ã‚‹ãŸã‚ã® -パッケージã§ã‚ã‚‹\textsf{chemobabel.sty}ã¨åŒæ¢±ãƒªã‚½ãƒ¼ã‚¹ã®ä½¿ã„方を説明ã—ã¾ã™ã€‚ +パッケージã§ã‚ã‚‹\Lpack{chemobabel.sty}ã¨åŒæ¢±ãƒªã‚½ãƒ¼ã‚¹ã®ä½¿ã„方を説明ã—ã¾ã™ã€‚ æ§‹é€ å¼ã¯Open Babelã®æ©Ÿèƒ½ã‚’利用ã™ã‚‹ã“ã¨ã«ã‚ˆã‚Šï¼ŒMDL Molfile, ChemDrawファイル, ã•ã‚‰ã«ã¯SMILES表記法をå«ã‚€\textbf{ã•ã¾ã–ã¾ãªåŒ–å¦ãƒ‡ãƒ¼ã‚¿å½¢å¼ã‹ã‚‰ç”Ÿæˆ}ã§ãã¾ã™ã€‚ 以下ã®æ§‹é€ å¼ã¯ã“ã®æ–¹æ³•ã«ã‚ˆã£ã¦å‡ºåŠ›ã•ã‚ŒãŸã‚‚ã®ã§ã™ã€‚ @@ -76,14 +82,14 @@ For English documentation, please refer to chemobabel-en.pdf. \begin{figure}[ht] \centering \chemobabel[width=65mm]{draw/Firefly luciferin.mol}{} \quad - \chemobabel[width=90mm]{draw/Brevetoxin A.mol}{} + \chemobabel*[width=90mm]{draw/Brevetoxin A.mol} \caption{Firefly luciferin \& Brevetoxin A (from MDL Molfiles)} \end{figure} \begin{figure}[ht] \centering \chemobabel[width=90mm]{draw/ATP.cdx}{} \hspace{1cm} - \chemobabel[width=35mm]{draw/Glucose.cdx}{} + \chemobabel*[width=35mm]{draw/Glucose.cdx} \caption{ATP (Adenosine triphosphate) \& Glucose (from ChemDraw files)} \end{figure} \begin{center}\small @@ -94,15 +100,15 @@ becomes wrong.\\ See \url{https://github.com/openbabel/openbabel/issues/338} \begin{figure}[ht] \centering \smilesobabel[width=36mm]{CCO}{} \hspace{1cm} - \smilesobabel[width=40mm]{CC(C(=O)O)N}{} \hspace{1cm} - \smilesobabel[width=30mm]{C1[C@H](C)C[C@@H](O)C1}{} + \smilesobabel*[width=40mm]{CC(C(=O)O)N} \hspace{1cm} + \smilesobabel*[width=30mm]{C1[C@H](C)C[C@@H](O)C1} \caption{Ethanol, Alanine \& (1\textit{S},3\textit{S})-3-Methylcyclopentanol (from SMILES notations)} \end{figure} \begin{figure}[ht] \centering - \smilesobabel[width=30mm]{CC(=O)Nc1ccc(cc1)O}{} \hspace{1cm} - \smilesobabel[width=40mm]{C([C@@H]1[C@H]([C@@H]([C@H]([C@H](O1)O)O)O)O)O}{} + \smilesobabel*[width=30mm]{CC(=O)Nc1ccc(cc1)O} \hspace{1cm} + \smilesobabel*[width=40mm]{C([C@@H]1[C@H]([C@@H]([C@H]([C@H](O1)O)O)O)O)O} \caption{Acetaminophen (Paracetamol) \& $\alpha$-\textsc{d}-Glucose (from SMILES notations)} \end{figure} @@ -158,8 +164,8 @@ Some \TeX/\LaTeX\ macros and packages are already available from \begin{itemize} \item \href{http://www.ctan.org/pkg/xymtex}{\XyMTeX}: a set of packages for drawing chemical structural formulas -\item \href{http://www.ctan.org/pkg/chemfig}{\textsf{chemfig}}: - a package which draws molecules using Ti\textit{k}Z +\item \href{http://www.ctan.org/pkg/chemfig}{\Lpack{chemfig}}: + a package which draws molecules using \TikZ \end{itemize} These packages are reliable and almost all kinds of structural formulas can be drawn in a consistent way. However, a lot of practice will be @@ -170,8 +176,8 @@ required before one can come to make full use of them. \begin{itemize} \item \href{http://www.ctan.org/pkg/xymtex}{\XyMTeX}: 化å¦æ§‹é€ å¼ã‚’æããŸã‚ã®ãƒ‘ッケージ集 - \item \href{http://www.ctan.org/pkg/chemfig}{\textsf{chemfig}}: - Ti\textit{k}Zを利用ã—ã¦æ§‹é€ å¼ã‚’æç”»ã™ã‚‹ãƒ‘ッケージ + \item \href{http://www.ctan.org/pkg/chemfig}{\Lpack{chemfig}}: + \TikZ を利用ã—ã¦æ§‹é€ å¼ã‚’æç”»ã™ã‚‹ãƒ‘ッケージ \end{itemize} ã“れらã®ãƒ‘ッケージã¯ç¢ºå®Ÿã§ï¼Œã‚ã‚‰ã‚†ã‚‹æ§‹é€ å¼ã‚’一貫性をもã£ã¦æç”»ã™ã‚‹ã“ã¨ãŒã§ãã¾ã™ã€‚ ã—ã‹ã—,å分ã«ãã®æ©Ÿèƒ½ã‚’活用ã§ãるよã†ã«ãªã‚‹ã«ã¯ç›¸å½“ã®ç†Ÿç·´ã‚’è¦ã—ã¾ã™ã€‚ @@ -196,7 +202,7 @@ In this case, you have to save files in both chemical formats %</ja> %<*en> -This new package, \textsf{chemobabel.sty}, will offer a new choice for +This new package, \Lpack{chemobabel.sty}, will offer a new choice for chemists who need chemical structures inserted in their \LaTeX\ documents. In this method, we use \href{http://openbabel.org/}{Open Babel} for generating chemical structural formulas in SVG format, @@ -204,7 +210,7 @@ and \href{https://inkscape.org/en/}{Inkscape} for converting SVG to PDF. Both programs are open source and cross-platform, and being actively maintained. %</en> %<*ja> -æ–°ã—ã„パッケージ \textsf{chemobabel.sty} ã¯ï¼Œ\LaTeX 文書ä¸ã«åŒ–å¦æ§‹é€ å¼ã‚’ +æ–°ã—ã„パッケージ \Lpack{chemobabel.sty} ã¯ï¼Œ\LaTeX 文書ä¸ã«åŒ–å¦æ§‹é€ å¼ã‚’ 挿入ã™ã‚‹å¿…è¦ãŒã‚る化å¦è€…ã«æ–°ãŸãªé¸æŠžè‚¢ã‚’æä¾›ã™ã‚‹ã“ã¨ã§ã—ょã†ã€‚ ã“ã®æ–¹æ³•ã§ã¯ï¼Œ\href{http://openbabel.org/}{Open Babel}ã«ã‚ˆã£ã¦ SVGå½¢å¼ã®æ§‹é€ å¼ç”»åƒã‚’生æˆã—, @@ -300,15 +306,15 @@ First, you have to install \href{http://openbabel.org/}{Open Babel} and \href{https://inkscape.org/en/}{Inkscape} (or \href{http://librsvg.sourceforge.net/download/}{librsvg}) on your computer, and export PATH to the command-line binary of both programs, -\verb+obabel+ and \verb+inkscape+ (or \verb+rsvg-convert+). +\Lcode{obabel} and \Lcode{inkscape} (or \Lcode{rsvg-convert}). You can confirm by executing following commands: %</en> %<*ja> åˆã‚ã«ã‚³ãƒ³ãƒ”ュータã«\href{http://openbabel.org/}{Open Babel}㨠\href{https://inkscape.org/ja/}{Inkscape}(ã¾ãŸã¯ \href{http://librsvg.sourceforge.net/download/}{librsvg})をインストールã—, -コマンドライン実行ファイルã§ã‚ã‚‹\verb+obabel+ã¨\verb+inkscape+ -(ã¾ãŸã¯\verb+rsvg-convert+)ã«PATHを通ã—ã¾ã™ã€‚ +コマンドライン実行ファイルã§ã‚ã‚‹ +\Lcode{obabel}ã¨\Lcode{inkscape}(ã¾ãŸã¯\Lcode{rsvg-convert})ã«PATHを通ã—ã¾ã™ã€‚ æ£ã—ãPATHãŒé€šã£ã¦ã„ã‚‹ã‹ã©ã†ã‹ã¯ä»¥ä¸‹ã®ã‚³ãƒžãƒ³ãƒ‰ã«ã‚ˆã£ã¦ç¢ºèªã§ãã¾ã™ï¼š %</ja> %<en>In UNIX operating system: @@ -346,17 +352,17 @@ In the preamble of your document, declare \begin{verbatim} \usepackage{chemobabel} \end{verbatim} -to load \textsf{chemobabel} package. -The package depends on \textsf{graphicx}. +to load \Lpack{chemobabel} package. +The package depends on \Lpack{graphicx}. %</en> %<*ja> プリアンブル㫠\begin{verbatim} \usepackage{chemobabel} \end{verbatim} -ã¨å®£è¨€ã—ã¦\textsf{chemobabel}パッケージをèªã¿è¾¼ã¿ã¾ã™ã€‚ -ã“ã‚Œã¯\textsf{graphicx}パッケージã«ä¾å˜ã—ã¾ã™ã®ã§ï¼Œ -ã‚‚ã—(u)p\LaTeX を使ã£ã¦ã„ã¦DVIドライãƒã«\texttt{dvipdfmx}を使用ã™ã‚‹å ´åˆã¯ +ã¨å®£è¨€ã—ã¦\Lpack{chemobabel}パッケージをèªã¿è¾¼ã¿ã¾ã™ã€‚ +ã“ã‚Œã¯\Lpack{graphicx}パッケージã«ä¾å˜ã—ã¾ã™ã®ã§ï¼Œ +ã‚‚ã—(u)p\LaTeX を使ã£ã¦ã„ã¦DVIドライãƒã«\Lcode{dvipdfmx}を使用ã™ã‚‹å ´åˆã¯ ドライãƒã‚ªãƒ—ション \verb+[dvipdfmx]+ をクラスオプション(グãƒãƒ¼ãƒãƒ«ï¼‰ã« 付ã‘ã‚‹ã®ã‚’忘れãªã„よã†ã«ã—ã¦ãã ã•ã„。 %</ja> @@ -385,7 +391,7 @@ of ATP (Adenosine triphosphate) drawn in ChemDraw, and \href{http://www.chemspider.com/}{ChemSpider} (originally \verb|9041092.mol|). Use \verb|\chemobabel| command as follows. I put original files in a -subdirectory \texttt{draw}, so added \texttt{draw/} before the actual filename. +subdirectory \Lcode{draw}, so added \Lcode{draw/} before the actual filename. Of course you can put in the same directory with your \LaTeX\ file. %</en> %<*ja> @@ -395,14 +401,14 @@ ChemDrawã§æç”»ã—ãŸãƒ•ã‚¡ã‚¤ãƒ«ï¼Œ\verb|Brevetoxin A.mol| 㯠(もã¨ã®ãƒ•ã‚¡ã‚¤ãƒ«å㯠\verb|9041092.mol| ã¨ãªã£ã¦ã„ã¾ã™ï¼‰ã€‚ \verb|\chemobabel| コマンドã¯æœ¬æ–‡ä¸ã§ä»¥ä¸‹ã®ã‚ˆã†ã«ã—ã¦ä½¿ã„ã¾ã™ã€‚ -ã“ã“ã§ã¯å…ƒã®ãƒ•ã‚¡ã‚¤ãƒ«ã‚’\texttt{draw}ã¨ã„ã†ã‚µãƒ–ディレクトリã«ç½®ã„ãŸã®ã§ï¼Œ -ファイルåã®å‰ã« \texttt{draw/} を付ã‘ã¾ã—ãŸã€‚ +ã“ã“ã§ã¯å…ƒã®ãƒ•ã‚¡ã‚¤ãƒ«ã‚’\Lcode{draw}ã¨ã„ã†ã‚µãƒ–ディレクトリã«ç½®ã„ãŸã®ã§ï¼Œ +ファイルåã®å‰ã« \Lcode{draw/} を付ã‘ã¾ã—ãŸã€‚ ã‚‚ã¡ã‚ã‚“ \LaTeX ソースã¨åŒä¸€ãƒ‡ã‚£ãƒ¬ã‚¯ãƒˆãƒªã«ç½®ãã“ã¨ã‚‚ã§ãã¾ã™ã€‚ %</ja> \begin{verbatim} \chemobabel[width=90mm]{draw/ATP.cdx}{} -\chemobabel[width=120mm]{draw/Brevetoxin A.mol}{} +\chemobabel*[width=120mm]{draw/Brevetoxin A.mol} \end{verbatim} %<*en> @@ -434,34 +440,44 @@ $ dvipdfmx test.dvi \begin{figure}[h] \centering \chemobabel[width=90mm]{draw/ATP.cdx}{} \\ \vspace{1cm} - \chemobabel[width=120mm]{draw/Brevetoxin A.mol}{} + \chemobabel*[width=120mm]{draw/Brevetoxin A.mol} \caption{Conversion from ATP.cdx and Brevetoxin A.mol}\label{fig:chem1} \end{figure} %<en>The syntax is: %<ja>構文ã¯ä»¥ä¸‹ã®ã¨ãŠã‚Šã§ã™ã€‚ \begin{center} -\verb|\chemobabel[|\textit{options}\verb|]{|\textit{filename}\verb|}{|\textit{obabel options}\verb|}| +\verb|\chemobabel[|\Lmeta{options}\verb|]{|\Lmeta{filename}\verb|}{|\Lmeta{obabel options}\verb|}| \\ +\verb|\chemobabel*[|\Lmeta{options}\verb|]{|\Lmeta{filename}\verb|}| \end{center} %<*en> -As parameters, \textit{filename} should be placed in the first braces, and -\textit{obabel options} (see Section \ref{depict} for some examples) -can be added in the second braces. -You can leave the second parameter empty. - -You can give \textit{options} to be passed to \verb|\includegraphics| -command as optional parameters in the box brackets. -This option is not necessary, so can be omitted. In this case the default -option ``scale=1" is passed to \verb|\includegraphics| command. +\verb|\chemobabel| takes one optional parameter and two mandatory parameters. +\begin{itemize} + \item The optional parameter \Lmeta{options} in the box brackets + is passed to \verb|\includegraphics|. + If omitted, the default ``scale=1' is assumed. + \item The first mandatory parameter \Lmeta{filename} is the file name + which contains chemical structural formula. + \item The second mandatory parameter \Lmeta{obabel options} + is passed to \verb|obabel| command + (see Section \ref{depict} for some examples). +\end{itemize} +If you want to leave the second parameter empty, +a shorthand form \verb|\chemobabel*| is also available +(since \Lver{v0.9k [2022/10/09]}). %</en> %<*ja> -引数ã¨ã—ã¦ï¼Œä¸æ‹¬å¼§ã®1ã¤ã‚ã«ãƒ•ã‚¡ã‚¤ãƒ«åを与ãˆï¼Œ2ã¤ã‚ã«obabelã«é€ã‚‹ -オプション(例ã¯ç¬¬\ref{depict}節をå‚照)を指定ã—ã¦ãã ã•ã„。 -2ã¤ã‚ã®å¼•æ•°ã¯ç©ºã«ã™ã‚‹ã“ã¨ã‚‚ã§ãã¾ã™ã€‚ - -ã¾ãŸï¼Œã‚ªãƒ—ションã¨ã—ã¦è§’括弧㫠\verb|\includegraphics| ã«æ¸¡ã™ã‚ªãƒ—ションを -指定ã™ã‚‹ã“ã¨ãŒã§ãã¾ã™ã€‚ -ã“ã®ã‚ªãƒ—ションã¯çœç•¥å¯èƒ½ã§ï¼Œä½•ã‚‚指定ã—ãªã„å ´åˆã¯ scale=1 ãŒé©ç”¨ã•ã‚Œã¾ã™ã€‚ +\verb|\chemobabel| ã¯1ã¤ã®ã‚ªãƒ—ション引数ã¨2ã¤ã®å¿…é ˆå¼•æ•°ã‚’ã¨ã‚Šã¾ã™ã€‚ +\begin{itemize} + \item 角括弧内ã®ã‚ªãƒ—ション引数㯠\verb|\includegraphics| ã«æ¸¡ã•ã‚Œã¾ã™ã€‚ + çœç•¥ã•ã‚ŒãŸå ´åˆã¯ \verb|scale=1| ã¨ã¿ãªã•ã‚Œã¾ã™ã€‚ + \item å¿…é ˆå¼•æ•°ã®1ã¤ã‚ã«ã¯åŒ–å¦æ§‹é€ å¼ãŒæã‹ã‚ŒãŸãƒ•ã‚¡ã‚¤ãƒ«åを与ãˆã¾ã™ã€‚ + \item å¿…é ˆå¼•æ•°ã®2ã¤ã‚ã«ã¯ \verb|obabel| ã«é€ã‚‹ã‚ªãƒ—ション + (例ã¯ç¬¬\ref{depict}節をå‚照)を指定ã—ã¾ã™ã€‚ +\end{itemize} +å¿…é ˆå¼•æ•°ã®2ã¤ã‚を空ã«ã—ãŸã„å ´åˆã¯ï¼Œ +çŸç¸®å½¢ã¨ã—㦠\verb|\chemobabel*| を使用ã™ã‚‹ã“ã¨ã‚‚ã§ãã¾ã™ +(\Lver{v0.9k [2022/10/09]}以é™ï¼‰ã€‚ %</ja> %<*en> @@ -488,7 +504,7 @@ Use \verb|\smilesobabel| command as follows: \begin{verbatim} \smilesobabel{CCO}{} -\smilesobabel[width=35mm]{CC(=O)Nc1ccc(cc1)O}{} +\smilesobabel*[width=25mm]{CC(=O)Nc1ccc(cc1)O} \end{verbatim} %<*en> @@ -511,18 +527,19 @@ $ dvipdfmx test.dvi \begin{figure}[h] \centering \smilesobabel{CCO}{} \quad - \smilesobabel[width=25mm]{CC(=O)Nc1ccc(cc1)O}{} + \smilesobabel*[width=25mm]{CC(=O)Nc1ccc(cc1)O} \caption{Conversion from SMILES notation}\label{fig:smi1} \end{figure} %<en>The syntax is: %<ja>構文ã¯ä»¥ä¸‹ã®ã¨ãŠã‚Šã§ã™ã€‚ \begin{center} -\verb|\smilesobabel[|\textit{options}\verb|]{|\textit{SMILES notation}\verb|}{|\textit{obabel options}\verb|}| +\verb|\smilesobabel[|\Lmeta{options}\verb|]{|\Lmeta{SMILES notation}\verb|}{|\Lmeta{obabel options}\verb|}| \\ +\verb|\smilesobabel*[|\Lmeta{options}\verb|]{|\Lmeta{SMILES notation}\verb|}| \end{center} %<*en> The only difference from \verb|\chemobabel| is that -\textit{SMILES notation} should be placed in the first braces. +\Lmeta{SMILES notation} should be placed in the first braces. You can put any kinds of SMILES notations in parameters of \verb|\smilesobabel|, even when they contain some special characters such as a backslash (\verb|\|) and a percent symbol (\verb|%|). @@ -539,26 +556,25 @@ these special characters. 