summaryrefslogtreecommitdiff
path: root/info/epslatex/english/epslatex.ps
diff options
context:
space:
mode:
authorNorbert Preining <norbert@preining.info>2019-09-02 13:46:59 +0900
committerNorbert Preining <norbert@preining.info>2019-09-02 13:46:59 +0900
commite0c6872cf40896c7be36b11dcc744620f10adf1d (patch)
tree60335e10d2f4354b0674ec22d7b53f0f8abee672 /info/epslatex/english/epslatex.ps
Initial commit
Diffstat (limited to 'info/epslatex/english/epslatex.ps')
-rw-r--r--info/epslatex/english/epslatex.ps34937
1 files changed, 34937 insertions, 0 deletions
diff --git a/info/epslatex/english/epslatex.ps b/info/epslatex/english/epslatex.ps
new file mode 100644
index 0000000000..a5e49b836f
--- /dev/null
+++ b/info/epslatex/english/epslatex.ps
@@ -0,0 +1,34937 @@
+%!PS-Adobe-2.0
+%%Creator: dvips(k) 5.94b Copyright 2004 Radical Eye Software
+%%Title: epslatex.dvi
+%%CreationDate: Thu Jan 12 18:12:21 2006
+%%Pages: 124
+%%PageOrder: Ascend
+%%BoundingBox: 0 0 595 842
+%%DocumentFonts: CMR17 CMR12 CMTT12 CMR10 CMR8 CMSS10 CMTT10 CMBX10
+%%+ SFRM1095 CMCSC10 CMBX8 SFRM0900 CMR9 CMR6 CMTT9 CMBX12 CMTI12 CMMI10
+%%+ CMTI10 CMTI9 CMTI8 CMSSBX10 CMSS9 CMITT10 SFTT1095 CMMI12 CMSY10
+%%+ CMSY9 CMMI9 CMSSI10 CMSL10 CMEX10 CMSS8 CMSL12 LCIRCLE10 LCIRCLEW10
+%%DocumentPaperSizes: a4
+%%EndComments
+%DVIPSWebPage: (www.radicaleye.com)
+%DVIPSCommandLine: dvips -K0 epslatex
+%DVIPSParameters: dpi=600
+%DVIPSSource: TeX output 2006.01.12:1812
+%%BeginProcSet: tex.pro 0 0
+%!
+/TeXDict 300 dict def TeXDict begin/N{def}def/B{bind def}N/S{exch}N/X{S
+N}B/A{dup}B/TR{translate}N/isls false N/vsize 11 72 mul N/hsize 8.5 72
+mul N/landplus90{false}def/@rigin{isls{[0 landplus90{1 -1}{-1 1}ifelse 0
+0 0]concat}if 72 Resolution div 72 VResolution div neg scale isls{
+landplus90{VResolution 72 div vsize mul 0 exch}{Resolution -72 div hsize
+mul 0}ifelse TR}if Resolution VResolution vsize -72 div 1 add mul TR[
+matrix currentmatrix{A A round sub abs 0.00001 lt{round}if}forall round
+exch round exch]setmatrix}N/@landscape{/isls true N}B/@manualfeed{
+statusdict/manualfeed true put}B/@copies{/#copies X}B/FMat[1 0 0 -1 0 0]
+N/FBB[0 0 0 0]N/nn 0 N/IEn 0 N/ctr 0 N/df-tail{/nn 8 dict N nn begin
+/FontType 3 N/FontMatrix fntrx N/FontBBox FBB N string/base X array
+/BitMaps X/BuildChar{CharBuilder}N/Encoding IEn N end A{/foo setfont}2
+array copy cvx N load 0 nn put/ctr 0 N[}B/sf 0 N/df{/sf 1 N/fntrx FMat N
+df-tail}B/dfs{div/sf X/fntrx[sf 0 0 sf neg 0 0]N df-tail}B/E{pop nn A
+definefont setfont}B/Cw{Cd A length 5 sub get}B/Ch{Cd A length 4 sub get
+}B/Cx{128 Cd A length 3 sub get sub}B/Cy{Cd A length 2 sub get 127 sub}
+B/Cdx{Cd A length 1 sub get}B/Ci{Cd A type/stringtype ne{ctr get/ctr ctr
+1 add N}if}B/CharBuilder{save 3 1 roll S A/base get 2 index get S
+/BitMaps get S get/Cd X pop/ctr 0 N Cdx 0 Cx Cy Ch sub Cx Cw add Cy
+setcachedevice Cw Ch true[1 0 0 -1 -.1 Cx sub Cy .1 sub]{Ci}imagemask
+restore}B/D{/cc X A type/stringtype ne{]}if nn/base get cc ctr put nn
+/BitMaps get S ctr S sf 1 ne{A A length 1 sub A 2 index S get sf div put
+}if put/ctr ctr 1 add N}B/I{cc 1 add D}B/bop{userdict/bop-hook known{
+bop-hook}if/SI save N @rigin 0 0 moveto/V matrix currentmatrix A 1 get A
+mul exch 0 get A mul add .99 lt{/QV}{/RV}ifelse load def pop pop}N/eop{
+SI restore userdict/eop-hook known{eop-hook}if showpage}N/@start{
+userdict/start-hook known{start-hook}if pop/VResolution X/Resolution X
+1000 div/DVImag X/IEn 256 array N 2 string 0 1 255{IEn S A 360 add 36 4
+index cvrs cvn put}for pop 65781.76 div/vsize X 65781.76 div/hsize X}N
+/p{show}N/RMat[1 0 0 -1 0 0]N/BDot 260 string N/Rx 0 N/Ry 0 N/V{}B/RV/v{
+/Ry X/Rx X V}B statusdict begin/product where{pop false[(Display)(NeXT)
+(LaserWriter 16/600)]{A length product length le{A length product exch 0
+exch getinterval eq{pop true exit}if}{pop}ifelse}forall}{false}ifelse
+end{{gsave TR -.1 .1 TR 1 1 scale Rx Ry false RMat{BDot}imagemask
+grestore}}{{gsave TR -.1 .1 TR Rx Ry scale 1 1 false RMat{BDot}
+imagemask grestore}}ifelse B/QV{gsave newpath transform round exch round
+exch itransform moveto Rx 0 rlineto 0 Ry neg rlineto Rx neg 0 rlineto
+fill grestore}B/a{moveto}B/delta 0 N/tail{A/delta X 0 rmoveto}B/M{S p
+delta add tail}B/b{S p tail}B/c{-4 M}B/d{-3 M}B/e{-2 M}B/f{-1 M}B/g{0 M}
+B/h{1 M}B/i{2 M}B/j{3 M}B/k{4 M}B/w{0 rmoveto}B/l{p -4 w}B/m{p -3 w}B/n{
+p -2 w}B/o{p -1 w}B/q{p 1 w}B/r{p 2 w}B/s{p 3 w}B/t{p 4 w}B/x{0 S
+rmoveto}B/y{3 2 roll p a}B/bos{/SS save N}B/eos{SS restore}B end
+
+%%EndProcSet
+%%BeginProcSet: cm-super-ts1.enc 0 0
+% This file is generated from `TS1uni.map' and `glyphlist.txt', `gl-other.txt'
+/TS1Encoding [
+% 0x00
+/Grave
+/Acute
+/Circumflex % ?
+/Tilde % ?
+/Dieresis
+/Hungarumlaut
+/Ring % ?
+/Caron
+/Breve % ?
+/Macron
+/Dotaccent % ?
+/cedilla
+/ogonek
+/quotesinglbase.ts1
+/.notdef
+/.notdef
+% 0x10
+/.notdef
+/.notdef
+/quotedblbase.ts1
+/.notdef
+/.notdef
+/twelveudash % ?
+/threequartersemdash
+/afii61664.cap % ?
+/arrowleft
+/arrowright
+/tieaccentlowercase % ?
+/tieaccentcapital % ?
+/tieaccentlowercase.new % ?
+/tieaccentcapital.new % ?
+/.notdef
+/afii61664.asc % ?
+% 0x20
+/uni2422
+/.notdef
+/.notdef
+/.notdef
+/dollar
+/.notdef
+/.notdef
+/quotesingle
+/.notdef
+/.notdef
+/asteriskmath
+/.notdef
+/comma
+/hyphendbl % ?
+/period
+/fraction
+% 0x30
+/zerooldstyle
+/oneoldstyle
+/twooldstyle
+/threeoldstyle
+/fouroldstyle
+/fiveoldstyle
+/sixoldstyle
+/sevenoldstyle
+/eightoldstyle
+/nineoldstyle
+/.notdef
+/.notdef
+/angleleft
+/minus
+/angleright
+/.notdef
+% 0x40
+/.notdef
+/.notdef
+/.notdef
+/.notdef
+/.notdef
+/.notdef
+/.notdef
+/.notdef
+/.notdef
+/.notdef
+/.notdef
+/.notdef
+/.notdef
+/uni2127
+/.notdef
+/circle
+% 0x50
+/.notdef
+/.notdef
+/.notdef
+/.notdef
+/.notdef
+/.notdef
+/.notdef
+/Omega
+/.notdef
+/.notdef
+/.notdef
+/uni301A
+/.notdef
+/uni301B
+/arrowup
+/arrowdown
+% 0x60
+/grave.ts1
+/.notdef
+/born % ?
+/divorced % ?
+/died % ?
+/.notdef
+/.notdef
+/.notdef
+/.notdef
+/.notdef
+/.notdef
+/.notdef
+/leaf % ?
+/married % ?
+/musicalnote
+/.notdef
+% 0x70
+/.notdef
+/.notdef
+/.notdef
+/.notdef
+/.notdef
+/.notdef
+/.notdef
+/.notdef
+/.notdef
+/.notdef
+/.notdef
+/.notdef
+/.notdef
+/.notdef
+/tildelow % ?
+/hyphendbl.alt % ?
+% 0x80
+/breve.ts1
+/caron.ts1
+/hungarumlaut.ts1
+/dblgrave.ts1
+/dagger
+/daggerdbl
+/uni2016
+/perthousand
+/bullet
+/uni2103
+/dollaroldstyle
+/centoldstyle
+/florin
+/colonmonetary
+/uni20A9
+/uni20A6
+% 0x90
+/guarani % ?
+/peso % ?
+/lira
+/recipe % ?
+/uni203D
+/gnaborretni % ?
+/dong
+/trademark
+/uni2031
+/paragraph.alt % ?
+/uni0E3F
+/afii61352
+/discount % ?
+/estimated
+/openbullet
+/uni2120
+% 0xA0
+/uni2045
+/uni2046
+/cent
+/sterling
+/currency
+/yen
+/brokenbar
+/section
+/dieresis.ts1
+/copyright
+/ordfeminine
+/copyleft % ?
+/logicalnot
+/uni2117
+/registered
+/macron.ts1
+% 0xB0
+/degree
+/plusminus
+/twosuperior
+/threesuperior
+/acute.ts1
+/mu
+/paragraph
+/periodcentered
+/uni203B
+/onesuperior
+/ordmasculine
+/radical
+/onequarter
+/onehalf
+/threequarters
+/Euro % or /Euro.alt
+% 0xC0
+/.notdef
+/.notdef
+/.notdef
+/.notdef
+/.notdef
+/.notdef
+/.notdef
+/.notdef
+/.notdef
+/.notdef
+/.notdef
+/.notdef
+/.notdef
+/.notdef
+/.notdef
+/.notdef
+% 0xD0
+/.notdef
+/.notdef
+/.notdef
+/.notdef
+/.notdef
+/.notdef
+/multiply
+/.notdef
+/.notdef
+/.notdef
+/.notdef
+/.notdef
+/.notdef
+/.notdef
+/.notdef
+/.notdef
+% 0xE0
+/.notdef
+/.notdef
+/.notdef
+/.notdef
+/.notdef
+/.notdef
+/.notdef
+/.notdef
+/.notdef
+/.notdef
+/.notdef
+/.notdef
+/.notdef
+/.notdef
+/.notdef
+/.notdef
+% 0xF0
+/.notdef
+/.notdef
+/.notdef
+/.notdef
+/.notdef
+/.notdef
+/divide
+/.notdef
+/.notdef
+/.notdef
+/.notdef
+/.notdef
+/.notdef
+/.notdef
+/.notdef
+/.notdef
+] def
+
+%%EndProcSet
+%%BeginProcSet: cmmi12.pfb 0 0
+%!PS-AdobeFont-1.1: CMMI12 1.100
+%%CreationDate: 1996 Jul 27 08:57:55
+
+% Copyright (C) 1997 American Mathematical Society. All Rights Reserved.
+
+11 dict begin
+/FontInfo 7 dict dup begin
+/version (1.100) readonly def
+/Notice (Copyright (C) 1997 American Mathematical Society. All Rights Reserved) readonly def
+/FullName (CMMI12) readonly def
+/FamilyName (Computer Modern) readonly def
+/Weight (Medium) readonly def
+/ItalicAngle -14.04 def
+/isFixedPitch false def
+end readonly def
+/FontName /CMMI12 def
+/PaintType 0 def
+/FontType 1 def
+/FontMatrix [0.001 0 0 0.001 0 0] readonly def
+/Encoding 256 array
+0 1 255 {1 index exch /.notdef put} for
+dup 161 /Gamma put
+dup 162 /Delta put
+dup 163 /Theta put
+dup 164 /Lambda put
+dup 165 /Xi put
+dup 166 /Pi put
+dup 167 /Sigma put
+dup 168 /Upsilon put
+dup 169 /Phi put
+dup 170 /Psi put
+dup 173 /Omega put
+dup 174 /alpha put
+dup 175 /beta put
+dup 176 /gamma put
+dup 177 /delta put
+dup 178 /epsilon1 put
+dup 179 /zeta put
+dup 180 /eta put
+dup 181 /theta put
+dup 182 /iota put
+dup 183 /kappa put
+dup 184 /lambda put
+dup 185 /mu put
+dup 186 /nu put
+dup 187 /xi put
+dup 188 /pi put
+dup 189 /rho put
+dup 190 /sigma put
+dup 191 /tau put
+dup 192 /upsilon put
+dup 193 /phi put
+dup 194 /chi put
+dup 195 /psi put
+dup 196 /tie put
+dup 0 /Gamma put
+dup 1 /Delta put
+dup 2 /Theta put
+dup 3 /Lambda put
+dup 4 /Xi put
+dup 5 /Pi put
+dup 6 /Sigma put
+dup 7 /Upsilon put
+dup 8 /Phi put
+dup 9 /Psi put
+dup 10 /Omega put
+dup 11 /alpha put
+dup 12 /beta put
+dup 13 /gamma put
+dup 14 /delta put
+dup 15 /epsilon1 put
+dup 16 /zeta put
+dup 17 /eta put
+dup 18 /theta put
+dup 19 /iota put
+dup 20 /kappa put
+dup 21 /lambda put
+dup 22 /mu put
+dup 23 /nu put
+dup 24 /xi put
+dup 25 /pi put
+dup 26 /rho put
+dup 27 /sigma put
+dup 28 /tau put
+dup 29 /upsilon put
+dup 30 /phi put
+dup 31 /chi put
+dup 32 /psi put
+dup 33 /omega put
+dup 34 /epsilon put
+dup 35 /theta1 put
+dup 36 /pi1 put
+dup 37 /rho1 put
+dup 38 /sigma1 put
+dup 39 /phi1 put
+dup 40 /arrowlefttophalf put
+dup 41 /arrowleftbothalf put
+dup 42 /arrowrighttophalf put
+dup 43 /arrowrightbothalf put
+dup 44 /arrowhookleft put
+dup 45 /arrowhookright put
+dup 46 /triangleright put
+dup 47 /triangleleft put
+dup 48 /zerooldstyle put
+dup 49 /oneoldstyle put
+dup 50 /twooldstyle put
+dup 51 /threeoldstyle put
+dup 52 /fouroldstyle put
+dup 53 /fiveoldstyle put
+dup 54 /sixoldstyle put
+dup 55 /sevenoldstyle put
+dup 56 /eightoldstyle put
+dup 57 /nineoldstyle put
+dup 58 /period put
+dup 59 /comma put
+dup 60 /less put
+dup 61 /slash put
+dup 62 /greater put
+dup 63 /star put
+dup 64 /partialdiff put
+dup 65 /A put
+dup 66 /B put
+dup 67 /C put
+dup 68 /D put
+dup 69 /E put
+dup 70 /F put
+dup 71 /G put
+dup 72 /H put
+dup 73 /I put
+dup 74 /J put
+dup 75 /K put
+dup 76 /L put
+dup 77 /M put
+dup 78 /N put
+dup 79 /O put
+dup 80 /P put
+dup 81 /Q put
+dup 82 /R put
+dup 83 /S put
+dup 84 /T put
+dup 85 /U put
+dup 86 /V put
+dup 87 /W put
+dup 88 /X put
+dup 89 /Y put
+dup 90 /Z put
+dup 91 /flat put
+dup 92 /natural put
+dup 93 /sharp put
+dup 94 /slurbelow put
+dup 95 /slurabove put
+dup 96 /lscript put
+dup 97 /a put
+dup 98 /b put
+dup 99 /c put
+dup 100 /d put
+dup 101 /e put
+dup 102 /f put
+dup 103 /g put
+dup 104 /h put
+dup 105 /i put
+dup 106 /j put
+dup 107 /k put
+dup 108 /l put
+dup 109 /m put
+dup 110 /n put
+dup 111 /o put
+dup 112 /p put
+dup 113 /q put
+dup 114 /r put
+dup 115 /s put
+dup 116 /t put
+dup 117 /u put
+dup 118 /v put
+dup 119 /w put
+dup 120 /x put
+dup 121 /y put
+dup 122 /z put
+dup 123 /dotlessi put
+dup 124 /dotlessj put
+dup 125 /weierstrass put
+dup 126 /vector put
+dup 127 /tie put
+dup 128 /psi put
+dup 160 /space put
+readonly def
+/FontBBox{-30 -250 1026 750}readonly def
+/UniqueID 5087386 def
+currentdict end
+currentfile eexec
+
+80347982AB3942D930E069A70D0D48311D725E830D1C76FBA12E12486E989C9874C2B527F092
+5722787027F44470D484262C360CDFDDDF3657533A57BB16F73048BFBBFCB73A650484015441
+FDC837ADD94AC8FBD2022E3EC8F115D4B4BB7B7F15388F22CC6198EFE768BD9FCEB3446EE4A8
+DC27D6CD152485384EF5F59381FFDA43F2D20C8FB08AA27AB2015B774DB10DACFDCD33E60F17
+8C461553146AB427BDD7DA12534BA078AD3D780414930E72218B3075925CE1192F11FC8530FC
+D5E3038E3A6A6DB2DCFBAE3B4653E7E02730314E02B54A1E296D2BEF8A79411D9225DAD7B4E6
+D6F9CF0688B69BA21193BF1495807E7BCB09B7064E91FA0DED228E4209AAE407A7AACA60B107
+6299AC4ABD23EF02F108765F0E3D91F92F3AFBFDED372FCF6E4B1416901517DA8F2FB3C9FE7A
+87BCBE6FD36CD5B5823FDB74229036A63C3346A1093E6B1036902C1BF42FC317C80ABF04020A
+47B344C36DE42F05C490A0FF44AB6D5249E9F552A8707BB7661E242644814001C8430EBD5E5F
+0B944CEB666EE64359D663E355B2F17093A964139D17287F6CA6A024767EBA4FE4873855BABE
+2F07B91560F68300B06DFE27264C163195D446980C35BCA0B48F7806626AE72636593A05BA40
+3CE1C0F8B2CEA3ECD586E90AC17D034BA4AF708304F231313459FBBBFB97D4834D0395754AB3
+F22D6495D2144087D448616FA1CE27BC50D346543287E3860D99B433624119BB9920A2113604
+C0E260FD275BA55E0FD19C83E19ADDC3BAA1F32F6B7284038845CCEE71A3311DDB17B84975F7
+A984BED7C6EC2A06E5B335A763D081C6273F86A46632FD9141A27902074FC860DF3A2EB59B89
+774C767022DBB577E30DA128BD7706A43AF886D0C256B50FA968EF06776AAC0BA5387E9011EB
+2334C1F42C090F06A1125C207EA6324E87F46414050D88004F564EA336A05016C7B7569E633F
+7B7F1428C5CC47DA7C875218D4A1044E26A472B1FB52CE63ABF9B840B8F8BA45BCCFB65367C8
+75DCBE1B0ADDEF3761E296DCDA097E86467463CB4B29CDC95ADA06A0476D0E5EF9EF7BC53AA5
+3ACEC2BC5E00D557829294914BC7F823EC0729494005A45A1E1C68077EC42CBDA7E4097E07AB
+30D8208B1DF2EBEE1E09D4EDC9035566A2B14689F0D5A5ADBA565896797AA61F06AAB496F2C0
+B8CB2B37A35889DD87803AE6795B23AF56A8942EB93AD6F76EF05B3805BF383FF4575465A842
+E8B4D5BCAE363EEACE407E5B5CE83B678A01249736ACEB146B9D4CB91B488251AB190026902B
+DAC96696DCB3B3D7ED4E8445130F4A63CF52FFE8D10402CAB38CCE75B08488074EE90A09EADD
+649D834E8019D6245D65C701571C3411079E05C2E424AC7385B659302DB5802D10F7CC8CD9F6
+EB6BE8994D4FBBEBB2CD064BF655598A1AF5CD5388A0802D8432345A57ED2C2E95492E3C4F0A
+6EE1C5D9CE849D734B572E8F1774A46336B100F563EAF84082231E6BF148AFA5945F8B51E70B
+FB79E76A4BC5D2C152B1550C6CB6538011B31D5E979F30BB95D1A6146D6434565439388FE815
+F560576B71D799F6DA1CD8A373A685278C5988DB3F0273B00248FFE450C14E2CC53A6BA589D9
+50FD2E43BEEBE4E35838349CB201DD9498050267F593D748EF30C1AD484DB11539CB706F3C65
+AFBE7778ED4470F51B026618A4A5FE1C7A9D93A5625226F4CF4DB4DF6BE1D1439003027A1CA5
+DB1D288E109690E5EF1BB3D566F3C86302CE7501F09091AABDF84B8C78F71348F36170BE65FB
+CF5161148D69EBC91D28CEE15A3B44AEC6BBC8E5D6CECB8F9A2DACD7B66804EFFF08343CD925
+A50AED2EC2C58C72FE198A93DED89695C15573BB95E4797BE8945D5DF06D1E0690E1DECB104A
+A9143111682831293FB6F9F781E9D540C5E7F25D463B7B211F3EA0642806A21EC62F52344D7D
+8BB230477D85E39A4C63D2D2200716E419E3BC78482F9005A73C767797FB938F0FB985376468
+0C984DCEFF25B10C08A5B355BFF4171B107270D868CC3578B7897B88D85115DF75D2661FC52E
+C614DB064549F7E7B7E69C93F8DF410552D18939D5CF32962EFA787949BED083525AE62E2119
+CDF12FD932F96E9D5D5FC96D51912D763974377B69785E84BF9600A6A946CA8848124CB5EF09
+2D4BB72DCA67ADF52D637B806E1FB9477E4BCB24E4780035F8A72BFBB670CB93298167CE1B3F
+3715CFBDED1546BA7F974898F03B786B6ACBC9326A85BB29604CEEFEABE9DFF2CE9CD8963B11
+04480AF7887FB85E8944357A91BCD3824DA9F5370E8ADA17BE9CF36ECFB861950F9DE73D2902
+C3FF5F8E1228E64F190F523248EBA6CF6290A278AB09F7E636012754089BD49AF82EDF9F32EE
+43320D24E393658B4238AF64E42189A11EC12E42453A6270E6D70C84CD902289335F2E9ED046
+06368B7FE951B1294A17202F6B1BF8857F4536A105D746247407D8E2EEC70C7EA5C6CDC721E2
+90A8B8D528BEC8582C35D2A6E6D30994346B5EC2477C2D0D5B97603C8C3423744D5E0C50EA75
+095594BB24B9E34C0EA2AE82D3DB11DDC45A77CEFE93C4AA6642A9C76E34F576EF71FD60F41F
+3E074E74952BC576E558036EB9892E016D3F46DA3517F884B49C3D69D0C3649C98E41FB7C830
+0B18A7148E98EA399809D8201CA9FDFAEDFC2129A232ECFA32D630477943DF448491EE685180
+82B5D1537739D91DB3DBCA594915B4255A55352C60F305ADCD9437B029660B36F214B027504B
+7C535F36DF74C5BD51E0D060CDE000BD38F60BC7E6CEBDC8C31A63062F7A39CA1CA177548156
+0AB53EDEAF31AED9C151115129B93CBE9D6834DF0DAE514726C6D0E6F4F99498EDA5C4625D02
+33235FC57436AC454D9B10A08789CE55E4D845927899388441AB73F8A94384AFE061C52B6688
+6F1F72563338A4D04114E2F357D59B68359F04823A7BCC5575453CCBA28A9C522E883627F225
+B1892DA9337C3EAF3CEBF2428E47B86766AA1EE2DF228DDDF2D1368C63D5C00971EC12ADC6FA
+3B4EC682F0B007D533BD2903282EC15E7717B99F6284E76FA24619A042574FDD792128C65EC8
+793DA8790E56D7D9E5B9CC1921F1043459BB9025CD882DDA610F7F558281C56AAF82FA978923
+6795037F2C385E11B9167812B1DA3C7322E73955E26C292F17EAD971551008DDBA460144372E
+01BEE2DCFF4BF4A24816EA4CA2FD9D903838A0CE42D8D5D6D49140CA8A33B1E9085CBE8529F5
+AC8401C4E59D28318D80655BFF40A0E3F2ED31A4304B731246BFB7D44AFDA6C2890885596CD3
+600FBCF96A95191E8C5C840F2FEBB2C9999CC0636FEE70281BA69FA70B08A92C7E1D2BBB5DC3
+A9AE2A8FDF8CABB6B2C6A92DC2E6A7EB6C5AC4CB6292FEC3260208564A0CAA8F0DB1B2AA6B5C
+FE7896EB3DFAB600CE834A60465BBA4CBF751FBB98DF440C587132294F6ED1E9E5503802BA9E
+1107340F67AC3F37F3C097742E61E0BAA5F5020A4639ABC3B07D603EDF4CC7E80DD5675AFED9
+B5DD4CCD35B299381FF7B38F413DA9CE41CFE08485BAC0993EFCD07FEA9E8C631EF2F249DBF7
+36027109E752FB25E00DBEAA0C2014C2D8C87F4B3848BDB8AA593A6B6D55CB99D304EBFE2135
+25BB3223F8366531386D7DB594683B2DAC4176929F6B39EC2EF57EF1C4E1CBA9736B73DCF25F
+DA39C525A330B58BE920654012784958D8C0A5A43CA3AAE4ECE338DB19B2704E653A26842CFD
+EE8A313475D33AFAF1270FD57B4EEFC9AC4F0BEC2CF23072E53814DBF8FAF283AA5C883DEB92
+8B86E1A3206474D5C75D30F00D50A334E69292C6E0D385641D9FF891292D815A1D365F216FE5
+F916842FB8E857E2627B09859D3203A6EBFB98B8E01ED264924B767CEBC5403ED88F382FC377
+90842A8959ABECACBDE20B97846602D65050E198BE907BED14AF76A9131D9CB460C601CA387C
+491531C23D166BF7200EBCD41ECC3FFCCE117C4EB1F05E1890645629C9767B83995458F7E14B
+623933F466944752FAC277187C4FB209C879B5EB91698949AA1E343DFF3D7B96C388DA0E3013
+A044E9D254A2691A5139B8FF7174E16822B76C39B250C28FDBAB74AF1A6A79E06EA996A4AB34
+49EA126044B3C0880C40F4CBC7ADFB73CC5AB29E7D71B73F8C4D8D9243D6F0CBDCEBA54C4593
+E48C600C3729953B2505D78177DD0C65DDFDD4BB7C6DCB2A973C99DB42513B334601BACB66D9
+2D9F0CCBA5D566A42489E9461DDD246FD15C57F9836217CC8DECDD6A95E9CB0C66ACCDA835F1
+2CA778BEC7C8B92417E0BDA48A04348229AB736DFE324B99996F80DDAC105A0F6DD69E330E9A
+8DE1CD32FB3ADB7E0570111A0D08BC9475BBAB122097740B53A360A7DC2EBDD0CD94B37BF686
+C84D1CE4F095B32E2EE46F85F44B6E3BB289401EE3BE0BBAD9A158D5B2B1D0645EDC72C8E4E9
+B620A06788A0A9FBBBE63C76E857F37ACDA79D431C31D1698D8081F833412C0162BDFB90028D
+B30E89265D8A654FF316DBE54A8F1CCA426DB4DDCBE99ED97EAE070BC24A203FEE3296C28AD3
+C89B444B3893E882A3D929F283CE822311846042111BC2CD2697E2FD93E171443CD04461EDF9
+352B2AB5657C19644AC6E66543618FFF3DE61EB932DA8992070B58D804E6BF94D316500F89F3
+122ED3996611EBE903C415744BE5477A8C4117E4F600316847BA54F193743594357CD8481301
+C8A88E6718F3E192E07E1368F5CE727C7FEA501C3AB79F83F88D87CAB2AED90F3AE9408F9253
+85C033C10B349CC339C4961430F9CCD84441FAF97DF300E7B0693C98083EEAD17D0903FCFCD4
+B461892CD7D0C8FD7DBD317DCD9C8349FBC3C70AF56FC189981F061078ADE979A7D8C96EC0D7
+96BD51E6BF7F7624C61E78EB045E87E48908A3D2F5AB35386D28E1FE52DDFAD920304060EE8E
+24421F5962A6F7FFF72A62C14CC3F4325D69BBB80F097B1B91D3578943D6A409BD3A0A72E1B9
+4A1B9A42317CC2D4F55634D8EF89D2637DD6D005B5F4DD8B143C451B1D0682F850A53FC8356F
+5B730E55E111D362F977081DFE2651D28799948454A363B626827A2679AB6C8783FB6019EB6A
+B5D567729ADC1EC50E69D482DA0D90E087C5249BC7C6C1A7D5C1A16CA7E377C04BEC0DE8C408
+08E0AA4CFE5724F650AAFEE416B7E0CE1F8520A03424A1629416CE7440A75A3928FA5A9A162B
+E53E4E58C01B97F466C0B42F573E67164A89812FE3D0D7398AEE02A2592FB12B8E8E21A91EDD
+30E04F0423700F27966D0202C330F2B92927992E5FE433FDEF2BA9B10EE22E1DA359DD3B0F51
+85237F2301AA1AB07AFA4BB389DDB9D1202BC8AFBB1AAA1D8E837D66F0AA7F5DB85E6B959270
+6D3A17F2EB9C4B96F4F3C4D891656CDB37A9AB8620533D09813A0F11F5DA5EBF19D271C5E9FE
+337D648E2F957BC8F0C150916FDEBEAB4903B861A71695C571B407E639A015EAC61627468A9B
+D5EAA936D207B24D8C4080BABA26787D70AAAFC39EF4FCF2EB8A933BE0BC303390B0C48F2B2F
+9158EBAE3D3C97686ECB9B2783784E0637BE9682E8CB3C49042DEBAC265CFB046563DE793BA8
+AD74AD18F915838B426FB64882E27263B200CBA65A4EFE9259C2D27A26FD55C2EFB45F7C3D29
+EF476DC9CB5E196EAA9E7E85E3DF2976751D570E906C26FAD06C72C99ED9040340E17500DE0D
+F396F22034E1197A79CFC44D7A7F96C87B074BA8B6DBBC50CFC6CB082D0A393A8E2BDD0C1601
+62FE5A200C4173BA464AA3ED63777577F29FE8494371579B64DA3A4983776E9F65A0783C49C4
+862EF6C708E0E4913445F696C2365F027923EC02CD6B6381628172D7A134A51A44C2E0129FA4
+7BFD89B4856E7EE723C57EDC17C2CBEA3CBDFF6833610605FD4F60E5790ADE33F42793400C02
+C30D08FCB2F83E17E2DFA084D0247336E9CECA9EA5E055CD1BD669BD1A6A722C2EA05E3A4687
+442E5BD475D7DF4531C1D6A26B407B47FEB9A36892E935A54B037BCA887CE6A1DB38B63222A4
+F32E493C992E9F41996B0B1BE3E1A11DB0B75F3E4A0B871C28ADA0BD428A83989EA05610BFF3
+61E7B9A3C9A79DE59911668E55C35D5A88D17C4A451DECE10F713C63BAF65109D6AA75BAA84C
+3B030D6648582DF7A447A6AD3B14C88A9C68EFDA278BBEC86E7722A436678528118B797E14C1
+4FD39670D78D5E7AEA9EBBD7F11F7EC716C4805289A4DA73F6A8D9A9518171CFDA5078C62257
+275E7D4994640A512D282358BCFA01BFB455F557FC4A7A14A0827FE76F0975830E2F80D1CA20
+E02291C50606EB76E3F4ACF136148F2882EEF4C28EB2A7707D4C97739B10EB907B16B36B2F22
+766DB7500E7A2BC413618009A45F3E3E9964C423564E632455D7D3CDBA22F4DCFB642CEF710D
+D219ABCDE35F82BAB6120B244BB6DA19D8833620A30630F80F77BC8835424882E2C9FA2B6245
+91B0C67C102CF79C513B350DBA95032572DA0AFD0B98615EBEA2B7F4FEAF4471E635651932A0
+11586145B59E434F98A09E12FB1E6EBFEA29A4872FF8C6CDDF091938BBCC07AE13216AEA076D
+9C4F9D22124EAD08D72ED2485B5AFCDDBBFFEA273675EECC236D14985668EC10E6FCEDCA91A7
+0E2A2555E6531DF09BBC7F82A8CE0303B79B1273A67797AC9712692D3CD63789B1F295AE6241
+2D5529D4C0B7904497B4D1507BBA5F4518264B49F9274FFEA226B736867FE02BCCCEFDE5F5BE
+A6B7B700FF2F46F1714DBA94DC38FB553DE129ED55EE9B94C05D36F9E09DDD6D792FA46D06A7
+3B0B2F2C5CAE527467A234BB72CE3E05F6769287304E1C7AB220719BBCACA7A27213688D0B3E
+1C05817C1977A2B58C1EF598A088374DD8A4D56D24C908147CD66EC69C0B7CFDDD23E55374FA
+1168B7247CB19DD94C5A31FCE4694C139CE9CCFDA56E2388D8CBF003889EADD4F053E1B3083A
+7C68652368F38BBEF23896D1B122B2EE87F94F00AB22B3500875A3B24527E837A380D96BBD59
+18564078262501F903480CFAEF224601F7A8143D9FC1D23AC1ED76E3CA4EA6E021BECBCC4169
+EBE3050980E13B30449D1892DF47D0BBFDBF846436377D2AC575EE07FFEFE4FEA2A212C78CBD
+C1F0B0CE6FDFFDDC3D31FE494DEB2A379C37F437669EC1F1EB272F81B982E2986CBCA0B2A965
+AF5028863E0F0D9BA50D520C2CCB6E6844E64147CBE7F4FDEC6041BE659FEA0438652E4BB9D5
+463388F19F3EBDE1EE1DA15344751A2B19E9B14DDEC1800702A9A0EF84FEBDD21E9DE5D6D50B
+A14383C86B69179F9BBD8ADF1829B5DF8EB13B7D9061E3DC2D0F00639B92AF612A166ED1C6B9
+2CC42FBB47FEA59CE5953ED34C87CF9AAFCF9EB955382EF6704F58092872515D63A4B2D65846
+4A59842E23F47B3876E31A2B17BBC7350AE308859F652A3AB9A0ACB88F37B815B5E0DBFFB6A6
+95DE8BBB6D5D5E9EA2A8741B1D561E4E4BAC2AD1C9CB69B36D2D24FBF18F399CC1919A6501CC
+5DDCE91F57B8AB1F134EA3481CB22AE36BF4C0EF95A6AA439E1F9C23005B8401A7D790D11B26
+1A9A456BE3D2CC5B0D701E39BA0A50185F10AE44D2F859777286104003EA3DCC87BFFEA2EC65
+E09F07D71B3A18934628C217C2B14C34330666F47004C5FB57462D4BF238FDE95CAD89F6646A
+6CE22BE01E8BA630CDDBE313A4DF6BB771D5352ED25364D81062766D695A7516C3B603F0EF9A
+78D194CC4ED49BF9FAD1DBBEFCE69F56EB63910B79A80EF6D46358E7AFCA155830D28536E127
+542F9C37D02F247346FC2E4812259383290E38D6C982A0649454AC7B396AE01A57C65D532139
+E17D8D6B06C47713E58589515EC5F40DB47E00656DD76C13EC229F75ED7962F2D7B28E33FEDE
+7CB67B8ABEDC4299C524165B3F28A3E1A6B922BD468FD1FF57C0983597307B16F763E421045E
+61D8D5A2E67DFA7D84633F0DAD76C606D901BFC9D5A22601833984A24650F478B6DE1AC903C8
+B45097627DE2CBA95CD0A2D0EC9D80274F1BE77272913405A47682531275FD509F64A9756ECF
+CE1FEA7B1EB5B613D0A24143102DFD4EECE422F65A0239577E36245BD7EB1D3021B1258A397B
+A61E94115C7FF86C336A9A9C8F44C54F0381E612D3C9D60336E733D120F482F9C05598FA8935
+CF0D400375DA9F4B59ABF635AD86C5905A5B3DFCAA59B591C8B9AD92CFEC270D512F83904853
+10FAE867952824A98312DD6BD642FF7D69A5038B4996D765AE7BAA71249815DD6D9223D696BE
+AF2542BFDFDA1EC77A1FBE30B00B10D2F9D9A2EDCD9CCEDA4D2F0485D45D551356AD911D933C
+18F607AA212BE08B92264443E5A93AEAA8DE39F8D683288A699AF5D256584D2CC3113B2AB808
+229A9837F84B8C6E224ECB66D0DB565A8C4EE455F75EF3384702B3BB43FF12DC7DE5660ADB6D
+5846E7F74833C990D84A8E32E4F4FC3E23556235599FB4E0CC2DA7E0383A3D6A1010FE79B4C5
+9F44C16AA26C13B6CBB9AA878FDA8FE04130983DB97BC2424E974AFF12904EC88A6CF1BE342A
+89EFAE736A720E89D2342B3AF0CA4250F945441292D9E02B4013C121E53F1553A173DC593D17
+A96B97C4A20E83304AAE66475848C908FC713FA29D23EBF7B922ABB2B217F877FCB199999E6D
+5D2A7462EFBA6A8FB5A1AA1829B2F1B99E75F17F768EC090CDAB200725FA84754201FD0A68D5
+00D43BDFB3398917BE43B4477267BA6DC9AD5E78C3CD8ACFE51E60FC5BBCCE675765E28DD321
+6668F93B192BAD3D53E2D0EB98D4F27DED7EE3713B2C96626D91F294282A156BD903F972FFC8
+94406BC71D5DD265B69FE2C02F78302A5A21550159EFA31391D8E210121151E9745D5CA6D0D8
+67AD8BFBCF9A9A40DA71C46B6EE6B1CFFE3C68778C96B760FEFC82652035B4818863FF131FC2
+497B2DB1BA8BF7663800A9DFE8A1E3EEBFDE4913A1069E346ED5D55115C0E323F42647ACDAC6
+83664DC38AD882DEEF01EB1B04D0086781EE9FE197C1AF0E6F6167F2B37BC84869FB82DF2E61
+4694941DBAFEE1652013759A7F3C590FE845B564706B63D404B5D8945B0A01F9B88D3A20A98D
+A3C926904C92B9EDE21B57B11F7143586BEE73499B1123BFF5F559E3CD42F52A75B887644A85
+3BA45A6045CDEB5D74FC32A66FD90E4C30161DEA1FBF7DC808C23F79CE19CC86ED8416C61104
+83753AEE1188FDA50D780F902D23E3BC0AAD486E722037EBAED8EA35FEB0D9833A5998AEB5C9
+0E61FE020E6FDBC0277DEFEF3C65C6CAB5CD9B2B88695EE3D2C69E9CB61468E59D2F7B1BCBA9
+AD278EB0F2A36F8934832AEF1F507300110B71E82F4EE7CFE3306AA856EE47081DAFCA1FDDDB
+27A16163E2B6000F54384636B807FBFDA3F70D0D8CD5BB6562361D132D1FEFCD781676E2A9FA
+1E9C7BD18BEFA58A58574BABC67F4F0F6F86A7382CE998E02A64295EAB48A337FB8362E99394
+93519DB11D41D4111DF41D683409DB1D981E903978F6465BF764121755DABEBCCF611DEE804E
+3915B9810BCFD2377C26E19219B5E09DFC9F1A7B9C27D823B10F8F3024C405DA5CA6F06492A3
+3544EE6E0090BC2F927F4B806019AD45B2D47CDBCE950C70BA3815BD5C4DEB594C71E4BEA659
+DF6F0CA4C78BBCE6658960ABB11E7FA292BB05FE91EA037BF05BF3F0F79E4FF2691C5FE9F650
+4B4D2DBC49ABA76BB332FBC667148EF3FB1014930C20FA3A55C08F073A188544BB87449359E7
+52576993DB1EAB25F28813A9FC81792149609DEBFC3BBA4349BC1870D44E448BDE003DFF9F84
+E275334E52C91366004D9605A9D0DE343D1D78A1B0B83549ED232ADA43AD4FC7D4DB01CDDD34
+6B5D75E837FE444D814C230C90FE6EDD5CE3F98DBB365F1789EF9CFC0BF0BDBFAD6FE5F86823
+1DAD2C9403728D103BD2DCBC02C9246EF14BCDE6A7C849F2E5AA5D7E529FA7E32CA5B28B2844
+A93F2884FC8D5FE905981F450C83A53803C8928F870B4FB9FF402118227E8C5CB952394388E9
+72302A1DA49D0D2C300AC8F589536E7A0115F1FFD413A243BCEE6854497B2A26B8A255176ACB
+44A7A98B6A87BA69C1597CD19C60296EE8827076A004775D069976EDA3C4AE5413DF3DA3A427
+48F6EED802B0C93BA98E4CB1647036DF08DD49637E11486030E2FEE2DD40C6B79E08960BB051
+65B9EA12B72E5DC6D94B0288F549599BF1C0BC63E7E0CB39AD5A0ED6F5BFFCEC932A05884165
+3B7C4AE87D72FCD622C35C44C49FC754438217FBAAA60BC16FC9E057025565AF67F9EAF50849
+3F72A3DBF323D1D7A6DE8AAA1AEE726BA3800A46A4198805F943035C7FBAFFA2D09790D174F4
+768054E2205045E4520F1E3758EAA353F833F82884761DB2506C24EC933811401AFC75620FA1
+38207A2B9371D4EEB5B1A6BDE6423A83447A850208FE54F05BF2D2435C20A33DF95703B9FC35
+E5AF43EB316AB76E4ED54427F3812019D707214CE633E0CE1419555CD1BDCF87F65DE2F6F443
+86533D626AFC4406881852D075F2D227C83B397BBD7CD7103B5FE9C08CAB1CA45FD07D8BACA5
+137B8C287B3BB0E607FDAAB753D204F408D8BED693F99D4E778F813DFCC269F84B0A47B1E598
+606FD58914E15826D51B01094A3560AE82E993DAB6B6CFECBC0A6989860ECE90897F3507261E
+B39F4201050F0A35E4F1AD7C97D1193BD944AC797A8C70EDAFD7F4FD035A03C1159CCC94B93B
+ACAE57FFAD2D83DE3ED3BA231805E321137725912992F870C7ADE3764AFDCB60EA19A4D9387E
+D2C45D76A4335BBA8BD87AE5C4D331EF3D6EE98598C3BCCF259886CC13064C3AA17BD63A3597
+547FCCDE53D8E1A005CBF93CBF31E77D053605DD182E53EFF89E7C16CA0B9CF7ABCA930E4D33
+CA0E1E72FDB295FD586CAB13794B30A334E4F8F844CD632882F5F6107C45296556029C0DC3A7
+395BA482AC29CF12EADCB7BBDBA81474E0D553570A0CB6D98E618ABA2EF560B0FF8F393669F0
+48C473F39A2168015D74E77D502AB53434632986CEE6DB3F375B267871D7CB01BB51A34CF66C
+C32A3817E71E4C392C07BE9264B3B1085D8C1A63C3CF73CEEFE24A4DDED7F5867F79B0A95C76
+91B7423B172CB5BA803FB5E407DFB9D5C736E604BCD86F9D9E74544A16831FD4846ED13AC8A2
+FA34995A9ED4215C59CA4D2A9AEC17B3BA91CF85978EA1255A24E40FD48DE57EF46A368BEE26
+574EDA1600B8EF817948C206F6F10BB2F4DD2E5DEEDAB1914D3F56EFC16CA9E19615D40239C9
+79CA2C99BFA3711A9849D6303E7116D96C2F2E760019000737A8E26B8E48430210FE7A2B08D1
+98A7D6EA21DB6DD184B9B8EF2133598BDB5311D7F904934AFACEB63E7BB89D9527922963FFA3
+2D87FA6B652BE94953DE83FBA87FFC013794C55890947BFC8D6B5911D4CB3F90EC0F9739C098
+A5C5B63731F2A97C921680248E4706584906733E91BF8DBDD6D3AFA269BF7A4C915ED8295966
+87F8C1847A00A7A5E9C94ED168289A835A8A318A29E988AEB62773DD2CABB9C2340EA4B191D2
+D8CE2DF301329AC6FC0D822AF0004761D695D1A94C8F2C9137D58BE9D79FB5F2F9120173AF4F
+1312C31C9A18137145F35ABE045ABB69460F2CD8402D7022C1AC112735DF89AFD79A399EB7BE
+25AAC7049BC76F3DF3EA82A671701AD2BDAE4B93DDDD8516D71E3A2201AD80767EC7642BD83F
+FE59F12CE9E9725D2F16A19514CF3C37E55D4F1B55D704100F44A7DCBB150985C0B41C5978D8
+61362D0CAE67D93852E7723CE2054CB35C8E8527B66583F5E66085D2549AD623DAA57EE4F87C
+D91166A62B7ACDC9756FAD46FEEA9DE7B9F1AA264B370931F0FCDBC0A01EE30751D35B1C9B48
+0D75B50F2D770CD53E95B33021BFB741C0F9989623B2DC26D25130276C7273595C51D45CB2A5
+88F8082FB71EAAAB2B0F4E4F109D04174F908EEB4E7514937CE4D15452E34CC1482FD01E9D76
+F48E38A106666C2C4C8EFA44F2DA41EB072328AD35E76841E9462B3FF981072D3624D128BA02
+E31E107E639FFFF66D0946941FBB8D352CE607CD22F3F47AB7D9D47E23591EB9B646431A97E0
+57ED7110B0B871723C82C72385F31EE576B2607BE8E6BD76C498EFC0F915352A7E983B895463
+1D80825E45B1B424003897885EA225822041CA50DDE48FE4D056F55E42F5553D451434654B52
+E764E05AADA718D27EE62A9690B99D34F33A3F41A68BF89057D3F0EEC777EB18B772A30E9302
+9BCE79A229F14DFF1E9B5536090DA9514F6FEAD6F6577A91A3EEB21C1B007146ABF97DA8A354
+39D02191CCBC44F74256785A7E43BDF1AAB080ABA8A6EFCDA47311F8586B57560DDB45F37129
+16B31E7D34AEA7BBB7080C7CFCAC0CA7C87C0A86B8E058885487D4799681F1E214C36CD0ED7F
+7F0B5D22A4AA5F484764A4B3927E2DBA79E5B841522A6448959A811FAEF38172D5B7656C8CD7
+5BB415870DAE6E39DDBD1D23541725E0FCCB9846ABBAE3D9522C812B83AC18ADFE7A823734BB
+BE7D225392A114AC57AC4E00C2F2F0D8D765FE59ED70A28E73DAF9DD689FCD17BFE3F966DCC0
+F5344C13E59530A0265ACA05D35B0422BB7C2899BFBF119A0A88FFC02F9678B756E13D4581D2
+83F6184085BF1C747A7104DC485FAE721315A0610B9FA9C60C7C251AE88BBB1CB92A47348CC6
+1949B8E8F8E4BC40AE27CFCDA32B5018B8F40877172E8671589E01D315242C172AA36DC33B72
+F75DE90E7474E258A08A28A9BD19443E046403A6FBAC095BE1BCC39DB87BAFF7E691B6AF2FE9
+3230A79A143092FA422D33DA2140A77401B36755C36184BE3FCBB0BFB64A77D484C074F60BD8
+5C559C11ADE1C640691140E9456149CFB924E56AD3D66435DA8A8117C69F695883AB4CFF1F81
+AA03595492FB2258CF6AEA9E03923E66B3541EAF48837AD6BEA9C87E3E2C0E595F8E49C7D13E
+C3E1905264F30801417237B595A590D1C2558F29723E3B36F8D2AB4E2D20CF3219EFD724A535
+2EA36EE67CBDCAEF7D46B01B64A4300D955223C2B33FC50D9644AE6B237BA265FAB4DBA097C4
+FEF74EC1D8BB521C51EE63FAF679D8F372D94C1F3093910B58B7B3C5A93B40A15DFABEFC734E
+E926458C5E73EC989D935EB849CE575D5A17ABBEEA8FD7B3D49F4C83DB8844FEEC2C5C60682E
+B6031570381806F2A414419B843C4E0B75CB28C491F8B60FB5B8644C1AD42D5ACCEA0147DBF3
+B1E150C46FB7B95F94C514046FE4956601DA026A52DDFA6D0113F573949FCD4F62B7A675B854
+8458B7AFBDEC22E26B8F155A5A9C31730B382846B77622AF2D4EAE72D6ECB385625F3AEEC3CC
+64E1B66AEB9B1746AD7330FCE8B307E864D19230F657C27F75CDB7812F0FD5E78A8A6F9CDC2B
+AB26EECF2D3340F9DF33A34A7B32A7A8E907DCCA44850E15F1660EE31C04A988D687146E86CB
+3A4B844345B54B72B4D062DD563E6E22BA5FDE9281F92713086EF3D1AF48D1BEBFB7B42FE26C
+6E24F30F799F28EBBC30CD85C4B3CBF12FE829F003477EAEC472062B3338503D4327B11C05C7
+A8AC2834FDC1380E10DE3F424C2058546552089B1907BF835381D2B8A2927AFA677559B14BCC
+F4C568A7BA7814B67DC37A42596CBBADEB56C2DA7EDFCDF638FE426416F0689589DB462C6A5D
+7E91CBA44238DC81634642BA73E243B713F7FD77016EB939C04D9CACED02B29114758ECA032C
+D1D30A641843A9B06DE72EEFE1368896E58732BF5B2716197D53C1DA1DAE6EC8E95BE8781E3F
+BD1DA59CAB4AF93852203AA9C93F86AAF64733AC3532CDCE6DD76F3C463BAF5DDBBD0B81D344
+5CDD95A41F605B1AF09F6444A4B67E964C2B1C7E3D4527B6A85011829CEDB1011B66308229AA
+A48654E1692CD5FBD96420A5A0A54CF5DBEB71F17F9B33E5AB1EBD059E1BD9FCD3BA4E4CD30A
+C39531441869A8589960CBECCA2171AA7BD97F273514C02F3D765434A7076D37EFD76854B253
+5AF55012BA722BF89BBC6CBF848FE74E61E712EB03CB935191121C7F45797788A01A97FE857E
+5773ED8A59D53EB491ED7CB9C8F08A44B03C0F828DA18EA302B59E821A2769C0C75FD1A1E3E1
+FDF244BDD85D64E43B9779B81C4478271FAB8AB12F9756B0BE42D5DA8E4F9723380458E873E5
+8EDF603A17816277136D8695A68D7314F3E53FE156C8D3A4F28DB1812445E67F893832498673
+BA67D28F09B4EBA6959A993EDA798FE05E46A3BA00C1A00F18C2683047EFD4255C5F2258733C
+400E8E2008F43AA140078662117B806F6A168B142757176AACFFC982EB36463FCB102E67276D
+8DB5F3A61D62D732D7EE339EA973E4448C25C88EC0FD166B9BDA5E18B9F489C85B246947E983
+095ED7D30E2E8991E173BA6B0482DED2FBB7594CEEB54140E58C34A579F3CCC46A2653199604
+A6EEDBFD6E9CDF78D8441C12F8722F10974ECBEC054509ED994BD0D6B0B3E3A0AE7418EEB9B0
+13C99F32F9DD20F08C58290FE67F6CD333D5F53CA6133FB594B51A297DF560BCBA323FA14523
+8CB47DDDE7745D419A6F42953044132978A241D8B1B548C5ECA5D1681A4A109466845BF9C130
+500592DEFF93918E93F4962354731BA9A2E537B6069C1054776F20D786078FFD8E7F0A7558EE
+D62E1C92196E80C301FADF8610D09D83EF79F5DF6B0C7E5429D0ADE1C609FF1AC8DEDEF00EA7
+FBC9D4DB5C57313BA9F9E1074E76A6AC0C0BD5CD7B423EB4A1E4895F5BB5C139E03B4D8E5B4A
+3BE9C98613891BFC0369863AF0B7A3F16C2730FB4380F6DE7EBFACF42EA816A976C72006694C
+AF0CFCBC3619E3488F4D8A930A195C891423E1620F8CECC40494E77769C70EFFB696F3439E96
+F0A7F9908402BB1D4A79E9432013F5A5954520869ABFB679606DA06969A4F995D0043E927801
+5991D1BA7691B44F2E42ABAD1BC6091AC67BD4A575289F76AAE24C910481392AC2081865D0AA
+81A737DFCC31E11F15AE2DA3F65BBAEB8365AAC2166FD30A5AED6F58604C084B7259B932994B
+85F4C43D07B8B51B97752990D04EBD4C4E43B7880ADC4158FD8E27231B26AF71C5D337803F47
+7C8F45FDFEDD5DFCA4BC02C4AA0CCE461F1C889BDA97771CC1F0AE8DA165D5F1244D364C9A92
+D6F509FBBBDA28A2FE9596A175C1017323915D753CBF4B0F916C16D28864DD8A8241991CAA5B
+231F8BEFE7D1FE1332D4BB3CD66790CDD66B0B8DBE8D7CCDB8FEBCBD3446E4AE4BCA759D8D69
+64457C5EB9136911A80022E96DD20CE7B8028215D79B831DFDA6F65537246F56AC19E9E3AFD4
+E526B59E48E51F3E9E64BD3079CD3BA7AD0018D4B6C8DF2F00319312452209947188D575EE41
+6D8F7E4B1D4ABB75D5F4CCB141624B12007D415C4D18B6A673E194DECB2BF1DFEC5A4F5CC1E9
+FC6B179A37B239FAAF9A71CEECC5C57532CF57181C1E7F375B4E18EDFEEAAAE5EA1E2D9CBF26
+D789048EB0E8A9AECAC59DE58258ADAAEC756850C12415196DBB828D7DD9F3A906FFC52DEB8D
+3B23DE786F024BD9C40F9C58BF9D6C669F43E4A9078951D4BCDDB2CF7BAD6A2BCCA47B215846
+35ECBEFA51B7A261935D17D6EBB454B48FECE0F3EA3A8FFCFB757D180781471F24DC80FB2992
+51BF6D0E41E1AEDE304943A89803736485FF808D98937A1FAB46AD17EFE94848365C0BCECBB3
+E1BAB1287E537BD166C0DCDFEE7B509A364FEB6BB3A3BA748281CB949653C676071B54690FC9
+1390AC12CEDF2B9603FC1EA902CD89ECDBD57AE164FC341DFC38F3964F15B63A5E8B666E1803
+8D6B93B7C24E65C82C9CC2A253EB9F975CFC227B6DCA80D77A473BCB812191A826B699FA28A4
+CB6758CB385D88542B64F26C01E2727D9660DC37C7A44ADBDCA9F1B0C8C76E508A87659ECEDD
+4CABED3C1DF20ED033B119DA1A91606FF725D4D73A38A8C0B44B4CC53C6A70794C22D63D7DED
+FEC693F4374766303C29128722CF195AAB86BE58A9BEF7495692FB6BC528882F63AE9FE3A153
+F23CE5F4CF0A371C102F2E980391E504837671AC7857D1AD505C29B60CB2D88A833F542FE607
+363E3125DEBA2088D697D9961B1488A22404D73049B19D90A697CE02BAF3BD2C0077A71B15C9
+6D5FA22C815DC4C25978F3873BE805F69D9D1C2B337CAC808BB1F8C32AB5085BD4959852F9F5
+7C0EA3C5E989FC483AF14F6E39354247548A09AA32D9BFDD9D9FB6DEC42242217DD73B4108C9
+D47B6D27544D3DC92E00DC5FCFFBF829466345160FB29129FB395D8EC590E0655A89C2ADD203
+4EA01AAEC90CBCA8038D2CA8B4C5F4247C918379C00C7F99620B00F54290D677CD8793ED6F2F
+B82255E970B14BF704C3EA59310E5483BA3564830CF7F4E70CE28763F78801FA8A18AE7A83D4
+9EF16EA6206AD611919F285EA4E14F223C4F40E1BAF0538980DE9D68C65E0A226E39511EF690
+61497F9805E1CCBED59AA1124FAFA8EE3DFD4FBF5F8DCB718B4AF88E1627E80D9EEDA5A8031B
+EAB89F28EECBDDDE0A85E1734EBA378C701E7AB5D802023C5A32854FD70F503A75C40650F44B
+277AD2185149CAEB51C3AD04D50BA03885D07709399147ACBE525A38925E3878366C935D9482
+A635211E3C7296B96AA447485767FDB35852D786826D3EBB9BE7BAF76A50F3CF220019A3D5A3
+5E0B54EAC1CF3876EFDDE1E218E4234016B2DBB1A70E521E9A32CA3B3DDED1AF16A673716B22
+4DADDE391C484F43B9DE6B96CBA03F03BC9A52CB2B9F56277C76A5ED5170D4895086C04B4BBE
+97CE4EF93F599B3AF0E8FFBB1EBA45A07F752FA2AE997A3D9A57664B7668141CC8213ED2F7B5
+F04D119C34FB2FADB40953DD4BA0936C2241443F6D353C7D64F723FAC645A189B789F8B18CBC
+7D4C5382423B894D08AF70298883EDA6A309251C17B67F7CC5D83A44F410A948FEA3DB610547
+AF8A28D4CD1D8E7A42BBBA7FD4610C372D1B2943ADC83E4E2C8A9BE8D5E1CF3B30137E7D38A2
+A74614CA4E2CD7DEED7AA9BF2351C4465CD0CC2F78DED6C84EE4D71F0EC53CA9B0515FE66375
+717E9AEDB2C49F19578566E4C3C95DA95E18BE73055EDF508DCF5B6A1FB414AFA486E7C4CFE8
+5DDD518B068F27ED99ECC2D690626F04A4E1A7A33AE5763955991A023B78EB2ECA41C6945245
+A48D40399AC799C8A8992EF69FE705AF9D1069A720EBE65DFDE46E1E8C599C7558FA6DCA4CFC
+EB620AD7F044DDB6E4437DE358DE669AAF3873B83DF068D187332735E3870BB95941D41CEEAC
+1972DD0E11B08CE89CB0704F64E6015265DF13AF8B43620A53D84893E9DD25F71F4380191942
+A3DFB0467835CC29A8B8C04D65BDFE9BA239BF469A3646A014E76B0D7B6AD3BB8EB80D7EF276
+BE0D8F812D3A617C920BA7FA9D0CFD1C81E4ABE831638CDD28A065331008F3C85FAAFFF57737
+D091503BF4C2932F6D40B3140312FE780DCB46A8871DD8414E5D54BB4E7C781B3BE1C35B54B3
+B12A2156B29CC5CAFEE3BF0198B2407664676410401918505BDD29B6D369D98FF18A26C78CAD
+9C6ED94F67DABB68ABB938FFA462B694070FD96627D0ADA7DC0748332ECD424FB258991CC8F0
+698DE2D8D21DBA777A8E4A63C4C6FE680E42D99678D0314E5A2BE541AB96059C194CAAC8C526
+3AB3F586E4B9D27C00AF372940C71F7B6F28366F04F0BB4195F1FC96A5D37CA226EE2E1815AF
+E24D238FA664DADC051790C3718F7B1E2CAC29413729ED3B3486B1250FB837EB2383D7205E42
+249BA65165812181BECC4B6BFF113098E507B2E0E163605ED91FD4298728512EF81A91E2D31C
+17EE6FB7A38E6DE02601572BEBA27ECA7DB2561CB555D0299505980EE1BA0ACB2CD0F549A253
+C0042B0ABFE55D8FFFCA5473E169995C76CCA4D78802932A1F56B0EEC11FB04C65F350C1A1D8
+7207D43F173FE0F3224AA99BC75564D72C8EF325F37133EF2D989F6A93340ADEC5EDA5D7438C
+2FE1885C69B01463B3EDD534871C0760DFCA487A2A8AAF24FAA9744B273BAAC1FA8283601964
+75F67B7F91C1D78C58FA0A60F07B69F57CCC0EB097C7F533AD5A9D962DF80AB3A54EBA2B5444
+5F7A70D2DAAF9110165A52D5777D20B4FEFA3F686558F146BEB33A4F5623407028A3E5E6F9A4
+FCBA726423EAE9362EDF2C3F5292C0F2B795BFF8B2F94E52E7F110B805875A32CED3A5F572F8
+92FD981036A6FD652914D776FCA43C7799532794346D19A452B935B8B06B1380E1203A64FE53
+ED7744C2A6A863376A67204A29922868B3B2E3CFF62F72C22A60D2ECF4F8714260BB106454D3
+86404F3CDC03BB4DC0F0ABA36440BCC98CE2F5617E38519EEF3C9B2C430A1F8AC9DDE867EE66
+B2ECC80B3B73288490825C6CA91637A6FF06DCFCB31434309A55D62F1A030DA9BB75494E2669
+F9DF957BEDE2296AB61EB70F3191E9315A6A6832D271C4867BF19AC92E262A32CB690159B237
+989BD66C205601F106BE4DFE3687318FFFA635FB8C540B439A939C96647497E49E7CE8F05492
+CE6D3DC037A7420D37905F59035940D212F43983E14624E4BFC180F247F42727FCBB199D067C
+0C9E1E9EDAB62FB5F94922A0BADFD7A83FAC18E62DA9AA6EB5AAFC890EDC9DB8B0115CDCDF4F
+AB34BA416524AFE52055987BC6C4B0412346FD34FF47CFB7FDCAFDD834CC20D60E6D9749E051
+6D466D48C02FB8000186D057D06800461DE8847A1E91C54CAC011B8BEC1F6E6EF93B78A3B6B1
+CB6161869A66E3C79F7D640BA2A3F9EA1C177E4CE9F06AC82F8044DC37407C9876F3171A9A4B
+0FC412481B119E07D299C39040299F921DA197C7EFC2E950C1E01CBBA30AB7E85CA275F0AB6B
+601E7CA2FEBA664388F2F621F7934F1F8E1461B8C62290EAD4F240B77BA8DBD4705A6A0D5EF6
+A7A2006950BEA0EE3AE5935D685D13D752CB9E90593A09B285F3D05E9B1A2CE7DAC25E800EC7
+5EABF0F3D0B18758B01B6E7766DFA8A2ACB7CA64EFF9B42CF7FF05C7699A4C2A21870C24154F
+DBB17569DCCB80A46F49E9AA0A3CADD76B8B91FC1ED92BAF2B2731B1B6EEC11A3E4C25AEFF80
+420B6563220ACF67E9300338CE73EC10691ED248A0BF68C542D8F0A10E4A7FE8D0F87F837385
+A01B8ECB255778EBEEEA80F5EC231AD83EAE0B42DD2DDDBECE2EADBBB23BCE762F6046162BFF
+2B31AD5706ED0AFC0CFBF544E5BA6A3AEC0E1B1A3A3DD8EC92438FA7B66E2F636276325317F8
+D07461E29702FA530B9D872884A59770E91C3648727C48C014DC6ACF5CAF29C8C51458E48D75
+B11FDE9442737CC49022E9C480B374D73AD2BB80D2E0DA1D27B523AB400D3E71E128FB2767B2
+AFD6CC169B431E7EEF34F531E133275509E0B26E86BE9D352E953D677843CC691948F72A6DF8
+DA2A86ACB3056CA1687944DF70D56A6851C48B97769A23786FD2238F20C40214AEBDB28FC280
+E21464B562DEBFAD67C19FE6453B5C68B46E6E30E584BE3D14B52F929EFB458A3EEF2CE19F9B
+46EEEFFC431DBA2C2439B76F50FC06FC78721430E0D5396081DE648772E33BADD4F610A69D0B
+C1C668EBBAF72F8EA0BD00026345F4FDC968E5875EB432E55FC577A4B7BA63EC22F29CF3F769
+DDF52BFCC25773274E73278BB043B9E455493F061714483BE31DB24742FF79A16D3EDD938810
+9174CAAD33734080C68F07CCC9C6D02A25FB2BE71DF035B2C34233E29DF1C2B662879FAFA519
+9D1213904AA0D636517495FF44C668631C963C573A62A655D8885E7C204C50633E753B22A507
+9408624EE8E5CD8AA7233FB1C0B7A9F5815B0FC4DA9690DEBF4B62B4A8C8D3B1A73F7900A197
+9CFF959D1458FB70330784F7CE6C89C1BF7A2E3A526B2BB0CF629070587E923437C8AD6B2087
+023B053E550B96F4E4CFEBA86228D4758C3D92AD83B92BFF979B6500A1A9790A43AEB39F8929
+26ADA055A2A606F623A9DAB347C8C40EFC651C641F0BF8C3909F1FD57AF97683926251E5D1BE
+9ACF6DB22CC8CB3C64411B3D4AE2A238041094F0F6E57CBD019E5F6B570CA3BB75EDA7F1B7F1
+5167EA330C6408986712E5FC2250F337531020CFFBDC9AE8068EADC5DE84C58A836AEBA5B72F
+E723C6080963FB68A7C35A9F74D49CC0FFB493C372D2C2EB8369A16F6105B0CC6D583FB16AED
+9A549242FED2E1A05C9A0805072D30090BC73D0118AC4060B4521B203735A1322F188496C731
+3B695B76DAB8A9B367EDA4AA9EEEB88C2A70A32077DBF3558A3C17D9AD2E16027C6CFF034C9D
+0D3C5C79B51A58F292C5491B920B52C20E52503A648089FA45881CD62C2C879257BCB3A0D641
+6C90C7FB68E3A09966EE72EFE495370FFD97027367190A4652FF3E5C0BC13CFCD9CDA202EFD5
+3AB998FD8C43444B4A9076B1D6AEEA18AE71DE2CA91FC127ABA54FB425C2884C085CF4E200C9
+F71E971B6647889296F13E3AA3BECE4CC5E961D26E6119E653C82D42F4E2C236A945605C1707
+F898908C2EA375F3A9679572145A46D042B993BA5EA446D643EAA1951A0F3612F356FEF1900E
+F5F5D6403F8026DBAE83C3954861712A65D1FA16DC6CADA9768017F9F3ECF2E3E2D8A7627CB6
+CE22AACDBBF63C1B9E46E9A3E89099AD74AD15FD9E1A877C492E53D78B087C7665A61DE06CA9
+3523B2A1187C67627A672B5D912D6CD0ABB9957030023844481E0D2C5BBA533FB353A38154E8
+6D946CCECAC4196DD1B5B92BF12A2C300D1BF5720605E2699135EA920DC598817A17469E06A2
+2E83963E63BC14E73F44DD19206CF5993F9C4C843445591736FFBADA86DDCD378231FC0299C3
+3507750B7E72B4C704721FEFFBA0DA4B0C4BB998E747B12555C4FC2B023FBE7BC88441711217
+D0667A54F6313D5384403F1E7FDAEDC6E124ED95A4CBAA5596B0F83B933D9EAE4BE1F16D6017
+02477D3D37149BE811C05255FA058535C7D3C30943556EF80F701C8BDAFCDCEF9E520F94A2F9
+2E4220C302B9D73090D3C0C76EF28BA3ADC22A409AF12BB9CF3BCA5240CA3D0E01DCFC9C0077
+78CD0C08AB2D980910D8FD8D9B6135AECB85E7E3D9DFF94CA9D35FDE86FDF4324B64C8DCFC26
+C45C3FD1821951D1F718196A6F04D3453C04BA54DA87A3372C916A062DB9367B2230A6078387
+8D0A6500E0F970BD635B271D593F5CA3062DFECA8D84C6C3484D6C81C328058125E7A1E6ECF0
+65D23D6DD253AF681F9F65EA166D0081E9E246977EDD32343B709ADC09E59F4D7679010618A8
+7D2E57B588A8F7A2B9CBC564116E89C5D4665992039B1058B0BF6C6CF242D0BCC114E00272DE
+5102DAC8818C2AC9395AE5A2D5EB6B5475330B512A867AB70F5E4DBA6377BE976F8D871C597C
+D686AE04F8915F5F80BFD24350C5AD541E7CF5DD63487CA0774C7FC32CDB31D0AA04600267C0
+D04B36A37EEF5191CB3BF7F9522880C29C6F3EAF0367D755AF1C225E5E9F50F92538B2FD1DD9
+890813676800BA9D5C8D0E70B12E37E12D7F29BEBD4F064746E35C4CE9F7D1561A4B8C06CDA6
+D2E9B54ED377D9E0A6221CC68A9DBF62F39330CA8733FB17D13C091C15BFDEC842957E797B4E
+75CB7854EDD3828685CF9E07DB73BBF90218E81B1D762FAFC02B8321B1FDF13B9BF7CF0D271E
+974DB4CE5C4A4C62920DCFAFA4F94E39989E95BE3099529024F56586810D15E3A87FBE974B40
+B2A3745869B05EE5DCCC67B609DCFECC5BE2CF76B0EA694AD9A96059545628497EBD8912B3C4
+7EF28D8B6B416B4CEDF00363B7EBA4162FCB83D374507B12BBE968139E81D573DC13F231F09D
+88105E74DF38D8D554D8582534DD2DB85CC9A9DCDF50F22CB355826DEE570808F83D0EB4E12E
+2A852591D2DC7AD3FD27CFC9F07E62CE81D1822ADEE41E079D50B56E4833E440E81D834F8911
+D0A280FC151FF2C4DB4712B02E21BD8367E235E6E7068DCCC01107BE26779B29EAC37C4CF88A
+ED153AF4B49DFA66AA329FADEB5616AA95C088C67E8B036472234454499F6B501017CC7C93BF
+5DE2B77C10DC1A71AF3A87B5621CD3B4B8B1ED8B0795B4AB99DB0D27EC028FFE4A3028928646
+7512D7484970754C3704C4F257855A61909FD4CB7332E4AD6DFCF9A974D90B97881F4E70E123
+CF1E667671E84AFC65BD589F2A1AF684DDA0170CC1FD0F5516D1473A108B99278E809CBD4298
+0451F32EB59E50733B28A8A4E041BD3737FCD25F4DD714CA4C2DB68779F98BEA34C3FDE2306F
+21DE98FFA7A1527FA7617C0686C80538E4AC46BCE0B3E7D8729A0B8857E013D1505B2A55D035
+218760542026294442952C03665CAB32CB9322D6C79CD4FCDD6D31730BDE2975BE9D2783A4FC
+D3F2C6DBF54A826C909B40348640BB25EDE171ECE465C1D7B6C6D17C2DAB439EFE8CAFFAB89B
+89F8F53066F767EE18255E5774F88B154A43A968073FD1FB64AAC49518160C0B05B2262D2C99
+8E2CA2CEB4A294C50F943E853183304B358049AF56574CB2FBE28B0AC1E8DD780C913745A56F
+448B355180389A0A9A62F626DB7D38C8A539699919CE67399B1BFC15DF29D2D8AA50E0D44644
+41E92B842C366BEFACDA602B4B759DBF677EFD370FCBD578C52073D18219515D624C2C63D4AC
+C9F73966FFD4C8B3475823A0C3B97D583AD5CF4DBD4AEE999CA42D537F85F65DA7B0D876B563
+6A2A4D13D77455E822DB8F88743389648277E646849723C550189AD6CF2FF4533E4D33114582
+CD51BC59D174E65142FF14FEBE70D5518A00491AB48B748AC0AE6936F4553C20EE2F6D209C88
+74AB668C7033F1E1C8254250E3B4DF1EDCF3EC7B6D075F8C70A8B72F948390F72AD35AD08A61
+BD812BDCCF2491120D4D965B537FBC6B99D050CC8B1DAD9677D08884097DB2271FD2CC8774A5
+FE286A409D820DBB2010898933E8DC863822B0E0F3FDB6DE8FFFAC023D82CCB0C6DB6F0780A2
+A8C9846559B12606316BEFA9674B5EF246550352C088051E01C9A5953573972757854B61D258
+625396EE7C66BE55332E103F9BF2A02F5777CD2A1EA82E948BD4FD34F1C43379702BA518D13B
+96D99368F0224512183237C8F32421001C5C7AD10E1EC8DD90533CC3A4FFCF5CC373A0595916
+69CFD6BBFA2C7C2BE12373FE97617EF2D998C5F79A45C1BBA4CFBB7D57934AD9208D5A194DD6
+0A66AA202413A873AB0D4DF9166D4C359635C3B928628D7EA3F528BFBB36053E91A38C3B6CBA
+8E3C9A2694AA59DDE6809FF9B67FC851C18569772240555B88F76F88D4569A7027AFF1880FF9
+2F9E66EE8F6557E839B84B80066A6621F218A09598B6163AACF18E94C557A5AF84BE82E607E0
+472B37F9AF5EB036EC0F2E9CED8F54112C68B2F35A10DA0A1A19F5B987C32D296F1110283E63
+A40035125F4671759449E1D7707C494A3302D24B0D0341D4B93071B800310D260988D9D12E4A
+E4B30C311012485F95C1C96F2204520FF5E60692B32770CA9F6506C27AA832E5A52E2B431D52
+698DFD007260E81109B773CC3D32A30304B88983ACE94087C3ECCFB850F47545E3663CD7D26D
+53E16C7F7461BAADC34C78352B493E213C63C86928E7CE586F1BE4F970BAC01A2B76B2CDBFFF
+5179F1D660A1867944F5413808411926D4F177AE46C5AB5486C75159B7222C70F5237417792D
+685F69828FEAC8970974EA5638D1A77BD25351FE5545B6A803AFE3118D70642CB3C8473319F2
+0159B1B4C81386AAF3B377B17ED43C4FD1915C6A057552CCA798AE60E04B70D881423972F24F
+6B721785F8A76C8979099EB306D6A134CEF9CE30CB6C401A17BB1A8598FC5D955A6CB7EF8DCE
+9FCC30F1F36D18911DE67B9B32BFC15E565BBCAF91FE1F62518D50347076A38389A7F74AC4E8
+6D6812542BBC2024BC06FCA0023D9C35BDAEFF10E48F59B2AEF959204919FE177067F2BADE4A
+BF760E8D52B98E5870C18F5318AEF9147B827D756ABC7C96A8422F4A85CC5F51C444F655506F
+A8F669ACCB56FC0EED8453DFC1FA87CD76F452FF2E603F915B8E0CB12CEE06D674A8CA98BA60
+BCCA4E955C18FDDBF06F041F1EE76641AC9DE747D91239140A4B6D3B2ABF193B9BD65293B85D
+89B22B376F1CCAFE615547AD920F9704F22DCD00328A17251A6020C0D7C405820B369974230C
+CFFEC1D551C56E351945E58BF6863E9D7EA8ADA9C9AF074E2953B46AE02DFC18BBB47185F77C
+A6DB42B4BDC70046D3799F156CBFFEBA41754CE047F15036FCBBA65F509587F6934BBAC1738D
+91C380AFCCC3DE8CDBCB4D7897025F1C1B62984ED2EAD6A873071077BECD0A7D7BFEF7B70411
+8D2289F8157D85148D6543FF6032154207B840B8810087AEA35458C087EE9E941DAF0BCDF13D
+32EA1CC13A04742675F5C986EEAF8993698B91BD38995BDDB9FC7864C515D4513D9E08049BA9
+832E00C18660C2869B711D67CD11023F8906756BA83B512D159B9FFA301806EB28445912E2B7
+18941EFB598E36D6B07CC0D6BE507DCD532FC2A261763A79C33B81CDC8D358F42550AED3BC6A
+81B5AF1E8071F4C7467B74A4C9E4F34AAE28A3936798BF23FE0A01AF575C33DE07D33005BE56
+51AFC11CDC5BFD3AF1794B70B2F1C35AED1E40EA954591A5C6A32A36F482A5939325113B28F2
+18801A05BA5D7DD648BC78B1391B77677F22A4398F03F8273F0EFCCFEC1F3440C14671AB8E3A
+7330D4CC2C9ECEF017095BBBE52E22CF056EF848E4528408FFABF3B6A777800A024C734F3625
+2890F86DCD9D72D072608C157B4B188B8E86124613AFBC3F70A84B05C2D0B5CC1F3CBC0E62CB
+98378349CAF187D71931130F0339574D25C6FADED7B44C30AB4428B536EF30E6F7D9CBDCF177
+8E00171439AEF7894557D081584D24FFAA9A698ABFBE40A686B4DF85AE8E01D3017F8E44F4AC
+0BAF459FF45055114EF642D902326EEC7918390B0F8CA10652605A805D21AC343A6F9124BB8B
+30F6B7B4600E02E456D81AFD3C8B4BAB813BE21FD2E4A932CE37B4109D4334625D91E8117770
+44C814279028167E979F46646B44F88E8D58335976D91ED7C17EAAFD2701B9791AED67FFE56E
+168EC718CE363E7E63BFFDB98032FE540A455026461FFEA48A6ADEB93A30A33579069B3F85DA
+18F4A36F564E8068EE58A2ACA1C2E6F980BEACE7495EF9912C735C71EB19E2D21647207578BD
+81EC47B56A525CFD49121DC368165C78EB37A779557331BD714F018027894D80A2190B9CFBB2
+E6C8BFC28134F8E1B5D6B81A98011D70CAB2029348991AAD30486C01C7066DB51ECC80B94540
+B25A647A0DD86DA63907F740EC2E28E8EDEEEFBD06F0400DD8FB4804C5508FEBA5D24E67027A
+D9B00B5540560ACA90E7CD4059FEB0513C521668481F4F4D47F2DCCE610C47D4E1055FF2A0F4
+08E8BE66798DAA1DC1533E3A8029435E62BE7368958BCD21464A688C330E85F652721E78D51F
+AA848627A6A4EC77AC2D4A7946E8079EFD34348301F49C7789941533287ECC7C48510AF957FB
+8EEB9A908E963FAB3DA2B86D6B27F8C71713293CBE50A638B37D17F5D7F068B37F5B0F08C330
+82B72B87986853337AC95E6E52EAE193AFB60088ADBB6E70ADC42C370B34290D1F82C226B855
+69DB49EA39AD5B71957DE01E17E00D9084E9CA01845C0DDCD69127ECDE5519B6C712FC1D565C
+3F3517B72BEF40736FE26010DAD917BBB9152557056C018A646B73EE74D805526FC0EE9B199E
+040C3AE0330D92CB168541743C10455CABE8BD38342261872583D867E5BD74EF352B90BBE40B
+AE4F8207CFFBD65E1A8498ECB1CD55646CA1B2A9CA354EC38A15E53618A26980E652685EA67C
+F289956D2A4221372143FB29F835484FB2D817EE2D910A9F56079238E00B72E4218E1AFAF670
+B347AABF87E5E38DE871C0BE5F23255358675C139DCAAE9D885EC1BA4471F4BCF3F1B9794E88
+EE0DD0DD68370A510E50551D7E519EEFBBA62901E290E60439D162010192936B7CCE6F6E5125
+6204DBBCFA9589A9B0AA7AF3E62573962A3714AC5B78747BB83B5046541E58A25948B6CB2CC6
+0B0111148C49C1546A834C42CC910361986EB9F93DBC4D1B273EEF819B806F29E8FEBB91381F
+94DF1906CA7D92BA2CB685D6DF4AF67F4C4A3461500D2A5B962630755B0343140C5AC3FC75C8
+13105489B5523E80999CAD4F64322BD555A9C06F7BB447E2656C620F7FC4D381E2B8E2A67416
+66623F9ECB5E0A7C15219234581ED24A21B5EEA120C167E96C316B8D72D2A92C93E455734E2B
+98B0E37B59DD325FEC1994F84DCA5F0050C74D92E0AFD6A31A2DF2364E73AB2B54117C08EF46
+842AE3207C3B70E88023AA7D0DEA7917D1C928252DFB1B09EE673D34E4BD4F7338A44627F7F5
+F6F3914A6574A0709D0E9DF55ADE798B7239EF442798C4FBCC06289735722D2B219D889E2A6F
+ED824AC4CB429622E1B944E4E22987496FC86D7E9A74D70FCC368D3196BFB9F5FA512F74FE70
+A3A9CC7653908A03777BF1D288D3F69281C9986C0B3A1C422533EC92394842AC60DAD1490F65
+8D336F9CA9F1B7CA9E6F2F192148BF6F91794249A5CFC71E55725061C7ED18A48BEED9BDAB6B
+57FC85EEEEF6F411D78EF75DE6CF77BEF012C45F22D420773E5FA5FF3E4B83015F3BBE352DDB
+F78B946A363D1C58B2AE353BA3DB66CC7F56A9DDE6BC979A2A884257FFDBB136CD8300B53D83
+7D80D48F1A733FA5F519F8DF0A08009D0C5F99B1BE2273DDA102D1AED76D304A58FDE17F13C2
+8FB7DD802687A8ED5D6C06CF3EE7CC0CA88A927845E4CABF5E0225A76B3BCEED4C2C56107605
+DD4B9C118F8B2F7C00A4767FE7264D94127A5833C659433D9853C3FEF19E7656D36A76F44194
+6547C3869E3C07F9B7BE373E12EE066619AEDAB6F43A3B55AA8AD8227EB1B4B8CAA4C8CA5110
+858B30FFAC05BA4EAD421FE31B88DD09E2857F7C193581E6D287FC465E76559807B7043BB999
+34F4D6779CEF1B87D6E5EF4A76C5E9130C29F418A2EE9AFC4CC2CCEE9279DC5E78C7A37DA5D0
+0338A74CF5F43C73199ACA7150067A48249D79D3859DC624CD173208B7AA805B0AF7E3D77B34
+9AD914385AB9A33AC7A6B7A46686F64A206C9D0089DA1B5F14E88C37FB21A0963F6064E4611B
+96DDBE66EEA0A7C635AC16F1FDB158066DB65F7E6E195978DDF7B9DBD93ADCA33FFB67A90B66
+89FAC7272DA97CEB6EBD380AF79D9CED6915FA9DE1C8F7E1CC9E2485ACCA3AEFC46EEE1A940F
+2BFC0B97BEBE096872F179F62C2127BBF731896A51A04A17546D73AD8A6800E2E1E25A56675A
+5BD7113F694DD3C2B9144F689A7245D0662C9810AEA97E0986F24892CD4FA2590A44FC0289DA
+B6883DC7E5A3FB476B457F83600710D9A9C6D02F6BDCCE009CED18DC4802EBD65E3B3BB7D4D0
+AE73DCBA19476DE12527F2A91E2E0F3638540E2CD439E8363BFDCC202B0AA7003F575EEA6AB2
+75D6347F8CAC6A46E3BE50360914888388337BB6836F5C364F923D5AEE67537831FA56457547
+B48D3D5358A771004A8520A66CC14F24D84FFFFFA452963EB9320ACC3AC91A552690CB2C5CE3
+A85B5BDDA8D98931E02C69185DABCA4F81D7CF58FF5DD31CBA75ACEA8D8F1085DC984D9AB9E2
+0883A457C2A5331FD4FD5F7E17FB35FCF243E223A7B60499C99A00C5258021CD495A1E7296FF
+0D2D082D42094C166EA832099339630881E218B555D8BF2661BCF41A27FE97B33C2E1A0317F1
+D93C09BB3BC20DAEC46463D374546DD7824FEB6CF4A64087F80622DADC9804AED6707DC67AD0
+AC1B30F4B0EE17A028C46D112F9E16F456211F8C21DFC4A197B16B9DC8741A6423B5D861192A
+5FFA4B1ADC0EEB8CEAA21F4867E4E49824E638B052406040DEE67B2BA6312C2DE83BA17CED51
+65FA30F2B34590DD5340705C8EE41CC3C592587F4FF95ACBD451510F3076699107A067BFCB85
+AC77D80E928BC043E65C1D2E085D17280A4F7FAD5CECA74BAF6CA8991A90FAE70DF9E5AD27F3
+8A773A1BFB78BE07113884AF0A09E896C54C42B41267D3D5CBDF2179B7D05EEC35E5DA9F9D6E
+D05735F16AFA7B8290B2A2088A8BC8F2808A2E601382B9C2127F1BA0B9916045747993F0C92D
+B542A4FE31A74C3E4AE074F92BB1E828BFCACFBD7A46BDD1A64E8D9D976E348897BA5FD84640
+211A28C3D9960B948A2B1EE9560F2B399E41E0B0C54BC3BF880830DAB105C56E7837F89320E7
+10AE7FC05256E5E70875CA4648B5ED67787FB1C24804389950C28EB7B1BCC922B5DEEEBB94FA
+1BE0BA3324CF95764C2FB13EF20CDC3C9046EDD5E3D7CE15983D7127D9B0835B3546AD02B6EC
+690AF4E54E8B17F0FC178E037E354D17467762B837611288F9AC543C04005E79803B4D804ABF
+68EBB2BA44D2C762DA71E614F7545A1DE87AC789FD93855D920AD4BBD1ACD27AAFA5F3FE08D4
+4EF8BEA457E58487EC6FA9BEC8C25F4CCA68E2C070139FC610D639099651EF1E2F77372AFFDA
+DA55CFE1E3ABD5BFF14738AB3035FCEF4FA7DACE79EA942499BF4B177DF06DD60F7CF6FE92F0
+DA98E433D8AA773E6784220241BFC3F5CC3DC82183D2827CF0E240429FED566D8EFA32C5FE19
+5CB88B933DA775502FF57D592173A0D24E15C4498FC321567DAC0C4B22861561FA6B95930E7C
+429C869AF3758263AE8476444AFE52EB8763BB23C0A5A812C2874062ED7752C9C50F4CF3D315
+85A9F2F1DA9D75B435C15C7E8C5FA71115452C699D7C7D11D3FD2FAF9FB4E20F96F39B319A9E
+1E0F3E7336BAFADBF676F399C9A75D13159A2905B7F5E31A707EB833F8EE4442DA03ED80FAE0
+AF2AF7F57FD700A3172504E2257CEDEAB4DA4EEE079EBDA6FC610F85399A80F74FE8CF772F42
+E67E6606697F7B6C789D22C72DF61862F028B964DB3B3044641777D06ADED2BAB4F0F8C5D707
+6175907A007EB4317E4766E6F2AC310FD4D0CDB962599D4171E48E9B9FC7D78B77602EC51265
+627079AB66609899D250C9B5E33301450308CA0AAA70A841985981F0B12AC01CF739B7C6CB8A
+1D6344184CA72D7F9A5E1DB94B872353AD8BE1D72E36C15D000E321EDF4B899709EF6A4C35EE
+454262B63D555BDD32B01000B8C6F3912A8CE3DB7C3351EBE65245A78DDD8C77D6206ADA0F32
+51D37ABB49368A5A4FA91D68A4DA3275FD9FE0123ACC017FD6E89A36E8C4FEE96CB5106DE457
+CA3B44B3B52AF7BA773273E1B0FD745DDB287CA0616384B3B8FC8AEC3A9B900F8F0D37F9A6A4
+DCFFB4CADDAEF7025244B622CF4A237B7BA49A0EE3B41D7B66DECB8017279D8569F9E5C4F4F8
+4A5B8C80976FD8DA3BAD1A8B426ED7EA299AF0E761A8E4D5D273E61B1217BC14CC7D55C20A9A
+19FB1AC1CD47FC7D45D85548A9856634094A814D2D96352783A8E9633B2FC45EC3710DCBABA2
+A65A16EC34F5ABA221F6F0B6FFAB5BE886307EDCC05A0322A1A2FCCB1BCD1B650419F06C90CC
+4CC05EBD269AF0CA49759C1B85406DEC0B594ADCDAB8A33DD48230DF93C15F209F8C4F4CE089
+FC031B2BA6A3205A596F459A52938830E7A5693EED1B3B479579473E78309329569BE1B0E7FD
+486B72F52D084AE936F59A98CD03AAB0703DCFA05073F2864F0E5E72801F3084A39799D9C8BE
+580D43259711FD6B8252EAD8CC24791A6F3B8FA4514B9C01CC9DA37C10C7DBBC91D3B8CB53D0
+C92ABD86DD16BBFBF344575DA3BE86D415DACA97A281DC657E783F838F6D40DF782AF3FB0B1C
+692B8209F84476CC962807871CFEC07D24BE0DB2690017A8FD400AD5914F4F473BC2B71042B0
+B172DB259BDFD8330D968EC9DFB842902419E4090F613D2476E7BC5A3E8C006DE2CF2E54E29D
+53B1A065D5A7DDC7DC22A9B2B7535AE0EE1CA56214601498920FEF3E5CE1D1F321EDA290CE58
+078E01F2296A345FB32E15FB452CD42C9C25F9513EEF35D604CC1E47ADD9F2C726D771D55B43
+B079F88166D224CB150D459E59B478F566875AF92E80CB07BE80B693E9358A0E36E77356ECD8
+B1DA13240C02BB370C4A96075ADC295834AFBA1BD74AB53C476F28E6AC7D597CF2CC716C58BC
+92D5FBF696072508DB76A3AECE9B45D9D8C72783DF88F43E98F6D307AE518EA612DE8EFA61A4
+E8518A5F2C31F17DC860FE3514A7100571CC9BF05309AB81D317F1D2A6008E223EA045F5DFD6
+16E0FDADB5DD17929969ADAD1FAB246928351C7D4F9AE4324104065DFB3E48536D1658DF0638
+C446217534037F601342BC1DC239DB63D8049E030FA9FBAF471CA3568214CE38D19008CAA834
+60F51D50F0922838EBC7FBFF2D5562514A7A4693F865BB4DEE9024F03707D4D0610D1ECD1DEE
+A642D680AC9A6D14525AEF9A98E2CB1E17A8C45CBE0AA8A47A057A18D62E44807C5473B048C4
+2522A14AECE3DC7775B805ECD60559C6FD0DA27C0FBC6282021895F4A3EF59C9EC3C4C0C1441
+42A47B09001CA9D4356AF1301D3DF8C7A2401FF7D8A628E0F429A8AE351DD8E0C50980438F62
+899040120998F4A7690FB2843260F71A1D764DD5B790539EFB88C9389668E71DEA8B8FBE0B9F
+5B594EC7BF052FBAF43633821EC2B9B7E52D73EB8F104764D835128D9012DD1A949E2224FD09
+06645276E097EB04DDB0390A3E79E0941365A24A68377B135D783328E5EC46F84291B36E0DAC
+C3DD74558EE652BBEECA9059454E22794E8D6FCF93940CA7E4F4952C4AD10C35E953B4986E66
+EDBB77466BF03239DC1A01A2C41184946DCF60E068284713DD3D964762BCB58A7658E0D4181D
+8D7A72F1CFE23FC2302AAA71C03D921E4A2F2324D97E19B7C6F74352A5C49293E819EFBB9243
+346BC26740E472D7649B9EFCF4E1C3BCFC90BBAA8D06147044C017B3642310B17A9FC2CB825E
+C964E532DE75CD2BC37CA2A8D281BE7D88603005BD21706A530FF446A80E3B0E484D43044487
+D16CB8B4182930F31B967760DD8B453C0D71CB5A45EFA634339806662683CD990754B54E8292
+F70F2A09A06AC6817522A4DC69885007CE2FD18717F973F855F38B79369CF7F0BA790465BF3E
+997AF50B6F5E486C96430F1ED59A83E079ACA43A6F315846109F457AFA26B570390DD15C9255
+CC9FBADB58286FCAE12354E7F8C5010DA3AADC60F6984EFAD4075611D0DEFD5F5F2043EEB694
+A7A500DA22188F9868837826BE5A762C73CC24B545A24DDE9FDD799AC6BF0D3E2EC2E9CC30C2
+5B975E1EED99D4F9F3D1B6A2AA6B6504FCFA273AF1B2FEF5B8FBC6AD06F8EF01F262F664EEEC
+1C05B4872832F55BE3F3B95A599197841F68F04FB1B3C6258EA5D87E33C68B6EC32B6A3AB7F7
+78800C6F2B76EDC900CA6900FBE355B8E65CCFDD4BE56BBBDD5F112B515865CD20C297BD1214
+999F272E96E83A40E56ED0F6ABB5EFC25CC6D74E0DB6C02D72741108AAF3EC7429769C432795
+27FE20D669947DE4A257DC6ADA552C0BA018985FE493FC8D4D5B41FAAE51E0DF83382CE3EEAB
+D9F3742FB3F796C37B41F7BE4932A4E9A03E84152EA95CB6FC29F85D5EA7EDFFD7BEFBC9953A
+D60665707D55A8D55477961063F23B8701AF3330531875A48E88228FC014478EF756DA14327B
+BD7971CD4489015E39C8CD2AE6988CB81AD993AE94995F1CF7162B46678F71BE7EA163585A3B
+11FE47C6013CEA210AC8CE590CDA41475E3B61C2854EFD59190B4E819F092C2E4062BE28A206
+D086DF6EB29C26655E594DFC47EF872D878980A0DB181548EC9A5784B7A73C6EF38905A4352D
+E58D21F86ABB05D83E70EE3678141204F8EDC2A3908DF540DEFCDEBE1DF43B0A6D03C301D66B
+8D3733D79410668AD3F2A59AB0748C4B467CBAFB5308DF268016D5015C314E981F16D101D2D9
+11B5A9ED70B56D2C31653F7301AE015F54CC5F800BFBB536C2DA80CA2DF48ACA1DF7F586057C
+A4AF90E76378AF0A2CCAC5746E6B10BC16019D501289BB799D68A3A92B89BAB83469797F111A
+A357D01BD2B623524AD738ADB55E818243127CFF2A33C9B1400985A5E7AE14A702E3452F8E71
+0F241F4D0B139176C799B373CBCAC14838DCEF8B174E7F675DD3E2688F46297023D84A361566
+1EB93857E9B848881A94ED78DA985A5068CE4BD1187EEA3FAC10DE38FC3B6C8ECF2DDA03A0FF
+79131577D4AFE99934A03C22CA30704EF981FFFA3EA894AD6699409F0EA09DDE6FABC3EC8DEB
+AE140CB66EE37331D20F2AB927E4283B8C767E10C4F340DBF1FE874C1A97B08BFD043CCC9B62
+B1972BDFF67EBF7F3E3E45DAE0F22E6344CC1C89E9169D4F6C90F37740F5F76CA6306C16540D
+4788469926B46236D22F62DE509565959550F9714EA9433D4704E27B81231B98798C0F888BFE
+BCA5D203CC480B92993FCB4ED21758D98146D6D54AF44DC8626EC46928EF941BB50483651893
+B65C433759D2D0347B4219A61EAC415D880466B2D18FD91385ED688A7593F090608AEC4BFF5A
+14FCF92AF9B3D1DFF5AD63F8617DC70539F2E142887DF3DD358DAD04C47E50E6EB0379C2A55F
+730E70C019D4319F777F9F869BED86505D36D7EB23E568C659CB100D5486AFD3D28873E33E27
+6014638C5F17D3A1F193353E251C1C619CE150FDDCD7506847C1FA251C3CD572E3F4E187A0AB
+7625F02406F97A2F0B2EB917B31F499EC1D4B5A89E7B5C1DB6DE329F6126652C208C88C74C27
+08FAE8800808CF465CE3FBD6C195728C093107C0E148D3035FD5822EA917B3C499F2BF1BEBCE
+11AE998DE12845E6F500FC0D5DB06213AC2E5C581B73D50BB2E13D2E79344168D04CF4338634
+05E9B1A75A21D4E0924BFA6BD675FF02FFDFC46E593ECB509BC78409C78CCA5317B499F1E654
+2B94A75232B8A622DAA17FF41AAB7F469EE1750B43359A90DA3B2C6E7BA86E4752861EACF477
+D0072C922DBCBFC452B5E1DB1A41778610E9AA58DBEB33FB649B2E33F8DE7B25F9BBD0E4D332
+8031F8684094D1F0D581BE98C2042EA69C701BA70AD062EECD8DBF61644840E8C95D8A4234FC
+1405D8D007C6E14D1A68E14B3F7D609855BCC1B40F1EA8C2B41E2C90D4FF7FAEE037FBA5B11D
+073E1A61AB03D0F4BB19592B5524894F10F3B7F29B19803CD15B89C594A1A5B5FEEF7445A5E9
+0DC3E39BDABF0A97963E2DF29BF8D9D4375F82284080F9DA5BE69810F211DDEE5352224B2025
+1C3F8A55043A8FBBFE1E031CFD1D38DCB6C43588D92E58F739875F8E8C9194E5FC853DA1006A
+B74FABFA945E4F145E1EF3AC115D1FE242A3381530D171A5A932D881A1D060A64484AF6E8A44
+430CC614D8750B3D12CD1576790A72BEBFF217D863BD3A3F1EF95EBDAE08FD3D5259C55E3B5E
+89C14684B18833D86E5590165B43FDF869267CCCF305680124F25BCF086364046D03D2F869E1
+F2AAE0B34D3CF7CDBE8BB1EBF1EC13C6DD91F459834F497F0CD23C90770655C1CD74A488B743
+1B9F43CDA98ACD56592F3F3846A69512D114040A8086B4F5F068BB1908490EB22D4F8BFD033A
+D796EED2405C618D32F4D081476DF61A0D3A0CA91832E8B3C483E52D5C44D7512532D50F54C1
+D1921748E58C7ED83854420D04B2718E0467B4BF0A0133B998723B12275EDB56B0A21C026F4F
+D2B028095E2FD904596285706FA970ED55A7073A08FFE87F5E063FE949B5CB379B2F7B5C7DA1
+EA1977175FDE95CDF84123DCE6BCBBC5999CA4C61281109839429587BA0C76047F42F8ADF2DF
+368EEF61E6C18DD432B7592C8F00B22C84EAA72CF9B13CF83DC48E9003499FEA6135B07D36C9
+150F06178A79FD5BBD0960A8A0E729514DF63F4A6390FAFB12532070D75C75AB3EE9622CC919
+D42AD3CCF3815C71B04C14966FD7416C9B7EE234E82F2E7184DDC489603B1D49CC85E86A7495
+530F8C09B25442D242F9BBA6C47E97264DBE30B6213158D5E82B2FD86CAB00A53E83F53D7AC7
+CD9E6B701D873A4555003CDFEB1D8B9A455EFBBD88E926299781888EB814D8B45EBA8A5C854F
+17C03541E5B28C5399C922737C10DE4942DBEC96A4E803AA48D054BE1E9D9D75ABAB659B46C2
+5E30BAC982EA3F1941F8753506A02076B26792144275F834221FE32C88A98E0266E3EDFDD08B
+7BE24381069F7FA418343236EF117D207D9C999E8DC7E8BE5FC8D588FFB399191A6D060407B4
+C94D30548435FD707155803D3981043484426F47028F0A551ED788463227586881256354209E
+34208EF3315CDAC8291490C4C91037727D78E9EDCB2CD828BB161D17403B31AD5FB55A6BD1C7
+A70800D0B252332F3D0F1AE764945A8BA4D5128FE48416FB2D8521D8774554006E75BB8149D2
+792A24E264A445C138CAE70429F4115148FC46A64C1B1AA91035E5CAC7D56B94773E615382E1
+FEE0EBA3C020228F1B1E903088A5B4CBACD287F60B7BC530F7E9024E1267B96DF8A0CEEDD429
+A291F86F3117969AC46D6675D969A2C8392D00356FD2EEE67C5DBDC2896A290BE1E285342670
+35170B245BD6677B670DBB926BB20F7E879A6F9AA49AF1B3CD57664DBCC19FC4E58772C4D284
+E28E57346E44F5BB59E75FDFE66C68508EE98B87ACA3CE30C9B789B3E62AFAC20C45F143CCBA
+978B7DE18085B6F1ADA0A33F119B09A7F051A1629CB8DB0EA094AC458863552BE4304A3A247F
+43C5B0160C76FBF592C5A3319961305C1AF886A390267847D218ACD200948390C14A5B57B706
+7915177734765739D8B4EBBFDE8253A1046DCA4E13F3A031A562E9B8BD88E5A4C848088B56B0
+1EA525F94D32436087FA34C6EF4E5BDC32503A3C409A75E0DAD3148FB0AA6E913332D6ACEBD7
+7C84DB1E4B110EC84109CAA6C4E9CEB0C18093F5E9BB96B6294B820C8B22AB831391F01231D5
+2A8CA189D04E3329C94110EC07ECBBA15AAD2D50AA829BA960369723B6741278E39D9B7E9755
+C7FA82C1E7117A1620B1502BB9B251782B7966F29D63CED01018741422D821A5D0FC4411DA57
+9E7A47374CC143CA5AD4C9BCD2037BC993D94AFBA735523E4BF2488E36DDCD02B9B71AF3826B
+58CFBB3D47247D7C560963DF43BDA8C9A1CF69571B29877F1210F13272AB725D27D3F5D0E4E9
+7727A9A0E789484AE677A272F4A777AAD4263ACF572480892233A1DA23918B17D37EAC8FE8DA
+16F52F1617EDB1AE936FB0037E0476D09FD278C556F9CFD899F41B8E1854D50457CB3CA6CA6B
+A8A964DDC0750432B59277F2982B9C19F6824A60ED7945C1C737914B75838D958D2FD8C6F8AA
+F6BBDFE6882891F91A2B441DA2D53082324D35FF12C7C4FD2698933654CF6A78FA370055B2AB
+078086EBE0FB7A715DAEE6B202516B033567E9DE6CE9235C159C687A7039871CCD726CBFED14
+43F99A8194340A84E529EEF8B6C423CF487045F3D4582D9335EC9394362E41FB2312315F737E
+56F15AF4745C6A31E05AF56A7361E043EFAB8D5E219D292FB6512BFD552F2E378751ED4E90B5
+453CFCD01E8BBD826E328B3D3F7943EC188EF170E2C0B3B5DAE662BFADAEBE50ABE0C3A7D605
+0A3D978AADA8A23D1E65D280CE6649AA096704DC2206EE61CDC81E75E8B69D7A40FAF01519F3
+831DBD268D116BE69D12D44EE05A6066930DA03890117CCFC9C2B324A93DE0E3B6AEE41990C5
+D7760ACC6D3182EF6CA086D32EB717CB244E68EE027A4AD03CBAF40878342B8FCDFA4E866805
+7912698691655E8581870BD730D941D662A88A9DA5202A368C9CB0BE0E8BC5984D3D54EA95D5
+4A81FE8BE7C3F67223B985A28B35CAB59D28DA662DBA33C5FAAF5CDF8B5140343EF7A82C260F
+FBA07A7E905AC89452697690A5A121A199D2970F12E80341C295EFDD17D032A742A29FE30DA6
+C2C44DC192630A57122D07A5196FBCD0EB56230971AF33AFFE68A833F583D634EFCA31FF46CF
+4DA8DB9E7B4105E2029D2247FA0B575A881FBCD4C37D2E2F4AB7F7A51E1411EE00EDD0C754DA
+938E017FA8E2F56297F7510E20BC275C569EEC62BEADEA90537CB47AF6F492C28F1A7D03D78C
+EB3A596E6D57C3D86B482D3EF2DCF352038DF4E9EC535E0536F5E75936810D3785A3439B2A28
+8CCBEAC100768BBF846D0B8BC41F699703C47C15B26BCB542B007A34B4205AF6C7A7C7145258
+D4C506D82AB9F04DEDDDACFEC874EA4947F65A9AB682E0C497EBDC0244B7D7C724C4A9BCDB29
+173BF51A054C9046DBAAF2E681BF1426A8564F27299FC64E62A38CA5C757E422251F22FF16D9
+823E0A5534076C8F12F586802F6C66A6E2BE16BA97963A521F9127DDBEE098C69DBA32488D44
+C259B35C2E61AFF83817549CDEE368F7811DF262FC18BD60286622D2A4EA859B8860BF387A1E
+95E0F7B72DB061F34671C902BA2803FBCDA7E06B26C00007153B1D89DCF4C71D2BC86BED5423
+BF9661B41962038AFAA36424E74F319C5283A67EE3868BB8C73F9232B8FC8E31D1352A0213F4
+03B1D157D6435D6509614C67DC0DAD5819DECAF98EF557931DF953A5662103C7A7F0A868657D
+C992E64AC488DC088B0CDF772DE91368B783FEC311BBB60F22BD0C7B4A7F7BED0F240F17F2AC
+45A9A2E9F672A21DD41E4B075D54D4E80CFFBBD1DC391DD29107710F08EEBBC02E5A35B7C990
+E78F686DDE2B2FAA499F285C4D8E7A10BC48663F30847145827173F9034E0E3D8E03635B1DC7
+12573AD404EAF33A7A730B63BFC1D6F42429121EC13EA5D85A4D3DFA5488F4CE10E08F34EB83
+C277291A1AF3B02625EA35E931EE4658E73C04A1FF4EA88662EE6C6105746B3FADCAC6FD670A
+FE2FACADB3480DAFEABA0A7F361DB527A073D01FC86AB5BE5FBD582783F3D26D1E0D44E1C577
+CB63940BCACFE15570304F5518B4D9BEF913DD4255C76335723890F765847A3489F985B2E576
+E078BB844F44572BB824E1865BC534572637E35625D4AC31B6AB5596E290D689874A3BE273C5
+C1270478E7B925B08ED9E2E63233655625AF6A899BF73CD69903A27C8E06683AFED2E209D7E7
+9D272344331267D189556BE3B62F0D2178E1505D20F916F12B5E0D80BB2E67467449ED1E20A1
+EBB99DD097B651130C06E9284ECE3C91C5B8DE7B6DB935ACE4F9CA4560392893464DCFFDC463
+537DDEFA8DAFE59C0C2C12C58D1E093817D36159B684EF38F45648119EA254BFEBB4DEF31286
+9A8F296B5B3CF62538D1F38B9E1C273E1989F734E6F05A35269F082FAD95C5AEB719ADF7D99D
+D646C650A93D2FC8ED9A266C8AF3D49C0AD385674EDC63F7036CC5D02C088FEFB44C5E859E33
+C5545E6C02178C69052C8E4DAD307D74873102339D631231F981A23725DC85A342D44BF632D1
+6474F325A9308FD394DD9AEBED391D535B27C4D0FD2D147A4AA2932A19D832371080AB31299C
+910A928694AEBDF4D966E0A1682CD98237D073C3DD6BC19F3E39D056154F763B45A6F192B7C9
+71C60E6275F087C4A9C61D26DE070FB94450D8330847B826336A9B1056768643EF5CDAB3874A
+F8E64C01905981F1B61E3933FB844702B079622E17D958B64FE5D96E0B4DDD83D745E2AB1CFB
+1786C07470474EC53339CEA8F0ECCF4B71ABCB0E578E9F0E9D760634708CEFA7EA5F7EBA4DC8
+CD1C416F078756D6237409169AC9780BA8E6B6A29566C3C53BE9FDE79A78B471F05C9723F8F9
+0DFB23158F7D3FBD767CBB437D85B1A825C1351108DFF112AA9749363175497638D4B9A2D8F4
+34E56178925F00467E77245E1547CA9556579D202D7C94041D41E4DB05BCDCFE9F7483FAB1AA
+8CCEE0BBD5AD3BDFA87640D0A4763718D1191BB487C9384841464993AECA21722558CBC1BFA1
+E540C1D0FB477123281B2270ACF6207F2075A84C147DB4F45CD3B9AA97D9607D0DE09C4DACFD
+FFC9C889B31A211E8D6AB4967E68A90DE86212E23D7AA0266A5759C9D4165C98A4922ADCF6D8
+209B82378A4175AC6B91A4EFBA924506F181F1917385C7A1AEC29501CC62473C225214028413
+343CAC23EDD299D1627DE6E7CE9DE4B19104728A4876A0939E0DF5FD19D5DB6E8890DA1C259B
+54BAFA5EDEC6E443732DF9B40594242C9862FE554C3D0869F7FF495DE0C192846A182C2E80B6
+DA51CBDF5794B34978FB8BCD26CFCA6C46F5320F1AC0692FDCA4DEE5E4206841F46BE9BD1EAE
+6C131ED3DBF52237120487C30CDAA32DDD8AFFC01E0CEEE85A7564CD3AD7386FF964C0544F62
+6B924A1AD77A99C348FF7150F7896DFD839F6328E715BA33891CE00E8F469898F7AD75A626A0
+D02C76EDA787D7B74E2C3EA9E018C4414FAD9732ACCC2386875298680D553E6DD873E8219E66
+862DF3CBA71410374E6D7ACCCCC9C4CA389F96435064EF577DD391463D67F98789C42326A92C
+758B017029538369BD530203A039E06167C536EF17500BCCEF386C77FA7BEEEEA2D87E9BD5A2
+72ADD904E484E2D086D8CD6238F58B62FC39B7B53E64895FCE06A86DC2990151BE86D572E2FE
+E28F2C6DBBF43B6B3B76BD7BC543000BDFDEA65074309E291CEEF398C7755E73BB502C98DA18
+8137CBF8984C341E55C498003CFECBFD0C63B2288FABC92EDBF7DB81A8A0785008C57517B36A
+1D885BC80A684DF355077307A8AAC76FC9304279C6D96A130EBE61327D8D4A9BEDA3F944C528
+A2C920FC7351DD7BEE534D57FD3D7429C1A245937A86F139FBE86BA87644502234204209FC6B
+A1CDD4213CE0C0F19B42B0E5BC4E97182C16069A852C75287AEEAEB719DCF15BBA17714CB534
+060CC4AC13B4FA18122E5747F0EC59CF4BFDDBEDA2D802AD801D2AB1E148427AFA2DDD765C17
+011FC1175FFD498AF19BDC51D4367AFD662FE538F244374FA7CF088D790523D5886F5A225955
+9909E46A887C6B317A31618A4C7AF5C2512F83C7B4E9C441388F8216EE8AA2FB7B18D62E44E6
+A37622153661F64C0E4AA570798BBA35187AFD393F384ED35DFD8D7CB9745FE36258AD50E5CE
+F99E364EE9440BABD3430230C6788C655871E034FCBE154D5859B78125017D08220D33BDE57A
+0744FAD3F9EA4F70040F3A9BE483269B928600AA03CC0FB0EEDCD42731E06A2D7A95F1A8400000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+cleartomark
+
+
+
+%%EndProcSet
+%%BeginProcSet: texps.pro 0 0
+%!
+TeXDict begin/rf{findfont dup length 1 add dict begin{1 index/FID ne 2
+index/UniqueID ne and{def}{pop pop}ifelse}forall[1 index 0 6 -1 roll
+exec 0 exch 5 -1 roll VResolution Resolution div mul neg 0 0]/Metrics
+exch def dict begin Encoding{exch dup type/integertype ne{pop pop 1 sub
+dup 0 le{pop}{[}ifelse}{FontMatrix 0 get div Metrics 0 get div def}
+ifelse}forall Metrics/Metrics currentdict end def[2 index currentdict
+end definefont 3 -1 roll makefont/setfont cvx]cvx def}def/ObliqueSlant{
+dup sin S cos div neg}B/SlantFont{4 index mul add}def/ExtendFont{3 -1
+roll mul exch}def/ReEncodeFont{CharStrings rcheck{/Encoding false def
+dup[exch{dup CharStrings exch known not{pop/.notdef/Encoding true def}
+if}forall Encoding{]exch pop}{cleartomark}ifelse}if/Encoding exch def}
+def end
+
+%%EndProcSet
+%%BeginProcSet: special.pro 0 0
+%!
+TeXDict begin/SDict 200 dict N SDict begin/@SpecialDefaults{/hs 612 N
+/vs 792 N/ho 0 N/vo 0 N/hsc 1 N/vsc 1 N/ang 0 N/CLIP 0 N/rwiSeen false N
+/rhiSeen false N/letter{}N/note{}N/a4{}N/legal{}N}B/@scaleunit 100 N
+/@hscale{@scaleunit div/hsc X}B/@vscale{@scaleunit div/vsc X}B/@hsize{
+/hs X/CLIP 1 N}B/@vsize{/vs X/CLIP 1 N}B/@clip{/CLIP 2 N}B/@hoffset{/ho
+X}B/@voffset{/vo X}B/@angle{/ang X}B/@rwi{10 div/rwi X/rwiSeen true N}B
+/@rhi{10 div/rhi X/rhiSeen true N}B/@llx{/llx X}B/@lly{/lly X}B/@urx{
+/urx X}B/@ury{/ury X}B/magscale true def end/@MacSetUp{userdict/md known
+{userdict/md get type/dicttype eq{userdict begin md length 10 add md
+maxlength ge{/md md dup length 20 add dict copy def}if end md begin
+/letter{}N/note{}N/legal{}N/od{txpose 1 0 mtx defaultmatrix dtransform S
+atan/pa X newpath clippath mark{transform{itransform moveto}}{transform{
+itransform lineto}}{6 -2 roll transform 6 -2 roll transform 6 -2 roll
+transform{itransform 6 2 roll itransform 6 2 roll itransform 6 2 roll
+curveto}}{{closepath}}pathforall newpath counttomark array astore/gc xdf
+pop ct 39 0 put 10 fz 0 fs 2 F/|______Courier fnt invertflag{PaintBlack}
+if}N/txpose{pxs pys scale ppr aload pop por{noflips{pop S neg S TR pop 1
+-1 scale}if xflip yflip and{pop S neg S TR 180 rotate 1 -1 scale ppr 3
+get ppr 1 get neg sub neg ppr 2 get ppr 0 get neg sub neg TR}if xflip
+yflip not and{pop S neg S TR pop 180 rotate ppr 3 get ppr 1 get neg sub
+neg 0 TR}if yflip xflip not and{ppr 1 get neg ppr 0 get neg TR}if}{
+noflips{TR pop pop 270 rotate 1 -1 scale}if xflip yflip and{TR pop pop
+90 rotate 1 -1 scale ppr 3 get ppr 1 get neg sub neg ppr 2 get ppr 0 get
+neg sub neg TR}if xflip yflip not and{TR pop pop 90 rotate ppr 3 get ppr
+1 get neg sub neg 0 TR}if yflip xflip not and{TR pop pop 270 rotate ppr
+2 get ppr 0 get neg sub neg 0 S TR}if}ifelse scaleby96{ppr aload pop 4
+-1 roll add 2 div 3 1 roll add 2 div 2 copy TR .96 dup scale neg S neg S
+TR}if}N/cp{pop pop showpage pm restore}N end}if}if}N/normalscale{
+Resolution 72 div VResolution 72 div neg scale magscale{DVImag dup scale
+}if 0 setgray}N/psfts{S 65781.76 div N}N/startTexFig{/psf$SavedState
+save N userdict maxlength dict begin/magscale true def normalscale
+currentpoint TR/psf$ury psfts/psf$urx psfts/psf$lly psfts/psf$llx psfts
+/psf$y psfts/psf$x psfts currentpoint/psf$cy X/psf$cx X/psf$sx psf$x
+psf$urx psf$llx sub div N/psf$sy psf$y psf$ury psf$lly sub div N psf$sx
+psf$sy scale psf$cx psf$sx div psf$llx sub psf$cy psf$sy div psf$ury sub
+TR/showpage{}N/erasepage{}N/copypage{}N/p 3 def @MacSetUp}N/doclip{
+psf$llx psf$lly psf$urx psf$ury currentpoint 6 2 roll newpath 4 copy 4 2
+roll moveto 6 -1 roll S lineto S lineto S lineto closepath clip newpath
+moveto}N/endTexFig{end psf$SavedState restore}N/@beginspecial{SDict
+begin/SpecialSave save N gsave normalscale currentpoint TR
+@SpecialDefaults count/ocount X/dcount countdictstack N}N/@setspecial{
+CLIP 1 eq{newpath 0 0 moveto hs 0 rlineto 0 vs rlineto hs neg 0 rlineto
+closepath clip}if ho vo TR hsc vsc scale ang rotate rwiSeen{rwi urx llx
+sub div rhiSeen{rhi ury lly sub div}{dup}ifelse scale llx neg lly neg TR
+}{rhiSeen{rhi ury lly sub div dup scale llx neg lly neg TR}if}ifelse
+CLIP 2 eq{newpath llx lly moveto urx lly lineto urx ury lineto llx ury
+lineto closepath clip}if/showpage{}N/erasepage{}N/copypage{}N newpath}N
+/@endspecial{count ocount sub{pop}repeat countdictstack dcount sub{end}
+repeat grestore SpecialSave restore end}N/@defspecial{SDict begin}N
+/@fedspecial{end}B/li{lineto}B/rl{rlineto}B/rc{rcurveto}B/np{/SaveX
+currentpoint/SaveY X N 1 setlinecap newpath}N/st{stroke SaveX SaveY
+moveto}N/fil{fill SaveX SaveY moveto}N/ellipse{/endangle X/startangle X
+/yrad X/xrad X/savematrix matrix currentmatrix N TR xrad yrad scale 0 0
+1 startangle endangle arc savematrix setmatrix}N end
+
+%%EndProcSet
+%%BeginProcSet: color.pro 0 0
+%!
+TeXDict begin/setcmykcolor where{pop}{/setcmykcolor{dup 10 eq{pop
+setrgbcolor}{1 sub 4 1 roll 3{3 index add neg dup 0 lt{pop 0}if 3 1 roll
+}repeat setrgbcolor pop}ifelse}B}ifelse/TeXcolorcmyk{setcmykcolor}def
+/TeXcolorrgb{setrgbcolor}def/TeXcolorgrey{setgray}def/TeXcolorgray{
+setgray}def/TeXcolorhsb{sethsbcolor}def/currentcmykcolor where{pop}{
+/currentcmykcolor{currentrgbcolor 10}B}ifelse/DC{exch dup userdict exch
+known{pop pop}{X}ifelse}B/GreenYellow{0.15 0 0.69 0 setcmykcolor}DC
+/Yellow{0 0 1 0 setcmykcolor}DC/Goldenrod{0 0.10 0.84 0 setcmykcolor}DC
+/Dandelion{0 0.29 0.84 0 setcmykcolor}DC/Apricot{0 0.32 0.52 0
+setcmykcolor}DC/Peach{0 0.50 0.70 0 setcmykcolor}DC/Melon{0 0.46 0.50 0
+setcmykcolor}DC/YellowOrange{0 0.42 1 0 setcmykcolor}DC/Orange{0 0.61
+0.87 0 setcmykcolor}DC/BurntOrange{0 0.51 1 0 setcmykcolor}DC
+/Bittersweet{0 0.75 1 0.24 setcmykcolor}DC/RedOrange{0 0.77 0.87 0
+setcmykcolor}DC/Mahogany{0 0.85 0.87 0.35 setcmykcolor}DC/Maroon{0 0.87
+0.68 0.32 setcmykcolor}DC/BrickRed{0 0.89 0.94 0.28 setcmykcolor}DC/Red{
+0 1 1 0 setcmykcolor}DC/OrangeRed{0 1 0.50 0 setcmykcolor}DC/RubineRed{
+0 1 0.13 0 setcmykcolor}DC/WildStrawberry{0 0.96 0.39 0 setcmykcolor}DC
+/Salmon{0 0.53 0.38 0 setcmykcolor}DC/CarnationPink{0 0.63 0 0
+setcmykcolor}DC/Magenta{0 1 0 0 setcmykcolor}DC/VioletRed{0 0.81 0 0
+setcmykcolor}DC/Rhodamine{0 0.82 0 0 setcmykcolor}DC/Mulberry{0.34 0.90
+0 0.02 setcmykcolor}DC/RedViolet{0.07 0.90 0 0.34 setcmykcolor}DC
+/Fuchsia{0.47 0.91 0 0.08 setcmykcolor}DC/Lavender{0 0.48 0 0
+setcmykcolor}DC/Thistle{0.12 0.59 0 0 setcmykcolor}DC/Orchid{0.32 0.64 0
+0 setcmykcolor}DC/DarkOrchid{0.40 0.80 0.20 0 setcmykcolor}DC/Purple{
+0.45 0.86 0 0 setcmykcolor}DC/Plum{0.50 1 0 0 setcmykcolor}DC/Violet{
+0.79 0.88 0 0 setcmykcolor}DC/RoyalPurple{0.75 0.90 0 0 setcmykcolor}DC
+/BlueViolet{0.86 0.91 0 0.04 setcmykcolor}DC/Periwinkle{0.57 0.55 0 0
+setcmykcolor}DC/CadetBlue{0.62 0.57 0.23 0 setcmykcolor}DC
+/CornflowerBlue{0.65 0.13 0 0 setcmykcolor}DC/MidnightBlue{0.98 0.13 0
+0.43 setcmykcolor}DC/NavyBlue{0.94 0.54 0 0 setcmykcolor}DC/RoyalBlue{1
+0.50 0 0 setcmykcolor}DC/Blue{1 1 0 0 setcmykcolor}DC/Cerulean{0.94 0.11
+0 0 setcmykcolor}DC/Cyan{1 0 0 0 setcmykcolor}DC/ProcessBlue{0.96 0 0 0
+setcmykcolor}DC/SkyBlue{0.62 0 0.12 0 setcmykcolor}DC/Turquoise{0.85 0
+0.20 0 setcmykcolor}DC/TealBlue{0.86 0 0.34 0.02 setcmykcolor}DC
+/Aquamarine{0.82 0 0.30 0 setcmykcolor}DC/BlueGreen{0.85 0 0.33 0
+setcmykcolor}DC/Emerald{1 0 0.50 0 setcmykcolor}DC/JungleGreen{0.99 0
+0.52 0 setcmykcolor}DC/SeaGreen{0.69 0 0.50 0 setcmykcolor}DC/Green{1 0
+1 0 setcmykcolor}DC/ForestGreen{0.91 0 0.88 0.12 setcmykcolor}DC
+/PineGreen{0.92 0 0.59 0.25 setcmykcolor}DC/LimeGreen{0.50 0 1 0
+setcmykcolor}DC/YellowGreen{0.44 0 0.74 0 setcmykcolor}DC/SpringGreen{
+0.26 0 0.76 0 setcmykcolor}DC/OliveGreen{0.64 0 0.95 0.40 setcmykcolor}
+DC/RawSienna{0 0.72 1 0.45 setcmykcolor}DC/Sepia{0 0.83 1 0.70
+setcmykcolor}DC/Brown{0 0.81 1 0.60 setcmykcolor}DC/Tan{0.14 0.42 0.56 0
+setcmykcolor}DC/Gray{0 0 0 0.50 setcmykcolor}DC/Black{0 0 0 1
+setcmykcolor}DC/White{0 0 0 0 setcmykcolor}DC end
+
+%%EndProcSet
+%%BeginFont: LCIRCLEW10
+%!PS-AdobeFont-1.1: LCIRCLEW10 1.001
+%%CreationDate: 1992 Oct 23 20:22:00
+%%RevisionDate: 2001 Jun 05 20:22:00
+% Copyright (C) 1997, 2001 American Mathematical Society. All Rights Reserved.
+11 dict begin
+/FontInfo 7 dict dup begin
+/version (1.001) readonly def
+/Notice (Copyright (C) 1997, 2001 American Mathematical Society. All Rights Reserved) readonly def
+/FullName (LCIRCLEW10) readonly def
+/FamilyName (LaTeX) readonly def
+/Weight (Bold) readonly def
+/ItalicAngle 0 def
+/isFixedPitch false def
+end readonly def
+/FontName /LCIRCLEW10 def
+/PaintType 0 def
+/FontType 1 def
+/FontMatrix [0.001 0 0 0.001 0 0] readonly def
+/Encoding 256 array
+0 1 255 {1 index exch /.notdef put} for
+dup 4 /a4 put
+dup 5 /a5 put
+dup 6 /a6 put
+dup 7 /a7 put
+readonly def
+/FontBBox{-2000 -2000 2080 2080}readonly def
+/UniqueID 5011943 def
+currentdict end
+currentfile eexec
+D9D66F637A9E5292A4933615152D29EEC26E1BED2E48CAB7AC058698EA30B07E
+F8BDB66981B14445E1107420FDAF32EDBD5C26E35B334E3AF24373B2A13984D9
+1D56801ACCF98612DE2C19685E0F4D52369AD642D169AB57DAB10665C6C01538
+497544391FABD08A483766E9B5C7ABA9A537C053A8ADC16DEBD8B5C9E1EDEB21
+E4E89B0945C0737B96F0194585BE0D9B958F1030EA84710C31971BA7E93777C2
+0658995DC8702442780303E948079822B9EE0C531A5CC49578EB9E683CB77495
+DF613FBDC4536BD7A90F044B7EEE6EACA2042539F62789EA39AA16433AC4BD0F
+98AAA04894F5487C279D2766B50B23E16D7F1023E387F60757E6C80FAE85A8AD
+149D104B38BABA49C58CCD52B719D635E892DCE74F3D283407537FE6CF45E192
+54BF678237D2B8B3C0AE474E96765078627EFAC8AA84DBF87784E5E755C587AB
+BE50DF55D35CDD05D96F562153E2016C3D23ED27DEF2C3908BD0BE882E838796
+BA837E4B671E2CEC2471BC438FAFA250F12170D86934A19C468D5EE6C8B2428C
+AF1EA0FBCE58BABD5BD3A354CB89003AFF34BB325334141E622CAC8CC29F962F
+E4E4FBB6C0C21D4B0835248F760476BE1B36948376B6A4FBB98E9D9F49D97132
+7166B1D32CB3E6590B11917FF0244AC94551E6EF79FCEB8FD65D947E2B209930
+4DEFA82AF22E5320B8A19C0B968D88806CCCC1FC5934ED4B8FCA05AA42A725B0
+1FB85D31D75E9F198EC6D3A0920C9298E2F1535FF124C0760E00054F631218AD
+BACF10F693891EFB272786596ABEA45AD4A2860C4E346515C79FCE68FE8B973D
+F54F8D267370670A62546B001E39136F45CC78192A31EF35C1415522DBB171A6
+E36B3DD83802C2305228A4989C062F84219987A9585C33DDBD17150A39A3CA2D
+A2A91BA35367D7A031E6F0965F920B26577B7FE34FD3EC315837EC1D91E1442C
+2C3515DE36B9FDAB2AB6C742C7D27B63843146711159C1202B67BFD05B61C2C2
+B9F2158FF806B504D8F4256A8A26071309DE213B55DC08BD1B7736E37FAAE154
+EEDC361EB417EECB1EE914448060975EE3A7373C3A15976847AEC4038566CFA9
+FE199A54D8DE6CA6DEAA701F53AB2B4C9BD3BD0962FE4413AEF395D05D93BBCD
+B2F46C23F2036069640C1C9AFEFE5C29ED70BA2B1EC197C6109A8842F3B92999
+B9F0CA18022E4EA0A178996AAFE698A0CEEC13785C8AC50AFD0985F401EC4E3A
+280662EB69DFD6DEB6795F4F32B1400C26068C0E3D5729F72C363C14590F6538
+8A589445E06F98F54C6124223CCC1AA6F62B5E0DD43949E014DA39B0E614D37F
+341BF750F2175EA1D0D15CC0605BE4E6AB8023782D3029F6C118435CE4DB0124
+D477F40A275C6DBFAF97AD4622180CAA7A631B8A9343992ADF48436319D72082
+C40D41B365ADD556A6CD5C3A870C65FDF0F578EFEE8F6CBF0C87421EC91B166B
+74CF8C2F10CB05AFEC9278B768FB8A1C3FA67D17B9F2AD485432A1F1906E633A
+B46EBD59F9CD686C8571B62505E71C2F2658497A5A1E73A80DBAB5714150DFBD
+5F266E58DD6174EA1A8DD2149985546EACB6AC23934B30B08B9F297E94A27CF3
+42FF4DF7A0C1F58A05AA17942F651E60F071BD80A2D9665A1929D5B4BB1F17E8
+450CA6513C3127F2B461DF3E9D5997350533096E47E3FEA41A3DC7E04E
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+cleartomark
+%%EndFont
+%%BeginFont: LCIRCLE10
+%!PS-AdobeFont-1.1: LCIRCLE10 1.001
+%%CreationDate: 1992 Oct 23 20:21:59
+%%RevisionDate: 2001 Jun 05 20:21:59
+% Copyright (C) 1997, 2001 American Mathematical Society. All Rights Reserved.
+11 dict begin
+/FontInfo 7 dict dup begin
+/version (1.001) readonly def
+/Notice (Copyright (C) 1997, 2001 American Mathematical Society. All Rights Reserved) readonly def
+/FullName (LCIRCLE10) readonly def
+/FamilyName (LaTeX) readonly def
+/Weight (Medium) readonly def
+/ItalicAngle 0 def
+/isFixedPitch false def
+end readonly def
+/FontName /LCIRCLE10 def
+/PaintType 0 def
+/FontType 1 def
+/FontMatrix [0.001 0 0 0.001 0 0] readonly def
+/Encoding 256 array
+0 1 255 {1 index exch /.notdef put} for
+dup 4 /a4 put
+dup 5 /a5 put
+dup 6 /a6 put
+dup 7 /a7 put
+readonly def
+/FontBBox{-2000 -2000 2040 2040}readonly def
+/UniqueID 5011942 def
+currentdict end
+currentfile eexec
+D9D66F637A9E5292A4933615152D29EEC26E1BED2E48CAB7AC058698EA30B07E
+F8BDB66981B14445E1107420FDAF32EDBD5C26E35B334E3AF24373B2A13984D9
+1D56801ACCF98612DE2C19685E0F4D52369AD642D169AB57DAB10665C6C01538
+497544391FABD08A483766E9B5C7ABA9A537C053A8ADC16DEBD8B5C9E1EDEB21
+E4E89B0945C0737B96F0194585BE0D9B958F1030EA84710C31971BA7E93777C2
+0658995DC8702442780303E948079822B9EE0C531A5CC49578EB9E683CB77495
+DF613FBDC4536BD7A90F044B7EEE6EACA2042539F62789EA39AA16433AC4BD0F
+98AAA04894F5487C279D2766B50B23E16D7F1023E387FA4165DF522DB290D390
+B669550A43638C3C9CC38C7667A22D27F9DB1542620110A8671B2713C8DB93D3
+4C500474AC190831F9C7441DC4A7C27EE88DAEF10D7AEE6FDB22E7625E802B4C
+FCEE0DC79988734BDA39B9896B1833D4BEC4F91DB321F343F57B3FC5ECA13AEA
+AB108165934BDE65D2EB5A62BD395AB84402D4A2703E3DC3BEC860D5A4EB785A
+1D8D0D1AE7D31BFCD3ABE3E9779B6BC28D93CFCFD8461032D969F1C9A53A6DCA
+321062C6750132DD47444F208275E5000794E261F842CA01FD5DCA6F8C92C7EA
+E2D8D66ADB1194BD8AC59E9191895A2FCA88F32DA2B27717F18C258EE2402C69
+5655EE4D15708452687828A90653E9FC2707F1E9ACA413DAD6E5EE607F6DCB97
+09B7195203A395C97CCC7390F38D69AEC6323A0AAE0A05958B7987701BBD6497
+F95D8653699C39F179820FB8C2DBD7A4E7EDF03E83F7536946A3F532650AC5CD
+48C10BA3AB8F67915EAC0053592CA317E0A8EFD1322398DB7D9B32ECE97791A0
+0B49839C58E426531833D30F153863E92A79516C2878AEE6916F0FA78F94714E
+D709C10DB24955FC0DE6769D34E4E1DB2ADED1775C5A5A6313C93B6A0195311B
+4A334B4D9B914EA59194239AAD1358BC269B8CBD35A7685ACB29282D46440A38
+083B9CB2258BB81E2489B5FBF551AEA1330D4DF70E9E650964A369CA2F77DEBD
+0CDBCECDD2DFE4EE609FBBCA49DDD2E80830BDFC1C575CED40B4EB39EF89C7AE
+9EB8133E5A5D01442844AA268EB596FB8EA2DAF179A6C716775C5758B6917C9F
+9FA128CE877D5FE74323CADD648C2EC613942134DE109B40A48028C7438532ED
+53505E612E153790B79E78D38A8DB18F201692C9CE52CBDE0250832C10ED39E3
+0F19F0B43BEEE706CF2145FA8BC13F3FE9B8DEAF74ACD5DB40CD81ED7CD6CE3B
+AE632A893C184E3182A15A1438A147FCC9220501F585AF23E90F3E41D3B64C5B
+B2C8B49C2D74E140D9EFCB173EBABAD6436EFBC19B675B2FC52D839B6BE9F2C7
+2D6A364AC76170E45EE90A7B173B26B6E433F1B4AD587AA4C5D07238D13B562C
+3FDAD367AC026499274137739A6EF8525BD017CBAF7AA21EBD64E88F7DDD49A4
+88424A94003628D9FBB077B8594822238F70E012EFDB5AEE62FA96FF8141C831
+D79F533DA5F77E596F804BE884FE2C87C255FCF61DFC39159330D9419ECA7643
+1CFFDE3084E6F813138A4EB3378E962EC67EE992D3BC03DAE4013F71DDEA78FB
+55CFC6E36A07527CBFAEB45DBFFC3F6F60AB782078200C56CC54C512180B79FC
+A6A06734BDF815549B126587886CECC2147F1103B1124C2FC749B45FBFD0
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+cleartomark
+%%EndFont
+%%BeginFont: CMSSBX10
+%!PS-AdobeFont-1.1: CMSSBX10 1.0
+%%CreationDate: 1991 Aug 20 16:43:06
+% Copyright (C) 1997 American Mathematical Society. All Rights Reserved.
+11 dict begin
+/FontInfo 7 dict dup begin
+/version (1.0) readonly def
+/Notice (Copyright (C) 1997 American Mathematical Society. All Rights Reserved) readonly def
+/FullName (CMSSBX10) readonly def
+/FamilyName (Computer Modern) readonly def
+/Weight (Bold) readonly def
+/ItalicAngle 0 def
+/isFixedPitch false def
+end readonly def
+/FontName /CMSSBX10 def
+/PaintType 0 def
+/FontType 1 def
+/FontMatrix [0.001 0 0 0.001 0 0] readonly def
+/Encoding 256 array
+0 1 255 {1 index exch /.notdef put} for
+dup 12 /fi put
+dup 13 /fl put
+dup 97 /a put
+dup 98 /b put
+dup 100 /d put
+dup 102 /f put
+dup 103 /g put
+dup 105 /i put
+dup 111 /o put
+dup 112 /p put
+dup 115 /s put
+dup 116 /t put
+dup 117 /u put
+readonly def
+/FontBBox{-71 -250 1099 780}readonly def
+/UniqueID 5000806 def
+currentdict end
+currentfile eexec
+D9D66F633B846A97B686A97E45A3D0AA0529731C99A784CCBE85B4993B2EEBDE
+3B12D472B7CF54651EF21185116A69AB1096ED4BAD2F646635E019B6417CC77B
+532F85D811C70D1429A19A5307EF63EB5C5E02C89FC6C20F6D9D89E7D91FE470
+B72BEFDA23F5DF76BE05AF4CE93137A219ED8A04A9D7D6FDF37E6B7FCDE0D90B
+986423E5960A5D9FBB4C956556E8DF90CBFAEC476FA36FD9A5C8175C9AF513FE
+D919C2DDD26BDC0D99398B9F4D03D5993DFC0931DC68A9127B5D4E0B0EC0247B
+E3E94556B49E4EAF6EA99F1420405194F4D8D644F28FE1F090E80BF5C7D59585
+C1AE46D025A67CD5A59ECBDE2AAF87F725A9843589338F85C6176E7F6DAB2032
+74BA5CDC992D97660FDB3962D486E2682550AF11DECBCB7F76A28A4177905B2E
+F4767CA41528636EA69E80B3A1D33060B9F0250896EF2431F4530727CBBBCB63
+5D0CC646976759E52EB09E65B7110CA7A16EB65E0F9DBD26032DBD90A6964D18
+6B8BC2030609B972DA155820C9FA67A1A26B9BC9712A9A5AF82343D16BCC542F
+890ED28C0BA88F875CE90B1910D1A8FAFA6506F893CA462FDAA96E2A71ABC8A9
+A209E7AEB0E41C5A3ADE180857031416EA0123B75292427B282D9C21D765A8C6
+82107AF774BAEFA24DCB2DB22410CA3C540C0F9D108362C9C9C81FD259BFA359
+D7289FC6963978B46CCE8744FC96D5F106A59311646E6C4C6E520AAAA9719D68
+9032C53E3C38EE31A3E9995FB08207BAF83F0FCEF63A536528839428AD1E8A68
+F254B65CEC6ADBDBB524D4639388374A5C74C46DF2FD1A30C7B61995ED32BFFB
+7F06514E444BB108F3BE17F643D2BBFCB2947FA98789142D00B63105B09B9F24
+86E3FAF44F38E9F91A405408481FAD3B8B60381AC52FE674CE23C2E2F688C244
+EB64A97378970E7DEAB6FD875ABAA19DFA10D3FFB5D2AEE741A277B5147C8103
+1BB179D97426EFA47587DC7D60856B369CC280AFF938EFE801F7140730187895
+5E5405EB740BC38B48A7A84437916B550A65C7069CD0940D54DDFCF2EABBAF6B
+ED1681F1E44855C53DEDDE611A36118430BBD52A00C12ECAA9229A2127D51675
+CF2C2F3B0D7FC536869254DD2013DBAC46247851A4E1FE51870FB96E3817B22F
+7BB93DF5EB5B056BD4958940CBD75917197D0550C2A1E4E09B068AF59E949877
+CA94CB81FB2E659EF5C30E0FCC86FB2521D0B40C610BC4D91F103E9802E6F01D
+76A83FD61DD32F929DB65E5DD049EBCA5C0644562DB503A4EDE38502B15B7E44
+4F4B51D80171DFC471E17398AD7AD612B04889FD5142CD95AFE005CBBA52943C
+D9FEE9F74F6A696A9A00D516329C135268FA3677B1634076BC793F6E6A445D85
+6897E378582F8B9B306BC104A14D592EE3A0B70B0D0D680E3179D7B8AEF6954A
+7B9D2B643E86710197FFF409AC79996CC844C7444C67E20662672F2E27306307
+8EFDA47034A596F629CBFA470F94063C93601ACBED790E7D97089888B4C0C07F
+D5539F4E7FF2005B0191737D4A871F35D6732847E63FAFA851D905D27436345B
+95C61ADC6E58C44118FACCD2AEA13D2C57F190FE38D9F62AF899FF15551F3CA7
+1D488168F402652079EBD8D00B2A515C69E6FEC3D7F7DB1527D347C2951176AE
+440F937C3544E1A956D98B2D582DCD9E51D8FB02722725A8B6420446C50778ED
+D15DEC7A461765AD6F526AA8E3286511C061DAB885DE4DBA657A397F6D6C77AA
+AEE26C65CA544E0D0A6357E8CA87CAB843337664A2C115346D30B9CE490590A1
+B21709B9AF1040B4D2A3D33638DF166B21A27C63A4BCE72C12E95B831A350A01
+64D3F6581FD590D40B25E4F1B2F7599E059A683D2E6A4727DAF51A6E612A1BBC
+5B568D689F41B89EC91BF2D7B12035E082499F2AB08B7AA9DB0E472F21C90EEC
+E96424FB4CE61624660383E8AD18E9C194710CF2B14B1EBFF05A3FE75955CF58
+CAC94E737F025252B04F77A8EF4CE139A23994FA6BA88AEFCFE768DC95C1B22D
+4C30F57169E55A05A8EE622DBF4165ACABB824CED4BB6DA366866ADF228CCA97
+14ED2EA5DB1C2DF37C2EAC63B4B2697CB9809AC1FF98496B4BAA176F096B3A20
+B728501D59A8F534C45855BE4AE363B2FDCE74C0DCA3E4D30BEABC147A2665F1
+2C355EF244053AA2004074024759AAF201DF8635D98C27881E5DAA957399F1E6
+366EF44391BF3CB1C6B7A338F38AB816BDC7B6F86480D7623E837FB4642065B0
+D105FE3B2DB40DBEF76EACF970CF6EFC8B0D686D85239C2C2EB51FEA26C1B44C
+5DC313721379B01AD731183671BE07D472C2E89C3949184DF0A4C93CF862D4C2
+20108CECCCED4BC9C8866273E2C80EA5B9D9E8EDFF140157F1059B8B12536F91
+6B273C1BBB7B61B86EC24B25EA5BD09D04A1A563A11835A96D943F79CD888359
+363647FDE8B2B9CFECD09B16DE3773E2D1C0649D8691B6076B83FF45EA2D0B9C
+3568CF9C63F169743E1AEC10F1C87B312BD5D0FBE6C3130983C320210BCE5C02
+B2CCD3FE2DB5DF1E3AAF7C125A6AA813C987A94835EC53BB97281811F019B13C
+5B1552A2DE40C21B6A0CF3E94B0C919DDD7C7CAEF961A53F3FB80E0BED3387FA
+80BC18B25A0311943E0DC39A502C591C6FDFD331371524FE45750B188295FE28
+5C67C573607E083A542A9E005066FD60FD061EB5B67207C2C87D772C55C879D0
+7DEC57C5F9D9B4F87CC8DD1396D6F2B224BF0771C8230B02796E5879C0D02FB1
+AB650123A48179F267F5E2C9222C9AEA7E9B6C510C217E0402681163A4C11AD3
+69C8770B5B89B4DE3B010957290E57EF2D1EFC58CB11B192326235E2587DFCA7
+C7B1A76FF10C867C2BAFB40C03873BF51F46EC43E449E502266D28B0BB42E032
+7FA6A2360E4C81D9BF9791CF7D8D1DC0D4E9E043FC4C6497F05A28CECAD727F3
+DBC8DC96DEC461FF23F85F4FB34A57DDFECD43BF35C67E66DD906929292EAB25
+E4C3DEABA35DDED81D4633153FCF8F5AC8BF60B79BB8D7997BCBDD43EFFBBAD5
+B9B7AAB40B83015EA82FA27AD09EB760C8DEF65768337DD7F1FBE3A0DAF336CA
+ADA5231EC4EAE1F35F9C026E29518B5325C83EA6D462ED4CCD2A0750B4065B81
+711B66C30020FCED910AC5D0C0060116D78AFD558ED2096F39B841D88499DE45
+46EC34D701D729D7AB4F8256DF5F9181912824D61819D2ED1385E9BF90078902
+1D60A8826DD53467F86E1473E00956608C3F5BF6BD665CF2394965699B95DAA1
+56826AC20578B29A74225E15FFD7690960D3D88EDE0CFECD642E91684CB5DCBB
+6573581C51DCBD19DC75E01654F7EF2E0852D05210BDB256D9A4CBC83494825B
+3503116C168389AD3C5182CA0A3D95D9F30D32A95414870ED722B319FF54AB19
+935A3C6B9C1FE77057652F8E67A2EE669278BAFE2AAE7F557CDCB0FC3B94E7D4
+46000C27471903154D0793E94A98D3B05F9E86AF724C2E8FD4BBDFDC9DA63EF4
+8A8DECCD7C6C946D1913DE57348048175BEB263297D4CFDE10169AE5D6C295A6
+218673D6A7D971313CE00F5F2F14F3B62D2EB7942CCB61037138706CA16893CC
+5DD8279B8BF2D8687667DFEDD64A32FCEDDA493C03CDEB60FC4D4078D74B24AC
+D218E8BFAAA5C11A525A8765FF74B5E901C3934F3DA74DF5FC1EBDCDA387C6F3
+08EEC2843351AA85BAD1ABB0A4B09E56E295EA6B71D546AA45C271196E042A1E
+8B234A0CF7B52D336517F60F3C5E53BAF70FE561AAABBEE9056DA05E07E2939C
+CD0C4D6DFB76882163E6B164813708391F64DE02A65582A3B6E866AD47C273B5
+147F57D527254403D5176F4BF465082A966E816AA6EDABADBE6BC4C6589E0F46
+154CD2903367EFFBA25F597726C56E654A32E054FDD16F5C9C475F1960619288
+977260922F472A4BBBE67B753281E28CC11F82C03A250A716AB269FF91556AC0
+C8E4C25A37352D7445A0C6B23D0691566325DAFE53A18181ED5BFF8B5E715877
+EFF54B3446666A088454ABE1E365FC07B9191A405E5F9CEA5C61DFA5A58A2CD0
+5751439B64C58C46F699090E7FF1D531436C7162E4C1C4F91537276E36CD824B
+117CABA4543114805A7199E6C59070F0905629A1A1F43E69ACDB3F307D76AD8F
+32F0C3588253A7E226209F7710D208EDF67650B3174D2660242EF5FCFF44FF24
+BCB84404A1E3E2665891D4276A379A69A056C4675A6CADFEC5555D70F1B44A47
+38EF2217AC6F0B917CB9B8CDFDBECC7BEE9E6A74
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+cleartomark
+%%EndFont
+%%BeginFont: CMSL12
+%!PS-AdobeFont-1.1: CMSL12 1.0
+%%CreationDate: 1991 Aug 20 16:40:41
+% Copyright (C) 1997 American Mathematical Society. All Rights Reserved.
+11 dict begin
+/FontInfo 7 dict dup begin
+/version (1.0) readonly def
+/Notice (Copyright (C) 1997 American Mathematical Society. All Rights Reserved) readonly def
+/FullName (CMSL12) readonly def
+/FamilyName (Computer Modern) readonly def
+/Weight (Medium) readonly def
+/ItalicAngle -9.46 def
+/isFixedPitch false def
+end readonly def
+/FontName /CMSL12 def
+/PaintType 0 def
+/FontType 1 def
+/FontMatrix [0.001 0 0 0.001 0 0] readonly def
+/Encoding 256 array
+0 1 255 {1 index exch /.notdef put} for
+dup 35 /numbersign put
+dup 51 /three put
+dup 67 /C put
+dup 69 /E put
+dup 70 /F put
+dup 84 /T put
+dup 97 /a put
+dup 101 /e put
+dup 104 /h put
+dup 105 /i put
+dup 108 /l put
+dup 109 /m put
+dup 110 /n put
+dup 111 /o put
+dup 112 /p put
+dup 115 /s put
+dup 116 /t put
+dup 120 /x put
+readonly def
+/FontBBox{-56 -251 1102 750}readonly def
+/UniqueID 5000799 def
+currentdict end
+currentfile eexec
+D9D66F633B846A97B686A97E45A3D0AA0529731C99A784CCBE85B4993B2EEBDE
+3B12D472B7CF54651EF21185116A69AB1096ED4BAD2F646635E019B6417CC77B
+532F85D811C70D1429A19A5307EF63EB5C5E02C89FC6C20F6D9D89E7D91FE470
+B72BEFDA23F5DF76BE05AF4CE93137A219ED8A04A9D7D6FDF37E6B7FCDE0D90B
+986423E5960A5D9FBB4C956556E8DF90CBFAEC476FA36FD9A5C8175C9AF513FE
+D919C2DDD26BDC0D99398B9F4D03D6A8F05B47AF95EF28A9C561DBDC98C47CF5
+55FBD18DCEF738EFB8E96B4B61D9C1A24F5FE2B29EF89EA4320BCB1D16E30E22
+AB926EBADAACFDC5784740982ADC9619BFDF3586F8C12E6F6E588B44226DCB87
+DEFC33CDC78D0E39CE42F3CD39130758A1DA6723A3BFE0FC6ACE02389569609D
+E0A2F8219BCA30B5669A6EF48E4FC32BBCC3CA7CC2C7615DACC771E59FDCBA30
+17F349B2BEF4EC6B45905D23BDEEC669B3BF525881857B942BF724608CBA8DA8
+37CB92A472B89421D4BA156248D4F4F7AA90DA4EEEB4B3D57A4C2F0F41B7E669
+9AA74D9F4743AC680A1EA18B567BBD8A2BCCEAC1795CCB5188C77C5B199027DF
+F158135941CD020826973194789ED9B5279136A8B9D0D9979E5E80F95A223851
+BC17E0EBB94FDAE8F32FE889774D72FA17E179F5AF39385406FBA973734BCAE5
+4DD33DEA30B1BCAA9207D96BDBC6AE9519E3603AC39A09B2A52ADDF935FE10EA
+A759515DF32688D0E95B1D37CE23E9F45A114572761B088BAB7464D8A1BF7BEF
+EDFEC4E472006F678C5E2F6E61AF9E5A5D6DB85600E53818535889F6C31061A4
+9A6C369C2680CB769A5540D5A62429DAEE4E2AF5971BC12DAF37B3DAEB66BA94
+2998AD18DD63DF3A15EB2FC41AC343063AEAFCD5D2E1BB23C444D4671A954A93
+D554797F45A27AC629EF606552DAF0A70B539A55D6650446540E197351E18723
+1A81C4DF4BDAF4FA2F411723FC05B9C2B63676B9AE9013902CF9687200FE6F77
+30D33F2319AD36876F2F99783468B94DC015433E24640A767F249797A7B240A8
+3628220DFE56BF68BED82B9FEA11E4051191DA2A8C47F96F335DC419013B4E02
+384093D41196BE8A9945207B90A4C168D2B6742820A3CBDA4D64D3D0E41A892B
+1630644639930826D6BBA1588F4FF170319C5A0DFC945BBA547C9D0C98BDA805
+23E9C607DFBD30DCC0118B85B6DEC668F400A3267ABC950B5DE3D40E0457395C
+FD715301FEF4DEE99D912DD77BB93F26F37EF6A4140DE86E2C23E72028E482F7
+30F92ECFB7188378B1B232E543C838C4B5C4A9C1692923215CA55C15A6562FA3
+4BA02B802FB80A29B681055137EC7C774B7F84D058F14EF16BB5DBBDC94D4D2B
+C4601F87C22ABBC3425B07BF5F95780D5432FCEAD6D48383FEF5713B2A7A51A1
+52E5C97284C1994CBDB754331ED9CB4BC9D11D97814CE4D7371661B1685A0755
+319B2950EA5D843EC2A3BDD4A4BF82AC893F7D325D027DA63EEA7AFA4E7C000C
+56ADC289438AFC49683A1436BC3D10974D8CC0FD11D26219107A4AA73E020677
+1AF959629FB079A2AEE300158960329DDD2DAAC5321313BBB8EF51C09AEC0814
+02185DBE853D84AD5414FD92B0D7C2913FEA1C894318F0D765863CA113029162
+42B72D1A52CEAEF065BD9E329236E892B30D153CDABEF4E8F59B97B0C82D13CA
+68B6820F32E08C6068484C5C09B9825F3E71849B4A0501D32A2AC67CF65C01F9
+A13FC802CEAE72F5CB3E8DB9209595F2C25E7AA4753C7F235E7C9C0F634FF126
+024D47CA3A4E77FF05B51BB186BF54AEDF097779E866C03E5F6BB12D776FA0CE
+DD5EBE9A74A93FEF74A184B77EF49DA74B5186466FEA207EB0231EDE8744C7B4
+1DBAAB4EDC69752B2A11FC39C0DEF7E7D834656831E8C0189AA7CD831158AD55
+B1122AAF63978917FB08BC98E27909ADC5A75FE6BA0374BB3D6FA6CCB3B89CE5
+334223CBF8D8754D99FF673D9218568BF39E2D52D3AE3AC178A3A940C99CD519
+FA9F96D0F83AE3BAB0C55F43AB54AB44D2EFD1376BD476077D7AA16866F01E68
+0DFC1B1CE3BCCB92C0F0B5CAF491B34F09EFAFDBEDD8673B1288CBE05AAE6B5D
+092612997C1C6D5D73197A7F28AA7BE2ACEA8144B3A7E95A9FB11C6DEAE34669
+C48CA69075786D40A83628F4F9BA6AAB56B139D2BB4E343552FB6B2C300C98F8
+C9E7E6D510A48BC47AD2ED9C58B2F70E5D68E1E1E61FA10EAD20B814030CE263
+78FBD4ACEA60F11E0DD2BB594A923B0BD7FB8479AAC4F5F33D28531F36F9DE5C
+E266B1E04D82858606F47DC8DF214C32C75A33E6FC85E41366B9109CB5E968A8
+AC75AF924E9B95D709ABBA3AD3E3701524F7A66F7BD25EC50F1DCFBB72919E23
+5049596AFF7FAC85EC87B4B0C98ADD2C3D9AA0776F6DD9C6E501FFA7F924AE24
+71D12F0CBAD79968D1728AF322CFF7585833B1B9FA5DFBC30446A4E158A0D465
+5C00B4B30DFD2BCFF4D6F0ECF84438934B588A1696EDD8B02B79006F411DA686
+FD34FFA43223D06DB9A2AD76119024DBC1EBDD90F8793D6F15E098815AB96663
+C1DF1B29FA275F4FB37F95595AFF8D163925BACFF6883A3399D63A2DE2AE157B
+80E66E2A0ADD8CCBD249382C7FDDFD0E159E33B374AFBD793A5C6DBDF3B11DFC
+435710C5D29ACBA4CDA79EDB626EBED391E075C0096D6B29A3B03CC8B6F99515
+4C8433B6C52B27513FBED7032C7CC2558A0E4CBC623AAAB83C6514797E4C6E87
+FE0D7E2688F2844EB82298E27D3AE35165C19B7750B3C3BCC3635BFDAA1926ED
+0B5643E746C732FF44F502F2B63EB6A1A3086D1255A78D1CC9A6C144DBDE5619
+784CD67FC7EB2C116E1B952785CA3A2BB8DD432E94EB2D6E3C48E1D9814B5A59
+27F4B3011929C48D112EF77D7AB821370BED019A34E15672A94C17FE8F52C32D
+00E6663CA3210ACE443A2E5FF11D315AD19F5BD2E37F3AAB75B898108D0D92E1
+3FE18F87796299ECDBE2E38EF82DA84D85D1A9D37451209B9240C304DA55130B
+19C2AF6DC3B20EF09691FB195468F24F2D6BA27E01FCA8F208A04530CD0CC97B
+BF2E84A67241C9740DBFF06B34ED2C57E8742EAA65849B79FDA9021E9122E7A6
+5FFCFDA67CF086F8D4BBAD42B61F7E832A75102E6D54B69028C09F85FF2426F3
+FB3AAFF1C59643477A906B8B92CD6AE5D6BBCA9552835B528A99499BA7711FAE
+1D2843C067DAA333F5876FD46CB44A96F00ED501891614A7F7D5EC27AA2F4ADE
+C39479A70BBB33FCA19C9F6A6A0880C7DFAF55303F2EA4742C5399FC8DA16289
+45CFB199CA798E2486FD27C9D1D47CBC9249DB2454501F7F551C3532B5BC45F0
+14061708B7E5C70CC9591DA3A0BE51EDBBF665C24545A95BE2825E71F25FA8A9
+DD3EE02C535C7870B0385F50455004AD86526ECAC5CAA1CC250886E202EE14F3
+449722F3A342BBB8A979D39D205B0A102868BFBEE354DB257916B34CE705CEAD
+2F5DCB5F79103EE7FDACFF594B1B28A6B4AA7F57405F93646E506C445E67E1E6
+10AD7EB3F1AEDC9DC34F2B5774DD1A813F88EDD1EF6F8CDB089869122F0ECF88
+54AD00D64F19B0211BE30C6E69F160FC20728D1D54BB99C7C5FF2662598E5436
+A0A903F82327FDF99240575544F72FAC4E86ADF67D28DE3858423BC246598AA4
+52571BA5A5DAB195C318669D977EEBC27C7F5058AC2E10ABF6764FA6110D4B1F
+E1240837376CF5970B802463AC70218D7EC8EB86A2220564515B9A5DA8E6DD72
+507EB02A4B03DDF2925DFEDFED09E7EEEDA4A00AD522F63F3BED2A2E747996F7
+B80A957C3E243CB9D9A5BE6B2AB7029F1D6D9E31CD109D8337D31743593A9AEB
+CB4E9F698559EE63CE66370F733B54D5F5AA936CC06EFFD0974C15CEBCB1FA12
+800768754F751B8E3AD409351912E84152212D6CFC110835831991F20F11203C
+5DEC7D3FC70F115A5DAE9736402EB1252B94E07CEA53A7FC4801643E65F80FAE
+D8D04005F41D1971D45821AFBAA2CF6F95D26AAA4273D6D2C07146755D9F840D
+115E743F0A21F395735E431E5BC613D01F48FE4B296CCE7662F2C3FBB3810308
+15FAE9EFC1091A1EA83EA8ECC1F8E664755CD34C05FBE602CC56EF7DE3146ABC
+36B91CAC038D023304F33F6BCEFEDCEE97F2135D92F61E75DC4B0C368E8B6D7F
+138E5FD61C27E1D6532B4886BA3E9F9001671F23EC8D90263C10708F26BA9643
+FED30E4B591174A398A4E424C0BACF08F08453009341D40CA617DB8D0AFEEBB5
+AC604859A7DC0F23B496871A88A0D60C86988ACF5FBB36E00111200A0A47F00C
+ED10B25566812090C34516E35DC4026000603B9EA1841716D6D0A283B11A95FF
+FB78F1809512555C706A0D2CB0DC176A9A6ABDE8D886E70123F67E2EBE9B3C0D
+061AD73FA8F19A8B85E4150301602EB85C102A3CDAA7344B52DE6D2398725305
+EFEF1233324547F8501B28CA4DB6B42EAF1879CBDBB073FBA787114C804E8671
+73301900BEE94997AA56A1CD30A61937298BF044805411E5C8CC91BE5F7801AC
+C24835CD57A1BFC3A603C4BA111E191DA0B91E1BD541062E0A7A1E9D8C07129D
+BCDD19A0DD18D2C797FAE09D654E88488CED8A62CA454335034056FB1A9FCE26
+B69C70D222E9489BF0F74FD8E48A8B448BB87EFB05955258737C43FCE9F4135E
+306E6C0F0227D6EE241A5AC68EFDDA153ACC5E904A28B26FB11C1F3270D91F11
+520229A19F26D0E2FCEE83A341623C8FDB0024706A3D596601C7ED977B2DF4F9
+A2120D889B790957D4077FECDA09263BAE2A70095C69A45217D980371F9B5D94
+21596CD4E226610734488900EEA8A7F78B98F309A63BA0622E02AB319EE129C0
+3B09EE5D7045DA770DBD9D93367C81700B1093A63366465919A2153E5AC4B071
+9259E4EB5B648271EA2FCE023D11C8497366F29FD173356A8E0CE49AC9478DE4
+B22DFA66F29536E1DFBB725B3C9DA64D6DBF61716C0F5C2650965D67248AAFA8
+DCB6BB3AC473B1AF9CA3614562B4A02BFD23DA2DAF514D924C46053B23ED77F1
+EC6EB809EE43320086542ED19F40844AC3D3A3F0408F8E87DD0D93F9761AEA90
+034B204B6281F7F5614D47C2140738ED3AE36C2BF08DB1D29F0DFD646B493807
+52952CDA66869DF55CDF9A3FA28B356DB13261F5B28797159E4EB25A211DD0AD
+FA7F72113FC8C775CB61892B69AF23E2BFAC1DC14120713268CF3E4F7F38A52E
+4915A6D3FF55DFFBD16695216A5A322281CE448A0342F3D8EE38F271441E734C
+7F02A33D3754DEB720B0B60F686EAF219301FBC5268081ECA38BA0FD6D493C19
+53CB968F5FC0D8A314B6B62998FAD1AB444F53740748C8DD9803DEDEC0E6FE32
+8EDE00DED3AA41FB928E2A8DE40934CF7AB9E42AA459AFB9132BDD03827CB3CE
+ABAC9DFD28CF81319BAAA4CF843BE2AE7D28E7B7A37BB07AB7A3559A8BA62894
+D1F658FDDEFAF2F3D2D953761A0AB09E8F68CD3A3CF8DE249DEEC12C2CFF8DD3
+A50E0C29721EFE270675871AC9182256458A610B4055779B780508045EA4880C
+E66EB40CB8BCB1FEB4D23AD1F963B1DC63A20A7B7CDBC254965B483D978204DB
+796AC849C46695B45A1F6FAEC3A718EF0C9E4601FC974A8CC7569E86DC2DCB53
+1312EAD1E83564D1E69313FD97AE138198E7E05C831F88A90B97A1DBC5750B32
+9D8BB86D07D1720BF1D228F725B0E4C5BD8150437AEEE84809BFB57E69877E1D
+7FAA699371C5250F576F276172B6CE6C90C7CF294D14E30C491B2320C2627C6A
+437C2FB9A4BEFD7479F87ABB83A43492862749FCADBE8A566BFC7C399744C880
+14965D832615DF0C6AE7FBDDF44722F956C4C569C07320BCD4F82CC5BC31C11E
+C24581439CD75DD751710C614E4501633B3DA5BF94173E07154D4BAF390BC7CB
+35F2BA900F4AFA7EDFC501A4FEC556FFA01B2FF4901B0D148CA759B968351EF5
+2B8AE7F33D2D88970E743F8E87B65C725475D3F026BD6255A240601FE6D364F4
+32982A67E1FD95134BBB6AD51F01B19D4D04AC3309B66D740C3D160901994CC5
+73665008A40E44AE53B7D557F29F01DC85C78430B1A9CE4F214D5907E3B6671F
+38D9CD9E0C2779129D35E8F69B8E333B2E9C2BD363454F2C92F7BDD0BDCF1593
+D8CF9938DEB270FF5F23422F174D4CB7F84374EA724708EDE0F993C4C41B60E4
+19163F5F0097D64D7D54184344681519F82DB3ED520A8F208A96B4C2409925B2
+8D2E8E0BD3CE37B65555FF92AC475263FE628C507659472474
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+cleartomark
+%%EndFont
+%%BeginFont: CMSS8
+%!PS-AdobeFont-1.1: CMSS8 1.0
+%%CreationDate: 1991 Aug 20 17:34:12
+% Copyright (C) 1997 American Mathematical Society. All Rights Reserved.
+11 dict begin
+/FontInfo 7 dict dup begin
+/version (1.0) readonly def
+/Notice (Copyright (C) 1997 American Mathematical Society. All Rights Reserved) readonly def
+/FullName (CMSS8) readonly def
+/FamilyName (Computer Modern) readonly def
+/Weight (Medium) readonly def
+/ItalicAngle 0 def
+/isFixedPitch false def
+end readonly def
+/FontName /CMSS8 def
+/PaintType 0 def
+/FontType 1 def
+/FontMatrix [0.001 0 0 0.001 0 0] readonly def
+/Encoding 256 array
+0 1 255 {1 index exch /.notdef put} for
+dup 35 /numbersign put
+dup 50 /two put
+dup 67 /C put
+dup 69 /E put
+dup 70 /F put
+dup 84 /T put
+dup 97 /a put
+dup 101 /e put
+dup 104 /h put
+dup 105 /i put
+dup 108 /l put
+dup 109 /m put
+dup 110 /n put
+dup 111 /o put
+dup 112 /p put
+dup 115 /s put
+dup 116 /t put
+dup 120 /x put
+readonly def
+/FontBBox{-65 -250 1062 761}readonly def
+/UniqueID 5000801 def
+currentdict end
+currentfile eexec
+D9D66F633B846A97B686A97E45A3D0AA052A014267B7904EB3C0D3BD0B83D891
+016CA6CA4B712ADEB258FAAB9A130EE605E61F77FC1B738ABC7C51CD46EF8171
+9098D5FEE67660E69A7AB91B58F29A4D79E57022F783EB0FBBB6D4F4EC35014F
+D2DECBA99459A4C59DF0C6EBA150284454E707DC2100C15B76B4C19B84363758
+469A6C558785B226332152109871A9883487DD7710949204DDCF837E6A8708B8
+2BDBF16FBC7512FAA308A093FE5CF4E9D2405B17498276F99362748F6E97327D
+7CDA3F577075245561191667923D37830EEC37A0161B6A3EC8FDD63CDB8C8D4A
+AD39C69A264813FA79C25E85AC95C71AB965F6C14A4A1ACF5BAE27A5F628B172
+47CF6A12008558438874199C237501B72BFEFE64B606A327623BD8B217E8349B
+7BF5C2204F4DE2FB269845D5714A31151A66064419CCC46A63F8E54B92B5070F
+F3D80801DBEC658CD3926B15BE3D4B7591FC36663D3C03926D0D3637B53BCC22
+73C8E0001B416A65FC67C53383458DC125FD14FFE391BBBA321B5AF5DEF85DBA
+5A5FD759FD2AAB6AF31CDA6202EBB763E3CAC1FF91B1175EF818FD662B60C642
+738A3B4F27822A0560BB7C08AD42F976351FA5225A0E6D56C7FBE06A809CC468
+FB2E90C84FA56C62CB7BBFC80BD94F5C6BC0EED14433A4A356D2D15DC87B34B0
+99A100502F55A32D736757642F9F9719FD9E35A1430A72C254614B4000113705
+5474FCFCE47A6978F69FA467B818309E61598EC18089BB924C393B3FF1280D72
+E1969BF5AD3D1074FF13202D4CC324396BAFF2397DAB2C516C656B6B240F023D
+0C28AEBB957C23012C971D444DD1C4C2BD7DCE178D46CF8EC20DCAB9A930907E
+124F3B3B8D16DBF166BA40CD780DE2155BF21EC2C3E0073422E54A09DF4A9491
+63B55882122F6B40490D81533CB0E16967E32D4F5B5D5D14F578BAA0137704A3
+2386E6AA4E3D160559EB245625253380CE64C30B41B573D7249B0B6157B02EFE
+0D82006B4CF4A294FDDAB5B87CAD0B2D3367F9138EE0922FBDD3D7BFE4C6B297
+762F95616A75D0FC2D2E22D79172DF1A3287C67BD27658A448FC61077B3033AA
+5479ABBF5CD952B5E19E437CD642CDC43FBB26115DCC019FEB3195F4DD09F4AF
+B9F767070B704B5F9E2FDD580CE48F7E6270EA63ECDEC8983E89FA8B76FAF802
+E12D3CED08342B411767BA15B0E04907F887C7EF12973270419115DBED49CE9F
+52558230E92EA3E0D1003FBB6461C198B0CBDB47C24B2BC5AF17BD52E5B5A91F
+534867A6D50BF8B9DEF0F6F6B2B13DA587AA5BAC9C36E7AEBBC0B79C4E10115A
+D4B7FAF31988BD6253C6DF609E6227E9D38E2A93DF8710341BB287E7521FC94F
+0218C13E9A217BF131934E34FF95BC71254434FCE358216C0A1957F74C2E08AE
+2ACFD23AA92245F094C5EBC7B97180B64E069779FF6FBC78E3A6EB3823C8A6B9
+D05825D0F8ACD8DFA14723FBE3058E6A6A0BB42F01C327AACB1B2ADFEFBEEC72
+77B04914961B7EB1305C5E7E11BD0490C67BF07609FFA007EF80E6B58FB9C596
+EE1D7718A57AA6DF754C0E433226A21643A8F4721C42E17F2CE331C0B40AF447
+E3D0CDF81E83F25B411A9963F544676C80D2D2D5FB67765B1FF58452D4CA74E5
+00CB94E0696054C6A66B9964AB204C7BC5AE7C61621AE437BD54B0ED0548A261
+EAEBB22EC6E4D65D81EB358F0ECF8C7525B888E3F1C988044572CB04FFBF909F
+4E4BD0B89C6C8456BAFCD713D8FC5F2D31EC020E3CCA37B414975507CA133D12
+26314158DE314AF17FADCD1F0E6EEE6C0D6977059D6408706BB6303CAB0A371F
+F867FB0B960187CEB1CC053F2F45E38EC3A7EE01414C09200A07511DE83E9D64
+DF0C130B4A6FE55FE8EA9C99DEB559654D081209F5A4889FD03AB994FA98A29C
+D65E629972F3B1D01AA2767692B79BCDA3DDE62675E31EF41E842B04E239C9D9
+C65FC39F267808AE1129306439FF5161F5AA50075BCB02797EF55A3EF83DD352
+C3C84216604ACA4772E0ABC297C2211A432D6C7427835FFA518A39B694866D8A
+928FB1841715D2F8EE576ECB9534A03B583426EC9AA09F8CA56EB1AA655C4197
+E312356AF4A15EE89AD62D889F1B76668013CD05ACCA565ACEA7709295AAEF56
+A366A2EBF87BA190974BB8F648663EA5395EA979F23F0B4E8B83C9AEB5FBDAE2
+AD678DBAFD8BDC5F53623FDEB6B94D20B2B10FC040BA2824F6BB81F35872C31E
+A2304680AC07D65D90CB09C24238BE74DAF0068DC9CC377399AF3A5F2C304865
+A5228E223537BFDC79C5ACB1B2D563D850BE9283596F565EB99C8CBDF307FD7F
+78EF70DA1E27A18EB5B922FAAA43E5968C4E8599C877D764ED86250C957EF80A
+A9B7610ACA4F0200F4CD8F276B5578FE4B0F28B616D7233FC904997105CBF985
+13E86CB2D8217ADF7899627734CBD63A9750F796F88BBD1954C87B06B5274188
+E926FF5F6817657D76966C2145FF1690CF6907052986964FD02B1700993E8EAB
+B5B1790A2FDFC96D164FFEB788D4ED23D157D6BD6C6B50C19E66D0BA83FFC49D
+7A30980467EA05F0537DE1AFB3866AEDC140B15E9801D3F2EBC3A3E32BB2C843
+999059EDF1DEEC0DEC5F6516DAE2E91D45987A445AB6109462AE093DB6393FFB
+73FB56EAF3736C0AD752459748EB479AE71209F6DECDA06CAE0BE2A4F45C0C33
+1D551B495F0F40E3FDE44A3A683BD7B7ACD07F90C9D77240B2472D777A5DADCA
+F0A175A525490EA5FDC2ACB4B903698695A7E2E9FA97CFB5CC88449016FFEA0E
+0F550509FACD6607BEB97544F716520180BA11D577FFD5CAFBB821AB1269E36A
+29509234B2A4E346BEB371C992754518B5DD3F10B619CDB1AFCF1A846CD23AD6
+BB2AC9CFDBD2E14D16F512CB71044431F1B68632E3E66035058AD892DD5A7E78
+7C80935FD3FAF8A4CCB778EAE060C4E37C0AFF4C272F818DCD43B0BA34299837
+D142C0495EA5012D0D026A79CE0784AA0CE105791152B70347CC465CBD5A402E
+D9F46B9D482E27FEC3EFF19B5C7B1758BB4A2290A58F60CAEE7AB45D4C248052
+679FD302905CCE3F6F1D2F3AF58E3C68F058860D68E71E22B677502B9969AF06
+A76E16C5D4EE19F643301E7DAF6994FAF4181C123CA61A6EA8C398F57857DCEB
+BF89E49C44D9592455D41A7FED56761E98AA1F4166651C7960FF9B8E0D45E8ED
+AB56D0CC66B130FC73788D142C71B2408EFE6E225DB3E3B4670EAD6FE22722E6
+5E7192159E07BF1F7F5860A9978F9D985B215221CBC8B60FF26824827E155A92
+F7383542EE280471BE956CED3F843DDE6742EED4C999F988D45B8A48C3487C3C
+467DA056C156A2DC2BC9AC9752A07C1DB4CAD0BEFFC656DAAD636AF40407707A
+18150A41B96577B656995E0F5B20F3ECE7F35E2122DB5343CFF0CA4A63EF34D8
+A695203888EB7B231A5BCF4F47D03770DF8643327CA5D6ADCBD15D131E951C92
+9D08F4A34E5689DEF9B4E1DBBDE134794A4D5625A4E9D86A968D564579B1D0BB
+58DC33C8C7F928FF35124A2F722B655BAB2E6DD6BB951992665A8D3F9FEA2457
+89B9250A841F135C76B08BD01796878BD62EFFB70D62B996A022A340CAF14751
+1F51D1C1D14B56B45621C28FD54E6FA36573781BECF2DD4523FF09656C6CF27A
+651405E4D557669338E57252FC6B149F9338486A887A5F6A93B0EFD0E85648E8
+99D204ED94752BB846B569D219073B64D21877DA2C841018C3C821B4F15ED899
+0D2FDF33EBD8C47AC215FE349CA2D1CE92702F572809BCDB4E723BF5C2918843
+EC6A414D38B02F4AF9E47F63461EA35F84695A8F2FDD33725B3D5B1CC7865F75
+CBDB545A7E1B470DC491A448B9D2E62C9CE9A6C7543864129631A5C27B2F0DC4
+9FF6F911807DA08B2A47F68E0B77BE5DF0714AAEDAC6E6D53434A949C9E958E7
+59FE430D74AFAE40819997AFD228039C70C6BFE716676F92FF4B59C89D4B3024
+FC1F971666131ED4283F1326531823EDE7C692211D148B0575F8408CFEA3D2CF
+A7BD96290408D0B82BF17BFD2160F3330597362CC0361BB0F83B2D6935964A94
+2F1448797A64929761825238E6C5B075E1408C17557E9A9AA1737E014B7A31E4
+B105890326677135125A82E12B0214D33C272542188478A98EB3E51487CDA951
+8036B4C8D9F76CEF3F4CDB373533E1DA1F7B34B24ADFFE4B7C7880F9BD22DB1A
+FD46FC5446D84038C5F8A1
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+cleartomark
+%%EndFont
+%%BeginFont: CMMI12
+%!PS-AdobeFont-1.1: CMMI12 1.100
+%%CreationDate: 1996 Jul 27 08:57:55
+% Copyright (C) 1997 American Mathematical Society. All Rights Reserved.
+11 dict begin
+/FontInfo 7 dict dup begin
+/version (1.100) readonly def
+/Notice (Copyright (C) 1997 American Mathematical Society. All Rights Reserved) readonly def
+/FullName (CMMI12) readonly def
+/FamilyName (Computer Modern) readonly def
+/Weight (Medium) readonly def
+/ItalicAngle -14.04 def
+/isFixedPitch false def
+end readonly def
+/FontName /CMMI12 def
+/PaintType 0 def
+/FontType 1 def
+/FontMatrix [0.001 0 0 0.001 0 0] readonly def
+/Encoding 256 array
+0 1 255 {1 index exch /.notdef put} for
+dup 58 /period put
+readonly def
+/FontBBox{-30 -250 1026 750}readonly def
+/UniqueID 5087386 def
+currentdict end
+currentfile eexec
+D9D66F633B846A97B686A97E45A3D0AA0529731C99A784CCBE85B4993B2EEBDE
+3B12D472B7CF54651EF21185116A69AB1096ED4BAD2F646635E019B6417CC77B
+532F85D811C70D1429A19A5307EF63EB5C5E02C89FC6C20F6D9D89E7D91FE470
+B72BEFDA23F5DF76BE05AF4CE93137A219ED8A04A9D7D6FDF37E6B7FCDE0D90B
+986423E5960A5D9FBB4C956556E8DF90CBFAEC476FA36FD9A5C8175C9AF513FE
+D919C2DDD26BDC0D99398B9F4D03D6A8F05B47AF95EF28A9C561DBDC98C47CF5
+5250011D19E9366EB6FD153D3A100CAA6212E3D5D93990737F8D326D347B7EDC
+4391C9DF440285B8FC159D0E98D4258FC57892DCC57F7903449E07914FBE9E67
+3C15C2153C061EB541F66C11E7EE77D5D77C0B11E1AC55101DA976CCACAB6993
+EED1406FBB7FF30EAC9E90B90B2AF4EC7C273CA32F11A5C1426FF641B4A2FB2F
+4E68635C93DB835737567FAF8471CBC05078DCD4E40E25A2F4E5AF46C234CF59
+2A1CE8F39E1BA1B2A594355637E474167EAD4D97D51AF0A899B44387E1FD933A
+323AFDA6BA740534A510B4705C0A15647AFBF3E53A82BF320DD96753639BE49C
+2F79A1988863EF977B800C9DB5B42039C23EB86953713F730E03EA22FF7BB2C1
+D97D33FD77B1BDCC2A60B12CF7805CFC90C5B914C0F30A673DF9587F93E47CEA
+5932DD1930560C4F0D97547BCD805D6D854455B13A4D7382A22F562D7C55041F
+0FD294BDAA1834820F894265A667E5C97D95FF152531EF97258F56374502865D
+A1E7C0C5FB7C6FB7D3C43FEB3431095A59FBF6F61CEC6D6DEE09F4EB0FD70D77
+2A8B0A4984C6120293F6B947944BE23259F6EB64303D627353163B6505FC8A60
+00681F7A3968B6CBB49E0420A691258F5E7B07B417157803FCBE9B9FB1F80FD8
+CA0DA1186446DD565542BCCC7D339A1EB34C7F49246E8D72E987EB477C6DB757
+99AF86CEBCD7605C487A00CD2CD093098182DC57B20D78ECE0BECF3A0BF88EBA
+C866DB19F34BBBED6634AFC0F08D2AFB2A92578A6F8B4ADCD6594737FF6EED7D
+5B536DA9E3E2CADB40DB7C600EA4D100D33C3B92B1CF857E012C4EB370BA8295
+55B50047CC8911C98FE1A7BA6CDEA82D34476286E710776823690AD333DD3A49
+335002F4680DBE1C21174BF016B0DF799B01EB9D6988479A8334BBA2F8DC7146
+BC0DAE9DE3A6453B181808E68A89E0C02DAC6264D002B422EBC1CF14F65D9888
+15EE6D514D3457F7F3C6A3D17EE1DA076F73ECC392D349174DA9E4680F29CE10
+0157E42CA35F5DBFF56BFC3AA07E61A78DBE882C5AB388220C19750D3643E7C8
+23D6673027CE568A4ACCE1D12B1D9E5A43507F4AF9BC873237F65A6B95078DD2
+378007CF0F0DE7CCEF760E19D6D1D7B412EC5D4972
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+cleartomark
+%%EndFont
+%%BeginFont: CMEX10
+%!PS-AdobeFont-1.1: CMEX10 1.00
+%%CreationDate: 1992 Jul 23 21:22:48
+% Copyright (C) 1997 American Mathematical Society. All Rights Reserved.
+11 dict begin
+/FontInfo 7 dict dup begin
+/version (1.00) readonly def
+/Notice (Copyright (C) 1997 American Mathematical Society. All Rights Reserved) readonly def
+/FullName (CMEX10) readonly def
+/FamilyName (Computer Modern) readonly def
+/Weight (Medium) readonly def
+/ItalicAngle 0 def
+/isFixedPitch false def
+end readonly def
+/FontName /CMEX10 def
+/PaintType 0 def
+/FontType 1 def
+/FontMatrix [0.001 0 0 0.001 0 0] readonly def
+/Encoding 256 array
+0 1 255 {1 index exch /.notdef put} for
+dup 122 /bracehtipdownleft put
+dup 123 /bracehtipdownright put
+dup 124 /bracehtipupleft put
+dup 125 /bracehtipupright put
+readonly def
+/FontBBox{-24 -2960 1454 772}readonly def
+/UniqueID 5000774 def
+currentdict end
+currentfile eexec
+D9D66F633B846A97B686A97E45A3D0AA052A014267B7904EB3C0D3BD0B83D891
+016CA6CA4B712ADEB258FAAB9A130EE605E61F77FC1B738ABC7C51CD46EF8171
+9098D5FEE67660E69A7AB91B58F29A4D79E57022F783EB0FBBB6D4F4EC35014F
+D2DECBA99459A4C59DF0C6EBA150284454E707DC2100C15B76B4C19B84363758
+469A6C558785B226332152109871A9883487DD7710949204DDCF837E6A8708B8
+2BDBF16FBC7512FAA308A093FE5CF5B8CAC6A7BEB5D02276E511FFAF2AE11910
+DE076F24311D94D07CACC323F360887F1EA11BDDA7927FF3325986FDB0ABDFC8
+8E4B40E7988921D551EC0867EBCA44C05657F0DC913E7B3004A5F3E1337B6987
+FEBC45F989C8DC6DC0AD577E903F05D0D54208A0AE7F28C734F130C133B48422
+BED48639A2B74E4C08F2E710E24A99F347E0F4394CE64EACB549576E89044E52
+EABE595BC964156D9D8C2BAB0F49664E951D7C1A3D1789C47F03C7051A63D5E8
+DF04FAAC47351E82CAE0794AA9692C6452688A74A7A6A7AD09B8A9783C235EC1
+EA2156261B8FB331827145DE315B6EC1B3D8B67B3323F761EAF4C223BB214C4C
+6B062D1B281F5041D068319F4911058376D8EFBA59884BA3318C5BC95684F281
+E0591BC0D1B2A4592A137FF301610019B8AC46AE6E48BC091E888E4487688350
+E9AD5074EE4848271CE4ACC38D8CBC8F3DB32813DDD5B341AF9A6601281ABA38
+4A978B98483A63FCC458D0E3BCE6FD830E7E09B0DB987A6B63B74638FC9F21A5
+8C68479E1A85225670D79CDDE5AC0B77F5A994CA700B5F0FF1F97FC63EFDE023
+8135F04A9D20C31998B12AE06676C362141AAAA395CDEF0A49E0141D335965F2
+FB4198499799CECCC8AA5D255264784CD30A3E8295888EFBC2060ADDD7BAC45A
+EEEECDFF7A47A88E69D84C9E572616C1AC69A34B5F0D0DE8EE4EDF9F4ADE0387
+680924D8D5B73EF04EAD7F45977CA8AD73D4DD45DE1966A3B8251C0386164C35
+5880DD2609C80E96D1AB861C9259748E98F6711D4E241A269ED51FF328344664
+3AF9F18DCE671611DB2F5D3EA77EE734D2BED623F973E6840B8DAD1E2C3C2666
+DD4DD1C1CF9DB1FD1568F84892C602408AFD8174118B9E1476C880193A1E332C
+DEB81FA1F4C64D240C929C16D8516C4470EE50795719FA0A3BCA33A6F427B59A
+A24BF1A2AE1CCC869AC90F3B25A2718F821C4A0969E30E899891212ABB5B17D2
+2760A1041FD13462BE5E0FA2C711F045E90A6371B9C9025F7B26C05D4FC8BF68
+9316D0D0B6AC3EF95246D0D89FDFFDA1CF32EA6ABFFFD9CC1846B899F84ABADD
+2F259FCD3B2CB623D2DE602A812F94E98423DFAA48A3A4C3BE5A31C13D7DC2CA
+5C51DAB16D09C77417EC161DB6665AA975F535AC3ED0D3B2A5C19602E5FD9D87
+6BF3A202D8F9C95BA18B95E7D53DCBEBA2B2750F9562163602DD6E8955EAF300
+4476D27FECBADDEF681E3E57664681CC7B8ED53F7251ACCDD7398588C8868773
+DED6D252BF748DACDC141B0ECAE13512A7D95E58146CA68A161836549DCDEFD3
+72FC900E907194E634A84FE49DADCDCFAE796215EC46A6CFE5F4DC5CA1D5AED1
+3211A833BA13440974E86A73A1521DFC4217198E4FD86CCC9F03519316ABBBE6
+7A92CE75E20B649630DF0BC37331D0D9A8C25A5A1C35E10C3EB901EDB389D4E8
+DE097A4D8F1205F13DD3A6C102EEF7DF2DF96CF42744FBA1C9F61140EB44D623
+A39E84DD17D9C3C2CDB72AC6B72039C0A616F657C5ADA4B991ED610D389F63CA
+B1BD3C54C708BF01606E811E6606EC8B929D65801E343969C9274AA341B8B2BC
+05DDA4C86F6925B3D59789C6800DD145197789C6EC18910B4784B1D9C1DD0590
+38EDE27876BFD72836B22715
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+cleartomark
+%%EndFont
+%%BeginFont: CMR12
+%!PS-AdobeFont-1.1: CMR12 1.0
+%%CreationDate: 1991 Aug 20 16:38:05
+% Copyright (C) 1997 American Mathematical Society. All Rights Reserved.
+11 dict begin
+/FontInfo 7 dict dup begin
+/version (1.0) readonly def
+/Notice (Copyright (C) 1997 American Mathematical Society. All Rights Reserved) readonly def
+/FullName (CMR12) readonly def
+/FamilyName (Computer Modern) readonly def
+/Weight (Medium) readonly def
+/ItalicAngle 0 def
+/isFixedPitch false def
+end readonly def
+/FontName /CMR12 def
+/PaintType 0 def
+/FontType 1 def
+/FontMatrix [0.001 0 0 0.001 0 0] readonly def
+/Encoding 256 array
+0 1 255 {1 index exch /.notdef put} for
+dup 44 /comma put
+dup 46 /period put
+dup 48 /zero put
+dup 49 /one put
+dup 50 /two put
+dup 51 /three put
+dup 52 /four put
+dup 54 /six put
+dup 58 /colon put
+dup 65 /A put
+dup 66 /B put
+dup 67 /C put
+dup 70 /F put
+dup 74 /J put
+dup 75 /K put
+dup 76 /L put
+dup 80 /P put
+dup 82 /R put
+dup 83 /S put
+dup 84 /T put
+dup 86 /V put
+dup 97 /a put
+dup 98 /b put
+dup 99 /c put
+dup 100 /d put
+dup 101 /e put
+dup 102 /f put
+dup 103 /g put
+dup 104 /h put
+dup 105 /i put
+dup 107 /k put
+dup 108 /l put
+dup 109 /m put
+dup 110 /n put
+dup 111 /o put
+dup 112 /p put
+dup 114 /r put
+dup 115 /s put
+dup 116 /t put
+dup 117 /u put
+dup 118 /v put
+dup 120 /x put
+dup 121 /y put
+dup 122 /z put
+readonly def
+/FontBBox{-34 -251 988 750}readonly def
+/UniqueID 5000794 def
+currentdict end
+currentfile eexec
+D9D66F633B846A97B686A97E45A3D0AA052A014267B7904EB3C0D3BD0B83D891
+016CA6CA4B712ADEB258FAAB9A130EE605E61F77FC1B738ABC7C51CD46EF8171
+9098D5FEE67660E69A7AB91B58F29A4D79E57022F783EB0FBBB6D4F4EC35014F
+D2DECBA99459A4C59DF0C6EBA150284454E707DC2100C15B76B4C19B84363758
+469A6C558785B226332152109871A9883487DD7710949204DDCF837E6A8708B8
+2BDBF16FBC7512FAA308A093FE5CF4E9D2405B169CD5365D6ECED5D768D66D6C
+68618B8C482B341F8CA38E9BB9BAFCFAAD9C2F3FD033B62690986ED43D9C9361
+3645B82392D5CAE11A7CB49D7E2E82DCD485CBA04C77322EB2E6A79D73DC194E
+59C120A2DABB9BF72E2CF256DD6EB54EECBA588101ABD933B57CE8A3A0D16B28
+51D7494F73096DF53BDC66BBF896B587DF9643317D5F610CD9088F9849126F23
+DDE030F7B277DD99055C8B119CAE9C99158AC4E150CDFC2C66ED92EBB4CC092A
+AA078CE16247A1335AD332DAA950D20395A7384C33FF72EAA31A5B89766E635F
+45C4C068AD7EE867398F0381B07CB94D29FF097D59FF9961D195A948E3D87C31
+821E9295A56D21875B41988F7A16A1587050C3C71B4E4355BB37F255D6B237CE
+96F25467F70FA19E0F85785FF49068949CCC79F2F8AE57D5F79BB9C5CF5EED5D
+9857B9967D9B96CDCF73D5D65FF75AFABB66734018BAE264597220C89FD17379
+26764A9302D078B4EB0E29178C878FD61007EEA2DDB119AE88C57ECFEF4B71E4
+140A34951DDC3568A84CC92371A789021A103A1A347050FDA6ECF7903F67D213
+1D0C7C474A9053866E9C88E65E6932BA87A73686EAB0019389F84D159809C498
+1E7A30ED942EB211B00DBFF5BCC720F4E276C3339B31B6EABBB078430E6A09BB
+377D3061A20B1EB98796B8607EECBC699445EAA866C38E03ED7D4F3EDBCA1926
+2AF6A41F67AFCFBF3630C943FA111E4CCD988A7363F7C2B75EAF5830B049460E
+0D2B337988F150B9182E989E7750C51BA83DF37685483F86D1F47478883F3F6A
+4B7F768DA5AA89E8F163029ADD4A9209DE8A4F285766C06EA859639B92CCCDCA
+F59B1C2BB8D588CA754D1257BFF76B53984DF4937093AAEF79009D32A29A4C16
+FB610C7D6713482C48D7F9E8410C0F00AD6E67021056B6035534E79F05D14EF2
+4E813344B92052E6E38491989F62E8E70B47BDC92590B2014993BE18A006458A
+3672CDDFD78055840B508F88391DF3C9A811E48A16D9D64A4BE27B206B991362
+526567F5312DE0FCF62BCEB4484565B514F807DFE4464733056EF96BA1EEE4B0
+00C107449F3A1AE0D1FDF04AB31DF715C341E35569B94967D3A49E2246F1C53C
+1B0AF0DC7FBEEBB939DE3271190623AC6DF57C40F37ED7B5BC3502CFF69E2400
+7CD980FD2C76148B66DF487F3E9B632A82E474C27EC3898D415F17979E837357
+6B5020D7B59DFBEC17F06611E63931673901334765D300F4E8364F561AF72060
+300249E94F60ACC9E3412BB9CBF8B64259825B03276A49CC014FA247FE119E04
+0A04D881499902D29548815FF60E5E117010F1CA53AAD9F0D2A43BD50F278965
+0E10154116231D4D742F03264329C1428817EC2ABC5CB42526821ED38331B9C2
+47FA83A9022B1329EF5E0F2EC9F71D2E13E2AC5EEC5C1BDC07B52124467A4AE3
+F9162893C86AF105BAE2074D457C82A5DC5573FF3746E5DA4C36B9C83AC3FE8A
+CE82692FABB698D52D68E4BD2F073E0C76F69F19974863E25C0505633523FD6A
+F7263620C76412DFD321F4D38D6EF1E75B9FD237714CFD0FD49E70E5DA548E68
+9AD068BC71102094FC193921E7BD99576D260DB857D313868F6CC221ADA77012
+894F1E83988FAB2E0C71FD756D39E433221606BDAEE00ADA30E9BC88B3F68EC8
+92A000D04703DCDC31EA45B6A25156BB6E99D795FC1F7D08CABA96E05C9E1201
+E27A2CC7B0C5483BF8F12A75B82A47156F91D1F9C500F56D0E26B713095C4B9B
+341EC560E703A2543601E4AF50F1721108251206A95C5592C2556C6118520EC6
+4443BC3DDCBC955B60D127BBC4F019D6FC94B04D9C2BEB0D7557EA0AF19BB6DB
+AABF8371C46D6F620CE2858E54AB1EDD57D09816114B956BD0BF4D54889E2C67
+3CABC3385DC8E79AE8D9BB5384EBC131C001F68DC5B914894937F11A57CDA343
+E6EE50ED77AB0141EFDDB7881C2A813A1EECD98E6855C2D184405871746737EB
+D452B5FAECE58CCE9742240F979B241A360B6655888B1F23F42FE183AB2681D9
+B597A6242FF59520C729CFDB880CE57DC539950B5B4227B9ED24B015D942C82F
+143D45412DC465DC45F8911B23AB480E280C404600ABD05A07479073D8864D67
+46893652434D7940948533ECCE044E4F1262CB1C5E58FB64893B0681AD40175D
+0232C54B0DDD881055BC11F4068EAFA4AB49792918FC01B6B806FFDD8669B465
+1FFE00BF4AFFA331E5E47162C5A3CAC385A3EDFD5793E91DFA9C82C29BE10F09
+83DF41E589A29A1B095498B6BA16B340BED4339EAB2E9CB8CE92AFCA8D7AA99E
+03FEEBF66FEF7C0F719201A581CC47C824936C5F1701CA7440224E61F51EFEC8
+0B46C5AFD9122D495BFBB95D366E4D6CDB5EDF2578B8F0BE38D7E2090F05EF8E
+4E49D4825C5EA903640DD00CD09F5D6792A523B14472CADE90E1A07A418B27CA
+0A9973AA6DB908D40FE7C9D720E8AF09EC49FBB7D2250B9F5201D8BE0A34EA20
+0A5E17115B5DE6E7EE641786835D9F49D182DFF91BA0554756A8D1D045AA28B3
+7803419575950F6FDCC5992CFA1B78F36370C7F4762D3A0D2E0B37F441E1E59A
+CB519BF10F35AF2FBE73561EDB446FA42F7942DF35F486B81EB62A6CC9C18799
+FADC31E68D04BD7704B683C16AA6086CCF88DB230D8943B669F94F1D3781EF7F
+85FF25F23F383331C55A47C77085BCB45094F89910C0F623D202E951AE32CF05
+197CDEE4897303A29054A2AB0D1A4B575674F2044194BAE615ED4D170A1916A6
+02B50F604F8D48D8DCBF095CE12B3850E9439101EF1E1081EC14B8F69E94C476
+C1F0E2FC5AB7DB30218143F1FFFE80C2C4A026A28E7DBB058020258D7EE3CADF
+E7EAE8073DD619A642FC5131A8D0AB8F27F3C67B98D8B21639A9969662044D00
+1BA5C5316B8DA40398C61FB81B7E502D60295D44199FA6ACC8EB7A74D478E6CC
+6573C171DB96E361E03B3A0D3F32574D74973C64FA63287A664901A23FCF4AE3
+4B497DFFD395F2EB4F93C0718E6A4EB828C823F663DEF062F6228107E176EA78
+9E759CBE0388036CA93FEC0821AD46C8CDF8A7B893F9B5BDFA09AAF4EBA10BE0
+86C23DE6C3C7E3DD9BF1A0F393249528797A6E6C7343DB4C90779F3B5E59106A
+647EFE1DB150258362A439F5B01013779180A09C6C9918B06DBC0F8CBD4439BE
+F89A7B76D764CFA143BE19DE62C5D8F9113B549C31701EE1358216FED9B12AA4
+984F8C641113F826B47F9148EE9BE42087E661A8707E2F463312308056440F71
+F7870D9CC58A342BA2683CD15512C6FC67C5CDEA5E3D11148090F1AF11134FFB
+2C45DFC91E3CF23D5003FAB994F1208C9DC3D98AE97B9C67A868542362C978E3
+D12E22E2A12791BDB733B56364BA58BF5F784C6FB2460F2C43883BA663193D13
+F82B82CB22FD39B7887BDA75BFD295C352BFCE06C3D70F219F27C3278CECC398
+8B36E5A3E51688CEDF0CA2FE206663D6B7C680576760130FCDFE96106185C024
+EC72F0A8006348A07407BDEB04FAF7F1950EF490A91CEC4253C364DA557293E5
+99C38D9C7E7F7BE4FACDB8C0A573A1FD2E75EE156583C4E33ED8C08BF26729E6
+0D5B32625E98C42D15CF9F5BF663EDC32E50D3C6E637503AEC313841C3D2F310
+CB307803068C7A3945C6BE4B644E975AB61DCBB19C2C1188A06507D404075A47
+332BC15835E0799D2C5E5C79A1E44014DCE46E1AC1A653FF12156239EF702658
+F39A1EA15015AF8194FCBFBE8434F7244B16E7E1A2B3430C3B25FDA27632E594
+927C8F6C4F38E8ACD534FD0A4B81B8F3405C53E0D0B814A776A32504CC5BEAAE
+A1A537D5A22B3C41334EA00B985950E7F07218ED6664AD20A1BA68DA1121950B
+7816D6DFA86A850FD58101D262B8E3C66FD4D886E1607A9E0ACB230AC0D2E595
+AAF773C15F6F4A65A9DD5EFF004F6251323FA9AE134274CE4708FD88CAB33C55
+C702C6DE7958D64A4CC369074F335D8A21BEBA26563156476FD785FF2439C59A
+8773370B409C40ACF0016F97A01B7C000CFF3BD507553096245AD8ED2E45F693
+5EB55FCB1DCDB9AD7FDE01A7242644B0C16322323A713CEEF777E125C0E83DDD
+C22889DEE8D8F49980A12B6FCB3C0DE6EA1A08E5896EC24B94F79734643AA463
+D221986F0DAB385B2A4C2B3667006D6EFD867DD93D74D5D0F70ACF9BE10D202A
+90AF3ED813030499DB2433981639FB5894C142D1304DE91437A1068F2621E920
+8AB47CD7F32D06653A05BBB65D788CC91108C8235F1BFB005D32D649CF988483
+200BB2CD280FEF090104FA489AE78C1F002A5B30DCFF281D5E2DD1889638E6CC
+1DA04BEB4637491707182D5D094C879D1607A8169A5637576039414B622D6DA3
+B512A657441CCBD768D6A94853005FD97B6C954A138041824E8187DF5A5E1947
+A1CD9F7715F6E4E47C5BD697859A8C06F28AF9178E9AA932069F92824AA28EBF
+A09830F16C28564D820F93436FCD28646E01EAFDCE9F78727703D52579839B52
+16867BD10A64F6100999D126AA784F2D3713999EF3BFA57197529D52696BDD25
+2581A12667CD850379D4C1CAA4050B8F8B5F61187E44CE97384A6057D744766D
+8276BEA3717749483E4C554BC413E6C0EE3F832DA1DC6D1029EC375670C8F28A
+6BB46EE5A4FF9FC127CB02CAC88CEEC587B0C8270C6E3F6A3ADB7FE10940C181
+DA9008B2C0525AADE3EFC3E07957871C9592776188AF57597392328C753C7D62
+91D7DD7C0206303F81BCBDA2F5B0A6ADA0C4BA2CF5BBAEB27F89847BE4B9D470
+C3D92C9ED1B4C979C2B3B7C694B9F74D7EC78BD03D877E2EC47E29886D33CAF5
+147C30255BAEE9098012038B1703BC91F554FF1298EC5D2DF9F4FA98DEEC1F89
+BBDDBD620E5183D4CC8DF518BE6EF79B98A64568C84058760CC0902DDD8C330F
+3B637B4C8D78049CC2CA8393A7242A6D964E787966D03B70487C40132966266F
+B42FA0A35AAB1F7FFB87EDAD888B8C5AE2C179743BEAB741A9D52A5D3204BA58
+8323345306D9E150C98E9E696C91B2ED4D1B17E72F9EE87ADAD7F2BFBD6428A5
+7D4B1D8708D47C8EE0B82883D48FC39E3AAFD50E7247962F04CDA7C802FF4043
+EF15736A3CD179B7C67E31FD5BC2FE98CF3B10083D4CD1DBCBD817DC982492A7
+18804EF20B1A2E1AEA585483A9D8481769A2FA4A9DCB56623C32688054777F53
+444737C782DA7A36ABC98EA024EBD928F7DD11A6041BCD8888885F74C0CFFAD8
+1431FB0C8C3067AFF18EE68078990C89FD9A44AA7AEC8B7D5DE4850C4D93EC02
+75EA7540E236DDA136498456F3B5BEC1FAF9239E51C6C9312FF29AD971C8626B
+0C66BB01A824EF564DB4EE38A86F685BDE56BFDE8C93C41EA4C6E82A8517878B
+3050426C72ED55B7A274202916282FD3B2757627E8C7251626BA7F2A58130D48
+4B1C2AB1B5A6BEAE54B963EEC4C38C1D7D270211D100A0C25F0C73C53853D197
+1107C2CBAE34EB31192C7B6DCFEABE4ABB67979893165786B51D51117B2BB843
+3BC9801E3FB079FA1413877A40C23B6741AB8287AF3E0396D50DA2ACB0C1462A
+3C10E3830FE1EF66B085EB67AD2FC9285F5FB6BA2FACFE4D86BAEC0BAC253C60
+4E463D388B378CB54A409AAD3C59DF7E388B7CF39EB8A2AD5ADE63CDBD215F96
+0EA1EE626CBC19784CC76B72D62E0A34C065EC3B1246F6B9C1072768E487CCE7
+89761F75CEDECF98258463E1F4558D02BD4E5287609B7DEA158D651449670220
+C4E19176646FF1DF745EE27FBF7806C7B411B23D924D9661482AC996F96CCB6E
+CE9BF93CCDBF9D4836960A4E5AA4EFF696DBA58B8CA836E4A3A7A9BFB8D8B016
+A484D5B789C2253055B988ECD15266AC8A4EBD926BCD228891BC0614BD8553BC
+810D913368524D3726B4C4E87F11AD870D0036963133890388181A30F052B94C
+2E544B8F708C87D0A3DE54E5DF9D29771423884D309E589D86CB1488D5812ED4
+CBEC347891948A1C90659588C9386E41A290187D6E7EB2DFD0F1AC1FB900E755
+F55C6191D39349903B30C5FCDF14DC496EE0D0AF8D21EB954417BABF848B9F0A
+0A2E0C5F6C74FFE32F90129E3C1B2DB4238FB74A4385341C7B3991BAA20F1BEB
+B0A241887F0DD45B2A7030995A2574E43A2F2568F6628A17DD2830A44641E468
+81C0D2F3894483F82F45272824663AA6EB91EEA3684267E38EECF03CB0E29DE3
+89301CAB382755D5118C1AC82575F56449013DD0F632BE55CD7B3D0C7A725718
+560368026FB4B6078A1F09E8EC63EC5F111F43D9964350F10D1259C19BF01607
+1F24D068020E7731BD2CE9CAB8320994D84251FF472DB91C041B43B32C78AC73
+3C36ABFD30396683189DD376ABB28CB3418A181C347A8C855FE4642FF0E4DA3A
+42AA9A4FE81CF8A0CA0FF2BBAC2DDDA2503C7812A791B15BE392DE35B775D856
+143BA7CEF7276BE5DB86509573FF1F3858ED7B54929652BF1EB5E56EACE221E9
+D8276A7DCC822CDD7DFA33C4046A750DEB3FEE0E5B887689326533092381DFFA
+D12CDD786E941C00EDFDE6498897F9A367F18D1E101E9E38E7EA2E45672CFAB8
+88122093B023F2F68E7AD9E96C179C3BF50C7F106B3DD18800CBF02FAB51030E
+271EF9693782516C908372FFAA6147FBE289EF1D1068934CD226A6A8FB510269
+D88A732B88FEE13B5E9CFF031300FD37FEE0537F1C0695535E5F61754C9350DF
+0EEF574A28B51106E8D17FBFCF668F75A1D8FFDF1DF34A961190B391AA2E58A5
+C218C94873377A253ED74112FFB4E51768730EDC3107387E47E54B6E349168C9
+6519FFC57458E8E5756BDD3FE1F3F1F0B1D4A42CBAAC0C0F108C40163E92D731
+FCA1E8D3CBE0CE68B548DB41859356944FFC9276E24FCE9E4FC48E2BDC654186
+ED6106F05CBD427C306CDC5389143E446FB38665887B24B527AE29E34A5B864F
+458D24BF4FFF0FFBCC6CEE691F1976538616320F13B6013036959DAE3FA3A8A3
+4CCA95A6280D12D9B5858FCC5178444ABD3D2684276D19F67C4A87C15892E836
+33D7D067B96E6DFC6F38B2FF1851CB1FEDD623ADB9C0C7692FB28153D1DE9741
+D9AB593C3C594AD79638BEEB94CDFE8E42DBB4853214585282CE7F4B9E41C4FA
+4B03364E6847C04BF57FEC453DCEDE87C5A8A419596001F58D75D32803C45CF3
+A885DC6F3DBF717106F567110294610768D0D4876016264427D473336DC312A7
+120E26A92B8D715259C798DC8391A0A1C62876873DBAE8E1488BD42DB3DDC703
+D84C9B61EA830CF516C57B6CEE39DCD3F801C207D68DDC251DF079E82A7E6C64
+9E4B5380752E5524F832CCAE69D8637A0A04534CCE46904D2920B998213AB5EA
+9DBFDF277F1F8FCBAC8A943E04E6AA68D562862A0D12E67DDB1C4932EF3D4EA1
+C96DDFB07599BD120AB3712834A797535A2F09AD9FF1787A293CCE0013A52E3C
+11397C3FBF45BAE7A2897E061986C7C1F692CE1949837548E6518226711122EC
+C29FB561F0A5F3D00139ECFF85EDCFBF14F7EE206F874CEAD2CA8154E9EFFB09
+17AD31F5079C0EB88F5CD8B422C8CC78CD44585B96999CC84419CB626F6FD8EF
+2C07EED43598A5434DB8FFDE9BD3E4516787DA6FA83111CA186F5E2535BE0A77
+C1763C86B8B2A479FF6C370A44F8FEF45DC7C5BDD20B52D64CB37797E4BC24D2
+67755C6156D63D352FF2EC0D08CBCD145386AAA6EAB6D6EAEA3E486654D09EAE
+6BF43C3B032F63B39C8CCF969CC2B02BF7C48D775A329DB92193AEC8424093E6
+FCAF394078471A9C20CE927625A0413A0AE1D34CDCEFBE2818DAD24489C5E4F8
+352EBF4AD4D2E8303A43B0C65212643EDD087A44F001EB7028907225598EC289
+67EDA56BE76E0E2B04D8CDCC63EDA1DFFB4EAF675F33ADA40F8F58B7AD25335D
+4C45763B671371709FCF5447AEE5006EE984D875FDC9528D642D3943E9580F22
+FB72E2CFA63F01C0ECB8F49383424F906BEEEE94AE3B8B1627F9CCFA1028AA71
+BA38AEB6FB8326B41A24D67FFB79321F31F386609ABC07A453C1E21652F7576F
+8DED425085840F6EC231681D0E71C2B1F54D822F418A82E06112A4ED0455E0DD
+8B56947B99F92618A03CDF67734032EFFB98392149E65ABE9C2119708536948D
+E635B05FA8FADC2E514A40E6E4195CF76DA4D2304A8094FAFB5CBA74780797D5
+E35B0874C7C02BD9138216CA8404360429453A385400CEA2CF9578A63F9AA1F6
+80FA653E940DED46865F5C906A3C4C8F256EAAC6B1748E8887BA615FDF5FCC45
+F672F85EA0B8801CF78E8897936584B5E9CCDDAF03B24AF1D6ED9981EC44B68C
+14E45B16AFB0853DB712D8E823509D86BE4E9CE052459C07BF28D8D4C874992F
+AB24DF55211912F60979E1624786A83BA2AAA5F4B790A2BA375657ECC8D0C627
+F1D237420EA2350F5730B99F6B383013E0C2AF86BD55C7F7E85AC670106CC7A3
+F0A889D6B4B531DC5A72B2564A95D08D5BB8B011BC20E659930686F03413C9D8
+A1A3E93739BF67036D70492BE9326241D9B80F8A33FAB482C755CC82EA8ABB6C
+C8BD91F7F98A5C0B7392D80686118DC74D7219365E0D520CCF5CCA20290BF82F
+CE02AC0C7E87E42593ECD6B3EC9075B070DFE05EB88F0015190633F59E4F66DF
+C508F179AE0F73EF6F6AB0D8A4B4AC9FDD29CEDEA64FC1FC60E71AC239C85D82
+F34465B0E656F7EEB936D4A5A487E51E0AD8F38A805B8EB2A8BD769E384F647B
+D904325C6D4B4D91311B61DD987F84EE9529B5774A58CB2454C0537C64639C44
+6C15B8051268D3CDF8985D606D140FDA157AD7B71A8B5CF3160F859F29500D6B
+BC6C6AA65EBDD96E323D74D9E49D3744114AFD73B62E70AFBD60D2649113C50B
+F7ECE4FB689EA72EFECFD5590D6A3ABCB2AD424D15EAD60D9E4612B6027F37BB
+C53479253D983C26802814EE04F27A98E733FA224E6C1FB4C83AB47F8E622641
+C2A64411D86FA3CB105D83548EC25E1B5055EE73C12386794AB4AC9194377E86
+B84988D3A3A2118EBA8F9616D14ABE14B4C59A1098B29FF972B7CCCE7891AD2E
+71C5514FCBE4E4EA8805FA5F76B9B494B7AD3BEC11AB1DD2B2902B0D3C4A9B00
+E2BDF163A89AD2BA04D2E604110E4E423F57D3677BFAA4F92B4A254597EB4CEF
+BD7EB2A2CF4EB69D24F52C0BDF10A802FCA219CF8D0082BAB4F84AB34766F86D
+4FCDFD2B5F6B7E41D3139B3327618BC0B08E667BEC6C31B25D17F05D091874EC
+78E1C19ED8A4D8C1E087C3B93C3595E3DEFCA4B932A59316C398260485FA6152
+A1B66D2A5868A65162CA853D72DD3FBF4208A1F42129E7291F5543AC246D3460
+42D090048939303BC6FAB153997F00F94C64F839A6EDB3DE2FCC2F685931B87B
+D3707768B9C49DA6966F290B2B295C37F8801EA6798BBF53877121409D6CE2E8
+16842C4C6E969754C413200D1A075C95EBB31CB2288BB405F558E24D7A43B1E9
+B9912ECBEA1350A7E897A0C2C236FEE75BDB6F586D10E0C6787BB809AB8D5671
+C6FB0D9B8A487C30D336075475134D25A87AB764B7A7AE708B0B1FF52FE44FB4
+E025D591429370E317424452852918560151F4E6020A47199A01EF4F19C0113D
+E5A3619D88530ACE4FC1EBA5E31AA3404466184C55FA65EAE5695E01A76994B9
+68BA7F32825DC1BEE2D7D1C9A1EAC3AEAA0DD0C98EBDEE9A3BC2B62BCBC478F8
+CF91377FCF1267618E5A448C87754F54F1849607704D42F462C96BDEC66B3BD4
+EF630333F5872DC7F99D75CA394F183CBDFAE4DCB1BE1B8ADF64C5795DBD6206
+60C3FAA9005E1E2E71AEE59EC8501FF525A778B72C4D27F652646840D12096BA
+D8273E1562EE794E8919EAC45481FBD1CC5BC5CED35FB17C7778E8E121EC0A14
+C335F8A570B105DE8133105BF8E871FCAC25799D0A336FFC5226906A4EB50BF2
+2D620D0FE6AE77B14AB1E317AB0F2E6D1F18A539917A0B3C2DECDFF1218E9621
+028DB5D423628BF20C8A49F548C8E2EB178B2FB04CAA2FD5BF0D642E78DA4184
+E9CC849B0543B3F3C1DC5D315CF4D333C334D637CF3C734462C4D4E6FA10251C
+35E976EC1888025BA2C5BCDD96C812029981BB6CE75FAF98B9FAF3619CC7DF95
+9C0D2850C881835B2E2D9CB8708009DE7374758F1F478EB0253AAF9451631682
+F55AC251E6F651F66C9B9992135C821B0D37F8C99D125175DE8F6E96C83F591A
+AC3DB7C72D9D024BB8322EDA7F12195D0EBE2DEDB74C9DF951724F91B57ED532
+6A43E5FC97EF66D69D5B07EF1EC1A0FD4814CD9097CA263CF3C7020FA966DE48
+2BD503791694DB277011A936238A95C023C3F3BA15AECC48497442B24E9D8F3E
+A9D69040A755FE58F91A969E94EB6C6FAA0ECD062B8B963AD6F5A6293BB51CA7
+8956C0CCF4F694F0DC99EA6B0611D088C1D7EE09F05FDB8E81FEFCF114F27BFE
+8A70DE936BE1046D524A169249895F1FB07A65003423D75B8EEA813811DF665A
+DE9B788D00D1126E4289454944B544C1C993E80A22CDB6F20ECFF0937C7099A3
+C04EEAB9D2D50A89788D3DF4DC33BCAAFBF73EE0569689CC32734A82999DD94A
+B0D0093F0AF85DD8581B9D35FD30DDB9E16006F4AB643BB058FCC25BFAF82ECD
+3EDFBCA2BBBEC4AD138E88DF99958A1242F1CDA517F1BFB57C24AFC61969B2C1
+3968EC3241AA9C2F7D49E4B7DB009D19FFF45CCDD9392593823DDC1FE79360C6
+C5A40F5946D916793860CEF629DD8EA91414D0C39D37062BC999E0D3AE24D4EE
+89663C179BA69C392493C8697C02533AC4CF38F3FD148BF755B26F4CC6CFEECE
+39ED6FB190805C32024836879304ED380F028B0B330378709C037253D2845843
+E50C7478E4ADF95F62B4AD41DDE7614971C5D281C6793D551B623E4F5677A480
+09FB03CD728E06F37E017C70FB85E7F4382324352822199637A066C76546C956
+9B1896736A03787C298D1E81D6F69379E06E33B7086920F96E3110EF1E0B8E86
+385963854288C48C8D492ABD591AC5A20CBC2E9B4C138418C79C76EADB74D49B
+D49A997539F1AFCC1F05FCC1B9
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+cleartomark
+%%EndFont
+%%BeginFont: CMR10
+%!PS-AdobeFont-1.1: CMR10 1.00B
+%%CreationDate: 1992 Feb 19 19:54:52
+% Copyright (C) 1997 American Mathematical Society. All Rights Reserved.
+11 dict begin
+/FontInfo 7 dict dup begin
+/version (1.00B) readonly def
+/Notice (Copyright (C) 1997 American Mathematical Society. All Rights Reserved) readonly def
+/FullName (CMR10) readonly def
+/FamilyName (Computer Modern) readonly def
+/Weight (Medium) readonly def
+/ItalicAngle 0 def
+/isFixedPitch false def
+end readonly def
+/FontName /CMR10 def
+/PaintType 0 def
+/FontType 1 def
+/FontMatrix [0.001 0 0 0.001 0 0] readonly def
+/Encoding 256 array
+0 1 255 {1 index exch /.notdef put} for
+dup 11 /ff put
+dup 12 /fi put
+dup 13 /fl put
+dup 14 /ffi put
+dup 15 /ffl put
+dup 18 /grave put
+dup 19 /acute put
+dup 25 /germandbls put
+dup 34 /quotedblright put
+dup 35 /numbersign put
+dup 37 /percent put
+dup 38 /ampersand put
+dup 39 /quoteright put
+dup 40 /parenleft put
+dup 41 /parenright put
+dup 43 /plus put
+dup 44 /comma put
+dup 45 /hyphen put
+dup 46 /period put
+dup 47 /slash put
+dup 48 /zero put
+dup 49 /one put
+dup 50 /two put
+dup 51 /three put
+dup 52 /four put
+dup 53 /five put
+dup 54 /six put
+dup 55 /seven put
+dup 56 /eight put
+dup 57 /nine put
+dup 58 /colon put
+dup 59 /semicolon put
+dup 61 /equal put
+dup 65 /A put
+dup 66 /B put
+dup 67 /C put
+dup 68 /D put
+dup 69 /E put
+dup 70 /F put
+dup 71 /G put
+dup 72 /H put
+dup 73 /I put
+dup 74 /J put
+dup 75 /K put
+dup 76 /L put
+dup 77 /M put
+dup 78 /N put
+dup 79 /O put
+dup 80 /P put
+dup 82 /R put
+dup 83 /S put
+dup 84 /T put
+dup 85 /U put
+dup 86 /V put
+dup 87 /W put
+dup 88 /X put
+dup 89 /Y put
+dup 90 /Z put
+dup 91 /bracketleft put
+dup 92 /quotedblleft put
+dup 93 /bracketright put
+dup 94 /circumflex put
+dup 97 /a put
+dup 98 /b put
+dup 99 /c put
+dup 100 /d put
+dup 101 /e put
+dup 102 /f put
+dup 103 /g put
+dup 104 /h put
+dup 105 /i put
+dup 106 /j put
+dup 107 /k put
+dup 108 /l put
+dup 109 /m put
+dup 110 /n put
+dup 111 /o put
+dup 112 /p put
+dup 113 /q put
+dup 114 /r put
+dup 115 /s put
+dup 116 /t put
+dup 117 /u put
+dup 118 /v put
+dup 119 /w put
+dup 120 /x put
+dup 121 /y put
+dup 122 /z put
+dup 123 /endash put
+dup 127 /dieresis put
+readonly def
+/FontBBox{-251 -250 1009 969}readonly def
+/UniqueID 5000793 def
+currentdict end
+currentfile eexec
+D9D66F633B846A97B686A97E45A3D0AA052A014267B7904EB3C0D3BD0B83D891
+016CA6CA4B712ADEB258FAAB9A130EE605E61F77FC1B738ABC7C51CD46EF8171
+9098D5FEE67660E69A7AB91B58F29A4D79E57022F783EB0FBBB6D4F4EC35014F
+D2DECBA99459A4C59DF0C6EBA150284454E707DC2100C15B76B4C19B84363758
+469A6C558785B226332152109871A9883487DD7710949204DDCF837E6A8708B8
+2BDBF16FBC7512FAA308A093FE5CF7158F1163BC1F3352E22A1452E73FECA8A4
+87100FB1FFC4C8AF409B2067537220E605DA0852CA49839E1386AF9D7A1A455F
+D1F017CE45884D76EF2CB9BC5821FD25365DDEA6E45F332B5F68A44AD8A530F0
+92A36FAC8D27F9087AFEEA2096F839A2BC4B937F24E080EF7C0F9374A18D565C
+295A05210DB96A23175AC59A9BD0147A310EF49C551A417E0A22703F94FF7B75
+409A5D417DA6730A69E310FA6A4229FC7E4F620B0FC4C63C50E99E179EB51E4C
+4BC45217722F1E8E40F1E1428E792EAFE05C5A50D38C52114DFCD24D54027CBF
+2512DD116F0463DE4052A7AD53B641A27E81E481947884CE35661B49153FA19E
+0A2A860C7B61558671303DE6AE06A80E4E450E17067676E6BBB42A9A24ACBC3E
+B0CA7B7A3BFEA84FED39CCFB6D545BB2BCC49E5E16976407AB9D94556CD4F008
+24EF579B6800B6DC3AAF840B3FC6822872368E3B4274DD06CA36AF8F6346C11B
+43C772CC242F3B212C4BD7018D71A1A74C9A94ED0093A5FB6557F4E0751047AF
+D72098ECA301B8AE68110F983796E581F106144951DF5B750432A230FDA3B575
+5A38B5E7972AABC12306A01A99FCF8189D71B8DBF49550BAEA9CF1B97CBFC7CC
+96498ECC938B1A1710B670657DE923A659DB8757147B140A48067328E7E3F9C3
+7D1888B284904301450CE0BC15EEEA00E48CCD6388F3FC3BEFD8D9C400015B65
+0F2F536D035626B1FF0A69D732C7A1836D635C30C06BED4327737029E5BA5830
+B9E88A4024C3326AD2F34F47B54739B48825AD6699F7D117EA4C4AEC4440BF6D
+AA0099DEFD326235965C63647921828BF269ECC87A2B1C8CAD6C78B6E561B007
+97BE2BC7CA32B4534075F6491BE959D1F635463E71679E527F4F456F774B2AF8
+FEF3D8C63B2F8B99FE0F73BA44B3CF15A613471EA3C7A1CD783D3EB41F4ACEE5
+20759B6A4C4466E2D80EF7C7866BAD06E5DF0434D2C607FC82C9EBD4D8902EE4
+0A7617C3AEACCB7CCE00319D0677AA6DB7E0250B51908F966977BD8C8D07FDBD
+F4D058444E7D7D91788DEA997CBE0545902E67194B7BA3CD0BF454FCA60B9A20
+3E6BB526D2D21FBD6D78E21A936F2E123C0F6EF41AA2266CF51B513EBF49D4D9
+2C0C93820A37010A4C8990B3D2551EED2FC7474753A9834C8D1740509FCC0145
+64E1F5B7D491CF9F7F35DF3A0C3A22226CD835F91CC8B8E94D2D8BE12F1DCC57
+9015BDB37819553B2121B0E209E3E7A0FF34CE29175A0E7D978742CEE7D5CE5A
+41AD7F4A22324A606E08F30998D4C5AABC95068BE7A9DAA9F9DF7A21B822D622
+120D6E84CBAEF516903ECB357133B8BAD87A39C237849B862FCCC4174D1E5505
+EE168B69FC70F303A1653E9FB661BC46028B06DD501B212ACCBF0E21E9CAE867
+1B2C7E2A633DF8DE4DFFF50CF72B6C25C82458DECD664AEC9641455796196B26
+5AC0FC3AB3DE11F7BA302ADFEA056CD8180833E760A9B5AEA5B7C0684B4D5ED4
+813A3064682CAA6705065AAB5C9874DA90D94D90245E4B981710E1E0BADA5317
+0D4A021AC3C64F33BB44C4851CD927C5AC1701E4168B333B221AF0D1460DCF82
+B7D4CDDD927053A53DD12E5BDBF3417786D6D4BC5C9F715607A353568DF3C13E
+CFBBF97AE7E6A74210485D0BEAD062128C9DF5EC887C392DD1A2ABF1AD34324C
+F5C6B2F7AD70ADAA465F1DA233DFC765A88E4605DF8694FED0EB57B3876F7BED
+5EE6D4940F32250DC3AC668EB757C2ABE940D44DB17131A820C6179A8F984CA1
+449899AA29639EAC0FB9701025D55BD054E058D3E91C9928F3697DB06C39C2B6
+19C19261CC9FC054535E03C59C16D876BC4717C39F50EF7E4789E68361DC1058
+721FD578FD3B2ED98513068AF9178FF44B9FB6FE793E4EFB1C735041EC47FE57
+B63F1F98B53CC0C9D8C9AF9A902840D5F2F81D1A2C21A08883B56BA57A0FEDF7
+E842DA37BA35BBC77B77BB0F5D3B2EFB4950E17C2172DE7480FA2A7B63B79106
+82EAFCAB0F993142B749A0FCC7CCB54D20544DABFFD1BD2400225B118C799C3E
+B7092F35F89CB46199C286B74D3D60FD761644FE7467436FEB6EEB11A408D88E
+104B9FB34197C27740ED123FBEE75E7967593AC4EE607DB0426B74D081B209C0
+ABE7D706EFFB9D6BE0607254667BC10CB15988EA00EDB0B4372448796B10B4DB
+A547C2BEBAECCB634D6925B0DA3B7D5243FABF7CABD16B358B3B56FD72789EC8
+7F7114548565987E3F804C15C4EA714A43544D7EB86EBFAA23DF57638711E28C
+333FDC8B2CBA15DE22BAF32ED4FFD7BFE0E489F4C2B83D5E333D906001A68853
+17C80CB800A292BBB11D309FE54E8B77C989E16231EFF428E15DF111866AE717
+A2BC1AFA282D901FD279445C3736A07B54B45D9527E999DA1962C77721896C5F
+4AF14D80E659C1B575BD738129C42FF8323D189CCAC92D86370D5D3AF6ADC14F
+19E317BCB933E5E8BE6BADD00D7DC14EA79CDA96F09E769116E197A253559355
+1EB2A3CB1C34B7650F7E6A8FF017B4AA4E46432CEA397A228B2ADD64FEBB6510
+A2EC593B475F94A75151BEE4AD2D521DAA75215F8961783F0581C4F9F9670318
+856C75D1C4ECC4CB4307A1188ACC0A23E2ADD57654CB95EDA5F38D3B6C641651
+9FF523FE23BDF1C071C902C330C81431E79A52ED71E4A1EACC704FCB0303AEB8
+6D473B0E81AA9EE420383A7741C4F401BE961183024AAD2A72810897A236898F
+431F6A6095D596FB632286C5575B1394920968B52F3C2ABCA267C933ED3AEE99
+41F8B877CF1E297A9E1319FBC9D6F128EE1B6B9E5106398B914A08DD0A3A275B
+B85423FFDE860795489A5EBD497C19E6B3546C80ECAF10EBB021F2E4365A5B05
+D2219F87D0D35AEB86CB203FEAC22B5E6633BD127F1F6B0D980CA5E19BF2BBE6
+683EFF744B33ACF8041A43B53BF999B47DC09784C1C9E53A427DA725E1FE95CB
+9CD7FAA6DEA81CD9F48C2A1217B0C5863C8526BE1848ED3207B79894FDAF04DB
+E29DFDF174553AE886683540A031158A6B897BB813765DC720626C156A78D331
+32ECE1DC97EED13207A11AFD0C26DFFD19779226DB48281DE42D8E6EC76F7EAE
+69D6F7E212BCCFBAFCB1D4091C90C00215551CB226CF50BFE71D607FC636BB31
+D9A21A29FD4CC9291F37C03A050B7D460AD49D1ED1CAAF2F4D9618AF0DF8B32B
+1A5F72E1428CF6D4346549A960B3D68036AFB2D2F048FA3868733AD7F23BA2F9
+EAF5BD864E7EEA24D7DD0B3CD4E127FEECCD65AABCA5C52D9D23AA6C1D8770C6
+149948DCE8CDEE881305387D7E7D474391BD05706869C69359D35B247938CB6B
+ED3E667786FEF5561CB5EA0ABC4868761B732104259E95855D9266349CEB679B
+F87329A163A08F2D9A7AB0C407AEE24D96617CBAB11FD6A349A23629A1ABC21C
+7414A261C883AA88289A7A5231A7D7C58C4023E5F44076764434AAE3A6A53E07
+AB9D9F8BA23AE6209D1A77A19498662200B28B01E7FF7546084EED9D135ED671
+A9ECA433CAE1EDE4E3686A8D23E68C136B15D13DABC957C20596BDA566D48BEA
+BDA7D825F64A900A90897ED436F01418CEAEE84C3FE63CA1161707944B243D35
+7EBE0BD929F281F5AD7AE2AEF26F16EE915935EE1758E493C2EED9B98FF7A30B
+67C06D7880209D32CFB1D88558675E4ED139600024AA93FFC582D40CD037A9D7
+17A22DDB4BBAB4C647AC58CB10773F55496E9B31270800420B2E744956B9FD0A
+1CA5244DC9F62BDDBD26F840EEE82EF830F063F0766954CD41B7C4B108FF3A75
+D3B6841370853C13840CD45A23DA8CDFB00E5C6CEDEAE6EDD5A5EDC20A65B7ED
+3D008ED9EFD617E8773A23AF1038D03D95A3275BC148E4F650FCCEB907775156
+AA1EBDF65AB732B19C23D781910D04B292216C695F138FE750586AC3EE5A2FE3
+A40F40C6A72E017AA605DA7AAD050786520A4104E9254A64B81743CDD268D57E
+CE1F8015AF3B3FAC91422CA70BCC22EC6BBCCFC3CA0FC48571A3F113335B1D60
+828C63E45695832F0235734ACEED7216F1A35D9342246CB13BEE41A7270B27DA
+D5C5ED3EE28983DE5370859928B3E0C4E0251EE790235E237B252D03D89452CC
+F8E240C2F3E175274340235D9985C6B86F8A633E8ABC708637B9CBC77BC6E958
+E19E5E256394D233E5B5E6650D0CCE988CF822B2BB08EBCA27F7D4A03D969522
+B3F58ADA9F668D1190F470DC05DE4C85480608D842FBDE50B9B5C4268CEF65E0
+DF4C51AB5890C88A6EE23B6A97FABE476762A8A8CC13DF926AB26886CEEC8CEA
+203C546C71B145EC2EFFD22B600D94DAE4D530C8FCEB583C461E044A59B1B38B
+5BD8E110BE7FCBCA887515B814B9EB11C5AB8E3A0F02C9B6E45B5ACA0C2B44E6
+044AADBFFB8051C37A29A68FEC8F26461CA9BD5B728F128A29A43989DDD82021
+22F5B63696039E5FD7CB7654D12C6DEA6164C5B03EF114D7B9B6477E87347310
+1AE34432A87805215995D9DA518EE37AE04791FC2C7765940F81331457C49A39
+334288ACE2DE4A34E6E6109F5EACFF6EF8D92E2E159DB394ABB4599E1EDC0EA4
+1DDC0E3DD8C1113DB35F99120CC4043C9B426FD01B4C0FA61145F2CCD0A47718
+7061B7E0787270DEF220C30AADC207BE4F6580D8CBDBA89CAD4E4E35F2D9F912
+6FA58D0813830702DA833A8F6550B5D7ABF734A2723DC1078D1330F0230443A1
+6DFE746411F538A136F8250597385150C0DE452F50B77B4F834F6AD36BDA6352
+3D78F650ACB4F366EA4F2EC63CF49BC7ABD681F15B56638CA8F1B5D4B9DAC297
+BA6E755896041412C745CAD704F2D36BAF5970B7308C965AD2845B4FF1543CAF
+812A959713EDBE61608F44B4BA5DAB1585097A32778F9CBC5F0E7427397B6D6F
+9A26D9DB02DE7655369655E518A37BF689E4056BA30BDD137710B9B0DD5F04F8
+BCFEA40D7036D2880C48278E8F7EBB0CC3DF07E418D055C935C5B6E2B55C2BE0
+4A754730395FFAF690F33E66237624FD069AC152544A5933447B0E8A34358006
+0FC2ADC78A11B1794504016316B9F9562877D9620F82F8E3542C02D335436738
+EAD428B33D139E66F5C89A754D6F30B308F454B0A754B12557C602708E2E1F7C
+F2F718676BE5767D85D4C48E3A8AAF43BD193BCD37442E5C19251DDCAEE189C4
+0E69B6B33E0B4EF5F4AB4563A0A05047F1EED59F38D706A1AF5213267AB7CB67
+E969703BFE4E0FAA0854D21AE188E6BFB71D882C57DA8A32B3A62669F21844C8
+60D871DAC3F8E50D853757190679BCF7B29B0F9113EE6EB9C5C03C4FBD130F59
+9D9C9D05C72FF7E57BA8770C57E61E6E9D9A7A6A9D2801ECD057E7580020D1AD
+E8C4E288A92E8FA7BE47EA73BD9FA6AF23AA0151F18311AA514E9758A2084DD6
+65AE13E8EACE8216FD45CAC2EA3916F2AA1F0DAA758A1B0E21D8C3CE25BB0E12
+106309972258E290724C64B8BA0FC6F27D109DAD1FAD8DA0DF3696287A47DCBF
+53D114248BD91B65A16A3E4D3FF1961E7C224FB83451D8F6447888F55B39DD60
+E1E821E1DD2480E0194E0E39B3A6EAF38B84DBB43E0D7F8BE6DBD3C7CBDFCCE4
+8212EE8725A94DB053FABF80F5003E9201B70D1B3E91C57E2AB01029E04C2DD3
+F3B01B001E1E87DDA1B1E3D3A00CB205A443F4E3DA35E5785402D9C09BB2093A
+A71A5A5E110BDA000B112FBEF3EDE1E592B15B2A8AE90725E2D3506997B7FA80
+81A30C1B826BDA46DDB60563553EB586268686CA9D854717049BD11555CEAA60
+849C9EFB8051A35F5A785B216DC3E04C646651BE6804A0809F89010121810D52
+204C4CC820C316EDE87A51CC0244AB84711C22B6F8F3F7B0FFA8ADF632B58744
+4910BAF39D1266D26A1BDA0A6E97C17F0F4694D2097A60353A79E90024D0982E
+FFCA95E064E3FEE8E122AAA31ECFE25676DAFA027FFD171D93A24711349A7845
+671C9E79EE7D213F0334634701FD40C5845A4D1747F933D722FE14704E1A4D1A
+E3281CA7A2387E058215E052A36417D24FD499F79D81F0853D8E1BE3759350B7
+1BD30BB31130C297C72091E87BEDEEE772EA2B50B51A55C83B6A322D91EE9E05
+E54C6FAF5F3D822FAED960BAF879DA9DD21E07D5B7072AD8222BB28F761B0661
+F72D11A1076CC45035383264040AC6110F4CA98AA5E50A662C0CE3206DC9F67B
+9B0DBBCDBE8BCD423EBD861FEB976855FD19333C91D72A90D8DCE86E5BD326FD
+0135B2FFD16CACF514282C142F5030F59303ADB150CF818FDAD3F93A704CF3FB
+2B0E4805AE4E8DAFEE48E77A5F6FEDDF0B7474474CC096081872B347B05E79B4
+EA565411C750398B99350AE44C7253A17A77A987A511F3A81236B332FA01952F
+B59466C0F8CAE39434092BBED956F212CB4BA17619B5B42CC398AFD670FE37A1
+2A9201357A278EC0495133A9456B058B89D8C6298698609710AC87104F276D9E
+7AD3D479D4ED0D88AC14A5FAF2AC1C92884C56424DF9A2AB32B3553483809B50
+A1ADE4E708F75DABE13A5A216C05F2CCECE4D0BF44C34EEBAC25A5D3A5900B8F
+D8E5B7A14BE16187752B940FFF6077E020757F7089B158320963D7BCA0364AE1
+10DE2EEBED18C7DE0F2B3A98DEB2AA9BD567FA74B6F8EE39C1F0257964E48C6C
+C101262075192503ADDE47E0A2F8646CBF7ECEE19A63B8B06935E6A63AE3B3FD
+1C0F352AE784671A9F435E86F04D179E16F7E575A7B3D53E5684209F6C201D0D
+B19C26CBAAF1EA9D3E6D3EFD872E8860148B9D7B40D47CD4D85C5AF96D9B7081
+8F2FDC7AB1B768DEC599213D746A11972286B299D708F6760E681877E37C2B17
+8685EA2C1CC8D4B28ADEBCFD7794B17B53137B4A7EF7A1CC1152D5B0F24FE520
+C921C333E4D6E21D4378DF9876372D4AE54DEDD7F3B602D2A7DD795D295266ED
+53181DCE2B0B0821D1FBADA8F5176BDFF6448B45839432B6BF6690569A2AF22A
+1E006CF77D2058A3328D5D829FCACC75E8CFABFABDE8171FEFAE1B6216DC4ED2
+FD68CD8A68451066ED295B396313907F6EE0F0443475C1EF2863CE8A2E799356
+1ECE6B9928B5BDFCF89D4C1B0B7838BFF4CA1079FCCF30B54A64556D961B64E8
+43A90017A50F405C57060D246B882525DF52469AAE7FC7B6C9F903D548B70FAF
+0FA2237729010B1611A42CE375BA41B8BF4073216C154AF17AE7A709A7535998
+AC204192CEE62E89BE45E8CFC443D0F11B4D913ED7351B9AD19DF95E945A352E
+2F655EA3EF8CBDA445775B02DDE1B788B28819D359BA883456119717A79A8571
+30FD189490424F1F55819886181085FF48790379BE05891C2E93DF5D0DA65689
+05D4F73A31C7311BE31CF900A3E543107B509C459F35BE3386D2F8CE8E062407
+7BE96021B41B7508E17CEECD3A36E283E562F8F34FE8D04D2C531FB78BFE9AE4
+BEE9ADA9641A4EC659EB28DE730ABEC93962B870E0D4ADECC880C41EEF787A85
+44E4583FE5F0D93F9EE01C3769A49BC29A41F9097871DE698D5142087A8C0309
+BE5FAC99E8082F973012B2E217770F36BB721F01586BF98C552BBFD675D31134
+BD416EBCE7718006D8927B55036ADC574800D23E4CBA316C7E7B32FCEA9C8A76
+A6F0BFE1B35F2C35E873841DFE8FCA9D74C83BCA72B2541D4AEA7E12FBB719D2
+8F3037DC3DFB663A751C29E0F66A54C40290BD44B0CA65D3D8E3EFB9333837E8
+08B3DBA39897051A87A7FAE55E2C0C6B30993766D581476AD9BAD0C967458DFD
+C7F5ACC62DBA84F983838190AD42E52F469FE739587759367F8ADB41B8173304
+BE40D9AAFB63302CCCECAA5EEB140D22D96CD1F23D91F0C6DF2302B0795B3247
+2543867833D92DAF5FBE7499294D9879663CADA95644E218C55313CEDBC8CA8B
+29EDA2489F630A83027A7460E5EC9D6FAA93E726DD17EFD4FA6F379748C5D957
+0A69E7B66F353D1F684344C220E215A0B81EA1077B718DD0B50CFC18D9F141CB
+47ED598C1B87348A6963FF4AC3906BD06038CBB320A948D0E584FB8C4AB84FCD
+151ADFE9E6765CD137ABDABE0CA8902ABB231646A0F57FD745EDF3EBD4F9740D
+02FDB3FE75F07BBDBBC9A7FF5B2C039B2C8AB9738792A5612AC621230A965DCD
+099836A12DB64920846639266F2867C75A6AB82055A412FA43D52A5DCD164A24
+A2DBDBFAFC4035DA70677B74C29BA837BF3843B01505A20E169C884A3308A20A
+B7B1EC067AF5BD728AFB06DC1130EB495511EAC13BD9CE0BA0E324D9B818F8E6
+4107A48294084A012F7013AF95CC5FB811DCAC35788B7105C6196DF9AFB9E256
+239A4575CE067418D597227AB7DDC8D4F93F5DC4EE7871125DDA563B00EFF193
+46BBADC7558C1EA36CAB830EEF3B2948696728F1D57466AF2E386D025D2F058F
+DA9A1013CBA5CF983684EE358F54C6E995A2EEAAF2C2D222D4B90DBC23C4630B
+F5E3DF82AA261F4B134C37A6E8A4977D14A32843C9CEA689A07953105F8EB759
+164740E1974E36FF5BC6206EF10E8EDCB6F1C5905DA8FADAE3F0358A78BCE14B
+778DEAABD044AC572F4515AE00618D8A09D2174901BAA63611DD0330F8FF0618
+76B49F493FB4BC2E49AF0C898A63FC09BF913DFC632CC63CC5B716A6D61F0075
+8A305BC2BD4B9F36A49874FC109A1B0007C44E283E6D41ECFA5C0CF86AE7A23E
+281EBDCB3806E13C11DD54B3BAB252F8998A36946B2217E44D46FC82AC4183C1
+F70918C07ECE2D6A007FF7BBEF00525372DA2DAE85143C17CA3085BA1FFABD8B
+0EBE23100890BFDD943DF6872929B184430B5A4E82DBDD776AD181254979687A
+F76AE9C5AA12FC5A32A0C233DFB295BE882759F542ED83A005FB858EF24D39A0
+8DB664AEA7E5BC00E7ACF17A14DE25515DA19CAA862454AD8FB6483151B2DCAC
+F955F5D0472A45455DD3C05C68205D4E65E0771246D385EC399E161D1696572B
+5A1DD642670A59AD1BD24A01CA3086863A62E71E11CBAC6310752AC2C7AC4C79
+7A83B95FDCDC8E5B646A0F3F4497286ABA7B10BA05DADB395C4E4672C87524DD
+EAF4DB672A7BBF3E03E21DCBF85BE567B17AD39E8AD29674B6FF7D3F05E280A0
+C7AE4FCEF6E53AF8C5E00836E9CB86C5B0C1C61E92DF405FECDA7E2F7CD596BD
+3145E6C9A70E3B37E0B9C3E6CB0CC60AA95F90DD9C6A506FB2B1C4FAAA2CB8C5
+D8CEE6A64A4B1882A89EB911A9F091AF61888C33827BDDAF1D33F6DCF6359508
+3EE6E0F118BE13B67F0FB997DB11D67D775FD347BA21203C75C52B0420D38946
+0FD53563A8CAF4F39E0B245C090CA8467AE799A6DCCC02ACAAEE63B1F1CDBAC5
+AEFCDBC2DE573D1C97A4AE342548B600407304AB6CA04D9A871189E90A2C2E8C
+0E3A471FA0DA594D0B80212FF81A51B487B74E8145D462BACF0C9438F2716334
+EECF0D75ABFB575679CE7A0FD42F7E3C25E679823F319267F513A256A408D16E
+623A502F6A564238CDC390025FD30C7CE1F4D981BF9202132717DA879CBBD942
+65840368AA0323F058AC6758C044A58867A953A6C56E67B2EA35E32158C98217
+8D512545EA6B429948C9F3A21AF6E3E3C9BE8391F2A4B2AEFA6542A5661FE7AF
+1759C7DFEEE2BB351EF1B9D6F00F7ACDD45D95D5EE18D4F62E050CCCFAE5CACA
+334E29019DC9159CCB4FC3E6A5405CB0B87763CFA16588F7368F03879316CC60
+5612E62E96AFC54F571979492793DBC01806E283110CA0E601E1F25F532B00C2
+0D9C89B554B63E8B0869D3B8E20AB61FBF4F291D8D35D7E918D99DC9FA0D1748
+6578166EE41A4CB89AA1BDB8A80B99E847F53C6FA2B6B2EFB0E740FD919D2D3C
+E0658B6988063BAFBBF90EBCD92F16935E351E82A2D95488C0C588AB95544D31
+F11044B10A86767CC684EA098912ED7AF9A47FED435E81738CBB9FE8F7DD6A6C
+F928F4EF3314694377E91F0D3F8CF3FE671876662C422352D05F00ACD1222CAA
+FFA7576B71BF55F6EE51F1B66DDF12A8FD643DB848DFD94CD88DFA832038C4DC
+D7177BFBEE9AD5A412AD20828CFCA83A28FD3864E59E998CF87BC1B44E77D97D
+AC7486CB6EF85891F3105C13967390A6089F02733F857BAC0C5B5531CD7F6173
+07067FBBF79FB86E614EF76F3E329D329DB3CBA999E44364E9C5F3FC5B0A2719
+2941D726A1A6B9DF0138419B09865F4EA8854356D3AC73B8216FC5F173853E3C
+DE18538DF036C2193FB5A6F6E754AAA8602315EBE2B3DDB0D06FA9DAC589F7EF
+83AF2062BA4B3919A475FEB45AF590F998E54755737058B1D4C2003DFC7BC140
+09154CFA4579CAB748016BC4A8D4A5B6E5CF1527F4D80268AE58653C96E157EC
+97010FA65520C5E2D6328F0D75662D84240F9DCA91D465C2F88D153455927118
+8A0FB14A1A2BCF916D66DE1EC9894E41C10B18D6339706A799D4DED548D5714A
+C032355C16B38C70F6AC8FA627F98C5041ED0EED5479734E4AAA5E5D51CA18D8
+E7593004142305536632BBD9C6DF7D2D50429E396CF1F537BD06ACD0DC22A376
+384A0CEE284FEF85A8A79CCFA7390103A7B0609A376B9C5E457FF9CA618A8250
+9C641670277876EB67B630DD930636F4C7F2E977159A843DC0BBF15A66D80EF6
+AD1BEA3F21EA021016F46179DA45519CCF222A4FEBFEBD6A89D175586AFF2C2F
+CB0F3C98FBE306CBCBAD32EE97325B23E2742D79C2DFF7328CE054F8D8528848
+2E7D3CB20CF24E7D4F135193FDC1F88C8E957A72B3D34EF99AF6283CF8BCC2A7
+FD04059DBFF4CC6090996F4A59F9FA516F34359374CF9A39F39AF1803DE39F24
+28F254F7A046388F19CE1C3097581EBE809A59C7066820652944A7A65A8AA1B7
+5BACD25950F6FFDF10C3595953A3B0174936608897027DE01A8B428E70748F1E
+71B3CCFDEB708E3D18803695E27CC67390345068941E41EBF1BD9068531AC8E0
+7E3E85E44DB0492FDC401D417D8968F64ED82EB4550C7AA7EFAE86E54613168D
+B852BCC21F070BF169951E8B3568CCE142608594A46CC8C6317F853CD84EA22B
+2858959A0E8571B9B0DC21A0717983CB4ACC28D94248E386D2F3746E11F8CB93
+C8FEB318E0A1A1D3528D4CD18521F288A48277255643CB492181968805903472
+D27A1513FF9C9327D2C8086E8F0239D907B33EEF5083EE4128A14C5A89D133C9
+44CE2AB4614623A53F4348C93A28B9C751E0E653010BF96822CB53CBFBBD68D5
+C86990E0B9FD5B5EA3C79FFF54AA2D5CA6B2D9F60768BA712B1EDEEFE09CE974
+179288B57CAB05EC8626908F8727048CCD3117631E115B9E11E9D8EFAC3212D6
+7750E56C0D9CE176E4A186EB88673F17534AC475E7DE03729B0246CE62BA7E21
+4964C5F4D6D4FC3BC90A05A7B5EC05A84AD0DCE577AF540B554D19D78402D916
+1CA4E04057DDF05628FF14041EA98056C6F523FF5DBA82984B8D2BF7471C15A0
+F1786818FA3819E07342D6A5A3466BE1AFFA6B2D566B4D9AF6B3F2ACADDD1490
+A2C3CBC001BE560CB5AEB9B9274664662D0EB8DD184959DEB9CE689175B65AE8
+C18E5E4FE548632A7331559AC3FB443EFEC952DC4669E60CD7899ED936B53D0B
+6A995E19DF45B5B516BD028D319423561696E4558AAA21A565B84B5186F3BD98
+2FA94B0133D003361F5B9CE67208E7121FFED49AD138754BEA27AF9E25D98E21
+3F887B798C1F79FE3A6570EC511A8E4BD7238CCFB0166BA2204E1D8D89D62904
+977AF4B13699C83C68023A6622E048A7C63F01A819C68F869DFE37BE8C2FEDEF
+DB4FF0F778CF40EBC68B70600E0213D061923F26CBDC301F47E07A657C1FB761
+E0928F7A93D7DAB2A0A1C98CC816E43201761B8692A31C06EA31EF553440ADB5
+8D4296DBFB9F76DAD41431AE29449EF236B278F05CDB6BF14F75A8FB35D5DB7C
+451FF6F217828DD02E6B37C26672532E6748D2CB55C7353C4BC558EBB2C6CA77
+DE433C0712EE1DCA4547902725E95CCE069B6DA27BA72EC7F1982F9F8B68162F
+1D4CC13B64DD319509B54E6CF12717E657CA49EF3FBE998298DEB3C096AF1431
+0FF01EF378567CA4DCF1E58E7E39352E7BF861AC739CF1E57526FF23EA728F4E
+65391F3E9C6E29375CD83CDE98E386E9509B31B20160737B0D963C7C5DC5A048
+0110593F644AF7F79CEFA3F7B3A2000D24C06EA1789FBD2600AE86288E958EE1
+DFE8E624928E49365F717662158696F71CD61E74979BA31EB2D9CD9CBFD23583
+B188B582AAC5B6FF1D45FA0BD00EC1C8F1EEE7751C15875F297F01820CB78FC2
+1A2CDCCB06B8337D3F0184C0C2419CB1618217C076547C56B86494812A105059
+7046BEDCDDB3A0DD708D5A30C0B8C9C0BE63D28D2939D63DE5BC636FC87959C5
+16EB75D8F4EF09B294C7E883DF226CB034BFD9E10C424A958B4D97561AE70CD1
+423044FC7672413DF866EE14C0B7237CDD1720D299955CA833C459E534491A24
+A5529A4D30376636222E57E07A4F5EAF90CEAFFA9A7DB9AA46ADA1BD3321B576
+3016149BC36E39F41F5572171E4718818FA8439FB2E0DA7DDDCA3F6DC172B126
+A88A43F96CD4DAE382E701EE763B095D2EF8773F4179F2B68AB734987253F957
+E99E13C88D92EC0A959175D0F10C5F2F94E84D290CD2942ABE1D91B8F531403A
+9CB8F1761622FE2621E5EECF6B0B3DC14468BF4253D4A72A21FD237FF19C63B4
+DD01D627E54A1BCEB3C575AB380649C691CF252D94AFFB353645C18C809F6A95
+227EEC313749E453418E1315B8950CC2D8319F990A06E4931867AC4A4E2F483F
+522FC04C13B6D11C0D420547E107AC9ABC41EAF9C17A3C45C46ED2449BF4F1D9
+60BDB0E6DA32CB5DA4D8158D6F268B51B1049E619C029F6F603586507973DCF6
+FA01D52A260A7421732EC5D4DC26390B863B622705DC6A39D83EC5D8D6C46F3F
+E55103D9BD5BDDA482D47B65C9350B158C12CABC8C05442231F276930BA0897D
+BAA299C8650903ABDBBF6AE35AFC045C7AB18A44563DF3C1E162A084F8E40C17
+9C3F4A5A64DFFB3EFF9855FB462A3E4CA067E6CE0C9D0FEA037FE7AE2405EE61
+6B222CECE1D0FB8F5DA87B6D9A689C3A887D13DDF70E2ACFBF52F18574B0373D
+2D2A947F16B302DEBCF82870DE125146B373F3DE05831446C8AA147C83DFE11D
+56EF7E780554E5926546E3D84D00AA63C8F1E23ECADF4C04270FD9ACAE96E9FD
+A8DCEBC9124E8A937EE5F4388C9573526653A77BFC7A6602389CC0E71AC3FC8A
+E213C2B166B5F09DB13905ADFCF6F8DE716719C7CB78EB87E978554E90DD6578
+FA7CB4C1DBE88AB68E6204346D227264C72877B69FF6E5C3BC7274B554DAE0E9
+2D39C19874D6FF839314A8B330CAA42302CFE82F3DB9B41EEDCDEA6DEF8109FF
+F3AF882B6F8E9762ACDC83236FD1253348BE82690BE276B565630B73EA7CB3B4
+84C3B57B2F2CDA27451DCAB2AB3AB5154698FB9B48229D09752B1982E3B228CE
+1C58706C38FFFF55401D3B9A3B070E5497D581C927CD83933D334D0193BBC315
+742BAC135FFCD6E0CA884E46998072D75F5C9F539AA200063A0B4E488C4E831C
+AE22041EFD5B358D14F873FC343F1FF8E9BF7D5D82440FF8CA67F18F9C169E62
+F67B549AC3757DCECB241C5D5F860FCAB0B1E856B28B5D84849F7D710F7EA394
+F85BC693C2AFC0BFA94B3AD7A5EB5105A76BC0C3636E9735F4CC05465005B84D
+6344512D9DC979B9F24E146B5CC23AE9AEBBE0B9FF854FC4D71B05C4653E3282
+9014A17FF4908D0697229690FF49BBF582CE447C5B2057A832B4BE4F55DBA3B4
+B8F3B9767BD2D26A1FD05BDCBE547BB0A0BA833B5CBE3371D9718E44B21A236D
+78CE0BD93339162A784F4656F2D12702DAC944AE4CDC4AFAC6DC553D6141C040
+F8A23062564789F24E747E74BA8D9AE781ECD34A7FED25EB03E74CC092B5AC32
+D0E978B78C266BB05301F0764936FC089B40BD5D7B7C9E9EA8A48522C90ACB03
+13270DC12AA069D64DE69063BE8925E98DD2FDD1B129AD9CAECEE657DD373737
+3DCA27D94AC8A948401282911C4EB3BD617CD2FC50CED630D79BBF526992FC4D
+43BF4315B02CF06CBD25299B9EFA562E85BC520C6787A7C73491325C52A57041
+6C3B92BADC59433789190266D5EB3314CAA474F421A68C7A8E315F4FFA9EBB7B
+B3FB77C3974965EE7858B0205A548DF48F68D14867CC044A113227C8F296D349
+C564EB3A180457EEB30C005A6EF0CC56AE4A415CD2E7321E459033E1EE64A3D6
+8BAFD4C6384F57590993A094F1CEA5E28CFC3D0C07E577531D1ACDD5F5E831F8
+024ECFC5739F7E8C30E490CFA9E2A807780323A0812F3E680A71E677158FC46B
+A56C145A32750A7DFC948C8322A1CB95F4039DE91D49F4473301DC6258169ADF
+01FFF3A7A14C6391D781EEDD0F35C280FB7F72EF360A1B4C9FD67B5E7191B9C1
+0E13422385B08E3C20C46EF7173FB7DA51F3458A16405B9980811E9D4588B576
+120242A2AE93AE82817DA6CF0E65178067B17A5FE0E1580BF287878E81AC41CB
+53D9D67A6251766BC9F5132028EDE983D62AE209429EA35E267A8481BE4938C5
+B687B6C2FD72EDC2F72DD382F8551923D92B0EA6ABAD7F79F9373BB80B16AC17
+ED821D0820565F1D84E52509D3A52A032E3DB54DFAE0A62E57CA259A572E4068
+822BA4057C5C1DA55C80D98DAE2DFD8FE74160A63A6CF507C8A2E68CE7BC26C8
+8D48C4AC1F2D92F739F8243F897393DCBBDFA8AA1A142EDFDFC27DF97B05237A
+69A0E8CC0244EBB05BE0FBCB5CF6449F95E9D8F03158A7A600350FCAE368D73B
+1A615994FFAEE68D4B29584280BD4B0374F664C7A94AF6F0C350737CA3F0D6A9
+B897B62ADA57393DF87F1352D7F4500D89B1825C7F961EA91A73CD68C78FB283
+20CBF07880EA7941BD13478387768C8777485C488FCCEACBA1FF0E963D396539
+A7D1F6CE3410A612510CD50CD326C9A3DA10A1D1BD448FE6DE653F0929052778
+FE259A06B877A024B37BCD7E2132CB1B3040B865D68572F09BBDF20A67064D5F
+0B2C4333199A90B4827A6BAA90F0F2827188B9BC9DF373E510B00EEC92814ABB
+D4D2A539C2E79AE8806EE341E95655B3A8021540B252B9732A7211D638C10D75
+F5AB9BC0B3E1D7866F906070EBCB6FAD51AF86303C8017FBB6EF8FC28C860E49
+6AA4FA08E33E16D5F36EA664D7070C682168DBBB681B548315C7FB4452A5FDB7
+6D6DA3E06AE2DE4863024B43B16F12BEDEE950B9F76F4C24F4802EBEED378771
+2C98A38351C0C73EB6D117FB5C5E50ED4E8B1D508FAF0A2398FA3322CD79A33A
+1DDE4176BF18175B06208591F979771F8F4D5A86C4EF7E6F3641E30970C7440F
+FB4E138C5C494AF7EAC4C285F96082F77B27034221349511B5EC911570D794AB
+4491EC98BBFBD9B991D523805656355803DCBD18F5313C0E0A6BE2B46328D49D
+2AFE3B892C391563ECA2553A542962FC76671EE1CD78B61B3EE1871372CB1741
+6AB733F7C4E8BDC3FFF93A842EF4C35DBEC18EC3408688B5E6938A74B82D4527
+B7C42B213690FBAC1D83B3F5A142F84AA03FE77862CA34643CA002802A55840D
+C05A2254A517177631B4D36FE4D3E3AE3A92EFF7E6B6FB0AE8109AC8E8CC9390
+79A1314906D88CDD75AEDC8CDEB7F58396239FF77F7CC54D01C90B68CD3D9091
+A4C0E1B7B3F962D5B306CABD224C66D6DC8A8C861D8D904AA7372799E507C547
+48084E59ADD08E0F043A2856042CFE60E7B66B65F0A1C6D275EC6B98CC806816
+04DD3C603945151108E68D16917E4C5BAEE2C1D5905F2C5614717433497D6F89
+F5CFA83BDA331F527D56F9CA76F134E8BC14ECCD5D82882F898E365764B6CF3F
+17D86E76593720F2F95B25E82AB6A6C5A35AC24FB636603DEE0D9BBED9EF64C0
+8827A8AF4A82AFE5AFEB25FA4A6F9C9DAE599F3EAF11A7133F7D09DFDFD13BB6
+81A0A9613FBBF30176A758E4F91212B5591C7431447BBD632E31F0CB3486A9B0
+D32A9DD4299989F09E3F7D7B6EDCB504818008FBD4018964D6165CCE0405311F
+973DDC9DB6E9E065D7DB562BF47FFA9172BE0D7402D0294A77B9A705B2FB116B
+300428107C9601F1194D91A81D1D0DF5FECC63ABA94B1FFFE794072B7E9AD006
+86F2523CA552F1C9B56E8F205F67B8FFD4EBBDA804EF7A5719A8E708B4947420
+892CE5F26E348EA6F53EDB228DAF272E461909F31C9E3DBA0FD32F7D60608348
+7C17C6B733BDC018F0B56C5B918A72328EB4542B52DD03EB6171DF2750108B21
+AC156A1B41E6C1851239AB47D4BFA58824F3A6B4570081736F322034B5E02164
+CF01ACB2FD6AC465AE3D60AB15CC7C77825F40F1B6327DFFBA28F19C9E8852E5
+501D5B8C81D154597F43353F6EAB277E0468CF2C3F601E509BBAEB13835ADCD8
+36C508AD55F7F74632DD592952080C0797C67280D1C6A00A94CCA02185D463D7
+7F1287A83ABB5B082373F9975BB47CC0563100DB6483FBB02D35493E3087A377
+F5295D20DE0CFDA378785CE75F69659792CEDA6FBFEA9D4E728E84FEDA6886DA
+6841516D34668433D4AC1B9225F85D1115B3F246F974F0783ACA5290E8DA82F0
+8FF7E67171550BA91A0737545A16D60660F94B59EF172BE3F23BF15548B67AF2
+8B69BBA320B67537ADD13DB8126554F39EC1D6A2E9012DA9CFD9E551ED991928
+403DA88EED5B50386D355EBC38209D60227FF0151C650C26E176FA3769142010
+0A6C08BFCC69F76CA983C22E71CDB8F82C3CD631450D9E31D10C5B313E1475B8
+AD2B5C2BD9A0C38883C45D14A2A654CA521DA7DEDB9235BE50AB76E9113AFAED
+17001106966383AAF0302B3EA79FC67805C67A733C12699F5CF89C5CFCC76280
+06C93429DE7D1A25E95B614B3987CB2488FC11FA8412D39C6023D06919428C26
+B9FF1EBE070452CACE97CD92599EFA86C5F89559A5CEE7DE6A4808CC2A1B0A3D
+F5B3EC7D337648DDE0A58BCD7987C8B4030D924628035DC3AADC9259EDFDB2B6
+75095459916F6C7737782B7469783105C38D6554C6A78E656AA7C67DD1A2FC84
+D7CF339A6EA150B5C5F8E329E1356D9A3664FB8F84652E043629DA3C0F6137FA
+BE9460B8EFFB0A3B07C9D1CDFDC26514E16B418DB7C9EB1B629CB5115571F5F2
+74610A5730DE7B228A7EA001C583393A90EC1A17F2EB20BBD7FCB5A7EE8D8195
+6FB6CA6831EB211E287694043B470118C5186B7734F07F3F52CE8D2CF528104C
+AA2B0C0EA0E576B388D35D7AF5E4440E4FF330D2EB4762385DFFE58DF9958BC5
+AD236132EC8BA573A38702BBC2A7E944C2F22C6971E533477594BC752E17BDE8
+282D1DBEBFFD3638745AAE9E3F1CF7FD812A653E91B4D2016D5D7CA721743C64
+6CE1D6EE8E34FB2ABC2D4E2BF0738393CE51AFAFBD2186BBFDA416C588EF405E
+D89D37F7802F29DDE085D8315D2189C4E07CCFCC494BD387244FC7BD73ADF41D
+3C071CC037145DD93549D2B95611F473147F5B3D3949FB12B4DF4D8A6B7D8206
+C1351625CAE596E8543C950447BA55C44F9FBFD8CCD04D87883543CF543D091C
+1CD1771786772AE3185A2F8A3842CF6BF700F5A31E247753FA76ED9E1D1B0A95
+87A131D4592CAC12C320E153ECE839F2C20FC5B99DFB16A0C1A16F8C7F492BA7
+6CCC6117D6272DD61BC3BB8301D4E030D672985DF6DB265221002A002238C56C
+7A3DB8C784388CB1B83535AD8454C7D45146A30FFC249ADAFF377C50C7D8C378
+D112655B2D64976A2BA06EDDB0523B2A7AD5EACD98482B8A3BFB59B71E0616F8
+DCD2BB1D747C691F7878EB4252B5E72B9912E314426C7B702D6C3195D7E1FA1C
+C352A7D0CF4BF943F77A21246A14E52A126C7B3E6300B66FF5453A3C57A132A5
+CC0815673A02C4824CF938F8609573F7F8E6E6676AD8B9A596A8A46DC2807AAB
+52CBE24E053E669AC875BD8DA6AF49C38F74855DCFA6FC057E1D376ABC4EC44B
+CE76CB7DB900A963F6F4AD7D84D0461624E8CC9065179FF0B7EA74BFE9CDC331
+C877A966CF5E58B6F1A7C8BAB8955B6D74FDD25D59AAD4DB9538F7F8D9787AC6
+067F5C682D8144FF96D86AC31FB3DD4744E12D66CAF1C11D6D941DF1E62C6208
+FA32B32B99885A8E7D6C450583AA53DB3F2F6415BFF0F6D466D7428C09805E33
+ED20517823C17C87EEE7A625A00DE0EA97DB558D875B25DE8B2C725D28BB95F7
+48533E503B0275162342ABA6FC3558EAA850E952ABA87A7F31438067482CDB2E
+46306EB85241A3249B45B5E40396DC039D79CC8FA90733FFADF120E8F732ED95
+D40735C4204E9A332D99E822144DB447BED79AB9B40AD3EA3E5AA09691045F67
+C3CFF352204A6D192613F074C91D683C0D1EB385474D49C805D33DF884DE11B7
+2B8F0529F69A66EBCE71F84A8FF75F3DDCFCA34C742A0E69DAEAD6777E0335B3
+FB39EF4890FE0D951638A0FF58C3EB99AF8F7E2B99C67CF9A20776779BBC32C6
+A483A783A2B144133B3AC1389A279B4175BB677FF8E9EFEFBC517A602455BA83
+851452E1C821679070F8ACA1E15E158C56DF271868392B3FDF5EDEBA0CED921D
+2BC1831CB7FF62A2D52E2E246AAEEDFAA8E5D75B2BD2E8F3B3BF04CA7A016841
+DA4CBD1075D70D341F8C563B740FB6D57F2397AC7B9FC56FB8A1E05BD14469FB
+41B6FE3CF8D0732FA13CA47CB24359ACDB1BE8857CFE508749CFDD4696B84513
+5D59577F2BEA70ABEA57B69531B6CF71F1ADF60F596A6DD750C2E15122D6825A
+1800EA3A9638C0059E788FC8B9984BB270E7353FC858EB5AAB7B77263EF9EF18
+E9594DF0167FF1780FDF1E96D07996A69522033478097B03AF60EF4B3DDC86D1
+D88A4770607FD2106A0A9F35BD19690A8BC60DF9B53490FBBD1FB12C6367AD30
+7EBEAAF395EAB04D0ACE9C51EC2667A3E5A29DFFBC1D8FE613DD2999B6C9E13A
+6CD86071EF48EC13574BA687568EE7729F21E1D5C4706CCB32A0D3B65EB9379E
+9FEDBD77EC2E01BA03F8B1206AB649665434E45B6C65B0784B947E9B86557910
+9D4A1203DCA682BC27EB97999CB6E1812338C40C77A0A5D500843D767881417E
+17D7C5AA69293D18E4F0CBAEFEC6384438DCA314AF47F00E289E798BBD0E9B3C
+E0F6E9ED8E58E2A2D6515FF0791331807840ACC906AD5B1232169C87ED03B845
+3B72370CED07335B3EA85D2391FD349F475DF23442DA35B10D43D68962D32ADA
+744522F30772FA39B6A121D2C9CE576118309DDBDD3C1DDC74E0CEB6D1BDB07B
+64D2DB3C6363CB98058087D7A7A39D616FEA857250922493FFEFD114D097452E
+FF48CC456C10D7B8EB9AB3EE1D6F28FAE649AC46394C8DD0FD782279CA375CF1
+326FE1EDB5C84A4F882D1CA79F0AA07F56A45B6438059D5F41EE36543A03D24E
+45BC00B524702BA6F47F1F8AE8672E3E9808565625F2F971B6FCE16BB2F7CA69
+ED6B0F99228C586974AD25BDE8F22A0491890338DB4B1A9AC76D93F424BC7A84
+A66D7067E282A85A749F6D1C690F1414E3577334830179307BA79F32E3E14400
+7E02D31BF0AE78765D7B1271C765566EDCCFCDD71A739E487D153AE6AACE254B
+CAC4F2FD99E3B3EC8B33F4DE6E74A638E63E955E36F524522C920CCB5400B9A6
+7E5F9B30C9F4104BAAE707D64C746832B32CF9931E842E5E2E213138652EA8A3
+72AD9259E69DF2B48186BC969066060189496601CA9702D8BC6D8B7E7244815F
+E4B1C6D51A95C2C2F7BB7877DD43DF5CFD04B0B4679A008C066E6B5B62D78473
+708D66D5D00309327D71558B72E72BB66BDB7EEDD10A5D50148E34FF636E46B1
+FA9E13616EFD16A05E173BCBB0260BE1DA69E77D47807ED54CA6FEA9FAAE0CE7
+CA0A43FBA187FC7FB6A50A9838802ED2674FF868D7DE7EDCE4D1CA6C437886B6
+F3950A096FA5E431841B666AFD99909ACA0A182E4E87A5C1E0FC21BFF7460C34
+3B23A0A27AC94EC34B9176135E2F21D82ECFBB782EB772817DEB0DAFE47E7B30
+15D642410CAC06B251613C2B19C8F2716464A4745D5A5C6563018EB12FAECFB0
+336270A37256DCA1B77E54F467CC34E42A0FB7A4DD4C6A1EADB96EA49026C4F8
+80C26565EACEF6F666981376642A6CEE270A8C99C69A40B6EFA1A2311AC472AE
+F334A7AA11F90712EF76E56B7A167E6E58455548F7D3EDF071C97328FB53B002
+06979B10FEFA25229ECB7F497CEFDAA9D9758C2DDACA94F46342BCDD503A93E3
+A62038B9587A7FC693D81BCAF72C352347EF25E2017B49863022AAAC5F96587E
+8A794E5C7C1ABB843647B1D2086D825AB35E9D4681D132E7E991B4FB58558947
+C65FF8EA824A5DBAE85602B59DDF56530120EB750EB95A58C1C9246C022974C7
+A38274961F6B1269B158D03EE517575D6194AA65403E47D9CFCA23151D9B92EA
+BEB519F06327B807359394F5CF8C13077AF39F05C5C8ABF40E06A692E8F5F117
+A9BA712FADCD444B5839A50980CADA73B5D20E359370DD44732BFAE028F079A0
+A4A2E344EE64B7F20643C27EBFA49FFC276AD9E5A8742B123FCF212BEE0C326E
+5583C7419A7334A9A6ED87E45C7CD42A7563207B9047007C2F5EC3991EE1DF7B
+F009E2AE5B211A872DB6B841B8625BA5CA4806209AA68E39FDD4ABDD2095350C
+71FF7585A39098EB6CA863D18E74A51839D9D5F83FF991AA298EF5B6522D3FFB
+14FC7AFB2DAC8C86255C37BD459D5952F551A62C6457DFC27035AA9CCCB9E114
+3D32A02660C65B0FF9B71A4A3F8BCE520F9CA0652AFA8A7B73819DD6236192DD
+3EC65D6B13CA9CC7EC5ED53E994C5E00862A54E477CB4D8652ECFC3FE2A1838B
+3E877AC7DDA8F591DCF387CF4DB615117AFFDD27468D3945337CCC20A71AA7EC
+F61A59826069F7619121EB21799AC229ECF9FE76162241AD7F20B422B393391E
+9A1C67D2E27E1D13B1C7FD5A42F870D49E269B6775EB9ECE68322952ADBF6254
+2E9259CB915940BEBB6C97BA8400C634F32111C484291CA254A540613E1B679C
+E5884F294A849CD169187E62E8D199CAD131A22FB4004B427C8E9ECBB9BC2E18
+449DBFB71C983B96761AB90D1A8B10192F823925C8153FA35A4AD6020598AB18
+43BD6E20CEF99CCD46CAD89F25435878D32891A3D709AEA1B6B5B57C597CF2A4
+7897560BC69C5AB8DCF8842995982878B6E352DAAF92F2BFB630F8B53E029B2C
+9A529FCED970A4FBB9786FD98CC8F2BD8315082CBBACED1BB737A4F56D40D60F
+4A12F9C1BD2605A20B1608A08FF25D873D92814C432F33D07AE2A8E53D1A341F
+5AD15EA39BCF9ADE49DADB9CE59EB82CC5A0B825A3FDC8A237DDD2053B63C4C3
+D2F41599D75D3F5206E0B14113438D6D6693DE5302647F420AFE3B8366A1BE23
+3CD0EB24637855D6EFACB924AEF55C29C24086245FD585F59869B4FC88CD3859
+D20E77C892930AA86252E10E16A0F232E7B72D7187F64E7E86307DE4282A6B2D
+8C8F548DB56063133540454527E69018CEFBE1AE0CF43D5A15EA43145933D9B9
+2DA3A250AC6646728071315BD71545558DA4A388D4FECC12465BE14BAA219238
+6B4D2590B3A3B55F986271D92D4DD6F6A5C34F446AE3487A67DF8BC522789EA4
+87C7132AEFFA3EFF27EBB50D54BD8A78B081B50627F2D50C9899797E5711274C
+994BB6C9E5D3483F25894834B0244F332CB8F33E5004C2B400460636CA2D43E3
+11FFA4882A8B92B1F72B79965A4CA5A5F15ACCCBD80BD9DBE3F22C29580CBD61
+9CF6E72DE5A42F968316FAFF4733D9513134A5302ED5A73D0A74C626DB1D602F
+37F662DC06B8FD69AA0E652DD45F960D6A73B3FBE31030F0B81743B384804C99
+578F4B0E7B54D1BBFD4DAC75E95CCA604DE8ADE1F1681E8EFAF2760807498EEF
+E7E5FB6C203A9649D6A71021C1D4AC4C4CD1D74BEE7C39BC167AD47223D38E84
+4CE5508550C16BA29041318D9973A9CF6368EA785E5582D7EE09EF9BE0D45E1A
+FED726EB5F6A8F472F0FAE4186F24845868586C200C20839079DDFAF317BC612
+E8EC4EFDC27ECF9866E85A6F72F713DE3C450BE264033AAB71E8085E4643F549
+9EC9BD873074018C1452FEC4765930373E5CDD368B4586CA2E05CF55E7803D93
+C3140BD46C3159D63D3D77A53D8EA39916959C02AB726D550A296A9CA80F9778
+9DB5C415C96C73B0704455F1BE27B3E1321A13D7FD9AF9FA2CDA7319F53F61E1
+3ACE95957C2D993FA2564355F190F074A53BC32CB5211795496FDE477C8CE635
+95F3AEDE2826094400F7FC6506CC5304E80815D734771E2F9933D5B16247ACBF
+7D642AB151D7F559FC9C1305E47BD936CA6501351ACEB4A3FDC81D9114FDF666
+86987ACEDEF0859B668F3B60EC02F85C7B630C491662287614AEDAA522BFD586
+6B39CD016DE114D19E1E7C1658BCF2EE315A41E59CFDC86CB5BF761B516A448C
+EC895B36F77C13394BC7F6FD292B1D60C389DC3E71AADA671A98D14ACCBB403D
+A526E5E7A80C4458A68251FDC1E8E8242B0E0764362173759F7AD24D1DBCCF34
+5ABEEA0EB3B3A3341B86948506517862CD2C675B15E476D17FC8B0B30831438E
+B87DD42D9BF7AC5D8904C07243D0EDDAFF5DCA8D13D99B6027C5B075BDD1C564
+9C8B350C8A7FF7588C089804FE92819D14C7E76EA0BF0EAC7C93D007B0219472
+749638D9CF4EA771713762D552702668EC93353E320AEC174656D9099F4DD272
+1A4A8E4E8BAAE75A2DD54E48E7B3D0EA011BCB9F0E606A640C43F5FC5791A08A
+D30A28FE8A1060673D30D8D31DA294F110ED60F9E7E1C17FE293BA3868AB3A3D
+663A302C3FE19B3716CF24EB86128B1502797D4AA57803A8D9F4B3A9B5E5DBD2
+9B619B8DEC7CF29C0B8C97108F363C068874085261B272221399ADCD82BFEAD9
+E53207DB59C90E1D8A92E35A5534FAB7E8D5B7E665C79C978B596C05B06D35C8
+77BF9BB8135A9960C98EFD24027C9F1B77BD587274ECB212CABDAE15A00099A0
+4A3D6EAB5C7ED1E5886203F7F21A769FBE2FE95A655939A0A6B5926139E9C09F
+2872487E96A87C0D834476E49C0D2DFF973BB7BD44923D1EFEA3F1CB3DC28E2D
+AF1D6B3D3A4D5D963AC8B9A1017F54C9752A4B69055E516597A6645817BC04F5
+37730D6E535B6BEDF0AF3066B7D541618E837DE58647555BB70C2D95CCFCB039
+B12C03E1CC73A250A3C11D4DB5A462DF516E2ABD754B1F9050AE4D97537A40F8
+55C18C297246A9C80BFA0234DFDECB5F0BD87BC2945F0299FFF4989871D4EBA9
+83AF068E23DA0BFE43C8A64706AF9F00E5502757222906F8AD158BF7FA1CB82E
+8E0B2EA816049839F8DBCDD36AA2BC1AD9CFA8A21720092CC531EBFD0648F7BF
+45E122A1D8250DA066E0C254AF06D914F0A975222F83CCE217F0AA418BA42E3C
+72C487B4348ABBCFF978E4838CC3462F0D37756F1DD10214D00501158604183F
+1878C2697BE8FA769C155EAFEA49C5D0623A9BFC661BDC0EF8B15DB9ED7A993C
+99C8D3452F67DCF763747327E591A2F44B5B57F82C27C4B50B0E4F0A7F0967AC
+CC7A86E8487654541CBC645D64
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+cleartomark
+%%EndFont
+%%BeginFont: CMSL10
+%!PS-AdobeFont-1.1: CMSL10 1.0
+%%CreationDate: 1991 Aug 20 16:40:20
+% Copyright (C) 1997 American Mathematical Society. All Rights Reserved.
+11 dict begin
+/FontInfo 7 dict dup begin
+/version (1.0) readonly def
+/Notice (Copyright (C) 1997 American Mathematical Society. All Rights Reserved) readonly def
+/FullName (CMSL10) readonly def
+/FamilyName (Computer Modern) readonly def
+/Weight (Medium) readonly def
+/ItalicAngle -9.46 def
+/isFixedPitch false def
+end readonly def
+/FontName /CMSL10 def
+/PaintType 0 def
+/FontType 1 def
+/FontMatrix [0.001 0 0 0.001 0 0] readonly def
+/Encoding 256 array
+0 1 255 {1 index exch /.notdef put} for
+dup 97 /a put
+dup 100 /d put
+dup 101 /e put
+dup 102 /f put
+dup 104 /h put
+dup 108 /l put
+dup 110 /n put
+dup 111 /o put
+dup 112 /p put
+dup 115 /s put
+dup 116 /t put
+readonly def
+/FontBBox{-62 -250 1123 750}readonly def
+/UniqueID 5000798 def
+currentdict end
+currentfile eexec
+D9D66F633B846A97B686A97E45A3D0AA0529731C99A784CCBE85B4993B2EEBDE
+3B12D472B7CF54651EF21185116A69AB1096ED4BAD2F646635E019B6417CC77B
+532F85D811C70D1429A19A5307EF63EB5C5E02C89FC6C20F6D9D89E7D91FE470
+B72BEFDA23F5DF76BE05AF4CE93137A219ED8A04A9D7D6FDF37E6B7FCDE0D90B
+986423E5960A5D9FBB4C956556E8DF90CBFAEC476FA36FD9A5C8175C9AF513FE
+D919C2DDD26BDC0D99398B9F4D03D5993DFC0930297866E1CD0A319B6B1FD958
+9429B9D40924DC059325D9D4CC0344F3F997A99E6CC0676735EBCD685AAC9142
+08DAFEC78BB41AFC2F1C219910BDF41D6279284EF600B69776CA15BC8A34347C
+30783C52AFA60FBE3E353E2AE354CF87B558776A22C776C7A0B5AB5CE1F941EF
+C2D9CAC37294BF407A671F10E4743BF842143F4F7DFEE643BA3BBD8BB9E3F24A
+BCCF7F0ADF8BA500620C81033EAE8C4EF2C1DEF13AC575F1B3BBB66F093D3B78
+5412B82B67FFA087AF57182B2230F9F2137180CA58A7D9B2C822FF04BE6CD01D
+43B2CA7058C7B953F6D9B5D6E91ECBAA5CDE1159B0E59C83DBAD96D6C8C8BAB1
+374EF652D10C0F3EE7104472C98DD3572AAF2D45A70BF7061447E21EE3C3BF23
+DF39C2D1B35B42CD5297BEBE6BC94F7C9DC6E61EC67E4F677256FED9064BD3E4
+B51A71B1D27CA4E5AA9E1D8080E6DAB5310711EEF87C40859FA935B19524AE83
+63B163FA8397BDFF443227FEDF7DB27DC35D89FB1C5E435DA0619A5C88AFC73B
+89A2DF5E767C5B536BC7167A840A0C32BD57A14DE69A7D0D819AC36FF32F908A
+5070F32983BB007437E3500799DF5E0AD3710A4C0000F0098D5BE99F2EB9C1C2
+C444FD9552D0DCA098A94B3BF176F511CEE13DB7EFFAED7C47B5ADCF8D4700F5
+7B6DF50EE617C00966B9A2828882804DB7477F4A8CF5345B7F3568B4F72BCE73
+2E2AA5BC4B4C70E21F3AD9AFC3B8605A00D67EF9ED1F4D13DDAA920D45B43CE0
+0941BF17CF05D2B777C11D4D844AB20C0693D1DDF00B27D9E1AA2D98A4A06CC6
+D342AD8F644F4787B66CA7D861E7CE13FCDA85C1B0C9F94009768EA89838EBA2
+7818F4085D21CD920BC93DF016DE8266F4388C3A0500AF9DF0EFBC1D25C9DB5D
+DD725442199AA6DA16946EF6C5997CB82007A8845C2F5D66418CAD49F0FD1043
+CA4F67A711EC3433357D72265EC26B2735D8C5FA4E3BF6B628B1A6619EE634E6
+3A027776BE8A107FAFC81CF7685352ED4F33833BA8CE702B6083393060E099EA
+6B33B8D1621D914220537E2FB0973FB4C6A572A289FF3E07FC9000CE88144087
+0D7F03E1C1778BB1F917786061E139C8A59EF34EEFC6F0DB4580EA795BF12A9E
+F913DE0CB721D2852B1B04A4A3632B1A645ED4D20A85F974C30673518FDF5C1E
+7A75809CE204217CAE1606F987990B7F031E84AA9CC0DE600A9ECC386478E315
+46B63E1403FE3EF8D38F461E22D04A7C35C7B30CD964B3DDF758522064328E4C
+4C7E6AD7DA1233D416338CAC55333979160A61215E53FE126E75186137BC9058
+94C9E34F8249313B983BF3C75EAD393B9E165ACDAEE9B865EF2B00E0F00698D6
+9C72D51A42FD8CB2E7F4B103D1927F3570BA49A86FCF779474D2263C30DE255C
+D7C07993D400A7FEC9C60AAFFDA834FB0E6CC6237C95D983354AECDD22C99C2E
+8FC57AB325C0788168BAD9FF4D8FC0BA68302283231B04EC56E64B43A127B3F8
+82CFCB199E4279414AE0A21CF3C7929596C69CCD33BB0DF1916181CBD23FD74A
+BF446D3190767603F0D4D0BF9E83EF94D958CCC8A4E5794E2C898B45EAC00CCB
+8A97316954D34056CE806CEED183B35A73C76F942FAD3701171C9D09C50D72BA
+5ABA2CAD58DDDF10AB1CBC7A6C7A6C9849CA1325790D7F1F8170BC3B13EAAA84
+F0A0FEB2A7298620E5351C57361DCEECEC9F97F7BB8DEA65536612BCC6AC80A7
+B4A0970F7A00CCFB098063294799F8EFC05F5A342E176E2629733C09560A777A
+8DEBA7D717BF113911C537425A990E3DFB3E50F9D83DF21EDB0EA2E459ABAD4A
+F849D97AB7C3BB40A5775ECC64B7D4EB1051F7CBF3B9A7FCFB01AFE99D6D5188
+3199BF72260B8F7170F4FFE87741A881295B53F2113042062986C17E48E4E6A6
+F6B6AD14E0A5874C4BCDA931B4B65B18B04D77ED2090146E0271E27D9B7EB3DE
+EE556B340EA8777449AD2E518F6909F836D0A926548694DBE1FC18F7B3E51896
+84B8784BB5B789A15BDA8DCBDBE5227702EB61D16EACF19E1B9CCC1D08143EF6
+B0C88B341C51215962E5142E8AD1629BCA85517BAB36EB9E4002C0F1E4A40DF9
+01884C1B8A7F55ABCFD2A3F97B84A348EACB20DD233B465656473ECF6E4AC374
+AC9ADD69D6828E125802BD6E693942B994252D219DA2AFB0ACA3116A14E18E17
+24D8BFB32D6C7FC01CA2018BE0C5B3A85624D3839110571BD5EE059BFBCC0E1B
+191DC9E2B7DBEE146B2EF42AE3A39D2C6906E08883B163D406ED4C9B29DDADA4
+7635EB3C48098EB003404C9C48191C279DA21552D0DCC0559884439D2BD96627
+7AE495F59D84A7F7B265104D73CE1ABDEB56D8194C626D1B7D28652980D49A7F
+F95A0994CB10C660B7515FC1C98D1FF7E116271E6DA800D0ADA4C0D626C21F02
+30D9CE707EA736EEA1BDBBF0D57909090EA63027173B7C6C10692991C76BFF91
+CE5CB822BB7F717D8655D919548B758FA5867FDCA442B1C568CC46C795EECBC6
+571FACF615A9B2B833679026896006764E70BF7198A0B91245EF1D29A5A18E24
+3E5F9840DAE9E21A04806C1160EDFF119BC0F585D2486F4A6DAF4E47414D4D10
+2811AE0DC6671EF79528C9DBEAE70E37D4A777233C38ABE26F2AA3E80433395E
+822F5E992FFAE921D9FD09ED9B7B5A83380E260FB826F00417D668B962F396E2
+B4A3A8F24D8161C82991FF9B0687437F1C3D8A08AE4CCA704F45F2524DE5501D
+71F5079A0E4F103D44385DE88536F495DF81F12C5B58580745434786B9209525
+2ADD52B64A5E64A3ADB2E693FB03059ED2C45C3C50ADF7439CEB750B33782802
+B7E5BDF0921DA6491E90560A82F7A0567EFC979DAB07D0B585A666CCF757A5B7
+7E0212D9FDEBA6C296A59C2CED317CE9AA68F361C73319B2BCCAD0DCE4E6A703
+C941C2FBB11F62A6414C90ECA72F08C7248EAFA8D29BEDCC5936401055C73B05
+C84315C69689D1DF0A17A21C7F6180A4EBDE858579D970A851E788284E98D049
+B9C9FA269F008BFDFF535855071653483BCDD17B05D88661875DBEE92193CC79
+6290CF98826218C5653797BD63149C7E1075DDB72F76153FC5FC16D56D71B637
+1A74FEFADB2AECF1B213BD8696D69BDEAFA079DFD0EF8406B5114B6CE653D018
+E6422F8204C200D49AE1D6E7E22413ED5857B717B42C9EFD894CC54B93FD846A
+05317DEC47F25A8FEDB02596EDC22087FBB5A71F7047D5674B772832C0A9246B
+FA9A212A6C0F45272E7D5210A30C2E7849C0623664858BF69F185793C3F8A00F
+9A231C8A1A82425C7847D17DA55A6220124A5DEDF24154C2FC349B4F9657CF81
+447456B7DBF0B34C6A27038BF5DE6BA4DF918757386A1358E476CE2066893B53
+E6727CDF0333B7C331B49EECEAB30BA3E5218DAE1AF1B89A7F009B23A6187A86
+903F329E228EE7F029AC1D280E3006545E08D61C034B1B7A413EEC49D4395257
+DCC24294A660238CFABE27DA047AEB0F465A0DE6D2725EC0546C11DA54596218
+4BE5E5457E9C05C471A2678B0279A2B901798C660462FC0DE9413E0EF3651EF0
+E7D01904918A7B62BABC35156895CD7DB9E18E9E6990E4CA01D7EACF0E79D345
+F6CD54025071F431ED3E6FD00FCBAC3413011AB91F4C2EEAB86C33757936454D
+797BFDB799676A4E0D70C5035B38C96E4A160B9C57F5EFA7572F1C2E93A5DCDB
+8C13FC925D362B2C3AAEF537DA7E18224EF9F4EA1E97DD25DD9F569F61F2A0FD
+AADFDD550363BC93AC2251F7E1C569285B8F8C855F2F4F64047EF092AEB89E2C
+F596FD46588E6D2176CF4A3755D55986BD57D485AEF16821258678AB1C6E05BE
+30D29932595EE42066EDDA1A53CFBCC902B091146CF474B6B0683EA6075CDE6F
+
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+cleartomark
+%%EndFont
+%%BeginFont: CMSSI10
+%!PS-AdobeFont-1.1: CMSSI10 1.0
+%%CreationDate: 1991 Aug 20 17:34:37
+% Copyright (C) 1997 American Mathematical Society. All Rights Reserved.
+11 dict begin
+/FontInfo 7 dict dup begin
+/version (1.0) readonly def
+/Notice (Copyright (C) 1997 American Mathematical Society. All Rights Reserved) readonly def
+/FullName (CMSSI10) readonly def
+/FamilyName (Computer Modern) readonly def
+/Weight (Medium) readonly def
+/ItalicAngle -12 def
+/isFixedPitch false def
+end readonly def
+/FontName /CMSSI10 def
+/PaintType 0 def
+/FontType 1 def
+/FontMatrix [0.001 0 0 0.001 0 0] readonly def
+/Encoding 256 array
+0 1 255 {1 index exch /.notdef put} for
+dup 12 /fi put
+dup 13 /fl put
+dup 45 /hyphen put
+dup 97 /a put
+dup 98 /b put
+dup 99 /c put
+dup 100 /d put
+dup 101 /e put
+dup 102 /f put
+dup 103 /g put
+dup 104 /h put
+dup 105 /i put
+dup 108 /l put
+dup 109 /m put
+dup 110 /n put
+dup 111 /o put
+dup 112 /p put
+dup 114 /r put
+dup 115 /s put
+dup 116 /t put
+dup 117 /u put
+dup 118 /v put
+dup 120 /x put
+dup 121 /y put
+readonly def
+/FontBBox{-97 -250 1077 759}readonly def
+/UniqueID 5000810 def
+currentdict end
+currentfile eexec
+D9D66F633B846A97B686A97E45A3D0AA0529731C99A784CCBE85B4993B2EEBDE
+3B12D472B7CF54651EF21185116A69AB1096ED4BAD2F646635E019B6417CC77B
+532F85D811C70D1429A19A5307EF63EB5C5E02C89FC6C20F6D9D89E7D91FE470
+B72BEFDA23F5DF76BE05AF4CE93137A219ED8A04A9D7D6FDF37E6B7FCDE0D90B
+986423E5960A5D9FBB4C956556E8DF90CBFAEC476FA36FD9A5C8175C9AF513FE
+D919C2DDD26BDC0D99398B9F4D03D5993DFC0931DC68A9127B5D4E0A53C980F1
+25B546006F90C14DDFBE6457E1FF62EDBC3E6E4C3EED9145D4C5B39CF986A3D4
+D0C1CAC35082AAFC77DCC962B778E051237529367886A80679538B245FB49480
+77B66D0597CF92890360923FF918968FEE737E79C5D46B9EEBEF1BBE460BB176
+93965EC82506D2BDFE8D9616A8A29CCD77C1E9F46B531EDDF69E2F97BDF7944D
+73F55F531755FA645D37AF1A508F565FC0B43379209C1E992F3AC34A479B2012
+B70958FA12CAC36A27BB5A2C1CBBE416FC572DB8D2DBBC80BDBAF524F1507A25
+29F1944A592F59983089BD5C221F2050EF0A5844E8F0D33DA8D59CFABAD16CED
+27CCBC6820BD354F0F435E0BAEB73F7EE863A8FF0DE038C244A3DA9EA2533DD5
+78784CACDC89701CEA9BEEEFE78A0DDE239B65448339F16B9E2B5E8177B2BDCD
+C36A9C52CC3DE95CD45BDA676794180065F7DA12A87F93C337251B7F7509371C
+76A2429CEFF53722452A8D36636C685ADF1BF6C27E7839464BB3882661246875
+67F547E1E16B4EB0C4C6BCC80661C929098102CA370391EE80F029E566BE0952
+7516AA0AA335BB76E4AE49E46E74A1A97BC55D556A9BBAAB7B91C0F897B6640E
+1A06111856ADB1A4DA7326FB2F64771DC6BE8BE44D7B24A6C8BAE2551A367339
+77D9C3F4206D5C6AD232C5560B70EDA4597AD76B28362B06FF30562C51D32143
+5DCDB73DA37B18363AB00182F6E117CF6418E49B54BBC545A3BFD486091BEA9D
+6A443A5CC1D29A74CA224B8BA0DE3BFBD22C1F2C9F06BAB31B7C647AC295EACA
+3E7E957C81459ED399B1D9EE777D164FC5E70E20F8DD369946509C7FEC758D7D
+92684531FE07355401881D20A753E5FB286DE49D365C03E73F8829901A7EA5CB
+6265DE3FC80B654DF2B990ACABC572D2A12EB0E6E0C1F0E5DB4E94B56E1D99ED
+9306C3055A70E16279E444E666140BB97A4CC702445035B2056B3A7B3FE498C1
+BDB853CB3EFEC2DF97694EC5C097C678C1DFE55EA6704068CFB95E5CD553ED58
+3B9DFE6E421BE432C789A67578A98276F216E846C147971E33DE211CAEE5E45A
+55EA03A112A9653ECF0078DD4AC50BA1D023B1B67D4D086403A38647607080DF
+0BC8DA9A4D0473BFA09F1B4B620891BDAE4DD090A9C565D4C3F7D6CE7B46F2D1
+67A695CE575B5EF3006F64284CD1C506CCDC76816C0D6CF8CE45CFD12E1B8578
+D9F9CC98F48652F89111E8F99BC4C3E008F44826E7A955B54681110510B81B79
+11E192720EFA004A4595ED28FE2A4ACAE126B32A9895DCADC3629D6663E52C2A
+ADD8668C10762B2AAE108F60CBC390697BE1649A9F6B495A720F242B11F6ADF6
+32CBA56454B0619EAD35B6D9A2D4BF9F4EC953723C96F1E9BCCDDB736BD489C3
+71791F03D2FF945A8A6BD53A9967C02CE053CEA90F8796D3FD67009FB7BF0EE9
+3D4806252438D18678E3620B59DAA30F13F71E92B345DC79A910F5F1C1A116B6
+EAB9ADCD1883E95A1B6A87246FB1F662BF6C4A73D4133A023055AF0C00CCA960
+5BBBAB17752C838821E32A525F551F95AFE2AF1763C2036F927A8AC5512D1161
+0FFE349D8838A6B6466C80EC0FB7CC337877B8E41EE856778121995643FD5273
+6AA56FD120652FEF32FE6A4A17ACEFF4C0FE349FAEF03307CB0315EEAE4ED1FB
+5D8D098C2A4AE3EDB2C1984B020AB4EA9054CDF933B95E2201521BFE9A66C39F
+B88AE428F57CFA5CA6AFB4A93201E2C37CB7D4B9574436992D6B182526E1E3D2
+8EB9B68EAC19B838CFB1B7BA66A830148E40987356F4AB7BA578F175FDEE3549
+80BA7DFF90D5CD4EC525BBE9E211845BBCB3BE641B9FF4D247CF6739B2164CB9
+ACBF5CE61F77B7435534E032876900273F65DD9D84A3B150A3BD6E20693901A2
+4E3EDF38CF21B72826BC9F1BCFF692C411E948F2871B172680CF3C3343264CD5
+ECE8B884A1E537A3C043EF25F76E18EC10293A2082994CAAE85EA1F363845AC0
+05CD8E88575943F8E7787F9965BB07BCD3A6366E504E4B916D06DE6CBAA53F9A
+CBAE80BEEFEE8E5BF251222F35C222F8AD48DE3D8D2936AA22784E8A0D52E77E
+A96254AF76FEB65D7F4535EDA0D9A6393A83C0679F44F704767933F8A323FCC0
+D3D20AA4442272E98109E0FB17869CEFCE725F2FE30849B109D46B438B17EA34
+89E63A88C69BC3341B724C160324B8AC378592596335712ECC1770F6C347F2AB
+428802B08702A5A45FFE25F19B729C8F3453C36034C21C7963D6161FB4EC0885
+B2171A3CB6BBF594978D2ECDB0D9AC4B324DF5D0064FAA6D92B6F324E47D165F
+139C8558740C4A4427A8D04C8026E38683C1DA439492BBB560C7D84615195BDB
+C1B17F06218607626EAF9C300B03E8FD3D86737B3546EA4317EF3AF80E180660
+E6464DE9BB7D4FC3D9E68BCA94A20956CAA8FE7E2418FE70BAD9591495B86752
+87E9273226EEC27682A801E380FFD2F2D585632C2117089FAB9234C1BE9A1D49
+D2E97E602A761F283EA8F501E72E752C42A832999AC88A687A0F0CD216BAEC7F
+FF96164595631F4E63E2BB4E097DE8AF0B6CE24A06BF92C44AB1E839C1CE2E69
+E79682983B9BD008B5B4BB79B562E0DF6A9CEFA76ABB7542846C36CCD5BFEADD
+D417A85A3D3C0B9B090B79ED631982EDD7BF0E137B32A421F4A770DE5F43E816
+4F897E0751768A7339D5C3B49329D2368AAD7B1504A195041A898BA1368E9A55
+B50FD868AB025A9CC7C8244B3113B1ADF7E96482E880D69076352B815FDD6C70
+1A7E93912E69D71A78D677F2C0CEBE89CA2247827CCE3B3E406178FE6259DA74
+651F6D50D8CF83D64D5E3472D6DB510F5007CD3B91795B87806387A749EB90C7
+17188000DFF63ED85C5C3D56D3A78A7403B9974AE8F0AB4A310EE895EFD66B16
+F1CDEDDBBCA8F9A207FB71D49759E5132A80EB58AAF316B8A819FECAFB1C6FE6
+D87D99F1A0C8E0B582CC56E01F9B055D14AAE5F12E2BE28AA467AA4898298CE0
+BF135B3785DA8E52AEC18D6669556779899580905717B4A4A989DCBFBBC925E1
+5C9F0CD7E5FC499BEA9851B3379C79675D58F2535FA1B4A843AEE5080C8C6E50
+BCE683A7179EDF81C4FCB74198A8A71173F9DC83C98F21C56D0367971F447108
+3D3EBD481B465D00DF6E5A03BF034F5639FF3B4A41764662ADB80C0B2818BDFB
+0364EC59F535773A864C45FF2917AC487FA5100CA395887B298D6AD9B7DCF42E
+99C8F52EAD996495526FA4DE777AE436A4F11EDDFFBFC65AFE371A510F673269
+CBEAE582554229B867F85EF84BF7FB10C02A78B897B5CEB69E084D80F150D8FA
+CB3B2727249BC7D869FCEFB44429A138D81F44FDAAD8E3EDBAD437C27D32ADC1
+78EAE8716D5A3F2B578EA3CCA73A700D1EC8EC6B23D8A2D9955F433B0D013128
+63520D45A9D8692EF8B3BAF2E97384E8E0360EBC9E4D10176624857D9CE975F3
+9E010C329F111FDD8D9ED18F4D8E2057534B3AD63A997A12FDA57F8666F52B89
+09456C98EC671C6A1BACDB49CEB4C9AEC5EC2E6D0060C041239F0FD7216B094A
+6150213D9133CAC1BA41F740FC179FC0966028248A3518E5E0D1920D0B4CFE83
+B081C5350A6EEC1BE2CF25E4CD16EE4EC5C764FE5E335AAAE2E7390892532832
+16194E770373A13AF62E669429DD11121B4D7CC9E1D3D8F338318D753312FC5E
+304E99EDDCAD65F28E80A57110A91378C4E3E1766721D236189230FAA9022D50
+C0E676A0FC20F0430689CDC8E753549606DF1A0AB513DCD8F0D36874008852BE
+D5F6091B98AE66D4D42F93D612047BBBDABD29E6CCCA447F48C2C0EC9BD66533
+044F92914A4FE7629CFB6B453DA11F537D91655A80D95F42B27E92BFE456D81A
+FD1E5B9D928B1F5D5EE2562F9F5D2FF0E1256950933B4E34AEA555DE1A834199
+A37CF001405A64AE7608FA1C428EECD574A039B24D0A311D33C7FCC34EFCE2AC
+E1D17718D0E5741F596A7155B7F4762A553B41D54D08AA44A6CCECE13A3EB512
+706FC0CC13086A90D81F0AEFB9DFC323BD80E16871FA32DBB78DE54BB07FB9A2
+FA879BD415B3D871AE389E86D98BA846EC88F71E9F4DACCE48DB7A08C8E1AE55
+16B59964A3260F94A9165777ACE82ADAF547CD72A6AE8641D4D5A97C3949F94B
+1BFFAD7ABFA271DFC69167F371CA8E4D35BE957207D8819FA769628328EE1EF5
+7D84A2F40DCF2B5A0642BC479C4B28B7D2A034BECBCBF0ECE1FD5C736ADC71A9
+01F14A6AE86CEF0506F7015AD0A0B8CFCD9FF641F1EFB081704DC3F9B64B02E2
+96F93D929687EB92C073F91C77753E6729174F45E56B32DD44429954EBC688A0
+7A62ADDDF648E6CB7CCFAB8F877CA03364CE72740B4BFB2B477667B06C24341C
+BB6B8036EA795BED56C4828EAC4B287BE5022C4F52FFB6B831435286C4F1AC30
+CB2FC735B1B369B4B6C4B200979FC199A15E331086517DAF5AFF3A0249F20C2F
+49D6EDFF15E61DD2A619A7272E98BC3B67285C4C8CED384F79EAA78026D60A5D
+1089FC7094495D636604E7E351B927C0112F22AF9E5D98EB170AD3C7508587A8
+CF26FB96487921700B2B380738938A6B225F77BDAC8A9B669BF9261C3A15017D
+3278CABFBB538038969D4C2930D05A0E591E821B193DFD97D017C5651B1A4207
+4700945B8E14801ADBE126C0626D9DA54EC082BD7E26A1C1020FC9417E6EC974
+C0D070FFBE892B63745B5BCAC4F8E5FA84F4490B26FF2AB0A27A7B1822CB525C
+894B2AE218D7D8DF2E5391E0D1311B69DB4E3465C7E825877A0429CDD30A6265
+F2F7F4FDCF8F5234C0EDDB7FC2C34B832725CB069204C130552CB433285D0ADA
+DCB73A095A629452EB5D245566C1A4FDB544E77E5213B932A7DAD2565E9323B6
+EBE2CC4A0A6402C4429E833C47B10BE6595C3013192E595246E20D29279EA4E4
+686A4C0511B5FE316497DA76A748374FEA7988112203689B2EBB1756AFF78FCE
+CB06564C37BB43F2B3897161A80658266A4DFCFAE8794E3B552D425883695F99
+AD4E715B
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+cleartomark
+%%EndFont
+%%BeginFont: CMMI9
+%!PS-AdobeFont-1.1: CMMI9 1.100
+%%CreationDate: 1996 Jul 23 07:53:55
+% Copyright (C) 1997 American Mathematical Society. All Rights Reserved.
+11 dict begin
+/FontInfo 7 dict dup begin
+/version (1.100) readonly def
+/Notice (Copyright (C) 1997 American Mathematical Society. All Rights Reserved) readonly def
+/FullName (CMMI9) readonly def
+/FamilyName (Computer Modern) readonly def
+/Weight (Medium) readonly def
+/ItalicAngle -14.04 def
+/isFixedPitch false def
+end readonly def
+/FontName /CMMI9 def
+/PaintType 0 def
+/FontType 1 def
+/FontMatrix [0.001 0 0 0.001 0 0] readonly def
+/Encoding 256 array
+0 1 255 {1 index exch /.notdef put} for
+dup 34 /epsilon put
+dup 58 /period put
+readonly def
+/FontBBox{-29 -250 1075 750}readonly def
+/UniqueID 5087384 def
+currentdict end
+currentfile eexec
+D9D66F633B846A97B686A97E45A3D0AA0529731C99A784CCBE85B4993B2EEBDE
+3B12D472B7CF54651EF21185116A69AB1096ED4BAD2F646635E019B6417CC77B
+532F85D811C70D1429A19A5307EF63EB5C5E02C89FC6C20F6D9D89E7D91FE470
+B72BEFDA23F5DF76BE05AF4CE93137A219ED8A04A9D7D6FDF37E6B7FCDE0D90B
+986423E5960A5D9FBB4C956556E8DF90CBFAEC476FA36FD9A5C8175C9AF513FE
+D919C2DDD26BDC0D99398B9F4D03D5993DFC0930297866E1CD0A319B6B1FD958
+9E394A533A081C36D6F5CA5FED4F9AC9ADE41E04F9FC52E758C9F45A92BED935
+86F9CFDB57732045913A6422AD4206418610C81D882EE493DE9523CC1BFE1505
+DD1390B19BC1947A01B93BC668BE9B2A0E69A968554239B88C00AF9FBDF09CCD
+67D3B2094C11A04762FE8CC1E91D020A28B3C122D24BEAACF82313F4604F2FEF
+6E176D730A879BE45DD0D4996EF0247AEB1CA0AB08FF374D99F06D47B36F9554
+FAD9A2D3CE451B7791C3709D8A1DDDEFBD840C1B42AB824D5A0DFF0E0F15B0B7
+22AEEB877FF489581DA6FA8DA64944555101EB16F7AB0B717E148B7B98D8DBFD
+730C52937E226545CF8DC3E07C5BA30739BAFCD0F2B44275A6D503F582C0FB4F
+449963D0AD2FAFDE33BA3D77BCA9D1DF878DDAFCA2E22CC4BACD542B282164C7
+97C2BDE318AF9D501CA21F6E662E7AAB75A5F24D2C182E598D175D44E88AB19A
+E7CD59584F95B389183EE21B525BF52A3F23C0FE5383A5565A19361D716F508C
+AAB78411CA5A4D27552CC1C435760D5A89D535B71C593E755C616661363308DA
+A683F54ED0C23FB2C225A008392B0B719F66F11A946A090B7C00B662A3C69599
+B4ECB0CC70C85C4BBBF207E0026F6C7A19F2ACFB7A60804FC98A4BFFD7BFFF2B
+9529E6D9D4238002BBC255BC62959D6F3381FE06E0621B879D5FE5B541D45A1E
+759A6E7DC32B1D1632368D09A97039DF255B6492B1B2B7E2C1434E8306ECA7D3
+5A79B6D614B4979F10988BC76ED53A5F45315CD7DA216221F842FD0F3E050DD2
+BAC23C984D506D8F7D614BCB6B244F5F41321549BB0BD041FBF3053307168680
+3435E9C9456846433DF6235D79BA455E54E35184F420186BD6AB1B3CFC162B8A
+652CE8868C3CA285C3BBC3B5384D598FCF99746A6E7C724189A4E149500A5EFA
+D2721000BA3826664A912E902ABC72998E7495280FB2E4ED8738A30AB7F76B05
+9525B726770B9AB34BAA892BCD7172C801A2A5849A4B61848F7A2FFB2F395AF3
+97CDEDF219D44E7CE16509A025590822A46EC7936E99B5CE2581485C2E16E67C
+67766B9763A04E7A6AFE55BAB4CAF854DE4E0C7E5036D259B4CC9DE58C48BDC9
+C8BFCD34DFA06F84E63A724ADF804D61912A713AD4566E9749F2C1CD1F809778
+55925F6EBFD0EDF11DDAA9D32ED01F0595B35D352D56570C7A9177335241D9DE
+1B8705883439BBA7A54F7C7DCC0BEE90D484BF20B746FA73DCE4143084E81435
+1A876EBD271A09CEF35E8E208F2EA2CC179D2602960D280C9D23CC9B906C723E
+A5F526C64CA858E848A292830447A805510F679F38F13A01B3294EFA8132C4D6
+BFF54044E03328853ADFD62E18DCD0A3682E3892D91FC509361C7C72D0EBBB76
+1B5B009BF06563B74638FC9F21A33AE18B23A7A4AD777A813238C8344188F3A3
+6095D49D0667B6CC2DC73494FEECAC6960C7D13B9648BFC46F94
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+cleartomark
+%%EndFont
+%%BeginFont: CMSY9
+%!PS-AdobeFont-1.1: CMSY9 1.0
+%%CreationDate: 1991 Aug 15 07:22:27
+% Copyright (C) 1997 American Mathematical Society. All Rights Reserved.
+11 dict begin
+/FontInfo 7 dict dup begin
+/version (1.0) readonly def
+/Notice (Copyright (C) 1997 American Mathematical Society. All Rights Reserved) readonly def
+/FullName (CMSY9) readonly def
+/FamilyName (Computer Modern) readonly def
+/Weight (Medium) readonly def
+/ItalicAngle -14.035 def
+/isFixedPitch false def
+end readonly def
+/FontName /CMSY9 def
+/PaintType 0 def
+/FontType 1 def
+/FontMatrix [0.001 0 0 0.001 0 0] readonly def
+/Encoding 256 array
+0 1 255 {1 index exch /.notdef put} for
+dup 25 /approxequal put
+readonly def
+/FontBBox{-30 -958 1146 777}readonly def
+/UniqueID 5000819 def
+currentdict end
+currentfile eexec
+D9D66F633B846A97B686A97E45A3D0AA052F09F9C8ADE9D907C058B87E9B6964
+7D53359E51216774A4EAA1E2B58EC3176BD1184A633B951372B4198D4E8C5EF4
+A213ACB58AA0A658908035BF2ED8531779838A960DFE2B27EA49C37156989C85
+E21B3ABF72E39A89232CD9F4237FC80C9E64E8425AA3BEF7DED60B122A52922A
+221A37D9A807DD01161779DDE7D31FF2B87F97C73D63EECDDA4C49501773468A
+27D1663E0B62F461F6E40A5D6676D0037D33F24E2FAC2B0009AD3C8350CDF8CC
+65BCA87979C36D14CB552E9A985E48BE4E88ECA16DF418749AF04FDD2B0E1380
+D281BB2476BB45FF30946B247DFD7F57305FA87E50CA338121C71CDFDF927A9C
+77FF14CB4A1D6D80356FB1171ED38C37702350497B44E42CE31DB2F493807DAA
+15B887C671199A54C4C1294BC520F5538C15556BC43C9F62342B121C6DCD6C5F
+491DA47FF360201EE21C08A781ED0589A6DF91B99FE118B9B29E4F068672E52F
+1A06C514D91C4C937D4E642503392B1CD1BE8C2F499A1AD3753691F4D1DAB520
+BDD769B8314239D6261D1B12F5E8412640EC9C012CEF1BF2A6B3A5206DEEEEBF
+DC01CE454F740FE3E10B44263F8DD5CB22D50B8ECAD66E78C82907D1308D56B9
+14A4310E936B3C9E84D2A3C5D3261A57980DE9C5B4F2B024BE183B996FD69EDB
+F08474EDEE2A533E8285D207F30BE8433D709F116DE375DFC785A3F6CD2F97D1
+82ABF91DFE745ED6607127F5EA5BC684CEB70066813D98159A0B7DAC216FBEB4
+742BA8B1DD73E7E6AF7DF9DEFF1E02CFB63DDDF1B8F0E1127E31FFFDF3CB4668
+267A79B083D471FF26139A5AF253EDC3E6FF8D41538EC9FC4C1FB3B7CBDFBFCD
+D7F09B14E9B6FBDC9C19B25F3F15F92BF9FE3219B4006FEBF55A4E56D8D91073
+B53A445C78C45A91DDBCD075F0E21BE7A97E4555045EE6D6CCB24286E78F2BE1
+AEF042988DDEC81820FFF9B0B4105D67E04DE1EA98B45E8FBF75B9A5772F3593
+136A1C82C4BE338D297867E07DA6900973F08F284051E2FF750058319F
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+cleartomark
+%%EndFont
+%%BeginFont: CMSY10
+%!PS-AdobeFont-1.1: CMSY10 1.0
+%%CreationDate: 1991 Aug 15 07:20:57
+% Copyright (C) 1997 American Mathematical Society. All Rights Reserved.
+11 dict begin
+/FontInfo 7 dict dup begin
+/version (1.0) readonly def
+/Notice (Copyright (C) 1997 American Mathematical Society. All Rights Reserved) readonly def
+/FullName (CMSY10) readonly def
+/FamilyName (Computer Modern) readonly def
+/Weight (Medium) readonly def
+/ItalicAngle -14.035 def
+/isFixedPitch false def
+end readonly def
+/FontName /CMSY10 def
+/PaintType 0 def
+/FontType 1 def
+/FontMatrix [0.001 0 0 0.001 0 0] readonly def
+/Encoding 256 array
+0 1 255 {1 index exch /.notdef put} for
+dup 0 /minus put
+dup 20 /lessequal put
+dup 28 /lessmuch put
+dup 29 /greatermuch put
+dup 41 /arrowdblright put
+dup 104 /angbracketleft put
+dup 105 /angbracketright put
+readonly def
+/FontBBox{-29 -960 1116 775}readonly def
+/UniqueID 5000820 def
+currentdict end
+currentfile eexec
+D9D66F633B846A97B686A97E45A3D0AA052F09F9C8ADE9D907C058B87E9B6964
+7D53359E51216774A4EAA1E2B58EC3176BD1184A633B951372B4198D4E8C5EF4
+A213ACB58AA0A658908035BF2ED8531779838A960DFE2B27EA49C37156989C85
+E21B3ABF72E39A89232CD9F4237FC80C9E64E8425AA3BEF7DED60B122A52922A
+221A37D9A807DD01161779DDE7D31FF2B87F97C73D63EECDDA4C49501773468A
+27D1663E0B62F461F6E40A5D6676D1D12B51E641C1D4E8E2771864FC104F8CBF
+5B78EC1D88228725F1C453A678F58A7E1B7BD7CA700717D288EB8DA1F57C4F09
+0ABF1D42C5DDD0C384C7E22F8F8047BE1D4C1CC8E33368FB1AC82B4E96146730
+DE3302B2E6B819CB6AE455B1AF3187FFE8071AA57EF8A6616B9CB7941D44EC7A
+71A7BB3DF755178D7D2E4BB69859EFA4BBC30BD6BB1531133FD4D9438FF99F09
+4ECC068A324D75B5F696B8688EEB2F17E5ED34CCD6D047A4E3806D000C199D7C
+515DB70A8D4F6146FE068DC1E5DE8BC5703D288CAFFEFC421ABEC649FD87E34B
+8152B8403C7DB49860ED86B02711EE6E5B72D7D9B408B1FB89D5C1C78ACAA4A0
+4E176AB7D7281992BE94DC902056793D2F8F189600650843FCB5CB77BDE88C4B
+449C6606FAA7FCFF76CAC7E4A8EA5B049F569B412D5D48969EA632413B51E98D
+85A05FB8FE1E1743AD1D04C94B0604C1CAF907B11D90CED1FF488E81A46ABF0D
+E8EA592B2BD018B422239E246BD0FE2191DC6463FFBD6E77C5890C19A99048AE
+5550DA109BCA45072ADB589433BB470E7ACC83EF7BF2A08C9557D7272A7D255A
+8071DFCDA4C740317954408363B898632536523620FDCE3B854E4F45C84359DC
+C2ED0F0CDAE6493255A609B61FEEDB0702650E173BB2DC84C97E05FF933B7185
+FB8F72F6AD10561761258CDF16AE5DBDC08D84228FD2C007F29CBF26BB5833AF
+A0EC310D7E58FCE59B3E3225CE37112C8A494D8FE99E494C031DD3B28D08E6EA
+82155ACEC10C2B7F33920F540715E3DA0861D4B19B466994F39DC2EA65C4FE73
+A32C75F05D36A69AB25349ECC9564F4DC69BC304282CEC27C669318F70F21B49
+35A0022F6AA5A8E22E6A217527DB8CE7929C3CF58FCF4E97B82E124277CADA42
+E6783F17DEB26309318FE113B0172A59EFD8C3F10B815D412FA23667D8262984
+870255DACB7F0AD3685C7A510082A3712E6C1D718855794B068DF83407C44E9A
+35A372A9503B7023BB4D2C1BC8FD5C5ECFF21A2323BC8611188D57FDCB9FE02F
+3ACBBE4C205714E8B4CC3019B103A565C8D9D2033151CCA9012FB3378D44AB95
+D12A809D7D8F2BA3C5106001C6731C0B399E3BC5BC94BC76FF3B6A1F2F91EF1B
+382D55FECAE2760129186CB8BFDCB9E9E2833672C47BCA98D62B110493213C5C
+BA8CCC6B713FF699DFEECADEFBA9C32C9B91C6EB4439AB3E38FC9B79239EF5D8
+03EAD019DACAE27CF700B3AA3AEB466E8EEEE833F3D24C036FD11671650D070A
+4F4C0EF25848CB1F335D34C81BA3477473DB4C0B400B04AA0D2072E9074F5E06
+01C6DBA2F8592D3D48E12287A4D566FE18C4BBE93B36FABAC47AD302B3943047
+6BDC9E5A9DF86E08694F3F061296A0C9721E149AA55C5EB09954604E910D256F
+65975E4BAAE8F5F02A14CDED82F564F114D189FDB12EA7B7E9B7E463CA903E38
+3C5B5E706A7D88D866A15A2BC1ECFD901F24DAD8E5B25F0CFE3FCCB8BC687F19
+17A88D212B043B4570F7018957A07D1221965058186E0CFF80878BD7A55EC141
+AFAAC6C141E69EFFDAB5A240EB239944819D46CCA2C437579C25FED65526E93A
+9264959D11BFA15354222203660B23CE18303120E8B2EFB8C292DC8F9D4E1644
+9A76AFBF3F2E3B20BC56B19FF2C5731459A01C513A57ACB4D97C2BC3841EC56A
+DEE911F046026930DB730EEEC3F8E9BF68D75E6197A137FE10E487668D3C6246
+B5A47A5F2989D121926D465E0BC717866CDA02220E9E2FE258F4BA23CC2DEBB2
+F3A81448D3F91EBCF6043C01C8FECE1BDD965A84F25AD086924A75AE73B9B53F
+B3F7F4A3E0AD7806D7B55D244104D109A09F1D75FDC1BC7C317C8F2A81CEC342
+8DB79591724BB4645FFD78070459C5E1503DDA310EF4687D1CA263FFEF67C083
+F06D49974D103B0DF579F77D5A765C74FD4397F25561BD8AF04D2C43
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+cleartomark
+%%EndFont
+%%BeginFont: CMTI10
+%!PS-AdobeFont-1.1: CMTI10 1.00B
+%%CreationDate: 1992 Feb 19 19:56:16
+% Copyright (C) 1997 American Mathematical Society. All Rights Reserved.
