diff options
author | Norbert Preining <norbert@preining.info> | 2019-09-02 13:46:59 +0900 |
---|---|---|
committer | Norbert Preining <norbert@preining.info> | 2019-09-02 13:46:59 +0900 |
commit | e0c6872cf40896c7be36b11dcc744620f10adf1d (patch) | |
tree | 60335e10d2f4354b0674ec22d7b53f0f8abee672 /graphics/mma2ltx/doc |
Initial commit
Diffstat (limited to 'graphics/mma2ltx/doc')
-rw-r--r-- | graphics/mma2ltx/doc/12mag.eps | 673 | ||||
-rw-r--r-- | graphics/mma2ltx/doc/12mag_3d.eps | 1104 | ||||
-rw-r--r-- | graphics/mma2ltx/doc/6mag.eps | 670 | ||||
-rw-r--r-- | graphics/mma2ltx/doc/arrparm.1 | 68 | ||||
-rw-r--r-- | graphics/mma2ltx/doc/arrsamp.eps | 115 | ||||
-rw-r--r-- | graphics/mma2ltx/doc/mma2ltx.dvi | bin | 0 -> 36796 bytes | |||
-rw-r--r-- | graphics/mma2ltx/doc/mma2ltx.pdf | bin | 0 -> 263721 bytes | |||
-rw-r--r-- | graphics/mma2ltx/doc/mma2ltx.ps | 5271 | ||||
-rw-r--r-- | graphics/mma2ltx/doc/mma2ltx6.ps | 6258 | ||||
-rw-r--r-- | graphics/mma2ltx/doc/optc.eps | 670 |
10 files changed, 14829 insertions, 0 deletions
diff --git a/graphics/mma2ltx/doc/12mag.eps b/graphics/mma2ltx/doc/12mag.eps new file mode 100644 index 0000000000..273b90cbf3 --- /dev/null +++ b/graphics/mma2ltx/doc/12mag.eps @@ -0,0 +1,673 @@ +%!PS-Adobe-2.0 EPSF-2.0 +%%BoundingBox: 0 0 283.46 175.19 +%%Title: 12mag.eps +%%Creator: mma2ltx v1.2 +%%CreationDate: Mon Jul 18 10:18:35 1994 +%%EndComments +%MMA2LTXCommandLine: mma2ltx -ucm -sfootnotesize -p -w10cm 12mag.ps +%%BeginProcSet: texmma22.pro +% Mathematica v2.2 prologue +/Mathdict 150 dict def +Mathdict begin +/Mwidth 283.46 def +/Mheight 175.19 def +/Mnodistort true def +/Mlmarg 0 def /Mrmarg 0 def /Mbmarg 0 def /Mtmarg 0 def /Mtransform{} +bind def /Mfixwid true def /Mfixdash false def /Mrot 0 def /Mpstart{ +MathPictureStart}bind def /Mpend{MathPictureEnd}bind def /Mscale{0 1 0 1 +5 -1 roll MathScale}bind def /ISOLatin1Encoding dup where{pop pop}{[ +/.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef +/.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef +/.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef +/.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef +/space /exclam /quotedbl /numbersign /dollar /percent /ampersand +/quoteright /parenleft /parenright /asterisk /plus /comma /minus /period +/slash /zero /one /two /three /four /five /six /seven /eight /nine +/colon /semicolon /less /equal /greater /question /at /A /B /C /D /E /F +/G /H /I /J /K /L /M /N /O /P /Q /R /S /T /U /V /W /X /Y /Z /bracketleft +/backslash /bracketright /asciicircum /underscore /quoteleft /a /b /c /d +/e /f /g /h /i /j /k /l /m /n /o /p /q /r /s /t /u /v /w /x /y /z +/braceleft /bar /braceright /asciitilde /.notdef /.notdef /.notdef +/.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef +/.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /dotlessi /grave +/acute /circumflex /tilde /macron /breve /dotaccent /dieresis /.notdef +/ring /cedilla /.notdef /hungarumlaut /ogonek /caron /space /exclamdown +/cent /sterling /currency /yen /brokenbar /section /dieresis /copyright +/ordfeminine /guillemotleft /logicalnot /hyphen /registered /macron +/degree /plusminus /twosuperior /threesuperior /acute /mu /paragraph +/periodcentered /cedilla /onesuperior /ordmasculine /guillemotright +/onequarter /onehalf /threequarters /questiondown /Agrave /Aacute +/Acircumflex /Atilde /Adieresis /Aring /AE /Ccedilla /Egrave /Eacute +/Ecircumflex /Edieresis /Igrave /Iacute /Icircumflex /Idieresis /Eth +/Ntilde /Ograve /Oacute /Ocircumflex /Otilde /Odieresis /multiply +/Oslash /Ugrave /Uacute /Ucircumflex /Udieresis /Yacute /Thorn +/germandbls /agrave /aacute /acircumflex /atilde /adieresis /aring /ae +/ccedilla /egrave /eacute /ecircumflex /edieresis /igrave /iacute +/icircumflex /idieresis /eth /ntilde /ograve /oacute /ocircumflex +/otilde /odieresis /divide /oslash /ugrave /uacute /ucircumflex +/udieresis /yacute /thorn /ydieresis]def}ifelse /MFontDict 50 dict def +/MStrCat{exch dup length 2 index length add string dup 3 1 roll copy +length exch dup 4 2 roll exch putinterval}def /MCreateEncoding{1 index +255 string cvs(-)MStrCat 1 index MStrCat cvn exch(Encoding)MStrCat cvn +dup where{exch get}{pop StandardEncoding}ifelse 3 1 roll dup MFontDict +exch known not{1 index findfont dup length dict begin{1 index /FID ne{ +def}{pop pop}ifelse}forall /Encoding 3 index def currentdict end 1 index +exch definefont pop MFontDict 1 index null put}if exch pop exch pop}def +/ISOLatin1{(ISOLatin1)MCreateEncoding}def /ISO8859{(ISOLatin1) +MCreateEncoding}def /Mcopyfont{dup maxlength dict exch{1 index /FID eq{ +pop pop}{2 index 3 1 roll put}ifelse}forall}def /Plain /Courier findfont +Mcopyfont definefont pop /Bold /Courier findfont Mcopyfont +definefont pop /Italic /Courier findfont Mcopyfont definefont +pop /MathPictureStart{gsave Mtransform Mlmarg Mbmarg translate Mwidth +Mlmarg Mrmarg add sub /Mwidth exch def Mheight Mbmarg Mtmarg add sub +/Mheight exch def /Mtmatrix matrix currentmatrix def /Mgmatrix matrix +currentmatrix def}bind def /MathPictureEnd{grestore}bind def /MFill{0 0 +moveto Mwidth 0 lineto Mwidth Mheight lineto 0 Mheight lineto fill}bind +def /MPlotRegion{3 index Mwidth mul 2 index Mheight mul translate exch +sub Mheight mul /Mheight exch def exch sub Mwidth mul /Mwidth exch def} +bind def /MathSubStart{Momatrix Mgmatrix Mtmatrix Mwidth Mheight 7 -2 +roll moveto Mtmatrix setmatrix currentpoint Mgmatrix setmatrix 9 -2 roll +moveto Mtmatrix setmatrix currentpoint 2 copy translate /Mtmatrix matrix +currentmatrix def 3 -1 roll exch sub /Mheight exch def sub /Mwidth exch +def}bind def /MathSubEnd{/Mheight exch def /Mwidth exch def /Mtmatrix +exch def dup setmatrix /Mgmatrix exch def /Momatrix exch def}bind def +/Mdot{moveto 0 0 rlineto stroke}bind def /Mtetra{moveto lineto lineto +lineto fill}bind def /Metetra{moveto lineto lineto lineto closepath +gsave fill grestore 0 setgray stroke}bind def /Mistroke{flattenpath 0 0 +0{4 2 roll pop pop}{4 -1 roll 2 index sub dup mul 4 -1 roll 2 index sub +dup mul add sqrt 4 -1 roll add 3 1 roll}{stop}{stop}pathforall pop pop +currentpoint stroke moveto currentdash 3 -1 roll add setdash}bind def +/Mfstroke{stroke currentdash pop 0 setdash}bind def /Mrotsboxa{gsave dup +/Mrot exch def Mrotcheck Mtmatrix dup setmatrix 7 1 roll 4 index 4 index +translate rotate 3 index -1 mul 3 index -1 mul translate /Mtmatrix +matrix currentmatrix def grestore Msboxa 3 -1 roll /Mtmatrix exch def +/Mrot 0 def}bind def /Msboxa{newpath 5 -1 roll Mvboxa pop Mboxout 6 -1 +roll 5 -1 roll 4 -1 roll Msboxa1 5 -3 roll Msboxa1 Mboxrot[7 -2 roll 2 +copy[3 1 roll 10 -1 roll 9 -1 roll]6 1 roll 5 -2 roll]}bind def /Msboxa1 +{sub 2 div dup 2 index 1 add mul 3 -1 roll -1 add 3 -1 roll mul}bind def +/Mvboxa{Mfixwid{Mvboxa1}{dup Mwidthcal 0 exch{add}forall exch Mvboxa1 4 +index 7 -1 roll add 4 -1 roll pop 3 1 roll}ifelse}bind def /Mvboxa1{ +gsave newpath[true 3 -1 roll{Mbbox 5 -1 roll{0 5 1 roll}{7 -1 roll exch +sub(m)stringwidth pop .3 mul sub 7 1 roll 6 -1 roll 4 -1 roll Mmin 3 -1 +roll 5 index add 5 -1 roll 4 -1 roll Mmax 4 -1 roll}ifelse false}forall{ +stop}if counttomark 1 add 4 roll]grestore}bind def /Mbbox{1 dict begin 0 +0 moveto /temp(T)def{gsave currentpoint newpath moveto temp 0 3 -1 roll +put temp false charpath flattenpath currentpoint pathbbox grestore +moveto lineto moveto}forall pathbbox newpath end}bind def /Mmin{2 copy +gt{exch}if pop}bind def /Mmax{2 copy lt{exch}if pop}bind def /Mrotshowa{ +dup /Mrot exch def Mrotcheck Mtmatrix dup setmatrix 7 1 roll 4 index 4 +index translate rotate 3 index -1 mul 3 index -1 mul translate /Mtmatrix +matrix currentmatrix def Mgmatrix setmatrix Mshowa /Mtmatrix exch def +/Mrot 0 def}bind def /Mshowa{4 -2 roll moveto 2 index Mtmatrix setmatrix +Mvboxa 7 1 roll Mboxout 6 -1 roll 5 -1 roll 4 -1 roll Mshowa1 4 1 roll +Mshowa1 rmoveto currentpoint Mfixwid{Mshowax}{Mshoway}ifelse pop pop pop +pop Mgmatrix setmatrix}bind def /Mshowax{0 1 4 index length -1 add{2 +index 4 index 2 index get 3 index add moveto 4 index exch get Mfixdash{ +Mfixdashp}if show}for}bind def /Mfixdashp{dup length 1 gt 1 index true +exch{45 eq and}forall and{gsave(--)stringwidth pop(-)stringwidth pop sub +2 div 0 rmoveto dup length 1 sub{(-)show}repeat grestore}if}bind def +/Mshoway{3 index Mwidthcal 5 1 roll 0 1 4 index length -1 add{2 index 4 +index 2 index get 3 index add moveto 4 index exch get[6 index aload +length 2 add -1 roll{pop Strform stringwidth pop neg exch add 0 rmoveto} +exch kshow cleartomark}for pop}bind def /Mwidthcal{[exch{Mwidthcal1} +forall][exch dup Maxlen -1 add 0 1 3 -1 roll{[exch 2 index{1 index Mget +exch}forall pop Maxget exch}for pop]Mreva}bind def /Mreva{[exch aload +length -1 1{1 roll}for]}bind def /Mget{1 index length -1 add 1 index ge{ +get}{pop pop 0}ifelse}bind def /Maxlen{[exch{length}forall Maxget}bind +def /Maxget{counttomark -1 add 1 1 3 -1 roll{pop Mmax}for exch pop}bind +def /Mwidthcal1{[exch{Strform stringwidth pop}forall]}bind def /Strform{ +/tem(x)def tem 0 3 -1 roll put tem}bind def /Mshowa1{2 copy add 4 1 roll +sub mul sub -2 div}bind def /MathScale{Mwidth Mheight Mlp translate +scale /yscale exch def /ybias exch def /xscale exch def /xbias exch def +/Momatrix xscale yscale matrix scale xbias ybias matrix translate matrix +concatmatrix def /Mgmatrix matrix currentmatrix def}bind def /Mlp{3 copy +Mlpfirst{Mnodistort{Mmin dup}if 4 index 2 index 2 index Mlprun 11 index +11 -1 roll 10 -4 roll Mlp1 8 index 9 -5 roll Mlp1 4 -1 roll and{exit}if +3 -1 roll pop pop}loop exch 3 1 roll 7 -3 roll pop pop pop}bind def +/Mlpfirst{3 -1 roll dup length 2 copy -2 add get aload pop pop pop 4 -2 +roll -1 add get aload pop pop pop 6 -1 roll 3 -1 roll 5 -1 roll sub div +4 1 roll exch sub div}bind def /Mlprun{2 copy 4 index 0 get dup 4 1 roll +Mlprun1 3 copy 8 -2 roll 9 -1 roll{3 copy Mlprun1 3 copy 11 -3 roll /gt +Mlpminmax 8 3 roll 11 -3 roll /lt Mlpminmax 8 3 roll}forall pop pop pop +pop 3 1 roll pop pop aload pop 5 -1 roll aload pop exch 6 -1 roll +Mlprun2 8 2 roll 4 -1 roll Mlprun2 6 2 roll 3 -1 roll Mlprun2 4 2 roll +exch Mlprun2 6 2 roll}bind def /Mlprun1{aload pop exch 6 -1 roll 5 -1 +roll mul add 4 -2 roll mul 3 -1 roll add}bind def /Mlprun2{2 copy add 2 +div 3 1 roll exch sub}bind def /Mlpminmax{cvx 2 index 6 index 2 index +exec{7 -3 roll 4 -1 roll}if 1 index 5 index 3 -1 roll exec{4 1 roll pop +5 -1 roll aload pop pop 4 -1 roll aload pop[8 -2 roll pop 5 -2 roll pop +6 -2 roll pop 5 -1 roll]4 1 roll pop}{pop pop pop}ifelse}bind def /Mlp1{ +5 index 3 index sub 5 index 2 index mul 1 index le 1 index 0 le or dup +not{1 index 3 index div .99999 mul 8 -1 roll pop 7 1 roll}if 8 -1 roll 2 +div 7 -2 roll pop sub 5 index 6 -3 roll pop pop mul sub exch}bind def +/intop 0 def /inrht 0 def /inflag 0 def /outflag 0 def /xadrht 0 def +/xadlft 0 def /yadtop 0 def /yadbot 0 def /Minner{outflag 1 eq{/outflag +0 def /intop 0 def /inrht 0 def}if 5 index gsave Mtmatrix setmatrix +Mvboxa pop grestore 3 -1 roll pop dup intop gt{/intop exch def}{pop} +ifelse dup inrht gt{/inrht exch def}{pop}ifelse pop /inflag 1 def}bind +def /Mouter{/xadrht 0 def /xadlft 0 def /yadtop 0 def /yadbot 0 def +inflag 1 eq{dup 0 lt{dup intop mul neg /yadtop exch def}if dup 0 gt{dup +intop mul /yadbot exch def}if pop dup 0 lt{dup inrht mul neg /xadrht +exch def}if dup 0 gt{dup inrht mul /xadlft exch def}if pop /outflag 1 +def}{pop pop}ifelse /inflag 0 def /inrht 0 def /intop 0 def}bind def +/Mboxout{outflag 1 eq{4 -1 roll xadlft leadjust add sub 4 1 roll 3 -1 +roll yadbot leadjust add sub 3 1 roll exch xadrht leadjust add add exch +yadtop leadjust add add /outflag 0 def /xadlft 0 def /yadbot 0 def +/xadrht 0 def /yadtop 0 def}if}bind def /leadjust{(m)stringwidth pop .5 +mul}bind def /Mrotcheck{dup 90 eq{yadbot /yadbot xadrht def /xadrht +yadtop def /yadtop xadlft def /xadlft exch def}if dup cos 1 index sin +Checkaux dup cos 1 index sin neg exch Checkaux 3 1 roll pop pop}bind def +/Checkaux{4 index exch 4 index mul 3 1 roll mul add 4 1 roll}bind def +/Mboxrot{Mrot 90 eq{brotaux 4 2 roll}if Mrot 180 eq{4 2 roll brotaux 4 2 +roll brotaux}if Mrot 270 eq{4 2 roll brotaux}if}bind def /brotaux{neg +exch neg}bind def /Mabsproc{0 matrix defaultmatrix dtransform +idtransform dup mul exch dup mul add sqrt}bind def /Mabswid{Mabsproc +setlinewidth}bind def /Mabsdash{exch[exch{Mabsproc}forall]exch setdash} +bind def /MBeginOrig{Momatrix concat}bind def /MEndOrig{Mgmatrix +setmatrix}bind def /sampledsound where{pop}{/sampledsound{exch pop exch +5 1 roll mul 4 idiv mul 2 idiv exch pop exch /Mtempproc exch def{ +Mtempproc pop}repeat}bind def}ifelse /g{setgray}bind def /k{ +setcmykcolor}bind def /m{moveto}bind def /p{gsave}bind def /r{ +setrgbcolor}bind def /w{setlinewidth}bind def /C{curveto}bind def /F{ +fill}bind def /L{lineto}bind def /P{grestore}bind def /s{stroke}bind def +/setcmykcolor where{pop}{/setcmykcolor{4 1 roll[4 1 roll]{1 index sub 1 +sub neg dup 0 lt{pop 0}if dup 1 gt{pop 1}if exch}forall pop setrgbcolor} +bind def}ifelse /Mcharproc{currentfile(x)readhexstring pop 0 get exch +div}bind def /Mshadeproc{dup 3 1 roll{dup Mcharproc 3 1 roll}repeat 1 eq +{setgray}{3 eq{setrgbcolor}{setcmykcolor}ifelse}ifelse}bind def +/Mrectproc{3 index 2 index moveto 2 index 3 -1 roll lineto dup 3 1 roll +lineto lineto fill}bind def /Mcolorimage{7 1 roll pop pop matrix +invertmatrix concat 2 exch exp 1 sub 3 1 roll 1 1 2 index{1 1 4 index{ +dup 1 sub exch 2 index dup 1 sub exch 7 index 9 index Mshadeproc +Mrectproc}for pop}for pop pop pop pop}bind def /Mimage{pop matrix +invertmatrix concat 2 exch exp 1 sub 3 1 roll 1 1 2 index{1 1 4 index{ +dup 1 sub exch 2 index dup 1 sub exch 7 index Mcharproc setgray +Mrectproc}for pop}for pop pop pop}bind def +%%EndProcSet: texmma22.pro +%MMA2LTXComment: Here follow the original Mathematica file stripped of the text strings +%! +%%Creator: Mathematica +%%AspectRatio: .61803 +MathPictureStart +%% Graphics +/Courier findfont 10 scalefont setfont +% Scaling calculations +0.0238095 0.952381 0.309017 0.294302 [ +[ -0.001 -0.001 0 0 ] +[ 1.001 .61903 0 0 ] +] MathScale +% Start of Graphics +1 setlinecap +1 setlinejoin +newpath +[ ] 0 setdash +0 g +p +p +.002 w +.21429 .30902 m +.21429 .31527 L +s +P +p +.002 w +.40476 .30902 m +.40476 .31527 L +s +P +p +.002 w +.59524 .30902 m +.59524 .31527 L +s +P +p +.002 w +.78571 .30902 m +.78571 .31527 L +s +P +p +.002 w +.97619 .30902 m +.97619 .31527 L +s +P +p +.001 w +.0619 .30902 m +.0619 .31277 L +s +P +p +.001 w +.1 .30902 m +.1 .31277 L +s +P +p +.001 w +.1381 .30902 m +.1381 .31277 L +s +P +p +.001 w +.17619 .30902 m +.17619 .31277 L +s +P +p +.001 w +.25238 .30902 m +.25238 .31277 L +s +P +p +.001 w +.29048 .30902 m +.29048 .31277 L +s +P +p +.001 w +.32857 .30902 m +.32857 .31277 L +s +P +p +.001 w +.36667 .30902 m +.36667 .31277 L +s +P +p +.001 w +.44286 .30902 m +.44286 .31277 L +s +P +p +.001 w +.48095 .30902 m +.48095 .31277 L +s +P +p +.001 w +.51905 .30902 m +.51905 .31277 L +s +P +p +.001 w +.55714 .30902 m +.55714 .31277 L +s +P +p +.001 w +.63333 .30902 m +.63333 .31277 L +s +P +p +.001 w +.67143 .30902 m +.67143 .31277 L +s +P +p +.001 w +.70952 .30902 m +.70952 .31277 L +s +P +p +.001 w +.74762 .30902 m +.74762 .31277 L +s +P +p +.001 w +.82381 .30902 m +.82381 .31277 L +s +P +p +.001 w +.8619 .30902 m +.8619 .31277 L +s +P +p +.001 w +.9 .30902 m +.9 .31277 L +s +P +p +.001 w +.9381 .30902 m +.9381 .31277 L +s +P +p +.002 w +0 .30902 m +1 .30902 L +s +P +p +.002 w +.02381 .01472 m +.03006 .01472 L +s +P +p +.002 w +.02381 .16187 m +.03006 .16187 L +s +P +p +.002 w +.02381 .45617 m +.03006 .45617 L +s +P +p +.002 w +.02381 .60332 m +.03006 .60332 L +s +P +p +.001 w +.02381 .04415 m +.02756 .04415 L +s +P +p +.001 w +.02381 .07358 m +.02756 .07358 L +s +P +p +.001 w +.02381 .10301 m +.02756 .10301 L +s +P +p +.001 w +.02381 .13244 m +.02756 .13244 L +s +P +p +.001 w +.02381 .1913 m +.02756 .1913 L +s +P +p +.001 w +.02381 .22073 m +.02756 .22073 L +s +P +p +.001 w +.02381 .25016 m +.02756 .25016 L +s +P +p +.001 w +.02381 .27959 m +.02756 .27959 L +s +P +p +.001 w +.02381 .33845 m +.02756 .33845 L +s +P +p +.001 w +.02381 .36788 m +.02756 .36788 L +s +P +p +.001 w +.02381 .39731 m +.02756 .39731 L +s +P +p +.001 w +.02381 .42674 m +.02756 .42674 L +s +P +p +.001 w +.02381 .4856 m +.02756 .4856 L +s +P +p +.001 w +.02381 .51503 m +.02756 .51503 L +s +P +p +.001 w +.02381 .54446 m +.02756 .54446 L +s +P +p +.001 w +.02381 .57389 m +.02756 .57389 L +s +P +p +.002 w +.02381 0 m +.02381 .61803 L +s +P +P +0 0 m +1 0 L +1 .61803 L +0 .61803 L +closepath +clip +newpath +p +p +p +.004 w +.02505 .60122 m +.02629 .50433 L +.02753 .01495 L +.02877 .20456 L +.03001 .40662 L +.03125 .52122 L +.03249 .37939 L +.03373 .59849 L +.03497 .16526 L +.03621 .59913 L +.03745 .49932 L +.03869 .57978 L +.03993 .47842 L +.04117 .01686 L +.04241 .54573 L +.04365 .08292 L +.04489 .58269 L +.04613 .02424 L +.04737 .42893 L +.04861 .49881 L +.04985 .04314 L +.05109 .20767 L +.05233 .57956 L +.05357 .4713 L +.05481 .12034 L +.05605 .02845 L +.05729 .25919 L +.05853 .5293 L +.05977 .59618 L +.06101 .44158 L +.06225 .20574 L +.06349 .0425 L +.06473 .02694 L +.06597 .14355 L +.06721 .32322 L +.06845 .48895 L +.07341 .41006 L +.07465 .27441 L +.07589 .15173 L +.07713 .06312 L +.07837 .01925 L +.07961 .02131 L +.08085 .06335 L +.08209 .13505 L +.08333 .22429 L +.08581 .40937 L +.08705 .48692 L +.08829 .54646 L +.08953 .58513 L +.09077 .60225 L +Mistroke +.09201 .5989 L +.09325 .57739 L +.09449 .54088 L +.09573 .49293 L +.09821 .37715 L +.10069 .25654 L +.10317 .1511 L +.10441 .1082 L +.10565 .0731 L +.10689 .04624 L +.10813 .02773 L +.10938 .01739 L +.11062 .0148 L +.11186 .0194 L +.1131 .03049 L +.11558 .06901 L +.11682 .0948 L +.11806 .12385 L +.12302 .25771 L +.12798 .39089 L +.13046 .4487 L +.13294 .49805 L +.13542 .53798 L +.1379 .56815 L +.13914 .57962 L +.14038 .58873 L +.14162 .59555 L +.14286 .60019 L +.1441 .60272 L +.14534 .60328 L +.14658 .60195 L +.14782 .59888 L +.14906 .59417 L +.1503 .58795 L +.15278 .57149 L +.15774 .52578 L +.1627 .46881 L +.17262 .34332 L +.18254 .22678 L +.19246 .13418 L +.19742 .09842 L +.20238 .06965 L +.20734 .04754 L +.20982 .03883 L +.2123 .03159 L +.21478 .02574 L +.21726 .02122 L +.2185 .01943 L +.21974 .01795 L +.22098 .01675 L +Mistroke +.22222 .01584 L +.22346 .01521 L +.2247 .01483 L +.22594 .01472 L +.22718 .01484 L +.22842 .01521 L +.22966 .0158 L +.2309 .01661 L +.23214 .01763 L +.23462 .02028 L +.2371 .02367 L +.24206 .03243 L +.25198 .05636 L +.2619 .08629 L +.30159 .22571 L +.34127 .35055 L +.36111 .40105 L +.38095 .44359 L +.40079 .47888 L +.42063 .50781 L +.44048 .53126 L +.46032 .55007 L +.48016 .56498 L +.5 .57662 L +.51984 .58556 L +.53968 .59223 L +.5496 .59485 L +.55952 .59704 L +.56944 .59884 L +.57937 .60029 L +.58929 .60143 L +.59921 .60227 L +.60417 .60259 L +.60913 .60285 L +.61409 .60305 L +.61657 .60313 L +.61905 .60319 L +.62153 .60324 L +.62277 .60326 L +.62401 .60328 L +.62525 .6033 L +.62649 .60331 L +.62773 .60331 L +.62897 .60332 L +.63021 .60332 L +.63145 .60332 L +.63269 .60331 L +.63393 .6033 L +.63641 .60328 L +.63765 .60326 L +Mistroke +.63889 .60325 L +.64385 .60314 L +.64881 .60299 L +.65873 .60258 L +.66865 .60202 L +.67857 .60133 L +.69841 .59961 L +.7381 .59506 L +.77778 .5895 L +.81746 .58332 L +.85714 .57678 L +.89683 .57008 L +.93651 .56334 L +.97619 .55666 L +Mfstroke +P +P +P +% End of Graphics +MathPictureEnd +end diff --git a/graphics/mma2ltx/doc/12mag_3d.eps b/graphics/mma2ltx/doc/12mag_3d.eps new file mode 100644 index 0000000000..e81415bed5 --- /dev/null +++ b/graphics/mma2ltx/doc/12mag_3d.eps @@ -0,0 +1,1104 @@ +%!PS-Adobe-2.0 EPSF-2.0 +%%BoundingBox: 0 0 103.64 85.04 +%%Title: 12mag_3d.eps +%%Creator: mma2ltx v1.2 +%%CreationDate: Mon Jul 18 10:20:55 1994 +%%EndComments +%MMA2LTXCommandLine: mma2ltx -stiny -ucm -p -h3cm 12mag_3d.ps +%%BeginProcSet: texmma22.pro +% Mathematica v2.2 prologue +/Mathdict 150 dict def +Mathdict begin +/Mwidth 103.64 def +/Mheight 85.04 def +/Mnodistort true def +/Mlmarg 0 def /Mrmarg 0 def /Mbmarg 0 def /Mtmarg 0 def /Mtransform{} +bind def /Mfixwid true def /Mfixdash false def /Mrot 0 def /Mpstart{ +MathPictureStart}bind def /Mpend{MathPictureEnd}bind def /Mscale{0 1 0 1 +5 -1 roll MathScale}bind def /ISOLatin1Encoding dup where{pop pop}{[ +/.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef +/.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef +/.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef +/.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef +/space /exclam /quotedbl /numbersign /dollar /percent /ampersand +/quoteright /parenleft /parenright /asterisk /plus /comma /minus /period +/slash /zero /one /two /three /four /five /six /seven /eight /nine +/colon /semicolon /less /equal /greater /question /at /A /B /C /D /E /F +/G /H /I /J /K /L /M /N /O /P /Q /R /S /T /U /V /W /X /Y /Z /bracketleft +/backslash /bracketright /asciicircum /underscore /quoteleft /a /b /c /d +/e /f /g /h /i /j /k /l /m /n /o /p /q /r /s /t /u /v /w /x /y /z +/braceleft /bar /braceright /asciitilde /.notdef /.notdef /.notdef +/.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef +/.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /dotlessi /grave +/acute /circumflex /tilde /macron /breve /dotaccent /dieresis /.notdef +/ring /cedilla /.notdef /hungarumlaut /ogonek /caron /space /exclamdown +/cent /sterling /currency /yen /brokenbar /section /dieresis /copyright +/ordfeminine /guillemotleft /logicalnot /hyphen /registered /macron +/degree /plusminus /twosuperior /threesuperior /acute /mu /paragraph +/periodcentered /cedilla /onesuperior /ordmasculine /guillemotright +/onequarter /onehalf /threequarters /questiondown /Agrave /Aacute +/Acircumflex /Atilde /Adieresis /Aring /AE /Ccedilla /Egrave /Eacute +/Ecircumflex /Edieresis /Igrave /Iacute /Icircumflex /Idieresis /Eth +/Ntilde /Ograve /Oacute /Ocircumflex /Otilde /Odieresis /multiply +/Oslash /Ugrave /Uacute /Ucircumflex /Udieresis /Yacute /Thorn +/germandbls /agrave /aacute /acircumflex /atilde /adieresis /aring /ae +/ccedilla /egrave /eacute /ecircumflex /edieresis /igrave /iacute +/icircumflex /idieresis /eth /ntilde /ograve /oacute /ocircumflex +/otilde /odieresis /divide /oslash /ugrave /uacute /ucircumflex +/udieresis /yacute /thorn /ydieresis]def}ifelse /MFontDict 50 dict def +/MStrCat{exch dup length 2 index length add string dup 3 1 roll copy +length exch dup 4 2 roll exch putinterval}def /MCreateEncoding{1 index +255 string cvs(-)MStrCat 1 index MStrCat cvn exch(Encoding)MStrCat cvn +dup where{exch get}{pop StandardEncoding}ifelse 3 1 roll dup MFontDict +exch known not{1 index findfont dup length dict begin{1 index /FID ne{ +def}{pop pop}ifelse}forall /Encoding 3 index def currentdict end 1 index +exch definefont pop MFontDict 1 index null put}if exch pop exch pop}def +/ISOLatin1{(ISOLatin1)MCreateEncoding}def /ISO8859{(ISOLatin1) +MCreateEncoding}def /Mcopyfont{dup maxlength dict exch{1 index /FID eq{ +pop pop}{2 index 3 1 roll put}ifelse}forall}def /Plain /Courier findfont +Mcopyfont definefont pop /Bold /Courier findfont Mcopyfont +definefont pop /Italic /Courier findfont Mcopyfont definefont +pop /MathPictureStart{gsave Mtransform Mlmarg Mbmarg translate Mwidth +Mlmarg Mrmarg add sub /Mwidth exch def Mheight Mbmarg Mtmarg add sub +/Mheight exch def /Mtmatrix matrix currentmatrix def /Mgmatrix matrix +currentmatrix def}bind def /MathPictureEnd{grestore}bind def /MFill{0 0 +moveto Mwidth 0 lineto Mwidth Mheight lineto 0 Mheight lineto fill}bind +def /MPlotRegion{3 index Mwidth mul 2 index Mheight mul translate exch +sub Mheight mul /Mheight exch def exch sub Mwidth mul /Mwidth exch def} +bind def /MathSubStart{Momatrix Mgmatrix Mtmatrix Mwidth Mheight 7 -2 +roll moveto Mtmatrix setmatrix currentpoint Mgmatrix setmatrix 9 -2 roll +moveto Mtmatrix setmatrix currentpoint 2 copy translate /Mtmatrix matrix +currentmatrix def 3 -1 roll exch sub /Mheight exch def sub /Mwidth exch +def}bind def /MathSubEnd{/Mheight exch def /Mwidth exch def /Mtmatrix +exch def dup setmatrix /Mgmatrix exch def /Momatrix exch def}bind def +/Mdot{moveto 0 0 rlineto stroke}bind def /Mtetra{moveto lineto lineto +lineto fill}bind def /Metetra{moveto lineto lineto lineto closepath +gsave fill grestore 0 setgray stroke}bind def /Mistroke{flattenpath 0 0 +0{4 2 roll pop pop}{4 -1 roll 2 index sub dup mul 4 -1 roll 2 index sub +dup mul add sqrt 4 -1 roll add 3 1 roll}{stop}{stop}pathforall pop pop +currentpoint stroke moveto currentdash 3 -1 roll add setdash}bind def +/Mfstroke{stroke currentdash pop 0 setdash}bind def /Mrotsboxa{gsave dup +/Mrot exch def Mrotcheck Mtmatrix dup setmatrix 7 1 roll 4 index 4 index +translate rotate 3 index -1 mul 3 index -1 mul translate /Mtmatrix +matrix currentmatrix def grestore Msboxa 3 -1 roll /Mtmatrix exch def +/Mrot 0 def}bind def /Msboxa{newpath 5 -1 roll Mvboxa pop Mboxout 6 -1 +roll 5 -1 roll 4 -1 roll Msboxa1 5 -3 roll Msboxa1 Mboxrot[7 -2 roll 2 +copy[3 1 roll 10 -1 roll 9 -1 roll]6 1 roll 5 -2 roll]}bind def /Msboxa1 +{sub 2 div dup 2 index 1 add mul 3 -1 roll -1 add 3 -1 roll mul}bind def +/Mvboxa{Mfixwid{Mvboxa1}{dup Mwidthcal 0 exch{add}forall exch Mvboxa1 4 +index 7 -1 roll add 4 -1 roll pop 3 1 roll}ifelse}bind def /Mvboxa1{ +gsave newpath[true 3 -1 roll{Mbbox 5 -1 roll{0 5 1 roll}{7 -1 roll exch +sub(m)stringwidth pop .3 mul sub 7 1 roll 6 -1 roll 4 -1 roll Mmin 3 -1 +roll 5 index add 5 -1 roll 4 -1 roll Mmax 4 -1 roll}ifelse false}forall{ +stop}if counttomark 1 add 4 roll]grestore}bind def /Mbbox{1 dict begin 0 +0 moveto /temp(T)def{gsave currentpoint newpath moveto temp 0 3 -1 roll +put temp false charpath flattenpath currentpoint pathbbox grestore +moveto lineto moveto}forall pathbbox newpath end}bind def /Mmin{2 copy +gt{exch}if pop}bind def /Mmax{2 copy lt{exch}if pop}bind def /Mrotshowa{ +dup /Mrot exch def Mrotcheck Mtmatrix dup setmatrix 7 1 roll 4 index 4 +index translate rotate 3 index -1 mul 3 index -1 mul translate /Mtmatrix +matrix currentmatrix def Mgmatrix setmatrix Mshowa /Mtmatrix exch def +/Mrot 0 def}bind def /Mshowa{4 -2 roll moveto 2 index Mtmatrix setmatrix +Mvboxa 7 1 roll Mboxout 6 -1 roll 5 -1 roll 4 -1 roll Mshowa1 4 1 roll +Mshowa1 rmoveto currentpoint Mfixwid{Mshowax}{Mshoway}ifelse pop pop pop +pop Mgmatrix setmatrix}bind def /Mshowax{0 1 4 index length -1 add{2 +index 4 index 2 index get 3 index add moveto 4 index exch get Mfixdash{ +Mfixdashp}if show}for}bind def /Mfixdashp{dup length 1 gt 1 index true +exch{45 eq and}forall and{gsave(--)stringwidth pop(-)stringwidth pop sub +2 div 0 rmoveto dup length 1 sub{(-)show}repeat grestore}if}bind def +/Mshoway{3 index Mwidthcal 5 1 roll 0 1 4 index length -1 add{2 index 4 +index 2 index get 3 index add moveto 4 index exch get[6 index aload +length 2 add -1 roll{pop Strform stringwidth pop neg exch add 0 rmoveto} +exch kshow cleartomark}for pop}bind def /Mwidthcal{[exch{Mwidthcal1} +forall][exch dup Maxlen -1 add 0 1 3 -1 roll{[exch 2 index{1 index Mget +exch}forall pop Maxget exch}for pop]Mreva}bind def /Mreva{[exch aload +length -1 1{1 roll}for]}bind def /Mget{1 index length -1 add 1 index ge{ +get}{pop pop 0}ifelse}bind def /Maxlen{[exch{length}forall Maxget}bind +def /Maxget{counttomark -1 add 1 1 3 -1 roll{pop Mmax}for exch pop}bind +def /Mwidthcal1{[exch{Strform stringwidth pop}forall]}bind def /Strform{ +/tem(x)def tem 0 3 -1 roll put tem}bind def /Mshowa1{2 copy add 4 1 roll +sub mul sub -2 div}bind def /MathScale{Mwidth Mheight Mlp translate +scale /yscale exch def /ybias exch def /xscale exch def /xbias exch def +/Momatrix xscale yscale matrix scale xbias ybias matrix translate matrix +concatmatrix def /Mgmatrix matrix currentmatrix def}bind def /Mlp{3 copy +Mlpfirst{Mnodistort{Mmin dup}if 4 index 2 index 2 index Mlprun 11 index +11 -1 roll 10 -4 roll Mlp1 8 index 9 -5 roll Mlp1 4 -1 roll and{exit}if +3 -1 roll pop pop}loop exch 3 1 roll 7 -3 roll pop pop pop}bind def +/Mlpfirst{3 -1 roll dup length 2 copy -2 add get aload pop pop pop 4 -2 +roll -1 add get aload pop pop pop 6 -1 roll 3 -1 roll 5 -1 roll sub div +4 1 roll exch sub div}bind def /Mlprun{2 copy 4 index 0 get dup 4 1 roll +Mlprun1 3 copy 8 -2 roll 9 -1 roll{3 copy Mlprun1 3 copy 11 -3 roll /gt +Mlpminmax 8 3 roll 11 -3 roll /lt Mlpminmax 8 3 roll}forall pop pop pop +pop 3 1 roll pop pop aload pop 5 -1 roll aload pop exch 6 -1 roll +Mlprun2 8 2 roll 4 -1 roll Mlprun2 6 2 roll 3 -1 roll Mlprun2 4 2 roll +exch Mlprun2 6 2 roll}bind def /Mlprun1{aload pop exch 6 -1 roll 5 -1 +roll mul add 4 -2 roll mul 3 -1 roll add}bind def /Mlprun2{2 copy add 2 +div 3 1 roll exch sub}bind def /Mlpminmax{cvx 2 index 6 index 2 index +exec{7 -3 roll 4 -1 roll}if 1 index 5 index 3 -1 roll exec{4 1 roll pop +5 -1 roll aload pop pop 4 -1 roll aload pop[8 -2 roll pop 5 -2 roll pop +6 -2 roll pop 5 -1 roll]4 1 roll pop}{pop pop pop}ifelse}bind def /Mlp1{ +5 index 3 index sub 5 index 2 index mul 1 index le 1 index 0 le or dup +not{1 index 3 index div .99999 mul 8 -1 roll pop 7 1 roll}if 8 -1 roll 2 +div 7 -2 roll pop sub 5 index 6 -3 roll pop pop mul sub exch}bind def +/intop 0 def /inrht 0 def /inflag 0 def /outflag 0 def /xadrht 0 def +/xadlft 0 def /yadtop 0 def /yadbot 0 def /Minner{outflag 1 eq{/outflag +0 def /intop 0 def /inrht 0 def}if 5 index gsave Mtmatrix setmatrix +Mvboxa pop grestore 3 -1 roll pop dup intop gt{/intop exch def}{pop} +ifelse dup inrht gt{/inrht exch def}{pop}ifelse pop /inflag 1 def}bind +def /Mouter{/xadrht 0 def /xadlft 0 def /yadtop 0 def /yadbot 0 def +inflag 1 eq{dup 0 lt{dup intop mul neg /yadtop exch def}if dup 0 gt{dup +intop mul /yadbot exch def}if pop dup 0 lt{dup inrht mul neg /xadrht +exch def}if dup 0 gt{dup inrht mul /xadlft exch def}if pop /outflag 1 +def}{pop pop}ifelse /inflag 0 def /inrht 0 def /intop 0 def}bind def +/Mboxout{outflag 1 eq{4 -1 roll xadlft leadjust add sub 4 1 roll 3 -1 +roll yadbot leadjust add sub 3 1 roll exch xadrht leadjust add add exch +yadtop leadjust add add /outflag 0 def /xadlft 0 def /yadbot 0 def +/xadrht 0 def /yadtop 0 def}if}bind def /leadjust{(m)stringwidth pop .5 +mul}bind def /Mrotcheck{dup 90 eq{yadbot /yadbot xadrht def /xadrht +yadtop def /yadtop xadlft def /xadlft exch def}if dup cos 1 index sin +Checkaux dup cos 1 index sin neg exch Checkaux 3 1 roll pop pop}bind def +/Checkaux{4 index exch 4 index mul 3 1 roll mul add 4 1 roll}bind def +/Mboxrot{Mrot 90 eq{brotaux 4 2 roll}if Mrot 180 eq{4 2 roll brotaux 4 2 +roll brotaux}if Mrot 270 eq{4 2 roll brotaux}if}bind def /brotaux{neg +exch neg}bind def /Mabsproc{0 matrix defaultmatrix dtransform +idtransform dup mul exch dup mul add sqrt}bind def /Mabswid{Mabsproc +setlinewidth}bind def /Mabsdash{exch[exch{Mabsproc}forall]exch setdash} +bind def /MBeginOrig{Momatrix concat}bind def /MEndOrig{Mgmatrix +setmatrix}bind def /sampledsound where{pop}{/sampledsound{exch pop exch +5 1 roll mul 4 idiv mul 2 idiv exch pop exch /Mtempproc exch def{ +Mtempproc pop}repeat}bind def}ifelse /g{setgray}bind def /k{ +setcmykcolor}bind def /m{moveto}bind def /p{gsave}bind def /r{ +setrgbcolor}bind def /w{setlinewidth}bind def /C{curveto}bind def /F{ +fill}bind def /L{lineto}bind def /P{grestore}bind def /s{stroke}bind def +/setcmykcolor where{pop}{/setcmykcolor{4 1 roll[4 1 roll]{1 index sub 1 +sub neg dup 0 lt{pop 0}if dup 1 gt{pop 1}if exch}forall pop setrgbcolor} +bind def}ifelse /Mcharproc{currentfile(x)readhexstring pop 0 get exch +div}bind def /Mshadeproc{dup 3 1 roll{dup Mcharproc 3 1 roll}repeat 1 eq +{setgray}{3 eq{setrgbcolor}{setcmykcolor}ifelse}ifelse}bind def +/Mrectproc{3 index 2 index moveto 2 index 3 -1 roll lineto dup 3 1 roll +lineto lineto fill}bind def /Mcolorimage{7 1 roll pop pop matrix +invertmatrix concat 2 exch exp 1 sub 3 1 roll 1 1 2 index{1 1 4 index{ +dup 1 sub exch 2 index dup 1 sub exch 7 index 9 index Mshadeproc +Mrectproc}for pop}for pop pop pop pop}bind def /Mimage{pop matrix +invertmatrix concat 2 exch exp 1 sub 3 1 roll 1 1 2 index{1 1 4 index{ +dup 1 sub exch 2 index dup 1 sub exch 7 index Mcharproc setgray +Mrectproc}for pop}for pop pop pop}bind def +%%EndProcSet: texmma22.pro +%MMA2LTXComment: Here follow the original Mathematica file stripped of the text strings +%! +%%Creator: Mathematica +%%AspectRatio: .82055 +MathPictureStart +%% SurfaceGraphics +/Courier findfont 10 scalefont setfont +% Scaling calculations +0.0249355 0.99742 -0.0396341 0.99742 [ +[ 0 0 0 0 ] +[ 1 .82055 0 0 ] +] MathScale +% Start of Graphics +1 setlinecap +1 setlinejoin +newpath +[ ] 0 setdash +0 g +p +p +.002 w +.06024 .26735 m +.67932 .02494 L +s +P +p +.002 w +.16191 .22754 m +.16631 .23196 L +s +P +p +.002 w +.35089 .15354 m +.35496 .15826 L +s +P +p +.002 w +.55515 .07356 m +.55883 .07859 L +s +P +p +.001 w +.19857 .21319 m +.20117 .21587 L +s +P +p +.001 w +.23578 .19861 m +.23834 .20134 L +s +P +p +.001 w +.27356 .18382 m +.27609 .18658 L +s +P +p +.001 w +.31193 .1688 m +.31441 .17159 L +s +P +p +.001 w +.39046 .13804 m +.39286 .14091 L +s +P +p +.001 w +.43066 .1223 m +.43301 .12521 L +s +P +p +.001 w +.4715 .10631 m +.4738 .10926 L +s +P +p +.001 w +.51299 .09007 m +.51525 .09305 L +s +P +p +.001 w +.1258 .24168 m +.12847 .2443 L +s +P +p +.001 w +.09021 .25561 m +.09292 .25819 L +s +P +p +.001 w +.598 .05678 m +.60015 .05984 L +s +P +p +.001 w +.64156 .03972 m +.64365 .04282 L +s +P +P +p +p +.002 w +.67932 .02494 m +.94594 .43277 L +s +P +p +.002 w +.73688 .11298 m +.73104 .11515 L +s +P +p +.002 w +.82692 .2507 m +.82101 .25271 L +s +P +p +.002 w +.90545 .37083 m +.8995 .3727 L +s +P +p +.001 w +.75593 .14211 m +.75241 .14339 L +s +P +p +.001 w +.77443 .17042 m +.77091 .17168 L +s +P +p +.001 w +.79242 .19793 m +.78889 .19917 L +s +P +p +.001 w +.8099 .22468 m +.80637 .2259 L +s +P +p +.001 w +.84347 .27602 m +.83992 .27721 L +s +P +p +.001 w +.85958 .30067 m +.85603 .30184 L +s +P +p +.001 w +.87527 .32467 m +.87171 .32582 L +s +P +p +.001 w +.89056 .34805 m +.88699 .34919 L +s +P +p +.001 w +.71727 .08298 m +.71377 .0843 L +s +P +p +.001 w +.69707 .05207 m +.69358 .05342 L +s +P +p +.001 w +.91997 .39304 m +.9164 .39415 L +s +P +p +.001 w +.93413 .4147 m +.93055 .41579 L +s +P +P +p +p +.002 w +.06024 .26735 m +.02494 .49015 L +s +P +p +.002 w +.05986 .26974 m +.06567 .26747 L +s +P +p +.002 w +.0517 .32128 m +.05752 .31906 L +s +P +p +.002 w +.04324 .37466 m +.04908 .37249 L +s +P +p +.002 w +.03447 .42999 m +.04034 .42788 L +s +P +p +.002 w +.02537 .48738 m +.03126 .48533 L +s +P +p +.001 w +.05825 .27991 m +.06174 .27855 L +s +P +p +.001 w +.05663 .29014 m +.06012 .28879 L +s +P +p +.001 w +.055 .30045 m +.05849 .2991 L +s +P +p +.001 w +.05335 .31083 m +.05685 .30949 L +s +P +p +.001 w +.05003 .3318 m +.05353 .33048 L +s +P +p +.001 w +.04835 .3424 m +.05185 .34108 L +s +P +p +.001 w +.04666 .35308 m +.05016 .35177 L +s +P +p +.001 w +.04495 .36383 m +.04846 .36252 L +s +P +p +.001 w +.04151 .38557 m +.04502 .38427 L +s +P +p +.001 w +.03977 .39655 m +.04328 .39527 L +s +P +p +.001 w +.03801 .40762 m +.04153 .40634 L +s +P +p +.001 w +.03625 .41876 m +.03977 .41749 L +s +P +p +.001 w +.03268 .4413 m +.0362 .44004 L +s +P +p +.001 w +.03087 .45269 m +.0344 .45144 L +s +P +p +.001 w +.02905 .46417 m +.03258 .46292 L +s +P +p +.001 w +.02722 .47573 m +.03075 .47449 L +s +P +P +0 0 m +1 0 L +1 .82055 L +0 .82055 L +closepath +clip +newpath +p +.002 w +.06024 .26735 m +.02494 .49015 L +s +.02494 .49015 m +.40296 .79562 L +s +.40296 .79562 m +.41001 .59401 L +s +.41001 .59401 m +.06024 .26735 L +s +.67932 .02494 m +.94594 .43277 L +s +.94594 .43277 m +.97506 .64585 L +s +.97506 .64585 m +.69286 .25814 L +s +.69286 .25814 m +.67932 .02494 L +s +.06024 .26735 m +.02494 .49015 L +s +.02494 .49015 m +.69286 .25814 L +s +.69286 .25814 m +.67932 .02494 L +s +.67932 .02494 m +.06024 .26735 L +s +.41001 .59401 m +.94594 .43277 L +s +.94594 .43277 m +.97506 .64585 L +s +.97506 .64585 m +.40296 .79562 L +s +.40296 .79562 m +.41001 .59401 L +s +P +p +0 .096 .575 r +.0015 w +.38505 .67298 .40659 .69179 .44146 .72507 .42007 .70194 Metetra +0 .368 .834 r +.42007 .70194 .44146 .72507 .47787 .75077 .45661 .72394 Metetra +.421 .591 .913 r +.45661 .72394 .47787 .75077 .51565 .76096 .49455 .73186 Metetra +.65 .676 .861 r +.49455 .73186 .51565 .76096 .55426 .75082 .53342 .72139 Metetra +.757 .71 .808 r +.53342 .72139 .55426 .75082 .59303 .72006 .5726 .69228 Metetra +.813 .734 .776 r +.5726 .69228 .59303 .72006 .63138 .67312 .61156 .64848 Metetra +.846 .757 .765 r +.61156 .64848 .63138 .67312 .66909 .61778 .65002 .59698 Metetra +.862 .786 .775 r +.65002 .59698 .66909 .61778 .70634 .56311 .68812 .54597 Metetra +.856 .821 .813 r +.68812 .54597 .70634 .56311 .74372 .51741 .72634 .50303 Metetra +.805 .855 .887 r +.72634 .50303 .74372 .51741 .78207 .48688 .76543 .47385 Metetra +.64 .84 .977 r +.76543 .47385 .78207 .48688 .8223 .47481 .8062 .46148 Metetra +.314 .683 .978 r +.8062 .46148 .8223 .47481 .86517 .48141 .84938 .46611 Metetra +.036 .47 .88 r +.84938 .46611 .86517 .48141 .91111 .5037 .89538 .48498 Metetra +0 .378 .836 r +.89538 .48498 .91111 .5037 .96002 .53575 .94412 .51262 Metetra +.009 .432 .863 r +.36293 .65367 .38505 .67298 .42007 .70194 .39846 .67034 Metetra +.386 .535 .882 r +.39846 .67034 .42007 .70194 .45661 .72394 .43526 .68197 Metetra +.552 .56 .816 r +.43526 .68197 .45661 .72394 .49455 .73186 .47327 .68377 Metetra +.637 .582 .776 r +.47327 .68377 .49455 .73186 .53342 .72139 .51218 .67288 Metetra +.695 .61 .758 r +.51218 .67288 .53342 .72139 .5726 .69228 .55158 .64914 Metetra +.742 .649 .757 r +.55158 .64914 .5726 .69228 .61156 .64848 .59107 .61514 Metetra +.786 .705 .774 r +.59107 .61514 .61156 .64848 .65002 .59698 .63043 .57559 Metetra +.826 .787 .814 r +.63043 .57559 .65002 .59698 .68812 .54597 .6697 .53613 Metetra +.839 .902 .882 r +.6697 .53613 .68812 .54597 .72634 .50303 .70921 .50211 Metetra +.693 .975 .914 r +.70921 .50211 .72634 .50303 .76543 .47385 .74946 .47765 Metetra +.245 .752 .721 r +.74946 .47765 .76543 .47385 .8062 .46148 .79104 .46503 Metetra +.104 0 0 r +.79104 .46503 .8062 .46148 .84938 .46611 .83448 .46437 Metetra +.183 0 0 r +.83448 .46437 .84938 .46611 .89538 .48498 .88006 .47363 Metetra +.003 .499 .865 r +.88006 .47363 .89538 .48498 .94412 .51262 .92776 .4888 Metetra +.515 .706 .958 r +.34022 .63385 .36293 .65367 .39846 .67034 .37667 .63267 Metetra +.587 .599 .831 r +.37667 .63267 .39846 .67034 .43526 .68197 .41394 .6295 Metetra +.611 .554 .766 r +.41394 .6295 .43526 .68197 .47327 .68377 .45203 .62271 Metetra +.628 .543 .739 r +.45203 .62271 .47327 .68377 .51218 .67288 .49085 .61134 Metetra +.647 .553 .735 r +.49085 .61134 .51218 .67288 .55158 .64914 .53025 .59534 Metetra +.671 .585 .751 r +.53025 .59534 .55158 .64914 .59107 .61514 .57008 .57556 Metetra +.702 .65 .795 r +.57008 .57556 .59107 .61514 .63043 .57559 .61028 .55361 Metetra +.739 .774 .882 r +.61028 .55361 .63043 .57559 .6697 .53613 .65084 .53145 Metetra +.68 .946 .96 r +.65084 .53145 .6697 .53613 .70921 .50211 .69188 .51105 Metetra +.69188 .51105 .70921 .50211 .74946 .47765 .73358 .494 Metetra +.135 0 0 r +.73358 .494 .74946 .47765 .79104 .46503 .77618 .48116 Metetra +.221 0 0 r +.77618 .48116 .79104 .46503 .83448 .46437 .81987 .47259 Metetra +.124 0 0 r +.81987 .47259 .83448 .46437 .88006 .47363 .86478 .46747 Metetra +.288 .761 .936 r +.86478 .46747 .88006 .47363 .92776 .4888 .91091 .46428 Metetra +.739 .766 .875 r +.31689 .61349 .34022 .63385 .37667 .63267 .35461 .59244 Metetra +.689 .635 .79 r +.35461 .59244 .37667 .63267 .41394 .6295 .3926 .57313 Metetra +.652 .566 .746 r +.3926 .57313 .41394 .6295 .45203 .62271 .43086 .55711 Metetra +.625 .532 .728 r +.43086 .55711 .45203 .62271 .49085 .61134 .46952 .54525 Metetra +.606 .52 .732 r +.46952 .54525 .49085 .61134 .53025 .59534 .50875 .53759 Metetra +.591 .533 .758 r +.50875 .53759 .53025 .59534 .57008 .57556 .54872 .53334 Metetra +.576 .582 .822 r +.54872 .53334 .57008 .57556 .61028 .55361 .58955 .53099 Metetra +.533 .704 .949 r +.58955 .53099 .61028 .55361 .65084 .53145 .63128 .52859 Metetra +.241 .749 .878 r +.63128 .52859 .65084 .53145 .69188 .51105 .67385 .5241 Metetra +.143 0 0 r +.67385 .5241 .69188 .51105 .73358 .494 .7171 .51584 Metetra +.214 0 0 r +.7171 .51584 .73358 .494 .77618 .48116 .76082 .5028 Metetra +.136 0 0 r +.76082 .5028 .77618 .48116 .81987 .47259 .80484 .48492 Metetra +.80484 .48492 .81987 .47259 .86478 .46747 .84907 .46311 Metetra +.668 .963 .933 r +.84907 .46311 .86478 .46747 .91091 .46428 .89354 .43901 Metetra +.817 .767 .806 r +.29291 .59257 .31689 .61349 .35461 .59244 .33211 .55352 Metetra +.751 .666 .767 r +.33211 .55352 .35461 .59244 .3926 .57313 .37097 .51988 Metetra +.688 .594 .745 r +.37097 .51988 .3926 .57313 .43086 .55711 .40953 .49576 Metetra +.628 .543 .739 r +.40953 .49576 .43086 .55711 .46952 .54525 .44809 .48341 Metetra +.566 .507 .748 r +.44809 .48341 .46952 .54525 .50875 .53759 .48709 .48297 Metetra +.491 .486 .779 r +.48709 .48297 .50875 .53759 .54872 .53334 .52702 .4924 Metetra +.383 .488 .842 r +.52702 .4924 .54872 .53334 .58955 .53099 .56822 .50772 Metetra +.172 .509 .912 r +.56822 .50772 .58955 .53099 .63128 .52859 .61084 .52356 Metetra +0 .429 .692 r +.61084 .52356 .63128 .52859 .67385 .5241 .65469 .53409 Metetra +.253 0 0 r +.65469 .53409 .67385 .5241 .7171 .51584 .69935 .53424 Metetra +.138 0 0 r +.69935 .53424 .7171 .51584 .76082 .5028 .74419 .52098 Metetra +.74419 .52098 .76082 .5028 .80484 .48492 .78867 .49412 Metetra +.589 .911 .664 r +.78867 .49412 .80484 .48492 .84907 .46311 .83246 .45646 Metetra +.867 .973 .855 r +.83246 .45646 .84907 .46311 .89354 .43901 .87565 .41296 Metetra +.846 .762 .77 r +.26827 .57106 .29291 .59257 .33211 .55352 .30886 .51932 Metetra +.793 .699 .761 r +.30886 .51932 .33211 .55352 .37097 .51988 .34863 .47573 Metetra +.726 .641 .763 r +.34863 .47573 .37097 .51988 .40953 .49576 .38761 .446 Metetra +.639 .582 .774 r +.38761 .446 .40953 .49576 .44809 .48341 .42622 .43321 Metetra +.52 .518 .794 r +.42622 .43321 .44809 .48341 .48709 .48297 .46508 .43754 Metetra +.35 .445 .817 r +.46508 .43754 .48709 .48297 .52702 .4924 .5049 .45623 Metetra +.114 .36 .823 r +.5049 .45623 .52702 .4924 .56822 .50772 .54626 .48375 Metetra +0 .285 .771 r +.54626 .48375 .56822 .50772 .61084 .52356 .5894 .51247 Metetra +0 .288 .664 r +.5894 .51247 .61084 .52356 .65469 .53409 .63415 .53378 Metetra +.162 0 0 r +.63415 .53378 .65469 .53409 .69935 .53424 .67988 .54001 Metetra +.67988 .54001 .69935 .53424 .74419 .52098 .7257 .52645 Metetra +.635 .957 .781 r +.7257 .52645 .74419 .52098 .78867 .49412 .77075 .49287 Metetra +.874 .992 .81 r +.77075 .49287 .78867 .49412 .83246 .45646 .81455 .44356 Metetra +.919 .912 .796 r +.81455 .44356 .83246 .45646 .87565 .41296 .85719 .3861 Metetra +.853 .76 .759 r +.24293 .54895 .26827 .57106 .30886 .51932 .28455 .49224 Metetra +.824 .739 .771 r +.28455 .49224 .30886 .51932 .34863 .47573 .3251 .44474 Metetra +.767 .714 .803 r +.3251 .44474 .34863 .47573 .38761 .446 .36458 .41272 Metetra +.657 .669 .85 r +.36458 .41272 .38761 .446 .42622 .43321 .40344 .39954 Metetra +.448 .575 .889 r +.40344 .39954 .42622 .43321 .46508 .43754 .44238 .40538 Metetra +.133 .408 .855 r +.44238 .40538 .46508 .43754 .5049 .45623 .48222 .42724 Metetra +0 .243 .753 r +.48222 .42724 .5049 .45623 .54626 .48375 .52365 .45908 Metetra +0 .199 .701 r +.52365 .45908 .54626 .48375 .5894 .51247 .56702 .49241 Metetra +0 .325 .778 r +.56702 .49241 .5894 .51247 .63415 .53378 .6122 .51759 Metetra +.192 .616 .946 r +.6122 .51759 .63415 .53378 .67988 .54001 .65855 .52589 Metetra +.608 .857 .991 r +.65855 .52589 .67988 .54001 .7257 .52645 .70508 .51195 Metetra +.823 .904 .896 r +.70508 .51195 .7257 .52645 .77075 .49287 .75081 .47548 Metetra +.894 .879 .813 r +.75081 .47548 .77075 .49287 .81455 .44356 .79515 .42142 Metetra +.908 .846 .771 r +.79515 .42142 .81455 .44356 .85719 .3861 .83815 .35839 Metetra +.846 .762 .77 r +.21687 .5262 .24293 .54895 .28455 .49224 .25887 .4732 Metetra +.842 .792 .804 r +.25887 .4732 .28455 .49224 .3251 .44474 .2999 .42848 Metetra +.8 .827 .872 r +.2999 .42848 .3251 .44474 .36458 .41272 .3399 .3978 Metetra +.652 .831 .969 r +.3399 .3978 .36458 .41272 .40344 .39954 .37924 .38427 Metetra +.275 .671 .97 r +.37924 .38427 .40344 .39954 .44238 .40538 .41859 .38806 Metetra +0 .379 .796 r +.41859 .38806 .44238 .40538 .48222 .42724 .45873 .40637 Metetra +0 .238 .708 r +.45873 .40637 .48222 .42724 .52365 .45908 .50034 .43365 Metetra +0 .285 .771 r +.50034 .43365 .52365 .45908 .56702 .49241 .5438 .46214 Metetra +.138 .445 .879 r +.5438 .46214 .56702 .49241 .6122 .51759 .58906 .48313 Metetra +.443 .595 .907 r +.58906 .48313 .6122 .51759 .65855 .52589 .63558 .48879 Metetra +.646 .68 .868 r +.63558 .48879 .65855 .52589 .70508 .51195 .6825 .47434 Metetra +.761 .725 .819 r +.6825 .47434 .70508 .51195 .75081 .47548 .72891 .43954 Metetra +.827 .756 .784 r +.72891 .43954 .75081 .47548 .79515 .42142 .77425 .38878 Metetra +.865 .784 .77 r +.77425 .38878 .79515 .42142 .83815 .35839 .81849 .32978 Metetra +.817 .767 .806 r +.19004 .50278 .21687 .5262 .25887 .4732 .23163 .46155 Metetra +.831 .861 .868 r +.23163 .46155 .25887 .4732 .2999 .42848 .27268 .42589 Metetra +.757 .955 .938 r +.27268 .42589 .2999 .42848 .3399 .3978 .31312 .39999 Metetra +.429 .871 .878 r +.31312 .39999 .3399 .3978 .37924 .38427 .35318 .38615 Metetra +.35318 .38615 .37924 .38427 .41859 .38806 .39336 .3845 Metetra +.183 0 0 r +.39336 .3845 .41859 .38806 .45873 .40637 .43423 .39295 Metetra +0 .432 .794 r +.43423 .39295 .45873 .40637 .50034 .43365 .47632 .40743 Metetra +.172 .509 .912 r +.47632 .40743 .50034 .43365 .5438 .46214 .51994 .42245 Metetra +.408 .541 .878 r +.51994 .42245 .5438 .46214 .58906 .48313 .5651 .43198 Metetra +.544 .559 .82 r +.5651 .43198 .58906 .48313 .63558 .48879 .61146 .43079 Metetra +.629 .582 .782 r +.61146 .43079 .63558 .48879 .6825 .47434 .65846 .41575 Metetra +.693 .615 .764 r +.65846 .41575 .6825 .47434 .72891 .43954 .70547 .38667 Metetra +.747 .66 .764 r +.70547 .38667 .72891 .43954 .77425 .38878 .75207 .34645 Metetra +.797 .723 .783 r +.75207 .34645 .77425 .38878 .81849 .32978 .79819 .30023 Metetra +.739 .766 .875 r +.16241 .47867 .19004 .50278 .23163 .46155 .20277 .4551 Metetra +.721 .922 .96 r +.20277 .4551 .23163 .46155 .27268 .42589 .24333 .43331 Metetra +.447 .88 .813 r +.24333 .43331 .27268 .42589 .31312 .39999 .28405 .41491 Metetra +.28405 .41491 .31312 .39999 .35318 .38615 .32503 .4008 Metetra +.031 0 0 r +.32503 .4008 .35318 .38615 .39336 .3845 .36645 .39102 Metetra +.36645 .39102 .39336 .3845 .43423 .39295 .40855 .38474 Metetra +.336 .781 .96 r +.40855 .38474 .43423 .39295 .47632 .40743 .45154 .3804 Metetra +.533 .704 .949 r +.45154 .3804 .47632 .40743 .51994 .42245 .49558 .37595 Metetra +.581 .599 .836 r +.49558 .37595 .51994 .42245 .5651 .43198 .54068 .36927 Metetra +.6 .551 .771 r +.54068 .36927 .5651 .43198 .61146 .43079 .58675 .3586 Metetra +.618 .538 .742 r +.58675 .3586 .61146 .43079 .65846 .41575 .63362 .34288 Metetra +.639 .55 .738 r +.63362 .34288 .65846 .41575 .70547 .38667 .68106 .32207 Metetra +.665 .586 .757 r +.68106 .32207 .70547 .38667 .75207 .34645 .72894 .2971 Metetra +.701 .657 .804 r +.72894 .2971 .75207 .34645 .79819 .30023 .77721 .2697 Metetra +.515 .706 .958 r +.13396 .45384 .16241 .47867 .20277 .4551 .17246 .45043 Metetra +.32 .789 .93 r +.17246 .45043 .20277 .4551 .24333 .43331 .21206 .44486 Metetra +.21206 .44486 .24333 .43331 .28405 .41491 .25288 .4354 Metetra +.25288 .4354 .28405 .41491 .32503 .4008 .29486 .42102 Metetra +.29486 .42102 .32503 .4008 .36645 .39102 .33785 .40167 Metetra +.447 .87 .747 r +.33785 .40167 .36645 .39102 .40855 .38474 .38163 .37827 Metetra +.729 .946 .952 r +.38163 .37827 .40855 .38474 .45154 .3804 .42598 .3525 Metetra +.739 .774 .882 r +.42598 .3525 .45154 .3804 .49558 .37595 .47078 .32647 Metetra +.687 .64 .798 r +.47078 .32647 .49558 .37595 .54068 .36927 .51605 .30224 Metetra +.644 .564 .75 r +.51605 .30224 .54068 .36927 .58675 .3586 .5619 .28147 Metetra +.614 .525 .73 r +.5619 .28147 .58675 .3586 .63362 .34288 .60855 .26507 Metetra +.593 .513 .733 r +.60855 .26507 .63362 .34288 .68106 .32207 .65625 .25308 Metetra +.579 .527 .761 r +.65625 .25308 .68106 .32207 .72894 .2971 .70521 .24464 Metetra +.569 .581 .826 r +.70521 .24464 .72894 .2971 .77721 .2697 .75552 .23814 Metetra +.009 .432 .863 r +.10464 .42825 .13396 .45384 .17246 .45043 .14104 .44346 Metetra +.195 0 0 r +.14104 .44346 .17246 .45043 .21206 .44486 .17944 .45321 Metetra +.138 0 0 r +.17944 .45321 .21206 .44486 .25288 .4354 .22019 .45232 Metetra +.22019 .45232 .25288 .4354 .29486 .42102 .26317 .43765 Metetra +.465 .864 .685 r +.26317 .43765 .29486 .42102 .33785 .40167 .30787 .40904 Metetra +.784 .998 .846 r +.30787 .40904 .33785 .40167 .38163 .37827 .35357 .36935 Metetra +.869 .919 .859 r +.35357 .36935 .38163 .37827 .42598 .3525 .39958 .3237 Metetra +.826 .787 .814 r +.39958 .3237 .42598 .3525 .47078 .32647 .44549 .27816 Metetra +.756 .677 .774 r +.44549 .27816 .47078 .32647 .51605 .30224 .49121 .23844 Metetra +.686 .596 .75 r +.49121 .23844 .51605 .30224 .5619 .28147 .53706 .20887 Metetra +.618 .538 .742 r +.53706 .20887 .5619 .28147 .60855 .26507 .58357 .19179 Metetra +.552 .499 .751 r +.58357 .19179 .60855 .26507 .65625 .25308 .63141 .18732 Metetra +.482 .482 .78 r +.63141 .18732 .65625 .25308 .70521 .24464 .68114 .19329 Metetra +.401 .495 .84 r +.68114 .19329 .70521 .24464 .75552 .23814 .73309 .20548 Metetra +0 .096 .575 r +.07442 .40187 .10464 .42825 .14104 .44346 .10905 .43019 Metetra +.414 0 0 r +.10905 .43019 .14104 .44346 .17944 .45321 .14636 .45093 Metetra +.13 0 0 r +.14636 .45093 .17944 .45321 .22019 .45232 .18699 .45621 Metetra +.394 .852 .852 r +.18699 .45621 .22019 .45232 .26317 .43765 .23082 .44119 Metetra +.773 .989 .892 r +.23082 .44119 .26317 .43765 .30787 .40904 .27708 .40561 Metetra +.889 .94 .841 r +.27708 .40561 .30787 .40904 .35357 .36935 .32462 .35393 Metetra +.896 .861 .798 r +.32462 .35393 .35357 .36935 .39958 .3237 .37232 .29396 Metetra +.862 .786 .775 r +.37232 .29396 .39958 .3237 .44549 .27816 .41948 .23467 Metetra +.805 .716 .767 r +.41948 .23467 .44549 .27816 .49121 .23844 .46594 .18421 Metetra +.728 .649 .77 r +.46594 .18421 .49121 .23844 .53706 .20887 .51208 .14854 Metetra +.631 .582 .78 r +.51208 .14854 .53706 .20887 .58357 .19179 .55866 .13082 Metetra +.511 .515 .796 r +.55866 .13082 .58357 .19179 .63141 .18732 .60663 .13118 Metetra +.369 .453 .816 r +.60663 .13118 .63141 .18732 .68114 .19329 .65686 .14672 Metetra +.214 .41 .839 r +.65686 .14672 .68114 .19329 .73309 .20548 .70986 .17168 Metetra +.537 .015 0 r +.04324 .37466 .07442 .40187 .10905 .43019 .077 .40763 Metetra +0 .168 .606 r +.077 .40763 .10905 .43019 .14636 .45093 .1138 .43228 Metetra +.116 .582 .916 r +.1138 .43228 .14636 .45093 .18699 .45621 .15445 .43963 Metetra +.627 .848 .984 r +.15445 .43963 .18699 .45621 .23082 .44119 .19889 .42414 Metetra +.819 .866 .881 r +.19889 .42414 .23082 .44119 .27708 .40561 .24623 .38554 Metetra +.874 .836 .806 r +.24623 .38554 .27708 .40561 .32462 .35393 .2951 .32894 Metetra +.883 .808 .77 r +.2951 .32894 .32462 .35393 .37232 .29396 .34415 .26321 Metetra +.871 .784 .763 r +.34415 .26321 .37232 .29396 .41948 .23467 .39247 .19847 Metetra +.837 .76 .778 r +.39247 .19847 .41948 .23467 .46594 .18421 .43981 .14372 Metetra +.772 .728 .812 r +.43981 .14372 .46594 .18421 .51208 .14854 .48654 .10547 Metetra +.653 .673 .856 r +.48654 .10547 .51208 .14854 .55866 .13082 .5335 .08713 Metetra +.465 .578 .883 r +.5335 .08713 .55866 .13082 .60663 .13118 .58175 .08883 Metetra +.239 .456 .869 r +.58175 .08883 .60663 .13118 .65686 .14672 .6323 .10744 Metetra +.062 .362 .832 r +.6323 .10744 .65686 .14672 .70986 .17168 .68581 .13668 Metetra +P +p +.002 w +.67932 .02494 m +.94594 .43277 L +s +.94594 .43277 m +.97506 .64585 L +s +.97506 .64585 m +.69286 .25814 L +s +.69286 .25814 m +.67932 .02494 L +s +.06024 .26735 m +.02494 .49015 L +s +.02494 .49015 m +.69286 .25814 L +s +.69286 .25814 m +.67932 .02494 L +s +.67932 .02494 m +.06024 .26735 L +s +P +p +p +.002 w +.06024 .26735 m +.67932 .02494 L +s +P +p +.002 w +.16191 .22754 m +.16631 .23196 L +s +P +p +.002 w +.35089 .15354 m +.35496 .15826 L +s +P +p +.002 w +.55515 .07356 m +.55883 .07859 L +s +P +p +.001 w +.19857 .21319 m +.20117 .21587 L +s +P +p +.001 w +.23578 .19861 m +.23834 .20134 L +s +P +p +.001 w +.27356 .18382 m +.27609 .18658 L +s +P +p +.001 w +.31193 .1688 m +.31441 .17159 L +s +P +p +.001 w +.39046 .13804 m +.39286 .14091 L +s +P +p +.001 w +.43066 .1223 m +.43301 .12521 L +s +P +p +.001 w +.4715 .10631 m +.4738 .10926 L +s +P +p +.001 w +.51299 .09007 m +.51525 .09305 L +s +P +p +.001 w +.1258 .24168 m +.12847 .2443 L +s +P +p +.001 w +.09021 .25561 m +.09292 .25819 L +s +P +p +.001 w +.598 .05678 m +.60015 .05984 L +s +P +p +.001 w +.64156 .03972 m +.64365 .04282 L +s +P +P +% End of Graphics +MathPictureEnd +end diff --git a/graphics/mma2ltx/doc/6mag.eps b/graphics/mma2ltx/doc/6mag.eps new file mode 100644 index 0000000000..7e1854a00c --- /dev/null +++ b/graphics/mma2ltx/doc/6mag.eps @@ -0,0 +1,670 @@ +%!PS-Adobe-2.0 EPSF-2.0 +%%BoundingBox: 0 0 212.60 131.39 +%%Title: 6mag.eps +%%Creator: mma2ltx v1.2 +%%CreationDate: Mon Jul 18 10:15:06 1994 +%%EndComments +%MMA2LTXCommandLine: mma2ltx -ucm -p -w7.5cm 6mag.ps +%%BeginProcSet: texmma22.pro +% Mathematica v2.2 prologue +/Mathdict 150 dict def +Mathdict begin +/Mwidth 212.60 def +/Mheight 131.39 def +/Mnodistort true def +/Mlmarg 0 def /Mrmarg 0 def /Mbmarg 0 def /Mtmarg 0 def /Mtransform{} +bind def /Mfixwid true def /Mfixdash false def /Mrot 0 def /Mpstart{ +MathPictureStart}bind def /Mpend{MathPictureEnd}bind def /Mscale{0 1 0 1 +5 -1 roll MathScale}bind def /ISOLatin1Encoding dup where{pop pop}{[ +/.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef +/.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef +/.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef +/.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef +/space /exclam /quotedbl /numbersign /dollar /percent /ampersand +/quoteright /parenleft /parenright /asterisk /plus /comma /minus /period +/slash /zero /one /two /three /four /five /six /seven /eight /nine +/colon /semicolon /less /equal /greater /question /at /A /B /C /D /E /F +/G /H /I /J /K /L /M /N /O /P /Q /R /S /T /U /V /W /X /Y /Z /bracketleft +/backslash /bracketright /asciicircum /underscore /quoteleft /a /b /c /d +/e /f /g /h /i /j /k /l /m /n /o /p /q /r /s /t /u /v /w /x /y /z +/braceleft /bar /braceright /asciitilde /.notdef /.notdef /.notdef +/.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef +/.