特別ãªæ–‡å—ã‚’å«ã‚€ã“ã¨ãŒã§ãã‚‹è¨è¨ˆã«ãªã£ã¦ã„ã¾ã™ã€‚ %</ja> \begin{verbatim} -\smilesobabel[width=28mm]{Cl/C=C/Br}{} -\smilesobabel[width=28mm]{Cl/C=C\Br}{} +\smilesobabel*[width=28mm]{Cl/C=C/Br} +\smilesobabel*[width=28mm]{Cl/C=C\Br} \end{verbatim} \begin{figure}[h] \centering - \smilesobabel[width=28mm]{Cl/C=C/Br}{} \quad - \smilesobabel[width=28mm]{Cl/C=C\Br}{} + \smilesobabel*[width=28mm]{Cl/C=C/Br} \quad + \smilesobabel*[width=28mm]{Cl/C=C\Br} \end{figure} %<*en> -\noindent \textbf{Notes for users of earlier versions} ($\le$ \textsf{chemobabel} v0.6 [2015/06/29]) +\noindent \textbf{Notes for users of earlier versions \Lver{v0.6 [2015/06/29]} or older} -In earlier versions of \textsf{chemobabel}, it was necessary for users +In earlier versions of \Lpack{chemobabel}, it was necessary for users to pay another attention when using these \LaTeX\ special characters. However, the workaround I had suggested before was far from desirable because ``casual \LaTeX\ users'' were forced to change category codes of these characters manually. -To solve this problem, I prepared supporting macros inside the package -itself ($\ge$ \textsf{chemobabel} v0.7 [2015/08/26]). +To solve this problem, I improved the internal macros since \Lver{v0.7 [2015/08/26]}. Now you can put any kinds of SMILES notations directly without worrying about special characters (\verb|\|, \verb|%|, etc). Note that the undesirable workaround (like changing \verb|\catcode| inside @@ -566,15 +582,15 @@ Note that the undesirable workaround (like changing \verb|\catcode| inside %</en> %<*ja> -\noindent \textbf{æ—§ãƒãƒ¼ã‚¸ãƒ§ãƒ³ã®ãƒ¦ãƒ¼ã‚¶ã«å¯¾ã™ã‚‹æ³¨æ„} ($\le$ \textsf{chemobabel} v0.6 [2015/06/29]) +\noindent \textbf{\Lver{v0.6 [2015/06/29]}以å‰ã®æ—§ãƒãƒ¼ã‚¸ãƒ§ãƒ³ã®ãƒ¦ãƒ¼ã‚¶ã«å¯¾ã™ã‚‹æ³¨æ„} -å¤ã„ãƒãƒ¼ã‚¸ãƒ§ãƒ³ã®\textsf{chemobabel}ã§ã¯ï¼Œ +å¤ã„ãƒãƒ¼ã‚¸ãƒ§ãƒ³ã®\Lpack{chemobabel}ã§ã¯ï¼Œ ã“れらã®\LaTeX ã§ç‰¹åˆ¥ãªæ„味をæŒã¤æ–‡å—ã«æ³¨æ„を払ã†å¿…è¦ãŒã‚ã‚Šã¾ã—ãŸã€‚ 従æ¥ç§ãŒç´¹ä»‹ã—ã¦ããŸå›žé¿ç–ã¯â€œã‚«ã‚¸ãƒ¥ã‚¢ãƒ«ãª \LaTeX ユーザâ€ã« カテゴリーコードを手動ã§å¤‰æ›´ã•ã›ã¦ã„ãŸãŸã‚,好ã¾ã—ã„ã‚‚ã®ã§ã¯ã‚ã‚Šã¾ã›ã‚“ã§ã—ãŸã€‚ -ã“ã®å•é¡Œã‚’解決ã™ã‚‹ãŸã‚,パッケージ本体ã®å´ã§ã“れらã®æ–‡å—をサãƒãƒ¼ãƒˆã™ã‚‹ -マクãƒã‚’組ã¿è¾¼ã¿ã¾ã—ãŸï¼ˆ\textsf{chemobabel} v0.7 [2015/08/26] 以é™ï¼‰ã€‚ +ã“ã®å•é¡Œã‚’解決ã™ã‚‹ãŸã‚,\Lver{v0.7 [2015/08/26]}以é™ã§ã¯ +パッケージ本体ã®å´ã§ã“れらã®æ–‡å—をサãƒãƒ¼ãƒˆã™ã‚‹ã‚ˆã†ã«æ”¹è‰¯ã‚’æ–½ã—ã¾ã—ãŸã€‚ ã“ã‚Œã«ã‚ˆã‚Šï¼Œ\verb|\| ã‚„ \verb|%| ã¨ã„ã£ãŸç‰¹åˆ¥ãªæ–‡å—を心é…ã™ã‚‹ã“ã¨ãªã, ä»»æ„ã®SMILES表記を直接引数ã«æ¸¡ã™ã“ã¨ãŒã§ãるよã†ã«ãªã£ã¦ã„ã¾ã™ã€‚ 従æ¥ã®å›žé¿ç–(\verb|\begingroup| ... \verb|\endgroup| 内㧠\verb|\catcode| ã‚’ @@ -591,16 +607,16 @@ Note that the undesirable workaround (like changing \verb|\catcode| inside %</ja> %<*en> -By default, \textsf{chemobabel} converts chemical structures into +By default, \Lpack{chemobabel} converts chemical structures into PDF images using Inkscape. However, you can switch the image format and the conversion program if you like. When you are using drivers which do not support PDF figures (such as dvips), -it will be helpful if \textsf{chemobabel} converts them into EPS images. +it will be helpful if \Lpack{chemobabel} converts them into EPS images. For this purpose, you can use: %</en> %<*ja> -\textsf{chemobabel} パッケージã¯ï¼Œãƒ‡ãƒ•ã‚©ãƒ«ãƒˆã§ã¯åŒ–å¦æ§‹é€ å¼ã‚’Inkscapeã«ã‚ˆã£ã¦ +\Lpack{chemobabel} パッケージã¯ï¼Œãƒ‡ãƒ•ã‚©ãƒ«ãƒˆã§ã¯åŒ–å¦æ§‹é€ å¼ã‚’Inkscapeã«ã‚ˆã£ã¦ PDFå½¢å¼ã®ç”»åƒãƒ•ã‚¡ã‚¤ãƒ«ã«å¤‰æ›ã—ã¦æ–‡æ›¸ä¸ã«å–ã‚Šè¾¼ã¿ã¾ã™ã€‚ ã—ã‹ã—,オプションã§ç”»åƒå½¢å¼ã¨å¤‰æ›ãƒ—ãƒã‚°ãƒ©ãƒ を変更ã™ã‚‹ã“ã¨ãŒã§ãã¾ã™ã€‚ @@ -612,19 +628,19 @@ dvipsãªã©ã®PDFéžå¯¾å¿œã®ãƒ‰ãƒ©ã‚¤ãƒã‚’使用ã™ã‚‹å ´åˆã¯ï¼ŒEPSå½¢å¼ã® \end{verbatim} %<*en> The option \verb|eps| switches the image format (that is, output format -from Inkscape) into EPS ($\ge$ \textsf{chemobabel} v0.9d [2016/02/28]). +from Inkscape) into EPS (since \Lver{v0.9d [2016/02/28]}). You can also change the image conversion program from ``Inkscape'' to -``rsvg-convert'' ($\ge$ \textsf{chemobabel} v0.9e [2016/03/07]). +``rsvg-convert'' (since \Lver{v0.9e [2016/03/07]}). The program rsvg-convert is faster than inkscape, so it will be useful. For this purpose, use \verb|librsvg| option: %</en> %<*ja> ã¨ã„ã†ã‚ˆã†ã« \verb|eps| オプションを指定ã™ã‚Œã°ï¼Œå†…部ã§Inkscapeã‹ã‚‰å‡ºåŠ›ã•ã‚Œã‚‹ -ç”»åƒå½¢å¼ã‚’PDFã§ã¯ãªãEPSã«å¤‰æ›´ã—ã¾ã™ï¼ˆ\textsf{chemobabel} v0.9d [2016/02/28] 以é™ï¼‰ã€‚ +ç”»åƒå½¢å¼ã‚’PDFã§ã¯ãªãEPSã«å¤‰æ›´ã—ã¾ã™ï¼ˆ\Lver{v0.9d [2016/02/28]}以é™ï¼‰ã€‚ ã¾ãŸï¼Œç”»åƒå¤‰æ›ãƒ—ãƒã‚°ãƒ©ãƒ ã‚’ Inkscape ã‹ã‚‰ rsvg-convert ã«å¤‰æ›´ã™ã‚‹ã“ã¨ã‚‚ã§ãã¾ã™ -(\textsf{chemobabel} v0.9e [2016/03/07] 以é™ï¼‰ã€‚ +(\Lver{v0.9e [2016/03/07]}以é™ï¼‰ã€‚ rsvg-convertã¯Inkscapeより高速ã§ã™ã‹ã‚‰ï¼Œä¾¿åˆ©ã‹ã‚‚ã—ã‚Œã¾ã›ã‚“。 ã“ã®å ´åˆã¯ï¼Œä»¥ä¸‹ã®ã‚ˆã†ã« \verb|librsvg| オプションを指定ã—ã¾ã™ã€‚ %</ja> @@ -646,13 +662,13 @@ The default behavior is equivalent to the \verb|pdf| and \verb|inkscape| options Moreover, Open Babel v2.4.0 or later versions generate images with a rather large margin. To avoid this, the images are cropped using \verb|pdfcrop| for PDF or \verb|ps2eps| for EPS -($\ge$ \textsf{chemobabel} v0.9i [2022/09/12]). +(since \Lver{v0.9i [2022/09/12]}). If you want to disable this cropping, please add \verb|nocrop| option: %</en> %<*ja> ã•ã‚‰ã«ï¼ŒOpen Babel v2.4.0以é™ã§ç”Ÿæˆã•ã‚Œã‚‹ç”»åƒã¯ãƒ‡ãƒ•ã‚©ãƒ«ãƒˆã§ä½™ç™½ãŒå¤§ãã„ãŸã‚, \verb|pdfcrop|(PDFã®å ´åˆï¼‰ã‚ã‚‹ã„ã¯\verb|ps2eps|(EPSã®å ´åˆï¼‰ã§ -クãƒãƒƒãƒ—ã—ã¦ã„ã¾ã™ï¼ˆ\textsf{chemobabel} v0.9i [2022/09/12] 以é™ï¼‰ã€‚ +クãƒãƒƒãƒ—ã—ã¦ã„ã¾ã™ï¼ˆ\Lver{v0.9i [2022/09/12]}以é™ï¼‰ã€‚ ã“れをやã‚ãŸã„å ´åˆã¯ \verb|nocrop| オプションを指定ã—ã¦ãã ã•ã„。 %</ja> \begin{verbatim} @@ -704,7 +720,7 @@ When typesetting, usual command $ pdflatex test.tex \end{verbatim} can be used. -With \verb|extract| option, all \textsf{chemobabel} does is extracting +With \verb|extract| option, all \Lpack{chemobabel} does is extracting all \verb|\chemobabel| and \verb|\smilesobabel| commands from the original \LaTeX\ file. You will get ``ChemFigFile.tex'' in the same directory, a minimal @@ -718,7 +734,7 @@ You can simply typeset it by $ platex test.tex \end{verbatim} ã¨ã„ã†ã‚³ãƒžãƒ³ãƒ‰ã‚’使ã„ã¾ã™ã€‚ -\verb|extract| オプションを付ã‘ã‚‹ã¨ï¼Œ\textsf{chemobabel}パッケージ㯠+\verb|extract| オプションを付ã‘ã‚‹ã¨ï¼Œ\Lpack{chemobabel}パッケージ㯠å˜ã«å…ƒã®\LaTeX ソースã‹ã‚‰ \verb|\chemobabel| 㨠\verb|\smilesobabel| コマンド ã ã‘を抽出ã™ã‚‹ã¯ãŸã‚‰ãã‚’ã—ã¾ã™ã€‚ ãã®çµæžœï¼ŒåŒã˜ãƒ‡ã‚£ãƒ¬ã‚¯ãƒˆãƒªã«ã€ŒChemFigFile.texã€ã¨ã„ã†ãƒ•ã‚¡ã‚¤ãƒ«ãŒç”Ÿæˆã—ã¾ã™ã€‚ @@ -730,9 +746,9 @@ $ pdflatex -shell-escape ChemFigFile.tex \end{verbatim} %<*ja> 欧文ã¨åŒã˜ä»•æ§˜ã«çµ±ä¸€ã—ãŸãŸã‚,抽出ã•ã‚Œã‚‹ã€ŒChemFigFile.texã€ã§ã¯ -\textsf{graphicx}パッケージ㫠\texttt{[dvipdfmx]} オプション +\Lpack{graphicx}パッケージ㫠\verb+[dvipdfmx]+ オプション を与ãˆãšã«èªã¿è¾¼ã‚“ã§ã„ã¾ã™ã€‚ã—ãŸãŒã£ã¦ï¼Œ -ã“ã®ã‚¿ã‚¤ãƒ—セットã ã‘ã¯\texttt{pdflatex}を用ã„ã¦ãã ã•ã„。 +ã“ã®ã‚¿ã‚¤ãƒ—セットã ã‘ã¯\Lcode{pdflatex}を用ã„ã¦ãã ã•ã„。 %</ja> %<*en> and you will get PDF figures in the same way @@ -776,12 +792,12 @@ $ dvipdfmx test.dvi %<*en> As I have already mentioned, in both \verb|\chemobabel| and \verb|\smilesobabel|, -you can give some \textit{obabel options} in the second braces. +you can give some \Lmeta{obabel options} in the second braces. Here I will introduce some examples. %</en> %<*ja> æ—¢ã«è¿°ã¹ãŸã¨ãŠã‚Šï¼Œ\verb|\chemobabel| 㨠\verb|\smilesobabel| ã®ä¸¡æ–¹ã«ã¤ã„ã¦ï¼Œ -2ã¤ã‚ã®ä¸æ‹¬å¼§ã« \textit{obabel options} を与ãˆã‚‹ã“ã¨ãŒã§ãã¾ã™ã€‚ +2ã¤ã‚ã®ä¸æ‹¬å¼§ã« \Lmeta{obabel options} を与ãˆã‚‹ã“ã¨ãŒã§ãã¾ã™ã€‚ ã“ã“ã§ï¼Œã„ãã¤ã‹ã®æœ‰ç”¨ãªä¾‹ã‚’挙ã’ã¦ãŠãã¾ã™ã€‚ %</ja> \begin{itemize} @@ -807,8 +823,8 @@ $ obabel -:"CC(=O)Nc1ccc(cc1)O" -O smilesobabelimg[NUM].svg -xu -xC \begin{verbatim} \chemobabel{ATP.cdx}{-xd} \end{verbatim} -%<en>You can add \texttt{-xd} option to remove filenames from ChemDraw figures with Open Babel 2.x. -%<ja>Open Babel 2.x系列ã§ChemDrawã®å›³ã‹ã‚‰ãƒ•ã‚¡ã‚¤ãƒ«åã‚’å–り除ãã«ã¯ï¼Œ\texttt{-xd} オプションを付ã‘ã¾ã™ï¼š +%<en>You can add \Lcode{-xd} option to remove filenames from ChemDraw figures with Open Babel 2.x. +%<ja>Open Babel 2.x系列ã§ChemDrawã®å›³ã‹ã‚‰ãƒ•ã‚¡ã‚¤ãƒ«åã‚’å–り除ãã«ã¯ï¼Œ\Lcode{-xd} オプションを付ã‘ã¾ã™ï¼š \begin{verbatim} $ obabel -:"ATP.cdx" -O chemobabelimg[NUM].svg -xd \end{verbatim} @@ -819,7 +835,7 @@ $ obabel -:"ATP.cdx" -O chemobabelimg[NUM].svg -xd \smilesobabel[width=21mm]{CC(=O)Nc1ccc(cc1)O}{} \hspace{1cm} \smilesobabel[width=25mm]{CC(=O)Nc1ccc(cc1)O}{-xa} \hspace{1cm} \smilesobabel[width=21mm]{CC(=O)Nc1ccc(cc1)O}{-xu} - \caption{Acetaminophen (Paracetamol): Nothing, \texttt{-xa}, \texttt{-xu}} + \caption{Acetaminophen (Paracetamol): Nothing, \Lcode{-xa}, \Lcode{-xu}} SMILES: \verb|CC(=O)Nc1ccc(cc1)O| \end{figure} @@ -828,7 +844,7 @@ $ obabel -:"ATP.cdx" -O chemobabelimg[NUM].svg -xd \smilesobabel[width=25mm]{C1[C@H](C)C[C@@H](O)C1}{} \hspace{1cm} \smilesobabel[width=25mm]{C1[C@H](C)C[C@@H](O)C1}{-xC} \hspace{1cm} \smilesobabel[width=25mm]{C1[C@H](C)C[C@@H](O)C1}{-xt} - \caption{(1\textit{S},3\textit{S})-3-Methylcyclopentanol: Nothing, \texttt{-xC}, \texttt{-xt}} + \caption{(1\textit{S},3\textit{S})-3-Methylcyclopentanol: Nothing, \Lcode{-xC}, \Lcode{-xt}} SMILES: \verb|C1[C@H](C)C[C@@H](O)C1| \end{figure} @@ -837,7 +853,7 @@ $ obabel -:"ATP.cdx" -O chemobabelimg[NUM].svg -xd \smilesobabel[width=42mm]{CCc1cccc(c1)C(=O)Cl}{} \hspace{1cm} \smilesobabel[width=42mm]{CCc1cccc(c1)C(=O)Cl}{-xa -xu} \hspace{1cm} \smilesobabel[width=42mm]{CCc1cccc(c1)C(=O)Cl}{-xu -xC} - \caption{3-Ethylbenzoyl chloride: Nothing, \texttt{-xa -xu}, \texttt{-xu -xC}} + \caption{3-Ethylbenzoyl chloride: Nothing, \Lcode{-xa -xu}, \Lcode{-xu -xC}} SMILES: \verb|CCc1cccc(c1)C(=O)Cl| \end{figure} @@ -845,7 +861,7 @@ $ obabel -:"ATP.cdx" -O chemobabelimg[NUM].svg -xd \centering \smilesobabel[width=42mm]{CCc1cccc(c1)C(=O)Cl}{--highlight "cC=O blue"} \hspace{1cm} \smilesobabel[width=42mm]{CCc1cccc(c1)C(=O)Cl}{-xA --genalias} - \caption{3-Ethylbenzoyl chloride: \texttt{--highlight "cC=O blue"}, \texttt{-xA --genalias}} + \caption{3-Ethylbenzoyl chloride: \Lcode{--highlight "cC=O blue"}, \Lcode{-xA --genalias}} SMILES: \verb|CCc1cccc(c1)C(=O)Cl| \end{figure} @@ -853,14 +869,14 @@ $ obabel -:"ATP.cdx" -O chemobabelimg[NUM].svg -xd \centering \chemobabel[width=65mm]{draw/Firefly luciferin.mol}{} \hspace{1cm} \chemobabel[width=65mm]{draw/Firefly luciferin.mol}{-xa} - \caption{Firefly luciferin (from MDL Molfiles): Nothing, \texttt{-xa}} + \caption{Firefly luciferin (from MDL Molfiles): Nothing, \Lcode{-xa}} \end{figure} \begin{figure}[ht] \centering \chemobabel[width=70mm]{draw/ATP.cdx}{} \hspace{1cm} \chemobabel[width=70mm]{draw/ATP.cdx}{-xd} - \caption{ATP (from ChemDraw files): Nothing, \texttt{-xd}} + \caption{ATP (from ChemDraw files): Nothing, \Lcode{-xd}} \end{figure} \begin{figure}[ht] @@ -897,14 +913,14 @@ Open Babelã¯SMILES表記ã‹ã‚‰è¤‡é›‘ãªæ§‹é€ å¼ã‚’生æˆã™ã‚‹ã“ã¨ãŒã§ãã \begin{figure}[ht] \centering - \smilesobabel[width=55mm]{CN1CC[C@]23c4c5ccc(c4O[C@H]2[C@H](C=C[C@H]3[C@H]1C5)O)O}{} + \smilesobabel*[width=55mm]{CN1CC[C@]23c4c5ccc(c4O[C@H]2[C@H](C=C[C@H]3[C@H]1C5)O)O} \caption{($-$)-Morphine} SMILES: \verb|CN1CC[C@]23c4c5ccc(c4O[C@H]2[C@H](C=C[C@H]3[C@H]1C5)O)O| \end{figure} \begin{figure}[ht] \centering - \smilesobabel[width=150mm]{C[C@@H]1C[C@H]2[C@@H](CC(=O)O2)O[C@H]3C[C@@H]4[C@H](C[C@@H]([C@@H]5[C@@H](O4)C/C=C\C[C@@H]6[C@@H](O5)C/C=C\[C@@H]7[C@@H](O6)CCC[C@@H]8[C@@](O7)(C[C@@H]9[C@@H](O8)C[C@@H]2[C@@H](O9)[C@H](C[C@H](O2)CC(=C)C=O)O)C)C)O[C@@]3(C1)C}{} + \smilesobabel*[width=150mm]{C[C@@H]1C[C@H]2[C@@H](CC(=O)O2)O[C@H]3C[C@@H]4[C@H](C[C@@H]([C@@H]5[C@@H](O4)C/C=C\C[C@@H]6[C@@H](O5)C/C=C\[C@@H]7[C@@H](O6)CCC[C@@H]8[C@@](O7)(C[C@@H]9[C@@H](O8)C[C@@H]2[C@@H](O9)[C@H](C[C@H](O2)CC(=C)C=O)O)C)C)O[C@@]3(C1)C} \caption{Brevetoxin A} SMILES (Sorry but too long): \verb|C[C@@H]1C[C@H]2[C@@H](CC(=O)O2)O[C@H]3C[C@@H]4[C@H](C[C@@H]([C@@H]5[C@@H](O4)C/C=C\C[C@@H]6[C@@H](O5)C/C=C\[C@@H]7[C@@H](O6)CCC[C@@H]8[C@@](O7)(C[C@@H]9[C@@H](O8)C[C@@H]2[C@@H](O9)[C@H](C[C@H](O2)CC(=C)C=O)O)C)C)O[C@@]3(C1)C| \end{figure} @@ -939,10 +955,10 @@ Sesamin: \verb|c1cc2c(cc1C3C4COC(C4CO3)c5ccc6c(c5)OCO6)OCO2| \centering \includegraphics[scale=0.5]{figures/Mac231-sesamin-normal.pdf} \includegraphics[scale=0.5]{figures/Mac231-sesamin-gen2d.pdf} - \caption{Sesamin (figures from Open Babel for Mac 2.3.1; Normal and \texttt{--gen2d})} + \caption{Sesamin (figures from Open Babel for Mac 2.3.1; Normal and \Lcode{--gen2d})} \includegraphics[scale=0.5]{figures/Win232-sesamin-normal.pdf} \includegraphics[scale=0.5]{figures/Win232-sesamin-gen2d.pdf} - \caption{Sesamin (figures from Open Babel for Win 2.3.2; Normal and \texttt{--gen2d})} + \caption{Sesamin (figures from Open Babel for Win 2.3.2; Normal and \Lcode{--gen2d})} \end{center} \end{figure} @@ -963,7 +979,7 @@ Here we can see the formula generated from a SMILES notation lacks one double bo \caption{Firefly luciferin: exact structure from ChemSpider ID 4588411} \includegraphics[scale=0.6]{figures/Win232-FireflyLuciferin.pdf} \caption{Firefly luciferin?: output from Open Babel for Win 2.3.2} - \smilesobabel[width=66mm]{C1[C@@H](N/C(=c\2/nc3c(=CC(=O)C=C3)s2)/S1)C(=O)O}{} + \smilesobabel*[width=66mm]{C1[C@@H](N/C(=c\2/nc3c(=CC(=O)C=C3)s2)/S1)C(=O)O} \caption{Firefly luciferin?: output from current Open Babel} SMILES: \verb|C1[C@@H](N/C(=c\2/nc3c(=CC(=O)C=C3)s2)/S1)C(=O)O| \end{figure} @@ -991,24 +1007,24 @@ only one character string is very interesting, isn't it? %</ja> %<*en> -\subsection{Advantages of \textsf{chemobabel}} +\subsection{Advantages of \Lpack{chemobabel}} %</en> %<*ja> -\subsection{\textsf{chemobabel}パッケージã®æœ‰åˆ©ãªç‚¹} +\subsection{\Lpack{chemobabel}パッケージã®æœ‰åˆ©ãªç‚¹} %</ja> %<*en> The macros \verb|\smiles| (written by Noel O'Boyle \cite{NOB1}) and -\verb|\obabel| (depends on \textsf{graphvizObabel.sty} by +\verb|\obabel| (depends on \Lpack{graphvizObabel.sty} by Jakob Lykke Andersen's \cite{JLA}) can be used as follows: %</en> %<*ja> Noel O'Boyleã•ã‚“ã«ã‚ˆã‚‹ \verb|\smiles| \cite{NOB1} ã‚ã‚‹ã„㯠-Jakob Lykke Andersenã•ã‚“ã«ã‚ˆã‚‹\textsf{graphvizObabel.sty}㌠+Jakob Lykke Andersenã•ã‚“ã«ã‚ˆã‚‹\Lpack{graphvizObabel.sty}㌠æä¾›ã™ã‚‹ \verb+\obabel+ \cite{JLA} ã¯ä»¥ä¸‹ã®ã‚ˆã†ã«ã—ã¦ä½¿ã†ã“ã¨ã«ãªã£ã¦ã„ã¾ã™ï¼š %</ja> \begin{verbatim} -% ----- for \smiles command ----- +%% ----- for \smiles command ----- \newcounter{smilescounter} \setcounter{smilescounter}{1} \newcommand{\smiles}[1]{ @@ -1016,11 +1032,16 @@ Jakob Lykke Andersenã•ã‚“ã«ã‚ˆã‚‹\textsf{graphvizObabel.sty}㌠\includegraphics{smilesimg\arabic{smilescounter}.png} \addtocounter{smilescounter}{1} } -% ----- for \obabel command ----- -\usepackage{graphvizObabel} -% ============ usage ============ + ... \smiles{CCO} +%% ----- +\end{verbatim} +\begin{verbatim} +%% ----- for \obabel command ----- +\usepackage{graphvizObabel} + ... \obabel[scale=0.6]{CCO} +%% ----- \end{verbatim} %<*en> However, \verb|\smiles| command creates raster graphics (.png) and @@ -1055,7 +1076,7 @@ Also, computer-generated formulas may sometimes be unnatural and undesirable. Therefore this method will be useful only when you need a simple method for inserting structural formulas with minimal modification. If you are not satisfied with the output, consider using {\XyMTeX} or -\textsf{chemfig} packages instead. +\Lpack{chemfig} packages instead. I also found following packages which can be used for similar purpose: %</en> @@ -1068,16 +1089,16 @@ I also found following packages which can be used for similar purpose: 好ã¾ã—ããªã„å ´åˆã‚‚ã‚ã‚‹ã‹ã‚‚ã—ã‚Œã¾ã›ã‚“。 ã—ãŸãŒã£ã¦ï¼Œã“ã®æ–¹æ³•ã¯æ§‹é€ å¼ã®å‡ºåŠ›ã‚’完全ã«åˆ¶å¾¡ã—ãŸã„ã¨ã„ã†æ„図ãŒãªã, æ§‹é€ å¼ã‚’簡便ã«æŒ¿å…¥ã—ãŸã„å ´åˆã«ã®ã¿å½¹ã«ç«‹ã¤ã§ã—ょã†ã€‚ -出力ã«æº€è¶³ã§ããªã„å ´åˆã¯ï¼Œ\XyMTeX ã‚„\textsf{chemfig}ã®ã‚ˆã†ãªãƒ‘ッケージを +出力ã«æº€è¶³ã§ããªã„å ´åˆã¯ï¼Œ\XyMTeX ã‚„\Lpack{chemfig}ã®ã‚ˆã†ãªãƒ‘ッケージを 代ã‚ã‚Šã«ä½¿ã†ã“ã¨ã‚’ã”検討ãã ã•ã„。 åŒæ§˜ã®ç›®çš„ã‚’é”æˆã™ã‚‹ãŸã‚ã«ä½¿ãˆãã†ãªãƒ‘ッケージã¨ã—ã¦ï¼Œ 以下ã®ã‚ˆã†ãªã‚‚ã®ã‚‚ã‚ã‚Šã¾ã™ï¼š %</ja> \begin{itemize} - \item \href{http://www.ctan.org/pkg/mol2chemfig}{\textsf{mol2chemfig}}: + \item \href{http://www.ctan.org/pkg/mol2chemfig}{\Lpack{mol2chemfig}}: convert chemical structures from MDL molfile format - to \textsf{chemfig} source code + to \Lpack{chemfig} source code \end{itemize} \clearpage @@ -1126,7 +1147,7 @@ It is important to prevent these characters from being translated as \LaTeX\ special characters. However, a backslash (\verb|\|) is a default escape character in \LaTeX, and a percent symbol (\verb|%|) also has a special meaning as a comment character. -In \textsf{chemobabel} (higher than v0.7), all these characters are +In \Lpack{chemobabel} (higher than v0.7), all these characters are handled properly by changing category codes temporarily (like \verb+\verb+). \\ %</en> %<*ja> @@ -1134,18 +1155,12 @@ handled properly by changing category codes temporarily (like \verb+\verb+). \\ å¿…è¦ãŒã‚ã‚Šã¾ã™ãŒï¼Œãƒãƒƒã‚¯ã‚¹ãƒ©ãƒƒã‚·ãƒ¥ \verb|\| ã¯ãƒ‡ãƒ•ã‚©ãƒ«ãƒˆã® エスケープ文å—ã§ã‚り,ã¾ãŸãƒ‘ãƒ¼ã‚»ãƒ³ãƒˆè¨˜å· \verb|%| もコメント文å—㨠ã—ã¦ã®ç‰¹æ®Šãªæ„味をæŒã£ã¦ã„ã¾ã™ã€‚ -\textsf{chemobabel} v0.7以上ã§ã¯ï¼Œã‚«ãƒ†ã‚´ãƒªãƒ¼ã‚³ãƒ¼ãƒ‰ã‚’一時的ã«å¤‰æ›´ã™ã‚‹ã“ã¨ã§ +\Lpack{chemobabel} v0.7以上ã§ã¯ï¼Œã‚«ãƒ†ã‚´ãƒªãƒ¼ã‚³ãƒ¼ãƒ‰ã‚’一時的ã«å¤‰æ›´ã™ã‚‹ã“ã¨ã§ ã“れらã™ã¹ã¦ã®æ–‡å—ã‚’é©åˆ‡ã«æ‰±ã†ã‚ˆã†ã«ãªã£ã¦ã„ã¾ã™ï¼ˆ\verb+\verb+ã¨åŒæ§˜ã®æ‰‹æ³•ï¼‰ã€‚ %</ja> \clearpage -To do (if possible): -\begin{itemize} -\item Check whether \texttt{obabel} and \texttt{inkscape} are successfully -installed or not, before running programs. -\end{itemize} - %<*en> \section{Version History} %</en> @@ -1156,10 +1171,10 @@ installed or not, before running programs. \begin{table}[h] \centering \begin{tabular}{ll} -2014/12/01 v0.1 & Made public as \textsf{smilesobabel.sty} \\ +2014/12/01 v0.1 & Made public as \Lpack{smilesobabel.sty} \\ 2014/12/02 v0.2 & Add options which can be passed to obabel. \\ -2014/12/07 v0.3 & Change name of package: \textsf{chemobabel.sty} \\ - & Images are stored in \texttt{chemobabelimgdir}. \\ +2014/12/07 v0.3 & Change name of package: \Lpack{chemobabel.sty} \\ + & Images are stored in \Lcode{chemobabelimgdir}. \\ & Add \verb|\chemobabel| command. \\ 2014/12/09 v0.4 & Fix a bug: (Thanks: Yusuke Terada) \\ & Extra spaces at the end of lines are removed. \\ @@ -1179,13 +1194,17 @@ installed or not, before running programs. 2022/09/11 v0.9h & Support Inkscape version 1.0 command line syntax. \\ 2022/09/12 v0.9i & Crop images before inclusion, add \verb|nocrop| option. \\ 2022/09/19 v0.9j & Check shell-escape status to show better error message. \\ + & This is the first release on CTAN! \\ +2022/10/09 v0.9k & Add \verb|\chemobabel*| and \verb|\smilesobabel*|. \\ + & Warn if a user need to run another \LaTeX. \\ + & Improve \verb|[extract]| to take over user-given package options. \\ \end{tabular} \end{table} \textbf{Important!} \begin{itemize} \item In Version 0.2, the number of parameters set in \verb|\smilesobabel| is changed! -\item From Version 0.3, the package name is changed to \textsf{chemobabel.sty}. +\item From Version 0.3, the package name is changed to \Lpack{chemobabel.sty}. \item From Version 0.7, the \verb|\catcode|-related workaround is rather harmful. \end{itemize} diff --git a/graphics/chemobabel/chemobabel.sty b/graphics/chemobabel/chemobabel.sty index 4f3122bb37..070effec11 100644 --- a/graphics/chemobabel/chemobabel.sty +++ b/graphics/chemobabel/chemobabel.sty @@ -17,7 +17,7 @@ \NeedsTeXFormat{LaTeX2e} \ProvidesPackage{chemobabel} - [2022/09/19 v0.9j Chemical structures with Open Babel] + [2022/10/09 v0.9k Chemical structures with Open Babel] %% Start of package main code %% Thanks: http://imada.sdu.dk/~jlandersen/latex/graphvizObabel.sty @@ -25,6 +25,9 @@ \RequirePackage{verbatim} \RequirePackage{graphicx} +%% ----- Check status ----- +\chardef\chemob@bel@status\z@ + %% ----- External command execution ----- \ifx\directlua\@undefined \def\chemob@bel@exec#1{\immediate\write18{#1}} @@ -44,6 +47,17 @@ \chardef\chemob@bel@shellescape =\directlua{tex.sprint(status.shell_escape)} \fi +%% ----- Ensure -shell-escape when processing ChemFigFile.tex +\edef\chemob@bel@jobname{\jobname} +{\escapechar=-1 \xdef\chemob@bel@outname{\string\ChemFigFile}} +\ifx\chemob@bel@jobname\chemob@bel@outname + \ifnum\chemob@bel@shellescape=\@ne\else + \PackageError{chemobabel}{% + Processing \chemob@bel@outname.tex needs -shell-escape.\MessageBreak + Run 'pdflatex -shell-escape \chemob@bel@outname.tex'}\@ehc + \fi +\fi + %% ----- Make a directory for images ----- \newcommand\chemobabelimgdir{chemobabelimgdir} \chemob@bel@exec{mkdir \chemobabelimgdir} @@ -98,6 +112,7 @@ No log file.% }% \end{minipage}}% + \global\chardef\chemob@bel@status\@ne }% } %% ----- Common part of \smilesobabel and \chemobabel end ----- @@ -111,14 +126,28 @@ % 1: (optional) options for includegraphics % 2: SMILES notation % 3: options for obabel -\newcommand\smilesobabel[1][scale=1]{% +\newcommand\smilesobabel{\@ifstar{\smilesobabel@i}{\smilesobabel@ii}} +\newcommand\smilesobabel@i[1][scale=1]{% \def\smilesobabel@next{\includegraphics[#1]}% \begingroup \let\do\@makeother \dospecials \catcode`\{=1 \catcode`\}=2 - \@smilesobabel + \@smilesobabel@i } -\newcommand\@smilesobabel[2]{% +\newcommand\smilesobabel@ii[1][scale=1]{% + \def\smilesobabel@next{\includegraphics[#1]}% + \begingroup + \let\do\@makeother \dospecials \catcode`\{=1 \catcode`\}=2 + \@smilesobabel@ii +} +\def\@smilesobabel@i#1{% + \endgroup + \@smilesobabel@main{#1}{}% +} +\def\@smilesobabel@ii#1#2{% \endgroup + \@smilesobabel@main{#1}{#2}% +} +\def\@smilesobabel@main#1#2{% \chemob@bel@exec{% \smilesob@bel@obabelcmd{#1}{#2} 2>\smilesob@belGetName.log && \chemob@bel@svgtoimgcmd{\smilesob@belGetName}{\chemob@belimgExt} 2>>\smilesob@belGetName.log @@ -138,14 +167,28 @@ % 1: (optional) options for includegraphics % 2: original files (.mol, .cdx, etc.) % 3: options for obabel -\newcommand\chemobabel[1][scale=1]{% +\newcommand\chemobabel{\@ifstar{\chemobabel@i}{\chemobabel@ii}} +\newcommand\chemobabel@i[1][scale=1]{% + \def\chemobabel@next{\includegraphics[#1]}% + \begingroup + \let\do\@makeother \dospecials \catcode`\{=1 \catcode`\}=2 + \@chemobabel@i +} +\newcommand\chemobabel@ii[1][scale=1]{% \def\chemobabel@next{\includegraphics[#1]}% \begingroup \let\do\@makeother \dospecials \catcode`\{=1 \catcode`\}=2 - \@chemobabel + \@chemobabel@ii +} +\def\@chemobabel@i#1{% + \endgroup + \@chemobabel@main{#1}{}% } -\newcommand\@chemobabel[2]{% +\def\@chemobabel@ii#1#2{% \endgroup + \@chemobabel@main{#1}{#2}% +} +\def\@chemobabel@main#1#2{% \IfFileExists{"#1"}{% % the