+11 dict begin
+/FontInfo 7 dict dup begin
+/version (1.00B) readonly def
+/Notice (Copyright (C) 1997 American Mathematical Society. All Rights Reserved) readonly def
+/FullName (CMTI10) readonly def
+/FamilyName (Computer Modern) readonly def
+/Weight (Medium) readonly def
+/ItalicAngle -14.04 def
+/isFixedPitch false def
+end readonly def
+/FontName /CMTI10 def
+/PaintType 0 def
+/FontType 1 def
+/FontMatrix [0.001 0 0 0.001 0 0] readonly def
+/Encoding 256 array
+0 1 255 {1 index exch /.notdef put} for
+dup 11 /ff put
+dup 12 /fi put
+dup 13 /fl put
+dup 39 /quoteright put
+dup 40 /parenleft put
+dup 41 /parenright put
+dup 44 /comma put
+dup 45 /hyphen put
+dup 46 /period put
+dup 48 /zero put
+dup 49 /one put
+dup 50 /two put
+dup 51 /three put
+dup 56 /eight put
+dup 57 /nine put
+dup 58 /colon put
+dup 65 /A put
+dup 66 /B put
+dup 67 /C put
+dup 68 /D put
+dup 69 /E put
+dup 70 /F put
+dup 71 /G put
+dup 72 /H put
+dup 73 /I put
+dup 76 /L put
+dup 77 /M put
+dup 78 /N put
+dup 79 /O put
+dup 80 /P put
+dup 82 /R put
+dup 83 /S put
+dup 84 /T put
+dup 85 /U put
+dup 87 /W put
+dup 88 /X put
+dup 91 /bracketleft put
+dup 93 /bracketright put
+dup 96 /quoteleft put
+dup 97 /a put
+dup 98 /b put
+dup 99 /c put
+dup 100 /d put
+dup 101 /e put
+dup 102 /f put
+dup 103 /g put
+dup 104 /h put
+dup 105 /i put
+dup 107 /k put
+dup 108 /l put
+dup 109 /m put
+dup 110 /n put
+dup 111 /o put
+dup 112 /p put
+dup 114 /r put
+dup 115 /s put
+dup 116 /t put
+dup 117 /u put
+dup 118 /v put
+dup 119 /w put
+dup 120 /x put
+dup 121 /y put
+dup 122 /z put
+readonly def
+/FontBBox{-163 -250 1146 969}readonly def
+/UniqueID 5000828 def
+currentdict end
+currentfile eexec
+D9D66F633B846A97B686A97E45A3D0AA0529731C99A784CCBE85B4993B2EEBDE
+3B12D472B7CF54651EF21185116A69AB1096ED4BAD2F646635E019B6417CC77B
+532F85D811C70D1429A19A5307EF63EB5C5E02C89FC6C20F6D9D89E7D91FE470
+B72BEFDA23F5DF76BE05AF4CE93137A219ED8A04A9D7D6FDF37E6B7FCDE0D90B
+986423E5960A5D9FBB4C956556E8DF90CBFAEC476FA36FD9A5C8175C9AF513FE
+D919C2DDD26BDC0D99398B9F4D03D5993DFC0930297866E1CD0A319B6B1FD958
+9E3948FFB0B4E70F212EC976D65099D84E0D37A7A771C3101D6AD26A0513378F
+21EC3643079EECE0C9AB54B4772E5DCA82D0D4ACC7F42FB493AA04A3BF4A1BD6
+06ECE186315DBE9CFDCB1A0303E8D3E83027CD3AFA8F0BD466A8E8CA0E7164CF
+55B332FAD43482748DD4A1CB3F40CB1F5E67192B8216A0D8FE30F9F05BF016F5
+B5CC130A4B0796EE065495422FBA55BEE9BFD99D04464D987AC4D237C208FA86
+0B112E55CE7B3782A34BC22E3DE31755D9AFF19E490C8E43B85E17ECE87FA8B9
+1485831624D24F37C39BF9972D74E6EC4784727AC00B9C4A3AD3DA1C22BD6961
+7E0ADAF55422F22ACA5E4DCD4DF9FCD187A566B7FB661D0530454D0DD6C6C50A
+7A3875C6CBF8EC7769F32A1F3F7FC1C072BADEC97794D4E90E0035282A170402
+356E5A9CD9ABD80AC4342A5283E458A7269252F4541CBB6452B39ED54D336D0B
+19928E9CD1AB26AD83EB209E2EC75011A2643813053B5DBB0246097C4821B5F2
+C92554E9140BE35B2DBFCD98809A8EC9FC910FDE9E0D86457C70ACB056EBF90F
+244DC0A5BBD455E15D6E3180311D52CF50B0BF7D0A7F64F3A1821E0AEDBC2E7B
+AEB549FE1D51088C153799C6E089B5D5D65E1C4E2D2B430CDF1FFA23CCB25D95
+5C4DD885310A706B320AB25C8D742C6F29953254FA54DAAEE60ED477877D19BC
+D28E9AB576B0EA088171FD000B60D73B3C57F754BC07EBC9BF751B7D2B32459D
+993861B7C4B0D98C422A11BECEF76F4EFC0ECAEE89723E6CED53E3678D733363
+2DF068AEF0FE7DFB57393BDAA439A6A4C396F86032A98009EAE1247B7DE83B3B
+E46DF2898598FF5E6CA6953127432A967E4FD41CDD60D6E413059A58FA556EF3
+309178B57C16A763CFC9BEEC276944BDEA255789EF4E1ECDE1EA43EEDB955513
+F42EDDCF39AE522A1DC2DC523F046EEC4CCAE25792B702C288732F5B13B5CCE7
+E8B6A1A1DB86B1EA38883E481BEAB54023EDD9BB94E7780DEEA577ADAA169E66
+AB7D8607B409619E79F242CF52E618AC0DAE43317C507CDB27EA8A1472D4E8D9
+17E62C98DFB049C78AD15560CE44A39581BD6B555165091C5D41071212A9D51E
+6DC3005C821622476DB88946944FBD830DC0293272497557825CF153F8E257E4
+1C9A2C1C27CB7610BED918021BCF64795D6571584830231C7EE85AB23906C085
+B17C9070C59EE450E6124FA3488AAF61751160F6CE1A0618FEA94397D1EFA9E0
+621AC7E9AC853CCAE73DEF3F7438E921BDD42D7E139C431530AF569FD8592D99
+8DA4F085A207616874D71D6005F57219784B5B33CDCF2CD8F061090E46E0AED8
+3063FDF0E57BACE8CA49A148F35674D09BC0E0DF348A4C699E4C124BD349E1BB
+57D26EB43B1B35213BB612B9E011FEAD57A8654671AD663C327C3077284AC6BA
+130F486A332EE15C3B8AD60048C7ECFC4F551DCEA1C949FF81F164F454A3D2A7
+6C9B4718321B7CF930653EA0EC924A0E3E270417D8496C9545EEE6D9E936EEEB
+F09F32C082B756D533BEC0085BD5B280CEACB03D8AEBA065AA8BD1E16DAE9E39
+5BF7C1AC2C34ED6B1778F709AAB31CF5E629A84B1B93AF84F1ED34E90ECC98C7
+A3C2F97976AC79F9DAFAAC679550E6B1749B60C1E686D811AE39DF4EC2BF6500
+90CFF1289FDB6F13FD35621DEC61E54FDB9F2F490A0279DF74C7E91E2F4B79FA
+87354F6C2AF4628B7BEA988E1D6B6F4337FD44939367A331C7E405B587E6ED6C
+A424D2883BA17CB1EC926CEDA73B50C7B53D11BD3E00A82638CB76C043C2D6B4
+17AED321749330FEFF3C3C96085FEAA846B76784E701EF6AD74F4198A4F505A6
+B24F601965CE8C4D70D316A4745D08F7E367EA71849E56E51E8075E6C9ECF0AF
+790C34667CE4B59610802FCE470495D21B2B50A55FD89DCF2F5A5DFAEF8C6CA7
+A099EEAF6DFA0A1A637B9641640648A919B9B83E3AF7A6D76026066493C85155
+79EE0B427900187FF69109CB6319282CCE00E48C1FADE95E93ADFB89D1582314
+6106827770F49A3280E222D9ED1D7D1F2CE97618620052976677FCFFF743DB5B
+EC49D904FAD865C6D3B4F4EB37919FEDFAD695B0E29BAE0499E47FC24EAD12BD
+FB3EFDE65EDFBBBC29594C8E017C1FC37D8DBDDED24CB56BFB0967AEB2F4034A
+47CE43B1709AF30AF9AC08BE1867D41C279C5BD8269AEAB52826D6B0832CBF22
+9C1B10B4F4CF3EEA3B60527D02F00698007CCDDAF5615D275010BBD50571E3FD
+E210A302171F9F935623D54BDB9D9A38A4D5FF2D564A0CED10EB6AD2AC16B363
+52AD685728C5DE87C7BC5AC6E488141803BF7BF302CFBB25C71B7825CC6F9D1D
+6336274D00A83F9AD5AA60F3C88245C8A71E60D75818D675A1BB428A3E08C588
+D7226DFE3028B091096B1BC58E57D3191CD7F6EE4DAE670FC19D964F4B1B7FCE
+C1F4E5443CDA5451E471952D053030CBD07A0CD8BA47FB8726F1E0B949281A08
+988C36D9419B154D28EC9BD2E011866C93D251DCE933C71405D9E26676340DB5
+1AE7DB1EEE611A6D0FCBC903F726F05318358E756DDAA8A627FB9AEC4C25A285
+7B4C54F7F5ADD07D1990614118DFCF53A3F195D129DA1EA48F32E8CC3BCFF080
+C630E79F9DF58A90DF574011FA032C3F9D2EE56424832DE226CA5C59B9A607AF
+EB9FF46C0868DB07F062AFAEE08ADB66EE779E58D7B3B039779C179EF86A5CC2
+43E397B5F888C93BD5D9F4D42B7AFAA5EC2935AA8F9612C43801447F1123AB10
+6666708DCB08F0107E5BDC1E594B692ACE674714CF422341F022F3A536EDE654
+DAAF1F4F05A020D896AC09F0B14D7E22DD072208CE1D84CD00205AB27CE9F401
+70C71EAA00736786D7E11F518D0553297EA1FE928AAD13C6913B78BF6C227565
+EB52E96FAABF6B0B653C27F8FFDD169C34CD500FD7F9D1F613B9897B807CA5CC
+6DCCC7807009C531EC49D67676564FB9D17704F4CB7B58C16BFD96A133DA41CB
+C04B1E7CC600EA2C11C9E46AC5EF883A382F6172D1E016972FBB772F56E7D69F
+BCD2D4D947608FC39979D48B85E1A764D4121DCFDB33DD78D3595294556F0123
+2128BC061463936AB7C5AC065C351017A1634BE3370C8F19CFA96E29F3E5C295
+6612941845F749B983D703126673B5F0A08D2A00F0FE47CA07BAF440877F2476
+24A14559B134690CE459A40D98D3E4BC076AF648F3D4D423C7421D2E35760B56
+067F0C4D96D835233AEB3AC354E365B3875827A22E93FEDBCF3A0CA528DF547F
+2AC00F96E704DDEE2B8D35C50A27BE9E647307A58BA897C2BF6829E781B4DBB7
+473EEB1EC85B74103EBF32B7006F911220F627E43EC67912E5F137F804B487B8
+B029E6A1EE4BD5F559AB47570466004FB6CAE21AC131E4240B3F54641CF2C0FD
+6A8AA57CF395ED46D4211953CB45CDB890C4B52D58CD067DCC94BF591F27A4E1
+19BCA31EC9839282D172DDFA6B6816C5C4B02E421C6BDF419E3D21AF4FFC083B
+C8AA0AAA51A10CDFB52E9F8D0ACE76F25D50BFD9FFCA4CF6338B7919E0429430
+AF6E2774EF177E0C686D8B84B4E7271AC78C10EC5B9409F66EE784DDC5034E71
+FB0DD7E2361211E1D2F8FDD3B5FC8FF9FA1F7E6BBDADB17D97B2243A76F954BA
+39DAFDC2A2E3B2D5D06FEC675EDFA330A44EBF73701A9DF0077BA70FAB161C35
+DDE8C0A267BE20DB3C81F8A66C4832120129641510250C420C2BAFD4E4EE9A5D
+2DBEA256DC9B15AFB7BBB9839C52FB8A02F46A76E3B2ADDECB38ECAF96996E97
+C8AAB17A90B02B1EA95BD969F14E009B1BF7740298EBBA68E9D8A3EECDF77011
+8A93EB95FA8DA4655E7A864CDC2B7E77A033578DD27F5C90C6FEF187A89A96A3
+E4F0F6F2ED56F61DF261CE071208DA5FA2E6AAC52FF97391A5EC67426432971D
+289C9995DE6679B4E57117F2065C176DE879544D60A85C72803C1327385A0520
+F13462E2CF85D466A01B1B03DED6D4B3717BC2E617541CA16F7BBC54902ABABA
+860D800A59D3F8EB1F091CFC58FDE2EF55A52F8135F2214D890A937CC1E47CEE
+014804DE68FA7EB9D582651448872B85E7112FD4479E715BD85C653EAA3C7FE0
+3EA67B9E1DC8E3F2157D5D694D1D3E9B8793FE9A5756E0A2915DAF520D2ADB33
+6C35BCCFB6E8BC0D55D73A08A49F44C05A83C3D791A84C17131A298304D227FE
+2595E2696CF18B209B722CE44266A6ED9670A1F99A58C05B8F678D2449AC562A
+57E1BB26774454F4DFB3900550D7E26E15B9D74E1D6F147EDCDA7656E0645F03
+6F190A0E73F0EB1933F2ED79693F8D45BD0B00F40CEE39EF1E7871E21A8AE3D8
+1C401F57608249A85AA19B60E4B547711C0115A93481E836374FCFF386D13015
+6FC3FD74A40181EB457CF218FCD5D0B8E2F5628709A4A78CB55C1709D6E3019B
+6598FFF8A9721ECFDA778CF70DB9D552838274D81FD69D3E724FB0C7B8780526
+E14CD93E8B4DE6A34368AF7D730993A64EE4A492805367867F123A4AB510A9E1
+B2A394D8D842A34E90F63EF56CF9ED862E6C42E145416BB04C6363AE8EDF1847
+623FE752B8F50C16CA933AA4BCF57A83BE8A22F9A6C373B73AA2F2DF4DC8B5AF
+9D14A5188DEEE5AA30170C0D9813CA2A2A3147A8AB889029A5C780B1CAD73594
+10A926B93F0593229D37E812DC789B5D22A9C5694A0A50FD2D0ADCDE6447A095
+435494F0882C861F299F0D49DC4358710498F5E9A6EC82AAF6564EC292D34BC0
+C7A88A53E5262D46F8F398BECE41568C22545B558C11D965D8557BB41D31B16D
+77CC1A960A849FC1FD556872198A4EAB1687924CB6065F1C47E49E2D4BDA29EA
+F785449C32F703736B5E7317E8CE4CD33CA5CC4221C3221569BF0D26EF383DE1
+9FFB479E6FD70EC073937CF7F77BBE889EE1691495A8D6BE453FEF88D5C53B5D
+5425DC07248ED3307A7BF6A4FCB798A98F50CA64CFB651F76984A1BDAB0CAD09
+E32BC3E461DC61498542F99F75DAC56E68EDA3C5BD672D62139D714440CC5DA2
+D88EA07E396D429A07507343E46CA063198871FD18FDA4CCA7B12B6253AB16D6
+D2252D3F53599EFFD4300600977945332D17248E6892790FF3BE93EA52B88A11
+0D7CC752DEE3FD45130986F8A886EF3CC7801A5CB0B87D4AB6504337ABC41F5A
+1F9EDBCA743F6ABFD2B0F22DD5A5FD10149970D3EEC3861FFC36C81B9B530091
+94C4EEDF8CCF107E82649F76098C21B7E9006B94414D60EB1130B0163F266B4B
+A97B3601B0C7552FE7B548C0FF26F9757504257DC5BEAF6C2CE0C9C02BFFE6F3
+93164E5F3A1A63CDBC5F546FC2FE53E4B3102B23CE755783C70FD66EF4045F5A
+AE7C8EC6DE2DFB9B15290DFE852DE18CF1815F8107058AB603A552EEED1EDD42
+3FA8DD0E5B2B6EFAD0CC4D30ED78EF8D654D0507ECA632F56BF329F66E630A8C
+2D64809B33305548A0725E845841901879EC714138F8FF300126803F5E5CA9AE
+FBDDDBAA9DC6751EB1F99C4F7C4AB64C6A50DA709B60360C50FFD9613C7CC7E5
+DCDE7504C2E678EF2BF97E35F78D1DB87ADE5D664C72E999D411D69A81B4FBB0
+0307A506F91ED388C4C34889AC774178D443F6A0E1CDE53D157E0A9EE3911908
+C7AF8B3979793F10BB04265A118FD8E5446BAC0C4C61799960F18DC9E4957B0F
+FBA6CDC6F856B406018704805929F5BD6EAAEE16CD6187E2C0C20518E896E29E
+55E5F21B7B5938EE9E3C0F329D977FC7A50A50990EE335692087170A96AB1A9F
+919FC1B77973FAA0F22BF21C6BBE4E014AF433892172B1A7ED155CDF5C63C78A
+762421808684054989591FBB0971002F87D8F3318C73C51E609E1C464C50A60C
+944A3BF596542748D918FFC9FDD8C0397AD82DA00C5C933B92ADDC377CB8320D
+3A05485515C749C0E598E548FCC3FFACB6D9F0A3C41EB013A482B09CD13D099D
+AE3AEE2B1379CADDECA19ACCA9201481BE1793215AEDB02B007BB13A137E5AB4
+398FAD86FBD73762B00E1E5B68E826E80228515EFFB9622572A004D6299B9AF1
+ECF9BDC4BBDA1DE7BCA3D1E42C7460DF9A6C8034548F6BD473C5FAA9CDA3CDFA
+3E165AD903D92C069AF455F0EA4B2FD843C9B1343E550677295256D260405E15
+135399E1835BF6B975CA786B7F578F3B791F9BD3D04FCCED9280BEA337A84B9B
+E149AD2C31E86EC7BD9745BF69B5D032D260A173BB1A49B73D1485AF27A16344
+2651CC57851FEA18E0FB5C3E123A8375A74FDC6F55A1F9C025E5BC7D352556BB
+F50006FA43624CACB248F4E06720300F5964CF78EAB2BDEFD551884AE5D7EDDF
+376375EA4CEA67151EE905E9A733509ABED1947AB0A00DDD48828B9328980A58
+4607078BD89EE5FDA185F9C6C58DC38605DA54F323A4921A911002829D3F10F6
+0960021D951894AA3A41DD08D2FF33F923FA165D0204E4B6E5BAF7A6DC7B6C62
+97C5AFE525FD4F71CF0CDD5D9592E188F47BDEFE1054D4FDCA73375A7931A8D3
+1829D7C2D18F242EEE4E77EB8DAC2AC90AF754B9C57130F931BB107FBBB29B76
+770339F10363456338FF0595C14C12645796CA0CA1D06BF73A0B7333501AD811
+2DDBFC00C663520351CA73E9940FEABE95AC9DBA9C40BF4D231E9A826529FA4C
+5F0951E378525A90BAB4BE68D612A76BE93AED8F11BB79B03F7D0D0E7A658433
+3C25248997B6662C9CBEF49FA2861DB8ED21A646AB901FE13B2E0D5BD0256C69
+1098E56646EDBA97187DABD5D631F371DE2135B99C21157B2B719E608905BF2B
+F2B52A0F16D76244636D78D3113240AC697CD1FA48779C411A94B786BBFC13C1
+FB476C341ED3ED8A1405F8F1F3664A08F01EEDE340DB2D8FD38C426D186FFCC5
+077E36956541DA9A7377FF700928755AD7B196B9C01CB0EB65EABC6B91D2E168
+EFE2BC5C66A81DB834CF21D9B3FD5C6F7E1E161720D4C7BC8159235C0C4ED12E
+4660033C3EFCBF686C19B2968634ED1019AB7315A7AD0A25B7E03B7F95976BE4
+AF54F16E002473E8E964F631EE18B04C3EC38AAE5A12704B5D0CEF57626FEF56
+3CC8E3B8392EB5602E9B52019D5752A6EA85E8B4B292848E462442C651AA63D6
+2F23621C299ABD94E0CEFF374386A34EE8B12ECC37B41A5D9A7C744FD122E303
+D6AB5B77A021DDBB12F973D65B7518E05DEF9A122946838368FDCDFD18D83EB6
+FBFFC7D720771D8BC010AD8608D18116E714F06B3CEC2CAE9809CF01A227A109
+CA11B59844EE97C8C6EB22E812A6D9A380868D9884C5A9C573F52121FFAE2284
+45EE46B4C6C1964651564CEC657D1F9CD9C1E5A7F74299826564A06E625391A7
+9AB84CCACA0F9B38D2BFAAA3A41B9A96A2F18C23CC5D996CB4D8D5ADAB5B74F8
+111BB5BF52FE0017C4DA523FB1F54AD95F7EFA4171F11E3D49FF98A0D5350B48
+2E19EFEB8CDDD331889B12A3F967A669AC31D605B261B86CAD8143DAFA83C040
+BF4ABF03619AF5F5BC737772DC6296AA5EBBBC48E71EA8CBCF6F465E0DE205AE
+A2EA49AE0A2D143A393C7CA66653BC1637164BE23C7D114067A050EECFCDEEA9
+CADDFFA7FAC6B736F876C73FF98A8CD85BE6C652244934D0A2AF133CFD9E6BDA
+C8556150293FB61491D0212A2E140893D2D1136D2A633085BF0ACD308A77BD03
+7FE6A84B19907C6DA6CC6AEB7397CD8AC8DF54AA13AAE947C0BBCA32DFD280F3
+D1D4E10A19E846F494F58D4FA29D35ACAD423E49E06B487196EC3E531191D0EB
+825B5705D8B8A389613A8027B11FC5202CA2A3064DB8DCEBB7F34676DCBEDAFA
+4063613E7ABA1AAF91A7A6F8D1A36087C9B760A0375F3C3570774177A88FC9AF
+3C7F3829CE651321431B6D306BBC251550FDF6601C5CBD1CA635305E4393686D
+ECA8DE25B425E64AEA0D8AC6EC23C18E0D633E428EC15A77A2A457FA21CFFD86
+FE7973B707464072ACF22C1B76B51AC3BF3C4A7DC007BF2D6BF6C0E1004C3A47
+036BA54F17404CEC5047118EB40405D0975123AC5C1BD4D463DFA6D2644FDC20
+F3D6E166D31B13CD3ECDCD8702F6CD255EF5FB3C859325422E76C49DA1847AF1
+A0313E629B36BCA5AE0EB37C9A37DDCC6849AEB88B4E7B4200CBA704652B4EB2
+0AC2F99B8A28C5C86E49A03033FA76A069B91C8A11DFBDAB2FDB1C8810398CA2
+5256A7918171B2DE21D388AB7C5C965F356B3D7A1FEBC4D5EB2A1F22F6922306
+59FC089F593A8A27950D51A4E2983140132166FF8680950B59C848B755D8F779
+FB00F53C5E144D6E73EDED56A4504B3485386E044B6FD31AAB7EAD39EEC15B5B
+46746BE45B2A90BE05A4DD1E2845C4028D50C6A4874202A9F2A0ECF443217753
+92BCB939D3B41C3E170F2DBBE98AC508CB9BFAC3151DE9F1CCF80FDC5AE42E01
+F91C9669CE461C422143A8A7BBE6FBC2D0B433C76E27E850E1AAB41EF9E182A8
+00E986FF4E6CE70C083A0B0162B1651F1BBE64FEFC5585B7BE2B9F6B4B17E46F
+1DAC7ACDBE6AA7121E967DB0FCDD9985E13FD19E5802A142A829B149AEF7A9B4
+7005027555E885C4B850744C788EF5A0B1084E01BD90AD67A512DBB716989535
+D679457013D9D8B131285F45D6D0329A58192F3648F11E97BB4CBDD3BCA204BC
+2BDE7822C1EC938E07921C861CCFEE91898EADE9EC61FC4DC355E2E3C9457FBC
+11550610AD85884DA32BCE1777FF397871D6D727C80017CCA1BD863D6B79F3F9
+BDD97175C36C6C200C3F2F72B26AD7EECA9B6D613AA3B2300AC90921D0408950
+B4F42CE2FC5B841F2BE60B6377394B83F2AEBB496D762908E474E6ED42F2E1EB
+22E6D3FC3C6053BA1AD88A11D69547239B993602A79A51401B02C68C83B8D0C3
+463D82046AF1985C621524484E9A83574205195AA11AC7EF6CD48BE5DA505A5B
+E915DCF57EB72B15AF62DBB1F2F0DD5474066559DCD33FEC6BB96BFC4C08EE59
+DBF3282695BB208042B143D7A78B89BE94309E08BD7736B0822388724306CCE0
+5533EEFA95EF7861C9A2313E9D55E47D9A7D838927C6A4BB4329AE9F7358D2B8
+DC542630DBA291849FD01393AB85AFECDB8DAC4F5881146169CC6AFF9743E59A
+45C06798CBBB2010AAF43EB3DE77725C990AB0579EF9034F4E04B3129C53740E
+EC0E9D9E01B9BF826FB111410CCEA6F504B7FC304B40BA784CCF623C7223E2DE
+EE8559149561B1B39D4B00535C3F9C4FD44CF71F305A1D6079B583BF02F78964
+BADB7E777C99F5D7BFBECF1DA3F8BA9D1007E6819FA5CBC145A5DD05E509CEC3
+AD2BDA0AEB90D34981543C8B73178D733D2A114816AB836A15A38378337C3097
+60164C86641EE1B337D379E7F8B38ED845089762F8CBA489F7D20FCEB233E0CA
+B7DB6E4C1AC6038080CCEE206447156926F7F085E6F611A401F925C99FD547E7
+DA813C029A9B22E532BDA41B7785D913755D415F9565AD064548F0218F758B3E
+3C1AF553A53A1BE6FDAC5FD3234E6D518DC18F37A25658225C4DDB6C88340CAD
+B78260DA09E325A21B48F3D146768F67AE7FEC0D66B82263E09C8B4CD4EF21B8
+EA624CE3C3C3492763510F20485E9573CC1597AE79D8586427132329FFF8A3AD
+71080EC8E725DE042FC4E6EEA99E08EE8182EA8990E2D18CFA791790A2900DC6
+853560AEAB4DEE9125DABA03573A139AA9F7A2EC7FB175F262651C68A890D358
+994E93D619F10AC427E9FC81EB3581FEE0EA46B67DBE37CFD77A75BF74BC1034
+156A599AC47C4C4FF0695D7AC899C254F13DDE79FB7C69533B81C11743BBBE40
+981EB3A6FE2B98CE3621C7FCDD3746C1028AB2089BEE497716414DE333610086
+4BF35D178E6E89A9B952F5D8353F180CBBEC5C33D4CB224AEC7F00108E871DC8
+F5C078F05116FBBD4DDF9B754CE5BE554884E3B3A0220B032A26B8C3F89D6C63
+A42CFE0A91E92C577EB762768EC2E92C816B8A28246E6BA68F76039E872C860D
+D91209C778520207C3687F3C48233FC45BA27413CFC5F423CF06FB540BFB936D
+2F3EA6A3AACE4302A26601ED094CC01FFA7FD5E1E3FA43FDBF0A6F2CE76DD957
+6C00FB5B52B72BF7044FBA9DF2714A1A36133E1D5A7E9CC065080E845B477124
+91E28FC5167A82DA4713181B2CFAE9F43F32F0054291CEA0C21C22BED63E4926
+488EBE5B8071002DE7F868C36025BF991931E64230A7A87704D2FD977B33AA0C
+A14A6CF39BF465F7C0BF8513A652AE18E07A028CE90B60E222600FAD1EA81FFA
+681234382626BB6E701051220DD614F11B79F549053EF122313C62010FA41F74
+93A95961279373C386918D515DA24F6EE4E21BEA2916DD5A9682673F334BDA24
+74852BF371C417DB72A452BF63387F03E48E9AC46CF002478B0E0BA7359C44BC
+98338DA5A24AF472C0CCEE86A5BFBFEF768C23EAD5870969E12E999EAD706D72
+6E0E9DC3B5ED1C2CAC36B2016AE5E0C9AFF03C35CC48ADA02B6833BEB709A3F0
+376CED42FCF38A3C475F24E524CB22A5083EC2682562F30805ABAE5DFE2D262D
+2C7854E17E5D4BE93E7C29D1D3DBD0D338CFA410410D043F08E3A97FB90880D3
+2996F4FD69D5522EF5FA8E6C1E41DF037B1544ABF2563C6A919E6E02A7CAF027
+32E707DB8FD7A5FEF0262271C816BEDE9E79581D01174DC7AE8B682633BFF3F1
+B85F7BFE195325E6688765A65509A5C2C8AB2C868BA6A4828683882E930129B2
+CBD35816874506CA289A06046DBBB05B253872457F7E65EAAB874A70AFFB539E
+06569C372F615A369818599D635605DF1A77DA7C47E750FADCCB66AF081B73C2
+F401D3FA1B86C508E575DFC137EE35F8A73A2B59FFBE6609BBC9500101EDE424
+2B5C3F4938E1A4D56A2C53385DFEB432496843B08D23C9E27BEE7CC4B94551FC
+0497DD97FBF7791D336BADE8FC5503071C5B1CD2B738412A9990C4043EA84E5E
+EA2877AF81B93D75E7ABFBECFD5F45300E09FA0B9ACED401D82BC24CF93726DC
+928C254C86FF040C0DFAD691C52419C41535D44F3A5720A4B2F8D0126F48D1F2
+705E91382657BE2D8572BDB6CEA9587FDB29DA1C75AFBCF25E43E1BB64A9CE26
+EA07BA568010AB01512899A5208901BEC68EE7BAA1BD1A130B74C8BD4D5AA7BE
+08C4D0FCB1DCFEF2FF3B23FF5A62937EEC46CC7D19356FA9E204A0C6F73E8536
+DD088EE94E1204A9358EAF4DCE91D68D46C6F8F80EBE95B31827CFCB8C4F8F56
+C3D7CBEA4F82F50328216DF1177A47D8FE307FD6586A36E5C886EF8ECAB754EB
+3230EC664161A8A3BB8FD3D732DDFB27F4FF945902CA5DA0E16F7D705B9B2072
+EF40B799EC7F4DAEC256334F52BE6D5C43CF2F4A65BBFE6828FAA1F9F3791C97
+1A1E12D8946DE0E1729269BBA23EBF1B101A18CF87B777B4630B700BFA36DDF5
+2BBF98F8A13E27217BB4968DB7123421263B03D090748F1F6179F817AB88180B
+86EE00C03173031818FBA77B2ECEA4B6809097D78408D16A2582FA19FCF5FDC9
+3E6E87D794EE0215E550BA5FE15B42B2DC6241D7B640694828D294F1A86A5E1A
+B2D9707983AC7CB0B154A4283DF7913313CD4B367F24CD1E91165DBDA28F9DC7
+94E26A00E8288B7E9B789B377EED2F304CB3B8C9FAA96B523AE163706C73C124
+9B8E9BB288742F6994A21D321F0F29E1464D4ECFDE9F995E69F806061FA82050
+C6AE3AC6465903CC782110D3E41F8568561C7AD1A53E53649FE16971E8F5D8D6
+21C86119D8A8FA0FCABB3FC1E63309241E379D2AC559DD4960A5ACD3D461B8C2
+0FBED5718B7F8B9F7E63D0E4C34D0F91AA408B52A41D6BB58B126E68078FCB66
+34116961747E82C4F50957091A4E0F9C88ACA3A0B4D3E5E065E72C41B61F4E7A
+17C18EB2D184914EACA0BCB3CAAEA288C03C8B6C290EA179262CD74734AA6CFC
+DF4D61DC54A4D74D7F2F3BA1BDDE4228801FEA263D7AD084807AC72ADEAEF9BD
+690606778C2852DC75ED5B1A38FC6B520AADBE5E0F80CA26D90CE0AE547C6FBA
+16E4EE2D42FD7FB80C4BFFB34AEAB220EF0B76F788989E3A141A9FB014AFF4F0
+5BAB96C28D51454AF0BF9B952C8F615F627CC90D9A84BEFBB75291F7D2CD3658
+A0F5826DB39711AF0CFCC39E40751B040661D7C561062E3ABE5CC7D4A3BF21A2
+A8ED700BADD63D388B5387240D63FB93ED30107E118D194DEF85E171349D0FEA
+02B0CC32FEEAC2CE699D1CD7CEF1337C95FA1CA8DA497AD44C44AAB34CF490C7
+78E804C227028F20BAABF2FA27939400DA87BBE8DFA976178ECE2DB82D1979D2
+2681D62550680CF8FCB95C91D1B15F2F3E41C7000E3489F3B21CEAB4FA6D97C3
+95A723FF985DD48A8BBD76838FD69E22277565081A03983A63E63FD2E3D8D043
+87DA96E032B6FB646189FB8BFCCB4F3D2CFFD9F34A1BDE95843AB4BEEB6CA226
+951BFC060B60B61404BD5293AD0DFC31D38860133684C765BF26A09AD4FFDF50
+66A4A1820FAF2A8EBF01B396D6F37BECB6C55ECE19BEB189AF2164358FAEFA71
+89B5CDC9CA2FF27C09FA43DBFDA9B2411E51BC10A3F5F70EF25E9567C131064D
+70AF9E44EFC0CA27E3DE6826D615A6B22F220CAE4CA4F734921259195F8C210F
+DAF57E6D1CBBC072540123880C46D59EE512505EFF6E4A305EB13F2BE6850ADE
+F94F73C2CAFF23B74E80C8A04FE0BDA8DB67FC02FD32665E29704B06ABB012C2
+3DB4A09A1CCBA75912CD20E2D61197899A6EFB7DBFBCE914B8DCBD95B56E3E63
+7E61FBB230458FD9B0D446FAC05D0BA41B083A7BB50ACFE13602EB67C2CD7A4C
+8F34E6DAFE84FF90249447C71F77C234FDADD7EEC3DD504E8BB9C318C993ECAB
+E4A83357B9ABEA0500F723ABE6455CA8F43D76B562185FE4EA7E60E8E40C4F11
+C6FF2D499853D0517461F46561BA53A599570EF98C78041C94E76483440CC41F
+F319201C0847014C28001240684A9B7F8C6ABFB057F48EDC4AA43B569A1D3861
+E4520420626C6BD7E74953A682141753F251DAF944E7589004C2C3B4B8A6F756
+F869F0D80B6717CEB011B10D7D6C5841E85084890FC54340406B71B9996633E6
+7D09B08F7785952D42AB38E12B9894D3DC450F8F510C2EAC91E7FA218ED5AF6B
+F492486983171CEF0EE88E4FA94CC393E0E6990AE891AA16606B9AFEF2FDDCCC
+08981FD40B4224583C30A884FC89D8C82238BEE0CBE9DA0887085D452C8DA118
+910DCC172C10E4F49C3CEFCCB9506DDCB527F30EAB8BBD3E4106C66437CD0AF4
+0B57E988C155D35D7FEA6F1940BABBF767BF9F53367F7AFD5B3FA02E9269A11D
+69E2F9B8AE7A6F7C1034CEF6F403514F4DAB9B3F515EDCE1BB6BF563951B5C1E
+61CC002041736DDC4B64286F5F1EE3039FF6F498B0C3A30777B11D5A43075683
+C78B098ED5461C0F9E69FD18A018BC3CBE1539123FFEB4CBEE923AE6EE92095E
+14C9E4DCB2F8F3C7E2D07078CD38BF22D0931BD25FD38D92CBD951B8F550B02E
+C3D266C0401B4200689D4F53F3C83654B6846F0C8AB93CF84DE36499E18301B5
+4CAFB7A3814A37267633FFA713D9A72D817A24C85A24DB566F2F5B45FF2E2F99
+5B31680DB2436BD162B92C4DF9AF7EF001E248A79D2FB0BA0283AB72E70C34A3
+4F4C982B3405B38B36D9EC86D1FCCB4BA5001FFA870E2B6C6F9D2178BF5D4CE6
+F4230733781AC736CAD13079C0A75374074FAC9276B3433A69B8CB3A5D7E8204
+811F1A7BADA5F46E54E43ABE5A42440F7417EDF3994ED3574A4A823A23FC757F
+09AEF9532996D4F8024B56B50CB8D6EFD2C7E506E361912695684B7D06A4E118
+969DD602284E65544BFC54F5FCB423A32A7979596F14C7FADA3AE1F5999060EE
+64ED60C7C1F25C4A2BB6CAFFC7D2EA92CDC6E665BC95F733A62A02759FD7E574
+9CB31A7935DD77FB8F6A9EED76B7B1D7455AEFE497BF3C6EE597C57BF5C7034C
+E5FC4984FB0E575857F7243C83E89D988AAC9CF12FB382719BE8DDE2CABAA1EF
+EDE627447A1F53D25F8291215AD1F197AD7F26C7100F8D732D7969490CC442C6
+1B182D0568CEF9D87E4540154559EB4D4A00B2EBFF4DD64BA2DF82EDAF82EE83
+F77C3C144A9C0E954653F31AE02F5261142A6BF97D5201CC7ADD107B03318C05
+82F867269D63704616A66867C4F503818CD0583D01B7486291FE17E0FDF8462D
+E3B6806EDFEF2BCC42F25350E441B9EC60DE039A3B572E1FBB73267686D3EA4B
+6D281FBEA413A9A2FAAE6CE1C84C0860DF2AA53F624D8EF361174C9E967FA075
+3D596B879A6799C257D50A7EF8EA5D26F120C2FEE3B310434169F4A7FD1505C1
+753CDDD8A85541ED71221F0305BE16EE24DDE4815674FD2A8C17FCB42F47965C
+19C241A5E5B500656DDEEA1C7035FE723062CC95C76E55EEBFB626465ACAF60E
+768663CD195BBEDF39178A7A466B84AE0DD4B649088DF2D760EFEC9CE97EE48E
+571D8D60114B3FCF846E24B20FD628F053BC665BEA3854989BF586767EFAF47D
+4F7D93DB5064DAFD93DF513F2A688C5506541665DF9665840184C7B40D23B8D3
+F2E6BB1E062A68D8006DEB35415A70F72E8E875E50E6A4ADF892B58759EBF6E3
+DDCE77AE9E8E123DB494F1BD546D9BE40056B63890B737DD45322451465765BA
+B7D0B38726154B1670A521D113A1DE39D7AD69566456FB760069682A8D0E272E
+E945C1AE3CDE2C8FA415C637B03B32CE8F2577CFC9C6B0417ED436BFEAE35420
+AB7E1E69FF7CC5CBCDD0A23DD9E5E91CFA85F82199A474AE1ED575B4E44C1F58
+5A865C1E8A242F1A1EDB7C2420B7D131BDCB7ACA4556517E9DE58D58A5F2E534
+48E62EFCA90A653BEFD8435FC9FE1B211C12E99F9D243CFC83B5107F2D3EC3D5
+CCDF97470CCBF8612040288BB312CC9C78CBECE73F915E69868D259811FCA8FB
+9D501D923E5AAB65BBF8EF029C6D146E63823F43C16DD45E8A63194E57C84489
+173EE68F912324102DF4DFCAF9579574E5F670D2C13595F0872FB81FFD41AECF
+20AC693E0145A13E7F2A533214B9843D9A242B8C5129914B999040DFB6511AF9
+B53B44F392455A9AA3D816AD164859B6212CBACDF6E8CA6F9181A7E21729A201
+1A5FA75F6D9C1982DCB70E40436366DA2D03AF422D47A6B807C2FAD9A4CE8499
+ABF26A8BE9F82CDB86F013736E30E559A5F6AE8B2F80DEE41BCDD503B62423E9
+0F457D33432FFB66B387EBA0277F89D43A3B1AF3F559E20150BE5C6073A7F875
+F485800F84D662A0BD3A257560F6D9185152AC8F2F495DFB712ADB19AE81F4B5
+57F82F587610E15C0868CB571877EF2D8D1F2D607490641856770E1857502F7B
+22155718C7EB08618A04255181A0F5F35E4D2C89E704B72B67464CC2AF6AF7E2
+E392FE5DF2B5BDBD13253FE0F7E9FF9B36CF45CBF3990841A95D547DB3D05EC3
+8A0CCBD3D9E7D9DE04E265DC630FEE232A03BE090FE17E72C4A978E685DAF570
+E67DD8371827EB803AFA71E5D0BCF78735EFA3B9F77FD56A43BDDAEC02262AB0
+5432D8501AE034F821235E22F12996D50C9FFACEE6727FAB0173D303ECCF4BA4
+F0DDF834DA19681218E18CC8D1155B88AF19AA7C7F4218CD456DB1D011319770
+931C07A1E03DD8C0531B54478CA60022F8F3A8E26BD66F8BC624B4469700A734
+388E5FC90BBBCAE70DD5CE692A3CBFAAA15B7842B26E2F5BFFD63A7D695230D9
+16B8D7396D2AE53925635F9461FFEE2A655AA6BCA05481BB0A96A9AA2232F524
+E9FCFB918DF6A2E51D83953ABF38CCB6C8BE67659421E7E346DE3E7F9D7905A1
+9FE979AB1DBC7D43C11B972D647F87DEA6AA7B1881168E2F33B9DFCC273B45DD
+3E896F146165A2E97B0482F857ECB635B97F2EC5060BD73BEF2F149A81888B7E
+CABABD7748FBF11F4BCD72C46ABE116F4FD89C7FFC4647AF1FFE5482024429B5
+446DDB47D8B8F433B80E88A7A22C782FA931C056D353FE673C9BB3C82D2E7FB2
+E5AD9C96434BE35BF2E4865BED84F1F200AB24089A1858C56DAA1ACD0CD1D9C2
+80FC0D4447B34209FA0417B04B2B93FA047BAEAFEB551349ED23729D0FF35D49
+6726E0B99E6E6DB44D1B870D3FF58D8CE91EB3495C085C9726246A9B429BD5A7
+313D868CFCCEB8CE69CA2C97AD75A1EF1230A0837CDA260263ABDD679F4FDB77
+9D539611B9A79F92BBA5D64BC8A7FB8DBAD19D12C7F8339B9762DBEAAE08B2CB
+87A8C48BCE0536FF75216DFB5BE76912127BC6FDFD8780A5250FB9B3A0BD6EDD
+EE062841F0C4A0BD92A761DA0B62289733E5F7F4F7116EB528F9B947F577A972
+5F3F6049136EC870D6BA0DC54A05938A52C45DAF38C4E5B4F04630BD4CDD8C7B
+59BF65B7F33C26B144BE21E63015F461753792DDC2CEED4716FB974A5D529769
+448518ADA96D9FF461A9F8CC6344667561394AF0D088D17952AB8CBA6F936ADB
+76114B8F8CE4CB69BF4BD9CFDE20ADFDCB3E1BFA49037862CA298E373D45E22E
+96696C4601C2AAAE176B241185959C4CD2384D92238B2F36878E0639E4E3CF09
+F8304B5AE034C4C3D5861EA1C4AD532B0A8043874AEA1EF65E9287963AD8B029
+8C63BB9CE7246C62D1B735675BDCE03E17F9CF8BD5C80BF64278BAEA6984BFEC
+463B3E7AC89302EB7D1D7B2024FE1C8A3CD6D83079F3B6FAE7111DF26455DBB0
+C2F875A7A0FF4570D20C166E3D77B73EC57082732827865559A3FC4B83FB1E78
+FE95C784B5B2602C3FD7F3CF825A9D032A63CD5080ED828C943759E286E1CFBD
+0A6A6C8D5FFA56C0DBB5ADED2C83FC4E2182FD875867CF8E92319240F2D77F74
+FA167FE2A42FD71A9DDFBC3CC3AA85F954AE06A1EF356BA823EAA41694BC713D
+9FE515B867CCCA4C6CAB3AFDF8B0FEBD21DEED4CA87CF1949D86364D85DA9AF2
+440E47B9C6A2FD487679C65594EFF0E3E5590165BE0230E09E4305F502E3456D
+3405EC646C3C0056E64F54CF4C9C839AA6335552C61AFD4600E96F2D76953D89
+3008642F6463578B72142FC1D681E5819602C21CFD3E4A793A08A2916FA77B7F
+E1BB03405031215E7DF629420E6F1EDAD912A09A86BDDFDBD1572499BD2AFAD4
+CCD2D227EF8203F8E1A08FFE8A6E948259D01C09D844E4E8E5EBA5D05457A23B
+D08170E1F8352026366760E6E6693DFC941171B414C84AC4FF06278FAEB6F7C8
+1CF27A01AE4CD98F212787A55252341F3FE9937A60B479F9FF8D0EDE01A11772
+FDF612B12D1F513915BD3E94427317941F012AD9179BB1AD60A4DE565E13DD6C
+4743C3310D950420476422ACCB6EA4618A3298AA11AE59651C2FA774FFF1200B
+A8C154D91A183AB1E3D885081830F0F336F9F93D1C5DA87C8278DA6131DE036F
+E3C24119D2971177EFF13175B1F2300C1385420636944BF2065C76DD738AB33F
+EACED4CE8128E8E94F4369E9494F849ABEBFCF52FDFCF88E77CD44512CC84839
+32B3B24864BAF8242C070C471413F230454E308112AE347D6CCFAB350082A769
+00F4D79BA7658BE552FD1323D807F21DAA3351691B5FE3F0737F16807DDCB7CC
+F2DD668BDF56A441B3ACBCBF5B88779238A2D9835768433203C5BC7D79EC5F43
+F4CEC28CB14A2B04953D9E5CD7B5B5A8895B12D06466B4608A3EF5EC513844A6
+2971F00F4426D64027E3C79C7C14E1A4E2EBC4E8761E0AE7124240044A74AD3E
+5C17B47082B07FAA3F29F8BF449987029C56FF96099C3B652C75C1FB209B9056
+16B3552A6A34DC04E74CDFB75CAA2FF9D09A5848AC4C73B8BBE11FB8EA73F298
+F7F3FABF88363B915908DD2B5F2FE2FB518F0762F6C9BED8E50FC95B76722BE0
+F4A925F9A9FE646C038B545E625C68BE110EDC479157EB00A452704AD9D987B7
+A7E476F4C6402AA011636C133A1677DCAFEE51FF7C8C4484ECBEF50D66AB57B9
+72897269163F81099035EE145783C7F8EA540D7DF882F4B6B19ABB59171F2409
+0B2CEAC44306F4C6EF568080CCD5EA48E641CC4029B3D9B15A60548A1A5F7134
+D4C6564261A728DD756BE9C14E679BFB9615DD353F64F4C3097F560BA70B28EA
+DCC8AFBEB83BB267C71A0590E892E64DFA0F0A33D59EFB5F6027B77AA545C40D
+C8B3AF15536232FC482A61C576D8FB615F2ABED39B3318DEED8D2A390642B39E
+A9BA723D239E44FB94CF6D3A8D5CD81D200E1EC73A078EAC19BC15D3DB42B53D
+EB9DAB0E6ABEC9B54607F17C897430C93FBD537227792F195F2ED96E7E9B476C
+ACE8871B8F35F17FA699FDFC1E84559872BFD5974E008617D795AFA13CF614C2
+E8C31A6593D68D6BC067757DCFE56979C9CEC04301AEC06F69CC576A63468991
+96C7A7B4C8D96C4CFEE51D261D9CACA0EF109EFFB4FDC54DED745E0814500119
+D60A530DD3C759D358E150AABA8CA8B5DCE71349A611105613954AF66FE31326
+BEC765F32A7DB33238FA3332846C39130EAC48D2084722E9A8054D1DCF07D4B4
+88FDC9102AE9B503AF7644742B94419B08EBC6A4EC55AD975F8C78E98841F373
+7C20129125B4FF74B5AA10859324988439DF5089426895983A8EB52F864354FF
+5683DAC04B552177CFABB567E9902D46ED9F9614264A5C999DA148F7DD23A63F
+8B4F69BD6D51989A80617EA908C755728E8A00212BA19BB5337F5B05901E7F5D
+FF939D8E075E502F0AD636A8D622414A0D8F5D18EA353561011F20F3E7610DF5
+F873A4B7C47B6AAB6FE994CBE17CD5531AD10F20A236D186376164D6E7C37D35
+9EE92875D10445E9D8CA448B1B5157891EE746F0CEAD4A0EB57B3E56A5542937
+C7FAEA6DCC43211D85F95507B259FC96BD758AC2D583E9539A3B0F731D397A9F
+CCDC945EF97A6DD96E0F1B31B86DD3CC9CBD79702E9FAAD2FF117A0508BF88B9
+31DECD5D3E0D611BF0A6166C1CBD65EFB3C0D76E97DDF2A014F80C744BC148B0
+34644E08EA91505BF260C7AE37A18E37EC8303346EC467AD820A576F422ED863
+76678BCE68D92AAAE291154307691689CB7F76D531639D8F7BC805A431840FC5
+413B837E4812253430C34F7D4298EBF0FDBFC0C7F33EDCD0D8D2DDFC24E44591
+8AE9960301CEEBBD2BE518CED66AE4561D470B0F0567A568608C3519FD13E8A7
+951F5914A46404FEB6EE1C2F523D778842A004CAD8C301DEA174C31679E87064
+8AC9EBF70ADC35FFB8A17FEC46BC5C7B2AE4C0FE00443812E8BF8015C6A693E3
+CBB67B623B02D78F6E96BD673010D27DEE00994D7ACE9681E0E7064E481A0B3B
+E91BCA80A54F0FFC27686153BDC6D5E0B2B37DDDF01A209AA4C1B5873B27ECCB
+F8E56A9294BA616F3C4A2F779C474BF3F6F2AE5B5D7A693EB2C8E933B3684D43
+5FE55CF54EACD649D00FCA9391EAEB4E12EDA80BA5D8CA84B4981FD8224E25E4
+DF77F2875F1CD9C3162B0BF047C55307AE9738639058114B169B14C11B592F3D
+D89D841403F1B78142562AC0863F812D87E7033BF2CEF3BE1875A2DD250FCE96
+5DEB25CB2CCFD4B0BF1F2E1756B3ACB812E3A47BDDAFAB76F5FD6FF4BA1ACD37
+D8B7089936EB09A4D7B2871949C2FF1C9B6F56036A714C4075CFE8843AD2F917
+862E6777E3FC47F46FF1EA8E5E564DB86474BB8CC60A20B7FD58F53A48D25385
+E6C50729E4E93FCF8C60A0C63BFE1FAB0F0CA3
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+cleartomark
+%%EndFont
+%%BeginFont: SFTT1095
+%!FontType1-1.0: SFTT1095 0.3
+%%CreationDate: Wed Sep 12 2001
+% Copyright (c) 2001 Vladimir Volovich <vvv@vsu.ru>.
+% See the file COPYING (GNU General Public License) for license conditions.
+% Converted from METAFONT EC/TC and LH fonts:
+% ectt1095, tctt1095, latt1095, lbtt1095, lctt1095, rxtt1095.
+11 dict begin
+/FontInfo 6 dict dup begin
+/version (0.3) def
+/FullName (Computer Modern Typewriter) def
+/FamilyName (Computer Modern) def
+/ItalicAngle 0 def
+/isFixedPitch true def
+/Weight (Medium) def
+end readonly def
+/FontName /SFTT1095 def
+/Encoding StandardEncoding def
+/PaintType 0 def
+/FontType 1 def
+/FontMatrix [0.001 0 0 0.001 0 0] def
+/UniqueID 5124736 def
+/FontBBox{-204 -361 1351 830}readonly def
+currentdict end
+currentfile eexec
+D9D66F633B846A97B686A97E45A3D0AA052A014267B7904EB3C0D3BD0B83D891
+016CA6B55C6E47AD7A9A958A6E22E00FDD4D6492D53ADDC90ECD778346C06747
+57609FE8907DFFFED75E2CF963A64C7F72488F4A02372BE681E9BBF09A9CE5A9
+3894F6358C244FCD46C148F1EB60DE2137E6D3079D6AE03B3724F7D7BBA47BC4
+41C27FFFDFF9FB7B7738A8D88C27573A53E244723E07C995948DED2516B6044E
+ADED62C496A56BC14483D307884467ADE985655A4712DD06ED00811F9A05BF9F
+BF2AC66203817289FFB5BDCD0445293981AF6F55928C132E885ED009DE1B5FB0
+C230370EB5156A8B609E466F00F768F0A52ABCFBFCE3514C0FDDE31E601AD508
+2666AD26D9DB386B9FEC80AC197C9FE7447928C0C6A2858375F0A1D7AD3BE53C
+9A926DDFBAC60D846783AA97CB86F804701BF53F7C4D18B925FD604F60231215
+EBDF4FAD73F2D13518E1901C3DA00ACE65647765106EFCA89D1F779499C0F35B
+29985BB1691E899575EF570E682D1DADBC20CA7AFE4299947765D2A13BA8354F
+02D739A46670062CC4CF6DDE1C0E8228A5BF1DA8F16202D18BF2975F21EAB0D1
+4B6D59986563FE3B50ED044723FAF99B7E466730DB3F7F27E70DA654D692BD6C
+A54C2A5D3CBB152C64983040467F958A0024F33BC3DA1E18DE770A136FE22AED
+39CE277A77C2A3F8DAECD2C133CCD7A20C2D9762CB9F6C30653DD52F6A8BD13F
+1E9D9A2C29787FCD373BCB2379B6CD9D0C90D81B2AED9A16ED71551472193318
+E1794335302A9C191D9656D7AEFD90D3900252A3793AC5453C26F3F52322C8C8
+06F72F7F26FEB32BFE1F6D84528DD160E9EC3289AD116DC1E56FD2989333A539
+60268DE077F06D0891CB441C7231E8A8D3DF04C5E15C33CB68883A421FAAD887
+8F7B6E9D68B24B8E4375691C7D53A8436601FE1C14E86EAC45E7D03FF4D4FA68
+8FA1B9F29FAA16EBB4F87D263A39B33FB4C903B9BF64054DB23DA948DBFABB93
+9C758760B58CBAB4128C8DC10B1975C9279A5A1BC33261F0882E05C4564FEB0A
+C8ADDC131BA780381645F347DBDAFA568B3F09EB7A62E8E0F71C4E986D74328C
+943BA63B52CCB2C996FB2E06991681710A28EDA8BBA5CD2E17888E6963483E06
+1326174138537C82849315CD7FC49361E013B4431A2390F065F9B7D4B015E5B0
+C887EC59856831EF1D64528EBB7BDE4C839B6FEDB13910F91E96F112C1DEC533
+78A7182CEC54382A0C85A321F65395C80E434BED1F65D335EDFA1F8E95605BF9
+ECA551C0907F9E2FB5FDB6524D3B6709F890B8244E3B22F441E0E3695199B699
+928CED421E2E0821C47454FABE0FEDCCA21057AF5B68969F70557615F0429AA0
+A2C34FCEBCCB0A3AE17AFC89ACC3317C464661876D283DFCF3ADB0116C331AA8
+31D8B4E75384B84CE2D6D75343851842F34C97CF7AAF5329DF63378E13EE700F
+23D37451ECAD1B74F370528811675550DC6C580C77D11FDCD7C979AD238FE071
+77D2B926973C2DF369C7468DEA494725E8EF00CCC128D8FCA869971B71DA3215
+39ADD2F641C6498CEBAD9370C9AAE10873F13A
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+cleartomark
+%%EndFont
+%%BeginFont: CMITT10
+%!PS-AdobeFont-1.1: CMITT10 1.0
+%%CreationDate: 1991 Aug 18 17:48:50
+% Copyright (C) 1997 American Mathematical Society. All Rights Reserved.
+11 dict begin
+/FontInfo 7 dict dup begin
+/version (1.0) readonly def
+/Notice (Copyright (C) 1997 American Mathematical Society. All Rights Reserved) readonly def
+/FullName (CMITT10) readonly def
+/FamilyName (Computer Modern) readonly def
+/Weight (Medium) readonly def
+/ItalicAngle -14.04 def
+/isFixedPitch true def
+end readonly def
+/FontName /CMITT10 def
+/PaintType 0 def
+/FontType 1 def
+/FontMatrix [0.001 0 0 0.001 0 0] readonly def
+/Encoding 256 array
+0 1 255 {1 index exch /.notdef put} for
+dup 33 /exclam put
+dup 40 /parenleft put
+dup 41 /parenright put
+dup 50 /two put
+dup 55 /seven put
+dup 66 /B put
+dup 84 /T put
+dup 91 /bracketleft put
+dup 93 /bracketright put
+dup 97 /a put
+dup 98 /b put
+dup 101 /e put
+dup 104 /h put
+dup 108 /l put
+dup 115 /s put
+dup 116 /t put
+readonly def
+/FontBBox{11 -233 669 696}readonly def
+/UniqueID 5000779 def
+currentdict end
+currentfile eexec
+D9D66F633B846A97B686A97E45A3D0AA0529731C99A784CCBE85B4993B2EEBDE
+3B12D472B7CF54651EF21185116A69AB1096ED4BAD2F646635E019B6417CC77B
+532F85D811C70D1429A19A5307EF63EB5C5E02C89FC6C20F6D9D89E7D91FE470
+B72BEFDA23F5DF76BE05AF4CE93137A219ED8A04A9D7D6FDF37E6B7FCDE0D90B
+986423E5960A5D9FBB4C956556E8DF90CBFAEC476FA36FD9A5C8175C9AF513FE
+D919C2DDD26BDC0D99398B9F4D004D606918A40B8D7BFA821B73E118040992A4
+E1BF99740F8FAA47E4349853C8149C0F8BE2F23C6F332BC0373C867D0715E8FA
+FF163A60AFD0FED665D5829739975C5DE12EB30895604D211F645D4E13330DB7
+64B6E35463C93B752F691FDDC44595B0A0E9E57C6F649809C4DBC7DB58102A60
+46349E9A5740893A1BD4536B99ECE72B147B713619037400669C07291022F84F
+4F3302F8244D2F0F1380466E81E0B5E00AF33E021A55620A7A93F3BD49C7040A
+67C096167F502EF2051B526405B9391B4340A3FFEC103E317E315A88D31661E1
+7E4104A2B925D1DDA9586861904FF6FFCE6A8E808385E4C4014F5A494874E2FB
+C3758D6989AB68C4CEF82F92B9439794FC404A29D086ED6B27997735BC3A24F0
+473FFD74BAECF5282E2EBFCB92D69B81C568D394055E2E30A7E3F448796E4EB8
+019AC2E075377F777183BD87FDD194E855ABFA35AFA73304DBB181C267431B16
+70456FD8470B525011891C1E140B8FF24A474B89F1CEAAB509F91FCAF512E16D
+8413BAC0C664FDCD31245C5996F4883305D3EDF1C8D1E6F0B1E79A06028BBDDF
+6AA5B515DF33BA8FFF2394262F3FE1DF95AD661322BFA5179E325BD1B1EECE49
+69F64789FF1BE8DE5CD7485571A07471BD6CAB4891BAB122BE4C4A1B7176F33E
+A1A434F745811B71EA8AF73407F32E9F4EAAE1C1FAA979523C18A24F754C307C
+CE056DCB71B20292D4FBCBF9AB9E9B81DADAB90E60BE926315049E5BF0F50315
+66D82E4963CB556F19461F43EF80302912AC1168884A1692AC59BFBC431B14AC
+A5FC06C4AB595F9DF66CE5EB69568038445A9EDDE20CF92BA308A23178D8555C
+78CCCF09E4E648AF4BE995779BDC627DE9A530AE98075DC25BAA32A528E74450
+5B0B849270FC308A8BC83B815C5AA64E61A238C34EBDD0FE766E41089E72DE15
+4F494D2438CDF5D00CE085F5EE9E2C6D3AE8CD129820659D90270EEBF682B3DD
+B006D5A7F39CF618EA82FBBE3F5A810495FC25B79954C51B914D8A7C50E5F82A
+588512EDC20E32D470EBB8AC35911CF7AF7852C059CF4E9D5C401B264B1BEC1B
+D426971E03F59E38BF195B956E455FD3F6586A2B34D3494C2E65D3259F291D8E
+4DFE29A115F3C10DE5A176BA5CD35CDF5A1F1FEBFF889B6115934787543A5C68
+F3C2AF13BF88FD4235EF2F49F6D2F3842752A4F76BF8460F6E9572A681B51D8C
+3E2A1F0EA037CDFE1451FE944AE8985BFDAD7AD07956E56FE270C159CC4F266B
+FB116BC605545582C2B90E982460E61D2569C2368AF8E1C3D418A5D31408CD72
+30F9D7B5B11B5E9B6C7AB4C8CDF0898B0E34E271BDF2D8CF3443161E5131E2C3
+E989DF1708A73FC0FD52506B6CC99E92C03E6A436A30408850EA1E12CF4EA163
+3426609CB07F6437A8224379FC2AAAE6C1BE7E30AE5BAC6718D5C98F5AC864CD
+B0928C270E2E4B5A40172406756EF64132E6A78938129A3F87A4E4FE0A47CB02
+7907B325C91AF711FC52877834743839F3734A8177EE07D253916D68A18CA6F9
+9A333A562A26D953067C9103F97CD5B3D71F225C8F283465F71090A0E07FDCFE
+F92DADF9BC918666920CD24688312746D8E0FFE9F6A5E9D283BE16FEB21F320B
+1FDFCF1EDFC7FAEAC9B2EBB28E4D5F1BEF5F3C0E32268EB74A8256B11D930A57
+0BF5A5612D5240C7130B488CF196A2DC9F20BCA93F7BEEA3979506400145F031
+175CA4B1ADAB0CB5809FBAEC78C10F936EA20D4A9A53C9B4966FABC64E8203DC
+AFAE04ED6AD39E48C79DB0233F2CF25CA506698EF61CAD3D1B7EA869D5D97B62
+48229140C30E168E85CA43BCFD8965503BA210D3EE64B257E2467A594E346E08
+851F7D0B6CF14DA3E92E268D1EBEF589C00001F469F25D32D497F014106FE89B
+56EDBF277C530F425CBB3D2851D3E4FD029D4A729FAE04C5121F7656705995BE
+404AC35674B74B9CD9351C880B3C73A0CE94532D016E34E6D71E203AA1F44916
+EE78B3A886B716C0827855A062B12EA8E4D880A3A068AF44829FC313ABE2A906
+F47D50167E0F15E5164A6A920A1F73AB6519D4871DF0C1E5D5EEAF47A301E398
+59D3DF15DD88DACD53B3BE5CC6E9A1771E40298CA561542B28EDE89EDCFAD4C0
+7E3E08719E2832DD027233AA5140719AD478A26E9351CFD63F9EEFD3EF93621F
+00C60722E342050C79EFBAC5D0CD328168E43E3CC3885BE901BDD565DE951E51
+F0DA5AC725E26B00B5204BE0E9A1C2836327008FE458A20C1E712612F85C9F51
+C734A6C5BF1B455DF2487C4051E35393B1CCCE8DE3311497862ACA8D55384C12
+9028088279B2FBCDEEE2AF0B162637E18793400EE4CC3D67C39311EE18C13AEB
+A36C6B269D42AA1D7696449181F5AE91B25F5C4A1BE211E01F0FFB5CAF50ABB2
+0659ADFE527DA575C396D926130E44557AA3DEDE240E8B4806FC5EB3B75CCD02
+5DB0DCBBAE093224AABBBAFF8C0C1D568D72B8B06E027E92B606EC2F315CB852
+27AB2DB062D8D1AC5AABEDFD61E13B976A4A187D6AC0581A460DCBE6590027B4
+C31D925C948E1897F255160C8A207BB3D6114325571CA016F4B136763AED9EC3
+B79BDDC523213711585A0CEDB38B7AAEC7313C220BF71CA3A8F122BEAE0D4803
+1FE92AFE16EA884D8E3C70EBE608812B6F11AC46A073738B6BBD31162400508F
+211A609100F41B731457837F338770CCBC98E4C9CC8E4CD5CDB1ECD4C901A36F
+B20E8AFAB02B1469B775AAFA41D59A2A104934648A1A81241490327F09BB04BA
+4C45FB4499788CF85986C9D428027428EA00E744C62A209FABD16449AC830D33
+973172149862BBE39C309831B2AECB187FDC9A9D072232A81A2D1032CFD29DD5
+704E8AE99CA5B814C4370506618FB777A4FC97DA9B90C6375A5FD2C9A914357C
+D4259948F5F3931D33BAF2BFA1BC2C182894936CCE226B4541B2C70580715FC5
+073CC7315DB0BFF36FCFB8A2BA6C6389A87FE959B113557FA4C909F6675DCA33
+F059E4771E1AC49BFFD235D0D66621250517EAA18A4DC0BA151884378EB2CB9E
+F36045A5B631360626855B5CB1D6E7A0CEFB610F8EFE351414AF176EF5887FA6
+FFCF7136595EB1A1D3074CB192D3AFA73EC67D8C137138FFB1ABDFA1CA700729
+7A8348B5C14A4009F72A7C50593C900952874A17C7EFA5480B506727BBC603E0
+17850E5F40B9AB361C8D3E9B5C51D409A95FABC50B16A276CA86AD2BB47BD89A
+A53C6904420BA2743CEA86741DF79B2920073D1E027E3F00A8FDB6D2A89D6725
+707A748CAC3783CE01E44039423FB84FE90C1AD4C51AF3EB9384D7A1695D7BBD
+35E7E2EEA94A62EFE68D5D7A835E6D8DC64C47CFBAF12153EE601534DBFC9912
+272D914A94321795EA0226179A7E07280363D292CC5EB078710AE5882A9A14D7
+2606B9F89DE91253BC994370A1B0EC0503A09D7EBBB0B4630AA15B795BCC1F57
+13697680E264F6312EEA431A2463E676D1305EA15944DA10448FE5B02D0C9ED7
+53BB400DAD7A9F06B5D728EAC6AF93B251875C28C70D69029A0F922AEF595B0B
+3EFC59198BCBCCBE2263EC944329E41DE3694001FA7C7EEA64C4FC4E5B27607A
+964CD14EE47F6A9A9356350A73C63E8983C8D4E2DBD39A0C0AE2D4188790F78C
+BFB97C0CE7A9090ABA3EFE4DE7360C0F545BB61DB217F571001FD3736550AC89
+E92D1D5FE1A0C46B97D7AE464814A05E007051C9296C2B157A15402DD8233CF9
+8C86D64B67AB849B347714C71747ACCB8DAD56420483885219A9F9DC9729A63B
+6850FA40301F1464C26B003A011944EDC7CA19952FC31CF9131FEECD73C4120E
+1C4A7EBA9865ED2B90E90BA77A4E7990B11CA7B66E58D1311673AAFF002FB674
+AABFF8BEF2798222A2215E1069E5E1FED7323AF769D0135409361208021EC2DE
+6F72211073F44B5BA92D99F4FBD95A91A7356E120DA636DBDB6FF9348ED81AFB
+0A33A7C0EE5D05449DAF4D63F8243A8F0ACDB39EFC51CC511EFC97B45B207B2B
+BC28277BC82A071365B5DC6C51D11A16136045668DCACE5C6D1D5258BDE772EB
+469A64A7D41EF452EAFC58A5A31BC67D7AC2D66721C07A47762BE5F2E35514C3
+A6CB706CD2B7F0626C6218D1F2D90EC205118EB861A02632D852A9D9C3623BE6
+E70BA37833C050824DF37F7B3F2EDCBAEF071C93119FB18BF67818D9C163D840
+3EECF39E2A68D8C9DE83638101C6D51AD8C61E82D04D18B4069FBBDC3D78D7EE
+70D285D696E354B517DD28B5F87FB301C335182E0FFA1D6D554938B2C6E8E867
+9F60C2451AD6E205B4D3F4DDB4A4711DD64E4FCFD1D335C70D613E947E7D1BBB
+F1615A76E019CE3B33EF6940EB8FF2542C4DB497
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+cleartomark
+%%EndFont
+%%BeginFont: CMTT12
+%!PS-AdobeFont-1.1: CMTT12 1.0
+%%CreationDate: 1991 Aug 20 16:45:46
+% Copyright (C) 1997 American Mathematical Society. All Rights Reserved.
+11 dict begin
+/FontInfo 7 dict dup begin
+/version (1.0) readonly def
+/Notice (Copyright (C) 1997 American Mathematical Society. All Rights Reserved) readonly def
+/FullName (CMTT12) readonly def
+/FamilyName (Computer Modern) readonly def
+/Weight (Medium) readonly def
+/ItalicAngle 0 def
+/isFixedPitch true def
+end readonly def
+/FontName /CMTT12 def
+/PaintType 0 def
+/FontType 1 def
+/FontMatrix [0.001 0 0 0.001 0 0] readonly def
+/Encoding 256 array
+0 1 255 {1 index exch /.notdef put} for
+dup 42 /asterisk put
+dup 45 /hyphen put
+dup 72 /H put
+dup 91 /bracketleft put
+dup 92 /backslash put
+dup 93 /bracketright put
+dup 97 /a put
+dup 98 /b put
+dup 99 /c put
+dup 100 /d put
+dup 101 /e put
+dup 102 /f put
+dup 103 /g put
+dup 104 /h put
+dup 105 /i put
+dup 108 /l put
+dup 109 /m put
+dup 110 /n put
+dup 111 /o put
+dup 112 /p put
+dup 114 /r put
+dup 115 /s put
+dup 116 /t put
+dup 117 /u put
+dup 118 /v put
+dup 119 /w put
+dup 120 /x put
+dup 121 /y put
+dup 122 /z put
+dup 123 /braceleft put
+dup 125 /braceright put
+readonly def
+/FontBBox{-1 -234 524 695}readonly def
+/UniqueID 5000833 def
+currentdict end
+currentfile eexec
+D9D66F633B846A97B686A97E45A3D0AA052A014267B7904EB3C0D3BD0B83D891
+016CA6CA4B712ADEB258FAAB9A130EE605E61F77FC1B738ABC7C51CD46EF8171
+9098D5FEE67660E69A7AB91B58F29A4D79E57022F783EB0FBBB6D4F4EC35014F
+D2DECBA99459A4C59DF0C6EBA150284454E707DC2100C15B76B4C19B84363758
+469A6C558785B226332152109871A9883487DD7710949204DDCF837E6A8708B8
+2BDBF16FBC7512FAA308A093FE5F0364CD5660FE13FF01BC20148F9C480BCD0E
+C81D5BFC66F04993DD73F0BE0AB13F53B1BA79FE5F618A4F672B16C06BE3251E
+3BCB599BFA0E6041FBD558475370D693A959259A2699BA6E97CF40435B8E8A4B
+426343E145DF14E59028D4E0941AB537E34024E6CDE0EA9AF8038A3260A0358D
+D5B1DB53582F0DAB7ADE29CF8DBA0992D5A94672DFF91573F38D9BFD1A57E161
+E52DA1B41433C82261E47F79997DF603935D2A187A95F7A25D148FB3C2B6AA32
+6B982C32C6B25867871ED7B38E150031A3DE568C8D3731A779EAAF09AC5CE6C5
+A129C4147E56882B8068DF37C97C761694F1316AF93E33FF7E0B2F1F252735CE
+0D9F7BCE136B06EE967ABE0C8DF24DCBBF99874702ED252B677F407CB39678CC
+85DDFC2F45C552BA967E4158165ED16FECC4E32AC4D3B3EB8046DCDD37C92FDF
+F1F3710BB8EF5CA358ABACA33C7E5ACAD6BF5DC58BDFC3CF09BA2A38291D45A4
+C15FF1916FE2EC47FDC80911EB9C61F5D355BEDFC9DB17588547763AC5F0B1CC
+12D2FFB32E0803D37E3281DA9CE36C5433655526ACFB3A301C56FAB09DF07B5D
+048B47687348DEB96F3F9C53CE56DDD312B93D3918CD92AF53FB9461864D11B8
+0138918D0B1270C54873C4012CDE6F886DB11BCEA04B023EBB43E0D0A06BE725
+741D08B9DB688731A6C9886C15A83C28DADCC81385EA239E045E8F3670CE03DB
+9EE77ED067036595C9F3B1854343BE3A12E486B6E5A2F8AC44FA5378D28DCCEE
+306B0E283AA444423F9A4FF38E2B56DCF67A39CEB2C643DAE86865517D5D0371
+CB8797208ADEC637330A3A57902C9A88EDB75A7C16FA9850075D9F19578EC666
+1353CC1FC512D59DFF847ACCD174951273B3F2E868E3045E98F553D94F378E86
+F0390287DC9C3B28327026560C53E4869B91C80BDD5AEB9273D328F441B50E33
+0753881101495EF123C2637CAF44C31578929D62C74066510FFC9C7A278C7333
+EC3340B7D56E68935BC934DA28E91E13B1239069D5EA1A9E9E041EE4CA1E945F
+8246206A672F5A9CAB627F1ED416CB78E0E0E930586CAE690134E520BF628324
+B2B18916D39EA4E59C4B6708D79F0D092103D8D4A4B2F54676D34C4DA21CE6F1
+49DDA840D214E2820D0BE80480934A9C4A7CD5AF722F77630D7A77A42190AE76
+477D65B9D7C3EB6AE4E6401EA22B22002371534FF56C20A5D6FA41D2119E0A50
+D84DC447813C9E50D1679CCABBE5C5A5ED71A3CFC30AB6046BB53991EB8EA2BA
+903E98E48C05EDBA35FBA4156123AF84B10CF70C573048DC491AA01B417EED5B
+5D14C600B64A73C484B84DB16FF41F2F7AC2B4B124ADDC1C4C8B68EDF4D566FD
+C77B78C6991DE47A062436BE8920DD0AD3CB3B07B678DF383E54E709BBB12918
+091600B5FEAF958D6DB3A9464C92DB88D6B745CA475CA1C7000E014E8B168BF6
+4EA80D945C139DEAB8EADF44E05DF8524BBA87E25E7055A8F5037368C2C636FB
+DE3EF033F31D672211CD059C61BC02FAE90F40A05FF568B6324325769BB5BBBD
+0B6CBB553A39C7C8E2EE2410D0A9AD45C9FEB3B31363BEAE7C80A001B93B1B10
+1BC45F464D50CD22E775F83C8A9D7B0913DEFD99D564CB21F3F1A514DAA1C713
+4965D3C1A81CD3133E52EC37597F387E16EAF17EC72563344F30EBEE4F7A91D6
+910ABE1507EF336858F38007C5D5638A11DB9D54CDF95862C6F63A955932A6B5
+0DAAA706120F359E42B4D0A876FE55DB94F0418399417836BA61B07AC7CB36E9
+806083301B3DA55D76080DA08A244760719E8C7623B04381E8377474E042669E
+55E6F1DC4EEAE089F4113C7EDD8D2F5187DA0ACE7E5CE3CF514BC9AE48CB0998
+ABB273E2A6726D1976CE326BF63BE939212C625AC3426E24E981EE764E53462A
+F2ECF8190B84709413091C5C154E6126F8FD34F12FEAB056327C4D8338132E15
+FFBD3EA2C0DBEFDCB2482B2DEC56B0FC1BA635A39069D36A2802449050920E72
+5E985649C29AD3AB861B932FCFB7BD1102468BB99B508981E49FDE5DE2557FFB
+A7A3F82B7A59B709626CC9381743F1BE1E3A2FBC3D3CAFC88649157A01D78DD1
+DDE639F16D42A88A8DCB68B1ACF69BC7A6D85C65DF21D5909A9DE503C2377040
+C11830E72136D6147CB73E3655AE91B62B1F922DE1CBD866AFAC5AF0E0E3F2C2
+668C171B0021E26F473BDC8561129F48888043F0DED88A31E729B59166C19CC2
+DA6DFA517ABD8FFD7CF1E0E089F6F255DD020B249BA50EB602EBC8860DBEBB45
+80DF50AC1C1F4AA0840F1D4104FA26C189C11DD79878BE93961328E340274210
+C42BDE93978D0D01F0063DDF70662A34291FAEC9958328358EC012E93E3CAAB1
+72B80481BE4CF214AB484AAC4CE382D535127E081E4A0A47397DFEDFBA3FA8AA
+B39AD0855477D9DD5F1F2F4B934DF92BA1BF5559FC7159DF3FD93907112890CC
+BA4744363E2130E0C04B3ECECEBF95F0928D8794CC5D2C6F23E5203B090527D8
+566F12AA675262BD535E3B5092DB1DFB2CBE0D768DD8F76D6C68116C3D1F596D
+11FFE5C36617F5C4B70BC9C4CDC2AD5C6BD3DF72FE71A1D07B02155D94558BAE
+A9B1A72D1E5CFD92FEE92D5663939FFD1E156371768DA616B598669AD0F222FE
+72802E426F37FDFF5F9C2209C62AFCFE42128347CE2819CD09CA29186405C740
+6EDA0CFEDE26FE1DDD6B5DEF79741E27346D1C85AA2D75AAF515811558EF82B9
+4D25027FB037156473C72D396373AE4F02B88775A07F0B25CFD2A72B4D3A2F03
+499FCE933A725753F79230C38489E13BC8717E64AF3F061DCB72ADF4C075F4FA
+2CB83DB0F6B8523725E764377B7940354F3B1FA87188F8F271B2B1CCAE5A4F25
+92A613110633A0BF6ED4EF89D0A77D34A4373D9FAFD28E64678C6228A61CDB74
+1182FA7BD719093FBAD940C63456BF952BD67A6224BDA5A54C1DD613E3E8C689
+B527E128A65B43CF1F7C16043062EE7406FE118716EDFD11C4866A8AEFC96533
+E0117CBE30EDAC574D937475CA4A138EF4B3D8D58D297B76E25E9C7447DF971B
+32377D7FC0C2D50E4034ED4AE904876A3B39E2B582E7E6579307035D0530E8C1
+EF11FA619CCE95140EECB47FE591060E4F46B44F87B2DCE6062E6A37EACF235A
+8C2DF0B7C81EAB48FC1F50CD89EB07A7108B7F25AAA317FD099B933A752C8D83
+7B60C112C5BBD7B69775B43A5303F23C8AFA6ECC642F04BD7C483B11C846F06F
+0F12740991D34BFA81B89CCD1D8D6F3376E8603303A8C1F382EF6BF0830C6710
+D73512A9E5B04F13C6BF006F1E647304F4A400FD1C684688C8A3D7E33D7C7E52
+0EDFE03215F49F513F27BD4C4DE79F465172DFBAF08A00C147B790A8CE66FA75
+8D2E04F6DF237BFBFB8F0844AE0248097C2394DD99B5620EA87D009E3602826B
+ADB396F67B14B9E44F2F28B93F18DC70EB285556D7FA6689EE34055EC6DC43FE
+15F24BBADFF454B2D9149F1535AF2ED9E0B4DF03A10D37AF57C612811E1D2D9C
+0FF27B43FE781FC0D7029ABC16506F345F63560273D266DE5A5F3D75EAA259B8
+81D1BBE40986DB562CAF413C2E7CBA8D7137D56E410D0483C8337FA2EB5B1500
+578884A5D04CF9282301E8E982DC48AFC45530BDD9A591F6D46A124A152B5681
+C738BB469AC2B2BF782414756AB27178CEDDF1B4262E1332A9E12B3E5063EB8E
+51713C2DB0FDB074A7BF7DA4C78BFE7117305A8F79C2EBD28E5CD114A8E9A794
+0982A50EF98C393E85676781836D942A69F9FAA83261963D16BB48984C968F2D
+E2E8ACC9F8EFEC0B3FFA298FC93C14098B01C53C88E1119401F8BC307D3056BA
+86FE328F7972E9689D575D8068D563ADA44CC8CA1768F082D9D7CAE9AFE81216
+1DA5769469C0AA9E332BDC92520A21E359EB598541574AECB8FA6ADA1F135A29
+0814B16B6F5DD288CEDEFB6FC413B72F0D57315A47283156384DF5073F4FAE50
+1B691892099C73E548D26F802A728EF00A16A1F21BAB2DBCD01589E837B7ABCB
+FE506FC6F1A7B4666DB913488EECFEF5E8054BD3C238EE0E7352C7082C99CBF9
+088B296FF1D3803ADF7F0258BDB2F4BD33611B23DA2D4F0CAEEDA08EE9950091
+45046178F645FDF46EEEF6E2DEE6C00FFAD477A1DBBC6BAC7FDFC2557443C8A6
+A369050E6DB03052EF6F847E64D2A098D2DFB9C596F515EF0BF6833D0857D728
+07C6C76A70AD2149D4B14D55CF4B894D58AEF03614D4753ABF0D9D2E3ED80DA9
+A9A8203808320315A23B0043FCD6848CB0B6EA6DF7A4080466FA78D7169F3F67
+4F15D3FCD7FCB51BFC1921CA24B57F8A64B323D5A0256FD8AF50159ABE21C38B
+DE929B3EF335233A86995D38D09C1EC74ADAE6F71BC083E70139048E25E75418
+0D44D52F5B3B5062877E3EE80CBF7F916B621881289CB9A47F5FDAFB0AD22E17
+48AFBDD244752E920D030653C1C4330F4AD84EDB62633754015EC6DECEEFA7FD
+4914C429ACD7C6B53DE3381D21688EBD0E086A7096BE1B25578D656BDD92FC45
+0E89004565470E9A01EDD088AA53DC306BD3B176ADEEFE4B3BF64DE02CF52006
+D2B62E10303BB9B474046036F2D4C3647A0E472D42940132FBB86C7ECB57F834
+F153EB44016EE1F23C4C8BDB7FE6ABAF1A392B09777AEEC7DF4E23A01134E8F1
+AAAF8F16B3EB592FC8D33092414104978C9CED05B516BEE51695DDC0F536CDAD
+83B37AA1D1208849D48C537A47D4AE27D9B60BA08F98833E1445C891B422310F
+4D4EAAB9CD2477AC3ADA7626786206B563AF3A287F2B08E20C95B20D460D7F17
+83831930F4C971033B6614F1E12B9610250C50EF108DAD93F9A9B3DDEFECAB0B
+E3B1FC75B5F22FAB0B1D835C53D5CE0734C43D4113EF58E88730E8DB60A873C0
+3E25F99C06DD4F245AC1497E02F454524956ABF2FB9CF28EE215E32605752633
+CD639D00EC5D23F149645338F540B04504FF5E356D1C1A0138E559A58C07777A
+E6A40E6F194E7BBE335CA97348FA0A273CD4E5410C6C77A20B25B45A89F57CEF
+2473270C44B9B44972E76DF43EF086DEB439B26F9E06D573AF010533009E3307
+2BD8730714B780219BAFCD742B9A0091302519FB2CBD14D4AD17BF189CED1434
+E4F902E11B8719B72FC78E1F58B15AAD3B0D87C3A632E3EE3C4799C56E4CCE3A
+0832D4E3505DC41AC64B50362E7E036361F3874948B0BEA54353939A65CF6857
+F816E6F8F47833D353C8DFC38C0AAC4215B3B26A7822AA189A5FE2607720B963
+76DC6500482642F9F27D811AAA4ACEAAF6D65DD51CBAED18AB5CEEC7C7DFFB54
+A0E0E516F971817985905BD6E346806FD330D02EF92E5A91D1E8150FC82DD605
+D162C7C00E45CC9F1C3497E362A2199F47C3645DE5A3A019CBA45B6A5CFABC09
+39225D9DB6186A3B1E66D950F83FE5D6F85000B6158D21A18D8AD64AB45698E6
+3043B35F938633E9C0C343C602DB9FCAD6A8C03F52552285162EB4A72490F77B
+4A6FB3B5476832351A552FC04609CDB0A0A63CD7A34A22FBDFC0356E7AA92063
+95E47ABE00BDBF918B8859D9B6290C129B69C24533F5689134F9B014A7ACD76C
+76CFCA5AAF0879F81BDA064ADBDC8DFABCF58BBEE3E9693295AA62B2A477C4A2
+694C109351014EF1F3F5C81E2EC2D8165242EE16751982B9B563527A7FEFF944
+2420EE5ED8EEC03A3873C8DD44D30AC90491F6A8E0CD494DAECFCFB84996B48C
+42F48348124146B15DF8D8082B12694794CA59EA4916FBB7BCD0D82FC03A5B15
+28DAC8535844EF4ECE4302E093493560DF86B624053658E7FEDFF5700649F2A9
+7CD4E78B69661220CED61964C544CF03C535919C5F25425D11869C9E6A5A6D4F
+821B8A21E5988D4EE5780C20784D5346D84BCF5D2A09B304F684164D9E0A02E5
+0BAC39A9283533D268928BC65D078EE090E77B3C0F417D53F3435F482AD95911
+C14AB456F9C00051B97CBAFF5A8F161D924B92DE60CC4695235AE4614992945D
+DA998DD4223E1A9E15C5BCE9F9E8397FD53B85D9CEE36C5EB55C8822916752F8
+94805A753BDD8064768DF72E48B0419E18EF80AEF55C9B8D64ADF5FA2FCC26BB
+E9032269CA8A8702A5DA0FD3909F2829D0AA20677F8423FDD24CA1AC04DF2B71
+96E4EEB76ED46724AD19F427F54B30F151387AC277713DB1C9ABBBDFC31044D0
+1FE3AC18207A8FC61A89C01F5740FA3F7CFC8D49112B7FFC19F2BA59D6DF05D7
+5AB7D55FE544054C8635C929D0702BBAFFAC50ACB64DA3F63CABDC61C2557978
+E74825CAE0437E8427A8DADE9AAC047D6658E82F026C7FCFC431F63C57E6C5B9
+24A01128CC41F20C97013A91DEE9067730FE9407B55DD9005F72CAA49D0DDA0B
+249BFA6D8C35D771962E97C41349450AA29ADA7BA845E5EAF2C768B792A75174
+40636E3D95E2A3D91A6EF46464D6ABB8C3E2591105B237820AA9604CD240D7C8
+E3627FA0A2721765594AD6F0D30CE8301F98BB2A12476C04CF1F4BDE3B283AE2
+4808A54C6A11C8DC108EFBACAEB1B4FA156AA6D5D86D59C792AC4794FE8F871C
+532B8B1ACD0A3F311BA9EF20AD5FBB1145F261ACE9AAE3413DB50E52B4193EE7
+100B5C2DCD2F55C09DDDD660FA6C9535FF5D156CBF5B4E059A910FEFCEC88183
+DE548520316BC3AAC078219F586B2A9B3F41FF9E06DD298B3E68A94BE2D1F549
+2355CB62D5613EA302F0DFF495606156F901656B31FD869A58DBF3A74184EFFF
+4E8CDB3D82AF442CFCAC607F9AFF2B08A78E056DAD21055146263866BE427DC3
+EACEE82E47F5D9667666886E4F632436D5E106A9D7D5F9DE5E68E6FE5899A088
+76F378CA5F0FDFB6409A03AB86A8478A365E03A8A36514DC9BA44AEA5288605E
+508D52B4D5D8C2596DC46AF08AD67A27B5488A82F68A9E19C942A05C6051D70E
+B2FF4C9DCA88090A889AD495E1AB8605FF22B3357A4D4D7653CA94C564998FAD
+CB939CC407062675DAC01FCFB913B23F2C5F58960857BB71F277501A383661DC
+55475E59F8A03756E1F1C262F86EC033D6E38EDE7B371964E362623FCE4EEA5D
+A5D7E5D391F659DB54E4493B2CD7A191AFE003F32D11691242B71E6F488FC2A3
+9D2CEE3F1E510D5C8CD29F17E0CAB752D6A289B104BF0D15D00A067C637CDECD
+5A76505157AED710689283D13A26FDAC3C4195BE445642A1F10D4361EC4F1CCB
+0ACC17F2B3C8F3AD55C60B101963BDE830CA2404815569716D4E44A90AE573D7
+77FEF341562CA292A02051EF0ACF1783C3F236BA1163AFC9D5D7E37F9232B1B5
+435C6947D847D4D4B5A1B832C2E6A98BD76DF46E9D689E1E9D1EB3084D04CAA1
+1F99FB5583991382C4E2047C1F8263B5CCBD503DD7252948903F8750D7F64C28
+19F21B65A3DA880CE80F725DC11A286655E8D6B5D2FB9DE29C1B59AC3D392889
+4BFEFBCA12BAAAA42E5212AD6834797ACC24BBD09CCFF0F996F3DBE3EA5002C6
+0A4BF26026A8F5F38E196E1AC53480B8817937844805F91C8FF51C1F7DD71F57
+91413D8674BF523A77E7CFDE9F5BD09DBDF51DAC7A03EE3E3823BE01A66DAB9E
+51D00782FDC7C1760A786E0EE6A0703D708DBBD1E7B59054436DE4FC7314EBF5
+AB23594247A5A38D7F37A051BE2E6BE21A56893611570CD2ACB2DC768DA44BBD
+D8D40D5729591B8EFCA8E6
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+cleartomark
+%%EndFont
+%%BeginFont: CMSS9
+%!PS-AdobeFont-1.1: CMSS9 1.0
+%%CreationDate: 1991 Aug 20 17:34:24
+% Copyright (C) 1997 American Mathematical Society. All Rights Reserved.
+11 dict begin
+/FontInfo 7 dict dup begin
+/version (1.0) readonly def
+/Notice (Copyright (C) 1997 American Mathematical Society. All Rights Reserved) readonly def
+/FullName (CMSS9) readonly def
+/FamilyName (Computer Modern) readonly def
+/Weight (Medium) readonly def
+/ItalicAngle 0 def
+/isFixedPitch false def
+end readonly def
+/FontName /CMSS9 def
+/PaintType 0 def
+/FontType 1 def
+/FontMatrix [0.001 0 0 0.001 0 0] readonly def
+/Encoding 256 array
+0 1 255 {1 index exch /.notdef put} for
+dup 12 /fi put
+dup 13 /fl put
+dup 45 /hyphen put
+dup 50 /two put
+dup 97 /a put
+dup 98 /b put
+dup 99 /c put
+dup 100 /d put
+dup 101 /e put
+dup 102 /f put
+dup 103 /g put
+dup 104 /h put
+dup 105 /i put
+dup 108 /l put
+dup 109 /m put
+dup 110 /n put
+dup 111 /o put
+dup 112 /p put
+dup 114 /r put
+dup 115 /s put
+dup 116 /t put
+dup 117 /u put
+dup 120 /x put
+readonly def
+/FontBBox{-63 -250 1027 760}readonly def
+/UniqueID 5000802 def
+currentdict end
+currentfile eexec
+D9D66F633B846A97B686A97E45A3D0AA052A014267B7904EB3C0D3BD0B83D891
+016CA6CA4B712ADEB258FAAB9A130EE605E61F77FC1B738ABC7C51CD46EF8171
+9098D5FEE67660E69A7AB91B58F29A4D79E57022F783EB0FBBB6D4F4EC35014F
+D2DECBA99459A4C59DF0C6EBA150284454E707DC2100C15B76B4C19B84363758
+469A6C558785B226332152109871A9883487DD7710949204DDCF837E6A8708B8
+2BDBF16FBC7512FAA308A093FE5CF7158F1163BDCEEA888D07B439DBD4E8B4C9
+D198C0387612A3C669D6A672BF4726B90213C2EC063317A043B6447FEC896BD0
+598D0AA1DDB874B7D72F3E89529FFB544C16C41F04AB6972093A91C201589D61
+A8FE417702E200FC26E47359B881D02F7CB42A5B21F90424F82FEFEEC5ED59F6
+C48895523098D73036537A54639526839F785D7157E08DDBCD96AEF023667FC0
+1921070EA097CAAAE9E4E9D5D21DB9363555AD932858E23A534F7DA9F2F0E79E
+9D46C0D5EDC452179B6A328A52412F2FC548B03A056663DCE243A441EADC0D63
+8FF6D19EEC71606A368EC3EF1DB8FA9117DB6169ED3BD792D9AB2811378E50A8
+535232683CFB2C5E0F3C350CD294AF9804B7B88FC848D962819940AC88247756
+BD1EDE31C397076351447974F91BA99BF34081C1A6C65879C36934E1494108BF
+FA61B57E3A8154D7CBB6AC9B671700FE227AECF9160145957A2E629C3931CA4D
+42147A6CA42FE5E0947DD2EEEB0A640EF9C73800A59F0F0B6B75C3C9C863ADED
+9627DEBC218141FA414913611061B3EBB46AA393CDB074A40492FDEAD1207838
+A13CA709C2CDE567B9688DC5D4D622ACD752A7D6DE3F79002ACDA6AE41EEC084
+BB1D3C962725E1AB05922698C598FEAB0D02ACFD97CD8BAD811193660043AEEE
+659C18DADD0E614A401FA0F0A485AD4A47DB73FDB3D2B294145FFBCCB994FD2E
+68B4ECB3364B377FF6243ED93921F3B3DFDAC3CE9CB3E2B23115BD45FF1F6734
+70DDC37F712D78543A8A8A561DAF3303DD8F3742EB700043207D04A782D94952
+1E57EC7E5858AA91F07524F2EF2A129D38CAF8698126B8981537CD4DC45AB99E
+EE571322DA22745F552675C785D0A8898ADEDD5DA7388C11DF0FF66BE7E92BBD
+1C4C12384C846EDCA0A9C9B1BA65A359D7125491EF9E303D9D4A631F28CA680A
+9BEE19A2C94FA79780F0B335DF137F5C83F7782FD1690BB95914E05459AD4A98
+5677D92FD08F67CBBF7821B85D2BAF5B4815F23E84BE20CCFD164982D3BAC341
+C9352121A211BD05D6C29DC5392CA4375B76B27BCBA2446CE1EB993E36B15032
+961232996264FD1BB33B30497B8C147F2F43B7568F81AD00AC6E1B0239E86284
+D08DBA2675ADDDC720358F1EB3E0F336F410C3D4DFD9E7446301021CFA70FDB8
+E9C6B5BE74F8D61D5455B2EE1166C213F5F0F6EC15FDDED55E34376343DA5C9B
+3AB89D236927298ACC5757401935B4DAC7628D589D856DEE7129A15B12F2C475
+3CB41B148A844F25CBD6B2BD379B9270F8A3B70B298B3A0DB6E4F740CE2AA588
+E48C42A93A3D7874E7941C00DD83412197C7FEE9FA358E34D861B867197BA4B3
+4189E5A07DD388865EF1215E3F6BE9C41431DF9E3BE3987223017D3ECD3765A2
+E0D5D975D397D8B659236B38209EA78EB5FDF99E015A3759924222127B0B024F
+DBC6C37130CB9E0DD6A2D5275AEDFDF6EAB97C300314347EC8416912B53E7E29
+7F5C6BA69F3F3E0B3F51F5E5377A1AF8A0CDC0E4663A4C63F8243AD52E11075A
+A0A4D3E1249E0CF305CC555A5F8A41A45E9B2C8669818A2C8A4FFA900938C84B
+A741521EBC8AE4033833C500E941F6218501C43B3C77F28373FE592A738301D4
+AF7D0445F73E4D3B3BC9D987EFF0BFB6362FAC2B5EBA288C7135A60E5DD21178
+29863606F33DBB34436E76815EB4B21DEC4ECB639DB4807163F6AFDB07C6CD6B
+A65076EB85B0F8ED8BA9340209A40F525B12936A944BBA0A374483F46348B561
+D379DE9EE8016C3B796BDF191EFBA09073C25D951FE3CC06DFAFA06F3504BE8A
+00BCDC72F3A58574DCB7BFBE40D88B03ABAF1B454BA2681C58488B83EE79AD5F
+7D65424B56A659394F0331F963E606C8968C471E4826D2DBA0017519EEE7EF45
+67132A163DE602CA8D84324FF1821B24B79FEFF75BD4B3BD16DED1855EB38664
+042FD460B88736A644009B41607265C14E2BAB80A6C040144F09C19D098F242E
+05B5717DEB05D59971CA62C08998DECF3F90797B6DCF887D2475CB772D4890D0
+C2E92137CAA6220EAE1CECA27B8E4BEA0171095DAA29D52B64669EEF7921F72B
+54958972AE86DC0AD1E8DA6549294D266D04E5A4C7ADC3585FC2CEAA434B0E3D
+23EA004C3EE2BFFE8BE2F3763F0491D5DD55555C5E595A819732DF35BBB58C66
+23673473981C2BEC968BC0812FE3976B2A466463C4EE379653819EAE2E70D0AC
+69F2CB2679D0C9F0EE3B6DABA5A86CED1043A687706F1EF27799610C6D8BADC6
+B8329BA52E747369A5BD82077AABA51F1E824EBCB70C0A6C2843A5ACD117BE81
+CE7BB216CEC9327937D8D2CADED61E5B15F01E3CE81AFC682518752667AB0A97
+C5B34C20E88F44F31C28855F34D148FAB054780BB7B6ADA127C4F91B62DAA353
+FA5E58E8D52C6679C691F96DF195A789BDC1C54C35BDA26644AA6D20B14C68D2
+FB185A935228DCD9A770F2A0B99CE7B8C2CA9768BDDF8B710CD5649D88AFEE96
+37F54F9A15FC58EA003FAAA29A885C7B39BE267DCDE3243A14E0E5EC8A76A500
+BFB9D89CB3A2921396028840BBE8CC9D5DB3B4B0F1A6C9F6E64A9F776D8E3B87
+110051327B7267F5DC31C042613DBED0325E462F6AD1651E198D17DA58E92D2F
+CD15A35873FF27D637CA27C44C4967FF13454618392A495D0E818203310BD1C0
+00AFB1367FD358CB8183BD42A453F2F235B29EBB921F64FC38D4AD92019051AD
+B4D5895837D63CB80D91AA99B1EB9E1296E2B128F2BE54D2B858591A33009427
+9BCD83F6BA87EA1D7D4FA049091A9CC68AA48A0747B1D9584F98182B894EFBF6
+F56B260A055B89B23872EC7450C8AA0833C79F1410A14E0823BDCC28B53C79D1
+0EE8EB0282C6FF8503A7E1BD3150353BC07CF0C48D91E923DF716232353DEC19
+DD25F3F8D8A900E5155AAD27A5F5B54675EE8C80E46D90750F786D927D48E6E4
+A61748D90A4FC77F3B5BEDC6719992D96157A47D3F2B96D465D2BE05314002C2
+ECA6EDAA78BC8B7616A70A238D911058AA8E8E261B3CA973DA9611D7E7073470
+C7B73DB29E41EFA2FF4C50CB4891E3F26ACE04017489766C59660BC70FDC84EA
+7719D0A97E82282FB5BE433EA986FFE7748218430D6DB87EEC06C93667587A3C
+878BF224ABD7EB015188F9469E7F8CD99B5E8FA42B428205ABB4E256598D224A
+99E5C592FA9141C3AC14BA5A9294AB06528725CA03CC3F241CA883C6312325A3
+378B145E83FA6A541EAE67B0134A48A6EBF829D056B7D87473519478DBB88C7B
+ED379F546EDBA476AA4EC867D844F505E1A49D07947B269722E05E1573B347E5
+4B8847E427E98E4238F3B6038CFEB456A311D31E3B0B576ADF7EE1AD90B3C7D8
+6EE23CDB63197AD51D5A1C041C8BAB75872E5C600036BA92C43048F1D445E9FD
+BC3251E6C16AE952B94D3E1F8E0BFF8EA1B02164E98E8EDEE02FE883A23CEA26
+535CFBC2F3F1033C2B1AE779A00C0A09C7C8390D173230F6791C62EBBD490644
+39F1777370FCCA1E047355AE31152D1B60D948E8C69EDFF8CB69B517DEB9ADFC
+C13934D807BA40B4ECEF21EC927A6BADE45C274F6D8BF3FE88BE317202BE9509
+5814ACAB022AE73A4685484E219FE315D5EEF5A5C83AC994CA089BE0A62324BB
+024EA647CCD0882A859BCF49072DAF3056474963767D2B2565408DD3FB0F1C5F
+6C9913FE1128B890A6E316F35ECCE664C35FFA22877507F6181807BFD6DA7B31
+E596341CC0D5838A5B9BFFF306D06FF82E2B6651C520E3D19F2D7E68AB458F3E
+AD9A57FFA1181081D295DEA3B27468FD71637D32EC24F9F7073C2E65431D8346
+C8E651D58EE2E65D0E074BD6B0EA3DC6317FF7DDE745FCEC36296EF9E9F26300
+FED3B5C00DFB3072CBFFBB4B38C4DC8F8CE01A8610E282995566809C29E8A28A
+332C90DB3067246820578898C29F6398571A9549A826A8BB4F7EF44F78389964
+B66BF6B1B190A026C580DAFCB182CFAE42655BD7BC81BD7CE44FED8C0A4A8A63
+887FB5FDC43D9AF99488DD0042844D104DAE02E2B13D922DC8EC45E1AD302F3A
+B0DC409BAF32F5B0D86DB3737A2267A566885DD60D1C98761EACBA1EB8A5146F
+38E8D163E9595D7C29AC631D6A51B02F717F5799FBCC74A516A0FAF1C2BB6418
+03F0AB076B38400D2FCF9ED5F708568F096A8FE9B0A9FD1C6F69462A9E4AEB6E
+3912921BAAFB148B1580056FFF62E1027B36CCA94A8DAAF0273293AB708DB718
+BA3969DB95598B0D6F38A193B6C131FFF4DE5C550C0B6E036F28E0A1267E38B2
+42EAC867A0CFD76AAD66F2FA354EE065EE4B163A052F1FAD7FEACFC5DDB29C6D
+EA866AB625228F7194302FE0D951A71AD7C1FF3DD15B29D109AE71727FBF8537
+AB3DEBAD2B1FD62188F6B13EF4E321205E952B96D8F5D2BA77182FC8CB078EAE
+BBAFBDCD42092D9D1C8ABF44B4BC495BC06A2B712EDFCFF21ACF26F4847E6E6C
+5F7D06CE8411DAFC4DBD5A2DF261FCD159385B2955434FFBA14EB1F0D95618B2
+01AEEB134440117D30F52EAA048235FDB3C6DFC747AD83FDB2497A095A32E8B3
+B606F151777C27327839A6B8A272AE75142E23B3E19C3A0F358ED76C7E20D958
+91262E30B759BFF6B334D58F9898971AAEAB659B7C7B8ED35A290B27811B4DAA
+6064
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+cleartomark
+%%EndFont
+%%BeginFont: CMTI8
+%!PS-AdobeFont-1.1: CMTI8 1.0
+%%CreationDate: 1991 Aug 18 21:07:42
+% Copyright (C) 1997 American Mathematical Society. All Rights Reserved.
+11 dict begin
+/FontInfo 7 dict dup begin
+/version (1.0) readonly def
+/Notice (Copyright (C) 1997 American Mathematical Society. All Rights Reserved) readonly def
+/FullName (CMTI8) readonly def
+/FamilyName (Computer Modern) readonly def
+/Weight (Medium) readonly def
+/ItalicAngle -14.04 def
+/isFixedPitch false def
+end readonly def
+/FontName /CMTI8 def
+/PaintType 0 def
+/FontType 1 def
+/FontMatrix [0.001 0 0 0.001 0 0] readonly def
+/Encoding 256 array
+0 1 255 {1 index exch /.notdef put} for
+dup 65 /A put
+readonly def
+/FontBBox{-35 -250 1190 750}readonly def
+/UniqueID 5000826 def
+currentdict end
+currentfile eexec
+D9D66F633B846A97B686A97E45A3D0AA0529731C99A784CCBE85B4993B2EEBDE
+3B12D472B7CF54651EF21185116A69AB1096ED4BAD2F646635E019B6417CC77B
+532F85D811C70D1429A19A5307EF63EB5C5E02C89FC6C20F6D9D89E7D91FE470
+B72BEFDA23F5DF76BE05AF4CE93137A219ED8A04A9D7D6FDF37E6B7FCDE0D90B
+986423E5960A5D9FBB4C956556E8DF90CBFAEC476FA36FD9A5C8175C9AF513FE
+D919C2DDD26BDC0D99398B9F4D03D6A8F05B47AF95EF28A9C561DBDC98C47CF5
+525003F3DAD7933EB57E7DB1462E9D906F6D8F5BF740206C1EC5F36E00AAFF68
+F3EF6F3A2540E5F9564D1C215BC1E7E69C7D04DA5DB1CF195613C9CBF4BAA360
+84AEF3E10E24877FBE36AD731DC97305BDE6DB1F934909FAF60B8E28561FBC57
+0F5B6225425BFDE8F0C71CD4507B82FF803E9A301397975E38A259DE1E1B4FC0
+06BB1DC2D45B987A2268A77CE8DC025CB0D1B39788BBEE149103950650171C94
+5FED1063050A90BD38605BD9365D1C2AE42A7DA3DDB9A263FE10BD487F63D908
+D4F02758BD9D7BE53E6353A25BEFA29E42B50C1D078A8B3A746EEDB381CCE36C
+93FC4BD1A8D1D6ACD0D355E948CFE397B74D243EB51597D251D0BAE6884D70E8
+FEE119462E1939A9783414DF59EEA5FF1529F13869D1FF0A44935C5198CC5DAA
+E1FD2A17AEEBF4974052D06734A409E26C457C06700C55896C90BB33E044A737
+46590D9FA242819B9527FD59818D8829D4EB2D26A34CC05A2CC063E66F2DF193
+8E4F9670014BC243180E45B51DDB05AD1E6A7F619EE1CE09CFC1A4F02CB7270E
+4482FEDF673EDED38EF3173C475C34BFB3F6623C5E942A7797FEDDD0EF1D54E9
+1D90D7076C0A9687E334907C22F2E7C603388D8D626B0E5A62B7543DCBB575D7
+9A6BE1528EC9BC18570001092524E4FBB02F3B29293BCB4F0EF14A2DD9DB22A5
+BB33455799E8120D2A4862424AA4A382972E2845E042506FC8F6E201D11DD0F2
+09FAD8DC29C3E12B66293ACBFB13FA0F26238981F2CD52B47A8CDE6DF5CDFAAF
+3113E1A6366B806EABA9C34E5D41167CD10D7B639021FB4CFDAE28CE72A93F3C
+E8929A4803AA3E45F388F65179AA988898B7B7A825026543A4D7824049DEDBFE
+DDE9F67DB6DBD5B6459EEC30F199A2D5D55C7E054D42914EE2E2DE4A51350C6F
+0B11455F19EB012DA63082F568236CF01AEBE7E5248525DC880BAB20817165C7
+1D4E954FAE3EFF315B0A04C50FB7AE204A5DE55925C8C8299C4E491D11451999
+5A05E67B818715504A2C0BD8D4632BBF07220B06D8334BE9C0E561912BDA6AD2
+EAA44A822DB0C8C1C6AE167E7B247658DE705086B0079192E96EACB9F0224C3B
+4671549470B819BDA2A447F75D73DBFDC744062532278F61A5E3FAAAA006D5ED
+F0181E09F59BB20B7D54E6C084DEC0805EDF64A5AD1DC5192A18B6530636567F
+BF2BB9986BADCD153931E82A4B73C70041F6A0A0CD3EBF4FE0C657AFE1274A91
+C1B5589D1FF64191ED3F33A28F159CBCDFE347F85CEB9EB301CB9CB4E42B4F6D
+5CAB5E07F20FDB0570935D1AF223767EF1DA1F36786E28CD8B9D0A73F697
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+cleartomark
+%%EndFont
+%%BeginFont: CMCSC10
+%!PS-AdobeFont-1.1: CMCSC10 1.0
+%%CreationDate: 1991 Aug 18 17:46:49
+% Copyright (C) 1997 American Mathematical Society. All Rights Reserved.
+11 dict begin
+/FontInfo 7 dict dup begin
+/version (1.0) readonly def
+/Notice (Copyright (C) 1997 American Mathematical Society. All Rights Reserved) readonly def
+/FullName (CMCSC10) readonly def
+/FamilyName (Computer Modern) readonly def
+/Weight (Medium) readonly def
+/ItalicAngle 0 def
+/isFixedPitch false def
+end readonly def
+/FontName /CMCSC10 def
+/PaintType 0 def
+/FontType 1 def
+/FontMatrix [0.001 0 0 0.001 0 0] readonly def
+/Encoding 256 array
+0 1 255 {1 index exch /.notdef put} for
+dup 97 /a put
+dup 98 /b put
+dup 99 /c put
+dup 100 /d put
+dup 101 /e put
+dup 102 /f put
+dup 103 /g put
+dup 104 /h put
+dup 105 /i put
+dup 106 /j put
+dup 107 /k put
+dup 108 /l put
+dup 109 /m put
+dup 110 /n put
+dup 111 /o put
+dup 112 /p put
+dup 115 /s put
+dup 116 /t put
+dup 117 /u put
+dup 118 /v put
+dup 119 /w put
+dup 120 /x put
+dup 122 /z put
+readonly def
+/FontBBox{14 -250 1077 750}readonly def
+/UniqueID 5000772 def
+currentdict end
+currentfile eexec
+D9D66F633B846A97B686A97E45A3D0AA0529731C99A784CCBE85B4993B2EEBDE
+3B12D472B7CF54651EF21185116A69AB1096ED4BAD2F646635E019B6417CC77B
+532F85D811C70D1429A19A5307EF63EB5C5E02C89FC6C20F6D9D89E7D91FE470
+B72BEFDA23F5DF76BE05AF4CE93137A219ED8A04A9D7D6FDF37E6B7FCDE0D90B
+986423E5960A5D9FBB4C956556E8DF90CBFAEC476FA36FD9A5C8175C9AF513FE
+D919C2DDD26BDC0D99398B9F4D03D5993DFC0930297866E1CD0A30EB76029337
+900ECFB1390CA5C0C3A04528044F266BA17BE487C79B94FAC6D6484684C5BFEA
+87BCCC77D40AD11552035E95E3007126418ED49B68468B38A14E88E68A267B98
+076F1C9769A5AFBC285E5B158EAC9F926F1D6C0B8F1D57D9C31D25AE27123518
+9D2CD92E5689E0213089BD268DA5E47525CB8EABAA4B78A15AEA34705889AB3A
+FFB8953B5B3482E52BFA0940630ADF8C0AC2177D907324299EE980E850F203CD
+B627962F43D5A678C44243CDE97853BDC6AB45FD5C09AD274DAF89929F583CC9
+CCC24BDFC68B92111055ABA5F26D2DC67C70906F71C2957701D65AE746A60C30
+40E6CB24B97FCDAD0487AE38A201FBF0E41BABD2181981A71940F1E707F91E5D
+C8CA50CB16D8702D188E56D014D92F76CE0B52ABDB9110E32438D2BBF3E6A40B
+7B005F10BB437812CAC6ED2996F7606DC962C4FDE207FF322782C343DF44CEC5
+FF06A55C630C20E9AE1B0D1C5673753C43BA0767D65D1B451CC6380D8BB3C4DC
+81E8FD8AA79BE993218686F29D3CD925566DD587F541A0DA1B1CC3BCEA2E6C7D
+5E1016F6917A871F1BBAD96AF9E867735017119A381FCF33EB2D3E1E7093FD90
+CDB0CED4818CFD9E201A03430CEC713620BE0D3254158931FB657C6877C1B3D2
+24030F377820DA58F4B95CFE645109F3F1B80DB5FACFD7D05AE2909EEFCF95AD
+9CB286C8B6C075CA2267C101B736139863186C193E31085E7C9FD88EF8BBECE3
+933542C85309013325B4BBFE9A5B606780C8580ABDA2F5D0064EBFC23939B307
+08568C3B7F5F053BF367DEBA349FABB9F760C44D100BDEEFBB01F27BFC61FF7F
+7805CB7BC8197F2EA913834A01BD5E7C258339BD763A8ABC6190546815ED3030
+31D047901F10493240CC0E050D161993AE0C5D93E5234F192E6DFC857D9959FF
+D52A1B7BFB5C32EDE6F88A0BD199BBC268275D7DA5ABC6A5AE5F493E926154BE
+8B565385529C5503F449608BCDE0EA72C563DB6FBC73B4210BE5F0889F67FFDE
+CB5A3F8AFBBC9D0543F0EA5990A3FE0B6ED38901C076AA3C4DC17B56C3BF2D61
+1816B02733E567FE49C481B70C89F588398435B16C14EE8B3A3356688D33993A
+461184FF8A4B4CF636E6EACDDE6DE644857EE40D246BCBA40E766648A0AE47EC
+70C1AFD022A001939E329853F8A9A5EC2ADE6BAFE60F7C3AC991319694E19760
+47F895008A9B687058563FC82CA54A839430D9472D9CEB04CFA0A53F3640CB1A
+B4F9BE4B107F6EA51F02A1D59E88905939DE5F54CE34B9F8D9BE357ABDB89FE7
+B9985D06DC67AF6703240E2799ADAB95969B795F4B94A0106E1CAEFE04BE122B
+6E3C97F56B388C108960A2778A04BEDAEC94856474B1F4135327B2405D21D7BA
+2BBCC54A44451B8FFDB4E221F232D86A400DA6DA2689B924F8C182365A440E9D
+4F0A134E6CE54D5B189D282298F6A2D80DC4DD08A769741117AB259892FBBA2E
+E6E8CE33D3ED35716E45C66F0F36894D38FB3BD1E7328AA079B03CD2F0BA5686
+0309C95C5A79A4B2441F7D8AFD03E7AD05287DC864406AE897ADB1A5A90F7BAD
+F1E16476D2833481592BAB6DA0E618CB7EFA75D49CA598D09E62366C69EF4E65
+1A40AE605A73F44CCC03E2983E6288D1B9A415AA796509221DB597EEE3E05F11
+0BFCAD80321F684D4E809D3DD426050A5DC0F106181E9BF5270398EFCDEECD96
+2A360CC839812E25BDD4E200171B6B7DD3D023A4400F424DC2DF65BD230BE23D
+BF415BDB1F1D3076465B0F1C9F8453B9C9E89ED99E95F9F56C9C0FEA85F14E0E
+998216892B5A6FF3ACE42E1BC482538F983700707090DA082A26162A81F74159
+5EEAC65AB8A714A7175058869C672ED96692BEFC42024B3413871B5490A3564C
+2547C680688678D11FE6C7AF6488F144418A94BF7F72AF4E73A7E48121E8D142
+0672F065C1043B03F135BFC42B8C2DD54733448DC4DAE9C70DB90C2B4CF1E2E5
+D53024F66F4A7F13E686017C44540285BB6B3CD402124671CF5D889723D712B7
+D5CE13B9A7B05985A05FB7D86C43841F60B49925E56086325D5DB9B0D3142733
+9C1F10CC6517FCD9C2AD4F43EFC7DF8F2DABFE08106AC6A23F094016AD479FD1
+E73AEACAA55DA7BF0BED42ED68A61EB26A519BE0D9A07808FA20409F0764A858
+75C80681D5EDC360448E13E10481CD830B73442A38BA548916D4C4291CA92908
+5093823AEAE5E5B74F625610CFA143FBB3E564EA247BA8AF818C48D19BC9CA7F
+FCAAC3964E2C581878240B7FF61A8844241541A380AD12A6F64F9294903A1312
+F85A6B9F5ED7F3F00865A96DB30EBB1EFD12FD53103B5BA06816BF93560F437B
+AE160D17B284018487EC32F4F728CDBB3C46C42890C1F30A44F2E50F612C5EDF
+177CD509F34D92CDC4DA90AB68A13D1EEB6037C49A6CA18500283F2DE8AB50CD
+B06D73086823988EDA17D3EC082F2DF1051E439CBFC6C5E17B8A92BA3AC30E2A
+327D991D1B300C37E3EB5D07AC22B36B649D5C62512E74527816E83C06C5B070
+CB91A96E896EC0A48E4C8E8ADD8CE901EF08D5F7A6EB6F5FD7F11E816F92A7B1
+CC1381358B5071F448983D4CCB9BB339CA1B7BEDAA7421188AB30EA8A06CDF16
+D5AD3514FFC3EDD162C1503F9BCCB4B1BA9A56F67AC8BA973565152763D7FC3D
+C57C5423ECF69E992CCE0009298DB194AC94B93A1090DD9713ACAB2309C1033E
+91B137F08E9F90359C8A5126563FDD60F7B56DDC44DB5F7175D2F62BD7243459
+0B39C037AC96A2723D08316643BB897A58C513582DD39D2E82097FE7CA419F69
+70FF028DB97C960A0689A0195214F8A48DE678EF46A31FA1A16568BD2FE1CA7C
+3FC1AAFA0CD5CE930F09B3D937B196AB9FD92FD9B9DDCE2A2F346B51501DC289
+5059EF1ECE2EABE14EFE52C536C02983882CC45A30A0D3779363EFE30AC6B8D9
+2E946738BCF822B9F1D9B01BA5B576444B38743DE1D5A560F519CF6259996CCE
+4ACCE61BFB98060D81A8C8E8C1C18C20439E095CBD615F1E42A26961621E0BBC
+A165F738559046606915BE627C49F70D47DF03E7B5E0C66D37E91D26D1D436C3
+88543FCE8AC6E7A421DECFBC6033000C381059B9D92EF8F020BC30D8F0FB6F3D
+DFEDEAD02AB7B7BC9A71E97BB9AE48F4D0EB78C4A469228C783FF32398066856
+F997EFD29F5FD6CAD1A5CC842839C27DA358E8920BE0E54184335961CC1FA929
+F20451CCB96F54411F887C9F0C69A7FCFABB33615B411FB70C8E14DF17C8D502
+6A43EB709FF78645D0C7371023BF1B2D5FAC19886E847D1CD77A85820945336B
+B3188A636364168C360ED0DA052F0AF755BED72180C30FF1E873CEA718797FE7
+2B7928F9D75E2E1F365BC37746978E3B5ACCBB9885B909F440AA37C00554CBAD
+CF259F68B8B903707515463F26F9DF74437C06B855341D0AF86BF1145AC2CDC9
+F5A9EAC3B466A11BCBE24A01352007EC4B8CFDD06933C2C693EB8045CD44AAE0
+0B30564BD87D4E008A8430723418832448AA032BFA2C8BB58250D47E21A5D0F3
+63ED3A8A32FF02C577406E541592A2A102E9A34C3ED6473699435B4674C0B13F
+F2F0F501B8613F531ED845126B25934DA27E9A9CD1653A3E91E4CD11C7BC0E5A
+B885AE24AA2E4F2C65B47ABF12BA8668EDC0507B7CC78BF22B74C71576358D32
+BC05A36582BEB7BB063080C0AF99831C56386C4F4C03D07EF4D08F4F9DC62CFA
+D8AD11A3D238A675E0F3EF998DA004A2402D9311CF9470C262536A254FF2CB75
+4A2DB7768A658C46D91B6B75E6C6EA1728E335046033F2162095D6987487CAF9
+ED9E59B2F7F0F26C4F9FFB5AAB08FBB26012A06068EC33C1878590875E186BDD
+9DBCAF60F211CDC49C714BBBF753A71C2D3B201ED2CE52199C4B0DFBFEEFE8D8
+59304B9FB2C34A27E7729DD0B9E5CBA9B3C4D4C9493C5BF95D47444F0A1A5BEE
+37FE8E72B1AB7100D113F5E864112A636D938F5581374989481F54DDACD4423A
+8843E7FC0ABF41539E5996372B3AB11316EF82242F0007D9805143E27F54FA39
+76BE4C35056D6DAF89AB34E0163ACFC22E9EB42DDA0FF61B25A387072B75ACC6
+FE47A8E5AAA8520C72A010F2F47BAB5B4B33F9F690FCD51D1F39257DAC914CCA
+D504970715AA7DED193127EDAD46CB0DF2FF500C7CF5E8F6C7B540464B6C5CC4
+7768279FDADC7F46CE10653E5D4E6ED5810758A373B78168E33D0EE6FCABC1D7
+D3E34FB99484C66C5F29C45B8350F5351E1D9151BD3C0FCFEA5DDFE693F84683
+8A06916B8A5737F06B1EF3C9160307103BC5988308B2A365B522D57A92697D24
+85BB6D66F2867EBD1BFF17E90BD8069AACD9AF68BCE509C5A639F405F08668EE
+2E02F59914A6A5DB60E3C8AF327AF9F99D893E87A2402C21F2C5B94A6F3E5A6F
+F520625B3A3254870F671E8B257C449EC569FC7503B7E65AB60AF3388A4FC04E
+940A388F639B6C499E2556336634D2617221B59E340E25BCA85DE7DEE2289B87
+B376261BFB9052D661CB6AA2EA5E93E1CCB06BC335B029FD15E7CE25A3F8789C
+A5D602350251B34DB33E6DF4AB402D8416E37037733AABFD54E76B32A4670FD0
+437F259AC856A71EBCE160C904094112C66999C987B1A4A56AFCC777C29AC013
+D38927305DF4DC631C8988F1867DD3471C73492F064E61A596BEADA1970C117D
+DFEC15886D649F5823EB21DC3C27DC4EA34838FCCEFC0F5E0A4671F42DE1C4E3
+FE22B07CDBA0D38D11B2B9829F941BEC1DFDB6FCDA0B2908995D81919321A387
+B1E3FA1A18E94ED7EF1101BA447FC70CD8330AA8CCF96D4AC894416B87B83F80
+5ACCA40FCBD3A2EBF63461489CA815EFA95DF5E09D818868E85DA5AE46E87B8F
+6C9DA5ED2933AB1C20CE109BA151958BAE4EE77630B7CB9F4792C5E61B3DFEC7
+AC2D04211EB7F6E3957E1574FD208FCA778D7A71E0EFDCACE657107A136D8B6A
+2667EA661A287256E5BBE24B2C64A663D146D7776537292A07CE2E917A42B9B1
+02C1039141BB2B56FB2F09F0645875A2999C13DC65DC8451F1D12C4A8B4DEBF1
+E9E35EC5CD8AD7661FCE5D444ABACA19F23CF813F0549061D2E7EA7E35B9CAC1
+0407C8B414E63EF708CEC8555D047B68BD5FE8C575B43A9BA140CA2EA07841EB
+EFBBCDEE74E9BDD1D3516CA38B76D7C629E348EAFA9D213E676CE78830B03EB8
+C448ADF95F62B4F44FFD98163E29D6D672DDF560C840D8E48E1A5A043EDA9DCD
+E8F18A1C4604BD8070A5BECF45FD180D7E8392B7388B3A3840492DF3E84F4758
+DD67E769CE09334870E65708855123D0779D8E456D83BBBFEB88481C812CCB42
+5D8773B4A8900BE40F73716434B64FA1FBCCBF14491318416ACF01CC4E504519
+97F40DE41641BD5D07A28CC6A2BCC215C537B8DFE27207932AEC414DE963C094
+D448BC399CC670FD75B9A763270EA5B68F21A99EC11AB318BE0A3C916F360CAE
+68A515971A90C90FEF468975720C2D34538505DC6F897FA8E0DAB77A2E3475ED
+FF6AD9A7E368EF31DEB96D46C4598E89ADA3D1E7BC32FE65B698B6342C4D5CB3
+B69A3AB3BE8A5096506645C56EB9AC6EBA578EFA3AA9D33729840A56C3BE32D5
+BFAFBD628667F012426B0C1B6FC85A1965E162721DC43E9BBA916950DB57D035
+9FEAB52DE343B9FEF70450C80A3A6FB1A7E458AA23F59D551F71E8A999C50E28
+62B7350C4EA8B42589A569C8A1593153F3B5C7625324A961CF8BBEE053184AC5
+4347D8D6120DC98945819C450334A845D58A39CF4008AAAEB90CF7CE528E59CC
+CA6D0DCF371ED4B1776A9B937AC01B2B78D6B8146E319D00F90495C53F959D55
+8A9CACA14345CB761D628C516D6483C51C138D3E4A0AE67405A8F4368311406F
+9A038B69E4E22FAB7963305FB2C31BA3465DCED45E6487FED57C163C73B9B030
+6ABE458104F1AF09699939A18CACBEA7279EBAFC5F2E04E37B74FD12DFC6BF48
+8075179A5EC31BF0C649CBC654BF7B5DB7BE4147F248F7A965F44C9DD01EE76A
+259B1EBD64CB9B1F7D5C049FB660789CCFC8A6C371DA6D6451EE36BE0950BED5
+15CED86111868CD4DFFE98E40EAB4F2A1D893513924ACA4F9C1D7A02321C9701
+D751C905F0453E701439C660B310A5A8333F6FC9DADE4B5390495060467CB218
+053D31F204E5DD36BE2A6D467EC0CA8E6DF1841A53588BF501616D00DD90CF9A
+B9351B4F20FC2687489AA3B9A7C0CAC743D424D79920D760601C9DFF3C
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+cleartomark
+%%EndFont
+%%BeginFont: CMTI9
+%!PS-AdobeFont-1.1: CMTI9 1.0
+%%CreationDate: 1991 Aug 18 21:08:07
+% Copyright (C) 1997 American Mathematical Society. All Rights Reserved.
+11 dict begin
+/FontInfo 7 dict dup begin
+/version (1.0) readonly def
+/Notice (Copyright (C) 1997 American Mathematical Society. All Rights Reserved) readonly def
+/FullName (CMTI9) readonly def
+/FamilyName (Computer Modern) readonly def
+/Weight (Medium) readonly def
+/ItalicAngle -14.04 def
+/isFixedPitch false def
+end readonly def
+/FontName /CMTI9 def
+/PaintType 0 def
+/FontType 1 def
+/FontMatrix [0.001 0 0 0.001 0 0] readonly def
+/Encoding 256 array
+0 1 255 {1 index exch /.notdef put} for
+dup 97 /a put
+dup 98 /b put
+dup 99 /c put
+dup 101 /e put
+dup 102 /f put
+dup 105 /i put
+dup 108 /l put
+dup 110 /n put
+dup 111 /o put
+dup 114 /r put
+dup 115 /s put
+dup 116 /t put
+dup 118 /v put
+dup 119 /w put
+readonly def
+/FontBBox{-35 -250 1148 750}readonly def
+/UniqueID 5000827 def
+currentdict end
+currentfile eexec
+D9D66F633B846A97B686A97E45A3D0AA0529731C99A784CCBE85B4993B2EEBDE
+3B12D472B7CF54651EF21185116A69AB1096ED4BAD2F646635E019B6417CC77B
+532F85D811C70D1429A19A5307EF63EB5C5E02C89FC6C20F6D9D89E7D91FE470
+B72BEFDA23F5DF76BE05AF4CE93137A219ED8A04A9D7D6FDF37E6B7FCDE0D90B
+986423E5960A5D9FBB4C956556E8DF90CBFAEC476FA36FD9A5C8175C9AF513FE
+D919C2DDD26BDC0D99398B9F4D03D5993DFC0930297866E1CD0A319B6B1FD958
+9E3948FFB3DF7BFF10C9BDA4EFE5F68A8CB1526990D1357AE6D2F7C2D2EF8496
+4E47B39E6712EB8908A3265E5FAB40567E866C244814449F1E993AAB422C3F1D
+DFA8C7118584F2E5197FD4BFA3A8AE9E953C6CD4672C0FF51E41C3A919749C1A
+F06650DF4C5E17492164BDBCDF22609A74BFA7F69960A64B9F949FFC2A807458
+8579366C4F41BDE1FDFBCC4845FA19BBB6963D65EE8532549274BAEBDFF24FA6
+03235D1BE37C06B1938AF369DA75BF38DDBC87A1FF445EAA16E1895ABE9506B9
+211955753E447865D33CEF007391D2666A046277A30A49804FFCED3FEA5EB2C3
+E52EE14A9F75241EA10C91974CDA6236EB840FD44D6DDE4D9B3266C3B99BD38B
+D835BCA8CB819C073480FB972CC028D218F6A1D344CE1B63F4FBF2C826F412E1
+6E0B05A26125865A14FD7B7030B478BB8BC6BC395335C3BA940E1C348267F4F9
+0AF97BBEE253511940F1048E175D3569F7D05A28851B6F50765FEB6C9654FEDC
+1BF52F535DB5BB90C1BD5D2EBF75E0AEBE82B20507F3C28A03746781018D4EB2
+298E4F2C27ACF73FA73EBE43F014BB575AAD516C0407B29E1653375135ECB74D
+C91372F06FA8EF37C31AF3FA48AE65318EAA6C34830A5377ABB2DFA5DA53A574
+433484BA1466709A4B186761655C8E482833B697673E847C691079E7F1DCB8D6
+1AD91101D757B83E2090337D525AEECB028FB3C9F6A6E6AD2F322CFDC5A833E6
+1CE4EDBF41FD34FD61630581D222F854A76C2EA9FD72796A7C9CC1F6C2FCCD16
+E95CA05826A4ECFADA6A5FB83C41A7131E52BA6585DD6DD78515D8F7327DFC6F
+9404F891D1368E30A83178D627B5D720AA3C62C86045895C0F591DA4EF832E77
+71D479432124536C48555EB1516CDB005ADA967EE12197316503FB05FBC6519C
+4291EF4D52231E5CFAC691C98C7A4E12248DDEEA0F315F5A02D8C440B7D4EE26
+EDE6535CAE7BDEBC3421B902BD5F2B2D1FAB2B559D731CF445F929B69DA05206
+35709AFA678B3C3A52686310A04B09CDBBCF9B4A8111ABA59D43C1F771BDCBC7
+3C004D89648F159A33BF70B4B83C0DCB6F665FF677E9E9895365B716B232C4CB
+A2D54A84608DCBB14716EE6C9C2B2F2D9E739602A1EBC5B7CC36B5809579860D
+35D9F75E538D8027A7DF9FB6AAF7B9D6857F40BC2D7158CD05FB51693F2BD7B1
+97E413698DF2C68F9211599956F1E2BCA5DD806BBD8559395264F95E1FAC36A6
+5AD54A8E353D820FC5DAA94270091AF351F4C673477A1156776F87D0A2A5D84A
+F140B7B2B57B29E5295585E2BE0F633A8723D4DFB2DA1FDEFE1EBCAF3D676435
+D1ACB52979355D177539F7414CCC87AB31DF9F4456132C00262365F3631CB899
+43A6BD3280B5B0A28B1DCF813D2F87ABBCF9E9992E5BFF3E269E7E2269D48C7F
+917B69E3D8E698AB2EBFCBB41BA841DC2E465DE6BC8E427B733AA050B64C96A4
+506CDFB4610608DDF23705AC63F0CACB4C6D2065141434335A1056F59DAF9769
+AE558BC27A03E699C8CF4FCCCE085DE5EB896592320EEA6469D153E044A83E7E
+DBEB11A62E3031B60B35FD998D07ED43EE432CA20B0820A738719CF1A2D16FF3
+5C7FF36CB30F58597D67E818F8F7183F7E84EFE612B73281FB669C7955706FF7
+6C80914B1E89B7B0FA74C4249AEFF554950EC0D7402BC7898C0C18F38ED3192A
+A2522CAB41EC1866FF8CE7CA702028F1665080DF61240279EE5745B2CCF029A4
+180A0C8FC0155394C0492AE3723A6F01B6BDA696AACFFAB9D237CA34BD821DAD
+EB0468BF9A5E2641B1D18E60FF82060F93739E08318631424793026E06BC8C41
+59D72208C0D0C6B04352385DC8DAD08F93CC0AAC7AA5151996F6E007A28FBF03
+5ADAEB0CACE68013B2623604C27E87DDEB4DDF1E9578ACE809D0015074F79EF7
+0D45EBCB2A31A351C3F18834D3EDAD68551ED357E9BFFDABA49E52CC73607164
+AA527E467D6467B53778FD7F4ABB1A420AB5C30B3F2F6903A03057A57D7265D0
+77379FD634D61FC4210BADC38FDE28378F47445D32E055A34C372D5EE8D296CF
+E7B7F9FF72C30259CE439E4FB49DCC0E6E4BE9194FC3812510979BA5AF0C1D38
+FA825827FE4296582F93FC3FE6A51E6C4EBD49E855179855368F256732394B80
+0741E98FF23F278F82EEDBDA4E872867DF74BC4ACCD83F1130215D85EC9138BE
+2CB36962180304C8B13CFFD2A9C6FD36D0B4A4B4DBA7F6D1FF17DD56CBEBE702
+656D0622AB9390F5EE3B7D5EBDEDE25D08751A765231A5F1BC3D309FBD9780A0
+6421B8DB9DA4AAD1F0BABD2AD89D4E3F63379563F146EC34B648BF5115D58284
+698CC7DFA6CDCA536C12227D1E3B45DC8F79094D45052ED05A148B1F0954B2ED
+2EC5ACF58658B2854CA8FD4F889FCC92FDEFD0159463C44952F8485057D90FAC
+FE492C1FB72BCC1C9C7EC7A80350839A94AA3FB67EC7B18A47F4F9331BB43688
+9057CFA7879DCE07B340E431DE24521E4F303FD0C46646E924CD5DEFAD927393
+45B657E85E818949A35E29887BA369ECD5939B445D171577DD9729BC80E8AD45
+C9F8B4A867967D8F3084F9112BB2E4251F7CEB16BACD1274EE4FB708189BF578
+298B36645A0FE5351219308F763E6CA7B33FB4331C2AEC67EDA8B14408140ABE
+41411A50D2649B329420517B5A2CD45D4B7AEAABF8BA7562779BFA4D333D5AEB
+35AF710311417CD536D8A2C32B4391520A32E08CA857775BA6FFDAC5B15D012F
+CB2FD58B30133657C2236655045B48B12F3C918CD28272807F60B0E0A9104DC4
+BE36711455DF5E6472F612194909FD5F91B6113D74C75B79E178C1F57A1197D3
+114ED04951C73C5C0A3CD31E22DEAEF4A7BF6E59721F40616639B8C4DC9266C7
+BBB5E0C9F6C81D34544CC9BBF018A1E90F307AAEBCE26433CE6E0D6ADD109C63
+641DD41B8C0B3BD9C333E9C6C0535501CC5FCE726EDAE1D6C6718CD239B79CF4
+52004ABB5147E4E4AB47BA057C65F3CF40F09A3813A921078490A18505275C6C
+A6DAD989596043ADC65CB0F30C280F847ECA596AEE6DC4B003EA6EA6B040537D
+85ECDEE811D4B2F520792B5FB85DDB94218AEBA38D64C67800EEF12D55D75503
+85C6793D55209CB5F40D81C6EE67AA6C7BBB04AC9B2FD7402EE214CADBE34E43
+6ACF3753438657DA94D732834048C102F75213B35EE435D919AD2711EA6DD19F
+6BCCFC996BDA247405587BAED1CE2475263BD539FB781714A62730B8933EC7C8
+165A954E53CA1B318ABBF232E4A638A12E520B767DF92EC865D41190B2451E64
+A413DC0072CA80FA35228B56238EA468C8B5ED3C393577989EBBBB7A2AEA7FE6
+C523915767AF82A902F002F8B033B5B266971818D98B03C0891C33E74FD944A7
+C69665A2A90DDBD92A77C04EF93A2AAC600F188D33D7EDE9AE7BFF09EEF1841A
+B77346AA42ED985260F4037D7B802171E69084C4A1BB8F63817E2359B79BA984
+016DACE28CDD7360B623DC5E4BDBA1B8E3CF857CCC1D0B8D972B026E81463843
+9EB2D889C84B714B8B6CD33D5D32ECFFED6372E8E7078245C4B7E98EF133C130
+6A2C4C9A4D1364A217AF7A670266716867551693DB28F7994E77B98B6CE1C33C
+E0781DCCBC1BB3E7CD4E8316CE01F8803C6E260C275A22A898C51E4AD42C8089
+0631F019BFFCDE94BF3650AC613649601FEB196DE757FB8BD1F9DA8288F316D4
+D67E748019C391314FF9FAF4C8E6D018DC9B57105EF8566F454E851BD3E2690F
+AB5C8B2FA11EF843B6BD580C64DFBC7D4D684A706676E91F171501455543D635
+61E669947F9ED7BF98E9BD9C3908BDC82601C5A78EBA012346BF25094E273F13
+F4B506F8411151B52A30CC711BBD1B34A4F5AAF05B43C2DA888CB8EDEC649808
+A321CDA5F170BB506BEB556F80F0375D201B6FD0CCCB710F86FAD20E27C6EAF4
+3F5C0ECD25C89EC3AEC322ACC9809D1C34547700F2B2E64922DFD4326C521AA6
+FB6E5314B6F072690ABC28CA94B75550FF401491A91CC78CD0CF5E5487B93C4F
+C2BD50FF91D55C46FD91D43F80D74E3C0BBA05DAACD4F3E43F195CF5BB22F05A
+3C85CD5A5D2B65B14D32869EE9E6C06ED0EC33B0222844F226AA6C75BA412671
+9D80A5D77C7536BCB7E39FDD3A4A9BCCEB62727FA2475618D7D56E72CC360677
+5363395820B620C1A7E1DFDE8F3899E216819102484ACB67478F38AD23B990B6
+3E11D9D4BA63E61C794F7E0D26DB95FA8993E0B4CC8A20331FC0FD34D44AD16B
+B01E2EC151DAB56E58813463516D53DDA699F25BED05F118AC1697162590EB80
+940E9CF2250DB2090F25242361680726E4CB41C917AA218D2CF6AEE10A3CEDFD
+43475C5FDE1A812498A1601A20669A95D95CC4E9C79EE53418DCDE4D8E279B3F
+13C097A0013E491EF8FDCCB092C66C5DFA0858DB5D75B7F697A888F2B63C09DB
+B9FB5AE053A959F2EDEEBE6A305EDFE3C880A6A69045DD9AA30C7CD4BBD13622
+1A2E1E43AB1C2485A30DD00201A01599BF8EAC564865660ADCF85CFB99D6D2AB
+87D9B50964A3C845E39C5FFB4D131AC1E7C16B8E7BD22B4F7007F0521FAEF8D7
+40DC8D8631A39FEA8D5F28964E81F2F5E21B823F319CA625DA07F7
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+cleartomark
+%%EndFont
+%%BeginFont: CMBX10
+%!PS-AdobeFont-1.1: CMBX10 1.00B
+%%CreationDate: 1992 Feb 19 19:54:06
+% Copyright (C) 1997 American Mathematical Society. All Rights Reserved.
+11 dict begin
+/FontInfo 7 dict dup begin
+/version (1.00B) readonly def
+/Notice (Copyright (C) 1997 American Mathematical Society. All Rights Reserved) readonly def
+/FullName (CMBX10) readonly def
+/FamilyName (Computer Modern) readonly def
+/Weight (Bold) readonly def
+/ItalicAngle 0 def
+/isFixedPitch false def
+end readonly def
+/FontName /CMBX10 def
+/PaintType 0 def
+/FontType 1 def
+/FontMatrix [0.001 0 0 0.001 0 0] readonly def
+/Encoding 256 array
+0 1 255 {1 index exch /.notdef put} for
+dup 11 /ff put
+dup 12 /fi put
+dup 13 /fl put
+dup 14 /ffi put
+dup 35 /numbersign put
+dup 39 /quoteright put
+dup 44 /comma put
+dup 45 /hyphen put
+dup 46 /period put
+dup 47 /slash put
+dup 48 /zero put
+dup 49 /one put
+dup 50 /two put
+dup 51 /three put
+dup 52 /four put
+dup 53 /five put
+dup 54 /six put
+dup 55 /seven put
+dup 56 /eight put
+dup 57 /nine put
+dup 58 /colon put
+dup 65 /A put
+dup 66 /B put
+dup 67 /C put
+dup 68 /D put
+dup 69 /E put
+dup 70 /F put
+dup 71 /G put
+dup 72 /H put
+dup 73 /I put
+dup 75 /K put
+dup 76 /L put
+dup 77 /M put
+dup 78 /N put
+dup 79 /O put
+dup 80 /P put
+dup 82 /R put
+dup 83 /S put
+dup 84 /T put
+dup 85 /U put
+dup 86 /V put
+dup 87 /W put
+dup 88 /X put
+dup 97 /a put
+dup 98 /b put
+dup 99 /c put
+dup 100 /d put
+dup 101 /e put
+dup 102 /f put
+dup 103 /g put
+dup 104 /h put
+dup 105 /i put
+dup 106 /j put
+dup 107 /k put
+dup 108 /l put
+dup 109 /m put
+dup 110 /n put
+dup 111 /o put
+dup 112 /p put
+dup 114 /r put
+dup 115 /s put
+dup 116 /t put
+dup 117 /u put
+dup 118 /v put
+dup 119 /w put
+dup 120 /x put
+dup 121 /y put
+dup 122 /z put
+readonly def
+/FontBBox{-301 -250 1164 946}readonly def
+/UniqueID 5000768 def
+currentdict end
+currentfile eexec
+D9D66F633B846A97B686A97E45A3D0AA052A014267B7904EB3C0D3BD0B83D891
+016CA6CA4B712ADEB258FAAB9A130EE605E61F77FC1B738ABC7C51CD46EF8171
+9098D5FEE67660E69A7AB91B58F29A4D79E57022F783EB0FBBB6D4F4EC35014F
+D2DECBA99459A4C59DF0C6EBA150284454E707DC2100C15B76B4C19B84363758
+469A6C558785B226332152109871A9883487DD7710949204DDCF837E6A8708B8
+2BDBF16FBC7512FAA308A093FE5F00F963068B8B731A88D7740B0DDAED1B3F82
+7DB9DFB4372D3935C286E39EE7AC9FB6A9B5CE4D2FAE1BC0E55AE02BFC464378
+77B9F65C23E3BAB41EFAE344DDC9AB1B3CCBC0618290D83DC756F9D5BEFECB18
+2DB0E39997F264D408BD076F65A50E7E94C9C88D849AB2E92005CFA316ACCD91
+FF524AAD7262B10351C50EBAD08FB4CD55D2E369F6E836C82C591606E1E5C73F
+DE3FA3CAD272C67C6CBF43B66FE4B8677DAFEEA19288428D07FEB1F4001BAA68
+7AAD6DDBE432714E799CFA49D8A1A128F32E8B280524BC8041F1E64ECE4053C4
+9F0AEC699A75B827002E9F95826DB3F643338F858011008E338A899020962176
+CF66A62E3AEF046D91C88C87DEB03CE6CCDF4FB651990F0E86D17409F121773D
+6877DF0085DFB269A3C07AA6660419BD0F0EF3C53DA2318BA1860AB34E28BAC6
+E82DDB1C43E5203AC9DF9277098F2E42C0F7BD03C6D90B629DE97730245B8E8E
+8903B9225098079C55A37E4E59AE2A9E36B6349FA2C09BB1F5F4433E4EEFC75E
+3F9830EB085E7E6FBE2666AC5A398C2DF228062ACF9FCA5656390A15837C4A99
+EC3740D873CFEF2E248B44CA134693A782594DD0692B4DBF1F16C4CDECA692C4
+0E44FDBEF704101118BC53575BF22731E7F7717934AD715AC33B5D3679B784C9
+4046E6CD3C0AD80ED1F65626B14E33CFDA6EB2825DC444FA6209615BC08173FF
+1805BDFCCA4B11F50D6BD483FD8639F9E8D0245B463D65A0F12C26C8A8EE2910
+757696C3F13144D8EA5649816AAD61A949C3A723ABB585990593F20A35CD6B7E
+0FA0AD8551CEE41F61924DC36A464A10A1B14C33FAFB04862E30C66C1BC55665
+6D07D93B8C0D596E109EE2B1AAB479F7FAA35279ADB468A624BE26D527BFF5ED
+E067598E1B8B78188FA4BCFB0B51692D07B0BEBB930C6F0997B437E2C51B876B
+61A563A2673932C2045833FAA35DB22ADE12102335D36BEEC9D5B0E0CC51613F
+0561B0B802BB1E1111E959C7745653516A296E671784C8F9E06B892846BA33E3
+8AAE46D5DD487E56A90079CA7DA18D25F3681DD0131C46E14DCDF512FC14D9AC
+7341D5046C96E98C17C37FF5841CD42609A279E8E3D4698F925E037E82E12B02
+1B0B763596B1655E53AB42EBE4B24C3F2AD371F10BA0F922AE573BBB163DD66E
+89F2C4E2B1A15300BB08D9818E77F0AB16910AA98FFE60E4A8C7048962318896
+14FC51AC3AF1497ED9F43B8DA7FA23DE5DD815FBF20E1D9DE2223F4CBCDD0068
+884D90CF371C1A2709F44B556CDB7CB1A77C52F20DFD64D7F70A328B8C3D6107
+1868A4CE3AA3077101B3A36C552BA0F270EAE2638FF076060C4F37550A944C8B
+95B4EC1B9A7380E3A66208382AA3BA671B1E88E9AD54CC91B60FDA9109D30B51
+21D35D4755521650099378AECF718D9C52E3CFF47410574094AD902E89688D20
+129A629713E4D867865B965862907838A651E73292089B6FDFBFC2C0C9CB6ABA
+D11B83E2308B297DA7F4E8389A1FDB581494183E8E501048C240DEA4E901DA94
+E30D1E8156295403054A80C890985DA5E5B2F43DE4EE39D2B8427E01E62CD1A6
+1D9C4D253DB21B123EF6680A7B81897FF9CE89A5C61B1BD571BCB630EE4DA991
+24462C827AE695F0C8F536A5CD0F4B5983A054F202DCE6BAA265FC3D8895E370
+68A679D4FAD134E4D4B2222F8253CFCBB762E300D4B216319BEE1BE962A8F2BC
+D3C44D1B5023FBDCAF1FB0ECC02D3B718F41E71FFBF2160052F8FBE1512D2B23
+659BA54E2052B34E84EBA3ACB0E594CE3BD31CBAEA12ABB5B7B3B5B8B54C1627
+D63C5DC924FC1DF8884803676D79DA26590F7EFE53A7300F91CFE53A8B8AD521
+65C16C8AEB2DC236D21737BA69C7963C61C4866D66ADDF047C5913027C54649D
+97764F99CCA0574113D946B09DCF3032905B141FD0396E44A51213349E6F1E91
+25A35CAA02A2AAB91EE12F259A12A71FE9ACE238383AC59698E08594C83BFA3F
+773B6635B9DB506856E3E4084FDD6E25D47303C4EF19383CC88BAA0CC385C297
+0FCFCD3DA681736AF12732CE580B0C65F0079D9EC94B3B5603827F696FED48CB
+91B2BC46DE57678D1B3EB2A32E2A0D0F7A0A2A7EC77AD00DDD3D3C6158077736
+E5E0A8C27DADAA97B1CE71B30853BB077F4BDC21F1206CBD8F65DA7747507660
+C21610CDFC0186F0FB527CADD8F42BBFF4B126CA09EA593805D4A5CDA135B14F
+4F03D05C47E0DA72FFBE7180C00C9ABFF4744C464D6DFCE39749F7A0A816431E
+61883DD1E0F026FC3AD0E8A77A3747D36E0DCB14657227F330C4842C4617653B
+CCEDE8CE08B45524B4C96ACFF67A82BE7DDEF5CFC3051B565B3D55BB82737CC5
+E5199AD02BCD8A1A14762EB2889FFC6350BA4F728040D2A098A8D964A1F20D15
+C5FC7B831ACC333C7AC945CF5C79A48FD324FE4BF900A522A37AA0754226F422
+E9551CBFA0325514E5180B598DD77FB29FFCA09D950520A53DDC24A092F6FD56
+832642FEF3038B305DE368F294884E2083D65903FA4E7580ABA2C268FDBAF824
+1CC21DDBDE539046C5A945EF2DA767DA69B10DABA8EF477BE13FA0D8C8B03C7E
+9561C08C78B8282473046DBDB430D440C691AAB0B7DA0570AEF5B7AFAD683152
+A45B2470E0353018F1C92103F42A7450FE097647C5F3D0A6DC1B01961ADCD8D6
+F1EC5FF415555F9124C2096DD00D9B2454293B00501310CE71EB6B4C55AE3FE5
+675D08A01566687E47525980C14B287347926A7AFEF052E8BC676F08E6BEB6ED
+104719A30D2DFC0A3C8BE0F01855DA0A629C687EEB8288CCEA90CB811A08E5D4
+5749240D2B3B835ABC0C2677B2244855E82A5746880190C9BB1D4E7995DE239C
+8D62281397806F652FBBB0911E8BEFB4FA49643E589805DA34959D06B25D5D43
+8CC19EA237296951E628149CA7352FAB0EFEAB1C9809F2E91906A1F0985C4D1E
+3A6704BE1C6EA10649D8EFFE50F91C8353901697768006E060F0CFB4FC994484
+1B8A08CA18ED99642BB5D1610694A4EFBE916137D05E797FD31C7EADE147BC40
+AE36D19A37128D008560E2671C7AA4606E587248D494987A05C3C188F498535B
+0717413D6BAE7FED7A8CAF761FCC8A000B792890E22D00834FD4B9D76B7E9470
+209F555F4BF695964DA90F05AFEE207AE9FEACB5491F78601A071E53E4CA43C2
+F868FF010BAB29EBD535C29AD9DC5B6FF5A92510B349C91A19A95DDFEAFDD6A0
+77F266BBA9D917D5D177E1590FEEFF3B94BB8F285E7D85E3AD865670C43DA6AA
+971F293A717FE08EFD6CF97210DE90A68B63D6968B83DD1549A8E3329F40AD0A
+A854B6CCD50573088E9148F22B30F4C0C682BCE2AD3BB16BE2A55AD3A1D8BE48
+90047988E8A7AE43D1A20F4180B305A0E0D431D4B8B60345E2608FE3D8B1F657
+9CEC023A1D9F6CB19FEE02A00133BD4453BDDC79389979DDC79092F7C339B825
+BC5E5045C2F58458FF03A2046F7DF00B3F6F36CC0FE76A468B896E30688F2273
+8D8C2D3B3745154E378CEA5723BD40C50F08F58805022A99F441190945910B98
+E9022F83CC740E9FE3FCBC883C303E86BB3D511A83A11216666AE274F09BA22B
+79C5869E3906DA219E44D22B5B6940334ADC7E1C3B3439CE4628DDA7E7A1CCD8
+A85F06F04B1734C8D9CFD685C3A7E6D98AF93A31D19FA95AB8FFABE9D3497F2C
+2B55F47B358B045E97FA9EAED33E31BD325CB56B76C1DADBF16B502E540618E8
+A4FC6539EFABD7045FEBBC720A31D5F4B1BC3F5408EF487758CBE10421570266
+1FF9A5783DF4DDCF26652CEA1566059C37F39A708539C4532F2959BA02BDC6D0
+535253C91C85C8365AD752E4857D915109FB8FEBF0A332247C2712FD50CAE967
+CDF5E9FEB42F9834AD470B0FF94AC96A01703B52011DD368A290F8BA06C8E74E
+2707B69708E58016296A270719D761A13BD826907F7E79FD86B286B5FD3E8C59
+137268BE45C18905725DAC7AAA249CADE436B0BBF0E45828771436AF8144CDB5
+D3CD68E05827B588E422BA28896974133988DE0944793E9AA345BB5A12EB2050
+C36D3E738F6A277BE08D5B8C77B1B261771A3CB9B97599067D49B8BB84F921AC
+A9E9069B544944957A8147A341F98F85F15B703902D1102465A4CE9C5841CCAA
+F84A3411BB1E3C6D0007FEFDE861CE4B5D52876E8A7AAEBDAAE06F79DF7B3C3E
+E7119D832C8B0BD790BCACF5ADE059645AC7F4AC024F8CC26DE61BA1EED9573B
+F3137F035EF7B759997421043584B1E53D9904F9BD83041FE3CA7328A5958441
+11E53EFDF67D1C0E4ED0F323F61FF87F654E1D18B5C2150158464CDC03D1B9FE
+780979A4F5A1BEF484A79A43774B2C02DCFBAB2D13FE5AB7724746326F5D1F8A
+5390CD2DA1125FF24348167ACCC322E4927EF0ACFBE3E96886EDFA78A965B686
+2A3FD06A9309DB4F6EDD080F409B0D35D2438F9D726BF27DF196967072ABE93E
+B036CD34F785C3DADC431B341143D1E9C8821DF199F76017407B86567FBE6625
+EA907A2EFFBC8226EA3F48C3805C28D45E7B76AA42EC919C737DD5C84CFF8BC1
+910B5894FDC941819A5740CAE55C5F8DFF9799D38BE1AE865016D474AD62D556
+8333A9F02B5BDF7B4E8F4AB8FDB4BCC8C19FA2484F176819EDB3F1BBF54174FD
+55EDADCD9C7FB737A243B9C66848CA1998E44847B7F1ECEDC59C49C72D018E6F
+4048584E6B8C4C0E601535395B61026BD2299B1A710F5A123B299FD7C1633CC9
+B5456F558B2956E8BCE846D659582815AF3F0871073CA72EC276815130E65238
+64C264217AA0A87E1381162905274EF539B210A0755813D38765FE9FB5876EB0
+562DE72A304523FE09438BFC994070B0A8C77F81359C70ACE20A0A11979946B5
+D293FFA544CD89A6570AAB1F4087B36400705BA505AAE5E362CFEB2812248C6B
+2B5AC542F779526EFAABDE3911E9D40A027AC60932E1507F163F1DBCD6CACB8D
+86DD3A94709DE62234E1FF6EDCE51752B044534431345BDBD96BBAA071C37303
+803D6661DC7540DAF2CF40703C7140B9B6B84F956B651C76E1AC2BD7E99CCFCD
+1FF828A0F53F03D19A5C1428B978CCE58D549FE7DEA4853D49178E3914B498BD
+4F68A63D6D5F331EDBAA2907FE5022821D59FF9D6E7DBF113D6140E9AF4BD10C
+45DBEB225861D72A15FCC2C8B316BCCB6CECDD5A5C6B349A948EB5A76EA2A20A
+30B855C7DADED5A284C3E244A0140576838282727B404FC836FE570E36081229
+16B04055EBFE6D25BBFDE153F321F19FE251C1A9670AD21F3EB5FD2AC5757E40
+FF7F7CB2D6E1E6A20F79F53036971A9FC0C4F13DB607E03821A710AD423667F3
+1E50290D859C8397CE980A4F6A3E5091855948AB00DD3B3C1ADA13A8F04D9EF2
+2A5D2C2B70C7E777C660C78B7CC7ACA25BAD9E85CEADA33D976AD5A520331C56
+EB21F15BDA5635C5F7D274013FBE2FACF8064AA4F79F1322342410441F512A32
+4231962B4E82A7E6C9037CC7CA43955B5A2A2C03D0AB3BAA635D8F67D5633C3C
+8EC873A52837082579E38E4C1D3212E6F6ED61B87EE9D5F6BEE636BBA289B951
+41B8719465B8500770BCC1821A0D8D4CEBBDFAC74718A424F71DBF8A3AD96C3E
+2F7F3857396EC839E075B3F36D9E7ED2AB0C6514270E0978938BECBC50807C5A
+6AF77AEAD147BA2367B9906C3529E2A46AD2EDE1C8B193AA1533055D09209910
+C1190ED19D3701F8BEDCAD3F409ABF258EF5DBB5F698E8B5665452790FF434F5
+6116E7C00FF5A81CD59085FBF8A9F81DCC35CC231FB662116F5B49388BF35311
+F060DDCDDC8E1C6168AB6D6A7654CBB28A7A62FC98363C0C3307B01166D12FBA
+D553CC8113110EA29CF74A3D57E369A847B923D3C10B4CA1EFF4A7ACA6179383
+5747D92E78001AF4A82720BEE19D355544A27B548B9CD05F6697247A1643A65F
+850681748F201588EE999245FE6037A2A355AF975569EB0DF9C1BF56E8CCD6AE
+A80682C6021C0EBF4B789288A5CF4F9F495A47BEAF472707828274101580950B
+C97BF30F1F558F6F9021933AD8B88BA32FE416BCD8B5ED7FFF45A55D518FA2EC
+E6AF643E98D7AB1FE86666106B30286AAEFCAF788E7083D821AEAB06FD1194B6
+E5CFB4746E1DCADF115E0581615EF2F1FD8DFBBC3D5315E39F675AD14D73E8F3
+B6BB22EFC4D4802D633F5702BAE06B3F01928D734901723534149C7A1773B9AD
+C024AACC1E2F306ADB53CF8E23CAE9F9AFDFD9D5C0B11F9C4E74853622D86674
+520160AB947C03306E71ADEE693958FF4E2DF76E01AB8A571324AA7ADA53B38C
+D5C4FECD4EBD819E292C9139BB9D01A46364D692B1EF8A50DFAE8AC2A42C0D73
+413FEBDB22139E55E3F2D440595B11CE0CD3D7A7A42C7C403CDF4C05D5F851AE
+2324D2C8EE4ECDB212DD4729621075E713FD4E7FBCC7CF28A44CD3B0FB4B245C
+C5D2534A06768F2F6D470D65518CF52E9F8A9475BD3E13A39471169FE2E66E4D
+D65ED44FDC9E6DE2FDE814FDBF69D759B5755A6996F89A09E37A13DB601411EF
+CEA9B58AEF56A53DB83F402F7D7EF2C3207F36611F614817B9C49A9AB69B2255
+568A777E5E912EE39AEE0C90B7A74145E3DC9673594ABCF53DF9ACEE7F709943
+F60D20582408F7FE85DD45A6FECBE5A13C06527E1DE3D85D1FD11F08C91AEB7F
+5F817097B58F6C43950656B1F565D03CE4C36E439E8EF6F636B84A560CDF4672
+E12ACC9B213FD5DD267A06BB9ACFCEA8E6F13275E4894692A5FE44AED78F0DD3
+3B898CC72C335E805D8A712D014DCF3D85EE660DB2D36D4B9F931FAF95EF715F
+5C3266896090171E763482C77AE3EC91B54B7F4AF9570A5DBA9C79ED26EC0A86
+FF451DC66DF35906A6471C063F858BAA855D26DC0CAFEBCEA87EF21D94ACE9DF
+E1E7099E2FB92CB21A4CE58D409D42415BBB99FE309FF7EE3A6D413FF54FE62E
+3A2C2CBDED750472E185F38DADE2808D14D2A2A3435AD5167E746A5F8622C0E2
+FEEBCF51A06AE74D66868C8D24CCD7EDF4C92F50DF810CE4747866760D4E0B2B
+CF49DF7F672F52F68D9B4E804D0DB5BA85333EBF4931D5C002770A3CFCA09B21
+19923E806CA9C60D48B8876CE0900E73521B610CCB3CADD57E2EEE072E448440
+A5DDE06705683EE3EE31E5C4F96BEA09101BECEB4BA82749212E5B8B3EEC6C8A
+25ACB72818A29925508B8F289BB46E2C6EA02D923C6E8E387FC86843F21CFDF1
+97AD1510E87AE5F180511D611D0C5D5EC0555778D8B2EA4A76A33D3E91919F12
+8467B43A14521D0BE702E013926750BF12ABA5D6DE58A4B9EC4CF7AF3B57B44A
+8A04F05DECE2346E86C1A461F868EEA04A2684960A8E22442643A59DE2398037
+7CC1A660DB692BC5C1A1B723B32001F54C08ABE45311674B0FBC7EF9BF988662
+763367DCD42FB9EF44A33B26EA01883002C91C5823DE2E4A5FE9E903045CB322
+49C0F82B06C77BF0250090D2271A179FEE5F457E28B1CE03C7CA9CB0D2385338
+4A99363AF70BF1261134E4C44458F138D0632AF911CCB9C0ED46FC133A846AF4
+08C0454804F5C8466FE4C8A6095340F5BE99E03E9AC8F8BDA8E9C21DB2A853DC
+502C27A8A011F8A1221E314833BFDE12F7DD230618F3715398F197464573F17A
+AB5628CB1F28E15A644DB4A14559CBC5A584D776408834C86BD69E8D218BF867
+EA51BDADCA2E4E6CB1AD5AA684128D18F4BBB6DEAD010C49286C464E90041DB2
+019C05DD5A9B1BAD09AAAB3715CD7FC25326F570E98121D6B71FB377BDD24EBD
+577E463BE51EC536BD477983AE183C53D6E17F310659D6F5A9A873B1B330B347
+F01DFF6EB20EF7BC57036230EE64EB864669DD865676D4C29B295A863F237A25
+4571D9CE2B96520486A9EFD7B0411D6F559BC9F71E6950179D46BB311A2FCA7B
+765990B716726692698036A8CC95E0E0C8508566C24D545C100E3776D47AB8AF
+6E5D513525FBDC92E72C6B3810F04D6B99C365AAD3989625A7A75C1A942C56D9
+C2F6E362F146F4405ED16E32106492D277330A0AB3A266AAB6F7959F174E6FF2
+E090628DF9BCC0364C97D9E64A6B6D54A68EF3B9A4A20A5EDA5392553220D36E
+F130BB4659EDFEF06594AFFDF4C99002EFACE58885F78C8E1633E01D3F711B78
+A6B5F31972D8A859A6D1F1E8D0A4F53DA05DED27F970ACBDCDFEDCB861038E1D
+60EE44E8D014FF99239BE1D87AD97EE2061E33B21FC4DD7A863CB852132F7D30
+C4E728CC53D52C036A7CEDED7DE4B1C0237E76C3211F09973A4930182FC1D141
+CE6A222C2550488AA4A2B7A78323D0ACC3D01B59BCAF5516CA9730C395ABAA3A
+D5B565051CD66D5D962AAD75E2A0FBCB42FCA1F04C1C06D3D5C80811BDE21906
+3E475F81ED66A9A4F061AEF9EE01D986049C4994444B882BDE07BCC8E4FF8038
+3359D39E20FD088DF55FCEFB799901577E046CFAB76345081A0B6F21DFA48F63
+87107113CA9ED95FCE2357AA377833CD9933808FF1DD3D023E15FD07AEBEB4D1
+9E6BCAB0CEA0218A908DF4E73936A3B97E4E0FC13D4303651BD2C98D7AF70DFF
+8DDD9765CB7F5C2809930EA11A93FF9321F75A162496772521B7C03DA46F0C70
+3CCA9268C995134A61E884C1BE6B219D6B241A88FEE385C7C25697B1AB274C22
+6E7ED034334554BF11AA72698B00924CD937808463A2DE8C1742F5A9B20A4C50
+797A27A20857EF4CB26D6CD32C08FF1EF72CBDDB7A3524E94E8AF2E277360DE1
+CE9A444976F327F536E02C25C747388D07FBD90F7673FA95D341104604582287
+3E538A283EF63C4CEF065FCA59A538266658B228034BEAFD647271DD4A74254F
+87A5395F07596BD1567B8F64C28C185835FA58000DF3B438B01C6D25CF20F7E1
+E33A76C7451567BCA39E9C638619BEDF41BFAA3B10193CEB976B22CB87537D8B
+8D12C60A26E6417176532A131EDA009F978BCFFB5CC5684389A66C88E23DF4D5
+6DCA6763BE4573BF6B46FEB2452A541573A18894906A55E5674BC5FE55299F30
+25B495058F7ADA0108BA83C1C7708AD5E30FBCC1D97A28955724C7208F265495
+74FE5068F6963E6FEF52FE5D026BDEB5C2E9676B8519A3F5348FAD76A210AD8C
+016393349838608A3C8BC08E38F56BA5793D38A61B089143864F221868C5156D
+E4962F71BE8135A63F3212463D92A6119B513DD4007469BEBA422C14186AD709
+06F44C8D01376BBDA68AD44E10D52E96932450C66B446054E58E53BA8EFC7A68
+88BA374B21332BD1890196B625B247E4F182637E524C34552C4740F34844F205
+5FD6C03E3BF20A509F7CF977C12162C83582F7CF81BADDF52D6C3D0CCC20C933
+37369277DC3A32299F73A3DBEB257DBB6DDB98B4307E91B363C89F6F28BEC46C
+4A9C1D161EB150E8F9DAF46162F2ABAC62434BA49F87BABB13DB4F68FD21EAD7
+4CBB7B71C269C1FC8D4770A0A66325CA1D7ED95A35F5B6B7C82043DB30EA4884
+C989129029F62AFB90E1CF41A9B34480D28C87F3A80804DFD217400BBD943A54
+222560D28E9B19603C4A4953C247B348C4A83918FC992E8A0B596C4551EA1E04
+F87A6D181648E495AA44E13E112BB3273E862EBD7FA0B3442835C30A60101518
+7E52E6A57DB9163371EEA170DA4DD90B5CC683A1E725D23401D30382D46BC31B
+B1304C620BF35D5AD7649FC6FC50258FC6787ECF99FD0A17E797741A8F0254E9
+352C497A7AE3D957EBEA325626FB61BFB3256361F5AE1E55B195BB18DEFA7D74
+FB38638A3C2E3D1FA3144AC2AEC592D5E29383D38838525AA72D6B1B25885D43
+288CA8659FEB123C5821CE3D71D02C2BA2B417A595A24F6352AA692C92A4365C
+F03ED647475B0E0D10427407AA693A824777157EEC75A870B482253D0033AD53
+A9842C351D5085E8E929C7A45889D9B4AC0F53BC24FEDFD214E068D63E65EE41
+0A995169BBF8075A1464BBD188068ABA7B9E5445F6525446D8C2BC6294A60B66
+BEB65541D15FA3B3D80FC95451B29D8896F8D3148E8B4BB59EED9F1300DF22EB
+96F61587631DDDB93670E3B5CFF9593F2AED8309FEA3B80C91203BA8B37FE59F
+21021341B1AEC3B136BAD3A60C15B126022E834FF77BAE5292DDAE5CC5E91060
+54D0FBC21C8EC72067C50C5D2621D41ECCBE4870B5A7789A5060F67257381E5E
+1A9B07175F427244540E332876FFF63ABE42FCE39D2D19BE66E9F546D5DFE9BC
+000A240D877D211B3D249C01DEE997CA84B4C11C0C3B9FAAC4B9A2D453F92304
+11AB44BD718E242ADFF30C8020F1BE67B5C30700EA667CA1685F41F49811199B
+1AAC91D81D1DEE8BB76C254814DAD24F1AE3F1C8B19D1BBD366B500A97D61A53
+5B8A71C48067811B29E44DF226E6523C2354A892F82F5473392A4FD560588216
+4AC288E0363C80DD721A4BAA34FD285E8D31ADCFA7CD32E7AB34A909B0C32262
+872D4121A878E0B78024DDC64CEE6576F568DF566D9A77D9F91F93ADD3E8FFCA
+229BCF0375A6C6E041CCD2AC3A71AA94BA1CB0A31EA0DDA50DC8A3F67B17F70F
+86E61868B0A62798C61A79D742F72C295D4EEB9352206FCC549603E2B0FCAE81
+107F5E6FD8F70175DF4259531F30AA15879C6A526AF23A467020F1E15F6DBE73
+DFFA29B088A786ABCDA6A37DC87E350C327BC350D6C22A2FD99710D8E2426CC9
+E82A9C8A09B34268E2D5BC442E1F5B1B7ECB7AD9CA02C6106D242D590FCFA76C
+988B2720D73AEF51836084FF9D40A031F6911A6DFCB549441FBACE4981C37FF5
+7B4A57E4B5E86C072DECABBB2E654A1481AA2C1A58221ADB55C5B0D02AA93988
+7DC16299F3BFDEB6A89D8E21E4C69E2D771BA306BB15923903960C64341DABE5
+79694517ABD44DEB75FCCF1FD41B9466F194ACE07AD447385F494E83780EACC1
+0097FF1141302A97D84E6551A4F677BFA82B12881BA6074C62A7A118AF99429B
+6DF68DF329A2390769BD821A5F4EE04B80436E7A5DDC2CE68D0AA3885B5A56F1
+30BFC9222EB63E10997299DB794DC75A2FD293EC397937F1CC58A8E71101224F
+302520C4E0947ECD5CFDA03A735E694491CDACB9B660B67B464DB012420966E7
+42C1AA03C6622FF17F887C5ECA2A22076AEC24D89A79BB9C8161895B60F5670D
+87EA64A999D3B60305D300486F293B5B673D2A43183A2F824677050FFBF26FF9
+88C37EB3A5264FB06B952BB7BE1D3F1EEE173B6B0C2A34189EECB21B6CA61FE4
+861345727CC9A7D79D155A7FCF370E04427F2BDC8BC3A96B8719A9DE442A8A5B
+DD2A6D683947550B0F2B11A86B1E16D794ABE3C373753F3E59A48072EA638A09
+9DD7F0792F9EC2BC54764AEF3EC954FA47F557C601E6B39192DEC5BA35148262
+887780DB3186AB9444AB9AAD15921F530B8D74AAE69F4A234913E1EE0469C392
+4406E30147528A2330D27228D3FB8623FAA667A1CC773BFCC0ECB594BE578606
+22048B471556CBC4DD5F181E39C2480097B46AA9D8F0D3EC23B16C9D70731598
+656FE2E686F255D7E00E92EC7C7A5759FEC87AF22A17145390C7CD99AA90658E
+A6FEC8056C09933460973CEF2B4B0CB9464C60CC01866C5789E9CBF407B6E41F
+88DD71608BC44627D5EA631F080BF85490E5C46F77926CF9CED77623C840F758
+87AD2C2C18A5E8D253DE08982B7705B8F744CBCCD2C7BDFD1A74B3D079D4F7D0
+D9BBAC655B1FBA9AF60FAFFE22D4A9A313E0D57E414E4191D95DD9F1BC27B2FF
+7EA2A3D6A3423E3A2CF5C79C7D76D5A4FCEB2AFB6D9A94E70D7A1D01EABACDC2
+1C18DA8157010CFE89666D07255E4DF8A719935E1F0BB32165D0DF9449D91B0C
+7B3A02AA975E7C1BAF761166DA4D87D985CF44E98C9658F864FDA66439FB5EE9
+27AB344FC6B539DD0536D8BD17B8E88910D55F5534F32D7224604752A7C79621
+AED54B0F9388C2146BF0875E970FB5068C513FEED125C10A42078B892F048952
+2549312C795180BEC87DD2A92A1993CB8A5210D07E5E5DA02875D8185F42F7F3
+D4ED53270F6EE8BB7B322509229B3FAB686F4B02C8F51CCCB9E5BB7DD308744A
+52C5E219F69391DDD41E64511896825EB6375379279E30D902AF354A2FADB441
+E02B9310AD85765A33519F5DA455ACDDABD5CD3140F54A06F9B9A9D978790793
+E08BA813D360C1DF65CAA4678F7482B98AFFBA82278B4BBC60432B8C267846A4
+8621D077736442319077041A60B16ABE8CE975338002E1CD81BC2FD12DA434E4
+7F7CB80ADD62D6821482DD118E9E9F4FEFA639CC7D46DD703EF7E4FDACC52F18
+55ACEE48B6AFE221D27FE06381282FF8E1B6881098BFDF3DD1ECE775E776B54C
+CDF21C35BBE7ECEC3E9182247453B3154E7410A12A0B81FDBB64B5C1E3E9E62F
+0C8B86387A31CB5866F167F3E95545D7161672FEBBFAD0C67510A9D729FF5617
+7B468FB4F05E8E2E0CE15455ADEA6917238BDB60AC6C3A324227BCA8E391FE67
+CA73BD4A6E320438E98B6D4A1661484BD23F9F3B887D06247CC39EF4C9ED0FF6
+3FE303E6FBDBCA122FA2175A815ABBBA67733EF57D9F9C7308DFA697A0E4C1D8
+79AD9F4DAC3821873C9A7E47C857823192943FB168EC87E190E495667948BE97
+2F798D77A5247B890B4E01D31FC974D38FAADA0262C506B58E85A91E26ED4FD2
+C66F4FBC2FC74B27F33E1504E9D08F725F396465E8A2244A76CE72D044D2C237
+66063184D901AC9B1EE675195A518FCCF8F845C5BEA3CAA8880D7700017C2FAC
+F90BD236CA3451153FEE7A8FD9D31DBF5A2EF74C36635348FBE6EF91DF10049A
+71593BAEC392E11107E7160DA8C6288FEE8B98499405096706EBC00EB949433A
+072F045D4D29570066E55276C04A1685F44E1C1672FFFE9E837BC6F003F2F0FC
+2508AAC430E1D63F7085D061B3C3865C7F2C49AF704E266C079979777578C4E3
+5F33F3EB2B98A6242328001935FFAB33F51E9FA1B1C311448E066C213550B195
+867A770990A7FF36556F1BCD40B1F46E2AD91FDA8A8BE65B1457E7A67BBE97FB
+B6CC8F35D8662F37F119034701B0D9B9D93E45CCBDD267F4050B11CE8C1EF049
+522E9FF8231857D7367867097C84B91651CAE80C0C1A15010ACC2C0B5B1B072D
+FE0BFBA82C51882D3AF177ECD1AC76C4F8565D4765E6C49DEB6F4A75C21E3D9B
+5D780DA92286AD6508EA91A0A05E45406D7A00708BBBAE54F578247B395D528B
+73B678CB0EDF9E24963BA5D78B3F19094CC1A4CC5F608D3B0A03E53A23A6CAAC
+22ED815208D18D372791177642FE1152B284FDCCCE2BF51510D108DDD88D6F94
+71D3DE61EAB4EDCB40BFE890B7736F3D8BA0023F69226902B2F74E6773AF538A
+16BA7EAFC03DE251EDD0382D7CBCA2ED4023E1E0C46A003D60E6A1F37FC18957
+07026828DB690669EFE17E929DD5AAEC5C5D705BD31EB7C961996B7B686A5F26
+5DA98E9076EE73D11BC5F44AD4C7EBADBD50BFED9572D2401D4AA5031F15C7D7
+2CA648D7C889045C1F8830C31296BF4005504C1F7D36059C84383CBA9C9C2999
+E7E30C97A5C83EC3060A24EFCE82B75E0646337338D5B68CF30C05256140D3CE
+4CE4E3E89AC925E815614A60B7B1DBF76FA011AD42D7E915F8B8E42D61F15BE4
+A5617991F2D02D2D146D3C4BDB9CC527EE528C1163CAE83DC2A6C6FA687E4D0F
+B79D2E50F3BD11FD29DF024E06D6587018196C2010FBA987C9CD5E679623620E
+16C70E8FA9AC7B96FF94265A02FD25B7F0C6B92CC46D18E6D29465D276CBCC1E
+A7424D976B16D3076BDDEAFC2C36BB0F18374C6EDF2A157E437D957381D54333
+99D183EEF1FBC08C54ED09AAC340C09DE413C9A8C1C7B4F67F7A61BADD70B048
+25413BC02F6EA0B55D612479A2007606EA5CCEBF85A5B057B4255150A2761C4A
+DE0CB7C99398688E227315E562461A3B573DCDE60F49D624D4D82746FBB22309
+81B2C649A69BDC6D85E2BEADC151D0FC54CB6794F87B28AA4D06D7B0767431A2
+36A93749F1E6AD9120F1B814F40B99C6C0B049EB343E56A6FE49B304223520CA
+46090028B9F207666CF88467BD4592B195380E84835513CD1D0A05F757D217B9
+FA139F3CC4CE6B5630A81A1F91B3CEACE66900AB70F21FA4725B66ADA3E82B6B
+35CE3304603FDE138AE29E602010F5F44E48EFADEC1E81F8266FA94E52EDCC47
+15922E1A081CF78BC3F25B8AB0404FA4C88A2D1F56B86BAFAFE7F293C2B2BE34
+18D323ADDA1FF4CF67E0A626226AD99C76B893BD36B4BF6E276F60806B69B347
+050789215DE08ABE1CDCF0205A050BB79BF6D2B44999EDEE76937DAE45644A55
+143B8242F9F5278EAD5AFC6FF428298EF50B3279B487C4A5FF656C7DBC7E2BA7
+34710F27AEDA9A155C84786D94ED9EFF84EF00EF987D1388797C0F6123CB59E6
+C5E3A8AB005B7C333B995C3053D5EC23B7860DAF94FBACD0B568883A1DF382AA
+0AD61F8328CBEB34BEC1BEDB27AF9600A2E75793078BBAD37C4CEAE972CB7F1A
+DEF698DCD79B2B2B727BD5C910BA5E6C66C94D44D1341A25B1537145722DF13D
+D3A6C145A6C2545BD79D83489DAA37839A71494A44F1318AA641BB9EAE56F58B
+203BF4FBEB460C7C696C6FF36DE4EE27D45032F1BA5334E7ADEA4B74DC48D171
+071D5605AB55978053B09921D7C2CD1BA5DEF58FCC273AC0EE23256E252FB7C3
+A448F02B22F4D297689A94B93B824EB253FD094FF10A8CC48797B9784FBCAD49
+4B291E6C30BA08F040586825D036E9F503F908EBDC1C3A28F955072A7C4CE2E0
+652E16D2437920E534F6FC1823C51D35EA010B97715D1BFB250EE9777A66224D
+40D46509509EE487D8772C42D7053BE1DB5BA3DE1EF997B97A6A8DD1314D5DAC
+415D180B35ADEBB81CA959DF2A3CF8E7FAE36C2139EB52B235C02ED4957C07A5
+82B80AEAB62B8E8B02B5F380B519488166BAE067C67C490B06E3CF466B24AFE1
+1B86B9F4C8168B2AAAA140AF22CC439E808AB9F7B19A45D7EA4F0807894D7C5C
+3267FBBCBF83B254C024DFCC4519EA4D3703FD98258A9D25A8E4D6124018B8DF
+BD11091610EA055D187D741D0214A01B16199CAB2584EC2899CC801B3F9CB9FF
+70C8157074EE522CD57615A677C66E4737FE9673CC67494D0B2FEA9AF57C0CD7
+35B89C9121F1A88C21AB759E245051D9B13F7D3F2EDF2E27F3D87DD5D48E726E
+7099CE090849EE1D2FD72470A8B64BAC8A0BDC8B5825239DE182F4F576354CD3
+1C95164B0A9CF5270CD65E3341D262507A3FA75490B4A85AAD6EF1964034776A
+D3BCD51BE65079A371F229F41EDA5B83440A7A75809CE20D63C2C2AE0D6034B0
+7501828014E076EA08B2A52C9EFCA535FCC1F16721B92E80DD2E00B4E64C78AC
+CA7D7D592BEB88A8CF513859826D6C3B516FDDE18483325D2B46331AD2463D00
+65C20341DCDE5902C150A4E17801293D158C9D958BC876F5AF81A48AAA71ECC4
+E955DE5105E361E7798DF1987D8B9D6850E14DA67BB1DDFC71C230FD14BBACA1
+6211317325901AA078647C5A1EBAC45B84C1795345C4B8B6A99E9DA305C19885
+D40C2B9C5ACB9F769A9C7F333B32CECDE8FBABE8A0188AA026A25FFF928685C5
+B3B68EF97B956C72A99AFC40F7AAAB8FB980E6356DE12970AFDFAE8E90A41F3B
+A39649BCE4FE6196D640796E7C11F64D6A992D1694A165E2124A84F44B08779C
+ABA410000BA3430845D6F5EAD4655F2E3F5D93530F96BBF1CD6F9F8AE79EB723
+7AA5903CC684274437A98961393D5A83D5EE37C9C1D3DB1B16B55BFF3DB65C82
+150B29D83042A6F590405671EFE3B7BA3E360232357D9FFE795CD80364DFEE70
+328909D3DD7603C31CC80DB5D3C283AED08291E9364B5BD746AA3446CB1612B7
+B60AF6E72052D0A1BA2904D43C68F51E9B5DF9A41E54C959AA2DD9C1E2D2CEE1
+7FED1E0B39FB1F240D0EBDFAF5D8BAC087856E1D97D38E282FF0C7698978CA0C
+EEB543BEE46A726C4A25ECAA06AAE80A49AF9FB6428D5C35E107F005CEDB91C0
+16DD7207F3678BE5AD293B3E193676873D312A9A217D6E56C9FB6AC11A42CBB3
+D1BDBD655562ECBA71C042A433BE1FD9C7841DA1493D4B4FCA250A101C954EEF
+826DA32E8EB107F18195FD1D7A047D906937FFF368BD93984270E9D39DA83FC2
+7DBB7790FC9568F0CDE0573BB88FC0A1B42E2ED6DC9EFA3085B50704F58E4775
+94EA76532D389AFF9B549D9F89E650376B3E95409ECB885FA8AB6424A7F642DA
+C8969E865787C38BC1FFCD352B2C56736F73578DC72808E167334DFB3EF7B9BE
+F4C4F430036E3D238AF5D4AE285B4D60BFA1987E9F2BFEB93DB94A642EFEB04A
+D22CE5B71124AF2E876186094B5B17BAD75D025820B0C4535B5C230132F35D04
+8050BA272E5DAEB5AA6A2352B4FD4FA49D021F1F01DFE1726F2281E02E314B1E
+407D3B10177F25AB5ADF2A5DF26D4DFAA07E5CCFB5FA4F9D0703EBE0F788DC47
+250D61C7E340479FBDB861748D1730FC5DAA39D656630C49D7D2458EC6309D28
+B745FBC314F53CA9C7563026CDD43B1F54A4BE4E08829BAABD193196398A44F2
+72F93B6715DD9FC098CDC64070E1165C05C60040436A5A97BC606ACEF1B8CFD5
+862E50E1B3C7D36B3468328D245CFA0CD6F0DC8761380FAD81B7939B3B9590D8
+3B854CD5ECE654700CAC4F3326668AD530F99E1727A37B7C877D1D050BD4D1D3
+E1E326DDA5E59AD1CC07A9D393BC50810DF596685406DB928416F1A0BD2CDC3C
+B79D2A0D4E4A2E1DFD4280413BD70BA04C2745873B6B63998696B045CAD7F949
+8E1A0CDB94449C81C8E54749AF28F238A8E187582F8F275E3FBCC30D4E5C28D9
+C6DB039BDA6AC8BB8CA371E2997434F55F850121386A64565B7913268C82FD5B
+426A110D7D154D7CE445E6465FF5F8DACDFF0F1FC2FAD0358FA5233AAAE3D6CC
+61D8346227A195224980F6540EB3FB0D0A88046C588BD839C942F66369CCEBBC
+CF7C2522E2A74D80D9E1A1F1AF26F0C8C235FBD1405CB3BC6DFE12A2CE25B646
+3C93CFB1F2C39D88C4C8F6A6A1558684B283F50160F21DE9D24B0A7F7B739C27
+B47EFBDD7BD460CB914BFCAFB4D1D3D7CA28B13C135E8A1E54EDFB83180A2DB0
+6DC534ED4AF21E008454F880A98C02B12E726D636F916E694EB57B0B5E4088B6
+3005CE6C9EA152F44995315C558BCFF85BC88229E0C66819BA9D1205FBEFC3B9
+71B119443683B83F9F1F3891629C5ECFB363248243F45D2AAF44D3C0DD9984B1
+FD2BF2449A553B130FB92A1480C3D068D039C8CEB01E03F9EAF78D5ED601E43D
+D2CFC144790A23EEBC874B0FCAD75C01CD4E3696C9A96C581ADAA8AC9A84361F
+ED9152CF83A7468B24A5DB8CCA37A015EB9316DE9B7BAF7F010EE58439BEEDA7
+C8F64FCA8727AF0DF797AEBD93FF612D249957F7ED36C968EE765B4734518FDD
+EBF3E1CD0C5B379F8E7F05EB0E01A91E647456EF1FE16D22336FE107D6F30F08
+BDE14E7757282745AD063AEE4DAB0FF6C3CA5A097D43DA549418D1FFAB5DB122
+8E576945C3524938F7A3D11405656220DB1825D5D9E3A1059ADC1B7DF147E8E6
+D7BEA331CD31E02EBD5267F83E177C4167F48D3614AF58B63A6A5D6F32E47853
+1F9D6E10A08035229BBF249AD78C6155AB42E5B6D7D347015729A3349D77266A
+3B3655A7D423B4DACAAC32BF9FB50398056E7D77EDB75E380CE45C4F55B26105
+8B3E30873F0451911CC5F4C15EAFD5041E1094D099D5C35AA34B72526AE494FC
+43C0849C125BBDBACC01A5D1502C3C192BAC137205D3257A154A0D5BDB8B9B0D
+E3C6C019CA3B050B79E6855A1931FD9FE941F63170F6EBEDEB0F8A71E495115B
+2CE1E9982731C784A2176F3305F429F11BC5692748E7ACCC6BD2204CC3BC324C
+76E7453CD5B653C74B9AAFB048EFCA7CD5AD208B6A3236CDC7F0702EDD3B8D5D
+C84CD896A2B716688FB2BFFB91BD38AAC2330B6AC04105279D97FC67B8AC3343
+463E7DC8BB6436FFCFFB183404F47F20CDE9A4F6436451E80BCAB4E0DA518BE3
+3DD12794D4A98D0E56D9350A577CA1701AA12D2C5411D0BC69083993651A1E7C
+E2CD0D91AB70EBE2A1F1078C2F89DC8DB84909FECCFE5FCA721B814FAE86991B
+7439A1440324B3E94640883070C091FE0D6D40E41FF3649698784727679E665C
+25077016DF6550E560C126405F6BC7E1C64EDB192AA6A6B429489211047B438E
+8E88EFB1E134E3A147D6080C84F60777001EAA263AC479C840426190BF1BF661
+68720893FC6DF39196CB1C9EC92BF4C17BA3C863FF02B1698A8F5DCA2B767EAF
+A5A7FF57542F3551C03377D3C8C561567357347E28512A3FEBC2034863ABD2AE
+20D4DE64E5CFCDD197E70836B35E68B9
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+cleartomark
+%%EndFont
+%%BeginFont: CMMI10
+%!PS-AdobeFont-1.1: CMMI10 1.100
+%%CreationDate: 1996 Jul 23 07:53:57
+% Copyright (C) 1997 American Mathematical Society. All Rights Reserved.
+11 dict begin
+/FontInfo 7 dict dup begin
+/version (1.100) readonly def
+/Notice (Copyright (C) 1997 American Mathematical Society. All Rights Reserved) readonly def
+/FullName (CMMI10) readonly def
+/FamilyName (Computer Modern) readonly def
+/Weight (Medium) readonly def
+/ItalicAngle -14.04 def
+/isFixedPitch false def
+end readonly def
+/FontName /CMMI10 def
+/PaintType 0 def
+/FontType 1 def
+/FontMatrix [0.001 0 0 0.001 0 0] readonly def
+/Encoding 256 array
+0 1 255 {1 index exch /.notdef put} for
+dup 25 /pi put
+dup 34 /epsilon put
+dup 58 /period put
+dup 59 /comma put
+dup 61 /slash put
+dup 120 /x put
+dup 121 /y put
+readonly def
+/FontBBox{-32 -250 1048 750}readonly def
+/UniqueID 5087385 def
+currentdict end
+currentfile eexec
+D9D66F633B846A97B686A97E45A3D0AA0529731C99A784CCBE85B4993B2EEBDE
+3B12D472B7CF54651EF21185116A69AB1096ED4BAD2F646635E019B6417CC77B
+532F85D811C70D1429A19A5307EF63EB5C5E02C89FC6C20F6D9D89E7D91FE470
+B72BEFDA23F5DF76BE05AF4CE93137A219ED8A04A9D7D6FDF37E6B7FCDE0D90B
+986423E5960A5D9FBB4C956556E8DF90CBFAEC476FA36FD9A5C8175C9AF513FE
+D919C2DDD26BDC0D99398B9F4D03D5993DFC0930297866E1CD0A319B6B1FD958
+9E394A533A081C36D456A09920001A3D2199583EB9B84B4DEE08E3D12939E321
+990CD249827D9648574955F61BAAA11263A91B6C3D47A5190165B0C25ABF6D3E
+6EC187E4B05182126BB0D0323D943170B795255260F9FD25F2248D04F45DFBFB
+DEF7FF8B19BFEF637B210018AE02572B389B3F76282BEB29CC301905D388C721
+59616893E774413F48DE0B408BC66DCE3FE17CB9F84D205839D58014D6A88823
+D9320AE93AF96D97A02C4D5A2BB2B8C7925C4578003959C46E3CE1A2F0EAC4BF
+8B9B325E46435BDE60BC54D72BC8ACB5C0A34413AC87045DC7B84646A324B808
+6FD8E34217213E131C3B1510415CE45420688ED9C1D27890EC68BD7C1235FAF9
+1DAB3A369DD2FC3BE5CF9655C7B7EDA7361D7E05E5831B6B8E2EEC542A7B38EE
+03BE4BAC6079D038ACB3C7C916279764547C2D51976BABA94BA9866D79F13909
+95AA39B0F03103A07CBDF441B8C5669F729020AF284B7FF52A29C6255FCAACF1
+74109050FBA2602E72593FBCBFC26E726EE4AEF97B7632BC4F5F353B5C67FED2
+3EA752A4A57B8F7FEFF1D7341D895F0A3A0BE1D8E3391970457A967EFF84F6D8
+47750B1145B8CC5BD96EE7AA99DDC9E06939E383BDA41175233D58AD263EBF19
+AFC0E2F840512D321166547B306C592B8A01E1FA2564B9A26DAC14256414E4C8
+42616728D918C74D13C349F4186EC7B9708B86467425A6FDB3A396562F7EE4D8
+40B43621744CF8A23A6E532649B66C2A0002DD04F8F39618E4F572819DD34837
+B5A08E643FDCA1505AF6A1FA3DDFD1FA758013CAED8ACDDBBB334D664DFF5B53
+956017667C419C4021DA92976C7550A196C257FC2124E6FA715D14B5E9855550
+1281E5B43545ECA054B34658C494C18923C3B23CD4375A55BDCC68DD7FBD7BE6
+B1148FB4308A430EC5896876C70A2C059AF769F9BDB4B05D1895C0E36E0A5054
+ED05505804610E266E30CA9B2E6CD39BCF4E767FCE62B512579D5B77CA295FF1
+0F864DD38D5BC99778EC16CAC80D23E8A667518EDA342007433E808B6A21568E
+D0264B7C7B435FFEDB7BDC5D85D72B5480B960FCE4C8881C1C355DC819F72673
+EE607520C2B4098011C2B953F9DE4E0818FF40670910F5B661F9515090EBA38F
+313D69ACA24E20AC7019B0F3DE63CA37430D71C7A592748E1A148A0695C5D97E
+15737737042C70A35B1E913D5C5F1D62C24F065ADE8E191722F9067D707504D8
+F2BF6F8F431A7478796E8B77FB1588D7B42E34215EAE806D87EA391CC81DF889
+F96FAB14E10B790C160C669451DC3937195377973410CE405A81128900DDBF4B
+573CDC1DE452A5FBA5CA1556EA55C370933071228AC5FFFEBE2EC529E930A6B0
+23C657F8BF08BB32864DC7CCC55C9290FB255355FC895E3551DD6C09C1F5A1FC
+65B6560611E0E530607E5BD560C980FA81FC98ADD432C0906B4DB898F0D327AF
+D1B58EF18E951A68DEAC60CCD278FE495FA3D2EE38A680848F769099B2EE0CCA
+8C13623806B838A0DF179925E17DCD0446E70F658BD665004A843CC81ACC4500
+6986F98B1661EFBCB76D5EB53DD3B5805DC38686472BEE54B3D167A3B316E91B
+9A6F775D9EF79B79F1878BE3A660ACBDCAB72841389668F491C50B0411ED565F
+BEE8010E2CC441895793E9F49125C6F37C76C364EDE5D3F030C9C79BE3D57F8A
+88C9C61FE1433D4E2705611EF77035383E9C0156F863EA0FF7D9E81DEC4237D9
+DC41BD8703BE6C2015D6F3EF2EC415DE7F0F03A50056E3BA8B15D838B37815EB
+E4E08298CBBB4C03697562A8042EDB9B45BEAFC3DBC468796D287D386A108054
+5664F55DF3FAA31E0A2AEDD796D75E3D34BDD5E36B239F4C0B242AB19D17DAB2
+08D0C72F1CC5C0F56D19991C164D40C2325422BEDBCBCB84AE12FC47669D9851
+1AFD27451EBC0FCE3701E8E05113F3EEA35947AFFD61B322A240723854340F8A
+C48E2E2E6327883823E90F730A1B5952E58085F2E4BC8A2150A8CF8A261DDC17
+CE24E923B5312E1F7074B8379D9BF5FC4C98D45B473F220FD60D8FA92BA72860
+4BC23C6A9219E9768E291781C7EB496DE0570DB10F0FA221C7929AD48F27DC32
+7821BB7EC1958E9D8A18D377E3D7CBD7024609800831E129D03AC175FC744042
+D949AF71E5ED67C7E75D71FC5BCED03383166593FA73AF7E04D1654AB01AEE8D
+9E31A6BFBD4540077EA97830F9569464296EF683159AE3B5AD12BBC365B7F15C
+2C71D3EB1A3F1A39499E32A800E5922F06C76CF33455500EFB5162D1FC604EEA
+CBE1A7CA72309A829DA1927271753D59774F7414D7F4D025D9908E7F752BCAB1
+7AF025F327FABF27E9A350A1391861C0DE7AFD8BE1721DE4ACF357DC58F9F70A
+DB7EEF34FE00A60E1C5EED636089D316063FCF0CCEDE831F0CD854A2D454D8D9
+A5CE723A739D22AA58ED50EE60F4F0C39AD34F7463ACC24B2494163D83961F9E
+DE2E0BFD412657F8F84A03D23669F147266E01DBE62998E7F4B2A1DE969151D5
+009EA4089082D7B373B76367A63991CCE8AD729E70E39B5D50EEAEA1B31384DC
+2E6CC2C7C1810B771BAE024BDC09ACC88287B74DDA79CE5F6ED1083C8BAF57CD
+DD66845866D95450AC7F44DB36A55FAF99E70AFA49A146C4EE332A3DD233
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+cleartomark
+%%EndFont
+%%BeginFont: CMBX12
+%!PS-AdobeFont-1.1: CMBX12 1.0
+%%CreationDate: 1991 Aug 20 16:34:54
+% Copyright (C) 1997 American Mathematical Society. All Rights Reserved.
+11 dict begin
+/FontInfo 7 dict dup begin
+/version (1.0) readonly def
+/Notice (Copyright (C) 1997 American Mathematical Society. All Rights Reserved) readonly def
+/FullName (CMBX12) readonly def
+/FamilyName (Computer Modern) readonly def
+/Weight (Bold) readonly def
+/ItalicAngle 0 def
+/isFixedPitch false def
+end readonly def
+/FontName /CMBX12 def
+/PaintType 0 def
+/FontType 1 def
+/FontMatrix [0.001 0 0 0.001 0 0] readonly def
+/Encoding 256 array
+0 1 255 {1 index exch /.notdef put} for
+dup 11 /ff put
+dup 12 /fi put
+dup 13 /fl put
+dup 35 /numbersign put
+dup 39 /quoteright put
+dup 44 /comma put
+dup 45 /hyphen put
+dup 46 /period put
+dup 47 /slash put
+dup 48 /zero put
+dup 49 /one put
+dup 50 /two put
+dup 51 /three put
+dup 52 /four put
+dup 53 /five put
+dup 54 /six put
+dup 55 /seven put
+dup 56 /eight put
+dup 57 /nine put
+dup 58 /colon put
+dup 65 /A put
+dup 66 /B put
+dup 67 /C put
+dup 68 /D put
+dup 69 /E put
+dup 70 /F put
+dup 71 /G put
+dup 72 /H put
+dup 73 /I put
+dup 74 /J put
+dup 76 /L put
+dup 77 /M put
+dup 78 /N put
+dup 79 /O put
+dup 80 /P put
+dup 82 /R put
+dup 83 /S put
+dup 84 /T put
+dup 85 /U put
+dup 86 /V put
+dup 87 /W put
+dup 88 /X put
+dup 97 /a put
+dup 98 /b put
+dup 99 /c put
+dup 100 /d put
+dup 101 /e put
+dup 102 /f put
+dup 103 /g put
+dup 104 /h put
+dup 105 /i put
+dup 106 /j put
+dup 107 /k put
+dup 108 /l put
+dup 109 /m put
+dup 110 /n put
+dup 111 /o put
+dup 112 /p put
+dup 114 /r put
+dup 115 /s put
+dup 116 /t put
+dup 117 /u put
+dup 118 /v put
+dup 119 /w put
+dup 120 /x put
+dup 121 /y put
+dup 122 /z put
+readonly def
+/FontBBox{-53 -251 1139 750}readonly def
+/UniqueID 5000769 def
+currentdict end
+currentfile eexec
+D9D66F633B846A97B686A97E45A3D0AA052A014267B7904EB3C0D3BD0B83D891
+016CA6CA4B712ADEB258FAAB9A130EE605E61F77FC1B738ABC7C51CD46EF8171
+9098D5FEE67660E69A7AB91B58F29A4D79E57022F783EB0FBBB6D4F4EC35014F
+D2DECBA99459A4C59DF0C6EBA150284454E707DC2100C15B76B4C19B84363758
+469A6C558785B226332152109871A9883487DD7710949204DDCF837E6A8708B8
+2BDBF16FBC7512FAA308A093FE5F0364CD5660F74BEE96790DE35AFA90CCF712
+B1805DA88AE375A04D99598EADFC625BDC1F9C315B6CF28C9BD427F32C745C99
+AEBE70DAAED49EA45AF94F081934AA47894A370D698ABABDA4215500B190AF26
+7FCFB7DDA2BC68605A4EF61ECCA3D61C684B47FFB5887A3BEDE0B4D30E8EBABF
+20980C23312618EB0EAF289B2924FF4A334B85D98FD68545FDADB47F991E7390
+B10EE86A46A5AF8866C010225024D5E5862D49DEB5D8ECCB95D94283C50A363D
+68A49071445610F03CE3600945118A6BC0B3AA4593104E727261C68C4A47F809
+D77E4CF27B3681F6B6F3AC498E45361BF9E01FAF5527F5E3CC790D3084674B3E
+26296F3E03321B5C555D2458578A89E72D3166A3C5D740B3ABB127CF420C316D
+F957873DA04CF0DB25A73574A4DE2E4F2D5D4E8E0B430654CF7F341A1BDB3E26
+77C194764EAD58C585F49EF10843FE020F9FDFD9008D660DE50B9BD7A2A87299
+BC319E66D781101BB956E30643A19B93C8967E1AE4719F300BFE5866F0D6DA5E
+C55E171A24D3B707EFA325D47F473764E99BC8B1108D815CF2ACADFA6C4663E8
+30855D673CE98AB78F5F829F7FA226AB57F07B3E7D4E7CE30ED3B7EB0D3035C5
+148DA8D9FA34483414FDA8E3DC9E6C479E3EEE9A11A0547FC9085FA4631AD19C
+E936E0598E3197207FA7BB6E55CFD5EF72AEC12D9A9675241C7A71316B2E148D
+E2A1732B3627109EA446CB320EBBE2E78281CDF0890E2E72B6711335857F1E23
+337C75E729701E93D5BEC0630CDC7F4E957233EC09F917E5CA703C7E93841598
+0E73843FC6619DE017C8473A6D1B2BE5142DEBA285B98FA1CC5E64D2ADB981E6
+472971848451A245DDF6AA3B8225E9AC8E4630B0FF32D679EC27ACAD85C6394E
+A6F71023B660EE883D8B676837E9EBA4E42BA8F365433A900F1DC3A9F0E88A26
+30F9120B5D68BECD2760EFF272B05A79928D299242338556B2D3394AFC49F66D
+40AFEA4F628C8DCEB19B30FAC75DC14A5C835AD6341AC8183856C78EC4DA45B2
+B7E37FB4E64EA4060A8A7B98E61F268FC8316E0140F69A1D20750E90CBA5BA37
+D5EA17255543598A1B16B89941D2ED532DA282A1C10EB0789CCBFEB89BA1E8E0
+5B6A60AC34BF00A1AA51B7129C4A6D8D9F69863BA0DBCFD82A0772ED1594625C
+ABCAE4C4BBF2DA3325E08DFE62361E6A848C408569432F8509FE1C4ED08648AB
+75E5EAD9BF35B1F80B15D96998732241DD14A372D1BD0C4F354C0AC33627FB37
+9805CD3249423EF27F64F6E4E8EF80E8877B28ECC7DB24633FD3C5739F26081C
+C17B583E545485DB408D61428AC921DDEEFB73319F45F40D81D71C8A5A2FD4AA
+320BBE8D2FA0022C08EEA7F6281EEFE90E5E501FBC47E20E1F64BC9B48426AB4
+62BDE0388B27FBF7C272EA4C2C72105AEAE4B2E4FDDBA2F7CD73FC0B939AE294
+C1B00278E9DD47D24EF5466A6CCE5E594A38860C807580EA030A2F9B973678F8
+E4C1ADFC4B20B528543AB19A8688CE3AD146AFAC35E53AF0738381D568958B2C
+112BBB74E0AF39363C690182B7D25BD0FCC2F0EE6509C7C0329B1A9D92B4F9A0
+236A38614FB1B371FF771A094506149173757976FA499A0EE32BA7C2022B221B
+F5EABB891CC233F7962DC04DD0242B01AC384C4282F8698B46BE874795C5249B
+4FC1A64444DEDB4B9A8AC911027F927C3613B6409B220A11A1DF490A4A3B3306
+A506695362FD4324338E085B70E078267C5D1C58108E7DB20D5470EDF2776813
+1AC547836145D4CEF442FE39791B82C2BE53D1D8109237C0B491452404E7E76A
+35C68CB953ED7FA455963A128456F981A76D97DC287A54C0F4731441119EFEB3
+0397FAFCB81481914B1D40B92FB9EAB9998410D889B011E8D4E928BE13D8956E
+0C08C2AA040B208079C38BC3EB82393F7965D22D6B8C0135BF91A3FE611DE7B0
+2E5A48FE57832018E67DE42B3E7AC95012CCDC3761A1DB449AC501BB406327FF
+E7E3EEDB09065A192CE8AEF256C771FD02961B4E4F25AB7543911E55C805BF7A
+AA426A9604493D148018E034D70D6ADF3EEEA7DE4C8EA1A488AEC47F3B8F9428
+68AAA7258A31543FF5225ECE24A206CD27B16C0F58E9831619C446AF7DAE16A4
+1A2C6DCFD7ABB47A7B97D472A7DA466B1C12D25AEDAEA95473F7F28604CE4708
+EB18E4B2D2B302FDDFDAA80823C352069547E91581B166C639EB3C0F5AD937D6
+9454ADA401430B9C72470B8E6DD058A5D5122EF0886F9FE7AD43B0166CED4AA4
+E7206547790445FF2FE6D1BFFA1B62CE17417795678787A29C33F2CF438C0CA8
+FE09BF623291072570B045C5FE4BFB1140850599F6720B83A19772BA928A7E85
+0BC6FF87F514FA12851464CFB68EA245E1874B4D16FB2A907307152ACAFE4993
+0CDC152012CFF8E00942E4E6E7DDFC639CE97A9B68854632B32FD1A41D2B1F91
+6BED81C5D7542A2116E1DC1CF129CE273E8AC549AC25D4F460E4B5D3E97A9762
+53C2388A4EFD61C9BBABB7A2B27471A33F72ACA89C83CE7AFAA1F785A97D5554
+03B844E15CE41C46CC5456878836AC29A35A83BFA260DFD57D5091ADA855E9B2
+7FB74A44FB62A210B669E037E40D4910562E9C778BAB6DEC6F2935769BE47A53
+4777AB7B338CA7C3CA505A6D7B67D0EFBBE78788C3A1A4FD8EA80B70D0FEB557
+E17A8377A05931987CB8593D2AFC60165902640AC2015469B7D765266BBD2266
+D109E51AE645AB9E42F8455A50DBBC13E263A2B09884D93C19B851AA6F845C7C
+AE33FF5B702B2BCAFDDC33A565386EB09E3FE7D87AADA9EDA86E0B42608E560E
+FBE007FC7DC150A06E5DDF1A4EDA5CA48F54C85603BA98998BCA3651CBC62ED2
+4EAAA57D4BEA33A6C19BE6D1D89A2B4DE0577074D745E4A4FC4E2D8AD3EA50F2
+15A63B518D2D473CE04C23D8E6B84C2393839FA7BCE85FCE871895559AE9EE69
+DE82EFE9BC6DFF902404B5C470165AB228DAEB12D550BF2A795577F1749C5460
+6CC618242B4B7A6EEAC6913252E707F39499482AF0FB6C32E3FBFC9B7ED8F72D
+803BE61A7D49DFF212BF78006970A51D7768413B910EDA2C76913305ED2B95EC
+3DAB298F18808164E4F6F59AB471BDAC265B756B2416A4DA1CD19220983549B9
+75137DC63654007E3AA970D18DFBAF80F751F54D20F27E5574BE46141C55AE25
+00E47F9704703CDFFB82FEF3D50EF08D03398BC712EAA38F5992D82754097024
+FD89D42C308462160F96C1D24093A4D345B37614AAC0B74AA2FC98A699A83B0E
+3CAA5A5825B4323C43F9E06100A13250C428CC3F4EC537D2DA0F64A399447AB3
+9A30DCED71F0300ACA3E40FF288B3DA902E93F5D97A63351A29A11041BB90D34
+8CD4C3B3C90AD15A382CFCF8893D82CB7B0AD871CCD9DF1FD583508E5800E585
+8CAFBD98D02E889438BB2E56EC870ADDA2CB5295A7C607BE9A506B3B4030E5DF
+8FF020BFA5FD025DCB5E0FC84F1E30FB74448A7227E9EE54328E3D19D47F7BC8
+FC7F36E1EA81DC6F13FF669BA0351B9C17F51C17E91C81D7A162EF08466EF5DC
+209D9B914734FD2A4CC05B4F2DD106AD89E8F27D26A95B245748B16012496BD4
+44C6EC0D1FF3DC5ED042D1B58709DAA6721128948A4F5C0E9165CDE8AB8F0506
+685C919B1D3E357C2A4AAE8D3AAE77265A7AE397D10876D7BD97AE17BD30F798
+D9F6CD4EDA97BE4A9BF399DE47EC805936A834D0EB3DED941BBAA9F228E5E734
+2F9055474E24E0018F83FCE3F82B9009FCC2FA36859D8A6A8FCE6F28D0BA1E4A
+C97DC2C8313B71D423D821F125B51D21A5DCEA80AC3BDF60FDA991163899681A
+22221EF772EBFE7CF1F49162EAE3FBDC3324DF5A1D78A2F50BC0789A6B3D4592
+BB21F731570AB67E2C42C8689D9004CCA83D82C7D51D59FF4DFFC4CD9DC11FC2
+C36DC3FB0E4A366C168012A3F8A9174795AE03471E4E520CA4428E3EA40A0FD8
+47BE38A2F075CDE6F4BEDF80FCD828CD80D6115C4AD7857F2AB5ACA889BAFFA9
+F8C5E17DB135DD7C678EC7D527E9E17F5A0CD23CB64DF4B395B11A3868101611
+D3138BF6A28FBD447443654B214FE3DE0DF40F009101880630517D48F8E4BA01
+3BE9DF9730DF15899EAFD4F42D7B9D2CB695DBB476B6A33EAB158C0658750A29
+713EFC1D58514B6F0CD884FAE98F6935EEAB9F2C4F5226CF284CD5054D68467A
+C0C9C251C5926A25505F82167A25282FD17E8073C4F4690D74E8129E2831DECA
+22395876920B9C70515CF28E5215BCB66128A633B1B9756563780483F4893A6D
+A3A7D11AB5A16C658C386B8994B21C3B4C649E29FCB1DE9C72316B9AABBA44E1
+BA20B311B4C6035FE0E176701078E702BAA3C1DB65BC98A237FA23574C70DB58
+EA6581FB552D51B66B9D1A85270B94E5769510B051408BDC8F30230927AEB80D
+F6B2EAF6BDBDE9D54C2AEDAF4D22047044140D0326D1553DCBF9D48EE277E927
+C0F000A79625D030B1575A53D78D3BC8D387324209565957979B97FFCCD4B53F
+A353FC6BCBADCBBE51CFCAE7A748EC3FECFE674F35CA0A018C74B38D97E6B77B
+9EF400880B415786FFDCE5913C77DABA5FE4E79BAB6F01C39EA98128560C20A6
+37AF32B6DC62B945080B8B403E8E86C651A7BFD752D44272B54CE74C15496417
+7CE2BFD701D4063277EDE1B0AD1D5C66898EFABF1C9AE0D9841B19F8BB0F8945
+800DE3E96C39A51BFB3B345C59630FDF9810F839E3E5AE1599D230A54D97A581
+75895590722EFBEC0304947A16E25FAA8BC49C61E673CB7E1F57FF723431A2B2
+48E379817703203166C656F913B0BEB98294B6FE4DDBFA5FEDF6AE185A819DA0
+9487FF5E1AA49214077AA5FFD83F36CC6466051DAD9F91A17B6AD13380740FCD
+10759F6801A8EC31639B50B638D0B0F0B662818FEFFE56E7A8FF83ABE382D458
+68551512096783989D196D5037C318DB797B8264DFFC7FC0E9FB80D9EBBA876F
+018057AECE28F3531F49B1C17DD22332E5DA29BDD55D0FF69F4785FCFB640111
+2D199ADFF77560537E1784728D45AE8C26E445DDC400BE93BEFD25C40EA9ADB1
+9CBF3794B1D18E55F41EF89329B141E31A1B011005E84F9E2A6AB6FF3C6E2029
+060F32DEEDB3C15A94D17D6BBF8E0C740A756F28D8443E6FCE004AF079ADE4D7
+EAE5F2AB3C8FB22DE906747F490D8F2489DA22724CFEFC5A17C01E23B1812055
+B5FB3D45267D1F75E6E0CA716080936288D72CF403710239081602FD24BDA14E
+B36A3B4A699351C329667079705D3BC9EBED8FB8C95EAFC6AD373F297B71D48F
+1155DF19F1B8EF931AB5262484383CE2C2A9C5362B334D6CEF4B2B5FCAFAFC76
+8445B95F83CA0EE87F43D1532290AC22A9DF1F49D050C7108AF344AB130DE218
+B984A78CB40A6E63C2E1D98D9FE12DEA4E6F5678973C0FFA26A27C1062ECFF07
+1E2943D915C88BCB268FE00300062CBD46FEFD3E19478414654195EFBD214E1D
+D50BFA5080F5CA62C531524BD4CD00F76B7FEE45790575B8E5C3CBEA7CA5FFB6
+26B39A29EE3D4B5241148C83977638F697FDBAA48E74A5CCBE78EEBA9F66B0D0
+65955B65C74DE8E3A0A58DE5E5A1A2644E9581E1D28DD51334F982B4AEB4CA7B
+E6FB9E18F04A7358137AEBCFA8B551DBEC9918E59C6F13B5DD824268B7DA1EBD
+DFB4543FCEFA1EA9E4CC616E50649CDB74EF36C21CDF107C15CD2F48200F6408
+7693728F926FE5C213FDF4B01004ECF29B3442DB2536801FB11BF6AA909E061E
+357DD27FA42BFC0EF29BB666B648AE2406117297BC3B8C0FF2A85FC06DA9E6AE
+2A3071F54C5089DD01FF2CDCE017B555C7290C43A8D1A0FEE2D4C31B9C31175A
+8EB3D06609642A7DAA92C83EEC3D267D9EFE7AAB6D11CC81776765D41ED4CC0F
+F3852AFEB2D09945144CCFBC412BC98CEE2B6EB095A8AEBFD63B3CA62252536B
+9F7DA27ED51F52808AB64414D40CEC52A4BC708A553A85CC07EF3C20E58B76AB
+BCEF9196248639218D4A9B4ED4F6808A03FBD3B87229EC3B54EDB524A6A2C6D7
+AB668DA03F6CF84CEDE09C10AF1237DAFB1E708E91C23655329342B13CB33177
+8BD366269C3E2DF9C3F8F0D6C2EF6CC5EB72EE8334B630312459E70BC86F8A3C
+A18FF90E93C35F099E2B4F542665C24EC4B0CADFD2C08586E314F70DB3566AAF
+25DEBDC91297375713BFB9A017F406041178456254FFCA58DE0BB7D057818C0A
+DC55F4BE9EEFA036875771E9C3731E168EAA630C099173CAD49F79FDFD652349
+6C5412148937F5E4029DFCAF96609C02B89CC822B921DDDFCA4C03E6E6EBBC3A
+53CEE94A3D32803ADB908D1701DB22688C6BB592B7470517A88D5E41A885D63E
+76D8DE07BC06C8EE3084A6A115710062BD0F02634E728D6486C96942C8E25C34
+4A623947C59679119886D4F9FC2AC56922CABB4183B9522BCD92995DAADD2765
+C37878B053967ADE6951AAFC96B65DC9D41DE3B949EF525BE8FC8F8416E068CA
+0F57E86CB94352558E149B3CE1E63092A34D3B66BB4570E47E14A279406143EB
+419B95C41CC657CE2C35C55DFA1BFD76DC25CFDC2D336B140140EA1A0C7557A1
+C4BF0A7A945A1B4FAB9E164A02CE12870E88E1289851C07D188BCB991138F904
+DEE442CBD50104A25ADDF51DE545F0C8CAD785A7E69310FBA0BCE3F3BB94E47F
+C270328317158A50966DEFB41BC102305344B6F7BAC27B2CB3D940504D5BA1C1
+4D37AC140D2F97893A105B6F97E514C2D6E77CCDD362CBA21F748CAFF695AAC9
+1739F73788E70AB3A5264100634ABF50CA2455B9C7E5C704A325209DDC9ED965
+A87C94AC54B615C8D04BF49974C08E7E1FCA6498A2F2290E1BDD47D48C2DF508
+5A9B069FC88604F03BF7A82AA9B2955D67BAF42CF432E161A766405C81CE57AC
+B11D1DF757C4FA78E35851178DF5F71C4A68490B87B489FA5E8729A4125265B7
+38C5396EFBE728B937681876BC6BCC99530F60DA27C7E43D8FA024A31C67B540
+2D1E35B1CC787964C675B9605B01C06B84C607EA9C8FDE717573465B0F293C0D
+2530C279697D12EF6E2725B595EF1CD214528BF27680D2C78472885B79C37CF3
+2AFDB20ECD22ACDDAC2189BCEA2B626E5F037697F3A8AC9BC2B561419E6B8D4D
+84D4455717D3E4D98719ABE57D0E3CE19B607B648D978ACB50E2DCBE5585F8FD
+B920B704FC86A66DA57533CD1EF07E04A591C8E2DCEED2A9263A4E3282C543D1
+73F00A12BB0F2012715E2FB63D9B302C2A02CDCD477548C2C9DFF7CE4D8C1E58
+25F032A8A53BDFDF360791E2BFB3728D11B5181B96E360E01E7DC3592D458397
+40416D8366FC337F3E800C770000A5757CADC6926CD92FB850A14361E53458A4
+3BB094E0E6ACE900563083BCBE1D4FD77ADA63016E1FFD81EBD968CB12D74EE3
+4A85FB7FFBE0120A8088D2F422CE82C23F13E238C08A26A7950AE8FA510C23B7
+A266BBB8E1736AE39F173A3A852F74D546150362EEB296C2DDD3D0A22C476144
+4464B9AF6013FA49584C34E6E84906569AB66CABCE55AA7C57461D86243A6897
+74F689A505264C1B6A0CEC25BCDB16A3D614A23EC7F47A99B27AD55389B3FD16
+736A865C42A463E095BAB5B5F342F5C0DEE3A21DF240A9F2D078419013A08130
+B3DC17E5D57E3F35BF8178F9EF4BD9FBF0AC84AD30001A9B8723B0DCC7AB26C2
+B4C7F26D6023E5AF31F3DF097D963E5B9884374AD89AF018ECCE8B93E8AD02F1
+F7F316C74307855DE40659D1679449D5AF946AF000249DAE7E0F1A38BECB6A54
+09AF9753F1B2A810EE0FDD1F098B6F9E77A2D1EA57D9CD40EB110F6162402B41
+74A02BBA4C07952827DCC3D13A5A2CCB98F4FC84068EB4CF645AC15D73B0047F
+1F0BF170DE2E47152E38E07FCE39B0B206AA8E00AFDF0DEB4F66D4ABC6DEAA98
+D08C95134C6D123D53A27331D1452CEF4729C9DB9DF837A4C24358BA19361F06
+8E85E9B7E1561AD48B932EBAA8A17E65A089416D69A8D7C190EE6BBB36C1E137
+674607E7E58F7DBC4FC312690CF2E5312EC38926E212BF66116BE9C745A620B6
+5AB01DC0721C876EFCB1FD61E23885F27960671F7E52A48CB2F374D1F8AB5472
+FC88F8BD4C6C847E4E609FF3277E1E433FC0B02D90965124AFA32C34DC777F2B
+18402FD4F8CDA9BE2D659E3525BDE9819AE92DE8ED7D88416FEFBA1560F73DD3
+549568F06074123C8E47D96D7B1CEA32FF6F65F2C801D9589901E26C50456A3E
+12CFB9EE28DEE53DF5958B1B8508C342495D84B25DE2C5307E083D8B0A639A09
+6012F74F4E4C83F815EFF3166B767F32D025C1DCCC7E8ECDE5E0586357EB421B
+6188E495724213CF39A6577D303D38670007FAA01A59C0C7254FC7B8433B077B
+434659657724B1DB6DF157051193D1910E4D75F71BC5D920A06D3880488BFE58
+52F3E9EECDCF1A3D8CE9062D696FFD586BE06E074527594B56BD4AB18BF50ED0
+B33849008B3B69D813A2FD566F03871F30DC30B5301C2B5478C134595F0F171A
+4C8973B0C277C46E229CDA08C51A90C88F5A896DAF6D4DDBC643E4F4D70C5524
+5C6879895CCE918B5562A66BA058D29018A315AC0EC0B5BF002826CFC59018E2
+8F608719E51A4058E9DC7E039BFB9AFCAA973A708C49E363778F4C71FC9B38F1
+2CF7003E44021CF15A7DBC92C0FA59FCACB4A69ED06FF0822C793CF3EA488D86
+EA67C3DADEE343A3CD7784E68AB235F9AAC6FDAF33532FE679C4B90813807E3E
+52A59658EFB7C673B657B42D1CDE58F5689680845F8CAB01AC1189A5522085AD
+A7EF68C3799D99629D98B6314A987CBACF865ED03AB4AF6836A44D76C1FD3B38
+3AB7FAE6910C21B78B1F8F51BA6FCA2B07B817DA65A9E36358206A7C9EBDC0F8
+E40FB1A535BDA30521D056BD42F03FFD2AFD3D6CBEEE245399A4EA14CEEC08FF
+16738290E4CC024E04D5EC6E04B880BA4F5D99119B3347DFC2CA50603233A78D
+535E4EA566D7002673362D495BDC3B19C5C66B0768493B72890ADA0FC40CB488
+7127D17462A51E685FDC326C56BE55D6A9D2E2394EE34C7001481E24BAF66D43
+229997ABA2DD59C92FEB9D196F7B19E3AB2305530247E43EF39E9BC652FDCA02
+EB083D605D6B692E7EC68519313C9511FF6E08AF28EDAE29BD1F5F8AA756C2B9
+9D3EF42A8266992EB8B70D3D3F005083375F81EB1EF835FE302B5449E00E42B8
+1F187E21ACACF186878BC590DA78FF925C97371228D805C0900A47058BB9AAFE
+A073AECD0315F4AA869F62D120F6F0EBCEB7FAF7C0DD5787328A29C95E3637B5
+368C09FCF0D7DB6D4DE4563D5F4E91E11D473A2535BAA5E9D770ECB33340254F
+B0EE312DB223E7D8E0C0E50CA8AA9B4F2C0DA7EAA1C73C421A8E7C1378207ECF
+02400E6578A2A7B1FAB6F8D9E4AC8DA278E336C8F97F7A8E5A266C7C6DD1C5DB
+675E99C96E212E3316CC9BC27BF1467FE11659357C64E88DBEE3C9DC40830C2D
+A97D1909D5F0A121601C37E6042F1585EBCE53C81C982B27072731F2606D252E
+F64C105FEB9562793117006BF03D6F5823E35B1F6940A5DB0A37064BF946A03B
+C8CBE22C69336D30DB90C164BB87CBE5A85559DC0BA7F5319AD26EB75F8CC542
+2D93A994B74866763B9D601E436882A9270BC59F25323E74434C0664E7648BE4
+ECB5233E102409EDFF6312E607E0C50E593604D599608A76DE5B994036186149
+A4173EA3B5736CBADA440E3D6A1A164679AAAB1905092A09F72EFF9275EF3825
+CA7CCF3220BF6373ED846BB93A60136313C28D503B4E52DFC0836BD2E79B4925
+2B35839546DC9C5EC7E31B1691E42D5B7A5B08D996E8CA7A022469AE5CE0F822
+5F4512E57E3A33AD5CCA2A15C4F4E2EA8FA661007AD8D42B03EA038A2E334304
+4CD3EF2267D9DFC07410D0C901565C59DFAEBE8A5E5D5784B42B6DED4DEF9B3E
+B5286E3E2B84532BA35AC9A7E960D71AB46F5CF6186994A0F1867E487D720F1C
+C02B7D6452E70437913997DBDB6CEDD7C4C513C2C7C247B4F5772B57D1ECF6FA
+1A90353E93E281B7164C8FDD306B144F7BA778C09054E114D91093C1F868306D
+95F6BF93C3C8094E5D0626944F3F71148708B01F6DECA86620BD2A3BC73D5CAB
+B674FDD7C6EC55160535E5F5BC9F5C8F3E8A0F0FE7141478AE59B7CC1EE19AE9
+1C675713DE0E08D2956B25ADC41B53A1C2C8F38759D70E67A77B713C30B79BA7
+3DB4283458FCA7CB2D95A31CE3B3A04EFA013B78E92B36F641DAE64BA4ACE916
+CB0549FC82B84A74472CB678ACBA6146926594ADF3FA6348C7C45FB674654377
+336EFA6E3051F80364B20B47DD1A09393E8EA2ADBC43BCB894A0B745343C71E8
+646259020347388041C99ECD19020ABD3278823329855936567B9747C0A1D40D
+068E885373A197378C3BA5D3A0E2AA3764B0279D09BC0B94E0E357E960ADD781
+562D034723651F252A84269C490B62A7E8CF561E27A0275067FFD1AE27A1EB5B
+F78C6BED02817FC265027F2EAD8EFECE39CEB41DEC23711CF9160204BA9840A3
+72D55F620CAC88E4665FCE1FFE055DFF07512C14C82280CCF6694DDEFCFA5FC2
+B337CCCCC7E6D3D7BF5BA4CB241B1C818F12721CD7FC5557E0D5017083B231A9
+1CC96CE60521F914D328FF3CCAD7F74EC3FC88C76A8D0099888899F5B16BD439
+FE2AFE24EB1A287A3A97614D48DF9A8CE04F020A013553B5262A266404BD8DD6
+E5D75F473C5A3142F38CA2FBE23DDA2BD9B0E35970AF75F29367D4FC747F46A0
+EC3027E0B95CEB155E32E466FF96C5FEF75A8D574907272E55E6D0E4F797A479
+C67AAF5FD4E2EAA07A411C1AA77E6501F0BD79D829E7FA1286FB6FCDC0D92C55
+16A84069BCBFE35036A97F92089392060F801C1C10583D3F2FCBC45A511BDE82
+792CBEAB8A3F2C12724CC0F417C29C3EFA29A7884E410B0F6941B76889FE222D
+C445903ADA57F4329F92D7B85DBC1382C2E97F1ED6B790BB7B67E880492D3B22
+83D3516E3D64210D91D625700A411495FB414D4BCEFEAF1609775E7C0B9E2D66
+B91409AE0C7F5102312B3A8297F736D67F12C6DA7DCCD233C811232A3427D510
+4B0FE3595C7D504FB538BEDBCBB5ACCC351E6B373993627852930557793410C6
+A9749DEF6CE49076C4668639230BCBE6CCB7DEEA066DD38F4CF4B478A69B9924
+0F32950D35B1FDAAA12FAFED15B29CFC318695059EC9662F73914DFEC5711D89
+50EBB6A5F4DD2375A117C37ED7133E723F4282847B44E945C9847DEAA4CB4651
+A75D718441800059F4462CE161F93030F7162B64A7A27E2C7D22DC58C9FA7BAC
+7BFEC0129364B7CC00EBD99ED2227AC5F4E92E8ACBEB9AA5DA474902BE31217F
+A35FE50318549B224E40833566280565779EFF8112295CBE57C67AD6A7293DC7
+F1B37E4E7F7680146111ED412E9162C011DCF1E7082EF8ED26FD828A5C8CACBD
+2D2A025E54CFB16569A094A28D1CA0271DEBB7AB5212B99B17E01A404A5662CD
+BD730B0A8A9A2422BFB9B61BC87C0A563D76E5CD86DF4160E2C16D8B9A47F593
+594C28F7040AC90E85D095340CE2DF801F86079C0F068CBA2203A1E8D3705D33
+523E68C785C1AF5B6244C1A87C324DAB10550D4EF65512924E29982C87DE1D29
+48ADDE7B22AFEC4BAB60D080BEF4E66FF52DAED7CD155BE21419E1B94AFE5E43
+57DCF2472B5C0F74C7D703263F28C0ACFE07C8BFCE0E031132CEFFD6721BADB0
+A0E3AF7AFB6F4152D3874846B0B9D9A1EA52A4E37ED39357818B697142C75419
+9BB08A6DFF9B377675C4340C38515FF4B82785DBBF0C278F81D4CB103B6E4F79
+C86A17A08C0600C1CFAA49A1A3F0A7A9FDF679B60A5255F62BBD287A13947CB0
+E8974C89757CFCB4EE1E96591F419D1D5D7FAB7085FC331E5212BB797DAC7799
+D6982FACAFB5680D1B56299B2809BF4E44C161C6FEFC751F4802920EB60D76B0
+E53F27EEB5FAF99E7726D1DDB419E3DF7D00A948FD599F5756960612AB2CB642
+A649C4DE54CEEE4DE833D45DE01AD03D2EA4BED4DDF24CCDF4FEEC0C17447B66
+944A4365CB1EC0DDCCC6E60866BB5EB428A93CF63C7FE33A7F5AA3EAFD122D9F
+DE0A65C2B717616D623AB055B3C36663F0D6817D6FE62FAB8BEA8C8E3A862AFA
+984229F100B7624ADA6C4FC5D0423A73181459A4B8CF7DDD53953296EE53F25D
+5687ACE532DE823007717BC2C2F2F7E5C9B38EF5B1D547D3C882283C23E49676
+A692B2C9F7EC7FE1FC9755BBCCF64A66A038B9B2B0BA61A40F2546ADB3E25385
+D8273AF875376F91AC421564E10EC365A35FCF8668BE134978F03380BBD656A2
+20E03E025B1332EDE4510EF403F4A37CB2A5C8514213BB80DDD1440099D9CD03
+1DB8E3F83FACCA4841F962F2FB8314DBB5D40B1B34EAF898ADC67D1E2F861C07
+3F29D20872FD0B323FBC51EB4B21FFF1AAA99610D40D551E2965840F11D848AB
+6E6D52956095C01EB4F31BDBC1052383E96BDC5DE7B93EE035E4D5986583A813
+A5DFCF70DB4642BD8DD9C6C6CE58521DDA22930DD47D71114C0CD65CD5A3D4C1
+E4B3E205E2526B5D24B2F8B50F574183E47E342A7ED61E8A793B6376FA8EE965
+6321F95EFB694008A71DF96D0D1B36FBC76009197217D2014ECAE2F2B94439EA
+DC2DB2B32415699E03B36187B3C30C55A7577E6F50A2495A383B9F4C247C000C
+ABB96BB60CD65AF0AB746B967F3CFDE6C3E5FDB217F66FFD208FE5302BD15D21
+B90E4971522A50762A92B1570B97305818420DE85BEFF90B403D6A2DC4A512D9
+EC903289EBA22A21516BC2CAD2D3D8E5C5F1189A53F64FE0189647B5362C1767
+5157C247B6337E6C54683CEC58A60D2B8BA4764E247435C431FADE130E1731D4
+65C51B3C6F45245DECBF9C87F47F6AE37D749435540B2CDC369A174D2AEC8887
+E44A283B432515947095F52D81119840D4106495971D8DFF4B6A9E4C1E94BC7F
+60A5A902CB4139E464EDA500969AB769475D35CFEB3E3A9BC46DF5764FEEA4B3
+443C33135A763D4EE2C6BABCA1445EC34D83D2B6C1129B18A6DBDBE5057ACDA1
+08469B451DC9B92530200BA261EFC14AFEA857FAECF91F33CD3EA908BA7CB3F8
+D6EEF182F0E179F5C0A07676EB400851D8E68AF0064DAA4050F31E8CD7D855D7
+AA9CDCEFB0CE3034E0236F5875B4B5C6B44EE281E4FABCA95BF44E8B61E2ED29
+FF923B5776D9077F538E5515BCD7BF887A2F788C5316ED1912ABAF6B81F1E68C
+B7808F35B9639EDF4B365101AB6CC062796EC51095474D458EA80AD330B28B3E
+211B83BF872A1419D64AF3DA29881EEB7DE22A762E618D11DCD8BEF3FBD17654
+2A43FF85E3CA94B2D0A4CC9C70274FDD3FBD91B8EB174AAC321CC7C33A34BD30
+3B7669523932FBDF59C3CCC9C5BBC91336C089B467BD8C914C3C3C3018C4B142
+9FA152E6D3AC06DDAB843420BCEC79177B0200FD92E402E09637F761238B26DD
+AF985B29427DF899776AECBAFD4D49C227318A214055C8A4ED08AE6A83F1BB49
+2A64FE1AFD21B7515E78C7159070620FDA247E534073F4063CDE64A2C28EDC43
+551005A595400C3C9E09931DD236CBB26E5EE994ACD52B7A07BA117B90166907
+6658A7F7DFA1A7A64D331DBFD238BA0F4FF49F7787726887E9A5FF645E42B069
+BA0DABC24EFE8C3A3F46181226268EBE43BFC76019ACB3DB5105D2F447CAA71F
+99AAEA61E0D9799E499A54EAA0C3E9D4796A161412967B905676591E9C2FF38D
+2AC5D6B689BB21A03BD710426C46F5336BABADA764E1540D7D85A2E634DB1E45
+471C8DE25912D226C7B05C135696471DE90926D8A0DBF6B5FB8B8E8181E73BCF
+4A32D4C090EED53516EB0B4E78281450BBD29D7013FAF10B050C2C383615F259
+44528517A287CC2DE54F0B5A3416A6C18729D61A4513C5E6E5C63AC58CC81064
+82B99E60AD15596D78888F6BC95BD8946B24DAEFEC81FAA4E4B428CC503E6BA7
+21709E66DD93B2B6076291F2751DBE1B567381E312933D06C321D7DD9D4B2740
+6BBF5480E3FD421D626444589D1FDC9341968B9F6F97EFADDDF1C4D7515F3860
+B0A5E09219004FEFE2ABC37DFDC2580AA960375DED53C61125855EF319844E47
+47CCAC4344DC9FCDF7264F4E5C12F9FF8199D53B84D11F1EA3C66DAAB5C3F938
+82E227D5A9DE972363809650E181A8C6394DEAD9A63794CFAD2E5187BA2B5DC7
+F43E97213D7C015D2CBDE1D1B5C0358513A6E55648E52740274B5460FC139C76
+36C84B11B87B7181F8AA618B09A6CFC947B334574CEB7E49BDA8AE8AE21A91E0
+6AA1E68E4B8508BCF537AF7F5FD12CCD03B023E0F0D73BFF48551E923A60AB13
+6F6D7AF0CF7725B1027886BFF4ADEC89BEC7FF86A43A38120BF6AA608D29BA39
+BF0AB389EAD8E03767D370420C839003312F8EC089846FFB938BF34DCBAC64BD
+5589ED3E91DC306C60F68F80B295C197C8FC71E8E9392CD48CDE019FE14BDB39
+71A1F81A603EB8A6BAD4ABC80AA2F97AB519AC421654392491924118EA5D2125
+F98B30F4EC431644C3D19D80BAD822572ED1C2BF3DDE59E666B49EC2AD951C7B
+0A26A74540188DFAEBA45EB867F4AB557A3952D773759CDA389D33DF00A72F9E
+AED85F6E5270D4BF433D341E57A82275E62255DBD4E05CF509BB747E7284BC31
+4D099DBA4573E46148474AF9960AF7DF5FF05801D3B226899C6C8BDE8D3CE081
+4ECE625D6E28B346D8BF38BA2CB7C6349A7D65F40024D022ED29F91D03D092AF
+018EF271904F201B0CF9CED38B42735955904141F1148E8FB52A09DA7CFEAAF5
+A06A4364B61AAEB1F355A4EEFDC5BFCDAC8BD2FFB3214DDD3B3E034407B6E12B
+B646701C16AE8051E1E0D8BFFEEDE561FFD0CD4171584DFD05C1EC5C3CEBC090
+F0C9796F371E6CD42D6EDE1F665D37DF6A7495FF76E696D72973B75E3908AC46
+74A9F73028B4D1B402F047A385765B883038E2ABDE88DAF9DDC58F0F052548B5
+6935E08730D2C8DB763435E349822BE7706B4EC5C022A346BF860698E4C395F1
+CFA57DEE349F1455E74A627BE0C507717C787943A4DC930A7175575CA75A6E0B
+4A0166C4B1AE5AD59609301B1CB0219A53D7F70B65A6E4DE738985DD299E1D26
+81587BE895B86BBD8CC8C1C989713C81300298626E3A436A246012F00621709B
+A0A5CA714FD2CF82563A1ADB27C2092E883FAC88AA5ED6B1D99C87C6B6D29C7F
+682FBCBDE8F414136BFD00D57BBC8AFF06EA06CE58FBE6E1EF22C36FD14ADD3D
+C0F21F31FF1C85FAC0009966B5A7273BA5F1A671F498B4953E2FF8192A1800D9
+3848A0EAAED1815280F9F44D131C8C733EEC41AAF3B1873C7BD5C424A060CDC4
+044F1BA3C5F059D38B99CAC7CB68FC3316DF2FC2EE2B83D720CB1683E7CD9DF4
+D398BC6B5296CCE3E61F9F8EE7F9C4015659298959FB51174C5A4961A608364F
+6C6C371B6ED3D5989890BB2FE62D84CBE7EBC74F90EB3F153917680B3067F26E
+690228598B80551D61612867D475356D4C6CB9EF86113F047046446568298BA9
+B6D0CA5D9E983CB8F60E8D9228070AE17C4A4A40CCD45EAF094F7C
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+cleartomark
+%%EndFont
+%%BeginFont: CMTI12
+%!PS-AdobeFont-1.1: CMTI12 1.0
+%%CreationDate: 1991 Aug 18 21:06:53
+% Copyright (C) 1997 American Mathematical Society. All Rights Reserved.
+11 dict begin
+/FontInfo 7 dict dup begin
+/version (1.0) readonly def
+/Notice (Copyright (C) 1997 American Mathematical Society. All Rights Reserved) readonly def
+/FullName (CMTI12) readonly def
+/FamilyName (Computer Modern) readonly def
+/Weight (Medium) readonly def
+/ItalicAngle -14.04 def
+/isFixedPitch false def
+end readonly def
+/FontName /CMTI12 def
+/PaintType 0 def
+/FontType 1 def
+/FontMatrix [0.001 0 0 0.001 0 0] readonly def
+/Encoding 256 array
+0 1 255 {1 index exch /.notdef put} for
+dup 44 /comma put
+dup 46 /period put
+dup 66 /B put
+dup 69 /E put
+dup 73 /I put
+dup 84 /T put
+dup 97 /a put
+dup 99 /c put
+dup 100 /d put
+dup 101 /e put
+dup 102 /f put
+dup 103 /g put
+dup 104 /h put
+dup 105 /i put
+dup 107 /k put
+dup 108 /l put
+dup 109 /m put
+dup 110 /n put
+dup 111 /o put
+dup 112 /p put
+dup 114 /r put
+dup 115 /s put
+dup 116 /t put
+dup 117 /u put
+dup 118 /v put
+dup 119 /w put
+dup 121 /y put
+readonly def
+/FontBBox{-36 -251 1103 750}readonly def
+/UniqueID 5000829 def
+currentdict end
+currentfile eexec
+D9D66F633B846A97B686A97E45A3D0AA0529731C99A784CCBE85B4993B2EEBDE
+3B12D472B7CF54651EF21185116A69AB1096ED4BAD2F646635E019B6417CC77B
+532F85D811C70D1429A19A5307EF63EB5C5E02C89FC6C20F6D9D89E7D91FE470
+B72BEFDA23F5DF76BE05AF4CE93137A219ED8A04A9D7D6FDF37E6B7FCDE0D90B
+986423E5960A5D9FBB4C956556E8DF90CBFAEC476FA36FD9A5C8175C9AF513FE
+D919C2DDD26BDC0D99398B9F4D03D6A8F05B47AF95EF28A9C561DBDC98C47CF5
+525003F3DBE5BF07B2E83E66B7F97DDD7CE0EEB75A78BD9227BF359D002B6ADB
+8AC57A33FED4EF021A7085B1E2B933DE602F0FF71467ECD501744AE338AF29A0
+26F7D368AC6F25CCB882DB7B7343566192BD687E1349225982823027D3B66703
+3B0DB7A7E680A682B98023D39C7FAE81A5D5B867A0A66C8AA0DBC83B1596A84F
+0436AC6A7900B767BDCCE0060A4811003C79FDCC71D73F7F2D0A6675E93AD21A
+56B4CD8EF75EED3DE8C0A18BEBF7B9D1BE72504872D56EDB272F1E97FC726CB6
+68C85C713059DA19F6C2E0F3E12710A59B6FC4699AE883DE8C8615B7292AC25C
+D5714B6CFB14EF0EF11EB13009BEBA4F345A5D3D6D9926ABC2BAD7DB1328651E
+437BFB3C46DA7B62219660FC368CF3D3704DAD3AB461C28F711665BF484BF61C
+052093D231CA65618EA463D63E406ECE858D180A6C0589B2FEDC321371C28E77
+DE974D655DF5FF7D41ED01FE717D928A885F6FA6CFE4D2C0807F8E7F937916E0
+96EDD1A3BA67802B1F4A49100E75613BA0356D9DCBBAD4DAB3C59E70A47058F5
+2163D1730F0EE4D1F87C3A4AE723A23CFD7986FC4FBD399347E9F5946354E013
+D860FC446AFF0B0744F5DA27CC777C96ADB388D1E835DDCBE123FB517679B9B7
+EF696E091A9D51510BE264701A41C04FA8125A48F306ACA7A83E35D5BA0C296A
+BC594ECA2CB27E92FED95B595C21E5BF0DA724D40761CB377BDE5FB98C9D152D
+6C0DC98C4083E9656321BFC445CD6FCC142DEF16E27DD6FAD0B3185223B1A7D6
+779F39C70793184F2C3B721FD0AE6D8E063BD47804785DAEA74AF8C75483B713
+65061653EAC242C94017DFFCAF621622976599273AB26CCC01D416BE138554E5
+B65BB2223F6B14C50E73F36AC356DC79B3FBF952FC122C03F998D8FB864A1016
+383FF882E54B9D79EA9B1312F642F65EF4AABBB287B2EDF49C7739D348F91D6A
+05BA157F5E5A76D4B795AA9180EA6038D99A2FE1115F9ADACE3AFF92A6516471
+575A9BA4FA4864732E2E212E7108602EAA11F09A5BDF46EBC142C87C335021BC
+565A23EB74AE6C73EFEB241E1E699B7127DFFAF97C500B201B302F5E65049614
+C244A2C2A759778DDCCB0395A618FDA2E43A22DB965D50D449DD0B7CCEA27623
+FCE58148785C4CCA7A9EB21728800BB42F8CF67BD59A0B41716A612D073212CD
+79F4B7CB121CB4D4F0A9C4622E4FE3C3F4B3B5B2C47BDCE828EFDC022A9CBACE
+B3E95EB808D3BBB53CF2381EE82D5CFF553D91B8BF6243A24FCDB7818155D2DD
+FA88FA69ABECDD9929623A7CD3D9328A91A86BA7AD8B982EA0A2A25DF4484249
+52D8CCE7B61F0882132EB758AC3E60DED4EB2698CDDDDDC0B41088FB48ABB4B5
+B659AD42EFDC98020A67B1A5083ACB6016293E243326E9D4C449996A26A78B14
+703DEFE767064FC68DBEBA3437238B2A75148602B4A95B09BB39B0CA598A96B4
+790708D8175F17BDDDA368A4F947C6CB585DA9264248A578CF09668AB49DD22F
+3AE0E9BD5CC99A16EF13A1E0620FA06BD04ED1304D546B84305D87E2EE3AE02A
+82E84A2115CC8BE27AE83105EAFD260864F7B74BE9689B3E382B5E69BA22C23D
+32DB915384B0C2B360688E81FA25233891B4BFC32DD12CCFE68BB6D6456DF0CD
+DC9CA760A90CFDD3257578D2F3DE62A94EDE436F482A6F2FC835E9B19CA6628B
+E8AC15694F065F8FFBCBF366097AE86E4F515847054045EBE16F1E512B7FF632
+684BE07159D536E194901F55E649E65B8CAF28412637958EC29D38B99754CF2A
+4497015297598959ACF5A655AFC69CAD1926B94615C1D6757CD798DE1E9AB30A
+FCE19F55880A29A8A8F6935970213E6A8D5BE060E91D65A6DDB75266C734EF53
+9E1F0CD5191D5335F1B6385642507205D811AE3A277BF308CEB10E14E51FCFA1
+EE60775925D7D86B2C72B4DAB3D29934894AB068DD14C38D2962FDBF9B4A98B6
+380B21912B0025450727D665F07B537991E4F8E2CA726CF6DF43D4C34F8E6512
+B58D56F3B5296B8B6829D5A14D5B6055535ECCAF72384F992AD32A1DC15D4711
+3F6942993DAD163BB620105F8A857ADEE39E2EEF937B24996EB4328A84386908
+A5AD80C9A90DC3A724AF80FB81E12F2AC53D37595D9FD04B4994B35B12CEFF40
+A9686EE47AFEC3760CE2F3C08D2A20331F6543C01ABDC21094CC4D82A8ED09B1
+2A71A40994F6070E932BD6449183193A0CCA601D3CBE5801602E30E6C3FF3375
+3A1E4CC79799C468F0EE64D8A01C610DC2392EE067CEA93DCF5615C82AC53B39
+BD1783EA50A8DFB81CE33E468A36D70AAB02B464F6B82EA710BD4DE0CB22617D
+FDB28466F045C18520F1482039F458007A914783D4EE9713711A9980E703EA0D
+9A945390742D874CE43B43B142A58A3B437B8B6C2DAC46136446DD8C5194974B
+92A79E64CE662149F2B95D34FB650FB2A29CCAF3497D151F353A1D4C1EA5CFF8
+768152739184F75077EFF5D7949484A86DE509A1055006F8153922261D394C45
+9A24D95B9CA7E0F87BC9B5EA9E29F4B8A5F4994085D8DB4AFB689D2D20F3358C
+2718FD0C1295BC9A222CAF1FFE602776A4DC4F9B56D6D4415E3A35B1DEED63D6
+4B15A1A81C5EB8FCF8531F1FEEE887C83BDBFCC0F7B14AD04FA4FB0BF8CEF9C9
+41B8C5EAF45ACE45E025E25CCBC9B29FED9F9EAD7326289E7D6AAC834051A91D
+8CF76BAE3FADF7C6883B52FC630932B6F9CE2F05423908EE78C5DB2B3754AC01
+A6080CCD13AE3B518B48042D2F72E07F687E803A289CC6FD308E66199456E54C
+F1A5892FD29002D2B5ECFFB7AA4C72AB55FAB496072CAA41C933182A494656AF
+D9A7DF0171BE792561BC2FCA4FF0351F623B28B0A84DA9E837E52B30C0A76CC3
+DB3879D6D57D63BF94A1BEAD666152C51EA25436B662D6FC4E1F27D8933E7ED9
+7B1F44BE7417737732F25ECE2B4FB8B62FA7E055CF0D43A031136FA21A5769FB
+1FF383A8B89DAEB0FCC042873D5094911AFF7E74718F8917FA102429C8A7CCC9
+09ACA2DC223F4B9F308E8ED7107CF8AA464A79137A5E11A9C72A27CE685022B1
+84D99D0AA2E8CE9D152FB8B74257826AFB3D7EB33636271A1FA1E779F339BB21
+E6992F1B0A70977B14876F7797E32AA6917F07F7E5C1F2E27430AFC560F47A9C
+3E79A919532F8BCBE51650CB379AEB5C19914F17E42020BD78A3ACD70A701319
+45F9278F83776E6D83379557679C1D042D3865F328EAC7911C6DD5CAAABD63E4
+31986D19A9ADDDF6141DC95272EC26352939842AB2B103E46FDF7342D1A04B99
+F8AB65554349867F3B3A3ABD652FCEA4B40E7A1037B0750F93A97A670CF1E384
+767DDD69FA4D98E4D07F205D37F77CFB2BE0514C1B9F83D46DF5DF23BE1DF78E
+E2F4D95C414DC2FD3658632EC905AF59D02957B05D85AEACFFA9D8443E7D32A2
+C60908C55D567D966A776D9A335643F3B6DE4E12783AC8F4180EB5CBB4EACEBC
+4D8273D98958E9BBDAE3C75C1429124AE5984128A59C27155626C33E90BFDC08
+74298342E76C2B7CDBC782DA8DAE74F4B78B1D75B9651F1F0D36CA02A9C2B509
+8090F20C99F3E947673851A1A625460BC66FF2F04CB480615286695CB1A2FCF2
+A9EEE41638C379E3F69E16777784087B247C1940F7199F844D30F0C81C551297
+5C4DB969C4427026ECCEF56E96A322A368E448291123CCEAEF2B40691B18166B
+077AA7D51428A176E03A054B0EA8B61F92AB2D753564866BAEE36EBC7D1FA3B5
+9361AA45FDD611B141C95D5FDD1FBA96458ACF294DD1BC793A2562808CAC17BD
+4D823ADDF303B507EBA76BCE9B4187EC1BBBAE48EEB412B7FAEA5EC125258591
+62D0107A861E1157825C6E475308A42F174F4986338FB101D8B93BE93C0DAF36
+611AEA854FFEFFA4509AADAF51E4438C29F531DEEE33D61308F09306A3FB3FF7
+870F0604E547D30C9DA4E4C6C3EE493D962F85F09AE0A2B67D536204DBE454FA
+5E0C9D768FF4BEBBC12E9CB4CFA2FB3F2D81010701C9B73437AAC8229A0F5481
+0257B371C8243B794E3903224A68926909C44F872F47E56B59135AD38B54D5B2
+0A154DDA8451C07073C59E41E8AF591EBA82A38E1F75D1B6D9D7178D39A7A451
+3B7D40128A5C176C4BDCF283834318E7E3DEB50A783F0DBA6AC35DABCB237C12
+B2737C84C345EC6CB8619DCC30F7B995A3B6346FDB049D506DB45B21C073CBFD
+0B46476795EFD3FAD869C105FFF252BB191FB00AF367F0CAE93BA8388D51AF56
+2F73284F37E903D0FAD0591A0DBBFB70E424661E20C0F002B9EB76D5E2A1D86D
+C78C95477E337EEFD5F90C946F7A2E275E11CC215A14CC1DC47D2CCD56883844
+0A125471B28A98C2287EACE60EA9784DBDE23CD8115E7C8745E97C9C08C99BFB
+E38EECF374AF0C80F7F11D1802036B5B85AAD33439E46F46425EC73706C64AF7
+851E485C0816A7BB85FD36FFBDE759CDAE8E3E4ABDC78DAB76BD4F120FBECBAC
+E9832251630A7CA96200AC950A6C862B0852F1447AE20FAED5481695473B0630
+1F1C724C0DEE1D897466EAC717361D15D4265F96307CEF13F3D09B53256A6E33
+8515785B8E5B3067EC056F9086CA288CB41E271D8B1D3153595E883E4070FE37
+347CB38CD8188292E2E7BC636CB16D5C85E141A86FD5A5BDE2EBDD8F2A6798FF
+BBD1B20859E32F7FEB0E3D2F9AE2E6A7FFB8679E0B987C57A7D63919D8CF495B
+87FDFBF9FB6BBE75391BBB4BE382D747AB1C7A0ABB70CF6F326512299346A210
+4FD21A7AAF6C85F12A4097F3261E187678BFD925E7B66D9998218C692D9FF260
+896B535D3FF418003CD6C7B4DF51BE1A369E547C68D10F188BF24A4A3950380D
+0BACD53E80E2250EF0622383F6189BF555F4AF0992637BD76D6159D263E080E8
+8D34F150528E9F61C6C677B9FDDCB5E2D2FCBFC1F6C1B62345DDC0B53D92ED6B
+7B8E4139ABCB0827476F1333D804DCF161D027E788B82DB14F9F2B262BEE8176
+EE1BFD72C8F33F89976403D54A46154737AA023127A84CD3D3FF54602E67A8EC
+50E893754BB9ECDD26C31E36CAFAC19BE9E891F0B24660F7734BA720742E9E63
+5214CBFC368F2829D2AFBF40937B5F666346BE4CEFE9620691DB76422BE043E1
+3553318B13074CD4C77AB4C29ABC5090743040C64B8B0AB43957C80440CD0FFB
+466763BC6A53967C6A6722BD0EC743117214D7811E444EE64886CEB0F56CB396
+0A4D28FB6F8CD03DD15A27CF2892BC3F8F1754A69B80CD15A8C00FDC6A4BDD66
+706FBA3F8254CF7A6AFE9F6F9C9E470B37A51EF8401DEC2AB5BEBDDB9A8EA9CE
+25871253CC3D3BAB1CC954CA7345C766A222A5CFB45734FC284FE6B73EA375E7
+E8A941E33FB0241232069C58DADA52074D29CF97C99C7B5372C4AD3C2C7B1400
+9D5793852AA5CE03B91083871D87953D5D377BF77C80CA3DDCD67EFF600CC5D4
+8D72D4AAC380664A39A1CCCDC367228A854EC85F535BF749AE9B8A4B7F2F4EC5
+E74A10372A503ED53B82E20D13055ACFF2DA99C94314123D6014A389E31FCE31
+85F72F4DFB93E1FE6209DEAC4A09650B5DEF5A66DCF413A46FB0AD560AEA2E48
+707E1E515BEE4A39B29FA4920DD60961536D45A3BF1FCA4E2D7BD275BF88D7CF
+1FE7F97E7A579DA1683F0E89EC6C2B223FE899C9E58B3E1DABCC09C845EB256A
+60CE6679D4A10B9A25842659D07D179EDFCC8674E4005EC059387D28FA7465C6
+BA6337A0207E9F659BF882AFAFED44081F2436411A70C0F22B6A0AC3BA614C76
+6F3141F8EEBA0711F871A2A339E8E3BD82601E86379FFB776A613CEB160C2912
+D771E47FFE40514CFFE816CD6F3D04A794D69461AA084BF88E7E45638DD3D6CE
+090F1111E57ED23E09BFBB8A8AC4661848295D340DA12E6C50CE64B343C99706
+7C75E2BFAE1F7DAA779FBAB2091F0A8DE7D5ACB170E3CADBFD10418104248503
+D960CF42E820663A709706FD63783FD0A317B200985D22CF8527A653B2479D45
+4414304CDE054D0781A23A1CCC3B70DF191049C46FBBE63B7CF3B08BA5DA1347
+B736ABD1BD2E4F082AF09CBE235F78796EF29D64953D20667061C25AC7122E68
+9BA50D59922220A20C51D097D54F42802CD6F1155BB4C923437BA55AF47BA45F
+395C7AC797F75AFEA65E18B21E17E7A3888BD9E5E537A2A807F3E01816E05854
+7B00B1CF4F87015C1A02BD19C97948B1DA3C909E854E547CCA3BEEC7FBBC1FCC
+77ED7E09FD0A7E374E6FC81A0DE4E1822631245C0CC07A25E08812BBF34CE495
+3AE62A05E315402C61A40DB8FD567F2CF07CD8C08113C8AB35F0EE140D444A17
+184D727B46011990076875B63258F699E979A9BB6740DDA1F2F5165557BA78CD
+CB908FD8D1F22933C858C1D65E1B2F33CBB9E5F1740C7842ED42D17C44B6FD0A
+8DD891991CE70EA138066D3D62107AEE622D14D724C9119A96EEA7404362E1EC
+3B5B2B6B9D6557ED6FF314A510FEF803F7E4294C10261A9DBAB4AC8900C425DB
+7D11C719D54A637FF9D1187A25F53514A6BFD9A741D7522824FB40056CCC9930
+066BFC03B50D927E3443CF5323C1BD310F70CBA67616309CE21CC59FFE0303FF
+1D83EEF8CEACB6066498B45487DCC91608B93CB1EE5F617F47980C19A0F42546
+E5F41257F83CF905997E7D6878FB2994A12E73485AFFD52B452420DAA283C66F
+C81555812FEA745E5C19A2092443BD67133A947643166B2E0ECCA49DC5B6F0F8
+9A030E67941CF02024CED7E4AE560C82C11B78A2E097FE62379CF86FDD2C5736
+12BD42EBFFF180782739A9C9732133F8FC5B42999E4D7AE77EC87734B29F9EED
+FDC176A587B1A816345D9BFFDA82FB52BCDBE8D97B5C03AF4F896DC1A71B08D5
+8AD895B6FF9CE5991110B12C49562F83BBEC34DF34A579ACEB8F10151D1258B7
+A94BCFCC0AAA5DE96E48141BCCF083E12F57F13EA2797E976B8A8017F641D63A
+096F32AEC86BE6B7B97EDCD8D1E001203A2ABC49C7237B0CFDD42CB712F1E280
+F8F5CCD47AF53AF863743EF908DA42725B76330CB16532D109009D974110F330
+C0B20AD5AF4D944399A4B5A09117742F2512643BC92E09BA6D1EF3FDBD670691
+C93746E3D9AB6C133AC3969840D6F56D30509FCC2CF5DD580FEFDF958AE31262
+DF46F710614A6A12BC8BF57505BA3D49828FA7762C7C7F60A8EA20AFAD84C2D6
+46457AB5372F03D42AA0771EF0EDCA4FDFF23944AA99DD2A42CA83773D11DE61
+30A611435AA151B8C1276C600B7BBCDD0FAFF4BB676D63FCFE677C236F2B0AB4
+215F59F05180CE5340CE4E179B1622E409D07234DDD1BA9E80603C490D035E17
+633116ACED2DF8E452018557FDCD4511B0F5673B9826FD820542554E6B353EC3
+EF22D3387E7805D7C9DB6867F035BA4367E66637E232DC96629E119A46E038CC
+0684E4B01515AA4F69B1EADE7DD56F1B2C56BB88BE9C48D0726473CD4405913E
+9354BFFD14D2A9843AF4546E8836C2C0C08AE10DF06FB0230ADE0430BA9F2528
+504ED27CB3434450258298D4E8BC3C937A56E3CCBA4317EA6EFF8ADDB916DE13
+DB72E484E1AD34B93DA5641161DD361C0FEE1345DCFD4400C4576D56AFC40395
+B576C16F1BE30D68C4B63733EFFE3ABA51500B2907B4D5A3261BD9A9324BFA10
+241BC53C421AA17178394F481A21DB2C56D86FA34CEA070C4652620C0D797C3A
+D8C7B947DB2E2F03CB417766B2AAB3EDFAE55E6ADAAFE053C43668E9F9F67B55
+BF4DBBE4B06FA10CEFD76D6E5500C62E9F58DA5F8083FC5B6D0CA1F4F01D9353
+5ABEC8A5B3BF311A752C74F6C4DB03C5DAE8A1BF58BD9D004848831227327FDD
+0D19B0DDAA120E6E201303F8923A0996FC0A5ED64CD855CDE269D4AF613C7946
+3A084300E8E140B91F67D13C5370AD0A5CA80564938067E262D9072EA033DBBB
+AF583F4F0590609AA2215CB0FA4CF3F821B16CD8B326EAFE18FFEEB9721692A4
+2B6D535E0EA29142066C1BF876D6A8E69EAB58C54F312BE6A2508AAC417ECE8E
+88A0918C35DE07C01BE64C653E6A501DFE57EE3EA876AEFB9EC9146555B3E71A
+41ED57EC1559DC071B8197865628955320435FD9D80802909159BB4523EAED06
+07AD8FBB66E3F24242BF148F21D65105AE82BD67BC9D0E50FA04D1FD1147CC85
+
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+cleartomark
+%%EndFont
+%%BeginFont: CMTT9
+%!PS-AdobeFont-1.1: CMTT9 1.0
+%%CreationDate: 1991 Aug 20 16:46:24
+% Copyright (C) 1997 American Mathematical Society. All Rights Reserved.
+11 dict begin
+/FontInfo 7 dict dup begin
+/version (1.0) readonly def
+/Notice (Copyright (C) 1997 American Mathematical Society. All Rights Reserved) readonly def
+/FullName (CMTT9) readonly def
+/FamilyName (Computer Modern) readonly def
+/Weight (Medium) readonly def
+/ItalicAngle 0 def
+/isFixedPitch true def
+end readonly def
+/FontName /CMTT9 def
+/PaintType 0 def
+/FontType 1 def
+/FontMatrix [0.001 0 0 0.001 0 0] readonly def
+/Encoding 256 array
+0 1 255 {1 index exch /.notdef put} for
+dup 33 /exclam put
+dup 35 /numbersign put
+dup 36 /dollar put
+dup 37 /percent put
+dup 38 /ampersand put
+dup 40 /parenleft put
+dup 41 /parenright put
+dup 42 /asterisk put
+dup 44 /comma put
+dup 45 /hyphen put
+dup 46 /period put
+dup 47 /slash put
+dup 48 /zero put
+dup 49 /one put
+dup 50 /two put
+dup 51 /three put
+dup 52 /four put
+dup 53 /five put
+dup 54 /six put
+dup 55 /seven put
+dup 56 /eight put
+dup 57 /nine put
+dup 58 /colon put
+dup 61 /equal put
+dup 64 /at put
+dup 65 /A put
+dup 66 /B put
+dup 67 /C put
+dup 68 /D put
+dup 69 /E put
+dup 70 /F put
+dup 71 /G put
+dup 73 /I put
+dup 76 /L put
+dup 77 /M put
+dup 78 /N put
+dup 79 /O put
+dup 80 /P put
+dup 82 /R put
+dup 83 /S put
+dup 84 /T put
+dup 85 /U put
+dup 86 /V put
+dup 87 /W put
+dup 88 /X put
+dup 90 /Z put
+dup 91 /bracketleft put
+dup 92 /backslash put
+dup 93 /bracketright put
+dup 96 /quoteleft put
+dup 97 /a put
+dup 98 /b put
+dup 99 /c put
+dup 100 /d put
+dup 101 /e put
+dup 102 /f put
+dup 103 /g put
+dup 104 /h put
+dup 105 /i put
+dup 106 /j put
+dup 107 /k put
+dup 108 /l put
+dup 109 /m put
+dup 110 /n put
+dup 111 /o put
+dup 112 /p put
+dup 113 /q put
+dup 114 /r put
+dup 115 /s put
+dup 116 /t put
+dup 117 /u put
+dup 118 /v put
+dup 119 /w put
+dup 120 /x put
+dup 121 /y put
+dup 122 /z put
+dup 123 /braceleft put
+dup 124 /bar put
+dup 125 /braceright put
+dup 126 /asciitilde put
+readonly def
+/FontBBox{-6 -233 542 698}readonly def
+/UniqueID 5000831 def
+currentdict end
+currentfile eexec
+D9D66F633B846A97B686A97E45A3D0AA052A014267B7904EB3C0D3BD0B83D891
+016CA6CA4B712ADEB258FAAB9A130EE605E61F77FC1B738ABC7C51CD46EF8171
+9098D5FEE67660E69A7AB91B58F29A4D79E57022F783EB0FBBB6D4F4EC35014F
+D2DECBA99459A4C59DF0C6EBA150284454E707DC2100C15B76B4C19B84363758
+469A6C558785B226332152109871A9883487DD7710949204DDCF837E6A8708B8
+2BDBF16FBC7512FAA308A093FE5F00F963068B8232429ED8B7CF6A3D879A2D1E
+2931CE5F5D18C658602059F07BE66E6EFC9239D7AB2FB8A4CBD41675B8ECF279
+650C29E53B14AC0E392A664848C1844B1CECBB2D5CFB72D0916B675C9A9A1E35
+F12696A6F628473C604A95376468E06E295AD6F76CEB939D94113532050B9D5A
+D2F41A9EFB9424D986612313B89EFE9C8A71313340B248F6853B1EDBF02B7F9E
+F447220FE131D7D54CFB8AA1281DBAEA73E665BACB1F164552CC0CEDB63BD4B1
+4A9AE8AC6FA02242DBE8DA46B64B6BFC11762F0784F216FC8B9120D688D1705A
+438B14F5E5DEAF2A98408B3B64620DE3732A4DAE6D08D5D97E34C75DAE19EABD
+BA0796165C1151BCBFB1DF8D29A63A8300DBDB9E3323CB82D0337598B83F4F2B
+A97CF5196D4D1CEC1EDB8966E548C0D9C194C932319610FB43EA1B86322FE641
+AB48770FF13BD475A7267E142388563D1A400419C585B22A9886074687BEDF74
+D905BE8EE440BA2ABF28EAB673399B7F129B9729DD5564C681954621903B84BB
+CAF89AC5ADB2932472DF29ADA2BDBDB4D05F65F28F5F4C529613D61858E0074A
+082A852710A62A147C966F2B85B51B0BE85F11D2057C66FDD61F6C5755367980
+9F4DE680601D4DA41B46F8D2148450000413C27AA39B586B74B977B25F0FD3C0
+4BA1EBFAFDBEC531EA1210365091671CE3C86A6D4BC591C37DCC02570042575A
+9D24252D6E01A8603753934D7EA5CAC1BE4E5AD2BA047DE8F3983B23A8A1511F
+B08D373B69E5076CE4300137B8805EBCC0AAB89BBB312A77835795E3C069322D
+42C893A30AD739E2BDD299679B158F7493764F2321E3965141B5ED1C6F4765ED
+F46D391A646B30C90002B1C461AEE79E5F094CACCA656CEA3DB921CC5205F328
+A2C69F817061D6C60B121EEE844CA5008F23DF072E1CF4BB6D91B539BF447567
+F0C07EE411408241DC9B538AD13465893016254424F397FA3A1C55115B2A2D0B
+75DD6E0120B00C7E70425FC7D5F4F61AE2D674C382EEC46DA6B1721384CCAFC9
+EC1EC4315798446B4DB80CE133B16929987929DB54132603670C6CC9531648E2
+5688E259AB33D5C70FFA0E5321EBAEE8B6CDC5F6EEEBBFCDA9AA1F3B8E6B73F9
+EEC11AAAB006BED785B9E5DDD2F88E8A1835BA7E1B61FBC937186FCAB9B2B8AD
+F7102723179569B5BD188E900760783A95678801F1DE1D1A993B81C6B658377D
+82D07C357EDDBD34C000A9BD4F701F064C452471422A4F374233178486FAA3F0
+4A44B86D19BC396DD07FD5A2402148AAE6EAD2F78C06301FBA36D19CC9FDF2EF
+B74ED043B8C1C8B47665F6AB0C4494DF11B8AF468606AC7148AB1D0C8B4A68A3
+DC1FACF49259D323E4198A7F46DD15CA2C7FAD56ED435E2FAC4BB347DF1823DD
+B4227D3B2AA8AD2ED804E23ABA0344D61D9945B2901DCB91F2797CBC3FBC9F6E
+10C859D915BF91E5F79B85793212F38D41EBD7CBEDD8C1459D1679CF7E27AE42
+A4813B53571BDA268CB9D6010A9509A176425BB9EC0395A6B3B2E96FB5212E29
+56D590391F52617712E2D12F81EFA966782311379D62D127BA64A66C896250F2
+60521679EE5FDFFF8E0A7EE7026561F20A942643D1B6EDAFF0EFAD81DD53E5A6
+04F4062EF1C4553671E3E6467E353BEDD12A8C73E4070563886EF96BD3BC6BEE
+5C65F317756F7E5FC9FCAE814D44EA462145D9FEFEACDFBA4E0AA41A0DBCC75D
+922A69AA85808F77CD359AFB0C6B68FEC4CF090B34A16669B55B7F0720EE7427
+6197543A82BEB87ED2AD187984D3F33AAA5523B9CEBDBC0CED7E528BA099A607
+F6422ACCCA897A8B24B72A0A929C1A337581A9C0796AB2A893790A6C144E800B
+1AB65E9A199298D8388FECD8BD0E2E8B14D6A0115A5B3BDEC8DE19274B86596B
+1CC9D0F0ECB660DA383CCA48876171AD408716DD0AED04FACA190DCCDE92A0D5
+46E17FAEC77C668EFEBF4B6204F8971658CB376A5289C78C2EEF5686A70E70FB
+67C5B74E6AACFB705363480F7A385AC7DA52F85824193DFE150A984BFEEBC030
+AF9B193DF06532BD3E27D2D4EFE2FDE0939B96ECB6ABD9D26117CCF0FF4E9BE1
+A28D164ECF4C0B890E2BBFE663E55BA4AB1BE6F4C250DAD5E7A5BA9BC48BB15B
+D47CE7BE1DF46F325A211826EDCCBC501EECCA1BA3E59DB85617C689A0117597
+C322483AD79C524A4E1865E42E7E9249E56452147F2F5A26ED00C8377C9C2CAC
+6C7661CD1762BD095E2F3B733DF8E667816F73C6F6249C1A051E8BD172ECBAE2
+289CB6FA8597D7A77558F02E39DE3D2547995787F3FD1DF154763DDC72025CA8
+5E88786E07E6D915620E70BCDE7D11B9EBC8A2F91A3A3A4176EEC48CDB8F2179
+D4FF6A47E3CA5C787FE9DF39D5E60A27C9A2590EFE3D1B255797C3A885B106A2
+A99FB10BEC3DA2EFCE74CF41F78645259FF2E65AC0F5FC435BF0DB21AD376798
+981EC047117E3FA775BA24E2E7BB9AC6DDDDE6C22D437EFA410FB455C819703A
+9B28F932B764DFB1E20045CDFA3427F21C2A69B60939CA0F53837F59072F5D49
+9AF7E08592B0EE74186C838588CCF5F39FA4216DD2276838B7E195751D329F92
+0CAA41EAD2349DB6F144EF9E3B8B0B4D3C01DEBE334BE3B4DD5CB2B06D33244B
+83BF085E222FA79544F184DBDE944BBA81141B272CC093A3CA5C30DD63595294
+D356C914DCEC9D73ACCC8DBC219B4CD20E0A5BA7018BA25769E9FDA68DF4EFBC
+EB37EA9BEBD050396DD2FC749FD7D75739241D4DF44E27FC4B88F3298F2DCC27
+FEF3E948BFFC637812762D2C6721F6D9AAD7A50733584E2832924FC257D930F7
+6425447A5967E5C586514F895DF0FFA2792016317E38498247EBC538680BF21C
+3C2574B3AECCFD9856D44EA18350EB261F799E823BA1181B6C49FA850DD66E7D
+46A0A0F2D2C2F878ADA95A39B12B9736FFC4CA11AC9B16951F4B56719A7DCCD8
+FB1843DD62D023A5936C969D7CD236FE037EF4A6E71AC4C6B722A047A027E528
+08FE28F9D51D263E6A9753695ADA98AB6982E5E2B0130B169B3ECD17AACEE974
+081ADE4776E1069F75B1E4C74AB9493834310439DB640A909A74E9DCBC4ACF59
+58AF0C3AB733A92EBBB205ECE37A85386A848CA943AFEBBCB78D9C56DAFA96BB
+E14187230DAA83783C038A35342821F3FF7E0F6BBFF3A7E2C673744CC4AC1552
+B30D63BB1F0CA0E3FFB5273BBAA75AB92D179B410AF0EF5439715B92C69DCD3B
+FF1464416EA362F1BB6007D2BD465673B0123CBCFE5CA8788316377294DC1CFF
+E99220191ECBB6DB57D8C9F39F6F09BA78F67634E5988568DC7EE7BD7B327EAE
+5B097D160C7712EEB1B466F0B873663D4B7102F61DAC7E670621D3C9685A033F
+8678CA9F704AC456163A65460AA43EB3EFE98A0BE59DD9B7DEBB1A592BB70566
+82FAA26A806D85BA76FD8D5BF90C2BC9EDF0F794AC100170B3F30AC27ECD82DC
+E29DE0CD3CC478EADA2363B68C228C6A48F718966D908800435CE77314DAEBC2
+E4099FFBCEB996DE1F4D7F3707B85FF92199B8DD4EA637EAC7CABB49D13D2ADF
+33DDBC30833407EAA9FCCC7120EA8A4886D5559155F4ECA3770D28E56A9B9D5D
+39E8BB296526E67531AA2F767BCF7AFFF41AAB1A0E438F25F857E0BAE18DAA11
+7072986ADABCCE113680736ECE0EB16BC74BF2738C8D94E9FB1C163D9DCCF039
+72CBA8DF14BA12C7CABD80A08DD62C310D8994B6263603EAABA1F6152FFEB4AA
+648E2D0E44BFBD0935F9BE6201FC72A5A73BC0E6DE253E9A1896EF30484E4FD0
+0EEC7B5573FA66E0BB8CB753B0F5A8B38D9DB354F1FAE8A4266BFFF9A57A14E2
+CFEB1230375F523A5943A97D4858E12966094331BBB307F0B80F828110900C7B
+CB4A3D902C2AE3B76FBEF28B97A3B5D42BB6E6534DB7A333AB261E4A0A631A10
+BC37970096985660FF686CA17FBB3FE634A237AF6CA251CAEBEAD58F6D1BC35E
+24D70E01F55C93752A5A29838395A5DAADFC84720D6DDB544CF826C857E80D58
+F8DC5FB8C22F84CEB09342EB847655692BFE07717E583F5697EF65168A4F557A
+CE76AA083392B32A06B86A0E6B5E36305478CB4786C83CF2F52D83F347D25AD7
+8A955EA8DC8EAFF8A720D9B401017DB6404A0FD5D8A2908D91F86200C73E3FF3
+392A5369885EA7468F9E777F7E53585426225EF41E2AC252F7F81DB2DA310324
+DEC466ECD0E291D03DF9A355883E58201054D4D07A352FB0140806A7FADB061D
+1E7C8455C372D331D7F5953E65690577AB8DC0A8C7FC511EB06274F28632A798
+4321C88742054F9DECACFE16F9754AAD60BB83B345FD2B9FE2A0CBC717C2A035
+960E380A6A903C47C9109EA27639D16B6B2817DFED762645692768F2007252C8
+76ABFA26752930CA50397ED2A99B63108688C26C46C57F691651794282B2E6A2
+313B37E00E6C4959BECB001FE227994827B771D2A6900CF62614030315A10310
+1C396943D8DD58F1A57A44EA12A48FA91E1DA374E4A60ACFF65017F33338182B
+D85FBE18706FC2D517094AC93D9D73953E2CC85E8178A58505A9B8D129098C0A
+C4F6A51023D8DB85B0958F54BC2237C257F0146A80168CC1647079B1D3573272
+30B5C1496EDC0E70A456AF24248F70CE77A28FD5F31491E2B493A25D5465E353
+2A8B0C5CD2ACA734A8F99B9D0F0300B0850041BD82AA42A080BC0D4DC46E954A
+DC33AC1E4CE4F8929DCE6FE3BC1010F5E94999B3A49951B2D30828077E81E895
+7563E18B4B8AFACE06A1A7538E824FEF47460814025C1CDF1BC41E01B75D4620
+DC49F43D302F550333664254D65324C13BE036C0D3EEDCB83A9BFF5F5BABCA4B
+5F3A9B2D5218659385A7E605B918CC653E4A465180B3F4BAB168CC9494E15A55
+0DACEC5CADB430CC1D94B7CE6D47CFF1E7F437A46289C9D36121B4FE7647BE0C
+CE877697A386848058E4577310F799393BB96D087376214B7A1E593D21E486BF
+E62139C81BA6C5F2D476AB0A4D539F4D85C9B92968A9E8A4D8BFAE94A0CFED5F
+767B3B658A60AED32A4273998B92AA290978DF2B82F8C2539C9DAE795C2D030D
+82E13FC78003CCDDF014FD624CBB5FF53EAE58E42D142FE0F7E9884C1BBA7D4A
+3454A723768816D16279EEFFC61D9C0C3F1B765E4CE5262C1FB3307CAFD1B31E
+28444461AFDE5C60D1E50C4016B0499E9CE8A3370CD7F4B7D6664CFB264F25B9
+CB9B34B3AA3DA232323BFE2396B517466940C8D66F37418AF4961B0BF85C24DB
+1BAA142780BCB92C0F4681738344D4BE9E2AAC12B80A8109F82A83328CF0B3C3
+D68A327CE181880D3A6E6AA27FD334C8D71242579FBF0F03C50E2B150C52C801
+937021BAAF80C7F45F05A8E44F2678504271FA4ADF720011D9A12F55F91A9D61
+38A6DCF7E6E4D89E2D62E53691455768B3C8F047EAD27A06BFEA4B0543344E0B
+0B12F71514DBBB9B54A09A65858E1EE9DA3DD427AB53FFFA9329216F20CA1D12
+D9CBA9B770354013DBFFD0EE8F3A8BF7636810BAEDC50CE86BB7368DF771A88C
+40035F1BA4CF8F8A2EA0755E220F6D05DBEAE67B7FCFE61EDF37912144204D90
+602B5CB56E6180D3693AB55B10AAE6DABF27B34CC6CFDF95B90D312A8D03A3E6
+E4CF802AAA4279CA875484DDAE753FD28784E5511A91C134FF0428507D991799
+2DB966401428A2DBA9152D1A2A8AAB5771C6A296E85497B1767876AEA7F3E4BD
+7E33CDD892FE67600EA4271BD1CB559DBA9BDFBF8CD3455EEB22AA160CBA2816
+4C68550828752C8A37330AAE8653B23B66EDBC9BB148C6CFB17929CDCC4D67C5
+784051E9421DFCFEBDE745CA8715E3507C20720FF1F88528821A669FEAC5C635
+E9E13A76065C40262E326A7688C55B7F2DA52470114A5633293FD1F8DC70C713
+BF1EA94F302A6192D1D2C51A05D9B1904472BED7E7F9182BF31CBCC835B02FD7
+1172A7FF5D546512CDDCF16B542DC2D083C41509B1BFB3C04FD1E7E1F30491C9
+EAA28B73206899DA4381DF3D58BA61E8EC49B3BD425577C9202A46EEB2EAFA4D
+6AA72AF6047102B2028CB3FDE852039A336EEB0D278BCCE5A8173E02DDA7C2F1
+8FA13D228D6A6229B0FEC6E0D9DD8826511448F7BA2F2F25832403E212871589
+029E52AA639894128A569F0F06AB5D0E6720CD2A967AED41C38AAB6C3145ACCF
+9CD218D37DD4308A002C3CD4FCF13615FCB1E6C85FC88F102A61961AF7D494DD
+00104A960D781AFBABBD2B12D4993373A3476C5F389BCA2E2955C35875EEE0B2
+03BE411C1051A1BA62BC9F583DB915B696AC89A6769251D3F4ADFA3A3E7550D7
+E87440135D2F9D1D9C0D8B39769ECD605EF7DB5BBDE6CEB7A23A5759D8823790
+66F3723AB517530D9E3A1C2FC8F57BD0DD7A88298E0E39B0A8D68BEFAFAF7B3D
+EC447C4EB11A45C97F526A0D6B1E98583A24CD0DA9FB8BF4B9CC0C042931F7C0
+0094271FEF8C3158D46D048E74E4841F6E6FD46C21C4800C4F1753BCD83FA8B4
+B992C07C95A150FE635A9A97AC31B8A07DB31B121F7EB0D016FA7A7E468B775F
+3ABDDF199F90B3CADA5BE7511C445431B31FC42204D834E6895EE4FD593E813F
+4223BA03FB6DB37BA93D8CA1FF27EC69DC641CC49914858FEA2D6A99569095CA
+70836718A0A8BE51C6ED679269B7177B1CD1C6E5A2DAC0F876280E667EBC98C4
+0F4E0F849031B4B3EF6C7A1D3B0C5599F21ED700B88DA22995402268187E6704
+D9905412432E63CCC830DC2C8368509D55EF9FE7FB9F614088BB62A7E7F93EA7
+9A6C7500DC43C5637D35329456D96FFF587050DF65C3308B161C9DA0EBC363A2
+00BA29D3606AC9BEFF0611114FCAA82AABB4E864BFBC7B06690E62EC270CC43C
+ECA338EBCB2A8D6B32F7C9E9401D9B346DCCB3985822B02C128DB234052441BB
+2A5F7DBF67FF3D6FFAA5EB3CFCF942790E558C318240D96C556F32491A9B60E1
+562679E32BD2D254C6E828D084159B14FF588BE8C7D8A9869AFBC7F7827DB5E3
+295ADEF59FE9801B747B7C632C99EC2D479314EAFC5BF74961CBDFE92F795C4C
+5991EF2B48461665511D561346732BBD71A629804CF25950C63664ECC2E329CF
+DCD9E3B7290CC79E30573F325EE9F0CF2730E8B3AABDE0EF885E5F897C8CB34B
+047E3DAFA9A486C5CD3BD3C9FEF2A295119B8AFF239F9EBAC510A7FCB5C899C8
+9F5C8E2ED29C8D90D28CB84BEF2674079D884064B2EBED43FEC545B041632DC7
+5E6F75A28845BFA89D783AD7E6F342FCE6D1A7322E3D3A8474C3F372D1A4E0C6
+740CC16B104F56FFE972713836BDB4CF8890C6646CF950CE2F706FDE97D63E6E
+15F03F8DEC127D469FCAD6A8C00C725F6C87F248D12087EDFB8D1D0EA656831D
+1FFD76C01A14D9E0CFCF51D2D577A6DCD7860E0217CE3D85C34B2C1A8C729758
+509330617BA58046FE902FA5A96E64209A794822D823ADC51DA7C9F3DCD7B0B6
+2938773F6F8EF6536DEC8985BDFEFEE7928891A6B6D05671809DEE525BBEEC88
+B4C7991EE9B14752E82A1AA58E9E9417D68D5B8AE2A9864BE702B2A2ACA44C32
+ED3B0DAE81FA42664A29AAC87E14BFDC6852EF7A61FBA0DD26B8E96EBB38A991
+1E214BA8AD721A63C310A03CEC0EB8D60755F6C71302DFEB638231266ED095DC
+D379CC90287003BC598ADC7E227CD2AE51505C2BD548B84DC5D6DE8E65A72D68
+659E3A66A29EAE4F4A544E8EFD1013EC4F8E54CBCAABDE3531B34E34253AD388
+2F4573F8D375A1FDAD9F43303310E7792F41CFB7A9FFD582D50CAE449E078C45
+2132D13366C5C5CBE7C5896557565CCB068B0898C16E961A45DF84F934BC29F2
+5A3310AB30A1402B32E3B56D40C5F551AAA97FBCA01F454BC879C8770A2C7705
+3A9A8476795EBDAFED69D6A910C60CE471003B71736A9EAB4E12AFA7691F3F94
+C31984F20E376D47AD0E3646C9FA1277DFA53463EE867E1F2EBCF975D9ACDA2D
+A50B40C280B282A42085B61C9E4B879E8ED3440EFCBB11253668A5A43F4F55C2
+61D8B9BAD6270E0611A0FA29E1EF08CC8A04C69E458D9CA1AF7FC431725E8243
+9F9EC601621AEC235141D5410DDA088D391A49F4DFBAE04D24C3E32C4B78FBBD
+ED500C355EB9C795D17F83DBAFB2B28CB4C434B9DE0EF4230AD035CA10F67E87
+83CF3FE9B8B75BFD9709D46388F7A26CE3BC4C9151368325802160B5146041A4
+C7B78D9900060E618DF0874DB1158FE7DBC35E601ED235EFAAA442F10D8F9E00
+746056222ED35E3A4119176FEF5FE5F7A01AB1CFA990110566B77D1BC8D72E7B
+FA17D9BCD21862135BAB99DDE5D5CC9EAEFFAF52B8CA37FEED05DEB06C07A6CD
+77B9001A3CF62078CE23980B5865A71B88304BDD7145498535FF3340C548A14F
+01A3F439CED725652878DDE27D63F75D9BFF456C27BF4A3111554C9E5B3B794C
+3B0D7889ACBCD4F653CF5E32E4541E7FEAF57C8DD3E9724B106994058F8D8871
+FF3072405E38801D5CD46F0B3001FDE561B676F1AA5C88149254CB85B1BEA9A1
+43CE012004CED40BA905CCC129631F93D70B30A8F1FF7D8B15D79B55B43908EC
+E055F776AEBB649C2AD2A757745B406394503046B82D60AB2F9488CCA9D13E2A
+776F8E030F435D68092BC008A289D36D06BEDCFC0BB52496FD34780FC560803C
+DC4CB1B0D728E26326F4FCA1F6A04FBFE781C7B870D8D84C3ACD42EE39285C8D
+B0EB2BB735F85F160FD0859ACF66B15FAAB30C46096A867ED906673DBE7CEB4B
+21B5FFFDEA4753BC0901AF0465D1B19B6C67287717993C17589D4E7472A1702D
+22BEF11A70FEE8EE4ED63A88ED6AAC9A13894AAAEB5320951078A1BF1BF42107
+6DE7507CC1DBD15B7879561CB7EAEA02D49CB2F991DA3335301B1726CAC65B7A
+977C56063751D0E514A8B04E798ADA123416A7722D353971C06BA589E07F65C8
+8A72A0BC1698C01E7EB27B34371DA0491BE6E42DE236DFF8D2FCE5BC8C248026
+0603D9FBB253365D9158ECE7C6F464B3FCABDAB49CA70A68C220459197A3D6CC
+F871D5DAC7AC4D1CC369BA4E77DF854D0266E1626AC5DA684EDA1EBC36060751
+51C1CA0A25174DD663922FC625DE1CBD7FB43C044165CCD9817DEF7E71F8AFF9
+C808EE8E598FC0F733CC0BA189070FFCE6301599AC074C962AB46FBF131E2349
+982F7534A7CDF52ED3ECEF7A74F2ADCCC9ED1957942B0F0272977A374D5ABBA7
+B4E394815263D0AFFAEBDAC619ED477422550B57AFB6D8856E9D98B00EEA7477
+7B9D22E39C756272FD04763C9CC6BA056228E3DF2C437EC39A585DDC12BE4C95
+B5BAE9E3C67CF6202F079099051FDCDAD3D51CC016FDFA34D22C17FFF058B0BB
+FB1931BB3374D32E21C98C72C4A8BF526680809D3801DFE8DC21714D306D0B2E
+DCC7EF3ADEA570E37E765F7822B15188694F44C787CD6F348309819A90C0F86C
+1967885787E899D77430D2993B8ECC960E298ADB4E15F7E41DC2BE94C6543B6B
+F7ECDB5C54D215A8D750518F64EAD03EA7648F7702D1D0FD611D01C8F89B810F
+59DC0D3EB7ED47B7BBFE9B65B35171D46B11B5F2A3D28372E740969527820C82
+21C4D2D3A039CD77DF81F8125BF14D9CA38D0560194C30E0B2AFBB53EBC00FC8
+312BB2D4133B6E8BC5BE88699B6547FCDD8D5C8618C225CA511702B80B85FB4F
+E3D1F7A73AD0FA9FAA8BCCE537E335974B31F4AC7F33B6CA930B751F2599C060
+9D7F415D91CCAD9C70DD2C849E64C77D922D851F51C3EE46D6B4D9EB636F7AD6
+FDD449FDFDA98EA7DAB652489987AE98A897E238C0162337AE3D360BDA8E2C04
+B8B9CA41E50723C5667FECA45938DD5EF7FD80246E6FB3BCF254E8C378FD911D
+A39A4B699BE974DB92795F5813F95761ECAEEA76A917FDB70417D69C30718D22
+A24F26DC0DE602BBFC44BA92AB05D03F3A9F7B47BEF988C3E07DC011DF86BE9C
+FA38F54E58E1AE7C308A60E44C0EB7C390A1BE3739F2EC36A81EBC95166002DD
+934E5A7CC3BA0B6A03BC7D3E5FB22EF2C91B0069E2AB8198728736D40B072AE4
+C204BDE2886EAEF948C6EB30DC41BC0E83F370F7A802A9772935BEB92A2A3C0C
+AACA408D9A36721821361E6781A5C2DB99955752C48AC9399B12C8F1448A3A23
+504C72A45038844772596E841FB65D0944ACCF90D836A53712714E8F84B56D2C
+3E07DA26B3765951F4B7DBAFBD05C86A51C73E6BA78DE5A2974112005DE7B42D
+8856B07333E9D12D4C2E73008C861FCFCF9522724C54B2D5FCA70D70C6C73246
+3E1402429C2B3F8C03C132D41A4EC8A7DA02DE9D130854FAE72F20E83CA0BD57
+7031A98E80ABD9931B073B97F86E44B2A0E47B78EB5955205C04A0DB473D8876
+6C8DB5C2F6AF4A75AC3BADFBAC651AD856C04308FB26D142E6626F6055179366
+3B83B52C9448EFE7E8C7E4FCE6A3F13A44F0714733FABC578D017043321185BD
+57B70F952039C0EBCE165B3695C22B1417A9CE7F57D5CCF814484038962A1914
+FCD6A0C40F3C6910D4EDA360907F8C63DD6A22D6B56EE2DF5310A9A32AEE4872
+5DE4B2E314C4E4B951CF97AC93CBE8D8C8BE814EF48D4787C1513AA89F9DA499
+C4981E9A1B7C6BE54CC2A22D737333222FC7B1FB15E0D3418A3299560DD04D3C
+B907FF16E038164645DB9F5AAF7C7420EB408D7509BAFADECEC4B38F7D5D9FA1
+970F961FF1690AA200715560436CE4A448410AC831B5AB127CF81DD3628E77D9
+3DF37361E817E4A6613BAB0095D3EE9A59017AABF540312068F980013353BBBB
+1B4E6EAB94192DC4348EA1E8B7B888C0F2FDC10CDA07E2E5EACC002B9360831C
+C17DC8ABB665DBC93A61A9588CC0E92DB40578F87EC21A813EFFB7E910914E54
+BDF1E1F5D7D05201925554989B69EFAED2BCE95597B4D6D76A3FBF6484429264
+6653790B4F2F5C793024B8C0BA55974F2D86981E2F659BBD227D0C582DFBB855
+1BD7D68D3B719C051A63F38FB8B065948D18C4D91B3DFFFA46883227829551BF
+BF4E942D8075C581921B7F491EA5849CB482D3CAEFFC1BF5497A8C81FDE310DF
+C32C4F1B77B6D7756D7C980FB5CCD4C086098EFA283B8D413AC340894C85E36B
+22BC65B0F55B4DA68E6A1514F7E85EA4FAF36142883E52F7A85D90DF8689D0B7
+7C8B461DAEC83B6294A7E9D31A514F4BD7CF6AB1124281C22B1C205A7213EB9E
+F961D9D0253FA646DD96C8023D249CA687E266B0CD461EBC87252212A4D74C57
+843070CC200657320E248C1ED92C1CA0ED837E681020C9B99113AC4ECF934E50
+CE81BF4A887D446D1389A9B1A46FFA083484CF14D6081F5CDE2DF2A1106B8F22
+7F765FC1977A8C562C2869BCD62A3B2F80904D8AC102B6A7C93EF44CCE3CD5CD
+B7F54BB50DCC92C2F73D71B4C23DA93CEE819144CD485087314C73BF85DAC141
+9DCDAA46FF075EA55130CF4ABE47EF1D8C2B43DC5FD62DFB3E7343000B1776DA
+BA742CA6AE305F10A50A9AE68717C1502F5773B8559022A3CFAD19517CF2C208
+603EE0466B3E4E958D7659C40C34B169C1346BB46ED28A19D45FC0C380D1DE6C
+F682887E7E8E9423F250A41CACCD62FC8ED3210B77EA0B559DE9E990C8C3733A
+C12C105AEC43EFC2D9BF5C218BFB620314CFCCE36D6049A99254FDB9BA3E5FA1
+540EF2A8174530A20AC045A21D0582F2AF5B84252015FA64EEF17AD7D8AB1E46
+E5B3D7A4AE2F89C961E0B0C78238A68F90DF95D90481E0AE209923CA523668D3
+2BECC4F92E3A4949E3FF727EDA0F90305AD2A7D241868C6CDDBBCB0A2B4F8AA9
+10F4A34C39630B51C441F077CE4A944FF3B3707FA86DEFBC9A6D1DAD508BF728
+EDE6C9BD625482645666488452DDA9FE50BE873117AA2625BB12420C10FF5ECF
+888CCD92F3530CF446E11EFFFA3B57AD967E9970369B535B6777C54FA6B23758
+4B9A5F43F3C638DD878F84D691DECB30BB3A1386DC8C2DA51DF578F4304126F3
+410EBED5623D46D61594A1412C6A6EBD55BDE2E737905B1C15BCBBBFD35BE1C4
+58858645039438230E99E53165F5D997E86D2F20B7C66849F42DE242769FC8D3
+0BFE08428351760757C255B6A3464293A6D2AB391B8E6ADF2674A8D3BEB6F0C1
+8B72BFB6A1181AFD382B14268888804641585845B0BDD611CD0313EF8106E30A
+A0EA2D570FCA568954A5E59FED787F55076331FA23F0D5531B905C8B3270409A
+41589DE70E02819176A8964D24C92E8B80BE9171729C13D485C067C79C8D88F2
+9384DC5FC65633B2B6613C375CE5B62EC22FDE2CBD8B398B2586D0674D3FD69E
+3739200C9E56E87CB613E07594E7127FC0F52453FA5E455DF50134669BE77401
+0005629A6452FD6C8CE4D212939CC5EFA21CDF16349566DF5B32D683B325632C
+FE7380D5B51329EA512DB85FB80580B71E8F3E15F7305515AB41A9AF7C1A513B
+4624B159B8066FCE593A12EB05E85CC94917378E1A3C54EA9F7CAA3CADFFE867
+04DA8E8946D412F3EDDC92E36AC4E8B4AA7931C66412909BB051C6864DEE73C6
+6615A152F5BB6F7B275A518CDACC388BFADDE5E8611922E2CA570735A90DD000
+DDEA4D15DCAFF8F428B74BCD8A9ED2A823A70C055EF2E818889FA5AA413A05DA
+2E9F6686E9956BD9781FEBC19B4403C82D99E9E58A03C4287DCBD26FBAB9E615
+47F4EA8C6EED38BA34683CFE2CB696DE84588FE245C4427F1C9AFAC368F5D434
+0356B2FC89A3F05968344D64F6449FF314B28E9C178E56DCC34DD0B2DEA40AA7
+4E9177A7B6EA977C59DF54A91173BAEA372DAC214DE57FFCFBBC33A5982B4E37
+9859EFB428A3751411519B7CC445200BE620ECC534DCE9647DD0D8D046767E1D
+A91D017927205DD5D67C29230402BDD01EAEE280409B32C0AECA00D601465BCF
+F189D498D1B6E548A8C942F30CF130B72D1EEECB3E4CD04D024F23E1701CA222
+8C9C64F60F2FCBCFABACCA2FF6C7B766F6A8CF4184F0324440C8C83C7A91C8E7
+38846BAE81962DFCDED200475CC43AD2E85FAB031242261443452B02F94275A0
+9BF9FA4C83B2E8F0DACBF40A27DEF3263B71C5316D7D9DB5E84C9CEA132EA27E
+B84DEB6DC9EA8D1B2B04CAB580D58605ED865A11D02E093C35C21C7876B81B46
+A76BF8B4CF24AC00E0C0C49B38D6D110528BAA7E40B3965E4969D8822441FD1D
+A1383E8C90F48A7ACC290AE610B340B133FD043EC2E47F79AB78E730CDADE0DD
+CFD892AE4FDC8406DB2E3A64D50F761F8EFEEB7252724573E192961B02B64D97
+45B35758CAF268D971F131797125246A5BF3E61ED17F8F63224FBE4CD3E06531
+2FA048B34D948F7E5DF6BEED43210D4CC6E690DC4482FABB257A32A44AD1A282
+569A0811C7FAB22D1B7600120073D6BCFB293C899C3E982BD6E6AFE774CEEC96
+6B66E8F04C195C41BBC5BDE81EA1644BCB8615139E3B16FE8500A268F7F5E71C
+9DF1CCA4B62BF1C8AE8D84C7225968E296EA88EE01DE83D7E826A522D221F3DC
+E7FBC29D4EDA2CCB2FA19582BDA6588AAD09DB12C216A10096FD792880BC8223
+D60F39A0D1F6710E0B84BBFEDA2DC189A41CD96EE72E513B13160462AFC2A391
+37F4C2F16ECE0960A173F6254E37001001F2AB7F783E43BB76E2C8EEAE51F2EE
+1B79F37633F9EC72624A030DD4A58B6DB2540DAE89239989B1CCEE38F58A3237
+F48BD3734B243AC87986798A9931E2F0691E77966259E5283B2EECFAF4C48D2B
+31A471C38BAB1BBC7790FBAB34FC8AF901CF1357054F3C90369CA578518F789C
+A9EDB8A21CA85B754EE1B68330B501298BCD201EC15811DC98D41FED73A89F7E
+FDB53719EAD53E2554F83547E2091E962FE8C7B037DE890B88B326C4D1C2B214
+F34CEE1F810AEAFCEDC1EE358428B3005770A04D68A8A32935365A32BCFE1097
+3303FBFAD395CC1CD9D20F1A9CCA3359BCB7BD48EE7EFA37374DE711B6DF2561
+6886C71FDD94D7AF21C73B37CE02AA260B2103444B20398BEA9C82337EF02548
+45CB37F3A07126854F98BD825349C10A9C307F4CC7A50EC78B85E58D34938480
+48ECEA30B96C497CBFC9F8639CA4BCFF9E49A6A095D1B0A49CCA6021963C0CA4
+82673F2EFAC0996CD90EEA16C66DE796FBFF0785C89B47537B20D5751AE24B5B
+F98EDF13B563981D536307B9F386E03DF2E981594B6A5AA0EACF19D7DC976805
+DF80E20A91F8459F5EE147AAAD4BD874D01C7B22E73B0474602D5C7395E5E8A2
+4191B46352F0088D7816E6426DDE5674BF5FB6479C051E73F4E606D0C9818E0D
+7BDF6FD05325B8E19535B0EE3D87C96866FD263F0EC94AEC707FF5BB53E5BAED
+2482F8A681EBBA17B1247F8CC0D866ABC199BFC8B91408D9F6EA8D8B3519896C
+D2F69B4594A9E5C164D88A76F5A5EA5F2EB83E27804E0244046C31473D2084F7
+F8446C638CD58A23588C793DE0FD617605C779C311D141602EA3ED721771AE6C
+23D6BEE1E642581753B1883109E0F5492B917906DEA8E7682D8C75CE1BCE85D5
+2F64A57A52C36164DAEB408E8BCDE0F4C4549E56D90D102BA92F1FF145723DEC
+1AC864C09E467261106AEBE5414E66C5CC2C7E2C8383636D5D846AB00B6B8315
+5135A5EBA2305350218A484DC29AA46A7B04073A7A2A9BE40539475315EC83E3
+92CD2FA8B33D031F5AAFB0CD6F9AF2C63581B86DCF0CF4BE58637F9920A2FA4E
+FC0CF10D9E14EE113A6798E72068843F99F9D2A740CB3805EFE987C8761F2044
+271C0BBEE5DAF0169AD9A101B31AAFA8BA183A67CC170DBCC8E4420E9E150355
+DC5A0975435A37AD83F111D1B7743B001C4AC295DBBA02153F2B6C2AB2354661
+6CD83B9C7FCC19DFF3CEEEBA022C0918143392D24932B5FA4B2D504109F1DC69
+EAC710B45FB2E15FE07ADCBD10FD837911BFF2885FF7D7A484151D4E71B866C4
+BF78D286F27D1F9951FC3C34A1D13F22DB3F1568803B64F9E7146E228F863F65
+53C4794050A7021041CFE115E8823A83127C867C3C07217C4797EB20FB862044
+2E8CCC2889000E96AE26E3EF18B9A965F24EEE3EB622412B883627129996B73E
+D0A8D281EEAE8B7F243EA336CA4C5FA6C123631466F10B605E6808D9016D79BE
+3785216B2477F13C674C9219BFC86B7F0FA59B5E23375ED7FED771AEDD26F14B
+23DA0A12CA08824555AD0CB5E9DCE9B24DA23DA0CBCD5DF122A1C0EC26CFA28C
+011A090BE1639978A6A5396E836D85EC0C757AE38526AC05FE4411F32294B9F7
+904B922BAC303DD46974327D6DF196A42C47E13F3FFD130508BCA24D5449233A
+47B7D13F3C715C0772173B66E461E0103306A75E55DB08BD6433ED694CF8552B
+E643448A7C68BD8E12E0A12A8FE808D0383013970092E3754ECBDA7A9896CAFD
+3E5CCADC0F51CD2FE6C5A395A9C640E7B459D613C3B0DB9098C60D8B3D6D12AD
+637633E4F64235043BAA63465DFD2EDB89FDCCA6429E389618DBAA57023F7DE6
+C97EABC97A279A25B32A08D3B847EE92B07A7FB67E2D13FFE62B38ADCF5FC026
+AC3C4AB19FB56A5560E2E8ECB228D43C1DC077B4A9E6832863F72D0C8961CEBC
+BA294EB533588A182F8D5BEF459EB1669F8612161B949C4BA7FC09733B037BB8
+A9D3C9FC829A86657F4F7378609782F115EDDD3572563E828A09B4F497607BBB
+6590EC79A17336AEC9C9A651D0CC95217BB2BB53F109CF9A61234611B4CD1194
+D47D0C519F6891EF6CCF11DF16D3DEA2B40616E27C46F391E8FC2C452D36A6AD
+5DFC1AB9A4705EB8499836142DADADD2956E30E48DFB6C6403CC8861876A60E6
+0A22D9681E68883C1189C80F257822ABD96513F725E6D97B341FBB6F7D83E074
+C8827BCBEAF064BB9A77CF36AAF3D7CB3E8FD4389C8ED8D8B387F13E0AFF2C3F
+66E19F847B121BB3B650C3F488CF097C3E5FE977787A6CC913B3206BCD7992DB
+E6923C8CBA01A06A4638B81EA5955198C9EE43CE1DA764DB521A9C61FC065CCF
+760613E6637425315E5CAF3D1B61CA280BDD9DAD70E8297632B1F72EE49B6876
+B4C4CC53FF1E6401BFD4026E50B64A09B3F8EEB5BD411B382FEDA64622228BBB
+3D9AAD617DF735BBE70FCCEFB3C9D4F30FF11A5A2C54001A042D1BCC994CBAD5
+F72AED49CA046AA1A6AF806C461080E1A49084116CABC88D4784C874089BCB51
+06B14A38E554F9A5A41A6DA2DD1CF57D8B33A6C54830F0A54BAA2ABE18440E6C
+09E9076B441CB9B4D859A03E56337001020BE4A165236637FB0B57255B4034D8
+B172234DAF86A3056C9D01745E5B98A7258D49547906AFD61898F336002BE668
+D3BC094CB5A47CC56C1F032A517AC1C00DE1A6664B71B8FD4FF39108D28D9A18
+B878B01CD77233710C25DB6AFF46B51101C2C9E8643A22E0E45B95BCBD1078A3
+BFB135929B6ECBD89F741C8BAF18BF56B5B2285C5AF5CDF9307D42DC1FE792FE
+92801C5568DF27E9D18A79C85B8DBD3BAF9B23BC68D0FA1210866B2A51502D23
+710B0F6463771CBCE1AD5BB1336863C4349F6CEFAE66E08014C0629DD110D9B8
+D1F6400607DC5A7414533D48B64C29408083FA14F83F59C62CBE0DD9E5DCE29B
+166B69D7A97AA9DB48C3C90B97BDE8862690E07D6CC3ABF269323DF1264060D2
+A567CA2F3F2E7B4ADB9B8A6C9AAADE9AF8DF3E0018DD8F4A1E44517BD140196A
+3E74FFEB9D5008E8C459AEE9786288E615F13C2219F0AD057D1E82C6EEEEE4F1
+8759F863BD03D86B45CF90F5A09E7227EBD2BDCC6555DA2C5304D306C0514573
+27A4AC13DDB2CEC03007F94C2DB5709088BC51B3F26C88947B90D77F7A292592
+0F1400A93018EE578B1DAE1146D03445C5F3CEEFE0B7D6C0EBFEC81935971222
+C45D507C7DF9A4C50A0D96795F9F0B520BEBEB9478AB875DDF81A0648BF82DB6
+7BCBC6ECEF325D5D911F68D154C09B0787A2A068376ABAD8A4949F262AAD6D53
+33D8F1934871DF6158158874DD22CECCB2263D48584E45B480B5C2886BF1F7C5
+FBBA810FFB49009F83B7DEE5F16A2251C70D51FF18CE2FE74BB8B4FE9EE39F7A
+4CF6527014119E39DB8DED7F641FA28EBA3C1917C68955A32E17B0C8FC4E653F
+0A79C86757B3DC13E03CE6EE1CA7511BE3393478583135138A3D11FED97EDA3F
+8FD27DC50A4C533BFA306B4ACF6303F2716597317E9FD01FD40E60E13BAE15E2
+2684491F40CD9BEE3A8B383A9662DA53FDF004B21C0BBBEF0A2403AB6CA6DE1C
+422C4A258B660452CCD54DD507995F661F0EE378B7171BD93DF4DBBD0582E1A3
+5370A620B0BF9C73F863B217DA3B4266B9730AC2143600BA427ECF7E2DCA743E
+C30426F111F996509D9474FE495EE78B279794168C4EDA1D33323D8166409D3F
+8F12EE9DEA10774B9062A847A29617BA888727B6AFF2CC9AA66A241AF89D6283
+D88FF5FE2B2FAC86AEA620DE1AFCC2AAC4914308E5D7EE3B36D9B145ACE90A39
+B06F816826AF0DD716BEBEE06C3E1E7C51D33B8392D02CAF3B153A6D4DF20975
+9664C4C28E56267FCA1E270FC431C1C645688EC66F8DB8C85A31A69E193379D0
+9A4E4599223970B4FECB255C0663DF4F91FEFEE57646CF40B396B9D9621406E1
+296B640E3E84C6D0EA91
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+cleartomark
+%%EndFont
+%%BeginFont: CMR6
+%!PS-AdobeFont-1.1: CMR6 1.0
+%%CreationDate: 1991 Aug 20 16:39:02
+% Copyright (C) 1997 American Mathematical Society. All Rights Reserved.
+11 dict begin
+/FontInfo 7 dict dup begin
+/version (1.0) readonly def
+/Notice (Copyright (C) 1997 American Mathematical Society. All Rights Reserved) readonly def
+/FullName (CMR6) readonly def
+/FamilyName (Computer Modern) readonly def
+/Weight (Medium) readonly def
+/ItalicAngle 0 def
+/isFixedPitch false def
+end readonly def
+/FontName /CMR6 def
+/PaintType 0 def
+/FontType 1 def
+/FontMatrix [0.001 0 0 0.001 0 0] readonly def
+/Encoding 256 array
+0 1 255 {1 index exch /.notdef put} for
+dup 48 /zero put
+dup 49 /one put
+dup 50 /two put
+dup 51 /three put
+dup 52 /four put
+dup 53 /five put
+dup 54 /six put
+dup 55 /seven put
+dup 56 /eight put
+dup 57 /nine put
+dup 65 /A put
+readonly def
+/FontBBox{-20 -250 1193 750}readonly def
+/UniqueID 5000789 def
+currentdict end
+currentfile eexec
+D9D66F633B846A97B686A97E45A3D0AA052A014267B7904EB3C0D3BD0B83D891
+016CA6CA4B712ADEB258FAAB9A130EE605E61F77FC1B738ABC7C51CD46EF8171
+9098D5FEE67660E69A7AB91B58F29A4D79E57022F783EB0FBBB6D4F4EC35014F
+D2DECBA99459A4C59DF0C6EBA150284454E707DC2100C15B76B4C19B84363758
+469A6C558785B226332152109871A9883487DD7710949204DDCF837E6A8708B8
+2BDBF16FBC7512FAA308A093FE5CF4E9D2405B169CD5365D6ECED5D768D66D6C
+68618B8C482B341F8CA38E9BB9BAFCFAAD9C2F3FD033B62690986ED43D9C9361
+3645B82392D5CAE11A7CB49D7E2E82DCD485CBA17D1AFFF95F4224CF7ECEE45C
+BFB7C8C77C22A01C345078D28D3ECBF804CDC2FE5025FA0D05CCC5EFC0C4F87E
+CBED13DDDF8F34E404F471C6DD2E43331D73E89BBC71E7BF889F6293793FEF5A
+C9DD3792F032E37A364C70914843F7AA314413D022AE3238730B420A7E9D0CF5
+D0E24F501451F9CDECE10AF7E14FF15C4F12F3FCA47DD9CD3C7AEA8D1551017D
+23131C09ED104C052054520268A4FA3C6338BA6CF14C3DE3BAF2EA35296EE3D8
+D6496277E11DFF6076FE64C8A8C3419FA774473D63223FFA41CBAE609C3D976B
+93DFB4079ADC7C4EF07303F93808DDA9F651F61BCCF79555059A44CBAF84A711
+6D98083CEF58230D54AD486C74C4A257FC703ACF918219D0A597A5F680B606E4
+EF94ADF8BF91A5096A806DB64EC96636A98397D22A74932EB7346A9C4B5EE953
+CB3C80AA634BFC28AA938C704BDA8DC4D13551CCFE2B2784BE8BF54502EBA9AF
+D49B79237B9C56310550BC30E9108BB06EAC755D6AA4E688EFE2A0AAB17F20FE
+00CD0BFF1B9CB6BDA0FA3A29A3117388B6686657A150CE6421FD5D420F4F7FB5
+B0DAA1BA19D638676E9CF159AC7325EF17B9F74E082BEF75E10A31C7011C0FFA
+99B797CE549B5C45238DD0FADD6B99D233AC69282DF0D91EA2DBD08CE0083904
+A6D968D5AE3BD159D01BDFF42D16111BC0A517C66B43972080D9DD4F3B9AE7FB
+11B035CE715C1218B2D779761D8D7E9DEBE277531BD58F313EBD27E33BEF9DC5
+50C7821A8BBC3B9FDF899D7EAA0B94493B97AFEAC503EB5ED7A7AB65756D833A
+1000B06DDE8802EFBEAB4ABB7F9B24BA71FE50A41F327C52C12A3DBF8D850D97
+963B286CB725518AFA7CDB513225DE15C4F9D80FD4AAA5B37481B0063FD3F0DB
+8872ECAE33EED0824445DCFABBF7F90D39C21D603D7BE65FFAA9108E6D6331DD
+F5D964A431F091A9DE755ED173A85A54609F64B925E31C058E04FA4CC93FDFCE
+EEF82A026AFCC4037F15DC7CA3A26A7B87CDA0BEDE2328741D9A8095C0EFBD4B
+E0DB3A0469D9ED85EF9B5D6F4831BB42A84BE5502F5701FE2D8A564A00B9FFD6
+3BAEC5ACAD58CC721F04C41CF5775FC7F3E1657700C479201E86AE99920F2CC1
+980A377DA9A20AEF881541BA61F4F3E6DF7DB0E56314BD637C2338136B6DA83C
+C7E49FB16199672B9BEFD98BA3D30A144E32264D85767F5397D721CCFCBC0F29
+1990833967B5E4A6FD429378D0FE4C5058EB915B7B7C67888287C0A04CC71D0F
+7FAB1C182C3A6B048ED639B46952328A0BDA8BEAEA73473A5ECDE439D83A89AE
+DED228CC62AA032A37B9E7AC7AA2B8ED30D8B0A8D0D24FB3744CC1CAE414A237
+6F7325B871626EF382C72A338B1C90D32AC2EF5EFAFD81FFDF822CA589EF0B1F
+CE9A137559AA6573FB887DA6BC75A08FD46112F27F9158D0D442FD4440691A6B
+8BDD1B700F7067806BD9D7D9030619C093B2BEF3F1B24AC9C1531AE68124C976
+5C739EF30F761041865C91E5CC20D84E17623B9F08C53B91BE96742B75D8A6AE
+A5816B06E272A2ABD303041AD8D322A18C8C48E12E1A2AE9252E3A57939F0D64
+9060E2863113235801DCC0D41AAB3295A28C4F6DE97356BBA6F74F507F89ECED
+241F066D55C836FC32E02DA15224E2A294E255CBEDADA1DE591789589B2476AA
+9DB528B6898887FB979290D4226CDDE1A239F750A34012E969452A18A813F5DE
+045C87D519E6D1A156DD9345785453CC6F22DBD0E9F647AA0BAEBC5DF8375426
+EE7553B4C43588F63ECD181E0763F68DA4B71B438E33F52F93494F9EDDD9C23A
+6F4DE73D6974ED8C6ABDC76C3385D8FF554848A32FB3251F96AC326C3F353DE5
+28BBB6657964EBBBD28BB3D978E11FBB730E9CB41D47F4BA8AEC9AC91D9BD561
+21F294677AE960E89AAC39BBDDB8C8F2DD088314E77FB5CABB5268809678D11B
+DC6285674288D6F317D551E20B42918049C1D74BAC0E9CFA488EAB99F0B5770E
+7EB6A53F53F4BC4C376FA53A7D47F8A54E00513F6997039767C24A33EA711428
+7BACB261C9D5608E55634C5C4C335064B45291077128C757796A3C397DFAF13D
+21279F0D91BE3BDF98FEE4AC5C31D595E0F23921C13600EB81D45FACA4C9E6F9
+BC425D68B03C70BACD8B764B46867326F958D2A897322FAE80311A44F8E76061
+2749D57123E5C94596DE60842BAEA6A783439569AF0D63FD17C37F7D68E9A661
+ED6FFDFF56687A01B9A3600BAEA6075AEADAB86D4DAABD5A61F973DF6BB3FCEC
+7DD2DAB46C00D84B7BBEA49B6DF5E3E478597DC14E7090D4B25E4ABEC783C043
+5948CB21E5EC1DA90B20276C4EAA2864D6A13444F33BA0F92F2624DB1D065ED8
+199F6B964CE20D23345E088AA810A5783438D27A181A50C8518980E67ACB9EE1
+19E64141B6A739DDDE3124B0D04F442023592675D6A4E12F34F1116FF19AD937
+887C83D63515B56223DC44C581E1B308F6AA9DB34BBDD9F92C4D77710016DB7B
+9604524E4C709BC71F13DDDA954883A25A53515E7CB637D623791D73F5C10CC9
+5A2F19400D8DC9C0DD423C29EF88F5397D19E2973FFBC699754B3935124C7422
+90CF6781A2D08D840C8B7D0539E39784868DF147CDBE3AE4BE756B644A29DDAC
+AB73E3F99BF3531CF3A4260B29D9D3AB0A829DC1A3DBEBB2792024D1E4433EAA
+AED7CA9B7827C35A6FB20F629D1124107A93480FA1C1E683D49C8BBDEB512946
+FBC3DA7625774A45D5DC84E7E752B2172151091195ECE033D546F96605E62AA5
+36DBDC16BE3CADCB5208052241678F29D356E0C085EE95DD3F0E18B50DD5B6BB
+BE89AB6AE363FD8FB891166C8AF446131BD8F659B5071CC090DCBF910A1A406C
+F33BE7DDED136CE6F9470C39D957E62A2DC11793D1A05C9C542F71664C1C452A
+93F370099BFC970DC461ADA06FEF0ED5F8D5E13C9609DCB82EFC1FD3CB8E9DB8
+1454F27955A05C70334A56F9B1B13702AD31D0FE581C32A232A521A6AF88EA4D
+4162708B15027D7404BA591296B5A171F61DB68C4204913AC7840084446B094A
+2A9ACE84E9307C89D274C2BCEC15477FA187EA53C2E0A00F900107D14372665E
+F753888749B637F0E358490FDA2DE4337E9204F13FA80629D054CFE89E357CC0
+1BB295BA088D21E1493A28253E888BD3C95E757C522BCEECA39AD92EF203E094
+EA51041C381D83F14AAD7C5F33DABD281EB31B226C70534D0E460C2B3A61BA38
+183AB08219B40BB788D9D9C618A8ACDD5F242C32DFD54E09081564BE2DEB0927
+B3EFCC6BECD09D6781A89871ED3BC4C23A5521985E2D82F2D39A378E7F9897E2
+D05E9CB632820EA62B334B53D865A3900345EA1B3713D7285F97543343DFB5BC
+0A80E40E720EE41DBEE1983A3CA24B04819D86AA431C77AD8002B757980D7736
+BED93E7BCD9385C52BFDD8FF9F18EB4E06B91409C52067128DE82AC674C83D09
+3F4BBB5E7D577A581730B383C43CA5AB58EFB4D44C3CED991756FC933B0AEA81
+7F64ECDD0133E3FCF2CC7FA9E41B750C71E19985E59A12F97EF7F296FAE6FC18
+54E7C2A02E3D4E3596AFF38C7C0A817740F285EFD8E6B8A30E66660C41C7AC7C
+B07A2E7B30AB4DA97009AF29B783EE356F3F4127B3C80969BB05
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+cleartomark
+%%EndFont
+%%BeginFont: CMR9
+%!PS-AdobeFont-1.1: CMR9 1.0
+%%CreationDate: 1991 Aug 20 16:39:59
+% Copyright (C) 1997 American Mathematical Society. All Rights Reserved.