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /dotlessi /grave +/acute /circumflex /tilde /macron /breve /dotaccent /dieresis /.notdef +/ring /cedilla /.notdef /hungarumlaut /ogonek /caron /space /exclamdown +/cent /sterling /currency /yen /brokenbar /section /dieresis /copyright +/ordfeminine /guillemotleft /logicalnot /hyphen /registered /macron +/degree /plusminus /twosuperior /threesuperior /acute /mu /paragraph +/periodcentered /cedilla /onesuperior /ordmasculine /guillemotright +/onequarter /onehalf /threequarters /questiondown /Agrave /Aacute +/Acircumflex /Atilde /Adieresis /Aring /AE /Ccedilla /Egrave /Eacute +/Ecircumflex /Edieresis /Igrave /Iacute /Icircumflex /Idieresis /Eth +/Ntilde /Ograve /Oacute /Ocircumflex /Otilde /Odieresis /multiply +/Oslash /Ugrave /Uacute /Ucircumflex /Udieresis /Yacute /Thorn +/germandbls /agrave /aacute /acircumflex /atilde /adieresis /aring /ae +/ccedilla /egrave /eacute /ecircumflex /edieresis /igrave /iacute +/icircumflex /idieresis /eth /ntilde /ograve /oacute /ocircumflex +/otilde /odieresis /divide /oslash /ugrave /uacute /ucircumflex +/udieresis /yacute /thorn /ydieresis]def}ifelse /MFontDict 50 dict def +/MStrCat{exch dup length 2 index length add string dup 3 1 roll copy +length exch dup 4 2 roll exch putinterval}def /MCreateEncoding{1 index +255 string cvs(-)MStrCat 1 index MStrCat cvn exch(Encoding)MStrCat cvn +dup where{exch get}{pop StandardEncoding}ifelse 3 1 roll dup MFontDict +exch known not{1 index findfont dup length dict begin{1 index /FID ne{ +def}{pop pop}ifelse}forall /Encoding 3 index def currentdict end 1 index +exch definefont pop MFontDict 1 index null put}if exch pop exch pop}def +/ISOLatin1{(ISOLatin1)MCreateEncoding}def /ISO8859{(ISOLatin1) +MCreateEncoding}def /Mcopyfont{dup maxlength dict exch{1 index /FID eq{ +pop pop}{2 index 3 1 roll put}ifelse}forall}def /Plain /Courier findfont +Mcopyfont definefont pop /Bold /Courier findfont Mcopyfont +definefont pop /Italic /Courier findfont Mcopyfont definefont +pop /MathPictureStart{gsave Mtransform Mlmarg Mbmarg translate Mwidth +Mlmarg Mrmarg add sub /Mwidth exch def Mheight Mbmarg Mtmarg add sub +/Mheight exch def /Mtmatrix matrix currentmatrix def /Mgmatrix matrix +currentmatrix def}bind def /MathPictureEnd{grestore}bind def /MFill{0 0 +moveto Mwidth 0 lineto Mwidth Mheight lineto 0 Mheight lineto fill}bind +def /MPlotRegion{3 index Mwidth mul 2 index Mheight mul translate exch +sub Mheight mul /Mheight exch def exch sub Mwidth mul /Mwidth exch def} +bind def /MathSubStart{Momatrix Mgmatrix Mtmatrix Mwidth Mheight 7 -2 +roll moveto Mtmatrix setmatrix currentpoint Mgmatrix setmatrix 9 -2 roll +moveto Mtmatrix setmatrix currentpoint 2 copy translate /Mtmatrix matrix +currentmatrix def 3 -1 roll exch sub /Mheight exch def sub /Mwidth exch +def}bind def /MathSubEnd{/Mheight exch def /Mwidth exch def /Mtmatrix +exch def dup setmatrix /Mgmatrix exch def /Momatrix exch def}bind def +/Mdot{moveto 0 0 rlineto stroke}bind def /Mtetra{moveto lineto lineto +lineto fill}bind def /Metetra{moveto lineto lineto lineto closepath +gsave fill grestore 0 setgray stroke}bind def /Mistroke{flattenpath 0 0 +0{4 2 roll pop pop}{4 -1 roll 2 index sub dup mul 4 -1 roll 2 index sub +dup mul add sqrt 4 -1 roll add 3 1 roll}{stop}{stop}pathforall pop pop +currentpoint stroke moveto currentdash 3 -1 roll add setdash}bind def +/Mfstroke{stroke currentdash pop 0 setdash}bind def /Mrotsboxa{gsave dup +/Mrot exch def Mrotcheck Mtmatrix dup setmatrix 7 1 roll 4 index 4 index +translate rotate 3 index -1 mul 3 index -1 mul translate /Mtmatrix +matrix currentmatrix def grestore Msboxa 3 -1 roll /Mtmatrix exch def +/Mrot 0 def}bind def /Msboxa{newpath 5 -1 roll Mvboxa pop Mboxout 6 -1 +roll 5 -1 roll 4 -1 roll Msboxa1 5 -3 roll Msboxa1 Mboxrot[7 -2 roll 2 +copy[3 1 roll 10 -1 roll 9 -1 roll]6 1 roll 5 -2 roll]}bind def /Msboxa1 +{sub 2 div dup 2 index 1 add mul 3 -1 roll -1 add 3 -1 roll mul}bind def +/Mvboxa{Mfixwid{Mvboxa1}{dup Mwidthcal 0 exch{add}forall exch Mvboxa1 4 +index 7 -1 roll add 4 -1 roll pop 3 1 roll}ifelse}bind def /Mvboxa1{ +gsave newpath[true 3 -1 roll{Mbbox 5 -1 roll{0 5 1 roll}{7 -1 roll exch +sub(m)stringwidth pop .3 mul sub 7 1 roll 6 -1 roll 4 -1 roll Mmin 3 -1 +roll 5 index add 5 -1 roll 4 -1 roll Mmax 4 -1 roll}ifelse false}forall{ +stop}if counttomark 1 add 4 roll]grestore}bind def /Mbbox{1 dict begin 0 +0 moveto /temp(T)def{gsave currentpoint newpath moveto temp 0 3 -1 roll +put temp false charpath flattenpath currentpoint pathbbox grestore +moveto lineto moveto}forall pathbbox newpath end}bind def /Mmin{2 copy +gt{exch}if pop}bind def /Mmax{2 copy lt{exch}if pop}bind def /Mrotshowa{ +dup /Mrot exch def Mrotcheck Mtmatrix dup setmatrix 7 1 roll 4 index 4 +index translate rotate 3 index -1 mul 3 index -1 mul translate /Mtmatrix +matrix currentmatrix def Mgmatrix setmatrix Mshowa /Mtmatrix exch def +/Mrot 0 def}bind def /Mshowa{4 -2 roll moveto 2 index Mtmatrix setmatrix +Mvboxa 7 1 roll Mboxout 6 -1 roll 5 -1 roll 4 -1 roll Mshowa1 4 1 roll +Mshowa1 rmoveto currentpoint Mfixwid{Mshowax}{Mshoway}ifelse pop pop pop +pop Mgmatrix setmatrix}bind def /Mshowax{0 1 4 index length -1 add{2 +index 4 index 2 index get 3 index add moveto 4 index exch get Mfixdash{ +Mfixdashp}if show}for}bind def /Mfixdashp{dup length 1 gt 1 index true +exch{45 eq and}forall and{gsave(--)stringwidth pop(-)stringwidth pop sub +2 div 0 rmoveto dup length 1 sub{(-)show}repeat grestore}if}bind def +/Mshoway{3 index Mwidthcal 5 1 roll 0 1 4 index length -1 add{2 index 4 +index 2 index get 3 index add moveto 4 index exch get[6 index aload +length 2 add -1 roll{pop Strform stringwidth pop neg exch add 0 rmoveto} +exch kshow cleartomark}for pop}bind def /Mwidthcal{[exch{Mwidthcal1} +forall][exch dup Maxlen -1 add 0 1 3 -1 roll{[exch 2 index{1 index Mget +exch}forall pop Maxget exch}for pop]Mreva}bind def /Mreva{[exch aload +length -1 1{1 roll}for]}bind def /Mget{1 index length -1 add 1 index ge{ +get}{pop pop 0}ifelse}bind def /Maxlen{[exch{length}forall Maxget}bind +def /Maxget{counttomark -1 add 1 1 3 -1 roll{pop Mmax}for exch pop}bind +def /Mwidthcal1{[exch{Strform stringwidth pop}forall]}bind def /Strform{ +/tem(x)def tem 0 3 -1 roll put tem}bind def /Mshowa1{2 copy add 4 1 roll +sub mul sub -2 div}bind def /MathScale{Mwidth Mheight Mlp translate +scale /yscale exch def /ybias exch def /xscale exch def /xbias exch def +/Momatrix xscale yscale matrix scale xbias ybias matrix translate matrix +concatmatrix def /Mgmatrix matrix currentmatrix def}bind def /Mlp{3 copy +Mlpfirst{Mnodistort{Mmin dup}if 4 index 2 index 2 index Mlprun 11 index +11 -1 roll 10 -4 roll Mlp1 8 index 9 -5 roll Mlp1 4 -1 roll and{exit}if +3 -1 roll pop pop}loop exch 3 1 roll 7 -3 roll pop pop pop}bind def +/Mlpfirst{3 -1 roll dup length 2 copy -2 add get aload pop pop pop 4 -2 +roll -1 add get aload pop pop pop 6 -1 roll 3 -1 roll 5 -1 roll sub div +4 1 roll exch sub div}bind def /Mlprun{2 copy 4 index 0 get dup 4 1 roll +Mlprun1 3 copy 8 -2 roll 9 -1 roll{3 copy Mlprun1 3 copy 11 -3 roll /gt +Mlpminmax 8 3 roll 11 -3 roll /lt Mlpminmax 8 3 roll}forall pop pop pop +pop 3 1 roll pop pop aload pop 5 -1 roll aload pop exch 6 -1 roll +Mlprun2 8 2 roll 4 -1 roll Mlprun2 6 2 roll 3 -1 roll Mlprun2 4 2 roll +exch Mlprun2 6 2 roll}bind def /Mlprun1{aload pop exch 6 -1 roll 5 -1 +roll mul add 4 -2 roll mul 3 -1 roll add}bind def /Mlprun2{2 copy add 2 +div 3 1 roll exch sub}bind def /Mlpminmax{cvx 2 index 6 index 2 index +exec{7 -3 roll 4 -1 roll}if 1 index 5 index 3 -1 roll exec{4 1 roll pop +5 -1 roll aload pop pop 4 -1 roll aload pop[8 -2 roll pop 5 -2 roll pop +6 -2 roll pop 5 -1 roll]4 1 roll pop}{pop pop pop}ifelse}bind def /Mlp1{ +5 index 3 index sub 5 index 2 index mul 1 index le 1 index 0 le or dup +not{1 index 3 index div .99999 mul 8 -1 roll pop 7 1 roll}if 8 -1 roll 2 +div 7 -2 roll pop sub 5 index 6 -3 roll pop pop mul sub exch}bind def +/intop 0 def /inrht 0 def /inflag 0 def /outflag 0 def /xadrht 0 def +/xadlft 0 def /yadtop 0 def /yadbot 0 def /Minner{outflag 1 eq{/outflag +0 def /intop 0 def /inrht 0 def}if 5 index gsave Mtmatrix setmatrix +Mvboxa pop grestore 3 -1 roll pop dup intop gt{/intop exch def}{pop} +ifelse dup inrht gt{/inrht exch def}{pop}ifelse pop /inflag 1 def}bind +def /Mouter{/xadrht 0 def /xadlft 0 def /yadtop 0 def /yadbot 0 def +inflag 1 eq{dup 0 lt{dup intop mul neg /yadtop exch def}if dup 0 gt{dup +intop mul /yadbot exch def}if pop dup 0 lt{dup inrht mul neg /xadrht +exch def}if dup 0 gt{dup inrht mul /xadlft exch def}if pop /outflag 1 +def}{pop pop}ifelse /inflag 0 def /inrht 0 def /intop 0 def}bind def +/Mboxout{outflag 1 eq{4 -1 roll xadlft leadjust add sub 4 1 roll 3 -1 +roll yadbot leadjust add sub 3 1 roll exch xadrht leadjust add add exch +yadtop leadjust add add /outflag 0 def /xadlft 0 def /yadbot 0 def +/xadrht 0 def /yadtop 0 def}if}bind def /leadjust{(m)stringwidth pop .5 +mul}bind def /Mrotcheck{dup 90 eq{yadbot /yadbot xadrht def /xadrht +yadtop def /yadtop xadlft def /xadlft exch def}if dup cos 1 index sin +Checkaux dup cos 1 index sin neg exch Checkaux 3 1 roll pop pop}bind def +/Checkaux{4 index exch 4 index mul 3 1 roll mul add 4 1 roll}bind def +/Mboxrot{Mrot 90 eq{brotaux 4 2 roll}if Mrot 180 eq{4 2 roll brotaux 4 2 +roll brotaux}if Mrot 270 eq{4 2 roll brotaux}if}bind def /brotaux{neg +exch neg}bind def /Mabsproc{0 matrix defaultmatrix dtransform +idtransform dup mul exch dup mul add sqrt}bind def /Mabswid{Mabsproc +setlinewidth}bind def /Mabsdash{exch[exch{Mabsproc}forall]exch setdash} +bind def /MBeginOrig{Momatrix concat}bind def /MEndOrig{Mgmatrix +setmatrix}bind def /sampledsound where{pop}{/sampledsound{exch pop exch +5 1 roll mul 4 idiv mul 2 idiv exch pop exch /Mtempproc exch def{ +Mtempproc pop}repeat}bind def}ifelse /g{setgray}bind def /k{ +setcmykcolor}bind def /m{moveto}bind def /p{gsave}bind def /r{ +setrgbcolor}bind def /w{setlinewidth}bind def /C{curveto}bind def /F{ +fill}bind def /L{lineto}bind def /P{grestore}bind def /s{stroke}bind def +/setcmykcolor where{pop}{/setcmykcolor{4 1 roll[4 1 roll]{1 index sub 1 +sub neg dup 0 lt{pop 0}if dup 1 gt{pop 1}if exch}forall pop setrgbcolor} +bind def}ifelse /Mcharproc{currentfile(x)readhexstring pop 0 get exch +div}bind def /Mshadeproc{dup 3 1 roll{dup Mcharproc 3 1 roll}repeat 1 eq +{setgray}{3 eq{setrgbcolor}{setcmykcolor}ifelse}ifelse}bind def +/Mrectproc{3 index 2 index moveto 2 index 3 -1 roll lineto dup 3 1 roll +lineto lineto fill}bind def /Mcolorimage{7 1 roll pop pop matrix +invertmatrix concat 2 exch exp 1 sub 3 1 roll 1 1 2 index{1 1 4 index{ +dup 1 sub exch 2 index dup 1 sub exch 7 index 9 index Mshadeproc +Mrectproc}for pop}for pop pop pop pop}bind def /Mimage{pop matrix +invertmatrix concat 2 exch exp 1 sub 3 1 roll 1 1 2 index{1 1 4 index{ +dup 1 sub exch 2 index dup 1 sub exch 7 index Mcharproc setgray +Mrectproc}for pop}for pop pop pop}bind def +%%EndProcSet: texmma22.pro +%MMA2LTXComment: Here follow the original Mathematica file stripped of the text strings +%! +%%Creator: Mathematica +%%AspectRatio: .61803 +MathPictureStart +%% Graphics +/Courier findfont 10 scalefont setfont +% Scaling calculations +0.5 0.151576 0.309017 0.257514 [ +[ -0.001 -0.001 0 0 ] +[ 1.001 .61903 0 0 ] +] MathScale +% Start of Graphics +1 setlinecap +1 setlinejoin +newpath +[ ] 0 setdash +0 g +p +p +.002 w +.04527 .30902 m +.04527 .31527 L +s +P +p +.002 w +.19685 .30902 m +.19685 .31527 L +s +P +p +.002 w +.34842 .30902 m +.34842 .31527 L +s +P +p +.002 w +.65158 .30902 m +.65158 .31527 L +s +P +p +.002 w +.80315 .30902 m +.80315 .31527 L +s +P +p +.002 w +.95473 .30902 m +.95473 .31527 L +s +P +p +.001 w +.07559 .30902 m +.07559 .31277 L +s +P +p +.001 w +.1059 .30902 m +.1059 .31277 L +s +P +p +.001 w +.13622 .30902 m +.13622 .31277 L +s +P +p +.001 w +.16653 .30902 m +.16653 .31277 L +s +P +p +.001 w +.22716 .30902 m +.22716 .31277 L +s +P +p +.001 w +.25748 .30902 m +.25748 .31277 L +s +P +p +.001 w +.28779 .30902 m +.28779 .31277 L +s +P +p +.001 w +.31811 .30902 m +.31811 .31277 L +s +P +p +.001 w +.37874 .30902 m +.37874 .31277 L +s +P +p +.001 w +.40905 .30902 m +.40905 .31277 L +s +P +p +.001 w +.43937 .30902 m +.43937 .31277 L +s +P +p +.001 w +.46968 .30902 m +.46968 .31277 L +s +P +p +.001 w +.53032 .30902 m +.53032 .31277 L +s +P +p +.001 w +.56063 .30902 m +.56063 .31277 L +s +P +p +.001 w +.59095 .30902 m +.59095 .31277 L +s +P +p +.001 w +.62126 .30902 m +.62126 .31277 L +s +P +p +.001 w +.68189 .30902 m +.68189 .31277 L +s +P +p +.001 w +.71221 .30902 m +.71221 .31277 L +s +P +p +.001 w +.74252 .30902 m +.74252 .31277 L +s +P +p +.001 w +.77284 .30902 m +.77284 .31277 L +s +P +p +.001 w +.83347 .30902 m +.83347 .31277 L +s +P +p +.001 w +.86378 .30902 m +.86378 .31277 L +s +P +p +.001 w +.8941 .30902 m +.8941 .31277 L +s +P +p +.001 w +.92441 .30902 m +.92441 .31277 L +s +P +p +.001 w +.01496 .30902 m +.01496 .31277 L +s +P +p +.001 w +.98504 .30902 m +.98504 .31277 L +s +P +p +.002 w +0 .30902 m +1 .30902 L +s +P +p +.002 w +.5 .0515 m +.50625 .0515 L +s +P +p +.002 w +.5 .18026 m +.50625 .18026 L +s +P +p +.002 w +.5 .43777 m +.50625 .43777 L +s +P +p +.002 w +.5 .56653 m +.50625 .56653 L +s +P +p +.001 w +.5 .07725 m +.50375 .07725 L +s +P +p +.001 w +.5 .10301 m +.50375 .10301 L +s +P +p +.001 w +.5 .12876 m +.50375 .12876 L +s +P +p +.001 w +.5 .15451 m +.50375 .15451 L +s +P +p +.001 w +.5 .20601 m +.50375 .20601 L +s +P +p +.001 w +.5 .23176 m +.50375 .23176 L +s +P +p +.001 w +.5 .25751 m +.50375 .25751 L +s +P +p +.001 w +.5 .28327 m +.50375 .28327 L +s +P +p +.001 w +.5 .33477 m +.50375 .33477 L +s +P +p +.001 w +.5 .36052 m +.50375 .36052 L +s +P +p +.001 w +.5 .38627 m +.50375 .38627 L +s +P +p +.001 w +.5 .41202 m +.50375 .41202 L +s +P +p +.001 w +.5 .46353 m +.50375 .46353 L +s +P +p +.001 w +.5 .48928 m +.50375 .48928 L +s +P +p +.001 w +.5 .51503 m +.50375 .51503 L +s +P +p +.001 w +.5 .54078 m +.50375 .54078 L +s +P +p +.001 w +.5 .02575 m +.50375 .02575 L +s +P +p +.001 w +.5 .59228 m +.50375 .59228 L +s +P +p +.002 w +.5 0 m +.5 .61803 L +s +P +P +0 0 m +1 0 L +1 .61803 L +0 .61803 L +closepath +clip +newpath +p +[ .025 .025 ] 0 setdash +p +.004 w +.02381 .30902 m +.04325 .27609 L +.06268 .2437 L +.08212 .21238 L +.10155 .18265 L +.12099 .155 L +.14043 .12987 L +.15986 .10768 L +.1793 .08881 L +.19874 .07354 L +.20845 .06735 L +.21817 .06215 L +.22789 .05796 L +.23275 .05625 L +.23761 .0548 L +.24247 .05362 L +.24733 .05269 L +.24976 .05233 L +.25219 .05203 L +.25462 .0518 L +.25583 .05171 L +.25705 .05164 L +.25826 .05158 L +.25887 .05155 L +.25948 .05154 L +.26008 .05152 L +.26069 .05151 L +.2613 .0515 L +.2619 .0515 L +.26251 .0515 L +.26312 .05151 L +.26373 .05152 L +.26433 .05154 L +.26494 .05155 L +.26555 .05158 L +.26676 .05164 L +.26798 .05171 L +.26919 .0518 L +.27162 .05203 L +.27405 .05233 L +.27648 .05269 L +.28134 .05362 L +.2862 .0548 L +.29592 .05796 L +.30564 .06215 L +.31535 .06735 L +.33479 .08071 L +.35423 .09781 L +.37366 .11838 L +.3931 .14209 L +Mistroke +.41254 .16853 L +.43197 .19729 L +.45141 .22787 L +.47085 .25979 L +.49028 .29252 L +.50972 .32552 L +.52915 .35824 L +.54859 .39016 L +.56803 .42075 L +.58746 .4495 L +.6069 .47594 L +.62634 .49965 L +.64577 .52022 L +.66521 .53733 L +.67493 .54449 L +.68465 .55069 L +.69436 .55589 L +.70408 .56007 L +.70894 .56178 L +.7138 .56323 L +.71866 .56442 L +.72352 .56534 L +.72595 .5657 L +.72838 .566 L +.73081 .56623 L +.73202 .56632 L +.73324 .5664 L +.73445 .56646 L +.73506 .56648 L +.73567 .5665 L +.73627 .56651 L +.73688 .56652 L +.73749 .56653 L +.7381 .56653 L +.7387 .56653 L +.73931 .56652 L +.73992 .56651 L +.74052 .5665 L +.74174 .56646 L +.74295 .5664 L +.74417 .56632 L +.74538 .56623 L +.74781 .566 L +.75024 .5657 L +.75267 .56534 L +.75753 .56442 L +.76239 .56323 L +.77211 .56007 L +.78183 .55589 L +.80126 .54449 L +Mistroke +.8207 .52923 L +.84014 .51035 L +.85957 .48817 L +.87901 .46304 L +.89845 .43538 L +.91788 .40565 L +.93732 .37434 L +.95675 .34195 L +.97619 .30902 L +Mfstroke +P +P +% End of Graphics +MathPictureEnd +end diff --git a/graphics/mma2ltx/doc/arrparm.1 b/graphics/mma2ltx/doc/arrparm.1 new file mode 100644 index 0000000000..4d9a4947c9 --- /dev/null +++ b/graphics/mma2ltx/doc/arrparm.1 @@ -0,0 +1,68 @@ +%!PS +%%BoundingBox: -12 -36 106 38 +%%Creator: MetaPost +%%CreationDate: 1995.06.21:1132 +%%Pages: 1 +%*Font: cmti10 9.96265 9.96265 64:dca19 +%%EndProlog +%%Page: 1 1 + 0.1 setgray +newpath 0 0 moveto +-11.33862 22.67725 lineto +68.03174 0 lineto +-11.33862 -22.67725 lineto + closepath fill + 0 setgray 0 0.5 dtransform truncate idtransform setlinewidth pop [] 0 setdash + 1 setlinejoin 10 setmiterlimit +newpath 0 0 moveto +-11.33862 22.67725 lineto +68.03174 0 lineto +-11.33862 -22.67725 lineto + closepath stroke + 1 setlinecap +newpath -11.33862 -34.01587 moveto +68.03174 -34.01587 lineto stroke +newpath 64.336 -35.54674 moveto +68.03174 -34.01587 lineto +64.336 -32.485 lineto + closepath +gsave fill grestore stroke +newpath -7.64288 -32.485 moveto +-11.33862 -34.01587 lineto +-7.64288 -35.54674 lineto + closepath +gsave fill grestore stroke + 0.5 0 dtransform exch truncate exch idtransform pop setlinewidth +newpath 79.37036 22.67725 moveto +79.37036 -22.67725 lineto stroke + 0 0.5 dtransform truncate idtransform setlinewidth pop +newpath 77.83957 -18.98167 moveto +79.37036 -22.67725 lineto +80.90115 -18.98167 lineto + closepath +gsave fill grestore stroke +newpath 80.90115 18.98167 moveto +79.37036 22.67725 lineto +77.83957 18.98167 lineto + closepath +gsave fill grestore stroke +newpath -11.33862 28.34656 moveto +0 28.34656 lineto stroke +newpath -3.69557 26.81577 moveto +0 28.34656 lineto +-3.69557 29.87735 lineto + closepath +gsave fill grestore stroke +newpath -7.64305 29.87735 moveto +-11.33862 28.34656 lineto +-7.64305 26.81577 lineto + closepath +gsave fill grestore stroke +9.81999 -29.07867 moveto +(length) cmti10 9.96265 fshow +82.37036 -3.45926 moveto +(width) cmti10 9.96265 fshow +-10.56125 31.34656 moveto +(inset) cmti10 9.96265 fshow +showpage +%%EOF diff --git a/graphics/mma2ltx/doc/arrsamp.eps b/graphics/mma2ltx/doc/arrsamp.eps new file mode 100644 index 0000000000..a6ffbc87c9 --- /dev/null +++ b/graphics/mma2ltx/doc/arrsamp.eps @@ -0,0 +1,115 @@ +%!PS-Adobe-2.0 EPSF-2.0 +%%BoundingBox: 0 0 227 141 +%%Title: arrsamp.eps +%%Creator: mma2ltx v1.23 +%%CreationDate: Wed Jun 21 12:23:20 1995 +%%EndComments +%Mma2ltxCommandLine: mma2ltx -a -ucm -w8cm arrsamp.ps +%Mma2ltxComment: For use with Mathematica prologue 'texmma22.pro' +Mathdict begin +/Mwidth 226.77 def +/Mheight 140.15 def +/Mnodistort true def +%Mma2ltxComment: Here follow the original Mathematica file stripped of the text labels +%! +%%Creator: Mathematica +%%AspectRatio: .61803 +MathPictureStart +%% Graphics +/Courier findfont 10 scalefont setfont +% Scaling calculations +0.5 0.10352 0.206011 0.103006 [ +[ -0.001 -0.001 0 0 ] +[ 1.001 .61903 0 0 ] +] MathScale +% Start of Graphics +1 setlinecap +1 setlinejoin +newpath +[ ] 0 setdash +0 g +p +p +.002 w +0 .20601 m +1 .20601 L +s +P +p +.002 w +.5 0 m +.5 .61803 L +s +P +P +0 0 m +1 0 L +1 .61803 L +0 .61803 L +closepath +clip +newpath +p +p +p +.004 w +.18944 .41202 m +.21532 .41202 L +.2412 .41202 L +.26708 .41202 L +.29296 .41202 L +.31884 .41202 L +.34472 .41202 L +.3706 .41202 L +.39648 .41202 L +.42236 .41202 L +.44824 .41202 L +.47412 .41202 L +.5 .41202 L +.52588 .41202 L +.55176 .41202 L +.57764 .41202 L +.60352 .41202 L +.6294 .41202 L +.65528 .41202 L +.68116 .41202 L +.70704 .41202 L +.73292 .41202 L +.7588 .41202 L +.78468 .41202 L +.81056 .41202 L +s +P +P +p +[ .01 .01 ] 0 setdash +.004 w +.18944 .20601 m +.18944 .41202 L +s +.81056 .20601 m +.81056 .41202 L +s +P +P +p +0 w +0 g +1.00100 0.20601 m +0.97600 0.21201 L +0.98200 0.20601 L +0.97600 0.20001 L +F +P +p +0 w +0 g +0.50000 0.61903 m +0.49400 0.59403 L +0.50000 0.60003 L +0.50600 0.59403 L +F +P +% End of Graphics +MathPictureEnd +end diff --git a/graphics/mma2ltx/doc/mma2ltx.dvi b/graphics/mma2ltx/doc/mma2ltx.dvi Binary files differnew file mode 100644 index 0000000000..29de9ad27f --- /dev/null +++ b/graphics/mma2ltx/doc/mma2ltx.dvi diff --git a/graphics/mma2ltx/doc/mma2ltx.pdf b/graphics/mma2ltx/doc/mma2ltx.pdf Binary files differnew file mode 100644 index 0000000000..175b590956 --- /dev/null +++ b/graphics/mma2ltx/doc/mma2ltx.pdf diff --git a/graphics/mma2ltx/doc/mma2ltx.ps b/graphics/mma2ltx/doc/mma2ltx.ps new file mode 100644 index 0000000000..e70a0db324 --- /dev/null +++ b/graphics/mma2ltx/doc/mma2ltx.ps @@ -0,0 +1,5271 @@ +%!PS-Adobe-2.0 +%%Creator: dvips 5.58 Copyright 1986, 1994 Radical Eye Software +%%Title: mma2ltx.dvi +%%CreationDate: Thu Jun 22 16:44:25 1995 +%%Pages: 15 +%%PageOrder: Ascend +%%BoundingBox: 0 0 596 842 +%%EndComments +%DVIPSCommandLine: C:\TEX\BIN\dvips32.EXE mma2ltx -pj:c:\tmp\dv1.mfj +%DVIPSParameters: dpi=300, compressed, comments removed +%DVIPSSource: TeX output 1995.06.21:1413 +%%BeginProcSet: texc.pro +/TeXDict 250 dict def TeXDict begin /N{def}def /B{bind def}N /S{exch}N +/X{S N}B /TR{translate}N /isls false N /vsize 11 72 mul N /hsize 8.5 72 +mul N /landplus90{false}def /@rigin{isls{[0 landplus90{1 -1}{-1 1} +ifelse 0 0 0]concat}if 72 Resolution div 72 VResolution div neg scale +isls{landplus90{VResolution 72 div vsize mul 0 exch}{Resolution -72 div +hsize mul 0}ifelse TR}if Resolution VResolution vsize -72 div 1 add mul +TR[matrix currentmatrix{dup dup round sub abs 0.00001 lt{round}if} +forall round exch round exch]setmatrix}N /@landscape{/isls true N}B +/@manualfeed{statusdict /manualfeed true put}B /@copies{/#copies X}B +/FMat[1 0 0 -1 0 0]N /FBB[0 0 0 0]N /nn 0 N /IE 0 N /ctr 0 N /df-tail{ +/nn 8 dict N nn begin /FontType 3 N /FontMatrix fntrx N /FontBBox FBB N +string /base X array /BitMaps X /BuildChar{CharBuilder}N /Encoding IE N +end dup{/foo setfont}2 array copy cvx N load 0 nn put /ctr 0 N[}B /df{ +/sf 1 N /fntrx FMat N df-tail}B /dfs{div /sf X /fntrx[sf 0 0 sf neg 0 0] +N df-tail}B /E{pop nn dup definefont setfont}B /ch-width{ch-data dup +length 5 sub get}B /ch-height{ch-data dup length 4 sub get}B /ch-xoff{ +128 ch-data dup length 3 sub get sub}B /ch-yoff{ch-data dup length 2 sub +get 127 sub}B /ch-dx{ch-data dup length 1 sub get}B /ch-image{ch-data +dup type /stringtype ne{ctr get /ctr ctr 1 add N}if}B /id 0 N /rw 0 N +/rc 0 N /gp 0 N /cp 0 N /G 0 N /sf 0 N /CharBuilder{save 3 1 roll S dup +/base get 2 index get S /BitMaps get S get /ch-data X pop /ctr 0 N ch-dx +0 ch-xoff ch-yoff ch-height sub ch-xoff ch-width add ch-yoff +setcachedevice ch-width ch-height true[1 0 0 -1 -.1 ch-xoff sub ch-yoff +.1 sub]/id ch-image N /rw ch-width 7 add 8 idiv string N /rc 0 N /gp 0 N +/cp 0 N{rc 0 ne{rc 1 sub /rc X rw}{G}ifelse}imagemask restore}B /G{{id +gp get /gp gp 1 add N dup 18 mod S 18 idiv pl S get exec}loop}B /adv{cp +add /cp X}B /chg{rw cp id gp 4 index getinterval putinterval dup gp add +/gp X adv}B /nd{/cp 0 N rw exit}B /lsh{rw cp 2 copy get dup 0 eq{pop 1}{ +dup 255 eq{pop 254}{dup dup add 255 and S 1 and or}ifelse}ifelse put 1 +adv}B /rsh{rw cp 2 copy get dup 0 eq{pop 128}{dup 255 eq{pop 127}{dup 2 +idiv S 128 and or}ifelse}ifelse put 1 adv}B /clr{rw cp 2 index string +putinterval adv}B /set{rw cp fillstr 0 4 index getinterval putinterval +adv}B /fillstr 18 string 0 1 17{2 copy 255 put pop}for N /pl[{adv 1 chg} +{adv 1 chg nd}{1 add chg}{1 add chg nd}{adv lsh}{adv lsh nd}{adv rsh}{ +adv rsh nd}{1 add adv}{/rc X nd}{1 add set}{1 add clr}{adv 2 chg}{adv 2 +chg nd}{pop nd}]dup{bind pop}forall N /D{/cc X dup type /stringtype ne{] +}if nn /base get cc ctr put nn /BitMaps get S ctr S sf 1 ne{dup dup +length 1 sub dup 2 index S get sf div put}if put /ctr ctr 1 add N}B /I{ +cc 1 add D}B /bop{userdict /bop-hook known{bop-hook}if /SI save N @rigin +0 0 moveto /V matrix currentmatrix dup 1 get dup mul exch 0 get dup mul +add .99 lt{/QV}{/RV}ifelse load def pop pop}N /eop{SI restore showpage +userdict /eop-hook known{eop-hook}if}N /@start{userdict /start-hook +known{start-hook}if pop /VResolution X /Resolution X 1000 div /DVImag X +/IE 256 array N 0 1 255{IE S 1 string dup 0 3 index put cvn put}for +65781.76 div /vsize X 65781.76 div /hsize X}N /p{show}N /RMat[1 0 0 -1 0 +0]N /BDot 260 string N /rulex 0 N /ruley 0 N /v{/ruley X /rulex X V}B /V +{}B /RV statusdict begin /product where{pop product dup length 7 ge{0 7 +getinterval dup(Display)eq exch 0 4 getinterval(NeXT)eq or}{pop false} +ifelse}{false}ifelse end{{gsave TR -.1 .1 TR 1 1 scale rulex ruley false +RMat{BDot}imagemask grestore}}{{gsave TR -.1 .1 TR rulex ruley scale 1 1 +false RMat{BDot}imagemask grestore}}ifelse B /QV{gsave newpath transform +round exch round exch itransform moveto rulex 0 rlineto 0 ruley neg +rlineto rulex neg 0 rlineto fill grestore}B /a{moveto}B /delta 0 N /tail +{dup /delta X 0 rmoveto}B /M{S p delta add tail}B /b{S p tail}B /c{-4 M} +B /d{-3 M}B /e{-2 M}B /f{-1 M}B /g{0 M}B /h{1 M}B /i{2 M}B /j{3 M}B /k{ +4 M}B /w{0 rmoveto}B /l{p -4 w}B /m{p -3 w}B /n{p -2 w}B /o{p -1 w}B /q{ +p 1 w}B /r{p 2 w}B /s{p 3 w}B /t{p 4 w}B /x{0 S rmoveto}B /y{3 2 roll p +a}B /bos{/SS save N}B /eos{SS restore}B end +%%EndProcSet +%%BeginProcSet: texmma22.pro +/Mathdict 150 dict def Mathdict begin /Mlmarg 0 def /Mrmarg 0 def +/Mbmarg 0 def /Mtmarg 0 def /Mtransform{}bind def /Mfixwid true def +/Mfixdash false def /Mrot 0 def /Mpstart{MathPictureStart}bind def +/Mpend{MathPictureEnd}bind def /Mscale{0 1 0 1 5 -1 roll MathScale}bind +def /ISOLatin1Encoding dup where{pop pop}{[/.notdef /.notdef /.notdef +/.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef +/.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef +/.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef +/.notdef /.notdef /.notdef /.notdef /.notdef /space /exclam /quotedbl +/numbersign /dollar /percent /ampersand /quoteright /parenleft +/parenright /asterisk /plus /comma /minus /period /slash /zero /one /two +/three /four /five /six /seven /eight /nine /colon /semicolon /less +/equal /greater /question /at /A /B /C /D /E /F /G /H /I /J /K /L /M /N +/O /P /Q /R /S /T /U /V /W /X /Y /Z /bracketleft /backslash +/bracketright /asciicircum /underscore /quoteleft /a /b /c /d /e /f /g +/h /i /j /k /l /m /n /o /p /q /r /s /t /u /v /w /x /y /z /braceleft /bar +/braceright /asciitilde /.notdef /.notdef /.notdef /.notdef /.notdef +/.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef +/.notdef /.notdef /.notdef /.notdef /dotlessi /grave /acute /circumflex +/tilde /macron /breve /dotaccent /dieresis /.notdef /ring /cedilla +/.notdef /hungarumlaut /ogonek /caron /space /exclamdown /cent /sterling +/currency /yen /brokenbar /section /dieresis /copyright /ordfeminine +/guillemotleft /logicalnot /hyphen /registered /macron /degree +/plusminus /twosuperior /threesuperior /acute /mu /paragraph +/periodcentered /cedilla /onesuperior /ordmasculine /guillemotright +/onequarter /onehalf /threequarters /questiondown /Agrave /Aacute +/Acircumflex /Atilde /Adieresis /Aring /AE /Ccedilla /Egrave /Eacute +/Ecircumflex /Edieresis /Igrave /Iacute /Icircumflex /Idieresis /Eth +/Ntilde /Ograve /Oacute /Ocircumflex /Otilde /Odieresis /multiply +/Oslash /Ugrave /Uacute /Ucircumflex /Udieresis /Yacute /Thorn +/germandbls /agrave /aacute /acircumflex /atilde /adieresis /aring /ae +/ccedilla /egrave /eacute /ecircumflex /edieresis /igrave /iacute +/icircumflex /idieresis /eth /ntilde /ograve /oacute /ocircumflex +/otilde /odieresis /divide /oslash /ugrave /uacute /ucircumflex +/udieresis /yacute /thorn /ydieresis]def}ifelse /MFontDict 50 dict def +/MStrCat{exch dup length 2 index length add string dup 3 1 roll copy +length exch dup 4 2 roll exch putinterval}def /MCreateEncoding{1 index +255 string cvs(-)MStrCat 1 index MStrCat cvn exch(Encoding)MStrCat cvn +dup where{exch get}{pop StandardEncoding}ifelse 3 1 roll dup MFontDict +exch known not{1 index findfont dup length dict begin{1 index /FID ne{ +def}{pop pop}ifelse}forall /Encoding 3 index def currentdict end 1 index +exch definefont pop MFontDict 1 index null put}if exch pop exch pop}def +/ISOLatin1{(ISOLatin1)MCreateEncoding}def /ISO8859{(ISOLatin1) +MCreateEncoding}def /Mcopyfont{dup maxlength dict exch{1 index /FID eq{ +pop pop}{2 index 3 1 roll put}ifelse}forall}def /Plain /Courier findfont +Mcopyfont definefont pop /Bold /Courier-Bold findfont Mcopyfont +definefont pop /Italic /Courier-Oblique findfont Mcopyfont definefont +pop /MathPictureStart{gsave Mtransform Mlmarg Mbmarg translate Mwidth +Mlmarg Mrmarg add sub /Mwidth exch def Mheight Mbmarg Mtmarg add sub +/Mheight exch def /Mtmatrix matrix currentmatrix def /Mgmatrix matrix +currentmatrix def}bind def /MathPictureEnd{grestore}bind def /MFill{0 0 +moveto Mwidth 0 lineto Mwidth Mheight lineto 0 Mheight lineto fill}bind +def /MPlotRegion{3 index Mwidth mul 2 index Mheight mul translate exch +sub Mheight mul /Mheight exch def exch sub Mwidth mul /Mwidth exch def} +bind def /MathSubStart{Momatrix Mgmatrix Mtmatrix Mwidth Mheight 7 -2 +roll moveto Mtmatrix setmatrix currentpoint Mgmatrix setmatrix 9 -2 roll +moveto Mtmatrix setmatrix currentpoint 2 copy translate /Mtmatrix matrix +currentmatrix def 3 -1 roll exch sub /Mheight exch def sub /Mwidth exch +def}bind def /MathSubEnd{/Mheight exch def /Mwidth exch def /Mtmatrix +exch def dup setmatrix /Mgmatrix exch def /Momatrix exch def}bind def +/Mdot{moveto 0 0 rlineto stroke}bind def /Mtetra{moveto lineto lineto +lineto fill}bind def /Metetra{moveto lineto lineto lineto closepath +gsave fill grestore 0 setgray stroke}bind def /Mistroke{flattenpath 0 0 +0{4 2 roll pop pop}{4 -1 roll 2 index sub dup mul 4 -1 roll 2 index sub +dup mul add sqrt 4 -1 roll add 3 1 roll}{stop}{stop}pathforall pop pop +currentpoint stroke moveto currentdash 3 -1 roll add setdash}bind def +/Mfstroke{stroke currentdash pop 0 setdash}bind def /Mrotsboxa{gsave dup +/Mrot exch def Mrotcheck Mtmatrix dup setmatrix 7 1 roll 4 index 4 index +translate rotate 3 index -1 mul 3 index -1 mul translate /Mtmatrix +matrix currentmatrix def grestore Msboxa 3 -1 roll /Mtmatrix exch def +/Mrot 0 def}bind def /Msboxa{newpath 5 -1 roll Mvboxa pop Mboxout 6 -1 +roll 5 -1 roll 4 -1 roll Msboxa1 5 -3 roll Msboxa1 Mboxrot[7 -2 roll 2 +copy[3 1 roll 10 -1 roll 9 -1 roll]6 1 roll 5 -2 roll]}bind def /Msboxa1 +{sub 2 div dup 2 index 1 add mul 3 -1 roll -1 add 3 -1 roll mul}bind def +/Mvboxa{Mfixwid{Mvboxa1}{dup Mwidthcal 0 exch{add}forall exch Mvboxa1 4 +index 7 -1 roll add 4 -1 roll pop 3 1 roll}ifelse}bind def /Mvboxa1{ +gsave newpath[true 3 -1 roll{Mbbox 5 -1 roll{0 5 1 roll}{7 -1 roll exch +sub(m)stringwidth pop .3 mul sub 7 1 roll 6 -1 roll 4 -1 roll Mmin 3 -1 +roll 5 index add 5 -1 roll 4 -1 roll Mmax 4 -1 roll}ifelse false}forall{ +stop}if counttomark 1 add 4 roll]grestore}bind def /Mbbox{1 dict begin 0 +0 moveto /temp(T)def{gsave currentpoint newpath moveto temp 0 3 -1 roll +put temp false charpath flattenpath currentpoint pathbbox grestore +moveto lineto moveto}forall pathbbox newpath end}bind def /Mmin{2 copy +gt{exch}if pop}bind def /Mmax{2 copy lt{exch}if pop}bind def /Mrotshowa{ +dup /Mrot exch def Mrotcheck Mtmatrix dup setmatrix 7 1 roll 4 index 4 +index translate rotate 3 index -1 mul 3 index -1 mul translate /Mtmatrix +matrix currentmatrix def Mgmatrix setmatrix Mshowa /Mtmatrix exch def +/Mrot 0 def}bind def /Mshowa{4 -2 roll moveto 2 index Mtmatrix setmatrix +Mvboxa 7 1 roll Mboxout 6 -1 roll 5 -1 roll 4 -1 roll Mshowa1 4 1 roll +Mshowa1 rmoveto currentpoint Mfixwid{Mshowax}{Mshoway}ifelse pop pop pop +pop Mgmatrix setmatrix}bind def /Mshowax{0 1 4 index length -1 add{2 +index 4 index 2 index get 3 index add moveto 4 index exch get Mfixdash{ +Mfixdashp}if show}for}bind def /Mfixdashp{dup length 1 gt 1 index true +exch{45 eq and}forall and{gsave(--)stringwidth pop(-)stringwidth pop sub +2 div 0 rmoveto dup length 1 sub{(-)show}repeat grestore}if}bind def +/Mshoway{3 index Mwidthcal 5 1 roll 0 1 4 index length -1 add{2 index 4 +index 2 index get 3 index add moveto 4 index exch get[6 index aload +length 2 add -1 roll{pop Strform stringwidth pop neg exch add 0 rmoveto} +exch kshow cleartomark}for pop}bind def /Mwidthcal{[exch{Mwidthcal1} +forall][exch dup Maxlen -1 add 0 1 3 -1 roll{[exch 2 index{1 index Mget +exch}forall pop Maxget exch}for pop]Mreva}bind def /Mreva{[exch aload +length -1 1{1 roll}for]}bind def /Mget{1 index length -1 add 1 index ge{ +get}{pop pop 0}ifelse}bind def /Maxlen{[exch{length}forall Maxget}bind +def /Maxget{counttomark -1 add 1 1 3 -1 roll{pop Mmax}for exch pop}bind +def /Mwidthcal1{[exch{Strform stringwidth pop}forall]}bind def /Strform{ +/tem(x)def tem 0 3 -1 roll put tem}bind def /Mshowa1{2 copy add 4 1 roll +sub mul sub -2 div}bind def /MathScale{Mwidth Mheight Mlp translate +scale /yscale exch def /ybias exch def /xscale exch def /xbias exch def +/Momatrix xscale yscale matrix scale xbias ybias matrix translate matrix +concatmatrix def /Mgmatrix matrix currentmatrix def}bind def /Mlp{3 copy +Mlpfirst{Mnodistort{Mmin dup}if 4 index 2 index 2 index Mlprun 11 index +11 -1 roll 10 -4 roll Mlp1 8 index 9 -5 roll Mlp1 4 -1 roll and{exit}if +3 -1 roll pop pop}loop exch 3 1 roll 7 -3 roll pop pop pop}bind def +/Mlpfirst{3 -1 roll dup length 2 copy -2 add get aload pop pop pop 4 -2 +roll -1 add get aload pop pop pop 6 -1 roll 3 -1 roll 5 -1 roll sub div +4 1 roll exch sub div}bind def /Mlprun{2 copy 4 index 0 get dup 4 1 roll +Mlprun1 3 copy 8 -2 roll 9 -1 roll{3 copy Mlprun1 3 copy 11 -3 roll /gt +Mlpminmax 8 3 roll 11 -3 roll /lt Mlpminmax 8 3 roll}forall pop pop pop +pop 3 1 roll pop pop aload pop 5 -1 roll aload pop exch 6 -1 roll +Mlprun2 8 2 roll 4 -1 roll Mlprun2 6 2 roll 3 -1 roll Mlprun2 4 2 roll +exch Mlprun2 6 2 roll}bind def /Mlprun1{aload pop exch 6 -1 roll 5 -1 +roll mul add 4 -2 roll mul 3 -1 roll add}bind def /Mlprun2{2 copy add 2 +div 3 1 roll exch sub}bind def /Mlpminmax{cvx 2 index 6 index 2 index +exec{7 -3 roll 4 -1 roll}if 1 index 5 index 3 -1 roll exec{4 1 roll pop +5 -1 roll aload pop pop 4 -1 roll aload pop[8 -2 roll pop 5 -2 roll pop +6 -2 roll pop 5 -1 roll]4 1 roll pop}{pop pop pop}ifelse}bind def /Mlp1{ +5 index 3 index sub 5 index 2 index mul 1 index le 1 index 0 le or dup +not{1 index 3 index div .99999 mul 8 -1 roll pop 7 1 roll}if 8 -1 roll 2 +div 7 -2 roll pop sub 5 index 6 -3 roll pop pop mul sub exch}bind def +/intop 0 def /inrht 0 def /inflag 0 def /outflag 0 def /xadrht 0 def +/xadlft 0 def /yadtop 0 def /yadbot 0 def /Minner{outflag 1 eq{/outflag +0 def /intop 0 def /inrht 0 def}if 5 index gsave Mtmatrix setmatrix +Mvboxa pop grestore 3 -1 roll pop dup intop gt{/intop exch def}{pop} +ifelse dup inrht gt{/inrht exch def}{pop}ifelse pop /inflag 1 def}bind +def /Mouter{/xadrht 0 def /xadlft 0 def /yadtop 0 def /yadbot 0 def +inflag 1 eq{dup 0 lt{dup intop mul neg /yadtop exch def}if dup 0 gt{dup +intop mul /yadbot exch def}if pop dup 0 lt{dup inrht mul neg /xadrht +exch def}if dup 0 gt{dup inrht mul /xadlft exch def}if pop /outflag 1 +def}{pop pop}ifelse /inflag 0 def /inrht 0 def /intop 0 def}bind def +/Mboxout{outflag 1 eq{4 -1 roll xadlft leadjust add sub 4 1 roll 3 -1 +roll yadbot leadjust add sub 3 1 roll exch xadrht leadjust add add exch +yadtop leadjust add add /outflag 0 def /xadlft 0 def /yadbot 0 def +/xadrht 0 def /yadtop 0 def}if}bind def /leadjust{(m)stringwidth pop .5 +mul}bind def /Mrotcheck{dup 90 eq{yadbot /yadbot xadrht def /xadrht +yadtop def /yadtop xadlft def /xadlft exch def}if dup cos 1 index sin +Checkaux dup cos 1 index sin neg exch Checkaux 3 1 roll pop pop}bind def +/Checkaux{4 index exch 4 index mul 3 1 roll mul add 4 1 roll}bind def +/Mboxrot{Mrot 90 eq{brotaux 4 2 roll}if Mrot 180 eq{4 2 roll brotaux 4 2 +roll brotaux}if Mrot 270 eq{4 2 roll brotaux}if}bind def /brotaux{neg +exch neg}bind def /Mabsproc{0 matrix defaultmatrix dtransform +idtransform dup mul exch dup mul add sqrt}bind def /Mabswid{Mabsproc +setlinewidth}bind def /Mabsdash{exch[exch{Mabsproc}forall]exch setdash} +bind def /MBeginOrig{Momatrix concat}bind def /MEndOrig{Mgmatrix +setmatrix}bind def /sampledsound where{pop}{/sampledsound{exch pop exch +5 1 roll mul 4 idiv mul 2 idiv exch pop exch /Mtempproc exch def{ +Mtempproc pop}repeat}bind def}ifelse /g{setgray}bind def /k{ +setcmykcolor}bind def /m{moveto}bind def /p{gsave}bind def /r{ +setrgbcolor}bind def /w{setlinewidth}bind def /C{curveto}bind def /F{ +fill}bind def /L{lineto}bind def /P{grestore}bind def /s{stroke}bind def +/setcmykcolor where{pop}{/setcmykcolor{4 1 roll[4 1 roll]{1 index sub 1 +sub neg dup 0 lt{pop 0}if dup 1 gt{pop 1}if exch}forall pop setrgbcolor} +bind def}ifelse /Mcharproc{currentfile(x)readhexstring pop 0 get exch +div}bind def /Mshadeproc{dup 3 1 roll{dup Mcharproc 3 1 roll}repeat 1 eq +{setgray}{3 eq{setrgbcolor}{setcmykcolor}ifelse}ifelse}bind def +/Mrectproc{3 index 2 index moveto 2 index 3 -1 roll lineto dup 3 1 roll +lineto lineto fill}bind def /Mcolorimage{7 1 roll pop pop matrix +invertmatrix concat 2 exch exp 1 sub 3 1 roll 1 1 2 index{1 1 4 index{ +dup 1 sub exch 2 index dup 1 sub exch 7 index 9 index Mshadeproc +Mrectproc}for pop}for pop pop pop pop}bind def /Mimage{pop matrix +invertmatrix concat 2 exch exp 1 sub 3 1 roll 1 1 2 index{1 1 4 index{ +dup 1 sub exch 2 index dup 1 sub exch 7 index Mcharproc setgray +Mrectproc}for pop}for pop pop pop}bind def end +%%EndProcSet +%%BeginProcSet: finclude.pro +/fstore{dup dict exch{dup 4 2 roll put}repeat def}bind def /fshow{gsave +72 TeXDict /Resolution get div -72 TeXDict /VResolution get div scale 1 +DVImag div dup scale get cvx exec show grestore}bind def +%%EndProcSet +%%BeginProcSet: special.pro +TeXDict begin /SDict 200 dict N SDict begin /@SpecialDefaults{/hs 612 N +/vs 792 N /ho 0 N /vo 0 N /hsc 1 N /vsc 1 N /ang 0 N /CLIP 0 N /rwiSeen +false N /rhiSeen false N /letter{}N /note{}N /a4{}N /legal{}N}B +/@scaleunit 100 N /@hscale{@scaleunit div /hsc X}B /@vscale{@scaleunit +div /vsc X}B /@hsize{/hs X /CLIP 1 N}B /@vsize{/vs X /CLIP 1 N}B /@clip{ +/CLIP 2 N}B /@hoffset{/ho X}B /@voffset{/vo X}B /@angle{/ang X}B /@rwi{ +10 div /rwi X /rwiSeen true N}B /@rhi{10 div /rhi X /rhiSeen true N}B +/@llx{/llx X}B /@lly{/lly X}B /@urx{/urx X}B /@ury{/ury X}B /magscale +true def end /@MacSetUp{userdict /md known{userdict /md get type +/dicttype eq{userdict begin md length 10 add md maxlength ge{/md md dup +length 20 add dict copy def}if end md begin /letter{}N /note{}N /legal{} +N /od{txpose 1 0 mtx defaultmatrix dtransform S atan/pa X newpath +clippath mark{transform{itransform moveto}}{transform{itransform lineto} +}{6 -2 roll transform 6 -2 roll transform 6 -2 roll transform{ +itransform 6 2 roll itransform 6 2 roll itransform 6 2 roll curveto}}{{ +closepath}}pathforall newpath counttomark array astore /gc xdf pop ct 39 +0 put 10 fz 0 fs 2 F/|______Courier fnt invertflag{PaintBlack}if}N +/txpose{pxs pys scale ppr aload pop por{noflips{pop S neg S TR pop 1 -1 +scale}if xflip yflip and{pop S neg S TR 180 rotate 1 -1 scale ppr 3 get +ppr 1 get neg sub neg ppr 2 get ppr 0 get neg sub neg TR}if xflip yflip +not and{pop S neg S TR pop 180 rotate ppr 3 get ppr 1 get neg sub neg 0 +TR}if yflip xflip not and{ppr 1 get neg ppr 0 get neg TR}if}{noflips{TR +pop pop 270 rotate 1 -1 scale}if xflip yflip and{TR pop pop 90 rotate 1 +-1 scale ppr 3 get ppr 1 get neg sub neg ppr 2 get ppr 0 get neg sub neg +TR}if xflip yflip not and{TR pop pop 90 rotate ppr 3 get ppr 1 get neg +sub neg 0 TR}if yflip xflip not and{TR pop pop 270 rotate ppr 2 get ppr +0 get neg sub neg 0 S TR}if}ifelse scaleby96{ppr aload pop 4 -1 roll add +2 div 3 1 roll add 2 div 2 copy TR .96 dup scale neg S neg S TR}if}N /cp +{pop pop showpage pm restore}N end}if}if}N /normalscale{Resolution 72 +div VResolution 72 div neg scale magscale{DVImag dup scale}if 0 setgray} +N /psfts{S 65781.76 div N}N /startTexFig{/psf$SavedState save N userdict +maxlength dict begin /magscale true def normalscale currentpoint TR +/psf$ury psfts /psf$urx psfts /psf$lly psfts /psf$llx psfts /psf$y psfts +/psf$x psfts currentpoint /psf$cy X /psf$cx X /psf$sx psf$x psf$urx +psf$llx sub div N /psf$sy psf$y psf$ury psf$lly sub div N psf$sx psf$sy +scale psf$cx psf$sx div psf$llx sub psf$cy psf$sy div psf$ury sub TR +/showpage{}N /erasepage{}N /copypage{}N /p 3 def @MacSetUp}N /doclip{ +psf$llx psf$lly psf$urx psf$ury currentpoint 6 2 roll newpath 4 copy 4 2 +roll moveto 6 -1 roll S lineto S lineto S lineto closepath clip newpath +moveto}N /endTexFig{end psf$SavedState restore}N /@beginspecial{SDict +begin /SpecialSave save N gsave normalscale currentpoint TR +@SpecialDefaults count /ocount X /dcount countdictstack N}N /@setspecial +{CLIP 1 eq{newpath 0 0 moveto hs 0 rlineto 0 vs rlineto hs neg 0 rlineto +closepath clip}if ho vo TR hsc vsc scale ang rotate rwiSeen{rwi urx llx +sub div rhiSeen{rhi ury lly sub div}{dup}ifelse scale llx neg lly neg TR +}{rhiSeen{rhi ury lly sub div dup scale llx neg lly neg TR}if}ifelse +CLIP 2 eq{newpath llx lly moveto urx lly lineto urx ury lineto llx ury +lineto closepath clip}if /showpage{}N /erasepage{}N /copypage{}N newpath +}N /@endspecial{count ocount sub{pop}repeat countdictstack dcount sub{ +end}repeat grestore SpecialSave restore end}N /@defspecial{SDict begin} +N /@fedspecial{end}B /li{lineto}B /rl{rlineto}B /rc{rcurveto}B /np{ +/SaveX currentpoint /SaveY X N 1 setlinecap newpath}N /st{stroke SaveX +SaveY moveto}N /fil{fill SaveX SaveY moveto}N /ellipse{/endangle X +/startangle X /yrad X /xrad X /savematrix matrix currentmatrix N TR xrad +yrad scale 0 0 1 startangle endangle arc savematrix setmatrix}N end +%%EndProcSet +TeXDict begin 39158280 55380996 1000 300 300 (/TMP/MMA2LTX-/mma2ltx.dvi) +@start /Fa 6 121 df<EB1FE0EB7FFC48487E487F3907F03F80390FC00FC0391F8003E0 +D83F0013F0003E13015A15F800FC13005AB6FCA315F000F8C8FCA27E127C127E003E1470 +003F14F8381F8001390FE003F03807F80F6CB512E06C14C06C6C1300EB0FF81D1F7C9E26 +>101 D<EB1FC0EBFFF8487F000713FF390FF07F80391FC01FC0EB00074814E0003E1303 +48EB01F0A248EB00F8A86C1301007C14F0007E1303003E14E0003F1307391F800FC0EBC0 +1F390FF07F806CB51200000113FC6C5BEB1FC01D1F7C9E26>111 +D<387FC0FE39FFE3FFC001EF7F6CB57E0003EB83F849C67E01F8133E49133F8149EB0F80 +A216C01507A7150F6D1480151F16006D5B157E6D5B9038FF07F8ECFFF001EF5B01E71380 +D9E1FEC7FC01E0C8FCACEA7FFFB57EA26C90C8FC222F7F9E26>I<397FF803FC39FFFC1F +FE4A7E007F90B5128039007DFE1FEB7FF09138E00F00ECC0064AC7FC91C8FCA2137EA313 +7CAD007FB5FCB67EA26C91C7FC211F7E9E26>114 D<1338137CA8007FB512E0B612F0A2 +6C14E0D8007CC7FCAF1538157CA5017E13FC90383F03F890381FFFF06D13E06D13C00101 +13001E287EA726>116 D<397FF81FFE486C487EA26C486C5A3903E003C03801F0070000 +495A6D48C7FCEB7C1EEB3E3EEB1E7C6D5A5C6D5A1303A21307497E1478EB1E3CEB3C3EEB +7C1EEB780F01F07F00016D7E3803E003496C7E397FF80FFF486C481380A26C486C130021 +1F7E9E26>120 D E /Fb 2 122 df<EA0E3CEA1346EA218E138CEA43001203A312061308 +12C6EAE610EACA20EA71C00F0E7E8D10>120 D<EA3804EA2C0C124CA2EA8C181218A3EA +3030A31370EA18E0EA0F60120013C012E0EAE180EA4300123C0E147D8D11>I +E /Fc 8 117 df<D9FFF8923803FFE060D903FCEEF800F00DF0027CED0FE0181B801833 +1863A201064C5A80EF0187A2EF03076E7E010C9238060F80170CA217186E7E173001184C +C7FC17606E7E17C0EE0180A20130913803003EEC01F01606A25EEC00F8494A5B5EA25E15 +7C5E495EED7D80153F93C7FC0001143E486C1501D80FF8013C497EB5D8801C90B512F0DA +00185D43317DB042>77 D<EB3FF8EBFFFE3901F01F800003EB07C000076D7EA200036D7E +13E0C7FCA24A5AA3EB07FFEB3F833801FC033903E007C0EA0FC0EA1F80EA3F00127EEDC1 +804890380F8300A2141F1417007E1327ECC786393F0387FC391FFE03F83903F801E0211F +7C9E24>97 D<903801FF80010F13E090383E01F0EBF8033801F007EA03E03807C003D80F +8013E0001F90C7FC90C8FC5AA2127EA45AA4127CA2127E003E14C0A26CEB0180390F8003 +003807C0063803F03C3801FFF038003FC01C1F7C9E20>99 D<EB03F8EB1FFE90387E0F80 +9038F803C0EA01E03903C001E01207D80F8013F0121F13005A123E127E007FB5FC15E000 +7EC8FC5AA4127CA215406C14C0EC0180121E6CEB03003807800E3803E07C3801FFF03800 +3F801C1F7C9E20>101 D<EB07C013FF5AEA000FA25CA649C8FCA6133EA2EC03F8EC0FFE +EC381F9138600F8090397C8007C0EB7D00137EA2137CA201FCEB0F805BA54848EB1F00A6 +4848133EA50007147EA2B5380FFFF0A224327EB128>104 D<130FEB1F80133F14C0EB7F +80133F1400131E90C7FCAA133EEA07FEA21200137CA65BA6485AA6485AA51207A2EAFFFE +A212317EB014>I<90263E03F8EB3F80270FFE0FFEEBFFE0913A381F0381F00000903A60 +0F8600F890277C8007C8137CD97D0013D0017E14E0A2017C5CA201FC010F14F8495CA548 +4890391F0001F0A64848013EEB03E0A50007027E1307A2B5260FFFF0B5FCA2381F7E9E3C +>109 D<1318A31338A213301370A213F012011203485A121FB512F8A23803E000A2485A +A6485AA648C7FCA21460A4003E13C0A3EB0180121E381F0300EA0F86EA07FCEA01F0152C +7AAB1C>116 D E /Fd 10 120 df<EB07E01300A2EB01C0A4EB0380A43801E700EA0717 +EA0C0F1218EA380E12301270A2485AA41339A3EA6079EA319AEA1E0C131D7C9C15>100 +D<13F8EA0704120CEA1802EA38041230EA7008EA7FF0EAE000A5EA60041308EA30101360 +EA0F800F127C9113>I<EB78C0EA01C5EA03031206000E1380120C121CA238380700A413 +0EA3EA181EEA0C7CEA079CEA001CA25BA2EAC030EAE070EAC1C0007FC7FC121A7E9113> +103 D<EA0FC01201A2485AA448C7FCA4EA0E3E13C3380F0380120E121E121CA338380700 +A3130E00701340A2131C1480EAE00C38600700121D7E9C15>I<EA01801203EA0100C7FC +A7121C12261247A2128EA2120E5AA35AA21271A31272A2123C091C7C9B0D>I<EA1F8012 +03A2EA0700A4120EA45AA45AA45AA412E2A312E412641238091D7D9C0B>108 +D<EA383EEA4CC3384D0380124E129E129C121CA238380700A3130E00701340A2131C1480 +EAE00C3860070012127C9117>110 D<EA01F0EA0608120C131CEA1818EA1C00121F13C0 +EA0FF01207EA00781338EA603012E012C0EA8060EA60C0EA1F000E127D9111>115 +D<12035AA3120EA4EAFFE0EA1C00A35AA45AA4EAE080A2EAE100A2126612380B1A7C990E +>I<381E0183382703871247148338870701A2120EA2381C0E02A31404EA180C131C1408 +EA1C1E380C26303807C3C018127C911C>119 D E /Fe 1 1 df<B512C0A212027D8618> +0 D E /Ff 2 60 df<124012E0124003037D8209>58 D<124012E012601220A21240A212 +8003087D8209>I E /Fg 6 54 df<120412081210123012201260A2124012C0AA124012 +60A212201230121012081204061A7D920C>40 D<128012401220123012101218A2120812 +0CAA12081218A212101230122012401280061A7F920C>I<121FEA3180EA60C0EA4040EA +C060A8EA4040EA60C0EA3180EA1F000B107F8F0F>48 D<1218127812981218AC12FF0810 +7D8F0F>I<121FEA6180EA40C0EA806012C01200A213C0EA0180EA030012065AEA102012 +20EA7FC012FF0B107F8F0F>I<EA20C0EA3F80EA2E001220A3122FEA3080EA2040EA0060 +A312C0EA80C0EA6180EA1F000B107F8F0F>53 D E /Fh 1 115 df<120FEA3FC0EA7FE0 +A2EAFFF0A4EA7FE0A2EA3FC0EA0F000C0C86850C>114 D E /Fi +1 121 df<D903F013FC90390FFC01FF903A3C1E0303809026700F0613C0903AC0078C0F +E0D80180EBD81FD8030013F0A2000602E013C0178048ED0F0093C7FC48495AA2C7FCA24A +5AA44AC8FCA4147E1603A3001E491306123FD87F805C1381D8FF015CD9033C5B007E013E +5B267C061E5B3A381C0F0780271FF807FFC7FC3907E001F82B277EA531>120 +D E /Fj 5 121 df<1438147814F81303130F137FEA0FFFEAFFF71387EAF0071200B3B3 +B1497EEB3FFFB712C0A3224477C334>49 D<003FBAFCA3903BF8000FFE000701C06D4813 +0090C7163F007EF01F80007C180FA200781807A300701803A500F019C0481801A5C893C7 +FCB3B3A64B7E92383FFF800103B712F8A342467CC54B>84 D<EC7F80903803FFF090380F +C0FC90383F003F017CEB1F8049EB0FC00001EC07E0485A4848EB03F0000F15F8A24848EB +01FCA2123FA2484814FE1500A212FFA290B6FCA20180C8FCA6127FA37F123F160E121F7F +000F151C12076D1438000315706C7E6C6C14E0013EEB03C090391F800700903807E03E90 +3801FFF89038003FC0272F7DAD2E>101 D<130EA7131EA4133EA3137EA213FE12011203 +1207001FB512FCB6FCA2C648C7FCB3A4150EAB017E131C137F7F151890381F803890380F +C070903807E0E0903801FFC09038007F001F417EBF28>116 D<267FFFF890B512C0A300 +0101E090387FFC006C6C48EB3FE0013FEC1F80011F92C7FC6E131E6D6C5B01075C6D6C5B +6E5B903801FE010100495A91387F0780DA3F8FC8FC15CEEC1FDEEC0FFC6E5AA26E7E1401 +4A7E4A7E4A6C7EEC0E3F91381E1FC04A6C7E02787F4A6C7EECE00301016D7ED903C07F49 +486C7E49C77E707E496E7E017F81484881000F6DEB7FFCB5D8E001B512F0A3342C7FAB37 +>120 D E /Fk 2 55 df<7E12F012FCB4FC13E013FEA213E0130012FC12F012800F0C67 +852A>45 D<1206A4120FA3EA1F80A2EA3FC0A2EA7FE0A3EAFFF00C0F86A72A>54 +D E /Fl 1 49 df<1206120FA2120E121EA2121C123C1238A212301270A2126012E012C0 +124008117F910A>48 D E /Fm 3 122 df<381FFFFE38381C0E00201304126012401338 +128000001300A25BA45BA4485AA41203EA3FFC17177F9615>84 D<EA0F1F3811A180EA20 +C31400EA41801201A348C7FC130212C3EAE704EAC508EA78F0110E7F8D14>120 +D<EA1C02EA26061246A2EA860C120CA3EA1818A31338EA0C70EA07B0EA00301360127013 +C0EA2180EA1E000F147F8D11>I E /Fn 4 121 df<126012F0A2126004047C830C>58 +D<130113031306A3130CA31318A31330A31360A213C0A3EA0180A3EA0300A31206A25AA3 +5AA35AA35AA35AA210297E9E15>61 D<EB01E0EB0630EB0E7814F0EB1C601400A45BA238 +03FFC038003800A25BA55BA5485AA55B1203A20063C7FC12F312F612E4127815257E9C14 +>102 D<380787803808C8403810F0C03820F1E0EBE3C03840E1803800E000A2485AA438 +63808012F3EB810012E5EA84C6EA787813127E9118>120 D E /Fo +15 120 df<387FFFFEB6FCA36C13FE18057D941F>45 D<EA03FE380FFFC0003F13E04813 +F0387C01F838F8007C143CA300701378380001F8EB07F0EB0FE0EB1F80EB3F00137E137C +5BA75B90C7FCA6136013F0487EA26C5A136016257CA41F>63 D<EA07FCEA1FFF4813C080 +383E03F0EA1C01C77E1478A3EB7FF8EA03FF120F383FE078EA7E0012785AA4007813F8EA +7E036CB512E0A2380FFE3F3803F80F1B1A7D991F>97 D<EA7F8012FFA2127F1207A7EB87 +E0EB9FF8EBBFFE90B5FCEBF83F9038E00F80EBC007EC03C0138015E01401A6140315C0EB +C0071580EBE00F9038F03F00EBFFFEEBBFFCEB9FF8380387C01B257FA41F>I<EB7FE038 +01FFF8000713FC5A381FC07C383F0038003E13005A1278A25AA61278A2007C133C7E003F +137C381FC0F8380FFFF07E000113C038007F00161A7C991F>I<EB03FC1307A21303EB00 +3CA713FCEA03FF4813BC4813FCEA1F81EA3E00003C137C007C133C127812F85AA67E0078 +137CA26C13FCEA3E01EA1F836CB512C06CEBBFE06C133FD800F813C01B257EA41F>I<13 +7F3801FFC0000713E04813F0381F81F8383F0078003C133C127C0078131EA2B512FEA400 +F0C7FCA21278A2007C131E7E381F803EEBE07C380FFFF8000313F06C13E038003F80171A +7D991F>I<14FCEB03FF010F13805BEB3E0F90383C070049C7FCA5387FFFFEB5FCA3D800 +78C7FCB2383FFFF0487FA26C5B19257FA41F>I<EA7F8012FFA2127F1207A7EB87E0EB9F +F0EBBFF8EBFFFCEBF83CEBE01E13C0A21380AE397FF87FE039FFFCFFF0A2397FF87FE01C +257FA41F>104 D<387F87E038FF9FF0EBBFF86CB47E3807F83CEBE01E13C0A21380AE39 +7FF87FE039FFFCFFF0A2397FF87FE01C1A7F991F>110 D<13FCEA03FF481380001F13E0 +1387383E01F0387C00F800781378A248133CA76C137C00781378007C13F8A2383E01F038 +1F87E013FF000713806C1300EA00FC161A7C991F>I<387F87E038FF9FF8EBBFFE6CB5FC +3807F83F9038E00F80EBC007EC03C0138015E01401A6140315C0EBC0071580EBE00F9038 +F03F00EBFFFEEBBFFCEB9FF8EB87C00180C7FCA9EA7FF8487EA26C5A1B277F991F>I<38 +03FC70380FFFF0123F5AEA7C03EAF801EAF000A27E007C1300EA3FE06CB4FC000713C0C6 +13E0EB07F0EB00F80070137C00F0133CA27E6C137C38FF01F8EBFFF0A200E713C038E1FE +00161A7C991F>115 D<387F81FEEAFF83A2EA7F813807801EAF143EA2EBC0FE6CB512E0 +15F06C139F39007E1FE01C1A7F991F>117 D<39FFE07FF0A4391C000380A3001E130700 +0E1400A2EB0F87A2131F000613C638071DCEA2133D14EEA2380338ECA21378EBF8FCEBF0 +7CA23801E0781C1A7F991F>119 D E /Fp 20 117 df<12FFA808087B8712>46 +D<EB3FC03801FFF8487F487F380FF0FF391FC03F80003F14C0EB801FA2007F14E0EB000F +A34814F0B26C14E0A2EB801FA2003F14C0A2EBC03F391FE07F80390FF0FF0090B5FC0003 +13FC6C5B38003FC01C2C7EAA21>48 D<130E131F137F485A123F5AB5FC7EC6FCB3AD003F +13FE4813FFA26C13FE182B7CAA21>I<13FF000313E0000F7F4813FC487FA2387F83FFD8 +FE0113807F007C137F003C14C012380018133F1208C7FC147FA21580A2ECFF00A2495A49 +5A5C495A495A495A495A49C7FC13FE13F8485A485A485A485A48C8FC123E007FB51280B6 +12C0A46C14801A2B7DAA21>I<EBFF80000313F0000F7F4813FE5A387F81FFEA3E00001C +148012180008137FC7FC14FFA21500A2495A495A1307EBFFF05C8014FCEB03FEEB00FF15 +80147F15C0A7124012600070EBFF8012FCD8FF03130090B5FC6C5B6C5B6C5B000713E0C6 +13801A2C7DAA21>I<EB03FC497EA2130FA2131F131E133EA2137CA213F8A2120113F012 +0313E01207EA0FC0A2EA1F80A2EA3F00A2127EA25AB612E015F0A46C14E0C7EAFE00A814 +7C1C2A7EA921>I<000FB5FC481480A4150001E0C7FCA9EBFFE014F814FE8001F01380EB +C07F9038803FC0A2EA0F00C713E0A712101230003814C0007C137F127E39FF81FF806CB5 +FC6C14006C5B6C5B000313F0C613801B2B7EA921>I<EB0FE0EB7FF813FF12035A380FFC +1801F0C7FC485A485A5BA2127FA290C8FCA238FF0FF0EB3FFC80137FEBC07F1580EB803F +A215C01300A77EA21380A2003FEB7F8013C0391FE0FF0090B5FC6C5B6C5B6C5B6C5B3800 +3F801A2C7DAA21>I<007FB51280B612C0A46C1480C7121FEC3F00147E14FE495A495AA2 +495A130F5C131F133F5C137F5CA213FF91C7FC5AA35B1203A5485AA86C5A1A2A7DA921> +I<EB7F803803FFF0000F13FC487FA2383FE1FF13C0397F807F80A8003F14006D5A001F5B +6CB45A6C5B6C5B000F13FC381FE1FE383F807F007F1480EB003F4814C0A9397F807F80A2 +EBC0FF6CB51200A26C5B6C5B000313F038007F801A2C7DAA21>I<EB7F803803FFE0487F +487F487F383FC1FEEB80FF007F7F1300481480143FA315C0A7147F7EA2EB80FF123F381F +FFBF6C133F7EEA03FCC71380A2147FA215005CA2380C01FEEA0F0748B45A5C485B6C5B6C +1380D801FCC7FC1A2C7DAA21>I<EB03FF011F13E090B512FC488048EB03FF2607FC0013 +804848EB7FC04848EB3FE049131F003F15F049130F007F15F8A2491307A200FF15FCAE00 +7F15F86D130FA3003F15F06D131F001F15E06D133F6C6CEB7FC06C6CEBFF802603FF0313 +006CEBFFFE6C5C013F13F0010390C7FC262C7CAA2F>79 D<EBFFC0000713F0001F13FC14 +FE1301381C00FF12181210C7FCA390B5FC1207EA1FF0EA3FC0485A5B5AA41381EA7F8713 +FE6C5A6C5A3807E07E181B7E9A1F>97 D<EC0FC0EC1FE0AE13FE3807FF9F4813DF4813FF +383FF07FEBC01FEA7F80A2EAFF00ABEA7F80A2383FC03FEBE07F6CB5FC6C13DF6C131F39 +00FC0FC01B2A7EA922>100 D<127FEAFF80A7EA7F00C7FCA7123FEA7F80B3A7EA3F0009 +2B7EAA0F>105 D<387E03F838FF0FFE497E5B01601380EBC07F1380A21300B2007EEB3F +00191B7C9A22>110 D<EB7FE03803FFFC487F001FEBFF80EBE07F393FC03FC0397F801F +E0A2EB000F4814F0A96C14E0EB801FA2393FC03FC0EBE07F6CB512806C1400000313FC38 +007FE01C1B7E9A21>I<387E07F038FF3FFC497E90B5FC01C113809038007FC0143FA215 +E0141FA9EC3FC0A3EC7F80EBC1FF90B512006D5AEB3FF8EB0FE090C8FCAB127E1B277C9A +22>I<EA03FE381FFFC04813F05AEA7E0338FC00E0146014007EEAFFC013FC387FFF806C +13C06C13E06C13F07E38007FF8EA400713011260127012F838FE03F0B5FC6C13E0001F13 +803803FE00151B7E9A19>115 D<EA07E0487EA7387FFFC0B512E0A26C13C0380FF000B1 +1420EBF8E03807FFF0A26C13C03801FE0014237FA218>I E /Fq +17 122 df<000FB5FC5A5A3870418000401300EA8081A21200EA01831303A21203A21206 +A2120EA2000C1380121CA2EA180118157E941C>25 D<133F3801FFC0380381E038040040 +4813005AA31360EA0B98EA0FF80010C7FC5A5AA35A6C1380124038600100EA300EEA1FFC +EA07E013177F9517>34 D<127012F8A3127005057C840E>58 D<127012F812FCA2127412 +04A41208A21210A212201240060F7C840E>I<14801301A2EB0300A31306A35BA35BA35B +A35BA35BA3485AA448C7FCA31206A35AA35AA35AA35AA35AA311317DA418>61 +D<001FB512FE391E01E00E001814061230382003C0A200401404A2EB07801280A2000014 +0049C7FCA4131EA45BA45BA45BA41201387FFFC01F227EA11D>84 +D<141E14FC141CA31438A41470A414E01378EA01C4EA0302380601C0120E121C123C3838 +03801278A338F00700A31408EB0E101270131E38302620EA18C6380F03C017237EA219> +100 D<137EEA038138070080120E5A5A38780100EA7006EAFFF800F0C7FCA25AA41480A2 +38700300EA3004EA1838EA0FC011157D9417>I<141EEC638014C71301ECC30014801303 +A449C7FCA4EBFFF8010EC7FCA65BA55BA55BA4136013E0A25BA21271EAF18090C8FC1262 +123C192D7EA218>I<13E0A21201EA00C01300A9121E1223EA4380A21283EA8700A21207 +120EA35AA3EA38201340127013801230EA3100121E0B227EA111>105 +D<393C07E01F3A46183061803A47201880C03A87401D00E0EB801E141C1300000E903838 +01C0A4489038700380A2ED070016044801E01308150EA2ED0610267001C01320D83000EB +03C026157E942B>109 D<383C07C038461860384720303887403813801300A2000E1370 +A44813E0A2EB01C014C1003813C2EB03821484130100701388383000F018157E941D>I< +3803C0F03804631CEB740EEA0878EB7007A2140FEA00E0A43801C01EA3143C38038038A2 +EBC07014E038072180EB1E0090C7FCA2120EA45AA3B47E181F819418>112 +D<137E138138030080EA0201EA0603140090C7FC120713F0EA03FC6CB4FCEA003FEB0780 +1303127000F01300A2EAE002EA4004EA3018EA0FE011157E9417>115 +D<136013E0A4EA01C0A4EA0380EAFFFCEA0380A2EA0700A4120EA45AA31308EA3810A213 +20EA184013C0EA0F000E1F7F9E12>I<3801E0F03806310C38081A1C0010133CEA201C14 +181400C65AA45BA314083860E01012F0142038E1704038423080383C1F0016157E941C> +120 D<001E131800231338EA438014701283EA8700A2000713E0120EA3381C01C0A4EB03 +80A21307EA0C0B380E1700EA03E7EA0007A2130E1260EAF01C1318485AEA8060EA41C000 +3FC7FC151F7E9418>I E /Fr 20 122 df<1238127C12FEA3127C123807077C8610>46 +D<13181378EA01F812FFA21201B3A7387FFFE0A213207C9F1C>49 +D<EA03FCEA0FFF383C1FC0387007E0007C13F0EAFE0314F8A21301127CEA3803120014F0 +A2EB07E014C0EB0F80EB1F00133E13385BEBE018EA01C0EA0380EA0700000E1338380FFF +F05A5A5AB5FCA215207D9F1C>I<13FE3807FFC0380F07E0381E03F0123FEB81F8A3EA1F +0314F0120014E0EB07C0EB1F803801FE007F380007C0EB01F014F8EB00FCA2003C13FE12 +7EB4FCA314FCEA7E01007813F8381E07F0380FFFC03801FE0017207E9F1C>I<1238127C +12FEA3127C12381200A81238127C12FEA3127C123807167C9510>58 +D<007FB61280A2397E03F80F00781407007014030060140100E015C0A200C01400A40000 +1500B3A248B512F0A222227EA127>84 D<EA0FFC383FFF80387E07C0EB03E0130114F012 +3C1200A2133FEA03FDEA1FC1EA3F01127E12FCA4EA7E02EB0CF8381FF87F3807E03F1816 +7E951B>97 D<EB01FEA2EB003EABEA01FC3807FFBE380F81FE381F007E003E133E127E12 +7C12FCA8127CA26C137E6C13FE380F83BE3907FF3FC0EA01FC1A237EA21F>100 +D<13FE3807FF80380F87C0381E01E0003E13F0EA7C0014F812FCA2B5FCA200FCC7FCA312 +7CA2127E003E13186C1330380FC0703803FFC0C6130015167E951A>I<121C123E127FA3 +123E121CC7FCA7B4FCA2121FB2EAFFE0A20B247EA310>105 D<B4FCA2121FB3ADEAFFE0 +A20B237EA210>108 D<3AFF07F007F090391FFC1FFC3A1F303E303E01401340496C487E +A201001300AE3BFFE0FFE0FFE0A22B167E9530>I<38FF07E0EB1FF8381F307CEB403CEB +803EA21300AE39FFE1FFC0A21A167E951F>I<13FE3807FFC0380F83E0381E00F0003E13 +F848137CA300FC137EA7007C137CA26C13F8381F01F0380F83E03807FFC03800FE001716 +7E951C>I<38FF0FE0EB3FF8381FE07CEB803E497E1580A2EC0FC0A8EC1F80A29038803F +00EBC03EEBE0FCEB3FF8EB0FC090C8FCA8EAFFE0A21A207E951F>I<EAFE1FEB3FC0381E +67E013C71387A2381F83C090C7FCADEAFFF0A213167E9517>114 +D<EA0FF3EA3FFFEA781FEA6007EAE003A212F000FCC7FCEA7FE013F8EA3FFEEA0FFF1201 +38000F80EAC007130312E0A238F00700EAFC0EEAEFFCEAC7F011167E9516>I<487EA412 +03A21207A2120F123FB5FCA2EA0F80ABEB8180A5EB8300EA07C3EA03FEEA00F811207F9F +16>I<39FFE01FE0A2391F800700000F1306EBC00E0007130C13E000035BA26C6C5AA26C +6C5AA2EB7CC0A2137F6D5AA26DC7FCA2130EA21B167F951E>118 +D<39FFE01FE0A2391F800700000F1306EBC00E0007130C13E000035BA26C6C5AA26C6C5A +A2EB7CC0A2137F6D5AA26DC7FCA2130EA2130CA25B1278EAFC3813305BEA69C0EA7F8000 +1FC8FC1B207F951E>121 D E /Fs 2 14 df<B61280A219027D8A20>0 +D<EB03FE90380FFF8090383C01E09038F00078D801C0131C48C7120600068048EC018048 +EC00C0A2481560A2481530A3481518A900601530A36C1560A26C15C0A26CEC01806CEC03 +006C1406D801C0131CD800F0137890383C01E090380FFF80D903FEC7FC25277E9D2A>13 +D E /Ft 18 122 df<127012F8A312700505788416>46 D<EA7FF8EAFFFE6C7EEA1C0FEB +0780EB03C01301A214E01300A8EB01C0A21303EB0780130F387FFF00485AEA7FF8131980 +9816>68 D<EA1FE0487E487EEA783CEA300E1200A2EA03FE121FEA3E0E127012E0A3EA78 +3E387FFFE0EA3FE7EA0F8313127E9116>97 D<12FCA3121CA4137CEA1DFEEA1FFFEB0780 +381E03C0EA1C01EB00E0A6EB01C0EA1E03381F0780EBFF00EA1DFEEA0C7813197F9816> +I<133FA31307A4EA03C7EA0FF748B4FCEA3C1F487EEA700712E0A6EA700F12786C5A381F +FFE0EA0FF7EA07C713197F9816>100 D<EA03F0EA0FFC487EEA3C0F487E3870038012E0 +B5FCA300E0C7FCA2387003801278EA3E07381FFF00EA07FEEA01F811127E9116>I<131E +137F3801FF8013C7380383001380A2EA7FFFB5FCA2EA0380ACEA7FFC487E6C5A11197F98 +16>I<1203EA0780A2EA0300C7FCA4EAFF80A31203ACEAFFFC13FE13FC0F1A7C9916>105 +D<EA7FC012FF127F1201B3EA7FFFB512806C130011197E9816>108 +D<EAFC78EAFDFCB47EEA1F0FEA1E07121CAA38FF8FE0139F138F13127F9116>110 +D<EA03E0EA0FF8487EEA3C1E487EEA700738E00380A5EAF00700701300EA780FEA3C1EEA +1FFC6C5AEA03E011127E9116>I<EAFC7CEAFDFEB5FC381F0780381E03C0EA1C01EB00E0 +A6EB01C0EA1E03381F0780EBFF00EA1DFEEA1C7890C7FCA6B47EA3131B7F9116>I<387F +0FC038FF3FE0EA7F7F3807F040EBC0005BA290C7FCA8EA7FFC12FF127F13127F9116> +114 D<EA0FECEA3FFC127FEAF03CEAE01CA2EA7000EA7F80EA1FF0EA07F8EA003CEA600E +12E012F0EAF81EEAFFFC13F8EAC7E00F127D9116>I<12035AA4EA7FFFB5FCA20007C7FC +A75BEB0380A3EB8700EA03FE6C5A6C5A11177F9616>I<EAFC3FA3EA1C07AB131F381FFF +E0EA0FF7EA07C713127F9116>I<387F1FC038FF9FE0387F1FC0381C0700A2EA0E0EA36C +5AA4EA03B8A3EA01F0A26C5A13127F9116>I<387F1FC038FF9FE0387F1FC0381C070012 +0E130EA212075BA2EA039CA21398EA01B8A2EA00F0A35BA3485A1279127BEA7F8090C7FC +123C131B7F9116>121 D E /Fu 52 122 df<137E3801C180EA0301380703C0120EEB01 +8090C7FCA5B512C0EA0E01B0387F87F8151D809C17>12 D<381FC07C3830718339783B01 +80131E0030EB00C0EA001CA248B5FCD80F1CC7FC12381270126012E0011E1340A2D86033 +1380393061C300381F807C1A127E911E>26 D<126012F012F812681208A31210A2122012 +401280050C7C9C0C>39 D<1380EA0100120212065AA25AA25AA35AA412E0AC1260A47EA3 +7EA27EA27E12027EEA0080092A7C9E10>I<7E12407E12307EA27EA27EA37EA41380AC13 +00A41206A35AA25AA25A12205A5A092A7E9E10>I<126012F0A212701210A41220A21240 +1280040C7C830C>44 D<126012F0A2126004047C830C>46 D<EA03C0EA0C30EA1818EA30 +0CA2EA700EEA6006A2EAE007ADEA6006A2EA700EEA300CA2EA1818EA0C30EA07E0101D7E +9B15>48 D<5A1207123F12C71207B3A5EAFFF80D1C7C9B15>I<EA07C0EA1830EA201CEA +400C130EEAF00F12F81307A21270EA000F130EA2131CA213381370136013C0EA0180EA03 +00EA0601120C1218EA1002EA3FFE127F12FF101C7E9B15>I<EA07E0EA1830EA201CA2EA +781E130E131E1238EA001CA2131813301360EA07C0EA0030131CA2130E130FA2127012F8 +A3EAF00EEA401C1220EA1830EA07C0101D7E9B15>I<130CA2131C133CA2135C13DC139C +EA011C120312021204120C1208121012301220124012C0B512C038001C00A73801FFC012 +1C7F9B15>I<EA300CEA3FF813F013C0EA2000A6EA23E0EA2C30EA3018131CEA200E1200 +130FA3126012F0A3EA800EEA401E131CEA2038EA1870EA07C0101D7E9B15>I<13F0EA03 +0CEA0404EA0C0EEA181E1230130CEA7000A21260EAE3E0EAE430EAE818EAF00C130EEAE0 +061307A51260A2EA7006EA300E130CEA1818EA0C30EA03E0101D7E9B15>I<EA03E0EA0C +30EA1008EA200C13061260A21270A2EA7C0CEA3E18EA3FB0EA1FE0EA07F013F8EA18FCEA +307EEA601E130FEAC0071303A4EA60021304EA300CEA1C10EA07E0101D7E9B15>56 +D<EA03C0EA0C30EA1818EA300C1270EA600EEAE006A21307A51260EA700F1230EA1817EA +0C27EA07C7EA0006A2130EEA300C127813181270EA2030EA10C0EA0F80101D7E9B15>I< +007FB512C0B612E0C9FCA8B612E06C14C01B0C7E8F20>61 D<1306A3130FA3EB1780A2EB +37C01323A2EB43E01341A2EB80F0A338010078A2EBFFF83802003CA3487FA2000C131F80 +001E5BB4EBFFF01C1D7F9C1F>65 D<90381F8080EBE0613801801938070007000E13035A +14015A00781300A2127000F01400A8007014801278A212386CEB0100A26C13026C5B3801 +80083800E030EB1FC0191E7E9C1E>67 D<B512FC380F003C140C1404A214061402A21301 +1400A35B13FF13037FA3140113001402A31406A2140C143CB512FC181C7E9B1C>69 +D<B512F8380F007814181408A2140C1404A213011400A35B13FF13037FA490C7FCA8EAFF +F8161C7E9B1B>I<EAFFF0EA0F00B3A8EAFFF00C1C7F9B0F>73 D<B4EB1FF0390F800380 +9038C00100120BEA09E0EA08F0A21378133C133E131E130F14811307EB03C1EB01E114F1 +13001479147D143D141FA2808080121CB46C7E1C1C7F9B1F>78 D<B51280380F00E01478 +143C141C141EA5141C143C147814E0EBFF8090C7FCACEAFFF0171C7E9B1C>80 +D<B5FC380F01E0EB007880141C141EA4141C143C5CEB01E001FFC7FCEB01E0EB00701478 +80A61510A2141CA239FFF00E20C7EA03C01C1D7E9B1F>82 D<3807E080EA1C19EA300513 +03EA600112E01300A36C13007E127CEA7FC0EA3FF8EA1FFEEA07FFC61380130FEB07C013 +0313011280A300C01380A238E00300EAD002EACC0CEA83F8121E7E9C17>I<007FB512C0 +38700F010060130000401440A200C014201280A300001400B1497E3803FFFC1B1C7F9B1E +>I<3AFFE1FFC0FF3A1F003E003C001E013C13186C6D1310A32607801F1320A33A03C027 +8040A33A01E043C080A33A00F081E100A39038F900F3017913F2A2017E137E013E137CA2 +013C133C011C1338A20118131801081310281D7F9B2B>87 D<39FFF07FC0390FC01E0038 +07800CEBC00800035B6C6C5A13F000005BEB7880137C013DC7FC133E7F7F80A2EB13C0EB +23E01321EB40F0497E14783801007C00027F141E0006131F001F148039FF807FF01C1C7F +9B1F>I<1208121012201240A21280A312B012F812781230050C7D9C0C>96 +D<EA1FC0EA3070EA78387F12301200A2EA01FCEA0F1C12381270126000E01340A3EA603C +38304E80381F870012127E9115>I<12FC121CAA137CEA1D87381E0180381C00C014E014 +601470A6146014E014C0381E018038190700EA10FC141D7F9C17>I<EA03F8EA0C0CEA18 +1E1230EA700CEA600012E0A61260EA70021230EA1804EA0C18EA03E00F127F9112>I<EB +1F801303AAEA03F3EA0E0BEA1807EA30031270126012E0A6126012701230EA1807EA0E1B +3803E3F0141D7F9C17>I<EA07E0EA0C30EA1818EA300CEA700EEA600612E0EAFFFEEAE0 +00A41260EA70021230EA1804EA0C18EA03E00F127F9112>I<13F8EA018CEA071E1206EA +0E0C1300A6EAFFE0EA0E00B0EA7FE00F1D809C0D>I<EB03803807C4C0EA1C7838383880 +38301800EA701CA4EA3018EA38386C5AEA27C00020C7FCA21230EA3FF86CB4FC1480EA20 +03386001C0EAC000A33860018038300300EA1C0EEA07F8121C7F9215>I<12FC121CAA13 +7C1387EA1D03001E1380121CAD38FF9FF0141D7F9C17>I<1218123CA21218C7FCA712FC +121CB0EAFF80091D7F9C0C>I<12FC121CAAEB0FE0EB0780EB06005B13105B5B13E0121D +EA1E70EA1C781338133C131C7F130F148038FF9FE0131D7F9C16>107 +D<12FC121CB3A9EAFF80091D7F9C0C>I<39FC7E07E0391C838838391D019018001EEBE0 +1C001C13C0AD3AFF8FF8FF8021127F9124>I<EAFC7CEA1C87EA1D03001E1380121CAD38 +FF9FF014127F9117>I<EA03F0EA0E1CEA1806487E00701380EA600100E013C0A6006013 +80EA700300301300EA1806EA0E1CEA03F012127F9115>I<EAFC7CEA1D87381E0180001C +13C0EB00E0A21470A614E0A2EB01C0001E1380381D0700EA1CFC90C7FCA7B47E141A7F91 +17>I<EAFCE0EA1D38EA1E78A2EA1C301300ACEAFFC00D127F9110>114 +D<EA1F90EA2070EA4030EAC010A212E0EAF800EA7F80EA3FE0EA0FF0EA00F8EA80381318 +12C0A2EAE010EAD060EA8FC00D127F9110>I<1204A4120CA2121C123CEAFFE0EA1C00A9 +1310A5120CEA0E20EA03C00C1A7F9910>I<38FC1F80EA1C03AD1307120CEA0E1B3803E3 +F014127F9117>I<38FF07E0383C0380381C0100A2EA0E02A2EA0F06EA0704A2EA0388A2 +13C8EA01D0A2EA00E0A3134013127F9116>I<39FF3FC7E0393C0703C0001CEB01801500 +130B000E1382A21311000713C4A213203803A0E8A2EBC06800011370A2EB803000001320 +1B127F911E>I<38FF07E0383C0380381C0100A2EA0E02A2EA0F06EA0704A2EA0388A213 +C8EA01D0A2EA00E0A31340A25BA212F000F1C7FC12F312661238131A7F9116>121 +D E /Fv 8 117 df<D807F8EB07FC0000EC0FC001BC14801517A21527A2D8011EEB4F00 +A2158FA2EC010F130F0002EB021EA21404A2EB0788149000045C14A0A214C01303148000 +0C5C001EEB007C3AFF8307FF80261C7E9B26>77 D<EA07F0EA1C18EA1E0CEA1C0E121812 +00A2EA01FEEA0F0EEA1C1C1230127000E01340A2133CEB5C80EA709D383F0E0012127D91 +15>97 D<13FEEA0307000E1380001C1300EA380690C7FC5AA35AA31260EA70025BEA3008 +EA1C30EA07C011127E9112>99 D<EA01F8EA070CEA0C06EA1807EA380312301270EA7FFF +EA70005AA312601302EA7004EA3008EA1C30EA07C010127E9112>101 +D<EA07E012015BA6485AA3EB8F80EBB0C0EBC0E0EA0780A21300A4380E01C0A6381C0380 +001E13C038FF9FF0141D7F9C17>104 D<13C01201A21380C7FCA7EA1F8012071203EA07 +00A6120EA65A121EEAFF800A1D7F9C0C>I<391F8FC0FC39079061063903E07607380780 +78A2EB0070A4000EEBE00EA64848485A001EEBE01E3AFF8FF8FF8021127F9124>109 +D<1202A31206A25A121C123CEAFFE0EA1C00A25AA65A1340A41380A2EA3100121E0B1A7C +9910>116 D E /Fw 6 55 df<120C121C12EC120CAFEAFFC00A137D9211>49 +D<121FEA60C01360EAF07013301260EA0070A2136013C012011380EA02005AEA08101210 +EA2020EA7FE012FF0C137E9211>I<EA0FC0EA3070EA7038A31200133013E0EA0FC0EA00 +7013381318131C126012F01318EAE038EA6070EA1FC00E137F9211>I<136013E0A2EA01 +6012021206120C120812101220126012C0EAFFFCEA0060A5EA03FC0E137F9211>I<EA60 +60EA7FC01380EA44001240A3124FEA70C0EA40E0EA00601370A212E0A21360EA40E0EA21 +C0EA1F000C137E9211>I<EA07C0EA0C20EA10701220EA6000A25A12CFEAD0C0EAE060EA +C0201330A31240EA6020EA2060EA10C0EA0F000C137E9211>I E +/Fx 9 121 df<B612FCA21E027C8C27>0 D<6C13026C13060060130C6C13186C13306C13 +606C13C03803018038018300EA00C6136C1338A2136C13C6EA018338030180380600C048 +136048133048131848130C4813064813021718789727>2 D<EC7FC0903803FFF890380F +803E90393C0007800170EB01C001C0EB006048488048C87E0006814881A24881A248ED01 +80A248ED00C0A3481660AB006016C0A36CED0180A26CED0300A26C1506A26C5D6C5D6C6C +5C6C6C5C0170495A013CEB078090260F803EC7FC903803FFF89038007FC02B2F7DA332> +13 D<EA03F0EA0FFC487E487E481380A2B512C0A86C1380A26C13006C5A6C5AEA03F012 +147D9519>15 D<EB03C0EB1E0013385B5BB1485A485A000FC7FC12F8120FEA03806C7E6C +7EB113707F131EEB03C012317DA419>102 D<12F8120FEA03806C7E6C7EB113707F131E +EB03C0EB1E0013385B5BB1485A485A000FC7FC12F812317DA419>I<1320136013C0A3EA +0180A3EA0300A21206A35AA35AA25AA35AA35AA21260A37EA37EA27EA37EA37EA2EA0180 +A3EA00C0A3136013200B327CA413>I<12C0A21260A37EA37EA27EA37EA37EA2EA0180A3 +EA00C0A31360A213C0A3EA0180A3EA0300A21206A35AA35AA25AA35AA35AA20B327DA413 +>I<EA07C0EA1C30EA30081270EA600CEAE01CA213081300A2127012301238120C7EEA0F +80EA1860EA3030EA7018EA601CEAE00EA5EA700CEA301CEA1818EA0C30EA03E0EA00C013 +6013381318131C130EA212201270A2EA600CEA201C1318EA1870EA07C00F2D7DA216> +120 D E /Fy 77 126 df<EA701CEAF01EA7EA701CA5EA600C0F0E7B9D1A>34 +D<136013E0A4EA03F8EA0FFE381FFF80383CE7C0EA78E13870E0E012E013E1A2EBE0C000 +7013001278123F6C7EEA07FCC6B4FCEBEF80EBE3C013E1EBE0E012F0A312E03870E1C0EA +78E3383CEF80381FFF006C5AEA03F0C65AA3136013277DA21A>36 +D<001813C0383C01E0127E130300E713C0A213071480130F1400A2EA7E1F131E123CEA18 +3EEA003C137C1378A213F85BA212015B12035B14C03807C3F01383EB8738120F1307121F +121EA2123E383C03F0A2381800C015277EA21A>I<13E0EA03F0487E1338EA0E1CA45BEB +39FC1371EA07F1EBE1C013C11381EB8380120FEA1FC3383DC700EA78E7EA70EEEAE07EA2 +EB3C08141C137EEA70FF387FE7F8EA3FC3380F00E0161E7F9D1A>I<1218123C123E121E +120EA5121CA2123812F812F01260070F779D1A>I<1338137813F0EA01E0EA03C0EA0780 +EA0F00120E5AA25AA25AA35AAA1270A37EA27EA27E120FEA0780EA03C0EA01E0EA00F813 +7813380D2878A21A>I<126012F012787E7E7EEA07801203EA01C0A2EA00E0A21370A313 +38AA1370A313E0A2EA01C0A2EA03801207EA0F00121E5A5A5A12600D287CA21A>I<13E0 +A538F0E1E0EAFCE7387EEFC0381FFF00EA07FCEA01F0EA07FCEA1FFF387EEFC038FCE7E0 +EAF0E13800E000A513157D991A>I<1218123E127E127F123F121F1207120EA2121C12FC +12F81260080D77851A>44 D<387FFFC0B512E0A26C13C013047D901A>I<1230127812FC +A212781230060676851A>I<14C0EB01E0A2130314C013071480130F1400A25B131E133E +133C137C1378A213F85B12015B12035BA212075B120F90C7FC5A121EA2123E123C127C12 +7812F85AA2126013277DA21A>I<EA01F0EA07FC487EEA1F1FEA1C0738380380A2387001 +C0A338E000E0A9EAF001007013C0A2EA780300381380EA3C07001C1300EA1F1FEA0FFE6C +5AEA01F0131E7D9D1A>I<13C01201A212031207120F127F12FD12711201B2EA7FFFA310 +1E7B9D1A>I<EA03F8EA0FFE381FFF80383C07C0387801E0EA70004813707EA21260C7FC +A214E0A2EB01C01303EB0780EB0F00131E5B5B5BEA03E0485A48C7FC001E13705A387FFF +F0B5FC7E141E7D9D1A>I<EA03FCEA0FFF003F13C0383C03E0EA78001470A2C7FCA214E0 +1301EB07C03803FF80140014C0380003E01300147014781438A2126012F0147848137000 +7013E0EA7E03383FFFC0000F1300EA01FC151E7E9D1A>I<EB0F80131F133BA2137313F3 +13E3EA01C3120313831207EA0F03120E121E123C1238127812F0B512FEA338000380A6EB +3FF8EB7FFCEB3FF8171E7F9D1A>I<383FFFC05AA20070C7FCA8EA71F8EA7FFEEBFF8038 +7E07C0EA7801383000E0C7FC1470A3126012F014E0EAE001387003C0387C0F80383FFF00 +EA0FFEEA03F0141E7D9D1A>I<137E3801FF804813C0380781E0EA0F01121E383C00C000 +3813005AA3EAE1F8EAE7FEB5FC38FE078038F803C0EAF001EB00E0A25A7E1270A2EB01C0 +1238383C0380EA1E0F380FFF00EA07FCEA01F0131E7D9D1A>I<12E0B512F8A214F038E0 +00E0EB01C0EA0003EB0780EB0F00130E5BA25BA25BA25BA3485AA4485AA8151F7E9E1A> +I<EA01FCEA07FF001F13C01307383C01E0387800F000701370A3007813F0003813E0381E +03C0380FFF803803FE00487E381F8FC0383C01E0387800F000701370481338A46C137800 +701370007813F0383E03E0381FFFC000071300EA01FC151E7E9D1A>I<EA01F0EA07FCEA +1FFEEA3E0F38380780EA7003EB01C012E0A214E01300A213011270EA7803EA3C0FEA1FFF +EA0FFCEA03F0380001C0A3EB0380126038F007005B133EEA7FFCEA3FF0EA0FC0131E7D9D +1A>I<1230127812FCA2127812301200A91230127812FCA212781230061576941A>I<14C0 +EB03E01307EB0FC0EB3F80EB7E005BEA03F8EA07E0485AEA3F80007EC7FC5AA2127E6C7E +EA0FC06C7EEA03F8C67E137EEB3F80EB0FC0EB07E01303EB00C0131A7D9B1A>60 +D<387FFFF0B512F8A26C13F0C8FCA4387FFFF0B512F8A26C13F0150C7E941A>I<126012 +F87E127E6C7EEA0FC06C7EEA03F8C67E137EEB3F80EB0FC0EB07E0A2EB0FC0EB3F80EB7E +005BEA03F8EA07E0485AEA3F80007EC7FC5A5A1260131A7D9B1A>I<EA07FCEA1FFF007F +1380387803C038E001E0EAF000A2EA6001380003C0EB0F80EB1F00133C5B13705BA55B90 +C7FCA613C0487EA26C5A131E7D9D1A>I<1338137CA2136C13EEA313C6A2EA01C7A31383 +00031380A4380701C0A213FFA24813E0EA0E00A3001E13F0001C1370387F01FC38FF83FE +387F01FC171E7F9D1A>65 D<EB7C38EA01FF000713F8EA0F83EA1E00001C13785A14385A +A214005AA812701438A27EA26C1370001E13F0380F83E03807FFC00001138038007C0015 +1E7E9D1A>67 D<EA7FFEB5FC6C1380381C07C0EB01E0EB00F0147014781438A2143C141C +A8143C1438A21478147014F0EB01E0EB07C0EA7FFFB512006C5A161E7F9D1A>I<B512F8 +A3381C0038A41400A3130EA3EA1FFEA3EA1C0EA390C7FCA3141CA5B512FCA3161E7E9D1A +>I<B512F8A3381C0038A41400A31307A3EA1FFFA3EA1C07A390C7FCA8EAFFC0A3151E7E +9D1A>I<EBF8E0EA03FEEA07FFEA0F07EA1E03EA3C01EA38005AA3481300A6EB0FF8A3EB +00E01270A213011238EA3C03121EEA0F07EA07FFEA03FEEA00F8151E7E9D1A>I<38FF83 +FEA3381C0070AA381FFFF0A3381C0070AB38FF83FEA3171E7F9D1A>I<EA7FFFB512806C +1300EA01C0B3A6EA7FFFB512806C1300111E7C9D1A>I<3801FFC05A7E38000E00B3A212 +6012F0131E5BEA7FF86C5AEA0FC0121E7C9D1A>I<EA7FE012FF127F000EC7FCB3141CA5 +387FFFFCB5FC7E161E7F9D1A>76 D<00FC137E6C13FEA2383B01B8A31383A200391338A2 +13C7A2EA38C613EEA2136CA2137C1338A21300A700FE13FEA3171E7F9D1A>I<EA0FFE38 +3FFF804813C0EA7C07EA700100F013E0EAE000B1EAF001A2007013C0EA7C07EA7FFF6C13 +80380FFE00131E7D9D1A>79 D<EAFFFEEBFF8014C0381C03E0EB00F0147014781438A414 +78147014F0EB03E0381FFFC01480EBFE00001CC7FCA9B47EA3151E7E9D1A>I<EAFFFC13 +FF1480381C07C0EB01E0EB00F01470A414F0EB01E0EB07C0381FFF8014001480381C07C0 +1301EB00E0A514E214E7A338FF807EA21438181E7F9D1A>82 D<3803F8E0EA0FFEEA1FFF +EA3C07EA780112F0EAE000A3140012701278EA3F80EA1FF8EA07FF38007FC0EB07E0EB00 +F014701438A2126012E0A214706C13F038FE01E0B512C000EF138038E1FE00151E7E9D1A +>I<387FFFFEB5FCA238E0380EA400001300B3A23803FF80A3171E7F9D1A>I<38FF83FEA3 +381C0070B3A26C13E0A2380701C013833803FF806C1300EA007C171E7F9D1A>I<00FE13 +FEA30070131CA26C1338A7137C00181330381CEE70A513C6A2380DC760A31383A3000F13 +E0A2380701C0171E7F9D1A>87 D<387F87F8A3380E01C0EA0703EB8380EA0387EBC700EA +01CF13EEEA00FE5B137C13781338137CA213FE13EEEA01CF13C7380387801383380701C0 +A2380E00E0A2387F01FC38FF83FE387F01FC171E7F9D1A>I<EAFFFCA3EAE000B3AFEAFF +FCA30E2776A21A>91 D<126012F0A27E1278127C123C123E121EA2121F7E7F12077F1203 +A27F12017F12007F1378A2137C133C133E131E131F7FA21480130714C0130314E01301A2 +EB00C013277DA21A>I<EAFFFCA3EA001CB3AFEAFFFCA30E277FA21A>I<387FFFC0B512E0 +A26C13C013047D7E1A>95 D<120C121E123E12381270A212E0A512F012F812781230070F +76A11A>I<EA1FF0EA3FFC487EEA780FEA300738000380A2137FEA07FF121FEA3F83EA78 +03127012E0A3EA7007EA780F383FFFFCEA1FFDEA07F016157D941A>I<127E12FE127E12 +0EA6133EEBFF80000F13E0EBC1F0EB8070EB0038120E141CA7000F13381478EB80F0EBC1 +E0EBFFC0000E138038063E00161E7F9D1A>I<EBFF80000313C0000F13E0EA1F01383C00 +C04813001270A25AA51270A2007813707E381F01F0380FFFE0000313C03800FE0014157D +941A>I<EB0FC0131F130F1301A6EA01F1EA07FDEA0FFFEA1E0FEA3C07EA7803EA700112 +E0A7EA7003A2EA3807EA3E0F381FFFF83807FDFC3801F1F8161E7E9D1A>I<EA01F8EA07 +FF481380381E07C0EA3C01387800E01270481370A2B512F0A300E0C7FC1270A200781370 +7E381F01F0380FFFE0000313803800FE0014157D941A>I<EB07E0EB1FF0EB3FF8EB7878 +EBF030EBE000A4387FFFF0B5FCA23800E000AF383FFF804813C06C1380151E7F9D1A>I< +3801F87C3807FFFE5A381E078C381C0380383801C0A5381C0380EA1E07381FFF005BEA39 +F80038C7FCA27E381FFF8014E04813F83878007C0070131C48130EA40070131C0078133C +003E13F8381FFFF0000713C00001130017217F941A>I<127E12FE127E120EA6133EEBFF +80000F13C013C1EB80E01300120EAC387FC3FC38FFE7FE387FC3FC171E7F9D1A>I<13C0 +487EA26C5A90C7FCA6EA7FE0A31200AF387FFF80B512C06C1380121F7C9E1A>I<12FEA3 +120EA6EB0FFC131F130FEB03C0EB0780EB0F00131E5B5B13FC120F13DE138F380E078013 +03EB01C014E0EB00F038FFE3FEA3171E7F9D1A>107 D<EA7FE012FF127F1200B3A6387F +FFC0B512E06C13C0131E7D9D1A>I<387CE0E038FFFBF8EA7FFF381F1F1CEA1E1EA2EA1C +1CAC387F1F1F39FFBFBF80397F1F1F00191580941A>I<EA7E3E38FEFF80007F13C0EA0F +C1EB80E01300120EAC387FC3FC38FFE7FE387FC3FC17157F941A>I<EA01F0EA07FCEA1F +FF383E0F80EA3C07387803C0EA700138E000E0A6EAF001007013C0EA7803383C0780EA3E +0F381FFF00EA07FCEA01F013157D941A>I<EA7E3E38FEFF80007F13E0380FC1F0EB8070 +EB0038120E141CA7000F13381478EB80F0EBC1E0EBFFC0000E1380EB3E0090C7FCA8EA7F +C0487E6C5A16207F941A>I<387F81F838FF8FFC387F9FFE3803FE1EEBF80CEBE000A25B +5BAAEA7FFFB5FC7E17157F941A>114 D<3807FB80EA1FFF127FEA7807EAE003A30078C7 +FCEA7FC0EA1FFCEA07FE38003F801307386001C012E0A2EAF00338FC0780B51200EAEFFE +EAE3F812157C941A>I<487E1203A6387FFFE0B5FCA238038000AA1470A43801C1E013FF +6C1380EB3F00141C7F9B1A>I<387E07E0EAFE0FEA7E07EA0E00AD1301EA0F033807FFFC +6C13FE3800FCFC17157F941A>I<387F83FC38FFC7FE387F83FC380E00E0A3380701C0A3 +38038380A33801C700A3EA00EEA3137CA2133817157F941A>I<38FF83FEA338380038A2 +6C1370A31338137CA2380C6C60380EEEE0A413C6000613C0EA07C71383A217157F941A> +I<387FC7F8EBCFFCEBC7F8380703C038038380EBC700EA01EFEA00FE137C13781338137C +13EE120113C738038380000713C0EA0F01387FC7FC00FF13FE007F13FC17157F941A>I< +387F83FC38FFC7FE387F83FC380E00E0A27EEB01C0A2EA0381EB838013C31201EBC700EA +00E7A213E61366136E133CA31338A35BA2EA30F0EA78E01271EA7FC06C5A001EC7FC1720 +7F941A>I<387FFFF8B5FCA238E000F0EB01E0EB03C038000780EB0F00131E137C5B485A +EA03C0485A380F0038121E5A5AB512F8A315157E941A>I<EB07E0131F133FEB78005B5B +AB1201485AB45A90C7FC7FEA03C06C7E1200AB7F1378EB3FE0131F130713277DA21A>I< +127CB4FC7FEA03C06C7E1200AB7F1378EB3FE0131F133FEB78005B5BAB1201485AB45A90 +C7FC127C13277DA21A>125 D E /Fz 6 121 df<EC1F80EC7FE0903801E0F09038038078 +903806003C49133E49131E0138131FEB31801361EB60C013C0A29038C1803FEA0181A2EB +8300D80303137E130615FC018C13F83801F801D800E013F090380003E0EC0780EC0F0014 +1E143814F0EB01C0EB0780010EC7FC13385B5BD80180130C48C7FC00061418120E000C14 +30481470D83FE013F09038FF03E039707FFFC0D8601F1380D8E0071300486C5AEB00FC20 +307AAE25>50 D<EB03E090381FF8E090383C1DF0EBF80D3801F007D803E013E03807C003 +A2EA0F80001FEB07C013005AA2007EEB0F80A448EB1F00A31504EC3E0CA2127C147EECFE +18383C01FC391E03BE30380F0E1E3907FC0FE03901F007C01E1F799E25>97 +D<133EEA07FEA2EA007E137CA413F8A4EA01F0A4EA03E0A4EA07C0A4EA0F80A4EA1F00A4 +123EA45AA31310EAF830A3136012F0A213C01279EA3F80EA1E000F327AB112>108 +D<3B03C007E003F03B0FF03FF80FFC3B1C78787C1C1E00189039C03E701F3B307D801E60 +0FD97F0013C0D8607ED91F8013801600017C16004848013E5BA21200A2484849133EA35F +48485BA25F1808484848481418EE01F0A21830270F8003E013E0186018C0933800E18001 +0049EBFF00000E4A133E351F7A9E3B>I<131C133C137CA45BA4485AA3B512C0A23803E0 +00A3485AA4485AA448C7FCA4123EA31480EA7C01A2EB0300A21306EA780C5BEA3C70EA1F +E0EA0F80122C79AB18>116 D<90383E01F09038FF83FC3901C3C60E390301CC1E0006EB +F83E000C147E14F00018147C1538393003E000A21200A2495AA4495AA3150890381F0018 +123C127C007E143048481360A239786F01C03970C78380393F83FE006CC65A1F1F7C9E21 +>120 D E /FA 12 121 df<1206120E12FE120EB1EAFFE00B157D9412>49 +D<EA0F80EA30E0EA4070EA8030EAC03812E0124012001370A2136013C0EA0180EA030012 +06EA0C081208EA1018EA3FF0127F12FF0D157E9412>I<EA0FE0EA3030EA6018EA701CA2 +1200131813381360EA07E0EA00301318130C130EA212E0A2EAC00CEA4018EA3030EA0FE0 +0F157F9412>I<1330A2137013F012011370120212041208121812101220124012C0EAFF +FEEA0070A5EA03FE0F157F9412>I<EA6030EA7FE013C0EA44001240A4EA4F80EA70E0EA +4070EA00301338A2124012E0A2EA8030EA4060EA20C0EA1F000D157E9412>I<EA01F0EA +0608EA080CEA181C1230EA7000126012E0EAE3E0EAEC30EAF018130CEAE00EA31260A2EA +300C1318EA1830EA07C00F157F9412>I<EA0FC0EA1860EA3030EA7038EAE018EAFFF8EA +E000A31260EA7008EA3010EA1830EA07C00D0E7F8D10>101 D<38F8F83E383B1CC7393C +0F0380EA380EAA39FE3F8FE01B0E7F8D1E>109 D<EA07C0EA1830EA3018EA600CA2EAE0 +0EA5EA701CEA3018EA1830EA07C00F0E7F8D12>111 D<EA1F40EA60C0EAC040A2EAE000 +B4FCEA7F80EA1FC0EA01E0EA8060A212C0EAE0C0EA9F000B0E7F8D0E>115 +D<1208A31218A21238EAFFC0EA3800A71340A4EA1C80EA0F000A147F930E>I<EAFE3FEA +3C1CEA1C10EA0E20EA074013C0EA0380EA01C0EA02E0EA04F0EA0870EA1838EA383CEAFC +7F100E7F8D13>120 D E /FB 50 122 df<ED3FE0EB0FFC013FEB7FF0137F13FF5A3803 +FE1C140C00079038003FE0A292C7FCA83A7FFFF81FE0B538FC3FF0A36C13F83807FE00B3 +A96C48EB1FE024337FB22A>12 D<1538157C15FCA2140115F8A2140315F0140715E0A214 +0F15C0A2141F1580A2143F15005C147EA214FE5CA213015CA213035C13075CA2130F5CA2 +131F5CA2133F91C7FC5B137EA213FE5BA212015BA212035B12075BA2120F5BA2121F5BA2 +123F90C8FC5A127EA212FE5AA25A12781E487CB527>47 D<EB0FF0EB7FFE48B512804814 +C04814E0390FFC3FF0391FF81FF8EBF00F393FE007FCA3007F14FEEBC003A400FF14FFB3 +A3007F14FEA3EBE007003F14FCA3391FF00FF8EBF81F390FFC3FF06CB512E06C14C06C14 +8039007FFE00EB0FF020347DB227>I<EB01E0497E130F131F13FF127FA2B5FC7E133F12 +00B3B2003FB512E0A24814F06C14E0A21C337BB227>I<EB1FE0EBFFFC000313FF481480 +4814C04814E04814F0397FE07FF8EB803F39FF001FFC140F127E003E14FE121C000C1307 +1204C7FCA2140FA215FCA2EC1FF8A2EC3FF015E0147F15C0ECFF80491300495A5C495A49 +5A495A495A495A91C7FC13FE485A485A485A485A5B48B512FC4814FE5AA46C14FC1F337D +B227>I<EB1FF0EBFFFE0003EBFF804814C0001F14E04814F0397FF03FF8EB801FEA3F00 +001E14FC000C130FC7FCA3141FA215F8A2EC3FF0A2EC7FE0903801FFC0013F1380ECFE00 +5CECFF8015E09038003FF0EC1FF8EC0FFC15FE1407A215FFA712600078EB0FFE127CB413 +1F9038E03FFC90B512F87E001F14F06C14E06C14800001140038001FF020347DB227>I< +EC7FE04A7EA25BA25BA2EB07DFA2130FEB1F9FA2133F141F137FA213FEA2EA01FCA2EA03 +F8A2EA07F0A2EA0FE0121F13C0123F1380127F13005A90B6128016C0A56C1580C7381FF0 +00AA6E5A22327EB127>I<000FB512F04814F8A515F001F8C7FCABEBFFF814FF158015C0 +15E09038FC3FF09038F01FF813E09038C00FFCA2EA0F80C713FEA812081218003C14FC14 +1F127EB4EB3FF8EBC07F6CB512F06C14E06C14C06C14806C1400000113FC38003FE01F33 +7DB127>I<49B4FC010F13C0133F5B48B5FC5A48138049C7FCEA0FF8121F5B123F5BA212 +7FA25BA238FFC3FF01C713C001CF13E001DF13F090B512F89038F80FFCEBF00715FEEBE0 +03A215FF13C0A6127FA313E0A2123FEC07FE13F0001F14FCEBFC1F6CB512F87E6C14F06C +14E06C1480013F1300EB0FF820347DB227>I<007FB512FEB7FCA56C14FEC7EA03FCEC07 +F8140FEC1FF015E0143FEC7FC014FF15805B491300A2495AA2495AA2495AA2133F5CA213 +7FA25C13FFA3485BA6485BA96C90C7FC20327DB127>I<EB1FF890B5FC000314C04814E0 +4814F04814F8393FF81FFCEBE007A2397FC003FEA8003F14FCA2391FE007F8EBF00F6CB5 +12F0000314C0C61400A2000314C0000F14F0391FF00FF8393FE007FC007F14FEEBC003A2 +00FF14FFA9007F14FEEBE007A2393FF81FFC90B5FC6C14F86C14F06C14E06C14C0C61400 +EB1FF820347DB227>I<EB1FF0EBFFFE487F000714C04814E0A2391FF81FF0393FF00FF8 +13E0007FEB07FC13C012FF15FE1403A315FFA75C127FA26D5A123F6D5A381FFFFB7E6C13 +F36C13E3C613C390380003FEA21407A215FCA2140F15F80004131F000FEB3FF0381FC0FF +90B512E04814C01580000F14006C13FC6C13F038007F8020347DB227>I<EBFFE0000F13 +FC003F13FF481480B612C0D87F8013E0387E003F007814F01230C7FCA5EC7FE014FF4913 +C04913801500EB07FC495A5C495A5C133F5CA249C7FCA890C8FCA6137F497EA76DC7FC1C +327CB125>63 D<EC7FF84A7E497FA3497FA3498014FDA2D90FF97FA214F8011F805CA201 +3F6D7E14E0A2017F6D7EA214C001FF6D7EA21480486E7EA21400486E7EA248481580A290 +B7FC4816C0A34816E0A201F8C7FC484815F0167FA2484815F8163FA2484815FC161F5B6C +C8EA0FF82E327DB135>65 D<EC1FFF49B512E0010714FC011F14FF137F90B7FC5A489038 +F803FE489038C0007E4849133E49C7120E001F15064991C7FC485AA2485AA4485AAE6C7E +A46C7EA26C7E6D1403000F5D6D6C5B6C6D133F6C9039F801FF806C90B6FC7E7F011FECFE +00010714F8010114E0D9001F90C7FC29347CB232>67 D<007FB512E0B612FEEDFFC016F0 +8282D9E0017F9138001FFF6F138015036F13C0A26F13E0A2EE7FF0A3163FA217F8AD17F0 +A2167FA217E016FFA24B13C05D4B1380031F1300EDFFFE90B65A5E5E16C04BC7FC6C14E0 +2D3279B139>I<007FB6FCB71280A5160001E0C8FCAE90B512F881A55D01E0C8FCB3A36C +5A213279B12C>70 D<EC0FFF49B512F0010714FC011F14FF017F15C090B7FC5A48EBFC01 +489039E0003F80480180130F91C7120748481403491401484891C7FCA2127F5BA3485AA8 +92381FFFE05DA56C7EED007FA27F123FA26C7E7F6C7E806C13E06C01FC13FF6C90B6FC7E +7F011F15800107ECFE00010114F0D9000F90C7FC2B347CB235>I<D87FC0ECFF80486C49 +13C0B390B7FCA79038E00001B3A46C486D13802A3279B139>I<EA7FC0EAFFE0B3B3ACEA +7FC00B327AB118>I<EA7FC0487EB3B3A690B512FC15FEA56C14FC1F3279B12A>76 +D<D87FF0ED3FFC486CED7FFEA26D15FFA26D5CA36D5C01BF15FBA26E1307A2D99FC0EB0F +F3A3D98FE0EB1FE3A36E133F018715C36E137FA2018315836E13FFA2018115036E5AA201 +8014FEECFF03A2027F13FC1587023F13F8A215CF021F13F0A391380FFFE0A26E13C0A36E +1380A26E13006E5A6CC9EA01FC373279B146>I<EC3FFC0103B512C0010F14F0013F14FC +90B7FC48D9F00F138048D9C00313C04890C713E04848EC7FF049143F001F16F849141F00 +3F16FC49140FA2007F16FEA2491407A200FF16FFAE007F16FE6D140FA46C6CEC1FFCA26C +6CEC3FF8A26C6CEC7FF06D14FF6CD9C00313E06CD9F00F13C06C90B612806C1600013F14 +FC6D5C010314C09026003FFCC7FC30347CB239>79 D<007FB512C0B612F815FF168016C0 +16E0D9E00113F09138007FF8153F151F16FCA2150FA4151FA216F8153FED7FF0EC01FF90 +B612E016C0160015FC15E09038E07FF0143F81141F81140F816E7EA26E1380A26E13C0A2 +6E13E0A2ED7FF0153F16F8ED1FFCA2ED0FFEA26C48EB07FC273279B132>82 +D<007FB712F8B812FCA56C16F8C7D83FF8C7FCB3B3A66E5A2E327DB135>84 +D<D87FC0EB01FE486CEB03FFB3B3007F15FE6D1307A2003FEC0FFC7F6C6CEB3FF801FF13 +7F6C90B512F06C15E06C15C0C61500011F13FC010313C0283379B137>I<00FE912607FF +80EB01FC6C4A6D13036D49150783A27F007F4AED0FF88316DF6C6C18F0DB7FCF141F8316 +8F6C6C18E0DBFF87143F8316076C6C18C04A0103147F8315FED807FC18800203010114FF +8315FCD803FE6E150002075D18815D0001047F5B01FF1683020F15C35D6C043F5B148F02 +9F15C74B14E7017F031F5BA3DADFC014EFD93FFF6EB45AA25DA26D6F5BA292C7FC6D6F5B +6D486E5B46327EB14B>87 D<EB1FFC90B51280000314E04814F04814F89038E00FFC1380 +90380007FE120E120CC7FCA3EB0FFF90B5FC1203000F1307EA1FF8EA3FF0EA7FE0EAFFC0 +A5EBE00F007F131FEBF07F6CB5FC6C13F76C13E76C13873901FC03FC1F217EA026>97 +D<EA7F80487EB0EBC1FE9038C7FF8001DF13E090B512F015F8EBF81F9038E00FFC9038C0 +07FEA3140315FFAB15FE1407A215FCEBE00F9038F03FF890B512F015E001DF13C001CF13 +00387F83FC20327CB128>I<EB1FFC90B5FC000314C04814F05A381FFC07383FF0019038 +E000E0007F146015005B12FFAB127F6D13181538003F14789038F001F8381FFC0F6CB5FC +7E6C14E0C6148090381FF8001D217DA023>I<EC01FEEC03FFB0EB3FC33801FFF34813FB +4890B5FC5A381FFC0F383FF00313E0127FA213C012FFAB127F13E0A2123F6D5A381FF81F +6CB6FC7E6C13FB6C13E339003F81FE20327DB128>I<EB0FFC90387FFF8048B512E00007 +14F04814F8381FFC0F9038F003FCD83FE013FE007F130113C015FF00FF7FA390B6FCA315 +FE0180C7FC7FA2127FA27F003F14066D130E6C6C133E390FFE01FE90B5FC12036C14F86C +6C13E0903807FE0020217EA025>I<903807FF80133F90B5FC5A5A3807FE07EBFC0191C7 +FC120FA9387FFFF0B57EA36C5BD80FFCC7FCB3A96C5A19327FB118>I<90391FF801E090 +B5EA0FF0000314FF5A4814F0D9F81F130048486C7EEBE007003F80A7001F5CEBF00F6C6C +485A90B5FC6C5C5D000691C7FC380E1FF890C9FC120F487E90B512C06C14FC81EDFF806C +15C0A2001F15E05A3A7F80007FF048C7121F150FA46C6CEB1FE06D133FD83FF0EBFFC06C +B612806C15006C5C000114F8D8001F138024307FA027>I<EA7F80487EB0EC7F809038C1 +FFE001C313F001CF13F801DF13FCEBDE0F9038F807FE13F013E0A213C0B3A4397F8003FC +1F327CB128>I<EA7FC0EAFFE0A9EA7FC0C7FCA7EA3FC0EA7FE0B3ADEA3FC00B337DB213> +I<EB1FF0EB3FF8A9EB1FF090C7FCA7EB0FF0EB1FF8B3B3A338603FF0EA7FFFB512E014C0 +6C13806C1300EA03FC154185B215>I<127F487EB0EC0FF8EC1FFCEC3FF8EC7FF0903881 +FFE0018313C001871380018F1300EB9FFEEBBFFCEBFFF85C5C5CA2808080A2EBEFFCEBC7 +FEEB83FF13811580018013C0EC7FE0143F15F0EC1FF8EC0FFCEC07FEA2397F0003FC1F32 +7CB126>I<EA7F80EAFFC0B3B3ACEA7F800A327CB113>I<277F803FC013FF28FFC1FFF007 +13C001C36D4813E001C76D4813F001CF6D4813F8D9DE07EB781F903BF803FFE00FFC01F0 +14C001E01480A201C01400B3A46C486C48EB07F836217CA03F>I<397F807F8039FFC1FF +E001C313F001CF13F801DF13FCEBDE0F9038F807FE13F013E0A213C0B3A4397F8003FC1F +217CA028>I<EB0FFC90B512C0000314F048804880391FFC0FFE393FF003FF497E007F15 +80A2497EA200FF15C0AA007F15806D5AA26C6C481300A2391FFC0FFE6CB55A6C5C6C5CC6 +14C0D91FFEC7FC22217EA027>I<387F81FE39FFC7FF8001DF13E090B512F015F8EBF83F +9038E00FFC01C013FE1407A3EC03FFABEC07FEA3EC0FFCEBE01F9038F03FF890B512F015 +E001DF13C001CF1300EBC3FC01C0C7FCAD6C5A202F7CA028>I<90381FC1FE9038FFF3FF +000313FB4890B5FC5A381FFC1F383FF807497EEA7FE0A3EAFFC0ABEA7FE0A3EA3FF05C38 +1FFC1F6CB6FC7E6C13FB6C13E338003F83EB0003ADEC01FE202F7DA028>I<007F137838 +FF81F813831387138F139F13BF1480EBFC005B5B5BA25BB36C5A15217CA01B>I<EBFFC0 +000313FC000F13FF5A5AA2EB807E387F000E140691C7FC7F13F0EBFF806C13E0806C13FC +6C7F7E6C7FC6FC010F13801300143F12601278127E39FF807F0090B5FC5CA2003F5B000F +13F0C613C019217EA01E>I<EA03FC487EA8387FFFFEB6FCA36C5BD807FEC7FCB3A25C5C +9038FF0F806C13FF15006C5B6C13F8EB7F80192A7FA91D>I<397F8003FC39FFC007FEB3 +A5140FA2141F127FEBE07F383FFFF76C13E76C13870003EB03FC1F217CA028>I<00FED9 +07E0137F6C496C13FFD9801F5BA215F8D87FC015FE023F1303A215FCD83FE0EC07FC147D +15FEA2261FF079EB0FF814F915FF14F8D80FF8EC1FF013F94A139F0007027F13E016BF13 +FDD9FFE013FF6C6E13C0A314C06C6E1380A36C496C13006D486C5A30217EA035>119 +D<007F14FE38FF8001EBC003127F01E013FC1407123F01F013F8001F130F13F8000F14F0 +141F13FC120701FE13E00003133FA2000114C013FF7EEC7F80A2137FECFF007FA26D5AA3 +6D5AA213075CA35C130FA2495A124038F07FC0B5FC5C91C7FC5BEA7FF8EA1FC01F2F7EA0 +24>121 D E /FC 1 98 df<1304130EA3131FA2EB2F801327A2EB43C0A2EBC3E01381A2 +48C67EA2487F13FF38020078487FA3487F1218003C131F00FEEB7FE01B1A7F991F>97 +D E /FD 9 117 df<EAFFF8A20D027E8B10>45 D<D807FCEC1FF0D8007CEC3F00015E14 +3E165EA2169EA2018F495AA21502A215049038878008D801075C1510A21520EB03C01540 +00025D1580A2903801E100A214E200044A5A14E4EB00F8A214F0120C4A485A003E01607F +3AFFC0403FFE2C227DA12D>77 D<EA07FCEA0C06EA1E031480EA0C01000013C0EB0380A2 +137FEA03E3EA0F03121C38380700127800F01308A2130FA2EB1710387867A0381F83C015 +157D9418>97 D<13FF380381C0EA0603120C381C018048C7FC1278127012F0A55AA26C13 +8038700100A2EA3806EA1C18EA07E012157C9416>99 D<13FE38038380380701C0380C00 +E0121C5A12781270B5FC00F0C7FCA45AA26C134000701380123038380300EA0E0CEA03F0 +13157D9416>101 D<1378EA03F8EA0070A65BA63801C3F0EBCC18EBD00CEBE00EA213C0 +0003131C1380A538070038A6000E1370000F137838FFE7FF18237FA21B>104 +D<136013F01201A2EA00E01300A8EA01C0120F1201A4EA0380A6EA0700A6120E120FEAFF +C00C227FA10E>I<3A01C1F807E03A0FC60C18303A01D80E60389039E007801CA201C013 +000003491338EB800EA54848481370A6000E4913E0000F013C13F03AFFE3FF8FFE27157F +942A>109 D<1380A3120113005AA25A5A5AEAFFFCEA0E00A55AA6EA3810A51320A2EA1C +40EA07800E1F7C9E13>116 D E /FE 31 121 df<91380FC0F8913830718E913860F31E +ECC0F70101EB660C9138800E001303A35DEB0700A490B612C090390E003800A45D5BA45D +5BA44A5A1370A44A5A13E0A292C7FC495AA238718E0638F19E0CEB1E1838620C30383C07 +C0272D82A21E>11 D<EC0FF0EC380CEC600EECC01E1301EC801C01031300A349C7FCA590 +B512F090380E0070A215E0A25BA2EC01C0A31338EC0380A315889038700710A4EC032090 +38E001C091C7FCA25BA21201EA718012F100F3C8FC1262123C1F2D82A21B>I<120C121E +123FA2121D1202A31204A212081210122012401280080F75A20F>39 +D<127012F8A212F012E005057A840F>46 D<EB0FC0EB1060EB6038EB8018141CEA010038 +02201E13101204A33808203CA2EB40381478EB80F0380700E0380001C0EB030013061318 +132013C048C7FC1202481310481330481320481360385F80C0EA63FF0040138038807F00 +131E17227CA019>50 D<14FE90380701809038180060012013105B49130848C712043802 +01F03804070839080C04023810180290383003C2382060019038E00382EA40C01241A239 +83800704A4EC0E08A20081131EEC2E103980C04E209038618E6039403E078090C8FC7EA2 +6C14E0000CEB07800003EB7C003800FF801F2379A225>64 D<90B6128090380F00071501 +A2131EA21600A25BA2140192C7FCEB7802A21406140EEBFFFCEBF00CA33801E008A21504 +EC0008485AA25DA248485B15605D1401380F0007B65A21227DA121>69 +D<D9FF80EB07FC010FEC0F801617A20117EC2F00EB13C0164F168F0123149EED011EA215 +020143495AA21508EB41E00181495A1520A21540D801015C1580ECE100A23A0200F201E0 +A214F414F8484A5A14F0A2000C13E0001EEBC007D8FF80EB7FF82E227DA12C>77 +D<001FB512F8391E03C03800181418123038200780A200401410A2EB0F001280A2000014 +00131EA45BA45BA45BA4485AA41203B5FC1D2277A123>84 D<90397FF80FFC90390FC003 +C0D907801380ED02006E5A01035BECE018151001015B6E5A01005B02F1C7FC14FA147CA3 +143CA2147E149EEB011EEB031FEB060F01047F1308EB100701207FEB4003138000018038 +0300015A001F497E39FFC00FFE26227EA124>88 D<EBF8C0EA0185EA0705380E0380A212 +1C123C383807001278A3EAF00EA31410EB1C201270133C38305C40138C380F078014157B +9419>97 D<EA03C0EA1F801203A3EA0700A4120EA45A13F8EA1D0CEA1E0EEA3C06EA3807 +A2130F1270A4EAE01EA3133C1338A2EA607013E0EA31C0EA1F0010237BA216>I<137EEA +01C138030180EA0703EA0E07121C003CC7FC12381278A35AA45B12701302EA300CEA1830 +EA0FC011157B9416>I<143CEB03F8EB0038A31470A414E0A4EB01C013F9EA0185EA0705 +380E0380A2121C123C383807001278A3EAF00EA31410EB1C201270133C38305C40138C38 +0F078016237BA219>I<13F8EA0384EA0E02121C123C1238EA7804EAF018EAFFE0EAF000 +A25AA41302A2EA6004EA7018EA3060EA0F800F157A9416>I<EB1F18EB30B813E03801C0 +70A2EA03801207EB00E05AA3381E01C0A4EB0380120E1307EA060BEB1700EA01E7EA0007 +A2130EA3EA701CEAF0185BEA60E0EA3F80151F7E9416>103 D<13F0EA0FE01200A3485A +A4485AA448C7FC131FEB2180EBC0C0380F00E0A2120EA2381C01C0A438380380A3EB0704 +00701308130E1410130600E01320386003C016237DA219>I<13C0EA01E013C0A2C7FCA8 +121E12231243A25AA3120EA25AA35AA21340EA7080A3EA71001232121C0B217BA00F>I< +14E01301A2EB00C01400A8131E1323EB43801383A2EA0103A238000700A4130EA45BA45B +A45BA3EA70E0EAF0C0EAF1800063C7FC123C132B82A00F>I<EA01E0EA0FC01201A3EA03 +80A4EA0700A4120EA45AA45AA45AA3127112E2A4126412380B237CA20C>108 +D<391C0F80F8392610C10C39476066063987807807A2EB0070A2000EEBE00EA44848485A +A3ED38202638038013401570168015303A7007003100D83003131E23157B9428>I<3838 +0F80384C30C0384E4060388E8070EA8F00128EA24813E0A4383801C0A3EB038400701388 +14081307EB031012E0386001E016157B941B>I<137EEA01C338038180380701C0120E00 +1C13E0123C12381278A338F003C0A21480130700701300130E130CEA3018EA1870EA07C0 +13157B9419>I<3801C1F0380262183804741C3808780CEB700EA2141EEA00E0A43801C0 +3CA3147838038070A2EBC0E0EBC1C038072380EB1E0090C7FCA2120EA45AA3EAFFC0171F +7F9419>I<EBF840380184C0EA0705380E0380A2121C123C383807001278A3EAF00EA45B +1270133CEA305C5BEA0F381200A25BA45BA3EA0FFC121F7B9416>I<EA1C1F3826208038 +4741C0EA87831303EB018090C7FC120EA45AA45AA45A123012157B9415>I<13FCEA0183 +38020080EA0401EA0C03140090C7FC120F13F0EA07FC6C7EEA003E130F7F1270EAF006A2 +EAE004EA4008EA2030EA1FC011157D9414>I<13C01201A4EA0380A4EA0700EAFFF8EA07 +00A2120EA45AA45AA31310EA7020A213401380EA3100121E0D1F7C9E10>I<001E136000 +2313E0EA4380EB81C01283EA8701A238070380120EA3381C0700A31408EB0E101218121C +EB1E20EA0C263807C3C015157B941A>I<001EEB60E00023EBE0F0384380E1EB81C00083 +1470D887011330A23907038020120EA3391C070040A31580A2EC0100130F380C0B023806 +13843803E0F81C157B9420>119 D<3803C1E0380462103808347038103CF0EA20381460 +1400C65AA45BA314203861C04012F1148038E2C100EA4462EA383C14157D9416>I +E /FF 12 117 df<1238127C12FCA212F812700606798512>46 D<EC1FE0ECF01C903803 +800690380600010118EB00804914C04914604914202601803F1330390300E0C03A060380 +60103A0407002018D80C0E1330D8181E133E49131EEA30380178133CEA607013F0A2D8C1 +E0EB7830A4EDF060A21281020113C000C114E000C00103138090387007E1913809E30090 +381830E639600FC07C90C9FC122012306C14076C143C6CEB01F02601C01FC7FC38007FF0 +252A76A92E>64 D<133EEBE1183801C0BC380380FC380700785A121EA2003E5B5AA34848 +5AA448485AECC180A39038078300EA700FEB0B86EA38333818618C380F80F0191A79991F +>97 D<EA01E0123FA212035BA4485AA448C7FCA4EA1E3EEB6380381F81C01301003E13E0 +EA3C00EB01F0A21278A438F003E0A314C0EAE007A21480EB0F00A2131EEA701CEA3038EA +18E0EA0F80142A79A91B>I<EB1F80EB70403801C02038038030EA07005A121E003E1360 +123C387C01C0EB0F00EA7FF800F8C7FCA55AA2142000701360007813C038380180381807 +00EA0C1CEA07F0141A79991B>101 D<EB03E090380E118090381C0BC0EB380F90387007 +8013F0EA01E0A20003EB0F00EA07C0A3380F801EA4495AA45C6C13F8A238038378380186 +F0EA00F81300A2495AA35CEA700338F8078091C7FCEAF00EEAE03CEA3FE01A267D991B> +103 D<133CEA07FCA2EA007C1378A45BA4485AA43803C3E0EBCC38EBD01C13E00007131E +13C01380A248485AA4001E5BA35C5A1560EB01E01540007814C0ECC08014C1ECC30038F0 +00C6006013781B2A7BA91F>I<131C133EA2133C13381300A9EA03C0EA0CE0EA1860EA30 +F0A21260A2EA61E012C11201EA03C0A2EA0780A3EA0F00A2130C121E13081318121C1330 +1320EA0C40EA07800F287BA712>I<1378EA07F8120F120013F0A4EA01E0A4EA03C0A4EA +0780A4EA0F00A4121EA45AA45A1360A3EAF0C0A21270EA7180EA3100121E0D2A7BA90F> +108 D<EB0FC0EB7870EBE0383803C01CEA0780380F001E5A001E131F123E123C127CA248 +133EA3143C48137C147814F814F0387001E0007813C03838038038180700EA0E1CEA03F0 +181A79991F>111 D<9038780F8090388C18E039018E607038030FC0EC80780006EB0038 +157CA2EA0C1E1200A34913F8A315F0EB7801A215E0EC03C013F8EC07801500EBFC0E3801 +E638EBE3E001E0C7FCA2485AA4485AA3120FEA7FF812FF1E267F991F>I<13301378A213 +F0A4EA01E0A4B5FCA2EA03C0A2EA0780A4EA0F00A4121EA45A1306A2130C12781318EA38 +101320EA1840EA0F8010257AA414>116 D E /FG 2 106 df<130C131CA21338A21370A3 +13E0A3EA01C0A2EA0380A3EA0700A3120EA25AA35AA35AA25AA31270A27EA37EA37EA27E +A3EA0380A3EA01C0A2EA00E0A31370A31338A2131CA2130C0E3D7BAC17>104 +D<12C07EA21270A27EA37EA37EA27EA3EA0380A3EA01C0A2EA00E0A31370A31338A2131C +A31338A21370A313E0A3EA01C0A2EA0380A3EA0700A3120EA25AA35AA35AA25AA25A0E3D +7DAC17>I E /FH 17 118 df<12E07E7E127C123C7E1207EA0380EA01C0120013200B0B +7AA91E>18 D<127812FCA212FEA2127A1202A41204A31208A212101220124007127B8511 +>44 D<1310137013F0120712FF12F81200B3AD487E387FFFE0A213287BA71E>49 +D<13FE3807FF80380E07E0381803F0382001F8130048137CA200F8137E7E143EA3007813 +7EC7FC147CA214F8A2EB01F014E0EB03C0EB07801400130E5B5B5B13605B38018002EA03 +00000613045A5A0010130C383FFFFC4813F8B5FCA217287DA71E>I<00181318001F13F0 +EBFFE014C01480EBFE00EA11F80010C7FCA8137E38138380381400C0001813E000101370 +C71278147C143CA2143EA3127012F8A3143C12800040137C14787E003013F0381801E038 +0E07C03807FF00EA01FC17297DA71E>53 D<137F3801FFC03807C1E0380F0070001E7F48 +133C141C48131EA200F87FA41580A41278141F7EA2001C132F6C134F6C13CF3803810FEA +007E01001300A3141EA35C121C003E5B1470003C5B381801C0381C0780D80FFFC7FCEA03 +F819297EA71E>57 D<02FF13100107EBE03090381FC07890393E000C7001F8EB06F04848 +1303484813014848130048481470A248C812305A123E1610127EA2007C150012FCA892B5 +FC127C007EEC03F01501123EA2123F7E6C7EA26C7E6C7E6C6C13026C7E013EEB0C709039 +1FC03830903907FFE0100100EB8000282B7DA92F>71 D<48B5FCA2380003F01301B3AA12 +30127812FCA214E0EAF803004013C03820078000101300EA0C1EEA03F0182A7DA81F>74 +D<120FB4FCA2121F7EACEB07E0EB1838EB600EEB8007158090380003C0A2EC01E0A215F0 +A715E0A2140315C01580EB8007000EEB0F00EB401C380C303838080FC01C2A7EA921>98 +D<137E3803C380380700E0000E13F0481370003C1378143848133CA212F8A2B512FC00F8 +C7FCA51278127C003C1304A26C1308000E13106C13203801C0C038007F00161A7E991B> +101 D<120FB4FCA2121F7EACEB07F0EB1838EB201C497E140F1380A21300B139FFF0FFF0 +A21C2A7EA921>104 D<121E123FA4121EC7FCA9120FB4FCA2121F7EB3A2EAFFF0A20C29 +7EA811>I<380F07F038FF1838EB201C381F400E000F130F1380A21300B139FFF0FFF0A2 +1C1A7E9921>110 D<137F3801C1C038070070000E7F487F003C131EA2487FA200F81480 +A800781400A26C131EA26C5B000E13386C5B3801C1C0D8007FC7FC191A7E991E>I<380F +07E038FF1838EB601E380F800FEC0780010013C0140315E0A2EC01F0A715E01403A215C0 +EC07801380EC0F00EB401CEB3078EB0FC090C8FCAAEAFFF0A21C267E9921>I<3807F840 +381C06C0EA3001EA6000A200E01340A27E6C1300127EEA7FF0EA3FFEEA0FFF0003138038 +003FC01307388001E0A2EAC000A36C13C0EAF00100F8138038C40700EA83F8131A7E9918 +>115 D<000F130FB413FFA2001F131F6C7FB05CA26C132F3903804F803901C08FF03800 +7F0F1C1A7E9921>117 D E /FI 80 124 df<90381FC1F090387037189038C03E3C3801 +807C000313783907003800A9B612C03907003800B2143C397FE1FFC01E2380A21C>11 +D<EB1FC0EB7020EBC0103801803800031378EA0700143091C7FCA7B512F8380700781438 +B2397FE1FF80192380A21B>I<12E0A212F012781238121C12061202120108097BA218> +18 D<391FF00FC039301C18703978066018903807E01C383003C00000140E1480A29038 +7FFFFE3907C38000EA0E03123C1278A200F07F1502A290380260043978063008393C1818 +30390FE007C01F157E9423>26 D<EA7038EAF87CEAFC7EA2EA743AEA0402A4EA0804A2EA +1008A2EA2010EA40200F0F7EA218>34 D<7FA2EA03F0EA0C8CEA1082EA20811260384080 +8012C01387A338E08300138012701278123F13E0EA1FF8EA07FCEA01FEEA009F1387A2EB +8380A2EAF081A312E00080130012401383EA2086EA1084EA0898EA07E0EA0080A311287D +A418>36 D<127012F812FCA212741204A41208A21210A212201240060F7CA20E>39 +D<132013401380EA01005A12061204120CA25AA25AA312701260A312E0AE1260A3127012 +30A37EA27EA2120412067E7EEA0080134013200B327CA413>I<7E12407E7E12187E1204 +1206A27EA2EA0180A313C01200A313E0AE13C0A312011380A3EA0300A21206A21204120C +5A12105A5A5A0B327DA413>I<127012F812FCA212741204A41208A21210A21220124006 +0F7C840E>44 D<EAFFF8A20D02808B10>I<127012F8A3127005057C840E>I<14801301A2 +EB0300A31306A35BA35BA35BA35BA35BA3485AA448C7FCA31206A35AA35AA35AA35AA35A +A311317DA418>I<EA01F0EA071CEA0C06487E00381380A2387001C0A400F013E0AE0070 +13C0A3EA780300381380A2381C0700EA0C06EA071CEA01F013227EA018>I<1380120312 +0F12F31203B3A9EA07C0EAFFFE0F217CA018>I<EA03F0EA0C1CEA100700201380384003 +C0A2008013E012F0EAF801A3EA2003120014C0A2EB07801400130E5B13185B5B5B485A90 +C7FC000213205A5A00181360481340383FFFC05AB5FC13217EA018>I<EA03F8EA0C1EEA +100F38200780004013C0127813031307123800001380A214005B130C1338EA03F0EA001C +130FEB0780A2EB03C0A214E01220127012F8A200F013C01240EB0780122038100F00EA0C +1CEA03F013227EA018>I<1303A25BA25B1317A213271367134713871201130712021206 +12041208A212101220A2124012C0B512F838000700A7EB0F80EB7FF015217FA018>I<00 +101380381E0700EA1FFF5B13F8EA17E00010C7FCA6EA11F8EA120CEA1C07381803801210 +380001C0A214E0A4127012F0A200E013C01280EA4003148038200700EA1006EA0C1CEA03 +F013227EA018>I<137EEA01C138030080380601C0EA0C03121C381801800038C7FCA212 +781270A2EAF0F8EAF30CEAF4067F00F81380EB01C012F014E0A51270A3003813C0A23818 +0380001C1300EA0C06EA070CEA01F013227EA018>I<12401260387FFFE014C0A2384000 +8038C0010012801302A2485A5BA25B5BA21360134013C0A21201A25B1203A41207A76CC7 +FC13237DA118>I<EA01F8EA060EEA0803381001801220386000C0A31270A23878018000 +3E1300EA3F02EA1FC4EA0FF812036C7EEA067EEA083F38100F80383007C0EA6003EB00E0 +5A1460A40060134014C06C138038180300EA0E0EEA03F013227EA018>I<EA01F0EA060C +487EEA1807383803801270A238F001C0A314E0A5127013031238EA1805120CEA0619EA03 +E1380001C0A3EB0380A21230387807001306EA700CEA20186C5AEA0FC013227EA018>I< +127012F8A312701200AB127012F8A3127005157C940E>I<127012F8A312701200AB1270 +12F8A312781208A41210A312201240A2051F7C940E>I<B612FEA2C9FCA8B612FEA21F0C +7D9126>61 D<497EA3497EA3EB05E0A2EB09F01308A2EB1078A3497EA3497EA2EBC01F49 +7EA248B51280EB0007A20002EB03C0A348EB01E0A348EB00F0121C003EEB01F839FF800F +FF20237EA225>65 D<B512F8380F800E0007EB0780EC03C015E0140115F0A515E01403EC +07C0EC0F80EC3E00EBFFFE9038800780EC03C0EC01E015F0140015F8A6EC01F0A2EC03E0 +EC07C0000FEB0F00B512FC1D227EA123>I<903807E0109038381830EBE0063901C00170 +39038000F048C7FC000E1470121E001C1430123CA2007C14101278A200F81400A8127815 +10127C123CA2001C1420121E000E14407E6C6C13803901C001003800E002EB381CEB07E0 +1C247DA223>I<B512F0380F801E00071307EC0380EC01C0EC00E015F01578A2157C153C +A3153EA9153CA2157C1578A215F015E01401EC03C0EC0700000F131EB512F01F227EA125 +>I<B612C0380F80070007130114001540A215601520A314201500A3146014E013FF1380 +14601420A315081400A21510A31530A2157015E0000F1303B6FC1D227EA121>I<B612C0 +380F80070007130114001540A215601520A314201500A3146014E013FF138014601420A4 +91C7FCA9487EEAFFFE1B227EA120>I<903807F00890383C0C18EBE0023901C001B83903 +8000F848C71278481438121E15185AA2007C14081278A200F81400A7EC1FFF0078EB00F8 +1578127C123CA27EA27E7E6C6C13B86C7E3900E0031890383C0C08903807F00020247DA2 +26>I<39FFFC3FFF390FC003F039078001E0AE90B5FCEB8001AF390FC003F039FFFC3FFF +20227EA125>I<EAFFFCEA0FC0EA0780B3ACEA0FC0EAFFFC0E227EA112>I<D8FFFCEBFF80 +D80FC0EB7C006C48133015205D5D4AC7FC14025C5C5C5C5C5CEB81C0EB83E01385EB88F0 +1390EBA078EBC03C13808080A26E7E8114036E7EA26E7E81486C7F3AFFFC07FF8021227E +A126>75 D<EAFFFCEA1F806CC7FCB3A21401A41403A214021406A2141E48137EB512FE18 +227DA11E>I<D8FFC0EB03FF000F15F0000715E0D805E01305A2D804F01309A301781311 +A36D1321A36D1341A26D1381A39038078101A3EB03C2A2EB01E4A3EB00F8A31470120E00 +1FEC03F03AFFE0203FFF28227EA12D>I<39FF8007FF3907C000F81570D805E01320EA04 +F0A21378137C133C7F131F7FEB0780A2EB03C0EB01E0A2EB00F014F81478143C143E141E +140FA2EC07A0EC03E0A21401A21400000E1460121FD8FFE0132020227EA125>I<EB0FE0 +EB783CEBE00E3903C0078039078003C0390F0001E0000E1300001E14F0481478A2007C14 +7CA20078143CA200F8143EA90078143C007C147CA2003C1478003E14F8001E14F06CEB01 +E0A239078003C03903C007803900E00E00EB783CEB0FE01F247DA226>I<B512F0380F80 +3C0007130FEC078015C0140315E0A615C014071580EC0F00143CEBFFF00180C7FCAE487E +EAFFFC1B227EA121>I<B512E0380F803C0007130E6E7E81140381A55D14075D020EC7FC +143CEBFFE0EB80708080141E140E140FA481A3168015C014073A0FC003C10039FFFC01E2 +C8127C21237EA124>82 D<3803F020380C0C60EA1802383001E0EA70000060136012E0A2 +1420A36C1300A21278127FEA3FF0EA1FFE6C7E0003138038003FC0EB07E01301EB00F0A2 +14707EA46C1360A26C13C07E38C8018038C60700EA81FC14247DA21B>I<007FB512F839 +780780780060141800401408A300C0140C00801404A400001400B3A3497E3801FFFE1E22 +7EA123>I<39FFFC07FF390FC000F86C4813701520B3A5000314407FA2000114806C7E90 +38600100EB3006EB1C08EB03F020237EA125>I<D8FFF0EB7FC0D81F80EB1F006CC7120C +7F00071408A26C6C5BA36C6C5BA26D136000001440A201785BA2137CD93C01C7FCA2EB1E +02A36D5AA2148CEB0788A2EB03D0A214F06D5AA26D5AA322237FA125>I<3BFFF03FFC03 +FE3B1F8007E000F86C486C48137017206E7ED807801540A24A7E2603C0021480A39039E0 +04780100011600A2EC083CD800F01402A2EC101E01785CA2EC200F013C5CA20260138890 +391E400790A216D090391F8003F0010F5CA2EC00016D5CA20106130001025C2F237FA132 +>I<397FF803FF390FE001F83907C000E06C6C5B00015CEBF001D800F890C7FCEB7802EB +7C04133EEB1E08EB1F10EB0FB0EB07A014C06D7E130180497EEB0278EB047CEB0C3EEB08 +1EEB101F496C7E140701407F496C7E1401D801007F486D7E5AD81F807F3AFFC003FFC022 +227FA125>I<D8FFF0EB7FC0D81F80EB1F00000F140C000714087F00035C6C6C5B7F0000 +5C6D13C0017C5BD93C01C7FC133EEB1E02EB1F06EB0F84EB078814D8EB03D014E01301AC +1303EB3FFE22227FA125>I<12FEA212C0B3B3A912FEA207317BA40E>91 +D<EA0804EA1008EA2010A2EA4020A2EA8040A4EAB85CEAFC7EA2EA7C3EEA381C0F0F7AA2 +18>I<12FEA21206B3B3A912FEA207317FA40E>I<120812101220A21240A21280A412B812 +FCA2127C1238060F7DA20E>96 D<EA1FE0EA3038EA780C130EEA30071200A313FFEA07C7 +EA1E07123C1278127000F01308A3130FEA7817383C2390380FC1E015157E9418>I<120E +12FE121E120EAB131FEB61C0EB8060380F0030000E1338143C141C141EA7141C143C1438 +000F1370380C8060EB41C038083F0017237FA21B>I<EA01FEEA0703380C0780121C3838 +03000078C7FC127012F0A712700078134012386C1380380C0100EA0706EA01F812157E94 +16>I<14E0130F13011300ABEA01F8EA0704EA0C02EA1C01EA38001278127012F0A71270 +12781238EA1801EA0C0238070CF03801F0FE17237EA21B>I<EA01FCEA0707380C038038 +1C01C01238007813E0EA700012F0B5FC00F0C7FCA512700078132012386C13406C138038 +070300EA00FC13157F9416>I<133E13E33801C780EA0387130748C7FCA9EAFFF80007C7 +FCB27FEA7FF0112380A20F>I<14703803F198380E1E18EA1C0E38380700A200781380A4 +00381300A2EA1C0EEA1E1CEA33F00020C7FCA212301238EA3FFE381FFFC06C13E0383000 +F0481330481318A400601330A2003813E0380E03803803FE0015217F9518>I<120E12FE +121E120EABEB1F80EB60C0EB80E0380F0070A2120EAF38FFE7FF18237FA21B>I<121C12 +3EA3121CC7FCA8120E127E121E120EB1EAFFC00A227FA10E>I<13E0EA01F0A3EA00E013 +00A81370EA07F012001370B3A51260EAF0E013C0EA6180EA3F000C2C83A10F>I<120E12 +FE121E120EABEB03FCEB01F014C01480EB02005B5B5B133813F8EA0F1CEA0E1E130E7F14 +80EB03C0130114E0EB00F014F838FFE3FE17237FA21A>I<120E12FE121E120EB3ADEAFF +E00B237FA20E>I<390E1FC07F3AFE60E183803A1E807201C03A0F003C00E0A2000E1338 +AF3AFFE3FF8FFE27157F942A>I<380E1F8038FE60C0381E80E0380F0070A2120EAF38FF +E7FF18157F941B>I<EA01FCEA0707380C0180381800C0003813E0481370A200F01378A7 +00701370007813F0003813E0381C01C0380E038038070700EA01FC15157F9418>I<EA0E +1F38FE61C0380E8060380F0070000E1338143CA2141EA7143CA21438000F1370380E80E0 +EB41C0EB3F0090C7FCA9EAFFE0171F7F941B>I<3801F82038070460EA0E02EA1C010038 +13E0EA7800A25AA71278A2EA3801121CEA0C02EA070CEA01F0C7FCA9EB0FFE171F7E941A +>I<EA0E3CEAFE46EA1E8FEA0F0F13061300120EAD120FEAFFF010157F9413>I<EA0F88EA +3078EA601812C01308A212E0EAF000127FEA3FE0EA0FF0EA01F8EA003CEA801C130CA212 +C01308EAE018EAD030EA8FC00E157E9413>I<1202A41206A3120E121E123EEAFFFCEA0E +00AB1304A6EA07081203EA01F00E1F7F9E13>I<000E137038FE07F0EA1E00000E1370AD +14F0A238060170380382783800FC7F18157F941B>I<38FF80FE381E00781430000E1320 +A26C1340A2EB80C000031380A23801C100A2EA00E2A31374A21338A3131017157F941A> +I<39FF8FF87F393E01E03C001CEBC01814E0000E1410EB0260147000071420EB04301438 +D803841340EB8818141CD801C81380EBD00C140E3900F00F00497EA2EB6006EB40022015 +7F9423>I<38FF83FE381F00F0000E13C06C1380EB8100EA0383EA01C2EA00E41378A213 +38133C134E138FEA0187EB0380380201C0000413E0EA0C00383E01F038FF03FE17157F94 +1A>I<38FF80FE381E00781430000E1320A26C1340A2EB80C000031380A23801C100A2EA +00E2A31374A21338A31310A25BA35B12F05B12F10043C7FC123C171F7F941A>I<383FFF +C038380380EA300700201300EA600EEA401C133C1338C65A5B12015B38038040EA07005A +000E13C04813805AEA7801EA7007B5FC12157F9416>I<B512FE1701808C18>I +E /FJ 6 121 df<EC01FCEC0FFF91383E07C091387001E09138E000F0494813F8494813 +7C49C7FC010E147EEB0C10EB1C180138147FA21370A213E0A348484813FEA25CED01FC14 +C09039C18003F82600C30013F001FEEB07E0017C130F90C713C0ED1F00153E15FC4A5AEC +03E0EC0FC0023FC7FC147CEB01F0495AEB0F80011EC8FC5B01701430491470485A485A48 +C812E05A000E140148EC03C0D81FFCEB0780393FFFE01FD8381FB51200D870075B01015B +486C5BEC3FF0EC0FC0283979B72C>50 D<147CEB03FF90380F838690381F01CF90383C00 +FF5B01F87F485A4848137E120749133E120F001F5C5B123FA290C75A5AA300FE495AA448 +495A1670A3913807C0E0140F127C141F91383FC1C0003C1377003E01E31380391E01C3C3 +3A0F0781C7003903FE00FED800F8137C242777A52C>97 D<EB0F803803FFC04813807EEA +001FA21400A4133EA45BA45BA4485AA4485AA4485AA4485AA448C7FCA4123EA45A130EA3 +485AA45BA2EA7870A2EA38E0EA1FC06C5A123D78BB16>108 D<D803E001FEEB03F83C07 +F003FF800FFE3C0E380F83C03E0F3D1C3C1C01E0700780903C1E3800F0E003C0003849EB +F1C04AEBF380D93FC0D9FF0013E00070495BA291C75A013E5CD8E07E0101EC07C0A2D800 +7C5CA2494948EB0F80A3F01F004848495AA2183EA24848495AF07C07A3484849C7EAF80E +A3F0F01C4848133E19181938197048C748EC70E0F03FC0000E0238EC1F00402779A546> +I<EB0380EB07C0A3EB0F80A4EB1F00A4133EA45B007FB5FCB6FC14FE3800F800A4485AA4 +485AA4485AA4485AA448C7FC141CA21438123E1430147014E0A2EB01C0381E0380EB0700 +EA0E0EEA07FCEA01F0183778B51D>116 D<903907E003F090391FF80FFC90393C3C1C1E +9038701E309039E00E703F3A01C00FE07FD8038013C00100147E48148000061538000E15 +00A24849C7FCA2C7FCA2143EA45CA45C1638A349481370121C003E15E0EA7E0300FEEC01 +C00107EB038026FC0678130039780E380E3938381C1C391FF00FF83907E007E028277CA5 +28>120 D E(cmti10)cvn 9.96265 /Fd 1 fstore end +%%EndProlog +%%BeginSetup +%%Feature: *Resolution 300dpi +TeXDict begin +%%PaperSize: A4 + +%%EndSetup +%%Page: 0 1 +0 0 bop 781 367 a FJ(mma2ltx)810 471 y FI(V)l(ersion)16 +b(1.23)730 619 y FH(Giusepp)r(e)i(Ghib\022)-30 b(o)636 +694 y FG(h)p FF(ghib)m(o@galile)m(o.p)m(olito.it)6 b +FG(i)760 810 y FH(June)20 b(21,)f(1995)34 1352 y FE(Mma2ltx)f +FI(is)g(a)g(program)g(whic)o(h)g(allo)o(ws)g(to)g(a)g +FD(Mathematica)f FI(user)h(to)g(include)f(the)h(graphics)g(pro-)-39 +1412 y(duced)d(b)o(y)h FD(Mathematica)f FI(in)h(a)g(L)575 +1406 y FC(a)599 1412 y FI(T)626 1427 y(E)654 1412 y(X)g(do)q(cumen)o(t) +f(using)h(o)o(wn)h(L)1173 1406 y FC(a)1197 1412 y FI(T)1224 +1427 y(E)1251 1412 y(X)f(fon)o(ts)g(and)h(sym)o(b)q(ols)e(for)i(lab)q +(els.)p eop +%%Page: 1 2 +1 1 bop -39 174 a FB(1)79 b(Intro)r(duction)-39 284 y +FD(Mathematica)21 b FI(has)j(p)q(erhaps)f(the)g(b)q(est)g(data)h +(plotting)f(to)q(ol)h(curren)o(tly)d(a)o(v)m(ailable,)i(but)h(its)e +(con)o(trol)-39 344 y(o)o(v)o(er)c(mathematical)e(sym)o(b)q(ols)j(and)h +(form)o(ul\032)e(inside)g(graphics)i(is)g(v)o(ery)e(p)q(o)q(or)1454 +326 y FA(1)1475 344 y FI(:)28 b(it)19 b(is)g(limited)d(to)k(the)-39 +404 y(c)o(haracters)c(a)o(v)m(ailable)f(in)h(the)g(fon)o(t)g(`Sym)o(b)q +(ol'.)34 464 y(T)61 475 y(E)88 464 y(X)i(instead)g(is)g(v)o(ery)f(p)q +(o)o(w)o(erful)g(in)h(this)g(sub)s(ject)g(but)g(has)h(no)f(data)h +(plotting)f(capabilit)o(y:)24 b(it)18 b(can)-39 525 y(only)e(include)f +(external)g(graphics.)34 585 y FE(mma2ltx)20 b FI(is)e(the)h(\\bridge") +h(across)g(the)f(t)o(w)o(o)g(w)o(orlds:)28 b(it)18 b(allo)o(ws)h(to)h +(use)f(an)o(y)g(L)1537 579 y FC(a)1561 585 y FI(T)1588 +600 y(E)1616 585 y(X)f(sym)o(b)q(ol)g(and)-39 645 y(fon)o(t)e(as)h(lab) +q(els)f(in)g(graphics)g(created)g(b)o(y)g FD(Mathematica)p +FI(.)-39 811 y FB(2)79 b(What)26 b(do)r(es)h Fz(mma2ltx)e +FB(do?)