file exists: start processing % (``#1'' can contain spaces, so ``"'' required) @@ -157,7 +200,7 @@ \chemob@bel@common@maybeimg{\chemobabel@next}{\chemob@belGetName}{file ``#1''}% }{% % the file does not exist: show a std error - \PackageError{chemobabel}{File ``#1'' not found}{}% + \PackageError{chemobabel}{File ``#1'' not found}\@ehc \fbox{\begin{minipage}{0.9\textwidth} Error in chemobabel: the file ``#1'' does not exist. \end{minipage}}% @@ -201,67 +244,180 @@ \DeclareOption{librsvg}% {\let\chemob@bel@svgtoimgcmd\chemob@bel@librsvgcmd} % crop image or not -\DeclareOption{nocrop}{% - \let\chemob@bel@cropcmd\@gobble - \let\chemob@bel@maybecrop\@empty} +\let\chemob@bel@nocrop\relax +\DeclareOption{nocrop}{\let\chemob@bel@nocrop\@empty} % default settings \ExecuteOptions{pdf,inkscape} -\ProcessOptions\relax +% handle user settings - arbitrary order allowed +\ProcessOptions*\relax +\ifx\chemob@bel@nocrop\relax \else + \let\chemob@bel@cropcmd\@gobble + \let\chemob@bel@maybecrop\@empty +\fi %% ----- Declaration of options end ----- +%% ----- Warn if something went wrong ----- +% e.g.) \chemob@bel@common@maybeimg is not an image +% --- when current processing failed +% AND previous shell-escape run not found +% e.g.) \chemob@bel@common@maybeimg is definitely a wrong image +% --- when current processing failed +% BUT previous shell-escape run with different total number found +% --- note that re-run after removing [extract] should avoid the warning +% --- as it will include all the correct images from previous shell-escape run +\def\chemob@bel@record@imgnum#1{% + \immediate\write#1{\gdef\string + \smilesob@bel@imgNum{\number\value{smilesob@belCounter}}}% + \immediate\write#1{\gdef\string + \chemob@bel@imgNum{\number\value{chemob@belCounter}}}% +} +\def\chemob@bel@preserve@imgnum#1{% + \immediate\write#1{\gdef\string + \smilesob@bel@imgNum{\smilesob@bel@imgNum}}% + \immediate\write#1{\gdef\string + \chemob@bel@imgNum{\chemob@bel@imgNum}}% +} +\def\chemob@bel@atenddocument{% + \ifnum\chemob@bel@status>\z@ % at least one is not an image + \PackageWarningNoLine{chemobabel}{% + Some processing failed.\MessageBreak + Please rerun}% + \else % all images + \ifnum\chemob@bel@shellescape=\@ne % current run is shell-escape + % record number of images of the current run + \if@filesw + \chemob@bel@record@imgnum{\@mainaux}% + \fi + % when processing ChemFigFile.tex, also write to the original .aux + \ifx\chemob@bel@jobname\chemob@bel@outname + \IfFileExists{\chemobabelfile.tex}{% + \if@filesw + \newwrite\chemob@bel@origaux + \immediate\openout\chemob@bel@origaux=\chemobabelfile.aux\relax + \chemob@bel@record@imgnum{\chemob@bel@origaux}% + \immediate\closeout\chemob@bel@origaux + \fi + }{}% + \fi + \else + % compare number of images with the previous shell-escape run + \ifx\smilesob@bel@imgNum\@undefined\def\smilesob@bel@imgNum{0}\fi + \ifnum\value{smilesob@belCounter}=\smilesob@bel@imgNum\relax\else + \PackageWarningNoLine{chemobabel}{% + Number of \noexpand\smilesobabel changed.\MessageBreak + Please rerun}% + \fi + \ifx\chemob@bel@imgNum\@undefined\def\chemob@bel@imgNum{0}\fi + \ifnum\value{chemob@belCounter}=\chemob@bel@imgNum\relax\else + \PackageWarningNoLine{chemobabel}{% + Number of \noexpand\chemobabel changed.\MessageBreak + Please rerun}% + \fi + % record number of images of the previous shell-escape run + \if@filesw + \chemob@bel@preserve@imgnum{\@mainaux}% + \fi + \fi + \fi +} +\AtEndDocument{\chemob@bel@atenddocument} +%% ----- Warn if something went wrong end ----- + %% ----- Exit this package now, if [extract] is not specified ----- \ifx\chemob@bel@extract\relax \endinput \fi %% Extracting all codes of Open Babel figures %% Thanks: http://oku.edu.mie-u.ac.jp/tex/mod/forum/discuss.php?d=1411 +%% ----- Safety check before opening output file ----- +\ifx\chemob@bel@jobname\chemob@bel@outname + \PackageWarningNoLine{chemobabel}{% + Wow! Your file name is `\chemob@bel@outname'!\MessageBreak + Option [extract] ignored to avoid overwriting} + \expandafter\endinput +\fi + \PackageWarningNoLine{chemobabel}{% You are using [extract] option.\MessageBreak No chemical structures will be printed} +%% ----- Accumulate user-given options to be passed ----- +% the image extension (non-empty) +\edef\chemob@bel@options{\chemob@belimgExt} +% image conversion command (except default=inkscape) +\ifx\chemob@bel@svgtoimgcmd\chemob@bel@inkscapeoldcmd + \edef\chemob@bel@options{\chemob@bel@options,inkscape-old} +\else\ifx\chemob@bel@svgtoimgcmd\chemob@bel@librsvgcmd + \edef\chemob@bel@options{\chemob@bel@options,librsvg} +\fi\fi +% crop image or not +\ifx\chemob@bel@nocrop\relax \else + \edef\chemob@bel@options{\chemob@bel@options,nocrop} +\fi + %% ----- Define intermediate output file and load packages ----- -\newwrite\ChemFigFile -\immediate\openout\ChemFigFile=ChemFigFile.tex\relax -\immediate\write\ChemFigFile{\string\documentclass{article}} -\immediate\write\ChemFigFile{\string\usepackage{graphicx}} -\immediate\write\ChemFigFile{\string\usepackage{chemobabel}} +\newwrite\chemob@bel@outfile +\immediate\openout\chemob@bel@outfile=\chemob@bel@outname.tex\relax +\immediate\write\chemob@bel@outfile{\string\def\string\chemobabelfile{\chemob@bel@jobname}} +\immediate\write\chemob@bel@outfile{\string\documentclass{article}} +\immediate\write\chemob@bel@outfile{\string\usepackage[\chemob@bel@options]{chemobabel}} %% ----- Read and write ----- -\immediate\write\ChemFigFile{\string\begin{document}} -\AtEndDocument{% - \immediate\write\ChemFigFile{\string\end{document}}% - \immediate\closeout\ChemFigFile +\immediate\write\chemob@bel@outfile{\string\begin{document}} +\def\chemob@bel@atenddocument{% + \immediate\write\chemob@bel@outfile{\string\end{document}}% + \immediate\closeout\chemob@bel@outfile \chemob@bel@ifnochem{}{% \PackageWarningNoLine{chemobabel}{% Some chemical structures are extracted.\MessageBreak Run 'pdflatex -shell-escape ChemFigFile.tex'}}% } -\renewcommand\smilesobabel{% +% \smilesobabel*[#1]{#2} => normalized to \smilesobabel[#1]{#2}{#3} +\renewcommand\smilesobabel@i{% + \begingroup + \let\do\@makeother \dospecials \catcode`\{=1 \catcode`\}=2 + \@smilesobabel@i +} +\renewcommand\smilesobabel@ii{% \begingroup - \let\do\@makeother - \dospecials - \catcode`\{=1 - \catcode`\}=2 - \@@smilesobabel + \let\do\@makeother \dospecials \catcode`\{=1 \catcode`\}=2 + \@smilesobabel@ii } -\newcommand\@@smilesobabel[3][scale=1]{% +\renewcommand\@smilesobabel@i[2][scale=1]{% \endgroup - \immediate\write\ChemFigFile{% + \@smilesobabel@main{#1}{#2}{}% +} +\renewcommand\@smilesobabel@ii[3][scale=1]{% + \endgroup + \@smilesobabel@main{#1}{#2}{#3}% +} +\def\@smilesobabel@main#1#2#3{% + \immediate\write\chemob@bel@outfile{% \string\smilesobabel[#1]{#2}{#3}% \string\newpage}% [\smilesob@belGetName.\chemob@belimgExt]% \addtocounter{smilesob@belCounter}{1}} -\renewcommand\chemobabel{% +% \chemobabel*[#1]{#2} => normalized to \chemobabel[#1]{#2}{#3} +\renewcommand\chemobabel@i{% \begingroup - \let\do\@makeother - \dospecials - \catcode`\{=1 - \catcode`\}=2 - \@@chemobabel + \let\do\@makeother \dospecials \catcode`\{=1 \catcode`\}=2 + \@chemobabel@i } -\newcommand\@@chemobabel[3][scale=1]{% +\renewcommand\chemobabel@ii{% + \begingroup + \let\do\@makeother \dospecials \catcode`\{=1 \catcode`\}=2 + \@chemobabel@ii +} +\renewcommand\@chemobabel@i[2][scale=1]{% \endgroup - \immediate\write\ChemFigFile{% + \@chemobabel@main{#1}{#2}{}% +} +\renewcommand\@chemobabel@ii[3][scale=1]{% + \endgroup + \@chemobabel@main{#1}{#2}{#3}% +} +\def\@chemobabel@main#1#2#3{% + \immediate\write\chemob@bel@outfile{% \string\chemobabel[#1]{#2}{#3}% \string\newpage}% [\chemob@belGetName.\chemob@belimgExt]% diff --git a/graphics/chemobabel/example-en.tex b/graphics/chemobabel/example-en.tex index 3f98668adf..86f01f6435 100644 --- a/graphics/chemobabel/example-en.tex +++ b/graphics/chemobabel/example-en.tex @@ -15,10 +15,11 @@ \maketitle The formulas below are generated using \textsf{chemobabel} package with the help of Open Babel and Inkscape. +% Note: \smilesobabel* and \chemobabel* are provided since 2022-10-09. \begin{figure}[ht] \centering - \smilesobabel{CCO}{} + \smilesobabel*{CCO} \caption{Ethanol} \end{figure} @@ -30,8 +31,8 @@ The formulas below are generated using \textsf{chemobabel} package with the help \begin{figure}[ht] \centering - \smilesobabel[scale=0.7]{Cl/C=C/Br}{} - \smilesobabel[scale=0.7]{Cl/C=C\Br}{} + \smilesobabel*[scale=0.7]{Cl/C=C/Br} + \smilesobabel*[scale=0.7]{Cl/C=C\Br} \caption{(\textit{E})-1-bromo-2-chloroethene \& (\textit{Z})-1-bromo-2-chloroethene} \end{figure} @@ -43,7 +44,7 @@ The formulas below are generated using \textsf{chemobabel} package with the help \begin{figure}[ht] \centering - \chemobabel[scale=0.4]{draw/Brevetoxin A.mol}{} + \chemobabel*[scale=0.4]{draw/Brevetoxin A.mol} \caption{Brevetoxin A} \end{figure} diff --git a/graphics/chemobabel/example-ja.tex b/graphics/chemobabel/example-ja.tex index c166604975..cc44e109db 100644 --- a/graphics/chemobabel/example-ja.tex +++ b/graphics/chemobabel/example-ja.tex @@ -16,10 +16,11 @@ \begin{document} \maketitle 以下ã®æ§‹é€ å¼ã¯ã€\textsf{chemobabel} パッケージを用ã„㦠Open Babel 㨠Inkscape を介ã—ãŸè‡ªå‹•å¤‰æ›ã«ã‚ˆã‚Šç”Ÿæˆã—ã¾ã—ãŸã€‚ +% Note: \smilesobabel* 㨠\chemobabel* 㯠2022-10-09 ã§è¿½åŠ ã•ã‚Œã¾ã—ãŸã€‚ \begin{figure}[ht] \centering - \smilesobabel{CCO}{} + \smilesobabel*{CCO} \caption{エタノール} \end{figure} @@ -31,8 +32,8 @@ \begin{figure}[ht] \centering - \smilesobabel[scale=0.7]{Cl/C=C/Br}{} - \smilesobabel[scale=0.7]{Cl/C=C\Br}{} + \smilesobabel*[scale=0.7]{Cl/C=C/Br} + \smilesobabel*[scale=0.7]{Cl/C=C\Br} \caption{(\textit{E})-1-ブãƒãƒ¢-2-クãƒãƒã‚¨ãƒ†ãƒ³ã¨(\textit{Z})-1-ブãƒãƒ¢-2-クãƒãƒã‚¨ãƒ†ãƒ³} \end{figure} @@ -44,7 +45,7 @@ \begin{figure}[ht] \centering - \chemobabel[scale=0.4]{draw/Brevetoxin A.mol}{} + \chemobabel*[scale=0.4]{draw/Brevetoxin A.mol} \caption{ブレベトã‚シンA} \end{figure} diff --git a/macros/latex/contrib/iexec/DEPENDS.txt b/macros/latex/contrib/iexec/DEPENDS.txt index 5fa4f92b5c..3e3774f0e2 100644 --- a/macros/latex/contrib/iexec/DEPENDS.txt +++ b/macros/latex/contrib/iexec/DEPENDS.txt @@ -1,3 +1,4 @@ hard shellesc hard pgfkeys hard xkeyval +hard expl3 diff --git a/macros/latex/contrib/iexec/iexec.dtx b/macros/latex/contrib/iexec/iexec.dtx index fb38432b0e..2478ac224a 100644 --- a/macros/latex/contrib/iexec/iexec.dtx +++ b/macros/latex/contrib/iexec/iexec.dtx @@ -50,17 +50,14 @@ %<package>\NeedsTeXFormat{LaTeX2e} %<package>\ProvidesPackage{iexec} %<*package> -[01.10.2022 0.6.1 Inputable Shell Executions] +[09.10.20220 0.7.0 Inputable Shell Executions] %</package> %<*driver> \documentclass{ltxdoc} \usepackage[tt=false, type1=true]{libertine} +\usepackage{microtype} \usepackage{iexec} \usepackage{href-ul} -\raggedbottom -\setlength{\parindent}{0pt} -\setlength{\columnsep}{32pt} -\setlength{\parskip}{6pt} \PageIndex \EnableCrossrefs \CodelineIndex @@ -105,7 +102,7 @@ Today is % % \columnbreak % -% Today is \iexec{date +\%e-\%b-\%Y} +% Today is \iexec[log]{date +\%e-\%b-\%Y} % \end{multicols} % \begin{macro}{\iexec} @@ -184,6 +181,43 @@ This file won't be deleted: \iexec[stdout=me.txt]{whoami}. %\fi % \end{macro} +% \begin{macro}{append} +% The stdout produced will be appended to the file specified: +%\iffalse +%<*verb> +%\fi +\begin{verbatim} +\documentclass{article} +\usepackage[trace]{iexec} +\begin{document} +\iexec[append,stdout=foo.txt,quiet]{echo 'Hello, '} +\iexec[append,stdout=foo.txt,quiet]{echo 'Jeffrey!'