+11 dict begin
+/FontInfo 7 dict dup begin
+/version (1.0) readonly def
+/Notice (Copyright (C) 1997 American Mathematical Society. All Rights Reserved) readonly def
+/FullName (CMR9) readonly def
+/FamilyName (Computer Modern) readonly def
+/Weight (Medium) readonly def
+/ItalicAngle 0 def
+/isFixedPitch false def
+end readonly def
+/FontName /CMR9 def
+/PaintType 0 def
+/FontType 1 def
+/FontMatrix [0.001 0 0 0.001 0 0] readonly def
+/Encoding 256 array
+0 1 255 {1 index exch /.notdef put} for
+dup 11 /ff put
+dup 12 /fi put
+dup 13 /fl put
+dup 14 /ffi put
+dup 34 /quotedblright put
+dup 39 /quoteright put
+dup 40 /parenleft put
+dup 41 /parenright put
+dup 44 /comma put
+dup 45 /hyphen put
+dup 46 /period put
+dup 47 /slash put
+dup 48 /zero put
+dup 49 /one put
+dup 50 /two put
+dup 51 /three put
+dup 52 /four put
+dup 53 /five put
+dup 54 /six put
+dup 55 /seven put
+dup 57 /nine put
+dup 58 /colon put
+dup 59 /semicolon put
+dup 65 /A put
+dup 66 /B put
+dup 67 /C put
+dup 69 /E put
+dup 70 /F put
+dup 71 /G put
+dup 72 /H put
+dup 73 /I put
+dup 75 /K put
+dup 76 /L put
+dup 77 /M put
+dup 78 /N put
+dup 79 /O put
+dup 80 /P put
+dup 82 /R put
+dup 83 /S put
+dup 84 /T put
+dup 85 /U put
+dup 86 /V put
+dup 87 /W put
+dup 88 /X put
+dup 91 /bracketleft put
+dup 92 /quotedblleft put
+dup 93 /bracketright put
+dup 97 /a put
+dup 98 /b put
+dup 99 /c put
+dup 100 /d put
+dup 101 /e put
+dup 102 /f put
+dup 103 /g put
+dup 104 /h put
+dup 105 /i put
+dup 106 /j put
+dup 107 /k put
+dup 108 /l put
+dup 109 /m put
+dup 110 /n put
+dup 111 /o put
+dup 112 /p put
+dup 113 /q put
+dup 114 /r put
+dup 115 /s put
+dup 116 /t put
+dup 117 /u put
+dup 118 /v put
+dup 119 /w put
+dup 120 /x put
+dup 121 /y put
+dup 122 /z put
+readonly def
+/FontBBox{-39 -250 1036 750}readonly def
+/UniqueID 5000792 def
+currentdict end
+currentfile eexec
+D9D66F633B846A97B686A97E45A3D0AA052A014267B7904EB3C0D3BD0B83D891
+016CA6CA4B712ADEB258FAAB9A130EE605E61F77FC1B738ABC7C51CD46EF8171
+9098D5FEE67660E69A7AB91B58F29A4D79E57022F783EB0FBBB6D4F4EC35014F
+D2DECBA99459A4C59DF0C6EBA150284454E707DC2100C15B76B4C19B84363758
+469A6C558785B226332152109871A9883487DD7710949204DDCF837E6A8708B8
+2BDBF16FBC7512FAA308A093FE5CF7158F1163BC1F3352E22A1452E73FECA8A4
+87100FB1FFC4C8AF409B2067537220E605DA0852CA49839E1386AF9D7A1A455F
+D1F017CE45884D76EF2CB9BC5821FD25365DDEA6E45F332B5F68A44AD8A530F0
+92A36FADB679CF58BAFDD3E51DFDD314B91A605515D729EE20C42505FD4E0835
+3C9D365B14C003BC6DD352F0228A8C161F172D2551CD1C67CD0B1B21DED53203
+046FAFF9B1129167921DD82C5964F9DDDFE0D2686875BD075FC81831A941F20E
+C5CD90040A092E559F6D1D3B0E9BB71733595AE0EA6093F986377A96060BF12A
+A1B525CD9FA741FE051DD54A32BECD55A868DD63119A4370F8322CCBEC889BC2
+A723CB4015FC4AA90AE873EA14DE13382CA9CF0D8DFB65F0ABEDFD9A64BB3F4D
+731E2E1C9A1789228FF44116230A70C339C9819676022AB31B5C9C589AE9094B
+09882051AD4637C1710D93E8DD117B4E7B478493B91EA6306FDB3FA6D738AAB1
+49FBB21A00AC2A999C21445DE3177F21D8B6AAB33869C882613EA6B5EC56476B
+5634181ECBF03BFEDB57F079EACE3B334F6F384BDF9D70AEBD592C8ECF21378B
+54A8B5DBF7CB9282E16AA517E14843909339B5E7C55B038BF3BB493F3B884A1C
+C25F9E8FB912CBE23199AD9D2C3E573727701BA301526C66C3617B9514D6F11F
+11930B1D97C17816C85B1BFD9B973A191B33CC3B391815AC46268691C741B2D4
+48A840F1128D9B2F9CF07D0709FE796B23A836417BF7B5B12D67F74453C82F5F
+25F7B30701D6F6D4F4DC623C0C27D6A6FBECC7312A3CD10932FC7C10851C3C52
+24B75DEA8A648B7F34F5711DB0E843C914E25663C510185BC37BDB7593C1C259
+21D8DDAD33982C336BF272BAB2F48E68217403FE9F54877B243614A87E64784D
+2796EE4179FBF96123D1BEE3EF89D682B427BA4F12A1318A57F18BE5DD903815
+26168947724A8DC3DF39EC155721A14AAFD432D73F5992468F84A7B3ECD619D0
+97E18EF7DCF54239B374958C90D272ADDCDCD8EB10ECA2AE79ED6C11085130A9
+E8B87D813DC8EAF168EB49D2BD53F87566FA62538F1F8FEB1107E9C72FB4FD7D
+793B24B9E72B4C356EB3941EC25499986D584B433C43A23EA7F0D5094EC66E86
+A69D62CD16373FBAEC1C3A93A71404D89960EEA34F067289C744A30A58647927
+5E602A77A88543D37A0957040E33E30AD0EF14CC10CE052E42A5D9C7B18F0504
+54D055BD52AF6A111EF491CA0547E943D8DCD1CBD3E3F77C657689B48A96BDA7
+83F657FD08427223DD6D2B633A7944B4128F9BF7BA8E2A71D46843A433B7BD3F
+77213CD27B2349351308EAF89658BD8BDEA6DB1CCDF7472C92991D492F3C8B1E
+D0C299518C93911A9CCD7D77E02C5AB5486D8778F50FBEC9FBCC99584CD8D2B8
+E6C4ADFCC25C50ECAB8D437A510DD1191D190B62AA803D49257748EF082EF217
+2C27F3168B3D145C7AF3D51C00A1F9732004D2EF8E25B602F57F7644BDD7135B
+C4DEA0990BA23A1AA8CE3F23ADA6012CCFAE205C278B9D50381A3E7865C249FF
+161702435BEAFA03DE173EB64B1205A43E47F592668604341B3185020BF47686
+6D40EA3B463C989076C13DA13F3F566D4AA5F6D8E6233FF4FB993A2EFAE78265
+1D1F32950359382C67AE669ACB66493A559C478721CD37D664AB7E2BD2B1EDBA
+DCB5EC746D8308BFE768D8C2E4E072FBEBB6CCCA7ED54538DD6D5759C88F6351
+CEF77210C48F172BF21022D8D1410F972C9C6DC60BB496B666A69546604530A5
+3B1CD9E9EA29C8022562D63FF6578748600F25C8AE7E0274FD9C6C5C6B13D664
+7AC301FC1448A8EB45200A516AC343E6EA0884CE7BA0E89E40E15FADCF4788E6
+EBDF743B0486ED89C3C661CBC023A3976D93AEB9167068E3E9D6C460FBEB5FD5
+A895338A7806F385F3B0FDC3604FB325CE5C67B66A43DBE06EFC11A855F92194
+49387847856982621DEF2A2C6728AA81C19438409D4C62ED947688BD8537ADD9
+2162991288934A75BC396517A15955983769B7B225391BE779B99FBCB218B285
+0031807E4BD03009DD552A5629AC8C4D16F5A6406C42BFF50A32112C7079476B
+8E3DE483A30DD9547172E515FC512D438EA98FEDA5F867088C1C4CBC2F94F14E
+7EB6ECC23037B0EA7B9D5A8A1356F956A79361B53C3EFC6C648F1F53DC54C810
+75886DCA08E5F1EDECDDC3327617BB81035A76EA6D730C60A5F611BE02DA2065
+F24C5871F13AA19061F0E4E0136C7BA17C423E13E76A7814F032468519E4A8A7
+8507FAD7BFE9274D755A8B8251A647F522793C851F760BCAE182B5B70A894E9F
+D0F56CE44279611AAD60D4DDE1ADFEF662252C2737D3C3A1B25546884BBA5E39
+861DC1A336391E7CBA473FB9E91BA1C7D1FDD41B0C796205DB487247AE2D4455
+83270DA08D2AB61CE4EC1983974AD436ADFFC929C8AA6B9F1B51D737B1270468
+BEC3E520D40C079605FF8AB38C911EC29A8844418D1014ADE33E4D3B44024870
+CAB75D3217F3FB8F28B6169511F75ECE774A829969D9B7B927196DBACDF81997
+11243547F43D6EA0BE54547CD389B3D37EC7D2A9C7373F463628A8EA71A01440
+A66F9ABA07B4671F959A994F88055653D313765C424A0E30819CDDA3E0401A27
+4134445D13A2EEDB4FC731F4C6FCCF7397174E47675833A14925359E6F102980
+D54CD1268FB5255151B68ECCB15A08A70C8FC5ADE316C6A10602C09A42230702
+56394D1FE222FB0CB15B4F48A9C4294B6EC9DA04292F2BC3CFD1E0B106EAD07D
+F51A6CD4F74215B31558D4BB841923B1DF09BAB0FF5759876108ED82DF29CFEA
+FE3F0D490C3FA2D0A2783B6D8A47387C1E4DFA4CAE97FF07312BA65C078DAE3E
+817FA9C0CC922BD146E238E678145AFFFD5A6DDEB96981A4CB661AD307421F71
+31FE228449495C6887879C3D6EA435DECE82B71DDE5D04FA18CD41DE88FBF2F6
+3DD3CF0976D93198D199536B46027972AD0E9B75E5DAB330099B0F5D69227D64
+87677753A074D51A2F23067B19EC170751DE814AB28969BC043730CAB0C1AD83
+BE52CC7A5F4911B1DC4D1512951722FBB31F9A3D1E1B8388DA698BA4C17FF991
+15626B5A44EED7FD121FFF46AA370C308D469DD29E4855611736ECE52D9C3EC2
+F18803E47DAF34D3E6DA4FF3498E76B8DC94FF8391DDCE27CE91B1C9D7D59ECF
+AF277FBF4C93CE3783402D4060BC196A4ED295B49C989431A85E5957E3D91FF1
+98DBD7F0CDCDE6EE12A1B8619C0363A6F922C5B44FD2ED315868F716B0A92020
+D6A25AA44A2CAE1F5DBEAFE2F7314879A24866FEF1005E5BA4B0751DD8113E17
+AC9A184400F8CFC8EC22BF0E3C8149CF740740DCF955FD212212693664639C25
+05D59084509B9AE9F8140A7E2055BADEBA2731B7394E68CBF3CE9B9B3F186838
+07018C3D7527755572DA6D8C6DF19E2B44DD126EDC3357A042610D2A7724E060
+34F65EAA0EE15FD80F220AB0F39599800D8AE3FE7811D99C3F2D8AA7E4EB8918
+2D927F074233364949D42A45708C453CCD1B9D19363DCA985E4816844B1D4808
+77F2697F22609C77BA74352FA0F4243D5917CF76C47BFF814E98AE78E59AD6D5
+BAC149758CD2A71CE258B1F9CD599105D9BA94CFD8DF335DF4906A4B1CB7E55D
+7396B167BEDA52C3BB665DE5D307C76FDB5D7BE425E2D5B94C5B936D04E2AF82
+F7E5AB20A8FF6BDB6961EAF31CF3E57609F09E81D04F8B6873BD15E1FE248334
+D2DC400DADE5F3D9EC8DE70DEF5086A67F3A35898A23B046CC2A6B0265D916B0
+1B3C333F70B5EEC047FDDA60AC721A9CAF1D0AF28B3059F4F6C81630D809E7A7
+697BD012F2DCF8B2EE2C759C31C20450E057F2358BA190B81EF85D07DC915A36
+83ABEE07398E7CDFA966053DC751347FE016E8C525A982B861486B42A35CED73
+F6312CEF1836196C3B966FDCD5B30EBBDBF4E56F8ABAC7B113D26ADFF4A5CFF9
+A50FFE872F665D2E6DDAEF18512066F13653A99C4A11C8861E22DA466567705B
+2DE10A6647D95EF6539859A3C418EED6A5AD94027681213807B169C9A0EF153E
+8912BE45D5307C1F1019DA5CF9F73A458389D769F5F31F9976B9F04558DA3255
+CE1802A0D910F7EE9C179705E66719219330056CCCD28EC11F721478EBE5F667
+1560DEF0AF33D691B2829E960400495A5081EBB07F3118E4F015E9A075262BDE
+43B61FD89CEE026C7D5E667750962BBB2E49C9D7CC23552F636148E078A02A3C
+D42CFCD78533E276381302E314F84B064528BD96C3A32BF8683DC0A1A469F262
+84E1D0FEE1125700F06F584F6CC0784546ACE4CEE56DC6478F641D725E16DA65
+B7C3F85B8FF524431594EF60328CF4017CF070CDD1CCAA86FCFC67B9B63606F9
+55DA0C6097CB3BD7A60372E636BB20F455BCBA6351B913A19E0C51A6BFBAE5BA
+ACF0B8A0C501612C3203011F59646656A6B96014275AF5E1A11F74E2A1074AC9
+230443FE1B82B26055E56D249EF8EFB9FFC9842F070E5B54BA42BC56F68951E1
+CF3F2D24B9605F2697350E68755B9AE33DF869C2DC20D9C946769B247456821D
+AAFF9DBF705A3460AF89BB6A63FB6153D7A837AEAA68C0129A29EEDF999351A2
+30D5ED46FDF325845C65224610646A7F1F441F8D7A8473A15F9E9843F7283A22
+62EA53D5B8A7C708838D3174A0C8760D2C09E1862B8D1F367D7E6172ACC19B3F
+1E45096851BE0EF383CABB17BEDBBE5411BCA56A5B4ABC7819C83F5FB66E30E9
+2940EBA618F5D7255133A39D395DFF81465B0678241D14EC7A58D40FA897AE63
+FCE2D46717D92601D267201D29F4E094A5165B24933EB8410AB74CDE2CC16362
+54F4E80AC64BC29155D0975404843057AB70F6C1957CBAD634077594CDA7E59B
+283A327697AAE6509A4EACEF3CA38EE0894DA32364DE2F81B5748ECFC18728F0
+53AD718F3D9F443F43E3E3CE71F57C7FA2469804002D98432ED642A0BD67E33A
+0C415F04B146B2CD7ADBFA020399773CE30FBFDB66E070FA82F64631DEBD13D4
+26F760FC7E2531D5C091D35EFB6B28B06F6D88EB15B781863BE9E122DA7366D6
+F2D0C588238DE8A450E47542E8DF6C08660CC583B8BDA2C82CEA98767312D85B
+E717F6CEC37875C1019ED60239CA8A47A478406B462AD0DD2044768F11C50645
+0E853F8184CF6D603830631946CCE9949B1EF7A37D3D10BD9398FF4B8BD75870
+3883C213466AE63BBA77D549AA3B83FE5057E28270D3472798A06CC105BCAE85
+F67FD4702AB38D3586D164AEDF008C3C111BEE4F0AD216362765385ADE5D84F1
+A8EBA6FB74F185B799772199E89C850F0FD97CACC2CAD85840808350CE4CAD20
+946EB31547EBCF2F70BA08C6046896E301F3884FD17E55FBB109A2F980DD47F4
+75349351478EC9FFF9E70361C09CDA32EAD41C6854F90206B4261AB1C09027A1
+A6938F1BDC0F94571B615ECDA06FF237A94D9E34EA932D8617066A09DF1E28E4
+CD2812F291CBA5DB2BBC1EB237EB08C7C9C0A577F4FA9C5DFA30E5CE4FBA8AFE
+7CB6EF26E09A92B2EB12DFF14455F5C15B8FE8FCC493D46371F6751E6CE7EB6D
+D5E9FFFA2BAF61FF808893E0EED938F5F1306B1E23815B201561F86AEB6794FF
+B8CA1B8FA3626E67E48D95FCBE7EB5860A86529FF34413DD5FC71413C0AED5A3
+583C7977E0CCFCF2A2A7CB2BA99A2CC762440AD58E403B63A2084376893F10AD
+47545D43F929B9A9FA53604DF4E26116D2BF94067DA163B0745610F3A25436B8
+06DDD7DFD96CBD9CD12CEB4030A9B0F4261699FA6644C144C048A913CAD525EE
+D9DEAAE712E7336527B6D5A9521C8CC4F5E192B05048D31D4B134B5401C3057E
+CDBAB06E33AB29B6A9E7CDB1159D85D2E7D6BBB3C2A205BB756BF3091CA99C0A
+B3E1266527E3838F25AB0ED9C93D5B6AB2CE3054A27CC9ECE937EDF983C6B97A
+F9FEA086515A15001B1D2F7BFFE98DF839BE14D3BE7C642F32A8091CA6D1D792
+9A21D13238B5D17AD2E07EDC04A5CC6414BC435E840B204CB297348C0720D135
+7E70602C45DBEED690D3AA4253BB5C9B992158C58A6A425BC173B4A1E84F4F4E
+F464D1E50BCFE55DB20D9E534E955C75ECB8140499F19D3DEA18CF256B0B41A0
+55536C144F8B0EE2825CE9C0DC4F8EFAD6F1A2A7FF5F0881882BB89B8176C479
+E71EA849990F50465FFDF122956F536ED393090C1B68B66E94529E88E7068BB9
+3D6EBE00149F5453B82D2479ADA383434F64D229A3E0576D3EEC2644BB02BD08
+0F3A495D7137DF4459D09D033C2BB8119EEC6348EA963157F256BCA4521F5BD2
+796D2D437A52538D956D4DF498ADB34E95D42401AAC46D7657A76DA3F61291D2
+40B7345B112612BB7C330576A46C39D47A98336EF793BBF3879B439A721A8A7F
+28860B972352C0F53CBA6891303B541DE74E93C3598A9D685AA78E25B735690B
+0F60042DF6D38E476E12700158908F72CD93FDE0F1912B316889BF62AAF6ECB0
+B0804AC329BBBE25901F9FC84DD7E519FD9D94319332B034262227468FBA6EFF
+E03C728DBBA7D998ACDF5B424F13247A183ECF6EEF479D3D48A301C06D9980A0
+05F7947ED990390737BE04734AD72DF313F59B8583FDCCE6EA1B6AF5FA79902D
+97FEA38AC28DE7931072EC834B75BE83E3CA2DFD7BECB07D8437789A42C4BF41
+6917795216FB9D89689CA8E0D17A005220B79F9D235A12A4E70A5A307FD21CF0
+CE5F6A6DB60F65D67A786D60DB7D582E5928170D18D7DBC9C893109E113BD203
+AFD3B09CDD6F55BA89D67FFAA9D462A6B36B65A31DF47F91123D237228AE03DC
+EA63AC154453F92FBCBDB4FD1008A8755AE9EF012B19070F791DDA1A0EB6791B
+D2B40BF5A276882E82787274DE62013BCB19D7067FD6E271948E773A3DF930C0
+5653BCAC36E8E0874A87DF9D2A4DF5515D1C17ED858E14E56DA9F49F4AB2B6FE
+065E6EA1087B0EF758E3F0ECBC4111F90F4E63EB540F9007E45898580166C117
+C3FB45F222DA09B5E0A202DFD2DDD2B6F339B443E8DF4756C7C135D57BB95999
+4EE2F3A0A6E6FB40CB9B376C80008F1EBA015B6EF06B1D182ADABA4B41CF4463
+3319F2B06DCE8588346FD570A715B8FF518BBC282ADCEAED2B6E595F72CDE8F9
+B83931663EFE0DDF86A0E17A9DA90771A5D904EC54BBB1730124C3733808DFB4
+1E0E6DDDED933837D5EFB5796963AA5EE3966105800C331AE404B649B9293E2A
+49201154BED689D92F75D415190B2ED46B31B2C99523A5E8F0DA9A327959A6B9
+D5E3A15D67D2CAE8FC481F7A6193F9B5BAD76746E8EA99BDF56148BE7CD925DA
+96865D5FF41D20DAFE8918B0CCF1862D2CEF3E8822F52B5BE1036F0F63FDD249
+A12AAF5608E4B3CD9C4C6D4C4FE889CF988CAFA59987ECEB1E1DF5557E918451
+1756489241F6D21731A426127AEE1B77D5270CC512D923F28F2F004D5037D3BA
+8FA3ADA1E2557952D0405E7260A872FA87F25CE435559F0B72233A832092D3A1
+2CD1D44DD94EB57DB4641F8941D0A468AD9B88147F583F8854694678117B8A81
+B871D9A0E016A818DA8175E9933D20D14031CFE6CBA08DA5E394C9F1BC3917A5
+39EBF265C68F187842CFF653D1008D910D73B097B1D9A228AD7504E5E6BA7481
+A8CB6F86FD9D63B918BF7C2C0CA8D51C5447E743D8D50AF5332759611E3B239A
+3875D1764621EB3BFE1BF8005C04F5BC8F886C74431D0821175EC94F95728900
+28FA19C34EFE7EAFBF527D4DC551B67469373DF6F8A5F03D1EA315BE1C8BF74B
+3617DF1229508CD6DA28A05AD3CCB19036E20B4E7D422823BC365296B94392EC
+79388723769BDB820E425693F970C449913DF3FE175D19482520586F001A70EF
+D9A25C8AB078F2991C9384D3C8E26B159CAC95CA5CB503F4D68736D318C6DA33
+DE5A6225FEFBA1C628F54F83390EA179E2F23921299AE390E5FA9AACAE885734
+F5C6FE21D8A2C5392F02F511AE09EB40F46DF09E3C11BB134821A6127CE0FE95
+DD27C2C08835EDF77D170F68505C571BE8A13237DD0A4D6FFB19A620BAA28366
+CC535B47786C3364E5F0D20FA6692A97B8F00B147A2B7E220CDC339CCC852E98
+62EA289E0C245EBB92BC159EFBFF33030FFBBDEBCC3B16AFD17E30B0394DD7D0
+8AB946CFA93177A91A0CB3A906D34CB2C362B5F9DC28FFA3D2AAC9B94B2FC6C3
+20115A4BDD7B073B3BCE0D790F5BF30A24D4389325ED5B6EC6C5BAE2358CD0C7
+FAB4131D4928F737F27A86F3CD5317F92C3BFE3D2438DFDAE560CC99AD4AF73A
+64D8C54CDA03809032808821F5FBB77183390474DCA752F5BA2C1FC2D973E4B1
+FAA893A102DB49E5BCDFC0DE7D6E2C4D4F7E73DEED0F2C5D41E06B7EAFD36FC1
+9004CA73D691DF2A695C15282019686047CC65E677E7D73CDA90CAE0E5C082B4
+34205A1AEB8236C07D6831748EF462D7E33BB19FFE998F1683887FCAEC38F4F6
+25DEB7A374796C5E6873CC2A95678DD4EB09611DE97CFA5684D5027FA275B72A
+8551EA455A706C88F723B0952EAE72B833A4B09FE21D77559B3ADF5B7E35B0EA
+6146EC582968CDE6A66FC4FAFEB5A5410BC2B5F7A1C10B615CE3CBEB6ECCE7A0
+3F5AFD949C53ACE3E0412C516F5EFE9CA74D17B13EDFFC37A7685530C586686C
+A4303092820AD28E10A4B2CF48087A6C75F616668F734A555F6403B73DF2349A
+77FFF48FD9F3A5262B0E373B73B383DC9EA2EB102EF2071A2CDA93D51BED6D2F
+7D04C2DB766A54F36FE7C996550712A46AA956C6955E566AEB7F6F0732C87DF5
+6BE3B7E7622B9AEBD64D0A59E1F573FA49F8E45DCCA9D198364385A61BB81166
+2CE1A91FFB65D619125EB95836D39804F4CE8324C74ECEFE09CF36FD3920B604
+EEE3FA6114B0E6FDD4308F499AE0D7E1522ED872610FD8065F6D01DF385DA33B
+290EA15F5EACB415771F3FB2F11074C0118D0E0F5541BD65F774CEE8408F0373
+D13F0D26D70F7592161B4584F249F568A789B6EF9FBE4C549CF255806B32696A
+80E032FCE857332767C2BAAF1C13EF99B880D66B26C8C1123418D07F33D28DF6
+FDD01BA321D016C5466AD7F7E2CC66150E061B0D8B61E4AEA11F69CE87331759
+4517284D3326481C1587CE5A9A892AA78AC7A71FB9EDD744AC135110CB4B60B6
+E8CF7E71E59B29947BE90A10AFF21F664BE00C25BED1C3121FD72B957B246D94
+D4C2590FEE9FA112B4B940AB8C6EB4E73B7C3F7BCD617F58FF56F71E571C2D1D
+0540799D853DA4547DA6E2B51DE8EED7E9F11C2D9FC9DBF138F01ACB6A3639A7
+5E86C5BBC612072FE0426FE9C8543ED138CB137B90367BE48BBA6BFA9A9CE22C
+AB2DF61B48CF63F7526134B987B16934CD27EDE47A0FEC644066532165B9E0D0
+53DEFC63620792598B6E9865AD39BBEE82B13B416A0739E23FF9310AC7765F4C
+612F9EF628921E1B2583AA16A36A44AE57420F49EDCD3BCD177F57F56F8E0623
+919D66DD290BFB1CCDEBE11E0980F83E288AB8CB449A0C0D722A99E8D25E37FB
+4321E7D90B1947C0EF89AC595BB9EDAA1BCF947E1830FA75560EC0C7E8341D7F
+7663F2772801C4C455F878E63C52592F040DB7FF68B1342CBA69ADD53E7AD54D
+A9C7C2750A88781583A55CA2B63B87BA5783CE6F379FF29B6DE5C6440F6B9F37
+2978D828710F510435D53E3877952BB594F67F1D1E66B7E0A782A28DDA886699
+8F807675E05E5D05604595AB1886A25256E6427263E83581203048A87D3D2B61
+CEE9EC8C9EEA2FAD8CAA4245A058FEBC332E271B80B5F584FC5FF69362EB81BF
+575D1A9525434FC2E78EFA323D8C7C72CDAD0D2365636AEEB79DC97F30BD225D
+AD416A1B380F2B4BC1E42840A658190A15CC8A5FDAE81F125EC036BE41053EEE
+8BBB60BA4AE2738DD24AF9999298F49F5728292480027265ECEF19E9C9392B24
+060912AD8823BDCCA966BFD82E784E898BF31840E3DBBD00D9F2F1CD9B3677E1
+C2743F3C0A8B7494113A99D96B111F6523AA4D38E624F01FF3D61D15EBF1CDF3
+C1A4AFE26899BE7541FA0D0665C3163D572DA4F3BC2F95B342024006265A0BF9
+C56D843451E5EBC70768DD453D4A1E036955E85962082F309BC220AF31004058
+C88F4C4495C27F4CF79255D1D00E01CB450F8E8024114E4C9BD66C8D3F21BCA9
+26D86251B8F2A517E31679B647C0BC5370FF069EF853622318FF817ABA34F3A7
+02D7AA01B78919833A3C949624822E7842D3F25875028D85BF68BE06D139AA46
+D0956DF4C30D1D002D070D40E25CB5402841AD0AD62E9E149A1524205C707D4B
+D4FA71E3DC8EB7973EC0B9E5F91CAAB97FAAE9DD364D19E62CC681E29F780C7F
+D64739103B864246E7A35D49ACD111A3F19BF62609F8A66913E0F1269CD85EAD
+92FBA55617AF3A2AE04EE55B0576366335230CA3603211AAA630A0E328B518FF
+7879F794A748AB2864042D9D0FD3AC02FF8EED2FB9B30960B586ABD4B8BCB335
+88E74770B3828D211107A07A05AB5DE46E8CBEED6725751D0D15237D6648E000
+5989DDB8FE9531336BEDE438892B00FE9ECFFA08A2C8E70FF6D30C07D92B10D0
+EB4B0C1F121DD79A8655817E146CB6B229C248F27FD20A857DCB8F0FC311DC04
+2B9D6372667CB6895080855007AF6DBC246326AADE5E4403A63A1675EB2C6827
+CDA96B178680C6770C11CF6D2A080CB4CD126DC02A7091458DA575CAA8CD7313
+8117AB4232E6FFA888E4A2830077F7ABDEDF681675745CD838C36C0E334743FB
+0D7976875D944902EEA67579CEB603F03BA59F13560C9F3EEDCC7B3EFE75B356
+CF730C49FA3784DCCB20AB6B997ADED550A6D41DF09E6A1F1FD05BAC201E8201
+D619E869194B16C0524148EE31C3585346FEB6F9D898F03582D20FA2224ABED5
+DD5F49BD827C5C40CFD54AB868CA60B3D5CAF3044ED09E029B02350AEC2E69DD
+1AFA3D4631A01737D8CD724F1385974BDD77195EB14D3E4769002EA3B6149EDE
+3E46A11FD58DCD6FFC49BDE5AF46FEE4B1F047769D8EA194657243AA90FF78EE
+1ECCF5727A4ED18339DCAE58E7824B5776EF8C9311E95D18ECAE9227D85DC69D
+DCBD7ED871D249B5B282BAD8FCD48F4B36F2D1AA83ECA45616E1EB9D978F1042
+D9C75229E322DCEEB657DFC9945091AA3C5508638EE54FE88963FF0191B10E15
+C4E17E0BCD691EA0EEDF54D4ADDBE4904B60C52CBFB06A14E0B0E7D738B47334
+E7E112535B0E4D2AB632C85D6C9483843E7A00AB082D287824C1C499EAA3B315
+B8EE6C19563EFE8653DC152B2CFF31300B8107DB1E22417366F84F3F27E63678
+7F9A7D9B223C74D2B50AE5A653773A86DA2174B2AE90A9A8AD21F12831B7DADB
+D487E689313FA0252F1CEF249A82EECB611BA7AFD4A110070B1D2B4B26E22576
+BD1FA1DDC3A01EBB15FAC71F988C3C1B2E4DFEA1C98F8F01B0EF824525295626
+AA9432D8BC6582D5367B4511D61830DC68E954F6D1639D86DF1611372EF68E80
+9994EEB0899CE3C06A202116487A1F2D0D914487644F23357F38A22A277A9066
+557116B8457CE907832B367A4E2204544DB79D0898B44E410E76714022AC791B
+C1933F3E04A240653B2353B85E2A09D115CD9C71655A6A322DE28ECC677B109C
+3AF732256FCB4CC533A876AF9A1A4D4783F828605D54E3E8BB3309D71BA649D9
+19FBA5CA81BEDD0F41F7DC2BC13A2DC185E292719B3CD8584896A4363583D506
+8270B1A69F9E45F3D65B4477FD3CB6F1E8DB0EF68BB378950D9370824253A33B
+DBCC50D59B41469275A3A6ED33810479AD551FD20D822F36C665FEC64260805E
+971A15C4CA281722BCCBC55040DD86C31F4B46D0393BC0762D137409AE9ADFA3
+FADB1987262B2613BD85ACF4EABC93C4D53584C38A9AEA156072D25008E84A26
+B143452C4DB165182AF106375DD5A3E8E3005290E129B617D9F7124A9DE8A29A
+E8A773FEAED7528D6B282726EBE69EA78918D55C884042B950B84F5DB1B17A67
+47EE9A05BFC7DCF20901617B505202EA6E67D7B2D9E1CB40932619F63FB4B29F
+CB1EB6F4A759C4584DADFB66CAAB846B7F38C4BDBD14516F6D3E8EB1455E599D
+9C8C0462D778D73F33DC0195D4974DEC28A9E8E0190E1DDAB0141A55B5655CCF
+A184D237C28AF2F3CCD182800B4CE0830BDA5E0F6EB7CADE5F119BA4F8233CAC
+E6ED164432E005322645923D0D22005144551BFD9CEC13D61D89BC0553C1E884
+64C77B7449AAD830F2A39CC45D25674D5C153B73D199AF086162597E838876BD
+0CE4A26DAC643FA395FCB6DE4B6F321DB2C103412EF11C694492CD8F11DC1DEB
+34FDE0ADFD99FF2F8B0CEDBAD94B5F7EA04B8AFBF24C1831C342B38B84AF6F5A
+BA1497F013504BE3ECD1BC271DFA92B9AE8BC2AE65CFF00BE760E51AA1932D0B
+5B61837D988F2BAD141F6C133F17AC4327C598ECDBFB9201D8D874615EA91BEF
+9544772C907B57995062CA886F9CC4CF58B0BA4F9C71128C0BA42EC22D14674E
+74393B29803EF91331F7F6088406C313FB96F3E7919025F845A65FC6AC12A25F
+1221B54FC2B9A213FBBF36279AD243AE8EC0956E37508F3DDF8468813ED9C1DF
+59883C613364628354894A0772D6DAD3E1178F50CFBC361E5D823F4B23996699
+9D0B624BC24CDA3BCDA331A13B25A763F008FB397E2C387BFA9CBE951B10FBEB
+DF55F1483027914DFA4B3183580627A719E0B4D1A61158D827CF869409DD6AAC
+5CB3FAE9E8A1ABD524771AFAE85D1437B860C2751EB1F9D309005D83C0F5603A
+395B1B7C7028F670B7B90C83BE227DA60B707229176E99CD42EC1C8824C73400
+F97B3B1160E0451EA53D362283C34C779A9243AE630DDEC54CA88FD152E22617
+755AFBA3F28902ED6A9CCB6D066A725A3CFE13AFE398467247C57AFCBAF6A0BD
+AF67C16C4A68854FF3E536797D60C65B2E3D0BA67CDE454B5D3D4EF3B387B3D2
+49DF91882A563F68A44A98B3E18E878230461615FE9FF35E1D62910AE900B21A
+CE44D104AECA51CF186FF2A6E69056F2F5AAECF95B17525FB0BC74BFEDFBEF46
+5CE21E71C7FC0826E08A4D5850D0157739DCAC843200016A8232106D4072587F
+66EE6E08E424397813A3F44F79C7B56E80D9C59DC727D0E2ED0330B042632F8F
+2EF2B230991C4B093878D7F9242F61F33DF0C8296CED3A06DBE48057C02E2A96
+CCAA44B19AF24F4F00BF16D911C31A47268C2857F7C3FF589DE5F11ACCE4E4E7
+0E9BC8C08B6DC030E3F73D2A653F5A28EB722D70C870864964A4DC365630DDEF
+BBA5FD60A8DD7A383EC6EE4BDAA5CC8CADBEBD740F8FD5E39B8B678A7233500B
+EAB50C4ED1403BA011A45DC6A611DD29C58FFF8A0CBCF5C7A1BBB4765A3E9B57
+30AED2C2C3B32C8A0BD4FF786DD5C6FFF090276CF6E86CC04D3D75CA6D6B4740
+30A8C0177BF562446199AFDDF2AB62E9DBF3C6DF6633B157D063C0FB697E01AE
+AB4D4940EB09F2D777B9A78F69889CD859C11D0FCF92D34C606CD1E3B2F89946
+74A1749EB0E9370E8ED1C568CB1CD721B7BD9791F0DD96365ED1DB67874FDB6F
+4A01DB7E81C84293E2454C74599C162B32A27015F3E158C08312D47847152FAA
+354E1A7CD200DF5C1E032682902545D2C5F70CA9709D4DCF8BFF1F381B44DB3C
+251EA11933B297E33AB7C3A5C7E75232D02EC1F3F0C1CC3EE96139B1CE38E3DA
+859E0AE6DA10EC1D06EF1C7B67EEF8A6CB041920BB49446E2F25B93016A8AEFA
+71D1F76807668CD1637F009D10DF653096F63A74E321D7B0980EEC9621B263F2
+614208F9B9EE2DEFBD54F0220157CA16FA0AFB4A91761DB55A4B377635370886
+8DF0FB0CE382EB6834D656A78C4C03BE3EC4EBDCCE71F67670E65B1A5977D8AC
+E3DD9D4513511780BDD32AC85E0E4E50DAE1FC208977C5CBBAA68995DB48454C
+1A6AF96D9523BB435748DC1C8E83528C17E0E091111D5F9785244A5DFCD5DEAF
+B77D23CFA234EA27FD64E4BF05D689C0FEA93DFB5B6D3393C98443217535099D
+8633564C37A5F0614391A7338AF55F98E7A04CDD6681AC03AE860072EC306A34
+19FE8B1675605A9B62ED537466B604C733AE3BF9E2D1D7FC1E458BB17E047998
+93E9312FF5DFA6E7D17D25E89E5CBED8F2B8FCF84BEC95562F50E2DF19D5C674
+FA7A19F94B3AB08FE42DFDA5F1E0FA27D6E147F809356989E5F0A0763269A153
+2DA72E0A56973E51DD03BCC99E115C8BAD86726472C0876BEB438456321E603C
+64566F314036711DD2678BDF8B466C49C0418B8B7B340D58F839E16CAC8815ED
+EB3ADC82481F1ACC6B0C941799AD3DB5A11C0FAD646CB2A8524CE01EAC3D35C5
+EECD1D8546AEF47946F6B1B1FF2C461D1448BA6F48AA7BADB8431C3934896474
+119B5A6BB6EFF80E16F0CC5BCABFAA063B3E20D64DC50EAFE6C373F6F5F9D47F
+37C90219B3455F9180B6FB91BE93BFE5CFC47B3A856C1B93C8C0E97CF158EF25
+5B145B2200767F93EA1BCDA10C707DC54F29121AB7EFD8FB19625D4507AF1925
+208C2370EAF51DCF6A76B37C096416F8EDE5E954C3B0F7E569215CB670FEFAFD
+69C40BCBF09AF21B74A1FFED55CC04E048BCA3E6DE00D70F2DEE14BD1358BA50
+D49104380423E13AF3EB47B079B9FBB50381AA1018DE0FD5E82A32502C4098B9
+52816A7068F5452B177D7DB8327D577DF8BEB0F6E14D3E2AAAF4A6421C1BB807
+65583E0FFCF5CF02B91417B8298406AF63757B351CB9C92420258E06B6CE195C
+4BCAE9D2AEE2E76AE99BB90C02EF932B24043F074A01D275F13DA02884F43539
+5F9ABE43DD6D3CDF3B7F72BDD1D7F7847D66FFB2EF836A59992028063784F6A8
+CB0492E3B32FD91DBBBE3CCF76AD57AA3D1CFA4CAC2C35B4072EFD585B6C2624
+F6F78A441061ECA276B7C2E593035D47CF2F1F94710E77719FDD2924BA75B9BA
+E3309C484B3BFF74FB63675D259CF79B055EBF7C3316757ED4CBD7FCB69AEB2E
+A675549035D2103FCC4FD0E525FD4FC642458F7510A58DBF2F3317595BF579BC
+4BB27CA8F0631AFC77B503528480A23BD75B389AEA918A6A37ECFF50AFE8887F
+18F263B9CC6E0191ECF54D5A46648ECF90502B7DAA4373BF2E3984350F6C40E2
+5415DC8068788EA35FCEA8B56D4C486830EB060B75A1F3D0545C82A3D7D2EC00
+E348B5B12E3D12C3CC41E633C36F3CB70E99E73AC70049CB86F8CD526846C84A
+551451E4B3CAB1209A3C3DAC2E78FF9435AFA6469EC1E3A1F4794BAF89042866
+049F727E3FDE75A7FB8DA13FE214CB3BA2B987A85E510D1F84AFAE17B7BD8B65
+483FAD8E0E45A7679C9460182816C471148453E50189DD7007A9E8A53E1A856F
+FBD0B1C02BFC2B9397E2E7D891E85494330DD5AC5FA02002520A2144A2DC8960
+87506F0F17AB6697E69D49F94D848A67782367B7FF0256430B63C27EF370ADE0
+367D8E9B0B2EE394DF214B4A66842785E8776CDC8AAD3CE4C5043874BF803684
+B5BC1BF1608C8C04C1A1AA9F3A486C191EB86EB09958687493159917EDBB41F1
+0E49DD00F01DBC52C326F7D48C3276BD4C2D1643355A27DE885EEC294A65F071
+8798BECBCFDAC18198AD1A7A9CE37D663953C2385DC451768CA729031A55401A
+86AF32F16600D6ED00317CA10EEB65BDA3C138F8D46B03383588B20C06E0D24D
+0598D49415226ADD1032FFF645ECEF6A92220A2C45F769CFFE4CCFE4D93C73AF
+8996F22F5FF75E4843D9533BC09CF80E9E2A8B7002321210B52D174CF1448A4F
+B0FB050330B00461CA7921957C58127AE024803961BF9E9DEE06E888834CE489
+FD4AD39ED005F5B777312ABEA2EF81B5D3EF4C60028D14D584A4113714473E66
+73C8FDED35BF7D14D78ED0A0FB57AC838EFD52D50AA70456BF828B56611F71FD
+1718673A175EB164AF33E6DB967270D6F19EEE5273E1C01635E596B10AAAC64D
+787C2AA9EDF3AED22834C7E3DEFD6D2FB8D4514565F76CEF0A263ECD356C0A4F
+F1464EA1DDB2020196E58B3B736AE777489CB3C6B0356B6286BCD26F78DE526D
+9F2462003345D4EFA2F1420248181363D07FBD0B1C2CE13F5697387D579A96D5
+ACAAA0C2B6060C2C29C7434147AAC97163DF639D76D44681C6FCDFAEA5E35AD3
+F90713F24007E0A23B66AF5EC3D372D5E56DD6DDDA1A612F27A5024CC395618E
+148C76508DE994F58C40E8C3053F2D7E3C2B42F20E18B899084FF68659D78D48
+CD022E7F1CD97737628C208E1339C15BAB2571D7993D5B951A57DE6BC005D89B
+A548B438F34B9C999DEF847BDFC5918E62039F20467E8D2DE4934FFD74D8D9D0
+EEBE15D4EA254AED54AAABF5C2E00896B04CE5A9B810DBCD9A77252CB0F2073C
+DAE7A8789CCEE650DB864D798CCC770495B8D5F6D734E4052A0FBD02E16C2DD3
+0B0B96832CBE38384856FC39C709E28BEC4BAEF472D5480420E122EB65D74AF4
+D32BFDE0D4C0D4F326BE453EB7E34FCCE90134996BB0C9722192BE87DACD2128
+7294F70170907B274EBC62D3A4F37DD8919C3563B8E0DBC7DFF390970539F33B
+071B75BBE1B08EC809C6F981B36E5C776A56EFEF8351ACC9375DF221A15BADBB
+C86DBB45BDD6127F8DB00DF979309AEB84E3E51CDB1AFDCFD823BB3C8B7E5322
+7DA0CF03550B91485E7A70D56FF76751021392E192D2FE84959B1A24DA6DD7CC
+B747B4352246BDE16292FC18428DF4E92BD53D0F8876D40AA91D4A8520D08969
+328E0C61E3CCF049354D9B3C82A24FA3D554FEDEDF7658AA7B2BBBD7949BA28B
+6E25D650A454BE7D1C6326EDDF3491FBFCADFBA8E5E6CFE1DEB39871965A8009
+A46E5DB960F623CA3305BABA7799F0AC85C6FD8A252CFE1FC6F0DDCAD32AED02
+DCB161AB62A7ECE22FA6BD3BEA04E716E21DEEF2B47CBF22714047AE9AE66BBA
+8A9B4702017544F87C634E3C177DD186E9731A99478561D4730F88FD35575FAA
+B4B7E1C4AC78999E862B20873F5A8E19380E9F495356448B87C01FA1119FAC69
+C74E5DBBB0D73EB3F5033603F223A1A77ED75E653FB0415800CFDE93B530DBF3
+C297253A4B6A80E14BD878CE2E5A3E78EF245B4551BA040778A55AC1F54B9404
+4DEAF70C0AD52E3E80D60993DE6FD928E229B33FD28B9780C00264E9244D8D94
+812510E73FC7FBF26E52898CA8A262C07CAA70C50083D10A73310A1D25BBB484
+91DC26F261C926C95AEA5741E5095F52750CF795A20D6759B15A1FD7CA958A32
+B8494F88A260FBEAD94200CFA4F4A9389FE36D683363F42FE1D5571390355614
+4EADF9E6BA22C0BB2752116D523C424140082188F95DE72CC753E0B3DA09C981
+6C7592E21B7F178B4F73BAD8BD40A71E8DF9276A65A1E44BED0D9CD28E981157
+803422D326CC2809CFBB5190D9A78C2736D3DA712C02CF0CC3A1DE44FADF0A15
+AFED8DFF846B21B21C0B0E2393A0B5B9F453BA1531B54B86A51C489CF77D691D
+86094295E786CB9C33BC1E724E4D24CA0553E389C09683642050022C2BE1C814
+A10365975F32CBCCBC06F76E356FE0979001479A7600FD6DE89FA348016FF9E2
+AFADB1A0E28068E7A75B555AD332925143D552B31B2B65DC0341659638072D6C
+298793DA27837096042DCBC515D1474288589107FD447D6593D3E5A20BD617B7
+16D6FB1AF1DFFEF0047108274DB2EBA8502D7052988D030A2182FAE064A80245
+7EFDD7F5DEEAF7EE76C5F934FEF5A983F3AE3839C542E092F199CF2704980D3E
+32EC04137BB416DF5D25F37087E627564392765473AF256F80AA302DA69E1CBD
+7148D5314EECC16F8AC01AF04082522C9D370393B6CAED0B2D85B7B28FEE7658
+5E49D85250EB86270466BC0C1865E467
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+cleartomark
+%%EndFont
+%%BeginFont: SFRM0900
+%!FontType1-1.0: SFRM0900 0.3
+%%CreationDate: Wed Sep 12 2001
+% Copyright (c) 2001 Vladimir Volovich <vvv@vsu.ru>.
+% See the file COPYING (GNU General Public License) for license conditions.
+% Converted from METAFONT EC/TC and LH fonts:
+% ecrm0900, tcrm0900, larm0900, lbrm0900, lcrm0900, rxrm0900.
+11 dict begin
+/FontInfo 6 dict dup begin
+/version (0.3) def
+/FullName (Computer Modern Roman) def
+/FamilyName (Computer Modern) def
+/ItalicAngle 0 def
+/isFixedPitch false def
+/Weight (Medium) def
+end readonly def
+/FontName /SFRM0900 def
+/Encoding StandardEncoding def
+/PaintType 0 def
+/FontType 1 def
+/FontMatrix [0.001 0 0 0.001 0 0] def
+/UniqueID 5124485 def
+/FontBBox{-196 -322 1502 937}readonly def
+currentdict end
+currentfile eexec
+D9D66F633B846A97B686A97E45A3D0AA052A014267B7904EB3C0D3BD0B83D891
+016CA6B55C6E47AD7A9A958A6E22E00FDD4D6492D53ADDC90ECD778346C06747
+57609FE8907DFFFED75E2CF963A64C7F72488F4A02372BE681E9BBF09A9CE5A9
+3894F6358C244FCD46C148F1EB60DE2137E6D3079D6AE03B3724F7D7BBA47BC4
+41C27FFFDFF9FB7B7738A8D88C27573A53E244723E07C995948DED2516B6044E
+ADED62C496A56BC14483D307884467ADE985655A4712DD06ED00811F9A05BF9F
+BF2AC66203817289FFB5BDCD0445293981AF6F55928C132E885ED009DE1B5FB0
+C230370EB5156A8B609E466F00F768F0A52ABCFBFCE3514C0FDDE31E601AD508
+2666AD26D9DB386B9FEC80AC197C9FE7447928C0C6A2858375F0A1D7AD3BE53C
+9A926DDFBAC60D846783AA97CB86F804701BF53F7C4D18B925FD604F60231215
+EBDF4FAD73F2D13518E1901C3DA00ACE65647765106EFCA89D1CE1790D79A70F
+8C45A005B27C96FDB37BCF5870B914D0CEF73047BCA3F0DD984E5D1375A0B3CB
+52F08E0A1551C63CD2DAE4330504CBF32EAF800220FE49467437BEB586DC4B6F
+9B83235FD41B43FD16DF298738CFA7A6697DEEA5F75020C1CB36ACA9B1DD85F2
+CEF72A6F12F5C2E339464A441C50E45D74F8B740633A3427A2C6E080BA99DDF5
+6C69ABDD2DFE7965078130CC29AC9E7EBA0DD6844E19CA7F5F34B4DF64F292F0
+20BA3DD5EDF280F32FA0C0AD115A47622EF0BA8205E75A559A02594CDC920B1C
+1C9977D1B3919590EA4327A74847E2256357E80A23863672C65A9E792B274F74
+85DCB2C5CFF0BD95D5D0133C986B8AB06A15B643AA19E8688FE8B3BA700B6F1D
+4AC3DAFA424161562DC92AEF10A87A2DC253DB0D891C1E24196F656B00CD218E
+7330AA6784E6C9E72912FF81931AADA4A4CAD52F010A4F795A981B8620F93A3D
+170218D4B9FAF124465C1E16E8860156F02107F2AF303C4F4D179673EDD6FCDA
+D98410ABA9FF455E20C704795448C20A8B9C2C16B8C1B8724ACB378626FDDBAA
+C24F63F4077DE1C3F1740BFD672EAD6380275EE69946BBFFE64B2D0CA62CA71C
+36E81B9D050384E3062B664366FA8FD4BC13731D562910CC1664D3D609599000
+8D47B187F95EC1364A13625BDDDFCD6A8EF5A053260A9A6F7C83C89A8CC6BD28
+67C3739121734A635FF48420EBE775F823E83D1BDC03DD57F1837CDEB5E0EEE0
+68661FB109E4733BBCA533CB3CCF7F5DE3F47A3342BDA9D9136A6B54FB84337C
+B741A05208E15D2243D91AEB26F2CACE2B7811958CCD4B7520C86211BCF924FA
+359E3EC9A19616DE8DC72393DA3B8D7A1D680F4190114645821FD6A6050ED511
+8349B93C85746465837EEA634DE084B51C823EFBCB6F982FD0BC747C97D93862
+D6F4EE6401D92852F5DB74D31DD7F6EC74967BA1422475319E14E1A9A0E5DB83
+8578EB00562EF7A05431908B32CF1FC8A1ABCB56A8752BB61DFB134DA5571823
+4C1A6BCD3094296EE5242CCFA9F301FF414FA54EA80F7065BE7BF707FBEBA1EF
+881FE0D5F6542B911BC4C553993E6D8F76265A008B866874A6EBF9C0546FA117
+333AA20750F5E6BAB60F8917DC2E15E92919DB83E383D29DEC79266D80E9B159
+22004A0D8584C4642AD2D9EE9E41A8185A
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+cleartomark
+%%EndFont
+%%BeginFont: CMBX8
+%!PS-AdobeFont-1.1: CMBX8 1.0
+%%CreationDate: 1991 Aug 20 16:36:07
+% Copyright (C) 1997 American Mathematical Society. All Rights Reserved.
+11 dict begin
+/FontInfo 7 dict dup begin
+/version (1.0) readonly def
+/Notice (Copyright (C) 1997 American Mathematical Society. All Rights Reserved) readonly def
+/FullName (CMBX8) readonly def
+/FamilyName (Computer Modern) readonly def
+/Weight (Bold) readonly def
+/ItalicAngle 0 def
+/isFixedPitch false def
+end readonly def
+/FontName /CMBX8 def
+/PaintType 0 def
+/FontType 1 def
+/FontMatrix [0.001 0 0 0.001 0 0] readonly def
+/Encoding 256 array
+0 1 255 {1 index exch /.notdef put} for
+dup 65 /A put
+readonly def
+/FontBBox{-59 -250 1235 750}readonly def
+/UniqueID 5000766 def
+currentdict end
+currentfile eexec
+D9D66F633B846A97B686A97E45A3D0AA052A014267B7904EB3C0D3BD0B83D891
+016CA6CA4B712ADEB258FAAB9A130EE605E61F77FC1B738ABC7C51CD46EF8171
+9098D5FEE67660E69A7AB91B58F29A4D79E57022F783EB0FBBB6D4F4EC35014F
+D2DECBA99459A4C59DF0C6EBA150284454E707DC2100C15B76B4C19B84363758
+469A6C558785B226332152109871A9883487DD7710949204DDCF837E6A8708B8
+2BDBF16FBC7512FAA308A093FE5F05C11F9A72F5DA508C30BC4BF52C8B1EC5FB
+7F9DDDD0964A6D59193A389D490DAA6F6ACD02CF71C06802F3AE5A001F2B3A6D
+EEB60E9DD26DBCE1D29C825A9BEFE3A6572E70DC7B60344C3E0C9C77ABE1804C
+7ED61C544F0B4A3D6C7662DE8575C07BED3F6DBA7D64A9C8613AA152B74A140E
+AAD9B66E0FAEED6AF9D1820F361C1269A5E90519A3E6D40782E06778C0AFAA30
+E8CEAB87054C4D156C1B14B4E8471D78648FDAC70A3B8ED474FA356393A77420
+4211F60E397D2FEFC6A8D91A80C84EB9E38E663249FB91D5C8A5CBA68BA04272
+5D5D42497E1CF5CA1E62EC2B139F5CD4D6318EBBA7AE28614D2D88709C2A3762
+611524B8A1FFC7B0FCBAF77AD8159C354F4887DB1A27781DE0A4BA7DF2CE2025
+D9278CED48584E8E6BDF30BFD24284BA1DF828B637BF84A02908BBCED67372C9
+EF44711BC2B1DA343C8D9D27A9745525C774F5D639B7AEC197CEEDD06FD27923
+35ED0D402AEEB51134665A47847429D91CF419CA9B09DC905F610F8DFC54E606
+ADCDA19D5CC68A7BC7108EC9236C64205B23CE68B9BC38EF3E5BF9E0E6ADF404
+7365C8D0436609438C82EEB2F356F79186DDF6C1C797D3C278108B1767D15178
+C4C3E8ADC2482BAB9536AE8419E5CF3EE1B6E53BDCE2A83E2E485F496A562C10
+B3F5A131BB19D1E5414C86C5F995521076340536E10613E42779FA15EFDB451F
+53495CE8EFF239E4EC442E1439594549D45F5276F93D496C9AC712D762D0B702
+E894290BA028837304AFDDD8BAA6564E9DC307A14A7A206550FADDC7784DE3BF
+3390188BBCDDD929C82B1D7B529553BA75ACF5B385D31EE3902D96B2B5DDFFF1
+9F0F90FD791E54128C1717F313486896868A34FAFF22E23CEF046D02C156CEFB
+BEC5F726D4263EBD641C785872BF90346BF49088C8877F9A3402BEDCDF362EA5
+436C779C0CB62A95AA06B1492A401D2EDF3E6BE56ACC2AE3BAEBF714DAF5A23D
+00D64D527051A3011E5C7EE06717306B0B661EBBA51BF78757E76F3F702C0F5B
+49E7C40E3332FDE276C911B61E73A6FF5E3452A7576DFA8E5F4AE0CCE22992B5
+461CAB01CBC1B06CE88F3E5D9E13AA5619FEBB8D453EB3A0BAE6980C469151A2
+B2A1C75B147CFB48654EA6F59F3A35C7E5254199E13190C94B9FBA47F6178871
+A2D25CE75AFBAF7D03338A68A4C349012B07C7AB2999028C75EBF0D97AE453D6
+CC7F93D4067380DD7463BF6FA26DC69F254B81DD0156B5CB737FC8E48D34D8C5
+C4DCF86A4C9C6C44426E334C2D3EAD5C1E328C41C534315ECCD621483071343D
+2B8A6D47FC53C7A8C778849AC1
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+cleartomark
+%%EndFont
+%%BeginFont: SFRM1095
+%!FontType1-1.0: SFRM1095 0.3
+%%CreationDate: Wed Sep 12 2001
+% Copyright (c) 2001 Vladimir Volovich <vvv@vsu.ru>.
+% See the file COPYING (GNU General Public License) for license conditions.
+% Converted from METAFONT EC/TC and LH fonts:
+% ecrm1095, tcrm1095, larm1095, lbrm1095, lcrm1095, rxrm1095.
+11 dict begin
+/FontInfo 6 dict dup begin
+/version (0.3) def
+/FullName (Computer Modern Roman) def
+/FamilyName (Computer Modern) def
+/ItalicAngle 0 def
+/isFixedPitch false def
+/Weight (Medium) def
+end readonly def
+/FontName /SFRM1095 def
+/Encoding StandardEncoding def
+/PaintType 0 def
+/FontType 1 def
+/FontMatrix [0.001 0 0 0.001 0 0] def
+/UniqueID 5124487 def
+/FontBBox{-188 -320 1445 942}readonly def
+currentdict end
+currentfile eexec
+D9D66F633B846A97B686A97E45A3D0AA052A014267B7904EB3C0D3BD0B83D891
+016CA6B55C6E47AD7A9A958A6E22E00FDD4D6492D53ADDC90ECD778346C06747
+57609FE8907DFFFED75E2CF963A64C7F72488F4A02372BE681E9BBF09A9CE5A9
+3894F6358C244FCD46C148F1EB60DE2137E6D3079D6AE03B3724F7D7BBA47BC4
+41C27FFFDFF9FB7B7738A8D88C27573A53E244723E07C995948DED2516B6044E
+ADED62C496A56BC14483D307884467ADE985655A4712DD06ED00811F9A05BF9F
+BF2AC66203817289FFB5BDCD0445293981AF6F55928C132E885ED009DE1B5FB0
+C230370EB5156A8B609E466F00F768F0A52ABCFBFCE3514C0FDDE31E601AD508
+2666AD26D9DB386B9FEC80AC197C9FE7447928C0C6A2858375F0A1D7AD3BE53C
+9A926DDFBAC60D846783AA97CB86F804701BF53F7C4D18B925FD604F60231215
+EBDF4FAD73F2D13518E1901C3DA00ACE65647765106EFCA89D1CE17BE9DCA4B8
+33E768FED39FD1398C5F0C6FD419AECFF3048A85D8F5457861B91F00B1174A5C
+BA8FE4B800D45346511FBC2892D8933678222BA5F80BBC61E4F9D21D1ACAB39B
+65D53B9A48EFD341C060A6CB254FD1D632A479C691D46705C8FA762C33BCF36B
+D46C9A982C71D7EF5C9C7FE065F708E4078768D5C185CF7E398253BBD8351BDE
+898A25DD572F487266EA7098947ED2E407DA78F03C081F985056BA4DC451F9D8
+1A0652D46A05C01AB6156AC43B103D344C088BBD455A6EA1D14BF1F1C55D0526
+D64B6DC65BF9558C4C3FD0569943B43E872C853CA18577047335FAE8658B8E52
+9D18C3A780D2A744052041990D8A836D0A30F4FEC74E6C462FDD55B5668336ED
+D3CDC6099A4DAB23CBF36040AF8FB560EE5C17DB2BDBF8A8B221C18AE9FE7ED7
+F00B0A4437A79791086C2090C86D6E7D4C105DB42467559FCDC9561BA0EE58CF
+A4959132D9C35A595D19EE15E63FC02D26B27662952688EEB5D59592FBDE8D81
+7BF04B63D892478DC5DF2DEBF0BC70B9D4EBD5E32C525FAA36E180AF523BD0F3
+954C460C35EB760BB9C0A40F45CDD73EB87322DC2D72DC0CAEE8F954AD550BA9
+60CC43B1800186FF4507617E94C5720350560CAD8C8ED04F6C8A28878ABBD7FF
+0D82F2E6C51152CF87015036C84A770C16EA31C81B4C8D3ED348BEB23DEA7EBA
+CA3D7DB5B2651CA7235EE7DAA0435039788CDFF600A2D4EA98CB942F743D030D
+2483F7514284F8656A6FED637208445C7C712CC5C4A070AA94EF074EC0104A25
+2260FB130A7834545294454AFF925FBB515128DE77EF6DFB14B6ACCF3173CE03
+9A9B9DF6F0194891E7470A7B035E156903B461EE349002E94F19D01AC465BDEF
+56662CCCB2776393C7521993CDFC7EE3FFDCEE80140A54E59A4347E537CE2FC7
+1ABAA6E366EBAD6C6E05768121D331D71DA9FE860B60DB0081E375D86D171237
+6C5901B1C4496D2ACE9C63C7A87B6AD591F8B279F3D9F6A59AAE64D39AB19BB8
+356D008E1482B1C24D95EAB94C3E24F32B0E4E37D198C0D0659D11019FC9D641
+FCF55E6681131AD66BB7724CAD740FEDC3E27F16849EE49289F24AAFEB18AF0D
+450F577940B39AD6322711899EB9F43FA3575F7FBDA6225040B8EEB00BCE77F5
+2CBF744FA29A54D989D5DC6A80CA4B11F62A03F83C6AEB7EFAE673940D9FA57B
+A549FBB64277965E2751A705D116805B15434A0370B2D1CB3BDC3A30939CE9F4
+29E9DBAEF01C2B2344D2D021C3C465FF8DBE35441117540276EAC26188A74234
+AD04CA1E891F52B9D9EBFF6E764E083BBA8A2D553CDE8B3A6ECAEE554956C138
+1B400710E3A196C0A0C76BD502FA0840A71D8CA051615CD9282A596769ED2EB5
+696A397F10CBB0E76C179B17842A5CBB51A3A16DE9BF6F6E21A391E2887EB839
+F7A2A9E5C4118211D5BD541E58EAE230DAD77D9F08FB05C3494D63EAB87C15C1
+A44F3B0154A96331BFE725CDA793F6108842C027A733D13138315509B8CA99B4
+0A3CA81A9B7458B67DB7919BA91A7B49478A0E8A4A500E620F5E0067F5283A2D
+06C72F4FBC1018E1A1443CA8E39245AFFEE4A232E6EF006895D5753941E22BBF
+6FC536BFA725299F3F8B3231A8FA2BB6F264877D157AB2EB8322B3594090FDFD
+8EF64483716E3568888C89C095374BC2D791D8501B9DD4A7DE8B7A2B040A79E2
+1A616C88CD995611CDF3630E5847BB5D307960E8433D18482D270DCD18233FA8
+594F6133D0C9BD100725792C7DAEDABA4741F369E3F8234A568FB97D88F9B651
+B72955574842E4D3CF24F542CEFB055A6E255B95D35CA17142381D551676CCD1
+88EDB295D984748C1DD5A1FD5DCA8670240CACCDC2E75E720F01C9B54FF14B76
+5D10F4ED2F3A5702776B4EED1509B8BD6276ADAA456A6A6DDFC74BD878492489
+FAE2DBD8FA5D62C58D747E3CDBB5BE3810C38A4FEB278D6CD43B35FB88CC2B51
+9493C9EB499ACC021052DFDC65DFC64D29B8D53ED4727EC262FE3A8F05CEC5FA
+3DA9FACEC2C094EDB63C28F8E7C23F583DC78DFF7849E0123AFB9FD63ECF36DC
+F9F0844196BBD573952966E37B9C64801D47F41D97975DD403995299390A1E4D
+0239A81895B5C5E6795860E8C5A811EC8745F5A30710879CB10B27415EE4507B
+79B21B36E1DF2574CBBF71753F221BE4BB40B79AB696C9177E2124E455ED32F1
+F0507C8C91C4CA6DE3D30B0D1B10BE8F262043B5B260397BBA0772C68F2B177A
+F767B836FFA9109E8EDB19C8866B8CC7AB76EE1E7246E3CDDCEEEAE518BF12AC
+AA9B90126D17174C26E28B37FA667ED142E5F94BBB6E2C3324DAD03BD76E964D
+3E11D2732449224BBB2B354086E3AD402ABF220D3E2577F5C2D65DE7F6EA014F
+3A2B5DEE9325177C95C8321747FB8DEE828BADC83AD7CE35A5C93CC19285B8D4
+344AE23ADDC6DEB9EB95C98785930BA086CED7ADC76A4EDE1B9315299C17EE0F
+A0BBE123544AC28C3143A64735E3798CE0CB13E554DBEA34946583370CDBCAE9
+97608D0460FBBDF3FEB05E643053B02ADC5A9E7608EED63916C1B61E0C3ECBB3
+0F4304F6D9727B872524A880B06EC053D712A3594451CB25C4F6AB301102A487
+0FE04CE3A80229E4FC458165D894D4563F323997AD0AD23D6B4C502DC8A3402E
+96023170FA251B3742FA39137AAA115E451D3ED9D7DF4717EB114550D828A412
+7B9B7485586D66CA458D73989558C198355440F87909F7F3CDD241A5B1A1A1D4
+95F6A1679797B800A101625272DA93A5E0850489ADD0914A50B7A29CF3A4B43C
+2F053E19A16E5A1B111900D12D010BC98EED8189056F7FD695D7A2E045A8ABBA
+F0A9BE1DA7CD15659B5449DFDF8B645C2143FEDFE6E24B089A976F9C21271788
+019A7CF6E4346D8C9109DED708E6FE641CA807B2599C22559B2B17B64D327665
+0A463D555AFEC748F2A53ED0299C1A4DA03D0269FE3B9095F351CC0D93D513E3
+EC07EBD410C65F5B986546338A2239F27C07D66FCDF497186B10C7649003F849
+51DFDC3BC8E7A011AF17AB6D274EC67FA6ECA1577A94363EE42C1CE5957CD2E6
+335839962115167C85AFA1D3D78EEBC9FC68AAC0AC12790E068D8FB28434D54A
+22570A504018E34631C58240A8CF7F01E78235D85340E8CCE1C900227AEB6DA5
+81953CE53A6F20F4CE2D3A543C2E3A86FBFCFAEC0A7568FCDBCDD88EC5EEE178
+0A68DE013FE008DF3211F4338229BDC85FECAC967DF98C1B17BA3C640B4538AC
+52DF1DC4827B6DB779DA5061B7F53FF9D12D9D37034D5E32AD8B11FBD8C826F8
+B182DF4E0F911F26757D4A5D62F96A764303137B5652A5746F7D44706674D50A
+2D8211676F375782CBDCB2E42C04E3ED3F15038969844402F1C11398FE31DC93
+6C939CF3EA90E22CCBE9818B9EF5C5033D4DD4331F46088578E3561FE2672D5A
+6EC1128BD7B0B42F476D6A325AB3562BD4C26A24D8922CE0E080863E67F60CD6
+6DB734E98C3C96E91DFFBBAEAEFE7B416516C34C54BD31D6799C5063FB5F64E1
+89CF1F78C47036CEE3BEA4604CA5D56FC14376C827664C531E1C6A73151BD3DD
+202C2A7E16107A7F609A945373B85DC2E05F11A839EC8E5B8120C07567924722
+964C457907EF857768FA82898BD95FB6604F9EF690F844F6C502219633659DA7
+DD0EF8EA99AE4069420C3367989C59FC31E269F9BB267B366EBC90C9E374577D
+4E94708617AA17B39AF03107E692DBA9573239687800B061C275EF00278C4939
+8A4ED7462DA7432664B63038FDCC6778918A9FE60D222FBC972F7275BA69DCCE
+0B53F55D258474EFF956D6254D15D2AEE6A1DBB810F8E989EF354674884E1CD8
+572B3C664A1981835DB43C7791836909A6946961624295A348E9E6737B4ECF8E
+F3B6A3D13C430CB7BFD99F2DADD5BDA964221F5BDFDC21AF88610166AC7D1105
+0DCCF22F9EEC3DEF33F541FEED67CCDD209F17E89E4CDAA34BFAAFC613C80279
+94E5C1B8402045BCBDFC3081C94C8455D111F09CC52CE4ADA26D2F2CF8D58894
+0E16C72653B4CF0C0887861683E0EB45D64D88A86092AA9A4478FEC89E425BCB
+AA6A2152CEC730DD308A23BAEB27FCC49DE5C7D013B994B66C487C1D89F39100
+5283322736121541FE4EDC6CDFB7D0D4A1E774185562C97E7B12D46E2DF7096A
+66A73EC14BD391508227ABB658FA556EF33760314FC7B826CFC380247E2FDC40
+7FF8B311C8EEF9FB2AA9CCDF025B89C875F633147B1A1369AE535F8EB8C5BF58
+C7A5B25E2189C181604178F8ADCF308F12BD9C984EE5287F18062C998E1B6A2D
+FC20F2318C9F692749CAE8A25C9A6610177484BC321B833231142B0A460E2867
+0824072A6879C6F55C1C3D28075BC1FDB06D2C68B29971E6C53B5CAEFF5104CE
+94A68335278F48541EFED7C25E45F8AB84DFCDD5DDF7B854C4BF36A381356E79
+53E369455F2BE257C3B6D1E211CA97D04F2B99D97CD55CEE453C885BBF442487
+A28E0C537E70DBF5082F51E7321380CEA593668EEC3C9AE0BF74543D00A6C826
+3792B99C09FC709737A46B8935C577AACAEE84784E873AC9723611014F171AC9
+6999ED5446028F5ABADFB21F6CC7A175FEABDA80C3DAC07BA099C28B8A1559FC
+277B01FA9D34D0930547609A3C9B26A213AD5635DC4D2EDCEDEB5DB2B4E01B19
+35328249AD9A7F139E92C186902F37DA214886E4B30C4AB335BFF3F762ABAB0E
+FF4DB09BF257495B9EC98B9C160D3CFFE4E1B2519FBB2B7790B38D8048EF9381
+85B169DBCF00E9AD7B0403449FB7FB6329E44BA4BB7D31EFCD46CB9F7AA5BD7C
+FB60A8C44E0332588C5AA6C525C2DE9CDC3C861F76D9D1038E882F05CE4EADF1
+78E8B37088624C549855633AA1E24BA356B61F60C1CF6172595475660D1AFB16
+106AD327481FFE31583544B2968689F684D8B007222B745D1BCA70B515170BEC
+2C027ED115EBA6E3BFFA8C17833876B152EC2BEF0675264154B2235448C16C39
+80A760633C3B19CA4F6668A5D13A46BE14E2BC9750DF037C6C00DE7BCF6DBD32
+C2800D15C2A43E02D9C498C3D8A48838A442E796E11044C88649DF8E6F1FD958
+579A801E9D4CCEA9D04EE24629D829EAFBBE837B1EDAC16B811C28ABF1D5E115
+A3FFC350E7F23B3A45C4C3926C8210293CA3F73BA7264AE1EB392403F0F14375
+305730F983E923C4A9D7A917EAFB50D34B6C1045BCF67F2B295D688825B10D18
+E3EEAC3DE65FF1E36B990182A4BBB5323F1B37CD275FBAC807C55AE387102048
+4ACDAE74A3E88A4FADCB3DE0F664F3F9FB6B093D9368CECEDEE20A86AD85B58B
+CDC9BBCDBF3BF5A4EBA5C3EC49D94E6CE3A887B013045876A041D59DB2883387
+C7566D6A791701A8EB405EADCE957B001530E2F152516023043CAC354D532624
+5ACE938572FC0CE8CE250FAD6292F6754EDA86BB99E46A1747DC7C14E26940E8
+50451C550EE6B044AD5AF93DBBDC12F32BDBB44F3C4C42A95E51CE601DA73C3B
+78D4C35D3B492409063F3FD252BE4033CB0A3A0173B95A050C71643327C4E56F
+85CF46D479F1361AF8C72BD087D6941BAA47150A169C3C1072C8193E36B5F1D3
+FAB7A688217D52955542B51AD1616E5308B0B80C7190D1FAD81AA210A15C68E9
+25B3141F5D8FB4AE9A0BD0C1FF5E143D64762EBE15DCFEFA839FCC6406FFCFC0
+C7A77E83D1A804550EEE8C7E7C399B86B9AF10B77917D792FEE2E4CE89CAD91C
+50826F07B7D9211B91B6C42FE968E8963F4E8628653D338305050C9EE005F24B
+F94F4CF5BA8AF7D162A220073F9D118179748A72DDB4CA049DCD6F8E538D241F
+24AC95E034A337CE275D9792CF709FFC1EEC83BB5674D4C5F9D228ADBBE756CF
+87AFFDF4A50907A5EB55B7E1D3BE1EA9D96FBC174C525BD3F8AE3ABD61FDEA7D
+5B829C83B3C93EE95B4FAF01CE58A163E2F01C55455FDD227E62CA00B2E5A539
+3669D7063F24F365EDBEE47A2092232623355EEE31B8A3051CAFF0CBE8F07CA5
+766916BDA0599EA10799477D1F7B6D4CFCD5941E1ACF6A13BABB9017E6E323ED
+4E4AD623924848FB4DB6DA9143D4422C89B57E6D6ABD1C60C834BA1FC040AF04
+A3B9681CA5FBB16AC420CCEEB0FA4D0BB8CD6C9C19E649571768885043E4F830
+DFD676FC0C172DEF165734C1A4B9716A4A2DFC2B367262A39A5D15398BC75A93
+35A6FAC883F50F2DFD29ACF7F2DC55E825472320B570589CB2CC21764379FF83
+98AAA049AB151BAD4D90B5D9E5D0D98F7AFC53C3BC05FE1EF3D7721B05FC1208
+8CB9AE143572154E8B2A28A2F9590F7B6EED52392EF971109735B3AF9B5A61D3
+2631FCDC052282AE177E92A9585C26ACE90BF4E8F85C95571926E349D2B6F93C
+09FCA1EBA78A7B05DF4C366D4D2F0E172C8AC420AD67B6E31BC9A983B098D4E6
+C965746F065BB5510138AE5277D072513236AF0DC8C381A587DC9F82B6BE089B
+B0ADF2DB607AA7A2048056D4BF37E9893CBC5E357AE63F9A97A2C92AAD804137
+2F8B9613E4C191AF304492B362E6BDC00AD94C198510E4534C0F902BC42BF109
+FB34C3FBAE69C28883D6E40F3E64509C0E17D631C8ACFABB6FA48EFA0ACB65B9
+E6E655AFE53F9F414B3AFB82E9AADF7AB43D90E252FEC50A55C95EFCADC34825
+7F84BF9D6A2AF7F15D16838F7DAF61336EDB7E5DFCAD6E01BDC8A90244DDF146
+E37EFCF8C2F957399AA15C1A43D1A7FAF2036FCDC2AEEE1911ECC21089E83613
+F5C80BE9DC099D542E9DC4C04DC895DC4945F4227E911E310F7D2A28BEB623D5
+515BA63C3AF767D539960E642100B873A68CDAD9E7AC26F05FD9DFDF05F4CA1F
+9F59C5DACD728661B3974327FE718F78BCEECAD6CA61DE1F5EABE06F23A0D0ED
+9586A23AE9D3C1F92F99B66F7E21D717BE228A75EAA84F85CA09337E8B9FF55B
+57B71198F9FB9E0062A3FD0EBE5AC28831C6533D041FBB50B733A2E0C1B9B9D8
+755ED03692D2B473BBEE6293D1A4DB880D095A7EDEEA974BFDE4942DDD0344A0
+D9C0254286D6FAE9671D2753E7DA8B9380D4EFFD55C4160A6F093CF9C1D82045
+AB033777E1EEFEC5FFF95B2E8B4EA35411EBA34E1CE1CEF3D1B3126131C2AA1C
+D29223EC95D3A56B3D343CB4F92685589F36E1B48D60518EC3FAA1CF8C2A35FF
+1F8CFF2C12F300700FD18931D0AAEE641047B43862CAFDD518C958B3769ABAFF
+8606F048C830838DCFAFCDD853C307F4A2565163FA43916E0733C37AE910E60A
+62943242767F2470EB7D417FC07D5960C59577843AB9777316722096264722C4
+B7CB9EF1640E1E4BDF8F4B6F8A5E3A74345BAD443BC7F38F4F15D17CE38742A9
+2AB81EA4F9EB29203A0B11309DF384C9B2E9E9B34452F10A88E4A95E1716E3D1
+A202580A25A7451011EBA36001D2A56D09A1B5D36962D7F0EE8AA7BC73BD33E1
+94DB60B9A04A3D97A97BF98D0E136CE9E4BFE3B43605F4D4E42C8DDB80A47A63
+74D4FB01E6220B001C56872D799A6160956B2658204043938E749F20798A2CF5
+1A19535F2112926D48FA5881074ABE7919A2D9C41870838F4ABD354B2B3DDE88
+426CE527F5B6FD103D2DE1F3B1EAAA1DE52E3AA80BB13F66D426E8849C38DA76
+374765AC7E6D76823DD8CCB8AC7058B06718D3DB2EECBF9E499699BBAA32DCA3
+248DE2ED2EE8D0FEAA294DDA667C3008DB00831580D71AC33D99815331E8858B
+FE5A35AACC2459D208A77D6E687A2E3D641BFAF6ED043CFCA142C908B2BF8178
+BFB8E2B65F8D938C2556AF84E425421E0EBE2ED99A1EAB1348225C7190D42E09
+47314DEE4B28C662E23A16697EB1A3247BDCC2F00B5F22EBDC965824B7FDEA9F
+6CE917E89E253C68ACA8B74D7FE3C08D73AB9EBD1AE555B2184C237DF8FD106D
+C9FB679FBC0566E2F2552C5DFE0738C56BD11D3E0E7102CF7D5682319B5ACD17
+2E313B9A048F29FAB54F5311E17A6E8398C9234F610B974A0CDD161BEF123F59
+644C302D4B0F7D629E27D5F96365F6C022A9BEF7AC54B5D43DEC61354347A253
+AAE00E76E1A47B8E7D3F30AD895A175772E4D0A1EC583BACE75FF20F3A11433B
+B95E9E20CBA8347351D26C824E4B23467EA50E8D62CA52B16E08DE8B351A69B8
+8CB3D1E09968D2F5E0021FAA59FF936230894C991B6350E9AC0D78CF8D2E7DBC
+7D8A8567D35DB9EC468CDED769F521571C6A90094CB0BA46F8958111AB11A08B
+9A0906330212944904770C222F0EE3D6EFA3FEB126888D06ACBB095FD5B8587F
+52434634EF8C82D88C3B55676BF00E58C3020938DE737964EB1C7760758FB998
+DA57F004BEFB4BFA8E2E498486E21BD9CAB1D213D5AD9C130B7BA3AE7DA02AC1
+A537B5995E6F0617E1A8397AD47D995188FED3B46A14D0D4F2F93797E81C75AF
+E6D1D9E3E1A67BB68257AEB962FA84E9BB3F8838929F0F8F5E29DC0BB42EBA53
+96A629E716AEA2E17FE1D897A0A78C628498F7F4CC09B581D273876023236FF4
+B6643F85F5584E8048A94B34A4C960053AD6CE48E2E784C6F00680B576DA0CF2
+E4DC5DAD2AE864B60F724789EF879538A071A719E64E82B8DCB886F94D41BDD4
+383C30B0554CF79AF3BD0656F584DEF55F7BA6157B5E19C7C960B01F7CA8C93F
+24F05DDEBFD668003ADD33C809B6CF441C3A15D86836945424DC91E2E087BD3B
+656471C552EEED8A2021B4FDA2F62C1B30E257E0FC19562D5C0EFC5A4F362DF5
+A1EC53E39C2353552D5D6A0C74862067DA3A075AE6856EDC61E235A20CCBFDD2
+5AD81AC221B5585C55198A6678939DE741EC986824D6AC38CE7B20E1DF3B80BF
+432552AD23625E8F66860A3154A16BD4C7735235DCF9BEFB00592F1FF418499B
+3FE889E73197F2E345D14E56C291413C501F3269DB1F067A37EFA0A910C0C86F
+D39D6CDDB9645E5B8732E2060F48A5822CE3776C23F4F2493351BE46A1CED51F
+30654219A5BC832F4545081B4C9FF7F4760BE6BC03CBD5EE19CE509B1C1E9587
+C31B946CB2B6CBDB45EE43D77FF99A3076C58562D08E81180B1107340038AE07
+1F4FCF20A955B505077E0E897233198C03C530B9538D8243C5AAC31049B0254F
+529B3952088F0EDF0C62BBAE564D739F802F5238872F7EFC58DD2BEF81F0E2A5
+93DBB2ACDB26B69BAF8B31CD1B66613AD84D7F0642A2702F76D1D568D31FC0B9
+E428305FBD5156F8552DBFB22763B9D1B5545C6E3FC540B443B7AA8B82B3C3F9
+DDE1273B64D77F201ADC6B09ADC7457A64535968DE935BB492FD1824CB92A80F
+29BCA4B7DE602E3C3758C4D0D8BA39F3896C9F927713A413EAE141F2C38C8459
+73877AFA92D4F99F83047C79B2148869D06E580D8A99EED2A71A7CD83FDAE0EF
+6B3B01C094C1577E3F3A25E6F29213F3D848B28F05899013395C75362F37B4BD
+066D109BB043A893E5AA319D1AF40AD2661177F098BA3EDFBC0DF55F62C05D2F
+B3B2EF6F60A9DF1133D3E1DD1D073F5BF439BF40FB0ACC82C57F922E9E2599ED
+3C181E88CA664E7D484D9D427EA573410BC1985B34F47F26F13F348046A4568B
+3844AA9B0F72408A2AA555350ED0112C1F04B3D4A9D33D19CAE35E666B9A1155
+8EE5F2656AA439D81AC4EE1C1E58B2DCAC3D1CF2AA8EA59584B009E0E7334745
+5181F1BEBB66BD04F62569EFCE95FBBF1AF6DDF0F43B3D322AC86954A51D4E12
+0E30B3014D7F078042C365BDF5A1D27FE317F2433D3529A1B0CCF951CCD48D75
+
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+cleartomark
+%%EndFont
+%%BeginFont: CMTT10
+%!PS-AdobeFont-1.1: CMTT10 1.00B
+%%CreationDate: 1992 Apr 26 10:42:42
+% Copyright (C) 1997 American Mathematical Society. All Rights Reserved.
+11 dict begin
+/FontInfo 7 dict dup begin
+/version (1.00B) readonly def
+/Notice (Copyright (C) 1997 American Mathematical Society. All Rights Reserved) readonly def
+/FullName (CMTT10) readonly def
+/FamilyName (Computer Modern) readonly def
+/Weight (Medium) readonly def
+/ItalicAngle 0 def
+/isFixedPitch true def
+end readonly def
+/FontName /CMTT10 def
+/PaintType 0 def
+/FontType 1 def
+/FontMatrix [0.001 0 0 0.001 0 0] readonly def
+/Encoding 256 array
+0 1 255 {1 index exch /.notdef put} for
+dup 33 /exclam put
+dup 34 /quotedbl put
+dup 35 /numbersign put
+dup 36 /dollar put
+dup 37 /percent put
+dup 39 /quoteright put
+dup 40 /parenleft put
+dup 41 /parenright put
+dup 42 /asterisk put
+dup 43 /plus put
+dup 44 /comma put
+dup 45 /hyphen put
+dup 46 /period put
+dup 47 /slash put
+dup 48 /zero put
+dup 49 /one put
+dup 50 /two put
+dup 51 /three put
+dup 52 /four put
+dup 53 /five put
+dup 54 /six put
+dup 55 /seven put
+dup 56 /eight put
+dup 57 /nine put
+dup 58 /colon put
+dup 59 /semicolon put
+dup 60 /less put
+dup 61 /equal put
+dup 62 /greater put
+dup 64 /at put
+dup 65 /A put
+dup 66 /B put
+dup 67 /C put
+dup 68 /D put
+dup 69 /E put
+dup 70 /F put
+dup 71 /G put
+dup 72 /H put
+dup 73 /I put
+dup 74 /J put
+dup 75 /K put
+dup 76 /L put
+dup 77 /M put
+dup 78 /N put
+dup 79 /O put
+dup 80 /P put
+dup 82 /R put
+dup 83 /S put
+dup 84 /T put
+dup 85 /U put
+dup 86 /V put
+dup 87 /W put
+dup 88 /X put
+dup 90 /Z put
+dup 91 /bracketleft put
+dup 92 /backslash put
+dup 93 /bracketright put
+dup 94 /asciicircum put
+dup 95 /underscore put
+dup 96 /quoteleft put
+dup 97 /a put
+dup 98 /b put
+dup 99 /c put
+dup 100 /d put
+dup 101 /e put
+dup 102 /f put
+dup 103 /g put
+dup 104 /h put
+dup 105 /i put
+dup 106 /j put
+dup 107 /k put
+dup 108 /l put
+dup 109 /m put
+dup 110 /n put
+dup 111 /o put
+dup 112 /p put
+dup 113 /q put
+dup 114 /r put
+dup 115 /s put
+dup 116 /t put
+dup 117 /u put
+dup 118 /v put
+dup 119 /w put
+dup 120 /x put
+dup 121 /y put
+dup 122 /z put
+dup 123 /braceleft put
+dup 124 /bar put
+dup 125 /braceright put
+dup 126 /asciitilde put
+readonly def
+/FontBBox{-4 -235 731 800}readonly def
+/UniqueID 5000832 def
+currentdict end
+currentfile eexec
+D9D66F633B846A97B686A97E45A3D0AA052A014267B7904EB3C0D3BD0B83D891
+016CA6CA4B712ADEB258FAAB9A130EE605E61F77FC1B738ABC7C51CD46EF8171
+9098D5FEE67660E69A7AB91B58F29A4D79E57022F783EB0FBBB6D4F4EC35014F
+D2DECBA99459A4C59DF0C6EBA150284454E707DC2100C15B76B4C19B84363758
+469A6C558785B226332152109871A9883487DD7710949204DDCF837E6A8708B8
+2BDBF16FBC7512FAA308A093FE5F00F963068B8232429ED8B7CF6A3D879A2D19
+38DD5C4467F9DD8C5D1A2000B3A6BF2F25629BAEC199AE8BD4BA6ED9BBF7DABF
+D0E153BAB1C17900D4FCE209622ACD19E7C74C2807D0397357ED07AB460D5204
+EB3A45B7AC4D106B7303AD8348853032A745F417943F9B4FED652B835AA49727
+A8B4117AFF1D4BCE831EB510B6851796D0BE6982B76620CB3CE0C22CACDD4593
+F244C14EEC0E5A7C4AC42392F81C01BC4257FE12AF33F4BFEA9108FF11CF9714
+4DD6EC70A2C4C1E4F328A1EB25E43525FB1E16C07E28CC359DF61F426B7D41EA
+6A0C84DD63275395A503AAE908E1C82D389FD12A21E86999799E7F24A994472E
+A10EAE77096709BE0D11AAD24A30D96E15A51D720AFB3B10D2E0AC8DC1A1204B
+E8725E00D7E3A96F9978BC19377034D93D080C4391E579C34FF9FC2379CB119F
+1E5BBEA91AE20F343C6420BE1E2BD0636B04FCCC0BEE0DC2D56D66F06DB22438
+452822CBEAF03EE9EAA8398F276EC0D92A7FB978C17805DB2F4A7DFBA56FD6AF
+8670EB364F01DE8FCAFBAF657D68C3A03112915736CEABAA8BA5C0AC25288369
+5D49BD891FABEFE8699A0AE3ED85B48ACB22229E15623399C93DE7D935734ADA
+DA7A1462C111D44AD53EA35B57E5D0B5FC0B481820E43222DB8EFCD5D30E15F9
+BA304FA879392EE0BCC0E1A61E74B3A1FC3A3D170218D7244580C7AA0DC65D19
+741FA5FE6F8CBF60250ACC27454BBF0897CA4B909C83A56672958752ED4B5E79
+E18660764F155E86F09EFA9F7685F2F5027EC85A775287B30E2069DE4E4D5712
+E7D033481A53A2702BA7542C71062173039030CF28D8B9C63B5596A9B42B33E7
+D922944A38713383D3648A4AF160A3B0C8F3379BA4372BE2E7EA49AABA75AEEE
+C5DDE1D8BF68483C3D21271280ABB91D54CC819680322EAB72E1250A760BC8DA
+726405EFE420635B5B7F0B48752C06083E92BDE06401C42A2C528C8A60381227
+CEBEF0C9440DC034DAD9C19FB27DB399BDAEE22053591D6538587C768C1B7B0B
+7D1E222D2D8AF3A6473CC4C0D6C3E0DB49068CEB8C9BD1C5CD486A50DAA10BC7
+7D6286142355E3F21DD254E27C00C442728A0BAEC9D3F17AE9CE320D365152E9
+EB0D5E3874F2BCEDA98521D23FCFC30B4B69DAD2ADBE80E5964ED0ABEF6C73B6
+DAD30E2C5061E3747FE536E1A5D190D028F2130AF608F5DDF9DDDF1E77DC8437
+ECB3EC93B33505DF47884DDBD1DC6BBE4098DF04A29AF6FA3AE344600D0AAB53
+B3820DD7ECB600A3B8001C51AF2CA7A39AE1485A0FCD5D16F0657F61E9655AA1
+B8326F1813FEB669F4EF61CCAEF05098C73D6BE54CE3936F10EE4C56D0B8486E
+66F02EDABFE670DFD8F4C41F743CA204E5C7F64B9D06544E1AB0449A45FABC91
+5F0536F53E88DFE702A9E92DC317D5587E49A2E4AA2D6C07BC2974FBE2069E05
+4A56D8029AD43F8367FB7BB624A49847435ED26374035D5B1EB9505B6D8D7555
+6665128B99C201E2B34FA0F362F572FA69E160A4AE99E0E058E53D548B7BE991
+76C432D7FBD61DE7DDB8C0BF8B01CE184C35806E9141B79A6DB955DD756C8EE9
+C3114D383290DAFD03286DD852D73CF5EEA5657245276DFFF49506B1E5F3EF7E
+DAD841A79CEB7ABD1ADED33DDED4BB921F6CBC1C8D7F711169380254070114BE
+0F0FABFDDF8DFE74F44D87D8F424F03A3D4EEA65BA913713F837C5128203F99E
+12BDCC878BA17B34D796FA747F6D778EF068DBB771554F9C64DBBE16024AB356
+FB15A245924EFBCDB3BCD58ADB6AB154DAE796268F407EDE778DF79804532EE4
+DF63522FBB599137E5DCAA0054CC09924603DADC05F0BFDEA4D1C2CAC0518633
+E4D5891FE58A37D4055BD86BAA99E6B64CCA60BD8B7ED9A258C4EDD356EF78C8
+156756286794E407A857F49DFD1C286881CD18055466F50CF2D768F319A2B1FD
+116DE2BBD1C0E481D77EE0BF879779465E0E53605DBCCCBACCC3887A4CA8CE1F
+E5D3E9B3D84D1CD5BE08DB07B5A324C5A752A3773FBB420E35D2E2FAE456C7F7
+66DDA4A2B0922EFA48C7BB12942CEA6EFBBCE12BBB85DE4D19E224E9B602ECD1
+3B28CFD50CB2C66DF52A6B4E82A7E9846B0C9C8DB8E90A62260184FC1A470EC6
+A5EF9FA92C1F9108F297AEB5C5618AC3DEA1EF3A730A16F8771FA9A65469C26E
+F63373649A4A726FC526F1D3186E8C92B3F1940DE24E3A30600F2196153E2B62
+1A8B7DEC5781F3577EA3109C9A5B3BED4FAEF867BBE973CAC86BEE44DD4D02CE
+3E01EC2BAF70A3C5C5E8F0B105F42819D548BBC2884ACF70B92CC6B0D26A0389
+BE43AE4AA9F07373A2D7FD91736F8BFD092FE9F9CB1643C7D2459550AF63D91B
+7C8EF0E0E5D19F6E46125E018338B1CD93DD4E4BFCD4C2E83837039EE90A13D0
+CD70B571F111BA2E6AC35B129FB3CA5F10C0C8CE74470FDA3A707C60929177D7
+07D377F4060A4BF0E49933E339B048A3F9D7DD83C292ED2CA0A4D229078DA579
+9A317E611670EDA404CC984DAD64A9CE35F438855585B9C152D77545971AC6E6
+79AB677041E3B523A7259A9D818E9A1C8F62E60381D19D540E9B2B91E7C719BD
+28B3D4E768537B7F7BEDD1CA8C8CA9C393E27EFEA07337D6951B7E2C586990E0
+18DE59F1E544B1BE9CADD17157657CCA6A269BCBB47D58D73291CCCFC6CB064C
+8FF09880CEE6FE58235827C22B9F686D2A88A0F3D8AACE3BA3E6E0E6B487FFB6
+E5CEA44C921282C27F25C98CBFF2A7E6D55C71086375E0D7BFB887A58AB32B3A
+C02298B0A8E0AD4524DBADCB006288332E122B3C67056449641F1AB8CE12711A
+CADCC9D3C6BEFECA75008F1EC8ECCE80F947FFACB69C2B4123F463BF51C03D8B
+C8DCCC0DDB10E348709A703B2563069159A465775DA96EDF67D33101C2715974
+BA4432EA4240D84551312901C58BA70C42EC963C1A974BF97B1393DD52F235D7
+102ECB726ADEE793C16FFD733AA7690CBC86DFD9C11F4E8F57A10CE24E1D0569
+29020E5177BEE7D6AA7CE1DFBB59633D9E3A1CCA3FF02262C79B9AAD4F5CF724
+A15AAA97AA94A0B1CD73229B7A3C401B8D36D51819DA2A2E7C73D021BF6DB72E
+4E4A8404618F102D30990F3DF341D8C4DB08B294FCC1345502E0B10D2FC43CAF
+E5CB63D8AA9805DD06832FB14D95F941F9044AF28493D869666F24104891B190
+A885D58685E4445504CB046392B3D03C8223FB79A8D8AB57EF980E468C58AF64
+40E492B6CD8D535CA832AC91953BB77E99B354061BA0E8A5891961B3D07292B1
+DA17448A8F3DC4BE5CB6D6828EB4EF66D4960F6C2C913831AC2B191B0ACF9DDA
+87326FBBC980FDF30BF08A67A4D3E63DF8DB58E5B9D33B4EC087651C847B805F
+CE02A3D15AB8C4C4BA55234FC2C3E2A32DFC02C92388D3DCAF12AC8AA2136A71
+316A35BC7B32D1078E23285C7C52C390FCBFE33A35D3F1ED45F5FC9DEE19012B
+09CBC3D38770C78BCC5C164D8B59E57D0F0F5015AA9750A22DA33070846B79D8
+6AE2F11D50D596BB182E101DE40FE6AAE151850A9A38F6F771B852DE22A3B428
+103C73324B4243BA53B259B6F6B2C88F4F1A988B6BDB86523A4916625C6DCD63
+3F9788F956EA170FDC74DD975AB80EC5526D3564C3865978DD0ACDA652A27537
+F311F69285CDA0025D9DA82D032BB274F48F7F6E4F2EE7EC91ADA783791EE449
+EEB37C40E965B84A73A3AB3ABB284AAF832649C885BCA6826567CCECA109C89B
+09B3F2F775BD7062CB0D93604CC4991DBAA723E7292786D69452D0C4F1C841B2
+6CAA8DF321BC23DCB871A2524C4F34257F17F6659B1F7128E90B7BB7CA7D6BC3
+DC67135B0ACA56D6002CDA0C60B770846709F34C2D6525D891A680A4BC8CE2D3
+8269B7688CE89BC7996B2837DA1B5578C6F66D931E101494AFD17285288FD3C7
+D73AB2CBA28A91D22B6F549CFB871A1088022CD233E1A0E45B856D5BD89A7021
+3A8C5A6FE1DD39D0F2478B77CBAF0EB9F4D3B0A676414C791FA6C7CD3744BDC7
+F6B5C10361F83F0B9EB72E3715DC3EE2BB50413ABFA9075B1CE2A2DA02999688
+6B0851C2FB1F6336E10D20C22ED9516F036E53752F61EB8C14738C8917B735F3
+52999AC9C240D19BAE73F02B30030FAF77FB895F25ED06291DAD2A2594B177A1
+359E2A10702F29C8A54FF038E107FB1F5BD302A6C0F8FD9D7192F0A951A7EA02
+07F63383EB28C652CF60338AE299B5F5AEAF8F336B41D40178ADA55511EC8FBE
+3C37946A8C4105D37460C492CA364FF9741725769DF46AEF2B7A1C8FF5B66098
+6540267750D2942E224AB7707F78D81A748E3B69F765551A2CBB90FA122024F2
+00E13AC773212382F3A970FA4288DDDD9DAA0D8DEA2EF4C3CB2A1A734645A7D7
+A4EB55AF2F6855AA9CF7907F61F221D20CBE268D0174132135E27DE4E7A9F6E2
+7B29AB7B6BED2EFC31C3B1B7D357D8780B7555FA830DE6F859B9ED4501B623C6
+42B07A7A7049BD77A805EE7FD5F9FC53823631665FF04DCB8D1328625CA0712D
+B412CC3BAAFD1AB27D58479B5071CB3BA086E6F4C6A193B5BC34F32DE237503F
+D8018A93F43A62A48DC5F65BCAE1ADBF584C7E182D27DE17CEAB2A1A51AB8BC4
+DBC306C8DE89D0F8E5B941C684B29CE11E1A83CAA34CECF0C7BB9E9495A1D29A
+6783D321C1E774B184B6F070884E72E0028331D0CEDF44F010462521D8FBB260
+0A577AB9682CE67CE5DE0E8B86C332EC192C8E622F5918A93ECB7CE9C2191CFE
+6BE5F9123C7C0F4F07CF6C761A1AF3C79A3A7CC0BBF9C6F35919BEC9DBA117C0
+47117E3BAEBCC90FFAA039247EA2254E958A439BA2B2125CBECD24F785E59139
+7AE475FD8D519B9418E621B4BDC978FEDC4AD36E6BF482CAD3436CE628161D96
+123AD8BAFB9234E314D8BD2A1C44A142E855F950F4D928F60571B1A1102D20C5
+C609BE975A6E40D3F58E269D326FF427123422626F59D1336413D1B55FF63B1D
+53A6F429342031782A37D2FBDED43DA0E221992E3D8274EDD91535A6B1352785
+51C263E5797B0178D38948B3A2F8DA912EA8F7CCB15D33EA5C7B9914C1D891A7
+63FF7D4258418987411C5D7267F7609C097B1D29794285A2C65A3F67506B6BE2
+322642DD3F2D22205AF4B7D05A6D72A0E0A5EC0053C41ED6597311754B493C40
+5868CB52250DA784BEBCA0F3ECDC5A21B3EAB237BD0CFD3D42939937AAAB2DB8
+7C4CD851CEABCAE16ADC2526CD77AB8EEA45F1C42E9ED8BF3993111B0D7A222D
+93803083335605F8956C2C05FEA348FF9189859AF4C058D832C36D8473EF0737
+B7BDFD040344BA82F3F50F4B6D5DD870CD84DB6CF42CC583158B94CAD9D6EB68
+4E615EDC6FBFDC944371C2E1E18BD7031163997C0E22753E2955F08B0C55AFB6
+B90A1A604034517DEB59F528A785B92D50EF653A4FB8C52AFB02356F1E880464
+2EE5B99CCCB406FEC32579DC98E279679B1213730599816BFDE4737141B4B4E7
+DADA32479C9A7084040FDB73A16FEE8E092637625BEFA204CD059EA630359F43
+B6ACBAF98E1561113F13BA843DD13E616CB766AC5C84667AD2C47353BE4B41F9
+C3B0F552519C1E2FB420DF280AC20F5C4C9E7323F7901C33B098127766336B15
+692FE678E3DB20439DEA6360CCB21C08176110CD13A85A143DD18248D7A0BFE7
+E630891F14788D135F1162E0CC5CC1D391593DE6F94EC2F13D51C8D6398D1F3A
+C6F8B82D390233D47D5409C85E591C096B1E7CEA40A7DAC8BFED3299F39024B7
+909178685CDA30A3341663FBDF9F3B78FFFB4D1C23054D707836F9AF7CD02645
+42EFAA7D5A6F5F7FC725196D16B793E56301E3F16D29BE461E9CD2F53A88D946
+751ED6C43ECE5FAC669ABC30670FD02EA5EBAB073A20A1354B76D4DD72F20C28
+C4CDB8575DDADC18C818B6CAA78D48FBA86F63ACCAE59B961F23120E919B772E
+5D097FB3D8B2645DA4DF0BE03E8E61EB858AFA5BE82505FCD3D2D5B6E35C6320
+0D0BB778CE27156F5394302AE93344F48D1751A6AFACDCD65FEAAE86186FB9FA
+EF09C346493D6EA810CDA1659742C0353AE1DD6A3EF3DF1ED509B336D74C509E
+C9C34B11A7F63021F1190DBFBBFD3E0DB7FB2194DF109386E544E37BFCD136CA
+BF47AD2C942C91722E6B2825EB8DDCF1781E1925B259514E3E256E726A1717A8
+E3BCCE1803E70BB716128677C2E40ED731FAFAC0BA410E21DD734F4F9069B561
+80BF57C4D6E55C969C5DD9C25C71529647A4F0DDF382DD2E9A39C743E4A85944
+8988F7899A1749518D2F90C8CE45792D3302CEC5DD2327776B71A209F961120E
+69B0EC90CA80A4550A3F6ED1ABCA7A1CC1CE47BC8FF4393A20E3B23128848A5F
+16C7DCDE7CF623C67497FA31C44BD51787BAFF3FA69D3BA57E13F374CA5B96FF
+BCA80969B2506B2D33564BA61E1F12029A2CB72FE1528B88953312C81F790063
+FEE1F734B092A3F767CD36ADED710EB66A521426B788FAA08D945D9743284B84
+C541DBDD1B0A70D720DCEE53606A8B36F256ABEA097359ABD208184DA1AB0E2C
+2E1F773D39FB26A3AA6B3E119438193A65020EFB9C9E0FF1C98B46BC38E084EE
+02565761641EBB5AC8CB5A637332255FCD5AB75C90061C27CF3EEBD3C8DDEEC9
+EA03BE45A33309DF3D6E067B733275DDBC1C05FBB98B0C914CD502100C00F4A8
+7685EA49D6E1C4F62EF73ABD3B2A11CCDCF12CBA9569C24D71CC4A4A90FE1982
+1288B8C84C605E067ACB8AFE3AD04444295D9FFA34A94DFF9079371E25994EBA
+7BBB40CF138BF0AB210A1FBA2638F3A9F5EE6E2D308D209F8AED8248C9796C1E
+581798237895E291124788361E8C53653A7184D8D61A34A1382EB4BDB019EB54
+F4F9FAE8D1B5F0826AB744799EDE8A3A182D70961A2CC04B199FCBEAA153CA7B
+1D4268B9E3097843EEBEE61DEBA60D54C519DC86ED069F262AC3749A12D406A3
+78D9F55D339789C3C16E1F0C8757BF9E13F8F8EF56F11DF982F6D50E8AD47233
+5E87865F522A71CD93B8D3D683222C6861D8D883B6B9F98BEB8892C106512177
+FEDED9D13DA5537C42B67F1418410D3C2171AA409C38EDD2704C216453342904
+EF22AF85CA4836BF29470F7FF40B1182FC70EE2FD110793812F5CA8ED2ADEBD8
+60D9F8B21139D26BCD39E69F062ABB441F0BCF1094C7979B191ECE7E970633E3
+23CF99B8536392F7404DACF99289D71AACCB9B832DC776458834F9A04E52F657
+A3E64E981C832A150BC280E675863AFF2B65CCD77EBD78A5DC455E1E3DDB698A
+1B587BD93C1A16C6762102BB84FB524F91794AD2CF25949615F6C59636A6DCB1
+640F15290EB07BF7C5665C8CBCCDE03B3FDD6802E35D449447D179AC7455F53F
+E4CB06D49DA24273C2E05BDA1E6E32C24BF6A43337693881E1C44349935F655F
+7BD5301998F892D1FC8EE53BE786F439F1E33D8FFA8DF3E99E89CB86C58E252D
+F32502E35314CCBE5FB02FF30BDA21C478EFC67DC5EAD39114CD5D0D39C49BF3
+64FB9CADB82918FEB64B44AB6970F3CF2570596B111B5FCD41BE1661AE59A156
+2C528D1FC791E52B34EF2F43AD16218D05EA0502963B6591A8CA27E12FA8FB07
+4DC93A46BF9F9CAE010707B79C4602CFA58DB218675D66C9756315F6B39FC50D
+FC1ED41F2D2C97EE7DCFA086DF91026C9736470E4088DF99D261B0CC7F28FA16
+438326D458171D07D4FBBA776C517417011211E067F5C7D95B2B5C18ED9CA763
+987D2295A3EAC6A82B0497004EE93264DB0040EC4D8A7FEE1C4CE8A1498AE9EE
+E1D5C79DD2DC7661051158ECF8338F036E280E2BFCB2668DEF54490C29B6C49C
+964651A262F09287B80F56A7796875CE0AA17FDAEF185B0AA80C3F9C7A2B7974
+44BD01414093FF41CADAD44613431F8F943BB58589D0BC4B4CEEAF8E7CB7BA94
+E6B494BA50D89294577D8EFD4F35E9D5073FB127446DE1DFC89AA37373F91B8B
+5B87DD4D883450272C0EC8005B0A7BC1B3016565158A4F120F15FEB9C2969441
+CD0E9DDDBDBBDF2E7209B2B577363225EBFBC48930D3EC12DFA409AA19F98647
+6BB2098465E88D122220A22D57B865CDFB9F5634A84634A116F6B795B7FB879E
+8BCBF9F3C5BD7983985AA432C618CD7FF376391D2C7C5456119496838FFCB9D9
+1A1123526444A8451B52E63223E054E5CE52420B2D9821DCC415C4EFC4F31032
+02234F68C49C53C06F8D9E992763566E71D32581D4D9F910E08B2141DE6F8622
+D3D19F69DA92AF0601BAF2D9502A3018335B3F7CCFDFE61DC9012405E7B21453
+08DB6B7C063E4B6380F1763B0A860C16EB3C4A2284BB34415080CDB1D42BA9EB
+26FC36F1DC6196E444637D7F11E3E6B09543382FC9F2B6596BE86AA76985D04C
+02F3539D9A77AB76AB48026BFB6FBE02138138A099BBE571389ADE004A565D3F
+49938E6B0C5A35B3BD649A06299B09FD2711C1646C1B9E6D73313DCA0993B4BB
+1D48209E88AB747D2720155F1C5679B5E0988E0409ECA437E10267CE9B8BCEF9
+8F61C728777569915C9C84E77C02C051ADF6B6395943540A92649D2ED5F75B33
+34A58AEFBE979662427729AF64A4E4ED66FC50F4B591D12582B3FDB112BE79AB
+915DE958279B619A505E96A88C02DFA12ADF697E3ED6677BF498859C33C0D4B2
+9B5879D026CEB1E1E597BE8E8061DC4A423D9F3989B9D449A89A69A330851BEC
+C44AA91ED45A17FC4007C4E3E5A38CCCC49C173B11676D0B335B27E1FB72E131
+794BB170BCE30BED5B8CC2D0DCB4AE1DFB31E041BBE208CCC602AB383EE899B1
+3084C202F67CEC67FE201204FAA1B01A2C44CF50B9752A7C1871906802476D10
+DE27EBADC49778A6472AE52F883733D95DC4EE9DAB6965130CE0638C55E1A4CB
+2E58B2380653103D5CC6EBF2F142E8DCB5EDF3F76EF196D2D82C8AB00ED70CA2
+95C010D9B8ECFD1F94F3AC31FF636ED2302970FA0BDB06945B49024A6E6DC22F
+14247FEE22134A0F5E71BC42F6EC87B3E5615C2EE37439099A5C417A1F61D601
+BD60B02AC06F8247B340FF5CA3D8F1778DA19D662D2E666E447334D871255EEF
+AA4F588FD4FC46B1C559BCC671C91B4CA4060BB2CBFF34497D7899524BC69337
+E8413F36FA3A6BED77E0739DD03AD8A44E4DD5A65471F10DD6632464BA4EA5F0
+EE7C08418CD8B44D13797FADF9EB99FFC9FBF41C03E7F8D63C6797F3080F6DBC
+1ECE115C8E1E2C9B089A28CEC069015502E5D38A88F20AA8E0BB0C6008A94B08
+578C218DF9A55429BEF772B517A8C795F99F77502D1142693B4E2BF5737EEE02
+77BF9C6679F04CB806829DD216CECAD20A9C30663AD8B38F6879192E41D5667F
+3FB981B054C64D4F89A580DDA04DEDC71E7DCC0F0F09273C60458F53BF5CC18B
+6D24639EEE3E5F9E138746CA0309BC007266B8BDBCB7D960F22B8179B2F96F46
+6F481013EA21E4AA419D07AB20384E15DFFD2E3AD871643C3E1A2614C4E29BD3
+34B5B33946C4691930904A5DCFD9C647026A2EBCD7AD3A72C34DD84F0B3D1F44
+3444F019047970AA154B13C6861E155A099A35487AE590A8BAAE70876A92820B
+CDC0D387A2926F28366687304A7B70CAC94B87B515EACDAA6436350E74A1A42F
+62952E814C0DD4AC4C58B27BC0EADAA6B0BC6DF3011A186E5F24847820136CDF
+D1E9A6B14D8C46C546B063DA2FDFA97F094921275435E5D552523BC52ADEEBA5
+295C501EEB32D3EB671B2B8BD0F9FB2EFC292B67398FCC036982A571CA453676
+52AE7BFD3C190A064D7FD4C0348301DE7F5301A892FE3E573868998DE1EA4497
+049088350D05109952E737B677F01F13D6618BC5110FD459344B6F583C48E9CB
+707B01DDBEAFD55F34F95A28A51AC2338688A4B1612922C1E371FB45A3059BF2
+732805C44578239F35A983E3AD1EAF79BD135FC8360561E1C49EA527A0EC2C98
+828101396D32A6E8E149C2514BD6575867572EED545B10A5B2BE306EA0874B3D
+10C792ABBA6D81F7DCAF21389EDF4D9510814AAE8E5A55E67C73993F4ED63BEE
+4081630E29F4632D8480E4B3124F59096361CD4D99833EADEFB9E4E9DB028DDC
+498058FAD4B6138A23206E17AC987863AD9744F31DAF6CB116BA957FE8C20FAD
+7AA9ED519C336CE2D48DB7E7910CD8EB7E009189BF448638EEBE0DF9902383B6
+C4E621BF3321F009AEA426574D3AD0F237AE0567B2CE2CCFE3140199ACCFB987
+73C5AC9EBF9850D1E6A434C65507A59EFE58E315374638574BAC6C75181ED350
+FAB44D0C581CBC2CA6399E23F68684FEFDF1B5FEC795B103E3DA3561FD26C3AC
+407FF0750891C89B87734E59E947DEDA173DB5AF020D54C4F610F88DDCFD6EE3
+B924362B62DECF5BCA2153BF1EDD3790C26F5FBB97D4F713C163EE2C70E983F2
+11FE87E9C6F27A673F63F53815A0E3B0D35F8F32F025CF8FB542536E43834438
+E8BD2095C3D15F34BD362C92FABBDDF1C9E1B8E6460D834FDD024DB832D369B4
+0D3B6314B67C6D54948CFFD59CF92579356AA05F596EBD24CEA3683C9EF39538
+EA185DF75F710ECBA520F455B88E59EC3D6B7A606F7F6F240516F10F39B13937
+69E1CDC908D360B1922B5117A830FF35A130B07E833F4111920C5A07B67B3EF5
+7A1148A856F4585D9C1FE19A1E0ED2C13C9A69B7752319A71D73E6AE6C7E0693
+61DD23DA507D1CDAABE66A3F06412091979C6EF4306E1858D903855B61E8DF32
+D561126E0AAF4A81F7CC80284B7332FC3A0EBD5405F9573527B74A6D81E57D03
+4C02D5347BFB31A5A2F107B0DA731FCB3BC4D0E6E0E50FA74E7C0A5E526E3DC5
+2579CFEB563D4A488BE84231E05C7993E421B223CA74872EC68BA605EB3372AC
+4B92F8950B14D5CD57AE0D6C97EDF37B562D4C7C1D13ABBC2D5C6ABCC0D9BA0A
+C66C5CD1724368640BCBA93E07A9F8771363323A223A2B47E36669E41655F17C
+D579A3432419D0A3D9374011CA97F8ED28538B4E29593282F807CE04E6C019AC
+1973B89D38368DFBE268C8DEA124EB6962934C2166396EC7B926D1638DFECAE7
+AE98D74C1546FDAB585B6F2A707067453FA4C032402A28EF15B4C1E9C99738D6
+51FCB6A14779A5BB1E6779E69B948EA973A22AA94AF9F469598C500C7865240A
+FE4109DB56EDD857FA2B25CE2AE5B99CCCFC4C102EA8480FB1B3BBF0BFD0AE04
+6AAF08F1C8038E2619A83BB53CA815703E6D6FFA050C2E348E0C7D6937998131
+4862A4808A575B50EED8768CD0EBBF3CAC165DC3684CBB8E4B147DF4FD3D2A5E
+038AEF7BFF5A97A6B47D74E0168FD0E441BF479F41052B2BE57D103407CE53DA
+6BECEDAE98BEF2EB0BE30BE9D0539849EEF8354DB18E69D3101E7D05C3E98244
+118F125D783F46CD2F81AD0F9317EB676D024D80D80C30372C884F5D0C173330
+6DD1871B180FF5922ECF13335B05977F2BF09B04B2E3A2B16200FDD00EAC91FF
+C57A4BD55ECEBF533509F7885DE9FEBAB184D56CEEA428A242D9DFFD427DD2EB
+003D3A152D57149C8382CCC974352BC784AC864445DF21A2C8DA27400B58EC35
+21DA0EA1F4F733696D1F24904A7A2663623650A6855AA8D671FBF3D329936E77
+02A126AD441787D6A7639747302D75E9C5C00CAFA7A55C940CC0408FA55FC92D
+B8325E77E2A656DBFED84C0B96987009831BB4CDE032DA7E44CB47A7D3CDE8CA
+915C692166E68928D365C0B5A29FDAE373B14AA89E7020D3FCFA2293568F3A54
+105D8EE36C769302CDBA4DA21F95CF2D60DC088E677057E98CF266EA979F7913
+F468EE324829AB8B333BC608C89056D500DFF32EE64473D95418D3A0D01794F7
+E71767488A65F22650F9385B5ECE08B86D2F2B849ED115BD180D6BC078361108
+C0EC644461F23003D6A0ED5B411DE972A7023782B72F701681ABFB3B1CCD23A1
+162BD57119A0B62D09AC75C6B9D76AC3B8B14F5859AFC6F7B31AA623790BB854
+E28FA5611279513A8590AA16C692E8CEF9802F2BFF3178E7D2105F0225BD8D66
+00C6DC6995DBAA61C1153D0E8CE81F4A2ECEB6CD62EE96F2FAF38646E392FF21
+9F8B2AFB99D8F2124290E9580F7B6B097B1014A2C458F7DF5EBD0B5924F4943B
+0214D6FD4E745D170E397C2E6DA6F21F4F9A169C8A86B1B5264B34ED40D2A678
+8F91DDFE56066E4F923E63CB90ACD9A25B67B7DA2A74C80318BC6E491A764996
+155FFBD44F3C3457506A9901DFDBBC632A19CADB85D111389883AB8135981B96
+D7BCA55009C3E5EB23A82CFC784A9B67D810693287B0929AC76DCEE8BED0273C
+53DE730319413058928CD864DD4AEE2CF42E43BEBA30D4733C7D771725815519
+6D3AF0C983BFA048FDC702994B0F9DEA8CD2E92025FE1F9DDF401D67B52F2FB4
+1C4618B6A51083CDDDC56B31B90906585B0AD132B401263BB2281441BA626967
+E097D28F095581F18426E84B85FCE11F052EF9EEA56C7D042472A1D2CAF943CC
+9A92533B48C3341F52E42CF5DB48DC86BC1A94A96961C762B2A7ABB195001C4B
+2E2E456797D7CECDBD0497F8C8D7851D3D6ECF13FD6AB34EE59E09F768F7E619
+B83EAEA74A1DEBC87542C76DE08C9D756430018DD3FE678A4EF0DE5213111724
+72A5C4EE2FE5862103229AFD57E3D63119E6703914D168A48BC6BF5A03FC91F3
+C8BDD8FBB02A51AAB4882A40AA92D6CC871F7B43F0B0F2634AB29E8F4E6A1B40
+14CB01CFE93DE0453CDB1AD6FD421931D54E7E36440BFF7657D0B19341CFF9C5
+BFC3D8E08381B4DDEE5B3E54DC32E1719558EC77DD95F47C2898C8EB77D2C666
+2B75AE96D3924EFC4D81F7693E5FC2F3D0D816708C0C8EDCF0369F31FBE9C62C
+FEBA17C0739143E99779EA0FA26BCE6FB9550A22427920D6070AF9A14D24DC9A
+CEDCE2818BF49BFBE73066F8E912BFD8C05B3D0055C2DBE15E55601E450F22F7
+F7B1239DC7A652D0E6B7C33072CC68F3D6D4EB59A881CDEBD651B1D090063F28
+AEADB671F408750EB0D5DEB50E94D20D09CBD67D53A2822A43FD56E23A70288B
+211CE8E122B1D2BF691657F6F5B01DAB65A42ADE3C9F562DD409B378DCED6CC9
+322B1FBFD0E8B770FA56F1D00D150B265BD88492D7AA8DF0F16D6AB614EDF99F
+14B39604FA44CC6161E0B114B27055CA79C5762BF0A050D890269BB3AABDE0EF
+ACF7E5FA0BF2265193FF913A6F3E03E13449DCBFA06ACCE79F1A4A53CE3AD2BE
+D93845900DF34A94E36DE741AC2A3A0999BF6B796B93A2306E7F414C96822C90
+6854148FB8ACFE6857A3CD7D0F0A9A462E185A88B9226B33AE42DA864DF65DA4
+8BE72F1EB1DFCA412ABA16ECD75C326CF8B7E0521C43A5EAB7677F726FB76A67
+67B83ACF4579F54407D4C883DD89AA06F71A1E0F47F63DA3D587923E9112C781
+903AE3BAA3FFF1CDCB08BA0536417BC5EA3C9151B53A0822E464F59686002EF2
+43048972929CA7661135573230744B0D9DD4D51FD814FFE9BCE6AEF360AAF881
+AE3A3D8D746B6B0906331C6F5D11AC1A6C91D218EB0898E84553C09D9C9325AB
+BD645EF5A1C82C89B0F90DBF746F19A1238C5F5A039A6E3A5BE2E81CD0E52851
+CFB637DEE87E53946A4ECC03A1020F7CFB553FF9C357024DFD3DCF3BB7E70764
+0DBB2DEA52130D0AD48A0A4C36820DFEEBC99D19B21E99EAD993F54D9B05CA9C
+19FF1C04C01D1A808F42B6C9E03E1D1D01119513E5796F2F8AED15F882B8B49A
+C2F1ABAA652620D1F0F1380E06F226E9A8054D5100C8C0A9CF8C7F0B04A36B05
+5A34E71CD7E2FD045580F94F0E5A29AAC80DA485F106152FD200AAC5401D6CE5
+7398F1EA9EE0D9D977A9EA2E638131566C7D106A94F2E69F84022F7C7D5D7023
+1B102522040F507903FC87A441C7EC687331B1BFE74A5974AC2A06BC1D501FD3
+A00352161430CFAAD015EA5950220DA6F3D4293D767437FCDFAC652273A90C3F
+72356E1DA2832A0CFDB1B9CA361AAFA21DCD807B4ECF42BEA36E2C0D54BED770
+656E95DE5FF2A07243FADEB793DE95EA016F3DC581239665349F70D4B8E90CF1
+1F01ECD904805434E3049647C15AFE9F026DA01F2477732F06E57EE8C3092ACD
+9AD9DDB7332D1E4A6097CD9A30FABAC7FEF773322B81611CA5E997CCBAF04F0C
+AC4EAE96DEE5A833435A5B8C7730A9AB3C052F2A41F70416B194CB527EE38ECD
+FB4D8343D3C52E4AABE614AD133F1E6E502E29D7084EF4FD749FC7CBDFADE98D
+AAD986B81CDBEA7C78CB0AD30F43F8CAEE60372F8DB2E8A7F0C43E7C5195AA5E
+E0653995B98A24730052EE40F4B28EC9FB897067B1889FB492867F17F472E1B0
+3E4EC0C37E2B8B3697D0004057EEB3A16BC59DA69F0642EBCF6679AC59D7432F
+EA74DC9022EF5FE5C4E9DAD4E37E48EBECC9AE4BDF65B6BAE1368B168F61C427
+43019E7688271A42FE06AB2F48A5DB89BF8EABF962CAC86ECB0C11F77BE6FF08
+AE09F3B8355A4AA184F010099A703483DFEF8DE067E89CD225E41049C588EB4E
+27F0E4BAFF7BA2B36716645FC5394FFDC6A92CB8788F22B859A0810B38F011E2
+EA60B3374B538057D342D30D1D2C2A171CD69CD57C0D0082688DEBC047E7273D
+4FD5FF340DDE34133883398FFEDCB52C0A2476AB7D9C19693EFCE6E56D6A0848
+6422C03016CAA72889CCB0E66580F420F2F3208DFC816902AC8CBCC6302CA1AE
+92A0B001781C1D54563EB210505E24BD3086D81FF8C5329EBCC1A08222975F23
+C35E95B7A7937FEA26FD1950DB1F306693E2DD6B286957559C1E5A3B0660F7DB
+BC9002C14C9DD763A054BA5B97ECAAAAE1CA5AAE6B54B1631AB07955C6724F4D
+8C8FB4C1320A3564CF4168AEDD2B2BB7CB6ED37799F09D85B8DCDDAB7E3FC248
+391AA27A40C913DAA7A25CAEDD9F1FB845B6FE292A45B1EFDF06041FA3EDE990
+7A945DE81E57A8C323635A89F04EE3EA5F9FDAE3B5B0D577AB84F0C8243092A0
+5D571CA54A9E37D08FE671D2E8F51952BC8551430F3A5B3719351AB6FC4F1571
+E9A12E667F0E8E13CF3C3BC8A5F09C080891B9B8E12598490AC3298CA30A814D
+B94B5F2D136FE3722524958E8371175F7899C7B882FE9D1BB910453262E90912
+ECF5CE8671AD799EBFFBA5E61B4105C98A0547C1CCA034EDDD31625640A40B18
+392DD2CDF99C6CB421F507A1F49D7C6CF164AC79AE23EEA2CC900CF528D5EA33
+73B46B396A95E2B566F83BD6A3C255213D0229C06A9D4E87615B3930A2AA8CB4
+2BE37393346F1641C62819A26AE9A08D30853ECFDCBB1DF3039B80F50A271541
+D0A4CB67034AC893F9939262ADDDD191EEDD26648F2547DDE65194FB0388D8FB
+262FEA99AE1D04BA3F06D1E0CC994C95D7E801F8EFDADEF2F79FD86BB3CD0C08
+3E6C48379AE0F80C0172AC45DE7288F231222BCB159ACB77E3E0D26298D6B23D
+9D1220A8673EC4FEEEBBD31FDBF0D955A76E2286FB9FD9C2F73BED4C49542286
+A5AE8AC01643E3CC063F7DC8665D86A8ABF42C23D1BFF97C713F4D6C8729A64A
+785F7056FD1EC6DCEBA5CA71C3938896EF6D1A60778811F5F08BED2B98B082BF
+5255B489A0C64F1A270E7406DAF2E48F02AFDB7E19E61FC91104A1A9950D78BE
+7344F0F2F65B6FD69D7B6B69A52290E2E3F41DEB8E176E4D1771F2676A3A2A2D
+8AB5ADFB708BC05EE418A190A95F7631B47FBA9A9890C4624E75BF794054D809
+F7388E209C06166A62F55FFD4A7990A15909A2F8B732915F4D29B5E0220F9848
+3CFBBDE626F3C02B0B392F8098C0C0589F79515DDC5C9107E3B1973D1CBBBC14
+1B3FBE14625ECDEDB87A8A3D2205DFCAE0EAB84067492848AEF9D7F80EBC4256
+C8976BF10E31E9DDCAFDDE41AE92E922EAD025501C5CE8FF99333613AF9F01C4
+70E7A5820059588B1D485572B9456695D8ACB512C0F35B3A510DDC96AAB5826D
+44A8A7F6599E8A41E903F3AD7D84D00757EC45E673221C1FD7725C7471C77C02
+2DF11162F323EC6EA13F75F8724FC34A00D5F8F183C07F618F6EB4EFC34DEFE5
+6D79A4AC5DEC2D7C17D810AA6ED8EE9F9B20B40C22A8611C211526005C748CA3
+C42012524CCBE75BF7D0D1DEFA8ADB7C38AE5752F4AF1A49DB7553671F56D44E
+3EA6EAC795D2D227D35CE97834F03B2A780C3A42EC5D9F58E5A3D5BFDF27BE21
+24858A5242A3FE49A024B8E944C1F3530FCD7CE6F4DB25C9F89CBE6E8A6E52F5
+A90DFFEB392E5DB37DD5383FD7C4E4957445B61CE3C92E67111A7911BA238CEC
+C44855141A49F54A7E330B9A97F509F7EF7316B213E9AF54A31B62F6DBC646A8
+819671EF775A7335005CA8CAB3A2C5BDB6D37B201C4F156AE4BA1ADD788B1E25
+8307BCED97F3E517BE0493EFBE5EED1E5BF0BA17C81C0F87E6A3DF7EABF443FD
+1F8035362FC975C80EFD62F78F6B34FCAD033408AB09EE691901243B81F2D2D3
+57A472F6459122C6D22F3FEDF3F33CF99484DF6099A51F08E62C8E7E3E9957C3
+BBCC2CBA0252EE23066226D75D595D6CF6A19EFD75621C79B3B833F09C5EB1C5
+42C00B303E2D6030DD50E0ADE069F2BE73EBDC6A300DEEC58B5CA5BA7EFD23B7
+FB137FDABB8A795903CCDCD72EE149BF41ABBBEFC18A32F1F276968FED2D312D
+3F5FB7A0C86F830E4E32607C541D43561352A5CB2DCAFD4A878C7AF9FE7BDEE2
+2ACFA8308C765741FACE329BB018B53DC4FC379C4DE7766639E2B4077C17945E
+F0482F1E99CAD7B5855131A97158DC99120C8E3F2A7332A071D87816615336F9
+9A3136EF4794D4675564DB51F5C968133493D45A7A050B989D188093CD86DE0E
+9C30B91E9F9AF39597169C9A71CD63C4ECE6E0775C0A3C4E83991E548A8F0F81
+EFDC983962A2C81960E30684754D97B8383642DDB93BC197F9C15B2AFA91A616
+C7C8F1D8C4F3420E669FC0165E53B93140F5B192F881AA8141B30F20BB015023
+808B92F17BEE7FCA7C3507CB4DA1515024C241004B856AD2B63BD71ABE9CD9DE
+173DFF257EFDD28921A6D5B008EC442E42FD2E1902379FF7F477D34B0DAD0C64
+35DDC27F7E785273D68025D7C61E845D8429C0A683C81030925669EFC81B349C
+349A086473DBD6FEABC497C8F058F3C6E98A2AFE100E5D94ADAE3367E34053FD
+EF4AAE2C80A4DE0D0A66BEC110AD2F2955941EE73203D39796FD90BBB124BA93
+2488652BCCA9077882B4F187598D476A6B11C878F39B9A1DC69FDB54E5111D4A
+53A7BFF4636019DE4023196DD553AB9F75DE5595E154F1B48A85AD81EBE581B8
+79C392645444A3636F71C952CFDC4249B0F8F875201001C1994ED1A700BF8884
+A517F96749C7D8A8BBD2EDBB85B203B8F0828B1F665BBC9071E2D2A736E524FE
+5860D9ACEA6E1ED82CAF1571513339800EAAD8CD74B4C9B04765D651D203EF41
+F29B3C1556268AD5E298883E9D805A2DAAEE520B211CE99E277A8FA09F50C558
+599EB2C7940D710DABABBE1DFFCCB9AD614ABF3BD5CE3D487F869CEE773C087F
+6D8F933162EA97F0777AD07BB5A21B7A8DE557E540942064CD12E8982EA8CECA
+9CB3A0F001278312D81AF8A448E3455F6C28A59A65513DC87D3ACBA54F539510
+83B538ACE2E5D10FD0FF852101C8CEBBF448723255683A0E30AC529BB18F33B2
+32FD19A9E7BFD527A80C631D9A08ABBE8C9A040EBDD320DC13F7CE19CA2638C8
+08DD7B39411B55366F4174EF6EB83CD7E2ED95761D7CA161BC9FAB23EA950CEA
+CF302561CF45E35EB150ABED8F470BC26C33C3D43D450BF88009292007DC1105
+879A957AF71EF8A1A90784CDBA1C534F2426750FC11C4E1FE63A124799160E44
+F73DBF6D117F9396FED35C51871D95F51E7299A16234BD9BAC9B632FEAC53D9F
+7EF7E7FAC2A3A05A5F8B555E6A96A4F56AB5456E15C8DE9CD654E2B3363A81C8
+560A56A3AB4937EB15A0DB2462D23B7A82FFB20AF26B19020BBE818E51F2B354
+30B82BDC7D61E9327CE9530032E883141B74045D8017D394CF1CF7B3B2734A5D
+F986F05E3115B9E5CE9BE6A33D8ADCC1A85A8A55F10309303B35C1FCF83541B3
+F831000E94C171FC06CA2BDEADAC55C1E2DFC0B20B774A23C11211DEECB01E58
+20DBFD6790210A0FC16109B54DB90DD933CD8A668E664DEC47D02E82965A2966
+CE323D6476E94FD6BE4B5ABCEBA425DD13ABE3401032E5440473A8AD155D04C7
+9C4D1B413A31918846A8AD632EAF4690A4114918C715E519C7C2A28A8F2AAF78
+DE86D7188E841A05695D188BCCCE166CD3EC94C946AB85BE543C16EC27E90B72
+33A13CDA441DB1454627666FD52DC5357543CD8D3A0E0EA5FD876D3CC57CEBDC
+69FC9AC62E3FFDCBB266BD07C7CCBC008A1294365DA8FB806CD590E68F4B947C
+62D3EF07744646F7782B582653A987EA46827E28CC963D96A169730F7318DD57
+3202205C0D84358D69F93C130B1C4EF450684946BAE1786EDA054656F266D241
+62DCE0DD3CB3226E038FEC153F7E9AE073E85E2956BF9D156587BDE49A84763B
+87099A3BCBCEDA316FA93EAB4CBBAF6BD11E662028F6F9DE7E3BB860460D0C48
+F026278D6BEEB8360F9A4852F281EEA819B581CFAC524B984F64AD0B502A1530
+E34135DA02346802FA91637BF4D57266E5ECE5527719E85819A37ECA49EC7AA8
+D24C2A442FDCAA84B76FCAAEB8E1A10E36BB9E16E57BCDB9762776B75B6B492D
+20B9A63B3F1FC4D7947237F2B85CE6417B6A9546CC922A1DC2C40A7D07BF48D7
+358CF6250EF3F2CBBF64ACDAAF0C33870C54B3AA0BD3C65EE2B3CEFE098C3ED2
+62201CE1FB033A28C5A85FECBF18697AE7BDE770684C5C2A376F99649F62CDEE
+4B7DF363CD33465F50066EBAC9CEBAB214CF4C8D280FFC26E98935667137A708
+6D4305C26F8D2A44301C83709B919442814EF57119105D1D638F293C0BC0C9C4
+459E88DFDFF80ED36F053E14667FA798CB8D64EE0BF51D2F81B61458581349F8
+BC9D0778EAEF5DC18A454ED33C930458E9AD5207C0C07D7C143284660F65AD50
+D0B9D9BD12F8B176F9A82D5D814EA299F286452717B6DE3F2CEF9922D2023F84
+EB1499D6D4AFC36ED174103E0ED8827BB519F20873D61EA963ED6BD523530313
+FC80B4A05E527E64F8572475704C71624EAEFC4863FA2342153A23FD84379A81
+B37937D37B8727E882263163953C9D8C166E0A18EAE0599BCA9532372BFD06D7
+831F47A23B422FF2EB9354901C5DB5D3026121E5D464865F5A7388A2B18910EB
+1E8757473EA44BA4B23C5FA9DC4766CBD480B8BB79AED68C35B0D2F137E10FDD
+008F9C4A6839C6919DAE01BFCF26B8919EBA623DE172FDC645F245BF2430339C
+106C3EE5D603D6AE2BA6FFEC520637042F21BDB8485E50F56A77E43C7D73ABE8
+21D36A5DDB742CFCD303195C1AA360613C6702B32105D638646945ECFF4C86F1
+F5114F3F13C3F8C026B3925B810CA3FA0EF8FCA9CA9CA52C9045491E5E166A7F
+A6B5C164F8DE1ED82ACCBAEAE828859BC1F9CA255E1FAB5332B75CF3C9401AE3
+A1308AB7E0EB7AC19A311C30FE68EDC8281666753FFC7128C2709EAD997D2E75
+6955A70F27A6A4D500066F4779EC37BB9EC57A59F5E9F6D1B0806BABA3392231
+E043DE2FBDF0DDEAF5F04CEE7591E76E0C109FFC414834FFEC31A329EBB22CD2
+ABBA1FC87A89E08B042F17981E18F573835AC0CE03B37C0679B66651C8374BEB
+DCFB1A273B2686EB7C5234AF16AE0CBF0F4AE8A6579D320A77F4BA7142DFBA11
+E569E0A1A81A394A5D40AD16562932BE1F6B3C0BAF988A8B3E016036B0963389
+F92B6FBCAB1AA136362609985380E44B4A2ABC1509BDCFC68B28E07A20DEDBCF
+67D7DD4796E9F5FBA9A5AFC35E9D6B73F0DDFC2970EA1312D5C34A2B7D651B87
+9B091CB2A4D79F64257FFA7AB1B3052D339EEA164E98699AB62CA1DBDB2D6778
+292101AA735A84BA8A197CBC8344AA9B0D9AEA3A9EE376807C5CF2260A16AD9E
+911EFCC2D5B3EE9F0E04290F8702CCA86D43F4D20DBE7DA95DAB2C1A4F2E99C8
+6EBA1D68BC1B6BD7C942438B66981E2BB4DD9C56DF912502BA478FBDE9A926EB
+809115CA15BFD673A101C213990F2EDA091180D1897E98DFFD9DE0CED859B2C7
+F8370D8DC46046F73D66F2677EBAC60E8D33C2B79CD03F0A8E5D43ADE05816AE
+28F709B6562E24339777129652D72A458A8BB578D6BA36E1F23AE0EF70041211
+3705F0D81115D494AEFD0558B9AE2E738E54450BACE872D1B66FB9116BEF9C5C
+29989D6F58B1389866A428B9D5EFB0FFF622E4E6CDFFD7FBB8EEDF9C7B4597D2
+A5F00C11496AF34931F1703A4E526571B00B2CFF2B0F9AC54C0AF2A4771C979D
+331453EC5F79ED2EB1F8EC4A7B3D51E5DB96A42DDA6C14321C5F720985DF1A20
+538D582D8CFC0CA8202B124C204B3BAADE656F47E10D3A86F8378DB229212A27
+A653088F785CFB3125A6DAFE2E99FADB74EDDE2679B28D1D3A5326CE44C7409B
+58BFF9BF21ED145C38BFD65527
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+cleartomark
+%%EndFont
+%%BeginFont: CMSS10
+%!PS-AdobeFont-1.1: CMSS10 1.0
+%%CreationDate: 1991 Aug 20 17:33:34
+% Copyright (C) 1997 American Mathematical Society. All Rights Reserved.
+11 dict begin
+/FontInfo 7 dict dup begin
+/version (1.0) readonly def
+/Notice (Copyright (C) 1997 American Mathematical Society. All Rights Reserved) readonly def
+/FullName (CMSS10) readonly def
+/FamilyName (Computer Modern) readonly def
+/Weight (Medium) readonly def
+/ItalicAngle 0 def
+/isFixedPitch false def
+end readonly def
+/FontName /CMSS10 def
+/PaintType 0 def
+/FontType 1 def
+/FontMatrix [0.001 0 0 0.001 0 0] readonly def
+/Encoding 256 array
+0 1 255 {1 index exch /.notdef put} for
+dup 12 /fi put
+dup 13 /fl put
+dup 45 /hyphen put
+dup 97 /a put
+dup 98 /b put
+dup 99 /c put
+dup 100 /d put
+dup 101 /e put
+dup 102 /f put
+dup 103 /g put
+dup 104 /h put
+dup 105 /i put
+dup 108 /l put
+dup 109 /m put
+dup 110 /n put
+dup 111 /o put
+dup 112 /p put
+dup 114 /r put
+dup 115 /s put
+dup 116 /t put
+dup 117 /u put
+dup 118 /v put
+dup 119 /w put
+dup 120 /x put
+dup 121 /y put
+readonly def
+/FontBBox{-61 -250 999 759}readonly def
+/UniqueID 5000803 def
+currentdict end
+currentfile eexec
+D9D66F633B846A97B686A97E45A3D0AA052A014267B7904EB3C0D3BD0B83D891
+016CA6CA4B712ADEB258FAAB9A130EE605E61F77FC1B738ABC7C51CD46EF8171
+9098D5FEE67660E69A7AB91B58F29A4D79E57022F783EB0FBBB6D4F4EC35014F
+D2DECBA99459A4C59DF0C6EBA150284454E707DC2100C15B76B4C19B84363758
+469A6C558785B226332152109871A9883487DD7710949204DDCF837E6A8708B8
+2BDBF16FBC7512FAA308A093FE5CF7158F1163BDCEEA888D07B439DBD4E8B4C9
+D198C03874B5E6F8FBF4922065A92BC3E66D05DE53971CB1424510E892442858
+D69CE1F76E4DA76C87C763A4B2FE36321E54B1328C9155B8ED6361855A151723
+3386AEA3D042B8D89C8C0E9A33E5DF3B466F7BB8C2C8A4ED4CDAFF55FC6D3EE6
+0AF2CEBFC1AC3A6E6692F8BB81F82D86BAE85016AD62FCB05467082C2E5AD348
+44D1439C2B59F65590E57CA0DE481A7A34E79931B1513C4C30156170409A4BB8
+46D412D1DAF88AD30722F12DBCA1CCC6B4BCC28D06B0D29149DDEC520C8FBA13
+6B82E2E1790F00B216282FF122EF0D47B70A1B29514DDF7C0435ED238C14BDF5
+6DA243117FBEF7398F97EB95597707ED63C6797EBA1B46EA19ABB1DABDA171B3
+16CD500F5D64CBFBE4F9CBC3E66A34427D3C4D0C432710289381F9BFD91B4FF4
+1E3A896C3EEA2F3105C218877D6C0C6B763760FA364D00065E1CAE9DCB5676ED
+286A9ED0D1C946DCA6A2A670EE0936FB4706CC62E234CFEED34AA615C48D2872
+A087F30990C85E64BA68F3D5C117123467DB411C9F2D6F6858CC70C1E352C477
+713097321B4C4FD4C5CDE305415F998E7245908EEDE6E056A736EA77BD8C639C
+3A79FFD0B74B3D28F0494A115F2841CF8A8827AB5608F96FD8998A5F40FB3DFE
+3AA0C7696DE4E1D18DC0D6E84B943175FC38FFC42A9C0CBB13A908978C98BFE5
+034F88480F32B9DEB2FD228FF6CB0B89B045AB02020C82E3F5716DC640613185
+9F597CE262729BC52132F43922B9E28BB71A30AC8709634561B22D13C4FAFE0A
+12C4451969226B220038AD8DDA990A4E2CAD53DBEAB698898BBD3046234EB4EA
+901287E71CB41296C431383AB85F18882F65BE36923F6C0FD6FADB8244AD3664
+CA365C8986926F1AC61331E0CFA5C269CF6C8A4F8F52F0CFE16FBE435D315B31
+917486AE877182D755931F0BA2773B8D65D7FEFC0F0193CC7C7DDDB30CCEA342
+2678586C32D4DA3011DB8355C8ED60391044098ABD0F3A547E4F4D0B7A717C9D
+361EDAE1C486FE0C385FD19BBD26DCF4C6E5ACE1B4C6D64355999CB1885C4EC0
+4A5FD3692EFB8E1F5F23F9C40184F7213B146182C3FF51F68BAC665620456C2A
+D6680A6C8FC8FE0D130DA51E5321CD3188728B9760AB8504A35143153F85332E
+4E5EFA6961F0C67E0DA8DE19B04F4E02ECEBDC68C9E379303AAA1E8F1ED939BD
+45FAC10EECEB9DAF6F63462B00C73253D8BE5D690BDFED7B4B22BD8A86AD1683
+E5A8062C966D88334918292CAE2F8B0E0733F4D6B8EC4EE46C4E5D5802E871D7
+989D0EA2ED58EBECBCEDDC8EF5740200736017A8ADEE3614CC0B2CE2BB8811E1
+A0C9E8FE14281AF72D6DB5F44E59310D59CE7B72F720C63911A9DB65498F4929
+DF8661E01E6E24E6BC41448AE46BB75C1EC448FF44314BCF6C2F8F33C7EBFA6E
+5DCDD74BBE4D63798FEBF256F873D0E3286751AB2742C302FAB24D7459338099
+ECBB2A56838E2B5A3A6804BBA2F961FD412BDCC672B791129B5F738A3782829B
+08F1D627E42B95ECCF707F831683F891DC582E93E25CF33A82C266EF4645B4DF
+AAAE3047C5AE86962C13AEB121E4FBE93F14BA9A42187664E3F0B3DF6765FB27
+F42DD9626A220992877A645B14469BC0E5C877D53CBD0CF40EAD1E88044B8871
+4723CC7BD957B0B9361409AD01CDD477A0ED8D01A243C2C7D58422899CB18AA0
+77EDAFE499418A1174E3080A89E7D24E21E4EBD73F2B10BCCB7E3E47385D4E13
+8907D9F85D193D4511B7FCCC98E4D9BAD4246C16FE2A200886B9D688863280A0
+4283E954A61647D578381280E69C8E18C10EA414A5B36C2F660A96CF3852D678
+4D887AFA2949012C941FA56D4DAAA16CF911FA1ED4930F27E79A561222CD2402
+7E44E15895E65DE3B16BC946C8811AB2D921B16B0E4A42F6A83F3BE368AB9791
+213B3AA70A3E6826FD181C19A6B7DA7975C287CB6C39167F841BEC2FBB4BBEE5
+83EDF87CD5B856442ED15ED2D7545F8D23D91636A0DE3AF379AA466423D823F8
+B7198903D2D06DFFCB4AFF80F39B41714C08B072140935895B8DA9B68A955989
+FD32EC451F38F494E623C6F7D774C3B2A98DA99150BF4CB96B0C146B9BC33E28
+6A32EB5E127F7B2C58C8C20D61DA940F3B0CF7D93DAFB46CB7AB0517122F4B99
+A893EAF1F0F2464C9876BE2EF9B5A88568CD948FEC42172A87F5A4D9FEBDEFC4
+26B72D49393440B93FFD0D768E896D16F4BCA2EE6A1BC6FB194202CD2C0BEEB3
+2C91CF0BFCC63914C1073DB3359617541E65E84B87DB828900A378482BF2350F
+D230C3F1995138332EE8CB33BE3AB46B60F2E04EBA220EF04D359E0B0B254F2B
+BEDD6E3D618566E037A9B16FF8E6EE544857562B5027FD8432F76E9B08A6B69E
+94A301542190707020DBD947816C8BC4B3195765CBB611BF895EFE8031407D3E
+1DDB0AB9F771BE5083DF080D617FC5FB4EE5C4D2CE55BC7B6E84BA3FDC28D9A7
+F8C01F97A5A663F9DF367A4F143D3B5FCF15A1CFD6071B7649D0466DC6BCCD55
+2D26584C5CE030E17A3F1CC18B9FFC48B2DC7BE4AE2313BC1346A76FBC2251A0
+8A6F6A84B11CFF7A65325B772E8B78CD57EE4262F4E001EC12C29EA9DA4CE5A3
+1179CD24E76138A434E85E21CF2813E2766128BA01421A3CA50ECDF9FEDB315E
+A1B1E34378B411085A6803C9CD00B4221400B289E2E7D5606078E695D273385F
+475FB39F9B9DAEEAA6D8C1B88B079CD425CB4660A62B489FA2C75619A8002E23
+F4213752CE330A1E0693194E6445135078673FF3F32919124D3628A153F2ED6E
+112E76C4A7BDAE4FE52A3C36AA78FA8FCE79AEFF6E767D798788B2ABEEEBE6A0
+C53AC45AFA738AEE8F9EA444BD207DC62F7707B9F54282A62B214EC4B0C11927
+C9B54088D5E1D0DE7A54FE2E0010E0A8A8C6AE52B1719FF5AE0347B819218202
+07D6DF4B41A35D62D4882C8858E5E8DBAA43ECD6730755203F73E152CAF71194
+B28D33B3F79B15F140F312064E28304F719F4992CB84E91997C61272995D1071
+1D9E1784BD850F038FDC14BA28BB67A1FC1371C2B15F9B5069ED8CD6ADF3565D
+3A0E16B331F917B9DFE115433C0F8E6CCA311A8857ECB51ED1D0584E825509E9
+3F7ED07B159DDAB884246F737495D88E6290580DBD8C7AF261E40C155705E5A6
+A3306582CA8A83C831F2D3F010345F75DB08E9646AA2C324938DEBB7CD114B74
+084DCDCC878F2C7E1728EAC2575B0DE976E5A06813E4A104BB24CB0B42598036
+85D68CB6B9A55B04211DC855AD9F609949DE3222355A78FE8FB91AE9C0B898AE
+2959ACF800FC90246D6B97F17ECB6DA44CAE3B8029FCE96016D80776965E3976
+9F8B187AF876E4892693EE88E45368885C46CF9290276EC64D80736ECE0EAEBA
+B744862E5F4F1DDE09057B9ECAA22573D353E1F2101F3A3A9058C2D7B01A53E7
+7D9A814F696AA54F73EE45CB607F208CEB5136ED5F2C8A8A36BB3DD6358D1FFC
+559DFA614CF689301DC7CD2584D4152961789997485E77070D8CAD6653E4B0CA
+F3AB726DBDC13B71C0E55B879A9F4B5F787663EC4A56E6A9838F3E519B3CB4FD
+E6CE8ED019BB74719B3FA67B18B07AF8A85DB670276D2951FE1D84746D10F0D4
+75A743F0D82B385F3DFF7AEFB23C8B097BCD767C23497CB13981C2ECA364594B
+7B90EA16ED99859A1FF0D164631F631EBCE1FDFDC3C9BD5CF8472F5E421630E5
+2B0397F7BE06B6F7415A83A4C87E9C36D28A7C0657155D514B9F1E66E62DA4EB
+751247424E6C4E4BDEA80EB11EF95FCE8E6DCD95B962562FC967F62812EF8B67
+E4546FBC3096C170456FFA8DC1AFA689BD71F5580FD4E8611BEA5DCF6FEDE35A
+5C093886BC28A28C0B821D207A43F4A163D96B72357DFB8DA6D0AC375223F61B
+445326CEA2CE2454ECBFE6F5B30C2B5A33AEF2F09E6474D2D2D9491743E79F18
+470A26C4224A7DC75A49ACADB499DE1F2E2448ED198C9D2010EEFD192A7D6798
+09EF141CC039DBDA7FE432F17A82AE58EE1A28B6BE5D15D63F2C08D64BDFA650
+E7E9077D195BA551F27FA13D3A0A2C729E4E9AA929522B14C90EDA65D6B17360
+63A7F5E01BDB62C4803DBD76E3592806CAEFD55A5D9B2D6921D49A91477C77D1
+00D544073B93CFC468FDF2D09CC77FEAB554FA378A51D9F6AC856802776DEC87
+217FE2A2637D7A389BC8F33F96CAC3FE3DFA9E526DA8EFA66F1679892FD8F9EE
+EE55CC1BBA1663186A0A850967BD854D9C9504687629C4DA7CDE8E04A21CFA48
+BEB531A076034E0D5FFD25BEC5B401CF9BD2C1ED0BF1626DA164568443A6C029
+6A963910E62F7E1145F8F55D5AA94663B2C6D947477FFDD62FF20CE842C0A5DF
+F0C16562B6355741CA917D49A258BFE7EB9F447C7D4996D0C3A2D7699C5328C0
+0CCFE337F88E98CF311C43DFC541888969DB4185F5E125DCBE9B8C5DE4997689
+07646A5F53A0659F62F81A5F0321533C88496E7165FB0BA7A926716909842278
+665D0A4CC7F743FF4E6FE22139B2C3B2745C079E3F1279FA75F7BE8E417F53D0
+2A5A509A3918509A8BF024D28D860FD8ADCFC3CC8C6FB722B43774FF99CCB05A
+A15A669EBFCC5B88E2492E8A44C527D5C721DB0AAF47335C6EDC72355952AF4D
+0097ADD94A36C39CB9B675903CE19CCD18EF9412EE62540B4F9567C14A7615D7
+1F6A6EE84FF182C4853FCD75FFC02387CCA0F1C40848F02AEACD80C8EC79EA3E
+146E99550F184CDF31EC892979F0271D328ADD0FA8F08EC6DDD1B37501E9DF4C
+33431B9BAB50DABEBC0194EC3DE4C70FAF92379C00A5374D5A8A3A677BF7CF7B
+75834EEF66CB3A429B78829821EB7CD88D55F4BD3F5FBFA372AF771ADEE4CC70
+6FD68A61DEA3BCF95974A8DF710752F66E028F8DB053D0ABFF319EBB2BCE19B8
+6E8CD371B4BF62482855A3391C0A1A1C
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+cleartomark
+%%EndFont
+%%BeginFont: CMR8
+%!PS-AdobeFont-1.1: CMR8 1.0
+%%CreationDate: 1991 Aug 20 16:39:40
+% Copyright (C) 1997 American Mathematical Society. All Rights Reserved.
+11 dict begin
+/FontInfo 7 dict dup begin
+/version (1.0) readonly def
+/Notice (Copyright (C) 1997 American Mathematical Society. All Rights Reserved) readonly def
+/FullName (CMR8) readonly def
+/FamilyName (Computer Modern) readonly def
+/Weight (Medium) readonly def
+/ItalicAngle 0 def
+/isFixedPitch false def
+end readonly def
+/FontName /CMR8 def
+/PaintType 0 def
+/FontType 1 def
+/FontMatrix [0.001 0 0 0.001 0 0] readonly def
+/Encoding 256 array
+0 1 255 {1 index exch /.notdef put} for
+dup 46 /period put
+dup 48 /zero put
+dup 49 /one put
+dup 50 /two put
+dup 51 /three put
+dup 52 /four put
+dup 53 /five put
+dup 54 /six put
+dup 55 /seven put
+dup 56 /eight put
+dup 57 /nine put
+dup 65 /A put
+dup 99 /c put
+dup 101 /e put
+dup 102 /f put
+dup 105 /i put
+dup 110 /n put
+dup 111 /o put
+dup 112 /p put
+dup 114 /r put
+dup 115 /s put
+dup 116 /t put
+dup 122 /z put
+readonly def
+/FontBBox{-36 -250 1070 750}readonly def
+/UniqueID 5000791 def
+currentdict end
+currentfile eexec
+D9D66F633B846A97B686A97E45A3D0AA052A014267B7904EB3C0D3BD0B83D891
+016CA6CA4B712ADEB258FAAB9A130EE605E61F77FC1B738ABC7C51CD46EF8171
+9098D5FEE67660E69A7AB91B58F29A4D79E57022F783EB0FBBB6D4F4EC35014F
+D2DECBA99459A4C59DF0C6EBA150284454E707DC2100C15B76B4C19B84363758
+469A6C558785B226332152109871A9883487DD7710949204DDCF837E6A8708B8
+2BDBF16FBC7512FAA308A093FE5CF4E9D2405B169CD5365D6ECED5D768D66D6C
+68618B8C482B341F8CA38E9BB9BAFCFAAD9C2F3FD033B62690986ED43D9C9361
+3645B82392D5CAE11A7CB49D7E2E82DCD485CBA1772CE422BB1D7283AD675B65
+48A7EA0069A883EC1DAA3E1F9ECE7586D6CF0A128CD557C7E5D7AA3EA97EBAD3
+9619D1BFCF4A6D64768741EDEA0A5B0EFBBF347CDCBE2E03D756967A16B613DB
+0FC45FA2A3312E0C46A5FD0466AB097C58FFEEC40601B8395E52775D0AFCD7DB
+8AB317333110531E5C44A4CB4B5ACD571A1A60960B15E450948A5EEA14DD330F
+EA209265DB8E1A1FC80DCD3860323FD26C113B041A88C88A21655878680A4466
+FA10403D24BB97152A49B842C180E4D258C9D48F21D057782D90623116830BA3
+9902B3C5F2F2DD01433B0D7099C07DBDE268D0FFED5169BCD03D48B2F058AD62
+D8678C626DC7A3F352152C99BA963EF95F8AD11DB8B0D351210A17E4C2C55AD8
+9EB64172935D3C20A398F3EEEEC31551966A7438EF3FEE422C6D4E05337620D5
+ACC7B52BED984BFAAD36EF9D20748B05D07BE4414A63975125D272FAD83F76E6
+10FFF8363014BE526D580873C5A42B70FA911EC7B86905F13AFE55EB0273F582
+83158793B8CC296B8DE1DCCF1250FD57CB0E035C7EDA3B0092ED940D37A05493
+2EC54E09B984FCA4AB7D2EA182BCF1263AA244B07EC0EA901C077A059F709F30
+4384CB5FA748F2054FAD9A7A43D4EA427918BD414F766531136B60C3477C6632
+BEFE3897B58C19276A301926C2AEF2756B367319772C9B201C49B4D935A8267B
+041D6F1783B6AEA4DAC4F5B3507D7032AA640AAB12E343A4E9BDCF419C04A721
+3888B25AF4E293AACED9A6BDC78E61DA1C424C6503CC1885F762B92A5FFBF525
+9174B7C713DAA31E268BF4F188B1D7829C1893858A61CCF8AE793FA6248D671C
+3BCF85D756480A1724A0EABCF58BD6E83058A5980A84AE3AF1D85C64C141E554
+99F09938DEDF15659EC888E41B81D360363B1E57DCD6AF8519F1819F08B65D0A
+8CCFD7E64286CA3F4DAEDD882A0BF3C74B7A54EB57623AF5F5A317C91D430135
+41CEFBECBBD5556177CFC1ED56DC3B0A3F0E05325BE30FDA807C2BAA2892BDDE
+7136C910FD474403857B8A997B330868D437840A2FBBED109148DA9CA7DAE1B5
+DD74C3E413684321F7AE6F668D38DCAB9CF15ADE4E5DBE3D95DA274FA4DFC266
+D8F077E4C345B9BF4B85A922C60EBA5AF96DE5839C38E26C52799D5E4B90AFF4
+5B725E4AAE3CBE59DC8D2E3493F78676C8BDA2CAAE6E91E062DB4E0A6781D913
+E39C497511BF4DB2AD688676D289ABA77F63814668BBC63A8CEC57F5D0234982
+F48DC16D77AD6D6389E9E4B8D09E135831C61A96C3945DAF291FAC6604A5DABC
+17E8DDB98751D944DD93FBFE6D3C67E6D6053B8598FCBFFE4D95B052C8CD9623
+DD8F96D916EEB6951E2CB25C9EFD1AE407FDA8EB293ECDB668074FB91DB6F980
+BBC4D26F737972D33B1E79826BA4FA4DCEB8E4080E7AB5BAA7183CA4126D7E71
+2B3AFC36EAAC0FEA2D0CB4C52E735314FD99C80C0F3287E1C17B6262D17BD8EF
+59783445726B00B51F4495092E71D0EA275A3AEE7ADB8022FE4F671CCA060E1D
+018814499B77F9AA0BA9571CB1AAF5085B71BB35A6BA179807BB0711F2033B19
+63B6DA2D62A3E5E73D5119D0BC15D9922560A031DEA3DBB3361A2C893F9CF458
+2DB68D875C7B2C66E8AD6E0C482FC684695074B3762E0883BD0EB06E6B77A0F8
+58D66F65B224BD78627ECBE3F9AD9D035BCD99F2DFECA1057D1C85C5E0E0BB7C
+FC21E671DFBD90118741CEC34E3DA474A97699A4BA4B5970CBBEA0079AD54A5C
+B036A980594FF8EF93698ADF3DD413F29B176C62F56945ADA7FF6752C589F48B
+3527A872333FCE2D122AAA6827BF7040A24EFA096669CA2C2399FC476EA10527
+C28282F0F226E4B6FA3E8BFAB212D44EF551B55A6C6746A5BA5DD01B5C13DD66
+F2BCD53FDB3CE4ABE38A536574503AD2FD5F615D49924C02BE04C04AC8A8E244
+CB022E765A169AA822CB58E72D6C7652E9705A3F9A521C3E492C6887A0598671
+96EB16D35D03279A321FB5817BE96BE7B79D7B0D695C08BA30193B019BF03CC8
+2B80ED0E03E93F4740E0CBB609C1D6309A79D6951BDA187000B4537EA7385296
+FC45C3D4E407D00AB83C93DDA6DB20978321BCF1DC62DC3D11FCD0AB98A9DB15
+5D3713D8E85D9F7FEC37ADAEC5F3338F3C3FF8F4EEA2F541E32FA9DE806A657D
+702959F477BA824443CC5F6AB6D5B437164C0E9553ABDAF9075FD271522FE90D
+77A7C5FC85D58350BCAD4E80FEF13C54FF678AD7A54E04EDB8A02B7C057D7426
+30CAF168862EDA379EDB69541E2659B16D4DE34D9F7BC30EBA024ED0F57D33F2
+3421AC01A4ED10D2D70C39D36AC8EE89E53ECBBADA88CF705B1972E18212A9A5
+D4E67C835F0E6CBDBA0E621E75CBC564B1F27F43F34593733A855325A3348319
+22BCC61682515A617875C0A519349B73C89CF40F7ED56B22EBC1718DECE0D266
+4615E0B6FB1F234A2E704743E1A26290227F3F6B3E2DB6E60831BD4E911D55E1
+4E38332DC0C863220DEE20F2264B36DA7461DB4D9FC79461FB1177F6A2E83211
+76C09872B4453086A7443E009DFD877ADE72FEC8DDD3C02F5794823C6A7A6899
+BB31584B1D450F9F9C723F33DC687A560F350E8B6E747CA0DBEE076C4611E22F
+7F15D72D11E86098028E7CA355379D3EE45A7FB60F374A725FB0192600EEA25E
+D8DDA15F5A1AC8D7D75CB3D3660A0AAB82C0733909961070DB40E3FD0FB50DB8
+2EE490A61199A135D59B93F60E6A422BF167888F4F9E533B8E9CB1BF8C7A0F88
+2E602109A2360776D62E461443748253CE37204237ACF8ADC46ADF18BE2EBFA6
+B5442C89446281E4EFBE05CB1899EE08562AF26CD0233492FA8B1A97236F8645
+2B7E529187D7250E4AF7DA1F0650A458263EDC17B7CE8EBC2E9B0FB8873E2FF1
+D0F2578E9F61131A847102596F0234B1DD7C0932CFB556D435506E44B69C9C2A
+00ECDF5187658B77BB4022170F9B52F84E9744124C453EB5FD4A0A4663CCC15A
+5608BEB484192ACFF4A82E75AFF047EB7D6BB70611525D845305054DE19394B9
+CBFC9BA826EBE616863CB68AE007E8513A88D69EA7F1B0936ACA5C77060EEFE7
+22FB7EF4D93321B572EBA233A849FEBBC390E58483B83DD6E7506C1C2E4467D3
+4922C2CDD14A07E9D7F8C7FF8060B0FE879A0CEDB73760E3592AC0B63F114F58
+CA9FA898067A38B4A5BCC5361D595639743EEDA5EF222189E375004F01C50083
+BE4961F12BA4A38D61E43BC890D8FAD1A9F11D264714CF1058C0BC14AA7E6661
+65FC44D28345E262C6478B50A9FD5F4D05556FC76FFD29FEBF96AD509DA028D4
+08747D881750D9E95A20D89F96746D35CD660FEB0C88EEF1594542AEF7B54F49
+2ACA53288046DE819C1B59F0435395EE1F20ACA276FF2F395429E00529918C26
+48BCDE71F58F50AC0BCC75F70765FC731A5D8350E82D4E5CEB1BD898789F7FD4
+8A71F76086D025BC69C53BD0A76C8A68DBFC3B1DEABF987C3F394C0905D064B2
+23752FD9F4CF2D3C28434BF0ACECB16B41179EAA98D486173AA646ED8821530B
+B6608488686D3DA1D5057B4F54E1852928673EA67B525867EB5BEFC8C2FE599E
+5ADA8600C18EE96CB1D278A6591467E187FE2C12A939E1477CA9099752F61503
+A3735419940D3DA448F5BEC8B0A7DD4943B03874FA898882C39239604E62B03E
+CB475B9FBAE4B8C0A09DBDB7C6553524974C9D899645EF936359B4D3E36F6485
+4C2E3A717FF831032DB2EE045EBE4A154D9DEACC1290B4CBDE52B27C3F39BB53
+15D5F7860DC3D8EF6B27408929D0BE47CFD21D21589F44C04555627063F075C5
+B73E51989B622D29F82909BCD6C9781781910282421F0AB44F24DDA341D00FD5
+1CCA2CB587535A2EDAE9E1802C2EBD27C9B0FB5D496BC1E078CCE877D3ABC004
+0FA8F6B216677939DADCC83EB66BBAB0129C3030ADC5535B66AB2E6767848016
+E7ABC6C18A6C5480B70124AEB28B13FA38976FDE0635996D919AA5DB2A969A79
+6FB7CB4CCBD34A29902D99936CD52CC826F9ED7B2606550F064D28F3811CE282
+5550BFEEC914DE8A685C9921D34825E8B4005FD69AD90018AF7A16F4B9FFAECF
+49017727F26187243002DC090FE42D375E05B68038182062FDD05A5AE072851A
+2F0534D38730BC80448EB6BF66C12E3DB20C288D5566300FA953F91862A8923D
+C6284EA25DC70B623B01155784EB8279087B2BC10579CB5DB79AE72908A82759
+A874E3082D0911E2546D520CDE606A3566C876F636A88D8769E3F5F1A2A1C002
+484AF9D4F46D840861C4B4DCEFFF56052533D5AFAAA48054BFE0C156F32340FC
+ACE64B0708887CF9D74D2414418C4FB464B328E48B080AF7606FC65BA0305164
+AA92B5679A3EBF4A27731750DB273B9448F67422F751942BF7004ED74DD82339
+1D05A81FA6EB836690FB7EF1173152F4C4C1F46B24BE13C5D9E3717C443F89F1
+0D20D6411716E4725B08BFD3404BF500CE7FBB470A0E712749EC772E79A6EA8E
+2BF77537EA62CDC9092E77EA3347B5F7942DBB816143E0C5ABA93F6E8EC290CF
+0C4F3978A0CF1BD2D8301A63C93E2DC5D09028F8054B3494B28E39E614EA63F2
+416E10C7E654FA76559F3908BE1B06C048E46722D2CBDC8172AD21DBF0DD9FAC
+914A9BC615976B1A1902A13D5F348553AB65BE88F975466D5D3CED4C625534C4
+029B5C5BF41FCF90067F5589D934F245432929C72516130E6525D2046F4ECFD9
+A01ADFE78226E2085F32D62F12048B2ED910FC2084EA6BCD6F7CB30CD13822F1
+1CA3A5D8F02C4F40D556A8886A656FC8A860764563A7D2AD8F6F6F7BA5199154
+46C746373104F6D62CE31B84A434529955318D80557CF098F3F0AB0F107EB833
+60BCA0EB0B94D630CED4220420672153F9122724675307FABCF87FCB8B2932EA
+B1A45FE660692E3A0ED3A759F2DC961D6C1A44B9693A1807B4478432E50E3202
+419ECCE08184D515C0D3E90CF271474B401C397D583C772DDB3DCD4494485709
+C4452248D2F89ADD0ED7B74091AA1775F6AD770C3C12F8C4E11C235051BA5DF9
+A85A6CC6FF082021FF724CDB276253DE97EE0DB683296F9E4CEDF55CAFF2333F
+FACD5BDD6638ADD73E3E6B2D74B3DF463526592C22D1BDEADC7AF197D3232D55
+6008B424E861140AE3009DAE1170DB8A98800D38B15EC031F06E7C2203406A74
+837015ACD891C67753065C2E83DE3ABA75D3202043A3C0799895D514F8B8D993
+F81081DF9972C8A1EFBACA204F6DD0DA39F42F12CD3710FFD130AC1168F8D185
+604E471191F1C4685244D30F810BE68A365BC8DACB3242446E40D7FFA1A68D01
+F37B59D66D88BDD0D20A0F723CF454FBCF99D525BA7A95CC4AB45984A9DBA5AC
+CA1A79D9BD682D0614A0275508D78BF3591DD2AF9180DB85EDFF3073D3F37A80
+F68B9A613D3A4F2FC102CDFDDC716A1C9DE26F53AD95A73FBE5470920D3DDD63
+70E078BD2673AF2664BE3901147EAFFAC3375D6230FE5F4F740E80B92647005C
+4F8067811743FCDDB1BFD97C96808F1614C8BA58CD248242A6FB6FE3C31BF34E
+689DAFEB3293E5003D680755A692792E62375FEED7399794AE172EE6B2E595D6
+AC0AD4FECE869CE61AB0A04DB88D33936B5DEF20C66EBC1B88ECE8364BFAF7AE
+55B4BA1C5EF652190850CEEF9AB12A25B397047E776A7B873FF6CD4DDB65DBE6
+4B9021381AA1D677BDF7858B480BD54086B7D5D38F0CF0AA83A6CE00F6A80B63
+C8DBFEE0AF35FE0D63D49B0B3619B37935610D0B08E2A48E33F667F564A1792C
+C6336CEB9FEB325D9B2A3D9539555B75E95C84B9C3A63760DFDEE1111369B4F1
+0240F59B6DAAC7499DA36ABE9BFE1A05BEF4860EE6C8D493D0B4A6EBAA31A1B9
+132E81B4A9C3038D5E02CD17A13534BD943FA124D9866140F0C9B3E7EF5238FD
+17D56CFB94FDC0BC9FF38A7975919905D2ABFB3C17CA4BF856B77CD9E22D
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+cleartomark
+%%EndFont
+%%BeginFont: CMR17
+%!PS-AdobeFont-1.1: CMR17 1.0
+%%CreationDate: 1991 Aug 20 16:38:24
+% Copyright (C) 1997 American Mathematical Society. All Rights Reserved.
+11 dict begin
+/FontInfo 7 dict dup begin
+/version (1.0) readonly def
+/Notice (Copyright (C) 1997 American Mathematical Society. All Rights Reserved) readonly def
+/FullName (CMR17) readonly def
+/FamilyName (Computer Modern) readonly def
+/Weight (Medium) readonly def
+/ItalicAngle 0 def
+/isFixedPitch false def
+end readonly def
+/FontName /CMR17 def
+/PaintType 0 def
+/FontType 1 def
+/FontMatrix [0.001 0 0 0.001 0 0] readonly def
+/Encoding 256 array
+0 1 255 {1 index exch /.notdef put} for
+dup 69 /E put
+dup 71 /G put
+dup 73 /I put
+dup 76 /L put
+dup 84 /T put
+dup 85 /U put
+dup 88 /X put
+dup 97 /a put
+dup 99 /c put
+dup 100 /d put
+dup 101 /e put
+dup 102 /f put
+dup 103 /g put
+dup 104 /h put
+dup 105 /i put
+dup 109 /m put
+dup 110 /n put
+dup 111 /o put
+dup 112 /p put
+dup 114 /r put
+dup 115 /s put
+dup 116 /t put
+readonly def
+/FontBBox{-33 -250 945 749}readonly def
+/UniqueID 5000795 def
+currentdict end
+currentfile eexec
+D9D66F633B846A97B686A97E45A3D0AA052A014267B7904EB3C0D3BD0B83D891
+016CA6CA4B712ADEB258FAAB9A130EE605E61F77FC1B738ABC7C51CD46EF8171
+9098D5FEE67660E69A7AB91B58F29A4D79E57022F783EB0FBBB6D4F4EC35014F
+D2DECBA99459A4C59DF0C6EBA150284454E707DC2100C15B76B4C19B84363758
+469A6C558785B226332152109871A9883487DD7710949204DDCF837E6A8708B8
+2BDBF16FBC7512FAA308A093FE5F075EA0A10A15B0ED05D5039DA41B32B16E95
+A3CE9725A429B35BAD796912FC328E3A28F96FCADA20A598E247755E7E7FF801
+BDB00E9B9B086BDBE6EDCF841A3EAFC6F5284FED3C634085BA4EE0FC6A026E96
+96D55575481B007BF93CA452EE3F71D83FAAB3D9DEDD2A8F96C5840EAE5BE5DC
+9322E81DFF5E250DEB386E12A49FC9FBF9B4C25C3283F3CEA74B8278A1B09DA7
+E9AE4FBAAF23EDF5A3E07D39385D521547C3AAAB8EB70549756EBA8EF445AF4A
+497CA924ACCC3DD5456F8E2C7E36946A5BF14E2E959895F7C94F49137256BE46
+4A238684D52792234869EAE1A6D8ADF4E138B79472D2A90A6CA99E2394CC20CD
+3841733046175B20CEBE372327BF13428EED6A3E2FDF84C2DBA4B0AD584EE9DF
+B51828D3B8F385846158C29C9AC3496CB9692DD10219697B2ED4D425C3957FD8
+C4600D76E045C561216EF05D38177243C314877A69A1C22E3BEC611A2EE5A216
+9B7C264CF6D1839DBBD78A40610F2C0D7C2FE09FFA9822FF55035AD52546970F
+83EED2D30EABB1F303091EBC11A5379B12BB3F405E371519A53EA9D66174ED25
+A2E55463EC71A97BE4C04B39E68112956117C8252DB6FB14AB64534B4BCD568B
+246DB833982B38CDE7268BBF74B6B0C18091E1B1F87D32D66F4DD023D1F10D2A
+7736A960F72AC01F733A11023832CD68FB6288A5977743F781214D8FA9C0C3F7
+80001321D4397771F728FD9EE57CFE7D9192B887EC883EB1505068261DC40089
+7B7D2820F06515CD74513521F6397FEAB3AD3572D9A8269430E407E357422461
+1785FC2782047F4C0339D79B16862D939F3A37F78E4E2174E4FBF132539CB760
+207999FF86F6A3EBE48EB0A1CA635450FDEEF79EB16D853F3BF4B7AB327313BA
+9991211FE10DE49402F33CF209F181D4B259580E8F3BA3A13383CE041740FE6F
+1137A29E0D2D1276DA327F91DA86446481C4DDF2F21BBA048460DA90F775C647
+002D5B2128D2D46EDF0E660382E23111AD5D389B876F996C2A004BA13C36911F
+16778A059F7ADF99527170490A6D43A66F4B80EE99051CCE8A40F207393532C8
+2ED7324C7B8D2FDA112251100D5DDAB0C7384BC8F9A98D2C51874F3BEA95346C
+EED315CCBED7AF22644B3970F175A2115D334E42E37E1B1054BE692621502AB0
+93941ABEA4A31FCCA21A7DD35FF6728C878D170A23C67327B6F3EF280B4A5E93
+8A94B09E8E1AE51AFE4A4E2BC826F937C56510FCF4D3548881E5F3C3105FA1AB
+0007C1F488FCEE1B722DA534A40C111A9CA26C50DCCE50CA54225BFBA6C3B828
+66221E85631552DEC90C55E2994B8326EB3B47324EFF305A63F1FC12E796552E
+D96F2D03C8CF2FD8AA7355B8C17425183F0B066A4BCBD7A977EADF4F48A0F86C
+F1BAC20B3500EBF282DABAE9B27FAB7F7DB949AD4FD34EB26611396364FD3DA3
+E6C946724A457E4F54B9B43086433CD6AAA7CD58CED610B0A8A255BC95D35894
+AA04004C0E8438CBC489824AE9257BF072D6F3F1AAAF6474D41C2CF8797E37EA
+AC4B5EA372F12F8A8BAC92304127C880F1910603B0C4875B8793D9EFF548BCDA
+E4BE93FD437B83009ADFC1C72318CBB5F7F2ECB171930C64D967B30630ABC2D8
+AEA1B205C2B019504A51C2E9EF28EF49118E69724955CEC1167B6564165A12C2
+EED4F0032EB363EBCD5224BED116333F64CAA1C381186F19AF83267466874A95
+3B138120635CF48FE832DB6AD446E0AC7089FB76E37ABDB9A001D1B59FCB120A
+193ABAE1EDA575FB916E080CDA52D4C3E7EEB6E4A4D0392DB060DB5ABED2C388
+134BF71B89479FFA3C13951D2C79DA7A8D93FB84772B54537E9D48B3F1FC1F03
+5E4096469E10DF049E325EC9C0DF0C6DCC91EA7EDBE78094BEADB8A01C1CE8BD
+715C13145A03CC37C8476CADF426EB3A9CCBB2C3209BC412F4485BE129E80BFB
+8C4DBF4FF09DA5921F0C165CB7E88A95B03C9A2774E13A1A2D593AAE96ADC210
+18E5B3EA53C9B107CC829E6C252F5CCA527DCA6C7C7B3B8582542AD8E01B6F79
+FBF8A5596124E84A69C05675A0E7C895128A64FF0276777C69663939616B4668
+8185220720E535D844E0362FA7C33D55904CAB96324C0A20BDDA945AB9A5A5A3
+E2DF77C0ED38C689A37CFEBCCD1D189F81EBA4DA10F5F35544C09522CA4BF54A
+8BC181FBB1861090D47458DB051001CF044F9EFE1E665E0DB86B2276ABF98030
+7ECC71FEA7674745E7394137C77F37D9F0B71C3FCC58BC1001AD4D585285A459
+9BBDB3D7A2134EFF41BA5702C18769B47FDFDBB1A13FE2735C2DE8316202FCE1
+F2366AA45FA41A22D12076AD9C32B6795E514DB3AAF40DBECC801AC54C1F0313
+A73C606C49DD1920057702BA01C4434294F8A1D2ACB6B93E39F6FB814C9F0A0D
+D700AFFE41964586F47A49217627C50C23912D0A5548543C1F66F1E71F0553E4
+75A48A965B7BC2988A02A42E74E8B1024F9AE2BD7316B053C14006FE56F4F4B4
+0C059BBEC3CAF2888334137D249B0D4884FCC0845A1A6EF66AF9244970BD39F8
+47D7DCB85422115EAB4A285C2F0A73BFC0BB01CE66BA57B57DBD96C5D5248F0F
+961BE6B3764E2EA30FBEC50417BA673FEE6E130C5B319B3B5344A1C2EF1B9A34
+90844899E66A4E8AC18D24B210A647F9C13E31FA821E2DE88B73E46EE37A2728
+E21DBE2235A97ACED25AF31C28A6883FE889C763B42324F2F0ACC3525273D58D
+ED07D9CE80FF8DBBEDC0BB8304B68FF19E51359DC477AE2DA3D474EE76C136ED
+2E48FDF5351D466CBEC9DA6391D86789A55448CE68F326AF4473CA8071FDC056
+69CC0EEF6D38D000B9566D01532E46284F9A5AA0E3C5FCB2C3F00671A2B9ED28
+1FE8CF0AC44FADE1BEA7238E8BA4797CD38DD04E81A1EEE2C1DAA77BBC53A520
+CA01BDB3719618F1B23550415CA84CA3BB5AFA735F5D99A8EA098391F9294F01
+E0DBCB2AD6513C6F0A6EA0777FA7B3166C4431A5E9C1966B504EE6A1A8911C87
+7167B9A1A669B0AB382769D3335677F99F104892CD2DEB3661640F62A667593A
+BC046EEC296CAA3D0F37D51D0C3B729DA8026FCDB98FE8FBCB00FA26DF055417
+4DF9790354E77435E5EB33BF79041E493A3AC9253D59B4200147757A40139AE6
+68A336F898A0E06AF46983810DA24CA96FE86FF17EF06ADF1A60B64E663A4D2A
+893C496D713217D28441FFF31B186A59D8B83CBAE0E96357C2E89A078F5F60E3
+0AB499FDD8585ECED8B26DF83A72EA95DCFA77D2055EB6531A86B20149932CB9
+17CFFB8D97567E38CBA2D726AEE78817C3A01E40F3B4DF3B14CE4101A224B2F7
+9F6F221EAF76DB266911E8BE682D412D2F453979B0B194FB19B167D3917F89E4
+0996259409227D7C5022832911CF0991B0A3201A4B64392529F451941B5ADAD5
+053F6152B396A5036C5A38C6C09610FFB602209C11D41E5548867A6892E93660
+850EFA9ACA8B8190478682A888FE1561DD1D1E954F4BD9D1DE8D3DD5BA76FE48
+51EE5C4C00F33DAC7FB9469972622F5AD8F2111B31A3B695FA33CE0B89C64DFA
+226C73B88A9BEA1FE2D3951EDF4505BA2CA246C13C857B8EB0DD12302E01E9C5
+E1E7CAB33C23127CA168ADE235125F0099CF8AD5FFC17DFBE8C4ACCC7E75F924
+D177515CBDEF239B8C14887B896DB82900AF82DE2525636B457A2BA8049C8FCF
+7E17FF8E269687CF95B453E6200EC00D1E1FF1F8FE092B22CDDB678633228277
+027F3CFB99585CC887324B46D44FABDF80A1F4C10946877C725E1F1CB814706F
+A9A51BC3785562A47E73D8A94ABB28E42937330D5738DA82039BE4A94DCD6E71
+3DD70356828E82850DF4AA4A4B7C2FCC6B2948D38D4A921D9ECCE298D6584FB5
+60E0DBEB2239C9919AEA38540EC5943D8D49E452BF82609907CC4C0923992426
+6BDD0AE833183DEB78B741531CA79D45BAF281BBB3766B69B7AA3D888F084689
+27F1B08F8AFD7CE8AF2B3E633E46E86AFA25E57224A54375B944EDFA87E3A357
+102457870B48443D97055574DD24659C21D73D084B3439285DBD17737462FA4F
+4D55E6CBDE071FB02AB116F85EFF723988ED9B5EEE0B5D147901A4C2AD824D26
+8C5CC81947DDA1DADB043720F8F561A69DB3E2F792EA0DFB2789A012908029A3
+9EAE6D5F60BEECF49932E26C19AC52FF51BFA1B687D2694387EAE7BA83F9971A
+A36A1CAE7612BC37D83A4A24457FCAD32B1F59782DE5F119C5D024127AF03222
+BDF3DED50D883DD3856ECCA48B305C06AD32BE55414A1BB1269602E727321C98
+DF209CA90D24EE8DC5115A3D698123384831994B6B580955DF616CEAC8C58F86
+D68988F9EE2225CC02079D2DF65E80547BDC886B017DEE715078B108844E27E5
+8B145B960C70C6EF032FCE290B3CE7683764CA77806BB0E5141CEE39F4BCD0A1
+18DC3A9EA424324DB6D2493D5862E6CEE0DD47B68F46DA3AFA42616B7C4FF990
+BBEAE9CA6EC74C070EE50C595A12A5AE2189B54436803A64B094DCD39357ED0C
+4159D0DD8FFD3972D7BA1107A64EC7EC839310AC169B7FBA3F9445D80B36B13B
+2094D943029127942D03FFA339ED7FF481FF7940C9B89848BCF3827D8C762FC0
+224B08E769D201486686CC75A7859EF52916F0AB6FFF4E8AE2CE175FDE8A9ABB
+5CFD88FA935997B5C6621FA5F93877CEE1CDE32DC385A16FFE6D20A746E16842
+ECF5122AAFE4DF6FF83D837F68FEDE6C6D2B7C3B9FBD6AE157E6E908FB3BBC92
+908F02E56B2898C2C242A1CFAF1D53E15F36271AC5383C09B65A5E9FFB9AED21
+04CA41F485F03F83FE10B5E546DF9A4A0A4556A3C7BD8A57C97C2530667E78C0
+4689D69FE0551B0E857AB02988B93226CADDF8ADF5B88B3F0ECF4C806588FCEE
+8DEE739CF1374D7EAEEA259E82842D2CB79849D3BC95A65B0ECB453742531CB3
+A09F7CA9A6E5C03DC511AE7F71FD84F896B5ACDBBCFD99FC633A3A26C198D0BC
+766D448673AD93C00B8470082D0CA77E519757C94B12BB3540F7C512F3083F00
+AA6E80055CA654511D68B770E8C21D948E092E9C22D6B893986D44DF6A39E3C7
+AD0ED50A64C3F01A65CDA315787F8D4B1A05C2C6444A3E0946D26CA5BAB33824
+41356E0875188F7BB8F04E24BE262CF9A0863B37BFC9DA38A8899544AA31088F
+18DD38956D6A86CF4D002CD431A065CC2451C73F8B9A6B5C3DA24CDB456B5F35
+1D9E2C4DE454C2DBA29845D8F983B6C1CF0936175CAB123D9CDC336BAA60640D
+2D664E35C4FF41AD5D7E4F185A8B6F11F03EC3918DB165C84270B476595D93E4
+02255DB45A1BA672418BF8D2C601F5E1EEF94C2B186F87C46F00AA9A347FCEC5
+697927E680D69D40DA88E40FFB764F5D68226F971B891A829843EB7D861F95D3
+75D5990109FD0774B7E573A8FECB6FEB4E29FE53694B3D2883E3C6DCD05153D4
+69226A878ECC9C585FBBF2D0990F1147262F0C52126787C3F0E53E979496FA39
+2628D0B1F6F9ADC21C4CF6E57BEF5A8D11DA767937F825BDE0C2642BD472B17B
+405A74FEAC5CBC6B53B3453E66C356FE950FA92B9737952B0023CF2FE78C84DD
+C131E6EF8CF11E73611A6EEA9E481255249020CB80B478B4305CCDDB6AD16620
+BC0616277A9B7BEECC404314E183FEAE4BE8CB4F1C13DAD76D4605B4D28F9822
+C6742D78B3EFD144D804AD42CD602233C4221F26C9457E7497686C3FED9162CC
+4489510D32DCC589232F7F9BCADD6BF314126E421290C5FCF0D34242BE6251AE
+F220B80F397AA91A8A90618BF20AC47463B7E10B4C7F7E2546A3C0C75B99EE8C
+3F38B9A5CF2960C81DD90DF63EC8FD6F96059D71FCB1E795C271886FE899EA64
+DF38E2C2CAEF5B13D044DC2F9869A794CC63D803469E1E4AADC38F186D2E2D0C
+6D3F2F3325FD71A9D6599EE703E7DAD5AAF6A4EED10B9FF25A393595435E03D9
+E2B99F1FB90A95947EE7528B0BA6FACD495F4103AD09DC6AAA3B6A11826200FC
+FF03D93A96C4C62638D7C9D00C03FC142BC1E9DC7EB2C1B8302B99AEA41AECE1
+38B98697F420255274AA28197437BFE102D26739BD3054195A107516EDB653D1
+288DE066E0B2540AD4B6CB1B152AAB1D8BB8468C15C5554797
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+cleartomark
+%%EndFont
+TeXDict begin 39139632 55387786 1000 600 600 (epslatex.dvi)
+@start /Fa 248[66 66 66 66 4[{}4 83.022 /LCIRCLEW10 rf
+/Fb 248[66 66 66 66 4[{}4 83.022 /LCIRCLE10 rf /Fc 138[56
+40 42 3[55 7[55 4[56 52 83[58 58 12[{}9 99.6264 /CMSSBX10
+rf /Fd 135[62 3[46 46 2[65 59 65 98 33 2[33 65 2[52 3[59
+12[85 13[76 80 1[85 15[59 15[98 35[{}18 119.552 /CMSL12
+rf /Fe 135[33 3[25 27 2[36 35 36 56 17 2[17 36 2[31 3[34
+12[48 13[40 42 1[45 16[35 14[59 35[{}18 66.4176 /CMSS8
+rf /Ff 197[33 58[{}1 119.552 /CMMI12 rf /Fg 130[37 37
+37 37 122[{}4 83.022 /CMEX10 rf /Fh 133[52 62 62 1[62
+65 46 46 46 1[65 59 65 98 33 2[33 65 59 36 52 2[65 59
+12[85 65 2[80 3[73 5[76 2[85 83 7[33 5[59 2[59 49[{}30
+119.552 /CMR12 rf /Fi 133[37 5[32 33 3[42 46 69 23 2[23
+2[25 37 3[42 97[{}11 83.022 /CMR10 rf /Fj 139[35 36 2[51
+45 51 1[25 3[51 1[28 40 51 2[45 97[{}11 90.9091 /CMSL10
+rf /Fk 134[42 42 1[42 47 33 35 31 1[47 45 47 72 22 2[22
+47 45 28 40 47 40 47 44 51[30 31[49 49 12[{}24 90.9091
+/CMSSI10 rf /Fl 197[21 23[36 34[{}2 74.7198 /CMMI9 rf
+/Fm 230[60 25[{}1 74.7198 /CMSY9 rf /Fn 150[35 35 62[91
+11[91 91 7[71 19[71{}7 90.9091 /CMSY10 rf /Fo 140[34
+35 1[42 42 47 1[21 4[38 25 38 1[38 5[25 1[25 8[61 16[62
+7[42 42 6[42 2[25 1[25 44[{}19 83.022 /CMTI10 rf /Fp
+219[47 36[{ TS1Encoding ReEncodeFont }1 90.9091 /SFTT1095
+rf /Fq 139[48 48 6[48 3[48 2[48 2[48 48 3[48 1[48 6[48
+17[48 10[48 4[48 8[48 48 6[48 33[{}16 90.9091 /CMITT10
+rf /Fr 137[62 2[62 2[62 6[62 4[62 100[{}5 119.552 /CMTT12
+rf /Fs 135[35 2[40 28 29 26 1[40 38 40 61 18 2[18 40
+38 23 34 40 34 40 37 46[38 4[26 31[41 41 12[{}23 74.7198
+/CMSS9 rf /Ft 143[51 6[23 2[31 1[51 100[{}4 90.9091 /CMSSBX10
+rf /Fu 190[53 65[{}1 66.4176 /CMTI8 rf /Fv 139[54 42
+2[51 58 56 68 47 3[56 1[49 51 1[54 1[56 97[{}12 90.9091
+/CMCSC10 rf /Fw 136[51 35 1[25 31 32 2[39 43 1[20 2[24
+2[24 35 1[35 35 39 97[{}14 74.7198 /CMTI9 rf /Fx 190[72
+65[{}1 83.022 /CMBX10 rf /Fy 133[37 44 42 60 42 49 30
+37 38 1[46 46 51 74 23 42 1[28 46 42 28 42 46 42 42 46
+28 7[68 91 1[68 65 51 2[62 70 68 82 57 2[35 68 70 59
+62 69 65 64 68 6[28 6[46 46 46 46 1[28 33 28 2[37 37
+28 25[53 51 56 11[{}58 90.9091 /CMTI10 rf /Fz 134[45
+52 58[45 1[25 25 23[42 8[52 25[{}7 90.9091 /CMMI10 rf
+/FA 135[102 1[102 108 75 76 79 1[108 97 108 161 54 102
+1[54 108 97 59 88 108 86 1[94 8[146 2[149 135 7[116 2[72
+1[152 122 127 1[140 138 20[65 45[{}31 172.188 /CMBX12
+rf /FB 133[50 59 59 81 59 62 44 44 46 1[62 56 62 93 31
+59 34 31 62 56 34 51 62 50 62 54 8[85 116 85 86 78 62
+84 1[77 84 88 106 67 1[58 42 88 88 70 74 86 81 80 85
+6[31 56 56 56 56 56 56 56 56 56 56 56 31 37 31 4[31 3[93
+21[62 62 65 11[{}67 99.6264 /CMBX12 rf /FC 134[47 1[65
+45 52 32 40 41 1[50 50 55 80 25 45 1[30 50 45 30 45 50
+45 1[50 12[70 10[38 3[66 2[69 19[30 1[30 44[{}27 99.6264
+/CMTI12 rf /FD 133[60 71 71 97 71 75 52 53 55 1[75 67
+75 112 37 71 41 37 75 67 41 61 75 60 75 65 8[102 139
+102 103 94 75 100 1[92 101 105 128 81 2[50 105 106 85
+88 103 97 96 102 6[37 67 67 67 67 67 67 67 67 67 67 2[45
+37 8[112 22[75 12[{}61 119.552 /CMBX12 rf /FE 129[39
+39 39 39 39 39 39 39 39 39 39 39 39 39 39 39 39 39 39
+39 39 39 39 39 39 39 39 39 39 39 39 2[39 39 39 39 1[39
+39 39 39 39 39 39 1[39 39 39 39 39 2[39 1[39 39 39 39
+39 39 39 39 2[39 2[39 39 39 39 39 39 39 39 39 39 39 39
+39 39 39 1[39 39 39 1[39 39 39 39 1[39 33[{}80 74.7198
+/CMTT9 rf /FF 190[45 7[30 30 30 30 30 30 30 30 30 30
+48[{}11 49.8132 /CMR6 rf /FG 133[34 41 41 55 41 43 30
+30 30 41 43 38 43 64 21 41 23 21 43 38 23 34 43 34 43
+38 3[21 38 21 2[58 79 58 58 55 43 57 1[52 60 58 70 48
+60 1[28 58 60 50 52 1[55 54 58 5[21 21 38 1[38 38 38
+38 38 38 38 38 38 21 26 21 2[30 30 21 4[38 19[64 43 43
+45 11[{}73 74.7198 /CMR9 rf /FH 86[85 169[{ TS1Encoding ReEncodeFont }1
+74.7198 /SFRM0900 rf /FI 190[61 65[{}1 66.4176 /CMBX8
+rf /FJ 133[50 1[61 83 61 61 59 46 2[56 63 61 74 51 63
+42 30 1[64 53 56 62 59 58 61 97[{}22 99.6264 /CMCSC10
+rf /FK 119[45 99[45 36[{ TS1Encoding ReEncodeFont }2
+90.9091 /SFRM1095 rf /FL 133[46 55 55 76 55 58 41 41
+43 1[58 52 58 87 29 55 32 29 58 52 32 48 58 46 58 51
+8[79 108 79 80 73 58 78 1[71 79 82 99 63 82 1[40 82 82
+66 69 80 76 74 79 6[29 52 52 52 52 52 52 52 52 52 52
+52 29 35 29 4[29 3[87 20[87 58 58 61 11[{}68 90.9091
+/CMBX10 rf /FM 129[48 48 1[48 48 48 48 48 48 48 48 48
+48 48 48 48 48 48 48 48 48 48 48 48 48 48 48 48 48 48
+48 48 48 48 48 48 2[48 48 48 48 48 48 48 1[48 48 48 48
+48 48 48 48 48 48 48 48 48 48 48 48 48 1[48 48 48 1[48
+48 48 1[48 48 48 48 48 48 48 48 48 48 48 1[48 4[48 48
+48 1[48 33[{}81 90.9091 /CMTT10 rf /FN 129[44 44 44 44
+44 44 44 44 44 44 44 44 44 44 44 44 44 44 44 44 44 44
+44 44 44 44 44 44 44 44 44 44 1[44 44 44 44 1[44 44 44
+44 44 44 44 1[44 44 44 44 44 1[44 44 44 44 44 44 44 44
+44 44 44 2[44 1[44 44 44 44 44 44 44 44 44 44 44 44 44
+44 44 44 44 44 44 44 44 1[44 44 44 44 44 33[{}86 83.022
+/CMTT10 rf /FO 134[42 42 62 42 47 33 35 31 1[47 45 47
+72 22 2[22 47 45 28 40 47 40 47 44 51[30 31[49 49 12[{}25
+90.9091 /CMSS10 rf /FP 133[31 5[27 28 28 1[39 35 39 4[20
+2[22 31 1[31 33[53 7[35 35 35 35 35 35 35 35 35 35 1[20
+46[{}23 66.4176 /CMR8 rf /FQ 128[45 3[45 40 48 48 66
+48 51 35 36 36 48 51 45 51 76 25 48 28 25 51 45 28 40
+51 40 51 45 2[45 25 45 25 56 68 68 93 68 68 66 51 67
+1[62 71 68 83 57 71 47 33 68 71 59 62 69 66 64 68 3[71
+1[25 25 45 45 45 45 45 45 45 45 45 45 45 25 30 25 71
+1[35 35 25 71 76 1[76 45 8[45 5[45 45 2[76 76 51 51 53
+11[{}90 90.9091 /CMR10 rf /FR 130[51 1[51 51 51 51 51
+51 51 51 51 51 1[51 51 51 51 51 2[51 51 51 51 51 51 51
+51 51 3[51 51 51 18[51 26[51 2[51 42[{}31 99.6264 /CMTT12
+rf /FS 133[43 51 3[54 38 38 38 2[49 54 1[27 51 1[27 54
+49 30 43 54 43 1[49 10[73 3[72 6[76 50 8[73 10[49 2[49
+49 49 49 1[27 1[27 44[{}30 99.6264 /CMR12 rf /FT 139[51
+52 51 1[73 66 73 111 3[36 73 66 40 58 73 58 1[66 8[99
+2[99 96 7[83 2[47 1[104 1[90 69[{}22 143.462 /CMR17 rf
+end
+%%EndProlog
+%%BeginSetup
+%%Feature: *Resolution 600dpi
+TeXDict begin
+%%PaperSize: A4
+ end
+%%EndSetup
+%%Page: 1 1
+TeXDict begin 1 0 bop Black 0 TeXcolorgray Black Black
+Black Black 887 216 a FT(Using)44 b(Imp)t(orted)f(Graphics)g(in)g(L)
+2578 186 y FS(A)2631 216 y FT(T)2705 247 y(E)2779 216
+y(X)g(and)h(p)t(dfL)3403 186 y FS(A)3456 216 y FT(T)3530
+247 y(E)3603 216 y(X)1964 468 y FS(Keith)33 b(Rec)m(kdahl)1654
+585 y FR(epslatex)54 b(at)d(yahoo)i(dot)f(com)2021 787
+y FS(V)-8 b(ersion)33 b(3.0.1)1931 900 y(Jan)m(uary)h(12,)e(2006)771
+1249 y FQ(This)c(do)s(cumen)m(t)g(describ)s(es)f(\014rst)h(ho)m(w)g(to)
+h(imp)s(ort)f(graphics)g(in)m(to)i(L)3124 1232 y FP(A)3163
+1249 y FQ(T)3214 1268 y(E)3264 1249 y(X)f(do)s(cumen)m(ts)f(and)630
+1361 y(then)k(co)m(v)m(ers)i(a)f(wide)f(v)-5 b(ariet)m(y)34
+b(issues)e(ab)s(out)g(their)h(use.)46 b(Readers)33 b(can)g(lo)s(cate)h
+(sp)s(eci\014c)e(infor-)630 1474 y(mation)j(b)m(y)f(c)m(hec)m(king)i
+(the)p 0.05 1.00 1.00 0.40 TeXcolorcmyk 34 w(T)-8
+b(able)35 b(of)f(Con)m(ten)m(ts)p Black 35 w(starting)h(on)f(page)h(5)f
+(or)h(the)p 0.05 1.00 1.00 0.40 TeXcolorcmyk 34 w(Index)p
+Black 33 w(starting)630 1587 y(on)30 b(page)h(122.)630
+1753 y(Imp)s(orting)f(graphics)g(b)s(egins)g(with)g(sp)s(ecifying)g
+(the)h FO(graphicx)f FQ(pac)m(k)-5 b(age)p Black Black
+804 1895 a FN(\\usepackage{graph)o(ic)o(x})630 2036 y
+FQ(and)30 b(then)g(using)g(the)g FM(\\includegraphics)c
+FQ(command)k(to)h(insert)g(the)f(\014le)p Black Black
+804 2177 a FN(\\includegraphics{)o(fi)o(le})630 2331
+y FQ(The)e FM(\\includegraphics)c FQ(command)29 b(is)f(co)m(v)m(ered)j
+(in)d(more)h(detail)g(in)g(Section)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 29 w(7)p Black 29 w(on)f(page)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 30 w(22)p Black(.)630 2527 y(This)i(do)s(cumen)m(t)g(is)g
+(divided)g(in)m(to)h(the)g(follo)m(wing)h(\014v)m(e)e(parts)p
+Black 630 2715 a FL(P)m(art)35 b(I:)f(Bac)m(kground)j(Information)p
+Black 857 2865 a FQ(This)c(part)h(pro)m(vides)g(historical)h
+(information)g(and)e(describ)s(es)g(basic)i(L)3354 2848
+y FP(A)3393 2865 y FQ(T)3444 2885 y(E)3494 2865 y(X)f(terminol-)857
+2978 y(ogy)-8 b(.)42 b(It)31 b(also)p Black 967 3143
+a FK(\210)p Black 45 w FQ(The)g(Encapsulated)f(P)m(ostScript)i(\()p
+FJ(eps)p FQ(\))e(format,)h(di\013erences)h(b)s(et)m(w)m(een)f
+FJ(eps)f FQ(and)1057 3256 y FJ(ps)g FQ(\014les,)g(and)g(metho)s(ds)g
+(for)g(con)m(v)m(erting)i(non-)p FJ(eps)d FQ(graphics)h(to)h
+FJ(eps)p FQ(.)p Black 967 3386 a FK(\210)p Black 45 w
+FQ(The)j(graphic)g(formats)g(that)g(can)g(b)s(e)g(directly)g(imp)s
+(orted)f(with)h(p)s(dfT)3532 3405 y(E)3580 3386 y(X)g(\()p
+FJ(jpeg)p FQ(,)1057 3498 y FJ(png)p FQ(,)c FJ(pdf)p FQ(,)h(MetaP)m
+(ost\))i(are)e(describ)s(ed.)p Black 967 3628 a FK(\210)p
+Black 45 w FQ(F)-8 b(reew)m(are/Sharew)m(are)33 b(graphics)d(soft)m(w)m
+(are)i(is)e(describ)s(ed.)p Black 630 3816 a FL(P)m(art)35
+b(I)s(I:)f(The)h(L)1253 3799 y FI(A)1299 3816 y FL(T)1355
+3836 y(E)1409 3816 y(X)g(Graphics)h(Bundle)p Black 857
+3966 a FQ(This)28 b(part)h(describ)s(es)g(the)g(commands)f(in)h(the)g
+(graphics)g(bundle)f(whic)m(h)g(imp)s(ort,)h(scale,)857
+4079 y(and)h(rotate)i(graphics.)41 b(This)30 b(part)g(co)m(v)m(ers)i(m)
+m(uc)m(h)e(of)h(the)g(information)f(in)g(the)h(graphics)857
+4192 y(bundle)e(do)s(cumen)m(tation)i([)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk(7)p Black 1 w(].)p Black 630 4379 a FL(P)m(art)k(I)s(I)s
+(I:)f(Using)h(Graphics)h(Inclusion)g(Commands)p Black
+857 4530 a FQ(This)i(part)h(describ)s(es)e(ho)m(w)i(the)g(graphics)g
+(bundle)e(commands)h(are)h(used)f(to)h(imp)s(ort,)857
+4643 y(rotate,)24 b(and)c(scale)i(graphics.)37 b(Three)20
+b(situations)h(where)f(graphics)g(inclusion)h(is)f(mo)s(di\014ed)857
+4755 y(are)31 b(also)g(co)m(v)m(ered:)p Black 630 4833
+1332 4 v 630 4955 a FH(\251)c FG(Cop)n(yrigh)n(t)f(1995-2006)j(b)n(y)d
+(Keith)g(Rec)n(kdahl.)36 b(Repro)r(duction)26 b(and)g(distribution)g
+(is)h(allo)n(w)n(ed)h(under)e(terms)630 5046 y(of)34
+b(the)f(L)885 5029 y FF(A)918 5046 y FG(T)960 5062 y(E)1003
+5046 y(X)g(Pro)t(ject)i(Public)e(License)h(\(LPPL\).)f(See)p
+0.05 1.00 1.00 0.40 TeXcolorcmyk 33 w FE(http://www.latex-)t
+(project.o)q(rg/lp)q(pl/)p Black 39 w FG(for)h(the)630
+5137 y(details)27 b(of)f(the)f(LPPL)h(license.)p Black
+Black 2272 5640 a FQ(1)p Black eop end
+%%Page: 2 2
+TeXDict begin 2 1 bop Black 0 TeXcolorgray Black Black
+Black 967 -149 a FK(\210)p Black 45 w FQ(Compressed)40
+b FJ(eps)g FQ(\014les)g(and)h(non-)p FJ(eps)e FQ(graphic)i(formats)g
+(\()p FJ(tiff)p FQ(,)j FJ(gif)p FQ(,)g FJ(jpeg)p FQ(,)1057
+-36 y FJ(pict)p FQ(,)38 b(etc.\))61 b(can)37 b(also)h(b)s(e)e(inserted)
+g(on-the-\015y)h(when)f FM(dvips)f FQ(is)i(used)f(with)g(an)1057
+77 y(op)s(erating)28 b(system)f(whic)m(h)g(supp)s(orts)f(pip)s(es)g
+(\(suc)m(h)h(as)h(Unix\).)40 b(When)27 b(using)g(other)1057
+190 y(op)s(erating)38 b(systems,)h(the)f(non-)p FJ(eps)d
+FQ(graphics)j(m)m(ust)f(b)s(e)g(con)m(v)m(erted)h(to)g
+FJ(eps)e FQ(b)s(e-)1057 303 y(forehand.)1057 432 y(Since)24
+b(neither)g(L)1614 416 y FP(A)1653 432 y FQ(T)1704 452
+y(E)1754 432 y(X)g(nor)f FM(dvips)f FQ(has)i(an)m(y)g(built-in)f
+(decompression)h(or)g(graphics-)1057 545 y(con)m(v)m(ersion)32
+b(capabilities,)g(that)f(soft)m(w)m(are)h(m)m(ust)e(b)s(e)g(pro)m
+(vided)g(b)m(y)g(the)h(user.)p Black 967 675 a FK(\210)p
+Black 45 w FQ(Since)45 b(man)m(y)f(graphics)h(applications)g(supp)s
+(ort)e(only)j FJ(asci)r(i)f FQ(text,)k(the)c FJ(ps)p
+FQ(frag)1057 788 y(system)g(allo)m(ws)i(text)e(in)g FJ(eps)f
+FQ(\014les)g(to)i(b)s(e)e(replaced)i(with)e(L)3264 771
+y FP(A)3303 788 y FQ(T)3354 807 y(E)3404 788 y(X)h(sym)m(b)s(ols)g(or)
+1057 901 y(mathematical)33 b(expressions.)p Black 967
+1030 a FK(\210)p Black 45 w FQ(When)24 b(an)g FJ(eps)f
+FQ(graphic)i(is)f(inserted)g(m)m(ultiple)h(times)f(\(suc)m(h)h(as)f(a)h
+(logo)g(b)s(ehind)e(the)1057 1143 y(text)37 b(or)e(in)g(the)g(page)h
+(header\))f(the)h(\014nal)f(P)m(ostScript)g(includes)g(m)m(ultiple)h
+(copies)1057 1256 y(of)j(the)g(graphics.)66 b(When)38
+b(the)h(graphics)f(are)h(not)g(bitmapp)s(ed,)h(a)f(smaller)g(\014nal)
+1057 1369 y(P)m(ostScript)29 b(\014le)g(can)g(b)s(e)f(obtained)g(b)m(y)
+h(de\014ning)e(a)i(P)m(ostScript)g(command)f(for)h(the)1057
+1482 y(graphics.)p Black 630 1670 a FL(P)m(art)35 b(IV:)g(The)f
+(\014gure)h(En)m(vironmen)m(t)p Black 857 1820 a FQ(There)23
+b(are)g(sev)m(eral)h(adv)-5 b(an)m(tages)25 b(to)f(placing)g(graphics)f
+(in)f(\014gure)h(en)m(vironmen)m(ts.)38 b(Figure)857
+1933 y(en)m(vironmen)m(ts)d(automatically)i(n)m(um)m(b)s(er)32
+b(graphics,)j(allo)m(wing)h(them)e(to)h(b)s(e)e(referenced)857
+2046 y(or)39 b(included)f(in)g(a)h(table)g(of)g(con)m(ten)m(ts.)67
+b(Since)39 b(the)g(\014gures)e(can)i(\015oat)h(to)f(a)m(v)m(oid)h(p)s
+(o)s(or)857 2159 y(page)31 b(breaks,)g(it)g(is)f(m)m(uc)m(h)h(easier)g
+(to)g(pro)s(duce)e(a)i(professional-lo)s(oking)h(do)s(cumen)m(t.)857
+2309 y(In)i(addition)h(to)h(general)g(information)f(ab)s(out)f(the)h
+(\014gure)f(en)m(vironmen)m(t,)j(this)e(section)857 2422
+y(describ)s(es)30 b(the)g(follo)m(wing)i(\014gure-related)f(topics:)p
+Black 967 2587 a FK(\210)p Black 45 w FQ(Ho)m(w)h(to)g(customize)h(the)
+e(\014gure)g(en)m(vironmen)m(t,)h(suc)m(h)f(as)g(adjusting)g(\014gure)g
+(place-)1057 2700 y(men)m(t,)e(\014gure)f(spacing,)h(caption)g
+(spacing,)g(and)e(adding)g(horizon)m(tal)j(line)e(b)s(et)m(w)m(een)1057
+2813 y(the)36 b(\014gure)e(and)h(the)h(text.)56 b(Caption)36
+b(formatting)g(can)f(also)i(b)s(e)d(customized,)k(al-)1057
+2926 y(lo)m(wing)32 b(users)d(to)i(mo)s(dify)f(the)g(st)m(yle,)i
+(width,)e(and)g(fon)m(t)h(of)f(captions.)p Black 967
+3055 a FK(\210)p Black 45 w FQ(Ho)m(w)41 b(to)g(create)g(marginal)g
+(\014gures)e(and)g(wide)h(\014gures)f(whic)m(h)h(extend)g(in)m(to)h
+(the)1057 3168 y(margins.)p Black 967 3298 a FK(\210)p
+Black 45 w FQ(Ho)m(w)24 b(to)g(pro)s(duce)d(\014gures)i(with)f
+(landscap)s(e)h(orien)m(tation)i(in)e(a)g(p)s(ortrait)g(do)s(cumen)m
+(t.)p Black 967 3427 a FK(\210)p Black 45 w FQ(Ho)m(w)43
+b(to)f(place)h(captions)g(b)s(eside)e(the)h(\014gure)g(instead)g(of)g
+(b)s(elo)m(w)g(or)g(ab)s(o)m(v)m(e)h(the)1057 3540 y(\014gure.)p
+Black 967 3670 a FK(\210)p Black 45 w FQ(F)-8 b(or)32
+b(t)m(w)m(o-sided)g(do)s(cumen)m(ts,)f(ho)m(w)g(to)h(ensure)e(that)h(a)
+h(\014gure)e(app)s(ears)g(on)h(an)g(o)s(dd)1057 3782
+y(or)25 b(ev)m(en)g(page.)40 b(Also,)26 b(ho)m(w)f(to)g(ensure)f(that)h
+(t)m(w)m(o)h(\014gures)e(app)s(ear)g(on)h(facing)g(pages.)p
+Black 967 3912 a FK(\210)p Black 45 w FQ(Ho)m(w)31 b(to)g(create)h(b)s
+(o)m(xed)f(\014gures.)p Black 630 4100 a FL(P)m(art)k(V:)g(Complex)g
+(Figures)p Black 857 4250 a FQ(This)42 b(part)g(describ)s(es)g(ho)m(w)h
+(to)g(construct)g(complex)g(\014gures)f(that)h(con)m(tain)h(m)m
+(ultiple)857 4363 y(graphics.)p Black 967 4528 a FK(\210)p
+Black 45 w FQ(Ho)m(w)37 b(to)h(form)e(side-b)m(y-side)h(graphics,)h
+(side-b)m(y-side)f(\014gures,)h(and)d(side-b)m(y-side)1057
+4641 y(sub\014gures.)p Black 967 4770 a FK(\210)p Black
+45 w FQ(Ho)m(w)c(to)g(place)h(a)f(table)g(next)f(to)h(a)g(\014gure)f
+(in)g(the)h(same)f(\015oat.)p Black 967 4900 a FK(\210)p
+Black 45 w FQ(Ho)m(w)h(to)g(stac)m(k)h(m)m(ultiple)f(ro)m(ws)g(of)f
+(\014gures.)p Black 967 5029 a FK(\210)p Black 45 w FQ(Ho)m(w)h(to)g
+(construct)g(con)m(tin)m(ued)g(\014gures)f(whic)m(h)g(can)h(span)e(m)m
+(ultiple)i(pages.)p Black 2272 5640 a(2)p Black eop end
+%%Page: 3 3
+TeXDict begin 3 2 bop Black 0 TeXcolorgray Black Black
+630 138 a FD(Where)45 b(to)h(Get)f(this)g(Do)t(cumen)l(t)630
+341 y FQ(This)30 b(do)s(cumen)m(t)g(is)g(a)m(v)-5 b(ailable)33
+b(in)d FJ(pdf)g FQ(and)g(P)m(ostScript)h(form)f(as)p
+Black Black 0.05 1.00 1.00 0.40 TeXcolorcmyk 1388
+528 a FM(CTAN/info/epslatex/englis)o(h/ep)o(sla)o(tex.)o(ps)p
+Black 0.05 1.00 1.00 0.40 TeXcolorcmyk 1364 641 a
+(CTAN/info/epslatex/englis)o(h/ep)o(slat)o(ex.)o(pdf)p
+Black 630 829 a FQ(where)43 b FM(CTAN)f FQ(can)h(b)s(e)g(replaced)g(b)m
+(y)g(an)m(y)h(of)f(the)g(follo)m(wing)j FJ(ct)-7 b(an)44
+b FQ(\(Comprehensiv)m(e)f(T)3842 848 y(E)3892 829 y(X)630
+942 y(Arc)m(hiv)m(e)32 b(Net)m(w)m(ork\))g(sites)f(and)f(mirrors)p
+Black Black 830 1127 a(England)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 353 w FM(ftp://ftp.tex.ac.uk/tex-)s(arch)o(ive/)p
+Black 830 1239 a FQ(German)m(y)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 319 w FM(ftp://ftp.dante.de/tex-)t(ar)o(chi)o(ve/)p
+Black 830 1352 a FQ(Denmark)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 318 w FM(ftp://tug.org/tex-)t(archive)p
+Black 830 1465 a FQ(F)-8 b(rance)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 420 w FM(ftp://ftp.loria.fr/pub/c)o(tan)p
+Black 830 1578 a FQ(Russia)p 0.05 1.00 1.00 0.40 TeXcolorcmyk
+423 w FM(ftp://ftp.chg.ru/pub/TeX)o(/CTA)o(N)p Black
+830 1691 a FQ(V)g(ermon)m(t,)31 b(USA)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 100 w FM(ftp://ctan.tug.org/tex-)t(ar)o(chi)o(ve/)p
+Black 830 1804 a FQ(Florida,)g(USA)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 154 w FM(ftp://ftp.cise.ufl.edu/p)o(ub/m)o(irr)o(ors/)o
+(tex-)s(arch)o(ive/)p Black 830 1917 a FQ(Utah,)g(USA)p
+0.05 1.00 1.00 0.40 TeXcolorcmyk 241 w FM(ftp://ctan.math.utah.edu)o
+(/tex)o(-)t(arc)o(hive)o(/)p Black 830 2030 a FQ(Korea)p
+0.05 1.00 1.00 0.40 TeXcolorcmyk 446 w FM(ftp://ftp.ktug.or.kr/tex)o
+(-)t(arc)o(hive)o(/)p Black 830 2143 a FQ(Japan)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 444 w FM(ftp://ftp.riken.go.jp/pu)o(b/te)o(x-)t(ar)o(chiv)
+o(e/)p Black 830 2256 a FQ(Hong)g(Kong)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 231 w FM(ftp://ftp.comp.hkbu.edu.)o(hk/p)o(ub/)o(TeX/)o
+(CTAN)o(/)p Black 830 2369 a FQ(Singap)s(ore)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 291 w FM(ftp://ftp.nus.edu.sg/pub)o(/doc)o(s/T)o(eX/)p
+Black 830 2481 a FQ(New)f(Zealand)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 166 w FM(ftp://elena.aut.ac.nz/pu)o(b/CT)o(AN)p
+Black 830 2594 a FQ(Australia)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 317 w FM(ftp://ctan.unsw.edu.au/t)o(ex-)t(a)o(rchi)o(ve/)p
+Black 830 2707 a FQ(India)p 0.05 1.00 1.00 0.40 TeXcolorcmyk
+478 w FM(http://mirror.gnowledge.)o(org/)o(cta)o(n/)p
+Black 830 2820 a FQ(South)f(Africa)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 179 w FM(ftp://ftp.sun.ac.za/CTAN)o(/)p
+Black 830 2933 a FQ(Brazil)p 0.05 1.00 1.00 0.40 TeXcolorcmyk
+448 w FM(ftp://ftp.das.ufsc.br/pu)o(b/ct)o(an/)p Black
+630 3113 a FQ(A)35 b(complete)h(list)f(of)42 b FJ(ct)-7
+b(an)35 b FQ(mirrors)f(can)h(b)s(e)f(obtained)h(from)f(the)h
+FM(CTAN.sites)c FQ(\014le)k(at)h(an)m(y)630 3226 y FJ(ct)-7
+b(an)31 b FQ(site.)771 3339 y(Jean-Pierre)24 b(Drucb)s(ert's)e(F)-8
+b(renc)m(h)24 b(translation)g(of)f(V)-8 b(ersion)24 b(2.0)g(of)f(this)g
+(do)s(cumen)m(t)g(is)g(a)m(v)-5 b(ail-)630 3452 y(able)31
+b(in)f FJ(pdf)g FQ(and)g(P)m(ostScript)h(as)p Black Black
+0.05 1.00 1.00 0.40 TeXcolorcmyk 1364 3640 a FM
+(CTAN/info/epslatex/french)o(/fep)o(slat)o(ex.)o(pdf)p
+Black 0.05 1.00 1.00 0.40 TeXcolorcmyk 1388 3752 a
+(CTAN/info/epslatex/french)o(/fep)o(sla)o(tex.)o(ps)p
+Black 630 4328 a FD(Ac)l(kno)l(wledgmen)l(ts)630 4531
+y FQ(I)39 b(w)m(ould)g(lik)m(e)h(to)g(thank)f(Da)m(vid)i(Carlisle)e
+(for)g(pro)m(viding)h(a)f(great)i(deal)e(of)h(assistance)g(with)630
+4644 y(this)30 b(do)s(cumen)m(t.)40 b(Donald)30 b(Arseneau,)g(Robin)g
+(F)-8 b(airbairns,)30 b(Jim)f(Hafner,)h(Piet)h(v)-5 b(an)30
+b(Oostrum,)630 4757 y(Rolf)36 b(Nieprasc)m(hk,)j(Axel)e(Sommerfeldt,)g
+(and)f(other)g(con)m(tributors)g(to)h(the)g FM(comp.text.tex)630
+4870 y FQ(newsgroup)f(pro)m(vided)h(m)m(uc)m(h)g(of)h(the)f
+(information)g(for)g(this)h(do)s(cumen)m(t.)61 b(Thanks)36
+b(to)i(Jean-)630 4983 y(Pierre)30 b(Drucb)s(ert)g(for)g(translating)i
+(this)e(do)s(cumen)m(t)g(in)m(to)h(F)-8 b(renc)m(h.)771
+5096 y(Thanks)30 b(also)h(go)s(es)h(to)f(the)g(man)m(y)g(other)g(p)s
+(eople)g(who)f(pro)m(vided)g(me)h(with)f(v)-5 b(aluable)32
+b(sug-)630 5209 y(gestions)f(and)f(bug)g(rep)s(orts)g(for)g(this)g(do)s
+(cumen)m(t.)p Black 2272 5640 a(3)p Black eop end
+%%Page: 4 4
+TeXDict begin 4 3 bop Black 0 TeXcolorgray Black Black
+Black Black 1596 1007 a FC(T)-7 b(o)34 b(my)h(charming)e(wife)i(Be)-5
+b(cky,)1731 1124 y(and)34 b(to)h(Elise)g(and)f(Eric,)934
+1240 y(two)h(wonderful)f(kids)g(who)h(have)f(disrupte)-5
+b(d)34 b(and)h(enriche)-5 b(d)33 b(my)i(life)1388 1353
+y(mor)-5 b(e)34 b(than)h(I)f(ever)h(c)-5 b(ould)34 b(have)h(imagine)-5
+b(d.)1780 2258 y @beginspecial 0 @llx 0 @lly 102 @urx
+77 @ury 1020 @rwi @setspecial
+%%BeginDocument: EliseAndEric125.eps2
+%!PS-Adobe-3.0 EPSF-3.0
+%%Creator: (ImageMagick)
+%%Title: (EliseAndEric125.eps2)
+%%CreationDate: (Thu Dec 08 13:11:56 2005)
+%%BoundingBox: 0 0 102 77
+%%HiResBoundingBox: 0 0 102 77
+%%LanguageLevel: 2
+%%Pages: 1
+%%EndComments
+
+%%BeginDefaults
+%%EndDefaults
+
+%%BeginProlog
+%
+% Display a color image. The image is displayed in color on
+% Postscript viewers or printers that support color, otherwise
+% it is displayed as grayscale.
+%
+/DirectClassImage
+{
+ %
+ % Display a DirectClass image.
+ %
+ colorspace 0 eq
+ {
+ /DeviceRGB setcolorspace
+ <<
+ /ImageType 1
+ /Width columns
+ /Height rows
+ /BitsPerComponent 8
+ /Decode [0 1 0 1 0 1]
+ /ImageMatrix [columns 0 0 rows neg 0 rows]
+ compression 0 gt
+ { /DataSource pixel_stream /DCTDecode filter }
+ { /DataSource pixel_stream /DCTDecode filter } ifelse
+ >> image
+ }
+ {
+ /DeviceCMYK setcolorspace
+ <<
+ /ImageType 1
+ /Width columns
+ /Height rows
+ /BitsPerComponent 8
+ /Decode [1 0 1 0 1 0 1 0]
+ /ImageMatrix [columns 0 0 rows neg 0 rows]
+ compression 0 gt
+ { /DataSource pixel_stream /DCTDecode filter }
+ { /DataSource pixel_stream /DCTDecode filter } ifelse
+ >> image
+ } ifelse
+} bind def
+
+/PseudoClassImage
+{
+ %
+ % Display a PseudoClass image.
+ %
+ % Parameters:
+ % colors: number of colors in the colormap.
+ %
+ currentfile buffer readline pop
+ token pop /colors exch def pop
+ colors 0 eq
+ {
+ %
+ % Image is grayscale.
+ %
+ currentfile buffer readline pop
+ token pop /bits exch def pop
+ /DeviceGray setcolorspace
+ <<
+ /ImageType 1
+ /Width columns
+ /Height rows
+ /BitsPerComponent bits
+ /Decode [0 1]
+ /ImageMatrix [columns 0 0 rows neg 0 rows]
+ compression 0 gt
+ { /DataSource pixel_stream /DCTDecode filter }
+ {
+ /DataSource pixel_stream /DCTDecode filter
+ <<
+ /K -1
+ /Columns columns
+ /Rows rows
+ >> /CCITTFaxDecode filter
+ } ifelse
+ >> image
+ }
+ {
+ %
+ % Parameters:
+ % colormap: red, green, blue color packets.
+ %
+ /colormap colors 3 mul string def
+ currentfile colormap readhexstring pop pop
+ currentfile buffer readline pop
+ [ /Indexed /DeviceRGB colors 1 sub colormap ] setcolorspace
+ <<
+ /ImageType 1
+ /Width columns
+ /Height rows
+ /BitsPerComponent 8
+ /Decode [0 255]
+ /ImageMatrix [columns 0 0 rows neg 0 rows]
+ compression 0 gt
+ { /DataSource pixel_stream /DCTDecode filter }
+ { /DataSource pixel_stream /DCTDecode filter } ifelse
+ >> image
+ } ifelse
+} bind def
+
+/DisplayImage
+{
+ %
+ % Display a DirectClass or PseudoClass image.
+ %
+ % Parameters:
+ % x & y translation.
+ % x & y scale.
+ % label pointsize.
+ % image label.
+ % image columns & rows.
+ % class: 0-DirectClass or 1-PseudoClass.
+ % colorspace: 0-RGB or 1-CMYK.
+ % compression: 0-RLECompression or 1-NoCompression.
+ % hex color packets.
+ %
+ gsave
+ /buffer 512 string def
+ /pixel_stream currentfile def
+
+ currentfile buffer readline pop
+ token pop /x exch def
+ token pop /y exch def pop
+ x y translate
+ currentfile buffer readline pop
+ token pop /x exch def
+ token pop /y exch def pop
+ currentfile buffer readline pop
+ token pop /pointsize exch def pop
+ /Helvetica findfont pointsize scalefont setfont
+ x y scale
+ currentfile buffer readline pop
+ token pop /columns exch def
+ token pop /rows exch def pop
+ currentfile buffer readline pop
+ token pop /class exch def pop
+ currentfile buffer readline pop
+ token pop /colorspace exch def pop
+ currentfile buffer readline pop
+ token pop /compression exch def pop
+ class 0 gt { PseudoClassImage } { DirectClassImage } ifelse
+ grestore
+} bind def
+%%EndProlog
+%%Page: 1 1
+%%PageBoundingBox: 0 0 102 77
+userdict begin
+%%BeginData: 21907 Binary Bytes
+DisplayImage
+0 0
+102.4 76.8
+12.000000
+256 192
+0
+0
+0
+ÿØÿà
+
+
+’
+
+
+
+  !#"! $)4,$'1'-=-167:::"*?D>8B3796
+  
+
+
+
+
+OOOOOOOOOOOOOOOOOOOOOOOOOOOOOOOOOOOOOOÿÀ
+ 
+%&'()*456789:CDEFGHIJSTUVWXYZcdefghijstuvwxyzƒ„…†‡ˆ‰Š’“”•–—˜™š¢£¤¥¦§¨©ª²³´µ¶·¸¹ºÂÃÄÅÆÇÈÉÊÒÓÔÕÖ×ØÙÚáâãäåæçèéêñòóôõö÷øùú
+ 
+$4á%ñ&'()*56789:CDEFGHIJSTUVWXYZcdefghijstuvwxyz‚ƒ„…†‡ˆ‰Š’“”•–—˜™š¢£¤¥¦§¨©ª²³´µ¶·¸¹ºÂÃÄÅÆÇÈÉÊÒÓÔÕÖ×ØÙÚâãäåæçèéêòóôõö÷øùúÿÚ
+MæÊÄŒv¨H¦,™ùO`j` Q’yô¡ ;
+”YÛÙyÄ«§Z-¸n#×q©-µK¹îZCåƒò³[úVÑFrqe­.CµÔ,ƒæÊ s~ ðÄSÀËqÇpG°útnËò3æ±À˧Éiu¶@©äÔôÚ@®{
+Á­mØÕ7m·@†ÌŠHÕ¥o”•n‡Ú½3ÀºjÛX³žJœgã4ZòEÅû¯¹½©k1Y.|‰w9
+ÎÛ¥Õêk½½49\Å£"VPF=3ÿ
+«Lúô®:9iÐÆO_DVrÚ\£)À%y8úS …®ˆOõ(HS‚G¸¬ž¨ù©=ߞƆ‘áÑ$1ÜÎ¥²2‘ûv&»½&”y
+ð¶Ð¾Ý¿Ïµ{øZÊ—3^üõ—¡Ñ•WæÆr}‡’ó4-îUÊ’' ÅÞÂÖùv{ƒŽUOTݳ¥ki¬Ì=P+ãdB˜ê[qª~$]1ŵâ¤Ö…°?Ù÷ÅpW~–{£ÌÍaÍI»ÞpÕhÐÿ
+
+
+    ÿÛ
+©$’X@àÁ>Õ^Š{T9ŽœzU2M"oi#¸m43·”p9C{ȈïþƒP
+`rÂ@êöÇö{
+HÏ™šæD/ÉLt 
+’ž¤
+–Þ%eÀ9†ÓŒ~µ)§Ûq}8È85ÄÀ9Ï5)§K—}J{PʘáOÔ! Ì‘ƒ×¾>ôå‡1·ŽÔÂîéJš>Æœ4±ÆHÎ3šBŒ”_ÌÂRRC’EÒP'ÓùSö¤'{`
+O#éRQܬžcøë”=Í7C™¸¤çi¯‚Ãn“žj?âJnHÇLÉg‘‰þ)=jM·Ãž@¦AX'ÐÒì™RžBJÃQO8ê£Tã2f{zQ[œñ°ñPhWÈŽÜc53vSêB³ò„BøOÒ‰«£¸ýbE걺 #ÿ
+±ÉýÅ-xÑ)byPIJ‡Ì@ã
+ÏÓŸÒ®HðöjŒmàµ8¤õÁÎèOíPÚ¼Ez–…aÖ|²?ÂR¿ªZˆ|‘&jÚ:•Ýòl+¥¦4‚®§ y+Z8$Ô}vš Ô÷çc¥.6âÕ!!Iä ã®}HkwþCòÙùQ#ø… |¹<Ÿ¦N B¿1.Ùy!9KˆJÑþP ä~¿½XÖ¨]°?lîÉ­ú±kwbŠT³Ñ`ð¿µ>Ÿ ›¬E:Ùþ!#¸#¯X¡Õ¥Ò~PqŸðŸ¥i{ñwÝ^Õ6¨ðk7{r:kP`¦ªZãÛžC‹ÂTJJr{+¥VNÈ,¾ê\HJ»|@°¦dgJJQ½%AG¸s×ôªBj h•«œ$J"–™9SˆÔJP^GL棞%n­}ÉÍ,ã›´ß•‚sW‰YlÅPJù'ŒÔªæmN•†ÒêUÁBÁù}ip´ý«ã ðd0`Ç>àN
+NáSÚQÕ¦zÊû£¯­5l4’¥”‚}éÕ¹ôÿ
+.²é«ö³ñö]CžR¤y)8á 6HýÎO­yu,Gž¥ãIŒg©}xQ¢ ˜ýáôŽÏl1ö5XøÑ¥eZ/—G˜B”¨®¡Ð„Ž
+q°ô­{¤ô»ZzË:GJñ+H›Å×â›l)*d´êqÔqÍ5t+P ܦ¼=‡=OÎÛåÁÇüíÊ{ž?Ò«"Ûñ%¤Ú’PN8 ‚9­ âO„Ò¬z™æã´¯)õå öÉϦ>ô»Ã‹‚4æ’<Ôà+æ’=ì ½´ ó3°Æ
+r’çtžã°4âÝq1ÞBO˜BHÊ~ýêÒ¹x2‹uýMºÓ‹aÓ„8r’;W×߉orLWÔ¢»ËPQ¹ Á”~ÇPv=ÀN€órœÅQ·Qìz¥uM¡V«³ÉWäIÊ
+ƒŸ®*ÉLÅÎR¢¯Lbšž 'ŽçÉ BRŸ™XôâºNWѼ`÷9¦‹º-Ge)ÿ
+wj²™²Q†BQŸÏF}É4Ðaþã„6Ðúíz–—aˆÂIJ±·ÜäŽ^µqϵ^´³V¦_+[<æò«`Ûí@Ú2ûLf µ×%©cH^WócŸ-¾˜ò} ã¥^úyÖõŽŽH\“-¦e´ÐYPP 'wQßT¬@WŽ¤ôçsÝã‰søá<$·w”Ò–¶ö¥ºóZ^&„µEuR£Áe§Vw©H@=rhcÁûSq´Šåço8OSS÷ÍQw‹ü,Xñ•·‚û½>¸Fš½¨1>_c;íS$å$4Ù
+Àö¡Ë€eĨ*œÖ~0^ì”Ü5–"Txl©)?ü5±x“2èêPì†do*ÚWŽ÷¦Vµ°õ摇r”‡Ö”—'b¨.á¦à;µNïlðG¢ÍMr|0¥FGST.µÖíCCë™%Ä0ÞâPÈ%JÀÉ
+0KŽ8Ó‡jˆÜO¡r)¿ˆ–äê­úòR™±\e|¿œ[QÎ2?JiY úELÙ”H·¨´_$úg9ý*VšTˆÊ’ûÂ<q7O@s]®E˜¶Œt½°%<öÆxÅJDá&9[EÖЭÉHQøªòß½ÂD% ’)V“‹ƒ¶k„‡ÁCKYÀá &ŸF²Ü^SNy>XIèáÚjŽ|Æ\xveÂ1Éá†
+°)ÓpÓ¨T‡ÛJxÜrjÑü?xo_jÙN¸õ¾×RÞ'
+)÷$’qþSTª–â‘>ð×@:‰°®W»âîBÀqI ÝÁPôãÙ¥´ô›<›Ô:„lpÕ †¼µ ƒùŠ@ô#“Ï?zïHø{2évK2€gvçc4¬¤)Í£îF?QéV-1§-3VûkPžÚö-Õ§Ó¸ ŽAíÏj´á:2j äÅt—…ö÷ïξ‘°
+ìBO×ëZ/À«l­-®ís{s,,­Ô¸JV¦È!C=5"¤ IiíÅ¡§èï/™zLÆs(}§
+Á
+KÅÝ×ÑÖÔ½[p³Âî‹vZ‡pTsûP‡€ž!B¾ëä(n‚ÈÃüÀœz}SZ9QZœÁí(Pä•è
+TxRQX¤Œt)N8­M7NY!<J¢±¸òTP3N¬×ûkr>"WþÓ’ÚŽ-ÿ
+3ÐçÒ¾•tEÓɵÇw,´…)kÏ)Çú~¦ˆÛó3í{~lÁĺòÁ@IqĹeY¯X!µ¶C+èU·pÏÞ–¿ÉM¦*o*RÈÁ?Zoct]Y[Ê$yG!´jž>Ðub~°'±¢OèU„ú?zv›RÝÁqÅîôÝŠ^ªºIIÚ´2=ŽzldN°§%º¥1¯¡÷5ÞâøÐF·FÇœóIWù” ­éø°Ùdøe)ÖÒ˲'Ít,“Ê’”¡>Üï>õù¾Ô4¾A %ßn‡ý+_þuÁ:ñ§VáADc2*gw%$lô¯»6äæ[S屉µõVŒmöRݹKpÿ
+ùý7¤m±’ûo èí^*Ÿi˜q
+7*å=¢<ÄYä0€Ãª?šC¿”·Æ…Ôž™¡"ÿ
+Çcê(ÓNønõêÚ¤¶ÑZ€ù¡B=äý"M4Är`o2>Õñ)áHÀ)q=óS/ ˜²–ÂVËèA!
+¤ã·¨§Žhiv—‰e*
+ob)ëºUÔÚÜ”ãhK‰‘Œe$`ÿ
+@Ôá9ãõ¬á'N8¯%ÈŽÉWþbÆáVf€ñcWè{Jà]t2çÆA*MÞ
+×å( N¹«i á‹w+Õ
+—µé™—&Kb;qy'nÔ'
+¸@@ÆÜvå=(öاäÞ£¹¥ Œö8éY¦Í¨S>}µs+¶ÝC¾Ú÷m.‚A¾
+ºûV¤Ðl‡,PÝp…º„„•‘0MV “ˆÎÖP›¼Â ‘ÇJ‡½ØX¸´µÖG*çëSô¦³Òµ2BE«r ¤5¿‚ZsV´¦®pÛ–Ò±…'èG5U·øw¶èÂëÖY³¢£;Œ3rö"´ä˜+ZŽx¡Ûü
+Ye9=À ½c¦E‘àÚ6žøô«¢uœ6­ÎmëBªÑñ0Ümn R«¨d;Œ%,6‰—ì4^Âló],ÇœðŒã¡ ”„“ƒ×4Ú×£4¯LÆDiÌÃeïâJœ€yíùsÆvã½iìèR†¡„bI’¤ì'
+œá{è|NMtÒpµà +ĹŒ\§>©,¸â›ÚÓIIRò}0FzÖ:Fß Ç/ cËL KgÜÓ%jÉ-䔡Ì„zt#Ž3œ
+HrT¦–¬nYq
+ÿ
+³jîðwÆuè’‰ÔÛí/3Ž8
+IúàsìšÏjUõš] å‡#ýAõúJõtµi€G#õ?ysi»”«UÜÚ®ìª$ö…4ïêp{W]¿UÜ"ÀØÛÅÖñªæ©Kâ=‡_¶Ó¡0„…³%
+ÄgÐýzŽœWZkÄ…YÖ#Î*~8á/ÏÜV_Oz²ÞÞrVžÅmÉâjëzîŠuNÄaMçqÜÀ8ªûþŒ™AÖØYÏä
+™ѵ+häzyIö>µΆEÖé!×쬬|ŠHÜ:àŒdsííU~V+`ÄÈš§5Þ¥OÁñr,†XYyÐPÙ qíÍ=Ón·sLfŠ”¢]udž:%5.Î’jÒÃë•cbö2âŒõ8ÏéL#8„?%ÆÒÝI AJR?‰žÝ;Q>ØÙ™ct*'qä½KïÎyÇã»#åi ©
+Ë>,þ1´-¦{öÈ(‘}ž…©›kiIô*á#îjȲª·òz—Ü­gmqe(}$þ•}º"duÎF1YÇø‹—©%ï:.ù!PØ·›\÷ÙííšÔzÚÑœlÜwuey9âË]@`ò☯¾F{Ð׉7‰
+i…ˆñú3ŒSïí¹oµŒ,d
+¡îÞ\|D’Y»_ž·Û¬78Â0A+Ï '9öÀÅ =Æ·`êJŠ÷c&[Ó%Ø£%L¹|jL¡ù“ñ
+Ënúá «ýk0x›4NÖò™Hù"¡¶Rb
+¿ùBh· ^áàï6^š ®>pc#!D’¥sòôúS£5[Ý„’MB—Š‰úñô§ ‘€;V³ßla|ͪœÎŠËr¬Óó)lºO!C ½F¹óc×½9i[ÛÁÇNÄ'%,Nã ôαrÊð%Jr"ŽJAù}E\–GìÂÓÉu*¼¨¬àÙSg)ä÷¡§öۻРŠú˜pRM-×úrj~´8oìbmg§® —¬á¿±š A@P9÷¨=F¤ù ÆT~õWÚüa•ÜÖ|Ð:-fœÜ¼Z‡=´4°°;ÖBßOÔ!Æ336hu(pPþÒ Å؉—ÞŒ|È…}0 4!I*AOfHû“RºŽøåíàWò¶3ƒØ·Òçœâ•ýÜá?JÒhhj+{ý?JÚzÉ°rOQ`»
+c«$ tU8•üØïJPa¾ ÂVÎX'cãĤ x5>ír\‹1Û>KJ¾*øÒºe5køV@ä ÐqҨ˗ˆŽÛ¦-ip­Ò½¨lTª¹ô͚"¥ÜT—JÖ•,g$dñSgÈÀ„êj±HÏñ*´È…-2‚w´±’
+Ú8õ5œÌ¨²hÃI¡EJX}½èC¶üw ª†zÀa.Øöx¬4†ÑÓ‚ êFv)[N¥%¥u‹oDLG•å¼‘ùTzý)¾¥¸ !j'ëRÔ^®’ú´ûL®ïÖÆîn¹½Â‡Iý–+_&®^¬»HXÂÜ–êöú|ÇåWÇâ+^^4ªm"×/á~4>—T
+¾]˜ öüƳ›µ;Š·)Ã’IäóͦIsæm=.²‹¸™ ÚøýštÒùäçïQ­»•J|ÙÀOÖœÕÌÔ+qõsK³ù}Å6hç4å‘ïNk8\OwÌ]'î1Ú½[i_\W)<`õï‡ö¢‡#î"J OåqY÷æ¼ó‚®úÒ§ŽIäp~•ÉNÑN(v¬Jؘƒ¾cÉÂÕ”ÿ
+€
+p?»Òµ÷àfØu–ü¹|å©öÜp¥?”àŒ~•¯þ}šáŸ ͇ôþïǦ;Áÿ
+Õ $üÊ<µai¿ÅýÓAxÁ>Ãý©6_ÔÆäm lpÉ#9Ž=#¨BŸiÅP¬úq¥TÚ¥·d¥Mù ëÓ©¤Þ£¥MUX~ÇRz¿NÓúj·®pr?Yú1¤e¡Ø¢bRͬt)##ö ?õÄ{<'Þ¢’I' ¡_‰lj­
+Þ™˜ðEæÌØd!G—#ŽXõ
+ÙŸá…ƒÖ®c¤¿µãïSM©m§ÿ
+3 4–YA$`R~3ø£kÐzmùÓOðÓµÝó8¼p”ûŸùÒÂKnÏž§ƒ
+r^H
+ß~µ³ÿ
+ž*D¶’ú?2ˆV?’¿jÑz)ZŠ|çüM' ¸_P¯wG#ù^I½ËÓÓŸó_R÷¨òŽ½i]7¨"k«yÕ«'?=y®“ñ¨ˆèB~qÛŽiÞžÓÌÄi ^ˆäç·q]`W™ÜW2Zçvaøä4´ÄŽ´z„FKjQ#9Ûš.rÕ2<´$lðœS•Dˆ†FäŽûÆz ”FT\)h·{††ÔÖûͺJâÊ„øZ\lð¤tZ;‚’Fô­{§µÕ¿Äh)D°ˆóÂGšÞrG IîÁœõ^›‹5•**Â]ÎCö¡­¯eÛn‘¬s›1¥4vB¹#>Qá§`Iá]8èr1Þ£éàåÇsýK {¶ê©*0~qóûMϧ<'a¤-Ô>”%|ðœæ¥.Ú¸g[††]}Dî´j¤<;ñòåa•ðW$¥k‘žùTŸ¡«Ö‹º~á<‰IiXÉiãµCíßíY­ñ9KVÍã™BÝ<<š‰­Ö*$䡽©ý… LÑiŽ¢·R=:“Vνñ’µ5ôúµIêÏÛZ\Zyç =…Bå¹0ñeÖ¨Èma‡¦â¥%Ä¥EA §<­G ¦²§ãbʳGK/9™‘]p¤«€´©9 tè°>Õ!uÕ³¼Fü@ØmÈqkŒÖðË(鸌}¥Kþ<RÔ+–Š´$ñ-ï-C¾¤ÿ
+/C?éBv+š%4H<ŒqD±ÝÉëÁmc3¤io[02Yž íNÙ;“œÓ=éë$$c<ÓJÄn­˜é—p®Áüž¾¸ö¤óµïíJ©p3Fƒ.ÌècØשshúf¼Iä½}·ƒÅKqñ gŠs ÀÁãÛ±ûÒû~£½r¤|Ç’* [0ËYisø—b:ˆËòß(! #¡ÇnºKU¸³1EǬ)KÊ…N˜Í¶:žwòŽƒº¥
+%õÏ”·HÚV¢p;f³Úœ+á[1}¼Øi+
+ïq´ÃvM²JbËB“…­!@ÀAã½0»kñ¨\zÛ¨b;u}ÂŽ¾–ÖF2x
+ì\PôÃ:=Îd£)x gáPJsÆã¹\§Ôí?j‘Y†÷9ßõÔÔ)òGýÏüÈŠÔ—Rh$l²=OjŸƒ1¨å››l¥¯RW¹h…`Žœâ ¾*+Ä1l´¨-Ôr‘Ç߯­/lÓ'PÞ]¹8>‡’ÛiFâ’?1ŒsÓ8éUX¤ý Ì}¿îêÛ s>lt÷ 
+[KN\u‚8Àç<Žµ;á/†‘£ÙZ½ÜÙÏ™µÈÐÝ08ÂÖ÷~õb\4ü‚Ñ[ªZ À2¾ý¿ß5Ó½п.«Q‘äû?ê(¿Ö[OxcÊœçî>%Ý6é>{QÌ“ü$È u©˜f¾U8qŽG&“ЮC¼øsmKë{-ª;‡ùp?l½F³%Pn a*C‰ÆyâµDŒ•øŸ©´ŸÅéªÔ§L ÿ
+uE·ÚG$ŠJçzCƒÊf3Že;·Çè(jD¨ìY>.ààJÚYÉJŽOá žÿ
+÷o @8 ‰ `㱪Þm² ½òWq+yJS$wsùNO8ïJ/+`Æ?™f¥X¦,Ú²ÀÑ!ÅÕVض­K#6[HfìÂYIü¥_â:þÔa-­K§#©ß(Þí@dK‚7íæoó¶G½d›úSsë€ä¸ QG˜•eƒ‚zc9ûU§ødüCO»ÜQjµ (o~⬡`^Ec®®»,*Ü‘ÿ
+‡yËÊ"î†øv ÉR P<ûÔÔÕE¸ØÜi Ài%YO#vGô4×I]š·²ã2\R¬nQù÷ÿ
+%%EndData
+end
+%%PageTrailer
+%%Trailer
+%%BoundingBox: 0 0 102 77
+%%HiResBoundingBox: 0 0 102 77
+%%EOF
+
+%%EndDocument
+ @endspecial Black 2272 5640 a FQ(4)p Black eop end
+%%Page: 5 5
+TeXDict begin 5 4 bop Black 0 TeXcolorgray Black Black
+630 138 a FD(Con)l(ten)l(ts)p 0.00 0.00 0.70 TeXcolorrgb
+630 455 a FB(I)112 b(Bac)m(kground)38 b(Information)p
+Black 1918 w(9)p 0.00 0.00 0.70 TeXcolorrgb 630 659
+a FL(1)84 b(In)m(tro)s(duction)p Black 2566 w(9)p 0.00 0.00 0.70
+TeXcolorrgb 630 863 a(2)g(L)791 846 y FI(A)837 863 y
+FL(T)893 883 y(E)948 863 y(X)35 b(T)-9 b(erminology)p
+Black 2224 w(10)p 0.00 0.00 0.70 TeXcolorrgb 630 1067
+a(3)84 b(Encapsulated)35 b(P)m(ostScript)p Black 1969
+w(11)p 0.00 0.00 0.70 TeXcolorrgb 766 1180 a FQ(3.1)94
+b(F)-8 b(orbidden)30 b(P)m(ostScript)h(Op)s(erators)p
+Black 31 w(.)46 b(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)f(.)h(.)g
+(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)p Black 80 w(12)p Black
+0.00 0.00 0.70 TeXcolorrgb 766 1292 a(3.2)94 b(The)30
+b(EPS)g(BoundingBo)m(x)p Black 92 w(.)46 b(.)g(.)f(.)h(.)g(.)f(.)h(.)g
+(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)
+p Black 80 w(12)p Black 0.00 0.00 0.70 TeXcolorrgb
+766 1405 a(3.3)94 b(Con)m(v)m(erting)32 b(PS)e(\014les)g(to)h(EPS)p
+Black 84 w(.)45 b(.)h(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)f
+(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)p Black 80 w(13)p
+Black 0.00 0.00 0.70 TeXcolorrgb 766 1518 a(3.4)94
+b(Fixing)32 b(Non-standard)e(EPS)f(\014les)p Black 89
+w(.)46 b(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)g(.)f(.)
+h(.)g(.)f(.)h(.)g(.)p Black 80 w(14)p Black 0.00 0.00 0.70
+TeXcolorrgb 630 1722 a FL(4)84 b(Ho)m(w)35 b(EPS)g(Files)g(are)f(Used)i
+(b)m(y)f(L)2098 1705 y FI(A)2144 1722 y FL(T)2200 1742
+y(E)2255 1722 y(X)p Black 1521 w(14)p 0.00 0.00 0.70
+TeXcolorrgb 766 1835 a FQ(4.1)94 b(Line)31 b(Bu\013er)f(Ov)m(er\015o)m
+(w)p Black 51 w(.)45 b(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)g(.)f(.)h
+(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)p
+Black 80 w(14)p Black 0.00 0.00 0.70 TeXcolorrgb 630
+2039 a FL(5)84 b(PDF)36 b(Graphics)p Black 2428 w(15)p
+0.00 0.00 0.70 TeXcolorrgb 766 2152 a FQ(5.1)94 b(JPEG)p
+Black 72 w(.)46 b(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)g(.)f(.)h
+(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)
+g(.)f(.)h(.)g(.)p Black 80 w(15)p Black 0.00 0.00 0.70
+TeXcolorrgb 766 2265 a(5.2)94 b(PNG)p Black 42 w(.)46
+b(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h
+(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)
+g(.)p Black 80 w(16)p Black 0.00 0.00 0.70 TeXcolorrgb
+766 2378 a(5.3)94 b(PDF)p Black 53 w(.)46 b(.)g(.)f(.)h(.)g(.)g(.)f(.)h
+(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)
+g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)p Black 80
+w(16)p Black 0.00 0.00 0.70 TeXcolorrgb 766 2491 a(5.4)94
+b(MetaP)m(ost)p Black 77 w(.)46 b(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)g
+(.)f(.)h(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)g(.)
+f(.)h(.)g(.)f(.)h(.)g(.)p Black 80 w(16)p Black 0.00 0.00 0.70
+TeXcolorrgb 766 2603 a(5.5)94 b(PurifyEPS)p Black 30
+w(.)46 b(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)
+g(.)f(.)h(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)p
+Black 80 w(17)p Black 0.00 0.00 0.70 TeXcolorrgb 630
+2807 a FL(6)84 b(Graphics)36 b(Soft)m(w)m(are)p Black
+2250 w(17)p 0.00 0.00 0.70 TeXcolorrgb 766 2920 a FQ(6.1)94
+b(Ghostscript)p Black 65 w(.)46 b(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)g(.)f
+(.)h(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)g(.)f(.)
+h(.)g(.)f(.)h(.)g(.)p Black 80 w(17)p Black 0.00 0.00 0.70
+TeXcolorrgb 766 3033 a(6.2)94 b(Graphics-Con)m(v)m(ersion)32
+b(Programs)p Black 69 w(.)46 b(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g
+(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)p Black 80
+w(17)p Black 0.00 0.00 0.70 TeXcolorrgb 766 3146 a(6.3)94
+b(Lev)m(el)32 b(2)f(EPS)e(W)-8 b(rapp)s(ers)p Black 48
+w(.)46 b(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)
+f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)p Black 80 w(20)p
+Black 0.00 0.00 0.70 TeXcolorrgb 766 3259 a(6.4)94
+b(Editing)31 b(P)m(ostScript)p Black 71 w(.)46 b(.)f(.)h(.)g(.)g(.)f(.)
+h(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)g(.)f(.)h
+(.)g(.)f(.)h(.)g(.)p Black 80 w(21)p Black 0.00 0.00 0.70
+TeXcolorrgb 630 3576 a FB(I)s(I)112 b(The)37 b(L)1084
+3554 y FI(A)1128 3576 y FB(T)1187 3598 y(E)1248 3576
+y(X)g(Graphics)h(Bundle)p Black 1655 w(22)p 0.00 0.00 0.70
+TeXcolorrgb 630 3780 a FL(7)84 b(Graphics)36 b(Inclusion)p
+Black 2234 w(22)p 0.00 0.00 0.70 TeXcolorrgb 766 3893
+a FQ(7.1)94 b(Graphics)31 b(Driv)m(er)p Black 31 w(.)45
+b(.)h(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f
+(.)h(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)p
+Black 80 w(22)p Black 0.00 0.00 0.70 TeXcolorrgb 766
+4006 a(7.2)94 b(Graphics)31 b(Inclusion)f(for)g(D)m(VIPS-st)m(yle)i(Do)
+s(cumen)m(ts)p Black 62 w(.)46 b(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)
+h(.)g(.)p Black 80 w(22)p Black 0.00 0.00 0.70 TeXcolorrgb
+766 4119 a(7.3)94 b(Graphics)31 b(Inclusion)f(for)g(p)s(dfL)2044
+4102 y FP(A)2083 4119 y FQ(T)2134 4138 y(E)2182 4119
+y(X)h(Do)s(cumen)m(ts)p Black 50 w(.)46 b(.)f(.)h(.)g(.)f(.)h(.)g(.)g
+(.)f(.)h(.)g(.)f(.)h(.)g(.)p Black 80 w(23)p Black 0.00 0.00 0.70
+TeXcolorrgb 766 4232 a(7.4)94 b(Do)s(cumen)m(ts)31 b(to)h(b)s(e)d(Pro)s
+(cessed)h(b)m(y)h(b)s(oth)e(L)2468 4215 y FP(A)2507 4232
+y FQ(T)2558 4251 y(E)2609 4232 y(X)h(and)g(p)s(dfL)3041
+4215 y FP(A)3080 4232 y FQ(T)3131 4251 y(E)3180 4232
+y(X)p Black 92 w(.)45 b(.)h(.)g(.)f(.)h(.)g(.)p Black
+80 w(23)p Black 0.00 0.00 0.70 TeXcolorrgb 766 4345
+a(7.5)94 b(Sp)s(ecifying)30 b(Width,)h(Heigh)m(t,)h(or)e(Angle)p
+Black 39 w(.)46 b(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)g(.)f
+(.)h(.)g(.)f(.)h(.)g(.)p Black 80 w(24)p Black 0.00 0.00 0.70
+TeXcolorrgb 630 4549 a FL(8)84 b(Rotating)35 b(and)g(Scaling)h(Ob)6
+b(jects)p Black 1740 w(27)p 0.00 0.00 0.70 TeXcolorrgb
+766 4661 a FQ(8.1)94 b(The)30 b(scaleb)s(o)m(x)i(Command)p
+Black 62 w(.)46 b(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h
+(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)p Black
+80 w(27)p Black 0.00 0.00 0.70 TeXcolorrgb 766 4774
+a(8.2)94 b(The)30 b(resizeb)s(o)m(x)h(Commands)p Black
+67 w(.)46 b(.)f(.)h(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)f(.)h
+(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)p Black 80 w(27)p
+Black 0.00 0.00 0.70 TeXcolorrgb 766 4887 a(8.3)94
+b(The)30 b(rotateb)s(o)m(x)i(Command)p Black 83 w(.)46
+b(.)f(.)h(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)g
+(.)f(.)h(.)g(.)f(.)h(.)g(.)p Black 80 w(28)p Black 0.00 0.00 0.70
+TeXcolorrgb 630 5091 a FL(9)84 b(Adv)-6 b(anced)36 b
+(Graphics-Inclusion)h(Commands)p Black 1205 w(29)p 0.00 0.00 0.70
+TeXcolorrgb 766 5204 a FQ(9.1)94 b(The)30 b(DeclareGraphicsExtensions)j
+(Command)p Black 90 w(.)46 b(.)f(.)h(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)
+f(.)h(.)g(.)p Black 80 w(29)p Black 0.00 0.00 0.70
+TeXcolorrgb 766 5317 a(9.2)94 b(The)30 b(DeclareGraphicsRule)j(Command)
+p Black 53 w(.)46 b(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)g(.)f(.)h
+(.)g(.)f(.)h(.)g(.)p Black 80 w(30)p Black Black 2272
+5640 a(5)p Black eop end
+%%Page: 6 6
+TeXDict begin 6 5 bop Black 0 TeXcolorgray Black Black
+0.00 0.00 0.70 TeXcolorrgb 630 -149 a FB(I)s(I)s(I)112
+b(Using)38 b(Graphics-Inclusion)h(Commands)p Black 1159
+w(32)p 0.00 0.00 0.70 TeXcolorrgb 630 55 a FL(10)32
+b(Horizon)m(tal)k(Spacing)g(and)e(Cen)m(tering)p Black
+1534 w(32)p 0.00 0.00 0.70 TeXcolorrgb 766 168 a FQ(10.1)49
+b(Horizon)m(tal)33 b(Cen)m(tering)p Black 49 w(.)45 b(.)h(.)g(.)g(.)f
+(.)h(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)g(.)f(.)
+h(.)g(.)f(.)h(.)g(.)p Black 80 w(32)p Black 0.00 0.00 0.70
+TeXcolorrgb 766 281 a(10.2)j(Horizon)m(tal)33 b(Spacing)p
+Black 56 w(.)46 b(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)g(.)f(.)h
+(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)p
+Black 80 w(32)p Black 0.00 0.00 0.70 TeXcolorrgb 630
+485 a FL(11)32 b(Rotation,)j(Scaling,)h(and)f(Alignmen)m(t)p
+Black 1555 w(33)p 0.00 0.00 0.70 TeXcolorrgb 766 598
+a FQ(11.1)49 b(Di\013erence)32 b(Bet)m(w)m(een)h(Heigh)m(t)f(and)d(T)-8
+b(otalheigh)m(t)p Black 89 w(.)46 b(.)f(.)h(.)g(.)f(.)h(.)g(.)g(.)f(.)h
+(.)g(.)f(.)h(.)g(.)p Black 80 w(33)p Black 0.00 0.00 0.70
+TeXcolorrgb 766 711 a(11.2)j(Scaling)32 b(of)e(Rotated)i(Graphics)p
+Black 41 w(.)45 b(.)h(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)f
+(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)p Black 80 w(33)p
+Black 0.00 0.00 0.70 TeXcolorrgb 766 824 a(11.3)j(Alignmen)m(t)32
+b(of)e(Rotated)i(Graphics)p Black 51 w(.)46 b(.)f(.)h(.)g(.)g(.)f(.)h
+(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)p
+Black 80 w(34)p Black 0.00 0.00 0.70 TeXcolorrgb 766
+936 a(11.4)j(Minipage)32 b(V)-8 b(ertical)33 b(Alignmen)m(t)p
+Black 84 w(.)46 b(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)f(.)h
+(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)p Black 80 w(36)p
+Black 0.00 0.00 0.70 TeXcolorrgb 630 1140 a FL(12)32
+b(Ov)m(erla)m(ying)k(Tw)m(o)e(Imp)s(orted)h(Graphics)p
+Black 1455 w(38)p 0.00 0.00 0.70 TeXcolorrgb 766 1253
+a FQ(12.1)49 b(Ov)m(erpic)31 b(P)m(ac)m(k)-5 b(age)p
+Black 85 w(.)46 b(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)g(.)f
+(.)h(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)p
+Black 80 w(39)p Black 0.00 0.00 0.70 TeXcolorrgb 630
+1457 a FL(13)32 b(Using)k(Sub)s(directories)p Black 2138
+w(39)p 0.00 0.00 0.70 TeXcolorrgb 766 1570 a FQ(13.1)49
+b(T)1026 1589 y(E)1076 1570 y(X)31 b(Searc)m(h)g(P)m(ath)p
+Black 57 w(.)46 b(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)g(.)f
+(.)h(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)p
+Black 80 w(39)p Black 0.00 0.00 0.70 TeXcolorrgb 766
+1683 a(13.2)j(T)-8 b(emp)s(orarily)31 b(Changing)f(the)g(T)2110
+1702 y(E)2160 1683 y(X)h(Searc)m(h)f(P)m(ath)p Black
+35 w(.)46 b(.)f(.)h(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)p
+Black 80 w(40)p Black 0.00 0.00 0.70 TeXcolorrgb 766
+1796 a(13.3)j(Graphics)31 b(Searc)m(h)f(P)m(ath)p Black
+84 w(.)46 b(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g
+(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)p Black 80
+w(40)p Black 0.00 0.00 0.70 TeXcolorrgb 766 1909 a(13.4)j(Conserving)
+30 b(P)m(o)s(ol)i(Space)p Black 41 w(.)46 b(.)g(.)g(.)f(.)h(.)g(.)f(.)h
+(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)
+g(.)p Black 80 w(41)p Black 0.00 0.00 0.70 TeXcolorrgb
+630 2112 a FL(14)32 b(Compressed)k(and)e(Non-EPS)i(Graphics)f(Files)g
+(in)g FM(dvips)p Black 786 w FL(42)p 0.00 0.00 0.70
+TeXcolorrgb 766 2225 a FQ(14.1)49 b(Compressed)30 b(EPS)f(Example)p
+Black 34 w(.)46 b(.)f(.)h(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g
+(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)p Black 80
+w(43)p Black 0.00 0.00 0.70 TeXcolorrgb 766 2338 a(14.2)j(Non-EPS)30
+b(Graphic)h(Files)p Black 87 w(.)46 b(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)g
+(.)f(.)h(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)p
+Black 80 w(43)p Black 0.00 0.00 0.70 TeXcolorrgb 766
+2451 a(14.3)j(GIF)31 b(Example)p Black 56 w(.)46 b(.)f(.)h(.)g(.)f(.)h
+(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)f(.)h(.)
+g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)p Black 80 w(44)p Black
+0.00 0.00 0.70 TeXcolorrgb 766 2564 a(14.4)j(T)1026
+2584 y(E)1076 2564 y(X)31 b(Searc)m(h)g(P)m(ath)g(and)e(dvips)p
+Black 64 w(.)45 b(.)h(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)f
+(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)p Black 80 w(44)p
+Black 0.00 0.00 0.70 TeXcolorrgb 630 2768 a FL(15)32
+b(The)j(PSfrag)g(P)m(ac)m(k)-6 b(age)p Black 2171 w(45)p
+0.00 0.00 0.70 TeXcolorrgb 766 2881 a FQ(15.1)49 b(PSfrag)30
+b(Example)h(#1)p Black 84 w(.)45 b(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g
+(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)
+p Black 80 w(46)p Black 0.00 0.00 0.70 TeXcolorrgb
+766 2994 a(15.2)j(PSfrag)30 b(Example)h(#2)p Black 84
+w(.)45 b(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)
+g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)p Black 80
+w(47)p Black 0.00 0.00 0.70 TeXcolorrgb 766 3107 a(15.3)j(L)999
+3090 y FP(A)1038 3107 y FQ(T)1089 3126 y(E)1140 3107
+y(X)30 b(T)-8 b(ext)31 b(in)f(EPS)g(File)p Black 86 w(.)46
+b(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)f(.)h(.)g
+(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)p Black 80 w(48)p Black
+0.00 0.00 0.70 TeXcolorrgb 766 3220 a(15.4)j(Figure)31
+b(and)f(T)-8 b(ext)31 b(Scaling)g(with)f(PSfrag)p Black
+53 w(.)46 b(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f
+(.)h(.)g(.)p Black 80 w(48)p Black 0.00 0.00 0.70 TeXcolorrgb
+766 3332 a(15.5)j(PSfrag)30 b(and)g(PDFT)1690 3352 y(E)1741
+3332 y(X)p Black 46 w(.)45 b(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)g(.)
+f(.)h(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)p
+Black 80 w(48)p Black 0.00 0.00 0.70 TeXcolorrgb 630
+3536 a FL(16)32 b(Including)k(An)f(EPS)g(File)g(Multiple)g(Times)p
+Black 1309 w(49)p 0.00 0.00 0.70 TeXcolorrgb 766 3649
+a FQ(16.1)49 b(De\014ning)31 b(a)g(P)m(ostScript)g(Command)p
+Black 82 w(.)45 b(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)g
+(.)f(.)h(.)g(.)f(.)h(.)g(.)p Black 80 w(50)p Black 0.00 0.00 0.70
+TeXcolorrgb 766 3762 a(16.2)j(Graphics)31 b(in)f(P)m(age)i(Header)f(or)
+f(F)-8 b(o)s(oter)p Black 55 w(.)46 b(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g
+(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)p Black 80
+w(52)p Black 0.00 0.00 0.70 TeXcolorrgb 766 3875 a(16.3)j(W)-8
+b(atermark)32 b(Graphics)e(in)h(Bac)m(kground)p Black
+73 w(.)46 b(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f
+(.)h(.)g(.)p Black 80 w(53)p Black 0.00 0.00 0.70 TeXcolorrgb
+630 4192 a FB(IV)111 b(The)38 b(Figure)g(En)m(vironmen)m(t)p
+Black 1763 w(55)p 0.00 0.00 0.70 TeXcolorrgb 630 4396
+a FL(17)32 b(The)j(Figure)g(En)m(vironmen)m(t)p Black
+1952 w(55)p 0.00 0.00 0.70 TeXcolorrgb 766 4509 a FQ(17.1)49
+b(Creating)31 b(Floating)i(Figures)p Black 63 w(.)46
+b(.)f(.)h(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)g
+(.)f(.)h(.)g(.)f(.)h(.)g(.)p Black 80 w(56)p Black 0.00 0.00 0.70
+TeXcolorrgb 766 4622 a(17.2)j(Figure)31 b(Placemen)m(t)p
+Black 40 w(.)46 b(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)g(.)f
+(.)h(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)p
+Black 80 w(58)p Black 0.00 0.00 0.70 TeXcolorrgb 766
+4735 a(17.3)j(Clearing)31 b(Unpro)s(cessed)f(Floats)p
+Black 27 w(.)45 b(.)h(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)f
+(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)p Black 80 w(59)p
+Black 0.00 0.00 0.70 TeXcolorrgb 766 4848 a(17.4)j(T)-8
+b(o)s(o)31 b(Man)m(y)g(Unpro)s(cessed)f(Floats)p Black
+95 w(.)46 b(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)g(.)f
+(.)h(.)g(.)f(.)h(.)g(.)p Black 80 w(60)p Black 0.00 0.00 0.70
+TeXcolorrgb 630 5052 a FL(18)32 b(Customizing)k(Float)e(Placemen)m(t)p
+Black 1735 w(61)p 0.00 0.00 0.70 TeXcolorrgb 766 5165
+a FQ(18.1)49 b(Float)33 b(Placemen)m(t)f(Coun)m(ters)p
+Black 50 w(.)46 b(.)f(.)h(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g
+(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)p Black 80
+w(61)p Black 0.00 0.00 0.70 TeXcolorrgb 766 5278 a(18.2)j(Figure)31
+b(F)-8 b(ractions)p Black 87 w(.)46 b(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g
+(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)
+f(.)h(.)g(.)p Black 80 w(61)p Black 0.00 0.00 0.70
+TeXcolorrgb 766 5390 a(18.3)j(Suppressing)29 b(Floats)p
+Black 62 w(.)46 b(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)g(.)f(.)h
+(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)p
+Black 80 w(63)p Black Black 2272 5640 a(6)p Black eop
+end
+%%Page: 7 7
+TeXDict begin 7 6 bop Black 0 TeXcolorgray Black Black
+0.00 0.00 0.70 TeXcolorrgb 630 -149 a FL(19)32 b(Customizing)k(the)e
+(\014gure)i(En)m(vironmen)m(t)p Black 1416 w(64)p 0.00 0.00 0.70
+TeXcolorrgb 766 -36 a FQ(19.1)49 b(Figure)31 b(Spacing)p
+Black 73 w(.)45 b(.)h(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)g
+(.)f(.)h(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)p
+Black 80 w(64)p Black 0.00 0.00 0.70 TeXcolorrgb 766
+77 a(19.2)j(Horizon)m(tal)33 b(Lines)d(Ab)s(o)m(v)m(e/Belo)m(w)k
+(Figure)p Black 82 w(.)46 b(.)f(.)h(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)g(.)f
+(.)h(.)g(.)f(.)h(.)g(.)p Black 80 w(65)p Black 0.00 0.00 0.70
+TeXcolorrgb 766 190 a(19.3)j(Caption)31 b(V)-8 b(ertical)33
+b(Spacing)p Black 25 w(.)46 b(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)g(.)f(.)h
+(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)p
+Black 80 w(66)p Black 0.00 0.00 0.70 TeXcolorrgb 766
+303 a(19.4)j(Caption)31 b(Lab)s(el)p Black 27 w(.)46
+b(.)f(.)h(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g
+(.)f(.)h(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)p
+Black 80 w(67)p Black 0.00 0.00 0.70 TeXcolorrgb 766
+416 a(19.5)j(Caption)31 b(Num)m(b)s(ering)p Black 88
+w(.)45 b(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)
+g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)p Black 80
+w(67)p Black 0.00 0.00 0.70 TeXcolorrgb 766 529 a(19.6)j(Mo)m(ving)32
+b(Figures)f(to)g(End)e(of)i(Do)s(cumen)m(t)p Black 52
+w(.)46 b(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)
+h(.)g(.)p Black 80 w(68)p Black 0.00 0.00 0.70 TeXcolorrgb
+766 642 a(19.7)j(Adjusting)30 b(Caption)h(Linespacing)p
+Black 69 w(.)46 b(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)f(.)h(.)g
+(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)p Black 80 w(68)p Black
+0.00 0.00 0.70 TeXcolorrgb 630 846 a FL(20)32 b(Customizing)k
+(Captions)f(with)f(caption)h(pac)m(k)-6 b(age)p Black
+1083 w(69)p 0.00 0.00 0.70 TeXcolorrgb 766 958 a FQ(20.1)49
+b(Caption)31 b(P)m(ac)m(k)-5 b(age)33 b(Ov)m(erview)p
+Black 25 w(.)46 b(.)f(.)h(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g
+(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)p Black 80
+w(69)p Black 0.00 0.00 0.70 TeXcolorrgb 766 1071 a(20.2)j(Caption)31
+b(Commands)p Black 85 w(.)45 b(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)g
+(.)f(.)h(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)p
+Black 80 w(70)p Black 0.00 0.00 0.70 TeXcolorrgb 766
+1184 a(20.3)j(Customizing)31 b(Captions)g(with)f(Caption)g(Command)p
+Black 64 w(.)46 b(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)p
+Black 80 w(70)p Black 0.00 0.00 0.70 TeXcolorrgb 766
+1297 a(20.4)j(Caption)31 b(P)m(ac)m(k)-5 b(age)33 b(Examples)p
+Black 84 w(.)45 b(.)h(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)f
+(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)p Black 80 w(76)p
+Black 0.00 0.00 0.70 TeXcolorrgb 766 1410 a(20.5)j(F)-8
+b(urther)31 b(Customization)p Black 44 w(.)46 b(.)g(.)g(.)f(.)h(.)g(.)f
+(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)
+h(.)g(.)p Black 80 w(84)p Black 0.00 0.00 0.70 TeXcolorrgb
+630 1614 a FL(21)32 b(Non-Floating)j(Figures)p Black
+2112 w(87)p 0.00 0.00 0.70 TeXcolorrgb 766 1727 a FQ(21.1)49
+b(Non-\015oating)32 b(Figures)f(without)f(the)h(caption)g(pac)m(k)-5
+b(age)p Black 41 w(.)46 b(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)p
+Black 80 w(88)p Black 0.00 0.00 0.70 TeXcolorrgb 766
+1840 a(21.2)j(The)30 b FO(\015oat)g FQ(P)m(ac)m(k)-5
+b(age's)34 b FM([H])29 b FQ(Placemen)m(t)j(Option)p Black
+37 w(.)46 b(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)p
+Black 80 w(88)p Black 0.00 0.00 0.70 TeXcolorrgb 630
+2044 a FL(22)32 b(Marginal)k(Figures)p Black 2304 w(89)p
+0.00 0.00 0.70 TeXcolorrgb 630 2247 a(23)c(Wide)j(Figures)p
+Black 2474 w(90)p 0.00 0.00 0.70 TeXcolorrgb 766 2360
+a FQ(23.1)49 b(Wide)31 b(Figures)g(in)f(One-sided)g(Do)s(cumen)m(ts)p
+Black 50 w(.)46 b(.)f(.)h(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g
+(.)f(.)h(.)g(.)p Black 80 w(90)p Black 0.00 0.00 0.70
+TeXcolorrgb 766 2473 a(23.2)j(Wide)31 b(Figures)g(in)f(Tw)m(o-sided)h
+(Do)s(cumen)m(ts)p Black 37 w(.)46 b(.)f(.)h(.)g(.)f(.)h(.)g(.)f(.)h(.)
+g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)p Black 80 w(91)p Black
+0.00 0.00 0.70 TeXcolorrgb 630 2677 a FL(24)32 b(Landscap)s(e)j
+(Figures)p Black 2240 w(91)p 0.00 0.00 0.70 TeXcolorrgb
+766 2790 a FQ(24.1)49 b(Landscap)s(e)30 b(En)m(vironmen)m(t)p
+Black 58 w(.)46 b(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h
+(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)p Black
+80 w(92)p Black 0.00 0.00 0.70 TeXcolorrgb 766 2903
+a(24.2)j(Sidew)m(a)m(ys\014gure)31 b(En)m(vironmen)m(t)p
+Black 39 w(.)45 b(.)h(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)f
+(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)p Black 80 w(92)p
+Black 0.00 0.00 0.70 TeXcolorrgb 766 3016 a(24.3)j(Rotcaption)32
+b(Command)p Black 69 w(.)46 b(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)g(.)f
+(.)h(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)p
+Black 80 w(94)p Black 0.00 0.00 0.70 TeXcolorrgb 630
+3220 a FL(25)32 b(Captions)j(Beside)g(Figures)p Black
+1978 w(94)p 0.00 0.00 0.70 TeXcolorrgb 766 3332 a FQ(25.1)49
+b(The)30 b(Sidecap)h(P)m(ac)m(k)-5 b(age)p Black 45 w(.)45
+b(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)f
+(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)p Black 80 w(95)p
+Black 0.00 0.00 0.70 TeXcolorrgb 766 3445 a(25.2)j(Side)30
+b(Captions)h(without)f(Sidecap)p Black 81 w(.)46 b(.)f(.)h(.)g(.)g(.)f
+(.)h(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)p
+Black 80 w(96)p Black 0.00 0.00 0.70 TeXcolorrgb 630
+3649 a FL(26)32 b(Figures)k(on)f(Ev)m(en)g(or)g(Odd)f(P)m(ages)p
+Black 1690 w(97)p 0.00 0.00 0.70 TeXcolorrgb 766 3762
+a FQ(26.1)49 b(Figures)31 b(on)f(F)-8 b(acing)33 b(P)m(ages)p
+Black 57 w(.)46 b(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h
+(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)p Black
+80 w(98)p Black 0.00 0.00 0.70 TeXcolorrgb 630 3966
+a FL(27)32 b(Bo)m(xed)k(Figures)p Black 2432 w(99)p 0.00 0.00 0.70
+TeXcolorrgb 766 4079 a FQ(27.1)49 b(Bo)m(x)32 b(Around)d(Graphic)p
+Black 44 w(.)45 b(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g
+(.)f(.)h(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)p
+Black 80 w(99)p Black 0.00 0.00 0.70 TeXcolorrgb 766
+4192 a(27.2)j(Bo)m(x)32 b(Around)d(Figure)i(and)f(Caption)p
+Black 76 w(.)45 b(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)g
+(.)f(.)h(.)g(.)f(.)h(.)g(.)p Black 80 w(99)p Black 0.00 0.00 0.70
+TeXcolorrgb 766 4305 a(27.3)j(Customizing)31 b(fb)s(o)m(x)f(P)m
+(arameters)p Black 57 w(.)46 b(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h
+(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)p Black
+35 w(101)p Black 0.00 0.00 0.70 TeXcolorrgb 766 4418
+a(27.4)j(The)30 b(F)-8 b(ancyb)s(o)m(x)32 b(P)m(ac)m(k)-5
+b(age)p Black 38 w(.)46 b(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)g(.)f(.)h
+(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)p
+Black 35 w(101)p Black 0.00 0.00 0.70 TeXcolorrgb 630
+4735 a FB(V)112 b(Complex)38 b(Figures)p Black 2134 w(104)p
+0.00 0.00 0.70 TeXcolorrgb 630 4939 a FL(28)32 b(Side-b)m(y-Side)j
+(Graphics)p Black 2028 w(104)p 0.00 0.00 0.70 TeXcolorrgb
+766 5052 a FQ(28.1)49 b(Side-b)m(y-Side)31 b(Graphics)f(in)g(a)h
+(Single)f(Figure)p Black 47 w(.)45 b(.)h(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)
+g(.)f(.)h(.)g(.)f(.)h(.)g(.)p Black 35 w(104)p Black
+0.00 0.00 0.70 TeXcolorrgb 766 5165 a(28.2)j(Side-b)m(y-Side)31
+b(Figures)p Black 67 w(.)45 b(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)g
+(.)f(.)h(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)p
+Black 35 w(105)p Black 0.00 0.00 0.70 TeXcolorrgb 766
+5278 a(28.3)j(Side-b)m(y-Side)31 b(Sub\014gures)p Black
+88 w(.)46 b(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)f
+(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)p Black 35 w(106)p
+Black Black 2272 5640 a(7)p Black eop end
+%%Page: 8 8
+TeXDict begin 8 7 bop Black 0 TeXcolorgray Black Black
+0.00 0.00 0.70 TeXcolorrgb 630 -149 a FL(29)32 b(Separate)j
+(Minipages)g(for)g(Captions)p Black 1536 w(108)p 0.00 0.00 0.70
+TeXcolorrgb 630 55 a(30)d(Placing)k(a)f(T)-9 b(able)35
+b(Beside)g(a)g(Figure)p Black 1579 w(109)p 0.00 0.00 0.70
+TeXcolorrgb 630 259 a(31)d(Stac)m(k)m(ed)k(Figures)f(and)g
+(Sub\014gures)p Black 1602 w(110)p 0.00 0.00 0.70 TeXcolorrgb
+766 372 a FQ(31.1)49 b(Stac)m(k)m(ed)32 b(Figures)p Black
+40 w(.)45 b(.)h(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)g(.)f(.)h
+(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)p
+Black 35 w(110)p Black 0.00 0.00 0.70 TeXcolorrgb 766
+485 a(31.2)j(Stac)m(k)m(ed)32 b(Sub\014gures)p Black
+61 w(.)46 b(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f
+(.)h(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)p
+Black 35 w(111)p Black 0.00 0.00 0.70 TeXcolorrgb 630
+689 a FL(32)32 b(The)j(sub\014g)h(pac)m(k)-6 b(age)p
+Black 2168 w(113)p 0.00 0.00 0.70 TeXcolorrgb 766 802
+a FQ(32.1)49 b(The)30 b(Sub\015oat)g(Command)p Black
+65 w(.)46 b(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)f
+(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)p Black 35 w(113)p
+Black 0.00 0.00 0.70 TeXcolorrgb 766 914 a(32.2)j(Customizing)31
+b FO(sub\014g)h FQ(with)e(captionsetup)h(Command)p Black
+77 w(.)46 b(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)p
+Black 35 w(113)p Black 0.00 0.00 0.70 TeXcolorrgb 766
+1027 a(32.3)j(The)30 b(Con)m(tin)m(uedFloat)j(Command)p
+Black 56 w(.)46 b(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)f(.)h(.)g
+(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)p Black 35 w(114)p Black
+0.00 0.00 0.70 TeXcolorrgb 630 1231 a FL(33)32 b(Con)m(tin)m(ued)j
+(Figures)g(and)g(Sub\014gures)p Black 1482 w(116)p 0.00 0.00 0.70
+TeXcolorrgb 766 1344 a FQ(33.1)49 b(Con)m(tin)m(ued)31
+b(Figures)p Black 77 w(.)46 b(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g
+(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)
+p Black 35 w(116)p Black 0.00 0.00 0.70 TeXcolorrgb
+766 1457 a(33.2)j(Con)m(tin)m(ued)31 b(Sub\014gures)p
+Black 28 w(.)45 b(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g
+(.)f(.)h(.)g(.)f(.)h(.)g(.)g(.)f(.)h(.)g(.)f(.)h(.)g(.)p
+Black 35 w(116)p Black 0.00 0.00 0.70 TeXcolorrgb 766
+1661 a FL(References)p Black 2547 w(120)p 0.00 0.00 0.70
+TeXcolorrgb 766 1865 a(Index)p Black 2778 w(122)p Black
+2272 5640 a FQ(8)p Black eop end
+%%Page: 9 9
+TeXDict begin 9 8 bop Black 0 TeXcolorgray Black Black
+630 -149 a FD(P)l(art)46 b(I)630 59 y FA(Bac)-5 b(kground)63
+b(Information)630 326 y FD(1)135 b(In)l(tro)t(duction)630
+529 y FQ(When)30 b(T)946 548 y(E)997 529 y(X)g(w)m(as)h(written,)h(P)m
+(ostScript/)p FJ(eps)p FQ(,)e FJ(jpeg)p FQ(,)h FJ(gif)p
+FQ(,)g(and)f(other)h(graphic)g(formats)g(did)p Black
+Black -3766 w FL(History)630 642 y FQ(not)26 b(exist.)39
+b(As)26 b(a)g(result,)g(Kn)m(uth's)f FJ(d)n(vi)g FQ(format)h(do)s(es)f
+(not)g(ha)m(v)m(e)i(direct)f(supp)s(ort)d(for)j(imp)s(orted)630
+755 y(graphics.)40 b(Ho)m(w)m(ev)m(er,)32 b(T)1466 774
+y(E)1516 755 y(X)d(allo)m(ws)i FJ(d)n(vi)e FQ(\014les)g(to)h(con)m
+(tain)h FM(\\special)c FQ(commands)h(whic)m(h)h(pass)630
+867 y(commands)h(to)h(programs)f(whic)m(h)h(use)f FJ(d)n(vi)g
+FQ(\014les.)41 b(This)30 b(allo)m(w)m(ed)i(T)2990 887
+y(E)3040 867 y(X)f(and)e(L)3339 851 y FP(A)3378 867 y
+FQ(T)3429 887 y(E)3480 867 y(X)h(to)i(imp)s(ort)630 980
+y(an)m(y)f(graphic)f(format)h(whic)m(h)f(is)g(supp)s(orted)f(b)m(y)h
+(the)h FJ(d)n(vi)f FQ(program)g(b)s(eing)g(used.)771
+1093 y(F)-8 b(or)30 b(man)m(y)f(y)m(ears,)i FJ(d)n(vi)e
+FQ(\014les)g(w)m(ere)h(usually)f(con)m(v)m(erted)h(to)g(P)m(ostScript)g
+(and)e(the)i(standard)630 1206 y(imp)s(orted-graphic)38
+b(format)g(w)m(as)g(Encapsulated)g(P)m(ostScript)g(\()p
+FJ(eps)p FQ(\),)h(whic)m(h)f(is)f(a)i(subset)e(of)630
+1319 y(the)42 b(P)m(ostScript)g(language.)75 b(Inserting)42
+b FJ(eps)e FQ(graphics)h(in)h(L)2804 1302 y FP(A)2843
+1319 y FQ(T)2894 1339 y(E)2944 1319 y(X)f(originally)i(required)e(the)
+630 1432 y(lo)m(w-lev)m(el)34 b FM(\\special)c FQ(command.)44
+b(T)-8 b(o)32 b(mak)m(e)h(graphic-insertion)f(easier)h(and)e(more)h(p)s
+(ortable,)630 1545 y(t)m(w)m(o)42 b(higher-lev)m(el)h(pac)m(k)-5
+b(ages)42 b FO(epsf)48 b FQ(and)40 b FO(ps\014g)i FQ(w)m(ere)f(written)
+g(for)g(L)3018 1528 y FP(A)3057 1545 y FQ(T)3108 1564
+y(E)3158 1545 y(X2.09.)74 b(In)40 b FO(epsf)6 b FQ(,)44
+b(the)630 1658 y(graphics)25 b(insertion)g(w)m(as)h(done)f(b)m(y)f(the)
+i FM(\\epsfbox)d FQ(command,)j(while)f(three)g(other)g(commands)630
+1771 y(con)m(trolled)j(graphic)e(scaling.)40 b(In)26
+b FO(ps\014g)q FQ(,)h(the)g FM(\\psfig)d FQ(command)i(not)g(only)h
+(inserted)f(graphics,)630 1884 y(it)g(also)g(scaled)g(and)f(rotated)h
+(them.)39 b(While)26 b(the)f FO(ps\014g)i FQ(syn)m(tax)e(w)m(as)h(p)s
+(opular,)f(its)h(co)s(de)f(w)m(as)h(not)630 1997 y(as)31
+b(robust)e(as)i FO(epsf)6 b FQ(.)41 b(As)30 b(a)h(result,)f(the)h
+FO(eps\014g)h FQ(pac)m(k)-5 b(age)32 b(w)m(as)f(created)g(as)g(a)f(h)m
+(ybrid)g(of)g(the)h(t)m(w)m(o)630 2109 y(graphics)36
+b(pac)m(k)-5 b(ages,)40 b(with)d(its)f FM(\\epsfig)f
+FQ(command)h(using)g(the)g FM(\\psfig)f FQ(syn)m(tax)i(and)f(m)m(uc)m
+(h)630 2222 y(of)h(the)g(more-robust)g FM(\\epsfbox)e
+FQ(co)s(de.)61 b(Unfortunately)-8 b(,)40 b FM(\\epsfig)35
+b FQ(still)j(used)e(some)i(of)f(the)630 2335 y(less-robust)30
+b FM(\\psfig)f FQ(co)s(de.)771 2448 y(With)43 b(the)f(release)h(of)f(L)
+1630 2431 y FP(A)1669 2448 y FQ(T)1720 2468 y(E)1770
+2448 y(X)14 b(2)1897 2462 y Fz(")1986 2448 y FQ(in)41
+b(1994,)47 b(the)42 b(L)2547 2431 y FP(A)2586 2448 y
+FQ(T)2637 2468 y(E)2688 2448 y(X3)g(team)h(addressed)e(the)h(general)p
+Black Black -3680 w FL(L)304 2431 y FI(A)350 2448 y FL(T)406
+2468 y(E)461 2448 y(X)131 2561 y(Graphics)214 2674 y(Bundle)630
+2561 y FQ(problem)31 b(of)h(inserting)h(graphics)e(in)h(L)1959
+2544 y FP(A)1998 2561 y FQ(T)2049 2581 y(E)2099 2561
+y(X.)46 b(Their)31 b(e\013orts)i(pro)s(duced)d(the)i(\\L)3390
+2544 y FP(A)3429 2561 y FQ(T)3480 2581 y(E)3531 2561
+y(X)g(graphics)630 2674 y(bundle)899 2641 y FP(1)975
+2674 y FQ(whic)m(h)37 b(con)m(tains)i(totally)h(re-written)e(commands)g
+(that)g(are)g(more)g(e\016cien)m(t,)k(more)630 2787 y(robust,)30
+b(and)g(more)g(p)s(ortable)g(than)h(other)f(graphics-insertion)h
+(commands.)771 2900 y(The)20 b(graphics)h(bundle)e(con)m(tains)i(the)g
+(\\standard")g FO(graphics)f FQ(pac)m(k)-5 b(age)23 b(and)c(the)i
+(\\extended")630 3013 y FO(graphicx)41 b FQ(pac)m(k)-5
+b(age.)74 b(While)41 b(b)s(oth)f(pac)m(k)-5 b(ages)43
+b(con)m(tain)f(an)f FM(\\includegraphics)36 b FQ(command,)630
+3126 y(the)c(pac)m(k)-5 b(ages)33 b(con)m(tain)g Fy(di\013er)-5
+b(ent)41 b FQ(v)m(ersions)31 b(of)39 b FM(\\includegraphics)p
+FQ(.)h(The)31 b FO(graphicx)g FQ(v)m(ersion)630 3239
+y(uses)26 b(\\named)g(argumen)m(ts")g(\(similar)h(to)g(the)f
+FM(\\psfig)e FQ(syn)m(tax\))j(whic)m(h,)g(although)g(con)m(v)m(enien)m
+(t,)630 3351 y(violate)41 b(the)e(L)1123 3335 y FP(A)1162
+3351 y FQ(T)1213 3371 y(E)1263 3351 y(X)g(syn)m(tax)g(guidelines)h
+(whic)m(h)e(require)h(that)g(optional)h(argumen)m(ts)f(b)s(e)f(p)s(o-)
+630 3464 y(sitional.)63 b(As)38 b(a)g(compromise,)h(t)m(w)m(o)g(v)m
+(ersions)f(of)45 b FM(\\includegraphics)33 b FQ(w)m(ere)38
+b(written,)h(with)630 3577 y(the)30 b FO(graphics)f FQ(pac)m(k)-5
+b(age)32 b(follo)m(wing)f(the)e(L)2026 3561 y FP(A)2065
+3577 y FQ(T)2116 3597 y(E)2167 3577 y(X)g(syn)m(tax)h(guidelines)g(and)
+f(the)g FO(graphicx)h FQ(pac)m(k)-5 b(age)630 3690 y(using)29
+b(the)g(more-con)m(v)m(enien)m(t)j(named)d(argumen)m(ts.)40
+b(The)29 b FO(graphicx)g FM(\\includegraphics)c FQ(sup-)630
+3803 y(p)s(orts)35 b(scaling)i(and)e(rotating,)j(but)d(the)h
+FO(graphics)g FM(\\includegraphics)31 b FQ(command)k(m)m(ust)h(b)s(e)
+630 3916 y(nested)30 b(inside)g FM(\\rotatebox)e FQ(or)i
+FM(\\scalebox)e FQ(commands)i(to)h(pro)s(duce)f(rotating)h(or)g
+(scaling.)771 4029 y(This)i(do)s(cumen)m(t)g(uses)g(the)h
+FO(graphicx)f FQ(pac)m(k)-5 b(age)36 b(b)s(ecause)d(its)h(syn)m(tax)g
+(is)f(more)h(con)m(v)m(enien)m(t)630 4142 y(than)28 b(the)g
+FO(graphics)h FQ(syn)m(tax.)40 b(Since)29 b(b)s(oth)e(pac)m(k)-5
+b(ages)30 b(ha)m(v)m(e)g(the)e(same)h(capabilities,)i(the)d(exam-)630
+4255 y(ples)f(in)h(this)f(do)s(cumen)m(t)h(can)f(also)i(b)s(e)e(p)s
+(erformed)f(with)h(the)h FO(graphics)f FQ(pac)m(k)-5
+b(age,)31 b(although)d(the)630 4368 y(resulting)37 b(syn)m(tax)h(ma)m
+(y)g(b)s(e)e(more)h(cum)m(b)s(ersome)g(and)g(sligh)m(tly)h(less)g
+(e\016cien)m(t.)62 b(F)-8 b(or)38 b(a)f(more-)630 4481
+y(detailed)31 b(description)g(of)f(the)h(pac)m(k)-5 b(ages,)32
+b(see)f(the)g(graphics)f(bundle)f(do)s(cumen)m(tation)j([)p
+0.05 1.00 1.00 0.40 TeXcolorcmyk(7)p Black(].)771
+4593 y(F)-8 b(or)30 b(bac)m(kw)m(ard-compatibilit)m(y)-8
+b(,)33 b(the)c(graphics)g(bundle)f(also)i(includes)e(the)h
+FO(eps\014g)i FQ(pac)m(k)-5 b(age)630 4706 y(whic)m(h)43
+b(replaces)h(the)g(original)g(L)1795 4690 y FP(A)1834
+4706 y FQ(T)1885 4726 y(E)1936 4706 y(X)14 b(2)2063 4720
+y Fz(")2153 4706 y FO(eps\014g)45 b FQ(pac)m(k)-5 b(age.)82
+b(The)43 b(new)f FO(eps\014g)j FQ(pac)m(k)-5 b(age)46
+b(de-)630 4819 y(\014nes)30 b(the)h FM(\\epsfbox)p FQ(,)e
+FM(\\psfig)p FQ(,)g(and)h FM(\\epsfig)f FQ(commands)h(as)h(wrapp)s(ers)
+e(whic)m(h)h(simply)h(call)630 4932 y(the)37 b FM(\\includegraphics)32
+b FQ(command.)59 b(Since)36 b(these)h(wrapp)s(ers)e(are)i(less)f
+(e\016cien)m(t)i(than)f(the)630 5045 y(straigh)m(t)g
+FM(\\includegraphics)32 b FQ(command,)38 b(the)e(wrapp)s(ed)f(pac)m(k)
+-5 b(aged)38 b(should)d(b)s(e)g(used)h(only)p Black 630
+5143 1332 4 v 734 5233 a FF(1)768 5265 y FG(Note)21 b(that)f(there)g
+(is)h(a)f(plain)h(T)1660 5281 y(E)1703 5265 y(X)f(v)n(ersion)h(of)g
+(the)f(L)2266 5248 y FF(A)2299 5265 y FG(T)2341 5281
+y(E)2385 5265 y(X)g(graphics)h(bundle.)32 b(See)20 b(the)g(\014les)h
+(in)f(the)g(directory)p 0.05 1.00 1.00 0.40 TeXcolorcmyk
+630 5356 a FE(CTAN/macros/plain/graphics/)p Black Black
+Black 2272 5640 a FQ(9)p Black eop end
+%%Page: 10 10
+TeXDict begin 10 9 bop Black 0 TeXcolorgray Black Black
+630 -149 a FQ(for)30 b(old)h(do)s(cumen)m(ts,)f(with)g
+FM(\\includegraphics)c FQ(used)k(for)g(all)h(new)f(do)s(cumen)m(ts.)771
+-36 y(In)f(addition)h(to)h(impro)m(ving)g FJ(eps)e FQ
+(graphics-inclusion,)h(the)g(L)2913 -52 y FP(A)2952 -36
+y FQ(T)3003 -16 y(E)3054 -36 y(X)g(graphics)g(bundle)e(also)p
+Black Black -3844 w FL(Non-EPS)131 77 y(Graphics)91 b
+FQ(addressed)27 b(the)i(problem)e(of)i(including)f(non-)p
+FJ(eps)e FQ(graphic)j(formats)f(suc)m(h)g(as)g FJ(jpeg)g
+FQ(and)f FJ(gif)p FQ(.)630 190 y(Since)21 b FJ(d)n(vi)p
+FQ(-to-)p FJ(ps)h FQ(con)m(v)m(erters)g(generally)h(did)d(not)h(supp)s
+(ort)e(direct)j(inclusion)f(of)g(most)g(non-)p FJ(eps)630
+303 y FQ(formats,)28 b(inserting)g(these)g(graphics)f(in)m(to)h(P)m
+(ostScript)g(do)s(cumen)m(ts)f(required)f(the)i(graphics)f(to)630
+416 y(b)s(e)h(con)m(v)m(erted)j(in)m(to)f FJ(eps)d FQ(ahead)j(of)f
+(time.)41 b(While)29 b(this)g(ahead-of-time)i(con)m(v)m(ersion)f(is)f
+(usually)630 529 y(still)46 b(the)f(b)s(est)f(approac)m(h,)49
+b(the)c(graphics)g(bundle)f(pro)m(vided)g(another)h(option:)71
+b(on-the-\015y)630 642 y(graphics)39 b(con)m(v)m(ersion)h(b)m(y)e(the)h
+FJ(d)n(vi)p FQ(-to-)p FJ(ps)g FQ(con)m(v)m(erter.)67
+b(Section)p 0.05 1.00 1.00 0.40 TeXcolorcmyk 40 w(6.2)p
+Black 39 w(on)39 b(page)p 0.05 1.00 1.00 0.40 TeXcolorcmyk
+39 w(17)p Black 40 w(describ)s(es)630 755 y(graphics-con)m(v)m(ersion)
+29 b(programs)f(while)g(Section)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 28 w(14)p Black 29 w(on)g(page)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 28 w(42)p Black 29 w(describ)s(es)f(ho)m(w)h(to)h(use)e
+(non-)630 868 y FJ(eps)i FQ(graphics)h(with)g FJ(d)n(vi)p
+FQ(-to-)p FJ(ps)i FQ(con)m(v)m(erters.)771 980 y(When)42
+b(P)m(ostScript)g(w)m(as)g(the)g(con)m(v)m(en)m(tional)j(\014nal)c
+(format)h(for)g(L)3089 964 y FP(A)3128 980 y FQ(T)3179
+1000 y(E)3229 980 y(X)g(do)s(cumen)m(ts,)j(the)p Black
+Black -3761 w FL(p)s(dfT)406 1001 y(E)461 980 y(X)630
+1093 y FQ(pro)s(cess)28 b(w)m(as)h(a)g(t)m(w)m(o-step)h(pro)s(cedure:)
+39 b(\(1\))30 b(L)2180 1077 y FP(A)2219 1093 y FQ(T)2270
+1113 y(E)2320 1093 y(X)f(w)m(as)g(used)e(to)j(create)g(a)f
+FJ(d)n(vi)g FQ(\014le,)g(and)f(\(2\))i(a)630 1206 y FJ(d)n(vi)p
+FQ(-to-)p FJ(ps)c FQ(pro)s(cessor)f(\(suc)m(h)g(as)h
+FM(dvips)p FQ(\))e(w)m(as)h(used)g(to)h(create)h(a)e(P)m(ostScript)h
+(\014le.)39 b(The)25 b(adv)m(en)m(t)630 1319 y(and)i(subsequen)m(t)f(p)
+s(opularit)m(y)h(of)h(Adob)s(e's)e FJ(pdf)i FQ(format)f(initially)i
+(added)e(a)g(third)f(step)i(to)g(the)630 1432 y(con)m(v)m(en)m(tional)
+41 b(pro)s(cess:)55 b(\(3\))39 b(a)g(to)s(ol)g(suc)m(h)e(as)h
+(Ghostscript)2752 1399 y FP(2)2792 1432 y FQ(,)i(Adob)s(e)e(Acrobat)
+3473 1399 y FP(3)3513 1432 y FQ(,)i(or)e(PStill)3920
+1399 y FP(4)630 1545 y FQ(w)m(as)31 b(used)e(to)i(con)m(v)m(ert)h(the)f
+(P)m(ostScript)g(\014le)f(to)h FJ(pdf)p FQ(.)771 1658
+y(Ho)m(w)m(ev)m(er,)36 b(not)d(only)g(w)m(as)g(this)g(three-step)h(L)
+2341 1641 y FP(A)2380 1658 y FQ(T)2431 1677 y(E)2481
+1658 y(X-)p FM(dvips)p FQ(-ghostscript)f(pro)s(cess)g(cum)m(b)s(er-)630
+1771 y(some,)41 b(it)d(made)g(certain)h FJ(pdf)g FQ(features)f(suc)m(h)
+g(as)g(h)m(yp)s(erlinks)f(di\016cult)h(to)h(implemen)m(t.)64
+b(T)-8 b(o)630 1884 y(correct)32 b(this,)f(H\022)-45
+b(an)31 b(Th)m(^)-43 b(e)1443 1864 y(\023)1519 1884 y(Th\022)e(anh)30
+b(wrote)h(a)g(to)s(ol)h(called)g(T)2636 1903 y(E)2686
+1884 y(X2)p FJ(pdf)g FQ(whic)m(h)e(mo)s(di\014ed)g(the)h(T)3842
+1903 y(E)3892 1884 y(X)630 1997 y(engine)36 b(to)f(pro)s(duce)f
+FJ(pdf)i FQ(\014les)f(directly)g(from)g(T)2384 2016 y(E)2434
+1997 y(X.)55 b(T)2633 2016 y(E)2683 1997 y(X2)p FJ(pdf)36
+b FQ(w)m(as)f(ev)m(en)m(tually)i(renamed)630 2110 y(p)s(dfT)814
+2129 y(E)862 2110 y(X)31 b(and,)g(with)g(the)g(help)g(of)g(man)m(y)g(v)
+m(olun)m(teers)h(\(and)f(the)h(blessing)f(of)g(Donald)g(Kn)m(uth\),)630
+2222 y(w)m(as)j(extended)g(to)g(implemen)m(t)g(the)g(full)g(t)m(yp)s
+(esetting)h(capabilities)g(of)f(T)3197 2242 y(E)3247
+2222 y(X.)51 b(While)35 b(p)s(dfT)3844 2242 y(E)3892
+2222 y(X)630 2335 y(nominally)f(outputs)g FJ(pdf)p FQ(,)h(it)f(also)h
+(has)e(the)h(capabilit)m(y)i(of)e(outputting)g(the)g(same)g
+FJ(d)n(vi)g FQ(that)630 2448 y(w)m(ould)c(b)s(e)g(pro)s(duced)f(b)m(y)h
+(T)1593 2468 y(E)1643 2448 y(X.)771 2561 y(Just)d(as)g(the)g
+FM(latex)f FQ(command)h(uses)f(T)2145 2581 y(E)2195 2561
+y(X)i(to)f(pro)s(cess)g(L)2736 2544 y FP(A)2775 2561
+y FQ(T)2826 2581 y(E)2876 2561 y(X)h(do)s(cumen)m(ts)e(in)m(to)i
+FJ(d)n(vi)g FQ(\014les,)630 2674 y(the)i(command)f FM(pdflatex)e
+FQ(uses)i(p)s(dfT)1986 2694 y(E)2035 2674 y(X)g(to)i(pro)s(cess)e(L)
+2583 2657 y FP(A)2622 2674 y FQ(T)2673 2694 y(E)2723
+2674 y(X)h(do)s(cumen)m(ts)f(directly)h(in)m(to)h FJ(pdf)630
+2787 y FQ(\014les.)771 2900 y(An)39 b(imp)s(ortan)m(t)g(asp)s(ect)g(of)
+h(p)s(dfT)1953 2919 y(E)2001 2900 y(X)f(is)g(its)h(nativ)m(e)g
+(inclusion)f(of)g(a)g(v)-5 b(ariet)m(y)41 b(of)e(graphics)p
+Black Black -3963 w FL(p)s(dfT)204 2920 y(E)259 2900
+y(X)c(and)131 3013 y(Graphics)91 b FQ(formats:)39 b FJ(jpeg)p
+FQ(,)28 b FJ(png)p FQ(,)g FJ(pdf)p FQ(,)g(MetaP)m(ost.)42
+b(Although)28 b(older)g(v)m(ersions)f(of)h(p)s(dfT)3419
+3032 y(E)3467 3013 y(X)g(supp)s(orted)630 3126 y(nativ)m(e)j(inclusion)
+e(of)37 b FJ(tiff)30 b FQ(\014les,)g(the)g(curren)m(t)f(v)m(ersion)h
+(of)f(p)s(dfT)2887 3145 y(E)2936 3126 y(X)g(do)s(es)h
+Fy(not)38 b FQ(supp)s(ort)28 b FJ(tiff)p FQ(.)771 3239
+y(Also)d(note)g(that)g(p)s(dfT)1541 3258 y(E)1589 3239
+y(X)g(cannot)g(not)f(directly)h(imp)s(ort)f FJ(eps)f
+FQ(\014les)3082 3206 y FP(5)3121 3239 y FQ(,)j(whic)m(h)e(requires)g
+(users)630 3352 y(with)e FJ(eps)f FQ(\014les)h(to)h(use)f(a)g(program)g
+(lik)m(e)i FM(epstopdf)c FQ(whic)m(h)i(con)m(v)m(erts)h
+FJ(eps)e FQ(\014les)h(to)h FJ(pdf)f FQ(format,)630 3464
+y(although)31 b(this)f(prev)m(en)m(ts)h(the)f(direct)h(use)f(of)38
+b FJ(ps)p FQ(frag)30 b(\(see)h(Section)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 31 w(15)p Black 31 w(on)g(page)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 31 w(45)p Black(\).)630 3751 y FD(2)135
+b(L)865 3726 y Fx(A)917 3751 y FD(T)989 3777 y(E)1059
+3751 y(X)44 b(T)-11 b(erminology)630 3954 y FQ(A)32 b
+Fy(b)-5 b(ox)45 b FQ(is)32 b(an)m(y)h(L)1191 3937 y FP(A)1230
+3954 y FQ(T)1281 3973 y(E)1331 3954 y(X)f(ob)5 b(ject)34
+b(\(c)m(haracters,)h(graphics,)e(etc.\))48 b(that)33
+b(is)f(treated)i(as)e(a)h(unit)f(\(see)630 4067 y([)p
+0.05 1.00 1.00 0.40 TeXcolorcmyk(1)p Black 1 w(,)38
+b(page)f(103]\).)60 b(Eac)m(h)37 b(b)s(o)m(x)f(has)g(a)g
+Fy(r)-5 b(efer)g(enc)g(e)39 b(p)-5 b(oint)46 b FQ(on)37
+b(its)f(left)h(side.)58 b(The)36 b(b)s(o)m(x's)g Fy(b)-5
+b(aseline)630 4180 y FQ(is)34 b(a)h(horizon)m(tal)h(line)f(whic)m(h)f
+(passes)g(through)g(the)g(reference)h(p)s(oin)m(t)g(\(see)g(Figure)p
+0.05 1.00 1.00 0.40 TeXcolorcmyk 35 w(1)p Black(\).)53
+b(When)630 4293 y(L)654 4276 y FP(A)693 4293 y FQ(T)744
+4312 y(E)794 4293 y(X)45 b(forms)e(lines)i(of)g(text,)k(c)m(haracters)c
+(are)g(placed)g(left-to-righ)m(t)i(with)d(their)g(reference)630
+4405 y(p)s(oin)m(ts)23 b(aligned)i(on)e(a)h(horizon)m(tal)h(line)f
+(called)h(the)f Fy(curr)-5 b(ent)27 b(b)-5 b(aseline)p
+FQ(,)26 b(aligning)e(the)g(c)m(haracters')630 4518 y(baselines)34
+b(with)g(the)g(curren)m(t)g(baseline.)52 b(L)2118 4502
+y FP(A)2157 4518 y FQ(T)2208 4538 y(E)2259 4518 y(X)34
+b(follo)m(ws)h(the)f(same)g(pro)s(cess)g(for)g(t)m(yp)s(esetting)630
+4631 y(graphics)29 b(or)g(other)h(ob)5 b(jects;)30 b(the)g(reference)f
+(p)s(oin)m(t)g(of)h(eac)m(h)g(ob)5 b(ject)30 b(is)f(placed)h(on)f(the)g
+(curren)m(t)630 4744 y(baseline.)p Black 630 4822 1332
+4 v 734 4912 a FF(2)768 4943 y FG(F)-6 b(ree)26 b(soft)n(w)n(are,)i
+(see)e(Section)p 0.05 1.00 1.00 0.40 TeXcolorcmyk
+26 w(6.1)p Black 26 w(on)g(page)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 26 w(17)p Black(.)734 5039 y FF(3)768 5070
+y FG(Commercial)i(soft)n(w)n(are,)g(see)e FE(www.adobe.com)734
+5166 y FF(4)768 5197 y FG(Sharew)n(are,)h(see)f FE(www.pstill.com)734
+5293 y FF(5)768 5325 y FG(p)r(dfT)921 5341 y(E)964 5325
+y(X)g Fw(c)l(an)32 b FG(directly)26 b(imp)r(ort)g FJ(eps)e
+FG(\014les)i(pro)r(cessed)g(b)n(y)f(PurifyEPS,)i(see)f(Section)p
+0.05 1.00 1.00 0.40 TeXcolorcmyk 26 w(5.5)p Black
+26 w(on)g(page)p 0.05 1.00 1.00 0.40 TeXcolorcmyk
+26 w(17)p Black(.)p Black Black 2250 5640 a FQ(10)p Black
+eop end
+%%Page: 11 11
+TeXDict begin 11 10 bop Black 0 TeXcolorgray Black Black
+Black 1679 960 a @beginspecial 0 @llx 0 @lly 155 @urx
+151 @ury 1440 @rhi @setspecial
+%%BeginDocument: box1.eps
+%!PS-Adobe-2.0 EPSF-2.0
+%%Title: box1.fig
+%%Creator: fig2dev Version 3.2 Patchlevel 4
+%%CreationDate: Sun May 22 21:17:17 2005
+%%For: epstein@linux (Becky Epstein)
+%%BoundingBox: 0 0 155 151
+%%Magnification: 1.0000
+%%EndComments
+/$F2psDict 200 dict def
+$F2psDict begin
+$F2psDict /mtrx matrix put
+/col-1 {0 setgray} bind def
+/col0 {0.000 0.000 0.000 srgb} bind def
+/col1 {0.000 0.000 1.000 srgb} bind def
+/col2 {0.000 1.000 0.000 srgb} bind def
+/col3 {0.000 1.000 1.000 srgb} bind def
+/col4 {1.000 0.000 0.000 srgb} bind def
+/col5 {1.000 0.000 1.000 srgb} bind def
+/col6 {1.000 1.000 0.000 srgb} bind def
+/col7 {1.000 1.000 1.000 srgb} bind def
+/col8 {0.000 0.000 0.560 srgb} bind def
+/col9 {0.000 0.000 0.690 srgb} bind def
+/col10 {0.000 0.000 0.820 srgb} bind def
+/col11 {0.530 0.810 1.000 srgb} bind def
+/col12 {0.000 0.560 0.000 srgb} bind def
+/col13 {0.000 0.690 0.000 srgb} bind def
+/col14 {0.000 0.820 0.000 srgb} bind def
+/col15 {0.000 0.560 0.560 srgb} bind def
+/col16 {0.000 0.690 0.690 srgb} bind def
+/col17 {0.000 0.820 0.820 srgb} bind def
+/col18 {0.560 0.000 0.000 srgb} bind def
+/col19 {0.690 0.000 0.000 srgb} bind def
+/col20 {0.820 0.000 0.000 srgb} bind def
+/col21 {0.560 0.000 0.560 srgb} bind def
+/col22 {0.690 0.000 0.690 srgb} bind def
+/col23 {0.820 0.000 0.820 srgb} bind def
+/col24 {0.500 0.190 0.000 srgb} bind def
+/col25 {0.630 0.250 0.000 srgb} bind def
+/col26 {0.750 0.380 0.000 srgb} bind def
+/col27 {1.000 0.500 0.500 srgb} bind def
+/col28 {1.000 0.630 0.630 srgb} bind def
+/col29 {1.000 0.750 0.750 srgb} bind def
+/col30 {1.000 0.880 0.880 srgb} bind def
+/col31 {1.000 0.840 0.000 srgb} bind def
+
+end
+save
+newpath 0 151 moveto 0 0 lineto 155 0 lineto 155 151 lineto closepath clip newpath
+-39.1 184.0 translate
+1 -1 scale
+
+/cp {closepath} bind def
+/ef {eofill} bind def
+/gr {grestore} bind def
+/gs {gsave} bind def
+/sa {save} bind def
+/rs {restore} bind def
+/l {lineto} bind def
+/m {moveto} bind def
+/rm {rmoveto} bind def
+/n {newpath} bind def
+/s {stroke} bind def
+/sh {show} bind def
+/slc {setlinecap} bind def
+/slj {setlinejoin} bind def
+/slw {setlinewidth} bind def
+/srgb {setrgbcolor} bind def
+/rot {rotate} bind def
+/sc {scale} bind def
+/sd {setdash} bind def
+/ff {findfont} bind def
+/sf {setfont} bind def
+/scf {scalefont} bind def
+/sw {stringwidth} bind def
+/tr {translate} bind def
+/tnt {dup dup currentrgbcolor
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb}
+ bind def
+/shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul
+ 4 -2 roll mul srgb} bind def
+ /DrawEllipse {
+ /endangle exch def
+ /startangle exch def
+ /yrad exch def
+ /xrad exch def
+ /y exch def
+ /x exch def
+ /savematrix mtrx currentmatrix def
+ x y tr xrad yrad sc 0 0 1 startangle endangle arc
+ closepath
+ savematrix setmatrix
+ } def
+
+/$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def
+/$F2psEnd {$F2psEnteredState restore end} def
+
+$F2psBegin
+10 setmiterlimit
+0 slj 0 slc
+ 0.06000 0.06000 sc
+%
+% Fig objects follow
+%
+%
+% here starts figure with depth 1
+% Polyline
+15.000 slw
+n 3210 3045 m 1935 3045 l 1935 945 l 3210 945 l
+ cp gs 0.95 setgray ef gr gs col-1 s gr
+% Ellipse
+7.500 slw
+n 1935 2295 75 75 0 360 DrawEllipse gs 0.00 setgray ef gr gs col-1 s gr
+
+% Polyline
+n 1860 945 m
+ 810 945 l gs col-1 s gr
+% Polyline
+n 1860 3045 m
+ 810 3045 l gs col-1 s gr
+% Polyline
+n 1785 2295 m
+ 1485 2295 l gs col-1 s gr
+% Polyline
+n 1935 570 m
+ 1935 870 l gs col-1 s gr
+% Polyline
+n 3210 570 m
+ 3210 870 l gs col-1 s gr
+% Polyline
+gs clippath
+1072 930 m 997 930 l 997 1131 l 1035 963 l 1072 1131 l cp
+eoclip
+n 1035 1845 m
+ 1035 945 l gs col-1 s gr gr
+
+% arrowhead
+n 1072 1131 m 1035 963 l 997 1131 l 1035 1098 l 1072 1131 l
+ cp gs 0.00 setgray ef gr col-1 s
+% Polyline
+gs clippath
+1672 930 m 1597 930 l 1597 1131 l 1635 963 l 1672 1131 l cp
+eoclip
+n 1635 1470 m
+ 1635 945 l gs col-1 s gr gr
+
+% arrowhead
+n 1672 1131 m 1635 963 l 1597 1131 l 1635 1098 l 1672 1131 l
+ cp gs 0.00 setgray ef gr col-1 s
+% Polyline
+gs clippath
+1597 3060 m 1672 3060 l 1672 2858 l 1635 3027 l 1597 2858 l cp
+eoclip
+n 1635 2765 m
+ 1635 3045 l gs col-1 s gr gr
+
+% arrowhead
+n 1597 2858 m 1635 3027 l 1672 2858 l 1635 2892 l 1597 2858 l
+ cp gs 0.00 setgray ef gr col-1 s
+% Polyline
+gs clippath
+1597 2310 m 1672 2310 l 1672 2108 l 1635 2277 l 1597 2108 l cp
+eoclip
+n 1635 2295 m
+ 1635 1770 l gs col-1 s gr gr
+
+% arrowhead
+n 1597 2108 m 1635 2277 l 1672 2108 l 1635 2142 l 1597 2108 l
+ cp gs 0.00 setgray ef gr col-1 s
+% Polyline
+gs clippath
+1672 2280 m 1597 2280 l 1597 2481 l 1635 2313 l 1672 2481 l cp
+eoclip
+n 1635 2565 m
+ 1635 2295 l gs col-1 s gr gr
+
+% arrowhead
+n 1672 2481 m 1635 2313 l 1597 2481 l 1635 2448 l 1672 2481 l
+ cp gs 0.00 setgray ef gr col-1 s
+% Polyline
+ [60] 0 sd
+n 1935 2295 m
+ 3210 2295 l gs col-1 s gr [] 0 sd
+% Polyline
+gs clippath
+1941 2224 m 2000 2269 l 2123 2109 l 1991 2221 l 2063 2063 l cp
+eoclip
+n 2250 1880 m
+ 1980 2235 l gs col-1 s gr gr
+
+% arrowhead
+n 2063 2063 m 1991 2221 l 2123 2109 l 2072 2113 l 2063 2063 l
+ cp gs 0.00 setgray ef gr col-1 s
+% Polyline
+gs clippath
+2477 2285 m 2404 2305 l 2457 2499 l 2450 2327 l 2530 2480 l cp
+eoclip
+n 2550 2700 m
+ 2445 2310 l gs col-1 s gr gr
+
+% arrowhead
+n 2530 2480 m 2450 2327 l 2457 2499 l 2485 2457 l 2530 2480 l
+ cp gs 0.00 setgray ef gr col-1 s
+% Polyline
+gs clippath
+997 3060 m 1072 3060 l 1072 2858 l 1035 3027 l 997 2858 l cp
+eoclip
+n 1035 2145 m
+ 1035 3045 l gs col-1 s gr gr
+
+% arrowhead
+n 997 2858 m 1035 3027 l 1072 2858 l 1035 2892 l 997 2858 l
+ cp gs 0.00 setgray ef gr col-1 s
+% Polyline
+gs clippath
+1924 692 m 1925 767 l 2127 766 l 1958 730 l 2126 691 l cp
+eoclip
+n 2306 727 m
+ 1940 730 l gs col-1 s gr gr
+
+% arrowhead
+n 2126 691 m 1958 730 l 2127 766 l 2092 728 l 2126 691 l
+ cp gs 0.00 setgray ef gr col-1 s
+% Polyline
+gs clippath
+3219 762 m 3220 687 l 3018 685 l 3187 725 l 3017 760 l cp
+eoclip
+n 2856 721 m
+ 3205 725 l gs col-1 s gr gr
+
+% arrowhead
+n 3017 760 m 3187 725 l 3018 685 l 3052 723 l 3017 760 l
+ cp gs 0.00 setgray ef gr col-1 s
+/Times-Roman ff 180.00 scf sf
+2100 1800 m
+gs 1 -1 sc (Reference) col-1 sh gr
+/Times-Roman ff 180.00 scf sf
+2305 1990 m
+gs 1 -1 sc (Point) col-1 sh gr
+/Times-Roman ff 180.00 scf sf
+2577 2829 m
+gs 1 -1 sc (Baseline) dup sw pop 2 div neg 0 rm col-1 sh gr
+/Times-Roman ff 180.00 scf sf
+1029 2040 m
+gs 1 -1 sc (totalheight) dup sw pop 2 div neg 0 rm col-1 sh gr
+/Times-Roman ff 180.00 scf sf
+1632 1642 m
+gs 1 -1 sc (height) dup sw pop 2 div neg 0 rm col-1 sh gr
+/Times-Roman ff 180.00 scf sf
+1635 2694 m
+gs 1 -1 sc (depth) dup sw pop 2 div neg 0 rm col-1 sh gr
+/Times-Roman ff 180.00 scf sf
+2588 765 m
+gs 1 -1 sc (width) dup sw pop 2 div neg 0 rm col-1 sh gr
+% here ends figure;
+$F2psEnd
+rs
+showpage
+
+%%EndDocument
+ @endspecial 1728 1156 a FQ(Figure)31 b(1:)p 0 TeXcolorgray
+Black 41 w(Sample)f(L)2468 1139 y FP(A)2507 1156 y FQ(T)2558
+1176 y(E)2608 1156 y(X)h(Bo)m(x)p Black 771 1441 a(The)39
+b(size)i(of)f(eac)m(h)h(b)s(o)m(x)f(is)f(describ)s(ed)g(b)m(y)h(three)g
+(lengths:)59 b Fy(height)p FQ(,)43 b Fy(depth)p FQ(,)h
+Fy(width)p FQ(.)70 b(The)630 1554 y Fy(height)43 b FQ(is)35
+b(the)f(distance)h(from)e(the)i(reference)f(p)s(oin)m(t)h(to)f(the)h
+(top)f(of)g(the)h(b)s(o)m(x.)52 b(The)33 b Fy(depth)43
+b FQ(is)630 1667 y(the)37 b(distance)h(from)f(the)h(reference)f(p)s
+(oin)m(t)h(to)g(the)f(b)s(ottom)h(of)f(the)h(b)s(o)m(x.)61
+b(The)37 b Fy(width)45 b FQ(is)38 b(the)630 1780 y(width)31
+b(of)g(the)h(b)s(o)m(x.)43 b(The)31 b Fy(totalheight)42
+b FQ(is)32 b(de\014ned)e(as)h(the)h(distance)g(from)f(the)g(b)s(ottom)h
+(of)g(the)630 1893 y(b)s(o)m(x)e(to)h(the)g(top)g(of)f(the)h(b)s(o)m
+(x,)f(or)g(totalheigh)m(t=heigh)m(t+depth.)771 2006 y(The)g(reference)g
+(p)s(oin)m(t)g(of)g(a)g(non-rotated)h FJ(eps)d FQ(graphic)i(is)g(its)g
+(lo)m(w)m(er-left)j(corner)c(\(see)i(left)630 2118 y(b)s(o)m(x)37
+b(in)f(Figure)p 0.05 1.00 1.00 0.40 TeXcolorcmyk 38
+w(2)p Black(\),)j(giving)f(it)f(zero)h(depth)e(and)g(making)h(its)h
+(totalheigh)m(t)h(equal)f(its)f(heigh)m(t.)630 2231 y(The)27
+b(middle)g(b)s(o)m(x)h(in)f(Figure)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 28 w(2)p Black 28 w(sho)m(ws)g(a)h(rotated)h(graphic)e
+(where)h(the)f(heigh)m(t)i(is)e(not)h(equal)g(to)630
+2344 y(the)h(totalheigh)m(t.)43 b(The)29 b(righ)m(t)h(b)s(o)m(x)f(in)f
+(Figure)p 0.05 1.00 1.00 0.40 TeXcolorcmyk 30 w(2)p
+Black 29 w(sho)m(ws)h(a)h(rotated)g(graphic)f(where)g(the)g(heigh)m(t)
+630 2457 y(is)h(zero.)p Black 630 4145 a @beginspecial
+0 @llx 0 @lly 519 @urx 248 @ury 3996 @rwi @setspecial
+%%BeginDocument: box2.eps
+%!PS-Adobe-2.0 EPSF-2.0
+%%Title: box2.fig
+%%Creator: fig2dev Version 3.2 Patchlevel 4
+%%CreationDate: Sun May 22 21:38:32 2005
+%%For: epstein@linux (Becky Epstein)
+%%BoundingBox: 0 0 519 248
+%%Magnification: 1.0000
+%%EndComments
+/$F2psDict 200 dict def
+$F2psDict begin
+$F2psDict /mtrx matrix put
+/col-1 {0 setgray} bind def
+/col0 {0.000 0.000 0.000 srgb} bind def
+/col1 {0.000 0.000 1.000 srgb} bind def
+/col2 {0.000 1.000 0.000 srgb} bind def
+/col3 {0.000 1.000 1.000 srgb} bind def
+/col4 {1.000 0.000 0.000 srgb} bind def
+/col5 {1.000 0.000 1.000 srgb} bind def
+/col6 {1.000 1.000 0.000 srgb} bind def
+/col7 {1.000 1.000 1.000 srgb} bind def
+/col8 {0.000 0.000 0.560 srgb} bind def
+/col9 {0.000 0.000 0.690 srgb} bind def
+/col10 {0.000 0.000 0.820 srgb} bind def
+/col11 {0.530 0.810 1.000 srgb} bind def
+/col12 {0.000 0.560 0.000 srgb} bind def
+/col13 {0.000 0.690 0.000 srgb} bind def
+/col14 {0.000 0.820 0.000 srgb} bind def
+/col15 {0.000 0.560 0.560 srgb} bind def
+/col16 {0.000 0.690 0.690 srgb} bind def
+/col17 {0.000 0.820 0.820 srgb} bind def
+/col18 {0.560 0.000 0.000 srgb} bind def
+/col19 {0.690 0.000 0.000 srgb} bind def
+/col20 {0.820 0.000 0.000 srgb} bind def
+/col21 {0.560 0.000 0.560 srgb} bind def
+/col22 {0.690 0.000 0.690 srgb} bind def
+/col23 {0.820 0.000 0.820 srgb} bind def
+/col24 {0.500 0.190 0.000 srgb} bind def
+/col25 {0.630 0.250 0.000 srgb} bind def
+/col26 {0.750 0.380 0.000 srgb} bind def
+/col27 {1.000 0.500 0.500 srgb} bind def
+/col28 {1.000 0.630 0.630 srgb} bind def
+/col29 {1.000 0.750 0.750 srgb} bind def
+/col30 {1.000 0.880 0.880 srgb} bind def
+/col31 {1.000 0.840 0.000 srgb} bind def
+
+end
+save
+newpath 0 248 moveto 0 0 lineto 519 0 lineto 519 248 lineto closepath clip newpath
+-6.8 259.4 translate
+1 -1 scale
+
+/cp {closepath} bind def
+/ef {eofill} bind def
+/gr {grestore} bind def
+/gs {gsave} bind def
+/sa {save} bind def
+/rs {restore} bind def
+/l {lineto} bind def
+/m {moveto} bind def
+/rm {rmoveto} bind def
+/n {newpath} bind def
+/s {stroke} bind def
+/sh {show} bind def
+/slc {setlinecap} bind def
+/slj {setlinejoin} bind def
+/slw {setlinewidth} bind def
+/srgb {setrgbcolor} bind def
+/rot {rotate} bind def
+/sc {scale} bind def
+/sd {setdash} bind def
+/ff {findfont} bind def
+/sf {setfont} bind def
+/scf {scalefont} bind def
+/sw {stringwidth} bind def
+/tr {translate} bind def
+/tnt {dup dup currentrgbcolor
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb}
+ bind def
+/shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul
+ 4 -2 roll mul srgb} bind def
+ /DrawEllipse {
+ /endangle exch def
+ /startangle exch def
+ /yrad exch def
+ /xrad exch def
+ /y exch def
+ /x exch def
+ /savematrix mtrx currentmatrix def
+ x y tr xrad yrad sc 0 0 1 startangle endangle arc
+ closepath
+ savematrix setmatrix
+ } def
+
+/$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def
+/$F2psEnd {$F2psEnteredState restore end} def
+
+$F2psBegin
+10 setmiterlimit
+0 slj 0 slc
+ 0.06000 0.06000 sc
+%
+% Fig objects follow
+%
+%
+% here starts figure with depth 0
+% Ellipse
+7.500 slw
+gs
+6870 1920 tr
+-255.024 rot
+n 0 0 75 75 0 360 DrawEllipse 255.024 rot
+gs 0.00 setgray ef gr gs col-1 s gr
+gr
+
+% Ellipse
+n 630 1916 75 75 0 360 DrawEllipse gs 0.00 setgray ef gr gs col-1 s gr
+
+% Ellipse
+gs
+3627 1904 tr
+-330.024 rot
+n 0 0 75 75 0 360 DrawEllipse 330.024 rot
+gs 0.00 setgray ef gr gs col-1 s gr
+gr
+
+% Polyline
+15.000 slw
+n 630 570 m 630 1920 l 2730 1920 l 2730 570 l
+ cp gs col-1 s gr
+% Polyline
+7.500 slw
+gs clippath
+670 1949 m 604 1984 l 699 2162 l 653 1996 l 765 2127 l cp
+eoclip
+n 810 2288 m
+ 645 1980 l gs col-1 s gr gr
+
+% arrowhead
+n 765 2127 m 653 1996 l 699 2162 l 716 2114 l 765 2127 l
+ cp gs 0.00 setgray ef gr col-1 s
+% Polyline
+n 570 585 m
+ 150 585 l gs col-1 s gr
+% Polyline
+n 480 1920 m
+ 150 1920 l gs col-1 s gr
+% Polyline
+gs clippath
+367 585 m 292 585 l 292 786 l 330 618 l 367 786 l cp
+eoclip
+n 330 1110 m
+ 330 600 l gs col-1 s gr gr
+
+% arrowhead
+n 367 786 m 330 618 l 292 786 l 330 753 l 367 786 l
+ cp gs 0.00 setgray ef gr col-1 s
+% Polyline
+n 2715 210 m
+ 2715 510 l gs col-1 s gr
+% Polyline
+n 3510 1905 m
+ 3135 1905 l gs col-1 s gr
+% Polyline
+n 3555 3030 m
+ 3135 3030 l gs col-1 s gr
+% Polyline
+gs clippath
+3292 1920 m 3367 1920 l 3367 1718 l 3330 1887 l 3292 1718 l cp
+eoclip
+n 3330 1905 m
+ 3330 1530 l gs col-1 s gr gr
+
+% arrowhead
+n 3292 1718 m 3330 1887 l 3367 1718 l 3330 1752 l 3292 1718 l
+ cp gs 0.00 setgray ef gr col-1 s
+% Polyline
+n 3630 705 m
+ 3630 285 l gs col-1 s gr
+% Polyline
+n 6120 705 m
+ 6120 360 l gs col-1 s gr
+% Polyline
+15.000 slw
+n 8730 2265 m 7425 1920 l 6870 3945 l 8175 4290 l
+ cp gs col-1 s gr
+% Polyline
+7.500 slw
+n 8730 1845 m
+ 8730 1464 l gs col-1 s gr
+% Polyline
+n 6735 1920 m
+ 6495 1920 l gs col-1 s gr
+% Polyline
+n 6810 4305 m
+ 6525 4305 l gs col-1 s gr
+% Polyline
+gs clippath
+6667 1905 m 6592 1905 l 6592 2106 l 6630 1938 l 6667 2106 l cp
+eoclip
+n 6630 2895 m
+ 6630 1920 l gs col-1 s gr gr
+
+% arrowhead
+n 6667 2106 m 6630 1938 l 6592 2106 l 6630 2073 l 6667 2106 l
+ cp gs 0.00 setgray ef gr col-1 s
+% Polyline
+gs clippath
+6592 4327 m 6667 4327 l 6667 4125 l 6630 4294 l 6592 4125 l cp
+eoclip
+n 6630 4312 m
+ 6630 3202 l gs col-1 s gr gr
+
+% arrowhead
+n 6592 4125 m 6630 4294 l 6667 4125 l 6630 4159 l 6592 4125 l
+ cp gs 0.00 setgray ef gr col-1 s
+% Polyline
+gs clippath
+2720 402 m 2720 327 l 2518 327 l 2687 365 l 2518 402 l cp
+eoclip
+n 2705 365 m
+ 1956 365 l gs col-1 s gr gr
+
+% arrowhead
+n 2518 402 m 2687 365 l 2518 327 l 2552 365 l 2518 402 l
+ cp gs 0.00 setgray ef gr col-1 s
+% Polyline
+n 625 220 m
+ 625 520 l gs col-1 s gr
+% Polyline
+gs clippath
+605 327 m 605 402 l 806 402 l 638 365 l 806 327 l cp
+eoclip
+n 1356 365 m
+ 620 365 l gs col-1 s gr gr
+
+% arrowhead
+n 806 327 m 638 365 l 806 402 l 773 365 l 806 327 l
+ cp gs 0.00 setgray ef gr col-1 s
+% Polyline
+gs clippath
+6140 562 m 6140 487 l 5938 487 l 6107 525 l 5938 562 l cp
+eoclip
+n 5151 525 m
+ 6125 525 l gs col-1 s gr gr
+
+% arrowhead
+n 5938 562 m 6107 525 l 5938 487 l 5972 525 l 5938 562 l
+ cp gs 0.00 setgray ef gr col-1 s
+% Polyline
+gs clippath
+3615 487 m 3615 562 l 3816 562 l 3648 525 l 3816 487 l cp
+eoclip
+n 3630 525 m
+ 4507 525 l gs col-1 s gr gr
+
+% arrowhead
+n 3816 487 m 3648 525 l 3816 562 l 3783 525 l 3816 487 l
+ cp gs 0.00 setgray ef gr col-1 s
+% Polyline
+gs clippath
+8740 1702 m 8740 1627 l 8538 1627 l 8707 1665 l 8538 1702 l cp
+eoclip
+n 8043 1665 m
+ 8725 1665 l gs col-1 s gr gr
+
+% arrowhead
+n 8538 1702 m 8707 1665 l 8538 1627 l 8572 1665 l 8538 1702 l
+ cp gs 0.00 setgray ef gr col-1 s
+% Polyline
+gs clippath
+6855 1627 m 6855 1702 l 7056 1702 l 6888 1665 l 7056 1627 l cp
+eoclip
+n 6870 1665 m
+ 7503 1665 l gs col-1 s gr gr
+
+% arrowhead
+n 7056 1627 m 6888 1665 l 7056 1702 l 7023 1665 l 7056 1627 l
+ cp gs 0.00 setgray ef gr col-1 s
+% Polyline
+ [15 45] 45 sd
+n 8730 4305 m 6870 4305 l 6870 1920 l 8730 1920 l
+ cp gs col-1 s gr [] 0 sd
+% Polyline
+gs clippath
+292 1935 m 367 1935 l 367 1733 l 330 1902 l 292 1733 l cp
+eoclip
+n 330 1920 m
+ 330 1470 l gs col-1 s gr gr
+
+% arrowhead
+n 292 1733 m 330 1902 l 367 1733 l 330 1767 l 292 1733 l
+ cp gs 0.00 setgray ef gr col-1 s
+% Polyline
+gs clippath
+3292 3045 m 3367 3045 l 3367 2843 l 3330 3012 l 3292 2843 l cp
+eoclip
+n 3330 2625 m
+ 3330 3030 l gs col-1 s gr gr
+
+% arrowhead
+n 3292 2843 m 3330 3012 l 3367 2843 l 3330 2877 l 3292 2843 l
+ cp gs 0.00 setgray ef gr col-1 s
+% Polyline
+15.000 slw
+n 4301 744 m 3626 1914 l 5441 2964 l 6116 1794 l
+ cp gs col-1 s gr
+% Polyline
+7.500 slw
+n 3573 738 m
+ 3123 738 l gs col-1 s gr
+% Polyline
+gs clippath
+3374 729 m 3299 729 l 3299 930 l 3337 762 l 3374 930 l cp
+eoclip
+n 3337 1156 m
+ 3337 744 l gs col-1 s gr gr
+
+% arrowhead
+n 3374 930 m 3337 762 l 3299 930 l 3337 897 l 3374 930 l
+ cp gs 0.00 setgray ef gr col-1 s
+% Polyline
+gs clippath
+3371 1903 m 3296 1903 l 3296 2104 l 3334 1936 l 3371 2104 l cp
+eoclip
+n 3334 1918 m
+ 3334 2286 l gs col-1 s gr gr
+
+% arrowhead
+n 3371 2104 m 3334 1936 l 3296 2104 l 3334 2071 l 3371 2104 l
+ cp gs 0.00 setgray ef gr col-1 s
+% Polyline
+ [15 45] 45 sd
+n 6118 3033 m 3624 3033 l 3624 740 l 6118 740 l
+ cp gs col-1 s gr [] 0 sd
+% Polyline
+n 6869 1821 m
+ 6869 1467 l gs col-1 s gr
+/Times-Roman ff 180.00 scf sf
+615 2452 m
+gs 1 -1 sc (Reference) col-1 sh gr
+/Times-Roman ff 180.00 scf sf
+787 2640 m
+gs 1 -1 sc (Point) col-1 sh gr
+/Times-Roman ff 180.00 scf sf
+4837 588 m
+gs 1 -1 sc (width) dup sw pop 2 div neg 0 rm col-1 sh gr
+/Times-Roman ff 180.00 scf sf
+337 1348 m
+gs 1 -1 sc (height) dup sw pop 2 div neg 0 rm col-1 sh gr
+/Times-Roman ff 180.00 scf sf
+1667 420 m
+gs 1 -1 sc (width) dup sw pop 2 div neg 0 rm col-1 sh gr
+/Times-Roman ff 180.00 scf sf
+6623 3112 m
+gs 1 -1 sc (depth) dup sw pop 2 div neg 0 rm col-1 sh gr
+/Times-Roman ff 180.00 scf sf
+7780 1707 m
+gs 1 -1 sc (width) dup sw pop 2 div neg 0 rm col-1 sh gr
+/Times-Bold ff 240.00 scf sf
+1740 1290 m
+gs 1 -1 sc (Graphics) dup sw pop 2 div neg 0 rm col-1 sh gr
+/Times-Bold ff 240.00 scf sf
+4860 1950 m
+gs 1 -1 sc 330.0 rot (Graphics) dup sw pop 2 div neg 0 rm col-1 sh gr
+/Times-Bold ff 240.00 scf sf
+7755 3090 m
+gs 1 -1 sc 255.0 rot (Graphics) dup sw pop 2 div neg 0 rm col-1 sh gr
+/Times-Roman ff 180.00 scf sf
+3337 1384 m
+gs 1 -1 sc (height) dup sw pop 2 div neg 0 rm col-1 sh gr
+/Times-Roman ff 180.00 scf sf
+3337 2487 m
+gs 1 -1 sc (depth) dup sw pop 2 div neg 0 rm col-1 sh gr
+% here ends figure;
+$F2psEnd
+rs
+showpage
+
+%%EndDocument
+ @endspecial 1674 4341 a(Figure)h(2:)p 0 TeXcolorgray
+Black 41 w(Rotated)h(L)2446 4324 y FP(A)2485 4341 y FQ(T)2536
+4360 y(E)2586 4341 y(X)e(Bo)m(xes)p Black 630 4756 a
+FD(3)135 b(Encapsulated)45 b(P)l(ostScript)630 4959 y
+FQ(The)28 b(P)m(ostScript)g(language)i(describ)s(es)d(b)s(oth)g
+(graphics)h(and)f(text.)41 b(The)28 b(P)m(ostScript)h(language)630
+5072 y(is)42 b(used)f(in)h(con)m(v)m(en)m(tional)i(P)m(ostScript)f(\()p
+FJ(ps)p FQ(\))f(\014les)g(to)g(describ)s(e)g(m)m(ultiple-page)h(do)s
+(cumen)m(ts)630 5185 y(and)d(also)i(in)e(Encapsulated)h(P)m(ostScript)g
+(\()p FJ(eps)p FQ(\))f(\014les)g(to)i(describ)s(e)e(graphics)g(for)h
+(insertion)630 5298 y(in)m(to)31 b(do)s(cumen)m(ts.)41
+b(There)30 b(are)g(t)m(w)m(o)i(main)e(di\013erences)h(b)s(et)m(w)m(een)
+g FJ(ps)f FQ(and)f FJ(eps)g FQ(\014les)p Black 767 5441
+a FK(\210)p Black 45 w FJ(eps)g FQ(\014les)i(can)f(con)m(tain)i(only)f
+(certain)g(P)m(ostScript)g(op)s(erators.)p Black 2250
+5640 a(11)p Black eop end
+%%Page: 12 12
+TeXDict begin 12 11 bop Black 0 TeXcolorgray Black Black
+Black 767 -149 a FK(\210)p Black 45 w FJ(eps)30 b FQ(\014les)i(m)m(ust)
+f(con)m(tain)i(a)f(BoundingBo)m(x)g(line)g(whic)m(h)f(sp)s(eci\014es)g
+(the)h(size)g(of)g(the)f FJ(eps)857 -36 y FQ(graphic.)630
+208 y FB(3.1)112 b(F)-9 b(orbidden)39 b(P)m(ostScript)d(Op)s(erators)
+630 358 y FQ(Since)26 b FJ(eps)e FQ(graphics)i(m)m(ust)g(share)f(the)i
+(page)f(with)g(other)g(ob)5 b(jects,)27 b(the)g(commands)e(in)h(an)f
+FJ(eps)630 449 y FQ(\014le)30 b(cannot)g(p)s(erform)e(page)j(op)s
+(erations)f(suc)m(h)f(as)h(selecting)i(a)e(page)h(size)f(\(suc)m(h)g
+(as)g FM(letter)e FQ(or)630 540 y FM(a4)p FQ(\))33 b(or)g(erasing)h
+(the)f(en)m(tire)h(page)g(with)f FM(erasepage)p FQ(.)46
+b(The)33 b(follo)m(wing)h(P)m(ostScript)g(op)s(erators)630
+632 y(are)d(not)f(allo)m(w)m(ed)j(in)d FJ(eps)f FQ(\014les:)p
+Black Black 708 765 a FE(a3)629 b(a4)432 b(a5)588 b(banddevice)277
+b(clear)708 856 y(cleardictstack)161 b(copypage)198 b(erasepage)315
+b(exitserver)277 b(framedevice)708 947 y(grestoreall)h(initclip)198
+b(initgraphics)g(initmatrix)277 b(letter)708 1038 y(legal)512
+b(note)354 b(prenderbands)198 b(quit)511 b(renderbands)708
+1130 y(setdevice)356 b(setglobal)159 b(setpagedevice)g(setpageparams)h
+(setsccbatch)708 1221 y(setshared)356 b(startjob)198
+b(stop)630 1354 y FQ(Although)25 b(the)g(follo)m(wing)h(P)m(ostScript)g
+(op)s(erators)f(can)g(b)s(e)f(used)g(in)g FJ(eps)g FQ(\014les,)i(they)f
+(ma)m(y)g(cause)630 1445 y(problems)30 b(if)g(not)h(used)e(prop)s(erly)
+-8 b(.)p Black Black 708 1578 a FE(nulldevice)160 b(setcolortransfer)g
+(setgstate)316 b(sethalftone)708 1669 y(setmatrix)199
+b(setscreen)433 b(settransfer)238 b(undefinedfont)630
+1824 y FQ(Some)35 b(of)g(the)g(ab)s(o)m(v)m(e)h(op)s(erators)f(ma)m(y)g
+(cause)h(the)f FJ(d)n(vi)p FQ(-to-)p FJ(ps)g FQ(pro)s(cess)g(to)g
+(fail,)i(while)e(others)630 1937 y(ma)m(y)29 b(cause)g(strange)g
+(problems)e(suc)m(h)h(as)h(graphics)f(whic)m(h)g(are)h(misplaced,)g(in)
+m(visible,)g(or)g(\015ash)630 2050 y(on)40 b(the)h(screen.)72
+b(Since)40 b(man)m(y)h(of)g(these)g(op)s(erators)g(do)f(not)h(a\013ect)
+h(the)f(P)m(ostScript)g(stac)m(k,)630 2163 y(suc)m(h)34
+b(problems)h(can)g(often)g(b)s(e)f(eliminated)i(b)m(y)e(simply)h
+(deleting)h(the)f(o\013ending)f(P)m(ostScript)630 2276
+y(op)s(erator.)41 b(Other)30 b(cases)h(ma)m(y)g(require)f(complicated)i
+(hac)m(king)g(of)e(the)h(P)m(ostScript)g(co)s(de.)630
+2519 y FB(3.2)112 b(The)38 b(EPS)f(BoundingBo)m(x)630
+2691 y FQ(By)45 b(con)m(v)m(en)m(tion,)51 b(the)45 b(\014rst)f(line)h
+(of)g(a)h(P)m(ostScript)f(\014le)g(sp)s(eci\014es)f(the)h(t)m(yp)s(e)g
+(of)g(P)m(ostScript)630 2803 y(and)35 b(is)i(then)e(follo)m(w)m(ed)j(b)
+m(y)e(a)g(series)h(of)f(commen)m(ts)h(called)g(the)f
+Fy(he)-5 b(ader)48 b FQ(or)36 b Fy(pr)-5 b(e)g(amble)p
+FQ(.)60 b(\(Lik)m(e)630 2916 y(L)654 2900 y FP(A)693
+2916 y FQ(T)744 2936 y(E)794 2916 y(X,)38 b(P)m(ostScript's)f(commen)m
+(t)g(c)m(haracter)g(is)f FM(\045)p FQ(\).)58 b(One)36
+b(of)g(these)g(commen)m(ts)h(sp)s(eci\014es)f(the)630
+3029 y(BoundingBo)m(x.)42 b(The)29 b(BoundingBo)m(x)j(line)e(con)m
+(tains)i(four)e(in)m(tegers)p Black 741 3172 a(1.)p Black
+46 w(The)g Fz(x)p FQ(-co)s(ordinate)i(of)e(the)h(lo)m(w)m(er-left)h
+(corner)f(of)f(the)h(BoundingBo)m(x.)p Black 741 3322
+a(2.)p Black 46 w(The)f Fz(y)s FQ(-co)s(ordinate)i(of)e(the)h(lo)m(w)m
+(er-left)h(corner)f(of)f(the)h(BoundingBo)m(x.)p Black
+741 3473 a(3.)p Black 46 w(The)f Fz(x)p FQ(-co)s(ordinate)i(of)e(the)h
+(upp)s(er-righ)m(t)e(corner)h(of)h(the)f(BoundingBo)m(x.)p
+Black 741 3623 a(4.)p Black 46 w(The)g Fz(y)s FQ(-co)s(ordinate)i(of)e
+(the)h(upp)s(er-righ)m(t)e(corner)h(of)h(the)f(BoundingBo)m(x.)630
+3752 y(F)-8 b(or)31 b(example,)g(the)g(\014rst)f(5)g(lines)h(of)g(an)f
+FJ(eps)f FQ(\014le)h(created)i(b)m(y)e(gn)m(uplot)h(are)p
+Black Black 848 3894 a FN(\045!PS-Adobe-2.0)38 b(EPSF-2.0)848
+3993 y(\045\045Creator:)h(gnuplot)848 4093 y(\045\045DocumentFonts:)e
+(Times-Roman)848 4192 y(\045\045BoundingBox:)h(50)k(50)h(410)g(302)848
+4292 y(\045\045EndComments)630 4446 y FQ(Th)m(us)32 b(the)h(gn)m(uplot)
+g FJ(eps)e FQ(graphic)i(has)g(a)g(lo)m(w)m(er-left)i(corner)e(with)f
+(co)s(ordinates)i(\(50)p Fz(;)15 b FQ(50\))36 b(and)630
+4559 y(an)41 b(upp)s(er-righ)m(t)g(corner)g(with)g(co)s(ordinates)h
+(\(410)p Fz(;)15 b FQ(302\).)78 b(The)40 b(BoundingBo)m(x)j(parameters)
+630 4672 y(ha)m(v)m(e)28 b(units)f(of)g(P)m(ostScript)g(p)s(oin)m(ts)g
+(whic)m(h)g(are)2285 4653 y FP(1)2312 4672 y Fz(=)2343
+4682 y FP(72)2441 4672 y FQ(of)g(an)g(inc)m(h,)h(making)f(the)h(ab)s(o)
+m(v)m(e)g(graphic's)630 4785 y(natural)c(width)f(5)h(inc)m(hes)h(and)e
+(its)h(natural)g(heigh)m(t)h(3.5)g(inc)m(hes.)39 b(Note)26
+b(that)e(a)g(P)m(ostScript)h(p)s(oin)m(t)630 4898 y(is)31
+b(is)f(sligh)m(tly)i(larger)f(than)g(a)g(T)1730 4918
+y(E)1780 4898 y(X)f(p)s(oin)m(t,)h(whic)m(h)f(is)2502
+4879 y FP(1)2528 4898 y Fz(=)2559 4908 y FP(72.27)2751
+4898 y FQ(of)h(an)f(inc)m(h.)42 b(In)30 b(T)3377 4918
+y(E)3427 4898 y(X)g(and)g(L)3726 4881 y FP(A)3765 4898
+y FQ(T)3816 4918 y(E)3867 4898 y(X,)630 5011 y(P)m(ostScript)36
+b(p)s(oin)m(ts)f(are)g(called)h(\\big)g(p)s(oin)m(ts")f(and)g
+(abbreviated)g FM(bp)f FQ(while)h(T)3407 5031 y(E)3457
+5011 y(X)h(p)s(oin)m(ts)f(are)630 5124 y(called)d(\\p)s(oin)m(ts")f
+(and)e(abbreviated)i FM(pt)p FQ(.)p Black 2250 5640 a(12)p
+Black eop end
+%%Page: 13 13
+TeXDict begin 13 12 bop Black 0 TeXcolorgray Black Black
+630 -149 a FB(3.3)112 b(Con)m(v)m(erting)38 b(PS)f(\014les)h(to)f(EPS)
+630 23 y FQ(Single-page)k(P)m(ostScript)f(\014les)f(without)g(an)m(y)h
+(improp)s(er)d(commands)i(can)h(b)s(e)e(con)m(v)m(erted)j(to)630
+136 y FJ(eps)34 b FQ(b)m(y)h(using)g(one)h(of)f(the)g(follo)m(wing)i
+(metho)s(ds)e(for)g(adding)g(a)g(BoundingBo)m(x)i(line.)55
+b FL(Since)630 249 y(these)36 b(metho)s(ds)h(do)f(not)g(c)m(hec)m(k)i
+(for)f(illegal)f(P)m(ostScript)h(op)s(erators,)g(they)f(do)h(not)630
+362 y(pro)s(duce)24 b(usable)g(EPS)f(\014les)h(unless)g(the)f(PS)h
+(\014les)g(are)f(free)g(of)h(forbidden)g(op)s(erators.)p
+Black 741 504 a FQ(1.)p Black 46 w(The)45 b(most)h(con)m(v)m(enien)m(t)
+h(option)f(is)g(to)g(use)f(the)h FM(ps2epsi)d FQ(utilit)m(y)k
+(distributed)d(with)857 617 y(Ghostscript)34 b(\(see)f(Section)p
+0.05 1.00 1.00 0.40 TeXcolorcmyk 34 w(6.1)p Black
+34 w(on)g(page)p 0.05 1.00 1.00 0.40 TeXcolorcmyk
+34 w(17)p Black(\),)i(whic)m(h)d(reads)h(the)g(P)m(ostScript)h(\014le,)
+g(cal-)857 730 y(culates)i(the)f(BoundingBo)m(x)g(parameters,)h(and)e
+(creates)i(an)e FJ(eps)f FQ(\014le)i(\(complete)h(with)857
+843 y(a)31 b(BoundingBo)m(x\))h(whic)m(h)e(con)m(tains)h(the)g(P)m
+(ostScript)g(graphics.)857 993 y(The)f(resulting)f(\014le)h
+FJ(eps)f FQ(\014le)g(is)h(in)g FJ(epsi)e FQ(format,)j(whic)m(h)e(means)
+h(it)g(con)m(tains)h(an)f(In)m(ter-)857 1106 y(c)m(hange)k(\(lo)m
+(w-resolution)g(bitmapp)s(ed\))d(preview)h(at)h(the)f(b)s(eginning)f
+(of)i(the)f(\014le.)46 b(Since)857 1219 y(this)24 b(preview)g(is)g
+FJ(asci)r(i)p FQ(-enco)s(ded,)h(it)f(do)s(es)g(not)g(cause)h(the)f
+(Section)p 0.05 1.00 1.00 0.40 TeXcolorcmyk 24 w(4.1)p
+Black 25 w FM(bufsize)e FQ(errors.)857 1332 y(Ho)m(w)m(ev)m(er,)33
+b(this)d FJ(epsi)f FQ(preview)h(increases)i(the)e(\014le)h(size.)p
+Black 741 1482 a(2.)p Black 46 w(Another)h(metho)s(d)f(of)g(ha)m(ving)i
+(ghostscript)f(calculate)i(the)d(BoundingBo)m(x)i(parameters)857
+1595 y(is)24 b(to)h(use)f(the)g FM(epstool)e FQ(utilit)m(y)-8
+b(,)27 b(a)m(v)-5 b(ailable)26 b(for)e(Unix,)h FJ(dos)p
+FQ(,)h(Windo)m(ws,)f(and)e(OS/2)h(from)p Black Black
+0.05 1.00 1.00 0.40 TeXcolorcmyk 1263 1776 a FM
+(http://www.cs.wisc.edu/)2367 1793 y(~)2409 1776 y
+(ghost/gsview/epstool.ht)o(m)p Black 857 1942 a FQ(F)-8
+b(or)31 b(example,)h(the)e(command)p Black Black 1119
+2076 a FN(epstool)40 b(--copy)i(--bbox)f(file1.eps)f(file2.eps)857
+2223 y FQ(analyzes)26 b(the)f(con)m(ten)m(ts)i(of)32
+b FM(file1.eps)22 b FQ(to)k(determine)f(the)g(correct)h(BoundingBo)m(x)
+g(and)857 2336 y(then)33 b(copies)h(the)f(con)m(ten)m(ts)i(of)40
+b FM(file1.eps)30 b FQ(with)j(the)g(calculated)i(BoundingBo)m(x)f(in)m
+(to)857 2449 y FM(file2.eps)p FQ(.)857 2599 y(The)24
+b FM(epstool)e FQ(utilit)m(y)j(can)g(also)g(b)s(e)e(used)h(to)g(add)g
+FJ(tiff)p FQ(,)i FJ(wmf)p FQ(,)h FJ(epsi)22 b FQ(bitmap)i(previews)857
+2712 y(to)31 b(an)g FJ(eps)e FQ(\014le,)h(or)h(extract)h(bitmap)e
+(previews)g(from)g(an)g FJ(eps)f FQ(\014le.)p Black 741
+2862 a(3.)p Black 46 w(Alternativ)m(ely)-8 b(,)46 b(the)40
+b(BoundingBo)m(x)g(parameters)h(can)f(b)s(e)f(calculated)j(and)d(man)m
+(ually)857 2975 y(inserted)31 b(in)f(the)h(P)m(ostScript)h(\014le's)f
+(BoundingBo)m(x)g(line)g(or)g(sp)s(eci\014ed)f(in)h(the)g(graphics-)857
+3088 y(insertion)24 b(command)f(\(e.g.,)j(the)e FM(\\includegraphics)18
+b FQ(command's)24 b FM(bb)e FQ(option\).)39 b(There)857
+3201 y(are)31 b(sev)m(eral)h(w)m(a)m(ys)f(to)g(calculate)i(the)d
+(BoundingBo)m(x)i(parameters)p Black 896 3366 a(\(a\))p
+Black 46 w(Use)d(Ghostview/GSview)g(to)g(displa)m(y)f(the)g(P)m
+(ostScript)h(graphic.)40 b(As)28 b(the)g(p)s(oin)m(ter)1057
+3479 y(is)37 b(mo)m(v)m(ed)g(around)f(the)h(graphic,)h(the)f(p)s(oin)m
+(ter's)g(co)s(ordinates)g(\(with)g(resp)s(ect)f(to)1057
+3592 y(the)28 b(lo)m(w)m(er-left)i(corner)e(of)g(the)g(page\))h(are)f
+(displa)m(y)m(ed.)40 b(T)-8 b(o)29 b(determine)e(the)h(Bound-)1057
+3705 y(ingBo)m(x)f(parameters,)g(record)e(the)h(p)s(oin)m(ter)f(co)s
+(ordinates)i(at)f(the)f(lo)m(w)m(er-left)j(corner)1057
+3818 y(of)j(the)f(graphic)h(and)f(the)g(upp)s(er-righ)m(t)f(corner)i
+(of)f(the)h(graphic.)p Black 891 3947 a(\(b\))p Black
+45 w(Prin)m(t)37 b(out)g(a)g(cop)m(y)g(of)g(the)g(P)m(ostScript)g
+(graphics)g(and)f(measure)g(the)h(horizon)m(tal)1057
+4060 y(and)c(v)m(ertical)j(distances)e(\(in)f(inc)m(hes\))h(from)f(the)
+h(lo)m(w)m(er-left)h(corner)f(of)f(the)h(pap)s(er)1057
+4173 y(to)e(the)g(lo)m(w)m(er-left)i(corner)d(of)h(the)g(graphics.)44
+b(Multiply)31 b(these)h(measuremen)m(ts)g(b)m(y)1057
+4286 y(72)25 b(to)f(get)h(the)f(BoundingBo)m(x's)h(lo)m(w)m(er-left)h
+(co)s(ordinates.)40 b(Lik)m(ewise,)26 b(measure)e(the)1057
+4399 y(distances)j(from)f(the)g(lo)m(w)m(er-left)j(corner)d(of)h(the)f
+(pap)s(er)f(to)i(the)g(upp)s(er-righ)m(t)e(corner)1057
+4512 y(of)31 b(the)f(graphics)h(to)g(get)g(the)g(BoundingBo)m(x's)g
+(upp)s(er-righ)m(t)f(co)s(ordinates.)p Black 901 4641
+a(\(c\))p Black 46 w(The)d FM(bbfig)f FQ(script)h(uses)g(a)h(P)m
+(ostScript)g(prin)m(ter)f(to)h(calculate)i(the)e(BoundingBo)m(x.)1057
+4754 y FM(bbfig)23 b FQ(adds)h(some)h(P)m(ostScript)g(commands)f(to)h
+(the)g(b)s(eginning)f(of)h(the)f(P)m(ostScript)1057 4867
+y(\014le)k(and)f(sends)g(it)h(to)g(the)g(prin)m(ter.)40
+b(A)m(t)28 b(the)g(prin)m(ter,)g(the)g(added)f(P)m(ostScript)h(com-)
+1057 4980 y(mands)h(calculate)i(the)f(BoundingBo)m(x)g(of)f(the)h
+(original)g(P)m(ostScript)g(\014le,)g(prin)m(ting)1057
+5093 y(the)42 b(BoundingBo)m(x)g(co)s(ordinates)g(sup)s(erimp)s(osed)d
+(on)j(the)g(P)m(ostScript)g(graphic.)1057 5206 y(The)30
+b FM(bbfig)f FQ(script)h(is)h(a)m(v)-5 b(ailable)33 b(from)p
+Black Black 0.05 1.00 1.00 0.40 TeXcolorcmyk 2055
+5350 a FM(CTAN/support/bbfig/)p Black Black 2250 5640
+a FQ(13)p Black eop end
+%%Page: 14 14
+TeXDict begin 14 13 bop Black 0 TeXcolorgray Black Black
+630 -149 a FB(3.4)112 b(Fixing)39 b(Non-standard)g(EPS)e(\014les)630
+23 y FQ(Some)h(applications)i(\(suc)m(h)e(as)h(Mathematica)h(and)e(F)-8
+b(rameMak)m(er\))41 b(pro)s(duce)c(non-standard)630 136
+y FJ(eps)30 b FQ(\014les)g(whic)m(h)h(cannot)g(b)s(e)f(used)g(in)h
+(other)g(programs)g(suc)m(h)f(as)h(L)2978 119 y FP(A)3017
+136 y FQ(T)3068 155 y(E)3118 136 y(X.)43 b(Some)30 b(of)h(these)h(ap-)
+630 249 y(plications)f(ha)m(v)m(e)f(dev)m(elop)s(ed)g(their)g(o)m(wn)f
+(\\impro)m(v)m(ed")i(\015a)m(v)m(or)f(of)g(P)m(ostScript)g(with)f
+(additional)630 362 y(features,)44 b(while)c(other)h(applications)h
+(use)e(p)s(o)s(or)g(P)m(ostScript)h(programming.)71 b(Often)40
+b(these)630 475 y(non-standard)25 b FJ(eps)g FQ(can)i(b)s(e)f(easily)h
+(\014xed)f(b)m(y)g(scripts)g(pro)m(vided)g(b)m(y)g(either)h(the)f(soft)
+m(w)m(are)i(com-)630 587 y(panies)k(themselv)m(es)h(or)g(b)m(y)f(P)m
+(ostScript-sa)m(vvy)h(users.)46 b(Chec)m(k)32 b(the)g(soft)m(w)m(are)i
+(man)m(ufacturer's)630 700 y(w)m(eb)c(page)h(or)g(searc)m(h)g(USENET)e
+(groups)h(asso)s(ciated)i(with)e(the)h(soft)m(w)m(are.)630
+987 y FD(4)135 b(Ho)l(w)45 b(EPS)g(Files)h(are)f(Used)g(b)l(y)g(L)2544
+962 y Fx(A)2596 987 y FD(T)2668 1013 y(E)2738 987 y(X)630
+1190 y FQ(When)29 b(pro)s(cessing)h(a)g FM(dvips)p FQ(-st)m(yle)f(do)s
+(cumen)m(t,)h(the)g FJ(eps)e FQ(\014les)i(are)g(used)e(b)m(y)i(b)s(oth)
+f(L)3576 1173 y FP(A)3615 1190 y FQ(T)3666 1209 y(E)3716
+1190 y(X)h(and)630 1303 y(the)h FJ(d)n(vi)p FQ(-to-)p
+FJ(ps)g FQ(con)m(v)m(erter.)p Black 741 1445 a(1.)p Black
+46 w(L)881 1429 y FP(A)920 1445 y FQ(T)971 1465 y(E)1022
+1445 y(X)25 b(scans)g(the)h FJ(eps)d FQ(\014le)j(for)f(the)g
+(BoundingBo)m(x)h(line,)h(whic)m(h)e(tells)h(L)3330 1429
+y FP(A)3369 1445 y FQ(T)3420 1465 y(E)3470 1445 y(X)g(ho)m(w)f(m)m(uc)m
+(h)857 1558 y(space)31 b(to)g(reserv)m(e)g(for)f(the)h(graphic.)p
+Black 741 1709 a(2.)p Black 46 w(The)26 b FJ(d)n(vi)p
+FQ(-to-)p FJ(ps)h FQ(con)m(v)m(erter)h(then)d(reads)h(the)h
+FJ(eps)e FQ(\014le)h(and)f(inserts)h(the)h(graphics)f(in)g(the)857
+1822 y FJ(ps)k FQ(\014le.)630 1964 y(This)g(has)g(the)g(follo)m(wing)i
+(rami\014cations)p Black 767 2107 a FK(\210)p Black 45
+w FQ(If)21 b(the)g(BoundingBo)m(x)h(parameters)g(are)g(sp)s(eci\014ed)e
+(in)h(the)g(graphics-insertion)h(command)857 2220 y(\(e.g.,)29
+b(the)d FM(bb)f FQ(option)h(of)33 b FM(\\includegraphics)21
+b FQ(is)k(used\))h(then)f(L)3078 2203 y FP(A)3117 2220
+y FQ(T)3168 2240 y(E)3218 2220 y(X)h(nev)m(er)g(ev)m(en)g(reads)857
+2333 y(the)36 b FJ(eps)e FQ(\014le.)57 b(In)35 b(fact,)j(the)e
+FJ(eps)e FQ(\014le)i(do)s(es)f(not)h(ev)m(en)g(need)f(to)i(exist)f
+(when)f(L)3655 2316 y FP(A)3694 2333 y FQ(T)3745 2353
+y(E)3795 2333 y(X)h(is)857 2446 y(run.)p Black 767 2596
+a FK(\210)p Black 45 w FQ(Since)22 b(T)1137 2616 y(E)1187
+2596 y(X)f(cannot)h(read)f(non-)p FJ(asci)r(i)g FQ(\014les)h(and)e
+(cannot)i(spa)m(wn)f(other)g(programs,)j(L)3752 2579
+y FP(A)3791 2596 y FQ(T)3842 2616 y(E)3892 2596 y(X)857
+2709 y(cannot)i(read)g(the)f(BoundingBo)m(x)i(information)f(from)f
+(compressed)g(or)g(non-)p FJ(eps)f FQ(graph-)857 2822
+y(ics)32 b(\014les.)43 b(In)30 b(these)h(cases,)i(the)e(BoundingBo)m(x)
+h(parameters)f(m)m(ust)g(b)s(e)g(sp)s(eci\014ed)f(in)h(the)857
+2935 y(graphics-insertion)k(command)e(\(e.g.,)k(in)d(the)g
+FM(bb)f FQ(option)h(of)g(the)g FM(\\includegraphics)857
+3048 y FQ(command\))29 b(or)g(stored)g(in)g(a)g(non-compressed)g(text)h
+(\014le)f(\(see)g(Section)p 0.05 1.00 1.00 0.40 TeXcolorcmyk
+30 w(14)p Black 30 w(on)g(page)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 29 w(42)p Black(\).)p Black 767 3198 a FK(\210)p
+Black 45 w FQ(The)37 b FJ(eps)f FQ(graphics)h(are)g(not)h(included)e
+(in)h(the)g FJ(d)n(vi)h FQ(\014le.)61 b(Since)37 b(the)g
+FJ(eps)f FQ(\014les)h(m)m(ust)857 3311 y(b)s(e)28 b(presen)m(t)h(when)f
+(the)h FJ(d)n(vi)g FQ(\014le)g(is)g(con)m(v)m(erted)h(to)g
+FJ(ps)p FQ(,)f(the)g FJ(eps)e FQ(\014les)i(m)m(ust)g(accompan)m(y)857
+3424 y FJ(d)n(vi)i FQ(\014les)f(whenev)m(er)g(they)h(are)g(mo)m(v)m
+(ed.)p Black 767 3574 a FK(\210)p Black 45 w FQ(The)e
+FJ(eps)f FQ(graphics)h(ma)m(y)h(not)f(app)s(ear)g(in)f(some)i
+FJ(d)n(vi)f FQ(view)m(ers.)41 b(T)-8 b(o)30 b(help)e(the)i(user)e(with)
+857 3687 y(placemen)m(t)22 b(of)f(the)g(graphics,)h(these)f
+FJ(d)n(vi)g FQ(view)m(ers)g(generally)h(displa)m(y)e(the)h(BoundingBo)m
+(x)857 3800 y(in)30 b(whic)m(h)g(the)h(graphics)f(will)h(b)s(e)f
+(inserted.)630 4043 y FB(4.1)112 b(Line)39 b(Bu\013er)e(Ov)m(er\015o)m
+(w)630 4202 y FQ(T)681 4221 y(E)731 4202 y(X)e(reads)g
+FJ(asci)r(i)g FQ(\014les)f(one)i(line)f(at)g(a)h(time,)h(putting)d(eac)
+m(h)j(line)e(in)f(its)i(line)f(bu\013er,)g(whic)m(h)630
+4301 y(is)30 b(often)h(ab)s(out)g(3000)h(c)m(haracters)g(long.)41
+b(If)30 b(an)m(y)h(of)f(the)h(lines)g(of)f(the)h FJ(eps)e
+FQ(\014le)i(is)f(longer)h(than)630 4401 y(the)g(line)f(bu\013er,)g(the)
+g(follo)m(wing)i(error)e(is)h(displa)m(y)m(ed)p Black
+Black 804 4542 a FN(Unable)41 b(to)i(read)f(an)h(entire)e
+(line--bufsize=30)o(00.)804 4642 y(Please)g(ask)i(a)g(wizard)e(to)i
+(enlarge)e(me.)630 4796 y FQ(Since)25 b FJ(eps)e FQ(rarely)i(ha)m(v)m
+(e)h(lines)e(longer)i(than)e(3000)i(c)m(haracters,)i(there)c(are)h(t)m
+(w)m(o)h(p)s(ossible)f(causes)630 4909 y(of)31 b(suc)m(h)f(an)g(error)p
+Black 741 5052 a(1.)p Black 46 w FL(The)35 b(EPS)g(\014le)g(con)m
+(tains)g(a)g(long)h(binary)f(preview.)857 5202 y FQ(Some)g
+(applications)g(place)h(a)e(binary)g(preview)g(of)h(the)f(graphics)g
+(at)i(the)e(b)s(eginning)g(of)857 5315 y(the)42 b FJ(eps)f
+FQ(\014le.)75 b(This)41 b(allo)m(ws)i(applications)g(\(suc)m(h)f(as)g
+FJ(d)n(vi)g FQ(view)m(ers\))g(to)h(displa)m(y)f(the)p
+Black 2250 5640 a(14)p Black eop end
+%%Page: 15 15
+TeXDict begin 15 14 bop Black 0 TeXcolorgray Black Black
+857 -149 a FQ(graphics)35 b(ev)m(en)h(though)f(the)g(application)h
+(cannot)g(in)m(terpret)f(P)m(ostScript.)55 b(Curren)m(tly)-8
+b(,)857 -36 y(relativ)m(ely)33 b(few)d(T)1469 -16 y(E)1519
+-36 y(X-related)i(applications)f(use)g(suc)m(h)f(previews.)857
+115 y(If)37 b(the)h(binary)f(preview)h(is)f(smaller)i(than)e(the)h
+(line)g(bu\013er,)h(the)e FM(\\includegraphics)857 227
+y FQ(command)29 b(skips)g(o)m(v)m(er)i(the)e(preview)2150
+194 y FP(6)2190 227 y FQ(.)40 b(Ho)m(w)m(ev)m(er,)32
+b(the)d(o)m(v)m(erfull)i FM(bufsize)c FQ(error)i(o)s(ccurs)857
+340 y(if)34 b(the)h(binary)e(preview)h(is)g(larger)h(than)f(the)g(line)
+g(bu\013er.)51 b(There)34 b(are)g(a)h(couple)g(w)m(ork-)857
+453 y(arounds)29 b(for)i(this)f(problem)p Black 896 618
+a(\(a\))p Black 46 w(If)21 b(the)h(preview)f(w)m(on't)h(b)s(e)e(used,)j
+(the)e(problem)g(can)h(b)s(e)e(a)m(v)m(oided)j(b)m(y)e(either)h
+(deleting)1057 731 y(it)g(with)f(a)h(text)h(editor)f(or)f(b)m(y)h(prev)
+m(en)m(ting)g(the)g(original)g(graphics)g(application)g(from)1057
+844 y(creating)32 b(the)f(preview.)p Black 891 974 a(\(b\))p
+Black 45 w(Since)j(L)1322 957 y FP(A)1361 974 y FQ(T)1412
+993 y(E)1462 974 y(X)f(reads)g(the)h FJ(eps)e FQ(\014le)h(to)i(only)e
+(obtain)h(the)f(BoundingBo)m(x)i(parame-)1057 1087 y(ters,)45
+b(L)1298 1070 y FP(A)1337 1087 y FQ(T)1388 1106 y(E)1439
+1087 y(X)d(do)s(es)f(not)i(read)e(the)h FJ(eps)f FQ(\014le)h(if)g(the)g
+(BoundingBo)m(x)h(parameters)1057 1200 y(are)38 b(pro)m(vided)f(b)m(y)h
+(the)f(graphics-insertion)h(command)g(\(e.g.,)j(the)c
+FM(bb)g FQ(option)h(to)1057 1313 y FM(\\includegraphics)p
+FQ(\))p Black 741 1478 a(2.)p Black 46 w FL(The)30 b(\014le's)h
+(end-of-line)f(c)m(haracters)h(are)f(corrupted)h(b)m(y)f(an)h(improp)s
+(er)f(trans-)857 1591 y(fer.)857 1741 y Fy(The)f(fol)5
+b(lowing)29 b(pr)-5 b(oblem)30 b(do)-5 b(es)30 b(not)f(o)-5
+b(c)g(cur)29 b(with)g(most)g(r)-5 b(e)g(c)g(ent)30 b(T)3063
+1760 y(E)3112 1741 y(X)e(distributions)i(whose)857 1854
+y(versions)k(of)e(T)1368 1873 y(E)1418 1854 y(X)g(ar)-5
+b(e)34 b(smart)g(enough)f(to)g(identify)g(al)5 b(l)33
+b(end-of-line)f(char)-5 b(acters.)857 2004 y FQ(Di\013eren)m(t)38
+b(platforms)e(use)g(di\013eren)m(t)h(end-of-line)g(c)m(haracters:)54
+b(Unix)36 b(uses)g(a)g(line)h(feed)857 2117 y(c)m(haracter)45
+b(\()p FM(^J)p FQ(\),)e(Macin)m(tosh)i(uses)d(a)i(carriage)g(return)e
+(\()p FM(^M)p FQ(\),)h(while)g FJ(dos)p FQ(/Windo)m(ws)857
+2230 y(uses)32 b(a)g(carriage)h(return)e(and)g(line)h(feed)g(pair)f(\()
+p FM(^M^J)p FQ(\).)h(F)-8 b(or)32 b(example,)h(if)f(an)g
+FJ(eps)e FQ(\014le)i(is)857 2343 y(transferred)24 b(in)h(binary)g(mo)s
+(de)g(from)f(a)i(Macin)m(tosh)h(to)f(a)f(Unix)g(mac)m(hine,)i(the)f
+(Unix)f(T)3842 2362 y(E)3892 2343 y(X)857 2456 y(do)s(esn't)32
+b(see)h(an)m(y)g FM(^J)e FQ(end-of-line)i(c)m(haracters)h(and)d(th)m
+(us)h(thinks)g(the)g(en)m(tire)h(\014le)f(is)h(one)857
+2569 y(big)e(line,)g(o)m(v)m(er\014lling)h(the)e(line)h(bu\013er.)857
+2719 y(If)25 b(the)h FJ(eps)e FQ(\014le)h(has)g(no)h(binary)e(sections)
+j(\(e.g.,)h(no)d(binary)g(preview)g(and)g(no)g(em)m(b)s(edded)857
+2832 y(graphics\))46 b(this)f(problem)g(can)h(b)s(e)f(a)m(v)m(oided)i
+(b)m(y)e(transferring)g(the)g FJ(eps)f FQ(\014le)i(in)f(text)857
+2945 y(mo)s(de.)39 b(Ho)m(w)m(ev)m(er,)29 b FJ(eps)c
+FQ(\014les)h(with)f(binary)g(sections)i(m)m(ust)f(b)s(e)f(transferred)g
+(with)h(binary)857 3058 y(mo)s(de,)k(since)h(the)f(text)h(mo)s(de)e
+(transfer)h(ma)m(y)g(corrupt)g(the)g(binary)f(section.)42
+b(Since)30 b(this)857 3171 y(binary)d(transfer)h(do)s(es)f(not)h
+(translate)h(the)g(end-of-line)f(c)m(haracters,)i(the)e(BoundingBo)m(x)
+857 3283 y(information)h(m)m(ust)f(b)s(e)f(pro)m(vided)h(b)m(y)f(the)i
+(graphics-insertion)f(command)g(\(e.g.,)i(the)f FM(bb)857
+3396 y FQ(option)i(to)g FM(\\includegraphics)p FQ(\).)630
+3683 y FD(5)135 b(PDF)44 b(Graphics)630 3886 y FQ(As)32
+b(men)m(tioned)g(earlier,)h(p)s(dfT)1698 3905 y(E)1746
+3886 y(X)f(can)g(directly)h(imp)s(ort)e(the)h FJ(pdf)p
+FQ(,)g FJ(png)p FQ(,)g FJ(jpeg)p FQ(,)f(and)g(Meta-)630
+3999 y(P)m(ost)41 b(graphic)f(formats.)70 b(This)39 b(section)j(pro)m
+(vides)e(a)g(short)g(description)g(of)g(these)g(formats.)630
+4112 y(The)29 b(commands)f(for)h(inserting)h(these)f(graphics)g(in)m
+(to)h(p)s(dfL)2705 4095 y FP(A)2744 4112 y FQ(T)2795
+4131 y(E)2844 4112 y(X)f(are)h(describ)s(ed)e(in)h(Section)p
+0.05 1.00 1.00 0.40 TeXcolorcmyk 30 w(7)p Black 630
+4224 a(on)h(page)p 0.05 1.00 1.00 0.40 TeXcolorcmyk
+31 w(22)p Black(.)630 4468 y FB(5.1)112 b(JPEG)630 4640
+y FJ(jpeg)42 b FQ(is)h(a)h(compression)f(standard)f(authored)h(b)m(y)g
+(Join)m(t)h(Photographic)f(Exp)s(erts)g(Group)630 4752
+y(\()p FJ(jpeg)p FQ(\))30 b(Committee)p Black Black
+0.05 1.00 1.00 0.40 TeXcolorcmyk 1818 4940 a FM
+(http://www.jpeg.org/)p Black Black 630 5038 1332 4 v
+734 5128 a FF(6)768 5160 y FG(Note)f(that)f FE(\\psfig)h
+FG(and)f(other)h(obsolete)g(graphics)g(commands)g(did)f(not)g(ha)n(v)n
+(e)g(the)g(abilit)n(y)h(to)f(skip)g(o)n(v)n(er)630 5251
+y(binary)d(previews)p Black Black 2250 5640 a FQ(15)p
+Black eop end
+%%Page: 16 16
+TeXDict begin 16 15 bop Black 0 TeXcolorgray Black Black
+630 -149 a FQ(The)28 b FJ(jpeg)f FQ(format)i(is)f(a)g(compression)h
+(standard)e(for)h(bitmap)g(graphics)g(whic)m(h)g(uses)g(a)g(lossy)3920
+-182 y FP(7)630 -36 y FQ(compression)e(sc)m(heme.)40
+b(In)24 b(particular,)k(its)e(compression)f(do)s(es)h(not)f(preserv)m
+(e)h(lines)g(and)f(sharp)630 77 y(edges,)k(making)f(it)g(p)s(o)s(orly)f
+(suited)g(for)g(line)h(dra)m(wings)g(and)f(or)g(graphics)h(with)f
+(sharp)f(features.)630 319 y FB(5.2)112 b(PNG)630 491
+y FQ(F)-8 b(or)34 b(man)m(y)g(y)m(ears)g(the)f FJ(gif)h
+FQ(format)g(w)m(as)g(the)f(standard)g(for)g(compressed)g(bitmaps)g(for)
+h(icons)630 604 y(and)i(other)g(line)h(dra)m(wings,)g(since)g(its)f
+(lossless)h FJ(lzw)h FQ(compression)e(do)s(es)g(not)h(distort)f(sharp)
+630 717 y(edges.)78 b(Unisys's)42 b(enforcemen)m(t)h(of)g(its)g
+FJ(lzw)h FQ(paten)m(t)g(coupled)e(with)g(some)h FJ(gif)g
+FQ(tec)m(hnical)630 830 y(limitations)j(\(suc)m(h)e(a)h(limit)g(of)f
+(256)i(colors\))f(spurred)e(the)h(dev)m(elopmen)m(t)i(of)e(the)h(P)m
+(ortable)630 943 y(Net)m(w)m(ork)27 b(Graphics)f(\(PNG\))g(format)g(b)m
+(y)f(a)h(group)f(ev)m(en)m(tually)j(called)f(the)f FJ(png)f
+FQ(Dev)m(elopmen)m(t)630 1056 y(Group)p Black Black
+0.05 1.00 1.00 0.40 TeXcolorcmyk 1579 1237 a FM
+(http://www.libpng.org/pub)o(/pn)o(g/)p Black 630 1419
+a FQ(Lik)m(e)32 b(GIF,)g(PNG)g(uses)f(lossless)h(compression)f(whic)m
+(h)g(is)g(suitable)h(for)f(line)h(dra)m(wings.)43 b(While)630
+1532 y FJ(png)g FQ(can)g(b)s(e)g(used)f(on)h(an)m(y)h(bitmap,)j
+FJ(jpeg)p FQ('s)42 b(lossy)i(compression)f(is)g(often)h(b)s(etter)f
+(than)630 1644 y FJ(png)26 b FQ(for)g(photographs)h(and)f(other)h
+(bitmaps)f(without)g(sharp)g(edges)h(\(where)f(\\b)s(etter")i(means)630
+1757 y(pro)s(ducing)h(smaller)i(\014les)f(without)h(distortion)g
+(noticeable)h(b)m(y)e(the)h(nak)m(ed)f(ey)m(e\).)630
+2000 y FB(5.3)112 b(PDF)p 0.05 1.00 1.00 0.40 TeXcolorcmyk
+630 2171 a FQ(Adob)s(e)p Black('s)41 b(P)m(ortable)h(Do)s(cumen)m(t)f
+(F)-8 b(ormat)43 b(\()p FJ(pdf)p FQ(\))e(shares)g(man)m(y)g
+(similarities)h(to)g(its)f(Adob)s(e)630 2284 y(sibling)i(P)m
+(ostScript.)80 b(Lik)m(e)44 b(P)m(ostScript,)k FJ(pdf)43
+b FQ(can)h(con)m(tain)g(text,)k(v)m(ector)d(dra)m(wings,)i(and)630
+2397 y(bitmap)25 b(dra)m(wings.)38 b(A)26 b FJ(pdf)f
+FQ(\014le)g(can)g(con)m(tain)i(an)e(en)m(tire)h(do)s(cumen)m(t)e(or)h
+(just)g(a)g(single)h(dra)m(wing)630 2510 y(\(similar)31
+b(to)g FJ(eps)p FQ(\).)771 2623 y FJ(pdf)f FQ(is)f(not)h(only)g(the)g
+(primary)e(output)h(format)h(of)g(p)s(dfT)2802 2642 y(E)2850
+2623 y(X,)g(but)f FJ(pdf)h FQ(also)g(is)g(the)g(most)630
+2736 y(common)40 b(metho)s(d)g(for)f(imp)s(orting)h(v)m(ector)i
+(graphics)e(in)m(to)h(p)s(dfT)2954 2755 y(E)3002 2736
+y(X.)70 b(Man)m(y)40 b(graphics)g(pro-)630 2849 y(grams)f(allo)m(w)i
+(their)e(graphics)g(output)f(to)i(b)s(e)e(directly)i(sa)m(v)m(ed)g(in)f
+FJ(pdf)g FQ(format.)67 b(Programs)630 2962 y(without)25
+b(direct)h FJ(pdf)f FQ(output)g(can)h(instead)g(output)e
+FJ(eps)g FQ(v)m(ector)j(graphics)f(whic)m(h)f(can)g(b)s(e)g(eas-)630
+3075 y(ily)31 b(con)m(v)m(erted)h(to)f FJ(pdf)f FQ(v)m(ector)i
+(graphics)e(b)m(y)g(the)h FM(epstopdf)d FQ(con)m(v)m(ersion)j(program)g
+(a)m(v)-5 b(ailable)630 3187 y(from)31 b FJ(ct)-7 b(an)31
+b FQ(as)h(a)f(Windo)m(ws)g(executable)i(or)e(as)h(a)f
+FM(perl)f FQ(script)i(for)f(use)f(on)i(other)f(platforms)630
+3300 y(suc)m(h)f(as)h(Unix/Lin)m(ux)f(or)g(MacOS)16 b(X)p
+Black Black 0.05 1.00 1.00 0.40 TeXcolorcmyk 1770
+3482 a FM(CTAN/support/epstopdf/)p Black 630 3724 a FB(5.4)112
+b(MetaP)m(ost)630 3896 y FQ(MetaP)m(ost)41 b(is)d(a)g(graphics)g
+(language)i(written)e(b)m(y)g(John)f(Hobb)m(y)i(that)f(is)h(based)e(on)
+h(Donald)630 4009 y(Kn)m(uth's)31 b Fv(met)-6 b(af)n(ont)p
+FQ(,)30 b(but)h(with)g(the)h(added)f(capabilit)m(y)i(of)f(outputting)g
+(P)m(ostScript.)45 b(Infor-)630 4122 y(mation)31 b(ab)s(out)f(MetaP)m
+(ost)j(is)d(a)m(v)-5 b(ailable)33 b(from)p Black Black
+0.05 1.00 1.00 0.40 TeXcolorcmyk 1531 4303 a FM
+(http://www.tug.org/metapos)o(t.h)o(tml)p Black 0.05 1.00 1.00 0.40
+TeXcolorcmyk 1171 4416 a(http://cm.bell-)t(labs.com/wh)o(o/ho)o(bby)o
+(/Met)o(aPos)o(t.h)o(tml)p Black 630 4598 a FQ(and)d(is)g(do)s(cumen)m
+(ted)g(in)g([)p 0.05 1.00 1.00 0.40 TeXcolorcmyk(25)p
+Black 2 w(].)771 4710 y(MetaP)m(ost)41 b(can)e(b)s(e)f(used)f(inn)h
+FM(dvips)p FQ(-st)m(yle)h(L)2391 4694 y FP(A)2430 4710
+y FQ(T)2481 4730 y(E)2531 4710 y(X)g(do)s(cumen)m(ts)f(and)g(also)h
+(can)g(b)s(e)f(used)630 4823 y(directly)930 4790 y FP(8)1000
+4823 y FQ(b)m(y)31 b(p)s(dfL)1284 4807 y FP(A)1323 4823
+y FQ(T)1374 4843 y(E)1422 4823 y(X)g(do)s(cumen)m(ts.)p
+Black 630 4919 1332 4 v 734 5008 a FF(7)768 5040 y FG(Lossy)g
+(compression)g(means)f(that)g(the)f(compression)i(pro)r(cess)g(loses)h
+(data.)47 b(That)30 b(is,)i(decompresssing)g(a)630 5131
+y(lossy-compressed)25 b(bitmap)e(do)r(es)h Fw(not)32
+b FG(pro)r(duce)23 b(the)g(original)j(bitmap.)33 b(Con)n(v)n(ersely)-6
+b(,)24 b(no)g(data)g(is)g(lost)g(during)g(a)630 5222
+y Fw(lossless)33 b FG(compression,)27 b(so)f(decompressing)h(a)f
+(lossless-compressed)j(bitmap)c(pro)r(duces)h(the)f(original)j(bitmap.)