-39 921 y FE(Mma2ltx)15 b FI(reads)f(a)h(P)o(ostScript)g +(graphic)f(\014le)g(generated)h(b)o(y)f(the)g FD(Mathematica)f +FI(command)g(`)p Fy(Display)p FI(')1903 903 y FA(2)-39 +981 y FI(and)18 b(writes)f(t)o(w)o(o)g(output)h(\014les;)f(the)g +(\014rst)h(one)g(is)f(a)h(L)951 975 y FC(a)975 981 y +FI(T)1002 996 y(E)1029 981 y(X)f(\014le)g(and)h(con)o(tains)f(ev)o(ery) +f(string)i(of)g(text)f(of)-39 1041 y(the)e(original)g(graphics)h +(\014le)f(in)g(L)557 1035 y FC(a)581 1041 y FI(T)608 +1056 y(E)636 1041 y(X)g(form;)f(the)h(second)h(is)g(an)g(EPSF)f +(\014le:)21 b(it)15 b(substan)o(tially)g(con)o(tains)-39 +1101 y(the)j(same)g(things)h(of)g(the)f(original)h(P)o(ostScript)f +(\014le,)g(except)g(it)g(has)i(b)q(een)e(stripp)q(ed)h(of)g(an)o(y)g +(string)g(of)-39 1162 y(text.)-39 1328 y FB(3)79 b(Requirements)-39 +1438 y FI(In)16 b(order)h(to)h(include)d FD(Mathematica)h +FI(graphics)h(pro)q(cessed)h(b)o(y)e FE(mma2ltx)i FI(in)o(to)e(L)1467 +1432 y FC(a)1491 1438 y FI(T)1518 1453 y(E)1546 1438 +y(X)g(do)q(cumen)o(ts)g(y)o(ou)-39 1498 y(need)f(L)86 +1492 y FC(a)110 1498 y FI(T)137 1513 y(E)165 1498 y(X)h(\(ob)o(vious\)) +g(and)h(the)f(Rokic)o(ki's)e Fy(dvips)949 1480 y FA(3)983 +1498 y Fy(dvi)h FI(pro)q(cessor.)34 1558 y(Files)i(pro)q(cessed)i(b)o +(y)f FE(mma2ltx)h FI(w)o(ere)f(tested)g(under)g(L)1055 +1552 y FC(a)1079 1558 y FI(T)1106 1573 y(E)1134 1558 +y(X)g(v2.09)g(\(25)i(Marc)o(h)e(1992\))i(and)f Fy(dvips)-39 +1618 y FI(v5.55)d(\(and)h(new)o(er\).)k(The)16 b(graphics)g(\014les)g +(used)h(w)o(ere)e(created)h(with)g(Mathematica)1559 1600 +y FA(4)1593 1618 y FI(v2.2.)-39 1785 y FB(4)79 b +(Distribution/Disclaime)o(r)-39 1894 y FE(mma2ltx)18 +b FI(is)f(sharew)o(are.)26 b(If)17 b(y)o(ou)g(\014nd)h(it)f(useful)g +(\(or)h(con)o(tin)o(ue)f(using)h(it)f(longer)h(than)g(a)g(w)o(eek\))e +(please)-39 1954 y(consider)e(pa)o(ying)h(the)g(fee)f(\(the)h(easiest)g +(w)o(a)o(y)g(is)f(simply)f(to)j(send)f(the)g(cash)g(in)g(an)g(en)o(v)o +(elop)q(e\))f(of)h(US)g($15)-39 2014 y(\(US)g(Dollars\),)i(or)f(20)h +(DM)f(\(German)g(Marks\))g(to)h(the)f(author)h(\(see)f +Fx(x)p FI(14)h(for)f(the)g(author's)h(address\).)34 2075 +y FE(mma2ltx)g FI(is)f(Cop)o(yrigh)o(t)523 2073 y(c)509 +2075 y Fx(\015)g FI(1994)h(b)o(y)f(Giusepp)q(e)h(Ghib\022)-24 +b(o.)34 2135 y(This)17 b(soft)o(w)o(are)h(is)f(pro)o(vided)g(\\as)h +(is")g(with)f(no)h(explicit)d(or)j(implicit)c(w)o(arran)o(t)o(y)j(of)h +(an)o(y)g(kind.)24 b(Y)l(ou)-39 2195 y(are)16 b(using)g(it)g(at)h(y)o +(our)f(o)o(wn)h(risk.)34 2255 y(The)e(author)i(disclaims)d(an)o(y)h +(liabilit)o(y)e(for)j(damages,)g(including)e(an)o(y)i(direct,)e +(indirect,)g(inciden)o(tal,)-39 2315 y(sp)q(ecial,)d(exemplary)l(,)e +(or)j(consequen)o(tial)e(damages)h(arising)h(in)f(an)o(y)g(w)o(a)o(y)g +(out)h(of)f(the)g(use)h(of)f(this)g(soft)o(w)o(are,)-39 +2376 y(ev)o(en)k(if)g(advised)h(of)h(the)f(p)q(ossibilit)o(y)f(of)i +(suc)o(h)f(damage.)p -39 2419 784 2 v 17 2450 a Fw(1)35 +2465 y Fv(Mathematica)d Fu(supp)q(orts)j(output)f(in)f(T)668 +2474 y(E)691 2465 y(X)h(form,)d(but)j(this)f(feature)i(is)e(only)g(for) +g(form)o(ul\032)e(and)i(do)q(esn't)h(regard)g(the)-39 +2515 y(graphics.)17 2550 y Fw(2)35 2565 y Fu(The)g(`)p +Ft(Display)p Fu(')c(command)g(sa)o(v)o(es)k(a)e(ra)o(w)h(P)o(ostScript) +h(represen)o(tation)g(of)e(a)h(graphic)g(in)f(a)h(\014le.)17 +2599 y Fw(3)35 2614 y Ft(dvips)h Fu(is)i(a)e(con)o(v)o(erter)j(from)d +Ft(dvi)g Fu(to)h(P)o(ostScript)h(\014les.)26 b(It)16 +b(w)o(as)g(dev)o(elop)q(ed)h(b)o(y)f(T.)g(Rokic)o(ki)f(and)h(is)g(a)o +(v)n(ailable)e(via)-39 2664 y(anon)o(ymous)e(FTP)i(from)e +Ft(labrea.stanford.e)o(du)f Fu(or)j(in)f(an)o(y)g(CT)m(AN)h(site.)17 +2699 y Fw(4)35 2714 y Fv(Mathematica)f Fu(is)h(Cop)o(yrigh)o(t)536 +2713 y(c)525 2714 y Fs(\015)o Fu(1988,)e(1995)h(b)o(y)h(W)m(olfram)d +(Researc)o(h,)j(Inc.)928 2914 y FI(1)p eop +%%Page: 2 3 +2 2 bop 34 166 a FI(This)14 b(soft)o(w)o(are)g(ma)o(y)e(b)q(e)j(freely) +d(distributed)h(and)i(copied)f(as)g(long)h(as)f(the)g(follo)o(wing)g +(conditions)g(are)-39 226 y(ac)o(kno)o(wledged:)33 328 +y Fx(\017)25 b FI(All)14 b(parts)j(of)g(the)f(program)g(and)h(the)f(do) +q(cumen)o(tation)f(m)o(ust)g(b)q(e)h(left)g(in)o(tact)f(in)h(an)o(y)g +(w)o(a)o(ys.)33 430 y Fx(\017)25 b FI(The)15 b(distribution)h(of)g +(single)g(parts)g(is)g(not)g(allo)o(w)o(ed.)k(The)c(repac)o(king)g(of)g +(this)g(distribution)f(with)83 490 y(other)h(pac)o(k)o(ers/arc)o(hiv)o +(ers)e(is,)i(ho)o(w)o(ev)o(er,)e(allo)o(w)o(ed.)-39 656 +y FB(5)79 b(Using)26 b Fz(mma2ltx)-39 766 y FI(T)l(o)16 +b(use)h FE(mma2ltx)p FI(,)f(just)g(t)o(yp)q(e)166 867 +y Fy(C:\\>)24 b(mma2ltx)f(mypic.ps)-39 969 y FI(where)16 +b Fy(mypic.ps)d FI(is)k(the)f(output)h(of)g(the)g FD(Mathematica)p +FI('s)d(primitiv)o(e)f(`)p Fy(Display)p FI('.)19 b FE(mma2ltx)e +FI(supp)q(orts)-39 1029 y(man)o(y)d(options,)j(as)g(describ)q(ed)e(in)h +(the)g(next)g(section.)-39 1196 y FB(6)79 b(Command)26 +b(Line)f(Options)-39 1305 y FI(Options)13 b(are)f(sp)q(eci\014ed)g(on)i +(the)e(command)f(line)g(using)i(a)g(dash)h(`)p Fy(-)p +FI(')d(follo)o(w)o(ed)h(b)o(y)g(a)h(letter.)19 b(No)13 +b(spaces)g(are)-39 1365 y(allo)o(w)o(ed)j(b)q(et)o(w)o(een)g(the)g(`)p +Fy(-)p FI(')g(and)h(the)g(letter.)22 b(The)17 b(letter)f(ma)o(y)f(b)q +(e)i(follo)o(w)o(ed)f(b)o(y)g(an)i(argumen)o(t.)k(Spaces)-39 +1426 y(b)q(et)o(w)o(een)15 b(the)h(letter)f(and)i(the)f(argumen)o(t)f +(are)h(allo)o(w)o(ed)g(instead.)34 1486 y(Here)h(follo)o(ws)h(a)g +(description)f(of)i(the)f(options)g(supp)q(orted)h(b)o(y)f +FE(mma2ltx)p FI(.)27 b(F)l(acultativ)o(e)17 b(argumen)o(ts)-39 +1546 y(are)f(indicated)f(in)h(the)g(`)p Fr(T)-5 b(emplate)p +FI(')13 b(enclosed)j(b)q(et)o(w)o(een)f(square)i(brac)o(k)o(ets)e([)p +Fq(:)8 b(:)g(:)f FI(].)34 1606 y(Note)16 b(that)g(ev)o(ery)f(string)i +(in)f(the)g(command)e(line)i(whic)o(h)f(is)h(not)h(an)g(option)g +(argumen)o(t)e(is)h(tak)o(en)g(as)-39 1666 y(an)g(input)g(\014le.)-39 +1811 y Fp(6.1)65 b(Option)22 b Fo(-?)-39 1903 y FI(Option)16 +b Fy(-?)f FI(\()p Fy(-"?")g FI(on)i(Unix\))e(sho)o(ws)i(the)f(follo)o +(wing)g(help)g(messages:)-39 2005 y Fy(mma2ltx)23 b(v1.23)g(-)j +(Copyright)c(\(C\))j(1994,)e(1995)i(by)f(Giuseppe)f(Ghibo`)-39 +2125 y(Usage:)g(mma2ltx)g([<options>)o(])g(<filename)o(\(s\))o(>)g +([<options)o(>])-39 2185 y(Where)g(<options>)g(is)i(one)f(or)h(more)f +(of:)12 2306 y(-?)50 b(Show)25 b(these)e(messages)12 +2366 y(-d)50 b(Don't)24 b(keep)g(the)h(aspect)e(ratio)12 +2426 y(-n)50 b(Deactivate)22 b(automatic)h($...$)g(enclosing)12 +2486 y(-b)50 b(Enclose)23 b(every)h(string)g(into)g(a)h(white)f(box)g +(\(default)f(=)i(transpar.)e(box\))12 2547 y(-p[<str>])f(Include)h(the) +i(Mathemati)o(ca)d(PostScript)g(prologue)h(in)i(the)f(.EPS)h(file)12 +2607 y(-h[<dimen>)o(])d(Set)j(picture)e(height)g(to)i(<dimen>)e +(\(default)g(=)i(100bp\))12 2667 y(-w[<dimen>)o(])d(Set)j(picture)e +(width)49 b(to)25 b(<dimen>)e(\(default)g(=)i(161bp\))12 +2727 y(-f[<dimen>)o(])d(Add)j(an)g(\\fbox)f(to)h(the)f(picture)f +(\(\\fboxsep=)o(<di)o(men)o(>\))12 2787 y(-u<unit>)g(Set)h(all)h +(dimension)o(s)e(in)h(the)h(unit)f(<unit>)928 2914 y +FI(2)p eop +%%Page: 3 4 +3 3 bop 12 166 a Fy(-s<cmd>)49 b(Set)24 b(the)h(font)f(size)g(with)g +(the)h(TeX)f(command)f(<cmd>)12 226 y(-o<str>)49 b(Output)23 +b(filename)12 286 y(-e<str>)49 b(Change)23 b(only)h(MMA)h(labels)e +(which)h(begin)g(with)g(<str>)12 347 y(-c\(sx,sy\)=)o(\(n)o(ews)o(x,n)o +(ew)o(sy\))o(\(<d)o(ime)o(n>)o(,<d)o(ime)o(n>\))e(\(change)h +(alignment\))12 407 y(-a[<num>:<)o(nu)o(m>:)o(<nu)o(m>)o(])g(Draw)h +(arrows)f(on)i(x)h(and)e(y)h(axes)12 527 y(<dimen>)e(=)i(a)g(number)f +(followed)f(by)h(one)h(of)g(TeX's)f(unit)g(\(e.g.)g(10.3cm\))12 +587 y(<num>)75 b(=)25 b(a)g(number)f(\(e.g.)g(0.0125\))12 +648 y(<unit>)49 b(=)25 b(a)g(TeX's)f(unit)g(\(e.g.)g(cm\))12 +708 y(<cmd>)75 b(=)25 b(a)g(TeX)g(command)e(without)g(the)i(backslash)d +('\\')12 768 y(<str>)75 b(=)25 b(a)g(text)g(string)-39 +888 y(Example:)191 949 y(mma2ltx)e(-sfootnotes)o(ize)f(-w5in)i(pic1.ps) +f(pic2.ps)-39 1009 y(processes)f(the)i(files)g(`pic1.ps')f(and)h +(`pic2.ps'.)e(The)j(width)e(of)i(the)g(pictures)-39 1069 +y(will)f(be)h(5)g(inch)f(and)h(\\footnote)o(siz)o(e)d(will)j(be)g(used) +f(as)h(LaTeX)e(command)g(to)-39 1129 y(set)h(the)h(font)f(size.)-39 +1274 y Fp(6.2)65 b(Options)22 b Fo(-w)h Fp(and)e Fo(-h)-39 +1366 y Fr(T)-5 b(emplate:)19 b Fy(-w)p Fx(h)p FE(dimen)t +Fx(i)220 1426 y Fy(-h)p Fx(h)p FE(dimen)t Fx(i)-39 1499 +y FI(Options)j Fy(-w)f FI(and)h Fy(-h)f FI(m)o(ust)f(b)q(e)i(used)g(to) +g(sp)q(ecify)f(resp)q(ectiv)o(ely)e(the)j(width)f(and)i(the)e(heigh)o +(t)g(of)h(the)-39 1559 y(picture.)27 b(The)18 b(argumen)o(t)f +Fx(h)p FE(dimen)t Fx(i)j FI(is)e(a)h(n)o(um)o(b)q(er)e(follo)o(w)o(ed)g +(b)o(y)h(one)h(of)g(T)1376 1570 y(E)1403 1559 y(X's)f(unit)g(\(i.e.)27 +b(one)18 b(of)h Fy(mm)p FI(,)-39 1619 y Fy(cm)p FI(,)g +Fy(pt)p FI(,)g Fy(bp)p FI(,)h Fy(pc)p FI(,)f Fy(in)p +FI(,)h Fy(dd)p FI(,)f Fy(cc)p FI(,)h Fy(sp)p FI(\).)31 +b(F)l(or)20 b(example,)d(`)p Fy(-w10.3cm)p FI(')f(sp)q(eci\014es)k(a)g +(10)p Fq(:)p FI(3)8 b(cm)19 b(wide)g(picture.)-39 1679 +y(Note)12 b(that)i(`)p Fy(-w)25 b(10.3cm)p FI(',)10 b(`)p +Fy(-w=10.3cm)p FI(')g(and)j(`)p Fy(-w:10.3cm)p FI(')c(are)14 +b(accepted)e(to)q(o,)j(but)e(`)p Fy(-w10.3)23 b(cm)p +FI(')12 b(isn't)-39 1739 y(accepted)g(\(note)h(the)f(space)h(after)g +(the)f(n)o(um)o(b)q(er)g Fy(10)p FI(\).)19 b(Note)12 +b(also)i(that)f(w)o(e)f(ma)o(y)g(sp)q(ecify)g(only)g(one)h(of)h(')p +Fy(-w)p FI(')-39 1800 y(or)g(')p Fy(-h)p FI(':)19 b(the)14 +b(other)g(dimension)f(is)h(calculated)f(to)i(k)o(eep)e(the)h +FD(Mathematica)f FI(asp)q(ect)h(ratio.)21 b(If)14 b(either)f(the)-39 +1860 y(width)k(and)h(the)f(heigh)o(t)g(are)h(sp)q(eci\014ed,)f(the)g +(picture)f(will)h(ha)o(v)o(e)g(\(appro)o(ximately\))e(those)j +(dimensions,)-39 1920 y(but)12 b(the)g(inside)g(graphic)h(will)e(ha)o +(v)o(e)h(dimensions)f(suc)o(h)h(to)h(\014t)g(one)f(of)h(heigh)o(t)f(or) +h(width,)g(according)f(to)h(the)-39 1980 y(asp)q(ect)j(ratio.)22 +b(F)l(or)16 b(instance,)g(sp)q(ecifying)f(on)i(the)f(command)e(line)h +(`)p Fy(-w10cm)23 b(-h10cm)p FI(')14 b(and)i(the)g(asp)q(ect)-39 +2040 y(ratio)61 2022 y FA(5)100 2040 y FI(is)k(0)p Fq(:)p +FI(62)h(then)f(the)f(picture)g(will)g(b)q(e)h(10)8 b(cm)13 +b Fx(\002)g FI(10)8 b(cm)20 b(large)f(\(this)h(is)g(the)f(dimension)g +(\\visible")-39 2101 y(to)h(L)36 2095 y FC(a)60 2101 +y FI(T)87 2116 y(E)115 2101 y(X\),)f(but)i(the)f(inside)f(graphic)i +(will)e(b)q(e)i(10)8 b(cm)19 b(wide)h(and)h(6)p Fq(:)p +FI(2)8 b(cm)20 b(high.)33 b(If)20 b(w)o(e)g(ha)o(v)o(e)g(instead)-39 +2161 y(`)p Fy(-w10cm)j(-h3cm)p FI(',)18 b(the)h(picture)g(will)g(b)q(e) +h(10)8 b(cm)13 b Fx(\002)g FI(3)8 b(cm)19 b(large)g(but)h(the)g(inside) +f(graphic)h(will)f(b)q(e)h(just)-39 2221 y(4)p Fq(:)p +FI(84)8 b(cm)14 b(wide)g(and)h(3)8 b(cm)14 b(high.)21 +b(If)14 b(w)o(e)g(don't)h(w)o(an)o(t)g(to)g(k)o(eep)e(the)i +FD(Mathematica)e FI(asp)q(ect)i(ratio)g(w)o(e)f(m)o(ust)-39 +2281 y(use)i(the)g Fy(-d)f FI(option.)22 b(Default)16 +b(width)g(is)g(161)8 b(bp)r(;)16 b(default)g(heigh)o(t)f(is)i(100)8 +b(bp)q(.)-39 2426 y Fp(6.3)65 b(Option)22 b Fo(-d)-39 +2518 y FI(Suppress)16 b(the)g(asp)q(ect)h(ratio)g(k)o(eeping.)p +-39 2562 784 2 v 17 2592 a Fw(5)35 2607 y Fu(The)e(asp)q(ect)g(ratio)e +(is)h(heigh)o(t)p Fn(=)p Fu(width)f(in)h(scaled)g(co)q(ordinates)h +(\(i.e.,)d(from)g(0)i(to)g(1\).)928 2914 y FI(3)p eop +%%Page: 4 5 +4 4 bop -39 166 a Fp(6.4)65 b(Option)22 b Fo(-n)-39 258 +y FI(By)14 b(default)h FE(mma2ltx)h FI(encloses)e(ev)o(ery)g(string)h +(grabb)q(ed)h(from)e(the)h FD(Mathematica)f FI(P)o(ostScript)h(\014le)f +(in)o(to)-39 319 y(a)h Fy($)p Fq(:)8 b(:)g(:)f Fy($)15 +b FI(pair.)21 b(Sp)q(ecifying)14 b(the)g Fy(-n)h FI(option)g(on)h(the)e +(command)f(line,)h(this)h(b)q(eha)o(viour)g(will)f(b)q(e)h(disabled.) +-39 463 y Fp(6.5)65 b(Option)22 b Fo(-b)-39 555 y FI(By)17 +b(default)h(ev)o(ery)f(string)i(is)f(placed)g(on)h(the)f(graphic)g(as)h +(if)f(it)g(w)o(as)h(enclosed)e(in)h(a)h(transparen)o(t)g(b)q(o)o(x.)-39 +616 y(Using)14 b(this)g(option)g(ev)o(ery)f(string)h(will)f(b)q(e)i(no) +f(longer)g(\\transparen)o(t",)i(but)e(rather)g(enclosed)g(in)g(a)g +(white)-39 676 y(b)q(o)o(x)19 b(ha)o(ving)g(the)g(same)f(size)g(\(see)h +(the)f(string)i(\\some)e(text")h(sho)o(wn)h(in)e(Fig.)h(4)g(for)h(the)f +(b)q(eha)o(viour)g(of)-39 736 y(this)d(option\).)-39 +880 y Fp(6.6)65 b(Option)22 b Fo(-o)-39 973 y Fr(T)-5 +b(emplate:)19 b Fy(-o)p Fx(h)p FE(\014lename)t Fx(i)-39 +1045 y FI(Sp)q(ecify)g(the)h(output)i(\014lename.)32 +b(By)20 b(default)g FE(mma2ltx)h FI(uses)g(as)g(output)g(names)e(the)i +(names)e(of)i(the)-39 1106 y(input)13 b(\014les)h(stripp)q(ed)g(of)g +(the)f(extension)h(to)g(whic)o(h)f(app)q(end)i(the)e(prop)q(er)i +(\014le)e(extension)g(\(i.e.,)f(`)p Fy(.tex)p FI(')g(for)-39 +1166 y(the)k(L)57 1160 y FC(a)81 1166 y FI(T)108 1181 +y(E)135 1166 y(X)g(\014le)g(and)g(`)p Fy(.eps)p FI(')e(for)j(the)f +(EPSF)h(\014le\).)j(The)d Fy(-o)e FI(option)i(allo)o(ws)g(y)o(ou)f(to)g +(sp)q(ecify)g(a)h(di\013eren)o(t)-39 1226 y(name)h(for)h(the)g(EPSF)h +(P)o(ostScript)f(output)h(\014le.)29 b(In)19 b(this)g(case)g(the)g +(name)f(of)i(the)f(L)1559 1220 y FC(a)1583 1226 y FI(T)1610 +1241 y(E)1637 1226 y(X)g(\014le)g(will)f(b)q(e)-39 1286 +y Fx(h)p FE(\014lename)t Fx(i)p FI(.)p Fy(tex)f FI(an)o(yw)o(a)o(y)l(.) +-39 1431 y Fp(6.7)65 b(Option)22 b Fo(-f)-39 1523 y Fr(T)-5 +b(emplate:)19 b Fy(-f)c FI([)p Fx(h)p FE(dimen)t Fx(i)p +FI(])-39 1596 y(The)24 b Fy(-f)f FI(option)h(tells)f +FE(mma2ltx)i FI(to)f(enclose)f(the)h(whole)g(picture)f(in)o(to)h(an)g +Fy(\\fbox)p FI(.)42 b(The)24 b(optional)-39 1656 y(argumen)o(t)f(is)h +(the)g(amoun)o(t)g(of)h Fy(\\fboxsep)p FI(;)g(b)o(y)f(default)g +FE(mma2ltx)h FI(assumes)e Fy(\\fboxsep=0p)o(t)p FI(.)43 +b(F)l(or)-39 1716 y(instance)16 b(the)g(command)166 1818 +y Fy(mma2ltx)23 b(-f5pt)g(-w8cm)h(mypic.ps)-39 1919 y +FI(pro)q(duces)13 b(a)h(picture)e(8)c(cm)k(wide,)h(enclosed)g(in)o(to)f +Fy(\\fbox)p FI(;)g(from)g(eac)o(h)h(edge)g(of)h(the)e(b)q(o)o(x)i(and)g +(its)e(con)o(ten)o(ts)-39 1980 y(there)j(are)i(5)8 b(pt.)-39 +2124 y Fp(6.8)65 b(Option)22 b Fo(-s)-39 2216 y Fr(T)-5 +b(emplate:)19 b Fy(-s)p Fx(h)p FE(c)n(ontr)n(ol)e(se)n(quenc)n(e)t +Fx(i)-39 2289 y FI(This)22 b(option)g(sp)q(eci\014es)f(a)i(L)488 +2283 y FC(a)512 2289 y FI(T)539 2304 y(E)566 2289 y(X)f(fon)o(t-size)f +(con)o(trol)g(sequence)g(to)h(c)o(hange)g(the)g(size)f(of)h(the)g +(picture)-39 2349 y(lab)q(els.)e(Note)15 b(that)g FE(mma2ltx)h +FI(do)q(esn't)f(c)o(hec)o(k)e(if)h(the)h Fx(h)p FE(c)n(ontr)n(ol)h(se)n +(quenc)n(e)t Fx(i)h FI(is)e(a)g(v)m(alid)g(L)1571 2343 +y FC(a)1595 2349 y FI(T)1622 2364 y(E)1649 2349 y(X)f(command.)-39 +2409 y(So)i(b)q(e)h(careful.)34 2470 y(Generally)f(a)h(L)309 +2464 y FC(a)333 2470 y FI(T)360 2485 y(E)388 2470 y(X)f(fon)o(t-size)h +(command)e(ma)o(y)g(b)q(e)j(one)f(of)g Fy(tiny)p FI(,)f +Fy(scriptsiz)o(e)p FI(,)e Fy(footnotes)o(ize)o FI(,)-39 +2530 y Fy(normalsiz)o(e)p FI(,)i Fy(large)p FI(,)h Fy(Large)p +FI(,)g Fy(LARGE)p FI(,)g Fy(huge)p FI(,)h Fy(Huge)p FI(.)27 +b(No)19 b(leading)g(bac)o(kslash)g(is)f(needed)h(\(y)o(ou)f(m)o(ust)-39 +2590 y(use)e Fy(-sfootnote)o(si)o(ze)d FI(instead)j(of)h +Fy(-s\\footno)o(tes)o(ize)o FI(\).)34 2650 y(By)j(default)g(the)g +(picture)g(uses)g(the)h(L)749 2644 y FC(a)773 2650 y +FI(T)800 2665 y(E)827 2650 y(X)f(curren)o(t)g(fon)o(t)g(size.)33 +b(Note)20 b(that)h(this)g(command)d(will)-39 2710 y(a\013ect)e(size)f +(the)h(of)h Fr(all)f FI(the)g(strings)g(con)o(tained)g(in)g(the)g +(picture.)928 2914 y(4)p eop +%%Page: 5 6 +5 5 bop -39 166 a Fp(6.9)65 b(Option)22 b Fo(-u)-39 258 +y Fr(T)-5 b(emplate:)19 b Fy(-u)p Fx(h)p FE(T)324 269 +y(E)350 258 y(X's)e(unit)5 b Fx(i)-39 331 y FI(The)14 +b Fy(-u)g FI(option)h(sp)q(eci\014es)f(the)g(unit)g(of)h(measure)e(of)i +(quan)o(tities)e(con)o(tained)h(in)g(the)g Fy(.tex)f +FI(\014le)h(generated)-39 391 y(b)o(y)k FE(mma2ltx)p +FI(.)29 b(Also)18 b(the)h(messages)f(sho)o(wn)i(during)e(L)981 +385 y FC(a)1005 391 y FI(T)1032 406 y(E)1060 391 y(X)g(and)h +FE(mma2ltx)h FI(pro)q(cessing)f(will)f(use)g(that)-39 +451 y(unit.)-39 595 y Fp(6.10)65 b(Option)22 b Fo(-p)-39 +688 y Fr(T)-5 b(emplate:)19 b Fy(-p)p FI([)p Fx(h)p FE(pr)n(olo)n(gue)d +(\014le)t Fx(i)p FI(])34 761 y(By)i(default)g(the)h(EPSF)g(\014le)f +(pro)q(duced)i(b)o(y)e FE(mma2ltx)h FI(do)q(esn't)h(con)o(tain)e(the)h +FD(Mathematica)e FI(P)o(ost-)-39 821 y(Script)g(prologue)h(\(i.e.)24 +b(it)17 b(cannot)h(b)q(e)g(prin)o(ted)f(as)h(is\).)25 +b(In)17 b(fact)h(this)g(prologue)g(is)f(included)g(only)g(once)-39 +881 y(in)e(the)h(\014nal)h(P)o(ostScript)f(\014le)f(pro)q(duced)i(b)o +(y)f Fy(dvips)p FI(.)34 941 y(The)21 b Fx(h)p FE(pr)n(olo)n(gue)h +(\014le)t Fx(i)g FI(is)f(an)g(optional)h(argumen)o(t)e(and)h(allo)o(ws) +g(to)g(sp)q(ecify)g(an)g(alternate)g FD(Mathe-)-39 1001 +y(matica)16 b FI(prologue)j(\014le)f(\(e.g.)27 b(a)18 +b(new)o(er)g(prologue)h(\014le\).)27 b(T)l(o)18 b(obatin)h(a)g +(prologue)g(\014le)e(y)o(ou)h(can)h(use)f(the)-39 1061 +y(program)e Fy(extpro)p FI(.)j(See)c Fx(x)q FI(10)i(for)f(further)g +(details.)34 1122 y(Using)24 b(this)f(option)i(the)e(EPSF)i(\014le)e +(pro)q(duced)h(b)o(y)g FE(mma2ltx)g FI(will)f(con)o(tain)h(the)f +FD(Mathematica)-39 1182 y FI(prologue)16 b(\014le.)21 +b(This)16 b(ma)o(y)e(b)q(e)i(v)o(ery)f(useful)h(for)g(some)f +Fy(dvi)g FI(preview)o(er)g(with)g(capabilit)o(y)g(to)i(sho)o(w)f(P)o +(ost-)-39 1242 y(Script)f(sp)q(ecials.)-39 1386 y Fp(6.11)65 +b(Option)22 b Fo(-c)-39 1478 y Fr(T)-5 b(emplate:)19 +b Fy(-c)p Fx(h)p FI(\()p Fq(s)339 1485 y Fm(x)360 1478 +y Fq(;)8 b(s)405 1485 y Fm(y)426 1478 y FI(\))14 b(=)f(\()p +Fq(s)552 1460 y Fl(0)552 1491 y Fm(x)574 1478 y Fq(;)8 +b(s)619 1460 y Fl(0)619 1491 y Fm(y)640 1478 y FI(\)\()p +Fq(dimen)815 1485 y Fm(x)836 1478 y Fq(;)g(dimen)995 +1485 y Fm(y)1015 1478 y FI(\))p Fx(i)34 1551 y FI(The)18 +b Fy(-c)f FI(option)i(can)f(b)q(e)g(used)h(to)f(o)o(v)o(erride)f(a)h(p) +q(eculiar)g(b)q(eha)o(viour)g(of)g FD(Mathematica)p FI('s)e(primitiv)o +(e)-39 1611 y Fy(Text)p FI(.)37 b(T)l(o)22 b(place)g(text,)g +FE(mma2ltx)h FI(normally)d(uses)j(the)f(same)f(con)o(v)o(en)o(tions)f +(of)j(the)f FD(Mathematica)p FI('s)-39 1671 y(primitiv)n(e)13 +b(`)p Fy(Text)p FI(':)19 b(reference)c(p)q(oin)o(t)h(\()p +Fq(x;)8 b(y)r FI(\))15 b(is)h(realized)f(as)i(follo)o(ws:)33 +1771 y Fx(\017)25 b FI(The)16 b(text)f(string)i(is)f(placed)g(in)o(to)g +(a)g(b)q(o)o(x)h(ha)o(ving)f(the)g(same)f(size.)33 1872 +y Fx(\017)25 b FI(An)17 b(o\013set)i(\()p Fq(s)337 1879 +y Fm(x)359 1872 y Fq(;)8 b(s)404 1879 y Fm(y)424 1872 +y FI(\))18 b(in)g(the)f(b)q(ounding)i(b)q(o)o(x)f(co)q(ordinates)h +(system)e(\(see)g(the)h(Fig.)f(1\))h(determines)83 1932 +y(where)d(the)h(reference)f(p)q(oin)o(t)h(go)q(es.)p +1182 2297 709 2 v 1849 2296 a Fk(-)p 1535 2532 2 473 +v 1536 2102 a(6)p 1356 2177 361 4 v 1356 2413 4 237 v +1385 2327 a Fj(T)-9 b(ext)1631 2269 y(1)p 1631 2307 52 +2 v 1632 2387 a Fi(x)p 1713 2413 4 237 v 1356 2416 361 +4 v 1713 2177 a Fh(r)1690 2160 y Fg(\(1)p Ff(;)6 b Fg(1\))1713 +2296 y Fh(r)1725 2284 y Fg(\(1)p Ff(;)g Fg(0\))1713 2414 +y Fh(r)1678 2445 y Fg(\(1)p Ff(;)g Fe(\000)p Fg(1\))1536 +2414 y Fh(r)1548 2445 y Fg(\(0)p Ff(;)g Fe(\000)p Fg(1\))1359 +2414 y Fh(r)1288 2445 y Fg(\()p Fe(\000)p Fg(1)p Ff(;)g +Fe(\000)p Fg(1\))1359 2296 y Fh(r)1254 2284 y Fg(\()p +Fe(\000)p Fg(1)p Ff(;)g Fg(0\))1359 2177 y Fh(r)1300 +2160 y Fg(\()p Fe(\000)p Fg(1)p Ff(;)g Fg(1\))1536 2177 +y Fh(r)1548 2160 y Fg(\(0)p Ff(;)g Fg(1\))1845 2330 y +Fq(s)1868 2337 y Fm(x)1481 2081 y Fq(s)1504 2088 y Fm(y)1152 +2634 y FI(Figure)11 b(1:)19 b(Bounding)12 b(b)q(o)o(x)g(co)q +(ordinates.)34 2032 y(F)l(or)k(instance)g(the)g(o\013set)g(\()p +Fx(\000)p FI(1)p Fq(;)8 b FI(1\))17 b(means)e(that)h(the)g(b)q(o)o(x) +-39 2092 y(con)o(taining)h(the)h(string)g(is)f(placed)g(with)h(the)f(p) +q(oin)o(t)h(\()p Fx(\000)p FI(1)p Fq(;)8 b FI(1\))-39 +2152 y(at)17 b(the)f(reference)g(p)q(oin)o(t)h(\()p Fq(x;)8 +b(y)r FI(\),)15 b(i.e.)22 b(left)16 b(and)i(top)f(aligned.)-39 +2213 y(If)i(the)g(o\013set)i(is)f(\(0)p Fq(;)8 b FI(0\))20 +b(then)g(the)f(b)q(o)o(x)h(is)g(cen)o(tered)e(on)j(the)-39 +2273 y(reference)g(p)q(oin)o(t)i(\()p Fq(x;)8 b(y)r FI(\).)40 +b(Note)23 b(that)g(w)o(e)f(ma)o(y)g(also)h(ha)o(v)o(e)-39 +2333 y(o\013sets)14 b(greater)f(than)g(1.)21 b(F)l(or)13 +b(instance)g(the)g(lab)q(elling)f(of)i(the)-39 2393 y +Fq(x)p FI(-axis)j(is)h(realized)f(\(b)o(y)g FD(Mathematica)p +FI(\))f(using)j(a)f(reference)-39 2453 y(p)q(oin)o(t)j(lying)f(on)h +(the)g Fq(x)p FI(-axis)g(and)g(a)g(b)q(ounding)h(b)q(o)o(x)g(o\013set) +-39 2513 y(of)g(\(0)p Fq(;)8 b FI(2\).)41 b(With)23 b(suc)o(h)f +(o\013set,)j(di\013eren)o(t)c(heigh)o(t)i Fq(x)p FI(-lab)q(els)-39 +2574 y(w)o(ould)16 b(b)q(e)g(placed)g(at)g(di\013eren)o(t)g(distance)g +(from)f(the)h Fq(x)p FI(-axis.)-39 2634 y(The)i(`)p Fy(-c)p +FI(')f(option)h(b)o(y-passes)h(this)g(b)q(eha)o(viour.)27 +b(It)18 b(replaces)-39 2694 y(an)o(y)h(lab)q(el)g(ha)o(ving)g(\()p +Fq(s)379 2701 y Fm(x)401 2694 y Fq(;)8 b(s)446 2701 y +Fm(y)466 2694 y FI(\))20 b(bb-o\013set)g(with)f(lab)q(els)g(ha)o(ving) +-39 2754 y(\()p Fq(s)3 2736 y Fl(0)3 2767 y Fm(x)24 2754 +y Fq(;)8 b(s)69 2736 y Fl(0)69 2767 y Fm(y)90 2754 y +FI(\))15 b(bb-o\013set)h(further)f(shifted)g(b)o(y)f(\()p +Fq(dimen)865 2761 y Fm(x)886 2754 y Fq(;)8 b(dimen)1045 +2761 y Fm(y)1065 2754 y FI(\))15 b(from)f(the)h(curren)o(t)f(p)q +(osition)i(\()p Fq(dimen)1805 2761 y Fm(x)1841 2754 y +FI(and)-39 2814 y Fq(dimen)98 2821 y Fm(y)134 2814 y +FI(m)o(ust)f(b)q(e)h(n)o(um)o(b)q(ers)f(follo)o(w)o(ed)g(b)o(y)h(one)g +(of)h(T)946 2825 y(E)973 2814 y(X's)f(unit\).)928 2914 +y(5)p eop +%%Page: 6 7 +6 6 bop 34 166 a FI(The)20 b(follo)o(wing)f(example)f(could)i(mak)o(e)e +(this)i(clear.)32 b(Consider)20 b(a)g(graphic)h(ha)o(ving)e(the)h +(follo)o(wing)-39 226 y(lab)q(els)523 296 y Fx(\000)567 +262 y FI(3)p 567 285 25 2 v 567 330 a(2)705 296 y Fx(\000)11 +b FI(1)109 b Fx(\000)942 262 y FI(1)p 942 285 V 942 330 +a(2)1074 262 y(1)p 1074 285 V 1074 330 a(2)1201 296 y(1)1328 +262 y(3)p 1328 285 V 1328 330 a(2)-39 403 y(under)16 +b(the)g Fq(x)p FI(-axis.)22 b(Since)15 b(lab)q(els)i(`)p +Fx(\000)669 383 y FA(3)p 669 391 18 2 v 669 420 a(2)691 +403 y FI(',)e(`)p Fx(\000)792 383 y FA(1)p 792 391 V +792 420 a(2)814 403 y FI(',)h(`)877 383 y FA(1)p 877 +391 V 877 420 a(2)899 403 y FI(')g(and)h(and)g(`)1138 +383 y FA(3)p 1138 391 V 1138 420 a(2)1160 403 y FI(')f(are)h(higher)f +(than)h(lab)q(el)f(`)p Fx(\000)p FI(1')g(and)h(`1',)-39 +463 y(they)h(are)i(placed)e(lo)o(w)o(er)h(than)h(the)f(lab)q(els)g(`)p +Fx(\000)p FI(1'.)29 b(Using)19 b(the)g(option)h(`)p Fy(-c\(0,2\)=\()o +(0,1)o(\)\(0)o(pt,)o(-5)o(pt\))o FI(')-39 523 y(ev)o(ery)15 +b(lab)q(els)h(will)g(b)q(e)g(placed)g(with)h(the)f(top)h(edge)g(of)g +(the)f(b)q(o)o(x)h(that)g(b)q(ounds)h(them,)c(at)j(5)8 +b(pt)18 b(from)d(the)-39 583 y Fq(x)p FI(-axis,)g(as)i(sho)o(wn)g(in)f +(Fig.)g(2.)34 643 y(Note)g(that)g(it)g(is)g(p)q(ossible)h(to)f(sp)q +(ecify)g(m)o(ultiple)d Fy(-c)i FI(options)i(on)g(the)f(same)f(command)f +(line.)8 1259 y @beginspecial 212.597809 @hsize 131.390900 +@vsize @setspecial +%%BeginDocument: 6mag.eps +%MMA2LTXCommandLine: mma2ltx -ucm -p -w7.5cm 6mag.ps +% Mathematica v2.2 prologue +/Mathdict 150 dict def +Mathdict begin +/Mwidth 212.60 def +/Mheight 131.39 def +/Mnodistort true def +/Mlmarg 0 def /Mrmarg 0 def /Mbmarg 0 def /Mtmarg 0 def /Mtransform{} +bind def /Mfixwid true def /Mfixdash false def /Mrot 0 def /Mpstart{ +MathPictureStart}bind def /Mpend{MathPictureEnd}bind def /Mscale{0 1 0 1 +5 -1 roll MathScale}bind def /ISOLatin1Encoding dup where{pop pop}{[ +/.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef +/.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef +/.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef +/.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef +/space /exclam /quotedbl /numbersign /dollar /percent /ampersand +/quoteright /parenleft /parenright /asterisk /plus /comma /minus /period +/slash /zero /one /two /three /four /five /six /seven /eight /nine +/colon /semicolon /less /equal /greater /question /at /A /B /C /D /E /F +/G /H /I /J /K /L /M /N /O /P /Q /R /S /T /U /V /W /X /Y /Z /bracketleft +/backslash /bracketright /asciicircum /underscore /quoteleft /a /b /c /d +/e /f /g /h /i /j /k /l /m /n /o /p /q /r /s /t /u /v /w /x /y /z +/braceleft /bar /braceright /asciitilde /.notdef /.notdef /.notdef +/.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef +/.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /dotlessi /grave +/acute /circumflex /tilde /macron /breve /dotaccent /dieresis /.notdef +/ring /cedilla /.notdef /hungarumlaut /ogonek /caron /space /exclamdown +/cent /sterling /currency /yen /brokenbar /section /dieresis /copyright +/ordfeminine /guillemotleft /logicalnot /hyphen /registered /macron +/degree /plusminus /twosuperior /threesuperior /acute /mu /paragraph +/periodcentered /cedilla /onesuperior /ordmasculine /guillemotright +/onequarter /onehalf /threequarters /questiondown /Agrave /Aacute +/Acircumflex /Atilde /Adieresis /Aring /AE /Ccedilla /Egrave /Eacute +/Ecircumflex /Edieresis /Igrave /Iacute /Icircumflex /Idieresis /Eth +/Ntilde /Ograve /Oacute /Ocircumflex /Otilde /Odieresis /multiply +/Oslash /Ugrave /Uacute /Ucircumflex /Udieresis /Yacute /Thorn +/germandbls /agrave /aacute /acircumflex /atilde /adieresis /aring /ae +/ccedilla /egrave /eacute /ecircumflex /edieresis /igrave /iacute +/icircumflex /idieresis /eth /ntilde /ograve /oacute /ocircumflex +/otilde /odieresis /divide /oslash /ugrave /uacute /ucircumflex +/udieresis /yacute /thorn /ydieresis]def}ifelse /MFontDict 50 dict def +/MStrCat{exch dup length 2 index length add string dup 3 1 roll copy +length exch dup 4 2 roll exch putinterval}def /MCreateEncoding{1 index +255 string cvs(-)MStrCat 1 index MStrCat cvn exch(Encoding)MStrCat cvn +dup where{exch get}{pop StandardEncoding}ifelse 3 1 roll dup MFontDict +exch known not{1 index findfont dup length dict begin{1 index /FID ne{ +def}{pop pop}ifelse}forall /Encoding 3 index def currentdict end 1 index +exch definefont pop MFontDict 1 index null put}if exch pop exch pop}def +/ISOLatin1{(ISOLatin1)MCreateEncoding}def /ISO8859{(ISOLatin1) +MCreateEncoding}def /Mcopyfont{dup maxlength dict exch{1 index /FID eq{ +pop pop}{2 index 3 1 roll put}ifelse}forall}def /Plain /Courier findfont +Mcopyfont definefont pop /Bold /Courier findfont Mcopyfont +definefont pop /Italic /Courier findfont Mcopyfont definefont +pop /MathPictureStart{gsave Mtransform Mlmarg Mbmarg translate Mwidth +Mlmarg Mrmarg add sub /Mwidth exch def Mheight Mbmarg Mtmarg add sub +/Mheight exch def /Mtmatrix matrix currentmatrix def /Mgmatrix matrix +currentmatrix def}bind def /MathPictureEnd{grestore}bind def /MFill{0 0 +moveto Mwidth 0 lineto Mwidth Mheight lineto 0 Mheight lineto fill}bind +def /MPlotRegion{3 index Mwidth mul 2 index Mheight mul translate exch +sub Mheight mul /Mheight exch def exch sub Mwidth mul /Mwidth exch def} +bind def /MathSubStart{Momatrix Mgmatrix Mtmatrix Mwidth Mheight 7 -2 +roll moveto Mtmatrix setmatrix currentpoint Mgmatrix setmatrix 9 -2 roll +moveto Mtmatrix setmatrix currentpoint 2 copy translate /Mtmatrix matrix +currentmatrix def 3 -1 roll exch sub /Mheight exch def sub /Mwidth exch +def}bind def /MathSubEnd{/Mheight exch def /Mwidth exch def /Mtmatrix +exch def dup setmatrix /Mgmatrix exch def /Momatrix exch def}bind def +/Mdot{moveto 0 0 rlineto stroke}bind def /Mtetra{moveto lineto lineto +lineto fill}bind def /Metetra{moveto lineto lineto lineto closepath +gsave fill grestore 0 setgray stroke}bind def /Mistroke{flattenpath 0 0 +0{4 2 roll pop pop}{4 -1 roll 2 index sub dup mul 4 -1 roll 2 index sub +dup mul add sqrt 4 -1 roll add 3 1 roll}{stop}{stop}pathforall pop pop +currentpoint stroke moveto currentdash 3 -1 roll add setdash}bind def +/Mfstroke{stroke currentdash pop 0 setdash}bind def /Mrotsboxa{gsave dup +/Mrot exch def Mrotcheck Mtmatrix dup setmatrix 7 1 roll 4 index 4 index +translate rotate 3 index -1 mul 3 index -1 mul translate /Mtmatrix +matrix currentmatrix def grestore Msboxa 3 -1 roll /Mtmatrix exch def +/Mrot 0 def}bind def /Msboxa{newpath 5 -1 roll Mvboxa pop Mboxout 6 -1 +roll 5 -1 roll 4 -1 roll Msboxa1 5 -3 roll Msboxa1 Mboxrot[7 -2 roll 2 +copy[3 1 roll 10 -1 roll 9 -1 roll]6 1 roll 5 -2 roll]}bind def /Msboxa1 +{sub 2 div dup 2 index 1 add mul 3 -1 roll -1 add 3 -1 roll mul}bind def +/Mvboxa{Mfixwid{Mvboxa1}{dup Mwidthcal 0 exch{add}forall exch Mvboxa1 4 +index 7 -1 roll add 4 -1 roll pop 3 1 roll}ifelse}bind def /Mvboxa1{ +gsave newpath[true 3 -1 roll{Mbbox 5 -1 roll{0 5 1 roll}{7 -1 roll exch +sub(m)stringwidth pop .3 mul sub 7 1 roll 6 -1 roll 4 -1 roll Mmin 3 -1 +roll 5 index add 5 -1 roll 4 -1 roll Mmax 4 -1 roll}ifelse false}forall{ +stop}if counttomark 1 add 4 roll]grestore}bind def /Mbbox{1 dict begin 0 +0 moveto /temp(T)def{gsave currentpoint newpath moveto temp 0 3 -1 roll +put temp false charpath flattenpath currentpoint pathbbox grestore +moveto lineto moveto}forall pathbbox newpath end}bind def /Mmin{2 copy +gt{exch}if pop}bind def /Mmax{2 copy lt{exch}if pop}bind def /Mrotshowa{ +dup /Mrot exch def Mrotcheck Mtmatrix dup setmatrix 7 1 roll 4 index 4 +index translate rotate 3 index -1 mul 3 index -1 mul translate /Mtmatrix +matrix currentmatrix def Mgmatrix setmatrix Mshowa /Mtmatrix exch def +/Mrot 0 def}bind def /Mshowa{4 -2 roll moveto 2 index Mtmatrix setmatrix +Mvboxa 7 1 roll Mboxout 6 -1 roll 5 -1 roll 4 -1 roll Mshowa1 4 1 roll +Mshowa1 rmoveto currentpoint Mfixwid{Mshowax}{Mshoway}ifelse pop pop pop +pop Mgmatrix setmatrix}bind def /Mshowax{0 1 4 index length -1 add{2 +index 4 index 2 index get 3 index add moveto 4 index exch get Mfixdash{ +Mfixdashp}if show}for}bind def /Mfixdashp{dup length 1 gt 1 index true +exch{45 eq and}forall and{gsave(--)stringwidth pop(-)stringwidth pop sub +2 div 0 rmoveto dup length 1 sub{(-)show}repeat grestore}if}bind def +/Mshoway{3 index Mwidthcal 5 1 roll 0 1 4 index length -1 add{2 index 4 +index 2 index get 3 index add moveto 4 index exch get[6 index aload +length 2 add -1 roll{pop Strform stringwidth pop neg exch add 0 rmoveto} +exch kshow cleartomark}for pop}bind def /Mwidthcal{[exch{Mwidthcal1} +forall][exch dup Maxlen -1 add 0 1 3 -1 roll{[exch 2 index{1 index Mget +exch}forall pop Maxget exch}for pop]Mreva}bind def /Mreva{[exch aload +length -1 1{1 roll}for]}bind def /Mget{1 index length -1 add 1 index ge{ +get}{pop pop 0}ifelse}bind def /Maxlen{[exch{length}forall Maxget}bind +def /Maxget{counttomark -1 add 1 1 3 -1 roll{pop Mmax}for exch pop}bind +def /Mwidthcal1{[exch{Strform stringwidth pop}forall]}bind def /Strform{ +/tem(x)def tem 0 3 -1 roll put tem}bind def /Mshowa1{2 copy add 4 1 roll +sub mul sub -2 div}bind def /MathScale{Mwidth Mheight Mlp translate +scale /yscale exch def /ybias exch def /xscale exch def /xbias exch def +/Momatrix xscale yscale matrix scale xbias ybias matrix translate matrix +concatmatrix def /Mgmatrix matrix currentmatrix def}bind def /Mlp{3 copy +Mlpfirst{Mnodistort{Mmin dup}if 4 index 2 index 2 index Mlprun 11 index +11 -1 roll 10 -4 roll Mlp1 8 index 9 -5 roll Mlp1 4 -1 roll and{exit}if +3 -1 roll pop pop}loop exch 3 1 roll 7 -3 roll pop pop pop}bind def +/Mlpfirst{3 -1 roll dup length 2 copy -2 add get aload pop pop pop 4 -2 +roll -1 add get aload pop pop pop 6 -1 roll 3 -1 roll 5 -1 roll sub div +4 1 roll exch sub div}bind def /Mlprun{2 copy 4 index 0 get dup 4 1 roll +Mlprun1 3 copy 8 -2 roll 9 -1 roll{3 copy Mlprun1 3 copy 11 -3 roll /gt +Mlpminmax 8 3 roll 11 -3 roll /lt Mlpminmax 8 3 roll}forall pop pop pop +pop 3 1 roll pop pop aload pop 5 -1 roll aload pop exch 6 -1 roll +Mlprun2 8 2 roll 4 -1 roll Mlprun2 6 2 roll 3 -1 roll Mlprun2 4 2 roll +exch Mlprun2 6 2 roll}bind def /Mlprun1{aload pop exch 6 -1 roll 5 -1 +roll mul add 4 -2 roll mul 3 -1 roll add}bind def /Mlprun2{2 copy add 2 +div 3 1 roll exch sub}bind def /Mlpminmax{cvx 2 index 6 index 2 index +exec{7 -3 roll 4 -1 roll}if 1 index 5 index 3 -1 roll exec{4 1 roll pop +5 -1 roll aload pop pop 4 -1 roll aload pop[8 -2 roll pop 5 -2 roll pop +6 -2 roll pop 5 -1 roll]4 1 roll pop}{pop pop pop}ifelse}bind def /Mlp1{ +5 index 3 index sub 5 index 2 index mul 1 index le 1 index 0 le or dup +not{1 index 3 index div .99999 mul 8 -1 roll pop 7 1 roll}if 8 -1 roll 2 +div 7 -2 roll pop sub 5 index 6 -3 roll pop pop mul sub exch}bind def +/intop 0 def /inrht 0 def /inflag 0 def /outflag 0 def /xadrht 0 def +/xadlft 0 def /yadtop 0 def /yadbot 0 def /Minner{outflag 1 eq{/outflag +0 def /intop 0 def /inrht 0 def}if 5 index gsave Mtmatrix setmatrix +Mvboxa pop grestore 3 -1 roll pop dup intop gt{/intop exch def}{pop} +ifelse dup inrht gt{/inrht exch def}{pop}ifelse pop /inflag 1 def}bind +def /Mouter{/xadrht 0 def /xadlft 0 def /yadtop 0 def /yadbot 0 def +inflag 1 eq{dup 0 lt{dup intop mul neg /yadtop exch def}if dup 0 gt{dup +intop mul /yadbot exch def}if pop dup 0 lt{dup inrht mul neg /xadrht +exch def}if dup 0 gt{dup inrht mul /xadlft exch def}if pop /outflag 1 +def}{pop pop}ifelse /inflag 0 def /inrht 0 def /intop 0 def}bind def +/Mboxout{outflag 1 eq{4 -1 roll xadlft leadjust add sub 4 1 roll 3 -1 +roll yadbot leadjust add sub 3 1 roll exch xadrht leadjust add add exch +yadtop leadjust add add /outflag 0 def /xadlft 0 def /yadbot 0 def +/xadrht 0 def /yadtop 0 def}if}bind def /leadjust{(m)stringwidth pop .5 +mul}bind def /Mrotcheck{dup 90 eq{yadbot /yadbot xadrht def /xadrht +yadtop def /yadtop xadlft def /xadlft exch def}if dup cos 1 index sin +Checkaux dup cos 1 index sin neg exch Checkaux 3 1 roll pop pop}bind def +/Checkaux{4 index exch 4 index mul 3 1 roll mul add 4 1 roll}bind def +/Mboxrot{Mrot 90 eq{brotaux 4 2 roll}if Mrot 180 eq{4 2 roll brotaux 4 2 +roll brotaux}if Mrot 270 eq{4 2 roll brotaux}if}bind def /brotaux{neg +exch neg}bind def /Mabsproc{0 matrix defaultmatrix dtransform +idtransform dup mul exch dup mul add sqrt}bind def /Mabswid{Mabsproc +setlinewidth}bind def /Mabsdash{exch[exch{Mabsproc}forall]exch setdash} +bind def /MBeginOrig{Momatrix concat}bind def /MEndOrig{Mgmatrix +setmatrix}bind def /sampledsound where{pop}{/sampledsound{exch pop exch +5 1 roll mul 4 idiv mul 2 idiv exch pop exch /Mtempproc exch def{ +Mtempproc pop}repeat}bind def}ifelse /g{setgray}bind def /k{ +setcmykcolor}bind def /m{moveto}bind def /p{gsave}bind def /r{ +setrgbcolor}bind def /w{setlinewidth}bind def /C{curveto}bind def /F{ +fill}bind def /L{lineto}bind def /P{grestore}bind def /s{stroke}bind def +/setcmykcolor where{pop}{/setcmykcolor{4 1 roll[4 1 roll]{1 index sub 1 +sub neg dup 0 lt{pop 0}if dup 1 gt{pop 1}if exch}forall pop setrgbcolor} +bind def}ifelse /Mcharproc{currentfile(x)readhexstring pop 0 get exch +div}bind def /Mshadeproc{dup 3 1 roll{dup Mcharproc 3 1 roll}repeat 1 eq +{setgray}{3 eq{setrgbcolor}{setcmykcolor}ifelse}ifelse}bind def +/Mrectproc{3 index 2 index moveto 2 index 3 -1 roll lineto dup 3 1 roll +lineto lineto fill}bind def /Mcolorimage{7 1 roll pop pop matrix +invertmatrix concat 2 exch exp 1 sub 3 1 roll 1 1 2 index{1 1 4 index{ +dup 1 sub exch 2 index dup 1 sub exch 7 index 9 index Mshadeproc +Mrectproc}for pop}for pop pop pop pop}bind def /Mimage{pop matrix +invertmatrix concat 2 exch exp 1 sub 3 1 roll 1 1 2 index{1 1 4 index{ +dup 1 sub exch 2 index dup 1 sub exch 7 index Mcharproc setgray +Mrectproc}for pop}for pop pop pop}bind def +%MMA2LTXComment: Here follow the original Mathematica file stripped of the text strings +MathPictureStart +/Courier findfont 10 scalefont setfont +% Scaling calculations +0.5 0.151576 0.309017 0.257514 [ +[ -0.001 -0.001 0 0 ] +[ 1.001 .61903 0 0 ] +] MathScale +% Start of Graphics +1 setlinecap +1 setlinejoin +newpath +[ ] 0 setdash +0 g +p +p +.002 w +.04527 .30902 m +.04527 .31527 L +s +P +p +.002 w +.19685 .30902 m +.19685 .31527 L +s +P +p +.002 w +.34842 .30902 m +.34842 .31527 L +s +P +p +.002 w +.65158 .30902 m +.65158 .31527 L +s +P +p +.002 w +.80315 .30902 m +.80315 .31527 L +s +P +p +.002 w +.95473 .30902 m +.95473 .31527 L +s +P +p +.001 w +.07559 .30902 m +.07559 .31277 L +s +P +p +.001 w +.1059 .30902 m +.1059 .31277 L +s +P +p +.001 w +.13622 .30902 m +.13622 .31277 L +s +P +p +.001 w +.16653 .30902 m +.16653 .31277 L +s +P +p +.001 w +.22716 .30902 m +.22716 .31277 L +s +P +p +.001 w +.25748 .30902 m +.25748 .31277 L +s +P +p +.001 w +.28779 .30902 m +.28779 .31277 L +s +P +p +.001 w +.31811 .30902 m +.31811 .31277 L +s +P +p +.001 w +.37874 .30902 m +.37874 .31277 L +s +P +p +.001 w +.40905 .30902 m +.40905 .31277 L +s +P +p +.001 w +.43937 .30902 m +.43937 .31277 L +s +P +p +.001 w +.46968 .30902 m +.46968 .31277 L +s +P +p +.001 w +.53032 .30902 m +.53032 .31277 L +s +P +p +.001 w +.56063 .30902 m +.56063 .31277 L +s +P +p +.001 w +.59095 .30902 m +.59095 .31277 L +s +P +p +.001 w +.62126 .30902 m +.62126 .31277 L +s +P +p +.001 w +.68189 .30902 m +.68189 .31277 L +s +P +p +.001 w +.71221 .30902 m +.71221 .31277 L +s +P +p +.001 w +.74252 .30902 m +.74252 .31277 L +s +P +p +.001 w +.77284 .30902 m +.77284 .31277 L +s +P +p +.001 w +.83347 .30902 m +.83347 .31277 L +s +P +p +.001 w +.86378 .30902 m +.86378 .31277 L +s +P +p +.001 w +.8941 .30902 m +.8941 .31277 L +s +P +p +.001 w +.92441 .30902 m +.92441 .31277 L +s +P +p +.001 w +.01496 .30902 m +.01496 .31277 L +s +P +p +.001 w +.98504 .30902 m +.98504 .31277 L +s +P +p +.002 w +0 .30902 m +1 .30902 L +s +P +p +.002 w +.5 .0515 m +.50625 .0515 L +s +P +p +.002 w +.5 .18026 m +.50625 .18026 L +s +P +p +.002 w +.5 .43777 m +.50625 .43777 L +s +P +p +.002 w +.5 .56653 m +.50625 .56653 L +s +P +p +.001 w +.5 .07725 m +.50375 .07725 L +s +P +p +.001 w +.5 .10301 m +.50375 .10301 L +s +P +p +.001 w +.5 .12876 m +.50375 .12876 L +s +P +p +.001 w +.5 .15451 m +.50375 .15451 L +s +P +p +.001 w +.5 .20601 m +.50375 .20601 L +s +P +p +.001 w +.5 .23176 m +.50375 .23176 L +s +P +p +.001 w +.5 .25751 m +.50375 .25751 L +s +P +p +.001 w +.5 .28327 m +.50375 .28327 L +s +P +p +.001 w +.5 .33477 m +.50375 .33477 L +s +P +p +.001 w +.5 .36052 m +.50375 .36052 L +s +P +p +.001 w +.5 .38627 m +.50375 .38627 L +s +P +p +.001 w +.5 .41202 m +.50375 .41202 L +s +P +p +.001 w +.5 .46353 m +.50375 .46353 L +s +P +p +.001 w +.5 .48928 m +.50375 .48928 L +s +P +p +.001 w +.5 .51503 m +.50375 .51503 L +s +P +p +.001 w +.5 .54078 m +.50375 .54078 L +s +P +p +.001 w +.5 .02575 m +.50375 .02575 L +s +P +p +.001 w +.5 .59228 m +.50375 .59228 L +s +P +p +.002 w +.5 0 m +.5 .61803 L +s +P +P +0 0 m +1 0 L +1 .61803 L +0 .61803 L +closepath +clip +newpath +p +[ .025 .025 ] 0 setdash +p +.004 w +.02381 .30902 m +.04325 .27609 L +.06268 .2437 L +.08212 .21238 L +.10155 .18265 L +.12099 .155 L +.14043 .12987 L +.15986 .10768 L +.1793 .08881 L +.19874 .07354 L +.20845 .06735 L +.21817 .06215 L +.22789 .05796 L +.23275 .05625 L +.23761 .0548 L +.24247 .05362 L +.24733 .05269 L +.24976 .05233 L +.25219 .05203 L +.25462 .0518 L +.25583 .05171 L +.25705 .05164 L +.25826 .05158 L +.25887 .05155 L +.25948 .05154 L +.26008 .05152 L +.26069 .05151 L +.2613 .0515 L +.2619 .0515 L +.26251 .0515 L +.26312 .05151 L +.26373 .05152 L +.26433 .05154 L +.26494 .05155 L +.26555 .05158 L +.26676 .05164 L +.26798 .05171 L +.26919 .0518 L +.27162 .05203 L +.27405 .05233 L +.27648 .05269 L +.28134 .05362 L +.2862 .0548 L +.29592 .05796 L +.30564 .06215 L +.31535 .06735 L +.33479 .08071 L +.35423 .09781 L +.37366 .11838 L +.3931 .14209 L +Mistroke +.41254 .16853 L +.43197 .19729 L +.45141 .22787 L +.47085 .25979 L +.49028 .29252 L +.50972 .32552 L +.52915 .35824 L +.54859 .39016 L +.56803 .42075 L +.58746 .4495 L +.6069 .47594 L +.62634 .49965 L +.64577 .52022 L +.66521 .53733 L +.67493 .54449 L +.68465 .55069 L +.69436 .55589 L +.70408 .56007 L +.70894 .56178 L +.7138 .56323 L +.71866 .56442 L +.72352 .56534 L +.72595 .5657 L +.72838 .566 L +.73081 .56623 L +.73202 .56632 L +.73324 .5664 L +.73445 .56646 L +.73506 .56648 L +.73567 .5665 L +.73627 .56651 L +.73688 .56652 L +.73749 .56653 L +.7381 .56653 L +.7387 .56653 L +.73931 .56652 L +.73992 .56651 L +.74052 .5665 L +.74174 .56646 L +.74295 .5664 L +.74417 .56632 L +.74538 .56623 L +.74781 .566 L +.75024 .5657 L +.75267 .56534 L +.75753 .56442 L +.76239 .56323 L +.77211 .56007 L +.78183 .55589 L +.80126 .54449 L +Mistroke +.8207 .52923 L +.84014 .51035 L +.85957 .48817 L +.87901 .46304 L +.89845 .43538 L +.91788 .40565 L +.93732 .37434 L +.95675 .34195 L +.97619 .30902 L +Mfstroke +P +P +% End of Graphics +MathPictureEnd +end +%%EndDocument + @endspecial 18 1081 a Fs(\000)55 1053 y Fu(3)p 55 1072 +21 2 v 55 1110 a(2)157 1027 y Fs(\000)p Fu(1)285 1081 +y Fs(\000)322 1053 y Fu(1)p 322 1072 V 322 1110 a(2)574 +1053 y(1)p 574 1072 V 574 1110 a(2)708 1025 y(1)842 1053 +y(3)p 842 1072 V 842 1110 a(2)387 1224 y Fs(\000)p Fu(1)354 +1110 y Fs(\000)p Fu(0)p Fn(:)p Fu(5)387 885 y(0)p Fn(:)p +Fu(5)419 771 y(1)988 1259 y @beginspecial 212.597809 +@hsize 131.390900 @vsize @setspecial +%%BeginDocument: optc.eps +%MMA2LTXCommandLine: mma2ltx -ucm -p -w7.5cm -c(0,2)=(0,1)(0pt,-5pt) optc.ps +% Mathematica v2.2 prologue +/Mathdict 150 dict def +Mathdict begin +/Mwidth 212.60 def +/Mheight 131.39 def +/Mnodistort true def +/Mlmarg 0 def /Mrmarg 0 def /Mbmarg 0 def /Mtmarg 0 def /Mtransform{} +bind def /Mfixwid true def /Mfixdash false def /Mrot 0 def /Mpstart{ +MathPictureStart}bind def /Mpend{MathPictureEnd}bind def /Mscale{0 1 0 1 +5 -1 roll MathScale}bind def /ISOLatin1Encoding dup where{pop pop}{[ +/.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef +/.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef +/.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef +/.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef +/space /exclam /quotedbl /numbersign /dollar /percent /ampersand +/quoteright /parenleft /parenright /asterisk /plus /comma /minus /period +/slash /zero /one /two /three /four /five /six /seven /eight /nine +/colon /semicolon /less /equal /greater /question /at /A /B /C /D /E /F +/G /H /I /J /K /L /M /N /O /P /Q /R /S /T /U /V /W /X /Y /Z /bracketleft +/backslash /bracketright /asciicircum /underscore /quoteleft /a /b /c /d +/e /f /g /h /i /j /k /l /m /n /o /p /q /r /s /t /u /v /w /x /y /z +/braceleft /bar /braceright /asciitilde /.notdef /.notdef /.notdef +/.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef +/.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /dotlessi /grave +/acute /circumflex /tilde /macron /breve /dotaccent /dieresis /.notdef +/ring /cedilla /.notdef /hungarumlaut /ogonek /caron /space /exclamdown +/cent /sterling /currency /yen /brokenbar /section /dieresis /copyright +/ordfeminine /guillemotleft /logicalnot /hyphen /registered /macron +/degree /plusminus /twosuperior /threesuperior /acute /mu /paragraph +/periodcentered /cedilla /onesuperior /ordmasculine /guillemotright +/onequarter /onehalf /threequarters /questiondown /Agrave /Aacute +/Acircumflex /Atilde /Adieresis /Aring /AE /Ccedilla /Egrave /Eacute +/Ecircumflex /Edieresis /Igrave /Iacute /Icircumflex /Idieresis /Eth +/Ntilde /Ograve /Oacute /Ocircumflex /Otilde /Odieresis /multiply +/Oslash /Ugrave /Uacute /Ucircumflex /Udieresis /Yacute /Thorn +/germandbls /agrave /aacute /acircumflex /atilde /adieresis /aring /ae +/ccedilla /egrave /eacute /ecircumflex /edieresis /igrave /iacute +/icircumflex /idieresis /eth /ntilde /ograve /oacute /ocircumflex +/otilde /odieresis /divide /oslash /ugrave /uacute /ucircumflex +/udieresis /yacute /thorn /ydieresis]def}ifelse /MFontDict 50 dict def +/MStrCat{exch dup length 2 index length add string dup 3 1 roll copy +length exch dup 4 2 roll exch putinterval}def /MCreateEncoding{1 index +255 string cvs(-)MStrCat 1 index MStrCat cvn exch(Encoding)MStrCat cvn +dup where{exch get}{pop StandardEncoding}ifelse 3 1 roll dup MFontDict +exch known not{1 index findfont dup length dict begin{1 index /FID ne{ +def}{pop pop}ifelse}forall /Encoding 3 index def currentdict end 1 index +exch definefont pop MFontDict 1 index null put}if exch pop exch pop}def +/ISOLatin1{(ISOLatin1)MCreateEncoding}def /ISO8859{(ISOLatin1) +MCreateEncoding}def /Mcopyfont{dup maxlength dict exch{1 index /FID eq{ +pop pop}{2 index 3 1 roll put}ifelse}forall}def /Plain /Courier findfont +Mcopyfont definefont pop /Bold /Courier findfont Mcopyfont +definefont pop /Italic /Courier findfont Mcopyfont definefont +pop /MathPictureStart{gsave Mtransform Mlmarg Mbmarg translate Mwidth +Mlmarg Mrmarg add sub /Mwidth exch def Mheight Mbmarg Mtmarg add sub +/Mheight exch def /Mtmatrix matrix currentmatrix def /Mgmatrix matrix +currentmatrix def}bind def /MathPictureEnd{grestore}bind def /MFill{0 0 +moveto Mwidth 0 lineto Mwidth Mheight lineto 0 Mheight lineto fill}bind +def /MPlotRegion{3 index Mwidth mul 2 index Mheight mul translate exch +sub Mheight mul /Mheight exch def exch sub Mwidth mul /Mwidth exch def} +bind def /MathSubStart{Momatrix Mgmatrix Mtmatrix Mwidth Mheight 7 -2 +roll moveto Mtmatrix setmatrix currentpoint Mgmatrix setmatrix 9 -2 roll +moveto Mtmatrix setmatrix currentpoint 2 copy translate /Mtmatrix matrix +currentmatrix def 3 -1 roll exch sub /Mheight exch def sub /Mwidth exch +def}bind def /MathSubEnd{/Mheight exch def /Mwidth exch def /Mtmatrix +exch def dup setmatrix /Mgmatrix exch def /Momatrix exch def}bind def +/Mdot{moveto 0 0 rlineto stroke}bind def /Mtetra{moveto lineto lineto +lineto fill}bind def /Metetra{moveto lineto lineto lineto closepath +gsave fill grestore 0 setgray stroke}bind def /Mistroke{flattenpath 0 0 +0{4 2 roll pop pop}{4 -1 roll 2 index sub dup mul 4 -1 roll 2 index sub +dup mul add sqrt 4 -1 roll add 3 1 roll}{stop}{stop}pathforall pop pop +currentpoint stroke moveto currentdash 3 -1 roll add setdash}bind def +/Mfstroke{stroke currentdash pop 0 setdash}bind def /Mrotsboxa{gsave dup +/Mrot exch def Mrotcheck Mtmatrix dup setmatrix 7 1 roll 4 index 4 index +translate rotate 3 index -1 mul 3 index -1 mul translate /Mtmatrix +matrix currentmatrix def grestore Msboxa 3 -1 roll /Mtmatrix exch def +/Mrot 0 def}bind def /Msboxa{newpath 5 -1 roll Mvboxa pop Mboxout 6 -1 +roll 5 -1 roll 4 -1 roll Msboxa1 5 -3 roll Msboxa1 Mboxrot[7 -2 roll 2 +copy[3 1 roll 10 -1 roll 9 -1 roll]6 1 roll 5 -2 roll]}bind def /Msboxa1 +{sub 2 div dup 2 index 1 add mul 3 -1 roll -1 add 3 -1 roll mul}bind def +/Mvboxa{Mfixwid{Mvboxa1}{dup Mwidthcal 0 exch{add}forall exch Mvboxa1 4 +index 7 -1 roll add 4 -1 roll pop 3 1 roll}ifelse}bind def /Mvboxa1{ +gsave newpath[true 3 -1 roll{Mbbox 5 -1 roll{0 5 1 roll}{7 -1 roll exch +sub(m)stringwidth pop .3 mul sub 7 1 roll 6 -1 roll 4 -1 roll Mmin 3 -1 +roll 5 index add 5 -1 roll 4 -1 roll Mmax 4 -1 roll}ifelse false}forall{ +stop}if counttomark 1 add 4 roll]grestore}bind def /Mbbox{1 dict begin 0 +0 moveto /temp(T)def{gsave currentpoint newpath moveto temp 0 3 -1 roll +put temp false charpath flattenpath currentpoint pathbbox grestore +moveto lineto moveto}forall pathbbox newpath end}bind def /Mmin{2 copy +gt{exch}if pop}bind def /Mmax{2 copy lt{exch}if pop}bind def /Mrotshowa{ +dup /Mrot exch def Mrotcheck Mtmatrix dup setmatrix 7 1 roll 4 index 4 +index translate rotate 3 index -1 mul 3 index -1 mul translate /Mtmatrix +matrix currentmatrix def Mgmatrix setmatrix Mshowa /Mtmatrix exch def +/Mrot 0 def}bind def /Mshowa{4 -2 roll moveto 2 index Mtmatrix setmatrix +Mvboxa 7 1 roll Mboxout 6 -1 roll 5 -1 roll 4 -1 roll Mshowa1 4 1 roll +Mshowa1 rmoveto currentpoint Mfixwid{Mshowax}{Mshoway}ifelse pop pop pop +pop Mgmatrix setmatrix}bind def /Mshowax{0 1 4 index length -1 add{2 +index 4 index 2 index get 3 index add moveto 4 index exch get Mfixdash{ +Mfixdashp}if show}for}bind def /Mfixdashp{dup length 1 gt 1 index true +exch{45 eq and}forall and{gsave(--)stringwidth pop(-)stringwidth pop sub +2 div 0 rmoveto dup length 1 sub{(-)show}repeat grestore}if}bind def +/Mshoway{3 index Mwidthcal 5 1 roll 0 1 4 index length -1 add{2 index 4 +index 2 index get 3 index add moveto 4 index exch get[6 index aload +length 2 add -1 roll{pop Strform stringwidth pop neg exch add 0 rmoveto} +exch kshow cleartomark}for pop}bind def /Mwidthcal{[exch{Mwidthcal1} +forall][exch dup Maxlen -1 add 0 1 3 -1 roll{[exch 2 index{1 index Mget +exch}forall pop Maxget exch}for pop]Mreva}bind def /Mreva{[exch aload +length -1 1{1 roll}for]}bind def /Mget{1 index length -1 add 1 index ge{ +get}{pop pop 0}ifelse}bind def /Maxlen{[exch{length}forall Maxget}bind +def /Maxget{counttomark -1 add 1 1 3 -1 roll{pop Mmax}for exch pop}bind +def /Mwidthcal1{[exch{Strform stringwidth pop}forall]}bind def /Strform{ +/tem(x)def tem 0 3 -1 roll put tem}bind def /Mshowa1{2 copy add 4 1 roll +sub mul sub -2 div}bind def /MathScale{Mwidth Mheight Mlp translate +scale /yscale exch def /ybias exch def /xscale exch def /xbias exch def +/Momatrix xscale yscale matrix scale xbias ybias matrix translate matrix +concatmatrix def /Mgmatrix matrix currentmatrix def}bind def /Mlp{3 copy +Mlpfirst{Mnodistort{Mmin dup}if 4 index 2 index 2 index Mlprun 11 index +11 -1 roll 10 -4 roll Mlp1 8 index 9 -5 roll Mlp1 4 -1 roll and{exit}if +3 -1 roll pop pop}loop exch 3 1 roll 7 -3 roll pop pop pop}bind def +/Mlpfirst{3 -1 roll dup length 2 copy -2 add get aload pop pop pop 4 -2 +roll -1 add get aload pop pop pop 6 -1 roll 3 -1 roll 5 -1 roll sub div +4 1 roll exch sub div}bind def /Mlprun{2 copy 4 index 0 get dup 4 1 roll +Mlprun1 3 copy 8 -2 roll 9 -1 roll{3 copy Mlprun1 3 copy 11 -3 roll /gt +Mlpminmax 8 3 roll 11 -3 roll /lt Mlpminmax 8 3 roll}forall pop pop pop +pop 3 1 roll pop pop aload pop 5 -1 roll aload pop exch 6 -1 roll +Mlprun2 8 2 roll 4 -1 roll Mlprun2 6 2 roll 3 -1 roll Mlprun2 4 2 roll +exch Mlprun2 6 2 roll}bind def /Mlprun1{aload pop exch 6 -1 roll 5 -1 +roll mul add 4 -2 roll mul 3 -1 roll add}bind def /Mlprun2{2 copy add 2 +div 3 1 roll exch sub}bind def /Mlpminmax{cvx 2 index 6 index 2 index +exec{7 -3 roll 4 -1 roll}if 1 index 5 index 3 -1 roll exec{4 1 roll pop +5 -1 roll aload pop pop 4 -1 roll aload pop[8 -2 roll pop 5 -2 roll pop +6 -2 roll pop 5 -1 roll]4 1 roll pop}{pop pop pop}ifelse}bind def /Mlp1{ +5 index 3 index sub 5 index 2 index mul 1 index le 1 index 0 le or dup +not{1 index 3 index div .99999 mul 8 -1 roll pop 7 1 roll}if 8 -1 roll 2 +div 7 -2 roll pop sub 5 index 6 -3 roll pop pop mul sub exch}bind def +/intop 0 def /inrht 0 def /inflag 0 def /outflag 0 def /xadrht 0 def +/xadlft 0 def /yadtop 0 def /yadbot 0 def /Minner{outflag 1 eq{/outflag +0 def /intop 0 def /inrht 0 def}if 5 index gsave Mtmatrix setmatrix +Mvboxa pop grestore 3 -1 roll pop dup intop gt{/intop exch def}{pop} +ifelse dup inrht gt{/inrht exch def}{pop}ifelse pop /inflag 1 def}bind +def /Mouter{/xadrht 0 def /xadlft 0 def /yadtop 0 def /yadbot 0 def +inflag 1 eq{dup 0 lt{dup intop mul neg /yadtop exch def}if dup 0 gt{dup +intop mul /yadbot exch def}if pop dup 0 lt{dup inrht mul neg /xadrht +exch def}if dup 0 gt{dup inrht mul /xadlft exch def}if pop /outflag 1 +def}{pop pop}ifelse /inflag 0 def /inrht 0 def /intop 0 def}bind def +/Mboxout{outflag 1 eq{4 -1 roll xadlft leadjust add sub 4 1 roll 3 -1 +roll yadbot leadjust add sub 3 1 roll exch xadrht leadjust add add exch +yadtop leadjust add add /outflag 0 def /xadlft 0 def /yadbot 0 def +/xadrht 0 def /yadtop 0 def}if}bind def /leadjust{(m)stringwidth pop .5 +mul}bind def /Mrotcheck{dup 90 eq{yadbot /yadbot xadrht def /xadrht +yadtop def /yadtop xadlft def /xadlft exch def}if dup cos 1 index sin +Checkaux dup cos 1 index sin neg exch Checkaux 3 1 roll pop pop}bind def +/Checkaux{4 index exch 4 index mul 3 1 roll mul add 4 1 roll}bind def +/Mboxrot{Mrot 90 eq{brotaux 4 2 roll}if Mrot 180 eq{4 2 roll brotaux 4 2 +roll brotaux}if Mrot 270 eq{4 2 roll brotaux}if}bind def /brotaux{neg +exch neg}bind def /Mabsproc{0 matrix defaultmatrix dtransform +idtransform dup mul exch dup mul add sqrt}bind def /Mabswid{Mabsproc +setlinewidth}bind def /Mabsdash{exch[exch{Mabsproc}forall]exch setdash} +bind def /MBeginOrig{Momatrix concat}bind def /MEndOrig{Mgmatrix +setmatrix}bind def /sampledsound where{pop}{/sampledsound{exch pop exch +5 1 roll mul 4 idiv mul 2 idiv exch pop exch /Mtempproc exch def{ +Mtempproc pop}repeat}bind def}ifelse /g{setgray}bind def /k{ +setcmykcolor}bind def /m{moveto}bind def /p{gsave}bind def /r{ +setrgbcolor}bind def /w{setlinewidth}bind def /C{curveto}bind def /F{ +fill}bind def /L{lineto}bind def /P{grestore}bind def /s{stroke}bind def +/setcmykcolor where{pop}{/setcmykcolor{4 1 roll[4 1 roll]{1 index sub 1 +sub neg dup 0 lt{pop 0}if dup 1 gt{pop 1}if exch}forall pop setrgbcolor} +bind def}ifelse /Mcharproc{currentfile(x)readhexstring pop 0 get exch +div}bind def /Mshadeproc{dup 3 1 roll{dup Mcharproc 3 1 roll}repeat 1 eq +{setgray}{3 eq{setrgbcolor}{setcmykcolor}ifelse}ifelse}bind def +/Mrectproc{3 index 2 index moveto 2 index 3 -1 roll lineto dup 3 1 roll +lineto lineto fill}bind def /Mcolorimage{7 1 roll pop pop matrix +invertmatrix concat 2 exch exp 1 sub 3 1 roll 1 1 2 index{1 1 4 index{ +dup 1 sub exch 2 index dup 1 sub exch 7 index 9 index Mshadeproc +Mrectproc}for pop}for pop pop pop pop}bind def /Mimage{pop matrix +invertmatrix concat 2 exch exp 1 sub 3 1 roll 1 1 2 index{1 1 4 index{ +dup 1 sub exch 2 index dup 1 sub exch 7 index Mcharproc setgray +Mrectproc}for pop}for pop pop pop}bind def +%MMA2LTXComment: Here follow the original Mathematica file stripped of the text strings +MathPictureStart +/Courier findfont 10 scalefont setfont +% Scaling calculations +0.5 0.151576 0.309017 0.257514 [ +[ -0.001 -0.001 0 0 ] +[ 1.001 .61903 0 0 ] +] MathScale +% Start of Graphics +1 setlinecap +1 setlinejoin +newpath +[ ] 0 setdash +0 g +p +p +.002 w +.04527 .30902 m +.04527 .31527 L +s +P +p +.002 w +.19685 .30902 m +.19685 .31527 L +s +P +p +.002 w +.34842 .30902 m +.34842 .31527 L +s +P +p +.002 w +.65158 .30902 m +.65158 .31527 L +s +P +p +.002 w +.80315 .30902 m +.80315 .31527 L +s +P +p +.002 w +.95473 .30902 m +.95473 .31527 L +s +P +p +.001 w +.07559 .30902 m +.07559 .31277 L +s +P +p +.001 w +.1059 .30902 m +.1059 .31277 L +s +P +p +.001 w +.13622 .30902 m +.13622 .31277 L +s +P +p +.001 w +.16653 .30902 m +.16653 .31277 L +s +P +p +.001 w +.22716 .30902 m +.22716 .31277 L +s +P +p +.001 w +.25748 .30902 m +.25748 .31277 L +s +P +p +.001 w +.28779 .30902 m +.28779 .31277 L +s +P +p +.001 w +.31811 .30902 m +.31811 .31277 L +s +P +p +.001 w +.37874 .30902 m +.37874 .31277 L +s +P +p +.001 w +.40905 .30902 m +.40905 .31277 L +s +P +p +.001 w +.43937 .30902 m +.43937 .31277 L +s +P +p +.001 w +.46968 .30902 m +.46968 .31277 L +s +P +p +.001 w +.53032 .30902 m +.53032 .31277 L +s +P +p +.001 w +.56063 .30902 m +.56063 .31277 L +s +P +p +.001 w +.59095 .30902 m +.59095 .31277 L +s +P +p +.001 w +.62126 .30902 m +.62126 .31277 L +s +P +p +.001 w +.68189 .30902 m +.68189 .31277 L +s +P +p +.001 w +.71221 .30902 m +.71221 .31277 L +s +P +p +.001 w +.74252 .30902 m +.74252 .31277 L +s +P +p +.001 w +.77284 .30902 m +.77284 .31277 L +s +P +p +.001 w +.83347 .30902 m +.83347 .31277 L +s +P +p +.001 w +.86378 .30902 m +.86378 .31277 L +s +P +p +.001 w +.8941 .30902 m +.8941 .31277 L +s +P +p +.001 w +.92441 .30902 m +.92441 .31277 L +s +P +p +.001 w +.01496 .30902 m +.01496 .31277 L +s +P +p +.001 w +.98504 .30902 m +.98504 .31277 L +s +P +p +.002 w +0 .30902 m +1 .30902 L +s +P +p +.002 w +.5 .0515 m +.50625 .0515 L +s +P +p +.002 w +.5 .18026 m +.50625 .18026 L +s +P +p +.002 w +.5 .43777 m +.50625 .43777 L +s +P +p +.002 w +.5 .56653 m +.50625 .56653 L +s +P +p +.001 w +.5 .07725 m +.50375 .07725 L +s +P +p +.001 w +.5 .10301 m +.50375 .10301 L +s +P +p +.001 w +.5 .12876 m +.50375 .12876 L +s +P +p +.001 w +.5 .15451 m +.50375 .15451 L +s +P +p +.001 w +.5 .20601 m +.50375 .20601 L +s +P +p +.001 w +.5 .23176 m +.50375 .23176 L +s +P +p +.001 w +.5 .25751 m +.50375 .25751 L +s +P +p +.001 w +.5 .28327 m +.50375 .28327 L +s +P +p +.001 w +.5 .33477 m +.50375 .33477 L +s +P +p +.001 w +.5 .36052 m +.50375 .36052 L +s +P +p +.001 w +.5 .38627 m +.50375 .38627 L +s +P +p +.001 w +.5 .41202 m +.50375 .41202 L +s +P +p +.001 w +.5 .46353 m +.50375 .46353 L +s +P +p +.001 w +.5 .48928 m +.50375 .48928 L +s +P +p +.001 w +.5 .51503 m +.50375 .51503 L +s +P +p +.001 w +.5 .54078 m +.50375 .54078 L +s +P +p +.001 w +.5 .02575 m +.50375 .02575 L +s +P +p +.001 w +.5 .59228 m +.50375 .59228 L +s +P +p +.002 w +.5 0 m +.5 .61803 L +s +P +P +0 0 m +1 0 L +1 .61803 L +0 .61803 L +closepath +clip +newpath +p +[ .025 .025 ] 0 setdash +p +.004 w +.02381 .30902 m +.04325 .27609 L +.06268 .2437 L +.08212 .21238 L +.10155 .18265 L +.12099 .155 L +.14043 .12987 L +.15986 .10768 L +.1793 .08881 L +.19874 .07354 L +.20845 .06735 L +.21817 .06215 L +.22789 .05796 L +.23275 .05625 L +.23761 .0548 L +.24247 .05362 L +.24733 .05269 L +.24976 .05233 L +.25219 .05203 L +.25462 .0518 L +.25583 .05171 L +.25705 .05164 L +.25826 .05158 L +.25887 .05155 L +.25948 .05154 L +.26008 .05152 L +.26069 .05151 L +.2613 .0515 L +.2619 .0515 L +.26251 .0515 L +.26312 .05151 L +.26373 .05152 L +.26433 .05154 L +.26494 .05155 L +.26555 .05158 L +.26676 .05164 L +.26798 .05171 L +.26919 .0518 L +.27162 .05203 L +.27405 .05233 L +.27648 .05269 L +.28134 .05362 L +.2862 .0548 L +.29592 .05796 L +.30564 .06215 L +.31535 .06735 L +.33479 .08071 L +.35423 .09781 L +.37366 .11838 L +.3931 .14209 L +Mistroke +.41254 .16853 L +.43197 .19729 L +.45141 .22787 L +.47085 .25979 L +.49028 .29252 L +.50972 .32552 L +.52915 .35824 L +.54859 .39016 L +.56803 .42075 L +.58746 .4495 L +.6069 .47594 L +.62634 .49965 L +.64577 .52022 L +.66521 .53733 L +.67493 .54449 L +.68465 .55069 L +.69436 .55589 L +.70408 .56007 L +.70894 .56178 L +.7138 .56323 L +.71866 .56442 L +.72352 .56534 L +.72595 .5657 L +.72838 .566 L +.73081 .56623 L +.73202 .56632 L +.73324 .5664 L +.73445 .56646 L +.73506 .56648 L +.73567 .5665 L +.73627 .56651 L +.73688 .56652 L +.73749 .56653 L +.7381 .56653 L +.7387 .56653 L +.73931 .56652 L +.73992 .56651 L +.74052 .5665 L +.74174 .56646 L +.74295 .5664 L +.74417 .56632 L +.74538 .56623 L +.74781 .566 L +.75024 .5657 L +.75267 .56534 L +.75753 .56442 L +.76239 .56323 L +.77211 .56007 L +.78183 .55589 L +.80126 .54449 L +Mistroke +.8207 .52923 L +.84014 .51035 L +.85957 .48817 L +.87901 .46304 L +.89845 .43538 L +.91788 .40565 L +.93732 .37434 L +.95675 .34195 L +.97619 .30902 L +Mfstroke +P +P +% End of Graphics +MathPictureEnd +end +%%EndDocument + @endspecial 998 1060 a Fs(\000)1035 1032 y Fu(3)p 1035 +1051 V 1035 1089 a(2)1137 1032 y Fs(\000)p Fu(1)1266 +1060 y Fs(\000)1303 1032 y Fu(1)p 1303 1051 V 1303 1089 +a(2)1554 1032 y(1)p 1554 1051 V 1554 1089 a(2)1688 1032 +y(1)113 b(3)p 1822 1051 V 1822 1089 a(2)1367 1224 y Fs(\000)p +Fu(1)1335 1110 y Fs(\000)p Fu(0)p Fn(:)p Fu(5)1367 885 +y(0)p Fn(:)p Fu(5)1399 771 y(1)200 1319 y FI(Without)16 +b(`)p Fy(-c)p FI(')f(correction)512 b(With)16 b(`)p Fy(-c)p +FI(')f(correction)526 1417 y(Figure)h(2:)21 b(Beha)o(viour)15 +b(of)i(the)f(`)p Fy(-c)p FI(')f(option.)