} +\input{foo.txt} +\end{document} +\end{verbatim} +%\iffalse +%</verb> +%\fi +% \end{macro} + +% \begin{macro}{log} +% The stdout produced will be printed in \TeX{} log: +%\iffalse +%<*verb> +%\fi +\begin{verbatim} +\documentclass{article} +\usepackage{iexec} +\begin{document} +\iexec[log]{echo 'Hello, \\LaTeX!'} +\input{foo.txt} +\end{document} +\end{verbatim} +%\iffalse +%</verb> +%\fi +% \end{macro} + % \StopEventually{} % \section{Implementation} @@ -193,9 +227,15 @@ This file won't be deleted: \iexec[stdout=me.txt]{whoami}. % \changes{v0.4.1}{2021/08/08}{Options trace, stdout, and quiet added} % \changes{v0.5.0}{2022/01/08}{Major bug fixes} -% \iffalse +% First, we include a few packages: +% \begin{macrocode} \RequirePackage{shellesc} \RequirePackage{pgfkeys} +\RequirePackage{expl3} +% \end{macrocode} + +% Then, we parse package options: +% \begin{macrocode} \RequirePackage{xkeyval} \makeatletter\newif\ifiexec@trace \DeclareOptionX{trace}{\iexec@tracetrue} @@ -206,12 +246,34 @@ This file won't be deleted: \iexec[stdout=me.txt]{whoami}. stdout/.estore in = \iexec@stdout, stdout/.default = iexec.tmp, trace/.estore in = \iexec@traceit, + append/.estore in = \iexec@append, + log/.estore in = \iexec@log, quiet/.estore in = \iexec@quiet, stdout }\makeatother -% \fi +% \end{macrocode} + +% \begin{macro}{\iexec@typeout} +% Then, we define an internal command |\iexec@typeout| for printing the content of a file, +% as suggested \href{https://tex.stackexchange.com/questions/660808}{here}: +% \begin{macrocode} +\makeatletter\ExplSyntaxOn +\NewDocumentCommand{\iexec@typeout}{m}{ + \iexec_typeout_file:n { #1 }} +\ior_new:N \g_iexec_typeout_ior +\cs_new_protected:Nn \iexec_typeout_file:n +{ + \ior_open:Nn \g_iexec_typeout_ior { #1 } + \ior_str_map_inline:Nn \g_iexec_typeout_ior + {\iow_term:n { ##1 }} + \ior_close:N \g_iexec_typeout_ior +} +\ExplSyntaxOff\makeatother +% \end{macrocode} +% \end{macro} % \begin{macro}{\iexec} +% Then, we define |\iexec| command. % It is implemented with the help of |\ShellEscape| from |shellesc| package: % \begin{macrocode} \makeatletter\newcommand\iexec[2][]{% @@ -222,7 +284,7 @@ This file won't be deleted: \iexec[stdout=me.txt]{whoami}. % it nothing will work; so, it's better to throw an error earlier than later: % \begin{macrocode} \ifdefined\pdfshellescape\ifnum\pdfshellescape=1\else% - \PackageError{iexec}{You must run latex with + \PackageError{iexec}{You must run TeX processor with --shell-escape option}{}% \fi\fi% \begingroup% @@ -238,19 +300,29 @@ This file won't be deleted: \iexec[stdout=me.txt]{whoami}. % \end{macrocode} % Then, we execute it: % \begin{macrocode} - \ShellEscape{#2 > \iexec@stdout}% + \ShellEscape{#2 \ifdefined\iexec@append>\fi> \iexec@stdout}% % \end{macrocode} % Then, a message is printed to TeX log: % \begin{macrocode} \message{^^Jiexec: [#2 > \iexec@stdout]^^J}% \endgroup% % \end{macrocode} +% Then, if required, the content of the stdout file will be printed to the log: +% \begin{macrocode} + \ifdefined\iexec@log + \message{^^Jiexec: this is the content of \iexec@stdout:^^J}% + \iexec@typeout{\iexec@stdout} + \message{^^J<EOF>^^J}% + \fi% +% \end{macrocode} % Then, include the produced output into the current document: % \begin{macrocode} \ifdefined\iexec@quiet - \message{^^Jiexec: Due to 'quiet' we didn't read - the content of '\iexec@stdout'^^J}% + \message{^^Jiexec: Due to 'quiet' option we didn't read + the content of '\iexec@stdout' (\pdffilesize{} bytes)^^J}% \else% + \message{^^Jiexec: We include the content of + '\iexec@stdout' (\pdffilesize{} bytes)...^^J}% \input{\iexec@stdout}% \message{^^Jiexec: The content of '\iexec@stdout' was included into the document^^J}% diff --git a/macros/latex/contrib/iexec/iexec.ins b/macros/latex/contrib/iexec/iexec.ins index 36172278a6..8d2fd38a42 100644 --- a/macros/latex/contrib/iexec/iexec.ins +++ b/macros/latex/contrib/iexec/iexec.ins @@ -48,8 +48,8 @@ SOFTWARE. \endpreamble \generate{\file{iexec.sty}{\from{iexec.dtx}{package}}} \obeyspaces -\Msg{*** To finish the installation you have to move the ".sty"} -\Msg{*** file into a directory searched by TeX. To produce the} -\Msg{*** documentation run the file ".dtx" through LaTeX. If any} -\Msg{*** questions, submit a new GitHub issue.} +\Msg{To finish the installation you have to move the ".sty"} +\Msg{file into a directory searched by TeX. To produce the} +\Msg{documentation run the file ".dtx" through LaTeX. If any} +\Msg{questions, submit a new GitHub issue.} \endbatchfile diff --git a/macros/latex/contrib/iexec/iexec.pdf b/macros/latex/contrib/iexec/iexec.pdf Binary files differindex 74233b4810..6030b3fa7a 100644 --- a/macros/latex/contrib/iexec/iexec.pdf +++ b/macros/latex/contrib/iexec/iexec.pdf diff --git a/macros/latex/contrib/thalie/CHANGELOG.md b/macros/latex/contrib/thalie/CHANGELOG.md index 6321921e29..f91eca7082 100644 --- a/macros/latex/contrib/thalie/CHANGELOG.md +++ b/macros/latex/contrib/thalie/CHANGELOG.md @@ -1,3 +1,9 @@ +* thalie 0.12a (2022-10-09) + + * The `xspace` option also affects \did. + + -- Louis Paternault <spalax@gresille.org> + * thalie 0.11b (2022-06-16) * Fix sloppy previous release. diff --git a/macros/latex/contrib/thalie/README.md b/macros/latex/contrib/thalie/README.md index 96ee7129e8..f6babe79fe 100644 --- a/macros/latex/contrib/thalie/README.md +++ b/macros/latex/contrib/thalie/README.md @@ -5,13 +5,13 @@ It defines commands to introduce characters' lines, to render stage direction, to divide a play into acts and scenes, to automatically build the dramatis personae, etc. -- Version 0.11b (2022-06-16) +- Version 0.12a (2022-10-09) - Usage and installation instruction are available in the [documentation](http://mirrors.ctan.org/macros/latex/contrib/thalie/thalie.pdf). - Examples - - [French play, in verse](https://framagit.org/spalax/thalie/raw/v0.11b/examples/cyrano.pdf) ([source](https://framagit.org/spalax/thalie/raw/v0.11b/examples/cyrano.tex)) - - [French play, in prose](https://framagit.org/spalax/thalie/raw/v0.11b/examples/domjuan.pdf) ([source](https://framagit.org/spalax/thalie/raw/v0.11b/examples/domjuan.tex)) - - [English play, in prose](https://framagit.org/spalax/thalie/raw/v0.11b/examples/hamlet.pdf) ([source](https://framagit.org/spalax/thalie/raw/v0.11b/examples/hamlet.tex)) - - [English play, in verse](https://framagit.org/spalax/thalie/raw/v0.11b/examples/henry.pdf) ([source](https://framagit.org/spalax/thalie/raw/v0.11b/examples/henry.tex)) + - [French play, in verse](https://framagit.org/spalax/thalie/raw/v0.12a/examples/cyrano.pdf) ([source](https://framagit.org/spalax/thalie/raw/v0.12a/examples/cyrano.tex)) + - [French play, in prose](https://framagit.org/spalax/thalie/raw/v0.12a/examples/domjuan.pdf) ([source](https://framagit.org/spalax/thalie/raw/v0.12a/examples/domjuan.tex)) + - [English play, in prose](https://framagit.org/spalax/thalie/raw/v0.12a/examples/hamlet.pdf) ([source](https://framagit.org/spalax/thalie/raw/v0.12a/examples/hamlet.tex)) + - [English play, in verse](https://framagit.org/spalax/thalie/raw/v0.12a/examples/henry.pdf) ([source](https://framagit.org/spalax/thalie/raw/v0.12a/examples/henry.tex)) License ------- diff --git a/macros/latex/contrib/thalie/thalie.dtx b/macros/latex/contrib/thalie/thalie.dtx index 646c4e41dd..d9ba447489 100644 --- a/macros/latex/contrib/thalie/thalie.dtx +++ b/macros/latex/contrib/thalie/thalie.dtx @@ -25,7 +25,7 @@ %<package>\NeedsTeXFormat{LaTeX2e} %<package>\ProvidesPackage{thalie} %<*package> - [2022/06/16 v0.11b A package to typeset drama plays] + [2022/10/09 v0.12a A package to typeset drama plays] %</package> % %<*driver> @@ -80,7 +80,7 @@ % % \GetFileInfo{thalie.dtx} % -% \DoNotIndex{\@backslashchar, \@ifnextchar, \protect\`} +% \DoNotIndex{\@backslashchar, \@ifnextchar} % \DoNotIndex{\#,\$,\%,\&,\@,\\,\{,\},\^,\_,\~,\ ,\!,\(,\),\,} % \DoNotIndex{\addcontentsline, \addto, \ae, \AND, \arabic, \abovedisplayshortskip, \abovedisplayskip, \addtolength} % \DoNotIndex{\begin, \bfseries, \boolean, \baselineskip, \belowdisplayskip, \belowdisplayshortskip, \boolfalse, \booltrue} @@ -119,9 +119,10 @@ % \@speaks, % \@verseadjust, % } -% \DoNotIndex{\newcommand, \newcounter, \newenvironment, \noindent, \noexpand, \NOT, \newif, \newlength, \newline, \nopagebreak} +% \DoNotIndex{\newcommand, \newcounter, \newenvironment, \noindent, \noexpand, \NOT, \newif, \newlength, \newline, \nopagebreak, \notbool} % \DoNotIndex{\OR} -% \DoNotIndex{\par, \pgfkeys, \ProcessPgfPackageOptions, \protect, \protected@xappto, \parindent, \parskip, \predisplaysize, \prevgraf, \providebool} +% \DoNotIndex{\par, \pgfkeys, \ProcessPgfPackageOptions, \protect, \protected@xappto, \parindent, \parskip, \predisplaysize, \prevgraf, \providebool, \providecommand} +% \expandafter\DoNotIndex\expandafter{\string\ } ^^A From https://www.latex-project.org/cgi-bin/ltxbugs2html?pr=latex%2F3540 % \DoNotIndex{\quad} % \DoNotIndex{\refstepcounter, \renewcommand, \RequirePackage, \right, \Roman, \relax, \rightmargin} % \DoNotIndex{\section, \setboolean, \setlength, \sffamily, \smallskip} @@ -260,7 +261,7 @@ % \label{sec:usage} % % \subsection{Localization} -% \changes{v0.9a}{2017/04/22}{Add section \emph{Localization}.} +% \changes{v0.09a}{2017/04/22}{Add section \emph{Localization}.} % % By default, commands \lstinline|\act|, \lstinline|\scene|, etc. use English words, but they are % translated to the current language used by |babel| or @@ -303,8 +304,9 @@ % \label{table:packageoptions} % \end{table} % -% \subsubsection{Space following character commands} -% \changes{v0.7}{2015/12/28}{New package option \texttt{xspace}.} +% \subsubsection{Space following character commands and stage directions} +% \label{option:xspace} +% \changes{v0.07}{2015/12/28}{New package option \texttt{xspace}.} % As commands introducing characters' lines and displaying characters' names % may be frequently used, it might be tempting to omit the following \lstinline|{}| For % instance, one might prefer to write: @@ -331,7 +333,7 @@ % If package option |xspace| is set (e.g. |xspace=true|), space is automatically % added after those commands if necessary\footnote{This is done with % the |$\backslash$xspace| command (from the |xspace| package), hence the name.}; -% otherwise, it is not. +% otherwise, it is not. The same rule applies after a |\did| command. % % For historical reasons, the option |xspace| default is |true|, but this might % change in some later non-backward compatible version. @@ -925,7 +927,7 @@ No! It's a bit short, young man\ldots % \ref{fig:character_example}). % % \paragraph{Choose style} -% \changes{v0.6}{2014/06/25}{New character styles \texttt{imprimerie-verse}, \texttt{imprimerie-prose} and \texttt{arden}.