+734 5318 y FF(8)768 5349 y FG(p)r(dfL)899 5332 y FF(A)932
+5349 y FG(T)974 5366 y(E)1018 5349 y(X)e(actually)h(uses)g(ConT)-6
+b(eXt)27 b(co)r(de)g(b)n(y)f(Hans)h(Hagen)f(to)h(con)n(v)n(ert)f(MetaP)
+n(ost)j(graphics)e(in)n(to)g FJ(pdf)630 5441 y FG(on-the-\015y)-6
+b(,)24 b(ho)n(w)n(ev)n(er)h(this)h(is)g(transparen)n(t)g(to)g(users.)p
+Black Black 2250 5640 a FQ(16)p Black eop end
+%%Page: 17 17
+TeXDict begin 17 16 bop Black 0 TeXcolorgray Black Black
+771 -149 a FQ(The)29 b(follo)m(wing)i(pro)s(cedure)e(uses)g(the)h
+FM(pstoedit)d FQ(utilit)m(y)k(along)f(with)g(MetaP)m(ost)i(\()p
+FM(mpost)p FQ(\))630 -49 y(to)d(con)m(v)m(ert)h(an)f
+FJ(eps)e FQ(\014le)h(named)g FM(graphic.eps)d FQ(in)m(to)30
+b(a)f(MetaP)m(ost)i(\014le)d(name)h FM(graphic.mps)p
+Black Black 979 92 a FN(pstoedit)40 b(-f)j(mpost)e(graphic.eps)e
+(graphic.mp)979 192 y(mpost)i(graphic.mp)979 291 y(rename)g(graphic.1)f
+(graphic.mps)630 576 y FB(5.5)112 b(PurifyEPS)630 748
+y FQ(Scott)46 b(P)m(akin's)g FM(purifyeps)d FQ(utilit)m(y)j(is)g(able)g
+(to)g(con)m(v)m(ert)g(man)m(y)g(\(but)f(not)g(all\))i
+FJ(eps)d FQ(to)i(a)630 861 y(\\puri\014ed")29 b(v)m(ersion)i(that)g
+(can)g(b)s(e)f(read)g(b)m(y)g(b)s(oth)g(L)2418 844 y
+FP(A)2457 861 y FQ(T)2508 880 y(E)2558 861 y(X)h(and)e(p)s(dfL)2990
+844 y FP(A)3029 861 y FQ(T)3080 880 y(E)3129 861 y(X.)771
+974 y(Y)-8 b(ou)31 b(need)f(all)h(of)g(the)f(follo)m(wing)i(in)e(order)
+g(to)h(run)e FM(purifyeps)p FQ(:)p Black 630 1161 a FL(PurifyEPS)p
+Black 46 w FQ(Av)-5 b(ailable)33 b(from)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 31 w FM(CTAN/support/purifyeps/)p Black
+25 w FQ(where)d FM(CTAN/)g FQ(should)g(b)s(e)h(re-)857
+1274 y(placed)g(b)m(y)f(an)m(y)h(of)g(the)f FJ(ct)-7
+b(an)31 b FQ(sites)g(listed)g(on)f(page)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 31 w(3)p Black(.)p Black 630 1462 a FL(P)m(erl)p
+Black 46 w FQ(Av)-5 b(ailable)32 b(from)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 30 w FM(http://www.cpan.org)p Black Black
+630 1650 a FL(psto)s(edit)p Black 45 w FQ(Av)-5 b(ailable)32
+b(from)p 0.05 1.00 1.00 0.40 TeXcolorcmyk 30 w FM
+(http://www.pstoedit.net/p)o(stoe)o(dit)p Black Black
+630 1837 a FL(mp)s(ost)p Black 46 w FQ(from)e(a)g(L)1272
+1820 y FP(A)1311 1837 y FQ(T)1362 1857 y(E)1413 1837
+y(X)g(distribution)g(that)h(includes)f(MetaP)m(ost.)630
+2124 y FD(6)135 b(Graphics)44 b(Soft)l(w)l(are)630 2330
+y FB(6.1)112 b(Ghostscript)630 2501 y FQ(Ghostscript)40
+b(is)g(a)f(P)m(ostScript/)p FJ(pdf)i FQ(in)m(terpreter)f(whic)m(h)f
+(runs)f(on)i(most)f(platforms)h(and)f(is)630 2614 y(distributed)h(for)h
+(free)1400 2581 y FP(9)1439 2614 y FQ(.)73 b(This)40
+b(allo)m(ws)j(P)m(ostScript,)h FJ(eps)p FQ(,)f(and)d
+FJ(pdf)h FQ(\014les)g(to)h(b)s(e)e(displa)m(y)m(ed)630
+2727 y(on)f(the)g(screen)g(and)f(prin)m(ted)g(to)i(b)s(oth)e(P)m
+(ostscript)i(and)e(non-P)m(ostScript)h(prin)m(ters.)66
+b(AFPL)630 2840 y(Ghostscript)31 b(is)f(a)m(v)-5 b(ailable)33
+b(from)d(the)g(Ghostscript)h(home)g(page)p Black Black
+0.05 1.00 1.00 0.40 TeXcolorcmyk 1579 3028 a FM
+(http://www.cs.wisc.edu/)2683 3045 y(~)2725 3028 y(ghost/)p
+Black 630 3215 a FQ(These)g(sites)g(con)m(tains)h(pre-compiled)f(Windo)
+m(ws/)p FJ(dos)p FQ(/OS/2)i(and)d(Macin)m(tosh)i(executables,)630
+3328 y(along)d(with)f(ready-to-compile)j(source)d(co)s(de)h(for)f
+(Unix/)p FJ(vms)p FQ(.)40 b(Also)29 b(a)m(v)-5 b(ailable)30
+b(are)f(graphical)630 3441 y(in)m(terfaces)38 b(\(suc)m(h)f(as)h
+(GSview,)g(Ghostview,)i(GV,)e(etc\))g(for)f(Ghostscript)g(whic)m(h)g
+(mak)m(es)h(the)630 3554 y(viewing)31 b(of)f(P)m(ostScript)h(m)m(uc)m
+(h)g(easier.)630 3798 y FB(6.2)112 b(Graphics-Con)m(v)m(ersion)40
+b(Programs)630 3969 y FQ(The)f(follo)m(wing)h(freew)m(are)g(and)f
+(sharew)m(are)g(programs)g(con)m(v)m(ert)h(b)s(et)m(w)m(een)g(graphics)
+f(format.)630 4082 y(In)29 b FM(dvips)p FQ(-st)m(yle)h(do)s(cumen)m
+(ts,)g(these)g(programs)g(can)g(con)m(v)m(ert)h(non-)p
+FJ(eps)d FQ(graphics)i(to)g FJ(eps)p FQ(.)40 b(In)630
+4195 y(p)s(dfL)787 4178 y FP(A)826 4195 y FQ(T)877 4215
+y(E)926 4195 y(X)d(do)s(cumen)m(ts,)i(these)e(program)g(can)h(con)m(v)m
+(ert)h(graphics)e(to)h(one)f(of)g(the)h(supp)s(orted)630
+4308 y(formats)44 b(\()p FJ(pdf)p FQ(,)49 b FJ(png)p
+FQ(,)e FJ(jpeg)p FQ(\).)82 b(Some)44 b(of)h(the)f(programs)g(allo)m(w)i
+(command-line)e(con)m(v)m(er-)630 4421 y(sion)33 b(whic)m(h)f(mak)m(es)
+h(it)g(p)s(ossible)f(to)i(con)m(v)m(ert)g(the)f(graphics)f
+(on-the-\015y)h(\(see)h(Section)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 33 w(14.2)p Black 34 w(on)630 4534 y(page)p
+0.05 1.00 1.00 0.40 TeXcolorcmyk 31 w(43)p Black(\).)p
+Black 630 4635 1332 4 v 734 4724 a FF(9)768 4756 y FG(Although)d(AFPL)g
+(Ghostscript)h(\(formerly)g(kno)n(wn)e(as)i(Aladdin)f(Ghostscript\))h
+(is)f(distributed)g(for)h(free,)630 4847 y(it)j(is)g(not)f(in)g(the)h
+(public)f(domain.)61 b(It)34 b(is)h(cop)n(yrigh)n(ted)f(and)g(comes)i
+(with)f(certain)g(limitations)h(suc)n(h)e(as)h(no)630
+4938 y(commercial)h(distribution.)60 b(When)34 b(v)n(ersions)h(of)g
+(Aladdin)f(Ghostscript)g(b)r(ecome)h(appro)n(ximately)g(one)f(y)n(ear)
+630 5030 y(old,)24 b(Aladdin)d(releases)j(them)e(as)h(\\GNU)f
+(Ghostscript")h(whose)g(use)g(is)f(go)n(v)n(erned)g(b)n(y)f(the)h
+(less-restrictiv)n(e)i(GNU)630 5121 y(Public)i(License.)p
+Black Black 2250 5640 a FQ(17)p Black eop end
+%%Page: 18 18
+TeXDict begin 18 17 bop Black 0 TeXcolorgray Black Black
+Black 630 -149 a FL(ImageMagic)m(k)p Black 857 1 a FQ(ImageMagic)m(k)35
+b(is)c(a)g(free)g(op)s(en-source)g(soft)m(w)m(are)i(suite)e(to)h
+(create,)h(edit,)f(and)f(comp)s(ose)857 114 y(bitmap)41
+b(images.)72 b(It)41 b(can)g(read,)i(con)m(v)m(ert)f(and)e(write)h
+(images)h(in)e(a)h(large)h(v)-5 b(ariet)m(y)42 b(of)857
+227 y(formats.)f(Images)31 b(can)f(b)s(e)f(cropp)s(ed,)g(colors)i(can)g
+(b)s(e)e(c)m(hanged,)i(v)-5 b(arious)30 b(e\013ects)h(can)g(b)s(e)857
+340 y(applied,)26 b(images)f(can)f(b)s(e)f(rotated)i(and)f(com)m
+(bined,)h(and)f(text,)i(lines,)g(p)s(olygons,)f(ellipses)857
+453 y(and)30 b(Bezier)i(curv)m(es)e(can)h(b)s(e)f(added)f(to)j(images)f
+(and)f(stretc)m(hed)h(and)f(rotated.)857 590 y(F)-8 b(or)36
+b(example,)i(when)c(ImageMagic)m(k's)39 b FM(convert)33
+b FQ(is)i(on)g(the)h(op)s(erating)g(system)f(path,)857
+690 y(the)c(follo)m(wing)h(command)p Black Black 1293
+867 a FN(convert)41 b(file.jpg)f(file.eps)857 1058 y
+FQ(stores)31 b(an)f FJ(eps)f FQ(v)m(ersion)i(of)38 b
+FM(file.jpg)28 b FQ(in)i FM(file.eps)p FQ(.)857 1195
+y(Multiple)h(\014les)g(can)f(b)s(e)g(con)m(v)m(erted)i(with)e(the)h
+(wildcard)p Black Black 1293 1372 a FN(convert)41 b(*.gif)g(images.png)
+857 1542 y FQ(creates)h FJ(png)d FQ(v)m(ersions)i(of)f(all)h(the)f
+FJ(gif)h FQ(\014les)f(in)f(the)i(curren)m(t)e(directory)i(and)e(stores)
+857 1633 y(them)31 b(as)p Black Black 1250 1802 a FE(images-0.png)1250
+1894 y(images-1.png)1250 1985 y(...)857 2176 y FQ(Sa)m(ving)f(the)g
+(resulting)h FJ(png)e FQ(\014les)g(with)g(the)h(same)g(base)f
+(\014lename)h(as)f(the)h(original)h FJ(gif)857 2289 y
+FQ(\014les)h(is)f(more)h(in)m(v)m(olv)m(ed)h(since)f(it)g(requires)f
+(writing)g(a)h(shell)g(script)f(or)h(Windo)m(ws)f(batc)m(h)857
+2402 y(\014le.)857 2552 y(ImageMagic)m(k)25 b(runs)20
+b(on)i(all)g(ma)5 b(jor)22 b(op)s(erating)g(systems)g(and)f(Binaries)i
+(and)e(information)857 2665 y(can)31 b(b)s(e)f(do)m(wnloaded)g(from)p
+Black Black 0.05 1.00 1.00 0.40 TeXcolorcmyk 1764
+2889 a FM(http://www.imagemagick.or)o(g/)p Black Black
+630 3113 a FL(GraphicsMagic)m(k)p Black 857 3263 a FQ(The)h(ImageMagic)
+m(k)j(in)m(terface)f(p)s(erio)s(dically)e(c)m(hanges,)i(causing)e
+(incompatibilit)m(y)i(with)857 3376 y(co)s(de)42 b(that)h(uses)e
+(ImageMagic)m(k.)79 b(As)42 b(a)g(result,)j(the)d(GraphicsMagic)m(k)i
+(pro)5 b(ject)43 b(w)m(as)857 3489 y(started)33 b(in)g(No)m(v)m(em)m(b)
+s(er)h(2002)g(as)f(a)g(fork)f(from)g(ImageMagic)m(k)k(5.5.2,)f(with)e
+(the)g(goal)h(of)857 3602 y(pro)m(viding)i(a)g(set)g(of)g(graphics-con)
+m(v)m(ersion)i(utilities)f(with)e(a)h(stable)h(in)m(terface)g(and)e(an)
+857 3715 y(emphasis)30 b(on)g(\014xing)g(bugs)g(o)m(v)m(er)i(adding)e
+(new)g(features.)857 3865 y(GraphicsMagic)m(k)f(runs)c(on)i(Unix/Lin)m
+(ux,)g(Cygwin,)g(MacOS)16 b(X,)27 b(and)f(Windo)m(ws.)39
+b(Bina-)857 3978 y(ries)31 b(and)e(source)i(co)s(de)g(can)f(b)s(e)g(do)
+m(wnloaded)g(from)p Black Black 0.05 1.00 1.00 0.40
+TeXcolorcmyk 1693 4202 a FM(http://www.graphicsmagi)o(ck.o)o(rg/)p
+Black Black 630 4426 a FL(NetPBM)p Black 857 4576 a FM(NetPBM)25
+b FQ(is)i(a)g(free)f(op)s(en-source)h(v)m(ersion)g(of)f(the)h(no)m
+(w-unsupp)s(orted)d FM(PBMPLUS)h FQ(pac)m(k)-5 b(age.)857
+4726 y FM(NetPBM)26 b FQ(is)i(a)g(to)s(olkit)h(for)f(manipulation)f(of)
+h(graphic)g(images,)i(including)d(con)m(v)m(ersion)i(of)857
+4839 y(images)c(b)s(et)m(w)m(een)f(a)g(v)-5 b(ariet)m(y)25
+b(of)e(di\013eren)m(t)h(formats.)39 b(There)23 b(are)h(o)m(v)m(er)h
+(220)g(separate)f(to)s(ols)857 4952 y(in)d(the)g(pac)m(k)-5
+b(age)23 b(including)e(con)m(v)m(erters)h(for)f(ab)s(out)g(100)h
+(graphics)f(formats.)38 b FM(NetPBM)19 b FQ(uses)857
+5065 y(the)31 b(commandline)f(and)g(do)s(esn't)g(ha)m(v)m(e)i(a)f
+(graphical)g(in)m(terface.)857 5215 y(Most)42 b(Lin)m(ux)f
+(distributions)f(and)h(the)g(Cygwin)g(Pro)5 b(ject)42
+b(include)e FM(NetPBM)g FQ(pac)m(k)-5 b(ages.)857 5328
+y(Binary)38 b(distributions)e(of)45 b FM(NetPBM)36 b
+FQ(for)h(Windo)m(ws,)j(MacOS)15 b(X,)38 b(and)f(other)g(op)s(erating)
+857 5441 y(systems)31 b(can)f(b)s(e)g(do)m(wnloaded)h(from)p
+Black 2250 5640 a(18)p Black eop end
+%%Page: 19 19
+TeXDict begin 19 18 bop Black 0 TeXcolorgray Black Black
+Black Black 0.05 1.00 1.00 0.40 TeXcolorcmyk 1693
+-149 a FM(http://netpbm.sourcefor)o(ge.n)o(et/)p Black
+Black 630 76 a FL(Irfan)m(view)p Black 857 227 a FQ(Irfan)m(view)41
+b(is)f(an)h(excellen)m(t,)k(easy-to-install)f(graphic)d(view)m(er)g
+(for)f(Windo)m(ws)h(that)g(is)857 339 y(compact)34 b(and)d(fast.)47
+b(Irfan)m(view)32 b(supp)s(orts)e(viewing)j(and)f(con)m(v)m(erting)i(b)
+s(et)m(w)m(een)f(a)f(wide)857 452 y(v)-5 b(ariet)m(y)45
+b(of)e(\014le)h(formats,)i(and)d(pro)m(vides)g(basic)h(image)g(editing)
+g(\(suc)m(h)g(as)f(cropping,)857 565 y(resampling,)35
+b(color/brigh)m(tness)h(adjustmen)m(ts,)f(etc\).)53 b(Irfan)m(view)33
+b(supp)s(orts)f(b)s(oth)i(GUI)857 678 y(and)c(commandline)h(op)s
+(eration,)g(including)f(batc)m(h)h(mo)s(de.)857 815 y(F)-8
+b(or)41 b(example,)i(when)38 b(Irfan)m(view's)i(executable)h
+FM(i)p 2649 815 29 4 v 34 w(view32.exe)c FQ(is)j(on)f(the)h(Windo)m(ws)
+857 915 y(path,)31 b(the)f(follo)m(wing)i(command)p Black
+Black 1293 1093 a FN(i_view32)40 b(*.gif)i(/convert=*.png)857
+1285 y FQ(creates)33 b FJ(png)d FQ(v)m(ersions)h(of)h(all)f(the)h
+FJ(gif)f FQ(\014les)g(in)f(the)i(curren)m(t)e(directory)-8
+b(,)33 b(storing)e(them)857 1398 y(in)f(\014les)f(with)h
+FM(.png)e FQ(extensions)i(and)g(the)f(same)h(base)g(name)g(as)g(the)g
+(original)h FJ(gif)f FQ(\014les.)857 1548 y(Irfan)m(view)h(can)f(b)s(e)
+g(do)m(wnloaded)g(from)p Black Black 0.05 1.00 1.00 0.40
+TeXcolorcmyk 1812 1773 a FM(http://www.irfanview.com)o(/)p
+Black 857 1998 a FQ(Irfan)m(view)c(is)h(freew)m(are)g(for)f(p)s
+(ersonal,)h(academic,)h(and)e(non-pro\014t)f(users.)39
+b(Commercial)857 2111 y(users)30 b(are)h(ask)m(ed)g(to)g(donate)g(a)f
+FK($)p FQ(12)i(registration)g(fee.)p Black 630 2299 a
+FL(Graphic)k(Con)m(v)m(erter)p Black 857 2449 a FQ(Graphic)48
+b(Con)m(v)m(erter)h(is)f FK($)p FQ(30)h(sharew)m(are)g(for)f(Macin)m
+(tosh)h(whic)m(h)f(reads)g(ab)s(out)g(190)857 2562 y(graphic)31
+b(formats)f(and)g(exp)s(orts)g(ab)s(out)g(75)h(formats.)41
+b(F)-8 b(or)31 b(information,)g(see)p Black Black 0.05 1.00 1.00 0.40
+TeXcolorcmyk 1836 2787 a FM(http://www.lemkesoft.de/)p
+Black Black 630 3012 a FL(WMF2EPS)p Black 857 3162 a
+FM(WMF2EPS)36 b FQ(is)i(a)h FK($)p FQ(20)g(sharew)m(are)f
+FJ(wmf)p FQ(-to-)p FJ(eps)i FQ(con)m(v)m(ersion)f(program)f(whic)m(h)g
+(runs)e(on)857 3275 y(Windo)m(ws.)41 b(It)31 b(is)f(a)m(v)-5
+b(ailable)33 b(from)p Black Black 0.05 1.00 1.00 0.40
+TeXcolorcmyk 1717 3500 a FM(CTAN/nonfree/support/wm)o(f2e)o(ps/)p
+Black 857 3725 a FQ(where)d FM(CTAN/)f FQ(should)g(b)s(e)h(replaced)h
+(b)m(y)f(an)m(y)h(of)g(the)f FJ(ct)-7 b(an)31 b FQ(sites)g(listed)g(on)
+f(page)p 0.05 1.00 1.00 0.40 TeXcolorcmyk 31 w(3)p
+Black(.)857 3875 y(The)g(soft)m(w)m(are)i(can)f(also)g(b)s(e)f(do)m
+(wnloaded)g(from)g(the)h FM(WMF2EPS)d FQ(homepage)p Black
+Black 0.05 1.00 1.00 0.40 TeXcolorcmyk 1812 4100 a
+FM(http://www.wmf2eps.de.vu)o(/)p Black 857 4325 a FQ(The)20
+b(homepage)h(also)g(includes)f(other)h(information,)i(including)d
+(links)g(to)h(Adob)s(e-compatible)857 4438 y(prin)m(ter)30
+b(driv)m(ers)g(\(whic)m(h)h(is)f(required)g(for)g FM(WMF2EPS)p
+FQ(\).)p Black 630 4626 a FL(KVEC)p Black 857 4776 a
+FJ(kvec)24 b FQ(is)g(sharew)m(are)h(\()p FK($)p FQ(25)g(for)f
+(non-commercial)h(use,)h FK($)p FQ(50)f(for)e(commercial)j(use\))e
+(whic)m(h)857 4889 y(con)m(v)m(erts)46 b(bitmap)d(graphics)h(\()p
+FJ(bmp)p FQ(,)k FJ(gif)p FQ(,)g FJ(tiff)p FQ(,)g(etc\))e(in)m(to)f(P)m
+(ostScript)f(and)g(other)857 5002 y(v)m(ector)25 b(formats.)38
+b FJ(kvec)23 b FQ(is)g(a)m(v)-5 b(ailable)25 b(for)d(Windo)m(ws,)j
+(OS/2,)g(Lin)m(ux,)f(Unix,)g(Macin)m(tosh,)857 5115 y(and)30
+b(BeOS.)h(More)g(information)f(is)h(a)m(v)-5 b(ailable)33
+b(at)p Black Black 0.05 1.00 1.00 0.40 TeXcolorcmyk
+1979 5340 a FM(http://www.kvec.de)p Black Black 2250
+5640 a FQ(19)p Black eop end
+%%Page: 20 20
+TeXDict begin 20 19 bop Black 0 TeXcolorgray Black Black
+Black 630 -149 a FL(xv)p Black 857 2 a FM(xv)36 b FQ(is)g(an)h(in)m
+(teractiv)m(e)i(image)e(manipulation)g(program)f(for)g(the)h(X)f(Windo)
+m(w)h(System.)857 115 y(While)31 b(it)g(has)e(graphics-con)m(v)m
+(ersion)j(capabilit)m(y)-8 b(,)33 b FM(xv)c FQ(w)m(as)h(designed)g(for)
+g(image)h(manip-)857 227 y(ulation)g(program)g(and)e(th)m(us)h(is)h
+(not)g(tailored)g(for)f(graphics)h(con)m(v)m(ersion)g(\(for)g(example,)
+857 340 y(it)f(do)s(es)e(not)i(pro)m(vide)f(command-line)g
+(capabilities)i(so)e(graphics)g(m)m(ust)g(b)s(e)f(one-b)m(y-one.)857
+491 y FM(xv)i FQ(is)h FK($)p FQ(25)h(sharew)m(are)f(for)g
+(non-commercial)h(use,)f(with)f(the)h FK($)p FQ(25)h(registration)g
+(manda-)857 604 y(tory)f(for)f(commercial)i(use.)41 b(More)31
+b(information)f(is)h(a)m(v)-5 b(ailable)33 b(from)p Black
+Black 0.05 1.00 1.00 0.40 TeXcolorcmyk 1645 828 a
+FM(http://www.trilon.com/xv)o(/xv.)o(html)p Black Black
+630 1053 a FL(GIMP)p Black 857 1204 a FJ(gimp)45 b FQ(\()p
+FJ(gnu)h FQ(Image)g(Manipulation)g(Program\))g(is)g(a)f(freely)h(a)m(v)
+-5 b(ailable)48 b(image)e(ma-)857 1317 y(nipulation)32
+b(program)g(whic)m(h)g(duplicates)g(m)m(uc)m(h)g(of)g(the)h
+(functionalit)m(y)g(of)f(PhotoShop.)857 1430 y FJ(gimp)e
+FQ(is)h(a)m(v)-5 b(ailable)32 b(for)f(Unix/Lin)m(ux,)f(Windo)m(ws,)h
+(and)e(MacOS)16 b(X.)31 b(More)g(information)857 1542
+y(is)g(a)m(v)-5 b(ailable)32 b(at)p Black Black 0.05 1.00 1.00 0.40
+TeXcolorcmyk 1931 1767 a FM(http://www.gimp.org/)p Black
+630 2011 a FB(6.3)112 b(Lev)m(el)38 b(2)g(EPS)f(W)-9
+b(rapp)s(ers)630 2183 y FQ(Lev)m(el)39 b(2)f(P)m(ostScript)g(supp)s
+(orts)d(sev)m(eral)k(compression)f(sc)m(hemes,)i(including)d(DCT)g
+(\(used)g(in)630 2295 y FJ(jpeg)c FQ(\014les\))g(and)g
+FJ(lzw)i FQ(\(used)e(in)g(man)m(y)i FJ(tiff)f FQ(\014les\).)50
+b(Additionally)-8 b(,)36 b(this)d(binary)g(data)h(can)630
+2408 y(b)s(e)40 b FJ(asci)r(i)p FQ(-enco)s(ded)g(as)h
+FJ(asci)r(i)p FQ(85)g(or)f FJ(asci)r(i)p FQ(Hex)h(\(whic)m(h)g(pro)s
+(duces)e FJ(asci)r(i)h FQ(\014les)g(whic)m(h)h(are)630
+2521 y(125\045)30 b(and)e(200\045,)i(resp)s(ectiv)m(ely)-8
+b(,)31 b(of)d(the)h(original)h(binary)e(size\).)41 b(The)28
+b(fact)i(that)f(Lev)m(el-2)h FJ(eps)630 2634 y FQ(supp)s(orts)e(these)i
+(compression)f(sc)m(hemes)h(allo)m(ws)h(a)f(Lev)m(el-2)i
+FJ(eps)c FQ(\014le)i(to)g(b)s(e)f(constructed)h(as)g(a)630
+2747 y(wrapp)s(er)i(around)h(a)h FJ(jpeg)f FQ(\014le)g(or)h
+FJ(tiff)g FQ(\014le.)51 b(This)33 b(pro)s(duces)g(b)s(etter)g(qualit)m
+(y)i(and)e(smaller)630 2860 y(\014les)22 b(than)h(con)m(v)m(erting)h
+(the)f(graphics)f(to)h(con)m(v)m(en)m(tional)j FJ(eps)p
+FQ(.)37 b(If)22 b(one)h(has)f(a)h(Lev)m(el)g(2)g(P)m(ostScript)630
+2973 y(prin)m(ter,)30 b(it)h(is)g(b)s(etter)f(to)h(use)f(the)h(follo)m
+(wing)g(wrapp)s(er)e(programs)h(instead)h(of)f(the)h(con)m(v)m(ersion)
+630 3086 y(programs)37 b(listed)h(ab)s(o)m(v)m(e.)63
+b(Since)37 b(the)h(resulting)f(P)m(ostScript)h(\014les)f(can)h(only)f
+(b)s(e)g(prin)m(ted)g(on)630 3199 y(Lev)m(el)32 b(2)e(prin)m(ters,)h
+(the)f(do)s(cumen)m(ts)g(are)h(less)g(p)s(ortable.)771
+3312 y(Note)37 b(that,)g(b)m(y)e(default,)i FM(dvips)d
+FQ(strips)h(the)g(commen)m(t)h(lines)g(\(those)g(lines)f(whic)m(h)g(b)s
+(egin)630 3425 y(with)22 b FM(\045\045)p FQ(\))f(from)h(an)m(y)g
+(included)g FJ(eps)e FQ(graphics.)38 b(Since)22 b FJ(asci)r(i)p
+FQ(85-enco)s(ded)h(lev)m(el-2)i(graphics)d(can)630 3537
+y(ha)m(v)m(e)29 b(lines)e(b)s(eginning)g(with)g FM(\045\045)p
+FQ(,)g(users)g(including)h FJ(asci)r(i)p FQ(85-enco)s(ded)g(lev)m(el-2)
+i FJ(eps)c FQ(\014les)h(m)m(ust)630 3650 y(use)36 b(the)h
+FM(dvips)47 b(-K0)35 b FQ(\(K)i(follo)m(w)m(ed)h(b)m(y)f(a)g(zero\))h
+(option)f(to)g(prev)m(en)m(t)g FM(dvips)f FQ(from)g(stripping)630
+3763 y(commen)m(t)31 b(lines.)41 b(Note)32 b FJ(asci)r(i)p
+FQ(Hex)f(lev)m(el-2)i(enco)s(ding)d(do)s(es)g(not)h(ha)m(v)m(e)g(this)g
+(problem.)p Black 630 3976 a FL(jp)s(eg2ps)p Black 857
+4126 a FQ(A)45 b FJ(jpeg)e FQ(graphic)h(can)h(b)s(e)f(con)m(v)m(erted)h
+(to)g(lev)m(el)h(2)f(P)m(ostScript)g(b)m(y)f(the)g(C)g(program)857
+4239 y FM(jpeg2ps)p FQ(,)37 b(whic)m(h)g(can)g(b)s(e)g(compiled)g
+(Unix,)i FJ(dos)p FQ(,)g(and)e(other)g(systems.)61 b
+FM(jpeg2ps)35 b FQ(is)857 4352 y(a)m(v)-5 b(ailable)33
+b(from)p Black Black 0.05 1.00 1.00 0.40 TeXcolorcmyk
+1717 4577 a FM(CTAN/nonfree/support/jp)o(eg2)o(ps/)p
+Black 0.05 1.00 1.00 0.40 TeXcolorcmyk 1263 4690 a
+(http://www.pdflib.com/pro)o(duct)o(s/m)o(ore/)o(jpeg)o(2ps)o(.htm)o(l)
+p Black 0.05 1.00 1.00 0.40 TeXcolorcmyk 1168 4803
+a(http://gnuwin32.sourcef)o(orge)o(.net)o(/pa)o(ckag)o(es/j)o(peg)o
+(2ps.)o(htm)p Black 857 5028 a FQ(where)d FM(CTAN/)f
+FQ(should)g(b)s(e)h(replaced)h(b)m(y)f(an)m(y)h(of)g(the)f
+FJ(ct)-7 b(an)31 b FQ(sites)g(listed)g(on)f(page)p
+0.05 1.00 1.00 0.40 TeXcolorcmyk 31 w(3)p Black(.)857
+5178 y FM(jpeg2ps)44 b FQ(supp)s(orts)f(three)i(t)m(yp)s(es)h(of)f(lev)
+m(el-2)j(enco)s(ding:)70 b FJ(asci)r(i)p FQ(85)46 b(\(default\),)k
+(8-bit)857 5291 y(binary)30 b(\(using)h FM(jpeg2ps)46
+b(-b)p FQ(\),)31 b(or)f(7-bit)h FJ(asci)r(i)p FQ(Hex)g(\(using)g
+FM(jpeg2ps)46 b(-h)p FQ(\).)p Black 2250 5640 a(20)p
+Black eop end
+%%Page: 21 21
+TeXDict begin 21 20 bop Black 0 TeXcolorgray Black Black
+Black 630 -149 a FL(ti\0132ps)p Black 857 2 a FQ(A)29
+b FJ(tiff)h FQ(graphic)e(can)i(b)s(e)e(con)m(v)m(erted)i(to)f
+FJ(lzw)q FQ(-enco)s(ded)h(Lev)m(el-2)g(P)m(ostScript)g(b)m(y)e(using)
+857 115 y FM(tiff2ps)p FQ(,)e(whic)m(h)h(can)h(b)s(e)e(compiled)i(on)f
+(Unix,)h FJ(dos)p FQ(,)g(Mac,)h(and)e FJ(vms)g FQ(platforms.)39
+b(The)857 227 y(source)31 b(co)s(de)f(for)h FM(tiff2ps)d
+FQ(is)i(a)m(v)-5 b(ailable)33 b(from)d(the)h(follo)m(wing)g(three)g
+(sites)p Black Black 0.05 1.00 1.00 0.40 TeXcolorcmyk
+1118 452 a FM(http://www-)t(mipl.jpl.nasa.)o(gov)o(/)2512
+470 y(~)2554 452 y(ndr/tiff/html/tools.html)p Black
+0.05 1.00 1.00 0.40 TeXcolorcmyk 1645 565 a
+(ftp://ftp.sgi.com/graphi)o(cs/t)o(iff/)p Black Black
+630 790 a FL(ImageMagic)m(k's)36 b(lev)m(el-2)f(EPS)g(Capabilit)m(y)p
+Black 857 927 a FQ(As)h(describ)s(ed)f(in)h(Section)p
+0.05 1.00 1.00 0.40 TeXcolorcmyk 37 w(6.2)p Black
+38 w(on)g(page)p 0.05 1.00 1.00 0.40 TeXcolorcmyk
+37 w(17)p Black(,)i(ImageMagic)m(k)i(can)c(con)m(v)m(ert)i(b)s(et)m(w)m
+(een)f(a)857 1027 y(large)h(n)m(um)m(b)s(er)e(of)h(graphics)g(formats.)
+60 b(Since)37 b(one)g(of)g(these)h(formats)f(is)g(lev)m(el-2)i
+FJ(eps)p FQ(,)857 1127 y(ImageMagic)m(k)e(has)c(the)g(same)h
+(functionalit)m(y)h(as)e(the)h(lev)m(el-2)h(wrapp)s(ers)d(listed)h(ab)s
+(o)m(v)m(e.)857 1226 y(F)-8 b(or)31 b(example,)p Black
+Black 1075 1405 a FN(convert)84 b(file.jpeg)g(file.eps2)857
+1596 y FQ(creates)32 b(a)f(lev)m(el-2)i FJ(eps)c FQ(v)m(ersion)i(of)37
+b FM(file.jpeg)28 b FQ(and)i(stores)h(it)g(in)f FM(file.eps2)p
+FQ(.)630 1840 y FB(6.4)112 b(Editing)38 b(P)m(ostScript)630
+2012 y FQ(While)h(the)g(graphics)g(in)f(an)g FJ(eps)f
+FQ(\014le)i(can)g(b)s(e)f(mo)s(di\014ed)f(b)m(y)i(editing)g(the)g
+(\014le's)f(P)m(ostScript)630 2124 y(commands,)31 b(this)g(is)g
+(di\016cult)g(for)g(most)g(p)s(eople.)42 b(Instead,)32
+b(it)f(is)g(easier)h(to)g(use)e(the)h(follo)m(wing)630
+2237 y(programs)f(to)h(edit)g FJ(eps)e FQ(graphics)p
+Black 630 2425 a FL(psto)s(edit)p Black 857 2575 a FM(pstoedit)24
+b FQ(is)j(a)f(free)h(program)f(for)g(Unix/Lin)m(ux)g(and)g(Windo)m(ws)g
+(whic)m(h)g(con)m(v)m(erts)i(P)m(ost-)857 2688 y(Script)40
+b(and)f(PDF)i(graphics)f(in)m(to)h(v)m(ector)h(formats)e(\(suc)m(h)h
+(as)f FM(Xfig)p FQ('s)f FM(.fig)g FQ(format\).)857 2801
+y(More)31 b(information)g(is)f(a)m(v)-5 b(ailable)33
+b(at)p Black Black 0.05 1.00 1.00 0.40 TeXcolorcmyk
+1836 3026 a FM(http://www.pstoedit.com/)p Black Black
+630 3251 a FL(Ma)m(yura)i(Dra)m(w)p Black 857 3401 a
+FQ(Ma)m(yura)j(Dra)m(w)g(\(formerly)g(kno)m(wn)f(as)g(P)m(ageDra)m(w\))
+j(is)e FK($)p FQ(39)g(sharew)m(are)g(for)f(Windo)m(ws)857
+3514 y(3.1/95/NT)c(whic)m(h)d(is)h(a)m(v)-5 b(ailable)33
+b(from)p Black Black 0.05 1.00 1.00 0.40 TeXcolorcmyk
+1884 3739 a FM(http://www.mayura.com/)p Black 857 3964
+a FQ(When)d(used)g(with)g(ghostscript,)h(Ma)m(yura)g(Dra)m(w)g(can)g
+(edit)g(P)m(ostScript)g(\014les.)p Black 630 4152 a FL(x\014g)p
+Black 857 4302 a FM(Xfig)e FQ(is)i(a)g(free)f(dra)m(wing)g(program)h
+(for)f(Unix/Xwindo)m(w)g(a)m(v)-5 b(ailable)33 b(from)p
+Black Black 0.05 1.00 1.00 0.40 TeXcolorcmyk 1931
+4527 a FM(http://www.xfig.org/)p Black 857 4752 a(Xfig)44
+b FQ(can)h(imp)s(ort)f FJ(eps)f FQ(dra)m(wings)i(and)f(add)g
+(annotations,)50 b(but)44 b(curren)m(tly)g(cannot)857
+4865 y(mo)s(dify)30 b(the)g(original)i FJ(eps)d FQ(graphics.)p
+Black 2250 5640 a(21)p Black eop end
+%%Page: 22 22
+TeXDict begin 22 21 bop Black 0 TeXcolorgray Black Black
+630 -149 a FD(P)l(art)46 b(I)t(I)630 59 y FA(The)64 b(L)1071
+23 y FD(A)1144 59 y FA(T)1247 97 y(E)1350 59 y(X)h(Graphics)f(Bundle)
+630 289 y FQ(This)32 b(part)g(pro)m(vides)h(an)f(o)m(v)m(erview)i(of)f
+(The)f(L)2224 272 y FP(A)2263 289 y FQ(T)2314 309 y(E)2364
+289 y(X)h(Graphics)f(Bundle.)47 b(More)33 b(detail)h(can)f(b)s(e)630
+402 y(found)g(in)h(the)h(graphics)f(bundle)f(do)s(cumen)m(tation)i([)p
+0.05 1.00 1.00 0.40 TeXcolorcmyk(7)p Black 1 w(])g(or)f(the)h
+Fy(L)2881 385 y Fu(A)2920 402 y Fy(T)2970 422 y(E)3019
+402 y(X)h(Gr)-5 b(aphics)38 b(Comp)-5 b(anion)630 515
+y FQ([)p 0.05 1.00 1.00 0.40 TeXcolorcmyk(4)p Black
+1 w(].)630 801 y FD(7)135 b(Graphics)44 b(Inclusion)630
+1004 y FQ(Graphics)30 b(are)h(imp)s(orted)f(using)g(the)g
+FO(graphicx)h FQ(pac)m(k)-5 b(age's)32 b FM(\\includegraphics)26
+b FQ(command)771 1117 y FB(Syn)m(tax:)142 b FR
+(\\includegraphics[options])q({fil)q(enam)q(e})630 1280
+y FQ(where)26 b(the)g(options)h(are)g(listed)g(in)f(T)-8
+b(ables)p 0.05 1.00 1.00 0.40 TeXcolorcmyk 26 w(1)p
+Black(,)p 0.05 1.00 1.00 0.40 TeXcolorcmyk 28 w(2)p
+Black(,)28 b(and)p 0.05 1.00 1.00 0.40 TeXcolorcmyk
+26 w(3)p Black(.)39 b(Since)27 b FM(\\includegraphics)22
+b FQ(do)s(es)k(not)630 1393 y(end)k(the)g(curren)m(t)g(paragraph,)h(it)
+f(can)h(place)g(graphics)g(within)f(text)h(suc)m(h)f(as)h
+@beginspecial 95 @llx 100 @lly 185 @urx 200 @ury 89 @rhi
+@setspecial
+%%BeginDocument: pretzel.eps
+%! pretzel.eps
+%%BoundingBox: 95 100 185 200
+
+5 setlinewidth
+1 setlinecap
+110 100 moveto
+120 120 140 160 160 160 curveto
+170 160 180 150 180 140 curveto
+180 120 160 100 140 100 curveto
+120 100 100 120 100 140 curveto
+100 150 110 160 120 160 curveto
+140 160 160 120 170 100 curveto
+stroke
+showpage
+
+%%EndDocument
+ @endspecial 97 w(or)g @beginspecial 27.469999 @llx 27.469999
+@lly 172.520004 @urx 172.520004 @ury 79 @rhi @setspecial
+%%BeginDocument: cm.eps
+%!
+%%BoundingBox: 27.47 27.47 172.52 172.52
+
+100 100 translate
+newpath
+ 0 0 moveto
+ 0 0 72 0 90 arc
+ closepath
+ fill
+
+ 0 0 moveto
+ 0 0 72 90 180 arc
+ closepath
+ stroke
+
+ 0 0 moveto
+ 0 0 72 180 270 arc
+ closepath
+ fill
+
+ 0 0 moveto
+ 0 0 72 270 360 arc
+ closepath
+ stroke
+
+showpage
+
+%%EndDocument
+ @endspecial 66 w(.)630 1636 y FB(7.1)112 b(Graphics)39
+b(Driv)m(er)630 1808 y FQ(The)i(user)g(m)m(ust)h(sp)s(ecify)g(a)g
+(graphics)g(driv)m(er)f(whic)m(h)h(tells)h(the)f(graphics)g(pac)m(k)-5
+b(age)43 b(ho)m(w)f(to)630 1921 y(pro)s(cess)34 b(the)h(imp)s(orted)f
+(graphic.)53 b(The)34 b(graphics)h(bundle)e(curren)m(tly)h(supp)s(orts)
+f(18)i(di\013eren)m(t)630 2034 y(driv)m(ers,)42 b(but)e(this)g(do)s
+(cumen)m(t)f(only)i(co)m(v)m(ers)g(the)f(t)m(w)m(o)i(most)e(common)g
+(driv)m(ers:)60 b(the)40 b FM(dvips)630 2147 y FQ(driv)m(er)g(for)g
+FM(dvips)p FQ(-st)m(yle)h(do)s(cumen)m(ts)1969 2114 y
+FP(10)2084 2147 y FQ(and)f(the)h FM(pdftex)d FQ(driv)m(er)j(for)f(for)g
+(p)s(dfL)3493 2130 y FP(A)3532 2147 y FQ(T)3583 2166
+y(E)3632 2147 y(X)g(do)s(cu-)630 2260 y(men)m(ts.)54
+b(If)35 b(the)g(user)f(w)m(an)m(ts)h(to)h(use)f(either)g(of)g(these)g
+(driv)m(ers,)h(the)f(driv)m(er)g(usually)f(do)s(es)h(not)630
+2373 y(need)f(to)g(b)s(e)f(explicitly)j(sp)s(eci\014ed,)e(as)g(the)g
+FM(graphics.cfg)c FQ(in)k(most)g(L)3122 2356 y FP(A)3161
+2373 y FQ(T)3212 2392 y(E)3262 2373 y(X)g(distributions)f(is)630
+2485 y(smart)d(enough)g(to)i(sp)s(ecify)e(the)g(correct)i(driv)m(er)
+2307 2452 y FP(11)2381 2485 y FQ(.)630 2648 y(If)e(the)g(user)g(needs)g
+(to)h(sp)s(ecify)f(a)h(driv)m(er,)f(it)h(can)g(b)s(e)f(sp)s(eci\014ed)f
+(in)h(one)h(of)g(three)f(w)m(a)m(ys)p Black Black -3569
+w FL(Sp)s(ecifying)131 2761 y(A)k(Driv)m(er)p Black 741
+2791 a FQ(1.)p Black 46 w(The)c(default)h(can)f(b)s(e)g(sp)s(eci\014ed)
+g(in)g(the)g FM(graphics.cfg)d FQ(\014le.)p Black 741
+2941 a(2.)p Black 46 w(An)m(y)h(driv)m(er)f(sp)s(eci\014ed)g(as)h(a)g
+FM(\\documentclass)23 b FQ(option)28 b(o)m(v)m(errides)h(the)e(driv)m
+(er)h(sp)s(eci\014ed)857 3054 y(in)i FM(graphics.cfg)p
+FQ(.)p Black 741 3204 a(3.)p Black 46 w(An)m(y)43 b(driv)m(er)f(sp)s
+(eci\014ed)g(as)h(an)g(option)g(in)f FM(\\usepackage{graphics})37
+b FQ(o)m(v)m(errides)44 b(the)857 3317 y(driv)m(ers)30
+b(sp)s(eci\014ed)g(in)g(the)h(previous)e(t)m(w)m(o)j(manners.)630
+3561 y FB(7.2)112 b(Graphics)39 b(Inclusion)f(for)f(D)m(VIPS-st)m(yle)g
+(Do)s(cumen)m(ts)630 3719 y FQ(The)g(b)s(est-supp)s(orted)e(graphics)j
+(format)g(for)f FM(dvips)p FQ(-st)m(yle)g(do)s(cumen)m(ts)h(is)f
+FJ(eps)p FQ(.)61 b(When)37 b(the)630 3819 y(do)s(cumen)m(t)30
+b(is)h(pro)s(cessed)e(with)i FM(latex)p FQ(,)e(the)h(follo)m(wing)i
+(command)p Black Black 892 3960 a FN(\\includegraphic)o(s{)o(fil)o(e.)o
+(eps)o(})630 4101 y FQ(includes)43 b(the)g(graphics)g(from)g(the)h
+FJ(eps)d FQ(\014le)j FM(file.eps)d FQ(at)j(its)f(natural)h(size.)80
+b(When)43 b(the)630 4201 y(sp)s(eci\014ed)30 b(\014lename)g(has)g(no)h
+(extension)p Black Black 892 4342 a FN(\\includegraphic)o(s{)o(fil)o
+(e})630 4496 y FQ(then)20 b FM(\\includegraphics)c FQ(app)s(ends)i(the)
+j(extensions)g(in)e(the)i FM(\\DeclareGraphicsExtensio)o(ns)630
+4609 y FQ(extension)31 b(list)g(\(See)g(Section)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 31 w(9.1)p Black 32 w(on)f(page)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 31 w(29)p Black(\).)p Black 630 4710 1332
+4 v 703 4799 a FF(10)768 4831 y FG(Where)24 b FE(latex)h
+FG(pro)r(cesses)g(the)e(L)1712 4814 y FF(A)1745 4831
+y FG(T)1787 4847 y(E)1831 4831 y(X)g(\014le)h(in)n(to)g(a)g
+FJ(d)n(vi)g FG(\014le,)g(whic)n(h)g(then)f(is)h(subsequen)n(tly)e(pro)r
+(cessed)j(in)n(to)630 4922 y(P)n(ostScript)h(form)g(b)n(y)g
+FE(dvips)p FG(.)703 5018 y FF(11)768 5049 y FG(The)h
+FE(graphics.cfg)h FG(\014le)f(detects)f(whether)g(the)g(do)r(cumen)n(t)
+f(is)i(b)r(eing)f(pro)r(cessed)h(b)n(y)f FE(latex)i FG(or)e
+FE(pdflatex)630 5141 y FG(and)f(sp)r(eci\014es)i(a)f
+FE(dvips)g FG(option)g(when)g(for)g FE(latex)h FG(and)f(a)f
+FE(pdftex)i FG(option)f(for)h FE(pdflatex)p FG(.)p Black
+Black 2250 5640 a FQ(22)p Black eop end
+%%Page: 23 23
+TeXDict begin 23 22 bop Black 0 TeXcolorgray Black Black
+630 -149 a FB(7.3)112 b(Graphics)39 b(Inclusion)f(for)f(p)s(dfL)2200
+-171 y FI(A)2244 -149 y FB(T)2303 -127 y(E)2364 -149
+y(X)g(Do)s(cumen)m(ts)630 10 y FQ(p)s(dfT)814 29 y(E)862
+10 y(X)31 b(supp)s(orts)e(the)h(direct)h(imp)s(orting)g(of)37
+b FJ(pdf)p FQ(,)31 b FJ(png)p FQ(,)g FJ(jpeg)p FQ(,)f(and)g(MetaP)m
+(ost)j(graphics.)630 109 y(When)d(the)h(do)s(cumen)m(t)f(is)g(pro)s
+(cessed)g(with)g FM(pdflatex)p FQ(,)f(the)h(follo)m(wing)i(commands)p
+Black Black 1066 250 a FN(\\includegraphics)o({f)o(ile)o(.p)o(df})1066
+450 y(\\includegraphics)o({f)o(ile)o(.p)o(ng})1066 649
+y(\\includegraphics)o({f)o(ile)o(.j)o(pg})1066 848 y(\\includegraphics)
+o({f)o(ile)o(.m)o(ps})630 989 y FQ(include)37 b(the)g(graphics)g(from)g
+(the)g FJ(pdf)g FQ(\014le)g FM(file.pdf)p FQ(,)g(the)g
+FJ(png)f FQ(\014le)i FM(file.png)p FQ(,)e(and)h(the)630
+1089 y FJ(jpeg)25 b FQ(\014le)i FM(file.jpg)p FQ(,)e(and)g(the)i(MetaP)
+m(ost)i(\014le)d FM(file.mps)e FQ(at)j(their)f(natural)h(size.)40
+b(When)26 b(the)630 1189 y(sp)s(eci\014ed)k(\014lename)g(has)g(no)h
+(extension)p Black Black 892 1330 a FN(\\includegraphic)o(s{)o(fil)o
+(e})630 1484 y FQ(then)20 b FM(\\includegraphics)c FQ(app)s(ends)i(the)
+j(extensions)g(in)e(the)i FM(\\DeclareGraphicsExtensio)o(ns)630
+1597 y FQ(extension)31 b(list)g(\(See)g(Section)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 31 w(9.1)p Black 32 w(on)f(page)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 31 w(29)p Black(\).)630 1840 y FB(7.4)112
+b(Do)s(cumen)m(ts)38 b(to)f(b)s(e)h(Pro)s(cessed)g(b)m(y)f(b)s(oth)h(L)
+2731 1818 y FI(A)2775 1840 y FB(T)2834 1863 y(E)2894
+1840 y(X)f(and)i(p)s(dfL)3421 1818 y FI(A)3465 1840 y
+FB(T)3524 1863 y(E)3585 1840 y(X)630 2012 y FQ(It)29
+b(is)f(often)h(desired)f(to)h(allo)m(w)h(a)f(do)s(cumen)m(t)f(to)h(b)s
+(e)f(pro)s(cessed)g(b)m(y)g(either)h(L)3225 1995 y FP(A)3264
+2012 y FQ(T)3315 2032 y(E)3365 2012 y(X)g(or)f(p)s(dfL)3728
+1995 y FP(A)3767 2012 y FQ(T)3818 2032 y(E)3867 2012
+y(X,)630 2125 y(with)35 b(L)866 2108 y FP(A)905 2125
+y FQ(T)956 2145 y(E)1006 2125 y(X)g(and)f FM(dvips)f
+FQ(used)h(when)g(P)m(ostScript)i(output)e(is)h(needed)f(and)g(p)s(dfL)
+3509 2108 y FP(A)3548 2125 y FQ(T)3599 2145 y(E)3648
+2125 y(X)h(to)h(b)s(e)630 2238 y(used)26 b(when)f FJ(pdf)h
+FQ(output)g(is)h(needed.)39 b(Tw)m(o)26 b(things)h(c)m(hange)g(when)e
+(switc)m(hing)i(b)s(et)m(w)m(een)h(L)3752 2221 y FP(A)3791
+2238 y FQ(T)3842 2257 y(E)3892 2238 y(X)630 2351 y(and)i(p)s(dfL)964
+2334 y FP(A)1003 2351 y FQ(T)1054 2370 y(E)1102 2351
+y(X:)p Black 767 2494 a FK(\210)p Black 45 w FQ(The)g(appropriate)h
+FO(graphicx)f FQ(driv)m(er)g(c)m(hanges.)p Black 767
+2644 a FK(\210)p Black 45 w FQ(The)g(graphic)h(t)m(yp)s(es)f(that)h
+(can)g(b)s(e)e(directly)i(imp)s(orted)f(c)m(hange.)630
+2787 y(The)41 b(follo)m(wing)i(steps)e(adjust)g(these)g(things,)k(allo)
+m(wing)e(a)e(do)s(cumen)m(t)g(to)i(b)s(e)d(pro)s(cessed)h(b)m(y)630
+2900 y(either)31 b(L)912 2883 y FP(A)951 2900 y FQ(T)1002
+2919 y(E)1052 2900 y(X)g(or)f(p)s(dfL)1419 2883 y FP(A)1458
+2900 y FQ(T)1509 2919 y(E)1558 2900 y(X:)p Black 741
+3042 a(1.)p Black 46 w(Create)h(t)m(w)m(o)h(copies)1559
+3009 y FP(12)1665 3042 y FQ(of)f(eac)m(h)g(graphic)g(to)g(b)s(e)e(imp)s
+(orted:)p Black 896 3208 a(\(a\))p Black 46 w(An)h FJ(eps)f
+FQ(v)m(ersion)i(whic)m(h)f(is)h(imp)s(orted)e(when)h
+FM(latex)f FQ(pro)s(cesses)h(the)g(do)s(cumen)m(t.)p
+Black 891 3337 a(\(b\))p Black 45 w(A)21 b FJ(png)p FQ(,)h
+FJ(pdf)p FQ(,)g FJ(jpeg)p FQ(,)g(or)e(MetaP)m(ost)j(v)m(ersion)e(whic)m
+(h)f(is)g(imp)s(orted)g(when)f FM(pdflatex)1057 3450
+y FQ(pro)s(cesses)30 b(the)h(do)s(cumen)m(t.)p Black
+741 3615 a(2.)p Black 46 w(Do)37 b(not)g(sp)s(ecify)g
+FM(dvips)e FQ(or)h FM(pdftex)f FQ(as)i(an)f(option)h(in)f(the)g
+FM(\\documentclass)c FQ(or)37 b(the)857 3728 y FM
+(\\usepackage{graphicx})15 b FQ(commands.)37 b(Instead,)22
+b(the)f FM(graphic.cfg)c FQ(command)j(should)857 3841
+y(automatically)34 b(pass)29 b(the)i(appropriate)f(option)h(to)g(the)g
+FO(graphicx)f FQ(pac)m(k)-5 b(age.)p Black 741 3978 a(3.)p
+Black 46 w(When)37 b(using)g(the)h FM(\\includegraphics)33
+b FQ(command)k(to)h(insert)f(the)h(graphics,)h(do)f(not)857
+4078 y(sp)s(ecify)30 b(an)m(y)h(extension.)41 b(F)-8
+b(or)32 b(example:)p Black Black 1380 4211 a FN(\\includegraphics{)o
+(gr)o(aph)o(ic)o(})857 4358 y FQ(The)23 b(default)g(extension)g(list)h
+(de\014ned)e(in)g FM(dvips.def)f FQ(causes)i(L)3026 4342
+y FP(A)3065 4358 y FQ(T)3116 4378 y(E)3166 4358 y(X)g(to)h(imp)s(ort)e
+(the)h FJ(eps)857 4471 y FQ(v)m(ersion)33 b(of)g(the)g(graphics)f
+(while)h(the)g(default)g(extension)g(list)g(de\014ned)e(in)i
+FM(pdftex.def)857 4584 y FQ(causes)j(p)s(dfL)1298 4567
+y FP(A)1337 4584 y FQ(T)1388 4604 y(E)1437 4584 y(X)f(to)i(imp)s(ort)d
+(the)i FJ(png)p FQ(,)h FJ(pdf)p FQ(,)g FJ(jpeg)p FQ(,)f(or)f(MetaP)m
+(ost)j(v)m(ersion)e(of)g(the)857 4697 y(graphics)31 b(\(see)g(Section)p
+0.05 1.00 1.00 0.40 TeXcolorcmyk 31 w(9.1)p Black
+32 w(on)f(page)p 0.05 1.00 1.00 0.40 TeXcolorcmyk
+31 w(29)p Black(\).)p Black 741 4847 a(4.)p Black 46
+w(Do)36 b(not)f(directly)g(use)g FJ(ps)p FQ(frag.)53
+b(If)42 b FJ(ps)p FQ(frag)34 b(substitution)g(is)h(needed,)h(use)f(the)
+f(metho)s(d)857 4960 y(describ)s(ed)c(in)g(Section)p
+0.05 1.00 1.00 0.40 TeXcolorcmyk 31 w(15.5)p Black
+32 w(on)g(page)p 0.05 1.00 1.00 0.40 TeXcolorcmyk
+31 w(48)p Black(.)p Black 630 5056 1332 4 v 703 5145
+a FF(12)768 5177 y FG(Sometimes)f(PurifyEPS)f(\(see)g(Section)p
+0.05 1.00 1.00 0.40 TeXcolorcmyk 28 w(5.5)p Black
+29 w(on)g(page)p 0.05 1.00 1.00 0.40 TeXcolorcmyk
+28 w(17)p Black(\))g(can)g(b)r(e)g(used)f(to)h(create)h(a)f(single)g
+(\014le)g(that)g(can)630 5268 y(b)r(e)e(used)f(b)n(y)g(b)r(oth)g(L)1218
+5251 y FF(A)1251 5268 y FG(T)1293 5285 y(E)1337 5268
+y(X)g(and)g(p)r(dfL)1700 5251 y FF(A)1733 5268 y FG(T)1775
+5285 y(E)1819 5268 y(X.)p Black Black 2250 5640 a FQ(23)p
+Black eop end
+%%Page: 24 24
+TeXDict begin 24 23 bop Black 0 TeXcolorgray Black Black
+630 -149 a FL(7.4.1)105 b(Conditional)35 b(Co)s(de)g(with)f(the)g
+Ft(ifp)s(df)41 b FL(P)m(ac)m(k)-6 b(age)630 12 y FQ(The)49
+b FO(ifp)s(df)54 b FQ(pac)m(k)-5 b(age's)51 b FM(\\ifpdf)d
+FQ(command)h(detects)2529 -21 y FP(13)2654 12 y FQ(whether)g(the)g(do)s
+(cumen)m(t)g(is)g(b)s(eing)630 103 y(pro)s(cessed)34
+b(b)m(y)i FM(latex)e FQ(or)h FM(pdflatex)p FQ(,)e(allo)m(wing)k(the)e
+(do)s(cumen)m(t)g(to)g(ha)m(v)m(e)h(conditional)g(co)s(de.)630
+194 y(F)-8 b(or)34 b(example,)g(since)f(it)h(ma)m(y)f(b)s(e)g
+(advisable)g(to)h(minimize)f(the)g(length)h(of)f(the)g(extension)g
+(list)630 286 y(\(as)41 b(describ)s(ed)f(in)g(Section)p
+0.05 1.00 1.00 0.40 TeXcolorcmyk 41 w(9.1)p Black(\))i(the)f
+FM(\\ifpdf)e FQ(command)h(can)h(b)s(e)f(used)g(to)h(customize)h(the)630
+377 y(extension)31 b(list)p Black Black 865 482 a FE
+(\\usepackage{ifpdf})865 573 y(...)865 664 y(\\ifpdf)1022
+756 y(\\DeclareGraphicsExtensions{.)q(pdf,)q(.png,)q(.jpg)q(,.mp)q(s})
+865 847 y(\\else)1022 938 y(\\DeclareGraphicsExtensions{.)q(eps})865
+1030 y(\\fi)630 1134 y FQ(If)f(the)h(user)e(w)m(an)m(ts)i(the)g
+(conditional)h(co)s(de)e(to)h(use)f(di\013eren)m(t)h
+FM(\\documentclass)c FQ(options,)k(the)630 1226 y(follo)m(w)37
+b(co)s(de)f(allo)m(ws)i(the)e FM(\\ifpdf)e FQ(command)i(to)g(b)s(e)g
+(de\014ned)e Fy(b)-5 b(efor)g(e)44 b FQ(the)36 b FM(\\documentclass)630
+1317 y FQ(command)p Black Black 865 1421 a FE(\\RequirePackage{ifpdf})
+865 1513 y(\\ifpdf)983 1604 y(\\documentclass[pdftex]{articl)q(e})865
+1695 y(\\else)983 1787 y(\\documentclass[dvips]{article)q(})865
+1878 y(\\fi)630 2004 y FQ(This)20 b(co)s(de)h(passes)f(the)h
+FM([pdftex])e FQ(option)i(if)g(the)g(do)s(cumen)m(t)f(is)h(b)s(eing)f
+(pro)s(cessed)g(b)m(y)i FM(pdflatex)630 2117 y FQ(and)39
+b(passes)g(the)h FM([dvips])d FQ(option)j(if)g(the)f(do)s(cumen)m(t)g
+(is)h(b)s(eing)f(pro)s(cessed)g(b)m(y)h FM(latex)p FQ(.)67
+b(As)630 2230 y(describ)s(ed)38 b(in)h(Section)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 40 w(7.1)p Black 41 w(on)g(page)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 40 w(22)p Black(,)k(this)c(co)s(de)g(is)h(generally)g(not)
+g(needed)f(since)h(most)630 2343 y(distributions)30 b(automatically)j
+(do)d(this)g(in)g(their)h FM(graphics.cfg)c FQ(\014le.)630
+2581 y FB(7.5)112 b(Sp)s(ecifying)39 b(Width,)f(Heigh)m(t,)f(or)g
+(Angle)630 2739 y FQ(The)30 b(command)p Black Black -1130
+w FL(Sp)s(ecifying)246 2852 y(Width)p Black Black 308
+w FN(\\includegraphics)o([w)o(idt)o(h=)o(3in)o(]{)o(fil)o(e})630
+2965 y FQ(includes)25 b(the)g(graphics)h(from)e(the)i(sp)s(eci\014ed)e
+(\014le)i(suc)m(h)f(that)g(its)h(width)e(is)i(3)f(inc)m(hes.)40
+b(Instead)25 b(of)630 3065 y(sp)s(ecifying)31 b(a)h(\014xed)e(width)h
+(\(suc)m(h)g(as)h(3)g(inc)m(hes\))g(sp)s(ecifying)f(the)g(width)g(in)g
+(terms)g(of)g(scalable)630 3164 y(lengths)913 3131 y
+FP(14)1018 3164 y FQ(mak)m(es)h(the)e(graphic)h(la)m(y)m(out)h(more)e
+(robust.)40 b(F)-8 b(or)31 b(example,)h(the)e(command)p
+Black Black 848 3277 a FN(\\includegraphics)o([w)o(idt)o(h=)o(\\li)o
+(ne)o(wid)o(th)o(]{)o(gra)o(ph)o(ic})630 3390 y FQ(scales)i(the)e
+(included)g(graphic)g(to)h(b)s(e)f(as)h(wide)f(as)g(the)h(curren)m(t)f
+(text.)42 b(The)30 b(command)p Black Black 848 3503 a
+FN(\\includegraphics)o([w)o(idt)o(h=)o(0.8)o(0\\)o(lin)o(ew)o(id)o(th])
+o({g)o(rap)o(hi)o(c})630 3616 y FQ(mak)m(es)g(the)e(included)g(graphic)
+h(80\045)g(as)g(wide)g(as)f(the)h(curren)m(t)g(text.)41
+b(When)28 b(the)h FO(calc)g FQ(pac)m(k)-5 b(age)630 3715
+y(is)28 b(used,)f(the)h(follo)m(wing)h(command)e(causes)h(the)f
+(graphics)h(to)g(b)s(e)f(2)h(inc)m(hes)f(more)h(narro)m(w)f(than)630
+3815 y(the)k(curren)m(t)f(text)p Black Black 892 3928
+a FN(\\includegraphic)o(s[)o(wid)o(th)o(=\\l)o(in)o(ewi)o(dt)o(h-)o
+(2.0)o(in)o(]{g)o(ra)o(ph)o(ic})630 4140 y FQ(Similarly)-8
+b(,)31 b(the)g(command)p Black Black -1504 w FL(Sp)s(ecifying)233
+4253 y(Heigh)m(t)p Black 630 4192 1332 4 v 703 4281 a
+FF(13)768 4313 y FG(Historically)-6 b(,)43 b(one)37 b(metho)r(d)h(for)h
+(doing)f(this)g(detection)g(w)n(as)h(to)f(use)f(the)h(fact)g(that)g
+FE(\\pdfoutput)i FG(w)n(as)630 4404 y(de\014ned)24 b(only)h(if)g(p)r
+(dfL)1262 4387 y FF(A)1295 4404 y FG(T)1337 4420 y(E)1381
+4404 y(X)f(w)n(as)i(pro)r(cessing)h(the)d(do)r(cumen)n(t.)34
+b(Ho)n(w)n(ev)n(er,)25 b(man)n(y)f(T)3075 4420 y(E)3119
+4404 y(X)g(distributions)h(no)n(w)h(ha)n(v)n(e)630 4496
+y(their)j FE(latex)i FG(command)f(actually)g(execute)f(p)r(dfL)2103
+4478 y FF(A)2136 4496 y FG(T)2178 4512 y(E)2221 4496
+y(X)g(in)h FJ(d)n(vi)f FG(mo)r(de,)i(causing)g FE(\\pdfoutput)h
+FG(to)e(b)r(e)f(de\014ned)630 4587 y(when)g(b)r(oth)f
+FE(latex)i FG(and)f FE(pdflatex)h FG(are)g(executed.)43
+b(The)29 b Fs(ifp)r(df)35 b FG(pac)n(k)l(age)29 b(solv)n(es)g(this)g
+(problem)g(b)n(y)f(pro)n(viding)630 4678 y(a)e(conditional)h(command)e
+(that)h(robustly)f(determines)h(whether)f(the)g(do)r(cumen)n(t)h(is)g
+(b)r(eing)g(pro)r(cessed)g(directly)630 4769 y(in)n(to)g(a)g
+FJ(pdf)f FG(\014le.)703 4865 y FF(14)768 4897 y FG(The)h(prede\014ned)f
+(scalable)i(lengths)f(are:)p Black 630 5010 a FE(\\textwidth)p
+Black 48 w FG(is)g(the)f(width)h(of)g(the)g(do)r(cumen)n(t's)f(normal)i
+(text.)p Black 630 5123 a FE(\\linewidth)p Black 48 w
+FG(is)f(the)f(width)h(of)g(lines)h(for)f(the)f(curren)n(t)g(en)n
+(vironmen)n(t.)p Black 630 5236 a FE(em)p Black 46 w
+FG(is)h(the)f(width)h(of)g(a)g(capital)h(M)f(for)h(the)e(curren)n(t)g
+(fon)n(t.)p Black 630 5349 a FE(ex)p Black 46 w FG(is)h(the)f(heigh)n
+(t)h(of)g(a)g(lo)n(w)n(ercase)i(x)d(for)i(the)e(curren)n(t)g(fon)n(t.)p
+Black Black 2250 5640 a FQ(24)p Black eop end
+%%Page: 25 25
+TeXDict begin 25 24 bop Black 0 TeXcolorgray Black Black
+Black 1485 160 a FB(T)-9 b(able)38 b(1:)p 0 TeXcolorgray
+Black 50 w(includegraphics)i(Options)p Black Black -120
+289 4081 4 v -120 402 4 113 v -67 368 a FM(height)p 583
+402 V 415 w FQ(The)30 b(heigh)m(t)h(of)g(the)f(graphics)h(\(in)f(an)m
+(y)h(of)f(the)h(accepted)h(T)2716 388 y(E)2766 368 y(X)e(units\).)p
+3957 402 V -120 406 4081 4 v -120 519 4 113 v -67 485
+a FM(totalheight)p 583 519 V 175 w FQ(The)g(totalheigh)m(t)j(of)e(the)f
+(graphics)h(\(in)f(an)m(y)h(of)f(the)h(accepted)g(T)2902
+504 y(E)2952 485 y(X)g(units\).)p 3957 519 V -120 522
+4081 4 v -120 635 4 113 v -67 601 a FM(width)p 583 635
+V 463 w FQ(The)f(width)g(of)g(the)h(graphics)f(\(in)g(an)m(y)h(of)g
+(the)f(accepted)i(T)2698 620 y(E)2748 601 y(X)e(units\).)p
+3957 635 V -120 638 4081 4 v -120 864 4 226 v -67 717
+a FM(scale)p 583 864 V 463 w FQ(Scale)j(factor)h(for)e(the)h(graphic.)
+47 b(Sp)s(ecifying)33 b FM(scale=2)e FQ(mak)m(es)i(the)g(graphic)f(t)m
+(wice)i(as)f(large)636 830 y(as)e(its)f(natural)h(size.)p
+3957 864 V -120 867 4081 4 v -120 1093 4 226 v -67 946
+a FM(angle)p 583 1093 V 463 w FQ(Sp)s(eci\014es)25 b(the)h(angle)h(of)e
+(rotation,)k(in)c(degrees,)i(with)f(a)g(coun)m(ter-clo)s(c)m(kwise)i
+(\(an)m(ti-clo)s(c)m(kwise\))636 1059 y(rotation)k(b)s(eing)e(p)s
+(ositiv)m(e.)p 3957 1093 V -120 1096 4081 4 v -120 1548
+4 452 v -67 1175 a FM(origin)p 583 1548 V 415 w FQ(The)21
+b FM(origin)e FQ(command)i(sp)s(eci\014es)g(what)g(p)s(oin)m(t)h(to)g
+(use)f(for)g(the)g(rotation)i(origin.)38 b(By)21 b(default,)636
+1288 y(the)31 b(ob)5 b(ject)31 b(is)f(rotated)i(ab)s(out)e(its)h
+(reference)f(p)s(oin)m(t.)636 1401 y(The)i(p)s(ossible)h(origin)g(p)s
+(oin)m(ts)g(are)g(the)g(same)g(as)g(those)h(for)e(the)h
+FM(\\rotatebox)d FQ(command)j(in)636 1514 y(Section)p
+0.05 1.00 1.00 0.40 TeXcolorcmyk 25 w(8.3)p Black
+24 w(on)24 b(page)p 0.05 1.00 1.00 0.40 TeXcolorcmyk
+24 w(28)p Black(.)40 b(F)-8 b(or)24 b(example,)i FM(origin=c)21
+b FQ(rotates)k(the)f(graphic)g(ab)s(out)f(its)h(cen)m(ter.)p
+3957 1548 V -120 1551 4081 4 v -120 2229 4 678 v -67
+1630 a FM(bb)p 583 2229 V 607 w FQ(Sp)s(eci\014es)29
+b(BoundingBo)m(x)i(parameters.)41 b(F)-8 b(or)31 b(example)g
+FM(bb=10)46 b(20)h(100)g(200)29 b FQ(sp)s(eci\014es)h(that)636
+1743 y(the)i(BoundingBo)m(x)h(has)f(its)g(lo)m(w)m(er-left)j(corner)d
+(at)h(\(10,20\))h(and)e(its)g(upp)s(er-righ)m(t)f(corner)h(at)636
+1856 y(\(100,200\).)636 1969 y(Since)37 b FM(\\includegraphics)c
+FQ(automatically)40 b(reads)d(the)h(BoundingBo)m(x)g(parameters)f(from)
+636 2082 y(the)30 b FJ(eps)f FQ(\014le,)i(the)f FM(bb)f
+FQ(option)i(is)f(usually)g(not)g(sp)s(eci\014ed.)40 b(It)30
+b(is)g(useful)g(if)g(the)g(BoundingBo)m(x)636 2195 y(parameters)h(in)f
+(the)g FJ(eps)f FQ(\014le)i(are)g(missing)f(or)g(incorrect.)p
+3957 2229 V -120 2232 4081 4 v Black Black 1238 3042
+a FB(T)-9 b(able)38 b(2:)p 0 TeXcolorgray Black 50 w(includegraphics)i
+(Cropping)e(Options)p Black Black -120 3171 V -120 4300
+4 1130 v -67 3250 a FM(viewport)p 583 4300 V 319 w FQ(Sp)s(eci\014es)h
+(what)g(p)s(ortion)f(of)i(the)f(graphic)g(to)h(view.)67
+b(Lik)m(e)40 b(a)g(BoundingBo)m(x,)i(the)e(area)g(is)636
+3363 y(sp)s(eci\014ed)d(b)m(y)h(four)f(n)m(um)m(b)s(ers)f(whic)m(h)h
+(are)i(the)e(co)s(ordinates)i(of)f(the)g(lo)m(w)m(er-left)i(corner)d
+(and)636 3476 y(upp)s(er-righ)m(t)29 b(corner.)40 b(The)29
+b(co)s(ordinates)i(are)f(relativ)m(e)i(to)f(lo)m(w)m(er-left)h(corner)d
+(of)h(the)g(Bound-)636 3589 y(ingBo)m(x.)636 3702 y(F)-8
+b(or)63 b(example,)72 b(if)62 b(the)h(graphic's)g(BoundingBo)m(x)g
+(parameters)g(are)g FM(50)47 b(50)h(410)e(302)p FQ(,)636
+3815 y FM(viewport=50)f(50)i(122)g(122)c FQ(displa)m(ys)h(the)g(1-inc)m
+(h)h(square)e(from)h(the)g(lo)m(w)m(er)h(left)g(of)f(the)636
+3928 y(graphic,)32 b(and)f FM(viewport=338)44 b(230)j(410)g(302)31
+b FQ(displa)m(ys)g(the)h(1-inc)m(h)g(square)f(from)g(the)h(up-)636
+4041 y(p)s(er)d(righ)m(t)i(of)g(the)f(graphic.)636 4154
+y(The)h FM(clip)f FQ(option)h(\(see)h(T)-8 b(able)p
+0.05 1.00 1.00 0.40 TeXcolorcmyk 32 w(3)p Black(\))32
+b(m)m(ust)f(b)s(e)g(used)f(to)i(prev)m(en)m(t)g(the)f(p)s(ortion)g(of)g
+(the)h(graphic)636 4266 y(outside)f(the)f(viewp)s(ort)g(from)g(b)s
+(eing)g(displa)m(y)m(ed.)p 3957 4300 V -120 4304 4081
+4 v -120 5094 4 791 v -67 4383 a FM(trim)p 583 5094 V
+511 w FQ(An)h(alternate)i(metho)s(d)d(for)h(sp)s(ecifying)g(what)g(p)s
+(ortion)g(of)g(the)h(graphic)f(to)h(view.)43 b(The)31
+b(four)636 4496 y(n)m(um)m(b)s(ers)g(sp)s(ecify)i(the)f(amoun)m(t)h(to)
+h(remo)m(v)m(e)g(from)e(the)h(left,)h(b)s(ottom,)g(righ)m(t,)g(and)e
+(top)h(side,)636 4609 y(resp)s(ectiv)m(ely)-8 b(.)43
+b(P)m(ositiv)m(e)32 b(n)m(um)m(b)s(ers)d(trim)h(from)g(a)h(side,)g
+(negativ)m(e)h(n)m(um)m(b)s(ers)d(add)h(to)h(a)g(side.)636
+4721 y(F)-8 b(or)41 b(example,)j FM(trim=1)i(2)i(3)f(4)40
+b FQ(trims)g(the)h(graphic)g(b)m(y)f(1)h FM(bp)f FQ(on)g(the)h(left,)j
+(2)c FM(bp)g FQ(on)h(the)636 4834 y(b)s(ottom,)31 b(3)g
+FM(bp)f FQ(on)g(the)g(righ)m(t,)i(4)e FM(bp)g FQ(on)g(the)h(top.)636
+4947 y(The)g FM(clip)f FQ(option)h(\(see)i(T)-8 b(able)p
+0.05 1.00 1.00 0.40 TeXcolorcmyk 31 w(3)p Black(\))32
+b(m)m(ust)g(b)s(e)e(used)h(to)g(prev)m(en)m(t)h(the)g(trimmed)e(p)s
+(ortion)h(from)636 5060 y(b)s(eing)f(displa)m(y)m(ed.)p
+3957 5094 V -120 5097 4081 4 v Black Black 2250 5640
+a(25)p Black eop end
+%%Page: 26 26
+TeXDict begin 26 25 bop Black 0 TeXcolorgray Black Black
+Black 1270 -159 a FB(T)-9 b(able)38 b(3:)p 0 TeXcolorgray
+Black 50 w(includegraphics)h(Bo)s(olean)f(Options)p Black
+Black -120 -29 4081 4 v -120 423 4 452 v -67 50 a FM(clip)p
+763 423 V 691 w FQ(Sp)s(ecifying)45 b FM(clip=false)d
+FQ(the)j(en)m(tire)g(graphic)g(app)s(ears,)i(ev)m(en)e(if)g(p)s
+(ortions)e(app)s(ear)816 163 y(outside)31 b(the)f(viewing)h(area.)42
+b(\(default\))816 276 y(When)26 b FM(clip)f FQ(or)g FM(clip=true)f
+FQ(is)i(sp)s(eci\014ed,)g(an)m(y)g(graphics)g(outside)g(of)g(the)h
+(viewing)f(area)816 389 y(are)31 b(clipp)s(ed)f(and)f(do)i(not)f(app)s
+(ear.)p 3957 423 V -120 426 4081 4 v -120 990 4 565 v
+-67 505 a FM(draft)p 763 990 V 643 w FQ(Sp)s(ecifying)k
+FM(draft)d FQ(or)i FM(draft=true)d FQ(prev)m(en)m(ts)j(the)g(graphic)g
+(from)f(b)s(eing)g(included)g(in)816 618 y(the)25 b(do)s(cumen)m(t.)39
+b(The)24 b(graphic's)h(BoundingBo)m(x)h(and)e(\014lename)h(are)g
+(displa)m(y)m(ed)g(in)g(place)816 731 y(of)31 b(the)f(graphic,)h
+(making)g(it)g(faster)f(to)h(displa)m(y)g(and)f(prin)m(t)g(the)g(do)s
+(cumen)m(t.)816 844 y(Sp)s(ecifying)h FM(draft=false)d
+FQ(causes)i(the)h(EPS)e(graphic)i(to)g(b)s(e)f(inserted.)p
+3957 990 V -120 994 4081 4 v -120 1784 4 791 v -67 1073
+a FM(keepaspectratio)p 763 1784 V 163 w FQ(When)d FM(keepaspectratio)c
+FQ(is)k(not)g(sp)s(eci\014ed,)h(sp)s(ecifying)f(b)s(oth)f(the)h
+FM(width)f FQ(and)g(either)816 1186 y FM(height)k FQ(or)h
+FM(totalheight)d FQ(causes)k(the)f(graphic)g(to)h(b)s(e)f(scaled)h
+(anamorphically)g(to)g(\014t)816 1299 y(b)s(oth)e(the)g(sp)s(eci\014ed)
+g(heigh)m(t)h(and)f(width.)816 1411 y(When)44 b FM(keepaspectratio)c
+FQ(is)45 b(sp)s(eci\014ed,)i(sp)s(ecifying)d(b)s(oth)g(the)h
+FM(width)e FQ(and)g(either)816 1524 y FM(height)34 b
+FQ(or)i FM(totalheight)d FQ(mak)m(es)k(the)g(graphic)f(as)g(large)h(as)
+f(p)s(ossible)g(suc)m(h)g(that)g(its)816 1637 y(asp)s(ect)j(ratio)g
+(remains)f(the)g(same)g(and)g(the)g(graphic)g(exceeds)h(neither)f(the)h
+(sp)s(eci\014ed)816 1750 y(heigh)m(t)31 b(nor)f(width.)p
+3957 1784 V -120 1787 4081 4 v Black Black Black 848
+2070 a FN(\\includegraphics)o([h)o(eig)o(ht)o(=2c)o(m])o({fi)o(le)o(})
+630 2224 y FQ(includes)g(the)h(graphics)f(from)g(the)h(sp)s(eci\014ed)f
+(\014le)h(scaled)g(suc)m(h)f(that)h(its)g(heigh)m(t)h(is)e(2)h(cm.)41
+b(The)630 2337 y FM(\\includegraphics)34 b FQ(command)k(also)h
+(includes)e(a)i FM(totalheight)c FQ(option)k(for)f(sp)s(ecifying)g(a)
+630 2450 y(graphic's)k(totalheigh)m(t.)78 b(\(See)43
+b(Section)p 0.05 1.00 1.00 0.40 TeXcolorcmyk 42 w(2)p
+Black 42 w(on)f(page)p 0.05 1.00 1.00 0.40 TeXcolorcmyk
+43 w(10)p Black 43 w(for)f(the)h(de\014nition)g(of)g(heigh)m(t)h(and)
+630 2563 y(totalheigh)m(t\).)630 2762 y(The)28 b FM(\\includegraphics)c
+FQ(command's)29 b FM(angle)e FQ(option)i(sp)s(eci\014es)g(the)f(angle)i
+(of)f(the)g(included)p Black Black -3890 w FL(Sp)s(ecifying)274
+2875 y(Angle)630 2862 y FQ(graphic)p Black Black 761
+3003 a FN(\\begin{center})892 3102 y(\\includegraphic)o(s[)o(ang)o(le)o
+(=45)o(]{)o(gra)o(ph)o(ic)o(})761 3202 y(\\end{center})630
+3357 y FQ(includes)37 b(the)h(graphic)g(at)g(its)g(natural)g(size)g
+(and)f(then)h(rotates)h(it)f(b)m(y)f(45)i(degrees)f(coun)m(ter-)630
+3469 y(clo)s(c)m(kwise)32 b(\(an)m(ti-clo)s(c)m(kwise\).)630
+3710 y FL(7.5.1)105 b(Sp)s(ecifying)36 b(Angle)f(and)g(Heigh)m(t)g(or)g
+(Width)630 3868 y FQ(Since)c(the)g FM(\\includegraphics)26
+b FQ(options)31 b(are)g(in)m(terpreted)g(from)f(left)h(to)h(righ)m(t,)f
+(the)g(order)f(in)630 3968 y(whic)m(h)g(the)h(angle)g(and)f(size)h(are)
+g(sp)s(eci\014ed)e(mak)m(es)j(a)e(di\013erence.)42 b(F)-8
+b(or)31 b(example)p Black Black 761 4109 a FN(\\begin{center})892
+4208 y(\\includegraphic)o(s[)o(ang)o(le)o(=90)o(,t)o(ota)o(lh)o(ei)o
+(ght)o(=1)o(cm])o({g)o(ra)o(phi)o(c})892 4308 y(\\includegraphic)o(s[)o
+(tot)o(al)o(hei)o(gh)o(t=1)o(cm)o(,a)o(ngl)o(e=)o(90])o({g)o(ra)o(phi)o
+(c})761 4408 y(\\end{center})630 4562 y FQ(pro)s(duces)p
+Black Black 2117 5293 a
+ currentpoint currentpoint translate 0.19684 0.19684 scale neg exch
+neg exch translate
+ 2117 5293 a 2567 5293 a
+ gsave currentpoint currentpoint translate 90 neg rotate neg exch neg
+exch translate
+ 2567
+5293 a @beginspecial 0 @llx 0 @lly 144 @urx 54 @ury 1440
+@rwi @setspecial
+%%BeginDocument: graphic.eps
+%!PS-Adobe-2.0 EPSF-2.0
+%%Title: graphic.eps
+%%Creator: fig2dev Version 3.2 Patchlevel 0-beta2
+%%CreationDate: Thu Dec 11 20:58:11 1997
+%%For: Keith Reckdahl
+%%Orientation: Portrait
+%%BoundingBox: 0 0 144 54
+%%Pages: 0
+%%BeginSetup
+%%IncludeFeature: *PageSize Letter
+%%EndSetup
+%%Magnification: 1.00
+%%EndComments
+/$F2psDict 200 dict def
+$F2psDict begin
+$F2psDict /mtrx matrix put
+/col-1 {0 setgray} bind def
+/col0 {0.000 0.000 0.000 srgb} bind def
+/col1 {0.000 0.000 1.000 srgb} bind def
+/col2 {0.000 1.000 0.000 srgb} bind def
+/col3 {0.000 1.000 1.000 srgb} bind def
+/col4 {1.000 0.000 0.000 srgb} bind def
+/col5 {1.000 0.000 1.000 srgb} bind def
+/col6 {1.000 1.000 0.000 srgb} bind def
+/col7 {1.000 1.000 1.000 srgb} bind def
+/col8 {0.000 0.000 0.560 srgb} bind def
+/col9 {0.000 0.000 0.690 srgb} bind def
+/col10 {0.000 0.000 0.820 srgb} bind def
+/col11 {0.530 0.810 1.000 srgb} bind def
+/col12 {0.000 0.560 0.000 srgb} bind def
+/col13 {0.000 0.690 0.000 srgb} bind def
+/col14 {0.000 0.820 0.000 srgb} bind def
+/col15 {0.000 0.560 0.560 srgb} bind def
+/col16 {0.000 0.690 0.690 srgb} bind def
+/col17 {0.000 0.820 0.820 srgb} bind def
+/col18 {0.560 0.000 0.000 srgb} bind def
+/col19 {0.690 0.000 0.000 srgb} bind def
+/col20 {0.820 0.000 0.000 srgb} bind def
+/col21 {0.560 0.000 0.560 srgb} bind def
+/col22 {0.690 0.000 0.690 srgb} bind def
+/col23 {0.820 0.000 0.820 srgb} bind def
+/col24 {0.500 0.190 0.000 srgb} bind def
+/col25 {0.630 0.250 0.000 srgb} bind def
+/col26 {0.750 0.380 0.000 srgb} bind def
+/col27 {1.000 0.500 0.500 srgb} bind def
+/col28 {1.000 0.630 0.630 srgb} bind def
+/col29 {1.000 0.750 0.750 srgb} bind def
+/col30 {1.000 0.880 0.880 srgb} bind def
+/col31 {1.000 0.840 0.000 srgb} bind def
+
+end
+save
+-2.0 61.0 translate
+1 -1 scale
+
+/cp {closepath} bind def
+/ef {eofill} bind def
+/gr {grestore} bind def
+/gs {gsave} bind def
+/sa {save} bind def
+/rs {restore} bind def
+/l {lineto} bind def
+/m {moveto} bind def
+/rm {rmoveto} bind def
+/n {newpath} bind def
+/s {stroke} bind def
+/sh {show} bind def
+/slc {setlinecap} bind def
+/slj {setlinejoin} bind def
+/slw {setlinewidth} bind def
+/srgb {setrgbcolor} bind def
+/rot {rotate} bind def
+/sc {scale} bind def
+/sd {setdash} bind def
+/ff {findfont} bind def
+/sf {setfont} bind def
+/scf {scalefont} bind def
+/sw {stringwidth} bind def
+/tr {translate} bind def
+/tnt {dup dup currentrgbcolor
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb}
+ bind def
+/shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul
+ 4 -2 roll mul srgb} bind def
+/$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def
+/$F2psEnd {$F2psEnteredState restore end} def
+%%EndProlog
+
+$F2psBegin
+10 setmiterlimit
+n 0 1048 m 0 0 l 2473 0 l 2473 1048 l cp clip
+ 0.06000 0.06000 sc
+% Polyline
+30.000 slw
+n 2400 975 m 75 975 l 75 150 l 2400 150 l cp gs col-1 s gr
+/Times-Bold ff 360.00 scf sf
+1220 705 m
+gs 1 -1 sc (Graphic) dup sw pop 2 div neg 0 rm col-1 sh gr
+$F2psEnd
+rs
+
+%%EndDocument
+ @endspecial 3767 5293 a
+ currentpoint grestore moveto
+ 3767 5293 a 2117 5293 a
+ currentpoint currentpoint translate 1 0.19684 div 1 0.19684 div scale
+neg exch neg exch translate
+ 2117
+5293 a 2473 5293 a
+ gsave currentpoint currentpoint translate 90 neg rotate neg exch neg
+exch translate
+ 2473 5293 a @beginspecial 0 @llx 0
+@lly 144 @urx 54 @ury 283 @rhi @setspecial
+%%BeginDocument: graphic.eps
+%!PS-Adobe-2.0 EPSF-2.0
+%%Title: graphic.eps
+%%Creator: fig2dev Version 3.2 Patchlevel 0-beta2
+%%CreationDate: Thu Dec 11 20:58:11 1997
+%%For: Keith Reckdahl
+%%Orientation: Portrait
+%%BoundingBox: 0 0 144 54
+%%Pages: 0
+%%BeginSetup
+%%IncludeFeature: *PageSize Letter
+%%EndSetup
+%%Magnification: 1.00
+%%EndComments
+/$F2psDict 200 dict def
+$F2psDict begin
+$F2psDict /mtrx matrix put
+/col-1 {0 setgray} bind def
+/col0 {0.000 0.000 0.000 srgb} bind def
+/col1 {0.000 0.000 1.000 srgb} bind def
+/col2 {0.000 1.000 0.000 srgb} bind def
+/col3 {0.000 1.000 1.000 srgb} bind def
+/col4 {1.000 0.000 0.000 srgb} bind def
+/col5 {1.000 0.000 1.000 srgb} bind def
+/col6 {1.000 1.000 0.000 srgb} bind def
+/col7 {1.000 1.000 1.000 srgb} bind def
+/col8 {0.000 0.000 0.560 srgb} bind def
+/col9 {0.000 0.000 0.690 srgb} bind def
+/col10 {0.000 0.000 0.820 srgb} bind def
+/col11 {0.530 0.810 1.000 srgb} bind def
+/col12 {0.000 0.560 0.000 srgb} bind def
+/col13 {0.000 0.690 0.000 srgb} bind def
+/col14 {0.000 0.820 0.000 srgb} bind def
+/col15 {0.000 0.560 0.560 srgb} bind def
+/col16 {0.000 0.690 0.690 srgb} bind def
+/col17 {0.000 0.820 0.820 srgb} bind def
+/col18 {0.560 0.000 0.000 srgb} bind def
+/col19 {0.690 0.000 0.000 srgb} bind def
+/col20 {0.820 0.000 0.000 srgb} bind def
+/col21 {0.560 0.000 0.560 srgb} bind def
+/col22 {0.690 0.000 0.690 srgb} bind def
+/col23 {0.820 0.000 0.820 srgb} bind def
+/col24 {0.500 0.190 0.000 srgb} bind def
+/col25 {0.630 0.250 0.000 srgb} bind def
+/col26 {0.750 0.380 0.000 srgb} bind def
+/col27 {1.000 0.500 0.500 srgb} bind def
+/col28 {1.000 0.630 0.630 srgb} bind def
+/col29 {1.000 0.750 0.750 srgb} bind def
+/col30 {1.000 0.880 0.880 srgb} bind def
+/col31 {1.000 0.840 0.000 srgb} bind def
+
+end
+save
+-2.0 61.0 translate
+1 -1 scale
+
+/cp {closepath} bind def
+/ef {eofill} bind def
+/gr {grestore} bind def
+/gs {gsave} bind def
+/sa {save} bind def
+/rs {restore} bind def
+/l {lineto} bind def
+/m {moveto} bind def
+/rm {rmoveto} bind def
+/n {newpath} bind def
+/s {stroke} bind def
+/sh {show} bind def
+/slc {setlinecap} bind def
+/slj {setlinejoin} bind def
+/slw {setlinewidth} bind def
+/srgb {setrgbcolor} bind def
+/rot {rotate} bind def
+/sc {scale} bind def
+/sd {setdash} bind def
+/ff {findfont} bind def
+/sf {setfont} bind def
+/scf {scalefont} bind def
+/sw {stringwidth} bind def
+/tr {translate} bind def
+/tnt {dup dup currentrgbcolor
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb}
+ bind def
+/shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul
+ 4 -2 roll mul srgb} bind def
+/$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def
+/$F2psEnd {$F2psEnteredState restore end} def
+%%EndProlog
+
+$F2psBegin
+10 setmiterlimit
+n 0 1048 m 0 0 l 2473 0 l 2473 1048 l cp clip
+ 0.06000 0.06000 sc
+% Polyline
+30.000 slw
+n 2400 975 m 75 975 l 75 150 l 2400 150 l cp gs col-1 s gr
+/Times-Bold ff 360.00 scf sf
+1220 705 m
+gs 1 -1 sc (Graphic) dup sw pop 2 div neg 0 rm col-1 sh gr
+$F2psEnd
+rs
+
+%%EndDocument
+ @endspecial 3102 5293 a
+ currentpoint grestore moveto
+ 3102 5293 a Black 2250 5640
+a FQ(26)p Black eop end
+%%Page: 27 27
+TeXDict begin 27 26 bop Black 0 TeXcolorgray Black Black
+630 -149 a FQ(The)33 b(\014rst)g(b)s(o)m(x)h(is)g(rotated)h(90)g
+(degrees)f(and)f(then)h(scaled)g(suc)m(h)g(that)g(its)h(heigh)m(t)f(is)
+g(one)g(cen-)630 -36 y(timeter.)43 b(The)31 b(second)g(b)s(o)m(x)f(is)h
+(scaled)h(suc)m(h)e(that)i(its)f(heigh)m(t)h(is)f(one)g(cen)m(timeter)i
+(and)d(then)g(it)630 77 y(is)g(rotated)i(90)f(degrees.)771
+190 y(Note)41 b(that)f(the)g(t)m(w)m(o)g(graphics)g(in)f(the)h(ab)s(o)m
+(v)m(e)g(\014gure)f(are)h(separated)g(b)m(y)f(an)h(in)m(terw)m(ord)630
+303 y(space)31 b(b)s(ecause)f(the)h(\014rst)e FM(\\includegraphics)d
+FQ(line)31 b(did)f(not)g(end)g(with)g(a)h FM(\045)p FQ(.)630
+589 y FD(8)135 b(Rotating)46 b(and)f(Scaling)h(Ob)7 b(jects)630
+792 y FQ(In)41 b(addition)h(to)h(the)f FM(\\includegraphics)c
+FQ(command,)45 b(the)d FO(graphicx)g FQ(pac)m(k)-5 b(age)44
+b(includes)e(4)630 905 y(other)31 b(commands)f(whic)m(h)g(rotate)i(and)
+d(scale)j Fy(any)39 b FQ(L)2444 889 y FP(A)2483 905 y
+FQ(T)2534 925 y(E)2584 905 y(X)31 b(ob)5 b(ject:)42 b(text,)31
+b FJ(eps)e FQ(graphic,)i(etc.)p Black Black 869 1060
+a FM(\\scalebox{h-scale}[v-sc)o(ale])o({ar)o(gume)o(nt})869
+1173 y(\\resizebox{width}{heigh)o(t}{a)o(rgu)o(ment)o(})869
+1285 y(\\resizebox*{width}{tota)o(lhei)o(ght)o(}{ar)o(gume)o(nt})869
+1398 y(\\rotatebox[options]{ang)o(le}{)o(arg)o(umen)o(t})630
+1573 y FQ(Since)37 b(the)g FO(graphicx)f FM(\\includegraphics)d
+FQ(command)j(supp)s(orts)f(rotating)j(and)e(scaling)i(op-)630
+1672 y(tions)29 b(suc)m(h)f(as)h FM(angle)e FQ(and)h
+FM(width)p FQ(,)f(the)i(commands)f(in)h(this)f(section)i(rarely)e(need)
+h(to)g(b)s(e)f(used)630 1772 y(with)i FJ(eps)f FQ(graphics.)41
+b(F)-8 b(or)31 b(example,)p Black Black 848 1913 a FN
+(\\includegraphics)o([s)o(cal)o(e=)o(2]{)o(fi)o(le})848
+2013 y(\\includegraphics)o([w)o(idt)o(h=)o(4in)o(]{)o(fil)o(e})848
+2112 y(\\includegraphics)o([a)o(ngl)o(e=)o(45])o({f)o(ile)o(})630
+2254 y FQ(pro)s(duce)e(the)i(same)g(three)f(graphics)g(as)p
+Black Black 848 2395 a FN(\\scalebox{2}{\\in)o(cl)o(ude)o(gr)o(aph)o
+(ic)o(s{f)o(il)o(e})o(})848 2494 y(\\resizebox{4in}{)o(!})o({\\i)o(nc)o
+(lud)o(eg)o(rap)o(hi)o(cs)o({fi)o(le)o(}})848 2594 y
+(\\rotatebox{45}{\\)o(in)o(clu)o(de)o(gra)o(ph)o(ics)o({f)o(il)o(e}})
+630 2748 y FQ(Ho)m(w)m(ev)m(er,)g(the)e(\014rst)f(syn)m(tax)h(is)f
+(preferred)g(b)s(ecause)g(it)h(is)g(faster)g(and)f(pro)s(duces)f(more)h
+(e\016cien)m(t)630 2861 y(P)m(ostScript/)p FJ(pdf)p FQ(.)630
+3105 y FB(8.1)112 b(The)38 b(scaleb)s(o)m(x)h(Command)630
+3276 y(Syn)m(tax:)142 b FR(\\scalebox{h-scale}[v-scale)q(]{a)q(rgum)q
+(ent})630 3439 y FQ(The)34 b FM(\\scalebox)f FQ(command)i(scales)h(an)f
+(ob)5 b(ject,)37 b(making)e(its)h(width)e(b)s(e)g FM(h-scale)f
+FQ(times)j(its)630 3552 y(original)d(width)f(and)f(making)i(the)f(ob)5
+b(ject's)33 b(heigh)m(t)g(b)s(e)f FM(v-scale)e FQ(times)j(its)f
+(original)i(heigh)m(t.)630 3665 y(If)48 b FM(v-scale)39
+b FQ(is)i(omitted,)k(it)d(defaults)f(to)h FM(h-scale)p
+FQ(,)g(k)m(eeping)g(the)g(asp)s(ect)f(ratio)h(constan)m(t.)630
+3778 y(Negativ)m(e)33 b(v)-5 b(alues)31 b(re\015ect)g(the)g(ob)5
+b(ject.)630 4021 y FB(8.2)112 b(The)38 b(resizeb)s(o)m(x)g(Commands)630
+4193 y(Syn)m(tax:)142 b FR(\\resizebox{width}{height}{)q(arg)q(umen)q
+(t})1129 4306 y(\\resizebox*{width}{totalh)q(eigh)q(t}{)q(argu)q(ment)q
+(})630 4455 y FQ(The)22 b FM(\\resizebox)e FQ(command)i(resizes)i(an)e
+(ob)5 b(ject)24 b(to)f(a)g(sp)s(eci\014ed)f(size.)39
+b(Sp)s(ecifying)23 b FM(!)38 b FQ(as)22 b(either)630
+4555 y FM(height)29 b FQ(or)i FM(width)e FQ(mak)m(es)i(that)h(length)f
+(b)s(e)f(suc)m(h)g(that)h(the)g(asp)s(ect)g(ratio)h(remains)e(constan)m
+(t.)630 4654 y(F)-8 b(or)31 b(example,)p Black Black
+848 4796 a FN(\\resizebox{2in}{)o(!})o({ar)o(gu)o(men)o(t})630
+4950 y FQ(scales)h(the)e FM(argument)e FQ(to)j(b)s(e)f(2)h(inc)m(hes)g
+(wide)f(while)g(k)m(eeping)h(its)g(asp)s(ect)g(ratio)g(constan)m(t.)771
+5050 y(The)d(standard)f(L)1357 5033 y FP(A)1396 5050
+y FQ(T)1447 5069 y(E)1497 5050 y(X)h(argumen)m(ts)h FM(\\height)p
+FQ(,)d FM(\\width)p FQ(,)i FM(\\totalheight)p FQ(,)d
+FM(\\depth)h FQ(can)j(b)s(e)630 5149 y(used)h(to)h(refer)f(to)h(the)f
+(original)i(size)f(of)38 b FM(argument)p FQ(.)g(F)-8
+b(or)31 b(example,)p Black Black 848 5290 a FN(\\resizebox{2in}{)o(\\h)
+o(eig)o(ht)o(}{a)o(rg)o(ume)o(nt)o(})p Black 2250 5640
+a FQ(27)p Black eop end
+%%Page: 28 28
+TeXDict begin 28 27 bop Black 0 TeXcolorgray Black Black
+630 -149 a FQ(sizes)31 b FM(argument)d FQ(to)j(a)g(width)f(of)g(2)h
+(inc)m(hes)g(while)f(k)m(eeping)h(its)g(same)g(heigh)m(t.)771
+-36 y(The)38 b FM(\\resizebox*)e FQ(command)i(is)h(iden)m(tical)h(to)f
+FM(\\resizebox)p FQ(,)g(except)g(the)g(second)g(ar-)630
+77 y(gumen)m(t)34 b(sp)s(eci\014es)f(the)h FM(totalheight)d
+FQ(of)j(the)g(ob)5 b(ject.)52 b(\(See)34 b(Section)p
+0.05 1.00 1.00 0.40 TeXcolorcmyk 34 w(2)p Black 35
+w(on)f(page)p 0.05 1.00 1.00 0.40 TeXcolorcmyk 35
+w(10)p Black 34 w(for)h(the)630 190 y(de\014nition)25
+b(of)g(heigh)m(t)g(and)g(totalheigh)m(t,)k(and)24 b(see)h(Section)p
+0.05 1.00 1.00 0.40 TeXcolorcmyk 26 w(11.1)p Black
+27 w(on)f(page)p 0.05 1.00 1.00 0.40 TeXcolorcmyk
+26 w(33)p Black 26 w(for)g(a)i(comparison)630 303 y(of)38
+b FM(height)28 b FQ(and)i FM(totalheight)d FQ(options.\))630
+546 y FB(8.3)112 b(The)38 b(rotateb)s(o)m(x)f(Command)630
+718 y(Syn)m(tax:)142 b FR(\\rotatebox[options]{angle})q({ar)q(gume)q
+(nt})630 881 y FQ(The)36 b FM(\\rotatebox)e FQ(command)j(rotates)h(an)f
+(ob)5 b(ject)38 b(b)m(y)f(an)f(angle)i(giv)m(en)g(in)f(degrees,)i(with)
+e(a)630 994 y(coun)m(ter-clo)s(c)m(kwise)30 b(rotation)f(b)s(eing)e(p)s
+(ositiv)m(e.)40 b(By)28 b(default,)h(the)e(ob)5 b(ject)29
+b(is)e(rotated)h(ab)s(out)g(its)630 1107 y(reference)h(p)s(oin)m(t.)41
+b(The)28 b FM(\\rotatebox)f FQ(options)i(allo)m(w)h(the)g(p)s(oin)m(t)f
+(of)g(rotation)h(to)g(b)s(e)e(sp)s(eci\014ed.)p Black
+741 1249 a(1.)p Black 46 w(Sp)s(ecifying)j(the)g FM([x=xdim,y=ydim])p
+FQ(,)c(the)j(ob)5 b(ject)32 b(is)f(rotated)h(ab)s(out)e(the)h(p)s(oin)m
+(t)g(whose)857 1362 y(co)s(ordinates)g(relativ)m(e)i(to)e(the)g
+(reference)f(p)s(oin)m(t)h(are)f(\()p FM(xdim,ydim)p
+FQ(\).)p Black 741 1513 a(2.)p Black 46 w(The)g FM(origin)f
+FQ(option)i(sp)s(eci\014es)f(one)g(of)h(12)g(sp)s(ecial)g(p)s(oin)m(ts)
+f(sho)m(wn)g(in)g(in)g(Figure)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 31 w(3)p Black(.)p Black 1223 3072 a @beginspecial
+177 @llx 493 @lly 433 @urx 665 @ury 1728 @rhi @setspecial
+%%BeginDocument: origin_frag.eps
+%!PS-Adobe-2.0 EPSF-2.0
+%%BoundingBox: 177 493 433 665
+%%HiResBoundingBox: 177.81 493.656 432.834 664.854
+%%Creator: dvips(k) 5.94b Copyright 2004 Radical Eye Software
+%%Title: origin_frag.dvi
+%%CreationDate: Sat May 28 13:04:04 2005
+%%DocumentFonts: CMR10 CMTT10
+%%EndComments
+%DVIPSWebPage: (www.radicaleye.com)
+%DVIPSCommandLine: dvips -E origin_frag
+%DVIPSParameters: dpi=600
+%DVIPSSource: TeX output 2005.05.28:1303
+%%BeginProcSet: tex.pro 0 0
+%!
+/TeXDict 300 dict def TeXDict begin/N{def}def/B{bind def}N/S{exch}N/X{S
+N}B/A{dup}B/TR{translate}N/isls false N/vsize 11 72 mul N/hsize 8.5 72
+mul N/landplus90{false}def/@rigin{isls{[0 landplus90{1 -1}{-1 1}ifelse 0
+0 0]concat}if 72 Resolution div 72 VResolution div neg scale isls{
+landplus90{VResolution 72 div vsize mul 0 exch}{Resolution -72 div hsize
+mul 0}ifelse TR}if Resolution VResolution vsize -72 div 1 add mul TR[
+matrix currentmatrix{A A round sub abs 0.00001 lt{round}if}forall round
+exch round exch]setmatrix}N/@landscape{/isls true N}B/@manualfeed{
+statusdict/manualfeed true put}B/@copies{/#copies X}B/FMat[1 0 0 -1 0 0]
+N/FBB[0 0 0 0]N/nn 0 N/IEn 0 N/ctr 0 N/df-tail{/nn 8 dict N nn begin
+/FontType 3 N/FontMatrix fntrx N/FontBBox FBB N string/base X array
+/BitMaps X/BuildChar{CharBuilder}N/Encoding IEn N end A{/foo setfont}2
+array copy cvx N load 0 nn put/ctr 0 N[}B/sf 0 N/df{/sf 1 N/fntrx FMat N
+df-tail}B/dfs{div/sf X/fntrx[sf 0 0 sf neg 0 0]N df-tail}B/E{pop nn A
+definefont setfont}B/Cw{Cd A length 5 sub get}B/Ch{Cd A length 4 sub get
+}B/Cx{128 Cd A length 3 sub get sub}B/Cy{Cd A length 2 sub get 127 sub}
+B/Cdx{Cd A length 1 sub get}B/Ci{Cd A type/stringtype ne{ctr get/ctr ctr
+1 add N}if}B/CharBuilder{save 3 1 roll S A/base get 2 index get S
+/BitMaps get S get/Cd X pop/ctr 0 N Cdx 0 Cx Cy Ch sub Cx Cw add Cy
+setcachedevice Cw Ch true[1 0 0 -1 -.1 Cx sub Cy .1 sub]{Ci}imagemask
+restore}B/D{/cc X A type/stringtype ne{]}if nn/base get cc ctr put nn
+/BitMaps get S ctr S sf 1 ne{A A length 1 sub A 2 index S get sf div put
+}if put/ctr ctr 1 add N}B/I{cc 1 add D}B/bop{userdict/bop-hook known{
+bop-hook}if/SI save N @rigin 0 0 moveto/V matrix currentmatrix A 1 get A
+mul exch 0 get A mul add .99 lt{/QV}{/RV}ifelse load def pop pop}N/eop{
+SI restore userdict/eop-hook known{eop-hook}if showpage}N/@start{
+userdict/start-hook known{start-hook}if pop/VResolution X/Resolution X
+1000 div/DVImag X/IEn 256 array N 2 string 0 1 255{IEn S A 360 add 36 4
+index cvrs cvn put}for pop 65781.76 div/vsize X 65781.76 div/hsize X}N
+/p{show}N/RMat[1 0 0 -1 0 0]N/BDot 260 string N/Rx 0 N/Ry 0 N/V{}B/RV/v{
+/Ry X/Rx X V}B statusdict begin/product where{pop false[(Display)(NeXT)
+(LaserWriter 16/600)]{A length product length le{A length product exch 0
+exch getinterval eq{pop true exit}if}{pop}ifelse}forall}{false}ifelse
+end{{gsave TR -.1 .1 TR 1 1 scale Rx Ry false RMat{BDot}imagemask
+grestore}}{{gsave TR -.1 .1 TR Rx Ry scale 1 1 false RMat{BDot}
+imagemask grestore}}ifelse B/QV{gsave newpath transform round exch round
+exch itransform moveto Rx 0 rlineto 0 Ry neg rlineto Rx neg 0 rlineto
+fill grestore}B/a{moveto}B/delta 0 N/tail{A/delta X 0 rmoveto}B/M{S p
+delta add tail}B/b{S p tail}B/c{-4 M}B/d{-3 M}B/e{-2 M}B/f{-1 M}B/g{0 M}
+B/h{1 M}B/i{2 M}B/j{3 M}B/k{4 M}B/w{0 rmoveto}B/l{p -4 w}B/m{p -3 w}B/n{
+p -2 w}B/o{p -1 w}B/q{p 1 w}B/r{p 2 w}B/s{p 3 w}B/t{p 4 w}B/x{0 S
+rmoveto}B/y{3 2 roll p a}B/bos{/SS save N}B/eos{SS restore}B end
+
+%%EndProcSet
+%%BeginProcSet: psfrag.pro 0 0
+%%
+%% This is file `psfrag.pro',
+%% generated with the docstrip utility.
+%%
+%% The original source files were:
+%%
+%% psfrag.dtx (with options: `filepro')
+%%
+%% Copyright (c) 1996 Craig Barratt, Michael C. Grant, and David Carlisle.
+%% All rights reserved.
+%%
+%% This file is part of the PSfrag package.
+%%
+userdict begin
+/PSfragLib 90 dict def
+/PSfragDict 6 dict def
+/PSfrag { PSfragLib begin load exec end } bind def
+end
+PSfragLib begin
+/RO /readonly load def
+/CP /currentpoint load def
+/CM /currentmatrix load def
+/B { bind RO def } bind def
+/X { exch def } B
+/MD { { X } forall } B
+/OE { end exec PSfragLib begin } B
+/S false def
+/tstr 8 string def
+/islev2 { languagelevel } stopped { false } { 2 ge } ifelse def
+[ /sM /tM /srcM /dstM /dM /idM /srcFM /dstFM ] { matrix def } forall
+sM currentmatrix RO pop
+dM defaultmatrix RO idM invertmatrix RO pop
+srcFM identmatrix pop
+/Hide { gsave { CP } stopped not newpath clip { moveto } if } B
+/Unhide { { CP } stopped not grestore { moveto } if } B
+/setrepl islev2 {{ /glob currentglobal def true setglobal array astore
+ globaldict exch /PSfrags exch put glob setglobal }}
+ {{ array astore /PSfrags X }} ifelse B
+/getrepl islev2 {{ globaldict /PSfrags get aload length }}
+ {{ PSfrags aload length }} ifelse B
+/convert {
+ /src X src length string
+ /c 0 def src length {
+ dup c src c get dup 32 lt { pop 32 } if put /c c 1 add def
+ } repeat
+} B
+/Begin {
+ /saver save def
+ srcFM exch 3 exch put
+ 0 ne /debugMode X 0 setrepl
+ dup /S exch dict def { S 3 1 roll exch convert exch put } repeat
+ srcM CM dup invertmatrix pop
+ mark { currentdict { end } stopped { pop exit } if } loop
+ PSfragDict counttomark { begin } repeat pop
+} B
+/End {
+ mark { currentdict end dup PSfragDict eq { pop exit } if } loop
+ counttomark { begin } repeat pop
+ getrepl saver restore
+ 7 idiv dup /S exch dict def {
+ 6 array astore /mtrx X tstr cvs /K X
+ S K [ S K known { S K get aload pop } if mtrx ] put
+ } repeat
+} B
+/Place {
+ tstr cvs /K X
+ S K known {
+ bind /proc X tM CM pop
+ CP /cY X /cX X
+ 0 0 transform idtransform neg /aY X neg /aX X
+ S K get dup length /maxiter X
+ /iter 1 def {
+ iter maxiter ne { /saver save def } if
+ tM setmatrix aX aY translate
+ [ exch aload pop idtransform ] concat
+ cX neg cY neg translate cX cY moveto
+ /proc load OE
+ iter maxiter ne { saver restore /iter iter 1 add def } if
+ } forall
+ /noXY { CP /cY X /cX X } stopped def
+ tM setmatrix noXY { newpath } { cX cY moveto } ifelse
+ } {
+ Hide OE Unhide
+ } ifelse
+} B
+/normalize {
+ 2 index dup mul 2 index dup mul add sqrt div
+ dup 4 -1 roll exch mul 3 1 roll mul
+} B
+/replace {
+ aload pop MD
+ CP /bY X /lX X gsave sM setmatrix
+ str stringwidth abs exch abs add dup 0 eq
+ { pop } { 360 exch div dup scale } ifelse
+ lX neg bY neg translate newpath lX bY moveto
+ str { /ch X ( ) dup 0 ch put false charpath ch Kproc } forall
+ flattenpath pathbbox [ /uY /uX /lY /lX ] MD
+ CP grestore moveto
+ currentfont /FontMatrix get dstFM copy dup
+ 0 get 0 lt { uX lX /uX X /lX X } if
+ 3 get 0 lt { uY lY /uY X /lY X } if
+ /cX uX lX add 0.5 mul def
+ /cY uY lY add 0.5 mul def
+ debugMode { gsave 0 setgray 1 setlinewidth
+ lX lY moveto lX uY lineto uX uY lineto uX lY lineto closepath
+ lX bY moveto uX bY lineto lX cY moveto uX cY lineto
+ cX lY moveto cX uY lineto stroke
+ grestore } if
+ dstFM dup invertmatrix dstM CM srcM
+ 2 { dstM concatmatrix } repeat pop
+ getrepl /temp X
+ S str convert get {
+ aload pop [ /rot /scl /loc /K ] MD
+ /aX cX def /aY cY def
+ loc {
+ dup 66 eq { /aY bY def } { % B
+ dup 98 eq { /aY lY def } { % b
+ dup 108 eq { /aX lX def } { % l
+ dup 114 eq { /aX uX def } { % r
+ dup 116 eq { /aY uY def } % t
+ if } ifelse } ifelse } ifelse } ifelse pop
+ } forall
+ K srcFM rot tM rotate dstM
+ 2 { tM concatmatrix } repeat aload pop pop pop
+ 2 { scl normalize 4 2 roll } repeat
+ aX aY transform
+ /temp temp 7 add def
+ } forall
+ temp setrepl
+} B
+/Rif {
+ S 3 index convert known { pop replace } { exch pop OE } ifelse
+} B
+/XA { bind [ /Kproc /str } B /XC { ] 2 array astore def } B
+/xs { pop } XA XC
+/xks { /kern load OE } XA /kern XC
+/xas { pop ax ay rmoveto } XA /ay /ax XC
+/xws { c eq { cx cy rmoveto } if } XA /c /cy /cx XC
+/xaws { ax ay rmoveto c eq { cx cy rmoveto } if }
+ XA /ay /ax /c /cy /cx XC
+/raws { xaws { awidthshow } Rif } B
+/rws { xws { widthshow } Rif } B
+/rks { xks { kshow } Rif } B
+/ras { xas { ashow } Rif } B
+/rs { xs { show } Rif } B
+/rrs { getrepl dup 2 add -1 roll //restore exec setrepl } B
+PSfragDict begin
+islev2 not { /restore { /rrs PSfrag } B } if
+/show { /rs PSfrag } B
+/kshow { /rks PSfrag } B
+/ashow { /ras PSfrag } B
+/widthshow { /rws PSfrag } B
+/awidthshow { /raws PSfrag } B
+end PSfragDict RO pop
+end
+
+%%EndProcSet
+%%BeginProcSet: texps.pro 0 0
+%!
+TeXDict begin/rf{findfont dup length 1 add dict begin{1 index/FID ne 2
+index/UniqueID ne and{def}{pop pop}ifelse}forall[1 index 0 6 -1 roll
+exec 0 exch 5 -1 roll VResolution Resolution div mul neg 0 0]/Metrics
+exch def dict begin Encoding{exch dup type/integertype ne{pop pop 1 sub
+dup 0 le{pop}{[}ifelse}{FontMatrix 0 get div Metrics 0 get div def}
+ifelse}forall Metrics/Metrics currentdict end def[2 index currentdict
+end definefont 3 -1 roll makefont/setfont cvx]cvx def}def/ObliqueSlant{
+dup sin S cos div neg}B/SlantFont{4 index mul add}def/ExtendFont{3 -1
+roll mul exch}def/ReEncodeFont{CharStrings rcheck{/Encoding false def
+dup[exch{dup CharStrings exch known not{pop/.notdef/Encoding true def}
+if}forall Encoding{]exch pop}{cleartomark}ifelse}if/Encoding exch def}
+def end
+
+%%EndProcSet
+%%BeginProcSet: special.pro 0 0
+%!
+TeXDict begin/SDict 200 dict N SDict begin/@SpecialDefaults{/hs 612 N
+/vs 792 N/ho 0 N/vo 0 N/hsc 1 N/vsc 1 N/ang 0 N/CLIP 0 N/rwiSeen false N
+/rhiSeen false N/letter{}N/note{}N/a4{}N/legal{}N}B/@scaleunit 100 N
+/@hscale{@scaleunit div/hsc X}B/@vscale{@scaleunit div/vsc X}B/@hsize{
+/hs X/CLIP 1 N}B/@vsize{/vs X/CLIP 1 N}B/@clip{/CLIP 2 N}B/@hoffset{/ho
+X}B/@voffset{/vo X}B/@angle{/ang X}B/@rwi{10 div/rwi X/rwiSeen true N}B
+/@rhi{10 div/rhi X/rhiSeen true N}B/@llx{/llx X}B/@lly{/lly X}B/@urx{
+/urx X}B/@ury{/ury X}B/magscale true def end/@MacSetUp{userdict/md known
+{userdict/md get type/dicttype eq{userdict begin md length 10 add md
+maxlength ge{/md md dup length 20 add dict copy def}if end md begin
+/letter{}N/note{}N/legal{}N/od{txpose 1 0 mtx defaultmatrix dtransform S
+atan/pa X newpath clippath mark{transform{itransform moveto}}{transform{
+itransform lineto}}{6 -2 roll transform 6 -2 roll transform 6 -2 roll
+transform{itransform 6 2 roll itransform 6 2 roll itransform 6 2 roll
+curveto}}{{closepath}}pathforall newpath counttomark array astore/gc xdf
+pop ct 39 0 put 10 fz 0 fs 2 F/|______Courier fnt invertflag{PaintBlack}
+if}N/txpose{pxs pys scale ppr aload pop por{noflips{pop S neg S TR pop 1
+-1 scale}if xflip yflip and{pop S neg S TR 180 rotate 1 -1 scale ppr 3
+get ppr 1 get neg sub neg ppr 2 get ppr 0 get neg sub neg TR}if xflip
+yflip not and{pop S neg S TR pop 180 rotate ppr 3 get ppr 1 get neg sub
+neg 0 TR}if yflip xflip not and{ppr 1 get neg ppr 0 get neg TR}if}{
+noflips{TR pop pop 270 rotate 1 -1 scale}if xflip yflip and{TR pop pop
+90 rotate 1 -1 scale ppr 3 get ppr 1 get neg sub neg ppr 2 get ppr 0 get
+neg sub neg TR}if xflip yflip not and{TR pop pop 90 rotate ppr 3 get ppr
+1 get neg sub neg 0 TR}if yflip xflip not and{TR pop pop 270 rotate ppr
+2 get ppr 0 get neg sub neg 0 S TR}if}ifelse scaleby96{ppr aload pop 4
+-1 roll add 2 div 3 1 roll add 2 div 2 copy TR .96 dup scale neg S neg S
+TR}if}N/cp{pop pop showpage pm restore}N end}if}if}N/normalscale{
+Resolution 72 div VResolution 72 div neg scale magscale{DVImag dup scale
+}if 0 setgray}N/psfts{S 65781.76 div N}N/startTexFig{/psf$SavedState
+save N userdict maxlength dict begin/magscale true def normalscale
+currentpoint TR/psf$ury psfts/psf$urx psfts/psf$lly psfts/psf$llx psfts
+/psf$y psfts/psf$x psfts currentpoint/psf$cy X/psf$cx X/psf$sx psf$x
+psf$urx psf$llx sub div N/psf$sy psf$y psf$ury psf$lly sub div N psf$sx
+psf$sy scale psf$cx psf$sx div psf$llx sub psf$cy psf$sy div psf$ury sub
+TR/showpage{}N/erasepage{}N/copypage{}N/p 3 def @MacSetUp}N/doclip{
+psf$llx psf$lly psf$urx psf$ury currentpoint 6 2 roll newpath 4 copy 4 2
+roll moveto 6 -1 roll S lineto S lineto S lineto closepath clip newpath
+moveto}N/endTexFig{end psf$SavedState restore}N/@beginspecial{SDict
+begin/SpecialSave save N gsave normalscale currentpoint TR
+@SpecialDefaults count/ocount X/dcount countdictstack N}N/@setspecial{
+CLIP 1 eq{newpath 0 0 moveto hs 0 rlineto 0 vs rlineto hs neg 0 rlineto
+closepath clip}if ho vo TR hsc vsc scale ang rotate rwiSeen{rwi urx llx
+sub div rhiSeen{rhi ury lly sub div}{dup}ifelse scale llx neg lly neg TR
+}{rhiSeen{rhi ury lly sub div dup scale llx neg lly neg TR}if}ifelse
+CLIP 2 eq{newpath llx lly moveto urx lly lineto urx ury lineto llx ury
+lineto closepath clip}if/showpage{}N/erasepage{}N/copypage{}N newpath}N
+/@endspecial{count ocount sub{pop}repeat countdictstack dcount sub{end}
+repeat grestore SpecialSave restore end}N/@defspecial{SDict begin}N
+/@fedspecial{end}B/li{lineto}B/rl{rlineto}B/rc{rcurveto}B/np{/SaveX
+currentpoint/SaveY X N 1 setlinecap newpath}N/st{stroke SaveX SaveY
+moveto}N/fil{fill SaveX SaveY moveto}N/ellipse{/endangle X/startangle X
+/yrad X/xrad X/savematrix matrix currentmatrix N TR xrad yrad scale 0 0
+1 startangle endangle arc savematrix setmatrix}N end
+
+%%EndProcSet
+%%BeginFont: CMTT10
+%!PS-AdobeFont-1.1: CMTT10 1.00B
+%%CreationDate: 1992 Apr 26 10:42:42
+% Copyright (C) 1997 American Mathematical Society. All Rights Reserved.
+11 dict begin
+/FontInfo 7 dict dup begin
+/version (1.00B) readonly def
+/Notice (Copyright (C) 1997 American Mathematical Society. All Rights Reserved) readonly def
+/FullName (CMTT10) readonly def
+/FamilyName (Computer Modern) readonly def
+/Weight (Medium) readonly def
+/ItalicAngle 0 def
+/isFixedPitch true def
+end readonly def
+/FontName /CMTT10 def
+/PaintType 0 def
+/FontType 1 def
+/FontMatrix [0.001 0 0 0.001 0 0] readonly def
+/Encoding 256 array
+0 1 255 {1 index exch /.notdef put} for
+dup 66 /B put
+dup 91 /bracketleft put
+dup 93 /bracketright put
+dup 98 /b put
+dup 99 /c put
+dup 108 /l put
+dup 114 /r put
+dup 116 /t put
+readonly def
+/FontBBox{-4 -235 731 800}readonly def
+/UniqueID 5000832 def
+currentdict end
+currentfile eexec
+D9D66F633B846A97B686A97E45A3D0AA052A014267B7904EB3C0D3BD0B83D891
+016CA6CA4B712ADEB258FAAB9A130EE605E61F77FC1B738ABC7C51CD46EF8171
+9098D5FEE67660E69A7AB91B58F29A4D79E57022F783EB0FBBB6D4F4EC35014F
+D2DECBA99459A4C59DF0C6EBA150284454E707DC2100C15B76B4C19B84363758
+469A6C558785B226332152109871A9883487DD7710949204DDCF837E6A8708B8
+2BDBF16FBC7512FAA308A093FE5F00F963068B8232429ED8B7CF6A3D879A2D19
+38DD5C4467F9DD8C5D1A2000B3A6BF2F25629BAEC199AE8BD4BA6ED9BBF7DABF
+D0E153BAB1C17900D4FCE209622ACD19E7C74C2807D0397357ED07AB460D5204
+EB3A45B7AC4D106B7303AD8348853032A745F417943F9B4FED652B835AA49727
+A8B4117AFF1D4BCE831EB510B6851796D0BE6982B76620CB3CE0C22CACDD4593
+F244C14EEC0E5A7C4AC42392F81C01BC4257FE12AF33F4BFEA9108FF11CF9714
+4DD6EC70A2C4C1E4F328A1EB25E43525FB1E16C07E28CC359DF61F426B7D41EA
+6A0C84DD63275395A503AAE908E1C82D389FD12A21E86999799E7F24A994472E
+A10EAE77096709BE0D11AAD24A30D96E15A51D720AFB3B10D2E0AC8DC1A1204B
+E8725E00D7E3A96F9978BC19377034D93D080C4391E579C34FF9FC2379CB119F
+1E5BBEA91AE20F343C6420BE1E2BD0636B04FCCC0BEE0DC2D56D66F06DB22438
+452822CBEAF03EE9EAA8398F276EC0D92A7FB978C17805DB2F4A7DFBA56FD6AF
+8670EB364F01DE8FCAFBAF657D68C3A03112915736CEABAA8BA5C0AC25288369
+5D49BD891FABEFE8699A0AE3ED85B48ACB22229E15623399C93DE7D935734ADA
+DA7A1462C111D44AD53EA35B57E5D0B5FC0B481820E43222DB8EFCD5D30E15F9
+BA304FA879392EE0BCC1A77C8392948FE1B07931A19298FB60E443E198089A0A
+16D46095558E6DBAB7E03022F2A762470D545CE6B8D931FA66E63DDB04125D5E
+A2F86EC0944B0D160100C2DB33B92C400A8CCB715F68477177459BCD57C86D97
+449A25D63E9584EEF820A7AB919BC62D28434BFBA0EC53913CEB3BF4857057BB
+3FB43E95092D6DC0B7CE4E1D8C1FDD292F80E973E277C7FCC9878D2F97D0E3E9
+8DD466CCB4EEC3E16429C36FC9583A048A83F68049C707E5FC1473E7DF90125D
+BCC3489C04F227D170EA0C1E8E021294FBF894B19E966F94B1F3FF879474E9EA
+34D55A9EEB4459E5DBF801CDAB652D681BC673C26D3C73FE1AE6232638CB2582
+F75CA7F1BA6327B0A39B251E10606247224799C0B710586D3E3DDF28A5864D56
+6F5C532735511ECB7C52B7B6D47042B26B5C7B7D12DE631FE3BB27C41F4FB436
+5874CC0D1A182B42E4E0146BBECF15613329897CEF40C9BDBD3E04163CC9BBF8
+202F1A53B6EFA137FD7F30D95DAC874E4BF7544FC321A761F9FAC978C8F9FEEB
+8EDE51AF3554AF92E3AC35809669C7D10AEE9EAE2BD1C09EE582144E4AF8255D
+3DFD9C3107DA232FE1FB923D3ABE78293BF063FBE35FE860684C8875F735DC9F
+316CEAF6BA883ED6019A40277AEAB1A450739EC247E377E6A3A9EAE83493B704
+9690D6CC0C0C808F19CB5F883B5FD6AE51F50020E6F45BD57DB169FD3568C8E0
+44865DE7308E8AD8B3E3EF62F7F7E3780CF0258A92F433D8A3E7CDB3D63A932A
+AE28816D999955116FB5B015C6D1321FD7F86C61800BCB0EB3F63364E6189AC7
+65FC2C0D760984B32D5B67823F69FA949CF45BC62039D1BE0588B45349ED37FA
+454ECC45F7763C6D8F71BEB6CC5282B287478C4B70F8BAC1FB7FC9191E173820
+EAB8A5D479D1CC1FFD4E9C61DA7348CAEEC28D8E7AE16DAB358E21EBD2EB62D1
+DA87CD216DA30B49DE0EDC34D6678D04AB2FED4A268B4C4286DCD162D3B4EFC2
+03D24BDDD2D828317025D0336DCDE505CA3C46ED6F2C5E5F0EB25E9AE4DAE675
+E53463B62B8A8CE31AF52BAD7FE00E38C13DC3BAA232265FA96E977AA6CDB5E0
+2C650A35D331A92306B7A25BD656C8B16348F08CDB1FBE48728D4265E0737908
+11E61B80DAC75BE86A21EA165A0504F7D2CB3EF1DA7F8733D2A27C2DBFBB3386
+15A71541D1C9BD0C28EFB46A2CC108A7C30C662D75447DB52CF8435F0535C976
+1D992B666FDDC84F1122673553ECE773C6C5CB3D5932B5BCB84C4D9B1DE32349
+671A347A2E70684F61B831AB6227642F32489A24905AC939A4108BF1A17C0901
+FBAB8399EFB6B504583678631472B48C771D833F8123B7768AD01C4C605C20AA
+385BE75BED32999C8C5658D2F31353B1DDE0E6E79F8CC8A175A9DFF31AD86217
+B52B0FBC4C984D97A723693632E583A09D04D78F344F1F1D5F8EB63732C2F64D
+E9E3C5B0B252E57DFD9AC28F0C261453B8A685639F000B9FE289293F75085FE1
+BEAE55181854882E29B66A4451DEBEA22AC0D81821F19415C363D2D5BAD4753E
+8F93498E305926F605AF00CD9A0B1B8B4633159033CCD800777E68F7742688BF
+3214E28D49FA6AE3F0F9282DB5A8082680B1DA144B3AD896585BF87D15AE55A1
+D199408D34F05B4B1524688A16BBF05A387E7B816BD7EF6FD2F4D3202D8B8B06
+336137AED54727072861E7E781B45AEC442BF470678849D28D8685ABA633D4AD
+C95637A63C6438A8CDCF92166A276268E9B8C9506ED7AC399D8AA6293DE5F1D4
+DDA3D91BDE47B8CFE7655946CF3A10E17E5ED3E99E0172CB72C28DADFEC87D56
+D1CF497B8D9F9AA2978CBE8E581B35C7042351D16070003A1932CF8579682634
+01A2F009D88CFBCDDFA01212CB8F4CB5E0B52CF5DE2A9C0DED5713444654D5F5
+BF1BC561C3111E9D7BA9FC79C8609823867C22D360377D8ED8A5248204333F10
+011FF07D757895E3799CDEDF229E26EE21C40FB415C4A3EBC663FB5ED4F0A79B
+7DF550AAE6DFDA5A0AAAA7DED504AC4D20A1A2A617D0D42A9754CBFB34E35B44
+DD12A22121D2F5039C00C2662C28BB3B047F18B4A482F024F235149C7EF61093
+C88C90A389D010840BE83EEE9A56ECCF3D07A061B3154917A9BDBE5A847AD70E
+DE639C2C9F53CBE2A1ECE83566D9EBC9C73787A3E8C045AFDF3BB02B7D9F382C
+637032008080EB09322A828CFB06CC347C52A70C9BA902A1352EC9AAF5C6663C
+0B4A6FB8280B83F323DA1BD145C0126F1AC353B9AF57BACFC37483380DA8E80C
+4518FC6B19CA5AA3B79643BCF7A11B2CBB18CBD8B1A43B32D18E098DF97F8AFC
+410A3B491F16F658A93AA8063FD465EDD510BDB20CC16317AFE36D9F42EE3D06
+738F12AD50C1BC7652D694FC74115E340760DDBE2B9C6D632DB5856D32318380
+BBB3EC05CE5685BAE64B2C6685DA732E68C9B178ABCCBB83188D6801BD84B25F
+6D53964C81742C984150F8366A3926683A1EF1BA08DAA445CFE9153E1A64F124
+1FF7E58F899FEFF92DFF6E529F5B53BAF0400907F1BC95F5
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+cleartomark
+%%EndFont
+%%BeginFont: CMR10
+%!PS-AdobeFont-1.1: CMR10 1.00B
+%%CreationDate: 1992 Feb 19 19:54:52
+% Copyright (C) 1997 American Mathematical Society. All Rights Reserved.
+11 dict begin
+/FontInfo 7 dict dup begin
+/version (1.00B) readonly def
+/Notice (Copyright (C) 1997 American Mathematical Society. All Rights Reserved) readonly def
+/FullName (CMR10) readonly def
+/FamilyName (Computer Modern) readonly def
+/Weight (Medium) readonly def
+/ItalicAngle 0 def
+/isFixedPitch false def
+end readonly def
+/FontName /CMR10 def
+/PaintType 0 def
+/FontType 1 def
+/FontMatrix [0.001 0 0 0.001 0 0] readonly def
+/Encoding 256 array
+0 1 255 {1 index exch /.notdef put} for
+dup 80 /P put
+dup 83 /S put
+dup 97 /a put
+dup 99 /c put
+dup 101 /e put
+dup 102 /f put
+dup 103 /g put
+dup 108 /l put
+dup 109 /m put
+dup 110 /n put
+dup 112 /p put
+dup 114 /r put
+dup 115 /s put
+dup 116 /t put
+readonly def
+/FontBBox{-251 -250 1009 969}readonly def
+/UniqueID 5000793 def
+currentdict end
+currentfile eexec
+D9D66F633B846A97B686A97E45A3D0AA052A014267B7904EB3C0D3BD0B83D891
+016CA6CA4B712ADEB258FAAB9A130EE605E61F77FC1B738ABC7C51CD46EF8171
+9098D5FEE67660E69A7AB91B58F29A4D79E57022F783EB0FBBB6D4F4EC35014F
+D2DECBA99459A4C59DF0C6EBA150284454E707DC2100C15B76B4C19B84363758
+469A6C558785B226332152109871A9883487DD7710949204DDCF837E6A8708B8
+2BDBF16FBC7512FAA308A093FE5CF7158F1163BC1F3352E22A1452E73FECA8A4
+87100FB1FFC4C8AF409B2067537220E605DA0852CA49839E1386AF9D7A1A455F
+D1F017CE45884D76EF2CB9BC5821FD25365DDEA6E45F332B5F68A44AD8A530F0
+92A36FAC8D27F9087AFEEA2096F839A2BC4B937F24E080EF7C0F9374A18D565C
+295A05210DB96A23175AC59A9BD0147A310EF49C551A417E0A22703F94FF7B75
+409A5D417DA6730A69E310FA6A4229FC7E4F620B0FC4C63C50E99E179EB51E4C
+4BC45217722F1E8E40F1E1428E792EAFE05C5A50D38C52114DFCD24D54027CBF
+2512DD116F0463DE4052A7AD53B641A27E81E481947884CE35661B49153FA19E
+0A2A860C7B61558671303DE6AE06A80E4E450E17067676E6BBB42A9A24ACBC3E
+B0CA7B7A3BFEA84FED39CCFB6D545BB2BCC49E5E16976407AB9D94556CD4F008
+24EF579B6800B6DC3AAF840B3FC6822872368E3B4274DD06CA36AF8F6346C11B
+43C772CC242F3B212C4BD7018D71A1A74C9A94ED0093A5FB6557F4E0751047AF
+D72098ECA301B8AE68110F983796E581F106144951DF5B750432A230FDA3B575
+5A38B5E7972AABC12306A01A99FCF8189D71B8DBF49550BAEA9CF1B97CBFC7CC
+96498ECC938B1A1710B670657DE923A659DB8757147B140A48067328E7E3F9C3
+7D1888B284904301450CE0BC15EEEA00E48CCD6388F3FC3BEE09555C11E6E295
+71B219B380EE9E5BB17AD84B4E8AED35880BD88E5AC7D9FE25C46889CD093396
+F0E34A62F93E64C8E7975CFD617121244AB09FF9A4F73F8166197D0CDE2EEBB3
+81AB9BD8329579C2122368F56DEB89BA6E42C5D9E20F2789CC4A89E4AD9B877F
+8A0ACB84936F109D86211169257C19756A97E682601F4D1E7ED950A351C14DAC
+4BEA7FB0E58FB5AEB55BC09B1253748B61B4E00C448F263458BF958D3986BF18
+9636037E95FB425AAC96FCED5B4C766F93041FAA0DBB196B0A220B8E3A9FCA6E
+B4F5C0C775C25AFF4F5099CD3A2FA59ACA735718F8E90B351B015320794A89E8
+4C34F32B465E201008CCC0A15C2DEE572BDA14D8BDDFCF2743A15F8A93386861
+828F6251F206B9131C951D1ED4364A9CCE507E2959A1DA04A777B592888D38ED
+E68FFB3EFE83870BA8E04B88C9EEEB2DB80D4D07B52CE914D9DADF825A5301AC
+C64063909D6C1DC84C274C90004F41A1FAFD450805C5DD2A8E4F4C23E114246F
+C103EB63B58F33E44DD04F6367E04C3CBB3400BA3C1943B874CFB7DBF6A3EB5A
+3F665C5A98F578A03948821E40D1608FB70C5915CA0DE369A0D7112BFF6CAE56
+CB9BF699DAF3859F2B46DF97AE05915E791F1CE849154C53C4403EFD6F1A44EF
+78C167190F3326BA35B2A0F95CD03492DBA2903489ABB6B2EB9F977F3F4D690B
+31E8F6E32F83D91F721ABD116A40698F26610853E7FD075478979BEF42166C1B
+312E8C20CB3F080B08A69416DA402D336C627BABC4737FC72F8F4F6BB7D73551
+EE33D3CEA9052546399CE5FF4996968D1EF09B7C19995C083E727D2398021CAE
+6B824B074160730AE1D61010FB6167E8AC42145BCE800A58D221004F6B953F48
+B4A99CBF85F829F34F76B02D02D956F2D9710B38FE827FE961A3BA3E78F64ECD
+DADF68975D97F94EA8A698A5C6C48A4186630DA766AE8A57D650A226E068F161
+436B0F6334FE45E57BA7F3CC6E63E2866E3BDBA559FF30704DF235ABA5080004
+CA0FA6C522B546D0B3F60BA1D7D956CB17517DF95D8D5E51D994BACE39AC902E
+2000C577FA15398CF620966AE73D22C7312708911CCBA89FB4078064701CEF7A
+66A23555E9BF2A40BDDB9BAD16E0B91E4D9ADED721784AB48D99878E0FEA0826
+8E3B221641B77CEC9AF312CFC857F4D45E91067AB304DE3EE54B08231102E217
+DCC50595595DE41A41B4877E383EF37B07017F3DFFE0AA74DC6137EB726C9481
+03B47BBE9E556034AFBD9629D7F6B88EA20514F3453A08F1898F30FB9588376C
+14E7A13680158B11195C156DCF13C6734C10457CBAFD4FA76F37C278B616531C
+0CB5BD657D0582137BD76A2F6C33822483F6BF57D78C038FEE996903566C3E3B
+A94123B89708DDD88E8C042D2A1A71EED1B08E7A7FE2032A3597CB5B7CB69E94
+38E82B5453AEDFE9F1FE62A5ADBD626AAC055391F965D8B962E4C11A9A9129FF
+ED45858FB71B1D08B58FF55F036ADC122F3547038679A7BF522A998F6D5B2769
+2E4F137F616BB4DD6B1A8568EFE1876FBECF597347BBF659BC34EC29834F2902
+346BC15AF423652B6F10C95CB745F3EB72AF2BB04FDA11AE44A7723DF1C25B66
+087DC352F9F7436A539AEB3CB43FEE6C69817AB56ED21E9007C8EA08A7AA051F
+0C6B9B41759DAA0524DA1417717DFC0822C8D85AF977650008A35B3F781CA4C5
+F177C5BD978F2035F792292E4938172FF65AD8ECFD464F3D24885710FC767268
+3AD5FC13257916E750BA77785E09ACB9487AE30D630EF1EBD0747A1489FA0CF7
+7198746F8D6D8D40EC4E2CD793731316F2FC014501B5710D8AED947AF22C6475
+8791CE18B1C62F8A57D75EC42E7F18DAA6C125DAE28633362E4C02F1A60D586D
+5456A3F55816C61078050CA03602E48F491E54148181674B5A1028A266DA3146
+22214DAC67790E98E605855ED5AB23BEA9E697F6C4778F5802DD53C37E290380
+5AA562593CBCAC69E599E48A472C147EC91A98D27F6927E77518A213BD3670EB
+12DE3A151CDD9EDA5D75C7A6F7BF38D6904F4DF0B5355D5D923A89A7C4F30629
+74C121779A50242716750E54115DE3646D0C35B04179AD46A41CA239C5C35104
+080972A477719058673C5654CBDDB911D4FC07E02EFC41DFFB8A7B3C83F8CFA3
+B9FE43446CBE678E51525F3CB64C3236F23003B1CA01E560248159915EC6EC04
+D3BAD037313906D7064C47CE4AA5AD83567BFEC6691A41A1C5F64BA618C1D310
+3002E63307B05B1B4324004F8A6659805CE9CFBC87F101E5346E9889F9EEB61A
+D1C52A8E1DE244E25B4EFB42D17E46ABCC8851C0C36995A037764480C0BE0D8B
+108189619D44B84A71B0513B59AE006E933D9C567A47B9F204F158B9658D256A
+B820E070B21BC40919D636D0589B97D6269A35B7DE76A5C587C7D62BE2DC198B
+544758D42E2386B2268A00FBAC609FCBEEF858812DE9E96B6F9D69799A41CA31
+E81AE53EC85B836270C66F0B631D3CCAAB83038FAF5BBE1AA03E4341A5ACB6AB
+D878D347593BCE6B7021A715DD16C4B8731E57EC21AC152BF72B3D54CBE4903C
+6EFE6CA2E7650772C5BCC1EC12E522DFE2D538499185E2D6727E173B5100528D
+633BE94A25A05F0E8411750A8574725A859338DBBD81E81C6C17B65694019675
+767804BFBFE09CAEEF073683CDC140A53D03D1AA0F5563696A1EF9EEC9C35427
+64473C665CA1903243A3EA37565352781874F98308A700762F7A4D5697F9977F
+D33414E9AA00244F6DE227299D2FB78637C3606F493AAEC08F4ADE8E68C72FF3
+9D25FDA5067AE64BFD4850D05ACCA93828C1FE6764B68A8D790523D59C1FFBA7
+B914B4C59A74071D6C5ED0DCB02B776E909186365EA2DBE51DCD4D41CD53749C
+948D72AEB9327FB016DEA47CA1433DE2A2E55F283C4BF4D1580580B302D7492E
+BDF414545606B687C37717B1B5A0E13A70D045C542A8956EEA04404D44887426
+2526EC38F37857674E64BA8953874B0272F85FC7BF0F1387D7448A62ABAA66FB
+ED7BEE0C4DDA5C4C68CFCE175AEA3F6780385610F69EFA0ABB01B9D226339CE7
+CFDB2806D4485A034F98CCD3FC51B4F75E9D253B02E3AE384331BEB10FDAC99B
+53785586B16AA568F294010AC3AD6C730C73A29D4E6DD8DB34A037782E5331A6
+F9BE5ED5D7B8FD264746478504E5DEA5A8FF46243B7D0FACF3668032964BAF56
+A76C6A5D9BECA6D630FAA0505BEE375B5DA5B0F601309841B9AA58CEABAE54D0
+D50184C8CE1EE7F17DC5BF17FB86A03F0AE743BB3859F5DD7B4C3FBCDA24C7DB
+D60E69778157CA1D74AE6CAAEC9266EBC80D6C20C44C219858596E569C6F690B
+31F4265A757204A7F8EBB60BF7FE407002048B7989173C5E7AC09966D0F758C4
+107BD5734204294A23E205F38A9F4E3DF364E9CF1F9B49437C8962A2FDB8D90F
+CD2EDB884892F09FA26CBDD274B6E5BDCD3D7F829473A2083EF7DB0FE00ED338
+0B68E866C68D6E8AEC27366541E30E24D89A2614E4993341C7EA571FEFCEDD59
+E1A90AFE1BC63D7F95EEE3EDDB59A6086DF64018F9F9E8969D4E419B412B83BB
+8C9593C7F117144FE91976718BE2F045B59F1EDE61FF147A836E3900711EE5A8
+4F20DA144051A0FA1F88B9AE82A8822FAB6684CFA4EC4E0BCAA9401B90C05E33
+4DEB6BE74E5E6C3E08E17994588DE0627CC66E3CD600E0C522F852706D04A08A
+CA426F5894E0F3D8C843976D765C0595735013D85AB25456537C877C01846CD2
+820042FF2D5C4627108D7AB11F02229B31C23488843CD87F12B6873AA27AB4DE
+B24A99DC972B63970B090B19E04101ABC705B87DB5A4B1C0E99E3AB6B58E89DC
+F2BAA5A4B28419DF0823690BE0717F09B2A5C90DEDD4270A8FE0950325B00291
+5F0EC4A1F6DAD00E594D2E818833792C8B92D941A81A18751DC12B95957A617E
+CA07E8744169AE120E374B2A72AA37D4B82845B08797891F40F6B3E67F8A0405
+F5B9EA3654EEA365208F09FDA1A6466542D4BDC9CBBBEE19B8377E3C00FA064D
+6EC4A2EF09F0A6296BD54FABB1E09CAE71304460715216F75D7EBC50B07CCE39
+3D68B8A4CA4B1CBC79D05C4A800489BBF1C582FCDB067920A4DC902EAFE7E12B
+DE24CC57D75D9689CE70A7446E49487F11268DF8DC5F1020227FFE6009C4956D
+BB41D9973DBA34F329B032F6B0435C6BD5730D1E1F6DCA8AFC56D33E7248619C
+224966E38774412098DFF9BABF01C0DD41165ED62DD23507BFF3293B5881F1E1
+E489878C92794F7409D60F757AE3488D354E4931244DE8F049521D6F94094AE9
+8A535965F2C5B2D1EABA1433DEFA9C368F641B30957D3631A1330FC0AC317EF7
+DDD341327440D0384DCDD00932A2888D3D18ABEDB8DE82C48CAB07AAA713CDCC
+1392DE1D897169226452E68E68D88B0E61F9039ADE4460BFF74AFC49C13853DF
+62610F8A6CEFDD7E35A495488EC65F2FAFF785D45334C7AE5ADA77D4528523A4
+76B5689F710AFF0B3BED2FFBB11AC730473D1FB96855C95EAB539529D249447F
+7C2675E3EC84E45F505CD3A7DA4CDFC33E392205E8E46F15A7DD6C1DE4E87500
+E2B1B443D1F431050BB70DBE3B98DA196534B259D729679FF941074073E8A968
+FD3FBCF653F34C3D2673FCD67F7C2C5CD1490C688ED1C21E7DB5B2CE3368B4CE
+DF30A29EA3F316381193CB3C27E7BEF8BCF0E7E76281D73F92A999C79C7F974E
+939B1FAA1F574FD6E2B3146053B07F33C01DA22306F00C0A6D3CCB0459DEE48D
+E46A9BE7F13EC7A6B6832EB982FD92C5C971F34E0B3F3D5A6C3BF5687A323339
+5C8919669F6CB4F16E0DD3560AB0FD8728CF23560940FA8FC00F7B524122EFDD
+E94E0D1AB883BC8BD45AEB5C0C72BDEF53390B4BA14E2487D2E53B5FC7580009
+631D3D6C473E1581E43852AE9C49E8856537F75B72D0CB51B7A3ECA751317BD9
+96AD427359D38EFC45C4AEC1B707CF47533D7F7659C5A5E1A95066A2B14C69B9
+04424F63
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+cleartomark
+%%EndFont
+TeXDict begin 40258437 52099154 1000 600 600 (origin_frag.dvi)
+@start /Fa 139[44 1[44 5[44 8[44 44 4[44 1[44 24[44 66[{}8
+83.022 /CMTT10 rf /Fb 139[32 33 33 1[46 1[46 69 23 4[42
+25 37 1[37 1[42 13[46 2[57 80[{}14 83.022 /CMR10 rf end
+%%EndProlog
+%%BeginSetup
+%%Feature: *Resolution 600dpi
+TeXDict begin
+ end
+%%EndSetup
+TeXDict begin 1 0 bop 881 1880 a
+ /PSfrag where{pop([lt])[[0(r)1 0]]([lc])[[1(r)1 0]]([lB])[[2(rt)1
+0]]([lb])[[3(rt)1 0]]([ct])[[4()1 0]]([c])[[5()1 0]]([cB])[[6()1 0]]([cb])[[7()1
+0]]([rt])[[8(l)1 0]]([rc])[[9(l)1 0]]([rB])[[10(l)1 0]]([rb])[[11(l)1
+0]]12 0 -1/Begin PSfrag}{userdict /PSfrag{pop}put}ifelse
+ 881 1880 a @beginspecial
+0 @llx 0 @lly 228 @urx 154 @ury 1728 @rhi @setspecial
+%%BeginDocument: origin.eps
+%!PS-Adobe-2.0 EPSF-2.0
+%%Title: origin.fig
+%%Creator: fig2dev Version 3.2 Patchlevel 4
+%%CreationDate: Sun May 22 21:41:35 2005
+%%For: epstein@linux (Becky Epstein)
+%%BoundingBox: 0 0 228 154
+%%Magnification: 1.0000
+%%EndComments
+/$F2psDict 200 dict def
+$F2psDict begin
+$F2psDict /mtrx matrix put
+/col-1 {0 setgray} bind def
+/col0 {0.000 0.000 0.000 srgb} bind def
+/col1 {0.000 0.000 1.000 srgb} bind def
+/col2 {0.000 1.000 0.000 srgb} bind def
+/col3 {0.000 1.000 1.000 srgb} bind def
+/col4 {1.000 0.000 0.000 srgb} bind def
+/col5 {1.000 0.000 1.000 srgb} bind def
+/col6 {1.000 1.000 0.000 srgb} bind def
+/col7 {1.000 1.000 1.000 srgb} bind def
+/col8 {0.000 0.000 0.560 srgb} bind def
+/col9 {0.000 0.000 0.690 srgb} bind def
+/col10 {0.000 0.000 0.820 srgb} bind def
+/col11 {0.530 0.810 1.000 srgb} bind def
+/col12 {0.000 0.560 0.000 srgb} bind def
+/col13 {0.000 0.690 0.000 srgb} bind def
+/col14 {0.000 0.820 0.000 srgb} bind def
+/col15 {0.000 0.560 0.560 srgb} bind def
+/col16 {0.000 0.690 0.690 srgb} bind def
+/col17 {0.000 0.820 0.820 srgb} bind def
+/col18 {0.560 0.000 0.000 srgb} bind def
+/col19 {0.690 0.000 0.000 srgb} bind def
+/col20 {0.820 0.000 0.000 srgb} bind def
+/col21 {0.560 0.000 0.560 srgb} bind def
+/col22 {0.690 0.000 0.690 srgb} bind def
+/col23 {0.820 0.000 0.820 srgb} bind def
+/col24 {0.500 0.190 0.000 srgb} bind def
+/col25 {0.630 0.250 0.000 srgb} bind def
+/col26 {0.750 0.380 0.000 srgb} bind def
+/col27 {1.000 0.500 0.500 srgb} bind def
+/col28 {1.000 0.630 0.630 srgb} bind def
+/col29 {1.000 0.750 0.750 srgb} bind def
+/col30 {1.000 0.880 0.880 srgb} bind def
+/col31 {1.000 0.840 0.000 srgb} bind def
+
+end
+save
+newpath 0 154 moveto 0 0 lineto 228 0 lineto 228 154 lineto closepath clip newpath
+-20.3 180.0 translate
+1 -1 scale
+
+/cp {closepath} bind def
+/ef {eofill} bind def
+/gr {grestore} bind def
+/gs {gsave} bind def
+/sa {save} bind def
+/rs {restore} bind def
+/l {lineto} bind def
+/m {moveto} bind def
+/rm {rmoveto} bind def
+/n {newpath} bind def
+/s {stroke} bind def
+/sh {show} bind def
+/slc {setlinecap} bind def
+/slj {setlinejoin} bind def
+/slw {setlinewidth} bind def
+/srgb {setrgbcolor} bind def
+/rot {rotate} bind def
+/sc {scale} bind def
+/sd {setdash} bind def
+/ff {findfont} bind def
+/sf {setfont} bind def
+/scf {scalefont} bind def
+/sw {stringwidth} bind def
+/tr {translate} bind def
+/tnt {dup dup currentrgbcolor
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb}
+ bind def
+/shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul
+ 4 -2 roll mul srgb} bind def
+ /DrawEllipse {
+ /endangle exch def
+ /startangle exch def
+ /yrad exch def
+ /xrad exch def
+ /y exch def
+ /x exch def
+ /savematrix mtrx currentmatrix def
+ x y tr xrad yrad sc 0 0 1 startangle endangle arc
+ closepath
+ savematrix setmatrix
+ } def
+
+/$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def
+/$F2psEnd {$F2psEnteredState restore end} def
+
+$F2psBegin
+10 setmiterlimit
+0 slj 0 slc
+ 0.06000 0.06000 sc
+%
+% Fig objects follow
+%
+%
+% here starts figure with depth 2
+% Polyline
+15.000 slw
+n 3750 2790 m 1590 2790 l 1590 660 l 3750 660 l
+ cp gs 0.95 setgray ef gr gs col-1 s gr
+% here ends figure;
+%
+% here starts figure with depth 0
+% Ellipse
+7.500 slw
+n 1590 2175 45 45 0 360 DrawEllipse gs 0.00 setgray ef gr gs col-1 s gr
+
+% Polyline
+n 1796 1725 m 1804 1725 l gs col-1 s gr
+% Polyline
+ [60] 0 sd
+n 1590 2175 m
+ 3750 2175 l gs col-1 s gr [] 0 sd
+% Polyline
+ [60] 0 sd
+n 1590 1725 m
+ 3750 1725 l gs col-1 s gr [] 0 sd
+% Polyline
+ [60] 0 sd
+n 2670 660 m
+ 2670 2790 l gs col-1 s gr [] 0 sd
+% Polyline
+gs clippath
+2663 1449 m 2702 1385 l 2529 1282 l 2655 1401 l 2490 1346 l cp
+eoclip
+n 2318 1200 m
+ 2670 1410 l gs col-1 s gr gr
+
+% arrowhead
+n 2490 1346 m 2655 1401 l 2529 1282 l 2539 1331 l 2490 1346 l
+ cp gs 0.00 setgray ef gr col-1 s
+% Polyline
+gs clippath
+2323 1749 m 2395 1728 l 2339 1535 l 2350 1708 l 2267 1556 l cp
+eoclip
+n 2205 1207 m
+ 2355 1725 l gs col-1 s gr gr
+
+% arrowhead
+n 2267 1556 m 2350 1708 l 2339 1535 l 2312 1578 l 2267 1556 l
+ cp gs 0.00 setgray ef gr col-1 s
+% Polyline
+gs clippath
+2140 2172 m 2069 2148 l 2005 2340 l 2094 2192 l 2076 2363 l cp
+eoclip
+n 1995 2490 m
+ 2100 2175 l gs col-1 s gr gr
+
+% arrowhead
+n 2076 2363 m 2094 2192 l 2005 2340 l 2051 2320 l 2076 2363 l
+ cp gs 0.00 setgray ef gr col-1 s
+% Polyline
+gs clippath
+1527 2185 m 1559 2117 l 1377 2031 l 1514 2137 l 1345 2098 l cp
+eoclip
+n 1005 1897 m
+ 1530 2145 l gs col-1 s gr gr
+
+% arrowhead
+n 1345 2098 m 1514 2137 l 1377 2031 l 1391 2079 l 1345 2098 l
+ cp gs 0.00 setgray ef gr col-1 s
+% Polyline
+gs clippath
+2632 1709 m 2685 1762 l 2828 1618 l 2683 1712 l 2775 1566 l cp
+eoclip
+n 2977 1417 m
+ 2670 1725 l gs col-1 s gr gr
+
+% arrowhead
+n 2775 1566 m 2683 1712 l 2828 1618 l 2778 1616 l 2775 1566 l
+ cp gs 0.00 setgray ef gr col-1 s
+% Polyline
+gs clippath
+2683 2136 m 2634 2193 l 2787 2325 l 2684 2187 l 2836 2268 l cp
+eoclip
+n 2932 2400 m
+ 2670 2175 l gs col-1 s gr gr
+
+% arrowhead
+n 2836 2268 m 2684 2187 l 2787 2325 l 2786 2274 l 2836 2268 l
+ cp gs 0.00 setgray ef gr col-1 s
+/Times-Roman ff 180.00 scf sf
+2565 570 m
+gs 1 -1 sc ([ct]) col-1 sh gr
+/Times-Roman ff 180.00 scf sf
+1290 1755 m
+gs 1 -1 sc ([lc]) col-1 sh gr
+/Times-Roman ff 180.00 scf sf
+1350 615 m
+gs 1 -1 sc ([lt]) col-1 sh gr
+/Times-Roman ff 180.00 scf sf
+338 1808 m
+gs 1 -1 sc (Reference) col-1 sh gr
+/Times-Roman ff 180.00 scf sf
+510 2010 m
+gs 1 -1 sc (Point) col-1 sh gr
+/Times-Roman ff 180.00 scf sf
+1747 2625 m
+gs 1 -1 sc (Baseline) col-1 sh gr
+/Times-Roman ff 180.00 scf sf
+3000 2535 m
+gs 1 -1 sc ([cB]) col-1 sh gr
+/Times-Roman ff 180.00 scf sf
+3023 1358 m
+gs 1 -1 sc ([c]) col-1 sh gr
+/Times-Roman ff 180.00 scf sf
+1665 1140 m
+gs 1 -1 sc (Centerlines) col-1 sh gr
+/Times-Roman ff 180.00 scf sf
+2527 3000 m
+gs 1 -1 sc ([cb]) col-1 sh gr
+/Times-Roman ff 180.00 scf sf
+3795 2977 m
+gs 1 -1 sc ([rb]) col-1 sh gr
+/Times-Roman ff 180.00 scf sf
+3825 2242 m
+gs 1 -1 sc ([rB]) col-1 sh gr
+/Times-Roman ff 180.00 scf sf
+3832 1770 m
+gs 1 -1 sc ([rc]) col-1 sh gr
+/Times-Roman ff 180.00 scf sf
+3802 593 m
+gs 1 -1 sc ([rt]) col-1 sh gr
+/Times-Roman ff 180.00 scf sf
+1230 2355 m
+gs 1 -1 sc ([lB]) col-1 sh gr
+/Times-Roman ff 180.00 scf sf
+1335 2985 m
+gs 1 -1 sc ([lb]) col-1 sh gr
+% here ends figure;
+$F2psEnd
+rs
+showpage
+
+%%EndDocument
+ @endspecial 881 1880 a
+ /End PSfrag
+ 881 1880 a 881 594 a
+ /Hide PSfrag
+ 881 594
+a 141 652 a Fb(PSfrag)26 b(replacemen)n(ts)p 141 681
+741 4 v 881 684 a
+ /Unhide PSfrag
+ 881 684 a 881 752 a
+ {
+ 881 752 a 706 777
+a Fa([lt])881 752 y
+ } 0/Place PSfrag
+ 881 752 a 881 851 a
+ {
+ 881 851 a 706
+877 a Fa([lc])881 851 y
+ } 1/Place PSfrag
+ 881 851 a 881 919 a
+ {
+ 881 919 a
+706 976 a Fa([lB])881 919 y
+ } 2/Place PSfrag
+ 881 919 a 881 1018 a
+ {
+ 881
+1018 a 706 1076 a Fa([lb])881 1018 y
+ } 3/Place PSfrag
+ 881 1018 a 794 1150
+a
+ {
+ 794 1150 a 706 1176 a Fa([ct])794 1150 y
+ } 4/Place PSfrag
+ 794 1150 a
+816 1250 a
+ {
+ 816 1250 a 751 1275 a Fa([c])816 1250 y
+ } 5/Place PSfrag
+ 816
+1250 a 794 1350 a
+ {
+ 794 1350 a 706 1375 a Fa([cB])794 1350
+y
+ } 6/Place PSfrag
+ 794 1350 a 794 1449 a
+ {
+ 794 1449 a 706 1475 a Fa([cb])794
+1449 y
+ } 7/Place PSfrag
+ 794 1449 a 706 1549 a
+ {
+ 706 1549 a 25 x Fa([rt])706
+1549 y
+ } 8/Place PSfrag
+ 706 1549 a 706 1648 a
+ {
+ 706 1648 a 26 x Fa([rc])706
+1648 y
+ } 9/Place PSfrag
+ 706 1648 a 706 1748 a
+ {
+ 706 1748 a 25 x Fa([rB])706
+1748 y
+ } 10/Place PSfrag
+ 706 1748 a 706 1848 a
+ {
+ 706 1848 a 25 x Fa([rb])706
+1848 y
+ } 11/Place PSfrag
+ 706 1848 a eop end
+%%Trailer
+
+userdict /end-hook known{end-hook}if
+%%EOF
+
+%%EndDocument
+ @endspecial 1630 3268 a(Figure)h(3:)p 0 TeXcolorgray
+Black 41 w(Av)-5 b(ailable)32 b(Origin)e(P)m(oin)m(ts)p
+Black 857 3495 a(The)25 b(horizon)m(tal)i(p)s(osition)e(of)g(the)g
+FM(origin)f FQ(p)s(oin)m(ts)h(is)g(sp)s(eci\014ed)f(b)m(y)h(one)h(of)f
+(three)h(letters:)857 3607 y FM(l,c,r)31 b FQ(\(whic)m(h)i(stand)f(for)
+g(left,)h(cen)m(ter,)i(righ)m(t,)e(resp)s(ectiv)m(ely\),)i(while)d(the)
+h(v)m(ertical)h(p)s(o-)857 3720 y(sition)d(is)f(sp)s(eci\014ed)g(b)m(y)
+g(one)g(of)h(four)e(letters:)42 b FM(t,c,B,b)28 b FQ(\(whic)m(h)i
+(stand)g(for)g(top,)h(cen)m(ter,)857 3833 y(Baseline,)h(b)s(ottom,)f
+(resp)s(ectiv)m(ely\).)43 b(F)-8 b(or)31 b(example)p
+Black 857 3988 a FM([rb])p Black 45 w FQ(sp)s(eci\014es)f(the)g(b)s
+(ottom-righ)m(t)i(corner)p Black 857 4117 a FM([lt])p
+Black 45 w FQ(sp)s(eci\014es)e(the)g(top-left)i(corner)p
+Black 857 4247 a FM([cB])p Black 45 w FQ(sp)s(eci\014es)e(the)g(cen)m
+(ter)i(of)e(the)h(graphic's)f(Baseline)857 4401 y(Note)i(that)p
+Black 967 4566 a FK(\210)p Black 45 w FQ(The)24 b(order)g(of)h(the)f
+(letters)i(is)e(not)h(imp)s(ortan)m(t,)h(making)g FM([br])d
+FQ(equiv)-5 b(alen)m(t)26 b(to)f FM([rb])p FQ(.)p Black
+967 4696 a FK(\210)p Black 45 w FM(c)g FQ(represen)m(ts)g(either)g(the)
+g(horizon)m(tal)i(cen)m(ter)f(or)f(v)m(ertical)i(cen)m(ter)f(dep)s
+(ending)d(what)1057 4809 y(letter)32 b(is)e(used)g(with)g(it.)p
+Black 967 4938 a FK(\210)p Black 45 w FQ(If)35 b(only)g(one)g(letter)h
+(is)f(sp)s(eci\014ed,)h(the)f(other)g(is)g(assumed)f(to)i(b)s(e)e
+FM(c)p FQ(,)i(making)h FM([c])1057 5051 y FQ(equiv)-5
+b(alen)m(t)32 b(to)f FM([cc])p FQ(,)f FM([l])f FQ(equiv)-5
+b(alen)m(t)32 b(to)f FM([lc])p FQ(,)f FM([t])f FQ(equiv)-5
+b(alen)m(t)32 b(to)f FM([tc])p FQ(,)e(etc.)p Black 2250
+5640 a(28)p Black eop end
+%%Page: 29 29
+TeXDict begin 29 28 bop Black 0 TeXcolorgray Black Black
+630 -149 a FD(9)135 b(Adv)-7 b(anced)43 b(Graphics-Inclusion)i
+(Commands)630 54 y FQ(This)36 b(section)h(describ)s(es)f(adv)-5
+b(anced)37 b(graphics-inclusion)g(commands)f(whic)m(h)g(are)h(needed)f
+(in)630 167 y(the)31 b(follo)m(wing)g(situations)p Black
+741 297 a(1.)p Black 46 w(When)f(the)h(sp)s(eci\014ed)f(\014lename)g
+(has)g(no)h(extension.)41 b(F)-8 b(or)31 b(example)p
+Black Black 1337 430 a FN(\\includegraphics)o({f)o(il)o(e})p
+Black 741 577 a FQ(2.)p Black 46 w(When)f(compressed)g
+FJ(eps)g FQ(graphics)g(are)h(used)e(\(also)j(see)f(Section)p
+0.05 1.00 1.00 0.40 TeXcolorcmyk 31 w(14.1)p Black
+32 w(on)f(page)p 0.05 1.00 1.00 0.40 TeXcolorcmyk
+31 w(43)p Black(\).)p Black 741 728 a(3.)p Black 46 w(When)g(non-EPS)g
+(graphics)g(are)h(used)e(\(also)j(see)f(Section)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 31 w(14.2)p Black 32 w(on)f(page)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 32 w(43)p Black(\).)630 870 y(In)d(these)h(situations,)h
+(the)f FM(\\DeclareGraphicsRule)22 b FQ(and)27 b FM
+(\\DeclareGraphicsExtension)o(s)630 983 y FQ(commands)20
+b(are)h(needed)e(to)j(con)m(trol)f(ho)m(w)g(L)2105 967
+y FP(A)2144 983 y FQ(T)2195 1003 y(E)2245 983 y(X)f(handles)g(\014les)g
+(sp)s(eci\014ed)g(in)g FM(\\includegraphics)p FQ(.)p
+Black 767 1126 a FK(\210)p Black 45 w FQ(The)39 b FM
+(\\DeclareGraphicsExtensio)o(ns)33 b FQ(command)39 b(sp)s(eci\014es)g
+(the)g(extensions)h(to)g(at-)857 1239 y(tempt)e(\(e.g.,)j
+FM(.eps)p FQ(,)e FM(.ps)p FQ(,)f FM(.eps.gz)p FQ(,)g(etc.\))64
+b(when)36 b(the)i(sp)s(eci\014ed)f(\014lename)g(do)s(es)h(not)857
+1352 y(ha)m(v)m(e)32 b(an)e(extension.)p Black 767 1502
+a FK(\210)p Black 45 w FQ(The)35 b FM(\\DeclareGraphicsRule)30
+b FQ(sp)s(eci\014es)k(a)i(command)f(whic)m(h)g(op)s(erates)g(on)g(the)h
+(\014le.)857 1615 y(The)h(execution)i(of)f(this)f(command)g(requires)g
+(an)h(op)s(erating)g(system)f(whic)m(h)h(supp)s(ort)857
+1728 y(pip)s(es.)i(F)-8 b(or)31 b(example,)g(Unix)g(supp)s(orts)d(pip)s
+(es)h(while)i FJ(dos)f FQ(do)s(es)g(not.)857 1878 y(Making)21
+b(this)g(command)f(a)g(decompression)g(command)h(allo)m(ws)g
+(compressed)f FJ(eps)f FQ(graph-)857 1991 y(ics)35 b(to)f(b)s(e)f
+(used.)50 b(Making)35 b(this)f(command)f(a)i(graphics-con)m(v)m(ersion)
+g(command)f(allo)m(ws)857 2104 y(non-)p FJ(eps)29 b FQ(graphics)h(to)i
+(b)s(e)d(used.)630 2348 y FB(9.1)112 b(The)38 b
+(DeclareGraphicsExtensions)h(Command)630 2519 y FQ(The)29
+b FM(\\DeclareGraphicsExtensio)o(ns)23 b FQ(command)29
+b(tells)i(L)2715 2502 y FP(A)2754 2519 y FQ(T)2805 2539
+y(E)2855 2519 y(X)f(whic)m(h)f(extensions)h(to)g(try)f(if)630
+2632 y(a)i(\014le)f(with)g(no)h(extension)g(is)f(sp)s(eci\014ed)g(in)g
+(the)g FM(\\includegraphics)c FQ(command.)771 2732 y(F)-8
+b(or)39 b(con)m(v)m(enience,)j(a)c(default)g(set)g(of)g(extensions)h
+(is)f(pre-de\014ned)e(dep)s(ending)g(on)i(whic)m(h)630
+2831 y(graphics)24 b(driv)m(er)f(is)h(selected.)40 b(F)-8
+b(or)25 b(example)f(if)g(the)g FO(graphicx)g FQ(pac)m(k)-5
+b(age)26 b(uses)d(the)i FM(dvips)d FQ(driv)m(er,)630
+2931 y(the)31 b(follo)m(wing)g(graphic)g(extensions)g(\(de\014ned)e(in)
+h FM(dvips.def)p FQ(\))f(are)h(used)g(b)m(y)g(default)p
+Black Black 935 3072 a FN(\\DeclareGraphics)o(Ext)o(en)o(sio)o(ns)o
+({.e)o(ps)o(,.)o(ps,)o(.e)o(ps.)o(gz)o(,.)o(ps.)o(gz)o(,.e)o(ps)o(.Z})
+630 3213 y FQ(If)45 b(the)h FO(graphicx)f FQ(pac)m(k)-5
+b(age)48 b(uses)d(the)g FM(pdftex)f FQ(driv)m(er,)49
+b(the)d(follo)m(wing)h(graphic)e(extensions)630 3313
+y(\(de\014ned)29 b(in)i FM(pdftex.def)p FQ(\))c(are)k(used)f(b)m(y)g
+(default)p Black Black 935 3454 a FN(\\DeclareGraphics)o(Ext)o(en)o
+(sio)o(ns)o({.p)o(ng)o(,.)o(pdf)o(,.)o(jpg)o(,.)o(mp)o(s})630
+3595 y FQ(With)44 b(the)g FM(dvips)e FQ(graphics)h(extension)h(list,)k
+FM(\\includegraphics{file})37 b FQ(\014rst)43 b(lo)s(oks)h(for)630
+3695 y FM(file.eps)p FQ(,)34 b(then)h FM(file.ps)p FQ(,)g(then)f
+FM(file.eps.gz)p FQ(,)g(etc.)i(un)m(til)g(a)f(\014le)h(is)f(found.)53
+b(This)35 b(allo)m(ws)630 3794 y(the)c(graphics)f(to)h(b)s(e)f(sp)s
+(eci\014ed)f(with)p Black Black 935 3935 a FN(\\includegraphics)o({fi)o
+(le)o(})630 4077 y FQ(instead)i(of)p Black Black 935
+4218 a FN(\\includegraphics)o({fi)o(le)o(.ep)o(s})630
+4372 y FQ(The)k(\014rst)g(syn)m(tax)h(has)f(the)h(adv)-5
+b(an)m(tage)37 b(that)f(if)f(y)m(ou)h(later)h(decide)f(to)g(compress)f
+FM(file.eps)p FQ(,)630 4485 y(y)m(ou)30 b(need)f(not)g(edit)h(the)f(L)
+1532 4468 y FP(A)1571 4485 y FQ(T)1622 4505 y(E)1672
+4485 y(X)h(\014le.)40 b(The)29 b(extensionless)h(syn)m(tax)g(also)g
+(allo)m(ws)h(the)e(do)s(cumen)m(t)630 4598 y(to)i(b)s(e)e(pro)s(cessed)
+h(b)m(y)g(either)g(L)1679 4581 y FP(A)1718 4598 y FQ(T)1769
+4618 y(E)1820 4598 y(X)g(or)g(p)s(dfL)2186 4581 y FP(A)2225
+4598 y FQ(T)2276 4618 y(E)2325 4598 y(X)g(as)g(describ)s(ed)f(in)h
+(Section)p 0.05 1.00 1.00 0.40 TeXcolorcmyk 31 w(7.4)p
+Black 31 w(on)g(page)p 0.05 1.00 1.00 0.40 TeXcolorcmyk
+31 w(23)p Black(.)771 4711 y(Ho)m(w)m(ev)m(er,)c(the)c(extensionless)h
+(syn)m(tax)f(can)g(aggra)m(v)-5 b(ate)25 b(p)s(o)s(ol)d(space)g
+(problems)f(as)h(describ)s(ed)630 4824 y(in)30 b(Section)p
+0.05 1.00 1.00 0.40 TeXcolorcmyk 31 w(9.1.2)p Black
+32 w(b)s(elo)m(w.)p Black 2250 5640 a(29)p Black eop
+end
+%%Page: 30 30
+TeXDict begin 30 29 bop Black 0 TeXcolorgray Black Black
+630 -149 a FL(9.1.1)105 b(Filenames)35 b(Without)g(Extensions)630
+10 y FQ(Note)d(that)p Black Black 935 136 a FN(\\includegraphics)o({fi)
+o(le)o(})630 263 y FQ(do)s(es)c Fy(not)37 b FQ(attempt)29
+b(to)f(op)s(en)g FM(file)e FQ(unless)i(the)g(n)m(ull)f(extension)i
+FM({})e FQ(is)h(included)f(in)h(the)g(exten-)630 363
+y(sion)i(list.)42 b(F)-8 b(or)31 b(example,)p Black Black
+935 489 a FN(\\DeclareGraphics)o(Ext)o(en)o(sio)o(ns)o({.e)o(ps)o(,.)o
+(eps)o(.g)o(z,{)o(}})630 629 y FQ(causes)g FM(file)e
+FQ(to)i(b)s(e)f(attempted)h(if)38 b FM(file.eps)28 b
+FQ(and)i FM(file.eps.gz)d FQ(are)k(not)f(found.)771 742
+y(Since)c(the)g(default)g(extension)g(list)h(do)s(es)e
+Fy(not)35 b FQ(include)26 b(the)g(n)m(ull)f(extension,)j(users)d(w)m
+(an)m(ting)630 855 y(to)35 b(use)f(extensionless)h(\014les)f(m)m(ust)h
+(use)f(the)g FM(\\DeclareGraphicsExtension)o(s)28 b FQ(command)34
+b(to)630 968 y(de\014ne)c(an)g(extension)h(list)g(that)g(includes)f
+(the)g(n)m(ull)h(extension.)630 1205 y FL(9.1.2)105 b(P)m(o)s(ol)36
+b(Space)g(Problems)630 1364 y FQ(Sp)s(ecifying)23 b(no)g(\014le)g
+(extension)h(and)e(relying)i(on)f(L)2319 1347 y FP(A)2358
+1364 y FQ(T)2409 1383 y(E)2459 1364 y(X)g(to)h(c)m(ho)s(ose)g(the)f
+(correct)i(extension)e(from)630 1463 y(the)k FM
+(\\DeclareGraphicsExtensi)o(ons)20 b FQ(extension)27
+b(list)g(can)f(aggra)m(v)-5 b(ate)30 b(p)s(o)s(ol)c(space)h(problems)
+630 1563 y(\(see)41 b(Section)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 41 w(13.4)p Black 42 w(on)f(page)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 41 w(41)p Black(\).)72 b(If)40 b(p)s(o)s(ol)g(space)h(is)f
+(a)h(concern,)i(commands)d(without)g(an)630 1662 y(extension)31
+b(suc)m(h)f(as)p Black Black 892 1789 a FN(\\includegraphic)o(s{)o(fil)
+o(e})630 1916 y FQ(should)h(only)h(b)s(e)f(used)g(when)g(a)i
+FM(\\DeclareGraphicsExtensi)o(ons)25 b FQ(command)32
+b(has)g(sp)s(eci\014ed)630 2015 y(a)f(minimal)f(n)m(um)m(b)s(er)f(of)i
+(extensions,)g(suc)m(h)f(as)p Black Black 935 2142 a
+FN(\\DeclareGraphics)o(Ext)o(en)o(sio)o(ns)o({.e)o(ps)o(,.)o(eps)o(.g)o
+(z})630 2410 y FB(9.2)112 b(The)38 b(DeclareGraphicsRule)h(Command)630
+2581 y FQ(The)20 b FM(\\DeclareGraphicsRule)15 b FQ(command)20
+b(sp)s(eci\014es)f(ho)m(w)j FM(\\includegraphics)16 b
+FQ(should)j(treats)630 2694 y(\014le,)31 b(dep)s(ending)e(on)h(their)g
+(extensions.)630 2857 y FL(Syn)m(tax:)131 b FM
+(\\DeclareGraphicsRule{ext}{)o(type)o(}{s)o(izef)o(ile})o({co)o(mman)o
+(d})630 3006 y FQ(F)-8 b(or)31 b(example,)g(the)g(command)p
+Black Black 804 3133 a FN(\\DeclareGraphicsR)o(ul)o(e{.)o(ep)o(s.g)o
+(z})o({ep)o(s})o({.)o(eps)o(.b)o(b}{)o(`g)o(un)o(zip)37
+b(-c)43 b(#1})630 3273 y FQ(sp)s(eci\014es)21 b(that)i(an)m(y)f(\014le)
+g(with)f(a)h FM(.eps.gz)e FQ(extension)i(is)g(treated)h(as)f
+(compressed)f FJ(eps)f FQ(\014le,)k(with)630 3386 y(the)e(the)h
+(BoundingBo)m(x)g(information)f(stored)h(in)f(the)g(\014le)h(with)e(a)i
+FM(.eps.bb)d FQ(extension,)25 b(and)d(the)630 3499 y
+FM(gunzip)46 b(-c)27 b FQ(command)g(uncompresses)g(the)h(\014le.)40
+b(\(Since)28 b(L)2692 3482 y FP(A)2731 3499 y FQ(T)2782
+3518 y(E)2832 3499 y(X)g(cannot)g(read)f(BoundingBo)m(x)630
+3612 y(information)45 b(from)f(a)h(compressed)f(\014le,)k(the)d
+(BoundingBo)m(x)g(line)g(m)m(ust)f(b)s(e)g(stored)h(in)f(an)630
+3724 y(uncompressed)29 b(\014le.\))771 3824 y(The)43
+b FM(\\DeclareGraphicsRule)37 b FQ(allo)m(ws)44 b FM(*)f
+FQ(to)g(signify)g(an)m(y)h(unkno)m(wn)d(extension.)79
+b(F)-8 b(or)630 3924 y(example,)p Black 1267 4144 a FB(T)f(able)38
+b(4:)p 0 TeXcolorgray Black 50 w(DeclareGraphicsRule)h(Argumen)m(ts)p
+Black Black -120 4273 4081 4 v -120 4386 4 113 v -67
+4352 a FM(ext)p 583 4386 V 559 w FQ(The)30 b(\014le)g(extension.)p
+3957 4386 V -120 4390 4081 4 v -120 4503 4 113 v -67
+4469 a FM(type)p 583 4503 V 511 w FQ(The)g(graphics)g(t)m(yp)s(e)h(for)
+f(that)h(extension.)p 3957 4503 V -120 4506 4081 4 v
+-120 4845 4 339 v -67 4585 a FM(sizefile)p 583 4845 V
+319 w FQ(The)21 b(extension)g(of)g(the)h(\014le)f(whic)m(h)f(con)m
+(tains)j(the)e(BoundingBo)m(x)h(information)f(for)g(the)g(graph-)636
+4698 y(ics.)76 b(If)42 b(this)g(option)g(is)g(blank,)j(then)d(the)g
+(size)h(information)f(m)m(ust)g(b)s(e)f(sp)s(eci\014ed)h(b)m(y)g(the)
+636 4811 y FM(\\includegraphics)26 b FQ(command's)k FM(bb)g
+FQ(option.)p 3957 4845 V -120 4848 4081 4 v -120 5413
+4 565 v -67 4927 a FM(command)p 583 5413 V 367 w FQ(The)g(command)g(to)
+i(b)s(e)e(applied)g(to)h(the)g(\014le.)41 b(\(often)31
+b(left)h(blank\).)41 b(The)30 b(command)g(m)m(ust)g(b)s(e)636
+5040 y(preceded)k(b)m(y)g(a)h(single)g(bac)m(kw)m(ard)g(quote)g(\(not)g
+(to)g(b)s(e)f(confused)f(with)h(the)h(more)g(common)636
+5153 y(single)30 b(forw)m(ard)f(quote.\))41 b(Curren)m(tly)-8
+b(,)30 b(only)h FM(dvips)d FQ(allo)m(ws)j(execution)f(of)g(suc)m(h)f(a)
+h(command.)636 5266 y(See)k(Section)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 35 w(14)p Black 34 w(on)g(page)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 35 w(42)p Black 34 w(for)g(examples)g(of)g(using)f(this)h
+(command)f(for)h(use)f(with)h(com-)636 5379 y(pressed)c(and)f(non-)p
+FJ(eps)g FQ(graphics.)p 3957 5413 V -120 5416 4081 4
+v Black Black 2250 5640 a(30)p Black eop end
+%%Page: 31 31
+TeXDict begin 31 30 bop Black 0 TeXcolorgray Black Black
+Black Black 892 -149 a FN(\\DeclareGraphic)o(sR)o(ule)o({*)o(}{e)o(ps)o
+(}{*)o(}{)o(})630 6 y FQ(causes)28 b(an)m(y)g(unkno)m(wn)e(extension)i
+(to)h(b)s(e)e(treated)h(as)g(an)f FJ(eps)g FQ(\014le.)40
+b(F)-8 b(or)28 b(example,)h(this)f(causes)630 119 y FM(file.EPS)p
+FQ(\))g(to)k(b)s(e)d(treated)j(as)e(an)h FJ(eps)e FQ(\014le.)771
+232 y(The)42 b(extension)g(is)g(de\014ned)f(as)h(the)g(p)s(ortion)g(of)
+g(the)g(\014lename)g(after)h(the)f(\014rst)f(p)s(erio)s(d,)p
+Black Black -3897 w FL(P)m(erio)s(ds)36 b(In)83 344 y(Filenames)90
+b FQ(whic)m(h)40 b(mak)m(es)i(it)f(p)s(ossible)f(for)g(\014les)h
+(ending)f(in)g FM(eps.gz)f FQ(to)j(b)s(e)e(iden)m(ti\014ed)g(as)h
+(compressed)630 457 y FJ(eps)30 b FQ(\014les.)42 b(T)-8
+b(o)31 b(a)m(v)m(oid)i(confusion,)e(the)g(base)g(p)s(ortion)g(of)g(the)
+g(\014lename)g(should)f(not)h(con)m(tain)i(a)630 570
+y(p)s(erio)s(d.)45 b(F)-8 b(or)32 b(example,)i(sp)s(ecifying)f
+FM(file.name.eps.gz)28 b FQ(mak)m(es)33 b FM(\\includegraphics)27
+b FQ(lo)s(ok)630 683 y(for)e(a)g(graphics)g(rule)f(asso)s(ciated)i
+(with)f(the)g(extension)h FM(name.eps.gz)p FQ(.)35 b(Since)25
+b(suc)m(h)g(a)g(graphics)630 796 y(rule)36 b(probably)g(do)s(es)g(not)h
+(exist,)i(the)d(graphics)h(rule)f(for)g(the)h(unkno)m(wn)e(extension)i
+(is)f(used.)630 909 y(\(Filenames)c(with)e(m)m(ultiple)i(p)s(erio)s(ds)
+d(w)m(ork)i(if)f(their)h(t)m(yp)s(e)g(happ)s(ens)e(to)i(b)s(e)f(the)h
+(default)g(t)m(yp)s(e.)630 1022 y(F)-8 b(or)36 b(example,)h(when)d
+(\014les)h(with)g(unkno)m(wn)e(extensions)j(are)f(treated)h(as)f
+FJ(eps)p FQ(,)h(the)f(\014lename)630 1135 y FM(file.name.eps)27
+b FQ(is)j(coinciden)m(tly)i(treated)g(correctly)-8 b(.\))771
+1226 y(F)g(or)27 b(con)m(v)m(enience,)i(a)d(default)f(set)i(of)f
+(graphics)f(rules)g(is)h(pre-de\014ned)e(dep)s(ending)h(on)g(whic)m(h)p
+Black Black -3945 w FL(Pre-de\014ned)30 1339 y(Commands)630
+1317 y FQ(graphics)38 b(driv)m(er)g(is)g(selected.)65
+b(F)-8 b(or)39 b(example)f(if)g(the)h FM(dvips)d FQ(driv)m(er)i(is)g
+(used,)h(the)f(follo)m(wing)630 1422 y(graphic)30 b(rules)g
+(\(de\014ned)g(in)g FM(dvips.def)p FQ(\))2093 1389 y
+FP(15)2196 1422 y FQ(are)h(used)e(b)m(y)h(default)p Black
+Black 787 1555 a FE(\\DeclareGraphicsRule{.eps}{ep)q(s}{.e)q(ps}{)q(})
+787 1646 y(\\DeclareGraphicsRule{.ps}{eps)q(}{.ps)q(}{})787
+1737 y(\\DeclareGraphicsRule{.pz}{eps)q(}{.bb)q(}{`g)q(unzip)46
+b(-c)40 b(#1})787 1829 y(\\DeclareGraphicsRule{.eps.Z}{)q(eps}{)q(.eps)
+q(.bb}{)q(`gun)q(zip)46 b(-c)39 b(#1})787 1920 y
+(\\DeclareGraphicsRule{.ps.Z}{e)q(ps}{.)q(ps.b)q(b}{`g)q(unzi)q(p)45
+b(-c)40 b(#1})787 2011 y(\\DeclareGraphicsRule{.eps.gz})q({eps})q({.ep)
+q(s.bb})q({`gu)q(nzip)46 b(-c)39 b(#1})787 2103 y
+(\\DeclareGraphicsRule{.ps.gz}{)q(eps}{)q(.ps.)q(bb}{`)q(gunz)q(ip)45
+b(-c)40 b(#1})787 2194 y(\\DeclareGraphicsRule{.pcx}{bm)q(p}{}{)q(})787
+2285 y(\\DeclareGraphicsRule{.bmp}{bm)q(p}{}{)q(})787
+2377 y(\\DeclareGraphicsRule{.msp}{bm)q(p}{}{)q(})787
+2468 y(\\DeclareGraphicsRule{*}{eps}{)q(*}{})630 2622
+y FQ(The)32 b(\014rst)f(t)m(w)m(o)i(commands)f(de\014ne)g(the)g
+FM(.eps)f FQ(and)g FM(.ps)h FQ(extensions)g(as)g FJ(eps)f
+FQ(\014les.)46 b(The)32 b(next)630 2735 y(\014v)m(e)25
+b(commands)g(de\014ne)f(extensions)i(for)e(compressed)h
+FJ(eps)f FQ(\014les.)39 b(The)24 b(next)h(three)g(commands)630
+2848 y(de\014ne)30 b(extensions)i(for)f FJ(pcx)p FQ(,)g
+FJ(bmp)p FQ(,)g FJ(msp)g FQ(bitmaps.)42 b(The)31 b(last)h(command)e
+(causes)i(\014lenames)630 2961 y(with)e(unkno)m(wn)f(extensions)i(to)g
+(b)s(e)f(treated)h(as)g(an)f FJ(eps)f FQ(\014le.)771
+3052 y(If)22 b(the)g(p)s(dfT)1186 3072 y(E)1234 3052
+y(X)g(driv)m(er)f(is)h(used,)h(the)f(follo)m(wing)i(graphic)e(rules)
+2914 3019 y FP(16)3010 3052 y FQ(\(de\014ned)f(in)g FM(pdftex.def)p
+FQ(\))630 3144 y(are)31 b(used)e(b)m(y)i(default)p Black
+Black 787 3277 a FE(\\DeclareGraphicsRule{.png}{pn)q(g}{.p)q(ng}{)q(})
+787 3368 y(\\DeclareGraphicsRule{.pdf}{pd)q(f}{.p)q(df}{)q(})787
+3459 y(\\DeclareGraphicsRule{.jpg}{jp)q(g}{.j)q(pg}{)q(})787
+3550 y(\\DeclareGraphicsRule{.mps}{mp)q(s}{.m)q(ps}{)q(})630
+3705 y FQ(whic)m(h)f(sp)s(ecify)g(the)h(b)s(eha)m(vior)f(for)g(p)s(dfT)
+2042 3724 y(E)2091 3705 y(X's)g(supp)s(orted)f(graphic)h(formats.)p
+Black 630 5101 1332 4 v 703 5191 a FF(15)768 5222 y FG(The)24
+b(co)r(de)g(in)f FE(dvips.def)j FG(actually)e(do)r(es)g(not)g(use)f
+FE(\\DeclareGraphicsRule)28 b FG(but)23 b(the)g(e\013ect)h(is)g(the)f
+(same.)703 5318 y FF(16)768 5349 y FG(The)32 b FE(pdftex.def)h
+FG(\014le)e(actually)h(c)n(hec)n(ks)e(the)h(p)r(dfT)2315
+5365 y(E)2358 5349 y(X)g(v)n(ersion)g(and)g(includes)g(logic)i(to)e
+(de\014ne)f(only)h(the)630 5441 y(graphics)c(rules)f(whic)n(h)f(that)h
+(v)n(ersion)g(can)f(handle)p Black Black 2250 5640 a
+FQ(31)p Black eop end
+%%Page: 32 32
+TeXDict begin 32 31 bop Black 0 TeXcolorgray Black Black
+630 -149 a FD(P)l(art)46 b(I)t(I)t(I)630 59 y FA(Using)64
+b(Graphics-Inclusion)f(Commands)630 326 y FD(10)135 b(Horizon)l(tal)47
+b(Spacing)d(and)h(Cen)l(tering)630 532 y FB(10.1)112
+b(Horizon)m(tal)37 b(Cen)m(tering)630 690 y FQ(The)23
+b(placemen)m(t)i(of)f(the)g(graphic)g(is)g(con)m(trolled)h(b)m(y)f(the)
+g(curren)m(t)g(text)g(justi\014cation.)40 b(T)-8 b(o)24
+b(cen)m(ter)630 790 y(the)31 b(graphic,)f(put)g(it)h(inside)f(a)h(cen)m
+(ter)g(en)m(vironmen)m(t)p Black Black 848 929 a FN(\\begin{center})979
+1028 y(\\includegraphic)o(s[w)o(id)o(th=)o(2i)o(n]{)o(gr)o(ap)o(hic)o
+(})848 1128 y(\\end{center})630 1267 y FQ(If)i(the)g
+FM(\\includegraphics)c FQ(command)k(is)g(inside)g(an)g(en)m(vironmen)m
+(t)g(\(suc)m(h)h(as)f FM(minipage)e FQ(or)630 1366 y
+FM(figure)p FQ(\),)k(the)h FM(\\centering)c FQ(declaration)37
+b(cen)m(ters)f(the)g(remaining)f(output)g(of)g(the)h(en)m(viron-)630
+1466 y(men)m(t.)41 b(F)-8 b(or)31 b(example)p Black Black
+848 1605 a FN(\\begin{figure})979 1704 y(\\centering)979
+1804 y(\\includegraphic)o(s[w)o(id)o(th=)o(2i)o(n]{)o(gr)o(ap)o(hic)o
+(})848 1904 y(\\end{figure})630 2042 y FQ(is)f(similar)h(to)p
+Black Black 848 2181 a FN(\\begin{figure})848 2281 y(\\begin{center})
+979 2380 y(\\includegraphic)o(s[w)o(id)o(th=)o(2i)o(n]{)o(gr)o(ap)o
+(hic)o(})848 2480 y(\\end{center})848 2580 y(\\end{figure})630
+2732 y FQ(The)i FM(\\centering)f FQ(syn)m(tax)i(is)g(preferred)f(b)s
+(ecause)h(the)g FM(\\begin{center})c FQ(syn)m(tax)k(pro)s(duces)630
+2845 y(double)45 b(v)m(ertical)i(space)f(ab)s(o)m(v)m(e)h(and)d(b)s
+(elo)m(w)i(the)g(\014gure)e(due)h(to)h(the)f(space)h(pro)s(duced)e(b)m
+(y)630 2958 y(the)34 b FM(figure)e FQ(en)m(vironmen)m(t)i(and)f(b)m(y)h
+(the)f FM(center)f FQ(en)m(vironmen)m(t.)51 b(If)34 b(extra)g(v)m
+(ertical)i(space)e(is)630 3070 y(desired,)c(the)h(commands)f(in)g
+(Section)p 0.05 1.00 1.00 0.40 TeXcolorcmyk 31 w(19.1)p
+Black 32 w(on)g(page)p 0.05 1.00 1.00 0.40 TeXcolorcmyk
+31 w(64)p Black 31 w(should)g(b)s(e)g(used.)771 3183
+y(Bugs)21 b(in)f(the)g FM(\\psfig)f FQ(and)g FM(\\epsfbox)f
+FQ(commands)i(made)g(it)h(di\016cult)f(to)h(pro)s(duce)f(horizon)m
+(tally-)p Black Black -3973 w FL(Obsolete)225 3296 y(Syn)m(tax)90
+b FQ(cen)m(tered)37 b(graphics.)58 b(The)36 b(T)1653
+3316 y(E)1703 3296 y(X)g(commands)g FM(\\centerline)d
+FQ(and)i FM(\\leavevmode)e FQ(w)m(ere)k(used)630 3409
+y(as)31 b(w)m(ork-arounds)e(for)h(bugs)g(in)g FM(\\psfig)f
+FQ(and)h FM(\\epsfbox)p FQ(.)771 3522 y(Since)43 b(the)g
+FM(\\includegraphics)38 b FQ(command)k(is)h(written)f(correctly)-8
+b(,)48 b(the)43 b FM(\\centerline)630 3635 y FQ(and)29
+b FM(\\leavevmode)d FQ(commands)j(are)g(no)g(longer)h(needed,)f(allo)m
+(wing)i(graphics)e(to)h(b)s(e)f(cen)m(tered)630 3748
+y(with)h(the)h FM(\\centering)c FQ(command)j(or)h(the)f
+FM(center)f FQ(en)m(vironmen)m(t.)630 3991 y FB(10.2)112
+b(Horizon)m(tal)37 b(Spacing)630 4149 y FQ(It)26 b(is)f(imp)s(ortan)m
+(t)h(to)h(realize)g(that)f(L)1836 4132 y FP(A)1875 4149
+y FQ(T)1926 4169 y(E)1977 4149 y(X)f(arranges)h(graphics)g(the)g(same)g
+(w)m(a)m(y)h(it)f(formats)g(other)630 4249 y(ob)5 b(jects)25
+b(suc)m(h)g(as)f(letters.)40 b(F)-8 b(or)26 b(example,)g(an)f(in)m
+(terw)m(ord)g(space)g(is)f(in)m(tro)s(duced)g(b)s(et)m(w)m(een)i(L)3752
+4232 y FP(A)3791 4249 y FQ(T)3842 4268 y(E)3892 4249
+y(X)630 4348 y(input)j(lines)i(unless)f(the)g(line)h(ends)f(with)g(a)g
+FM(\045)p FQ(.)41 b(F)-8 b(or)31 b(example,)g(just)f(as)p
+Black Black 804 4487 a FN(Hello)804 4587 y(World)630
+4726 y FQ(put)g(an)g(in)m(terw)m(ord)h(space)f(b)s(et)m(w)m(een)h
+(\\Hello")i(and)d(\\W)-8 b(orld")p Black Black 804 4864
+a FN(\\includegraphics{)o(fi)o(le})804 4964 y(\\includegraphics{)o(fi)o
+(le})630 5103 y FQ(puts)27 b(an)h(in)m(terw)m(ord)h(space)f(b)s(et)m(w)
+m(een)h(the)f(graphics.)40 b(Ending)27 b(the)i(\014rst)e(line)i(with)e
+(a)i(commen)m(t)630 5202 y(c)m(haracter)p Black Black
+804 5341 a FN(\\includegraphics{)o(fi)o(le})o(\045)804
+5441 y(\\includegraphics{)o(fi)o(le})p Black 2250 5640
+a FQ(32)p Black eop end
+%%Page: 33 33
+TeXDict begin 33 32 bop Black 0 TeXcolorgray Black Black
+630 -149 a FQ(puts)39 b(no)g(space)h(b)s(et)m(w)m(een)g(the)g
+(graphics.)68 b(When)40 b(horizon)m(tal)h(spacing)f(is)f(desired)g(b)s
+(et)m(w)m(een)630 -49 y(graphics,)e(the)e FM(\\hspace)e
+FQ(command)i(inserts)g(a)g(sp)s(eci\014c)g(amoun)m(t)h(of)f(space)3321
+-82 y FP(17)3432 -49 y FQ(while)g FM(\\hfill)630 51 y
+FQ(inserts)28 b(a)h(rubb)s(er)d(length)j(whic)m(h)f(pro)m(vides)h(whic)
+m(h)f(expands)f(to)j(\014ll)e(the)h(a)m(v)-5 b(ailable)31
+b(space.)40 b(F)-8 b(or)630 150 y(example,)p Black Black
+761 291 a FN(\\includegraphics)o({f)o(il)o(e}\\)o(hf)o(ill)o(\\i)o(ncl)
+o(ud)o(eg)o(rap)o(hi)o(cs{)o(fi)o(le)o(})630 432 y FQ(pushes)29
+b(the)i(graphics)f(to)h(the)g(left)g(and)e(righ)m(t)i(margins,)g(while)
+p Black Black 761 574 a FN(\\hfill\\includegr)o(ap)o(hi)o(cs{)o(fi)o
+(le})o(\045)761 673 y(\\hfill\\includegr)o(ap)o(hi)o(cs{)o(fi)o(le})o
+(\\h)o(spa)o(ce)o(*{)o(\\fi)o(ll)o(})630 828 y FQ(puts)c(equal)h
+(spacing)g(b)s(efore,)g(b)s(et)m(w)m(een,)h(and)e(after)h(the)g
+(graphics.)40 b(Since)27 b FM(\\hfill)f FQ(commands)630
+941 y(whic)m(h)41 b(o)s(ccur)g(b)s(efore)g(a)h(linebreak)f(are)h
+(ignored,)i(the)e FM(\\hspace*{\\fill})37 b FQ(w)m(as)k(needed)g(to)630
+1053 y(supply)29 b(the)h(trailing)i(space.)771 1166 y(In)f(addition)h
+(to)h(the)f FM(\\hspace)e FQ(and)h FM(\\hfill)g FQ(commands,)h(the)g
+FM(\\quad)e FQ(command)i(inserts)p Black Black -3688
+w FL(Other)187 1279 y(Spacing)30 1392 y(Commands)630
+1279 y FQ(horizon)m(tal)i(space)f(equal)g(to)g(the)f(curren)m(t)g(fon)m
+(t)h(size)g(\(for)f(example,)i(when)d(using)h(10)h(pt)f(fon)m(t,)630
+1392 y FM(\\quad)23 b FQ(inserts)h(10)h(pt)f(of)h(horizon)m(tal)h
+(space\).)39 b(The)24 b(command)g FM(\\qquad)f FQ(inserts)h(t)m(wice)h
+(as)g(m)m(uc)m(h)630 1505 y(horizon)m(tal)32 b(space)f(as)g
+FM(\\quad)p FQ(.)630 1792 y FD(11)135 b(Rotation,)47
+b(Scaling,)f(and)e(Alignmen)l(t)630 1998 y FB(11.1)112
+b(Di\013erence)38 b(Bet)m(w)m(een)f(Heigh)m(t)g(and)i(T)-9
+b(otalheigh)m(t)630 2256 y FQ(Care)32 b(m)m(ust)g(b)s(e)f(tak)m(en)i
+(with)f(the)g FM(height)f FQ(option,)i(as)f(users)f(often)i(mean)f(the)
+g(o)m(v)m(erall)i(heigh)m(t)630 2355 y(whic)m(h)28 b(is)h(set)g(b)m(y)f
+(the)h FM(totalheight)d FQ(option)j(\(see)g(Figure)p
+0.05 1.00 1.00 0.40 TeXcolorcmyk 29 w(1)p Black 29
+w(on)f(page)p 0.05 1.00 1.00 0.40 TeXcolorcmyk 30
+w(11)p Black(\).)41 b(When)28 b(the)h(ob)5 b(ject)630
+2455 y(has)33 b(zero)g(depth,)g(the)h FM(totalheight)29
+b FQ(is)k(the)g(same)h(as)f(the)g FM(height)e FQ(and)i(sp)s(ecifying)h
+FM(height)630 2555 y FQ(w)m(orks)41 b(\014ne.)72 b(When)41
+b(the)g(ob)5 b(ject)42 b(has)e(a)i(non-zero)f(depth,)i(sp)s(ecifying)f
+FM(height)e FQ(instead)h(of)630 2654 y FM(totalheight)g
+FQ(causes)j(either)g(an)f(incorrectly-sized)j(graphic)e(or)f(a)h
+(divide-b)m(y-zero)h(error.)630 2754 y(F)-8 b(or)36 b(imp)s(orting)h
+FJ(eps)d FQ(\014les,)j(the)f(distinction)g(b)s(et)m(w)m(een)h
+FM(height)c FQ(and)i FM(totalheight)e FQ(is)j(most)630
+2854 y(imp)s(ortan)m(t)31 b(when)e(rotating)j(and)d(then)h(scaling)i(a)
+f(graphic.)41 b(F)-8 b(or)31 b(example,)p Black Black
+804 2995 a FN(\\includegraphics[)o(an)o(gle)o(=-)o(45,)o(to)o(tal)o(he)
+o(ig)o(ht=)o(1i)o(n]{)o(fi)o(le)o(})804 3094 y(\\includegraphics[)o(an)
+o(gle)o(=-)o(45,)o(he)o(igh)o(t=)o(1i)o(n]{)o(fi)o(le})630
+3249 y FQ(The)38 b(\014rst)f(command)i(scales)g(the)g(rotated)g
+(graphic)f(suc)m(h)g(that)h(its)g(total)h(heigh)m(t)g(is)e(1)h(inc)m
+(h.)630 3362 y(The)g(second)h(command)g(scales)h(the)f(rotated)h
+(graphics)f(suc)m(h)f(that)i(the)f(p)s(ortion)f(ab)s(o)m(v)m(e)j(its)
+630 3475 y(reference)31 b(p)s(oin)m(t)f(is)h(1)f(inc)m(h)h(tall.)630
+3718 y FB(11.2)112 b(Scaling)39 b(of)e(Rotated)h(Graphics)630
+3876 y FQ(When)26 b(the)g(heigh)m(t)h(or)f(width)f(of)i(a)f(graphic)g
+(is)g(sp)s(eci\014ed,)h(the)f(sp)s(eci\014ed)f(size)i(is)f(not)h(the)f
+(size)h(of)630 3976 y(the)32 b(graphic)g(but)f(rather)h(of)g(its)g
+(BoundingBo)m(x.)46 b(This)31 b(distinction)h(is)g(esp)s(ecially)h(imp)
+s(ortan)m(t)630 4076 y(in)d(the)h(scaling)g(of)g(rotated)g(graphics.)41
+b(F)-8 b(or)31 b(example)p Black Black 848 4217 a FN(\\begin{center})
+935 4316 y(\\includegraphics)o([to)o(ta)o(lhe)o(ig)o(ht=)o(1i)o(n])o
+({ro)o(se)o(tte)o(})935 4416 y(\\includegraphics)o([an)o(gl)o(e=4)o(5,)
+o(tot)o(al)o(he)o(igh)o(t=)o(1in)o(]{)o(ro)o(set)o(te)o(})935
+4516 y(\\includegraphics)o([an)o(gl)o(e=9)o(0,)o(tot)o(al)o(he)o(igh)o
+(t=)o(1in)o(]{)o(ro)o(set)o(te)o(})848 4615 y(\\end{center})630
+4770 y FQ(pro)s(duces)p Black 630 4865 1332 4 v 703 4955
+a FF(17)768 4987 y FG(Instead)19 b(of)g(making)g(the)g
+FE(\\hspace)h FG(amoun)n(t)f(a)g(\014xed)f(length)g(suc)n(h)h(as)g(1)g
+(inc)n(h,)h(making)f(the)g FE(\\hspace)h FG(amoun)n(t)630
+5078 y(a)26 b(function)g(of)32 b FE(\\linewidth)c FG(or)e
+FE(\\em)g FG(increases)h(a)f(do)r(cumen)n(t's)g(p)r(ortabilit)n(y)-6
+b(.)p Black Black 2250 5640 a FQ(33)p Black eop end
+%%Page: 34 34
+TeXDict begin 34 33 bop Black 0 TeXcolorgray Black Black
+Black Black 1365 360 a @beginspecial 124.379997 @llx
+124.379997 @lly 487.609985 @urx 487.609985 @ury 720 @rhi
+@setspecial
+%%BeginDocument: rosette.eps
+%!
+%%BoundingBox: 124.38 124.38 487.61 487.61
+
+/inch {72 mul} def
+
+/wedge
+ { newpath
+ 0 0 moveto
+ 1 0 translate
+ 15 rotate
+ 0 15 sin translate
+ 0 0 15 sin -90 90 arc
+ closepath
+ } def
+
+gsave
+ 4.25 inch 4.25 inch translate
+ 1.75 inch 1.75 inch scale
+ 0.02 setlinewidth
+ 2 1 13
+ {
+ 13 div setgray
+ gsave
+ wedge
+ gsave
+ fill
+ grestore
+ 0 setgray stroke
+ grestore
+ 30 rotate
+ } for
+
+grestore
+showpage
+
+
+%%EndDocument
+ @endspecial 1995 360 a
+ currentpoint currentpoint translate 0.14017 0.14017 scale neg exch
+neg exch translate
+ 1995 360 a 4135 360 a
+ gsave currentpoint currentpoint translate 45 neg rotate neg exch neg
+exch translate
+ 4135 360
+a @beginspecial 124.379997 @llx 124.379997 @lly 487.609985
+@urx 487.609985 @ury 3632 @rwi @setspecial
+%%BeginDocument: rosette.eps
+%!
+%%BoundingBox: 124.38 124.38 487.61 487.61
+
+/inch {72 mul} def
+
+/wedge
+ { newpath
+ 0 0 moveto
+ 1 0 translate
+ 15 rotate
+ 0 15 sin translate
+ 0 0 15 sin -90 90 arc
+ closepath
+ } def
+
+gsave
+ 4.25 inch 4.25 inch translate
+ 1.75 inch 1.75 inch scale
+ 0.02 setlinewidth
+ 2 1 13
+ {
+ 13 div setgray
+ gsave
+ wedge
+ gsave
+ fill
+ grestore
+ 0 setgray stroke
+ grestore
+ 30 rotate
+ } for
+
+grestore
+showpage
+
+
+%%EndDocument
+ @endspecial 7162 360 a
+ currentpoint grestore moveto
+ 7162 360 a 1995 360 a
+ currentpoint currentpoint translate 1 0.14017 div 1 0.14017 div scale
+neg exch neg exch translate
+ 1995 360
+a 2625 360 a
+ currentpoint currentpoint translate 0.19821 0.19821 scale neg exch
+neg exch translate
+ 2625 360 a 5652 360 a
+ gsave currentpoint currentpoint translate 90 neg rotate neg exch neg
+exch translate
+ 5652 360 a @beginspecial
+124.379997 @llx 124.379997 @lly 487.609985 @urx 487.609985
+@ury 3632 @rwi @setspecial
+%%BeginDocument: rosette.eps
+%!
+%%BoundingBox: 124.38 124.38 487.61 487.61
+
+/inch {72 mul} def
+
+/wedge
+ { newpath
+ 0 0 moveto
+ 1 0 translate
+ 15 rotate
+ 0 15 sin translate
+ 0 0 15 sin -90 90 arc
+ closepath
+ } def
+
+gsave
+ 4.25 inch 4.25 inch translate
+ 1.75 inch 1.75 inch scale
+ 0.02 setlinewidth
+ 2 1 13
+ {
+ 13 div setgray
+ gsave
+ wedge
+ gsave
+ fill
+ grestore
+ 0 setgray stroke
+ grestore
+ 30 rotate
+ } for
+
+grestore
+showpage
+
+
+%%EndDocument
+ @endspecial 8679 360 a
+ currentpoint grestore moveto
+ 8679 360 a 2625 360 a
+ currentpoint currentpoint translate 1 0.19821 div 1 0.19821 div scale
+neg exch neg exch translate
+ 2625 360
+a 630 524 a FQ(Although)30 b(it)h(ma)m(y)g(seem)f(strange)h(that)g(the)
+f(graphics)h(ha)m(v)m(e)g(di\013eren)m(t)g(sizes,)g(it)g(should)e(mak)m
+(e)630 637 y(sense)h(after)h(viewing)g(the)g(BoundingBo)m(xes)p
+Black Black 1365 1315 a @beginspecial 0 @llx 0 @lly 74
+@urx 74 @ury 720 @rhi @setspecial
+%%BeginDocument: square.eps
+%!PS-Adobe-2.0 EPSF-2.0
+%%Title: square.fig
+%%Creator: fig2dev Version 3.2 Patchlevel 4
+%%CreationDate: Sun May 22 21:45:21 2005
+%%For: epstein@linux (Becky Epstein)
+%%BoundingBox: 0 0 74 74
+%%Magnification: 1.0000
+%%EndComments
+/$F2psDict 200 dict def
+$F2psDict begin
+$F2psDict /mtrx matrix put
+/col-1 {0 setgray} bind def
+/col0 {0.000 0.000 0.000 srgb} bind def
+/col1 {0.000 0.000 1.000 srgb} bind def
+/col2 {0.000 1.000 0.000 srgb} bind def
+/col3 {0.000 1.000 1.000 srgb} bind def
+/col4 {1.000 0.000 0.000 srgb} bind def
+/col5 {1.000 0.000 1.000 srgb} bind def
+/col6 {1.000 1.000 0.000 srgb} bind def
+/col7 {1.000 1.000 1.000 srgb} bind def
+/col8 {0.000 0.000 0.560 srgb} bind def
+/col9 {0.000 0.000 0.690 srgb} bind def
+/col10 {0.000 0.000 0.820 srgb} bind def
+/col11 {0.530 0.810 1.000 srgb} bind def
+/col12 {0.000 0.560 0.000 srgb} bind def
+/col13 {0.000 0.690 0.000 srgb} bind def
+/col14 {0.000 0.820 0.000 srgb} bind def
+/col15 {0.000 0.560 0.560 srgb} bind def
+/col16 {0.000 0.690 0.690 srgb} bind def
+/col17 {0.000 0.820 0.820 srgb} bind def
+/col18 {0.560 0.000 0.000 srgb} bind def
+/col19 {0.690 0.000 0.000 srgb} bind def
+/col20 {0.820 0.000 0.000 srgb} bind def
+/col21 {0.560 0.000 0.560 srgb} bind def
+/col22 {0.690 0.000 0.690 srgb} bind def
+/col23 {0.820 0.000 0.820 srgb} bind def
+/col24 {0.500 0.190 0.000 srgb} bind def
+/col25 {0.630 0.250 0.000 srgb} bind def
+/col26 {0.750 0.380 0.000 srgb} bind def
+/col27 {1.000 0.500 0.500 srgb} bind def
+/col28 {1.000 0.630 0.630 srgb} bind def
+/col29 {1.000 0.750 0.750 srgb} bind def
+/col30 {1.000 0.880 0.880 srgb} bind def
+/col31 {1.000 0.840 0.000 srgb} bind def
+
+end
+save
+newpath 0 74 moveto 0 0 lineto 74 0 lineto 74 74 lineto closepath clip newpath
+-3.8 77.2 translate
+1 -1 scale
+
+/cp {closepath} bind def
+/ef {eofill} bind def
+/gr {grestore} bind def
+/gs {gsave} bind def
+/sa {save} bind def
+/rs {restore} bind def
+/l {lineto} bind def
+/m {moveto} bind def
+/rm {rmoveto} bind def
+/n {newpath} bind def
+/s {stroke} bind def
+/sh {show} bind def
+/slc {setlinecap} bind def
+/slj {setlinejoin} bind def
+/slw {setlinewidth} bind def
+/srgb {setrgbcolor} bind def
+/rot {rotate} bind def
+/sc {scale} bind def
+/sd {setdash} bind def
+/ff {findfont} bind def
+/sf {setfont} bind def
+/scf {scalefont} bind def
+/sw {stringwidth} bind def
+/tr {translate} bind def
+/tnt {dup dup currentrgbcolor
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb}
+ bind def
+/shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul
+ 4 -2 roll mul srgb} bind def
+/$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def
+/$F2psEnd {$F2psEnteredState restore end} def
+
+$F2psBegin
+10 setmiterlimit
+0 slj 0 slc
+ 0.06000 0.06000 sc
+%
+% Fig objects follow
+%
+%
+% here starts figure with depth 0
+% Polyline
+7.500 slw
+n 1275 1275 m 1275 75 l 75 75 l 75 1275 l
+ cp gs col-1 s gr
+% here ends figure;
+$F2psEnd
+rs
+showpage
+
+%%EndDocument
+ @endspecial 1995 1315 a
+ currentpoint currentpoint translate 0.68802 0.68802 scale neg exch
+neg exch translate
+ 1995 1315 a 2431 1315 a
+ gsave currentpoint currentpoint translate 45 neg rotate neg exch neg
+exch translate
+ 2431
+1315 a @beginspecial 0 @llx 0 @lly 74 @urx 74 @ury 740
+@rwi @setspecial
+%%BeginDocument: square.eps
+%!PS-Adobe-2.0 EPSF-2.0
+%%Title: square.fig
+%%Creator: fig2dev Version 3.2 Patchlevel 4
+%%CreationDate: Sun May 22 21:45:21 2005
+%%For: epstein@linux (Becky Epstein)
+%%BoundingBox: 0 0 74 74
+%%Magnification: 1.0000
+%%EndComments
+/$F2psDict 200 dict def
+$F2psDict begin
+$F2psDict /mtrx matrix put
+/col-1 {0 setgray} bind def
+/col0 {0.000 0.000 0.000 srgb} bind def
+/col1 {0.000 0.000 1.000 srgb} bind def
+/col2 {0.000 1.000 0.000 srgb} bind def
+/col3 {0.000 1.000 1.000 srgb} bind def
+/col4 {1.000 0.000 0.000 srgb} bind def
+/col5 {1.000 0.000 1.000 srgb} bind def
+/col6 {1.000 1.000 0.000 srgb} bind def
+/col7 {1.000 1.000 1.000 srgb} bind def
+/col8 {0.000 0.000 0.560 srgb} bind def
+/col9 {0.000 0.000 0.690 srgb} bind def
+/col10 {0.000 0.000 0.820 srgb} bind def
+/col11 {0.530 0.810 1.000 srgb} bind def
+/col12 {0.000 0.560 0.000 srgb} bind def
+/col13 {0.000 0.690 0.000 srgb} bind def
+/col14 {0.000 0.820 0.000 srgb} bind def
+/col15 {0.000 0.560 0.560 srgb} bind def
+/col16 {0.000 0.690 0.690 srgb} bind def
+/col17 {0.000 0.820 0.820 srgb} bind def
+/col18 {0.560 0.000 0.000 srgb} bind def
+/col19 {0.690 0.000 0.000 srgb} bind def
+/col20 {0.820 0.000 0.000 srgb} bind def
+/col21 {0.560 0.000 0.560 srgb} bind def
+/col22 {0.690 0.000 0.690 srgb} bind def
+/col23 {0.820 0.000 0.820 srgb} bind def
+/col24 {0.500 0.190 0.000 srgb} bind def
+/col25 {0.630 0.250 0.000 srgb} bind def
+/col26 {0.750 0.380 0.000 srgb} bind def
+/col27 {1.000 0.500 0.500 srgb} bind def
+/col28 {1.000 0.630 0.630 srgb} bind def
+/col29 {1.000 0.750 0.750 srgb} bind def
+/col30 {1.000 0.880 0.880 srgb} bind def
+/col31 {1.000 0.840 0.000 srgb} bind def
+
+end
+save
+newpath 0 74 moveto 0 0 lineto 74 0 lineto 74 74 lineto closepath clip newpath
+-3.8 77.2 translate
+1 -1 scale
+
+/cp {closepath} bind def
+/ef {eofill} bind def
+/gr {grestore} bind def
+/gs {gsave} bind def
+/sa {save} bind def
+/rs {restore} bind def
+/l {lineto} bind def
+/m {moveto} bind def
+/rm {rmoveto} bind def
+/n {newpath} bind def
+/s {stroke} bind def
+/sh {show} bind def
+/slc {setlinecap} bind def
+/slj {setlinejoin} bind def
+/slw {setlinewidth} bind def
+/srgb {setrgbcolor} bind def
+/rot {rotate} bind def
+/sc {scale} bind def
+/sd {setdash} bind def
+/ff {findfont} bind def
+/sf {setfont} bind def
+/scf {scalefont} bind def
+/sw {stringwidth} bind def
+/tr {translate} bind def
+/tnt {dup dup currentrgbcolor
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb}
+ bind def
+/shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul
+ 4 -2 roll mul srgb} bind def
+/$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def
+/$F2psEnd {$F2psEnteredState restore end} def
+
+$F2psBegin
+10 setmiterlimit
+0 slj 0 slc
+ 0.06000 0.06000 sc
+%
+% Fig objects follow
+%
+%
+% here starts figure with depth 0
+% Polyline
+7.500 slw
+n 1275 1275 m 1275 75 l 75 75 l 75 1275 l
+ cp gs col-1 s gr
+% here ends figure;
+$F2psEnd
+rs
+showpage
+
+%%EndDocument
+ @endspecial 3048 1315 a
+ currentpoint grestore moveto
+ 3048 1315 a 1995 1315 a
+ currentpoint currentpoint translate 1 0.68802 div 1 0.68802 div scale
+neg exch neg exch translate
+ 1995
+1315 a 2625 1315 a
+ currentpoint currentpoint translate 0.97302 0.97302 scale neg exch
+neg exch translate
+ 2625 1315 a 3242 1315 a
+ gsave currentpoint currentpoint translate 90 neg rotate neg exch neg
+exch translate
+ 3242 1315
+a @beginspecial 0 @llx 0 @lly 74 @urx 74 @ury 740 @rwi
+@setspecial
+%%BeginDocument: square.eps
+%!PS-Adobe-2.0 EPSF-2.0
+%%Title: square.fig
+%%Creator: fig2dev Version 3.2 Patchlevel 4
+%%CreationDate: Sun May 22 21:45:21 2005
+%%For: epstein@linux (Becky Epstein)
+%%BoundingBox: 0 0 74 74
+%%Magnification: 1.0000
+%%EndComments
+/$F2psDict 200 dict def
+$F2psDict begin
+$F2psDict /mtrx matrix put
+/col-1 {0 setgray} bind def
+/col0 {0.000 0.000 0.000 srgb} bind def
+/col1 {0.000 0.000 1.000 srgb} bind def
+/col2 {0.000 1.000 0.000 srgb} bind def
+/col3 {0.000 1.000 1.000 srgb} bind def
+/col4 {1.000 0.000 0.000 srgb} bind def
+/col5 {1.000 0.000 1.000 srgb} bind def
+/col6 {1.000 1.000 0.000 srgb} bind def
+/col7 {1.000 1.000 1.000 srgb} bind def
+/col8 {0.000 0.000 0.560 srgb} bind def
+/col9 {0.000 0.000 0.690 srgb} bind def
+/col10 {0.000 0.000 0.820 srgb} bind def
+/col11 {0.530 0.810 1.000 srgb} bind def
+/col12 {0.000 0.560 0.000 srgb} bind def
+/col13 {0.000 0.690 0.000 srgb} bind def
+/col14 {0.000 0.820 0.000 srgb} bind def
+/col15 {0.000 0.560 0.560 srgb} bind def
+/col16 {0.000 0.690 0.690 srgb} bind def
+/col17 {0.000 0.820 0.820 srgb} bind def
+/col18 {0.560 0.000 0.000 srgb} bind def
+/col19 {0.690 0.000 0.000 srgb} bind def
+/col20 {0.820 0.000 0.000 srgb} bind def
+/col21 {0.560 0.000 0.560 srgb} bind def
+/col22 {0.690 0.000 0.690 srgb} bind def
+/col23 {0.820 0.000 0.820 srgb} bind def
+/col24 {0.500 0.190 0.000 srgb} bind def
+/col25 {0.630 0.250 0.000 srgb} bind def
+/col26 {0.750 0.380 0.000 srgb} bind def
+/col27 {1.000 0.500 0.500 srgb} bind def
+/col28 {1.000 0.630 0.630 srgb} bind def
+/col29 {1.000 0.750 0.750 srgb} bind def
+/col30 {1.000 0.880 0.880 srgb} bind def
+/col31 {1.000 0.840 0.000 srgb} bind def
+
+end
+save
+newpath 0 74 moveto 0 0 lineto 74 0 lineto 74 74 lineto closepath clip newpath
+-3.8 77.2 translate
+1 -1 scale
+
+/cp {closepath} bind def
+/ef {eofill} bind def
+/gr {grestore} bind def
+/gs {gsave} bind def
+/sa {save} bind def
+/rs {restore} bind def
+/l {lineto} bind def
+/m {moveto} bind def
+/rm {rmoveto} bind def
+/n {newpath} bind def
+/s {stroke} bind def
+/sh {show} bind def
+/slc {setlinecap} bind def
+/slj {setlinejoin} bind def
+/slw {setlinewidth} bind def
+/srgb {setrgbcolor} bind def
+/rot {rotate} bind def
+/sc {scale} bind def
+/sd {setdash} bind def
+/ff {findfont} bind def
+/sf {setfont} bind def
+/scf {scalefont} bind def
+/sw {stringwidth} bind def
+/tr {translate} bind def
+/tnt {dup dup currentrgbcolor
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb}
+ bind def
+/shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul
+ 4 -2 roll mul srgb} bind def
+/$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def
+/$F2psEnd {$F2psEnteredState restore end} def
+
+$F2psBegin
+10 setmiterlimit
+0 slj 0 slc
+ 0.06000 0.06000 sc
+%
+% Fig objects follow
+%
+%
+% here starts figure with depth 0
+% Polyline
+7.500 slw
+n 1275 1275 m 1275 75 l 75 75 l 75 1275 l
+ cp gs col-1 s gr
+% here ends figure;
+$F2psEnd
+rs
+showpage
+
+%%EndDocument
+ @endspecial 3859 1315 a
+ currentpoint grestore moveto
+ 3859 1315 a 2625 1315 a
+ currentpoint currentpoint translate 1 0.97302 div 1 0.97302 div scale
+neg exch neg exch translate
+ 2625
+1315 a 630 1479 a FQ(Eac)m(h)f(graphic)g(is)g(scaled)h(suc)m(h)e(that)h
+(its)h(rotated)f(BoundingBo)m(x)h(is)f(1)g(inc)m(h)g(tall.)42
+b(The)29 b(scaling)630 1592 y(scales)j(the)e(size)h(of)g(the)f
+(BoundingBo)m(x)i Fy(not)39 b FQ(the)31 b(size)g(of)g(visible)f
+(graphics.)630 1831 y FB(11.3)112 b(Alignmen)m(t)38 b(of)g(Rotated)f
+(Graphics)630 2003 y FL(11.3.1)106 b(Example)34 b(#1)630
+2161 y FQ(When)c(graphics)g(are)h(rotated,)h(the)f(ob)5
+b(jects)31 b(ma)m(y)g(not)f(align)h(prop)s(erly)-8 b(.)40
+b(F)-8 b(or)31 b(example)p Black Black 848 2279 a FN(\\begin{center})
+935 2379 y(\\includegraphics)o([to)o(ta)o(lhe)o(ig)o(ht=)o(1i)o(n])o
+({ro)o(se)o(tte)o(})935 2478 y(\\includegraphics)o([to)o(ta)o(lhe)o(ig)
+o(ht=)o(1i)o(n,)o(ang)o(le)o(=-4)o(5])o({r)o(ose)o(tt)o(e})935
+2578 y(\\includegraphics)o([to)o(ta)o(lhe)o(ig)o(ht=)o(1i)o(n,)o(ang)o
+(le)o(=-9)o(0])o({r)o(ose)o(tt)o(e})848 2677 y(\\end{center})630
+2809 y FQ(pro)s(duces)p Black Black 1240 3486 a
+ gsave currentpoint currentpoint translate 0 neg rotate neg exch neg
+exch translate
+ 1240
+3486 a @beginspecial 124.379997 @llx 124.379997 @lly
+487.609985 @urx 487.609985 @ury 720 @rhi @setspecial
+%%BeginDocument: rosette.eps
+%!
+%%BoundingBox: 124.38 124.38 487.61 487.61
+
+/inch {72 mul} def
+
+/wedge
+ { newpath
+ 0 0 moveto
+ 1 0 translate
+ 15 rotate
+ 0 15 sin translate
+ 0 0 15 sin -90 90 arc
+ closepath
+ } def
+
+gsave
+ 4.25 inch 4.25 inch translate
+ 1.75 inch 1.75 inch scale
+ 0.02 setlinewidth
+ 2 1 13
+ {
+ 13 div setgray
+ gsave
+ wedge
+ gsave
+ fill
+ grestore
+ 0 setgray stroke
+ grestore
+ 30 rotate
+ } for
+
+grestore
+showpage
+
+
+%%EndDocument
+ @endspecial 1840 3486 a
+ currentpoint grestore moveto
+ 1840 3486 a 1871 3486 a
+ gsave currentpoint currentpoint translate -45 neg rotate neg exch
+neg exch translate
+ 1871
+3486 a @beginspecial 124.379997 @llx 124.379997 @lly
+487.609985 @urx 487.609985 @ury 720 @rhi @setspecial
+%%BeginDocument: rosette.eps
+%!
+%%BoundingBox: 124.38 124.38 487.61 487.61
+
+/inch {72 mul} def
+
+/wedge
+ { newpath
+ 0 0 moveto
+ 1 0 translate
+ 15 rotate
+ 0 15 sin translate
+ 0 0 15 sin -90 90 arc
+ closepath
+ } def
+
+gsave
+ 4.25 inch 4.25 inch translate
+ 1.75 inch 1.75 inch scale
+ 0.02 setlinewidth
+ 2 1 13
+ {
+ 13 div setgray
+ gsave
+ wedge
+ gsave
+ fill
+ grestore
+ 0 setgray stroke
+ grestore
+ 30 rotate
+ } for
+
+grestore
+showpage
+
+
+%%EndDocument
+ @endspecial 2471 3486 a
+ currentpoint grestore moveto
+ 2471 3486 a 2750 3486 a
+ gsave currentpoint currentpoint translate -90 neg rotate neg exch
+neg exch translate
+ 2750
+3486 a @beginspecial 124.379997 @llx 124.379997 @lly
+487.609985 @urx 487.609985 @ury 720 @rhi @setspecial
+%%BeginDocument: rosette.eps
+%!
+%%BoundingBox: 124.38 124.38 487.61 487.61
+
+/inch {72 mul} def
+
+/wedge
+ { newpath
+ 0 0 moveto
+ 1 0 translate
+ 15 rotate
+ 0 15 sin translate
+ 0 0 15 sin -90 90 arc
+ closepath
+ } def
+
+gsave
+ 4.25 inch 4.25 inch translate
+ 1.75 inch 1.75 inch scale
+ 0.02 setlinewidth
+ 2 1 13
+ {
+ 13 div setgray
+ gsave
+ wedge
+ gsave
+ fill
+ grestore
+ 0 setgray stroke
+ grestore
+ 30 rotate
+ } for
+
+grestore
+showpage
+
+
+%%EndDocument
+ @endspecial 3350 3486 a
+ currentpoint grestore moveto
+ 3350 3486 a 630 4209 a FQ(Again,)g(this)g(is)f
+(b)s(etter)h(illustrated)g(b)m(y)f(the)g(BoundingBo)m(xes)p
+Black Black 1240 4886 a
+ gsave currentpoint currentpoint translate 0 neg rotate neg exch neg
+exch translate
+ 1240 4886 a @beginspecial 0 @llx
+0 @lly 74 @urx 74 @ury 720 @rhi @setspecial
+%%BeginDocument: square.eps
+%!PS-Adobe-2.0 EPSF-2.0
+%%Title: square.fig
+%%Creator: fig2dev Version 3.2 Patchlevel 4
+%%CreationDate: Sun May 22 21:45:21 2005
+%%For: epstein@linux (Becky Epstein)
+%%BoundingBox: 0 0 74 74
+%%Magnification: 1.0000
+%%EndComments
+/$F2psDict 200 dict def
+$F2psDict begin
+$F2psDict /mtrx matrix put
+/col-1 {0 setgray} bind def
+/col0 {0.000 0.000 0.000 srgb} bind def
+/col1 {0.000 0.000 1.000 srgb} bind def
+/col2 {0.000 1.000 0.000 srgb} bind def
+/col3 {0.000 1.000 1.000 srgb} bind def
+/col4 {1.000 0.000 0.000 srgb} bind def
+/col5 {1.000 0.000 1.000 srgb} bind def
+/col6 {1.000 1.000 0.000 srgb} bind def
+/col7 {1.000 1.000 1.000 srgb} bind def
+/col8 {0.000 0.000 0.560 srgb} bind def
+/col9 {0.000 0.000 0.690 srgb} bind def
+/col10 {0.000 0.000 0.820 srgb} bind def
+/col11 {0.530 0.810 1.000 srgb} bind def
+/col12 {0.000 0.560 0.000 srgb} bind def
+/col13 {0.000 0.690 0.000 srgb} bind def
+/col14 {0.000 0.820 0.000 srgb} bind def
+/col15 {0.000 0.560 0.560 srgb} bind def
+/col16 {0.000 0.690 0.690 srgb} bind def
+/col17 {0.000 0.820 0.820 srgb} bind def
+/col18 {0.560 0.000 0.000 srgb} bind def
+/col19 {0.690 0.000 0.000 srgb} bind def
+/col20 {0.820 0.000 0.000 srgb} bind def
+/col21 {0.560 0.000 0.560 srgb} bind def
+/col22 {0.690 0.000 0.690 srgb} bind def
+/col23 {0.820 0.000 0.820 srgb} bind def
+/col24 {0.500 0.190 0.000 srgb} bind def
+/col25 {0.630 0.250 0.000 srgb} bind def
+/col26 {0.750 0.380 0.000 srgb} bind def
+/col27 {1.000 0.500 0.500 srgb} bind def
+/col28 {1.000 0.630 0.630 srgb} bind def
+/col29 {1.000 0.750 0.750 srgb} bind def
+/col30 {1.000 0.880 0.880 srgb} bind def
+/col31 {1.000 0.840 0.000 srgb} bind def
+
+end
+save
+newpath 0 74 moveto 0 0 lineto 74 0 lineto 74 74 lineto closepath clip newpath
+-3.8 77.2 translate
+1 -1 scale
+
+/cp {closepath} bind def
+/ef {eofill} bind def
+/gr {grestore} bind def
+/gs {gsave} bind def
+/sa {save} bind def
+/rs {restore} bind def
+/l {lineto} bind def
+/m {moveto} bind def
+/rm {rmoveto} bind def
+/n {newpath} bind def
+/s {stroke} bind def
+/sh {show} bind def
+/slc {setlinecap} bind def
+/slj {setlinejoin} bind def
+/slw {setlinewidth} bind def
+/srgb {setrgbcolor} bind def
+/rot {rotate} bind def
+/sc {scale} bind def
+/sd {setdash} bind def
+/ff {findfont} bind def
+/sf {setfont} bind def
+/scf {scalefont} bind def
+/sw {stringwidth} bind def
+/tr {translate} bind def
+/tnt {dup dup currentrgbcolor
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb}
+ bind def
+/shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul
+ 4 -2 roll mul srgb} bind def
+/$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def
+/$F2psEnd {$F2psEnteredState restore end} def
+
+$F2psBegin
+10 setmiterlimit
+0 slj 0 slc
+ 0.06000 0.06000 sc
+%
+% Fig objects follow
+%
+%
+% here starts figure with depth 0
+% Polyline
+7.500 slw
+n 1275 1275 m 1275 75 l 75 75 l 75 1275 l
+ cp gs col-1 s gr
+% here ends figure;
+$F2psEnd
+rs
+showpage
+
+%%EndDocument
+ @endspecial 1840 4886 a
+ currentpoint grestore moveto
+ 1840 4886 a 1871 4886 a
+ gsave currentpoint currentpoint translate -45 neg rotate neg exch
+neg exch translate
+ 1871
+4886 a @beginspecial 0 @llx 0 @lly 74 @urx 74 @ury 720
+@rhi @setspecial
+%%BeginDocument: square.eps
+%!PS-Adobe-2.0 EPSF-2.0
+%%Title: square.fig
+%%Creator: fig2dev Version 3.2 Patchlevel 4
+%%CreationDate: Sun May 22 21:45:21 2005
+%%For: epstein@linux (Becky Epstein)
+%%BoundingBox: 0 0 74 74
+%%Magnification: 1.0000
+%%EndComments
+/$F2psDict 200 dict def
+$F2psDict begin
+$F2psDict /mtrx matrix put
+/col-1 {0 setgray} bind def
+/col0 {0.000 0.000 0.000 srgb} bind def
+/col1 {0.000 0.000 1.000 srgb} bind def
+/col2 {0.000 1.000 0.000 srgb} bind def
+/col3 {0.000 1.000 1.000 srgb} bind def
+/col4 {1.000 0.000 0.000 srgb} bind def
+/col5 {1.000 0.000 1.000 srgb} bind def
+/col6 {1.000 1.000 0.000 srgb} bind def
+/col7 {1.000 1.000 1.000 srgb} bind def
+/col8 {0.000 0.000 0.560 srgb} bind def
+/col9 {0.000 0.000 0.690 srgb} bind def
+/col10 {0.000 0.000 0.820 srgb} bind def
+/col11 {0.530 0.810 1.000 srgb} bind def
+/col12 {0.000 0.560 0.000 srgb} bind def
+/col13 {0.000 0.690 0.000 srgb} bind def
+/col14 {0.000 0.820 0.000 srgb} bind def
+/col15 {0.000 0.560 0.560 srgb} bind def
+/col16 {0.000 0.690 0.690 srgb} bind def
+/col17 {0.000 0.820 0.820 srgb} bind def
+/col18 {0.560 0.000 0.000 srgb} bind def
+/col19 {0.690 0.000 0.000 srgb} bind def
+/col20 {0.820 0.000 0.000 srgb} bind def
+/col21 {0.560 0.000 0.560 srgb} bind def
+/col22 {0.690 0.000 0.690 srgb} bind def
+/col23 {0.820 0.000 0.820 srgb} bind def
+/col24 {0.500 0.190 0.000 srgb} bind def
+/col25 {0.630 0.250 0.000 srgb} bind def
+/col26 {0.750 0.380 0.000 srgb} bind def
+/col27 {1.000 0.500 0.500 srgb} bind def
+/col28 {1.000 0.630 0.630 srgb} bind def
+/col29 {1.000 0.750 0.750 srgb} bind def
+/col30 {1.000 0.880 0.880 srgb} bind def
+/col31 {1.000 0.840 0.000 srgb} bind def
+
+end
+save
+newpath 0 74 moveto 0 0 lineto 74 0 lineto 74 74 lineto closepath clip newpath
+-3.8 77.2 translate
+1 -1 scale
+
+/cp {closepath} bind def
+/ef {eofill} bind def
+/gr {grestore} bind def
+/gs {gsave} bind def
+/sa {save} bind def
+/rs {restore} bind def
+/l {lineto} bind def
+/m {moveto} bind def
+/rm {rmoveto} bind def
+/n {newpath} bind def
+/s {stroke} bind def
+/sh {show} bind def
+/slc {setlinecap} bind def
+/slj {setlinejoin} bind def
+/slw {setlinewidth} bind def
+/srgb {setrgbcolor} bind def
+/rot {rotate} bind def
+/sc {scale} bind def
+/sd {setdash} bind def
+/ff {findfont} bind def
+/sf {setfont} bind def
+/scf {scalefont} bind def
+/sw {stringwidth} bind def
+/tr {translate} bind def
+/tnt {dup dup currentrgbcolor
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb}
+ bind def
+/shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul
+ 4 -2 roll mul srgb} bind def
+/$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def
+/$F2psEnd {$F2psEnteredState restore end} def
+
+$F2psBegin
+10 setmiterlimit
+0 slj 0 slc
+ 0.06000 0.06000 sc
+%
+% Fig objects follow
+%
+%
+% here starts figure with depth 0
+% Polyline
+7.500 slw
+n 1275 1275 m 1275 75 l 75 75 l 75 1275 l
+ cp gs col-1 s gr
+% here ends figure;
+$F2psEnd
+rs
+showpage
+
+%%EndDocument
+ @endspecial 2471 4886 a
+ currentpoint grestore moveto
+ 2471 4886 a 2750 4886 a
+ gsave currentpoint currentpoint translate -90 neg rotate neg exch
+neg exch translate
+ 2750
+4886 a @beginspecial 0 @llx 0 @lly 74 @urx 74 @ury 720
+@rhi @setspecial
+%%BeginDocument: square.eps
+%!PS-Adobe-2.0 EPSF-2.0
+%%Title: square.fig
+%%Creator: fig2dev Version 3.2 Patchlevel 4
+%%CreationDate: Sun May 22 21:45:21 2005
+%%For: epstein@linux (Becky Epstein)
+%%BoundingBox: 0 0 74 74
+%%Magnification: 1.0000
+%%EndComments
+/$F2psDict 200 dict def
+$F2psDict begin
+$F2psDict /mtrx matrix put
+/col-1 {0 setgray} bind def
+/col0 {0.000 0.000 0.000 srgb} bind def
+/col1 {0.000 0.000 1.000 srgb} bind def
+/col2 {0.000 1.000 0.000 srgb} bind def
+/col3 {0.000 1.000 1.000 srgb} bind def
+/col4 {1.000 0.000 0.000 srgb} bind def
+/col5 {1.000 0.000 1.000 srgb} bind def
+/col6 {1.000 1.000 0.000 srgb} bind def
+/col7 {1.000 1.000 1.000 srgb} bind def
+/col8 {0.000 0.000 0.560 srgb} bind def
+/col9 {0.000 0.000 0.690 srgb} bind def
+/col10 {0.000 0.000 0.820 srgb} bind def
+/col11 {0.530 0.810 1.000 srgb} bind def
+/col12 {0.000 0.560 0.000 srgb} bind def
+/col13 {0.000 0.690 0.000 srgb} bind def
+/col14 {0.000 0.820 0.000 srgb} bind def
+/col15 {0.000 0.560 0.560 srgb} bind def
+/col16 {0.000 0.690 0.690 srgb} bind def
+/col17 {0.000 0.820 0.820 srgb} bind def
+/col18 {0.560 0.000 0.000 srgb} bind def
+/col19 {0.690 0.000 0.000 srgb} bind def
+/col20 {0.820 0.000 0.000 srgb} bind def
+/col21 {0.560 0.000 0.560 srgb} bind def
+/col22 {0.690 0.000 0.690 srgb} bind def
+/col23 {0.820 0.000 0.820 srgb} bind def
+/col24 {0.500 0.190 0.000 srgb} bind def
+/col25 {0.630 0.250 0.000 srgb} bind def
+/col26 {0.750 0.380 0.000 srgb} bind def
+/col27 {1.000 0.500 0.500 srgb} bind def
+/col28 {1.000 0.630 0.630 srgb} bind def
+/col29 {1.000 0.750 0.750 srgb} bind def
+/col30 {1.000 0.880 0.880 srgb} bind def
+/col31 {1.000 0.840 0.000 srgb} bind def
+
+end
+save
+newpath 0 74 moveto 0 0 lineto 74 0 lineto 74 74 lineto closepath clip newpath
+-3.8 77.2 translate
+1 -1 scale
+
+/cp {closepath} bind def
+/ef {eofill} bind def
+/gr {grestore} bind def
+/gs {gsave} bind def
+/sa {save} bind def
+/rs {restore} bind def
+/l {lineto} bind def
+/m {moveto} bind def
+/rm {rmoveto} bind def
+/n {newpath} bind def
+/s {stroke} bind def
+/sh {show} bind def
+/slc {setlinecap} bind def
+/slj {setlinejoin} bind def
+/slw {setlinewidth} bind def
+/srgb {setrgbcolor} bind def
+/rot {rotate} bind def
+/sc {scale} bind def
+/sd {setdash} bind def
+/ff {findfont} bind def
+/sf {setfont} bind def
+/scf {scalefont} bind def
+/sw {stringwidth} bind def
+/tr {translate} bind def
+/tnt {dup dup currentrgbcolor
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb}
+ bind def
+/shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul
+ 4 -2 roll mul srgb} bind def
+/$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def
+/$F2psEnd {$F2psEnteredState restore end} def
+
+$F2psBegin
+10 setmiterlimit
+0 slj 0 slc
+ 0.06000 0.06000 sc
+%
+% Fig objects follow
+%
+%
+% here starts figure with depth 0
+% Polyline
+7.500 slw
+n 1275 1275 m 1275 75 l 75 75 l 75 1275 l
+ cp gs col-1 s gr
+% here ends figure;
+$F2psEnd
+rs
+showpage
+
+%%EndDocument
+ @endspecial 3350 4886 a
+ currentpoint grestore moveto
+ 3350 4886 a Black 2250 5640
+a FQ(34)p Black eop end
+%%Page: 35 35
+TeXDict begin 35 34 bop Black 0 TeXcolorgray Black Black
+630 -149 a FQ(In)24 b(this)g(case,)k(the)c(ob)5 b(jects')26
+b(reference)f(p)s(oin)m(ts)g(\(original)h(lo)m(w)m(er-left)h(corners\))
+e(are)g(aligned)g(on)g(a)630 -49 y(horizon)m(tal)j(line.)40
+b(If)27 b(it)g(is)g(desired)f(to)h(instead)g(ha)m(v)m(e)h(the)f(cen)m
+(ters)h(aligned,)g(the)f FM(origin)e FQ(option)630 51
+y(of)38 b FM(\\includegraphics)26 b FQ(can)k(b)s(e)g(used)p
+Black Black 848 192 a FN(\\begin{center})935 291 y(\\includegraphics)o
+([to)o(ta)o(lhe)o(ig)o(ht=)o(1i)o(n])o({ro)o(se)o(tte)o(})935
+391 y(\\includegraphics)o([to)o(ta)o(lhe)o(ig)o(ht=)o(1i)o(n,)o(ori)o
+(gi)o(n=c)o(,a)o(ng)o(le=)o(-4)o(5]{)o(ro)o(set)o(te)o(})935
+491 y(\\includegraphics)o([to)o(ta)o(lhe)o(ig)o(ht=)o(1i)o(n,)o(ori)o
+(gi)o(n=c)o(,a)o(ng)o(le=)o(-9)o(0]{)o(ro)o(set)o(te)o(})848
+590 y(\\end{center})630 745 y FQ(This)g(aligns)h(the)f(cen)m(ters)i(of)
+e(the)h(graphics)p Black Black 1240 1570 a @beginspecial
+124.379997 @llx 124.379997 @lly 487.609985 @urx 487.609985
+@ury 720 @rhi @setspecial
+%%BeginDocument: rosette.eps
+%!
+%%BoundingBox: 124.38 124.38 487.61 487.61
+
+/inch {72 mul} def
+
+/wedge
+ { newpath
+ 0 0 moveto
+ 1 0 translate
+ 15 rotate
+ 0 15 sin translate
+ 0 0 15 sin -90 90 arc
+ closepath
+ } def
+
+gsave
+ 4.25 inch 4.25 inch translate
+ 1.75 inch 1.75 inch scale
+ 0.02 setlinewidth
+ 2 1 13
+ {
+ 13 div setgray
+ gsave
+ wedge
+ gsave
+ fill
+ grestore
+ 0 setgray stroke
+ grestore
+ 30 rotate
+ } for
+
+grestore
+showpage
+
+
+%%EndDocument
+ @endspecial 1871 1270 a
+ gsave currentpoint currentpoint translate -45 neg rotate neg exch
+neg exch translate
+ 1871 1270 a @beginspecial 124.379997
+@llx 124.379997 @lly 487.609985 @urx 487.609985 @ury
+720 @rhi @setspecial
+%%BeginDocument: rosette.eps
+%!
+%%BoundingBox: 124.38 124.38 487.61 487.61
+
+/inch {72 mul} def
+
+/wedge
+ { newpath
+ 0 0 moveto
+ 1 0 translate
+ 15 rotate
+ 0 15 sin translate
+ 0 0 15 sin -90 90 arc
+ closepath
+ } def
+
+gsave
+ 4.25 inch 4.25 inch translate
+ 1.75 inch 1.75 inch scale
+ 0.02 setlinewidth
+ 2 1 13
+ {
+ 13 div setgray
+ gsave
+ wedge
+ gsave
+ fill
+ grestore
+ 0 setgray stroke
+ grestore
+ 30 rotate
+ } for
+
+grestore
+showpage
+
+
+%%EndDocument
+ @endspecial 2471 1270 a
+ currentpoint grestore moveto
+ 2471 1270 a 2750 970 a
+ gsave currentpoint currentpoint translate -90 neg rotate neg exch
+neg exch translate
+ 2750
+970 a @beginspecial 124.379997 @llx 124.379997 @lly 487.609985
+@urx 487.609985 @ury 720 @rhi @setspecial
+%%BeginDocument: rosette.eps
+%!
+%%BoundingBox: 124.38 124.38 487.61 487.61
+
+/inch {72 mul} def
+
+/wedge
+ { newpath
+ 0 0 moveto
+ 1 0 translate
+ 15 rotate
+ 0 15 sin translate
+ 0 0 15 sin -90 90 arc
+ closepath
+ } def
+
+gsave
+ 4.25 inch 4.25 inch translate
+ 1.75 inch 1.75 inch scale
+ 0.02 setlinewidth
+ 2 1 13
+ {
+ 13 div setgray
+ gsave
+ wedge
+ gsave
+ fill
+ grestore
+ 0 setgray stroke
+ grestore
+ 30 rotate
+ } for
+
+grestore
+showpage
+
+
+%%EndDocument
+ @endspecial 3350 970 a
+ currentpoint grestore moveto
+ 3350 970 a 630 1892 a FL(11.3.2)106
+b(Example)34 b(#2)630 2051 y FQ(Similarly)-8 b(,)31 b(the)g(commands)p
+Black Black 804 2192 a FN(\\begin{center})979 2292 y(\\includegraphic)o
+(s[w)o(id)o(th=)o(1i)o(n]{)o(gr)o(ap)o(hic)o(})979 2391
+y(\\hspace{1in})979 2491 y(\\includegraphic)o(s[w)o(id)o(th=)o(1i)o
+(n,a)o(ng)o(le)o(=-9)o(0])o({gr)o(ap)o(hi)o(c})804 2590
+y(\\end{center})630 2745 y FQ(rotate)h(the)e(righ)m(t-hand)h(graphic)f
+(around)g(its)g(lo)m(w)m(er-left)j(corner,)e(pro)s(ducing)p
+Black Black 1552 3071 a @beginspecial 0 @llx 0 @lly 144
+@urx 54 @ury 720 @rwi @setspecial
+%%BeginDocument: graphic.eps
+%!PS-Adobe-2.0 EPSF-2.0
+%%Title: graphic.eps
+%%Creator: fig2dev Version 3.2 Patchlevel 0-beta2
+%%CreationDate: Thu Dec 11 20:58:11 1997
+%%For: Keith Reckdahl
+%%Orientation: Portrait
+%%BoundingBox: 0 0 144 54
+%%Pages: 0
+%%BeginSetup
+%%IncludeFeature: *PageSize Letter
+%%EndSetup
+%%Magnification: 1.00
+%%EndComments
+/$F2psDict 200 dict def
+$F2psDict begin
+$F2psDict /mtrx matrix put
+/col-1 {0 setgray} bind def
+/col0 {0.000 0.000 0.000 srgb} bind def
+/col1 {0.000 0.000 1.000 srgb} bind def
+/col2 {0.000 1.000 0.000 srgb} bind def
+/col3 {0.000 1.000 1.000 srgb} bind def
+/col4 {1.000 0.000 0.000 srgb} bind def
+/col5 {1.000 0.000 1.000 srgb} bind def
+/col6 {1.000 1.000 0.000 srgb} bind def
+/col7 {1.000 1.000 1.000 srgb} bind def
+/col8 {0.000 0.000 0.560 srgb} bind def
+/col9 {0.000 0.000 0.690 srgb} bind def
+/col10 {0.000 0.000 0.820 srgb} bind def
+/col11 {0.530 0.810 1.000 srgb} bind def
+/col12 {0.000 0.560 0.000 srgb} bind def
+/col13 {0.000 0.690 0.000 srgb} bind def
+/col14 {0.000 0.820 0.000 srgb} bind def
+/col15 {0.000 0.560 0.560 srgb} bind def
+/col16 {0.000 0.690 0.690 srgb} bind def
+/col17 {0.000 0.820 0.820 srgb} bind def
+/col18 {0.560 0.000 0.000 srgb} bind def
+/col19 {0.690 0.000 0.000 srgb} bind def
+/col20 {0.820 0.000 0.000 srgb} bind def
+/col21 {0.560 0.000 0.560 srgb} bind def
+/col22 {0.690 0.000 0.690 srgb} bind def
+/col23 {0.820 0.000 0.820 srgb} bind def
+/col24 {0.500 0.190 0.000 srgb} bind def
+/col25 {0.630 0.250 0.000 srgb} bind def
+/col26 {0.750 0.380 0.000 srgb} bind def
+/col27 {1.000 0.500 0.500 srgb} bind def
+/col28 {1.000 0.630 0.630 srgb} bind def
+/col29 {1.000 0.750 0.750 srgb} bind def
+/col30 {1.000 0.880 0.880 srgb} bind def
+/col31 {1.000 0.840 0.000 srgb} bind def
+
+end
+save
+-2.0 61.0 translate
+1 -1 scale
+
+/cp {closepath} bind def
+/ef {eofill} bind def
+/gr {grestore} bind def
+/gs {gsave} bind def
+/sa {save} bind def
+/rs {restore} bind def
+/l {lineto} bind def
+/m {moveto} bind def
+/rm {rmoveto} bind def
+/n {newpath} bind def
+/s {stroke} bind def
+/sh {show} bind def
+/slc {setlinecap} bind def
+/slj {setlinejoin} bind def
+/slw {setlinewidth} bind def
+/srgb {setrgbcolor} bind def
+/rot {rotate} bind def
+/sc {scale} bind def
+/sd {setdash} bind def
+/ff {findfont} bind def
+/sf {setfont} bind def
+/scf {scalefont} bind def
+/sw {stringwidth} bind def
+/tr {translate} bind def
+/tnt {dup dup currentrgbcolor
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb}
+ bind def
+/shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul
+ 4 -2 roll mul srgb} bind def
+/$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def
+/$F2psEnd {$F2psEnteredState restore end} def
+%%EndProlog
+
+$F2psBegin
+10 setmiterlimit
+n 0 1048 m 0 0 l 2473 0 l 2473 1048 l cp clip
+ 0.06000 0.06000 sc
+% Polyline
+30.000 slw
+n 2400 975 m 75 975 l 75 150 l 2400 150 l cp gs col-1 s gr
+/Times-Bold ff 360.00 scf sf
+1220 705 m
+gs 1 -1 sc (Graphic) dup sw pop 2 div neg 0 rm col-1 sh gr
+$F2psEnd
+rs
+
+%%EndDocument
+ @endspecial 2813 3071 a
+ gsave currentpoint currentpoint translate -90 neg rotate neg exch
+neg exch translate
+ 2813 3071 a @beginspecial 0
+@llx 0 @lly 144 @urx 54 @ury 720 @rwi @setspecial
+%%BeginDocument: graphic.eps
+%!PS-Adobe-2.0 EPSF-2.0
+%%Title: graphic.eps
+%%Creator: fig2dev Version 3.2 Patchlevel 0-beta2
+%%CreationDate: Thu Dec 11 20:58:11 1997
+%%For: Keith Reckdahl
+%%Orientation: Portrait
+%%BoundingBox: 0 0 144 54
+%%Pages: 0
+%%BeginSetup
+%%IncludeFeature: *PageSize Letter
+%%EndSetup
+%%Magnification: 1.00
+%%EndComments
+/$F2psDict 200 dict def
+$F2psDict begin
+$F2psDict /mtrx matrix put
+/col-1 {0 setgray} bind def
+/col0 {0.000 0.000 0.000 srgb} bind def
+/col1 {0.000 0.000 1.000 srgb} bind def
+/col2 {0.000 1.000 0.000 srgb} bind def
+/col3 {0.000 1.000 1.000 srgb} bind def
+/col4 {1.000 0.000 0.000 srgb} bind def
+/col5 {1.000 0.000 1.000 srgb} bind def
+/col6 {1.000 1.000 0.000 srgb} bind def
+/col7 {1.000 1.000 1.000 srgb} bind def
+/col8 {0.000 0.000 0.560 srgb} bind def
+/col9 {0.000 0.000 0.690 srgb} bind def
+/col10 {0.000 0.000 0.820 srgb} bind def
+/col11 {0.530 0.810 1.000 srgb} bind def
+/col12 {0.000 0.560 0.000 srgb} bind def
+/col13 {0.000 0.690 0.000 srgb} bind def
+/col14 {0.000 0.820 0.000 srgb} bind def
+/col15 {0.000 0.560 0.560 srgb} bind def
+/col16 {0.000 0.690 0.690 srgb} bind def
+/col17 {0.000 0.820 0.820 srgb} bind def
+/col18 {0.560 0.000 0.000 srgb} bind def
+/col19 {0.690 0.000 0.000 srgb} bind def
+/col20 {0.820 0.000 0.000 srgb} bind def
+/col21 {0.560 0.000 0.560 srgb} bind def
+/col22 {0.690 0.000 0.690 srgb} bind def
+/col23 {0.820 0.000 0.820 srgb} bind def
+/col24 {0.500 0.190 0.000 srgb} bind def
+/col25 {0.630 0.250 0.000 srgb} bind def
+/col26 {0.750 0.380 0.000 srgb} bind def
+/col27 {1.000 0.500 0.500 srgb} bind def
+/col28 {1.000 0.630 0.630 srgb} bind def
+/col29 {1.000 0.750 0.750 srgb} bind def
+/col30 {1.000 0.880 0.880 srgb} bind def
+/col31 {1.000 0.840 0.000 srgb} bind def
+
+end
+save
+-2.0 61.0 translate
+1 -1 scale
+
+/cp {closepath} bind def
+/ef {eofill} bind def
+/gr {grestore} bind def
+/gs {gsave} bind def
+/sa {save} bind def
+/rs {restore} bind def
+/l {lineto} bind def
+/m {moveto} bind def
+/rm {rmoveto} bind def
+/n {newpath} bind def
+/s {stroke} bind def
+/sh {show} bind def
+/slc {setlinecap} bind def
+/slj {setlinejoin} bind def
+/slw {setlinewidth} bind def
+/srgb {setrgbcolor} bind def
+/rot {rotate} bind def
+/sc {scale} bind def
+/sd {setdash} bind def
+/ff {findfont} bind def
+/sf {setfont} bind def
+/scf {scalefont} bind def
+/sw {stringwidth} bind def
+/tr {translate} bind def
+/tnt {dup dup currentrgbcolor
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb}
+ bind def
+/shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul
+ 4 -2 roll mul srgb} bind def
+/$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def
+/$F2psEnd {$F2psEnteredState restore end} def
+%%EndProlog
+
+$F2psBegin
+10 setmiterlimit
+n 0 1048 m 0 0 l 2473 0 l 2473 1048 l cp clip
+ 0.06000 0.06000 sc
+% Polyline
+30.000 slw
+n 2400 975 m 75 975 l 75 150 l 2400 150 l cp gs col-1 s gr
+/Times-Bold ff 360.00 scf sf
+1220 705 m
+gs 1 -1 sc (Graphic) dup sw pop 2 div neg 0 rm col-1 sh gr
+$F2psEnd
+rs
+
+%%EndDocument
+ @endspecial 3413 3071 a
+ currentpoint grestore moveto
+ 3413 3071 a 630 3817 a FQ(T)-8
+b(o)31 b(align)g(the)g(b)s(ottoms)f(of)h(the)f(graphics,)h(use)f(the)h
+(follo)m(wing)g(commands)p Black Black 761 3958 a FN(\\begin{center})
+892 4057 y(\\includegraphic)o(s[)o(wid)o(th)o(=1i)o(n])o({gr)o(ap)o(hi)
+o(c})892 4157 y(\\hspace{1in})892 4257 y(\\includegraphic)o(s[)o(wid)o
+(th)o(=1i)o(n,)o(ori)o(gi)o(n=)o(br,)o(an)o(gle)o(=-)o(90)o(]{g)o(ra)o
+(phi)o(c})761 4356 y(\\end{center})630 4511 y FQ(whic)m(h)f(rotate)i
+(the)f(righ)m(t)g(graphic)f(ab)s(out)g(its)h(lo)m(w)m(er-righ)m(t)h
+(corner,)f(pro)s(ducing)p Black Black 1552 5211 a @beginspecial
+0 @llx 0 @lly 144 @urx 54 @ury 720 @rwi @setspecial
+%%BeginDocument: graphic.eps
+%!PS-Adobe-2.0 EPSF-2.0
+%%Title: graphic.eps
+%%Creator: fig2dev Version 3.2 Patchlevel 0-beta2
+%%CreationDate: Thu Dec 11 20:58:11 1997
+%%For: Keith Reckdahl
+%%Orientation: Portrait
+%%BoundingBox: 0 0 144 54
+%%Pages: 0
+%%BeginSetup
+%%IncludeFeature: *PageSize Letter
+%%EndSetup
+%%Magnification: 1.00
+%%EndComments
+/$F2psDict 200 dict def
+$F2psDict begin
+$F2psDict /mtrx matrix put
+/col-1 {0 setgray} bind def
+/col0 {0.000 0.000 0.000 srgb} bind def
+/col1 {0.000 0.000 1.000 srgb} bind def
+/col2 {0.000 1.000 0.000 srgb} bind def
+/col3 {0.000 1.000 1.000 srgb} bind def
+/col4 {1.000 0.000 0.000 srgb} bind def
+/col5 {1.000 0.000 1.000 srgb} bind def
+/col6 {1.000 1.000 0.000 srgb} bind def
+/col7 {1.000 1.000 1.000 srgb} bind def
+/col8 {0.000 0.000 0.560 srgb} bind def
+/col9 {0.000 0.000 0.690 srgb} bind def
+/col10 {0.000 0.000 0.820 srgb} bind def
+/col11 {0.530 0.810 1.000 srgb} bind def
+/col12 {0.000 0.560 0.000 srgb} bind def
+/col13 {0.000 0.690 0.000 srgb} bind def
+/col14 {0.000 0.820 0.000 srgb} bind def
+/col15 {0.000 0.560 0.560 srgb} bind def
+/col16 {0.000 0.690 0.690 srgb} bind def
+/col17 {0.000 0.820 0.820 srgb} bind def
+/col18 {0.560 0.000 0.000 srgb} bind def
+/col19 {0.690 0.000 0.000 srgb} bind def
+/col20 {0.820 0.000 0.000 srgb} bind def
+/col21 {0.560 0.000 0.560 srgb} bind def
+/col22 {0.690 0.000 0.690 srgb} bind def
+/col23 {0.820 0.000 0.820 srgb} bind def
+/col24 {0.500 0.190 0.000 srgb} bind def
+/col25 {0.630 0.250 0.000 srgb} bind def
+/col26 {0.750 0.380 0.000 srgb} bind def
+/col27 {1.000 0.500 0.500 srgb} bind def
+/col28 {1.000 0.630 0.630 srgb} bind def
+/col29 {1.000 0.750 0.750 srgb} bind def
+/col30 {1.000 0.880 0.880 srgb} bind def
+/col31 {1.000 0.840 0.000 srgb} bind def
+
+end
+save
+-2.0 61.0 translate
+1 -1 scale
+
+/cp {closepath} bind def
+/ef {eofill} bind def
+/gr {grestore} bind def
+/gs {gsave} bind def
+/sa {save} bind def
+/rs {restore} bind def
+/l {lineto} bind def
+/m {moveto} bind def
+/rm {rmoveto} bind def
+/n {newpath} bind def
+/s {stroke} bind def
+/sh {show} bind def
+/slc {setlinecap} bind def
+/slj {setlinejoin} bind def
+/slw {setlinewidth} bind def
+/srgb {setrgbcolor} bind def
+/rot {rotate} bind def
+/sc {scale} bind def
+/sd {setdash} bind def
+/ff {findfont} bind def
+/sf {setfont} bind def
+/scf {scalefont} bind def
+/sw {stringwidth} bind def
+/tr {translate} bind def
+/tnt {dup dup currentrgbcolor
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb}
+ bind def
+/shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul
+ 4 -2 roll mul srgb} bind def
+/$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def
+/$F2psEnd {$F2psEnteredState restore end} def
+%%EndProlog
+
+$F2psBegin
+10 setmiterlimit
+n 0 1048 m 0 0 l 2473 0 l 2473 1048 l cp clip
+ 0.06000 0.06000 sc
+% Polyline
+30.000 slw
+n 2400 975 m 75 975 l 75 150 l 2400 150 l cp gs col-1 s gr
+/Times-Bold ff 360.00 scf sf
+1220 705 m
+gs 1 -1 sc (Graphic) dup sw pop 2 div neg 0 rm col-1 sh gr
+$F2psEnd
+rs
+
+%%EndDocument
+ @endspecial 2813 4611 a
+ gsave currentpoint currentpoint translate -90 neg rotate neg exch
+neg exch translate
+ 2813 4611 a @beginspecial 0
+@llx 0 @lly 144 @urx 54 @ury 720 @rwi @setspecial
+%%BeginDocument: graphic.eps
+%!PS-Adobe-2.0 EPSF-2.0
+%%Title: graphic.eps
+%%Creator: fig2dev Version 3.2 Patchlevel 0-beta2
+%%CreationDate: Thu Dec 11 20:58:11 1997
+%%For: Keith Reckdahl
+%%Orientation: Portrait
+%%BoundingBox: 0 0 144 54
+%%Pages: 0
+%%BeginSetup
+%%IncludeFeature: *PageSize Letter
+%%EndSetup
+%%Magnification: 1.00
+%%EndComments
+/$F2psDict 200 dict def
+$F2psDict begin
+$F2psDict /mtrx matrix put
+/col-1 {0 setgray} bind def
+/col0 {0.000 0.000 0.000 srgb} bind def
+/col1 {0.000 0.000 1.000 srgb} bind def
+/col2 {0.000 1.000 0.000 srgb} bind def
+/col3 {0.000 1.000 1.000 srgb} bind def
+/col4 {1.000 0.000 0.000 srgb} bind def
+/col5 {1.000 0.000 1.000 srgb} bind def
+/col6 {1.000 1.000 0.000 srgb} bind def
+/col7 {1.000 1.000 1.000 srgb} bind def
+/col8 {0.000 0.000 0.560 srgb} bind def
+/col9 {0.000 0.000 0.690 srgb} bind def
+/col10 {0.000 0.000 0.820 srgb} bind def
+/col11 {0.530 0.810 1.000 srgb} bind def
+/col12 {0.000 0.560 0.000 srgb} bind def
+/col13 {0.000 0.690 0.000 srgb} bind def
+/col14 {0.000 0.820 0.000 srgb} bind def
+/col15 {0.000 0.560 0.560 srgb} bind def
+/col16 {0.000 0.690 0.690 srgb} bind def
+/col17 {0.000 0.820 0.820 srgb} bind def
+/col18 {0.560 0.000 0.000 srgb} bind def
+/col19 {0.690 0.000 0.000 srgb} bind def
+/col20 {0.820 0.000 0.000 srgb} bind def
+/col21 {0.560 0.000 0.560 srgb} bind def
+/col22 {0.690 0.000 0.690 srgb} bind def
+/col23 {0.820 0.000 0.820 srgb} bind def
+/col24 {0.500 0.190 0.000 srgb} bind def
+/col25 {0.630 0.250 0.000 srgb} bind def
+/col26 {0.750 0.380 0.000 srgb} bind def
+/col27 {1.000 0.500 0.500 srgb} bind def
+/col28 {1.000 0.630 0.630 srgb} bind def
+/col29 {1.000 0.750 0.750 srgb} bind def
+/col30 {1.000 0.880 0.880 srgb} bind def
+/col31 {1.000 0.840 0.000 srgb} bind def
+
+end
+save
+-2.0 61.0 translate
+1 -1 scale
+
+/cp {closepath} bind def
+/ef {eofill} bind def
+/gr {grestore} bind def
+/gs {gsave} bind def
+/sa {save} bind def
+/rs {restore} bind def
+/l {lineto} bind def
+/m {moveto} bind def
+/rm {rmoveto} bind def
+/n {newpath} bind def
+/s {stroke} bind def
+/sh {show} bind def
+/slc {setlinecap} bind def
+/slj {setlinejoin} bind def
+/slw {setlinewidth} bind def
+/srgb {setrgbcolor} bind def
+/rot {rotate} bind def
+/sc {scale} bind def
+/sd {setdash} bind def
+/ff {findfont} bind def
+/sf {setfont} bind def
+/scf {scalefont} bind def
+/sw {stringwidth} bind def
+/tr {translate} bind def
+/tnt {dup dup currentrgbcolor
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb}
+ bind def
+/shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul
+ 4 -2 roll mul srgb} bind def
+/$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def
+/$F2psEnd {$F2psEnteredState restore end} def
+%%EndProlog
+
+$F2psBegin
+10 setmiterlimit
+n 0 1048 m 0 0 l 2473 0 l 2473 1048 l cp clip
+ 0.06000 0.06000 sc
+% Polyline
+30.000 slw
+n 2400 975 m 75 975 l 75 150 l 2400 150 l cp gs col-1 s gr
+/Times-Bold ff 360.00 scf sf
+1220 705 m
+gs 1 -1 sc (Graphic) dup sw pop 2 div neg 0 rm col-1 sh gr
+$F2psEnd
+rs
+
+%%EndDocument
+ @endspecial 3413 4611 a
+ currentpoint grestore moveto
+ 3413 4611 a Black 2250 5640
+a FQ(35)p Black eop end
+%%Page: 36 36
+TeXDict begin 36 35 bop Black 0 TeXcolorgray Black Black
+630 -149 a FB(11.4)112 b(Minipage)39 b(V)-9 b(ertical)37
+b(Alignmen)m(t)630 23 y FQ(It)28 b(is)f(often)i(useful)d(to)j(place)f
+(graphics)g(inside)f(of)h(minipage)g(en)m(vironmen)m(ts)g(\(for)g
+(example,)h(see)630 136 y(Section)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 26 w(28)p Black 26 w(on)c(page)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 26 w(104)p Black(\).)40 b(When)25 b(minipages)h(are)f
+(placed)h(side-b)m(y-side,)h(L)3262 119 y FP(A)3301 136
+y FQ(T)3352 155 y(E)3402 136 y(X)e(places)h(them)630
+249 y(suc)m(h)38 b(that)h(their)g(reference)g(p)s(oin)m(ts)g(are)g(v)m
+(ertically)h(aligned.)67 b(By)38 b(default,)k(the)c(minipage's)630
+362 y(reference)28 b(p)s(oin)m(t)g(is)g(v)m(ertically)i(cen)m(tered)f
+(on)f(its)g(left)g(edge.)41 b(An)27 b(optional)i(argumen)m(t)g(mo)s
+(di\014es)630 475 y(the)i(lo)s(cation)h(of)e(a)h(minipage's)g
+(reference)g(p)s(oin)m(t.)p Black 630 646 a FM([b])p
+Black 45 w FQ(causes)d(the)h(minipage's)g(reference)f(p)s(oin)m(t)h(to)
+g(b)s(e)e(v)m(ertically)k(aligned)e(with)f(the)g(reference)857
+759 y(p)s(oin)m(t)j(of)f(the)h(b)s(ottom)f(line)h(in)f(the)h(minipage.)