} +% \changes{v0.06}{2014/06/25}{New character styles \texttt{imprimerie-verse}, \texttt{imprimerie-prose} and \texttt{arden}.} % Several styles are available, to typeset character's name and lines in % different ways. Change the style by loading package using option % |characterstyle=|\marg{style} (available styles are |bold|, |center|, @@ -969,11 +971,14 @@ No! It's a bit short, young man\ldots % \DescribeMacro{\did} % \DescribeEnv{dida} % We define two ways to render stage directions: a short one, that is printed -% inline, and a long one, printed in its own paragraph. They act a bit like -% \lstinline|$\formula$| and \lstinline|\[\formula\]| for formulas. +% inline, and a long one, printed in its own paragraph\footnote{For people writing math: +% They act a bit like \lstinline|$1+1=2$| and \texttt{\bbackslash[1+1=2\bbackslash]} for formulas.}. % The first way is the command \lstinline|\did|\marg{directions}. The second way is the % environment |dida|. % +% Note that option \lstinline|xspace| may be used to automatically add a space, +% if necessary, after a \lstinline|\did| command (see section \ref{option:xspace}, page \pageref{option:xspace}). +% % \DescribeMacro{\onstage} % Some stage directions are displayed centered under the scene or act % definition (I often see it in classical drama, where the list of characters @@ -1207,7 +1212,7 @@ So is Lysander. % \subsection{Localization} % \label{sec:l10n} % -% \changes{v0.9a}{2017/04/22}{Use package |translations| for localization.} +% \changes{v0.09a}{2017/04/22}{Use package |translations| for localization.} % % Language cannot be defined directly in this package. Instead, the language % currently used by |babel| or |polyglossia| is used to translate the following @@ -1280,7 +1285,7 @@ So is Lysander. % % \section{Examples} % \label{sec:examples} -% \changes{v0.9a}{2017/04/22}{Add section \emph{Examples}.} +% \changes{v0.09a}{2017/04/22}{Add section \emph{Examples}.} % % \subsection{Characters' lines} % \label{sec:examples:characterslines} @@ -1850,13 +1855,13 @@ One! % \end{environment} % % \begin{environment}{dramatisenv} -% \changes{v0.9a}{2017/04/22}{It is now possible to customize style of dramatis person\ae.} +% \changes{v0.09a}{2017/04/22}{It is now possible to customize style of dramatis person\ae.} % \begin{macro}{\dramatischaracter} % \begin{macro}{\dramatischaractername} % \begin{macro}{\dramatischaracterdescription} % \begin{macro}{\characterspace} % \begin{environment}{charactergroup} -% \changes{v0.6}{2013/11/02}{Groups of characters are now aligned with other caracters.} +% \changes{v0.06}{2013/11/02}{Groups of characters are now aligned with other caracters.} % Customizable commands to build dramatis person\ae. % \begin{macrocode} % Environment used to *display* dramatis personae. @@ -2053,8 +2058,9 @@ One! % % \begin{macro}{\did} % Inline stage directions. +% \changes{v0.12a}{2022/10/09}{The \texttt{xspace} option also affects \texttt{\bbackslash{}did}.} % \begin{macrocode} -\newcommand{\did}[1]{\emph{(#1)} } +\newcommand{\did}[1]{\emph{(#1)}\@maybexspace} % \end{macrocode} % \end{macro} % @@ -2080,7 +2086,7 @@ One! % \subsection{Splitting verses} % \begin{macro}{\pauseverse} -% \changes{v0.7}{2015/12/28}{New commands \texttt{\bbackslash{}pauseverse}, \texttt{\bbackslash{}resumeverse}, \texttt{\bbackslash{}adjustverse}.} +% \changes{v0.07}{2015/12/28}{New commands \texttt{\bbackslash{}pauseverse}, \texttt{\bbackslash{}resumeverse}, \texttt{\bbackslash{}adjustverse}.} % \changes{v0.10c}{2021/09/26}{Document other implementations of \texttt{\bbackslash{}pauseverse} and \texttt{\bbackslash{}resumeverse}} % \begin{macro}{\resumeverse} % \begin{macro}{\adjustverse} @@ -2218,7 +2224,7 @@ One! % \end{macrocode} % % \begin{macro}{\setthalieoptions} -% \changes{v0.9a}{2017/04/22}{Add command \texttt{\bbackslash{}setthalieoptions}.} +% \changes{v0.09a}{2017/04/22}{Add command \texttt{\bbackslash{}setthalieoptions}.} % Redefine package options. % \begin{macrocode} \newcommand{\setthalieoptions}[1]{% @@ -2227,7 +2233,7 @@ One! % \end{macrocode} % \end{macro} % -% \changes{v0.5}{2013/06/08}{First published version.} +% \changes{v0.05}{2013/06/08}{First published version.} % % \addcontentsline{toc}{section}{Change History} % \PrintChanges diff --git a/macros/latex/contrib/thalie/thalie.pdf b/macros/latex/contrib/thalie/thalie.pdf Binary files differindex 2cc0c71438..5cb97d8e2f 100644 --- a/macros/latex/contrib/thalie/thalie.pdf +++ b/macros/latex/contrib/thalie/thalie.pdf diff --git a/macros/texinfo/latest/htmlxref.cnf b/macros/texinfo/latest/htmlxref.cnf index 663612b04f..a90481bb38 100644 --- a/macros/texinfo/latest/htmlxref.cnf +++ b/macros/texinfo/latest/htmlxref.cnf @@ -60,7 +60,7 @@ auctex node ${GS}/auctex/manual/auctex/ autoconf mono ${GS}/autoconf/manual/autoconf.html autoconf node ${GS}/autoconf/manual/html_node/ -autogen mono ${GS}/autogen/manual/html_mono/autogen.html +autogen mono ${GS}/autogen/manual/autogen.html autogen chapter ${GS}/autogen/manual/html_chapter/ autogen node ${GS}/autoconf/manual/html_node/ @@ -110,8 +110,8 @@ cpio node ${GS}/cpio/manual/html_node/ cssc node ${GS}/cssc/manual/ CVS = ${GS}/trans-coord/manual -cvs mono ${CVS}/cvs/cvs.html -cvs node ${CVS}/cvs/html_node/ +cvs mono ${CVS}/cvs/cvs.html +cvs node ${CVS}/cvs/html_node/ ddd mono ${GS}/ddd/manual/html_mono/ddd.html @@ -119,7 +119,7 @@ ddrescue mono ${GS}/ddrescue/manual/ddrescue_manual.html dejagnu node ${GS}/dejagnu/manual/ -DICO = https://puszcza.gnu.org.ua/software/dico/manual +DICO = https://www.gnu.org.ua/software/dico/manual dico mono ${DICO}/dico.html dico chapter ${DICO}/html_chapter/ dico section ${DICO}/html_section/ @@ -128,9 +128,6 @@ dico node ${DICO}/html_node/ diffutils mono ${GS}/diffutils/manual/diffutils diffutils node ${GS}/diffutils/manual/html_node/ -dmd mono ${GS}/dmd/manual/dmd -dmd node ${GS}/dmd/manual/html_node/ - ed mono ${GS}/ed/manual/ed_manual.html EMACS = ${GS}/emacs/manual @@ -359,10 +356,7 @@ gdb node ${GDB}/gdb/ stabs node ${GDB}/stabs/ GDBM = http://www.gnu.org.ua/software/gdbm/manual -gdbm mono ${GDBM}/gdbm.html -gdbm chapter ${GDBM}/html_chapter/ -gdbm section ${GDBM}/html_section/ -gdbm node ${GDBM}/html_node/ +gdbm node ${GDBM}/ gettext mono ${GS}/gettext/manual/gettext.html gettext node ${GS}/gettext/manual/html_node/ @@ -427,12 +421,15 @@ grep node ${GS}/grep/manual/html_node/ groff node ${GS}/groff/manual/html_node/ -GRUB = ${GS}/grub/manual - grub mono ${GRUB}/grub.html - grub node ${GRUB}/html_node/ +GRUB = ${GS}/grub/manual/ + grub mono ${GRUB}/grub/grub.html + grub node ${GRUB}/grub/html_node/ # multiboot mono ${GRUB}/multiboot/multiboot.html multiboot node ${GRUB}/multiboot/html_node/ + # + grub-dev mono ${GRUB}/grub-dev/grub-dev.html + grub-dev node ${GRUB}/grub-dev/html_node/ gsasl mono ${GS}/gsasl/manual/gsasl.html gsasl node ${GS}/gsasl/manual/html_node/ @@ -578,12 +575,10 @@ motti node ${GS}/motti/manual/ mpc node http://www.multiprecision.org/index.php?prog=mpc&page=html -mpfr mono http://www.mpfr.org/mpfr-current/mpfr.html +mpfr mono https://www.mpfr.org/mpfr-current/mpfr.html mtools mono ${GS}/mtools/manual/mtools.html -myserver mono http://www.myserverproject.net/doc.php - nano mono https://www.nano-editor.org/dist/latest/nano.html nettle chapter http://www.lysator.liu.se/~nisse/nettle/nettle.html @@ -593,17 +588,12 @@ ocrad mono ${GS}/ocrad/manual/ocrad_manual.html parted mono ${GS}/parted/manual/parted.html parted node ${GS}/parted/manual/html_node/ -pascal mono http://www.gnu-pascal.de/gpc/ +pascal node https://www.gnu-pascal.de/gpc/ # can't use pcb since url's contain dates --30nov10 -perl mono ${GS}/perl/manual/perldoc-all.html - PIES = http://www.gnu.org.ua/software/pies/manual -pies mono ${PIES}/pies.html -pies chapter ${PIES}/html_chapter/ -pies section ${PIES}/html_section/ -pies node ${PIES}/html_node/ +pies node ${PIES}/ plotutils mono ${GS}/plotutils/manual/en/plotutils.html plotutils node ${GS}/plotutils/manual/en/html_node/ @@ -629,11 +619,12 @@ rcs mono ${GS}/rcs/manual/rcs.html rcs node ${GS}/rcs/manual/html_node/ READLINE = https://tiswww.cwru.edu/php/chet/readline -readline mono ${READLINE}/readline.html - rluserman mono ${READLINE}/rluserman.html - history mono ${READLINE}/history.html +readline mono ${READLINE}/readline.html + rluserman mono ${READLINE}/rluserman.html + history mono ${READLINE}/history.html -recode mono http://recode.progiciels-bpi.ca/manual/index.html +# no manual for Recode found. Most recent fork seems to be at +# https://github.com/rrthomas/recode/ recutils mono ${GS}/recutils/manual/recutils.html recutils node ${GS}/recutils/manual/html_node/ @@ -659,10 +650,14 @@ screen node ${GS}/screen/manual/html_node/ sed mono ${GS}/sed/manual/sed.html sed node ${GS}/sed/manual/html_node/ -sharutils mono ${GS}/sharutils/manual/html_mono/sharutils.html +sharutils mono ${GS}/sharutils/manual/sharutils.html sharutils chapter ${GS}/sharutils/manual/html_chapter/ sharutils node ${GS}/sharutils/manual/html_node/ +# replaces dmd +shepherd mono ${GS}/shepherd/manual/shepherd.html +shepherd node ${GS}/shepherd/manual/html_node/ + # can't use mono files since they have generic names SMALLTALK = ${GS}/smalltalk smalltalk node ${SMALLTALK}/manual/html_node/ diff --git a/systems/texlive/tlnet/tlpkg/installer/config.guess b/systems/texlive/tlnet/tlpkg/installer/config.guess index a419d8643b..980b020838 100755 --- a/systems/texlive/tlnet/tlpkg/installer/config.guess +++ b/systems/texlive/tlnet/tlpkg/installer/config.guess @@ -4,7 +4,7 @@ # shellcheck disable=SC2006,SC2268 # see below for rationale -timestamp='2022-08-01' +timestamp='2022-09-17' # This file is free software; you can redistribute it and/or modify it # under the terms of the GNU General Public License as published by @@ -966,6 +966,12 @@ EOF GNU_REL=`echo "$UNAME_RELEASE" | sed -e 's/[-(].