+p Black 630 940 a FM([t])p Black 45 w FQ(causes)d(the)h(minipage's)g
+(reference)f(p)s(oin)m(t)h(to)g(b)s(e)e(v)m(ertically)k(aligned)e(with)
+f(the)g(reference)857 1053 y(p)s(oin)m(t)j(of)f(the)h(top)f(line)h(in)f
+(the)h(minipage.)630 1225 y(Note)g(the)g FM([b])e FQ(do)s(es)g
+Fy(not)40 b FQ(put)29 b(the)h(reference)h(p)s(oin)m(t)f(at)h(the)f(b)s
+(ottom)g(of)g(the)h(minipage.)41 b(Lik)m(e-)630 1338
+y(wise,)31 b(the)f FM([t])g FQ(do)s(es)g Fy(not)40 b
+FQ(put)29 b(the)i(reference)g(p)s(oin)m(t)f(at)h(the)g(top)f(of)h(the)f
+(minipage.)771 1429 y(When)f(the)h(minipage)g(con)m(tains)g(only)g(one)
+f(line,)i(the)e FM([b])g FQ(and)f FM([t])h FQ(options)h(pro)s(duce)e
+(the)630 1520 y(same)j(results.)40 b(F)-8 b(or)31 b(example,)h(b)s(oth)
+p Black Black 787 1637 a FE(\\begin{center})905 1729
+y(\\begin{minipage}[b]{.25\\linewid)q(th})1022 1820 y(\\centering)1022
+1911 y(\\includegraphics[width=1in]{)q(grap)q(hic})905
+2003 y(\\end{minipage}\045)905 2094 y
+(\\begin{minipage}[b]{.25\\linewid)q(th})1022 2185 y(\\centering)1022
+2277 y(\\includegraphics[width=1in,a)q(ngle)q(=-45])q({gra)q(phic)q(})
+905 2368 y(\\end{minipage})787 2459 y(\\end{center})630
+2576 y FQ(and)p Black Black 787 2693 a FE(\\begin{center})905
+2784 y(\\begin{minipage}[t]{.25\\linewid)q(th})1022 2876
+y(\\centering)1022 2967 y(\\includegraphics[width=1in]{)q(grap)q(hic})
+905 3058 y(\\end{minipage}\045)905 3150 y
+(\\begin{minipage}[t]{.25\\linewid)q(th})1022 3241 y(\\centering)1022
+3332 y(\\includegraphics[width=1in,a)q(ngle)q(=-45])q({gra)q(phic)q(})
+905 3424 y(\\end{minipage})787 3515 y(\\end{center})630
+3653 y FQ(pro)s(duce)40 b(Figure)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 42 w(4)p Black(.)75 b(In)41 b(b)s(oth)g(of)g(these)i
+(cases,)i(reference)d(p)s(oin)m(t)g(of)f(the)h(minipage)g(is)g(the)630
+3766 y(reference)31 b(p)s(oin)m(t)f(\(original)i(lo)m(w)m(er-left)h
+(corner\))d(of)h(the)g FJ(eps)e FQ(graphic.)p Black 1579
+4107 a @beginspecial 0 @llx 0 @lly 144 @urx 54 @ury 720
+@rwi @setspecial
+%%BeginDocument: graphic.eps
+%!PS-Adobe-2.0 EPSF-2.0
+%%Title: graphic.eps
+%%Creator: fig2dev Version 3.2 Patchlevel 0-beta2
+%%CreationDate: Thu Dec 11 20:58:11 1997
+%%For: Keith Reckdahl
+%%Orientation: Portrait
+%%BoundingBox: 0 0 144 54
+%%Pages: 0
+%%BeginSetup
+%%IncludeFeature: *PageSize Letter
+%%EndSetup
+%%Magnification: 1.00
+%%EndComments
+/$F2psDict 200 dict def
+$F2psDict begin
+$F2psDict /mtrx matrix put
+/col-1 {0 setgray} bind def
+/col0 {0.000 0.000 0.000 srgb} bind def
+/col1 {0.000 0.000 1.000 srgb} bind def
+/col2 {0.000 1.000 0.000 srgb} bind def
+/col3 {0.000 1.000 1.000 srgb} bind def
+/col4 {1.000 0.000 0.000 srgb} bind def
+/col5 {1.000 0.000 1.000 srgb} bind def
+/col6 {1.000 1.000 0.000 srgb} bind def
+/col7 {1.000 1.000 1.000 srgb} bind def
+/col8 {0.000 0.000 0.560 srgb} bind def
+/col9 {0.000 0.000 0.690 srgb} bind def
+/col10 {0.000 0.000 0.820 srgb} bind def
+/col11 {0.530 0.810 1.000 srgb} bind def
+/col12 {0.000 0.560 0.000 srgb} bind def
+/col13 {0.000 0.690 0.000 srgb} bind def
+/col14 {0.000 0.820 0.000 srgb} bind def
+/col15 {0.000 0.560 0.560 srgb} bind def
+/col16 {0.000 0.690 0.690 srgb} bind def
+/col17 {0.000 0.820 0.820 srgb} bind def
+/col18 {0.560 0.000 0.000 srgb} bind def
+/col19 {0.690 0.000 0.000 srgb} bind def
+/col20 {0.820 0.000 0.000 srgb} bind def
+/col21 {0.560 0.000 0.560 srgb} bind def
+/col22 {0.690 0.000 0.690 srgb} bind def
+/col23 {0.820 0.000 0.820 srgb} bind def
+/col24 {0.500 0.190 0.000 srgb} bind def
+/col25 {0.630 0.250 0.000 srgb} bind def
+/col26 {0.750 0.380 0.000 srgb} bind def
+/col27 {1.000 0.500 0.500 srgb} bind def
+/col28 {1.000 0.630 0.630 srgb} bind def
+/col29 {1.000 0.750 0.750 srgb} bind def
+/col30 {1.000 0.880 0.880 srgb} bind def
+/col31 {1.000 0.840 0.000 srgb} bind def
+
+end
+save
+-2.0 61.0 translate
+1 -1 scale
+
+/cp {closepath} bind def
+/ef {eofill} bind def
+/gr {grestore} bind def
+/gs {gsave} bind def
+/sa {save} bind def
+/rs {restore} bind def
+/l {lineto} bind def
+/m {moveto} bind def
+/rm {rmoveto} bind def
+/n {newpath} bind def
+/s {stroke} bind def
+/sh {show} bind def
+/slc {setlinecap} bind def
+/slj {setlinejoin} bind def
+/slw {setlinewidth} bind def
+/srgb {setrgbcolor} bind def
+/rot {rotate} bind def
+/sc {scale} bind def
+/sd {setdash} bind def
+/ff {findfont} bind def
+/sf {setfont} bind def
+/scf {scalefont} bind def
+/sw {stringwidth} bind def
+/tr {translate} bind def
+/tnt {dup dup currentrgbcolor
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb}
+ bind def
+/shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul
+ 4 -2 roll mul srgb} bind def
+/$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def
+/$F2psEnd {$F2psEnteredState restore end} def
+%%EndProlog
+
+$F2psBegin
+10 setmiterlimit
+n 0 1048 m 0 0 l 2473 0 l 2473 1048 l cp clip
+ 0.06000 0.06000 sc
+% Polyline
+30.000 slw
+n 2400 975 m 75 975 l 75 150 l 2400 150 l cp gs col-1 s gr
+/Times-Bold ff 360.00 scf sf
+1220 705 m
+gs 1 -1 sc (Graphic) dup sw pop 2 div neg 0 rm col-1 sh gr
+$F2psEnd
+rs
+
+%%EndDocument
+ @endspecial 2420 4107 a
+ gsave currentpoint currentpoint translate -45 neg rotate neg exch
+neg exch translate
+ 2420 4107 a @beginspecial 0
+@llx 0 @lly 144 @urx 54 @ury 720 @rwi @setspecial
+%%BeginDocument: graphic.eps
+%!PS-Adobe-2.0 EPSF-2.0
+%%Title: graphic.eps
+%%Creator: fig2dev Version 3.2 Patchlevel 0-beta2
+%%CreationDate: Thu Dec 11 20:58:11 1997
+%%For: Keith Reckdahl
+%%Orientation: Portrait
+%%BoundingBox: 0 0 144 54
+%%Pages: 0
+%%BeginSetup
+%%IncludeFeature: *PageSize Letter
+%%EndSetup
+%%Magnification: 1.00
+%%EndComments
+/$F2psDict 200 dict def
+$F2psDict begin
+$F2psDict /mtrx matrix put
+/col-1 {0 setgray} bind def
+/col0 {0.000 0.000 0.000 srgb} bind def
+/col1 {0.000 0.000 1.000 srgb} bind def
+/col2 {0.000 1.000 0.000 srgb} bind def
+/col3 {0.000 1.000 1.000 srgb} bind def
+/col4 {1.000 0.000 0.000 srgb} bind def
+/col5 {1.000 0.000 1.000 srgb} bind def
+/col6 {1.000 1.000 0.000 srgb} bind def
+/col7 {1.000 1.000 1.000 srgb} bind def
+/col8 {0.000 0.000 0.560 srgb} bind def
+/col9 {0.000 0.000 0.690 srgb} bind def
+/col10 {0.000 0.000 0.820 srgb} bind def
+/col11 {0.530 0.810 1.000 srgb} bind def
+/col12 {0.000 0.560 0.000 srgb} bind def
+/col13 {0.000 0.690 0.000 srgb} bind def
+/col14 {0.000 0.820 0.000 srgb} bind def
+/col15 {0.000 0.560 0.560 srgb} bind def
+/col16 {0.000 0.690 0.690 srgb} bind def
+/col17 {0.000 0.820 0.820 srgb} bind def
+/col18 {0.560 0.000 0.000 srgb} bind def
+/col19 {0.690 0.000 0.000 srgb} bind def
+/col20 {0.820 0.000 0.000 srgb} bind def
+/col21 {0.560 0.000 0.560 srgb} bind def
+/col22 {0.690 0.000 0.690 srgb} bind def
+/col23 {0.820 0.000 0.820 srgb} bind def
+/col24 {0.500 0.190 0.000 srgb} bind def
+/col25 {0.630 0.250 0.000 srgb} bind def
+/col26 {0.750 0.380 0.000 srgb} bind def
+/col27 {1.000 0.500 0.500 srgb} bind def
+/col28 {1.000 0.630 0.630 srgb} bind def
+/col29 {1.000 0.750 0.750 srgb} bind def
+/col30 {1.000 0.880 0.880 srgb} bind def
+/col31 {1.000 0.840 0.000 srgb} bind def
+
+end
+save
+-2.0 61.0 translate
+1 -1 scale
+
+/cp {closepath} bind def
+/ef {eofill} bind def
+/gr {grestore} bind def
+/gs {gsave} bind def
+/sa {save} bind def
+/rs {restore} bind def
+/l {lineto} bind def
+/m {moveto} bind def
+/rm {rmoveto} bind def
+/n {newpath} bind def
+/s {stroke} bind def
+/sh {show} bind def
+/slc {setlinecap} bind def
+/slj {setlinejoin} bind def
+/slw {setlinewidth} bind def
+/srgb {setrgbcolor} bind def
+/rot {rotate} bind def
+/sc {scale} bind def
+/sd {setdash} bind def
+/ff {findfont} bind def
+/sf {setfont} bind def
+/scf {scalefont} bind def
+/sw {stringwidth} bind def
+/tr {translate} bind def
+/tnt {dup dup currentrgbcolor
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb}
+ bind def
+/shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul
+ 4 -2 roll mul srgb} bind def
+/$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def
+/$F2psEnd {$F2psEnteredState restore end} def
+%%EndProlog
+
+$F2psBegin
+10 setmiterlimit
+n 0 1048 m 0 0 l 2473 0 l 2473 1048 l cp clip
+ 0.06000 0.06000 sc
+% Polyline
+30.000 slw
+n 2400 975 m 75 975 l 75 150 l 2400 150 l cp gs col-1 s gr
+/Times-Bold ff 360.00 scf sf
+1220 705 m
+gs 1 -1 sc (Graphic) dup sw pop 2 div neg 0 rm col-1 sh gr
+$F2psEnd
+rs
+
+%%EndDocument
+ @endspecial 3020 4107 a
+ currentpoint grestore moveto
+ 3020 4107 a 1407 4702 a FQ(Figure)i(4:)p
+0 TeXcolorgray Black 41 w(minipages)f(with)h FM([b])e
+FQ(or)h FM([t])g FQ(options)p Black 630 5043 a FL(11.4.1)106
+b(Aligning)35 b(the)g(Bottoms)g(of)g(Minipages)630 5215
+y FQ(One)30 b(metho)s(d)g(for)g(aligning)i(the)f(b)s(ottoms)f(of)h
+(minipages)g(is)f(to)i(force)f(the)f(minipage)h(baseline)630
+5328 y(b)s(e)41 b(the)h(b)s(ottom)g(of)h(the)f(minipage.)75
+b(Recall)44 b(that)e(the)g(minipage)h FM([b])e FQ(option)h(mak)m(es)h
+(the)630 5441 y(minipage)31 b(baseline)g(b)s(e)f(the)g(baseline)h(of)g
+(the)f(minipage's)h(b)s(ottom)g(line.)p Black 2250 5640
+a(36)p Black eop end
+%%Page: 37 37
+TeXDict begin 37 36 bop Black 0 TeXcolorgray Black Black
+771 -149 a FQ(If)40 b(the)h(b)s(ottom)f(line)h(of)f(the)h(minipage)g
+(happ)s(ens)d(to)j(ha)m(v)m(e)h(zero)f(depth,)h(then)f(the)f(last)630
+-36 y(line's)g(reference)f(p)s(oin)m(t)g(is)g(the)h(b)s(ottom)f(of)g
+(the)h(line)f(and)g(then)f(the)i(minipage)f FM([b])f
+FQ(option)630 77 y(w)m(ould)26 b(mak)m(e)i(the)e(minipage)h(baseline)g
+(b)s(e)f(the)g(b)s(ottom)h(of)g(the)f(minipage.)40 b(Similarly)-8
+b(,)28 b(if)f(a)g(line)630 190 y(with)i(zero)h(heigh)m(t)g(and)f(zero)h
+(depth)f(is)g(added)g(just)f(b)s(efore)h FM(\\end{minipage})p
+FQ(,)d(then)j(the)h FM([b])630 303 y FQ(option)h(mak)m(es)g(the)g
+(minipage's)g(baseline)g(b)s(e)e(the)i(b)s(ottom)g(of)f(the)h
+(minipage.)771 394 y(The)42 b(command)g FM(\\par\\vspace{0pt})d
+FQ(creates)k(suc)m(h)g(a)g(zero-heigh)m(t,)k(zero-depth)c(line.)630
+486 y(Since)e(the)g(baseline)g(of)g(this)f(zero-depth)h(line)g(is)g
+(the)g(b)s(ottom)g(of)g(the)g(minipage,)j(the)d FM([b])630
+577 y FQ(option)31 b(no)m(w)f(aligns)h(the)g(b)s(ottom)g(of)f(the)h
+(minipage.)41 b(F)-8 b(or)31 b(example)p Black Black
+708 691 a FE(\\begin{center})826 782 y(\\begin{minipage}[b]{.25\\line)q
+(width)q(})944 873 y(\\centering)944 965 y
+(\\includegraphics[width=1in]{gr)q(aphi)q(c})944 1056
+y(\\par\\vspace{0pt})826 1147 y(\\end{minipage}\045)826
+1239 y(\\begin{minipage}[b]{.25\\line)q(width)q(})944
+1330 y(\\centering)944 1421 y(\\includegraphics[width=1in,ang)q(le=-)q
+(45]{g)q(raph)q(ic})944 1513 y(\\par\\vspace{0pt})826
+1604 y(\\end{minipage})708 1695 y(\\end{center})630 1831
+y FQ(pro)s(duces)e(Figure)p 0.05 1.00 1.00 0.40 TeXcolorcmyk
+31 w(5)p Black(.)p Black 1579 2524 a @beginspecial 0
+@llx 0 @lly 144 @urx 54 @ury 720 @rwi @setspecial
+%%BeginDocument: graphic.eps
+%!PS-Adobe-2.0 EPSF-2.0
+%%Title: graphic.eps
+%%Creator: fig2dev Version 3.2 Patchlevel 0-beta2
+%%CreationDate: Thu Dec 11 20:58:11 1997
+%%For: Keith Reckdahl
+%%Orientation: Portrait
+%%BoundingBox: 0 0 144 54
+%%Pages: 0
+%%BeginSetup
+%%IncludeFeature: *PageSize Letter
+%%EndSetup
+%%Magnification: 1.00
+%%EndComments
+/$F2psDict 200 dict def
+$F2psDict begin
+$F2psDict /mtrx matrix put
+/col-1 {0 setgray} bind def
+/col0 {0.000 0.000 0.000 srgb} bind def
+/col1 {0.000 0.000 1.000 srgb} bind def
+/col2 {0.000 1.000 0.000 srgb} bind def
+/col3 {0.000 1.000 1.000 srgb} bind def
+/col4 {1.000 0.000 0.000 srgb} bind def
+/col5 {1.000 0.000 1.000 srgb} bind def
+/col6 {1.000 1.000 0.000 srgb} bind def
+/col7 {1.000 1.000 1.000 srgb} bind def
+/col8 {0.000 0.000 0.560 srgb} bind def
+/col9 {0.000 0.000 0.690 srgb} bind def
+/col10 {0.000 0.000 0.820 srgb} bind def
+/col11 {0.530 0.810 1.000 srgb} bind def
+/col12 {0.000 0.560 0.000 srgb} bind def
+/col13 {0.000 0.690 0.000 srgb} bind def
+/col14 {0.000 0.820 0.000 srgb} bind def
+/col15 {0.000 0.560 0.560 srgb} bind def
+/col16 {0.000 0.690 0.690 srgb} bind def
+/col17 {0.000 0.820 0.820 srgb} bind def
+/col18 {0.560 0.000 0.000 srgb} bind def
+/col19 {0.690 0.000 0.000 srgb} bind def
+/col20 {0.820 0.000 0.000 srgb} bind def
+/col21 {0.560 0.000 0.560 srgb} bind def
+/col22 {0.690 0.000 0.690 srgb} bind def
+/col23 {0.820 0.000 0.820 srgb} bind def
+/col24 {0.500 0.190 0.000 srgb} bind def
+/col25 {0.630 0.250 0.000 srgb} bind def
+/col26 {0.750 0.380 0.000 srgb} bind def
+/col27 {1.000 0.500 0.500 srgb} bind def
+/col28 {1.000 0.630 0.630 srgb} bind def
+/col29 {1.000 0.750 0.750 srgb} bind def
+/col30 {1.000 0.880 0.880 srgb} bind def
+/col31 {1.000 0.840 0.000 srgb} bind def
+
+end
+save
+-2.0 61.0 translate
+1 -1 scale
+
+/cp {closepath} bind def
+/ef {eofill} bind def
+/gr {grestore} bind def
+/gs {gsave} bind def
+/sa {save} bind def
+/rs {restore} bind def
+/l {lineto} bind def
+/m {moveto} bind def
+/rm {rmoveto} bind def
+/n {newpath} bind def
+/s {stroke} bind def
+/sh {show} bind def
+/slc {setlinecap} bind def
+/slj {setlinejoin} bind def
+/slw {setlinewidth} bind def
+/srgb {setrgbcolor} bind def
+/rot {rotate} bind def
+/sc {scale} bind def
+/sd {setdash} bind def
+/ff {findfont} bind def
+/sf {setfont} bind def
+/scf {scalefont} bind def
+/sw {stringwidth} bind def
+/tr {translate} bind def
+/tnt {dup dup currentrgbcolor
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb}
+ bind def
+/shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul
+ 4 -2 roll mul srgb} bind def
+/$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def
+/$F2psEnd {$F2psEnteredState restore end} def
+%%EndProlog
+
+$F2psBegin
+10 setmiterlimit
+n 0 1048 m 0 0 l 2473 0 l 2473 1048 l cp clip
+ 0.06000 0.06000 sc
+% Polyline
+30.000 slw
+n 2400 975 m 75 975 l 75 150 l 2400 150 l cp gs col-1 s gr
+/Times-Bold ff 360.00 scf sf
+1220 705 m
+gs 1 -1 sc (Graphic) dup sw pop 2 div neg 0 rm col-1 sh gr
+$F2psEnd
+rs
+
+%%EndDocument
+ @endspecial 2420 2099 a
+ gsave currentpoint currentpoint translate -45 neg rotate neg exch
+neg exch translate
+ 2420 2099 a @beginspecial 0
+@llx 0 @lly 144 @urx 54 @ury 720 @rwi @setspecial
+%%BeginDocument: graphic.eps
+%!PS-Adobe-2.0 EPSF-2.0
+%%Title: graphic.eps
+%%Creator: fig2dev Version 3.2 Patchlevel 0-beta2
+%%CreationDate: Thu Dec 11 20:58:11 1997
+%%For: Keith Reckdahl
+%%Orientation: Portrait
+%%BoundingBox: 0 0 144 54
+%%Pages: 0
+%%BeginSetup
+%%IncludeFeature: *PageSize Letter
+%%EndSetup
+%%Magnification: 1.00
+%%EndComments
+/$F2psDict 200 dict def
+$F2psDict begin
+$F2psDict /mtrx matrix put
+/col-1 {0 setgray} bind def
+/col0 {0.000 0.000 0.000 srgb} bind def
+/col1 {0.000 0.000 1.000 srgb} bind def
+/col2 {0.000 1.000 0.000 srgb} bind def
+/col3 {0.000 1.000 1.000 srgb} bind def
+/col4 {1.000 0.000 0.000 srgb} bind def
+/col5 {1.000 0.000 1.000 srgb} bind def
+/col6 {1.000 1.000 0.000 srgb} bind def
+/col7 {1.000 1.000 1.000 srgb} bind def
+/col8 {0.000 0.000 0.560 srgb} bind def
+/col9 {0.000 0.000 0.690 srgb} bind def
+/col10 {0.000 0.000 0.820 srgb} bind def
+/col11 {0.530 0.810 1.000 srgb} bind def
+/col12 {0.000 0.560 0.000 srgb} bind def
+/col13 {0.000 0.690 0.000 srgb} bind def
+/col14 {0.000 0.820 0.000 srgb} bind def
+/col15 {0.000 0.560 0.560 srgb} bind def
+/col16 {0.000 0.690 0.690 srgb} bind def
+/col17 {0.000 0.820 0.820 srgb} bind def
+/col18 {0.560 0.000 0.000 srgb} bind def
+/col19 {0.690 0.000 0.000 srgb} bind def
+/col20 {0.820 0.000 0.000 srgb} bind def
+/col21 {0.560 0.000 0.560 srgb} bind def
+/col22 {0.690 0.000 0.690 srgb} bind def
+/col23 {0.820 0.000 0.820 srgb} bind def
+/col24 {0.500 0.190 0.000 srgb} bind def
+/col25 {0.630 0.250 0.000 srgb} bind def
+/col26 {0.750 0.380 0.000 srgb} bind def
+/col27 {1.000 0.500 0.500 srgb} bind def
+/col28 {1.000 0.630 0.630 srgb} bind def
+/col29 {1.000 0.750 0.750 srgb} bind def
+/col30 {1.000 0.880 0.880 srgb} bind def
+/col31 {1.000 0.840 0.000 srgb} bind def
+
+end
+save
+-2.0 61.0 translate
+1 -1 scale
+
+/cp {closepath} bind def
+/ef {eofill} bind def
+/gr {grestore} bind def
+/gs {gsave} bind def
+/sa {save} bind def
+/rs {restore} bind def
+/l {lineto} bind def
+/m {moveto} bind def
+/rm {rmoveto} bind def
+/n {newpath} bind def
+/s {stroke} bind def
+/sh {show} bind def
+/slc {setlinecap} bind def
+/slj {setlinejoin} bind def
+/slw {setlinewidth} bind def
+/srgb {setrgbcolor} bind def
+/rot {rotate} bind def
+/sc {scale} bind def
+/sd {setdash} bind def
+/ff {findfont} bind def
+/sf {setfont} bind def
+/scf {scalefont} bind def
+/sw {stringwidth} bind def
+/tr {translate} bind def
+/tnt {dup dup currentrgbcolor
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb}
+ bind def
+/shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul
+ 4 -2 roll mul srgb} bind def
+/$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def
+/$F2psEnd {$F2psEnteredState restore end} def
+%%EndProlog
+
+$F2psBegin
+10 setmiterlimit
+n 0 1048 m 0 0 l 2473 0 l 2473 1048 l cp clip
+ 0.06000 0.06000 sc
+% Polyline
+30.000 slw
+n 2400 975 m 75 975 l 75 150 l 2400 150 l cp gs col-1 s gr
+/Times-Bold ff 360.00 scf sf
+1220 705 m
+gs 1 -1 sc (Graphic) dup sw pop 2 div neg 0 rm col-1 sh gr
+$F2psEnd
+rs
+
+%%EndDocument
+ @endspecial 3020 2099 a
+ currentpoint grestore moveto
+ 3020 2099 a 1440 2719 a FQ(Figure)h(5:)p
+0 TeXcolorgray Black 42 w(Minipages)h(with)f(Bottoms)i(Aligned)p
+Black 630 3064 a FL(11.4.2)106 b(Aligning)35 b(the)g(T)-9
+b(ops)35 b(of)g(Minipages)630 3236 y FQ(When)j(a)g(zero-heigh)m(t,)43
+b(zero-depth)38 b(line)h(is)f(added)f(to)i(the)g(top)f(of)g(the)h
+(minipage,)h(the)f FM([t])630 3349 y FQ(option)33 b(mak)m(es)h(the)f
+(minipage)g(baseline)g(b)s(e)f(the)h(top)g(of)g(the)g(minipage.)48
+b(When)33 b(this)f(is)h(done)630 3462 y(with)d(m)m(ultiple)h(side-b)m
+(y-side)g(minipages,)g(the)g(tops)f(of)h(the)f(minipages)h(are)g
+(aligned.)771 3553 y(The)f(command)h FM(\\vspace{0pt})c
+FQ(inserts)j(a)i(zero-heigh)m(t,)h(zero-depth)e(line)g(at)g(the)g(top)g
+(of)630 3644 y(the)i(minipage.)48 b(Since)33 b(the)g(baseline)g(of)g
+(this)g(zero-heigh)m(t)i(line)e(is)f(the)h(top)g(of)g(the)g(minipage,)
+630 3736 y(the)e FM([t])e FQ(option)i(no)m(w)f(aligns)h(the)g(top)g(of)
+f(the)h(minipage.)41 b(F)-8 b(or)31 b(example)p Black
+Black 708 3849 a FE(\\begin{center})826 3941 y
+(\\begin{minipage}[t]{.25\\line)q(width)q(})944 4032
+y(\\vspace{0pt})944 4123 y(\\centering)944 4215 y
+(\\includegraphics[width=1in]{gr)q(aphi)q(c})826 4306
+y(\\end{minipage}\045)826 4397 y(\\begin{minipage}[t]{.25\\line)q
+(width)q(})944 4489 y(\\vspace{0pt})944 4580 y(\\centering)944
+4671 y(\\includegraphics[width=1in,ang)q(le=-)q(45]{g)q(raph)q(ic})826
+4762 y(\\end{minipage})708 4854 y(\\end{center})630 4989
+y FQ(pro)s(duces)e(Figure)p 0.05 1.00 1.00 0.40 TeXcolorcmyk
+31 w(6)p Black(.)630 5102 y(This)23 b(aligns)h(the)f(tops)h(of)g(the)f
+(minipages)h(with)f(the)h(curren)m(t)f(baseline.)39 b(If)23
+b(it)h(is)g(instead)f(desired)630 5215 y(to)37 b(align)f(the)g(tops)g
+(of)g(the)g(minipages)g(with)g(the)g(top)g(of)g(the)g(curren)m(t)f
+(line)i(of)f(text,)i(replace)630 5328 y FM(\\vspace{0pt})19
+b FQ(with)k FM(\\vspace{-\\baselineskip})p FQ(.)32 b(This)22
+b(topic)h(is)g(men)m(tioned)h(in)e([)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk(3)p Black 1 w(,)i(pages)630 5441 y(863-865].)p
+Black 2250 5640 a(37)p Black eop end
+%%Page: 38 38
+TeXDict begin 38 37 bop Black 0 TeXcolorgray Black Black
+Black 1579 -15 a @beginspecial 0 @llx 0 @lly 144 @urx
+54 @ury 720 @rwi @setspecial
+%%BeginDocument: graphic.eps
+%!PS-Adobe-2.0 EPSF-2.0
+%%Title: graphic.eps
+%%Creator: fig2dev Version 3.2 Patchlevel 0-beta2
+%%CreationDate: Thu Dec 11 20:58:11 1997
+%%For: Keith Reckdahl
+%%Orientation: Portrait
+%%BoundingBox: 0 0 144 54
+%%Pages: 0
+%%BeginSetup
+%%IncludeFeature: *PageSize Letter
+%%EndSetup
+%%Magnification: 1.00
+%%EndComments
+/$F2psDict 200 dict def
+$F2psDict begin
+$F2psDict /mtrx matrix put
+/col-1 {0 setgray} bind def
+/col0 {0.000 0.000 0.000 srgb} bind def
+/col1 {0.000 0.000 1.000 srgb} bind def
+/col2 {0.000 1.000 0.000 srgb} bind def
+/col3 {0.000 1.000 1.000 srgb} bind def
+/col4 {1.000 0.000 0.000 srgb} bind def
+/col5 {1.000 0.000 1.000 srgb} bind def
+/col6 {1.000 1.000 0.000 srgb} bind def
+/col7 {1.000 1.000 1.000 srgb} bind def
+/col8 {0.000 0.000 0.560 srgb} bind def
+/col9 {0.000 0.000 0.690 srgb} bind def
+/col10 {0.000 0.000 0.820 srgb} bind def
+/col11 {0.530 0.810 1.000 srgb} bind def
+/col12 {0.000 0.560 0.000 srgb} bind def
+/col13 {0.000 0.690 0.000 srgb} bind def
+/col14 {0.000 0.820 0.000 srgb} bind def
+/col15 {0.000 0.560 0.560 srgb} bind def
+/col16 {0.000 0.690 0.690 srgb} bind def
+/col17 {0.000 0.820 0.820 srgb} bind def
+/col18 {0.560 0.000 0.000 srgb} bind def
+/col19 {0.690 0.000 0.000 srgb} bind def
+/col20 {0.820 0.000 0.000 srgb} bind def
+/col21 {0.560 0.000 0.560 srgb} bind def
+/col22 {0.690 0.000 0.690 srgb} bind def
+/col23 {0.820 0.000 0.820 srgb} bind def
+/col24 {0.500 0.190 0.000 srgb} bind def
+/col25 {0.630 0.250 0.000 srgb} bind def
+/col26 {0.750 0.380 0.000 srgb} bind def
+/col27 {1.000 0.500 0.500 srgb} bind def
+/col28 {1.000 0.630 0.630 srgb} bind def
+/col29 {1.000 0.750 0.750 srgb} bind def
+/col30 {1.000 0.880 0.880 srgb} bind def
+/col31 {1.000 0.840 0.000 srgb} bind def
+
+end
+save
+-2.0 61.0 translate
+1 -1 scale
+
+/cp {closepath} bind def
+/ef {eofill} bind def
+/gr {grestore} bind def
+/gs {gsave} bind def
+/sa {save} bind def
+/rs {restore} bind def
+/l {lineto} bind def
+/m {moveto} bind def
+/rm {rmoveto} bind def
+/n {newpath} bind def
+/s {stroke} bind def
+/sh {show} bind def
+/slc {setlinecap} bind def
+/slj {setlinejoin} bind def
+/slw {setlinewidth} bind def
+/srgb {setrgbcolor} bind def
+/rot {rotate} bind def
+/sc {scale} bind def
+/sd {setdash} bind def
+/ff {findfont} bind def
+/sf {setfont} bind def
+/scf {scalefont} bind def
+/sw {stringwidth} bind def
+/tr {translate} bind def
+/tnt {dup dup currentrgbcolor
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb}
+ bind def
+/shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul
+ 4 -2 roll mul srgb} bind def
+/$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def
+/$F2psEnd {$F2psEnteredState restore end} def
+%%EndProlog
+
+$F2psBegin
+10 setmiterlimit
+n 0 1048 m 0 0 l 2473 0 l 2473 1048 l cp clip
+ 0.06000 0.06000 sc
+% Polyline
+30.000 slw
+n 2400 975 m 75 975 l 75 150 l 2400 150 l cp gs col-1 s gr
+/Times-Bold ff 360.00 scf sf
+1220 705 m
+gs 1 -1 sc (Graphic) dup sw pop 2 div neg 0 rm col-1 sh gr
+$F2psEnd
+rs
+
+%%EndDocument
+ @endspecial 2420 -81 a
+ gsave currentpoint currentpoint translate -45 neg rotate neg exch
+neg exch translate
+ 2420 -81 a @beginspecial 0 @llx
+0 @lly 144 @urx 54 @ury 720 @rwi @setspecial
+%%BeginDocument: graphic.eps
+%!PS-Adobe-2.0 EPSF-2.0
+%%Title: graphic.eps
+%%Creator: fig2dev Version 3.2 Patchlevel 0-beta2
+%%CreationDate: Thu Dec 11 20:58:11 1997
+%%For: Keith Reckdahl
+%%Orientation: Portrait
+%%BoundingBox: 0 0 144 54
+%%Pages: 0
+%%BeginSetup
+%%IncludeFeature: *PageSize Letter
+%%EndSetup
+%%Magnification: 1.00
+%%EndComments
+/$F2psDict 200 dict def
+$F2psDict begin
+$F2psDict /mtrx matrix put
+/col-1 {0 setgray} bind def
+/col0 {0.000 0.000 0.000 srgb} bind def
+/col1 {0.000 0.000 1.000 srgb} bind def
+/col2 {0.000 1.000 0.000 srgb} bind def
+/col3 {0.000 1.000 1.000 srgb} bind def
+/col4 {1.000 0.000 0.000 srgb} bind def
+/col5 {1.000 0.000 1.000 srgb} bind def
+/col6 {1.000 1.000 0.000 srgb} bind def
+/col7 {1.000 1.000 1.000 srgb} bind def
+/col8 {0.000 0.000 0.560 srgb} bind def
+/col9 {0.000 0.000 0.690 srgb} bind def
+/col10 {0.000 0.000 0.820 srgb} bind def
+/col11 {0.530 0.810 1.000 srgb} bind def
+/col12 {0.000 0.560 0.000 srgb} bind def
+/col13 {0.000 0.690 0.000 srgb} bind def
+/col14 {0.000 0.820 0.000 srgb} bind def
+/col15 {0.000 0.560 0.560 srgb} bind def
+/col16 {0.000 0.690 0.690 srgb} bind def
+/col17 {0.000 0.820 0.820 srgb} bind def
+/col18 {0.560 0.000 0.000 srgb} bind def
+/col19 {0.690 0.000 0.000 srgb} bind def
+/col20 {0.820 0.000 0.000 srgb} bind def
+/col21 {0.560 0.000 0.560 srgb} bind def
+/col22 {0.690 0.000 0.690 srgb} bind def
+/col23 {0.820 0.000 0.820 srgb} bind def
+/col24 {0.500 0.190 0.000 srgb} bind def
+/col25 {0.630 0.250 0.000 srgb} bind def
+/col26 {0.750 0.380 0.000 srgb} bind def
+/col27 {1.000 0.500 0.500 srgb} bind def
+/col28 {1.000 0.630 0.630 srgb} bind def
+/col29 {1.000 0.750 0.750 srgb} bind def
+/col30 {1.000 0.880 0.880 srgb} bind def
+/col31 {1.000 0.840 0.000 srgb} bind def
+
+end
+save
+-2.0 61.0 translate
+1 -1 scale
+
+/cp {closepath} bind def
+/ef {eofill} bind def
+/gr {grestore} bind def
+/gs {gsave} bind def
+/sa {save} bind def
+/rs {restore} bind def
+/l {lineto} bind def
+/m {moveto} bind def
+/rm {rmoveto} bind def
+/n {newpath} bind def
+/s {stroke} bind def
+/sh {show} bind def
+/slc {setlinecap} bind def
+/slj {setlinejoin} bind def
+/slw {setlinewidth} bind def
+/srgb {setrgbcolor} bind def
+/rot {rotate} bind def
+/sc {scale} bind def
+/sd {setdash} bind def
+/ff {findfont} bind def
+/sf {setfont} bind def
+/scf {scalefont} bind def
+/sw {stringwidth} bind def
+/tr {translate} bind def
+/tnt {dup dup currentrgbcolor
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb}
+ bind def
+/shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul
+ 4 -2 roll mul srgb} bind def
+/$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def
+/$F2psEnd {$F2psEnteredState restore end} def
+%%EndProlog
+
+$F2psBegin
+10 setmiterlimit
+n 0 1048 m 0 0 l 2473 0 l 2473 1048 l cp clip
+ 0.06000 0.06000 sc
+% Polyline
+30.000 slw
+n 2400 975 m 75 975 l 75 150 l 2400 150 l cp gs col-1 s gr
+/Times-Bold ff 360.00 scf sf
+1220 705 m
+gs 1 -1 sc (Graphic) dup sw pop 2 div neg 0 rm col-1 sh gr
+$F2psEnd
+rs
+
+%%EndDocument
+ @endspecial 3020 -81 a
+ currentpoint grestore moveto
+ 3020 -81 a 1513 514 a FQ(Figure)31
+b(6:)p 0 TeXcolorgray Black 41 w(Minipages)h(with)e(T)-8
+b(ops)30 b(Aligned)p Black 630 805 a FD(12)135 b(Ov)l(erla)l(ying)47
+b(Tw)l(o)e(Imp)t(orted)g(Graphics)630 1008 y FQ(This)35
+b(section)i(describ)s(es)e(ho)m(w)h(to)h(o)m(v)m(erla)m(y)h(t)m(w)m(o)g
+(graphics.)57 b(Note)37 b(that)g(there)f(is)g(no)g(guaran-)630
+1121 y(tee)i(that)g(the)f(top)g(graphic)g(is)g(transparen)m(t;)k(it)c
+(ma)m(y)h(ha)m(v)m(e)g(b)s(een)e(created)i(with)f(an)g(opaque)630
+1234 y(bac)m(kground)30 b(that)h(hides)f(the)h(b)s(ottom)f(graphic.)771
+1333 y(F)-8 b(or)31 b(example)1259 1300 y FP(18)1334
+1333 y FQ(,)f(the)g(\014les)g FM(left.eps)e FQ(and)h
+FM(right.eps)e FQ(con)m(tain)k(the)f(graphics)g(sho)m(wn)f(in)630
+1433 y(Figure)p 0.05 1.00 1.00 0.40 TeXcolorcmyk 31
+w(7)p Black(,)i(then)f(the)h(commands)p Black Black 804
+1574 a FN(\\makebox[0pt][l]{)o(\\i)o(ncl)o(ud)o(egr)o(ap)o(hic)o(s{)o
+(le)o(ft.)o(ep)o(s}})o(\045)804 1674 y(\\includegraphics{)o(ri)o(ght)o
+(.e)o(ps})630 1828 y FQ(o)m(v)m(erla)m(y)g(the)f(t)m(w)m(o)g(graphics,)
+f(as)h(sho)m(wn)e(in)h(Figure)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 29 w(8)p Black(.)41 b(The)28 b(graphics)h(are)g(o)m(v)m
+(erlaid)i(with)e(their)630 1941 y(reference)g(\(lo)m(w)m(er-left\))j(p)
+s(oin)m(ts)d(coinciden)m(t.)42 b(In)28 b(this)g(particular)i(example,)g
+(the)f(graphics)g(had)630 2054 y(iden)m(tical)j(natural)f(sizes)g(so)f
+(they)h(o)m(v)m(erlaid)h(p)s(erfectly)f(without)f(an)m(y)h(scaling.)42
+b(Other)30 b(pairs)g(of)630 2167 y(graphics)c(ma)m(y)i(require)e
+(scaling)h(\(b)m(y)h FM(\\includegraphics)p FQ(,)c FM(\\scalebox)p
+FQ(,)h(or)h FM(\\resizebox)p FQ(\))e(to)630 2280 y(ac)m(hiev)m(e)33
+b(the)d(desired)g(o)m(v)m(erla)m(ying.)771 2393 y(This)e(o)m(v)m(erla)m
+(ying)j(co)s(de)d(ma)m(y)h(seem)g(m)m(ysterious)f(unless)g(one)g
+(understands)f(the)h FM(\\makebox)630 2506 y FQ(command.)54
+b(The)34 b FM(\\makebox[0pt][l]{...})29 b FQ(creates)36
+b(a)g(zero-width)f(b)s(o)m(x)f(in)h(whic)m(h)f(its)i(ar-)630
+2619 y(gumen)m(t)42 b(is)f(placed.)73 b(When)41 b(a)h(width)e(is)h(sp)s
+(eci\014ed)g(\(0)h(pt)f(in)g(this)g(case\),)k(the)d(t)m(yp)s(esetting)
+630 2731 y(algorithms)32 b(allo)s(cate)i(this)e(m)m(uc)m(h)f(horizon)m
+(tal)i(space)f(regardless)g(of)g(the)g(actual)g(width)f(of)h(the)630
+2844 y(con)m(ten)m(ts.)41 b(Th)m(us,)26 b(a)g(left-justi\014ed)h
+(zero-width)f(b)s(o)m(x)g(causes)g(the)g(L)2913 2828
+y FP(A)2952 2844 y FQ(T)3003 2864 y(E)3054 2844 y(X)g(ob)5
+b(jects)26 b(follo)m(wing)i(the)630 2957 y(b)s(o)m(x)i(to)h(b)s(e)f(t)m
+(yp)s(eset)h(on)g(top)f(of)h(the)f(con)m(ten)m(ts)i(of)f(the)f(b)s(o)m
+(x.)p Black 780 3608 a @beginspecial 0 @llx 0 @lly 144
+@urx 54 @ury 1440 @rwi @setspecial
+%%BeginDocument: left.eps
+%!PS-Adobe-2.0 EPSF-2.0
+%%Title: left.eps
+%%Creator: fig2dev Version 3.2 Patchlevel 0-beta2
+%%CreationDate: Wed Dec 30 17:53:26 1998
+%%For: Keith Reckdahl
+%%Orientation: Portrait
+%%BoundingBox: 0 0 144 54
+%%Pages: 0
+%%BeginSetup
+%%IncludeFeature: *PageSize Letter
+%%EndSetup
+%%Magnification: 1.00
+%%EndComments
+/$F2psDict 200 dict def
+$F2psDict begin
+$F2psDict /mtrx matrix put
+/col-1 {0 setgray} bind def
+/col0 {0.000 0.000 0.000 srgb} bind def
+/col1 {0.000 0.000 1.000 srgb} bind def
+/col2 {0.000 1.000 0.000 srgb} bind def
+/col3 {0.000 1.000 1.000 srgb} bind def
+/col4 {1.000 0.000 0.000 srgb} bind def
+/col5 {1.000 0.000 1.000 srgb} bind def
+/col6 {1.000 1.000 0.000 srgb} bind def
+/col7 {1.000 1.000 1.000 srgb} bind def
+/col8 {0.000 0.000 0.560 srgb} bind def
+/col9 {0.000 0.000 0.690 srgb} bind def
+/col10 {0.000 0.000 0.820 srgb} bind def
+/col11 {0.530 0.810 1.000 srgb} bind def
+/col12 {0.000 0.560 0.000 srgb} bind def
+/col13 {0.000 0.690 0.000 srgb} bind def
+/col14 {0.000 0.820 0.000 srgb} bind def
+/col15 {0.000 0.560 0.560 srgb} bind def
+/col16 {0.000 0.690 0.690 srgb} bind def
+/col17 {0.000 0.820 0.820 srgb} bind def
+/col18 {0.560 0.000 0.000 srgb} bind def
+/col19 {0.690 0.000 0.000 srgb} bind def
+/col20 {0.820 0.000 0.000 srgb} bind def
+/col21 {0.560 0.000 0.560 srgb} bind def
+/col22 {0.690 0.000 0.690 srgb} bind def
+/col23 {0.820 0.000 0.820 srgb} bind def
+/col24 {0.500 0.190 0.000 srgb} bind def
+/col25 {0.630 0.250 0.000 srgb} bind def
+/col26 {0.750 0.380 0.000 srgb} bind def
+/col27 {1.000 0.500 0.500 srgb} bind def
+/col28 {1.000 0.630 0.630 srgb} bind def
+/col29 {1.000 0.750 0.750 srgb} bind def
+/col30 {1.000 0.880 0.880 srgb} bind def
+/col31 {1.000 0.840 0.000 srgb} bind def
+
+end
+save
+-2.0 61.0 translate
+1 -1 scale
+
+/cp {closepath} bind def
+/ef {eofill} bind def
+/gr {grestore} bind def
+/gs {gsave} bind def
+/sa {save} bind def
+/rs {restore} bind def
+/l {lineto} bind def
+/m {moveto} bind def
+/rm {rmoveto} bind def
+/n {newpath} bind def
+/s {stroke} bind def
+/sh {show} bind def
+/slc {setlinecap} bind def
+/slj {setlinejoin} bind def
+/slw {setlinewidth} bind def
+/srgb {setrgbcolor} bind def
+/rot {rotate} bind def
+/sc {scale} bind def
+/sd {setdash} bind def
+/ff {findfont} bind def
+/sf {setfont} bind def
+/scf {scalefont} bind def
+/sw {stringwidth} bind def
+/tr {translate} bind def
+/tnt {dup dup currentrgbcolor
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb}
+ bind def
+/shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul
+ 4 -2 roll mul srgb} bind def
+/$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def
+/$F2psEnd {$F2psEnteredState restore end} def
+%%EndProlog
+
+$F2psBegin
+10 setmiterlimit
+n 0 1048 m 0 0 l 2473 0 l 2473 1048 l cp clip
+ 0.06000 0.06000 sc
+% Polyline
+30.000 slw
+n 2400 975 m 75 975 l 75 150 l 2400 150 l cp gs col-1 s gr
+/Times-Bold ff 360.00 scf sf
+600 675 m
+gs 1 -1 sc (Left) dup sw pop 2 div neg 0 rm col-1 sh gr
+$F2psEnd
+rs
+
+%%EndDocument
+ @endspecial 937 3705 a FG(\(a\))c(Con)n(ten)n(ts)f(of)33
+b FE(left.eps)2640 3608 y @beginspecial 0 @llx 0 @lly
+144 @urx 54 @ury 1440 @rwi @setspecial
+%%BeginDocument: right.eps
+%!PS-Adobe-2.0 EPSF-2.0
+%%Title: right.eps
+%%Creator: fig2dev Version 3.2 Patchlevel 0-beta2
+%%CreationDate: Wed Dec 30 17:52:58 1998
+%%For: Keith Reckdahl
+%%Orientation: Portrait
+%%BoundingBox: 0 0 144 54
+%%Pages: 0
+%%BeginSetup
+%%IncludeFeature: *PageSize Letter
+%%EndSetup
+%%Magnification: 1.00
+%%EndComments
+/$F2psDict 200 dict def
+$F2psDict begin
+$F2psDict /mtrx matrix put
+/col-1 {0 setgray} bind def
+/col0 {0.000 0.000 0.000 srgb} bind def
+/col1 {0.000 0.000 1.000 srgb} bind def
+/col2 {0.000 1.000 0.000 srgb} bind def
+/col3 {0.000 1.000 1.000 srgb} bind def
+/col4 {1.000 0.000 0.000 srgb} bind def
+/col5 {1.000 0.000 1.000 srgb} bind def
+/col6 {1.000 1.000 0.000 srgb} bind def
+/col7 {1.000 1.000 1.000 srgb} bind def
+/col8 {0.000 0.000 0.560 srgb} bind def
+/col9 {0.000 0.000 0.690 srgb} bind def
+/col10 {0.000 0.000 0.820 srgb} bind def
+/col11 {0.530 0.810 1.000 srgb} bind def
+/col12 {0.000 0.560 0.000 srgb} bind def
+/col13 {0.000 0.690 0.000 srgb} bind def
+/col14 {0.000 0.820 0.000 srgb} bind def
+/col15 {0.000 0.560 0.560 srgb} bind def
+/col16 {0.000 0.690 0.690 srgb} bind def
+/col17 {0.000 0.820 0.820 srgb} bind def
+/col18 {0.560 0.000 0.000 srgb} bind def
+/col19 {0.690 0.000 0.000 srgb} bind def
+/col20 {0.820 0.000 0.000 srgb} bind def
+/col21 {0.560 0.000 0.560 srgb} bind def
+/col22 {0.690 0.000 0.690 srgb} bind def
+/col23 {0.820 0.000 0.820 srgb} bind def
+/col24 {0.500 0.190 0.000 srgb} bind def
+/col25 {0.630 0.250 0.000 srgb} bind def
+/col26 {0.750 0.380 0.000 srgb} bind def
+/col27 {1.000 0.500 0.500 srgb} bind def
+/col28 {1.000 0.630 0.630 srgb} bind def
+/col29 {1.000 0.750 0.750 srgb} bind def
+/col30 {1.000 0.880 0.880 srgb} bind def
+/col31 {1.000 0.840 0.000 srgb} bind def
+
+end
+save
+-2.0 61.0 translate
+1 -1 scale
+
+/cp {closepath} bind def
+/ef {eofill} bind def
+/gr {grestore} bind def
+/gs {gsave} bind def
+/sa {save} bind def
+/rs {restore} bind def
+/l {lineto} bind def
+/m {moveto} bind def
+/rm {rmoveto} bind def
+/n {newpath} bind def
+/s {stroke} bind def
+/sh {show} bind def
+/slc {setlinecap} bind def
+/slj {setlinejoin} bind def
+/slw {setlinewidth} bind def
+/srgb {setrgbcolor} bind def
+/rot {rotate} bind def
+/sc {scale} bind def
+/sd {setdash} bind def
+/ff {findfont} bind def
+/sf {setfont} bind def
+/scf {scalefont} bind def
+/sw {stringwidth} bind def
+/tr {translate} bind def
+/tnt {dup dup currentrgbcolor
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb}
+ bind def
+/shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul
+ 4 -2 roll mul srgb} bind def
+/$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def
+/$F2psEnd {$F2psEnteredState restore end} def
+%%EndProlog
+
+$F2psBegin
+10 setmiterlimit
+n 0 1048 m 0 0 l 2473 0 l 2473 1048 l cp clip
+ 0.06000 0.06000 sc
+% Polyline
+30.000 slw
+n 2400 975 m 75 975 l 75 150 l 2400 150 l cp gs col-1 s gr
+/Times-Bold ff 360.00 scf sf
+1725 675 m
+gs 1 -1 sc (Right) dup sw pop 2 div neg 0 rm col-1 sh gr
+$F2psEnd
+rs
+
+%%EndDocument
+ @endspecial 2776 3705 a FG(\(b\))25 b(Con)n(ten)n(ts)g(of)33
+b FE(right.eps)1566 3902 y FQ(Figure)e(7:)p 0 TeXcolorgray
+Black 41 w(Con)m(ten)m(ts)h(of)e(Graphics)g(Files)p Black
+Black 1695 4586 a @beginspecial 0 @llx 0 @lly 144 @urx
+54 @ury 1440 @rwi @setspecial
+%%BeginDocument: left.eps
+%!PS-Adobe-2.0 EPSF-2.0
+%%Title: left.eps
+%%Creator: fig2dev Version 3.2 Patchlevel 0-beta2
+%%CreationDate: Wed Dec 30 17:53:26 1998
+%%For: Keith Reckdahl
+%%Orientation: Portrait
+%%BoundingBox: 0 0 144 54
+%%Pages: 0
+%%BeginSetup
+%%IncludeFeature: *PageSize Letter
+%%EndSetup
+%%Magnification: 1.00
+%%EndComments
+/$F2psDict 200 dict def
+$F2psDict begin
+$F2psDict /mtrx matrix put
+/col-1 {0 setgray} bind def
+/col0 {0.000 0.000 0.000 srgb} bind def
+/col1 {0.000 0.000 1.000 srgb} bind def
+/col2 {0.000 1.000 0.000 srgb} bind def
+/col3 {0.000 1.000 1.000 srgb} bind def
+/col4 {1.000 0.000 0.000 srgb} bind def
+/col5 {1.000 0.000 1.000 srgb} bind def
+/col6 {1.000 1.000 0.000 srgb} bind def
+/col7 {1.000 1.000 1.000 srgb} bind def
+/col8 {0.000 0.000 0.560 srgb} bind def
+/col9 {0.000 0.000 0.690 srgb} bind def
+/col10 {0.000 0.000 0.820 srgb} bind def
+/col11 {0.530 0.810 1.000 srgb} bind def
+/col12 {0.000 0.560 0.000 srgb} bind def
+/col13 {0.000 0.690 0.000 srgb} bind def
+/col14 {0.000 0.820 0.000 srgb} bind def
+/col15 {0.000 0.560 0.560 srgb} bind def
+/col16 {0.000 0.690 0.690 srgb} bind def
+/col17 {0.000 0.820 0.820 srgb} bind def
+/col18 {0.560 0.000 0.000 srgb} bind def
+/col19 {0.690 0.000 0.000 srgb} bind def
+/col20 {0.820 0.000 0.000 srgb} bind def
+/col21 {0.560 0.000 0.560 srgb} bind def
+/col22 {0.690 0.000 0.690 srgb} bind def
+/col23 {0.820 0.000 0.820 srgb} bind def
+/col24 {0.500 0.190 0.000 srgb} bind def
+/col25 {0.630 0.250 0.000 srgb} bind def
+/col26 {0.750 0.380 0.000 srgb} bind def
+/col27 {1.000 0.500 0.500 srgb} bind def
+/col28 {1.000 0.630 0.630 srgb} bind def
+/col29 {1.000 0.750 0.750 srgb} bind def
+/col30 {1.000 0.880 0.880 srgb} bind def
+/col31 {1.000 0.840 0.000 srgb} bind def
+
+end
+save
+-2.0 61.0 translate
+1 -1 scale
+
+/cp {closepath} bind def
+/ef {eofill} bind def
+/gr {grestore} bind def
+/gs {gsave} bind def
+/sa {save} bind def
+/rs {restore} bind def
+/l {lineto} bind def
+/m {moveto} bind def
+/rm {rmoveto} bind def
+/n {newpath} bind def
+/s {stroke} bind def
+/sh {show} bind def
+/slc {setlinecap} bind def
+/slj {setlinejoin} bind def
+/slw {setlinewidth} bind def
+/srgb {setrgbcolor} bind def
+/rot {rotate} bind def
+/sc {scale} bind def
+/sd {setdash} bind def
+/ff {findfont} bind def
+/sf {setfont} bind def
+/scf {scalefont} bind def
+/sw {stringwidth} bind def
+/tr {translate} bind def
+/tnt {dup dup currentrgbcolor
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb}
+ bind def
+/shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul
+ 4 -2 roll mul srgb} bind def
+/$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def
+/$F2psEnd {$F2psEnteredState restore end} def
+%%EndProlog
+
+$F2psBegin
+10 setmiterlimit
+n 0 1048 m 0 0 l 2473 0 l 2473 1048 l cp clip
+ 0.06000 0.06000 sc
+% Polyline
+30.000 slw
+n 2400 975 m 75 975 l 75 150 l 2400 150 l cp gs col-1 s gr
+/Times-Bold ff 360.00 scf sf
+600 675 m
+gs 1 -1 sc (Left) dup sw pop 2 div neg 0 rm col-1 sh gr
+$F2psEnd
+rs
+
+%%EndDocument
+ @endspecial @beginspecial 0 @llx 0 @lly 144 @urx 54
+@ury 1440 @rwi @setspecial
+%%BeginDocument: right.eps
+%!PS-Adobe-2.0 EPSF-2.0
+%%Title: right.eps
+%%Creator: fig2dev Version 3.2 Patchlevel 0-beta2
+%%CreationDate: Wed Dec 30 17:52:58 1998
+%%For: Keith Reckdahl
+%%Orientation: Portrait
+%%BoundingBox: 0 0 144 54
+%%Pages: 0
+%%BeginSetup
+%%IncludeFeature: *PageSize Letter
+%%EndSetup
+%%Magnification: 1.00
+%%EndComments
+/$F2psDict 200 dict def
+$F2psDict begin
+$F2psDict /mtrx matrix put
+/col-1 {0 setgray} bind def
+/col0 {0.000 0.000 0.000 srgb} bind def
+/col1 {0.000 0.000 1.000 srgb} bind def
+/col2 {0.000 1.000 0.000 srgb} bind def
+/col3 {0.000 1.000 1.000 srgb} bind def
+/col4 {1.000 0.000 0.000 srgb} bind def
+/col5 {1.000 0.000 1.000 srgb} bind def
+/col6 {1.000 1.000 0.000 srgb} bind def
+/col7 {1.000 1.000 1.000 srgb} bind def
+/col8 {0.000 0.000 0.560 srgb} bind def
+/col9 {0.000 0.000 0.690 srgb} bind def
+/col10 {0.000 0.000 0.820 srgb} bind def
+/col11 {0.530 0.810 1.000 srgb} bind def
+/col12 {0.000 0.560 0.000 srgb} bind def
+/col13 {0.000 0.690 0.000 srgb} bind def
+/col14 {0.000 0.820 0.000 srgb} bind def
+/col15 {0.000 0.560 0.560 srgb} bind def
+/col16 {0.000 0.690 0.690 srgb} bind def
+/col17 {0.000 0.820 0.820 srgb} bind def
+/col18 {0.560 0.000 0.000 srgb} bind def
+/col19 {0.690 0.000 0.000 srgb} bind def
+/col20 {0.820 0.000 0.000 srgb} bind def
+/col21 {0.560 0.000 0.560 srgb} bind def
+/col22 {0.690 0.000 0.690 srgb} bind def
+/col23 {0.820 0.000 0.820 srgb} bind def
+/col24 {0.500 0.190 0.000 srgb} bind def
+/col25 {0.630 0.250 0.000 srgb} bind def
+/col26 {0.750 0.380 0.000 srgb} bind def
+/col27 {1.000 0.500 0.500 srgb} bind def
+/col28 {1.000 0.630 0.630 srgb} bind def
+/col29 {1.000 0.750 0.750 srgb} bind def
+/col30 {1.000 0.880 0.880 srgb} bind def
+/col31 {1.000 0.840 0.000 srgb} bind def
+
+end
+save
+-2.0 61.0 translate
+1 -1 scale
+
+/cp {closepath} bind def
+/ef {eofill} bind def
+/gr {grestore} bind def
+/gs {gsave} bind def
+/sa {save} bind def
+/rs {restore} bind def
+/l {lineto} bind def
+/m {moveto} bind def
+/rm {rmoveto} bind def
+/n {newpath} bind def
+/s {stroke} bind def
+/sh {show} bind def
+/slc {setlinecap} bind def
+/slj {setlinejoin} bind def
+/slw {setlinewidth} bind def
+/srgb {setrgbcolor} bind def
+/rot {rotate} bind def
+/sc {scale} bind def
+/sd {setdash} bind def
+/ff {findfont} bind def
+/sf {setfont} bind def
+/scf {scalefont} bind def
+/sw {stringwidth} bind def
+/tr {translate} bind def
+/tnt {dup dup currentrgbcolor
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb}
+ bind def
+/shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul
+ 4 -2 roll mul srgb} bind def
+/$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def
+/$F2psEnd {$F2psEnteredState restore end} def
+%%EndProlog
+
+$F2psBegin
+10 setmiterlimit
+n 0 1048 m 0 0 l 2473 0 l 2473 1048 l cp clip
+ 0.06000 0.06000 sc
+% Polyline
+30.000 slw
+n 2400 975 m 75 975 l 75 150 l 2400 150 l cp gs col-1 s gr
+/Times-Bold ff 360.00 scf sf
+1725 675 m
+gs 1 -1 sc (Right) dup sw pop 2 div neg 0 rm col-1 sh gr
+$F2psEnd
+rs
+
+%%EndDocument
+ @endspecial 1659 4782 a(Figure)h(8:)p 0 TeXcolorgray
+Black 41 w(Tw)m(o)f(o)m(v)m(erlaid)i(graphics)p Black
+Black 630 4993 1332 4 v 703 5083 a FF(18)768 5114 y FG(Although)g(this)
+h(example)g(o)n(v)n(erla)n(ys)g(t)n(w)n(o)g FJ(eps)e
+FG(\014les,)k(similar)f(co)r(de)f(can)g(b)r(e)f(used)h(for)g(o)n(v)n
+(erla)n(ying)g(other)630 5206 y(graphic)26 b(formats.)p
+Black Black 2250 5640 a FQ(38)p Black eop end
+%%Page: 39 39
+TeXDict begin 39 38 bop Black 0 TeXcolorgray Black Black
+630 -149 a FB(12.1)112 b(Ov)m(erpic)38 b(P)m(ac)m(k)-6
+b(age)630 23 y FQ(Another)32 b(metho)s(d)g(for)g(o)m(v)m(erla)m(ying)i
+(graphics)f(is)f(the)g FO(overpic)h FQ(pac)m(k)-5 b(age,)35
+b(whic)m(h)d(de\014nes)f(a)i(pic-)630 136 y(ture)f(en)m(vironmen)m(t)h
+(whic)m(h)f(is)g(the)g(size)h(of)g(the)f(included)g(graphic.)46
+b(See)32 b(the)h FO(overpic)g FQ(pac)m(k)-5 b(age)630
+249 y(do)s(cumen)m(tation)31 b([)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk(27)p Black 1 w(])g(for)f(details.)630 534
+y FD(13)135 b(Using)46 b(Sub)t(directories)630 724 y
+FQ(When)37 b(imp)s(orting)f(a)h(large)h(n)m(um)m(b)s(er)e(of)h
+(graphics)f(\014les,)j(it)e(ma)m(y)h(b)s(e)e(desirable)h(to)g(store)h
+(the)630 823 y(graphics)33 b(\014les)g(in)f(a)h(sub)s(directory)-8
+b(.)48 b(F)-8 b(or)33 b(example,)i(when)d(the)h(sub)s(directory)e(is)i
+(named)g FM(sub)p FQ(,)630 923 y(one)c(ma)m(y)g(b)s(e)f(tempted)h(to)g
+(then)g(include)f(the)h(\014le)g FM(file.eps)d FQ(with)j(the)f(follo)m
+(wing)j(command)p Black Black 804 1057 a FN(\\includegraphics{)o(su)o
+(b/f)o(il)o(e.e)o(ps)o(})630 1205 y FQ(While)21 b(this)g(syn)m(tax)g(w)
+m(orks)g(for)f(most)h(Unix)g(and)f FJ(dos)h FQ(T)2548
+1224 y(E)2598 1205 y(X)g(distributions,)h(there)f(are)g(problems)630
+1318 y(with)30 b(suc)m(h)g(usage)p Black 630 1498 a FL(Ine\016ciency)p
+Black 857 1647 a FQ(Whenev)m(er)45 b(T)1349 1667 y(E)1399
+1647 y(X)g(op)s(ens)f(a)h(\014le,)j(the)d(\014lename)g(is)f(sa)m(v)m
+(ed)i(in)e(T)3141 1667 y(E)3191 1647 y(X)h(memory)-8
+b(.)83 b(When)857 1760 y(op)s(ening)22 b(a)g(large)i(n)m(um)m(b)s(er)c
+(of)j(\014les,)h(this)e(lost)h(memory)f(ma)m(y)g(cause)h(a)g(p)s(o)s
+(olsize)f(error)g(\(see)857 1873 y(Section)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 39 w(13.4)p Black 39 w(on)37 b(page)p
+0.05 1.00 1.00 0.40 TeXcolorcmyk 39 w(41)p Black(\).)63
+b(Since)38 b(explicitly)h(sp)s(ecifying)e(sub)s(directories)g
+(increases)857 1986 y(the)31 b(\014lename)f(length,)h(it)g(aggra)m(v)-5
+b(ates)34 b(this)c(p)s(o)s(ol)g(space)h(problem.)p Black
+630 2171 a FL(Unp)s(ortabilit)m(y)p Black 857 2320 a
+FQ(One)g(of)g(L)1178 2303 y FP(A)1217 2320 y FQ(T)1268
+2339 y(E)1318 2320 y(X's)h(adv)-5 b(an)m(tages)33 b(is)e(that)g(its)h
+(\014les)f(can)g(b)s(e)f(used)h(on)g(an)m(y)g(platform.)43
+b(Ho)m(w-)857 2433 y(ev)m(er,)37 b(em)m(b)s(edding)d(the)g(sub)s
+(directory)g(in)g(the)h(\014lename)g(results)f(in)g(the)h(\014le)g(b)s
+(ecoming)857 2546 y(op)s(erating-system)23 b(dep)s(enden)m(t.)37
+b(The)21 b(\014le)g(no)m(w)h(cannot)g(b)s(e)f(used)g(on)g
+FJ(vms)h FQ(or)f(Macin)m(tosh)857 2658 y(computers)30
+b(without)h(signi\014can)m(t)g(mo)s(di\014cation.)630
+2839 y(Instead)f(of)h(em)m(b)s(edding)e(the)i(sub)s(directory)e(in)h
+(the)h(\014lename,)g(there)f(are)h(t)m(w)m(o)h(other)e(options)p
+Black 741 2982 a(1.)p Black 46 w(The)21 b(b)s(est)f(metho)s(d)g(is)h
+(to)g(mo)s(dify)f(the)h(T)2218 3002 y(E)2268 2982 y(X)g(searc)m(h)g
+(path)g(\(see)h(Section)p 0.05 1.00 1.00 0.40 TeXcolorcmyk
+21 w(13.1)p Black 22 w(on)f(page)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 21 w(39)p Black(\).)p Black 741 3131 a(2.)p
+Black 46 w(Another)40 b(metho)s(d)e(is)i(to)g(sp)s(ecify)g
+FM(sub/)e FQ(in)h(a)h FM(\\graphicspath)c FQ(command)j(\(see)h(Sec-)857
+3244 y(tion)p 0.05 1.00 1.00 0.40 TeXcolorcmyk 33
+w(13.3)p Black 33 w(on)32 b(page)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 32 w(40)p Black(\).)47 b(Ho)m(w)m(ev)m(er,)34
+b(this)e(is)g(m)m(uc)m(h)g(less)g(e\016cien)m(t)h(than)f(mo)s(difying)f
+(the)857 3357 y(T)908 3376 y(E)958 3357 y(X)g(searc)m(h)g(path.)630
+3486 y(Both)c(of)f(these)g(options)g(causing)i FM(\\includegraphics)21
+b FQ(to)27 b(automatically)i(searc)m(h)d(the)g(graph-)630
+3586 y(ics)31 b(sub)s(directory)-8 b(,)30 b(allo)m(wing)p
+Black Black 892 3720 a FN(\\includegraphic)o(s{)o(sub)o(/f)o(ile)o(.e)o
+(ps})630 3854 y FQ(to)h(b)s(e)f(replaced)h(with)p Black
+Black 892 3989 a FN(\\includegraphic)o(s{)o(fil)o(e.)o(eps)o(})630
+4266 y FB(13.1)112 b(T)1000 4288 y(E)1060 4266 y(X)37
+b(Searc)m(h)h(P)m(ath)630 4437 y FQ(Since)f(the)g(metho)s(d)f(for)h(c)m
+(hanging)h(the)f(directories)h(in)f(whic)m(h)f(T)2948
+4457 y(E)2998 4437 y(X)h(lo)s(oks)h(dep)s(ends)d(on)i(the)630
+4550 y(T)681 4570 y(E)731 4550 y(X)32 b(distribution,)g(it)h(b)s
+(ecomes)g(v)m(ery)f(complicated)i(to)f(pro)m(vide)f(a)h(general)g
+(description.)46 b(As)630 4663 y(an)36 b(example,)i(this)e(section)h
+(describ)s(e)f(the)g(strategy)h(used)e(b)m(y)h(the)h(w)m(eb2c/teT)-8
+b(eX)38 b(Unix)e(dis-)630 4776 y(tributions.)41 b(Although)31
+b(the)g(metho)s(d)f(for)g(c)m(hanging)i(the)f(searc)m(h)g(path)f
+(di\013ers)h(for)f(other)h(T)3842 4795 y(E)3892 4776
+y(X)630 4889 y(distributions,)f(most)h(emplo)m(y)g(similar)f
+(strategies.)771 4988 y(F)-8 b(or)39 b(w)m(eb2c/teT)-8
+b(eX)41 b(Unix)d(distributions,)h(the)f(T)2519 5008 y(E)2569
+4988 y(X)h(searc)m(h)f(path)g(can)h(b)s(e)e(mo)s(di\014ed)g(b)m(y)630
+5088 y(setting)31 b(the)g FM(TEXINPUTS)d FQ(en)m(vironmen)m(t)j(v)-5
+b(ariable.)41 b(When)31 b(using)g FM(csh)e FQ(shells,)p
+Black Black 761 5222 a FN(setenv)41 b(TEXINPUTS)f(/dir1:/dir2:)630
+5357 y FQ(causes)34 b FM(/dir1)d FQ(and)i FM(/dir2)e
+FQ(to)j(b)s(e)f(searc)m(hed)g Fy(b)-5 b(efor)g(e)41 b
+FQ(the)34 b(default)f(directories.)50 b(Without)34 b(the)630
+5456 y(trailing)d(colon,)h(the)f(default)f(directories)i(are)e(not)h(b)
+s(e)f(searc)m(hed.)41 b(Setting)32 b FM(TEXINPUTS)c FQ(with)p
+Black 2250 5640 a(39)p Black eop end
+%%Page: 40 40
+TeXDict begin 40 39 bop Black 0 TeXcolorgray Black Black
+Black Black 761 -149 a FN(setenv)41 b(TEXINPUTS)f(:/dir1:/dir2)630
+-11 y FQ(causes)31 b FM(/dir1)e FQ(and)g FM(/dir2)g FQ(to)j(b)s(e)d
+(searc)m(hed)i Fy(after)41 b FQ(the)31 b(default)f(directories,)i
+(while)p Black Black 761 127 a FN(setenv)41 b(TEXINPUTS)f(/dir1::/dir2)
+630 278 y FQ(causes)30 b FM(/dir1)f FQ(to)i(b)s(e)e(searc)m(hed)i
+Fy(b)-5 b(efor)g(e)37 b FQ(the)30 b(default)g(directories)h(and)f
+FM(/dir2)e FQ(to)j(b)s(e)e(searc)m(hed)630 391 y Fy(after)41
+b FQ(the)30 b(default)h(directories.)771 490 y(Putting)36
+b FM(//)e FQ(after)i(a)f(directory)g(causes)g(all)g(of)g(its)g(sub)s
+(directories)g(to)g(b)s(e)f(searc)m(hed.)54 b(F)-8 b(or)630
+590 y(example,)p Black Black 761 728 a FN(setenv)41 b(TEXINPUTS)f
+(/dir1//:/dir2:)630 879 y FQ(causes)c(all)h(the)f(sub)s(directories)g
+(\(and)f(sub-sub)s(directories\))g(of)44 b FM(/dir1)34
+b FQ(to)j(b)s(e)e(searc)m(hed.)58 b(Be)630 992 y(careful)29
+b(in)f(using)h FM(//)f FQ(as)g(it)h(ma)m(y)g(slo)m(w)g(do)m(wn)f(the)g
+(searc)m(hing)i(if)e(the)g(directory)h(con)m(tains)h(man)m(y)630
+1104 y(\014les.)630 1287 y(These)g(examples)h(also)g(w)m(ork)g(for)f
+FM(sh)g FQ(shells,)g(although)h(the)g(syn)m(tax)g(should)e(b)s(e)h(c)m
+(hanged)h(to)p Black Black 804 1425 a FN(TEXINPUTS="/dir1:)o(/d)o(ir2)o
+(:")o(;)38 b(export)j(TEXINPUTS)630 1659 y FQ(When)34
+b(L)923 1642 y FP(A)962 1659 y FQ(T)1013 1678 y(E)1064
+1659 y(X)h(\014nds)e(\014les)h(on)h(the)g(T)1918 1678
+y(E)1968 1659 y(X)f(path,)i(it)f(do)s(es)g(not)f(include)h(the)g(en)m
+(tire)g(\014lename)g(in)630 1772 y(the)28 b FJ(d)n(vi)h
+FQ(\014le.)40 b(As)28 b(a)g(result,)h(old)f(v)m(ersions)h(of)35
+b FM(dvips)27 b FQ(or)h FM(xdvi)f FQ(whic)m(h)g(do)h(not)h(searc)m(h)g
+(the)f(T)3842 1791 y(E)3892 1772 y(X)630 1885 y(path)i(cannot)h(\014nd)
+e(the)h(\014le)h(\(see)g(Section)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 31 w(14.4)p Black 32 w(on)g(page)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 31 w(44)p Black(\).)630 2127 y FB(13.2)112
+b(T)-9 b(emp)s(orarily)39 b(Changing)g(the)e(T)2337 2150
+y(E)2397 2127 y(X)g(Searc)m(h)h(P)m(ath)630 2299 y FQ(This)22
+b(section)i(describ)s(es)f(ho)m(w)g(a)g(Unix)g(shell)g(script)g(can)g
+(temp)s(orarily)g(c)m(hange)h(the)g(T)3559 2319 y(E)3609
+2299 y(X)f(Searc)m(h)630 2412 y(P)m(ath)29 b(in)e(order)h(to)g(\014nd)f
+(pro)5 b(ject-sp)s(eci\014c)28 b(graphics)g(\014les.)40
+b(Users)28 b(can)g(then)g(construct)g(a)g(sepa-)630 2525
+y(rate)i(shell)g(script)g(for)g(eac)m(h)g(of)g(their)g(pro)5
+b(jects,)30 b(with)g(eac)m(h)h(script)e(sp)s(ecifying)h(the)g
+(directories)630 2638 y(that)h(are)g(unique)e(to)i(those)g(pro)5
+b(jects.)771 2737 y(F)-8 b(or)40 b(example,)j(supp)s(ose)38
+b(a)h(user)g(is)g(writing)h(a)g(journal)e(pap)s(er)h(and)f(w)m(an)m(ts)
+j(to)f(create)h(a)630 2837 y(unix)23 b(shell)i(script)e
+FM(latex)p 1522 2837 29 4 v 33 w(paper)g FQ(that)i(replaces)g(the)f
+FM(latex)f FQ(command.)38 b(Create)25 b(a)f(\014le)g(named)630
+2937 y FM(latex)p 876 2937 V 33 w(paper)29 b FQ(on)h(the)h(Unix)f
+(searc)m(h)h(path)f(con)m(taining)p Black Black 848 3074
+a FN(#!/bin/sh)848 3174 y(TEXINPUTS=)39 b(~/PAPER/SUB1/:~/P)o(APE)o(R/)
+o(SU)o(B2/)o(:$)o(TEX)o(IN)o(PU)o(TS)e(latex)42 b($@)630
+3312 y FQ(Mak)m(e)32 b(the)f(\014le)f(executable)i(with)p
+Black Black 848 3449 a FN(chmod)41 b(u+x)i(latex_paper)630
+3587 y FQ(Once)30 b(this)h(is)f(done,)g(t)m(yping)p Black
+Black 848 3725 a FN(latex_paper)39 b(file.tex)630 3876
+y FQ(adds)34 b FM(~/PAPER/SUB1/:~/PAPER/S)o(UB2/)28 b
+FQ(to)35 b(the)f(b)s(eginning)g(of)42 b FM(TEXINPUTS)31
+b FQ(b)s(efore)j FM(latex)630 3989 y(file.tex)d FQ(is)i(run,)g(allo)m
+(wing)i(L)1718 3972 y FP(A)1757 3989 y FQ(T)1808 4008
+y(E)1858 3989 y(X)f(to)f(\014nd)f(an)m(y)i(graphics)f(stored)g(in)g
+(the)h FM(~/PAPER/SUB1/)630 4102 y FQ(or)c FM(~/PAPER/SUB2/)d
+FQ(sub)s(directories.)771 4215 y(A)36 b(similar)h(script)f(called)h
+FM(dvips)p 1948 4215 V 33 w(paper)d FQ(w)m(ould)i(also)h(need)f(to)h(b)
+s(e)e(written)h(in)g(order)f(for)630 4328 y FM(dvips)29
+b FQ(to)i(\014nd)e(the)h(graphics)h(during)f FJ(d)n(vi)p
+FQ(-to-)p FJ(ps)h FQ(con)m(v)m(ersion.)630 4570 y FB(13.3)112
+b(Graphics)39 b(Searc)m(h)f(P)m(ath)630 4729 y FQ(By)c(default,)h(L)
+1135 4712 y FP(A)1174 4729 y FQ(T)1225 4748 y(E)1276
+4729 y(X)f(lo)s(oks)g(for)g(graphics)g(\014les)f(in)h(an)m(y)g
+(directory)h(on)e(the)h(T)3321 4748 y(E)3371 4729 y(X)g(searc)m(h)h
+(path.)630 4828 y(In)f(addition)g(to)h(these)g(directories,)i(L)1957
+4812 y FP(A)1996 4828 y FQ(T)2047 4848 y(E)2097 4828
+y(X)e(also)g(lo)s(oks)g(in)f(an)m(y)h(directories)g(sp)s(eci\014ed)f
+(in)g(the)630 4928 y FM(\\graphicspath)27 b FQ(command.)40
+b(F)-8 b(or)31 b(example,)p Black Black 848 5066 a FN
+(\\graphicspath{{d)o(ir)o(1/})o({d)o(ir2)o(/})o(})630
+5203 y FQ(tells)36 b(L)851 5187 y FP(A)890 5203 y FQ(T)941
+5223 y(E)991 5203 y(X)f(to)h(also)f(lo)s(ok)h(for)e(graphics)h(\014les)
+g(in)g FM(dir1/)e FQ(and)h FM(dir2/)p FQ(.)53 b(F)-8
+b(or)35 b(Macin)m(tosh,)j(this)630 5303 y(b)s(ecomes)p
+Black Black 848 5441 a FN(\\graphicspath{{d)o(ir)o(1:})o({d)o(ir2)o(:})
+o(})p Black 2250 5640 a FQ(40)p Black eop end
+%%Page: 41 41
+TeXDict begin 41 40 bop Black 0 TeXcolorgray Black Black
+630 -149 a FQ(It)29 b(is)h(imp)s(ortan)m(t)f(to)h(note)g(that)f(the)h
+(\014le-searc)m(hing)g(asso)s(ciated)h(with)e FM(\\graphicspath)d
+FQ(direc-)630 -36 y(tories)i(is)f(m)m(uc)m(h)g(slo)m(w)m(er)h(than)e
+(that)i(asso)s(ciated)g(with)f FM(TEXINPUTS)d FQ(directories.)41
+b(F)-8 b(urthermore,)630 77 y(eac)m(h)33 b(\014le)f(searc)m(h)h(done)f
+(in)f(a)h FM(\\graphicspath)d FQ(directory)j(consumes)g(additional)h(p)
+s(o)s(ol)e(space)630 190 y(\(see)g(Section)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 32 w(13.4)p Black 31 w(on)g(page)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 31 w(41)p Black(\).)771 303 y(Due)36 b(to)h(these)f
+(ine\016ciencies,)j(use)d(of)43 b FM(\\graphicspath)32
+b FQ(is)k(generally)h(discouraged.)57 b(In-)630 416 y(stead,)28
+b(it)e(is)g(usually)g(b)s(etter)g(to)h(sp)s(ecify)e(sub)s(directories)h
+(b)m(y)g(mo)s(difying)f(the)h(T)3362 435 y(E)3412 416
+y(X)h(searc)m(h)f(path)630 529 y(\(see)31 b(Section)p
+0.05 1.00 1.00 0.40 TeXcolorcmyk 32 w(13.1)p Black
+31 w(on)g(page)p 0.05 1.00 1.00 0.40 TeXcolorcmyk
+31 w(39)p Black(\).)630 772 y FB(13.4)112 b(Conserving)39
+b(P)m(o)s(ol)e(Space)630 931 y FQ(T)681 950 y(E)731 931
+y(X)j(reserv)m(es)g(a)h(p)s(ortion)e(of)h(its)h(memory)e(called)j
+Fy(p)-5 b(o)g(ol)43 b(sp)-5 b(ac)g(e)48 b FQ(for)40 b(its)g(in)m
+(ternal)h(passing)f(of)630 1030 y(strings.)75 b(Whenev)m(er)43
+b(T)1484 1050 y(E)1534 1030 y(X)f(op)s(ens)f(a)h(\014le)g(\(or)g(tries)
+h(to)f(op)s(en)g(a)g(\014le\),)k(some)c(p)s(o)s(ol)f(space)i(is)630
+1130 y(p)s(ermanen)m(tly)d(used.)71 b(When)40 b(op)s(ening)g(a)h(large)
+h(n)m(um)m(b)s(er)d(of)i(\014les,)i(this)d(lost)i(memory)e(ma)m(y)630
+1229 y(cause)31 b(T)924 1249 y(E)974 1229 y(X)f(to)i(run)c(out)j(of)g
+(p)s(o)s(ol)f(space,)h(causing)g(an)f(error)g(similar)h(to)p
+Black Black 804 1371 a FN(!)44 b(TeX)e(capacity)e(exceeded,)g(sorry)i
+([poolsize=72288)o(])630 1525 y FQ(Since)i(the)h(amoun)m(t)g(of)f(lost)
+h(p)s(o)s(ol)f(space)h(is)g(a)g(function)f(of)g(the)h(length)f(of)h
+(the)f(\014lename,)630 1638 y(sp)s(ecifying)30 b(sub)s(directories)g
+(aggra)m(v)-5 b(ates)33 b(this)d(p)s(o)s(ol)h(space)f(problem.)771
+1751 y(With)21 b(the)g(exception)h(of)f(the)f(latest)j(w)m(eb2c)e(v)m
+(ersion)g(and)f(some)h(commercial)h(distributions,)630
+1864 y(the)k(only)f(w)m(a)m(y)i(to)f(increase)g(the)g(p)s(o)s(ol)f
+(size)h(is)f(to)i(recompile)f(T)2765 1883 y(E)2815 1864
+y(X.)39 b(F)-8 b(ortunately)g(,)29 b(the)c(follo)m(wing)630
+1977 y(p)s(o)s(ol-conserv)-5 b(ation)32 b(rules)d(usually)i(solv)m(e)g
+(the)g(problem.)p Black 767 2119 a FK(\210)p Black 45
+w FQ(Av)m(oid)g(excessiv)m(ely-long)j(\014le)c(names.)p
+Black 767 2256 a FK(\210)p Black 45 w FQ(Don't)i(include)e(the)g(sub)s
+(directory)g(names)p Black Black 1162 2390 a FN(\\includegraphics{)o
+(sub)o(/f)o(il)o(e.e)o(ps)o(})857 2537 y FQ(Instead,)g(c)m(hange)h(the)
+f(T)1710 2557 y(E)1760 2537 y(X)g(searc)m(h)g(path)f(or)h(mo)m(v)m(e)h
+(the)f(\014les)g(out)g(of)f(the)h(sub)s(directory)-8
+b(.)p Black 767 2674 a FK(\210)p Black 45 w FQ(Don't)32
+b(use)e(the)g FM(\\graphicspath)d FQ(command.)p Black
+Black 1119 2808 a FN(\\graphicspath{{d)o(ir)o(1/})o({d)o(ir)o(2/})o(})
+1119 2907 y(...)1119 3007 y(\\includegraphics)o({f)o(ile)o(.e)o(ps)o(})
+857 3141 y FQ(causes)k FM(\\includegraphics)26 b FQ(to)31
+b(try)f(to)h(op)s(en)f(the)h(follo)m(wing)h(\014les)p
+Black Black 1380 3274 a FN(file.eps)1380 3374 y(dir1/file.eps)1380
+3474 y(dir2/file.eps)857 3620 y FQ(Eac)m(h)27 b(of)f(these)h(attempts)g
+(consumes)f(p)s(o)s(ol)g(space.)40 b(Instead)26 b(of)g(using)h
+FM(\\graphicspath)p FQ(,)857 3733 y(mo)s(dify)j(the)g(T)1370
+3753 y(E)1420 3733 y(X)h(searc)m(h)g(path.)p Black 767
+3870 a FK(\210)p Black 45 w FQ(Sp)s(ecify)g(the)h(en)m(tire)h
+(\014lename,)g(do)e(not)h(omit)h(the)f(\014les)f(extension/su\016x)h
+(\(e.g.,)i FM(.eps)p FQ(\).)857 3970 y(With)d(the)f(default)g
+FM(\\DeclareGraphicsExtensions)23 b FQ(\(see)31 b(Section)p
+0.05 1.00 1.00 0.40 TeXcolorcmyk 31 w(9.1)p Black
+32 w(on)f(page)p 0.05 1.00 1.00 0.40 TeXcolorcmyk
+30 w(29)p Black(\),)857 4070 y(the)h(command)p Black
+Black 1206 4203 a FN(\\includegraphics)o({fi)o(le)o(})857
+4337 y FQ(causes)g FM(\\includegraphics)26 b FQ(to)31
+b(try)f(to)h(op)s(en)f(the)h(follo)m(wing)h(\014les)p
+Black Black 1380 4471 a FN(file.eps)1380 4570 y(file.ps)1380
+4670 y(file.eps.gz)1380 4769 y(file.ps.gz)1380 4869 y(file.eps.Z)857
+5016 y FQ(This)e(is)g(esp)s(ecially)i(ine\016cien)m(t)f(when)f(used)f
+(in)h(conjunction)h(with)f FM(\\graphicspath)p FQ(.)857
+5166 y(Issuing)f(a)h FM(\\DeclareGraphicsExtension)o(s)24
+b FQ(command)29 b(with)h(a)g(minimal)f(n)m(um)m(b)s(er)g(of)857
+5279 y(extensions)i(minimizes)g(the)f(ine\016ciency)i(of)e(omitting)i
+(the)e(extension.)p Black 2250 5640 a(41)p Black eop
+end
+%%Page: 42 42
+TeXDict begin 42 41 bop Black 0 TeXcolorgray Black Black
+630 -149 a FQ(Note)24 b(that)g FM(\\includegraphics)18
+b FQ(only)23 b(consumes)f(p)s(o)s(ol)h(space)g(when)f(it)i(op)s(ens)e
+(or)g(attempts)i(to)630 -36 y(op)s(en)31 b(a)h(\014le.)44
+b(Since)32 b FM(\\includegraphics)27 b FQ(op)s(ens)j(\014les)i(to)g
+(determine)g(the)g(graphic's)f(Bound-)630 77 y(ingBo)m(x,)h(an)e
+(e\013ectiv)m(e)i(but)e(incon)m(v)m(enien)m(t)i(metho)s(d)d(of)h(prev)m
+(en)m(ting)h(p)s(o)s(ol)f(space)g(consumption)630 190
+y(is)k(to)g(sp)s(ecify)f(the)h(BoundingBo)m(x)g(parameters)g(with)f
+(the)h FM(\\includegraphics)29 b FQ(command's)630 303
+y FM(bb)h FQ(option)h(\(see)g(T)-8 b(able)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 31 w(1)p Black 31 w(on)30 b(page)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 31 w(25)p Black(\).)630 582 y FD(14)135
+b(Compressed)45 b(and)g(Non-EPS)g(Graphics)f(Files)i(in)f
+Fr(dvips)630 785 y FQ(As)e(describ)s(ed)f(in)h(Section)p
+0.05 1.00 1.00 0.40 TeXcolorcmyk 44 w(1)p Black(,)k(for)c
+FM(dvips)p FQ(-st)m(yle)h(do)s(cumen)m(ts,)i(L)2926 768
+y FP(A)2965 785 y FQ(T)3016 805 y(E)3066 785 y(X)e(shifts)e(the)i
+(graphics-)630 898 y(insertion)37 b(burden)e(on)m(to)j(the)f
+FJ(d)n(vi)g FQ(programs.)61 b(This)36 b(means)h(that)g(a)g(L)3152
+881 y FP(A)3191 898 y FQ(T)3242 918 y(E)3293 898 y(X)g(do)s(cumen)m(t)g
+(can)630 1011 y(use)30 b(an)m(y)h(graphic)f(format)h(whic)m(h)f(is)g
+(supp)s(orted)f(b)m(y)h(the)h FJ(d)n(vi)f FQ(program.)771
+1124 y(While)36 b(virtually)f(all)g FJ(d)n(vi)p FQ(-to-)p
+FJ(ps)h FQ(con)m(v)m(erters)g(supp)s(ort)d(insertion)i(of)42
+b FJ(eps)33 b FQ(graphics,)j(few)630 1237 y(con)m(v)m(erters)c(supp)s
+(ort)d(non-)p FJ(eps)g FQ(graphics.)42 b(This)30 b(means)h(the)g(using)
+f(non-EPS)g(graphics)g(with)630 1350 y(a)d FM(dvips)p
+FQ(-st)m(yle)g(do)s(cumen)m(t)f(generally)i(requires)e(con)m(v)m
+(erting)i(the)f(non-)p FJ(eps)e FQ(graphics)i(in)m(to)g
+FJ(eps)630 1463 y FQ(form.)40 b(This)30 b(can)g(b)s(e)g(done)g(in)g(t)m
+(w)m(o)i(w)m(a)m(ys:)p Black 630 1612 a FL(Con)m(v)m(ert)j(the)f(ahead)
+h(of)g(time)p Black 45 w FQ(Before)21 b FJ(d)n(vi)p FQ(-to-)p
+FJ(ps)g FQ(con)m(v)m(ersion,)j(use)c(a)h(graphics-con)m(v)m(ersion)857
+1725 y(program)29 b(to)g(con)m(v)m(ert)i(the)e(non-)p
+FJ(eps)e FQ(graphic)i(in)m(to)h FJ(eps)d FQ(format.)41
+b(This)28 b(con)m(v)m(erted)i FJ(eps)857 1838 y FQ(\014le)h(is)f
+(stored)h(and)e(subsequen)m(tly)h(used)g(b)m(y)g(the)h
+FJ(d)n(vi)p FQ(-to-)p FJ(ps)g FQ(con)m(v)m(erter.)p Black
+630 2011 a FL(Con)m(v)m(ert)k(on-the-\015y)p Black 45
+w FQ(During)21 b(the)g FJ(d)n(vi)p FQ(-to-)p FJ(ps)h
+FQ(con)m(v)m(ersion,)j(the)c FJ(d)n(vi)p FQ(-to-)p FJ(ps)h
+FQ(con)m(v)m(erter)h(calls)857 2124 y(a)e(graphics-con)m(v)m(ersion)h
+(program,)g(with)e(the)h(graphics-con)m(v)m(ersion)h(output)d(b)s(eing)
+h(pip)s(ed)857 2237 y(bac)m(k)31 b(in)m(to)h FJ(d)n(vi)p
+FQ(-to-)p FJ(ps)f FQ(con)m(v)m(erter)h(and)e(inserted)g(in)m(to)h(the)g
+(\014nal)f FJ(ps)f FQ(\014le.)630 2386 y(The)39 b(disadv)-5
+b(an)m(tage)40 b(of)f(con)m(v)m(erting)i(ahead)f(of)f(time)h(is)f(that)
+g(it)h(requires)f(storage)h(of)g(a)f(sec-)630 2499 y(ond)33
+b(v)m(ersion)h(of)f(the)h(graphics)f(\014le.)50 b(Although)34
+b(the)f(\\Con)m(v)m(ert)i(on-the-\015y")f(pro)s(cedure)e(do)s(es)630
+2612 y(not)37 b(require)g(the)h(additional)g(storage,)j(the)c(same)h
+(graphics-con)m(v)m(ersion)h(computations)f(are)630 2725
+y(rep)s(eated)27 b(at)h(ev)m(ery)h FJ(d)n(vi)p FQ(-to-)p
+FJ(ps)f FQ(execution.)41 b(This)26 b(is)h(a)g(storage-vs-sp)s(eed)i
+(tradeo\013,)f(but)f(most)630 2838 y(users)j(prefer)f(the)i(sp)s(eed)e
+(of)i(the)f(\\Con)m(v)m(ert)i(ahead)f(of)f(time".)771
+2951 y(Rather)h(than)g(directly)g(incorp)s(orating)g(graphics-con)m(v)m
+(ersion)i(routines,)e FM(dvips)e FQ(pro)m(vides)630 3064
+y(a)41 b(mec)m(hanism)f(for)h(calling)h(external)f(con)m(v)m(ersion)g
+(programs)2824 3031 y FP(19)2899 3064 y FQ(.)71 b(This)39
+b(mec)m(hanism)i(can)g(b)s(e)630 3177 y(accessed)35 b(from)e(L)1235
+3160 y FP(A)1274 3177 y FQ(T)1325 3196 y(E)1375 3177
+y(X)h(b)m(y)f(use)h FM(command)d FQ(argumen)m(t)j(of)41
+b FM(\\DeclareGraphicsRule)p FQ(.)k(This)33 b(is)630
+3290 y(more)26 b(\015exible)g(than)f(direct)h(supp)s(ort)e(b)s(ecause)i
+(it)g(k)m(eeps)g(the)g(graphics-con)m(v)m(ersion)h(uncoupled)630
+3403 y(from)22 b(the)g FJ(d)n(vi)p FQ(-to-)p FJ(ps)h
+FQ(con)m(v)m(ersion,)j(allo)m(wing)e(users)e(to)h(use)f(the)g
+(graphics-con)m(v)m(ersion)i(program)630 3516 y(of)31
+b(their)f(c)m(hoice.)771 3628 y(When)45 b(using)g FM(dvips)f
+FQ(and)g(an)g(op)s(erating)i(system)f(whic)m(h)f(supp)s(orts)f(pip)s
+(es)3524 3595 y FP(20)3643 3628 y FQ(one)i(can)630 3741
+y(use)32 b FM(\\DeclareGraphicsRule)26 b FQ(\(see)33
+b(Section)p 0.05 1.00 1.00 0.40 TeXcolorcmyk 33 w(9.2)p
+Black 33 w(on)f(page)p 0.05 1.00 1.00 0.40 TeXcolorcmyk
+33 w(30)p Black(\))h(to)g(sp)s(ecify)f(an)g(op)s(eration)g(to)630
+3854 y(b)s(e)i(p)s(erformed)g(on)h(the)g(\014le.)56 b(Making)36
+b(this)f(op)s(eration)g(a)h(decompression)f(command)g(allo)m(ws)630
+3967 y(compressed)h(graphics)g(\014les)g(to)h(b)s(e)f(used.)57
+b(Making)37 b(this)f(op)s(eration)h(a)f(graphics-con)m(v)m(ersion)630
+4080 y(command)30 b(allo)m(ws)i(non-)p FJ(eps)d FQ(graphics)h(\014les)g
+(can)h(b)s(e)f(used.)771 4180 y(Since)d FM(dvips)e FQ(is)i(curren)m
+(tly)g(the)g(only)h FJ(d)n(vi)p FQ(-to-)p FJ(ps)g FQ(con)m(v)m(erter)g
+(with)f(this)g(capabilit)m(y)-8 b(,)30 b(ev)m(ery-)630
+4279 y(thing)40 b(in)f(this)g(section)i(requires)e FM(dvips)p
+FQ(.)67 b(Users)39 b(need)g(to)i(pass)e(the)g FM(dvips)f
+FQ(option)i(to)h(the)630 4379 y FO(graphicx)33 b FQ(pac)m(k)-5
+b(age.)49 b(This)32 b(can)h(b)s(e)f(done)h(b)m(y)f(either)h(sp)s
+(ecifying)g(the)g FM(dvips)e FQ(global)j(option)f(in)630
+4479 y(the)e FM(\\documentclass)26 b FQ(command)p Black
+Black 935 4582 a FN(\\documentclass[d)o(vip)o(s,)o(11p)o(t])o({ar)o(ti)
+o(cl)o(e})630 4685 y FQ(or)k(b)m(y)h(sp)s(ecifying)f(the)g
+FM(dvips)f FQ(option)i(in)f(the)h FM(\\usepackage)c FQ(command)p
+Black Black 935 4789 a FN(\\usepackage[dvip)o(s]{)o(gr)o(aph)o(ic)o(x})
+630 4905 y FQ(Sp)s(ecifying)h(the)i FM(dvips)d FQ(option)j(in)e
+FM(\\documentclass)d FQ(it)30 b(is)f(preferred)e(b)s(ecause)i(it)h
+(passes)f(the)630 5018 y FM(dvips)g FQ(option)i(to)g(all)g(pac)m(k)-5
+b(ages.)p Black 630 5101 1332 4 v 703 5191 a FF(19)768
+5222 y FG(This)35 b(requires)g(an)f(op)r(erating)i(system)e(whic)n(h)g
+(supp)r(orts)h(pip)r(es.)61 b(F)-6 b(or)34 b(example,)j(Unix)c(supp)r
+(orts)i(pip)r(es)630 5314 y(while)27 b FJ(dos)e FG(do)r(es)i(not.)703
+5409 y FF(20)768 5441 y FG(F)-6 b(or)26 b(example,)g(Unix)f(supp)r
+(orts)g(pip)r(es)h(while)h FJ(dos)f FG(do)r(es)g(not.)p
+Black Black 2250 5640 a FQ(42)p Black eop end
+%%Page: 43 43
+TeXDict begin 43 42 bop Black 0 TeXcolorgray Black Black
+630 -149 a FB(14.1)112 b(Compressed)39 b(EPS)e(Example)630
+23 y FQ(The)30 b(steps)g(for)g(using)g(compressed)g FJ(eps)f
+FQ(\014les)i(are)p Black 741 166 a(1.)p Black 46 w(Create)g(an)g
+FJ(eps)e FQ(\014le)h(\()p FM(file1.eps)e FQ(for)j(example\))p
+Black 741 316 a(2.)p Black 46 w(Store)g(the)f(BoundingBo)m(x)i(line)e
+(in)g(another)h(\014le)f(\()p FM(file1.eps.bb)p FQ(\))p
+Black 741 453 a(3.)p Black 46 w(Compress)g(the)g FJ(eps)f
+FQ(\014le.)41 b(F)-8 b(or)31 b(example,)h(on)e(man)m(y)g(platforms,)h
+(the)f(command)p Black Black 1555 587 a FN(gzip)42 b(-9)g(file1.eps)857
+734 y FQ(creates)33 b(the)e(compressed)g(\014le)g FM(file1.eps.gz)p
+FQ(.)39 b(The)31 b FM(-9)f FQ(\(or)i FM(-best)p FQ(\))e(option)h(sp)s
+(eci\014es)857 847 y(maxim)m(um)g(compression.)p Black
+741 975 a(4.)p Black 46 w(Include)20 b(the)g(prop)s(er)f
+FM(\\DeclareGraphicsRule)c FQ(command)20 b(b)s(efore)g(the)g
+FM(\\includegraphics)857 1067 y FQ(command)40 b(in)g(the)h(L)1588
+1050 y FP(A)1627 1067 y FQ(T)1678 1086 y(E)1728 1067
+y(X)g(\014le.)70 b(The)40 b FM(\\DeclareGraphicsRule)35
+b FQ(command)40 b(informs)857 1158 y(L)881 1141 y FP(A)920
+1158 y FQ(T)971 1177 y(E)1022 1158 y(X)j(ho)m(w)g(to)h(treat)g(the)f
+(particular)g(su\016x)f(\(see)i(Section)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 44 w(9.2)p Black 44 w(on)f(page)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 44 w(30)p Black(\).)80 b(F)-8 b(or)857 1249
+y(example)p Black Black 1014 1375 a FE(\\documentclass[dvips]{articl)q
+(e})1014 1466 y(\\usepackage{graphicx})1014 1557 y(\\begin{document})
+1132 1649 y(\\DeclareGraphicsRule{.eps.gz}{)q(eps})q({.ep)q(s.bb})q
+({`gu)q(nzip)46 b(-c)39 b(#1})1132 1740 y(\\begin{figure})1328
+1831 y(\\centering)1328 1922 y(\\includegraphics[width=3in]{f)q(ile1)q
+(.eps.)q(gz})1328 2014 y(\\caption{Compressed)44 b(EPS)39
+b(Graphic})1328 2105 y(\\label{fig:compressed:eps})1132
+2196 y(\\end{figure})1014 2288 y(\\end{document})630
+2414 y FQ(In)31 b(this)g(particular)g(case,)i(the)f FM
+(\\DeclareGraphicsRule)25 b FQ(command)31 b(is)h(actually)h(not)e
+(neces-)630 2514 y(sary)36 b(b)s(ecause)h(it)g(happ)s(ens)e(to)i(b)s(e)
+f(one)h(of)g(the)g(graphics)g(rules)f(pre-de\014ned)f(in)h
+FM(dvips.def)p FQ(.)630 2613 y(If)f(another)h(compression)f(program)h
+(or)f(su\016xes)g(w)m(ere)h(used,)h(the)e FM(\\DeclareGraphicsRule)630
+2713 y FQ(command)21 b(w)m(ould)h(b)s(e)f(mandatory)-8
+b(.)38 b(F)-8 b(or)23 b(example,)h(if)e(the)g(BoundingBo)m(x)g(\014le)g
+(had)f(b)s(een)g(stored)630 2812 y(in)30 b FM(file1.bb)p
+FQ(,)e(the)j(corresp)s(onding)g FM(\\DeclareGraphicsRule)24
+b FQ(w)m(ould)31 b(b)s(e)p Black Black 892 2954 a FN(\\DeclareGraphic)o
+(sR)o(ule)o({.)o(eps)o(.g)o(z}{)o(ep)o(s})o({.b)o(b})o({`g)o(un)o(zi)o
+(p)38 b(-c)k(#1})630 3239 y FB(14.2)112 b(Non-EPS)37
+b(Graphic)i(Files)630 3410 y FQ(While)c(it)f(is)g(easy)g(to)h(insert)e
+FJ(eps)g FQ(graphics)h(in)m(to)g(L)2427 3393 y FP(A)2466
+3410 y FQ(T)2517 3430 y(E)2568 3410 y(X)g(do)s(cumen)m(ts,)g(it)g(is)g
+(not)g(as)g(straigh)m(t-)630 3523 y(forw)m(ard)25 b(to)h(insert)g(non-)
+p FJ(eps)e FQ(graphics)h(\()p FJ(gif)p FQ(,)j FJ(tiff)p
+FQ(,)f FJ(jpeg)p FQ(,)f FJ(pict)p FQ(,)g(etc.\).)41 b(A)26
+b(simple)f(solution)630 3636 y(is)36 b(to)g(determine)g(whether)f(the)h
+(application)g(whic)m(h)g(generated)g(the)g(non-)p FJ(eps)e
+FQ(graphic)i(also)630 3749 y(generates)43 b FJ(eps)d
+FQ(output.)74 b(If)41 b(not,)j(a)e(graphics-con)m(v)m(ersion)h(program)
+f(\(see)g(Section)p 0.05 1.00 1.00 0.40 TeXcolorcmyk
+42 w(6.2)p Black 43 w(on)630 3862 y(page)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 31 w(17)p Black(\))32 b(m)m(ust)e(b)s(e)g(used)f(to)i(con)
+m(v)m(ert)h(the)f(graphics)f(to)h(P)m(ostScript.)771
+3975 y(Since)38 b(a)g(non-)p FJ(eps)e FQ(graphics)i(\014le)g(ma)m(y)g
+(b)s(e)f(smaller)i(than)e(the)h(corresp)s(onding)g FJ(eps)f
+FQ(\014le,)630 4088 y(it)d(ma)m(y)h(b)s(e)e(desirable)h(to)h(k)m(eep)f
+(the)g(graphics)g(in)g(a)g(non-)p FJ(eps)e FQ(format)j(and)e(con)m(v)m
+(ert)i(them)f(to)630 4201 y(P)m(ostScript)25 b(when)e(the)h
+FJ(d)n(vi)h FQ(\014le)f(is)g(con)m(v)m(erted)i(to)f(P)m(ostScript.)39
+b(If)31 b FM(dvips)23 b FQ(is)h(used,)h(this)f(on-the-)630
+4313 y(\015y)33 b(con)m(v)m(ersion)j(can)e(b)s(e)f(sp)s(eci\014ed)g(b)m
+(y)h(the)g(command)g(option)h(in)e FM(\\DeclareGraphicsRule)p
+FQ(.)630 4426 y(F)-8 b(or)27 b(example,)h(using)e(on-the-\015y)h(con)m
+(v)m(ersion)h(to)f(insert)f FM(file2.gif)e FQ(in)m(to)j(a)g(L)3336
+4410 y FP(A)3375 4426 y FQ(T)3426 4446 y(E)3477 4426
+y(X)f(do)s(cumen)m(t)630 4539 y(requires)k(the)g(follo)m(wing)i(steps)p
+Black 741 4682 a(1.)p Black 46 w(Find)e(a)h FJ(gif)p
+FQ(-to-)p FJ(eps)g FQ(con)m(v)m(ersion)g(program)g(\(assume)f(it's)h
+(called)h FM(gif2eps)p FQ(\))p Black 741 4832 a(2.)p
+Black 46 w(One)f(needs)f(to)h(create)i(a)e(BoundingBo)m(x)g(\014le)g
+(whic)m(h)f(sp)s(eci\014es)h(the)g(natural)f(size)i(of)f(the)857
+4945 y FM(file2.gif)d FQ(graphics.)41 b(T)-8 b(o)31 b(do)f(this,)g(con)
+m(v)m(ert)i FM(file2.gif)c FQ(to)j(P)m(ostScript)g(and)p
+Black 896 5110 a(\(a\))p Black 46 w(If)d(the)g(P)m(ostScript)h(\014le)f
+(con)m(tains)h(a)g(BoundingBo)m(x)g(line,)g(sa)m(v)m(e)h(the)e
+(BoundingBo)m(x)1057 5223 y(line)j(in)f FM(file2.gif.bb)p
+Black 2250 5640 a FQ(43)p Black eop end
+%%Page: 44 44
+TeXDict begin 44 43 bop Black 0 TeXcolorgray Black Black
+Black 891 -149 a FQ(\(b\))p Black 45 w(If)28 b(the)g(P)m(ostScript)h
+(\014le)f(con)m(tains)h(no)g(BoundingBo)m(x)f(line,)i(determine)e(the)g
+(appro-)1057 -36 y(priate)e(BoundingBo)m(x)h(\(see)f(Section)p
+0.05 1.00 1.00 0.40 TeXcolorcmyk 26 w(3.2)p Black
+27 w(on)f(page)p 0.05 1.00 1.00 0.40 TeXcolorcmyk
+26 w(12)p Black(\))i(and)e(place)h(those)g(n)m(um)m(b)s(ers)1057
+77 y(in)k(a)h FM(\045\045BoundingBox:)37 b FQ(line)30
+b(in)g FM(file2.gif.bb)p Black 741 241 a FQ(3.)p Black
+46 w(Keep)h FM(file2.gif)c FQ(and)j FM(file2.gif.bb)d
+FQ(and)j(delete)i(the)e(P)m(ostScript)h(\014le.)p Black
+741 390 a(4.)p Black 46 w(Include)f FM(\\DeclareGraphicsRule{.gi)o
+(f}{e)o(ps}{)o(.gi)o(f.bb)o(}{`g)o(if2)o(eps)41 b(#1})857
+503 y FQ(b)s(efore)30 b(the)h FM(\\includegraphics)26
+b FQ(command)k(in)g(the)h(L)2782 486 y FP(A)2821 503
+y FQ(T)2872 522 y(E)2922 503 y(X)f(\014le.)630 646 y(When)g
+FM(\\includegraphics{file.gi)o(f})24 b FQ(is)30 b(issued,)g(L)2575
+629 y FP(A)2614 646 y FQ(T)2665 665 y(E)2715 646 y(X)g(reads)g(the)g
+(BoundingBo)m(x)h(from)630 759 y FM(file.gif.bb)c FQ(and)j(tells)h
+FM(dvips)e FQ(to)j(use)e FM(gif2eps)e FQ(to)j(con)m(v)m(ert)h
+FM(file.gif)c FQ(to)j FJ(eps)p FQ(.)630 1001 y FB(14.3)112
+b(GIF)38 b(Example)630 1159 y FQ(While)k(the)g(commands)f(necessary)h
+(for)g(including)f(non-)p FJ(eps)f FQ(graphics)h(are)h(dep)s(enden)m(t)
+f(on)630 1259 y(the)i(op)s(erating)h(system)f(and)g(the)g(graphics)g
+(con)m(v)m(ersion)h(program,)j(this)c(section)h(pro)m(vides)630
+1358 y(examples)31 b(for)f(t)m(w)m(o)i(common)e(Unix)h(con)m(v)m
+(ersion)g(programs.)41 b(The)30 b(commands)p Black Black
+761 1493 a FN(\\DeclareGraphics)o(Ru)o(le)o({.g)o(if)o(}{e)o(ps)o(}{.)o
+(gi)o(f.)o(bb})o({`)o(con)o(ve)o(rt)37 b(#1)43 b('eps:-')e(})761
+1592 y(\\begin{figure})892 1692 y(\\centering)892 1792
+y(\\includegraphic)o(s[)o(wid)o(th)o(=3i)o(n])o({fi)o(le)o(2.)o(gif)o
+(})892 1891 y(\\caption{GIF)d(Graphic})761 1991 y(\\end{figure})630
+2125 y FQ(use)e(the)h FM(convert)d FQ(program)j(\(part)f(of)h(the)g
+(ImageMagic)m(k)i(pac)m(k)-5 b(age\))39 b(pac)m(k)-5
+b(age)39 b(to)e(translate)630 2225 y(the)31 b FJ(gif)f
+FQ(\014le)h(in)m(to)g FJ(eps)p FQ(.)39 b(The)30 b(command)p
+Black Black 935 2359 a FN(convert)41 b(file2.gif)f('eps:-')630
+2507 y FQ(translates)30 b FM(file2.gif)c FQ(in)m(to)j
+FJ(eps)f FQ(format)h(\(sp)s(eci\014ed)f(b)m(y)g(the)h(\\)p
+FM(eps:)p FQ(")40 b(option\),)30 b(sending)e(the)630
+2620 y(result)i(to)h(standard)f(output)g(\(sp)s(eci\014ed)g(b)m(y)g
+(the)h(\\)p FM(-)p FQ(")g(sp)s(eci\014cation\).)771 2720
+y(Alternativ)m(ely)-8 b(,)42 b(one)c(can)g(use)f(the)h
+FM(ppm)f FQ(utilities)i(in)e(whic)m(h)g FM(giftoppm)p
+FQ(,)g FM(ppmtopgm)p FQ(,)h(and)630 2819 y FM(pgmtops)25
+b FQ(con)m(v)m(ert)j(the)f FJ(gif)g FQ(\014le)g(to)h
+FJ(eps)d FQ(via)j(the)f FM(ppm)f FQ(and)g(gra)m(yscale)j
+FM(pgm)d FQ(formats.)40 b(In)26 b(Unix,)630 2919 y(the)20
+b(piping)g(b)s(et)m(w)m(een)h(these)g(programs)f(is)g(sp)s(eci\014ed)g
+(b)m(y)g(the)g(follo)m(wing)j FM(\\DeclareGraphicsRule)630
+3018 y FQ(command)p Black Black 761 3153 a FN(\\DeclareGraphics)o(Ru)o
+(le)o({.g)o(if)o(}{e)o(ps)o(}{.)o(gi)o(f.)o(bb})o({`)o(gif)o(to)o(pp)o
+(m)38 b(#1)k(|)i(ppmtopgm)c(|)j(pgmtops})630 3430 y FB(14.4)112
+b(T)1000 3452 y(E)1060 3430 y(X)37 b(Searc)m(h)h(P)m(ath)f(and)i(dvips)
+630 3601 y FQ(When)j(L)931 3585 y FP(A)970 3601 y FQ(T)1021
+3621 y(E)1071 3601 y(X)g(encoun)m(ters)g(an)g FM(\\includegraphics)37
+b FQ(command,)45 b(it)d(lo)s(oks)h(in)e(the)h(curren)m(t)630
+3714 y(directory)33 b(for)f(the)h(\014le.)46 b(If)32
+b(it)h(do)s(es)f(not)h(\014nd)d(the)j(\014le)f(in)g(the)h(curren)m(t)f
+(directory)-8 b(,)34 b(it)f(searc)m(hes)630 3827 y(through)38
+b(the)h(T)1198 3847 y(E)1248 3827 y(X)h(path)e(for)h(the)g(\014le.)67
+b(When)39 b(the)g FJ(d)n(vi)g FQ(\014le)g(is)g(con)m(v)m(erted)h(to)g
+(P)m(ostScript,)630 3940 y FM(dvips)29 b FQ(p)s(erforms)h(the)h(same)g
+(searc)m(h)h(routine)f(and)f(ev)m(erything)i(w)m(orks)e(w)m(ell.)44
+b(Ho)m(w)m(ev)m(er,)33 b(when)630 4053 y(an)42 b(on-the-\015y)g
+(command)g(is)g(sp)s(eci\014ed)f(in)g(the)i FM(\\DeclareGraphicsRule)36
+b FQ(command,)45 b(the)630 4166 y(on-the-\015y)31 b(command)f(prev)m
+(en)m(ts)h FM(dvips)e FQ(from)g(prop)s(erly)h(searc)m(hing)h(the)f(T)
+3270 4185 y(E)3320 4166 y(X)h(path.)771 4266 y(F)-8 b(or)31
+b(example,)h(the)e(rule)p Black Black 848 4400 a FN(\\DeclareGraphics)o
+(Ru)o(le{)o(.e)o(ps.)o(gz)o(}{e)o(ps)o(}{)o(.ep)o(s.)o(bb})o({`)o(gu)o
+(nzi)o(p)37 b(-c)43 b(#1})630 4534 y FQ(sp)s(eci\014es)f(that)h(the)f
+FM(gunzip)k(-c)c FQ(command)g(b)s(e)f(used)h(on)g(\014les)g(ha)m(ving)h
+(a)f FM(.eps.gz)f FQ(su\016x.)630 4634 y(Supp)s(ose)29
+b(the)h(follo)m(wing)i(command)e(is)h(used)p Black Black
+848 4768 a FN(\\includegraphics)o({f)o(ile)o(.e)o(ps.)o(gz)o(})630
+4916 y FQ(If)k FM(file.eps.gz)26 b FQ(and)i FM(file.eps.bb)e
+FQ(are)j(in)f(the)h(curren)m(t)g(directory)-8 b(,)30
+b(the)f(path-searc)m(hing)h(is)630 5029 y(not)e(needed)g(and)f(ev)m
+(erything)i(w)m(orks)f(w)m(ell.)41 b(L)2208 5012 y FP(A)2247
+5029 y FQ(T)2298 5049 y(E)2348 5029 y(X)28 b(uses)g FM(file.eps.bb)d
+FQ(and)i FM(dvips)g FQ(executes)630 5142 y FM(gunzip)46
+b(-c)h(file.eps.gz)28 b FQ(to)j(uncompress)e(the)h(\014le.)771
+5241 y(Ho)m(w)m(ev)m(er,)g(things)c(don't)g(w)m(ork)h(if)33
+b FM(file.eps.gz)24 b FQ(and)i FM(file.eps.bb)d FQ(are)k(not)f(in)h
+(the)f(cur-)630 5341 y(ren)m(t)f(directory)-8 b(.)40
+b(If)24 b(they)h(are)g(instead)g(in)g(the)g(directory)h
+FM(/a/b/c/)d FQ(\(on)i(the)g(T)3316 5361 y(E)3366 5341
+y(X)g(path\),)i(L)3752 5324 y FP(A)3791 5341 y FQ(T)3842
+5361 y(E)3892 5341 y(X)630 5441 y(searc)m(hes)45 b(the)g(path)f(to)h
+(\014nd)e FM(/a/b/c/file.eps.bb)p FQ(.)78 b(Ho)m(w)m(ev)m(er,)50
+b(problems)44 b(o)s(ccur)g(when)p Black 2250 5640 a(44)p
+Black eop end
+%%Page: 45 45
+TeXDict begin 45 44 bop Black 0 TeXcolorgray Black Black
+630 -149 a FM(dvips)20 b FQ(executes)i FM(`gunzip)46
+b(-c)h(file.eps.gz)18 b FQ(b)s(ecause)k FM(gunzip)d FQ(cannot)j(\014nd)
+e FM(file.eps.gz)p FQ(.)630 -49 y(If)32 b(the)g(T)932
+-29 y(E)982 -49 y(X)g(distribution)g(uses)g(a)g(recen)m(t)h
+FM(kpathsea)d FQ(library)i(\(as)h(do)s(es)f(the)g FM(teTeX)f
+FQ(distribu-)630 51 y(tion\),)g(this)g(problem)f(can)g(b)s(e)g(solv)m
+(ed)h(b)m(y)f(the)h(follo)m(wing)h(graphics)e(rule)p
+Black Black 979 192 a FN(\\DeclareGraphic)o(sRu)o(le)o({.e)o(ps)o(.gz)o
+(}{)o(ep)o(s}{)o(.e)o(ps.)o(bb)o(}\045)1850 291 y({`gunzip)41
+b(-c)h(`kpsewhich)e(-n)j(latex)e(tex)i(#1`})630 432 y
+FQ(whic)m(h)30 b(uses)g FM(kpsewhich)e FQ(to)j(\014nd)e(the)h(\014le)h
+(for)f FM(gunzip)p FQ(.)39 b(The)p Black Black 848 574
+a FN(`kpsewhich)g(-n)k(latex)f(tex)g(#1)630 728 y FQ(command)36
+b(causes)g FM(dvips)f FQ(lo)s(ok)i(for)f(the)g(compressed)g(\014le)g
+(on)g(the)g(T)3103 748 y(E)3153 728 y(X)g(searc)m(h)h(path.)57
+b(The)630 841 y(full)22 b(\014lename)h(\(including)f(sub)s
+(directories\))h(is)f(then)g(app)s(ended)f(to)i(the)g
+FM(gunzip)46 b(-c)22 b FQ(command,)630 954 y(allo)m(wing)33
+b FM(gunzip)c FQ(to)i(\014nd)e(the)h(\014le)h(ev)m(en)g(though)f(it)h
+(is)f(not)h(in)f(the)h(curren)m(t)f(directory)-8 b(.)771
+1053 y(While)39 b(this)e(new)i FM(\\DeclareGraphicsRule)32
+b FQ(command)37 b(can)h(b)s(e)g(placed)g(at)g(the)g(b)s(egin-)630
+1153 y(ning)43 b(of)h(ev)m(ery)g(do)s(cumen)m(t,)i(it)e(ma)m(y)g(b)s(e)
+f(more)h(con)m(v)m(enien)m(t)h(to)f(add)f(the)h(follo)m(wing)h(to)f
+(the)630 1253 y FM(graphics.cfg)27 b FQ(\014le)p Black
+Black 979 1394 a FN(\\AtEndOfPackage)o({\045)979 1494
+y(\\DeclareGraphic)o(sRu)o(le)o({.e)o(ps)o(.gz)o(}{)o(ep)o(s}{)o(.e)o
+(ps.)o(bb)o(}\045)1850 1593 y({`gunzip)41 b(-c)h(`kpsewhich)e(-n)j
+(latex)e(tex)i(#1`}})630 1748 y FQ(and)30 b(lea)m(ving)i(the)e
+(existing)i FM(\\ExecuteOptions{dvips})24 b FQ(line.)630
+2034 y FD(15)135 b(The)44 b(PSfrag)i(P)l(ac)l(k)-7 b(age)630
+2237 y FQ(While)31 b(there)g(are)g(man)m(y)f(dra)m(wing)g(and)g
+(analysis)h(pac)m(k)-5 b(ages)32 b(whic)m(h)f(pro)s(duce)e
+FJ(eps)g FQ(\014les,)i(most)630 2350 y(do)g(not)h(supp)s(ort)e(sym)m(b)
+s(ols)h(and)g(equations)h(as)g(w)m(ell)h(as)e(L)2627
+2333 y FP(A)2666 2350 y FQ(T)2717 2369 y(E)2768 2350
+y(X.)44 b(The)31 b FJ(ps)p FQ(frag)g(pac)m(k)-5 b(age)34
+b(allo)m(ws)630 2463 y(L)654 2446 y FP(A)693 2463 y FQ(T)744
+2482 y(E)794 2463 y(X)d(users)e(to)i(replace)h(text)f(strings)f(in)g
+FJ(eps)f FQ(\014les)i(with)f(L)2731 2446 y FP(A)2770
+2463 y FQ(T)2821 2482 y(E)2871 2463 y(X)h(text)g(or)f(equations.)p
+Black 1699 2663 a FB(T)-9 b(able)38 b(5:)p 0 TeXcolorgray
+Black 50 w(PSfrag)g(Options)p Black Black -120 2793 4081
+4 v -120 2906 4 113 v -67 2872 a FM(PStext)p 583 2906
+V 415 w FQ(T)-8 b(ext)31 b(in)f FJ(eps)f FQ(\014le)i(to)g(b)s(e)f
+(replaced.)p 3957 2906 V -120 2909 4081 4 v -120 3135
+4 226 v -67 2988 a FM(posn)p 583 3135 V 511 w Fy(\(Optional,)42
+b(Defaults)d(to)g Fq([Bl])p Fy(.\))63 b FQ(P)m(osition)38
+b(of)f(placemen)m(t)i(p)s(oin)m(t)e(relativ)m(e)i(to)f(new)e(L)3698
+2971 y FP(A)3737 2988 y FQ(T)3788 3008 y(E)3839 2988
+y(X)636 3101 y(text.)p 3957 3135 V -120 3138 4081 4 v
+-120 3364 4 226 v -67 3217 a FM(PSposn)p 583 3364 V 415
+w Fy(\(Optional,)f(Defaults)f(to)g Fq([Bl])p Fy(.\))45
+b FQ(P)m(osition)33 b(of)e(placemen)m(t)i(p)s(oin)m(t)e(relativ)m(e)j
+(to)e(existing)h FJ(eps)636 3330 y FQ(text.)p 3957 3364
+V -120 3367 4081 4 v -120 3706 4 339 v -67 3446 a FM(scale)p
+583 3706 V 463 w Fy(\(Optional,)i(defaults)g(to)f(1.\))48
+b FQ(Scaling)32 b(factor)g(for)g(the)f(text.)45 b(F)-8
+b(or)33 b(b)s(est)e(results,)g(a)m(v)m(oid)i(using)636
+3559 y(the)h(scaling)h(factor)f(and)f(instead)h(use)f(L)2042
+3543 y FP(A)2081 3559 y FQ(T)2132 3579 y(E)2183 3559
+y(X)g(t)m(yp)s(e-size)i(commands)e(suc)m(h)h(as)g FM(\\small)d
+FQ(and)636 3672 y FM(\\large)p 3957 3706 V -120 3709
+4081 4 v -120 4274 4 565 v -67 3788 a(rot)p 583 4274
+V 559 w Fy(\(Optional,)k(defaults)f(to)g(zer)-5 b(o.\))46
+b FQ(When)31 b(an)g(angle)h(is)f(sp)s(eci\014ed,)g(it)g(is)g(the)g
+(angle)h(of)f(rotation)636 3901 y(of)26 b(the)g(new)g(text)h(relativ)m
+(e)h(to)f(the)f(existing)h(text.)40 b(The)26 b(angle)h(is)f(in)f
+(degrees)i(with)e(a)i(coun)m(ter-)636 4014 y(clo)s(c)m(kwise)32
+b(rotation)g(b)s(eing)e(p)s(ositiv)m(e.)636 4127 y(This)38
+b(option)h(is)g(esp)s(ecially)h(useful)e(when)f(dealing)j(with)e
+(applications)i(whic)m(h)f(only)f(allo)m(w)636 4240 y(horizon)m(tal)32
+b(text)f(in)g(their)f FJ(eps)f FQ(\014les.)p 3957 4274
+V -120 4277 4081 4 v -120 4616 4 339 v -67 4356 a FM(text)p
+583 4616 V 511 w FQ(The)h(L)847 4340 y FP(A)886 4356
+y FQ(T)937 4376 y(E)987 4356 y(X)h(text)g(to)g(insert)g(in)m(to)g(the)f
+FJ(eps)g FQ(graphic.)636 4469 y(Lik)m(e)45 b(regular)f(L)1194
+4452 y FP(A)1233 4469 y FQ(T)1284 4489 y(E)1335 4469
+y(X)g(text,)k(math)c(form)m(ulas)h(m)m(ust)e(b)s(e)h(enclosed)h(b)m(y)f
+(dollar)g(signs)g(\(e.g.,)636 4582 y Fp($)p FM(\\frac{1}{2})p
+Fp($)27 b FQ(or)k Fp($)p FM(x^2)p Fp($)p FQ(\).)p 3957
+4616 V -120 4619 4081 4 v Black 771 4837 a FJ(ps)p FQ(frag)i(3.0)h(w)m
+(as)g(totally)h(re-written)f(and)e(released)j(in)d(No)m(v)m(em)m(b)s
+(er)j(1996.)51 b(Previous)33 b(v)m(er-)630 4950 y(sions)e(of)39
+b FJ(ps)p FQ(frag)30 b(required)h(running)e(a)j(prepro)s(cessor)f
+(\(suc)m(h)g(as)g FM(ps2frag)f FQ(or)h FM(ps2psfrag)p
+FQ(\))e(to)630 5063 y(iden)m(tify)g(and)g(tag)h(all)g(the)f(text)h(in)f
+(the)g FJ(eps)f FQ(\014le.)40 b(Since)29 b FJ(ps)p FQ(frag)g(3.0)h
+(requires)f(no)g(prepro)s(cess-)630 5176 y(ing,)g(it)f(do)s(es)g(not)g
+(require)g(an)m(y)g(external)h(programs)f(suc)m(h)g(as)g
+FM(perl)f FQ(or)h FM(ghostscript)p FQ(.)37 b FJ(ps)p
+FQ(frag)630 5289 y(3.0)k(only)f(requires)f(a)h(recen)m(t)h(L)1735
+5272 y FP(A)1774 5289 y FQ(T)1825 5308 y(E)1875 5289
+y(X)f(and)f(the)h(graphics)g(bundle)e(distributed)h(with)g(L)3726
+5272 y FP(A)3765 5289 y FQ(T)3816 5308 y(E)3867 5289
+y(X.)630 5402 y(Reference)31 b([)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk(29)p Black 1 w(])g(pro)m(vides)f(complete)i(do)s(cumen)m
+(tation)f(on)g FJ(ps)p FQ(frag)e(3.0.)p Black 2250 5640
+a(45)p Black eop end
+%%Page: 46 46
+TeXDict begin 46 45 bop Black 0 TeXcolorgray Black Black
+771 -149 a FQ(An)32 b(additional)i(b)s(ene\014t)d(of)40
+b FJ(ps)p FQ(frag)32 b(rewrite)h(is)g(that)g(it)g(no)m(w)f(supp)s(orts)
+f(compressed)h FJ(eps)630 -36 y FQ(graphics.)39 b(Ho)m(w)m(ev)m(er,)28
+b(the)d FM(\\tex)e FQ(command)h(\(describ)s(ed)g(in)g(Section)p
+0.05 1.00 1.00 0.40 TeXcolorcmyk 26 w(15.3)p Black
+26 w(on)g(page)p 0.05 1.00 1.00 0.40 TeXcolorcmyk
+26 w(48)p Black(\))h(cannot)630 77 y(b)s(e)30 b(used)f(to)i(em)m(b)s
+(ed)f(L)1384 60 y FP(A)1423 77 y FQ(T)1474 97 y(E)1525
+77 y(X)g(text)i(in)e(compressed)g(graphics.)630 273 y(T)-8
+b(o)31 b(use)f FJ(ps)p FQ(frag,)g(create)i(an)e FJ(eps)f
+FQ(\014le)i(and)e(then)h(p)s(erform)f(the)i(follo)m(wing)h(steps)p
+Black 741 416 a(1.)p Black 46 w(Include)e FM(\\usepackage{psfrag})25
+b FQ(in)30 b(the)h(pream)m(ble)f(of)h(the)f(L)3053 399
+y FP(A)3092 416 y FQ(T)3143 435 y(E)3194 416 y(X)g(do)s(cumen)m(t.)p
+Black 741 564 a(2.)p Black 46 w(In)d(the)g(do)s(cumen)m(t,)i(use)e(the)
+g FM(\\psfrag)f FQ(command)h(to)h(sp)s(ecify)f(the)g
+FJ(eps)f FQ(text)j(to)f(replace)857 677 y(and)g(the)h(L)1211
+660 y FP(A)1250 677 y FQ(T)1301 696 y(E)1351 677 y(X)f(string)h(to)g
+(replace)g(it.)41 b(This)28 b(mak)m(es)h(the)f(sp)s(eci\014ed)g
+(substitution)g(o)s(ccur)857 790 y(in)38 b(an)m(y)g(subsequen)m(t)g
+FM(\\includegraphics)33 b FQ(command)38 b(issued)f(in)h(the)g(same)h
+(en)m(viron-)857 902 y(men)m(t.)p Black 741 1050 a(3.)p
+Black 46 w(Use)31 b(the)g FM(\\includegraphics)26 b FQ(command)k(as)g
+(usual.)630 1193 y(The)g(L)841 1176 y FP(A)880 1193 y
+FQ(T)931 1213 y(E)981 1193 y(X)h FM(\\psfrag)d FQ(command)i(has)g(the)h
+(follo)m(wing)h(syn)m(tax)p Black Black 869 1344 a FM
+(\\psfrag{PStext}[posn][P)o(Spos)o(n][)o(scal)o(e][r)o(ot])o({tex)o(t})
+630 1495 y FQ(with)e(its)h(argumen)m(ts)g(describ)s(ed)e(in)h(T)-8
+b(able)p 0.05 1.00 1.00 0.40 TeXcolorcmyk 31 w(5)p
+Black(.)771 1608 y(The)25 b FM(posn)f FQ(and)g FM(PSposn)g
+FQ(options)h(are)h(one)g(of)f(the)g(12)h(p)s(oin)m(ts)f(\(suc)m(h)h(as)
+f FM([tl])p FQ(,)g FM([br])p FQ(,)h FM([cc])p FQ(\))630
+1721 y(sho)m(wn)34 b(in)h(Figure)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 35 w(3)p Black 35 w(on)g(page)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 35 w(28)p Black(.)55 b(If)34 b(the)h(optional)h(argumen)m
+(ts)f(are)g(not)h(issued,)f(the)g(p)s(oin)m(t)630 1833
+y(defaults)f(to)g FM([Bl])p FQ(.)50 b(An)m(y)34 b(missing)g(letters)h
+(default)f(to)h FM(c)e FQ(\(e.g.,)k FM([)16 b(])33 b
+FQ(and)g FM([c])g FQ(are)h(equiv)-5 b(alen)m(t)630 1946
+y(to)29 b FM([cc])p FQ(,)e FM([l])g FQ(is)h(equiv)-5
+b(alen)m(t)29 b(to)g FM([lc])p FQ(\).)39 b(See)28 b([)p
+0.05 1.00 1.00 0.40 TeXcolorcmyk(29)p Black 1 w(])g(for)g(examples)g
+(of)g(v)-5 b(arious)28 b(com)m(binations)h(of)630 2059
+y(placemen)m(t)j(p)s(oin)m(ts.)771 2159 y(Note)g(that)f
+FM(\\psfrag)d FQ(matc)m(hes)k Fy(entir)-5 b(e)37 b FQ(text)32
+b(strings.)40 b(Th)m(us)30 b(the)g(command)p Black Black
+1109 2288 a FN(\\psfrag{pi}{$\\pi$)o(})630 2431 y FQ(replaces)i(the)f
+(string)h FM(pi)f FQ(with)g Fz(\031)s FQ(,)g(but)g(do)s(es)f(not)i
+(a\013ect)g(the)g(strings)e FM(pi/2)g FQ(or)h FM(2pi)p
+FQ(.)42 b(Separate)630 2543 y FM(\\psfrag)28 b FQ(commands)i(m)m(ust)h
+(en)m(tered)g(for)f(these)h(strings.)771 2643 y FJ(ps)p
+FQ(frag)23 b(cannot)g(p)s(erform)f(the)h(replacemen)m(t)h(unless)f(the)
+g(en)m(tire)h FJ(eps)e FQ(string)h(is)g(constructed)-3850
+b FL(Problems)-70 2756 y(with)34 b(Kerning)630 2743 y
+FQ(with)c(a)h(single)h(P)m(ostScript)f(command.)41 b(Some)31
+b(programs)f(break)g(string)h(up)e(in)m(to)j(sub-strings)630
+2842 y(or)27 b(individual)f(letters)h(in)g(order)f(to)h(p)s(erform)e(k)
+m(erning.)40 b(F)-8 b(or)27 b(example,)i(Corel)d(Dra)m(w)i(pro)s(duced)
+630 2942 y(the)j(follo)m(wing)i FJ(eps)c FQ(co)s(de)h(to)h(place)h(the)
+e(string)h(\\Hello)h(W)-8 b(orld")p Black Black 761 3071
+a FN(0)43 b(0)g(\(Hello)e(W\))i(@t)761 3171 y(1080)f(0)h(\(orld\))e(@t)
+630 3313 y FQ(Since)j FJ(ps)p FQ(frag)f(sees)h(this)g(as)g(t)m(w)m(o)h
+(unrelated)e(strings)h(\\Hello)h(W")g(and)e(\\orld",)48
+b(it)c(cannot)630 3426 y(p)s(erform)22 b(an)m(y)h(replacemen)m(t)i(of)f
+(\\Hello)h(W)-8 b(orld".)39 b(If)23 b(the)g(k)m(erning)h(cannot)g(b)s
+(e)e(man)m(ually)i(turned)630 3539 y(o\013,)42 b(using)d(Courier)g(or)g
+(other)h(monospaced)f(fon)m(ts)h(often)g(prev)m(en)m(ts)g(the)f(k)m
+(erning)3566 3506 y FP(21)3641 3539 y FQ(.)68 b(If)39
+b(the)630 3652 y(k)m(erning)30 b(cannot)h(b)s(e)f(a)m(v)m(oided,)i
+(only)f(single-c)m(haracter)i(replacemen)m(t)f(strings)e(can)g(b)s(e)g
+(used.)630 3893 y FB(15.1)112 b(PSfrag)38 b(Example)h(#1)630
+4052 y FQ(The)30 b(commands)p Black Black 935 4181 a
+FN(\\includegraphics)o({pe)o(nd)o(.ep)o(s})630 4310 y
+FQ(include)g(the)h(graphic)g(without)f(an)m(y)j FJ(ps)p
+FQ(frag)d(replacemen)m(t,)i(pro)s(ducing)d(Figure)p
+0.05 1.00 1.00 0.40 TeXcolorcmyk 31 w(9)p Black(.)42
+b(The)30 b(com-)630 4410 y(mands)p Black Black 935 4539
+a FN(\\psfrag{q1}{$\\th)o(eta)o(_1)o($})935 4638 y(\\psfrag{q2}{$\\th)o
+(eta)o(_2)o($})935 4738 y(\\psfrag{L1}{$L_1)o($})935
+4838 y(\\psfrag{L2}{$L_2)o($})935 4937 y(\\psfrag{P1}[][]{)o($P_)o(1$)o
+(})935 5037 y(\\psfrag{P2}[][]{)o(\\la)o(rg)o(e)38 b($P_2$})935
+5136 y(\\includegraphics)o({pe)o(nd)o(.ep)o(s})p Black
+630 5228 1332 4 v 703 5318 a FF(21)768 5349 y FG(In)32
+b(order)g(to)h(a)n(v)n(oid)f(k)n(erning,)i(the)d(fon)n(t)i(ma)n(y)f
+(need)g(to)g(b)r(e)g(set)h(to)f(Courier)h Fw(b)l(efor)l(e)39
+b FG(the)32 b(text)f(is)i(created.)630 5441 y(That)26
+b(is,)h(creating)f(the)f(text)g(and)h(then)f(con)n(v)n(erting)g(it)h
+(to)g(Courier)h(ma)n(y)e(still)i(result)f(in)f(k)n(erning.)p
+Black Black 2250 5640 a FQ(46)p Black eop end
+%%Page: 47 47
+TeXDict begin 47 46 bop Black 0 TeXcolorgray Black Black
+630 -149 a FQ(include)38 b(the)h(graphic)f(with)g FJ(ps)p
+FQ(frag)g(replacemen)m(t,)k(pro)s(ducing)37 b(Figure)p
+0.05 1.00 1.00 0.40 TeXcolorcmyk 39 w(10)p Black(.)66
+b(The)38 b(\014rst)g(four)630 -36 y FM(\\psfrag)25 b
+FQ(commands)h(p)s(osition)h(the)g(new)f(L)2140 -52 y
+FP(A)2179 -36 y FQ(T)2230 -16 y(E)2280 -36 y(X)h(text)h(suc)m(h)e(that)
+i(its)f(left)g(baseline)h(p)s(oin)m(t)e(cor-)630 77 y(resp)s(onds)f(to)
+j(the)g(left)g(baseline)f(p)s(oin)m(t)h(of)f(the)g FJ(eps)f
+FQ(text.)41 b(The)27 b(last)h(t)m(w)m(o)g FM(\\psfrag)d
+FQ(commands)630 190 y(use)41 b(the)h FM([][])e FQ(options)h(to)h(p)s
+(osition)g(the)f(L)2198 173 y FP(A)2237 190 y FQ(T)2288
+210 y(E)2339 190 y(X)g(text)h(suc)m(h)f(that)h(its)g(cen)m(ter)g
+(corresp)s(onds)630 303 y(to)36 b(the)g(cen)m(ter)h(of)f(the)g
+FJ(eps)e FQ(text.)58 b(Note)37 b(that)f(the)g FM(N)f
+FQ(tag)i(in)e(Figure)p 0.05 1.00 1.00 0.40 TeXcolorcmyk
+36 w(10)p Black 37 w(is)h(left)g(unc)m(hanged,)630 416
+y(sho)m(wing)30 b(that)h(not)g(all)g FJ(eps)e FQ(text)j(has)e(to)h(b)s
+(e)f(replaced.)p Black 710 1517 a @beginspecial 0 @llx
+0 @lly 371 @urx 258 @ury 1726 @rwi @setspecial
+%%BeginDocument: pend.eps
+%!PS-Adobe-2.0 EPSF-2.0
+%%Title: pend.fig
+%%Creator: fig2dev Version 3.2 Patchlevel 4
+%%CreationDate: Sun May 22 21:42:13 2005
+%%For: epstein@linux (Becky Epstein)
+%%BoundingBox: 0 0 371 258
+%%Magnification: 1.0000
+%%EndComments
+/$F2psDict 200 dict def
+$F2psDict begin
+$F2psDict /mtrx matrix put
+/col-1 {0 setgray} bind def
+/col0 {0.000 0.000 0.000 srgb} bind def
+/col1 {0.000 0.000 1.000 srgb} bind def
+/col2 {0.000 1.000 0.000 srgb} bind def
+/col3 {0.000 1.000 1.000 srgb} bind def
+/col4 {1.000 0.000 0.000 srgb} bind def
+/col5 {1.000 0.000 1.000 srgb} bind def
+/col6 {1.000 1.000 0.000 srgb} bind def
+/col7 {1.000 1.000 1.000 srgb} bind def
+/col8 {0.000 0.000 0.560 srgb} bind def
+/col9 {0.000 0.000 0.690 srgb} bind def
+/col10 {0.000 0.000 0.820 srgb} bind def
+/col11 {0.530 0.810 1.000 srgb} bind def
+/col12 {0.000 0.560 0.000 srgb} bind def
+/col13 {0.000 0.690 0.000 srgb} bind def
+/col14 {0.000 0.820 0.000 srgb} bind def
+/col15 {0.000 0.560 0.560 srgb} bind def
+/col16 {0.000 0.690 0.690 srgb} bind def
+/col17 {0.000 0.820 0.820 srgb} bind def
+/col18 {0.560 0.000 0.000 srgb} bind def
+/col19 {0.690 0.000 0.000 srgb} bind def
+/col20 {0.820 0.000 0.000 srgb} bind def
+/col21 {0.560 0.000 0.560 srgb} bind def
+/col22 {0.690 0.000 0.690 srgb} bind def
+/col23 {0.820 0.000 0.820 srgb} bind def
+/col24 {0.500 0.190 0.000 srgb} bind def
+/col25 {0.630 0.250 0.000 srgb} bind def
+/col26 {0.750 0.380 0.000 srgb} bind def
+/col27 {1.000 0.500 0.500 srgb} bind def
+/col28 {1.000 0.630 0.630 srgb} bind def
+/col29 {1.000 0.750 0.750 srgb} bind def
+/col30 {1.000 0.880 0.880 srgb} bind def
+/col31 {1.000 0.840 0.000 srgb} bind def
+
+end
+save
+newpath 0 258 moveto 0 0 lineto 371 0 lineto 371 258 lineto closepath clip newpath
+-9.2 263.5 translate
+1 -1 scale
+
+/cp {closepath} bind def
+/ef {eofill} bind def
+/gr {grestore} bind def
+/gs {gsave} bind def
+/sa {save} bind def
+/rs {restore} bind def
+/l {lineto} bind def
+/m {moveto} bind def
+/rm {rmoveto} bind def
+/n {newpath} bind def
+/s {stroke} bind def
+/sh {show} bind def
+/slc {setlinecap} bind def
+/slj {setlinejoin} bind def
+/slw {setlinewidth} bind def
+/srgb {setrgbcolor} bind def
+/rot {rotate} bind def
+/sc {scale} bind def
+/sd {setdash} bind def
+/ff {findfont} bind def
+/sf {setfont} bind def
+/scf {scalefont} bind def
+/sw {stringwidth} bind def
+/tr {translate} bind def
+/tnt {dup dup currentrgbcolor
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb}
+ bind def
+/shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul
+ 4 -2 roll mul srgb} bind def
+ /DrawEllipse {
+ /endangle exch def
+ /startangle exch def
+ /yrad exch def
+ /xrad exch def
+ /y exch def
+ /x exch def
+ /savematrix mtrx currentmatrix def
+ x y tr xrad yrad sc 0 0 1 startangle endangle arc
+ closepath
+ savematrix setmatrix
+ } def
+
+/$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def
+/$F2psEnd {$F2psEnteredState restore end} def
+
+$F2psBegin
+10 setmiterlimit
+0 slj 0 slc
+ 0.06000 0.06000 sc
+%
+% Fig objects follow
+%
+%
+% here starts figure with depth 0
+% Arc
+7.500 slw
+gs clippath
+2592 2142 m 2544 2084 l 2403 2198 l 2544 2133 l 2451 2256 l cp
+eoclip
+n 2068.5 1649.8 680.1 103.9 44.1 arcn
+gs col-1 s gr
+ gr
+
+% arrowhead
+n 2451 2256 m 2544 2133 l 2403 2198 l 2451 2256 l cp gs 0.00 setgray ef gr col-1 s
+% Arc
+gs clippath
+4195 3222 m 4123 3199 l 4068 3371 l 4150 3240 l 4140 3394 l cp
+eoclip
+n 2866.1 2901.2 1328.9 63.9 14.1 arcn
+gs col-1 s gr
+ gr
+
+% arrowhead
+n 4140 3394 m 4150 3240 l 4068 3371 l 4140 3394 l cp gs 0.00 setgray ef gr col-1 s
+% Ellipse
+n 2925 2790 225 225 0 360 DrawEllipse gs 0.00 setgray ef gr gs col-1 s gr
+
+% Ellipse
+n 5445 3600 225 225 0 360 DrawEllipse gs 0.00 setgray ef gr gs col-1 s gr
+
+% Ellipse
+n 3645 2040 300 300 0 360 DrawEllipse gs col-1 s gr
+
+% Ellipse
+n 4530 1455 300 300 0 360 DrawEllipse gs col-1 s gr
+
+% Ellipse
+n 5360 2388 300 300 0 360 DrawEllipse gs col-1 s gr
+
+% Polyline
+30.000 slw
+n 1905 570 m
+ 2790 2625 l gs col-1 s gr
+% Polyline
+n 3090 2895 m
+ 5250 3540 l gs col-1 s gr
+% Polyline
+7.500 slw
+ [60] 0 sd
+n 1905 570 m
+ 1905 2475 l gs col-1 s gr [] 0 sd
+% Polyline
+gs clippath
+5368 3377 m 5463 3372 l 5448 3120 l 5414 3342 l 5354 3126 l cp
+eoclip
+n 5377 2692 m
+ 5415 3360 l gs col-1 s gr gr
+
+% arrowhead
+n 5354 3126 m 5414 3342 l 5448 3120 l 5404 3167 l 5354 3126 l
+ cp gs 0.00 setgray ef gr col-1 s
+% Polyline
+ [60] 0 sd
+n 2970 3030 m
+ 3555 4380 l gs col-1 s gr [] 0 sd
+% Polyline
+n 6315 570 m 165 570 l 165 120 l 6315 120 l
+ cp gs 0.50 setgray ef gr gs col0 s gr
+% Polyline
+gs clippath
+3030 2572 m 3097 2639 l 3276 2460 l 3088 2582 l 3209 2393 l cp
+eoclip
+n 3420 2250 m
+ 3075 2595 l gs col-1 s gr gr
+
+% arrowhead
+n 3209 2393 m 3088 2582 l 3276 2460 l 3211 2458 l 3209 2393 l
+ cp gs 0.00 setgray ef gr col-1 s
+% Polyline
+gs clippath
+4463 549 m 4369 560 l 4397 810 l 4420 588 l 4492 799 l cp
+eoclip
+n 4485 1155 m
+ 4418 570 l gs col-1 s gr gr
+
+% arrowhead
+n 4492 799 m 4420 588 l 4397 810 l 4439 761 l 4492 799 l
+ cp gs 0.00 setgray ef gr col-1 s
+/Times-Roman ff 270.00 scf sf
+2475 1650 m
+gs 1 -1 sc (L1) col-1 sh gr
+/Times-Roman ff 270.00 scf sf
+4440 1545 m
+gs 1 -1 sc (N) col-1 sh gr
+/Times-Roman ff 270.00 scf sf
+3525 2130 m
+gs 1 -1 sc (P1) col-1 sh gr
+/Times-Roman ff 270.00 scf sf
+2070 2054 m
+gs 1 -1 sc (q1) col-1 sh gr
+/Times-Roman ff 270.00 scf sf
+3457 3518 m
+gs 1 -1 sc (q2) col-1 sh gr
+/Times-Roman ff 270.00 scf sf
+4080 3060 m
+gs 1 -1 sc (L2) col-1 sh gr
+/Times-Roman ff 270.00 scf sf
+5227 2467 m
+gs 1 -1 sc (P2) col-1 sh gr
+% here ends figure;
+$F2psEnd
+rs
+showpage
+
+%%EndDocument
+ @endspecial 644 1713 a(Figure)h(9:)p 0 TeXcolorgray
+Black 41 w(Without)g(PSfrag)f(Replacemen)m(t)2442 1517
+y @beginspecial 259 @llx 627 @lly 429 @urx 745 @ury 1726
+@rwi @setspecial
+%%BeginDocument: pend_frag.eps
+%!PS-Adobe-2.0 EPSF-2.0
+%%BoundingBox: 259 627 429 745
+%%HiResBoundingBox: 259.303 627.645 428.094 744.565
+%%Creator: dvips(k) 5.94b Copyright 2004 Radical Eye Software
+%%Title: pend_frag.dvi
+%%CreationDate: Sat May 28 13:13:43 2005
+%%DocumentFonts: CMR10 CMMI10 CMR8 CMMI12
+%%EndComments
+%DVIPSWebPage: (www.radicaleye.com)
+%DVIPSCommandLine: dvips -E pend_frag
+%DVIPSParameters: dpi=600
+%DVIPSSource: TeX output 2005.05.28:1313
+%%BeginProcSet: tex.pro 0 0
+%!
+/TeXDict 300 dict def TeXDict begin/N{def}def/B{bind def}N/S{exch}N/X{S
+N}B/A{dup}B/TR{translate}N/isls false N/vsize 11 72 mul N/hsize 8.5 72
+mul N/landplus90{false}def/@rigin{isls{[0 landplus90{1 -1}{-1 1}ifelse 0
+0 0]concat}if 72 Resolution div 72 VResolution div neg scale isls{
+landplus90{VResolution 72 div vsize mul 0 exch}{Resolution -72 div hsize
+mul 0}ifelse TR}if Resolution VResolution vsize -72 div 1 add mul TR[
+matrix currentmatrix{A A round sub abs 0.00001 lt{round}if}forall round
+exch round exch]setmatrix}N/@landscape{/isls true N}B/@manualfeed{
+statusdict/manualfeed true put}B/@copies{/#copies X}B/FMat[1 0 0 -1 0 0]
+N/FBB[0 0 0 0]N/nn 0 N/IEn 0 N/ctr 0 N/df-tail{/nn 8 dict N nn begin
+/FontType 3 N/FontMatrix fntrx N/FontBBox FBB N string/base X array
+/BitMaps X/BuildChar{CharBuilder}N/Encoding IEn N end A{/foo setfont}2
+array copy cvx N load 0 nn put/ctr 0 N[}B/sf 0 N/df{/sf 1 N/fntrx FMat N
+df-tail}B/dfs{div/sf X/fntrx[sf 0 0 sf neg 0 0]N df-tail}B/E{pop nn A
+definefont setfont}B/Cw{Cd A length 5 sub get}B/Ch{Cd A length 4 sub get
+}B/Cx{128 Cd A length 3 sub get sub}B/Cy{Cd A length 2 sub get 127 sub}
+B/Cdx{Cd A length 1 sub get}B/Ci{Cd A type/stringtype ne{ctr get/ctr ctr
+1 add N}if}B/CharBuilder{save 3 1 roll S A/base get 2 index get S
+/BitMaps get S get/Cd X pop/ctr 0 N Cdx 0 Cx Cy Ch sub Cx Cw add Cy
+setcachedevice Cw Ch true[1 0 0 -1 -.1 Cx sub Cy .1 sub]{Ci}imagemask
+restore}B/D{/cc X A type/stringtype ne{]}if nn/base get cc ctr put nn
+/BitMaps get S ctr S sf 1 ne{A A length 1 sub A 2 index S get sf div put
+}if put/ctr ctr 1 add N}B/I{cc 1 add D}B/bop{userdict/bop-hook known{
+bop-hook}if/SI save N @rigin 0 0 moveto/V matrix currentmatrix A 1 get A
+mul exch 0 get A mul add .99 lt{/QV}{/RV}ifelse load def pop pop}N/eop{
+SI restore userdict/eop-hook known{eop-hook}if showpage}N/@start{
+userdict/start-hook known{start-hook}if pop/VResolution X/Resolution X
+1000 div/DVImag X/IEn 256 array N 2 string 0 1 255{IEn S A 360 add 36 4
+index cvrs cvn put}for pop 65781.76 div/vsize X 65781.76 div/hsize X}N
+/p{show}N/RMat[1 0 0 -1 0 0]N/BDot 260 string N/Rx 0 N/Ry 0 N/V{}B/RV/v{
+/Ry X/Rx X V}B statusdict begin/product where{pop false[(Display)(NeXT)
+(LaserWriter 16/600)]{A length product length le{A length product exch 0
+exch getinterval eq{pop true exit}if}{pop}ifelse}forall}{false}ifelse
+end{{gsave TR -.1 .1 TR 1 1 scale Rx Ry false RMat{BDot}imagemask
+grestore}}{{gsave TR -.1 .1 TR Rx Ry scale 1 1 false RMat{BDot}
+imagemask grestore}}ifelse B/QV{gsave newpath transform round exch round
+exch itransform moveto Rx 0 rlineto 0 Ry neg rlineto Rx neg 0 rlineto
+fill grestore}B/a{moveto}B/delta 0 N/tail{A/delta X 0 rmoveto}B/M{S p
+delta add tail}B/b{S p tail}B/c{-4 M}B/d{-3 M}B/e{-2 M}B/f{-1 M}B/g{0 M}
+B/h{1 M}B/i{2 M}B/j{3 M}B/k{4 M}B/w{0 rmoveto}B/l{p -4 w}B/m{p -3 w}B/n{
+p -2 w}B/o{p -1 w}B/q{p 1 w}B/r{p 2 w}B/s{p 3 w}B/t{p 4 w}B/x{0 S
+rmoveto}B/y{3 2 roll p a}B/bos{/SS save N}B/eos{SS restore}B end
+
+%%EndProcSet
+%%BeginProcSet: psfrag.pro 0 0
+%%
+%% This is file `psfrag.pro',
+%% generated with the docstrip utility.
+%%
+%% The original source files were:
+%%
+%% psfrag.dtx (with options: `filepro')
+%%
+%% Copyright (c) 1996 Craig Barratt, Michael C. Grant, and David Carlisle.
+%% All rights reserved.
+%%
+%% This file is part of the PSfrag package.
+%%
+userdict begin
+/PSfragLib 90 dict def
+/PSfragDict 6 dict def
+/PSfrag { PSfragLib begin load exec end } bind def
+end
+PSfragLib begin
+/RO /readonly load def
+/CP /currentpoint load def
+/CM /currentmatrix load def
+/B { bind RO def } bind def
+/X { exch def } B
+/MD { { X } forall } B
+/OE { end exec PSfragLib begin } B
+/S false def
+/tstr 8 string def
+/islev2 { languagelevel } stopped { false } { 2 ge } ifelse def
+[ /sM /tM /srcM /dstM /dM /idM /srcFM /dstFM ] { matrix def } forall
+sM currentmatrix RO pop
+dM defaultmatrix RO idM invertmatrix RO pop
+srcFM identmatrix pop
+/Hide { gsave { CP } stopped not newpath clip { moveto } if } B
+/Unhide { { CP } stopped not grestore { moveto } if } B
+/setrepl islev2 {{ /glob currentglobal def true setglobal array astore
+ globaldict exch /PSfrags exch put glob setglobal }}
+ {{ array astore /PSfrags X }} ifelse B
+/getrepl islev2 {{ globaldict /PSfrags get aload length }}
+ {{ PSfrags aload length }} ifelse B
+/convert {
+ /src X src length string
+ /c 0 def src length {
+ dup c src c get dup 32 lt { pop 32 } if put /c c 1 add def
+ } repeat
+} B
+/Begin {
+ /saver save def
+ srcFM exch 3 exch put
+ 0 ne /debugMode X 0 setrepl
+ dup /S exch dict def { S 3 1 roll exch convert exch put } repeat
+ srcM CM dup invertmatrix pop
+ mark { currentdict { end } stopped { pop exit } if } loop
+ PSfragDict counttomark { begin } repeat pop
+} B
+/End {
+ mark { currentdict end dup PSfragDict eq { pop exit } if } loop
+ counttomark { begin } repeat pop
+ getrepl saver restore
+ 7 idiv dup /S exch dict def {
+ 6 array astore /mtrx X tstr cvs /K X
+ S K [ S K known { S K get aload pop } if mtrx ] put
+ } repeat
+} B
+/Place {
+ tstr cvs /K X
+ S K known {
+ bind /proc X tM CM pop
+ CP /cY X /cX X
+ 0 0 transform idtransform neg /aY X neg /aX X
+ S K get dup length /maxiter X
+ /iter 1 def {
+ iter maxiter ne { /saver save def } if
+ tM setmatrix aX aY translate
+ [ exch aload pop idtransform ] concat
+ cX neg cY neg translate cX cY moveto
+ /proc load OE
+ iter maxiter ne { saver restore /iter iter 1 add def } if
+ } forall
+ /noXY { CP /cY X /cX X } stopped def
+ tM setmatrix noXY { newpath } { cX cY moveto } ifelse
+ } {
+ Hide OE Unhide
+ } ifelse
+} B
+/normalize {
+ 2 index dup mul 2 index dup mul add sqrt div
+ dup 4 -1 roll exch mul 3 1 roll mul
+} B
+/replace {
+ aload pop MD
+ CP /bY X /lX X gsave sM setmatrix
+ str stringwidth abs exch abs add dup 0 eq
+ { pop } { 360 exch div dup scale } ifelse
+ lX neg bY neg translate newpath lX bY moveto
+ str { /ch X ( ) dup 0 ch put false charpath ch Kproc } forall
+ flattenpath pathbbox [ /uY /uX /lY /lX ] MD
+ CP grestore moveto
+ currentfont /FontMatrix get dstFM copy dup
+ 0 get 0 lt { uX lX /uX X /lX X } if
+ 3 get 0 lt { uY lY /uY X /lY X } if
+ /cX uX lX add 0.5 mul def
+ /cY uY lY add 0.5 mul def
+ debugMode { gsave 0 setgray 1 setlinewidth
+ lX lY moveto lX uY lineto uX uY lineto uX lY lineto closepath
+ lX bY moveto uX bY lineto lX cY moveto uX cY lineto
+ cX lY moveto cX uY lineto stroke
+ grestore } if
+ dstFM dup invertmatrix dstM CM srcM
+ 2 { dstM concatmatrix } repeat pop
+ getrepl /temp X
+ S str convert get {
+ aload pop [ /rot /scl /loc /K ] MD
+ /aX cX def /aY cY def
+ loc {
+ dup 66 eq { /aY bY def } { % B
+ dup 98 eq { /aY lY def } { % b
+ dup 108 eq { /aX lX def } { % l
+ dup 114 eq { /aX uX def } { % r
+ dup 116 eq { /aY uY def } % t
+ if } ifelse } ifelse } ifelse } ifelse pop
+ } forall
+ K srcFM rot tM rotate dstM
+ 2 { tM concatmatrix } repeat aload pop pop pop
+ 2 { scl normalize 4 2 roll } repeat
+ aX aY transform
+ /temp temp 7 add def
+ } forall
+ temp setrepl
+} B
+/Rif {
+ S 3 index convert known { pop replace } { exch pop OE } ifelse
+} B
+/XA { bind [ /Kproc /str } B /XC { ] 2 array astore def } B
+/xs { pop } XA XC
+/xks { /kern load OE } XA /kern XC
+/xas { pop ax ay rmoveto } XA /ay /ax XC
+/xws { c eq { cx cy rmoveto } if } XA /c /cy /cx XC
+/xaws { ax ay rmoveto c eq { cx cy rmoveto } if }
+ XA /ay /ax /c /cy /cx XC
+/raws { xaws { awidthshow } Rif } B
+/rws { xws { widthshow } Rif } B
+/rks { xks { kshow } Rif } B
+/ras { xas { ashow } Rif } B
+/rs { xs { show } Rif } B
+/rrs { getrepl dup 2 add -1 roll //restore exec setrepl } B
+PSfragDict begin
+islev2 not { /restore { /rrs PSfrag } B } if
+/show { /rs PSfrag } B
+/kshow { /rks PSfrag } B
+/ashow { /ras PSfrag } B
+/widthshow { /rws PSfrag } B
+/awidthshow { /raws PSfrag } B
+end PSfragDict RO pop
+end
+
+%%EndProcSet
+%%BeginProcSet: texps.pro 0 0
+%!
+TeXDict begin/rf{findfont dup length 1 add dict begin{1 index/FID ne 2
+index/UniqueID ne and{def}{pop pop}ifelse}forall[1 index 0 6 -1 roll
+exec 0 exch 5 -1 roll VResolution Resolution div mul neg 0 0]/Metrics
+exch def dict begin Encoding{exch dup type/integertype ne{pop pop 1 sub
+dup 0 le{pop}{[}ifelse}{FontMatrix 0 get div Metrics 0 get div def}
+ifelse}forall Metrics/Metrics currentdict end def[2 index currentdict
+end definefont 3 -1 roll makefont/setfont cvx]cvx def}def/ObliqueSlant{
+dup sin S cos div neg}B/SlantFont{4 index mul add}def/ExtendFont{3 -1
+roll mul exch}def/ReEncodeFont{CharStrings rcheck{/Encoding false def
+dup[exch{dup CharStrings exch known not{pop/.notdef/Encoding true def}
+if}forall Encoding{]exch pop}{cleartomark}ifelse}if/Encoding exch def}
+def end
+
+%%EndProcSet
+%%BeginProcSet: special.pro 0 0
+%!
+TeXDict begin/SDict 200 dict N SDict begin/@SpecialDefaults{/hs 612 N
+/vs 792 N/ho 0 N/vo 0 N/hsc 1 N/vsc 1 N/ang 0 N/CLIP 0 N/rwiSeen false N
+/rhiSeen false N/letter{}N/note{}N/a4{}N/legal{}N}B/@scaleunit 100 N
+/@hscale{@scaleunit div/hsc X}B/@vscale{@scaleunit div/vsc X}B/@hsize{
+/hs X/CLIP 1 N}B/@vsize{/vs X/CLIP 1 N}B/@clip{/CLIP 2 N}B/@hoffset{/ho
+X}B/@voffset{/vo X}B/@angle{/ang X}B/@rwi{10 div/rwi X/rwiSeen true N}B
+/@rhi{10 div/rhi X/rhiSeen true N}B/@llx{/llx X}B/@lly{/lly X}B/@urx{
+/urx X}B/@ury{/ury X}B/magscale true def end/@MacSetUp{userdict/md known
+{userdict/md get type/dicttype eq{userdict begin md length 10 add md
+maxlength ge{/md md dup length 20 add dict copy def}if end md begin
+/letter{}N/note{}N/legal{}N/od{txpose 1 0 mtx defaultmatrix dtransform S
+atan/pa X newpath clippath mark{transform{itransform moveto}}{transform{
+itransform lineto}}{6 -2 roll transform 6 -2 roll transform 6 -2 roll
+transform{itransform 6 2 roll itransform 6 2 roll itransform 6 2 roll
+curveto}}{{closepath}}pathforall newpath counttomark array astore/gc xdf
+pop ct 39 0 put 10 fz 0 fs 2 F/|______Courier fnt invertflag{PaintBlack}
+if}N/txpose{pxs pys scale ppr aload pop por{noflips{pop S neg S TR pop 1
+-1 scale}if xflip yflip and{pop S neg S TR 180 rotate 1 -1 scale ppr 3
+get ppr 1 get neg sub neg ppr 2 get ppr 0 get neg sub neg TR}if xflip
+yflip not and{pop S neg S TR pop 180 rotate ppr 3 get ppr 1 get neg sub
+neg 0 TR}if yflip xflip not and{ppr 1 get neg ppr 0 get neg TR}if}{
+noflips{TR pop pop 270 rotate 1 -1 scale}if xflip yflip and{TR pop pop
+90 rotate 1 -1 scale ppr 3 get ppr 1 get neg sub neg ppr 2 get ppr 0 get
+neg sub neg TR}if xflip yflip not and{TR pop pop 90 rotate ppr 3 get ppr
+1 get neg sub neg 0 TR}if yflip xflip not and{TR pop pop 270 rotate ppr
+2 get ppr 0 get neg sub neg 0 S TR}if}ifelse scaleby96{ppr aload pop 4
+-1 roll add 2 div 3 1 roll add 2 div 2 copy TR .96 dup scale neg S neg S
+TR}if}N/cp{pop pop showpage pm restore}N end}if}if}N/normalscale{
+Resolution 72 div VResolution 72 div neg scale magscale{DVImag dup scale
+}if 0 setgray}N/psfts{S 65781.76 div N}N/startTexFig{/psf$SavedState
+save N userdict maxlength dict begin/magscale true def normalscale
+currentpoint TR/psf$ury psfts/psf$urx psfts/psf$lly psfts/psf$llx psfts
+/psf$y psfts/psf$x psfts currentpoint/psf$cy X/psf$cx X/psf$sx psf$x
+psf$urx psf$llx sub div N/psf$sy psf$y psf$ury psf$lly sub div N psf$sx
+psf$sy scale psf$cx psf$sx div psf$llx sub psf$cy psf$sy div psf$ury sub
+TR/showpage{}N/erasepage{}N/copypage{}N/p 3 def @MacSetUp}N/doclip{
+psf$llx psf$lly psf$urx psf$ury currentpoint 6 2 roll newpath 4 copy 4 2
+roll moveto 6 -1 roll S lineto S lineto S lineto closepath clip newpath
+moveto}N/endTexFig{end psf$SavedState restore}N/@beginspecial{SDict
+begin/SpecialSave save N gsave normalscale currentpoint TR
+@SpecialDefaults count/ocount X/dcount countdictstack N}N/@setspecial{
+CLIP 1 eq{newpath 0 0 moveto hs 0 rlineto 0 vs rlineto hs neg 0 rlineto
+closepath clip}if ho vo TR hsc vsc scale ang rotate rwiSeen{rwi urx llx
+sub div rhiSeen{rhi ury lly sub div}{dup}ifelse scale llx neg lly neg TR
+}{rhiSeen{rhi ury lly sub div dup scale llx neg lly neg TR}if}ifelse
+CLIP 2 eq{newpath llx lly moveto urx lly lineto urx ury lineto llx ury
+lineto closepath clip}if/showpage{}N/erasepage{}N/copypage{}N newpath}N
+/@endspecial{count ocount sub{pop}repeat countdictstack dcount sub{end}
+repeat grestore SpecialSave restore end}N/@defspecial{SDict begin}N
+/@fedspecial{end}B/li{lineto}B/rl{rlineto}B/rc{rcurveto}B/np{/SaveX
+currentpoint/SaveY X N 1 setlinecap newpath}N/st{stroke SaveX SaveY
+moveto}N/fil{fill SaveX SaveY moveto}N/ellipse{/endangle X/startangle X
+/yrad X/xrad X/savematrix matrix currentmatrix N TR xrad yrad scale 0 0
+1 startangle endangle arc savematrix setmatrix}N end
+
+%%EndProcSet
+%%BeginFont: CMMI12
+%!PS-AdobeFont-1.1: CMMI12 1.100
+%%CreationDate: 1996 Jul 27 08:57:55
+% Copyright (C) 1997 American Mathematical Society. All Rights Reserved.
+11 dict begin
+/FontInfo 7 dict dup begin
+/version (1.100) readonly def
+/Notice (Copyright (C) 1997 American Mathematical Society. All Rights Reserved) readonly def
+/FullName (CMMI12) readonly def
+/FamilyName (Computer Modern) readonly def
+/Weight (Medium) readonly def
+/ItalicAngle -14.04 def
+/isFixedPitch false def
+end readonly def
+/FontName /CMMI12 def
+/PaintType 0 def
+/FontType 1 def
+/FontMatrix [0.001 0 0 0.001 0 0] readonly def
+/Encoding 256 array
+0 1 255 {1 index exch /.notdef put} for
+dup 80 /P put
+readonly def
+/FontBBox{-30 -250 1026 750}readonly def
+/UniqueID 5087386 def
+currentdict end
+currentfile eexec
+D9D66F633B846A97B686A97E45A3D0AA0529731C99A784CCBE85B4993B2EEBDE
+3B12D472B7CF54651EF21185116A69AB1096ED4BAD2F646635E019B6417CC77B
+532F85D811C70D1429A19A5307EF63EB5C5E02C89FC6C20F6D9D89E7D91FE470
+B72BEFDA23F5DF76BE05AF4CE93137A219ED8A04A9D7D6FDF37E6B7FCDE0D90B
+986423E5960A5D9FBB4C956556E8DF90CBFAEC476FA36FD9A5C8175C9AF513FE
+D919C2DDD26BDC0D99398B9F4D03D6A8F05B47AF95EF28A9C561DBDC98C47CF5
+5250011D19E9366EB6FD153D3A100CAA6212E3D5D93990737F8D326D347B7EDC
+4391C9DF440285B8FC159D0E98D4258FC57892DCC57F7903449E07914FBE9E67
+3C15C2153C061EB541F66C11E7EE77D5D77C0B11E1AC55101DA976CCACAB6993
+EED1406FBB7FF30EAC9E90B90B2AF4EC7C273CA32F11A5C1426FF641B4A2FB2F
+4E68635C93DB835737567FAF8471CBC05078DCD4E40E25A2F4E5AF46C234CF59
+2A1CE8F39E1BA1B2A594355637E474167EAD4D97D51AF0A899B44387E1FD933A
+323AFDA6BA740534A510B4705C0A15647AFBF3E53A82BF320DD96753639BE49C
+2F79A1988863EF977B800C9DB5B42039C23EB86953713F730E03EA22FF7BB2C1
+D97D33FD77B1BDCC2A60B12CF7805CFC90C5B914C0F30A673DF9587F93E47CEA
+5932DD1930560C4F0D97547BCD805D6D854455B13A4D7382A22F562D7C55041F
+0FD294BDAA1834820F894265A667E5C97D95FF152531EF97258F56374502865D
+A1E7C0C5FB7C6FB7D3C43FEB3431095A59FBF6F61CEC6D6DEE09F4EB0FD70D77
+2A8B0A4984C6120293F6B947944BE23259F6EB64303D627353163B6505FC8A60
+00681F7A3968B6CBB49E0420A691258F5E7B07B417157803FCBE9B9FB1F80FD8
+CA0DA1186446DD565542BCCC7D339A1EB34C7F49246E8D72E987EB477C6DB757
+99AF86CEBCD7605C487A00CD2CD093098182DC57B20D78ECE0BECF3A0BF88EBA
+C866DB19F34BBBED6634AFC0F08D2AFB2A92578A6F8B4ADCD6594737FF6EED7D
+5B536DA9E3E2CADB40DB7C600EA4D100D33C3B92B1CF857E012C4EB370BA8295
+55B50047CC8911C98FE1A7BA6CDEA82D34476286E710571F16D10F018C74B387
+B5E1A596D45EDED31BD26E7ACDEFE171498987688B8CBBE07DFF07E1DB43384C
+A3F325DE9829B118F1629D51EC9BBF82CD78D3AE38D7011F6CDFF9FB98BD188B
+E307821BE31250D83AD87A8ED8E13ED38A42728F408C0025FA55DBEA1D840EE1
+44687DF840C67F5B5A9C74FF638A891C8D7AC6B6C8566C9DC9025EA522258FA6
+F520C3E95696018F864966FD57C262C59BF43991E87C37AB895548CAD529A17B
+2F0941F25CF3E9C0F6CBCE6DE992861C021D91C131FC4888A9EC4E5329B9298B
+7883A6FE70C1FD29DC993B6E4CF79B1BBEDB38D6794C545E8D4F32E78764B36A
+E45E2DB298ADE78DD1661D73BBC892EEB03D3417A339F4DB9D20F260885EE5D6
+900CCD091152DD0DDAB60EC66CEAB06E4CF987F90C1D4E74BF853A04C2B74601
+E743F52F0F29D2D05FFA0B6BACC64468CF62C0A2
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+cleartomark
+%%EndFont
+%%BeginFont: CMR8
+%!PS-AdobeFont-1.1: CMR8 1.0
+%%CreationDate: 1991 Aug 20 16:39:40
+% Copyright (C) 1997 American Mathematical Society. All Rights Reserved.
+11 dict begin
+/FontInfo 7 dict dup begin
+/version (1.0) readonly def
+/Notice (Copyright (C) 1997 American Mathematical Society. All Rights Reserved) readonly def
+/FullName (CMR8) readonly def
+/FamilyName (Computer Modern) readonly def
+/Weight (Medium) readonly def
+/ItalicAngle 0 def
+/isFixedPitch false def
+end readonly def
+/FontName /CMR8 def
+/PaintType 0 def
+/FontType 1 def
+/FontMatrix [0.001 0 0 0.001 0 0] readonly def
+/Encoding 256 array
+0 1 255 {1 index exch /.notdef put} for
+dup 49 /one put
+dup 50 /two put
+readonly def
+/FontBBox{-36 -250 1070 750}readonly def
+/UniqueID 5000791 def
+currentdict end
+currentfile eexec
+D9D66F633B846A97B686A97E45A3D0AA052A014267B7904EB3C0D3BD0B83D891
+016CA6CA4B712ADEB258FAAB9A130EE605E61F77FC1B738ABC7C51CD46EF8171
+9098D5FEE67660E69A7AB91B58F29A4D79E57022F783EB0FBBB6D4F4EC35014F
+D2DECBA99459A4C59DF0C6EBA150284454E707DC2100C15B76B4C19B84363758
+469A6C558785B226332152109871A9883487DD7710949204DDCF837E6A8708B8
+2BDBF16FBC7512FAA308A093FE5CF4E9D2405B169CD5365D6ECED5D768D66D6C
+68618B8C482B341F8CA38E9BB9BAFCFAAD9C2F3FD033B62690986ED43D9C9361
+3645B82392D5CAE11A7CB49D7E2E82DCD485CBA1772CE422BB1D7283AD675B65
+48A7EA0069A883EC1DAA3E1F9ECE7586D6CF0A128CD557C7E5D7AA3EA97EBAD3
+9619D1BFCF4A6D64768741EDEA0A5B0EFBBF347CDCBE2E03D756967A16B613DB
+0FC45FA2A3312E0C46A5FD0466AB097C58FFEEC40601B8395E52775D0AFCD7DB
+8AB317333110531E5C44A4CB4B5ACD571A1A60960B15E450948A5EEA14DD330F
+EA209265DB8E1A1FC80DCD3860323FD26C113B041A88C88A21655878680A4466
+FA10403D24BB97152A49B842C180E4D258C9D48F21D057782D90623116830BA3
+9902B3C5F2F2DD01433B0D7099C07DBDE268D0FFED5169BCD03D48B2F058AD62
+D8678C626DC7A3F352152C99BA963EF95F8AD11DB8B0D351210A17E4C2C55AD8
+9EB64172935D3C20A398F3EEEEC31551966A7438EF3FEE422C6D4E05337620D5
+ACC7B52BED984BFAAD36EF9D20748B05D07BE4414A63975125D272FAD83F76E6
+10FFF8363014BE526D580873C5A42B70FA911EC7B86905F13AFE55EB0273F582
+83158793B8CC296B8DE1DCCF1250FD57CB0E035C7EDA3B0092ED940D37A05493
+2EC54E09B984FCA4AB7D2EA182BCF1263AA244B07EC0EA901C077A059F709F30
+4384CB5FA748F2054FAD9A7A43D4EA427918BD414F766531136B60C3477C6632
+BEFE3897B58C19276A301926C2AEF2756B367319772C9B201C49B4D935A8267B
+041D6F1783B6AEA4DAC4F5B3507D7032AA640AAB12E343A4E9BDCF419C04A721
+3888B25AF4E293AACED9A6BDC78E61DA1C424C6503CC1885F762B86FECDA8944
+AA3B20AD6019056E01677B959B23107F1962AB2CF6A52AB2745FDD5383ABAC44
+22F83D93327D560012C565E49F2EEC04A6EEBA9D605FBD223B59CD8DE300A5CA
+3790E9B4CF846CF5AE93B687F3D3EA411CAC0F03C47ADF9D83887702475E36A6
+9FDA88B48C6FBF07959EF4C6F61741CDC2D503CB8AA0135458716D07D1774C21
+750D01533D7CC822892EB494A82295E9537CF478A381CA7146A6BCDB1FD833E1
+4D59DEA7DE0D1976AC7B448C17861ADB891766639B6F06B1CF3B56FC847D6C37
+606C5D8EF98FA61D8943C404756BFBD2F87ADEB2DA92585C7521D88F486F5DCC
+92ED93565808705D38E9DB085661B771872CBAE4DA363A02669E99EF1AD09E50
+636CFF7172E5EBFB1DC08E76123FD5E5D60D76DB7A5DDBA4F32521A4543169B9
+8825E3F2A124A1CDF79BC32262897100B0BEE618A92806BBFB7C1522821547BB
+7D97346A3FFFDEB9A36068828431810D0640D0F3F07D8EBC8F1A952BFB809BF7
+E54C0444110A1EE0BC7392CCE28224C70E6872A8C91DE82508094E3418C02118
+5507AD925037FC20ECBEAB31D84929D5C6A0720FBB3E
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+cleartomark
+%%EndFont
+%%BeginFont: CMMI10
+%!PS-AdobeFont-1.1: CMMI10 1.100
+%%CreationDate: 1996 Jul 23 07:53:57
+% Copyright (C) 1997 American Mathematical Society. All Rights Reserved.
+11 dict begin
+/FontInfo 7 dict dup begin
+/version (1.100) readonly def
+/Notice (Copyright (C) 1997 American Mathematical Society. All Rights Reserved) readonly def
+/FullName (CMMI10) readonly def
+/FamilyName (Computer Modern) readonly def
+/Weight (Medium) readonly def
+/ItalicAngle -14.04 def
+/isFixedPitch false def
+end readonly def
+/FontName /CMMI10 def
+/PaintType 0 def
+/FontType 1 def
+/FontMatrix [0.001 0 0 0.001 0 0] readonly def
+/Encoding 256 array
+0 1 255 {1 index exch /.notdef put} for
+dup 18 /theta put
+dup 76 /L put
+dup 80 /P put
+readonly def
+/FontBBox{-32 -250 1048 750}readonly def
+/UniqueID 5087385 def
+currentdict end
+currentfile eexec
+D9D66F633B846A97B686A97E45A3D0AA0529731C99A784CCBE85B4993B2EEBDE
+3B12D472B7CF54651EF21185116A69AB1096ED4BAD2F646635E019B6417CC77B
+532F85D811C70D1429A19A5307EF63EB5C5E02C89FC6C20F6D9D89E7D91FE470
+B72BEFDA23F5DF76BE05AF4CE93137A219ED8A04A9D7D6FDF37E6B7FCDE0D90B
+986423E5960A5D9FBB4C956556E8DF90CBFAEC476FA36FD9A5C8175C9AF513FE
+D919C2DDD26BDC0D99398B9F4D03D5993DFC0930297866E1CD0A319B6B1FD958
+9E394A533A081C36D456A09920001A3D2199583EB9B84B4DEE08E3D12939E321
+990CD249827D9648574955F61BAAA11263A91B6C3D47A5190165B0C25ABF6D3E
+6EC187E4B05182126BB0D0323D943170B795255260F9FD25F2248D04F45DFBFB
+DEF7FF8B19BFEF637B210018AE02572B389B3F76282BEB29CC301905D388C721
+59616893E774413F48DE0B408BC66DCE3FE17CB9F84D205839D58014D6A88823
+D9320AE93AF96D97A02C4D5A2BB2B8C7925C4578003959C46E3CE1A2F0EAC4BF
+8B9B325E46435BDE60BC54D72BC8ACB5C0A34413AC87045DC7B84646A324B808
+6FD8E34217213E131C3B1510415CE45420688ED9C1D27890EC68BD7C1235FAF9
+1DAB3A369DD2FC3BE5CF9655C7B7EDA7361D7E05E5831B6B8E2EEC542A7B38EE
+03BE4BAC6079D038ACB3C7C916279764547C2D51976BABA94BA9866D79F13909
+95AA39B0F03103A07CBDF441B8C5669F729020AF284B7FF52A29C6255FCAACF1
+74109050FBA2602E72593FBCBFC26E726EE4AEF97B7632BC4F5F353B5C67FED2
+3EA752A4A57B8F7FEFF1D7341D895F0A3A0BE1D8E3391970457A967EFF84F6D8
+47750B1145B8CC5BD96EE7AA99DDC9E06939E383BDA41175233D58AD263EBF19
+AFC0E2F840512D321166547B306C592B8A01E1FA2564B9A26DAC14256414E4C8
+42616728D918C74D13C349F4186EC7B9708B86467425A6FDB3A396562F7EE4D8
+40B43621744CF8A23A6E532649B66C2A0002DD04F8F39618E4F572819DD34837
+B5A08E643FDCA1505AF6A1FA3DDFD1FA758013CAED8ACDDBBB334D664DFF5B53
+956017667094CD8DC214A666D7D12CB23EC030318B42CF6021E67CDF01BD0233
+3270218FA370DAEB68B42017CF548BBBEC5C942A5F1D31E4F9C29278A0C609DC
+D5F6C4D2BE78C6857CD16D30ADF8B4896EAD09F5C0BBF3370005ADFBD75CF53D
+2EC56360C33FFD9AD64FCF5D520A9D50054C170AFF8A03D66B94EE3BC0747DE9
+BE7A69F65636A740310E4310E85AE8D3015987BD7FA528298B0D9E7D5CCB52FD
+62DFE7E2B6B4941CA2BF1FBF15114D7C0779A2704585F8C3F7FDF0706ECDE4C3
+6C61F5EE402CA2A6A914A37F645AACB9E1E9FA39B735B36D7C11D9559C3FC061
+968B21DE97588BF20639C29314D9A476AB65D13746ACCFD19DE5A530CFEAE89F
+403B1F5F3F4A0A609DDBD5C690870C9A991C00ACF864630ECCF086A4CECFA40D
+D73BD3CF7D0B24D409E8E9FCC243C1BAA07F1096409475F428C406D21796DDC5
+19298F746B0C4A40E3640E0E4C38F741F0A201A4219718CAD8EB1A3599D5E042
+41CEE60C32935B5052D2879C626A9A83229C55BE3B5862D7443F92415CBCC4F1
+BA588E8B42779FB8E92D81EF8DB43E22C594A86E787E657222BA095EADC905F0
+A978FCD49DE21868C17A5DC57722E57BECE945AC936015594C35F73BD65B02FB
+B902FC4B5D73EE23BA74AA608D004B31B4494398BCD24DAD22C268DE6C1AE9B0
+7D05D1F72695AAE20B64F2F31D6AAC66B6A6356C6B51DB28BBF7751D8864A3B1
+91A81C8A66B198092752D33915F0230CF198B7329BA71004767421B324AC5F30
+CB72B96319B8D66EE9762CAA36F4B9C238D5FDE027CC14ACDBD840C0DBE792F9
+5AAE17C267AD9899D4BADCC77310AE52D0E8A350B9FB5C7339CAEF472C5BD395
+977B3BC0003EA0AE4B08DD1A1BF9BFDF22499E9EA45D97A434582D02C5B1865F
+5B1F98BB576B46DF55DA7A99D37E5FC54CE925F6FECBACE80C6D2FC23AA2B1AA
+C19649D5F91A196D49E319979AE1D4
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+cleartomark
+%%EndFont
+%%BeginFont: CMR10
+%!PS-AdobeFont-1.1: CMR10 1.00B
+%%CreationDate: 1992 Feb 19 19:54:52
+% Copyright (C) 1997 American Mathematical Society. All Rights Reserved.
+11 dict begin
+/FontInfo 7 dict dup begin
+/version (1.00B) readonly def
+/Notice (Copyright (C) 1997 American Mathematical Society. All Rights Reserved) readonly def
+/FullName (CMR10) readonly def
+/FamilyName (Computer Modern) readonly def
+/Weight (Medium) readonly def
+/ItalicAngle 0 def
+/isFixedPitch false def
+end readonly def
+/FontName /CMR10 def
+/PaintType 0 def
+/FontType 1 def
+/FontMatrix [0.001 0 0 0.001 0 0] readonly def
+/Encoding 256 array
+0 1 255 {1 index exch /.notdef put} for
+dup 80 /P put
+dup 83 /S put
+dup 97 /a put
+dup 99 /c put
+dup 101 /e put
+dup 102 /f put
+dup 103 /g put
+dup 108 /l put
+dup 109 /m put
+dup 110 /n put
+dup 112 /p put
+dup 114 /r put
+dup 115 /s put
+dup 116 /t put
+readonly def
+/FontBBox{-251 -250 1009 969}readonly def
+/UniqueID 5000793 def
+currentdict end
+currentfile eexec
+D9D66F633B846A97B686A97E45A3D0AA052A014267B7904EB3C0D3BD0B83D891
+016CA6CA4B712ADEB258FAAB9A130EE605E61F77FC1B738ABC7C51CD46EF8171
+9098D5FEE67660E69A7AB91B58F29A4D79E57022F783EB0FBBB6D4F4EC35014F
+D2DECBA99459A4C59DF0C6EBA150284454E707DC2100C15B76B4C19B84363758
+469A6C558785B226332152109871A9883487DD7710949204DDCF837E6A8708B8
+2BDBF16FBC7512FAA308A093FE5CF7158F1163BC1F3352E22A1452E73FECA8A4
+87100FB1FFC4C8AF409B2067537220E605DA0852CA49839E1386AF9D7A1A455F
+D1F017CE45884D76EF2CB9BC5821FD25365DDEA6E45F332B5F68A44AD8A530F0
+92A36FAC8D27F9087AFEEA2096F839A2BC4B937F24E080EF7C0F9374A18D565C
+295A05210DB96A23175AC59A9BD0147A310EF49C551A417E0A22703F94FF7B75
+409A5D417DA6730A69E310FA6A4229FC7E4F620B0FC4C63C50E99E179EB51E4C
+4BC45217722F1E8E40F1E1428E792EAFE05C5A50D38C52114DFCD24D54027CBF
+2512DD116F0463DE4052A7AD53B641A27E81E481947884CE35661B49153FA19E
+0A2A860C7B61558671303DE6AE06A80E4E450E17067676E6BBB42A9A24ACBC3E
+B0CA7B7A3BFEA84FED39CCFB6D545BB2BCC49E5E16976407AB9D94556CD4F008
+24EF579B6800B6DC3AAF840B3FC6822872368E3B4274DD06CA36AF8F6346C11B
+43C772CC242F3B212C4BD7018D71A1A74C9A94ED0093A5FB6557F4E0751047AF
+D72098ECA301B8AE68110F983796E581F106144951DF5B750432A230FDA3B575
+5A38B5E7972AABC12306A01A99FCF8189D71B8DBF49550BAEA9CF1B97CBFC7CC
+96498ECC938B1A1710B670657DE923A659DB8757147B140A48067328E7E3F9C3
+7D1888B284904301450CE0BC15EEEA00E48CCD6388F3FC3BEE09555C11E6E295
+71B219B380EE9E5BB17AD84B4E8AED35880BD88E5AC7D9FE25C46889CD093396
+F0E34A62F93E64C8E7975CFD617121244AB09FF9A4F73F8166197D0CDE2EEBB3
+81AB9BD8329579C2122368F56DEB89BA6E42C5D9E20F2789CC4A89E4AD9B877F
+8A0ACB84936F109D86211169257C19756A97E682601F4D1E7ED950A351C14DAC
+4BEA7FB0E58FB5AEB55BC09B1253748B61B4E00C448F263458BF958D3986BF18
+9636037E95FB425AAC96FCED5B4C766F93041FAA0DBB196B0A220B8E3A9FCA6E
+B4F5C0C775C25AFF4F5099CD3A2FA59ACA735718F8E90B351B015320794A89E8
+4C34F32B465E201008CCC0A15C2DEE572BDA14D8BDDFCF2743A15F8A93386861
+828F6251F206B9131C951D1ED4364A9CCE507E2959A1DA04A777B592888D38ED
+E68FFB3EFE83870BA8E04B88C9EEEB2DB80D4D07B52CE914D9DADF825A5301AC
+C64063909D6C1DC84C274C90004F41A1FAFD450805C5DD2A8E4F4C23E114246F
+C103EB63B58F33E44DD04F6367E04C3CBB3400BA3C1943B874CFB7DBF6A3EB5A
+3F665C5A98F578A03948821E40D1608FB70C5915CA0DE369A0D7112BFF6CAE56
+CB9BF699DAF3859F2B46DF97AE05915E791F1CE849154C53C4403EFD6F1A44EF
+78C167190F3326BA35B2A0F95CD03492DBA2903489ABB6B2EB9F977F3F4D690B
+31E8F6E32F83D91F721ABD116A40698F26610853E7FD075478979BEF42166C1B
+312E8C20CB3F080B08A69416DA402D336C627BABC4737FC72F8F4F6BB7D73551
+EE33D3CEA9052546399CE5FF4996968D1EF09B7C19995C083E727D2398021CAE
+6B824B074160730AE1D61010FB6167E8AC42145BCE800A58D221004F6B953F48
+B4A99CBF85F829F34F76B02D02D956F2D9710B38FE827FE961A3BA3E78F64ECD
+DADF68975D97F94EA8A698A5C6C48A4186630DA766AE8A57D650A226E068F161
+436B0F6334FE45E57BA7F3CC6E63E2866E3BDBA559FF30704DF235ABA5080004
+CA0FA6C522B546D0B3F60BA1D7D956CB17517DF95D8D5E51D994BACE39AC902E
+2000C577FA15398CF620966AE73D22C7312708911CCBA89FB4078064701CEF7A
+66A23555E9BF2A40BDDB9BAD16E0B91E4D9ADED721784AB48D99878E0FEA0826
+8E3B221641B77CEC9AF312CFC857F4D45E91067AB304DE3EE54B08231102E217
+DCC50595595DE41A41B4877E383EF37B07017F3DFFE0AA74DC6137EB726C9481
+03B47BBE9E556034AFBD9629D7F6B88EA20514F3453A08F1898F30FB9588376C
+14E7A13680158B11195C156DCF13C6734C10457CBAFD4FA76F37C278B616531C
+0CB5BD657D0582137BD76A2F6C33822483F6BF57D78C038FEE996903566C3E3B
+A94123B89708DDD88E8C042D2A1A71EED1B08E7A7FE2032A3597CB5B7CB69E94
+38E82B5453AEDFE9F1FE62A5ADBD626AAC055391F965D8B962E4C11A9A9129FF
+ED45858FB71B1D08B58FF55F036ADC122F3547038679A7BF522A998F6D5B2769
+2E4F137F616BB4DD6B1A8568EFE1876FBECF597347BBF659BC34EC29834F2902
+346BC15AF423652B6F10C95CB745F3EB72AF2BB04FDA11AE44A7723DF1C25B66
+087DC352F9F7436A539AEB3CB43FEE6C69817AB56ED21E9007C8EA08A7AA051F
+0C6B9B41759DAA0524DA1417717DFC0822C8D85AF977650008A35B3F781CA4C5
+F177C5BD978F2035F792292E4938172FF65AD8ECFD464F3D24885710FC767268
+3AD5FC13257916E750BA77785E09ACB9487AE30D630EF1EBD0747A1489FA0CF7
+7198746F8D6D8D40EC4E2CD793731316F2FC014501B5710D8AED947AF22C6475
+8791CE18B1C62F8A57D75EC42E7F18DAA6C125DAE28633362E4C02F1A60D586D
+5456A3F55816C61078050CA03602E48F491E54148181674B5A1028A266DA3146
+22214DAC67790E98E605855ED5AB23BEA9E697F6C4778F5802DD53C37E290380
+5AA562593CBCAC69E599E48A472C147EC91A98D27F6927E77518A213BD3670EB
+12DE3A151CDD9EDA5D75C7A6F7BF38D6904F4DF0B5355D5D923A89A7C4F30629
+74C121779A50242716750E54115DE3646D0C35B04179AD46A41CA239C5C35104
+080972A477719058673C5654CBDDB911D4FC07E02EFC41DFFB8A7B3C83F8CFA3
+B9FE43446CBE678E51525F3CB64C3236F23003B1CA01E560248159915EC6EC04
+D3BAD037313906D7064C47CE4AA5AD83567BFEC6691A41A1C5F64BA618C1D310
+3002E63307B05B1B4324004F8A6659805CE9CFBC87F101E5346E9889F9EEB61A
+D1C52A8E1DE244E25B4EFB42D17E46ABCC8851C0C36995A037764480C0BE0D8B
+108189619D44B84A71B0513B59AE006E933D9C567A47B9F204F158B9658D256A
+B820E070B21BC40919D636D0589B97D6269A35B7DE76A5C587C7D62BE2DC198B
+544758D42E2386B2268A00FBAC609FCBEEF858812DE9E96B6F9D69799A41CA31
+E81AE53EC85B836270C66F0B631D3CCAAB83038FAF5BBE1AA03E4341A5ACB6AB
+D878D347593BCE6B7021A715DD16C4B8731E57EC21AC152BF72B3D54CBE4903C
+6EFE6CA2E7650772C5BCC1EC12E522DFE2D538499185E2D6727E173B5100528D
+633BE94A25A05F0E8411750A8574725A859338DBBD81E81C6C17B65694019675
+767804BFBFE09CAEEF073683CDC140A53D03D1AA0F5563696A1EF9EEC9C35427
+64473C665CA1903243A3EA37565352781874F98308A700762F7A4D5697F9977F
+D33414E9AA00244F6DE227299D2FB78637C3606F493AAEC08F4ADE8E68C72FF3
+9D25FDA5067AE64BFD4850D05ACCA93828C1FE6764B68A8D790523D59C1FFBA7
+B914B4C59A74071D6C5ED0DCB02B776E909186365EA2DBE51DCD4D41CD53749C
+948D72AEB9327FB016DEA47CA1433DE2A2E55F283C4BF4D1580580B302D7492E
+BDF414545606B687C37717B1B5A0E13A70D045C542A8956EEA04404D44887426
+2526EC38F37857674E64BA8953874B0272F85FC7BF0F1387D7448A62ABAA66FB
+ED7BEE0C4DDA5C4C68CFCE175AEA3F6780385610F69EFA0ABB01B9D226339CE7
+CFDB2806D4485A034F98CCD3FC51B4F75E9D253B02E3AE384331BEB10FDAC99B
+53785586B16AA568F294010AC3AD6C730C73A29D4E6DD8DB34A037782E5331A6
+F9BE5ED5D7B8FD264746478504E5DEA5A8FF46243B7D0FACF3668032964BAF56
+A76C6A5D9BECA6D630FAA0505BEE375B5DA5B0F601309841B9AA58CEABAE54D0
+D50184C8CE1EE7F17DC5BF17FB86A03F0AE743BB3859F5DD7B4C3FBCDA24C7DB
+D60E69778157CA1D74AE6CAAEC9266EBC80D6C20C44C219858596E569C6F690B
+31F4265A757204A7F8EBB60BF7FE407002048B7989173C5E7AC09966D0F758C4
+107BD5734204294A23E205F38A9F4E3DF364E9CF1F9B49437C8962A2FDB8D90F
+CD2EDB884892F09FA26CBDD274B6E5BDCD3D7F829473A2083EF7DB0FE00ED338
+0B68E866C68D6E8AEC27366541E30E24D89A2614E4993341C7EA571FEFCEDD59
+E1A90AFE1BC63D7F95EEE3EDDB59A6086DF64018F9F9E8969D4E419B412B83BB
+8C9593C7F117144FE91976718BE2F045B59F1EDE61FF147A836E3900711EE5A8
+4F20DA144051A0FA1F88B9AE82A8822FAB6684CFA4EC4E0BCAA9401B90C05E33
+4DEB6BE74E5E6C3E08E17994588DE0627CC66E3CD600E0C522F852706D04A08A
+CA426F5894E0F3D8C843976D765C0595735013D85AB25456537C877C01846CD2
+820042FF2D5C4627108D7AB11F02229B31C23488843CD87F12B6873AA27AB4DE
+B24A99DC972B63970B090B19E04101ABC705B87DB5A4B1C0E99E3AB6B58E89DC
+F2BAA5A4B28419DF0823690BE0717F09B2A5C90DEDD4270A8FE0950325B00291
+5F0EC4A1F6DAD00E594D2E818833792C8B92D941A81A18751DC12B95957A617E
+CA07E8744169AE120E374B2A72AA37D4B82845B08797891F40F6B3E67F8A0405
+F5B9EA3654EEA365208F09FDA1A6466542D4BDC9CBBBEE19B8377E3C00FA064D
+6EC4A2EF09F0A6296BD54FABB1E09CAE71304460715216F75D7EBC50B07CCE39
+3D68B8A4CA4B1CBC79D05C4A800489BBF1C582FCDB067920A4DC902EAFE7E12B
+DE24CC57D75D9689CE70A7446E49487F11268DF8DC5F1020227FFE6009C4956D
+BB41D9973DBA34F329B032F6B0435C6BD5730D1E1F6DCA8AFC56D33E7248619C
+224966E38774412098DFF9BABF01C0DD41165ED62DD23507BFF3293B5881F1E1
+E489878C92794F7409D60F757AE3488D354E4931244DE8F049521D6F94094AE9
+8A535965F2C5B2D1EABA1433DEFA9C368F641B30957D3631A1330FC0AC317EF7
+DDD341327440D0384DCDD00932A2888D3D18ABEDB8DE82C48CAB07AAA713CDCC
+1392DE1D897169226452E68E68D88B0E61F9039ADE4460BFF74AFC49C13853DF
+62610F8A6CEFDD7E35A495488EC65F2FAFF785D45334C7AE5ADA77D4528523A4
+76B5689F710AFF0B3BED2FFBB11AC730473D1FB96855C95EAB539529D249447F
+7C2675E3EC84E45F505CD3A7DA4CDFC33E392205E8E46F15A7DD6C1DE4E87500
+E2B1B443D1F431050BB70DBE3B98DA196534B259D729679FF941074073E8A968
+FD3FBCF653F34C3D2673FCD67F7C2C5CD1490C688ED1C21E7DB5B2CE3368B4CE
+DF30A29EA3F316381193CB3C27E7BEF8BCF0E7E76281D73F92A999C79C7F974E
+939B1FAA1F574FD6E2B3146053B07F33C01DA22306F00C0A6D3CCB0459DEE48D
+E46A9BE7F13EC7A6B6832EB982FD92C5C971F34E0B3F3D5A6C3BF5687A323339
+5C8919669F6CB4F16E0DD3560AB0FD8728CF23560940FA8FC00F7B524122EFDD
+E94E0D1AB883BC8BD45AEB5C0C72BDEF53390B4BA14E2487D2E53B5FC7580009
+631D3D6C473E1581E43852AE9C49E8856537F75B72D0CB51B7A3ECA751317BD9
+96AD427359D38EFC45C4AEC1B707CF47533D7F7659C5A5E1A95066A2B14C69B9
+04424F63
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+cleartomark
+%%EndFont
+TeXDict begin 40258437 52099154 1000 600 600 (pend_frag.dvi)
+@start /Fa 175[63 80[{}1 99.6264 /CMMI12 rf /Fb 205[35
+35 49[{}2 66.4176 /CMR8 rf /Fc 175[58 3[62 57[43 18[{}3
+90.9091 /CMMI10 rf /Fd 139[35 36 36 1[51 1[51 76 25 4[45
+28 40 1[40 1[45 13[51 2[62 80[{}14 90.9091 /CMR10 rf
+end
+%%EndProlog
+%%BeginSetup
+%%Feature: *Resolution 600dpi
+TeXDict begin
+ end
+%%EndSetup
+TeXDict begin 1 0 bop 1559 772 a
+ /PSfrag where{pop(q1)[[0(Bl)1 0]](q2)[[1(Bl)1 0]](L1)[[2(Bl)1 0]](L2)[[3(Bl)1
+0]](P1)[[4()1 0]](P2)[[5()1 0]]6 0 -1/Begin PSfrag}{userdict /PSfrag{pop}put}ifelse
+ 1559 772 a @beginspecial
+0 @llx 0 @lly 371 @urx 258 @ury 1695 @rwi @setspecial
+%%BeginDocument: pend.eps
+%!PS-Adobe-2.0 EPSF-2.0
+%%Title: pend.fig
+%%Creator: fig2dev Version 3.2 Patchlevel 4
+%%CreationDate: Sun May 22 21:42:13 2005
+%%For: epstein@linux (Becky Epstein)
+%%BoundingBox: 0 0 371 258
+%%Magnification: 1.0000
+%%EndComments
+/$F2psDict 200 dict def
+$F2psDict begin
+$F2psDict /mtrx matrix put
+/col-1 {0 setgray} bind def
+/col0 {0.000 0.000 0.000 srgb} bind def
+/col1 {0.000 0.000 1.000 srgb} bind def
+/col2 {0.000 1.000 0.000 srgb} bind def
+/col3 {0.000 1.000 1.000 srgb} bind def
+/col4 {1.000 0.000 0.000 srgb} bind def
+/col5 {1.000 0.000 1.000 srgb} bind def
+/col6 {1.000 1.000 0.000 srgb} bind def
+/col7 {1.000 1.000 1.000 srgb} bind def
+/col8 {0.000 0.000 0.560 srgb} bind def
+/col9 {0.000 0.000 0.690 srgb} bind def
+/col10 {0.000 0.000 0.820 srgb} bind def
+/col11 {0.530 0.810 1.000 srgb} bind def
+/col12 {0.000 0.560 0.000 srgb} bind def
+/col13 {0.000 0.690 0.000 srgb} bind def
+/col14 {0.000 0.820 0.000 srgb} bind def
+/col15 {0.000 0.560 0.560 srgb} bind def
+/col16 {0.000 0.690 0.690 srgb} bind def
+/col17 {0.000 0.820 0.820 srgb} bind def
+/col18 {0.560 0.000 0.000 srgb} bind def
+/col19 {0.690 0.000 0.000 srgb} bind def
+/col20 {0.820 0.000 0.000 srgb} bind def
+/col21 {0.560 0.000 0.560 srgb} bind def
+/col22 {0.690 0.000 0.690 srgb} bind def
+/col23 {0.820 0.000 0.820 srgb} bind def
+/col24 {0.500 0.190 0.000 srgb} bind def
+/col25 {0.630 0.250 0.000 srgb} bind def
+/col26 {0.750 0.380 0.000 srgb} bind def
+/col27 {1.000 0.500 0.500 srgb} bind def
+/col28 {1.000 0.630 0.630 srgb} bind def
+/col29 {1.000 0.750 0.750 srgb} bind def
+/col30 {1.000 0.880 0.880 srgb} bind def
+/col31 {1.000 0.840 0.000 srgb} bind def
+
+end
+save
+newpath 0 258 moveto 0 0 lineto 371 0 lineto 371 258 lineto closepath clip newpath
+-9.2 263.5 translate
+1 -1 scale
+
+/cp {closepath} bind def
+/ef {eofill} bind def
+/gr {grestore} bind def
+/gs {gsave} bind def
+/sa {save} bind def
+/rs {restore} bind def
+/l {lineto} bind def
+/m {moveto} bind def
+/rm {rmoveto} bind def
+/n {newpath} bind def
+/s {stroke} bind def
+/sh {show} bind def
+/slc {setlinecap} bind def
+/slj {setlinejoin} bind def
+/slw {setlinewidth} bind def
+/srgb {setrgbcolor} bind def
+/rot {rotate} bind def
+/sc {scale} bind def
+/sd {setdash} bind def
+/ff {findfont} bind def
+/sf {setfont} bind def
+/scf {scalefont} bind def
+/sw {stringwidth} bind def
+/tr {translate} bind def
+/tnt {dup dup currentrgbcolor
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb}
+ bind def
+/shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul
+ 4 -2 roll mul srgb} bind def
+ /DrawEllipse {
+ /endangle exch def
+ /startangle exch def
+ /yrad exch def
+ /xrad exch def
+ /y exch def
+ /x exch def
+ /savematrix mtrx currentmatrix def
+ x y tr xrad yrad sc 0 0 1 startangle endangle arc
+ closepath
+ savematrix setmatrix
+ } def
+
+/$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def
+/$F2psEnd {$F2psEnteredState restore end} def
+
+$F2psBegin
+10 setmiterlimit
+0 slj 0 slc
+ 0.06000 0.06000 sc
+%
+% Fig objects follow
+%
+%
+% here starts figure with depth 0
+% Arc
+7.500 slw
+gs clippath
+2592 2142 m 2544 2084 l 2403 2198 l 2544 2133 l 2451 2256 l cp
+eoclip
+n 2068.5 1649.8 680.1 103.9 44.1 arcn
+gs col-1 s gr
+ gr
+
+% arrowhead
+n 2451 2256 m 2544 2133 l 2403 2198 l 2451 2256 l cp gs 0.00 setgray ef gr col-1 s
+% Arc
+gs clippath
+4195 3222 m 4123 3199 l 4068 3371 l 4150 3240 l 4140 3394 l cp
+eoclip
+n 2866.1 2901.2 1328.9 63.9 14.1 arcn
+gs col-1 s gr
+ gr
+
+% arrowhead
+n 4140 3394 m 4150 3240 l 4068 3371 l 4140 3394 l cp gs 0.00 setgray ef gr col-1 s
+% Ellipse
+n 2925 2790 225 225 0 360 DrawEllipse gs 0.00 setgray ef gr gs col-1 s gr
+
+% Ellipse
+n 5445 3600 225 225 0 360 DrawEllipse gs 0.00 setgray ef gr gs col-1 s gr
+
+% Ellipse
+n 3645 2040 300 300 0 360 DrawEllipse gs col-1 s gr
+
+% Ellipse
+n 4530 1455 300 300 0 360 DrawEllipse gs col-1 s gr
+
+% Ellipse
+n 5360 2388 300 300 0 360 DrawEllipse gs col-1 s gr
+
+% Polyline
+30.000 slw
+n 1905 570 m
+ 2790 2625 l gs col-1 s gr
+% Polyline
+n 3090 2895 m
+ 5250 3540 l gs col-1 s gr
+% Polyline
+7.500 slw
+ [60] 0 sd
+n 1905 570 m
+ 1905 2475 l gs col-1 s gr [] 0 sd
+% Polyline
+gs clippath
+5368 3377 m 5463 3372 l 5448 3120 l 5414 3342 l 5354 3126 l cp
+eoclip
+n 5377 2692 m
+ 5415 3360 l gs col-1 s gr gr
+
+% arrowhead
+n 5354 3126 m 5414 3342 l 5448 3120 l 5404 3167 l 5354 3126 l
+ cp gs 0.00 setgray ef gr col-1 s
+% Polyline
+ [60] 0 sd
+n 2970 3030 m
+ 3555 4380 l gs col-1 s gr [] 0 sd
+% Polyline
+n 6315 570 m 165 570 l 165 120 l 6315 120 l
+ cp gs 0.50 setgray ef gr gs col0 s gr
+% Polyline
+gs clippath
+3030 2572 m 3097 2639 l 3276 2460 l 3088 2582 l 3209 2393 l cp
+eoclip
+n 3420 2250 m
+ 3075 2595 l gs col-1 s gr gr
+
+% arrowhead
+n 3209 2393 m 3088 2582 l 3276 2460 l 3211 2458 l 3209 2393 l
+ cp gs 0.00 setgray ef gr col-1 s
+% Polyline
+gs clippath
+4463 549 m 4369 560 l 4397 810 l 4420 588 l 4492 799 l cp
+eoclip
+n 4485 1155 m
+ 4418 570 l gs col-1 s gr gr
+
+% arrowhead
+n 4492 799 m 4420 588 l 4397 810 l 4439 761 l 4492 799 l
+ cp gs 0.00 setgray ef gr col-1 s
+/Times-Roman ff 270.00 scf sf
+2475 1650 m
+gs 1 -1 sc (L1) col-1 sh gr
+/Times-Roman ff 270.00 scf sf
+4440 1545 m
+gs 1 -1 sc (N) col-1 sh gr
+/Times-Roman ff 270.00 scf sf
+3525 2130 m
+gs 1 -1 sc (P1) col-1 sh gr
+/Times-Roman ff 270.00 scf sf
+2070 2054 m
+gs 1 -1 sc (q1) col-1 sh gr
+/Times-Roman ff 270.00 scf sf
+3457 3518 m
+gs 1 -1 sc (q2) col-1 sh gr
+/Times-Roman ff 270.00 scf sf
+4080 3060 m
+gs 1 -1 sc (L2) col-1 sh gr
+/Times-Roman ff 270.00 scf sf
+5227 2467 m
+gs 1 -1 sc (P2) col-1 sh gr
+% here ends figure;
+$F2psEnd
+rs
+showpage
+
+%%EndDocument
+ @endspecial 1559 772 a
+ /End PSfrag
+ 1559 772 a 1559 -3 a
+ /Hide PSfrag
+ 1559 -3
+a 748 61 a Fd(PSfrag)30 b(replacemen)m(ts)p 748 92 811
+4 v 1559 95 a
+ /Unhide PSfrag
+ 1559 95 a 1477 194 a
+ {
+ 1477 194 a Fc(\022)1520
+208 y Fb(1)1477 194 y
+ } 0/Place PSfrag
+ 1477 194 a 1477 307 a
+ {
+ 1477 307
+a Fc(\022)1520 321 y Fb(2)1477 307 y
+ } 1/Place PSfrag
+ 1477 307 a 1457
+420 a
+ {
+ 1457 420 a Fc(L)1519 434 y Fb(1)1457 420 y
+ } 2/Place PSfrag
+ 1457
+420 a 1457 533 a
+ {
+ 1457 533 a Fc(L)1519 547 y Fb(2)1457
+533 y
+ } 3/Place PSfrag
+ 1457 533 a 1510 622 a
+ {
+ 1510 622 a 1461 646 a Fc(P)1519
+660 y Fb(1)1510 622 y
+ } 4/Place PSfrag
+ 1510 622 a 1508 731 a
+ {
+ 1508 731
+a 1457 757 a Fa(P)1520 772 y Fb(2)1508 731 y
+ } 5/Place PSfrag
+ 1508 731
+a eop end
+%%Trailer
+
+userdict /end-hook known{end-hook}if
+%%EOF
+
+%%EndDocument
+ @endspecial 2419 1713 a(Figure)h(10:)p 0 TeXcolorgray
+Black 41 w(With)g(PSfrag)f(Replacemen)m(t)p Black 630
+2048 a FB(15.2)112 b(PSfrag)38 b(Example)h(#2)630 2220
+y FQ(This)20 b(example)i(demonstrates)g(ho)m(w)f(the)h
+FM(\\shortstack)p FQ(,)e FM(\\colorbox)p FQ(,)h(and)g
+FM(\\fcolorbox)d FQ(com-)630 2333 y(mands)29 b(can)i(b)s(e)f(used)f
+(with)h FM(\\psfrag)p FQ(.)p Black 630 2480 a FL(shortstac)m(k)p
+Black 46 w FQ(The)g FM(\\shortstack)e FQ(command)i(allo)m(ws)i(text)f
+(to)g(b)s(e)f(stac)m(k)m(ed)j(v)m(ertically)-8 b(,)33
+b(whic)m(h)857 2593 y(can)j(b)s(e)f(used)g(to)h(substitute)f(m)m
+(ultiple)h(lines)g(of)g(text)g(for)g(a)g(single)g(line)g(of)f(text.)57
+b(The)857 2706 y(lines)31 b(of)f(text)i(are)f(separated)f(b)m(y)h(the)f
+FM(\\\\)g FQ(command.)p Black 630 2864 a FL(colorb)s(o)m(x)p
+Black 47 w FQ(The)e FM(\\colorbox)e FQ(command)i(\(part)g(of)g(the)h
+FO(colo)m(r)i FQ(pac)m(k)-5 b(age,)31 b(whic)m(h)d(is)g(distributed)857
+2963 y(with)44 b(L)1102 2947 y FP(A)1141 2963 y FQ(T)1192
+2983 y(E)1243 2963 y(X\))g(places)h(a)g(rectangular)g(color)h(bac)m
+(kground)e(b)s(ehind)e(an)i(ob)5 b(ject.)83 b(The)857
+3063 y(distance)37 b(that)f(the)g(bac)m(kground)g(extends)g(b)s(ey)m
+(ond)f(the)h(ob)5 b(ject)37 b(is)f(con)m(trolled)h(b)m(y)f(the)857
+3163 y FM(\\fboxsep)28 b FQ(length.)42 b(F)-8 b(or)31
+b(example,)p Black Black 1119 3292 a FN(\\colorbox{white})o({t)o(ext)o
+(})857 3435 y FQ(places)k(a)f(rectangular)g(white)g(bac)m(kground)f(b)s
+(ehind)f FM(text)p FQ(.)49 b(See)34 b(the)g(graphics)f(bundle)857
+3548 y(do)s(cumen)m(tation)e([)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk(7)p Black 1 w(])g(for)f(details)h(on)g FM(\\colorbox)p
+FQ(.)857 3690 y(With)i FJ(ps)p FQ(frag,)e FM(\\colorbox)f
+FQ(is)h(useful)h(for)f(placing)i(text)f(at)h(a)f(lo)s(cation)i(where)d
+(lines)h(or)857 3803 y(shading)g(w)m(ould)h(mak)m(e)h(it)f(di\016cult)f
+(to)i(view)f(the)g(text.)48 b(Placing)34 b(a)f(white)g(bac)m(kground)
+857 3916 y(b)s(ehind)c(the)h(text)i(prev)m(en)m(ts)f(the)f(dra)m(wing)g
+(from)g(obstructing)h(the)f(text.)p Black 630 4087 a
+FL(fcolorb)s(o)m(x)p Black 47 w FQ(The)i FM(\\fcolorbox)e
+FQ(command)i(\(also)h(part)g(of)f(the)h FO(colo)m(r)i
+FQ(pac)m(k)-5 b(age\))35 b(is)d(similar)h(to)857 4200
+y(the)23 b FM(\\colorbox)d FQ(command,)k(except)g(that)f(a)g(frame)g
+(is)g(dra)m(wn)e(around)h(the)h(bac)m(kground.)857 4313
+y(The)g(command)71 b FM(\\fcolorbox{black}{white}{)o(text)o(})65
+b FQ(puts)23 b(a)h(white)f(bac)m(kground)857 4426 y(with)30
+b(a)h(rectangular)g(blac)m(k)h(frame)e(b)s(ehind)f FM(text)p
+FQ(.)857 4568 y(The)45 b(thic)m(kness)g(of)g(the)g(frame)g(is)g(con)m
+(trolled)h(b)m(y)f(the)g(length)g FM(\\fboxrule)d FQ(and)j(the)857
+4681 y(spacing)g(b)s(et)m(w)m(een)h(the)f(frame)g(and)f(the)h(text/ob)5
+b(ject)47 b(is)e(con)m(trolled)i(b)m(y)d(the)i(length)857
+4794 y FM(\\fboxsep)p FQ(.)630 4928 y(Figure)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 31 w(11)p Black 31 w(sho)m(ws)30 b(the)h(graphic)f
+(without)h FJ(ps)p FQ(frag)e(substitution.)41 b(The)30
+b(commands)p Black Black 848 5028 a FN(\\psfrag{q1}[][]{)o(\\c)o(olo)o
+(rb)o(ox{)o(wh)o(ite)o(}{)o($q)o(_1$)o(}})848 5128 y
+(\\psfrag{base}{\\f)o(co)o(lor)o(bo)o(x{b)o(la)o(ck})o({w)o(hi)o(te})o
+({B)o(ase)o(}})848 5227 y(\\psfrag{Actuator)o(}[)o(l][)o(l])o({\\s)o
+(ho)o(rts)o(ta)o(ck)o({Hy)o(dr)o(aul)o(ic)o(\\\\)37 b(Actuator}})848
+5327 y(\\includegraphics)o({m)o(ass)o(.e)o(ps})630 5441
+y FQ(use)30 b FJ(ps)p FQ(frag)g(to)h(pro)s(duce)e(the)i(graphics)f(in)g
+(Figure)p 0.05 1.00 1.00 0.40 TeXcolorcmyk 31 w(12)p
+Black(.)p Black 2250 5640 a(47)p Black eop end
+%%Page: 48 48
+TeXDict begin 48 47 bop Black 0 TeXcolorgray Black Black
+Black 630 568 a @beginspecial 0 @llx 0 @lly 240 @urx
+119 @ury 1878 @rwi @setspecial
+%%BeginDocument: mass.eps
+%!PS-Adobe-2.0 EPSF-2.0
+%%Title: mass.fig
+%%Creator: fig2dev Version 3.2 Patchlevel 4
+%%CreationDate: Sun May 22 21:40:56 2005
+%%For: epstein@linux (Becky Epstein)
+%%BoundingBox: 0 0 240 119
+%%Magnification: 1.0000
+%%EndComments
+/$F2psDict 200 dict def
+$F2psDict begin
+$F2psDict /mtrx matrix put
+/col-1 {0 setgray} bind def
+/col0 {0.000 0.000 0.000 srgb} bind def
+/col1 {0.000 0.000 1.000 srgb} bind def
+/col2 {0.000 1.000 0.000 srgb} bind def
+/col3 {0.000 1.000 1.000 srgb} bind def
+/col4 {1.000 0.000 0.000 srgb} bind def
+/col5 {1.000 0.000 1.000 srgb} bind def
+/col6 {1.000 1.000 0.000 srgb} bind def
+/col7 {1.000 1.000 1.000 srgb} bind def
+/col8 {0.000 0.000 0.560 srgb} bind def
+/col9 {0.000 0.000 0.690 srgb} bind def
+/col10 {0.000 0.000 0.820 srgb} bind def
+/col11 {0.530 0.810 1.000 srgb} bind def
+/col12 {0.000 0.560 0.000 srgb} bind def
+/col13 {0.000 0.690 0.000 srgb} bind def
+/col14 {0.000 0.820 0.000 srgb} bind def
+/col15 {0.000 0.560 0.560 srgb} bind def
+/col16 {0.000 0.690 0.690 srgb} bind def
+/col17 {0.000 0.820 0.820 srgb} bind def
+/col18 {0.560 0.000 0.000 srgb} bind def
+/col19 {0.690 0.000 0.000 srgb} bind def
+/col20 {0.820 0.000 0.000 srgb} bind def
+/col21 {0.560 0.000 0.560 srgb} bind def
+/col22 {0.690 0.000 0.690 srgb} bind def
+/col23 {0.820 0.000 0.820 srgb} bind def
+/col24 {0.500 0.190 0.000 srgb} bind def
+/col25 {0.630 0.250 0.000 srgb} bind def
+/col26 {0.750 0.380 0.000 srgb} bind def
+/col27 {1.000 0.500 0.500 srgb} bind def
+/col28 {1.000 0.630 0.630 srgb} bind def
+/col29 {1.000 0.750 0.750 srgb} bind def
+/col30 {1.000 0.880 0.880 srgb} bind def
+/col31 {1.000 0.840 0.000 srgb} bind def
+
+end
+save
+newpath 0 119 moveto 0 0 lineto 240 0 lineto 240 119 lineto closepath clip newpath
+-84.8 162.7 translate
+1 -1 scale
+
+/cp {closepath} bind def
+/ef {eofill} bind def
+/gr {grestore} bind def
+/gs {gsave} bind def
+/sa {save} bind def
+/rs {restore} bind def
+/l {lineto} bind def
+/m {moveto} bind def
+/rm {rmoveto} bind def
+/n {newpath} bind def
+/s {stroke} bind def
+/sh {show} bind def
+/slc {setlinecap} bind def
+/slj {setlinejoin} bind def
+/slw {setlinewidth} bind def
+/srgb {setrgbcolor} bind def
+/rot {rotate} bind def
+/sc {scale} bind def
+/sd {setdash} bind def
+/ff {findfont} bind def
+/sf {setfont} bind def
+/scf {scalefont} bind def
+/sw {stringwidth} bind def
+/tr {translate} bind def
+/tnt {dup dup currentrgbcolor
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb}
+ bind def
+/shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul
+ 4 -2 roll mul srgb} bind def
+/$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def
+/$F2psEnd {$F2psEnteredState restore end} def
+
+$F2psBegin
+10 setmiterlimit
+0 slj 0 slc
+ 0.06000 0.06000 sc
+%
+% Fig objects follow
+%
+%
+% here starts figure with depth 0
+% Polyline
+7.500 slw
+n 1425 1125 m 1425 2700 l 5400 2700 l 5400 2100 l 1875 2100 l 1875 1125 l
+
+ cp gs col7 0.75 shd ef gr gs col-1 s gr
+% Polyline
+n 2550 1575 m 3450 1575 l 3450 1875 l 2550 1875 l
+ cp gs col7 0.95 shd ef gr gs col-1 s gr
+% Polyline
+n 3450 1275 m
+ 3450 755 l gs col-1 s gr
+% Polyline
+n 1875 1050 m
+ 1875 750 l gs col-1 s gr
+% Polyline
+gs clippath
+3465 930 m 3465 870 l 3280 870 l 3430 900 l 3280 930 l cp
+1860 870 m 1860 930 l 2045 930 l 1895 900 l 2045 870 l cp
+eoclip
+n 1875 900 m
+ 3450 900 l gs col-1 s gr gr
+
+% arrowhead
+n 2045 870 m 1895 900 l 2045 930 l 2015 900 l 2045 870 l
+ cp gs 0.00 setgray ef gr col-1 s
+% arrowhead
+n 3280 930 m 3430 900 l 3280 870 l 3310 900 l 3280 930 l
+ cp gs 0.00 setgray ef gr col-1 s
+% Polyline
+n 1875 1650 m 2550 1650 l 2550 1800 l 1875 1800 l
+ cp gs col7 0.90 shd ef gr gs col-1 s gr
+% Polyline
+gs clippath
+2895 1560 m 2931 1608 l 3079 1497 l 2941 1563 l 3043 1449 l cp
+eoclip
+n 3825 900 m
+ 2925 1575 l gs col-1 s gr gr
+
+% arrowhead
+n 3043 1449 m 2941 1563 l 3079 1497 l 3037 1491 l 3043 1449 l
+ cp gs 0.00 setgray ef gr col-1 s
+% Polyline
+n 3450 2100 m 4425 2100 l 4425 1350 l 3450 1350 l
+ cp gs col7 0.55 shd ef gr gs col-1 s gr
+/Times-Roman ff 180.00 scf sf
+2570 935 m
+gs 1 -1 sc (q1) col-1 sh gr
+/Times-Roman ff 180.00 scf sf
+3850 945 m
+gs 1 -1 sc (Actuator) col-1 sh gr
+/Times-Roman ff 210.00 scf sf
+2520 2452 m
+gs 1 -1 sc (base) col-1 sh gr
+% here ends figure;
+$F2psEnd
+rs
+showpage
+
+%%EndDocument
+ @endspecial 170 x FQ(Figure)55 b(11:)p 0 TeXcolorgray
+Black 89 w(Without)g(PSfrag)e(Replace-)630 851 y(men)m(t)2395
+568 y @beginspecial 252 @llx 654 @lly 436 @urx 749 @ury
+1878 @rwi @setspecial
+%%BeginDocument: mass_frag.eps
+%!PS-Adobe-2.0 EPSF-2.0
+%%BoundingBox: 252 654 436 749
+%%HiResBoundingBox: 252.011 654.131 435.604 748.05
+%%Creator: dvips(k) 5.94b Copyright 2004 Radical Eye Software
+%%Title: mass_frag.dvi
+%%CreationDate: Sat May 28 13:28:53 2005
+%%DocumentFonts: CMR10 CMMI10 CMR8
+%%EndComments
+%DVIPSWebPage: (www.radicaleye.com)
+%DVIPSCommandLine: dvips -E mass_frag
+%DVIPSParameters: dpi=600
+%DVIPSSource: TeX output 2005.05.28:1328
+%%BeginProcSet: tex.pro 0 0
+%!
+/TeXDict 300 dict def TeXDict begin/N{def}def/B{bind def}N/S{exch}N/X{S
+N}B/A{dup}B/TR{translate}N/isls false N/vsize 11 72 mul N/hsize 8.5 72
+mul N/landplus90{false}def/@rigin{isls{[0 landplus90{1 -1}{-1 1}ifelse 0
+0 0]concat}if 72 Resolution div 72 VResolution div neg scale isls{
+landplus90{VResolution 72 div vsize mul 0 exch}{Resolution -72 div hsize
+mul 0}ifelse TR}if Resolution VResolution vsize -72 div 1 add mul TR[
+matrix currentmatrix{A A round sub abs 0.00001 lt{round}if}forall round
+exch round exch]setmatrix}N/@landscape{/isls true N}B/@manualfeed{
+statusdict/manualfeed true put}B/@copies{/#copies X}B/FMat[1 0 0 -1 0 0]
+N/FBB[0 0 0 0]N/nn 0 N/IEn 0 N/ctr 0 N/df-tail{/nn 8 dict N nn begin
+/FontType 3 N/FontMatrix fntrx N/FontBBox FBB N string/base X array
+/BitMaps X/BuildChar{CharBuilder}N/Encoding IEn N end A{/foo setfont}2
+array copy cvx N load 0 nn put/ctr 0 N[}B/sf 0 N/df{/sf 1 N/fntrx FMat N
+df-tail}B/dfs{div/sf X/fntrx[sf 0 0 sf neg 0 0]N df-tail}B/E{pop nn A
+definefont setfont}B/Cw{Cd A length 5 sub get}B/Ch{Cd A length 4 sub get
+}B/Cx{128 Cd A length 3 sub get sub}B/Cy{Cd A length 2 sub get 127 sub}
+B/Cdx{Cd A length 1 sub get}B/Ci{Cd A type/stringtype ne{ctr get/ctr ctr
+1 add N}if}B/CharBuilder{save 3 1 roll S A/base get 2 index get S
+/BitMaps get S get/Cd X pop/ctr 0 N Cdx 0 Cx Cy Ch sub Cx Cw add Cy
+setcachedevice Cw Ch true[1 0 0 -1 -.1 Cx sub Cy .1 sub]{Ci}imagemask
+restore}B/D{/cc X A type/stringtype ne{]}if nn/base get cc ctr put nn
+/BitMaps get S ctr S sf 1 ne{A A length 1 sub A 2 index S get sf div put
+}if put/ctr ctr 1 add N}B/I{cc 1 add D}B/bop{userdict/bop-hook known{
+bop-hook}if/SI save N @rigin 0 0 moveto/V matrix currentmatrix A 1 get A
+mul exch 0 get A mul add .99 lt{/QV}{/RV}ifelse load def pop pop}N/eop{
+SI restore userdict/eop-hook known{eop-hook}if showpage}N/@start{
+userdict/start-hook known{start-hook}if pop/VResolution X/Resolution X
+1000 div/DVImag X/IEn 256 array N 2 string 0 1 255{IEn S A 360 add 36 4
+index cvrs cvn put}for pop 65781.76 div/vsize X 65781.76 div/hsize X}N
+/p{show}N/RMat[1 0 0 -1 0 0]N/BDot 260 string N/Rx 0 N/Ry 0 N/V{}B/RV/v{
+/Ry X/Rx X V}B statusdict begin/product where{pop false[(Display)(NeXT)
+(LaserWriter 16/600)]{A length product length le{A length product exch 0
+exch getinterval eq{pop true exit}if}{pop}ifelse}forall}{false}ifelse
+end{{gsave TR -.1 .1 TR 1 1 scale Rx Ry false RMat{BDot}imagemask
+grestore}}{{gsave TR -.1 .1 TR Rx Ry scale 1 1 false RMat{BDot}
+imagemask grestore}}ifelse B/QV{gsave newpath transform round exch round
+exch itransform moveto Rx 0 rlineto 0 Ry neg rlineto Rx neg 0 rlineto
+fill grestore}B/a{moveto}B/delta 0 N/tail{A/delta X 0 rmoveto}B/M{S p
+delta add tail}B/b{S p tail}B/c{-4 M}B/d{-3 M}B/e{-2 M}B/f{-1 M}B/g{0 M}
+B/h{1 M}B/i{2 M}B/j{3 M}B/k{4 M}B/w{0 rmoveto}B/l{p -4 w}B/m{p -3 w}B/n{
+p -2 w}B/o{p -1 w}B/q{p 1 w}B/r{p 2 w}B/s{p 3 w}B/t{p 4 w}B/x{0 S
+rmoveto}B/y{3 2 roll p a}B/bos{/SS save N}B/eos{SS restore}B end
+
+%%EndProcSet
+%%BeginProcSet: psfrag.pro 0 0
+%%
+%% This is file `psfrag.pro',
+%% generated with the docstrip utility.
+%%
+%% The original source files were:
+%%
+%% psfrag.dtx (with options: `filepro')
+%%
+%% Copyright (c) 1996 Craig Barratt, Michael C. Grant, and David Carlisle.
+%% All rights reserved.
+%%
+%% This file is part of the PSfrag package.
+%%
+userdict begin
+/PSfragLib 90 dict def
+/PSfragDict 6 dict def
+/PSfrag { PSfragLib begin load exec end } bind def
+end
+PSfragLib begin
+/RO /readonly load def
+/CP /currentpoint load def
+/CM /currentmatrix load def
+/B { bind RO def } bind def
+/X { exch def } B
+/MD { { X } forall } B
+/OE { end exec PSfragLib begin } B
+/S false def
+/tstr 8 string def
+/islev2 { languagelevel } stopped { false } { 2 ge } ifelse def
+[ /sM /tM /srcM /dstM /dM /idM /srcFM /dstFM ] { matrix def } forall
+sM currentmatrix RO pop
+dM defaultmatrix RO idM invertmatrix RO pop
+srcFM identmatrix pop
+/Hide { gsave { CP } stopped not newpath clip { moveto } if } B
+/Unhide { { CP } stopped not grestore { moveto } if } B
+/setrepl islev2 {{ /glob currentglobal def true setglobal array astore
+ globaldict exch /PSfrags exch put glob setglobal }}
+ {{ array astore /PSfrags X }} ifelse B
+/getrepl islev2 {{ globaldict /PSfrags get aload length }}
+ {{ PSfrags aload length }} ifelse B
+/convert {
+ /src X src length string
+ /c 0 def src length {
+ dup c src c get dup 32 lt { pop 32 } if put /c c 1 add def
+ } repeat
+} B
+/Begin {
+ /saver save def
+ srcFM exch 3 exch put
+ 0 ne /debugMode X 0 setrepl
+ dup /S exch dict def { S 3 1 roll exch convert exch put } repeat
+ srcM CM dup invertmatrix pop
+ mark { currentdict { end } stopped { pop exit } if } loop
+ PSfragDict counttomark { begin } repeat pop
+} B
+/End {
+ mark { currentdict end dup PSfragDict eq { pop exit } if } loop
+ counttomark { begin } repeat pop
+ getrepl saver restore
+ 7 idiv dup /S exch dict def {
+ 6 array astore /mtrx X tstr cvs /K X
+ S K [ S K known { S K get aload pop } if mtrx ] put
+ } repeat
+} B
+/Place {
+ tstr cvs /K X
+ S K known {
+ bind /proc X tM CM pop
+ CP /cY X /cX X
+ 0 0 transform idtransform neg /aY X neg /aX X
+ S K get dup length /maxiter X
+ /iter 1 def {
+ iter maxiter ne { /saver save def } if
+ tM setmatrix aX aY translate
+ [ exch aload pop idtransform ] concat
+ cX neg cY neg translate cX cY moveto
+ /proc load OE
+ iter maxiter ne { saver restore /iter iter 1 add def } if
+ } forall
+ /noXY { CP /cY X /cX X } stopped def
+ tM setmatrix noXY { newpath } { cX cY moveto } ifelse
+ } {
+ Hide OE Unhide
+ } ifelse
+} B
+/normalize {
+ 2 index dup mul 2 index dup mul add sqrt div
+ dup 4 -1 roll exch mul 3 1 roll mul
+} B
+/replace {
+ aload pop MD
+ CP /bY X /lX X gsave sM setmatrix
+ str stringwidth abs exch abs add dup 0 eq
+ { pop } { 360 exch div dup scale } ifelse
+ lX neg bY neg translate newpath lX bY moveto
+ str { /ch X ( ) dup 0 ch put false charpath ch Kproc } forall
+ flattenpath pathbbox [ /uY /uX /lY /lX ] MD
+ CP grestore moveto
+ currentfont /FontMatrix get dstFM copy dup
+ 0 get 0 lt { uX lX /uX X /lX X } if
+ 3 get 0 lt { uY lY /uY X /lY X } if
+ /cX uX lX add 0.5 mul def
+ /cY uY lY add 0.5 mul def
+ debugMode { gsave 0 setgray 1 setlinewidth
+ lX lY moveto lX uY lineto uX uY lineto uX lY lineto closepath
+ lX bY moveto uX bY lineto lX cY moveto uX cY lineto
+ cX lY moveto cX uY lineto stroke
+ grestore } if
+ dstFM dup invertmatrix dstM CM srcM
+ 2 { dstM concatmatrix } repeat pop
+ getrepl /temp X
+ S str convert get {
+ aload pop [ /rot /scl /loc /K ] MD
+ /aX cX def /aY cY def
+ loc {
+ dup 66 eq { /aY bY def } { % B
+ dup 98 eq { /aY lY def } { % b
+ dup 108 eq { /aX lX def } { % l
+ dup 114 eq { /aX uX def } { % r
+ dup 116 eq { /aY uY def } % t
+ if } ifelse } ifelse } ifelse } ifelse pop
+ } forall
+ K srcFM rot tM rotate dstM
+ 2 { tM concatmatrix } repeat aload pop pop pop
+ 2 { scl normalize 4 2 roll } repeat
+ aX aY transform
+ /temp temp 7 add def
+ } forall
+ temp setrepl
+} B
+/Rif {
+ S 3 index convert known { pop replace } { exch pop OE } ifelse
+} B
+/XA { bind [ /Kproc /str } B /XC { ] 2 array astore def } B
+/xs { pop } XA XC
+/xks { /kern load OE } XA /kern XC
+/xas { pop ax ay rmoveto } XA /ay /ax XC
+/xws { c eq { cx cy rmoveto } if } XA /c /cy /cx XC
+/xaws { ax ay rmoveto c eq { cx cy rmoveto } if }
+ XA /ay /ax /c /cy /cx XC
+/raws { xaws { awidthshow } Rif } B
+/rws { xws { widthshow } Rif } B
+/rks { xks { kshow } Rif } B
+/ras { xas { ashow } Rif } B
+/rs { xs { show } Rif } B
+/rrs { getrepl dup 2 add -1 roll //restore exec setrepl } B
+PSfragDict begin
+islev2 not { /restore { /rrs PSfrag } B } if
+/show { /rs PSfrag } B
+/kshow { /rks PSfrag } B
+/ashow { /ras PSfrag } B
+/widthshow { /rws PSfrag } B
+/awidthshow { /raws PSfrag } B
+end PSfragDict RO pop
+end
+
+%%EndProcSet
+%%BeginProcSet: texps.pro 0 0
+%!
+TeXDict begin/rf{findfont dup length 1 add dict begin{1 index/FID ne 2
+index/UniqueID ne and{def}{pop pop}ifelse}forall[1 index 0 6 -1 roll
+exec 0 exch 5 -1 roll VResolution Resolution div mul neg 0 0]/Metrics
+exch def dict begin Encoding{exch dup type/integertype ne{pop pop 1 sub
+dup 0 le{pop}{[}ifelse}{FontMatrix 0 get div Metrics 0 get div def}
+ifelse}forall Metrics/Metrics currentdict end def[2 index currentdict
+end definefont 3 -1 roll makefont/setfont cvx]cvx def}def/ObliqueSlant{
+dup sin S cos div neg}B/SlantFont{4 index mul add}def/ExtendFont{3 -1
+roll mul exch}def/ReEncodeFont{CharStrings rcheck{/Encoding false def
+dup[exch{dup CharStrings exch known not{pop/.notdef/Encoding true def}
+if}forall Encoding{]exch pop}{cleartomark}ifelse}if/Encoding exch def}
+def end
+
+%%EndProcSet
+%%BeginProcSet: special.pro 0 0
+%!
+TeXDict begin/SDict 200 dict N SDict begin/@SpecialDefaults{/hs 612 N
+/vs 792 N/ho 0 N/vo 0 N/hsc 1 N/vsc 1 N/ang 0 N/CLIP 0 N/rwiSeen false N
+/rhiSeen false N/letter{}N/note{}N/a4{}N/legal{}N}B/@scaleunit 100 N
+/@hscale{@scaleunit div/hsc X}B/@vscale{@scaleunit div/vsc X}B/@hsize{
+/hs X/CLIP 1 N}B/@vsize{/vs X/CLIP 1 N}B/@clip{/CLIP 2 N}B/@hoffset{/ho
+X}B/@voffset{/vo X}B/@angle{/ang X}B/@rwi{10 div/rwi X/rwiSeen true N}B
+/@rhi{10 div/rhi X/rhiSeen true N}B/@llx{/llx X}B/@lly{/lly X}B/@urx{
+/urx X}B/@ury{/ury X}B/magscale true def end/@MacSetUp{userdict/md known
+{userdict/md get type/dicttype eq{userdict begin md length 10 add md
+maxlength ge{/md md dup length 20 add dict copy def}if end md begin
+/letter{}N/note{}N/legal{}N/od{txpose 1 0 mtx defaultmatrix dtransform S
+atan/pa X newpath clippath mark{transform{itransform moveto}}{transform{
+itransform lineto}}{6 -2 roll transform 6 -2 roll transform 6 -2 roll
+transform{itransform 6 2 roll itransform 6 2 roll itransform 6 2 roll
+curveto}}{{closepath}}pathforall newpath counttomark array astore/gc xdf
+pop ct 39 0 put 10 fz 0 fs 2 F/|______Courier fnt invertflag{PaintBlack}
+if}N/txpose{pxs pys scale ppr aload pop por{noflips{pop S neg S TR pop 1
+-1 scale}if xflip yflip and{pop S neg S TR 180 rotate 1 -1 scale ppr 3
+get ppr 1 get neg sub neg ppr 2 get ppr 0 get neg sub neg TR}if xflip
+yflip not and{pop S neg S TR pop 180 rotate ppr 3 get ppr 1 get neg sub
+neg 0 TR}if yflip xflip not and{ppr 1 get neg ppr 0 get neg TR}if}{
+noflips{TR pop pop 270 rotate 1 -1 scale}if xflip yflip and{TR pop pop
+90 rotate 1 -1 scale ppr 3 get ppr 1 get neg sub neg ppr 2 get ppr 0 get
+neg sub neg TR}if xflip yflip not and{TR pop pop 90 rotate ppr 3 get ppr
+1 get neg sub neg 0 TR}if yflip xflip not and{TR pop pop 270 rotate ppr
+2 get ppr 0 get neg sub neg 0 S TR}if}ifelse scaleby96{ppr aload pop 4
+-1 roll add 2 div 3 1 roll add 2 div 2 copy TR .96 dup scale neg S neg S
+TR}if}N/cp{pop pop showpage pm restore}N end}if}if}N/normalscale{
+Resolution 72 div VResolution 72 div neg scale magscale{DVImag dup scale
+}if 0 setgray}N/psfts{S 65781.76 div N}N/startTexFig{/psf$SavedState
+save N userdict maxlength dict begin/magscale true def normalscale
+currentpoint TR/psf$ury psfts/psf$urx psfts/psf$lly psfts/psf$llx psfts
+/psf$y psfts/psf$x psfts currentpoint/psf$cy X/psf$cx X/psf$sx psf$x
+psf$urx psf$llx sub div N/psf$sy psf$y psf$ury psf$lly sub div N psf$sx
+psf$sy scale psf$cx psf$sx div psf$llx sub psf$cy psf$sy div psf$ury sub
+TR/showpage{}N/erasepage{}N/copypage{}N/p 3 def @MacSetUp}N/doclip{
+psf$llx psf$lly psf$urx psf$ury currentpoint 6 2 roll newpath 4 copy 4 2
+roll moveto 6 -1 roll S lineto S lineto S lineto closepath clip newpath
+moveto}N/endTexFig{end psf$SavedState restore}N/@beginspecial{SDict
+begin/SpecialSave save N gsave normalscale currentpoint TR
+@SpecialDefaults count/ocount X/dcount countdictstack N}N/@setspecial{
+CLIP 1 eq{newpath 0 0 moveto hs 0 rlineto 0 vs rlineto hs neg 0 rlineto
+closepath clip}if ho vo TR hsc vsc scale ang rotate rwiSeen{rwi urx llx
+sub div rhiSeen{rhi ury lly sub div}{dup}ifelse scale llx neg lly neg TR
+}{rhiSeen{rhi ury lly sub div dup scale llx neg lly neg TR}if}ifelse
+CLIP 2 eq{newpath llx lly moveto urx lly lineto urx ury lineto llx ury
+lineto closepath clip}if/showpage{}N/erasepage{}N/copypage{}N newpath}N
+/@endspecial{count ocount sub{pop}repeat countdictstack dcount sub{end}
+repeat grestore SpecialSave restore end}N/@defspecial{SDict begin}N
+/@fedspecial{end}B/li{lineto}B/rl{rlineto}B/rc{rcurveto}B/np{/SaveX
+currentpoint/SaveY X N 1 setlinecap newpath}N/st{stroke SaveX SaveY
+moveto}N/fil{fill SaveX SaveY moveto}N/ellipse{/endangle X/startangle X
+/yrad X/xrad X/savematrix matrix currentmatrix N TR xrad yrad scale 0 0
+1 startangle endangle arc savematrix setmatrix}N end
+
+%%EndProcSet
+%%BeginProcSet: color.pro 0 0
+%!
+TeXDict begin/setcmykcolor where{pop}{/setcmykcolor{dup 10 eq{pop
+setrgbcolor}{1 sub 4 1 roll 3{3 index add neg dup 0 lt{pop 0}if 3 1 roll
+}repeat setrgbcolor pop}ifelse}B}ifelse/TeXcolorcmyk{setcmykcolor}def
+/TeXcolorrgb{setrgbcolor}def/TeXcolorgrey{setgray}def/TeXcolorgray{
+setgray}def/TeXcolorhsb{sethsbcolor}def/currentcmykcolor where{pop}{
+/currentcmykcolor{currentrgbcolor 10}B}ifelse/DC{exch dup userdict exch
+known{pop pop}{X}ifelse}B/GreenYellow{0.15 0 0.69 0 setcmykcolor}DC
+/Yellow{0 0 1 0 setcmykcolor}DC/Goldenrod{0 0.10 0.84 0 setcmykcolor}DC
+/Dandelion{0 0.29 0.84 0 setcmykcolor}DC/Apricot{0 0.32 0.52 0
+setcmykcolor}DC/Peach{0 0.50 0.70 0 setcmykcolor}DC/Melon{0 0.46 0.50 0
+setcmykcolor}DC/YellowOrange{0 0.42 1 0 setcmykcolor}DC/Orange{0 0.61
+0.87 0 setcmykcolor}DC/BurntOrange{0 0.51 1 0 setcmykcolor}DC
+/Bittersweet{0 0.75 1 0.24 setcmykcolor}DC/RedOrange{0 0.77 0.87 0
+setcmykcolor}DC/Mahogany{0 0.85 0.87 0.35 setcmykcolor}DC/Maroon{0 0.87
+0.68 0.32 setcmykcolor}DC/BrickRed{0 0.89 0.94 0.28 setcmykcolor}DC/Red{
+0 1 1 0 setcmykcolor}DC/OrangeRed{0 1 0.50 0 setcmykcolor}DC/RubineRed{
+0 1 0.13 0 setcmykcolor}DC/WildStrawberry{0 0.96 0.39 0 setcmykcolor}DC
+/Salmon{0 0.53 0.38 0 setcmykcolor}DC/CarnationPink{0 0.63 0 0
+setcmykcolor}DC/Magenta{0 1 0 0 setcmykcolor}DC/VioletRed{0 0.81 0 0
+setcmykcolor}DC/Rhodamine{0 0.82 0 0 setcmykcolor}DC/Mulberry{0.34 0.90
+0 0.02 setcmykcolor}DC/RedViolet{0.07 0.90 0 0.34 setcmykcolor}DC
+/Fuchsia{0.47 0.91 0 0.08 setcmykcolor}DC/Lavender{0 0.48 0 0
+setcmykcolor}DC/Thistle{0.12 0.59 0 0 setcmykcolor}DC/Orchid{0.32 0.64 0
+0 setcmykcolor}DC/DarkOrchid{0.40 0.80 0.20 0 setcmykcolor}DC/Purple{
+0.45 0.86 0 0 setcmykcolor}DC/Plum{0.50 1 0 0 setcmykcolor}DC/Violet{
+0.79 0.88 0 0 setcmykcolor}DC/RoyalPurple{0.75 0.90 0 0 setcmykcolor}DC
+/BlueViolet{0.86 0.91 0 0.04 setcmykcolor}DC/Periwinkle{0.57 0.55 0 0
+setcmykcolor}DC/CadetBlue{0.62 0.57 0.23 0 setcmykcolor}DC
+/CornflowerBlue{0.65 0.13 0 0 setcmykcolor}DC/MidnightBlue{0.98 0.13 0
+0.43 setcmykcolor}DC/NavyBlue{0.94 0.54 0 0 setcmykcolor}DC/RoyalBlue{1
+0.50 0 0 setcmykcolor}DC/Blue{1 1 0 0 setcmykcolor}DC/Cerulean{0.94 0.11
+0 0 setcmykcolor}DC/Cyan{1 0 0 0 setcmykcolor}DC/ProcessBlue{0.96 0 0 0
+setcmykcolor}DC/SkyBlue{0.62 0 0.12 0 setcmykcolor}DC/Turquoise{0.85 0
+0.20 0 setcmykcolor}DC/TealBlue{0.86 0 0.34 0.02 setcmykcolor}DC
+/Aquamarine{0.82 0 0.30 0 setcmykcolor}DC/BlueGreen{0.85 0 0.33 0
+setcmykcolor}DC/Emerald{1 0 0.50 0 setcmykcolor}DC/JungleGreen{0.99 0
+0.52 0 setcmykcolor}DC/SeaGreen{0.69 0 0.50 0 setcmykcolor}DC/Green{1 0
+1 0 setcmykcolor}DC/ForestGreen{0.91 0 0.88 0.12 setcmykcolor}DC
+/PineGreen{0.92 0 0.59 0.25 setcmykcolor}DC/LimeGreen{0.50 0 1 0
+setcmykcolor}DC/YellowGreen{0.44 0 0.74 0 setcmykcolor}DC/SpringGreen{
+0.26 0 0.76 0 setcmykcolor}DC/OliveGreen{0.64 0 0.95 0.40 setcmykcolor}
+DC/RawSienna{0 0.72 1 0.45 setcmykcolor}DC/Sepia{0 0.83 1 0.70
+setcmykcolor}DC/Brown{0 0.81 1 0.60 setcmykcolor}DC/Tan{0.14 0.42 0.56 0
+setcmykcolor}DC/Gray{0 0 0 0.50 setcmykcolor}DC/Black{0 0 0 1
+setcmykcolor}DC/White{0 0 0 0 setcmykcolor}DC end
+
+%%EndProcSet
+%%BeginFont: CMR8
+%!PS-AdobeFont-1.1: CMR8 1.0
+%%CreationDate: 1991 Aug 20 16:39:40
+% Copyright (C) 1997 American Mathematical Society. All Rights Reserved.
+11 dict begin
+/FontInfo 7 dict dup begin
+/version (1.0) readonly def
+/Notice (Copyright (C) 1997 American Mathematical Society. All Rights Reserved) readonly def
+/FullName (CMR8) readonly def
+/FamilyName (Computer Modern) readonly def
+/Weight (Medium) readonly def
+/ItalicAngle 0 def
+/isFixedPitch false def
+end readonly def
+/FontName /CMR8 def
+/PaintType 0 def
+/FontType 1 def
+/FontMatrix [0.001 0 0 0.001 0 0] readonly def
+/Encoding 256 array
+0 1 255 {1 index exch /.notdef put} for
+dup 49 /one put
+readonly def
+/FontBBox{-36 -250 1070 750}readonly def
+/UniqueID 5000791 def
+currentdict end
+currentfile eexec
+D9D66F633B846A97B686A97E45A3D0AA052A014267B7904EB3C0D3BD0B83D891
+016CA6CA4B712ADEB258FAAB9A130EE605E61F77FC1B738ABC7C51CD46EF8171
+9098D5FEE67660E69A7AB91B58F29A4D79E57022F783EB0FBBB6D4F4EC35014F
+D2DECBA99459A4C59DF0C6EBA150284454E707DC2100C15B76B4C19B84363758
+469A6C558785B226332152109871A9883487DD7710949204DDCF837E6A8708B8
+2BDBF16FBC7512FAA308A093FE5CF4E9D2405B169CD5365D6ECED5D768D66D6C
+68618B8C482B341F8CA38E9BB9BAFCFAAD9C2F3FD033B62690986ED43D9C9361
+3645B82392D5CAE11A7CB49D7E2E82DCD485CBA1772CE422BB1D7283AD675B65
+48A7EA0069A883EC1DAA3E1F9ECE7586D6CF0A128CD557C7E5D7AA3EA97EBAD3
+9619D1BFCF4A6D64768741EDEA0A5B0EFBBF347CDCBE2E03D756967A16B613DB
+0FC45FA2A3312E0C46A5FD0466AB097C58FFEEC40601B8395E52775D0AFCD7DB
+8AB317333110531E5C44A4CB4B5ACD571A1A60960B15E450948A5EEA14DD330F
+EA209265DB8E1A1FC80DCD3860323FD26C113B041A88C88A21655878680A4466
+FA10403D24BB97152A49B842C180E4D258C9D48F21D057782D90623116830BA3
+9902B3C5F2F2DD01433B0D7099C07DBDE268D0FFED5169BCD03D48B2F058AD62
+D8678C626DC7A3F352152C99BA963EF95F8AD11DB8B0D351210A17E4C2C55AD8
+9EB64172935D3C20A398F3EEEEC31551966A7438EF3FEE422C6D4E05337620D5
+ACC7B52BED984BFAAD36EF9D20748B05D07BE4414A63975125D272FAD83F76E6
+10FFF8363014BE526D580873C5A42B70FA911EC7B86905F13AFE55EB0273F582
+83158793B8CC296B8DE1DCCF1250FD57CB0E035C7EDA3B0092ED940D37A05493
+2EC54E09B984FCA4AB7D2EA182BCF1263AA244B07EC0EA901C077A059F709F30
+4384CB5FA748F2054FAD9A7A43D4EA427918BD414F766531136B60C3477C6632
+BEFE3897B58C19276A301926C2AEF2756B367319772C9B201C49B4D935A8267B
+041D6F1783B6AEA4DAC4F5B3507D7032AA640AAB12E343A4E9BDCF419C04A721
+3888B25AF4E293AACED9A6BDC78E61DA1C424C6503CC1885F762B93EC4488CF1
+43FF3B2A427C5E1C756D1925AEDB3B4A7C8275B3DD03F0E7BC7763D19E0208C6
+D09F51A1883ACF462E1C76C395331864B08D5EFA157EB3987FEBF0D50B02BC3D
+E9E3F9964F760093244CDCE61A99510E3D80055E7653950E8BE2E201F74FA145
+C6D43BAEE7FB7BD1FDC7D84CF7D60E7C2CA6B7DCC137EE4E6F5DD76446CD6A56
+87DADB906D1483ECECA680995A9A7B736CAF3C43E1B71B5E248F5D5D90F237E5
+2B14A39157E555159DD0DE5C78CF7EDE532374FF6A6A9703665ADF4234D87FA4
+3871EBC6254E1C5D00637AB2A30E29D11D8F2F9D030F3D6894A857CCF8EB36C2
+22EC11E3BB4FDFB2875415B71C8F87CED60577B7ED9A1AACFEFB
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+cleartomark
+%%EndFont
+%%BeginFont: CMMI10
+%!PS-AdobeFont-1.1: CMMI10 1.100
+%%CreationDate: 1996 Jul 23 07:53:57
+% Copyright (C) 1997 American Mathematical Society. All Rights Reserved.
+11 dict begin
+/FontInfo 7 dict dup begin
+/version (1.100) readonly def
+/Notice (Copyright (C) 1997 American Mathematical Society. All Rights Reserved) readonly def
+/FullName (CMMI10) readonly def
+/FamilyName (Computer Modern) readonly def
+/Weight (Medium) readonly def
+/ItalicAngle -14.04 def
+/isFixedPitch false def
+end readonly def
+/FontName /CMMI10 def
+/PaintType 0 def
+/FontType 1 def
+/FontMatrix [0.001 0 0 0.001 0 0] readonly def
+/Encoding 256 array
+0 1 255 {1 index exch /.notdef put} for
+dup 113 /q put
+readonly def
+/FontBBox{-32 -250 1048 750}readonly def
+/UniqueID 5087385 def
+currentdict end
+currentfile eexec
+D9D66F633B846A97B686A97E45A3D0AA0529731C99A784CCBE85B4993B2EEBDE
+3B12D472B7CF54651EF21185116A69AB1096ED4BAD2F646635E019B6417CC77B
+532F85D811C70D1429A19A5307EF63EB5C5E02C89FC6C20F6D9D89E7D91FE470
+B72BEFDA23F5DF76BE05AF4CE93137A219ED8A04A9D7D6FDF37E6B7FCDE0D90B
+986423E5960A5D9FBB4C956556E8DF90CBFAEC476FA36FD9A5C8175C9AF513FE
+D919C2DDD26BDC0D99398B9F4D03D5993DFC0930297866E1CD0A319B6B1FD958
+9E394A533A081C36D456A09920001A3D2199583EB9B84B4DEE08E3D12939E321
+990CD249827D9648574955F61BAAA11263A91B6C3D47A5190165B0C25ABF6D3E
+6EC187E4B05182126BB0D0323D943170B795255260F9FD25F2248D04F45DFBFB
+DEF7FF8B19BFEF637B210018AE02572B389B3F76282BEB29CC301905D388C721
+59616893E774413F48DE0B408BC66DCE3FE17CB9F84D205839D58014D6A88823
+D9320AE93AF96D97A02C4D5A2BB2B8C7925C4578003959C46E3CE1A2F0EAC4BF
+8B9B325E46435BDE60BC54D72BC8ACB5C0A34413AC87045DC7B84646A324B808
+6FD8E34217213E131C3B1510415CE45420688ED9C1D27890EC68BD7C1235FAF9
+1DAB3A369DD2FC3BE5CF9655C7B7EDA7361D7E05E5831B6B8E2EEC542A7B38EE
+03BE4BAC6079D038ACB3C7C916279764547C2D51976BABA94BA9866D79F13909
+95AA39B0F03103A07CBDF441B8C5669F729020AF284B7FF52A29C6255FCAACF1
+74109050FBA2602E72593FBCBFC26E726EE4AEF97B7632BC4F5F353B5C67FED2
+3EA752A4A57B8F7FEFF1D7341D895F0A3A0BE1D8E3391970457A967EFF84F6D8
+47750B1145B8CC5BD96EE7AA99DDC9E06939E383BDA41175233D58AD263EBF19
+AFC0E2F840512D321166547B306C592B8A01E1FA2564B9A26DAC14256414E4C8
+42616728D918C74D13C349F4186EC7B9708B86467425A6FDB3A396562F7EE4D8
+40B43621744CF8A23A6E532649B66C2A0002DD04F8F39618E4F572819DD34837
+B5A08E643FDCA1505AF6A1FA3DDFD1FA758013CAED8ACDDBBB334D664DFF5B53
+9560176676ABB71BBD0EE56B4CC492C0652750227CEC6D8A782F80AD84C2E22F
+FE365569A6C5D7841D2870B2103B61FF4E626248D4196932246696C1DF9315FA
+347B4C991450AA7430067340036C2EE4D6FFC6081FF84913FFCFDF4264798456
+4CFECA81F4D7AEBADF92E1C4C4BDDE0E5E25ECCAB6617D3AADC63C43B7362CA9
+4B91BFF7D020198AC87250EECC5CE6D84858EC1C7D8D78674E7A07B40E0B1D23
+5E6EC0423933B2977C34A0124C2AABBE30384F72EA64295A7C4A2390D781C0B0
+616AD6B9F8BCAEA74805D1F03C563CE14058983D9C695831E48A48E01657EF97
+7C1A98CF1315395608108F0B943D3AC6DADC1F437F8B317E4DF4003057E27B63
+C16F28610E70E2851338761D36CE591D5874C97345EB95634734B9919AD90058
+E986FA40B9E83FDD8ABDEA9EB287E887AD19E73CB6D61EDF0C23B3D46B3A2253
+1F1FEF82C280BFEA232585BB00185B296C1D85AB60A1CF9EA345
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+cleartomark
+%%EndFont
+%%BeginFont: CMR10
+%!PS-AdobeFont-1.1: CMR10 1.00B
+%%CreationDate: 1992 Feb 19 19:54:52
+% Copyright (C) 1997 American Mathematical Society. All Rights Reserved.
+11 dict begin
+/FontInfo 7 dict dup begin
+/version (1.00B) readonly def
+/Notice (Copyright (C) 1997 American Mathematical Society. All Rights Reserved) readonly def
+/FullName (CMR10) readonly def
+/FamilyName (Computer Modern) readonly def
+/Weight (Medium) readonly def
+/ItalicAngle 0 def
+/isFixedPitch false def
+end readonly def
+/FontName /CMR10 def
+/PaintType 0 def
+/FontType 1 def
+/FontMatrix [0.001 0 0 0.001 0 0] readonly def
+/Encoding 256 array
+0 1 255 {1 index exch /.notdef put} for
+dup 65 /A put
+dup 66 /B put
+dup 72 /H put
+dup 80 /P put
+dup 83 /S put
+dup 97 /a put
+dup 99 /c put
+dup 100 /d put
+dup 101 /e put
+dup 102 /f put
+dup 103 /g put
+dup 105 /i put
+dup 108 /l put
+dup 109 /m put
+dup 110 /n put
+dup 111 /o put
+dup 112 /p put
+dup 114 /r put
+dup 115 /s put
+dup 116 /t put
+dup 117 /u put
+dup 121 /y put
+readonly def
+/FontBBox{-251 -250 1009 969}readonly def
+/UniqueID 5000793 def
+currentdict end
+currentfile eexec
+D9D66F633B846A97B686A97E45A3D0AA052A014267B7904EB3C0D3BD0B83D891
+016CA6CA4B712ADEB258FAAB9A130EE605E61F77FC1B738ABC7C51CD46EF8171
+9098D5FEE67660E69A7AB91B58F29A4D79E57022F783EB0FBBB6D4F4EC35014F
+D2DECBA99459A4C59DF0C6EBA150284454E707DC2100C15B76B4C19B84363758
+469A6C558785B226332152109871A9883487DD7710949204DDCF837E6A8708B8
+2BDBF16FBC7512FAA308A093FE5CF7158F1163BC1F3352E22A1452E73FECA8A4
+87100FB1FFC4C8AF409B2067537220E605DA0852CA49839E1386AF9D7A1A455F
+D1F017CE45884D76EF2CB9BC5821FD25365DDEA6E45F332B5F68A44AD8A530F0
+92A36FAC8D27F9087AFEEA2096F839A2BC4B937F24E080EF7C0F9374A18D565C
+295A05210DB96A23175AC59A9BD0147A310EF49C551A417E0A22703F94FF7B75
+409A5D417DA6730A69E310FA6A4229FC7E4F620B0FC4C63C50E99E179EB51E4C
+4BC45217722F1E8E40F1E1428E792EAFE05C5A50D38C52114DFCD24D54027CBF
+2512DD116F0463DE4052A7AD53B641A27E81E481947884CE35661B49153FA19E
+0A2A860C7B61558671303DE6AE06A80E4E450E17067676E6BBB42A9A24ACBC3E
+B0CA7B7A3BFEA84FED39CCFB6D545BB2BCC49E5E16976407AB9D94556CD4F008
+24EF579B6800B6DC3AAF840B3FC6822872368E3B4274DD06CA36AF8F6346C11B
+43C772CC242F3B212C4BD7018D71A1A74C9A94ED0093A5FB6557F4E0751047AF
+D72098ECA301B8AE68110F983796E581F106144951DF5B750432A230FDA3B575
+5A38B5E7972AABC12306A01A99FCF8189D71B8DBF49550BAEA9CF1B97CBFC7CC
+96498ECC938B1A1710B670657DE923A659DB8757147B140A48067328E7E3F9C3
+7D1888B284904301450CE0BC15EEEA00E48CCD6388F3FC3BEFD8D9C400015B65
+0F2F536D035626B1FF0A69D732C7A1836D635C30C06BED4327737029E5BA5830
+B9E88A4024C3326AD2F34F47B54739B48825AD6699F7D117EA4C4AEC4440BF6D
+AA0099DEFD326235965C63647921828BF269ECC87A2B1C8CAD6C78B6E561B007
+97BE2BC7CA32B4534075F6491BE959D1F635463E71679E527F4F456F774B2AF8
+FEF3D8C63B283796A9AD847424B4E6508546C36223A3B17EB82A56592F27FC27
+F1D49D5FF4BBC0E16231807AF7E195AA7D0D01C7566243448B222D57B811EAE6
+DE9370F84E207DC9BEC731AD6040FD9B804FA14CA264B73136F9AF34390319F6
+A543D5D4D7FDDDF2F76651E557683614521110DEC1CCAC426117DDA7D6CF1B8B
+7879B21FDC78BAB3C944BCDCD6A65B67F3692F0A8D5E36FB783A63D4FBC9842E
+2CBC2720A7206F42A99AEC79FBBA92A27965AF40A71E05E4BA8D7FC58C828491
+84A8EBDB90B1167333987F7D42A76E9C5C5A842EF91A19C55CCA6ADEB88B59E2
+4FE4A96A8CFF51A1BEC1F1A6A1A5A5BFB54A1BE8C704194D72A79D33F099107F
+153E3FFC70BED6D04DB4820FDAC002428C6741B91D8206296D827D3171351E85
+39BB0DF1C2457E876D3A2E7E499D9D4104762FD19BA0526D38D2BF751EC56EB5
+C80EE2A7AAF2CA12D1EB4548266CE8C0D2F93158A6728EB552FA09202865142F
+E8D1300D637E6326175E17CD72787BCC9BB7121225F59C4C19CC59B8A6084482
+61AEFA59772D67F05E9DDF2CA46FD0EE22A88D9A1F1E0F81552BD0795515FAD3
+F86F5BAA6E2A79BD5B4D33EE5265DE91D14A68CE87B62E036C54AB64149034EB
+07AFED80CE482FA427EB4EA198D8B4FB4CE1A3554A0BE5B900C5056FF5D05886
+74146999CBFC16D3A20C8BD91FDE31DE4745820F2CAD99F5489D95B08349EA6A
+0ED8F2302B44FA2589DEC1BC21D9C251BDF71BAD45A7796DC14E05E21ABCA2ED
+B4D5BF3B1E7369FC9D9D3ADE0BF0C1397B771BDA1F4851799518D7372D3BF7F7
+2EA59BAEC0A4775BCF9848B7913431F55F1D0A49F935B930847153AAA127352B
+0A927C230AA6483979EC9770334684CD7008480DA5D5708E37A821AC21DECAF1
+B212EA446316709A323307073AA80BCA4304C3DBD06FA114069FC4A80CE9AAE7
+9F064761AEBB2558EF18E9426554A1EA2FB13FB29D98CAD4AB09E934986A69C8
+6D2374008990B97AEA971FB14B6B1700AE32B3CE211DA7EE5A3EFD186F17A8DC
+F589189143A871D96EB080A7472F30B2F260091BFB975013C1B1B7A347A6DE28
+4F9C9FD2F9A16FC1D9593C14522FAAA2B29703B535A14F1B60E65A13C4E5FFE0
+A7AD8D402F232034B7BCEDA9C49AB562DC60CEFB19FBE99E371B70D76C6496D6
+D9708B8E43484DB51BBAD8FFB735DFF7FE82C45D3F4EFD8A7F38708331E2B828
+4AD317E2B6C5718F184A1158EE6934DF085A60670A248C72AF4B9FF5945CB38D
+5137395B2A0A42F174C9CBD15D6BDCB0596AEB66EEAD75DF05EBE2493A79011E
+043CFCC51E943E73BD1197DD9C47AF06C0C4450248CB20D72DB19FFD497380F0
+3724A040B891E9F77675B720C48E9DB9AE50E4D7D74BAC0F211023F6102EC15D
+4DDCE3DCB88CE7C2B6AE0A7D9B2EBD530A9C313EE459CA3E86907D03E0AC9684
+48BE3962189CEBBB02808E3A4AEA14C22551CE8F68CD15CB3BA28B3A905C7EA6
+486956FDBB15B85C91B9799701A3D6C955FE56081022F21C999FF0A438C9F3B4
+5562FEA9536012EF0D51E6F61FA92BF93A45BA93A4D9761BB8A37657DDDB5439
+62EDC2400B773E10BCF012BCB99F341A03015921F3A8670071E2D9E0FDB55AF9
+5E5AE1BCC9D8F3509D89170B6035EEC3AD6FC733445DABC07490A9D3C80A28C9
+DEF2DBB022B585C4A55CF0BCBE249FF45CECCA72147C71797FB58E26753470D4
+F707BE383A1F910BE51CBF088C9F7D1AEA422C6123559A714AE664D50687F9E8
+58A8D5C033E5365B8491D9CD3CDEDB229CE19495D05189A015D48B6C7367E821
+C40DC2E98987E847B3BAD43A3FCC1C81F3BEE3DC7096EFB19BD0DD5EDCBC618C
+DD446FABC487C6103216E7DDC27BF7F1DA4890492B33F8C23916BF9A9E785A7C
+A79E20665BD7067C699A4CEDA697F4945DD1DC3C9ABAE8E6101E39B1170A975B
+9B555BFDC4759E92EEA424AB244A37FE50751B10473E87C9308B39285EABF270
+B7052F1566AFDF8E934D78F0B1FCDB02B67D07C52D61B77E28989C6624CEA4F5
+4E945997E69C91EE52C58F86CD990AE06833CA2BDC3F3FF8B45882938E41DBE1
+12921684B2CCED211F89D26D69093FE9E88B18F84817F909B1353AB5C85E8696
+24C5EA405E10A5F2C61FFAF592868E20083E7CE8C26318A1679136AAFB5D2E00
+62333081DA58DED70AA4B9857CD4C30B0314723964A545EC14327BB4FC7C0C43
+727A0290FECD3B634EAE90603C6A602A429AF0C3288FA5F5551DCE58FDD6DF15
+F04D6117B67FD6A5F8B4DF46272864ACD32BAE75C5A7245A110E2390EC9282C0
+5F0FCD46A5B2C863C1C331453FF1866A3875F102907391FD365433853D73E6B0
+6417E593BDC0B5BA6CAC29234E269645E3F7AB0DD8851C0EAA3E16FF866892A4
+07D01360794FCFED41E5B44F9093870087A31AE675870F72F983B64D5C6FD082
+EADD435F052B81E7EEFC0EB626B7A3FD3DAFE7C58BCBABEF3DEB4064945103F2
+A88E9DB2BB2D04E72DE5A99A11F932C150C778EA826FAF830E6AB1CC240BD528
+70E1FF7106CD79C81744A3B648E34B0BFF47EAEED5086FC5DBC2E4E7FC454F8B
+6464356EF5955EE248E64F8F3513071C32320C0649BA7CD4DE2BE85F547E90D3
+A6008A831D0E845FAA30666EC69B92CCB114AFFA9AB57238F2357D8362EA6780
+41E673F72A250DC3CF8AEB4022A22C1A951FFFC91C38DFE41495375F03EB7121
+86DBE36859BCC2B66DC0F59ECE0B46D16D20B7B8BA1A47EBCD3580615C01AA32
+8D4DD2B6FA62BC6AF58763D341F1334757AB99F0019F32A424DF4F12202F4954
+A09911261C888B639D84ED2484DD93061F9B2F56D82B9458A2D4CCC698D42A5D
+67B7DF9BC80C175171C3105FECD0A162EAC718F2E40128657B0C0FCA031C56D6
+C2D017D4409759E7078C377BB8136D905FE7C65B9CA1CC42E83C93FDE71F599C
+323FEA5E1CEFA430C574DF91597DFA9F96053C0332874E445308F07CDF4F06ED
+6D33D3247A4938A7DD73D151965CCC6225CBC481897032B8F69C677562D4AC5E
+7E137B3E28AADE589D94EFBCFB22C7FEFA2B7D7C6FF7ECFC0FE034F131763C5B
+FC71A02EB87A8C4FD897B484A2F90AC10C8C959548F3BDEC101B73B7B967E322
+CA17917DFBE795AEE2917EAEC7F141331107A657F74A4A74860150AAC3E67FEB
+EFA6CBF6ADFA74B20DC9B0F31D89849BCCC56FA9A82D55A2B4AEC55B342EF938
+75C44886D08B0378C231805F3973DCA6C0354B3F5E2C8CA6DB4E76B608C7EF6A
+D3FB5DEA31641C4364AC0930D57343BE930D8A03343F18781A4C22DAD87ADBB2
+EFF2F6B8114E8C433846FFE7BF81842F9360326A52902052EC85782F8427126B
+56726CA1554000944A75530E1FF9604C87F2339DDBFF4F643EC8FD12D2B113EB
+DE6C8D5D22BE6FDCFB55F8C5B7D9F16D28F0FDC89F685DEE88DD3F344A8535D8
+4F62C6DD37955C7E00F2DF3BACB15A26B1E13A6E07E68FAFF717E93ADBD29A6E
+F456EB8EAB0BAF4896AB1ABDDD03A92259FCF730853DA410D854ECBFED6C1A30
+80E526F03E2ABDB6A550ECA36D180CE27A84181B8E00E72F01347D312B9C595A
+ECF16761CDC7D79B3E271C953FB747764FB877B53FE188B6BDF671526F52FD8F
+D23CACFB6930E1978D18C42C5326321E87813CE660A48C3D842929418C4F2AF0
+5472B34FDA2445992D7739E2EF87564DD09E455B99C6A34CC7CE74BE32CCBD05
+D52AAFD11E3BCA38890662C48BDB5E5C8057240FC7A7DF287E95DCBB0E897D0F
+CA85BDFB7932DA0E5A4552F174E6694846E5A49CBAA7954DE42AA14D181C45D9
+52C1458678CAECE787E2CCFCE98EF5DBE873E6A2C7B7D65FDD4B4504D27D48FA
+D32D11BF3084763B1E69FAED012EAF6A248AE75689EF9F7666A8072A6A739884
+5D62B238C27F2156BB41C3546F48CCB3895CAA8B18E3E49610B145C2597A26B0
+FAB5D3E1134E20D416C38F25061594E69C892BF7360CA6BAD76168060EF6E76C
+F735884FEACC05A82DB01A6B853010C77E7CF837CE37F59B93415390FD8A7383
+1CC3A5C652ABFEB2B4C3D3118043E8B90749887CDC455994F45303966C23FF12
+CF20DA865415C044AF4A7EAC3B10C5D21DB708D44E87FCD91EC54933B7CEB5C7
+A20C772216717D4DFCC483E599BF39D797E23CE90ADD731E8C58C547F55510B2
+5E5CB91EEBD3FD3C02B72F998B3BE8B16E04B447E487A8844E27E993C9D80D10
+AF0BD7151CC1AB67A8FDA86175392A81431F7E49DE02A7B9D089A3E07DC3030B
+63D1F17BF6AA819D268B7759C7593FCA9CBE938BB9C017F12D1CEC7E17A686F1
+595BA9D0C05778B3A523C43E9C335700C066F2C7E1D1AD9F239A31C554019CEF
+EE961BEF7490DBAA768C1607CA8C984BE0229B2C4D1BF0B8C9EF78444EA6AA26
+9BB06E4609C61F31F719A44A93BD95C1D4C03D6B91A98F8785015695CD1B27D1
+E91E558BA3AD3F0B6F251E0F350947F836C653CE9426D197EAFA62AEAA98C188
+327E9912FD6117FB62C9B326550BE3BF9CB9C51C354B145EE2405120982F5357
+500B9E6F76B86BA71E94DDD4F768E33ED0332981AB57019D5D805980858BBA15
+25C7312BE2CF731C286A0FC47FC837E2108A52D3B6B40CFE8BF0FD1C32D1B92B
+CABE9E76C95A19021FA2AE9587F56C027909A2EAA400EC8FB6996FE9BBB6ED67
+3C251CAA8DB988BE70A764427214367B9A957A5262267D882EBA2826ECB080CB
+7ADAE9EB45F01A9F8ACD6FF9F1A5446BC53E93EC1927B82F047BD2134D3545B8
+E601F338F510C68F16587D0562119F09D12BED6FC522DCF9602C81C2D738E1DD
+01490B2CFE7F1DF619B8887AA3C6F8F22390466323BB05060664576CD5A8106B
+88304445BA11C6B319DDB83FAF3B40CA7D9C7A1E53F3FAB221C1D65654938A36
+BC30496911E773F232DE072113F3421225BB5745159F43E41BB6AE86B20F4599
+1634FF5D7660ADF57DC9CE5AE5B01317DEAB280CD4E715AFA69CF05F497F4C0A
+8ED63824E56DECECCB742101A828EA49CAB699AC72F74BDF6184AF420887BF1A
+4EC16CDCF6A87DEFBDBCB9228843016A98C2F468DCDC584B3C2C6C86D401B54C
+88B744280472C6A0D40EBB73ED3B6158C8257FDC36C8485820988C8F5AB03CF5
+CA3B884F4C8339694F73448E161723845AC7B4AC303A4BC5A4D35F2483D7D29B
+0F6D9766B194446615637984205F033EA76F3E078338DA9ACA303B2A1B7561AA
+0D0366E78FFEEBA49FADF127E1F44C11468DB50ADC5DD17F828EF87B78CC3D4F
+F1C42C30A9E7E2CBB1913AD1BB9D2787F771DCACD66A1EE926A742F1DBEB2CC6
+8CF7A2FEB56B8EBC530C0817675F028C81861B529343DBECC831575AE971AA61
+E8A671C6034ABA6AFABC7F2BAE27FD6B24896282A43488FD55A5B9019F0E378F
+D959D3EA75376661A12241B21CF95ECE4D3F214A96828EAA8D17440E18154B3D
+61DDCCABF6AFC7AD40499AA5F090CCC6779E56D1B54D18CE7901E43D33837127
+51977AFC8F6D6EC000ED0F88CAF3EBD17C6DC1173793116DD6A37D7A2E17A85F
+691489FC288C8EBBF9C5E8D7BA3C77A3012CB5969EDEB73D6CF953C390031D5B
+73E2BDCD76E8CB18263417C1C076FC113773E7987404D66FFD2E53ED2E01915D
+F46FE469EDC5BA1277B3D5B82523711F2F221C8928402D58D67A3C5F995DA2E2
+9370A61EB6E606BEBCA5847D728BF41C14764116361969214E3E9F15737BA5F1
+8D5349B4B70D08B98C082E770C637F672750903CA038550B6A7887EB50CA9268
+CF4E1B249844293E388EEA40184299BF1124BD1B2466022E60EF193BCBC77871
+1983490EA6A9589CB1F0BAF3E54EF68F1CC8128EADACA248DFF5AFDAA46D9DCB
+CED64FB17F58D0C214CE59B9143332B0841B7E5C997E59BB02B32FC30BC66A85
+F575FC06C653F14878C16A2A108DC642E7AA46838BDD942131976212363EDA2C
+3917FCA125600ADA65E4F06631FB69A74071CC29F0FC62036C7C2A51CC94DB1F
+9CD8F6333ED7260AF788D871987C74BA88F7C81BF2FFA2101CF7ED62CC157E79
+3AF51D1B2542CF83FDD2C7D005636034A39D76184E3108EB8654918143FE913E
+C62523B610501065A34810E4C834C5A52B0C933E547A5E9E45E3FD8B05FE1E18
+DD225947EF53F58D0AF34B9C9BDD46CB59C5D8946B5AF9A8A1452B13A003058B
+F4505E84B56EBDEDB6CA96D88F22764CF5F5A83CC524E4113E6FA7C521EED98C
+DD3CA5CCDA02BB54B8E2D2602D863CE0423FC2A45CF788491FA8252268BB12A8
+1DE5020E364780ECBD32880DA6CB35367C20A378C53F3D3CBE60F526AAAA14D7
+B38CE0EAC7BBB5F838E9055733E0432C4218E668FBB8AE84D161356F91E89566
+B712AA8C528EC0A1E723F89D642DC633CB1A27F15C9E064AA3F0223C95E21A32
+2E8FCBAD0987D1CE6C070C45671C8E594528BFFF43CEEAA7A30335D51D348C00
+2551A6806559BC8625372E93C560F94D328D824A9F2656A5D4C1989E88AD599B
+FBB81142D81D60B7D65CAAB45DF4B9BDC90E62EB8ECBF514A492F5F4D517D866
+380436C390B61195BEDF1586914583E1AAF9A7240227C10D5C2E82E888FCE5BA
+B7D6E2EE1741E68955DB1E5EFC39D937ED80A62B5193903F6AF086D0048347B1
+FAD50F606509372D37814A40007ED9932FD7D58F052EE676F6300E0CB22C0DAD
+6DF5578F49D4D181099336709021
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+cleartomark
+%%EndFont
+TeXDict begin 40258437 52099154 1000 600 600 (mass_frag.dvi)
+@start /Fa 206[35 49[{}1 66.4176 /CMR8 rf /Fb 142[41
+113[{}1 90.9091 /CMMI10 rf /Fc 134[48 3[51 35 36 36 1[51
+45 51 76 25 2[25 1[45 28 40 51 40 1[45 13[51 2[62 7[68
+5[64 68 65[{}22 90.9091 /CMR10 rf end
+%%EndProlog
+%%BeginSetup
+%%Feature: *Resolution 600dpi
+TeXDict begin
+ end
+%%EndSetup
+TeXDict begin 1 0 bop Black Black Black Black 1497 552
+a
+ /PSfrag where{pop(q1)[[0()1 0]](base)[[1(Bl)1 0]](Actuator)[[2(l)1
+0]]3 0 -1/Begin PSfrag}{userdict /PSfrag{pop}put}ifelse
+ 1497 552 a @beginspecial 0 @llx 0 @lly 240 @urx 119
+@ury 1844 @rwi @setspecial
+%%BeginDocument: mass.eps
+%!PS-Adobe-2.0 EPSF-2.0
+%%Title: mass.fig
+%%Creator: fig2dev Version 3.2 Patchlevel 4
+%%CreationDate: Sun May 22 21:40:56 2005
+%%For: epstein@linux (Becky Epstein)
+%%BoundingBox: 0 0 240 119
+%%Magnification: 1.0000
+%%EndComments
+/$F2psDict 200 dict def
+$F2psDict begin
+$F2psDict /mtrx matrix put
+/col-1 {0 setgray} bind def
+/col0 {0.000 0.000 0.000 srgb} bind def
+/col1 {0.000 0.000 1.000 srgb} bind def
+/col2 {0.000 1.000 0.000 srgb} bind def
+/col3 {0.000 1.000 1.000 srgb} bind def
+/col4 {1.000 0.000 0.000 srgb} bind def
+/col5 {1.000 0.000 1.000 srgb} bind def
+/col6 {1.000 1.000 0.000 srgb} bind def
+/col7 {1.000 1.000 1.000 srgb} bind def
+/col8 {0.000 0.000 0.560 srgb} bind def
+/col9 {0.000 0.000 0.690 srgb} bind def
+/col10 {0.000 0.000 0.820 srgb} bind def
+/col11 {0.530 0.810 1.000 srgb} bind def
+/col12 {0.000 0.560 0.000 srgb} bind def
+/col13 {0.000 0.690 0.000 srgb} bind def
+/col14 {0.000 0.820 0.000 srgb} bind def
+/col15 {0.000 0.560 0.560 srgb} bind def
+/col16 {0.000 0.690 0.690 srgb} bind def
+/col17 {0.000 0.820 0.820 srgb} bind def
+/col18 {0.560 0.000 0.000 srgb} bind def
+/col19 {0.690 0.000 0.000 srgb} bind def
+/col20 {0.820 0.000 0.000 srgb} bind def
+/col21 {0.560 0.000 0.560 srgb} bind def
+/col22 {0.690 0.000 0.690 srgb} bind def
+/col23 {0.820 0.000 0.820 srgb} bind def
+/col24 {0.500 0.190 0.000 srgb} bind def
+/col25 {0.630 0.250 0.000 srgb} bind def
+/col26 {0.750 0.380 0.000 srgb} bind def
+/col27 {1.000 0.500 0.500 srgb} bind def
+/col28 {1.000 0.630 0.630 srgb} bind def
+/col29 {1.000 0.750 0.750 srgb} bind def
+/col30 {1.000 0.880 0.880 srgb} bind def
+/col31 {1.000 0.840 0.000 srgb} bind def
+
+end
+save
+newpath 0 119 moveto 0 0 lineto 240 0 lineto 240 119 lineto closepath clip newpath
+-84.8 162.7 translate
+1 -1 scale
+
+/cp {closepath} bind def
+/ef {eofill} bind def
+/gr {grestore} bind def
+/gs {gsave} bind def
+/sa {save} bind def
+/rs {restore} bind def
+/l {lineto} bind def
+/m {moveto} bind def
+/rm {rmoveto} bind def
+/n {newpath} bind def
+/s {stroke} bind def
+/sh {show} bind def
+/slc {setlinecap} bind def
+/slj {setlinejoin} bind def
+/slw {setlinewidth} bind def
+/srgb {setrgbcolor} bind def
+/rot {rotate} bind def
+/sc {scale} bind def
+/sd {setdash} bind def
+/ff {findfont} bind def
+/sf {setfont} bind def
+/scf {scalefont} bind def
+/sw {stringwidth} bind def
+/tr {translate} bind def
+/tnt {dup dup currentrgbcolor
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb}
+ bind def
+/shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul
+ 4 -2 roll mul srgb} bind def
+/$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def
+/$F2psEnd {$F2psEnteredState restore end} def
+
+$F2psBegin
+10 setmiterlimit
+0 slj 0 slc
+ 0.06000 0.06000 sc
+%
+% Fig objects follow
+%
+%
+% here starts figure with depth 0
+% Polyline
+7.500 slw
+n 1425 1125 m 1425 2700 l 5400 2700 l 5400 2100 l 1875 2100 l 1875 1125 l
+
+ cp gs col7 0.75 shd ef gr gs col-1 s gr
+% Polyline
+n 2550 1575 m 3450 1575 l 3450 1875 l 2550 1875 l
+ cp gs col7 0.95 shd ef gr gs col-1 s gr
+% Polyline
+n 3450 1275 m
+ 3450 755 l gs col-1 s gr
+% Polyline
+n 1875 1050 m
+ 1875 750 l gs col-1 s gr
+% Polyline
+gs clippath
+3465 930 m 3465 870 l 3280 870 l 3430 900 l 3280 930 l cp
+1860 870 m 1860 930 l 2045 930 l 1895 900 l 2045 870 l cp
+eoclip
+n 1875 900 m
+ 3450 900 l gs col-1 s gr gr
+
+% arrowhead
+n 2045 870 m 1895 900 l 2045 930 l 2015 900 l 2045 870 l
+ cp gs 0.00 setgray ef gr col-1 s
+% arrowhead
+n 3280 930 m 3430 900 l 3280 870 l 3310 900 l 3280 930 l
+ cp gs 0.00 setgray ef gr col-1 s
+% Polyline
+n 1875 1650 m 2550 1650 l 2550 1800 l 1875 1800 l
+ cp gs col7 0.90 shd ef gr gs col-1 s gr
+% Polyline
+gs clippath
+2895 1560 m 2931 1608 l 3079 1497 l 2941 1563 l 3043 1449 l cp
+eoclip
+n 3825 900 m
+ 2925 1575 l gs col-1 s gr gr
+
+% arrowhead
+n 3043 1449 m 2941 1563 l 3079 1497 l 3037 1491 l 3043 1449 l
+ cp gs 0.00 setgray ef gr col-1 s
+% Polyline
+n 3450 2100 m 4425 2100 l 4425 1350 l 3450 1350 l
+ cp gs col7 0.55 shd ef gr gs col-1 s gr
+/Times-Roman ff 180.00 scf sf
+2570 935 m
+gs 1 -1 sc (q1) col-1 sh gr
+/Times-Roman ff 180.00 scf sf
+3850 945 m
+gs 1 -1 sc (Actuator) col-1 sh gr
+/Times-Roman ff 210.00 scf sf
+2520 2452 m
+gs 1 -1 sc (base) col-1 sh gr
+% here ends figure;
+$F2psEnd
+rs
+showpage
+
+%%EndDocument
+ @endspecial 1497 552 a
+ /End PSfrag
+ 1497 552 a 1497 39 a
+ /Hide PSfrag
+ 1497 39
+a 686 102 a Fc(PSfrag)30 b(replacemen)m(ts)p 686 133
+811 4 v 1497 136 a
+ /Unhide PSfrag
+ 1497 136 a 1432 196 a
+ {
+ 1432 196 a Black
+1 TeXcolorgray 1 TeXcolorgray 1367 249 130 107 v 1 TeXcolorgray
+Black 1392 207 a Fb(q)1433 221 y Fa(1)p 1 TeXcolorgray
+Black Black 1432 196 a
+ } 0/Place PSfrag
+ 1432 196 a 1254 348 a
+ {
+ 1254 348
+a Black 0 TeXcolorgray 1254 261 243 4 v 1254 373 4 112
+v 1 TeXcolorgray 1 TeXcolorgray 1258 373 236 112 v 1
+TeXcolorgray Black 28 w Fc(Base)p 1 TeXcolorgray 0 TeXcolorgray
+1493 373 4 112 v 1254 376 243 4 v Black Black 1254 348
+a
+ } 1/Place PSfrag
+ 1254 348 a 1107 468 a
+ {
+ 1107 468 a Black -21 x Fc(Hydraulic)1124
+552 y(Actuator)p Black 1107 468 a
+ } 2/Place PSfrag
+ 1107 468 a Black Black
+eop end
+%%Trailer
+
+userdict /end-hook known{end-hook}if
+%%EOF
+
+%%EndDocument
+ @endspecial 2435 764 a(Figure)31 b(12:)p 0 TeXcolorgray
+Black 42 w(With)g(PSfrag)f(Replacemen)m(t)p Black 630
+1143 a FB(15.3)112 b(L)968 1120 y FI(A)1012 1143 y FB(T)1071
+1165 y(E)1132 1143 y(X)37 b(T)-9 b(ext)36 b(in)i(EPS)f(File)630
+1314 y FQ(The)c(recommended)f(and)h(most)g(p)s(opular)f(metho)s(d)g
+(for)h(using)h FJ(ps)p FQ(frag)f(is)g(the)g FM(\\psfrag)e
+FQ(com-)630 1427 y(mand)38 b(describ)s(ed)g(in)g(the)h(previous)g
+(section.)67 b(An)38 b(alternativ)m(e,)44 b(less)39 b(e\016cien)m(t,)k
+(metho)s(d)38 b(for)630 1540 y(using)28 b FJ(ps)p FQ(frag)e(is)h(the)g
+FM(\\tex)f FQ(command,)i(whic)m(h)f(em)m(b)s(eds)f(the)h(L)2798
+1523 y FP(A)2837 1540 y FQ(T)2888 1560 y(E)2939 1540
+y(X)g(text)h(directly)f(in)g(the)g FJ(eps)630 1653 y
+FQ(\014le.)41 b(See)30 b([)p 0.05 1.00 1.00 0.40 TeXcolorcmyk(29)p
+Black 2 w(])g(for)g(more)h(information.)630 1896 y FB(15.4)112
+b(Figure)39 b(and)f(T)-9 b(ext)37 b(Scaling)h(with)g(PSfrag)630
+2068 y FQ(If)31 b(a)h(graphic)f(using)h FJ(ps)p FQ(frag)f(is)g(scaled,)
+i(the)e FJ(ps)p FQ(frag)g(text)h(is)g(scaled)g(along)g(with)f(the)h
+(graphic.)630 2181 y(As)e(a)h(result,)g(a)f(subtlet)m(y)h(of)g(the)f
+FO(graphicx)h FQ(pac)m(k)-5 b(age)32 b(a\013ects)g(the)f(size)g(of)f
+(the)h(text.)p Black 767 2310 a FK(\210)p Black 45 w
+FQ(When)d(the)f FM(width)p FQ(,)g FM(height)p FQ(,)g(or)g
+FM(totalheight)e FQ(options)j(are)g(used)e(to)j(size)f(the)g(graphic)p
+Black Black 1075 2544 a FN(\\includegraphics[)o(wi)o(dth)o(=3)o(in)o
+(]{f)o(il)o(e.e)o(ps)o(})857 2677 y FQ(the)j FJ(ps)p
+FQ(frag)f(text)h(is)f(inserted)h Fy(after)40 b FQ(the)31
+b(scaling.)42 b(Con)m(v)m(ersely)-8 b(,)p Black Black
+1075 2811 a FN(\\resizebox{3in}{!)o(}{)o(\\in)o(cl)o(ud)o(egr)o(ap)o
+(hic)o(s{)o(fi)o(le.)o(ep)o(s}})857 2958 y FQ(Includes)27
+b(the)g(graphic)g(at)h(its)g(natural)f(size,)i(inserts)e(the)g
+FJ(ps)p FQ(frag)f(text,)j(and)e(then)g(scales)857 3071
+y(b)s(oth)j(the)g(graphics)h(and)f(the)g(text.)p Black
+767 3208 a FK(\210)p Black 45 w FQ(Similarly)-8 b(,)32
+b(when)d(scaling)i(options)g(are)g(sp)s(eci\014ed)f Fy(b)-5
+b(efor)g(e)38 b FQ(rotation)p Black Black 1075 3342 a
+FN(\\includegraphics[)o(wi)o(dth)o(=3)o(in)o(,an)o(gl)o(e=3)o(0])o({f)o
+(ile)o(.e)o(ps})857 3475 y FQ(the)c(scaling)g(is)f(implicitly)h
+(handled)e(b)m(y)h(the)g(graphics)g(inclusion)g(function.)49
+b(Ho)m(w)m(ev)m(er,)857 3575 y(when)30 b(scaling)h(options)g(are)g(sp)s
+(eci\014ed)e Fy(after)41 b FQ(rotation)p Black Black
+1075 3709 a FN(\\includegraphics[)o(an)o(gle)o(=3)o(0,)o(wid)o(th)o
+(=3i)o(n])o({f)o(ile)o(.e)o(ps})857 3855 y FQ(the)33
+b(graphic)g(is)f(\014rst)g(included)g(at)h(its)g(natural)f(size,)i
+(then)e(rotated,)j(and)d(then)g(scaled.)857 3968 y(Since)37
+b FJ(ps)p FQ(frag)g(replaces)g(the)h(new)e(text)i(during)e(the)h
+(graphics)g(inclusion,)i(the)e(second)857 4081 y(command)29
+b(scales)i(the)e(new)h FJ(ps)p FQ(frag)e(text)i(while)g(the)f(\014rst)f
+(command)h(do)s(es)g Fy(not)p FQ(.)41 b(When)857 4194
+y(the)c(included)e(size)j(of)e(the)h FJ(eps)e FQ(graphic)h(greatly)i
+(di\013ers)e(from)g(its)g(natural)h(size,)i(the)857 4307
+y(t)m(w)m(o)32 b(commands)e(pro)s(duce)f(v)m(ery)i(di\013eren)m(t)g
+(results.)630 4450 y(See)g([)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk(29)p Black 1 w(])f(for)g(more)h(information)g(on)f(the)h
+(scaling)g(of)38 b FJ(ps)p FQ(frag)29 b(text.)630 4693
+y FB(15.5)112 b(PSfrag)38 b(and)g(PDFT)1816 4715 y(E)1876
+4693 y(X)630 4865 y FJ(ps)p FQ(frag)31 b(cannot)i(b)s(e)e(used)g(with)g
+(p)s(dfT)1943 4885 y(E)1992 4865 y(X.)45 b(If)38 b FJ(ps)p
+FQ(frag)31 b(substitution)h(is)g(needed,)g(one)g(option)g(is)630
+4978 y(to)39 b(use)e(the)h(L)1101 4961 y FP(A)1140 4978
+y FQ(T)1191 4997 y(E)1241 4978 y(X-to-)p FJ(d)n(vi)p
+FQ(-to-P)m(ostScript-to-)p FJ(pdf)43 b FQ(route)38 b(that)h(w)m(as)f
+(used)f(b)s(efore)g(p)s(dfT)3818 4997 y(E)3867 4978 y(X.)630
+5091 y(While)h(this)g(allo)m(ws)h FJ(ps)p FQ(frag)e(substitution,)j
+(users)d(lose)h(the)g(adv)-5 b(an)m(tages)40 b(that)e(p)s(dfT)3644
+5110 y(E)3692 5091 y(X)g(pro-)630 5204 y(vides.)771 5317
+y(A)48 b(b)s(etter)g(\(although)g(more)g(lab)s(orious\))g(metho)s(d)f
+(is)h(to)g(use)g FJ(ps)p FQ(frag)f(indirectly)h(with)630
+5430 y(p)s(dfT)814 5449 y(E)862 5430 y(X.)38 b(This)19
+b(allo)m(ws)j FJ(ps)p FQ(frag)e(substitution)g(while)g(also)h(k)m
+(eeping)g(the)g(adv)-5 b(an)m(tages)22 b(of)e(p)s(dfT)3819
+5449 y(E)3867 5430 y(X.)p Black 2250 5640 a(48)p Black
+eop end
+%%Page: 49 49
+TeXDict begin 49 48 bop Black 0 TeXcolorgray Black Black
+Black 741 -149 a FQ(1.)p Black 46 w(F)-8 b(or)48 b(eac)m(h)g(graphic)f
+(that)h(uses)e FJ(ps)p FQ(frag,)51 b(create)e(a)e(separate)h(L)3130
+-165 y FP(A)3169 -149 y FQ(T)3220 -129 y(E)3270 -149
+y(X)f(\014le)g(con)m(taining)857 -36 y(the)39 b FJ(ps)p
+FQ(frag)g(commands)f(and)h(the)g FM(\\includegraphics)c
+FQ(command.)66 b(Y)-8 b(ou)39 b(m)m(ust)g(use)857 77
+y FM(\\pagestyle{empty})26 b FQ(to)31 b(prev)m(en)m(t)g(page)g(n)m(um)m
+(b)s(ers)e(from)h(b)s(eing)g(placed)h(on)f(the)h(page.)857
+212 y(Assume)f(these)h FJ(ps)p FQ(frag)f(L)1737 195 y
+FP(A)1776 212 y FQ(T)1827 231 y(E)1877 212 y(X)h(\014les)f(are)h(named)
+p Black Black 1293 343 a FN(GraphicFrag00.tex)1293 442
+y(GraphicFrag01.tex)1293 542 y(...)p Black 741 673 a
+FQ(2.)p Black 46 w(A)m(t)h(the)e(op)s(erating)h(system)f(command)h
+(line,)g(p)s(erform)e(the)h(follo)m(wing)i(steps)p Black
+Black 1075 804 a FN(latex)85 b(GraphicFrag00.tex)1075
+904 y(dvips)42 b(-E)g(GraphicFrag00)1075 1003 y(epstool)f(--copy)g
+(--bbox)g(GraphicFrag00.ps)c(GraphicFrag00.ep)o(s)1075
+1103 y(epstopdf)j(GraphicFrag00.eps)857 1247 y FQ(The)46
+b(\014rst)g(command)h(creates)h FN(GraphicFrag00.dv)o(i)p
+FQ(.)83 b(The)46 b(second)h(command)f(cre-)857 1360 y(ates)39
+b FN(GraphicFrag00.ps)p FQ(.)57 b(The)37 b(third)g(command)h
+(calculates)i(the)e(BoundingBo)m(x)h(for)857 1473 y FN
+(GraphicFrag00.ps)14 b FQ(and)20 b(inserts)g(the)g(BoundingBo)m(x)h
+(and)f(con)m(ten)m(ts)i(of)27 b FN(GraphicFrag00.ps)857
+1586 y FQ(in)m(to)38 b FN(GraphicFrag00.ep)o(s)p FQ(.)53
+b(The)36 b(last)i(command)e(con)m(v)m(erts)i FN(GraphicFrag00.eps)30
+b FQ(in)m(to)857 1699 y FJ(pdf)h FQ(format.)p Black 741
+1847 a(3.)p Black 46 w(Rep)s(eat)g(step)g(2)f(for)g FN
+(GraphicFrag01.tex)o FQ(,)25 b(.)15 b(.)h(.)p Black 741
+1981 a(4.)p Black 46 w(Use)31 b FM(\\includegraphics)26
+b FQ(to)31 b(include)f(the)h(resulting)h FJ(pdf)e FQ(\014les)p
+Black Black 1293 2112 a FN(GraphicFrag00.pdf)1293 2212
+y(GraphicFrag01.pdf)1293 2312 y(...)857 2456 y FQ(in)m(to)i(the)e
+(original)i(L)1551 2439 y FP(A)1590 2456 y FQ(T)1641
+2476 y(E)1691 2456 y(X)f(\014le.)p Black 741 2604 a(5.)p
+Black 46 w(Pro)s(cess)g(the)f(L)1366 2587 y FP(A)1405
+2604 y FQ(T)1456 2623 y(E)1506 2604 y(X)h(\014le)f(with)g
+FM(pdflatex)p FQ(.)630 2888 y FD(16)135 b(Including)45
+b(An)f(EPS)g(File)i(Multiple)f(Times)630 3091 y FQ(When)24
+b(the)h(same)g FJ(eps)e FQ(graphic)h(is)h(inserted)f(m)m(ultiple)h
+(times,)i(its)e FJ(eps)e FQ(co)s(de)i(app)s(ears)e(m)m(ultiple)630
+3204 y(times)40 b(in)g(the)g(\014nal)f FJ(ps)g FQ(\014le.)70
+b(In)39 b(particular,)j(this)e(often)g(happ)s(ens)e(when)h(a)h(logo)i
+(or)e(other)630 3316 y(graphics)j(are)g(inserted)g(in)m(to)h(a)f(do)s
+(cumen)m(t's)g(header)g(or)g(fo)s(oter.)78 b(This)43
+b(section)h(describ)s(es)630 3429 y(impro)m(v)m(ed)31
+b(metho)s(ds)e(for)i(inserting)f(a)h(graphic)f(m)m(ultiple)h(times)2874
+3396 y FP(22)2950 3429 y FQ(.)771 3542 y(There)24 b(are)h(four)f
+(common)h(metho)s(ds)f(for)g(including)g(the)h(same)g
+FJ(eps)e FQ(graphics)i(man)m(y)f(times)p Black 741 3685
+a(1.)p Black 46 w(Use)33 b FM(\\includegraphics{file.eps})26
+b FQ(wherev)m(er)33 b(y)m(ou)g(w)m(an)m(t)g(the)g(graphic.)48
+b(This)32 b(has)857 3798 y(t)m(w)m(o)g(problems)p Black
+896 3961 a(\(a\))p Black 46 w(L)1081 3944 y FP(A)1120
+3961 y FQ(T)1171 3980 y(E)1222 3961 y(X)e(m)m(ust)g(\014nd)f(and)h
+(read)g(the)h(\014le)f(ev)m(ery)h(time)g FM(\\includegraphics)26
+b FQ(is)31 b(used.)p Black 891 4088 a(\(b\))p Black 45
+w(The)i FJ(eps)f FQ(graphics)h(commands)g(are)g(rep)s(eated)h(in)f(the)
+g(\014nal)g FJ(ps)f FQ(\014le,)i(pro)s(ducing)1057 4201
+y(a)d(large)h(\014le.)p Black 741 4363 a(2.)p Black 46
+w(Sa)m(v)m(e)45 b(the)f(graphics)g(in)g(a)g(L)1856 4346
+y FP(A)1895 4363 y FQ(T)1946 4383 y(E)1996 4363 y(X)g(b)s(o)m(x)g(and)g
+(use)f(the)h(b)s(o)m(x)g(wherev)m(er)g(y)m(ou)g(w)m(an)m(t)h(the)857
+4476 y(graphic.)i(This)32 b(sa)m(v)m(es)h(L)1688 4459
+y FP(A)1727 4476 y FQ(T)1778 4496 y(E)1829 4476 y(X)f(time)h(since)g
+(it)g(m)m(ust)f(only)g(\014nd)f(and)h(read)g(the)h(\014le)f(once.)857
+4589 y(Ho)m(w)m(ev)m(er,)h(it)e(do)s(es)f(not)h(reduce)f(the)g(size)h
+(of)g(the)g(\014nal)f(P)m(ostScript)g(\014le.)857 4723
+y(A)m(t)i(the)e(b)s(eginning)g(of)g(the)h(\014le,)g(include)f(the)g
+(follo)m(wing)i(commands)p Black Black 1206 4855 a FN
+(\\newsavebox{\\myg)o(rap)o(hi)o(c})1206 4954 y(\\sbox{\\mygraphic)o
+(}{\\)o(in)o(cl)o(ude)o(gr)o(aph)o(ic)o(s{)o(fil)o(e.)o(eps)o(}})p
+Black 630 5046 1332 4 v 703 5135 a FF(22)768 5167 y FG(Although)43
+b(this)h(do)r(cumen)n(t)f(do)r(es)h(not)f(y)n(et)g(do)r(cumen)n(t)g
+(it,)48 b(users)c(are)g(encouraged)h(to)e(consider)h(the)630
+5258 y Fs(graphicx-psmin)36 b FG(pac)n(k)l(age[)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk(20)p Black 2 w(],)j(whic)n(h)d(pro)n(vides)f(a)i(w)n(a)n
+(y)e(to)h(include)g(a)g(rep)r(eated)g(P)n(ostScript)h(graphic)f(only)
+630 5349 y(once)27 b(in)g(a)g(P)n(ostScript)g(do)r(cumen)n(t.)38
+b(This)28 b(pac)n(k)l(age)f(only)g(w)n(orks)g(when)g(the)f
+FJ(d)n(vi)h FG(\014le)g(is)h(p)r(ost-pro)r(cessed)g(with)630
+5441 y FE(dvips)f FG(v)n(ersion)f(5.95b)g(or)g(later.)p
+Black Black 2250 5640 a FQ(49)p Black eop end
+%%Page: 50 50
+TeXDict begin 50 49 bop Black 0 TeXcolorgray Black Black
+857 -149 a FQ(Then)24 b(use)g(the)h(command)f FM(\\usebox{\\mygraphic})
+19 b FQ(wherev)m(er)25 b(y)m(ou)g(w)m(an)m(t)g(the)g(graphic.)857
+-36 y(\(The)20 b(graphics)h(can)f(b)s(e)g(scaled)h(b)m(y)f(placing)h
+(the)g FM(\\usebox)d FQ(command)i(inside)g(a)h FM(\\scalebox)857
+77 y FQ(or)31 b FM(\\resizebox)c FQ(command.\))p Black
+741 227 a(3.)p Black 46 w(When)22 b(the)f FJ(eps)f FQ(\014le)i(con)m
+(tains)h(v)m(ector)g(graphics)e(\(as)h(opp)s(osed)f(to)h(bitmapp)s(ed)e
+(graphics\),)857 340 y(it)31 b(is)f(p)s(ossible)g(to)h(write)f(a)h(P)m
+(ostScript)f(command)g(whic)m(h)g(dra)m(ws)g(the)g(graphics)3663
+307 y FP(23)3738 340 y FQ(.)40 b(The)857 453 y(graphic)28
+b(can)g(then)f(b)s(e)f(included)h(b)m(y)g(issuing)h(the)f(P)m
+(ostScript)h(command)f(wherev)m(er)h(the)857 566 y(graphic)j(is)f
+(needed.)41 b(Section)p 0.05 1.00 1.00 0.40 TeXcolorcmyk
+31 w(16.1)p Black 32 w(on)30 b(page)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 31 w(50)p Black 31 w(describ)s(es)g(this)g(pro)s(cedure.)
+857 716 y(Since)35 b(the)f(\014nal)g(P)m(ostScript)h(\014le)f(includes)
+g(the)g(graphics)g(commands)g(only)h(once,)h(the)857
+829 y(\014nal)e(P)m(ostScript)h(\014le)g(is)f(m)m(uc)m(h)h(smaller.)53
+b(Note)36 b(that)f(since)f(the)h(graphics)f(commands)857
+941 y(are)k(stored)g(in)f(prin)m(ter)g(memory)h(while)f(the)h(\014nal)f
+(P)m(ostScript)h(\014le)g(is)f(b)s(eing)g(prin)m(ted,)857
+1054 y(this)h(metho)s(d)g Fy(may)47 b FQ(cause)38 b(the)g(prin)m(ter)g
+(to)h(run)d(out)i(of)h(memory)e(and)h(not)g(prin)m(t)g(the)857
+1167 y(do)s(cumen)m(t.)857 1317 y(Although)g(this)f(metho)s(d)g
+(results)g(in)h(a)f(small)h(\014nal)f(P)m(ostScript)h(\014le,)i(it)e
+(still)g(requires)857 1430 y(L)881 1413 y FP(A)920 1430
+y FQ(T)971 1450 y(E)1022 1430 y(X)30 b(to)h(\014nd)e(and)h(read)g(the)h
+(\014le)f(con)m(taining)i(the)f(P)m(ostScript)g(commands.)p
+Black 741 1580 a(4.)p Black 46 w(Lik)m(e)22 b(the)f(previous)g(metho)s
+(d,)h(de\014ne)e(a)i(P)m(ostScript)f(command)g(whic)m(h)g(dra)m(ws)f
+(the)h(graph-)857 1693 y(ics,)42 b(but)37 b(include)i(this)f(command)g
+(in)g(a)h(L)2350 1676 y FP(A)2389 1693 y FQ(T)2440 1712
+y(E)2491 1693 y(X)f(b)s(o)m(x.)65 b(This)38 b(results)g(in)g(a)h(small)
+g(\014nal)857 1806 y(P)m(ostScript)31 b(\014le)g(and)e(only)i(requires)
+f(L)2190 1789 y FP(A)2229 1806 y FQ(T)2280 1825 y(E)2330
+1806 y(X)h(to)g(\014nd)e(and)g(read)i(the)f(\014le)h(once.)630
+2049 y FB(16.1)112 b(De\014ning)39 b(a)f(P)m(ostScript)e(Command)630
+2221 y FQ(This)25 b(section)i(describ)s(es)e(ho)m(w)g(to)i(created)f(a)
+g(P)m(ostScript)g(command)g(whic)m(h)f(dra)m(ws)g(the)h(graph-)630
+2333 y(ics)k(from)f(an)g FJ(eps)f FQ(\014le)h(con)m(taining)i(v)m
+(ector)g(graphics.)40 b(This)29 b(pro)s(cedure)f(do)s(es)h(not)g(w)m
+(ork)h(if)f(the)630 2446 y FJ(eps)g FQ(\014le)i(con)m(tains)g
+Fy(bitmapp)-5 b(e)g(d)42 b FQ(graphics.)771 2538 y(T)-8
+b(o)37 b(con)m(v)m(ert)h(the)e FJ(eps)f FQ(graphics)i(in)m(to)g(a)g(P)m
+(ostScript)g(command,)g(the)g FJ(eps)e FQ(\014le)h(m)m(ust)h(b)s(e)630
+2629 y(brok)m(en)d(in)m(to)h(t)m(w)m(o)h(\014les,)f(one)g(whic)m(h)f
+(de\014nes)f(the)i(P)m(ostScript)g(dictionary)g(and)e(the)i(graphics)
+630 2720 y(commands,)46 b(and)c(another)h(whic)m(h)g(includes)f(the)h
+(header)g(information)g(and)f(the)h(uses)g(the)630 2812
+y(previously-de\014ned)33 b(P)m(ostScript)i(command.)52
+b(F)-8 b(or)35 b(example,)h(an)e FJ(eps)f FQ(\014le)h(created)i(b)m(y)f
+FM(Xfig)630 2903 y FQ(has)30 b(the)h(form)p Black Black
+748 3034 a FE(\045!PS-Adobe-2.0)42 b(EPSF-2.0)748 3125
+y(\045\045Title:)f(/tmp/xfig-fig017255)748 3217 y(\045\045Creator:)g
+(fig2dev)g(Version)g(2.1.8)f(Patchlevel)i(0)748 3308
+y(\045\045CreationDate:)g(Sun)e(Sep)79 b(3)40 b(15:36:01)h(1995)748
+3399 y(\045\045Orientation:)h(Portrait)748 3490 y(\045\045BoundingBox:)
+g(0)e(0)f(369)h(255)748 3582 y(\045\045Pages:)h(0)748
+3673 y(\045\045EndComments)748 3764 y(/$F2psDict)g(200)f(dict)g(def)748
+3856 y($F2psDict)h(begin)748 3947 y(...)748 4038 y(\045\045EndProlog)
+748 4221 y($F2psBegin)748 4312 y(...)748 4404 y($F2psEnd)p
+Black 630 4498 1332 4 v 703 4587 a FF(23)768 4619 y FG(While)21
+b(it)f(is)h(p)r(ossible)h(to)e(construct)g(a)h(P)n(ostScript)f(command)
+h(whic)n(h)f(dra)n(ws)h(v)n(ector)f(graphics,)j(it)d(turns)g(out)630
+4710 y(to)27 b(b)r(e)g(a)g(\\feature")h(of)33 b FJ(eps)26
+b FG(that)g(is)i(imp)r(ossible)g(to)f(construct)g(suc)n(h)f(a)h
+(command)g(for)h(bitmapp)r(ed)e(graphics.)630 4801 y(Bitmapp)r(ed)f
+(graphics)g(are)g(usually)g(con)n(v)n(erted)e(to)i FJ(eps)e
+FG(b)n(y)h(ha)n(ving)g(the)g FE(image)h FG(\(or)g FE(colorimage)p
+FG(\))i(P)n(ostScript)630 4893 y(op)r(erators)j(read)g(the)f(curren)n
+(t)f(\014le)h(as)h(data.)45 b(It)29 b(is)h(not)f(p)r(ossible)h(to)g
+(put)e(suc)n(h)h(constructs)g(in)n(to)g(a)h(P)n(ostScript)630
+4984 y(pro)r(cedure.)j(It)20 b(is)i(p)r(ossible)g(to)f(c)n(hange)g(the)
+g FJ(eps)e FG(\014le)i(so)h(that)f(it)g(passes)h(the)e(image)i(data)f
+(as)h(P)n(ostScript)f(strings)630 5075 y(rather)j(than)g(reading)h(the)
+f(\014le,)h(but)e(this)h(is)h(di\016cult)f(to)h(automate)g(and)f
+(generally)h(requires)f(a)h(fair)g(amoun)n(t)f(of)630
+5167 y(hand)h(editing)h(of)g(the)g(P)n(ostScript.)707
+5258 y(Since)34 b(most)h(p)r(eople)g(are)g(not)f(P)n(ostScript)h(exp)r
+(erts,)i(hand-editing)c(the)i(P)n(ostScript)f(is)h(generally)h(not)e
+(an)630 5349 y(option.)45 b(If)30 b(the)e(graphic)i(can)f(b)r(e)g
+(describ)r(ed)h(b)n(y)e(P)n(ostScript)h(v)n(ector)g(primitiv)n(es,)i
+(it)e(ma)n(y)g(b)r(e)g(p)r(ossible)i(to)e(use)630 5441
+y(the)c FJ(kvec)h FG(program)g(\(see)g(page)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 27 w(19)p Black(\))g(to)g(successfully)h(con)n(v)n(ert)e
+(the)g(graphic)h(to)g(v)n(ector)g(format.)p Black Black
+2250 5640 a FQ(50)p Black eop end
+%%Page: 51 51
+TeXDict begin 51 50 bop Black 0 TeXcolorgray Black Black
+630 -149 a FQ(Where)27 b FM(...)e FQ(indicates)i(unlisted)f(commands.)