*//'` GUESS=$UNAME_MACHINE-unknown-$GNU_SYS$GNU_REL-$LIBC ;; + x86_64:[Mm]anagarm:*:*|i?86:[Mm]anagarm:*:*) + GUESS="$UNAME_MACHINE-pc-managarm-mlibc" + ;; + *:[Mm]anagarm:*:*) + GUESS="$UNAME_MACHINE-unknown-managarm-mlibc" + ;; *:Minix:*:*) GUESS=$UNAME_MACHINE-unknown-minix ;; diff --git a/systems/texlive/tlnet/tlpkg/installer/ctan-mirrors.pl b/systems/texlive/tlnet/tlpkg/installer/ctan-mirrors.pl index db547aad88..2694c2f9f3 100644 --- a/systems/texlive/tlnet/tlpkg/installer/ctan-mirrors.pl +++ b/systems/texlive/tlnet/tlpkg/installer/ctan-mirrors.pl @@ -14,6 +14,7 @@ $mirrors = { 'https://mirrors.aliyun.com/CTAN/' => 1, 'https://mirrors.bfsu.edu.cn/CTAN/' => 1, 'https://mirrors.cloud.tencent.com/CTAN/' => 1, + 'https://mirrors.cqu.edu.cn/CTAN/' => 1, 'https://mirrors.hit.edu.cn/CTAN/' => 1, 'https://mirrors.sjtug.sjtu.edu.cn/ctan/' => 1, 'https://mirrors.sustech.edu.cn/CTAN/' => 1, @@ -45,7 +46,6 @@ $mirrors = { 'https://cran.asia/tex/' => 1, 'https://ftp.kaist.ac.kr/pub/tex-archive/' => 1, 'https://lab.uklee.pe.kr/tex-archive/' => 1, - 'https://mirror.kakao.com/CTAN/' => 1, 'https://mirror.navercorp.com/CTAN/' => 1, }, 'Singapore' => { @@ -67,7 +67,6 @@ $mirrors = { 'https://mirror.datacenter.by/pub/mirrors/CTAN/' => 1, }, 'Czech Republic' => { - 'http://ftp.cvut.cz/tex-archive/' => 1, 'https://mirrors.nic.cz/tex-archive/' => 1, }, 'Denmark' => { @@ -83,6 +82,7 @@ $mirrors = { 'https://ctan.mines-albi.fr/' => 1, 'https://ctan.tetaneutral.net/' => 1, 'https://distrib-coffee.ipsl.jussieu.fr/pub/mirrors/ctan/' => 1, + 'https://mirror.ibcp.fr/pub/CTAN/' => 1, 'https://mirrors.ircam.fr/pub/CTAN/' => 1, 'https://texlive.mycozy.space/' => 1, }, @@ -148,7 +148,6 @@ $mirrors = { 'https://ctan.ijs.si/tex-archive/' => 1, }, 'Spain' => { - 'https://ctan.fisiquimicamente.com/' => 1, 'https://ctan.javinator9889.com/' => 1, 'https://osl.ugr.es/CTAN/' => 1, }, diff --git a/systems/texlive/tlnet/tlpkg/texlive.tlpdb b/systems/texlive/tlnet/tlpkg/texlive.tlpdb index 59b9bb6536..96347bc254 100644 --- a/systems/texlive/tlnet/tlpkg/texlive.tlpdb +++ b/systems/texlive/tlnet/tlpkg/texlive.tlpdb @@ -26,11 +26,11 @@ depend container_split_src_files/1 depend frozen/0 depend minrelease/2016 depend release/2022 -depend revision/64657 +depend revision/64666 name 00texlive.image category TLCore -revision 64651 +revision 64667 shortdesc TeX Live files only in the source repository longdesc The files here are not copied by the installer and containers longdesc are not built for them; they exist only in the source @@ -1978,6 +1978,7 @@ runfiles size=12924 tlpkg/tlpsrc/gitinfo.tlpsrc tlpkg/tlpsrc/gitinfo2.tlpsrc tlpkg/tlpsrc/gitlog.tlpsrc + tlpkg/tlpsrc/gitstatus.tlpsrc tlpkg/tlpsrc/gitver.tlpsrc tlpkg/tlpsrc/globalvals.tlpsrc tlpkg/tlpsrc/glosmathtools.tlpsrc @@ -4646,7 +4647,7 @@ depend setting_available_architectures:aarch64-linux amd64-freebsd amd64-netbsd name 00texlive.installer category TLCore -revision 64645 +revision 64659 shortdesc TeX Live standalone installer package longdesc This package defines the files to go into the installer longdesc archives (install-tl-unx.tar.gz, install-tl.zip) built by the @@ -55241,7 +55242,7 @@ catalogue-version 1.3a name chemobabel category Package -revision 64444 +revision 64665 shortdesc Convert chemical structures from ChemDraw, MDL molfile or SMILES using Open Babel relocated 1 longdesc This package provides a way to convert and include chemical @@ -55252,11 +55253,11 @@ longdesc execution of the following external commands via latex longdesc -shell-escape. obabel (Open Babel) inkscape or rsvg-convert longdesc (for SVG -> PDF/EPS conversion) pdfcrop or ps2eps (optional; longdesc for cropping large margins of PDF/EPS) -containersize 3288 -containerchecksum f159b13c34af594debd04b87300da871521850775ed954fa369cd92aaf515f00d49a78d758cd348df8df5c64035026f991d4181ac3b9971cb8606209802396fa -doccontainersize 893812 -doccontainerchecksum f36ca888fc3d16657352f9d479e087cca897f8f66a50d49b0b112913a1db9cba299fe11f0bf381b1a4f9f096a54308f7eb401a080ccb08c87ddde695fb473ba0 -docfiles size=392 +containersize 4304 +containerchecksum 4512137d44b235974f10bc8afcff09ff30b8f912ee91ff11c9e3cb70b95e282c4de48901c4674bd48ae867e2b11cc98fd612ae376f018d88f7bfeff0cf2e8e7d +doccontainersize 914092 +doccontainerchecksum d7fae5092600a7bbbf07acbe313400ffe0d9469a4b23ac5db5ed01024cb3c96e89aed23176ec8911dec7dc33904aefdfaac205267b7d22daddfcfa0871f94564 +docfiles size=401 RELOC/doc/latex/chemobabel/LICENSE RELOC/doc/latex/chemobabel/README.md details="Readme" RELOC/doc/latex/chemobabel/chemobabel-en.pdf details="Package documentation (English)" language="en" @@ -55268,12 +55269,12 @@ docfiles size=392 RELOC/doc/latex/chemobabel/example-ja.pdf RELOC/doc/latex/chemobabel/example-ja.tex RELOC/doc/latex/chemobabel/images-for-doc.tar.gz -srccontainersize 15152 -srccontainerchecksum 52dbb8061770b9168981ac5828f3f3d7f45cbe896802a209f0d69cc1886ce0c616c3cd636cac413f6ba5c0a40da95e57e515ee35d54758eaa7afc876f6b390b5 +srccontainersize 15364 +srccontainerchecksum 7c328a3596944cd4fd39c4c25eb0b653d681cc6d4144bf34bc87c1a698e2c9db796086c7fd6e0543554a5ae40e3f7186b00e7dbb497d3b659557e5f6b5bb5646 srcfiles size=14 RELOC/source/latex/chemobabel/chemobabel.dtx RELOC/source/latex/chemobabel/chemobabel.ins -runfiles size=3 +runfiles size=4 RELOC/tex/latex/chemobabel/chemobabel.sty catalogue-contact-repository https://github.com/aminophen/chemobabel catalogue-ctan /graphics/chemobabel @@ -69584,7 +69585,7 @@ containerchecksum c73220abd1545907a1d8de37cb534d2c6bd2534f1b55f03c069f39f535c326 name collection-latexextra category Collection -revision 64639 +revision 64662 shortdesc LaTeX additional packages relocated 1 longdesc A very large collection of add-on packages for LaTeX. @@ -70162,6 +70163,7 @@ depend gitfile-info depend gitinfo depend gitinfo2 depend gitlog +depend gitstatus depend gitver depend globalvals depend gloss @@ -71053,8 +71055,8 @@ depend zref-clever depend zref-vario depend zwgetfdate depend zwpagelayout -containersize 6776 -containerchecksum 743b6d9aad158805ba706cef7166b5b3b1842e0ee58ce518a400da2902548b6f279784429344d0367c76885906c37827a26eb469b0f227fa7d788877e6490949 +containersize 6780 +containerchecksum 1144b3f75484e085644b9830288e8eaa7a677f8d0625484fbdeecce067bd49f6655e12d3ce6ce64459d80aa676f83246679d03186fd3d3bf1b48916ffe76d710 name collection-latexrecommended category Collection @@ -133662,6 +133664,40 @@ catalogue-license lppl1.3 catalogue-topics version-control doc-mgmt catalogue-version 0.0.beta +name gitstatus +category Package +revision 64662 +shortdesc Include Git information in the document as watermark or via variables +relocated 1 +longdesc If your LaTeX-document is version-controlled with git, you +longdesc might encounter situations, where you want to include some +longdesc information of your git-repository into your LaTeX-document- +longdesc e.g. to keep track on who gave you feedback on which version of +longdesc your document. This git-information can be included on every +longdesc page by a watermark or (for custom needs) via provided +longdesc variables. +containersize 1544 +containerchecksum 153b9df6e1629d42a1c96a4f6c4c25dbe180db8976a102d633cd54ac36b75c1650328f8c5039ebb10c7927f7d6717a9260f39b7de6c0f9f9f37fb6fcfa9dffad +doccontainersize 290508 +doccontainerchecksum e7741e738bafe379f71bd77aaa9b2a33c26b5da13f659181eddab01fcf8209ffbd0604d0b374368b7d814ca9608503f9e4004730871845e8f7b491e40bcb79f3 +docfiles size=77 + RELOC/doc/latex/gitstatus/LICENSE + RELOC/doc/latex/gitstatus/README.md details="Readme" + RELOC/doc/latex/gitstatus/example.tex + RELOC/doc/latex/gitstatus/gitstatus.pdf details="Package documentation" +srccontainersize 2624 +srccontainerchecksum 23ab1b1fe293fc842eb9ed3306e2b70d2fae8ba62178b64b29872f933bdd8f80b0991358fbd6aadfa194185790632acf2ec5249ef2fa9d490913072ba1b0660a +srcfiles size=3 + RELOC/source/latex/gitstatus/gitstatus.dtx + RELOC/source/latex/gitstatus/gitstatus.ins +runfiles size=1 + RELOC/tex/latex/gitstatus/gitstatus.sty +catalogue-contact-home https://github.com/mgrub/gitstatus +catalogue-ctan /macros/latex/contrib/gitstatus +catalogue-license lppl1.3 +catalogue-topics decoration watermark +catalogue-version 1.1 + name gitver category Package revision 63920 @@ -145953,7 +145989,7 @@ catalogue-version 1.0.0 name iexec category Package -revision 64575 +revision 64663 shortdesc Execute shell commands and input their output relocated 1 longdesc With the help of the \iexec command, you can execute a shell @@ -145962,17 +145998,17 @@ longdesc package also lets you use any special symbols inside your longdesc command. depend tools depend xkeyval -containersize 1864 -containerchecksum 84835e195d4d7c4637fbf63bc23f66efdc1d9aa0f274ab7846c583b04b5ea89ca6b6de1ffccc2405e0dc03c8fa6ed8cae549a7d8c8a7aee93a0fde877f0540b1 -doccontainersize 284432 -doccontainerchecksum ff0f832308fbef4dfe40a48dc120a7808ecafba8094ccb81320dc246fad85e63e4bf58b3ccdf71110c762ee3435f71cad5228667c3d41a4c69a5b29f33560e17 -docfiles size=73 +containersize 2116 +containerchecksum 1283e4f6563ddd0bd69a726e368bd348ac8d7e554f4563ff912b2bccea00f3f0d213e985a6c76178aeaf132d5f1f9b1c0049d62bdcd4a6017fb6eabd1fdc74b4 +doccontainersize 294484 +doccontainerchecksum 78b2eeed7f402d70118930462d82d41ca3eac0c864fc37f9c77b7d333c6d748607f1ffdf21a02daeb02123e0bb8b9bea6d026b1ae21cbb030969f92b071f4b80 +docfiles size=75 RELOC/doc/latex/iexec/DEPENDS.txt RELOC/doc/latex/iexec/LICENSE.txt RELOC/doc/latex/iexec/README.md details="Readme" RELOC/doc/latex/iexec/iexec.pdf details="Package documentation" -srccontainersize 3964 -srccontainerchecksum 9f51413dda2457db17a97e771ad47c0099275eba49e7c3ec67a456ad2af67a49ecd2c05f65e0468ad3a62c16fd14228ff91415956cfc64227940e0518f2e3fef +srccontainersize 4388 +srccontainerchecksum e48afbd9b17d15c2d7e168200521cd501e34593706191605d33418a208015ff9d460ad9f6550ef27c233f73e33ccd95b3111bac4c65f6ad4aaab1084f53d8caa srcfiles size=4 RELOC/source/latex/iexec/iexec.dtx RELOC/source/latex/iexec/iexec.ins @@ -145983,7 +146019,7 @@ catalogue-contact-repository https://github.com/yegor256/iexec catalogue-ctan /macros/latex/contrib/iexec catalogue-license mit catalogue-topics sys-supp exec-foreign -catalogue-version 0.6.1 +catalogue-version 0.7.0 name ifallfalse category Package @@ -273614,17 +273650,17 @@ catalogue-topics font font-virtual font-supp-maths font-cm font-sans name sansmathfonts category Package -revision 59673 -shortdesc Correct placement of accents in sans-serif maths +revision 64661 +shortdesc Extended Computer Modern sans serif fonts relocated 1 longdesc Sans serif small caps and math fonts for use with Computer longdesc Modern. execute addMap sansmathfonts.map -containersize 4275628 -containerchecksum d94d362ac6bac44177f61d73baeb4eebff6bd1309fedf0d152b422e1b5f2bd2014c4b95876cce75033d6f6a7835c277b6e1cff2beabdd510be3e32ac7501f393 -doccontainersize 297124 -doccontainerchecksum 0aa7efe2afcf020bcb15e185fc402e6a8c65cb7c8b563217cede4ca23f58a5ce4bc3028cdc140a4d9354b62830471d8a8e49f23c8c6e48c161fe859fc60306bb -docfiles size=78 +containersize 4275704 +containerchecksum 1ef587f14a0b5d51dabacfc1717b84d221bbc3bfeca002cd58ed9c239838d888036fb26f404b5bf5d7a7fb82f70b0f5663ef06ce92059b32a67b1e0c31331e7f +doccontainersize 365128 +doccontainerchecksum de240522929a1b2942e3108c03a5523e42b0bdfd4365afabad98a22dcd73784070ba26d3a4ceb821749bd557b19b220f2785687f52ad47a502f8f67f05409839 +docfiles size=95 RELOC/doc/fonts/sansmathfonts/README.txt details="Readme" RELOC/doc/fonts/sansmathfonts/sansmathfonts.pdf details="Package documentation" RELOC/doc/fonts/sansmathfonts/sansmathfonts.tex @@ -307762,7 +307798,7 @@ docfiles size=376 name texlive-scripts category TLCore -revision 64645 +revision 64659 shortdesc TeX Live infrastructure programs longdesc Includes install-tl, tl-portable, rungs, etc.; not needed for longdesc tlmgr to run but still ours. Not included in tlcritical. @@ -307770,11 +307806,11 @@ depend texlive-scripts.ARCH depend texlive.infra execute addMap mathpple.map postaction shortcut type=menu name="TeX Live command-line" cmd=TEXDIR/tlpkg/installer/tl-cmd.bat -containersize 113672 -containerchecksum 34a7290a443e8a1fa4d5af62f213cc8f718625f2f3c6a48efccf1f358c08fd0df7a82814a41cfec55a59c887bf791deee80d23fbfb556c60742e37f8bb3ef1c5 -doccontainersize 