+39 b(The)26 b FJ(eps)f FQ(\014le)i(generally)g(con)m(tains)h(three)e
+(parts)p Black 741 -6 a(1.)p Black 46 w(The)k(header)g(commands)g(whic)
+m(h)g(b)s(egin)g(with)g FM(\045)p Black 741 130 a FQ(2.)p
+Black 46 w(The)g(Prolog)i(section)f(whic)m(h)f(starts)h(with)p
+Black Black 1119 263 a FN(/$F2psDict)39 b(200)k(dict)f(def)857
+395 y FQ(and)30 b(ends)g(with)p Black Black 1119 528
+a FN(\045\045EndProlog)857 674 y FQ(The)25 b(Prolog)h(de\014nes)e(the)h
+(commands)g(in)f(the)i(P)m(ostScript)f(dictionary)h(used)e(b)m(y)h(the)
+g FJ(eps)857 787 y FQ(\014le.)39 b(In)25 b(this)h(example,)h(the)f
+(dictionary)g(is)g(named)f FM($F2psDict)e FQ(although)j(other)g(names)
+857 899 y(can)31 b(b)s(e)f(used.)p Black 741 1049 a(3.)p
+Black 46 w(The)g(last)h(part)g(con)m(tains)g(the)g(commands)f(used)f
+(to)i(dra)m(w)f(the)h(graphics.)630 1170 y(Supp)s(ose)23
+b(the)i(ab)s(o)m(v)m(e)i FJ(eps)c FQ(\014le)j(is)f(named)f
+FM(file.eps)p FQ(.)37 b(Create)26 b(the)f(\014les)g FM(file.h)e
+FQ(and)i FM(file.ps)630 1261 y FQ(where)30 b FM(file.h)f
+FQ(con)m(tains)p Black Black 826 1389 a FE(/$F2psDict)42
+b(200)e(dict)g(def)826 1480 y($F2psDict)h(begin)826 1571
+y(...)826 1663 y(\045\045EndProlog)826 1845 y(/MyFigure)g({)826
+1937 y($F2psBegin)826 2028 y(...)826 2119 y($F2psEnd)826
+2211 y(})f(def)630 2338 y FQ(and)30 b FM(file.ps)e FQ(con)m(tains)p
+Black Black 826 2465 a FE(\045!PS-Adobe-2.0)43 b(EPSF-2.0)826
+2557 y(\045\045Title:)e(/tmp/xfig-fig017255)826 2648
+y(\045\045Creator:)h(fig2dev)e(Version)h(2.1.8)g(Patchlevel)g(0)826
+2739 y(\045\045CreationDate:)i(Sun)d(Sep)79 b(3)39 b(15:36:01)i(1995)
+826 2831 y(\045\045Orientation:)i(Portrait)826 2922 y
+(\045\045BoundingBox:)g(0)c(0)g(369)h(255)826 3013 y(\045\045Pages:)h
+(0)826 3105 y(\045\045EndComments)826 3196 y($F2psDict)g(begin)g
+(MyFigure)g(end)630 3323 y FM(file.h)23 b FQ(de\014nes)h(the)h
+(dictionary)g(and)f(de\014nes)g(the)h(P)m(ostScript)g(command)f
+FM(/MyFigure)p FQ(,)g(while)630 3415 y FM(file.ps)k FQ(con)m(tains)k
+(the)e(header)g(information)h(and)f(uses)g(the)g(P)m(ostScript)h
+(command)f(de\014ned)630 3506 y(in)45 b FM(file.h)p FQ(.)84
+b(In)45 b(particular,)50 b(it)c(is)g(imp)s(ortan)m(t)f(that)h(the)g
+FM(file.ps)d FQ(header)j(includes)f(the)630 3597 y FM(\045!PS...)24
+b FQ(line)i(and)f(the)h(BoundingBo)m(x)h(line.)39 b(The)26
+b(graphics)f(can)h(then)g(b)s(e)f(used)g(in)h(the)g(L)3752
+3581 y FP(A)3791 3597 y FQ(T)3842 3617 y(E)3892 3597
+y(X)630 3689 y(do)s(cumen)m(t)k(as)p Black Black 748
+3816 a FE(\\documentclass{article})748 3907 y(\\usepackage{graphicx})
+748 3999 y(\\special{header=file.h})748 4090 y(\\begin{document})865
+4181 y(...)865 4273 y(\\includegraphics[width=2in])q({file)q(.ps})865
+4364 y(...)865 4455 y(\\includegraphics[totalheigh)q(t=1in)q(]{fi)q
+(le.ps)q(})865 4547 y(...)748 4638 y(\\end{document})630
+4765 y FQ(Note)38 b(that)f(the)g(original)h(\014le)f
+FM(file.eps)d FQ(is)j(not)g(used.)59 b(Since)36 b(the)h(graphics)g
+(commands)f(in)630 4857 y FM(file.h)j FQ(are)j(only)f(included)g(once,)
+k(the)c(\014nal)g(P)m(ostScript)h(\014le)f(remains)g(small.)74
+b(Ho)m(w)m(ev)m(er,)630 4948 y(this)35 b(still)i(requires)d(L)1365
+4931 y FP(A)1404 4948 y FQ(T)1455 4968 y(E)1506 4948
+y(X)h(to)h(\014nd)e(and)h(read)g FM(file.ps)f FQ(whenev)m(er)h(the)g
+(graphics)h(are)f(used.)630 5039 y(The)e(follo)m(wing)h(commands)f(sa)m
+(v)m(e)h(the)f(graphics)g(in)g(a)g(L)2588 5023 y FP(A)2627
+5039 y FQ(T)2678 5059 y(E)2729 5039 y(X)g(b)s(o)m(x)g(to)h(pro)s(duce)d
+(a)j(small)f(\014nal)630 5131 y(P)m(ostScript)e(\014le)f(while)h
+(reading)h FM(file.ps)c FQ(only)i(once.)p Black Black
+748 5258 a FE(\\documentclass{article})748 5349 y
+(\\usepackage{graphicx})748 5441 y(\\special{header=file.h})p
+Black 2250 5640 a FQ(51)p Black eop end
+%%Page: 52 52
+TeXDict begin 52 51 bop Black 0 TeXcolorgray Black Black
+748 -57 a FE(\\newsavebox{\\mygraphic})748 34 y
+(\\sbox{\\mygraphic}{\\includegrap)q(hics[)q(widt)q(h=2in)q(]{fi)q
+(le.p)q(s}})748 217 y(\\begin{document})865 308 y(...)865
+399 y(\\usebox{\\mygraphic})865 491 y(...)865 582 y
+(\\resizebox*{1in}{!}{\\usebox)q({\\myg)q(raph)q(ic}})865
+673 y(...)748 765 y(\\end{document})630 917 y FQ(Lik)m(e)33
+b(the)f(previous)f(example,)i(these)g(commands)e(pro)s(duce)g(a)h
+(2-inc)m(h)h(wide)e(graphic)h(and)g(an-)630 1030 y(other)f(graphic)f
+(whose)g(totalheigh)m(t)j(is)e(1)g(inc)m(h.)630 1273
+y FB(16.2)112 b(Graphics)39 b(in)e(P)m(age)h(Header)g(or)f(F)-9
+b(o)s(oter)630 1431 y FQ(An)31 b(easy)h(metho)s(d)e(of)h(including)g
+(graphics)g(in)g(the)g(heading)h(is)f(to)h(use)e(the)i
+FO(fancyhdr)g FQ(pac)m(k)-5 b(age)630 1531 y(\(an)28
+b(impro)m(v)m(ed)f(v)m(ersion)h(of)g(the)g(old)f FO(fancyheadings)g
+FQ(pac)m(k)-5 b(age\))30 b(whic)m(h)d(is)h(do)s(cumen)m(ted)f(b)m(y)g
+([)p 0.05 1.00 1.00 0.40 TeXcolorcmyk(17)p Black 1
+w(].)630 1630 y(The)34 b(header)g(consists)h(of)g(three)g(parts:)48
+b(its)35 b(left)g(\014eld,)h(its)e(cen)m(ter)i(\014eld,)f(and)f(its)h
+(righ)m(t)g(\014eld.)630 1730 y(The)25 b FM(\\fancyhead)d
+FQ(command)j(sp)s(eci\014es)g(the)h(con)m(ten)m(ts)h(of)e(the)h(header)
+f(\014elds,)h(with)f(the)g FM(L,C,R)630 1829 y FQ(options)31
+b(sp)s(ecifying)f(whic)m(h)g(\014eld\(s\))h(the)f(command)g(mo)s
+(di\014es.)40 b(F)-8 b(or)31 b(example)p Black Black
+979 1968 a FN(\\pagestyle{fanc)o(y})979 2068 y(\\fancyhead[C]{M)o(y)38
+b(Paper})630 2207 y FQ(causes)31 b(the)f(cen)m(ter)i(header)e(\014eld)g
+(to)h(b)s(e)f(\\My)h(P)m(ap)s(er",)g(while)p Black Black
+979 2345 a FN(\\pagestyle{fanc)o(y})979 2445 y(\\fancyhead[L,R])o({\\t)
+o(ex)o(tbf)o({C)o(onf)o(id)o(en)o(tia)o(l})o(})630 2597
+y FQ(causes)24 b(b)s(oth)f(the)i(left)f(and)f(righ)m(t)i(header)f
+(\014elds)f(to)i(b)s(e)e(\\)p FL(Con\014den)m(tial)p
+FQ(".)39 b(If)23 b(no)h FM(L,C,R)e FQ(option)630 2710
+y(is)30 b(sp)s(eci\014ed,)f(it)h(applies)g(to)g(all)h(three)f(header)f
+(\014elds.)40 b(Th)m(us)29 b FM(\\fancyhead{})d FQ(is)k(used)f(to)h
+(clear)630 2823 y(all)35 b(the)f(header)g(\014elds.)50
+b(The)34 b FM(\\fancyfoot)d FQ(command)j(similarly)g(sp)s(eci\014es)g
+(the)g(left,)i(cen)m(ter,)630 2936 y(and)30 b(righ)m(t)h(fo)s(oter)g
+(\014elds.)771 3027 y(The)36 b(commands)h(in)f(the)h
+FO(fancyhdr)h FQ(pac)m(k)-5 b(age)38 b(can)f(insert)g(graphics)g(in)f
+(the)h(headers)g(and)-3952 b FL(Graphics)36 b(in)320
+3140 y(P)m(age)-120 3253 y(Header/F)-9 b(o)s(oter)630
+3118 y FQ(fo)s(oters.)47 b(F)-8 b(or)33 b(example,)h(after)f(splitting)
+g(the)f FJ(eps)f FQ(\014le)i FM(file.eps)d FQ(in)m(to)j(the)g(t)m(w)m
+(o)g(\014le)g FM(file.h)630 3210 y FQ(and)d FM(file.ps)e
+FQ(as)j(describ)s(ed)e(in)h(Section)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 31 w(16.1)p Black 32 w(on)g(page)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 32 w(50)p Black(,)h(the)g(commands)p Black
+Black 826 3340 a FE(\\documentclass{article})826 3432
+y(\\usepackage{fancyhdr,graphic)q(x})826 3614 y
+(\\renewcommand{\\headheight}{0)q(.6in})85 b(\045\045)40
+b(must)g(be)g(large)g(enough)h(for)e(graphic)826 3706
+y(\\renewcommand{\\textheight}{7)q(.5in})826 3888 y(\045)h(Define)g
+(PostScript)i(graphics)f(command)826 3980 y(\\special{header=file.h})
+826 4162 y(\045)f(Save)g(graphics)h(in)e(LaTeX)i(box)826
+4254 y(\\newsavebox{\\mygraphic})826 4345 y
+(\\sbox{\\mygraphic}{\\includegr)q(aphic)q(s[to)q(talhe)q(ight)q(=0.5)q
+(in]{f)q(ile.)q(ps}})826 4528 y(\\pagestyle{fancy})826
+4619 y(\\fancyhead{})121 b(\045)39 b(clear)h(all)g(header)h(fields)826
+4710 y(\\fancyhead[L]{\\usebox{\\mygra)q(phic})q(})826
+4801 y(\\fancyfoot{})121 b(\045)39 b(clear)h(all)g(footer)h(fields)826
+4893 y(\\fancyfoot[C]{\\thepage})826 4984 y
+(\\renewcommand{\\headrulewidth)q(}{0.5)q(pt})826 5075
+y(\\renewcommand{\\footrulewidth)q(}{0pt)q(})826 5258
+y(\\begin{document})826 5349 y(...)826 5441 y(\\end{document})p
+Black 2250 5640 a FQ(52)p Black eop end
+%%Page: 53 53
+TeXDict begin 53 52 bop Black 0 TeXcolorgray Black Black
+630 -149 a FQ(places)31 b(the)f(graphics)f(at)i(the)f(top)g(left)g(of)g
+(eac)m(h)h(\\fancy")g(page)f(with)g(a)g(0.5)h(pt)e(horizon)m(tal)j
+(line)630 -36 y(dra)m(wn)39 b(under)g(the)h(header.)69
+b(Additionally)-8 b(,)44 b(the)c(page)h(n)m(um)m(b)s(er)d(is)i(placed)h
+(at)f(the)h(b)s(ottom)630 77 y(cen)m(ter)33 b(of)g(eac)m(h)g(page,)h
+(with)e(no)g(horizon)m(tal)i(line)e(dra)m(wn)g(ab)s(o)m(v)m(e)h(the)g
+(fo)s(oter.)47 b(Note)33 b(that)g(this)630 190 y(do)s(es)d(not)h
+(a\013ect)h(\\plain")f(pages.)630 406 y(When)37 b(the)g
+FM([twoside])d FQ(do)s(cumen)m(tclass)j(option)h(is)f(used,)g(one)h(ma)
+m(y)f(w)m(an)m(t)h(to)f(individually)-3894 b FL(Odd/Ev)m(en)121
+519 y(Headings)630 506 y FQ(sp)s(ecify)26 b(the)h(o)s(dd)f(and)g(ev)m
+(en)h(page)h(headers/fo)s(oters.)40 b(The)26 b FM(E,O)f(\\fancyhead)f
+FQ(options)j(sp)s(ecify)630 605 y(the)g(ev)m(en)g(and)f(o)s(dd)f(page)i
+(headers,)g(resp)s(ectiv)m(ely)-8 b(.)42 b(If)25 b(the)i
+FM(E,O)f FQ(options)g(are)h(not)g(sp)s(eci\014ed,)g(the)630
+705 y(command)f(applies)g(to)g(b)s(oth)f(ev)m(en)i(and)e(o)s(dd)g
+(pages.)40 b(Lik)m(ewise)27 b(the)f FM(E,O)f(\\fancyfoot)e
+FQ(options)630 804 y(sp)s(ecify)30 b(the)h(ev)m(en)g(and)e(o)s(dd)h
+(page)h(fo)s(oters.)41 b(F)-8 b(or)31 b(example,)p Black
+Black 935 946 a FN(\\pagestyle{fancy)o(})935 1045 y(\\fancyhead[LE]{M)o
+(y)38 b(Paper})935 1145 y(\\fancyhead[RO]{M)o(y)g(Name})935
+1244 y(\\fancyfoot[C]{\\t)o(hep)o(ag)o(e})630 1386 y
+FQ(places)33 b(\\My)g(P)m(ap)s(er")g(in)f(the)h(upp)s(er)d(left)j(of)g
+(ev)m(en)g(fancy)g(pages,)g(\\My)h(Name")f(in)f(the)h(upp)s(er)630
+1485 y(righ)m(t)40 b(of)g(o)s(dd)e(fancy)i(pages,)i(and)d(the)h(page)g
+(n)m(um)m(b)s(er)e(in)i(the)f(b)s(ottom)h(cen)m(ter)h(of)e(all)i(fancy)
+630 1585 y(pages.)g(Replacing)32 b(the)p Black Black
+892 1726 a FN(\\fancyhead[L]{\\)o(us)o(ebo)o(x{)o(\\my)o(gr)o(aph)o(ic)
+o(}})630 1867 y FQ(command)e(in)g(the)h(ab)s(o)m(v)m(e)g(example)g
+(with)p Black Black 892 2008 a FN(\\fancyhead[LE,R)o(O])o({\\u)o(se)o
+(box)o({\\)o(myg)o(ra)o(ph)o(ic})o(})630 2163 y FQ(places)k(the)g
+(graphic)g(at)g(the)f(top)h(outside)g(\(the)g(left)g(side)g(of)f(ev)m
+(en)h(pages,)i(righ)m(t)e(side)f(of)h(o)s(dd)630 2276
+y(pages\))c(of)g(all)g(fancy)g(pages.)630 2505 y(The)44
+b FM(\\fancyhead)d FQ(commands)i(only)i(apply)e(to)i(pages)g(whose)e
+(st)m(yle)j(are)e(\\fancy".)83 b(Ev)m(en)-3888 b FL(Mo)s(difying)6
+2618 y(Plain)35 b(P)m(ages)91 b FQ(though)34 b FM(\\pagestyle{fancy})29
+b FQ(causes)34 b(the)g(do)s(cumen)m(t)g(to)g(ha)m(v)m(e)h(a)g(fancy)f
+(page)g(st)m(yle,)j(some)630 2731 y(pages)d(\(title)i(pages,)f(table)g
+(of)f(con)m(ten)m(ts)h(pages,)g(the)f(\014rst)f(page)i(of)f(c)m
+(hapters,)h(etc.\))52 b(are)34 b(still)630 2843 y(giv)m(en)d(a)g(plain)
+f(pagest)m(yle)j(b)m(y)d(default.)771 2943 y(The)e FM(\\fancypagestyle)
+c FQ(command)29 b(can)f(b)s(e)g(used)g(to)h(mo)s(dify)f(the)h(plain)f
+(pagest)m(yle.)42 b(F)-8 b(or)630 3043 y(example,)31
+b(adding)f(the)g(follo)m(wing)i(co)s(de)e(to)h(the)g(ab)s(o)m(v)m(e)g
+(example)g(causes)f(the)h(graphic)f(to)h(also)630 3142
+y(b)s(e)f(placed)h(at)g(the)f(upp)s(er)f(left)i(of)f(plain)g(pages.)p
+Black Black 848 3283 a FN(\\fancypagestyle{)o(pl)o(ain)o(}{)o(\045)979
+3383 y(\\fancyhead{})125 b(\045)44 b(clear)d(all)i(header)e(fields)979
+3483 y(\\fancyhead[L]{\\)o(use)o(bo)o(x{\\)o(my)o(gra)o(ph)o(ic)o(}})
+979 3582 y(\\fancyfoot{})125 b(\045)44 b(clear)d(all)i(footer)e(fields)
+979 3682 y(\\fancyfoot[C]{\\)o(the)o(pa)o(ge})979 3782
+y(\\renewcommand{\\)o(hea)o(dr)o(ule)o(wi)o(dth)o(}{)o(0.)o(5pt)o(})979
+3881 y(\\renewcommand{\\)o(foo)o(tr)o(ule)o(wi)o(dth)o(}{)o(0p)o(t}})
+630 4022 y FQ(When)30 b(the)h FM(twoside)d FQ(do)s(cumen)m(tclass)j
+(option)g(is)f(used,)g(replacing)h(b)s(oth)f(of)h(the)p
+Black Black 848 4163 a FN(\\fancyhead[L]{\\u)o(se)o(box)o({\\)o(myg)o
+(ra)o(phi)o(c})o(})630 4305 y FQ(commands)f(with)p Black
+Black 848 4446 a FN(\\fancyhead[LE,RO)o(]{)o(\\us)o(eb)o(ox{)o(\\m)o
+(ygr)o(ap)o(hi)o(c}})630 4600 y FQ(places)h(the)g(graphic)f(at)h(the)g
+(top)g(outside)f(of)h(ev)m(ery)g(page)g(\(b)s(oth)f(plain)g(and)g
+(fancy\).)630 4844 y FB(16.3)112 b(W)-9 b(atermark)38
+b(Graphics)g(in)g(Bac)m(kground)630 5015 y FQ(In)44 b(addition)g(to)h
+(adding)f(graphics)g(to)h(the)f(headers)g(and)g(fo)s(oters,)k(the)d
+FO(fancyhdr)g FQ(pac)m(k)-5 b(age)630 5128 y(can)42 b(place)g(graphics)
+f(b)s(ehind)f(in)h(the)h(text,)j(whic)m(h)c(is)g(useful)g(for)g
+(creating)i(a)f(logo)h(or)e(seal)630 5241 y(w)m(atermark.)771
+5332 y(The)23 b(follo)m(wing)i(example)g(places)f(the)g(graphics)g(in)f
+FM(file.eps)e FQ(on)j(ev)m(ery)g(page)h(\(b)s(oth)e(fancy)630
+5424 y(and)30 b(plain\).)p Black 2250 5640 a(53)p Black
+eop end
+%%Page: 54 54
+TeXDict begin 54 53 bop Black 0 TeXcolorgray Black Black
+Black Black 787 -149 a FE(\\documentclass{article})787
+-57 y(\\usepackage{graphicx,fancyhdr)q(})787 125 y(\045\045\045)40
+b(store)g(graphics)h(in)f(a)f(box)787 217 y(\\newsavebox{\\mygraphic})
+787 308 y(\\sbox{\\mygraphic}{\\includegra)q(phics)q([kee)q(paspe)q
+(ctra)q(tio,)1454 399 y(height=0.8\\textheight,)1454
+491 y(width=0.8\\linewidth]{file.eps})q(})787 673 y(\\pagestyle{fancy})
+787 765 y(\\fancyhead{})787 856 y(\\fancyhead[C]{\\setlength{\\uni)q
+(tleng)q(th}{)q(1in})1179 947 y(\\begin{picture}\(0,0\))1258
+1039 y(\\put\(-2.2,-6\){\\usebox{\\mygraphi)q(c}})1179
+1130 y(\\end{picture}})787 1313 y(\\fancypagestyle{plain}{\045)983
+1404 y(\\fancyhead{}\045)983 1495 y(\\fancyhead[C]{\\setlength{\\uni)q
+(tlen)q(gth}{)q(1in})1454 1586 y(\\begin{picture}\(0,0\))1532
+1678 y(\\put\(-2.2,-6\){\\usebox{\\mygra)q(phic)q(}})1454
+1769 y(\\end{picture}}})787 1952 y(\\begin{document})865
+2043 y(...)787 2134 y(\\end{document})630 2289 y FQ(The)28
+b(ab)s(o)m(v)m(e)i(example)f(places)g(the)f(graphics)h(suc)m(h)f(that)h
+(their)f(lo)m(w)m(er)i(left)f(corner)g(is)f(2.2)i(inc)m(hes)630
+2402 y(to)g(the)g(left)h(and)e(6)h(inc)m(hes)g(b)s(elo)m(w)g(the)g(cen)
+m(ter)h(of)f(the)f(header.)41 b(The)29 b(graphic)h(p)s(osition)g(can)g
+(b)s(e)630 2515 y(adjusted)g(b)m(y)g(c)m(hanging)h(these)g(t)m(w)m(o)h
+(n)m(um)m(b)s(ers.)771 2628 y(Since)24 b(the)g(header)g(is)g(t)m(yp)s
+(eset)g(b)s(efore)g(the)g(text,)i(this)e(example)h(causes)f(the)g(text)
+h(to)g(app)s(ear)630 2740 y(on)g(top)h(of)f(the)h(graphics.)39
+b(Since)25 b(the)g(fo)s(oter)h(is)f(t)m(yp)s(eset)i(after)e(the)h
+(text,)h(putting)e(the)h(graphics)630 2853 y(in)k(the)h(fo)s(oter)g
+(causes)f(the)h(graphics)f(to)h(app)s(ear)f(on)g(top)h(of)f(the)h
+(text.)771 2966 y(If)39 b(the)h(con)m(ten)m(ts)h(of)47
+b FM(file.eps)38 b FQ(con)m(tain)j(v)m(ector)g(\(not)f(bitmapp)s(ed\))f
+(graphics,)j(a)e(m)m(uc)m(h)630 3079 y(smaller)i(\014nal)g(P)m
+(ostScript)g(\014le)h(can)f(b)s(e)f(obtained)h(b)m(y)g(using)g(the)g
+(pro)s(cedure)e(describ)s(ed)h(in)630 3192 y(Section)p
+0.05 1.00 1.00 0.40 TeXcolorcmyk 31 w(16.1)p Black
+32 w(on)30 b(page)p 0.05 1.00 1.00 0.40 TeXcolorcmyk
+31 w(50)p Black(.)630 3432 y FL(16.3.1)106 b(eso-pic)35
+b(P)m(ac)m(k)-6 b(age)630 3604 y FQ(Another)29 b(metho)s(d)f(for)h
+(adding)g(L)1773 3587 y FP(A)1812 3604 y FQ(T)1863 3623
+y(E)1913 3604 y(X)g(ob)5 b(ject)30 b(on)f(ev)m(ery)h(page)g(is)f(the)g
+FO(eso-pic)h FQ(pac)m(k)-5 b(age)31 b(whic)m(h)630 3717
+y(de\014nes)g(a)i(zero-length)h(picture)e(en)m(vironmen)m(t)h(with)f
+(basep)s(oin)m(t)g(at)h(the)f(lo)m(w)m(er)i(left)f(corner)f(of)630
+3830 y(the)f(page.)41 b(See)31 b(the)f FO(eso-pic)i FQ(pac)m(k)-5
+b(age)32 b(do)s(cumen)m(tation)f([)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk(15)p Black 1 w(])g(for)f(details.)p Black
+2250 5640 a(54)p Black eop end
+%%Page: 55 55
+TeXDict begin 55 54 bop Black 0 TeXcolorgray Black Black
+630 -149 a FD(P)l(art)46 b(IV)630 59 y FA(The)64 b(Figure)g(En)-5
+b(vironmen)g(t)630 326 y FD(17)135 b(The)44 b(Figure)h(En)l(vironmen)l
+(t)630 529 y FQ(When)32 b(using)f(a)h(w)m(ord)g(pro)s(cessor,)g
+(\014gures)f(app)s(ear)g(exactly)j(where)d(the)h(user)f(places)i(them)
+3860 496 y FP(24)3935 529 y FQ(.)630 642 y(Since)j(these)h(\014gures)e
+(cannot)i(b)s(e)e(split,)j(they)f(often)f(lead)h(to)g(p)s(o)s(or)e
+(page)i(breaks)f(that)h(lea)m(v)m(e)630 755 y(large)46
+b(c)m(h)m(unks)e(of)h(blank)g(space)g(at)g(the)g(b)s(ottom)g(of)g
+(pages.)85 b(T)-8 b(o)45 b(ac)m(hiev)m(e)i(a)e(professional-)630
+867 y(lo)s(oking)40 b(do)s(cumen)m(t,)h(the)e(author)f(m)m(ust)h(man)m
+(ually)g(rearrange)h(the)f(\014gures)f(to)h(a)m(v)m(oid)h(these)630
+980 y(p)s(o)s(or)h(page)h(breaks.)75 b(This)41 b(\014gure-sh)m
+(u\017ing)f(b)s(ecomes)i(quite)g(tedious,)j(esp)s(ecially)e(since)f(it)
+630 1093 y(m)m(ust)30 b(b)s(e)g(rep)s(eated)g(whenev)m(er)h(the)f(do)s
+(cumen)m(t)g(is)h(mo)s(di\014ed.)771 1206 y(L)795 1189
+y FP(A)834 1206 y FQ(T)885 1226 y(E)935 1206 y(X)d(pro)m(vides)f
+(\015oating)h(\014gures)e(whic)m(h)h(automatically)j(mo)m(v)m(e)f(to)f
+(esthetically-pleasing)630 1319 y(lo)s(cations,)g(pro)s(ducing)d
+(professional-lo)s(oking)i(do)s(cumen)m(ts)e(without)h(all)h(of)e(the)h
+(\014gure-mo)m(ving)630 1432 y(drudgery)-8 b(.)37 b(Ho)m(w)m(ev)m(er,)
+28 b(these)c(\015oating)h(\014gures)e(often)i(b)s(other)e(new)g(users)g
+(who)h(are)g(accustomed)630 1545 y(to)39 b(man)m(ual)f(\014gure)f
+(placemen)m(t.)65 b(T)-8 b(aking)38 b(adv)-5 b(an)m(tage)40
+b(of)e(L)2709 1528 y FP(A)2748 1545 y FQ(T)2799 1564
+y(E)2849 1545 y(X's)g(\015oating)h(\014gures)e(requires)630
+1658 y(the)31 b(follo)m(wing)p Black 630 1820 a FL(Don't)k(comp)s(ose)h
+(text)e(whic)m(h)i(is)f(dep)s(enden)m(t)f(on)i(\014gure)f(placemen)m
+(t.)p Black 857 1966 a FQ(Using)24 b(the)f(phrase)g(\\This)g
+(\014gure...")39 b(or)23 b(\\The)g(follo)m(wing)i(\014gure...")39
+b(requires)23 b(the)h(\014gure)857 2079 y(to)35 b(b)s(e)f(in)g(a)g
+(certain)i(lo)s(cation.)54 b(Using)34 b(the)h(phrase)e(\\Figure)i
+(14...")54 b(allo)m(ws)36 b(the)f(\014gure)857 2191 y(to)c(b)s(e)f(p)s
+(ositioned)g(an)m(ywhere.)p Black 630 2369 a FL(Relax.)p
+Black 857 2514 a FQ(Some)23 b(users)f(get)i(quite)f(w)m(orried)g(when)e
+(a)i(\014gure)f(isn't)h(placed)h(exactly)g(where)e(they)h(w)m(an)m(t)
+857 2627 y(it.)41 b(Figure)31 b(placemen)m(t)g(is)f(L)1816
+2610 y FP(A)1855 2627 y FQ(T)1906 2647 y(E)1956 2627
+y(X's)g(job;)g(users)f(generally)i(should)e(not)h(w)m(orry)g(ab)s(out)f
+(it.)630 2873 y(The)35 b(follo)m(wing)i(pages)f(describ)s(e)e(ho)m(w)i
+(the)f(L)2200 2856 y FP(A)2239 2873 y FQ(T)2290 2892
+y(E)2341 2873 y(X)g(determines)g(\015oat)h(lo)s(cations)h(whic)m(h)e
+(ob)s(ey)p Black Black -3859 w FL(Summary)105 2986 y(of)g(Advice)91
+b FQ(t)m(yp)s(esetting)28 b(rules)d(for)h(a)h(professional-lo)s(oking)h
+(do)s(cumen)m(t.)39 b(F)-8 b(or)27 b(con)m(v)m(enience,)i(the)e
+(solutions)630 3099 y(to)k(the)g(most-common)g(\015oat-placemen)m(t)i
+(problems)d(are)g(listed)h(b)s(elo)m(w.)p Black 741 3241
+a(1.)p Black 46 w(Don't)k(handcu\013)e(L)1516 3225 y
+FP(A)1555 3241 y FQ(T)1606 3261 y(E)1656 3241 y(X.)52
+b(The)34 b(more)g(\015oat)g(placemen)m(t)i(options)e(are)h(giv)m(en)g
+(to)f(L)3726 3225 y FP(A)3765 3241 y FQ(T)3816 3261 y(E)3867
+3241 y(X,)857 3354 y(the)41 b(b)s(etter)g(it)g(handles)f(\015oat)h
+(placemen)m(t.)72 b(In)40 b(particular,)k(the)d FM([htbp])d
+FQ(and)i FM([tbp])857 3467 y FQ(options)31 b(w)m(ork)f(w)m(ell.)42
+b(See)31 b(Section)p 0.05 1.00 1.00 0.40 TeXcolorcmyk
+31 w(17.2)p Black 32 w(on)f(page)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 31 w(58)p Black(.)p Black 741 3599 a(2.)p
+Black 46 w(Man)m(y)24 b(p)s(eople)g(\014nd)e(the)h(default)h(\015oat)g
+(parameters)g(are)g(to)s(o)g(restrictiv)m(e.)40 b(The)23
+b(follo)m(wing)857 3699 y(commands)p Black Black 1162
+3828 a FN(\\setcounter{topnu)o(mbe)o(r})o({4)o(})1162
+3927 y(\\setcounter{botto)o(mnu)o(mb)o(er)o(}{4)o(})1162
+4027 y(\\setcounter{total)o(num)o(be)o(r})o({10)o(})1162
+4126 y(\\renewcommand{\\te)o(xtf)o(ra)o(ct)o(ion)o(}{)o(0.1)o(5})1162
+4226 y(\\renewcommand{\\to)o(pfr)o(ac)o(ti)o(on})o({0)o(.85)o(})1162
+4326 y(\\renewcommand{\\bo)o(tto)o(mf)o(ra)o(cti)o(on)o(}{0)o(.7)o(0})
+1162 4425 y(\\renewcommand{\\fl)o(oat)o(pa)o(ge)o(fra)o(ct)o(ion)o(}{)o
+(0.)o(66})857 4567 y FQ(set)30 b(the)f(\015oat)g(parameters)h(to)f
+(more-p)s(ermissiv)m(e)g(v)-5 b(alues.)41 b(See)29 b(Section)p
+0.05 1.00 1.00 0.40 TeXcolorcmyk 30 w(18)p Black 29
+w(on)g(page)p 0.05 1.00 1.00 0.40 TeXcolorcmyk 30
+w(61)p Black(.)p Black 741 4712 a(3.)p Black 46 w(L)881
+4696 y FP(A)920 4712 y FQ(T)971 4732 y(E)1022 4712 y(X)40
+b(allo)m(ws)h(\014gures)e(to)i(\015oat)g(to)g(the)f(top)g(of)g(the)g
+(curren)m(t)g(page,)k(th)m(us)39 b(app)s(earing)857 4825
+y(b)s(efore)e(the)h(reference)g(in)f(the)g(text.)63 b(Users)37
+b(who)g(do)g(not)h(lik)m(e)g(this)f(b)s(eha)m(vior)h(should)857
+4938 y(use)33 b(the)g FO(\015after)h FQ(pac)m(k)-5 b(age)35
+b([)p 0.05 1.00 1.00 0.40 TeXcolorcmyk(18)p Black
+1 w(].)48 b(Include)32 b FM(\\usepackage{flafter})c FQ(at)34
+b(the)f(b)s(eginning)857 5051 y(of)e(the)f(do)s(cumen)m(t;)h(no)f
+(other)h(commands)f(are)g(necessary)-8 b(.)p Black 630
+5137 1332 4 v 703 5226 a FF(24)768 5258 y FG(Although)28
+b(man)n(y)f(w)n(ord)h(pro)r(cessors)i(do)d(allo)n(w)j(\014gures)e(to)g
+(mo)n(v)n(e)f(around)h(text)f(\(or)h(vice-v)n(ersa\),)h(the)e(v)l(ast)
+630 5349 y(ma)t(jorit)n(y)38 b(of)g(the)e(users)i(do)f(not)g(use)g(suc)
+n(h)f(capabilit)n(y)i(b)r(ecause)f(of)h(either)f(p)r(o)r(or)h(implemen)
+n(tation)f(b)n(y)f(the)630 5441 y(soft)n(w)n(are)27 b(author)f(and/or)g
+(ignorance/indi\013erence)h(b)n(y)e(the)g(do)r(cumen)n(t)h(author.)p
+Black Black 2250 5640 a FQ(55)p Black eop end
+%%Page: 56 56
+TeXDict begin 56 55 bop Black 0 TeXcolorgray Black Black
+Black 741 -149 a FQ(4.)p Black 46 w(T)-8 b(o)31 b(guaran)m(tee)h(that)g
+(a)f(\014gure)f(do)s(es)g(not)h(\015oat)g(past)g(a)g(certain)g(p)s(oin)
+m(t,)g(use)f(the)h FO(placeins)857 -36 y FQ(pac)m(k)-5
+b(age)33 b(and)c(issue)i(a)f FM(\\FloatBarrier)d FQ(command.)41
+b(See)30 b(Section)p 0.05 1.00 1.00 0.40 TeXcolorcmyk
+31 w(17.3)p Black 32 w(on)h(page)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 31 w(59)p Black(.)857 115 y(W)-8 b(arning,)35
+b(o)m(v)m(eruse)g(of)41 b FM(\\FloatBarrier)30 b FQ(indicates)k(that)h
+(either)f(the)f(\015oat-placemen)m(t)857 227 y(is)h(b)s(eing)f
+(micro-managed)j(or)d(the)h(\015oat)h(parameters)f(are)g(set)h
+(incorrectly)-8 b(,)36 b(neither)e(of)857 340 y(whic)m(h)c(are)h(go)s
+(o)s(d.)630 584 y FB(17.1)112 b(Creating)38 b(Floating)h(Figures)630
+742 y FQ(Floating)h(\014gures)d(are)h(created)h(b)m(y)e(putting)h
+(commands)f(in)h(a)g FM(figure)e FQ(en)m(vironmen)m(t.)63
+b(The)630 842 y(con)m(ten)m(ts)34 b(of)e(the)h(\014gure)e(en)m
+(vironmen)m(t)i(alw)m(a)m(ys)h(remain)e(in)g(one)g(c)m(h)m(unk,)h
+(\015oating)g(to)g(pro)s(duce)630 941 y(go)s(o)s(d)d(page)g(breaks.)41
+b(The)29 b(\015oating)i(\014gures)e(can)h(b)s(e)f(automatically)k(n)m
+(um)m(b)s(ered)c(b)m(y)g(using)h(the)630 1041 y FM(\\caption)36
+b FQ(command.)66 b(F)-8 b(or)39 b(example,)j(the)d(follo)m(wing)h
+(commands)f(put)f(the)h(graphic)f(from)630 1141 y FM(graph.eps)28
+b FQ(inside)i(a)h(\015oating)g(\014gure)p Black Black
+848 1282 a FN(\\begin{figure})979 1381 y(\\centering)979
+1481 y(\\includegraphic)o(s[t)o(ot)o(alh)o(ei)o(ght)o(=2)o(in)o(]{g)o
+(ra)o(ph.)o(ep)o(s})979 1581 y(\\caption{This)38 b(is)43
+b(an)f(inserted)f(EPS)h(graphic})979 1680 y(\\label{fig:grap)o(h})848
+1780 y(\\end{figure})848 1979 y(The)g(graph)g(in)h(Figure~\\ref{fig)o
+(:gr)o(ap)o(h})37 b(on)43 b(Page~\\pageref{fi)o(g:)o(gra)o(ph)o(}.)o
+(..)630 2134 y FQ(Notes)32 b(ab)s(out)e(\014gures)p Black
+767 2276 a FK(\210)p Black 45 w FQ(The)23 b(optional)h
+FM(\\label)e FQ(command,)j(can)e(b)s(e)g(used)f(with)h(the)h
+FM(\\ref)p FQ(,)f(and)g FM(\\pageref)e FQ(com-)857 2389
+y(mands)32 b(to)i(reference)g(the)f(caption.)50 b(See)33
+b(Section)p 0.05 1.00 1.00 0.40 TeXcolorcmyk 34 w(17.1.1)p
+Black 36 w(for)g(additional)h(information)857 2502 y(on)39
+b(references.)68 b(The)38 b FM(\\label)g FQ(command)h(m)m(ust)g(b)s(e)f
+(placed)i(immediately)g Fy(after)50 b FQ(the)857 2615
+y FM(\\caption)25 b FQ(command.)39 b(Putting)27 b(the)g
+FM(\\label)e FQ(b)s(efore)h(the)h FM(\\caption)d FQ(causes)j(the)g
+FM(\\ref)857 2728 y FQ(command)h(to)g(reference)h(the)f(last)g
+(reference-able)h(ob)5 b(ject)29 b(\(whic)m(h)f(often)g(is)g(the)g
+(section)857 2841 y(or)j(previous)f(\014gure\).)p Black
+767 2991 a FK(\210)p Black 45 w FQ(If)44 b(the)g(\014gure)g(en)m
+(vironmen)m(t)g(con)m(tains)i(no)d FM(\\caption)f FQ(commands,)48
+b(it)c(pro)s(duces)f(an)857 3104 y(unn)m(um)m(b)s(ered)28
+b(\015oating)k(\014gure.)p Black 767 3254 a FK(\210)p
+Black 45 w FQ(If)i(the)h(\014gure)e(en)m(vironmen)m(t)i(con)m(tains)h
+(m)m(ultiple)f FM(\\caption)d FQ(commands,)j(it)g(pro)s(duces)857
+3367 y(m)m(ultiple)40 b(\014gures)e(whic)m(h)g(\015oat)i(together.)68
+b(This)38 b(is)g(useful)g(in)h(constructing)g(side-b)m(y-)857
+3480 y(side)29 b(graphics)f(\(see)h(Section)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 30 w(28)p Black 29 w(on)f(page)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 30 w(104)p Black(\))i(or)e(complex)h(arrangemen)m(ts)g
+(suc)m(h)g(as)f(in)857 3593 y(Section)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 31 w(31)p Black 32 w(on)i(page)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 31 w(110)p Black(.)p Black 767 3730 a FK(\210)p
+Black 45 w FQ(By)25 b(default,)h(the)f(caption)h(text)f(is)g(used)f(as)
+h(the)f(caption)i(and)e(also)h(in)g(the)f(list)i(of)e(\014gures.)857
+3830 y(The)34 b(caption)i(has)e(an)h(optional)g(argumen)m(t)g(whic)m(h)
+g(sp)s(eci\014es)f(the)g(list-of-\014gure)i(en)m(try)-8
+b(.)857 3929 y(F)g(or)31 b(example,)p Black Black 1337
+4063 a FN(\\caption[List)38 b(Text]{Caption)g(Text})857
+4210 y FQ(causes)32 b(\\Caption)f(T)-8 b(ext")33 b(to)e(app)s(ear)g(in)
+f(the)i(caption,)g(but)e(\\List)i(T)-8 b(ext")32 b(to)g(app)s(ear)e(in)
+857 4323 y(the)h(list)g(of)f(\014gures.)40 b(This)30
+b(is)g(useful)g(when)f(long,)j(descriptiv)m(e)f(captions)g(are)g(used.)
+p Black 767 4473 a FK(\210)p Black 45 w FQ(The)g(\014gure)f(en)m
+(vironmen)m(t)h(can)h(only)f(b)s(e)f(used)g(in)h Fy(outer)i(p)-5
+b(ar)g(agr)g(aph)37 b(mo)-5 b(de)p FQ(,)33 b(prev)m(en)m(ting)857
+4586 y(it)e(from)f(b)s(eing)g(used)g(inside)g(an)m(y)g(b)s(o)m(x)h
+(\(suc)m(h)f(as)h(parb)s(o)m(x)e(or)i(minipage\).)p Black
+767 4723 a FK(\210)p Black 45 w FQ(Figure)g(en)m(vironmen)m(ts)g
+(inside)f(of)h(paragraphs)p Black Black 1250 4857 a FN(....text)40
+b(text)i(text)g(text)g(text)g(text)1250 4956 y(\\begin{figure})1380
+5056 y(....)1250 5156 y(\\end{figure})1250 5255 y(text)f(text)h(text)g
+(text)g(text)g(text...)857 5402 y FQ(are)31 b(not)g(pro)s(cessed)e(un)m
+(til)i(the)g(end)e(of)i(the)g(paragraph.)p Black 2250
+5640 a(56)p Black eop end
+%%Page: 57 57
+TeXDict begin 57 56 bop Black 0 TeXcolorgray Black Black
+630 -149 a FL(17.1.1)106 b(De\014ning)35 b(a)g(Reference)g(Command)630
+10 y FQ(Instead)30 b(of)h(t)m(yping)p Black Black 761
+151 a FN(Figure~\\ref{fig:)o(gr)o(ap)o(h})37 b(on)43
+b(Page~\\pageref{fi)o(g:g)o(ra)o(ph)o(})630 292 y FQ(it)31
+b(is)f(more)h(con)m(v)m(enien)m(t)h(to)f(de\014ne)f(the)h(follo)m(wing)
+g(command)g(in)f(the)g(do)s(cumen)m(t)g(pream)m(ble)p
+Black Black 717 433 a FN(\\newcommand\\Figpa)o(ge)o([1)o(]{F)o(ig)o
+(ure)o(~\\)o(ref)o(*{)o(#1)o(})38 b(on)k(Page~\\pageref*{#1)o(}})630
+574 y FQ(whic)m(h)30 b(allo)m(ws)i(the)e(reference)h(co)s(de)g(to)g
+(shortened)f(to)p Black Black 761 715 a FN(\\Figpage{fig:gra)o(ph)o(})
+630 997 y FL(Conditional)35 b(References)771 1130 y FQ(The)27
+b(ab)s(o)m(v)m(e)i FM(\\Figpage)c FQ(de\014nition)i(alw)m(a)m(ys)i
+(prin)m(ts)e(b)s(oth)g(the)g(Figure's)h(n)m(um)m(b)s(er)e(and)h(page)
+630 1229 y(n)m(um)m(b)s(er.)38 b(In)27 b(cases)h(where)f(the)h
+(\014gure)e(app)s(ears)h(on)g(the)h(same)g(page)g(as)f(the)h
+(reference,)g(it)g(ma)m(y)630 1329 y(b)s(e)i(desirable)g(to)h(omit)h
+(the)e(page)h(n)m(um)m(b)s(er.)40 b(This)29 b(can)i(ac)m(hiev)m(ed)h(b)
+m(y)e(the)h(follo)m(wing)h(co)s(de)p Black Black 717
+1470 a FN(\\newcommand\\FigDi)o(ff)o([1)o(]{F)o(ig)o(ure)o(~\\)o(ref)o
+(*{)o(#1)o(})38 b(on)k(Page~\\pageref*{#1)o(}})717 1570
+y(\\newcommand\\FigSa)o(me)o([1)o(]{F)o(ig)o(ure)o(~\\)o(ref)o(*{)o(#1)
+o(}})717 1669 y(\\newcommand\\Figre)o(f[)o(1])o({\\i)o(ft)o(hen)o(el)o
+(se{)o(\\v)o(al)o(ue{)o(pa)o(ge})o(=\\)o(pa)o(ger)o(ef)o({#1)o(}})1632
+1769 y({\\FigSame{#1}}{\\F)o(igD)o(if)o(f{#)o(1})o(}})630
+1924 y FQ(If)37 b(the)i(reference)f(and)f(\014gure)h(are)g(on)g(the)g
+(same)g(page,)j(the)d FM(\\Figref)e FQ(command)i(calls)h(the)630
+2036 y FM(\\FigSame)32 b FQ(command)j(whic)m(h)f(displa)m(ys)g
+(\\Figure)i(17".)54 b(If)35 b(the)f(reference)h(and)f(\014gure)g(are)h
+(on)630 2149 y(di\013eren)m(t)c(pages,)h(the)f FM(\\Figref)d
+FQ(command)j(calls)h(the)f FM(\\FigDiff)d FQ(command)i(whic)m(h)h
+(displa)m(ys)630 2262 y(\\Figure)g(17)h(on)e(P)m(age)i(25".)771
+2375 y(The)39 b FO(va)m(rio)m(ref)47 b FQ(pac)m(k)-5
+b(age)42 b([)p 0.05 1.00 1.00 0.40 TeXcolorcmyk(34)p
+Black 1 w(])e(pro)m(vides)g(addition)g(commands)f(lik)m(e)i(this)f(for)
+g(referencing)630 2488 y(Figures,)31 b(T)-8 b(ables,)31
+b(Section,)h(etc.)630 2728 y FL(17.1.2)106 b(h)m(yp)s(erref)35
+b(P)m(ac)m(k)-6 b(age)630 2900 y FQ(The)31 b FO(hyp)s(erref)38
+b FQ(pac)m(k)-5 b(age)34 b(allo)m(ws)f(users)e(to)h(construct)g(h)m(yp)
+s(erlinks)f(within)g(L)3270 2883 y FP(A)3309 2900 y FQ(T)3360
+2919 y(E)3410 2900 y(X)h(do)s(cumen)m(ts,)630 3013 y(most)f(commonly)g
+(in)f(conjunction)g(with)g FM(pdflatex)p FQ(.)771 3126
+y(One)h(feature)g(of)h FO(hyp)s(erref)37 b FQ(is)31 b(that)h(it)f
+(rede\014nes)g(the)g FM(\\ref)f FQ(and)g FM(\\cite)g
+FQ(commands)h(to)h(b)s(e)630 3239 y(t)m(yp)s(eset)26
+b(as)g(h)m(yp)s(erlinks)e(to)i(the)g(reference.)39 b(The)25
+b FM(\\ref*)f FQ(and)h FM(\\cite*)e FQ(commands)i(are)h(de\014ned)630
+3351 y(for)k(references)h(and)f(cites)h(without)g(h)m(yp)s(erlinks.)771
+3464 y(Because)23 b(the)f FO(hyp)s(erref)28 b FQ(pac)m(k)-5
+b(age)24 b(rede\014nes)d(man)m(y)h(L)2554 3448 y FP(A)2593
+3464 y FQ(T)2644 3484 y(E)2694 3464 y(X)g(commands,)i(users)d(should)f
+(order)630 3577 y(their)30 b FM(\\usepackage)e FQ(to)j(mak)m(e)g
+FO(hyp)s(erref)37 b FQ(b)s(e)30 b(the)g(last)h(pac)m(k)-5
+b(age)33 b(loaded.)771 3690 y(F)-8 b(or)31 b(more)g(information,)g(see)
+g(the)f(Hyp)s(ertext)h(Man)m(ual)g([)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk(21)p Black 1 w(].)630 3930 y FL(Hyp)s(ertext)j(References)
+630 4055 y FQ(When)40 b(using)f(the)h FO(hyp)s(erref)46
+b FQ(pac)m(k)-5 b(age,)45 b(the)40 b FM(\\ref)f FQ(command)g(t)m(yp)s
+(esets)i(the)f(\014gure)f(n)m(um)m(b)s(er)630 4146 y(with)d(a)h(h)m(yp)
+s(erlink)f(to)h(the)g(\014gure.)58 b(Since)37 b(the)g(\014gure)f(n)m
+(um)m(b)s(er)f(is)h(relativ)m(ely)j(small,)g(it)e(ma)m(y)630
+4237 y(b)s(e)f(di\016cult)h(for)f(readers)h(to)g(clic)m(k)h(on)f(the)g
+(actual)h(\014gure)e(n)m(um)m(b)s(er.)58 b(T)-8 b(o)37
+b(mak)m(e)h(clic)m(king)h(the)630 4329 y(h)m(yp)s(erlink)29
+b(easier,)j(the)e(follo)m(wing)i(co)s(de)p Black Black
+708 4462 a FE(\\newcommand\\Figlink[1]{\\hyp)q(erre)q(f[#1])q({Fig)q
+(ure~\\)q(ref*)q({#1})q(})45 b(on)40 b(Page~\\pageref*{#1}})630
+4616 y FQ(de\014nes)f(a)g FM(\\Figlink)f FQ(command)h(whic)m(h)g(turns)
+f(the)i(en)m(tire)g(\\Figure)h(17")f(reference)g(in)m(to)h(a)630
+4729 y(single)31 b(h)m(yp)s(erlink.)p Black 2250 5640
+a(57)p Black eop end
+%%Page: 58 58
+TeXDict begin 58 57 bop Black 0 TeXcolorgray Black Black
+630 -149 a FB(17.2)112 b(Figure)39 b(Placemen)m(t)630
+23 y FQ(The)h FM(figure)f FQ(en)m(vironmen)m(t)i(has)g(an)g(optional)g
+(argumen)m(t)h(whic)m(h)e(allo)m(ws)i(users)e(to)h(sp)s(ecify)630
+136 y(p)s(ossible)26 b(\014gure)h(lo)s(cations.)41 b(The)26
+b(optional)i(argumen)m(t)g(can)f(con)m(tain)h(an)m(y)f(com)m(bination)i
+(of)e(the)630 249 y(follo)m(wing)32 b(letters)p Black
+630 403 a FM(h)p Black 45 w Fy(Her)-5 b(e:)67 b FQ(Place)42
+b(the)f(\014gure)f(in)g(the)h(text)h(where)f(the)g(\014gure)f(command)g
+(is)h(lo)s(cated.)74 b(This)857 516 y(option)30 b(cannot)h(b)s(e)e
+(executed)h(if)g(there)g(is)f(not)h(enough)f(ro)s(om)h(remaining)g(on)f
+(the)h(page.)p Black 630 666 a FM(t)p Black 45 w Fy(T)-7
+b(op:)47 b FQ(Place)31 b(the)g(\014gure)f(at)h(the)f(top)h(of)g(a)f
+(page.)p Black 630 817 a FM(b)p Black 45 w Fy(Bottom:)47
+b FQ(Place)32 b(the)f(\014gure)e(at)j(the)e(b)s(ottom)h(of)f(a)h(page)
+2690 784 y FP(25)2766 817 y FQ(.)p Black 630 967 a FM(p)p
+Black 45 w Fy(Flo)-5 b(at)35 b(Page:)45 b FQ(Place)32
+b(the)e(\014gure)g(on)g(a)h(con)m(taining)h(only)f(\015oats.)630
+1121 y(Notes)h(on)e(\014gure)g(placemen)m(t:)p Black
+767 1264 a FK(\210)p Black 45 w FQ(If)g(no)g(optional)i(argumen)m(ts)f
+(are)f(listed,)i(the)e(placemen)m(t)i(options)f(default)f(to)h
+FM([tbp])p FQ(.)857 1401 y(The)e(default)g(argumen)m(ts)g(can)g(b)s(e)f
+(customized)i(b)m(y)f(rede\014ning)f(the)h(in)m(ternal)g(command)857
+1501 y FM(\\fps@figure)p FQ(.)38 b(F)-8 b(or)31 b(example,)g(the)g
+(follo)m(wing)h(co)s(de)p Black Black 1206 1634 a FN(\\makeatletter)
+1293 1734 y(\\def\\fps@figure{h)o(tb)o(p})1206 1834 y(\\makeatother)857
+1981 y FQ(causes)f(the)g(placemen)m(t)g(options)g(to)g(default)g(to)g
+FM([htbp])p FQ(.)p Black 767 2131 a FK(\210)p Black 45
+w FQ(The)41 b(order)h(in)f(whic)m(h)g(the)h(placemen)m(t)h(options)f
+(are)h(sp)s(eci\014ed)e(do)s(es)g Fy(not)51 b FQ(mak)m(e)43
+b(an)m(y)857 2244 y(di\013erence,)25 b(as)d(the)g(placemen)m(t)i
+(options)e(are)g(alw)m(a)m(ys)i(attempted)f(in)f(the)g(order)g
+FM(h-t-b-p)p FQ(.)857 2357 y(Th)m(us)30 b FM([hb])f FQ(and)h
+FM([bh])f FQ(are)i(b)s(oth)e(attempted)j(as)e FM(h-b)p
+FQ(.)p Black 767 2507 a FK(\210)p Black 45 w FQ(The)40
+b(more)h(\015oat)h(placemen)m(t)g(options)f(are)g(giv)m(en)g(to)h(L)
+2836 2490 y FP(A)2875 2507 y FQ(T)2926 2527 y(E)2976
+2507 y(X,)i(the)d(b)s(etter)f(it)i(handles)857 2620 y(\015oat)27
+b(placemen)m(t.)41 b(In)25 b(particular,)i(the)f FM([htbp])p
+FQ(,)g FM([tbp])p FQ(,)f FM([htp])p FQ(,)h FM([tp])f
+FQ(options)h(usually)857 2733 y(w)m(ork)31 b(w)m(ell.)p
+Black 767 2883 a FK(\210)p Black 45 w FQ(Single-lo)s(cation)48
+b(options)f FM([t])p FQ(,)i FM([b])p FQ(,)g FM([p])c([h])g
+FQ(are)h(problematic)3271 2850 y FP(26)3347 2883 y FQ(.)87
+b(If)45 b(the)i(\014gure)857 2996 y(do)s(esn't)c(\014t)g(in)g(the)h(sp)
+s(eci\014ed)e(lo)s(cation,)49 b(the)43 b(\014gure)g(b)s(ecomes)g(stuc)m
+(k,)48 b(blo)s(c)m(king)c(the)857 3109 y(subsequen)m(t)27
+b(\014gures.)39 b(A)28 b(\\T)-8 b(o)s(o)29 b(Man)m(y)f(Unpro)s(cessed)f
+(Floats")j(error)d(o)s(ccurs)g(if)h(this)g(log-)857 3222
+y(jam)33 b(of)f(\014gures)g(exceeds)h(L)1787 3205 y FP(A)1826
+3222 y FQ(T)1877 3241 y(E)1928 3222 y(X's)f(limit)i(of)e(18)i(unpro)s
+(cessed)d(\015oats)i(\(see)g(Section)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 33 w(17.4)p Black 857 3335 a(on)e(page)p
+0.05 1.00 1.00 0.40 TeXcolorcmyk 31 w(60)p Black(\).)630
+3477 y(When)f(L)919 3461 y FP(A)958 3477 y FQ(T)1009
+3497 y(E)1059 3477 y(X)h(\\tries")h(to)f(place)g(a)g(\014gure,)f(it)h
+(ob)s(eys)f(the)g(follo)m(wing)i(rules)p Black Black
+-2974 w Fo(A)n(lso)e(se)l(e)194 3577 y(R)l(efer)l(enc)l(e)133
+3677 y([)p 0.05 1.00 1.00 0.40 TeXcolorcmyk(1)p Black
+1 w(,)g(p)l(g)g(198])r(.)p Black 741 3620 a FQ(1.)p Black
+46 w(A)e(\014gure)g(can)g(only)g(b)s(e)g(placed)g(in)g(the)g(lo)s
+(cations)h(sp)s(eci\014ed)f(b)m(y)g(its)g(placemen)m(t)h(options.)p
+Black 741 3771 a(2.)p Black 46 w(The)h(\014gure)g(cannot)h(cause)g(the)
+f(page)i(to)f(b)s(e)e(o)m(v)m(erfull.)p Black 741 3921
+a(3.)p Black 46 w(The)g(\015oat)g(m)m(ust)g(b)s(e)f(placed)h(on)g(the)g
+(page)h(where)e(it)i(o)s(ccurs)e(in)h(the)g(text,)h(or)f(on)g(a)g
+(later)857 4034 y(page)1038 4001 y FP(27)1114 4034 y
+FQ(.)40 b(Th)m(us)30 b(\014gures)f(can)i(\\\015oat)h(later")f(but)f
+(cannot)h(\\\015oat)h(earlier")p Black 741 4184 a(4.)p
+Black 46 w(Figures)25 b(m)m(ust)g(app)s(ear)e(in)i(order.)38
+b(Th)m(us)23 b(a)i(\014gure)f(cannot)h(b)s(e)f(placed)h(un)m(til)g
+Fy(al)5 b(l)34 b FQ(previous)857 4297 y(\014gures)c(are)h(placed.)41
+b(Tw)m(o)30 b(rami\014cations)i(of)e(this)g(rule)g(are)p
+Black 967 4462 a FK(\210)p Black 45 w FQ(A)h(\014gure)f(can)g(nev)m(er)
+h(b)s(e)f(placed)g(\\here")i(if)e(there)g(are)h(an)m(y)g(unpro)s
+(cessed)e(\014gures.)p Black 630 4558 1332 4 v 703 4647
+a FF(25)768 4679 y FG(When)d(a)i(\014gure)e(is)i(placed)f(at)g(the)f(b)
+r(ottom)h(of)h(a)f(page,)h(it)f(is)g(placed)g(b)r(elo)n(w)h(an)n(y)e
+(fo)r(otnotes)j(on)e(the)f(page.)630 4770 y(Although)f(this)h(ma)n(y)f
+(b)r(e)h(ob)t(jectionable,)i(there)d(curren)n(tly)g(is)h(no)g(w)n(a)n
+(y)g(to)g(c)n(hange)f(this)h(arrangemen)n(t.)703 4866
+y FF(26)768 4897 y FG(In)i(fact,)j(the)e FE([h])g FG(option)h(should)e
+Fw(never)39 b FG(b)r(e)28 b(used.)44 b(It)29 b(is)g(so)h(bad)e(that)h
+(recen)n(t)g(v)n(ersions)g(of)h(L)3580 4880 y FF(A)3613
+4897 y FG(T)3655 4913 y(E)3699 4897 y(X)e(auto-)630 4989
+y(matically)f(c)n(hange)f(it)g(to)f FE([ht])p FG(.)703
+5084 y FF(27)768 5116 y FG(Since)g(a)g(\015oat)g(can)f(app)r(ear)h(at)g
+(the)g(top)f(of)h(the)g(page)g(where)g(it)g(o)r(ccurs)g(in)g(the)f
+(text,)g(it)h(can)g(app)r(ear)g(b)r(efore)630 5207 y(its)k(o)r
+(ccurrence)h(in)f(the)f(text.)44 b(If)29 b(this)g(is)g(ob)t
+(jectionable,)j(the)d Fs(\015after)h FG(pac)n(k)l(age)f(can)g(b)r(e)g
+(used)g(to)g(prev)n(en)n(t)f(this.)630 5298 y(No)e(command)f(is)i
+(necessary)f(to)g(activ)l(ate)g Fs(\015after)q FG(;)g(just)g(include)g
+(it)g(in)f(a)h FE(\\usepackage)i FG(command.)p Black
+Black 2250 5640 a FQ(58)p Black eop end
+%%Page: 59 59
+TeXDict begin 59 58 bop Black 0 TeXcolorgray Black Black
+Black 967 -149 a FK(\210)p Black 45 w FQ(One)29 b(\\imp)s
+(ossible-to-place")j(\014gure)d(prev)m(en)m(ts)g(an)m(y)h(subsequen)m
+(t)e(\014gure)h(from)f(b)s(e-)1057 -36 y(ing)39 b(placed)h(un)m(til)f
+(the)g(end)f(of)h(the)g(do)s(cumen)m(t)g(or)g(un)m(til)g(L)3149
+-52 y FP(A)3188 -36 y FQ(T)3239 -16 y(E)3289 -36 y(X's)h(\015oat)f
+(limit)h(is)1057 77 y(reac)m(hed.)i(See)30 b(Section)p
+0.05 1.00 1.00 0.40 TeXcolorcmyk 31 w(17.4)p Black
+32 w(on)h(page)p 0.05 1.00 1.00 0.40 TeXcolorcmyk
+31 w(60)p Black(.)857 242 y(Similarly)-8 b(,)35 b(a)e(table)h(cannot)g
+(b)s(e)e(placed)h(un)m(til)h Fy(al)5 b(l)42 b FQ(previous)33
+b(tables)h(are)f(placed.)49 b(Ho)m(w-)857 355 y(ev)m(er,)32
+b(tables)f(can)f(leapfrog)i(\014gures)d(and)h(vice-v)m(ersa.)p
+Black 741 506 a(5.)p Black 46 w(The)j(aesthetic)h(rules)f(in)g(Section)
+p 0.05 1.00 1.00 0.40 TeXcolorcmyk 33 w(18)p Black
+34 w(m)m(ust)g(b)s(e)f(follo)m(w)m(ed.)50 b(F)-8 b(or)34
+b(example,)g(the)f(n)m(um)m(b)s(er)857 618 y(of)41 b(\015oats)g(on)g(a)
+g(page)g(cannot)g(exceed)h FM(totalnumber)p FQ(.)68 b(Sp)s(ecifying)40
+b(an)h(exclamation)857 731 y(p)s(oin)m(t)25 b(in)g(the)g(placemen)m(t)h
+(options)g(\(e.g.,)h FM(\\begin{figure}[!ht])p FQ(\))20
+b(mak)m(es)26 b(L)3562 715 y FP(A)3601 731 y FQ(T)3652
+751 y(E)3703 731 y(X)f(\\try)857 844 y(really)33 b(hard")e(b)m(y)g
+(ignoring)h(the)f(aesthetic)j(rules)d(whic)m(h)g(apply)g(to)h(text)h
+(pages)f(\()p FM(!)f FQ(do)s(es)857 957 y(not)g(a\013ect)h(the)e
+(aesthetic)j(rules)d(whic)m(h)g(apply)g(to)h(\015oat)g(pages\).)630
+1201 y FB(17.3)112 b(Clearing)39 b(Unpro)s(cessed)f(Floats)630
+1372 y FQ(A)c(big)f(adv)-5 b(an)m(tage)36 b(for)d(using)g(\015oats)h
+(is)f(that)i(L)2267 1356 y FP(A)2306 1372 y FQ(T)2357
+1392 y(E)2407 1372 y(X)e(is)h(not)g(required)e(to)j(place)f(them)g
+(imme-)630 1485 y(diately)c(in)f(the)g(text.)41 b(Instead,)30
+b(L)1783 1468 y FP(A)1822 1485 y FQ(T)1873 1505 y(E)1923
+1485 y(X)f(can)g(hold)g(the)g(\015oat)h(un)m(til)f(it)h(can)f(place)h
+(it)g(at)f(a)h(b)s(etter)630 1598 y(lo)s(cation.)42 b(When)30
+b(a)h(\015oat)g(has)f(b)s(een)f(read)h(b)m(y)h(L)2288
+1581 y FP(A)2327 1598 y FQ(T)2378 1618 y(E)2428 1598
+y(X)f(but)g(not)g(y)m(et)i(placed)e(on)g(the)h(page,)g(it)g(is)630
+1711 y(called)23 b(a)f(\\unpro)s(cessed)e(\015oat.")39
+b(While)23 b(the)f(\015oat-placing)h(algorithm)g(w)m(orks)e(w)m(ell,)k
+(sometimes)630 1824 y(it)31 b(is)f(necessary)h(to)g(force)g(L)1570
+1807 y FP(A)1609 1824 y FQ(T)1660 1843 y(E)1710 1824
+y(X)g(to)g(pro)s(cess)f(an)m(y)h(unpro)s(cessed)e(\015oats.)771
+1937 y(Belo)m(w)35 b(are)e(three)h(metho)s(ds)e(for)h(clearing)i(pro)s
+(cessed)d(\015oats.)50 b(These)33 b(commands)g(should)630
+2050 y(b)s(e)h(used)g(sparingly;)i(their)f(o)m(v)m(eruse)g(is)g(either)
+g(a)g(sign)f(y)m(ou)h(are)g(micro-managing)h(y)m(our)e(\015oat)630
+2163 y(placemen)m(t)40 b(or)e(y)m(our)g(\015oat)h(placemen)m(t)h
+(parameters)f(ha)m(v)m(e)g(bad)f(v)-5 b(alues)39 b(\(see)g(Section)p
+0.05 1.00 1.00 0.40 TeXcolorcmyk 39 w(18)p Black 39
+w(on)630 2276 y(page)p 0.05 1.00 1.00 0.40 TeXcolorcmyk
+31 w(61)p Black(\).)p Black 630 2488 a FL(clearpage)p
+Black 857 2638 a FQ(The)e(most)g(basic)h(metho)s(d)e(for)h(clearing)h
+(the)g(unpro)s(cessed)d(\014gures)i(bac)m(klog)i(is)e(to)h(is-)857
+2751 y(sue)c(a)g FM(\\clearpage)e FQ(command,)i(whic)m(h)g(places)h
+(all)g(unpro)s(cessed)d(\015oats)j(and)e(starts)i(a)857
+2864 y(new)g(page.)57 b(While)37 b(this)e(is)h(e\013ectiv)m(e,)j(it)d
+(is)g(undesirable)f(as)g(it)i(generally)f(pro)s(duces)f(a)857
+2977 y(partially-\014lled)d(page.)p Black 630 3165 a
+FL(FloatBarrier)p Black 857 3315 a FQ(F)-8 b(or)21 b(most)g
+(situations,)i(the)e(b)s(est)f(metho)s(d)f(for)h(forcing)h(\015oat)g
+(placemen)m(t)h(is)e(the)g FM(\\FloatBarrier)857 3428
+y FQ(command)42 b(pro)m(vided)g(b)m(y)g(the)g FO(placeins)g
+FQ(pac)m(k)-5 b(age.)78 b(There)41 b(are)i(three)f(w)m(a)m(ys)h(of)f
+(using)857 3541 y FO(placeins)p Black 941 3706 a FQ(1.)p
+Black 46 w(The)20 b FM(\\FloatBarrier)d FQ(command)j(causes)g(all)i
+(unpro)s(cessed)c(\015oats)j(to)g(b)s(e)f(pro)s(cessed)1057
+3819 y(immediately)-8 b(.)43 b(Unlik)m(e)31 b FM(\\clearpage)p
+FQ(,)d(it)j(do)s(es)f(not)g(start)h(a)g(new)f(page.)p
+Black 941 3935 a(2.)p Black 46 w(Since)g(it)h(is)f(often)h(desirable)f
+(to)h(k)m(eep)g(\015oats)f(in)g(the)g(section)i(in)d(whic)m(h)h(they)g
+(w)m(ere)1057 4035 y(issued,)g(the)h FM(section)d FQ(option)p
+Black Black 1493 4133 a FN(\\usepackage[secti)o(on)o(]{)o(pla)o(ce)o
+(ins)o(})1057 4244 y FQ(rede\014nes)35 b(the)g FM(\\section)e
+FQ(command,)k(inserting)e(a)h FM(\\FloatBarrier)31 b
+FQ(command)1057 4357 y(b)s(efore)f(eac)m(h)i(section.)1057
+4486 y(Note)37 b(that)f(this)g(option)g(is)g(v)m(ery)g(strict.)57
+b(F)-8 b(or)36 b(example,)i(if)e(a)g(new)f(section)h(start)1057
+4599 y(in)e(the)g(middle)g(of)g(a)h(page,)h(the)e FM(section)e
+FQ(option)j(do)s(es)e(not)i(allo)m(w)g(a)g(\015oat)f(from)1057
+4712 y(the)27 b(old)f(section)i(to)f(app)s(ear)f(at)h(the)g(b)s(ottom)f
+(of)h(the)f(page,)j(since)d(that)h(is)g(after)g(the)1057
+4825 y(start)k(of)g(the)f(new)g(section.)p Black 941
+4941 a(3.)p Black 46 w(The)g FM(below)f FQ(option)p Black
+Black 1493 5039 a FN(\\usepackage[below)o(]{)o(pl)o(ace)o(in)o(s})1057
+5151 y FQ(is)36 b(a)g(less-restrictiv)m(e)i(v)m(ersion)e(of)g(the)g
+FM(section)e FQ(option.)57 b(It)36 b(allo)m(ws)h(\015oats)f(to)h(b)s(e)
+1057 5263 y(placed)28 b(after)f(the)g(b)s(eginning)g(of)g(a)g(new)g
+(section,)i(pro)m(vided)d(that)i(some)f(of)h(the)f(old)1057
+5376 y(section)32 b(app)s(ears)d(on)i(the)f(page.)p Black
+2250 5640 a(59)p Black eop end
+%%Page: 60 60
+TeXDict begin 60 59 bop Black 0 TeXcolorgray Black Black
+857 -149 a FQ(The)33 b FO(placeins)g FQ(pac)m(k)-5 b(age)35
+b(do)s(es)e(not)g(c)m(hange)h(the)f(\015oats')h(\015oat-placemen)m(t)i
+(options.)49 b(F)-8 b(or)857 -36 y(example,)30 b(since)f
+FM(\\FloatBarrier)c FQ(can)30 b(only)e(place)i(a)f FM([t])f
+FQ(\015oat)i(at)f(the)g(top)g(of)g(a)g(page,)857 77 y(the)41
+b FM(\\FloatBarrier)c FQ(command)j(pro)s(cesses)h(a)g
+FM([t])e FQ(\015oat)j(b)m(y)e(\014lling)h(the)g(remaining)857
+190 y(p)s(ortion)31 b(of)h(the)f(curren)m(t)g(page)h(with)f(whitespace)
+h(and)f(then)f(placing)i(the)g FM([t])e FQ(\015oat)i(at)857
+303 y(the)i(top)g(of)g(the)f(next)h(page.)51 b(Similarly)-8
+b(,)35 b(since)f FM(\\FloatBarrier)c FQ(cannot)k(place)h(a)f
+FM([b])857 416 y FQ(\015oat)d(\\here",)h(text)f(is)g(prev)m(en)m(ted)f
+(from)g(app)s(earing)g(b)s(elo)m(w)h(it.)857 566 y(Both)i(of)f(these)h
+(examples)f(once)h(again)g(demonstrate)g(that)f(L)3016
+549 y FP(A)3055 566 y FQ(T)3106 586 y(E)3157 566 y(X)g(\015oat)g
+(placemen)m(t)i(is)857 679 y(most)23 b(e\013ectiv)m(e)j(when)c(m)m
+(ultiple)h(\015oat-placemen)m(t)i(options)e(\(suc)m(h)g(as)g
+FM([tbp])f FQ(or)g FM([htbp])p FQ(\))857 792 y(are)31
+b(sp)s(eci\014ed.)p Black 630 980 a FL(afterpage/clearpage)p
+Black 857 1117 a FQ(The)40 b FO(afterpage)h FQ(pac)m(k)-5
+b(age)42 b(pro)m(vides)e(the)h FM(\\afterpage)d FQ(command)i(whic)m(h)g
+(executes)i(a)857 1216 y(command)30 b(at)i(the)e(next)h(naturally-o)s
+(ccurring)f(page)h(break.)41 b(Therefore,)30 b(using)p
+Black Black 1293 1395 a FN(\\afterpage{\\clear)o(pa)o(ge)o(})857
+1586 y FQ(causes)h(all)g(unpro)s(cessed)e(\015oats)i(to)g(b)s(e)f
+(cleared)h(at)g(the)g(next)f(page)i(break.)857 1737 y(Using)42
+b FM(\\afterpage{\\clearpage})35 b FQ(command)41 b(ma)m(y)h(not)f(alw)m
+(a)m(ys)i(solv)m(e)f(\015oat)g(limit)857 1850 y(problems)d(\(see)i
+(Section)p 0.05 1.00 1.00 0.40 TeXcolorcmyk 41 w(17.4)p
+Black 41 w(on)f(page)p 0.05 1.00 1.00 0.40 TeXcolorcmyk
+40 w(60)p Black(\).)70 b(Since)40 b(it)g(puts)f(do)s(es)h(not)g
+(execute)h(the)857 1963 y FM(\\clearpage)25 b FQ(un)m(til)j(the)g(end)f
+(of)g(the)h(page,)h(additional)g(unpro)s(cessed)d(\015oats)i(ma)m(y)g
+(accu-)857 2075 y(m)m(ulate)k(b)s(efore)e(the)g(page)h(break.)857
+2226 y FM(\\afterpage{\\clearpage})25 b FQ(is)30 b(esp)s(ecially)i
+(useful)d(when)h(pro)s(ducing)f(small)h(\015oatpage)857
+2339 y(\014gures.)90 b(The)47 b FM(\\floatpagefraction)42
+b FQ(\(see)48 b(Section)p 0.05 1.00 1.00 0.40 TeXcolorcmyk
+48 w(18.2)p Black 48 w(on)f(page)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 48 w(61)p Black(\))h(prev)m(en)m(ts)857
+2452 y(\015oatpage)i(\015oats)e(whic)m(h)g(are)h(\\to)s(o)g(small")g
+(from)f(b)s(eing)f(placed)i(on)f(a)g(\015oat)h(page.)857
+2564 y(F)-8 b(urthermore,)49 b(since)d(the)g FM(!)85
+b FQ(\015oat-placemen)m(t)47 b(mo)s(di\014er)e(do)s(es)g(not)g(apply)g
+(to)h(\015oat)857 2677 y(pages,)k FM([!p])44 b FQ(do)s(es)h(not)h(o)m
+(v)m(erride)g(the)g FM(\\floatpagefraction)40 b FQ(restriction.)87
+b(Using)857 2790 y FM(\\afterpage{\\clearpage})14 b FQ(is)21
+b(an)f(easy)h(metho)s(d)f(to)h(o)m(v)m(erride)g(the)f
+FM(\\floatpagefraction)857 2903 y FQ(restriction)32 b(without)e
+(causing)h(a)g(partially-\014lled)g(text)h(page.)630
+3147 y FB(17.4)112 b(T)-9 b(o)s(o)37 b(Man)m(y)i(Unpro)s(cessed)g
+(Floats)630 3318 y FQ(If)22 b(a)i(\015oat)f(cannot)h(b)s(e)e(pro)s
+(cessed)h(immediately)-8 b(,)26 b(it)e(is)f(placed)g(on)g(the)g(unpro)s
+(cessed)f(\015oat)h(queue)630 3431 y(un)m(til)37 b(it)g(can)g(b)s(e)f
+(pro)s(cessed.)58 b(Since,)39 b(L)2007 3414 y FP(A)2046
+3431 y FQ(T)2097 3451 y(E)2147 3431 y(X)e(only)g(has)f(ro)s(om)g(for)h
+(18)g(\015oats)g(on)f(this)h(queue,)630 3544 y(ha)m(ving)28
+b(more)f(than)g(18)h(unpro)s(cessed)e(\015oats)i(pro)s(duces)e(a)h(\\T)
+-8 b(o)s(o)29 b(Man)m(y)e(Unpro)s(cessed)g(Floats")630
+3657 y(error.)40 b(There)30 b(are)h(four)f(p)s(ossible)g(causes)g(for)g
+(this)h(error:)p Black 741 3800 a(1.)p Black 46 w(The)22
+b(most)h(common)f(problem)g(is)g(that)h(the)g(\015oat)g(placemen)m(t)h
+(options)e(are)h(incompatible)857 3913 y(with)33 b(the)g(\015oat)h
+(placemen)m(t)g(parameters.)49 b(F)-8 b(or)34 b(example,)g(a)g
+FM([t])e FQ(\014gure)g(whose)h(heigh)m(t)857 4026 y(is)40
+b(larger)g(than)g FM(\\topfraction)c FQ(b)s(ecomes)k(stuc)m(k.)69
+b(Since)40 b(the)g(other)g(single-p)s(osition)857 4139
+y(options)28 b(ha)m(v)m(e)g(similar)g(problems,)g(sp)s(ecify)e(as)i
+(man)m(y)f(\015oat)h(placemen)m(t)h(options)f(as)f(p)s(os-)857
+4251 y(sible.)p Black 741 4402 a(2.)p Black 46 w(Incompatible)47
+b(\015oat)g(fraction)f(v)-5 b(alues)47 b(ma)m(y)f(mak)m(e)h(it)g(imp)s
+(ossible)e(to)i(place)g(certain)857 4515 y(\015oats.)39
+b(T)-8 b(o)24 b(a)m(v)m(oid)g(this,)h(mak)m(e)f(sure)f(an)m(y)g
+(\015oat)h(fraction)g(v)-5 b(alues)23 b(satisfy)h(the)f(Section)p
+0.05 1.00 1.00 0.40 TeXcolorcmyk 24 w(18.2)p Black
+857 4628 a(guidelines.)p Black 741 4778 a(3.)p Black
+46 w(In)30 b(rare)g(situations,)h(users)f(with)g(man)m(y)g(\015oats)h
+(and)f(man)m(y)i FM(\\marginpar)27 b FQ(notes)k(\(whic)m(h)857
+4891 y(use)38 b(the)g(same)g(queue\),)i(ma)m(y)e(need)f(a)h(larger)h
+(unpro)s(cessed)d(\015oat)i(queue.)63 b(Using)38 b(the)857
+5004 y FO(mo)m(re\015oats)30 b FQ(pac)m(k)-5 b(age)31
+b(increases)e(the)g(size)h(of)f(the)f(unpro)s(cessed)g(\015oat)h(queue)
+f(from)h(18)g(to)857 5117 y(36.)p Black 741 5267 a(4.)p
+Black 46 w(L)881 5250 y FP(A)920 5267 y FQ(T)971 5286
+y(E)1022 5267 y(X's)g(\015oat)h(placemen)m(t)h(queue)e(is)g(exceeded)h
+(if)f(more)h(than)e(18)j(\014gures)d(are)i(sp)s(eci\014ed)857
+5380 y(without)h(an)m(y)f(text)i(b)s(et)m(w)m(een)f(them.)40
+b(P)m(ossible)32 b(solutions)e(include)p Black 2250 5640
+a(60)p Black eop end
+%%Page: 61 61
+TeXDict begin 61 60 bop Black 0 TeXcolorgray Black Black
+Black 896 -149 a FQ(\(a\))p Black 46 w(Scatter)32 b(the)f(\014gures)f
+(in)h(the)g(text.)43 b(This)30 b(allo)m(ws)i(enough)f(text)h(to)f
+(accum)m(ulate)i(to)1057 -36 y(force)d(natural)e(pagebreaks,)i(making)f
+(it)g(easier)h(for)e(L)2905 -52 y FP(A)2944 -36 y FQ(T)2995
+-16 y(E)3046 -36 y(X)h(to)g(pro)s(cess)f(the)h(\015oats.)p
+Black 891 76 a(\(b\))p Black 45 w(Put)39 b FM(\\clearpage)d
+FQ(b)s(et)m(w)m(een)j(some)h(\014gures.)65 b(This)38
+b(is)h(incon)m(v)m(enien)m(t)i(b)s(ecause)d(it)1057 176
+y(requires)30 b(some)h(iterations)h(to)f(a)m(v)m(oid)h(partially-full)f
+(pages.)42 b(Note)31 b(that)p Black Black 1667 270 a
+FN(\\afterpage{\\clear)o(pag)o(e})1057 377 y FQ(\(whic)m(h)36
+b(causes)g(a)g FM(\\clearpage)d FQ(at)j(the)g(next)g(naturally-o)s
+(ccurring)g(pagebreak\))1057 490 y(do)s(es)j(not)h(help)f(in)g(this)g
+(situation)h(b)s(ecause)f(the)h(\015oat)g(queue)f(limit)h(is)f(reac)m
+(hed)1057 603 y(b)s(efore)30 b(enough)g(text)i(is)e(accum)m(ulated)i
+(in)e(order)g(to)h(trigger)g(a)g(pagebreak.)p Black 901
+728 a(\(c\))p Black 46 w(Since)f(there)g(is)g(no)g(text,)h(the)f
+(\014gures)f(don't)h(need)g(to)g(\015oat.)41 b(Therefore,)30
+b(the)g(b)s(est)1057 841 y(solution)e(is)f(probably)f(to)i(use)e(the)i
+(Section)p 0.05 1.00 1.00 0.40 TeXcolorcmyk 27 w(21)p
+Black 28 w(pro)s(cedure)e(for)h(constructing)g(non-)1057
+954 y(\015oating)40 b(\014gures,)g(separated)f(b)m(y)h
+FM(\\vspace)d FQ(or)h FM(\\vfill)f FQ(commands)h(to)i(pro)m(vide)1057
+1067 y(v)m(ertical)33 b(spacing.)630 1349 y FD(18)135
+b(Customizing)46 b(Float)f(Placemen)l(t)630 1552 y FQ(The)27
+b(follo)m(wing)j(st)m(yle)f(parameters)f(are)h(used)e(b)m(y)g(L)2376
+1535 y FP(A)2415 1552 y FQ(T)2466 1572 y(E)2517 1552
+y(X)h(to)g(prev)m(en)m(t)h(a)m(wkw)m(ard-lo)s(oking)g(pages)630
+1665 y(whic)m(h)34 b(con)m(tain)h(to)s(o)f(man)m(y)g(\015oats)h(or)f
+(badly-placed)g(\015oats.)52 b(If)33 b(these)h(st)m(yle)h(parameters)g
+(are)630 1778 y(c)m(hanged)i(an)m(ywhere)g(in)f(the)h(do)s(cumen)m(t,)h
+(they)f(do)f(not)h(apply)f(un)m(til)h(the)g(next)g(page.)60
+b(Ho)m(w-)630 1891 y(ev)m(er,)36 b(if)e(the)g(parameters)g(are)g(c)m
+(hanged)h(in)e(the)h(do)s(cumen)m(t's)g(pream)m(ble,)i(they)e(apply)f
+(at)i(the)630 2004 y(b)s(eginning)30 b(of)g(the)h(do)s(cumen)m(t.)630
+2243 y FB(18.1)112 b(Float)38 b(Placemen)m(t)g(Coun)m(ters)630
+2401 y FQ(The)29 b(three)h(coun)m(ters)g(in)g(T)-8 b(able)p
+0.05 1.00 1.00 0.40 TeXcolorcmyk 30 w(6)p Black 30
+w(prev)m(en)m(t)30 b(L)2188 2385 y FP(A)2227 2401 y FQ(T)2278
+2421 y(E)2329 2401 y(X)f(from)g(placing)i(to)s(o)f(man)m(y)g(\015oats)g
+(on)g(a)g(text)630 2501 y(page.)40 b(These)27 b(coun)m(ters)h(do)f(not)
+h(a\013ect)h(\015oat)e(pages.)41 b(Sp)s(ecifying)27 b(a)g
+FM(!)39 b FQ(in)27 b(the)h(\015oat)f(placemen)m(t)630
+2601 y(options)33 b(causes)g(L)1256 2584 y FP(A)1295
+2601 y FQ(T)1346 2620 y(E)1397 2601 y(X)f(to)i(ignore)f(theses)g
+(parameters.)49 b(The)32 b(v)-5 b(alues)33 b(of)g(these)g(coun)m(ters)h
+(are)630 2700 y(set)d(with)f(the)h FM(\\setcounter)c
+FQ(command.)40 b(F)-8 b(or)31 b(example,)p Black Black
+848 2820 a FN(\\setcounter{tota)o(ln)o(umb)o(er)o(}{2)o(})630
+2941 y FQ(prev)m(en)m(ts)37 b(more)f(than)h(t)m(w)m(o)g(\015oats)g
+(from)f(b)s(eing)g(placed)h(on)f(an)m(y)h(text)h(page.)59
+b(Man)m(y)37 b(p)s(eopler)630 3040 y(feel)d(the)f(default)g(\015oat)h
+(placemen)m(t)g(coun)m(ters)g(are)f(to)s(o)h(restrictiv)m(e)g(and)f
+(prefer)f(larger)i(v)-5 b(alues)630 3140 y(suc)m(h)30
+b(as)p Black Black 935 3260 a FN(\\setcounter{topn)o(umb)o(er)o(}{4)o
+(})935 3359 y(\\setcounter{bott)o(omn)o(um)o(ber)o(}{)o(4})935
+3459 y(\\setcounter{tota)o(lnu)o(mb)o(er})o({1)o(0})p
+Black 1432 3659 a FB(T)-9 b(able)38 b(6:)p 0 TeXcolorgray
+Black 50 w(Float)g(Placemen)m(t)g(Coun)m(ters)p 630 3789
+3331 4 v 630 4014 4 226 v 755 3868 a FM(topnumber)p 1306
+4014 V 172 w FQ(The)26 b(maxim)m(um)h(n)m(um)m(b)s(er)e(of)i(\015oats)g
+(allo)m(w)m(ed)i(at)e(the)g(top)g(of)g(a)g(text)h(page)1359
+3981 y(\(the)j(default)f(is)h(2\).)p 3957 4014 V 630
+4018 3331 4 v 630 4244 4 226 v 683 4097 a FM(bottomnumber)p
+1306 4244 V 100 w FQ(The)g(maxim)m(um)g(n)m(um)m(b)s(er)f(of)h
+(\015oats)h(allo)m(w)m(ed)h(at)f(the)f(b)s(ottom)h(of)f(a)h(text)1359
+4210 y(page)f(\(the)g(default)f(is)h(1\).)p 3957 4244
+V 630 4247 3331 4 v 630 4473 4 226 v 707 4326 a FM(totalnumber)p
+1306 4473 V 124 w FQ(The)40 b(maxim)m(um)g(n)m(um)m(b)s(er)f(of)i
+(\015oats)g(allo)m(w)m(ed)h(on)e(an)m(y)h(one)g(text)g(page)1359
+4439 y(\(the)31 b(default)f(is)h(3\).)p 3957 4473 V 630
+4476 3331 4 v Black 630 4800 a FB(18.2)112 b(Figure)39
+b(F)-9 b(ractions)630 4958 y FQ(The)33 b(commands)g(in)g(T)-8
+b(able)p 0.05 1.00 1.00 0.40 TeXcolorcmyk 34 w(7)p
+Black 34 w(con)m(trol)35 b(what)e(fraction)h(of)g(a)f(page)i(can)e(b)s
+(e)g(co)m(v)m(ered)i(b)m(y)e(\015oats)630 5058 y(\(where)j(\\fraction")
+i(refers)e(to)h(the)f(heigh)m(t)h(of)g(the)f(\015oats)h(divided)e(b)m
+(y)j FM(\\textheight)p FQ(\).)55 b(The)630 5157 y(\014rst)35
+b(three)h(commands)g(p)s(ertain)g(only)g(to)g(text)h(pages,)i(while)d
+(the)g(last)h(command)f(p)s(ertains)630 5257 y(only)42
+b(to)h(\015oat)f(pages.)76 b(Sp)s(ecifying)42 b(a)g FM(!)75
+b FQ(in)42 b(the)g(\015oat)g(placemen)m(t)i(options)e(causes)h(L)3752
+5240 y FP(A)3791 5257 y FQ(T)3842 5277 y(E)3892 5257
+y(X)630 5357 y(to)34 b(ignore)f(the)h(\014rst)e(three)h(parameters,)h
+(but)f FM(\\floatpagefraction)28 b FQ(is)33 b(alw)m(a)m(ys)i(used.)47
+b(The)630 5456 y(v)-5 b(alue)31 b(of)f(these)h(fractions)g(are)g(set)g
+(b)m(y)g FM(\\renewcommand)p FQ(.)38 b(F)-8 b(or)31 b(example,)p
+Black 2250 5640 a(61)p Black eop end
+%%Page: 62 62
+TeXDict begin 62 61 bop Black 0 TeXcolorgray Black Black
+Black Black 761 -149 a FN(\\renewcommand{\\t)o(ex)o(tf)o(rac)o(ti)o
+(on})o({0)o(.3})630 -4 y FQ(lets)31 b(\015oats)g(co)m(v)m(er)h(no)e
+(more)h(than)f(70\045)h(of)g(a)f(text)i(page.)p Black
+1399 191 a FB(T)-9 b(able)38 b(7:)p 0 TeXcolorgray Black
+50 w(Figure)g(Placemen)m(t)g(F)-9 b(ractions)p 630 321
+3331 4 v 630 659 4 339 v 802 400 a FM(\\textfraction)p
+1592 659 V 219 w FQ(The)32 b(minim)m(um)g(fraction)i(of)f(a)g(text)h
+(page)f(whic)m(h)f(m)m(ust)h(b)s(e)f(o)s(c-)1645 513
+y(cupied)h(b)m(y)g(text.)51 b(The)32 b(default)i(is)f(0.2,)i(whic)m(h)e
+(prev)m(en)m(ts)h(\015oats)1645 625 y(from)c(co)m(v)m(ering)i(more)f
+(than)f(80\045)h(of)g(a)f(text)i(page.)p 3957 659 V 630
+663 3331 4 v 630 1566 4 904 v 826 742 a FM(\\topfraction)p
+1592 1566 V 243 w FQ(The)27 b(maxim)m(um)h(fraction)g(of)g(a)g(text)h
+(page)g(whic)m(h)e(can)h(b)s(e)f(o)s(ccu-)1645 855 y(pied)33
+b(b)m(y)f(\015oats)h(at)h(the)f(top)g(of)g(the)g(page.)48
+b(The)33 b(default)g(is)f(0.7,)1645 967 y(whic)m(h)23
+b(prev)m(en)m(ts)i(an)m(y)e(\015oat)i(whose)e(heigh)m(t)i(is)e(greater)
+i(than)e(70\045)1645 1080 y(of)42 b FM(\\textheight)31
+b FQ(from)i(b)s(eing)h(placed)g(at)h(the)g(top)f(of)g(a)h(page.)1645
+1193 y(Similarly)-8 b(,)44 b(if)d(the)f(com)m(bined)h(heigh)m(t)h(of)e
+(m)m(ultiple)h FM(t)g FQ(\015oats)g(is)1645 1306 y(greater)h(than)e
+(70\045)i(of)48 b FM(\\textheight)p FQ(,)40 b(they)h(all)g(will)h(not)e
+(b)s(e)1645 1419 y(placed)27 b(at)h(the)f(top)g(of)g(a)g(page,)h(ev)m
+(en)g(if)f(they)g(n)m(um)m(b)s(er)e(less)i(than)1645
+1532 y FM(topnumber)p FQ(.)p 3957 1566 V 630 1569 3331
+4 v 630 2134 4 565 v 755 1648 a FM(\\bottomfraction)p
+1592 2134 V 170 w FQ(The)g(maxim)m(um)h(fraction)g(of)g(a)g(text)h
+(page)g(whic)m(h)e(can)h(b)s(e)f(o)s(ccu-)1645 1761 y(pied)34
+b(b)m(y)f(\015oats)i(at)g(the)f(b)s(ottom)g(of)g(the)g(page.)52
+b(The)34 b(default)g(is)1645 1874 y(0.3,)29 b(whic)m(h)d(prev)m(en)m
+(ts)g(an)m(y)h(\015oat)g(whose)f(heigh)m(t)h(is)g(greater)g(than)1645
+1987 y(30\045)k(of)37 b FM(\\textheight)26 b FQ(from)k(b)s(eing)f
+(placed)h(at)h(the)f(b)s(ottom)g(of)1645 2100 y(a)h(text)g(page.)p
+3957 2134 V 630 2137 3331 4 v 630 2589 4 452 v 683 2216
+a FM(\\floatpagefraction)p 1592 2589 V 98 w FQ(The)d(minim)m(um)f
+(fraction)i(of)f(a)h(\015oat)g(page)g(that)g(m)m(ust)f(b)s(e)f(o)s
+(ccu-)1645 2329 y(pied)f(b)m(y)h(\015oats.)40 b(Th)m(us)26
+b(the)h(fraction)g(of)g(blank)f(space)h(on)g(a)g(\015oat)1645
+2442 y(page)33 b(cannot)f(b)s(e)f(more)h(than)g FM
+(1-\\floatpagefraction)p FQ(.)39 b(The)1645 2555 y(default)31
+b(is)f(0.5.)p 3957 2589 V 630 2592 3331 4 v Black 771
+2770 a(The)43 b(default)h(placemen)m(t)h(fraction)f(v)-5
+b(alues)44 b(prev)m(en)m(t)g(man)m(y)f(and/or)h(large)g(\015oats)g
+(from)-3897 b FL(Placemen)m(t)163 2883 y(F)-9 b(raction)59
+2996 y(Guidelines)630 2869 y FQ(dominating)34 b(text)i(pages)e(and)g
+(also)h(prev)m(en)m(t)f(small)h(\014gures)e(from)h(b)s(eing)f(placed)i
+(in)f(a)g(sea)h(of)630 2969 y(whitespace)30 b(on)f(a)h(\015oat)f(page.)
+41 b(While)30 b(the)g(default)f(v)-5 b(alues)30 b(generally)g(w)m(ork)f
+(w)m(ell,)i(sometimes)630 3069 y(they)26 b(ma)m(y)g(b)s(e)f(a)h(bit)g
+(to)s(o)g(restrictiv)m(e,)j(resulting)d(in)f(\014gures)g(\015oating)i
+(to)s(o)f(far)f(from)h(where)f(they)630 3168 y(are)30
+b(issued.)40 b(In)28 b(these)i(cases)g(it)g(ma)m(y)h(b)s(e)d(desirable)
+i(to)g(set)g(the)g(placemen)m(t)h(fractions)f(to)g(more)630
+3268 y(p)s(ermissiv)m(e)g(v)-5 b(alues)31 b(suc)m(h)f(as)p
+Black Black 804 3400 a FN(\\renewcommand{\\te)o(xt)o(fra)o(ct)o(ion)o
+(}{)o(0.1)o(5})804 3499 y(\\renewcommand{\\to)o(pf)o(rac)o(ti)o(on})o
+({0)o(.85)o(})804 3599 y(\\renewcommand{\\bo)o(tt)o(omf)o(ra)o(cti)o
+(on)o(}{0)o(.7)o(0})804 3698 y(\\renewcommand{\\fl)o(oa)o(tpa)o(ge)o
+(fra)o(ct)o(ion)o(}{)o(0.)o(66})630 3843 y FQ(One)23
+b(m)m(ust)h(tak)m(e)h(care)f(when)f(adjusting)g(placemen)m(t)i
+(fraction)g(v)-5 b(alues,)25 b(as)f(unreasonable)g(v)-5
+b(alues)630 3956 y(can)42 b(lead)h(to)g(p)s(o)s(or)d(formatting)j
+(and/or)f(\\stuc)m(k")i(\015oats.)76 b(T)-8 b(o)42 b(a)m(v)m(oid)i(suc)
+m(h)d(problems,)k(the)630 4069 y(follo)m(wing)32 b(guidelines)f(should)
+e(b)s(e)h(used:)p Black 630 4247 a FM(\\textfraction)p
+Black 857 4396 a FQ(Setting)36 b FM(\\textfraction)31
+b FQ(smaller)j(than)g(0.15)h(is)f(discouraged)g(as)h(it)f(pro)s(duces)f
+(hard-)857 4509 y(to-read)d(pages.)40 b(If)28 b(a)h(\014gure's)f(heigh)
+m(t)i(is)e(more)h(than)f(85\045)h(of)36 b FM(\\textheight)p
+FQ(,)26 b(it)j(almost)857 4621 y(certainly)38 b(lo)s(oks)g(b)s(etter)f
+(b)m(y)g(itself)h(on)f(a)g(\015oat)h(page)g(than)e(squeezed)i(on)f(a)g
+(text)h(page)857 4734 y(with)30 b(a)h(couple)g(of)f(lines)h(of)g(text)g
+(b)s(elo)m(w)g(it.)857 4883 y(F)-8 b(urthermore,)30 b
+Fy(never)39 b FQ(set)30 b FM(\\textfraction)c FQ(to)k(zero)g(as)g(p)s
+(ermits)e(a)i(text)g(page)h(to)f(ha)m(v)m(e)857 4996
+y(no)h(text,)g(whic)m(h)f(confuses)g(L)1839 4979 y FP(A)1878
+4996 y FQ(T)1929 5015 y(E)1980 4996 y(X)g(and)g(leads)h(to)g
+(badly-formatted)g(pages.)p Black 630 5179 a FM(\\topfraction)p
+Black 857 5328 a FQ(Nev)m(er)37 b(set)f FM(\\topfraction)d
+FQ(larger)j(than)g(1)g(-)g FM(\\textfraction)p FQ(,)e(as)i(that)g
+(causes)g(con-)857 5441 y(tradictions)c(in)e(the)g(\015oat-placing)i
+(algorithm.)p Black 2250 5640 a(62)p Black eop end
+%%Page: 63 63
+TeXDict begin 63 62 bop Black 0 TeXcolorgray Black Black
+Black 630 -149 a FM(\\bottomfraction)p Black 857 2 a
+FQ(Since)21 b(\\go)s(o)s(d)f(t)m(yp)s(esetting)i(st)m(yle")g
+(discourages)f(large)g(b)s(ottom)g(\014gures,)g FM(\\bottomfraction)857
+115 y FQ(is)39 b(generally)h(smaller)f(than)g FM(\\topfraction)p
+FQ(.)63 b(Nev)m(er)39 b(set)h FM(\\bottomfraction)34
+b FQ(larger)857 227 y(than)e(1)g(-)h FM(\\textfraction)p
+FQ(,)c(as)j(that)g(causes)h(con)m(tradictions)g(in)f(the)g
+(\015oat-placing)i(al-)857 340 y(gorithm.)p Black 630
+528 a FM(\\floatpagefraction)p Black 857 678 a FQ(If)f
+FM(\\floatpagefraction)21 b FQ(is)26 b(set)h(v)m(ery)f(small,)i(ev)m
+(ery)f(\015oat)g(page)g(con)m(tains)g(exactly)h(one)857
+791 y(\015oat,)k(resulting)e(in)g(excessiv)m(e)i(whitespace)g(around)d
+(small)i FM(p)f FQ(\014gures.)857 941 y(If)44 b FM(\\floatpagefraction)
+31 b FQ(is)37 b(larger)g(than)g FM(\\topfraction)c FQ(,)39
+b FM([tp])c FQ(\014gures)h(ma)m(y)h(b)s(e-)857 1054 y(come)32
+b(\\stuc)m(k.")43 b(F)-8 b(or)31 b(example,)h(supp)s(ose)d(the)i(heigh)
+m(t)g(of)g(a)g FM([tp])e FQ(\014gure)h(is)h(larger)g(than)857
+1167 y FM(\\topfraction)26 b FQ(but)i(smaller)h(than)f
+FM(\\floatpagefraction)p FQ(,)d(it)k(b)s(ecomes)g(\\stuc)m(k")h(b)s(e-)
+857 1280 y(cause)38 b(it)f(is)h(to)s(o)f(large)i(to)e(b)s(e)g(placed)g
+(on)g(a)h(text)g(page)f(and)g(to)s(o)h(small)f(to)h(b)s(e)e(placed)857
+1393 y(on)46 b(a)h(\015oat)g(page.)89 b(T)-8 b(o)46 b(prev)m(en)m(t)h
+(suc)m(h)f(stuc)m(k)h(\014gures,)i FM(\\floatpagefraction)42
+b FQ(and)857 1506 y FM(\\topfraction)27 b FQ(should)j(satisfy)h(the)f
+(follo)m(wing)i(inequalit)m(y:)1496 1710 y FM(\\floatpagefraction)20
+b Fn(\024)25 b FM(\\topfraction)17 b Fn(\000)j FQ(0)p
+Fz(:)p FQ(05)857 1914 y(The)35 b(0.05)i(term)f(is)f(due)g(to)h(the)f
+(di\013erence)h(in)f(the)h(accoun)m(ting)h(of)f(v)m(ertical)h(space)f
+(for)857 2027 y(text)46 b(pages)e(and)g(\015oat)h(pages)1951
+1994 y FP(28)2026 2027 y FQ(.)83 b(Lik)m(ewise,)49 b(if)i
+FM([bp])43 b FQ(or)h FM([hbp])f FQ(\014gures)h(are)g(used,)857
+2140 y FM(\\floatpagefraction)26 b FQ(and)j FM(\\bottomfraction)e
+FQ(should)i(also)i(satisfy)1424 2344 y FM(\\floatpagefraction)21
+b Fn(\024)j FM(\\bottomfraction)17 b Fn(\000)i FQ(0)p
+Fz(:)p FQ(05)857 2549 y(Note)37 b(that)g(the)f(default)f(v)-5
+b(alues)36 b(do)g(not)g(satisfy)g(the)g(second)g(inequalit)m(y)-8
+b(,)39 b(whic)m(h)c(ma)m(y)857 2662 y(o)s(ccasionally)e(cause)e
+(problems)e(with)h FM([bp])g FQ(and)f FM([hbp])g FQ(\014gures.)630
+2905 y FB(18.3)112 b(Suppressing)40 b(Floats)630 3077
+y FQ(The)35 b FM(\\suppressfloats)d FQ(prev)m(en)m(ts)k(additional)h
+(\015oats)f(from)f(app)s(earing)h(at)g(the)g(top)g(or)g(the)630
+3190 y(b)s(ottom)j(of)f(the)h(curren)m(t)f(page.)66 b(They)38
+b(do)g(not)h(a\013ect)h(\014gures)e(with)g(\\here")h(placemen)m(t)h(or)
+630 3303 y(those)31 b(with)f FM(!)40 b FQ(in)30 b(the)h(placemen)m(t)h
+(options.)771 3415 y(Putting)42 b FM(\\suppressfloats[t])36
+b FQ(immediately)41 b(b)s(efore)g(a)f(\014gure,)j(prev)m(en)m(ts)e
+(that)g(\015oat)630 3528 y(from)d(app)s(earing)g(ab)s(o)m(v)m(e)h(the)f
+(place)i(where)d(it)i(app)s(ears)f(in)g(the)g(text.)65
+b(The)38 b FO(\015after)h FQ(pac)m(k)-5 b(age)630 3641
+y(rede\014nes)29 b(L)1028 3624 y FP(A)1067 3641 y FQ(T)1118
+3661 y(E)1169 3641 y(X's)h(\015oat)h(algorithm)h(to)f(prev)m(en)m(t)g
+(this)f(for)g(the)h(en)m(tire)g(do)s(cumen)m(t.)p Black
+1516 3842 a FB(T)-9 b(able)38 b(8:)p 0 TeXcolorgray Black
+50 w(Suppress\015oats)h(Options)p 630 3971 3331 4 v 630
+4197 4 226 v 683 4050 a FM(\\suppressfloats[t])p 1592
+4197 V 98 w FQ(Prev)m(en)m(ts)c(additional)g(\014gures)f(from)g(app)s
+(earing)g(at)h(the)f(top)h(of)1645 4163 y(the)c(curren)m(t)f(page.)p
+3957 4197 V 630 4200 3331 4 v 630 4426 4 226 v 683 4279
+a FM(\\suppressfloats[b])p 1592 4426 V 98 w FQ(Prev)m(en)m(ts)e
+(additional)g(\014gures)e(from)g(app)s(earing)h(at)g(the)g(b)s(ottom)
+1645 4392 y(of)k(the)f(curren)m(t)g(page.)p 3957 4426
+V 630 4430 3331 4 v 630 4655 4 226 v 755 4509 a FM(\\suppressfloats)p
+1592 4655 V 170 w FQ(Prev)m(en)m(ts)37 b(additional)g(\014gures)e(from)
+g(app)s(earing)h(at)g(either)h(the)1645 4622 y(b)s(ottom)31
+b(or)f(the)h(top)f(of)h(the)g(curren)m(t)f(page.)p 3957
+4655 V 630 4659 3331 4 v Black Black 630 4836 1332 4
+v 703 4926 a FF(28)768 4958 y FG(Sp)r(eci\014cally)-6
+b(,)25 b FE(\\textfloatsep)i FG(and)d(the)f(other)h(text-page)g
+(\015oat)g(spacing)h Fw(is)30 b FG(coun)n(ted)24 b(when)g(comparing)h
+(a)630 5049 y(\014gure)g(with)h FE(\\topfraction)p FG(,)i(but)d(the)g
+(\015oat)h(page)g(spacings)g(are)g Fw(not)34 b FG(coun)n(ted)24
+b(in)i(testing)g(if)g(a)g(\014gure)f(exceeds)630 5140
+y FE(\\floatpagefraction)p FG(.)37 b(As)23 b(a)f(result,)i
+FE(\\textfloatsep)h FG(divided)d(b)n(y)g FE(\\textheight)j
+FG(\(whic)n(h)d(is)h Fm(\031)e FG(0)p Fl(:)p FG(05\))j(should)630
+5232 y(b)r(e)i(subtracted)f(from)h FE(\\topfraction)p
+FG(.)38 b(See)25 b(Section)p 0.05 1.00 1.00 0.40 TeXcolorcmyk
+26 w(19.1)p Black 27 w(on)h(page)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 26 w(64)p Black 26 w(for)h(information)g(on)f(\014gure)f
+(spacing.)p Black Black 2250 5640 a FQ(63)p Black eop
+end
+%%Page: 64 64
+TeXDict begin 64 63 bop Black 0 TeXcolorgray Black Black
+630 -149 a FD(19)135 b(Customizing)46 b(the)f(\014gure)g(En)l(vironmen)
+l(t)630 58 y FB(19.1)112 b(Figure)39 b(Spacing)630 216
+y FQ(The)j(lengths)h(in)g(T)-8 b(able)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 43 w(9)p Black 43 w(con)m(trol)45 b(ho)m(w)d(m)m(uc)m(h)h
+(v)m(ertical)i(spacing)e(is)g(added)f(b)s(et)m(w)m(een)i(t)m(w)m(o)630
+316 y(\014gures)34 b(or)h(b)s(et)m(w)m(een)g(a)g(\014gure)f(and)g
+(text.)55 b(Unlik)m(e)36 b(most)f(other)g(L)2933 299
+y FP(A)2972 316 y FQ(T)3023 335 y(E)3073 316 y(X)g(lengths,)i(these)e
+(three)630 415 y(are)h(rubb)s(er)e(lengths,)j(whic)m(h)f(pro)m(vides)f
+(spacing)i(whic)m(h)e(can)h(shrink)e(or)i(expand)f(to)i(pro)m(vide)630
+515 y(b)s(etter)c(page)g(formatting.)49 b(These)33 b(lengths)g(are)g
+(set)g(with)g(the)g FM(\\setlength)d FQ(command.)47 b(F)-8
+b(or)630 614 y(example,)p Black Black 804 747 a FN(\\setlength{\\float)
+o(se)o(p}{)o(10)o(pt)37 b(plus)42 b(3pt)g(minus)g(2pt})630
+894 y FQ(sets)26 b(the)h(\\nominal")g(v)-5 b(alue)26
+b(of)34 b FM(\\floatsep)23 b FQ(to)k(b)s(e)e(10)i(p)s(oin)m(ts.)40
+b(T)-8 b(o)26 b(impro)m(v)m(e)h(page)g(formatting,)630
+1007 y(the)k(\015oat)g(separation)g(can)f(b)s(e)g(as)h(small)g(as)f(8)h
+(p)s(oin)m(ts)f(or)h(as)f(large)i(as)e(13)i(p)s(oin)m(ts.)771
+1119 y(Since)e(L)1032 1103 y FP(A)1071 1119 y FQ(T)1122
+1139 y(E)1172 1119 y(X)g(places)g FM(\\intextsep)d FQ(ab)s(o)m(v)m(e)j
+(and)f(b)s(elo)m(w)h(eac)m(h)g(\\here")h(\015oat,)f(t)m(w)m(o)h
+(consecu-)630 1232 y(tiv)m(e)25 b(\\here")f(\015oats)g(are)g(separated)
+g(b)m(y)f(t)m(w)m(o)i FM(\\intextsep)20 b FQ(spaces.)39
+b(This)23 b(extra)h(spacing)g(can)g(b)s(e)630 1345 y(a)m(v)m(oiding)33
+b(b)m(y)d(com)m(bining)i(the)f(t)m(w)m(o)h(\015oats)f(in)m(to)h(a)f
+(single)h(\015oat,)g(although)f(this)g(ma)m(y)g(result)g(in)630
+1458 y(a)h(less-attractiv)m(e)k(la)m(y)m(out)d(since)f(it)h(prev)m(en)m
+(ts)f(the)g(\015oat-placemen)m(t)i(algorithm)f(from)e(placing)630
+1571 y(the)g(t)m(w)m(o)g(\015oats)g(separately)-8 b(.)771
+1684 y(The)35 b(lengths)h(listed)g(in)f(T)-8 b(able)p
+0.05 1.00 1.00 0.40 TeXcolorcmyk 37 w(9)p Black 35
+w(do)36 b(not)g(a\013ect)h(the)f(spacing)g(of)f(\015oats)h(on)g
+(\015oat)g(pages.)630 1797 y(The)j(\015oat-page)j(spacing)e(is)g(con)m
+(trolled)h(b)m(y)f(the)g(lengths)g(listed)g(in)g(T)-8
+b(able)p 0.05 1.00 1.00 0.40 TeXcolorcmyk 40 w(10)p
+Black(.)70 b(The)39 b(\015oat-)630 1910 y(page)31 b(spacings)g(often)f
+(use)g(the)h FM(fil)e FQ(unit)h(to)h(pro)m(vide)g(in\014nite)f(stretc)m
+(habilit)m(y)-8 b(,)33 b(similar)e(to)g(the)630 2023
+y(v)m(ertical)36 b(space)f(pro)s(duced)d(b)m(y)k FM(\\vfill)p
+FQ(.)50 b(When)34 b(m)m(ultiple)h FM(fil)e FQ(spaces)i(app)s(ear)e(in)h
+(the)h(same)630 2136 y(space,)h(they)e(expand)g(prop)s(ortionally)g(to)
+h(\014ll)f(the)g(space.)52 b(F)-8 b(or)35 b(example,)h(the)f(default)f
+(\015oat-)630 2249 y(page)39 b(parameters)g(cause)f(the)h(space)g(b)s
+(et)m(w)m(een)g(\015oat-page)h(\015oats)e(to)h(b)s(e)f(double)g(the)g
+(space)630 2361 y(ab)s(o)m(v)m(e)32 b(the)e(top)h(\015oat)g(or)f(b)s
+(elo)m(w)h(the)f(b)s(ottom)h(\015oat.)771 2461 y(The)e
+FM(@)g FQ(in)g(the)g(names)g(of)g(the)h(T)-8 b(able)p
+0.05 1.00 1.00 0.40 TeXcolorcmyk 30 w(10)p Black 30
+w(lengths)29 b(mean)g(they)h(are)f(in)m(ternal)h(commands)3860
+2428 y FP(29)3935 2461 y FQ(.)630 2561 y(As)43 b(a)h(result,)j(an)m(y)e
+FM(\\setlength)40 b FQ(command)j(whic)m(h)g(mo)s(di\014es)g(the)g
+(lengths)h(m)m(ust)f(b)s(e)g(sur-)630 2660 y(rounded)29
+b(b)m(y)i FM(\\makeatletter)c FQ(and)j FM(\\makeatother)p
+FQ(.)37 b(F)-8 b(or)31 b(example,)p Black 630 2720 1332
+4 v 703 2809 a FF(29)768 2841 y FG(An)n(y)52 b(user)g(co)r(de)h(whic)n
+(h)g(accesses)i(or)e(rede\014nes)f(in)n(ternal)h(commands)g(m)n(ust)f
+(b)r(e)h(surrounded)f(b)n(y)630 2932 y FE(\\makeatletter)29
+b FG(and)c FE(\\makeatother)p FG(.)p Black Black 1333
+3179 a FB(T)-9 b(able)38 b(9:)p 0 TeXcolorgray Black
+50 w(Figure)g(Spacing)h(for)e(T)-9 b(ext)37 b(P)m(ages)p
+630 3309 3331 4 v 630 3647 4 339 v 779 3388 a FM(\\floatsep)p
+1353 3647 V 196 w FQ(F)-8 b(or)38 b(\015oats)g(at)h(the)f(top)g(or)g(b)
+s(ottom)g(of)g(a)g(page,)i(this)e(is)g(the)g(v)m(ertical)1407
+3501 y(spacing)i(b)s(et)m(w)m(een)h(\015oats.)71 b(The)40
+b(default)g(is)h FM(12pt)e(plus)g(2pt)g(minus)1407 3614
+y(2pt)p 3957 3647 V 630 3651 3331 4 v 630 3990 4 339
+v 683 3730 a(\\textfloatsep)p 1353 3990 V 100 w FQ(F)-8
+b(or)38 b(\015oats)g(at)h(the)f(top)g(or)g(b)s(ottom)g(of)g(a)g(page,)i
+(this)e(is)g(the)g(v)m(ertical)1407 3843 y(spacing)j(b)s(et)m(w)m(een)h
+(the)f(\015oat)h(and)e(the)i(text.)74 b(The)40 b(default)i(is)f
+FM(20pt)1407 3956 y(plus)29 b(2pt)g(minus)g(4pt)p 3957
+3990 V 630 3993 3331 4 v 630 4332 4 339 v 755 4072 a(\\intextsep)p
+1353 4332 V 172 w FQ(F)-8 b(or)35 b(\015oats)f(placed)h(in)f(the)h
+(middle)e(of)i(a)f(text)i(page)f(\(i.e.,)i(with)d(the)g
+FM(h)1407 4185 y FQ(placemen)m(t)c(option\),)h(this)e(is)h(the)f(v)m
+(ertical)j(spacing)d(ab)s(o)m(v)m(e)i(and)e(b)s(elo)m(w)1407
+4298 y(the)h(\015oat.)42 b(The)29 b(default)i(is)f FM(12pt)g(plus)f
+(2pt)g(minus)g(2pt)p 3957 4332 V 630 4335 3331 4 v 1312
+4624 a FB(T)-9 b(able)38 b(10:)p 0 TeXcolorgray Black
+50 w(Figure)h(Spacing)f(for)g(Floatpages)p 630 4753 V
+630 4979 4 226 v 683 4832 a FM(\\@fptop)p 1067 4979 V
+101 w FQ(This)31 b(is)g(the)h(v)m(ertical)i(spacing)e(ab)s(o)m(v)m(e)g
+(the)g(top)g(\015oatpage)h(\015oat.)45 b(The)31 b(default)1120
+4945 y(is)g FM(0pt)e(plus)g(1.0fil)p 3957 4979 V 630
+4982 3331 4 v 630 5208 4 226 v 683 5061 a(\\@fpsep)p
+1067 5208 V 101 w FQ(This)24 b(is)g(the)h(v)m(ertical)h(spacing)f(b)s
+(et)m(w)m(een)g(\015oatpage)h(\015oats.)40 b(The)24 b(default)g(is)h
+FM(8pt)1120 5174 y(plus)k(2.0fil)p 3957 5208 V 630 5212
+3331 4 v 630 5437 4 226 v 683 5291 a(\\@fpbot)p 1067
+5437 V 101 w FQ(This)43 b(is)h(the)g(v)m(ertical)i(spacing)e(b)s(elo)m
+(w)g(the)g(b)s(ottom)g(\015oatpage)i(\015oat.)81 b(The)1120
+5404 y(default)31 b(is)f FM(0pt)g(plus)f(1.0fil)p 3957
+5437 V 630 5441 3331 4 v Black Black 2250 5640 a FQ(64)p
+Black eop end
+%%Page: 65 65
+TeXDict begin 65 64 bop Black 0 TeXcolorgray Black Black
+Black Black 804 -149 a FN(\\makeatletter)935 -49 y(\\addtolength{\\@f)o
+(pse)o(p})o({4p)o(t})804 51 y(\\makeatother)630 205 y
+FQ(increases)31 b(the)g(space)g(b)s(et)m(w)m(een)g(\015oatpage)g
+(\015oats)g(b)m(y)g(4)f(p)s(oin)m(ts.)630 448 y FB(19.2)112
+b(Horizon)m(tal)37 b(Lines)i(Ab)s(o)m(v)m(e/Belo)m(w)e(Figure)630
+607 y FQ(Horizon)m(tal)46 b(lines)e(can)g(b)s(e)f(automatically)j(dra)m
+(wn)d(b)s(et)m(w)m(een)i(the)e(text)i(and)e(\014gures)g(whic)m(h)630
+706 y(app)s(ear)30 b(at)h(the)f(top/b)s(ottom)i(of)e(the)h(page)g(b)m
+(y)f(rede\014ning)g(the)p Black Black 935 848 a FN(\\topfigurerule)935
+947 y(\\bottomfigurerul)o(e)630 1102 y FQ(commands.)84
+b(Although)45 b FM(\\topfigrule)d FQ(and)i FM(\\bottomfigrule)d
+FQ(are)46 b(already)f(de\014ned)f(as)630 1215 y(L)654
+1198 y FP(A)693 1215 y FQ(T)744 1234 y(E)794 1215 y(X)c(commands,)h
+(the)e(strange)h(w)m(a)m(y)h(in)d(whic)m(h)h(they)h(are)g(de\014ned)e
+(requires)g(them)i(to)g(b)s(e)630 1327 y(rede\014ned)29
+b(with)h FM(\\newcommand)e FQ(instead)i(of)38 b FM(\\renewcommand)p
+FQ(.)771 1427 y(T)-8 b(o)47 b(a)m(v)m(oid)h(disrupting)d(the)h(page)h
+(formatting,)k(these)c(commands)f(m)m(ust)g(ha)m(v)m(e)i(a)e(zero)630
+1527 y(heigh)m(t.)65 b(Th)m(us)38 b(dra)m(wing)g(0.4)h(p)s(oin)m(t)f
+(line)h(m)m(ust)f(b)s(e)g(accompanied)h(b)m(y)f(a)h(0.4)h(p)s(oin)m(t)e
+(v)m(ertical)630 1626 y(bac)m(kspace.)k(F)-8 b(or)31
+b(example,)p Black Black 804 1767 a FN(\\newcommand{\\topf)o(ig)o(rul)o
+(e})o({\\h)o(ru)o(le\\)o(vs)o(pa)o(ce{)o(-0)o(.4p)o(t})o(})630
+1909 y FQ(Since)j FM(\\topfigrule)c FQ(is)k(executed)h(b)s(efore)e(the)
+h FM(\\textfloatsep)c FQ(spacing,)35 b(the)f(ab)s(o)m(v)m(e)h(com-)630
+2008 y(mand)27 b(pro)m(vides)i(no)f(spacing)h(b)s(et)m(w)m(een)g(the)f
+(\014gure)g(and)g(the)g(line.)41 b(The)27 b(follo)m(wing)j(commands)630
+2108 y(pro)m(vide)g(5)h(p)s(oin)m(ts)f(of)h(space)g(b)s(et)m(w)m(een)g
+(the)g(\014gure)e(and)h(the)h(line.)p Black Black 804
+2249 a FN(\\newcommand{\\topf)o(ig)o(rul)o(e})o({\045)935
+2349 y(\\vspace*{5pt}\\hr)o(ule)o(\\v)o(spa)o(ce)o({-5)o(.4)o(pt)o(}})
+804 2448 y(\\newcommand{\\botf)o(ig)o(rul)o(e})o({\045)935
+2548 y(\\vspace*{-5.4pt})o(\\hr)o(ul)o(e\\v)o(sp)o(ace)o({5)o(pt)o(}})
+630 2702 y FQ(The)44 b FM(\\topfigrule)d FQ(de\014nition)j(\014rst)g
+(mo)m(v)m(es)h(5)g(p)s(oin)m(ts)f(do)m(wn)g(\(in)m(to)i(the)f
+FM(\\textfloatsep)630 2815 y FQ(spacing\))h(to)f(pro)m(vide)h(space)f
+(b)s(et)m(w)m(een)h(the)f(\014gure)f(and)h(the)g(line.)85
+b(It)45 b(then)g(dra)m(ws)f(a)i(0.4)630 2928 y(p)s(oin)m(t)34
+b(horizon)m(tal)i(line)f(and)f(mo)m(v)m(es)i(bac)m(k)f(up)e(5.4)i(p)s
+(oin)m(ts)g(to)g(comp)s(ensate)g(for)f(the)g(previous)630
+3041 y(do)m(wn)m(w)m(ard)27 b(motion.)40 b(Lik)m(ewise,)30
+b(the)d FM(\\botfigrule)d FQ(command)j(dra)m(ws)g(a)h(0.4)g(p)s(oin)m
+(t)g(line)f(with)630 3154 y(5)k(p)s(oin)m(ts)f(of)h(spacing)f(b)s(et)m
+(w)m(een)h(the)g(\014gure)f(and)f(the)i(rule.)771 3267
+y(Since)37 b(these)f(commands)h(place)g(5)g(p)s(oin)m(ts)f(of)h(space)g
+(b)s(et)m(w)m(een)g(the)f(line)h(and)f(\014gure,)i(the)630
+3380 y(spacing)27 b(b)s(et)m(w)m(een)h(the)f(line)h(and)e(the)i(text)g
+(is)f FM(\\textfloatsep)71 b(-)47 b(5pt)27 b FQ(\(see)h(Section)p
+0.05 1.00 1.00 0.40 TeXcolorcmyk 27 w(19.1)p Black
+29 w(on)630 3493 y(page)p 0.05 1.00 1.00 0.40 TeXcolorcmyk
+31 w(64)p Black(\).)771 3592 y(The)d(line)h(thic)m(kness)g(can)g(b)s(e)
+e(c)m(hanged)i(from)f(the)h(0.4)h(p)s(oin)m(t)e(default)h(b)m(y)f
+(using)g(the)h FM(\\hrule)630 3692 y FQ(command's)k FM(height)f
+FQ(option)p Black Black 804 3833 a FN(\\newcommand{\\topf)o(ig)o(rul)o
+(e})o({\045)935 3933 y(\\vspace*{5pt}{\\h)o(rul)o(e)37
+b(height0.8pt}\\vspa)o(ce{)o(-5)o(.8)o(pt})o(})804 4032
+y(\\newcommand{\\botf)o(ig)o(rul)o(e})o({\045)935 4132
+y(\\vspace*{-5.8pt})o({\\h)o(ru)o(le)g(height0.8pt}\\vspa)o(ce)o({5)o
+(pt})o(})630 4286 y FQ(Notes)32 b(on)e(\014gure)g(rules:)p
+Black 767 4429 a FK(\210)p Black 45 w FQ(The)46 b FM(\\topfigrule)c
+FQ(and)j FM(\\bottomfigrule)d FQ(a\013ect)47 b(neither)f(\015oatpage)h
+(\014gures)e(nor)857 4542 y(\\here")h(\014gures)e(\(i.e.,)51
+b(using)44 b(the)i FM(h)e FQ(option\).)86 b(If)45 b(a)g(\\here")h
+(\014gure)e(happ)s(ens)g(to)i(b)s(e)857 4655 y(placed)31
+b(at)g(the)g(top)f(or)h(the)f(b)s(ottom)h(of)g(the)f(page,)i(no)e(line)
+g(is)h(dra)m(wn.)p Black 630 4751 1332 4 v 707 4872 a
+FG(T)-6 b(o)29 b(implemen)n(t)f(its)h(commands,)i(L)1739
+4855 y FF(A)1772 4872 y FG(T)1814 4888 y(E)1857 4872
+y(X)d(uses)h(man)n(y)f(in)n(ternal)h(commands)g(whic)n(h)g(users)g
+(generally)g(do)g(not)630 4963 y(need)e(to)i(access.)42
+b(T)-6 b(o)28 b(prev)n(en)n(t)f(these)h(in)n(ternal)g(command)g(names)g
+(from)h(acciden)n(tally)g(con\015icting)f(with)g(user-)630
+5055 y(de\014ned)c(names,)j(L)1171 5037 y FF(A)1204 5055
+y FG(T)1246 5071 y(E)1289 5055 y(X)e(includes)h(a)g FE(@)f
+FG(in)g(these)h(in)n(ternal)f(command)h(names.)35 b(Since)25
+b(L)3199 5037 y FF(A)3232 5055 y FG(T)3274 5071 y(E)3318
+5055 y(X)g(command)g(names)630 5146 y(can)34 b(con)n(tain)h(only)f
+(letters,)j(de\014ning)c(a)i(command)f(whose)h(name)f(con)n(tains)h
+FE(@)f FG(are)h(normally)f(not)g(p)r(ossible.)630 5237
+y(Ho)n(w)n(ev)n(er,)26 b(when)f(it)h(is)g(necessary)g(for)h(users)e(to)
+h(c)n(hange)g(the)f(in)n(ternal)h(commands,)g(the)f FE(\\makeatletter)k
+FG(com-)630 5328 y(mand)j(causes)h(L)1112 5311 y FF(A)1145
+5328 y FG(T)1187 5345 y(E)1231 5328 y(X)f(to)h(treat)f
+FE(@)h FG(as)g(a)g(letter,)i(th)n(us)c(allo)n(wing)k(users)e(to)f(use)h
+FE(@)f FG(in)h(command)f(names.)56 b(The)630 5420 y FE(\\makeatother)26
+b FG(command)d(causes)g(L)1723 5403 y FF(A)1756 5420
+y FG(T)1798 5436 y(E)1842 5420 y(X)f(to)h(rev)n(ert)g(to)g(the)f
+(normal)i(b)r(eha)n(vior)f(of)h(treating)g FE(@)f FG(as)h(a)f
+(non-letter.)p Black Black 2250 5640 a FQ(65)p Black
+eop end
+%%Page: 66 66
+TeXDict begin 66 65 bop Black 0 TeXcolorgray Black Black
+Black 1463 -159 a FB(T)-9 b(able)38 b(11:)p 0 TeXcolorgray
+Black 50 w(Figure)g(Rule)f(Commands)p 630 -29 3331 4
+v 630 310 4 339 v 755 50 a FM(\\topfigrule)p 1401 310
+V 171 w FQ(This)c(command)g(is)g(executed)h(after)g(the)f(last)h
+(\015oat)g(at)g(the)g(top)f(of)g(a)1454 163 y(page,)d(but)d(b)s(efore)h
+(the)g FM(\\textfloatsep)d FQ(spacing)j(\(see)h(Section)p
+0.05 1.00 1.00 0.40 TeXcolorcmyk 29 w(19.1)p Black
+1454 276 a(on)i(page)p 0.05 1.00 1.00 0.40 TeXcolorcmyk
+31 w(64)p Black(\).)p 3957 310 V 630 313 3331 4 v 630
+539 4 226 v 683 392 a FM(\\bottomfigrule)p 1401 539 V
+99 w FQ(This)d(command)g(is)h(executed)g(b)s(efore)f(the)h(\014rst)e
+(\015oat)j(at)f(the)f(b)s(ottom)1454 505 y(of)j(a)g(page,)g(but)f
+(after)g(the)h FM(\\textfloatsep)c FQ(spacing.)p 3957
+539 V 630 542 3331 4 v Black Black 767 781 a FK(\210)p
+Black 45 w FQ(The)c(horizon)m(tal)i(rules)e(are)g(as)h(wide)f(as)g(the)
+h(text,)i(ev)m(en)e(if)f(wider)f(\014gures)h(\(see)h(Section)p
+0.05 1.00 1.00 0.40 TeXcolorcmyk 24 w(23)p Black 857
+893 a(on)31 b(page)p 0.05 1.00 1.00 0.40 TeXcolorcmyk
+31 w(90)p Black(\))g(are)g(used.)p Black 767 1039 a FK(\210)p
+Black 45 w FQ(The)24 b(T)1089 1059 y(E)1139 1039 y(X)h
+FM(\\hrule)d FQ(command)i(w)m(as)h(used)f(instead)g(of)h(L)2750
+1022 y FP(A)2789 1039 y FQ(T)2840 1059 y(E)2890 1039
+y(X)g FM(\\rule)e FQ(command)h(b)s(ecause)857 1152 y(the)31
+b FM(\\rule)e FQ(w)m(ould)h(generate)i(additional)f(space)g(when)e
+FM(\\parskip)g FQ(is)h(not)h(zero.)630 1391 y FB(19.3)112
+b(Caption)38 b(V)-9 b(ertical)37 b(Spacing)630 1541 y
+FQ(L)654 1524 y FP(A)693 1541 y FQ(T)744 1561 y(E)794
+1541 y(X)42 b(assumes)g(that)g(captions)h(are)f(placed)h(b)s(elo)m(w)f
+(the)g(graphic,)j(placing)e(more)f(v)m(ertical)630 1632
+y(spacing)31 b(ab)s(o)m(v)m(e)g(the)g(caption)g(than)f(b)s(elo)m(w)h
+(it.)41 b(As)30 b(a)h(result,)g(the)f(commands)p Black
+Black 865 1742 a FE(\\begin{figure})983 1833 y(\\centering)983
+1924 y(\\caption{Caption)43 b(Above)d(Graphic})983 2015
+y(\\includegraphics[width=1in]{g)q(raph)q(ic})865 2107
+y(\\end{figure})630 2238 y FQ(pro)s(duce)29 b(Figure)p
+0.05 1.00 1.00 0.40 TeXcolorcmyk 31 w(13)p Black(,)j(whose)e
+(caption)h(is)f(placed)h(quite)g(close)h(to)f(the)f(graphic.)p
+Black 1599 2508 a(Figure)h(13:)p 0 TeXcolorgray Black
+42 w(Caption)f(Ab)s(o)m(v)m(e)i(Graphic)1995 2775 y @beginspecial
+0 @llx 0 @lly 144 @urx 54 @ury 720 @rwi @setspecial
+%%BeginDocument: graphic.eps
+%!PS-Adobe-2.0 EPSF-2.0
+%%Title: graphic.eps
+%%Creator: fig2dev Version 3.2 Patchlevel 0-beta2
+%%CreationDate: Thu Dec 11 20:58:11 1997
+%%For: Keith Reckdahl
+%%Orientation: Portrait
+%%BoundingBox: 0 0 144 54
+%%Pages: 0
+%%BeginSetup
+%%IncludeFeature: *PageSize Letter
+%%EndSetup
+%%Magnification: 1.00
+%%EndComments
+/$F2psDict 200 dict def
+$F2psDict begin
+$F2psDict /mtrx matrix put
+/col-1 {0 setgray} bind def
+/col0 {0.000 0.000 0.000 srgb} bind def
+/col1 {0.000 0.000 1.000 srgb} bind def
+/col2 {0.000 1.000 0.000 srgb} bind def
+/col3 {0.000 1.000 1.000 srgb} bind def
+/col4 {1.000 0.000 0.000 srgb} bind def
+/col5 {1.000 0.000 1.000 srgb} bind def
+/col6 {1.000 1.000 0.000 srgb} bind def
+/col7 {1.000 1.000 1.000 srgb} bind def
+/col8 {0.000 0.000 0.560 srgb} bind def
+/col9 {0.000 0.000 0.690 srgb} bind def
+/col10 {0.000 0.000 0.820 srgb} bind def
+/col11 {0.530 0.810 1.000 srgb} bind def
+/col12 {0.000 0.560 0.000 srgb} bind def
+/col13 {0.000 0.690 0.000 srgb} bind def
+/col14 {0.000 0.820 0.000 srgb} bind def
+/col15 {0.000 0.560 0.560 srgb} bind def
+/col16 {0.000 0.690 0.690 srgb} bind def
+/col17 {0.000 0.820 0.820 srgb} bind def
+/col18 {0.560 0.000 0.000 srgb} bind def
+/col19 {0.690 0.000 0.000 srgb} bind def
+/col20 {0.820 0.000 0.000 srgb} bind def
+/col21 {0.560 0.000 0.560 srgb} bind def
+/col22 {0.690 0.000 0.690 srgb} bind def
+/col23 {0.820 0.000 0.820 srgb} bind def
+/col24 {0.500 0.190 0.000 srgb} bind def
+/col25 {0.630 0.250 0.000 srgb} bind def
+/col26 {0.750 0.380 0.000 srgb} bind def
+/col27 {1.000 0.500 0.500 srgb} bind def
+/col28 {1.000 0.630 0.630 srgb} bind def
+/col29 {1.000 0.750 0.750 srgb} bind def
+/col30 {1.000 0.880 0.880 srgb} bind def
+/col31 {1.000 0.840 0.000 srgb} bind def
+
+end
+save
+-2.0 61.0 translate
+1 -1 scale
+
+/cp {closepath} bind def
+/ef {eofill} bind def
+/gr {grestore} bind def
+/gs {gsave} bind def
+/sa {save} bind def
+/rs {restore} bind def
+/l {lineto} bind def
+/m {moveto} bind def
+/rm {rmoveto} bind def
+/n {newpath} bind def
+/s {stroke} bind def
+/sh {show} bind def
+/slc {setlinecap} bind def
+/slj {setlinejoin} bind def
+/slw {setlinewidth} bind def
+/srgb {setrgbcolor} bind def
+/rot {rotate} bind def
+/sc {scale} bind def
+/sd {setdash} bind def
+/ff {findfont} bind def
+/sf {setfont} bind def
+/scf {scalefont} bind def
+/sw {stringwidth} bind def
+/tr {translate} bind def
+/tnt {dup dup currentrgbcolor
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb}
+ bind def
+/shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul
+ 4 -2 roll mul srgb} bind def
+/$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def
+/$F2psEnd {$F2psEnteredState restore end} def
+%%EndProlog
+
+$F2psBegin
+10 setmiterlimit
+n 0 1048 m 0 0 l 2473 0 l 2473 1048 l cp clip
+ 0.06000 0.06000 sc
+% Polyline
+30.000 slw
+n 2400 975 m 75 975 l 75 150 l 2400 150 l cp gs col-1 s gr
+/Times-Bold ff 360.00 scf sf
+1220 705 m
+gs 1 -1 sc (Graphic) dup sw pop 2 div neg 0 rm col-1 sh gr
+$F2psEnd
+rs
+
+%%EndDocument
+ @endspecial Black 771 2939 a(The)j(caption)h(spacing)f(is)g(con)m
+(trolled)i(b)m(y)e(the)g(lengths)g FM(\\abovecaptionskip)c
+FQ(\(whic)m(h)k(is)630 3030 y FM(10pt)30 b FQ(b)m(y)g(default\))i(and)e
+FM(\\belowcaptionskip)c FQ(\(whic)m(h)31 b(is)g(zero)g(b)m(y)g
+(default\).)42 b(The)31 b(standard)630 3121 y(L)654 3104
+y FP(A)693 3121 y FQ(T)744 3141 y(E)794 3121 y(X)h(commands)f
+FM(\\setlength)e FQ(and)i FM(\\addtolength)d FQ(are)k(used)f(to)i(mo)s
+(dify)d(these)i(lengths.)630 3213 y(F)-8 b(or)31 b(example,)g(the)g
+(commands)p Black Black 865 3322 a FE(\\begin{figure})983
+3413 y(\\setlength{\\abovecaptionskip})q({0pt)q(})983
+3504 y(\\setlength{\\belowcaptionskip})q({10p)q(t})983
+3596 y(\\centering)983 3687 y(\\caption{Caption)43 b(Above)d(Graphic})
+983 3778 y(\\includegraphics[width=1in]{g)q(raph)q(ic})865
+3870 y(\\end{figure})630 4001 y FQ(pro)s(duce)28 b(Figure)p
+0.05 1.00 1.00 0.40 TeXcolorcmyk 29 w(14)p Black(,)j(whic)m(h)e(has)
+f(has)h(no)g(extra)h(space)f(ab)s(o)m(v)m(e)i(the)e(caption)h(and)e(10)
+i(p)s(oin)m(ts)f(of)630 4113 y(space)i(b)s(et)m(w)m(een)g(the)g
+(caption)g(and)f(the)g(graphic.)p Black 1599 4300 a(Figure)h(14:)p
+0 TeXcolorgray Black 42 w(Caption)f(Ab)s(o)m(v)m(e)i(Graphic)1995
+4651 y @beginspecial 0 @llx 0 @lly 144 @urx 54 @ury 720
+@rwi @setspecial
+%%BeginDocument: graphic.eps
+%!PS-Adobe-2.0 EPSF-2.0
+%%Title: graphic.eps
+%%Creator: fig2dev Version 3.2 Patchlevel 0-beta2
+%%CreationDate: Thu Dec 11 20:58:11 1997
+%%For: Keith Reckdahl
+%%Orientation: Portrait
+%%BoundingBox: 0 0 144 54
+%%Pages: 0
+%%BeginSetup
+%%IncludeFeature: *PageSize Letter
+%%EndSetup
+%%Magnification: 1.00
+%%EndComments
+/$F2psDict 200 dict def
+$F2psDict begin
+$F2psDict /mtrx matrix put
+/col-1 {0 setgray} bind def
+/col0 {0.000 0.000 0.000 srgb} bind def
+/col1 {0.000 0.000 1.000 srgb} bind def
+/col2 {0.000 1.000 0.000 srgb} bind def
+/col3 {0.000 1.000 1.000 srgb} bind def
+/col4 {1.000 0.000 0.000 srgb} bind def
+/col5 {1.000 0.000 1.000 srgb} bind def
+/col6 {1.000 1.000 0.000 srgb} bind def
+/col7 {1.000 1.000 1.000 srgb} bind def
+/col8 {0.000 0.000 0.560 srgb} bind def
+/col9 {0.000 0.000 0.690 srgb} bind def
+/col10 {0.000 0.000 0.820 srgb} bind def
+/col11 {0.530 0.810 1.000 srgb} bind def
+/col12 {0.000 0.560 0.000 srgb} bind def
+/col13 {0.000 0.690 0.000 srgb} bind def
+/col14 {0.000 0.820 0.000 srgb} bind def
+/col15 {0.000 0.560 0.560 srgb} bind def
+/col16 {0.000 0.690 0.690 srgb} bind def
+/col17 {0.000 0.820 0.820 srgb} bind def
+/col18 {0.560 0.000 0.000 srgb} bind def
+/col19 {0.690 0.000 0.000 srgb} bind def
+/col20 {0.820 0.000 0.000 srgb} bind def
+/col21 {0.560 0.000 0.560 srgb} bind def
+/col22 {0.690 0.000 0.690 srgb} bind def
+/col23 {0.820 0.000 0.820 srgb} bind def
+/col24 {0.500 0.190 0.000 srgb} bind def
+/col25 {0.630 0.250 0.000 srgb} bind def
+/col26 {0.750 0.380 0.000 srgb} bind def
+/col27 {1.000 0.500 0.500 srgb} bind def
+/col28 {1.000 0.630 0.630 srgb} bind def
+/col29 {1.000 0.750 0.750 srgb} bind def
+/col30 {1.000 0.880 0.880 srgb} bind def
+/col31 {1.000 0.840 0.000 srgb} bind def
+
+end
+save
+-2.0 61.0 translate
+1 -1 scale
+
+/cp {closepath} bind def
+/ef {eofill} bind def
+/gr {grestore} bind def
+/gs {gsave} bind def
+/sa {save} bind def
+/rs {restore} bind def
+/l {lineto} bind def
+/m {moveto} bind def
+/rm {rmoveto} bind def
+/n {newpath} bind def
+/s {stroke} bind def
+/sh {show} bind def
+/slc {setlinecap} bind def
+/slj {setlinejoin} bind def
+/slw {setlinewidth} bind def
+/srgb {setrgbcolor} bind def
+/rot {rotate} bind def
+/sc {scale} bind def
+/sd {setdash} bind def
+/ff {findfont} bind def
+/sf {setfont} bind def
+/scf {scalefont} bind def
+/sw {stringwidth} bind def
+/tr {translate} bind def
+/tnt {dup dup currentrgbcolor
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb}
+ bind def
+/shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul
+ 4 -2 roll mul srgb} bind def
+/$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def
+/$F2psEnd {$F2psEnteredState restore end} def
+%%EndProlog
+
+$F2psBegin
+10 setmiterlimit
+n 0 1048 m 0 0 l 2473 0 l 2473 1048 l cp clip
+ 0.06000 0.06000 sc
+% Polyline
+30.000 slw
+n 2400 975 m 75 975 l 75 150 l 2400 150 l cp gs col-1 s gr
+/Times-Bold ff 360.00 scf sf
+1220 705 m
+gs 1 -1 sc (Graphic) dup sw pop 2 div neg 0 rm col-1 sh gr
+$F2psEnd
+rs
+
+%%EndDocument
+ @endspecial Black 771 4823 a(If)e(a)h(do)s(cumen)m(t)f(has)g(all)h
+(its)g(captions)g(at)g(the)g(top)g(of)f(its)h(\015oats,)g(the)g
+(commands)p Black Black 1022 4940 a FN(\\setlength{\\above)o(ca)o(pti)o
+(on)o(ski)o(p})o({0)o(pt})1022 5040 y(\\setlength{\\below)o(ca)o(pti)o
+(on)o(ski)o(p})o({1)o(0pt)o(})630 5157 y FQ(can)36 b(b)s(e)f(issued)g
+(in)g(the)h(do)s(cumen)m(t's)g(pream)m(ble)g(to)g(a\013ect)h(the)f
+(caption)h(spacing)f(for)f Fy(al)5 b(l)46 b FQ(the)630
+5257 y(do)s(cumen)m(t's)26 b(captions)g(\(\014gures)g
+Fy(and)36 b FQ(tables\).)k(If)26 b(a)g(do)s(cumen)m(t)g(con)m(tains)h
+(captions)f(at)h(the)f(top)630 5357 y(of)36 b(some)g(\015oats)h(and)e
+(at)i(the)f(b)s(ottom)g(of)g(other)g(\015oats,)j(it)d(ma)m(y)h(b)s(e)e
+(desirable)h(to)h(de\014ne)e(the)630 5456 y(follo)m(wing)d(command)p
+Black 2250 5640 a(66)p Black eop end
+%%Page: 67 67
+TeXDict begin 67 66 bop Black 0 TeXcolorgray Black Black
+Black Black 761 -149 a FN(\\newcommand{\\top)o(ca)o(pt)o(ion)o(}{)o
+(\045)935 -49 y(\\setlength{\\abov)o(eca)o(pt)o(ion)o(sk)o(ip})o({0)o
+(pt)o(}\045)935 51 y(\\setlength{\\belo)o(wca)o(pt)o(ion)o(sk)o(ip})o
+({1)o(0p)o(t}\045)935 150 y(\\caption})630 305 y FQ(Then)26
+b FM(\\topcaption{caption)43 b(text})25 b FQ(pro)s(duces)h(a)h(caption)
+h(whic)m(h)f(is)g(prop)s(erly)f(spaced)h(for)630 418
+y(the)k(top)f(of)h(a)f(\015oat.)771 530 y(Tw)m(o)h(other)f(metho)s(ds)g
+(for)g(pro)s(ducing)f(prop)s(erly-spaced)h(top)g(captions)h(are)p
+Black 767 673 a FK(\210)p Black 45 w FQ(The)f FO(caption)g
+FQ(pac)m(k)-5 b(age's)32 b FM(position=top)27 b FQ(option)k(in)f(T)-8
+b(able)p 0.05 1.00 1.00 0.40 TeXcolorcmyk 31 w(16)p
+Black 31 w(on)30 b(page)p 0.05 1.00 1.00 0.40 TeXcolorcmyk
+31 w(74)p Black 31 w(sw)m(aps)g(the)857 786 y(meaning)h(of)38
+b FM(\\abovecaptionskip)25 b FQ(and)30 b FM(\\belowcaptionskip)p
+Black 767 936 a FK(\210)p Black 45 w FQ(The)j FO(top)s(capt)f
+FQ(pac)m(k)-5 b(age)35 b([)p 0.05 1.00 1.00 0.40 TeXcolorcmyk(33)p
+Black 2 w(],)f(de\014nes)e(a)h FM(\\topcaption)d FQ(command)j(whic)m(h)
+g(pro)s(duces)f(a)857 1049 y(caption)j(with)f(the)h FM
+(\\abovecaptionskip)29 b FQ(and)34 b FM(\\belowcaptionskip)c
+FQ(lengths)k(in)m(ter-)857 1162 y(c)m(hanged.)630 1406
+y FB(19.4)112 b(Caption)38 b(Lab)s(el)630 1556 y FQ(By)23
+b(default,)h(L)1113 1539 y FP(A)1152 1556 y FQ(T)1203
+1575 y(E)1253 1556 y(X)f(inserts)f(a)g(caption)i(lab)s(el)e(suc)m(h)g
+(as)h(\\Figure)g(13:)37 b(")g(at)23 b(the)g(b)s(eginning)e(of)i(the)630
+1647 y(the)35 b(caption.)56 b(The)34 b(\\Figure")j(p)s(ortion)d(can)i
+(b)s(e)e(c)m(hanged)i(b)m(y)f(rede\014ning)f(the)h FM(\\figurename)630
+1738 y FQ(command.)40 b(F)-8 b(or)32 b(example,)f(the)g(commands)p
+Black Black 865 1871 a FE(\\begin{figure})983 1963 y(\\centering)983
+2054 y(\\includegraphics[width=1in]{g)q(raph)q(ic})983
+2145 y(\\renewcommand{\\figurename}{Fi)q(g.})983 2237
+y(\\caption{This)42 b(is)e(the)g(Caption})865 2328 y(\\end{figure})630
+2482 y FQ(pro)s(duce)34 b(Figure)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 35 w(15)p Black(.)56 b(The)35 b(caption)g(fon)m(t,)i(the)f
+(\\:")51 b(delimiter,)37 b(and)d(other)h(caption)h(c)m(harac-)630
+2595 y(teristics)c(can)e(b)s(e)g(customized)h(with)f(the)h
+FO(caption)f FQ(pac)m(k)-5 b(age)33 b(\(see)e(Section)p
+0.05 1.00 1.00 0.40 TeXcolorcmyk 31 w(20)p Black 31
+w(on)g(page)p 0.05 1.00 1.00 0.40 TeXcolorcmyk 31
+w(69)p Black(\).)p Black 1980 2943 a @beginspecial 0
+@llx 0 @lly 144 @urx 54 @ury 720 @rwi @setspecial
+%%BeginDocument: graphic.eps
+%!PS-Adobe-2.0 EPSF-2.0
+%%Title: graphic.eps
+%%Creator: fig2dev Version 3.2 Patchlevel 0-beta2
+%%CreationDate: Thu Dec 11 20:58:11 1997
+%%For: Keith Reckdahl
+%%Orientation: Portrait
+%%BoundingBox: 0 0 144 54
+%%Pages: 0
+%%BeginSetup
+%%IncludeFeature: *PageSize Letter
+%%EndSetup
+%%Magnification: 1.00
+%%EndComments
+/$F2psDict 200 dict def
+$F2psDict begin
+$F2psDict /mtrx matrix put
+/col-1 {0 setgray} bind def
+/col0 {0.000 0.000 0.000 srgb} bind def
+/col1 {0.000 0.000 1.000 srgb} bind def
+/col2 {0.000 1.000 0.000 srgb} bind def
+/col3 {0.000 1.000 1.000 srgb} bind def
+/col4 {1.000 0.000 0.000 srgb} bind def
+/col5 {1.000 0.000 1.000 srgb} bind def
+/col6 {1.000 1.000 0.000 srgb} bind def
+/col7 {1.000 1.000 1.000 srgb} bind def
+/col8 {0.000 0.000 0.560 srgb} bind def
+/col9 {0.000 0.000 0.690 srgb} bind def
+/col10 {0.000 0.000 0.820 srgb} bind def
+/col11 {0.530 0.810 1.000 srgb} bind def
+/col12 {0.000 0.560 0.000 srgb} bind def
+/col13 {0.000 0.690 0.000 srgb} bind def
+/col14 {0.000 0.820 0.000 srgb} bind def
+/col15 {0.000 0.560 0.560 srgb} bind def
+/col16 {0.000 0.690 0.690 srgb} bind def
+/col17 {0.000 0.820 0.820 srgb} bind def
+/col18 {0.560 0.000 0.000 srgb} bind def
+/col19 {0.690 0.000 0.000 srgb} bind def
+/col20 {0.820 0.000 0.000 srgb} bind def
+/col21 {0.560 0.000 0.560 srgb} bind def
+/col22 {0.690 0.000 0.690 srgb} bind def
+/col23 {0.820 0.000 0.820 srgb} bind def
+/col24 {0.500 0.190 0.000 srgb} bind def
+/col25 {0.630 0.250 0.000 srgb} bind def
+/col26 {0.750 0.380 0.000 srgb} bind def
+/col27 {1.000 0.500 0.500 srgb} bind def
+/col28 {1.000 0.630 0.630 srgb} bind def
+/col29 {1.000 0.750 0.750 srgb} bind def
+/col30 {1.000 0.880 0.880 srgb} bind def
+/col31 {1.000 0.840 0.000 srgb} bind def
+
+end
+save
+-2.0 61.0 translate
+1 -1 scale
+
+/cp {closepath} bind def
+/ef {eofill} bind def
+/gr {grestore} bind def
+/gs {gsave} bind def
+/sa {save} bind def
+/rs {restore} bind def
+/l {lineto} bind def
+/m {moveto} bind def
+/rm {rmoveto} bind def
+/n {newpath} bind def
+/s {stroke} bind def
+/sh {show} bind def
+/slc {setlinecap} bind def
+/slj {setlinejoin} bind def
+/slw {setlinewidth} bind def
+/srgb {setrgbcolor} bind def
+/rot {rotate} bind def
+/sc {scale} bind def
+/sd {setdash} bind def
+/ff {findfont} bind def
+/sf {setfont} bind def
+/scf {scalefont} bind def
+/sw {stringwidth} bind def
+/tr {translate} bind def
+/tnt {dup dup currentrgbcolor
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb}
+ bind def
+/shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul
+ 4 -2 roll mul srgb} bind def
+/$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def
+/$F2psEnd {$F2psEnteredState restore end} def
+%%EndProlog
+
+$F2psBegin
+10 setmiterlimit
+n 0 1048 m 0 0 l 2473 0 l 2473 1048 l cp clip
+ 0.06000 0.06000 sc
+% Polyline
+30.000 slw
+n 2400 975 m 75 975 l 75 150 l 2400 150 l cp gs col-1 s gr
+/Times-Bold ff 360.00 scf sf
+1220 705 m
+gs 1 -1 sc (Graphic) dup sw pop 2 div neg 0 rm col-1 sh gr
+$F2psEnd
+rs
+
+%%EndDocument
+ @endspecial 1737 3138 a(Fig.)h(15:)p 0 TeXcolorgray
+Black 41 w(This)e(is)g(the)h(Caption)p Black 630 3493
+a FB(19.5)112 b(Caption)38 b(Num)m(b)s(ering)630 3664
+y FQ(The)33 b(default)h(metho)s(d)f(for)g(n)m(um)m(b)s(ering)g(the)g
+(\014gures)g(is)h(Arabic)g(\(1,)16 b(2,)g(3,)g(4,)p Fz(:)f(:)g(:)q
+FQ(\).)51 b(This)33 b(can)h(b)s(e)630 3777 y(c)m(hanged)d(b)m(y)f
+(rede\014ning)g(the)g FM(\\thefigure)e FQ(command.)771
+3877 y(The)20 b(n)m(um)m(b)s(er)f(of)h(the)h(curren)m(t)f(\014gure)g
+(is)g(stored)g(in)g(the)h FM(figure)d FQ(coun)m(ter.)38
+b(The)20 b FM(\\thefigure)630 3976 y FQ(command)39 b(sp)s(eci\014es)f
+(whic)m(h)h(of)g(the)g(coun)m(ter)g(n)m(um)m(b)s(ering)f(commands)h(\()
+p FM(\\arabic)p FQ(,)g FM(\\roman)p FQ(,)630 4076 y FM(\\Roman)p
+FQ(,)29 b FM(\\alph)p FQ(,)g FM(\\Alph)p FQ(\))g(is)i(used)e(to)i(prin)
+m(t)f(the)h(coun)m(ter)g(v)-5 b(alue.)41 b(F)-8 b(or)31
+b(example,)p Black Black 804 4217 a FN(\\renewcommand{\\th)o(ef)o(igu)o
+(re)o(}{\\)o(Ro)o(man)o({f)o(ig)o(ure)o(}})630 4372 y
+FQ(causes)c(the)g(\014gures)f(to)i(b)s(e)e(n)m(um)m(b)s(ered)f(with)i
+(upp)s(ercase)f(Roman)g(n)m(umerals)h(\(I,)16 b(I)s(I,)e(I)s(I)s(I,)g
+(IV,)p Fz(:)h(:)g(:)q FQ(\).)630 4597 y(Notes)32 b(on)e(\014gure)g(n)m
+(um)m(b)s(ering:)p Black 767 4740 a FK(\210)p Black 45
+w FQ(There)g(m)m(ust)g(b)s(e)g(26)h(or)g(few)m(er)f(\014gures)g(to)h
+(use)f(the)h FM(\\alph)e FQ(or)h FM(\\Alph)f FQ(commands.)p
+Black 767 4891 a FK(\210)p Black 45 w FQ(Since)34 b(Roman)g(n)m(um)m(b)
+s(ering)f(pro)s(duces)f(longer)j(\014gure)e(n)m(um)m(b)s(ers)f(\(e.g.,)
+37 b(XVI)s(I)s(I)c(vs.)g(18\),)857 5003 y(using)e FM(\\Roman)e
+FQ(or)h FM(\\roman)f FQ(ma)m(y)i(cause)g(spacing)g(problems)e(in)h(the)
+h(T)-8 b(able)31 b(of)g(Figures.)p Black 2250 5640 a(67)p
+Black eop end
+%%Page: 68 68
+TeXDict begin 68 67 bop Black 0 TeXcolorgray Black Black
+630 -149 a FB(19.6)112 b(Mo)m(ving)39 b(Figures)f(to)f(End)g(of)h(Do)s
+(cumen)m(t)630 10 y FQ(Some)21 b(journals)g(require)g(that)h(tables)g
+(and)e(\014gures)h(b)s(e)g(separated)g(from)g(the)g(text.)39
+b(The)21 b FO(end\015oat)630 109 y FQ(pac)m(k)-5 b(age)27
+b(mo)m(v)m(es)e(all)h(the)f(\014gures)e(and)h(table)i(to)f(the)g(end)f
+(of)g(the)h(do)s(cumen)m(t.)39 b(Simply)23 b(including)630
+209 y(the)31 b(pac)m(k)-5 b(age)p Black Black 761 317
+a FN(\\usepackage{endf)o(lo)o(at)o(})630 438 y FQ(activ)g(ates)30
+b(the)e(pac)m(k)-5 b(age.)42 b(The)27 b(pac)m(k)-5 b(age)30
+b(supp)s(orts)25 b(man)m(y)j(options)g(whic)m(h)f(can)h(b)s(e)f
+(included)g(in)630 551 y(the)k FM(\\usepackage)c FQ(command,)j
+(including)p Black 767 680 a FK(\210)p Black 45 w FQ(Notes)i(suc)m(h)f
+(as)g(\\[Figure)h(4)f(ab)s(out)f(here.]")43 b(are)31
+b(placed)g(in)f(appro)m(ximately)i(where)f(the)857 780
+y(\015oats)g(w)m(ould)g(ha)m(v)m(e)g(app)s(eared)f(in)h(the)f(text.)43
+b(Suc)m(h)29 b(notes)i(can)g(b)s(e)f(turned)g(o\013)g(with)h(the)857
+879 y FM(nomarkers)d FQ(pac)m(k)-5 b(age)33 b(option)p
+Black Black 988 1006 a FN(\\usepackage[noma)o(rke)o(rs)o(]{e)o(nd)o(fl)
+o(oat)o(})857 1133 y FQ(The)i(text)h(of)g(these)g(notes)f(can)h(b)s(e)f
+(c)m(hanged)h(b)m(y)f(rede\014ning)f(the)i FM(\\figureplace)c
+FQ(and)857 1233 y FM(\\tableplace)c FQ(commands.)40 b(F)-8
+b(or)31 b(example,)p Black Black 1075 1360 a FN(\\renewcommand{\\fi)o
+(gu)o(rep)o(la)o(ce)o(}{\045)1162 1459 y(\\begin{center}\045)1162
+1559 y([\\figurename~\\the)o(pos)o(tf)o(ig)o(\\)38 b(would)j(appear)g
+(here.]\045)1162 1659 y(\\end{center}})857 1799 y FQ(c)m(hanges)32
+b(the)e FM(\\figureplace)d FQ(text.)p Black 767 1943
+a FK(\210)p Black 45 w FQ(A)37 b(list)g(of)f(\014gures)g(is)h(included)
+e(b)s(efore)h(the)h(\014gures)f(and)g(a)g(list)h(of)g(tables)g(is)g
+(included)857 2055 y(b)s(efore)i(the)h(tables.)68 b(The)39
+b FM(nofiglist)e FQ(and)i FM(notablist)e FQ(pac)m(k)-5
+b(age)41 b(options)f(suppress)857 2168 y(these)31 b(lists.)p
+Black 767 2312 a FK(\210)p Black 45 w FQ(The)21 b FM(fighead)e
+FQ(and)i FM(tabhead)e FQ(pac)m(k)-5 b(age)23 b(options)f(create)g
+(section)h(headers)d(for)h(the)h(\014gures)857 2425 y(and)30
+b(tables,)h(resp)s(ectiv)m(ely)-8 b(.)p Black 767 2568
+a FK(\210)p Black 45 w FQ(The)22 b(\014gures)g(app)s(ear)g(b)s(efore)g
+(the)g(tables.)39 b(The)22 b FM(tablesfirst)d FQ(pac)m(k)-5
+b(age)25 b(option)d(rev)m(erses)857 2681 y(this)31 b(order.)p
+Black 767 2812 a FK(\210)p Black 45 w FQ(A)h FM(\\clearpage)d
+FQ(command)j(is)f(executed)i(after)f(eac)m(h)h(\014gure)e(and)g(table,)
+j(causing)e(eac)m(h)857 2911 y(\015oat)41 b(to)g(app)s(ear)f(on)g(a)h
+(page)g(b)m(y)f(itself.)72 b(This)39 b(can)i(b)s(e)f(c)m(hanged)h(b)m
+(y)f(mo)s(difying)g(the)857 3011 y FM(\\efloatseparator)26
+b FQ(command.)41 b(F)-8 b(or)31 b(example,)p Black Black
+1032 3138 a FN(\\renewcommand{\\)o(efl)o(oa)o(tse)o(pa)o(ra)o(tor)o(}{)
+o(\\mb)o(ox)o({})o(})857 3278 y FQ(places)g(an)g(empt)m(y)h
+FM(\\mbox)d FQ(after)i(eac)m(h)g(\015oat.)630 3515 y
+FB(19.7)112 b(Adjusting)38 b(Caption)g(Linespacing)630
+3674 y FQ(T)-8 b(o)31 b(doublespace)f(a)h(do)s(cumen)m(t,)g(include)f
+(either)p Black Black 1066 3781 a FN(\\linespread{1.6})630
+3889 y FQ(or)g(equiv)-5 b(alen)m(tly)p Black Black 1066
+3997 a FN(\\renewcommand{\\b)o(as)o(eli)o(ne)o(str)o(et)o(ch)o(}{1)o
+(.6)o(})630 4104 y FQ(in)25 b(the)g(pream)m(ble)1243
+4071 y FP(30)1318 4104 y FQ(.)39 b(In)24 b(addition)h(to)g
+(doublespaced)g(text,)i(this)e(also)h(pro)s(duces)d(doublespaced)630
+4204 y(captions)i(and)e(fo)s(otnotes.)40 b(T)-8 b(o)24
+b(pro)s(duce)f(doublespaced)h(text)h(and)e(singlespaced)i(captions)g
+(and)630 4304 y(fo)s(otnotes,)32 b(use)e(the)g FO(setspace)h
+FQ(pac)m(k)-5 b(age)2014 4271 y FP(31)2091 4304 y FQ(.)p
+Black Black 848 4411 a FN(\\usepackage{sets)o(pa)o(ce})848
+4511 y(\\linestretch{1.5)o(})630 4632 y FQ(A)27 b(1.0)i(linestretc)m(h)
+f(causes)g(single-spaced)g(text,)h(a)f(1.25)g(linestretc)m(h)h(causes)f
+(space-and-a-half)630 4745 y(spaced)i(text,)i(and)e(a)h(1.6)g
+(linestretc)m(h)h(causes)f(doublespaced)f(text.)p Black
+630 4827 1332 4 v 703 4917 a FF(30)768 4948 y FG(Although)24
+b(it)g(is)g(generally)h(considered)g(p)r(o)r(or)g(st)n(yle,)f(these)g
+(commands)h(can)f(also)h(b)r(e)f(used)g(within)g(a)g(do)r(cu-)630
+5040 y(men)n(t)e(to)g(c)n(hange)h(the)f(in)n(terline)g(spacing.)35
+b(When)21 b(these)i(commands)f(are)h(used)f(within)h(a)f(do)r(cumen)n
+(t,)h(a)g(fon)n(tsize)630 5131 y(command)i(suc)n(h)f(as)h
+FE(\\normalsize)i FG(m)n(ust)d(issued)h(after)g(the)f(line-spacing)h
+(command)g(to)g(put)e(the)h(new)h(spacing)630 5222 y(in)n(to)h
+(e\013ect.)703 5318 y FF(31)768 5349 y FG(Although)k(the)h
+Fs(doublespace)g FG(pac)n(k)l(age)g(also)h(sets)f(line)g(spacing,)i(it)
+e(has)g(not)g(b)r(een)f(prop)r(erly)h(up)r(dated)f(to)630
+5441 y(L)650 5424 y FF(A)683 5441 y FG(T)725 5457 y(E)769
+5441 y(X)12 b(2)877 5449 y Fl(")916 5441 y FG(,)26 b(causing)h(it)e(to)
+h(in)n(teract)g(with)g(man)n(y)f(pac)n(k)l(ages.)35 b(As)26
+b(a)g(result,)g Fs(setspace)g FG(should)g(b)r(e)f(used)h(instead.)p
+Black Black 2250 5640 a FQ(68)p Black eop end
+%%Page: 69 69
+TeXDict begin 69 68 bop Black 0 TeXcolorgray Black Black
+630 -149 a FD(20)135 b(Customizing)46 b(Captions)g(with)f(caption)g
+(pac)l(k)-7 b(age)630 54 y FQ(Section)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 43 w(19.4)p Black 44 w(on)42 b(page)p
+0.05 1.00 1.00 0.40 TeXcolorcmyk 43 w(67)p Black 43
+w(describ)s(es)f(ho)m(w)i(to)g(customize)g(the)g(caption)g(lab)s(el)f
+(while)g(Sec-)630 167 y(tion)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 35 w(19.3)p Black 36 w(on)35 b(page)p
+0.05 1.00 1.00 0.40 TeXcolorcmyk 35 w(66)p Black 36
+w(describ)s(es)f(ho)m(w)h(to)g(customize)h(the)f(caption)h(v)m(ertical)
+g(spacing.)54 b(The)630 280 y FO(caption)31 b FQ(pac)m(k)-5
+b(age)1245 247 y FP(32)1354 280 y FQ(pro)m(vides)31 b(commands)g(for)g
+(customizing)i(other)f(caption)g(c)m(haracteristics.)630
+393 y(This)f(section)i(pro)m(vides)f(an)g(o)m(v)m(erview)i(of)e(the)g
+FO(caption)g FQ(pac)m(k)-5 b(age.)47 b(F)-8 b(urther)32
+b(details)h(are)f(found)630 506 y(in)e(the)h FO(caption)f
+FQ(pac)m(k)-5 b(age)32 b(do)s(cumen)m(tation)g([)p
+0.05 1.00 1.00 0.40 TeXcolorcmyk(12)p Black 1 w(].)771
+619 y(The)24 b FO(caption)f FQ(pac)m(k)-5 b(age)26 b(can)f(b)s(e)e
+(used)g(with)h(man)m(y)g(t)m(yp)s(es)g(of)g(\015oats)g(as)h(it)f
+(o\016cially)i(supp)s(orts)630 732 y(the)d FO(\015oat)o
+FQ(,)i FO(listings)o FQ(,)f FO(longtable)p FQ(,)g FO(rotating)r
+FQ(,)g FO(sidecap)p FQ(,)g FO(sup)s(ertabula)m(r)q FQ(,)g(and)e
+FO(sub\014g)h FQ(pac)m(k)-5 b(ages.)40 b(It)23 b(also)630
+845 y(w)m(orks)30 b(with)g(the)h FO(\015oat\014g)q FQ(,)g
+FO(sub\015oat)o FQ(,)g(and)f FO(wrap\014g)h FQ(pac)m(k)-5
+b(ages.)630 1057 y(Although)26 b(it)h(is)f(not)g(describ)s(ed)f(in)h
+(this)g(do)s(cumen)m(t,)g(the)h FO(ccaption)f FQ(\(note)h(the)f
+(double-c\))h(pac)m(k-)p Black Black -3737 w FO(ccaption)187
+1170 y FL(pac)m(k)-6 b(age)91 b FQ(age)32 b(also)f(pro)m(vides)f
+(commands)g(for)g(customizing)i(captions.)41 b(It)31
+b(is)f(describ)s(ed)g(in)g([)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk(13)p Black 1 w(].)630 1414 y FB(20.1)112
+b(Caption)38 b(P)m(ac)m(k)-6 b(age)38 b(Ov)m(erview)630
+1585 y FQ(There)30 b(are)h(t)m(w)m(o)g(asp)s(ects)g(to)g(the)g
+FO(caption)f FQ(pac)m(k)-5 b(age)p Black 767 1728 a FK(\210)p
+Black 45 w FQ(The)35 b(new)g(v)-5 b(arian)m(ts)36 b(of)g(the)f
+FM(\\caption)e FQ(command)j(whic)m(h)f(pro)s(duce)f(the)h(captions)i
+(are)857 1841 y(describ)s(ed)30 b(in)g(Section)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 31 w(20.2)p Black 32 w(and)f(listed)i(in)f(T)-8
+b(able)p 0.05 1.00 1.00 0.40 TeXcolorcmyk 31 w(12)p
+Black(.)p Black 767 1991 a FK(\210)p Black 45 w FQ(Section)p
+0.05 1.00 1.00 0.40 TeXcolorcmyk 47 w(20.3)p Black
+47 w(on)45 b(page)p 0.05 1.00 1.00 0.40 TeXcolorcmyk
+46 w(70)p Black 46 w(describ)s(es)g(the)h(t)m(w)m(o)h(metho)s(ds)d(for)
+h(sp)s(ecifying)h(caption-)857 2104 y(customizing)32
+b(options.)41 b(There)30 b(are)g(four)g(t)m(yp)s(es)h(of)f(options:)p
+Black 857 2292 a FL(F)-9 b(on)m(t)35 b(Options)p Black
+46 w FQ(customize)h(the)e(caption)i(fon)m(t)2569 2259
+y FP(33)2644 2292 y FQ(.)53 b(These)35 b(options)g(are)g(listed)g(in)f
+(T)-8 b(a-)1057 2405 y(ble)p 0.05 1.00 1.00 0.40 TeXcolorcmyk
+31 w(14)p Black 31 w(and)29 b(T)-8 b(able)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 31 w(15)p Black 31 w(on)30 b(page)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 31 w(73)p Black 31 w(with)g(examples)h(pro)m(vided)f(in)g
+(Section)p 0.05 1.00 1.00 0.40 TeXcolorcmyk 31 w(20.4.1)p
+Black 1057 2517 a(on)h(page)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 31 w(76)p Black(.)p Black 857 2664 a FL(Caption)k(Spacing)
+g(Options)p Black 46 w FQ(customize)45 b(the)g(caption)g(v)m(ertical)h
+(spacing.)83 b(These)1057 2777 y(options)32 b(are)g(listed)f(in)g(T)-8
+b(able)p 0.05 1.00 1.00 0.40 TeXcolorcmyk 32 w(16)p
+Black 32 w(on)32 b(page)p 0.05 1.00 1.00 0.40 TeXcolorcmyk
+32 w(74)p Black 32 w(with)f(examples)h(pro)m(vided)e(in)h(Sec-)1057
+2889 y(tion)p 0.05 1.00 1.00 0.40 TeXcolorcmyk 31
+w(20.4.2)p Black 33 w(on)f(page)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 31 w(77)p Black(.)p Black 857 3036 a FL(Caption)35
+b(Lab)s(el)f(Options)p Black 45 w FQ(customize)k(the)f(caption)g(lab)s
+(el)g(and)f(separator.)60 b(These)1057 3148 y(options)32
+b(are)g(listed)f(in)g(T)-8 b(able)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 32 w(17)p Black 32 w(on)32 b(page)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 32 w(74)p Black 32 w(with)f(examples)h(pro)m(vided)e(in)h
+(Sec-)1057 3261 y(tion)p 0.05 1.00 1.00 0.40 TeXcolorcmyk
+31 w(20.4.3)p Black 33 w(on)f(page)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 31 w(79)p Black(.)p Black 857 3407 a FL(Caption)35
+b(F)-9 b(ormatting)34 b(Options)p Black 46 w FQ(customize)26
+b(the)g(caption)g(formatting.)40 b(These)25 b(op-)1057
+3520 y(tions)39 b(are)g(listed)h(in)e(T)-8 b(able)p
+0.05 1.00 1.00 0.40 TeXcolorcmyk 39 w(18)p Black 40
+w(on)38 b(page)p 0.05 1.00 1.00 0.40 TeXcolorcmyk
+40 w(75)p Black 39 w(with)h(examples)g(pro)m(vided)f(in)g(Sec-)1057
+3633 y(tion)p 0.05 1.00 1.00 0.40 TeXcolorcmyk 31
+w(20.4.4)p Black 33 w(on)30 b(page)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 31 w(80)p Black(.)857 3821 y(Note)43 b(that)e(the)g
+(tables)h(listing)g(the)f(caption-pac)m(k)-5 b(age)44
+b(options)d(\(T)-8 b(ables)p 0.05 1.00 1.00 0.40 TeXcolorcmyk
+42 w(13)p Black 16 w(-)p 0.05 1.00 1.00 0.40 TeXcolorcmyk
+15 w(18)p Black(\))43 b(are)857 3934 y(group)s(ed)29
+b(together)i(on)f(pages)h(73-75)g(to)g(facilitate)i(con)m(v)m(enien)m
+(t)f(reference.)41 b(The)29 b(exam-)857 4047 y(ples)i(are)f(group)s(ed)
+g(together)h(in)g(Section)p 0.05 1.00 1.00 0.40 TeXcolorcmyk
+31 w(20.4)p Black 32 w(on)f(page)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 31 w(76)p Black(.)p Black 767 4197 a FK(\210)p
+Black 45 w FQ(Users)22 b(can)h(de\014ne)e(a)i(collection)i(of)d
+(caption)h(options,)h(called)g Fy(c)-5 b(aption)27 b(styles)p
+FQ(.)38 b(The)22 b(en)m(tire)857 4310 y(collection)j(of)e(options)f
+(can)h(b)s(e)f(sp)s(eci\014ed)f(with)h(the)h FM(style=)d
+FQ(option.)39 b(See)23 b(Section)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 23 w(20.5.1)p Black 857 4423 a(on)31 b(page)p
+0.05 1.00 1.00 0.40 TeXcolorcmyk 31 w(84)p Black(.)p
+Black 767 4573 a FK(\210)p Black 45 w FQ(Instead)21 b(of)h(just)f
+(using)g(the)g(built-in)g(option)h(v)-5 b(alues,)24 b(users)c(can)i
+(de\014ne)f(their)g(o)m(wn)g(option)857 4686 y(v)-5 b(alues)31
+b(as)g(describ)s(ed)e(in)h(Section)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 31 w(20.5.2)p Black(.)p Black 630 4764 1332
+4 v 703 4854 a FF(32)768 4885 y FG(V)-6 b(ersion)18 b(3)g(of)h(the)e
+Fs(caption)h FG(pac)n(k)l(age)g(replaces)h(previous)f
+Fs(caption)g FG(v)n(ersions)g(as)g(w)n(ell)h(as)g(the)e
+Fs(caption2)h FG(pac)n(k)l(age.)703 4981 y FF(33)768
+5012 y FG(Although)29 b Fs(caption)g FG(pac)n(k)l(age)g(pro)n(vides)g
+(commands)h(to)f(customize)h(a)g(caption's)g(fon)n(t,)h(not)e(ev)n(ery)
+f(com)n(bi-)630 5104 y(nation)j(of)g(fon)n(t)g(attributes)g
+(necessarily)h(exists)f(in)f(the)h(fon)n(t)g(b)r(eing)f(used.)50
+b(F)-6 b(or)30 b(example,)j(supp)r(ose)e(the)f(user)630
+5195 y(sp)r(eci\014es)i(a)g(fon)n(t)g(with)g(roman)g(family)-6
+b(,)35 b(small)d(caps)h(shap)r(e,)g(and)f(b)r(old)f(series.)54
+b(If)32 b(that)g(com)n(bination)g(is)g(not)630 5286 y(supp)r(orted)23
+b(b)n(y)f(the)h(curren)n(t)g(fon)n(t,)h(then)e(L)1857
+5269 y FF(A)1890 5286 y FG(T)1932 5302 y(E)1976 5286
+y(X)h(ma)n(y)g(instead)h(substitute)e(a)i(fon)n(t)g(with)f(roman)h
+(family)-6 b(,)25 b(uprigh)n(t)630 5378 y(shap)r(e,)h(and)g(b)r(old)f
+(series.)p Black Black 2250 5640 a FQ(69)p Black eop
+end
+%%Page: 70 70
+TeXDict begin 70 69 bop Black 0 TeXcolorgray Black Black
+630 -149 a FB(20.2)112 b(Caption)38 b(Commands)630 23
+y FQ(Section)p 0.05 1.00 1.00 0.40 TeXcolorcmyk 26
+w(17.1)p Black 28 w(on)25 b(page)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 26 w(56)p Black 27 w(describ)s(es)g(the)h
+FM(\\caption)d FQ(command)i(and)g(some)h(customization)i(is)630
+136 y(describ)s(ed)d(in)g(and)g(Section)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 26 w(19)p Black(.)40 b(The)26 b FO(caption)f
+FQ(pac)m(k)-5 b(age)28 b(pro)m(vides)d(man)m(y)h(more)g(customization)
+630 249 y(options.)771 362 y(The)d FO(caption)g FQ(pac)m(k)-5
+b(age)25 b(sligh)m(tly)g(c)m(hanges)f(this)f FM(\\caption)e
+FQ(command)i(and)f(also)i(in)m(tro)s(duces)630 475 y(new)30
+b(v)-5 b(arian)m(ts)31 b(as)g(describ)s(ed)e(in)h(T)-8
+b(able)p 0.05 1.00 1.00 0.40 TeXcolorcmyk 31 w(12)p
+Black(.)42 b(The)29 b(highligh)m(ts)j(include:)p Black
+767 604 a FK(\210)p Black 45 w FQ(The)d FO(caption)g
+FQ(pac)m(k)-5 b(age)31 b(c)m(hanges)f(the)f FM(\\caption)e
+FQ(command)h(suc)m(h)h(that)h(if)f(the)g(optional)857
+704 y(argumen)m(t)i(is)g(sp)s(eci\014ed)e(but)h(empt)m(y)p
+Black Black 1162 836 a FN(\\caption[]{captio)o(n)38 b(text})857
+982 y FQ(then)30 b(no)h(en)m(try)f(is)h(made)f(in)g(the)h(list)g(of)f
+(\014gures/tables)h(for)f(that)h(caption.)p Black 767
+1131 a FK(\210)p Black 45 w FQ(The)23 b(new)i FM(\\caption*)c
+FQ(command)i(displa)m(ys)h(the)g(caption)g(without)g(a)g(caption)h(lab)
+s(el)f(and)857 1244 y(without)31 b(en)m(try)f(in)g(the)h(list)g(of)f
+(tables.)p Black 767 1380 a FK(\210)p Black 45 w FQ(The)g(new)h
+FM(\\captionof)c FQ(command)j(allo)m(ws)h(a)g(particular)f(t)m(yp)s(e)g
+(of)h(caption)f(to)h(b)s(e)f(used)857 1479 y(an)m(ywhere:)39
+b(\014gure)27 b(en)m(vironmen)m(t,)i(table)f(en)m(vironmen)m(t,)h(or)e
+(elsewhere)g(in)g(a)h(do)s(cumen)m(t.)857 1579 y(F)-8
+b(or)31 b(example)p Black Black 1119 1712 a FN(\\begin{figure})1293
+1811 y(....)1293 1911 y(\\captionof{table})o([L)o(is)o(t)38
+b(of)k(Tables)f(Text]{Table)f(Caption})1119 2010 y(\\end{figure})857
+2156 y FQ(pro)s(duces)29 b(a)i(T)-8 b(able)31 b(caption)g(inside)f(a)h
+(\014gure)f(en)m(vironmen)m(t.)41 b(This)30 b(is)g(useful)g(for)p
+Black 941 2320 a(1.)p Black 46 w(Placing)50 b(a)f(table)g(and)f
+(\014gure)g(side-b)m(y-side)h(as)g(describ)s(ed)e(in)h(Section)p
+0.05 1.00 1.00 0.40 TeXcolorcmyk 50 w(30)p Black 49
+w(on)1057 2433 y(page)p 0.05 1.00 1.00 0.40 TeXcolorcmyk
+31 w(109)p Black(\).)p Black 941 2562 a(2.)p Black 46
+w(Constructing)30 b(marginal)i(\014gures)d(\(see)i(Section)p
+0.05 1.00 1.00 0.40 TeXcolorcmyk 32 w(22)p Black 31
+w(on)f(page)p 0.05 1.00 1.00 0.40 TeXcolorcmyk 31
+w(89)p Black(\).)p Black 941 2690 a(3.)p Black 46 w(Constructing)g
+(non-\015oating)i(\014gures)d(\(see)i(Section)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 32 w(21)p Black 31 w(on)f(page)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 31 w(87)p Black(\).)857 2854 y(Note)h(that)g(the)f
+FM(\\captionof)d FQ(should)i(alw)m(a)m(ys)i(b)s(e)f(used)f(inside)g
+(some)h(t)m(yp)s(e)g(of)h(en)m(viron-)857 2967 y(men)m(t)k(\(suc)m(h)g
+(as)f(minipage\))i(to)f(a)m(v)m(oid)h(page)f(breaks)f(o)s(ccurring)g(b)
+s(et)m(w)m(een)h(the)g(caption)857 3080 y(and)30 b(the)h(\015oat)g(con)
+m(ten)m(ts.)630 3352 y FB(20.3)112 b(Customizing)39 b(Captions)f(with)f
+(Caption)h(Command)630 3524 y FQ(As)29 b(men)m(tioned)h(earlier)g(in)e
+(Section)p 0.05 1.00 1.00 0.40 TeXcolorcmyk 30 w(20.1)p
+Black 31 w(on)h(page)p 0.05 1.00 1.00 0.40 TeXcolorcmyk
+29 w(69)p Black(,)i(the)e FO(caption)g FQ(pac)m(k)-5
+b(age)31 b(allo)m(ws)f(the)g(user)630 3637 y(to)41 b(customize)h(the)e
+(caption)h(fon)m(t,)j(spacing,)f(lab)s(el,)g(and)d(format.)71
+b(The)39 b(options)i(\(listed)g(in)630 3749 y(T)-8 b(ables)p
+0.05 1.00 1.00 0.40 TeXcolorcmyk 31 w(13)p Black 16
+w(-)p 0.05 1.00 1.00 0.40 TeXcolorcmyk 15 w(18)p Black(\))32
+b(can)f(b)s(e)e(sp)s(eci\014ed)h(in)g(either)h(of)f(t)m(w)m(o)i(w)m(a)m
+(ys:)p Black 630 3931 a FL(usepac)m(k)-6 b(age)36 b(options)p
+Black 857 4067 a FM(\\usepackage[options]{capt)o(ion})c
+FQ(where)39 b FM([options])d FQ(are)j(an)m(y)h(com)m(bination)g(of)857
+4167 y(options)31 b(sp)s(eci\014ed)f(in)g(T)-8 b(able)p
+0.05 1.00 1.00 0.40 TeXcolorcmyk 31 w(13)p Black(.)41
+b(F)-8 b(or)31 b(example)p Black Black 1075 4338 a FN
+(\\usepackage[margi)o(n=)o(10p)o(t,)o(fo)o(nt=)o(sm)o(all)o(,l)o(ab)o
+(elf)o(on)o(t=b)o(f])o({ca)o(pt)o(io)o(n})857 4523 y
+FQ(causes)36 b(all)g(caption)h(margins)e(to)h(b)s(e)f(inden)m(ted)g(b)m
+(y)g(an)h(additional)g(10pt)g(on)g(b)s(oth)e(left)857
+4636 y(and)k(righ)m(t)g(sides,)i(with)e(the)g(en)m(tire)h(caption)g
+(\(lab)s(el)f(and)g(text\))h(ha)m(ving)g(a)f(small)g(fon)m(t)857
+4749 y(size)31 b(and)f(the)h(lab)s(el)g(ha)m(ving)f(a)h(b)s(old)f(fon)m
+(t)h(series.)p Black 630 4934 a FL(captionsetup)k(command)p
+Black 857 5070 a FQ(The)d(command)g FM(\\captionsetup{options})27
+b FQ(causes)32 b(sp)s(eci\014ed)g(options)h(to)g(b)s(e)e(in)i(ef-)857
+5170 y(fect)j(for)e(the)h(remaining)f(en)m(vironmen)m(t.)54
+b(\(A)35 b FM(\\captionsetup)c FQ(command)j(in)g(a)h(do)s(cu-)857
+5269 y(men)m(t's)c(pream)m(ble)g(e\013ects)h(the)e(en)m(tire)h(do)s
+(cumen)m(t.\))41 b(F)-8 b(or)32 b(example)p Black Black
+1075 5441 a FN(\\captionsetup{mar)o(gi)o(n=1)o(0p)o(t,)o(fon)o(t=)o
+(sma)o(ll)o(,l)o(abe)o(lf)o(ont)o(=b)o(f})p Black 2250
+5640 a FQ(70)p Black eop end
+%%Page: 71 71
+TeXDict begin 71 70 bop Black 0 TeXcolorgray Black Black
+Black 2295 5441 a
+ gsave currentpoint currentpoint translate 90 neg rotate neg exch neg
+exch translate
+ 2295 5441 a Black 4217 4001 a FQ(T)-8
+b(able)31 b(12:)p 0 TeXcolorgray Black 42 w(caption)g(pac)m(k)-5
+b(age)32 b(caption)g(Commands)p 2295 4129 5681 4 v 2295
+4242 4 113 v 2348 4208 a(Command)p 4618 4242 V 1913 w(Description)p
+7972 4242 V 2295 4246 5681 4 v 2295 4266 V 2295 4491
+4 226 v 2348 4345 a FM(\\caption{)p Fn(h)p Fy(c)-5 b(aption)32
+b(text)9 b Fn(i)p FM(})p 4618 4491 V 1304 w FQ(Uses)38
+b Fn(h)p Fy(c)-5 b(aption)40 b(text)9 b Fn(i)38 b FQ(for)f(b)s(oth)f
+(\014gure/table)i(caption)h(and)d(for)h(List)h(of)f(Figures/T)-8
+b(ables.)4671 4458 y Fy(\(Same)34 b(b)-5 b(ehavior)33
+b(as)h(without)g Fk(caption)e Fy(p)-5 b(ackage\).)p 7972
+4491 V 2295 4495 5681 4 v 2295 4721 4 226 v 2348 4574
+a FM(\\caption[)p Fn(h)p Fy(list)31 b(entry)8 b Fn(i)p
+FM(]{)p Fn(h)p Fy(c)-5 b(aption)35 b(text)9 b Fn(i)p
+FM(})p 4618 4721 V 773 w FQ(Uses)45 b Fn(h)p Fy(c)-5
+b(aption)49 b(text)9 b Fn(i)45 b FQ(for)g(\014gure/table)h(caption)g
+(and)f Fn(h)p Fy(list)h(text)9 b Fn(i)46 b FQ(for)f(en)m(try)g(in)g
+(List)g(of)4671 4687 y(Figures/T)-8 b(ables.)42 b Fy(\(Same)34
+b(b)-5 b(ehavior)34 b(as)f(without)h Fk(caption)e Fy(p)-5
+b(ackage\).)p 7972 4721 V 2295 4724 5681 4 v 2295 4950
+4 226 v 2348 4803 a FM(\\caption[)28 b(]{)p Fn(h)p Fy(c)-5
+b(aption)34 b(text)9 b Fn(i)p FM(})p 4618 4950 V 1178
+w FQ(Uses)39 b Fn(h)p Fy(c)-5 b(aption)42 b(text)9 b
+Fn(i)39 b FQ(for)f(\014gure/table)i(caption)f(and)f(creates)i
+Fy(no)45 b FQ(en)m(try)39 b(in)f(List)h(of)f(Fig-)4671
+4916 y(ures/T)-8 b(ables.)p 7972 4950 V 2295 4953 5681
+4 v 2295 5179 4 226 v 2348 5032 a FM(\\caption*{)p Fn(h)p
+Fy(c)j(aption)32 b(text)9 b Fn(i)p FM(})p 4618 5179 V
+1256 w FQ(Uses)34 b Fn(h)p Fy(c)-5 b(aption)38 b(text)9
+b Fn(i)34 b FQ(for)f(\014gure/table)i(caption)g(but)e(do)s(es)g(not)h
+(include)g(caption)g(lab)s(el)h(or)4671 5145 y(separator)c(\(see)g
+(Figure)p 0.05 1.00 1.00 0.40 TeXcolorcmyk 31 w(16)p
+Black(\).)42 b(No)31 b(en)m(try)g(is)f(generated)i(for)e(the)g(List)h
+(of)f(Figures/T)-8 b(ables.)p 7972 5179 V 2295 5182 5681
+4 v 2295 5747 4 565 v 2348 5261 a FM(\\captionof{)p Fn(h)p
+Fy(\015o)j(at)32 b(typ)-5 b(e)7 b Fn(i)p FM(}[)p Fn(h)p
+Fy(list)34 b(entry)8 b Fn(i)p FM(]{)p Fn(h)p Fy(c)-5
+b(aption)35 b(text)9 b Fn(i)p FM(})p 4618 5747 V 142
+w FQ(If)30 b Fn(h)p Fy(\015o)-5 b(at)35 b(typ)-5 b(e)7
+b Fn(i)31 b FQ(is)g FM(figure)e FQ(then)h(Figure)h(caption)g(and)f(en)m
+(try)g(in)g(List)h(of)g(Figures)f(is)h(gener-)4671 5374
+y(ated,)f(ev)m(en)g(if)f(the)g FM(\\captionof)e FQ(command)i(is)g(lo)s
+(cated)h(outside)f(of)h(a)f(\014gure)g(en)m(vironmen)m(t.)4671
+5487 y(Lik)m(ewise,)k(if)e Fn(h)p Fy(\015o)-5 b(at)35
+b(typ)-5 b(e)7 b Fn(i)32 b FQ(is)g FM(table)d FQ(then)i(Figure)h
+(caption)g(and)e(en)m(try)h(in)g(List)h(of)f(T)-8 b(able)31
+b(is)4671 5600 y(generated,)g(ev)m(en)g(if)e(the)h FM(\\captionof)d
+FQ(command)j(is)f(lo)s(cated)i(outside)f(of)g(a)g(table)h(en)m(viron-)
+4671 5713 y(men)m(t.)p 7972 5747 V 2295 5750 5681 4 v
+2295 6202 4 452 v 2348 5829 a FM(\\captionof*{)p Fn(h)p
+Fy(\015o)-5 b(at)32 b(typ)-5 b(e)7 b Fn(i)p FM(}{)p Fn(h)p
+Fy(c)-5 b(aption)35 b(text)9 b Fn(i)p FM(})p 4618 6202
+V 625 w FQ(Similar)28 b(to)g FM(\\captionof)c FQ(command,)29
+b(the)e Fn(h)p Fy(\015o)-5 b(at)32 b(typ)-5 b(e)7 b Fn(i)29
+b FQ(sp)s(ecies)f(whether)e(a)i(\014gure)f(or)h(table)4671
+5942 y(caption)43 b(is)g(generated.)78 b(Similar)43 b(to)g
+FM(\\caption*)d FQ(command,)45 b FM(\\captionof*)40 b
+FQ(command)4671 6055 y(uses)35 b Fn(h)p Fy(c)-5 b(aption)39
+b(text)9 b Fn(i)36 b FQ(for)f(\014gure/table)h(caption)g(but)e(do)s(es)
+h(not)h(include)f(caption)h(lab)s(el)g(or)4671 6168 y(separator)31
+b(\(see)g(Figure)p 0.05 1.00 1.00 0.40 TeXcolorcmyk
+31 w(16)p Black(\).)42 b(No)31 b(en)m(try)g(is)f(generated)i(for)e(the)
+g(List)h(of)f(Figures/T)-8 b(ables.)p 7972 6202 V 2295
+6205 5681 4 v 2295 6431 4 226 v 2348 6284 a FM(\\ContinuedFloat)p
+4618 6431 V 1603 w FQ(Allo)m(ws)26 b(m)m(ultiple)f FM(\\caption)d
+FQ(command)i(to)h(share)f(same)h(\014gure)f(n)m(um)m(b)s(er.)37
+b(See)25 b(Section)p 0.05 1.00 1.00 0.40 TeXcolorcmyk
+25 w(32.3)p Black 4671 6397 a(on)30 b(page)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 31 w(114)p Black 32 w(and)g(Section)p
+0.05 1.00 1.00 0.40 TeXcolorcmyk 31 w(33)p Black 31
+w(on)h(page)p 0.05 1.00 1.00 0.40 TeXcolorcmyk 31
+w(116)p Black(.)p 7972 6431 V 2295 6434 5681 4 v Black
+2295 5441 a
+ currentpoint grestore moveto
+ 2295 5441 a Black Black 2250 5640 a FQ(71)p
+Black eop end
+%%Page: 72 72
+TeXDict begin 72 71 bop Black 0 TeXcolorgray Black Black
+857 -149 a FQ(causes)29 b(all)h(subsequen)m(t)e(caption)h(in)f(the)h
+(curren)m(t)g(en)m(vironmen)m(t)g(to)g(b)s(e)f(inden)m(ted)h(b)m(y)f
+(an)857 -36 y(additional)i(10pt)g(on)f(b)s(oth)f(left)i(and)e(righ)m(t)
+i(sides,)f(with)g(the)g(en)m(tire)h(caption)g(\(lab)s(el)g(and)857
+77 y(text\))i(ha)m(ving)f(a)g(small)g(fon)m(t)f(size)i(and)d(the)i(lab)
+s(el)g(ha)m(ving)g(a)f(b)s(old)g(fon)m(t)h(series.)857
+227 y(T)-8 b(able)p 0.05 1.00 1.00 0.40 TeXcolorcmyk
+31 w(13)p Black 31 w(describ)s(es)30 b(the)h FM(\\captionsetup)26
+b FQ(and)k FM(\\clearcaptionsetup)c FQ(commands.)630
+465 y(The)41 b FM(\\captionsetup)d FQ(command)j(has)g(t)m(w)m(o)i(adv)
+-5 b(an)m(tages)44 b(o)m(v)m(er)e(sp)s(ecifying)g(options)g(in)f(the)
+630 578 y FM(\\usepackage)27 b FQ(command)p Black 767
+721 a FK(\210)p Black 45 w FQ(The)k FM(\\captionsetup)d
+FQ(command)j(has)g(optional)h(argumen)m(ts)g(that)f(cause)h(the)g
+(options)857 833 y(to)f(apply)f(to)h(just)f(\014gures)g(or)g(just)g
+(tables.)p Black 767 970 a FK(\210)p Black 45 w FQ(The)j
+FM(\\captionsetup)c FQ(can)k(c)m(hange)h(the)g(settings)g(for)e(an)h
+(individual)f(\014gure)h(or)g(table.)857 1070 y(F)-8
+b(or)31 b(example:)p Black Black 988 1204 a FN(\\begin{figure})1119
+1303 y(...)1119 1403 y(\\captionsetup{ju)o(st)o(ifi)o(ca)o(ti)o(on=)o
+(ce)o(nte)o(ri)o(ng)o(})1119 1503 y(\\caption{This)38
+b(is)43 b(the)f(Caption)f(Text})988 1602 y(\\end{figure})857
+1749 y FQ(causes)32 b(the)g(captions)h(to)g(b)s(e)e(cen)m(tered)h(for)g
+(this)g(\014gure)f Fy(only)41 b FQ(but)31 b(do)s(es)g(not)h(a\013ect)i
+(an)m(y)857 1862 y(other)d(\014gure.)630 2005 y(While)25
+b(the)g FM(\\captionsetup)c FQ(can)k(b)s(e)f(used)g(to)h(customize)h(a)
+f(single)h(caption,)g(this)f(is)g(generally)630 2118
+y(considered)31 b(bad)f(st)m(yle.)43 b(In)30 b(general,)i(a)g(user)e
+(should)g(issue)g FM(\\captionsetup)d FQ(commands)k(the)630
+2231 y(pream)m(ble)g(and)e(a)m(v)m(oid)j(using)f FM(\\captionsetup)c
+FQ(within)j(the)h(do)s(cumen)m(t.)p Black 2250 5640 a(72)p
+Black eop end
+%%Page: 73 73
+TeXDict begin 73 72 bop Black 0 TeXcolorgray Black Black
+Black 1111 227 a FQ(T)-8 b(able)31 b(13:)p 0 TeXcolorgray
+Black 41 w(Caption)g(Setup)f(Commands)f(from)h(Caption)g(P)m(ac)m(k)-5
+b(age)p Black Black -120 355 4081 4 v -120 468 4 113
+v -67 434 a(Command)p 2003 468 V 1713 w(Description)p
+3957 468 V -120 472 4081 4 v -120 491 V -120 604 4 113
+v -67 571 a FM(\\captionsetup[)p Fn(h)p Fy(\015o)g(at)31
+b(typ)-5 b(e)7 b Fn(i)p FM(]{)p Fn(h)p Fy(options)g Fn(i)p
+FM(})p 2003 604 V 511 w FQ(Set)30 b(caption)i(attributes)p
+3957 604 V -120 717 V -67 683 a Fy(Examples)148 b FM(\\captionsetup{)p
+Fn(h)p Fy(options)7 b Fn(i)p FM(})p 2003 717 V 522 w
+FQ(options)30 b(apply)g(to)i(all)f(captions)p 3957 717
+V -120 830 V 453 796 a FM(\\captionsetup[figure]{)p Fn(h)p
+Fy(options)7 b Fn(i)p FM(})p 2003 830 V 138 w FQ(options)30
+b(apply)g(only)h(to)g(\014gure)f(captions)p 3957 830
+V -120 943 V 453 909 a FM(\\captionsetup[table]{)p Fn(h)p
+Fy(options)7 b Fn(i)p FM(})p 2003 943 V 186 w FQ(options)30
+b(apply)g(only)h(to)g(table)g(captions)p 3957 943 V -120
+946 4081 4 v -120 1059 4 113 v -67 1025 a FM(\\clearcaptionsetup{)p
+Fn(h)p Fy(\015o)-5 b(at)30 b(typ)-5 b(e)7 b Fn(i)p FM(})p
+2003 1059 V 729 w FQ(c)m(hanges)31 b(caption)g(attributes)g(to)g
+(defaults)p 3957 1059 V -120 1172 V -67 1138 a Fy(Examples)148
+b FM(\\clearcaptionsetup{figu)o(re})p 2003 1172 V 356
+w FQ(resets)30 b(\014gure)g(captions)h(to)g(ha)m(v)m(e)h(default)f
+(options)p 3957 1172 V -120 1285 V 453 1251 a FM
+(\\clearcaptionsetup{tabl)o(e})p 2003 1285 V 404 w FQ(resets)f(table)i
+(captions)f(to)g(ha)m(v)m(e)h(default)e(options)p 3957
+1285 V -120 1289 4081 4 v 1829 1710 a(T)-8 b(able)31
+b(14:)p 0 TeXcolorgray Black 42 w(F)-8 b(on)m(t)32 b(Options)p
+662 1838 2487 4 v 662 1951 4 113 v 715 1917 a(Option)p
+1242 1951 V 302 w(A\013ected)g(p)s(ortion)p 3145 1951
+V 662 1954 2487 4 v 662 1974 V 662 2200 4 226 v 715 2053
+a FM(font=)p 1242 2200 V 340 w FQ(A\013ects)37 b(en)m(tire)h(caption)f
+(\(caption)g(lab)s(el,)h(separa-)1295 2166 y(tor,)31
+b(and)f(caption)h(text\).)p 3145 2200 V 662 2204 2487
+4 v 662 2316 4 113 v 715 2283 a FM(labelfont=)p 1242
+2316 V 100 w FQ(A\013ects)g(only)g(caption)g(lab)s(el)g(and)f
+(separator)p 3145 2316 V 662 2320 2487 4 v 662 2433 4
+113 v 715 2399 a FM(textfont=)p 1242 2433 V 148 w FQ(A\013ects)h(only)g
+(caption)g(text)p 3145 2433 V 662 2436 2487 4 v 1529
+2823 a(T)-8 b(able)31 b(15:)p 0 TeXcolorgray Black 42
+w(P)m(ossible)g(F)-8 b(on)m(t)32 b(Option)e(V)-8 b(alues)p
+328 2952 3184 4 v 328 3065 4 113 v 381 3031 a(Action)p
+1230 3065 V 638 w FM(Option)46 b(Value)p 1906 3065 V
+102 w FQ(Description)p 3509 3065 V 328 3068 3184 4 v
+328 3088 V 328 3314 4 226 v 381 3167 a(Use)31 b(all)g(fon)m(t)g
+(defaults)p 1230 3314 V 103 w FM(default)p 1906 3314
+V 340 w FQ(Changes)20 b(fon)m(t)h(family)-8 b(,)24 b(shap)s(e,)e
+(series,)h(and)1959 3280 y(size)31 b(to)g(defaults)p
+3509 3314 V 328 3317 3184 4 v 328 3430 4 113 v 381 3396
+a(Sp)s(ecify)f(fon)m(t)h(family)p 1230 3430 V 152 w FM(rm)p
+1906 3430 V 580 w FQ(roman)f(fon)m(t)h(family)h Fy(\(default\))p
+3509 3430 V 328 3543 V 1230 3543 V 1283 3509 a FM(sf)p
+1906 3543 V 580 w FO(san)e(sa)m(rif)f(font)i(family)p
+3509 3543 V 328 3656 V 1230 3656 V 1283 3622 a FM(tt)p
+1906 3656 V 580 w(typewriter)45 b(font)h(family)p 3509
+3656 V 328 3659 3184 4 v 328 3772 4 113 v 381 3738 a
+FQ(Sp)s(ecify)30 b(fon)m(t)h(shap)s(e)p 1230 3772 V 173
+w FM(up)p 1906 3772 V 580 w FQ(uprigh)m(t)f(fon)m(t)h(shap)s(e)e
+Fy(\(default\))p 3509 3772 V 328 3885 V 1230 3885 V 1283
+3851 a FM(it)p 1906 3885 V 580 w Fy(italic)k(font)g(shap)-5
+b(e)p 3509 3885 V 328 3998 V 1230 3998 V 1283 3964 a
+FM(sl)p 1906 3998 V 580 w Fj(slan)m(ted)31 b(fon)m(t)g(shap)s(e)p
+3509 3998 V 328 4111 V 1230 4111 V 1283 4077 a FM(sc)p
+1906 4111 V 580 w Fv(small)i(caps)g(f)n(ont)g(shape)p
+3509 4111 V 328 4114 3184 4 v 328 4227 4 113 v 381 4193
+a FQ(Sp)s(ecify)d(fon)m(t)h(series)p 1230 4227 V 186
+w FM(md)p 1906 4227 V 580 w FQ(medium)e(fon)m(t)i(series)g
+Fy(\(default\))p 3509 4227 V 328 4340 V 1230 4340 V 1283
+4306 a FM(bf)p 1906 4340 V 580 w FL(b)s(old)k(fon)m(t)g(series)p
+3509 4340 V 328 4343 3184 4 v 328 4456 4 113 v 381 4422
+a FQ(Sp)s(ecify)30 b(fon)m(t)h(size)p 1230 4456 V 258
+w FM(scriptsize)p 1906 4456 V 196 w FP(scriptsize)23
+b(fon)n(t)i(size)p 3509 4456 V 328 4569 V 1230 4569 V
+1283 4535 a FM(footnotesize)p 1906 4569 V 100 w FG(fo)r(otnotesize)j
+(fon)n(t)e(size)p 3509 4569 V 328 4682 V 1230 4682 V
+1283 4648 a FM(small)p 1906 4682 V 436 w Fi(small)h(fon)n(t)h(size)p
+3509 4682 V 328 4795 V 1230 4795 V 1283 4761 a FM(normalsize)p
+1906 4795 V 196 w FQ(normal)i(fon)m(t)h(size)g Fy(\(default\))p
+3509 4795 V 328 4908 V 1230 4908 V 1283 4874 a FM(large)p
+1906 4908 V 436 w FS(large)h(fon)m(t)h(size)p 3509 4908
+V 328 5025 4 117 v 1230 5025 V 1283 4991 a FM(Large)p
+1906 5025 V 436 w Fh(Large)38 b(fon)m(t)f(size)p 3509
+5025 V 328 5028 3184 4 v Black Black 2250 5640 a FQ(73)p
+Black eop end
+%%Page: 74 74
+TeXDict begin 74 73 bop Black 0 TeXcolorgray Black Black
+Black 1369 449 a FQ(T)-8 b(able)31 b(16:)p 0 TeXcolorgray
+Black 41 w(captionsetup)g(V)-8 b(ertical)33 b(Space)e(Options)p
+Black Black -120 577 4081 4 v -120 690 4 113 v -67 656
+a(Keyw)m(ord)p 733 690 V 499 w FM(Value)p 1436 690 V
+463 w FQ(Description)p 3957 690 V -120 693 4081 4 v -120
+713 V -120 1165 4 452 v -67 792 a FM(aboveskip=)p 733
+1165 V 373 w(<amount>)p 1436 1165 V 319 w Fy(\(default)41
+b(is)g(10pt\))j FQ(Sets)39 b(the)g(v)m(ertical)h(spacing)g(b)s(et)m(w)m
+(een)f(the)g(cap-)1489 905 y(tion)j(and)e(the)h(\014gure/table)h(con)m
+(ten)m(ts.)75 b(Normally)-8 b(,)45 b(this)c(space)h(is)1489
+1018 y(placed)35 b(ab)s(o)m(v)m(e)g(the)g(caption,)h(but)e(when)f
+FM(position=top)e FQ(then)j(the)1489 1131 y FM(aboveskip=)28
+b FQ(spacing)i(is)h(placed)g(b)s(elo)m(w)f(the)h(caption.)p
+3957 1165 V -120 1168 4081 4 v -120 1620 4 452 v -67
+1247 a FM(belowskip=)p 733 1620 V 373 w(<amount>)p 1436
+1620 V 319 w Fy(\(default)f(is)e(0pt\))j FQ(Sets)26 b(the)g(v)m
+(ertical)i(spacing)e(in)g(the)g(direction)h(a)m(w)m(a)m(y)1489
+1360 y(from)g(the)g(\014gure/table)g(con)m(ten)m(ts.)42
+b(Normally)-8 b(,)29 b(this)e(space)g(is)g(placed)1489
+1473 y(b)s(elo)m(w)e(the)h(caption,)h(but)d(when)g FM(position=top)e
+FQ(then)j FM(belowskip=)1489 1586 y FQ(spacing)31 b(is)f(placed)h(ab)s
+(o)m(v)m(e)h(the)e(caption.)p 3957 1620 V -120 1623 4081
+4 v -120 1849 4 226 v -67 1702 a FM(position=)p 733 1849
+V 421 w(bottom)p 1436 1849 V 415 w Fy(\(default\))45
+b FQ(Places)d(the)e FM(aboveskip=)e FQ(spacing)j(ab)s(o)m(v)m(e)g(the)g
+(caption)1489 1815 y(and)30 b(the)g FM(belowskip=)e FQ(spacing)j(b)s
+(elo)m(w)f(the)h(caption.)p 3957 1849 V 736 1852 3224
+4 v -120 2075 4 226 v 733 2075 V 786 1928 a FM(top)p
+1436 2075 V 559 w FQ(This)e(caption)i(rev)m(erses)f(the)g
+FM(aboveskip=)d FQ(and)i FM(belowskip=)e FQ(spac-)1489
+2041 y(ings)j(\(to)i(accommo)s(date)g(captions)f(at)g(the)g(top)f(of)h
+(\015oats\).)p 3957 2075 V -120 2078 4081 4 v -120 2417
+4 339 v -67 2157 a FM(parskip=)p 733 2417 V 469 w(<amount>)p
+1436 2417 V 319 w Fy(\(default)c(is)f(0pt\))j FQ(The)23
+b(amoun)m(t)h(of)f(v)m(ertical)j(space)e(inserted)f(b)s(et)m(w)m(een)
+1489 2270 y(a)h(caption's)g(paragraphs.)38 b(\(This)23
+b(option)h(has)f(no)h(e\013ect)h(on)e(captions)1489 2383
+y(with)30 b(only)h(one)f(paragraph\).)p 3957 2417 V -120
+2420 4081 4 v 1246 2841 a(T)-8 b(able)31 b(17:)p 0 TeXcolorgray
+Black 41 w(captionsetup)g(Lab)s(el)f(and)g(Separator)h(Options)p
+-120 2970 V -120 3083 4 113 v -67 3049 a(Keyw)m(ord)p
+733 3083 V 499 w FM(Value)p 1436 3083 V 463 w FQ(Description)p
+3957 3083 V -120 3086 4081 4 v -120 3106 V -120 3332
+4 226 v -67 3185 a FM(labelformat=)p 733 3332 V 277 w(default)p
+1436 3332 V 367 w Fy(\(default\))d FQ(Caption)c(lab)s(el)g(is)g(t)m(yp)
+s(eset)g(as)g(sp)s(eci\014ed)f(in)g(the)h(do)s(cumen)m(t)1489
+3298 y(class.)p 3957 3332 V 736 3335 3224 4 v -120 3558
+4 226 v 733 3558 V 786 3411 a FM(simple)p 1436 3558 V
+415 w FQ(The)38 b(caption)g(lab)s(el)h(is)f(t)m(yp)s(eset)g(as)h(a)f
+(name)g(and)f(a)i(n)m(um)m(b)s(er.)62 b(F)-8 b(or)1489
+3524 y(example)31 b(\\Figure)g(9".)p 3957 3558 V 736
+3561 3224 4 v -120 3671 4 113 v 733 3671 V 786 3637 a
+FM(parens)p 1436 3671 V 415 w FQ(The)21 b(n)m(um)m(b)s(er)e(is)i(t)m
+(yp)s(eset)h(inside)f(paren)m(theses.)38 b(F)-8 b(or)22
+b(example,)i(\\\(9\)".)p 3957 3671 V 736 3674 3224 4
+v -120 4009 4 339 v 733 4009 V 786 3750 a FM(empty)p
+1436 4009 V 463 w FQ(The)h(caption)i(lab)s(el)f(is)g(empt)m(y)g(\(no)g
+(\\Figure",)i(no)e(n)m(um)m(b)s(er\).)38 b(This)25 b(is)1489
+3863 y(usually)34 b(used)f(with)h FM(labelsep=none)d
+FQ(to)k(also)g(eliminate)h(the)e(cap-)1489 3975 y(tion)d(separator.)p
+3957 4009 V -120 4013 4081 4 v -120 4126 4 113 v -67
+4092 a FM(labelsep=)p 733 4126 V 421 w(colon)p 1436 4126
+V 463 w Fy(\(default\))k FQ(The)30 b(caption)h(separator)g(is)f(a)h
+(colon)h(and)d(a)i(space)p 3957 4126 V 736 4129 3224
+4 v -120 4238 4 113 v 733 4238 V 786 4205 a FM(period)p
+1436 4238 V 415 w FQ(The)f(caption)h(separator)g(is)g(a)f(p)s(erio)s(d)
+f(and)h(a)h(space)p 3957 4238 V 736 4242 3224 4 v -120
+4351 4 113 v 733 4351 V 786 4317 a FM(space)p 1436 4351
+V 463 w FQ(The)f(caption)h(separator)g(is)g(a)f(single)h(space)p
+3957 4351 V 736 4355 3224 4 v -120 4464 4 113 v 733 4464
+V 786 4430 a FM(quad)p 1436 4464 V 511 w FQ(The)f(caption)h(separator)g
+(is)g(a)f FM(\\quad)p 3957 4464 V 736 4468 3224 4 v -120
+4577 4 113 v 733 4577 V 786 4543 a(newline)p 1436 4577
+V 367 w FQ(The)g(caption)h(separator)g(is)g(a)f FM(\\newline)p
+3957 4577 V 736 4581 3224 4 v -120 4803 4 226 v 733 4803
+V 786 4656 a(none)p 1436 4803 V 511 w FQ(No)106 b(caption)h(separator.)
+267 b(Usually)106 b(used)f(only)h(with)1489 4769 y FM
+(labelformat=empty)p 3957 4803 V -120 4806 4081 4 v Black
+Black 2250 5640 a FQ(74)p Black eop end
+%%Page: 75 75
+TeXDict begin 75 74 bop Black 0 TeXcolorgray Black Black
+Black 1429 677 a FQ(T)-8 b(able)31 b(18:)p 0 TeXcolorgray
+Black 41 w(captionsetup)g(F)-8 b(ormatting)33 b(Options)p
+Black Black -120 805 4081 4 v -120 918 4 113 v -67 884
+a(Keyw)m(ord)p 733 918 V 499 w FM(Value)p 1436 918 V
+463 w FQ(Description)p 3957 918 V -120 922 4081 4 v -120
+942 V -120 1055 4 113 v -67 1021 a FM(format=)p 733 1055
+V 517 w(plain)p 1436 1055 V 463 w Fy(\(default\))i FQ(Captions)30
+b(are)h(t)m(yp)s(eset)g(as)g(normal)f(paragraphs.)p 3957
+1055 V 736 1058 3224 4 v -120 1506 4 452 v 733 1506 V
+786 1134 a FM(hang)p 1436 1506 V 511 w FQ(The)20 b(caption's)i(2nd)e
+(and)h(subsequen)m(t)f(lines)h(are)g(inden)m(ted.)37
+b(It)21 b(gener-)1489 1246 y(ally)i(causes)g(the)f(\014rst)g(c)m
+(haracter)h(of)g(the)f(2nd)g(line)g(to)h(b)s(e)f(horizon)m(tally)1489
+1359 y(aligned)k(with)f(the)g(\014rst)g(c)m(haracter)i(of)e(the)h
+(caption)g(text)g(on)f(the)h(\014rst)1489 1472 y(line.)p
+3957 1506 V -120 1509 4081 4 v -120 1622 4 113 v -67
+1589 a FM(justification=)p 733 1622 V 181 w(justified)p
+1436 1622 V 271 w Fy(\(default\))35 b FQ(Caption)30 b(is)h(t)m(yp)s
+(eset)g(as)g(a)f(regular)h(paragraph.)p 3957 1622 V 736
+1626 3224 4 v -120 1735 4 113 v 733 1735 V 786 1701 a
+FM(centerlast)p 1436 1735 V 223 w FQ(Last)g(line)g(of)f(caption)h(is)g
+(horizon)m(tally)h(cen)m(tered.)p 3957 1735 V 736 1739
+3224 4 v -120 1848 4 113 v 733 1848 V 786 1814 a FM(centerfirst)p
+1436 1848 V 175 w FQ(First)f(line)f(of)h(caption)g(is)g(horizon)m
+(tally)h(cen)m(tered.)p 3957 1848 V 736 1852 3224 4 v
+-120 1961 4 113 v 733 1961 V 786 1927 a FM(centering)p
+1436 1961 V 271 w FQ(Eac)m(h)f(line)g(of)f(caption)i(is)e(horizon)m
+(tally)i(cen)m(tered.)p 3957 1961 V 736 1964 3224 4 v
+-120 2187 4 226 v 733 2187 V 786 2040 a FM(Centering)p
+1436 2187 V 271 w FQ(Same)c(as)g FM(centering)d FQ(except)k(the)f(T)
+2783 2060 y(E)2833 2040 y(X)g(w)m(ord-breaking)g(algorithm)1489
+2153 y(is)i(used.)p 3957 2187 V 736 2190 3224 4 v -120
+2300 4 113 v 733 2300 V 786 2266 a FM(raggedright)p 1436
+2300 V 175 w FQ(Eac)m(h)h(line)g(is)f(left-justi\014ed,)h(lea)m(ving)h
+(a)f(ragged)g(righ)m(t)g(margin.)p 3957 2300 V 736 2303
+3224 4 v -120 2526 4 226 v 733 2526 V 786 2379 a FM(RaggedRight)p
+1436 2526 V 175 w FQ(Same)42 b(as)g FM(raggedright)c
+FQ(except)43 b(the)f(T)2948 2398 y(E)2998 2379 y(X)f(w)m(ord-breaking)h
+(algo-)1489 2492 y(rithm)30 b(is)g(used.)p 3957 2526
+V 736 2529 3224 4 v -120 2639 4 113 v 733 2639 V 786
+2605 a FM(raggedleft)p 1436 2639 V 223 w FQ(Eac)m(h)h(line)g(is)f(righ)
+m(t-justi\014ed,)h(lea)m(ving)h(a)f(ragged)g(left)g(margin.)p
+3957 2639 V 736 2642 3224 4 v -120 2864 4 226 v 733 2864
+V 786 2718 a FM(RaggedLeft)p 1436 2864 V 223 w FQ(Same)21
+b(as)g FM(raggedleft)d FQ(except)k(the)g(T)2797 2737
+y(E)2847 2718 y(X)f(w)m(ord-breaking)g(algorithm)1489
+2831 y(is)30 b(used.)p 3957 2864 V -120 2868 4081 4 v
+-120 3094 4 226 v -67 2947 a FM(indentation=)p 733 3094
+V 277 w(<amount>)p 1436 3094 V 319 w Fy(\(default)f(is)f(0pt\))j
+FQ(Amoun)m(t)25 b(of)h Fy(additional)38 b FQ(inden)m(tation)26
+b(for)f(the)h(cap-)1489 3060 y(tion's)31 b(2nd)f(and)g(subsequen)m(t)f
+(lines.)p 3957 3094 V -120 3097 4081 4 v -120 3661 4
+565 v -67 3176 a FM(hangindent=)p 733 3661 V 325 w(<amount>)p
+1436 3661 V 319 w Fy(\(default)52 b(is)e(0pt\))55 b FQ(Amoun)m(t)50
+b(of)h Fy(additional)62 b FQ(inden)m(tation)51 b(for)f(the)1489
+3289 y(2nd)c(and)f(subsequen)m(t)h(lines)h(of)f Fy(e)-5
+b(ach)54 b FQ(paragraph)46 b(in)g(a)h(caption.)1489 3402
+y(Note)d FM(hangindent=)39 b FQ(do)s(es)j(not)h(apply)f(to)i(the)e
+(\014rst)g(line)h(of)g(eac)m(h)1489 3515 y(paragraph.)59
+b(\(If)36 b(a)h(caption)g(con)m(tains)h(only)f(one)f(paragraph,)i(then)
+1489 3628 y FM(hangindent=)27 b FQ(and)j FM(indentation=)d
+FQ(are)k(equiv)-5 b(alen)m(t.\))p 3957 3661 V -120 3665
+4081 4 v -120 3891 4 226 v -67 3744 a FM(margin=)p 733
+3891 V 517 w(<amount>)p 1436 3891 V 319 w Fy(\(default)31
+b(is)f(0pt\))i FQ(Both)d(left)f(and)f(righ)m(t)i(margins)e(are)h
+(brough)m(t)g(in)f(b)m(y)1489 3857 y(sp)s(eci\014ed)j(amoun)m(t.)p
+3957 3891 V -120 3894 4081 4 v -120 4233 4 339 v -67
+3973 a FM(width=)p 733 4233 V 565 w(<amount>)p 1436 4233
+V 319 w FQ(Sets)21 b(caption)g(width)e(\(left)j(and)e(righ)m(t)h
+(margins)f(are)h(brough)m(t)f(in)g(equal)1489 4086 y(amoun)m(ts\).)51
+b(If)34 b(b)s(oth)e FM(margin=)g FQ(and)h FM(width=)f
+FQ(v)-5 b(alues)34 b(are)g(sp)s(eci\014ed,)1489 4199
+y(the)d(last)g(option)g(sp)s(eci\014ed)e(applies.)p 3957
+4233 V -120 4236 4081 4 v -120 4462 4 226 v -67 4315
+a FM(singlelinecheck=)p 733 4462 V 85 w(true)p 1436 4462
+V 511 w Fy(\(default\))36 b FQ(If)31 b(the)h(caption)g(\014ts)g(on)f(a)
+h(single)g(line,)h(then)e(the)h(caption)1489 4428 y(is)e(cen)m(tered)i
+(regardless)f(of)37 b FM(justification=)27 b FQ(v)-5
+b(alue.)p 3957 4462 V 736 4465 3224 4 v -120 4575 4 113
+v 733 4575 V 786 4541 a FM(false)p 1436 4575 V 463 w
+FQ(F)d(ormat)30 b(of)37 b FM(justification=)25 b FQ(is)k(applied)g(to)h
+(single)f(line)h(captions.)p 3957 4575 V -120 4578 4081
+4 v Black Black 2250 5640 a(75)p Black eop end
+%%Page: 76 76
+TeXDict begin 76 75 bop Black 0 TeXcolorgray Black Black
+630 -149 a FB(20.4)112 b(Caption)38 b(P)m(ac)m(k)-6 b(age)38
+b(Examples)630 23 y FL(20.4.1)106 b(Caption)34 b(P)m(ac)m(k)-6
+b(age)36 b(F)-9 b(on)m(t)35 b(Options)630 195 y FQ(T)-8
+b(able)p 0.05 1.00 1.00 0.40 TeXcolorcmyk 43 w(14)p
+Black 43 w(sho)m(ws)42 b(the)g(three)h(options)f(the)h
+FO(caption)f FQ(pac)m(k)-5 b(age)44 b(pro)m(vides)e(for)g(customizing)i
+(a)630 307 y(caption's)34 b(fon)m(ts,)g(where)f(\\lab)s(el",)i
+(\\separator",)g(\\caption)f(text")h(are)e(de\014ned)f(in)h(Figure)p
+0.05 1.00 1.00 0.40 TeXcolorcmyk 33 w(16)p Black 630
+420 a(on)f(page)p 0.05 1.00 1.00 0.40 TeXcolorcmyk
+33 w(76)p Black(.)47 b(These)32 b(three)g(options)h(can)f(c)m(hange)i
+(an)m(y)e(com)m(bination)i(of)e(fon)m(t)h(family)-8 b(,)33
+b(shap)s(e,)630 533 y(series,)e(and)f(size,)h(as)g(sho)m(wn)f(in)g(T)-8
+b(able)p 0.05 1.00 1.00 0.40 TeXcolorcmyk 31 w(15)p
+Black(.)p Black 927 676 2737 25 v 927 1843 25 1168 v
+1188 995 a Fh(Figure)38 b(14)1188 1053 y Fg(|)p 1225
+1053 169 10 v 169 w({z)p 1468 1053 V 169 w(})1226 1173
+y Fh(Caption)1289 1304 y(Lab)s(el)1752 995 y(:)1694 1030
+y Fg(|{z})1739 1104 y
+ gsave currentpoint currentpoint translate -90 neg rotate neg exch
+neg exch translate
+ 1739 1104 a Fh(Separator)2234 1104
+y
+ currentpoint grestore moveto
+ 2234 1104 a 1863 995 a Fh(Plot)f(of)47 b(T)-10 b(emp)s(erature)37
+b(vs)p Ff(:)h Fh(Time)1863 1053 y Fg(|)p 1900 1053 695
+10 v 695 w({z)p 2669 1053 V 695 w(})2428 1173 y Fh(Caption)2516
+1303 y(T)-10 b(ext)p 3638 1843 25 1168 v 927 1868 2737
+25 v 1187 2038 a FQ(Figure)31 b(16:)p 0 TeXcolorgray
+Black 41 w(De\014nition)g(of)g(Caption)f(Lab)s(el,)h(Separator,)g(T)-8
+b(ext)p Black 630 2320 3331 4 v 630 2560 a FL(F)f(on)m(t)35
+b(Example)g(#1)630 2693 y FQ(The)30 b(command)p Black
+Black 848 2834 a FN(\\captionsetup{fo)o(nt)o(={d)o(ef)o(aul)o(t,)o(Lar)
+o(ge)o(,b)o(f}})848 2934 y(\\caption{This)38 b(is)43
+b(Caption)e(Font)h(Example)e(\\#1})630 3075 y FQ(sets)30
+b(all)h(caption)g(fon)m(t)f(c)m(haracteristics)j(to)e(their)f
+(defaults,)g(then)g(giv)m(es)h(en)m(tire)g(\014gure)e(caption)630
+3175 y(\(lab)s(el,)h(separator,)h(and)e(caption)h(text\))h(Large)f(fon)
+m(t)f(size)i(and)d(b)s(old)h(fon)m(t)h(series,)g(as)g(sho)m(wn)e(in)630
+3274 y(Figure)j(17.)41 b(The)30 b(fon)m(t)h(family)g(and)f(shap)s(e)f
+(remain)i(set)f(to)i(their)e(defaults.)1680 3600 y @beginspecial
+0 @llx 0 @lly 216 @urx 36 @ury 1440 @rwi @setspecial
+%%BeginDocument: short.eps
+%!PS-Adobe-2.0 EPSF-2.0
+%%Title: short.fig
+%%Creator: fig2dev Version 3.2 Patchlevel 4
+%%CreationDate: Sun May 22 21:43:01 2005
+%%For: epstein@linux (Becky Epstein)
+%%BoundingBox: 0 0 216 36
+%%Magnification: 1.0000
+%%EndComments
+/$F2psDict 200 dict def
+$F2psDict begin
+$F2psDict /mtrx matrix put
+/col-1 {0 setgray} bind def
+/col0 {0.000 0.000 0.000 srgb} bind def
+/col1 {0.000 0.000 1.000 srgb} bind def
+/col2 {0.000 1.000 0.000 srgb} bind def
+/col3 {0.000 1.000 1.000 srgb} bind def
+/col4 {1.000 0.000 0.000 srgb} bind def
+/col5 {1.000 0.000 1.000 srgb} bind def
+/col6 {1.000 1.000 0.000 srgb} bind def
+/col7 {1.000 1.000 1.000 srgb} bind def
+/col8 {0.000 0.000 0.560 srgb} bind def
+/col9 {0.000 0.000 0.690 srgb} bind def
+/col10 {0.000 0.000 0.820 srgb} bind def
+/col11 {0.530 0.810 1.000 srgb} bind def
+/col12 {0.000 0.560 0.000 srgb} bind def
+/col13 {0.000 0.690 0.000 srgb} bind def
+/col14 {0.000 0.820 0.000 srgb} bind def
+/col15 {0.000 0.560 0.560 srgb} bind def
+/col16 {0.000 0.690 0.690 srgb} bind def
+/col17 {0.000 0.820 0.820 srgb} bind def
+/col18 {0.560 0.000 0.000 srgb} bind def
+/col19 {0.690 0.000 0.000 srgb} bind def
+/col20 {0.820 0.000 0.000 srgb} bind def
+/col21 {0.560 0.000 0.560 srgb} bind def
+/col22 {0.690 0.000 0.690 srgb} bind def
+/col23 {0.820 0.000 0.820 srgb} bind def
+/col24 {0.500 0.190 0.000 srgb} bind def
+/col25 {0.630 0.250 0.000 srgb} bind def
+/col26 {0.750 0.380 0.000 srgb} bind def
+/col27 {1.000 0.500 0.500 srgb} bind def
+/col28 {1.000 0.630 0.630 srgb} bind def
+/col29 {1.000 0.750 0.750 srgb} bind def
+/col30 {1.000 0.880 0.880 srgb} bind def
+/col31 {1.000 0.840 0.000 srgb} bind def
+
+end
+save
+newpath 0 36 moveto 0 0 lineto 216 0 lineto 216 36 lineto closepath clip newpath
+-2.5 42.5 translate
+1 -1 scale
+
+/cp {closepath} bind def
+/ef {eofill} bind def
+/gr {grestore} bind def
+/gs {gsave} bind def
+/sa {save} bind def
+/rs {restore} bind def
+/l {lineto} bind def
+/m {moveto} bind def
+/rm {rmoveto} bind def
+/n {newpath} bind def
+/s {stroke} bind def
+/sh {show} bind def
+/slc {setlinecap} bind def
+/slj {setlinejoin} bind def
+/slw {setlinewidth} bind def
+/srgb {setrgbcolor} bind def
+/rot {rotate} bind def
+/sc {scale} bind def
+/sd {setdash} bind def
+/ff {findfont} bind def
+/sf {setfont} bind def
+/scf {scalefont} bind def
+/sw {stringwidth} bind def
+/tr {translate} bind def
+/tnt {dup dup currentrgbcolor
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb}
+ bind def
+/shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul
+ 4 -2 roll mul srgb} bind def
+/$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def
+/$F2psEnd {$F2psEnteredState restore end} def
+
+$F2psBegin
+10 setmiterlimit
+0 slj 0 slc
+ 0.06000 0.06000 sc
+%
+% Fig objects follow
+%
+%
+% here starts figure with depth 0
+% Polyline
+30.000 slw
+n 3600 675 m 75 675 l 75 150 l 3600 150 l
+ cp gs col-1 s gr
+/Times-Bold ff 360.00 scf sf
+1800 525 m
+gs 1 -1 sc (Graphic) dup sw pop 2 div neg 0 rm col-1 sh gr
+% here ends figure;
+$F2psEnd
+rs
+showpage
+
+%%EndDocument
+ @endspecial 969 3796 a FD(Figure)45 b(17:)p 0 TeXcolorgray
+Black 61 w(This)f(is)h(Caption)h(F)-11 b(on)l(t)45 b(Example)h(#1)630
+4012 y FQ(Note)i(that)g(the)f(ab)s(o)m(v)m(e)h(example)f(a\013ects)h(b)
+s(oth)e(\014gure)h(and)f(table)i(captions.)90 b(Adding)47
+b(a)630 4111 y FM([figures])28 b FQ(optional)j(argumen)m(t)g(to)g(the)g
+FM(\\captionsetup)c FQ(command)p Black Black 848 4253
+a FN(\\captionsetup[fi)o(gu)o(res)o(]{)o(fon)o(t=)o({de)o(fa)o(ul)o
+(t,L)o(ar)o(ge,)o(bf)o(}})630 4407 y FQ(causes)k(only)f(the)h(\014gure)
+f(captions)h(to)g(b)s(e)f(mo)s(di\014ed.)p 630 4573 V
+630 4813 a FL(F)-9 b(on)m(t)35 b(Example)g(#2)630 4946
+y FQ(The)30 b(command)p Black Black 848 5087 a FN(\\captionsetup{fo)o
+(nt)o(=de)o(fa)o(ult)o(,)37 b(textfont={scripts)o(iz)o(e,s)o(f})o(})848
+5187 y(\\caption{This)h(is)43 b(Caption)e(Font)h(Example)e(\\#2})p
+Black 2250 5640 a FQ(76)p Black eop end
+%%Page: 77 77
+TeXDict begin 77 76 bop Black 0 TeXcolorgray Black Black
+630 -149 a FQ(sets)39 b(all)h(\014gure-caption)f(fon)m(t)g(c)m
+(haracteristics)i(to)f(their)f(defaults,)i(then)d(giv)m(es)i(the)f
+(caption)630 -36 y(text)31 b(scriptsize)h(fon)m(t)e(size)i(and)d(san)i
+(serif)f(fon)m(t)h(family)-8 b(,)31 b(as)g(sho)m(wn)e(in)i(Figure)f
+(18.)1680 290 y @beginspecial 0 @llx 0 @lly 216 @urx
+36 @ury 1440 @rwi @setspecial
+%%BeginDocument: short.eps
+%!PS-Adobe-2.0 EPSF-2.0
+%%Title: short.fig
+%%Creator: fig2dev Version 3.2 Patchlevel 4
+%%CreationDate: Sun May 22 21:43:01 2005
+%%For: epstein@linux (Becky Epstein)
+%%BoundingBox: 0 0 216 36
+%%Magnification: 1.0000
+%%EndComments
+/$F2psDict 200 dict def
+$F2psDict begin
+$F2psDict /mtrx matrix put
+/col-1 {0 setgray} bind def
+/col0 {0.000 0.000 0.000 srgb} bind def
+/col1 {0.000 0.000 1.000 srgb} bind def
+/col2 {0.000 1.000 0.000 srgb} bind def
+/col3 {0.000 1.000 1.000 srgb} bind def
+/col4 {1.000 0.000 0.000 srgb} bind def
+/col5 {1.000 0.000 1.000 srgb} bind def
+/col6 {1.000 1.000 0.000 srgb} bind def
+/col7 {1.000 1.000 1.000 srgb} bind def
+/col8 {0.000 0.000 0.560 srgb} bind def
+/col9 {0.000 0.000 0.690 srgb} bind def
+/col10 {0.000 0.000 0.820 srgb} bind def
+/col11 {0.530 0.810 1.000 srgb} bind def
+/col12 {0.000 0.560 0.000 srgb} bind def
+/col13 {0.000 0.690 0.000 srgb} bind def
+/col14 {0.000 0.820 0.000 srgb} bind def
+/col15 {0.000 0.560 0.560 srgb} bind def
+/col16 {0.000 0.690 0.690 srgb} bind def
+/col17 {0.000 0.820 0.820 srgb} bind def
+/col18 {0.560 0.000 0.000 srgb} bind def
+/col19 {0.690 0.000 0.000 srgb} bind def
+/col20 {0.820 0.000 0.000 srgb} bind def
+/col21 {0.560 0.000 0.560 srgb} bind def
+/col22 {0.690 0.000 0.690 srgb} bind def
+/col23 {0.820 0.000 0.820 srgb} bind def
+/col24 {0.500 0.190 0.000 srgb} bind def
+/col25 {0.630 0.250 0.000 srgb} bind def
+/col26 {0.750 0.380 0.000 srgb} bind def
+/col27 {1.000 0.500 0.500 srgb} bind def
+/col28 {1.000 0.630 0.630 srgb} bind def
+/col29 {1.000 0.750 0.750 srgb} bind def
+/col30 {1.000 0.880 0.880 srgb} bind def
+/col31 {1.000 0.840 0.000 srgb} bind def
+
+end
+save
+newpath 0 36 moveto 0 0 lineto 216 0 lineto 216 36 lineto closepath clip newpath
+-2.5 42.5 translate
+1 -1 scale
+
+/cp {closepath} bind def
+/ef {eofill} bind def
+/gr {grestore} bind def
+/gs {gsave} bind def
+/sa {save} bind def
+/rs {restore} bind def
+/l {lineto} bind def
+/m {moveto} bind def
+/rm {rmoveto} bind def
+/n {newpath} bind def
+/s {stroke} bind def
+/sh {show} bind def
+/slc {setlinecap} bind def
+/slj {setlinejoin} bind def
+/slw {setlinewidth} bind def
+/srgb {setrgbcolor} bind def
+/rot {rotate} bind def
+/sc {scale} bind def
+/sd {setdash} bind def
+/ff {findfont} bind def
+/sf {setfont} bind def
+/scf {scalefont} bind def
+/sw {stringwidth} bind def
+/tr {translate} bind def
+/tnt {dup dup currentrgbcolor
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb}
+ bind def
+/shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul
+ 4 -2 roll mul srgb} bind def
+/$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def
+/$F2psEnd {$F2psEnteredState restore end} def
+
+$F2psBegin
+10 setmiterlimit
+0 slj 0 slc
+ 0.06000 0.06000 sc
+%
+% Fig objects follow
+%
+%
+% here starts figure with depth 0
+% Polyline
+30.000 slw
+n 3600 675 m 75 675 l 75 150 l 3600 150 l
+ cp gs col-1 s gr
+/Times-Bold ff 360.00 scf sf
+1800 525 m
+gs 1 -1 sc (Graphic) dup sw pop 2 div neg 0 rm col-1 sh gr
+% here ends figure;
+$F2psEnd
+rs
+showpage
+
+%%EndDocument
+ @endspecial 1574 486 a(Figure)h(18:)p 0 TeXcolorgray
+Black 41 w Fe(This)24 b(is)g(Caption)h(F)n(ont)g(Example)f(#2)p
+630 783 3331 4 v 630 1024 a FL(F)-9 b(on)m(t)35 b(Example)g(#3)630
+1156 y FQ(The)30 b(command)p Black Black 848 1298 a FN
+(\\captionsetup{fo)o(nt)o(={d)o(ef)o(aul)o(t,)o(Lar)o(ge)o(},)37
+b(labelfont=bf,)h(textfont=sl})848 1397 y(\\caption{This)g(is)43
+b(Caption)e(Font)h(Example)e(\\#3})630 1552 y FQ(sets)28
+b(all)g(\014gure-caption)g(fon)m(t)g(c)m(haracteristics)i(to)e(their)f
+(defaults,)i(then)e(giv)m(es)h(the)g(en)m(tire)g(cap-)630
+1665 y(tion)i(\(lab)s(el,)g(separator,)g(and)e(caption)i(text\))h
+(Large)e(fon)m(t)h(size,)g(giv)m(es)g(only)g(the)f(caption)h(lab)s(el)
+630 1777 y(and)d(separator)i(b)s(old)e(fon)m(t)h(series,)h(and)e(giv)m
+(es)i(only)f(the)g(caption)g(text)h(slan)m(ted)g(fon)m(t)f(shap)s(e,)g
+(as)630 1890 y(sho)m(wn)i(in)g(Figure)h(19.)1680 2216
+y @beginspecial 0 @llx 0 @lly 216 @urx 36 @ury 1440 @rwi
+@setspecial
+%%BeginDocument: short.eps
+%!PS-Adobe-2.0 EPSF-2.0
+%%Title: short.fig
+%%Creator: fig2dev Version 3.2 Patchlevel 4
+%%CreationDate: Sun May 22 21:43:01 2005
+%%For: epstein@linux (Becky Epstein)
+%%BoundingBox: 0 0 216 36
+%%Magnification: 1.0000
+%%EndComments
+/$F2psDict 200 dict def
+$F2psDict begin
+$F2psDict /mtrx matrix put
+/col-1 {0 setgray} bind def
+/col0 {0.000 0.000 0.000 srgb} bind def
+/col1 {0.000 0.000 1.000 srgb} bind def
+/col2 {0.000 1.000 0.000 srgb} bind def
+/col3 {0.000 1.000 1.000 srgb} bind def
+/col4 {1.000 0.000 0.000 srgb} bind def
+/col5 {1.000 0.000 1.000 srgb} bind def
+/col6 {1.000 1.000 0.000 srgb} bind def
+/col7 {1.000 1.000 1.000 srgb} bind def
+/col8 {0.000 0.000 0.560 srgb} bind def
+/col9 {0.000 0.000 0.690 srgb} bind def
+/col10 {0.000 0.000 0.820 srgb} bind def
+/col11 {0.530 0.810 1.000 srgb} bind def
+/col12 {0.000 0.560 0.000 srgb} bind def
+/col13 {0.000 0.690 0.000 srgb} bind def
+/col14 {0.000 0.820 0.000 srgb} bind def
+/col15 {0.000 0.560 0.560 srgb} bind def
+/col16 {0.000 0.690 0.690 srgb} bind def
+/col17 {0.000 0.820 0.820 srgb} bind def
+/col18 {0.560 0.000 0.000 srgb} bind def
+/col19 {0.690 0.000 0.000 srgb} bind def
+/col20 {0.820 0.000 0.000 srgb} bind def
+/col21 {0.560 0.000 0.560 srgb} bind def
+/col22 {0.690 0.000 0.690 srgb} bind def
+/col23 {0.820 0.000 0.820 srgb} bind def
+/col24 {0.500 0.190 0.000 srgb} bind def
+/col25 {0.630 0.250 0.000 srgb} bind def
+/col26 {0.750 0.380 0.000 srgb} bind def
+/col27 {1.000 0.500 0.500 srgb} bind def
+/col28 {1.000 0.630 0.630 srgb} bind def
+/col29 {1.000 0.750 0.750 srgb} bind def
+/col30 {1.000 0.880 0.880 srgb} bind def
+/col31 {1.000 0.840 0.000 srgb} bind def
+
+end
+save
+newpath 0 36 moveto 0 0 lineto 216 0 lineto 216 36 lineto closepath clip newpath
+-2.5 42.5 translate
+1 -1 scale
+
+/cp {closepath} bind def
+/ef {eofill} bind def
+/gr {grestore} bind def
+/gs {gsave} bind def
+/sa {save} bind def
+/rs {restore} bind def
+/l {lineto} bind def
+/m {moveto} bind def
+/rm {rmoveto} bind def
+/n {newpath} bind def
+/s {stroke} bind def
+/sh {show} bind def
+/slc {setlinecap} bind def
+/slj {setlinejoin} bind def
+/slw {setlinewidth} bind def
+/srgb {setrgbcolor} bind def
+/rot {rotate} bind def
+/sc {scale} bind def
+/sd {setdash} bind def
+/ff {findfont} bind def
+/sf {setfont} bind def
+/scf {scalefont} bind def
+/sw {stringwidth} bind def
+/tr {translate} bind def
+/tnt {dup dup currentrgbcolor
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb}
+ bind def
+/shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul
+ 4 -2 roll mul srgb} bind def
+/$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def
+/$F2psEnd {$F2psEnteredState restore end} def
+
+$F2psBegin
+10 setmiterlimit
+0 slj 0 slc
+ 0.06000 0.06000 sc
+%
+% Fig objects follow
+%
+%
+% here starts figure with depth 0
+% Polyline
+30.000 slw
+n 3600 675 m 75 675 l 75 150 l 3600 150 l
+ cp gs col-1 s gr
+/Times-Bold ff 360.00 scf sf
+1800 525 m
+gs 1 -1 sc (Graphic) dup sw pop 2 div neg 0 rm col-1 sh gr
+% here ends figure;
+$F2psEnd
+rs
+showpage
+
+%%EndDocument
+ @endspecial 1093 2412 a FD(Figure)45 b(19:)p 0 TeXcolorgray
+Black 61 w Fd(This)38 b(is)h(Caption)d(F)-10 b(on)m(t)39
+b(Example)e(#3)p 630 2731 V 630 2871 a FL(20.4.2)106
+b(Caption)34 b(V)-9 b(ertical)35 b(P)m(ac)m(k)-6 b(age)36
+b(Spacing)g(Options)630 3043 y FQ(As)e(their)g(names)g(suggest,)i(the)e
+(space)h(ab)s(o)m(v)m(e)g(the)f(caption)h(is)f(sp)s(eci\014ed)f(b)m(y)h
+(the)g FM(aboveskip)630 3156 y FQ(option)27 b(while)f(the)g(space)g(b)s
+(elo)m(w)h(the)f(caption)h(is)f(sp)s(eci\014ed)f(b)m(y)h(the)h
+FM(belowskip)c FQ(option.)40 b(Ho)m(w-)630 3269 y(ev)m(er,)e(this)d(is)
+g(only)h(the)f(case)i(when)d(the)i(default)f FM(position=bottom)c
+FQ(option)36 b(is)g(used.)54 b(The)630 3382 y FM(position=top)34
+b FQ(option)j(rev)m(erses)g(the)g(meanings)g(of)h(the)f
+FM(aboveskip)d FQ(and)i FM(belowskip)f FQ(op-)630 3494
+y(tions.)41 b(It)29 b(can)g(get)h(confusing)f(if)g(the)g(user)f(has)h
+(customized)h FM(aboveskip)c FQ(and)j FM(belowskip)d
+FQ(for)630 3607 y(a)38 b(top-caption)i(and)e(then)f(w)m(an)m(ts)i(a)g
+(b)s(ottom)f(caption,)j(in)d(whic)m(h)g(case)h(the)f
+FM(position=top)630 3720 y FQ(option)31 b(w)m(ould)f(ha)m(v)m(e)i(to)f
+(b)s(e)e(used)h(to)h(pro)s(duce)e(a)i(b)s(ottom)g(caption.)771
+3833 y(T)-8 b(o)31 b(a)m(v)m(oid)h(confusion,)e(the)h(follo)m(wing)h
+(pro)s(cedure)d(should)g(b)s(e)h(used)p Black 741 3976
+a(1.)p Black 46 w(Think)20 b(of)28 b FM(aboveskip=)17
+b FQ(option)22 b(as)e(the)h(caption/\015oat)i(spacing.)38
+b(That)20 b(is,)j(the)e(space)g(b)s(e-)857 4089 y(t)m(w)m(een)27
+b(the)g(caption)f(and)g(the)g(\015oat)h(con)m(ten)m(ts)g(should)e(b)s
+(e)h(sp)s(eci\014ed)f(in)h(the)g FM(aboveskip=)857 4202
+y FQ(option.)p Black 741 4352 a(2.)p Black 46 w(Think)21
+b(of)30 b FM(belowskip=)19 b FQ(option)k(as)f(the)h(caption/text)h
+(spacing.)39 b(That)22 b(is,)i(the)e(space)h(b)s(e-)857
+4465 y(t)m(w)m(een)f(the)e(caption)h(and)f(the)g(surrounding)e(text)k
+(should)d(b)s(e)h(sp)s(eci\014ed)f(in)h(the)h FM(belowskip=)857
+4578 y FQ(option.)p Black 741 4728 a(3.)p Black 46 w(Use)27
+b FM(position=bottom)c FQ(for)j(captions)i(at)f(the)g(b)s(ottom)g(of)g
+(\015oats.)40 b(Use)27 b FM(position=top)857 4841 y FQ(for)j(captions)i
+(at)f(the)f(top)h(of)f(\015oats.)630 5211 y FL(Caption)k(V)-9
+b(ertical)35 b(Spacing)h(Example)f(#1)630 5344 y FQ(The)28
+b FM(aboveskip=)e FQ(option)j(mo)s(di\014es)e(the)i(spacing)g(ab)s(o)m
+(v)m(e)g(a)g(caption)g(\(the)g(default)g(spacing)g(is)630
+5443 y(10pt\).)42 b(The)30 b(follo)m(wing)h(co)s(de)p
+Black 2250 5640 a(77)p Black eop end
+%%Page: 78 78
+TeXDict begin 78 77 bop Black 0 TeXcolorgray Black Black
+Black Black 848 -149 a FN(\\captionsetup{ab)o(ov)o(esk)o(ip)o(=1c)o(m})
+848 -49 y(\\caption{Vertica)o(l)37 b(Spacing)k(Example)g(\\#1})630
+105 y FQ(causes)31 b(pro)s(duces)e(a)i(1cm)g(spacing)f(ab)s(o)m(v)m(e)i
+(the)e(caption)i(as)e(sho)m(wn)g(in)g(Figure)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 31 w(20)p Black(.)1680 431 y @beginspecial
+0 @llx 0 @lly 216 @urx 36 @ury 1440 @rwi @setspecial
+%%BeginDocument: short.eps
+%!PS-Adobe-2.0 EPSF-2.0
+%%Title: short.fig
+%%Creator: fig2dev Version 3.2 Patchlevel 4
+%%CreationDate: Sun May 22 21:43:01 2005
+%%For: epstein@linux (Becky Epstein)
+%%BoundingBox: 0 0 216 36
+%%Magnification: 1.0000
+%%EndComments
+/$F2psDict 200 dict def
+$F2psDict begin
+$F2psDict /mtrx matrix put
+/col-1 {0 setgray} bind def
+/col0 {0.000 0.000 0.000 srgb} bind def
+/col1 {0.000 0.000 1.000 srgb} bind def
+/col2 {0.000 1.000 0.000 srgb} bind def
+/col3 {0.000 1.000 1.000 srgb} bind def
+/col4 {1.000 0.000 0.000 srgb} bind def
+/col5 {1.000 0.000 1.000 srgb} bind def
+/col6 {1.000 1.000 0.000 srgb} bind def
+/col7 {1.000 1.000 1.000 srgb} bind def
+/col8 {0.000 0.000 0.560 srgb} bind def
+/col9 {0.000 0.000 0.690 srgb} bind def
+/col10 {0.000 0.000 0.820 srgb} bind def
+/col11 {0.530 0.810 1.000 srgb} bind def
+/col12 {0.000 0.560 0.000 srgb} bind def
+/col13 {0.000 0.690 0.000 srgb} bind def
+/col14 {0.000 0.820 0.000 srgb} bind def
+/col15 {0.000 0.560 0.560 srgb} bind def
+/col16 {0.000 0.690 0.690 srgb} bind def
+/col17 {0.000 0.820 0.820 srgb} bind def
+/col18 {0.560 0.000 0.000 srgb} bind def
+/col19 {0.690 0.000 0.000 srgb} bind def
+/col20 {0.820 0.000 0.000 srgb} bind def
+/col21 {0.560 0.000 0.560 srgb} bind def
+/col22 {0.690 0.000 0.690 srgb} bind def
+/col23 {0.820 0.000 0.820 srgb} bind def
+/col24 {0.500 0.190 0.000 srgb} bind def
+/col25 {0.630 0.250 0.000 srgb} bind def
+/col26 {0.750 0.380 0.000 srgb} bind def
+/col27 {1.000 0.500 0.500 srgb} bind def
+/col28 {1.000 0.630 0.630 srgb} bind def
+/col29 {1.000 0.750 0.750 srgb} bind def
+/col30 {1.000 0.880 0.880 srgb} bind def
+/col31 {1.000 0.840 0.000 srgb} bind def
+
+end
+save
+newpath 0 36 moveto 0 0 lineto 216 0 lineto 216 36 lineto closepath clip newpath
+-2.5 42.5 translate
+1 -1 scale
+
+/cp {closepath} bind def
+/ef {eofill} bind def
+/gr {grestore} bind def
+/gs {gsave} bind def
+/sa {save} bind def
+/rs {restore} bind def
+/l {lineto} bind def
+/m {moveto} bind def
+/rm {rmoveto} bind def
+/n {newpath} bind def
+/s {stroke} bind def
+/sh {show} bind def
+/slc {setlinecap} bind def
+/slj {setlinejoin} bind def
+/slw {setlinewidth} bind def
+/srgb {setrgbcolor} bind def
+/rot {rotate} bind def
+/sc {scale} bind def
+/sd {setdash} bind def
+/ff {findfont} bind def
+/sf {setfont} bind def
+/scf {scalefont} bind def
+/sw {stringwidth} bind def
+/tr {translate} bind def
+/tnt {dup dup currentrgbcolor
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb}
+ bind def
+/shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul
+ 4 -2 roll mul srgb} bind def
+/$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def
+/$F2psEnd {$F2psEnteredState restore end} def
+
+$F2psBegin
+10 setmiterlimit
+0 slj 0 slc
+ 0.06000 0.06000 sc
+%
+% Fig objects follow
+%
+%
+% here starts figure with depth 0
+% Polyline
+30.000 slw
+n 3600 675 m 75 675 l 75 150 l 3600 150 l
+ cp gs col-1 s gr
+/Times-Bold ff 360.00 scf sf
+1800 525 m
+gs 1 -1 sc (Graphic) dup sw pop 2 div neg 0 rm col-1 sh gr
+% here ends figure;
+$F2psEnd
+rs
+showpage
+
+%%EndDocument
+ @endspecial 1485 780 a(Figure)h(20:)p 0 TeXcolorgray
+Black 42 w(V)-8 b(ertical)32 b(Spacing)f(Example)f(#1)p
+630 1088 3331 4 v 630 1328 a FL(Caption)k(V)-9 b(ertical)35
+b(Spacing)h(Example)f(#2)630 1474 y FQ(The)22 b(previous)g(example)h
+(sho)m(w)m(ed)f(ho)m(w)g(the)h FM(aboveskip=)c FQ(option)k(mo)s
+(di\014es)f(the)g(spacing)h(ab)s(o)m(v)m(e)630 1587 y(a)45
+b(caption.)85 b(This)44 b(example)i(sho)m(ws)f(ho)m(w)g(the)g
+FM(position=top)c FQ(rev)m(erses)46 b(the)f(meaning)g(of)630
+1700 y FM(aboveskip)28 b FQ(and)i FM(belowskip)p FQ(.)771
+1800 y(The)g(follo)m(wing)i(co)s(de)p Black Black 848
+1941 a FN(\\captionsetup{ab)o(ov)o(esk)o(ip)o(=1c)o(m,)o(pos)o(it)o(io)
+o(n=t)o(op)o(})848 2040 y(\\caption{Vertica)o(l)37 b(Spacing)k(Example)
+g(\\#2})630 2195 y FQ(causes)31 b(pro)s(duces)e(a)i(1cm)g(spacing)f(b)s
+(elo)m(w)h(the)f(caption)i(as)e(sho)m(wn)g(in)g(T)-8
+b(able)p 0.05 1.00 1.00 0.40 TeXcolorcmyk 31 w(19)p
+Black 1504 2400 a(T)g(able)31 b(19:)p 0 TeXcolorgray
+Black 41 w(V)-8 b(ertical)33 b(Spacing)d(Example)h(#2)p
+2142 2681 306 4 v 2142 2794 4 113 v 2196 2760 a(a)p 2291
+2794 V 103 w(b)p 2444 2794 V 2142 2797 306 4 v 2142 2910
+4 113 v 2198 2876 a(c)p 2291 2910 V 106 w(d)p 2444 2910
+V 2142 2914 306 4 v 630 3188 3331 4 v 630 3428 a FL(Caption)j(V)-9
+b(ertical)35 b(Spacing)h(Example)f(#3)630 3574 y FQ(The)25
+b(previous)g(example)h(sho)m(w)m(ed)g(the)g FM(position=top)c
+FQ(rev)m(erses)k(the)g(meaning)g(of)32 b FM(aboveskip)630
+3687 y FQ(and)e FM(belowskip)e FQ(for)i(use)g(in)g(placing)h(a)g
+(caption)g(ab)s(o)m(v)m(e)h(tables.)771 3786 y(If)k(table)h(captions)h
+(will)e(b)s(e)g(placed)h(ab)s(o)m(v)m(e)h(the)e(table)h(while)g(most)g
+(\014gure)e(captions)j(will)630 3886 y(b)s(e)31 b(placed)h(b)s(elo)m(w)
+f(the)h(\014gure,)f(it)h(is)f(con)m(v)m(enien)m(t)j(to)e(mak)m(e)g(the)
+g(top)g(p)s(osition)f(the)h(default)f(for)630 3986 y(table)g(captions)p
+Black Black 848 4127 a FN(\\captionsetup{ab)o(ov)o(esk)o(ip)o(=1c)o(m,)
+o(bel)o(ow)o(sk)o(ip=)o(0p)o(t})848 4226 y(\\captionsetup[fi)o(gu)o
+(re])o({p)o(osi)o(ti)o(on=)o(bo)o(tt)o(om})848 4326 y
+(\\captionsetup[ta)o(bl)o(e]{)o(po)o(sit)o(io)o(n=t)o(op)o(})848
+4426 y(...)848 4525 y(\\caption{Table)38 b(for)k(Vertical)e(Spacing)h
+(Example)g(\\#3})848 4625 y(\\caption{Figure)c(for)43
+b(Vertical)d(Spacing)h(Example)f(\\#3})630 4779 y FQ(causes)c(pro)s
+(duces)f(a)h(1cm)g(spacing)g(b)s(elo)m(w)h(table)f(captions)h(\(as)f
+(sho)m(wn)f(in)h(T)-8 b(able)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 36 w(20)p Black(\))37 b(and)f(a)630 4892
+y(1cm)31 b(spacing)g(ab)s(o)m(v)m(e)g(\014gure)f(captions)h(\(as)g(sho)
+m(wn)f(in)g(Figure)p 0.05 1.00 1.00 0.40 TeXcolorcmyk
+31 w(21)p Black(\).)p Black 2250 5640 a(78)p Black eop
+end
+%%Page: 79 79
+TeXDict begin 79 78 bop Black 0 TeXcolorgray Black Black
+1309 -161 a FQ(T)-8 b(able)31 b(20:)p 0 TeXcolorgray
+Black 42 w(T)-8 b(able)31 b(for)f(V)-8 b(ertical)33 b(Spacing)d
+(Example)h(#3)p 2142 121 306 4 v 2142 234 4 113 v 2196
+200 a(a)p 2291 234 V 103 w(b)p 2444 234 V 2142 237 306
+4 v 2142 350 4 113 v 2198 316 a(c)p 2291 350 V 106 w(d)p
+2444 350 V 2142 353 306 4 v 1695 661 a @beginspecial
+0 @llx 0 @lly 216 @urx 36 @ury 1440 @rwi @setspecial
+%%BeginDocument: short.eps
+%!PS-Adobe-2.0 EPSF-2.0
+%%Title: short.fig
+%%Creator: fig2dev Version 3.2 Patchlevel 4
+%%CreationDate: Sun May 22 21:43:01 2005
+%%For: epstein@linux (Becky Epstein)
+%%BoundingBox: 0 0 216 36
+%%Magnification: 1.0000
+%%EndComments
+/$F2psDict 200 dict def
+$F2psDict begin
+$F2psDict /mtrx matrix put
+/col-1 {0 setgray} bind def
+/col0 {0.000 0.000 0.000 srgb} bind def
+/col1 {0.000 0.000 1.000 srgb} bind def
+/col2 {0.000 1.000 0.000 srgb} bind def
+/col3 {0.000 1.000 1.000 srgb} bind def
+/col4 {1.000 0.000 0.000 srgb} bind def
+/col5 {1.000 0.000 1.000 srgb} bind def
+/col6 {1.000 1.000 0.000 srgb} bind def
+/col7 {1.000 1.000 1.000 srgb} bind def
+/col8 {0.000 0.000 0.560 srgb} bind def
+/col9 {0.000 0.000 0.690 srgb} bind def
+/col10 {0.000 0.000 0.820 srgb} bind def
+/col11 {0.530 0.810 1.000 srgb} bind def
+/col12 {0.000 0.560 0.000 srgb} bind def
+/col13 {0.000 0.690 0.000 srgb} bind def
+/col14 {0.000 0.820 0.000 srgb} bind def
+/col15 {0.000 0.560 0.560 srgb} bind def
+/col16 {0.000 0.690 0.690 srgb} bind def
+/col17 {0.000 0.820 0.820 srgb} bind def
+/col18 {0.560 0.000 0.000 srgb} bind def
+/col19 {0.690 0.000 0.000 srgb} bind def
+/col20 {0.820 0.000 0.000 srgb} bind def
+/col21 {0.560 0.000 0.560 srgb} bind def
+/col22 {0.690 0.000 0.690 srgb} bind def
+/col23 {0.820 0.000 0.820 srgb} bind def
+/col24 {0.500 0.190 0.000 srgb} bind def
+/col25 {0.630 0.250 0.000 srgb} bind def
+/col26 {0.750 0.380 0.000 srgb} bind def
+/col27 {1.000 0.500 0.500 srgb} bind def
+/col28 {1.000 0.630 0.630 srgb} bind def
+/col29 {1.000 0.750 0.750 srgb} bind def
+/col30 {1.000 0.880 0.880 srgb} bind def
+/col31 {1.000 0.840 0.000 srgb} bind def
+
+end
+save
+newpath 0 36 moveto 0 0 lineto 216 0 lineto 216 36 lineto closepath clip newpath
+-2.5 42.5 translate
+1 -1 scale
+
+/cp {closepath} bind def
+/ef {eofill} bind def
+/gr {grestore} bind def
+/gs {gsave} bind def
+/sa {save} bind def
+/rs {restore} bind def
+/l {lineto} bind def
+/m {moveto} bind def
+/rm {rmoveto} bind def
+/n {newpath} bind def
+/s {stroke} bind def
+/sh {show} bind def
+/slc {setlinecap} bind def
+/slj {setlinejoin} bind def
+/slw {setlinewidth} bind def
+/srgb {setrgbcolor} bind def
+/rot {rotate} bind def
+/sc {scale} bind def
+/sd {setdash} bind def
+/ff {findfont} bind def
+/sf {setfont} bind def
+/scf {scalefont} bind def
+/sw {stringwidth} bind def
+/tr {translate} bind def
+/tnt {dup dup currentrgbcolor
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb}
+ bind def
+/shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul
+ 4 -2 roll mul srgb} bind def
+/$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def
+/$F2psEnd {$F2psEnteredState restore end} def
+
+$F2psBegin
+10 setmiterlimit
+0 slj 0 slc
+ 0.06000 0.06000 sc
+%
+% Fig objects follow
+%
+%
+% here starts figure with depth 0
+% Polyline
+30.000 slw
+n 3600 675 m 75 675 l 75 150 l 3600 150 l
+ cp gs col-1 s gr
+/Times-Bold ff 360.00 scf sf
+1800 525 m
+gs 1 -1 sc (Graphic) dup sw pop 2 div neg 0 rm col-1 sh gr
+% here ends figure;
+$F2psEnd
+rs
+showpage
+
+%%EndDocument
+ @endspecial 1272 1010 a(Figure)g(21:)p 0 TeXcolorgray
+Black 42 w(Figure)g(for)f(V)-8 b(ertical)32 b(Spacing)f(Example)f(#3)p
+630 1318 3331 4 v 630 1459 a FL(20.4.3)106 b(Caption)34
+b(P)m(ac)m(k)-6 b(age)36 b(Lab)s(el)f(Options)630 1730
+y(Caption)f(Lab)s(el)h(Example)f(#1)630 1863 y FQ(The)c(follo)m(wing)i
+(co)s(de)p Black Black 848 2004 a FN(\\captionsetup{la)o(be)o(lfo)o(rm)
+o(at=)o(si)o(mpl)o(e})848 2104 y(\\caption{This)38 b(is)43
+b(Caption)e(Label)g(Example)g(\\#1})630 2258 y FQ(de\014ne)31
+b(the)h(lab)s(el)g(format)g(to)g(b)s(e)f FM(simple)p
+FQ(,)f(as)i(sho)m(wn)f(in)h(Figure)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 32 w(22)p Black(.)45 b(The)31 b FM(simple)f
+FQ(format)i(is)630 2371 y(usually)c(the)g(same)g(as)g(the)g
+FM(default)p FQ(,)e(although)j(the)f(do)s(cumen)m(t)f(class)i(could)f
+(de\014ne)f FM(default)630 2484 y FQ(di\013eren)m(tly)-8
+b(.)1680 2809 y @beginspecial 0 @llx 0 @lly 216 @urx
+36 @ury 1440 @rwi @setspecial
+%%BeginDocument: short.eps
+%!PS-Adobe-2.0 EPSF-2.0
+%%Title: short.fig
+%%Creator: fig2dev Version 3.2 Patchlevel 4
+%%CreationDate: Sun May 22 21:43:01 2005
+%%For: epstein@linux (Becky Epstein)
+%%BoundingBox: 0 0 216 36
+%%Magnification: 1.0000
+%%EndComments
+/$F2psDict 200 dict def
+$F2psDict begin
+$F2psDict /mtrx matrix put
+/col-1 {0 setgray} bind def
+/col0 {0.000 0.000 0.000 srgb} bind def
+/col1 {0.000 0.000 1.000 srgb} bind def
+/col2 {0.000 1.000 0.000 srgb} bind def
+/col3 {0.000 1.000 1.000 srgb} bind def
+/col4 {1.000 0.000 0.000 srgb} bind def
+/col5 {1.000 0.000 1.000 srgb} bind def
+/col6 {1.000 1.000 0.000 srgb} bind def
+/col7 {1.000 1.000 1.000 srgb} bind def
+/col8 {0.000 0.000 0.560 srgb} bind def
+/col9 {0.000 0.000 0.690 srgb} bind def
+/col10 {0.000 0.000 0.820 srgb} bind def
+/col11 {0.530 0.810 1.000 srgb} bind def
+/col12 {0.000 0.560 0.000 srgb} bind def
+/col13 {0.000 0.690 0.000 srgb} bind def
+/col14 {0.000 0.820 0.000 srgb} bind def
+/col15 {0.000 0.560 0.560 srgb} bind def
+/col16 {0.000 0.690 0.690 srgb} bind def
+/col17 {0.000 0.820 0.820 srgb} bind def
+/col18 {0.560 0.000 0.000 srgb} bind def
+/col19 {0.690 0.000 0.000 srgb} bind def
+/col20 {0.820 0.000 0.000 srgb} bind def
+/col21 {0.560 0.000 0.560 srgb} bind def
+/col22 {0.690 0.000 0.690 srgb} bind def
+/col23 {0.820 0.000 0.820 srgb} bind def
+/col24 {0.500 0.190 0.000 srgb} bind def
+/col25 {0.630 0.250 0.000 srgb} bind def
+/col26 {0.750 0.380 0.000 srgb} bind def
+/col27 {1.000 0.500 0.500 srgb} bind def
+/col28 {1.000 0.630 0.630 srgb} bind def
+/col29 {1.000 0.750 0.750 srgb} bind def
+/col30 {1.000 0.880 0.880 srgb} bind def
+/col31 {1.000 0.840 0.000 srgb} bind def
+
+end
+save
+newpath 0 36 moveto 0 0 lineto 216 0 lineto 216 36 lineto closepath clip newpath
+-2.5 42.5 translate
+1 -1 scale
+
+/cp {closepath} bind def
+/ef {eofill} bind def
+/gr {grestore} bind def
+/gs {gsave} bind def
+/sa {save} bind def
+/rs {restore} bind def
+/l {lineto} bind def
+/m {moveto} bind def
+/rm {rmoveto} bind def
+/n {newpath} bind def
+/s {stroke} bind def
+/sh {show} bind def
+/slc {setlinecap} bind def
+/slj {setlinejoin} bind def
+/slw {setlinewidth} bind def
+/srgb {setrgbcolor} bind def
+/rot {rotate} bind def
+/sc {scale} bind def
+/sd {setdash} bind def
+/ff {findfont} bind def
+/sf {setfont} bind def
+/scf {scalefont} bind def
+/sw {stringwidth} bind def
+/tr {translate} bind def
+/tnt {dup dup currentrgbcolor
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb}
+ bind def
+/shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul
+ 4 -2 roll mul srgb} bind def
+/$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def
+/$F2psEnd {$F2psEnteredState restore end} def
+
+$F2psBegin
+10 setmiterlimit
+0 slj 0 slc
+ 0.06000 0.06000 sc
+%
+% Fig objects follow
+%
+%
+% here starts figure with depth 0
+% Polyline
+30.000 slw
+n 3600 675 m 75 675 l 75 150 l 3600 150 l
+ cp gs col-1 s gr
+/Times-Bold ff 360.00 scf sf
+1800 525 m
+gs 1 -1 sc (Graphic) dup sw pop 2 div neg 0 rm col-1 sh gr
+% here ends figure;
+$F2psEnd
+rs
+showpage
+
+%%EndDocument
+ @endspecial 1375 3005 a(Figure)30 b(22:)p 0 TeXcolorgray
+Black 42 w(This)g(is)g(Caption)g(Lab)s(el)h(Example)f(#1)p
+630 3313 V 630 3553 a FL(Caption)k(Lab)s(el)h(Example)f(#2)630
+3686 y FQ(The)c(follo)m(wing)i(co)s(de)p Black Black
+848 3827 a FN(\\captionsetup{la)o(be)o(lfo)o(rm)o(at=)o(pa)o(ren)o(s})
+848 3927 y(\\caption{This)38 b(is)43 b(Caption)e(Label)g(Example)g
+(\\#2})630 4081 y FQ(de\014ne)c(the)g(lab)s(el)h(format)g(to)g(b)s(e)e
+FM(parens)p FQ(,)i(as)g(sho)m(wn)e(in)h(Figure)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 38 w(23)p Black(.)63 b(This)36 b(format)i(has)f(no)630
+4194 y(Figure)31 b(name,)g(and)e(instead)i(just)f(has)g(the)g(\014gure)
+g(n)m(um)m(b)s(er)f(surrounded)f(b)m(y)i(paren)m(theses.)1680
+4520 y @beginspecial 0 @llx 0 @lly 216 @urx 36 @ury 1440
+@rwi @setspecial
+%%BeginDocument: short.eps
+%!PS-Adobe-2.0 EPSF-2.0
+%%Title: short.fig
+%%Creator: fig2dev Version 3.2 Patchlevel 4
+%%CreationDate: Sun May 22 21:43:01 2005
+%%For: epstein@linux (Becky Epstein)
+%%BoundingBox: 0 0 216 36
+%%Magnification: 1.0000
+%%EndComments
+/$F2psDict 200 dict def
+$F2psDict begin
+$F2psDict /mtrx matrix put
+/col-1 {0 setgray} bind def
+/col0 {0.000 0.000 0.000 srgb} bind def
+/col1 {0.000 0.000 1.000 srgb} bind def
+/col2 {0.000 1.000 0.000 srgb} bind def
+/col3 {0.000 1.000 1.000 srgb} bind def
+/col4 {1.000 0.000 0.000 srgb} bind def
+/col5 {1.000 0.000 1.000 srgb} bind def
+/col6 {1.000 1.000 0.000 srgb} bind def
+/col7 {1.000 1.000 1.000 srgb} bind def
+/col8 {0.000 0.000 0.560 srgb} bind def
+/col9 {0.000 0.000 0.690 srgb} bind def
+/col10 {0.000 0.000 0.820 srgb} bind def
+/col11 {0.530 0.810 1.000 srgb} bind def
+/col12 {0.000 0.560 0.000 srgb} bind def
+/col13 {0.000 0.690 0.000 srgb} bind def
+/col14 {0.000 0.820 0.000 srgb} bind def
+/col15 {0.000 0.560 0.560 srgb} bind def
+/col16 {0.000 0.690 0.690 srgb} bind def
+/col17 {0.000 0.820 0.820 srgb} bind def
+/col18 {0.560 0.000 0.000 srgb} bind def
+/col19 {0.690 0.000 0.000 srgb} bind def
+/col20 {0.820 0.000 0.000 srgb} bind def
+/col21 {0.560 0.000 0.560 srgb} bind def
+/col22 {0.690 0.000 0.690 srgb} bind def
+/col23 {0.820 0.000 0.820 srgb} bind def
+/col24 {0.500 0.190 0.000 srgb} bind def
+/col25 {0.630 0.250 0.000 srgb} bind def
+/col26 {0.750 0.380 0.000 srgb} bind def
+/col27 {1.000 0.500 0.500 srgb} bind def
+/col28 {1.000 0.630 0.630 srgb} bind def
+/col29 {1.000 0.750 0.750 srgb} bind def
+/col30 {1.000 0.880 0.880 srgb} bind def
+/col31 {1.000 0.840 0.000 srgb} bind def
+
+end
+save
+newpath 0 36 moveto 0 0 lineto 216 0 lineto 216 36 lineto closepath clip newpath
+-2.5 42.5 translate
+1 -1 scale
+
+/cp {closepath} bind def
+/ef {eofill} bind def
+/gr {grestore} bind def
+/gs {gsave} bind def
+/sa {save} bind def
+/rs {restore} bind def
+/l {lineto} bind def
+/m {moveto} bind def
+/rm {rmoveto} bind def
+/n {newpath} bind def
+/s {stroke} bind def
+/sh {show} bind def
+/slc {setlinecap} bind def
+/slj {setlinejoin} bind def
+/slw {setlinewidth} bind def
+/srgb {setrgbcolor} bind def
+/rot {rotate} bind def
+/sc {scale} bind def
+/sd {setdash} bind def
+/ff {findfont} bind def
+/sf {setfont} bind def
+/scf {scalefont} bind def
+/sw {stringwidth} bind def
+/tr {translate} bind def
+/tnt {dup dup currentrgbcolor
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb}
+ bind def
+/shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul
+ 4 -2 roll mul srgb} bind def
+/$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def
+/$F2psEnd {$F2psEnteredState restore end} def
+
+$F2psBegin
+10 setmiterlimit
+0 slj 0 slc
+ 0.06000 0.06000 sc
+%
+% Fig objects follow
+%
+%
+% here starts figure with depth 0
+% Polyline
+30.000 slw
+n 3600 675 m 75 675 l 75 150 l 3600 150 l
+ cp gs col-1 s gr
+/Times-Bold ff 360.00 scf sf
+1800 525 m
+gs 1 -1 sc (Graphic) dup sw pop 2 div neg 0 rm col-1 sh gr
+% here ends figure;
+$F2psEnd
+rs
+showpage
+
+%%EndDocument
+ @endspecial 1339 4716 a(Figure)h(\(23\):)p 0 TeXcolorgray
+Black 42 w(This)f(is)g(Caption)h(Lab)s(el)f(Example)h(#2)p
+630 5024 V Black 2250 5640 a(79)p Black eop end
+%%Page: 80 80
+TeXDict begin 80 79 bop Black 0 TeXcolorgray Black Black
+630 -149 a FL(Caption)34 b(Lab)s(el)h(Example)f(#3)630
+-16 y FQ(The)c(follo)m(wing)i(co)s(de)p Black Black 848
+123 a FN(\\captionsetup{la)o(be)o(lfo)o(rm)o(at=)o(em)o(pty)o(,)37
+b(labelsep=none})848 222 y(\\caption{This)h(is)43 b(Caption)e(Label)g
+(Example)g(\\#3})630 374 y FQ(de\014ne)30 b(the)i(lab)s(el)f(format)g
+(to)h(b)s(e)f FM(empty)p FQ(,)f(as)h(sho)m(wn)g(in)f(Figure)p
+0.05 1.00 1.00 0.40 TeXcolorcmyk 32 w(23)p Black(.)44
+b(Since)31 b(no)g(\014gure)f(n)m(um)m(b)s(er)630 487
+y(is)g(displa)m(y)m(ed,)i(it)f(is)f(di\016cult)g(to)h(determine)g(that)
+g(it)g(is)f(Figure)p 0.05 1.00 1.00 0.40 TeXcolorcmyk
+31 w(23)p Black(.)1680 811 y @beginspecial 0 @llx 0 @lly
+216 @urx 36 @ury 1440 @rwi @setspecial
+%%BeginDocument: short.eps
+%!PS-Adobe-2.0 EPSF-2.0
+%%Title: short.fig
+%%Creator: fig2dev Version 3.2 Patchlevel 4
+%%CreationDate: Sun May 22 21:43:01 2005
+%%For: epstein@linux (Becky Epstein)
+%%BoundingBox: 0 0 216 36
+%%Magnification: 1.0000
+%%EndComments
+/$F2psDict 200 dict def
+$F2psDict begin
+$F2psDict /mtrx matrix put
+/col-1 {0 setgray} bind def
+/col0 {0.000 0.000 0.000 srgb} bind def
+/col1 {0.000 0.000 1.000 srgb} bind def
+/col2 {0.000 1.000 0.000 srgb} bind def
+/col3 {0.000 1.000 1.000 srgb} bind def
+/col4 {1.000 0.000 0.000 srgb} bind def
+/col5 {1.000 0.000 1.000 srgb} bind def
+/col6 {1.000 1.000 0.000 srgb} bind def
+/col7 {1.000 1.000 1.000 srgb} bind def
+/col8 {0.000 0.000 0.560 srgb} bind def
+/col9 {0.000 0.000 0.690 srgb} bind def
+/col10 {0.000 0.000 0.820 srgb} bind def
+/col11 {0.530 0.810 1.000 srgb} bind def
+/col12 {0.000 0.560 0.000 srgb} bind def
+/col13 {0.000 0.690 0.000 srgb} bind def
+/col14 {0.000 0.820 0.000 srgb} bind def
+/col15 {0.000 0.560 0.560 srgb} bind def
+/col16 {0.000 0.690 0.690 srgb} bind def
+/col17 {0.000 0.820 0.820 srgb} bind def
+/col18 {0.560 0.000 0.000 srgb} bind def
+/col19 {0.690 0.000 0.000 srgb} bind def
+/col20 {0.820 0.000 0.000 srgb} bind def
+/col21 {0.560 0.000 0.560 srgb} bind def
+/col22 {0.690 0.000 0.690 srgb} bind def
+/col23 {0.820 0.000 0.820 srgb} bind def
+/col24 {0.500 0.190 0.000 srgb} bind def
+/col25 {0.630 0.250 0.000 srgb} bind def
+/col26 {0.750 0.380 0.000 srgb} bind def
+/col27 {1.000 0.500 0.500 srgb} bind def
+/col28 {1.000 0.630 0.630 srgb} bind def
+/col29 {1.000 0.750 0.750 srgb} bind def
+/col30 {1.000 0.880 0.880 srgb} bind def
+/col31 {1.000 0.840 0.000 srgb} bind def
+
+end
+save
+newpath 0 36 moveto 0 0 lineto 216 0 lineto 216 36 lineto closepath clip newpath
+-2.5 42.5 translate
+1 -1 scale
+
+/cp {closepath} bind def
+/ef {eofill} bind def
+/gr {grestore} bind def
+/gs {gsave} bind def
+/sa {save} bind def
+/rs {restore} bind def
+/l {lineto} bind def
+/m {moveto} bind def
+/rm {rmoveto} bind def
+/n {newpath} bind def
+/s {stroke} bind def
+/sh {show} bind def
+/slc {setlinecap} bind def
+/slj {setlinejoin} bind def
+/slw {setlinewidth} bind def
+/srgb {setrgbcolor} bind def
+/rot {rotate} bind def
+/sc {scale} bind def
+/sd {setdash} bind def
+/ff {findfont} bind def
+/sf {setfont} bind def
+/scf {scalefont} bind def
+/sw {stringwidth} bind def
+/tr {translate} bind def
+/tnt {dup dup currentrgbcolor
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb}
+ bind def
+/shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul
+ 4 -2 roll mul srgb} bind def
+/$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def
+/$F2psEnd {$F2psEnteredState restore end} def
+
+$F2psBegin
+10 setmiterlimit
+0 slj 0 slc
+ 0.06000 0.06000 sc
+%
+% Fig objects follow
+%
+%
+% here starts figure with depth 0
+% Polyline
+30.000 slw
+n 3600 675 m 75 675 l 75 150 l 3600 150 l
+ cp gs col-1 s gr
+/Times-Bold ff 360.00 scf sf
+1800 525 m
+gs 1 -1 sc (Graphic) dup sw pop 2 div neg 0 rm col-1 sh gr
+% here ends figure;
+$F2psEnd
+rs
+showpage
+
+%%EndDocument
+ @endspecial 0 TeXcolorgray Black 1596 1007 a(This)g(is)g(Caption)h
+(Lab)s(el)f(Example)h(#3)p 630 1314 3331 4 v 630 1554
+a FL(Caption)j(Lab)s(el)h(Example)f(#4)630 1687 y FQ(The)c(follo)m
+(wing)i(co)s(de)p Black Black 848 1825 a FN(\\captionsetup{la)o(be)o
+(lfo)o(rm)o(at=)o(de)o(fau)o(lt)o(,)37 b(labelsep=period})848
+1925 y(\\caption{This)h(is)43 b(Caption)e(Label)g(Example)g(\\#4})630
+2076 y FQ(c)m(hanges)35 b(the)f(caption)h(separator)f(from)g(the)g
+(default)g(colon)h(to)g(a)f(p)s(erio)s(d,)g(as)g(sho)m(wn)f(in)h(Fig-)
+630 2189 y(ure)p 0.05 1.00 1.00 0.40 TeXcolorcmyk
+30 w(25)p Black(.)1680 2496 y @beginspecial 0 @llx 0
+@lly 216 @urx 36 @ury 1440 @rwi @setspecial
+%%BeginDocument: short.eps
+%!PS-Adobe-2.0 EPSF-2.0
+%%Title: short.fig
+%%Creator: fig2dev Version 3.2 Patchlevel 4
+%%CreationDate: Sun May 22 21:43:01 2005
+%%For: epstein@linux (Becky Epstein)
+%%BoundingBox: 0 0 216 36
+%%Magnification: 1.0000
+%%EndComments
+/$F2psDict 200 dict def
+$F2psDict begin
+$F2psDict /mtrx matrix put
+/col-1 {0 setgray} bind def
+/col0 {0.000 0.000 0.000 srgb} bind def
+/col1 {0.000 0.000 1.000 srgb} bind def
+/col2 {0.000 1.000 0.000 srgb} bind def
+/col3 {0.000 1.000 1.000 srgb} bind def
+/col4 {1.000 0.000 0.000 srgb} bind def
+/col5 {1.000 0.000 1.000 srgb} bind def
+/col6 {1.000 1.000 0.000 srgb} bind def
+/col7 {1.000 1.000 1.000 srgb} bind def
+/col8 {0.000 0.000 0.560 srgb} bind def
+/col9 {0.000 0.000 0.690 srgb} bind def
+/col10 {0.000 0.000 0.820 srgb} bind def
+/col11 {0.530 0.810 1.000 srgb} bind def
+/col12 {0.000 0.560 0.000 srgb} bind def
+/col13 {0.000 0.690 0.000 srgb} bind def
+/col14 {0.000 0.820 0.000 srgb} bind def
+/col15 {0.000 0.560 0.560 srgb} bind def
+/col16 {0.000 0.690 0.690 srgb} bind def
+/col17 {0.000 0.820 0.820 srgb} bind def
+/col18 {0.560 0.000 0.000 srgb} bind def
+/col19 {0.690 0.000 0.000 srgb} bind def
+/col20 {0.820 0.000 0.000 srgb} bind def
+/col21 {0.560 0.000 0.560 srgb} bind def
+/col22 {0.690 0.000 0.690 srgb} bind def
+/col23 {0.820 0.000 0.820 srgb} bind def
+/col24 {0.500 0.190 0.000 srgb} bind def
+/col25 {0.630 0.250 0.000 srgb} bind def
+/col26 {0.750 0.380 0.000 srgb} bind def
+/col27 {1.000 0.500 0.500 srgb} bind def
+/col28 {1.000 0.630 0.630 srgb} bind def
+/col29 {1.000 0.750 0.750 srgb} bind def
+/col30 {1.000 0.880 0.880 srgb} bind def
+/col31 {1.000 0.840 0.000 srgb} bind def
+
+end
+save
+newpath 0 36 moveto 0 0 lineto 216 0 lineto 216 36 lineto closepath clip newpath
+-2.5 42.5 translate
+1 -1 scale
+
+/cp {closepath} bind def
+/ef {eofill} bind def
+/gr {grestore} bind def
+/gs {gsave} bind def
+/sa {save} bind def
+/rs {restore} bind def
+/l {lineto} bind def
+/m {moveto} bind def
+/rm {rmoveto} bind def
+/n {newpath} bind def
+/s {stroke} bind def
+/sh {show} bind def
+/slc {setlinecap} bind def
+/slj {setlinejoin} bind def
+/slw {setlinewidth} bind def
+/srgb {setrgbcolor} bind def
+/rot {rotate} bind def
+/sc {scale} bind def
+/sd {setdash} bind def
+/ff {findfont} bind def
+/sf {setfont} bind def
+/scf {scalefont} bind def
+/sw {stringwidth} bind def
+/tr {translate} bind def
+/tnt {dup dup currentrgbcolor
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb}
+ bind def
+/shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul
+ 4 -2 roll mul srgb} bind def
+/$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def
+/$F2psEnd {$F2psEnteredState restore end} def
+
+$F2psBegin
+10 setmiterlimit
+0 slj 0 slc
+ 0.06000 0.06000 sc
+%
+% Fig objects follow
+%
+%
+% here starts figure with depth 0
+% Polyline
+30.000 slw
+n 3600 675 m 75 675 l 75 150 l 3600 150 l
+ cp gs col-1 s gr
+/Times-Bold ff 360.00 scf sf
+1800 525 m
+gs 1 -1 sc (Graphic) dup sw pop 2 div neg 0 rm col-1 sh gr
+% here ends figure;
+$F2psEnd
+rs
+showpage
+
+%%EndDocument
+ @endspecial 1375 2692 a(Figure)c(25.)p 0 TeXcolorgray
+Black 42 w(This)g(is)g(Caption)g(Lab)s(el)h(Example)f(#4)p
+630 2999 V 630 3238 a FL(Caption)k(Lab)s(el)h(Example)f(#5)630
+3371 y FQ(The)c(follo)m(wing)i(co)s(de)p Black Black
+848 3510 a FN(\\captionsetup{la)o(be)o(lfo)o(rm)o(at=)o(de)o(fau)o(lt)o
+(,)37 b(labelsep=newline})848 3609 y(\\caption{This)h(is)43
+b(Caption)e(Label)g(Example)g(\\#5})630 3761 y FQ(c)m(hanges)31
+b(the)g(caption)g(separator)g(to)g(a)g(newline,)g(as)f(sho)m(wn)g(in)g
+(Figure)p 0.05 1.00 1.00 0.40 TeXcolorcmyk 31 w(25)p
+Black(.)1680 4085 y @beginspecial 0 @llx 0 @lly 216 @urx
+36 @ury 1440 @rwi @setspecial
+%%BeginDocument: short.eps
+%!PS-Adobe-2.0 EPSF-2.0
+%%Title: short.fig
+%%Creator: fig2dev Version 3.2 Patchlevel 4
+%%CreationDate: Sun May 22 21:43:01 2005
+%%For: epstein@linux (Becky Epstein)
+%%BoundingBox: 0 0 216 36
+%%Magnification: 1.0000
+%%EndComments
+/$F2psDict 200 dict def
+$F2psDict begin
+$F2psDict /mtrx matrix put
+/col-1 {0 setgray} bind def
+/col0 {0.000 0.000 0.000 srgb} bind def
+/col1 {0.000 0.000 1.000 srgb} bind def
+/col2 {0.000 1.000 0.000 srgb} bind def
+/col3 {0.000 1.000 1.000 srgb} bind def
+/col4 {1.000 0.000 0.000 srgb} bind def
+/col5 {1.000 0.000 1.000 srgb} bind def
+/col6 {1.000 1.000 0.000 srgb} bind def
+/col7 {1.000 1.000 1.000 srgb} bind def
+/col8 {0.000 0.000 0.560 srgb} bind def
+/col9 {0.000 0.000 0.690 srgb} bind def
+/col10 {0.000 0.000 0.820 srgb} bind def
+/col11 {0.530 0.810 1.000 srgb} bind def
+/col12 {0.000 0.560 0.000 srgb} bind def
+/col13 {0.000 0.690 0.000 srgb} bind def
+/col14 {0.000 0.820 0.000 srgb} bind def
+/col15 {0.000 0.560 0.560 srgb} bind def
+/col16 {0.000 0.690 0.690 srgb} bind def
+/col17 {0.000 0.820 0.820 srgb} bind def
+/col18 {0.560 0.000 0.000 srgb} bind def
+/col19 {0.690 0.000 0.000 srgb} bind def
+/col20 {0.820 0.000 0.000 srgb} bind def
+/col21 {0.560 0.000 0.560 srgb} bind def
+/col22 {0.690 0.000 0.690 srgb} bind def
+/col23 {0.820 0.000 0.820 srgb} bind def
+/col24 {0.500 0.190 0.000 srgb} bind def
+/col25 {0.630 0.250 0.000 srgb} bind def
+/col26 {0.750 0.380 0.000 srgb} bind def
+/col27 {1.000 0.500 0.500 srgb} bind def
+/col28 {1.000 0.630 0.630 srgb} bind def
+/col29 {1.000 0.750 0.750 srgb} bind def
+/col30 {1.000 0.880 0.880 srgb} bind def
+/col31 {1.000 0.840 0.000 srgb} bind def
+
+end
+save
+newpath 0 36 moveto 0 0 lineto 216 0 lineto 216 36 lineto closepath clip newpath
+-2.5 42.5 translate
+1 -1 scale
+
+/cp {closepath} bind def
+/ef {eofill} bind def
+/gr {grestore} bind def
+/gs {gsave} bind def
+/sa {save} bind def
+/rs {restore} bind def
+/l {lineto} bind def
+/m {moveto} bind def
+/rm {rmoveto} bind def
+/n {newpath} bind def
+/s {stroke} bind def
+/sh {show} bind def
+/slc {setlinecap} bind def
+/slj {setlinejoin} bind def
+/slw {setlinewidth} bind def
+/srgb {setrgbcolor} bind def
+/rot {rotate} bind def
+/sc {scale} bind def
+/sd {setdash} bind def
+/ff {findfont} bind def
+/sf {setfont} bind def
+/scf {scalefont} bind def
+/sw {stringwidth} bind def
+/tr {translate} bind def
+/tnt {dup dup currentrgbcolor
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb}
+ bind def
+/shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul
+ 4 -2 roll mul srgb} bind def
+/$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def
+/$F2psEnd {$F2psEnteredState restore end} def
+
+$F2psBegin
+10 setmiterlimit
+0 slj 0 slc
+ 0.06000 0.06000 sc
+%
+% Fig objects follow
+%
+%
+% here starts figure with depth 0
+% Polyline
+30.000 slw
+n 3600 675 m 75 675 l 75 150 l 3600 150 l
+ cp gs col-1 s gr
+/Times-Bold ff 360.00 scf sf
+1800 525 m
+gs 1 -1 sc (Graphic) dup sw pop 2 div neg 0 rm col-1 sh gr
+% here ends figure;
+$F2psEnd
+rs
+showpage
+
+%%EndDocument
+ @endspecial 2106 4239 a(Figure)h(26)p 0 TeXcolorgray
+Black 1596 4352 a(This)f(is)g(Caption)h(Lab)s(el)f(Example)h(#5)p
+630 4659 V 630 4799 a FL(20.4.4)106 b(Caption)34 b(P)m(ac)m(k)-6
+b(age)36 b(F)-9 b(ormatting)35 b(Options)630 5070 y(F)-9
+b(ormatting)35 b(Example)g(#1:)46 b(Caption)35 b(Width)630
+5203 y FQ(The)30 b(follo)m(wing)i(co)s(de)p Black Black
+848 5341 a FN(\\captionsetup{wi)o(dt)o(h=3)o(in)o(})848
+5441 y(\\caption{This)38 b(is)43 b(an)g(example)d(of)j(customizing)c
+(the)j(caption)f(width})p Black 2250 5640 a FQ(80)p Black
+eop end
+%%Page: 81 81
+TeXDict begin 81 80 bop Black 0 TeXcolorgray Black Black
+630 -149 a FQ(causes)31 b(the)f(caption)i(to)f(b)s(e)e(t)m(yp)s(eset)j
+(in)e(a)g(3-inc)m(h)i(wide)e(column,)g(as)h(sho)m(wn)f(in)g(Figure)p
+0.05 1.00 1.00 0.40 TeXcolorcmyk 30 w(27)p Black(.)1680
+177 y @beginspecial 0 @llx 0 @lly 216 @urx 36 @ury 1440
+@rwi @setspecial
+%%BeginDocument: short.eps
+%!PS-Adobe-2.0 EPSF-2.0
+%%Title: short.fig
+%%Creator: fig2dev Version 3.2 Patchlevel 4
+%%CreationDate: Sun May 22 21:43:01 2005
+%%For: epstein@linux (Becky Epstein)
+%%BoundingBox: 0 0 216 36
+%%Magnification: 1.0000
+%%EndComments
+/$F2psDict 200 dict def
+$F2psDict begin
+$F2psDict /mtrx matrix put
+/col-1 {0 setgray} bind def
+/col0 {0.000 0.000 0.000 srgb} bind def
+/col1 {0.000 0.000 1.000 srgb} bind def
+/col2 {0.000 1.000 0.000 srgb} bind def
+/col3 {0.000 1.000 1.000 srgb} bind def
+/col4 {1.000 0.000 0.000 srgb} bind def
+/col5 {1.000 0.000 1.000 srgb} bind def
+/col6 {1.000 1.000 0.000 srgb} bind def
+/col7 {1.000 1.000 1.000 srgb} bind def
+/col8 {0.000 0.000 0.560 srgb} bind def
+/col9 {0.000 0.000 0.690 srgb} bind def
+/col10 {0.000 0.000 0.820 srgb} bind def
+/col11 {0.530 0.810 1.000 srgb} bind def
+/col12 {0.000 0.560 0.000 srgb} bind def
+/col13 {0.000 0.690 0.000 srgb} bind def
+/col14 {0.000 0.820 0.000 srgb} bind def
+/col15 {0.000 0.560 0.560 srgb} bind def
+/col16 {0.000 0.690 0.690 srgb} bind def
+/col17 {0.000 0.820 0.820 srgb} bind def
+/col18 {0.560 0.000 0.000 srgb} bind def
+/col19 {0.690 0.000 0.000 srgb} bind def
+/col20 {0.820 0.000 0.000 srgb} bind def
+/col21 {0.560 0.000 0.560 srgb} bind def
+/col22 {0.690 0.000 0.690 srgb} bind def
+/col23 {0.820 0.000 0.820 srgb} bind def
+/col24 {0.500 0.190 0.000 srgb} bind def
+/col25 {0.630 0.250 0.000 srgb} bind def
+/col26 {0.750 0.380 0.000 srgb} bind def
+/col27 {1.000 0.500 0.500 srgb} bind def
+/col28 {1.000 0.630 0.630 srgb} bind def
+/col29 {1.000 0.750 0.750 srgb} bind def
+/col30 {1.000 0.880 0.880 srgb} bind def
+/col31 {1.000 0.840 0.000 srgb} bind def
+
+end
+save
+newpath 0 36 moveto 0 0 lineto 216 0 lineto 216 36 lineto closepath clip newpath
+-2.5 42.5 translate
+1 -1 scale
+
+/cp {closepath} bind def
+/ef {eofill} bind def
+/gr {grestore} bind def
+/gs {gsave} bind def
+/sa {save} bind def
+/rs {restore} bind def
+/l {lineto} bind def
+/m {moveto} bind def
+/rm {rmoveto} bind def
+/n {newpath} bind def
+/s {stroke} bind def
+/sh {show} bind def
+/slc {setlinecap} bind def
+/slj {setlinejoin} bind def
+/slw {setlinewidth} bind def
+/srgb {setrgbcolor} bind def
+/rot {rotate} bind def
+/sc {scale} bind def
+/sd {setdash} bind def
+/ff {findfont} bind def
+/sf {setfont} bind def
+/scf {scalefont} bind def
+/sw {stringwidth} bind def
+/tr {translate} bind def
+/tnt {dup dup currentrgbcolor
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb}
+ bind def
+/shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul
+ 4 -2 roll mul srgb} bind def
+/$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def
+/$F2psEnd {$F2psEnteredState restore end} def
+
+$F2psBegin
+10 setmiterlimit
+0 slj 0 slc
+ 0.06000 0.06000 sc
+%
+% Fig objects follow
+%
+%
+% here starts figure with depth 0
+% Polyline
+30.000 slw
+n 3600 675 m 75 675 l 75 150 l 3600 150 l
+ cp gs col-1 s gr
+/Times-Bold ff 360.00 scf sf
+1800 525 m
+gs 1 -1 sc (Graphic) dup sw pop 2 div neg 0 rm col-1 sh gr
+% here ends figure;
+$F2psEnd
+rs
+showpage
+
+%%EndDocument
+ @endspecial 1395 347 a(Figure)h(27:)p 0 TeXcolorgray
+Black 42 w(This)f(is)g(an)h(example)g(of)g(customizing)1395
+460 y(the)g(caption)g(width)p 630 768 3331 4 v 630 1008
+a FL(F)-9 b(ormatting)35 b(Example)g(#2:)46 b(Default)35
+b(F)-9 b(ormat)630 1133 y FQ(Figure)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 21 w(28)p Black 21 w(-)20 b(Figure)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 21 w(36)p Black 21 w(on)g(P)m(age)i(82)f(sho)m(w)g
+(examples)f(of)h(the)f(sev)m(en)h(p)s(ossible)f FM(justification=)630
+1224 y FQ(v)-5 b(alues)27 b(used)f(with)h FM(format=default)p
+FQ(.)36 b(These)26 b(\014gures)h(are)g(pro)s(duced)e(b)m(y)i(the)g
+(follo)m(wing)i(co)s(de)p Black Black 787 1448 a FE
+(\\captionsetup{format=default,)q(justi)q(fica)q(tion=)q(just)q(ifie)q
+(d})787 1540 y(\\caption{Caption)43 b(with)d(default)h(format)f(and)g
+(justified)i(justification.)1140 1631 y(Caption)f(with)f(default)h
+(format)f(and)g(justified)i(justification.)1140 1722
+y(Caption)f(with)f(default)h(format)f(and)g(justified)i
+(justification.})787 1814 y(...)787 1905 y
+(\\captionsetup{format=default,)q(justi)q(fica)q(tion=)q(cent)q(erin)q
+(g})787 1996 y(\\caption{Caption)h(with)d(default)h(format)f(and)g
+(centering)i(justification.)1140 2088 y(Caption)f(with)f(default)h
+(format)f(and)g(centering)i(justification.)1140 2179
+y(Caption)f(with)f(default)h(format)f(and)g(centering)i
+(justification.})787 2270 y(...)787 2361 y
+(\\captionsetup{format=default,)q(justi)q(fica)q(tion=)q(cent)q(erla)q
+(st})787 2453 y(\\caption{Caption)h(with)d(default)h(format)f(and)g
+(centerlast)i(justification.)1140 2544 y(Caption)f(with)f(default)h
+(format)f(and)g(centerlast)i(justification.)1140 2635
+y(Caption)f(with)f(default)h(format)f(and)g(centerlast)i
+(justification.})787 2727 y(...)787 2818 y
+(\\captionsetup{format=default,)q(justi)q(fica)q(tion=)q(cent)q(erfi)q
+(rst})787 2909 y(\\caption{Caption)h(with)d(default)h(format)f(and)g
+(centerfirst)i(justification.)1140 3001 y(Caption)f(with)f(default)h
+(format)f(and)g(centerfirst)i(justification.)1140 3092
+y(Caption)f(with)f(default)h(format)f(and)g(centerfirst)i
+(justification.})787 3183 y(...)787 3275 y
+(\\captionsetup{format=default,)q(justi)q(fica)q(tion=)q(ragg)q(edri)q
+(ght})787 3366 y(\\caption{Caption)h(with)d(default)h(format)f(and)g
+(raggedright)i(justification.)1140 3457 y(Caption)f(with)f(default)h
+(format)f(and)g(raggedright)i(justification.)1140 3549
+y(Caption)f(with)f(default)h(format)f(and)g(raggedright)i
+(justification.})787 3640 y(...)787 3731 y
+(\\captionsetup{format=default,)q(justi)q(fica)q(tion=)q(Ragg)q(edRi)q
+(ght})787 3823 y(\\caption{Caption)h(with)d(default)h(format)f(and)g
+(RaggedRight)i(justification.)1140 3914 y(Caption)f(with)f(default)h
+(format)f(and)g(RaggedRight)i(justification.)1140 4005
+y(Caption)f(with)f(default)h(format)f(and)g(RaggedRight)i
+(justification.})787 4097 y(...)787 4188 y
+(\\captionsetup{format=default,)q(justi)q(fica)q(tion=)q(ragg)q(edle)q
+(ft})787 4279 y(\\caption{Caption)h(with)d(default)h(format)f(and)g
+(raggedleft)i(justification.)1140 4371 y(Caption)f(with)f(default)h
+(format)f(and)g(raggedleft)i(justification.)1140 4462
+y(Caption)f(with)f(default)h(format)f(and)g(raggedleft)i
+(justification.})630 4616 y FQ(As)33 b(can)h(b)s(e)e(seen)i(in)e
+(Figure)p 0.05 1.00 1.00 0.40 TeXcolorcmyk 34 w(28)p
+Black 34 w(-)i(Figure)p 0.05 1.00 1.00 0.40 TeXcolorcmyk
+33 w(36)p Black(,)h(the)f(ab)s(o)m(v)m(e)g(co)s(de)f(causes)h(the)f
+(\014rst)g(line)g(of)h(the)630 4729 y(caption)d(to)g(b)s(e)f(formatted)
+h(the)g(same)f(as)h(all)g(of)g(the)f(other)h(lines.)p
+630 4895 V 630 5135 a FL(F)-9 b(ormatting)35 b(Example)g(#3:)46
+b(Hang)35 b(F)-9 b(ormat)630 5260 y FQ(The)43 b(previous)h(example)g
+(used)g(the)g FM(format=default)c FQ(option.)82 b(This)43
+b(previous)g(example)630 5351 y(creates)d(Figure)p
+0.05 1.00 1.00 0.40 TeXcolorcmyk 40 w(37)p Black 40
+w(-)f(Figure)p 0.05 1.00 1.00 0.40 TeXcolorcmyk 40
+w(45)p Black(,)j(sho)m(wing)d(the)g(sev)m(en)h(p)s(ossible)e
+FM(justification=)e FQ(v)-5 b(alues)630 5443 y(used)30
+b(with)g FM(format=hang)p FQ(.)37 b(These)30 b(\014gures)g(are)h(pro)s
+(duced)e(b)m(y)h(the)g(follo)m(wing)i(co)s(de)p Black
+2250 5640 a(81)p Black eop end
+%%Page: 82 82
+TeXDict begin 82 81 bop Black 0 TeXcolorgray Black Black
+Black Black Black 982 243 a @beginspecial 0 @llx 0 @lly
+216 @urx 36 @ury 2252 @rwi @setspecial
+%%BeginDocument: short.eps
+%!PS-Adobe-2.0 EPSF-2.0
+%%Title: short.fig
+%%Creator: fig2dev Version 3.2 Patchlevel 4
+%%CreationDate: Sun May 22 21:43:01 2005
+%%For: epstein@linux (Becky Epstein)
+%%BoundingBox: 0 0 216 36
+%%Magnification: 1.0000
+%%EndComments
+/$F2psDict 200 dict def
+$F2psDict begin
+$F2psDict /mtrx matrix put
+/col-1 {0 setgray} bind def
+/col0 {0.000 0.000 0.000 srgb} bind def
+/col1 {0.000 0.000 1.000 srgb} bind def
+/col2 {0.000 1.000 0.000 srgb} bind def
+/col3 {0.000 1.000 1.000 srgb} bind def
+/col4 {1.000 0.000 0.000 srgb} bind def
+/col5 {1.000 0.000 1.000 srgb} bind def
+/col6 {1.000 1.000 0.000 srgb} bind def
+/col7 {1.000 1.000 1.000 srgb} bind def
+/col8 {0.000 0.000 0.560 srgb} bind def
+/col9 {0.000 0.000 0.690 srgb} bind def
+/col10 {0.000 0.000 0.820 srgb} bind def
+/col11 {0.530 0.810 1.000 srgb} bind def
+/col12 {0.000 0.560 0.000 srgb} bind def
+/col13 {0.000 0.690 0.000 srgb} bind def
+/col14 {0.000 0.820 0.000 srgb} bind def
+/col15 {0.000 0.560 0.560 srgb} bind def
+/col16 {0.000 0.690 0.690 srgb} bind def
+/col17 {0.000 0.820 0.820 srgb} bind def
+/col18 {0.560 0.000 0.000 srgb} bind def
+/col19 {0.690 0.000 0.000 srgb} bind def
+/col20 {0.820 0.000 0.000 srgb} bind def
+/col21 {0.560 0.000 0.560 srgb} bind def
+/col22 {0.690 0.000 0.690 srgb} bind def
+/col23 {0.820 0.000 0.820 srgb} bind def
+/col24 {0.500 0.190 0.000 srgb} bind def
+/col25 {0.630 0.250 0.000 srgb} bind def
+/col26 {0.750 0.380 0.000 srgb} bind def
+/col27 {1.000 0.500 0.500 srgb} bind def
+/col28 {1.000 0.630 0.630 srgb} bind def
+/col29 {1.000 0.750 0.750 srgb} bind def
+/col30 {1.000 0.880 0.880 srgb} bind def
+/col31 {1.000 0.840 0.000 srgb} bind def
+
+end
+save
+newpath 0 36 moveto 0 0 lineto 216 0 lineto 216 36 lineto closepath clip newpath
+-2.5 42.5 translate
+1 -1 scale
+
+/cp {closepath} bind def
+/ef {eofill} bind def
+/gr {grestore} bind def
+/gs {gsave} bind def
+/sa {save} bind def
+/rs {restore} bind def
+/l {lineto} bind def
+/m {moveto} bind def
+/rm {rmoveto} bind def
+/n {newpath} bind def
+/s {stroke} bind def
+/sh {show} bind def
+/slc {setlinecap} bind def
+/slj {setlinejoin} bind def
+/slw {setlinewidth} bind def
+/srgb {setrgbcolor} bind def
+/rot {rotate} bind def
+/sc {scale} bind def
+/sd {setdash} bind def
+/ff {findfont} bind def
+/sf {setfont} bind def
+/scf {scalefont} bind def
+/sw {stringwidth} bind def
+/tr {translate} bind def
+/tnt {dup dup currentrgbcolor
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb}
+ bind def
+/shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul
+ 4 -2 roll mul srgb} bind def
+/$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def
+/$F2psEnd {$F2psEnteredState restore end} def
+
+$F2psBegin
+10 setmiterlimit
+0 slj 0 slc
+ 0.06000 0.06000 sc
+%
+% Fig objects follow
+%
+%
+% here starts figure with depth 0
+% Polyline
+30.000 slw
+n 3600 675 m 75 675 l 75 150 l 3600 150 l
+ cp gs col-1 s gr
+/Times-Bold ff 360.00 scf sf
+1800 525 m
+gs 1 -1 sc (Graphic) dup sw pop 2 div neg 0 rm col-1 sh gr
+% here ends figure;
+$F2psEnd
+rs
+showpage
+
+%%EndDocument
+ @endspecial 171 x FQ(Figure)24 b(28:)p 0 TeXcolorgray
+Black 38 w(Caption)f(with)h(default)f(format)h(and)f(jus-)982
+526 y(ti\014ed)j(justi\014cation.)41 b(Caption)26 b(with)h(default)g
+(format)982 639 y(and)g(justi\014ed)g(justi\014cation.)40
+b(Caption)29 b(with)e(default)982 752 y(format)j(and)g(justi\014ed)g
+(justi\014cation.)-120 1273 y @beginspecial 0 @llx 0
+@lly 216 @urx 36 @ury 2252 @rwi @setspecial
+%%BeginDocument: short.eps
+%!PS-Adobe-2.0 EPSF-2.0
+%%Title: short.fig
+%%Creator: fig2dev Version 3.2 Patchlevel 4
+%%CreationDate: Sun May 22 21:43:01 2005
+%%For: epstein@linux (Becky Epstein)
+%%BoundingBox: 0 0 216 36
+%%Magnification: 1.0000
+%%EndComments
+/$F2psDict 200 dict def
+$F2psDict begin
+$F2psDict /mtrx matrix put
+/col-1 {0 setgray} bind def
+/col0 {0.000 0.000 0.000 srgb} bind def
+/col1 {0.000 0.000 1.000 srgb} bind def
+/col2 {0.000 1.000 0.000 srgb} bind def
+/col3 {0.000 1.000 1.000 srgb} bind def
+/col4 {1.000 0.000 0.000 srgb} bind def
+/col5 {1.000 0.000 1.000 srgb} bind def
+/col6 {1.000 1.000 0.000 srgb} bind def
+/col7 {1.000 1.000 1.000 srgb} bind def
+/col8 {0.000 0.000 0.560 srgb} bind def
+/col9 {0.000 0.000 0.690 srgb} bind def
+/col10 {0.000 0.000 0.820 srgb} bind def
+/col11 {0.530 0.810 1.000 srgb} bind def
+/col12 {0.000 0.560 0.000 srgb} bind def
+/col13 {0.000 0.690 0.000 srgb} bind def
+/col14 {0.000 0.820 0.000 srgb} bind def
+/col15 {0.000 0.560 0.560 srgb} bind def
+/col16 {0.000 0.690 0.690 srgb} bind def
+/col17 {0.000 0.820 0.820 srgb} bind def
+/col18 {0.560 0.000 0.000 srgb} bind def
+/col19 {0.690 0.000 0.000 srgb} bind def
+/col20 {0.820 0.000 0.000 srgb} bind def
+/col21 {0.560 0.000 0.560 srgb} bind def
+/col22 {0.690 0.000 0.690 srgb} bind def
+/col23 {0.820 0.000 0.820 srgb} bind def
+/col24 {0.500 0.190 0.000 srgb} bind def
+/col25 {0.630 0.250 0.000 srgb} bind def
+/col26 {0.750 0.380 0.000 srgb} bind def
+/col27 {1.000 0.500 0.500 srgb} bind def
+/col28 {1.000 0.630 0.630 srgb} bind def
+/col29 {1.000 0.750 0.750 srgb} bind def
+/col30 {1.000 0.880 0.880 srgb} bind def
+/col31 {1.000 0.840 0.000 srgb} bind def
+
+end
+save
+newpath 0 36 moveto 0 0 lineto 216 0 lineto 216 36 lineto closepath clip newpath
+-2.5 42.5 translate
+1 -1 scale
+
+/cp {closepath} bind def
+/ef {eofill} bind def
+/gr {grestore} bind def
+/gs {gsave} bind def
+/sa {save} bind def
+/rs {restore} bind def
+/l {lineto} bind def
+/m {moveto} bind def
+/rm {rmoveto} bind def
+/n {newpath} bind def
+/s {stroke} bind def
+/sh {show} bind def
+/slc {setlinecap} bind def
+/slj {setlinejoin} bind def
+/slw {setlinewidth} bind def
+/srgb {setrgbcolor} bind def
+/rot {rotate} bind def
+/sc {scale} bind def
+/sd {setdash} bind def
+/ff {findfont} bind def
+/sf {setfont} bind def
+/scf {scalefont} bind def
+/sw {stringwidth} bind def
+/tr {translate} bind def
+/tnt {dup dup currentrgbcolor
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb}
+ bind def
+/shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul
+ 4 -2 roll mul srgb} bind def
+/$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def
+/$F2psEnd {$F2psEnteredState restore end} def
+
+$F2psBegin
+10 setmiterlimit
+0 slj 0 slc
+ 0.06000 0.06000 sc
+%
+% Fig objects follow
+%
+%
+% here starts figure with depth 0
+% Polyline
+30.000 slw
+n 3600 675 m 75 675 l 75 150 l 3600 150 l
+ cp gs col-1 s gr
+/Times-Bold ff 360.00 scf sf
+1800 525 m
+gs 1 -1 sc (Graphic) dup sw pop 2 div neg 0 rm col-1 sh gr
+% here ends figure;
+$F2psEnd
+rs
+showpage
+
+%%EndDocument
+ @endspecial 171 x(Figure)21 b(29:)p 0 TeXcolorgray Black
+37 w(Caption)g(with)g(default)g(format)g(and)f(cen-)-120
+1557 y(terlast)40 b(justi\014cation.)67 b(Caption)39
+b(with)g(default)g(for-)-120 1670 y(mat)e(and)f(cen)m(terlast)i
+(justi\014cation.)60 b(Caption)36 b(with)-23 1782 y(default)30
+b(format)h(and)f(cen)m(terlast)i(justi\014cation.)2083
+1273 y @beginspecial 0 @llx 0 @lly 216 @urx 36 @ury 2252
+@rwi @setspecial
+%%BeginDocument: short.eps
+%!PS-Adobe-2.0 EPSF-2.0
+%%Title: short.fig
+%%Creator: fig2dev Version 3.2 Patchlevel 4
+%%CreationDate: Sun May 22 21:43:01 2005
+%%For: epstein@linux (Becky Epstein)
+%%BoundingBox: 0 0 216 36
+%%Magnification: 1.0000
+%%EndComments
+/$F2psDict 200 dict def
+$F2psDict begin
+$F2psDict /mtrx matrix put
+/col-1 {0 setgray} bind def
+/col0 {0.000 0.000 0.000 srgb} bind def
+/col1 {0.000 0.000 1.000 srgb} bind def
+/col2 {0.000 1.000 0.000 srgb} bind def
+/col3 {0.000 1.000 1.000 srgb} bind def
+/col4 {1.000 0.000 0.000 srgb} bind def
+/col5 {1.000 0.000 1.000 srgb} bind def
+/col6 {1.000 1.000 0.000 srgb} bind def
+/col7 {1.000 1.000 1.000 srgb} bind def
+/col8 {0.000 0.000 0.560 srgb} bind def
+/col9 {0.000 0.000 0.690 srgb} bind def
+/col10 {0.000 0.000 0.820 srgb} bind def
+/col11 {0.530 0.810 1.000 srgb} bind def
+/col12 {0.000 0.560 0.000 srgb} bind def
+/col13 {0.000 0.690 0.000 srgb} bind def
+/col14 {0.000 0.820 0.000 srgb} bind def
+/col15 {0.000 0.560 0.560 srgb} bind def
+/col16 {0.000 0.690 0.690 srgb} bind def
+/col17 {0.000 0.820 0.820 srgb} bind def
+/col18 {0.560 0.000 0.000 srgb} bind def
+/col19 {0.690 0.000 0.000 srgb} bind def
+/col20 {0.820 0.000 0.000 srgb} bind def
+/col21 {0.560 0.000 0.560 srgb} bind def
+/col22 {0.690 0.000 0.690 srgb} bind def
+/col23 {0.820 0.000 0.820 srgb} bind def
+/col24 {0.500 0.190 0.000 srgb} bind def
+/col25 {0.630 0.250 0.000 srgb} bind def
+/col26 {0.750 0.380 0.000 srgb} bind def
+/col27 {1.000 0.500 0.500 srgb} bind def
+/col28 {1.000 0.630 0.630 srgb} bind def
+/col29 {1.000 0.750 0.750 srgb} bind def
+/col30 {1.000 0.880 0.880 srgb} bind def
+/col31 {1.000 0.840 0.000 srgb} bind def
+
+end
+save
+newpath 0 36 moveto 0 0 lineto 216 0 lineto 216 36 lineto closepath clip newpath
+-2.5 42.5 translate
+1 -1 scale
+
+/cp {closepath} bind def
+/ef {eofill} bind def
+/gr {grestore} bind def
+/gs {gsave} bind def
+/sa {save} bind def
+/rs {restore} bind def
+/l {lineto} bind def
+/m {moveto} bind def
+/rm {rmoveto} bind def
+/n {newpath} bind def
+/s {stroke} bind def
+/sh {show} bind def
+/slc {setlinecap} bind def
+/slj {setlinejoin} bind def
+/slw {setlinewidth} bind def
+/srgb {setrgbcolor} bind def
+/rot {rotate} bind def
+/sc {scale} bind def
+/sd {setdash} bind def
+/ff {findfont} bind def
+/sf {setfont} bind def
+/scf {scalefont} bind def
+/sw {stringwidth} bind def
+/tr {translate} bind def
+/tnt {dup dup currentrgbcolor
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb}
+ bind def
+/shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul
+ 4 -2 roll mul srgb} bind def
+/$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def
+/$F2psEnd {$F2psEnteredState restore end} def
+
+$F2psBegin
+10 setmiterlimit
+0 slj 0 slc
+ 0.06000 0.06000 sc
+%
+% Fig objects follow
+%
+%
+% here starts figure with depth 0
+% Polyline
+30.000 slw
+n 3600 675 m 75 675 l 75 150 l 3600 150 l
+ cp gs col-1 s gr
+/Times-Bold ff 360.00 scf sf
+1800 525 m
+gs 1 -1 sc (Graphic) dup sw pop 2 div neg 0 rm col-1 sh gr
+% here ends figure;
+$F2psEnd
+rs
+showpage
+
+%%EndDocument
+ @endspecial 2148 1444 a(Figure)f(30:)p 0 TeXcolorgray
+Black 42 w(Caption)f(with)g(default)h(format)f(and)2083
+1557 y(cen)m(ter\014rst)45 b(justi\014cation.)84 b(Caption)45
+b(with)f(default)2083 1670 y(format)52 b(and)e(cen)m(ter\014rst)i
+(justi\014cation.)104 b(Caption)2083 1782 y(with)24 b(default)h(format)
+g(and)f(cen)m(ter\014rst)h(justi\014cation.)-120 2303
+y @beginspecial 0 @llx 0 @lly 216 @urx 36 @ury 2252 @rwi
+@setspecial
+%%BeginDocument: short.eps
+%!PS-Adobe-2.0 EPSF-2.0
+%%Title: short.fig
+%%Creator: fig2dev Version 3.2 Patchlevel 4
+%%CreationDate: Sun May 22 21:43:01 2005
+%%For: epstein@linux (Becky Epstein)
+%%BoundingBox: 0 0 216 36
+%%Magnification: 1.0000
+%%EndComments
+/$F2psDict 200 dict def
+$F2psDict begin
+$F2psDict /mtrx matrix put
+/col-1 {0 setgray} bind def
+/col0 {0.000 0.000 0.000 srgb} bind def
+/col1 {0.000 0.000 1.000 srgb} bind def
+/col2 {0.000 1.000 0.000 srgb} bind def
+/col3 {0.000 1.000 1.000 srgb} bind def
+/col4 {1.000 0.000 0.000 srgb} bind def
+/col5 {1.000 0.000 1.000 srgb} bind def
+/col6 {1.000 1.000 0.000 srgb} bind def
+/col7 {1.000 1.000 1.000 srgb} bind def
+/col8 {0.000 0.000 0.560 srgb} bind def
+/col9 {0.000 0.000 0.690 srgb} bind def
+/col10 {0.000 0.000 0.820 srgb} bind def
+/col11 {0.530 0.810 1.000 srgb} bind def
+/col12 {0.000 0.560 0.000 srgb} bind def
+/col13 {0.000 0.690 0.000 srgb} bind def
+/col14 {0.000 0.820 0.000 srgb} bind def
+/col15 {0.000 0.560 0.560 srgb} bind def
+/col16 {0.000 0.690 0.690 srgb} bind def
+/col17 {0.000 0.820 0.820 srgb} bind def
+/col18 {0.560 0.000 0.000 srgb} bind def
+/col19 {0.690 0.000 0.000 srgb} bind def
+/col20 {0.820 0.000 0.000 srgb} bind def
+/col21 {0.560 0.000 0.560 srgb} bind def
+/col22 {0.690 0.000 0.690 srgb} bind def
+/col23 {0.820 0.000 0.820 srgb} bind def
+/col24 {0.500 0.190 0.000 srgb} bind def
+/col25 {0.630 0.250 0.000 srgb} bind def
+/col26 {0.750 0.380 0.000 srgb} bind def
+/col27 {1.000 0.500 0.500 srgb} bind def
+/col28 {1.000 0.630 0.630 srgb} bind def
+/col29 {1.000 0.750 0.750 srgb} bind def
+/col30 {1.000 0.880 0.880 srgb} bind def
+/col31 {1.000 0.840 0.000 srgb} bind def
+
+end
+save
+newpath 0 36 moveto 0 0 lineto 216 0 lineto 216 36 lineto closepath clip newpath
+-2.5 42.5 translate
+1 -1 scale
+
+/cp {closepath} bind def
+/ef {eofill} bind def
+/gr {grestore} bind def
+/gs {gsave} bind def
+/sa {save} bind def
+/rs {restore} bind def
+/l {lineto} bind def
+/m {moveto} bind def
+/rm {rmoveto} bind def
+/n {newpath} bind def
+/s {stroke} bind def
+/sh {show} bind def
+/slc {setlinecap} bind def
+/slj {setlinejoin} bind def
+/slw {setlinewidth} bind def
+/srgb {setrgbcolor} bind def
+/rot {rotate} bind def
+/sc {scale} bind def
+/sd {setdash} bind def
+/ff {findfont} bind def
+/sf {setfont} bind def
+/scf {scalefont} bind def
+/sw {stringwidth} bind def
+/tr {translate} bind def
+/tnt {dup dup currentrgbcolor
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb}
+ bind def
+/shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul
+ 4 -2 roll mul srgb} bind def
+/$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def
+/$F2psEnd {$F2psEnteredState restore end} def
+
+$F2psBegin
+10 setmiterlimit
+0 slj 0 slc
+ 0.06000 0.06000 sc
+%
+% Fig objects follow
+%
+%
+% here starts figure with depth 0
+% Polyline
+30.000 slw
+n 3600 675 m 75 675 l 75 150 l 3600 150 l
+ cp gs col-1 s gr
+/Times-Bold ff 360.00 scf sf
+1800 525 m
+gs 1 -1 sc (Graphic) dup sw pop 2 div neg 0 rm col-1 sh gr
+% here ends figure;
+$F2psEnd
+rs
+showpage
+
+%%EndDocument
+ @endspecial -55 2474 a(Figure)31 b(31:)p 0 TeXcolorgray
+Black 41 w(Caption)g(with)f(default)h(format)f(and)-59
+2587 y(cen)m(tering)h(justi\014cation.)42 b(Caption)30
+b(with)g(default)-39 2700 y(format)g(and)g(cen)m(tering)i
+(justi\014cation.)41 b(Caption)-116 2813 y(with)30 b(default)g(format)h
+(and)f(cen)m(tering)h(justi\014cation.)2083 2303 y @beginspecial
+0 @llx 0 @lly 216 @urx 36 @ury 2252 @rwi @setspecial
+%%BeginDocument: short.eps
+%!PS-Adobe-2.0 EPSF-2.0
+%%Title: short.fig
+%%Creator: fig2dev Version 3.2 Patchlevel 4
+%%CreationDate: Sun May 22 21:43:01 2005
+%%For: epstein@linux (Becky Epstein)
+%%BoundingBox: 0 0 216 36
+%%Magnification: 1.0000
+%%EndComments
+/$F2psDict 200 dict def
+$F2psDict begin
+$F2psDict /mtrx matrix put
+/col-1 {0 setgray} bind def
+/col0 {0.000 0.000 0.000 srgb} bind def
+/col1 {0.000 0.000 1.000 srgb} bind def
+/col2 {0.000 1.000 0.000 srgb} bind def
+/col3 {0.000 1.000 1.000 srgb} bind def
+/col4 {1.000 0.000 0.000 srgb} bind def
+/col5 {1.000 0.000 1.000 srgb} bind def
+/col6 {1.000 1.000 0.000 srgb} bind def
+/col7 {1.000 1.000 1.000 srgb} bind def
+/col8 {0.000 0.000 0.560 srgb} bind def
+/col9 {0.000 0.000 0.690 srgb} bind def
+/col10 {0.000 0.000 0.820 srgb} bind def
+/col11 {0.530 0.810 1.000 srgb} bind def
+/col12 {0.000 0.560 0.000 srgb} bind def
+/col13 {0.000 0.690 0.000 srgb} bind def
+/col14 {0.000 0.820 0.000 srgb} bind def
+/col15 {0.000 0.560 0.560 srgb} bind def
+/col16 {0.000 0.690 0.690 srgb} bind def
+/col17 {0.000 0.820 0.820 srgb} bind def
+/col18 {0.560 0.000 0.000 srgb} bind def
+/col19 {0.690 0.000 0.000 srgb} bind def
+/col20 {0.820 0.000 0.000 srgb} bind def
+/col21 {0.560 0.000 0.560 srgb} bind def
+/col22 {0.690 0.000 0.690 srgb} bind def
+/col23 {0.820 0.000 0.820 srgb} bind def
+/col24 {0.500 0.190 0.000 srgb} bind def
+/col25 {0.630 0.250 0.000 srgb} bind def
+/col26 {0.750 0.380 0.000 srgb} bind def
+/col27 {1.000 0.500 0.500 srgb} bind def
+/col28 {1.000 0.630 0.630 srgb} bind def
+/col29 {1.000 0.750 0.750 srgb} bind def
+/col30 {1.000 0.880 0.880 srgb} bind def
+/col31 {1.000 0.840 0.000 srgb} bind def
+
+end
+save
+newpath 0 36 moveto 0 0 lineto 216 0 lineto 216 36 lineto closepath clip newpath
+-2.5 42.5 translate
+1 -1 scale
+
+/cp {closepath} bind def
+/ef {eofill} bind def
+/gr {grestore} bind def
+/gs {gsave} bind def
+/sa {save} bind def
+/rs {restore} bind def
+/l {lineto} bind def
+/m {moveto} bind def
+/rm {rmoveto} bind def
+/n {newpath} bind def
+/s {stroke} bind def
+/sh {show} bind def
+/slc {setlinecap} bind def
+/slj {setlinejoin} bind def
+/slw {setlinewidth} bind def
+/srgb {setrgbcolor} bind def
+/rot {rotate} bind def
+/sc {scale} bind def
+/sd {setdash} bind def
+/ff {findfont} bind def
+/sf {setfont} bind def
+/scf {scalefont} bind def
+/sw {stringwidth} bind def
+/tr {translate} bind def
+/tnt {dup dup currentrgbcolor
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb}
+ bind def
+/shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul
+ 4 -2 roll mul srgb} bind def
+/$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def
+/$F2psEnd {$F2psEnteredState restore end} def
+
+$F2psBegin
+10 setmiterlimit
+0 slj 0 slc
+ 0.06000 0.06000 sc
+%
+% Fig objects follow
+%
+%
+% here starts figure with depth 0
+% Polyline
+30.000 slw
+n 3600 675 m 75 675 l 75 150 l 3600 150 l
+ cp gs col-1 s gr
+/Times-Bold ff 360.00 scf sf
+1800 525 m
+gs 1 -1 sc (Graphic) dup sw pop 2 div neg 0 rm col-1 sh gr
+% here ends figure;
+$F2psEnd
+rs
+showpage
+
+%%EndDocument
+ @endspecial 2300 2474 a(Figure)g(32:)p 0 TeXcolorgray
+Black 41 w(Caption)g(with)f(default)g(for-)2269 2587
+y(mat)h(and)e(Cen)m(tering)i(justi\014cation.)42 b(Cap-)2288
+2700 y(tion)31 b(with)f(default)g(format)h(and)f(Cen)m(ter-)2264
+2813 y(ing)g(justi\014cation.)42 b(Caption)30 b(with)g(default)2330
+2925 y(format)h(and)f(Cen)m(tering)h(justi\014cation.)-120
+3447 y @beginspecial 0 @llx 0 @lly 216 @urx 36 @ury 2252
+@rwi @setspecial
+%%BeginDocument: short.eps
+%!PS-Adobe-2.0 EPSF-2.0
+%%Title: short.fig
+%%Creator: fig2dev Version 3.2 Patchlevel 4
+%%CreationDate: Sun May 22 21:43:01 2005
+%%For: epstein@linux (Becky Epstein)
+%%BoundingBox: 0 0 216 36
+%%Magnification: 1.0000
+%%EndComments
+/$F2psDict 200 dict def
+$F2psDict begin
+$F2psDict /mtrx matrix put
+/col-1 {0 setgray} bind def
+/col0 {0.000 0.000 0.000 srgb} bind def
+/col1 {0.000 0.000 1.000 srgb} bind def
+/col2 {0.000 1.000 0.000 srgb} bind def
+/col3 {0.000 1.000 1.000 srgb} bind def
+/col4 {1.000 0.000 0.000 srgb} bind def
+/col5 {1.000 0.000 1.000 srgb} bind def
+/col6 {1.000 1.000 0.000 srgb} bind def
+/col7 {1.000 1.000 1.000 srgb} bind def
+/col8 {0.000 0.000 0.560 srgb} bind def
+/col9 {0.000 0.000 0.690 srgb} bind def
+/col10 {0.000 0.000 0.820 srgb} bind def
+/col11 {0.530 0.810 1.000 srgb} bind def
+/col12 {0.000 0.560 0.000 srgb} bind def
+/col13 {0.000 0.690 0.000 srgb} bind def
+/col14 {0.000 0.820 0.000 srgb} bind def
+/col15 {0.000 0.560 0.560 srgb} bind def
+/col16 {0.000 0.690 0.690 srgb} bind def
+/col17 {0.000 0.820 0.820 srgb} bind def
+/col18 {0.560 0.000 0.000 srgb} bind def
+/col19 {0.690 0.000 0.000 srgb} bind def
+/col20 {0.820 0.000 0.000 srgb} bind def
+/col21 {0.560 0.000 0.560 srgb} bind def
+/col22 {0.690 0.000 0.690 srgb} bind def
+/col23 {0.820 0.000 0.820 srgb} bind def
+/col24 {0.500 0.190 0.000 srgb} bind def
+/col25 {0.630 0.250 0.000 srgb} bind def
+/col26 {0.750 0.380 0.000 srgb} bind def
+/col27 {1.000 0.500 0.500 srgb} bind def
+/col28 {1.000 0.630 0.630 srgb} bind def
+/col29 {1.000 0.750 0.750 srgb} bind def
+/col30 {1.000 0.880 0.880 srgb} bind def
+/col31 {1.000 0.840 0.000 srgb} bind def
+
+end
+save
+newpath 0 36 moveto 0 0 lineto 216 0 lineto 216 36 lineto closepath clip newpath
+-2.5 42.5 translate
+1 -1 scale
+
+/cp {closepath} bind def
+/ef {eofill} bind def
+/gr {grestore} bind def
+/gs {gsave} bind def
+/sa {save} bind def
+/rs {restore} bind def
+/l {lineto} bind def
+/m {moveto} bind def
+/rm {rmoveto} bind def
+/n {newpath} bind def
+/s {stroke} bind def
+/sh {show} bind def
+/slc {setlinecap} bind def
+/slj {setlinejoin} bind def
+/slw {setlinewidth} bind def
+/srgb {setrgbcolor} bind def
+/rot {rotate} bind def
+/sc {scale} bind def
+/sd {setdash} bind def
+/ff {findfont} bind def
+/sf {setfont} bind def
+/scf {scalefont} bind def
+/sw {stringwidth} bind def
+/tr {translate} bind def
+/tnt {dup dup currentrgbcolor
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb}
+ bind def
+/shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul
+ 4 -2 roll mul srgb} bind def
+/$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def
+/$F2psEnd {$F2psEnteredState restore end} def
+
+$F2psBegin
+10 setmiterlimit
+0 slj 0 slc
+ 0.06000 0.06000 sc
+%
+% Fig objects follow
+%
+%
+% here starts figure with depth 0
+% Polyline
+30.000 slw
+n 3600 675 m 75 675 l 75 150 l 3600 150 l
+ cp gs col-1 s gr
+/Times-Bold ff 360.00 scf sf
+1800 525 m
+gs 1 -1 sc (Graphic) dup sw pop 2 div neg 0 rm col-1 sh gr
+% here ends figure;
+$F2psEnd
+rs
+showpage
+
+%%EndDocument
+ @endspecial 170 x(Figure)g(33:)p 0 TeXcolorgray Black
+41 w(Caption)g(with)f(default)h(format)f(and)-120 3730
+y(raggedrigh)m(t)i(justi\014cation.)41 b(Caption)31 b(with)f(default)
+-120 3843 y(format)h(and)e(raggedrigh)m(t)j(justi\014cation.)42
+b(Caption)-120 3956 y(with)30 b(default)h(format)f(and)g(raggedrigh)m
+(t)-120 4069 y(justi\014cation.)2083 3447 y @beginspecial
+0 @llx 0 @lly 216 @urx 36 @ury 2252 @rwi @setspecial
+%%BeginDocument: short.eps
+%!PS-Adobe-2.0 EPSF-2.0
+%%Title: short.fig
+%%Creator: fig2dev Version 3.2 Patchlevel 4
+%%CreationDate: Sun May 22 21:43:01 2005
+%%For: epstein@linux (Becky Epstein)
+%%BoundingBox: 0 0 216 36
+%%Magnification: 1.0000
+%%EndComments
+/$F2psDict 200 dict def
+$F2psDict begin
+$F2psDict /mtrx matrix put
+/col-1 {0 setgray} bind def
+/col0 {0.000 0.000 0.000 srgb} bind def
+/col1 {0.000 0.000 1.000 srgb} bind def
+/col2 {0.000 1.000 0.000 srgb} bind def
+/col3 {0.000 1.000 1.000 srgb} bind def
+/col4 {1.000 0.000 0.000 srgb} bind def
+/col5 {1.000 0.000 1.000 srgb} bind def
+/col6 {1.000 1.000 0.000 srgb} bind def
+/col7 {1.000 1.000 1.000 srgb} bind def
+/col8 {0.000 0.000 0.560 srgb} bind def
+/col9 {0.000 0.000 0.690 srgb} bind def
+/col10 {0.000 0.000 0.820 srgb} bind def
+/col11 {0.530 0.810 1.000 srgb} bind def
+/col12 {0.000 0.560 0.000 srgb} bind def
+/col13 {0.000 0.690 0.000 srgb} bind def
+/col14 {0.000 0.820 0.000 srgb} bind def
+/col15 {0.000 0.560 0.560 srgb} bind def
+/col16 {0.000 0.690 0.690 srgb} bind def
+/col17 {0.000 0.820 0.820 srgb} bind def
+/col18 {0.560 0.000 0.000 srgb} bind def
+/col19 {0.690 0.000 0.000 srgb} bind def
+/col20 {0.820 0.000 0.000 srgb} bind def
+/col21 {0.560 0.000 0.560 srgb} bind def
+/col22 {0.690 0.000 0.690 srgb} bind def
+/col23 {0.820 0.000 0.820 srgb} bind def
+/col24 {0.500 0.190 0.000 srgb} bind def
+/col25 {0.630 0.250 0.000 srgb} bind def
+/col26 {0.750 0.380 0.000 srgb} bind def
+/col27 {1.000 0.500 0.500 srgb} bind def
+/col28 {1.000 0.630 0.630 srgb} bind def
+/col29 {1.000 0.750 0.750 srgb} bind def
+/col30 {1.000 0.880 0.880 srgb} bind def
+/col31 {1.000 0.840 0.000 srgb} bind def
+
+end
+save
+newpath 0 36 moveto 0 0 lineto 216 0 lineto 216 36 lineto closepath clip newpath
+-2.5 42.5 translate
+1 -1 scale
+
+/cp {closepath} bind def
+/ef {eofill} bind def
+/gr {grestore} bind def
+/gs {gsave} bind def
+/sa {save} bind def
+/rs {restore} bind def
+/l {lineto} bind def
+/m {moveto} bind def
+/rm {rmoveto} bind def
+/n {newpath} bind def
+/s {stroke} bind def
+/sh {show} bind def
+/slc {setlinecap} bind def
+/slj {setlinejoin} bind def
+/slw {setlinewidth} bind def
+/srgb {setrgbcolor} bind def
+/rot {rotate} bind def
+/sc {scale} bind def
+/sd {setdash} bind def
+/ff {findfont} bind def
+/sf {setfont} bind def
+/scf {scalefont} bind def
+/sw {stringwidth} bind def
+/tr {translate} bind def
+/tnt {dup dup currentrgbcolor
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb}
+ bind def
+/shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul
+ 4 -2 roll mul srgb} bind def
+/$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def
+/$F2psEnd {$F2psEnteredState restore end} def
+
+$F2psBegin
+10 setmiterlimit
+0 slj 0 slc
+ 0.06000 0.06000 sc
+%
+% Fig objects follow
+%
+%
+% here starts figure with depth 0
+% Polyline
+30.000 slw
+n 3600 675 m 75 675 l 75 150 l 3600 150 l
+ cp gs col-1 s gr
+/Times-Bold ff 360.00 scf sf
+1800 525 m
+gs 1 -1 sc (Graphic) dup sw pop 2 div neg 0 rm col-1 sh gr
+% here ends figure;
+$F2psEnd
+rs
+showpage
+
+%%EndDocument
+ @endspecial 170 x(Figure)h(34:)p 0 TeXcolorgray Black
+42 w(Caption)f(with)g(default)h(format)f(and)2083 3730
+y(RaggedRigh)m(t)j(justi\014cation.)41 b(Caption)30 b(with)h(de-)2083
+3843 y(fault)g(format)g(and)e(RaggedRigh)m(t)k(justi\014cation.)2083
+3956 y(Caption)e(with)f(default)g(format)h(and)f(RaggedRigh)m(t)2083
+4069 y(justi\014cation.)-120 4590 y @beginspecial 0 @llx
+0 @lly 216 @urx 36 @ury 2252 @rwi @setspecial
+%%BeginDocument: short.eps
+%!PS-Adobe-2.0 EPSF-2.0
+%%Title: short.fig
+%%Creator: fig2dev Version 3.2 Patchlevel 4
+%%CreationDate: Sun May 22 21:43:01 2005
+%%For: epstein@linux (Becky Epstein)
+%%BoundingBox: 0 0 216 36
+%%Magnification: 1.0000
+%%EndComments
+/$F2psDict 200 dict def
+$F2psDict begin
+$F2psDict /mtrx matrix put
+/col-1 {0 setgray} bind def
+/col0 {0.000 0.000 0.000 srgb} bind def
+/col1 {0.000 0.000 1.000 srgb} bind def
+/col2 {0.000 1.000 0.000 srgb} bind def
+/col3 {0.000 1.000 1.000 srgb} bind def
+/col4 {1.000 0.000 0.000 srgb} bind def
+/col5 {1.000 0.000 1.000 srgb} bind def
+/col6 {1.000 1.000 0.000 srgb} bind def
+/col7 {1.000 1.000 1.000 srgb} bind def
+/col8 {0.000 0.000 0.560 srgb} bind def
+/col9 {0.000 0.000 0.690 srgb} bind def
+/col10 {0.000 0.000 0.820 srgb} bind def
+/col11 {0.530 0.810 1.000 srgb} bind def
+/col12 {0.000 0.560 0.000 srgb} bind def
+/col13 {0.000 0.690 0.000 srgb} bind def
+/col14 {0.000 0.820 0.000 srgb} bind def
+/col15 {0.000 0.560 0.560 srgb} bind def
+/col16 {0.000 0.690 0.690 srgb} bind def
+/col17 {0.000 0.820 0.820 srgb} bind def
+/col18 {0.560 0.000 0.000 srgb} bind def
+/col19 {0.690 0.000 0.000 srgb} bind def
+/col20 {0.820 0.000 0.000 srgb} bind def
+/col21 {0.560 0.000 0.560 srgb} bind def
+/col22 {0.690 0.000 0.690 srgb} bind def
+/col23 {0.820 0.000 0.820 srgb} bind def
+/col24 {0.500 0.190 0.000 srgb} bind def
+/col25 {0.630 0.250 0.000 srgb} bind def
+/col26 {0.750 0.380 0.000 srgb} bind def
+/col27 {1.000 0.500 0.500 srgb} bind def
+/col28 {1.000 0.630 0.630 srgb} bind def
+/col29 {1.000 0.750 0.750 srgb} bind def
+/col30 {1.000 0.880 0.880 srgb} bind def
+/col31 {1.000 0.840 0.000 srgb} bind def
+
+end
+save
+newpath 0 36 moveto 0 0 lineto 216 0 lineto 216 36 lineto closepath clip newpath
+-2.5 42.5 translate
+1 -1 scale
+
+/cp {closepath} bind def
+/ef {eofill} bind def
+/gr {grestore} bind def
+/gs {gsave} bind def
+/sa {save} bind def
+/rs {restore} bind def
+/l {lineto} bind def
+/m {moveto} bind def
+/rm {rmoveto} bind def
+/n {newpath} bind def
+/s {stroke} bind def
+/sh {show} bind def
+/slc {setlinecap} bind def
+/slj {setlinejoin} bind def
+/slw {setlinewidth} bind def
+/srgb {setrgbcolor} bind def
+/rot {rotate} bind def
+/sc {scale} bind def
+/sd {setdash} bind def
+/ff {findfont} bind def
+/sf {setfont} bind def
+/scf {scalefont} bind def
+/sw {stringwidth} bind def
+/tr {translate} bind def
+/tnt {dup dup currentrgbcolor
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb}
+ bind def
+/shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul
+ 4 -2 roll mul srgb} bind def
+/$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def
+/$F2psEnd {$F2psEnteredState restore end} def
+
+$F2psBegin
+10 setmiterlimit
+0 slj 0 slc
+ 0.06000 0.06000 sc
+%
+% Fig objects follow
+%
+%
+% here starts figure with depth 0
+% Polyline
+30.000 slw
+n 3600 675 m 75 675 l 75 150 l 3600 150 l
+ cp gs col-1 s gr
+/Times-Bold ff 360.00 scf sf
+1800 525 m
+gs 1 -1 sc (Graphic) dup sw pop 2 div neg 0 rm col-1 sh gr
+% here ends figure;
+$F2psEnd
+rs
+showpage
+
+%%EndDocument
+ @endspecial 10 4760 a(Figure)h(35:)p 0 TeXcolorgray
+Black 42 w(Caption)f(with)g(default)h(format)f(and)-29
+4873 y(raggedleft)i(justi\014cation.)41 b(Caption)31
+b(with)f(default)11 4986 y(format)h(and)e(raggedleft)j
+(justi\014cation.)42 b(Caption)380 5099 y(with)30 b(default)h(format)f
+(and)g(raggedleft)1264 5212 y(justi\014cation.)2083 4590
+y @beginspecial 0 @llx 0 @lly 216 @urx 36 @ury 2252 @rwi
+@setspecial
+%%BeginDocument: short.eps
+%!PS-Adobe-2.0 EPSF-2.0
+%%Title: short.fig
+%%Creator: fig2dev Version 3.2 Patchlevel 4
+%%CreationDate: Sun May 22 21:43:01 2005
+%%For: epstein@linux (Becky Epstein)
+%%BoundingBox: 0 0 216 36
+%%Magnification: 1.0000
+%%EndComments
+/$F2psDict 200 dict def
+$F2psDict begin
+$F2psDict /mtrx matrix put
+/col-1 {0 setgray} bind def
+/col0 {0.000 0.000 0.000 srgb} bind def
+/col1 {0.000 0.000 1.000 srgb} bind def
+/col2 {0.000 1.000 0.000 srgb} bind def
+/col3 {0.000 1.000 1.000 srgb} bind def
+/col4 {1.000 0.000 0.000 srgb} bind def
+/col5 {1.000 0.000 1.000 srgb} bind def
+/col6 {1.000 1.000 0.000 srgb} bind def
+/col7 {1.000 1.000 1.000 srgb} bind def
+/col8 {0.000 0.000 0.560 srgb} bind def
+/col9 {0.000 0.000 0.690 srgb} bind def
+/col10 {0.000 0.000 0.820 srgb} bind def
+/col11 {0.530 0.810 1.000 srgb} bind def
+/col12 {0.000 0.560 0.000 srgb} bind def
+/col13 {0.000 0.690 0.000 srgb} bind def
+/col14 {0.000 0.820 0.000 srgb} bind def
+/col15 {0.000 0.560 0.560 srgb} bind def
+/col16 {0.000 0.690 0.690 srgb} bind def
+/col17 {0.000 0.820 0.820 srgb} bind def
+/col18 {0.560 0.000 0.000 srgb} bind def
+/col19 {0.690 0.000 0.000 srgb} bind def
+/col20 {0.820 0.000 0.000 srgb} bind def
+/col21 {0.560 0.000 0.560 srgb} bind def
+/col22 {0.690 0.000 0.690 srgb} bind def
+/col23 {0.820 0.000 0.820 srgb} bind def
+/col24 {0.500 0.190 0.000 srgb} bind def
+/col25 {0.630 0.250 0.000 srgb} bind def
+/col26 {0.750 0.380 0.000 srgb} bind def
+/col27 {1.000 0.500 0.500 srgb} bind def
+/col28 {1.000 0.630 0.630 srgb} bind def
+/col29 {1.000 0.750 0.750 srgb} bind def
+/col30 {1.000 0.880 0.880 srgb} bind def
+/col31 {1.000 0.840 0.000 srgb} bind def
+
+end
+save
+newpath 0 36 moveto 0 0 lineto 216 0 lineto 216 36 lineto closepath clip newpath
+-2.5 42.5 translate
+1 -1 scale
+
+/cp {closepath} bind def
+/ef {eofill} bind def
+/gr {grestore} bind def
+/gs {gsave} bind def
+/sa {save} bind def
+/rs {restore} bind def
+/l {lineto} bind def
+/m {moveto} bind def
+/rm {rmoveto} bind def
+/n {newpath} bind def
+/s {stroke} bind def
+/sh {show} bind def
+/slc {setlinecap} bind def
+/slj {setlinejoin} bind def
+/slw {setlinewidth} bind def
+/srgb {setrgbcolor} bind def
+/rot {rotate} bind def
+/sc {scale} bind def
+/sd {setdash} bind def
+/ff {findfont} bind def
+/sf {setfont} bind def
+/scf {scalefont} bind def
+/sw {stringwidth} bind def
+/tr {translate} bind def
+/tnt {dup dup currentrgbcolor
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb}
+ bind def
+/shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul
+ 4 -2 roll mul srgb} bind def
+/$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def
+/$F2psEnd {$F2psEnteredState restore end} def
+
+$F2psBegin
+10 setmiterlimit
+0 slj 0 slc
+ 0.06000 0.06000 sc
+%
+% Fig objects follow
+%
+%
+% here starts figure with depth 0
+% Polyline
+30.000 slw
+n 3600 675 m 75 675 l 75 150 l 3600 150 l
+ cp gs col-1 s gr
+/Times-Bold ff 360.00 scf sf
+1800 525 m
+gs 1 -1 sc (Graphic) dup sw pop 2 div neg 0 rm col-1 sh gr
+% here ends figure;
+$F2psEnd
+rs
+showpage
+
+%%EndDocument
+ @endspecial 2516 4760 a(Figure)h(36:)p 0 TeXcolorgray
+Black 42 w(Caption)f(with)g(default)h(for-)2386 4873
+y(mat)g(and)f(RaggedLeft)i(justi\014cation.)41 b(Cap-)2333
+4986 y(tion)31 b(with)f(default)h(format)g(and)e(RaggedLeft)2596
+5099 y(justi\014cation.)41 b(Caption)31 b(with)f(default)2510
+5212 y(format)g(and)g(RaggedLeft)i(justi\014cation.)p
+Black Black 2250 5640 a(82)p Black eop end
+%%Page: 83 83
+TeXDict begin 83 82 bop Black 0 TeXcolorgray Black Black
+Black Black Black 982 150 a @beginspecial 0 @llx 0 @lly
+216 @urx 36 @ury 2252 @rwi @setspecial
+%%BeginDocument: short.eps
+%!PS-Adobe-2.0 EPSF-2.0
+%%Title: short.fig
+%%Creator: fig2dev Version 3.2 Patchlevel 4
+%%CreationDate: Sun May 22 21:43:01 2005
+%%For: epstein@linux (Becky Epstein)
+%%BoundingBox: 0 0 216 36
+%%Magnification: 1.0000
+%%EndComments
+/$F2psDict 200 dict def
+$F2psDict begin
+$F2psDict /mtrx matrix put
+/col-1 {0 setgray} bind def
+/col0 {0.000 0.000 0.000 srgb} bind def
+/col1 {0.000 0.000 1.000 srgb} bind def
+/col2 {0.000 1.000 0.000 srgb} bind def
+/col3 {0.000 1.000 1.000 srgb} bind def
+/col4 {1.000 0.000 0.000 srgb} bind def
+/col5 {1.000 0.000 1.000 srgb} bind def
+/col6 {1.000 1.000 0.000 srgb} bind def
+/col7 {1.000 1.000 1.000 srgb} bind def
+/col8 {0.000 0.000 0.560 srgb} bind def
+/col9 {0.000 0.000 0.690 srgb} bind def
+/col10 {0.000 0.000 0.820 srgb} bind def
+/col11 {0.530 0.810 1.000 srgb} bind def
+/col12 {0.000 0.560 0.000 srgb} bind def
+/col13 {0.000 0.690 0.000 srgb} bind def
+/col14 {0.000 0.820 0.000 srgb} bind def
+/col15 {0.000 0.560 0.560 srgb} bind def
+/col16 {0.000 0.690 0.690 srgb} bind def
+/col17 {0.000 0.820 0.820 srgb} bind def
+/col18 {0.560 0.000 0.000 srgb} bind def
+/col19 {0.690 0.000 0.000 srgb} bind def
+/col20 {0.820 0.000 0.000 srgb} bind def
+/col21 {0.560 0.000 0.560 srgb} bind def
+/col22 {0.690 0.000 0.690 srgb} bind def
+/col23 {0.820 0.000 0.820 srgb} bind def
+/col24 {0.500 0.190 0.000 srgb} bind def
+/col25 {0.630 0.250 0.000 srgb} bind def
+/col26 {0.750 0.380 0.000 srgb} bind def
+/col27 {1.000 0.500 0.500 srgb} bind def
+/col28 {1.000 0.630 0.630 srgb} bind def
+/col29 {1.000 0.750 0.750 srgb} bind def
+/col30 {1.000 0.880 0.880 srgb} bind def
+/col31 {1.000 0.840 0.000 srgb} bind def
+
+end
+save
+newpath 0 36 moveto 0 0 lineto 216 0 lineto 216 36 lineto closepath clip newpath
+-2.5 42.5 translate
+1 -1 scale
+
+/cp {closepath} bind def
+/ef {eofill} bind def
+/gr {grestore} bind def
+/gs {gsave} bind def
+/sa {save} bind def
+/rs {restore} bind def
+/l {lineto} bind def
+/m {moveto} bind def
+/rm {rmoveto} bind def
+/n {newpath} bind def
+/s {stroke} bind def
+/sh {show} bind def
+/slc {setlinecap} bind def
+/slj {setlinejoin} bind def
+/slw {setlinewidth} bind def
+/srgb {setrgbcolor} bind def
+/rot {rotate} bind def
+/sc {scale} bind def
+/sd {setdash} bind def
+/ff {findfont} bind def
+/sf {setfont} bind def
+/scf {scalefont} bind def
+/sw {stringwidth} bind def
+/tr {translate} bind def
+/tnt {dup dup currentrgbcolor
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb}
+ bind def
+/shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul
+ 4 -2 roll mul srgb} bind def
+/$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def
+/$F2psEnd {$F2psEnteredState restore end} def
+
+$F2psBegin
+10 setmiterlimit
+0 slj 0 slc
+ 0.06000 0.06000 sc
+%
+% Fig objects follow
+%
+%
+% here starts figure with depth 0
+% Polyline
+30.000 slw
+n 3600 675 m 75 675 l 75 150 l 3600 150 l
+ cp gs col-1 s gr
+/Times-Bold ff 360.00 scf sf
+1800 525 m
+gs 1 -1 sc (Graphic) dup sw pop 2 div neg 0 rm col-1 sh gr
+% here ends figure;
+$F2psEnd
+rs
+showpage
+
+%%EndDocument
+ @endspecial 171 x FQ(Figure)30 b(37:)p 0 TeXcolorgray
+Black 42 w(Caption)38 b(with)g(hang)g(format)g(and)g(jus-)1425
+434 y(ti\014ed)59 b(justi\014cation.)127 b(Caption)59
+b(with)1425 546 y(hang)43 b(format)g(and)g(justi\014ed)f(justi\014ca-)
+1425 659 y(tion.)f(Caption)28 b(with)g(hang)g(format)h(and)1425
+772 y(justi\014ed)g(justi\014cation.)-120 1227 y @beginspecial
+0 @llx 0 @lly 216 @urx 36 @ury 2252 @rwi @setspecial
+%%BeginDocument: short.eps
+%!PS-Adobe-2.0 EPSF-2.0
+%%Title: short.fig
+%%Creator: fig2dev Version 3.2 Patchlevel 4
+%%CreationDate: Sun May 22 21:43:01 2005
+%%For: epstein@linux (Becky Epstein)
+%%BoundingBox: 0 0 216 36
+%%Magnification: 1.0000
+%%EndComments
+/$F2psDict 200 dict def
+$F2psDict begin
+$F2psDict /mtrx matrix put
+/col-1 {0 setgray} bind def
+/col0 {0.000 0.000 0.000 srgb} bind def
+/col1 {0.000 0.000 1.000 srgb} bind def
+/col2 {0.000 1.000 0.000 srgb} bind def
+/col3 {0.000 1.000 1.000 srgb} bind def
+/col4 {1.000 0.000 0.000 srgb} bind def
+/col5 {1.000 0.000 1.000 srgb} bind def
+/col6 {1.000 1.000 0.000 srgb} bind def
+/col7 {1.000 1.000 1.000 srgb} bind def
+/col8 {0.000 0.000 0.560 srgb} bind def
+/col9 {0.000 0.000 0.690 srgb} bind def
+/col10 {0.000 0.000 0.820 srgb} bind def
+/col11 {0.530 0.810 1.000 srgb} bind def
+/col12 {0.000 0.560 0.000 srgb} bind def
+/col13 {0.000 0.690 0.000 srgb} bind def
+/col14 {0.000 0.820 0.000 srgb} bind def
+/col15 {0.000 0.560 0.560 srgb} bind def
+/col16 {0.000 0.690 0.690 srgb} bind def
+/col17 {0.000 0.820 0.820 srgb} bind def
+/col18 {0.560 0.000 0.000 srgb} bind def
+/col19 {0.690 0.000 0.000 srgb} bind def
+/col20 {0.820 0.000 0.000 srgb} bind def
+/col21 {0.560 0.000 0.560 srgb} bind def
+/col22 {0.690 0.000 0.690 srgb} bind def
+/col23 {0.820 0.000 0.820 srgb} bind def
+/col24 {0.500 0.190 0.000 srgb} bind def
+/col25 {0.630 0.250 0.000 srgb} bind def
+/col26 {0.750 0.380 0.000 srgb} bind def
+/col27 {1.000 0.500 0.500 srgb} bind def
+/col28 {1.000 0.630 0.630 srgb} bind def
+/col29 {1.000 0.750 0.750 srgb} bind def
+/col30 {1.000 0.880 0.880 srgb} bind def
+/col31 {1.000 0.840 0.000 srgb} bind def
+
+end
+save
+newpath 0 36 moveto 0 0 lineto 216 0 lineto 216 36 lineto closepath clip newpath
+-2.5 42.5 translate
+1 -1 scale
+
+/cp {closepath} bind def
+/ef {eofill} bind def
+/gr {grestore} bind def
+/gs {gsave} bind def
+/sa {save} bind def
+/rs {restore} bind def
+/l {lineto} bind def
+/m {moveto} bind def
+/rm {rmoveto} bind def
+/n {newpath} bind def
+/s {stroke} bind def
+/sh {show} bind def
+/slc {setlinecap} bind def
+/slj {setlinejoin} bind def
+/slw {setlinewidth} bind def
+/srgb {setrgbcolor} bind def
+/rot {rotate} bind def
+/sc {scale} bind def
+/sd {setdash} bind def
+/ff {findfont} bind def
+/sf {setfont} bind def
+/scf {scalefont} bind def
+/sw {stringwidth} bind def
+/tr {translate} bind def
+/tnt {dup dup currentrgbcolor
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb}
+ bind def
+/shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul
+ 4 -2 roll mul srgb} bind def
+/$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def
+/$F2psEnd {$F2psEnteredState restore end} def
+
+$F2psBegin
+10 setmiterlimit
+0 slj 0 slc
+ 0.06000 0.06000 sc
+%
+% Fig objects follow
+%
+%
+% here starts figure with depth 0
+% Polyline
+30.000 slw
+n 3600 675 m 75 675 l 75 150 l 3600 150 l
+ cp gs col-1 s gr
+/Times-Bold ff 360.00 scf sf
+1800 525 m
+gs 1 -1 sc (Graphic) dup sw pop 2 div neg 0 rm col-1 sh gr
+% here ends figure;
+$F2psEnd
+rs
+showpage
+
+%%EndDocument
+ @endspecial 170 x(Figure)i(38:)p 0 TeXcolorgray Black
+41 w(Caption)k(with)g(hang)f(format)h(and)f(cen-)323
+1510 y(terlast)50 b(justi\014cation.)96 b(Caption)49
+b(with)323 1623 y(hang)27 b(format)g(and)f(cen)m(terlast)i
+(justi\014ca-)323 1736 y(tion.)41 b(Caption)28 b(with)g(hang)h(format)f
+(and)587 1849 y(cen)m(terlast)33 b(justi\014cation.)2083
+1227 y @beginspecial 0 @llx 0 @lly 216 @urx 36 @ury 2252
+@rwi @setspecial
+%%BeginDocument: short.eps
+%!PS-Adobe-2.0 EPSF-2.0
+%%Title: short.fig
+%%Creator: fig2dev Version 3.2 Patchlevel 4
+%%CreationDate: Sun May 22 21:43:01 2005
+%%For: epstein@linux (Becky Epstein)
+%%BoundingBox: 0 0 216 36
+%%Magnification: 1.0000
+%%EndComments
+/$F2psDict 200 dict def
+$F2psDict begin
+$F2psDict /mtrx matrix put
+/col-1 {0 setgray} bind def
+/col0 {0.000 0.000 0.000 srgb} bind def
+/col1 {0.000 0.000 1.000 srgb} bind def
+/col2 {0.000 1.000 0.000 srgb} bind def
+/col3 {0.000 1.000 1.000 srgb} bind def
+/col4 {1.000 0.000 0.000 srgb} bind def
+/col5 {1.000 0.000 1.000 srgb} bind def
+/col6 {1.000 1.000 0.000 srgb} bind def
+/col7 {1.000 1.000 1.000 srgb} bind def
+/col8 {0.000 0.000 0.560 srgb} bind def
+/col9 {0.000 0.000 0.690 srgb} bind def
+/col10 {0.000 0.000 0.820 srgb} bind def
+/col11 {0.530 0.810 1.000 srgb} bind def
+/col12 {0.000 0.560 0.000 srgb} bind def
+/col13 {0.000 0.690 0.000 srgb} bind def
+/col14 {0.000 0.820 0.000 srgb} bind def
+/col15 {0.000 0.560 0.560 srgb} bind def
+/col16 {0.000 0.690 0.690 srgb} bind def
+/col17 {0.000 0.820 0.820 srgb} bind def
+/col18 {0.560 0.000 0.000 srgb} bind def
+/col19 {0.690 0.000 0.000 srgb} bind def
+/col20 {0.820 0.000 0.000 srgb} bind def
+/col21 {0.560 0.000 0.560 srgb} bind def
+/col22 {0.690 0.000 0.690 srgb} bind def
+/col23 {0.820 0.000 0.820 srgb} bind def
+/col24 {0.500 0.190 0.000 srgb} bind def
+/col25 {0.630 0.250 0.000 srgb} bind def
+/col26 {0.750 0.380 0.000 srgb} bind def
+/col27 {1.000 0.500 0.500 srgb} bind def
+/col28 {1.000 0.630 0.630 srgb} bind def
+/col29 {1.000 0.750 0.750 srgb} bind def
+/col30 {1.000 0.880 0.880 srgb} bind def
+/col31 {1.000 0.840 0.000 srgb} bind def
+
+end
+save
+newpath 0 36 moveto 0 0 lineto 216 0 lineto 216 36 lineto closepath clip newpath
+-2.5 42.5 translate
+1 -1 scale
+
+/cp {closepath} bind def
+/ef {eofill} bind def
+/gr {grestore} bind def
+/gs {gsave} bind def
+/sa {save} bind def
+/rs {restore} bind def
+/l {lineto} bind def
+/m {moveto} bind def
+/rm {rmoveto} bind def
+/n {newpath} bind def
+/s {stroke} bind def
+/sh {show} bind def
+/slc {setlinecap} bind def
+/slj {setlinejoin} bind def
+/slw {setlinewidth} bind def
+/srgb {setrgbcolor} bind def
+/rot {rotate} bind def
+/sc {scale} bind def
+/sd {setdash} bind def
+/ff {findfont} bind def
+/sf {setfont} bind def
+/scf {scalefont} bind def
+/sw {stringwidth} bind def
+/tr {translate} bind def
+/tnt {dup dup currentrgbcolor
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb}
+ bind def
+/shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul
+ 4 -2 roll mul srgb} bind def
+/$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def
+/$F2psEnd {$F2psEnteredState restore end} def
+
+$F2psBegin
+10 setmiterlimit
+0 slj 0 slc
+ 0.06000 0.06000 sc
+%
+% Fig objects follow
+%
+%
+% here starts figure with depth 0
+% Polyline
+30.000 slw
+n 3600 675 m 75 675 l 75 150 l 3600 150 l
+ cp gs col-1 s gr
+/Times-Bold ff 360.00 scf sf
+1800 525 m
+gs 1 -1 sc (Graphic) dup sw pop 2 div neg 0 rm col-1 sh gr
+% here ends figure;
+$F2psEnd
+rs
+showpage
+
+%%EndDocument
+ @endspecial 2278 1397 a(Figure)e(39:)p 0 TeXcolorgray
+Black 42 w(Caption)f(with)g(hang)g(format)2527 1510 y(and)20
+b(cen)m(ter\014rst)h(justi\014cation.)38 b(Caption)2527
+1623 y(with)63 b(hang)h(format)g(and)g(cen)m(ter\014rst)2527
+1736 y(justi\014cation.)132 b(Caption)61 b(with)g(hang)2527
+1849 y(format)44 b(and)f(cen)m(ter\014rst)h(justi\014cation.)-120
+2303 y @beginspecial 0 @llx 0 @lly 216 @urx 36 @ury 2252
+@rwi @setspecial
+%%BeginDocument: short.eps
+%!PS-Adobe-2.0 EPSF-2.0
+%%Title: short.fig
+%%Creator: fig2dev Version 3.2 Patchlevel 4
+%%CreationDate: Sun May 22 21:43:01 2005
+%%For: epstein@linux (Becky Epstein)
+%%BoundingBox: 0 0 216 36
+%%Magnification: 1.0000
+%%EndComments
+/$F2psDict 200 dict def
+$F2psDict begin
+$F2psDict /mtrx matrix put
+/col-1 {0 setgray} bind def
+/col0 {0.000 0.000 0.000 srgb} bind def
+/col1 {0.000 0.000 1.000 srgb} bind def
+/col2 {0.000 1.000 0.000 srgb} bind def
+/col3 {0.000 1.000 1.000 srgb} bind def
+/col4 {1.000 0.000 0.000 srgb} bind def
+/col5 {1.000 0.000 1.000 srgb} bind def
+/col6 {1.000 1.000 0.000 srgb} bind def
+/col7 {1.000 1.000 1.000 srgb} bind def
+/col8 {0.000 0.000 0.560 srgb} bind def
+/col9 {0.000 0.000 0.690 srgb} bind def
+/col10 {0.000 0.000 0.820 srgb} bind def
+/col11 {0.530 0.810 1.000 srgb} bind def
+/col12 {0.000 0.560 0.000 srgb} bind def
+/col13 {0.000 0.690 0.000 srgb} bind def
+/col14 {0.000 0.820 0.000 srgb} bind def
+/col15 {0.000 0.560 0.560 srgb} bind def
+/col16 {0.000 0.690 0.690 srgb} bind def
+/col17 {0.000 0.820 0.820 srgb} bind def
+/col18 {0.560 0.000 0.000 srgb} bind def
+/col19 {0.690 0.000 0.000 srgb} bind def
+/col20 {0.820 0.000 0.000 srgb} bind def
+/col21 {0.560 0.000 0.560 srgb} bind def
+/col22 {0.690 0.000 0.690 srgb} bind def
+/col23 {0.820 0.000 0.820 srgb} bind def
+/col24 {0.500 0.190 0.000 srgb} bind def
+/col25 {0.630 0.250 0.000 srgb} bind def
+/col26 {0.750 0.380 0.000 srgb} bind def
+/col27 {1.000 0.500 0.500 srgb} bind def
+/col28 {1.000 0.630 0.630 srgb} bind def
+/col29 {1.000 0.750 0.750 srgb} bind def
+/col30 {1.000 0.880 0.880 srgb} bind def
+/col31 {1.000 0.840 0.000 srgb} bind def
+
+end
+save
+newpath 0 36 moveto 0 0 lineto 216 0 lineto 216 36 lineto closepath clip newpath
+-2.5 42.5 translate
+1 -1 scale
+
+/cp {closepath} bind def
+/ef {eofill} bind def
+/gr {grestore} bind def
+/gs {gsave} bind def
+/sa {save} bind def
+/rs {restore} bind def
+/l {lineto} bind def
+/m {moveto} bind def
+/rm {rmoveto} bind def
+/n {newpath} bind def
+/s {stroke} bind def
+/sh {show} bind def
+/slc {setlinecap} bind def
+/slj {setlinejoin} bind def
+/slw {setlinewidth} bind def
+/srgb {setrgbcolor} bind def
+/rot {rotate} bind def
+/sc {scale} bind def
+/sd {setdash} bind def
+/ff {findfont} bind def
+/sf {setfont} bind def
+/scf {scalefont} bind def
+/sw {stringwidth} bind def
+/tr {translate} bind def
+/tnt {dup dup currentrgbcolor
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb}
+ bind def
+/shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul
+ 4 -2 roll mul srgb} bind def
+/$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def
+/$F2psEnd {$F2psEnteredState restore end} def
+
+$F2psBegin
+10 setmiterlimit
+0 slj 0 slc
+ 0.06000 0.06000 sc
+%
+% Fig objects follow
+%
+%
+% here starts figure with depth 0
+% Polyline
+30.000 slw
+n 3600 675 m 75 675 l 75 150 l 3600 150 l
+ cp gs col-1 s gr
+/Times-Bold ff 360.00 scf sf
+1800 525 m
+gs 1 -1 sc (Graphic) dup sw pop 2 div neg 0 rm col-1 sh gr
+% here ends figure;
+$F2psEnd
+rs
+showpage
+
+%%EndDocument
+ @endspecial -13 2474 a(Figure)31 b(40:)p 0 TeXcolorgray
+Black 41 w(Caption)g(with)f(hang)g(format)h(and)419 2587
+y(cen)m(tering)g(justi\014cation.)42 b(Caption)409 2700
+y(with)30 b(hang)g(format)h(and)e(cen)m(tering)400 2813
+y(justi\014cation.)41 b(Caption)31 b(with)f(hang)362
+2925 y(format)g(and)g(cen)m(tering)i(justi\014cation.)2083
+2303 y @beginspecial 0 @llx 0 @lly 216 @urx 36 @ury 2252
+@rwi @setspecial
+%%BeginDocument: short.eps
+%!PS-Adobe-2.0 EPSF-2.0
+%%Title: short.fig
+%%Creator: fig2dev Version 3.2 Patchlevel 4
+%%CreationDate: Sun May 22 21:43:01 2005
+%%For: epstein@linux (Becky Epstein)
+%%BoundingBox: 0 0 216 36
+%%Magnification: 1.0000
+%%EndComments
+/$F2psDict 200 dict def
+$F2psDict begin
+$F2psDict /mtrx matrix put
+/col-1 {0 setgray} bind def
+/col0 {0.000 0.000 0.000 srgb} bind def
+/col1 {0.000 0.000 1.000 srgb} bind def
+/col2 {0.000 1.000 0.000 srgb} bind def
+/col3 {0.000 1.000 1.000 srgb} bind def
+/col4 {1.000 0.000 0.000 srgb} bind def
+/col5 {1.000 0.000 1.000 srgb} bind def
+/col6 {1.000 1.000 0.000 srgb} bind def
+/col7 {1.000 1.000 1.000 srgb} bind def
+/col8 {0.000 0.000 0.560 srgb} bind def
+/col9 {0.000 0.000 0.690 srgb} bind def
+/col10 {0.000 0.000 0.820 srgb} bind def
+/col11 {0.530 0.810 1.000 srgb} bind def
+/col12 {0.000 0.560 0.000 srgb} bind def
+/col13 {0.000 0.690 0.000 srgb} bind def
+/col14 {0.000 0.820 0.000 srgb} bind def
+/col15 {0.000 0.560 0.560 srgb} bind def
+/col16 {0.000 0.690 0.690 srgb} bind def
+/col17 {0.000 0.820 0.820 srgb} bind def
+/col18 {0.560 0.000 0.000 srgb} bind def
+/col19 {0.690 0.000 0.000 srgb} bind def
+/col20 {0.820 0.000 0.000 srgb} bind def
+/col21 {0.560 0.000 0.560 srgb} bind def
+/col22 {0.690 0.000 0.690 srgb} bind def
+/col23 {0.820 0.000 0.820 srgb} bind def
+/col24 {0.500 0.190 0.000 srgb} bind def
+/col25 {0.630 0.250 0.000 srgb} bind def
+/col26 {0.750 0.380 0.000 srgb} bind def
+/col27 {1.000 0.500 0.500 srgb} bind def
+/col28 {1.000 0.630 0.630 srgb} bind def
+/col29 {1.000 0.750 0.750 srgb} bind def
+/col30 {1.000 0.880 0.880 srgb} bind def
+/col31 {1.000 0.840 0.000 srgb} bind def
+
+end
+save
+newpath 0 36 moveto 0 0 lineto 216 0 lineto 216 36 lineto closepath clip newpath
+-2.5 42.5 translate
+1 -1 scale
+
+/cp {closepath} bind def
+/ef {eofill} bind def
+/gr {grestore} bind def
+/gs {gsave} bind def
+/sa {save} bind def
+/rs {restore} bind def
+/l {lineto} bind def
+/m {moveto} bind def
+/rm {rmoveto} bind def
+/n {newpath} bind def
+/s {stroke} bind def
+/sh {show} bind def
+/slc {setlinecap} bind def
+/slj {setlinejoin} bind def
+/slw {setlinewidth} bind def
+/srgb {setrgbcolor} bind def
+/rot {rotate} bind def
+/sc {scale} bind def
+/sd {setdash} bind def
+/ff {findfont} bind def
+/sf {setfont} bind def
+/scf {scalefont} bind def
+/sw {stringwidth} bind def
+/tr {translate} bind def
+/tnt {dup dup currentrgbcolor
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb}
+ bind def
+/shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul
+ 4 -2 roll mul srgb} bind def
+/$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def
+/$F2psEnd {$F2psEnteredState restore end} def
+
+$F2psBegin
+10 setmiterlimit
+0 slj 0 slc
+ 0.06000 0.06000 sc
+%
+% Fig objects follow
+%
+%
+% here starts figure with depth 0
+% Polyline
+30.000 slw
+n 3600 675 m 75 675 l 75 150 l 3600 150 l
+ cp gs col-1 s gr
+/Times-Bold ff 360.00 scf sf
+1800 525 m
+gs 1 -1 sc (Graphic) dup sw pop 2 div neg 0 rm col-1 sh gr
+% here ends figure;
+$F2psEnd
+rs
+showpage
+
+%%EndDocument
+ @endspecial 2190 2474 a(Figure)f(41:)p 0 TeXcolorgray
+Black 41 w(Caption)g(with)f(hang)g(format)h(and)2609
+2587 y(Cen)m(tering)g(justi\014cation.)41 b(Caption)2599
+2700 y(with)30 b(hang)g(format)h(and)f(Cen)m(tering)2603
+2813 y(justi\014cation.)41 b(Caption)31 b(with)f(hang)2552
+2925 y(format)h(and)f(Cen)m(tering)h(justi\014cation.)-120
+3380 y @beginspecial 0 @llx 0 @lly 216 @urx 36 @ury 2252
+@rwi @setspecial
+%%BeginDocument: short.eps
+%!PS-Adobe-2.0 EPSF-2.0
+%%Title: short.fig
+%%Creator: fig2dev Version 3.2 Patchlevel 4
+%%CreationDate: Sun May 22 21:43:01 2005
+%%For: epstein@linux (Becky Epstein)
+%%BoundingBox: 0 0 216 36
+%%Magnification: 1.0000
+%%EndComments
+/$F2psDict 200 dict def
+$F2psDict begin
+$F2psDict /mtrx matrix put
+/col-1 {0 setgray} bind def
+/col0 {0.000 0.000 0.000 srgb} bind def
+/col1 {0.000 0.000 1.000 srgb} bind def
+/col2 {0.000 1.000 0.000 srgb} bind def
+/col3 {0.000 1.000 1.000 srgb} bind def
+/col4 {1.000 0.000 0.000 srgb} bind def
+/col5 {1.000 0.000 1.000 srgb} bind def
+/col6 {1.000 1.000 0.000 srgb} bind def
+/col7 {1.000 1.000 1.000 srgb} bind def
+/col8 {0.000 0.000 0.560 srgb} bind def
+/col9 {0.000 0.000 0.690 srgb} bind def
+/col10 {0.000 0.000 0.820 srgb} bind def
+/col11 {0.530 0.810 1.000 srgb} bind def
+/col12 {0.000 0.560 0.000 srgb} bind def
+/col13 {0.000 0.690 0.000 srgb} bind def
+/col14 {0.000 0.820 0.000 srgb} bind def
+/col15 {0.000 0.560 0.560 srgb} bind def
+/col16 {0.000 0.690 0.690 srgb} bind def
+/col17 {0.000 0.820 0.820 srgb} bind def
+/col18 {0.560 0.000 0.000 srgb} bind def
+/col19 {0.690 0.000 0.000 srgb} bind def
+/col20 {0.820 0.000 0.000 srgb} bind def
+/col21 {0.560 0.000 0.560 srgb} bind def
+/col22 {0.690 0.000 0.690 srgb} bind def
+/col23 {0.820 0.000 0.820 srgb} bind def
+/col24 {0.500 0.190 0.000 srgb} bind def
+/col25 {0.630 0.250 0.000 srgb} bind def
+/col26 {0.750 0.380 0.000 srgb} bind def
+/col27 {1.000 0.500 0.500 srgb} bind def
+/col28 {1.000 0.630 0.630 srgb} bind def
+/col29 {1.000 0.750 0.750 srgb} bind def
+/col30 {1.000 0.880 0.880 srgb} bind def
+/col31 {1.000 0.840 0.000 srgb} bind def
+
+end
+save
+newpath 0 36 moveto 0 0 lineto 216 0 lineto 216 36 lineto closepath clip newpath
+-2.5 42.5 translate
+1 -1 scale
+
+/cp {closepath} bind def
+/ef {eofill} bind def
+/gr {grestore} bind def
+/gs {gsave} bind def
+/sa {save} bind def
+/rs {restore} bind def
+/l {lineto} bind def
+/m {moveto} bind def
+/rm {rmoveto} bind def
+/n {newpath} bind def
+/s {stroke} bind def
+/sh {show} bind def
+/slc {setlinecap} bind def
+/slj {setlinejoin} bind def
+/slw {setlinewidth} bind def
+/srgb {setrgbcolor} bind def
+/rot {rotate} bind def
+/sc {scale} bind def
+/sd {setdash} bind def
+/ff {findfont} bind def
+/sf {setfont} bind def
+/scf {scalefont} bind def
+/sw {stringwidth} bind def
+/tr {translate} bind def
+/tnt {dup dup currentrgbcolor
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb}
+ bind def
+/shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul
+ 4 -2 roll mul srgb} bind def
+/$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def
+/$F2psEnd {$F2psEnteredState restore end} def
+
+$F2psBegin
+10 setmiterlimit
+0 slj 0 slc
+ 0.06000 0.06000 sc
+%
+% Fig objects follow
+%
+%
+% here starts figure with depth 0
+% Polyline
+30.000 slw
+n 3600 675 m 75 675 l 75 150 l 3600 150 l
+ cp gs col-1 s gr
+/Times-Bold ff 360.00 scf sf
+1800 525 m
+gs 1 -1 sc (Graphic) dup sw pop 2 div neg 0 rm col-1 sh gr
+% here ends figure;
+$F2psEnd
+rs
+showpage
+
+%%EndDocument
+ @endspecial 170 x(Figure)g(42:)p 0 TeXcolorgray Black
+41 w(Caption)g(with)f(hang)g(format)h(and)323 3663 y(raggedrigh)m(t)h
+(justi\014cation.)42 b(Caption)323 3776 y(with)31 b(hang)f(format)g
+(and)g(raggedrigh)m(t)323 3889 y(justi\014cation.)42
+b(Caption)30 b(with)g(hang)323 4002 y(format)h(and)f(raggedrigh)m(t)323
+4115 y(justi\014cation.)2083 3380 y @beginspecial 0 @llx
+0 @lly 216 @urx 36 @ury 2252 @rwi @setspecial
+%%BeginDocument: short.eps
+%!PS-Adobe-2.0 EPSF-2.0
+%%Title: short.fig
+%%Creator: fig2dev Version 3.2 Patchlevel 4
+%%CreationDate: Sun May 22 21:43:01 2005
+%%For: epstein@linux (Becky Epstein)
+%%BoundingBox: 0 0 216 36
+%%Magnification: 1.0000
+%%EndComments
+/$F2psDict 200 dict def
+$F2psDict begin
+$F2psDict /mtrx matrix put
+/col-1 {0 setgray} bind def
+/col0 {0.000 0.000 0.000 srgb} bind def
+/col1 {0.000 0.000 1.000 srgb} bind def
+/col2 {0.000 1.000 0.000 srgb} bind def
+/col3 {0.000 1.000 1.000 srgb} bind def
+/col4 {1.000 0.000 0.000 srgb} bind def
+/col5 {1.000 0.000 1.000 srgb} bind def
+/col6 {1.000 1.000 0.000 srgb} bind def
+/col7 {1.000 1.000 1.000 srgb} bind def
+/col8 {0.000 0.000 0.560 srgb} bind def
+/col9 {0.000 0.000 0.690 srgb} bind def
+/col10 {0.000 0.000 0.820 srgb} bind def
+/col11 {0.530 0.810 1.000 srgb} bind def
+/col12 {0.000 0.560 0.000 srgb} bind def
+/col13 {0.000 0.690 0.000 srgb} bind def
+/col14 {0.000 0.820 0.000 srgb} bind def
+/col15 {0.000 0.560 0.560 srgb} bind def
+/col16 {0.000 0.690 0.690 srgb} bind def
+/col17 {0.000 0.820 0.820 srgb} bind def
+/col18 {0.560 0.000 0.000 srgb} bind def
+/col19 {0.690 0.000 0.000 srgb} bind def
+/col20 {0.820 0.000 0.000 srgb} bind def
+/col21 {0.560 0.000 0.560 srgb} bind def
+/col22 {0.690 0.000 0.690 srgb} bind def
+/col23 {0.820 0.000 0.820 srgb} bind def
+/col24 {0.500 0.190 0.000 srgb} bind def
+/col25 {0.630 0.250 0.000 srgb} bind def
+/col26 {0.750 0.380 0.000 srgb} bind def
+/col27 {1.000 0.500 0.500 srgb} bind def
+/col28 {1.000 0.630 0.630 srgb} bind def
+/col29 {1.000 0.750 0.750 srgb} bind def
+/col30 {1.000 0.880 0.880 srgb} bind def
+/col31 {1.000 0.840 0.000 srgb} bind def
+
+end
+save
+newpath 0 36 moveto 0 0 lineto 216 0 lineto 216 36 lineto closepath clip newpath
+-2.5 42.5 translate
+1 -1 scale
+
+/cp {closepath} bind def
+/ef {eofill} bind def
+/gr {grestore} bind def
+/gs {gsave} bind def
+/sa {save} bind def
+/rs {restore} bind def
+/l {lineto} bind def
+/m {moveto} bind def
+/rm {rmoveto} bind def
+/n {newpath} bind def
+/s {stroke} bind def
+/sh {show} bind def
+/slc {setlinecap} bind def
+/slj {setlinejoin} bind def
+/slw {setlinewidth} bind def
+/srgb {setrgbcolor} bind def
+/rot {rotate} bind def
+/sc {scale} bind def
+/sd {setdash} bind def
+/ff {findfont} bind def
+/sf {setfont} bind def
+/scf {scalefont} bind def
+/sw {stringwidth} bind def
+/tr {translate} bind def
+/tnt {dup dup currentrgbcolor
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb}
+ bind def
+/shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul
+ 4 -2 roll mul srgb} bind def
+/$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def
+/$F2psEnd {$F2psEnteredState restore end} def
+
+$F2psBegin
+10 setmiterlimit
+0 slj 0 slc
+ 0.06000 0.06000 sc
+%
+% Fig objects follow
+%
+%
+% here starts figure with depth 0
+% Polyline
+30.000 slw
+n 3600 675 m 75 675 l 75 150 l 3600 150 l
+ cp gs col-1 s gr
+/Times-Bold ff 360.00 scf sf
+1800 525 m
+gs 1 -1 sc (Graphic) dup sw pop 2 div neg 0 rm col-1 sh gr
+% here ends figure;
+$F2psEnd
+rs
+showpage
+
+%%EndDocument
+ @endspecial 170 x(Figure)h(43:)p 0 TeXcolorgray Black
+42 w(Caption)f(with)g(hang)g(format)h(and)2527 3663 y(RaggedRigh)m(t)h
+(justi\014cation.)41 b(Caption)2527 3776 y(with)30 b(hang)g(format)h
+(and)e(RaggedRigh)m(t)2527 3889 y(justi\014cation.)41
+b(Caption)30 b(with)h(hang)2527 4002 y(format)f(and)g(RaggedRigh)m(t)j
+(justi\014ca-)2527 4115 y(tion.)-120 4570 y @beginspecial
+0 @llx 0 @lly 216 @urx 36 @ury 2252 @rwi @setspecial
+%%BeginDocument: short.eps
+%!PS-Adobe-2.0 EPSF-2.0
+%%Title: short.fig
+%%Creator: fig2dev Version 3.2 Patchlevel 4
+%%CreationDate: Sun May 22 21:43:01 2005
+%%For: epstein@linux (Becky Epstein)
+%%BoundingBox: 0 0 216 36
+%%Magnification: 1.0000
+%%EndComments
+/$F2psDict 200 dict def
+$F2psDict begin
+$F2psDict /mtrx matrix put
+/col-1 {0 setgray} bind def
+/col0 {0.000 0.000 0.000 srgb} bind def
+/col1 {0.000 0.000 1.000 srgb} bind def
+/col2 {0.000 1.000 0.000 srgb} bind def
+/col3 {0.000 1.000 1.000 srgb} bind def
+/col4 {1.000 0.000 0.000 srgb} bind def
+/col5 {1.000 0.000 1.000 srgb} bind def
+/col6 {1.000 1.000 0.000 srgb} bind def
+/col7 {1.000 1.000 1.000 srgb} bind def
+/col8 {0.000 0.000 0.560 srgb} bind def
+/col9 {0.000 0.000 0.690 srgb} bind def
+/col10 {0.000 0.000 0.820 srgb} bind def
+/col11 {0.530 0.810 1.000 srgb} bind def
+/col12 {0.000 0.560 0.000 srgb} bind def
+/col13 {0.000 0.690 0.000 srgb} bind def
+/col14 {0.000 0.820 0.000 srgb} bind def
+/col15 {0.000 0.560 0.560 srgb} bind def
+/col16 {0.000 0.690 0.690 srgb} bind def
+/col17 {0.000 0.820 0.820 srgb} bind def
+/col18 {0.560 0.000 0.000 srgb} bind def
+/col19 {0.690 0.000 0.000 srgb} bind def
+/col20 {0.820 0.000 0.000 srgb} bind def
+/col21 {0.560 0.000 0.560 srgb} bind def
+/col22 {0.690 0.000 0.690 srgb} bind def
+/col23 {0.820 0.000 0.820 srgb} bind def
+/col24 {0.500 0.190 0.000 srgb} bind def
+/col25 {0.630 0.250 0.000 srgb} bind def
+/col26 {0.750 0.380 0.000 srgb} bind def
+/col27 {1.000 0.500 0.500 srgb} bind def
+/col28 {1.000 0.630 0.630 srgb} bind def
+/col29 {1.000 0.750 0.750 srgb} bind def
+/col30 {1.000 0.880 0.880 srgb} bind def
+/col31 {1.000 0.840 0.000 srgb} bind def
+
+end
+save
+newpath 0 36 moveto 0 0 lineto 216 0 lineto 216 36 lineto closepath clip newpath
+-2.5 42.5 translate
+1 -1 scale
+
+/cp {closepath} bind def
+/ef {eofill} bind def
+/gr {grestore} bind def
+/gs {gsave} bind def
+/sa {save} bind def
+/rs {restore} bind def
+/l {lineto} bind def
+/m {moveto} bind def
+/rm {rmoveto} bind def
+/n {newpath} bind def
+/s {stroke} bind def
+/sh {show} bind def
+/slc {setlinecap} bind def
+/slj {setlinejoin} bind def
+/slw {setlinewidth} bind def
+/srgb {setrgbcolor} bind def
+/rot {rotate} bind def
+/sc {scale} bind def
+/sd {setdash} bind def
+/ff {findfont} bind def
+/sf {setfont} bind def
+/scf {scalefont} bind def
+/sw {stringwidth} bind def
+/tr {translate} bind def
+/tnt {dup dup currentrgbcolor
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb}
+ bind def
+/shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul
+ 4 -2 roll mul srgb} bind def
+/$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def
+/$F2psEnd {$F2psEnteredState restore end} def
+
+$F2psBegin
+10 setmiterlimit
+0 slj 0 slc
+ 0.06000 0.06000 sc
+%
+% Fig objects follow
+%
+%
+% here starts figure with depth 0
+% Polyline
+30.000 slw
+n 3600 675 m 75 675 l 75 150 l 3600 150 l
+ cp gs col-1 s gr
+/Times-Bold ff 360.00 scf sf
+1800 525 m
+gs 1 -1 sc (Graphic) dup sw pop 2 div neg 0 rm col-1 sh gr
+% here ends figure;
+$F2psEnd
+rs
+showpage
+
+%%EndDocument
+ @endspecial 93 4740 a(Figure)e(44:)p 0 TeXcolorgray
+Black 42 w(Caption)f(with)g(hang)h(format)f(and)483 4853
+y(raggedleft)i(justi\014cation.)42 b(Caption)463 4966
+y(with)30 b(hang)h(format)f(and)g(raggedleft)476 5079
+y(justi\014cation.)41 b(Caption)31 b(with)f(hang)369
+5192 y(format)h(and)f(raggedleft)i(justi\014cation.)2083
+4570 y @beginspecial 0 @llx 0 @lly 216 @urx 36 @ury 2252
+@rwi @setspecial
+%%BeginDocument: short.eps
+%!PS-Adobe-2.0 EPSF-2.0
+%%Title: short.fig
+%%Creator: fig2dev Version 3.2 Patchlevel 4
+%%CreationDate: Sun May 22 21:43:01 2005
+%%For: epstein@linux (Becky Epstein)
+%%BoundingBox: 0 0 216 36
+%%Magnification: 1.0000
+%%EndComments
+/$F2psDict 200 dict def
+$F2psDict begin
+$F2psDict /mtrx matrix put
+/col-1 {0 setgray} bind def
+/col0 {0.000 0.000 0.000 srgb} bind def
+/col1 {0.000 0.000 1.000 srgb} bind def
+/col2 {0.000 1.000 0.000 srgb} bind def
+/col3 {0.000 1.000 1.000 srgb} bind def
+/col4 {1.000 0.000 0.000 srgb} bind def
+/col5 {1.000 0.000 1.000 srgb} bind def
+/col6 {1.000 1.000 0.000 srgb} bind def
+/col7 {1.000 1.000 1.000 srgb} bind def
+/col8 {0.000 0.000 0.560 srgb} bind def
+/col9 {0.000 0.000 0.690 srgb} bind def
+/col10 {0.000 0.000 0.820 srgb} bind def
+/col11 {0.530 0.810 1.000 srgb} bind def
+/col12 {0.000 0.560 0.000 srgb} bind def
+/col13 {0.000 0.690 0.000 srgb} bind def
+/col14 {0.000 0.820 0.000 srgb} bind def
+/col15 {0.000 0.560 0.560 srgb} bind def
+/col16 {0.000 0.690 0.690 srgb} bind def
+/col17 {0.000 0.820 0.820 srgb} bind def
+/col18 {0.560 0.000 0.000 srgb} bind def
+/col19 {0.690 0.000 0.000 srgb} bind def
+/col20 {0.820 0.000 0.000 srgb} bind def
+/col21 {0.560 0.000 0.560 srgb} bind def
+/col22 {0.690 0.000 0.690 srgb} bind def
+/col23 {0.820 0.000 0.820 srgb} bind def
+/col24 {0.500 0.190 0.000 srgb} bind def
+/col25 {0.630 0.250 0.000 srgb} bind def
+/col26 {0.750 0.380 0.000 srgb} bind def
+/col27 {1.000 0.500 0.500 srgb} bind def
+/col28 {1.000 0.630 0.630 srgb} bind def
+/col29 {1.000 0.750 0.750 srgb} bind def
+/col30 {1.000 0.880 0.880 srgb} bind def
+/col31 {1.000 0.840 0.000 srgb} bind def
+
+end
+save
+newpath 0 36 moveto 0 0 lineto 216 0 lineto 216 36 lineto closepath clip newpath
+-2.5 42.5 translate
+1 -1 scale
+
+/cp {closepath} bind def
+/ef {eofill} bind def
+/gr {grestore} bind def
+/gs {gsave} bind def
+/sa {save} bind def
+/rs {restore} bind def
+/l {lineto} bind def
+/m {moveto} bind def
+/rm {rmoveto} bind def
+/n {newpath} bind def
+/s {stroke} bind def
+/sh {show} bind def
+/slc {setlinecap} bind def
+/slj {setlinejoin} bind def
+/slw {setlinewidth} bind def
+/srgb {setrgbcolor} bind def
+/rot {rotate} bind def
+/sc {scale} bind def
+/sd {setdash} bind def
+/ff {findfont} bind def
+/sf {setfont} bind def
+/scf {scalefont} bind def
+/sw {stringwidth} bind def
+/tr {translate} bind def
+/tnt {dup dup currentrgbcolor
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb}
+ bind def
+/shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul
+ 4 -2 roll mul srgb} bind def
+/$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def
+/$F2psEnd {$F2psEnteredState restore end} def
+
+$F2psBegin
+10 setmiterlimit
+0 slj 0 slc
+ 0.06000 0.06000 sc
+%
+% Fig objects follow
+%
+%
+% here starts figure with depth 0
+% Polyline
+30.000 slw
+n 3600 675 m 75 675 l 75 150 l 3600 150 l
+ cp gs col-1 s gr
+/Times-Bold ff 360.00 scf sf
+1800 525 m
+gs 1 -1 sc (Graphic) dup sw pop 2 div neg 0 rm col-1 sh gr
+% here ends figure;
+$F2psEnd
+rs
+showpage
+
+%%EndDocument
+ @endspecial 2473 4740 a(Figure)f(45:)p 0 TeXcolorgray
+Black 42 w(Caption)f(with)g(hang)h(format)2957 4853 y(and)f(RaggedLeft)
+i(justi\014ca-)2821 4966 y(tion.)41 b(Caption)31 b(with)f(hang)g(for-)
+2770 5079 y(mat)h(and)f(RaggedLeft)i(justi\014ca-)2695
+5192 y(tion.)41 b(Caption)30 b(with)g(hang)h(format)2805
+5305 y(and)f(RaggedLeft)i(justi\014cation.)p Black Black
+2250 5640 a(83)p Black eop end
+%%Page: 84 84
+TeXDict begin 84 83 bop Black 0 TeXcolorgray Black Black
+Black Black 748 -149 a FE(\\captionsetup{format=hang,inde)q(ntion)q
+(=0pt)q(,just)q(ific)q(atio)q(n=jus)q(tifi)q(ed})748
+-57 y(\\caption{Caption)43 b(with)d(hang)g(format)g(and)g(justified)i
+(justification.)1101 34 y(Caption)f(with)f(hang)g(format)g(and)g
+(justified)i(justification.)1101 125 y(Caption)f(with)f(hang)g(format)g
+(and)g(justified)i(justification.})748 217 y(...)748
+308 y(\\captionsetup{format=hang,inde)q(ntion)q(=0pt)q(,just)q(ific)q
+(atio)q(n=cen)q(teri)q(ng})748 399 y(\\caption{Caption)h(with)d(hang)g
+(format)g(and)g(centering)i(justification.)1101 491 y(Caption)f(with)f
+(hang)g(format)g(and)g(centering)i(justification.)1101
+582 y(Caption)f(with)f(hang)g(format)g(and)g(centering)i
+(justification.})748 673 y(...)748 765 y
+(\\captionsetup{format=hang,inde)q(ntion)q(=0pt)q(,just)q(ific)q(atio)q
+(n=cen)q(terl)q(ast})748 856 y(\\caption{Caption)h(with)d(hang)g
+(format)g(and)g(centerlast)i(justification.)1101 947
+y(Caption)f(with)f(hang)g(format)g(and)g(centerlast)i(justification.)
+1101 1039 y(Caption)f(with)f(hang)g(format)g(and)g(centerlast)i
+(justification.})748 1130 y(...)748 1221 y
+(\\captionsetup{format=hang,inde)q(ntion)q(=0pt)q(,just)q(ific)q(atio)q
+(n=cen)q(terf)q(irst})748 1313 y(\\caption{Caption)h(with)d(hang)g
+(format)g(and)g(centerfirst)i(justification.)1101 1404
+y(Caption)f(with)f(hang)g(format)g(and)g(centerfirst)i(justification.)
+1101 1495 y(Caption)f(with)f(hang)g(format)g(and)g(centerfirst)i
+(justification.})748 1586 y(...)748 1678 y
+(\\captionsetup{format=hang,inde)q(ntion)q(=0pt)q(,just)q(ific)q(atio)q
+(n=rag)q(gedr)q(ight})748 1769 y(\\caption{Caption)h(with)d(hang)g
+(format)g(and)g(raggedright)i(justification.)1101 1860
+y(Caption)f(with)f(hang)g(format)g(and)g(raggedright)i(justification.)
+1101 1952 y(Caption)f(with)f(hang)g(format)g(and)g(raggedright)i
+(justification.})748 2043 y(...)748 2134 y
+(\\captionsetup{format=hang,inde)q(ntion)q(=0pt)q(,just)q(ific)q(atio)q
+(n=Rag)q(gedR)q(ight})748 2226 y(\\caption{Caption)h(with)d(hang)g
+(format)g(and)g(RaggedRight)i(justification.)1101 2317
+y(Caption)f(with)f(hang)g(format)g(and)g(RaggedRight)i(justification.)
+1101 2408 y(Caption)f(with)f(hang)g(format)g(and)g(RaggedRight)i
+(justification.})748 2500 y(...)748 2591 y
+(\\captionsetup{format=hang,inde)q(ntion)q(=0pt)q(,just)q(ific)q(atio)q
+(n=rag)q(gedl)q(eft})748 2682 y(\\caption{Caption)h(with)d(hang)g
+(format)g(and)g(raggedleft)i(justification.)1101 2774
+y(Caption)f(with)f(hang)g(format)g(and)g(raggedleft)i(justification.)
+1101 2865 y(Caption)f(with)f(hang)g(format)g(and)g(raggedleft)i
+(justification.})630 3019 y FQ(As)31 b(can)g(b)s(e)f(seen)h(in)f
+(Figure)p 0.05 1.00 1.00 0.40 TeXcolorcmyk 31 w(37)p
+Black 32 w(-)h(Figure)p 0.05 1.00 1.00 0.40 TeXcolorcmyk
+31 w(45)p Black(,)h(the)f FM(format=hang)c FQ(option)k(in)g(the)g(ab)s
+(o)m(v)m(e)h(co)s(de)630 3132 y(causes)f(the)f(second)h(and)f
+(subsequen)m(t)f(lines)i(to)g(ha)m(v)m(e)g(additional)h(inden)m
+(tation.)630 3376 y FB(20.5)112 b(F)-9 b(urther)38 b(Customization)630
+3547 y FQ(The)23 b FO(caption)h FQ(has)g(additional)g(feature)h(for)e
+(users)g(who)h(w)m(an)m(t)g(additional)h(customization.)41
+b(This)630 3660 y(section)32 b(pro)m(vides)e(a)h(brief)e(description,)i
+(with)f(detailed)i(instruction)e(a)m(v)-5 b(ailable)33
+b(in)d([)p 0.05 1.00 1.00 0.40 TeXcolorcmyk(12)p Black
+1 w(].)630 3900 y FL(20.5.1)106 b(Caption)34 b(St)m(yles)630
+4059 y FQ(Users)40 b(can)g(de\014ne)f(a)i(collection)i(of)d(caption)h
+(options,)i(called)e Fy(c)-5 b(aption)43 b(styles)p FQ(.)70
+b(The)40 b(en)m(tire)630 4158 y(collection)33 b(of)d(options)h(can)f(b)
+s(e)g(sp)s(eci\014ed)g(with)g(a)g(single)h(option.)41
+b(F)-8 b(or)31 b(example,)h(the)e(caption)630 4258 y(pac)m(k)-5
+b(age)32 b(automatically)i(de\014nes)29 b(a)i(st)m(yle)g(named)f
+FM(default)f FQ(suc)m(h)h(that)p Black Black 761 4399
+a FN(\\captionsetup{st)o(yl)o(e=)o(def)o(au)o(lt})630
+4540 y FQ(is)g(equiv)-5 b(alen)m(t)32 b(to)p Black Black
+761 4681 a FN(\\captionsetup{fo)o(nt)o(=d)o(efa)o(ul)o(t,)299
+b(labelfont=defau)o(lt,)1371 4781 y(textfont=default)o(,)125
+b(parskip=0pt,)1371 4881 y(labelformat=simp)o(le,)37
+b(labelsep=colon,)1371 4980 y(format=default,)212 b(indentation=0pt)o
+(,)1371 5080 y(hangindent=0pt,)g(margin=0pt,)1371 5180
+y(parinident=0pt,)g(justification=j)o(ust)o(if)o(ied)o(,)1371
+5279 y(singlelinecheck=)o(tru)o(e})p Black 2250 5640
+a FQ(84)p Black eop end
+%%Page: 85 85
+TeXDict begin 85 84 bop Black 0 TeXcolorgray Black Black
+630 -149 a FQ(The)30 b FM(\\DeclareCaptionStyle)c FQ(can)31
+b(b)s(e)f(used)g(in)h(the)g(do)s(cumen)m(t)g(pream)m(ble)g(to)h
+(de\014ne)e(other)630 -36 y(caption)f(st)m(yles.)41 b(These)28
+b(st)m(yles)i(can)e(either)h(explicitly)h(de\014ne)d(all)j(of)e(the)g
+(parameters)h(or)f(start)630 77 y(with)i(the)h FM(default)d
+FQ(st)m(yle)k(and)d(mo)s(dify)h(only)g(the)h(unique)e(option)i(v)-5
+b(alues.)771 177 y(F)d(or)30 b(example,)h(the)e(follo)m(wing)j
+FM(\\DeclareCaptionStyle)24 b FQ(command)29 b(in)g(the)g(do)s(cumen)m
+(t's)630 276 y(pream)m(ble)p Black Black 761 399 a FN
+(\\DeclareCaptionS)o(ty)o(le)o({Bi)o(gL)o(eft)o(}{)o(sty)o(le)o(=d)o
+(efa)o(ul)o(t,)37 b(labelsep=period,)2068 498 y(font=Large,)170
+b(labelfont=bold,)2068 598 y(justification=Rag)o(ge)o(dRi)o(gh)o(t,)
+2068 698 y(singlelinecheck=f)o(al)o(se})630 820 y FQ(allo)m(ws)32
+b(the)e FM(BigLeft)f FQ(st)m(yle)i(to)g(b)s(e)f(referenced)g(b)m(y)p
+Black Black 804 942 a FN(\\captionsetup{sty)o(le)o(=Bi)o(gL)o(eft)o(})
+804 1042 y(\\caption{This)39 b(Caption)h(uses)i(BigLeft)f(Style})630
+1178 y FQ(as)31 b(sho)m(wn)e(in)h(Figure)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 31 w(46)p Black(.)1695 1496 y @beginspecial
+0 @llx 0 @lly 216 @urx 36 @ury 1440 @rwi @setspecial
+%%BeginDocument: short.eps
+%!PS-Adobe-2.0 EPSF-2.0
+%%Title: short.fig
+%%Creator: fig2dev Version 3.2 Patchlevel 4
+%%CreationDate: Sun May 22 21:43:01 2005
+%%For: epstein@linux (Becky Epstein)
+%%BoundingBox: 0 0 216 36
+%%Magnification: 1.0000
+%%EndComments
+/$F2psDict 200 dict def
+$F2psDict begin
+$F2psDict /mtrx matrix put
+/col-1 {0 setgray} bind def
+/col0 {0.000 0.000 0.000 srgb} bind def
+/col1 {0.000 0.000 1.000 srgb} bind def
+/col2 {0.000 1.000 0.000 srgb} bind def
+/col3 {0.000 1.000 1.000 srgb} bind def
+/col4 {1.000 0.000 0.000 srgb} bind def
+/col5 {1.000 0.000 1.000 srgb} bind def
+/col6 {1.000 1.000 0.000 srgb} bind def
+/col7 {1.000 1.000 1.000 srgb} bind def
+/col8 {0.000 0.000 0.560 srgb} bind def
+/col9 {0.000 0.000 0.690 srgb} bind def
+/col10 {0.000 0.000 0.820 srgb} bind def
+/col11 {0.530 0.810 1.000 srgb} bind def
+/col12 {0.000 0.560 0.000 srgb} bind def
+/col13 {0.000 0.690 0.000 srgb} bind def
+/col14 {0.000 0.820 0.000 srgb} bind def
+/col15 {0.000 0.560 0.560 srgb} bind def
+/col16 {0.000 0.690 0.690 srgb} bind def
+/col17 {0.000 0.820 0.820 srgb} bind def
+/col18 {0.560 0.000 0.000 srgb} bind def
+/col19 {0.690 0.000 0.000 srgb} bind def
+/col20 {0.820 0.000 0.000 srgb} bind def
+/col21 {0.560 0.000 0.560 srgb} bind def
+/col22 {0.690 0.000 0.690 srgb} bind def
+/col23 {0.820 0.000 0.820 srgb} bind def
+/col24 {0.500 0.190 0.000 srgb} bind def
+/col25 {0.630 0.250 0.000 srgb} bind def
+/col26 {0.750 0.380 0.000 srgb} bind def
+/col27 {1.000 0.500 0.500 srgb} bind def
+/col28 {1.000 0.630 0.630 srgb} bind def
+/col29 {1.000 0.750 0.750 srgb} bind def
+/col30 {1.000 0.880 0.880 srgb} bind def
+/col31 {1.000 0.840 0.000 srgb} bind def
+
+end
+save
+newpath 0 36 moveto 0 0 lineto 216 0 lineto 216 36 lineto closepath clip newpath
+-2.5 42.5 translate
+1 -1 scale
+
+/cp {closepath} bind def
+/ef {eofill} bind def
+/gr {grestore} bind def
+/gs {gsave} bind def
+/sa {save} bind def
+/rs {restore} bind def
+/l {lineto} bind def
+/m {moveto} bind def
+/rm {rmoveto} bind def
+/n {newpath} bind def
+/s {stroke} bind def
+/sh {show} bind def
+/slc {setlinecap} bind def
+/slj {setlinejoin} bind def
+/slw {setlinewidth} bind def
+/srgb {setrgbcolor} bind def
+/rot {rotate} bind def
+/sc {scale} bind def
+/sd {setdash} bind def
+/ff {findfont} bind def
+/sf {setfont} bind def
+/scf {scalefont} bind def
+/sw {stringwidth} bind def
+/tr {translate} bind def
+/tnt {dup dup currentrgbcolor
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb}
+ bind def
+/shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul
+ 4 -2 roll mul srgb} bind def
+/$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def
+/$F2psEnd {$F2psEnteredState restore end} def
+
+$F2psBegin
+10 setmiterlimit
+0 slj 0 slc
+ 0.06000 0.06000 sc
+%
+% Fig objects follow
+%
+%
+% here starts figure with depth 0
+% Polyline
+30.000 slw
+n 3600 675 m 75 675 l 75 150 l 3600 150 l
+ cp gs col-1 s gr
+/Times-Bold ff 360.00 scf sf
+1800 525 m
+gs 1 -1 sc (Graphic) dup sw pop 2 div neg 0 rm col-1 sh gr
+% here ends figure;
+$F2psEnd
+rs
+showpage
+
+%%EndDocument
+ @endspecial 630 1670 a FD(Figure)45 b(46)p 0 TeXcolorgray
+Black 630 1819 a Fh(This)38 b(Caption)f(uses)i(BigLeft)f(St)m(yle)630
+2201 y FL(20.5.2)106 b(Additional)35 b(Option)f(V)-9
+b(alues)630 2360 y FQ(The)30 b FO(caption)g FQ(pac)m(k)-5
+b(age)33 b(pro)m(vides)d(commands)g(suc)m(h)g(as)p Black
+Black 892 2482 a FN(\\DeclareCaption)o(Fo)o(nt)892 2582
+y(\\DeclareCaption)o(La)o(bel)o(Se)o(par)o(at)o(or)892
+2681 y(\\DeclareCaption)o(La)o(bel)o(Fo)o(rma)o(t)892
+2781 y(\\DeclareCaption)o(Fo)o(rma)o(t)892 2880 y(\\DeclareCaption)o
+(La)o(bel)o(Ju)o(sti)o(fi)o(cat)o(io)o(n)630 3016 y FQ(to)43
+b(pro)m(vide)g(additional)h(option)f(v)-5 b(alues.)78
+b(These)43 b(commands)f(can)h(only)g(b)s(e)f(issued)g(in)h(the)630
+3129 y(do)s(cumen)m(t's)30 b(pream)m(ble.)p 630 3295
+3331 4 v 630 3532 a FL(Option)35 b(De\014nition)g(Example)f(#1)771
+3664 y FQ(T)-8 b(able)p 0.05 1.00 1.00 0.40 TeXcolorcmyk
+38 w(15)p Black 39 w(on)37 b(page)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 39 w(73)p Black 38 w(de\014nes)g(the)g(p)s(ossible)h(fon)m
+(t)g(options)g(that)g(can)g(b)s(e)e(used)h(b)m(y)h(the)630
+3764 y FM(font=)p FQ(,)28 b FM(labelfont=)p FQ(,)f(and)i
+FM(textfont=)d FQ(options.)41 b(The)28 b FM(\\DeclareCaptionFont)c
+FQ(allo)m(ws)31 b(the)630 3864 y(user)e(to)g(de\014ne)g(additional)h(v)
+-5 b(alues)30 b(that)f(can)h(b)s(e)f(used)f(b)m(y)h(these)h(options.)40
+b(F)-8 b(or)30 b(example,)h(the)630 3963 y(follo)m(wing)h(command)e(in)
+g(the)h(do)s(cumen)m(t's)f(pream)m(ble)p Black Black
+804 4086 a FN(\\DeclareCaptionFo)o(nt)o({Bi)o(gA)o(ndB)o(ol)o(d}{)o
+(\\L)o(ar)o(ge\\)o(bf)o(ser)o(ie)o(s})630 4208 y FQ(de\014nes)f(a)i
+FM(BigAndBold)d FQ(fon)m(t)j(suc)m(h)f(that)h(the)f(follo)m(wing)i(co)s
+(de)p Black Black 761 4330 a FN(\\captionsetup{fo)o(nt)o(=B)o(igA)o(nd)
+o(Bol)o(d})761 4430 y(\\caption{This)38 b(Caption)j(uses)h(a)h(Custom)e
+(Font})630 4566 y FQ(pro)s(duces)29 b(the)i(caption)g(in)f(Figure)p
+0.05 1.00 1.00 0.40 TeXcolorcmyk 31 w(47)p Black 1695
+4884 a @beginspecial 0 @llx 0 @lly 216 @urx 36 @ury 1440
+@rwi @setspecial
+%%BeginDocument: short.eps
+%!PS-Adobe-2.0 EPSF-2.0
+%%Title: short.fig
+%%Creator: fig2dev Version 3.2 Patchlevel 4
+%%CreationDate: Sun May 22 21:43:01 2005
+%%For: epstein@linux (Becky Epstein)
+%%BoundingBox: 0 0 216 36
+%%Magnification: 1.0000
+%%EndComments
+/$F2psDict 200 dict def
+$F2psDict begin
+$F2psDict /mtrx matrix put
+/col-1 {0 setgray} bind def
+/col0 {0.000 0.000 0.000 srgb} bind def
+/col1 {0.000 0.000 1.000 srgb} bind def
+/col2 {0.000 1.000 0.000 srgb} bind def
+/col3 {0.000 1.000 1.000 srgb} bind def
+/col4 {1.000 0.000 0.000 srgb} bind def
+/col5 {1.000 0.000 1.000 srgb} bind def
+/col6 {1.000 1.000 0.000 srgb} bind def
+/col7 {1.000 1.000 1.000 srgb} bind def
+/col8 {0.000 0.000 0.560 srgb} bind def
+/col9 {0.000 0.000 0.690 srgb} bind def
+/col10 {0.000 0.000 0.820 srgb} bind def
+/col11 {0.530 0.810 1.000 srgb} bind def
+/col12 {0.000 0.560 0.000 srgb} bind def
+/col13 {0.000 0.690 0.000 srgb} bind def
+/col14 {0.000 0.820 0.000 srgb} bind def
+/col15 {0.000 0.560 0.560 srgb} bind def
+/col16 {0.000 0.690 0.690 srgb} bind def
+/col17 {0.000 0.820 0.820 srgb} bind def
+/col18 {0.560 0.000 0.000 srgb} bind def
+/col19 {0.690 0.000 0.000 srgb} bind def
+/col20 {0.820 0.000 0.000 srgb} bind def
+/col21 {0.560 0.000 0.560 srgb} bind def
+/col22 {0.690 0.000 0.690 srgb} bind def
+/col23 {0.820 0.000 0.820 srgb} bind def
+/col24 {0.500 0.190 0.000 srgb} bind def
+/col25 {0.630 0.250 0.000 srgb} bind def
+/col26 {0.750 0.380 0.000 srgb} bind def
+/col27 {1.000 0.500 0.500 srgb} bind def
+/col28 {1.000 0.630 0.630 srgb} bind def
+/col29 {1.000 0.750 0.750 srgb} bind def
+/col30 {1.000 0.880 0.880 srgb} bind def
+/col31 {1.000 0.840 0.000 srgb} bind def
+
+end
+save
+newpath 0 36 moveto 0 0 lineto 216 0 lineto 216 36 lineto closepath clip newpath
+-2.5 42.5 translate
+1 -1 scale
+
+/cp {closepath} bind def
+/ef {eofill} bind def
+/gr {grestore} bind def
+/gs {gsave} bind def
+/sa {save} bind def
+/rs {restore} bind def
+/l {lineto} bind def
+/m {moveto} bind def
+/rm {rmoveto} bind def
+/n {newpath} bind def
+/s {stroke} bind def
+/sh {show} bind def
+/slc {setlinecap} bind def
+/slj {setlinejoin} bind def
+/slw {setlinewidth} bind def
+/srgb {setrgbcolor} bind def
+/rot {rotate} bind def
+/sc {scale} bind def
+/sd {setdash} bind def
+/ff {findfont} bind def
+/sf {setfont} bind def
+/scf {scalefont} bind def
+/sw {stringwidth} bind def
+/tr {translate} bind def
+/tnt {dup dup currentrgbcolor
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb}
+ bind def
+/shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul
+ 4 -2 roll mul srgb} bind def
+/$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def
+/$F2psEnd {$F2psEnteredState restore end} def
+
+$F2psBegin
+10 setmiterlimit
+0 slj 0 slc
+ 0.06000 0.06000 sc
+%
+% Fig objects follow
+%
+%
+% here starts figure with depth 0
+% Polyline
+30.000 slw
+n 3600 675 m 75 675 l 75 150 l 3600 150 l
+ cp gs col-1 s gr
+/Times-Bold ff 360.00 scf sf
+1800 525 m
+gs 1 -1 sc (Graphic) dup sw pop 2 div neg 0 rm col-1 sh gr
+% here ends figure;
+$F2psEnd
+rs
+showpage
+
+%%EndDocument
+ @endspecial 977 5080 a FD(Figure)45 b(47:)p 0 TeXcolorgray
+Black 60 w(This)g(Caption)h(uses)f(a)g(Custom)g(F)-11
+b(on)l(t)p 630 5391 V Black 2250 5640 a FQ(85)p Black
+eop end
+%%Page: 86 86
+TeXDict begin 86 85 bop Black 0 TeXcolorgray Black Black
+630 -149 a FL(Option)35 b(De\014nition)g(Example)f(#2)630
+-16 y FQ(T)-8 b(able)p 0.05 1.00 1.00 0.40 TeXcolorcmyk
+23 w(17)p Black 22 w(on)22 b(page)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 23 w(74)p Black 23 w(describ)s(es)f(ho)m(w)h(the)g
+FM(labelformat=)c FQ(option)23 b(con)m(trols)g(ho)m(w)f(the)g(\\Figure)
+630 84 y(33")35 b(p)s(ortion)e(of)h(the)g(caption)h(is)e(displa)m(y)m
+(ed.)52 b(The)33 b FM(\\DeclareCaptionLabelForm)o(at)28
+b FQ(allo)m(ws)630 183 y(the)d(user)f(to)h(de\014ne)f(additional)i
+FM(labelformat=)21 b FQ(options.)39 b(The)24 b(sym)m(b)s(ols)h
+FM(#1)f FQ(and)g FM(#2)g FQ(are)h(used)630 283 y(in)j(the)h
+(de\014nition)f(to)h(sp)s(ecify)f(where)f(the)i(\\Figure")h(and)e
+(Figure)g(Num)m(b)s(er)g(are)g(inserted.)40 b(F)-8 b(or)630
+383 y(example)31 b(the)g(follo)m(wing)g(command)g(in)f(the)g(do)s
+(cumen)m(t's)h(pream)m(ble)p Black Black 804 524 a FN
+(\\DeclareCaptionLa)o(be)o(lFo)o(rm)o(at{)o(ha)o(sh})o({#)o(1)37
+b({\\#}#2})630 665 y FQ(de\014nes)f(a)i FM(hash)d FQ(formatting)j
+(option)g(suc)m(h)f(that)g(a)h(hash)e(mark)h(#)f(is)h(placed)h(b)s(et)m
+(w)m(een)g(just)630 765 y(b)s(efore)44 b(the)g(\014gure)f(n)m(um)m(b)s
+(er.)81 b(Ho)m(w)m(ev)m(er,)50 b(this)44 b(de\014nition)f(has)h(a)h
+(\015a)m(w)f(in)f(that)i(the)f(space)630 864 y(in)d(the)g(de\014nition)
+f(after)i FM(#1)e FQ(is)h(not)g(desired)f(should)g FM(#1)h
+FQ(b)s(e)f(empt)m(y)-8 b(.)73 b(The)40 b FM(\\bothIfFirst)630
+964 y FQ(command)20 b(t)m(yp)s(esets)h(b)s(oth)f(of)h(its)f(argumen)m
+(ts)h(if)g(the)f(\014rst)g(argumen)m(t)h(exists,)i(otherwise)e(neither)
+630 1063 y(argumen)m(t)38 b(is)g(t)m(yp)s(eset.)63 b(Similarly)-8
+b(,)40 b(the)e FM(\\bothIfSecond)c FQ(command)j(t)m(yp)s(esets)h(b)s
+(oth)f(of)h(its)630 1163 y(argumen)m(ts)26 b(if)f(the)h(second)g
+(argumen)m(t)g(exists,)h(otherwise)f(neither)g(argumen)m(t)g(is)g(t)m
+(yp)s(eset.)39 b(The)630 1263 y(new)30 b(de\014nition)g(using)h
+FM(\\bothIfFirst)c FQ(is)p Black Black 804 1404 a FN
+(\\DeclareCaptionLa)o(be)o(lFo)o(rm)o(at{)o(ha)o(sh})o({\\)o(bo)o(thI)o
+(fF)o(irs)o(t{)o(#1)o(}{)37 b(}{\\#}#2})630 1545 y FQ(This)30
+b(de\014nition,)g(when)f(placed)i(in)f(the)h(do)s(cumen)m(t's)f(pream)m
+(ble)h(allo)m(ws)g(the)g(follo)m(wing)h(co)s(de)p Black
+Black 761 1686 a FN(\\captionsetup{la)o(be)o(lf)o(orm)o(at)o(=ha)o(sh)o
+(})761 1786 y(\\caption{This)38 b(Caption)j(has)h(a)h(Custom)e(Label)h
+(Format})630 1940 y FQ(to)31 b(pro)s(duce)e(the)i(caption)g(in)f
+(Figure)p 0.05 1.00 1.00 0.40 TeXcolorcmyk 31 w(48)p
+Black(.)1695 2266 y @beginspecial 0 @llx 0 @lly 216 @urx
+36 @ury 1440 @rwi @setspecial
+%%BeginDocument: short.eps
+%!PS-Adobe-2.0 EPSF-2.0
+%%Title: short.fig
+%%Creator: fig2dev Version 3.2 Patchlevel 4
+%%CreationDate: Sun May 22 21:43:01 2005
+%%For: epstein@linux (Becky Epstein)
+%%BoundingBox: 0 0 216 36
+%%Magnification: 1.0000
+%%EndComments
+/$F2psDict 200 dict def
+$F2psDict begin
+$F2psDict /mtrx matrix put
+/col-1 {0 setgray} bind def
+/col0 {0.000 0.000 0.000 srgb} bind def
+/col1 {0.000 0.000 1.000 srgb} bind def
+/col2 {0.000 1.000 0.000 srgb} bind def
+/col3 {0.000 1.000 1.000 srgb} bind def
+/col4 {1.000 0.000 0.000 srgb} bind def
+/col5 {1.000 0.000 1.000 srgb} bind def
+/col6 {1.000 1.000 0.000 srgb} bind def
+/col7 {1.000 1.000 1.000 srgb} bind def
+/col8 {0.000 0.000 0.560 srgb} bind def
+/col9 {0.000 0.000 0.690 srgb} bind def
+/col10 {0.000 0.000 0.820 srgb} bind def
+/col11 {0.530 0.810 1.000 srgb} bind def
+/col12 {0.000 0.560 0.000 srgb} bind def
+/col13 {0.000 0.690 0.000 srgb} bind def
+/col14 {0.000 0.820 0.000 srgb} bind def
+/col15 {0.000 0.560 0.560 srgb} bind def
+/col16 {0.000 0.690 0.690 srgb} bind def
+/col17 {0.000 0.820 0.820 srgb} bind def
+/col18 {0.560 0.000 0.000 srgb} bind def
+/col19 {0.690 0.000 0.000 srgb} bind def
+/col20 {0.820 0.000 0.000 srgb} bind def
+/col21 {0.560 0.000 0.560 srgb} bind def
+/col22 {0.690 0.000 0.690 srgb} bind def
+/col23 {0.820 0.000 0.820 srgb} bind def
+/col24 {0.500 0.190 0.000 srgb} bind def
+/col25 {0.630 0.250 0.000 srgb} bind def
+/col26 {0.750 0.380 0.000 srgb} bind def
+/col27 {1.000 0.500 0.500 srgb} bind def
+/col28 {1.000 0.630 0.630 srgb} bind def
+/col29 {1.000 0.750 0.750 srgb} bind def
+/col30 {1.000 0.880 0.880 srgb} bind def
+/col31 {1.000 0.840 0.000 srgb} bind def
+
+end
+save
+newpath 0 36 moveto 0 0 lineto 216 0 lineto 216 36 lineto closepath clip newpath
+-2.5 42.5 translate
+1 -1 scale
+
+/cp {closepath} bind def
+/ef {eofill} bind def
+/gr {grestore} bind def
+/gs {gsave} bind def
+/sa {save} bind def
+/rs {restore} bind def
+/l {lineto} bind def
+/m {moveto} bind def
+/rm {rmoveto} bind def
+/n {newpath} bind def
+/s {stroke} bind def
+/sh {show} bind def
+/slc {setlinecap} bind def
+/slj {setlinejoin} bind def
+/slw {setlinewidth} bind def
+/srgb {setrgbcolor} bind def
+/rot {rotate} bind def
+/sc {scale} bind def
+/sd {setdash} bind def
+/ff {findfont} bind def
+/sf {setfont} bind def
+/scf {scalefont} bind def
+/sw {stringwidth} bind def
+/tr {translate} bind def
+/tnt {dup dup currentrgbcolor
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb}
+ bind def
+/shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul
+ 4 -2 roll mul srgb} bind def
+/$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def
+/$F2psEnd {$F2psEnteredState restore end} def
+
+$F2psBegin
+10 setmiterlimit
+0 slj 0 slc
+ 0.06000 0.06000 sc
+%
+% Fig objects follow
+%
+%
+% here starts figure with depth 0
+% Polyline
+30.000 slw
+n 3600 675 m 75 675 l 75 150 l 3600 150 l
+ cp gs col-1 s gr
+/Times-Bold ff 360.00 scf sf
+1800 525 m
+gs 1 -1 sc (Graphic) dup sw pop 2 div neg 0 rm col-1 sh gr
+% here ends figure;
+$F2psEnd
+rs
+showpage
+
+%%EndDocument
+ @endspecial 1199 2462 a(Figure)h(#48:)p 0 TeXcolorgray
+Black 41 w(This)e(Caption)i(has)f(a)h(Custom)f(Lab)s(el)g(F)-8
+b(ormat)p 630 2770 3331 4 v 630 3010 a FL(Option)35 b(De\014nition)g
+(Example)f(#3)630 3143 y FQ(T)-8 b(able)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 44 w(17)p Black 45 w(on)44 b(page)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 44 w(74)p Black 45 w(de\014nes)f(the)h(p)s(ossible)f(v)-5
+b(alues)44 b(for)g(the)g FM(labelset=)d FQ(option.)81
+b(The)630 3242 y FM(\\DeclareCaptionLabelSepa)o(rato)o(r)18
+b FQ(command)25 b(allo)m(ws)h(users)d(to)i(de\014ne)f(additional)i(v)-5
+b(alues)630 3342 y(for)34 b(the)f FM(labelset=)f FQ(option.)51
+b(F)-8 b(or)34 b(example,)i(the)e(follo)m(wing)h(command)f(in)f(the)h
+(do)s(cumen)m(t's)630 3441 y(pream)m(ble)p Black Black
+804 3583 a FN(\\DeclareCaptionLa)o(be)o(lSe)o(pa)o(rat)o(or)o({ar)o(ro)
+o(w})o({\\q)o(ua)o(d\\e)o(ns)o(ur)o(ema)o(th)o({\\R)o(ig)o(hta)o(rr)o
+(ow)o(}\\q)o(ua)o(d})630 3724 y FQ(de\014nes)29 b(an)i
+FM(arrow)e FQ(lab)s(el)h(separator)h(suc)m(h)f(that)h(the)g(follo)m
+(wing)h(co)s(de)p Black Black 761 3865 a FN(\\captionsetup{la)o(be)o
+(ls)o(ep=)o(ar)o(row)o(})761 3964 y(\\caption{This)38
+b(Caption)j(has)h(a)h(Custom)e(Label)h(Separator})630
+4119 y FQ(pro)s(duce)29 b(the)i(caption)g(in)f(Figure)p
+0.05 1.00 1.00 0.40 TeXcolorcmyk 31 w(49)p Black(.)1695
+4444 y @beginspecial 0 @llx 0 @lly 216 @urx 36 @ury 1440
+@rwi @setspecial
+%%BeginDocument: short.eps
+%!PS-Adobe-2.0 EPSF-2.0
+%%Title: short.fig
+%%Creator: fig2dev Version 3.2 Patchlevel 4
+%%CreationDate: Sun May 22 21:43:01 2005
+%%For: epstein@linux (Becky Epstein)
+%%BoundingBox: 0 0 216 36
+%%Magnification: 1.0000
+%%EndComments
+/$F2psDict 200 dict def
+$F2psDict begin
+$F2psDict /mtrx matrix put
+/col-1 {0 setgray} bind def
+/col0 {0.000 0.000 0.000 srgb} bind def
+/col1 {0.000 0.000 1.000 srgb} bind def
+/col2 {0.000 1.000 0.000 srgb} bind def
+/col3 {0.000 1.000 1.000 srgb} bind def
+/col4 {1.000 0.000 0.000 srgb} bind def
+/col5 {1.000 0.000 1.000 srgb} bind def
+/col6 {1.000 1.000 0.000 srgb} bind def
+/col7 {1.000 1.000 1.000 srgb} bind def
+/col8 {0.000 0.000 0.560 srgb} bind def
+/col9 {0.000 0.000 0.690 srgb} bind def
+/col10 {0.000 0.000 0.820 srgb} bind def
+/col11 {0.530 0.810 1.000 srgb} bind def
+/col12 {0.000 0.560 0.000 srgb} bind def
+/col13 {0.000 0.690 0.000 srgb} bind def
+/col14 {0.000 0.820 0.000 srgb} bind def
+/col15 {0.000 0.560 0.560 srgb} bind def
+/col16 {0.000 0.690 0.690 srgb} bind def
+/col17 {0.000 0.820 0.820 srgb} bind def
+/col18 {0.560 0.000 0.000 srgb} bind def
+/col19 {0.690 0.000 0.000 srgb} bind def
+/col20 {0.820 0.000 0.000 srgb} bind def
+/col21 {0.560 0.000 0.560 srgb} bind def
+/col22 {0.690 0.000 0.690 srgb} bind def
+/col23 {0.820 0.000 0.820 srgb} bind def
+/col24 {0.500 0.190 0.000 srgb} bind def
+/col25 {0.630 0.250 0.000 srgb} bind def
+/col26 {0.750 0.380 0.000 srgb} bind def
+/col27 {1.000 0.500 0.500 srgb} bind def
+/col28 {1.000 0.630 0.630 srgb} bind def
+/col29 {1.000 0.750 0.750 srgb} bind def
+/col30 {1.000 0.880 0.880 srgb} bind def
+/col31 {1.000 0.840 0.000 srgb} bind def
+
+end
+save
+newpath 0 36 moveto 0 0 lineto 216 0 lineto 216 36 lineto closepath clip newpath
+-2.5 42.5 translate
+1 -1 scale
+
+/cp {closepath} bind def
+/ef {eofill} bind def
+/gr {grestore} bind def
+/gs {gsave} bind def
+/sa {save} bind def
+/rs {restore} bind def
+/l {lineto} bind def
+/m {moveto} bind def
+/rm {rmoveto} bind def
+/n {newpath} bind def
+/s {stroke} bind def
+/sh {show} bind def
+/slc {setlinecap} bind def
+/slj {setlinejoin} bind def
+/slw {setlinewidth} bind def
+/srgb {setrgbcolor} bind def
+/rot {rotate} bind def
+/sc {scale} bind def
+/sd {setdash} bind def
+/ff {findfont} bind def
+/sf {setfont} bind def
+/scf {scalefont} bind def
+/sw {stringwidth} bind def
+/tr {translate} bind def
+/tnt {dup dup currentrgbcolor
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb}
+ bind def
+/shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul
+ 4 -2 roll mul srgb} bind def
+/$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def
+/$F2psEnd {$F2psEnteredState restore end} def
+
+$F2psBegin
+10 setmiterlimit
+0 slj 0 slc
+ 0.06000 0.06000 sc
+%
+% Fig objects follow
+%
+%
+% here starts figure with depth 0
+% Polyline
+30.000 slw
+n 3600 675 m 75 675 l 75 150 l 3600 150 l
+ cp gs col-1 s gr
+/Times-Bold ff 360.00 scf sf
+1800 525 m
+gs 1 -1 sc (Graphic) dup sw pop 2 div neg 0 rm col-1 sh gr
+% here ends figure;
+$F2psEnd
+rs
+showpage
+
+%%EndDocument
+ @endspecial 1086 4640 a(Figure)g(49)92 b Fn(\))p 0 TeXcolorgray
+Black 91 w FQ(This)30 b(Caption)g(has)g(a)h(Custom)f(Lab)s(el)g
+(Separator)p 630 4948 V Black 2250 5640 a(86)p Black
+eop end
+%%Page: 87 87
+TeXDict begin 87 86 bop Black 0 TeXcolorgray Black Black
+630 -149 a FL(Option)35 b(De\014nition)g(Example)f(#4)630
+-3 y FQ(T)-8 b(able)p 0.05 1.00 1.00 0.40 TeXcolorcmyk
+38 w(18)p Black 38 w(on)36 b(page)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 38 w(75)p Black 38 w(sp)s(eci\014es)h(the)g(v)-5
+b(alues)37 b(that)h(can)f(b)s(e)g(used)f(b)m(y)h(the)g
+FM(format=)e FQ(option.)630 110 y(The)c FM(\\DeclareCaptionFormat)c
+FQ(command)k(allo)m(ws)j(users)d(to)i(de\014ne)e(additional)i(v)-5
+b(alues)32 b(for)630 223 y(the)f FM(format=)d FQ(option.)771
+323 y(The)36 b(sym)m(b)s(ols)g FM(#1)p FQ(,)i FM(#2)p
+FQ(,)f FM(#3)f FQ(are)h(used)f(in)g(the)h(de\014nition)f(to)h(sp)s
+(ecify)f(where)g(the)h(v)-5 b(arious)630 423 y(building)29
+b(blo)s(c)m(ks)h(app)s(ear,)f(where)g FM(#1)g FQ(represen)m(t)h(the)g
+(caption)h(lab)s(el,)f FM(#2)f FQ(represen)m(ts)g(the)h(cap-)630
+522 y(tion)39 b(separator,)i(and)d FM(#3)g FQ(represen)m(ts)g(the)h
+(caption)g(text)h(\(where)e(these)h(terms)f(are)h(de\014ned)630
+622 y(in)c(Figure)p 0.05 1.00 1.00 0.40 TeXcolorcmyk
+36 w(16)p Black 36 w(on)g(page)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 36 w(76)p Black(\).)56 b(F)-8 b(or)36 b(example,)i(the)d
+(follo)m(wing)i(command)e(in)g(the)g(do)s(cumen)m(t's)630
+721 y(pream)m(ble)p Black Black 804 839 a FN(\\DeclareCaptionFo)o(rm)o
+(at{)o(re)o(ver)o(se)o(}{#)o(3#)o(2\\)o(ens)o(ur)o(ema)o(th)o({\\)o
+(ll})o(#1)o(\\en)o(su)o(rem)o(at)o(h{)o(\\gg)o(}})630
+957 y FQ(de\014nes)j(the)g FM(reverse)f FQ(format)i(with)f(the)h
+(caption)g(text)h(app)s(earing)e(\014rst,)i(follo)m(w)m(ed)g(b)m(y)f
+(the)630 1056 y(separator,)33 b(and)d(then)h(the)h(caption)g(lab)s(el)g
+(surrounded)d(b)m(y)i(double)g(angle)h(brac)m(k)m(ets)h
+FM(\\ll)e FQ(and)630 1156 y FM(\\gg)p FQ(.)40 b(The)30
+b(follo)m(wing)i(co)s(de)p Black Black 761 1273 a FN(\\captionsetup{fo)
+o(rm)o(at)o(=re)o(ve)o(rse)o(,l)o(abe)o(ls)o(ep)o(=em)o(pt)o(y})761
+1373 y(\\caption{This)38 b(Caption)j(has)h(a)h(Custom)e(Format})630
+1504 y FQ(pro)s(duces)29 b(the)i(caption)g(in)f(Figure)p
+0.05 1.00 1.00 0.40 TeXcolorcmyk 31 w(50)p Black(.)1695
+1820 y @beginspecial 0 @llx 0 @lly 216 @urx 36 @ury 1440
+@rwi @setspecial
+%%BeginDocument: short.eps
+%!PS-Adobe-2.0 EPSF-2.0
+%%Title: short.fig
+%%Creator: fig2dev Version 3.2 Patchlevel 4
+%%CreationDate: Sun May 22 21:43:01 2005
+%%For: epstein@linux (Becky Epstein)
+%%BoundingBox: 0 0 216 36
+%%Magnification: 1.0000
+%%EndComments
+/$F2psDict 200 dict def
+$F2psDict begin
+$F2psDict /mtrx matrix put
+/col-1 {0 setgray} bind def
+/col0 {0.000 0.000 0.000 srgb} bind def
+/col1 {0.000 0.000 1.000 srgb} bind def
+/col2 {0.000 1.000 0.000 srgb} bind def
+/col3 {0.000 1.000 1.000 srgb} bind def
+/col4 {1.000 0.000 0.000 srgb} bind def
+/col5 {1.000 0.000 1.000 srgb} bind def
+/col6 {1.000 1.000 0.000 srgb} bind def
+/col7 {1.000 1.000 1.000 srgb} bind def
+/col8 {0.000 0.000 0.560 srgb} bind def
+/col9 {0.000 0.000 0.690 srgb} bind def
+/col10 {0.000 0.000 0.820 srgb} bind def
+/col11 {0.530 0.810 1.000 srgb} bind def
+/col12 {0.000 0.560 0.000 srgb} bind def
+/col13 {0.000 0.690 0.000 srgb} bind def
+/col14 {0.000 0.820 0.000 srgb} bind def
+/col15 {0.000 0.560 0.560 srgb} bind def
+/col16 {0.000 0.690 0.690 srgb} bind def
+/col17 {0.000 0.820 0.820 srgb} bind def
+/col18 {0.560 0.000 0.000 srgb} bind def
+/col19 {0.690 0.000 0.000 srgb} bind def
+/col20 {0.820 0.000 0.000 srgb} bind def
+/col21 {0.560 0.000 0.560 srgb} bind def
+/col22 {0.690 0.000 0.690 srgb} bind def
+/col23 {0.820 0.000 0.820 srgb} bind def
+/col24 {0.500 0.190 0.000 srgb} bind def
+/col25 {0.630 0.250 0.000 srgb} bind def
+/col26 {0.750 0.380 0.000 srgb} bind def
+/col27 {1.000 0.500 0.500 srgb} bind def
+/col28 {1.000 0.630 0.630 srgb} bind def
+/col29 {1.000 0.750 0.750 srgb} bind def
+/col30 {1.000 0.880 0.880 srgb} bind def
+/col31 {1.000 0.840 0.000 srgb} bind def
+
+end
+save
+newpath 0 36 moveto 0 0 lineto 216 0 lineto 216 36 lineto closepath clip newpath
+-2.5 42.5 translate
+1 -1 scale
+
+/cp {closepath} bind def
+/ef {eofill} bind def
+/gr {grestore} bind def
+/gs {gsave} bind def
+/sa {save} bind def
+/rs {restore} bind def
+/l {lineto} bind def
+/m {moveto} bind def
+/rm {rmoveto} bind def
+/n {newpath} bind def
+/s {stroke} bind def
+/sh {show} bind def
+/slc {setlinecap} bind def
+/slj {setlinejoin} bind def
+/slw {setlinewidth} bind def
+/srgb {setrgbcolor} bind def
+/rot {rotate} bind def
+/sc {scale} bind def
+/sd {setdash} bind def
+/ff {findfont} bind def
+/sf {setfont} bind def
+/scf {scalefont} bind def
+/sw {stringwidth} bind def
+/tr {translate} bind def
+/tnt {dup dup currentrgbcolor
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb}
+ bind def
+/shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul
+ 4 -2 roll mul srgb} bind def
+/$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def
+/$F2psEnd {$F2psEnteredState restore end} def
+
+$F2psBegin
+10 setmiterlimit
+0 slj 0 slc
+ 0.06000 0.06000 sc
+%
+% Fig objects follow
+%
+%
+% here starts figure with depth 0
+% Polyline
+30.000 slw
+n 3600 675 m 75 675 l 75 150 l 3600 150 l
+ cp gs col-1 s gr
+/Times-Bold ff 360.00 scf sf
+1800 525 m
+gs 1 -1 sc (Graphic) dup sw pop 2 div neg 0 rm col-1 sh gr
+% here ends figure;
+$F2psEnd
+rs
+showpage
+
+%%EndDocument
+ @endspecial 0 TeXcolorgray Black 1584 1990 a(This)f(Caption)i(has)f(a)
+h(Custom)f(F)-8 b(ormat)2015 2103 y Fn(\034)p FQ(Figure)31
+b(50)p Fn(\035)p 630 2385 3331 4 v 630 2551 a FD(21)135
+b(Non-Floating)46 b(Figures)630 2754 y Fy(Sinc)-5 b(e)48
+b(non-\015o)-5 b(ating)50 b(\014gur)-5 b(es)48 b(c)-5
+b(an)49 b(pr)-5 b(o)g(duc)g(e)50 b(lar)-5 b(ge)50 b(se)-5
+b(ctions)49 b(of)f(vertic)-5 b(al)49 b(whitesp)-5 b(ac)g(e,)54
+b(non-)630 2867 y(\015o)-5 b(ating)46 b(\014gur)-5 b(es)44
+b(ar)-5 b(e)45 b(gener)-5 b(al)5 b(ly)45 b(c)-5 b(onsider)g(e)g(d)47
+b(p)-5 b(o)g(or)46 b(typ)-5 b(esetting)45 b(style.)77
+b(Inste)-5 b(ad,)49 b(users)44 b(ar)-5 b(e)630 2980 y(str)g(ongly)36
+b(enc)-5 b(our)g(age)g(d)37 b(to)e(use)g(the)g(\014gur)-5
+b(e)35 b(envir)-5 b(onment's)36 b Fq([!ht])d Fy(optional)k(ar)-5
+b(gument)36 b(which)630 3093 y(moves)d(the)g(\014gur)-5
+b(e)33 b(only)g(if)g(ther)-5 b(e)33 b(is)g(not)g(enough)g(r)-5
+b(o)g(om)35 b(for)e(it)g(on)g(the)g(curr)-5 b(ent)33
+b(p)-5 b(age.)771 3259 y FQ(As)29 b(describ)s(ed)f(in)h(Section)p
+0.05 1.00 1.00 0.40 TeXcolorcmyk 30 w(17)p Black(,)h(L)1896
+3242 y FP(A)1935 3259 y FQ(T)1986 3279 y(E)2037 3259
+y(X)f(allo)m(ws)h(\014gures)e(and)h(tables)h(to)g(\\\015oat")g(to)g
+(impro)m(v)m(e)630 3359 y(the)44 b(do)s(cumen)m(t's)g(formatting.)82
+b(Occasionally)-8 b(,)49 b(it)c(is)f(desirable)g(to)g(ha)m(v)m(e)h(a)f
+(\014gure)g(app)s(ear)630 3458 y Fy(exactly)50 b FQ(where)40
+b(it)i(app)s(ears)e(in)h(the)g(L)1979 3441 y FP(A)2018
+3458 y FQ(T)2069 3478 y(E)2119 3458 y(X)g(source.)73
+b(Although)41 b(the)g FM(\\caption)e FQ(command)630 3558
+y(can)c(only)h(b)s(e)e(used)g FM(figure)g FQ(and)g FM(table)g
+FQ(en)m(vironmen)m(ts,)j(the)e FO(caption)g FQ(pac)m(k)-5
+b(age)38 b(de\014nes)c(the)630 3657 y FM(\\captionof)22
+b FQ(command)i(whic)m(h)h(tak)m(es)h(t)m(w)m(o)g(argumen)m(ts:)38
+b(the)25 b(t)m(yp)s(e)g(of)g(caption)h(\(table,)h(\014gure,)630
+3757 y(etc\))i(and)d(the)h(caption)h(text,)h(allo)m(wing)g(the)e
+FM(\\captionof)e FQ(command)h(can)i(b)s(e)e(used)g(outside)i(of)630
+3857 y(\014gure)i(and)g(table)h(en)m(vironmen)m(ts.)41
+b(Using)p Black Black 761 3974 a FN(\\captionof{figur)o(e})o({c)o(apt)o
+(io)o(n)d(text})630 4092 y FQ(creates)i(a)e(\014gure)g(caption,)j
+(regardless)e(of)f(whether)g(it)g(app)s(ears)g(in)g(a)g(\014gure)g(en)m
+(vironmen)m(t.)630 4191 y(Lik)m(ewise,)p Black Black
+761 4309 a FN(\\captionof{table)o(}{)o(ca)o(pti)o(on)f(text})630
+4427 y FQ(creates)32 b(a)f(table)g(caption,)g(regardless)g(of)g(its)f
+(lo)s(cation.)43 b(The)29 b(follo)m(wing)j(commands)p
+Black Black 892 4544 a FN(This)41 b(is)i(the)g(text)e(before)h(the)g
+(figure.)892 4644 y(\\\\[\\intextsep])1022 4743 y(\\begin{minipage}{)o
+(\\l)o(ine)o(wi)o(dth)o(})1197 4843 y(\\centering)1197
+4943 y(\\includegraphic)o(s[w)o(id)o(th=)o(2i)o(n])o({gr)o(ap)o(hic)o
+(}\045)1197 5042 y(\\captionof{figu)o(re})o({T)o(his)37
+b(is)42 b(a)i(non-floating)38 b(figure})1197 5142 y(\\label{fig:non:)o
+(flo)o(at)o(})1022 5241 y(\\end{minipage})892 5341 y(\\\\[\\intextsep])
+892 5441 y(This)j(is)i(the)g(text)e(after)h(the)g(figure.)p
+Black 2250 5640 a FQ(87)p Black eop end
+%%Page: 88 88
+TeXDict begin 88 87 bop Black 0 TeXcolorgray Black Black
+630 -149 a FQ(create)32 b(a)f(non-\015oating)g(\014gure.)40
+b(Notes)31 b(on)g(non-\015oating)g(\014gures:)p Black
+767 -6 a FK(\210)p Black 45 w FQ(The)24 b FM(minipage)e
+FQ(en)m(vironmen)m(t)i(is)g(needed)g(to)h(prev)m(en)m(t)f(a)h(page)g
+(break)f(within)f(the)h(\014gure.)p Black 767 142 a FK(\210)p
+Black 45 w FQ(The)29 b FM(\\\\[\\intextsep])d FQ(commands)j(start)i
+(new)e(lines)g(and)g(add)g(v)m(ertical)j(space)e(b)s(efore)857
+255 y(and)45 b(after)h(the)f(\014gure.)85 b(An)m(y)45
+b(amoun)m(t)h(of)f(space)h(can)g(b)s(e)e(used,)49 b FM(\\intextsep)42
+b FQ(\(see)857 368 y(Section)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 45 w(19.1)p Black 45 w(on)h(page)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 45 w(64)p Black(\))i(w)m(as)f(used)e(to)j(mak)m(e)f(the)g
+(non-\015oating)h(\014gure)e(spacing)857 481 y(consisten)m(t)32
+b(with)e(\015oating)h(\014gure)f(spacing.)p Black 767
+629 a FK(\210)p Black 45 w FQ(Normally)-8 b(,)28 b(\014gures)23
+b(are)i(placed)g(on)g(the)f(page)i(in)e(the)h(same)g(order)f(they)g(w)m
+(ere)i(submitted)857 742 y(to)46 b(the)f(\014gure)f(queue.)83
+b(Ho)m(w)m(ev)m(er,)51 b(non-\015oating)46 b(\014gures)e(are)h(placed)g
+(immediately)-8 b(,)857 854 y(leapfrogging)23 b(an)m(y)f(unpro)s
+(cessed)e(\014gures)g(sitting)j(in)e(the)g(\014gure)g(queue.)37
+b(If)21 b(this)g(happ)s(ens,)857 967 y(the)40 b(\014gures)f(do)g(not)h
+(app)s(ear)f(in)g(n)m(umerical)h(order)2686 934 y FP(34)2760
+967 y FQ(.)68 b(T)-8 b(o)40 b(a)m(v)m(oid)h(these)f(out-of-order)857
+1080 y(\014gures,)g(force)e(all)h(\015oating)g(\014gures)e(to)i(b)s(e)e
+(pro)s(cessed)h(b)m(y)g(issuing)f(a)i FM(\\clearpage)c
+FQ(or)857 1193 y FM(\\FloatBarrier)f FQ(command)j(b)s(efore)g(the)g
+(non-\015oating)h(\014gure)f(\(see)h(Section)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 38 w(17.3)p Black 39 w(on)857 1306 y(page)p
+0.05 1.00 1.00 0.40 TeXcolorcmyk 31 w(59)p Black(\).)p
+Black 767 1454 a FK(\210)p Black 45 w FQ(The)j FM(\\captionof)d
+FQ(command)j(is)g(also)h(useful)f(for)f(creating)j(marginal)f
+(\014gures)e(\(Sec-)857 1567 y(tion)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 50 w(22)p Black 50 w(on)50 b(page)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 50 w(89)p Black(\),)55 b(and)49 b(creating)i(a)f(table)g
+(b)s(eside)f(a)g(\014gure)g(\(Section)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 51 w(30)p Black 50 w(on)857 1680 y(page)p
+0.05 1.00 1.00 0.40 TeXcolorcmyk 31 w(109)p Black(\).)630
+1921 y FB(21.1)112 b(Non-\015oating)39 b(Figures)f(without)f(the)h
+(caption)g(pac)m(k)-6 b(age)630 2093 y FQ(As)40 b(describ)s(ed)f(ab)s
+(o)m(v)m(e,)45 b(the)40 b FO(caption)g FQ(pac)m(k)-5
+b(age's)43 b FM(\\captionof)37 b FQ(command)j(creates)i(captions)630
+2206 y(outside)32 b(of)f(\014gure/table)h(en)m(vironmen)m(ts.)44
+b(This)31 b(section)h(describ)s(es)f(ho)m(w)g(to)h(do)g(this)f(without)
+630 2318 y(using)f(the)g FO(caption)h FQ(pac)m(k)-5 b(age.)771
+2418 y(The)25 b FM(\\caption)e FQ(command)i(can)h(b)s(e)e(used)h(in)g
+FM(figure)f FQ(and)g FM(table)g FQ(en)m(vironmen)m(ts)i(b)s(ecause)630
+2518 y(these)h(en)m(vironmen)m(ts)h(de\014ne)e(the)h(in)m(ternal)g
+(command)g FM(\\@captype)d FQ(to)k(\\\014gure")f(and)f(\\table",)630
+2617 y(resp)s(ectiv)m(ely)-8 b(.)41 b(By)28 b(de\014ning)f
+FM(\\@captype)p FQ(,)f(the)h FM(\\caption)e FQ(command)h(can)i(b)s(e)e
+(used)g(outside)i(of)630 2717 y(\014gure)j(and)h(table)h(en)m(vironmen)
+m(ts.)46 b(A)32 b FM(\\makeatletter)p FQ({)p FM(\\makeatother)26
+b FQ(pair)32 b Fy(must)41 b FQ(enclose)630 2817 y FM(\\@captype)f
+FQ(to)k(allo)m(w)h FM(@)d FQ(to)i(b)s(e)e(used)g(in)g(a)h(command)f
+(name.)78 b(While)44 b(this)e(can)h(b)s(e)f(done)630
+2916 y(man)m(ually)31 b(eac)m(h)g(time)h(b)m(y)p Black
+Black 892 3046 a FN(\\includegraphic)o(s{)o(fil)o(e})892
+3145 y(\\makeatletter\\d)o(ef)o(\\@c)o(ap)o(typ)o(e{)o(fig)o(ur)o(e})o
+(\\ma)o(ke)o(ato)o(th)o(er)892 3245 y(\\caption{This)38
+b(is)k(the)h(caption})630 3374 y FQ(it)28 b(is)f(easier)i(to)f
+(de\014ne)e(a)i(command)f(to)h(do)f(this.)40 b(Including)26
+b(the)i(follo)m(wing)h(commands)e(in)g(the)630 3474 y(do)s(cumen)m(t's)
+j(pream)m(ble)p Black Black 848 3603 a FN(\\makeatletter)979
+3703 y(\\newcommand\\fig)o(cap)o(ti)o(on{)o(\\d)o(ef\\)o(@c)o(ap)o(typ)
+o(e{)o(fig)o(ur)o(e})o(\\ca)o(pt)o(ion)o(})979 3802 y
+(\\newcommand\\tab)o(cap)o(ti)o(on{)o(\\d)o(ef\\)o(@c)o(ap)o(typ)o(e{)o
+(tab)o(le)o(}\\)o(cap)o(ti)o(on})848 3902 y(\\makeatother)630
+4044 y FQ(de\014nes)h(the)h FM(\\figcaption)d FQ(and)j
+FM(\\tabcaption)d FQ(commands.)45 b(Using)34 b FM(\\figcaption)29
+b FQ(creates)630 4157 y(\014gure)k(captions,)i(regardless)e(of)h
+(whether)f(it)g(app)s(ears)g(in)g(a)h(\014gure)e(en)m(vironmen)m(t.)51
+b(Lik)m(ewise,)630 4270 y FM(\\tabcaption)27 b FQ(creates)32
+b(table)f(caption,)h(regardless)f(of)f(it)h(lo)s(cation.)630
+4511 y FB(21.2)112 b(The)38 b Fc(\015oat)g FB(P)m(ac)m(k)-6
+b(age's)38 b FR([H])g FB(Placemen)m(t)g(Option)630 4670
+y FQ(The)27 b FO(\015oat)h FQ(pac)m(k)-5 b(age)1319 4637
+y FP(35)1396 4670 y FQ(adds)27 b(an)g FM([H])g FQ(option)h(to)h(the)f
+FM(figure)e FQ(en)m(vironmen)m(t)j(whic)m(h)e(pro)s(duces)g(a)630
+4769 y(non-\015oating)k(\014gure.)40 b(The)30 b(follo)m(wing)i(co)s(de)
+p Black 630 4827 1332 4 v 703 4917 a FF(34)768 4948 y
+FG(In)21 b(these)g(situations,)j(the)d(T)-6 b(able)22
+b(of)g(Figures)g(lists)h(the)e(\014gures)g(in)h(order)f(of)i(app)r
+(earance,)g(not)e(in)g(n)n(umerical)630 5040 y(order.)703
+5135 y FF(35)768 5167 y FG(The)j Fs(\015oat)g FG(pac)n(k)l(age)f(allo)n
+(ws)j(users)e(to)g(de\014ne)e(new)i(t)n(yp)r(es)f(of)h(\015oats,)h(suc)
+n(h)e(as)i(\\Program")g(or)f(\\Algorithm.")630 5258 y(It)c(also)h
+(de\014nes)f(optional)h(b)r(o)n(xed)e(and)h(ruled)f(\015oat)i(st)n
+(yles.)33 b(These)20 b(optional)h(\015oat)g(st)n(yles)f(rede\014ne)g
+(the)f FE(\\caption)630 5349 y FG(command)29 b(suc)n(h)f(that)h(the)f
+(caption)h(is)h(alw)n(a)n(ys)g(t)n(yp)r(eset)e(at)h(a)g(particular)h
+(lo)r(cation,)h(regardless)g(of)e(where)g(the)630 5441
+y FE(\\caption)e FG(command)f(is)g(lo)r(cated,)h(prev)n(en)n(ting)e
+(construction)h(of)h(side-b)n(y-side)e(and)g(other)h(complex)f
+(\014gures.)p Black Black 2250 5640 a FQ(88)p Black eop
+end
+%%Page: 89 89
+TeXDict begin 89 88 bop Black 0 TeXcolorgray Black Black
+Black Black 848 -149 a FN(\\usepackage{floa)o(t})848
+-49 y(...)848 51 y(\\begin{figure}[H)o(])1066 150 y(.....)848
+250 y(\\end{figure})630 404 y FQ(pro)s(duces)29 b(a)i(non-\015oating)g
+(\014gure.)771 517 y(When)e(the)g FM([H])f FQ(\014gure)g(do)s(es)h(not)
+g(\014t)g(on)f(a)i(page,)g(the)f(\014gure)f(is)h(mo)m(v)m(ed)h(to)f
+(the)h(top)f(of)g(the)630 630 y(next)36 b(page.)56 b(If)35
+b(there)h(w)m(ere)g(an)m(y)g(fo)s(otnotes)h(on)e(the)h(\014rst)e(page,)
+k(they)e(app)s(ear)f(immediately)630 743 y(after)f(the)f(text)i
+(instead)e(of)h(at)g(the)f(b)s(ottom)h(of)f(the)h(page.)50
+b(If)33 b(this)g(b)s(eha)m(vior)g(is)g(undesirable,)630
+856 y(then)43 b(the)h FM(\\captionof)c FQ(command)k(describ)s(ed)e(in)h
+(Section)p 0.05 1.00 1.00 0.40 TeXcolorcmyk 44 w(21)p
+Black 44 w(on)h(page)p 0.05 1.00 1.00 0.40 TeXcolorcmyk
+44 w(87)p Black 44 w(can)g(b)s(e)f(used)630 969 y(instead)31
+b(of)f(the)h FO(\015oat)f FQ(pac)m(k)-5 b(age's)32 b
+FM([H])e FQ(placemen)m(t)i(option.)630 1255 y FD(22)135
+b(Marginal)46 b(Figures)630 1458 y FQ(The)21 b FM(\\marginpar)d
+FQ(command)j(places)g(notes)h(in)f(the)g(margin)g(of)g(the)g(do)s
+(cumen)m(t.)38 b(The)20 b(marginal)630 1571 y(notes)29
+b(are)g(placed)g(in)g(the)g(righ)m(t)g(margin)f(\(or)h(the)g(outside)g
+(margin)g(for)f FM(twoside)f FQ(do)s(cumen)m(ts\))630
+1684 y(unless)36 b(the)h FM(\\reversemarginpar)32 b FQ(command)37
+b(is)g(used)f(\(as)h(it)h(is)f(in)f(this)h(do)s(cumen)m(t\).)60
+b(The)630 1797 y(width)35 b(of)h(the)g(marginal)h(column)f(is)g(con)m
+(trolled)h(b)m(y)f(the)g FM(\\marginparwidth)c FQ(length,)38
+b(while)630 1910 y(the)31 b(horizon)m(tal)i(spacing)f(b)s(et)m(w)m(een)
+f(the)h(text)g(and)e(the)i(marginal)f(notes)h(is)f(con)m(trolled)i(b)m
+(y)e(the)630 2023 y FM(\\marginparsep)c FQ(length.)771
+2136 y(Marginal)39 b(notes)e(are)h(placed)g(suc)m(h)f(that)g(the)h
+(baseline)g(of)f(their)g(\014rst)g(line)g(is)h(v)m(ertically)630
+2249 y(aligned)31 b(with)f(the)h(baseline)g(of)f(the)h(text)g(whic)m(h)
+f(con)m(tains)i(the)e FM(\\marginpar)e FQ(command.)771
+2361 y(Marginal)h(notes)g(are)f(nev)m(er)g(brok)m(en)g(across)h(a)f
+(page;)i(if)e(a)g(marginal)h(note)f(starts)h(near)f(the)630
+2474 y(b)s(ottom)35 b(of)f(the)g(page,)i(it)f(con)m(tin)m(ues)g(in)m
+(to)h(the)e(b)s(ottom)g(margin.)53 b(If)33 b(the)i(previous)e(marginal)
+630 2587 y(note)f(w)m(ould)f(in)m(terfere)h(with)f(a)h(marginal)g
+(note,)h(L)2377 2571 y FP(A)2416 2587 y FQ(T)2467 2607
+y(E)2517 2587 y(X)f(\\bumps")e(the)h(latter)i(marginal)f(note)630
+2700 y(do)m(wn)m(w)m(ard.)64 b(Marginal)40 b(notes)f(cannot)g(b)s(e)f
+(bump)s(ed)e(to)j(the)f(next)h(page;)k(they)c(are)g(instead)630
+2813 y(bump)s(ed)e(in)m(to)j(the)g(b)s(ottom)f(margin.)67
+b(As)40 b(a)f(result,)j(the)d(p)s(osition)h(of)f(the)h(marginal)f
+(notes)630 2926 y(ma)m(y)30 b(ha)m(v)m(e)h(to)g(b)s(e)e(adjusted)g(b)s
+(efore)h(the)g(\014nal)f(prin)m(ting)h(to)g(a)m(v)m(oid)i(marginal)e
+(notes)g(near)g(page)630 3039 y(breaks.)771 3139 y(Since)i(the)h
+FM(figure)d FQ(en)m(vironmen)m(t)j(cannot)g(b)s(e)e(used)h(in)g(a)g
+(marginal)h(note,)h(\015oating)f(mar-)630 3238 y(ginal)k(\014gures)f
+(are)g(not)h(p)s(ossible.)58 b(Ho)m(w)m(ev)m(er,)40 b(the)c
+FM(\\captionof)d FQ(command)j(de\014ned)f(in)h(Sec-)630
+3338 y(tion)p 0.05 1.00 1.00 0.40 TeXcolorcmyk 42
+w(21)p Black 42 w(on)41 b(page)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 42 w(87)p Black 42 w(can)g(b)s(e)g(used)f(to)i(construct)f
+(a)h(non-\015oating)g(marginal)g(\014gure.)72 b(F)-8
+b(or)-4079 b @beginspecial 0 @llx 0 @lly 144 @urx 54
+@ury 792 @rwi @setspecial
+%%BeginDocument: graphic.eps
+%!PS-Adobe-2.0 EPSF-2.0
+%%Title: graphic.eps
+%%Creator: fig2dev Version 3.2 Patchlevel 0-beta2
+%%CreationDate: Thu Dec 11 20:58:11 1997
+%%For: Keith Reckdahl
+%%Orientation: Portrait
+%%BoundingBox: 0 0 144 54
+%%Pages: 0
+%%BeginSetup
+%%IncludeFeature: *PageSize Letter
+%%EndSetup
+%%Magnification: 1.00
+%%EndComments
+/$F2psDict 200 dict def
+$F2psDict begin
+$F2psDict /mtrx matrix put
+/col-1 {0 setgray} bind def
+/col0 {0.000 0.000 0.000 srgb} bind def
+/col1 {0.000 0.000 1.000 srgb} bind def
+/col2 {0.000 1.000 0.000 srgb} bind def
+/col3 {0.000 1.000 1.000 srgb} bind def
+/col4 {1.000 0.000 0.000 srgb} bind def
+/col5 {1.000 0.000 1.000 srgb} bind def
+/col6 {1.000 1.000 0.000 srgb} bind def
+/col7 {1.000 1.000 1.000 srgb} bind def
+/col8 {0.000 0.000 0.560 srgb} bind def
+/col9 {0.000 0.000 0.690 srgb} bind def
+/col10 {0.000 0.000 0.820 srgb} bind def
+/col11 {0.530 0.810 1.000 srgb} bind def
+/col12 {0.000 0.560 0.000 srgb} bind def
+/col13 {0.000 0.690 0.000 srgb} bind def
+/col14 {0.000 0.820 0.000 srgb} bind def
+/col15 {0.000 0.560 0.560 srgb} bind def
+/col16 {0.000 0.690 0.690 srgb} bind def
+/col17 {0.000 0.820 0.820 srgb} bind def
+/col18 {0.560 0.000 0.000 srgb} bind def
+/col19 {0.690 0.000 0.000 srgb} bind def
+/col20 {0.820 0.000 0.000 srgb} bind def
+/col21 {0.560 0.000 0.560 srgb} bind def
+/col22 {0.690 0.000 0.690 srgb} bind def
+/col23 {0.820 0.000 0.820 srgb} bind def
+/col24 {0.500 0.190 0.000 srgb} bind def
+/col25 {0.630 0.250 0.000 srgb} bind def
+/col26 {0.750 0.380 0.000 srgb} bind def
+/col27 {1.000 0.500 0.500 srgb} bind def
+/col28 {1.000 0.630 0.630 srgb} bind def
+/col29 {1.000 0.750 0.750 srgb} bind def
+/col30 {1.000 0.880 0.880 srgb} bind def
+/col31 {1.000 0.840 0.000 srgb} bind def
+
+end
+save
+-2.0 61.0 translate
+1 -1 scale
+
+/cp {closepath} bind def
+/ef {eofill} bind def
+/gr {grestore} bind def
+/gs {gsave} bind def
+/sa {save} bind def
+/rs {restore} bind def
+/l {lineto} bind def
+/m {moveto} bind def
+/rm {rmoveto} bind def
+/n {newpath} bind def
+/s {stroke} bind def
+/sh {show} bind def
+/slc {setlinecap} bind def
+/slj {setlinejoin} bind def
+/slw {setlinewidth} bind def
+/srgb {setrgbcolor} bind def
+/rot {rotate} bind def
+/sc {scale} bind def
+/sd {setdash} bind def
+/ff {findfont} bind def
+/sf {setfont} bind def
+/scf {scalefont} bind def
+/sw {stringwidth} bind def
+/tr {translate} bind def
+/tnt {dup dup currentrgbcolor
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb}
+ bind def
+/shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul
+ 4 -2 roll mul srgb} bind def
+/$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def
+/$F2psEnd {$F2psEnteredState restore end} def
+%%EndProlog
+
+$F2psBegin
+10 setmiterlimit
+n 0 1048 m 0 0 l 2473 0 l 2473 1048 l cp clip
+ 0.06000 0.06000 sc
+% Polyline
+30.000 slw
+n 2400 975 m 75 975 l 75 150 l 2400 150 l cp gs col-1 s gr
+/Times-Bold ff 360.00 scf sf
+1220 705 m
+gs 1 -1 sc (Graphic) dup sw pop 2 div neg 0 rm col-1 sh gr
+$F2psEnd
+rs
+
+%%EndDocument
+ @endspecial 170 x(Figure)44 b(51:)p 0 TeXcolorgray Black
+68 w(This)-120 3621 y(is)99 b(a)g(Marginal)-120 3734
+y(Figure)630 3437 y(example,)31 b(Figure)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 31 w(51)p Black 31 w(w)m(as)g(pro)s(duced)e(b)m(y)p
+Black Black 804 3579 a FN(...to)42 b(construct)e(a)j(non-floating)c
+(marginal)h(figure.)804 3678 y(\\marginpar{\\cente)o(ri)o(ng)1284
+3778 y(\\includegraphics)o([w)o(idt)o(h=)o(\\m)o(arg)o(in)o(par)o(wi)o
+(dt)o(h]{)o(gr)o(aph)o(ic)o(}\045)1284 3877 y(\\captionof{figur)o(e})o
+({Th)o(is)d(is)43 b(a)g(Marginal)d(Figure})1284 3977
+y(\\label{fig:margi)o(na)o(l:f)o(ig)o(})d(})804 4077
+y(For)43 b(example,)d(\\Figref{fig:marg)o(ina)o(l:)o(fi)o(g})d(was...)
+630 4231 y FQ(The)32 b(b)s(ottom)h(of)g(the)g(graphic)g(in)f(Figure)p
+0.05 1.00 1.00 0.40 TeXcolorcmyk 33 w(51)p Black 33
+w(is)h(aligned)h(with)e(the)h(text)g(baseline)h(where)e(the)630
+4344 y FM(\\marginpar)c FQ(command)i(is)g(lo)s(cated.)42
+b(Notes)32 b(on)e(marginal)h(\014gures:)p Black 767 4474
+a FK(\210)p Black 45 w FQ(Since)40 b(captions)g(for)g(marginal)g
+(\014gures)f(generally)i(are)f(narro)m(w,)i(using)d(either)h(of)g(the)
+857 4573 y FO(caption)31 b FQ(pac)m(k)-5 b(age)32 b(commands)p
+Black Black 1337 4707 a FN(\\captionstyle{ju)o(st)o(if)o(ica)o(ti)o
+(on=)o(ra)o(gg)o(edr)o(ig)o(ht})1337 4806 y(\\captionstyle{ju)o(st)o
+(if)o(ica)o(ti)o(on=)o(ra)o(gg)o(edl)o(ef)o(t})857 4940
+y FQ(b)s(efore)g(the)h FM(\\caption)d FQ(command)i(ma)m(y)g(pro)m(vide)
+h(b)s(etter)f(caption)h(formatting.)47 b(Addi-)857 5040
+y(tionally)-8 b(,)33 b(the)d FO(caption)h FQ(pac)m(k)-5
+b(age)32 b(command)p Black Black 1337 5173 a FN(\\captionsetup{fo)o(nt)
+o(=s)o(mal)o(l})857 5320 y FQ(can)d(b)s(e)f(used)f(to)i(decrease)h(the)
+e(size)i(of)e(the)h(caption)g(fon)m(t.)41 b(See)28 b(Section)p
+0.05 1.00 1.00 0.40 TeXcolorcmyk 29 w(20)p Black 30
+w(on)g(page)p 0.05 1.00 1.00 0.40 TeXcolorcmyk 29
+w(69)p Black 857 5433 a(for)i FO(caption)h FQ(information.)p
+Black 2250 5640 a(89)p Black eop end
+%%Page: 90 90
+TeXDict begin 90 89 bop Black 0 TeXcolorgray Black Black
+Black 767 -149 a FK(\210)p Black 45 w FQ(Lik)m(e)30 b(the)f
+(non-\015oating)g(\014gures)f(in)g(Section)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 30 w(21)p Black 29 w(on)h(page)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 29 w(87)p Black(,)h(the)f(marginal)h(\014gures)e(are)857
+-36 y(placed)23 b(ahead)f(of)g(an)m(y)h(unpro)s(cessed)d(\015oats.)39
+b(Th)m(us,)23 b(a)f FM(\\clearpage)d FQ(or)k FM(\\FloatBarrier)857
+77 y FQ(command)39 b(m)m(ust)f(b)s(e)g(issued)g(b)s(efore)h(the)f
+(marginal)i(note)f(if)g(one)g(w)m(an)m(ts)g(to)g(k)m(eep)h(the)857
+190 y(\014gures)30 b(in)g(order.)p Black 767 338 a FK(\210)p
+Black 45 w FQ(Marginal)j(notes)f(are)g(placed)g(b)m(y)f(the)h(routine)f
+(whic)m(h)h(also)g(places)g(\014gures)f(and)g(tables.)857
+451 y(If)40 b(man)m(y)g(\014gures,)i(tables,)i(and)39
+b(marginal)i(notes)g(are)f(b)s(eing)g(used,)i(it)e(is)h(p)s(ossible)e
+(to)857 564 y(exceed)c(the)g(n)m(um)m(b)s(er)d(of)i(unpro)s(cessed)f
+(\015oats)i(p)s(ermitted)e(b)m(y)h(L)3092 547 y FP(A)3131
+564 y FQ(T)3182 584 y(E)3232 564 y(X.)52 b(The)34 b FO(mo)m(re\015oats)
+857 677 y FQ(pac)m(k)-5 b(age)33 b(can)d(mitigate)j(these)e(problems)e
+(\(see)j(Section)p 0.05 1.00 1.00 0.40 TeXcolorcmyk
+31 w(17.4)p Black 32 w(on)e(page)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 31 w(60)p Black(\).)630 961 y FD(23)135
+b(Wide)45 b(Figures)630 1151 y FQ(T)m(yp)s(esetting)29
+b(readabilit)m(y)h(rules)e(limit)h(the)f(n)m(um)m(b)s(er)f(of)i(c)m
+(haracters)h(in)e(a)h(line)f(of)h(text.)41 b(Unless)630
+1251 y(a)33 b(large)h(fon)m(t)f(or)g(t)m(w)m(o)h(columns)e(are)h(used,)
+g(these)g(readabilit)m(y)h(rules)e(result)g(in)h(wide)f(margins)630
+1350 y(\(esp)s(ecially)41 b(when)e(using)g(8.5)i(x)f(11)g(inc)m(h)g
+(letter)h(pap)s(er\).)68 b(Section)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 41 w(22)p Black 40 w(demonstrated)40 b(ho)m(w)630
+1450 y(these)30 b(wide)f(margins)h(can)f(b)s(e)g(used)g(for)g(marginal)
+i(\014gures.)39 b(Another)30 b(option)g(is)f(to)i(construct)630
+1550 y(a)37 b(regular)g(\015oating)h(\014gure)f(whic)m(h)f(extends)h
+(in)m(to)h(one)f(or)g(b)s(oth)f(margins.)60 b(This)36
+b(is)h(done)g(b)m(y)630 1649 y(placing)24 b(a)g(wide)f(list)h(en)m
+(vironmen)m(t)g(inside)f(the)g(\014gure.)38 b(F)-8 b(or)24
+b(example,)i(a)e FM(narrow)d FQ(en)m(vironmen)m(t)630
+1749 y(can)31 b(b)s(e)e(de\014ned)h(b)m(y)g(including)g(the)g(follo)m
+(wing)i(co)s(de)f(in)f(the)g(pream)m(ble)h(of)g(y)m(our)f(do)s(cumen)m
+(t)p Black Black 848 1880 a FN(\\newenvironment{)o(na)o(rro)o(w})o([2])
+o({\045)935 1979 y(\\begin{list}{}{\045)935 2079 y(\\setlength{\\tops)o
+(ep})o({0)o(pt})o(\045)935 2179 y(\\setlength{\\left)o(mar)o(gi)o(n}{)o
+(#1)o(}\045)935 2278 y(\\setlength{\\righ)o(tma)o(rg)o(in})o({#)o
+(2}\045)935 2378 y(\\setlength{\\list)o(par)o(in)o(den)o(t})o({\\p)o
+(ar)o(in)o(den)o(t})o(\045)935 2477 y(\\setlength{\\item)o(ind)o(en)o
+(t}{)o(\\p)o(ari)o(nd)o(en)o(t}\045)935 2577 y(\\setlength{\\pars)o
+(ep})o({\\)o(par)o(sk)o(ip})o(}\045)848 2677 y(\\item[]}{\\end{li)o(st)
+o(}})630 2821 y FQ(F)-8 b(or)23 b(example,)h(an)m(y)e(text)h(whic)m(h)e
+(o)s(ccurs)h(b)s(et)m(w)m(een)g FM(\\begin{narrow}{1in}{2in})15
+b FQ(is)22 b(inden)m(ted)630 2934 y(b)m(y)31 b(1)g(inc)m(h)g(on)f(the)h
+(left)h(side)e(and)g(2)h(inc)m(hes)h(on)e(the)h(righ)m(t)g(side.)42
+b(When)31 b(negativ)m(e)i(lengths)e(are)630 3047 y(used,)f(the)g(con)m
+(ten)m(ts)i(extend)f(b)s(ey)m(ond)f(the)g(margins.)630
+3288 y FB(23.1)112 b(Wide)38 b(Figures)g(in)g(One-sided)h(Do)s(cumen)m
+(ts)630 3446 y FQ(The)33 b(follo)m(wing)j(co)s(de)e(uses)g(this)f
+FM(narrow)g FQ(en)m(vironmen)m(t)h(to)h(mak)m(e)g(the)f(\014gure)f
+(extend)i(1)f(inc)m(h)630 3546 y(in)m(to)d(the)g(left)g(margin,)g(pro)s
+(ducing)e(Figure)p 0.05 1.00 1.00 0.40 TeXcolorcmyk
+30 w(52)p Black(.)p Black Black 848 3677 a FN(\\begin{figure})848
+3777 y(\\begin{narrow}{-)o(1i)o(n}{)o(0i)o(n})979 3876
+y(\\includegraphic)o(s[w)o(id)o(th=)o(\\l)o(ine)o(wi)o(dt)o(h]{)o(wi)o
+(de})979 3976 y(\\caption{This)38 b(is)43 b(a)g(wide)f(figure})848
+4075 y(\\end{narrow})848 4175 y(\\end{figure})p Black
+Black Black 30 4910 a @beginspecial 0 @llx 0 @lly 360
+@urx 54 @ury 4716 @rwi @setspecial
+%%BeginDocument: wide.eps
+%!PS-Adobe-2.0 EPSF-2.0
+%%Title: wide.fig
+%%Creator: fig2dev Version 3.2 Patchlevel 4
+%%CreationDate: Sun May 22 21:45:53 2005
+%%For: epstein@linux (Becky Epstein)
+%%BoundingBox: 0 0 360 54
+%%Magnification: 1.0000
+%%EndComments
+/$F2psDict 200 dict def
+$F2psDict begin
+$F2psDict /mtrx matrix put
+/col-1 {0 setgray} bind def
+/col0 {0.000 0.000 0.000 srgb} bind def
+/col1 {0.000 0.000 1.000 srgb} bind def
+/col2 {0.000 1.000 0.000 srgb} bind def
+/col3 {0.000 1.000 1.000 srgb} bind def
+/col4 {1.000 0.000 0.000 srgb} bind def
+/col5 {1.000 0.000 1.000 srgb} bind def
+/col6 {1.000 1.000 0.000 srgb} bind def
+/col7 {1.000 1.000 1.000 srgb} bind def
+/col8 {0.000 0.000 0.560 srgb} bind def
+/col9 {0.000 0.000 0.690 srgb} bind def
+/col10 {0.000 0.000 0.820 srgb} bind def
+/col11 {0.530 0.810 1.000 srgb} bind def
+/col12 {0.000 0.560 0.000 srgb} bind def
+/col13 {0.000 0.690 0.000 srgb} bind def
+/col14 {0.000 0.820 0.000 srgb} bind def
+/col15 {0.000 0.560 0.560 srgb} bind def
+/col16 {0.000 0.690 0.690 srgb} bind def
+/col17 {0.000 0.820 0.820 srgb} bind def
+/col18 {0.560 0.000 0.000 srgb} bind def
+/col19 {0.690 0.000 0.000 srgb} bind def
+/col20 {0.820 0.000 0.000 srgb} bind def
+/col21 {0.560 0.000 0.560 srgb} bind def
+/col22 {0.690 0.000 0.690 srgb} bind def
+/col23 {0.820 0.000 0.820 srgb} bind def
+/col24 {0.500 0.190 0.000 srgb} bind def
+/col25 {0.630 0.250 0.000 srgb} bind def
+/col26 {0.750 0.380 0.000 srgb} bind def
+/col27 {1.000 0.500 0.500 srgb} bind def
+/col28 {1.000 0.630 0.630 srgb} bind def
+/col29 {1.000 0.750 0.750 srgb} bind def
+/col30 {1.000 0.880 0.880 srgb} bind def
+/col31 {1.000 0.840 0.000 srgb} bind def
+
+end
+save
+newpath 0 54 moveto 0 0 lineto 360 0 lineto 360 54 lineto closepath clip newpath
+-2.5 60.5 translate
+1 -1 scale
+
+/cp {closepath} bind def
+/ef {eofill} bind def
+/gr {grestore} bind def
+/gs {gsave} bind def
+/sa {save} bind def
+/rs {restore} bind def
+/l {lineto} bind def
+/m {moveto} bind def
+/rm {rmoveto} bind def
+/n {newpath} bind def
+/s {stroke} bind def
+/sh {show} bind def
+/slc {setlinecap} bind def
+/slj {setlinejoin} bind def
+/slw {setlinewidth} bind def
+/srgb {setrgbcolor} bind def
+/rot {rotate} bind def
+/sc {scale} bind def
+/sd {setdash} bind def
+/ff {findfont} bind def
+/sf {setfont} bind def
+/scf {scalefont} bind def
+/sw {stringwidth} bind def
+/tr {translate} bind def
+/tnt {dup dup currentrgbcolor
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb}
+ bind def
+/shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul
+ 4 -2 roll mul srgb} bind def
+/$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def
+/$F2psEnd {$F2psEnteredState restore end} def
+
+$F2psBegin
+10 setmiterlimit
+0 slj 0 slc
+ 0.06000 0.06000 sc
+%
+% Fig objects follow
+%
+%
+% here starts figure with depth 0
+% Polyline
+30.000 slw
+n 6000 975 m 75 975 l 75 150 l 6000 150 l
+ cp gs col-1 s gr
+/Times-Bold ff 360.00 scf sf
+3075 675 m
+gs 1 -1 sc (A Very, Very Wide Graphic) dup sw pop 2 div neg 0 rm col-1 sh gr
+% here ends figure;
+$F2psEnd
+rs
+showpage
+
+%%EndDocument
+ @endspecial 1669 5106 a FQ(Figure)30 b(52:)p 0 TeXcolorgray
+Black 42 w(This)g(is)g(a)h(wide)f(\014gure)p Black 771
+5341 a(When)e(marginal)g(notes)h(are)f(used,)g(it)h(ma)m(y)f(b)s(e)g
+(desired)f(to)i(mak)m(e)g(the)f(wide)f(\014gure)h(extend)630
+5441 y(exactly)35 b(to)g(the)e(edge)i(of)e(the)h(marginal)g(notes)g
+(\(making)g(the)g(\014gure)f(width)g(b)s(e)g FM(\\linewidth)p
+Black 2250 5640 a FQ(90)p Black eop end
+%%Page: 91 91
+TeXDict begin 91 90 bop Black 0 TeXcolorgray Black Black
+630 -149 a FQ(+)27 b FM(\\marginparwidth)c FQ(+)k FM(\\marginparsep)p
+FQ(\).)36 b(This)27 b(can)h(b)s(e)e(done)h(b)m(y)h(de\014ning)e(a)i
+(new)f(length)630 -49 y FM(\\marginwidth)f FQ(and)j(setting)h(it)g(to)g
+(b)s(e)e FM(\\marginparwidth)d FQ(+)k FM(\\marginparsep)p
+FQ(.)37 b(F)-8 b(or)30 b(exam-)630 51 y(ple,)p Black
+Black 848 192 a FN(\\newlength{\\marg)o(in)o(wid)o(th)o(})848
+291 y(\\setlength{\\marg)o(in)o(wid)o(th)o(}{\\)o(ma)o(rgi)o(np)o(ar)o
+(wid)o(th)o(})848 391 y(\\addtolength{\\ma)o(rg)o(inw)o(id)o(th})o({\\)
+o(mar)o(gi)o(np)o(ars)o(ep)o(})630 545 y FQ(then)g(use)g
+FM({-\\marginwidth})c FQ(in)k(the)h FM(\\begin{narrow})26
+b FQ(argumen)m(t.)630 789 y FB(23.2)112 b(Wide)38 b(Figures)g(in)g(Tw)m
+(o-sided)h(Do)s(cumen)m(ts)630 939 y FQ(F)-8 b(or)45
+b(t)m(w)m(o-sided)h(do)s(cumen)m(ts,)i(it)d(ma)m(y)g(b)s(e)f(desired)g
+(to)h(extend)g(the)f(wide)h(\014gures)e(in)m(to)j(the)630
+1030 y(binding-side)25 b(margin)h(\(i.e.,)i(the)e(left)g(margin)g(for)g
+(o)s(dd)e(pages)j(and)e(the)h(righ)m(t)g(margin)g(for)f(ev)m(en)630
+1122 y(pages\).)54 b(In)34 b(these)h(cases,)i(the)e FO(ifthen)f
+FQ(pac)m(k)-5 b(age's)37 b FM(\\ifthenelse)31 b FQ(command)k(can)f(b)s
+(e)g(used)g(to)630 1213 y(c)m(ho)s(ose)d(b)s(et)m(w)m(een)g(o)s
+(dd-page)g(co)s(de)f(and)g(ev)m(en-page)i(co)s(de.)41
+b(F)-8 b(or)31 b(example,)p Black Black 748 1346 a FE
+(\\usepackage{ifthen})748 1437 y(...)748 1528 y(\\begin{figure})826
+1620 y(\\ifthenelse{\\isodd{\\pageref{)q(fig:w)q(ide})q(}}\045)826
+1711 y({\045)40 b(BEGIN)g(ODD-PAGE)h(FIGURE)865 1802
+y(\\begin{narrow}{0in}{-1in})983 1894 y
+(\\includegraphics[width=\\linew)q(idth)q(]{fil)q(e})983
+1985 y(\\caption{Figure)i(Caption})983 2076 y(\\label{fig:wide})905
+2168 y(\\end{narrow})826 2259 y(}\045)d(END)g(ODD-PAGE)h(FIGURE)826
+2350 y({\045)f(BEGIN)g(EVEN-PAGE)h(FIGURE)865 2442 y
+(\\begin{narrow}{-1in}{0in})983 2533 y(\\includegraphics[width=\\linew)
+q(idth)q(]{fil)q(e})983 2624 y(\\caption{Figure)i(Caption})983
+2716 y(\\label{fig:wide})905 2807 y(\\end{narrow})826
+2898 y(}\045)d(END)g(EVEN-PAGE)h(FIGURE)748 2990 y(\\end{figure})630
+3144 y FQ(Since)32 b(the)h FM(\\pageref)d FQ(command)i(is)h(used)f(as)g
+(input)g(to)h FM(\\ifthenelse)p FQ(,)d(the)j(\014gure)f(ma)m(y)h(not)
+630 3257 y(b)s(e)d(prop)s(erly)f(t)m(yp)s(eset)i(un)m(til)g(L)1673
+3240 y FP(A)1712 3257 y FQ(T)1763 3276 y(E)1813 3257
+y(X)g(is)g(run)e(enough)h(times)h(to)g(cause)g(the)g(cross-references)g
+(to)630 3370 y(con)m(v)m(erge.)630 3656 y FD(24)135 b(Landscap)t(e)44
+b(Figures)630 3859 y FQ(In)g(a)i(do)s(cumen)m(t)f(with)g(p)s(ortrait)g
+(orien)m(tation,)51 b(there)45 b(are)h(three)f(metho)s(ds)f(for)h(pro)s
+(ducing)630 3972 y(\014gures)30 b(with)g(landscap)s(e)g(orien)m
+(tation.)p Black 741 4115 a(1.)p Black 46 w(The)37 b
+FO(lscap)s(e)g FQ(pac)m(k)-5 b(age)39 b(pro)m(vides)e(a)g
+FM(landscape)e FQ(en)m(vironmen)m(t,)40 b(whic)m(h)d(treats)h(the)f
+(left)857 4228 y(edge)30 b(of)f(the)g(pap)s(er)f(as)h(the)h(top)f(of)g
+(the)g(page,)h(causing)g(an)m(y)f(text,)i(tables,)f(or)f(\014gures)f
+(in)857 4341 y(the)j FM(landscape)d FQ(en)m(vironmen)m(t)j(to)g(ha)m(v)
+m(e)g(landscap)s(e)g(orien)m(tation.)p Black 741 4491
+a(2.)p Black 46 w(The)c FO(rotating)h FQ(pac)m(k)-5 b(age)29
+b(pro)m(vides)e(a)g FM(sidewaysfigure)c FQ(en)m(vironmen)m(t)28
+b(whic)m(h)f(is)g(similar)857 4604 y(to)j(the)f FM(figure)e
+FQ(en)m(vironmen)m(t)i(except)h(that)f(the)g(\014gures)f(ha)m(v)m(e)i
+(landscap)s(e)f(orien)m(tation.)p Black 741 4867 a(3.)p
+Black 46 w(The)d FO(rotating)h FQ(pac)m(k)-5 b(age)28
+b(pro)m(vides)f(a)f FM(\\rotcaption)d FQ(command)j(whic)m(h)g(is)g
+(similar)h(to)g(the)857 4980 y FM(\\caption)h FQ(command)j(except)g
+(that)g(caption)g(has)f(landscap)s(e)g(orien)m(tation.)630
+5123 y(Di\013erences)i(b)s(et)m(w)m(een)f(metho)s(ds)p
+Black 767 5266 a FK(\210)p Black 45 w FQ(Both)h(options)f(1)g(and)g(2)g
+(place)h(the)f(landscap)s(e)g(\014gure)f(on)h(a)g(separate)h(page.)43
+b(Option)31 b(3)857 5378 y(pro)s(duces)e(an)i(individual)e(\015oat)i
+(whic)m(h)g(need)f(not)g(b)s(e)g(on)g(its)h(o)m(wn)f(page.)p
+Black 2250 5640 a(91)p Black eop end
+%%Page: 92 92
+TeXDict begin 92 91 bop Black 0 TeXcolorgray Black Black
+Black 767 -149 a FK(\210)p Black 45 w FQ(While)46 b(Option)e(2)h(pro)s
+(duces)e(only)i(rotated)g(\014gures,)j(the)c FM(landscape)e
+FQ(en)m(vironmen)m(t)857 -36 y(in)c(Option)h(1)f(is)h(a)g(general-purp)
+s(ose)f(en)m(vironmen)m(t,)j(whic)m(h)d(can)h(pro)s(duce)e(landscap)s
+(e)857 77 y(pages)31 b(con)m(taining)h(an)m(y)f(com)m(bination)g(of)g
+(text,)h(tables,)f(and)f(\014gures.)40 b(The)29 b FM(landscape)857
+190 y FQ(en)m(vironmen)m(t)i(can)g(page-breaking)g(capabilit)m(y)-8
+b(,)33 b(so)e(m)m(ultiple)g(landscap)s(e)f(pages)h(can)g(b)s(e)857
+303 y(pro)s(duced)1225 270 y FP(36)1298 303 y FQ(.)p
+Black 767 453 a FK(\210)p Black 45 w FQ(The)k(full-page)g(\014gure)f
+(pro)s(duced)f(b)m(y)i(Option)f(2)i(\015oats)f(to)g(pro)m(vide)g(b)s
+(etter)g(do)s(cumen)m(t)857 566 y(formatting,)d(while)e(the)h(\014gure)
+f(pro)s(duced)e(b)m(y)i(Option)h(1)f(cannot)h(\015oat)3362
+533 y FP(37)3438 566 y FQ(.)p Black 767 716 a FK(\210)p
+Black 45 w FQ(Since)i(Options)g(1)h(and)e(3)i(use)f(the)g
+FM(figure)e FQ(en)m(vironmen)m(t,)k(they)e(can)h(b)s(e)e(used)h(in)f
+(con-)857 829 y(junction)e(with)g(the)h FO(end\015oat)f
+FQ(pac)m(k)-5 b(age)33 b(\(see)e(Section)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 31 w(19.6)p Black 32 w(on)f(page)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 32 w(68)p Black(\).)p Black 767 980 a FK(\210)p
+Black 45 w FQ(Options)35 b(1)g(and)f(2)h(are)g(b)s(est)f(suited)h(for)f
+(side-b)m(y-side)i(landscap)s(e)e(graphics)h(\(for)g(side-)857
+1093 y(b)m(y-side)c(metho)s(ds)f(see)g(Section)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 32 w(28)p Black 31 w(on)g(page)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 31 w(104)p Black(\).)630 1336 y FB(24.1)112
+b(Landscap)s(e)40 b(En)m(vironmen)m(t)630 1508 y FQ(The)i
+FO(lscap)s(e)h FQ(pac)m(k)-5 b(age)44 b(\(whic)m(h)f(is)g(part)g(of)g
+(the)g(standard)f(\\graphics)h(bundle")f(distributed)630
+1620 y(with)25 b(L)856 1604 y FP(A)895 1620 y FQ(T)946
+1640 y(E)997 1620 y(X\))h(de\014nes)f(the)g FM(landscape)f
+FQ(en)m(vironmen)m(t,)j(whic)m(h)f(pro)m(vides)f(a)h(metho)s(d)f(of)h
+(placing)630 1733 y(landscap)s(e)k(pages)g(in)f(a)i(p)s(ortrait)e(do)s
+(cumen)m(t.)41 b(The)29 b(landscap)s(e)h(pages)g(are)g(rotated)h(suc)m
+(h)e(that)630 1846 y(the)i(left)g(edge)g(of)f(the)h(p)s(ortrait)f(page)
+h(is)g(the)f(top)h(edge)g(of)g(the)f(landscap)s(e)g(page.)771
+1959 y(En)m(tering)48 b FM(\\begin{landscape})c FQ(prin)m(ts)j(all)i
+(unpro)s(cessed)d(p)s(ortrait)i(\015oats)h(and)e(then)630
+2072 y(switc)m(hes)23 b(to)h(landscap)s(e)e(orien)m(tation.)40
+b(Lik)m(ewise,)26 b FM(\\end{landscape})18 b FQ(prin)m(ts)k(all)h
+(unpro)s(cessed)630 2185 y(landscap)s(e)30 b(\015oats)h(and)f(then)g
+(switc)m(hes)h(bac)m(k)g(to)g(p)s(ortrait)g(orien)m(tation.)771
+2285 y(The)d(en)m(tire)h(con)m(ten)m(ts)h(of)e(the)h
+FM(landscape)c FQ(en)m(vironmen)m(t)k(is)f(t)m(yp)s(eset)h(with)f
+(landscap)s(e)g(ori-)630 2384 y(en)m(tation.)40 b(This)23
+b(ma)m(y)h(include)g(an)m(y)f(mixture)h(of)g(text,)i(\014gures,)e(and)f
+(tables.)40 b(If)23 b(the)g FM(landscape)630 2484 y FQ(en)m(vironmen)m
+(t)31 b(con)m(tains)h(only)e(a)h(\014gure)f(en)m(vironmen)m(t)p
+Black Black 935 2625 a FN(\\begin{landscape)o(})1022
+2725 y(\\begin{figure})1153 2824 y(\\centering)1153 2924
+y(\\includegraphics)o([wi)o(dt)o(h=4)o(in)o(]{)o(gra)o(ph)o(ic})1153
+3024 y(\\caption{Landsca)o(pe)37 b(Figure})1022 3123
+y(\\end{figure})935 3223 y(\\end{landscape})630 3377
+y FQ(the)20 b FM(landscape)e FQ(en)m(vironmen)m(t)j(pro)s(duces)e(a)i
+(landscap)s(e)f(\014gure.)37 b(Note)21 b(that)g(since)g(the)f
+FM(landscape)630 3490 y FQ(en)m(vironmen)m(t)31 b(starts)g(a)g(new)e
+(page,)j(it)f(ma)m(y)g(result)f(in)g(a)h(partially-blank)g(page.)630
+3734 y FB(24.2)112 b(Sidew)m(a)m(ys\014gure)40 b(En)m(vironmen)m(t)630
+3892 y FQ(The)26 b FO(rotating)i FQ(pac)m(k)-5 b(age)29
+b(pro)m(vides)e(the)g FM(sidewaysfigure)22 b FQ(en)m(vironmen)m(t)28
+b(whic)m(h)e(pro)s(duces)g(\014g-)630 3992 y(ures)k(with)g(landscap)s
+(e)g(orien)m(tation)1877 3959 y FP(38)1954 3992 y FQ(.)40
+b(F)-8 b(or)32 b(example)p Black Black 935 4133 a FN(\\begin{sidewaysf)
+o(igu)o(re)o(})1066 4232 y(\\centering)1066 4332 y(\\includegraphics)o
+([w)o(idt)o(h=)o(4in)o(]{)o(gr)o(aph)o(ic)o(})1066 4432
+y(\\caption{Sideway)o(sf)o(igu)o(re)37 b(Figure})935
+4531 y(\\end{sidewaysfig)o(ure)o(})630 4686 y FQ(pro)s(duces)29
+b(Figure)p 0.05 1.00 1.00 0.40 TeXcolorcmyk 31 w(53)p
+Black(.)p Black 630 4781 1332 4 v 703 4871 a FF(36)768
+4903 y FG(The)19 b FE(landscape)i FG(en)n(vironmen)n(t)e(w)n(orks)g(v)n
+(ery)f(w)n(ell)i(with)f(the)g Fs(longtable)g FG(pac)n(k)l(age)h(to)f
+(pro)r(duce)g(m)n(ultiple-page)630 4994 y(landscap)r(e)26
+b(tables.)703 5089 y FF(37)768 5121 y FG(Figures)h(issued)f(in)f(the)h
+FE(landscape)h FG(en)n(vironmen)n(t)e(can)h(\015oat)g(within)g(the)f
+(landscap)r(e)i(pages)703 5216 y FF(38)768 5248 y FG(The)37
+b Fs(rotating)h FG(pac)n(k)l(age)f(also)g(pro)n(vides)g(a)g
+FE(sidewaystable)i FG(en)n(vironmen)n(t)d(for)h(pro)r(ducing)g(tables)g
+(with)630 5339 y(landscap)r(e)26 b(orien)n(tation.)p
+Black Black 2250 5640 a FQ(92)p Black eop end
+%%Page: 93 93
+TeXDict begin 93 92 bop Black 0 TeXcolorgray Black Black
+Black 2295 5441 a
+ gsave currentpoint currentpoint translate 90 neg rotate neg exch neg
+exch translate
+ 2295 5441 a Black 3935 5753 a @beginspecial
+0 @llx 0 @lly 144 @urx 54 @ury 2880 @rwi @setspecial
+%%BeginDocument: graphic.eps
+%!PS-Adobe-2.0 EPSF-2.0
+%%Title: graphic.eps
+%%Creator: fig2dev Version 3.2 Patchlevel 0-beta2
+%%CreationDate: Thu Dec 11 20:58:11 1997
+%%For: Keith Reckdahl
+%%Orientation: Portrait
+%%BoundingBox: 0 0 144 54
+%%Pages: 0
+%%BeginSetup
+%%IncludeFeature: *PageSize Letter
+%%EndSetup
+%%Magnification: 1.00
+%%EndComments
+/$F2psDict 200 dict def
+$F2psDict begin
+$F2psDict /mtrx matrix put
+/col-1 {0 setgray} bind def
+/col0 {0.000 0.000 0.000 srgb} bind def
+/col1 {0.000 0.000 1.000 srgb} bind def
+/col2 {0.000 1.000 0.000 srgb} bind def
+/col3 {0.000 1.000 1.000 srgb} bind def
+/col4 {1.000 0.000 0.000 srgb} bind def
+/col5 {1.000 0.000 1.000 srgb} bind def
+/col6 {1.000 1.000 0.000 srgb} bind def
+/col7 {1.000 1.000 1.000 srgb} bind def
+/col8 {0.000 0.000 0.560 srgb} bind def
+/col9 {0.000 0.000 0.690 srgb} bind def
+/col10 {0.000 0.000 0.820 srgb} bind def
+/col11 {0.530 0.810 1.000 srgb} bind def
+/col12 {0.000 0.560 0.000 srgb} bind def
+/col13 {0.000 0.690 0.000 srgb} bind def
+/col14 {0.000 0.820 0.000 srgb} bind def
+/col15 {0.000 0.560 0.560 srgb} bind def
+/col16 {0.000 0.690 0.690 srgb} bind def
+/col17 {0.000 0.820 0.820 srgb} bind def
+/col18 {0.560 0.000 0.000 srgb} bind def
+/col19 {0.690 0.000 0.000 srgb} bind def
+/col20 {0.820 0.000 0.000 srgb} bind def
+/col21 {0.560 0.000 0.560 srgb} bind def
+/col22 {0.690 0.000 0.690 srgb} bind def
+/col23 {0.820 0.000 0.820 srgb} bind def
+/col24 {0.500 0.190 0.000 srgb} bind def
+/col25 {0.630 0.250 0.000 srgb} bind def
+/col26 {0.750 0.380 0.000 srgb} bind def
+/col27 {1.000 0.500 0.500 srgb} bind def
+/col28 {1.000 0.630 0.630 srgb} bind def
+/col29 {1.000 0.750 0.750 srgb} bind def
+/col30 {1.000 0.880 0.880 srgb} bind def
+/col31 {1.000 0.840 0.000 srgb} bind def
+
+end
+save
+-2.0 61.0 translate
+1 -1 scale
+
+/cp {closepath} bind def
+/ef {eofill} bind def
+/gr {grestore} bind def
+/gs {gsave} bind def
+/sa {save} bind def
+/rs {restore} bind def
+/l {lineto} bind def
+/m {moveto} bind def
+/rm {rmoveto} bind def
+/n {newpath} bind def
+/s {stroke} bind def
+/sh {show} bind def
+/slc {setlinecap} bind def
+/slj {setlinejoin} bind def
+/slw {setlinewidth} bind def
+/srgb {setrgbcolor} bind def
+/rot {rotate} bind def
+/sc {scale} bind def
+/sd {setdash} bind def
+/ff {findfont} bind def
+/sf {setfont} bind def
+/scf {scalefont} bind def
+/sw {stringwidth} bind def
+/tr {translate} bind def
+/tnt {dup dup currentrgbcolor
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb}
+ bind def
+/shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul
+ 4 -2 roll mul srgb} bind def
+/$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def
+/$F2psEnd {$F2psEnteredState restore end} def
+%%EndProlog
+
+$F2psBegin
+10 setmiterlimit
+n 0 1048 m 0 0 l 2473 0 l 2473 1048 l cp clip
+ 0.06000 0.06000 sc
+% Polyline
+30.000 slw
+n 2400 975 m 75 975 l 75 150 l 2400 150 l cp gs col-1 s gr
+/Times-Bold ff 360.00 scf sf
+1220 705 m
+gs 1 -1 sc (Graphic) dup sw pop 2 div neg 0 rm col-1 sh gr
+$F2psEnd
+rs
+
+%%EndDocument
+ @endspecial 4481 5949 a FQ(Figure)31 b(53:)p 0 TeXcolorgray
+Black 41 w(Sidew)m(a)m(ys\014gure)f(Figure)p Black 2295
+5441 a
+ currentpoint grestore moveto
+ 2295 5441 a Black Black 2250 5640 a FQ(93)p Black
+eop end
+%%Page: 94 94
+TeXDict begin 94 93 bop Black 0 TeXcolorgray Black Black
+771 -149 a FQ(Unlik)m(e)28 b(the)f FM(landscape)e FQ(en)m(vironmen)m
+(t,)j(the)g(\014gure)e(pro)s(duced)f(b)m(y)k FM(sidewaysfigure)23
+b FQ(can)630 -36 y(\015oat)29 b(within)f(the)g(p)s(ortrait)h(pages)f
+(to)h(a)m(v)m(oid)h(the)f(partially-blank)g(page)g(that)g(the)f
+FM(landscape)630 77 y FQ(en)m(vironmen)m(t)43 b(ma)m(y)g(pro)s(duce.)74
+b(Note)44 b(that)f(the)f FM(landscape)e FQ(en)m(vironmen)m(t)i(is)h(m)m
+(uc)m(h)f(more)630 190 y(\015exible,)h(allo)m(wing)f(the)e(landscap)s
+(e)g(pages)g(to)h(consist)g(of)f(a)g(mixture)g(of)g(text,)k(tables,)g
+(and)630 303 y(\014gures.)771 416 y(The)32 b(default)g(orien)m(tation)h
+(of)g(the)f(\014gures)f(pro)s(duced)f(b)m(y)j FM(sidewaysfigure)28
+b FQ(dep)s(ends)i(on)630 529 y(whether)43 b(the)g(do)s(cumen)m(t)h(is)f
+(pro)s(cessed)g(with)g(the)h FM(oneside)d FQ(or)j FM(twoside)d
+FQ(do)s(cumen)m(tclass)630 642 y(option)p Black 767 784
+a FK(\210)p Black 45 w FQ(When)26 b(the)g FM(oneside)f
+FQ(option)h(is)g(c)m(hosen,)i(the)e(b)s(ottom)h(of)f(graphic)g(is)g(to)
+m(w)m(ards)h(the)f(righ)m(t)857 897 y(edge)31 b(of)g(the)f(p)s(ortrait)
+h(page.)p Black 767 1042 a FK(\210)p Black 45 w FQ(When)44
+b(the)g FM(twoside)e FQ(option)i(is)g(c)m(hosen,)k(the)c(b)s(ottom)g
+(of)g(graphic)g(is)g(to)m(w)m(ards)h(the)857 1155 y(outside)31
+b(edge)g(of)g(the)f(p)s(ortrait)g(page.)630 1285 y(This)f(default)h(b)s
+(eha)m(vior)f(can)h(b)s(e)f(o)m(v)m(erridden)h(b)m(y)g(options)g(to)g
+(the)g FM(\\usepackage{rotating})630 1384 y FQ(command.)p
+Black Black 935 1498 a FN(\\usepackage[figu)o(res)o(le)o(ft])o({r)o
+(ota)o(ti)o(ng)o(})630 1611 y FQ(causes)37 b(the)h(b)s(ottom)f(of)g
+(the)g FM(sidewaysfigure)c FQ(graphics)k(to)h(b)s(e)e(to)m(w)m(ards)i
+(the)f(left)h(edge)g(of)630 1711 y(the)31 b(p)s(ortrait)f(page)h
+(\(regardless)g(of)38 b FM(oneside)28 b FQ(or)j FM(twoside)d
+FQ(options\).)41 b(Similarly)-8 b(,)p Black Black 935
+1824 a FN(\\usepackage[figu)o(res)o(ri)o(ght)o(]{)o(rot)o(at)o(in)o(g})
+630 1951 y FQ(causes)33 b(the)f(b)s(ottom)h(of)f(the)h
+FM(sidewaysfigure)28 b FQ(graphics)33 b(to)g(b)s(e)e(to)m(w)m(ards)i
+(the)g(righ)m(t)g(edge)g(of)630 2064 y(the)e(p)s(ortrait)f(page.)630
+2302 y FB(24.3)112 b(Rotcaption)38 b(Command)630 2460
+y FQ(The)j(metho)s(ds)g(in)g(Sections)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 42 w(24.1)p Black 43 w(and)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 41 w(24.2)p Black 43 w(b)s(oth)g(pro)s(duce)g(full-page)h
+(landscap)s(e)f(\014gures,)630 2560 y(whic)m(h)d(ma)m(y)h(not)f(b)s(e)g
+(necessary)h(for)f(smaller)h(landscap)s(e)f(\014gures.)64
+b(The)37 b FO(rotating)j FQ(pac)m(k)-5 b(age's)630 2659
+y FM(\\rotcaption)41 b FQ(command)j(can)g(b)s(e)f(used)h(to)g
+(construct)h(smaller)f(landscap)s(e)g(\014gures.)81 b(F)-8
+b(or)630 2759 y(example)p Black Black 935 2872 a FN(\\begin{figure})
+1022 2972 y(\\centering)1022 3072 y(\\begin{minipage}[)o(c])o({1i)o(n})
+1153 3171 y(\\hfill\\includegr)o(aph)o(ic)o(s[w)o(id)o(th)o(=2i)o(n,)o
+(ang)o(le)o(=9)o(0]{)o(gr)o(aph)o(ic)o(})1022 3271 y
+(\\end{minipage}\045)1022 3370 y(\\hspace{0.2in}\045)1022
+3470 y(\\begin{minipage}[)o(c])o({0.)o(5i)o(n})1153 3570
+y(\\captionsetup{wi)o(dth)o(=2)o(in})1153 3669 y(\\rotcaption{This)37
+b(is)43 b(a)g(caption)e(created)f(by)j(the)f(Rotcaption)e(command})1153
+3769 y(\\label{fig:rotca)o(pti)o(on)o(})1022 3869 y(\\end{minipage})935
+3968 y(\\end{figure})630 4095 y FQ(pro)s(duces)29 b(Figure)p
+0.05 1.00 1.00 0.40 TeXcolorcmyk 31 w(54)p Black(.)771
+4208 y(The)49 b(caption)h(pro)s(duced)d(b)m(y)j FM(\\rotcaption)c
+FQ(is)j(alw)m(a)m(ys)i(rotated)f(suc)m(h)f(that)g(its)h(b)s(ot-)630
+4321 y(tom)40 b(is)g(to)m(w)m(ards)g(the)g(righ)m(t)g(edge)g(of)g(the)g
+(pap)s(er.)67 b(Unlik)m(e)41 b(the)f(metho)s(ds)f(in)g(Sections)p
+0.05 1.00 1.00 0.40 TeXcolorcmyk 40 w(24.1)p Black
+630 4434 a(and)p 0.05 1.00 1.00 0.40 TeXcolorcmyk
+34 w(24.2)p Black(,)f(the)d FM(\\rotcaption)d FQ(command)i(do)s(es)h
+(not)g(rotate)i(the)e(graphics.)54 b(Therefore,)36 b(the)630
+4547 y FM(\\includegraphics)26 b FQ(command)k(in)g(the)h(ab)s(o)m(v)m
+(e)g(example)g(requires)f(the)h FM(angle=90)d FQ(option.)630
+4828 y FD(25)135 b(Captions)46 b(Beside)f(Figures)630
+5031 y FQ(Although)29 b(the)g(caption)g(of)g(a)g(\014gure)f(is)h
+(generally)h(placed)f(ab)s(o)m(v)m(e)h(or)f(b)s(elo)m(w)g(the)g
+(graphic,)g(this)630 5144 y(section)j(describ)s(es)d(ho)m(w)i(to)g
+(place)g(the)g(caption)g(b)s(eside)f(the)g(graphic)3059
+5111 y FP(39)3134 5144 y FQ(.)p Black 630 5228 1332 4
+v 703 5318 a FF(39)768 5349 y FG(Since)i(the)f(\014gure)h(en)n
+(vironmen)n(t)f(de\014ned)g(b)n(y)g(the)g Fs(\015oat)h
+FG(pac)n(k)l(age)g(places)h(the)f(caption)g Fw(b)l(elow)40
+b FG(the)32 b(b)r(o)r(dy)-6 b(,)630 5441 y(captions)38
+b(b)r(eside)g(\014gures)f(cannot)g(b)r(e)g(pro)r(duced)g(with)h(the)f
+Fs(\015oat)g FG(pac)n(k)l(age's)h(\014gure)f(en)n(vironmen)n(t.)69
+b(Other)p Black Black 2250 5640 a FQ(94)p Black eop end
+%%Page: 95 95
+TeXDict begin 95 94 bop Black 0 TeXcolorgray Black Black
+Black 2535 1560 a
+ gsave currentpoint currentpoint translate 90 neg rotate neg exch neg
+exch translate
+ 2535 1560 a @beginspecial 0 @llx 0
+@lly 144 @urx 54 @ury 2160 @rwi @setspecial
+%%BeginDocument: graphic.eps
+%!PS-Adobe-2.0 EPSF-2.0
+%%Title: graphic.eps
+%%Creator: fig2dev Version 3.2 Patchlevel 0-beta2
+%%CreationDate: Thu Dec 11 20:58:11 1997
+%%For: Keith Reckdahl
+%%Orientation: Portrait
+%%BoundingBox: 0 0 144 54
+%%Pages: 0
+%%BeginSetup
+%%IncludeFeature: *PageSize Letter
+%%EndSetup
+%%Magnification: 1.00
+%%EndComments
+/$F2psDict 200 dict def
+$F2psDict begin
+$F2psDict /mtrx matrix put
+/col-1 {0 setgray} bind def
+/col0 {0.000 0.000 0.000 srgb} bind def
+/col1 {0.000 0.000 1.000 srgb} bind def
+/col2 {0.000 1.000 0.000 srgb} bind def
+/col3 {0.000 1.000 1.000 srgb} bind def
+/col4 {1.000 0.000 0.000 srgb} bind def
+/col5 {1.000 0.000 1.000 srgb} bind def
+/col6 {1.000 1.000 0.000 srgb} bind def
+/col7 {1.000 1.000 1.000 srgb} bind def
+/col8 {0.000 0.000 0.560 srgb} bind def
+/col9 {0.000 0.000 0.690 srgb} bind def
+/col10 {0.000 0.000 0.820 srgb} bind def
+/col11 {0.530 0.810 1.000 srgb} bind def
+/col12 {0.000 0.560 0.000 srgb} bind def
+/col13 {0.000 0.690 0.000 srgb} bind def
+/col14 {0.000 0.820 0.000 srgb} bind def
+/col15 {0.000 0.560 0.560 srgb} bind def
+/col16 {0.000 0.690 0.690 srgb} bind def
+/col17 {0.000 0.820 0.820 srgb} bind def
+/col18 {0.560 0.000 0.000 srgb} bind def
+/col19 {0.690 0.000 0.000 srgb} bind def
+/col20 {0.820 0.000 0.000 srgb} bind def
+/col21 {0.560 0.000 0.560 srgb} bind def
+/col22 {0.690 0.000 0.690 srgb} bind def
+/col23 {0.820 0.000 0.820 srgb} bind def
+/col24 {0.500 0.190 0.000 srgb} bind def
+/col25 {0.630 0.250 0.000 srgb} bind def
+/col26 {0.750 0.380 0.000 srgb} bind def
+/col27 {1.000 0.500 0.500 srgb} bind def
+/col28 {1.000 0.630 0.630 srgb} bind def
+/col29 {1.000 0.750 0.750 srgb} bind def
+/col30 {1.000 0.880 0.880 srgb} bind def
+/col31 {1.000 0.840 0.000 srgb} bind def
+
+end
+save
+-2.0 61.0 translate
+1 -1 scale
+
+/cp {closepath} bind def
+/ef {eofill} bind def
+/gr {grestore} bind def
+/gs {gsave} bind def
+/sa {save} bind def
+/rs {restore} bind def
+/l {lineto} bind def
+/m {moveto} bind def
+/rm {rmoveto} bind def
+/n {newpath} bind def
+/s {stroke} bind def
+/sh {show} bind def
+/slc {setlinecap} bind def
+/slj {setlinejoin} bind def
+/slw {setlinewidth} bind def
+/srgb {setrgbcolor} bind def
+/rot {rotate} bind def
+/sc {scale} bind def
+/sd {setdash} bind def
+/ff {findfont} bind def
+/sf {setfont} bind def
+/scf {scalefont} bind def
+/sw {stringwidth} bind def
+/tr {translate} bind def
+/tnt {dup dup currentrgbcolor
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb}
+ bind def
+/shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul
+ 4 -2 roll mul srgb} bind def
+/$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def
+/$F2psEnd {$F2psEnteredState restore end} def
+%%EndProlog
+
+$F2psBegin
+10 setmiterlimit
+n 0 1048 m 0 0 l 2473 0 l 2473 1048 l cp clip
+ 0.06000 0.06000 sc
+% Polyline
+30.000 slw
+n 2400 975 m 75 975 l 75 150 l 2400 150 l cp gs col-1 s gr
+/Times-Bold ff 360.00 scf sf
+1220 705 m
+gs 1 -1 sc (Graphic) dup sw pop 2 div neg 0 rm col-1 sh gr
+$F2psEnd
+rs
+
+%%EndDocument
+ @endspecial 4335 1560 a
+ currentpoint grestore moveto
+ 4335 1560 a 2791 1560 a
+ gsave currentpoint currentpoint translate 90 neg rotate neg exch neg
+exch translate
+ 2791
+1560 a -57 x FQ(Figure)40 b(54:)p 0 TeXcolorgray Black
+61 w(This)g(is)g(a)g(caption)h(created)g(b)m(y)f(the)2791
+1616 y(Rotcaption)32 b(command)4591 1560 y
+ currentpoint grestore moveto
+ 4591 1560
+a Black 630 1817 a FB(25.1)112 b(The)38 b(Sidecap)h(P)m(ac)m(k)-6
+b(age)630 1976 y FQ(The)35 b(easiest)i(w)m(a)m(y)f(of)f(constructing)h
+(side)f(captions)i(is)e(to)h(use)f(the)g FO(sidecap)h
+FQ(pac)m(k)-5 b(age.)57 b(When)630 2075 y(a)32 b FM(\\caption)c
+FQ(command)j(is)h(used)e(in)h(the)g(SC\014gure)f(and)g(SCtable)i(en)m
+(vironmen)m(ts)f(de\014ned)f(b)m(y)630 2175 y(the)c FO(sidecap)g
+FQ(pac)m(k)-5 b(age,)29 b(the)d(captions)g(are)h(automatically)h
+(placed)f(to)f(the)g(side)g(of)g(the)g(con)m(ten)m(ts)630
+2275 y(of)31 b(the)f(en)m(vironmen)m(t.)41 b(F)-8 b(or)32
+b(example,)p Black Black 761 2416 a FN(\\usepackage{side)o(ca)o(p})761
+2515 y(...)761 2615 y(\\begin{SCfigure})892 2715 y(\\includegraphic)o
+(s[)o(wid)o(th)o(=3i)o(n])o({gr)o(ap)o(hi)o(c})892 2814
+y(\\caption{This)38 b(is)k(a)i(SCfigure})761 2914 y(\\end{SCfigure})630
+3068 y FQ(pro)s(duces)29 b(Figure)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 31 w(55)p Black(.)p Black Black 660 3861
+a @beginspecial 0 @llx 0 @lly 144 @urx 54 @ury 2160 @rwi
+@setspecial
+%%BeginDocument: graphic.eps
+%!PS-Adobe-2.0 EPSF-2.0
+%%Title: graphic.eps
+%%Creator: fig2dev Version 3.2 Patchlevel 0-beta2
+%%CreationDate: Thu Dec 11 20:58:11 1997
+%%For: Keith Reckdahl
+%%Orientation: Portrait
+%%BoundingBox: 0 0 144 54
+%%Pages: 0
+%%BeginSetup
+%%IncludeFeature: *PageSize Letter
+%%EndSetup
+%%Magnification: 1.00
+%%EndComments
+/$F2psDict 200 dict def
+$F2psDict begin
+$F2psDict /mtrx matrix put
+/col-1 {0 setgray} bind def
+/col0 {0.000 0.000 0.000 srgb} bind def
+/col1 {0.000 0.000 1.000 srgb} bind def
+/col2 {0.000 1.000 0.000 srgb} bind def
+/col3 {0.000 1.000 1.000 srgb} bind def
+/col4 {1.000 0.000 0.000 srgb} bind def
+/col5 {1.000 0.000 1.000 srgb} bind def
+/col6 {1.000 1.000 0.000 srgb} bind def
+/col7 {1.000 1.000 1.000 srgb} bind def
+/col8 {0.000 0.000 0.560 srgb} bind def
+/col9 {0.000 0.000 0.690 srgb} bind def
+/col10 {0.000 0.000 0.820 srgb} bind def
+/col11 {0.530 0.810 1.000 srgb} bind def
+/col12 {0.000 0.560 0.000 srgb} bind def
+/col13 {0.000 0.690 0.000 srgb} bind def
+/col14 {0.000 0.820 0.000 srgb} bind def
+/col15 {0.000 0.560 0.560 srgb} bind def
+/col16 {0.000 0.690 0.690 srgb} bind def
+/col17 {0.000 0.820 0.820 srgb} bind def
+/col18 {0.560 0.000 0.000 srgb} bind def
+/col19 {0.690 0.000 0.000 srgb} bind def
+/col20 {0.820 0.000 0.000 srgb} bind def
+/col21 {0.560 0.000 0.560 srgb} bind def
+/col22 {0.690 0.000 0.690 srgb} bind def
+/col23 {0.820 0.000 0.820 srgb} bind def
+/col24 {0.500 0.190 0.000 srgb} bind def
+/col25 {0.630 0.250 0.000 srgb} bind def
+/col26 {0.750 0.380 0.000 srgb} bind def
+/col27 {1.000 0.500 0.500 srgb} bind def
+/col28 {1.000 0.630 0.630 srgb} bind def
+/col29 {1.000 0.750 0.750 srgb} bind def
+/col30 {1.000 0.880 0.880 srgb} bind def
+/col31 {1.000 0.840 0.000 srgb} bind def
+
+end
+save
+-2.0 61.0 translate
+1 -1 scale
+
+/cp {closepath} bind def
+/ef {eofill} bind def
+/gr {grestore} bind def
+/gs {gsave} bind def
+/sa {save} bind def
+/rs {restore} bind def
+/l {lineto} bind def
+/m {moveto} bind def
+/rm {rmoveto} bind def
+/n {newpath} bind def
+/s {stroke} bind def
+/sh {show} bind def
+/slc {setlinecap} bind def
+/slj {setlinejoin} bind def
+/slw {setlinewidth} bind def
+/srgb {setrgbcolor} bind def
+/rot {rotate} bind def
+/sc {scale} bind def
+/sd {setdash} bind def
+/ff {findfont} bind def
+/sf {setfont} bind def
+/scf {scalefont} bind def
+/sw {stringwidth} bind def
+/tr {translate} bind def
+/tnt {dup dup currentrgbcolor
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb}
+ bind def
+/shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul
+ 4 -2 roll mul srgb} bind def
+/$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def
+/$F2psEnd {$F2psEnteredState restore end} def
+%%EndProlog
+
+$F2psBegin
+10 setmiterlimit
+n 0 1048 m 0 0 l 2473 0 l 2473 1048 l cp clip
+ 0.06000 0.06000 sc
+% Polyline
+30.000 slw
+n 2400 975 m 75 975 l 75 150 l 2400 150 l cp gs col-1 s gr
+/Times-Bold ff 360.00 scf sf
+1220 705 m
+gs 1 -1 sc (Graphic) dup sw pop 2 div neg 0 rm col-1 sh gr
+$F2psEnd
+rs
+
+%%EndDocument
+ @endspecial Black 2673 3827 a(Figure)i(55)q(:)p 0 TeXcolorgray
+Black 41 w(This)e(is)i(a)f(SC\014gure)p Black 771 4055
+a(The)g(follo)m(wing)i(four)d(options)i(can)g(b)s(e)f(sp)s(eci\014ed)f
+(in)h(the)h FM(\\usepackage)c FQ(command)p Black 630
+4243 a FL(outercaption)p Black 46 w FQ(This)35 b(option)i(places)g(the)
+g(caption)g(to)g(the)g(left)g(for)f(left)h(\(ev)m(en\))h(pages)f(and)
+857 4356 y(on)31 b(the)f(righ)m(t)h(for)f(righ)m(t)h(\(o)s(dd\))f
+(pages.)41 b(\(This)30 b(is)h(the)f(default\))p Black
+630 4544 a FL(innercaption)p Black 46 w FQ(This)h(option)h(places)h
+(the)f(caption)g(to)h(the)f(righ)m(t)g(for)g(left)g(\(ev)m(en\))h
+(pages)g(and)857 4657 y(on)e(the)f(left)h(for)f(righ)m(t)h(\(o)s(dd\))f
+(pages.)p Black 630 4844 a FL(leftcaption)p Black 45
+w FQ(This)g(option)h(places)g(the)g(caption)g(on)f(the)h(left.)p
+Black 630 5032 a FL(righ)m(tcaption)p Black 46 w FQ(This)f(option)g
+(places)i(the)e(caption)h(on)g(the)f(righ)m(t.)630 5219
+y(The)g FM(SCfigure)e FQ(en)m(vironmen)m(t)j(includes)f(t)m(w)m(o)i
+(optional)f(argumen)m(ts)p Black 630 5318 1332 4 v 630
+5439 a FG(asp)r(ects)c(of)f(the)f Fs(\015oat)h FG(pac)n(k)l(age)g(can)g
+(b)r(e)f(used)h(as)g(long)g(as)h(the)e FE(\\restylefloat)j
+FG(command)e(is)h(not)e(issued.)p Black Black 2250 5640
+a FQ(95)p Black eop end
+%%Page: 96 96
+TeXDict begin 96 95 bop Black 0 TeXcolorgray Black Black
+Black 767 -149 a FK(\210)p Black 45 w FQ(The)26 b(\014rst)g(optional)h
+(argumen)m(t)g(sp)s(eci\014es)f(the)h(relativ)m(e)h(width)e(of)h
+(caption)g(compared)f(to)857 -36 y(the)h(\014gure.)39
+b(A)27 b(large)g(v)-5 b(alue)28 b(\(e.g.,)h(100\))f(reserv)m(es)f(the)g
+(maxim)m(um)g(p)s(ossible)f(width.)38 b(The)857 77 y(default)31
+b(is)f(1.)p Black 767 226 a FK(\210)p Black 45 w FQ(The)21
+b(second)g(optional)i(argumen)m(t)e(sp)s(eci\014es)g(the)g(\015oat)h(p)
+s(osition)g(parameter)f(\(e.g.)39 b FM([htp])857 339
+y FQ(or)31 b FM([!ht])e FQ(\(see)i(Section)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 31 w(17.2)p Black 32 w(on)f(page)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 31 w(58)p Black(\).)630 581 y FB(25.2)112
+b(Side)38 b(Captions)h(without)e(Sidecap)630 753 y FQ(If)d(the)h
+FO(sidecap)g FQ(pac)m(k)-5 b(age)37 b(do)s(es)d(not)h(pro)m(vide)g
+(su\016cien)m(t)h(\015exibilit)m(y)-8 b(,)37 b(users)d(can)h(pro)s
+(duce)f(side)630 866 y(captions)39 b(with)f(the)g(metho)s(ds)g(in)g
+(this)g(section.)65 b(Section)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 39 w(25.2.1)p Black 41 w(sho)m(ws)37 b(ho)m(w)i(to)g
+(place)g(the)630 979 y(caption)f(to)g(the)f(left)h(of)g(the)f(graphic.)
+61 b(Placing)39 b(the)e(caption)h(to)g(the)f(righ)m(t)h(of)f(the)h
+(graphic)630 1092 y(pro)s(ceeds)c(similarly)-8 b(.)53
+b(F)-8 b(or)35 b FM(twoside)d FQ(do)s(cumen)m(ts,)j(Section)p
+0.05 1.00 1.00 0.40 TeXcolorcmyk 35 w(25.2.2)p Black
+36 w(sho)m(ws)f(ho)m(w)g(to)h(place)g(the)630 1205 y(caption)e(to)g
+(the)f(inside)g(of)g(the)g(graphic)g(\(to)h(the)f(left)h(of)f(the)g
+(graphic)g(for)g(o)s(dd)f(pages)i(and)e(to)630 1318 y(the)g(righ)m(t)g
+(of)f(the)h(graphic)f(for)g(ev)m(en)h(pages\).)630 1557
+y FL(25.2.1)106 b(Caption)34 b(to)h(Left)f(of)h(Figure)630
+1707 y FQ(The)42 b FM(\\caption)f FQ(command)h(places)i(the)f(caption)h
+(under)d(the)i(\014gure)f(or)h(table.)79 b(Minipage)630
+1798 y(en)m(vironmen)m(ts)40 b(can)g(b)s(e)e(used)h(to)h(tric)m(k)h
+(the)e(caption)i(command)e(in)m(to)h(placing)g(the)g(caption)630
+1889 y(b)s(eside)30 b(the)g(\014gure.)40 b(F)-8 b(or)32
+b(example,)f(the)f(commands)p Black Black 748 2016 a
+FE(\\begin{figure})865 2107 y(\\centering)865 2199 y
+(\\begin{minipage}[c]{.45\\lin)q(ewidt)q(h})983 2290
+y(\\centering)983 2381 y(\\caption{Caption)43 b(on)d(the)g(Side})983
+2473 y(\\label{fig:side:caption})826 2564 y(\\end{minipage}\045)826
+2655 y(\\begin{minipage}[c]{.45\\line)q(width)q(})983
+2747 y(\\centering)983 2838 y(\\includegraphics[width=\\linew)q(idth)q
+(]{gra)q(phic)q(})826 2929 y(\\end{minipage})748 3021
+y(\\end{figure})630 3169 y FQ(pro)s(duces)25 b(Figure)p
+0.05 1.00 1.00 0.40 TeXcolorcmyk 26 w(56)p Black(.)40
+b(It)27 b(ma)m(y)f(b)s(e)g(desirable)g(to)h(place)g(a)f(horizon)m(tal)i
+(spacing)e(command)g(suc)m(h)630 3282 y(as)31 b FM(\\hfill)d
+FQ(or)j FM(\\hspace{.05\\linewidth})24 b FQ(b)s(et)m(w)m(een)31
+b(the)g(minipages.)p Black 842 3744 a(Figure)g(56:)p
+0 TeXcolorgray Black 41 w(Caption)g(on)f(the)h(Side)2378
+3961 y @beginspecial 0 @llx 0 @lly 144 @urx 54 @ury 1798
+@rwi @setspecial
+%%BeginDocument: graphic.eps
+%!PS-Adobe-2.0 EPSF-2.0
+%%Title: graphic.eps
+%%Creator: fig2dev Version 3.2 Patchlevel 0-beta2
+%%CreationDate: Thu Dec 11 20:58:11 1997
+%%For: Keith Reckdahl
+%%Orientation: Portrait
+%%BoundingBox: 0 0 144 54
+%%Pages: 0
+%%BeginSetup
+%%IncludeFeature: *PageSize Letter
+%%EndSetup
+%%Magnification: 1.00
+%%EndComments
+/$F2psDict 200 dict def
+$F2psDict begin
+$F2psDict /mtrx matrix put
+/col-1 {0 setgray} bind def
+/col0 {0.000 0.000 0.000 srgb} bind def
+/col1 {0.000 0.000 1.000 srgb} bind def
+/col2 {0.000 1.000 0.000 srgb} bind def
+/col3 {0.000 1.000 1.000 srgb} bind def
+/col4 {1.000 0.000 0.000 srgb} bind def
+/col5 {1.000 0.000 1.000 srgb} bind def
+/col6 {1.000 1.000 0.000 srgb} bind def
+/col7 {1.000 1.000 1.000 srgb} bind def
+/col8 {0.000 0.000 0.560 srgb} bind def
+/col9 {0.000 0.000 0.690 srgb} bind def
+/col10 {0.000 0.000 0.820 srgb} bind def
+/col11 {0.530 0.810 1.000 srgb} bind def
+/col12 {0.000 0.560 0.000 srgb} bind def
+/col13 {0.000 0.690 0.000 srgb} bind def
+/col14 {0.000 0.820 0.000 srgb} bind def
+/col15 {0.000 0.560 0.560 srgb} bind def
+/col16 {0.000 0.690 0.690 srgb} bind def
+/col17 {0.000 0.820 0.820 srgb} bind def
+/col18 {0.560 0.000 0.000 srgb} bind def
+/col19 {0.690 0.000 0.000 srgb} bind def
+/col20 {0.820 0.000 0.000 srgb} bind def
+/col21 {0.560 0.000 0.560 srgb} bind def
+/col22 {0.690 0.000 0.690 srgb} bind def
+/col23 {0.820 0.000 0.820 srgb} bind def
+/col24 {0.500 0.190 0.000 srgb} bind def
+/col25 {0.630 0.250 0.000 srgb} bind def
+/col26 {0.750 0.380 0.000 srgb} bind def
+/col27 {1.000 0.500 0.500 srgb} bind def
+/col28 {1.000 0.630 0.630 srgb} bind def
+/col29 {1.000 0.750 0.750 srgb} bind def
+/col30 {1.000 0.880 0.880 srgb} bind def
+/col31 {1.000 0.840 0.000 srgb} bind def
+
+end
+save
+-2.0 61.0 translate
+1 -1 scale
+
+/cp {closepath} bind def
+/ef {eofill} bind def
+/gr {grestore} bind def
+/gs {gsave} bind def
+/sa {save} bind def
+/rs {restore} bind def
+/l {lineto} bind def
+/m {moveto} bind def
+/rm {rmoveto} bind def
+/n {newpath} bind def
+/s {stroke} bind def
+/sh {show} bind def
+/slc {setlinecap} bind def
+/slj {setlinejoin} bind def
+/slw {setlinewidth} bind def
+/srgb {setrgbcolor} bind def
+/rot {rotate} bind def
+/sc {scale} bind def
+/sd {setdash} bind def
+/ff {findfont} bind def
+/sf {setfont} bind def
+/scf {scalefont} bind def
+/sw {stringwidth} bind def
+/tr {translate} bind def
+/tnt {dup dup currentrgbcolor
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb}
+ bind def
+/shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul
+ 4 -2 roll mul srgb} bind def
+/$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def
+/$F2psEnd {$F2psEnteredState restore end} def
+%%EndProlog
+
+$F2psBegin
+10 setmiterlimit
+n 0 1048 m 0 0 l 2473 0 l 2473 1048 l cp clip
+ 0.06000 0.06000 sc
+% Polyline
+30.000 slw
+n 2400 975 m 75 975 l 75 150 l 2400 150 l cp gs col-1 s gr
+/Times-Bold ff 360.00 scf sf
+1220 705 m
+gs 1 -1 sc (Graphic) dup sw pop 2 div neg 0 rm col-1 sh gr
+$F2psEnd
+rs
+
+%%EndDocument
+ @endspecial Black 771 4151 a(The)41 b(caption)i(and)e(graphic)h(in)f
+(Figure)p 0.05 1.00 1.00 0.40 TeXcolorcmyk 42 w(56)p
+Black 43 w(are)h(cen)m(tered)h(v)m(ertically)-8 b(.)77
+b(If)42 b(it)g(is)g(instead)630 4264 y(desired)d(to)g(align)h(the)g(b)s
+(ottoms)f(or)g(tops)g(of)h(graphics)f(and)f(caption,)43
+b(see)c(Section)p 0.05 1.00 1.00 0.40 TeXcolorcmyk
+40 w(11.4)p Black 41 w(on)630 4377 y(page)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 31 w(36)p Black(.)630 4616 y FL(25.2.2)106
+b(Caption)34 b(on)h(Binding)h(Side)f(of)g(Graphic)630
+4766 y FQ(The)30 b(ab)s(o)m(v)m(e)h(co)s(de)g(for)f(Figure)p
+0.05 1.00 1.00 0.40 TeXcolorcmyk 31 w(56)p Black 31
+w(places)i(the)e(caption)h(to)g(the)g(left)g(of)g(the)f(graphic.)41
+b(F)-8 b(or)31 b(t)m(w)m(o-)630 4857 y(sided)i(do)s(cumen)m(ts,)i(it)f
+(ma)m(y)g(b)s(e)f(desired)g(to)h(place)h(the)f(caption)g(on)g(the)g
+(binding)e(side)i(of)g(the)630 4949 y(graphics.)40 b(In)28
+b(these)i(cases,)g(the)f FO(ifthen)g FQ(pac)m(k)-5 b(age's)31
+b FM(\\ifthenelse)26 b FQ(command)j(can)g(b)s(e)f(used)g(to)630
+5040 y(c)m(ho)s(ose)j(b)s(et)m(w)m(een)g(o)s(dd-page)g(co)s(de)f(and)g
+(ev)m(en-page)i(co)s(de.)41 b(F)-8 b(or)31 b(example,)p
+Black Black 748 5167 a FE(\\usepackage{ifthen})748 5258
+y(...)748 5349 y(\\begin{figure})865 5441 y(\\centering)p
+Black 2250 5640 a FQ(96)p Black eop end
+%%Page: 97 97
+TeXDict begin 97 96 bop Black 0 TeXcolorgray Black Black
+865 -149 a FE(\\ifthenelse{\\isodd{\\pageref)q({fig:)q(side)q(:capt)q
+(ion})q(}})865 -57 y({\045)40 b(BEGIN)g(ODD-PAGE)h(FIGURE)983
+34 y(\\begin{minipage}[c]{.45\\linew)q(idth)q(})1101
+125 y(\\centering)1101 217 y(\\caption{Caption)i(on)c(the)h(Side})1101
+308 y(\\label{fig:side:caption})983 399 y(\\end{minipage}\045)983
+491 y(\\hspace{0.05\\linewidth}\045)983 582 y
+(\\begin{minipage}[c]{.45\\linew)q(idth)q(})1101 673
+y(\\includegraphics[width=\\linewi)q(dth]{)q(grap)q(hic})983
+765 y(\\end{minipage}\045)865 856 y(}\045)g(END)g(ODD-PAGE)h(FIGURE)865
+947 y({\045)f(BEGIN)g(EVEN-PAGE)i(FIGURE)983 1039 y
+(\\begin{minipage}[c]{.45\\linew)q(idth)q(})1101 1130
+y(\\includegraphics[width=\\linewi)q(dth]{)q(grap)q(hic})983
+1221 y(\\end{minipage}\045)983 1313 y(\\hspace{0.05\\linewidth}\045)983
+1404 y(\\begin{minipage}[c]{.45\\linew)q(idth)q(})1101
+1495 y(\\centering)1101 1586 y(\\caption{Caption)h(on)c(the)h(Side})
+1101 1678 y(\\label{fig:side:caption})983 1769 y(\\end{minipage}\045)
+865 1860 y(}\045)g(END)g(EVEN-PAGE)h(FIGURE)748 1952
+y(\\end{figure})630 2106 y FQ(pro)s(duces)23 b(a)h(\014gure)g(where)g
+(the)g(caption)h(alw)m(a)m(ys)h(app)s(ear)d(on)h(the)h(binding)e(side)h
+(of)g(the)h(graphic.)630 2393 y FD(26)135 b(Figures)45
+b(on)g(Ev)l(en)g(or)g(Odd)g(P)l(ages)630 2596 y FQ(The)29
+b(\014gure)h(en)m(vironmen)m(t)g(\015oat-placemen)m(t)i(algorithm)f(do)
+s(es)f(not)g(con)m(trol)h(whether)e(a)i(\014gure)630
+2708 y(app)s(ears)f(on)h(an)f(ev)m(en)i(or)e(o)s(dd)g(page.)42
+b(This)30 b(section)i(describ)s(es)e(ho)m(w)h(to)g(use)g(the)g
+FM(\\afterpage)630 2821 y FQ(command)k(\(part)h(of)g(the)g
+FO(afterpage)g FQ(pac)m(k)-5 b(age\))38 b(and)d(the)h
+FM(\\ifthenelse)c FQ(command)k(\(part)g(of)630 2934 y(the)31
+b FO(ifthen)f FQ(pac)m(k)-5 b(age\))32 b(to)f(place)h(a)e(\014gure)g
+(on)m(to)i(an)e(o)s(dd)f(or)i(ev)m(en)g(page.)771 3047
+y(The)36 b(con)m(v)m(en)m(tional)k(metho)s(d)c(for)g(creating)i
+(\014gures)e(is)g(to)h(put)f(the)h(graphics)f(in)h(a)g(\014gure)630
+3160 y(en)m(vironmen)m(t.)68 b(Ho)m(w)m(ev)m(er,)43 b(since)d(\014gure)
+e(en)m(vironmen)m(ts)i(can)f(\015oat,)k(there)c(is)g(no)g(guaran)m(tee)
+630 3273 y(that)31 b(a)g(\014gure)f(desired)f(for)h(an)h(ev)m(en-page)h
+(w)m(on't)f(end)f(up)f(on)h(an)g(o)s(dd)g(page)h(\(or)g(vice)g(v)m
+(ersa\).)771 3373 y(Instead,)e(the)f FM(\\captionof)d
+FQ(command)i(describ)s(ed)g(in)g(Section)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 29 w(21)p Black 29 w(can)h(b)s(e)f(used)g(to)h(create)630
+3472 y(a)40 b(\014gure)e(without)h(using)g(a)g(\014gure)g(en)m
+(vironmen)m(t.)67 b(The)39 b FM(\\ifthenelse)d FQ(command)j(is)g(then)
+630 3572 y(used)c(to)i(place)g(the)g(\014rst)e(graphic)h(on)g(the)g
+(next)h(ev)m(en)g(page.)58 b(This)36 b(requires)f(rep)s(eating)i(the)
+630 3672 y(graphics)28 b(commands)h(t)m(wice,)h(once)f(for)f(the)h
+(case)h(of)e(the)h(next)g(page)g(b)s(eing)f(o)s(dd)f(and)h(once)h(for)
+630 3771 y(the)38 b(case)g(of)g(the)g(next)f(page)h(b)s(eing)g(ev)m
+(en.)62 b(T)-8 b(o)38 b(simplify)f(the)h(resulting)g(co)s(de,)h(a)f
+FM(\\leftfig)630 3871 y FQ(command)30 b(is)h(de\014ned)p
+Black Black 935 4012 a FN(\\newcommand\\left)o(fig)o({\045)1109
+4112 y(\\vspace*{\\fill}\045)1109 4211 y(\\centering)1109
+4311 y(\\includegraphics{)o(gra)o(ph)o(ic})1109 4410
+y(\\captionof{figure)o(}{T)o(hi)o(s)38 b(is)k(on)h(the)f(left)g
+(\(even\))f(page.})1109 4510 y(\\vspace*{\\fill}\\n)o(ewp)o(ag)o(e})630
+4651 y FQ(The)32 b(left-page)i(\014gures)e(are)h(then)f(created)i
+(using)e(this)g(newly-de\014ned)g FM(\\leftfig)e FQ(command)630
+4751 y(along)h(with)f(the)h FM(\\afterpage)d FQ(and)h
+FM(\\ifthenelse)f FQ(commands)p Black Black 892 4892
+a FN(\\afterpage{\\cle)o(ar)o(pag)o(e\045)1109 4992 y
+(\\ifthenelse{\\isod)o(d{\\)o(va)o(lue)o({p)o(ag)o(e}})o(}\045)1284
+5091 y({\\afterpage{\\lef)o(tf)o(ig})o(}\045)1284 5191
+y({\\leftfig}})630 5345 y FQ(Notes)k(ab)s(out)e(o)s(dd/ev)m(en)g(page)h
+(placemen)m(t:)p Black 2250 5640 a(97)p Black eop end
+%%Page: 98 98
+TeXDict begin 98 97 bop Black 0 TeXcolorgray Black Black
+Black 767 -149 a FK(\210)p Black 45 w FQ(T)-8 b(o)21
+b(force)g(the)f(\014gure)g(to)h(a)g(righ)m(t-hand)f(\(o)s(dd\))g(page,)
+j(rev)m(erse)e(the)f(order)g(of)h(the)f FM(\\ifthenelse)857
+-49 y FQ(argumen)m(ts.)p Black Black 1119 85 a FN(\\afterpage{\\clea)o
+(rp)o(age)o(\045)1380 184 y(\\ifthenelse{\\isod)o(d{)o(\\va)o(lu)o(e{p)
+o(ag)o(e})o(}}\045)1555 284 y({\\leftfig}}\045)1555 383
+y({\\afterpage{\\le)o(ftf)o(ig)o(}})p Black 767 530 a
+FK(\210)p Black 45 w FQ(Because)45 b(these)e(are)h(non-\015oating)g
+(\014gures,)h(the)f FM(\\value{page})39 b FQ(command)k(can)h(b)s(e)857
+643 y(used)25 b(to)g(determine)g(the)h(curren)m(t)f(page.)39
+b(\(This)25 b(is)g(not)g(useful)g(for)f(\015oating)i(\014gures)f(since)
+857 756 y FM(\\value{page})33 b FQ(is)k(the)f(curren)m(t)g(page)h(when)
+f(the)g(\014gure)g(en)m(vironmen)m(t)h(is)f(pro)s(cessed,)857
+869 y(not)k(where)f(it)g(is)h(placed.\))68 b(Th)m(us)38
+b(using)h FM(\\value{page})d FQ(is)j(b)s(etter)g(than)g
+FM(\\pageref)857 982 y FQ(since)31 b FM(\\pageref)d FQ(is)j(only)f
+(correct)i(once)f(the)f(L)2474 965 y FP(A)2513 982 y
+FQ(T)2564 1002 y(E)2615 982 y(X)g(references)h(ha)m(v)m(e)g(con)m(v)m
+(erged\).)p Black 767 1119 a FK(\210)p Black 45 w FQ(When)40
+b(using)f(large)i(\014gures,)h(it)f(is)f(p)s(ossible)f(for)h(a)g
+(pagebreak)h(to)g(o)s(ccur)e(within)h(the)857 1219 y(\014gure)29
+b(\(e.g.,)i(b)s(et)m(w)m(een)e(the)h(graphic)f(and)f(the)h(caption\).)
+42 b(The)28 b(\014gure)h(can)g(b)s(e)f(forced)h(to)857
+1318 y(sta)m(y)j(together)g(b)m(y)e(enclosing)h(it)g(in)f(a)h(minipage)
+g(en)m(vironmen)m(t)p Black Black 1032 1452 a FN(\\newcommand\\lef)o
+(tfi)o(g{)o(\045)1380 1552 y(\\vspace*{\\fill}\045)1380
+1651 y(\\begin{minipage}{)o(\\l)o(ine)o(wi)o(dth)o(})1511
+1751 y(\\centering)1511 1850 y(\\includegraphics)o({gr)o(ap)o(hic)o(})
+1511 1950 y(\\captionof{figur)o(e}{)o(Th)o(is)37 b(is)43
+b(on)g(the)f(left)g(\(even\))f(page.})1380 2050 y(\\end{minipage})1380
+2149 y(\\vspace*{\\fill}\\n)o(ew)o(pag)o(e})p Black 767
+2283 a FK(\210)p Black 45 w FQ(The)23 b FM(\\afterpage)d
+FQ(command)j(can)h(sometimes)g(b)s(e)e(\015aky)-8 b(,)25
+b(in)e(rare)g(cases)i(causing)e(a)h(\\lost)857 2383 y(\015oat")29
+b(error.)40 b(Remo)m(ving)29 b(the)f FM(\\clearpage)d
+FQ(b)s(efore)i(the)h FM(\\ifthenelse)d FQ(ma)m(y)k(help)e(this)857
+2482 y(situation.)p Black Black 1119 2616 a FN(\\afterpage{\\ifth)o(en)
+o(els)o(e{)o(\\i)o(sod)o(d{)o(\\va)o(lu)o(e{)o(pag)o(e})o(}}\045)1555
+2716 y({\\afterpage{\\le)o(ftf)o(ig)o(}}\045)1555 2815
+y({\\leftfig}})p Black 767 2949 a FK(\210)p Black 45
+w FQ(In)21 b(the)g(ab)s(o)m(v)m(e)h(example,)i(the)d(\014gure)g(uses)f
+(the)i(en)m(tire)g(ev)m(en)f(page.)39 b(T)-8 b(o)21 b(place)h(the)g
+(\014gure)e(at)857 3049 y(the)i(top)f(of)g(the)h(ev)m(en)f(page,)j(mo)s
+(dify)d(or)g(remo)m(v)m(e)h(the)g FM(\\vspace*{\\fill})17
+b FQ(and)j FM(\\newpage)857 3148 y FQ(commands)p Black
+Black 1162 3282 a FN(\\newcommand\\leftf)o(ig{)o(\045)1337
+3381 y(\\centering)1337 3481 y(\\includegraphics)o({g)o(ra)o(phi)o(c})
+1337 3581 y(\\captionof{figur)o(e})o({T)o(his)37 b(is)43
+b(at)f(the)h(top)f(of)h(the)f(left)g(\(even\))f(page.})1337
+3680 y(\\vspace{\\floatse)o(p})o(})630 3920 y FB(26.1)112
+b(Figures)39 b(on)e(F)-9 b(acing)39 b(P)m(ages)630 4079
+y FQ(T)-8 b(o)27 b(ease)g(the)g(comparison)f(of)h(t)m(w)m(o)g
+(\014gures)f(in)g(a)h FM(twoside)d FQ(do)s(cumen)m(t,)j(it)g(ma)m(y)g
+(b)s(e)f(desirable)g(to)630 4178 y(p)s(osition)31 b(the)g(\014gures)f
+(on)g(facing)i(pages.)42 b(T)-8 b(o)31 b(do)g(this,)g(a)g(pro)s(cedure)
+e(similar)i(to)h(the)e(previous)630 4278 y(section's)35
+b(ev)m(en/o)s(dd)e(page-placemen)m(t)j(m)m(ust)d(b)s(e)g(used.)48
+b(T)-8 b(o)34 b(simplify)f(the)h(resulting)f(co)s(de,)i(a)630
+4378 y FM(\\facingfigures)26 b FQ(command)31 b(is)f(de\014ned)f(as)p
+Black Black 848 4519 a FN(\\newcommand\\faci)o(ng)o(fig)o(ur)o(es{)o
+(\045)1066 4618 y(\\vspace*{\\fill}\045)1197 4718 y(\\centering)1197
+4818 y(\\includegraphic)o(s{l)o(ef)o(t})1197 4917 y(\\captionof{figu)o
+(re})o({T)o(his)37 b(is)42 b(on)h(the)g(left)e(\(even\))h(page.})1066
+5017 y(\\vspace*{\\fill}\\)o(ne)o(wpa)o(ge)o(\\vs)o(pa)o(ce)o(*{\\)o
+(fi)o(ll})o(\045)1197 5117 y(\\centering)1197 5216 y(\\includegraphic)o
+(s{r)o(ig)o(ht})1197 5316 y(\\captionof{figu)o(re})o({T)o(his)37
+b(is)42 b(on)h(the)g(right)e(\(odd\))h(page.})1066 5415
+y(\\vspace*{\\fill}\\)o(ne)o(wpa)o(ge)o(})p Black 2250
+5640 a FQ(98)p Black eop end
+%%Page: 99 99
+TeXDict begin 99 98 bop Black 0 TeXcolorgray Black Black
+630 -149 a FQ(The)27 b(facing)h(\014gures)e(are)i(then)f(created)h
+(using)f(this)g FM(\\facingfigures)c FQ(command)k(along)h(with)630
+-49 y(the)j FM(\\afterpage)c FQ(and)j FM(\\ifthenelse)d
+FQ(commands)p Black Black 935 81 a FN(\\afterpage{\\clea)o(rpa)o(ge)o
+(\045)1066 181 y(\\ifthenelse{\\iso)o(dd)o({\\v)o(al)o(ue{)o(pa)o(ge)o
+(}}})o(\045)1197 280 y({\\afterpage{\\fa)o(cin)o(gf)o(igu)o(re)o(s})o
+(}\045)1197 380 y({\\facingfigures)o(}})630 695 y FD(27)135
+b(Bo)l(xed)45 b(Figures)630 898 y FQ(The)30 b(term)g
+Fy(Boxe)-5 b(d)34 b(Figur)-5 b(e)38 b FQ(usually)30 b(refers)g(to)h
+(one)f(of)h(t)m(w)m(o)h(situations)p Black 767 1040 a
+FK(\210)p Black 45 w FQ(A)f(b)s(o)m(x)f(surrounds)e(the)i(\014gure's)g
+(graphic)h(but)e(not)i(the)f(\014gure's)g(caption.)p
+Black 767 1189 a FK(\210)p Black 45 w FQ(A)h(b)s(o)m(x)f(surrounds)e
+(the)i(\014gure's)g(graphic)h(and)e(its)i(caption.)630
+1331 y(The)37 b(basic)h(metho)s(d)e(for)h(b)s(o)m(xing)h(an)f(item)h
+(is)f(to)h(simply)f(place)i(the)e(item)h(inside)f(an)g
+FM(\\fbox)630 1444 y FQ(command,)26 b(whic)m(h)f(surrounds)d(the)j(ob)5
+b(ject)26 b(with)f(a)g(rectangular)h(b)s(o)m(x.)39 b(The)24
+b FO(fancyb)s(o)m(x)h FQ(pac)m(k)-5 b(age)630 1557 y(pro)m(vides)30
+b(b)s(o)m(xes)h(of)f(di\013eren)m(t)h(st)m(yles.)630
+1799 y FB(27.1)112 b(Bo)m(x)37 b(Around)h(Graphic)630
+1957 y FQ(Placing)k(an)f FM(\\fbox)f FQ(command)g(around)g(the)i
+FM(\\includegraphics)36 b FQ(command)41 b(pro)s(duces)f(a)630
+2056 y(b)s(o)m(x)30 b(around)g(the)g(included)g(graphic.)41
+b(F)-8 b(or)31 b(example,)g(the)g(commands)p Black Black
+804 2187 a FN(\\begin{figure})935 2286 y(\\centering)935
+2386 y(\\fbox{\\includegr)o(aph)o(ic)o(s[t)o(ot)o(alh)o(ei)o(gh)o(t=2)o
+(in)o(]{f)o(il)o(e})o(})935 2485 y(\\caption{Box)39 b(Around)i
+(Graphic,)f(But)i(Not)h(Around)e(Caption})935 2585 y(\\label{fig:boxed)
+o(_gr)o(ap)o(hic)o(})804 2685 y(\\end{figure})630 2828
+y FQ(place)31 b(a)g(b)s(o)m(x)f(around)g(the)g(included)g(\014gure,)g
+(as)h(sho)m(wn)e(in)h(Figure)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 31 w(57)p Black(.)p Black 1404 2944 1783
+4 v 1404 4194 4 1250 v 1432 4169 a @beginspecial 0 @llx
+0 @lly 371 @urx 258 @ury 1440 @rhi @setspecial
+%%BeginDocument: pend.eps
+%!PS-Adobe-2.0 EPSF-2.0
+%%Title: pend.fig
+%%Creator: fig2dev Version 3.2 Patchlevel 4
+%%CreationDate: Sun May 22 21:42:13 2005
+%%For: epstein@linux (Becky Epstein)
+%%BoundingBox: 0 0 371 258
+%%Magnification: 1.0000
+%%EndComments
+/$F2psDict 200 dict def
+$F2psDict begin
+$F2psDict /mtrx matrix put
+/col-1 {0 setgray} bind def
+/col0 {0.000 0.000 0.000 srgb} bind def
+/col1 {0.000 0.000 1.000 srgb} bind def
+/col2 {0.000 1.000 0.000 srgb} bind def
+/col3 {0.000 1.000 1.000 srgb} bind def
+/col4 {1.000 0.000 0.000 srgb} bind def
+/col5 {1.000 0.000 1.000 srgb} bind def
+/col6 {1.000 1.000 0.000 srgb} bind def
+/col7 {1.000 1.000 1.000 srgb} bind def
+/col8 {0.000 0.000 0.560 srgb} bind def
+/col9 {0.000 0.000 0.690 srgb} bind def
+/col10 {0.000 0.000 0.820 srgb} bind def
+/col11 {0.530 0.810 1.000 srgb} bind def
+/col12 {0.000 0.560 0.000 srgb} bind def
+/col13 {0.000 0.690 0.000 srgb} bind def
+/col14 {0.000 0.820 0.000 srgb} bind def
+/col15 {0.000 0.560 0.560 srgb} bind def
+/col16 {0.000 0.690 0.690 srgb} bind def
+/col17 {0.000 0.820 0.820 srgb} bind def
+/col18 {0.560 0.000 0.000 srgb} bind def
+/col19 {0.690 0.000 0.000 srgb} bind def
+/col20 {0.820 0.000 0.000 srgb} bind def
+/col21 {0.560 0.000 0.560 srgb} bind def
+/col22 {0.690 0.000 0.690 srgb} bind def
+/col23 {0.820 0.000 0.820 srgb} bind def
+/col24 {0.500 0.190 0.000 srgb} bind def
+/col25 {0.630 0.250 0.000 srgb} bind def
+/col26 {0.750 0.380 0.000 srgb} bind def
+/col27 {1.000 0.500 0.500 srgb} bind def
+/col28 {1.000 0.630 0.630 srgb} bind def
+/col29 {1.000 0.750 0.750 srgb} bind def
+/col30 {1.000 0.880 0.880 srgb} bind def
+/col31 {1.000 0.840 0.000 srgb} bind def
+
+end
+save
+newpath 0 258 moveto 0 0 lineto 371 0 lineto 371 258 lineto closepath clip newpath
+-9.2 263.5 translate
+1 -1 scale
+
+/cp {closepath} bind def
+/ef {eofill} bind def
+/gr {grestore} bind def
+/gs {gsave} bind def
+/sa {save} bind def
+/rs {restore} bind def
+/l {lineto} bind def
+/m {moveto} bind def
+/rm {rmoveto} bind def
+/n {newpath} bind def
+/s {stroke} bind def
+/sh {show} bind def
+/slc {setlinecap} bind def
+/slj {setlinejoin} bind def
+/slw {setlinewidth} bind def
+/srgb {setrgbcolor} bind def
+/rot {rotate} bind def
+/sc {scale} bind def
+/sd {setdash} bind def
+/ff {findfont} bind def
+/sf {setfont} bind def
+/scf {scalefont} bind def
+/sw {stringwidth} bind def
+/tr {translate} bind def
+/tnt {dup dup currentrgbcolor
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb}
+ bind def
+/shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul
+ 4 -2 roll mul srgb} bind def
+ /DrawEllipse {
+ /endangle exch def
+ /startangle exch def
+ /yrad exch def
+ /xrad exch def
+ /y exch def
+ /x exch def
+ /savematrix mtrx currentmatrix def
+ x y tr xrad yrad sc 0 0 1 startangle endangle arc
+ closepath
+ savematrix setmatrix
+ } def
+
+/$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def
+/$F2psEnd {$F2psEnteredState restore end} def
+
+$F2psBegin
+10 setmiterlimit
+0 slj 0 slc
+ 0.06000 0.06000 sc
+%
+% Fig objects follow
+%
+%
+% here starts figure with depth 0
+% Arc
+7.500 slw
+gs clippath
+2592 2142 m 2544 2084 l 2403 2198 l 2544 2133 l 2451 2256 l cp
+eoclip
+n 2068.5 1649.8 680.1 103.9 44.1 arcn
+gs col-1 s gr
+ gr
+
+% arrowhead
+n 2451 2256 m 2544 2133 l 2403 2198 l 2451 2256 l cp gs 0.00 setgray ef gr col-1 s
+% Arc
+gs clippath
+4195 3222 m 4123 3199 l 4068 3371 l 4150 3240 l 4140 3394 l cp
+eoclip
+n 2866.1 2901.2 1328.9 63.9 14.1 arcn
+gs col-1 s gr
+ gr
+
+% arrowhead
+n 4140 3394 m 4150 3240 l 4068 3371 l 4140 3394 l cp gs 0.00 setgray ef gr col-1 s
+% Ellipse
+n 2925 2790 225 225 0 360 DrawEllipse gs 0.00 setgray ef gr gs col-1 s gr
+
+% Ellipse
+n 5445 3600 225 225 0 360 DrawEllipse gs 0.00 setgray ef gr gs col-1 s gr
+
+% Ellipse
+n 3645 2040 300 300 0 360 DrawEllipse gs col-1 s gr
+
+% Ellipse
+n 4530 1455 300 300 0 360 DrawEllipse gs col-1 s gr
+
+% Ellipse
+n 5360 2388 300 300 0 360 DrawEllipse gs col-1 s gr
+
+% Polyline
+30.000 slw
+n 1905 570 m
+ 2790 2625 l gs col-1 s gr
+% Polyline
+n 3090 2895 m
+ 5250 3540 l gs col-1 s gr
+% Polyline
+7.500 slw
+ [60] 0 sd
+n 1905 570 m
+ 1905 2475 l gs col-1 s gr [] 0 sd
+% Polyline
+gs clippath
+5368 3377 m 5463 3372 l 5448 3120 l 5414 3342 l 5354 3126 l cp
+eoclip
+n 5377 2692 m
+ 5415 3360 l gs col-1 s gr gr
+
+% arrowhead
+n 5354 3126 m 5414 3342 l 5448 3120 l 5404 3167 l 5354 3126 l
+ cp gs 0.00 setgray ef gr col-1 s
+% Polyline
+ [60] 0 sd
+n 2970 3030 m
+ 3555 4380 l gs col-1 s gr [] 0 sd
+% Polyline
+n 6315 570 m 165 570 l 165 120 l 6315 120 l
+ cp gs 0.50 setgray ef gr gs col0 s gr
+% Polyline
+gs clippath
+3030 2572 m 3097 2639 l 3276 2460 l 3088 2582 l 3209 2393 l cp
+eoclip
+n 3420 2250 m
+ 3075 2595 l gs col-1 s gr gr
+
+% arrowhead
+n 3209 2393 m 3088 2582 l 3276 2460 l 3211 2458 l 3209 2393 l
+ cp gs 0.00 setgray ef gr col-1 s
+% Polyline
+gs clippath
+4463 549 m 4369 560 l 4397 810 l 4420 588 l 4492 799 l cp
+eoclip
+n 4485 1155 m
+ 4418 570 l gs col-1 s gr gr
+
+% arrowhead
+n 4492 799 m 4420 588 l 4397 810 l 4439 761 l 4492 799 l
+ cp gs 0.00 setgray ef gr col-1 s
+/Times-Roman ff 270.00 scf sf
+2475 1650 m
+gs 1 -1 sc (L1) col-1 sh gr
+/Times-Roman ff 270.00 scf sf
+4440 1545 m
+gs 1 -1 sc (N) col-1 sh gr
+/Times-Roman ff 270.00 scf sf
+3525 2130 m
+gs 1 -1 sc (P1) col-1 sh gr
+/Times-Roman ff 270.00 scf sf
+2070 2054 m
+gs 1 -1 sc (q1) col-1 sh gr
+/Times-Roman ff 270.00 scf sf
+3457 3518 m
+gs 1 -1 sc (q2) col-1 sh gr
+/Times-Roman ff 270.00 scf sf
+4080 3060 m
+gs 1 -1 sc (L2) col-1 sh gr
+/Times-Roman ff 270.00 scf sf
+5227 2467 m
+gs 1 -1 sc (P2) col-1 sh gr
+% here ends figure;
+$F2psEnd
+rs
+showpage
+
+%%EndDocument
+ @endspecial 3183 4194 V 1404 4197 1783 4 v 1123 4365
+a(Figure)h(57:)p 0 TeXcolorgray Black 42 w(Bo)m(x)g(Around)e(Graphic,)i
+(But)f(Not)i(Around)d(Caption)p Black 630 4718 a FB(27.2)112
+b(Bo)m(x)37 b(Around)h(Figure)g(and)h(Caption)630 4890
+y FQ(T)-8 b(o)35 b(include)g(b)s(oth)e(the)i(\014gure's)f(graphic)h
+(and)f(its)h(caption,)i(one)e(ma)m(y)g(b)s(e)f(tempted)h(to)g(mo)m(v)m
+(e)630 5002 y(the)i FM(\\caption)e FQ(command)h(inside)h(the)g
+FM(\\fbox)e FQ(command.)61 b(Ho)m(w)m(ev)m(er,)40 b(this)d(do)s(es)g
+(not)g(w)m(ork)630 5115 y(b)s(ecause)i FM(\\caption)f
+FQ(can)h(only)h(b)s(e)f(used)f(in)i(paragraph)f(mo)s(de,)i(while)f(the)
+f(con)m(ten)m(ts)i(of)f(an)630 5228 y FM(\\fbox)29 b
+FQ(command)h(are)h(pro)s(cessed)f(in)g(LR)g(mo)s(de)2348
+5195 y FP(40)2422 5228 y FQ(.)p Black 630 5320 1332 4
+v 703 5409 a FF(40)768 5441 y FG(L)788 5424 y FF(A)821
+5441 y FG(T)863 5457 y(E)907 5441 y(X)25 b(uses)h(three)g(mo)r(des:)35
+b(LR)25 b(mo)r(de,)h(paragraph)g(mo)r(de,)h(and)e(math)h(mo)r(de.)34
+b(See)26 b([)p 0.05 1.00 1.00 0.40 TeXcolorcmyk(1)p
+Black 1 w(,)g(pages)g(36,103-5].)p Black Black 2250 5640
+a FQ(99)p Black eop end
+%%Page: 100 100
+TeXDict begin 100 99 bop Black 0 TeXcolorgray Black Black
+771 -149 a FQ(Since)20 b(the)h(con)m(ten)m(ts)h(of)e(minipage)h(en)m
+(vironmen)m(ts)g(and)e FM(\\parbox)g FQ(commands)h(are)g(pro)s(cessed)
+630 -36 y(in)27 b(paragraph)f(mo)s(de,)h(the)h FM(\\caption)c
+FQ(command)j(can)g(b)s(e)g(included)f(in)g(the)h FM(\\fbox)f
+FQ(b)m(y)h(enclos-)630 77 y(ing)e(the)h FM(\\fbox)d FQ(con)m(ten)m(ts)k
+(inside)e(a)g(minipage)h(en)m(vironmen)m(t)g(or)f(a)g
+FM(\\parbox)e FQ(command.)39 b(Since)630 190 y(b)s(oth)28
+b(minipages)h(and)e(parb)s(o)m(xes)i(require)f(a)h(width)e(sp)s
+(eci\014cation,)j(there)f(is)f(no)h(direct)g(w)m(a)m(y)g(to)630
+303 y(mak)m(e)i(the)g FM(\\fbox)e FQ(exactly)j(as)f(wide)f(the)g
+(graphic)h(and)f(caption.)630 486 y(F)-8 b(or)31 b(example,)g(the)g
+(commands)p Black Black 717 627 a FN(\\begin{figure})848
+726 y(\\centering)848 826 y(\\fbox{)41 b(\\begin{minipage})o({4)c(in})
+1153 926 y(\\centering)1153 1025 y(\\includegraphics)o([to)o(ta)o(lhe)o
+(ig)o(ht)o(=2i)o(n])o({pe)o(nd)o(})1153 1125 y(\\caption{Box)i(Around)i
+(Figure)g(Graphic)g(and)h(Caption})1153 1225 y(\\label{fig:boxed)o(_fi)
+o(gu)o(re})848 1324 y(\\end{minipage})c(})717 1424 y(\\end{figure})630
+1578 y FQ(place)31 b(a)g(b)s(o)m(x)f(around)g(the)g(\014gure's)g
+(graphic)h(and)e(caption,)j(as)e(sho)m(wn)g(in)g(Figure)p
+0.05 1.00 1.00 0.40 TeXcolorcmyk 31 w(58)p Black Black
+1036 1699 2518 4 v 1036 3178 4 1480 v 1432 2924 a @beginspecial
+0 @llx 0 @lly 371 @urx 258 @ury 1440 @rhi @setspecial
+%%BeginDocument: pend.eps
+%!PS-Adobe-2.0 EPSF-2.0
+%%Title: pend.fig
+%%Creator: fig2dev Version 3.2 Patchlevel 4
+%%CreationDate: Sun May 22 21:42:13 2005
+%%For: epstein@linux (Becky Epstein)
+%%BoundingBox: 0 0 371 258
+%%Magnification: 1.0000
+%%EndComments
+/$F2psDict 200 dict def
+$F2psDict begin
+$F2psDict /mtrx matrix put
+/col-1 {0 setgray} bind def
+/col0 {0.000 0.000 0.000 srgb} bind def
+/col1 {0.000 0.000 1.000 srgb} bind def
+/col2 {0.000 1.000 0.000 srgb} bind def
+/col3 {0.000 1.000 1.000 srgb} bind def
+/col4 {1.000 0.000 0.000 srgb} bind def
+/col5 {1.000 0.000 1.000 srgb} bind def
+/col6 {1.000 1.000 0.000 srgb} bind def
+/col7 {1.000 1.000 1.000 srgb} bind def
+/col8 {0.000 0.000 0.560 srgb} bind def
+/col9 {0.000 0.000 0.690 srgb} bind def
+/col10 {0.000 0.000 0.820 srgb} bind def
+/col11 {0.530 0.810 1.000 srgb} bind def
+/col12 {0.000 0.560 0.000 srgb} bind def
+/col13 {0.000 0.690 0.000 srgb} bind def
+/col14 {0.000 0.820 0.000 srgb} bind def
+/col15 {0.000 0.560 0.560 srgb} bind def
+/col16 {0.000 0.690 0.690 srgb} bind def
+/col17 {0.000 0.820 0.820 srgb} bind def
+/col18 {0.560 0.000 0.000 srgb} bind def
+/col19 {0.690 0.000 0.000 srgb} bind def
+/col20 {0.820 0.000 0.000 srgb} bind def
+/col21 {0.560 0.000 0.560 srgb} bind def
+/col22 {0.690 0.000 0.690 srgb} bind def
+/col23 {0.820 0.000 0.820 srgb} bind def
+/col24 {0.500 0.190 0.000 srgb} bind def
+/col25 {0.630 0.250 0.000 srgb} bind def
+/col26 {0.750 0.380 0.000 srgb} bind def
+/col27 {1.000 0.500 0.500 srgb} bind def
+/col28 {1.000 0.630 0.630 srgb} bind def
+/col29 {1.000 0.750 0.750 srgb} bind def
+/col30 {1.000 0.880 0.880 srgb} bind def
+/col31 {1.000 0.840 0.000 srgb} bind def
+
+end
+save
+newpath 0 258 moveto 0 0 lineto 371 0 lineto 371 258 lineto closepath clip newpath
+-9.2 263.5 translate
+1 -1 scale
+
+/cp {closepath} bind def
+/ef {eofill} bind def
+/gr {grestore} bind def
+/gs {gsave} bind def
+/sa {save} bind def
+/rs {restore} bind def
+/l {lineto} bind def
+/m {moveto} bind def
+/rm {rmoveto} bind def
+/n {newpath} bind def
+/s {stroke} bind def
+/sh {show} bind def
+/slc {setlinecap} bind def
+/slj {setlinejoin} bind def
+/slw {setlinewidth} bind def
+/srgb {setrgbcolor} bind def
+/rot {rotate} bind def
+/sc {scale} bind def
+/sd {setdash} bind def
+/ff {findfont} bind def
+/sf {setfont} bind def
+/scf {scalefont} bind def
+/sw {stringwidth} bind def
+/tr {translate} bind def
+/tnt {dup dup currentrgbcolor
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb}
+ bind def
+/shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul
+ 4 -2 roll mul srgb} bind def
+ /DrawEllipse {
+ /endangle exch def
+ /startangle exch def
+ /yrad exch def
+ /xrad exch def
+ /y exch def
+ /x exch def
+ /savematrix mtrx currentmatrix def
+ x y tr xrad yrad sc 0 0 1 startangle endangle arc
+ closepath
+ savematrix setmatrix
+ } def
+
+/$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def
+/$F2psEnd {$F2psEnteredState restore end} def
+
+$F2psBegin
+10 setmiterlimit
+0 slj 0 slc
+ 0.06000 0.06000 sc
+%
+% Fig objects follow
+%
+%
+% here starts figure with depth 0
+% Arc
+7.500 slw
+gs clippath
+2592 2142 m 2544 2084 l 2403 2198 l 2544 2133 l 2451 2256 l cp
+eoclip
+n 2068.5 1649.8 680.1 103.9 44.1 arcn
+gs col-1 s gr
+ gr
+
+% arrowhead
+n 2451 2256 m 2544 2133 l 2403 2198 l 2451 2256 l cp gs 0.00 setgray ef gr col-1 s
+% Arc
+gs clippath
+4195 3222 m 4123 3199 l 4068 3371 l 4150 3240 l 4140 3394 l cp
+eoclip
+n 2866.1 2901.2 1328.9 63.9 14.1 arcn
+gs col-1 s gr
+ gr
+
+% arrowhead
+n 4140 3394 m 4150 3240 l 4068 3371 l 4140 3394 l cp gs 0.00 setgray ef gr col-1 s
+% Ellipse
+n 2925 2790 225 225 0 360 DrawEllipse gs 0.00 setgray ef gr gs col-1 s gr
+
+% Ellipse
+n 5445 3600 225 225 0 360 DrawEllipse gs 0.00 setgray ef gr gs col-1 s gr
+
+% Ellipse
+n 3645 2040 300 300 0 360 DrawEllipse gs col-1 s gr
+
+% Ellipse
+n 4530 1455 300 300 0 360 DrawEllipse gs col-1 s gr
+
+% Ellipse
+n 5360 2388 300 300 0 360 DrawEllipse gs col-1 s gr
+
+% Polyline
+30.000 slw
+n 1905 570 m
+ 2790 2625 l gs col-1 s gr
+% Polyline
+n 3090 2895 m
+ 5250 3540 l gs col-1 s gr
+% Polyline
+7.500 slw
+ [60] 0 sd
+n 1905 570 m
+ 1905 2475 l gs col-1 s gr [] 0 sd
+% Polyline
+gs clippath
+5368 3377 m 5463 3372 l 5448 3120 l 5414 3342 l 5354 3126 l cp
+eoclip
+n 5377 2692 m
+ 5415 3360 l gs col-1 s gr gr
+
+% arrowhead
+n 5354 3126 m 5414 3342 l 5448 3120 l 5404 3167 l 5354 3126 l
+ cp gs 0.00 setgray ef gr col-1 s
+% Polyline
+ [60] 0 sd
+n 2970 3030 m
+ 3555 4380 l gs col-1 s gr [] 0 sd
+% Polyline
+n 6315 570 m 165 570 l 165 120 l 6315 120 l
+ cp gs 0.50 setgray ef gr gs col0 s gr
+% Polyline
+gs clippath
+3030 2572 m 3097 2639 l 3276 2460 l 3088 2582 l 3209 2393 l cp
+eoclip
+n 3420 2250 m
+ 3075 2595 l gs col-1 s gr gr
+
+% arrowhead
+n 3209 2393 m 3088 2582 l 3276 2460 l 3211 2458 l 3209 2393 l
+ cp gs 0.00 setgray ef gr col-1 s
+% Polyline
+gs clippath
+4463 549 m 4369 560 l 4397 810 l 4420 588 l 4492 799 l cp
+eoclip
+n 4485 1155 m
+ 4418 570 l gs col-1 s gr gr
+
+% arrowhead
+n 4492 799 m 4420 588 l 4397 810 l 4439 761 l 4492 799 l
+ cp gs 0.00 setgray ef gr col-1 s
+/Times-Roman ff 270.00 scf sf
+2475 1650 m
+gs 1 -1 sc (L1) col-1 sh gr
+/Times-Roman ff 270.00 scf sf
+4440 1545 m
+gs 1 -1 sc (N) col-1 sh gr
+/Times-Roman ff 270.00 scf sf
+3525 2130 m
+gs 1 -1 sc (P1) col-1 sh gr
+/Times-Roman ff 270.00 scf sf
+2070 2054 m
+gs 1 -1 sc (q1) col-1 sh gr
+/Times-Roman ff 270.00 scf sf
+3457 3518 m
+gs 1 -1 sc (q2) col-1 sh gr
+/Times-Roman ff 270.00 scf sf
+4080 3060 m
+gs 1 -1 sc (L2) col-1 sh gr
+/Times-Roman ff 270.00 scf sf
+5227 2467 m
+gs 1 -1 sc (P2) col-1 sh gr
+% here ends figure;
+$F2psEnd
+rs
+showpage
+
+%%EndDocument
+ @endspecial 1249 3120 a(Figure)h(58:)p 0 TeXcolorgray
+Black 42 w(Bo)m(x)g(Around)e(Figure)i(Graphic)g(and)e(Caption)p
+3550 3178 V 1036 3181 2518 4 v Black 630 3377 a(It)37
+b(is)f(usually)g(a)h(trial-and-error)g(pro)s(cess)f(to)h(determine)g(a)
+g(minipage)g(width)e(whic)m(h)i(causes)630 3490 y(the)31
+b(b)s(o)m(x)g(to)h(ha)m(v)m(e)g(a)g(sn)m(ug)f(\014t)g(around)f(the)h
+(caption)h(and)f(graphic.)43 b(This)30 b(trial-and-error)i(can)630
+3602 y(b)s(e)e(a)m(v)m(oided)i(b)m(y)e(the)g(follo)m(wing)i(approac)m
+(hes.)p Black 741 3732 a(1.)p Black 46 w(Cho)s(ose)27
+b(an)g(arbitrary)g(minipage)g(width)g(and)f(force)i(the)f(graphic)g(to)
+h(b)s(e)e(as)i(wide)e(as)i(the)857 3832 y(minipage)p
+Black Black 1206 3965 a FN(\\includegraphics)o([wi)o(dt)o(h=)o(\\li)o
+(ne)o(wid)o(th)o(]{)o(pen)o(d})p Black 741 4099 a FQ(2.)p
+Black 46 w(When)38 b(it)g(is)g(desired)f(to)h(sp)s(ecify)g(the)g
+(graphic)g(heigh)m(t,)i(the)e(prop)s(er)e(minipage)j(width)857
+4199 y(can)30 b(b)s(e)f(calculated)j(b)m(y)e(placing)g(the)g(graphic)g
+(in)f(a)h(b)s(o)m(x)g(and)f(measuring)g(the)h(heigh)m(t)h(of)857
+4298 y(the)g(b)s(o)m(x.)p Black Black 1032 4432 a FN(\\newsavebox{\\my)
+o(box)o(})1032 4531 y(\\newlength{\\myl)o(eng)o(th)o(})1032
+4631 y(\\sbox{\\mybox}{\\)o(inc)o(lu)o(deg)o(ra)o(ph)o(ics)o([h)o(eig)o
+(ht)o(=3)o(in])o({f)o(ile)o(}})1032 4731 y(\\settowidth{\\my)o(len)o
+(gt)o(h}{)o(\\u)o(se)o(box)o({\\)o(myb)o(ox)o(}})1032
+4830 y(\\begin{figure})1162 4930 y(\\centering)1162 5030
+y(\\fbox{)41 b(\\begin{minipage}{)o(\\my)o(le)o(ngt)o(h})1380
+5129 y(\\centering)1380 5229 y(\\usebox{\\mybox})1380
+5328 y(\\caption{Box)e(Around)i(Figure)g(Graphic)g(and)h(Caption})1380
+5428 y(\\label{fig:boxed_)o(fi)o(gur)o(e})p Black 2227
+5640 a FQ(100)p Black eop end
+%%Page: 101 101
+TeXDict begin 101 100 bop Black 0 TeXcolorgray Black
+Black 1162 -149 a FN(\\end{minipage})38 b(})1032 -49
+y(\\end{figure})p Black 741 81 a FQ(3.)p Black 46 w(T)-8
+b(o)28 b(ensure)f(a)h(one-line)g(caption,)h(the)f(minipage)g(can)g(b)s
+(e)e(made)i(as)g(wide)f(as)g(the)h(caption)857 181 y(b)m(y)j
+(estimating)g(the)g(caption)g(width)f(with)g(a)h FM(\\settowidth)c
+FQ(command)p Black Black 944 311 a FN(\\newlength{\\mylen)o(gth)o(})944
+411 y(\\settowidth{\\myle)o(ngt)o(h})o({Fi)o(gu)o(re)37
+b(XX:)86 b(Box)42 b(Around)f(Figure)h(Graphic)e(and)j(Caption})944
+511 y(\\fbox{)f(\\begin{minipage)o(}{\\)o(my)o(le)o(ngt)o(h})944
+610 y(...)630 847 y FB(27.3)112 b(Customizing)39 b(fb)s(o)m(x)f(P)m
+(arameters)630 1006 y FQ(In)32 b(Figures)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 34 w(57)p Black 33 w(and)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 33 w(58)p Black(,)j(the)e(b)s(o)m(x)g(is)g(constructed)g
+(of)g(0.4)h(pt)f(thic)m(k)h(lines)f(with)g(a)g(3)h(pt)e(space)630
+1105 y(b)s(et)m(w)m(een)45 b(the)g(b)s(o)m(x)f(and)g(the)h(graphic.)84
+b(These)44 b(t)m(w)m(o)i(dimensions)e(can)h(b)s(e)f(customized)h(b)m(y)
+630 1205 y(setting)35 b(the)f(L)1116 1188 y FP(A)1155
+1205 y FQ(T)1206 1225 y(E)1256 1205 y(X)g(length)h(v)-5
+b(ariables)34 b FM(\\fboxrule)d FQ(and)j FM(\\fboxsep)p
+FQ(,)e(resp)s(ectiv)m(ely)-8 b(,)37 b(with)d(the)630
+1305 y FM(\\setlength)28 b FQ(command.)40 b(F)-8 b(or)31
+b(example,)h(the)e(commands)p Black Black 804 1429 a
+FN(\\begin{figure})935 1529 y(\\centering)935 1629 y
+(\\setlength{\\fbox)o(rul)o(e})o({3p)o(t})935 1728 y
+(\\setlength{\\fbox)o(sep)o(}{)o(1cm)o(})935 1828 y(\\fbox{\\includegr)
+o(aph)o(ic)o(s[t)o(ot)o(alh)o(ei)o(gh)o(t=2)o(in)o(]{p)o(en)o(d})o(})
+935 1928 y(\\caption{Graphic)37 b(with)42 b(Customized)d(Box})935
+2027 y(\\label{fig:boxed)o(_cu)o(st)o(om})804 2127 y(\\end{figure})630
+2265 y FQ(place)26 b(a)f(b)s(o)m(x)g(with)g(3)g(pt)g(thic)m(k)h(lines)f
+(whic)m(h)g(is)g(separated)g(from)f(the)i(graphic)f(b)m(y)f(1)i(cen)m
+(timeter,)630 2378 y(as)31 b(sho)m(wn)e(in)h(Figure)p
+0.05 1.00 1.00 0.40 TeXcolorcmyk 31 w(59)p Black Black
+1171 2514 2248 25 v 1171 4186 25 1673 v 1432 3950 a @beginspecial
+0 @llx 0 @lly 371 @urx 258 @ury 1440 @rhi @setspecial
+%%BeginDocument: pend.eps
+%!PS-Adobe-2.0 EPSF-2.0
+%%Title: pend.fig
+%%Creator: fig2dev Version 3.2 Patchlevel 4
+%%CreationDate: Sun May 22 21:42:13 2005
+%%For: epstein@linux (Becky Epstein)
+%%BoundingBox: 0 0 371 258
+%%Magnification: 1.0000
+%%EndComments
+/$F2psDict 200 dict def
+$F2psDict begin
+$F2psDict /mtrx matrix put
+/col-1 {0 setgray} bind def
+/col0 {0.000 0.000 0.000 srgb} bind def
+/col1 {0.000 0.000 1.000 srgb} bind def
+/col2 {0.000 1.000 0.000 srgb} bind def
+/col3 {0.000 1.000 1.000 srgb} bind def
+/col4 {1.000 0.000 0.000 srgb} bind def
+/col5 {1.000 0.000 1.000 srgb} bind def
+/col6 {1.000 1.000 0.000 srgb} bind def
+/col7 {1.000 1.000 1.000 srgb} bind def
+/col8 {0.000 0.000 0.560 srgb} bind def
+/col9 {0.000 0.000 0.690 srgb} bind def
+/col10 {0.000 0.000 0.820 srgb} bind def
+/col11 {0.530 0.810 1.000 srgb} bind def
+/col12 {0.000 0.560 0.000 srgb} bind def
+/col13 {0.000 0.690 0.000 srgb} bind def
+/col14 {0.000 0.820 0.000 srgb} bind def
+/col15 {0.000 0.560 0.560 srgb} bind def
+/col16 {0.000 0.690 0.690 srgb} bind def
+/col17 {0.000 0.820 0.820 srgb} bind def
+/col18 {0.560 0.000 0.000 srgb} bind def
+/col19 {0.690 0.000 0.000 srgb} bind def
+/col20 {0.820 0.000 0.000 srgb} bind def
+/col21 {0.560 0.000 0.560 srgb} bind def
+/col22 {0.690 0.000 0.690 srgb} bind def
+/col23 {0.820 0.000 0.820 srgb} bind def
+/col24 {0.500 0.190 0.000 srgb} bind def
+/col25 {0.630 0.250 0.000 srgb} bind def
+/col26 {0.750 0.380 0.000 srgb} bind def
+/col27 {1.000 0.500 0.500 srgb} bind def
+/col28 {1.000 0.630 0.630 srgb} bind def
+/col29 {1.000 0.750 0.750 srgb} bind def
+/col30 {1.000 0.880 0.880 srgb} bind def
+/col31 {1.000 0.840 0.000 srgb} bind def
+
+end
+save
+newpath 0 258 moveto 0 0 lineto 371 0 lineto 371 258 lineto closepath clip newpath
+-9.2 263.5 translate
+1 -1 scale
+
+/cp {closepath} bind def
+/ef {eofill} bind def
+/gr {grestore} bind def
+/gs {gsave} bind def
+/sa {save} bind def
+/rs {restore} bind def
+/l {lineto} bind def
+/m {moveto} bind def
+/rm {rmoveto} bind def
+/n {newpath} bind def
+/s {stroke} bind def
+/sh {show} bind def
+/slc {setlinecap} bind def
+/slj {setlinejoin} bind def
+/slw {setlinewidth} bind def
+/srgb {setrgbcolor} bind def
+/rot {rotate} bind def
+/sc {scale} bind def
+/sd {setdash} bind def
+/ff {findfont} bind def
+/sf {setfont} bind def
+/scf {scalefont} bind def
+/sw {stringwidth} bind def
+/tr {translate} bind def
+/tnt {dup dup currentrgbcolor
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb}
+ bind def
+/shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul
+ 4 -2 roll mul srgb} bind def
+ /DrawEllipse {
+ /endangle exch def
+ /startangle exch def
+ /yrad exch def
+ /xrad exch def
+ /y exch def
+ /x exch def
+ /savematrix mtrx currentmatrix def
+ x y tr xrad yrad sc 0 0 1 startangle endangle arc
+ closepath
+ savematrix setmatrix
+ } def
+
+/$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def
+/$F2psEnd {$F2psEnteredState restore end} def
+
+$F2psBegin
+10 setmiterlimit
+0 slj 0 slc
+ 0.06000 0.06000 sc
+%
+% Fig objects follow
+%
+%
+% here starts figure with depth 0
+% Arc
+7.500 slw
+gs clippath
+2592 2142 m 2544 2084 l 2403 2198 l 2544 2133 l 2451 2256 l cp
+eoclip
+n 2068.5 1649.8 680.1 103.9 44.1 arcn
+gs col-1 s gr
+ gr
+
+% arrowhead
+n 2451 2256 m 2544 2133 l 2403 2198 l 2451 2256 l cp gs 0.00 setgray ef gr col-1 s
+% Arc
+gs clippath
+4195 3222 m 4123 3199 l 4068 3371 l 4150 3240 l 4140 3394 l cp
+eoclip
+n 2866.1 2901.2 1328.9 63.9 14.1 arcn
+gs col-1 s gr
+ gr
+
+% arrowhead
+n 4140 3394 m 4150 3240 l 4068 3371 l 4140 3394 l cp gs 0.00 setgray ef gr col-1 s
+% Ellipse
+n 2925 2790 225 225 0 360 DrawEllipse gs 0.00 setgray ef gr gs col-1 s gr
+
+% Ellipse
+n 5445 3600 225 225 0 360 DrawEllipse gs 0.00 setgray ef gr gs col-1 s gr
+
+% Ellipse
+n 3645 2040 300 300 0 360 DrawEllipse gs col-1 s gr
+
+% Ellipse
+n 4530 1455 300 300 0 360 DrawEllipse gs col-1 s gr
+
+% Ellipse
+n 5360 2388 300 300 0 360 DrawEllipse gs col-1 s gr
+
+% Polyline
+30.000 slw
+n 1905 570 m
+ 2790 2625 l gs col-1 s gr
+% Polyline
+n 3090 2895 m
+ 5250 3540 l gs col-1 s gr
+% Polyline
+7.500 slw
+ [60] 0 sd
+n 1905 570 m
+ 1905 2475 l gs col-1 s gr [] 0 sd
+% Polyline
+gs clippath
+5368 3377 m 5463 3372 l 5448 3120 l 5414 3342 l 5354 3126 l cp
+eoclip
+n 5377 2692 m
+ 5415 3360 l gs col-1 s gr gr
+
+% arrowhead
+n 5354 3126 m 5414 3342 l 5448 3120 l 5404 3167 l 5354 3126 l
+ cp gs 0.00 setgray ef gr col-1 s
+% Polyline
+ [60] 0 sd
+n 2970 3030 m
+ 3555 4380 l gs col-1 s gr [] 0 sd
+% Polyline
+n 6315 570 m 165 570 l 165 120 l 6315 120 l
+ cp gs 0.50 setgray ef gr gs col0 s gr
+% Polyline
+gs clippath
+3030 2572 m 3097 2639 l 3276 2460 l 3088 2582 l 3209 2393 l cp
+eoclip
+n 3420 2250 m
+ 3075 2595 l gs col-1 s gr gr
+
+% arrowhead
+n 3209 2393 m 3088 2582 l 3276 2460 l 3211 2458 l 3209 2393 l
+ cp gs 0.00 setgray ef gr col-1 s
+% Polyline
+gs clippath
+4463 549 m 4369 560 l 4397 810 l 4420 588 l 4492 799 l cp
+eoclip
+n 4485 1155 m
+ 4418 570 l gs col-1 s gr gr
+
+% arrowhead
+n 4492 799 m 4420 588 l 4397 810 l 4439 761 l 4492 799 l
+ cp gs 0.00 setgray ef gr col-1 s
+/Times-Roman ff 270.00 scf sf
+2475 1650 m
+gs 1 -1 sc (L1) col-1 sh gr
+/Times-Roman ff 270.00 scf sf
+4440 1545 m
+gs 1 -1 sc (N) col-1 sh gr
+/Times-Roman ff 270.00 scf sf
+3525 2130 m
+gs 1 -1 sc (P1) col-1 sh gr
+/Times-Roman ff 270.00 scf sf
+2070 2054 m
+gs 1 -1 sc (q1) col-1 sh gr
+/Times-Roman ff 270.00 scf sf
+3457 3518 m
+gs 1 -1 sc (q2) col-1 sh gr
+/Times-Roman ff 270.00 scf sf
+4080 3060 m
+gs 1 -1 sc (L2) col-1 sh gr
+/Times-Roman ff 270.00 scf sf
+5227 2467 m
+gs 1 -1 sc (P2) col-1 sh gr
+% here ends figure;
+$F2psEnd
+rs
+showpage
+
+%%EndDocument
+ @endspecial 3394 4186 V 1171 4211 2248 25 v 1470 4381
+a(Figure)h(59:)p 0 TeXcolorgray Black 41 w(Graphic)f(with)h(Customized)
+f(Bo)m(x)p Black 630 4731 a FB(27.4)112 b(The)38 b(F)-9
+b(ancyb)s(o)m(x)39 b(P)m(ac)m(k)-6 b(age)630 4903 y FQ(In)42
+b(Figures)p 0.05 1.00 1.00 0.40 TeXcolorcmyk 44 w(57)p
+Black(,)p 0.05 1.00 1.00 0.40 TeXcolorcmyk 47 w(58)p
+Black(,)47 b(and)p 0.05 1.00 1.00 0.40 TeXcolorcmyk
+42 w(59)p Black(,)h(the)43 b FM(\\fbox)e FQ(command)i(w)m(as)g(used)g
+(to)g(place)h(standard)e(rec-)630 5016 y(tangular)37
+b(b)s(o)m(xes)f(around)f(the)h(\014gures.)57 b(The)35
+b FO(fancyb)s(o)m(x)h FQ(pac)m(k)-5 b(age)38 b(pro)m(vides)e(four)f
+(commands)630 5129 y FM(\\shadowbox)p FQ(,)j FM(\\doublebox)p
+FQ(,)g FM(\\ovalbox)p FQ(,)h(and)f FM(\\Ovalbox)e FQ(whic)m(h)j(pro)s
+(duce)e(other)i(t)m(yp)s(es)g(of)630 5241 y(b)s(o)m(xes)31
+b(as)f(sho)m(wn)g(in)g(T)-8 b(able)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 31 w(21)p Black(.)771 5341 y(Lik)m(e)34
+b FM(\\fbox)p FQ(,)e(the)i(separation)f(b)s(et)m(w)m(een)h(these)f(b)s
+(o)m(xes)g(and)g(their)g(con)m(ten)m(ts)h(is)f(con)m(trolled)630
+5441 y(b)m(y)27 b(the)h(L)931 5424 y FP(A)970 5441 y
+FQ(T)1021 5460 y(E)1071 5441 y(X)f(length)h FM(\\fboxsep)p
+FQ(.)37 b(The)27 b(length)h FM(\\shadowsize)c FQ(is)j(set)h(with)f(the)
+h FM(\\setlength)p Black 2227 5640 a FQ(101)p Black eop
+end
+%%Page: 102 102
+TeXDict begin 102 101 bop Black 0 TeXcolorgray Black
+Black Black 1515 -159 a FB(T)-9 b(able)38 b(21:)p 0 TeXcolorgray
+Black 50 w(F)-9 b(ancyBo)m(x)37 b(Commands)p Black Black
+-120 -29 4081 4 v -120 84 4 113 v -17 50 a FL(Command)p
+983 84 V 634 w(P)m(arameters)p 3957 84 V -120 87 4081
+4 v -120 675 4 588 v Black -17 262 a FM(\\shadowbox{Example})p
+Black 133 335 567 4 v 133 491 4 157 v 161 443 a FD(Example)p
+696 491 V 133 494 567 4 v 698 528 35 163 v 166 528 567
+35 v 983 675 4 588 v 1086 328 a FK(\210)30 b FQ(The)g(frame)g(thic)m
+(kness)h(is)g FM(\\fboxrule)p FQ(.)1086 441 y FK(\210)f
+FQ(The)g(shado)m(w)g(thic)m(kness)h(is)f FM(\\shadowsize)e
+FQ(\(whic)m(h)i(defaults)h(to)g(4)f(pt\).)p 3957 675
+V -120 678 4081 4 v -120 1258 4 581 v Black -17 853 a
+FM(\\doublebox{Example})p Black 136 952 594 5 v 136 1132
+5 180 v 150 964 565 3 v 150 1120 3 157 v 178 1072 a FD(Example)p
+713 1120 V 150 1122 565 3 v 725 1132 5 180 v 136 1137
+594 5 v 983 1258 4 581 v 1086 877 a FK(\210)g FQ(The)g(inner)f(frame)i
+(thic)m(kness)g(is)f(.75)p FM(\\fboxrule)1086 990 y FK(\210)g
+FQ(The)g(outer)h(frame)f(thic)m(kness)h(is)f(1.5)p FM(\\fboxrule)1086
+1103 y FK(\210)g FQ(The)g(spacing)h(b)s(et)m(w)m(een)g(the)f(frames)g
+(is)h(1.5)p FM(\\fboxrule)e FQ(+)h(0.5pt.)p 3957 1258
+V -120 1261 4081 4 v -120 2059 4 799 v Black 27 1477
+a FM(\\ovalbox{Example})p Black 150 1576 a Fb(\007)p
+150 1700 4 93 v 150 1735 a(\006)713 1576 y(\004)p 713
+1700 V 713 1735 a(\005)p 185 1735 497 4 v 185 1576 V
+178 1684 a FD(Example)p 983 2059 4 799 v 1086 1461 a
+FK(\210)g FQ(The)g(frame)g(thic)m(kness)h(is)g FM(\\thinlines)1086
+1574 y FK(\210)f FQ(En)m(tering)i FM(\\cornersize{x})26
+b FQ(the)31 b(diameter)g(of)g(the)f(corners)g FM(x)g
+FQ(times)h(the)1086 1687 y(minim)m(um)e(of)i(the)f(width)g(and)g(the)g
+(heigh)m(t.)42 b(The)30 b(default)g(is)h(0.5.)1086 1800
+y FK(\210)f FQ(The)g FM(\\cornersize*)d FQ(command)j(directly)h(sets)g
+(the)f(corner)h(diameter.)41 b(F)-8 b(or)1086 1912 y(example,)31
+b FM(\\cornersize*{1cm})25 b FQ(mak)m(es)32 b(the)e(corner)h(diameters)
+f(1)h(cm.)p 3957 2059 V -120 2063 4081 4 v -120 2606
+4 544 v Black 27 2237 a FM(\\Ovalbox{Example})p Black
+146 2322 a Fa(\007)p 146 2448 7 97 v 146 2485 a(\006)713
+2322 y(\004)p 713 2448 V 713 2485 a(\005)p 184 2485 501
+7 v 184 2322 V 178 2430 a FD(Example)p 983 2606 4 544
+v 1086 2304 a FM(\\Ovalbox)d FQ(is)i(the)h(same)f(as)h
+FM(\\ovalbox)d FQ(except)j(that)g(the)g(line)g(thic)m(kness)g(is)1086
+2417 y(con)m(trolled)g(b)m(y)h FM(\\thicklines)p FQ(.)p
+3957 2606 V -120 2609 4081 4 v Black 630 2892 a(command,)38
+b(as)f(w)m(as)g(done)g(for)f FM(\\fboxrule)e FQ(and)i
+FM(\\fboxsep)f FQ(in)h(Section)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 37 w(27.3)p Black 38 w(on)h(page)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 37 w(101)p Black(.)630 2991 y(The)29 b(lines)h(for)f
+FM(\\ovalbox)e FQ(and)i FM(\\Ovalbox)e FQ(ha)m(v)m(e)k(thic)m(knesses)f
+(corresp)s(onding)e(to)i(the)g(picture)630 3091 y(en)m(vironmen)m(t's)
+36 b FM(\\thicklines)31 b FQ(and)j FM(\\thinlines)p FQ(,)g(whic)m(h)g
+(are)i Fy(not)44 b FQ(lengths)35 b(and)f(th)m(us)g(can-)630
+3191 y(not)39 b(b)s(e)e(c)m(hanged)i(with)f(the)h FM(\\setlength)c
+FQ(command.)64 b(The)38 b(v)-5 b(alues)39 b(of)45 b FM(\\thicklines)36
+b FQ(and)630 3290 y FM(\\thinlines)h FQ(dep)s(end)h(on)i(the)g(size)h
+(and)e(st)m(yle)j(of)e(the)g(curren)m(t)g(fon)m(t.)69
+b(T)m(ypical)41 b(v)-5 b(alues)41 b(are)630 3390 y(0.8)31
+b(pt)g(for)f FM(\\thicklines)d FQ(and)j(0.4)h(pt)f(for)h
+FM(\\thinlines)p FQ(.)38 b(F)-8 b(or)31 b(example,)g(the)g(commands)p
+Black Black 804 3531 a FN(\\begin{figure})979 3631 y(\\centering)979
+3730 y(\\shadowbox{)39 b(\\begin{minipage})o({3)o(.5)e(in})1153
+3830 y(\\centering)1153 3930 y(\\includegraphics)o([to)o(ta)o(lhe)o(ig)
+o(ht)o(=2i)o(n])o({pe)o(nd)o(})1153 4029 y(\\caption{Shadowb)o(ox)g
+(Around)k(Entire)g(Figure})1153 4129 y(\\label{fig:boxed)o(_fa)o(nc)o
+(y})979 4228 y(\\end{minipage})c(})804 4328 y(\\end{figure})630
+4482 y FQ(place)29 b(a)f(shado)m(w)f(b)s(o)m(x)h(around)e(the)i
+(\014gure's)g(graphic)f(and)g(caption,)j(as)e(sho)m(wn)f(in)g(Figure)p
+0.05 1.00 1.00 0.40 TeXcolorcmyk 28 w(60)p Black(.)p
+Black 2227 5640 a(102)p Black eop end
+%%Page: 103 103
+TeXDict begin 103 102 bop Black 0 TeXcolorgray Black
+Black Black 1170 1844 2218 4 v 1170 3324 4 1480 v 1416
+3069 a @beginspecial 0 @llx 0 @lly 371 @urx 258 @ury
+1440 @rhi @setspecial
+%%BeginDocument: pend.eps
+%!PS-Adobe-2.0 EPSF-2.0
+%%Title: pend.fig
+%%Creator: fig2dev Version 3.2 Patchlevel 4
+%%CreationDate: Sun May 22 21:42:13 2005
+%%For: epstein@linux (Becky Epstein)
+%%BoundingBox: 0 0 371 258
+%%Magnification: 1.0000
+%%EndComments
+/$F2psDict 200 dict def
+$F2psDict begin
+$F2psDict /mtrx matrix put
+/col-1 {0 setgray} bind def
+/col0 {0.000 0.000 0.000 srgb} bind def
+/col1 {0.000 0.000 1.000 srgb} bind def
+/col2 {0.000 1.000 0.000 srgb} bind def
+/col3 {0.000 1.000 1.000 srgb} bind def
+/col4 {1.000 0.000 0.000 srgb} bind def
+/col5 {1.000 0.000 1.000 srgb} bind def
+/col6 {1.000 1.000 0.000 srgb} bind def
+/col7 {1.000 1.000 1.000 srgb} bind def
+/col8 {0.000 0.000 0.560 srgb} bind def
+/col9 {0.000 0.000 0.690 srgb} bind def
+/col10 {0.000 0.000 0.820 srgb} bind def
+/col11 {0.530 0.810 1.000 srgb} bind def
+/col12 {0.000 0.560 0.000 srgb} bind def
+/col13 {0.000 0.690 0.000 srgb} bind def
+/col14 {0.000 0.820 0.000 srgb} bind def
+/col15 {0.000 0.560 0.560 srgb} bind def
+/col16 {0.000 0.690 0.690 srgb} bind def
+/col17 {0.000 0.820 0.820 srgb} bind def
+/col18 {0.560 0.000 0.000 srgb} bind def
+/col19 {0.690 0.000 0.000 srgb} bind def
+/col20 {0.820 0.000 0.000 srgb} bind def
+/col21 {0.560 0.000 0.560 srgb} bind def
+/col22 {0.690 0.000 0.690 srgb} bind def
+/col23 {0.820 0.000 0.820 srgb} bind def
+/col24 {0.500 0.190 0.000 srgb} bind def
+/col25 {0.630 0.250 0.000 srgb} bind def
+/col26 {0.750 0.380 0.000 srgb} bind def
+/col27 {1.000 0.500 0.500 srgb} bind def
+/col28 {1.000 0.630 0.630 srgb} bind def
+/col29 {1.000 0.750 0.750 srgb} bind def
+/col30 {1.000 0.880 0.880 srgb} bind def
+/col31 {1.000 0.840 0.000 srgb} bind def
+
+end
+save
+newpath 0 258 moveto 0 0 lineto 371 0 lineto 371 258 lineto closepath clip newpath
+-9.2 263.5 translate
+1 -1 scale
+
+/cp {closepath} bind def
+/ef {eofill} bind def
+/gr {grestore} bind def
+/gs {gsave} bind def
+/sa {save} bind def
+/rs {restore} bind def
+/l {lineto} bind def
+/m {moveto} bind def
+/rm {rmoveto} bind def
+/n {newpath} bind def
+/s {stroke} bind def
+/sh {show} bind def
+/slc {setlinecap} bind def
+/slj {setlinejoin} bind def
+/slw {setlinewidth} bind def
+/srgb {setrgbcolor} bind def
+/rot {rotate} bind def
+/sc {scale} bind def
+/sd {setdash} bind def
+/ff {findfont} bind def
+/sf {setfont} bind def
+/scf {scalefont} bind def
+/sw {stringwidth} bind def
+/tr {translate} bind def
+/tnt {dup dup currentrgbcolor
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb}
+ bind def
+/shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul
+ 4 -2 roll mul srgb} bind def
+ /DrawEllipse {
+ /endangle exch def
+ /startangle exch def
+ /yrad exch def
+ /xrad exch def
+ /y exch def
+ /x exch def
+ /savematrix mtrx currentmatrix def
+ x y tr xrad yrad sc 0 0 1 startangle endangle arc
+ closepath
+ savematrix setmatrix
+ } def
+
+/$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def
+/$F2psEnd {$F2psEnteredState restore end} def
+
+$F2psBegin
+10 setmiterlimit
+0 slj 0 slc
+ 0.06000 0.06000 sc
+%
+% Fig objects follow
+%
+%
+% here starts figure with depth 0
+% Arc
+7.500 slw
+gs clippath
+2592 2142 m 2544 2084 l 2403 2198 l 2544 2133 l 2451 2256 l cp
+eoclip
+n 2068.5 1649.8 680.1 103.9 44.1 arcn
+gs col-1 s gr
+ gr
+
+% arrowhead
+n 2451 2256 m 2544 2133 l 2403 2198 l 2451 2256 l cp gs 0.00 setgray ef gr col-1 s
+% Arc
+gs clippath
+4195 3222 m 4123 3199 l 4068 3371 l 4150 3240 l 4140 3394 l cp
+eoclip
+n 2866.1 2901.2 1328.9 63.9 14.1 arcn
+gs col-1 s gr
+ gr
+
+% arrowhead
+n 4140 3394 m 4150 3240 l 4068 3371 l 4140 3394 l cp gs 0.00 setgray ef gr col-1 s
+% Ellipse
+n 2925 2790 225 225 0 360 DrawEllipse gs 0.00 setgray ef gr gs col-1 s gr
+
+% Ellipse
+n 5445 3600 225 225 0 360 DrawEllipse gs 0.00 setgray ef gr gs col-1 s gr
+
+% Ellipse
+n 3645 2040 300 300 0 360 DrawEllipse gs col-1 s gr
+
+% Ellipse
+n 4530 1455 300 300 0 360 DrawEllipse gs col-1 s gr
+
+% Ellipse
+n 5360 2388 300 300 0 360 DrawEllipse gs col-1 s gr
+
+% Polyline
+30.000 slw
+n 1905 570 m
+ 2790 2625 l gs col-1 s gr
+% Polyline
+n 3090 2895 m
+ 5250 3540 l gs col-1 s gr
+% Polyline
+7.500 slw
+ [60] 0 sd
+n 1905 570 m
+ 1905 2475 l gs col-1 s gr [] 0 sd
+% Polyline
+gs clippath
+5368 3377 m 5463 3372 l 5448 3120 l 5414 3342 l 5354 3126 l cp
+eoclip
+n 5377 2692 m
+ 5415 3360 l gs col-1 s gr gr
+
+% arrowhead
+n 5354 3126 m 5414 3342 l 5448 3120 l 5404 3167 l 5354 3126 l
+ cp gs 0.00 setgray ef gr col-1 s
+% Polyline
+ [60] 0 sd
+n 2970 3030 m
+ 3555 4380 l gs col-1 s gr [] 0 sd
+% Polyline
+n 6315 570 m 165 570 l 165 120 l 6315 120 l
+ cp gs 0.50 setgray ef gr gs col0 s gr
+% Polyline
+gs clippath
+3030 2572 m 3097 2639 l 3276 2460 l 3088 2582 l 3209 2393 l cp
+eoclip
+n 3420 2250 m
+ 3075 2595 l gs col-1 s gr gr
+
+% arrowhead
+n 3209 2393 m 3088 2582 l 3276 2460 l 3211 2458 l 3209 2393 l
+ cp gs 0.00 setgray ef gr col-1 s
+% Polyline
+gs clippath
+4463 549 m 4369 560 l 4397 810 l 4420 588 l 4492 799 l cp
+eoclip
+n 4485 1155 m
+ 4418 570 l gs col-1 s gr gr
+
+% arrowhead
+n 4492 799 m 4420 588 l 4397 810 l 4439 761 l 4492 799 l
+ cp gs 0.00 setgray ef gr col-1 s
+/Times-Roman ff 270.00 scf sf
+2475 1650 m
+gs 1 -1 sc (L1) col-1 sh gr
+/Times-Roman ff 270.00 scf sf
+4440 1545 m
+gs 1 -1 sc (N) col-1 sh gr
+/Times-Roman ff 270.00 scf sf
+3525 2130 m
+gs 1 -1 sc (P1) col-1 sh gr
+/Times-Roman ff 270.00 scf sf
+2070 2054 m
+gs 1 -1 sc (q1) col-1 sh gr
+/Times-Roman ff 270.00 scf sf
+3457 3518 m
+gs 1 -1 sc (q2) col-1 sh gr
+/Times-Roman ff 270.00 scf sf
+4080 3060 m
+gs 1 -1 sc (L2) col-1 sh gr
+/Times-Roman ff 270.00 scf sf
+5227 2467 m
+gs 1 -1 sc (P2) col-1 sh gr
+% here ends figure;
+$F2psEnd
+rs
+showpage
+
+%%EndDocument
+ @endspecial 1385 3265 a FQ(Figure)30 b(60:)p 0 TeXcolorgray
+Black 42 w(Shado)m(wb)s(o)m(x)g(Around)f(En)m(tire)i(Figure)p
+3384 3324 V 1170 3327 2218 4 v 3385 3360 35 1487 v 1203
+3360 2218 35 v Black Black 2227 5640 a(103)p Black eop
+end
+%%Page: 104 104
+TeXDict begin 104 103 bop Black 0 TeXcolorgray Black
+Black 630 -149 a FD(P)l(art)46 b(V)630 59 y FA(Complex)65
+b(Figures)630 326 y FD(28)135 b(Side-b)l(y-Side)45 b(Graphics)630
+529 y FQ(The)38 b(commands)h(necessary)g(for)f(side-b)m(y-side)i
+(graphics)f(dep)s(end)e(on)h(ho)m(w)h(the)g(user)f(w)m(an)m(ts)630
+642 y(the)32 b(graphics)f(organized.)45 b(This)30 b(section)j(co)m(v)m
+(ers)g(three)e(common)h(groupings)f(of)g(side-b)m(y-side)630
+755 y(graphics)p Black 741 897 a(1.)p Black 46 w(The)f(side-b)m(y-side)
+h(graphics)f(are)h(com)m(bined)g(in)m(to)g(a)g(single)g(\014gure.)p
+Black 741 1048 a(2.)p Black 46 w(The)g(side-b)m(y-side)h(graphics)g
+(eac)m(h)h(form)e(their)g(o)m(wn)h(\014gure)f(\(e.g.,)i(Figure)p
+0.05 1.00 1.00 0.40 TeXcolorcmyk 32 w(63)p Black 33
+w(and)e(Fig-)857 1160 y(ure)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 30 w(64)p Black(\).)p Black 741 1311 a(3.)p
+Black 46 w(The)h(side-b)m(y-side)h(graphics)g(eac)m(h)g(form)f(a)h
+(sub\014gure)e(\(e.g.,)k(Sub\014gure)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 30 w(65a)p Black 34 w(and)d(Sub-)857 1424
+y(\014gure)p 0.05 1.00 1.00 0.40 TeXcolorcmyk 30 w(65b)p
+Black(\))f(whic)m(h)f(are)h(part)f(of)h(a)g(single)g(\014gure)e
+(\(Figure)p 0.05 1.00 1.00 0.40 TeXcolorcmyk 32 w(65)p
+Black(\).)630 1566 y(This)g(section)h(describ)s(es)f(the)h(follo)m
+(wing)h(t)m(w)m(o)g(metho)s(ds)d(for)i(constructing)g(the)g(three)f(t)m
+(yp)s(es)h(of)630 1679 y(groupings)p Black 731 1822 a(a\))p
+Black 46 w(Successiv)m(e)i FM(\\includegraphics)26 b
+FQ(commands.)p Black 726 1972 a(b\))p Black 45 w(Side-b)m(y-side)44
+b(minipages,)k(eac)m(h)d(of)f(whic)m(h)f(con)m(tains)i(an)f
+FM(\\includegraphics)39 b FQ(com-)857 2085 y(mand.)630
+2228 y(It)33 b(is)h(v)m(ery)g(imp)s(ortan)m(t)f(to)h(understand)e(the)h
+(material)i(in)e(Section)p 0.05 1.00 1.00 0.40 TeXcolorcmyk
+35 w(2)p Black 33 w(on)h(page)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 34 w(10)p Black 34 w(when)e(con-)630 2341
+y(structing)21 b(side-b)m(y-side)h(\014gures.)37 b(Side-b)m(y-side)21
+b(\014gures)f(are)i(created)g(b)m(y)f(placing)h(b)s(o)m(xes)f(\(either)
+630 2454 y FM(\\includegraphics)26 b FQ(or)k(minipages\))h(b)s(eside)f
+(eac)m(h)i(other)e(on)h(a)f(line.)630 2697 y FB(28.1)112
+b(Side-b)m(y-Side)40 b(Graphics)f(in)e(a)h(Single)h(Figure)630
+2869 y FQ(The)31 b(easiest)i(metho)s(d)f(for)f(creating)i(side-b)m
+(y-side)f(graphics)g(in)f(a)h(single)h(\014gure)e(is)h(successiv)m(e)
+630 2982 y FM(\\includegraphics)18 b FQ(commands,)25
+b(although)e(using)f(side-b)m(y-side)i(minipages)f(mak)m(es)h(it)f
+(easier)630 3095 y(to)31 b(v)m(ertically)i(align)e(the)g(graphics.)630
+3335 y FL(28.1.1)106 b(Using)36 b(Side-b)m(y-Side)f(includegraphics)h
+(Commands)630 3493 y FQ(The)30 b(follo)m(wing)i(co)s(de)p
+Black Black 935 3634 a FN(\\begin{figure})1066 3734 y(\\centering)1066
+3834 y(\\includegraphics)o([w)o(idt)o(h=)o(1in)o(]{)o(gr)o(aph)o(ic)o
+(}\045)1066 3933 y(\\hspace{1in}\045)1066 4033 y(\\includegraphics)o
+([w)o(idt)o(h=)o(2in)o(]{)o(gr)o(aph)o(ic)o(})1066 4133
+y(\\caption{Two)38 b(Graphics)j(in)i(One)f(Figure})935
+4232 y(\\end{figure})630 4387 y FQ(pro)s(duces)36 b(Figure)p
+0.05 1.00 1.00 0.40 TeXcolorcmyk 38 w(61)p Black 38
+w(whic)m(h)h(is)g(4)h(inc)m(hes)g(wide)f(\(1)h(inc)m(h)f(for)g(the)h
+(\014rst)f(graphic,)i(1)f(inc)m(h)f(for)630 4500 y(the)h
+FM(\\hspace)p FQ(,)h(and)e(2)h(inc)m(hes)h(for)f(the)g(second)g
+(graphic\))h(whic)m(h)f(is)g(cen)m(tered)h(on)f(the)g(page.)630
+4612 y(The)33 b FM(\\hspace)e FQ(command)i(can)h(b)s(e)f(omitted)h(or)f
+(replaced)h(with)f FM(\\hfill)p FQ(,)g(whic)m(h)g(pushes)f(the)630
+4725 y(graphics)e(to)h(the)g(margins)f(\(see)i(Section)p
+0.05 1.00 1.00 0.40 TeXcolorcmyk 31 w(10.2)p Black
+32 w(on)e(page)p 0.05 1.00 1.00 0.40 TeXcolorcmyk
+31 w(32)p Black(\).)630 4965 y FL(28.1.2)106 b(Using)36
+b(Side-b)m(y-Side)f(Minipages)630 5124 y FQ(Placing)j(the)f
+FM(\\includegraphics)c FQ(commands)k(inside)g FM(minipage)d
+FQ(en)m(vironmen)m(ts)k(pro)m(vides)630 5223 y(the)31
+b(user)e(more)i(con)m(trol)h(o)m(v)m(er)f(the)g(graphics')f(v)m
+(ertical)j(placemen)m(t.)42 b(F)-8 b(or)31 b(example)p
+Black 2227 5640 a(104)p Black eop end
+%%Page: 105 105
+TeXDict begin 105 104 bop Black 0 TeXcolorgray Black
+Black Black 1065 210 a @beginspecial 0 @llx 0 @lly 144
+@urx 54 @ury 720 @rwi @setspecial
+%%BeginDocument: graphic.eps
+%!PS-Adobe-2.0 EPSF-2.0
+%%Title: graphic.eps
+%%Creator: fig2dev Version 3.2 Patchlevel 0-beta2
+%%CreationDate: Thu Dec 11 20:58:11 1997
+%%For: Keith Reckdahl
+%%Orientation: Portrait
+%%BoundingBox: 0 0 144 54
+%%Pages: 0
+%%BeginSetup
+%%IncludeFeature: *PageSize Letter
+%%EndSetup
+%%Magnification: 1.00
+%%EndComments
+/$F2psDict 200 dict def
+$F2psDict begin
+$F2psDict /mtrx matrix put
+/col-1 {0 setgray} bind def
+/col0 {0.000 0.000 0.000 srgb} bind def
+/col1 {0.000 0.000 1.000 srgb} bind def
+/col2 {0.000 1.000 0.000 srgb} bind def
+/col3 {0.000 1.000 1.000 srgb} bind def
+/col4 {1.000 0.000 0.000 srgb} bind def
+/col5 {1.000 0.000 1.000 srgb} bind def
+/col6 {1.000 1.000 0.000 srgb} bind def
+/col7 {1.000 1.000 1.000 srgb} bind def
+/col8 {0.000 0.000 0.560 srgb} bind def
+/col9 {0.000 0.000 0.690 srgb} bind def
+/col10 {0.000 0.000 0.820 srgb} bind def
+/col11 {0.530 0.810 1.000 srgb} bind def
+/col12 {0.000 0.560 0.000 srgb} bind def
+/col13 {0.000 0.690 0.000 srgb} bind def
+/col14 {0.000 0.820 0.000 srgb} bind def
+/col15 {0.000 0.560 0.560 srgb} bind def
+/col16 {0.000 0.690 0.690 srgb} bind def
+/col17 {0.000 0.820 0.820 srgb} bind def
+/col18 {0.560 0.000 0.000 srgb} bind def
+/col19 {0.690 0.000 0.000 srgb} bind def
+/col20 {0.820 0.000 0.000 srgb} bind def
+/col21 {0.560 0.000 0.560 srgb} bind def
+/col22 {0.690 0.000 0.690 srgb} bind def
+/col23 {0.820 0.000 0.820 srgb} bind def
+/col24 {0.500 0.190 0.000 srgb} bind def
+/col25 {0.630 0.250 0.000 srgb} bind def
+/col26 {0.750 0.380 0.000 srgb} bind def
+/col27 {1.000 0.500 0.500 srgb} bind def
+/col28 {1.000 0.630 0.630 srgb} bind def
+/col29 {1.000 0.750 0.750 srgb} bind def
+/col30 {1.000 0.880 0.880 srgb} bind def
+/col31 {1.000 0.840 0.000 srgb} bind def
+
+end
+save
+-2.0 61.0 translate
+1 -1 scale
+
+/cp {closepath} bind def
+/ef {eofill} bind def
+/gr {grestore} bind def
+/gs {gsave} bind def
+/sa {save} bind def
+/rs {restore} bind def
+/l {lineto} bind def
+/m {moveto} bind def
+/rm {rmoveto} bind def
+/n {newpath} bind def
+/s {stroke} bind def
+/sh {show} bind def
+/slc {setlinecap} bind def
+/slj {setlinejoin} bind def
+/slw {setlinewidth} bind def
+/srgb {setrgbcolor} bind def
+/rot {rotate} bind def
+/sc {scale} bind def
+/sd {setdash} bind def
+/ff {findfont} bind def
+/sf {setfont} bind def
+/scf {scalefont} bind def
+/sw {stringwidth} bind def
+/tr {translate} bind def
+/tnt {dup dup currentrgbcolor
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb}
+ bind def
+/shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul
+ 4 -2 roll mul srgb} bind def
+/$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def
+/$F2psEnd {$F2psEnteredState restore end} def
+%%EndProlog
+
+$F2psBegin
+10 setmiterlimit
+n 0 1048 m 0 0 l 2473 0 l 2473 1048 l cp clip
+ 0.06000 0.06000 sc
+% Polyline
+30.000 slw
+n 2400 975 m 75 975 l 75 150 l 2400 150 l cp gs col-1 s gr
+/Times-Bold ff 360.00 scf sf
+1220 705 m
+gs 1 -1 sc (Graphic) dup sw pop 2 div neg 0 rm col-1 sh gr
+$F2psEnd
+rs
+
+%%EndDocument
+ @endspecial 1260 w @beginspecial 0 @llx 0 @lly 144 @urx
+54 @ury 1440 @rwi @setspecial
+%%BeginDocument: graphic.eps
+%!PS-Adobe-2.0 EPSF-2.0
+%%Title: graphic.eps
+%%Creator: fig2dev Version 3.2 Patchlevel 0-beta2
+%%CreationDate: Thu Dec 11 20:58:11 1997
+%%For: Keith Reckdahl
+%%Orientation: Portrait
+%%BoundingBox: 0 0 144 54
+%%Pages: 0
+%%BeginSetup
+%%IncludeFeature: *PageSize Letter
+%%EndSetup
+%%Magnification: 1.00
+%%EndComments
+/$F2psDict 200 dict def
+$F2psDict begin
+$F2psDict /mtrx matrix put
+/col-1 {0 setgray} bind def
+/col0 {0.000 0.000 0.000 srgb} bind def
+/col1 {0.000 0.000 1.000 srgb} bind def
+/col2 {0.000 1.000 0.000 srgb} bind def
+/col3 {0.000 1.000 1.000 srgb} bind def
+/col4 {1.000 0.000 0.000 srgb} bind def
+/col5 {1.000 0.000 1.000 srgb} bind def
+/col6 {1.000 1.000 0.000 srgb} bind def
+/col7 {1.000 1.000 1.000 srgb} bind def
+/col8 {0.000 0.000 0.560 srgb} bind def
+/col9 {0.000 0.000 0.690 srgb} bind def
+/col10 {0.000 0.000 0.820 srgb} bind def
+/col11 {0.530 0.810 1.000 srgb} bind def
+/col12 {0.000 0.560 0.000 srgb} bind def
+/col13 {0.000 0.690 0.000 srgb} bind def
+/col14 {0.000 0.820 0.000 srgb} bind def
+/col15 {0.000 0.560 0.560 srgb} bind def
+/col16 {0.000 0.690 0.690 srgb} bind def
+/col17 {0.000 0.820 0.820 srgb} bind def
+/col18 {0.560 0.000 0.000 srgb} bind def
+/col19 {0.690 0.000 0.000 srgb} bind def
+/col20 {0.820 0.000 0.000 srgb} bind def
+/col21 {0.560 0.000 0.560 srgb} bind def
+/col22 {0.690 0.000 0.690 srgb} bind def
+/col23 {0.820 0.000 0.820 srgb} bind def
+/col24 {0.500 0.190 0.000 srgb} bind def
+/col25 {0.630 0.250 0.000 srgb} bind def
+/col26 {0.750 0.380 0.000 srgb} bind def
+/col27 {1.000 0.500 0.500 srgb} bind def
+/col28 {1.000 0.630 0.630 srgb} bind def
+/col29 {1.000 0.750 0.750 srgb} bind def
+/col30 {1.000 0.880 0.880 srgb} bind def
+/col31 {1.000 0.840 0.000 srgb} bind def
+
+end
+save
+-2.0 61.0 translate
+1 -1 scale
+
+/cp {closepath} bind def
+/ef {eofill} bind def
+/gr {grestore} bind def
+/gs {gsave} bind def
+/sa {save} bind def
+/rs {restore} bind def
+/l {lineto} bind def
+/m {moveto} bind def
+/rm {rmoveto} bind def
+/n {newpath} bind def
+/s {stroke} bind def
+/sh {show} bind def
+/slc {setlinecap} bind def
+/slj {setlinejoin} bind def
+/slw {setlinewidth} bind def
+/srgb {setrgbcolor} bind def
+/rot {rotate} bind def
+/sc {scale} bind def
+/sd {setdash} bind def
+/ff {findfont} bind def
+/sf {setfont} bind def
+/scf {scalefont} bind def
+/sw {stringwidth} bind def
+/tr {translate} bind def
+/tnt {dup dup currentrgbcolor
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb}
+ bind def
+/shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul
+ 4 -2 roll mul srgb} bind def
+/$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def
+/$F2psEnd {$F2psEnteredState restore end} def
+%%EndProlog
+
+$F2psBegin
+10 setmiterlimit
+n 0 1048 m 0 0 l 2473 0 l 2473 1048 l cp clip
+ 0.06000 0.06000 sc
+% Polyline
+30.000 slw
+n 2400 975 m 75 975 l 75 150 l 2400 150 l cp gs col-1 s gr
+/Times-Bold ff 360.00 scf sf
+1220 705 m
+gs 1 -1 sc (Graphic) dup sw pop 2 div neg 0 rm col-1 sh gr
+$F2psEnd
+rs
+
+%%EndDocument
+ @endspecial 1501 406 a FQ(Figure)31 b(61:)p 0 TeXcolorgray
+Black 42 w(Tw)m(o)f(Graphics)g(in)g(One)g(Figure)p Black
+Black Black 935 697 a FN(\\begin{figure})1066 797 y(\\centering)1066
+896 y(\\begin{minipage})o([c)o(]{0)o(.5)o(\\li)o(ne)o(wi)o(dth)o(})1197
+996 y(\\centering)39 b(\\includegraphics)o([wi)o(dt)o(h=1)o(in)o(]{)o
+(gra)o(ph)o(ic})1066 1096 y(\\end{minipage}\045)1066
+1195 y(\\begin{minipage})o([c)o(]{0)o(.5)o(\\li)o(ne)o(wi)o(dth)o(})
+1197 1295 y(\\centering)g(\\includegraphics)o([wi)o(dt)o(h=2)o(in)o(]{)
+o(gra)o(ph)o(ic})1066 1395 y(\\end{minipage})1066 1494
+y(\\caption{Centers)e(Aligned)k(Vertically})935 1594
+y(\\end{figure})630 1748 y FQ(pro)s(duces)29 b(Figure)p
+0.05 1.00 1.00 0.40 TeXcolorcmyk 31 w(62)p Black(,)i(whic)m(h)g(has)
+f(v)m(ertically-cen)m(tered)k(graphics.)p Black 1163
+2203 a @beginspecial 0 @llx 0 @lly 144 @urx 54 @ury 720
+@rwi @setspecial
+%%BeginDocument: graphic.eps
+%!PS-Adobe-2.0 EPSF-2.0
+%%Title: graphic.eps
+%%Creator: fig2dev Version 3.2 Patchlevel 0-beta2
+%%CreationDate: Thu Dec 11 20:58:11 1997
+%%For: Keith Reckdahl
+%%Orientation: Portrait
+%%BoundingBox: 0 0 144 54
+%%Pages: 0
+%%BeginSetup
+%%IncludeFeature: *PageSize Letter
+%%EndSetup
+%%Magnification: 1.00
+%%EndComments
+/$F2psDict 200 dict def
+$F2psDict begin
+$F2psDict /mtrx matrix put
+/col-1 {0 setgray} bind def
+/col0 {0.000 0.000 0.000 srgb} bind def
+/col1 {0.000 0.000 1.000 srgb} bind def
+/col2 {0.000 1.000 0.000 srgb} bind def
+/col3 {0.000 1.000 1.000 srgb} bind def
+/col4 {1.000 0.000 0.000 srgb} bind def
+/col5 {1.000 0.000 1.000 srgb} bind def
+/col6 {1.000 1.000 0.000 srgb} bind def
+/col7 {1.000 1.000 1.000 srgb} bind def
+/col8 {0.000 0.000 0.560 srgb} bind def
+/col9 {0.000 0.000 0.690 srgb} bind def
+/col10 {0.000 0.000 0.820 srgb} bind def
+/col11 {0.530 0.810 1.000 srgb} bind def
+/col12 {0.000 0.560 0.000 srgb} bind def
+/col13 {0.000 0.690 0.000 srgb} bind def
+/col14 {0.000 0.820 0.000 srgb} bind def
+/col15 {0.000 0.560 0.560 srgb} bind def
+/col16 {0.000 0.690 0.690 srgb} bind def
+/col17 {0.000 0.820 0.820 srgb} bind def
+/col18 {0.560 0.000 0.000 srgb} bind def
+/col19 {0.690 0.000 0.000 srgb} bind def
+/col20 {0.820 0.000 0.000 srgb} bind def
+/col21 {0.560 0.000 0.560 srgb} bind def
+/col22 {0.690 0.000 0.690 srgb} bind def
+/col23 {0.820 0.000 0.820 srgb} bind def
+/col24 {0.500 0.190 0.000 srgb} bind def
+/col25 {0.630 0.250 0.000 srgb} bind def
+/col26 {0.750 0.380 0.000 srgb} bind def
+/col27 {1.000 0.500 0.500 srgb} bind def
+/col28 {1.000 0.630 0.630 srgb} bind def
+/col29 {1.000 0.750 0.750 srgb} bind def
+/col30 {1.000 0.880 0.880 srgb} bind def
+/col31 {1.000 0.840 0.000 srgb} bind def
+
+end
+save
+-2.0 61.0 translate
+1 -1 scale
+
+/cp {closepath} bind def
+/ef {eofill} bind def
+/gr {grestore} bind def
+/gs {gsave} bind def
+/sa {save} bind def
+/rs {restore} bind def
+/l {lineto} bind def
+/m {moveto} bind def
+/rm {rmoveto} bind def
+/n {newpath} bind def
+/s {stroke} bind def
+/sh {show} bind def
+/slc {setlinecap} bind def
+/slj {setlinejoin} bind def
+/slw {setlinewidth} bind def
+/srgb {setrgbcolor} bind def
+/rot {rotate} bind def
+/sc {scale} bind def
+/sd {setdash} bind def
+/ff {findfont} bind def
+/sf {setfont} bind def
+/scf {scalefont} bind def
+/sw {stringwidth} bind def
+/tr {translate} bind def
+/tnt {dup dup currentrgbcolor
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb}
+ bind def
+/shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul
+ 4 -2 roll mul srgb} bind def
+/$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def
+/$F2psEnd {$F2psEnteredState restore end} def
+%%EndProlog
+
+$F2psBegin
+10 setmiterlimit
+n 0 1048 m 0 0 l 2473 0 l 2473 1048 l cp clip
+ 0.06000 0.06000 sc
+% Polyline
+30.000 slw
+n 2400 975 m 75 975 l 75 150 l 2400 150 l cp gs col-1 s gr
+/Times-Bold ff 360.00 scf sf
+1220 705 m
+gs 1 -1 sc (Graphic) dup sw pop 2 div neg 0 rm col-1 sh gr
+$F2psEnd
+rs
+
+%%EndDocument
+ @endspecial 2528 2316 a @beginspecial 0 @llx 0 @lly
+144 @urx 54 @ury 1440 @rwi @setspecial
+%%BeginDocument: graphic.eps
+%!PS-Adobe-2.0 EPSF-2.0
+%%Title: graphic.eps
+%%Creator: fig2dev Version 3.2 Patchlevel 0-beta2
+%%CreationDate: Thu Dec 11 20:58:11 1997
+%%For: Keith Reckdahl
+%%Orientation: Portrait
+%%BoundingBox: 0 0 144 54
+%%Pages: 0
+%%BeginSetup
+%%IncludeFeature: *PageSize Letter
+%%EndSetup
+%%Magnification: 1.00
+%%EndComments
+/$F2psDict 200 dict def
+$F2psDict begin
+$F2psDict /mtrx matrix put
+/col-1 {0 setgray} bind def
+/col0 {0.000 0.000 0.000 srgb} bind def
+/col1 {0.000 0.000 1.000 srgb} bind def
+/col2 {0.000 1.000 0.000 srgb} bind def
+/col3 {0.000 1.000 1.000 srgb} bind def
+/col4 {1.000 0.000 0.000 srgb} bind def
+/col5 {1.000 0.000 1.000 srgb} bind def
+/col6 {1.000 1.000 0.000 srgb} bind def
+/col7 {1.000 1.000 1.000 srgb} bind def
+/col8 {0.000 0.000 0.560 srgb} bind def
+/col9 {0.000 0.000 0.690 srgb} bind def
+/col10 {0.000 0.000 0.820 srgb} bind def
+/col11 {0.530 0.810 1.000 srgb} bind def
+/col12 {0.000 0.560 0.000 srgb} bind def
+/col13 {0.000 0.690 0.000 srgb} bind def
+/col14 {0.000 0.820 0.000 srgb} bind def
+/col15 {0.000 0.560 0.560 srgb} bind def
+/col16 {0.000 0.690 0.690 srgb} bind def
+/col17 {0.000 0.820 0.820 srgb} bind def
+/col18 {0.560 0.000 0.000 srgb} bind def
+/col19 {0.690 0.000 0.000 srgb} bind def
+/col20 {0.820 0.000 0.000 srgb} bind def
+/col21 {0.560 0.000 0.560 srgb} bind def
+/col22 {0.690 0.000 0.690 srgb} bind def
+/col23 {0.820 0.000 0.820 srgb} bind def
+/col24 {0.500 0.190 0.000 srgb} bind def
+/col25 {0.630 0.250 0.000 srgb} bind def
+/col26 {0.750 0.380 0.000 srgb} bind def
+/col27 {1.000 0.500 0.500 srgb} bind def
+/col28 {1.000 0.630 0.630 srgb} bind def
+/col29 {1.000 0.750 0.750 srgb} bind def
+/col30 {1.000 0.880 0.880 srgb} bind def
+/col31 {1.000 0.840 0.000 srgb} bind def
+
+end
+save
+-2.0 61.0 translate
+1 -1 scale
+
+/cp {closepath} bind def
+/ef {eofill} bind def
+/gr {grestore} bind def
+/gs {gsave} bind def
+/sa {save} bind def
+/rs {restore} bind def
+/l {lineto} bind def
+/m {moveto} bind def
+/rm {rmoveto} bind def
+/n {newpath} bind def
+/s {stroke} bind def
+/sh {show} bind def
+/slc {setlinecap} bind def
+/slj {setlinejoin} bind def
+/slw {setlinewidth} bind def
+/srgb {setrgbcolor} bind def
+/rot {rotate} bind def
+/sc {scale} bind def
+/sd {setdash} bind def
+/ff {findfont} bind def
+/sf {setfont} bind def
+/scf {scalefont} bind def
+/sw {stringwidth} bind def
+/tr {translate} bind def
+/tnt {dup dup currentrgbcolor
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb}
+ bind def
+/shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul
+ 4 -2 roll mul srgb} bind def
+/$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def
+/$F2psEnd {$F2psEnteredState restore end} def
+%%EndProlog
+
+$F2psBegin
+10 setmiterlimit
+n 0 1048 m 0 0 l 2473 0 l 2473 1048 l cp clip
+ 0.06000 0.06000 sc
+% Polyline
+30.000 slw
+n 2400 975 m 75 975 l 75 150 l 2400 150 l cp gs col-1 s gr
+/Times-Bold ff 360.00 scf sf
+1220 705 m
+gs 1 -1 sc (Graphic) dup sw pop 2 div neg 0 rm col-1 sh gr
+$F2psEnd
+rs
+
+%%EndDocument
+ @endspecial 1549 2486 a(Figure)d(62:)p 0 TeXcolorgray
+Black 41 w(Cen)m(ters)g(Aligned)g(V)-8 b(ertically)p
+Black 630 2814 a(Notes)32 b(on)e(this)g(example:)p Black
+767 2957 a FK(\210)p Black 45 w FQ(Lik)m(e)d(an)m(y)e(other)h(L)1474
+2940 y FP(A)1513 2957 y FQ(T)1564 2977 y(E)1614 2957
+y(X)g(ob)5 b(ject,)28 b(minipages)d(are)h(p)s(ositioned)g(suc)m(h)f
+(that)h(their)f(reference)857 3070 y(p)s(oin)m(t)34 b(is)g(aligned)g
+(with)f(the)h(curren)m(t)g(baseline.)51 b(By)34 b(default,)h(minipages)
+f(use)f(the)h FM([c])857 3183 y FQ(option)e(whic)m(h)f(places)h(the)f
+(reference)h(p)s(oin)m(t)f(at)h(the)g(v)m(ertical)h(cen)m(ter)f(of)g
+(the)f(minipage,)857 3296 y(the)44 b FM([t])e FQ(option)i(places)g(the)
+f(reference)h(p)s(oin)m(t)f(at)h(the)g(baseline)f(of)h(the)f
+(minipage's)857 3409 y(top)38 b(line)f(and)g(the)g FM([b])f
+FQ(option)i(places)g(the)f(reference)h(p)s(oin)m(t)f(at)g(the)h
+(baseline)f(of)h(the)857 3522 y(minipage's)31 b(b)s(ottom)g(line)g
+(\(see)g(Section)p 0.05 1.00 1.00 0.40 TeXcolorcmyk
+31 w(11.4)p Black 32 w(on)f(page)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 32 w(36)p Black(\).)p Black 767 3672 a FK(\210)p
+Black 45 w FQ(The)36 b FM(\045)f FQ(after)i(the)f(\014rst)f
+FM(\\end{minipage})d FQ(command)k(prev)m(en)m(ts)g(an)g(in)m(terw)m
+(ord)g(space)857 3785 y(from)26 b(b)s(eing)f(inserted)h(b)s(et)m(w)m
+(een)g(the)g FM(minipage)e FQ(b)s(o)m(xes)i(\(see)h(Section)p
+0.05 1.00 1.00 0.40 TeXcolorcmyk 27 w(10.2)p Black
+27 w(on)f(page)p 0.05 1.00 1.00 0.40 TeXcolorcmyk
+26 w(32)p Black(\).)p Black 767 3935 a FK(\210)p Black
+45 w FQ(When)j(the)h(widths)e(of)i(the)f(minipages)h(do)f(not)h(add)e
+(to)i(1.0)p FM(\\linewidth)p FQ(,)e(the)i FM(\\hspace)857
+4048 y FQ(or)22 b FM(\\hfill)f FQ(commands)h(can)g(b)s(e)g(used)f(to)i
+(sp)s(ecify)f(horizon)m(tal)i(spacing)e(\(see)h(Section)p
+0.05 1.00 1.00 0.40 TeXcolorcmyk 23 w(10.2)p Black
+857 4161 a(on)31 b(page)p 0.05 1.00 1.00 0.40 TeXcolorcmyk
+31 w(32)p Black(\).)630 4404 y FB(28.2)112 b(Side-b)m(y-Side)40
+b(Figures)630 4554 y FQ(In)30 b(the)h(previous)f(section,)j(m)m
+(ultiple)e FM(minipage)e FQ(en)m(vironmen)m(ts)i(w)m(ere)g(used)f
+(inside)g(a)i FM(figure)630 4646 y FQ(en)m(vironmen)m(t)48
+b(to)f(pro)s(duce)f(a)i(single)f(\014gure)g(consisting)g(of)h(m)m
+(ultiple)f(graphics.)91 b(Placing)630 4737 y FM(\\caption)30
+b FQ(statemen)m(ts)k(inside)d(the)h(minipages)h(mak)m(es)g(the)f
+(minipages)g(themselv)m(es)i(b)s(ecome)630 4828 y(\014gures.)40
+b(F)-8 b(or)31 b(example)p Black Black 865 4961 a FE(\\begin{figure})
+983 5053 y(\\centering)983 5144 y(\045\045----start)42
+b(of)d(first)i(figure----)983 5235 y(\\begin{minipage}[t]{0.4\\linew)q
+(idth)q(})1101 5326 y(\\centering)1101 5418 y
+(\\includegraphics[width=1in]{gr)q(aphic)q(})p Black
+2227 5640 a FQ(105)p Black eop end
+%%Page: 106 106
+TeXDict begin 106 105 bop Black 0 TeXcolorgray Black
+Black 1101 -149 a FE(\\caption{Small)42 b(Box})e(\\label{fig:side:a})
+983 -57 y(\\end{minipage}\045)983 34 y(\\hspace{1cm}\045)983
+125 y(\045\045----start)i(of)d(second)i(figure----)983
+217 y(\\begin{minipage}[t]{0.4\\linew)q(idth)q(})1101
+308 y(\\centering)1101 399 y(\\includegraphics[width=1.5in]{)q(graph)q
+(ic})1101 491 y(\\caption{Big)h(Box})79 b(\\label{fig:side:b})983
+582 y(\\end{minipage})865 673 y(\\end{figure})630 827
+y FQ(pro)s(duces)29 b(Figures)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 31 w(63)p Black 31 w(and)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 30 w(64)p Black(.)p Black 1211 1281 a @beginspecial
+0 @llx 0 @lly 144 @urx 54 @ury 720 @rwi @setspecial
+%%BeginDocument: graphic.eps
+%!PS-Adobe-2.0 EPSF-2.0
+%%Title: graphic.eps
+%%Creator: fig2dev Version 3.2 Patchlevel 0-beta2
+%%CreationDate: Thu Dec 11 20:58:11 1997
+%%For: Keith Reckdahl
+%%Orientation: Portrait
+%%BoundingBox: 0 0 144 54
+%%Pages: 0
+%%BeginSetup
+%%IncludeFeature: *PageSize Letter
+%%EndSetup
+%%Magnification: 1.00
+%%EndComments
+/$F2psDict 200 dict def
+$F2psDict begin
+$F2psDict /mtrx matrix put
+/col-1 {0 setgray} bind def
+/col0 {0.000 0.000 0.000 srgb} bind def
+/col1 {0.000 0.000 1.000 srgb} bind def
+/col2 {0.000 1.000 0.000 srgb} bind def
+/col3 {0.000 1.000 1.000 srgb} bind def
+/col4 {1.000 0.000 0.000 srgb} bind def
+/col5 {1.000 0.000 1.000 srgb} bind def
+/col6 {1.000 1.000 0.000 srgb} bind def
+/col7 {1.000 1.000 1.000 srgb} bind def
+/col8 {0.000 0.000 0.560 srgb} bind def
+/col9 {0.000 0.000 0.690 srgb} bind def
+/col10 {0.000 0.000 0.820 srgb} bind def
+/col11 {0.530 0.810 1.000 srgb} bind def
+/col12 {0.000 0.560 0.000 srgb} bind def
+/col13 {0.000 0.690 0.000 srgb} bind def
+/col14 {0.000 0.820 0.000 srgb} bind def
+/col15 {0.000 0.560 0.560 srgb} bind def
+/col16 {0.000 0.690 0.690 srgb} bind def
+/col17 {0.000 0.820 0.820 srgb} bind def
+/col18 {0.560 0.000 0.000 srgb} bind def
+/col19 {0.690 0.000 0.000 srgb} bind def
+/col20 {0.820 0.000 0.000 srgb} bind def
+/col21 {0.560 0.000 0.560 srgb} bind def
+/col22 {0.690 0.000 0.690 srgb} bind def
+/col23 {0.820 0.000 0.820 srgb} bind def
+/col24 {0.500 0.190 0.000 srgb} bind def
+/col25 {0.630 0.250 0.000 srgb} bind def
+/col26 {0.750 0.380 0.000 srgb} bind def
+/col27 {1.000 0.500 0.500 srgb} bind def
+/col28 {1.000 0.630 0.630 srgb} bind def
+/col29 {1.000 0.750 0.750 srgb} bind def
+/col30 {1.000 0.880 0.880 srgb} bind def
+/col31 {1.000 0.840 0.000 srgb} bind def
+
+end
+save
+-2.0 61.0 translate
+1 -1 scale
+
+/cp {closepath} bind def
+/ef {eofill} bind def
+/gr {grestore} bind def
+/gs {gsave} bind def
+/sa {save} bind def
+/rs {restore} bind def
+/l {lineto} bind def
+/m {moveto} bind def
+/rm {rmoveto} bind def
+/n {newpath} bind def
+/s {stroke} bind def
+/sh {show} bind def
+/slc {setlinecap} bind def
+/slj {setlinejoin} bind def
+/slw {setlinewidth} bind def
+/srgb {setrgbcolor} bind def
+/rot {rotate} bind def
+/sc {scale} bind def
+/sd {setdash} bind def
+/ff {findfont} bind def
+/sf {setfont} bind def
+/scf {scalefont} bind def
+/sw {stringwidth} bind def
+/tr {translate} bind def
+/tnt {dup dup currentrgbcolor
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb}
+ bind def
+/shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul
+ 4 -2 roll mul srgb} bind def
+/$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def
+/$F2psEnd {$F2psEnteredState restore end} def
+%%EndProlog
+
+$F2psBegin
+10 setmiterlimit
+n 0 1048 m 0 0 l 2473 0 l 2473 1048 l cp clip
+ 0.06000 0.06000 sc
+% Polyline
+30.000 slw
+n 2400 975 m 75 975 l 75 150 l 2400 150 l cp gs col-1 s gr
+/Times-Bold ff 360.00 scf sf
+1220 705 m
+gs 1 -1 sc (Graphic) dup sw pop 2 div neg 0 rm col-1 sh gr
+$F2psEnd
+rs
+
+%%EndDocument
+ @endspecial 1085 1477 a(Figure)i(63:)p 0 TeXcolorgray
+Black 42 w(Small)f(Bo)m(x)2629 1281 y @beginspecial 0
+@llx 0 @lly 144 @urx 54 @ury 1080 @rwi @setspecial
+%%BeginDocument: graphic.eps
+%!PS-Adobe-2.0 EPSF-2.0
+%%Title: graphic.eps
+%%Creator: fig2dev Version 3.2 Patchlevel 0-beta2
+%%CreationDate: Thu Dec 11 20:58:11 1997
+%%For: Keith Reckdahl
+%%Orientation: Portrait
+%%BoundingBox: 0 0 144 54
+%%Pages: 0
+%%BeginSetup
+%%IncludeFeature: *PageSize Letter
+%%EndSetup
+%%Magnification: 1.00
+%%EndComments
+/$F2psDict 200 dict def
+$F2psDict begin
+$F2psDict /mtrx matrix put
+/col-1 {0 setgray} bind def
+/col0 {0.000 0.000 0.000 srgb} bind def
+/col1 {0.000 0.000 1.000 srgb} bind def
+/col2 {0.000 1.000 0.000 srgb} bind def
+/col3 {0.000 1.000 1.000 srgb} bind def
+/col4 {1.000 0.000 0.000 srgb} bind def
+/col5 {1.000 0.000 1.000 srgb} bind def
+/col6 {1.000 1.000 0.000 srgb} bind def
+/col7 {1.000 1.000 1.000 srgb} bind def
+/col8 {0.000 0.000 0.560 srgb} bind def
+/col9 {0.000 0.000 0.690 srgb} bind def
+/col10 {0.000 0.000 0.820 srgb} bind def
+/col11 {0.530 0.810 1.000 srgb} bind def
+/col12 {0.000 0.560 0.000 srgb} bind def
+/col13 {0.000 0.690 0.000 srgb} bind def
+/col14 {0.000 0.820 0.000 srgb} bind def
+/col15 {0.000 0.560 0.560 srgb} bind def
+/col16 {0.000 0.690 0.690 srgb} bind def
+/col17 {0.000 0.820 0.820 srgb} bind def
+/col18 {0.560 0.000 0.000 srgb} bind def
+/col19 {0.690 0.000 0.000 srgb} bind def
+/col20 {0.820 0.000 0.000 srgb} bind def
+/col21 {0.560 0.000 0.560 srgb} bind def
+/col22 {0.690 0.000 0.690 srgb} bind def
+/col23 {0.820 0.000 0.820 srgb} bind def
+/col24 {0.500 0.190 0.000 srgb} bind def
+/col25 {0.630 0.250 0.000 srgb} bind def
+/col26 {0.750 0.380 0.000 srgb} bind def
+/col27 {1.000 0.500 0.500 srgb} bind def
+/col28 {1.000 0.630 0.630 srgb} bind def
+/col29 {1.000 0.750 0.750 srgb} bind def
+/col30 {1.000 0.880 0.880 srgb} bind def
+/col31 {1.000 0.840 0.000 srgb} bind def
+
+end
+save
+-2.0 61.0 translate
+1 -1 scale
+
+/cp {closepath} bind def
+/ef {eofill} bind def
+/gr {grestore} bind def
+/gs {gsave} bind def
+/sa {save} bind def
+/rs {restore} bind def
+/l {lineto} bind def
+/m {moveto} bind def
+/rm {rmoveto} bind def
+/n {newpath} bind def
+/s {stroke} bind def
+/sh {show} bind def
+/slc {setlinecap} bind def
+/slj {setlinejoin} bind def
+/slw {setlinewidth} bind def
+/srgb {setrgbcolor} bind def
+/rot {rotate} bind def
+/sc {scale} bind def
+/sd {setdash} bind def
+/ff {findfont} bind def
+/sf {setfont} bind def
+/scf {scalefont} bind def
+/sw {stringwidth} bind def
+/tr {translate} bind def
+/tnt {dup dup currentrgbcolor
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb}
+ bind def
+/shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul
+ 4 -2 roll mul srgb} bind def
+/$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def
+/$F2psEnd {$F2psEnteredState restore end} def
+%%EndProlog
+
+$F2psBegin
+10 setmiterlimit
+n 0 1048 m 0 0 l 2473 0 l 2473 1048 l cp clip
+ 0.06000 0.06000 sc
+% Polyline
+30.000 slw
+n 2400 975 m 75 975 l 75 150 l 2400 150 l cp gs col-1 s gr
+/Times-Bold ff 360.00 scf sf
+1220 705 m
+gs 1 -1 sc (Graphic) dup sw pop 2 div neg 0 rm col-1 sh gr
+$F2psEnd
+rs
+
+%%EndDocument
+ @endspecial 2697 1477 a(Figure)h(64:)p 0 TeXcolorgray
+Black 41 w(Big)h(Bo)m(x)p Black 630 1706 a(Notes)g(ab)s(out)e(this)g
+(example:)p Black 767 1849 a FK(\210)p Black 45 w FQ(Although)d(the)h
+(ab)s(o)m(v)m(e)g(commands)e(include)h Fy(one)34 b FQ(\014gure)27
+b(en)m(vironmen)m(t,)h(the)f(commands)857 1961 y(pro)s(duce)i
+Fy(two)38 b FQ(\014gures)29 b(b)s(ecause)i(t)m(w)m(o)g
+FM(\\caption)d FQ(commands)i(are)h(used.)p Black 767
+2112 a FK(\210)p Black 45 w FQ(The)c(\014gures)f(are)h(put)g(inside)g
+(t)m(w)m(o)h(minipages)f(whose)g(widths)f(are)i(40\045)f(of)g(the)h
+(width)e(of)857 2224 y(the)35 b(\014gure)g(en)m(vironmen)m(t)g(that)h
+(are)f(separated)h(b)m(y)f(1cm)g(of)g(horizon)m(tal)i(space.)55
+b(\(Note)857 2337 y(that)24 b(commen)m(t)f(c)m(haracters)h(after)f
+FM(\\end{minipage})c FQ(and)j FM(\\hspace{1cm})d FQ(ensure)j(that)857
+2450 y(the)35 b(spacing)h(is)e(exactly)j(1cm)f(b)m(y)e(prev)m(en)m
+(ting)i(in)m(terw)m(ord)f(spaces)g(b)s(et)m(w)m(een)h(the)f(mini-)857
+2563 y(pages)c(and)f(the)h(horizon)m(tal)h(space.\))857
+2713 y(By)c(default,)h(the)f(\014gure)g(captions)g(are)h(t)m(yp)s(eset)
+f(to)h(the)f(en)m(tire)h(width)e(of)h(the)g(minipage.)857
+2826 y(The)e(1cm)g(of)g(horizon)m(tal)h(space)g(w)m(as)f(used)f(to)i
+(ensure)e(horizon)m(tal)i(spacing)f(b)s(et)m(w)m(een)h(the)857
+2939 y(captions)k(\(for)g(longer)g(captions)g(and/or)f(wider)g
+(graphics\).)857 3089 y(Alternativ)m(ely)-8 b(,)49 b(the)43
+b(caption)h(widths)d(could)i(b)s(e)f(limited)i(b)m(y)e(the)h
+FO(caption)g FQ(pac)m(k)-5 b(age's)857 3202 y FM(margin)29
+b FQ(or)h FM(width)f FQ(k)m(eyw)m(ords)i(\(see)g(T)-8
+b(able)p 0.05 1.00 1.00 0.40 TeXcolorcmyk 31 w(18)p
+Black 31 w(on)31 b(page)p 0.05 1.00 1.00 0.40 TeXcolorcmyk
+31 w(75)p Black(\).)p Black 767 3352 a FK(\210)p Black
+45 w FQ(The)20 b FM(\\centering)e FQ(command)i(immediately)h(after)g
+FM(\\begin{figure})16 b FQ(causes)21 b(the)f(group)857
+3465 y(of)31 b(t)m(w)m(o)h(minipages)e(and)g(spacing)h(to)g(b)s(e)f
+(cen)m(tered)h(in)f(the)h(\014gure)e(en)m(vironmen)m(t.)p
+Black 767 3615 a FK(\210)p Black 45 w FQ(The)h FM(\\centering)e
+FQ(command)i(inside)g(the)g(minipage)h(causes)g(the)f(graphics)h(to)g
+(b)s(e)e(cen-)857 3728 y(tered)i(within)f(the)g(minipage.)630
+3971 y FB(28.3)112 b(Side-b)m(y-Side)40 b(Sub\014gures)630
+4121 y FQ(It)46 b(ma)m(y)g(b)s(e)f(desirable)h(to)h(refer)e(to)i
+(side-b)m(y-side)f(graphics)g(b)s(oth)f(individually)g(and)h(as)g(a)630
+4213 y(group.)i(The)32 b FM(\\subfloat)f FQ(command)h(\(from)h(the)g
+FO(sub\014g)h FQ(pac)m(k)-5 b(age,)36 b(describ)s(ed)c(in)g(Section)p
+0.05 1.00 1.00 0.40 TeXcolorcmyk 34 w(32)p Black 630
+4304 a(on)c(page)p 0.05 1.00 1.00 0.40 TeXcolorcmyk
+29 w(113)p Black(\))i(allo)m(ws)g(a)e(group)g(of)h(graphics)f(to)h(b)s
+(e)e(individually)h(de\014ned)f(as)i(sub\014gures)d(that)630
+4395 y(are)31 b(de\014ned)e(to)i(b)s(e)f(part)g(of)h(a)f(single)h
+(\014gure.)40 b(F)-8 b(or)32 b(example)p Black Black
+748 4528 a FE(\\usepackage{subfig})748 4619 y(...)748
+4710 y(\\begin{figure})865 4801 y(\\centering)865 4893
+y(\045\045----start)42 b(of)e(first)g(subfigure----)865
+4984 y(\\subfloat[Small)j(Box)d(with)g(a)g(Long)g(Caption]{)1062
+5075 y(\\label{fig:subfig:a})436 b(\045\045)39 b(label)i(for)f(first)g
+(subfigure)1062 5167 y(\\includegraphics[width=1.0in]{g)q(raphi)q(c}})
+865 5258 y(\\hspace{1in})865 5349 y(\045\045----start)i(of)e(second)g
+(subfigure----)865 5441 y(\\subfloat[Big)j(Box]{)p Black
+2227 5640 a FQ(106)p Black eop end
+%%Page: 107 107
+TeXDict begin 107 106 bop Black 0 TeXcolorgray Black
+Black 1062 -149 a FE(\\label{fig:subfig:b})436 b(\045\045)39
+b(label)i(for)f(second)g(subfigure)1062 -57 y
+(\\includegraphics[width=1.5in]{g)q(raphi)q(c}})865 34
+y(\\caption{Two)i(Subfigures})865 125 y(\\label{fig:subfig})711
+b(\045\045)39 b(label)i(for)f(entire)g(figure)748 217
+y(\\end{figure})630 346 y FQ(pro)s(duces)34 b(Figure)p
+0.05 1.00 1.00 0.40 TeXcolorcmyk 35 w(65)p Black(.)55
+b(The)34 b(commands)h(used)f(to)h(individually)g(and)f(collectiv)m(ely)
+k(reference)630 459 y(the)31 b(parts)f(of)g(Figure)p
+0.05 1.00 1.00 0.40 TeXcolorcmyk 31 w(65)p Black 31
+w(are)h(sho)m(wn)f(in)g(T)-8 b(able)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 31 w(22)p Black(.)p Black 1230 986 a @beginspecial
+0 @llx 0 @lly 144 @urx 54 @ury 720 @rwi @setspecial
+%%BeginDocument: graphic.eps
+%!PS-Adobe-2.0 EPSF-2.0
+%%Title: graphic.eps
+%%Creator: fig2dev Version 3.2 Patchlevel 0-beta2
+%%CreationDate: Thu Dec 11 20:58:11 1997
+%%For: Keith Reckdahl
+%%Orientation: Portrait
+%%BoundingBox: 0 0 144 54
+%%Pages: 0
+%%BeginSetup
+%%IncludeFeature: *PageSize Letter
+%%EndSetup
+%%Magnification: 1.00
+%%EndComments
+/$F2psDict 200 dict def
+$F2psDict begin
+$F2psDict /mtrx matrix put
+/col-1 {0 setgray} bind def
+/col0 {0.000 0.000 0.000 srgb} bind def
+/col1 {0.000 0.000 1.000 srgb} bind def
+/col2 {0.000 1.000 0.000 srgb} bind def
+/col3 {0.000 1.000 1.000 srgb} bind def
+/col4 {1.000 0.000 0.000 srgb} bind def
+/col5 {1.000 0.000 1.000 srgb} bind def
+/col6 {1.000 1.000 0.000 srgb} bind def
+/col7 {1.000 1.000 1.000 srgb} bind def
+/col8 {0.000 0.000 0.560 srgb} bind def
+/col9 {0.000 0.000 0.690 srgb} bind def
+/col10 {0.000 0.000 0.820 srgb} bind def
+/col11 {0.530 0.810 1.000 srgb} bind def
+/col12 {0.000 0.560 0.000 srgb} bind def
+/col13 {0.000 0.690 0.000 srgb} bind def
+/col14 {0.000 0.820 0.000 srgb} bind def
+/col15 {0.000 0.560 0.560 srgb} bind def
+/col16 {0.000 0.690 0.690 srgb} bind def
+/col17 {0.000 0.820 0.820 srgb} bind def
+/col18 {0.560 0.000 0.000 srgb} bind def
+/col19 {0.690 0.000 0.000 srgb} bind def
+/col20 {0.820 0.000 0.000 srgb} bind def
+/col21 {0.560 0.000 0.560 srgb} bind def
+/col22 {0.690 0.000 0.690 srgb} bind def
+/col23 {0.820 0.000 0.820 srgb} bind def
+/col24 {0.500 0.190 0.000 srgb} bind def
+/col25 {0.630 0.250 0.000 srgb} bind def
+/col26 {0.750 0.380 0.000 srgb} bind def
+/col27 {1.000 0.500 0.500 srgb} bind def
+/col28 {1.000 0.630 0.630 srgb} bind def
+/col29 {1.000 0.750 0.750 srgb} bind def
+/col30 {1.000 0.880 0.880 srgb} bind def
+/col31 {1.000 0.840 0.000 srgb} bind def
+
+end
+save
+-2.0 61.0 translate
+1 -1 scale
+
+/cp {closepath} bind def
+/ef {eofill} bind def
+/gr {grestore} bind def
+/gs {gsave} bind def
+/sa {save} bind def
+/rs {restore} bind def
+/l {lineto} bind def
+/m {moveto} bind def
+/rm {rmoveto} bind def
+/n {newpath} bind def
+/s {stroke} bind def
+/sh {show} bind def
+/slc {setlinecap} bind def
+/slj {setlinejoin} bind def
+/slw {setlinewidth} bind def
+/srgb {setrgbcolor} bind def
+/rot {rotate} bind def
+/sc {scale} bind def
+/sd {setdash} bind def
+/ff {findfont} bind def
+/sf {setfont} bind def
+/scf {scalefont} bind def
+/sw {stringwidth} bind def
+/tr {translate} bind def
+/tnt {dup dup currentrgbcolor
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb}
+ bind def
+/shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul
+ 4 -2 roll mul srgb} bind def
+/$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def
+/$F2psEnd {$F2psEnteredState restore end} def
+%%EndProlog
+
+$F2psBegin
+10 setmiterlimit
+n 0 1048 m 0 0 l 2473 0 l 2473 1048 l cp clip
+ 0.06000 0.06000 sc
+% Polyline
+30.000 slw
+n 2400 975 m 75 975 l 75 150 l 2400 150 l cp gs col-1 s gr
+/Times-Bold ff 360.00 scf sf
+1220 705 m
+gs 1 -1 sc (Graphic) dup sw pop 2 div neg 0 rm col-1 sh gr
+$F2psEnd
+rs
+
+%%EndDocument
+ @endspecial 1200 1083 a FG(\(a\))21 b(Small)h(Bo)n(x)g(with)1200
+1175 y(a)k(Long)g(Caption)2490 986 y @beginspecial 0
+@llx 0 @lly 144 @urx 54 @ury 1080 @rwi @setspecial
+%%BeginDocument: graphic.eps
+%!PS-Adobe-2.0 EPSF-2.0
+%%Title: graphic.eps
+%%Creator: fig2dev Version 3.2 Patchlevel 0-beta2
+%%CreationDate: Thu Dec 11 20:58:11 1997
+%%For: Keith Reckdahl
+%%Orientation: Portrait
+%%BoundingBox: 0 0 144 54
+%%Pages: 0
+%%BeginSetup
+%%IncludeFeature: *PageSize Letter
+%%EndSetup
+%%Magnification: 1.00
+%%EndComments
+/$F2psDict 200 dict def
+$F2psDict begin
+$F2psDict /mtrx matrix put
+/col-1 {0 setgray} bind def
+/col0 {0.000 0.000 0.000 srgb} bind def
+/col1 {0.000 0.000 1.000 srgb} bind def
+/col2 {0.000 1.000 0.000 srgb} bind def
+/col3 {0.000 1.000 1.000 srgb} bind def
+/col4 {1.000 0.000 0.000 srgb} bind def
+/col5 {1.000 0.000 1.000 srgb} bind def
+/col6 {1.000 1.000 0.000 srgb} bind def
+/col7 {1.000 1.000 1.000 srgb} bind def
+/col8 {0.000 0.000 0.560 srgb} bind def
+/col9 {0.000 0.000 0.690 srgb} bind def
+/col10 {0.000 0.000 0.820 srgb} bind def
+/col11 {0.530 0.810 1.000 srgb} bind def
+/col12 {0.000 0.560 0.000 srgb} bind def
+/col13 {0.000 0.690 0.000 srgb} bind def
+/col14 {0.000 0.820 0.000 srgb} bind def
+/col15 {0.000 0.560 0.560 srgb} bind def
+/col16 {0.000 0.690 0.690 srgb} bind def
+/col17 {0.000 0.820 0.820 srgb} bind def
+/col18 {0.560 0.000 0.000 srgb} bind def
+/col19 {0.690 0.000 0.000 srgb} bind def
+/col20 {0.820 0.000 0.000 srgb} bind def
+/col21 {0.560 0.000 0.560 srgb} bind def
+/col22 {0.690 0.000 0.690 srgb} bind def
+/col23 {0.820 0.000 0.820 srgb} bind def
+/col24 {0.500 0.190 0.000 srgb} bind def
+/col25 {0.630 0.250 0.000 srgb} bind def
+/col26 {0.750 0.380 0.000 srgb} bind def
+/col27 {1.000 0.500 0.500 srgb} bind def
+/col28 {1.000 0.630 0.630 srgb} bind def
+/col29 {1.000 0.750 0.750 srgb} bind def
+/col30 {1.000 0.880 0.880 srgb} bind def
+/col31 {1.000 0.840 0.000 srgb} bind def
+
+end
+save
+-2.0 61.0 translate
+1 -1 scale
+
+/cp {closepath} bind def
+/ef {eofill} bind def
+/gr {grestore} bind def
+/gs {gsave} bind def
+/sa {save} bind def
+/rs {restore} bind def
+/l {lineto} bind def
+/m {moveto} bind def
+/rm {rmoveto} bind def
+/n {newpath} bind def
+/s {stroke} bind def
+/sh {show} bind def
+/slc {setlinecap} bind def
+/slj {setlinejoin} bind def
+/slw {setlinewidth} bind def
+/srgb {setrgbcolor} bind def
+/rot {rotate} bind def
+/sc {scale} bind def
+/sd {setdash} bind def
+/ff {findfont} bind def
+/sf {setfont} bind def
+/scf {scalefont} bind def
+/sw {stringwidth} bind def
+/tr {translate} bind def
+/tnt {dup dup currentrgbcolor
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb}
+ bind def
+/shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul
+ 4 -2 roll mul srgb} bind def
+/$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def
+/$F2psEnd {$F2psEnteredState restore end} def
+%%EndProlog
+
+$F2psBegin
+10 setmiterlimit
+n 0 1048 m 0 0 l 2473 0 l 2473 1048 l cp clip
+ 0.06000 0.06000 sc
+% Polyline
+30.000 slw
+n 2400 975 m 75 975 l 75 150 l 2400 150 l cp gs col-1 s gr
+/Times-Bold ff 360.00 scf sf
+1220 705 m
+gs 1 -1 sc (Graphic) dup sw pop 2 div neg 0 rm col-1 sh gr
+$F2psEnd
+rs
+
+%%EndDocument
+ @endspecial 2726 1083 a(\(b\))f(Big)i(Bo)n(x)1766 1373
+y FQ(Figure)k(65:)p 0 TeXcolorgray Black 42 w(Tw)m(o)f(Sub\014gures)p
+Black Black 630 1664 a(T)-8 b(able)30 b(22:)p 0 TeXcolorgray
+Black 41 w(Sub\014gure)d(Reference)j(Commands)e(and)h(Their)g(Output)f
+(for)h(Figure)h(65)g(Example)p 1519 1793 1553 4 v 1519
+1906 4 113 v 1572 1872 a(Reference)h(Command)p 2672 1906
+V 330 w(Output)p 3068 1906 V 1519 1909 1553 4 v 1519
+1929 V 1519 2042 4 113 v 1572 2008 a FM(\\subref{fig:subfig:a})p
+2672 2042 V 0.05 1.00 1.00 0.40 TeXcolorcmyk 233 w
+FQ(\(a\))p Black 3068 2042 V 1519 2045 1553 4 v 1519
+2158 4 113 v 1572 2124 a FM(\\subref*{fig:subfig:a})p
+2672 2158 V 0.05 1.00 1.00 0.40 TeXcolorcmyk 221 w
+FQ(a)p Black 3068 2158 V 1519 2162 1553 4 v 1519 2275
+4 113 v 1572 2241 a FM(\\ref{fig:subfig:a})p 2672 2275
+V 0.05 1.00 1.00 0.40 TeXcolorcmyk 367 w FQ(65a)p
+Black 3068 2275 V 1519 2278 1553 4 v 1519 2391 4 113
+v 1572 2357 a FM(\\subref{fig:subfig:b})p 2672 2391 V
+0.05 1.00 1.00 0.40 TeXcolorcmyk 231 w FQ(\(b\))p
+Black 3068 2391 V 1519 2394 1553 4 v 1519 2507 4 113
+v 1572 2473 a FM(\\subref*{fig:subfig:b})p 2672 2507
+V 0.05 1.00 1.00 0.40 TeXcolorcmyk 218 w FQ(b)p Black
+3068 2507 V 1519 2510 1553 4 v 1519 2623 4 113 v 1572
+2589 a FM(\\ref{fig:subfig:b})p 2672 2623 V 0.05 1.00 1.00 0.40
+TeXcolorcmyk 365 w FQ(65b)p Black 3068 2623 V 1519 2627
+1553 4 v 1519 2739 4 113 v 1572 2706 a FM(\\ref{fig:subfig})p
+2672 2739 V 0.05 1.00 1.00 0.40 TeXcolorcmyk 486 w
+FQ(65)p Black 3068 2739 V 1519 2743 1553 4 v Black 630
+3050 a FL(28.3.1)106 b(Minipage)35 b(En)m(vironmen)m(ts)g(Inside)g
+(Sub\014gures)630 3200 y FQ(Since)g(Sub\014gure)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 32 w(65a)p Black 36 w(consists)h(of)e(only)h(the)g
+FM(\\includegraphics)30 b FQ(command,)36 b(the)f(caption)630
+3291 y(in)k(sub\014gure)p 0.05 1.00 1.00 0.40 TeXcolorcmyk
+37 w(65a)p Black 41 w(is)g(only)h(as)f(wide)g(as)h(the)f(included)g
+(graphic.)67 b(If)39 b(the)g(sub\014gure)f(instead)630
+3383 y(consists)f(of)g(the)g(en)m(tire)h(minipage,)h(the)e(caption)g
+(is)g(made)g(as)g(wide)f(as)h(the)g(minipage.)60 b(F)-8
+b(or)630 3474 y(example)p Black Black 708 3581 a FE(\\begin{figure})865
+3673 y(\\subfloat[Small)43 b(Box)d(with)g(a)g(Long)g(Caption]{)865
+3764 y(\\label{fig:mini:subfig:a})124 b(\045\045)39 b(label)i(for)f
+(first)g(subfigure)865 3855 y(\\begin{minipage}[b]{0.45\\li)q(newid)q
+(th})983 3947 y(\\centering)i(\\includegraphics[width=1in]{gra)q(phic)q
+(})865 4038 y(\\end{minipage}}\045)865 4129 y(\\hfill)865
+4221 y(\\subfloat[Big)h(Box]{)865 4312 y(\\label{fig:mini:subfig:b})124
+b(\045\045)39 b(label)i(for)f(second)g(subfigure)865
+4403 y(\\begin{minipage}[b]{0.45\\li)q(newid)q(th})983
+4495 y(\\centering)i(\\includegraphics[width=1.5in]{g)q(raph)q(ic})865
+4586 y(\\end{minipage}})865 4677 y(\\caption{Minipages)i(Inside)c
+(Subfigures})865 4769 y(\\label{fig:mini:subfig})202
+b(\045\045)39 b(label)i(for)f(entire)g(figure)708 4860
+y(\\end{figure})630 4989 y FQ(pro)s(duces)29 b(Figure)p
+0.05 1.00 1.00 0.40 TeXcolorcmyk 31 w(66)p Black(,)i(whic)m(h)g(con)
+m(tains)g(sub\014gures)p 0.05 1.00 1.00 0.40 TeXcolorcmyk
+29 w(66a)p Black 31 w(and)p 0.05 1.00 1.00 0.40 TeXcolorcmyk
+30 w(66b)p Black(.)771 5102 y(Since)i(sub\014gure)d(captions)k(are)e
+(\(b)m(y)h(default\))g(as)g(wide)f(as)h(the)f(sub\014gure,)g(the)h
+(sub\014gure)630 5215 y(captions)24 b(in)f(Figure)p
+0.05 1.00 1.00 0.40 TeXcolorcmyk 23 w(66)p Black 24
+w(are)h(wider)e(than)h(those)g(in)g(Figure)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 24 w(65)p Black(.)39 b(This)22 b(is)h(b)s(ecause)g(the)h
+(Figure)p 0.05 1.00 1.00 0.40 TeXcolorcmyk 23 w(65)p
+Black 630 5328 a(sub\014gures)e(con)m(tain)j(only)e(the)h(graphics)g
+(while)f(the)h(Figure)p 0.05 1.00 1.00 0.40 TeXcolorcmyk
+24 w(66)p Black 25 w(sub\014gures)e(con)m(tain)j(minipages)630
+5441 y(of)31 b(width)e FM(0.5\\linewidth)p FQ(.)p Black
+2227 5640 a(107)p Black eop end
+%%Page: 108 108
+TeXDict begin 108 107 bop Black 0 TeXcolorgray Black
+Black Black 1110 181 a @beginspecial 0 @llx 0 @lly 144
+@urx 54 @ury 720 @rwi @setspecial
+%%BeginDocument: graphic.eps
+%!PS-Adobe-2.0 EPSF-2.0
+%%Title: graphic.eps
+%%Creator: fig2dev Version 3.2 Patchlevel 0-beta2
+%%CreationDate: Thu Dec 11 20:58:11 1997
+%%For: Keith Reckdahl
+%%Orientation: Portrait
+%%BoundingBox: 0 0 144 54
+%%Pages: 0
+%%BeginSetup
+%%IncludeFeature: *PageSize Letter
+%%EndSetup
+%%Magnification: 1.00
+%%EndComments
+/$F2psDict 200 dict def
+$F2psDict begin
+$F2psDict /mtrx matrix put
+/col-1 {0 setgray} bind def
+/col0 {0.000 0.000 0.000 srgb} bind def
+/col1 {0.000 0.000 1.000 srgb} bind def
+/col2 {0.000 1.000 0.000 srgb} bind def
+/col3 {0.000 1.000 1.000 srgb} bind def
+/col4 {1.000 0.000 0.000 srgb} bind def
+/col5 {1.000 0.000 1.000 srgb} bind def
+/col6 {1.000 1.000 0.000 srgb} bind def
+/col7 {1.000 1.000 1.000 srgb} bind def
+/col8 {0.000 0.000 0.560 srgb} bind def
+/col9 {0.000 0.000 0.690 srgb} bind def
+/col10 {0.000 0.000 0.820 srgb} bind def
+/col11 {0.530 0.810 1.000 srgb} bind def
+/col12 {0.000 0.560 0.000 srgb} bind def
+/col13 {0.000 0.690 0.000 srgb} bind def
+/col14 {0.000 0.820 0.000 srgb} bind def
+/col15 {0.000 0.560 0.560 srgb} bind def
+/col16 {0.000 0.690 0.690 srgb} bind def
+/col17 {0.000 0.820 0.820 srgb} bind def
+/col18 {0.560 0.000 0.000 srgb} bind def
+/col19 {0.690 0.000 0.000 srgb} bind def
+/col20 {0.820 0.000 0.000 srgb} bind def
+/col21 {0.560 0.000 0.560 srgb} bind def
+/col22 {0.690 0.000 0.690 srgb} bind def
+/col23 {0.820 0.000 0.820 srgb} bind def
+/col24 {0.500 0.190 0.000 srgb} bind def
+/col25 {0.630 0.250 0.000 srgb} bind def
+/col26 {0.750 0.380 0.000 srgb} bind def
+/col27 {1.000 0.500 0.500 srgb} bind def
+/col28 {1.000 0.630 0.630 srgb} bind def
+/col29 {1.000 0.750 0.750 srgb} bind def
+/col30 {1.000 0.880 0.880 srgb} bind def
+/col31 {1.000 0.840 0.000 srgb} bind def
+
+end
+save
+-2.0 61.0 translate
+1 -1 scale
+
+/cp {closepath} bind def
+/ef {eofill} bind def
+/gr {grestore} bind def
+/gs {gsave} bind def
+/sa {save} bind def
+/rs {restore} bind def
+/l {lineto} bind def
+/m {moveto} bind def
+/rm {rmoveto} bind def
+/n {newpath} bind def
+/s {stroke} bind def
+/sh {show} bind def
+/slc {setlinecap} bind def
+/slj {setlinejoin} bind def
+/slw {setlinewidth} bind def
+/srgb {setrgbcolor} bind def
+/rot {rotate} bind def
+/sc {scale} bind def
+/sd {setdash} bind def
+/ff {findfont} bind def
+/sf {setfont} bind def
+/scf {scalefont} bind def
+/sw {stringwidth} bind def
+/tr {translate} bind def
+/tnt {dup dup currentrgbcolor
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb}
+ bind def
+/shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul
+ 4 -2 roll mul srgb} bind def
+/$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def
+/$F2psEnd {$F2psEnteredState restore end} def
+%%EndProlog
+
+$F2psBegin
+10 setmiterlimit
+n 0 1048 m 0 0 l 2473 0 l 2473 1048 l cp clip
+ 0.06000 0.06000 sc
+% Polyline
+30.000 slw
+n 2400 975 m 75 975 l 75 150 l 2400 150 l cp gs col-1 s gr
+/Times-Bold ff 360.00 scf sf
+1220 705 m
+gs 1 -1 sc (Graphic) dup sw pop 2 div neg 0 rm col-1 sh gr
+$F2psEnd
+rs
+
+%%EndDocument
+ @endspecial 797 278 a FG(\(a\))26 b(Small)g(Bo)n(x)g(with)g(a)g(Long)g
+(Caption)2761 181 y @beginspecial 0 @llx 0 @lly 144 @urx
+54 @ury 1080 @rwi @setspecial
+%%BeginDocument: graphic.eps
+%!PS-Adobe-2.0 EPSF-2.0
+%%Title: graphic.eps
+%%Creator: fig2dev Version 3.2 Patchlevel 0-beta2
+%%CreationDate: Thu Dec 11 20:58:11 1997
+%%For: Keith Reckdahl
+%%Orientation: Portrait
+%%BoundingBox: 0 0 144 54
+%%Pages: 0
+%%BeginSetup
+%%IncludeFeature: *PageSize Letter
+%%EndSetup
+%%Magnification: 1.00
+%%EndComments
+/$F2psDict 200 dict def
+$F2psDict begin
+$F2psDict /mtrx matrix put
+/col-1 {0 setgray} bind def
+/col0 {0.000 0.000 0.000 srgb} bind def
+/col1 {0.000 0.000 1.000 srgb} bind def
+/col2 {0.000 1.000 0.000 srgb} bind def
+/col3 {0.000 1.000 1.000 srgb} bind def
+/col4 {1.000 0.000 0.000 srgb} bind def
+/col5 {1.000 0.000 1.000 srgb} bind def
+/col6 {1.000 1.000 0.000 srgb} bind def
+/col7 {1.000 1.000 1.000 srgb} bind def
+/col8 {0.000 0.000 0.560 srgb} bind def
+/col9 {0.000 0.000 0.690 srgb} bind def
+/col10 {0.000 0.000 0.820 srgb} bind def
+/col11 {0.530 0.810 1.000 srgb} bind def
+/col12 {0.000 0.560 0.000 srgb} bind def
+/col13 {0.000 0.690 0.000 srgb} bind def
+/col14 {0.000 0.820 0.000 srgb} bind def
+/col15 {0.000 0.560 0.560 srgb} bind def
+/col16 {0.000 0.690 0.690 srgb} bind def
+/col17 {0.000 0.820 0.820 srgb} bind def
+/col18 {0.560 0.000 0.000 srgb} bind def
+/col19 {0.690 0.000 0.000 srgb} bind def
+/col20 {0.820 0.000 0.000 srgb} bind def
+/col21 {0.560 0.000 0.560 srgb} bind def
+/col22 {0.690 0.000 0.690 srgb} bind def
+/col23 {0.820 0.000 0.820 srgb} bind def
+/col24 {0.500 0.190 0.000 srgb} bind def
+/col25 {0.630 0.250 0.000 srgb} bind def
+/col26 {0.750 0.380 0.000 srgb} bind def
+/col27 {1.000 0.500 0.500 srgb} bind def
+/col28 {1.000 0.630 0.630 srgb} bind def
+/col29 {1.000 0.750 0.750 srgb} bind def
+/col30 {1.000 0.880 0.880 srgb} bind def
+/col31 {1.000 0.840 0.000 srgb} bind def
+
+end
+save
+-2.0 61.0 translate
+1 -1 scale
+
+/cp {closepath} bind def
+/ef {eofill} bind def
+/gr {grestore} bind def
+/gs {gsave} bind def
+/sa {save} bind def
+/rs {restore} bind def
+/l {lineto} bind def
+/m {moveto} bind def
+/rm {rmoveto} bind def
+/n {newpath} bind def
+/s {stroke} bind def
+/sh {show} bind def
+/slc {setlinecap} bind def
+/slj {setlinejoin} bind def
+/slw {setlinewidth} bind def
+/srgb {setrgbcolor} bind def
+/rot {rotate} bind def
+/sc {scale} bind def
+/sd {setdash} bind def
+/ff {findfont} bind def
+/sf {setfont} bind def
+/scf {scalefont} bind def
+/sw {stringwidth} bind def
+/tr {translate} bind def
+/tnt {dup dup currentrgbcolor
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb}
+ bind def
+/shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul
+ 4 -2 roll mul srgb} bind def
+/$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def
+/$F2psEnd {$F2psEnteredState restore end} def
+%%EndProlog
+
+$F2psBegin
+10 setmiterlimit
+n 0 1048 m 0 0 l 2473 0 l 2473 1048 l cp clip
+ 0.06000 0.06000 sc
+% Polyline
+30.000 slw
+n 2400 975 m 75 975 l 75 150 l 2400 150 l cp gs col-1 s gr
+/Times-Bold ff 360.00 scf sf
+1220 705 m
+gs 1 -1 sc (Graphic) dup sw pop 2 div neg 0 rm col-1 sh gr
+$F2psEnd
+rs
+
+%%EndDocument
+ @endspecial 2996 278 a(\(b\))f(Big)i(Bo)n(x)1519 475
+y FQ(Figure)k(66:)p 0 TeXcolorgray Black 42 w(Minipages)g(Inside)f
+(Sub\014gures)p Black 630 767 a FD(29)135 b(Separate)46
+b(Minipages)g(for)f(Captions)630 970 y FQ(Section)p
+0.05 1.00 1.00 0.40 TeXcolorcmyk 33 w(28.2)p Black
+34 w(on)32 b(page)p 0.05 1.00 1.00 0.40 TeXcolorcmyk
+33 w(105)p Black 34 w(describ)s(ed)f(ho)m(w)i(to)g(construct)f(side-b)m
+(y-side)h(\014gures)f(b)m(y)g(placing)630 1083 y(the)41
+b(graphics)f(command)g(and)g FM(\\caption)e FQ(command)i(together)i
+(inside)e(a)h FM(minipage)d FQ(en)m(vi-)630 1195 y(ronmen)m(t.)52
+b(This)33 b(section)i(describ)s(es)e(ho)m(w)h(placing)h(the)f(graphics)
+g(command)g(and)f FM(\\caption)630 1308 y FQ(command)28
+b(in)f(separate)i FM(minipage)d FQ(en)m(vironmen)m(ts)j(can)f(pro)m
+(vide)g(b)s(etter)g(v)m(ertical)i(alignmen)m(t.)771 1400
+y(The)36 b FM([t])g FQ(options)h(for)f(the)h(side-b)m(y-side)g
+(minipages)g(in)g(Figures)p 0.05 1.00 1.00 0.40 TeXcolorcmyk
+37 w(63)p Black 37 w(and)p 0.05 1.00 1.00 0.40 TeXcolorcmyk
+36 w(64)p Black 38 w(cause)g(the)630 1491 y(graphic)g(baselines)f(to)i
+(b)s(e)d(aligned)j(\(see)f(Section)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 37 w(11.4)p Black 38 w(on)f(page)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 38 w(36)p Black(\).)60 b(This)35 b(w)m(orks)i(w)m(ell)g
+(for)630 1582 y(non-rotated)f(graphics)g(as)f(it)h(causes)g(the)g(tops)
+f(of)h(the)g(captions)g(to)g(b)s(e)f(aligned.)57 b(Ho)m(w)m(ev)m(er,)
+630 1674 y(this)30 b(do)s(es)g(not)h(w)m(ork)f(w)m(ell)i(when)d(the)i
+(graphics)f(b)s(ottoms)h(are)f(not)h(aligned.)41 b(F)-8
+b(or)32 b(example,)p Black Black 708 1806 a FE(\\begin{figure})826
+1898 y(\\centering)826 1989 y(\045\045----start)42 b(of)e(first)g
+(figure----)826 2080 y(\\begin{minipage}[t]{.4\\linew)q(idth})944
+2172 y(\\centering)944 2263 y(\\includegraphics[width=2cm]{gr)q(aphi)q
+(c})944 2354 y(\\caption{Box)i(with)e(a)f(Long)i(Caption})826
+2446 y(\\end{minipage}\045)826 2537 y(\\hspace{1cm}\045)826
+2628 y(\045\045----start)h(of)e(second)g(figure----)826
+2720 y(\\begin{minipage}[t]{.4\\linew)q(idth})944 2811
+y(\\centering)944 2902 y(\\includegraphics[width=2cm,ang)q(le=-)q
+(30]{g)q(raph)q(ic})944 2994 y(\\caption{Rotated)j(Box})826
+3085 y(\\end{minipage}\045)708 3176 y(\\end{figure})630
+3331 y FQ(pro)s(duces)f(Figures)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 44 w(67)p Black 44 w(and)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 42 w(68)p Black 44 w(whic)m(h)h(do)h(not)f(ha)m(v)m(e)i
+(their)e(captions)h(aligned.)80 b(The)43 b FM([b])630
+3444 y FQ(minipage)35 b(options)g(w)m(ould)f(not)h(completely)i(solv)m
+(e)f(the)e(problem,)i(as)f(it)g(causes)g(the)g(b)s(ottom)630
+3557 y(lines)c(of)f(the)h(caption)g(to)g(b)s(e)f(aligned.)p
+Black 1275 3851 a @beginspecial 0 @llx 0 @lly 144 @urx
+54 @ury 566 @rwi @setspecial
+%%BeginDocument: graphic.eps
+%!PS-Adobe-2.0 EPSF-2.0
+%%Title: graphic.eps
+%%Creator: fig2dev Version 3.2 Patchlevel 0-beta2
+%%CreationDate: Thu Dec 11 20:58:11 1997
+%%For: Keith Reckdahl
+%%Orientation: Portrait
+%%BoundingBox: 0 0 144 54
+%%Pages: 0
+%%BeginSetup
+%%IncludeFeature: *PageSize Letter
+%%EndSetup
+%%Magnification: 1.00
+%%EndComments
+/$F2psDict 200 dict def
+$F2psDict begin
+$F2psDict /mtrx matrix put
+/col-1 {0 setgray} bind def
+/col0 {0.000 0.000 0.000 srgb} bind def
+/col1 {0.000 0.000 1.000 srgb} bind def
+/col2 {0.000 1.000 0.000 srgb} bind def
+/col3 {0.000 1.000 1.000 srgb} bind def
+/col4 {1.000 0.000 0.000 srgb} bind def
+/col5 {1.000 0.000 1.000 srgb} bind def
+/col6 {1.000 1.000 0.000 srgb} bind def
+/col7 {1.000 1.000 1.000 srgb} bind def
+/col8 {0.000 0.000 0.560 srgb} bind def
+/col9 {0.000 0.000 0.690 srgb} bind def
+/col10 {0.000 0.000 0.820 srgb} bind def
+/col11 {0.530 0.810 1.000 srgb} bind def
+/col12 {0.000 0.560 0.000 srgb} bind def
+/col13 {0.000 0.690 0.000 srgb} bind def
+/col14 {0.000 0.820 0.000 srgb} bind def
+/col15 {0.000 0.560 0.560 srgb} bind def
+/col16 {0.000 0.690 0.690 srgb} bind def
+/col17 {0.000 0.820 0.820 srgb} bind def
+/col18 {0.560 0.000 0.000 srgb} bind def
+/col19 {0.690 0.000 0.000 srgb} bind def
+/col20 {0.820 0.000 0.000 srgb} bind def
+/col21 {0.560 0.000 0.560 srgb} bind def
+/col22 {0.690 0.000 0.690 srgb} bind def
+/col23 {0.820 0.000 0.820 srgb} bind def
+/col24 {0.500 0.190 0.000 srgb} bind def
+/col25 {0.630 0.250 0.000 srgb} bind def
+/col26 {0.750 0.380 0.000 srgb} bind def
+/col27 {1.000 0.500 0.500 srgb} bind def
+/col28 {1.000 0.630 0.630 srgb} bind def
+/col29 {1.000 0.750 0.750 srgb} bind def
+/col30 {1.000 0.880 0.880 srgb} bind def
+/col31 {1.000 0.840 0.000 srgb} bind def
+
+end
+save
+-2.0 61.0 translate
+1 -1 scale
+
+/cp {closepath} bind def
+/ef {eofill} bind def
+/gr {grestore} bind def
+/gs {gsave} bind def
+/sa {save} bind def
+/rs {restore} bind def
+/l {lineto} bind def
+/m {moveto} bind def
+/rm {rmoveto} bind def
+/n {newpath} bind def
+/s {stroke} bind def
+/sh {show} bind def
+/slc {setlinecap} bind def
+/slj {setlinejoin} bind def
+/slw {setlinewidth} bind def
+/srgb {setrgbcolor} bind def
+/rot {rotate} bind def
+/sc {scale} bind def
+/sd {setdash} bind def
+/ff {findfont} bind def
+/sf {setfont} bind def
+/scf {scalefont} bind def
+/sw {stringwidth} bind def
+/tr {translate} bind def
+/tnt {dup dup currentrgbcolor
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb}
+ bind def
+/shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul
+ 4 -2 roll mul srgb} bind def
+/$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def
+/$F2psEnd {$F2psEnteredState restore end} def
+%%EndProlog
+
+$F2psBegin
+10 setmiterlimit
+n 0 1048 m 0 0 l 2473 0 l 2473 1048 l cp clip
+ 0.06000 0.06000 sc
+% Polyline
+30.000 slw
+n 2400 975 m 75 975 l 75 150 l 2400 150 l cp gs col-1 s gr
+/Times-Bold ff 360.00 scf sf
+1220 705 m
+gs 1 -1 sc (Graphic) dup sw pop 2 div neg 0 rm col-1 sh gr
+$F2psEnd
+rs
+
+%%EndDocument
+ @endspecial 845 4021 a(Figure)h(67:)p 0 TeXcolorgray
+Black 41 w(Bo)m(x)h(with)e(a)h(Long)f(Cap-)845 4134 y(tion)2830
+3851 y
+ gsave currentpoint currentpoint translate -30 neg rotate neg exch
+neg exch translate
+ 2830 3851 a @beginspecial 0 @llx 0 @lly 144 @urx
+54 @ury 566 @rwi @setspecial
+%%BeginDocument: graphic.eps
+%!PS-Adobe-2.0 EPSF-2.0
+%%Title: graphic.eps
+%%Creator: fig2dev Version 3.2 Patchlevel 0-beta2
+%%CreationDate: Thu Dec 11 20:58:11 1997
+%%For: Keith Reckdahl
+%%Orientation: Portrait
+%%BoundingBox: 0 0 144 54
+%%Pages: 0
+%%BeginSetup
+%%IncludeFeature: *PageSize Letter
+%%EndSetup
+%%Magnification: 1.00
+%%EndComments
+/$F2psDict 200 dict def
+$F2psDict begin
+$F2psDict /mtrx matrix put
+/col-1 {0 setgray} bind def
+/col0 {0.000 0.000 0.000 srgb} bind def
+/col1 {0.000 0.000 1.000 srgb} bind def
+/col2 {0.000 1.000 0.000 srgb} bind def
+/col3 {0.000 1.000 1.000 srgb} bind def
+/col4 {1.000 0.000 0.000 srgb} bind def
+/col5 {1.000 0.000 1.000 srgb} bind def
+/col6 {1.000 1.000 0.000 srgb} bind def
+/col7 {1.000 1.000 1.000 srgb} bind def
+/col8 {0.000 0.000 0.560 srgb} bind def
+/col9 {0.000 0.000 0.690 srgb} bind def
+/col10 {0.000 0.000 0.820 srgb} bind def
+/col11 {0.530 0.810 1.000 srgb} bind def
+/col12 {0.000 0.560 0.000 srgb} bind def
+/col13 {0.000 0.690 0.000 srgb} bind def
+/col14 {0.000 0.820 0.000 srgb} bind def
+/col15 {0.000 0.560 0.560 srgb} bind def
+/col16 {0.000 0.690 0.690 srgb} bind def
+/col17 {0.000 0.820 0.820 srgb} bind def
+/col18 {0.560 0.000 0.000 srgb} bind def
+/col19 {0.690 0.000 0.000 srgb} bind def
+/col20 {0.820 0.000 0.000 srgb} bind def
+/col21 {0.560 0.000 0.560 srgb} bind def
+/col22 {0.690 0.000 0.690 srgb} bind def
+/col23 {0.820 0.000 0.820 srgb} bind def
+/col24 {0.500 0.190 0.000 srgb} bind def
+/col25 {0.630 0.250 0.000 srgb} bind def
+/col26 {0.750 0.380 0.000 srgb} bind def
+/col27 {1.000 0.500 0.500 srgb} bind def
+/col28 {1.000 0.630 0.630 srgb} bind def
+/col29 {1.000 0.750 0.750 srgb} bind def
+/col30 {1.000 0.880 0.880 srgb} bind def
+/col31 {1.000 0.840 0.000 srgb} bind def
+
+end
+save
+-2.0 61.0 translate
+1 -1 scale
+
+/cp {closepath} bind def
+/ef {eofill} bind def
+/gr {grestore} bind def
+/gs {gsave} bind def
+/sa {save} bind def
+/rs {restore} bind def
+/l {lineto} bind def
+/m {moveto} bind def
+/rm {rmoveto} bind def
+/n {newpath} bind def
+/s {stroke} bind def
+/sh {show} bind def
+/slc {setlinecap} bind def
+/slj {setlinejoin} bind def
+/slw {setlinewidth} bind def
+/srgb {setrgbcolor} bind def
+/rot {rotate} bind def
+/sc {scale} bind def
+/sd {setdash} bind def
+/ff {findfont} bind def
+/sf {setfont} bind def
+/scf {scalefont} bind def
+/sw {stringwidth} bind def
+/tr {translate} bind def
+/tnt {dup dup currentrgbcolor
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb}
+ bind def
+/shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul
+ 4 -2 roll mul srgb} bind def
+/$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def
+/$F2psEnd {$F2psEnteredState restore end} def
+%%EndProlog
+
+$F2psBegin
+10 setmiterlimit
+n 0 1048 m 0 0 l 2473 0 l 2473 1048 l cp clip
+ 0.06000 0.06000 sc
+% Polyline
+30.000 slw
+n 2400 975 m 75 975 l 75 150 l 2400 150 l cp gs col-1 s gr
+/Times-Bold ff 360.00 scf sf
+1220 705 m
+gs 1 -1 sc (Graphic) dup sw pop 2 div neg 0 rm col-1 sh gr
+$F2psEnd
+rs
+
+%%EndDocument
+ @endspecial 3303 3851 a
+ currentpoint grestore moveto
+ 3303 3851 a 2605 4258 a FQ(Figure)h(68:)p
+0 TeXcolorgray Black 41 w(Rotated)h(Bo)m(x)p Black 771
+4465 a(The)21 b(alignmen)m(t)i(of)e(the)h(graphics)f(and)g(the)h
+(captions)g(can)g(b)s(e)e(done)i(separately)g(b)m(y)g(creating)630
+4556 y(t)m(w)m(o)47 b(ro)m(ws)e(of)g(minipages:)71 b(the)45
+b(\014rst)g(ro)m(w)g(con)m(taining)i(the)e(\014gures)g(and)f(the)i
+(second)f(ro)m(w)630 4647 y(con)m(taining)32 b(the)e(captions.)42
+b(F)-8 b(or)31 b(example)p Black Black 708 4780 a FE(\\begin{figure})
+826 4872 y(\\centering)826 4963 y(\045\045----start)42
+b(of)e(first)g(figure)h(graphics----)826 5054 y
+(\\begin{minipage}[b]{.4\\linew)q(idth})944 5146 y(\\centering)944
+5237 y(\\includegraphics[width=2cm]{gr)q(aphi)q(c})826
+5328 y(\\end{minipage}\045)826 5420 y(\\hspace{1cm}\045)p
+Black 2227 5640 a FQ(108)p Black eop end
+%%Page: 109 109
+TeXDict begin 109 108 bop Black 0 TeXcolorgray Black
+Black 826 -149 a FE(\045\045----start)42 b(of)e(second)g(figure)h
+(graphics----)826 -57 y(\\begin{minipage}[b]{.4\\linew)q(idth})944
+34 y(\\centering)944 125 y(\\includegraphics[width=2cm,ang)q(le=-)q
+(30]{g)q(raph)q(ic})826 217 y(\\end{minipage}\\\\[-10pt])826
+308 y(\045\045----start)h(of)e(first)g(figure)h(caption----)826
+399 y(\\begin{minipage}[t]{.4\\linew)q(idth})944 491
+y(\\caption{Box)h(with)e(a)f(Long)i(Caption})826 582
+y(\\end{minipage}\045)826 673 y(\\hspace{1cm}\045)826
+765 y(\045\045----start)h(of)e(second)g(figure)h(caption----)826
+856 y(\\begin{minipage}[t]{.4\\linew)q(idth})944 947
+y(\\caption{Rotated)i(Box})826 1039 y(\\end{minipage}\045)708
+1130 y(\\end{figure})630 1282 y FQ(pro)s(duces)22 b(Figures)p
+0.05 1.00 1.00 0.40 TeXcolorcmyk 24 w(69)p Black 24
+w(and)p 0.05 1.00 1.00 0.40 TeXcolorcmyk 23 w(70)p
+Black(,)k(whic)m(h)d(ha)m(v)m(e)i(the)f(graphic)f(baselines)h(aligned)h
+(and)d(the)i(caption)630 1394 y(top)31 b(lines)f(aligned.)p
+Black 1275 1688 a @beginspecial 0 @llx 0 @lly 144 @urx
+54 @ury 566 @rwi @setspecial
+%%BeginDocument: graphic.eps
+%!PS-Adobe-2.0 EPSF-2.0
+%%Title: graphic.eps
+%%Creator: fig2dev Version 3.2 Patchlevel 0-beta2
+%%CreationDate: Thu Dec 11 20:58:11 1997
+%%For: Keith Reckdahl
+%%Orientation: Portrait
+%%BoundingBox: 0 0 144 54
+%%Pages: 0
+%%BeginSetup
+%%IncludeFeature: *PageSize Letter
+%%EndSetup
+%%Magnification: 1.00
+%%EndComments
+/$F2psDict 200 dict def
+$F2psDict begin
+$F2psDict /mtrx matrix put
+/col-1 {0 setgray} bind def
+/col0 {0.000 0.000 0.000 srgb} bind def
+/col1 {0.000 0.000 1.000 srgb} bind def
+/col2 {0.000 1.000 0.000 srgb} bind def
+/col3 {0.000 1.000 1.000 srgb} bind def
+/col4 {1.000 0.000 0.000 srgb} bind def
+/col5 {1.000 0.000 1.000 srgb} bind def
+/col6 {1.000 1.000 0.000 srgb} bind def
+/col7 {1.000 1.000 1.000 srgb} bind def
+/col8 {0.000 0.000 0.560 srgb} bind def
+/col9 {0.000 0.000 0.690 srgb} bind def
+/col10 {0.000 0.000 0.820 srgb} bind def
+/col11 {0.530 0.810 1.000 srgb} bind def
+/col12 {0.000 0.560 0.000 srgb} bind def
+/col13 {0.000 0.690 0.000 srgb} bind def
+/col14 {0.000 0.820 0.000 srgb} bind def
+/col15 {0.000 0.560 0.560 srgb} bind def
+/col16 {0.000 0.690 0.690 srgb} bind def
+/col17 {0.000 0.820 0.820 srgb} bind def
+/col18 {0.560 0.000 0.000 srgb} bind def
+/col19 {0.690 0.000 0.000 srgb} bind def
+/col20 {0.820 0.000 0.000 srgb} bind def
+/col21 {0.560 0.000 0.560 srgb} bind def
+/col22 {0.690 0.000 0.690 srgb} bind def
+/col23 {0.820 0.000 0.820 srgb} bind def
+/col24 {0.500 0.190 0.000 srgb} bind def
+/col25 {0.630 0.250 0.000 srgb} bind def
+/col26 {0.750 0.380 0.000 srgb} bind def
+/col27 {1.000 0.500 0.500 srgb} bind def
+/col28 {1.000 0.630 0.630 srgb} bind def
+/col29 {1.000 0.750 0.750 srgb} bind def
+/col30 {1.000 0.880 0.880 srgb} bind def
+/col31 {1.000 0.840 0.000 srgb} bind def
+
+end
+save
+-2.0 61.0 translate
+1 -1 scale
+
+/cp {closepath} bind def
+/ef {eofill} bind def
+/gr {grestore} bind def
+/gs {gsave} bind def
+/sa {save} bind def
+/rs {restore} bind def
+/l {lineto} bind def
+/m {moveto} bind def
+/rm {rmoveto} bind def
+/n {newpath} bind def
+/s {stroke} bind def
+/sh {show} bind def
+/slc {setlinecap} bind def
+/slj {setlinejoin} bind def
+/slw {setlinewidth} bind def
+/srgb {setrgbcolor} bind def
+/rot {rotate} bind def
+/sc {scale} bind def
+/sd {setdash} bind def
+/ff {findfont} bind def
+/sf {setfont} bind def
+/scf {scalefont} bind def
+/sw {stringwidth} bind def
+/tr {translate} bind def
+/tnt {dup dup currentrgbcolor
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb}
+ bind def
+/shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul
+ 4 -2 roll mul srgb} bind def
+/$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def
+/$F2psEnd {$F2psEnteredState restore end} def
+%%EndProlog
+
+$F2psBegin
+10 setmiterlimit
+n 0 1048 m 0 0 l 2473 0 l 2473 1048 l cp clip
+ 0.06000 0.06000 sc
+% Polyline
+30.000 slw
+n 2400 975 m 75 975 l 75 150 l 2400 150 l cp gs col-1 s gr
+/Times-Bold ff 360.00 scf sf
+1220 705 m
+gs 1 -1 sc (Graphic) dup sw pop 2 div neg 0 rm col-1 sh gr
+$F2psEnd
+rs
+
+%%EndDocument
+ @endspecial 2830 1688 a
+ gsave currentpoint currentpoint translate -30 neg rotate neg exch
+neg exch translate
+ 2830 1688 a @beginspecial 0
+@llx 0 @lly 144 @urx 54 @ury 566 @rwi @setspecial
+%%BeginDocument: graphic.eps
+%!PS-Adobe-2.0 EPSF-2.0
+%%Title: graphic.eps
+%%Creator: fig2dev Version 3.2 Patchlevel 0-beta2
+%%CreationDate: Thu Dec 11 20:58:11 1997
+%%For: Keith Reckdahl
+%%Orientation: Portrait
+%%BoundingBox: 0 0 144 54
+%%Pages: 0
+%%BeginSetup
+%%IncludeFeature: *PageSize Letter
+%%EndSetup
+%%Magnification: 1.00
+%%EndComments
+/$F2psDict 200 dict def
+$F2psDict begin
+$F2psDict /mtrx matrix put
+/col-1 {0 setgray} bind def
+/col0 {0.000 0.000 0.000 srgb} bind def
+/col1 {0.000 0.000 1.000 srgb} bind def
+/col2 {0.000 1.000 0.000 srgb} bind def
+/col3 {0.000 1.000 1.000 srgb} bind def
+/col4 {1.000 0.000 0.000 srgb} bind def
+/col5 {1.000 0.000 1.000 srgb} bind def
+/col6 {1.000 1.000 0.000 srgb} bind def
+/col7 {1.000 1.000 1.000 srgb} bind def
+/col8 {0.000 0.000 0.560 srgb} bind def
+/col9 {0.000 0.000 0.690 srgb} bind def
+/col10 {0.000 0.000 0.820 srgb} bind def
+/col11 {0.530 0.810 1.000 srgb} bind def
+/col12 {0.000 0.560 0.000 srgb} bind def
+/col13 {0.000 0.690 0.000 srgb} bind def
+/col14 {0.000 0.820 0.000 srgb} bind def
+/col15 {0.000 0.560 0.560 srgb} bind def
+/col16 {0.000 0.690 0.690 srgb} bind def
+/col17 {0.000 0.820 0.820 srgb} bind def
+/col18 {0.560 0.000 0.000 srgb} bind def
+/col19 {0.690 0.000 0.000 srgb} bind def
+/col20 {0.820 0.000 0.000 srgb} bind def
+/col21 {0.560 0.000 0.560 srgb} bind def
+/col22 {0.690 0.000 0.690 srgb} bind def
+/col23 {0.820 0.000 0.820 srgb} bind def
+/col24 {0.500 0.190 0.000 srgb} bind def
+/col25 {0.630 0.250 0.000 srgb} bind def
+/col26 {0.750 0.380 0.000 srgb} bind def
+/col27 {1.000 0.500 0.500 srgb} bind def
+/col28 {1.000 0.630 0.630 srgb} bind def
+/col29 {1.000 0.750 0.750 srgb} bind def
+/col30 {1.000 0.880 0.880 srgb} bind def
+/col31 {1.000 0.840 0.000 srgb} bind def
+
+end
+save
+-2.0 61.0 translate
+1 -1 scale
+
+/cp {closepath} bind def
+/ef {eofill} bind def
+/gr {grestore} bind def
+/gs {gsave} bind def
+/sa {save} bind def
+/rs {restore} bind def
+/l {lineto} bind def
+/m {moveto} bind def
+/rm {rmoveto} bind def
+/n {newpath} bind def
+/s {stroke} bind def
+/sh {show} bind def
+/slc {setlinecap} bind def
+/slj {setlinejoin} bind def
+/slw {setlinewidth} bind def
+/srgb {setrgbcolor} bind def
+/rot {rotate} bind def
+/sc {scale} bind def
+/sd {setdash} bind def
+/ff {findfont} bind def
+/sf {setfont} bind def
+/scf {scalefont} bind def
+/sw {stringwidth} bind def
+/tr {translate} bind def
+/tnt {dup dup currentrgbcolor
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb}
+ bind def
+/shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul
+ 4 -2 roll mul srgb} bind def
+/$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def
+/$F2psEnd {$F2psEnteredState restore end} def
+%%EndProlog
+
+$F2psBegin
+10 setmiterlimit
+n 0 1048 m 0 0 l 2473 0 l 2473 1048 l cp clip
+ 0.06000 0.06000 sc
+% Polyline
+30.000 slw
+n 2400 975 m 75 975 l 75 150 l 2400 150 l cp gs col-1 s gr
+/Times-Bold ff 360.00 scf sf
+1220 705 m
+gs 1 -1 sc (Graphic) dup sw pop 2 div neg 0 rm col-1 sh gr
+$F2psEnd
+rs
+
+%%EndDocument
+ @endspecial 3303 1688 a
+ currentpoint grestore moveto
+ 3303 1688 a 845 2011 a FQ(Figure)h(69:)p
+0 TeXcolorgray Black 41 w(Bo)m(x)h(with)e(a)h(Long)f(Cap-)845
+2124 y(tion)2605 2011 y(Figure)h(70:)p 0 TeXcolorgray
+Black 41 w(Rotated)h(Bo)m(x)p Black 630 2435 a(Notes)g(on)e(this)g
+(example)p Black 767 2578 a FK(\210)p Black 45 w FQ(The)25
+b FM(\\\\)g FQ(breaks)g(the)g(line)h(after)f(the)h(last)g(\014gure.)38
+b(The)25 b FM(\\\\)g FQ(optional)h(argumen)m(t)g FM([-10pt])857
+2691 y FQ(mo)m(v)m(es)d(the)e(captions)h(closer)g(to)g(the)g(graphics)f
+(b)m(y)g(remo)m(ving)h(10)g(p)s(oin)m(ts)g(of)f(v)m(ertical)i(space)857
+2804 y(at)31 b(the)g(linebreak.)41 b(This)30 b(length)g(should)g(b)s(e)
+f(c)m(hanged)i(as)g(the)g(user)e(see)i(\014t.)p Black
+767 2953 a FK(\210)p Black 45 w FQ(The)c(graphic)g(minipages)g(ha)m(v)m
+(e)h(a)f FM([b])f FQ(option)i(to)f(mak)m(e)h(their)f(reference)h(p)s
+(oin)m(ts)e(b)s(e)h(the)857 3066 y(baseline)k(of)g(the)f(minipage's)h
+(b)s(ottom)g(line.)p Black 767 3216 a FK(\210)p Black
+45 w FQ(The)c(caption)g(minipages)h(ha)m(v)m(e)g(a)f
+FM([t])f FQ(option)i(to)f(mak)m(e)h(their)f(reference)h(p)s(oin)m(ts)e
+(b)s(e)h(the)857 3329 y(baseline)k(of)g(the)f(minipage's)h(top)g(line)g
+(\(to)g(v)m(ertically-align)j(the)d(captions')g(top)g(lines\).)p
+Black 767 3479 a FK(\210)p Black 45 w FQ(An)m(y)25 b
+FM(\\label)c FQ(commands)i(m)m(ust)g(b)s(e)f(issued)g(in)h(the)g(same)h
+(minipage)f(as)h(the)f(corresp)s(ond-)857 3591 y(ing)32
+b FM(\\caption)c FQ(command.)630 3877 y FD(30)135 b(Placing)46
+b(a)f(T)-11 b(able)45 b(Beside)g(a)g(Figure)630 4080
+y FQ(In)c(Section)p 0.05 1.00 1.00 0.40 TeXcolorcmyk
+42 w(28)p Black 42 w(on)g(page)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 42 w(104)p Black(,)46 b(side-b)m(y-side)c(\014gures)f(are)
+g(constructed)h(b)m(y)f(using)g(m)m(ultiple)630 4193
+y FM(\\caption)23 b FQ(commands)i(in)h(a)g(single)g(\014gure)f(en)m
+(vironmen)m(t.)39 b(Lik)m(ewise,)28 b(side-b)m(y-side)e(tables)h(are)
+630 4306 y(created)k(b)m(y)g(using)f(m)m(ultiple)h FM(\\caption)d
+FQ(commands)i(in)g(a)h(single)g(table)g(en)m(vironmen)m(t.)771
+4397 y(The)f FM(\\captionof)d FQ(commands)j(describ)s(ed)f(in)h
+(Section)p 0.05 1.00 1.00 0.40 TeXcolorcmyk 31 w(21)p
+Black 31 w(on)g(page)p 0.05 1.00 1.00 0.40 TeXcolorcmyk
+31 w(87)p Black 31 w(mak)m(e)h(it)f(p)s(ossible)630 4489
+y(to)h(put)f(a)h(table)g(b)s(eside)f(a)g(\014gure.)40
+b(F)-8 b(or)32 b(example,)f(the)f(follo)m(wing)i(commands)p
+Black Black 708 4619 a FE(\\begin{figure}[htb])826 4710
+y(\\begin{minipage}[b]{0.5\\line)q(width)q(})944 4801
+y(\\centering)944 4893 y(\\includegraphics[width=0.8\\lin)q(ewid)q
+(th]{g)q(raph)q(ic})944 4984 y(\\caption{This)42 b(is)e(a)f(Figure)i
+(by)e(a)h(Table})944 5075 y(\\label{fig:by:table})826
+5167 y(\\end{minipage}\045)826 5258 y(\\begin{minipage}[b]{0.5\\line)q
+(width)q(})944 5349 y(\\centering)944 5441 y(\\begin{tabular}{|c|c|})k
+(\\hline)p Black 2227 5640 a FQ(109)p Black eop end
+%%Page: 110 110
+TeXDict begin 110 109 bop Black 0 TeXcolorgray Black
+Black 1062 -149 a FE(Day)39 b(&)79 b(Data)40 b(\\\\)g(\\hline\\hline)
+1062 -57 y(Monday)158 b(&)39 b(14.6)h(\\\\)1062 34 y(Tuesday)119
+b(&)39 b(14.3)h(\\\\)1062 125 y(Wednesday)h(&)e(14.2)h(\\\\)1062
+217 y(Thursday)80 b(&)39 b(14.5)h(\\\\)1062 308 y(Friday)158
+b(&)39 b(14.9)h(\\\\)g(\\hline)944 399 y(\\end{tabular})944
+491 y(\\captionof{table}{This)k(is)c(a)f(Table)i(by)e(a)h(Figure})944
+582 y(\\label{table:by:fig})826 673 y(\\end{minipage})708
+765 y(\\end{figure})630 919 y FQ(use)30 b(a)h(\014gure)f(en)m(vironmen)
+m(t)h(to)g(create)h(Figure)p 0.05 1.00 1.00 0.40 TeXcolorcmyk
+30 w(71)p Black 32 w(and)d(T)-8 b(able)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 31 w(23)p Black(.)p Black 796 1718 a @beginspecial
+0 @llx 0 @lly 144 @urx 54 @ury 1598 @rwi @setspecial
+%%BeginDocument: graphic.eps
+%!PS-Adobe-2.0 EPSF-2.0
+%%Title: graphic.eps
+%%Creator: fig2dev Version 3.2 Patchlevel 0-beta2
+%%CreationDate: Thu Dec 11 20:58:11 1997
+%%For: Keith Reckdahl
+%%Orientation: Portrait
+%%BoundingBox: 0 0 144 54
+%%Pages: 0
+%%BeginSetup
+%%IncludeFeature: *PageSize Letter
+%%EndSetup
+%%Magnification: 1.00
+%%EndComments
+/$F2psDict 200 dict def
+$F2psDict begin
+$F2psDict /mtrx matrix put
+/col-1 {0 setgray} bind def
+/col0 {0.000 0.000 0.000 srgb} bind def
+/col1 {0.000 0.000 1.000 srgb} bind def
+/col2 {0.000 1.000 0.000 srgb} bind def
+/col3 {0.000 1.000 1.000 srgb} bind def
+/col4 {1.000 0.000 0.000 srgb} bind def
+/col5 {1.000 0.000 1.000 srgb} bind def
+/col6 {1.000 1.000 0.000 srgb} bind def
+/col7 {1.000 1.000 1.000 srgb} bind def
+/col8 {0.000 0.000 0.560 srgb} bind def
+/col9 {0.000 0.000 0.690 srgb} bind def
+/col10 {0.000 0.000 0.820 srgb} bind def
+/col11 {0.530 0.810 1.000 srgb} bind def
+/col12 {0.000 0.560 0.000 srgb} bind def
+/col13 {0.000 0.690 0.000 srgb} bind def
+/col14 {0.000 0.820 0.000 srgb} bind def
+/col15 {0.000 0.560 0.560 srgb} bind def
+/col16 {0.000 0.690 0.690 srgb} bind def
+/col17 {0.000 0.820 0.820 srgb} bind def
+/col18 {0.560 0.000 0.000 srgb} bind def
+/col19 {0.690 0.000 0.000 srgb} bind def
+/col20 {0.820 0.000 0.000 srgb} bind def
+/col21 {0.560 0.000 0.560 srgb} bind def
+/col22 {0.690 0.000 0.690 srgb} bind def
+/col23 {0.820 0.000 0.820 srgb} bind def
+/col24 {0.500 0.190 0.000 srgb} bind def
+/col25 {0.630 0.250 0.000 srgb} bind def
+/col26 {0.750 0.380 0.000 srgb} bind def
+/col27 {1.000 0.500 0.500 srgb} bind def
+/col28 {1.000 0.630 0.630 srgb} bind def
+/col29 {1.000 0.750 0.750 srgb} bind def
+/col30 {1.000 0.880 0.880 srgb} bind def
+/col31 {1.000 0.840 0.000 srgb} bind def
+
+end
+save
+-2.0 61.0 translate
+1 -1 scale
+
+/cp {closepath} bind def
+/ef {eofill} bind def
+/gr {grestore} bind def
+/gs {gsave} bind def
+/sa {save} bind def
+/rs {restore} bind def
+/l {lineto} bind def
+/m {moveto} bind def
+/rm {rmoveto} bind def
+/n {newpath} bind def
+/s {stroke} bind def
+/sh {show} bind def
+/slc {setlinecap} bind def
+/slj {setlinejoin} bind def
+/slw {setlinewidth} bind def
+/srgb {setrgbcolor} bind def
+/rot {rotate} bind def
+/sc {scale} bind def
+/sd {setdash} bind def
+/ff {findfont} bind def
+/sf {setfont} bind def
+/scf {scalefont} bind def
+/sw {stringwidth} bind def
+/tr {translate} bind def
+/tnt {dup dup currentrgbcolor
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb}
+ bind def
+/shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul
+ 4 -2 roll mul srgb} bind def
+/$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def
+/$F2psEnd {$F2psEnteredState restore end} def
+%%EndProlog
+
+$F2psBegin
+10 setmiterlimit
+n 0 1048 m 0 0 l 2473 0 l 2473 1048 l cp clip
+ 0.06000 0.06000 sc
+% Polyline
+30.000 slw
+n 2400 975 m 75 975 l 75 150 l 2400 150 l cp gs col-1 s gr
+/Times-Bold ff 360.00 scf sf
+1220 705 m
+gs 1 -1 sc (Graphic) dup sw pop 2 div neg 0 rm col-1 sh gr
+$F2psEnd
+rs
+
+%%EndDocument
+ @endspecial 699 1914 a(Figure)31 b(71:)p 0 TeXcolorgray
+Black 42 w(This)e(is)i(a)f(Figure)h(b)m(y)f(a)h(T)-8
+b(able)p 2703 1040 850 4 v 2703 1153 4 113 v 2898 1119
+a(Da)m(y)p 3250 1153 V 247 w(Data)p 3549 1153 V 2703
+1156 850 4 v 2703 1176 V 2703 1289 4 113 v 2818 1255
+a(Monda)m(y)p 3250 1289 V 183 w(14.6)p 3549 1289 V 2703
+1402 V 2815 1368 a(T)g(uesda)m(y)p 3250 1402 V 180 w(14.3)p
+3549 1402 V 2703 1515 V 2756 1481 a(W)g(ednesda)m(y)p
+3250 1515 V 121 w(14.2)p 3549 1515 V 2703 1627 V 2790
+1594 a(Th)m(ursda)m(y)p 3250 1627 V 153 w(14.5)p 3549
+1627 V 2703 1740 V 2851 1706 a(F)g(rida)m(y)p 3250 1740
+V 217 w(14.9)p 3549 1740 V 2703 1744 850 4 v 2383 1914
+a(T)g(able)31 b(23:)p 0 TeXcolorgray Black 41 w(This)f(is)g(a)h(T)-8
+b(able)31 b(b)m(y)f(a)h(Figure)p Black 630 2129 a(Since)f(L)891
+2113 y FP(A)930 2129 y FQ(T)981 2149 y(E)1032 2129 y(X)g(allo)m(ws)i
+(\014gure)e(\015oats)h(to)g(leapfrog)g(table)g(\015oats,)g(using)p
+Black Black 1153 2271 a FN(\\captionof{table)o(}{.)o(..)o(})630
+2412 y FQ(in)h(a)g(\014gure)g(en)m(vironmen)m(t)h(ma)m(y)g(place)g(the)
+f(table)h(ahead)g(of)f(unpro)s(cessed)f(tables.)47 b(Lik)m(ewise,)630
+2511 y(using)p Black Black 1153 2652 a FN(\\captionof{figur)o(e}{)o(..)