421700 -doccontainerchecksum 370d216038bb97b73f89280ae41fa155098753f0e757c3a36327467917a22afd0b9d7d815fa179190cc8168957f26ba7018c0fc0c50b78db8ff30469529876c4 -docfiles size=522 +containersize 113660 +containerchecksum c834eebea252e531087c23b8979cbb0788f2602de93762268ee51e81d51972429c86c85f243b4090fad75acf9af1fcf32e8de4af252b488b1fcd824206502fa1 +doccontainersize 421840 +doccontainerchecksum b1f7d12006ba585e6a2ebb6f2f2b72134e5358363a0c4a28dd5ae013e0c88cf2beacd593e840435dcd908019f543227520fe918dc66a2fbd7cf797c3c7cc8f73 +docfiles size=523 doc.html texmf-dist/doc/man/man1/fmtutil-sys.1 texmf-dist/doc/man/man1/fmtutil-sys.man1.pdf @@ -311921,24 +311957,24 @@ catalogue-version 2021.03.01 name thalie category Package -revision 63617 +revision 64664 shortdesc Typeset drama plays relocated 1 longdesc The package provides tools to typeset drama plays. It defines longdesc commands to introduce characters' lines, to render stage longdesc directions, to divide a play into acts and scenes and to build longdesc the dramatis personae automatically. -containersize 5156 -containerchecksum 4a4e46ed88a663b5cec1d672e324123e5ad42abe6b67f08f422cddb9bfedf852e64d76c11e1692f3b068403221a6d28ac9aa2092ecaf7c5e8b23dddba28be87d -doccontainersize 470844 -doccontainerchecksum 9d3ff6e33b98a94ce862f8e98647ba466e881efa058184b013098d9d951fff95badd8cbb587bb33cf9e380e77a5e489bee453ef21258c5751d45089f4bbfd9f9 -docfiles size=124 +containersize 5160 +containerchecksum ae2eed7a28642c568d213dbe2153c2b03bed85116fa80c3fd55ed7518b6a1c3bfe9c908cc3ac28dc8452cd502e0640cd570a0db55b345e49942628e675e24b0c +doccontainersize 479556 +doccontainerchecksum f10811532ca81ec8170c441545f86c9026f0e3f9b056582b190d7778b3a977881d1013161c7dc10c9bd9736a77062d56f6ea11b41f4f6290f3114a9e21bead4f +docfiles size=126 RELOC/doc/latex/thalie/CHANGELOG.md RELOC/doc/latex/thalie/LICENSE.txt RELOC/doc/latex/thalie/README.md details="Readme" RELOC/doc/latex/thalie/thalie.pdf details="Package documentation" -srccontainersize 20032 -srccontainerchecksum 3d79f5ce1cfbb50de169e706356eb0cdc7184ef686da2bd73a5de2a5ce26008bd73626188888ec04d575fc182e376fa3c029e5c6b06e0e41dc77f70be1b2c89e +srccontainersize 20224 +srccontainerchecksum a2b816eb9dc7077aec3c669a41a65ccdbffbbc2c4c094ead9631a0b38d0e80b3522f54a2648b847c9e88fd40d9a6ea540cf7d9ab5c494b2884ef19bde0652401 srcfiles size=21 RELOC/source/latex/thalie/thalie.dtx RELOC/source/latex/thalie/thalie.ins @@ -311951,12 +311987,11 @@ runfiles size=10 RELOC/tex/latex/thalie/thalie.sty catalogue-also drama dramatist play catalogue-contact-bugs https://framagit.org/spalax/thalie/issues -catalogue-contact-home https://framagit.org/spalax/thalie catalogue-contact-repository https://framagit.org/spalax/thalie catalogue-ctan /macros/latex/contrib/thalie catalogue-license lppl1.3 catalogue-topics drama-script -catalogue-version 0.11b +catalogue-version 0.12a name theanodidot category Package @@ -340712,7 +340747,7 @@ catalogue-version 1.0c name was category Package -revision 21439 +revision 64667 shortdesc A collection of small packages by Walter Schmidt relocated 1 longdesc A bundle of packages that arise in the author's area of @@ -340720,29 +340755,25 @@ longdesc interest: compliance of maths typesetting with ISO standards; longdesc symbols that work in both maths and text modes commas for both longdesc decimal separator and maths; and upright Greek letters in longdesc maths. -containersize 3092 -containerchecksum e3dec504da2dd28534872b4363695d797a874a0af5c2a77e6559a2765f6150cc50614b8905c90faa6fb9fd54d9634a9ddff148564904b1454f21d3fbd21918dd -doccontainersize 578872 -doccontainerchecksum 24cc3a8931fe48134810ffe626789139a821585f0d359a177c56ae5a442482fb9d36f344061128ac185469b97c4c3f440ad02ebc7135366253cd9bbcf99895bc -docfiles size=180 - RELOC/doc/latex/was/fixmath.pdf +containersize 2756 +containerchecksum a84a124286212d6950c1fae5808dd70d4127d8ae11b5ac382d1b6a1f91562e4366c0dd735a3745cd9764bf9f19a9a2da6b466859665070fe2cf97b4164c5751b +doccontainersize 467912 +doccontainerchecksum c56b3f95e9eead53f206caf964eb0e7fc2002cbd8a8000c470b3809556ff26510b96f8195cae1251c2134290990453def19e4879a256c2d0a0f48b86e6be15cc +docfiles size=142 RELOC/doc/latex/was/gensymb.pdf RELOC/doc/latex/was/icomma.pdf RELOC/doc/latex/was/readme.1st RELOC/doc/latex/was/upgreek.pdf -srccontainersize 9388 -srccontainerchecksum 507ed77f8a5a119c16fcb9478a559f516a2e612893941f8854e4945968ef5b44ccab641f1737c745b33209828a4541e3615dd46f304b5e2f5b29c5282eeeccef -srcfiles size=16 - RELOC/source/latex/was/fixmath.dtx - RELOC/source/latex/was/fixmath.ins +srccontainersize 8480 +srccontainerchecksum 0e50693596af3afa885ce4f5fe0b55db4cf08c45b9eca2ef8939cc7ea1f4376cb39e213dbe244ea13e47ccbe0e06f6e1c2a97963dfccc0d6fafdfbf903a712d0 +srcfiles size=13 RELOC/source/latex/was/gensymb.dtx RELOC/source/latex/was/gensymb.ins RELOC/source/latex/was/icomma.dtx RELOC/source/latex/was/icomma.ins RELOC/source/latex/was/upgreek.dtx RELOC/source/latex/was/upgreek.ins -runfiles size=6 - RELOC/tex/latex/was/fixmath.sty +runfiles size=5 RELOC/tex/latex/was/gensymb.sty RELOC/tex/latex/was/icomma.sty RELOC/tex/latex/was/upgreek.sty diff --git a/systems/texlive/tlnet/tlpkg/texlive.tlpdb.md5 b/systems/texlive/tlnet/tlpkg/texlive.tlpdb.md5 index de4cb5969d..e2b4c6417a 100644 --- a/systems/texlive/tlnet/tlpkg/texlive.tlpdb.md5 +++ b/systems/texlive/tlnet/tlpkg/texlive.tlpdb.md5 @@ -1 +1 @@ -1401c79b1476fe4127c9dd247d41bba4 texlive.tlpdb +fbd6d26d71e4e5ebe07d3fea507b6102 texlive.tlpdb diff --git a/systems/texlive/tlnet/tlpkg/texlive.tlpdb.sha512 b/systems/texlive/tlnet/tlpkg/texlive.tlpdb.sha512 index 43b7e328df..4ff2631c2a 100644 --- a/systems/texlive/tlnet/tlpkg/texlive.tlpdb.sha512 +++ b/systems/texlive/tlnet/tlpkg/texlive.tlpdb.sha512 @@ -1 +1 @@ -f43a65a466f2d9b00ea41e251c5f9888edca855ccaa7cdffda06ce7d21daca955c0f4a61d5445b4f01d6846cded1c3a42a14172b983777ac03726199fd1f5e7a texlive.tlpdb +aca4fa5198767a99b5edf3072f3d5370cc79323f0886eac1062a2af5419bc7b9940b3c12098c08e0dc4de8d2ed11bb4f8bab8f470b09bf32a2de2566e817c813 texlive.tlpdb diff --git a/systems/texlive/tlnet/tlpkg/texlive.tlpdb.sha512.asc b/systems/texlive/tlnet/tlpkg/texlive.tlpdb.sha512.asc index 5ece844f8c..d0f4127097 100644 --- a/systems/texlive/tlnet/tlpkg/texlive.tlpdb.sha512.asc +++ b/systems/texlive/tlnet/tlpkg/texlive.tlpdb.sha512.asc @@ -1,10 +1,10 @@ -----BEGIN PGP SIGNATURE----- -iQEcBAEBCgAGBQJjQg3eAAoJEEzhh34ZQ4xwR9gH+wS4bfFlyHacuOtQyd4TOybz -xb64pmn7CgQqH2IRmy6lTVuUr+LvV8UUH3CezkQoqy9EAXGcnGXClPcj8NDBfSR+ -O2WhOawfxnDcyb7ilDWAfoN4LX6k1kh2bShN5HT2saVbIEIzkYkK6fSOLpy0wZsW -Fs4dzZ7QOigCQ/B6/W0vPm+eOspjjF5SduRmaJuIEEklDKIwPLMFuHUcx+0XaTIL -IUvzDBmHWwiHQIsiybiUZXpa5IlmDK5w431ARatZARHc140aMK3Sf4W4Sff+U3pf -BHvp5Aajvlh9aT1/NFV7hJ0VSxyKtKTgWXirQk7pZ3bHL/n86gB2BkQ7LBIa5Pc= -=2l80 +iQEcBAEBCgAGBQJjQ18lAAoJEEzhh34ZQ4xwH7cIAKnJdQljMeFpjLz0wdftN/FR +HN0dBmNX3m7L13UoxBHCwJcBKYp/mNh7we3dJkuOY1uGXLCSXg0mR2yPvLEHOMMP +KzMlSsGBUaZndseNYRAO4ZAZ30S/1KV0u1s9dmnE8fL888FYQUvTs7gcXVish2fM +jjNSNiSlGEDRnev4W51Eh+5pLtUKSabAAQj1T2PcOV4NE5ebmxDaHUKLwt1JMG/U +YGQN4IWfmWUVfmgZ5f4yu7nq/RXSrUlLPwQWG9vjL4kijfpsN4ugNDSQI/infu+v +jzV6BbR8TFlemmMF/VpcisXkMB9jFgcNBkiA9x6NCe+mxa0BWkHuFNqkc3l1wR0= +=2DrE -----END PGP SIGNATURE----- diff --git a/systems/texlive/tlnet/tlpkg/texlive.tlpdb.xz b/systems/texlive/tlnet/tlpkg/texlive.tlpdb.xz Binary files differindex 0cfa0fd37c..0cbf09bd9c 100644 --- a/systems/texlive/tlnet/tlpkg/texlive.tlpdb.xz +++ b/systems/texlive/tlnet/tlpkg/texlive.tlpdb.xz diff --git a/systems/win32/miktex/tm/packages/next/pr.ini b/systems/win32/miktex/tm/packages/next/pr.ini index a781dbf3f8..d1132437a2 100644 --- a/systems/win32/miktex/tm/packages/next/pr.ini +++ b/systems/win32/miktex/tm/packages/next/pr.ini @@ -1,13 +1,13 @@ [repository]
-date=1665260167
+date=1665346562
lastupd=miktex-arctrl-bin-x64-2.9 miktex-asymptote-bin-x64-2.9 miktex-autosp-bin-x64-2.9 miktex-axohelp-bin-x64-2.9 miktex-bibarts-bin-x64-2.9 miktex-bibtex-bin-x64-2.9 miktex-bibtex8bit-bin-x64-2.9 miktex-bzip2-bin-x64-2.9 miktex-cairo-bin-x64-2.9 miktex-chktex-bin-x64-2.9 miktex-cjkutils-bin-x64-2.9 miktex-console-bin-x64-2.9 miktex-curl-bin-x64-2.9 miktex-cweb-bin-x64-2.9 miktex-devnag-bin-x64-2.9 miktex-doc miktex-dvicopy-bin-x64-2.9 miktex-dvipdfmx-bin-x64-2.9 miktex-dvipng-bin-x64-2.9 miktex-dvips-bin-x64-2.9
-lstdigest=326e495cc1d267ada2349dd2daa8e848
+lstdigest=6533fb6b2ccf5efdb19e34a6bca94777
numpkg=6057
relstate=next
-version=8316
+version=8317
;;;;This configuration file is signed by a MiKTeX maintainer. The signature follows.
;;;;-----BEGIN MIKTEX SIGNATURE-----
-;;;; signature/miktex: Orf4hNl/Gh6oPqbtjJddxgBhPDOi6x/Ch8lm5+rmPZvroMpaV6eXcSFT4N/otnCwFYsUIjXp/ggAA9c8Rqects4ZZgZi8rwUCw2dMQwUcpQOIe/PBH+61XrYdDTDe7Hz/5N/KyeCLccGxiryhW3UHAGMYuboXkGO+n3OXwXBz/bwLA/Gs2WJUwnfune0pdACqyVZ+EgJ4U4fWnZGsC0ZDwGNOJi8fPEPM8eIjqu7vkyZkljzn1QLNBpnGim66CYJsQWf0A7+BCgpyQrXWqD6HU6yX/Tc0X42CH4BR6qgA+2ZiKR9T9b+lmhDK3RQx73AcADRbQbKtS/k5180QtFlfA==
+;;;; signature/miktex: rG/7gM7HXiwg6NGo2UIi2uGF7VimGiKgyKk2c4NU4aWKRff3b6fV6tTRCDnU0rbrNJ75ncmcl+5wxLfcCzijOg4Hk4DTQIf49z31+69pgNTT6yEsU5vQ0/m96iz2u7Yn4XkPqckcQaaTTv4/gHc/Ccp8i5CgjhAxbU7/oRLdYDCH7/gXYEMrFeOWTPnwkyUcMrOiaOLCTVXuUpLbygMraZsiORehEeDP1ZBlWmF68nim4Mp1yG+4IX91Cn/FS+crTqXZjMRCpgozMTDBbuVuSfjjPmWdh9JB7AeITuj9elpcWmY8QbPqSA4ZwtjDUcO4BL52l7oZ7uiuYbFkmde6xQ==
;;;;-----END MIKTEX SIGNATURE-----
diff --git a/systems/win32/miktex/tm/packages/pr.ini b/systems/win32/miktex/tm/packages/pr.ini index aba6634251..85eeeb5ddc 100644 --- a/systems/win32/miktex/tm/packages/pr.ini +++ b/systems/win32/miktex/tm/packages/pr.ini @@ -1,13 +1,13 @@ [repository]
-date=1665259867
+date=1665346264
lastupd=abntexto abntexto__doc abntexto__source achemso achemso__doc achemso__source almendra almendra__doc andika andika__doc arimo arimo__doc babel babel-serbian babel-serbian__doc babel-serbian__source babel-serbianc babel-serbianc__doc babel-serbianc__source babel__doc
-lstdigest=024759d9fa4419a23b4b70bec77aa89c
+lstdigest=e9cb4a76db2b653f6aec316225ab198e
numpkg=6057
relstate=stable
-version=8316
+version=8317
;;;;This configuration file is signed by a MiKTeX maintainer. The signature follows.
;;;;-----BEGIN MIKTEX SIGNATURE-----
-;;;; signature/miktex: gZj05yUGmOsRbX8XIFMoB1OK7WCL0lZ77MpVbMvpXubT+K3Li8zV36NIf5Q4uTkD4SXbUUkWkSwBiLXTP+/kJ2Y5qy9deVQLPih8/aNS6p2OQJHo+H1RR2SNGlzyTAG1+XVOBiiWsSp3g1PshYauHYUSvlsOihr0H4D7YdtflphPdPtPngGiR6K45RVPI5QKFviNYfX020+lWU+WurLmxDEj0qzh00U5aYsutsOWHIUAu2pcmLy7hzxbWOqmhpxj7gNffCjHPcnDatlnwbh8HhHY7WugTB1hijdi4eVMexYTdaBmXoCjJS0gP8VbdzRoHroCCcLd5lLhBHKhu81y5g==
+;;;; signature/miktex: M1149Bc6fhhwdczeWSZYAOBlYAH20H0vK5WNX3+9uJ9VS7lDyg8nVa/2JgM6nbs3kLY17Bhv5Mo/n2fVw+O6jOF58voN3MFkPKBIVqEz16w8J2S6SYPit/fVkMaaJ0oFBkB5NLEvU32UglNXgXgGB5FAw1zfdhaBBlfOKvOqn5U9Qs2yKg5ULUdlhN1rCW51QZOF9wAWIbY1HNGf7+OxL5r9d0qeIy6Kva8tkojIrkSm5bHx8Rb7tyW3+Xs79dnJenBLkc5Dx8BvOW2HAVcAAFalSGyyF+cIvcEMSR/yzfQr0acd10BcRIRHJWSJJwdDKDS/M7NQs6OCQMMHvFchTg==
;;;;-----END MIKTEX SIGNATURE-----
@@ -2,4 +2,4 @@ # The source CTAN of this site's material: dante.ctan.org # The year-month-day-hour-minute of this site's material: -2022-10-09-02-02 +2022-10-10-02-02 |