+o(.})630 2807 y FQ(in)38 b(a)h(table)h(en)m(vironmen)m(t)f(ma)m(y)g
+(place)g(the)g(\014gure)f(ahead)h(of)f(unpro)s(cessed)f(\014gures.)65
+b(If)38 b(this)630 2920 y(is)h(ob)5 b(jectionable,)42
+b(it)d(can)g(b)s(e)f(prev)m(en)m(ted)h(b)m(y)g(putting)f(a)h
+FM(\\FloatBarrier)c FQ(or)k FM(\\clearpage)630 3033 y
+FQ(command)30 b(b)s(efore)g(the)h(\014gure)e(en)m(vironmen)m(t)i(\(see)
+h(Section)p 0.05 1.00 1.00 0.40 TeXcolorcmyk 31 w(17.3)p
+Black 32 w(on)e(page)p 0.05 1.00 1.00 0.40 TeXcolorcmyk
+31 w(59)p Black(\).)630 3319 y FD(31)135 b(Stac)l(k)l(ed)46
+b(Figures)f(and)f(Sub\014gures)630 3522 y FQ(Side-b)m(y-side)25
+b(\014gures)g(are)g(created)h(in)f(Section)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 26 w(28)p Black 25 w(on)g(page)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 26 w(104)p Black 26 w(b)m(y)g(a)h(v)-5 b(ariet)m(y)26
+b(metho)s(ds,)g(all)g(of)630 3635 y(whic)m(h)e(in)m(v)m(olv)m(e)i
+(placing)f(ob)5 b(jects)24 b(\(graphics,)i(minipages,)g(sub\015oats\))e
+(next)g(to)g(eac)m(h)i(other)e(on)g(a)630 3748 y(single)29
+b(line.)40 b(The)28 b(same)h(pro)s(cedure)e(pro)s(duces)f(stac)m(k)m
+(ed)31 b(graphics)d(when)f(the)h FM(\\\\)g FQ(command)g(is)630
+3861 y(used)d(to)i(explicitly)h(add)e(a)g(linebreak.)40
+b(The)25 b FM(\\\\)h FQ(command's)g(optional)h(argumen)m(t)g(can)f(sp)s
+(ecify)630 3974 y(additional)31 b(v)m(ertical)i(space,)e(suc)m(h)f(as)h
+FM(\\\\[20pt])p FQ(.)630 4217 y FB(31.1)112 b(Stac)m(k)m(ed)38
+b(Figures)630 4367 y FQ(Section)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 33 w(28)p Black 34 w(explained)33 b(ho)m(w)g(to)g
+(construct)g(side-b)m(y-side)g(\014gures.)47 b(This)32
+b(section)i(sho)m(ws)e(that)630 4459 y(adding)23 b(a)h(linebreak)g(pro)
+s(duces)e(m)m(ultiple)j(ro)m(ws)e(of)h(\014gures.)38
+b(F)-8 b(or)24 b(example,)i(the)e(follo)m(wing)h(co)s(de)p
+Black Black 865 4683 a FE(\\begin{figure}[htbp])983 4774
+y(\\centering)983 4865 y(\045\045----start)42 b(of)d(first)i
+(figure----)983 4957 y(\\begin{minipage}[t]{0.25\\line)q(widt)q(h})1101
+5048 y(\\centering)1101 5139 y(\\includegraphics[width=\\linewi)q
+(dth]{)q(grap)q(hic})1101 5231 y(\\caption{First)h(Stacked)f(Figure})
+1101 5322 y(\\label{fig:stacked:first})983 5413 y(\\end{minipage}\045)p
+Black 2227 5640 a FQ(110)p Black eop end
+%%Page: 111 111
+TeXDict begin 111 110 bop Black 0 TeXcolorgray Black
+Black 983 -149 a FE(\\hspace{1cm}\045)983 -57 y(\045\045----start)42
+b(of)d(second)i(figure----)983 34 y(\\begin{minipage}[t]{0.25\\line)q
+(widt)q(h})1101 125 y(\\centering)1101 217 y
+(\\includegraphics[width=\\linewi)q(dth]{)q(grap)q(hic})1101
+308 y(\\caption{Second)h(Stacked)f(Figure})1101 399 y
+(\\label{fig:stacked:second})983 491 y(\\end{minipage}\\\\[20pt])983
+582 y(\045\045----start)h(of)d(third)i(figure----)983
+673 y(\\begin{minipage}[t]{0.25\\line)q(widt)q(h})1101
+765 y(\\centering)1101 856 y(\\includegraphics[width=\\linewi)q(dth]{)q
+(grap)q(hic})1101 947 y(\\caption{Third)h(Stacked)f(Figure})1101
+1039 y(\\label{fig:stacked:third})983 1130 y(\\end{minipage}\045)983
+1221 y(\\hspace{1cm}\045)983 1313 y(\045\045----start)h(of)d(fourth)i
+(figure----)983 1404 y(\\begin{minipage}[t]{0.25\\line)q(widt)q(h})1101
+1495 y(\\centering)1101 1586 y(\\includegraphics[width=\\linewi)q
+(dth]{)q(grap)q(hic})1101 1678 y(\\caption{Fourth)h(Stacked)f(Figure})
+1101 1769 y(\\label{fig:stacked:fourth})983 1860 y(\\end{minipage}\045)
+983 1952 y(\\hspace{1cm}\045)983 2043 y(\045\045----start)h(of)d(fifth)
+i(figure----)983 2134 y(\\begin{minipage}[t]{0.25\\line)q(widt)q(h})
+1101 2226 y(\\centering)1101 2317 y(\\includegraphics[width=\\linewi)q
+(dth]{)q(grap)q(hic})1101 2408 y(\\caption{Fifth)h(Stacked)f(Figure})
+1101 2500 y(\\label{fig:stacked:fifth})983 2591 y(\\end{minipage}\045)
+865 2682 y(\\end{figure})630 2833 y FQ(pro)s(duces)29
+b(Figures)i(72-76.)p Black 1344 3261 a @beginspecial
+0 @llx 0 @lly 144 @urx 54 @ury 999 @rwi @setspecial
+%%BeginDocument: graphic.eps
+%!PS-Adobe-2.0 EPSF-2.0
+%%Title: graphic.eps
+%%Creator: fig2dev Version 3.2 Patchlevel 0-beta2
+%%CreationDate: Thu Dec 11 20:58:11 1997
+%%For: Keith Reckdahl
+%%Orientation: Portrait
+%%BoundingBox: 0 0 144 54
+%%Pages: 0
+%%BeginSetup
+%%IncludeFeature: *PageSize Letter
+%%EndSetup
+%%Magnification: 1.00
+%%EndComments
+/$F2psDict 200 dict def
+$F2psDict begin
+$F2psDict /mtrx matrix put
+/col-1 {0 setgray} bind def
+/col0 {0.000 0.000 0.000 srgb} bind def
+/col1 {0.000 0.000 1.000 srgb} bind def
+/col2 {0.000 1.000 0.000 srgb} bind def
+/col3 {0.000 1.000 1.000 srgb} bind def
+/col4 {1.000 0.000 0.000 srgb} bind def
+/col5 {1.000 0.000 1.000 srgb} bind def
+/col6 {1.000 1.000 0.000 srgb} bind def
+/col7 {1.000 1.000 1.000 srgb} bind def
+/col8 {0.000 0.000 0.560 srgb} bind def
+/col9 {0.000 0.000 0.690 srgb} bind def
+/col10 {0.000 0.000 0.820 srgb} bind def
+/col11 {0.530 0.810 1.000 srgb} bind def
+/col12 {0.000 0.560 0.000 srgb} bind def
+/col13 {0.000 0.690 0.000 srgb} bind def
+/col14 {0.000 0.820 0.000 srgb} bind def
+/col15 {0.000 0.560 0.560 srgb} bind def
+/col16 {0.000 0.690 0.690 srgb} bind def
+/col17 {0.000 0.820 0.820 srgb} bind def
+/col18 {0.560 0.000 0.000 srgb} bind def
+/col19 {0.690 0.000 0.000 srgb} bind def
+/col20 {0.820 0.000 0.000 srgb} bind def
+/col21 {0.560 0.000 0.560 srgb} bind def
+/col22 {0.690 0.000 0.690 srgb} bind def
+/col23 {0.820 0.000 0.820 srgb} bind def
+/col24 {0.500 0.190 0.000 srgb} bind def
+/col25 {0.630 0.250 0.000 srgb} bind def
+/col26 {0.750 0.380 0.000 srgb} bind def
+/col27 {1.000 0.500 0.500 srgb} bind def
+/col28 {1.000 0.630 0.630 srgb} bind def
+/col29 {1.000 0.750 0.750 srgb} bind def
+/col30 {1.000 0.880 0.880 srgb} bind def
+/col31 {1.000 0.840 0.000 srgb} bind def
+
+end
+save
+-2.0 61.0 translate
+1 -1 scale
+
+/cp {closepath} bind def
+/ef {eofill} bind def
+/gr {grestore} bind def
+/gs {gsave} bind def
+/sa {save} bind def
+/rs {restore} bind def
+/l {lineto} bind def
+/m {moveto} bind def
+/rm {rmoveto} bind def
+/n {newpath} bind def
+/s {stroke} bind def
+/sh {show} bind def
+/slc {setlinecap} bind def
+/slj {setlinejoin} bind def
+/slw {setlinewidth} bind def
+/srgb {setrgbcolor} bind def
+/rot {rotate} bind def
+/sc {scale} bind def
+/sd {setdash} bind def
+/ff {findfont} bind def
+/sf {setfont} bind def
+/scf {scalefont} bind def
+/sw {stringwidth} bind def
+/tr {translate} bind def
+/tnt {dup dup currentrgbcolor
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb}
+ bind def
+/shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul
+ 4 -2 roll mul srgb} bind def
+/$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def
+/$F2psEnd {$F2psEnteredState restore end} def
+%%EndProlog
+
+$F2psBegin
+10 setmiterlimit
+n 0 1048 m 0 0 l 2473 0 l 2473 1048 l cp clip
+ 0.06000 0.06000 sc
+% Polyline
+30.000 slw
+n 2400 975 m 75 975 l 75 150 l 2400 150 l cp gs col-1 s gr
+/Times-Bold ff 360.00 scf sf
+1220 705 m
+gs 1 -1 sc (Graphic) dup sw pop 2 div neg 0 rm col-1 sh gr
+$F2psEnd
+rs
+
+%%EndDocument
+ @endspecial 170 x(Figure)97 b(72:)p 0 TeXcolorgray Black
+173 w(First)1344 3544 y(Stac)m(k)m(ed)32 b(Figure)2413
+3261 y @beginspecial 0 @llx 0 @lly 144 @urx 54 @ury 999
+@rwi @setspecial
+%%BeginDocument: graphic.eps
+%!PS-Adobe-2.0 EPSF-2.0
+%%Title: graphic.eps
+%%Creator: fig2dev Version 3.2 Patchlevel 0-beta2
+%%CreationDate: Thu Dec 11 20:58:11 1997
+%%For: Keith Reckdahl
+%%Orientation: Portrait
+%%BoundingBox: 0 0 144 54
+%%Pages: 0
+%%BeginSetup
+%%IncludeFeature: *PageSize Letter
+%%EndSetup
+%%Magnification: 1.00
+%%EndComments
+/$F2psDict 200 dict def
+$F2psDict begin
+$F2psDict /mtrx matrix put
+/col-1 {0 setgray} bind def
+/col0 {0.000 0.000 0.000 srgb} bind def
+/col1 {0.000 0.000 1.000 srgb} bind def
+/col2 {0.000 1.000 0.000 srgb} bind def
+/col3 {0.000 1.000 1.000 srgb} bind def
+/col4 {1.000 0.000 0.000 srgb} bind def
+/col5 {1.000 0.000 1.000 srgb} bind def
+/col6 {1.000 1.000 0.000 srgb} bind def
+/col7 {1.000 1.000 1.000 srgb} bind def
+/col8 {0.000 0.000 0.560 srgb} bind def
+/col9 {0.000 0.000 0.690 srgb} bind def
+/col10 {0.000 0.000 0.820 srgb} bind def
+/col11 {0.530 0.810 1.000 srgb} bind def
+/col12 {0.000 0.560 0.000 srgb} bind def
+/col13 {0.000 0.690 0.000 srgb} bind def
+/col14 {0.000 0.820 0.000 srgb} bind def
+/col15 {0.000 0.560 0.560 srgb} bind def
+/col16 {0.000 0.690 0.690 srgb} bind def
+/col17 {0.000 0.820 0.820 srgb} bind def
+/col18 {0.560 0.000 0.000 srgb} bind def
+/col19 {0.690 0.000 0.000 srgb} bind def
+/col20 {0.820 0.000 0.000 srgb} bind def
+/col21 {0.560 0.000 0.560 srgb} bind def
+/col22 {0.690 0.000 0.690 srgb} bind def
+/col23 {0.820 0.000 0.820 srgb} bind def
+/col24 {0.500 0.190 0.000 srgb} bind def
+/col25 {0.630 0.250 0.000 srgb} bind def
+/col26 {0.750 0.380 0.000 srgb} bind def
+/col27 {1.000 0.500 0.500 srgb} bind def
+/col28 {1.000 0.630 0.630 srgb} bind def
+/col29 {1.000 0.750 0.750 srgb} bind def
+/col30 {1.000 0.880 0.880 srgb} bind def
+/col31 {1.000 0.840 0.000 srgb} bind def
+
+end
+save
+-2.0 61.0 translate
+1 -1 scale
+
+/cp {closepath} bind def
+/ef {eofill} bind def
+/gr {grestore} bind def
+/gs {gsave} bind def
+/sa {save} bind def
+/rs {restore} bind def
+/l {lineto} bind def
+/m {moveto} bind def
+/rm {rmoveto} bind def
+/n {newpath} bind def
+/s {stroke} bind def
+/sh {show} bind def
+/slc {setlinecap} bind def
+/slj {setlinejoin} bind def
+/slw {setlinewidth} bind def
+/srgb {setrgbcolor} bind def
+/rot {rotate} bind def
+/sc {scale} bind def
+/sd {setdash} bind def
+/ff {findfont} bind def
+/sf {setfont} bind def
+/scf {scalefont} bind def
+/sw {stringwidth} bind def
+/tr {translate} bind def
+/tnt {dup dup currentrgbcolor
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb}
+ bind def
+/shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul
+ 4 -2 roll mul srgb} bind def
+/$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def
+/$F2psEnd {$F2psEnteredState restore end} def
+%%EndProlog
+
+$F2psBegin
+10 setmiterlimit
+n 0 1048 m 0 0 l 2473 0 l 2473 1048 l cp clip
+ 0.06000 0.06000 sc
+% Polyline
+30.000 slw
+n 2400 975 m 75 975 l 75 150 l 2400 150 l cp gs col-1 s gr
+/Times-Bold ff 360.00 scf sf
+1220 705 m
+gs 1 -1 sc (Graphic) dup sw pop 2 div neg 0 rm col-1 sh gr
+$F2psEnd
+rs
+
+%%EndDocument
+ @endspecial 170 x(Figure)68 b(73:)p 0 TeXcolorgray Black
+116 w(Second)2413 3544 y(Stac)m(k)m(ed)32 b(Figure)810
+4065 y @beginspecial 0 @llx 0 @lly 144 @urx 54 @ury 999
+@rwi @setspecial
+%%BeginDocument: graphic.eps
+%!PS-Adobe-2.0 EPSF-2.0
+%%Title: graphic.eps
+%%Creator: fig2dev Version 3.2 Patchlevel 0-beta2
+%%CreationDate: Thu Dec 11 20:58:11 1997
+%%For: Keith Reckdahl
+%%Orientation: Portrait
+%%BoundingBox: 0 0 144 54
+%%Pages: 0
+%%BeginSetup
+%%IncludeFeature: *PageSize Letter
+%%EndSetup
+%%Magnification: 1.00
+%%EndComments
+/$F2psDict 200 dict def
+$F2psDict begin
+$F2psDict /mtrx matrix put
+/col-1 {0 setgray} bind def
+/col0 {0.000 0.000 0.000 srgb} bind def
+/col1 {0.000 0.000 1.000 srgb} bind def
+/col2 {0.000 1.000 0.000 srgb} bind def
+/col3 {0.000 1.000 1.000 srgb} bind def
+/col4 {1.000 0.000 0.000 srgb} bind def
+/col5 {1.000 0.000 1.000 srgb} bind def
+/col6 {1.000 1.000 0.000 srgb} bind def
+/col7 {1.000 1.000 1.000 srgb} bind def
+/col8 {0.000 0.000 0.560 srgb} bind def
+/col9 {0.000 0.000 0.690 srgb} bind def
+/col10 {0.000 0.000 0.820 srgb} bind def
+/col11 {0.530 0.810 1.000 srgb} bind def
+/col12 {0.000 0.560 0.000 srgb} bind def
+/col13 {0.000 0.690 0.000 srgb} bind def
+/col14 {0.000 0.820 0.000 srgb} bind def
+/col15 {0.000 0.560 0.560 srgb} bind def
+/col16 {0.000 0.690 0.690 srgb} bind def
+/col17 {0.000 0.820 0.820 srgb} bind def
+/col18 {0.560 0.000 0.000 srgb} bind def
+/col19 {0.690 0.000 0.000 srgb} bind def
+/col20 {0.820 0.000 0.000 srgb} bind def
+/col21 {0.560 0.000 0.560 srgb} bind def
+/col22 {0.690 0.000 0.690 srgb} bind def
+/col23 {0.820 0.000 0.820 srgb} bind def
+/col24 {0.500 0.190 0.000 srgb} bind def
+/col25 {0.630 0.250 0.000 srgb} bind def
+/col26 {0.750 0.380 0.000 srgb} bind def
+/col27 {1.000 0.500 0.500 srgb} bind def
+/col28 {1.000 0.630 0.630 srgb} bind def
+/col29 {1.000 0.750 0.750 srgb} bind def
+/col30 {1.000 0.880 0.880 srgb} bind def
+/col31 {1.000 0.840 0.000 srgb} bind def
+
+end
+save
+-2.0 61.0 translate
+1 -1 scale
+
+/cp {closepath} bind def
+/ef {eofill} bind def
+/gr {grestore} bind def
+/gs {gsave} bind def
+/sa {save} bind def
+/rs {restore} bind def
+/l {lineto} bind def
+/m {moveto} bind def
+/rm {rmoveto} bind def
+/n {newpath} bind def
+/s {stroke} bind def
+/sh {show} bind def
+/slc {setlinecap} bind def
+/slj {setlinejoin} bind def
+/slw {setlinewidth} bind def
+/srgb {setrgbcolor} bind def
+/rot {rotate} bind def
+/sc {scale} bind def
+/sd {setdash} bind def
+/ff {findfont} bind def
+/sf {setfont} bind def
+/scf {scalefont} bind def
+/sw {stringwidth} bind def
+/tr {translate} bind def
+/tnt {dup dup currentrgbcolor
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb}
+ bind def
+/shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul
+ 4 -2 roll mul srgb} bind def
+/$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def
+/$F2psEnd {$F2psEnteredState restore end} def
+%%EndProlog
+
+$F2psBegin
+10 setmiterlimit
+n 0 1048 m 0 0 l 2473 0 l 2473 1048 l cp clip
+ 0.06000 0.06000 sc
+% Polyline
+30.000 slw
+n 2400 975 m 75 975 l 75 150 l 2400 150 l cp gs col-1 s gr
+/Times-Bold ff 360.00 scf sf
+1220 705 m
+gs 1 -1 sc (Graphic) dup sw pop 2 div neg 0 rm col-1 sh gr
+$F2psEnd
+rs
+
+%%EndDocument
+ @endspecial 170 x(Figure)85 b(74:)p 0 TeXcolorgray Black
+149 w(Third)810 4348 y(Stac)m(k)m(ed)32 b(Figure)1879
+4065 y @beginspecial 0 @llx 0 @lly 144 @urx 54 @ury 999
+@rwi @setspecial
+%%BeginDocument: graphic.eps
+%!PS-Adobe-2.0 EPSF-2.0
+%%Title: graphic.eps
+%%Creator: fig2dev Version 3.2 Patchlevel 0-beta2
+%%CreationDate: Thu Dec 11 20:58:11 1997
+%%For: Keith Reckdahl
+%%Orientation: Portrait
+%%BoundingBox: 0 0 144 54
+%%Pages: 0
+%%BeginSetup
+%%IncludeFeature: *PageSize Letter
+%%EndSetup
+%%Magnification: 1.00
+%%EndComments
+/$F2psDict 200 dict def
+$F2psDict begin
+$F2psDict /mtrx matrix put
+/col-1 {0 setgray} bind def
+/col0 {0.000 0.000 0.000 srgb} bind def
+/col1 {0.000 0.000 1.000 srgb} bind def
+/col2 {0.000 1.000 0.000 srgb} bind def
+/col3 {0.000 1.000 1.000 srgb} bind def
+/col4 {1.000 0.000 0.000 srgb} bind def
+/col5 {1.000 0.000 1.000 srgb} bind def
+/col6 {1.000 1.000 0.000 srgb} bind def
+/col7 {1.000 1.000 1.000 srgb} bind def
+/col8 {0.000 0.000 0.560 srgb} bind def
+/col9 {0.000 0.000 0.690 srgb} bind def
+/col10 {0.000 0.000 0.820 srgb} bind def
+/col11 {0.530 0.810 1.000 srgb} bind def
+/col12 {0.000 0.560 0.000 srgb} bind def
+/col13 {0.000 0.690 0.000 srgb} bind def
+/col14 {0.000 0.820 0.000 srgb} bind def
+/col15 {0.000 0.560 0.560 srgb} bind def
+/col16 {0.000 0.690 0.690 srgb} bind def
+/col17 {0.000 0.820 0.820 srgb} bind def
+/col18 {0.560 0.000 0.000 srgb} bind def
+/col19 {0.690 0.000 0.000 srgb} bind def
+/col20 {0.820 0.000 0.000 srgb} bind def
+/col21 {0.560 0.000 0.560 srgb} bind def
+/col22 {0.690 0.000 0.690 srgb} bind def
+/col23 {0.820 0.000 0.820 srgb} bind def
+/col24 {0.500 0.190 0.000 srgb} bind def
+/col25 {0.630 0.250 0.000 srgb} bind def
+/col26 {0.750 0.380 0.000 srgb} bind def
+/col27 {1.000 0.500 0.500 srgb} bind def
+/col28 {1.000 0.630 0.630 srgb} bind def
+/col29 {1.000 0.750 0.750 srgb} bind def
+/col30 {1.000 0.880 0.880 srgb} bind def
+/col31 {1.000 0.840 0.000 srgb} bind def
+
+end
+save
+-2.0 61.0 translate
+1 -1 scale
+
+/cp {closepath} bind def
+/ef {eofill} bind def
+/gr {grestore} bind def
+/gs {gsave} bind def
+/sa {save} bind def
+/rs {restore} bind def
+/l {lineto} bind def
+/m {moveto} bind def
+/rm {rmoveto} bind def
+/n {newpath} bind def
+/s {stroke} bind def
+/sh {show} bind def
+/slc {setlinecap} bind def
+/slj {setlinejoin} bind def
+/slw {setlinewidth} bind def
+/srgb {setrgbcolor} bind def
+/rot {rotate} bind def
+/sc {scale} bind def
+/sd {setdash} bind def
+/ff {findfont} bind def
+/sf {setfont} bind def
+/scf {scalefont} bind def
+/sw {stringwidth} bind def
+/tr {translate} bind def
+/tnt {dup dup currentrgbcolor
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb}
+ bind def
+/shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul
+ 4 -2 roll mul srgb} bind def
+/$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def
+/$F2psEnd {$F2psEnteredState restore end} def
+%%EndProlog
+
+$F2psBegin
+10 setmiterlimit
+n 0 1048 m 0 0 l 2473 0 l 2473 1048 l cp clip
+ 0.06000 0.06000 sc
+% Polyline
+30.000 slw
+n 2400 975 m 75 975 l 75 150 l 2400 150 l cp gs col-1 s gr
+/Times-Bold ff 360.00 scf sf
+1220 705 m
+gs 1 -1 sc (Graphic) dup sw pop 2 div neg 0 rm col-1 sh gr
+$F2psEnd
+rs
+
+%%EndDocument
+ @endspecial 170 x(Figure)71 b(75:)p 0 TeXcolorgray Black
+121 w(F)-8 b(ourth)1879 4348 y(Stac)m(k)m(ed)32 b(Figure)2947
+4065 y @beginspecial 0 @llx 0 @lly 144 @urx 54 @ury 999
+@rwi @setspecial
+%%BeginDocument: graphic.eps
+%!PS-Adobe-2.0 EPSF-2.0
+%%Title: graphic.eps
+%%Creator: fig2dev Version 3.2 Patchlevel 0-beta2
+%%CreationDate: Thu Dec 11 20:58:11 1997
+%%For: Keith Reckdahl
+%%Orientation: Portrait
+%%BoundingBox: 0 0 144 54
+%%Pages: 0
+%%BeginSetup
+%%IncludeFeature: *PageSize Letter
+%%EndSetup
+%%Magnification: 1.00
+%%EndComments
+/$F2psDict 200 dict def
+$F2psDict begin
+$F2psDict /mtrx matrix put
+/col-1 {0 setgray} bind def
+/col0 {0.000 0.000 0.000 srgb} bind def
+/col1 {0.000 0.000 1.000 srgb} bind def
+/col2 {0.000 1.000 0.000 srgb} bind def
+/col3 {0.000 1.000 1.000 srgb} bind def
+/col4 {1.000 0.000 0.000 srgb} bind def
+/col5 {1.000 0.000 1.000 srgb} bind def
+/col6 {1.000 1.000 0.000 srgb} bind def
+/col7 {1.000 1.000 1.000 srgb} bind def
+/col8 {0.000 0.000 0.560 srgb} bind def
+/col9 {0.000 0.000 0.690 srgb} bind def
+/col10 {0.000 0.000 0.820 srgb} bind def
+/col11 {0.530 0.810 1.000 srgb} bind def
+/col12 {0.000 0.560 0.000 srgb} bind def
+/col13 {0.000 0.690 0.000 srgb} bind def
+/col14 {0.000 0.820 0.000 srgb} bind def
+/col15 {0.000 0.560 0.560 srgb} bind def
+/col16 {0.000 0.690 0.690 srgb} bind def
+/col17 {0.000 0.820 0.820 srgb} bind def
+/col18 {0.560 0.000 0.000 srgb} bind def
+/col19 {0.690 0.000 0.000 srgb} bind def
+/col20 {0.820 0.000 0.000 srgb} bind def
+/col21 {0.560 0.000 0.560 srgb} bind def
+/col22 {0.690 0.000 0.690 srgb} bind def
+/col23 {0.820 0.000 0.820 srgb} bind def
+/col24 {0.500 0.190 0.000 srgb} bind def
+/col25 {0.630 0.250 0.000 srgb} bind def
+/col26 {0.750 0.380 0.000 srgb} bind def
+/col27 {1.000 0.500 0.500 srgb} bind def
+/col28 {1.000 0.630 0.630 srgb} bind def
+/col29 {1.000 0.750 0.750 srgb} bind def
+/col30 {1.000 0.880 0.880 srgb} bind def
+/col31 {1.000 0.840 0.000 srgb} bind def
+
+end
+save
+-2.0 61.0 translate
+1 -1 scale
+
+/cp {closepath} bind def
+/ef {eofill} bind def
+/gr {grestore} bind def
+/gs {gsave} bind def
+/sa {save} bind def
+/rs {restore} bind def
+/l {lineto} bind def
+/m {moveto} bind def
+/rm {rmoveto} bind def
+/n {newpath} bind def
+/s {stroke} bind def
+/sh {show} bind def
+/slc {setlinecap} bind def
+/slj {setlinejoin} bind def
+/slw {setlinewidth} bind def
+/srgb {setrgbcolor} bind def
+/rot {rotate} bind def
+/sc {scale} bind def
+/sd {setdash} bind def
+/ff {findfont} bind def
+/sf {setfont} bind def
+/scf {scalefont} bind def
+/sw {stringwidth} bind def
+/tr {translate} bind def
+/tnt {dup dup currentrgbcolor
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb}
+ bind def
+/shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul
+ 4 -2 roll mul srgb} bind def
+/$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def
+/$F2psEnd {$F2psEnteredState restore end} def
+%%EndProlog
+
+$F2psBegin
+10 setmiterlimit
+n 0 1048 m 0 0 l 2473 0 l 2473 1048 l cp clip
+ 0.06000 0.06000 sc
+% Polyline
+30.000 slw
+n 2400 975 m 75 975 l 75 150 l 2400 150 l cp gs col-1 s gr
+/Times-Bold ff 360.00 scf sf
+1220 705 m
+gs 1 -1 sc (Graphic) dup sw pop 2 div neg 0 rm col-1 sh gr
+$F2psEnd
+rs
+
+%%EndDocument
+ @endspecial 170 x(Figure)95 b(76:)p 0 TeXcolorgray Black
+169 w(Fifth)2947 4348 y(Stac)m(k)m(ed)32 b(Figure)p Black
+630 4705 a FB(31.2)112 b(Stac)m(k)m(ed)38 b(Sub\014gures)630
+4855 y FQ(Section)p 0.05 1.00 1.00 0.40 TeXcolorcmyk
+37 w(28.3)p Black 38 w(on)f(page)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 37 w(106)p Black 38 w(explained)f(ho)m(w)h(to)g(construct)
+g(side-b)m(y-side)g(sub\014gures.)57 b(This)630 4946
+y(section)30 b(sho)m(ws)f(ho)m(w)f(adding)h(a)g(linebreak)g(pro)s
+(duces)f(ro)m(ws)h(of)g(sub\014gures.)38 b(F)-8 b(or)30
+b(example,)g(the)630 5038 y(follo)m(wing)i(co)s(de)p
+Black Black 708 5167 a FE(\\begin{figure})826 5258 y(\\centering)826
+5349 y(\045\045----start)42 b(of)e(first)g(subfigure----)826
+5441 y(\\subfloat[First)j(Subfigure]{)p Black 2227 5640
+a FQ(111)p Black eop end
+%%Page: 112 112
+TeXDict begin 112 111 bop Black 0 TeXcolorgray Black
+Black 1022 -149 a FE(\\label{fig:stacksub:a})319 b(\045\045)40
+b(label)g(for)g(first)g(subfigure)1022 -57 y
+(\\includegraphics[width=0.25\\)q(line)q(width)q(]{gr)q(aphi)q(c}})826
+34 y(\\hspace{0.1\\linewidth})826 125 y(\045\045----start)i(of)e
+(second)g(subfigure----)826 217 y(\\subfloat[Second)j(Subfigure]{)1022
+308 y(\\label{fig:stacksub:b})319 b(\045\045)40 b(label)g(for)g(second)
+h(subfigure)1022 399 y(\\includegraphics[width=0.25\\)q(line)q(width)q
+(]{gr)q(aphi)q(c}}\\\\)q([20p)q(t])826 491 y(\045\045----start)h(of)e
+(third)g(subfigure----)826 582 y(\\subfloat[Third)j(Subfigure]{)1022
+673 y(\\label{fig:stacksub:c})319 b(\045\045)40 b(label)g(for)g(third)g
+(subfigure)1022 765 y(\\includegraphics[width=0.25\\)q(line)q(width)q
+(]{gr)q(aphi)q(c}})826 856 y(\\hspace{0.1\\linewidth})826
+947 y(\045\045----start)i(of)e(fourth)g(subfigure----)826
+1039 y(\\subfloat[Fourth)j(Subfigure]{)1022 1130 y
+(\\label{fig:stacksub:d})319 b(\045\045)40 b(label)g(for)g(fourth)h
+(subfigure)1022 1221 y(\\includegraphics[width=0.25\\)q(line)q(width)q
+(]{gr)q(aphi)q(c}})826 1313 y(\\hspace{0.1\\linewidth})826
+1404 y(\045\045----start)h(of)e(fifth)g(subfigure----)826
+1495 y(\\subfloat[Fifth)j(Subfigure]{)1022 1586 y
+(\\label{fig:stacksub:e})319 b(\045\045)40 b(label)g(for)g(fifth)g
+(subfigure)1022 1678 y(\\includegraphics[width=0.25\\)q(line)q(width)q
+(]{gr)q(aphi)q(c}})826 1769 y(\\caption{Five)i(Subfigures})826
+1860 y(\\label{fig:stacksub})593 b(\045\045)40 b(label)g(for)g(entire)h
+(figure)708 1952 y(\\end{figure})630 2106 y FQ(pro)s(duces)29
+b(Figure)p 0.05 1.00 1.00 0.40 TeXcolorcmyk 31 w(77)p
+Black(.)p Black 1281 2619 a @beginspecial 0 @llx 0 @lly
+144 @urx 54 @ury 999 @rwi @setspecial
+%%BeginDocument: graphic.eps
+%!PS-Adobe-2.0 EPSF-2.0
+%%Title: graphic.eps
+%%Creator: fig2dev Version 3.2 Patchlevel 0-beta2
+%%CreationDate: Thu Dec 11 20:58:11 1997
+%%For: Keith Reckdahl
+%%Orientation: Portrait
+%%BoundingBox: 0 0 144 54
+%%Pages: 0
+%%BeginSetup
+%%IncludeFeature: *PageSize Letter
+%%EndSetup
+%%Magnification: 1.00
+%%EndComments
+/$F2psDict 200 dict def
+$F2psDict begin
+$F2psDict /mtrx matrix put
+/col-1 {0 setgray} bind def
+/col0 {0.000 0.000 0.000 srgb} bind def
+/col1 {0.000 0.000 1.000 srgb} bind def
+/col2 {0.000 1.000 0.000 srgb} bind def
+/col3 {0.000 1.000 1.000 srgb} bind def
+/col4 {1.000 0.000 0.000 srgb} bind def
+/col5 {1.000 0.000 1.000 srgb} bind def
+/col6 {1.000 1.000 0.000 srgb} bind def
+/col7 {1.000 1.000 1.000 srgb} bind def
+/col8 {0.000 0.000 0.560 srgb} bind def
+/col9 {0.000 0.000 0.690 srgb} bind def
+/col10 {0.000 0.000 0.820 srgb} bind def
+/col11 {0.530 0.810 1.000 srgb} bind def
+/col12 {0.000 0.560 0.000 srgb} bind def
+/col13 {0.000 0.690 0.000 srgb} bind def
+/col14 {0.000 0.820 0.000 srgb} bind def
+/col15 {0.000 0.560 0.560 srgb} bind def
+/col16 {0.000 0.690 0.690 srgb} bind def
+/col17 {0.000 0.820 0.820 srgb} bind def
+/col18 {0.560 0.000 0.000 srgb} bind def
+/col19 {0.690 0.000 0.000 srgb} bind def
+/col20 {0.820 0.000 0.000 srgb} bind def
+/col21 {0.560 0.000 0.560 srgb} bind def
+/col22 {0.690 0.000 0.690 srgb} bind def
+/col23 {0.820 0.000 0.820 srgb} bind def
+/col24 {0.500 0.190 0.000 srgb} bind def
+/col25 {0.630 0.250 0.000 srgb} bind def
+/col26 {0.750 0.380 0.000 srgb} bind def
+/col27 {1.000 0.500 0.500 srgb} bind def
+/col28 {1.000 0.630 0.630 srgb} bind def
+/col29 {1.000 0.750 0.750 srgb} bind def
+/col30 {1.000 0.880 0.880 srgb} bind def
+/col31 {1.000 0.840 0.000 srgb} bind def
+
+end
+save
+-2.0 61.0 translate
+1 -1 scale
+
+/cp {closepath} bind def
+/ef {eofill} bind def
+/gr {grestore} bind def
+/gs {gsave} bind def
+/sa {save} bind def
+/rs {restore} bind def
+/l {lineto} bind def
+/m {moveto} bind def
+/rm {rmoveto} bind def
+/n {newpath} bind def
+/s {stroke} bind def
+/sh {show} bind def
+/slc {setlinecap} bind def
+/slj {setlinejoin} bind def
+/slw {setlinewidth} bind def
+/srgb {setrgbcolor} bind def
+/rot {rotate} bind def
+/sc {scale} bind def
+/sd {setdash} bind def
+/ff {findfont} bind def
+/sf {setfont} bind def
+/scf {scalefont} bind def
+/sw {stringwidth} bind def
+/tr {translate} bind def
+/tnt {dup dup currentrgbcolor
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb}
+ bind def
+/shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul
+ 4 -2 roll mul srgb} bind def
+/$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def
+/$F2psEnd {$F2psEnteredState restore end} def
+%%EndProlog
+
+$F2psBegin
+10 setmiterlimit
+n 0 1048 m 0 0 l 2473 0 l 2473 1048 l cp clip
+ 0.06000 0.06000 sc
+% Polyline
+30.000 slw
+n 2400 975 m 75 975 l 75 150 l 2400 150 l cp gs col-1 s gr
+/Times-Bold ff 360.00 scf sf
+1220 705 m
+gs 1 -1 sc (Graphic) dup sw pop 2 div neg 0 rm col-1 sh gr
+$F2psEnd
+rs
+
+%%EndDocument
+ @endspecial 1368 2716 a FG(\(a\))d(First)g(Sub\014gure)2507
+2619 y @beginspecial 0 @llx 0 @lly 144 @urx 54 @ury 999
+@rwi @setspecial
+%%BeginDocument: graphic.eps
+%!PS-Adobe-2.0 EPSF-2.0
+%%Title: graphic.eps
+%%Creator: fig2dev Version 3.2 Patchlevel 0-beta2
+%%CreationDate: Thu Dec 11 20:58:11 1997
+%%For: Keith Reckdahl
+%%Orientation: Portrait
+%%BoundingBox: 0 0 144 54
+%%Pages: 0
+%%BeginSetup
+%%IncludeFeature: *PageSize Letter
+%%EndSetup
+%%Magnification: 1.00
+%%EndComments
+/$F2psDict 200 dict def
+$F2psDict begin
+$F2psDict /mtrx matrix put
+/col-1 {0 setgray} bind def
+/col0 {0.000 0.000 0.000 srgb} bind def
+/col1 {0.000 0.000 1.000 srgb} bind def
+/col2 {0.000 1.000 0.000 srgb} bind def
+/col3 {0.000 1.000 1.000 srgb} bind def
+/col4 {1.000 0.000 0.000 srgb} bind def
+/col5 {1.000 0.000 1.000 srgb} bind def
+/col6 {1.000 1.000 0.000 srgb} bind def
+/col7 {1.000 1.000 1.000 srgb} bind def
+/col8 {0.000 0.000 0.560 srgb} bind def
+/col9 {0.000 0.000 0.690 srgb} bind def
+/col10 {0.000 0.000 0.820 srgb} bind def
+/col11 {0.530 0.810 1.000 srgb} bind def
+/col12 {0.000 0.560 0.000 srgb} bind def
+/col13 {0.000 0.690 0.000 srgb} bind def
+/col14 {0.000 0.820 0.000 srgb} bind def
+/col15 {0.000 0.560 0.560 srgb} bind def
+/col16 {0.000 0.690 0.690 srgb} bind def
+/col17 {0.000 0.820 0.820 srgb} bind def
+/col18 {0.560 0.000 0.000 srgb} bind def
+/col19 {0.690 0.000 0.000 srgb} bind def
+/col20 {0.820 0.000 0.000 srgb} bind def
+/col21 {0.560 0.000 0.560 srgb} bind def
+/col22 {0.690 0.000 0.690 srgb} bind def
+/col23 {0.820 0.000 0.820 srgb} bind def
+/col24 {0.500 0.190 0.000 srgb} bind def
+/col25 {0.630 0.250 0.000 srgb} bind def
+/col26 {0.750 0.380 0.000 srgb} bind def
+/col27 {1.000 0.500 0.500 srgb} bind def
+/col28 {1.000 0.630 0.630 srgb} bind def
+/col29 {1.000 0.750 0.750 srgb} bind def
+/col30 {1.000 0.880 0.880 srgb} bind def
+/col31 {1.000 0.840 0.000 srgb} bind def
+
+end
+save
+-2.0 61.0 translate
+1 -1 scale
+
+/cp {closepath} bind def
+/ef {eofill} bind def
+/gr {grestore} bind def
+/gs {gsave} bind def
+/sa {save} bind def
+/rs {restore} bind def
+/l {lineto} bind def
+/m {moveto} bind def
+/rm {rmoveto} bind def
+/n {newpath} bind def
+/s {stroke} bind def
+/sh {show} bind def
+/slc {setlinecap} bind def
+/slj {setlinejoin} bind def
+/slw {setlinewidth} bind def
+/srgb {setrgbcolor} bind def
+/rot {rotate} bind def
+/sc {scale} bind def
+/sd {setdash} bind def
+/ff {findfont} bind def
+/sf {setfont} bind def
+/scf {scalefont} bind def
+/sw {stringwidth} bind def
+/tr {translate} bind def
+/tnt {dup dup currentrgbcolor
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb}
+ bind def
+/shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul
+ 4 -2 roll mul srgb} bind def
+/$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def
+/$F2psEnd {$F2psEnteredState restore end} def
+%%EndProlog
+
+$F2psBegin
+10 setmiterlimit
+n 0 1048 m 0 0 l 2473 0 l 2473 1048 l cp clip
+ 0.06000 0.06000 sc
+% Polyline
+30.000 slw
+n 2400 975 m 75 975 l 75 150 l 2400 150 l cp gs col-1 s gr
+/Times-Bold ff 360.00 scf sf
+1220 705 m
+gs 1 -1 sc (Graphic) dup sw pop 2 div neg 0 rm col-1 sh gr
+$F2psEnd
+rs
+
+%%EndDocument
+ @endspecial 2556 2716 a(\(b\))f(Second)g(Sub\014gure)668
+3313 y @beginspecial 0 @llx 0 @lly 144 @urx 54 @ury 999
+@rwi @setspecial
+%%BeginDocument: graphic.eps
+%!PS-Adobe-2.0 EPSF-2.0
+%%Title: graphic.eps
+%%Creator: fig2dev Version 3.2 Patchlevel 0-beta2
+%%CreationDate: Thu Dec 11 20:58:11 1997
+%%For: Keith Reckdahl
+%%Orientation: Portrait
+%%BoundingBox: 0 0 144 54
+%%Pages: 0
+%%BeginSetup
+%%IncludeFeature: *PageSize Letter
+%%EndSetup
+%%Magnification: 1.00
+%%EndComments
+/$F2psDict 200 dict def
+$F2psDict begin
+$F2psDict /mtrx matrix put
+/col-1 {0 setgray} bind def
+/col0 {0.000 0.000 0.000 srgb} bind def
+/col1 {0.000 0.000 1.000 srgb} bind def
+/col2 {0.000 1.000 0.000 srgb} bind def
+/col3 {0.000 1.000 1.000 srgb} bind def
+/col4 {1.000 0.000 0.000 srgb} bind def
+/col5 {1.000 0.000 1.000 srgb} bind def
+/col6 {1.000 1.000 0.000 srgb} bind def
+/col7 {1.000 1.000 1.000 srgb} bind def
+/col8 {0.000 0.000 0.560 srgb} bind def
+/col9 {0.000 0.000 0.690 srgb} bind def
+/col10 {0.000 0.000 0.820 srgb} bind def
+/col11 {0.530 0.810 1.000 srgb} bind def
+/col12 {0.000 0.560 0.000 srgb} bind def
+/col13 {0.000 0.690 0.000 srgb} bind def
+/col14 {0.000 0.820 0.000 srgb} bind def
+/col15 {0.000 0.560 0.560 srgb} bind def
+/col16 {0.000 0.690 0.690 srgb} bind def
+/col17 {0.000 0.820 0.820 srgb} bind def
+/col18 {0.560 0.000 0.000 srgb} bind def
+/col19 {0.690 0.000 0.000 srgb} bind def
+/col20 {0.820 0.000 0.000 srgb} bind def
+/col21 {0.560 0.000 0.560 srgb} bind def
+/col22 {0.690 0.000 0.690 srgb} bind def
+/col23 {0.820 0.000 0.820 srgb} bind def
+/col24 {0.500 0.190 0.000 srgb} bind def
+/col25 {0.630 0.250 0.000 srgb} bind def
+/col26 {0.750 0.380 0.000 srgb} bind def
+/col27 {1.000 0.500 0.500 srgb} bind def
+/col28 {1.000 0.630 0.630 srgb} bind def
+/col29 {1.000 0.750 0.750 srgb} bind def
+/col30 {1.000 0.880 0.880 srgb} bind def
+/col31 {1.000 0.840 0.000 srgb} bind def
+
+end
+save
+-2.0 61.0 translate
+1 -1 scale
+
+/cp {closepath} bind def
+/ef {eofill} bind def
+/gr {grestore} bind def
+/gs {gsave} bind def
+/sa {save} bind def
+/rs {restore} bind def
+/l {lineto} bind def
+/m {moveto} bind def
+/rm {rmoveto} bind def
+/n {newpath} bind def
+/s {stroke} bind def
+/sh {show} bind def
+/slc {setlinecap} bind def
+/slj {setlinejoin} bind def
+/slw {setlinewidth} bind def
+/srgb {setrgbcolor} bind def
+/rot {rotate} bind def
+/sc {scale} bind def
+/sd {setdash} bind def
+/ff {findfont} bind def
+/sf {setfont} bind def
+/scf {scalefont} bind def
+/sw {stringwidth} bind def
+/tr {translate} bind def
+/tnt {dup dup currentrgbcolor
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb}
+ bind def
+/shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul
+ 4 -2 roll mul srgb} bind def
+/$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def
+/$F2psEnd {$F2psEnteredState restore end} def
+%%EndProlog
+
+$F2psBegin
+10 setmiterlimit
+n 0 1048 m 0 0 l 2473 0 l 2473 1048 l cp clip
+ 0.06000 0.06000 sc
+% Polyline
+30.000 slw
+n 2400 975 m 75 975 l 75 150 l 2400 150 l cp gs col-1 s gr
+/Times-Bold ff 360.00 scf sf
+1220 705 m
+gs 1 -1 sc (Graphic) dup sw pop 2 div neg 0 rm col-1 sh gr
+$F2psEnd
+rs
+
+%%EndDocument
+ @endspecial 742 3410 a(\(c\))h(Third)g(Sub\014gure)1894
+3313 y @beginspecial 0 @llx 0 @lly 144 @urx 54 @ury 999
+@rwi @setspecial
+%%BeginDocument: graphic.eps
+%!PS-Adobe-2.0 EPSF-2.0
+%%Title: graphic.eps
+%%Creator: fig2dev Version 3.2 Patchlevel 0-beta2
+%%CreationDate: Thu Dec 11 20:58:11 1997
+%%For: Keith Reckdahl
+%%Orientation: Portrait
+%%BoundingBox: 0 0 144 54
+%%Pages: 0
+%%BeginSetup
+%%IncludeFeature: *PageSize Letter
+%%EndSetup
+%%Magnification: 1.00
+%%EndComments
+/$F2psDict 200 dict def
+$F2psDict begin
+$F2psDict /mtrx matrix put
+/col-1 {0 setgray} bind def
+/col0 {0.000 0.000 0.000 srgb} bind def
+/col1 {0.000 0.000 1.000 srgb} bind def
+/col2 {0.000 1.000 0.000 srgb} bind def
+/col3 {0.000 1.000 1.000 srgb} bind def
+/col4 {1.000 0.000 0.000 srgb} bind def
+/col5 {1.000 0.000 1.000 srgb} bind def
+/col6 {1.000 1.000 0.000 srgb} bind def
+/col7 {1.000 1.000 1.000 srgb} bind def
+/col8 {0.000 0.000 0.560 srgb} bind def
+/col9 {0.000 0.000 0.690 srgb} bind def
+/col10 {0.000 0.000 0.820 srgb} bind def
+/col11 {0.530 0.810 1.000 srgb} bind def
+/col12 {0.000 0.560 0.000 srgb} bind def
+/col13 {0.000 0.690 0.000 srgb} bind def
+/col14 {0.000 0.820 0.000 srgb} bind def
+/col15 {0.000 0.560 0.560 srgb} bind def
+/col16 {0.000 0.690 0.690 srgb} bind def
+/col17 {0.000 0.820 0.820 srgb} bind def
+/col18 {0.560 0.000 0.000 srgb} bind def
+/col19 {0.690 0.000 0.000 srgb} bind def
+/col20 {0.820 0.000 0.000 srgb} bind def
+/col21 {0.560 0.000 0.560 srgb} bind def
+/col22 {0.690 0.000 0.690 srgb} bind def
+/col23 {0.820 0.000 0.820 srgb} bind def
+/col24 {0.500 0.190 0.000 srgb} bind def
+/col25 {0.630 0.250 0.000 srgb} bind def
+/col26 {0.750 0.380 0.000 srgb} bind def
+/col27 {1.000 0.500 0.500 srgb} bind def
+/col28 {1.000 0.630 0.630 srgb} bind def
+/col29 {1.000 0.750 0.750 srgb} bind def
+/col30 {1.000 0.880 0.880 srgb} bind def
+/col31 {1.000 0.840 0.000 srgb} bind def
+
+end
+save
+-2.0 61.0 translate
+1 -1 scale
+
+/cp {closepath} bind def
+/ef {eofill} bind def
+/gr {grestore} bind def
+/gs {gsave} bind def
+/sa {save} bind def
+/rs {restore} bind def
+/l {lineto} bind def
+/m {moveto} bind def
+/rm {rmoveto} bind def
+/n {newpath} bind def
+/s {stroke} bind def
+/sh {show} bind def
+/slc {setlinecap} bind def
+/slj {setlinejoin} bind def
+/slw {setlinewidth} bind def
+/srgb {setrgbcolor} bind def
+/rot {rotate} bind def
+/sc {scale} bind def
+/sd {setdash} bind def
+/ff {findfont} bind def
+/sf {setfont} bind def
+/scf {scalefont} bind def
+/sw {stringwidth} bind def
+/tr {translate} bind def
+/tnt {dup dup currentrgbcolor
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb}
+ bind def
+/shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul
+ 4 -2 roll mul srgb} bind def
+/$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def
+/$F2psEnd {$F2psEnteredState restore end} def
+%%EndProlog
+
+$F2psBegin
+10 setmiterlimit
+n 0 1048 m 0 0 l 2473 0 l 2473 1048 l cp clip
+ 0.06000 0.06000 sc
+% Polyline
+30.000 slw
+n 2400 975 m 75 975 l 75 150 l 2400 150 l cp gs col-1 s gr
+/Times-Bold ff 360.00 scf sf
+1220 705 m
+gs 1 -1 sc (Graphic) dup sw pop 2 div neg 0 rm col-1 sh gr
+$F2psEnd
+rs
+
+%%EndDocument
+ @endspecial 1947 3410 a(\(d\))f(F)-6 b(ourth)25 b(Sub\014gure)3120
+3313 y @beginspecial 0 @llx 0 @lly 144 @urx 54 @ury 999
+@rwi @setspecial
+%%BeginDocument: graphic.eps
+%!PS-Adobe-2.0 EPSF-2.0
+%%Title: graphic.eps
+%%Creator: fig2dev Version 3.2 Patchlevel 0-beta2
+%%CreationDate: Thu Dec 11 20:58:11 1997
+%%For: Keith Reckdahl
+%%Orientation: Portrait
+%%BoundingBox: 0 0 144 54
+%%Pages: 0
+%%BeginSetup
+%%IncludeFeature: *PageSize Letter
+%%EndSetup
+%%Magnification: 1.00
+%%EndComments
+/$F2psDict 200 dict def
+$F2psDict begin
+$F2psDict /mtrx matrix put
+/col-1 {0 setgray} bind def
+/col0 {0.000 0.000 0.000 srgb} bind def
+/col1 {0.000 0.000 1.000 srgb} bind def
+/col2 {0.000 1.000 0.000 srgb} bind def
+/col3 {0.000 1.000 1.000 srgb} bind def
+/col4 {1.000 0.000 0.000 srgb} bind def
+/col5 {1.000 0.000 1.000 srgb} bind def
+/col6 {1.000 1.000 0.000 srgb} bind def
+/col7 {1.000 1.000 1.000 srgb} bind def
+/col8 {0.000 0.000 0.560 srgb} bind def
+/col9 {0.000 0.000 0.690 srgb} bind def
+/col10 {0.000 0.000 0.820 srgb} bind def
+/col11 {0.530 0.810 1.000 srgb} bind def
+/col12 {0.000 0.560 0.000 srgb} bind def
+/col13 {0.000 0.690 0.000 srgb} bind def
+/col14 {0.000 0.820 0.000 srgb} bind def
+/col15 {0.000 0.560 0.560 srgb} bind def
+/col16 {0.000 0.690 0.690 srgb} bind def
+/col17 {0.000 0.820 0.820 srgb} bind def
+/col18 {0.560 0.000 0.000 srgb} bind def
+/col19 {0.690 0.000 0.000 srgb} bind def
+/col20 {0.820 0.000 0.000 srgb} bind def
+/col21 {0.560 0.000 0.560 srgb} bind def
+/col22 {0.690 0.000 0.690 srgb} bind def
+/col23 {0.820 0.000 0.820 srgb} bind def
+/col24 {0.500 0.190 0.000 srgb} bind def
+/col25 {0.630 0.250 0.000 srgb} bind def
+/col26 {0.750 0.380 0.000 srgb} bind def
+/col27 {1.000 0.500 0.500 srgb} bind def
+/col28 {1.000 0.630 0.630 srgb} bind def
+/col29 {1.000 0.750 0.750 srgb} bind def
+/col30 {1.000 0.880 0.880 srgb} bind def
+/col31 {1.000 0.840 0.000 srgb} bind def
+
+end
+save
+-2.0 61.0 translate
+1 -1 scale
+
+/cp {closepath} bind def
+/ef {eofill} bind def
+/gr {grestore} bind def
+/gs {gsave} bind def
+/sa {save} bind def
+/rs {restore} bind def
+/l {lineto} bind def
+/m {moveto} bind def
+/rm {rmoveto} bind def
+/n {newpath} bind def
+/s {stroke} bind def
+/sh {show} bind def
+/slc {setlinecap} bind def
+/slj {setlinejoin} bind def
+/slw {setlinewidth} bind def
+/srgb {setrgbcolor} bind def
+/rot {rotate} bind def
+/sc {scale} bind def
+/sd {setdash} bind def
+/ff {findfont} bind def
+/sf {setfont} bind def
+/scf {scalefont} bind def
+/sw {stringwidth} bind def
+/tr {translate} bind def
+/tnt {dup dup currentrgbcolor
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb}
+ bind def
+/shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul
+ 4 -2 roll mul srgb} bind def
+/$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def
+/$F2psEnd {$F2psEnteredState restore end} def
+%%EndProlog
+
+$F2psBegin
+10 setmiterlimit
+n 0 1048 m 0 0 l 2473 0 l 2473 1048 l cp clip
+ 0.06000 0.06000 sc
+% Polyline
+30.000 slw
+n 2400 975 m 75 975 l 75 150 l 2400 150 l cp gs col-1 s gr
+/Times-Bold ff 360.00 scf sf
+1220 705 m
+gs 1 -1 sc (Graphic) dup sw pop 2 div neg 0 rm col-1 sh gr
+$F2psEnd
+rs
+
+%%EndDocument
+ @endspecial 3207 3410 a(\(e\))g(Fifth)h(Sub\014gure)1768
+3608 y FQ(Figure)31 b(77:)p 0 TeXcolorgray Black 41 w(Fiv)m(e)h
+(Sub\014gures)p Black Black 2227 5640 a(112)p Black eop
+end
+%%Page: 113 113
+TeXDict begin 113 112 bop Black 0 TeXcolorgray Black
+Black 630 -149 a FD(32)135 b(The)44 b(sub\014g)h(pac)l(k)-7
+b(age)630 54 y FQ(This)31 b(section)i(pro)m(vides)e(an)h(o)m(v)m
+(erview)h(of)f(the)g FO(sub\014g)h FQ(pac)m(k)-5 b(age.)46
+b(Readers)32 b(are)g(encouraged)g(to)630 167 y(read)e(Stev)m(en)h
+(Douglas)h(Co)s(c)m(hran's)e FO(sub\014g)h FQ(do)s(cumen)m(tation)h([)p
+0.05 1.00 1.00 0.40 TeXcolorcmyk(32)p Black 1 w(])e(for)h(the)f
+(full)g(details)3657 134 y FP(41)3733 167 y FQ(.)771
+280 y(Section)p 0.05 1.00 1.00 0.40 TeXcolorcmyk 27
+w(28.3)p Black 28 w(pro)m(vided)c(an)g(example)h(that)g(used)f(the)g
+FO(sub\014g)i FQ(pac)m(k)-5 b(age's)28 b FM(\\subfloat)c
+FQ(com-)630 393 y(mand)35 b(to)h(create)h(sub\014gures.)55
+b(The)35 b(example)i(also)f(used)f(the)h FM(\\label)e
+FQ(command)h(to)i(de\014ne)630 506 y(lab)s(els)23 b(for)g(the)h
+(\014gure)e(and)h(the)g(individual)g(sub\014gures.)36
+b(This)23 b(lab)s(els)g(can)h(b)s(e)e(referenced)h(using)630
+619 y(the)j FM(\\ref)e FQ(command)h(and)f(the)i FO(sub\014g)g
+FQ(pac)m(k)-5 b(age's)28 b FM(\\subref)23 b FQ(and)i
+FM(\\subref*)e FQ(commands,)j(with)630 732 y(referencing)31
+b(examples)g(describ)s(ed)e(T)-8 b(able)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 31 w(22)p Black(.)630 972 y FB(32.1)112
+b(The)38 b(Sub\015oat)h(Command)630 1143 y FQ(The)23
+b FM(\\subfloat)e FQ(command)i(has)h(one)f(mandatory)h(argumen)m(t)g
+(and)f(t)m(w)m(o)i(optional)f(argumen)m(ts.)630 1256
+y(The)i(mandatory)g(argumen)m(t)h(con)m(tains)g(the)g(commands)e(\(suc)
+m(h)i(as)f FM(\\includegraphics)p FQ(\))c(that)630 1369
+y(generate)36 b(the)f(sub\014gure)d(con)m(ten)m(ts.)55
+b(The)34 b(t)m(w)m(o)i(optional)f(argumen)m(ts)g(a\013ect)h(the)f
+(sub\014gure's)630 1482 y(caption:)p Black 767 1625 a
+FK(\210)p Black 45 w FQ(If)30 b(no)g(optional)i(argumen)m(ts)f(are)f
+(sp)s(eci\014ed)g(then)g(the)h(sub\014gure)d(has)i(no)h(sub)s(caption)p
+Black 767 1771 a FK(\210)p Black 45 w FQ(If)h(one)g(optional)h(argumen)
+m(t)f(is)g(sp)s(eci\014ed,)g(its)h(con)m(ten)m(ts)g(pro)m(vide)f(the)h
+(sub\014gure's)d(sub-)857 1884 y(caption)i(and)d(its)i
+(list-of-\014gures)g(text.)p Black 767 2030 a FK(\210)p
+Black 45 w FQ(If)g(t)m(w)m(o)h(optional)g(argumen)m(ts)f(are)g(sp)s
+(eci\014ed,)f(the)h(\014rst)f(\(left\))i(optional)g(argumen)m(t)f(pro-)
+857 2143 y(vides)i(the)h(sub\014gure's)d(list-of-\014gure)k(text)f
+(while)f(the)h(second)f(\(righ)m(t\))h(optional)h(argu-)857
+2256 y(men)m(t)c(pro)m(vides)f(its)h(sub)s(caption.)630
+2399 y(More)g(detail)h(on)e(on)g(the)h FM(\\subfloat)d
+FQ(command)i(options)g(are)h(giv)m(en)h(in)e(T)-8 b(able)p
+0.05 1.00 1.00 0.40 TeXcolorcmyk 31 w(24)p Black(.)630
+2639 y FB(32.2)112 b(Customizing)39 b Fc(sub\014g)f FB(with)g
+(captionsetup)g(Command)630 2810 y FQ(Section)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 23 w(20.1)p Black 25 w(on)22 b(page)p
+0.05 1.00 1.00 0.40 TeXcolorcmyk 24 w(69)p Black 23
+w(describ)s(es)g(ho)m(w)h(Figure)g(caption)g(can)g(b)s(e)f(customized)i
+(using)e(the)h(op-)630 2923 y(tional)k FO(caption)f FQ(pac)m(k)-5
+b(age.)42 b(The)25 b(same)i(customization)h(can)e(b)s(e)g(applied)g(to)
+h(sub\014gure)d(captions)630 3036 y(created)31 b(b)m(y)g(the)f
+FO(sub\014g)i FQ(pac)m(k)-5 b(age)1792 3003 y FP(42)1869
+3036 y FQ(.)771 3149 y(The)25 b FM(\\captionsetup)d FQ(command)k(has)f
+(an)h(optional)h(argumen)m(t)f(whic)m(h)f(sp)s(eci\014es)h(whether)630
+3262 y(the)39 b(customization)i(applies)e(to)h(\014gures,)h
+(sub\014gures,)e(tables,)j(subtables,)f(or)e(some)h(com)m(bi-)630
+3375 y(nation.)59 b(T)-8 b(able)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 37 w(25)p Black 37 w(sho)m(ws)36 b(the)g(p)s(ossible)g
+FM(\\captionsetup)c FQ(optional)38 b(argumen)m(ts)e(and)g(their)630
+3488 y(e\013ects.)p Black 630 3558 1332 4 v 703 3648
+a FF(41)768 3679 y FG(Since)24 b(the)g Fs(sub\014g)i
+FG(pac)n(k)l(age)e(requires)h(the)f Fs(caption)g FG(pac)n(k)l(age,)h
+(some)g(of)g Fs(sub\014g)g FG(pac)n(k)l(age's)g(capabilit)n(y)g(comes)
+630 3771 y(from)33 b(the)f Fs(caption)g FG(co)r(de.)54
+b(F)-6 b(ortunately)g(,)33 b(the)f Fs(sub\014g)h FG(do)r(cumen)n
+(tation)g(describ)r(es)g(the)e(full)i Fs(sub\014g)h FG(capabilit)n(y)-6
+b(,)630 3862 y(regardless)27 b(of)g(where)f(the)f(corresp)r(onding)i
+(co)r(de)f(resides.)703 3957 y FF(42)768 3989 y FG(Since)e(the)g
+Fs(sub\014g)i FG(pac)n(k)l(age)e(automatically)i(includes)f(the)e
+Fs(caption)h FG(pac)n(k)l(age,)i(the)d Fs(sub\014g)j
+FG(alw)n(a)n(ys)f(has)g(all)g(of)630 4080 y(the)g Fs(caption)h
+FG(pac)n(k)l(age's)g(customization)h(capabilities.)p
+Black Black 1512 4338 a FQ(T)-8 b(able)31 b(24:)p 0 TeXcolorgray
+Black 41 w FM(\\subfloat)d FQ(calling)k(argumen)m(ts)p
+Black Black -120 4466 4081 4 v -120 4579 4 113 v -67
+4545 a(Command)p 1783 4579 V 1493 w(List-of-Figures)g(Caption)p
+2870 4579 V 159 w(Sub-\015oat)e(caption)p 3957 4579 V
+-120 4582 4081 4 v -120 4602 V -120 4715 4 113 v -67
+4681 a FM(\\subfloat{)p FQ(b)s(o)s(dy)q FM(})p 1783 4715
+V 2870 4715 V 3957 4715 V -120 4718 4081 4 v -120 4831
+4 113 v -67 4797 a(\\subfloat[)13 b(]{)p FQ(b)s(o)s(dy)q
+FM(})p 1783 4831 V 1064 w FQ(\(b\))p 2870 4831 V 966
+w(\(b\))p 3957 4831 V -120 4835 4081 4 v -120 4948 4
+113 v -67 4914 a FM(\\subfloat[)p FQ(caption)29 b(text)p
+FM(]{)p FQ(b)s(o)s(dy)q FM(})p 1783 4948 V 598 w FQ(\(c\))i(caption)h
+(text)p 2870 4948 V 464 w(\(c\))f(caption)h(text)p 3957
+4948 V -120 4951 4081 4 v -120 5064 4 113 v -67 5030
+a FM(\\subfloat[)13 b(][)p FQ(caption)30 b(text)p FM(]{)p
+FQ(b)s(o)s(dy)q FM(})p 1783 5064 V 2870 5064 V 1575 w
+FQ(\(d\))g(caption)i(text)p 3957 5064 V -120 5067 4081
+4 v -120 5180 4 113 v -67 5146 a FM(\\subfloat[)13 b(][)h(]{)p
+FQ(b)s(o)s(dy)q FM(})p 1783 5180 V 2870 5180 V 2041 w
+FQ(\(e\))p 3957 5180 V -120 5183 4081 4 v -120 5296 4
+113 v -67 5262 a FM(\\subfloat[)p FQ(list)28 b(text)p
+FM(][)p FQ(caption)k(text)p FM(]{)p FQ(b)s(o)s(dy)q FM(})p
+1783 5296 V 192 w FQ(\(f)7 b(\))31 b(list)g(text)p 2870
+5296 V 641 w(\(f)7 b(\))31 b(caption)g(text)p 3957 5296
+V -120 5300 4081 4 v -120 5413 4 113 v -67 5379 a FM(\\subfloat[)p
+FQ(list)d(text)p FM(][)16 b(]{)p FQ(b)s(o)s(dy)q FM(})p
+1783 5413 V 658 w FQ(\(g\))32 b(list)f(text)p 2870 5413
+V 630 w(\(g\))p 3957 5413 V -120 5416 4081 4 v Black
+Black 2227 5640 a(113)p Black eop end
+%%Page: 114 114
+TeXDict begin 114 113 bop Black 0 TeXcolorgray Black
+Black Black 1291 -161 a FQ(T)-8 b(able)31 b(25:)p 0 TeXcolorgray
+Black 41 w(sub\014g)f(pac)m(k)-5 b(age's)32 b FM(\\captionsetup)27
+b FQ(options)p Black Black -120 -32 4081 4 v -120 80
+4 113 v -67 47 a(Command)p 1663 80 V 1373 w(Description)p
+3957 80 V -120 84 4081 4 v -120 104 V -120 217 4 113
+v -67 183 a FM(\\captionsetup{)p Fn(h)p Fy(options)7
+b Fn(i)p FM(})p 1663 217 V 702 w FQ(options)31 b(apply)f(to)h(all)g
+(captions)p 3957 217 V -120 220 4081 4 v -120 333 4 113
+v -67 299 a FM(\\captionsetup[figure]{)p Fn(h)p Fy(options)7
+b Fn(i)p FM(})p 1663 333 V 318 w FQ(options)31 b(apply)f(only)g(to)h
+(\014gures)f(and)g(sub\014gure)e(captions)p 3957 333
+V -120 336 4081 4 v -120 449 4 113 v -67 415 a FM
+(\\captionsetup[table]{)p Fn(h)p Fy(options)7 b Fn(i)p
+FM(})p 1663 449 V 366 w FQ(options)31 b(apply)f(only)g(to)h(table)h
+(and)d(subtable)i(captions)p 3957 449 V -120 452 4081
+4 v -120 678 4 226 v -67 531 a FM(\\captionsetup[subfloat]{)p
+Fn(h)p Fy(options)7 b Fn(i)p FM(})p 1663 678 V 222 w
+FQ(options)31 b(apply)f(only)h(to)g(all)g(sub\015oats)f(\(sub\014gures)
+f(and)h(sub-)1716 644 y(tables\))p 3957 678 V -120 682
+4081 4 v -120 794 4 113 v -67 761 a FM(\\captionsetup[subfigure]{)o
+Fn(h)p Fy(options)7 b Fn(i)p FM(})p 1663 794 V 175 w
+FQ(options)31 b(apply)f(to)h(sub\014gures)p 3957 794
+V -120 798 4081 4 v -120 911 4 113 v -67 877 a FM
+(\\captionsetup[subtable]{)p Fn(h)p Fy(options)7 b Fn(i)p
+FM(})p 1663 911 V 222 w FQ(options)31 b(apply)f(to)h(subtables)p
+3957 911 V -120 914 4081 4 v Black 771 1196 a(In)22 b(addition)g(to)i
+(the)e FM(\\captionsetup)d FQ(command's)j(options)h(listed)g(on)f(P)m
+(age)p 0.05 1.00 1.00 0.40 TeXcolorcmyk 24 w(73)p
+Black 16 w(-)p 0.05 1.00 1.00 0.40 TeXcolorcmyk 16
+w(75)p Black(,)j(there)630 1309 y(are)33 b(some)g FM(\\captionsetup)c
+FQ(options)k(whic)m(h)g(apply)f(only)h(to)g(the)g FO(sub\014g)h
+FQ(pac)m(k)-5 b(age,)36 b(as)d(sho)m(wn)630 1422 y(in)d(T)-8
+b(able)p 0.05 1.00 1.00 0.40 TeXcolorcmyk 31 w(26)p
+Black(.)630 1666 y FB(32.3)112 b(The)38 b(Con)m(tin)m(uedFloat)h
+(Command)630 1837 y FQ(The)29 b FO(sub\014g)i FQ(pac)m(k)-5
+b(age)32 b(also)f(pro)m(vides)e(the)h FM(\\ContinuedFloat)c
+FQ(command)j(whic)m(h)h(allo)m(ws)h(sub-)630 1950 y(\014gures)i(to)i(b)
+s(e)e(split)h(b)s(et)m(w)m(een)h(m)m(ultiple)f(\014gure)g(en)m
+(vironmen)m(ts)g(\(and)g(th)m(us)f(m)m(ultiple)i(pages\).)630
+2063 y(This)30 b(is)g(useful)g(when)p Black 767 2206
+a FK(\210)p Black 45 w FQ(a)h(\014gure)f(has)g(to)s(o)h(man)m(y)f
+(sub\014gures)f(to)i(\014t)f(on)h(a)f(single)h(page)p
+Black 767 2356 a FK(\210)p Black 45 w FQ(or)e(when)f(an)g(author)g
+(wishes)h(to)g(relate)h(m)m(ultiple)f(full-page)h(graphics)e(b)m(y)h
+(ha)m(ving)g(them)857 2469 y(n)m(um)m(b)s(ered)g(\(17a,)k(17b,)d(17c\))
+i(instead)f(\(18,)h(19,)f(20\))771 2612 y(Examples)g(of)f(the)h
+FM(\\ContinuedFloat)26 b FQ(are)31 b(pro)m(vided)f(in)g(Section)p
+0.05 1.00 1.00 0.40 TeXcolorcmyk 31 w(33)p Black(.)p
+Black 2227 5640 a(114)p Black eop end
+%%Page: 115 115
+TeXDict begin 115 114 bop Black 0 TeXcolorgray Black
+Black Black 1535 85 a FQ(T)-8 b(able)31 b(26:)p 0 TeXcolorgray
+Black 42 w(sub\014g)e(captionsetup)i(Options)p Black
+Black -120 214 4081 4 v -120 327 4 113 v -67 293 a(Keyw)m(ord)p
+673 327 V 439 w FM(Values)p 1376 327 V 415 w(Default)p
+1929 327 V 217 w FQ(Description)p 3957 327 V -120 330
+4081 4 v -120 350 V -120 576 4 226 v -67 429 a FM(config=)p
+673 576 V 457 w(<filename>)p 1376 576 V 223 w(subfig.cfg)p
+1929 576 V 73 w FQ(The)j(\014lename)h(from)f(whic)m(h)g(to)h(load)g
+FO(sub\014g)h FQ(con\014gu-)1982 542 y(ration.)p 3957
+576 V -120 579 4081 4 v -120 1031 4 452 v -67 658 a FM(lofdepth=)p
+673 1031 V 361 w(<integer>)p 1376 1031 V 271 w(1)p 1929
+1031 V 505 w FQ(If)d FM(lofdepth=1)p FQ(,)25 b(then)h(only)h(Figures)f
+(are)h(included)f(in)1982 771 y(the)41 b(List)h(of)f(Figures.)74
+b(If)48 b FM(lofdepth=2)p FQ(,)42 b(then)f(b)s(oth)1982
+884 y(Figures)d(and)g(Sub\014gures)e(are)i(included)g(in)f(the)i(List)
+1982 997 y(of)31 b(Figures.)p 3957 1031 V -120 1034 4081
+4 v -120 1486 4 452 v -67 1113 a FM(lotdepth=)p 673 1486
+V 361 w(<integer>)p 1376 1486 V 271 w(1)p 1929 1486 V
+505 w FQ(If)38 b FM(lotdepth=1)p FQ(,)30 b(then)i(only)g(T)-8
+b(ables)32 b(are)g(included)f(in)1982 1226 y(the)45 b(List)h(of)f(T)-8
+b(ables.)86 b(If)52 b FM(lotdepth=2)p FQ(,)47 b(then)e(b)s(oth)1982
+1339 y(T)-8 b(ables)32 b(and)g(Subtables)f(are)h(included)g(in)f(the)h
+(List)h(of)1982 1452 y(T)-8 b(ables.)p 3957 1486 V -120
+1489 4081 4 v -120 1715 4 226 v -67 1568 a FM(listofindent=)p
+673 1715 V 169 w(<length>)p 1376 1715 V 319 w(3.8em)p
+1929 1715 V 313 w FQ(Sets)40 b(the)g(total)i(inden)m(tation)f(from)f
+(the)g(left)h(margin)1982 1681 y(for)30 b(List)h(of)f(Floats)i(line)f
+(for)f(sub\015oats.)p 3957 1715 V -120 1718 4081 4 v
+-120 1944 4 226 v -67 1797 a FM(listofnumwidth=)p 673
+1944 V 73 w(<length>)p 1376 1944 V 319 w(2.5em)p 1929
+1944 V 313 w FQ(Sets)40 b(the)g(width)f(of)h(b)s(o)m(x)g(for)f(the)h
+(lab)s(el)g(n)m(um)m(b)s(er)f(for)1982 1910 y(List)31
+b(of)f(Floats)i(line)f(for)f(sub\015oats.)p 3957 1944
+V -120 1947 4081 4 v -120 2173 4 226 v -67 2026 a FM(farskip=)p
+673 2173 V 409 w(<length>)p 1376 2173 V 319 w(10pt)p
+1929 2173 V 361 w FQ(V)-8 b(ertical)42 b(space)e(on)g(the)g(\\far)f
+(side")i(of)e(the)h(sub\015oat)1982 2139 y(\(on)31 b(the)f(side)g(a)m
+(w)m(a)m(y)j(from)d(the)g(main)g(caption\).)p 3957 2173
+V -120 2176 4081 4 v -120 2402 4 226 v -67 2255 a FM(nearskip=)p
+673 2402 V 361 w(<length>)p 1376 2402 V 319 w(0pt)p 1929
+2402 V 409 w FQ(V)-8 b(ertical)34 b(space)e(on)g(the)g(\\near)g(side")g
+(of)g(the)g(sub\015oat)1982 2368 y(\(on)f(the)f(side)g(to)m(w)m(ards)i
+(the)e(main)g(caption\).)p 3957 2402 V -120 2406 4081
+4 v -120 2631 4 226 v -67 2485 a FM(captionskip=)p 673
+2631 V 217 w(<length>)p 1376 2631 V 319 w(4pt)p 1929
+2631 V 409 w FQ(V)-8 b(ertical)36 b(space)e(b)s(et)m(w)m(een)g(the)f
+(sub\015oat)g(and)g(its)h(sub-)1982 2597 y(caption)p
+3957 2631 V -120 2635 4081 4 v -120 2861 4 226 v -67
+2714 a FM(topadjust=)p 673 2861 V 313 w(<length>)p 1376
+2861 V 319 w(0pt)p 1929 2861 V 409 w FQ(Extra)24 b(v)m(ertical)i(space)
+e(added)f(to)i FM(captionskip)c FQ(when)1982 2827 y(sub)s(caption)30
+b(is)g(ab)s(o)m(v)m(e)i(sub\015oat.)p 3957 2861 V -120
+2864 4081 4 v -120 3203 4 339 v -67 2943 a FM(listofformat=)p
+673 3203 V 169 w Fq(\(see)726 3056 y(Table)46 b(27\))p
+1376 3203 V 1429 2943 a FM(subparens)p 1929 3203 V 121
+w FQ(Sp)s(eci\014es)56 b(format)g(of)h(en)m(tries)g(in)f(List)h(of)f
+(Figures)1982 3056 y(and)49 b(List)g(of)h(T)-8 b(ables.)98
+b(Must)50 b(b)s(e)e(sp)s(eci\014ed)h(b)s(efore)1982 3169
+y FM(\\listoffigures)p 3957 3203 V -120 3206 4081 4 v
+-120 3770 4 565 v -67 3285 a(subrefformat=)p 673 3770
+V 169 w Fq(\(see)726 3398 y(Table)d(27\))p 1376 3770
+V 1429 3285 a FM(subsimple)p 1929 3770 V 121 w FQ(Sp)s(eci\014es)31
+b(format)i(of)39 b FM(\\subref*)30 b FQ(output.)45 b(F)-8
+b(ormat)34 b(of)1982 3398 y FM(\\subref*)20 b FQ(output)i(dep)s(ends)f
+(on)h(the)g FM(subrefformat=)1982 3511 y FQ(v)-5 b(alue)36
+b(when)e(the)i(sub\015oat)e(is)i(formed,)g(regardless)g(of)1982
+3624 y(the)52 b FM(subrefformat=)c FQ(v)-5 b(alue)52
+b(when)f(the)h FM(\\subref*)1982 3737 y FQ(command)30
+b(is)h(en)m(tered.)p 3957 3770 V -120 3774 4081 4 v 727
+4211 a(T)-8 b(able)31 b(27:)p 0 TeXcolorgray Black 41
+w(sub\014g)e(captionsetup)i(Options)f(for)g FM(listofformat=)d
+FQ(and)j FM(subrefformat=)p Black Black 354 4339 3133
+4 v 354 4452 4 113 v 407 4418 a(Values)p 1057 4452 V
+415 w FQ(Example)p 1580 4452 V 176 w(Description)p 3483
+4452 V 354 4456 3133 4 v 354 4476 V 354 4588 4 113 v
+407 4555 a FM(subsimple)p 1057 4588 V 271 w FQ(b)p 1580
+4588 V 472 w(Only)g(output)g(sub\014gure)e(letter.)p
+3483 4588 V 354 4592 3133 4 v 354 4705 4 113 v 407 4671
+a FM(subparens)p 1057 4705 V 271 w FQ(\(b\))p 1580 4705
+V 402 w(Output)21 b(sub\014gure)f(letter)k(surrounded)19
+b(b)m(y)j(parens.)p 3483 4705 V 354 4708 3133 4 v 354
+4821 4 113 v 407 4787 a FM(empty)p 1057 4821 V 1580 4821
+V 986 w FQ(Don't)31 b(output)f(an)m(ything.)p 3483 4821
+V 354 4824 3133 4 v 354 4937 4 113 v 407 4903 a FM(simple)p
+1057 4937 V 415 w FQ(17b)p 1580 4937 V 382 w(Output)f(\014gure)h(n)m
+(um)m(b)s(er)f(and)h(sub\014gure)e(letter.)p 3483 4937
+V 354 4940 3133 4 v 354 5166 4 226 v 407 5020 a FM(parens)p
+1057 5166 V 415 w FQ(17\(b\))p 1580 5166 V 312 w(Output)40
+b(\014gure)h(n)m(um)m(b)s(er)g(follo)m(w)m(ed)i(b)m(y)f(sub\014gure)
+1633 5132 y(letter)32 b(surrounded)27 b(b)m(y)k(parens.)p
+3483 5166 V 354 5170 3133 4 v Black Black 2227 5640 a(115)p
+Black eop end
+%%Page: 116 116
+TeXDict begin 116 115 bop Black 0 TeXcolorgray Black
+Black 630 -149 a FD(33)135 b(Con)l(tin)l(ued)46 b(Figures)f(and)f
+(Sub\014gures)630 33 y FQ(When)31 b(t)m(w)m(o)i(successiv)m(e)g
+(\014gures)e(con)m(tain)i(closely-related)h(material,)f(it)g(ma)m(y)f
+(b)s(e)f(desirable)g(to)630 124 y(lab)s(el)25 b(the)h(\014gures)e(with)
+h(the)g(same)h(\014gure)e(n)m(um)m(b)s(er.)38 b(Since)25
+b(the)g FM(figure)f FQ(coun)m(ter)h(con)m(tains)i(the)630
+215 y(n)m(um)m(b)s(er)22 b(of)h(the)g(next)g(\014gure,)h(t)m(w)m(o)h
+(\014gures)d(can)h(b)s(e)g(giv)m(en)h(the)f(same)g(n)m(um)m(b)s(er)f(b)
+m(y)h(decremen)m(ting)630 307 y(the)31 b FM(figure)d
+FQ(coun)m(ter)j(b)s(efore)f(the)h(\014gure)f(en)m(vironmen)m(t.)41
+b(F)-8 b(or)31 b(example,)p Black Black 865 439 a FE(\\begin{figure})
+865 531 y(....)865 622 y(\\end{figure})865 713 y
+(\\addtocounter{figure}{-1})865 805 y(\\begin{figure})865
+896 y(....)865 987 y(\\end{figure})630 1142 y FQ(Ho)m(w)m(ev)m(er,)55
+b(the)49 b(inabilit)m(y)g(to)g(distinguish)f(b)s(et)m(w)m(een)h(these)f
+(iden)m(tically-n)m(um)m(b)s(ered)i(\014gures)630 1255
+y(causes)31 b(confusion.)630 1498 y FB(33.1)112 b(Con)m(tin)m(ued)38
+b(Figures)630 1657 y FQ(The)26 b(b)s(est)g(w)m(a)m(y)h(of)f
+(constructing)h(a)g(con)m(tin)m(ued)g(\014gure)f(is)g(to)h(use)f(the)h
+FO(sub\014g)g FQ(pac)m(k)-5 b(age)28 b(to)f(create)630
+1756 y(m)m(ultiple)e(Figures,)h(eac)m(h)f(of)f(whic)m(h)g(con)m(tains)h
+(a)f(single)h(sub\014gure.)37 b(This)23 b(allo)m(ws)i(the)f(con)m(tin)m
+(ued)630 1856 y(\014gures)36 b(to)i(b)s(e)f(referenced)g(individually)g
+(as)g(\\Figure)h(12\(a\)")i(or)d(collectiv)m(ely)k(\\Figure)d(12".)630
+1955 y(F)-8 b(or)31 b(example,)g(the)g(follo)m(wing)h(co)s(de)p
+Black Black 717 2097 a FN(\\usepackage{subfi)o(g,)o(gr)o(aph)o(ic)o(x})
+717 2196 y(...)717 2296 y(\\begin{figure}[tb)o(p])848
+2395 y(\\centering)848 2495 y(\\subfloat[Subcap)o(ti)o(on)37
+b(for)43 b(First)e(Part]{)1066 2595 y(\\label{subfig:co)o(nt)o(inu)o
+(ed)o(:fi)o(rs)o(t})124 b(\045\045)43 b(label)e(for)i(first)e
+(subfigure)1066 2694 y(\\includegraphics)o([h)o(eig)o(ht)o(=6i)o(n])o
+({t)o(ux})o(})848 2794 y(\\caption{Example)c(of)43 b(Continued)d
+(Figure})848 2894 y(\\label{fig:conti)o(nu)o(ed:)o(fi)o(rst)o(})81
+b(\045\045)43 b(label)e(for)i(first)e(figure)717 2993
+y(\\end{figure})717 3192 y(\\begin{figure}[tb)o(p])848
+3292 y(\\ContinuedFloat)848 3392 y(\\centering)848 3491
+y(\\subfloat[Subcap)o(ti)o(on)c(for)43 b(Second)e(Part]{)1066
+3591 y(\\label{subfig:co)o(nt)o(inu)o(ed)o(:se)o(co)o(nd)o(})81
+b(\045\045)43 b(label)e(for)i(second)e(subfigure)1066
+3691 y(\\includegraphics)o([h)o(eig)o(ht)o(=6i)o(n])o({t)o(ux})o(})848
+3790 y(\\caption{Example)c(of)43 b(Continued)d(Figure)h(\(cont'd\)})848
+3890 y(\\label{fig:conti)o(nu)o(ed:)o(se)o(con)o(d})81
+b(\045\045)42 b(label)g(for)g(second)f(figure)717 3989
+y(\\end{figure})630 4144 y FQ(Pro)s(duces)j(Figure)p
+0.05 1.00 1.00 0.40 TeXcolorcmyk 45 w(78)p Black(,)49
+b(whic)m(h)44 b(con)m(tains)i(Figure)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 45 w(78a)p Black 46 w(on)e(P)m(age)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 46 w(117)p Black 46 w(and)g(Figure)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 45 w(78b)p Black 45 w(on)630 4257 y(P)m(age)p
+0.05 1.00 1.00 0.40 TeXcolorcmyk 32 w(118)p Black(.)630
+4500 y FB(33.2)112 b(Con)m(tin)m(ued)38 b(Sub\014gures)630
+4650 y FQ(When)f(grouping)h(sub\014gures)e(together)j(in)e(a)h
+(\014gure,)i(there)d(often)i(is)e(not)h(enough)g(ro)s(om)f(to)630
+4742 y(place)46 b(all)f(of)g(the)g(sub\014gures)e(on)h(a)h(single)h
+(page.)84 b(Instead)45 b(of)g(breaking)f(them)h(in)m(to)h(t)m(w)m(o)630
+4833 y(di\013eren)m(tly-n)m(um)m(b)s(ered)26 b(Figures,)h(the)f
+FM(\\ContinuedFloat)c FQ(command)k(allo)m(ws)h(the)f(t)m(w)m(o)h(sets)g
+(of)630 4924 y(sub\014gures)i(to)i(ha)m(v)m(e)g(the)g(same)g(Figure)f
+(n)m(um)m(b)s(er.)40 b(F)-8 b(or)31 b(example,)g(the)g(follo)m(wing)h
+(co)s(de)p Black Black 708 5057 a FE(\\usepackage{subfig,graphicx)q(})
+708 5148 y(...)708 5240 y(\\begin{figure})826 5331 y(\\centering)826
+5422 y(\045\045----start)42 b(of)e(first)g(subfigure----)p
+Black 2227 5640 a FQ(116)p Black eop end
+%%Page: 117 117
+TeXDict begin 117 116 bop Black 0 TeXcolorgray Black
+Black Black 787 4236 a @beginspecial 0 @llx 0 @lly 313
+@urx 370 @ury 4320 @rhi @setspecial
+%%BeginDocument: tux.eps
+%!PS-Adobe-3.0 EPSF-3.0
+%%Creator: (ImageMagick)
+%%Title: (tux.eps2)
+%%CreationDate: (Thu Jan 12 17:45:51 2006)
+%%BoundingBox: 0 0 313 370
+%%HiResBoundingBox: 0 0 313 370
+%%LanguageLevel: 2
+%%Pages: 1
+%%EndComments
+
+%%BeginDefaults
+%%EndDefaults
+
+%%BeginProlog
+%
+% Display a color image. The image is displayed in color on
+% Postscript viewers or printers that support color, otherwise
+% it is displayed as grayscale.
+%
+/DirectClassImage
+{
+ %
+ % Display a DirectClass image.
+ %
+ colorspace 0 eq
+ {
+ /DeviceRGB setcolorspace
+ <<
+ /ImageType 1
+ /Width columns
+ /Height rows
+ /BitsPerComponent 8
+ /Decode [0 1 0 1 0 1]
+ /ImageMatrix [columns 0 0 rows neg 0 rows]
+ compression 0 gt
+ { /DataSource pixel_stream /DCTDecode filter }
+ { /DataSource pixel_stream /DCTDecode filter } ifelse
+ >> image
+ }
+ {
+ /DeviceCMYK setcolorspace
+ <<
+ /ImageType 1
+ /Width columns
+ /Height rows
+ /BitsPerComponent 8
+ /Decode [1 0 1 0 1 0 1 0]
+ /ImageMatrix [columns 0 0 rows neg 0 rows]
+ compression 0 gt
+ { /DataSource pixel_stream /DCTDecode filter }
+ { /DataSource pixel_stream /DCTDecode filter } ifelse
+ >> image
+ } ifelse
+} bind def
+
+/PseudoClassImage
+{
+ %
+ % Display a PseudoClass image.
+ %
+ % Parameters:
+ % colors: number of colors in the colormap.
+ %
+ currentfile buffer readline pop
+ token pop /colors exch def pop
+ colors 0 eq
+ {
+ %
+ % Image is grayscale.
+ %
+ currentfile buffer readline pop
+ token pop /bits exch def pop
+ /DeviceGray setcolorspace
+ <<
+ /ImageType 1
+ /Width columns
+ /Height rows
+ /BitsPerComponent bits
+ /Decode [0 1]
+ /ImageMatrix [columns 0 0 rows neg 0 rows]
+ compression 0 gt
+ { /DataSource pixel_stream /DCTDecode filter }
+ {
+ /DataSource pixel_stream /DCTDecode filter
+ <<
+ /K -1
+ /Columns columns
+ /Rows rows
+ >> /CCITTFaxDecode filter
+ } ifelse
+ >> image
+ }
+ {
+ %
+ % Parameters:
+ % colormap: red, green, blue color packets.
+ %
+ /colormap colors 3 mul string def
+ currentfile colormap readhexstring pop pop
+ currentfile buffer readline pop
+ [ /Indexed /DeviceRGB colors 1 sub colormap ] setcolorspace
+ <<
+ /ImageType 1
+ /Width columns
+ /Height rows
+ /BitsPerComponent 8
+ /Decode [0 255]
+ /ImageMatrix [columns 0 0 rows neg 0 rows]
+ compression 0 gt
+ { /DataSource pixel_stream /DCTDecode filter }
+ { /DataSource pixel_stream /DCTDecode filter } ifelse
+ >> image
+ } ifelse
+} bind def
+
+/DisplayImage
+{
+ %
+ % Display a DirectClass or PseudoClass image.
+ %
+ % Parameters:
+ % x & y translation.
+ % x & y scale.
+ % label pointsize.
+ % image label.
+ % image columns & rows.
+ % class: 0-DirectClass or 1-PseudoClass.
+ % colorspace: 0-RGB or 1-CMYK.
+ % compression: 0-RLECompression or 1-NoCompression.
+ % hex color packets.
+ %
+ gsave
+ /buffer 512 string def
+ /pixel_stream currentfile def
+
+ currentfile buffer readline pop
+ token pop /x exch def
+ token pop /y exch def pop
+ x y translate
+ currentfile buffer readline pop
+ token pop /x exch def
+ token pop /y exch def pop
+ currentfile buffer readline pop
+ token pop /pointsize exch def pop
+ /Helvetica findfont pointsize scalefont setfont
+ x y scale
+ currentfile buffer readline pop
+ token pop /columns exch def
+ token pop /rows exch def pop
+ currentfile buffer readline pop
+ token pop /class exch def pop
+ currentfile buffer readline pop
+ token pop /colorspace exch def pop
+ currentfile buffer readline pop
+ token pop /compression exch def pop
+ class 0 gt { PseudoClassImage } { DirectClassImage } ifelse
+ grestore
+} bind def
+%%EndProlog
+%%Page: 1 1
+%%PageBoundingBox: 0 0 313 370
+userdict begin
+%%BeginData: 37831 Binary Bytes
+DisplayImage
+0 0
+313 370
+12.000000
+313 370
+0
+0
+0
+ÿØÿà
+ÿÛ
+ ÿÄ
+AQa"q#2‘B¡±Áð$Ñá34CR‚r–ñ9UVWbsx—¶ÕÖ×ÿÄ
+ÿÄ
+
+r˜
+»~—mÊW,â/›hÉX7ÂLHÛ²‚«')ÉÚ³7=¹9¸³ŠüŸÃ|Íãö/äÖ¹Ëvb¬µm¡qÛR'H­d™ÍYŒÅ»pÇgtZÓM$-ëš Ë¬1³q¯šw ¦EÕÑYˆ|#þ*¯¸×ÊE<?òÕÆïý†òÎqÅ’~±âñç#ÈÔµbÝe…,3CÍì§ÄfŠ‹½¾㲂h¶^YÙT­¥)JR”¥)JR”¥)JR”¥)JR”¥)JR”¥)JR”¥)JR”¥)JR”¥)JR”¥)JV/@ºå/ˆï5óºÎ}[ë‘™7öe_P.ºlKbâugcÆÞ§¬å[ÑضõºÏÌDJÜÞFÛ&‹-"n™ä^D_qó;e–Ê8¿ äüˆÝc¦ %ì›&råIC¢-‚¥"‘…1“@àQhç~Iô7çPçQC™E1Ž¡Îa9Îs˜Ç9Œ"cÆDDDDDDGº•ø¥+ØD•W~Zj)®ãÐC_qé×ó¥+×Jò "¡÷¯¥)JR”®Én]·¦º®`$—Ubô(d‡ø€=‡_#ka°Ö÷}ºÝ}¬#de\H¸÷²NŒ+f xàC`[¦¢‚ }ÄçJWf™ÈWÁÕø­Ã$ä¦ =AÓ(‡¶¿ ”G·aØ{îºiŒc˜Â&0ŽÄÆqâ?q®FJbB£/%©ÃdJI‹¦*>¥#¤’1ƒî
+tðä]ë/´[ÑA4Ý¥»÷¬> ~V¸Äܽádì‹•O.û_¸í£…± –ÆȬÙl€»FQS¶•‘"-AU¨þîv‚-œ¬ùW¹×Ò”¥)JR”¥)JR”¥)JR”¥)JR”¥)JR”¥)JR”¥)JR”¥)JR”¥)JR•¾-—v—…Ÿˆì៻Œ]rœtƒ8MãI©|'zÃÁ*Ùf‚,Y—ì7i‚ÐÂŒ¢eHÊHnµñ²ÿ
+rNÑ‚l†ƒ(<Ë·r—|“™È¹nDž†Â…1Ž'Pàëé1ÏÐa
+Å€Ÿv„Ä{uŽ™6“Qª©ÌÔ«=¥)JVH
+W øÊa+yÜ‘£ 9`å| :©œ«)+k)‘­nHr›ÔJÿ
+q×â ñ‘›u-É+ë‡øk5qmà_PxÊͺ¬Ékbßt‹™³Ywz×ÝÝ2W‚ º•º-‹Ê
+»‰B²"j=iÍ|RW"—Ç…‡‚­ëm¸¶<í³"ýG­Ô@íU‘‘ÂØÁ{xwÕçæb…Éå
+£–m£Ÿ[R
+å2…MQ0BõŠ©$§XRdÊ mý¶+R¬¿Ä¬?PGõßwÄw;á‘Cñ3‰Ö}‘}ò}í³wd‹³$2™•±ðÝ¿r +Z±m­È‰K}{§ \†¼šJÞ¶b‚w%sžuHØȇà×WŽæ^Ç÷''ÚÊqg“8ö̼d!îN:ÌXŒ±õó9Ñ„¼Ì]scÖ‘kÁ\¥Š’l6¹îµîD×óQvæ&|âœsìe|koù\•âáâ5qLºzñäw/󅀊ÏÔMEɉïyLYÕ3$R1ƒ³c™F¦ *%ݪKëç-ÁŽm_œʯïëb,.ûbå‚qoÞøõäãØH«‘úÜÁI•Ê ä4·$ÄVŒ”q"²1oîfþ‘9÷N“Ö¶ÖäÎ ó3x”q:Ãäž%Iá켆ÆB&æ²îdQNèÇ·ÌÆŒ¼ñÝÞÍ1:mçí‰b¨€®ˆúiHå#gâά\«Ô×£ñgpU‡y s½²ÌˆAd„ŸÚrn©0YÁ
+òà¶DJ™R:Ȥ܋÷"`PÅJ=4‹åÉgÁ·Ëû»*ç\M>”|lG”µ¹_ jŸ"­‹²^㙳²Ñ§0,à³ì¥±ãi9L¦µ£}H•GÉ®ëã=´ Þð Þ5ü^:Ä0ŠvtÑ@áôD¢b’G9P
+å¼½ÝÆnEZ“h³›ŸeËyºOõèU^jÀ¸#RMîÓX=!ÔrR¹Ú*‡’'ÚgþÐù[ü3i ÑÓí[>`ù²ìÞ²x‚NZ<hå#"嫦Ëè¸lá%ÐT‡ITŽdÔ)ˆaÐWsA8µîK†Ùx².]Û³’ÐNœ6ó=:î"¸]fþqWÉUFæ:^jdS Åë!M²‚•°SXÇŽ7Âáeà<vXiOð®dÌñt/Ù¨éÕõƒÐšalYO>Y‚Q2¶º\ÂÅþ õ”3 ‚zÝ”“rh¸³¬8 Û¾X„Ê-ìûNö‚Ëð—+ûq(†Òñ7Ì-Ó»¨¹hƒ5l åã%cÖEó)FÊY‚OzT“Mp.Gß ï‰õçÁ^PßšzѼòs´’Ì]žÈdå1ýíi²p¥µ~°jîN26³˜lÙò>pÕW껶NÝú#-äºzǼªåÖBæÔ®ǘ†æÈiƵ”VÚ‰)gg™DŠ„k1vʘ¤BZõšl Óº&cÄ·˜,\H¾híÌq¹Œÿ
+"Ÿ@ÕÚOaüct…°-‘oO~ƪ+ۉǢ䱪”'òÓ8K&©EE[¹"Í”Q2(tŒrÁUã‘ž"˜—dê0vé(obÚÞƒ_ w¯>Ý\ø¿ê‡Z2¶wV¼Ã›qìÎC!s Ö8lôø~/ŽÆKpÉkaÅãY'˜=»»¾¹–g’ÔîõÍÀð+Æ,„˜‹)(¯%ÕÔ\ÞÜJŠ–[‰T¶û»Š"Dî=ª¾Õ¼Á¼+Ä–³A¾x…~ÚR=M2ȃ—‹`@LääIR&—REL«t$pªæ^ó$e‡‹¢ Ä)u¬üK,å¹°ußâÒp“6,Ǒ̭Éi6F=«sÀ£k]E¶X®oTâÜ“
+Ímg®¢îcqN5·|KFÈ€“X¤Nyƒay#1#s²"Q×UÏ3p\±í#ÚË'Ó%ýøŠé^lg»é·-³Ì\Yǹ D¡ì³6 '€óãn–+–„6‘®aImƒ•C/s(6“ðnOÄ}ã%¶†FíŠò6Ií%?EÄYUG(ŽB=¾j2)JUïªF®×€™ ¾$çg
+ò³ÀDÍ1—-xã ¶ö^b³nEÁÀ*ö51GÊ7›æHǧåõu½j]®žô:ÐC3‘DÎdÔLÅ:g!„‡!Ê bœ†(Šb˜
+I¬ ¼,x%dâ;:Þ„ŽjòYdY¿»n%”ÜbÓÅNb™TØ qU–"cƒM12®ÎåËŒŒâãðmÁ Ù²eM2
+àëÚuŒb0Ø°¨÷ØŽ´ÿ
+è ÒÍ£×)Êt§„J(šØ¬~r“™÷,~Xç&Dœ¶m³(¢±¬iÑo.Œj‹
+¡Æ%"Œ5šÑB‡I”U£¹u@ÄYËu1—©Hý+†%¶cªY{~—ð2ªöð^D$æ\Ž$Ñô0œ|uJ?ÎÞÇFfôdˆ÷Ž+†õH´C{wõ(H·„Í7ð’º!ó­n¯ø™[|‡Í¨âŒ‰ï;ª *¬ù&RÅÇ7ŽAB"´¢ŒSMÙ¢ã
+¹,Ù‡îLWt¸¹íD•hå£Öd¢„‰n£À
+MÀ—JËU_ñðïoÌñ9¬Æ‹äÉxf¾ÎpœÄ]Ö¹;‚¤Í‘Â] ùŒNef3[2ú²1~Ó1"KûÓ.¨®5­0|‚âH-ӲߗCøí±ÛÞu-ªìfó
+È’_aæ½Eî#QìI2ÞÞ“Æ’Ûä,§ŠE¾bêÁHaØýŒ;|}½õQ›tx¾N^k)oqOÙ Ï»X1–º˜8I‚K©´Ò9à-ƒÉ8rs¦`*×wI{¨6‚˜¹×ˆ'5äQ–å†T[cå\$é;
+9DÁB Ý6³¡\%ƒ’"ôº¸ž¨ü¢n³
+Æ(Îd{œi´Q¼2vÌ=õ¬3Høä@B-Ø"Šbp èz6ΩóÈë
+Îjºƒ “¥’kj&DöïîØ|À=·õ®'¬#7¡ýÇqkùXÇ#Í5Ç.ä‘3…Q-•ÆJ±°“ß~…™Gnˆ;ÔâÚcß‘½y”¸cÞ¶!,àx÷pò®‡Ç.ñß‹lRsbZ-Ý)·)_÷H£+s.`M0YFÎÖL­¡‘9ˆcy1MÚÆ"ʯÜãPò#±¶?PŒœÉþ/2áR5evíãÕN "Ѻh•E\8YQ’Eºj¨¢‡)QZüEÕžyY'øf8lµ«aaEí÷&ÙÂq>P,dU-¾Ì‡A{òbEËÐÙTc‘U6—XÈ‘INã7m+©J!âvëvŽ¥/[ˆ !p¼+ „QvtÊŒDqÄ©‡á‘)3f¡[¤£´Ý;))'z-ðÕÿ
+0å@ŽRxݤ˜$-ωWϔƭ±–lŒŒ\¢ÒI|{t<Î\9rÂM'“ëù7¦HGÉ3—jgDÌ…ÌÝ/02D6ÏÖ\w‚#PM`jS‰4oÝõÇAÓÔÐ
+"eÙ;+˜÷í”( ²G.ÀB±#–‰“•“ƒš`î*fAìL´\‚
+4'åFoØ>j±H³glÝ"«w(*B¨ŠÉ3”¦)€/c‡œÌ™ãœ‚Ö½ÊÝåÇŠ¦ž—±ÎSJ[2
+ô‘i˜¬r$²N(~'¢ˆ¤èäMÛUÛ;+‚ÈH
+ ê÷9ËÂlY¬¹‡íÆ6¤í¢ÑY[žØ‚n“()»y±EIì¢!ÆÊÄ S¿7 #vïÙ¢í5[,ô[(XÌáï%o.ò—òŽÁ2ƒsàÜ£iä¬ST¨v:MÜV«¥Žš œuÝn)-kÊ'ü:]×–%PJrËG"¹ùƒÜa«š3\cvÝW¾þ
+>4±rŒ¿ $»C²töcñJ€³náS°Ê.±
+öðÞÉ×–ȼw,¦GÀç’r&qp`«–m%.‹Uš«®ªîãúlïHÆ'—jßpѱm‹i;29²Ò”¥)JR”¥)JR”¥)JR”¥)JR”¥)JR”¥)JR”¥)JR”¥)JR­Ï–¼ªÃ&ã¾Qäö¹“µqv(·Uœ›vPMi9wª¬”}¿j[lNª?ŠÝwtó¸ërÚ‹*©Ù‰&‰,»f³”T¨:øüP¢øÀ{£X— Fü—æ$͉1üswøÅ¥ŒäØ~—²‰ˆÓqhÛrTÖ•¡";Jô¹£f¢½imYtÔ±WïâYâ ˜¼Myq‘ùO˜\(Ì÷ À1µ†“å^ÂâŒO
+íñ¬¼ws‘ÔN)»×23Òhµd-á-qÝ+²hæmvéÓnpó-óÃ’xÛŒØb1Gw]ÿ
+Nyvx}ØWKƇJ(. š¬™¼•J\y¤b&c
+që"€
+ˆHÜ1Ñè7“¸e•A$^Neé~õ`H€¢ëœÝ &­wýœÆõ·Å¹H‡[Ë9š¨b€‰T×rl{ôŸZöê¸R•ƒæOÂS6Ìêò¶ú®"dHqY–±J"
+?üjÁa-®@]çIÜQLW±–!$¨žÃ` ÜHÔªöÛ„ôÑ (Þ†àÜdä›9ŒˆîO!¾¦©YL&[)ªë-¾‘•Mè¦èQ¼ÓÉVƒüenš…Õîâþ=~õ¿üû“»m‡ÏCï­ëéíR‹‰°ƒVè¼|ܤ)JS&A ­vÖ»·¿ü¸Kტ<.ö<ŽƒãMì$43_z—Â&*É Ã¼”€Êæ>õof¹n¬s¬Ä kqš–{]lãŠÕO‚ ±*Ë£ìÊ´‚v>µÐ0‡Ųh¢Ì’hѲI&™‰S!SL¥*i"˜
+R
+gÞ‡B"S„£¡ W'Jß[kT'Äãánû„Ü®[<ئK òMÃ×+3n‚,!r
+‰®íÆÈ—’$ýªdÙÓåÁ6Ê'b¦ž¾z+M±Dq‚­Õ^1Ü·<@ø!šð«ö¨ØKRJâ°%΂«/uÀ¦Y¨w)‘ºíWpD%#˜=3¸I'ê3I›ˬSil¸ &mYé»^âŽsp[ròP±/H ¼‹™‡z´|œs´ÀL ¹dõºí— @ª¤r€Ž·JWJR”«¤á_-ò§9G†y[†Ÿ™­ó‡¯QÊ;rÎ2í·ÔÇÝÖÀ£AóÏmß6»ÉkZt‰
+׌Z|*ä)øOŸ.ŸCÆP]qÉY³“rfo †³ì—¤††šQWJ(«C'$œm©x¹TPk2ÎиÝ:‹aq®éJÚ3JR”¥)JR”¥)JR”¥)JR”¥)JR”¥)JR”¥)JR”¥)JR¸é‰ˆ‹z&R~~R:9ìÄÔÔÃÖÑ‘0ñ1•{%))$õTÇÇG³Ago^»YÍ"ªëªšIœåÔÃñøÙLø¡òqž~ׄäG±DΘ¥™/¦è8‡—Îw$r¤AS"»u¤!qtlšFwoÙŽßJ¼DÝñsE6œ‹?ƽFEð¬ãßÒ»–ÍMÌÛâÞxQZºM¬”GcdÛDrÛLåÀh©@­U‰ÇÏW¿`Q×íJWè„:§"iÊ(¡ŠDÓ!Dç9Î R…( Œc@¥)@DÂ
+#þQ·r®9QúofqFUˆnÜn«&UB‘\4MUЗµæTlÔ.+JRoÒ2Yㆠ©
+¥)JR”¥)JR”¥)JR”¥)JR”¥)JR”¥)JR”¨VñÜñU„ð¦á-Å’ —Ž}ȼ´¤–5ãM®ý#:nµðâ<—¿eÚ¦*ÖÎ/‰rK’IÅ6ÒÓJ[6ªËµ‘7HÌä””t4sùyw좢b™:’””’tƒèØæ((éë÷ï](“fl™¶IW8U4 šŠª¡!Œm<x<Nä¼Qùï~å;~Ié¸÷‹}V$ãT*ÂíãŽ`$œ™Ýüâ9ÁPôÓÙVxÏo»&ÒŒ œÚÖœ‘Ý~ɶ\ÊT=Ü÷-Ãz\— ãwMIÜ—]Ù9-rÜ÷ÛÕäfgî×î%&¦¥¤G/äåd9|ýã…]Ó¥Õ]cC˜ÃÁÒ»ö+±ždÜ•bcæP\^T$
+ÒF&2D
+„\Ú0€l
+p)´Æ™i›™’Ý.$%[,QßJË.Cï~ú8†û¾‡¿Þ¥ƒ<ÇqoM3ƹ þáå•M¼t›…¥»³ô¦œL=$7bÀ¥ˆ# 
+^¥+P¶WÆ7~ÉÙ ßñÃ{ãÎä±.¶[Ëo=kK;†’Çpƒe—f£–j,ÅÑH³Q$ RÕ?¬Á>/cà^`ÚÜܱbÈLaË6ˆÇÞY”=vhµ¢"Š™Uª'5çg±o Ù,f‚–Ì›µ×UÔ˜o‹nÜ–»f˜[ÐMÈêZIQE“c®‹qp°ÇˆuÎB
+†A
+ÕBS‘4ÈePÀB€&9ÎaÑJR†ÄÆ
+-¬eº‚Ì•M£ñ‰<¹PMWÊu)R‡Ç
+ؘæ5Íщ ‰Á )IGK›§eÆ lÚ6Œ `Ý_ÌT,oÆ="
+ ‹”ÈSÀ,¥PW9<Õ¢oÝ­4Y–DÀdЀʿ™Ü¤
+À3ã]æÊ Ó‹ÞV¤ÇRê9wÉìÈ͛”Š)MØn@Žc›Ô|™p¾ŠòÈOKgL²Â£()X ¶JZî¸â]=”˜’UËù«¬õû×—:tàê®éÓ…TUÇ:«®sU s‰†ìsª8çAcÈ‘Í7ÈŠ”é°H ç´ùœ¬%G}@"B+¯a®›Ç Q9 ãN:L ›Mù"b€” ˜õÃÔÐœ
+³œÆW1™éráºÁ=|7r›‹:ÜIezWFŽp˜\ ·zG‘Î᫈ù5J;kY3kÍ«($Õ“&è´hÙ4[¶n™REˆP‘4Ó!JR€
+¢.Y¾n£g(*™€JtÕES¦r ShiJÐᆶqy¢G%j±Ò)ºD b D@7¾þÞÞÿ
+Q&-…Sõ:
+˜  êTGø„iJµŠªø'4ßüqͯ>b©¥­ü‡oë[#Y’ÈBƒyëNa¤Ã¦™È㯡—ŽXLÖR-ËÈ牬ÑÒÉ”R”­ìü>äÕ‰ÌÎ/`žRãU7gçon_ŒC,âBI™S¸í7êŠH’¶uÊÞbÕ—:i‚”‡v-Ì¢Z†¹Áãà´ç ïŒÈ>]²¥Vo\θ…ªær¦1ÉÒ‰ÈÌJU2ÅÙù$‘sꊈ•ÁärÚáê"šh²Î”¥)JR”¥)JR”¥)JR”¥)JR¸[Žâƒ´-éë²è•emZð²—Å7$±[GCÁÂ1^N^UûƒþDG°láÛ¥Œ=) Š‡0è£ZG¼Qy­9âÏNHr¾MWåƒÈ÷óÆØÖ!ùÕó-ÌGi¢…§‹ }1úfíµ—êu6¨6EåÌönYDÜ‹“©°›âÝñ-(ð•Ÿ1Äâ-óW6ZLÛW9Zº9díN7E
+m²<Š¤@â-’Ÿ8eŒX% 4›¶_d¯Fq{"–¯K~%iɆH W‹‚e1C¨Å º€¿={v߶ÃÜ«†„º“±ñÔˆ²P "î<ìÚ˜†(*Woˆ-Ê©6;ê@3âéLuÜ
+29¤Dl|SHÝ”c&¬ ˜t¦‹fˆ‘º ¿"‘4ÊR‡È¾êR”¥)JR”¥ukâ};Zͺ.5N –RDa
+¡Ò1Ó0 ¢fé9C¶Ê!¡ûh@D}õiœ-¾dL&…ÔôÇ:¯î»”…g›¹Eoõ˜ÀÛ¿m{UÙÒ”¥)JR”¥)JR”¥)JR”¥)JV¥O‹ !‰<f3ÄÔM®zÅøk4$ÜSM4Y[Sý–I _,…¦î[HH®¢‚¢†~õæΘÙVl¿†4iÌ.åôÓ¾¿¸çvc×JìÝ*6Åy!åÀ̽=BN´ÔË:Œ)ÌS¦S‰ŠDÀ¸MR•ô4tዦÏZ*t3p‹¦Ë¦:Q Ô*¨ªAù5S”~F
+¢f)ÊÐx'È6|¯áù$Õêo–ÍXä £¦ Z]sÖ„S›Æ!r!ÿ
+’`u—P‚QeCwêÃã1ç®âáU•.£ þX]òW^K3'+$ä˜sºƒFÙQ:FM½ç‘¦-‡I(c¨“¦VôjíΓ³ŠVÞ'Üø¿üK9«™9a}Øæ„ÐÂã 9Ú¤P¸ïÛJ.ÃYI•VfW¬!Ä$®g,LV“œµË>šižYB…·ñê ’ù6 %
+"Jâ¯â2„)G¸kÛ«¾ÃéßuD*âxÊù9!‰ÖâD¡ò• ¿Ó¬¶þ]»R•Ø¹’ÑìÔî9²`“v6ݾŠE
+
+Q­ì¤êˆ ”Gîʯ*”®B&9iyXÈ–ýÜJH2ŽCA±óž¹M²]ƒ¸þuKÛçíU .Z±®ŸÙã Š²EØ"cù>¤Ç
+4kpX—·rÉèºfåünF‰•TÁøŠQ«¹MøS‘.Å‘kæ=ôÖþ¿oëXº|[œGä·†UíbZÓ7fIãÇ ±U×oÃ[1Îæ®iè|£1þäíxH(æ¯$æœÊ\™
+È’mT1àQY=¶IÚj|åš+x¤žyc†‘žYeuŽ(ãQ¶yÈTElÌ@{ lÖäG‘ÕYÝØ*"‚ÌÌÇAT ’I
+°uQeYS™EU9ÕQCˆ˜ê(¡„Ç9Ì;Æ1Œ#±ØÕÝežfä,½h=±¥ììao¼U
+*` ¬áXQ@ clÊ¿ˆ;b
+HºÉ˜6r^ʺ¡ä”´òæ"¼ÙJ7µo–02k¡'däË5јºFFù·fðIsÚrg|VÚz™F6»xGøÈqŸÅ§ íÆQ±3}¦Å’Y›³òÜ]¶$ª¥ÆR- ÝøþYÁT=¹xdzA')î>eŒ%ÂÒJ—¢Tt‘HÙdŽEWGRVV ¬¤A ‚ñPÕ‘™J21VF2°: ƒäA±ìOÞ^iJVêÛJ³~yZ+Þn»Ú5HË9Œs4‘J6Ù* vúlV(°ht=ªò+€º Ý6äͼô¥;if ´86P1Ë´Œ!ß±)Û¿åíÞ”«^àsõŸqc¦à¦"ñÍç#!À@Å× ¡’îAT‡CÜ
+¥8g†3±ÛZ¥)HFòˆBˆ HWJ”@]€H&
+óŠ½%ñí‰å[¦·E’3wÆŒŸÈ:|ñ¤ÀÔ p³Øä#“Œx¤l™å✾xáÛŽF ±låe¨Ùó–néþÞœÀ!Ò#ø´Swì:é…ùü„è
+éDâ⼌Yq¬“bo®.ñ–W—WW¶0^Ï-ÝżRND·1Êé¨HŽ$*ˆ<Þ÷Š_Ä á—ÇÈÌœ<Cí’Þ¶Ï#my›6vîš%å=sCe%/{ûc–*ð{>Ž-h‰#:·Oc/l1/üsyÈÉ¢)¼F Jªªë(²Ê(ºË(uUUS˜ê*ª†¨¢‡0‰Ž¡Ì"cœÆÂ&ÖÁ/ˆï<$ÈX’SŠ7æ? õS0*œNBµæÚ³SܤCÖF"äÇÐÔ7nŸQG¬ƒ¯¢²·û?ùO2åý ºÉó>Mšå—sœå–)È/§ÉdÆf[{Y/î™îþ|“[=̲º[É1¸·ŽãÝlÄã±®Ò m…®5&Ã[\Ooi
+ÛÃëµÍäfA acFh£‹¸
+>kTD¢ ªyM1…
+PkoƵ1@C¥@ŠlCæíû×ÒÏcÈõH³f=©Èm”)€ !­~Q0†ƒA öíXÿ
+‡‹zé$q^K8ÉßFiJJÂum-ò¬À¡ ^ÌÃÏ°–9òù ÌËÆÊÞ€U³³r
+R¡ )Kì
+Y§˜QP¡ßßÿ
+®Ÿ1,µ·sÆ:‡™`âÝ1”UÃk&ŒŒSæRl2nãÞ5v‚.ÕÙâÃ{³‚\¬É¼}¸¿ œö6»^2~Õ½óŒn2žBϸÚ:w ÒMâ kjî^ PQ¹Þ»íÈùÅ„QsæÛök|QÍÕŽ /Hù•ü·û§øŽ:òîDióü69"³³rÛ-ïy-ñ·L༶rã¦/4ß6ë:åÀW“^MŒ„&+/)QF¤-¦Ev: Ø "û‘dS­ ;'<¾$¬â9k`NE8·pg4SŽ+?ÀÕp1Øï5<n'w/Œd$\*,&7HòO1ô›Å¥Ù¯êz6=Ä2ƒ
+Ð/+''5 "þfû9X‰x§Ž#äâäãÜ&í„ŒsöŠ"é‹ö.‘IÓ7UIÃW &²*BÅÏÀÇâ¦m’Ô⟉¥Ò¬œ1VgŽ¹O#Óë#›*)¶c ˜Î@!nÄâD›_…!@X˜?i%ãÔ–—ÉýGúØSJámÛŠí„Œ¹-‰xùè –ˆ¿Š˜Šv‹Ø÷ìÜ‹†ÎP9ÒU3”@@JaÊ`
+…0€˜´ÃÕ@4
+}¹@NQn¹‰ÿ
+¬Íq¤ÐÈ=9Ö4V1²,©Au'¦6æ8îD¿#™µÒ¶¾í/÷÷1치£«wÆÌHÞʶä
+#½
+ü:r¯*îi9&R6n.Yãc8¸œ³1$î& p2í­&Np <Çܦh†‡QEP$ÆNckboøÇ`ñ+[þÇ·šA3E¹¬Ùöá˃”DzáAÞ»UExéã“(åË·k¬ºŠ,¡Ž4WŒœnc£7î£ÓI¥LôJNÄД… ¶:€{µ /i7g
+º‰¦%n‰JR&º(¡
+'µâ˜kÏž·ÁYHÏgó‘¯e½ÖNà„·1í`±DÛC’@ò#ƒôëÀì˜ÆEÆJæ0—Y9 å]©h O>„Úü ¶#EÙȽ¥˜\4
+¿·Îª>¹ËŒ²l Óð@ð²eVÙ–x§”A™pÉBÈz‡˜µfÝŒ›ÇRŽ\b'Œ¢Ñw¾”Úü/æ3</¯=.Íó[oÇ åÖöþIRD°{¥’Î)§(O¥n²Ü'­!ü¯s³v©5»¨Ö‘e8_!´ÆÆd»ls¼Q*Ó9Pr‘·j¶m(‘¹j¥~Hrœ¥9D¦
+ýWªt•HÙ^9]H*ÈÀe#Á  Çß·½)JVêT dÅlrù#SÂÏb%×±806Ç€R¤&Þ‘~¨ÂR
+¸ÿ
+¦UR‰—¬©yi§ÈÃ9WÏ°* ùèCØv/mý„kÊçÅÖOÅÏRms{žß)É.2fíìȪÜ[¡ßžÅï ãÆϬ‡töìÜôëŒËmøLXk+sô%­Qmå#GÎÚ&`~»÷Ëþ ßíý+ÇàÈoØ¿ÔÃZæ©TOýãç_öm¹Ö´{~šן°Ý|ÝÏþ3ÿ
+óJí­,,ìSÓ´·Žö! þ§Üýüýkäò<‡nÅÜÒ”¥rëe+ð¡B GØ×úù×ÑdVF•VØ‚4G÷PÈò>ÿ
+J`gŒ´lŒqçÉp¼c7Â_®§±£ï
+qœ§QHOÒ7?ܦ·ÇæDw_ê*8µ819:é””·­ÂP`™—`!òØ
+âá§!î(ôe`¤ØKÇ82ÅEìk¶ïZªv˨ÕÁpÙER9›¹Efë§ItUHàU1C•¬½Y^Údmmï¬. ¼³º‰'·º¶•'‚xdPñɱ³#£¡ ¬¤‚ ëÞ4:<nÑÈŒŽŒUÑÔ«+)!•”€C ùk[ÝC_ˆ\ 9MÅÛ¥¿@=¹,L³o=ÒzPì­)+*I‘N®ötÊ­å")“¤<¡2¦7œ`†ÔD ‡Ô?Ä*µsÓÑNòè­ý‹rýÅ(˜ôˆ Òó—ÇpðgT:sjÎ:Ó!)娠•B°HTX`]Qÿ
+n…I¾¤Ô)Ó0Š!]º½«+ªºÊÀ2²U•†Áx ‚#ÁjA ‚$Fˆ#Á ƒî)JRµ­)JR”¥)JR”¥P>Jò“;ÄóùÇ“¹~ȸºÜAÙž]´ºLIûH™9Â[Vœ:Eq?|^Ò‘°ÒŠ[¶™=yÝ(ÂÜ‚”~$lu*«^w•§Žm § _·$%cØöìÕÝxÝ·,“HkvصíØçó×켂ÍØÅÃÃÅ´u!% ñtZ³fÝg ªšI˜Á©3Ç;ÆzsÄ£>]¶~Z^q×G ¶ÖPc&²s8§
+Û²Œ¤äàeÖF7 òBê‡z”„EÍ–Šxí¤MjH¶k!ñ+i6q3o’ï·ÓW[<‰1äãí´k¿8â{hR:©Ëd M³²‚ ƒ
+ $û5ËÇÛµÝõ•ªo¾æê^Ot²¢ ©ÙñYÉñßH[b!1.2.8‡y…bѤ?WI:„A ,]B"B˜¡>Ö
+<( @ñõñ÷5ð™‚#ìþ@;þc½A¡¦Aßo¿`ú~€ü¾êWwû›$õE¤AÁa@>Ú×Óéüµ_V@5ÞÚÖ½þ•à
+
+\o[QúsT¯ˆ’ Ïý úlüÃýoé^ò¸DÚéP£°ß½Tpäl.
+µ^Ió“ˆ<>¶œÝœ™äf%ÃqMÈqM+Êñ‰c7$±¬èÁÛI.½Å?&² ÖQ´\$[ù@™³eL­MœˆøŠ|]¹2­g¹arã›reãÞZ˜j:;Å%
+ µ¹Ò2"™nªPÐÕwÞw†@¸dnëöë¹o{®]B+-sÝó²—-Ã&ªIÔ‘š™töIꉢšhî\ªb$B&)@­…ž ?..´I+cønàÇjâMQnžwäK›O6ôòŽ=U¯ˆ å!òMîÎ^K‚4®nÛ› ½¶gPŒ’5¿xE
+ìÁ“—üïåÿ
+9;—ÙúüÎS(”
+7#¶1–}œ‹˜Ø(©øÿ
+Ì?ŒP`‡ìÿ
+¥Sù–ÝœcgÁ·•½/¹sªŒ-eƹ¹îÉUPIg´<YX©3l‚Îä82-˜1Ew¯E¢*¬M¶nù;û|V& œ¾RîDŠÛŠ·–úòyd`¨‘Án’9%˜ èoÞµp"‰ç™’"Vy&™Ö(£Efyªªä’j°€
+ˆ*ž(²%[½º¢?†¨T/LŽÁEYD•bÌ{øLpAD§Œ–‰Êh.G1Å‘kJ͵¬H6–ÝŸoB22ê Â1ªMÒ×;§¯W1
+
+;xªïd¤]gÒ/—]ëç º]eþˆ|
+«•DeÌæòyûùrYk¹.îå
+GÒª"ÿ
+%S9 %²ÌþÜeÈŽÞÍãwמ¸‹¥ü«U7¶R’:€²öEÄ”‹8ö-ÄÅ"0Öl…ŸŠ)4HzÌlYüC~ËûcËóÜë¦9µÇ~þ½¸Êßñ{ÆX¡†þêC5ÑÅÜ”dXf™ä‘mç1$Ý‘ÉØVEð»ÚcqvX^Smq«(¢µ·ÊZ'ªÞ%Tˆ]@djɪґ²ŠÇfÏC-Ù&ÐPŠöz@>z÷üÁþ#íßUö#’­Eÿ
+@/ÃCÒ=Ôì !ÐþþÂ;¸ko;ÄÈ
+åDM° ˜
+þb‡!s7Ë·ª2-Ý×ëЈ‡qÑ‹Û·Pë¨}Ç[ïØu†ˆ¼òW,/´(WaÒÙƒ/§(œEÒpl]®Ü¢aUd]>Y©ÊP*‰Š"Q:bcg+öuco±¼£/ GX—Š\$çL¯ï YMøÖÌu¿>úûÔ}øƒ1#eß®óš·1 ‚{¾Zä1}»7½oßïæ¬Z•wö/‡·>²‹4ä1Ÿ¹‘X*ØÏ}bq§4]ÌÕhUJ&æß²¤;b¬r"eÊqH1Su˜
+ •wwMË Õ³ž“
+7%Fÿ
+¡ .ÎÕ!"†²¬³ðßøÔaÔ×w=Á{úëŽHÊ/±5Ý‹³šJ¬ePƒÆ×ÍËt¢Cšo Y¸Q_) e¶*ÊT {ì@4¯Ÿµd!àÍ’VnB”é/œòúdÄæé S€há ”)ä•é)ÄH&
+Ñ1¨º28>Àþ[Ðóùþ‡~HóWnîmÄ2‹®šD(w:§)
+
+±KÄå¾b‹ öú0##‡ÊRØúÍXÆIÂv‚£+òâh2¹²,£´ÒFéGM·”=ø>ê[òнÔ×ì rFrCgo*Y ¤wM9_à†»–*¡œR<Çœñ¾ gë_ȲÞÊ„Úc¡(÷W, h„"ˆÐÓI¨Ô6ÌU ¿`Ì;Éîn(Ö}’Îðg],‰ÍHGª[–ö1e Ž \Š+H3tˆ¤‰né…Û(‹¯WÔâ9ô:s}€8¿†øÙ¬F2¶m'$‹2Ü÷¤Ê曾oMÑ\—+²úÇ%ÎåëxvEanD¹|÷ðX¦îN€Ü
+i‘2”‰©…”¥
+Ol#
+H-$2·±;ò vW%7åâ
+é»TüÚú–…Û´Û¸ƒ* ó·¸H5­€ èm³˜*OûØŽô:)÷ïõ7m
+ä‹!›8¸À»³„Ä1ˆ`k{A–NÑv %­f•ýÚ‰(rª¤'¤)f¡:a§¢!÷8†À=ûûoæ>áP¿/ðוÁÞ=¦Gyc<nCug4/·ºº?/ËZnýžc…n,oínámj[yâ–6öNŽAÖˆ÷>|¨©»òÀ,‚‚wùL?ÇöÖ‡¾ƒ¸ë¿°ÿ
+D[¶lܪ,áeT•4’LÊ(a‚"SÀO»ç.MDf>^@KÙxÝší¤íì?*Ec.ëåTÔEÂJÞÌ”¿µm^ÆEÄ¢±º&Mæ¦á8X⦴­ìè¿ÃW!å9«lf')_QMÍì°¼v–p’;¦¹œ¨TU^â~9ј])æxN)–ÿ
+ P6¶Xçx©øYñwá+‡’ÜMã^-ÂwݳsBKå±Ã–|u‡vX=tlƒéBÕ$]°³ë~jR6yi„`¿o7§.Þ«Y'€€÷
+âg`áîxI{nàŽg1=úf&AÝ°“Š“j«)÷­•)’rÑëEÖlåJdÖEE9D¦ªOœñ{~iÄó¼bå‚G—°–Ù$ ‘ãRÛLÃê!¸Ž9
+ÿ
+S
+/¼I'MÖ˜S]"
+?Ÿõí­÷ïõù@Œ²¡D;¸ý'ÖÃèõ °þûz”Ë
+.¡n¢‹®áB"‚ uªªª¨`"H¤™
+U0)µŽR™A1€«Õoû¬_þÁÿ
+$%ÏlÂψXŠD,«'`TÄUTE0
+«`R—±@
+%%EndData
+end
+%%PageTrailer
+%%Trailer
+%%BoundingBox: 0 0 313 370
+%%HiResBoundingBox: 0 0 313 370
+%%EOF
+
+%%EndDocument
+ @endspecial 1805 4333 a FG(\(a\))26 b(Sub)r(caption)f(for)h(First)h(P)
+n(art)1485 4531 y FQ(Figure)k(78:)p 0 TeXcolorgray Black
+41 w(Example)g(of)f(Con)m(tin)m(ued)h(Figure)p Black
+Black 2227 5640 a(117)p Black eop end
+%%Page: 118 118
+TeXDict begin 118 117 bop Black 0 TeXcolorgray Black
+Black Black 787 4236 a @beginspecial 0 @llx 0 @lly 313
+@urx 370 @ury 4320 @rhi @setspecial
+%%BeginDocument: tux.eps
+%!PS-Adobe-3.0 EPSF-3.0
+%%Creator: (ImageMagick)
+%%Title: (tux.eps2)
+%%CreationDate: (Thu Jan 12 17:45:51 2006)
+%%BoundingBox: 0 0 313 370
+%%HiResBoundingBox: 0 0 313 370
+%%LanguageLevel: 2
+%%Pages: 1
+%%EndComments
+
+%%BeginDefaults
+%%EndDefaults
+
+%%BeginProlog
+%
+% Display a color image. The image is displayed in color on
+% Postscript viewers or printers that support color, otherwise
+% it is displayed as grayscale.
+%
+/DirectClassImage
+{
+ %
+ % Display a DirectClass image.
+ %
+ colorspace 0 eq
+ {
+ /DeviceRGB setcolorspace
+ <<
+ /ImageType 1
+ /Width columns
+ /Height rows
+ /BitsPerComponent 8
+ /Decode [0 1 0 1 0 1]
+ /ImageMatrix [columns 0 0 rows neg 0 rows]
+ compression 0 gt
+ { /DataSource pixel_stream /DCTDecode filter }
+ { /DataSource pixel_stream /DCTDecode filter } ifelse
+ >> image
+ }
+ {
+ /DeviceCMYK setcolorspace
+ <<
+ /ImageType 1
+ /Width columns
+ /Height rows
+ /BitsPerComponent 8
+ /Decode [1 0 1 0 1 0 1 0]
+ /ImageMatrix [columns 0 0 rows neg 0 rows]
+ compression 0 gt
+ { /DataSource pixel_stream /DCTDecode filter }
+ { /DataSource pixel_stream /DCTDecode filter } ifelse
+ >> image
+ } ifelse
+} bind def
+
+/PseudoClassImage
+{
+ %
+ % Display a PseudoClass image.
+ %
+ % Parameters:
+ % colors: number of colors in the colormap.
+ %
+ currentfile buffer readline pop
+ token pop /colors exch def pop
+ colors 0 eq
+ {
+ %
+ % Image is grayscale.
+ %
+ currentfile buffer readline pop
+ token pop /bits exch def pop
+ /DeviceGray setcolorspace
+ <<
+ /ImageType 1
+ /Width columns
+ /Height rows
+ /BitsPerComponent bits
+ /Decode [0 1]
+ /ImageMatrix [columns 0 0 rows neg 0 rows]
+ compression 0 gt
+ { /DataSource pixel_stream /DCTDecode filter }
+ {
+ /DataSource pixel_stream /DCTDecode filter
+ <<
+ /K -1
+ /Columns columns
+ /Rows rows
+ >> /CCITTFaxDecode filter
+ } ifelse
+ >> image
+ }
+ {
+ %
+ % Parameters:
+ % colormap: red, green, blue color packets.
+ %
+ /colormap colors 3 mul string def
+ currentfile colormap readhexstring pop pop
+ currentfile buffer readline pop
+ [ /Indexed /DeviceRGB colors 1 sub colormap ] setcolorspace
+ <<
+ /ImageType 1
+ /Width columns
+ /Height rows
+ /BitsPerComponent 8
+ /Decode [0 255]
+ /ImageMatrix [columns 0 0 rows neg 0 rows]
+ compression 0 gt
+ { /DataSource pixel_stream /DCTDecode filter }
+ { /DataSource pixel_stream /DCTDecode filter } ifelse
+ >> image
+ } ifelse
+} bind def
+
+/DisplayImage
+{
+ %
+ % Display a DirectClass or PseudoClass image.
+ %
+ % Parameters:
+ % x & y translation.
+ % x & y scale.
+ % label pointsize.
+ % image label.
+ % image columns & rows.
+ % class: 0-DirectClass or 1-PseudoClass.
+ % colorspace: 0-RGB or 1-CMYK.
+ % compression: 0-RLECompression or 1-NoCompression.
+ % hex color packets.
+ %
+ gsave
+ /buffer 512 string def
+ /pixel_stream currentfile def
+
+ currentfile buffer readline pop
+ token pop /x exch def
+ token pop /y exch def pop
+ x y translate
+ currentfile buffer readline pop
+ token pop /x exch def
+ token pop /y exch def pop
+ currentfile buffer readline pop
+ token pop /pointsize exch def pop
+ /Helvetica findfont pointsize scalefont setfont
+ x y scale
+ currentfile buffer readline pop
+ token pop /columns exch def
+ token pop /rows exch def pop
+ currentfile buffer readline pop
+ token pop /class exch def pop
+ currentfile buffer readline pop
+ token pop /colorspace exch def pop
+ currentfile buffer readline pop
+ token pop /compression exch def pop
+ class 0 gt { PseudoClassImage } { DirectClassImage } ifelse
+ grestore
+} bind def
+%%EndProlog
+%%Page: 1 1
+%%PageBoundingBox: 0 0 313 370
+userdict begin
+%%BeginData: 37831 Binary Bytes
+DisplayImage
+0 0
+313 370
+12.000000
+313 370
+0
+0
+0
+ÿØÿà
+ÿÛ
+ ÿÄ
+AQa"q#2‘B¡±Áð$Ñá34CR‚r–ñ9UVWbsx—¶ÕÖ×ÿÄ
+ÿÄ
+
+r˜
+»~—mÊW,â/›hÉX7ÂLHÛ²‚«')ÉÚ³7=¹9¸³ŠüŸÃ|Íãö/äÖ¹Ëvb¬µm¡qÛR'H­d™ÍYŒÅ»pÇgtZÓM$-ëš Ë¬1³q¯šw ¦EÕÑYˆ|#þ*¯¸×ÊE<?òÕÆïý†òÎqÅ’~±âñç#ÈÔµbÝe…,3CÍì§ÄfŠ‹½¾㲂h¶^YÙT­¥)JR”¥)JR”¥)JR”¥)JR”¥)JR”¥)JR”¥)JR”¥)JR”¥)JR”¥)JV/@ºå/ˆï5óºÎ}[ë‘™7öe_P.ºlKbâugcÆÞ§¬å[ÑضõºÏÌDJÜÞFÛ&‹-"n™ä^D_qó;e–Ê8¿ äüˆÝc¦ %ì›&råIC¢-‚¥"‘…1“@àQhç~Iô7çPçQC™E1Ž¡Îa9Îs˜Ç9Œ"cÆDDDDDDGº•ø¥+ØD•W~Zj)®ãÐC_qé×ó¥+×Jò "¡÷¯¥)JR”®Én]·¦º®`$—Ubô(d‡ø€=‡_#ka°Ö÷}ºÝ}¬#de\H¸÷²NŒ+f xàC`[¦¢‚ }ÄçJWf™ÈWÁÕø­Ã$ä¦ =AÓ(‡¶¿ ”G·aØ{îºiŒc˜Â&0ŽÄÆqâ?q®FJbB£/%©ÃdJI‹¦*>¥#¤’1ƒî
+tðä]ë/´[ÑA4Ý¥»÷¬> ~V¸Äܽádì‹•O.û_¸í£…± –ÆȬÙl€»FQS¶•‘"-AU¨þîv‚-œ¬ùW¹×Ò”¥)JR”¥)JR”¥)JR”¥)JR”¥)JR”¥)JR”¥)JR”¥)JR”¥)JR•¾-—v—…Ÿˆì៻Œ]rœtƒ8MãI©|'zÃÁ*Ùf‚,Y—ì7i‚ÐÂŒ¢eHÊHnµñ²ÿ
+rNÑ‚l†ƒ(<Ë·r—|“™È¹nDž†Â…1Ž'Pàëé1ÏÐa
+Å€Ÿv„Ä{uŽ™6“Qª©ÌÔ«=¥)JVH
+W øÊa+yÜ‘£ 9`å| :©œ«)+k)‘­nHr›ÔJÿ
+q×â ñ‘›u-É+ë‡øk5qmà_PxÊͺ¬Ékbßt‹™³Ywz×ÝÝ2W‚ º•º-‹Ê
+»‰B²"j=iÍ|RW"—Ç…‡‚­ëm¸¶<í³"ýG­Ô@íU‘‘ÂØÁ{xwÕçæb…Éå
+£–m£Ÿ[R
+å2…MQ0BõŠ©$§XRdÊ mý¶+R¬¿Ä¬?PGõßwÄw;á‘Cñ3‰Ö}‘}ò}í³wd‹³$2™•±ðÝ¿r +Z±m­È‰K}{§ \†¼šJÞ¶b‚w%sžuHØȇà×WŽæ^Ç÷''ÚÊqg“8ö̼d!îN:ÌXŒ±õó9Ñ„¼Ì]scÖ‘kÁ\¥Š’l6¹îµîD×óQvæ&|âœsìe|koù\•âáâ5qLºzñäw/󅀊ÏÔMEɉïyLYÕ3$R1ƒ³c™F¦ *%ݪKëç-ÁŽm_œʯïëb,.ûbå‚qoÞøõäãØH«‘úÜÁI•Ê ä4·$ÄVŒ”q"²1oîfþ‘9÷N“Ö¶ÖäÎ ó3x”q:Ãäž%Iá켆ÆB&æ²îdQNèÇ·ÌÆŒ¼ñÝÞÍ1:mçí‰b¨€®ˆúiHå#gâά\«Ô×£ñgpU‡y s½²ÌˆAd„ŸÚrn©0YÁ
+òà¶DJ™R:Ȥ܋÷"`PÅJ=4‹åÉgÁ·Ëû»*ç\M>”|lG”µ¹_ jŸ"­‹²^㙳²Ñ§0,à³ì¥±ãi9L¦µ£}H•GÉ®ëã=´ Þð Þ5ü^:Ä0ŠvtÑ@áôD¢b’G9P
+å¼½ÝÆnEZ“h³›ŸeËyºOõèU^jÀ¸#RMîÓX=!ÔrR¹Ú*‡’'ÚgþÐù[ü3i ÑÓí[>`ù²ìÞ²x‚NZ<hå#"嫦Ëè¸lá%ÐT‡ITŽdÔ)ˆaÐWsA8µîK†Ùx².]Û³’ÐNœ6ó=:î"¸]fþqWÉUFæ:^jdS Åë!M²‚•°SXÇŽ7Âáeà<vXiOð®dÌñt/Ù¨éÕõƒÐšalYO>Y‚Q2¶º\ÂÅþ õ”3 ‚zÝ”“rh¸³¬8 Û¾X„Ê-ìûNö‚Ëð—+ûq(†Òñ7Ì-Ó»¨¹hƒ5l åã%cÖEó)FÊY‚OzT“Mp.Gß ï‰õçÁ^PßšzѼòs´’Ì]žÈdå1ýíi²p¥µ~°jîN26³˜lÙò>pÕW껶NÝú#-äºzǼªåÖBæÔ®ǘ†æÈiƵ”VÚ‰)gg™DŠ„k1vʘ¤BZõšl Óº&cÄ·˜,\H¾híÌq¹Œÿ
+"Ÿ@ÕÚOaüct…°-‘oO~ƪ+ۉǢ䱪”'òÓ8K&©EE[¹"Í”Q2(tŒrÁUã‘ž"˜—dê0vé(obÚÞƒ_ w¯>Ý\ø¿ê‡Z2¶wV¼Ã›qìÎC!s Ö8lôø~/ŽÆKpÉkaÅãY'˜=»»¾¹–g’ÔîõÍÀð+Æ,„˜‹)(¯%ÕÔ\ÞÜJŠ–[‰T¶û»Š"Dî=ª¾Õ¼Á¼+Ä–³A¾x…~ÚR=M2ȃ—‹`@LääIR&—REL«t$pªæ^ó$e‡‹¢ Ä)u¬üK,å¹°ußâÒp“6,Ǒ̭Éi6F=«sÀ£k]E¶X®oTâÜ“
+Ímg®¢îcqN5·|KFÈ€“X¤Nyƒay#1#s²"Q×UÏ3p\±í#ÚË'Ó%ýøŠé^lg»é·-³Ì\Yǹ D¡ì³6 '€óãn–+–„6‘®aImƒ•C/s(6“ðnOÄ}ã%¶†FíŠò6Ií%?EÄYUG(ŽB=¾j2)JUïªF®×€™ ¾$çg
+ò³ÀDÍ1—-xã ¶ö^b³nEÁÀ*ö51GÊ7›æHǧåõu½j]®žô:ÐC3‘DÎdÔLÅ:g!„‡!Ê bœ†(Šb˜
+I¬ ¼,x%dâ;:Þ„ŽjòYdY¿»n%”ÜbÓÅNb™TØ qU–"cƒM12®ÎåËŒŒâãðmÁ Ù²eM2
+àëÚuŒb0Ø°¨÷ØŽ´ÿ
+è ÒÍ£×)Êt§„J(šØ¬~r“™÷,~Xç&Dœ¶m³(¢±¬iÑo.Œj‹
+¡Æ%"Œ5šÑB‡I”U£¹u@ÄYËu1—©Hý+†%¶cªY{~—ð2ªöð^D$æ\Ž$Ñô0œ|uJ?ÎÞÇFfôdˆ÷Ž+†õH´C{wõ(H·„Í7ð’º!ó­n¯ø™[|‡Í¨âŒ‰ï;ª *¬ù&RÅÇ7ŽAB"´¢ŒSMÙ¢ã
+¹,Ù‡îLWt¸¹íD•hå£Öd¢„‰n£À
+MÀ—JËU_ñðïoÌñ9¬Æ‹äÉxf¾ÎpœÄ]Ö¹;‚¤Í‘Â] ùŒNef3[2ú²1~Ó1"KûÓ.¨®5­0|‚âH-ӲߗCøí±ÛÞu-ªìfó
+È’_aæ½Eî#QìI2ÞÞ“Æ’Ûä,§ŠE¾bêÁHaØýŒ;|}½õQ›tx¾N^k)oqOÙ Ï»X1–º˜8I‚K©´Ò9à-ƒÉ8rs¦`*×wI{¨6‚˜¹×ˆ'5äQ–å†T[cå\$é;
+9DÁB Ý6³¡\%ƒ’"ôº¸ž¨ü¢n³
+Æ(Îd{œi´Q¼2vÌ=õ¬3Høä@B-Ø"Šbp èz6ΩóÈë
+Îjºƒ “¥’kj&DöïîØ|À=·õ®'¬#7¡ýÇqkùXÇ#Í5Ç.ä‘3…Q-•ÆJ±°“ß~…™Gnˆ;ÔâÚcß‘½y”¸cÞ¶!,àx÷pò®‡Ç.ñß‹lRsbZ-Ý)·)_÷H£+s.`M0YFÎÖL­¡‘9ˆcy1MÚÆ"ʯÜãPò#±¶?PŒœÉþ/2áR5evíãÕN "Ѻh•E\8YQ’Eºj¨¢‡)QZüEÕžyY'øf8lµ«aaEí÷&ÙÂq>P,dU-¾Ì‡A{òbEËÐÙTc‘U6—XÈ‘INã7m+©J!âvëvŽ¥/[ˆ !p¼+ „QvtÊŒDqÄ©‡á‘)3f¡[¤£´Ý;))'z-ðÕÿ
+0å@ŽRxݤ˜$-ωWϔƭ±–lŒŒ\¢ÒI|{t<Î\9rÂM'“ëù7¦HGÉ3—jgDÌ…ÌÝ/02D6ÏÖ\w‚#PM`jS‰4oÝõÇAÓÔÐ
+"eÙ;+˜÷í”( ²G.ÀB±#–‰“•“ƒš`î*fAìL´\‚
+4'åFoØ>j±H³glÝ"«w(*B¨ŠÉ3”¦)€/c‡œÌ™ãœ‚Ö½ÊÝåÇŠ¦ž—±ÎSJ[2
+ô‘i˜¬r$²N(~'¢ˆ¤èäMÛUÛ;+‚ÈH
+ ê÷9ËÂlY¬¹‡íÆ6¤í¢ÑY[žØ‚n“()»y±EIì¢!ÆÊÄ S¿7 #vïÙ¢í5[,ô[(XÌáï%o.ò—òŽÁ2ƒsàÜ£iä¬ST¨v:MÜV«¥Žš œuÝn)-kÊ'ü:]×–%PJrËG"¹ùƒÜa«š3\cvÝW¾þ
+>4±rŒ¿ $»C²töcñJ€³náS°Ê.±
+öðÞÉ×–ȼw,¦GÀç’r&qp`«–m%.‹Uš«®ªîãúlïHÆ'—jßpѱm‹i;29²Ò”¥)JR”¥)JR”¥)JR”¥)JR”¥)JR”¥)JR”¥)JR”¥)JR­Ï–¼ªÃ&ã¾Qäö¹“µqv(·Uœ›vPMi9wª¬”}¿j[lNª?ŠÝwtó¸ërÚ‹*©Ù‰&‰,»f³”T¨:øüP¢øÀ{£X— Fü—æ$͉1üswøÅ¥ŒäØ~—²‰ˆÓqhÛrTÖ•¡";Jô¹£f¢½imYtÔ±WïâYâ ˜¼Myq‘ùO˜\(Ì÷ À1µ†“å^ÂâŒO
+íñ¬¼ws‘ÔN)»×23Òhµd-á-qÝ+²hæmvéÓnpó-óÃ’xÛŒØb1Gw]ÿ
+Nyvx}ØWKƇJ(. š¬™¼•J\y¤b&c
+që"€
+ˆHÜ1Ñè7“¸e•A$^Neé~õ`H€¢ëœÝ &­wýœÆõ·Å¹H‡[Ë9š¨b€‰T×rl{ôŸZöê¸R•ƒæOÂS6Ìêò¶ú®"dHqY–±J"
+?üjÁa-®@]çIÜQLW±–!$¨žÃ` ÜHÔªöÛ„ôÑ (Þ†àÜdä›9ŒˆîO!¾¦©YL&[)ªë-¾‘•Mè¦èQ¼ÓÉVƒüenš…Õîâþ=~õ¿üû“»m‡ÏCï­ëéíR‹‰°ƒVè¼|ܤ)JS&A ­vÖ»·¿ü¸Kტ<.ö<ŽƒãMì$43_z—Â&*É Ã¼”€Êæ>õof¹n¬s¬Ä kqš–{]lãŠÕO‚ ±*Ë£ìÊ´‚v>µÐ0‡Ųh¢Ì’hѲI&™‰S!SL¥*i"˜
+R
+gÞ‡B"S„£¡ W'Jß[kT'Äãánû„Ü®[<ئK òMÃ×+3n‚,!r
+‰®íÆÈ—’$ýªdÙÓåÁ6Ê'b¦ž¾z+M±Dq‚­Õ^1Ü·<@ø!šð«ö¨ØKRJâ°%΂«/uÀ¦Y¨w)‘ºíWpD%#˜=3¸I'ê3I›ˬSil¸ &mYé»^âŽsp[ròP±/H ¼‹™‡z´|œs´ÀL ¹dõºí— @ª¤r€Ž·JWJR”«¤á_-ò§9G†y[†Ÿ™­ó‡¯QÊ;rÎ2í·ÔÇÝÖÀ£AóÏmß6»ÉkZt‰
+׌Z|*ä)øOŸ.ŸCÆP]qÉY³“rfo †³ì—¤††šQWJ(«C'$œm©x¹TPk2ÎиÝ:‹aq®éJÚ3JR”¥)JR”¥)JR”¥)JR”¥)JR”¥)JR”¥)JR”¥)JR¸é‰ˆ‹z&R~~R:9ìÄÔÔÃÖÑ‘0ñ1•{%))$õTÇÇG³Ago^»YÍ"ªëªšIœåÔÃñøÙLø¡òqž~ׄäG±DΘ¥™/¦è8‡—Îw$r¤AS"»u¤!qtlšFwoÙŽßJ¼DÝñsE6œ‹?ƽFEð¬ãßÒ»–ÍMÌÛâÞxQZºM¬”GcdÛDrÛLåÀh©@­U‰ÇÏW¿`Q×íJWè„:§"iÊ(¡ŠDÓ!Dç9Î R…( Œc@¥)@DÂ
+#þQ·r®9QúofqFUˆnÜn«&UB‘\4MUЗµæTlÔ.+JRoÒ2Yㆠ©
+¥)JR”¥)JR”¥)JR”¥)JR”¥)JR”¥)JR”¨VñÜñU„ð¦á-Å’ —Ž}ȼ´¤–5ãM®ý#:nµðâ<—¿eÚ¦*ÖÎ/‰rK’IÅ6ÒÓJ[6ªËµ‘7HÌä””t4sùyw좢b™:’””’tƒèØæ((éë÷ï](“fl™¶IW8U4 šŠª¡!Œm<x<Nä¼Qùï~å;~Ié¸÷‹}V$ãT*ÂíãŽ`$œ™Ýüâ9ÁPôÓÙVxÏo»&ÒŒ œÚÖœ‘Ý~ɶ\ÊT=Ü÷-Ãz\— ãwMIÜ—]Ù9-rÜ÷ÛÕäfgî×î%&¦¥¤G/äåd9|ýã…]Ó¥Õ]cC˜ÃÁÒ»ö+±ždÜ•bcæP\^T$
+ÒF&2D
+„\Ú0€l
+p)´Æ™i›™’Ý.$%[,QßJË.Cï~ú8†û¾‡¿Þ¥ƒ<ÇqoM3ƹ þáå•M¼t›…¥»³ô¦œL=$7bÀ¥ˆ# 
+^¥+P¶WÆ7~ÉÙ ßñÃ{ãÎä±.¶[Ëo=kK;†’Çpƒe—f£–j,ÅÑH³Q$ RÕ?¬Á>/cà^`ÚÜܱbÈLaË6ˆÇÞY”=vhµ¢"Š™Uª'5çg±o Ù,f‚–Ì›µ×UÔ˜o‹nÜ–»f˜[ÐMÈêZIQE“c®‹qp°ÇˆuÎB
+†A
+ÕBS‘4ÈePÀB€&9ÎaÑJR†ÄÆ
+-¬eº‚Ì•M£ñ‰<¹PMWÊu)R‡Ç
+ؘæ5Íщ ‰Á )IGK›§eÆ lÚ6Œ `Ý_ÌT,oÆ="
+ ‹”ÈSÀ,¥PW9<Õ¢oÝ­4Y–DÀdЀʿ™Ü¤
+À3ã]æÊ Ó‹ÞV¤ÇRê9wÉìÈ͛”Š)MØn@Žc›Ô|™p¾ŠòÈOKgL²Â£()X ¶JZî¸â]=”˜’UËù«¬õû×—:tàê®éÓ…TUÇ:«®sU s‰†ìsª8çAcÈ‘Í7ÈŠ”é°H ç´ùœ¬%G}@"B+¯a®›Ç Q9 ãN:L ›Mù"b€” ˜õÃÔÐœ
+³œÆW1™éráºÁ=|7r›‹:ÜIezWFŽp˜\ ·zG‘Î᫈ù5J;kY3kÍ«($Õ“&è´hÙ4[¶n™REˆP‘4Ó!JR€
+¢.Y¾n£g(*™€JtÕES¦r ShiJÐᆶqy¢G%j±Ò)ºD b D@7¾þÞÞÿ
+Q&-…Sõ:
+˜  êTGø„iJµŠªø'4ßüqͯ>b©¥­ü‡oë[#Y’ÈBƒyëNa¤Ã¦™È㯡—ŽXLÖR-ËÈ牬ÑÒÉ”R”­ìü>äÕ‰ÌÎ/`žRãU7gçon_ŒC,âBI™S¸í7êŠH’¶uÊÞbÕ—:i‚”‡v-Ì¢Z†¹Áãà´ç ïŒÈ>]²¥Vo\θ…ªær¦1ÉÒ‰ÈÌJU2ÅÙù$‘sꊈ•ÁärÚáê"šh²Î”¥)JR”¥)JR”¥)JR”¥)JR¸[Žâƒ´-éë²è•emZð²—Å7$±[GCÁÂ1^N^UûƒþDG°láÛ¥Œ=) Š‡0è£ZG¼Qy­9âÏNHr¾MWåƒÈ÷óÆØÖ!ùÕó-ÌGi¢…§‹ }1úfíµ—êu6¨6EåÌönYDÜ‹“©°›âÝñ-(ð•Ÿ1Äâ-óW6ZLÛW9Zº9díN7E
+m²<Š¤@â-’Ÿ8eŒX% 4›¶_d¯Fq{"–¯K~%iɆH W‹‚e1C¨Å º€¿={v߶ÃÜ«†„º“±ñÔˆ²P "î<ìÚ˜†(*Woˆ-Ê©6;ê@3âéLuÜ
+29¤Dl|SHÝ”c&¬ ˜t¦‹fˆ‘º ¿"‘4ÊR‡È¾êR”¥)JR”¥ukâ};Zͺ.5N –RDa
+¡Ò1Ó0 ¢fé9C¶Ê!¡ûh@D}õiœ-¾dL&…ÔôÇ:¯î»”…g›¹Eoõ˜ÀÛ¿m{UÙÒ”¥)JR”¥)JR”¥)JR”¥)JV¥O‹ !‰<f3ÄÔM®zÅøk4$ÜSM4Y[Sý–I _,…¦î[HH®¢‚¢†~õæΘÙVl¿†4iÌ.åôÓ¾¿¸çvc×JìÝ*6Åy!åÀ̽=BN´ÔË:Œ)ÌS¦S‰ŠDÀ¸MR•ô4tዦÏZ*t3p‹¦Ë¦:Q Ô*¨ªAù5S”~F
+¢f)ÊÐx'È6|¯áù$Õêo–ÍXä £¦ Z]sÖ„S›Æ!r!ÿ
+’`u—P‚QeCwêÃã1ç®âáU•.£ þX]òW^K3'+$ä˜sºƒFÙQ:FM½ç‘¦-‡I(c¨“¦VôjíΓ³ŠVÞ'Üø¿üK9«™9a}Øæ„ÐÂã 9Ú¤P¸ïÛJ.ÃYI•VfW¬!Ä$®g,LV“œµË>šižYB…·ñê ’ù6 %
+"Jâ¯â2„)G¸kÛ«¾ÃéßuD*âxÊù9!‰ÖâD¡ò• ¿Ó¬¶þ]»R•Ø¹’ÑìÔî9²`“v6ݾŠE
+
+Q­ì¤êˆ ”Gîʯ*”®B&9iyXÈ–ýÜJH2ŽCA±óž¹M²]ƒ¸þuKÛçíU .Z±®ŸÙã Š²EØ"cù>¤Ç
+4kpX—·rÉèºfåünF‰•TÁøŠQ«¹MøS‘.Å‘kæ=ôÖþ¿oëXº|[œGä·†UíbZÓ7fIãÇ ±U×oÃ[1Îæ®iè|£1þäíxH(æ¯$æœÊ\™
+È’mT1àQY=¶IÚj|åš+x¤žyc†‘žYeuŽ(ãQ¶yÈTElÌ@{ lÖäG‘ÕYÝØ*"‚ÌÌÇAT ’I
+°uQeYS™EU9ÕQCˆ˜ê(¡„Ç9Ì;Æ1Œ#±ØÕÝežfä,½h=±¥ììao¼U
+*` ¬áXQ@ clÊ¿ˆ;b
+HºÉ˜6r^ʺ¡ä”´òæ"¼ÙJ7µo–02k¡'däË5јºFFù·fðIsÚrg|VÚz™F6»xGøÈqŸÅ§ íÆQ±3}¦Å’Y›³òÜ]¶$ª¥ÆR- ÝøþYÁT=¹xdzA')î>eŒ%ÂÒJ—¢Tt‘HÙdŽEWGRVV ¬¤A ‚ñPÕ‘™J21VF2°: ƒäA±ìOÞ^iJVêÛJ³~yZ+Þn»Ú5HË9Œs4‘J6Ù* vúlV(°ht=ªò+€º Ý6äͼô¥;if ´86P1Ë´Œ!ß±)Û¿åíÞ”«^àsõŸqc¦à¦"ñÍç#!À@Å× ¡’îAT‡CÜ
+¥8g†3±ÛZ¥)HFòˆBˆ HWJ”@]€H&
+óŠ½%ñí‰å[¦·E’3wÆŒŸÈ:|ñ¤ÀÔ p³Øä#“Œx¤l™å✾xáÛŽF ±låe¨Ùó–néþÞœÀ!Ò#ø´Swì:é…ùü„è
+éDâ⼌Yq¬“bo®.ñ–W—WW¶0^Ï-ÝżRND·1Êé¨HŽ$*ˆ<Þ÷Š_Ä á—ÇÈÌœ<Cí’Þ¶Ï#my›6vîš%å=sCe%/{ûc–*ð{>Ž-h‰#:·Oc/l1/üsyÈÉ¢)¼F Jªªë(²Ê(ºË(uUUS˜ê*ª†¨¢‡0‰Ž¡Ì"cœÆÂ&ÖÁ/ˆï<$ÈX’SŠ7æ? õS0*œNBµæÚ³SܤCÖF"äÇÐÔ7nŸQG¬ƒ¯¢²·û?ùO2åý ºÉó>Mšå—sœå–)È/§ÉdÆf[{Y/î™îþ|“[=̲º[É1¸·ŽãÝlÄã±®Ò m…®5&Ã[\Ooi
+ÛÃëµÍäfA acFh£‹¸
+>kTD¢ ªyM1…
+PkoƵ1@C¥@ŠlCæíû×ÒÏcÈõH³f=©Èm”)€ !­~Q0†ƒA öíXÿ
+‡‹zé$q^K8ÉßFiJJÂum-ò¬À¡ ^ÌÃÏ°–9òù ÌËÆÊÞ€U³³r
+R¡ )Kì
+Y§˜QP¡ßßÿ
+®Ÿ1,µ·sÆ:‡™`âÝ1”UÃk&ŒŒSæRl2nãÞ5v‚.ÕÙâÃ{³‚\¬É¼}¸¿ œö6»^2~Õ½óŒn2žBϸÚ:w ÒMâ kjî^ PQ¹Þ»íÈùÅ„QsæÛök|QÍÕŽ /Hù•ü·û§øŽ:òîDióü69"³³rÛ-ïy-ñ·L༶rã¦/4ß6ë:åÀW“^MŒ„&+/)QF¤-¦Ev: Ø "û‘dS­ ;'<¾$¬â9k`NE8·pg4SŽ+?ÀÕp1Øï5<n'w/Œd$\*,&7HòO1ô›Å¥Ù¯êz6=Ä2ƒ
+Ð/+''5 "þfû9X‰x§Ž#äâäãÜ&í„ŒsöŠ"é‹ö.‘IÓ7UIÃW &²*BÅÏÀÇâ¦m’Ô⟉¥Ò¬œ1VgŽ¹O#Óë#›*)¶c ˜Î@!nÄâD›_…!@X˜?i%ãÔ–—ÉýGúØSJámÛŠí„Œ¹-‰xùè –ˆ¿Š˜Šv‹Ø÷ìÜ‹†ÎP9ÒU3”@@JaÊ`
+…0€˜´ÃÕ@4
+}¹@NQn¹‰ÿ
+¬Íq¤ÐÈ=9Ö4V1²,©Au'¦6æ8îD¿#™µÒ¶¾í/÷÷1치£«wÆÌHÞʶä
+#½
+ü:r¯*îi9&R6n.Yãc8¸œ³1$î& p2í­&Np <Çܦh†‡QEP$ÆNckboøÇ`ñ+[þÇ·šA3E¹¬Ùöá˃”DzáAÞ»UExéã“(åË·k¬ºŠ,¡Ž4WŒœnc£7î£ÓI¥LôJNÄД… ¶:€{µ /i7g
+º‰¦%n‰JR&º(¡
+'µâ˜kÏž·ÁYHÏgó‘¯e½ÖNà„·1í`±DÛC’@ò#ƒôëÀì˜ÆEÆJæ0—Y9 å]©h O>„Úü ¶#EÙȽ¥˜\4
+¿·Îª>¹ËŒ²l Óð@ð²eVÙ–x§”A™pÉBÈz‡˜µfÝŒ›ÇRŽ\b'Œ¢Ñw¾”Úü/æ3</¯=.Íó[oÇ åÖöþIRD°{¥’Î)§(O¥n²Ü'­!ü¯s³v©5»¨Ö‘e8_!´ÆÆd»ls¼Q*Ó9Pr‘·j¶m(‘¹j¥~Hrœ¥9D¦
+ýWªt•HÙ^9]H*ÈÀe#Á  Çß·½)JVêT dÅlrù#SÂÏb%×±806Ç€R¤&Þ‘~¨ÂR
+¸ÿ
+¦UR‰—¬©yi§ÈÃ9WÏ°* ùèCØv/mý„kÊçÅÖOÅÏRms{žß)É.2fíìȪÜ[¡ßžÅï ãÆϬ‡töìÜôëŒËmøLXk+sô%­Qmå#GÎÚ&`~»÷Ëþ ßíý+ÇàÈoØ¿ÔÃZæ©TOýãç_öm¹Ö´{~šן°Ý|ÝÏþ3ÿ
+óJí­,,ìSÓ´·Žö! þ§Üýüýkäò<‡nÅÜÒ”¥rëe+ð¡B GØ×úù×ÑdVF•VØ‚4G÷PÈò>ÿ
+J`gŒ´lŒqçÉp¼c7Â_®§±£ï
+qœ§QHOÒ7?ܦ·ÇæDw_ê*8µ819:é””·­ÂP`™—`!òØ
+âá§!î(ôe`¤ØKÇ82ÅEìk¶ïZªv˨ÕÁpÙER9›¹Efë§ItUHàU1C•¬½Y^Údmmï¬. ¼³º‰'·º¶•'‚xdPñɱ³#£¡ ¬¤‚ ëÞ4:<nÑÈŒŽŒUÑÔ«+)!•”€C ùk[ÝC_ˆ\ 9MÅÛ¥¿@=¹,L³o=ÒzPì­)+*I‘N®ötÊ­å")“¤<¡2¦7œ`†ÔD ‡Ô?Ä*µsÓÑNòè­ý‹rýÅ(˜ôˆ Òó—ÇpðgT:sjÎ:Ó!)娠•B°HTX`]Qÿ
+n…I¾¤Ô)Ó0Š!]º½«+ªºÊÀ2²U•†Áx ‚#ÁjA ‚$Fˆ#Á ƒî)JRµ­)JR”¥)JR”¥P>Jò“;ÄóùÇ“¹~ȸºÜAÙž]´ºLIûH™9Â[Vœ:Eq?|^Ò‘°ÒŠ[¶™=yÝ(ÂÜ‚”~$lu*«^w•§Žm § _·$%cØöìÕÝxÝ·,“HkvصíØçó×켂ÍØÅÃÃÅ´u!% ñtZ³fÝg ªšI˜Á©3Ç;ÆzsÄ£>]¶~Z^q×G ¶ÖPc&²s8§
+Û²Œ¤äàeÖF7 òBê‡z”„EÍ–Šxí¤MjH¶k!ñ+i6q3o’ï·ÓW[<‰1äãí´k¿8â{hR:©Ëd M³²‚ ƒ
+ $û5ËÇÛµÝõ•ªo¾æê^Ot²¢ ©ÙñYÉñßH[b!1.2.8‡y…bѤ?WI:„A ,]B"B˜¡>Ö
+<( @ñõñ÷5ð™‚#ìþ@;þc½A¡¦Aßo¿`ú~€ü¾êWwû›$õE¤AÁa@>Ú×Óéüµ_V@5ÞÚÖ½þ•à
+
+\o[QúsT¯ˆ’ Ïý úlüÃýoé^ò¸DÚéP£°ß½Tpäl.
+µ^Ió“ˆ<>¶œÝœ™äf%ÃqMÈqM+Êñ‰c7$±¬èÁÛI.½Å?&² ÖQ´\$[ù@™³eL­MœˆøŠ|]¹2­g¹arã›reãÞZ˜j:;Å%
+ µ¹Ò2"™nªPÐÕwÞw†@¸dnëöë¹o{®]B+-sÝó²—-Ã&ªIÔ‘š™töIꉢšhî\ªb$B&)@­…ž ?..´I+cønàÇjâMQnžwäK›O6ôòŽ=U¯ˆ å!òMîÎ^K‚4®nÛ› ½¶gPŒ’5¿xE
+ìÁ“—üïåÿ
+9;—ÙúüÎS(”
+7#¶1–}œ‹˜Ø(©øÿ
+Ì?ŒP`‡ìÿ
+¥Sù–ÝœcgÁ·•½/¹sªŒ-eƹ¹îÉUPIg´<YX©3l‚Îä82-˜1Ew¯E¢*¬M¶nù;û|V& œ¾RîDŠÛŠ·–úòyd`¨‘Án’9%˜ èoÞµp"‰ç™’"Vy&™Ö(£Efyªªä’j°€
+ˆ*ž(²%[½º¢?†¨T/LŽÁEYD•bÌ{øLpAD§Œ–‰Êh.G1Å‘kJ͵¬H6–ÝŸoB22ê Â1ªMÒ×;§¯W1
+
+;xªïd¤]gÒ/—]ëç º]eþˆ|
+«•DeÌæòyûùrYk¹.îå
+GÒª"ÿ
+%S9 %²ÌþÜeÈŽÞÍãwמ¸‹¥ü«U7¶R’:€²öEÄ”‹8ö-ÄÅ"0Öl…ŸŠ)4HzÌlYüC~ËûcËóÜë¦9µÇ~þ½¸Êßñ{ÆX¡†þêC5ÑÅÜ”dXf™ä‘mç1$Ý‘ÉØVEð»ÚcqvX^Smq«(¢µ·ÊZ'ªÞ%Tˆ]@djɪґ²ŠÇfÏC-Ù&ÐPŠöz@>z÷üÁþ#íßUö#’­Eÿ
+@/ÃCÒ=Ôì !ÐþþÂ;¸ko;ÄÈ
+åDM° ˜
+þb‡!s7Ë·ª2-Ý×ëЈ‡qÑ‹Û·Pë¨}Ç[ïØu†ˆ¼òW,/´(WaÒÙƒ/§(œEÒpl]®Ü¢aUd]>Y©ÊP*‰Š"Q:bcg+öuco±¼£/ GX—Š\$çL¯ï YMøÖÌu¿>úûÔ}øƒ1#eß®óš·1 ‚{¾Zä1}»7½oßïæ¬Z•wö/‡·>²‹4ä1Ÿ¹‘X*ØÏ}bq§4]ÌÕhUJ&æß²¤;b¬r"eÊqH1Su˜
+ •wwMË Õ³ž“
+7%Fÿ
+¡ .ÎÕ!"†²¬³ðßøÔaÔ×w=Á{úëŽHÊ/±5Ý‹³šJ¬ePƒÆ×ÍËt¢Cšo Y¸Q_) e¶*ÊT {ì@4¯Ÿµd!àÍ’VnB”é/œòúdÄæé S€há ”)ä•é)ÄH&
+Ñ1¨º28>Àþ[Ðóùþ‡~HóWnîmÄ2‹®šD(w:§)
+
+±KÄå¾b‹ öú0##‡ÊRØúÍXÆIÂv‚£+òâh2¹²,£´ÒFéGM·”=ø>ê[òнÔ×ì rFrCgo*Y ¤wM9_à†»–*¡œR<Çœñ¾ gë_ȲÞÊ„Úc¡(÷W, h„"ˆÐÓI¨Ô6ÌU ¿`Ì;Éîn(Ö}’Îðg],‰ÍHGª[–ö1e Ž \Š+H3tˆ¤‰né…Û(‹¯WÔâ9ô:s}€8¿†øÙ¬F2¶m'$‹2Ü÷¤Ê曾oMÑ\—+²úÇ%ÎåëxvEanD¹|÷ðX¦îN€Ü
+i‘2”‰©…”¥
+Ol#
+H-$2·±;ò vW%7åâ
+é»TüÚú–…Û´Û¸ƒ* ó·¸H5­€ èm³˜*OûØŽô:)÷ïõ7m
+ä‹!›8¸À»³„Ä1ˆ`k{A–NÑv %­f•ýÚ‰(rª¤'¤)f¡:a§¢!÷8†À=ûûoæ>áP¿/ðוÁÞ=¦Gyc<nCug4/·ºº?/ËZnýžc…n,oínámj[yâ–6öNŽAÖˆ÷>|¨©»òÀ,‚‚wùL?ÇöÖ‡¾ƒ¸ë¿°ÿ
+D[¶lܪ,áeT•4’LÊ(a‚"SÀO»ç.MDf>^@KÙxÝší¤íì?*Ec.ëåTÔEÂJÞÌ”¿µm^ÆEÄ¢±º&Mæ¦á8X⦴­ìè¿ÃW!å9«lf')_QMÍì°¼v–p’;¦¹œ¨TU^â~9ј])æxN)–ÿ
+ P6¶Xçx©øYñwá+‡’ÜMã^-ÂwݳsBKå±Ã–|u‡vX=tlƒéBÕ$]°³ë~jR6yi„`¿o7§.Þ«Y'€€÷
+âg`áîxI{nàŽg1=úf&AÝ°“Š“j«)÷­•)’rÑëEÖlåJdÖEE9D¦ªOœñ{~iÄó¼bå‚G—°–Ù$ ‘ãRÛLÃê!¸Ž9
+ÿ
+S
+/¼I'MÖ˜S]"
+?Ÿõí­÷ïõù@Œ²¡D;¸ý'ÖÃèõ °þûz”Ë
+.¡n¢‹®áB"‚ uªªª¨`"H¤™
+U0)µŽR™A1€«Õoû¬_þÁÿ
+$%ÏlÂψXŠD,«'`TÄUTE0
+«`R—±@
+%%EndData
+end
+%%PageTrailer
+%%Trailer
+%%BoundingBox: 0 0 313 370
+%%HiResBoundingBox: 0 0 313 370
+%%EOF
+
+%%EndDocument
+ @endspecial 1766 4333 a FG(\(b\))25 b(Sub)r(caption)g(for)i(Second)e
+(P)n(art)1312 4531 y FQ(Figure)31 b(78:)p 0 TeXcolorgray
+Black 41 w(Example)g(of)f(Con)m(tin)m(ued)h(Figure)g(\(con)m(t'd\))p
+Black Black 2227 5640 a(118)p Black eop end
+%%Page: 119 119
+TeXDict begin 119 118 bop Black 0 TeXcolorgray Black
+Black Black 1453 109 a @beginspecial 0 @llx 0 @lly 144
+@urx 54 @ury 850 @rwi @setspecial
+%%BeginDocument: graphic.eps
+%!PS-Adobe-2.0 EPSF-2.0
+%%Title: graphic.eps
+%%Creator: fig2dev Version 3.2 Patchlevel 0-beta2
+%%CreationDate: Thu Dec 11 20:58:11 1997
+%%For: Keith Reckdahl
+%%Orientation: Portrait
+%%BoundingBox: 0 0 144 54
+%%Pages: 0
+%%BeginSetup
+%%IncludeFeature: *PageSize Letter
+%%EndSetup
+%%Magnification: 1.00
+%%EndComments
+/$F2psDict 200 dict def
+$F2psDict begin
+$F2psDict /mtrx matrix put
+/col-1 {0 setgray} bind def
+/col0 {0.000 0.000 0.000 srgb} bind def
+/col1 {0.000 0.000 1.000 srgb} bind def
+/col2 {0.000 1.000 0.000 srgb} bind def
+/col3 {0.000 1.000 1.000 srgb} bind def
+/col4 {1.000 0.000 0.000 srgb} bind def
+/col5 {1.000 0.000 1.000 srgb} bind def
+/col6 {1.000 1.000 0.000 srgb} bind def
+/col7 {1.000 1.000 1.000 srgb} bind def
+/col8 {0.000 0.000 0.560 srgb} bind def
+/col9 {0.000 0.000 0.690 srgb} bind def
+/col10 {0.000 0.000 0.820 srgb} bind def
+/col11 {0.530 0.810 1.000 srgb} bind def
+/col12 {0.000 0.560 0.000 srgb} bind def
+/col13 {0.000 0.690 0.000 srgb} bind def
+/col14 {0.000 0.820 0.000 srgb} bind def
+/col15 {0.000 0.560 0.560 srgb} bind def
+/col16 {0.000 0.690 0.690 srgb} bind def
+/col17 {0.000 0.820 0.820 srgb} bind def
+/col18 {0.560 0.000 0.000 srgb} bind def
+/col19 {0.690 0.000 0.000 srgb} bind def
+/col20 {0.820 0.000 0.000 srgb} bind def
+/col21 {0.560 0.000 0.560 srgb} bind def
+/col22 {0.690 0.000 0.690 srgb} bind def
+/col23 {0.820 0.000 0.820 srgb} bind def
+/col24 {0.500 0.190 0.000 srgb} bind def
+/col25 {0.630 0.250 0.000 srgb} bind def
+/col26 {0.750 0.380 0.000 srgb} bind def
+/col27 {1.000 0.500 0.500 srgb} bind def
+/col28 {1.000 0.630 0.630 srgb} bind def
+/col29 {1.000 0.750 0.750 srgb} bind def
+/col30 {1.000 0.880 0.880 srgb} bind def
+/col31 {1.000 0.840 0.000 srgb} bind def
+
+end
+save
+-2.0 61.0 translate
+1 -1 scale
+
+/cp {closepath} bind def
+/ef {eofill} bind def
+/gr {grestore} bind def
+/gs {gsave} bind def
+/sa {save} bind def
+/rs {restore} bind def
+/l {lineto} bind def
+/m {moveto} bind def
+/rm {rmoveto} bind def
+/n {newpath} bind def
+/s {stroke} bind def
+/sh {show} bind def
+/slc {setlinecap} bind def
+/slj {setlinejoin} bind def
+/slw {setlinewidth} bind def
+/srgb {setrgbcolor} bind def
+/rot {rotate} bind def
+/sc {scale} bind def
+/sd {setdash} bind def
+/ff {findfont} bind def
+/sf {setfont} bind def
+/scf {scalefont} bind def
+/sw {stringwidth} bind def
+/tr {translate} bind def
+/tnt {dup dup currentrgbcolor
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb}
+ bind def
+/shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul
+ 4 -2 roll mul srgb} bind def
+/$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def
+/$F2psEnd {$F2psEnteredState restore end} def
+%%EndProlog
+
+$F2psBegin
+10 setmiterlimit
+n 0 1048 m 0 0 l 2473 0 l 2473 1048 l cp clip
+ 0.06000 0.06000 sc
+% Polyline
+30.000 slw
+n 2400 975 m 75 975 l 75 150 l 2400 150 l cp gs col-1 s gr
+/Times-Bold ff 360.00 scf sf
+1220 705 m
+gs 1 -1 sc (Graphic) dup sw pop 2 div neg 0 rm col-1 sh gr
+$F2psEnd
+rs
+
+%%EndDocument
+ @endspecial 1479 206 a FG(\(a\))26 b(First)g(Sub\014gure)2459
+109 y @beginspecial 0 @llx 0 @lly 144 @urx 54 @ury 850
+@rwi @setspecial
+%%BeginDocument: graphic.eps
+%!PS-Adobe-2.0 EPSF-2.0
+%%Title: graphic.eps
+%%Creator: fig2dev Version 3.2 Patchlevel 0-beta2
+%%CreationDate: Thu Dec 11 20:58:11 1997
+%%For: Keith Reckdahl
+%%Orientation: Portrait
+%%BoundingBox: 0 0 144 54
+%%Pages: 0
+%%BeginSetup
+%%IncludeFeature: *PageSize Letter
+%%EndSetup
+%%Magnification: 1.00
+%%EndComments
+/$F2psDict 200 dict def
+$F2psDict begin
+$F2psDict /mtrx matrix put
+/col-1 {0 setgray} bind def
+/col0 {0.000 0.000 0.000 srgb} bind def
+/col1 {0.000 0.000 1.000 srgb} bind def
+/col2 {0.000 1.000 0.000 srgb} bind def
+/col3 {0.000 1.000 1.000 srgb} bind def
+/col4 {1.000 0.000 0.000 srgb} bind def
+/col5 {1.000 0.000 1.000 srgb} bind def
+/col6 {1.000 1.000 0.000 srgb} bind def
+/col7 {1.000 1.000 1.000 srgb} bind def
+/col8 {0.000 0.000 0.560 srgb} bind def
+/col9 {0.000 0.000 0.690 srgb} bind def
+/col10 {0.000 0.000 0.820 srgb} bind def
+/col11 {0.530 0.810 1.000 srgb} bind def
+/col12 {0.000 0.560 0.000 srgb} bind def
+/col13 {0.000 0.690 0.000 srgb} bind def
+/col14 {0.000 0.820 0.000 srgb} bind def
+/col15 {0.000 0.560 0.560 srgb} bind def
+/col16 {0.000 0.690 0.690 srgb} bind def
+/col17 {0.000 0.820 0.820 srgb} bind def
+/col18 {0.560 0.000 0.000 srgb} bind def
+/col19 {0.690 0.000 0.000 srgb} bind def
+/col20 {0.820 0.000 0.000 srgb} bind def
+/col21 {0.560 0.000 0.560 srgb} bind def
+/col22 {0.690 0.000 0.690 srgb} bind def
+/col23 {0.820 0.000 0.820 srgb} bind def
+/col24 {0.500 0.190 0.000 srgb} bind def
+/col25 {0.630 0.250 0.000 srgb} bind def
+/col26 {0.750 0.380 0.000 srgb} bind def
+/col27 {1.000 0.500 0.500 srgb} bind def
+/col28 {1.000 0.630 0.630 srgb} bind def
+/col29 {1.000 0.750 0.750 srgb} bind def
+/col30 {1.000 0.880 0.880 srgb} bind def
+/col31 {1.000 0.840 0.000 srgb} bind def
+
+end
+save
+-2.0 61.0 translate
+1 -1 scale
+
+/cp {closepath} bind def
+/ef {eofill} bind def
+/gr {grestore} bind def
+/gs {gsave} bind def
+/sa {save} bind def
+/rs {restore} bind def
+/l {lineto} bind def
+/m {moveto} bind def
+/rm {rmoveto} bind def
+/n {newpath} bind def
+/s {stroke} bind def
+/sh {show} bind def
+/slc {setlinecap} bind def
+/slj {setlinejoin} bind def
+/slw {setlinewidth} bind def
+/srgb {setrgbcolor} bind def
+/rot {rotate} bind def
+/sc {scale} bind def
+/sd {setdash} bind def
+/ff {findfont} bind def
+/sf {setfont} bind def
+/scf {scalefont} bind def
+/sw {stringwidth} bind def
+/tr {translate} bind def
+/tnt {dup dup currentrgbcolor
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb}
+ bind def
+/shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul
+ 4 -2 roll mul srgb} bind def
+/$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def
+/$F2psEnd {$F2psEnteredState restore end} def
+%%EndProlog
+
+$F2psBegin
+10 setmiterlimit
+n 0 1048 m 0 0 l 2473 0 l 2473 1048 l cp clip
+ 0.06000 0.06000 sc
+% Polyline
+30.000 slw
+n 2400 975 m 75 975 l 75 150 l 2400 150 l cp gs col-1 s gr
+/Times-Bold ff 360.00 scf sf
+1220 705 m
+gs 1 -1 sc (Graphic) dup sw pop 2 div neg 0 rm col-1 sh gr
+$F2psEnd
+rs
+
+%%EndDocument
+ @endspecial 2446 206 a(\(b\))f(Second)g(Sub\014gure)1766
+404 y FQ(Figure)31 b(79:)p 0 TeXcolorgray Black 42 w(Tw)m(o)f
+(Sub\014gures)p Black 826 695 a FE(\\subfloat[First)43
+b(Subfigure]{)1022 786 y(\\label{fig:contfig:subone})320
+b(\045\045)40 b(label)g(for)g(first)g(subfigure)1022
+878 y(\\includegraphics[width=3cm]{)q(grap)q(hic}})826
+969 y(\\hspace{1cm})826 1060 y(\045\045----start)i(of)e(second)g
+(subfigure----)826 1152 y(\\subfloat[Second)j(Subfigure]{)1022
+1243 y(\\label{fig:contfig:subtwo})320 b(\045\045)40
+b(label)g(for)g(second)h(subfigure)1022 1334 y
+(\\includegraphics[width=3cm]{)q(grap)q(hic}})826 1426
+y(\\caption{Two)h(Subfigures})826 1517 y(\\label{fig:contfig:one})437
+b(\045\045)40 b(label)g(for)g(first)g(part)708 1608 y(\\end{figure})708
+1791 y(\\begin{figure})826 1882 y(\\ContinuedFloat)826
+1973 y(\\centering)826 2065 y(\045\045----start)i(of)e(third)g
+(subfigure----)826 2156 y(\\subfloat[Third)j(Subfigure]{)1022
+2247 y(\\label{fig:contfig:subthree})320 b(\045\045)40
+b(label)h(for)e(third)i(subfigure)1022 2339 y
+(\\includegraphics[width=3cm]{)q(grap)q(hic}})826 2430
+y(\\hspace{1cm})826 2521 y(\045\045----start)h(of)e(fourth)g
+(subfigure----)826 2613 y(\\subfloat[Fourth)j(Subfigure]{)1022
+2704 y(\\label{fig:contfig:subfour})320 b(\045\045)40
+b(label)g(for)g(fourth)h(subfigure)1022 2795 y
+(\\includegraphics[width=3cm]{)q(grap)q(hic}})826 2887
+y(\\caption{Two)h(Additional)g(Subfigures})826 2978 y
+(\\label{fig:contfig:two})437 b(\045\045)40 b(label)g(for)g(second)g
+(part)708 3069 y(\\end{figure})630 3224 y FQ(Creates)31
+b(one)f(\015oat)h(that)f(con)m(tains)h(Figures)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 31 w(79a)p Black 31 w(and)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 29 w(79b)p Black 31 w(and)e(another)h(\015oat)h(that)g
+(con)m(tains)630 3337 y(Figures)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 44 w(79c)p Black 45 w(and)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 43 w(79d)p Black(.)82 b(Note)45 b(that)f(the)g
+FM(\\ContinuedFloat)c FQ(command)k(not)g(only)g(giv)m(es)630
+3450 y(the)33 b(\015oats)h(the)f(same)h(Figure)f(n)m(um)m(b)s(er,)g(it)
+h(also)g(ensures)e(that)h(the)h(second)f(\015oat's)h(sub\014gure)630
+3562 y(lettering)e(do)s(es)e(not)h(reset)f(to)i(\(a\).)771
+3675 y(The)20 b(t)m(w)m(o)i(captions)f(ha)m(v)m(e)g(di\013eren)m(t)g
+(lab)s(els)f(\()p FM({fig:contfig:one})c FQ(and)k FM({fig:contfig:two})
+p FQ(\))630 3788 y(whic)m(h)26 b(b)s(oth)f(pro)s(duce)g(the)h(same)g
+FM(\\ref)f FQ(v)-5 b(alue)27 b(but)e(ma)m(y)i(pro)s(duce)d(di\013eren)m
+(t)j FM(\\pageref)d FQ(v)-5 b(alues)630 3901 y(since)31
+b(they)f(can)h(b)s(e)f(on)g(di\013eren)m(t)h(pages.)771
+4014 y(Since)40 b(four)e(sub\014gures)g(could)i(easily)g(\014t)g(in)f
+(one)h(\015oat,)i(this)e(example)g(ob)m(viously)g(do)s(es)630
+4127 y(not)28 b(require)f(the)g FM(\\ContinuedFloat)d
+FQ(command.)39 b(But)28 b(this)f(example)h(is)g(mean)m(t)g(to)g(sho)m
+(w)g(the)630 4240 y(pro)s(cedure)h(for)h(larger)h(collections)i(of)e
+(sub\014gures.)p Black 1453 5112 a @beginspecial 0 @llx
+0 @lly 144 @urx 54 @ury 850 @rwi @setspecial
+%%BeginDocument: graphic.eps
+%!PS-Adobe-2.0 EPSF-2.0
+%%Title: graphic.eps
+%%Creator: fig2dev Version 3.2 Patchlevel 0-beta2
+%%CreationDate: Thu Dec 11 20:58:11 1997
+%%For: Keith Reckdahl
+%%Orientation: Portrait
+%%BoundingBox: 0 0 144 54
+%%Pages: 0
+%%BeginSetup
+%%IncludeFeature: *PageSize Letter
+%%EndSetup
+%%Magnification: 1.00
+%%EndComments
+/$F2psDict 200 dict def
+$F2psDict begin
+$F2psDict /mtrx matrix put
+/col-1 {0 setgray} bind def
+/col0 {0.000 0.000 0.000 srgb} bind def
+/col1 {0.000 0.000 1.000 srgb} bind def
+/col2 {0.000 1.000 0.000 srgb} bind def
+/col3 {0.000 1.000 1.000 srgb} bind def
+/col4 {1.000 0.000 0.000 srgb} bind def
+/col5 {1.000 0.000 1.000 srgb} bind def
+/col6 {1.000 1.000 0.000 srgb} bind def
+/col7 {1.000 1.000 1.000 srgb} bind def
+/col8 {0.000 0.000 0.560 srgb} bind def
+/col9 {0.000 0.000 0.690 srgb} bind def
+/col10 {0.000 0.000 0.820 srgb} bind def
+/col11 {0.530 0.810 1.000 srgb} bind def
+/col12 {0.000 0.560 0.000 srgb} bind def
+/col13 {0.000 0.690 0.000 srgb} bind def
+/col14 {0.000 0.820 0.000 srgb} bind def
+/col15 {0.000 0.560 0.560 srgb} bind def
+/col16 {0.000 0.690 0.690 srgb} bind def
+/col17 {0.000 0.820 0.820 srgb} bind def
+/col18 {0.560 0.000 0.000 srgb} bind def
+/col19 {0.690 0.000 0.000 srgb} bind def
+/col20 {0.820 0.000 0.000 srgb} bind def
+/col21 {0.560 0.000 0.560 srgb} bind def
+/col22 {0.690 0.000 0.690 srgb} bind def
+/col23 {0.820 0.000 0.820 srgb} bind def
+/col24 {0.500 0.190 0.000 srgb} bind def
+/col25 {0.630 0.250 0.000 srgb} bind def
+/col26 {0.750 0.380 0.000 srgb} bind def
+/col27 {1.000 0.500 0.500 srgb} bind def
+/col28 {1.000 0.630 0.630 srgb} bind def
+/col29 {1.000 0.750 0.750 srgb} bind def
+/col30 {1.000 0.880 0.880 srgb} bind def
+/col31 {1.000 0.840 0.000 srgb} bind def
+
+end
+save
+-2.0 61.0 translate
+1 -1 scale
+
+/cp {closepath} bind def
+/ef {eofill} bind def
+/gr {grestore} bind def
+/gs {gsave} bind def
+/sa {save} bind def
+/rs {restore} bind def
+/l {lineto} bind def
+/m {moveto} bind def
+/rm {rmoveto} bind def
+/n {newpath} bind def
+/s {stroke} bind def
+/sh {show} bind def
+/slc {setlinecap} bind def
+/slj {setlinejoin} bind def
+/slw {setlinewidth} bind def
+/srgb {setrgbcolor} bind def
+/rot {rotate} bind def
+/sc {scale} bind def
+/sd {setdash} bind def
+/ff {findfont} bind def
+/sf {setfont} bind def
+/scf {scalefont} bind def
+/sw {stringwidth} bind def
+/tr {translate} bind def
+/tnt {dup dup currentrgbcolor
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb}
+ bind def
+/shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul
+ 4 -2 roll mul srgb} bind def
+/$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def
+/$F2psEnd {$F2psEnteredState restore end} def
+%%EndProlog
+
+$F2psBegin
+10 setmiterlimit
+n 0 1048 m 0 0 l 2473 0 l 2473 1048 l cp clip
+ 0.06000 0.06000 sc
+% Polyline
+30.000 slw
+n 2400 975 m 75 975 l 75 150 l 2400 150 l cp gs col-1 s gr
+/Times-Bold ff 360.00 scf sf
+1220 705 m
+gs 1 -1 sc (Graphic) dup sw pop 2 div neg 0 rm col-1 sh gr
+$F2psEnd
+rs
+
+%%EndDocument
+ @endspecial 1466 5209 a FG(\(c\))25 b(Third)h(Sub\014gure)2459
+5112 y @beginspecial 0 @llx 0 @lly 144 @urx 54 @ury 850
+@rwi @setspecial
+%%BeginDocument: graphic.eps
+%!PS-Adobe-2.0 EPSF-2.0
+%%Title: graphic.eps
+%%Creator: fig2dev Version 3.2 Patchlevel 0-beta2
+%%CreationDate: Thu Dec 11 20:58:11 1997
+%%For: Keith Reckdahl
+%%Orientation: Portrait
+%%BoundingBox: 0 0 144 54
+%%Pages: 0
+%%BeginSetup
+%%IncludeFeature: *PageSize Letter
+%%EndSetup
+%%Magnification: 1.00
+%%EndComments
+/$F2psDict 200 dict def
+$F2psDict begin
+$F2psDict /mtrx matrix put
+/col-1 {0 setgray} bind def
+/col0 {0.000 0.000 0.000 srgb} bind def
+/col1 {0.000 0.000 1.000 srgb} bind def
+/col2 {0.000 1.000 0.000 srgb} bind def
+/col3 {0.000 1.000 1.000 srgb} bind def
+/col4 {1.000 0.000 0.000 srgb} bind def
+/col5 {1.000 0.000 1.000 srgb} bind def
+/col6 {1.000 1.000 0.000 srgb} bind def
+/col7 {1.000 1.000 1.000 srgb} bind def
+/col8 {0.000 0.000 0.560 srgb} bind def
+/col9 {0.000 0.000 0.690 srgb} bind def
+/col10 {0.000 0.000 0.820 srgb} bind def
+/col11 {0.530 0.810 1.000 srgb} bind def
+/col12 {0.000 0.560 0.000 srgb} bind def
+/col13 {0.000 0.690 0.000 srgb} bind def
+/col14 {0.000 0.820 0.000 srgb} bind def
+/col15 {0.000 0.560 0.560 srgb} bind def
+/col16 {0.000 0.690 0.690 srgb} bind def
+/col17 {0.000 0.820 0.820 srgb} bind def
+/col18 {0.560 0.000 0.000 srgb} bind def
+/col19 {0.690 0.000 0.000 srgb} bind def
+/col20 {0.820 0.000 0.000 srgb} bind def
+/col21 {0.560 0.000 0.560 srgb} bind def
+/col22 {0.690 0.000 0.690 srgb} bind def
+/col23 {0.820 0.000 0.820 srgb} bind def
+/col24 {0.500 0.190 0.000 srgb} bind def
+/col25 {0.630 0.250 0.000 srgb} bind def
+/col26 {0.750 0.380 0.000 srgb} bind def
+/col27 {1.000 0.500 0.500 srgb} bind def
+/col28 {1.000 0.630 0.630 srgb} bind def
+/col29 {1.000 0.750 0.750 srgb} bind def
+/col30 {1.000 0.880 0.880 srgb} bind def
+/col31 {1.000 0.840 0.000 srgb} bind def
+
+end
+save
+-2.0 61.0 translate
+1 -1 scale
+
+/cp {closepath} bind def
+/ef {eofill} bind def
+/gr {grestore} bind def
+/gs {gsave} bind def
+/sa {save} bind def
+/rs {restore} bind def
+/l {lineto} bind def
+/m {moveto} bind def
+/rm {rmoveto} bind def
+/n {newpath} bind def
+/s {stroke} bind def
+/sh {show} bind def
+/slc {setlinecap} bind def
+/slj {setlinejoin} bind def
+/slw {setlinewidth} bind def
+/srgb {setrgbcolor} bind def
+/rot {rotate} bind def
+/sc {scale} bind def
+/sd {setdash} bind def
+/ff {findfont} bind def
+/sf {setfont} bind def
+/scf {scalefont} bind def
+/sw {stringwidth} bind def
+/tr {translate} bind def
+/tnt {dup dup currentrgbcolor
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add
+ 4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb}
+ bind def
+/shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul
+ 4 -2 roll mul srgb} bind def
+/$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def
+/$F2psEnd {$F2psEnteredState restore end} def
+%%EndProlog
+
+$F2psBegin
+10 setmiterlimit
+n 0 1048 m 0 0 l 2473 0 l 2473 1048 l cp clip
+ 0.06000 0.06000 sc
+% Polyline
+30.000 slw
+n 2400 975 m 75 975 l 75 150 l 2400 150 l cp gs col-1 s gr
+/Times-Bold ff 360.00 scf sf
+1220 705 m
+gs 1 -1 sc (Graphic) dup sw pop 2 div neg 0 rm col-1 sh gr
+$F2psEnd
+rs
+
+%%EndDocument
+ @endspecial 2449 5209 a(\(d\))f(F)-6 b(ourth)25 b(Sub\014gure)1540
+5407 y FQ(Figure)31 b(79:)p 0 TeXcolorgray Black 42 w(Tw)m(o)f
+(Additional)h(Sub\014gures)p Black Black 2227 5640 a(119)p
+Black eop end
+%%Page: 120 120
+TeXDict begin 120 119 bop Black 0 TeXcolorgray Black
+Black 630 -149 a FD(References)p Black 675 54 a FQ([1])p
+Black 47 w(Leslie)31 b(Lamp)s(ort,)40 b Fy(L)1508 38
+y Fu(A)1547 54 y Fy(T)1597 74 y(E)1646 54 y(X:)i(A)32
+b(Do)-5 b(cument)33 b(Pr)-5 b(ep)g(ar)g(ation)36 b(System,)d(Se)-5
+b(c)g(ond)34 b(Edition)p FQ(,)817 167 y(Addison-W)-8
+b(esley)g(,)32 b(Reading,)f(Massac)m(h)m(usetts,)i(1994,)f(ISBN)f
+(0-201-52983-1)p Black 675 355 a([2])p Black 47 w(Helm)m(ut)g(Kopk)-5
+b(a)30 b(and)g(P)m(atric)m(k)i(Daly)-8 b(,)43 b Fy(A)32
+b(Guide)g(to)i(L)2667 338 y Fu(A)2706 355 y Fy(T)2756
+374 y(E)2805 355 y(X,)e(F)-7 b(ourth)34 b(Edition)p FQ(,)817
+468 y(Addison-W)-8 b(esley)g(,)32 b(Reading,)f(Massac)m(h)m(usetts,)i
+(2004,)f(ISBN)f(0-321-17385-6)p Black 675 655 a([3])p
+Black 47 w(F)-8 b(rank)28 b(Mittelbac)m(h)j(and)d(Mic)m(hel)h(Go)s
+(ossens,)h(with)e(Johannes)f(Braams,)j(Da)m(vid)f(Carlisle,)817
+768 y(and)h(Chris)f(Ro)m(wley)-8 b(,)42 b Fy(The)33 b(L)1794
+752 y Fu(A)1833 768 y Fy(T)1883 788 y(E)1932 768 y(X)f(Comp)-5
+b(anion,)35 b(Se)-5 b(c)g(ond)34 b(Edition)p FQ(,)41
+b(Addison-W)-8 b(esley)817 881 y(P)m(earson)31 b(Education,)g(Boston,)g
+(Massac)m(h)m(usetts,)i(2004,)f(ISBN)f(0-201-36299-6)p
+Black 675 1069 a([4])p Black 47 w(Mic)m(hel)h(Go)s(ossens,)e(Sebastian)
+h(Rah)m(tz,)g(and)f(F)-8 b(rank)30 b(Mittelbac)m(h,)43
+b Fy(The)33 b(L)3372 1052 y Fu(A)3411 1069 y Fy(T)3461
+1088 y(E)3510 1069 y(X)f(Gr)-5 b(aphics)817 1182 y(Comp)g(anion)p
+FQ(,)43 b(Addison-W)-8 b(esley)g(,)32 b(Reading,)f(Massac)m(h)m
+(usetts,)i(1997,)817 1295 y(ISBN)d(0-201-85469-4)p Black
+675 1482 a([5])p Black 47 w(Mic)m(hel)i(Go)s(ossens,)f(Sebastian)f(Rah)
+m(tz,)i(and)e(F)-8 b(rank)30 b(Mittelbac)m(h,)43 b Fy(The)33
+b(L)3373 1466 y Fu(A)3412 1482 y Fy(T)3462 1502 y(E)3511
+1482 y(X)f(Web)817 1595 y(Comp)-5 b(anion)p FQ(,)43 b(Addison-W)-8
+b(esley)g(,)32 b(Reading,)f(Massac)m(h)m(usetts,)i(1999,)817
+1708 y(ISBN)d(0-201-43311-7)p Black 675 1896 a([6])p
+Black 47 w(H\022)-45 b(an)30 b(Th)m(^)-43 b(e)1122 1876
+y(\023)1198 1896 y(Th\022)e(anh,)29 b(Sebastian)i(Rah)m(tz,)h(Hans)e
+(Hagen,)h(Hartm)m(ut)g(Henk)m(el,)h(P)m(a)m(w)m(el)817
+2009 y(Jac)m(k)m(o)m(wski,)43 b Fy(The)32 b(p)-5 b(dfT)1626
+2028 y(E)1677 2009 y(X)32 b(user)h(manual)p FQ(,)42 b(Av)-5
+b(ailable)32 b(as)p 0.05 1.00 1.00 0.40 TeXcolorcmyk
+817 2122 a FM(CTAN/systems/pdftex/manu)o(al/)o(pdft)o(ex-l)o(.pd)o(f)p
+Black Black 675 2309 a FQ([7])p Black 47 w(D.)f(P)-8
+b(.)31 b(Carlisle,)41 b Fy(Packages)33 b(in)f(the)h(`gr)-5
+b(aphics')34 b(bund)5 b(le)37 b FQ(\(Do)s(cumen)m(ts)32
+b(the)e FO(graphics)p FQ(,)817 2422 y FO(graphicx)p FQ(,)h
+FO(lscap)s(e)o FQ(,)g FO(colo)m(r)i FQ(pac)m(k)-5 b(ages\),)43
+b(Av)-5 b(ailable)32 b(as)p 0.05 1.00 1.00 0.40 TeXcolorcmyk
+817 2535 a FM(CTAN/macros/latex/requir)o(ed/)o(grap)o(hics)o(/gr)o
+(fgui)o(de.p)o(s)p Black Black 675 2723 a FQ([8])p Black
+47 w(T)-8 b(obias)31 b(Oetik)m(er,)42 b Fy(The)32 b(Not)h(So)g(Short)h
+(Intr)-5 b(o)g(duction)35 b(to)f(L)2855 2706 y Fu(A)2894
+2723 y Fy(T)2944 2742 y(E)2993 2723 y(X)14 b(2)3121 2737
+y Fz(")3208 2723 y FQ(Av)-5 b(ailable)32 b(at)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 817 2836 a FM(CTAN/info/lshort/english)o(/ls)o(hort)o
+(.pdf)p Black 24 w FQ(and)p 0.05 1.00 1.00 0.40 TeXcolorcmyk
+817 2948 a FM(CTAN/info/lshort/english)o(/ls)o(hort)o(.ps)p
+Black Black 675 3136 a FQ([9])p Black 47 w(Harv)m(ey)f(Green)m(b)s
+(erg,)41 b Fy(A)32 b(Simpli\014e)-5 b(d)34 b(Intr)-5
+b(o)g(duction)35 b(to)f(L)2775 3119 y Fu(A)2814 3136
+y Fy(T)2864 3156 y(E)2913 3136 y(X)54 b FQ(Av)-5 b(ailable)32
+b(at)p 0.05 1.00 1.00 0.40 TeXcolorcmyk 817 3249 a
+FM(CTAN/info/simplified-lat)o(ex/)o(simp)o(lifi)o(ed-)o(intr)o(o.ps)p
+Black Black 630 3437 a FQ([10])p Black 47 w(Da)m(vid)f(Carlisle,)42
+b Fy(The)32 b Fk(afterpage)h Fy(p)-5 b(ackage)p FQ(,)42
+b(Av)-5 b(ailable)32 b(as)p 0.05 1.00 1.00 0.40 TeXcolorcmyk
+817 3549 a FM(CTAN/macros/latex/requir)o(ed/)o(tool)o(s/af)o(ter)o
+(page)o(.dtx)p Black Black 630 3737 a FQ([11])p Black
+47 w(L)841 3720 y FP(A)880 3737 y FQ(T)931 3757 y(E)981
+3737 y(X3)f(Pro)5 b(ject)31 b(T)-8 b(eam,)42 b Fy(The)32
+b Fk(calc)h Fy(p)-5 b(ackage)p FQ(,)42 b(Av)-5 b(ailable)32
+b(as)p 0.05 1.00 1.00 0.40 TeXcolorcmyk 817 3850 a
+FM(CTAN/macros/latex/requir)o(ed/)o(tool)o(s/ca)o(lc.)o(dtx)p
+Black Black 630 4038 a FQ([12])p Black 47 w(Axel)f(Sommerfeldt,)40
+b Fy(T)-7 b(yp)i(esetting)34 b(c)-5 b(aptions)34 b(with)g(the)f
+Fk(caption)f Fy(p)-5 b(ackage)p FQ(,)42 b(Av)-5 b(ailable)32
+b(as)p 0.05 1.00 1.00 0.40 TeXcolorcmyk 817 4151 a
+FM(CTAN/macros/latex/contri)o(b/c)o(apti)o(on/c)o(apt)o(ion.)o(pdf)p
+Black Black 630 4338 a FQ([13])p Black 47 w(P)m(eter)f(R.)g(Wilson,)41
+b Fy(The)33 b Fk(ccaption)g Fy(p)-5 b(ackage)p FQ(,)41
+b(Av)-5 b(ailable)32 b(as)p 0.05 1.00 1.00 0.40 TeXcolorcmyk
+817 4451 a FM(CTAN/macros/latex/contri)o(b/c)o(capt)o(ion/)o(cca)o
+(ptio)o(n.pd)o(f)p Black Black 630 4639 a FQ([14])p Black
+47 w(James)e(Darrell)i(McCauley)f(and)f(Je\013)g(Goldb)s(erg,)41
+b Fy(The)33 b Fk(end\015oat)f Fy(Package)p FQ(,)41 b(Av)-5
+b(ailable)817 4752 y(as)p 0.05 1.00 1.00 0.40 TeXcolorcmyk
+30 w FM(CTAN/macros/latex/contrib/)o(endf)o(loa)o(t/en)o(dflo)o(at.)o
+(pdf)p Black Black 630 4939 a FQ([15])p Black 47 w(Rolf)31
+b(Nieprasc)m(hk)41 b Fy(The)32 b Fk(eso-pic)i Fy(p)-5
+b(ackage)p FQ(,)42 b(Av)-5 b(ailable)32 b(as)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 817 5052 a FM(CTAN/macros/latex/contri)o(b/e)o(so-p)o
+(ic/e)o(so-)o(pic.)o(pdf)p Black Black 630 5240 a FQ([16])p
+Black 47 w(Timoth)m(y)f(V)-8 b(an)30 b(Zandt,)40 b Fy(Do)-5
+b(cumentation)35 b(for)e(fancyb)-5 b(ox.sty)p FQ(,)42
+b(Av)-5 b(ailable)32 b(as)p 0.05 1.00 1.00 0.40 TeXcolorcmyk
+817 5353 a FM(CTAN/macros/latex/contri)o(b/f)o(ancy)o(box/)o(fan)o
+(cybo)o(x.do)o(c)p Black Black 2227 5640 a FQ(120)p Black
+eop end
+%%Page: 121 121
+TeXDict begin 121 120 bop Black 0 TeXcolorgray Black
+Black Black 630 -149 a FQ([17])p Black 47 w(Piet)31 b(v)-5
+b(an)30 b(Oostrum,)40 b Fy(Page)32 b(layout)i(in)f(L)2226
+-165 y Fu(A)2265 -149 y Fy(T)2315 -129 y(E)2364 -149
+y(X)p FQ(,)40 b(Av)-5 b(ailable)32 b(as)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 817 -36 a FM(CTAN/macros/latex/contri)o(b/f)o(ancy)o(hdr/)
+o(fan)o(cyhd)o(r.pd)o(f)p Black Black 630 144 a FQ([18])p
+Black 57 w Fy(The)g Fk(\015after)g Fy(p)-5 b(ackage)p
+FQ(,)41 b(Av)-5 b(ailable)32 b(as)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 30 w FM(CTAN/macros/latex/unpacked)o(/fl)o(afte)o(r.st)o
+(y)p Black Black 630 324 a FQ([19])p Black 47 w(Anselm)e(Lingnau,)40
+b Fy(A)n(n)32 b(Impr)-5 b(ove)g(d)35 b(Envir)-5 b(onment)34
+b(for)f(Flo)-5 b(ats)p FQ(,)43 b(Av)-5 b(ailable)32 b(as)p
+0.05 1.00 1.00 0.40 TeXcolorcmyk 817 437 a FM
+(CTAN/macros/latex/contri)o(b/f)o(loat)o(/flo)o(at.)o(dtx)p
+Black Black 630 616 a FQ([20])p Black 47 w(Hendri)e(Adriaens)40
+b Fy(The)33 b Fk(graphicx-psmin)f Fy(p)-5 b(ackage)p
+FQ(,)42 b(Av)-5 b(ailable)32 b(as)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 817 729 a FM(CTAN/macros/latex/contri)o(b/g)o(raph)o(icx-)
+o(psm)o(in/g)o(raph)o(icx)o(-psm)o(in.p)o(df)p Black
+Black 630 909 a FQ([21])p Black 47 w(Sebastian)e(Rah)m(tz)i(and)e(Heik)
+m(o)i(Ob)s(erdiek)39 b Fy(Hyp)-5 b(ertext)33 b(marks)h(in)f(L)3146
+892 y Fu(A)3185 909 y Fy(T)3235 929 y(E)3284 909 y(X:)41
+b(a)33 b(manual)h(for)817 1022 y Fk(hyp)s(erref)p FQ(,)41
+b(Av)-5 b(ailable)32 b(as)p 0.05 1.00 1.00 0.40 TeXcolorcmyk
+817 1135 a FM(CTAN/macros/latex/contri)o(b/h)o(yper)o(ref/)o(doc)o
+(/man)o(ual.)o(pdf)p Black Black 630 1315 a FQ([22])p
+Black 47 w(Heik)m(o)g(Ob)s(erdiek)39 b Fy(The)33 b Fk(ifp)s(df)e
+Fy(p)-5 b(ackage)p FQ(,)42 b(Av)-5 b(ailable)32 b(as)p
+0.05 1.00 1.00 0.40 TeXcolorcmyk 817 1427 a FM
+(CTAN/macros/latex/contri)o(b/o)o(berd)o(iek/)o(ifp)o(df.s)o(ty)p
+Black Black 630 1607 a FQ([23])p Black 47 w(Da)m(vid)f(Carlisle,)42
+b Fy(The)32 b Fk(ifthen)h Fy(p)-5 b(ackage)p FQ(,)41
+b(Av)-5 b(ailable)32 b(as)p 0.05 1.00 1.00 0.40 TeXcolorcmyk
+817 1720 a FM(CTAN/macros/latex/base/i)o(fth)o(en.d)o(tx)p
+Black Black 630 1900 a FQ([24])p Black 47 w(D.)f(P)-8
+b(.)31 b(Carlisle,)41 b Fy(The)33 b Fk(lscap)s(e)f Fy(p)-5
+b(ackage)p FQ(,)42 b(Av)-5 b(ailable)32 b(as)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 817 2013 a FM(CTAN/macros/latex/requir)o(ed/)o(grap)o
+(hics)o(/ls)o(cape)o(.dtx)p Black Black 630 2192 a FQ([25])p
+Black 47 w(John)d(D.)i(Hobb)m(y)41 b Fy(A)32 b(User's)g(manual)i(for)f
+(MetaPost)p FQ(,)f(A)-8 b(T&T)29 b(Bell)j(Lab)s(oratories)817
+2305 y(Computing)e(Science)h(T)-8 b(ec)m(hnical)32 b(Rep)s(ort)e(162,)i
+(1992.)42 b(Av)-5 b(ailable)32 b(as)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 817 2418 a FM(http://cm.bell-)t(labs.com/)o(who/)o(hobb)o
+(y/c)o(str_)o(162.)o(pdf)p Black Black 630 2598 a FQ([26])p
+Black 47 w(Don)f(Hosek,)41 b Fy(The)33 b Fk(mo)m(re\015oats)h
+Fy(p)-5 b(ackage)p FQ(,)41 b(Av)-5 b(ailable)32 b(as)p
+0.05 1.00 1.00 0.40 TeXcolorcmyk 817 2711 a FM
+(CTAN/macros/latex/contri)o(b/m)o(isc/)o(more)o(flo)o(ats.)o(sty)p
+Black Black 630 2891 a FQ([27])p Black 47 w(Rolf)f(Nieprasc)m(hk)41
+b Fy(The)32 b Fk(overpic)i Fy(p)-5 b(ackage)p FQ(,)41
+b(Av)-5 b(ailable)32 b(as)p 0.05 1.00 1.00 0.40 TeXcolorcmyk
+817 3004 a FM(CTAN/macros/latex/contri)o(b/o)o(verp)o(ic/o)o(ver)o
+(pic.)o(sty)p Black Black 630 3183 a FQ([28])p Black
+47 w(Donald)f(Arseneau,)40 b Fy(The)33 b Fk(placeins)f
+Fy(p)-5 b(ackage)p FQ(,)42 b(Av)-5 b(ailable)32 b(as)p
+0.05 1.00 1.00 0.40 TeXcolorcmyk 817 3296 a FM
+(CTAN/macros/latex/contri)o(b/p)o(lace)o(ins/)o(pla)o(cein)o(s.st)o(y)p
+Black Black 630 3476 a FQ([29])p Black 47 w(Mic)m(hael)g(C.)e(Gran)m(t)
+i(and)d(Da)m(vid)j(Carlisle,)41 b Fy(The)f FJ(ps)p Fy(fr)-5
+b(ag)32 b(system,)h(version)h(3)p FQ(,)41 b(Av)-5 b(ailable)817
+3589 y(as)p 0.05 1.00 1.00 0.40 TeXcolorcmyk 30 w
+FM(CTAN/macros/latex/contrib/)o(psfr)o(ag/)o(pfgg)o(uide)o(.pd)o(f)p
+Black Black 630 3769 a FQ([30])p Black 47 w(Sebastian)30
+b(Rah)m(tz)i(and)e(Leonor)g(Barro)s(ca,)42 b Fy(The)33
+b Fk(rotating)f Fy(p)-5 b(ackage)p FQ(,)42 b(Av)-5 b(ailable)32
+b(as)p 0.05 1.00 1.00 0.40 TeXcolorcmyk 817 3881 a
+FM(CTAN/macros/latex/contri)o(b/r)o(otat)o(ing/)o(rot)o(atin)o(g.dt)o
+(x)p Black Black 630 4061 a FQ([31])p Black 47 w(Rolf)f(Nieprasc)m(hk)g
+(and)e(Hub)s(ert)h(G\177)-45 b(a\031lein)42 b Fy(The)32
+b Fk(sidecap)h Fy(p)-5 b(ackage)p FQ(,)42 b(Av)-5 b(ailable)32
+b(as)p 0.05 1.00 1.00 0.40 TeXcolorcmyk 817 4174 a
+FM(CTAN/macros/latex/contri)o(b/s)o(idec)o(ap/s)o(ide)o(cap.)o(pdf)p
+Black Black 630 4354 a FQ([32])p Black 47 w(Stev)m(en)f(Douglas)h(Co)s
+(c)m(hran,)40 b Fy(The)33 b Fk(sub\014g)f Fy(p)-5 b(ackage)p
+FQ(,)42 b(Av)-5 b(ailable)32 b(as)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 817 4467 a FM(CTAN/macros/latex/contri)o(b/s)o(ubfi)o
+(g/su)o(bfi)o(g.pd)o(f)p Black Black 630 4646 a FQ([33])p
+Black 47 w(Robin)e(F)-8 b(airbairns)40 b Fy(The)33 b
+Fk(top)s(capt)f Fy(p)-5 b(ackage)p FQ(,)42 b(Av)-5 b(ailable)32
+b(as)p 0.05 1.00 1.00 0.40 TeXcolorcmyk 817 4759 a
+FM(CTAN/macros/latex/contri)o(b/m)o(isc/)o(topc)o(apt)o(.sty)p
+Black Black 630 4939 a FQ([34])p Black 47 w(F)-8 b(rank)30
+b(Mittelbac)m(h)43 b Fy(The)33 b Fk(va)m(rio)m(ref)g
+Fy(p)-5 b(ackage)p FQ(,)42 b(Av)-5 b(ailable)32 b(as)p
+0.05 1.00 1.00 0.40 TeXcolorcmyk 817 5052 a FM
+(CTAN/macros/latex/requir)o(ed/)o(tool)o(s/va)o(rio)o(ref.)o(dtx)p
+Black Black 630 5232 a FQ([35])p Black 47 w(Da)m(vid)f(Carlisle,)42
+b Fy(The)32 b Fk(xr)h Fy(p)-5 b(ackage)p FQ(,)42 b(Av)-5
+b(ailable)32 b(as)p 0.05 1.00 1.00 0.40 TeXcolorcmyk
+817 5345 a FM(CTAN/macros/latex/requir)o(ed/)o(tool)o(s/xr)o(.dt)o(x)p
+Black Black 2227 5640 a FQ(121)p Black eop end
+%%Page: 122 122
+TeXDict begin 122 121 bop Black 0 TeXcolorgray Black
+Black Black 630 -20 a FD(Index)p Black 630 161 a FM(\\abovecaptionskip)
+26 b FQ(length,)p 0.05 1.00 1.00 0.40 TeXcolorcmyk
+31 w(66)p Black 630 274 a FM(\\afterpage)i FQ(command,)p
+0.05 1.00 1.00 0.40 TeXcolorcmyk 30 w(60)p Black(,)p
+0.05 1.00 1.00 0.40 TeXcolorcmyk 31 w(97)p Black 630
+387 a FM(\\Alph)h FQ(coun)m(ter)i(command,)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 30 w(67)p Black 630 500 a FM(\\alph)e FQ(coun)m(ter)i
+(command,)p 0.05 1.00 1.00 0.40 TeXcolorcmyk 30 w(67)p
+Black 630 613 a FM(\\Arabic)d FQ(coun)m(ter)j(command,)p
+0.05 1.00 1.00 0.40 TeXcolorcmyk 31 w(67)p Black 630
+726 a FM(\\arabic)d FQ(coun)m(ter)j(command,)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 31 w(67)p Black 630 917 a(baseline,)p
+0.05 1.00 1.00 0.40 TeXcolorcmyk 31 w(10)p Black 630
+1030 a FM(\\baselinestretch)26 b FQ(command,)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 30 w(68)p Black 630 1142 a(bb,)k FM(\\includegraphics)25
+b FQ(option,)p 0.05 1.00 1.00 0.40 TeXcolorcmyk 32
+w(25)p Black 630 1255 a FM(bbfig)p FQ(,)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 29 w(13)p Black 630 1368 a FM(\\belowcaptionskip)h
+FQ(length,)p 0.05 1.00 1.00 0.40 TeXcolorcmyk 31 w(66)p
+Black 630 1481 a FM(\\bottomfigrule)g FQ(command,)p
+0.05 1.00 1.00 0.40 TeXcolorcmyk 31 w(65)p Black 630
+1594 a FM(\\bottomfraction)g FQ(command,)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 31 w(61)p Black 630 1707 a FM(bottomnumber)17
+b FQ(\015oat)k(placemen)m(t)h(coun)m(ter,)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 23 w(61)p Black 630 1820 a(BoundingBo)m(x,)p
+0.05 1.00 1.00 0.40 TeXcolorcmyk 31 w(12)p Black 630
+1933 a(b)s(o)m(xed)30 b(\014gures,)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 30 w(99)p Black 630 2046 a FM(bufsize)p
+FQ(,)p 0.05 1.00 1.00 0.40 TeXcolorcmyk 29 w(14)p
+Black 630 2237 a FO(calc)h FQ(pac)m(k)-5 b(age,)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 32 w(24)p Black 630 2349 a FM(\\caption)28
+b FQ(command,)p 0.05 1.00 1.00 0.40 TeXcolorcmyk 31
+w(56)p Black(,)p 0.05 1.00 1.00 0.40 TeXcolorcmyk
+31 w(88)p Black 630 2462 a FO(caption)i FQ(pac)m(k)-5
+b(age,)p 0.05 1.00 1.00 0.40 TeXcolorcmyk 33 w(69)p
+Black(,)p 0.05 1.00 1.00 0.40 TeXcolorcmyk 31 w(89)p
+Black 796 2575 a(commands,)p 0.05 1.00 1.00 0.40 TeXcolorcmyk
+30 w(71)p Black(,)p 0.05 1.00 1.00 0.40 TeXcolorcmyk
+32 w(73)p Black({)p 0.05 1.00 1.00 0.40 TeXcolorcmyk(75)p
+Black 630 2688 a FM(\\@captype)28 b FQ(command,)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 30 w(88)p Black 630 2801 a FM(\\centering)g
+FQ(command,)p 0.05 1.00 1.00 0.40 TeXcolorcmyk 30
+w(32)p Black 796 2914 a(di\013erence)j(from)g FM(center)e
+FQ(en)m(vironmen)m(t,)p 0.05 1.00 1.00 0.40 TeXcolorcmyk
+962 3027 a(32)p Black 630 3140 a FM(\\centerline)e FQ(T)1236
+3159 y(E)1286 3140 y(X)k(command,)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 30 w(32)p Black 630 3253 a FM(\\clearpage)d
+FQ(command,)p 0.05 1.00 1.00 0.40 TeXcolorcmyk 30
+w(59)p Black(,)p 0.05 1.00 1.00 0.40 TeXcolorcmyk
+31 w(60)p Black 630 3366 a(clip,)j FM(\\includegraphics)26
+b FQ(option,)p 0.05 1.00 1.00 0.40 TeXcolorcmyk 31
+w(26)p Black 630 3479 a FO(colo)m(r)33 b FQ(pac)m(k)-5
+b(age,)p 0.05 1.00 1.00 0.40 TeXcolorcmyk 33 w(47)p
+Black 630 3591 a FM(\\colorbox)28 b FQ(command,)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 30 w(47)p Black 630 3704 a(compressed)i(graphics,)p
+0.05 1.00 1.00 0.40 TeXcolorcmyk 31 w(42)p Black(,)p
+0.05 1.00 1.00 0.40 TeXcolorcmyk 31 w(43)p Black 630
+3817 a(con)m(v)m(erting)i(graphics)f(to)g(EPS,)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 29 w(17)p Black 630 3930 a(con)m(v)m(erting)i
+FJ(ps)d FQ(\014les)g(to)h FJ(eps)p FQ(,)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 30 w(13)p Black 630 4043 a(CT)-8 b(AN)20
+b(\(Comprehensiv)m(e)h(T)1619 4063 y(E)1669 4043 y(X)f(Arc)m(hiv)m(e)h
+(Net-)962 4156 y(w)m(ork\),)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 31 w(3)p Black 630 4269 a(curren)m(t)30
+b(baseline,)p 0.05 1.00 1.00 0.40 TeXcolorcmyk 31
+w(10)p Black 630 4460 a FM(\\DeclareGraphicsExtensio)o(ns)14
+b FQ(command,)p 0.05 1.00 1.00 0.40 TeXcolorcmyk 962
+4573 a(29)p Black 630 4685 a FM(\\DeclareGraphicsRule)h
+FQ(command,)p 0.05 1.00 1.00 0.40 TeXcolorcmyk 22
+w(29)p Black(,)p 0.05 1.00 1.00 0.40 TeXcolorcmyk
+23 w(30)p Black(,)p 0.05 1.00 1.00 0.40 TeXcolorcmyk
+962 4798 a(43)p Black(,)p 0.05 1.00 1.00 0.40 TeXcolorcmyk
+32 w(44)p Black 630 4911 a(depth,)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 30 w(11)p Black 630 5024 a FM(\\doublebox)28
+b FQ(command,)p 0.05 1.00 1.00 0.40 TeXcolorcmyk 30
+w(101)p Black 630 5137 a(draft,)i FM(\\includegraphics)c
+FQ(option,)p 0.05 1.00 1.00 0.40 TeXcolorcmyk 31 w(26)p
+Black 630 5328 a FO(end\015oat)k FQ(pac)m(k)-5 b(age,)p
+0.05 1.00 1.00 0.40 TeXcolorcmyk 33 w(68)p Black(,)p
+0.05 1.00 1.00 0.40 TeXcolorcmyk 31 w(92)p Black 630
+5441 a FJ(eps)29 b FQ(BoundingBo)m(x,)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 31 w(12)p Black Black Black 2337 161 a FO(epsf)36
+b FQ(pac)m(k)-5 b(age,)p 0.05 1.00 1.00 0.40 TeXcolorcmyk
+33 w(9)p Black 2337 274 a FM(\\epsfbox)28 b FQ(command,)p
+0.05 1.00 1.00 0.40 TeXcolorcmyk 30 w(9)p Black(,)p
+0.05 1.00 1.00 0.40 TeXcolorcmyk 31 w(32)p Black 2337
+387 a FM(\\epsfig)g FQ(command,)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 30 w(9)p Black 2337 500 a FO(eso-pic)j FQ(pac)m(k)-5
+b(age,)p 0.05 1.00 1.00 0.40 TeXcolorcmyk 33 w(54)p
+Black 2337 696 a(facing-page)32 b(\014gures,)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 30 w(98)p Black 2337 809 a FO(fancyb)s(o)m(x)e
+FQ(pac)m(k)-5 b(age,)p 0.05 1.00 1.00 0.40 TeXcolorcmyk
+33 w(99)p Black(,)p 0.05 1.00 1.00 0.40 TeXcolorcmyk
+31 w(101)p Black 2337 922 a FM(\\fancyfoot)27 b FQ(command,)p
+0.05 1.00 1.00 0.40 TeXcolorcmyk 30 w(52)p Black 2337
+1035 a FO(fancyhdr)k FQ(pac)m(k)-5 b(age,)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 32 w(52)p Black(,)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 32 w(53)p Black 2337 1148 a FM(\\fancyhead)27
+b FQ(command,)p 0.05 1.00 1.00 0.40 TeXcolorcmyk 30
+w(52)p Black 2337 1261 a FO(fancyheadings)j FQ(pac)m(k)-5
+b(age,)p 0.05 1.00 1.00 0.40 TeXcolorcmyk 32 w(52)p
+Black 2337 1373 a FM(\\fancypagestyle)26 b FQ(command,)p
+0.05 1.00 1.00 0.40 TeXcolorcmyk 30 w(53)p Black 2337
+1486 a FM(\\fbox)i FQ(command,)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 31 w(99)p Black 2337 1599 a FM(\\fboxrule)f
+FQ(length,)p 0.05 1.00 1.00 0.40 TeXcolorcmyk 31 w(47)p
+Black(,)p 0.05 1.00 1.00 0.40 TeXcolorcmyk 32 w(101)p
+Black 2337 1712 a FM(\\fboxsep)h FQ(length,)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 31 w(47)p Black(,)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 31 w(101)p Black 2337 1825 a FM(\\fcolorbox)f
+FQ(command,)p 0.05 1.00 1.00 0.40 TeXcolorcmyk 30
+w(47)p Black 2337 1938 a FM(\\figcaption)g FQ(command,)p
+0.05 1.00 1.00 0.40 TeXcolorcmyk 30 w(88)p Black 2337
+2051 a(\014gure)i(references,)i(incorrect,)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 32 w(56)p Black 2337 2164 a FM(\\figurename)c
+FQ(command,)p 0.05 1.00 1.00 0.40 TeXcolorcmyk 30
+w(67)p Black 2337 2277 a(\014gures)2503 2390 y(\014gure)i(en)m
+(vironmen)m(t,)p 0.05 1.00 1.00 0.40 TeXcolorcmyk
+32 w(55)p Black 2503 2503 a(landscap)s(e,)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 30 w(91)p Black 2503 2616 a(marginal,)p
+0.05 1.00 1.00 0.40 TeXcolorcmyk 31 w(89)p Black 2503
+2728 a(non-\015oating,)p 0.05 1.00 1.00 0.40 TeXcolorcmyk
+31 w(87)p Black 2503 2841 a(placed)h(on)h(facing)g(pages,)p
+0.05 1.00 1.00 0.40 TeXcolorcmyk 31 w(98)p Black 2503
+2954 a(wide,)p 0.05 1.00 1.00 0.40 TeXcolorcmyk 30
+w(90)p Black 2337 3067 a FM(fil)e FQ(unit)h(of)g(length,)p
+0.05 1.00 1.00 0.40 TeXcolorcmyk 31 w(64)p Black 2337
+3180 a FM(\\fill)e FQ(length,)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 31 w(33)p Black 2337 3293 a FO(\015after)j
+FQ(pac)m(k)-5 b(age,)p 0.05 1.00 1.00 0.40 TeXcolorcmyk
+32 w(55)p Black(,)p 0.05 1.00 1.00 0.40 TeXcolorcmyk
+32 w(58)p Black(,)p 0.05 1.00 1.00 0.40 TeXcolorcmyk
+31 w(63)p Black 2337 3406 a FO(\015oat)30 b FQ(pac)m(k)-5
+b(age,)p 0.05 1.00 1.00 0.40 TeXcolorcmyk 32 w(88)p
+Black(,)p 0.05 1.00 1.00 0.40 TeXcolorcmyk 32 w(94)p
+Black 2337 3519 a(\015oat)31 b(page,)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 31 w(58)p Black 2337 3632 a FM(\\FloatBarrier)26
+b FQ(command,)p 0.05 1.00 1.00 0.40 TeXcolorcmyk 31
+w(56)p Black 2337 3745 a FM(\\FloatBarrier)g FQ(command,)p
+0.05 1.00 1.00 0.40 TeXcolorcmyk 31 w(59)p Black 2337
+3858 a FM(\\floatpagefraction)f FQ(command,)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 30 w(60)p Black(,)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 32 w(61)p Black 2337 3970 a FM(\\floatsep)i
+FQ(length,)p 0.05 1.00 1.00 0.40 TeXcolorcmyk 31 w(64)p
+Black 2337 4083 a FM(\\@fpbot)h FQ(length,)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 31 w(64)p Black 2337 4196 a FM(\\@fpsep)g
+FQ(length,)p 0.05 1.00 1.00 0.40 TeXcolorcmyk 31 w(64)p
+Black 2337 4309 a FM(\\@fptop)g FQ(length,)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 31 w(64)p Black 2337 4505 a(ghostscript,)p
+0.05 1.00 1.00 0.40 TeXcolorcmyk 31 w(17)p Black 2337
+4618 a(ghostview,)p 0.05 1.00 1.00 0.40 TeXcolorcmyk
+31 w(17)p Black 2337 4731 a FJ(gif)i FQ(graphics)2503
+4844 y(con)m(v)m(erting)i(to)f FJ(eps)p FQ(,)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 29 w(17)p Black 2503 4957 a(using)e(in)h(L)2870
+4940 y FP(A)2909 4957 y FQ(T)2960 4976 y(E)3011 4957
+y(X,)p 0.05 1.00 1.00 0.40 TeXcolorcmyk 31 w(42)p
+Black(,)p 0.05 1.00 1.00 0.40 TeXcolorcmyk 31 w(43)p
+Black 2337 5070 a FM(GIMP)p FQ(,)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 29 w(20)p Black 2337 5183 a(Graphic)g(Con)m(v)m(erter,)p
+0.05 1.00 1.00 0.40 TeXcolorcmyk 31 w(19)p Black 2337
+5295 a(graphics)g(bundle,)p 0.05 1.00 1.00 0.40 TeXcolorcmyk
+29 w(9)p Black 2337 5408 a(graphics)g(con)m(v)m(ersion)i(programs,)p
+0.05 1.00 1.00 0.40 TeXcolorcmyk 30 w(17)p Black Black
+2227 5640 a(122)p Black eop end
+%%Page: 123 123
+TeXDict begin 123 122 bop Black 0 TeXcolorgray Black
+Black 630 -149 a FO(graphics)30 b FQ(pac)m(k)-5 b(age,)p
+0.05 1.00 1.00 0.40 TeXcolorcmyk 33 w(9)p Black 630
+-36 a FM(graphics.cfg)27 b FQ(\014le,)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 31 w(45)p Black 630 77 a(GraphicsMagic)m(k,)p
+0.05 1.00 1.00 0.40 TeXcolorcmyk 33 w(18)p Black 630
+190 a FM(\\graphicspath)g FQ(command,)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 30 w(39)p Black(,)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 32 w(40)p Black 630 303 a FO(graphicx)j
+FQ(pac)m(k)-5 b(age,)p 0.05 1.00 1.00 0.40 TeXcolorcmyk
+33 w(9)p Black 630 416 a(GSview,)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 31 w(17)p Black 630 612 a(header,)30 b(graphics)h(in,)p
+0.05 1.00 1.00 0.40 TeXcolorcmyk 30 w(52)p Black 630
+725 a(heigh)m(t,)p 0.05 1.00 1.00 0.40 TeXcolorcmyk
+32 w(11)p Black 796 838 a FM(\\includegraphics)18 b FQ(option,)p
+0.05 1.00 1.00 0.40 TeXcolorcmyk 24 w(25)p Black(,)p
+0.05 1.00 1.00 0.40 TeXcolorcmyk 25 w(26)p Black(,)p
+0.05 1.00 1.00 0.40 TeXcolorcmyk 25 w(33)p Black 630
+951 a FM(\\hfill)29 b FQ(command,)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 30 w(33)p Black 630 1063 a FM(\\hspace)f
+FQ(command,)p 0.05 1.00 1.00 0.40 TeXcolorcmyk 31
+w(33)p Black 630 1259 a FO(ifp)s(df)35 b FQ(pac)m(k)-5
+b(age,)p 0.05 1.00 1.00 0.40 TeXcolorcmyk 33 w(24)p
+Black 630 1372 a FO(ifthen)30 b FQ(pac)m(k)-5 b(age,)p
+0.05 1.00 1.00 0.40 TeXcolorcmyk 33 w(91)p Black(,)p
+0.05 1.00 1.00 0.40 TeXcolorcmyk 31 w(96)p Black(,)p
+0.05 1.00 1.00 0.40 TeXcolorcmyk 32 w(97)p Black 630
+1485 a FM(\\ifthenelse)27 b FQ(command,)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 31 w(91)p Black(,)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 31 w(96)p Black(,)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 32 w(97)p Black 630 1598 a(ImageMagic)m(k,)p
+0.05 1.00 1.00 0.40 TeXcolorcmyk 34 w(18)p Black 630
+1711 a FM(\\includegraphics)f FQ(command,)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 30 w(9)p Black(,)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 31 w(22)p Black 796 1824 a(b)s(o)s(olean)k(options,)p
+0.05 1.00 1.00 0.40 TeXcolorcmyk 31 w(26)p Black 796
+1937 a(cropping)g(options,)p 0.05 1.00 1.00 0.40 TeXcolorcmyk
+31 w(25)p Black 796 2050 a(options,)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 31 w(25)p Black 630 2163 a(in)m(ternal)h(commands,)p
+0.05 1.00 1.00 0.40 TeXcolorcmyk 30 w(64)p Black(,)p
+0.05 1.00 1.00 0.40 TeXcolorcmyk 32 w(88)p Black 630
+2276 a FM(\\intextsep)d FQ(length,)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 31 w(64)p Black(,)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 31 w(88)p Black 630 2388 a(Irfan)m(view,)p
+0.05 1.00 1.00 0.40 TeXcolorcmyk 30 w(19)p Black 630
+2584 a FJ(jpeg)i FQ(graphics)796 2697 y(con)m(v)m(erting)i(to)f
+FJ(eps)p FQ(,)p 0.05 1.00 1.00 0.40 TeXcolorcmyk 30
+w(17)p Black 796 2810 a(con)m(v)m(erting)h(to)f(lev)m(el)h(2)f
+FJ(eps)p FQ(,)p 0.05 1.00 1.00 0.40 TeXcolorcmyk 29
+w(20)p Black 796 2923 a(using)f(in)g(L)1164 2906 y FP(A)1203
+2923 y FQ(T)1254 2943 y(E)1304 2923 y(X,)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 31 w(42)p Black(,)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 32 w(43)p Black 630 3036 a FM(jpeg2ps)p
+FQ(,)p 0.05 1.00 1.00 0.40 TeXcolorcmyk 29 w(20)p
+Black 630 3232 a(k)m(eepasp)s(ectratio)796 3345 y FM(\\includegraphics)
+c FQ(option,)p 0.05 1.00 1.00 0.40 TeXcolorcmyk 31
+w(26)p Black 630 3458 a FM(kpsewhich)p FQ(,)20 b(T)1158
+3477 y(E)1208 3458 y(X)g(path-searc)m(hing)i(program,)p
+0.05 1.00 1.00 0.40 TeXcolorcmyk 962 3571 a(45)p Black
+630 3684 a FJ(kvec)p FQ(,)p 0.05 1.00 1.00 0.40 TeXcolorcmyk
+30 w(19)p Black 630 3880 a FM(\\label)29 b FQ(command,)p
+0.05 1.00 1.00 0.40 TeXcolorcmyk 30 w(56)p Black 630
+3992 a(landscap)s(e)h(en)m(vironmen)m(t,)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 31 w(91)p Black(,)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 32 w(92)p Black 630 4105 a(landscap)s(e)g(\014gures,)p
+0.05 1.00 1.00 0.40 TeXcolorcmyk 30 w(91)p Black 630
+4218 a FM(\\leavevmode)d FQ(T)1236 4238 y(E)1286 4218
+y(X)k(command,)p 0.05 1.00 1.00 0.40 TeXcolorcmyk
+30 w(32)p Black 630 4331 a(lev)m(el)h(2)f(P)m(ostScript,)p
+0.05 1.00 1.00 0.40 TeXcolorcmyk 31 w(20)p Black 630
+4444 a FM(\\linespread)c FQ(command,)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 31 w(68)p Black 630 4557 a FO(lscap)s(e)j
+FQ(pac)m(k)-5 b(age,)p 0.05 1.00 1.00 0.40 TeXcolorcmyk
+32 w(91)p Black(,)p 0.05 1.00 1.00 0.40 TeXcolorcmyk
+32 w(92)p Black 630 4753 a FM(\\makeatletter)27 b FQ(command,)p
+0.05 1.00 1.00 0.40 TeXcolorcmyk 30 w(64)p Black(,)p
+0.05 1.00 1.00 0.40 TeXcolorcmyk 32 w(88)p Black 630
+4866 a FM(\\makeatother)g FQ(command,)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 30 w(64)p Black(,)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 32 w(88)p Black 630 4979 a(marginal)k(\014gures,)p
+0.05 1.00 1.00 0.40 TeXcolorcmyk 30 w(89)p Black 630
+5092 a FM(\\marginpar)d FQ(command,)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 30 w(60)p Black 630 5205 a(minipage)796
+5317 y(aligning)j(b)s(ottoms,)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 31 w(36)p Black 796 5430 a(aligning)g(tops,)p
+0.05 1.00 1.00 0.40 TeXcolorcmyk 31 w(37)p Black Black
+Black 2503 -149 a(v)m(ertical)h(alignmen)m(t,)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 32 w(36)p Black 2337 -36 a FO(mo)m(re\015oats)f
+FQ(pac)m(k)-5 b(age,)p 0.05 1.00 1.00 0.40 TeXcolorcmyk
+33 w(60)p Black(,)p 0.05 1.00 1.00 0.40 TeXcolorcmyk
+31 w(90)p Black 2337 156 a(named)29 b(argumen)m(ts,)p
+0.05 1.00 1.00 0.40 TeXcolorcmyk 31 w(9)p Black 2337
+269 a(natural)h(size,)p 0.05 1.00 1.00 0.40 TeXcolorcmyk
+31 w(12)p Black 2337 382 a FM(NetPBM)p FQ(,)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 28 w(18)p Black 2337 495 a(non-)p FJ(eps)e
+FQ(graphics)2503 608 y(con)m(v)m(erting)k(to)f FJ(eps)p
+FQ(,)p 0.05 1.00 1.00 0.40 TeXcolorcmyk 29 w(17)p
+Black 2503 721 a(con)m(v)m(erting)h(to)f(lev)m(el)h(2)f
+FJ(eps)p FQ(,)p 0.05 1.00 1.00 0.40 TeXcolorcmyk 29
+w(20)p Black 2503 834 a(using)e(in)h(L)2870 817 y FP(A)2909
+834 y FQ(T)2960 853 y(E)3011 834 y(X,)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 31 w(42)p Black(,)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 31 w(43)p Black 2337 947 a(non-\015oating)h(\014gure,)p
+0.05 1.00 1.00 0.40 TeXcolorcmyk 30 w(87)p Black 2337
+1139 a(origin,)g FM(\\includegraphics)26 b FQ(option,)p
+0.05 1.00 1.00 0.40 TeXcolorcmyk 31 w(25)p Black 2337
+1252 a FM(\\Ovalbox)i FQ(command,)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 30 w(101)p Black 2337 1364 a FM(\\ovalbox)g
+FQ(command,)p 0.05 1.00 1.00 0.40 TeXcolorcmyk 30
+w(101)p Black 2337 1477 a FO(overpic)j FQ(pac)m(k)-5
+b(age,)p 0.05 1.00 1.00 0.40 TeXcolorcmyk 32 w(39)p
+Black 2337 1669 a FM(\\pageref)28 b FQ(command,)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 30 w(56)p Black 2337 1782 a FM(PBMPLUS)p
+FQ(,)p 0.05 1.00 1.00 0.40 TeXcolorcmyk 28 w(18)p
+Black 2337 1895 a FJ(pict)h FQ(graphics)2503 2008 y(con)m(v)m(erting)j
+(to)f FJ(eps)p FQ(,)p 0.05 1.00 1.00 0.40 TeXcolorcmyk
+29 w(17)p Black 2503 2121 a(using)e(in)h(L)2870 2104
+y FP(A)2909 2121 y FQ(T)2960 2141 y(E)3011 2121 y(X,)p
+0.05 1.00 1.00 0.40 TeXcolorcmyk 31 w(43)p Black 2337
+2234 a FO(placeins)g FQ(pac)m(k)-5 b(age,)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 32 w(56)p Black(,)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 32 w(59)p Black 2337 2347 a(Please)31 b(ask)g(a)f(wizard,)
+p 0.05 1.00 1.00 0.40 TeXcolorcmyk 31 w(14)p Black
+2337 2460 a(P)m(ostScript)2503 2573 y(Lev)m(el)h(2)g(W)-8
+b(rapp)s(ers,)p 0.05 1.00 1.00 0.40 TeXcolorcmyk 30
+w(20)p Black 2337 2686 a FM(\\psfig)28 b FQ(command,)p
+0.05 1.00 1.00 0.40 TeXcolorcmyk 31 w(9)p Black(,)p
+0.05 1.00 1.00 0.40 TeXcolorcmyk 31 w(32)p Black 2337
+2799 a FJ(ps)p FQ(frag,)p 0.05 1.00 1.00 0.40 TeXcolorcmyk
+30 w(45)p Black 2337 2991 a FM(\\ref)h FQ(command,)p
+0.05 1.00 1.00 0.40 TeXcolorcmyk 30 w(56)p Black 2337
+3103 a FM(\\ref)g FQ(command,)h(strange)h(output,)p
+0.05 1.00 1.00 0.40 TeXcolorcmyk 30 w(56)p Black 2337
+3216 a(reference)f(p)s(oin)m(t,)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 31 w(10)p Black(,)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 31 w(11)p Black 2337 3329 a FM(\\resizebox)d
+FQ(command,)p 0.05 1.00 1.00 0.40 TeXcolorcmyk 30
+w(27)p Black 2337 3442 a FM(\\Roman)h FQ(coun)m(ter)j(command,)p
+0.05 1.00 1.00 0.40 TeXcolorcmyk 31 w(67)p Black 2337
+3555 a FM(\\roman)d FQ(coun)m(ter)j(command,)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 31 w(67)p Black 2337 3668 a FM(\\rotatebox)c
+FQ(command,)p 0.05 1.00 1.00 0.40 TeXcolorcmyk 30
+w(28)p Black 2337 3781 a FO(rotating)k FQ(pac)m(k)-5
+b(age,)p 0.05 1.00 1.00 0.40 TeXcolorcmyk 33 w(91)p
+Black(,)p 0.05 1.00 1.00 0.40 TeXcolorcmyk 31 w(92)p
+Black(,)p 0.05 1.00 1.00 0.40 TeXcolorcmyk 32 w(94)p
+Black 2337 3894 a FM(\\rotcaption)27 b FQ(command,)p
+0.05 1.00 1.00 0.40 TeXcolorcmyk 30 w(91)p Black(,)p
+0.05 1.00 1.00 0.40 TeXcolorcmyk 32 w(94)p Black 2337
+4007 a(rubb)s(er)g(length,)p 0.05 1.00 1.00 0.40 TeXcolorcmyk
+32 w(33)p Black(,)p 0.05 1.00 1.00 0.40 TeXcolorcmyk
+31 w(64)p Black 2337 4199 a(scale,)k FM(\\includegraphics)26
+b FQ(option,)p 0.05 1.00 1.00 0.40 TeXcolorcmyk 31
+w(25)p Black 2337 4312 a FM(\\scalebox)h FQ(command,)p
+0.05 1.00 1.00 0.40 TeXcolorcmyk 31 w(27)p Black 2337
+4425 a(SC\014gure)h(en)m(vironmen)m(t,)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 32 w(95)p Black 2337 4537 a FM(\\shadowbox)f
+FQ(command,)p 0.05 1.00 1.00 0.40 TeXcolorcmyk 30
+w(101)p Black(,)p 0.05 1.00 1.00 0.40 TeXcolorcmyk
+32 w(102)p Black 2337 4650 a FM(\\shadowsize)g FQ(length,)p
+0.05 1.00 1.00 0.40 TeXcolorcmyk 31 w(102)p Black
+2337 4763 a FM(\\shortstack)g FQ(command,)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 30 w(47)p Black 2337 4876 a FO(sidecap)j
+FQ(pac)m(k)-5 b(age,)p 0.05 1.00 1.00 0.40 TeXcolorcmyk
+32 w(95)p Black 2337 4989 a(sidew)m(a)m(ys\014gure)30
+b(en)m(vironmen)m(t,)p 0.05 1.00 1.00 0.40 TeXcolorcmyk
+31 w(91)p Black(,)p 0.05 1.00 1.00 0.40 TeXcolorcmyk
+32 w(92)p Black 2337 5102 a(sidew)m(a)m(ystable)i(en)m(vironmen)m(t,)p
+0.05 1.00 1.00 0.40 TeXcolorcmyk 31 w(92)p Black 2337
+5215 a FM(\\special)c FQ(command,)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 30 w(9)p Black 2337 5328 a FM(\\subfloat)f
+FQ(command,)p 0.05 1.00 1.00 0.40 TeXcolorcmyk 31
+w(106)p Black 2337 5441 a FM(\\suppressfloats)f FQ(command,)p
+0.05 1.00 1.00 0.40 TeXcolorcmyk 30 w(63)p Black Black
+2227 5640 a(123)p Black eop end
+%%Page: 124 124
+TeXDict begin 124 123 bop Black 0 TeXcolorgray Black
+Black 630 -149 a FM(\\tabcaption)27 b FQ(command,)p
+0.05 1.00 1.00 0.40 TeXcolorcmyk 31 w(88)p Black 630
+-36 a(T)-8 b(eX)31 b(capacit)m(y)i(exceeded,)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 31 w(41)p Black 630 77 a(T)681 97 y(E)731
+77 y(X)d(searc)m(h)i(path,)p 0.05 1.00 1.00 0.40 TeXcolorcmyk
+30 w(39)p Black 630 190 a(TEXINPUTS)d(\(T)1289 210 y(E)1340
+190 y(X)h(searc)m(h)h(path\),)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 31 w(39)p Black 630 303 a FM(\\textfloatsep)c
+FQ(length,)p 0.05 1.00 1.00 0.40 TeXcolorcmyk 31 w(63)p
+Black(,)p 0.05 1.00 1.00 0.40 TeXcolorcmyk 31 w(64)p
+Black 630 416 a FM(\\textfraction)g FQ(command,)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 30 w(61)p Black 630 529 a FM(\\thefigure)h
+FQ(command,)p 0.05 1.00 1.00 0.40 TeXcolorcmyk 30
+w(67)p Black 630 642 a FM(\\thicklines)f FQ(line)k(width,)p
+0.05 1.00 1.00 0.40 TeXcolorcmyk 30 w(102)p Black
+630 755 a FM(\\thinlines)d FQ(line)i(width,)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 30 w(102)p Black 630 868 a FJ(tiff)h FQ(graphics)796
+980 y(con)m(v)m(erting)h(to)f FJ(eps)p FQ(,)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 30 w(17)p Black 796 1093 a(con)m(v)m(erting)h(to)f(lev)m
+(el)h(2)f FJ(eps)p FQ(,)p 0.05 1.00 1.00 0.40 TeXcolorcmyk
+29 w(20)p Black 796 1206 a(using)f(in)g(L)1164 1190 y
+FP(A)1203 1206 y FQ(T)1254 1226 y(E)1304 1206 y(X,)p
+0.05 1.00 1.00 0.40 TeXcolorcmyk 31 w(42)p Black(,)p
+0.05 1.00 1.00 0.40 TeXcolorcmyk 32 w(43)p Black 630
+1319 a FM(tiff2ps)p FQ(,)p 0.05 1.00 1.00 0.40 TeXcolorcmyk
+29 w(21)p Black 630 1432 a(T)-8 b(o)s(o)31 b(Man)m(y)g(Unpro)s(cessed)e
+(Floats,)p 0.05 1.00 1.00 0.40 TeXcolorcmyk 33 w(58)p
+Black(,)p 0.05 1.00 1.00 0.40 TeXcolorcmyk 31 w(60)p
+Black 630 1545 a FO(top)s(capt)h FQ(pac)m(k)-5 b(age,)p
+0.05 1.00 1.00 0.40 TeXcolorcmyk 33 w(67)p Black 630
+1658 a FM(\\topfigrule)27 b FQ(command,)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 31 w(65)p Black 630 1771 a FM(\\topfraction)g
+FQ(command,)p 0.05 1.00 1.00 0.40 TeXcolorcmyk 30
+w(60)p Black(,)p 0.05 1.00 1.00 0.40 TeXcolorcmyk
+32 w(61)p Black 630 1884 a FM(topnumber)h FQ(\015oat)j(placemen)m(t)h
+(coun)m(ter,)p 0.05 1.00 1.00 0.40 TeXcolorcmyk 31
+w(61)p Black 630 1997 a(totalheigh)m(t,)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 33 w(11)p Black 796 2110 a FM(\\includegraphics)26
+b FQ(option,)p 0.05 1.00 1.00 0.40 TeXcolorcmyk 31
+w(25)p Black(,)p 0.05 1.00 1.00 0.40 TeXcolorcmyk
+32 w(33)p Black 630 2222 a FM(totalnumber)e FQ(\015oat)k(placemen)m(t)g
+(coun)m(ter,)p 0.05 1.00 1.00 0.40 TeXcolorcmyk 29
+w(61)p Black 630 2335 a(trim,)j FM(\\includegraphics)25
+b FQ(option,)p 0.05 1.00 1.00 0.40 TeXcolorcmyk 32
+w(25)p Black 630 2531 a(Unable)31 b(to)g(read)f(an)g(en)m(tire)i(line,)
+p 0.05 1.00 1.00 0.40 TeXcolorcmyk 31 w(14)p Black
+630 2644 a(Unpro)s(cessed)e(Floats,)i(T)-8 b(o)s(o)31
+b(Man)m(y)-8 b(,)p 0.05 1.00 1.00 0.40 TeXcolorcmyk
+31 w(58)p Black(,)p 0.05 1.00 1.00 0.40 TeXcolorcmyk
+32 w(60)p Black 630 2840 a(viewp)s(ort,)30 b FM(\\includegraphics)c
+FQ(option,)p 0.05 1.00 1.00 0.40 TeXcolorcmyk 31 w(25)p
+Black 630 3036 a(wide)k(\014gures,)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 30 w(90)p Black 630 3149 a(width,)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 30 w(11)p Black 796 3262 a FM(\\includegraphics)c
+FQ(option,)p 0.05 1.00 1.00 0.40 TeXcolorcmyk 31 w(24)p
+Black(,)p 0.05 1.00 1.00 0.40 TeXcolorcmyk 32 w(25)p
+Black 630 3375 a(wizard,)k(Please)i(ask)f(a)f(wizard,)p
+0.05 1.00 1.00 0.40 TeXcolorcmyk 31 w(14)p Black 630
+3488 a FM(WMF2EPS)p FQ(,)p 0.05 1.00 1.00 0.40 TeXcolorcmyk
+29 w(19)p Black 630 3684 a FM(xv)p FQ(,)p 0.05 1.00 1.00 0.40
+TeXcolorcmyk 30 w(20)p Black Black Black Black 2227 5640
+a(124)p Black eop end
+%%Trailer
+
+userdict /end-hook known{end-hook}if
+%%EOF