-39 1620 y Fp(6.12)65 +b(Option)22 b Fo(-e)-39 1712 y Fr(T)-5 b(emplate:)19 +b Fy(-e)p Fx(h)p FE(esc)n(ap)n(e)e(se)n(quenc)n(e)t Fx(i)34 +1785 y FI(This)k(option)h(tells)e FE(mma2ltx)i FI(to)g(con)o(v)o(ert)e +(in)o(to)h(L)975 1779 y FC(a)999 1785 y FI(T)1026 1800 +y(E)1053 1785 y(X)g(only)h(the)f(lab)q(els)g(whic)o(h)f(b)q(egin)i +(with)f(the)-39 1845 y(sequence)15 b Fx(h)p FE(esc)n(ap)n(e)j(se)n +(quenc)n(e)t Fx(i)p FI(.)k(F)l(or)17 b(instance)f(with)633 +1946 y Fy(mma2ltx)23 b(-elatex:)14 b FI(m)o(ypic.ps)-39 +2048 y(only)i(lab)q(els)g(whic)o(h)f(b)q(egin)i(with)f(the)g(string)g +(\\)p Fy(latex:)p FI(")k(will)15 b(b)q(e)i(con)o(v)o(erted.)j(Other)c +(lab)q(els)g(are)g(left)f(as)-39 2108 y(in)g(the)h(original)h +FD(Mathematica)d FI(graphic.)-39 2253 y Fp(6.13)65 b(Option)22 +b Fo(-a)-39 2345 y Fr(T)-5 b(emplate:)19 b Fy(-a)p FI([)p +Fx(h)p FE(length)t Fx(i)p FI(:)p Fx(h)p FE(width)t Fx(i)p +FI(:)p Fx(h)p FE(inset)5 b Fx(i)p FI(])34 2418 y(Using)20 +b(this)g(option,)i FE(mma2ltx)f FI(will)e(add)i(t)o(w)o(o)f(arro)o(ws)i +(on)f(the)f Fq(x)g FI(and)h Fq(y)h FI(axes)f(of)f(a)h(2D)g(graphic.)-39 +2478 y Fx(h)p FE(length)t Fx(i)p FI(,)e Fx(h)p FE(width)t +Fx(i)f FI(and)g Fx(h)p FE(inset)5 b Fx(i)18 b FI(are)g(optional)f +(parameters)f(to)i(sp)q(ecify)e(the)h(arro)o(w)h(size,)e(as)i(sho)o(wn) +g(in)-39 2538 y(\014gure)e(3.)34 2598 y(F)l(or)g(instance)114 +2700 y Fy(mma2ltx)23 b(-a)i(mypic.ps)-39 2802 y FI(or)928 +2914 y(6)p eop +%%Page: 7 8 +7 7 bop 173 713 a @beginspecial -12 @llx -36 @lly 106 +@urx 38 @ury 1180 @rwi @setspecial +%%BeginDocument: arrparm.1 +%*Font: cmti10 9.96265 9.96265 64:dca19 + 0.1 setgray +newpath 0 0 moveto +-11.33862 22.67725 lineto +68.03174 0 lineto +-11.33862 -22.67725 lineto + closepath fill + 0 setgray 0 0.5 dtransform truncate idtransform setlinewidth pop [] 0 setdash + 1 setlinejoin 10 setmiterlimit +newpath 0 0 moveto +-11.33862 22.67725 lineto +68.03174 0 lineto +-11.33862 -22.67725 lineto + closepath stroke + 1 setlinecap +newpath -11.33862 -34.01587 moveto +68.03174 -34.01587 lineto stroke +newpath 64.336 -35.54674 moveto +68.03174 -34.01587 lineto +64.336 -32.485 lineto + closepath +gsave fill grestore stroke +newpath -7.64288 -32.485 moveto +-11.33862 -34.01587 lineto +-7.64288 -35.54674 lineto + closepath +gsave fill grestore stroke + 0.5 0 dtransform exch truncate exch idtransform pop setlinewidth +newpath 79.37036 22.67725 moveto +79.37036 -22.67725 lineto stroke + 0 0.5 dtransform truncate idtransform setlinewidth pop +newpath 77.83957 -18.98167 moveto +79.37036 -22.67725 lineto +80.90115 -18.98167 lineto + closepath +gsave fill grestore stroke +newpath 80.90115 18.98167 moveto +79.37036 22.67725 lineto +77.83957 18.98167 lineto + closepath +gsave fill grestore stroke +newpath -11.33862 28.34656 moveto +0 28.34656 lineto stroke +newpath -3.69557 26.81577 moveto +0 28.34656 lineto +-3.69557 29.87735 lineto + closepath +gsave fill grestore stroke +newpath -7.64305 29.87735 moveto +-11.33862 28.34656 lineto +-7.64305 26.81577 lineto + closepath +gsave fill grestore stroke +9.81999 -29.07867 moveto +(length) cmti10 9.96265 fshow +82.37036 -3.45926 moveto +(width) cmti10 9.96265 fshow +-10.56125 31.34656 moveto +(inset) cmti10 9.96265 fshow +showpage +%%EndDocument + @endspecial 586 w @beginspecial 226.770996 @hsize 140.150101 +@vsize @setspecial +%%BeginDocument: arrsamp.eps +%Mma2ltxCommandLine: mma2ltx -a -ucm -w8cm arrsamp.ps +%Mma2ltxComment: For use with Mathematica prologue 'texmma22.pro' +Mathdict begin +/Mwidth 226.77 def +/Mheight 140.15 def +/Mnodistort true def +%Mma2ltxComment: Here follow the original Mathematica file stripped of the text labels +MathPictureStart +/Courier findfont 10 scalefont setfont +% Scaling calculations +0.5 0.10352 0.206011 0.103006 [ +[ -0.001 -0.001 0 0 ] +[ 1.001 .61903 0 0 ] +] MathScale +% Start of Graphics +1 setlinecap +1 setlinejoin +newpath +[ ] 0 setdash +0 g +p +p +.002 w +0 .20601 m +1 .20601 L +s +P +p +.002 w +.5 0 m +.5 .61803 L +s +P +P +0 0 m +1 0 L +1 .61803 L +0 .61803 L +closepath +clip +newpath +p +p +p +.004 w +.18944 .41202 m +.21532 .41202 L +.2412 .41202 L +.26708 .41202 L +.29296 .41202 L +.31884 .41202 L +.34472 .41202 L +.3706 .41202 L +.39648 .41202 L +.42236 .41202 L +.44824 .41202 L +.47412 .41202 L +.5 .41202 L +.52588 .41202 L +.55176 .41202 L +.57764 .41202 L +.60352 .41202 L +.6294 .41202 L +.65528 .41202 L +.68116 .41202 L +.70704 .41202 L +.73292 .41202 L +.7588 .41202 L +.78468 .41202 L +.81056 .41202 L +s +P +P +p +[ .01 .01 ] 0 setdash +.004 w +.18944 .20601 m +.18944 .41202 L +s +.81056 .20601 m +.81056 .41202 L +s +P +P +p +0 w +0 g +1.00100 0.20601 m +0.97600 0.21201 L +0.98200 0.20601 L +0.97600 0.20001 L +F +P +p +0 w +0 g +0.50000 0.61903 m +0.49400 0.59403 L +0.50000 0.60003 L +0.50600 0.59403 L +F +P +% End of Graphics +MathPictureEnd +end +%%EndDocument + @endspecial 1251 162 a Fq(p)1275 169 y Fm(T)1303 162 +y FI(\()p Fq(t)p FI(\))1482 575 y Fq(T)5 b(=)p FI(2)-686 +b Fx(\000)p Fq(T)5 b(=)p FI(2)1241 305 y(1)1241 570 y(0)1690 +568 y Fq(t)503 811 y FI(Figure)16 b(3:)22 b(Examples)14 +b(with)j(the)f(`)p Fy(-a)p FI(')e(option.)114 939 y Fy(mma2ltx)23 +b(-a)i(0.02:0.01:0)o(.00)o(5)d(mypic.ps)34 1030 y FI(The)g(three)f +(parameters)g Fx(h)p FE(length)t Fx(i)p FI(,)k Fx(h)p +FE(width)t Fx(i)p FI(,)f Fx(h)p FE(inset)5 b Fx(i)23 +b FI(m)o(ust)e(b)q(e)h(sp)q(eci\014ed)f(as)i(a)f(fraction)g(of)g(the) +-39 1090 y(picture)15 b(size)g(\(scaled)h(co)q(ordinates\).)22 +b(Default)16 b(v)m(alues)g(are)761 1188 y FE(lenght)44 +b FI(=)d(0)p Fq(:)p FI(025)774 1261 y FE(width)h FI(=)f(0)p +Fq(:)p FI(012)786 1334 y FE(inset)i FI(=)e(0)p Fq(:)p +FI(006)-39 1498 y FB(7)79 b(Including)26 b Fz(mma2ltx)f +FB(\014gures)-39 1608 y FI(T)l(o)13 b(include)f(a)i(picture)e(pro)q +(cessed)i(b)o(y)e FE(mma2ltx)i FI(in)o(to)f(a)27 b(L)1027 +1602 y FC(a)1051 1608 y FI(T)1078 1623 y(E)1105 1608 +y(X)13 b(do)q(cumen)o(t,)f(\014rst)h(y)o(ou)h(should)f(mo)o(v)o(e)e +(the)-39 1668 y(\014le)f(`)p Fy(mmatext.)o(sty)o FI(')e(in)i(y)o(our)h +(L)523 1662 y FC(a)547 1668 y FI(T)574 1683 y(E)601 1668 +y(X)g(input)f(directory)g(and)h(the)g(\014les)f(`)p Fy(texmma22.p)o(ro) +p FI(')o(,)f(`)p Fy(mmawhite)o(.e)o(ps)p FI(')-39 1728 +y(in)15 b(y)o(our)h(T)155 1739 y(E)182 1728 y(X)g(P)o(ostScript)g +(directory)665 1710 y FA(6)683 1728 y FI(.)21 b(Then)c(include)d(the)i +(st)o(yle)f(`)p Fy(mmatext)p FI(')d(at)17 b(the)f(top)g(of)g(y)o(our)g +(do)q(c-)-39 1788 y(umen)o(t:)166 1880 y Fy(\\document)o(sty)o(le)o +([..)o(.,m)o(mat)o(ex)o(t,.)o(..])o({..)o(.})-39 1971 +y FI(and)g(in)o(v)o(ok)o(e)f(the)h(follo)o(wing)g(macro)f(at)i(the)f(p) +q(oin)o(t)g(where)g(y)o(ou)g(wish)g(to)h(include)e(the)h(picture:)166 +2063 y Fy(\\input{my)o(pic)o(})-39 2154 y FI(where)25 +b(`)p Fy(mypic)p FI(')e(is)i(the)h(name)e(of)i(the)f(\014le)g(pro)q +(cessed)h(b)o(y)f FE(mma2ltx)p FI(.)50 b(Note)26 b(that)g(the)f +(command)-39 2214 y(`)p Fy(\\input{m)o(yp)o(ic})o FI(')10 +b(ma)o(y)h(b)q(e)i(in)o(v)o(ok)o(ed)f(within)g(an)o(y)h(L)923 +2208 y FC(a)947 2214 y FI(T)974 2229 y(E)1001 2214 y(X)g(en)o(vironmen) +o(t,)d(for)k(instance)e(the)h(commands:)166 2306 y Fy(\\begin{fi)o(gur) +o(e})243 2366 y(\\centerin)o(g)243 2426 y(\\tabcolse)o(p=)o(1cm)243 +2486 y(\\begin{ta)o(bu)o(lar)o(}{c)o(c})319 2547 y(\\input{mypi)o(c1}) +22 b(&\\input{my)o(pic)o(2})g(\\\\[2cm])319 2607 y(\\input{mypi)o(c3})g +(&\\input{my)o(pic)o(4})243 2667 y(\\end{tabu)o(la)o(r})166 +2727 y(\\end{figu)o(re})p -39 2769 784 2 v 17 2799 a +Fw(6)35 2814 y Fu(This)14 b(is)g(the)g(directory)h(where)g(y)o(ou)e(k)o +(eep)i(the)f Ft(dvips)f Fu(prologue)h(\014les.)928 2914 +y FI(7)p eop +%%Page: 8 9 +8 8 bop -39 166 a FI(will)18 b(pro)q(duce)i(a)g(\014gure)g(con)o +(taining)f(four)h FD(Mathematica)e FI(pictures.)30 b(Sometimes,)17 +b(during)j(the)f(L)1805 160 y FC(a)1829 166 y FI(T)1856 +181 y(E)1883 166 y(X)-39 226 y(pro)q(cessing)d(of)h(a)g(L)304 +220 y FC(a)328 226 y FI(T)355 241 y(E)382 226 y(X)f(\014le)f(con)o +(taining)i(one)f(or)h(more)e FE(mma2ltx)h FI(pictures)g(a)h(message)e +(as)166 328 y Fy(Mathemati)o(ca)22 b(picture:)h('mypic.eps)o(')g +(deltax=0.)o(48)o(502)f(cm)-39 430 y FI(or)16 b(a)h(message)e(as)166 +531 y Fy(Mathemati)o(ca)22 b(picture:)h('mypic.eps)o(')g(deltay=1.)o +(28)o(744)f(cm)-39 633 y FI(or)c(b)q(oth,)g(could)g(app)q(ear.)26 +b(If)17 b(this)h(happ)q(ens)h(it)e(means)g(that)h(the)f(picture)g(is)g +(wider)g(or)i(higher)e(\(b)o(y)g(the)-39 693 y(amoun)o(t)e(sho)o(wn\))i +(than)g(the)f(picture)f(whose)i(dimensions)e(w)o(ere)g(established)h +(with)g FE(mma2ltx)p FI(.)-39 860 y FB(8)79 b(Generating)25 +b Fc(Mathematica)g FB(pictures)-39 969 y FE(mma2ltx)12 +b FI(needs)g(a)h(P)o(ostScript)f(\014le.)19 b(This)13 +b(\014le)e(m)o(ust)g(b)q(e)h(created)g(from)f(within)h +FD(Mathematica)f FI(using)h(the)-39 1029 y(primitiv)n(e)d(`)p +Fy(Display)p FI(')g(\(see)j(the)g FD(Mathematica)f FI(man)o(ual)g(for)i +(a)f(detailed)g(description)f(of)i(this)f(primitiv)o(e)o(\).)34 +1090 y(Since)22 b FE(mma2ltx)i FI(just)g(executes)e(a)i(plain)f +(translation)h(of)f(ev)o(ery)f(string)i(con)o(tained)e(in)h(the)h +FD(Ma-)-39 1150 y(thematica)d FI(P)o(ostScript)i(\014le,)h(w)o(e)e(ma)o +(y)g(sp)q(ecify)g(a)i(L)960 1144 y FC(a)984 1150 y FI(T)1011 +1165 y(E)1038 1150 y(X)f(con)o(trol)g(sequence)f(directly)f(from)h +(within)-39 1210 y FD(Mathematica)p FI(.)d(F)l(or)e(instance,)e(to)i +(mark)e(tic)o(ks)g(with)h(the)g(L)1074 1204 y FC(a)1098 +1210 y FI(T)1125 1225 y(E)1152 1210 y(X)g(greek)g(letter)f(`)p +Fq(\031)r FI(',)f(w)o(e)i(ma)o(y)f(use)37 1312 y Fy(Show[g,)24 +b(Ticks)f(->)i({{0,)f({Pi/2,)g("\\\\pi\\\\ove)o(r2)o("},)e({Pi,)i +("\\\\pi"},)473 1372 y({3Pi/2,)f("3{\\\\Pi\\\\ov)o(er2)o(}")o(},)f +({2Pi,)i("2\\\\pi"},)e(Automatic}])34 1474 y FI(Note,)15 +b(to)g(obtain)h(the)g(bac)o(kslash)f(`)p Fy(\\)p FI(')f(from)h(within)g +FD(Mathematica)f FI(it)h(m)o(ust)f(b)q(e)h(doubled.)21 +b(So)16 b(ev)o(ery)-39 1534 y(L)-27 1528 y FC(a)-3 1534 +y FI(T)24 1549 y(E)51 1534 y(X)g(con)o(trol)g(sequence)f(sp)q +(eci\014ed)h(in)o(to)f(a)i FD(Mathematica)e FI(string)h(m)o(ust)f(b)q +(e)h(preceded)g(b)o(y)f(a)i(`)p Fy(\\\\)p FI('.)34 1594 +y(F)l(or)f(example)e(to)j(place)e(the)h(form)o(ula)807 +1723 y Fq(f)5 b FI(\()p Fq(x)p FI(\))14 b(=)g(sin)1042 +1690 y(1)p 1041 1712 28 2 v 1041 1758 a Fq(x)-39 1849 +y FI(at)19 b(the)g(p)q(oin)o(t)g(\(0)p Fq(:)p FI(5)p +Fq(;)8 b FI(0)p Fq(:)p FI(5\))20 b(of)f(a)h(graphic,)f(left)f(and)i(b)q +(ottom)f(aligned,)g(w)o(e)g(ma)o(y)e(use)j(the)e FD(Mathematica)-39 +1909 y FI(command)166 2011 y Fy(Text["f\(x)o(\)=\\)o(\\s)o(in\\)o(\\fr) +o(ac{)o(1})o({x})o(",)k({0.5,0.5},)g({-1,-1}])-39 2177 +y FB(9)79 b(Manual)26 b(adjustment)f(of)i(lab)r(els)-39 +2287 y FI(Sometime)o(s)12 b(ma)o(y)h(happ)q(ens)j(to)f(ha)o(v)o(e)f(t)o +(w)o(o)h(or)g(more)e(lab)q(els)i(to)q(o)h(m)o(uc)o(h)c(closed)j(eac)o +(h)f(other.)21 b(In)14 b(this)h(case)-39 2347 y(a)k(man)o(ual)e +(adjustmen)o(t)g(is)i(needed.)27 b(T)l(o)20 b(do)f(this,)f(edit)g(the)h +(\014le)f(generated)g(b)o(y)g FE(mma2ltx)i FI(ha)o(ving)e(the)-39 +2407 y(extension)d(`)p Fy(.tex)p FI('.)k(F)l(or)d(instance,)g(let's)f +(analyze)h(the)g(\014le)g(`)p Fy(mypic.te)o(x)p FI(')o(:)-39 +2509 y Fy(\045)25 b(Picture:)e(mypic.eps)-39 2569 y(\045)i(Created)e +(by)i(mma2ltx)e(v1.2)h(-)h(Copyright)e(\(C\))h(1994)g(Giuseppe)f +(Ghib\\`o)-39 2629 y(\045)i(Command)e(line)h(:)h(mma2ltx)e(-ucm)i +(-w10cm)e(-sfootnote)o(siz)o(e)f(mypic.ps)-39 2689 y(\045)j(Creation)e +(date:)g(Sat)i(Jul)f(16)h(10:40:43)e(1994)-39 2749 y(\\mmaheade)o(rpr)o +(ot)o(rue)-39 2810 y({\045)928 2914 y FI(8)p eop +%%Page: 9 10 +9 9 bop -39 166 a Fy(\\footnote)o(siz)o(e\045)-39 226 +y(\\mmasetpi)o(c\(1)o(0.)o(000)o(0,6)o(.1)o(803)o(\)[c)o(m]{)o(my)o +(pic)o(.ep)o(s})-39 286 y(\\mmatextf)o(its)o(\(2)o(.15)o(2,3)o(.0)o +(90\))o(\(0,)o(2\){)o($0)o(.2$)o(})-39 347 y(\\mmatextf)o(its)o(\(4)o +(.05)o(1,3)o(.0)o(90\))o(\(0,)o(2\){)o($0)o(.4$)o(})-39 +407 y(\\mmatextf)o(its)o(\(5)o(.94)o(9,3)o(.0)o(90\))o(\(0,)o(2\){)o +($0)o(.6$)o(})-39 467 y(\\mmatextf)o(its)o(\(7)o(.84)o(8,3)o(.0)o(90\)) +o(\(0,)o(2\){)o($0)o(.8$)o(})-39 527 y(\\mmatextf)o(its)o(\(9)o(.74)o +(7,3)o(.0)o(90\))o(\(0,)o(2\){)o($1)o($})-39 587 y(\\mmatextf)o(its)o +(\(0)o(.12)o(9,0)o(.1)o(57\))o(\(1,)o(0\){)o($-)o(1$})-39 +648 y(\\mmatextf)o(its)o(\(0)o(.12)o(9,1)o(.6)o(23\))o(\(1,)o(0\){)o +($-)o(0.5)o($})-39 708 y(\\mmatextf)o(its)o(\(0)o(.12)o(9,4)o(.5)o +(57\))o(\(1,)o(0\){)o($0)o(.5$)o(})-39 768 y(\\mmatextf)o(its)o(\(0)o +(.12)o(9,6)o(.0)o(24\))o(\(1,)o(0\){)o($1)o($})-39 828 +y(\\mmatextf)o(its)o(\(5)o(.00)o(0,4)o(.5)o(57\))o(\(-1)o(,-1)o(\){)o +($f\()o(x\)=)22 b(\\sin)i(\\frac{1}{x)o(}$})-39 888 y(\\begin{mm)o(api) +o(ct)o(ure)o(})-39 949 y(\\mmaputte)o(xt\()o(2.)o(152)o(,3.)o(09)o +(0\)\()o(0,2)o(\){$)o(0.)o(2$})-39 1009 y(\\mmaputte)o(xt\()o(4.)o(051) +o(,3.)o(09)o(0\)\()o(0,2)o(\){$)o(0.)o(4$})-39 1069 y(\\mmaputte)o +(xt\()o(5.)o(949)o(,3.)o(09)o(0\)\()o(0,2)o(\){$)o(0.)o(6$})-39 +1129 y(\\mmaputte)o(xt\()o(7.)o(848)o(,3.)o(09)o(0\)\()o(0,2)o(\){$)o +(0.)o(8$})-39 1189 y(\\mmaputte)o(xt\()o(9.)o(747)o(,3.)o(09)o(0\)\()o +(0,2)o(\){$)o(1$)o(})-39 1249 y(\\mmaputte)o(xt\()o(0.)o(129)o(,0.)o +(15)o(7\)\()o(1,0)o(\){$)o(-1)o($})-39 1310 y(\\mmaputte)o(xt\()o(0.)o +(129)o(,1.)o(62)o(3\)\()o(1,0)o(\){$)o(-0)o(.5$)o(})-39 +1370 y(\\mmaputte)o(xt\()o(0.)o(129)o(,4.)o(55)o(7\)\()o(1,0)o(\){$)o +(0.)o(5$})-39 1430 y(\\mmaputte)o(xt\()o(0.)o(129)o(,6.)o(02)o(4\)\()o +(1,0)o(\){$)o(1$)o(})-39 1490 y(\\mmaputte)o(xt\()o(5.)o(000)o(,4.)o +(55)o(7\)\()o(-1,)o(-1\))o({$)o(f\(x)o(\)=)e(\\sin)i(\\frac{1}{x})o($}) +-39 1550 y(\\end{mmap)o(ict)o(ur)o(e}\045)-39 1611 y(}\045)-39 +1707 y FI(W)l(e)h(ma)o(y)f(observ)o(e)h(that)g(ev)o(ery)f(lab)q(el)i +(app)q(ears)g(t)o(wice)e(in)i(the)f Fy(.tex)f FI(\014le:)39 +b(within)25 b(the)g(command)-39 1767 y Fy(\\mmatextf)o(its)7 +b FI(and)k(in)g(the)f(command)f Fy(\\mmaputtext)e FI(\(and)k(sometimes) +d(in)j(the)f(command)f Fy(\\mmaputtex)o(t*)p FI(\).)-39 +1827 y(These)16 b(commands)e(ha)o(v)o(e)i(the)g(follo)o(wing)g(syn)o +(tax:)429 1924 y Fy(\\mmatextfi)o(ts\()o Fq(x;)8 b(y)q +Fy(\)\()p Fq(s)915 1931 y Fm(x)934 1924 y Fq(;)g(s)979 +1931 y Fm(y)999 1924 y Fy(\))p FI([)p Fy(\()p FE(o\013)1120 +1931 y Fb(x)1141 1924 y Fq(;)g FE(o\013)1218 1931 y Fb(y)1240 +1924 y Fy(\))p FI(])p Fy({)p FE(obje)n(ct)p Fy(})429 +1984 y(\\mmaputtex)o(t)23 b(\()p Fq(x;)8 b(y)r Fy(\)\()p +Fq(s)914 1991 y Fm(x)934 1984 y Fq(;)g(s)979 1991 y Fm(y)999 +1984 y Fy(\))p FI([)p Fy(\()p FE(o\013)1120 1991 y Fb(x)1141 +1984 y Fq(;)g FE(o\013)1218 1991 y Fb(y)1240 1984 y Fy(\))p +FI(])p Fy({)p FE(obje)n(ct)p Fy(})429 2044 y(\\mmaputtex)o(t*\()o +Fq(x;)g(y)q Fy(\)\()p Fq(s)915 2051 y Fm(x)934 2044 y +Fq(;)g(s)979 2051 y Fm(y)999 2044 y Fy(\))p FI([)p Fy(\()p +FE(o\013)1120 2051 y Fb(x)1141 2044 y Fq(;)g FE(o\013)1218 +2051 y Fb(y)1240 2044 y Fy(\))p FI(])p Fy({)p FE(obje)n(ct)p +Fy(})-39 2140 y FI(where)17 b(\()p Fq(x;)8 b(y)r FI(\))17 +b(are)h(the)g(co)q(ordinates)h(of)f(the)g(reference)e(p)q(oin)o(t.)27 +b(\()p Fq(s)1207 2147 y Fm(x)1229 2140 y Fq(;)8 b(s)1274 +2147 y Fm(y)1295 2140 y FI(\))18 b(are)g(the)f(b)q(ounding)j(b)q(o)o(x) +e(co)q(or-)-39 2200 y(dinates)g(as)h(explained)e(at)i +Fx(x)p FI(6.11.)29 b(\()p FE(o\013)700 2207 y Fb(x)722 +2200 y Fq(;)8 b FE(o\013)799 2207 y Fb(y)821 2200 y FI(\))19 +b(is)f(an)h(optional)g(argumen)o(t)e(and)i(represen)o(ts)f(the)g +(o\013set)-39 2261 y(in)i(the)h Fq(x)g FI(and)h Fq(y)h +FI(direction)d(from)g(the)h(reference)e(p)q(oin)o(t)j(\()p +Fq(x;)8 b(y)r FI(\).)35 b Fx(f)p FE(obje)n(ct)5 b Fx(g)21 +b FI(ma)o(y)f(b)q(e)h(an)o(y)g(L)1716 2255 y FC(a)1740 +2261 y FI(T)1767 2276 y(E)1794 2261 y(X)g(ob-)-39 2321 +y(ject)i(\(ev)o(en)g(another)h FE(mma2ltx)h FI(picture\).)44 +b(The)24 b(unit)g(of)g(measure)f(is)h(the)f(one)i(whic)o(h)e(app)q +(ears)i(in)-39 2381 y(`)p Fy(\\mmasetp)o(ic)o FI(')11 +b(command)i(\(in)h(this)g(case)g Fy(cm)p FI(\).)20 b(The)14 +b(command)f(`)p Fy(\\mmaputt)o(ext)o(*)p FI(')e(has)k(the)f(same)f +(e\013ect)-39 2441 y(of)k(`)p Fy(\\mmaputtex)o(t)p FI(')o(,)e(except)h +(it)h(encloses)g(the)h FE(obje)n(ct)g FI(in)f(a)h(white)f(b)q(o)o(x)h +(\(see)f(the)g(lab)q(el)g(\\some)g(text")g(in)-39 2501 +y(the)f(3D)g(graphic)h(sho)o(wn)g(in)f(Fig.)f(4\).)34 +2562 y(F)l(or)d(instance)g(supp)q(ose)i(w)o(e)e(w)o(an)o(t)h(to)f(mo)o +(v)o(e)f(righ)o(t)h(the)g(lab)q(el)g(`0)p Fq(:)p FI(2')g(b)o(y)g(0)p +Fq(:)p FI(5)c(cm)o(,)k(then)h(w)o(e)f(m)o(ust)f(replace)-39 +2622 y(the)16 b(line)166 2718 y Fy(\\mmatextf)o(its)o(\(2)o(.15)o(2,3)o +(.09)o(0\))o(\(0,)o(2\){)o($0.)o(2$)o(})-39 2814 y FI(with)g(the)g +(line)928 2914 y(9)p eop +%%Page: 10 11 +10 10 bop 166 166 a Fy(\\mmatextf)o(its)o(\(2)o(.15)o(2,3)o(.09)o(0\))o +(\(0,)o(2\)\()o(0.5)o(,0)o(\){$)o(0.2)o($})-39 268 y +FI(and)16 b(the)g(line)166 369 y Fy(\\mmaputte)o(xt\()o(2.)o(152)o(,3.) +o(090)o(\)\()o(0,2)o(\){$)o(0.2)o($})-39 471 y FI(with)g(the)g(line)166 +573 y Fy(\\mmaputte)o(xt\()o(2.)o(152)o(,3.)o(090)o(\)\()o(0,2)o(\)\(0) +o(.5,)o(0\))o({$0)o(.2$)o(})-39 675 y FI(Note)f(that)i(this)f(approac)o +(h)h(is)e(similar)f(to)j(the)f(one)g(explained)f(at)i +Fx(x)p FI(6.11,)f(with)g(the)g(exception)f(that)h(w)o(e)-39 +735 y(ma)o(y)e(con)o(trol)i(ev)o(ery)f(lab)q(el,)g(rather)i(than)f(a)h +(group)g(of)g(lab)q(els.)34 795 y(No)o(w)i(supp)q(ose)i(w)o(e)f(w)o(an) +o(t)g(to)g(replace)f(the)h(lab)q(el)f(`0)p Fq(:)p FI(8')g(placed)h +(under)g(the)f Fq(x)p FI(-axis)h(with)g(the)f(lab)q(el)-39 +855 y(`)p Fq(x)3 862 y FA(1)22 855 y FI(')e(to)h(place)f(o)o(v)o(er)g +(the)g Fq(x)p FI(-axis)h(with)g(the)f(lo)o(w)h(edge)f(of)h(the)g(\(in)o +(visible\))d(b)q(o)o(x)j(that)h(b)q(ounds)g(this)e(lab)q(el)-39 +915 y(at)f(0)p Fq(:)p FI(2)8 b(cm)15 b(from)h(the)g Fq(x)p +FI(-axis.)21 b(In)16 b(this)g(case)g(w)o(e)g(m)o(ust)f(replace)g(the)h +(lines)166 1017 y Fy(\\mmatextf)o(its)o(\(7)o(.84)o(8,3)o(.09)o(0\))o +(\(0,)o(2\){)o($0.)o(8$)o(})166 1077 y(.)166 1137 y(.)166 +1198 y(.)166 1258 y(\\mmaputte)o(xt\()o(7.)o(848)o(,3.)o(090)o(\)\()o +(0,2)o(\){$)o(0.8)o($})-39 1359 y FI(with)g(the)g(lines)166 +1461 y Fy(\\mmatextf)o(its)o(\(7)o(.84)o(8,3)o(.09)o(0\))o(\(0,)o(-1\)) +o(\(0,)o(0.)o(2\){)o($x_)o(1$)o(})166 1521 y(.)166 1582 +y(.)166 1642 y(.)166 1702 y(\\mmaputte)o(xt\()o(7.)o(848)o(,3.)o(090)o +(\)\()o(0,-)o(1\)\()o(0,0)o(.2)o(\){$)o(x_1)o($})-39 +1804 y FI(The)g(result)g(is)g(sho)o(wn)h(in)e(Fig.)h(4.)385 +2601 y @beginspecial 283.463745 @hsize 175.189026 @vsize +@setspecial +%%BeginDocument: 12mag.eps +%MMA2LTXCommandLine: mma2ltx -ucm -sfootnotesize -p -w10cm 12mag.ps +% Mathematica v2.2 prologue +/Mathdict 150 dict def +Mathdict begin +/Mwidth 283.46 def +/Mheight 175.19 def +/Mnodistort true def +/Mlmarg 0 def /Mrmarg 0 def /Mbmarg 0 def /Mtmarg 0 def /Mtransform{} +bind def /Mfixwid true def /Mfixdash false def /Mrot 0 def /Mpstart{ +MathPictureStart}bind def /Mpend{MathPictureEnd}bind def /Mscale{0 1 0 1 +5 -1 roll MathScale}bind def /ISOLatin1Encoding dup where{pop pop}{[ +/.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef +/.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef +/.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef +/.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef +/space /exclam /quotedbl /numbersign /dollar /percent /ampersand +/quoteright /parenleft /parenright /asterisk /plus /comma /minus /period +/slash /zero /one /two /three /four /five /six /seven /eight /nine +/colon /semicolon /less /equal /greater /question /at /A /B /C /D /E /F +/G /H /I /J /K /L /M /N /O /P /Q /R /S /T /U /V /W /X /Y /Z /bracketleft +/backslash /bracketright /asciicircum /underscore /quoteleft /a /b /c /d +/e /f /g /h /i /j /k /l /m /n /o /p /q /r /s /t /u /v /w /x /y /z +/braceleft /bar /braceright /asciitilde /.notdef /.notdef /.notdef +/.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef +/.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /dotlessi /grave +/acute /circumflex /tilde /macron /breve /dotaccent /dieresis /.notdef +/ring /cedilla /.notdef /hungarumlaut /ogonek /caron /space /exclamdown +/cent /sterling /currency /yen /brokenbar /section /dieresis /copyright +/ordfeminine /guillemotleft /logicalnot /hyphen /registered /macron +/degree /plusminus /twosuperior /threesuperior /acute /mu /paragraph +/periodcentered /cedilla /onesuperior /ordmasculine /guillemotright +/onequarter /onehalf /threequarters /questiondown /Agrave /Aacute +/Acircumflex /Atilde /Adieresis /Aring /AE /Ccedilla /Egrave /Eacute +/Ecircumflex /Edieresis /Igrave /Iacute /Icircumflex /Idieresis /Eth +/Ntilde /Ograve /Oacute /Ocircumflex /Otilde /Odieresis /multiply +/Oslash /Ugrave /Uacute /Ucircumflex /Udieresis /Yacute /Thorn +/germandbls /agrave /aacute /acircumflex /atilde /adieresis /aring /ae +/ccedilla /egrave /eacute /ecircumflex /edieresis /igrave /iacute +/icircumflex /idieresis /eth /ntilde /ograve /oacute /ocircumflex +/otilde /odieresis /divide /oslash /ugrave /uacute /ucircumflex +/udieresis /yacute /thorn /ydieresis]def}ifelse /MFontDict 50 dict def +/MStrCat{exch dup length 2 index length add string dup 3 1 roll copy +length exch dup 4 2 roll exch putinterval}def /MCreateEncoding{1 index +255 string cvs(-)MStrCat 1 index MStrCat cvn exch(Encoding)MStrCat cvn +dup where{exch get}{pop StandardEncoding}ifelse 3 1 roll dup MFontDict +exch known not{1 index findfont dup length dict begin{1 index /FID ne{ +def}{pop pop}ifelse}forall /Encoding 3 index def currentdict end 1 index +exch definefont pop MFontDict 1 index null put}if exch pop exch pop}def +/ISOLatin1{(ISOLatin1)MCreateEncoding}def /ISO8859{(ISOLatin1) +MCreateEncoding}def /Mcopyfont{dup maxlength dict exch{1 index /FID eq{ +pop pop}{2 index 3 1 roll put}ifelse}forall}def /Plain /Courier findfont +Mcopyfont definefont pop /Bold /Courier findfont Mcopyfont +definefont pop /Italic /Courier findfont Mcopyfont definefont +pop /MathPictureStart{gsave Mtransform Mlmarg Mbmarg translate Mwidth +Mlmarg Mrmarg add sub /Mwidth exch def Mheight Mbmarg Mtmarg add sub +/Mheight exch def /Mtmatrix matrix currentmatrix def /Mgmatrix matrix +currentmatrix def}bind def /MathPictureEnd{grestore}bind def /MFill{0 0 +moveto Mwidth 0 lineto Mwidth Mheight lineto 0 Mheight lineto fill}bind +def /MPlotRegion{3 index Mwidth mul 2 index Mheight mul translate exch +sub Mheight mul /Mheight exch def exch sub Mwidth mul /Mwidth exch def} +bind def /MathSubStart{Momatrix Mgmatrix Mtmatrix Mwidth Mheight 7 -2 +roll moveto Mtmatrix setmatrix currentpoint Mgmatrix setmatrix 9 -2 roll +moveto Mtmatrix setmatrix currentpoint 2 copy translate /Mtmatrix matrix +currentmatrix def 3 -1 roll exch sub /Mheight exch def sub /Mwidth exch +def}bind def /MathSubEnd{/Mheight exch def /Mwidth exch def /Mtmatrix +exch def dup setmatrix /Mgmatrix exch def /Momatrix exch def}bind def +/Mdot{moveto 0 0 rlineto stroke}bind def /Mtetra{moveto lineto lineto +lineto fill}bind def /Metetra{moveto lineto lineto lineto closepath +gsave fill grestore 0 setgray stroke}bind def /Mistroke{flattenpath 0 0 +0{4 2 roll pop pop}{4 -1 roll 2 index sub dup mul 4 -1 roll 2 index sub +dup mul add sqrt 4 -1 roll add 3 1 roll}{stop}{stop}pathforall pop pop +currentpoint stroke moveto currentdash 3 -1 roll add setdash}bind def +/Mfstroke{stroke currentdash pop 0 setdash}bind def /Mrotsboxa{gsave dup +/Mrot exch def Mrotcheck Mtmatrix dup setmatrix 7 1 roll 4 index 4 index +translate rotate 3 index -1 mul 3 index -1 mul translate /Mtmatrix +matrix currentmatrix def grestore Msboxa 3 -1 roll /Mtmatrix exch def +/Mrot 0 def}bind def /Msboxa{newpath 5 -1 roll Mvboxa pop Mboxout 6 -1 +roll 5 -1 roll 4 -1 roll Msboxa1 5 -3 roll Msboxa1 Mboxrot[7 -2 roll 2 +copy[3 1 roll 10 -1 roll 9 -1 roll]6 1 roll 5 -2 roll]}bind def /Msboxa1 +{sub 2 div dup 2 index 1 add mul 3 -1 roll -1 add 3 -1 roll mul}bind def +/Mvboxa{Mfixwid{Mvboxa1}{dup Mwidthcal 0 exch{add}forall exch Mvboxa1 4 +index 7 -1 roll add 4 -1 roll pop 3 1 roll}ifelse}bind def /Mvboxa1{ +gsave newpath[true 3 -1 roll{Mbbox 5 -1 roll{0 5 1 roll}{7 -1 roll exch +sub(m)stringwidth pop .3 mul sub 7 1 roll 6 -1 roll 4 -1 roll Mmin 3 -1 +roll 5 index add 5 -1 roll 4 -1 roll Mmax 4 -1 roll}ifelse false}forall{ +stop}if counttomark 1 add 4 roll]grestore}bind def /Mbbox{1 dict begin 0 +0 moveto /temp(T)def{gsave currentpoint newpath moveto temp 0 3 -1 roll +put temp false charpath flattenpath currentpoint pathbbox grestore +moveto lineto moveto}forall pathbbox newpath end}bind def /Mmin{2 copy +gt{exch}if pop}bind def /Mmax{2 copy lt{exch}if pop}bind def /Mrotshowa{ +dup /Mrot exch def Mrotcheck Mtmatrix dup setmatrix 7 1 roll 4 index 4 +index translate rotate 3 index -1 mul 3 index -1 mul translate /Mtmatrix +matrix currentmatrix def Mgmatrix setmatrix Mshowa /Mtmatrix exch def +/Mrot 0 def}bind def /Mshowa{4 -2 roll moveto 2 index Mtmatrix setmatrix +Mvboxa 7 1 roll Mboxout 6 -1 roll 5 -1 roll 4 -1 roll Mshowa1 4 1 roll +Mshowa1 rmoveto currentpoint Mfixwid{Mshowax}{Mshoway}ifelse pop pop pop +pop Mgmatrix setmatrix}bind def /Mshowax{0 1 4 index length -1 add{2 +index 4 index 2 index get 3 index add moveto 4 index exch get Mfixdash{ +Mfixdashp}if show}for}bind def /Mfixdashp{dup length 1 gt 1 index true +exch{45 eq and}forall and{gsave(--)stringwidth pop(-)stringwidth pop sub +2 div 0 rmoveto dup length 1 sub{(-)show}repeat grestore}if}bind def +/Mshoway{3 index Mwidthcal 5 1 roll 0 1 4 index length -1 add{2 index 4 +index 2 index get 3 index add moveto 4 index exch get[6 index aload +length 2 add -1 roll{pop Strform stringwidth pop neg exch add 0 rmoveto} +exch kshow cleartomark}for pop}bind def /Mwidthcal{[exch{Mwidthcal1} +forall][exch dup Maxlen -1 add 0 1 3 -1 roll{[exch 2 index{1 index Mget +exch}forall pop Maxget exch}for pop]Mreva}bind def /Mreva{[exch aload +length -1 1{1 roll}for]}bind def /Mget{1 index length -1 add 1 index ge{ +get}{pop pop 0}ifelse}bind def /Maxlen{[exch{length}forall Maxget}bind +def /Maxget{counttomark -1 add 1 1 3 -1 roll{pop Mmax}for exch pop}bind +def /Mwidthcal1{[exch{Strform stringwidth pop}forall]}bind def /Strform{ +/tem(x)def tem 0 3 -1 roll put tem}bind def /Mshowa1{2 copy add 4 1 roll +sub mul sub -2 div}bind def /MathScale{Mwidth Mheight Mlp translate +scale /yscale exch def /ybias exch def /xscale exch def /xbias exch def +/Momatrix xscale yscale matrix scale xbias ybias matrix translate matrix +concatmatrix def /Mgmatrix matrix currentmatrix def}bind def /Mlp{3 copy +Mlpfirst{Mnodistort{Mmin dup}if 4 index 2 index 2 index Mlprun 11 index +11 -1 roll 10 -4 roll Mlp1 8 index 9 -5 roll Mlp1 4 -1 roll and{exit}if +3 -1 roll pop pop}loop exch 3 1 roll 7 -3 roll pop pop pop}bind def +/Mlpfirst{3 -1 roll dup length 2 copy -2 add get aload pop pop pop 4 -2 +roll -1 add get aload pop pop pop 6 -1 roll 3 -1 roll 5 -1 roll sub div +4 1 roll exch sub div}bind def /Mlprun{2 copy 4 index 0 get dup 4 1 roll +Mlprun1 3 copy 8 -2 roll 9 -1 roll{3 copy Mlprun1 3 copy 11 -3 roll /gt +Mlpminmax 8 3 roll 11 -3 roll /lt Mlpminmax 8 3 roll}forall pop pop pop +pop 3 1 roll pop pop aload pop 5 -1 roll aload pop exch 6 -1 roll +Mlprun2 8 2 roll 4 -1 roll Mlprun2 6 2 roll 3 -1 roll Mlprun2 4 2 roll +exch Mlprun2 6 2 roll}bind def /Mlprun1{aload pop exch 6 -1 roll 5 -1 +roll mul add 4 -2 roll mul 3 -1 roll add}bind def /Mlprun2{2 copy add 2 +div 3 1 roll exch sub}bind def /Mlpminmax{cvx 2 index 6 index 2 index +exec{7 -3 roll 4 -1 roll}if 1 index 5 index 3 -1 roll exec{4 1 roll pop +5 -1 roll aload pop pop 4 -1 roll aload pop[8 -2 roll pop 5 -2 roll pop +6 -2 roll pop 5 -1 roll]4 1 roll pop}{pop pop pop}ifelse}bind def /Mlp1{ +5 index 3 index sub 5 index 2 index mul 1 index le 1 index 0 le or dup +not{1 index 3 index div .99999 mul 8 -1 roll pop 7 1 roll}if 8 -1 roll 2 +div 7 -2 roll pop sub 5 index 6 -3 roll pop pop mul sub exch}bind def +/intop 0 def /inrht 0 def /inflag 0 def /outflag 0 def /xadrht 0 def +/xadlft 0 def /yadtop 0 def /yadbot 0 def /Minner{outflag 1 eq{/outflag +0 def /intop 0 def /inrht 0 def}if 5 index gsave Mtmatrix setmatrix +Mvboxa pop grestore 3 -1 roll pop dup intop gt{/intop exch def}{pop} +ifelse dup inrht gt{/inrht exch def}{pop}ifelse pop /inflag 1 def}bind +def /Mouter{/xadrht 0 def /xadlft 0 def /yadtop 0 def /yadbot 0 def +inflag 1 eq{dup 0 lt{dup intop mul neg /yadtop exch def}if dup 0 gt{dup +intop mul /yadbot exch def}if pop dup 0 lt{dup inrht mul neg /xadrht +exch def}if dup 0 gt{dup inrht mul /xadlft exch def}if pop /outflag 1 +def}{pop pop}ifelse /inflag 0 def /inrht 0 def /intop 0 def}bind def +/Mboxout{outflag 1 eq{4 -1 roll xadlft leadjust add sub 4 1 roll 3 -1 +roll yadbot leadjust add sub 3 1 roll exch xadrht leadjust add add exch +yadtop leadjust add add /outflag 0 def /xadlft 0 def /yadbot 0 def +/xadrht 0 def /yadtop 0 def}if}bind def /leadjust{(m)stringwidth pop .5 +mul}bind def /Mrotcheck{dup 90 eq{yadbot /yadbot xadrht def /xadrht +yadtop def /yadtop xadlft def /xadlft exch def}if dup cos 1 index sin +Checkaux dup cos 1 index sin neg exch Checkaux 3 1 roll pop pop}bind def +/Checkaux{4 index exch 4 index mul 3 1 roll mul add 4 1 roll}bind def +/Mboxrot{Mrot 90 eq{brotaux 4 2 roll}if Mrot 180 eq{4 2 roll brotaux 4 2 +roll brotaux}if Mrot 270 eq{4 2 roll brotaux}if}bind def /brotaux{neg +exch neg}bind def /Mabsproc{0 matrix defaultmatrix dtransform +idtransform dup mul exch dup mul add sqrt}bind def /Mabswid{Mabsproc +setlinewidth}bind def /Mabsdash{exch[exch{Mabsproc}forall]exch setdash} +bind def /MBeginOrig{Momatrix concat}bind def /MEndOrig{Mgmatrix +setmatrix}bind def /sampledsound where{pop}{/sampledsound{exch pop exch +5 1 roll mul 4 idiv mul 2 idiv exch pop exch /Mtempproc exch def{ +Mtempproc pop}repeat}bind def}ifelse /g{setgray}bind def /k{ +setcmykcolor}bind def /m{moveto}bind def /p{gsave}bind def /r{ +setrgbcolor}bind def /w{setlinewidth}bind def /C{curveto}bind def /F{ +fill}bind def /L{lineto}bind def /P{grestore}bind def /s{stroke}bind def +/setcmykcolor where{pop}{/setcmykcolor{4 1 roll[4 1 roll]{1 index sub 1 +sub neg dup 0 lt{pop 0}if dup 1 gt{pop 1}if exch}forall pop setrgbcolor} +bind def}ifelse /Mcharproc{currentfile(x)readhexstring pop 0 get exch +div}bind def /Mshadeproc{dup 3 1 roll{dup Mcharproc 3 1 roll}repeat 1 eq +{setgray}{3 eq{setrgbcolor}{setcmykcolor}ifelse}ifelse}bind def +/Mrectproc{3 index 2 index moveto 2 index 3 -1 roll lineto dup 3 1 roll +lineto lineto fill}bind def /Mcolorimage{7 1 roll pop pop matrix +invertmatrix concat 2 exch exp 1 sub 3 1 roll 1 1 2 index{1 1 4 index{ +dup 1 sub exch 2 index dup 1 sub exch 7 index 9 index Mshadeproc +Mrectproc}for pop}for pop pop pop pop}bind def /Mimage{pop matrix +invertmatrix concat 2 exch exp 1 sub 3 1 roll 1 1 2 index{1 1 4 index{ +dup 1 sub exch 2 index dup 1 sub exch 7 index Mcharproc setgray +Mrectproc}for pop}for pop pop pop}bind def +%MMA2LTXComment: Here follow the original Mathematica file stripped of the text strings +MathPictureStart +/Courier findfont 10 scalefont setfont +% Scaling calculations +0.0238095 0.952381 0.309017 0.294302 [ +[ -0.001 -0.001 0 0 ] +[ 1.001 .61903 0 0 ] +] MathScale +% Start of Graphics +1 setlinecap +1 setlinejoin +newpath +[ ] 0 setdash +0 g +p +p +.002 w +.21429 .30902 m +.21429 .31527 L +s +P +p +.002 w +.40476 .30902 m +.40476 .31527 L +s +P +p +.002 w +.59524 .30902 m +.59524 .31527 L +s +P +p +.002 w +.78571 .30902 m +.78571 .31527 L +s +P +p +.002 w +.97619 .30902 m +.97619 .31527 L +s +P +p +.001 w +.0619 .30902 m +.0619 .31277 L +s +P +p +.001 w +.1 .30902 m +.1 .31277 L +s +P +p +.001 w +.1381 .30902 m +.1381 .31277 L +s +P +p +.001 w +.17619 .30902 m +.17619 .31277 L +s +P +p +.001 w +.25238 .30902 m +.25238 .31277 L +s +P +p +.001 w +.29048 .30902 m +.29048 .31277 L +s +P +p +.001 w +.32857 .30902 m +.32857 .31277 L +s +P +p +.001 w +.36667 .30902 m +.36667 .31277 L +s +P +p +.001 w +.44286 .30902 m +.44286 .31277 L +s +P +p +.001 w +.48095 .30902 m +.48095 .31277 L +s +P +p +.001 w +.51905 .30902 m +.51905 .31277 L +s +P +p +.001 w +.55714 .30902 m +.55714 .31277 L +s +P +p +.001 w +.63333 .30902 m +.63333 .31277 L +s +P +p +.001 w +.67143 .30902 m +.67143 .31277 L +s +P +p +.001 w +.70952 .30902 m +.70952 .31277 L +s +P +p +.001 w +.74762 .30902 m +.74762 .31277 L +s +P +p +.001 w +.82381 .30902 m +.82381 .31277 L +s +P +p +.001 w +.8619 .30902 m +.8619 .31277 L +s +P +p +.001 w +.9 .30902 m +.9 .31277 L +s +P +p +.001 w +.9381 .30902 m +.9381 .31277 L +s +P +p +.002 w +0 .30902 m +1 .30902 L +s +P +p +.002 w +.02381 .01472 m +.03006 .01472 L +s +P +p +.002 w +.02381 .16187 m +.03006 .16187 L +s +P +p +.002 w +.02381 .45617 m +.03006 .45617 L +s +P +p +.002 w +.02381 .60332 m +.03006 .60332 L +s +P +p +.001 w +.02381 .04415 m +.02756 .04415 L +s +P +p +.001 w +.02381 .07358 m +.02756 .07358 L +s +P +p +.001 w +.02381 .10301 m +.02756 .10301 L +s +P +p +.001 w +.02381 .13244 m +.02756 .13244 L +s +P +p +.001 w +.02381 .1913 m +.02756 .1913 L +s +P +p +.001 w +.02381 .22073 m +.02756 .22073 L +s +P +p +.001 w +.02381 .25016 m +.02756 .25016 L +s +P +p +.001 w +.02381 .27959 m +.02756 .27959 L +s +P +p +.001 w +.02381 .33845 m +.02756 .33845 L +s +P +p +.001 w +.02381 .36788 m +.02756 .36788 L +s +P +p +.001 w +.02381 .39731 m +.02756 .39731 L +s +P +p +.001 w +.02381 .42674 m +.02756 .42674 L +s +P +p +.001 w +.02381 .4856 m +.02756 .4856 L +s +P +p +.001 w +.02381 .51503 m +.02756 .51503 L +s +P +p +.001 w +.02381 .54446 m +.02756 .54446 L +s +P +p +.001 w +.02381 .57389 m +.02756 .57389 L +s +P +p +.002 w +.02381 0 m +.02381 .61803 L +s +P +P +0 0 m +1 0 L +1 .61803 L +0 .61803 L +closepath +clip +newpath +p +p +p +.004 w +.02505 .60122 m +.02629 .50433 L +.02753 .01495 L +.02877 .20456 L +.03001 .40662 L +.03125 .52122 L +.03249 .37939 L +.03373 .59849 L +.03497 .16526 L +.03621 .59913 L +.03745 .49932 L +.03869 .57978 L +.03993 .47842 L +.04117 .01686 L +.04241 .54573 L +.04365 .08292 L +.04489 .58269 L +.04613 .02424 L +.04737 .42893 L +.04861 .49881 L +.04985 .04314 L +.05109 .20767 L +.05233 .57956 L +.05357 .4713 L +.05481 .12034 L +.05605 .02845 L +.05729 .25919 L +.05853 .5293 L +.05977 .59618 L +.06101 .44158 L +.06225 .20574 L +.06349 .0425 L +.06473 .02694 L +.06597 .14355 L +.06721 .32322 L +.06845 .48895 L +.07341 .41006 L +.07465 .27441 L +.07589 .15173 L +.07713 .06312 L +.07837 .01925 L +.07961 .02131 L +.08085 .06335 L +.08209 .13505 L +.08333 .22429 L +.08581 .40937 L +.08705 .48692 L +.08829 .54646 L +.08953 .58513 L +.09077 .60225 L +Mistroke +.09201 .5989 L +.09325 .57739 L +.09449 .54088 L +.09573 .49293 L +.09821 .37715 L +.10069 .25654 L +.10317 .1511 L +.10441 .1082 L +.10565 .0731 L +.10689 .04624 L +.10813 .02773 L +.10938 .01739 L +.11062 .0148 L +.11186 .0194 L +.1131 .03049 L +.11558 .06901 L +.11682 .0948 L +.11806 .12385 L +.12302 .25771 L +.12798 .39089 L +.13046 .4487 L +.13294 .49805 L +.13542 .53798 L +.1379 .56815 L +.13914 .57962 L +.14038 .58873 L +.14162 .59555 L +.14286 .60019 L +.1441 .60272 L +.14534 .60328 L +.14658 .60195 L +.14782 .59888 L +.14906 .59417 L +.1503 .58795 L +.15278 .57149 L +.15774 .52578 L +.1627 .46881 L +.17262 .34332 L +.18254 .22678 L +.19246 .13418 L +.19742 .09842 L +.20238 .06965 L +.20734 .04754 L +.20982 .03883 L +.2123 .03159 L +.21478 .02574 L +.21726 .02122 L +.2185 .01943 L +.21974 .01795 L +.22098 .01675 L +Mistroke +.22222 .01584 L +.22346 .01521 L +.2247 .01483 L +.22594 .01472 L +.22718 .01484 L +.22842 .01521 L +.22966 .0158 L +.2309 .01661 L +.23214 .01763 L +.23462 .02028 L +.2371 .02367 L +.24206 .03243 L +.25198 .05636 L +.2619 .08629 L +.30159 .22571 L +.34127 .35055 L +.36111 .40105 L +.38095 .44359 L +.40079 .47888 L +.42063 .50781 L +.44048 .53126 L +.46032 .55007 L +.48016 .56498 L +.5 .57662 L +.51984 .58556 L +.53968 .59223 L +.5496 .59485 L +.55952 .59704 L +.56944 .59884 L +.57937 .60029 L +.58929 .60143 L +.59921 .60227 L +.60417 .60259 L +.60913 .60285 L +.61409 .60305 L +.61657 .60313 L +.61905 .60319 L +.62153 .60324 L +.62277 .60326 L +.62401 .60328 L +.62525 .6033 L +.62649 .60331 L +.62773 .60331 L +.62897 .60332 L +.63021 .60332 L +.63145 .60332 L +.63269 .60331 L +.63393 .6033 L +.63641 .60328 L +.63765 .60326 L +Mistroke +.63889 .60325 L +.64385 .60314 L +.64881 .60299 L +.65873 .60258 L +.66865 .60202 L +.67857 .60133 L +.69841 .59961 L +.7381 .59506 L +.77778 .5895 L +.81746 .58332 L +.85714 .57678 L +.89683 .57008 L +.93651 .56334 L +.97619 .55666 L +Mfstroke +P +P +P +% End of Graphics +MathPictureEnd +end +%%EndDocument + @endspecial 671 2277 a Fu(0)p Fn(:)p Fu(2)837 2213 y(0)p +Fn(:)p Fu(4)1061 2277 y(0)p Fn(:)p Fu(6)1290 2207 y Fn(x)1314 +2213 y Fw(1)1526 2277 y Fu(1)347 2594 y Fs(\000)p Fu(1)315 +2421 y Fs(\000)p Fu(0)p Fn(:)p Fu(5)347 2077 y(0)p Fn(:)p +Fu(5)379 1903 y(1)975 2035 y Fn(f)t Fu(\()p Fn(x)p Fu(\))d(=)e(sin)1176 +2007 y(1)p 1174 2025 24 2 v 1174 2063 a Fn(x)1134 2601 +y @beginspecial 103.637100 @hsize 85.039124 @vsize @setspecial +%%BeginDocument: 12mag_3d.eps +%MMA2LTXCommandLine: mma2ltx -stiny -ucm -p -h3cm 12mag_3d.ps +% Mathematica v2.2 prologue +/Mathdict 150 dict def +Mathdict begin +/Mwidth 103.64 def +/Mheight 85.04 def +/Mnodistort true def +/Mlmarg 0 def /Mrmarg 0 def /Mbmarg 0 def /Mtmarg 0 def /Mtransform{} +bind def /Mfixwid true def /Mfixdash false def /Mrot 0 def /Mpstart{ +MathPictureStart}bind def /Mpend{MathPictureEnd}bind def /Mscale{0 1 0 1 +5 -1 roll MathScale}bind def /ISOLatin1Encoding dup where{pop pop}{[ +/.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef +/.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef +/.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef +/.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef +/space /exclam /quotedbl /numbersign /dollar /percent /ampersand +/quoteright /parenleft /parenright /asterisk /plus /comma /minus /period +/slash /zero /one /two /three /four /five /six /seven /eight /nine +/colon /semicolon /less /equal /greater /question /at /A /B /C /D /E /F +/G /H /I /J /K /L /M /N /O /P /Q /R /S /T /U /V /W /X /Y /Z /bracketleft +/backslash /bracketright /asciicircum /underscore /quoteleft /a /b /c /d +/e /f /g /h /i /j /k /l /m /n /o /p /q /r /s /t /u /v /w /x /y /z +/braceleft /bar /braceright /asciitilde /.notdef /.notdef /.notdef +/.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef +/.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /dotlessi /grave +/acute /circumflex /tilde /macron /breve /dotaccent /dieresis /.notdef +/ring /cedilla /.notdef /hungarumlaut /ogonek /caron /space /exclamdown +/cent /sterling /currency /yen /brokenbar /section /dieresis /copyright +/ordfeminine /guillemotleft /logicalnot /hyphen /registered /macron +/degree /plusminus /twosuperior /threesuperior /acute /mu /paragraph +/periodcentered /cedilla /onesuperior /ordmasculine /guillemotright +/onequarter /onehalf /threequarters /questiondown /Agrave /Aacute +/Acircumflex /Atilde /Adieresis /Aring /AE /Ccedilla /Egrave /Eacute +/Ecircumflex /Edieresis /Igrave /Iacute /Icircumflex /Idieresis /Eth +/Ntilde /Ograve /Oacute /Ocircumflex /Otilde /Odieresis /multiply +/Oslash /Ugrave /Uacute /Ucircumflex /Udieresis /Yacute /Thorn +/germandbls /agrave /aacute /acircumflex /atilde /adieresis /aring /ae +/ccedilla /egrave /eacute /ecircumflex /edieresis /igrave /iacute +/icircumflex /idieresis /eth /ntilde /ograve /oacute /ocircumflex +/otilde /odieresis /divide /oslash /ugrave /uacute /ucircumflex +/udieresis /yacute /thorn /ydieresis]def}ifelse /MFontDict 50 dict def +/MStrCat{exch dup length 2 index length add string dup 3 1 roll copy +length exch dup 4 2 roll exch putinterval}def /MCreateEncoding{1 index +255 string cvs(-)MStrCat 1 index MStrCat cvn exch(Encoding)MStrCat cvn +dup where{exch get}{pop StandardEncoding}ifelse 3 1 roll dup MFontDict +exch known not{1 index findfont dup length dict begin{1 index /FID ne{ +def}{pop pop}ifelse}forall /Encoding 3 index def currentdict end 1 index +exch definefont pop MFontDict 1 index null put}if exch pop exch pop}def +/ISOLatin1{(ISOLatin1)MCreateEncoding}def /ISO8859{(ISOLatin1) +MCreateEncoding}def /Mcopyfont{dup maxlength dict exch{1 index /FID eq{ +pop pop}{2 index 3 1 roll put}ifelse}forall}def /Plain /Courier findfont +Mcopyfont definefont pop /Bold /Courier findfont Mcopyfont +definefont pop /Italic /Courier findfont Mcopyfont definefont +pop /MathPictureStart{gsave Mtransform Mlmarg Mbmarg translate Mwidth +Mlmarg Mrmarg add sub /Mwidth exch def Mheight Mbmarg Mtmarg add sub +/Mheight exch def /Mtmatrix matrix currentmatrix def /Mgmatrix matrix +currentmatrix def}bind def /MathPictureEnd{grestore}bind def /MFill{0 0 +moveto Mwidth 0 lineto Mwidth Mheight lineto 0 Mheight lineto fill}bind +def /MPlotRegion{3 index Mwidth mul 2 index Mheight mul translate exch +sub Mheight mul /Mheight exch def exch sub Mwidth mul /Mwidth exch def} +bind def /MathSubStart{Momatrix Mgmatrix Mtmatrix Mwidth Mheight 7 -2 +roll moveto Mtmatrix setmatrix currentpoint Mgmatrix setmatrix 9 -2 roll +moveto Mtmatrix setmatrix currentpoint 2 copy translate /Mtmatrix matrix +currentmatrix def 3 -1 roll exch sub /Mheight exch def sub /Mwidth exch +def}bind def /MathSubEnd{/Mheight exch def /Mwidth exch def /Mtmatrix +exch def dup setmatrix /Mgmatrix exch def /Momatrix exch def}bind def +/Mdot{moveto 0 0 rlineto stroke}bind def /Mtetra{moveto lineto lineto +lineto fill}bind def /Metetra{moveto lineto lineto lineto closepath +gsave fill grestore 0 setgray stroke}bind def /Mistroke{flattenpath 0 0 +0{4 2 roll pop pop}{4 -1 roll 2 index sub dup mul 4 -1 roll 2 index sub +dup mul add sqrt 4 -1 roll add 3 1 roll}{stop}{stop}pathforall pop pop +currentpoint stroke moveto currentdash 3 -1 roll add setdash}bind def +/Mfstroke{stroke currentdash pop 0 setdash}bind def /Mrotsboxa{gsave dup +/Mrot exch def Mrotcheck Mtmatrix dup setmatrix 7 1 roll 4 index 4 index +translate rotate 3 index -1 mul 3 index -1 mul translate /Mtmatrix +matrix currentmatrix def grestore Msboxa 3 -1 roll /Mtmatrix exch def +/Mrot 0 def}bind def /Msboxa{newpath 5 -1 roll Mvboxa pop Mboxout 6 -1 +roll 5 -1 roll 4 -1 roll Msboxa1 5 -3 roll Msboxa1 Mboxrot[7 -2 roll 2 +copy[3 1 roll 10 -1 roll 9 -1 roll]6 1 roll 5 -2 roll]}bind def /Msboxa1 +{sub 2 div dup 2 index 1 add mul 3 -1 roll -1 add 3 -1 roll mul}bind def +/Mvboxa{Mfixwid{Mvboxa1}{dup Mwidthcal 0 exch{add}forall exch Mvboxa1 4 +index 7 -1 roll add 4 -1 roll pop 3 1 roll}ifelse}bind def /Mvboxa1{ +gsave newpath[true 3 -1 roll{Mbbox 5 -1 roll{0 5 1 roll}{7 -1 roll exch +sub(m)stringwidth pop .3 mul sub 7 1 roll 6 -1 roll 4 -1 roll Mmin 3 -1 +roll 5 index add 5 -1 roll 4 -1 roll Mmax 4 -1 roll}ifelse false}forall{ +stop}if counttomark 1 add 4 roll]grestore}bind def /Mbbox{1 dict begin 0 +0 moveto /temp(T)def{gsave currentpoint newpath moveto temp 0 3 -1 roll +put temp false charpath flattenpath currentpoint pathbbox grestore +moveto lineto moveto}forall pathbbox newpath end}bind def /Mmin{2 copy +gt{exch}if pop}bind def /Mmax{2 copy lt{exch}if pop}bind def /Mrotshowa{ +dup /Mrot exch def Mrotcheck Mtmatrix dup setmatrix 7 1 roll 4 index 4 +index translate rotate 3 index -1 mul 3 index -1 mul translate /Mtmatrix +matrix currentmatrix def Mgmatrix setmatrix Mshowa /Mtmatrix exch def +/Mrot 0 def}bind def /Mshowa{4 -2 roll moveto 2 index Mtmatrix setmatrix +Mvboxa 7 1 roll Mboxout 6 -1 roll 5 -1 roll 4 -1 roll Mshowa1 4 1 roll +Mshowa1 rmoveto currentpoint Mfixwid{Mshowax}{Mshoway}ifelse pop pop pop +pop Mgmatrix setmatrix}bind def /Mshowax{0 1 4 index length -1 add{2 +index 4 index 2 index get 3 index add moveto 4 index exch get Mfixdash{ +Mfixdashp}if show}for}bind def /Mfixdashp{dup length 1 gt 1 index true +exch{45 eq and}forall and{gsave(--)stringwidth pop(-)stringwidth pop sub +2 div 0 rmoveto dup length 1 sub{(-)show}repeat grestore}if}bind def +/Mshoway{3 index Mwidthcal 5 1 roll 0 1 4 index length -1 add{2 index 4 +index 2 index get 3 index add moveto 4 index exch get[6 index aload +length 2 add -1 roll{pop Strform stringwidth pop neg exch add 0 rmoveto} +exch kshow cleartomark}for pop}bind def /Mwidthcal{[exch{Mwidthcal1} +forall][exch dup Maxlen -1 add 0 1 3 -1 roll{[exch 2 index{1 index Mget +exch}forall pop Maxget exch}for pop]Mreva}bind def /Mreva{[exch aload +length -1 1{1 roll}for]}bind def /Mget{1 index length -1 add 1 index ge{ +get}{pop pop 0}ifelse}bind def /Maxlen{[exch{length}forall Maxget}bind +def /Maxget{counttomark -1 add 1 1 3 -1 roll{pop Mmax}for exch pop}bind +def /Mwidthcal1{[exch{Strform stringwidth pop}forall]}bind def /Strform{ +/tem(x)def tem 0 3 -1 roll put tem}bind def /Mshowa1{2 copy add 4 1 roll +sub mul sub -2 div}bind def /MathScale{Mwidth Mheight Mlp translate +scale /yscale exch def /ybias exch def /xscale exch def /xbias exch def +/Momatrix xscale yscale matrix scale xbias ybias matrix translate matrix +concatmatrix def /Mgmatrix matrix currentmatrix def}bind def /Mlp{3 copy +Mlpfirst{Mnodistort{Mmin dup}if 4 index 2 index 2 index Mlprun 11 index +11 -1 roll 10 -4 roll Mlp1 8 index 9 -5 roll Mlp1 4 -1 roll and{exit}if +3 -1 roll pop pop}loop exch 3 1 roll 7 -3 roll pop pop pop}bind def +/Mlpfirst{3 -1 roll dup length 2 copy -2 add get aload pop pop pop 4 -2 +roll -1 add get aload pop pop pop 6 -1 roll 3 -1 roll 5 -1 roll sub div +4 1 roll exch sub div}bind def /Mlprun{2 copy 4 index 0 get dup 4 1 roll +Mlprun1 3 copy 8 -2 roll 9 -1 roll{3 copy Mlprun1 3 copy 11 -3 roll /gt +Mlpminmax 8 3 roll 11 -3 roll /lt Mlpminmax 8 3 roll}forall pop pop pop +pop 3 1 roll pop pop aload pop 5 -1 roll aload pop exch 6 -1 roll +Mlprun2 8 2 roll 4 -1 roll Mlprun2 6 2 roll 3 -1 roll Mlprun2 4 2 roll +exch Mlprun2 6 2 roll}bind def /Mlprun1{aload pop exch 6 -1 roll 5 -1 +roll mul add 4 -2 roll mul 3 -1 roll add}bind def /Mlprun2{2 copy add 2 +div 3 1 roll exch sub}bind def /Mlpminmax{cvx 2 index 6 index 2 index +exec{7 -3 roll 4 -1 roll}if 1 index 5 index 3 -1 roll exec{4 1 roll pop +5 -1 roll aload pop pop 4 -1 roll aload pop[8 -2 roll pop 5 -2 roll pop +6 -2 roll pop 5 -1 roll]4 1 roll pop}{pop pop pop}ifelse}bind def /Mlp1{ +5 index 3 index sub 5 index 2 index mul 1 index le 1 index 0 le or dup +not{1 index 3 index div .99999 mul 8 -1 roll pop 7 1 roll}if 8 -1 roll 2 +div 7 -2 roll pop sub 5 index 6 -3 roll pop pop mul sub exch}bind def +/intop 0 def /inrht 0 def /inflag 0 def /outflag 0 def /xadrht 0 def +/xadlft 0 def /yadtop 0 def /yadbot 0 def /Minner{outflag 1 eq{/outflag +0 def /intop 0 def /inrht 0 def}if 5 index gsave Mtmatrix setmatrix +Mvboxa pop grestore 3 -1 roll pop dup intop gt{/intop exch def}{pop} +ifelse dup inrht gt{/inrht exch def}{pop}ifelse pop /inflag 1 def}bind +def /Mouter{/xadrht 0 def /xadlft 0 def /yadtop 0 def /yadbot 0 def +inflag 1 eq{dup 0 lt{dup intop mul neg /yadtop exch def}if dup 0 gt{dup +intop mul /yadbot exch def}if pop dup 0 lt{dup inrht mul neg /xadrht +exch def}if dup 0 gt{dup inrht mul /xadlft exch def}if pop /outflag 1 +def}{pop pop}ifelse /inflag 0 def /inrht 0 def /intop 0 def}bind def +/Mboxout{outflag 1 eq{4 -1 roll xadlft leadjust add sub 4 1 roll 3 -1 +roll yadbot leadjust add sub 3 1 roll exch xadrht leadjust add add exch +yadtop leadjust add add /outflag 0 def /xadlft 0 def /yadbot 0 def +/xadrht 0 def /yadtop 0 def}if}bind def /leadjust{(m)stringwidth pop .5 +mul}bind def /Mrotcheck{dup 90 eq{yadbot /yadbot xadrht def /xadrht +yadtop def /yadtop xadlft def /xadlft exch def}if dup cos 1 index sin +Checkaux dup cos 1 index sin neg exch Checkaux 3 1 roll pop pop}bind def +/Checkaux{4 index exch 4 index mul 3 1 roll mul add 4 1 roll}bind def +/Mboxrot{Mrot 90 eq{brotaux 4 2 roll}if Mrot 180 eq{4 2 roll brotaux 4 2 +roll brotaux}if Mrot 270 eq{4 2 roll brotaux}if}bind def /brotaux{neg +exch neg}bind def /Mabsproc{0 matrix defaultmatrix dtransform +idtransform dup mul exch dup mul add sqrt}bind def /Mabswid{Mabsproc +setlinewidth}bind def /Mabsdash{exch[exch{Mabsproc}forall]exch setdash} +bind def /MBeginOrig{Momatrix concat}bind def /MEndOrig{Mgmatrix +setmatrix}bind def /sampledsound where{pop}{/sampledsound{exch pop exch +5 1 roll mul 4 idiv mul 2 idiv exch pop exch /Mtempproc exch def{ +Mtempproc pop}repeat}bind def}ifelse /g{setgray}bind def /k{ +setcmykcolor}bind def /m{moveto}bind def /p{gsave}bind def /r{ +setrgbcolor}bind def /w{setlinewidth}bind def /C{curveto}bind def /F{ +fill}bind def /L{lineto}bind def /P{grestore}bind def /s{stroke}bind def +/setcmykcolor where{pop}{/setcmykcolor{4 1 roll[4 1 roll]{1 index sub 1 +sub neg dup 0 lt{pop 0}if dup 1 gt{pop 1}if exch}forall pop setrgbcolor} +bind def}ifelse /Mcharproc{currentfile(x)readhexstring pop 0 get exch +div}bind def /Mshadeproc{dup 3 1 roll{dup Mcharproc 3 1 roll}repeat 1 eq +{setgray}{3 eq{setrgbcolor}{setcmykcolor}ifelse}ifelse}bind def +/Mrectproc{3 index 2 index moveto 2 index 3 -1 roll lineto dup 3 1 roll +lineto lineto fill}bind def /Mcolorimage{7 1 roll pop pop matrix +invertmatrix concat 2 exch exp 1 sub 3 1 roll 1 1 2 index{1 1 4 index{ +dup 1 sub exch 2 index dup 1 sub exch 7 index 9 index Mshadeproc +Mrectproc}for pop}for pop pop pop pop}bind def /Mimage{pop matrix +invertmatrix concat 2 exch exp 1 sub 3 1 roll 1 1 2 index{1 1 4 index{ +dup 1 sub exch 2 index dup 1 sub exch 7 index Mcharproc setgray +Mrectproc}for pop}for pop pop pop}bind def +%MMA2LTXComment: Here follow the original Mathematica file stripped of the text strings +MathPictureStart +/Courier findfont 10 scalefont setfont +% Scaling calculations +0.0249355 0.99742 -0.0396341 0.99742 [ +[ 0 0 0 0 ] +[ 1 .82055 0 0 ] +] MathScale +% Start of Graphics +1 setlinecap +1 setlinejoin +newpath +[ ] 0 setdash +0 g +p +p +.002 w +.06024 .26735 m +.67932 .02494 L +s +P +p +.002 w +.16191 .22754 m +.16631 .23196 L +s +P +p +.002 w +.35089 .15354 m +.35496 .15826 L +s +P +p +.002 w +.55515 .07356 m +.55883 .07859 L +s +P +p +.001 w +.19857 .21319 m +.20117 .21587 L +s +P +p +.001 w +.23578 .19861 m +.23834 .20134 L +s +P +p +.001 w +.27356 .18382 m +.27609 .18658 L +s +P +p +.001 w +.31193 .1688 m +.31441 .17159 L +s +P +p +.001 w +.39046 .13804 m +.39286 .14091 L +s +P +p +.001 w +.43066 .1223 m +.43301 .12521 L +s +P +p +.001 w +.4715 .10631 m +.4738 .10926 L +s +P +p +.001 w +.51299 .09007 m +.51525 .09305 L +s +P +p +.001 w +.1258 .24168 m +.12847 .2443 L +s +P +p +.001 w +.09021 .25561 m +.09292 .25819 L +s +P +p +.001 w +.598 .05678 m +.60015 .05984 L +s +P +p +.001 w +.64156 .03972 m +.64365 .04282 L +s +P +P +p +p +.002 w +.67932 .02494 m +.94594 .43277 L +s +P +p +.002 w +.73688 .11298 m +.73104 .11515 L +s +P +p +.002 w +.82692 .2507 m +.82101 .25271 L +s +P +p +.002 w +.90545 .37083 m +.8995 .3727 L +s +P +p +.001 w +.75593 .14211 m +.75241 .14339 L +s +P +p +.001 w +.77443 .17042 m +.77091 .17168 L +s +P +p +.001 w +.79242 .19793 m +.78889 .19917 L +s +P +p +.001 w +.8099 .22468 m +.80637 .2259 L +s +P +p +.001 w +.84347 .27602 m +.83992 .27721 L +s +P +p +.001 w +.85958 .30067 m +.85603 .30184 L +s +P +p +.001 w +.87527 .32467 m +.87171 .32582 L +s +P +p +.001 w +.89056 .34805 m +.88699 .34919 L +s +P +p +.001 w +.71727 .08298 m +.71377 .0843 L +s +P +p +.001 w +.69707 .05207 m +.69358 .05342 L +s +P +p +.001 w +.91997 .39304 m +.9164 .39415 L +s +P +p +.001 w +.93413 .4147 m +.93055 .41579 L +s +P +P +p +p +.002 w +.06024 .26735 m +.02494 .49015 L +s +P +p +.002 w +.05986 .26974 m +.06567 .26747 L +s +P +p +.002 w +.0517 .32128 m +.05752 .31906 L +s +P +p +.002 w +.04324 .37466 m +.04908 .37249 L +s +P +p +.002 w +.03447 .42999 m +.04034 .42788 L +s +P +p +.002 w +.02537 .48738 m +.03126 .48533 L +s +P +p +.001 w +.05825 .27991 m +.06174 .27855 L +s +P +p +.001 w +.05663 .29014 m +.06012 .28879 L +s +P +p +.001 w +.055 .30045 m +.05849 .2991 L +s +P +p +.001 w +.05335 .31083 m +.05685 .30949 L +s +P +p +.001 w +.05003 .3318 m +.05353 .33048 L +s +P +p +.001 w +.04835 .3424 m +.05185 .34108 L +s +P +p +.001 w +.04666 .35308 m +.05016 .35177 L +s +P +p +.001 w +.04495 .36383 m +.04846 .36252 L +s +P +p +.001 w +.04151 .38557 m +.04502 .38427 L +s +P +p +.001 w +.03977 .39655 m +.04328 .39527 L +s +P +p +.001 w +.03801 .40762 m +.04153 .40634 L +s +P +p +.001 w +.03625 .41876 m +.03977 .41749 L +s +P +p +.001 w +.03268 .4413 m +.0362 .44004 L +s +P +p +.001 w +.03087 .45269 m +.0344 .45144 L +s +P +p +.001 w +.02905 .46417 m +.03258 .46292 L +s +P +p +.001 w +.02722 .47573 m +.03075 .47449 L +s +P +P +0 0 m +1 0 L +1 .82055 L +0 .82055 L +closepath +clip +newpath +p +.002 w +.06024 .26735 m +.02494 .49015 L +s +.02494 .49015 m +.40296 .79562 L +s +.40296 .79562 m +.41001 .59401 L +s +.41001 .59401 m +.06024 .26735 L +s +.67932 .02494 m +.94594 .43277 L +s +.94594 .43277 m +.97506 .64585 L +s +.97506 .64585 m +.69286 .25814 L +s +.69286 .25814 m +.67932 .02494 L +s +.06024 .26735 m +.02494 .49015 L +s +.02494 .49015 m +.69286 .25814 L +s +.69286 .25814 m +.67932 .02494 L +s +.67932 .02494 m +.06024 .26735 L +s +.41001 .59401 m +.94594 .43277 L +s +.94594 .43277 m +.97506 .64585 L +s +.97506 .64585 m +.40296 .79562 L +s +.40296 .79562 m +.41001 .59401 L +s +P +p +0 .096 .575 r +.0015 w +.38505 .67298 .40659 .69179 .44146 .72507 .42007 .70194 Metetra +0 .368 .834 r +.42007 .70194 .44146 .72507 .47787 .75077 .45661 .72394 Metetra +.421 .591 .913 r +.45661 .72394 .47787 .75077 .51565 .76096 .49455 .73186 Metetra +.65 .676 .861 r +.49455 .73186 .51565 .76096 .55426 .75082 .53342 .72139 Metetra +.757 .71 .808 r +.53342 .72139 .55426 .75082 .59303 .72006 .5726 .69228 Metetra +.813 .734 .776 r +.5726 .69228 .59303 .72006 .63138 .67312 .61156 .64848 Metetra +.846 .757 .765 r +.61156 .64848 .63138 .67312 .66909 .61778 .65002 .59698 Metetra +.862 .786 .775 r +.65002 .59698 .66909 .61778 .70634 .56311 .68812 .54597 Metetra +.856 .821 .813 r +.68812 .54597 .70634 .56311 .74372 .51741 .72634 .50303 Metetra +.805 .855 .887 r +.72634 .50303 .74372 .51741 .78207 .48688 .76543 .47385 Metetra +.64 .84 .977 r +.76543 .47385 .78207 .48688 .8223 .47481 .8062 .46148 Metetra +.314 .683 .978 r +.8062 .46148 .8223 .47481 .86517 .48141 .84938 .46611 Metetra +.036 .47 .88 r +.84938 .46611 .86517 .48141 .91111 .5037 .89538 .48498 Metetra +0 .378 .836 r +.89538 .48498 .91111 .5037 .96002 .53575 .94412 .51262 Metetra +.009 .432 .863 r +.36293 .65367 .38505 .67298 .42007 .70194 .39846 .67034 Metetra +.386 .535 .882 r +.39846 .67034 .42007 .70194 .45661 .72394 .43526 .68197 Metetra +.552 .56 .816 r +.43526 .68197 .45661 .72394 .49455 .73186 .47327 .68377 Metetra +.637 .582 .776 r +.47327 .68377 .49455 .73186 .53342 .72139 .51218 .67288 Metetra +.695 .61 .758 r +.51218 .67288 .53342 .72139 .5726 .69228 .55158 .64914 Metetra +.742 .649 .757 r +.55158 .64914 .5726 .69228 .61156 .64848 .59107 .61514 Metetra +.786 .705 .774 r +.59107 .61514 .61156 .64848 .65002 .59698 .63043 .57559 Metetra +.826 .787 .814 r +.63043 .57559 .65002 .59698 .68812 .54597 .6697 .53613 Metetra +.839 .902 .882 r +.6697 .53613 .68812 .54597 .72634 .50303 .70921 .50211 Metetra +.693 .975 .914 r +.70921 .50211 .72634 .50303 .76543 .47385 .74946 .47765 Metetra +.245 .752 .721 r +.74946 .47765 .76543 .47385 .8062 .46148 .79104 .46503 Metetra +.104 0 0 r +.79104 .46503 .8062 .46148 .84938 .46611 .83448 .46437 Metetra +.183 0 0 r +.83448 .46437 .84938 .46611 .89538 .48498 .88006 .47363 Metetra +.003 .499 .865 r +.88006 .47363 .89538 .48498 .94412 .51262 .92776 .4888 Metetra +.515 .706 .958 r +.34022 .63385 .36293 .65367 .39846 .67034 .37667 .63267 Metetra +.587 .599 .831 r +.37667 .63267 .39846 .67034 .43526 .68197 .41394 .6295 Metetra +.611 .554 .766 r +.41394 .6295 .43526 .68197 .47327 .68377 .45203 .62271 Metetra +.628 .543 .739 r +.45203 .62271 .47327 .68377 .51218 .67288 .49085 .61134 Metetra +.647 .553 .735 r +.49085 .61134 .51218 .67288 .55158 .64914 .53025 .59534 Metetra +.671 .585 .751 r +.53025 .59534 .55158 .64914 .59107 .61514 .57008 .57556 Metetra +.702 .65 .795 r +.57008 .57556 .59107 .61514 .63043 .57559 .61028 .55361 Metetra +.739 .774 .882 r +.61028 .55361 .63043 .57559 .6697 .53613 .65084 .53145 Metetra +.68 .946 .96 r +.65084 .53145 .6697 .53613 .70921 .50211 .69188 .51105 Metetra +.69188 .51105 .70921 .50211 .74946 .47765 .73358 .494 Metetra +.135 0 0 r +.73358 .494 .74946 .47765 .79104 .46503 .77618 .48116 Metetra +.221 0 0 r +.77618 .48116 .79104 .46503 .83448 .46437 .81987 .47259 Metetra +.124 0 0 r +.81987 .47259 .83448 .46437 .88006 .47363 .86478 .46747 Metetra +.288 .761 .936 r +.86478 .46747 .88006 .47363 .92776 .4888 .91091 .46428 Metetra +.739 .766 .875 r +.31689 .61349 .34022 .63385 .37667 .63267 .35461 .59244 Metetra +.689 .635 .79 r +.35461 .59244 .37667 .63267 .41394 .6295 .3926 .57313 Metetra +.652 .566 .746 r +.3926 .57313 .41394 .6295 .45203 .62271 .43086 .55711 Metetra +.625 .532 .728 r +.43086 .55711 .45203 .62271 .49085 .61134 .46952 .54525 Metetra +.606 .52 .732 r +.46952 .54525 .49085 .61134 .53025 .59534 .50875 .53759 Metetra +.591 .533 .758 r +.50875 .53759 .53025 .59534 .57008 .57556 .54872 .53334 Metetra +.576 .582 .822 r +.54872 .53334 .57008 .57556 .61028 .55361 .58955 .53099 Metetra +.533 .704 .949 r +.58955 .53099 .61028 .55361 .65084 .53145 .63128 .52859 Metetra +.241 .749 .878 r +.63128 .52859 .65084 .53145 .69188 .51105 .67385 .5241 Metetra +.143 0 0 r +.67385 .5241 .69188 .51105 .73358 .494 .7171 .51584 Metetra +.214 0 0 r +.7171 .51584 .73358 .494 .77618 .48116 .76082 .5028 Metetra +.136 0 0 r +.76082 .5028 .77618 .48116 .81987 .47259 .80484 .48492 Metetra +.80484 .48492 .81987 .47259 .86478 .46747 .84907 .46311 Metetra +.668 .963 .933 r +.84907 .46311 .86478 .46747 .91091 .46428 .89354 .43901 Metetra +.817 .767 .806 r +.29291 .59257 .31689 .61349 .35461 .59244 .33211 .55352 Metetra +.751 .666 .767 r +.33211 .55352 .35461 .59244 .3926 .57313 .37097 .51988 Metetra +.688 .594 .745 r +.37097 .51988 .3926 .57313 .43086 .55711 .40953 .49576 Metetra +.628 .543 .739 r +.40953 .49576 .43086 .55711 .46952 .54525 .44809 .48341 Metetra +.566 .507 .748 r +.44809 .48341 .46952 .54525 .50875 .53759 .48709 .48297 Metetra +.491 .486 .779 r +.48709 .48297 .50875 .53759 .54872 .53334 .52702 .4924 Metetra +.383 .488 .842 r +.52702 .4924 .54872 .53334 .58955 .53099 .56822 .50772 Metetra +.172 .509 .912 r +.56822 .50772 .58955 .53099 .63128 .52859 .61084 .52356 Metetra +0 .429 .692 r +.61084 .52356 .63128 .52859 .67385 .5241 .65469 .53409 Metetra +.253 0 0 r +.65469 .53409 .67385 .5241 .7171 .51584 .69935 .53424 Metetra +.138 0 0 r +.69935 .53424 .7171 .51584 .76082 .5028 .74419 .52098 Metetra +.74419 .52098 .76082 .5028 .80484 .48492 .78867 .49412 Metetra +.589 .911 .664 r +.78867 .49412 .80484 .48492 .84907 .46311 .83246 .45646 Metetra +.867 .973 .855 r +.83246 .45646 .84907 .46311 .89354 .43901 .87565 .41296 Metetra +.846 .762 .77 r +.26827 .57106 .29291 .59257 .33211 .55352 .30886 .51932 Metetra +.793 .699 .761 r +.30886 .51932 .33211 .55352 .37097 .51988 .34863 .47573 Metetra +.726 .641 .763 r +.34863 .47573 .37097 .51988 .40953 .49576 .38761 .446 Metetra +.639 .582 .774 r +.38761 .446 .40953 .49576 .44809 .48341 .42622 .43321 Metetra +.52 .518 .794 r +.42622 .43321 .44809 .48341 .48709 .48297 .46508 .43754 Metetra +.35 .445 .817 r +.46508 .43754 .48709 .48297 .52702 .4924 .5049 .45623 Metetra +.114 .36 .823 r +.5049 .45623 .52702 .4924 .56822 .50772 .54626 .48375 Metetra +0 .285 .771 r +.54626 .48375 .56822 .50772 .61084 .52356 .5894 .51247 Metetra +0 .288 .664 r +.5894 .51247 .61084 .52356 .65469 .53409 .63415 .53378 Metetra +.162 0 0 r +.63415 .53378 .65469 .53409 .69935 .53424 .67988 .54001 Metetra +.67988 .54001 .69935 .53424 .74419 .52098 .7257 .52645 Metetra +.635 .957 .781 r +.7257 .52645 .74419 .52098 .78867 .49412 .77075 .49287 Metetra +.874 .992 .81 r +.77075 .49287 .78867 .49412 .83246 .45646 .81455 .44356 Metetra +.919 .912 .796 r +.81455 .44356 .83246 .45646 .87565 .41296 .85719 .3861 Metetra +.853 .76 .759 r +.24293 .54895 .26827 .57106 .30886 .51932 .28455 .49224 Metetra +.824 .739 .771 r +.28455 .49224 .30886 .51932 .34863 .47573 .3251 .44474 Metetra +.767 .714 .803 r +.3251 .44474 .34863 .47573 .38761 .446 .36458 .41272 Metetra +.657 .669 .85 r +.36458 .41272 .38761 .446 .42622 .43321 .40344 .39954 Metetra +.448 .575 .889 r +.40344 .39954 .42622 .43321 .46508 .43754 .44238 .40538 Metetra +.133 .408 .855 r +.44238 .40538 .46508 .43754 .5049 .45623 .48222 .42724 Metetra +0 .243 .753 r +.48222 .42724 .5049 .45623 .54626 .48375 .52365 .45908 Metetra +0 .199 .701 r +.52365 .45908 .54626 .48375 .5894 .51247 .56702 .49241 Metetra +0 .325 .778 r +.56702 .49241 .5894 .51247 .63415 .53378 .6122 .51759 Metetra +.192 .616 .946 r +.6122 .51759 .63415 .53378 .67988 .54001 .65855 .52589 Metetra +.608 .857 .991 r +.65855 .52589 .67988 .54001 .7257 .52645 .70508 .51195 Metetra +.823 .904 .896 r +.70508 .51195 .7257 .52645 .77075 .49287 .75081 .47548 Metetra +.894 .879 .813 r +.75081 .47548 .77075 .49287 .81455 .44356 .79515 .42142 Metetra +.908 .846 .771 r +.79515 .42142 .81455 .44356 .85719 .3861 .83815 .35839 Metetra +.846 .762 .77 r +.21687 .5262 .24293 .54895 .28455 .49224 .25887 .4732 Metetra +.842 .792 .804 r +.25887 .4732 .28455 .49224 .3251 .44474 .2999 .42848 Metetra +.8 .827 .872 r +.2999 .42848 .3251 .44474 .36458 .41272 .3399 .3978 Metetra +.652 .831 .969 r +.3399 .3978 .36458 .41272 .40344 .39954 .37924 .38427 Metetra +.275 .671 .97 r +.37924 .38427 .40344 .39954 .44238 .40538 .41859 .38806 Metetra +0 .379 .796 r +.41859 .38806 .44238 .40538 .48222 .42724 .45873 .40637 Metetra +0 .238 .708 r +.45873 .40637 .48222 .42724 .52365 .45908 .50034 .43365 Metetra +0 .285 .771 r +.50034 .43365 .52365 .45908 .56702 .49241 .5438 .46214 Metetra +.138 .445 .879 r +.5438 .46214 .56702 .49241 .6122 .51759 .58906 .48313 Metetra +.443 .595 .907 r +.58906 .48313 .6122 .51759 .65855 .52589 .63558 .48879 Metetra +.646 .68 .868 r +.63558 .48879 .65855 .52589 .70508 .51195 .6825 .47434 Metetra +.761 .725 .819 r +.6825 .47434 .70508 .51195 .75081 .47548 .72891 .43954 Metetra +.827 .756 .784 r +.72891 .43954 .75081 .47548 .79515 .42142 .77425 .38878 Metetra +.865 .784 .77 r +.77425 .38878 .79515 .42142 .83815 .35839 .81849 .32978 Metetra +.817 .767 .806 r +.19004 .50278 .21687 .5262 .25887 .4732 .23163 .46155 Metetra +.831 .861 .868 r +.23163 .46155 .25887 .4732 .2999 .42848 .27268 .42589 Metetra +.757 .955 .938 r +.27268 .42589 .2999 .42848 .3399 .3978 .31312 .39999 Metetra +.429 .871 .878 r +.31312 .39999 .3399 .3978 .37924 .38427 .35318 .38615 Metetra +.35318 .38615 .37924 .38427 .41859 .38806 .39336 .3845 Metetra +.183 0 0 r +.39336 .3845 .41859 .38806 .45873 .40637 .43423 .39295 Metetra +0 .432 .794 r +.43423 .39295 .45873 .40637 .50034 .43365 .47632 .40743 Metetra +.172 .509 .912 r +.47632 .40743 .50034 .43365 .5438 .46214 .51994 .42245 Metetra +.408 .541 .878 r +.51994 .42245 .5438 .46214 .58906 .48313 .5651 .43198 Metetra +.544 .559 .82 r +.5651 .43198 .58906 .48313 .63558 .48879 .61146 .43079 Metetra +.629 .582 .782 r +.61146 .43079 .63558 .48879 .6825 .47434 .65846 .41575 Metetra +.693 .615 .764 r +.65846 .41575 .6825 .47434 .72891 .43954 .70547 .38667 Metetra +.747 .66 .764 r +.70547 .38667 .72891 .43954 .77425 .38878 .75207 .34645 Metetra +.797 .723 .783 r +.75207 .34645 .77425 .38878 .81849 .32978 .79819 .30023 Metetra +.739 .766 .875 r +.16241 .47867 .19004 .50278 .23163 .46155 .20277 .4551 Metetra +.721 .922 .96 r +.20277 .4551 .23163 .46155 .27268 .42589 .24333 .43331 Metetra +.447 .88 .813 r +.24333 .43331 .27268 .42589 .31312 .39999 .28405 .41491 Metetra +.28405 .41491 .31312 .39999 .35318 .38615 .32503 .4008 Metetra +.031 0 0 r +.32503 .4008 .35318 .38615 .39336 .3845 .36645 .39102 Metetra +.36645 .39102 .39336 .3845 .43423 .39295 .40855 .38474 Metetra +.336 .781 .96 r +.40855 .38474 .43423 .39295 .47632 .40743 .45154 .3804 Metetra +.533 .704 .949 r +.45154 .3804 .47632 .40743 .51994 .42245 .49558 .37595 Metetra +.581 .599 .836 r +.49558 .37595 .51994 .42245 .5651 .43198 .54068 .36927 Metetra +.6 .551 .771 r +.54068 .36927 .5651 .43198 .61146 .43079 .58675 .3586 Metetra +.618 .538 .742 r +.58675 .3586 .61146 .43079 .65846 .41575 .63362 .34288 Metetra +.639 .55 .738 r +.63362 .34288 .65846 .41575 .70547 .38667 .68106 .32207 Metetra +.665 .586 .757 r +.68106 .32207 .70547 .38667 .75207 .34645 .72894 .2971 Metetra +.701 .657 .804 r +.72894 .2971 .75207 .34645 .79819 .30023 .77721 .2697 Metetra +.515 .706 .958 r +.13396 .45384 .16241 .47867 .20277 .4551 .17246 .45043 Metetra +.32 .789 .93 r +.17246 .45043 .20277 .4551 .24333 .43331 .21206 .44486 Metetra +.21206 .44486 .24333 .43331 .28405 .41491 .25288 .4354 Metetra +.25288 .4354 .28405 .41491 .32503 .4008 .29486 .42102 Metetra +.29486 .42102 .32503 .4008 .36645 .39102 .33785 .40167 Metetra +.447 .87 .747 r +.33785 .40167 .36645 .39102 .40855 .38474 .38163 .37827 Metetra +.729 .946 .952 r +.38163 .37827 .40855 .38474 .45154 .3804 .42598 .3525 Metetra +.739 .774 .882 r +.42598 .3525 .45154 .3804 .49558 .37595 .47078 .32647 Metetra +.687 .64 .798 r +.47078 .32647 .49558 .37595 .54068 .36927 .51605 .30224 Metetra +.644 .564 .75 r +.51605 .30224 .54068 .36927 .58675 .3586 .5619 .28147 Metetra +.614 .525 .73 r +.5619 .28147 .58675 .3586 .63362 .34288 .60855 .26507 Metetra +.593 .513 .733 r +.60855 .26507 .63362 .34288 .68106 .32207 .65625 .25308 Metetra +.579 .527 .761 r +.65625 .25308 .68106 .32207 .72894 .2971 .70521 .24464 Metetra +.569 .581 .826 r +.70521 .24464 .72894 .2971 .77721 .2697 .75552 .23814 Metetra +.009 .432 .863 r +.10464 .42825 .13396 .45384 .17246 .45043 .14104 .44346 Metetra +.195 0 0 r +.14104 .44346 .17246 .45043 .21206 .44486 .17944 .45321 Metetra +.138 0 0 r +.17944 .45321 .21206 .44486 .25288 .4354 .22019 .45232 Metetra +.22019 .45232 .25288 .4354 .29486 .42102 .26317 .43765 Metetra +.465 .864 .685 r +.26317 .43765 .29486 .42102 .33785 .40167 .30787 .40904 Metetra +.784 .998 .846 r +.30787 .40904 .33785 .40167 .38163 .37827 .35357 .36935 Metetra +.869 .919 .859 r +.35357 .36935 .38163 .37827 .42598 .3525 .39958 .3237 Metetra +.826 .787 .814 r +.39958 .3237 .42598 .3525 .47078 .32647 .44549 .27816 Metetra +.756 .677 .774 r +.44549 .27816 .47078 .32647 .51605 .30224 .49121 .23844 Metetra +.686 .596 .75 r +.49121 .23844 .51605 .30224 .5619 .28147 .53706 .20887 Metetra +.618 .538 .742 r +.53706 .20887 .5619 .28147 .60855 .26507 .58357 .19179 Metetra +.552 .499 .751 r +.58357 .19179 .60855 .26507 .65625 .25308 .63141 .18732 Metetra +.482 .482 .78 r +.63141 .18732 .65625 .25308 .70521 .24464 .68114 .19329 Metetra +.401 .495 .84 r +.68114 .19329 .70521 .24464 .75552 .23814 .73309 .20548 Metetra +0 .096 .575 r +.07442 .40187 .10464 .42825 .14104 .44346 .10905 .43019 Metetra +.414 0 0 r +.10905 .43019 .14104 .44346 .17944 .45321 .14636 .45093 Metetra +.13 0 0 r +.14636 .45093 .17944 .45321 .22019 .45232 .18699 .45621 Metetra +.394 .852 .852 r +.18699 .45621 .22019 .45232 .26317 .43765 .23082 .44119 Metetra +.773 .989 .892 r +.23082 .44119 .26317 .43765 .30787 .40904 .27708 .40561 Metetra +.889 .94 .841 r +.27708 .40561 .30787 .40904 .35357 .36935 .32462 .35393 Metetra +.896 .861 .798 r +.32462 .35393 .35357 .36935 .39958 .3237 .37232 .29396 Metetra +.862 .786 .775 r +.37232 .29396 .39958 .3237 .44549 .27816 .41948 .23467 Metetra +.805 .716 .767 r +.41948 .23467 .44549 .27816 .49121 .23844 .46594 .18421 Metetra +.728 .649 .77 r +.46594 .18421 .49121 .23844 .53706 .20887 .51208 .14854 Metetra +.631 .582 .78 r +.51208 .14854 .53706 .20887 .58357 .19179 .55866 .13082 Metetra +.511 .515 .796 r +.55866 .13082 .58357 .19179 .63141 .18732 .60663 .13118 Metetra +.369 .453 .816 r +.60663 .13118 .63141 .18732 .68114 .19329 .65686 .14672 Metetra +.214 .41 .839 r +.65686 .14672 .68114 .19329 .73309 .20548 .70986 .17168 Metetra +.537 .015 0 r +.04324 .37466 .07442 .40187 .10905 .43019 .077 .40763 Metetra +0 .168 .606 r +.077 .40763 .10905 .43019 .14636 .45093 .1138 .43228 Metetra +.116 .582 .916 r +.1138 .43228 .14636 .45093 .18699 .45621 .15445 .43963 Metetra +.627 .848 .984 r +.15445 .43963 .18699 .45621 .23082 .44119 .19889 .42414 Metetra +.819 .866 .881 r +.19889 .42414 .23082 .44119 .27708 .40561 .24623 .38554 Metetra +.874 .836 .806 r +.24623 .38554 .27708 .40561 .32462 .35393 .2951 .32894 Metetra +.883 .808 .77 r +.2951 .32894 .32462 .35393 .37232 .29396 .34415 .26321 Metetra +.871 .784 .763 r +.34415 .26321 .37232 .29396 .41948 .23467 .39247 .19847 Metetra +.837 .76 .778 r +.39247 .19847 .41948 .23467 .46594 .18421 .43981 .14372 Metetra +.772 .728 .812 r +.43981 .14372 .46594 .18421 .51208 .14854 .48654 .10547 Metetra +.653 .673 .856 r +.48654 .10547 .51208 .14854 .55866 .13082 .5335 .08713 Metetra +.465 .578 .883 r +.5335 .08713 .55866 .13082 .60663 .13118 .58175 .08883 Metetra +.239 .456 .869 r +.58175 .08883 .60663 .13118 .65686 .14672 .6323 .10744 Metetra +.062 .362 .832 r +.6323 .10744 .65686 .14672 .70986 .17168 .68581 .13668 Metetra +P +p +.002 w +.67932 .02494 m +.94594 .43277 L +s +.94594 .43277 m +.97506 .64585 L +s +.97506 .64585 m +.69286 .25814 L +s +.69286 .25814 m +.67932 .02494 L +s +.06024 .26735 m +.02494 .49015 L +s +.02494 .49015 m +.69286 .25814 L +s +.69286 .25814 m +.67932 .02494 L +s +.67932 .02494 m +.06024 .26735 L +s +P +p +p +.002 w +.06024 .26735 m +.67932 .02494 L +s +P +p +.002 w +.16191 .22754 m +.16631 .23196 L +s +P +p +.002 w +.35089 .15354 m +.35496 .15826 L +s +P +p +.002 w +.55515 .07356 m +.55883 .07859 L +s +P +p +.001 w +.19857 .21319 m +.20117 .21587 L +s +P +p +.001 w +.23578 .19861 m +.23834 .20134 L +s +P +p +.001 w +.27356 .18382 m +.27609 .18658 L +s +P +p +.001 w +.31193 .1688 m +.31441 .17159 L +s +P +p +.001 w +.39046 .13804 m +.39286 .14091 L +s +P +p +.001 w +.43066 .1223 m +.43301 .12521 L +s +P +p +.001 w +.4715 .10631 m +.4738 .10926 L +s +P +p +.001 w +.51299 .09007 m +.51525 .09305 L +s +P +p +.001 w +.1258 .24168 m +.12847 .2443 L +s +P +p +.001 w +.09021 .25561 m +.09292 .25819 L +s +P +p +.001 w +.598 .05678 m +.60015 .05984 L +s +P +p +.001 w +.64156 .03972 m +.64365 .04282 L +s +P +P +% End of Graphics +MathPictureEnd +end +%%EndDocument + @endspecial 1161 2523 a Fe(\000)p Fg(2)1268 2555 y(0)1357 +2590 y(2)1457 2564 y Fe(\000)p Fg(2)1496 2506 y(0)1530 +2453 y(2)1116 2485 y Fe(\000)p Fg(1)1087 2463 y Fe(\000)p +Fg(0)p Ff(:)p Fg(5)1132 2443 y(0)1104 2419 y(0)p Ff(:)p +Fg(5)1125 2394 y(1)1161 2523 y Fe(\000)p Fg(2)1268 2555 +y(0)1357 2590 y(2)1281 2437 y @beginspecial 42.812069 +@hsize 11.676800 @vsize @setspecial +%%BeginDocument: mmawhite.eps +gsave 1 setgray clippath fill grestore +%%EndDocument + @endspecial 1281 2390 179 2 v 1281 2435 2 46 v 1295 +2423 a FA(some)g(text)p 1458 2435 V 1281 2437 179 2 v +659 2703 a FI(Figure)16 b(4:)22 b(A)16 b(sample)e(\014gure.)916 +2914 y(10)p eop +%%Page: 11 12 +11 11 bop -39 174 a FB(10)79 b(The)26 b(p)n(rogram)g +Fa(extpro)-39 284 y FI(The)16 b(program)h Fy(extpro)e +FI(extracts)h(a)h(prologue)g(\014le)f(from)g(a)h FD(Mathematica)f +FI(P)o(ostScript)g(sa)o(v)o(ed)g(picture.)-39 344 y(Simply)c(sa)o(v)o +(e)j(a)g(graphics)h(within)f FD(Mathematica)e FI(is)i +Fy(PS)g FI(format,)f(or)h(pass)h(the)f(output)h(through)g +Fy(psfix)p FI(.)-39 404 y(Then)g(use)586 506 y Fy(extpro)e +Fx(h)p FE(mma)j(\014le)t Fx(i)h(h)p FE(pr)n(olo)n(gue)f(\014le)t +Fx(i)-39 608 y FI(where)g Fx(h)p FE(mma)i(\014le)t Fx(i)g +FI(is)f(the)g(name)e(of)j(the)e(graphics)h(sa)o(v)o(ed)g(in)f +Fy(PS)h FI(format,)f(and)h Fx(h)p FE(pr)n(olo)n(gue)h(\014le)t +Fx(i)g FI(is)f(the)-39 668 y(name)d(of)h(the)g(prologue)h(\014le)f(to)g +(sa)o(v)o(e.)21 b(E.g.)556 770 y Fy(extpro)i(mygraph.ps)f(texmma23.p)o +(ro)-39 871 y FI(The)16 b(obtained)g(prologue)h(\014le)f(can)g(b)q(e)h +(used)f(as)h(optional)f(argumen)o(t)g(for)g(the)g(option)h +Fy(-p)p FI(.)916 2914 y(11)p eop +%%Page: 12 13 +12 12 bop -39 174 a FB(11)79 b(Distribution)26 b(Files)-39 +284 y FI(This)16 b(arc)o(hiv)o(e)f(con)o(tains)h(the)g(follo)o(wing)g +(\014les:)59 361 y Fy(msdos/mma)o(2lt)o(x.)o(exe)46 b +FI(Binary)16 b(executable)f(for)h(MS/DOS)59 421 y Fy(msdos/ext)o(pro)o +(.e)o(xe)72 b FI(Binary)16 b(executable)f(for)h(MS/DOS)59 +481 y Fy(amiga/mma)o(2lt)o(x)149 b FI(Binary)16 b(executable)f(for)h +(the)g(Amiga)59 541 y Fy(amiga/ext)o(pro)174 b FI(Binary)16 +b(executable)f(for)h(the)g(Amiga)59 601 y Fy(mma2ltx.c)251 +b FI(C)17 b(source)f(of)h FE(mma2ltx)59 662 y Fy(extpro.c)277 +b FI(C)17 b(source)f(of)h Fy(extpro)59 722 y(mmatext.s)o(ty)200 +b FI(L)556 716 y FC(a)580 722 y FI(T)607 737 y(E)635 +722 y(X)15 b(macro)h(\014le)59 782 y Fy(texmma22.)o(lpr)o(o)149 +b FD(Mathematica)15 b FI(v2.2)h(P)o(ostScript)g(prologue)h(\014le)59 +842 y Fy(texmma22.)o(pro)174 b FI(Squeezed)15 b(v)o(ersion)h(of)g(`)p +Fy(texmma22.l)o(pr)o(o)p FI(')59 902 y Fy(mmawhite.)o(eps)174 +b FI(A)16 b(P)o(ostScript)g(\014le)g(needed)f(to)i(`)p +Fy(mmatext.)o(sty)o FI(')59 963 y Fy(Makefile)277 b FI(A)16 +b(Unix)f(Mak)o(e\014le)59 1023 y Fy(makefile.)o(ami)174 +b FI(Mak)o(e\014le)15 b(for)h(the)g(Amiga)59 1083 y Fy(makefile.)o(msc) +174 b FI(Mak)o(e\014le)15 b(for)h(MS/DOS)59 1143 y Fy(doc/mma2l)o(tx.)o +(dv)o(i)98 b FI(Do)q(cumen)o(tation)16 b(of)g FE(mma2ltx)h +FI(\()p Fy(dvi)e FI(form\))59 1203 y Fy(doc/mma2l)o(tx.)o(ps)123 +b FI(Do)q(cumen)o(tation)16 b(of)g FE(mma2ltx)h FI(\(P)o(ostScript)f +(form)f(at)i(300)g(dpi\))59 1263 y Fy(doc/mma2l)o(tx6)o(.p)o(s)98 +b FI(Do)q(cumen)o(tation)16 b(of)g FE(mma2ltx)h FI(\(P)o(ostScript)f +(form)f(at)i(600)g(dpi\))59 1324 y Fy(doc/6mag.)o(eps)174 +b FE(mma2ltx)17 b FI(EPSF)g(\014le)e(\(needed)h(to)g(`)p +Fy(mma2ltx.dv)o(i)p FI(')o(\))59 1384 y Fy(doc/12mag)o(.ep)o(s)149 +b FE(mma2ltx)17 b FI(EPSF)g(\014le)e(\(needed)h(to)g(`)p +Fy(mma2ltx.dv)o(i)p FI(')o(\))59 1444 y Fy(doc/12mag)p +295 1444 16 2 v 15 w(3d.eps)80 b FE(mma2ltx)17 b FI(EPSF)g(\014le)e +(\(needed)h(to)g(`)p Fy(mma2ltx.dv)o(i)p FI(')o(\))59 +1504 y Fy(doc/optc.)o(eps)174 b FE(mma2ltx)17 b FI(EPSF)g(\014le)e +(\(needed)h(to)g(`)p Fy(mma2ltx.dv)o(i)p FI(')o(\))59 +1564 y Fy(doc/arrsa)o(mp.)o(ep)o(s)98 b FE(mma2ltx)17 +b FI(EPSF)g(\014le)e(\(needed)h(to)g(`)p Fy(mma2ltx.dv)o(i)p +FI(')o(\))59 1625 y Fy(doc/arrpa)o(rm.)o(1)149 b FE(mma2ltx)17 +b FI(EPSF)g(\014le)e(\(needed)h(to)g(`)p Fy(mma2ltx.dv)o(i)p +FI(')o(\))59 1685 y Fy(mysample.)o(tex)174 b FI(A)16 +b(sample)f(\014le)59 1745 y Fy(mypic.ps)277 b FI(A)16 +b(sample)f(picture)g(created)h(b)o(y)g FD(Mathematica)59 +1805 y Fy(mypic.tex)251 b FI(The)16 b(\014le)g(`)p Fy(mypic.ps)p +FI(')c(as)17 b(pro)q(cessed)g(b)o(y)f FE(mma2ltx)59 1865 +y Fy(mypic.eps)251 b FI(The)16 b(\014le)g(`)p Fy(mypic.ps)p +FI(')c(as)17 b(pro)q(cessed)g(b)o(y)f FE(mma2ltx)59 1926 +y Fy(README)329 b FI(A)16 b(short)h(description)f(of)g +FE(mma2ltx)p FI(.)-39 2073 y FB(12)79 b(Limits)24 b(of)j +Fz(mma2ltx)-39 2182 y FI(Curren)o(tly)15 b(aren't)h(\(y)o(et\))f(supp)q +(orted:)33 2284 y Fx(\017)25 b FI(rotated)16 b(lab)q(els.)33 +2386 y Fx(\017)25 b FI(m)o(ultiple)13 b(graphics)j(\(the)g(ones)h(pro)q +(duced)g(with)f Fy(GraphicsA)o(rra)o(y)p FI(\).)33 2487 +y Fx(\017)25 b FI(the)16 b(`)p Fy(...->Fo)o(ntF)o(orm)o +FI(')d FD(Mathematica)i FI(parameter.)-39 2654 y FB(13)79 +b(T)-7 b(o)27 b(do)g(list)-39 2763 y FI(Here)15 b(follo)o(w)h(future)g +(enhancemen)o(ts)e(whic)o(h)h(are)i(on)f(m)o(y)f(list:)916 +2914 y(12)p eop +%%Page: 13 14 +13 13 bop 33 166 a Fx(\017)25 b FI(Add)16 b(supp)q(ort)h(for)g(L)457 +160 y FC(a)481 166 y FI(T)508 181 y(E)535 166 y(X)f(2)612 +177 y Fq(")635 166 y FI(.)33 268 y Fx(\017)25 b FI(Add)16 +b(supp)q(ort)h(for)g(rotated)f(lab)q(els.)33 369 y Fx(\017)25 +b FI(Add)16 b(supp)q(ort)h(for)g(others)f Fy(dvi)f FI(to)i(P)o +(ostScript)f(pro)q(cessors.)-39 536 y FB(14)79 b(Autho)n(r)27 +b(info)-39 645 y FI(If)21 b(y)o(ou)g(ha)o(v)o(e)g(some)f(questions,)j +(suggestions,)h(commen)o(t)o(s,)c(bug)i(rep)q(ort)g(or)g(enhancemen)o +(t)e(requests,)-39 706 y(please)15 b(feel)h(free)f(to)i(con)o(tact)f +(me)e(at)j(one)f(of)h(the)f(follo)o(wing)g(addresses:)33 +807 y Fx(\017)25 b Fr(ordinary)18 b(mail:)83 930 y FI(Giusepp)q(e)e +(Ghib\022)-24 b(o)83 990 y(via)15 b(Sestriere,)g(133)83 +1050 y(I-10090)j(Cascine)e(Vica)f({)i(Riv)o(oli)d(\(T)l(orino\))83 +1110 y(IT)l(AL)l(Y)33 1233 y Fx(\017)25 b Fr(in)n(ternet:)20 +b FE(ghib)n(o@galile)n(o.p)n(olito.it)-39 1399 y FB(15)79 +b(Ackno)n(wledgements)-39 1509 y FI(The)16 b(author)h(wishes)f(to)h +(thanks:)33 1610 y Fx(\017)25 b FI(P)l(.)15 b(Lep)q(ora)j(for)f(his)f +(signi\014cativ)o(e)f(suggestions)i(and)g(collab)q(oration.)33 +1712 y Fx(\017)25 b FI(P)l(.)15 b(Boieri)g(for)i(his)f(suggestions)i +(and)e(for)h(ha)o(ving)f(in)o(tensely)f(tested)g FE(mma2ltx)p +FI(.)-39 1878 y FB(16)79 b(Histo)n(ry)-39 1988 y Fr(v)n(ersion)18 +b(1.23)141 2102 y Fx(\017)24 b FI(Added)16 b(option)g +Fy(-a)g FI(to)g(dra)o(w)h(arro)o(ws)g(on)g(axes)f(of)h(a)f(2D)h +(graphic.)141 2183 y Fx(\017)24 b FI(Fixed)15 b(a)i(bug)f(in)g(the)g +(st)o(yle)f Fy(mmatext.sty)o FI(.)-39 2297 y Fr(v)n(ersion)j(1.22)141 +2411 y Fx(\017)24 b FI(Fixed)15 b(a)i(small)d(bug)j(whic)o(h)f(caused)g +('segmen)o(tation)f(fault')g(under)i(Lin)o(ux.)141 2492 +y Fx(\017)24 b FI(Use)16 b(of)g(p)q(error\(\))h(instead)f(of)h +(strerror\(\))f(\(suggested)h(b)o(y)f(P)o(eter)f(Whaite\).)-39 +2606 y Fr(v)n(ersion)j(1.21)141 2721 y Fx(\017)24 b FI(P)o(ossibilit)o +(y)14 b(to)j(use)f(new)o(er)g(prologue)h(\014les)e(from)h +FD(Mathematica)p FI(.)141 2802 y Fx(\017)24 b FI(Added)16 +b(supp)q(ort)h(for)g(m)o(ultiple)c Fy(-c)i FI(options.)916 +2914 y(13)p eop +%%Page: 14 15 +14 14 bop 141 166 a Fx(\017)24 b FI(Added)16 b(option)g +Fy(-e)g FI(\(suggested)h(b)o(y)f(Holger)f(Danielsson\).)141 +247 y Fx(\017)24 b FI(Fixed)15 b(a)i(bug)f(in)g(the)g(function)g +(strtolwr\(\))h(\(rep)q(orted)f(b)o(y)g(Klaus)g(Burkhard\).)-39 +361 y Fr(v)n(ersion)i(1.2)141 475 y Fx(\017)24 b FI(Added)16 +b(supp)q(ort)i(to)f(obtain)g(non-transparen)o(t)h(ob)s(jects.)j(No)o(w) +c(ob)s(jects)f(\(strings,)h(pictures)190 535 y(and)g(so)h(on\),)f(can)g +(b)q(e)g(placed)f(to)h(o)o(v)o(erlap)f(the)h(bac)o(kground)g(graphic,)g +(i.e.)22 b(as)17 b(if)f(they)h(w)o(ere)190 596 y(non-transparen)o(t.) +141 677 y Fx(\017)24 b FI(Added)16 b(P)o(ostScript)g(do)q(cumen)o +(tation)f(for)h(600)i(dpi)e(prin)o(ters.)141 758 y Fx(\017)24 +b FI(Added)16 b(binary)g(executable)f(for)h(the)g(Amiga.)-39 +872 y Fr(v)n(ersion)i(1.1)24 b FI(First)15 b(public)h(release.)916 +2914 y(14)p eop +%%Trailer +end +userdict /end-hook known{end-hook}if +%%EOF diff --git a/graphics/mma2ltx/doc/mma2ltx6.ps b/graphics/mma2ltx/doc/mma2ltx6.ps new file mode 100644 index 0000000000..bfe9321f45 --- /dev/null +++ b/graphics/mma2ltx/doc/mma2ltx6.ps @@ -0,0 +1,6258 @@ +%!PS-Adobe-2.0 +%%Creator: dvips 5.58 Copyright 1986, 1994 Radical Eye Software +%%Title: mma2ltx.dvi +%%CreationDate: Wed Jun 21 14:17:45 1995 +%%Pages: 15 +%%PageOrder: Ascend +%%BoundingBox: 0 0 596 842 +%%EndComments +%DVIPSCommandLine: dvips -Pljfour -Z -omma2ltx6.ps mma2ltx +%DVIPSParameters: dpi=600, compressed, comments removed +%DVIPSSource: TeX output 1995.06.21:1413 +%%BeginProcSet: texc.pro +/TeXDict 250 dict def TeXDict begin /N{def}def /B{bind def}N /S{exch}N +/X{S N}B /TR{translate}N /isls false N /vsize 11 72 mul N /hsize 8.5 72 +mul N /landplus90{false}def /@rigin{isls{[0 landplus90{1 -1}{-1 1} +ifelse 0 0 0]concat}if 72 Resolution div 72 VResolution div neg scale +isls{landplus90{VResolution 72 div vsize mul 0 exch}{Resolution -72 div +hsize mul 0}ifelse TR}if Resolution VResolution vsize -72 div 1 add mul +TR[matrix currentmatrix{dup dup round sub abs 0.00001 lt{round}if} +forall round exch round exch]setmatrix}N /@landscape{/isls true N}B +/@manualfeed{statusdict /manualfeed true put}B /@copies{/#copies X}B +/FMat[1 0 0 -1 0 0]N /FBB[0 0 0 0]N /nn 0 N /IE 0 N /ctr 0 N /df-tail{ +/nn 8 dict N nn begin /FontType 3 N /FontMatrix fntrx N /FontBBox FBB N +string /base X array /BitMaps X /BuildChar{CharBuilder}N /Encoding IE N +end dup{/foo setfont}2 array copy cvx N load 0 nn put /ctr 0 N[}B /df{ +/sf 1 N /fntrx FMat N df-tail}B /dfs{div /sf X /fntrx[sf 0 0 sf neg 0 0] +N df-tail}B /E{pop nn dup definefont setfont}B /ch-width{ch-data dup +length 5 sub get}B /ch-height{ch-data dup length 4 sub get}B /ch-xoff{ +128 ch-data dup length 3 sub get sub}B /ch-yoff{ch-data dup length 2 sub +get 127 sub}B /ch-dx{ch-data dup length 1 sub get}B /ch-image{ch-data +dup type /stringtype ne{ctr get /ctr ctr 1 add N}if}B /id 0 N /rw 0 N +/rc 0 N /gp 0 N /cp 0 N /G 0 N /sf 0 N /CharBuilder{save 3 1 roll S dup +/base get 2 index get S /BitMaps get S get /ch-data X pop /ctr 0 N ch-dx +0 ch-xoff ch-yoff ch-height sub ch-xoff ch-width add ch-yoff +setcachedevice ch-width ch-height true[1 0 0 -1 -.1 ch-xoff sub ch-yoff +.1 sub]/id ch-image N /rw ch-width 7 add 8 idiv string N /rc 0 N /gp 0 N +/cp 0 N{rc 0 ne{rc 1 sub /rc X rw}{G}ifelse}imagemask restore}B /G{{id +gp get /gp gp 1 add N dup 18 mod S 18 idiv pl S get exec}loop}B /adv{cp +add /cp X}B /chg{rw cp id gp 4 index getinterval putinterval dup gp add +/gp X adv}B /nd{/cp 0 N rw exit}B /lsh{rw cp 2 copy get dup 0 eq{pop 1}{ +dup 255 eq{pop 254}{dup dup add 255 and S 1 and or}ifelse}ifelse put 1 +adv}B /rsh{rw cp 2 copy get dup 0 eq{pop 128}{dup 255 eq{pop 127}{dup 2 +idiv S 128 and or}ifelse}ifelse put 1 adv}B /clr{rw cp 2 index string +putinterval adv}B /set{rw cp fillstr 0 4 index getinterval putinterval +adv}B /fillstr 18 string 0 1 17{2 copy 255 put pop}for N /pl[{adv 1 chg} +{adv 1 chg nd}{1 add chg}{1 add chg nd}{adv lsh}{adv lsh nd}{adv rsh}{ +adv rsh nd}{1 add adv}{/rc X nd}{1 add set}{1 add clr}{adv 2 chg}{adv 2 +chg nd}{pop nd}]dup{bind pop}forall N /D{/cc X dup type /stringtype ne{] +}if nn /base get cc ctr put nn /BitMaps get S ctr S sf 1 ne{dup dup +length 1 sub dup 2 index S get sf div put}if put /ctr ctr 1 add N}B /I{ +cc 1 add D}B /bop{userdict /bop-hook known{bop-hook}if /SI save N @rigin +0 0 moveto /V matrix currentmatrix dup 1 get dup mul exch 0 get dup mul +add .99 lt{/QV}{/RV}ifelse load def pop pop}N /eop{SI restore userdict +/eop-hook known{eop-hook}if showpage}N /@start{userdict /start-hook +known{start-hook}if pop /VResolution X /Resolution X 1000 div /DVImag X +/IE 256 array N 0 1 255{IE S 1 string dup 0 3 index put cvn put}for +65781.76 div /vsize X 65781.76 div /hsize X}N /p{show}N /RMat[1 0 0 -1 0 +0]N /BDot 260 string N /rulex 0 N /ruley 0 N /v{/ruley X /rulex X V}B /V +{}B /RV statusdict begin /product where{pop product dup length 7 ge{0 7 +getinterval dup(Display)eq exch 0 4 getinterval(NeXT)eq or}{pop false} +ifelse}{false}ifelse end{{gsave TR -.1 .1 TR 1 1 scale rulex ruley false +RMat{BDot}imagemask grestore}}{{gsave TR -.1 .1 TR rulex ruley scale 1 1 +false RMat{BDot}imagemask grestore}}ifelse B /QV{gsave newpath transform +round exch round exch itransform moveto rulex 0 rlineto 0 ruley neg +rlineto rulex neg 0 rlineto fill grestore}B /a{moveto}B /delta 0 N /tail +{dup /delta X 0 rmoveto}B /M{S p delta add tail}B /b{S p tail}B /c{-4 M} +B /d{-3 M}B /e{-2 M}B /f{-1 M}B /g{0 M}B /h{1 M}B /i{2 M}B /j{3 M}B /k{ +4 M}B /w{0 rmoveto}B /l{p -4 w}B /m{p -3 w}B /n{p -2 w}B /o{p -1 w}B /q{ +p 1 w}B /r{p 2 w}B /s{p 3 w}B /t{p 4 w}B /x{0 S rmoveto}B /y{3 2 roll p +a}B /bos{/SS save N}B /eos{SS restore}B end +%%EndProcSet +%%BeginProcSet: texmma22.pro +% Mathematica v2.2 prologue +/Mathdict 150 dict def Mathdict begin /Mlmarg 0 def /Mrmarg 0 def +/Mbmarg 0 def /Mtmarg 0 def /Mtransform{}bind def /Mfixwid true def +/Mfixdash false def /Mrot 0 def /Mpstart{MathPictureStart}bind def +/Mpend{MathPictureEnd}bind def /Mscale{0 1 0 1 5 -1 roll MathScale}bind +def /ISOLatin1Encoding dup where{pop pop}{[/.notdef /.notdef /.notdef +/.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef +/.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef +/.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef +/.notdef /.notdef /.notdef /.notdef /.notdef /space /exclam /quotedbl +/numbersign /dollar /percent /ampersand /quoteright /parenleft +/parenright /asterisk /plus /comma /minus /period /slash /zero /one /two +/three /four /five /six /seven /eight /nine /colon /semicolon /less +/equal /greater /question /at /A /B /C /D /E /F /G /H /I /J /K /L /M /N +/O /P /Q /R /S /T /U /V /W /X /Y /Z /bracketleft /backslash +/bracketright /asciicircum /underscore /quoteleft /a /b /c /d /e /f /g +/h /i /j /k /l /m /n /o /p /q /r /s /t /u /v /w /x /y /z /braceleft /bar +/braceright /asciitilde /.notdef /.notdef /.notdef /.notdef /.notdef +/.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef +/.notdef /.notdef /.notdef /.notdef /dotlessi /grave /acute /circumflex +/tilde /macron /breve /dotaccent /dieresis /.notdef /ring /cedilla +/.notdef /hungarumlaut /ogonek /caron /space /exclamdown /cent /sterling +/currency /yen /brokenbar /section /dieresis /copyright /ordfeminine +/guillemotleft /logicalnot /hyphen /registered /macron /degree +/plusminus /twosuperior /threesuperior /acute /mu /paragraph +/periodcentered /cedilla /onesuperior /ordmasculine /guillemotright +/onequarter /onehalf /threequarters /questiondown /Agrave /Aacute +/Acircumflex /Atilde /Adieresis /Aring /AE /Ccedilla /Egrave /Eacute +/Ecircumflex /Edieresis /Igrave /Iacute /Icircumflex /Idieresis /Eth +/Ntilde /Ograve /Oacute /Ocircumflex /Otilde /Odieresis /multiply +/Oslash /Ugrave /Uacute /Ucircumflex /Udieresis /Yacute /Thorn +/germandbls /agrave /aacute /acircumflex /atilde /adieresis /aring /ae +/ccedilla /egrave /eacute /ecircumflex /edieresis /igrave /iacute +/icircumflex /idieresis /eth /ntilde /ograve /oacute /ocircumflex +/otilde /odieresis /divide /oslash /ugrave /uacute /ucircumflex +/udieresis /yacute /thorn /ydieresis]def}ifelse /MFontDict 50 dict def +/MStrCat{exch dup length 2 index length add string dup 3 1 roll copy +length exch dup 4 2 roll exch putinterval}def /MCreateEncoding{1 index +255 string cvs(-)MStrCat 1 index MStrCat cvn exch(Encoding)MStrCat cvn +dup where{exch get}{pop StandardEncoding}ifelse 3 1 roll dup MFontDict +exch known not{1 index findfont dup length dict begin{1 index /FID ne{ +def}{pop pop}ifelse}forall /Encoding 3 index def currentdict end 1 index +exch definefont pop MFontDict 1 index null put}if exch pop exch pop}def +/ISOLatin1{(ISOLatin1)MCreateEncoding}def /ISO8859{(ISOLatin1) +MCreateEncoding}def /Mcopyfont{dup maxlength dict exch{1 index /FID eq{ +pop pop}{2 index 3 1 roll put}ifelse}forall}def /Plain /Courier findfont +Mcopyfont definefont pop /Bold /Courier findfont Mcopyfont +definefont pop /Italic /Courier findfont Mcopyfont definefont +pop /MathPictureStart{gsave Mtransform Mlmarg Mbmarg translate Mwidth +Mlmarg Mrmarg add sub /Mwidth exch def Mheight Mbmarg Mtmarg add sub +/Mheight exch def /Mtmatrix matrix currentmatrix def /Mgmatrix matrix +currentmatrix def}bind def /MathPictureEnd{grestore}bind def /MFill{0 0 +moveto Mwidth 0 lineto Mwidth Mheight lineto 0 Mheight lineto fill}bind +def /MPlotRegion{3 index Mwidth mul 2 index Mheight mul translate exch +sub Mheight mul /Mheight exch def exch sub Mwidth mul /Mwidth exch def} +bind def /MathSubStart{Momatrix Mgmatrix Mtmatrix Mwidth Mheight 7 -2 +roll moveto Mtmatrix setmatrix currentpoint Mgmatrix setmatrix 9 -2 roll +moveto Mtmatrix setmatrix currentpoint 2 copy translate /Mtmatrix matrix +currentmatrix def 3 -1 roll exch sub /Mheight exch def sub /Mwidth exch +def}bind def /MathSubEnd{/Mheight exch def /Mwidth exch def /Mtmatrix +exch def dup setmatrix /Mgmatrix exch def /Momatrix exch def}bind def +/Mdot{moveto 0 0 rlineto stroke}bind def /Mtetra{moveto lineto lineto +lineto fill}bind def /Metetra{moveto lineto lineto lineto closepath +gsave fill grestore 0 setgray stroke}bind def /Mistroke{flattenpath 0 0 +0{4 2 roll pop pop}{4 -1 roll 2 index sub dup mul 4 -1 roll 2 index sub +dup mul add sqrt 4 -1 roll add 3 1 roll}{stop}{stop}pathforall pop pop +currentpoint stroke moveto currentdash 3 -1 roll add setdash}bind def +/Mfstroke{stroke currentdash pop 0 setdash}bind def /Mrotsboxa{gsave dup +/Mrot exch def Mrotcheck Mtmatrix dup setmatrix 7 1 roll 4 index 4 index +translate rotate 3 index -1 mul 3 index -1 mul translate /Mtmatrix +matrix currentmatrix def grestore Msboxa 3 -1 roll /Mtmatrix exch def +/Mrot 0 def}bind def /Msboxa{newpath 5 -1 roll Mvboxa pop Mboxout 6 -1 +roll 5 -1 roll 4 -1 roll Msboxa1 5 -3 roll Msboxa1 Mboxrot[7 -2 roll 2 +copy[3 1 roll 10 -1 roll 9 -1 roll]6 1 roll 5 -2 roll]}bind def /Msboxa1 +{sub 2 div dup 2 index 1 add mul 3 -1 roll -1 add 3 -1 roll mul}bind def +/Mvboxa{Mfixwid{Mvboxa1}{dup Mwidthcal 0 exch{add}forall exch Mvboxa1 4 +index 7 -1 roll add 4 -1 roll pop 3 1 roll}ifelse}bind def /Mvboxa1{ +gsave newpath[true 3 -1 roll{Mbbox 5 -1 roll{0 5 1 roll}{7 -1 roll exch +sub(m)stringwidth pop .3 mul sub 7 1 roll 6 -1 roll 4 -1 roll Mmin 3 -1 +roll 5 index add 5 -1 roll 4 -1 roll Mmax 4 -1 roll}ifelse false}forall{ +stop}if counttomark 1 add 4 roll]grestore}bind def /Mbbox{1 dict begin 0 +0 moveto /temp(T)def{gsave currentpoint newpath moveto temp 0 3 -1 roll +put temp false charpath flattenpath currentpoint pathbbox grestore +moveto lineto moveto}forall pathbbox newpath end}bind def /Mmin{2 copy +gt{exch}if pop}bind def /Mmax{2 copy lt{exch}if pop}bind def /Mrotshowa{ +dup /Mrot exch def Mrotcheck Mtmatrix dup setmatrix 7 1 roll 4 index 4 +index translate rotate 3 index -1 mul 3 index -1 mul translate /Mtmatrix +matrix currentmatrix def Mgmatrix setmatrix Mshowa /Mtmatrix exch def +/Mrot 0 def}bind def /Mshowa{4 -2 roll moveto 2 index Mtmatrix setmatrix +Mvboxa 7 1 roll Mboxout 6 -1 roll 5 -1 roll 4 -1 roll Mshowa1 4 1 roll +Mshowa1 rmoveto currentpoint Mfixwid{Mshowax}{Mshoway}ifelse pop pop pop +pop Mgmatrix setmatrix}bind def /Mshowax{0 1 4 index length -1 add{2 +index 4 index 2 index get 3 index add moveto 4 index exch get Mfixdash{ +Mfixdashp}if show}for}bind def /Mfixdashp{dup length 1 gt 1 index true +exch{45 eq and}forall and{gsave(--)stringwidth pop(-)stringwidth pop sub +2 div 0 rmoveto dup length 1 sub{(-)show}repeat grestore}if}bind def +/Mshoway{3 index Mwidthcal 5 1 roll 0 1 4 index length -1 add{2 index 4 +index 2 index get 3 index add moveto 4 index exch get[6 index aload +length 2 add -1 roll{pop Strform stringwidth pop neg exch add 0 rmoveto} +exch kshow cleartomark}for pop}bind def /Mwidthcal{[exch{Mwidthcal1} +forall][exch dup Maxlen -1 add 0 1 3 -1 roll{[exch 2 index{1 index Mget +exch}forall pop Maxget exch}for pop]Mreva}bind def /Mreva{[exch aload +length -1 1{1 roll}for]}bind def /Mget{1 index length -1 add 1 index ge{ +get}{pop pop 0}ifelse}bind def /Maxlen{[exch{length}forall Maxget}bind +def /Maxget{counttomark -1 add 1 1 3 -1 roll{pop Mmax}for exch pop}bind +def /Mwidthcal1{[exch{Strform stringwidth pop}forall]}bind def /Strform{ +/tem(x)def tem 0 3 -1 roll put tem}bind def /Mshowa1{2 copy add 4 1 roll +sub mul sub -2 div}bind def /MathScale{Mwidth Mheight Mlp translate +scale /yscale exch def /ybias exch def /xscale exch def /xbias exch def +/Momatrix xscale yscale matrix scale xbias ybias matrix translate matrix +concatmatrix def /Mgmatrix matrix currentmatrix def}bind def /Mlp{3 copy +Mlpfirst{Mnodistort{Mmin dup}if 4 index 2 index 2 index Mlprun 11 index +11 -1 roll 10 -4 roll Mlp1 8 index 9 -5 roll Mlp1 4 -1 roll and{exit}if +3 -1 roll pop pop}loop exch 3 1 roll 7 -3 roll pop pop pop}bind def +/Mlpfirst{3 -1 roll dup length 2 copy -2 add get aload pop pop pop 4 -2 +roll -1 add get aload pop pop pop 6 -1 roll 3 -1 roll 5 -1 roll sub div +4 1 roll exch sub div}bind def /Mlprun{2 copy 4 index 0 get dup 4 1 roll +Mlprun1 3 copy 8 -2 roll 9 -1 roll{3 copy Mlprun1 3 copy 11 -3 roll /gt +Mlpminmax 8 3 roll 11 -3 roll /lt Mlpminmax 8 3 roll}forall pop pop pop +pop 3 1 roll pop pop aload pop 5 -1 roll aload pop exch 6 -1 roll +Mlprun2 8 2 roll 4 -1 roll Mlprun2 6 2 roll 3 -1 roll Mlprun2 4 2 roll +exch Mlprun2 6 2 roll}bind def /Mlprun1{aload pop exch 6 -1 roll 5 -1 +roll mul add 4 -2 roll mul 3 -1 roll add}bind def /Mlprun2{2 copy add 2 +div 3 1 roll exch sub}bind def /Mlpminmax{cvx 2 index 6 index 2 index +exec{7 -3 roll 4 -1 roll}if 1 index 5 index 3 -1 roll exec{4 1 roll pop +5 -1 roll aload pop pop 4 -1 roll aload pop[8 -2 roll pop 5 -2 roll pop +6 -2 roll pop 5 -1 roll]4 1 roll pop}{pop pop pop}ifelse}bind def /Mlp1{ +5 index 3 index sub 5 index 2 index mul 1 index le 1 index 0 le or dup +not{1 index 3 index div .99999 mul 8 -1 roll pop 7 1 roll}if 8 -1 roll 2 +div 7 -2 roll pop sub 5 index 6 -3 roll pop pop mul sub exch}bind def +/intop 0 def /inrht 0 def /inflag 0 def /outflag 0 def /xadrht 0 def +/xadlft 0 def /yadtop 0 def /yadbot 0 def /Minner{outflag 1 eq{/outflag +0 def /intop 0 def /inrht 0 def}if 5 index gsave Mtmatrix setmatrix +Mvboxa pop grestore 3 -1 roll pop dup intop gt{/intop exch def}{pop} +ifelse dup inrht gt{/inrht exch def}{pop}ifelse pop /inflag 1 def}bind +def /Mouter{/xadrht 0 def /xadlft 0 def /yadtop 0 def /yadbot 0 def +inflag 1 eq{dup 0 lt{dup intop mul neg /yadtop exch def}if dup 0 gt{dup +intop mul /yadbot exch def}if pop dup 0 lt{dup inrht mul neg /xadrht +exch def}if dup 0 gt{dup inrht mul /xadlft exch def}if pop /outflag 1 +def}{pop pop}ifelse /inflag 0 def /inrht 0 def /intop 0 def}bind def +/Mboxout{outflag 1 eq{4 -1 roll xadlft leadjust add sub 4 1 roll 3 -1 +roll yadbot leadjust add sub 3 1 roll exch xadrht leadjust add add exch +yadtop leadjust add add /outflag 0 def /xadlft 0 def /yadbot 0 def +/xadrht 0 def /yadtop 0 def}if}bind def /leadjust{(m)stringwidth pop .5 +mul}bind def /Mrotcheck{dup 90 eq{yadbot /yadbot xadrht def /xadrht +yadtop def /yadtop xadlft def /xadlft exch def}if dup cos 1 index sin +Checkaux dup cos 1 index sin neg exch Checkaux 3 1 roll pop pop}bind def +/Checkaux{4 index exch 4 index mul 3 1 roll mul add 4 1 roll}bind def +/Mboxrot{Mrot 90 eq{brotaux 4 2 roll}if Mrot 180 eq{4 2 roll brotaux 4 2 +roll brotaux}if Mrot 270 eq{4 2 roll brotaux}if}bind def /brotaux{neg +exch neg}bind def /Mabsproc{0 matrix defaultmatrix dtransform +idtransform dup mul exch dup mul add sqrt}bind def /Mabswid{Mabsproc +setlinewidth}bind def /Mabsdash{exch[exch{Mabsproc}forall]exch setdash} +bind def /MBeginOrig{Momatrix concat}bind def /MEndOrig{Mgmatrix +setmatrix}bind def /sampledsound where{pop}{/sampledsound{exch pop exch +5 1 roll mul 4 idiv mul 2 idiv exch pop exch /Mtempproc exch def{ +Mtempproc pop}repeat}bind def}ifelse /g{setgray}bind def /k{ +setcmykcolor}bind def /m{moveto}bind def /p{gsave}bind def /r{ +setrgbcolor}bind def /w{setlinewidth}bind def /C{curveto}bind def /F{ +fill}bind def /L{lineto}bind def /P{grestore}bind def /s{stroke}bind def +/setcmykcolor where{pop}{/setcmykcolor{4 1 roll[4 1 roll]{1 index sub 1 +sub neg dup 0 lt{pop 0}if dup 1 gt{pop 1}if exch}forall pop setrgbcolor} +bind def}ifelse /Mcharproc{currentfile(x)readhexstring pop 0 get exch +div}bind def /Mshadeproc{dup 3 1 roll{dup Mcharproc 3 1 roll}repeat 1 eq +{setgray}{3 eq{setrgbcolor}{setcmykcolor}ifelse}ifelse}bind def +/Mrectproc{3 index 2 index moveto 2 index 3 -1 roll lineto dup 3 1 roll +lineto lineto fill}bind def /Mcolorimage{7 1 roll pop pop matrix +invertmatrix concat 2 exch exp 1 sub 3 1 roll 1 1 2 index{1 1 4 index{ +dup 1 sub exch 2 index dup 1 sub exch 7 index 9 index Mshadeproc +Mrectproc}for pop}for pop pop pop pop}bind def /Mimage{pop matrix +invertmatrix concat 2 exch exp 1 sub 3 1 roll 1 1 2 index{1 1 4 index{ +dup 1 sub exch 2 index dup 1 sub exch 7 index Mcharproc setgray +Mrectproc}for pop}for pop pop pop}bind def end +%%EndProcSet +%%BeginProcSet: finclude.pro +/fstore{dup dict exch{dup 4 2 roll put}repeat def}bind def /fshow{gsave +72 TeXDict /Resolution get div -72 TeXDict /VResolution get div scale 1 +DVImag div dup scale get cvx exec show grestore}bind def +%%EndProcSet +%%BeginProcSet: special.pro +TeXDict begin /SDict 200 dict N SDict begin /@SpecialDefaults{/hs 612 N +/vs 792 N /ho 0 N /vo 0 N /hsc 1 N /vsc 1 N /ang 0 N /CLIP 0 N /rwiSeen +false N /rhiSeen false N /letter{}N /note{}N /a4{}N /legal{}N}B +/@scaleunit 100 N /@hscale{@scaleunit div /hsc X}B /@vscale{@scaleunit +div /vsc X}B /@scale{dup /hsc X /vsc X}B /@hsize{/hs X /CLIP 1 N}B +/@vsize{/vs X /CLIP 1 N}B /@clip{/CLIP 2 N}B /@hoffset{/ho X}B /@voffset +{/vo X}B /@angle{/ang X}B /@rwi{10 div /rwi X /rwiSeen true N}B /@rhi{ +10 div /rhi X /rhiSeen true N}B /@llx{/llx X}B /@lly{/lly X}B /@urx{ +/urx X}B /@ury{/ury X}B /magscale true def end /@MacSetUp{userdict /md +known{userdict /md get type /dicttype eq{userdict begin md length 10 add +md maxlength ge{/md md dup length 20 add dict copy def}if end md begin +/letter{}N /note{}N /legal{}N /od{txpose 1 0 mtx defaultmatrix +dtransform S atan/pa X newpath clippath mark{transform{itransform moveto +}}{transform{itransform lineto}}{6 -2 roll transform 6 -2 roll transform +6 -2 roll transform{itransform 6 2 roll itransform 6 2 roll itransform 6 +2 roll curveto}}{{closepath}}pathforall newpath counttomark array astore +/gc xdf pop ct 39 0 put 10 fz 0 fs 2 F/|______Courier fnt invertflag{ +PaintBlack}if}N /txpose{pxs pys scale ppr aload pop por{noflips{pop S +neg S TR pop 1 -1 scale}if xflip yflip and{pop S neg S TR 180 rotate 1 +-1 scale ppr 3 get ppr 1 get neg sub neg ppr 2 get ppr 0 get neg sub neg +TR}if xflip yflip not and{pop S neg S TR pop 180 rotate ppr 3 get ppr 1 +get neg sub neg 0 TR}if yflip xflip not and{ppr 1 get neg ppr 0 get neg +TR}if}{noflips{TR pop pop 270 rotate 1 -1 scale}if xflip yflip and{TR +pop pop 90 rotate 1 -1 scale ppr 3 get ppr 1 get neg sub neg ppr 2 get +ppr 0 get neg sub neg TR}if xflip yflip not and{TR pop pop 90 rotate ppr +3 get ppr 1 get neg sub neg 0 TR}if yflip xflip not and{TR pop pop 270 +rotate ppr 2 get ppr 0 get neg sub neg 0 S TR}if}ifelse scaleby96{ppr +aload pop 4 -1 roll add 2 div 3 1 roll add 2 div 2 copy TR .96 dup scale +neg S neg S TR}if}N /cp{pop pop showpage pm restore}N end}if}if}N +/normalscale{Resolution 72 div VResolution 72 div neg scale magscale{ +DVImag dup scale}if 0 setgray}N /psfts{S 65781.76 div N}N /startTexFig{ +/psf$SavedState save N userdict maxlength dict begin /magscale true def +normalscale currentpoint TR /psf$ury psfts /psf$urx psfts /psf$lly psfts +/psf$llx psfts /psf$y psfts /psf$x psfts currentpoint /psf$cy X /psf$cx +X /psf$sx psf$x psf$urx psf$llx sub div N /psf$sy psf$y psf$ury psf$lly +sub div N psf$sx psf$sy scale psf$cx psf$sx div psf$llx sub psf$cy +psf$sy div psf$ury sub TR /showpage{}N /erasepage{}N /copypage{}N /p 3 +def @MacSetUp}N /doclip{psf$llx psf$lly psf$urx psf$ury currentpoint 6 2 +roll newpath 4 copy 4 2 roll moveto 6 -1 roll S lineto S lineto S lineto +closepath clip newpath moveto}N /endTexFig{end psf$SavedState restore}N +/@beginspecial{SDict begin /SpecialSave save N gsave normalscale +currentpoint TR @SpecialDefaults count /ocount X /dcount countdictstack +N}N /@setspecial{CLIP 1 eq{newpath 0 0 moveto hs 0 rlineto 0 vs rlineto +hs neg 0 rlineto closepath clip}if ho vo TR hsc vsc scale ang rotate +rwiSeen{rwi urx llx sub div rhiSeen{rhi ury lly sub div}{dup}ifelse +scale llx neg lly neg TR}{rhiSeen{rhi ury lly sub div dup scale llx neg +lly neg TR}if}ifelse CLIP 2 eq{newpath llx lly moveto urx lly lineto urx +ury lineto llx ury lineto closepath clip}if /showpage{}N /erasepage{}N +/copypage{}N newpath}N /@endspecial{count ocount sub{pop}repeat +countdictstack dcount sub{end}repeat grestore SpecialSave restore end}N +/@defspecial{SDict begin}N /@fedspecial{end}B /li{lineto}B /rl{rlineto} +B /rc{rcurveto}B /np{/SaveX currentpoint /SaveY X N 1 setlinecap newpath +}N /st{stroke SaveX SaveY moveto}N /fil{fill SaveX SaveY moveto}N +/ellipse{/endangle X /startangle X /yrad X /xrad X /savematrix matrix +currentmatrix N TR xrad yrad scale 0 0 1 startangle endangle arc +savematrix setmatrix}N end +%%EndProcSet +TeXDict begin 39158280 55380996 1000 600 600 +(Work:tmp/mma2ltx-doc/mma2ltx.dvi) @start /Fa 6 121 df<ED7FF0913807FFFE +021FEBFFC091B612F04915FC01078149814982498249D9C03F7F9027FFFE00077F4801F8 +01017F4849EB007F02C06E7E4849141F4890C86C7E5B001F707E5B4981003F1880498112 +7F5BA219C000FF825B90B9FCA71980190001E0CBFC127FA37F123F7FA26C6C163F6DEE7F +80000FEFFFC07F6C6D5C14E06C6D4A13806C6D5C6C01FE021F13006D6C6C137F6D9039F8 +03FFFE6D90B65A6D5E6D5E6D5E01005E023F92C7FC020F14FC020114E09126003FFEC8FC +3A4178BF4B>101 D<EDFFC0020F13FC023F13FF91B612C0010315F04981498149814981 +49D9807F7F9027FFFC000F7F4801F001037F48496D7F4A7F48496E7E4890C86C7E49151F +48486F7EA249150748486F7EA2007F18804981A448486F13C0AA6D5DA2007F1880A26D5D +A2003F18006D5DA26C6C4B5A6D151F000F5F6D153F6C6D4A5A6E14FF6C6D495B6C01F801 +075B6C6D495B9138FF807F6D90B65A6D93C7FC6D5D010715F86D5D010015C0023F91C8FC +020F13FC020013C03A4178BF4B>111 D<EE1FFC263FFFF090B57E48D9F80714E0B5D8FC +1F14F8037F14FE92B7FC91B87E856C846CDBF01F7FD8000FDA80037F4BC77F03F8147F4B +EC1FFE4B6E7E5D4B6E138092C87EA24A6F13C0845C1AE0197FA31AF0193FAA197F1AE0A2 +8019FF1AC06E5DA26F4A1380A26F4A1300606F4A5A6F143F6F4A5A6F49485A03FF01075B +EEE03F93B65A6102FD93C7FC02FC5D6F5C031F14F06F14C0030191C8FC9238003FF093CA +FCB3A4003FB6FC4881B77EA56C5D6C92CAFC445F7FBE4B>I<943803FF80003FB56C013F +13F0486E48B512FCB6D8E00780041F805E93B7128015E16C14E36C02E7EBFE07C7D87FEF +13E092B5D880031300EEFE004C6D5A04F06D5A4C91C7FC5E5EA293CAFC5DA25DA25DA25D +A45DB3A6003FB712FC4882B9FCA56C5E6C5E413F7CBE4B>114 D<EC1F804A7E4A7EAF00 +3FB812FC4883BAFCA56C5F6C5FC7D87FE0C9FCB3ABF01F80F03FC0F07FE0A718FF6F15C0 +023F5C6F5B6F4913806E6C5B9226FFC07F13006E90B55AA26E5D6E15F06E5D6E5D033F91 +C7FC030F13F8030013C03B507CCE4B>116 D<001FB5D8C003B512FC486E48804802F081 +5EA3826C02E05D6C4A6C5C260007FCC7D81FF0C7FC6E4A5A6D6C147F6D6D495A6D5E6F48 +90C8FC6E6C5ADA3FF05B021F495A6E6C485AEDFC1FDA07FE5B0203495A6E6C485A6E13FF +5F6F90C9FC6F5A151F5E6F5AA2824B7E153F4B7E834B6C7E913801FE3F02036D7E4B6C7E +DA07F87F4A486C7E021F1303DA3FE07F4B6C7E027F6D7F4A48137F4990C77F717E49486E +7E494881010F150F4A6E7E003FB500C090B6FC486E481580B617C06F5AA34B7E6C19806C +4A6C1500423E7CBD4B>120 D E /Fb 2 122 df<90383E01F09038FF87F83903C7DE1E38 +0783DC903803F87EEA0E01001E13F0EA1C03003C14380038EBE000A2EA300700005BA313 +0F5CA3011F1318153814001238D87C3F137012FC15E0EB7F0139F0FF03C03970E7878039 +3FC3FE00381F00F81F1F7C9D21>120 D<EA03C0D80FF01338D81E78137CD81C7C13FC00 +3814F812781270EBFC01D8F0F813F012E012E138C1F003000114E0120313E01407000714 +C013C0A2140F000F14801380A2141F150000075B5C13C03803E1FE3801FFBE38007E3EEB +007E147CA2003E5BA2387E01F0A2387C03E0387007C06C485AD83C3EC7FCEA1FF8EA07E0 +1E2C7A9D23>I E /Fc 8 117 df<027FB500F0070FB6128091B67E67551500A2DA001F6D +4F01F8C7FCDB07DF1CC003031BF769F601E7DCCFFE19EF0307F203CF048FDF078F90C8FC +A2F60F0FEE87FFF61E1F150F0407073C5B707F1E78A2F6F03F031FF101E0DB1E016D61F5 +03C0A2F507801F7FDB3E006DEE0F00033C641D1E65717E5313FF157C03784F5CA2716C4B +5AA252485A15F84B6D6CDB07805CF40F00A21C1E6602016E6C5D4B6464A264716C4A485B +14034B4D485DA2716D495AA251C75A14074B051E93C9FC717F636366020F6092C86D5F50 +5AA2505ADE7FF0163F4A4D5A021E6450C8FC1A1EF03FF850157F143E023C4D5EF01FFC62 +A2DFFDE015FF027CEEFFC002786F6062A202F894C9FC496C620103705A497E90261FFF80 +4B5D90B500F0071F13FC007FDAFFC06D4891B87E61A261B76E485B89627BE184>77 +D<ED0FFF92B512E0020314F891390FF807FE91393FC001FF027EC7EA7FC0D901F86E7E49 +486E7E14C0496C6E7ED90FF881496C14076E81A2133F1703A2845C011F5D6D485DEB07E0 +90C9FCA3170FA2EF7FFC4BB5FC153F4AB6FC020FEBF01F91387FFE00902601FFF05C0107 +13C04990C7FCEB3FFC4948143FEBFFE048495D485B4890C8FC485A001F167F49EF078000 +3F17E05B127F4915FFA200FF9438C00F00495CA25EA24C141EEE0F7F6C6C141E043C5C6C +6C02785C001F9239F03FE0F86C6CD903E0EBFBF06CB4903A0FC01FFFE06C9027C07F800F +5BC69027FFFE000790C7FC013F01F8EB01FC010101C090C9FC414378C048>97 +D<923803FFC0031F13FC92B6FC02039038807F80913A0FFC000FE0DA1FF0EB03F0DA7FC0 +EB00F84A48147C4990C8123CD907FE15FE494814074948140F4A141F133F4948143F495A +5A5C4817FC4890C8121FEF0FF848EE07E04992C7FC121F5B123FA3485AA412FF5BA75BA7 +6C6C16E018F01701003F17E017036DED07C0001F1780170F6C6CED1F000007163E6D5D00 +035E6C6C4A5A6C6DEB07E06D6C495AD91FF0EB7F8090270FFC03FEC7FC0103B512F80100 +14E0DA0FFEC8FC374376C040>99 D<923803FF80033F13F04AB512FC0207EB03FF913A0F +F8007F80DA3FE0EB3FC04A48EB1FE04948C7EA0FF04948EC07F8494815FC494814034948 +15FE133F495A4948EC01FFA2485B5A91C8FC5AA2485AA2121F5B123FA348485D90B9FCA2 +18FED8FFF8CAFC5BA65BA7127F187018786D16F8003F17F01701001FEE03E06D16C0000F +1607EF0F806C6CED1F006C6C153E00015E6C6C5D6D6CEB03F06D6CEB0FE0D91FF0EB3F80 +902707FE03FFC7FC0101B512FC6D6C13E0020790C8FC384377C040>101 +D<16FC913803FFF891B5FCA514016E6C5AA2153FA3157F5EA515FF5EA55C5EA55C93CAFC +A4943803FF804A021F13F04B017F13FC933901FE03FE933907F000FFDC0FC014804CC7EA +7FC0020F013C15E04B48143F5EEDFDE0DBFFC015F05E5C93C8FC5DA25D197F4A4816E0A3 +5DA219FF147F4B16C0A46014FF4B1680A4605B4B1600A4605B92C85BA4180F5B4A5EA418 +1F130FA2011F163F90267FFF8091B5FC007FB66CB7FCA2B7000115FEA348647BE350> +104 D<153FED7FC0EDFFE05C4A13F05CA416E0A216C06E13806E1300EC007C92C7FCB215 +3FECFFFE131FA35BA2EB007FEC1FFCA2140FA3141F5DA5143F5DA5147F5DA514FF5DA55B +5DA55B92C7FCA55B5CA5130F5C497EEB7FFF007FB6FC5DB6FCA324617CE027>I<033E90 +2603FFC0913803FFC0902601FFFC011F01F8021F13F8013F037F01FE027F13FE932701FE +03FF903901FE03FF932603F00090278003F0007FDC0FC090277FC00FC06D7E494AC76C6C +48C76C7ED9007F013E163E91261FF87891261FF0786E7E4C5E91260FF9E0EDF1E0DBFBC0 +DBFBC0814C5EDA1FFF16FF93C891C8FC4B5EA24B5E073F163F4A484C5EA34B5EA3027F04 +7F167F4B4C5EA502FF04FF16FF4B4C5EA5494C5E4B4C5EA5494C5E92C891C891C7FCA549 +4C5E4A4C5EA5010F040F160FA2011F041F161F90267FFF8091267FFF8091387FFF80007F +B6D8807FB6D8807FB61280B790B790B7FCA24C4C1600A271407BBF79>109 +D<EC01E04A5AA41407A25DA2140FA2141FA24AC8FCA25CA25CA2495A13031307130F131F +133F495A48B712C0120FB8FCA326001FFCC8FC5CA5133F5CA5137F5CA513FF5CA55A5CA5 +5A91C7123CA5485D5BA416F85E5BA215015EA24B5A7F00034A5A150F6C6C91C7FC151E6C +EB807C90387FE1F890381FFFF001075B010013802A5A73D738>116 +D E /Fd 10 120 df<ED01F815FFA3150316F0A21507A216E0A2150FA216C0A2151FA216 +80A2153FA202F81300EB07FE90381F877F90383E03FF017C5BEBF80112013803F0004848 +5B120FEBC001121F5DEA3F801403127F01005BA214075A485CA2140FA248ECC1C0A2141F +15C3ED8380143F1587007C017F1300ECFF076C485B9038038F8E391F0F079E3907FE03FC +3901F000F0253B77B92A>100 D<147F903803FFC090380FC1E090383F00F0017E13785B +485A485A485A120F4913F8001F14F0383F8001EC07E0EC1F80397F81FF00EBFFF891C7FC +90C8FC5A5AA55AA21530007C14381578007E14F0003EEB01E0EC03C06CEB0F806CEB3E00 +380781F83803FFE0C690C7FC1D2677A426>I<EC07C0EC3FF09138FC38E0903901F01FF0 +EB03E0903807C00FEB0F80011F1307D93F0013E05B017E130F13FE4914C01201151F1203 +491480A2153F1207491400A25DA249137EA215FEA25D00031301140314076C6C485A0000 +131FEB787BEB3FF390380FC3F0EB00031407A25DA2140F5D121C007E131F5D00FE49C7FC +147E5C387801F8387C07E0381FFF80D803FEC8FC24367CA426>103 +D<EB03F0EA01FFA3EA00075CA3130F5CA3131F5CA3133F91C8FCA35B90387E07F0EC1FFC +EC783E9038FFE01F02C01380EC800F1400485A16C05B49EB1F8012035BA2153F00071500 +5BA25D000F147E5B15FE5D121FD98001131C15F8163C003F01031338010013F0A2167048 +14E0007E15F016E0EDE1C000FE903801E38048903800FF000038143C263B7BB92A>I<EB +01C0EB07E014F0130F14E01307EB038090C7FCAB13F0EA03FCEA071EEA0E1F121CA21238 +5B1270A25BEAF07E12E013FEC65AA212015B1203A25B12075BA2000F13E013C013C1001F +13C01381A2EB83801303EB0700A2130E6C5AEA07F8EA01E0143879B619>I<EB0FC0EA07 +FFA3EA001F1480A2133FA21400A25BA2137EA213FEA25BA21201A25BA21203A25BA21207 +A25BA2120FA25BA2121FA25BA2123FA290C7FCA25AA2EA7E0EA212FE131EEAFC1CA2133C +133812F81378EA7870EA7CE0121FEA0F80123B79B915>108 D<D801E013FE3A07F803FF +803A0E3C0F07C03A1E3E3C03E0261C1F787F39383FF00114E0007813C000708114804A48 +5AEAF07FEAE07EA20000140701FE5C5BA2150F00015D5B151F5E12034990383F83801603 +16070007027F130049137EA2160E000F147C49141E161C5E001FEC3C7849EB1FE00007C7 +EA0780292679A42F>110 D<14FE903807FF8090380F83C090383E00E04913F001781370 +01F813F00001130313F0A215E00003EB01C06DC7FC7FEBFFC06C13F814FE6C7F6D13807F +010F13C01300143F141F140F123E127E00FE1480A348EB1F0012E06C133E00705B6C5B38 +1E03E06CB45AD801FEC7FC1C267AA422>115 D<EB0380EB07C0130FA4131F1480A3133F +1400A35B137E007FB5FCA2B6FC3800FC00A312015BA312035BA312075BA3120F5BA3121F +EB801CA2143C003F1338EB0078147014F014E0EB01C0EA3E03381F0780380F0F00EA07FC +EA01F0183579B31C>I<01F01507D803FC903903801F80D8071E903907C03FC0D80E1F13 +0F121C123C0038021F131F49EC800F00701607A249133FD8F07E168000E0ED000313FEC6 +4849130718000001147E5B03FE5B0003160E495BA2171E00070101141C01E05B173C1738 +A217781770020314F05F0003010713016D486C485A000190391E7C07802800FC3C3E0FC7 +FC90393FF81FFE90390FE003F0322679A437>119 D E /Fe 1 1 +df<B712C0A322037A8D30>0 D E /Ff 2 60 df<127812FCA4127806067A8513>58 +D<127812FCA212FEA2127E1206A3120CA2121C121812301260124007107A8513>I +E /Fg 6 54 df<130C1338137013E0EA01C0EA038013005A120EA25AA25AA312781270A3 +12F0AB1270A312781238A37EA27EA27E7E1380EA01C0EA00E013701338130C0E317AA418 +>40 D<12C012707E7E7E7E7E1380EA01C0A2EA00E0A21370A313781338A3133CAB1338A3 +13781370A313E0A2EA01C0A2EA038013005A120E5A5A5A12C00E317CA418>I<13FF0003 +13C0380781E0380F00F0001E137848133CA248131EA400F8131FAD0078131EA2007C133E +003C133CA26C13786C13F0380781E03803FFC0C6130018227DA01E>48 +D<13E01201120712FF12F91201B3A7487EB512C0A212217AA01E>I<EA01FC3807FF8038 +1C0FC0383003E0386001F0EB00F812F86C13FCA2147C1278003013FCC7FC14F8A2EB01F0 +EB03E014C0EB0780EB0F00131E13385B5B3801C00CEA0380380600185A5A383FFFF85AB5 +12F0A216217CA01E>I<00101330381E01F0381FFFE014C01480EBFE00EA1BF00018C7FC +A513FE381BFF80381F03C0381C01E0381800F014F8C71278A2147CA21230127812F8A214 +784813F8006013F0387001E01238381E07803807FF00EA01F816227CA01E>53 +D E /Fh 1 115 df<EB7F803801FFE0000713F8487F487F487FA2481480A2B612C0A86C +1480A26C1400A26C5B6C5B6C5B000113E038007F801A1A8D8C19>114 +D E /Fi 1 121 df<DB0FFCEDFFC092267FFF80010313F84AB500E0010F13FE02076E49 +EBFF8091270FF81FFCD97F8013C091273FC007FE9039FE001FE0913B7F0001FF01F802FE +4B48EB7FF0D901F86DD983E013FF49489226C7C00113F84948DA7FCF5B4A9238FF800749 +481600011F6049C85B013E1AF0017E5E017C1AE001FC7213C0494C158000017313004903 +FFEC00FC00034D91C7FC5BA25E00075F6C5AC9FC5E60A35E60A35E95CAFCA35E5FA3163F +5FA3167F1B3E5FA204FF167E1B7C5FD803F819FCD80FFC495F486C1801486C61484C1403 +4B5FB518074B5F505A4B161F49DABFF04AC7FCDB1F3F157E49D93F1F5D49017E6D495A49 +D9FC0F4A5A297FC001F807FCEB0FE06C4848486C6CEB3FC03E1FF01FE001FF81FF806CB5 +486CD9FFFEC8FC6C4A013F5B000149C7000F13E026001FF0020190C9FC554E7BCB62> +120 D E /Fj 5 121 df[<EE03C0EE0FE0161F163F167FED01FF5D150F153F4AB5FC1407 +147F010FB6FCB8FCA215DFECFE1F14F81480EBF000C8FCB3B3B3B3B3B04B7FA24B7F92B5 +7E021FECFFE0003FBA12F8A64AC71201>69 138 110 265 103 49 +D[<000FC212C0A64821E003F8C7000192C87E92C96C01FC150302F8F4007F02E0704916 +0F02808949CA1901498A491F7F491F3F491F1FA24848F70FF0A2491F07A390CB1A03A400 +3E2001A2007E21F8A4007C2000A848217CA6CC1B00B3B3B3B3A94F7FA296B57E06036E7E +95B712FE030FBC12E0A606F8C8123F>134 140 121 267 149 84 +D<93380FFF8093B512FC0307ECFF80033F15E092B712F80203D9FC0313FE4A9039E0003F +FF021F0180010F7F4A48C7000313E04A486E7F4A486E7F49496F7E4949153F49496F7E49 +49824990C97E49198049487013C05C01FF7113E0485B85481AF05C481AF84A825AA2481A +FC4A177FA25AA21BFE5AA25CA3B5FC91BAFCA41BFC0280CCFCA97EA280A37EA36C7FA36C +1A1C6E183E7EA26C6D187E1B7C6C1AFC6E18F86C6D1701017F19F06E17036D6DEE07E07F +6D6DEE0FC06D6D161F6D6DEE3F806D6DEE7F006D6DED01FE6EB44B5A6E6DEC0FF86E01E0 +EC3FF0020701FCECFFE06E9026FFC00F5B020091B6C7FC033F15FC030F15F0030115C0DB +003F49C8FC040313E04F5E7ADB5C>101 D<151FA85DA65DA45DA35CA25CA25CA25CA25C +5C5CA291B5FC13035B5B133F90B912F01207BAFCA5C76C90C9FCB3B3A9191FB1193F826E +163EA2197EA26E6D147C19FC826EED01F86E7FF003F06E6D13076E6DEB0FE06E01FFEB1F +C06FEBC07F6F90B51280030F15006F14FC03015CDB003F13E00403138040817CFE50> +116 D<D87FF890260FFFE0902603FFE0EBFFE090B793B6FCA6D8001F92C86CECF8000101 +02FC6F91C7FC6D4A6F13F8023F496F13E06E198099C8FC6E18FC6E6D5E6E6D5E6E60704B +5A6E6D5E6F6D4AC9FC6F167E7114FE6F6D5C6F6D495A6F4B5A7113076F6D495A6F6D5C6F +4B5A7149CAFC706D5A70EBC0FE705CF0E1F870EBF3F07013FF705C61705C7091CBFC717F +A2717F717F717FA2717F4D7F4D7F5F4D7FDD7E7F7F4D6C7FEE01F804036D7F4C486C7F4D +6C7FEE0FC04C486C7F043F6D7F4CC77F167E4C6E7F4B486E7F03036F7F4B5A4C6E7F4B48 +6E7F4B486E7F153F4BC86C7F037E6F7F03FE707F1401DA07FC707F020F717F021F85DA7F +FE84D901FF8501074E7F013F6D4C6D7E0003B600C04AB612F0B700F0020FEDFFFCA6D9C0 +019538E0003F66597DD86D>120 D E /Fk 2 55 df<12C012F012FCB4FC13C013F813FE +EBFFC014F814FF15E015FEA215E0150014F814C049C7FC13F813C090C8FC12FC12F012C0 +1F184E8B53>45 D<1318A4133CA3137EA313FFA3481380A34813C0A24813E0A34813F0A2 +4813F8A24813FCA24813FEA2B6FCA2181F8CD053>54 D E /Fl 1 +49 df<137813FE1201A3120313FCA3EA07F8A313F0A2EA0FE0A313C0121F1380A3EA3F00 +A3123E127E127CA35AA35A0F227EA413>48 D E /Fm 3 122 df<000FB8FCA23B1FC003 +F8003F0100151F001C4A130E123C003801071406123000704A130EA20060010F140C12E0 +485CA2141FC715005DA2143FA292C8FCA25CA2147EA214FEA25CA21301A25CA21303A25C +A21307A25C130F131F001FB512F0A2302D7FAC29>84 D<013F137C9038FFC1FF3A01C1E3 +83803A0380F703C0390700F60F000E13FE4813FC12180038EC0700003049C7FCA2EA2001 +00005BA313035CA301075B5D14C000385CD87C0F130600FC140E011F130C011B131C39F0 +3BE038D8707113F0393FE0FFC0260F803FC7FC221F7E9D28>120 +D<EA01E0D807F8130ED80E3C131FD81C3E133F0038143E12301270D8607E137ED8E07C13 +7C12C013FC484813FC000014F812015B1401000314F013E0A21403000714E013C0A21407 +15C00003130FEBE01F143F3901F07F8038007FEFEB1F8FEB001F1500A2003E133EA2007E +5B5C387C01F0387003E0383007C0383C0F80D80FFEC7FCEA03F0202C7E9D23>I +E /Fn 4 121 df<121C127FEAFF80A5EA7F00121C0909798817>58 +D<150C151E153EA2153C157CA2157815F8A215F01401A215E01403A215C01407A2158014 +0FA215005CA2141E143EA2143C147CA2147814F8A25C1301A25C1303A2495AA25C130FA2 +91C7FC5BA2131E133EA2133C137CA2137813F8A25B1201A25B1203A25B1207A25B120FA2 +90C8FC5AA2121E123EA2123C127CA2127812F8A25A12601F537BBD2A>61 +D<16F8ED03FEED0F8792381F0F80ED3E3F167F157CA215FC1700161C4A48C7FCA414035D +A414075DA20107B512F0A39026000FE0C7FC5DA4141F5DA4143F92C8FCA45C147EA514FE +5CA413015CA4495AA45C1307A25C121E123F387F8F80A200FF90C9FC131E12FEEA7C3CEA +7878EA1FF0EA07C0294C7CBA29>102 D<903907E001F090391FF807FC9039783E0E0F90 +39E01F1C1FD801C09038383F803A03800FF07F0100EBE0FF5A000E4A1300000C157E021F +133C001C4AC7FC1218A2C7123FA292C8FCA25CA2147EA214FEA24A130CA20101141C001E +1518003F5BD87F81143801835C00FF1560010714E03AFE0E7C01C0D87C1C495A2778383E +0FC7FC391FF00FFC3907C003F029267EA42F>120 D E /Fo 15 120 +df<003FB712FC4816FEB9FCA56C16FE6C16FC300979A83F>45 D<ECFFFE010FEBFFE001 +7F14FC48B71280000716C04816E04816F04816F8DA800713FCD87FFCC7EA3FFE01F0140F +4848EC07FF49806D80A46C485C5E6C48EC1FFEC9123FEEFFFC030313F84B13F0031F13E0 +4B13C04B13004B5A4A13F84A13E05E4A5B4A90C7FC5D4A5A4A5AA25D147FA25DA9143F5D +91C9FCAB140FEC3FC04A7E4A7EA66E5A6E5A020FC8FC304A79C93F>63 +D<903807FFF0017F13FE48B612C04815F048814815FE8248829038FC001F03077F03017F +816C486E7E163F6C486E7EC9FC160FA492B5FC141F49B6FC130F133F90B7FC120348ECF0 +0F48EBFC004813C04890C7FC13FCEA7FF0485A5B5BA46D141FA2163F6C6C147F01F8EB01 +FF6C6C01077F9026FF803FEBFFFE6C90B7FC6C17FF7E6C15F36C15C36C6C020013FE011F +01F8131F0103018090C7FC38367AB43F>97 D<387FFFC0A2B57EA47EA2EA003FADED07FE +92383FFFC092B512F002E314FC02EF8091B7FC8484DBF80F7FDBE0017FED800092C7EA3F +F84A6E7E4A140F4A814A140717034A81A2831980A283A85FA36E16005FA26E4A5AA26E4A +5A171F6E4A5A6E147F6F495ADBE0035BEDF80F92B65A6095C7FC02EF14FC02E35CD91FC1 +14E090260FC07F138090C7D80FF8C8FC394A7FC83F>I<913807FFF0023F13FF49B612C0 +010715E04915F0013F15F85B90B712FC489038FE001F4813F014C0485B4848C7EA0FF85B +4848EC07F093C7FC485AA2485AA25BA212FF5BA87FA2127F7FA36C6C15FE7F6C6CEC01FF +7F6C6C5C6C6D5B02E0EB0FFE6C01F8131F6C01FFEBFFFC6C91B512F86D15F06D15E0010F +15C06D15800101ECFE00D9003F13F002071380303678B43F>I<923807FFFCA24B7FA481 +A2ED0003ADEC1FF891B5FC010314C3010F14F34914FB017F14FF90B7FC5A48EBF807ECE0 +0148903880007F4890C7123F49141F4848140F5B48481407A248481403A25B12FFA35BA8 +7FA2007F15077FA2003F150F7F6D141F001F153F6D147F6C6C14FF6C6C6C5A6E5A6CD9F8 +1F90B5FC6C90B8FC6C18806D14FB6D14F36D14E30107028114000101EBFE019026001FF0 +C9FC394A7CC83F>I<EC07FE91387FFFE049B512F8010714FE011F804981498190B77E48 +D9FC037F48D9E0007F4849133F91C76C7E4848140F48486E7E5B48486E7EA24980127F49 +1680A200FF8190B8FCA61800A20180CAFC7FA2127F7FA26C7E177F6C7E6DEDFF806C7E6D +5C6C01C05B6C6D4913006C01F8EB1FFE9138FF807F6C91B55A6D5D011F5D6D5D01035D01 +0092C7FC021F13F80203138031367AB43F>I<EEFFC0030713F8033F13FE92B6FC5C4A15 +805C5C4A130315FC4A486C130015F04A486C5A94C7FC5DA9003FB712F85AB87EA46C5EA2 +C7D87FC0C8FCB3B1003FB77E4882B87EA46C5E6C5E314A7CC93F>I<387FFFC0A2B57EA4 +7EA2EA003FADED03FE92383FFFC092B512F002E38002E78002EF8091B7FCA2DBFC077FED +E0014B7E92C77F5C4A147F5CA25CA35CB3A7007FB5D8F01FB512E05EB66C4814F0A46C4A +6C14E0823C497FC83F>104 D<ED03FE3B7FFFC03FFFC092B512F0B500E38002E78002EF +8091B7FC7EDBFC077FD8003FEBE0014B7E92C77F5C4A147F5CA25CA35CB3A7007FB5D8F0 +1FB512E05EB66C4814F0A46C4A6C14E0823C347FB33F>110 D<EC0FFC91387FFF8049B5 +12E0010714F8011F14FE4980498190B77E48D9F8077F48D9E0017F48903980007FF891C7 +123F48486E7E48486E7E49140748486E7EA24980007F17804980A34848ED7FC0A96D15FF +A2007F1780A26D5CA26C6C4A1300A26C6C4A5A6D140F6C6C4A5A6D143F6C6D495A6C9039 +E001FFF06CD9F8075B6C90B65A6D5D6D92C7FC6D5C010714F86D5CD9007F1380DA0FFCC8 +FC32367AB43F>I<ED07FE3B7FFFC03FFFC092B512F0B500E314FC02EF8091B7FC846C83 +DBF80F7FD8003FD9E0017FED800092C7EA3FF84A6E7E4A140F4A814A140717034A81A283 +1980A283A85FA36E16005FA26E4A5AA26E4A5A171F6E4A5A6E147F6F495ADBE0035BEDF8 +0F92B65A6095C7FC02EF14FC02E35C02E114E0DAE07F1380DB0FF8C8FC92CAFCB2007FB5 +12F0A2B67EA46C5CA2394F7FB33F>I<903A01FFF80F80011FEBFF1F90B712C012035A5A +5A5AEC001FD87FF01303497FD8FF807F167F90C8FCA36DEC3F807F6C6C91C7FC13F86CB4 +7E14FE6CEBFFF86C14FF6C15E0000115F86C6C14FE010F8001001580020314C0DA000F13 +E015019238007FF0003F151F48ED0FF8487E16077FA36D140F7F6DEC1FF06D143F01FF14 +FFDAC00713E091B612C01780A2EEFE006D5C011F14F0D87E071480277C007FFCC7FC2D36 +77B43F>115 D<267FFFC090B57EA2B56C4880A46C80A2D8003FEC007FB3AA17FFA25EA2 +6E5B160F6E5BD91FFE90B612E091B8FC6D17F07FA26D810100DAFC3F13E0023F13E00207 +90C9FC3C347FB23F>117 D<267FFFFC010FB512806E5BB64914C0A46C496D14804A7FD8 +03F8C83807F000A26D150F00015FA56D151F00005FA3ED3F80ED7FC0017F496C485AA24A +13F0A35CD93F8301F890C7FC03FB5BA2148716FC15F1011F157E14CF16FE03E113FE15E0 +A2D90FDF5C15C002FF137FA36D496C5AA3ED001F6D5DD901FCEB07E03A337EB23F>119 +D E /Fp 20 117 df<B5FCAF7E1010768F25>46 D<913803FF80023F13F849B6FC010715 +C049814981017F15FC90B77EA24802837F4849C614804A7F48496D13C04A7F48496D13E0 +A24817F04A7FA24817F8A44817FC4A7FA6B516FEB3AC6C17FCA46E5BA36C17F8A36C17F0 +6E5BA26C17E06E5BA26C6D4913C06E5B6C6D90B512806CD9FF83140092B6FC6C5E6D5D6D +5D010F15E06D5D010192C7FCD9003F13F80203138037597BD542>48 +D<157E4AB4FC4A7F5C5C143F91B5FC130F001FB6FC127FA2B7FCA47EEA3FF8C7FCB3B3B3 +A6000FB712F04816FC5A17FEA317FC7E6C16F02F5677D542>I<EC1FFF49B512F0010714 +FC011F14FF4915C090B77E48824882488248828348178048D9F01F14C0ECC00348D90001 +14E0497F48486E13F0824916F8007F816C5A001F816C4816FCA212076C5A000181120090 +C8FCA25EA318F8A25E18F0A25E18E04C13C0A293B512804B14005F5D4B5B4B5B4B5B5F4B +5B4B90C7FC4B5A4A5B4A5B4A5B4A5B4A13804A90C8FC4A5A4A5A495B5D495B495B495B49 +90C9FC495A495A495A4813E0485B485B4890B712F04817F84817FC5AA77E18F8000F17F0 +36567BD542>I<91380FFFC091B512FC010314FF010F15C0013F15F0498148B77E488248 +825A48178048EBFC07DAE00114C0EC80006C48C77E6C5A6C4816E049806C5A6C5A6C5A90 +C8FCA35EA218C0A393B51280A24B1400A24B5B4B5B031F5B92B5FC027F5C17C05F94C7FC +A217C017F88317FFDA00071480030014C07013E0827013F018F88218FCA282A218FEAB12 +2000784B13FC127C127E007F5DD8FFC016F801F05C01FC16F0D9FF8090B5FCDAF80714E0 +91B7FC003F17C06C17806C17006C5E00015E6C5E013F15E0010F1580010102FCC7FCD900 +0F13C037597BD542>I<923807FFF8031F7F835DA25DA292B5FCA25CA25C167F5C5C15FE +141FA2EC3FFCA2EC7FF8A2ECFFF0A25B15E05B15C05B491380A2491300A2495AA2495AA2 +495AA2485BA2485B5C5A5C5A4890C7FCA2485AA2485AA2485A90B812FE841980A86C1800 +6C5FC949C7FCB0705A705A39537CD242>I<90B8FC4817804817C0A81880180002FCC9FC +B1ED7FF091B6FC17E08317FC8383188018C003C014E09138FE003F4A6D13F05C4A6D13F8 +5C5C18FC6C497F6C90C7FC90C8FC18FEAE12034817FC486C5C121F7F487E6D4A13F8487E +486C4A13F001FF5C02C090B512E06CEBF8076C90B712C06C17806C17006C5E6C5E6C5E6C +6C5D6D15C0010F92C7FC010114F8D9001F90C8FC37567CD242>I<ED0FFF4AB512F0020F +14FC143F91B6FC5B5B130F5B5B5BEDFE0190B538F0001C4802C090C7FC4891C9FC5C485B +5C5A5C5A5CA25AA25CA25AED1FFC92387FFF8002C1B512E04A14F8028780B5008F80029F +80188002BF15C0038014E09138FE003F4A6D13F04A7F18F84A7FA24A15FCA24A7FA218FE +A35CA87EA480A27EA318FC6C6D5BA36C6D15F85E6C7F6E4913F06C6D4913E0DAFF81B5FC +6C91B612C018807E6D16006D5D6D5D010715F06D5D01001580023F49C7FC020313E03759 +7BD542>I<003FB812F84817FCB912FEA818FC6C17F86C17F0C912074C13E04C13C04C13 +80A24C13004C5A5D4B5B5F5D4B5B5F5D4B5BA24B5B92B5FC94C7FC5C5E5C5E5C5E5CA24A +5BA24A5BA34A5BA391B55AA35B93C8FCA25BA25DA25BA4495BA7495BAD6D5B6D5B37547B +D242>I<913807FFC091B512FE01036E7E010F15E0013F15F8498190B77E488248178048 +17C0A24849C614E002F8133F4A7F48496D13F0A34A7F4817F8AA6C17F0A36E5B6C17E06E +5B6C17C06C01FC017F13806CD9FF83B512006C91B55A6D5D011F15F0010715C06D5D011F +15F0017F15FC90B77E4882000749C614C002F8133F48496D13E048496D13F04A7F4817F8 +A248496D13FCA4B516FEAC6C17FC6E5BA36C17F86E5B6E5B6C6D4913F002FE90B5FC6C90 +B712E06C17C0A26C17806C17006C5E013F15F86D5D010715C001004AC7FC020713C03759 +7BD542>I<91380FFFC091B512F8010314FE010F6E7E4915E04981498190B77E48824882 +5A48020114809126FC007F13C04801F07F7013E0485B82484915F0A28218F85CB5FCA218 +FCA282A418FEA85EA37EA26E5BA26C5DA26E5B7E6E5B6C6D90B5FC9138FE03FB6C90B5FC +6C15F37E6C15E36D02C313FC6D1483010F14030103EBFC079038007FF091C7FC18F8A35E +18F0A25E18E0A25E4C13C013E06D91B51280486C0103140001FE130F2703FFC03F5B4890 +B65A5F485E5F5F00035E6C4BC7FC6C5D013F14F0010F1480010001F8C8FC37597BD542> +I<93B5FC031F14F892B7FC020716E0021F16F8027F16FE49B97E49844984498449DAE007 +804991C7804901F8021F7F90B5486E7F4802C0020314804B804891C914C04A82481AE04A +82481AF04A82481AF84A82A2481AFC4A82A3481AFEA34A82A3B519FFB3A26C6D4C13FEA6 +6C6D4C13FCA46C6D4C13F8A26C6D4C13F0A26E5E6C1AE06E93B5FC6C6E4A14C06C6E4A14 +806F5C6C6E4A14006D01FC023F5B6D01FF91B55AEEE0076D91B75A010718E06D606D606D +6C4CC7FC021F16F8020716E002011680DA001F02F8C8FC030091C9FC505979D55F>79 +D<91381FFFE00103B512FE011F6E7E90B712E0000316F84882488283ECFE07DAE0011480 +91C7FC01FC6E13C06C5A13E0496E13E05B90C8FC1202C9FCA50307B5FC020FB6FC49B7FC +130F133F90B6123F000314E04814004813F8485B485B5C485BA2B5FC91C7FCA45E8093B5 +FC6C5C6E5A6E5A6CEBF83F91B7FC6C15BF6C153F6C14FE6C14FC6C14F06C4A6C13C0013F +D9800F1380D90FFCC9FC333A7CB83F>97 D<EF7FFCEFFFFE4C13FFB3A7EC3FF80103B5FC +010F14C1013F14F14914F990B9FC5A5A5A48ECC07F9138FE000F4801F813034A7F5A5CA2 +485BA4B55AB17E80A37E805E6C6D5B6E5B6C6D133FDAFF80B6FC6C91B7FC7E6C15FD6C15 +F96D14F16D14E1010F028013FE01039039FE007FFC9026003FF090C7FC38547CD243> +100 D<EA1FFF007F138014C0B5FCAC6C13806C1300C8FCACEA0FFF003F138014C05AB3B3 +AD7E1480000F130012547BD31E>105 D<D81FFC903803FF80D87FFE011F13F86D017F7F +B590B57E0203804A15804A15C05C18E0EC3FC091387F003F027C15F05C4A7FA25C5CA35C +B3B07E91C76C13E0D81FFE6E13C0343879B743>110 D<913803FFE0027F13FF49B612C0 +010F15F84981017F15FF90B87E48834883480280809138FC001F48496D7F4A7F48496D7F +A248496D7FA348834A7FA4B51780AE6C18006E5BA36C5F6E5BA26C6D495B6E5B6C6D495B +DAFF80B5FC6C91B65A6C5F6C5F6C5F6D93C7FC6D5D010F15F8010315E0D9007F91C8FC02 +0713F0393A7CB842>I<923803FF80D81FFE013F13F0D87FFF90B512FC028380B5008F80 +029F158091B712C018E018F0A2030114F89138F8007F02E0011F13FC1480827013FEA382 +18FFA282AF4C13FEA45E18FC5EA26E4913F86E5B02F890B512F0DAFE0314E091B7FC18C0 +188002BF1500029F5C028F14F8028714E0028114809126803FF8C7FC92C9FCB37E91CAFC +EA1FFE384F7AB743>I<903803FFF0013FEBFF8090B612F0000315FC4815FF5A5A5AA248 +48C66C5A01F81307150148481300163E161E160C6D91C7FCA213FE6D7E14FCECFFE06C14 +FC15FF6C15C0826C816C816C816C816C817E013F1580130F1301D9000714C0EC007F151F +001014071238003C80127EA2EA7F806D5B01F0158001FC5BB5EA803F91B61200A25EA200 +3F5D6C5D00075DC615C0013F91C7FC010113F02A3A7CB832>115 +D<EB1FFCEB7FFE8090B5FCAC001FECFFFC007F8182B8FCA46C5D6C5DC691C8FCB3AFED80 +075E9238C03F806D14FF92B5FC17C0A27F17806D15006D14FC6D14E06D91C7FC010013E0 +2A477EC530>I E /Fq 17 122 df<010FB712E0013F16F05B48B812E04817C02807E006 +0030C7FCEB800EEA0F00001E010C13705A0038011C13605A0060011813E000E013381240 +C7FC5C4B5AA214F014E01301150314C01303A3EB078082130FA2EB1F00A34980133E137E +A24980A2000114015BA26C48EB00E0342C7EAA37>25 D<EC07FE91387FFFC049B512F001 +0714F890391FF003FE49C7127E0178143E01E0140848481400485A90C9FC5A1206A41207 +7EEB803E3901E7FFC039007FC1E014FFD801E75BD80380C8FC48C9FC120E5A5A5A1260A2 +12E05AA4ED01806C14036C150000705C0078140E003E143C391FC003F86CB512E000035C +C649C7FCEB1FF0272F7EAC2E>34 D<121EEA7F80A2EAFFC0A4EA7F80A2EA1E000A0A7889 +1B>58 D<121EEA7F8012FF13C0A213E0A3127FEA1E601200A413E013C0A3120113801203 +13005A1206120E5A5A5A12600B1D78891B>I<1618163C167CA2167816F8A216F01501A2 +16E01503A216C01507A21680150FA2ED1F00A2151E153EA2153C157CA2157815F8A25D14 +01A24A5AA25D1407A25D140FA292C7FC5CA2141E143EA2143C147CA25CA25C1301A25C13 +03A25C1307A25C130FA291C8FC5BA2133EA2133C137CA2137813F8A25B1201A25B1203A2 +485AA25B120FA290C9FC5AA2121E123EA2123C127CA2127812F8A25A126026647BCA31> +61 D<48BA12C05AA291C7D980001380D807F092C7121F4949150F0180170748C75B1903 +120E48020316005E12181238003014074C5C00701806126000E0140F485DA3C8001F92C7 +FC5EA3153F5EA3157F5EA315FF93CAFCA35C5DA314035DA314075DA3140F5DA3141F5DA3 +143F5DA2147FA214FF01037F001FB612FCA25E42447EC339>84 D<EE01FC16FFA3EE03F8 +16011603A217F0A21607A217E0A2160FA217C0A2161FA21780A2163FA21700EC0FC09138 +7FF07F903801F838903907E01C7E90380FC00E90393F0007FE49130301FE5C485A491301 +120348485C120F491303121F5E485A1507127F495CA2150F12FF90C75BA2151FA2485DA2 +033F13301770EE0060A24B13E017C015FE007E130102031301003ED9073E1380003F010E +13036C011C14006C6C486C5A3A07C0F00F0E3A01FFC007FC3A007F0001F02E467CC433> +100 D<EC07F8EC3FFE903901FC0780903903F003C090390FC001E090381F8000017FC7FC +01FE1470485A484814F0000715E05B000F1401484814C015034848EB0780ED1F0015FC00 +7FEB1FF090B5128002F0C7FC0180C8FC12FF90C9FCA55AA41618007E15381670007F15E0 +6CEC01C0ED03806CEC07006C6C131E6D13383907E001F03901F00FC026007FFEC7FCEB1F +F0252D7CAB2D>I<EE07E0EE1FF8EE7C1CEEF80E923801F03E923803E07F17FFED07E116 +C117FE92380FC0FC177817004B5AA4153F93C7FCA45D157EA491B61280A3DA00FCC7FCA3 +14015DA414035DA414075DA4140F5DA5141F5DA4143F92C8FCA45C147EA45CA45C1301A2 +5CA2EA1C03007F5B12FF5C13075C4848C9FC12F8EA601EEA783CEA1FF0EA07C0305A7BC5 +30>I<141E143F5C5CA3147E143891C7FCAE133EEBFF803801C3C0380781E0380601F012 +0E121CEA180312381230A2EA700700605BA2EAE00F00C05BEA001F5CA2133F91C7FCA25B +137E13FE5BA212015BEC03800003140013F01207495A1406140E140CEBC01C141814385C +00035BEBE1C0C6B45A013EC7FC19437DC121>105 D<01F8D903FCEC7F80D803FED91FFF +903803FFE0D8071F903B7C0FC00F81F83E0E0F80E007E01C00FC001C9026C3C003017813 +7C271807C700D9F0E0137E02CE902601F1C0133E003801DCDAFB80133F003001D892C7FC +D90FF814FF0070495C0060495CA200E04949485CD8C01F187E4A5C1200040715FE013F60 +91C75BA2040F14014960017E5D1903041F5D13FE494B130762043F160E0001060F130C49 +92C713C0191F4CED801C00031A1849027E1638F2003004FE167000071A60494A16E0F201 +C0030192380F0380000FF18700494AEC03FED80380D90070EC00F84F2D7DAB55>109 +D<01F8EB03FCD803FEEB1FFFD8071F90387C0FC03B0E0F80E007E03A0C07C3C003001CD9 +C7007F001801CE1301003801DC80003013D8EB0FF800705B00605BA200E0491303D8C01F +5D5C12001607013F5D91C7FCA2160F495D137E161F5F13FE49143F94C7FC187000014B13 +6049147E16FE4C13E0000317C049150104F81380170300071700495D170EEE781C000FED +7C3849EC1FF0D80380EC07C0342D7DAB3A>I<D903E0EB3F80D90FF8EBFFE0903A1C7C03 +C0F8903A383E07007C9026703F1E137E9026601F387F5D01E00160EB1F8001C013E04A5A +00014A14C0018090C7FCA200035B1300147EC7FC02FE143FA25CA20101157F18805CA201 +0315FF18005C5F010714015F4A13035F010F14075F4C5A5F496C495A4CC7FC02B8137E02 +985B90393F9C01F891388F07E0913803FF80DA00FCC8FC4990C9FCA2137EA213FEA25BA2 +1201A25BA21203A21207B512F0A25C323F83AB31>112 D<EC0FF0EC7FFE903901F00F80 +9039078001C049C712E0011E14605BED01F0491307A201F8EB0FE05B7FED03806D90C7FC +7F7F14F86DB47E15E06D13F86D7F01077F1300EC07FF140081ED3F80151F120E003FEC0F +00487EA25D48C7121EA200FC5C12605D00705C6C495A6CEB07C0260F803FC7FC3803FFFC +38007FE0242D7BAB2E>115 D<141C147EA314FE5CA313015CA313035CA313075CA2007F +B512FCB6FC15F839000FC000A2131F5CA3133F91C7FCA35B137EA313FE5BA312015BA312 +035BA21570000714605B15E015C0000F130101C013801403EC070000071306140E5C6C6C +5A000113F03800FFC0013FC7FC1E3F7EBD23>I<02FCEB07E0903A03FF801FFC903A0F07 +C0781E903A1C03E0E01F903A3801F1C07FD9700013804901FB13FF4848EBFF00495B0003 +16FE90C71438484A130012061401000E5C120CC7FC14035DA314075DA3140F5DA3021F14 +3817305D1770023F1460121E003F16E0267F807FEB01C0026F148000FF01EF1303D901CF +EB070000FE903887C00E267C03835B3A3C0F01E0783A1FFC00FFE0D803F0EB3F80302D7E +AB37>120 D<133ED9FF8014E02603C3C0EB03F0380703E0380601F0000E1507001C16E0 +EA180312380030150F007016C0EA60075C161FD8E00F158000C05BEA001F4A133F170013 +3F91C7FC5E49147E137EA216FE01FE5C5BA215015E485AA215035EA200001407150F6D5C +017C131F153F6D13FF90391F03CFC0903807FF8F903801FC0F90C7121F5EA2153F93C7FC +D807C05BD81FE0137E5DA24848485A4A5A01805B39380007C00018495A001C49C8FC6C13 +7C380781F83803FFE0C66CC9FC2C407DAB30>I E /Fr 20 122 df<EA07C0EA1FF0EA3F +F8EA7FFCEAFFFEA7EA7FFCEA3FF8EA1FF0EA07C00F0F788E1F>46 +D<EC03C01407141F147FEB03FF133FB6FCA413C3EA0003B3B3ADB712FCA5264177C038> +49 D<ECFFE0010F13FE013F6D7E90B612E0000315F82607FC0313FE3A0FE0007FFFD81F +806D138048C7000F13C0488001C015E001F07F00FF6E13F07F17F881A46C5A6C5A6C5AC9 +FC17F05DA217E05D17C04B13804B1300A2ED1FFC4B5A5E4B5A4B5A4A90C7FC4A5A4A5AEC +0FF04A5AEC3F804AC7127814FE495A494814F8D907E014F0495A495A49C8FC017C140149 +140348B7FC4816E05A5A5A5A5AB8FC17C0A42D417BC038>I<ECFFF0010713FF011F14C0 +017F14F049C66C7ED803F8EB3FFED807E06D7E81D80FF86D138013FE001F16C07FA66C5A +6C4815806C485BC814005D5E4B5A4B5A4B5A4A5B020F1380902607FFFEC7FC15F815FF16 +C090C713F0ED3FFCED0FFEEEFF80816F13C017E0A26F13F0A217F8A3EA0FC0EA3FF0487E +A2487EA217F0A25D17E06C5A494913C05BD83F80491380D81FF0491300D80FFEEBFFFE6C +B612F800015D6C6C14C0011F49C7FC010113E02D427BC038>I<EA07C0EA1FF0EA3FF8EA +7FFCEAFFFEA7EA7FFCEA3FF8EA1FF0EA07C0C7FCAEEA07C0EA1FF0EA3FF8EA7FFCEAFFFE +A7EA7FFCEA3FF8EA1FF0EA07C00F2C78AB1F>58 D<003FBA12E0A59026FE000FEB8003D8 +7FE09338003FF049171F90C71607A2007E1803007C1801A300781800A400F819F8481978 +A5C81700B3B3A20107B8FCA545437CC24E>84 D<903801FFE0011F13FE017F6D7E48B612 +E03A03FE007FF84848EB1FFC6D6D7E486C6D7EA26F7FA36F7F6C5A6C5AEA00F090C7FCA4 +0203B5FC91B6FC1307013F13F19038FFFC01000313E0000F1380381FFE00485A5B127F5B +12FF5BA35DA26D5B6C6C5B4B13F0D83FFE013EEBFFC03A1FFF80FC7F0007EBFFF86CECE0 +1FC66CEB8007D90FFCC9FC322F7DAD36>97 D<EE03FEED07FFA5ED001F160FB1EC3FE090 +3803FFFC010FEBFF8F013F14CF9039FFF807FF48EBC00148903880007F4890C7123F4848 +141F49140F121F485AA3127F5BA212FFAC127FA37F123FA26C6C141FA26C6C143F000715 +7F6C6C91B5FC6CD9C00314FC6C9038F01FEF6DB5128F011FEBFE0F010713F89026007FC0 +EBF80036467CC43E>100 D<EC3FF80103B57E010F14E0013F8090397FF83FF89039FFC0 +07FC48496C7E48496C7E48486D1380485A001FED7FC05B003FED3FE0A2127F5B17F0161F +12FFA290B7FCA401F0C9FCA5127FA27FA2123F17F06C7E16016C6C15E06C6C14036C6DEB +07C06C6DEB0F806C01F0EB3F0090397FFE01FE011FB55A010714F0010114C09026001FFE +C7FC2C2F7DAD33>I<137C48B4FC4813804813C0A24813E0A56C13C0A26C13806C1300EA +007C90C7FCAAEB7FC0EA7FFFA512037EB3AFB6FCA518467CC520>105 +D<EB7FC0B5FCA512037EB3B3B3A3B61280A519457CC420>108 D<90277F8007FEEC0FFC +B590263FFFC090387FFF8092B5D8F001B512E002816E4880913D87F01FFC0FE03FF8913D +8FC00FFE1F801FFC0003D99F009026FF3E007F6C019E6D013C130F02BC5D02F86D496D7E +A24A5D4A5DA34A5DB3A7B60081B60003B512FEA5572D7CAC5E>I<90397F8007FEB59038 +3FFF8092B512E0028114F8913987F03FFC91388F801F000390399F000FFE6C139E14BC02 +F86D7E5CA25CA35CB3A7B60083B512FEA5372D7CAC3E>I<EC1FFC49B512C0010714F001 +1F14FC90397FF80FFF9026FFC0017F48496C7F4848C7EA3FE000078248486E7E49140F00 +1F82A2003F82491407007F82A400FF1780AA007F1700A46C6C4A5AA2001F5E6D141F000F +5E6C6C4A5AA26C6C6CEBFFE06C6D485B27007FF80F90C7FC6DB55A010F14F8010114C090 +26001FFCC8FC312F7DAD38>I<90397FC00FF8B590B57E02C314E002CF14F89139DFC03F +FC9139FF001FFE000301FCEB07FF6C496D13804A15C04A6D13E05C7013F0A2EF7FF8A4EF +3FFCACEF7FF8A318F017FFA24C13E06E15C06E5B6E4913806E4913006E495A9139DFC07F +FC02CFB512F002C314C002C091C7FCED1FF092C9FCADB67EA536407DAC3E>I<90387F80 +7FB53881FFE0028313F0028F13F8ED8FFC91389F1FFE000313BE6C13BC14F8A214F0ED0F +FC9138E007F8ED01E092C7FCA35CB3A5B612E0A5272D7DAC2E>114 +D<90391FFC038090B51287000314FF120F381FF003383FC00049133F48C7121F127E00FE +140FA215077EA27F01E090C7FC13FE387FFFF014FF6C14C015F06C14FC6C800003806C15 +806C7E010F14C0EB003F020313E0140000F0143FA26C141F150FA27EA26C15C06C141FA2 +6DEB3F8001E0EB7F009038F803FE90B55A00FC5CD8F03F13E026E007FEC7FC232F7CAD2C +>I<EB01E0A51303A41307A2130FA2131FA2133F137F13FF1203000F90B51280B7FCA4C6 +01E0C7FCB3A3ED01E0A9150302F013C0137F150790393FF80F8090391FFC1F006DB5FC6D +13FC01015B9038003FE023407EBE2C>I<B6903803FFFCA5000101E09038003E006C163C +80017F5D8017F8013F5D6E1301011F5D6E1303010F5D6E13076D5DED800F6D92C7FC15C0 +5E6DEBE01E163E6D143CEDF07C027F1378EDF8F8023F5B15FD021F5B15FF6E5BA36E5BA2 +6E90C8FCA26E5AA26E5AA21578362C7EAB3B>118 D<B6903803FFFCA5000101E0903800 +3E006C163C80017F5D8017F8013F5D6E1301011F5D6E1303010F5D6E13076D5DED800F6D +92C7FC15C05E6DEBE01E163E6D143CEDF07C027F1378EDF8F8023F5B15FD021F5B15FF6E +5BA36E5BA26E90C8FCA26E5AA26E5AA21578A215F85D14015D001F1303D83F805B387FC0 +07D8FFE05B140F92C9FC5C143E495A387FC1F8EB07F06CB45A6C5B000790CAFCEA01FC36 +407EAB3B>121 D E /Fs 2 14 df<007FB81280B912C0A26C17803204799641>0 +D<923803FFC0033F13FC4AB67E020715E0913A1FFE007FF8DA7FE0EB07FE4AC87ED903FC +ED3FC0D907F0ED0FE0D90FC0ED03F049486F7E49CA7E017E177E498349834848EF0F8000 +0319C04917074848EF03E0000F19F049170148CC12F8A2001E1978003E197CA2003C193C +007C193EA20078191EA300F8191FA248190FAA6C191FA20078191EA3007C193EA2003C19 +3C003E197CA2001E1978001F19F8A26C6CEF01F06D1703000719E06C6CEF07C06D170F00 +0119806C6CEF1F006D5F017E177E6D5F6D6C4B5A6D6C4B5AD907F0ED0FE0D903FCED3FC0 +D900FF03FFC7FCDA7FE0EB07FEDA1FFEEB7FF80207B612E002011580DA003F01FCC8FC03 +0313C0484E7BBB53>13 D E /Ft 18 122 df<121FEA3F80EA7FC0EAFFE0A5EA7FC0EA3F +80EA1F000B0B708A2C>46 D<007FB5FCB612C015F0816C803907E003FEEC00FFED7F8015 +3FED1FC0ED0FE0A2150716F0150316F81501A4ED00FCACED01F8A3150316F0A2150716E0 +150FED1FC0153FED7F80EDFF00EC03FE007FB55AB65A5D15C06C91C7FC26337EB22C>68 +D<3801FFF0000713FE001F6D7E15E048809038C01FF81407EC01FC381F80000006C77EC8 +127EA3ECFFFE131F90B5FC1203120F48EB807E383FF800EA7FC090C7FC12FE5AA47E007F +14FEEB8003383FE01F6CB612FC6C15FE6C14BF0001EBFE1F3A003FF007FC27247CA32C> +97 D<EA7FF0487EA3127F1201AAEC1FE0ECFFF801FB13FE90B6FC16809138F07FC09138 +801FE091380007F049EB03F85BED01FC491300A216FE167EA816FE6D14FCA2ED01F86D13 +036DEB07F0150F9138801FE09138E07FC091B51280160001FB5B01F813F83900F03FC027 +337FB22C>I<EC0FFE4A7EA380EC003FAAEB07F8EB3FFE90B512BF4814FF5A3807FC0F38 +0FF00348487E497E48487F90C7FC007E80A212FE5AA87E007E5CA2007F5C6C7E5C6C6C5A +380FF0073807FC1F6CB612FC6CECBFFE6C143FEB3FFC90390FF01FFC27337DB22C>100 +D<EB03FE90381FFFC0017F13F048B57E48803907FE03FE390FF800FFD81FE0EB3F805B48 +48EB1FC090C7120F5A007E15E015075AB7FCA416C000FCC9FC7E127EA2127F6CEC03C06D +EB07E06C7ED80FF0130F6C6CEB3FC001FF13FF000190B512806C1500013F13FC010F13F0 +0101138023247CA32C>I<EC0FF8EC3FFE91B5FC4914805B903807FC7F14F090390FE03F +0014C092C7FCA6007FB512FEB7FCA36C5C26000FC0C7FCB3A8003FB512F04880A36C5C21 +337DB22C>I<1307EB1FC0A2497EA36D5AA20107C7FC90C8FCA7387FFFC080B5FC7EA2EA +0007B3A8007FB512FCB612FEA36C14FC1F3479B32C>105 D<387FFFE0B57EA37EEA0003 +B3B3A5007FB61280B712C0A36C158022337BB22C>108 D<397FF01FE039FFF87FFC9038 +F9FFFE01FB7F6CB6FC00019038F03F80ECC01F02807FEC000F5B5BA25BB3267FFFE0B5FC +B500F11480A36C01E0140029247FA32C>110 D<EB07FCEB1FFF017F13C048B512F04880 +3907FC07FC390FF001FE48486C7E0180133F003F158090C7121F007EEC0FC0A348EC07E0 +A76C140F007E15C0A2007F141F6C15806D133F6C6CEB7F006D5B6C6C485A3907FC07FC6C +B55A6C5C6C6C13C0011F90C7FCEB07FC23247CA32C>I<397FF01FE039FFF8FFF801FB13 +FE90B6FC6C158000019038F07FC09138801FE091380007F049EB03F85BED01FC491300A2 +16FE167EA816FE6D14FCA2ED01F86D13036DEB07F0150F9138801FE09138E07FC091B512 +80160001FB5B01F813F8EC3FC091C8FCAD387FFFE0B57EA36C5B27367FA32C>I<D87FFE +EB3FC0B53801FFF0020713F8021F13FC6C5B39003F7FE1ECFF019138FC00F84A13704A13 +005CA25C5CA391C8FCAF007FB512E0B67EA36C5C26247EA32C>114 +D<90387FF8700003B512F8120F5A5A387FC00F387E00034813015AA36CEB00F0007F1400 +13F0383FFFC06C13FE6CEBFF80000314E0C66C13F8010113FCEB0007EC00FE0078147F00 +FC143F151F7EA26C143F6D133E6D13FE9038F007FC90B5FC15F815E000F8148039701FFC +0020247AA32C>I<131E133FA9007FB6FCB71280A36C1500D8003FC8FCB1ED03C0ED07E0 +A5EC800F011FEB1FC0ECE07F6DB51280160001035B6D13F89038003FE0232E7EAD2C>I< +3A7FF003FF80486C487FA3007F7F0001EB000FB3A3151FA2153F6D137F3900FE03FF90B7 +FC6D15807F6D13CF902603FE07130029247FA32C>I<3A7FFF01FFFCB514FE148314016C +15FC3A03E0000F80A26D131F00011500A26D5B0000143EA26D137E017C137CA2017E13FC +013E5BA2EB3F01011F5BA21483010F5BA214C701075BA214EF01035BA214FF6D90C7FCA2 +6D5A147C27247EA32C>I<3A7FFF01FFFCB5008113FE148314816C010113FC3A03E0000F +806C7E151F6D140012005D6D133E137C017E137E013E137CA2013F13FC6D5BA2EB0F815D +A2EB07C1ECC3E0A2EB03E3ECE7C0130114F75DEB00FFA292C7FC80A2143EA2147E147CA2 +14FC5CA2EA0C01003F5BEA7F83EB87E0EA7E0F495A387FFF806C90C8FC6C5A6C5AEA07E0 +27367EA32C>121 D E /Fu 52 122 df<EC0FF8EC7FFE903901F80780903907E001C090 +391F8000E090383F0007017E497EA25BA2485A6F5AED018092C8FCA9ED03F0B7FCA33901 +F8000F1503B3AA486C497E267FFFE0B512C0A32A3B7FBA2E>12 D<D91FE0EB07F0D9FFFC +EB3FFC2603E03FEBF81F3C07000F81F00F803C0F8007E3E007C0281FC003F7C013E001E0 +9039FF8003F06E1300EF01F8806C485B6C5AC8EC00FC5DA4023FB6FC0107B7FC90263FF0 +FCC8FC3801FE00EA07F8EA0FE0485A485A007F147E90C7FC5A48170C157F4B141C701318 +4A6D1338007FD903E7147090278007C3E013E03C3FC00F81F001C03C0FE03E007C078026 +03FFF890381FFE0026007FC0EB03F836277DA53C>26 D<121C127FEAFF80A213C0A3127F +121C1200A412011380A2120313005A1206120E5A5A5A12600A1979B917>39 +D<146014E0EB01C0EB0380EB0700130E131E5B5BA25B485AA2485AA212075B120F90C7FC +A25A121EA2123EA35AA65AB2127CA67EA3121EA2121F7EA27F12077F1203A26C7EA26C7E +1378A27F7F130E7FEB0380EB01C0EB00E01460135278BD20>I<12C07E12707E7E7E120F +6C7E6C7EA26C7E6C7EA21378A2137C133C133E131EA2131F7FA21480A3EB07C0A6EB03E0 +B2EB07C0A6EB0F80A31400A25B131EA2133E133C137C1378A25BA2485A485AA2485A48C7 +FC120E5A5A5A5A5A13527CBD20>I<121C127FEAFF80A213C0A3127F121C1200A4120113 +80A2120313005A1206120E5A5A5A12600A19798817>44 D<121C127FEAFF80A5EA7F0012 +1C0909798817>46 D<EB03F8EB1FFF90387E0FC09038F803E03901E000F0484813780007 +147C48487FA248C77EA2481580A3007EEC0FC0A600FE15E0B3007E15C0A4007F141F6C15 +80A36C15006D5B000F143EA26C6C5B6C6C5B6C6C485A6C6C485A90387E0FC0D91FFFC7FC +EB03F8233A7DB72A>48 D<EB01C013031307131F13FFB5FCA2131F1200B3B3A8497E007F +B512F0A31C3879B72A>I<EB0FF0EB7FFE48B57E3903E03FE0390F000FF0000E6D7E486D +7E486D7E123000706D7E126012FCB4EC7F807FA56CC7FC121CC8FCEDFF00A34A5A5D1403 +5D4A5A5D140F4A5A4A5A92C7FC147C5C495A495A495A495A91C8FC011EEB01805B5B4913 +0348481400485A485A000EC75A000FB6FC5A5A485CB6FCA321387CB72A>I<EB07F8EB3F +FF4913C03901F80FF03903C007F848486C7E380E0001000F80381FE0006D7FA56C5A6C5A +C85A1401A25D4A5AA24A5A5DEC0F80027EC7FCEB1FFCECFF809038000FE06E7EEC01FC81 +6E7EED7F80A216C0A2153F16E0A2121EEA7F80487EA416C049137F007F1580007EC7FC00 +70ECFF006C495A121E390F8003F83907F00FF00001B512C06C6C90C7FCEB0FF8233A7DB7 +2A>I<1538A2157815F8A2140114031407A2140F141F141B14331473146314C313011483 +EB030313071306130C131C131813301370136013C01201EA038013005A120E120C5A1238 +12305A12E0B712F8A3C73803F800AB4A7E0103B512F8A325397EB82A>I<0006140CD807 +80133C9038F003F890B5FC5D5D158092C7FC14FC38067FE090C9FCABEB07F8EB3FFE9038 +780F803907E007E090388003F0496C7E12066E7EC87EA28181A21680A4123E127F487EA4 +90C71300485C12E000605C12700030495A00385C6C1303001E495A6C6C485A3907E03F80 +0001B5C7FC38007FFCEB1FE0213A7CB72A>I<EC3FC0903801FFF0010713FC90380FE03E +90383F800790387E001F49EB3F804848137F485AA2485A000FEC3F0049131E001F91C7FC +A2485AA3127F90C9FCEB01FC903807FF8039FF1E07E090383801F0496C7E01607F01E013 +7E497FA249148016C0151FA290C713E0A57EA56C7E16C0A2121FED3F807F000F15006C6C +5B15FE6C6C5B6C6C485A3900FE07F090383FFFC06D90C7FCEB03FC233A7DB72A>I<EB03 +F8EB1FFF017F13C09038FC07F03901E001F848486C7E4848137C90C77E48141E000E141F +001E80A3121FA27F5D01E0131E6C6C133E01FC133C6D5B6C6C6C5AECC1E06CEBF3C06C01 +FFC7FC6C5BEB3FFF6D13C081017F13F801F07F3903E07FFE3907801FFF48486C13804813 +03003E6D13C0003CEB007F007C143F0078EC0FE000F814075A1503A21501A36C15C01278 +1503007C15806CEC07006C5C6C6C131ED807E0137C3903F803F0C6B55A013F1380D907FC +C7FC233A7DB72A>56 D<EB03F8EB1FFF017F13C09038FC07E03903F803F048486C7E4848 +6C7E49137E121F48487FA2007F158090C7FCA248EC1FC0A616E0A56C143FA27F123F001F +147FA26C6C13FF6C6C13DF000313013901F0039F3900FC0F1FD93FFC13C0EB07F090C7FC +153F1680A316005D000F147E487E486C5BA24A5A4A5A49485A6C48485A001C495A260F80 +7FC7FC3807FFFC000113F038003FC0233A7DB72A>I<007FB812F8B912FCA3CCFCAEB912 +FCA36C17F836167B9F41>61 D<1538A3157CA315FEA34A7EA34A6C7EA202077FEC063FA2 +020E7FEC0C1FA2021C7FEC180FA202387FEC3007A202707FEC6003A202C07F1501A2D901 +807F81A249C77F167FA20106810107B6FCA24981010CC7121FA2496E7EA3496E7EA3496E +7EA213E0707E1201486C81D80FFC02071380B56C90B512FEA3373C7DBB3E>65 +D<913A01FF800180020FEBE003027F13F8903A01FF807E07903A03FC000F0FD90FF0EB03 +9F4948EB01DFD93F80EB00FF49C8127F01FE153F12014848151F4848150FA248481507A2 +485A1703123F5B007F1601A35B00FF93C7FCAD127F6DED0180A3123F7F001F160318006C +7E5F6C7E17066C6C150E6C6C5D00001618017F15386D6C5CD91FE05C6D6CEB03C0D903FC +EB0F80902701FF803FC7FC9039007FFFFC020F13F002011380313D7BBA3C>67 +D<B812FCA30001903880000F6C90C71201EE007E173E171E170EA31706A317078316C0A3 +94C7FCA31501A21503150F91B5FCA3EC000F15031501A21500A21860A318E093C712C0A4 +1701A3EF0380A21707A2170F173F177F486D903807FF00B9FCA333397DB839>69 +D<B812F8A30001903880001F6C90C71201EE00FC177C173C171CA2170CA4170E1706A2ED +0180A21700A41503A21507151F91B5FCA3EC001F15071503A21501A692C8FCAD4813C0B6 +12C0A32F397DB836>I<B612C0A3C6EBC0006D5AB3B3AD497EB612C0A31A397EB81E>73 +D<B5913807FFFE8080C69238007FE06EEC1F80D9DFF0EC0F001706EBCFF8EBC7FCA2EBC3 +FEEBC1FFA201C07F6E7EA26E7E6E7E81140F6E7E8114036E7E168080ED7FC016E0153FED +1FF0ED0FF8A2ED07FCED03FEA2ED01FF6F1386A2EE7FC6EE3FE6A2EE1FF6EE0FFEA21607 +1603A216011600A2177E486C153E487ED80FFC151EB500C0140EA2170637397DB83E>78 +D<B712C016F816FE000190398001FF806C90C7EA3FC0EE0FE0EE07F0EE03F817FC17FE16 +01A217FFA717FEA2EE03FCA2EE07F817F0EE0FE0EE3FC0923801FF0091B512FC16F091C9 +FCB3A5487FB6FCA330397DB839>80 D<B612FEEDFFE016F8000190388007FE6C90C76C7E +EE3FC0707E707E707EA2707EA283A65FA24C5AA24C5A4C5AEE3F8004FFC8FCED07FC91B5 +12E05E9138000FF0ED03F8ED00FE82707E707EA2161F83A583A6F00180A217F8160F1803 +486D01071400B66D6C5A04011306933800FE0ECAEA3FFCEF07F0393B7DB83D>82 +D<D90FF813C090383FFE0190B512813903F807E33907E000F74848137F4848133F48C712 +1F003E140F007E1407A2007C140312FC1501A36C1400A37E6D14006C7E7F13F86CB47E6C +13F8ECFF806C14E06C14F86C14FEC680013F1480010714C0EB007F020713E0EC007FED3F +F0151F150FED07F8A200C01403A21501A37EA216F07E15036C15E06C14076C15C06C140F +6DEB1F80D8FBF0EB3F00D8F0FE13FE39E03FFFF8010F13E0D8C00190C7FC253D7CBA2E> +I<003FB812E0A3D9C003EB001F273E0001FE130348EE01F00078160000701770A3006017 +30A400E01738481718A4C71600B3B0913807FF80011FB612E0A335397DB83C>I<B5D8FC +07B5D8F001B5FCA30007902780001FFEC7EA1FF86C48C7D80FF8EC07E000010307ED03C0 +1B807F6C6F6C1500A26E5F017F6E6C1406A280013F4A6C5CA280011F4A6D5BEE067FA26D +6C010E6D5BEE0C3FA26D6C011C6D5BEE181FA26D6C6F5BEE300FA26D6C6F485AEE6007A2 +6D6C4CC7FC9338C003FCA203805D913B7F818001FE06A203C1150EDA3FC3C7EAFF0CA203 +E3151CDA1FE6EC7F98A215F6DA0FFCEC3FF0A302075E4B141FA202035E4B140FA202015E +4B1407A2020093C8FC4B80503B7EB855>87 D<007FB590383FFFFCA3C601F801071380D9 +7FE0D903FCC7FC013FEC01F06D6C5C5F6D6C5C6D6C13034CC8FC6D6C1306160E6D6C5B6D +EB8018163891387FC0306E6C5A16E06E6C5A91380FF18015FB6EB4C9FC5D14036E7EA26E +7F6F7EA24B7E15DF9138019FF09138038FF8150F91380607FC91380E03FE140C4A6C7EEC +38000230804A6D7E14E04A6D7E49486D7E130391C76C7E01066E7E130E010C6E7E011C14 +01013C8101FE822607FF80010713E0B500E0013FEBFF80A339397EB83E>I<EA01801203 +EA0700120E5A12181238123012701260A212E05AA412CEEAFF8013C0A3127FA2EA3F80EA +0E000A197AB917>96 D<EB1FE0EBFFFC3803E03F3907000F80390F8007E0486C6C7E13E0 +6E7EA26E7E6C5A6C5AC8FCA4147FEB07FFEB3FE0EBFE00EA03F8EA0FF0EA1FC0123F485A +90C7FC160C12FEA31401A26C13036CEB077C903980063E18383FC01E3A0FE0781FF03A03 +FFF00FE03A007F8007C026277DA52A>I<EA03F012FFA3120F1203B0EC1FE0EC7FF89038 +F1E03E9039F3801F809039F7000FC001FEEB07E049EB03F049EB01F85BED00FCA216FEA2 +167E167FAA167E16FEA216FC15016D14F8ED03F07F01EEEB07E001C6EB0FC09039C7801F +00903881E07E903800FFF8C7EA1FC0283B7EB92E>I<EB03FC90381FFF8090387E03E039 +01F80070484813F83907E001FC380FC003A2EA1F80123F90380001F848EB00F01500A212 +7E12FEAA127E127FA26C14067F001F140E6D130C000F141C6C6C13386C6C13706C6C13E0 +39007C07C090381FFF00EB07F81F277DA525>I<ED0FC0EC03FFA3EC003F150FB0EB03F8 +EB1FFF90387E078F9038F801EF3903F0007F4848133F4848131FA24848130F123F90C7FC +5AA2127E12FEAA127E127FA27EA26C6C131FA26C6C133F6C6C137F6C6CEBEFF03A01F801 +CFFF39007C078F90381FFE0FD907F813C0283B7DB92E>I<EB07F8EB1FFF90387C0FC039 +01F803E03903F001F0D807E013F8380FC0004848137CA248C7127E153E5A153F127E12FE +A3B7FCA248C8FCA5127EA2127FA26C14037F001F14076C6C13060007140E6D131CD801F0 +13386C6C137090387E03E090381FFF80903803FC0020277EA525>I<147E903803FF8090 +380FC1E0EB1F8790383F0FF0137EA213FCA23901F803C091C7FCADB512FCA3D801F8C7FC +B3AB487E387FFFF8A31C3B7FBA19>I<ED03F090390FF00FF890393FFC3C3C9039F81F70 +7C3901F00FE03903E007C03A07C003E010000FECF000A248486C7EA86C6C485AA200075C +6C6C485A6D485A6D48C7FC38073FFC38060FF0000EC9FCA4120FA213C06CB512C015F86C +14FE6CECFF804815C03A0F80007FE048C7EA0FF0003E140348140116F8481400A56C1401 +007C15F06CEC03E0003F1407D80F80EB0F80D807E0EB3F003901FC01FC39007FFFF00107 +90C7FC26387EA52A>I<EA03F012FFA3120F1203B0EC0FF0EC3FFCECF03F9039F1C01F80 +9039F3800FC0EBF70013FE496D7EA25BA35BB3A3486C497EB500C1B51280A3293A7EB92E +>I<EA0380EA0FE0487EA56C5AEA0380C8FCAAEA03F012FFA312071203B3AA487EB512C0 +A312387EB717>I<EA03F012FFA3120F1203B1913801FFFCA39138007FC01600157C1570 +5D4A5A4A5A4AC7FC141E1438147814FC13F1EBF3FEEBF73F01FE7FEBF81F496C7E811407 +6E7E6E7E811400157E157F811680ED1FC0486CEB3FF0B500C0B5FCA3283A7EB92C>107 +D<EA03F012FFA3120F1203B3B3AD487EB512C0A3123A7EB917>I<2703F00FF0EB1FE000 +FFD93FFCEB7FF8913AF03F01E07E903BF1C01F83803F3D0FF3800FC7001F802603F70013 +CE01FE14DC49D907F8EB0FC0A2495CA3495CB3A3486C496CEB1FE0B500C1B50083B5FCA3 +40257EA445>I<3903F00FF000FFEB3FFCECF03F9039F1C01F803A0FF3800FC03803F700 +13FE496D7EA25BA35BB3A3486C497EB500C1B51280A329257EA42E>I<EB03FE90380FFF +8090383E03E09038F800F84848137C48487F48487F4848EB0F80001F15C090C712074815 +E0A2007EEC03F0A400FE15F8A9007E15F0A2007F14076C15E0A26C6CEB0FC0000F15806D +131F6C6CEB3F006C6C137EC66C13F890387E03F090381FFFC0D903FEC7FC25277EA52A> +I<3903F01FE000FFEB7FF89038F1E07E9039F3801F803A07F7000FC0D803FEEB07E049EB +03F04914F849130116FC150016FEA3167FAA16FEA3ED01FCA26DEB03F816F06D13076DEB +0FE001F614C09039F7803F009038F1E07E9038F0FFF8EC1FC091C8FCAB487EB512C0A328 +357EA42E>I<3807E01F00FFEB7FC09038E1E3E09038E387F0380FE707EA03E613EE9038 +EC03E09038FC0080491300A45BB3A2487EB512F0A31C257EA421>114 +D<EBFF03000313E7380F80FF381E003F487F487F00707F12F0A2807EA27EB490C7FCEA7F +E013FF6C13E06C13F86C7F00037FC67F01071380EB007F141F00C0EB0FC01407A26C1303 +A37E15806C13077EEC0F00B4131E38F3C07C38E1FFF038C03F801A277DA521>I<1318A5 +1338A31378A313F8120112031207001FB5FCB6FCA2D801F8C7FCB215C0A93800FC011580 +EB7C03017E13006D5AEB0FFEEB01F81A347FB220>I<D803F0EB07E000FFEB01FFA3000F +EB001F00031407B3A4150FA3151F12016D133F0000EC77F86D9038E7FF8090383F03C790 +381FFF87903A03FC07E00029267EA42E>I<B538803FFEA33A0FF8000FF06C48EB07E000 +03EC03C06D148000011500A26C6C1306A26D130E017E130CA26D5BA2EC8038011F1330A2 +6D6C5AA214E001075BA2903803F180A3D901FBC7FCA214FF6D5AA2147CA31438A227257E +A32C>I<B53A1FFFE03FFEA3260FF8009038000FF86C48017EEB03E018C00003023EEB01 +80A26C6C013FEB0300A36C6CEC8006156FA2017E9038EFC00C15C7A2D93F016D5A158302 +81EBF038D91F831430150102C3EBF87090260FC6001360A2D907E66D5A02EC137CA2D903 +FCEB7F804A133FA2010192C7FC4A7FA20100141E4A130E0260130C37257EA33C>I<B538 +803FFEA33A0FF8000FF06C48EB07C00003EC03806C7E16007F00001406A2017E5BA2137F +6D5BA26D6C5AA2ECC070010F1360A26D6C5AA214F101035BA2D901FBC7FCA214FF6D5AA2 +147CA31438A21430A214701460A25CA2EA7C0100FE5B130391C8FC1306EAFC0EEA701C6C +5AEA1FF0EA0FC027357EA32C>121 D E /Fv 8 117 df<90267FFF80923803FFFE816101 +00F0FE00027FEE0DFCDA6FE0151B14EF02CFEE33F8A2DAC7F01563A219C7130102879238 +0187F0DA83F8EC0307A21806190F90260381FC140C02015F1818A218306E6C151F491660 +010604C05BA2037FEB0180A2943803003F130E010C03065CED3F805F5F197F011C6D6C5A +011895C7FC5FA25FDB0FE05C0138ECE180013002E3C75AA216E6ED07F604FC1301137001 +604A5C150301F05C00015DD807FCEE07FEB500E0D9C003B512FC150116804F397DB84C> +77 D<14FF010713E090381F01F8903878007C01F8137E01FE7F0001801680A35BEA0070 +90C7FCA4EC0FFF49B5FC90390FFC3F00EB7FC03801FE00EA03F848485B485A4848137E48 +5A007F150690C7FC15FE48ECFC0C481301A21403007F9038077C18140E3A3F801C7E303A +1FC0F83FF03A07FFE01FC0C69038000F8027277CA52A>97 D<EC7F80903803FFF090380F +C07C90383F000E017C131F49137F000114FF485A485A120F484813FE153848481300A248 +C8FCA35A5AA75A7EA2151C127E15386C143015706C6C13E0000FEB01C03907C007803903 +F03E003800FFF8EB1FC020277AA525>99 D<147F903803FFE090380F81F090383E00FC49 +137C48487F4848133F0007805B48481480121F5B123FA248C7FCA3B71200A248C9FCA65A +7EA2007E140EA25D6C14186C14386D5B6C6C485A3907E003802601F01FC7FC38007FFCEB +1FE021277BA525>101 D<EB01FC137F5CA213071303A35CA513075CA5130F5CED3FC0ED +FFF09138C3C0F89138CF007CD91FDC137E5C02F0133E4A133F5C5E4948137EA291C7FCA3 +16FE5B017E5CA4150113FE495CA415031201495CA400031407B500E1B512C0A202C11480 +2A3A7EB92E>104 D<EB01C0EB07F0130F14F8A214F0A214E0EB038090C7FCAAEB0FC0EA +03FFA3EA003FEB1F80A5133F1400A55B137EA513FE5BA512015BA41203B512C0A315387E +B717>I<90270FC03FC0EB7F80D803FF903AFFF001FFE048903BC3C0F80781F0913BCF00 +7C1E00F826003FDCD97E387F6D485C02F0D93EE0137C4AD93FC0137E4A5C047F14FE4948 +91C75AA291C7127EA44902FE1301017E4A5CA501FE01011403494A5CA500010203140749 +4A5CA4486C496C497EB500E1B500C3B51280A202C10283140041257EA445>109 +D<1306A4130EA2130C131CA2133C137C13FC5B12031207001FB5FCB6FCA23803F8005BA5 +12075BA5120F5BA5001F130C1380A4141C003F131813007E1438EB80301470380FC0E038 +07C1C03803FF8038007E00183479B220>116 D E /Fw 6 55 df<13381378EA01F8121F +12FE12E01200B3AB487EB512F8A215267BA521>49 D<13FF000313E0380E03F0381800F8 +48137C48137E00787F12FC6CEB1F80A4127CC7FC15005C143E147E147C5C495A495A5C49 +5A010EC7FC5B5B903870018013E0EA0180390300030012065A001FB5FC5A485BB5FCA219 +267DA521>I<13FF000313E0380F01F8381C007C0030137E003C133E007E133FA4123CC7 +123E147E147C5C495AEB07E03801FF8091C7FC380001E06D7E147C80143F801580A21238 +127C12FEA21500485B0078133E00705B6C5B381F01F03807FFC0C690C7FC19277DA521> +I<1438A2147814F81301A2130313071306130C131C131813301370136013C012011380EA +03005A120E120C121C5A12305A12E0B612E0A2C7EAF800A7497E90383FFFE0A21B277EA6 +21>I<0018130C001F137CEBFFF85C5C1480D819FCC7FC0018C8FCA7137F3819FFE0381F +81F0381E0078001C7F0018133EC7FC80A21580A21230127C12FCA3150012F00060133E12 +7000305B001C5B380F03E03803FFC0C648C7FC19277DA521>I<EB0FE0EB3FF8EBF81C38 +01E0063803C01F48485AEA0F005A121E003E131E91C7FC5AA21304EB3FC038FCFFF038FD +C078B4C67E143E48131E141FA2481480A4127CA4003C1400123E001E131E143E6C133C6C +6C5A3803C1F03801FFC06C6CC7FC19277DA521>I E /Fx 9 121 +df<007FB912E0BA12F0A26C18E03C04789A4D>0 D<0060160600F8160F6C161F007E163F +6C167E6C6C15FC6C6CEC01F86C6CEC03F06C6CEC07E06C6CEC0FC06C6CEC1F80017EEC3F +006D147E6D6C5B6D6C485A6D6C485A6D6C485A6D6C485A6D6C485ADA7E3FC7FCEC3F7E6E +5A6E5A6E5AA24A7E4A7EEC3F7EEC7E3F4A6C7E49486C7E49486C7E49486C7E49486C7E49 +486C7E49C7127E017E8049EC1F804848EC0FC04848EC07E04848EC03F04848EC01F84848 +EC00FC48C9127E007E163F48161F48160F00601606303072B04D>2 +D<933803FFE0047F13FF0303B612E0030F15F8923A7FFE003FFFDBFFC001017FDA03FEC8 +EA3FE0DA0FF8ED0FF8DA1FC0ED01FC4A486F7E02FECAEA3F804948717ED903F0EF07E049 +48717E4948717E4948717E49CC127E017E85017C8549737E0001874919074848737EA248 +48737E000F8749190090CE1278481B7CA2003E87A2003C1B1EA2007C1B1FA2007887A200 +F81C80A2481B07AC6C1B0FA200781C00A2007C63A2003C1B1EA2003E1B3EA26C63A26C1B +786D1AF86D19010007636C6C4F5AA26C6C4F5A6D190F000063017C4FC7FC017E616D197E +6D6C606D6C4D5A6D6C4D5A6D6C4D5AD901FCEF1FC06D6C4D5ADA3F8004FEC8FC6E6C4B5A +DA0FF8ED0FF8DA03FEED3FE0912600FFC0903801FF80DB7FFE013F90C9FC030FB612F803 +0315E0DB007F91CAFC040313E0595C7BC664>13 D<49B4FC010F13E0013F13F8497F48B6 +FC4815804815C04815E04815F0A24815F84815FCA3B712FEAA6C15FCA36C15F86C15F0A2 +6C15E06C15C06C15806C15006C6C13FC6D5B010F13E0010190C7FC27267BAB32>15 +D<ED0FE015FF913803FC00EC0FE0EC3FC04A5A4AC7FC5C495AA2495AB3AD495AA2495A13 +1F495A495A01FEC8FCEA07F8EAFFE0A2EA07F8EA00FEEB7F806D7E6D7E130F6D7EA26D7E +B3AD6D7EA26D7E806E7E6E7EEC0FE0EC03FC913800FFE0150F236479CA32>102 +D<12FEEAFFE0EA07F8EA00FEEB7F806D7E6D7E130F6D7EA26D7EB3AD6D7EA26D7E806E7E +6E7EEC0FE0EC03FC913800FFE0A2913803FC00EC0FE0EC3FC04A5A4AC7FC5C495AA2495A +B3AD495AA2495A131F495A495A01FEC8FCEA07F8EAFFE048C9FC236479CA32>I<140C14 +1E143EA2143C147CA214F8A214F01301A2EB03E0A214C01307A2EB0F80A214005BA2133E +A2133C137CA2137813F8A2485AA25B1203A2485AA25B120FA248C7FCA2121E123EA25AA2 +127812F8A41278127CA27EA2121E121FA26C7EA212077FA26C7EA212017FA26C7EA21378 +137CA2133C133EA27FA27F1480A2EB07C0A2130314E0A2EB01F0A2130014F8A2147CA214 +3C143EA2141E140C176476CA27>I<126012F07EA21278127CA27EA2121E121FA26C7EA2 +12077FA26C7EA212017FA26C7EA21378137CA2133C133EA27FA27F1480A2EB07C0A21303 +14E0A2EB01F0A2130014F8A2147CA2143C143EA4143C147CA214F8A214F01301A2EB03E0 +A214C01307A2EB0F80A214005BA2133EA2133C137CA2137813F8A2485AA25B1203A2485A +A25B120FA248C7FCA2121E123EA25AA2127812F8A25A126017647BCA27>I<EB1FC0EBFF +F83801F03E3807C00F390F800780001FEB03C0393F0001E01400007E14F0140314075AA3 +EC03E0EC00801500A3127EA2123E123F7E6C7E6C7E6C7E6C7EEA0078131EEB7F803801F9 +E03803E0F8380FC03C48487EEB001F48EB0F80007EEB07C015E0EC03F05AA2EC01F8A612 +7EA2EC03F07E7E390F8007E0D807C013C00003130F3901E01F803900F83E00EB3CFCEB0F +F0EB03C0EB00F0147C8080EC0F80EC07C015E0140315F0A2EC01F8A31208123E127FA3EC +03F0127E12780038EB07E0123C6CEB0FC06C14803907801F003803E07CC6B45AEB1FC01D +5A79C52C>120 D E /Fy 77 126 df<00085B003EEB07C0007FEB0FE0A24814F0A26C14 +E0B3A2007E1307003E14C0A20008EB01001C1E75BD33>34 D<1438147C14FCA5903803FF +80011F13F0017F13FC48B6FC4815804815C0260FFEFD13E0391FF0FC3FD83FC0EB1FF001 +80EB07F8EA7F00007E140316FC481401A21503A46CEC01F8ED0060007F15001380EA3FC0 +13F0EA1FFCEA0FFF6C7F6CEBFFC06C14F06C14FC013F7F01077F0100148016C09138FC7F +E0ED1FF0150FED07F815031501003C15FC127EB41400A45AA26CEC01F87E15030180EB07 +F0D83FC0130F01E0EB1FE0D81FF0EB3FC0390FFEFDFF6CB612806C15006C14FC6C5C011F +13E0010390C7FCEB00FCA5147C1438264D7AC433>36 D<D803E0143CD80FF8147C486C14 +FEA2486C1301A2D87F7F495AEA7E3F5E00FEEB8007EAFC1F5E150FA24B5AA25ED8FE3F13 +3F007E13004B5AEA7F7FD83FFE91C7FC5D6C5A5D380FF801EA03E0C7485AA25D1407A24A +5AA25D141FA24A5AA25D147FA292C8FC5CA2495AA25C1303A2495A167C4A48B4FC010F49 +1380A24A4813C0131F92380FEFE0D93FC013C7031F13F002801383137FA2EBFF00A25B12 +01A24914C70003020F13E016EF4848903807FFC0A2496D1380A26C486D13000001EC007C +2C4D7DC433>I<EB03E0EB0FF8497E497E497E90B5FC9038FE3F803801FC1F13F8000380 +EBF00FA7141F5D91393F87FFE001F84913F00001137F147E14FE9026F9FC0713E001FF90 +3801F8006C13F8ECF00302E05B1507D97FC05B14809038FF000F485D148048141F4801C0 +5B5A391FEFE03FD83FC791C7FC903887F07FD87F03137EECF8FE6D6C5A12FEEB00FF6E5A +A291393FF00180EE03C091391FE007E0140F6CEB1FF06C133FEC7FF8903980FFFE0FD83F +C301FF13C0D9FFFC13FF6C496C13806C497E6CD9E00F13006C90388007FE3A00FE0001F8 +2C3F7DBD33>I<EA07C0EA0FF0EA1FF8A213FCA213FE120F1207EA007EA613FE13FCA212 +01EA03F8A2EA07F0120FEA1FE0EA7FC0EAFF8013005A5A12700F1E6EBC33>I<140FEC3F +80147F14FF491300495AEB07F8495A495A495A495A49C7FC5B12015B485A12075B120F5B +121F5BA2123F5BA2127F90C8FCA45A5AAD7E7EA47F123FA27F121FA27F120F7F12077F12 +036C7E7F12007F6D7E6D7E6D7E6D7E6D7EEB03FE6D7E6D1380147F143FEC0F00194D6FC4 +33>I<127812FE7E7F6C7E6C7EEA0FF06C7E6C7E6C7E6C7E6D7E133F80131F6D7E801307 +801303801301A2801300A28080A41580143FAD147F1500A45C5CA213015CA213035C1307 +5C130F5C495A133F5C137F49C7FC485A485A485A485AEA3FE0485A485A90C8FC5A127819 +4D78C433>I<14F0497EA8007015E000F8EC01F000FE140700FF140F01C1133F01F113FF +263FF9F913C0000FB61200000314FCC614F06D5B011F1380D907FEC7FC90381FFF80017F +13E090B57E000314FC000F14FF263FF9F913C026FFF1F813F001C1133F0101130F00FE14 +0700F814010070EC00E000001500A86D5A242B79B333>I<EA07C0EA0FF0EA1FF8123F13 +FCA213FEA2121F120F1207EA007E13FEA213FC1201EA03F81207EA0FF0EA7FE012FF13C0 +13005A12780F196E8A33>44 D<007FB612FEA2B8FCA36C15FEA228077BA133>I<121FEA +3F80EA7FC0EAFFE0A5EA7FC0EA3F80EA1F000B0B6C8A33>I<167816F8ED01FCA21503A2 +ED07F8A2ED0FF0A2ED1FE0A216C0153FA2ED7F80A2EDFF00A24A5AA25D1403A24A5AA24A +5AA24A5AA25D143FA24A5AA24AC7FCA2495AA25C1303A2495AA2495AA25C131FA2495AA2 +495AA249C8FCA25B1201A2485AA2485AA2485AA25B121FA2485AA2485AA248C9FCA25AA2 +127CA2264D7AC433>I<14FF010313C0010F13F0497F497F497F9038FF81FF3A01FE007F +804848EB3FC049131F4848EB0FE0A24848EB07F0A24848EB03F8A24848EB01FCA348C812 +FEA4007E157E00FE157FAE6C15FF6C15FEA46D1301003F15FCA26D1303001F15F8A26C6C +EB07F0A26C6CEB0FE06D131F6C6CEB3FC0A26CB4EBFF806C018113006DB45A6D5B6D5B6D +5B010313C0010090C7FC283F7BBD33>I<EB01E0497EA21307A2130FA2131F133F137F13 +FF1203123F5AEAFFF713E71387EA7E071200B3B3A2003FB512FE48801680A216006C5C21 +3E76BD33>I<EB03FF011F13E0017F13FC48B57E48ECFF804815C0260FFE0313E03A1FF0 +007FF049EB1FF84848130F49EB03FC127F90C7EA01FE4814005A6C15FF167FA3127E123C +C9FCA216FF16FEA2150116FC150316F81507ED0FF0ED1FE0153F16C0ED7F80EDFF004A5A +EC07FC4A5A4A5A4A5A4A5A4A5A4990C7FC495AEB07F8EB1FF0495A495A495A4890C8FC48 +48143E4848147FEA0FF0485A48B7FCB8FCA37E6C15FE283E7BBD33>I<903801FFC0010F +13F8013F13FF90B67E48814881489038807FF03A0FFC000FF801F06D7E484813036F7EA2 +1500A26C5A6C5AC9FC15015EA215034B5A150F4B5A4B5A913803FFC00103B55A4991C7FC +5D8116C06D8090C76C7EED0FF8ED03FC6F7E6F7E821780163FA2EE1FC0A3123C127EB4FC +A2163F1780167F6C16006D5C6D495A6C6C1303D81FF8EB0FFC3A0FFF807FF86C90B55A6C +5D6C15806C6C91C7FC010F13FC010113C02A3F7CBD33>I<15FF4A7F5C5CA25C5C15DFEC +3F9FA2EC7F1F14FEA2EB01FCA2EB03F8EB07F0A2EB0FE0EB1FC0A2EB3F80A2EB7F0013FE +A2485A12035B485AA2485A485AA2485AA248C7FC12FEB812E017F0A46C16E0C8381F8000 +AC021FB512804A14C04A14E0A26E14C06E14802C3E7DBD33>I<0007B612F04815F85AA3 +16F001C0C8FCB0ECFFC001C713F801DF7F90B6FC168016C0028013E09039FC001FF001F0 +EB0FF849130749EB03FC6C4813016CC713FEC9FCA216FF167FA41218127EA2B415FF16FE +A24814016C15FC6C14036DEB07F86D130F6C6CEB1FF06C6CEB7FE09039FE03FFC06CB612 +806C150000015C6C14F8013F13E0010390C7FC283E7BBC33>I<EC07FC91383FFF8091B5 +12C0010314F0130F4914F890383FFC0790397FE003FCEBFFC0481300485A5B4848EB01F8 +49EB00F0000F15005B121F5B123F5BA2127FEB0004903801FFF0010713FCD8FF1F7F4848 +EBFF8090B612C0B712E09038FE007F01F8EB1FF049EB0FF849EB07FC49130349EB01FEA2 +90C8FC16FF167FA37EA47F123F16FF6D14FE121F15016C6CEB03FC6D13076C6C14F86DEB +1FF06C6C133F3A01FF80FFE06C90B512C06D14806DEBFE006D5B010713F001001380283F +7BBD33>I<127CB8128017C0A4178048C813004B5A4B5A007C4A5AC8485A5E151F4B5A4B +5A93C7FC5D5D4A5A14035D14075D140F5D141F5D143F5DA24AC8FCA25C5CA213015CA349 +5AA413075CA5130F5CAA6D5A6D5A2A3F7CBD33>I<ECFFC0010713F8011F13FE017F6D7E +90B67E4881489038807FF03A07FE001FF8D80FF8EB07FC49130348486D7E491300003F81 +4980A66C6C14FEA26C6C495A6D13036C6C495AD803FEEB1FF03A01FF807FE06C90B55A01 +3F91C7FC010F13FCA2013F13FF90B612C0489038807FE03A07FC000FF848486D7ED81FE0 +EB01FE4913004848147F007F168090C8123FA200FEED1FC0A76C153F6C16806D147F003F +16006D5C6C6C495A01F813076C6C495A3A07FF807FF86C90B55A6C5D6C6C14806D91C7FC +010713F8010013C02A3F7CBD33>I<49B47E010F13E0013F13F84913FE90B6FC00031580 +48018113C09038FC007F4848EB1FE04848EB0FF0485A49EB07F84848130390C7FCED01FC +5A5A16FE1500A416FFA37E7E6D5BA26C6C5B6D5B6C6C5B6C6C5BD807FE137F90B7FC6C15 +7F6C14FC6C6CEBF8FF6DEBE0FE010F1380903800200091C7FC150116FCA2150316F81507 +16F0000F140F486CEB1FE0486C133F16C0EDFF804A13004A5A381FF01F90B512F86C5C6C +5C6C1480C649C7FCEB3FF0283F7BBD33>I<121FEA3F80EA7FC0EAFFE0A5EA7FC0EA3F80 +EA1F00C7FCB3A3121FEA3F80EA7FC0EAFFE0A5EA7FC0EA3F80EA1F000B2B6CAA33>I<16 +08163E16FF5D15075DED3FFEED7FFC913801FFF0020713E04A1380023F1300EC7FFC4948 +5A4913E0010F13804990C7FCEB7FFC495A000313E0485B001F90C8FCEA7FFE13F8485A13 +C013F06C7E13FEEA1FFF000713C06C7FC613F86D7EEB1FFF6D7F010313E06D13F86D6C7E +6EB4FC020F13806E13E0020113F09138007FFCED3FFEED0FFF81150181163E160828337B +B733>60 D<007FB71280A2B812C0A36C16806C1600CBFCA9003FB7FC481680B812C0A36C +1680A22A177CA933>I<1210127CB4FC7F13E07FEA7FFC6C7E380FFF806C13E000017F6C +13FCEB3FFE6D6C7E01077F010113F06D7FEC3FFE6E7E020713C06E13E0020013F8ED7FFE +151FED0FFF1503150FED1FFE157FEDFFF8020313E04A13C0021F13004A5AECFFF8495B01 +0713C0011F5B4948C7FCEBFFFC4813F000075B481380D83FFEC8FC485AEAFFF05B138090 +C9FC127C121028337BB733>I<90380FFF80017F13F848B512FE0007ECFF804815C04815 +E0263FFC0113F03A7FE0001FF80180130748C7EA03FC5A6C1401A3127E15030018EC07F8 +C8121FED3FF0EDFFE04A13C04A1380913807FE004A5A4A5AEC3FE05D4A5A4AC7FCA2495A +5CA213035CA96D5A90C9FCA914E0EB03F8A2497EA36D5AA2EB00E0263E7ABD33>I<EC1F +804A7E4A7EA34A7EA314F901017FA501037FA214F0A201077FA4ECE07E010F137FA44948 +6C7EA549486C7EA4017F80EC000FA291B5FCA290B67EA43A01FE0007F8491303A4000381 +491301A3000781491300D87FFF90380FFFE0B56C4813F06E5AA24A7E6C496C13E02C3E7D +BD33>65 D<91391FE00780DAFFFC13C00103EBFF0F010F148F4914FF5B90387FF81F9038 +FFC00748497E4848487E497F485A167F485A49143F121F5B003F151F5BA2127F90C8EA0F +8093C7FCA25A5AAD7E7EA36DEC0F80003FED1FC0A27F121F7F000F153F6D15806C7E167F +6C6CECFF007F3A01FF8003FE6C6D485A90397FF81FF86DB55A6D5C6D5C010391C7FC0100 +13FCEC1FE02A3F7CBD33>67 D<003FB512F04814FCB7FC826C816C813A03F8007FF0ED1F +F8ED07FC15036F7E8281EE7F80A2163F17C0161FA217E0160FA4EE07F0AD160F17E0A416 +1F17C0163FA21780167FEEFF00A24B5A15034B5AED1FF8ED7FF0003FB6FC4815C0B75A93 +C7FC6C14FC6C14F02C3D7EBC33>I<003FB712E04816F0B8FCA27E7ED801FCC71207A8EE +03E093C7FCA6151F4B7EA490B6FCA69038FC003FA46FC7FC92C8FCA817F8EE01FCA9003F +B7FC5AB8FCA27E6C16F82E3D7EBC33>I<003FB712E04816F0B8FCA27E7ED801FCC71207 +A8EE03E093C7FCA7151F4B7EA490B6FCA69038FC003FA46FC7FC92C8FCB1383FFFF8487F +B57EA26C5B6C5B2C3D7DBC33>I<91387F803C903901FFF03E0107EBFC7E011F13FE49EB +FFFE5B9038FFE07F48EB803FEC000FEA03FC00071407491303485A491301121F5B123F49 +1300A2127F90C8FC167C93C7FCA25A5AA992387FFFC092B512E0A37E6C6E13C0923800FE +00A36D1301123FA27F121F6D1303120F7F6C6C1307A26C6C130F6C6C131F9038FF803F6C +EBE0FF6DB5FC7F6D13FE010713F80101EBF07C9026007F80C7FC2B3F7CBD33>I<3B7FFF +C00FFFF8B56C4813FCA46C496C13F8D803F8C7EA7F00B3A290B7FCA601F8C77EB3A53B7F +FFC00FFFF8B56C4813FCA46C496C13F82E3D7EBC33>I<003FB612804815C0B712E0A26C +15C06C1580260003F8C7FCB3B3AD003FB612804815C0B712E0A26C15C06C1580233D78BC +33>I<49B512F84914FC16FEA216FC6D14F890C7EA7F00B3B3A5123C127EB4FCA25D5D14 +01397F8007FC9038F01FF86CB5FC6C5C6C14C000035CC649C7FCEB1FF0273E79BC33>I< +387FFFF8B57E80A25C6C5BD801FCC9FCB3B3A3EE03E0EE07F0A9007FB7FCB8FCA46C16E0 +2C3D7DBC33>76 D<D83FF8EC1FFC486CEC3FFE486CEC7FFFA2007F16FE6C6CECFFFC0007 +16E001EF14F7EC8001A39039E7C003E7A3ECE007A201E314C7A2ECF00FA201E11487ECF8 +1FA201E01407A2ECFC3FA2EC7C3E157E147EEC3E7CA3EC1E78EC1FF8A2EC0FF0A3EC07E0 +EC03C091C7FCAED83FFCEC3FFC486CEC7FFEB591B5FCA26C48EC7FFE6C48EC3FFC303D7F +BC33>I<90381FFFF890B6FC000315C0000F15F0A24815F83A3FFC003FFC01E013074913 +034848EB01FEA290C8FCA500FE157FB3AC6C15FF6C15FEA46D1301A36C6CEB03FC01F013 +0F01FC133F6CB612F86C15F0A2000315C0C61500011F13F8283F7BBD33>79 +D<003FB512FC48ECFF80B712E016F86C816C813A01FC000FFF030313801500EE7FC0163F +EE1FE0160FA217F01607A6160F17E0A2161FEE3FC0167FEEFF801503030F130090B65A5E +5E16E0168003FCC7FC01FCC9FCB3383FFFE0487FB57EA26C5B6C5B2C3D7EBC33>I<007F +B57EB612F815FE81826C812603F8007FED3FF0ED0FF815076F7E1501A26F7EA74B5AA215 +034B5A150FED3FF0EDFFE090B65A5E93C7FC5D8182D9F8007F153F6F7E150F821507AA17 +3E177FA416F8030313FF267FFFC014FEB538E001FF17FC81EE7FF86C49EB3FF0C9EA0FC0 +303E7EBC33>82 D<D907FE137890393FFFC07C90B5EAF0FC4814FC000714FF5AEBFC0339 +1FF0007F4848133F0180131F007F140F90C712074814035AA21501A46CEC00F86C15007F +7F6C7E7FEA1FFE380FFFE06C13FF6C14F06C14FC6C6C13FF011F1480010314C0D9003F13 +E0020313F09138003FF8ED0FFC1507ED03FE1501150016FFA2007C157F12FEA56C15FF16 +FE7FED01FC6D130301F0EB07F801FC130F9039FF807FF091B512E016C000FC1580013FEB +FE00D8F80F5BD8780013E0283F7BBD33>I<003FB712F84816FCB8FCA43AFE000FE001A8 +007CED00F8C71500B3B3A40107B512C049804980A26D5C6D5C2E3D7EBC33>I<273FFFE0 +01B5FC486D481480B56C4814C0A26C496C14806C496C1400D801FCC7EA0FE0B3B3A36D14 +1F00005EA26D143F6D5DA26D6C49C7FC6E5B6D6C485AECF00390390FFC0FFC6DB55A6D5C +6D5C6D6C1380DA1FFEC8FCEC07F8323E80BC33>I<D83FFCEC3FFC486CEC7FFEB591B5FC +A26C48EC7FFE6C48EC3FFCD80FC0EC03F0A76D1407000716E0A86C6CEC0FC0A2EC07E0EC +0FF0EC1FF8A3000116809039F83FFC1FEC3E7CA4EC7E7EA200001600A2EC7C3E01FC5CEC +FC3FA3ECF81F017C143EA590397DF00FBEA3013D14BC90393FE007FCA5ECC003011F5C6D +486C5A303E7FBC33>87 D<3A3FFF807FFF486DB51280A46C496C13003A01FE000FE0151F +6C7E4B5AEB7F805E90383FC07F93C7FC6D6C5A5DEB0FF15DEB07FB5DEB03FF5D7F5D7F5D +147F6E5AA34A7EA24A7E815B81EB03FB81EB07F181EB0FE081011F7F02C07F013F133F02 +807F017F131F02007F49130F49801507000181491303000381491301D87FFF90380FFFE0 +B56C4813F05DA2816C496C13E02C3D7DBC33>I<007FB512C0B612E0A415C048C8FCB3B3 +B3ABB612C015E0A46C14C01B4D6CC433>91 D<127CA212FEA27EA26C7EA26C7EA26C7EA2 +120F7FA26C7EA26C7EA26C7EA212007FA26D7EA26D7EA26D7EA2130F80A26D7EA26D7EA2 +130180A26D7EA26E7EA26E7EA2141F81A26E7EA26E7EA26E7EA2140181A26E7EA2ED7F80 +A2ED3FC0A2151F16E0A2ED0FF0A2ED07F8A2ED03FCA21501A2ED00F81678264D7AC433> +I<007FB512C0B612E0A47EC7120FB3B3B3AB007FB5FCB6FCA46C14C01B4D7DC433>I<00 +7FB612FEA2B8FCA36C15FEA228077B7D33>95 D<131C137E13FE12011203EA07FCEA0FF0 +EA1FE013C0EA3F80A2EA7F00127EA212FE5AA6EAFFC013E013F0127FA2123FA2EA1FE0EA +07C00F1E6EC333>I<EB1FFC90B57E000314E048804814FC48809038F007FFEBE0016E7F +153F6C48806C48131FC87F150FA5EC0FFF49B5FC131F137F48B6FC0007140F4813C0381F +FC00EA3FF0EA7FC05B48C7FC5AA56C141F7E6D137FD83FE0497ED9F807EBFFF06CB712F8 +7E6C14F36C14C1C69138003FF0D91FF090C7FC2D2E7BAC33>I<EA3FFC487E12FFA2127F +123F1200ABEC01FE91380FFFC04A13F0027F7F91B512FE90B7FCECFE07DAF800138002E0 +EB7FC04AEB3FE04A131FEE0FF091C7FC16074915F81603A217FC1601A9160317F8A26D14 +0717F06E130F17E06E131FEE3FC06E137F9139F801FF80DAFE07130091B55A495C6E5BD9 +7E3F13E0D93C0F138090260003FEC7FC2E3E7FBC33>I<ECFFF0010713FE011FEBFF8049 +14C04914E048B612F048EBC01F9038FE000F485A485A4848EB07E049EB03C0484890C7FC +5BA2127F90C9FCA25A5AA97E7EA27F003FEC01F06DEB03F86C7E6D13076C6C14F06C6C13 +0F01FFEB1FE06CEBE07F6C90B512C06C1580013F14006D13FC01075B010013C0252E79AC +33>I<ED7FF84B7E5CA280157F1501ABEB01FF010713C1011F13F1017F13F990B6FC5A48 +13813907FE003FD80FF8131F49130F48481307491303123F491301127F90C7FCA25A5AA9 +7E7E15037F123F6D1307A26C6C130F6D131F6C6C133F6C6C137F2603FF81B512F091B612 +F8C602FD13FC6D13F96D01E113F8010F018013F0D901FEC8FC2E3E7DBC33>I<ECFF8001 +0713F0011F13FC497F90B6FC48158048018013C03A07FE003FE001F8EB0FF04848130748 +4814F8491303003F15FC491301127F90C7FC16FE15005A5AB7FCA516FC48C9FC7E7EA36C +7E167C6C6C14FE7F6C7E6D13016C6CEB03FC6CB4130F6C9038C03FF86C90B512F06D14E0 +6D14C0010F1400010313FC9038007FE0272E7BAC33>I<ED3FE0913801FFFC020713FE14 +1F4A13FF5CECFFC015004948137E4A133C010314005CA8003FB612F84815FCB7FCA36C15 +F8260003F8C7FCB3AD003FB612804815C0A46C1580283E7DBD33>I<D901FEEB1FE0903A +0FFFC0FFF0013F01F313F84990B512FC90B7FC5A48010313E12607FC00EB80F849017F13 +60484890383FC00049131FA2001F8149130FA66D131F000F5DA26D133F6C6C495A6D13FF +2603FF0390C7FCECFFFE485C5D5DD80FCF13C0D981FEC8FC0180C9FCA27FA26C7E7F90B5 +12FC6CECFFC06C15F0000715FC4815FF4816809038E0000748489038007FC090C8EA1FE0 +48150F007E150700FE16F0481503A56C1507007E16E0007F150F6C6CEC1FC001E0147FD8 +1FF8903801FF80270FFF801F13006C90B55A6C5DC615F0013F14C0010F91C7FC010013F0 +2E447DAB33>I<EA3FFC487E12FFA2127F123F1200AB4AB4FC020713C0021F13F0027F7F +91B5FC90B67EED07FEECF801ECF0004A7F4A7F5CA291C7FCA35BB3A43B3FFFF80FFFFC48 +6D4813FEB56C4813FFA26C496C13FE6C496C13FC303D7FBC33>I<14E0EB03F8A2497EA3 +6D5AA2EB00E091C8FCAA383FFFF8487FA47EEA0001B3AD007FB612C0B712E016F0A216E0 +6C15C0243E78BD33>I<EA7FF8487EA4127F1200AC4AB512C04A14E04A14F0A26E14E06E +14C09139000FF0004B5A4B5A4B5A4BC7FC4A5A4A5A4A5A4A5A4A5A4A5A4A5A4A7E01FD7F +90B5FC81ECF3F8ECE3FC14C1EC80FEEC007F5B496D7E6F7E82150F6F7E6F7E8215016F7E +3B7FFFF80FFFF0B56C4813F817FCA217F86C496C13F02E3D7EBC33>107 +D<383FFFFC487FB5FCA27E7EC7FCB3B3AD003FB612F84815FCB712FEA26C15FC6C15F827 +3D7ABC33>I<02FC137E3B7FC3FF01FF80D8FFEF01877F90B500CF7F15DF92B57E6C010F +13872607FE07130301FC01FE7F9039F803FC01A201F013F8A401E013F0B3A53C7FFE0FFF +07FF80B548018F13C0A46C486C01071380322C80AB33>I<4AB4FC263FFC0713C0267FFE +1F13F000FF017F7F91B5FC6CB67E6CEC07FEC6EBF801ECF0004A7F4A7F5CA291C7FCA35B +B3A43B3FFFF80FFFFC486D4813FEB56C4813FFA26C496C13FE6C496C13FC302C7FAB33> +I<EB01FE90380FFFC0013F13F0497F90B57E488048EB03FF2607FC0013804848EB7FC049 +133F4848EB1FE049130F4848EB07F0A2007F15F890C71203A300FEEC01FCAA6C14036C15 +F8A26D1307003F15F06D130FA26C6CEB1FE06D133F6C6CEB7FC06C6CEBFF802603FF0313 +006CEBFFFE6C5C6D5B6D5B010F13C0D901FEC7FC262E7AAC33>I<EC01FE3A3FFC0FFFC0 +486C4813F000FF017F7F91B512FE6CB7FC6CEBFE07C6D9F800138002E0EB7FC04AEB3FE0 +4A131FEE0FF091C7FC16074915F81603A217FC1601A9160317F8A26D140717F06E130F17 +E06E131FEE3FC06E137F9139F801FF80DAFE07130091B55A495C6E5B6E13E0020F1380DA +03FEC7FC91C9FCAF383FFFF8487FB57EA26C5B6C5B2E427FAB33>I<ED03FE3B7FFF801F +FF80B5D8C07F13E002C1B5FC02C314F014C76C9038CFFE0F39001FDFF09139FFC007E092 +388003C092C8FC5C5C5CA25CA25CA35CB2007FB512FEB7FCA46C5C2C2C7DAB33>114 +D<90381FFE0F90B5EA8F80000314FF120F5A5AEBF007387F800190C7FC00FE147F5A153F +A37E007FEC1F0001C090C7FCEA3FF8EBFFC06C13FF6C14E0000314F8C680011F13FF0100 +1480020713C0EC007FED1FE0007C140F00FEEC07F01503A27EA27F15076D14E06D130F6D +EB3FC09038FE01FF90B61280160000FD5C00FC14F8D8F83F13E0D8780790C7FC242E79AC +33>I<EB03C0497E130FAA003FB612FC4881B7FCA36C5D26000FE0C8FCB3A3161FEE3F80 +A5167F6E140001075C6E5A9138FE07FE6DB55A6D5C6D5C6E5B021F1380DA07FCC7FC2938 +7EB633>I<D83FFCEB1FFE486C497E00FF5CA2007F80003F800000EC007FB3A75EA25DA2 +6D5B90387F800FDAE03F13FC6DB612FE17FF6D806D01FE13FE01039038F83FFC010001C0 +C7FC302C7FAA33>I<3B3FFFC00FFFF0486D4813F8B56C4813FCA26C496C13F86C496C13 +F0D801F8C7EA7E006D14FE00005DA26D1301017E5CA2017F13036D5CA2EC8007011F5CA2 +ECC00F010F5CA36D6C485AA3ECF03F010391C7FCA26E5A0101137EA2ECFCFE01005BA214 +FF6E5AA36E5AA26E5A6E5A2E2B7EAA33>I<3B7FFF8007FFF8B56C4813FC6E5AA24A7E6C +496C13F8D80FC0C7EA0FC06D141F00071680A56D143F00031600A3EC0FC0EC1FE0A23A01 +F83FF07EA3EC7FF8147CA20000157C9039FCFCFCFCA3ECF87CA2017C5C017D137EECF03E +A2017F133FA26D486C5AA3ECC00F90390F8007C02E2B7EAA33>I<3B3FFFC07FFF80486D +B512C0B500F114E0A26C01E014C06C496C13803B00FE000FE000017F495AEB3F804B5A6D +6C48C7FC90380FE07E903807F0FEECF1FC903803FBF8EB01FF6D5B5D6E5A143F6E5A143F +814A7E14FF903801FBF0ECF9F8903803F1FCEB07E0157E90380FC07F011F6D7E90383F80 +1F02007F496D7E01FE6D7E484813033B7FFFC03FFFE0B56C4813F0A46C496C13E02C2B7D +AA33>I<3B7FFF801FFFE0B56C4813F06E4813F8A24A6C13F06C496C13E0D803F8C7EAFC +00000114015E7F000014036D5C137EA2017F495A7FA26E485A131FA26D6C485AA214E001 +0749C7FCA214F01303157EEB01F8A2157C010013FC14FC5D147C147DEC3FF0A36E5AA36E +5AA2141F5DA2143F92C8FCA3147EA214FE003F5B1301387F81F81383EB87F0139FEBFFE0 +6C5B5C6C90C9FCEA0FFCEA03F02D427DAA33>I<000FB712804816C05AA317800180C713 +004B5A4B5A4B5A4B5A6CC7485AC8485A4B5A4BC7FC4A5A4A5A4A5A4A5A4A5A4A5A4A5A4A +C8FC495A495A495A495A495A495A495A49C7EA0F804848EC1FC0485A485A485A485A485A +48B7FCB8FCA46C16802A2B7DAA33>I<ED07FEED7FFF4AB5FC14075C4A13FE91383FFE00 +15E0EC7F8092C7FCB3A45C495A1303EB1FFCEA3FFFB55A14E05C8014F8003F7FEA001FEB +03FE13016D7E80B3A481EC3FE015FE91381FFFFE6E13FF8014016E7EED07FE284D7BC433 +>I<EA7FF0B5FC14C014F0806C7F38003FFE1303EB00FF80B3A4816E7E81EC1FFCEDFFFC +6E13FF1403805C140F4A13FCEDFC00EC3FE05D4A5A92C7FCB3A45CEB03FE133F387FFFFC +B55A5C14C091C8FCEA7FF0284D7BC433>125 D E /Fz 6 121 df<933801FFC0040F13F8 +043F13FE9339FF81FF80923A01F8003FC0DB07E0EB0FE04B486D7E4BC77F033E6E7E4B6E +7E5D4A486E7E4A5A020717805D4A4816C0021F0140147FED00E0143E7015E04A1370A24A +16FFA2495AA213035C04F05B01074A15C05C15014C5B010F1880EC80034C5B0307160093 +C7FC4B4A5AEC001E4B4A5A6E484A5A01075BDA83E04A5A6DB4484A5A6D49495B6D48C748 +5B91C891C7FC4D5A4D5AEF3FF8EF7FE04D5A4C5BDC07FEC8FC4C5AEE1FF0EE7FE0923801 +FF804B90C9FCED0FFCED3FF0ED7FC04A485A4A48CAFCEC0FF8EC1FE04A5A4ACBFC14FE49 +4816784948167CD907E016FC49485E495A49C912015B017E4C5A5B48484C5A5B0003170F +48484C5A49163F260FFFF04B5ADAFF804AC7FC4802F8130301C09039FFE01FFE263F801F +90B55AEB0007007E6D5D02005D007C6E5C00FC6E5C48020F5C030349C8FC6F13F8489138 +003FE0436274DE49>50 D<ED07F8ED3FFE4AB5FC913A03FE0F80F0913A0FF003C1FC9139 +1FE001E3DA3FC013F74AC712FF495A4948147F4A5D495A010F153F495A49485D137F5C13 +FF48495DA25A91C8127F485FA2485A17FF60485AA25E003F94C7FC5BA25E007F5E5BA216 +075F5B12FF160F4D13F8A25B041F130105F013F0A2007F153F1803047F14E017E016FF00 +3F4AEC07C05D001F170F6DD907DF1480000FEC0F9FDB1F1FEB1F006C6CEB3E0F6C6C01FC +143E0001902601F8075B3C00FE0FE003F0FC903B7FFFC001FFF8011F90C713E0D907F8EC +3FC03D4271BF49>97 D<15FC903801FFFE133F4913FCA49038007FF8141FA315F0A2143F +A215E0A2147FA215C0A214FFA21580A25BA21500A25BA25CA21307A25CA2130FA25CA213 +1FA25CA2133FA25CA2137FA25CA213FFA25CA25AA291C7FCA25AA25BA21207A25BA2120F +A25BA2121FA25BA2123FEC03E013E0A2127FEC07C013C0A2140F00FF14801380A2EC1F00 +A25C007F133EA25C123F5C381F81F0EA0FC36CB45A6C1380C690C7FC1F6673E325>108 +D<D90FE0DA1FF04AB4FCD93FF8902601FFFE021F13E0D97FFE01076D6C017F13F8D9FC7F +903D1FF03FC001FF03FC4101F03F803F800FE003F800FE2603E01FD97E009026F007E07F +DBC0F80107D90F807FD807C0D9C1F06E48C77FDBE3E0153ED80F80D9E7C06D6C486E7EDB +EF805D001F02FFC7EBFDF0010017FF4A485E484A5E123E4B4A49147F4A4893C8FC127E00 +7C4A5DA200FC49484A4815FF486500784A5DC7FC49041F5D9BC7FC92C85BA249043F5D65 +4A5E1C070107047F5EA24A4C140F65010F16FF1C1F4A4C5DA2011F4B163F9A38E001F04A +93C8FC1C7F013F4BEFC0031FE04A4B15FF1D80017F0307F007C0634A4B1600F60F8001FF +150F52EB1F004A5D1E3E48161F6691C84902005C6699387E03E0494C92383F0FC076B45A +494C6F90C7FC6C486F48ED03F86C4274BF75>I<15F84A7E1403A21407A4140F5DA3141F +5DA3143F5DA3147F5DA314FF5DA3007FB7FCB8FCA316FE260003FEC7FCA313075CA3130F +5CA3131F5CA3133F5CA3137F5CA313FF5CA35A91C8FCA35A5BA3000715F85BA21501000F +15F049130316E01507001F15C05BED0F80151F1600153E120F5D5D0007495A4A5A0003EB +0FC03901F83F806CB5C7FCEB7FFCEB1FE0285C72D930>116 D<DA03FEEC3FC091260FFF +80EBFFF8023FD9E00313FE913BFF07F007E07F903D01F803F80F801F80902903F001FC1F +0013C0902807C000FE3E137F49484A13FF49C738FFFC0149EC7FF8013E4B5A5B01FC15E0 +49188000017113004903C05B0003EF007C4902FF91C7FC00075E5BA25D000F93C9FC6C5A +C8FC5D5EA315075EA3150F5EA3151F5EA3153F197C5EA2037F15FC615E1801D807C001FF +5DD81FE01603486C5F007F4915076100FF170F4A5E4EC7FC9026E007DF143E9026C00F9F +5C0180D98FE05B277F001F07495A003E903A7E03F007E03C1FC1FC01FC1FC0270FFFF000 +B55A6C496D48C8FCC60180EB0FF0424278BF43>120 D E /FA 12 +121 df<130C133C137CEA03FC12FFEAFC7C1200B3B113FE387FFFFEA2172C7AAB23>49 +D<EB7F803801FFF0380780FC380E003F48EB1F8048EB0FC05A0060EB07E012F000FC14F0 +7E1403A3007C1307C7FCA215E0140F15C0141F1580EC3F00147E147C5C495A495A495A49 +5A011EC7FC5B5B4913305B485A4848136048C7FC000E14E0001FB5FC5A4814C0B6FCA21C +2C7DAB23>I<EB3FC03801FFF03807C0FC380E007E487FEC1F80003F14C0A2EB800F1300 +A2000C131FC7FC1580A2EC3F00143E5C5CEB03F0EBFFC014F0EB00FC143FEC1F8015C014 +0F15E0A2EC07F0A21238127C12FEA3EC0FE012F8006014C00070131F6C1480001EEB3F00 +380780FC3801FFF038007FC01C2D7DAB23>I<140EA2141E143EA2147E14FEA2EB01BE13 +03143E1306130E130C131813381330136013E013C0EA0180120313001206120E120C5A12 +3812305A12E0B612FCA2C7EA3E00A9147F90381FFFFCA21E2D7EAC23>I<000CEB018038 +0FC01F90B512005C5C14F014C0D80C7EC7FC90C8FCA8EB1FC0EB7FF8380DE07C380F801F +01001380000E130F000CEB07C0C713E0A2140315F0A4127812FCA448EB07E012E0006014 +C00070130F6C14806CEB1F006C133E380780F83801FFE038007F801C2D7DAB23>I<EB03 +F8EB0FFE90383E0780EBF8013901F007C03803E00FEA07C0EA0F80A2391F00078091C7FC +123EA2127EA2127CEB0FC038FC3FF0EBF07C38FDC01EB4487E01001380EC07C04814E0A2 +14034814F0A4127CA3127EA2003E14E01407121E001F14C06CEB0F803907801F003803C0 +3E6C6C5A38007FF0EB1FC01C2D7DAB23>I<EB1F80EBFFF03803E0783807C03E380F801E +381F001FEC0F80123E007E130715C0127C12FCA3B6FCA200FCC8FCA5127EA2003E14C012 +3F6C1301390F80038001C013003803E00F3801F03C38007FF8EB1FC01A207E9E1F>101 +D<2607C07FEB07F03BFFC3FFC03FFC903AC783F0783F3C0FCE01F8E01F803B07DC00F9C0 +0F01F8D9FF8013C04990387F000749137EA249137CB2486C01FEEB0FE03CFFFE0FFFE0FF +FEA2371E7E9D3C>109 D<EB1FE0EB7FF83801F03E3803C00F3907800780390F0003C048 +14E0003EEB01F0A248EB00F8A300FC14FCA9007C14F8A26CEB01F0A26CEB03E0A2390F80 +07C03907C00F803901F03E0038007FF8EB1FE01E207E9E23>111 +D<3801FE183807FFB8381E01F8EA3C00481378481338A21418A27E7EB41300EA7FF06CB4 +FC6C13C06C13F0000113F838001FFC130138C0007E143EA26C131EA27EA26C133CA26C13 +7838FF01F038E3FFC000C0130017207E9E1C>115 D<1360A413E0A312011203A2120712 +1FB512F0A23803E000AF1418A714383801F03014703800F860EB3FE0EB0F80152A7FA81B +>I<3AFFFC07FF80A23A0FF003FC000003EB01F0000114C06D485A000091C7FCEB7C06EB +3E0E6D5A14B8EB0FB0EB07E013036D7E497E1307EB067C497EEB1C1F01387FEB700F496C +7E6E7ED803C07F00076D7E391FE003FC3AFFF007FFC0A2221D7F9C25>120 +D E /FB 50 122 df<ED3FF80203B5903803FFF8020FDAC00713FC023F6E4813FE5C49B6 +4913FF5BA25B5BA249EBFE1FEDFC07491403A2EDF801A24991C76C13FEA27213FC7213F8 +95C8FCAF001FB7903801FFF848DCC00713FE5AB86C4813FFA56C16C0A2001F1600C66C01 +F8C7FCB3B3B06D496E13FE7F6D01C0020113F848667DE554>12 D<F01F80F03FC0F07FE0 +19F018FFA25FA34D13E0A219C05FA219805FA24D1300A34D5AA260177FA26017FFA24C5B +A34C5BA2605EA2605EA24C90C7FCA34C5AA25F167FA25F16FFA24B5BA34B5BA25F5DA25F +5DA24B90C8FCA34B5AA25E157FA24B5AA34A5BA25E5CA25E5CA24A5BA34A90C9FCA25D14 +3FA25D147FA24A5AA3495BA25D5BA25D5BA2495BA34990CAFCA25C133FA25C137FA2495A +A3485BA25C5AA25C5AA2485BA34890CBFCA25B123FA25B127FA2485AA35BA25B127F6C5A +6C5A3C9077EB4F>47 D<ED1FFE0203B512F0020F14FC027FECFF8091B77E010316F04982 +498249824982498390B5D8FC0F80EDF00348DAC00080484A6D7F92C77E48844A8048844A +80A248844A80A34884A44819804A80A7B518C0B3AF6C1980A46E5CA46C1900A46C606E5C +A26C606E5CA26C606E5C6C6E495B6F90B5FC6C6E485C6F5A6CDAFC0F5C6D90B75AA26D94 +C7FC6D5E6D5E010316F06D5E6D6C1580021F4AC8FC020314F09126001FFEC9FC426A7AE6 +4F>I<ED03F8ED07FE150F4B7E5D92B5FC1403140F147F011FB6FC001FB7FC127FA2B8FC +A57E14EF381FF80FC7FCB3B3B3B10007B812F84817FE5A4817FFA56C17FEA2000717F838 +6775E64F>I<913801FFF0021FEBFF8091B612E0010315F84915FE011F6F7E49824916F0 +90B87E488348834883481880A24818C048020115E09138F8003F4801E0010F14F04A7F4A +6D14F8B5C77E5B7014FC5B007F826C5A001F18FE6C4881A212076C5A12016C488190C9FC +A25FA419FC5FA394B512F8A219F05E19E05E4C14C019805E19004C5B4C5B4C5B6093B55A +4B5C4B5C4B91C7FC4B5B4B5B4B5B5F4B5B92B55A4A5C4A49C8FC4A5B4A5B4A5B4A5B4A5B +91B55A4991C9FC495B495B5D495B495B495B495B90B5CAFC485B4813F8485B4890B812F0 +4818FC5A4818FEAA6C18FC7E6C18F03F6779E64F>I<EDFFFE020FEBFFE0027F14FC49B7 +FC010716C04982013F16F8498248B87E48835A4884488448ECC03F9138FC000F02F06D80 +02C07F6C497F6C90C7FC01FC83120749806C5A6C5A6C5A90C9FCA35EA361A25EA24C5CA2 +4C5CA24C91C7FC4C5B4C5B4BB5FC031F5C020FB65A4A15C06095C8FC17FCA2EFFF8018E0 +18F818FE6E8191C7003F14C00407800401807080838583858385A3711480AE00184C1400 +123E123F6D5D487E6D4B5B13F801FE92B5FC6D6C495CB500F05B9126FF801F5C92B7FC61 +6C607E6C606C60000395C7FC6C17FC6C6C5E011F16E00107168001004BC8FC021F14F002 +0149C9FC416A79E64F>I<93381FFFFC4C13FF5E8593B6FCA25DA25DA25D5DA25DA24B5A +A24B5AA215FF5E5C5C5E5C5E5C5E5C5E5C5E5C5D14FF495BA2495BA2495BA2495BA2495B +A2495B5B92C7FC90B5FC5C5A5C485BA2485BA2485BA2485B5A5C5A91C8FCB5FC91B912E0 +1AF8A21AFCA86C19F8A2001F19E0C90001EC8000B37091C7FCA2EF3FFC46647CE34F>I< +013FB87E90B912E05A85A961A2198003C0CAFCB3A29238C3FFC092B512FCEFFF8018E018 +F88418FF858585A2040380DBF000804B7F4B8192C77E854A805C855C6C5BD93FE08090C9 +FC1A80B0487E487E486C4B1400120F7F487E003F5E6D5F486C5DB5FC6E91B55A02E05B02 +F801075C6C9038FF803F6C91B75A6C60A26C606C60000195C7FC6C5F6D16F8011F5E6D16 +C0010393C8FC010015FC021F14E0020101FCC9FC41677BE34F>I<EE7FFC0307B57E037F +14E04AB67E020781141F5C91B7FC5B5B130FA25B49ECF00749EC800090B548C7123003F8 +91C7FC485C5D485C5D5A92CAFC5A5C5AA25CA25AA25CA2481508923801FFFC030713FF03 +1F14C04B14F04A488092B612FEB500F18102F3168014F719C091B812E0EDF803DBE00014 +F04B15F84B7F92C76C13FCA24A8019FE5CA3834A16FFA55CA77EA380A57EA36E4A13FE7E +A36C7F4D13FC806C5E6F15F86C6E90B5FC6F4814F06CECF80F92B712E07E19C06D17806D +17006D5E6D5E6D5E01015E6D16C0023F5D020F4AC7FC020314F0DA003F90C8FC406A79E6 +4F>I<001FB912FC007F18FFA2BB1280A91A007E61001F60CA00075B4D5B5F4D5B4D5B94 +B5FC614C91C7FC5E4C5B605E4C5B4C5BA24C5B93B5FC605D4B5CA24B91C8FCA24B5BA24B +5B5D5F5D5F92B5FCA25F5C5F5CA24A5CA34A91C9FCA25C5EA25CA25EA25CA25E91B5FCA4 +495CA6495CA75B5EAD6D5CA2010049CAFC416679E34F>I<92B5FC020F14F0027F14FE49 +B77E010716E0011F16F84982498290B9FC481880A24818C04818E0EDE00748DA800114F0 +92C7FC4A8048496E13F8A34A80A24818FCAB6C18F8A36E5C6C18F0A26C6D4A13E0A26C6D +91B512C06CDAC00314806C91B712006D5E6D5E010F16F0010316C0010093C7FCA2010316 +C0010F16F0013F16FC498248B9128048DAC00314C0484A6C14E04AC77E48496E13F04818 +F84A804818FCA348496E13FEA3B517FFAE6C18FEA26E5CA36C18FC6E5C6E5C6C6D91B512 +F86F5A6CDAF00F14F092B7FC6C18E0A26C18C06C18806C18006D5E6D5E6D5E010716E001 +0116806D6C4AC7FC020F14F09126007FFEC8FC406A79E64F>I<EDFFFE020FEBFFC0027F +14F849B612FE4981010F16C049824982498290B87E48834883481880EDF01F48DAC00714 +C0ED0003486F14E04A7F48496E13F0A24A804818F8A37113FCB55AA419FEA383A419FFA7 +5FA56C5E80A35F7E6E91B6FCA26C6D5B6E5B6C5DEDC01F6C91B8FC6C16EF7E17CF6C168F +6D150F011F02FE14FE6D14FC01034A5A6D14E0D9003F1380913800300092C7FC19FCA25F +A319F85FA219F094B5FCA24C14E0A201304A14C001785C01FE4A14806D5C4801C0017F14 +00DAF807B55A4890B7FC485F60485F60606C5F6C4CC7FC6C5E6C6C15F06D15C0010F92C8 +FC010114F8D9001F90C9FC406A79E64F>I<91383FFFF00103B67E011F15F090B712FC00 +0382000FEEFF80003F17C04817E0B912F018F8A26CD9F80114FC9138C0007F49C76C13FE +6C488013F0496E13FF6C5A5B90C8FC7EC9FCA55EA24C13FEA25E93B512FC5D4B14F85D18 +F04B14E04B14C04B14005F4B5B92B512F05F4A5C5F5C94C7FC4A5B5E5C5EA25E5C5EA25E +5CA35EAC91CAFCABEC1FFF027F13C0A291B57EAD6E5B806E90C8FC386677E54B>63 +D<041FB57E047F14E093B67EA24B81A24B81A34B81A34B81A34B82A34B01FB8017F3A24B +82A292B500E180A34A02E0805FA24A834D7EA24A834D7EA24A834C7FA24A84845E4A8484 +5E4A84845E91B583A24C7F4985A24C7F4985A24C804985A293C87E4985A249496F80A349 +496F80A292BAFC4986A390BC7EA34887A34887A3480280C96C7FA2864891CA80A24A8348 +1C80A24A83481CC0A24A83481CE0A24A83B51BF0A24A834A836C497213E06C90CC001F13 +C05C647AE369>65 D<94383FFFFC040FB612F093B8FC030717E0033F17FC92BAFC020319 +80140F5C147F91BBFC491A005B5B5B499238FC003F49038013014902FCC8EA3FFE04F015 +0F90B600C01503484B150193CA127E484A173C4B171C484A94C7FC5D485CA25D5A5DA248 +91CDFCA35C5AA25CA4B5FCA25CB280A27EA480A27E80A36C80A2817E81A26C80816C6EEF +01806FEF07C06C6E170F70163F6C6F167F6D02F0ED01FF04FC150F6DDAFF80027F13E06D +03FC0107B5FC6D92B8FC7F7F7F7F80021F19C06E19800203F0FE00020018F8033F17E003 +07178003004CC7FC040F15E0DC003F01FCC8FC536A77E665>67 D<001FB812F048EFFFC0 +4818FCBB7E1AF01AFC86747E871BF087878702F8C7000381DD001F810603811800073F80 +070F80857380857380868886A2747FA2861D80A286A21DC0A286A51DE0B3A21DC0A462A2 +1D80A262A21D0062A2505BA26297B55A614F5C614F5C4F5C197F4EB65A061F5D0503B7C7 +FC91BA5A636363631B8098C8FC1AFC1AF01A806C4EC9FC6C18E06C05F8CAFC5B6473E372 +>I<001FBA12804819E05ABB12F0AA1AE0A29126F8000F158093CAFCB3A991B812C019F0 +A285A861A219C002F8CBFCB3B3A46C5B7E6C13C0446473E358>70 +D<94383FFFF8040FB612E093B712FE0307EEFFC0033F17F092B912FC020318FF020F19C0 +4A19E0147F91BBFC5B5B491AC05B499238FC003F49038013014902FCC8123F04F0150F90 +B600C003031380484B8193CAFC484A173F4B171F484AEF0F004B83484A94C7FCA2485CA2 +5DA24891CDFCA35C5AA25CA4B5FCA25CAC0607B612F04E15F8A580A27EA480846C94C77E +80A36C80A281A26C80A26C80816C80816C80826C816D14F016FC6DECFF806D03FC011FB5 +FC6D92B8FC7F7F7F7F80141F6E19F0020319C002001900033F17FC030717E003004CC7FC +040F15E0DC003F01F8C8FC556A77E669>I<261FFFC0943807FFF04801F0051F13FC5AB5 +6C4D13FEB3B3A291BBFCAE02F8CA123FB3B3A66C497113FC7E6C01C0050713F0576473E3 +72>I<381FFFC04813F05AB512F8B3B3B3B3B3A46C13F07E6C13C0156473E32F>I<381FFF +C04813F05AB57EB3B3B3B3A994381FFFE091B812F819FC19FEAA6C18FC7E6C18F03F6473 +E353>76 D<261FFFFE97387FFFFC486D6C4EB6FC486E60B66C4E1580A26F60A26F60A36F +60A26F60A36F95B7FCA2705E02BF1AFDA2705E029F1AF9705EA2028F1AF1705EA202876D +4C13E1A302836D4C13C1A2705E02811A81A27093B5FC02801A01A2715C6F18FE715C6F18 +FCA2715C6F18F8715CA26F18F0715C6F18E0715CA26F18C0715C6F18807191B5FCA26F18 +00725A705EA2725A705E725A705EA2725A705EA2725A705EA2706D485BA3706D485BA270 +93C7FCA295B6FC715CA2715CA3715CA2715CA3715CA2715CA2715C7191C8FCF03FFC6C90 +CF14007ED81FFCF43FFC716473E38C>I<4CB5FC047F14FC0303B77E031F16F092B812FE +0203717E020F18E04A84027F18FC91BA7E4985498649DBC007814902FCC76C804902F002 +1F804902C00207804991C80001804B8190B548707F484A707F4B82484A701480A2484A70 +14C04B82A24891CA6C14E0A2481CF04A83A3481CF84A84A3481CFCA34A84A4B51BFEB3A3 +6C1CFC6E60A66C6D95B512F8A46C6D4D14F0A36C6E4C14E0A26F5E6C1CC06F5E6C1C806F +5E6C6E4C1400A26C6E4C5B03FF4BB5FC6D6E4A5C6D6E4A5C6D02F0021F5C04FE91B6FC6D +9126FFC0075D6D92B85A6D6201004FC7FC6E606E60020F18E00203188002004DC8FC033F +16F8030716C0DB007F02FCC9FC040191CAFC5F6A77E672>79 D<001FB812C04817FF4818 +E0BA12FC19FF1AC0861AF886868687A202F8C7000381DD003F80180F06038084848785A2 +8587AB6361A296B55AA2604E5C180F063F5C0503B65A91BAFC98C7FC62621AF0621A804F +C8FC19F096C9FC859138F800077080A27080858285838583717F85838683867180838683 +868486727FA2727F848784877280A272808487737FA2737FA2737FA27314806C49701400 +7E6C01C004015B516473E365>82 D<001FBD1280481CE05ABE12F0AA6C1CE0A2001FDAE0 +0FDA803F1480C993C9FCB3B3B3B3A87091CAFC827013FC5C637AE269>84 +D<261FFFC0EF3FFF4801F094B512C05AB56C4C14E0B3B3B3B16C6D4C14C0A56C6D4C1480 +A2616C6D19006F5D6C6E4B5B616C02F092B55A6F14036C02FF020F5C6C03F090B65A6C92 +B8FC636D616D61010F96C7FC6D18FC6D60010018E0023F1780020F4CC8FC020116F8DA00 +3F1580030002F0C9FC536773E36E>I<D83FFF4DB56CEF7FF04801C0040702E0933801FF +F86E4C6E5EB54D4F13FC6E856C22F84F6188806C5613F0616E856C22E06996B6FC6E856C +22C04E621AFD6E866C22804E01FC95B5FC50806C6E1F0068606F4C6C7F6C6968606F4C6C +7F6C694E61A26F4C6C7F6D684E61896D6D4C6C6068606F856D4E6C606895B5FC6F856D4D +6D60685F6D6D716E5D619DB5FC5F6D0280706E92C7FC614D61A26D02C07101E05C614D61 +1EF06D02E04A6E5EA2676E4A06F85C04F04A80A2676E4A7001FC5C04F85CA2676E4A705E +96C814FE16FC6E525B4E8105FF18FFA26E6D644E6F5CA293B596B5FC6E7393C8FC60A36E +745C60A26E654E82A36F735C60A26F4A705C6F91CA6C5C030749050114808E647DE395> +87 D<92B512C0021F14FC91B77E010716E0011F16F8017F8248B9FC48188019C0A2DBF0 +0F14E09126FE000314F002F87F02C06D14F86C5B49C87E5B4917FC49815B6C5A90C9FCA7 +043FB5FC033FB6FC0207B7FC147F0103B8FC130F013F15BF90B6EAC03F48ECFC004814F0 +000F14C04891C7FC5C485B485BA25CB5FCA25CA35FA26E91B5FCA25E6C6D5B806E130F6C +6D5B03C0B6FC6C91B7FC17BF6C163F6C15FE6C15FC6C15F86C4B6C13F8013F14C06DDA00 +0713E0010701FC90C8FC010013E03E477CC44B>97 D<381FFF804813E05AB57EB3ABEE7F +F80303B57E031F14E0037F14F892B612FE02F38102F78291B87E858585EDF00FDB800180 +4AC7FC4A6E7F4A804A6E7FA2831A8083A57114C0B31A805FA45F1A00A25F616E5C6E4A5B +6E91B5FC6E01035CEDE01F92B75A61616196C7FC02F715FC6C01E35D6C01E015E06CD980 +7F1480C8001F01FCC8FC030313C0426678E350>I<92383FFFE00207B6FC023F15C091B7 +12F8010316FE49EEFF80011F17C04917E05B90B9FC5A5A9226FC007F13C04802E0130748 +4A13014BEB007F4891C8123F4A151FF00F804849150395C7FCA2485BA45CB5FCB26C7FA4 +806C18C0F003E06E15076C170F6E151F6C6E147F6F903801FFF06C6E130F03FC90B5FC6C +91B7FC7E7E7F6D17E06D17C0010717006D16FC010016F0023F1580020702FCC7FCDA003F +13803C477BC446>I<F07FFE4DB51280A24D14C0B3AB913801FFE0021F13FC91B6FC0103 +15C3010F15E34915FB4992B6FC90BAFC5AA25A48ECFE019238F0003F4802C0130F4B7F48 +91C77E5C5A5CA25A5CA4B55AB3A26C7FA56C7FA2806C5E6E5C6F5B6C6E5B6F90B6FC6CEC +FC036C91B8FCA27E7E6D15FB011F15F36D03C11480010315810100913AFE007FFE00023F +01F890C8FC020313C042667BE350>I<92383FFFC00203B512FC021F14FF027F15C049B7 +12F0010716FC4982013F8249178090B912C05ADBFE0314E0489126E0007F13F0484A7F92 +C76C13F848824A6E13FC485B83484916FEA283485BA219FFA25CB5FCA28391B9FCA519FE +A219F802E0CAFCA66C7FA47E80A26C18186E167C6C6D16FC18016C6D15076F141F6C02E0 +EC7FFE03F8EB03FF6C02FF133F6C92B6FC7F7F6D17FC6D17F8010317E001001780023FED +FE00020F15F002011580DA000F01F0C7FC40477CC449>I<92380FFFE092B512FE0207EC +FF80021F15C0147F91B7FC5B5B5B5B5B1680499038FE001F4B130F4949130717034BEB01 +8094C7FC90B5FCB2001FECFFFC4815FF5AB87EA56C93C7FCA2001F15FCC602F0C8FCB3B3 +B06D5B7F6D138032667DE530>I<92B515FE021F02F8EB0FFF91B7137F010304C1B5FC49 +16E7011F93B6FC4919805B90BBFC48189F48DAF00FECC07FDBC003ED0700484A6C6EC7FC +92C7FC48496E7FA34A804884AC6C606E5CA36C6D91B55A6F5A6C6E485CEDF00F6C91B75A +6C95C8FC6D5E6D5E495E18E090B85A01FC93C9FC0001011F14F8020091CAFC92CCFC1203 +7FA27F8014E091B712C018FEF0FFE019F86C18FE851AC06C85867F8648BA7E120748855A +5A4801E0C712010280DA000F7F91C91203B5824982A285A46D94B5FCA26C6D4B5B6E5D6E +5D6C01F8031F5B02FE157F6CD9FFF0010FB55A6C91B85A6C616C616C616C6C4DC7FC6D5F +010F17F001011780D9003F03FCC8FC020092C9FC49637DC34F>I<381FFF804813E05AB5 +7EB3AB93380FFF80047F13F84BB512FE0307804B15C0033F15E04B15F092B7FC02F116F8 +14F302F716FC16019139FFF8007F15E04B6D13FE5D92C7FC835C5CA25CA45CB3B3A46C49 +6E13FC7E6C0180020313F03F6478E350>I<381FFFC04813F05AB512F8AE6C13F0A2001F +13C0C8FCAF380FFFC04813F05A4813F8B3B3B3A66C13F07E6C13C0156579E425>I<ED7F +FF4AB512C0A24A14E0AE6E14C0A26E6C130092C8FCAFED3FFF92B512C0A24A14E0B3B3B3 +B3A35C17C000185B123E387FC01F90B71280A21700B8FC5EA25E6C5D6C5D000715C00001 +5DD8003F01FCC7FC010113E02B838BE429>I<EA1FFC48B4FC5AB57EB3AD94383FFFC094 +B512E05E5E5E4C14C04C14804C14004C5B4BB512F84B5C4B5C4B5C4B5C4B91C7FC4B5B92 +B55A02815C02835C02875C028F5C02BF91C8FC91B55A5E5E5E5EA28282A2828282A28383 +8314FC4A804A6C7F4A6C7F14C04A6C7F4A6C7F6F80A26F806F806F80A2707F707F707FA2 +707F7014807014C0A27014E07014F07113F8A26C4881003F7013F0D81FF8030713E03D64 +77E34C>I<381FFF804813E05AB512F0B3B3B3B3B3A46C13E07E6C1380146478E325>I<93 +2607FFC0ED7FFCD81FFF027F01FC0207B512C048D9C001B6021F14F04802076F017F80B5 +6C4803E090B612FE4B6F4881037FDBF807168092B75B02E1704816C002E35F07FE17E002 +E7010192387FF01F9127EFF8007F9138FF800703E06D4A487EDAFFC06D6D486D14F04B5E +92C75D71824A5F4A5FA34A5FA34A94C8FCB3B3A46C496E496F13E06C70836C01806E01F8 +6F13806C4478C37D>I<93380FFF80D81FFF027F13F848D9C001B512FE48020780B56C48 +15C0033F15E04B15F092B7FC02E116F814E302E716FC16019139EFF8007FECFFE04B6D13 +FE5D92C7FC835C5CA25CA45CB3B3A46C496E13FC7E6C0180020313F03F4478C350>I<92 +381FFFE00203B6FC021F15E0027F15F849B712FE0107707E49834983017F17F890B97EA2 +48DAFC00804802F0013F7F4802C0010F14804B7F4891C76C14C04A8048496E14E0A34849 +6F13F0A34819F84A81A4B518FCB06C19F8A26E5DA36C19F06E92B5FCA36C6D4A14E06E5C +6C6E4914C06F5B6C02F0013F148003FC90B6FC6C91B812006C606C606D5F6D5F6D5F0107 +17806D94C7FC010016FC021F15E0020392C8FCDA001F13E046477CC44F>I<EE1FFC4BB5 +12C0271FFF800F14F048D9E03F14FC4891B67EB500F16F7E02F78291B87E85A28585EDF0 +1FDB8003804AC7FC02F8804A8283831A8083A3831AC0A383B05F1A80A35FA34D1400A25F +616E5C6E91B55A6E5B6E01075CEDE03F92B75A61616196C7FC02F715FC02F35D02F015E0 +6F1480031F01FCC8FC030313C092CBFCB3A56C5B7E6C1380426078C350>I<912601FFE0 +EB7FFE021FD9FC01B51280027F13FF0103B6008314C04915C3011F15F34915FB5B90BAFC +5A5A5A1601489138F8007F03E07F484A7F4B7F4891C77EA24A805A5CA25CA3B5FCA25CAF +80A27EA380A27E805F6C7F6F5B5F6C02E05B6C6E90B6FCEDFE076C91B8FC7EA27E013F15 +FB6D15F36D15C3010315830100ECFE03021F13F8020113C091C8FCB3A5711480A2943900 +7FFE0042607BC350>I<EE1F80D81FFFECFFC048EBC003485CB5EAE01F5D5D92B5FC14E1 +A214E314E7A214EF178091B5EAF00093C7FC15FC15F05D5D5D92C8FCA25C5CA25CA45CB3 +B06C5B7E6C13802A4478C335>I<91383FFFC00103B512FE011FECFFC04915F090B712FE +48824817805A5A5AA248D9F00114009138C0001F4A130716014890C8FC83171E170E94C7 +FC8080A214F014FEECFFF06CECFF8016F016FE6C8117C06C8217F86C826C826C826C7E6D +16806D16C01307010116E0EB003F1401DA000F14F01500163F82A2001881003C81123E12 +3F487E7F01F05C6D16E001FE5CD9FFC05BB5D8FC01B5FC91B712C0A21880A26C17006C5E +000F5E000316F0C65E011F158001034AC7FCD9001F13E034477CC43C>I<90380FFF8049 +13E05B497FB0001FB712F04816FC5AB87EA56C5EA2001F16F0C66C01F0C8FCB3B3A281A2 +170C173E6F137E6D4AB4FCEDFE0F92B6FC1880A27FA26D160017FC6D15F06D15C001004A +C7FC6E13F0DA1FFEC8FC31577DD43A>I<261FFF80913803FFF04801E0020F13FC5AB56C +4A13FEB3B3A75FA35FA294B5FCA25E5E6C7F5E6E131F6C01FFEB7FDF92B5FC6C169F171F +6C15FE00034B6C13FC6C15F06C6CDAE00313F0011F0280C8FC010101FCC9FC3F4478C150 +>I<D83FFCDB07FC923801FFC0486CDB1FFF030713E06D4B6D5CB56C4A6D4A13F0806C1D +E094B56C5CA2806C724A13C05E806C1D807391B5FC5E806C1D004C6E5BA2806C4C6D495B +160F806C64726C5BEE1FFC806C64043F6F5A84038013F86C73485B167FA26D01C0496C5E +745A16FF816D4B6C5E03E1705AA215F16D4B6C6DB55A15F3A26D01FB96C7FC4D6C13FD92 +B5FCA26D624D6C90B5FCA36D705D5EA26D62855EA26D624C80A26E496E5C6E496E5C020F +49020391C8FC64427DC16B>119 D<D83FFCEE3FF848B4EE7FFEB56C15FF6E5C5F6C7FA2 +6C6D4A13FCA2806C4C13F8807E4D13F06C7FA26C6D4A13E0A2816C4C13C0A26C8094B512 +806D7F19006D6D5AA26D5E15F85E6D5E15FC6D5C03FE5C7FA26D6D485BA36D5E169F8060 +8016DF6E5D93B5FCA26E92C7FCA2805F80A26E5CA2805FA2815F81A26F5BA2815F5DA25F +5DA294C8FC5D5EA215FF5E5C4A5B00305B007C495B007E5B267FC07F5B90B65AA25E93C9 +FC5D6C5C5D15E05D92CAFC6C13FC000313E03F607CC148>121 D +E /FC 1 98 df<157015F8A34A7EA24A7EA34A7E81A291380E3F80A2021E7FEC1C1FA24A +6C7EA34A6C7EA202F07FECE003A249486C7EA349486C7EA201078091C77EA249B67EA249 +81011CC7121FA2013C810138140FA2496E7EA201F081491403120183486C140100074B7E +D81FF84A7EB5027F13F8A335357CB43D>97 D E /FD 9 117 df<007FB512E0A3B612C0 +A31B067C9721>45 D<90261FFFF094B512C06F198062D9003F9439037FC000021F4EC7FC +1A06DA19FC5F1A0CA21A18DA18FE1619023817310230601A611AC1157FF1018314700260 +93380303F8A26F6C1406A2F10C0714E002C004185B6F7E193019601A0F010117C04A6C6C +5EF00180A2F003006F6C151F0103160602006060606F7E4E133F5B01064C5CA26F6C5BA2 +4D48137F130E010C4BC790C8FCED00FE17065F62011C5D0118027F5D5FA25FDC3FE01301 +01385D6201785D94C7FCD801FC6E1403D807FF021E4A7EB500F80307B512FE161C4A010C +5E5A447BC359>77 D<EC1FF0ECFFFE903903E03F8090390F000FC0011C6D7E496D7E017E +80017F1301D9FF807FA414005B133C90C7FCA21503A24AB45A143F903801FFC390380FF8 +0390383FE007EBFF802601FE005B485A485A485A4848130F123F49ECE030127F5B151FA2 +00FF91383FC06090C7FC6C6C137F15EFDA01CF13C03A3FC00387E03B1FE00707E1803B07 +F03E03FF003A01FFF801FE3A003FC000F82C2E7BAC31>97 D<EC07F8EC3FFF9138FC07C0 +903903F000E0D90FC013704948133849C712FC017E13034913071201485A12074914F800 +0F15F04848EB01E092C7FC485AA3127F5BA412FF90C9FCA67EA2166016E06C6C14C01501 +001F15806D1303000FEC07006C6C130E6C6C133C6C6C137039007E03E090381FFF80D903 +FCC7FC262E7AAC2B>99 D<EC0FF0EC7FFC903801F83F903907E00F8090391F8007C0D93F +0013E0017EEB03F05B0001EC01F8485AA2485A120F4914FC121F5B123F16F8A2485A90B6 +FCA20180C8FCA212FF90C9FCA57EA3166016E06C15C06D1301001FEC03806D1400000F5C +6C6C131E6C6C13386C6C13F039007E03C0D91FFFC7FCEB03FC262E7AAC2B>101 +D<EC3F80EB1FFFA25B1300147FA292C8FCA55C5CA513015CA513039138F801FE92380FFF +8092383E0FE092387007F09138F9E003902607FB8013F8ECF70002F6130114FE5C4A1303 +130F5CA25CA21607131F4A14F0A4160F133F4A14E0A4161F137F91C713C0A4163F5B4915 +80A30001157F486CECFFC0B5D8FC3F13FFA330457DC436>104 D<143C14FEEB01FFA25B +A3EB01FE14FCEB00781400ADEB03F8EA01FFA3EA000F130714F0A5130F14E0A5131F14C0 +A5133F1480A5137F1400A55B5BA31201487EB512F8A318437DC21C>I<902703F801FEEC +3FC0D801FF903B0FFFC001FFF848913B3E07F007C0FE923B7003F80E007FD8001FD9E001 +497F902607FBC0D9FC781480DAF70014E002F6010049131F02FE14FD4AECFF804A4990C7 +123F130F4A5CA24A5CA3011F0203157F4A4A1500A5013F02075D4A4A5CA5017F020F1401 +91C7495CA549021F1403494B5CA30001033F1407486C4A6C497EB5D8FC1FB50083B512F0 +A34C2C7DAB52>109 D<14C0A313015CA21303A21307A249C7FCA25B5B5B5B485A120300 +1FB512F0B6FCA2C648C7FC12015BA512035BA512075BA5120F5BA215C0A3001FEB018013 +C0A414031500A25C1406000F130E6D5A00075B6C6C5AC6B45AEB3F801C3E77BC26>116 +D E /FE 31 121 df<4CB414FC040F9039C003FF80933B3F81F00783C0933B7C00781F01 +E04C9038F83F03923C01F001FC3E07F003030103EB7E0F922607E007EB7C1F19FCDB0FC0 +01F814E0943A03F0F80FC0DD01E1EB0780031FD9000190C7FC5E180361153F93C7FCA218 +07615D157EA2180F6115FE91B912F0A3DA00FCC7D81F80C7FC1401A25D183F96C8FCA214 +035DA260187E14075DA218FE60140F5DA2170160141F5DA2170360143F92C7FCA2170760 +5C147EA2170F6014FE5CA24D5AA2495A95C9FC5F5C0103153E177E001CEBE038007F02FE +137C26FF07E114FC02C15C4C5AEB0F8100FE903901FC03E0D8F81F9038F007C03B701E00 +E00F80D8783CD9F83ECAFCD81FF0EB3FF8D807C0EB0FE04C5A83C53C>11 +D<EF7FF80407B5FC93391FC00FC093393E0001E004FCEB00F04B4813014B4813075E0307 +140FA24B5A19E0031FEC03804C90C7FCA3153F93C9FCA45D157EA415FE91B8FCA260DA00 +FCC7127E020115FE4B5CA317016014035D170360A214074B130760A3020F140F4B5CA317 +1F021F5D5DA2053F13E01801023F16C092C7FCA2EF7F03057E13805C027E15071900173E +180E02FEEC1E1E4AEC1F1CEF07F8EF01E094C8FC495AA35C1303A2001C5B127FEAFF075C +A2495A00FE90CBFCEAF81FEA701EEA783CEA1FF0EA07C03C5A83C537>I<13F0EA03F8EA +07FC120FA6EA03CCEA001C1318A213381330A2137013E013C0120113801203EA0700120E +5A5A5A5A5A0E1D6BC41E>39 D<120FEA3FC0127FA212FFA31380EA7F00123C0A0A76891E +>46 D<ED3FC0913801FFF0913807C07C4AC67E021CEB1F800278130F4AEB07C0494814E0 +4A1303494814F0130749C7FCEB0E06D91E0714F8EB1C03133C1338137813704A1307D9F0 +0614F013E0140E020C130F0001011C14E0EBC0180238131F4A14C06C6C48EB3F80D9E1C0 +137FD97F801400013EC712FE90C7485A4B5A4B5A4B5AED1F804BC7FC15FC4A5AEC03E0EC +0FC0023FC8FC147CEB01F0495AEB0780011FC9FC133E49EC03805B49140748481500485A +48485C90C8121E5A001E5D001C157CD83FFC5C9038FFC0013A7C0FFC07F0D87803B55AEA +700126F0007F5B486D90C7FCEC0FFEEC03F82D4478C132>50 D<EE1FF04BB5FC923907E0 +0FC092393E0001F003F8EB0078DA01E0141CDA0780804AC87E021CED0380027816C04A15 +014948ED00E0495A4948167049C7127E011E902603FFC01378011C90260F81E01338013C +90383E00704901FC7F90267001F87F494848151C000149487F494848EB0FE00003494814 +F00180ED07E0000749C7FCEB007E48160F000E4915C0121E381C01F8051F133CD83C03EE +803800385BA2053F1378D87807EE007000705BA24D13F0057E13E012F012E0EFFE0105FC +13C0A204011303010302031480933807F80700F06D010F1400D87001021F5B6E013D130E +010002795B027C01F0133C007890263E07C05B0038903A0FFF007FE0DA01F8EB1F80003C +90CBFC121C121E120E7E7F6C6C16FC6C6C15036C6CED1FE0017803FFC7FC011EEC0FF890 +3A0FC003FFC00101B500F8C8FC9026003FFEC9FC3E4772C54B>64 +D<91B912C0A30201902680000313806E90C8127F4A163F191F4B150FA30203EE07005DA3 +14074B5D190EA2140F4B1307A25F021F020E90C7FC5DA2171E023F141C4B133C177C17FC +027FEB03F892B5FCA39139FF8003F0ED00011600A2495D5CA2160101034B13705C19F061 +010791C8FC4A1501611803010F5F4A150796C7FC60131F4A151E183E183C013F167C4A15 +FC4D5A017F1503EF0FF04A143F01FF913803FFE0B9FCA26042447AC342>69 +D<91B56C93387FFFC08298B5FC02014DEBC0006E614A5FA203DF4C6CC7FC1A0E63912603 +CFE05D038F5F1A381A711407030FEEE1FCA2F101C3020FEE0383020E60F107036F6C1507 +021E160E021C60191CF1380F143C023804705BA2F1E01F0278ED01C091267003F85EF003 +801A3F02F0ED070002E0030E5CA24E137F130102C04B91C8FC606201036D6C5B02805F4D +5A943803800113070200DA07005BA2050E1303495D010E606F6C5A1907011E5D011C4B5C +A27048130F133C01384B5C017892C7FC191F01F85C486C027E5DD807FE027C4A7EB500F0 +0178013FB512C0A216705A447AC357>77 D<48B912F85AA2913B0007FC001FF0D807F84A +130701E0010F140349160148485C90C71500A2001E021F15E05E121C123C0038143F4C13 +01007818C0127000F0147F485DA3C800FF91C7FC93C9FCA35C5DA314035DA314075DA314 +0F5DA3141F5DA3143F5DA3147F5DA314FF92CAFCA35B5CA21303A21307497E007FB612C0 +A25E3D446FC346>84 D<023FB5D8C003B512E0A21780020001F8C7387FFC006F48EC3FE0 +6F48158097C7FC031F153E705C1978030F15E07013014E5A03074A5A7091C8FC180E0303 +5C705B187803015C70485A606FEB83800587C9FC178FEE7FDE17FC5F705A5F161F83A216 +0F4C7EA2163FEE77FC16F7ED01E3923803C3FEED07831601030E7F151CED3C004B805D4B +6D7E4A5A4A5A4AC76C7E5C141E4A6E7E14384A140F4A81495A01031507494881130F133F +017F4B7E2603FFC04A7E007F01F849B512FEB5FC614B447CC348>88 +D<EC1F80EC7FE0903901F07070903907C039F890380F801D90381F001F013E6D5A137E5B +484813075E485A120749130F000F5DA2485A151F003F5D5BA2153F007F92C7FC90C7FCA2 +5D157E12FEA29238FE0380EDFC071700A2007E13015E913803F80E1407003E010F131E16 +1C6C131C02385B3A0F80F078783A07C3E07C703A01FF801FE03A007E000780292D76AB32 +>97 D<EB0FE0EA07FFA338001FC0130F131FA25CA3133F91C8FCA35B137EA313FE5BA312 +015BEC1F80EC7FE03903F9E0F89038F3C07C9038F7003E13FE48487F5BA2491480485AA2 +5BA2121F5BA2153F123F90C7FCA2157F481500127EA25D5D5AA24A5AA24A5AA2007C5C4A +5A140F5D4A5A003C49C7FC003E137E001E5B6C485A380783E03803FF80C648C8FC214676 +C42D>I<EC0FE0EC7FF8903801F81E903807E00F90390F80078090381F0003017E14C049 +131F0001143F5B4848EB7F801207485AED3E00484890C7FCA2485AA2127F90C9FCA35A5A +A45AA5ED0180ED03C0ED0780A2007CEC0F00007E141E003E147C15F06CEB03E0390F800F +802607C07EC7FC3801FFF838007FC0222D75AB2D>I<EE07F0ED03FFA39238000FE01607 +160FA217C0A2161FA21780A2163FA21700A25EA2167EA216FEA25EEC1F80EC7FE1903801 +F071903907C039F890380F801D90381F001F013E130F017E5C5B48481307A248485C1207 +49130F120F5E485A151F123F495CA2153F127F90C790C7FCA25DA200FE147EA29238FE03 +80160703FC1300A2007E13015E913803F80E1407003E010F131E161C6C131C02385B3A0F +80F078783A07C3E07C703A01FF801FE03A007E0007802C4676C432>I<EC0FE0EC7FF890 +3801F83E903807C00F90391F800780EB3F00017E14C0491303485A48481307000715805B +000F140F484814005D4848133E15FCEC07F0007FEBFFC0D9FFFEC7FC14C090C9FC5A5AA5 +5AA4ED0180ED03C0007CEC0780A2007EEC0F00003E141E157C6C14F06CEB03E03907800F +802603C07EC7FC3801FFF838003FC0222D75AB2D>I<15FCEC03FF91390F83838091393E +01CFC091387C00EF4A13FF4948137F010315804948133F495A131F4A1400133F91C75A5B +167E13FE16FE1201495CA215011203495CA21503A2495CA21507A25EA2150F151F5E0001 +143F157F6C6C13FF913801DF8090387C039F90383E0F3FEB0FFCD903F090C7FC90C7FC5D +A2157EA215FEA25DA2001C495A127F48495A14074A5A485C023FC8FC00F8137E387C01F8 +381FFFE0000390C9FC2A407BAB2D>103 D<14FE137FA3EB01FC13001301A25CA21303A2 +5CA21307A25CA2130FA25CA2131FA25C157F90393F83FFC091388F81F091381E00F80238 +7F4948137C5C4A137EA2495A91C7FCA25B484814FE5E5BA2000314015E5BA2000714035E +5B1507000F5DA249130F5E001F1678031F1370491480A2003F023F13F0EE00E090C7FC16 +0148023E13C01603007E1680EE070000FEEC1E0FED1F1E48EC0FF80038EC03E02D467AC4 +32>I<143C147E14FE1301A3EB00FC14701400AE137C48B4FC3803C780380703C0000F13 +E0120E121C13071238A21278EA700F14C0131F00F0138012E0EA003F1400A25B137EA213 +FE5B12015BA212035B141E0007131C13E0A2000F133CEBC038A21478EB807014F014E0EB +81C0EA0783EBC7803803FE00EA00F8174378C11E>I<16F0ED03F8A21507A316F0ED01C0 +92C7FCAEEC01F0EC07FCEC1E1EEC380F0270138014E0130114C0EB03800107131F1400A2 +130E153F131E011C140090C7FC5DA2157EA215FEA25DA21401A25DA21403A25DA21407A2 +5DA2140FA25DA2141FA25DA2143FA292C7FCA25C147EA214FE001C5B127F48485A495AA2 +48485A495AD8F81FC8FCEA707EEA3FF8EA0FC0255683C11E>I<EB03F8EA01FFA3380007 +F013031307A214E0A2130FA214C0A2131FA21480A2133FA21400A25BA2137EA213FEA25B +A21201A25BA21203A25BA21207A25BA2120FA25BA2121FA25BA2123FA290C7FCA2387F01 +C01303007E1380A2130700FE130012FCA25B130EEA7C1E131CEA3C3CEA3E786C5AEA07C0 +154678C419>108 D<D801F0D90FE0EB07F0D803FCD97FF8EB3FFC28071E01F03EEBF81F +3E0E1F03C01F01E00F80271E0F8700D983807F001C018E90390F870007003C019C148E00 +3801B802DC8002F814FC26781FF05C0070495CA24A5C00F0494948130FD8E03F6091C75B +1200043F141F4960017E92C7FCA24C143F01FE95C7FC49147E6104FE147E1201494A14FE +610301EE0780000305011400494A14F8A2030302035B0007F0F00E495C1A1E0307EDE01C +000F193C494A153862030F020113F0001FF0F1E0494A903800FF800007C7D80380023EC7 +FC492D78AB50>I<D801F0EB0FE0D803FCEB7FF83A071E01F03E3A0E0F03C01F001ED987 +001380001C018E130F003C139C003801B814C014F838781FF000705BA25C00F049131FD8 +E03F158091C7FC1200163F491500137EA25E01FE147E5B16FE5E12014913015E170F0003 +0203130E4914F0A20307131E0007EDE01C5B173CEEC038000F167849157017E0ED03C100 +1FEDE3C049903801FF000007C8127C302D78AB37>I<EC0FE0EC7FFC903801F83E903907 +E00F8090390F8007C0EB1F00017EEB03E04914F0A248481301484814F81207485AA2485A +A2485A1503127F90C7FCA215074815F05AA2150F16E05AED1FC0A21680153F16005D157E +5D007C495A007E495A003E5C4A5A6CEB1F80260F803EC7FC3807C0FC3801FFF038003F80 +252D75AB32>I<D903E0137E903A07F801FF80903A0E3C0783E0903A1C1E0F01F0903A3C +1F1C00F801385B017849137C01705BA24A48137E01E05BA292C7FC00015B13C0147EC7FC +02FE14FEA25CA20101140117FC5CA20103140317F85CA20107EC07F0A24AEB0FE0A2010F +15C0EE1F80163F1700496C137E5E4B5A9138B803F090393F9C07E091389E0F80DA07FEC7 +FCEC01F849C9FCA2137EA213FEA25BA21201A25BA21203A21207B512F0A25C2F3F7FAB32 +>I<91381F800C91387FE01C903901F0703C903907C0387890390F801CF890381F001D01 +3E130F017E14F05B48481307A2484814E012075B000F140F16C0485AA2003F141F491480 +A3007F143F90C71300A35D00FE147EA315FE5DA2007E1301A24A5A1407003E130FA26C49 +5A143B380F80F33807C3E73901FF87E038007E071300140F5DA3141F5DA3143F92C7FCA2 +5CA25C017F13FEA25D263F76AB2D>I<D801F0EB3F803A03FC01FFF03A071E03C0F83A0E +0F0F007C001E90389E01FC001C139CECB803003813F0A2D91FE013F80078EC00E0007049 +1300A200F05BEAE03F91C8FC1200A25B137EA313FE5BA312015BA312035BA312075BA312 +0F5BA3121F5B0007C9FC262D78AB29>I<EC0FE0EC7FF8903801F01E903803C00F903907 +80078090380F0003011E14C0150749131FA2017CEB3F801378137CED0E0092C7FC137E13 +7F14F014FF6D13C06D13F06D7F6D7F1300EC0FFE14011400157F81120E003F141E487EA2 +153E48C7123CA200FC5C12705D0078495A6C495A6CEB0F80260F803EC7FC3803FFF83800 +7FC0222D7AAB28>I<1470EB01F8A313035CA313075CA3130F5CA3131F5CA2007FB512E0 +B6FC15C0D8003FC7FCA25B137EA313FE5BA312015BA312035BA312075BA3120F5BA2EC07 +80001F140013805C140E003F131EEB001C143C14385C6C13F0495A6C485AEB8780D807FE +C7FCEA01F81B3F78BD20>I<137C48B414072603C780EB1F80380703C0000F7F000E153F +121C0107150012385E1278D8700F147E5C011F14FE00F05B00E05DEA003FEC0001A2495C +137E150313FE495CA215071201495CA2030F13380003167849ECC070A3031F13F0EE80E0 +153F00011581037F13C06DEBEF8300000101148090397C03C787903A3E0F07C70090391F +FE01FE903903F000782D2D78AB34>I<017CEE038048B4020EEB0FC02603C780013FEB1F +E0380703C0000E7F5E001C037E130F01071607123804FE130300785DEA700F4A1501011F +130100F001804914C012E0EA003FDA000314034C14805B137E0307140701FE1700495CA2 +030F5C0001170E495CA260A24848495A60A2601201033F5C7F4B6C485A000002F713036D +9039E7E0078090267E01C349C7FC903A1F0781F81E903A0FFF007FF8D901FCEB0FE03B2D +78AB41>119 D<02F8133FD907FEEBFFE0903A0F0F83C0F0903A1C07C780F890393803CF +03017013EE01E0EBFC07120101C013F8000316F00180EC01C000074AC7FC13001407485C +120EC7FC140F5DA3141F5DA3143F92C8FCA34AEB03C01780147EA202FEEB0700121E003F +5D267F81FC130E6E5BD8FF83143CD903BE5B26FE079E5B3A7C0F1F01E03A3C1E0F83C027 +1FF803FFC7FC3907E000FC2D2D7CAB2D>I E /FF 12 117 df<EA03E0EA0FF0EA1FF8EA +3FFC127FA3EAFFF8A2EA7FF013E0EA3FC0EA0F000E0D738C25>46 +D<EF1FFC0403B57E040F14F093397FE007FCDB01FEC7127EDB07F0EC1F80DB1FC06E7E4B +C8EA03E003FC6F7EDA01F06F7E4A48167CDA0FC0824ACA121E023E171F4A834A18804948 +02FF14074948010701C014C04948011F01F013034A90387F81F8010F902701FE007C14E0 +90271F0003F86D1301013E49487F013CD91FE07F017C49481480494948010714F04949C7 +EBFC000001717E49485A0003495A4948485D120749485A000F17074948485D5A001E4948 +1601060F14E0003E017F16F0003C5CA2061F1303007C01FF04E013C0007891C8FCA2063F +130700F806C0138048485AA2067F130F07801300A262010004FF131E19004D143E6E173C +5F6E4A485B170F6E6C011F5C6C043F130100786D6C017D5C91270FE001F9495ADC03E049 +5A007C902703F81FC0011FC7FC003C6DB538007FFE9126007FFCEB1FFC003EDA0FE0EB07 +E0001E91CCFC121F6C7E12077F6C7E6C6CEF1FC06C6C177F017CDC03FFC7FC6DEE1FF86D +6C913801FFE0D90FE0021F90C8FCD903FE90380FFFF00100B7C9FC023F14F0020301F8CA +FC4C556ED35C>64 D<15FE913807FF80021FEBC0F091397F83F1F89139FE00F3FCD903FC +13FF4948137F49486D5A495A4948131F49485C13FF91C7FC5A48485DA2485A163F000F5E +5B121F167F003F5E5BA216FF007F93C7FC5BA25D5E485AA215039338FC01E05BA2030713 +03007F03F813C0A2150F031F13071880003FEC3FF06D017F130F001F02FF1400DA01F75B +3B0FE003E3F81E2707F00FC3133E3B03F83F01FC7C3B01FFFE00FFF826007FF8EB3FF0D9 +1FC0EB0FC0333574B33D>97 D<EB03FEEA03FF5AA27EEA00076D5AA21307A25CA2130FA2 +5CA2131FA25CA2133FA25CA2137FA25CA213FFA291C9FCEC01FC48903807FF80021F13E0 +9039FE7F07F09138F803F8486C486C7E14E04A6C7E4A7F4890C7FC4980491580A2485AA2 +5B16FF121FA25BA2003F5CA25BA2007F5C17005BA25D5E48C7FCA24B5AA25E48141F5E4B +5A127E5E4B5A007F14FF6C92C7FC4A5A4A5A6C6C485A6C6C485AEC1FC03907F07F802601 +FFFEC8FC6C13F8EB1FC0295473D237>I<ED7F80913807FFF0021F13FC91387FC0FE9039 +01FE003F49487FD90FF014804948130F495A495A13FF4890C7FC485A0007151F49150000 +0F5D49147E001F15FE4B5A4848EB07F0ED7FE091387FFF8048B500FCC7FC15E00280C8FC +01E0C9FC12FF5BA45BA7007FED0180EE03C01607EE0F80003F151F6DEC3F00001F157E6D +EB01F8000F4A5A6C6CEB0FE06C6CEB3F802701FC03FEC7FC6CB512F8013F13C0D907FCC8 +FC2A3573B337>101 D<ED03F8ED1FFE92397FFF83C0913A01FE0FC7E0913A07F803CFF0 +91390FF001FFEC1FC0023F6D13E04A5A4AC7127F495A010316C0495AA2495A1880495A01 +3F15FFA24A1500137F5E13FF4A5CA216035A4A5CA21607A291C75B5A160FA25F6C5A161F +A24C5AA20000157F16FF6D495B6D5B5D6D6C5A6D6C486C5A90380FE0FE903907FFF8FF01 +0113E09026003F8090C7FC91C7FC5DA25EA21503A25EA215075E000F140FD83FC05C007F +141F00FF5D4B5A4B5A4BC8FC49485A90380007F86CEB1FF06CB512C0000F49C9FC000113 +F0344C7AB337>103 D<EC3FE0EB3FFF5BA27FEB007F6E5AA2147FA25DA214FFA292C9FC +A25BA25CA21303A25CA21307A25CA2130FA25CED07FC011FEB3FFF92B512C09139E1FC0F +E09139E7E007F090263FEF807F9138FF00034A805C495A4A13015C1603495AA25C91C7FC +4815075F5BA20003150F5F5BA20007151F5F5B163F000F5EA249147F5F121F04FF133C49 +1500A2003F4A147C4C13784913034C13F8007F17F0A249ED01E016F800FFEE03C0170790 +C7EC0F800301EB1F00923800FC3E48EDFFFC48ED3FF00078ED0FC0365477D23D>I<15F0 +EC03F8EC07FC140FA315F8A215F0EC03C091C7FCB1EB07E0EB1FF8EB7FFCEBF87E3801E0 +3FEA03C0000714801380380F007F5A121EA24813FF1500127CEA78015CEAF803A200005B +13075CA2130F5CA2131F5C133F5CA2137F5CA201FF133C1400A248147C49137812034913 +F815F0A2EC01E013F8EC03C01407EC0F800001EB1F003800FC3EEBFFFCEB3FF0EB0FC01E +5077CE25>I<ECFF8090B5FC5AA27E13016D1300A25BA25CA21303A25CA21307A25CA213 +0FA25CA2131FA25CA2133FA25CA2137FA25CA213FFA291C7FCA25AA25BA21203A25BA212 +07A25BA2120FA25BA2121FA25BA2123FA25BA2127F143C1380A200FF137C14781300A214 +F85C5A13015C1303007F5B1307383F8F806CB4C7FCEA07FEEA01F8195475D21F>108 +D<ED3FE0913801FFFC020713FF91391FE03F8091397F801FE0903A01FE000FF049481307 +4948EB03F8494814FC49481301494814FE495A13FF4890C713FFA2485A12075B120FA248 +5A5E123F5BA25E007F16FE5BA2160F17FC5B00FF16F8161FA2EE3FF0007F16E05BEE7FC0 +17806D14FF003F4A13005E4B5A6C6C495A000F4A5A6D495A0007EC3F806C6C01FFC7FC39 +01FE03FC39007FFFF0011F13C0D903FCC8FC303574B33D>111 D<023F147F913AFFC001 +FFE049D9F00713F8903B03E3F81FC1FCD907C190383E00FE912681FC7C137FD90F015BDB +FFF0EB3F80011E4A14C05E013E4A131F013C91C713E0A24A5A137C01785B183FEBF807A2 +01005BA2020F157FA25DA2021F15FF19C05DA2023F5C19805DA2027F4A1300A24B5C1707 +02FF5D4D5A92C7FC60496D495A173F606F495A494BC7FC6F485A02FD495A9238F007F090 +3A07FCFC1FE092387FFF809126F81FFEC8FCED07F0010F90CAFCA25CA2131FA25CA2133F +A25CA2137FA25CA213FF487F007FEBFF80B67EA26C5C3B4B7FB33D>I<EC0380EC0FE014 +1FA2143FA25DA2147FA25DA214FFA292C7FCA25BA25CA21303A25CA2007FB61280B7FCA2 +7E26000FF8C7FCA25CA2131FA25CA2133FA25CA2137FA25CA213FFA291C8FCA25AA25BA2 +1203A25BA21207150F5B5D000F141EA249133E153C5D15F8495B14014A5A4A5A6C6C485A +4AC7FC3803F87E6CB45A38007FF0EB1F80214C76CA28>116 D E +/FG 2 106 df<EC01C0EC03E0A2140715C0A2140F1580A2141F15005C143EA2147E147C +A214FC5C13015CA213035C13075CA2130F5CA2131F91C7FC5B133EA2137E137CA213FC5B +12015BA212035B12075BA2120F5BA2121F90C8FC5A123EA2127E127CA212FC5A7E127CA2 +127E123EA2123F7E7F120FA27F1207A27F12037F1201A27F12007F137CA2137E133EA213 +3F7F80130FA2801307A2801303801301A280130080147CA2147E143EA2143F801580140F +A215C01407A215E01403A2EC01C01B7974D92E>104 D<127012F8A27E127CA2127E123E +A2123F7E7F120FA27F1207A27F12037F1201A27F12007F137CA2137E133EA2133F7F8013 +0FA2801307A2801303801301A280130080147CA2147E143EA2143F801580140FA215C014 +07A215E01403140715C0A2140F1580A2141F15005C143EA2147E147CA214FC5C13015CA2 +13035C13075CA2130F5CA2131F91C7FC5B133EA2137E137CA213FC5B12015BA212035B12 +075BA2120F5BA2121F90C8FC5A123EA2127E127CA212FC5AA212701B797AD92E>I +E /FH 17 118 df<120C123F487E7F12FF7F6C7EA26C7E6C7EEA07FE12036C7E6C1380EB +7FC0131FEB0FE0EB07F0EB03F81300147C143C1418161774D33C>18 +D<EA0F80EA3FE0EA7FF0A2EAFFF8A313FCA2127FA2123FEA0F9CEA001CA5133C1338A313 +78137013F013E01201A2EA03C013801207EA0F00121E123E123C12180E24768C21>44 +D<EC0780140F141F143F14FF1307133F000FB5FCB6FC13F913C1EAF0011200B3B3B3A849 +7F010F13F0B8FCA4285075CF3C>49 D<EC7FE0903803FFFE010FEBFFC0013F8049C613F8 +01FCEB1FFED803F06D7E490103138048486D13C0484815E048C8FC001EED7FF0123E003C +ED3FF8127C007816FC161FB47E01E015FEA26D140FA66C5A6C48141F0006C8FCC913FCA3 +EE3FF8A2EE7FF0A217E016FF4B13C017804B13005E15074B5A5E4B5A4B5AED7F8093C7FC +15FE4A5A4A5A4A5A4A5A4A5A4A5A92C8FC147C4A140E495A495A4948141E4948141C49C8 +FC131E5B5B49153C485A4848157848B712F85AA25A5A5AB812F0A42F507ACF3C>I<0003 +166001C0EC03E001F8141F903AFFC001FFC091B6128017005E5E5E5E16C093C7FC15FC01 +CF13E001C0C9FCAFEC0FF891B5FC01C314C09039C7F80FF09039CF8007F89039DE0003FC +01FC6D7E496D7E49EC7F804915C049EC3FE0A249EC1FF0C9FC17F8A3EE0FFCA417FEA412 +06EA3F80EA7FE012FF7FA317FC5BA249141F90C813F812701278EE3FF01238003C16E06C +ED7FC016FF6C16806D491300D807E0495A6C6C495AD801FCEB1FF83A00FF807FE0013FB5 +5A010F91C7FC010313F89038007FC02F537ACF3C>53 D<EC0FF8EC7FFF0103B512C09039 +07F80FF090391FE003F890393F8001FE49C77E01FE6E7E0001153F48486E7E484881000F +150F83485A707E123F83485AA283A200FF1503A283A71880A4007F5DA46C7E5E121FA200 +0F5D7F00075D6C6C143B0001157B6C6C14F3017FEB01E390393F8003C390271FE0078313 +006DB51203010313FE9038007FF091C7FC4C5AA45FA24C5AA35FD807F0141F486C5D486C +143F5F4C5AA24CC7FC4B5A495C6C48495A0180495A0007EC1FE001E0495A3A03FC01FF80 +6CB548C8FC6C6C13F8011F13E0010390C9FC31537BCF3C>57 D<DC1FFC14074BB512C003 +0F02F05B037F02FC5B913A01FFFC00FF4A01C090381FC03FDA0FFEC73807E07FDA3FF891 +3801F0FF4A486E7EDAFFC0157D4949153F010790C97E4948824948825C013F83495A4948 +8285485B48855C5A91CB7E5AA2484884A3485AA286127FA34995C7FCA212FFAE007F0403 +B7FCA27FA294C7003F13C0003F060F1380731300A26C7EA36C7EA27E807E807E6C7FA26D +7E6D7E6D7E616D7E6D6C5E010113C06D6D153E6E6C5DDA3FFC4B7EDA0FFF913803F03F02 +0301E090380FE01F6E01FC90387FC0076E6CB6C67E030F02FC90C7FC030114E09226001F +FEC9FC505879D45E>71 D<0103B71280A490C7003FEBC000030F5B6F90C7FCB3B3B3A2EA +1FC0487E487E487EA45E150F5B5E6C48131F01805C003CC7FC003E4A5A6C4A5A6C6C5C6C +6C495A2603F00190C8FC3901FE07FE39007FFFF86D13E0D907FEC9FC31557BD13D>74 +D<EB7FC0B5FCA41203C6FC137FB3A6ED07FC92383FFFC092B512F09139C3F80FFC9139C7 +C001FE02DFC76C7E02FCEC3FC04A6E7E4A81170F4A6E7E4A81170384717EA31980A283A2 +19C0AB1980A25FA21900A24D5AA26017076E4A5A6E5D4D5A02784A5A6E4A5AD97E1F4AC7 +FC903A7C0F8003FE913903F01FF8D97801B512E0902670007F138090C7D80FF8C8FC3A54 +7DD242>98 D<EC0FFC91B57E010314E090390FFC0FF890391FE003FC4948C67E49C7127F +01FEEC3F80000116C04848EC1FE0485A000FED0FF05B001F150717F8485AA2127FEE03FC +5BA212FFA290B7FCA301C0C9FCA7127F7FA2123FA2171C6C7EA26C6C153C000716386D15 +78000316F06C6CEC01E06C6CEC03C06D6C13076D6CEB0F80D90FF0EB7E00903907FE03FC +0101B55A6D6C13C0DA07FEC7FC2E367DB435>101 D<EB7FC0B5FCA41203C6FC137FB3A6 +ED03FE92381FFFC0037F13F09139C1F80FFC9139C3E003FE9139C78001FFECCF0002DE6D +7F14FC5C717E5CA25CA35CB3AC496C4A7E486D497FB600E0B612E0A43B537CD242>104 +D<137C48B4FC487FA2487FA56C5BA26C90C7FCEA007C90C8FCB0EB7FC0B5FCA41203C6FC +137FB3B3A3497E487FB612C0A41A517CD022>I<9039FF8003FEB590381FFFC0037F13F0 +913981F80FFC913983E003FE00039039878001FFC6EB8F00D97F9E6D7F14BC14B802F86E +7E5CA25CA35CB3AC496C4A7E486D497FB600E0B612E0A43B347CB342>110 +D<EC03FE91383FFFE091B512F8903903FE03FE903A0FF0007F80D91FC0EB1FC0D97F80EB +0FF001FEC7EA03F848486E7EA248486E7E0007824848ED7F80A24848ED3FC0A2003F17E0 +A249151F007F17F0A300FF17F8AB007F17F0A36D153F003F17E0A2001F17C06D157F000F +17806C6CEDFF00A26C6C4A5A6C6C4A5A6C6C4A5A6D6C495A6D6C495AD90FF0EB7F809027 +07FE03FFC7FC0101B512FCD9003F13E0020790C8FC35367DB43C>I<90397FC007FCB590 +383FFFC092B512F09139C3F80FFC9139C7C003FE000101DFC76C7E6C01FC6E7E6D486E7E +4A81171F4A6E7E4A81170784717EA3711380A47113C0AB4D1380A44D1300A26017076017 +0F6E4A5A6E5D4D5A6E4A5A6E4A5A02DF4990C7FC9139CF8007FE9139C3F01FF802C1B512 +E0DAC07F1380DB0FF8C8FC92CAFCB0497E487FB612E0A43A4B7DB342>I<D907FE13E090 +383FFFC148B512F33903F801FF390FC0003F4848131F48C7120F003E1407007E1403127C +150112FC1500A27E7EA201C014007FEA7FFCEBFFE06C13FF15E06C14F86C14FE0003806C +15806C6C14C0011F14E0010114F0EB000F020013F8151F00E0EC0FFC150715036C1401A2 +15007EA36C15F8A26C14016C15F06D1303ED07E001E0EB0FC0D8FDF0EB1F80D8F8FEEBFF +0090383FFFFCD8F00F13F0D8E001138026367CB42F>115 D<D97FC0EC7FC0B591B5FCA4 +00031503C61500017F157FB3AC17FFA45EA2013F5C5E6E147F011F020F7F6D6C011E13F8 +6D6C013CEBFFE0903903FE01F86DB512E06D6C1380912607FE00EBC0003B357CB342> +117 D E /FI 80 124 df<9239FFC001FC020F9038F80FFF913B3F803E3F03C0913BFC00 +077E07E0D903F890390FFC0FF0494890383FF81F4948EB7FF0495A494814E049C7FCF00F +E04991393FC0038049021F90C7FCAFB912F0A3C648C7D81FC0C7FCB3B2486CEC3FF0007F +D9FC0FB512E0A33C467EC539>11 D<4AB4FC020F13E091387F80F8903901FC001C49487F +D907E0130F4948137F011FECFF80495A49C7FCA25B49EC7F00163E93C7FCACEE3F80B8FC +A3C648C7FC167F163FB3B0486CEC7FC0007FD9FC1FB5FCA330467EC536>I<127C12FC7E +7EA26C7E6C7E6C7E120F6C7E6C7E1200137C7F131E7FEB0380EB0100111275C431>18 +D<D907F8EC3FC0D93FFF903801FFF0903BF80FC007E0FC3C03C003F00F803F3D070001F8 +1F001F80000E902600FC3EEB0FC0D80FC0D97E7C14E0486CD97FF813076D013F15F05EF0 +03F8151F5E6C5AD80380EE01FCC8FC5EA40207B7FC49B8FC90270FFE1FC0C8FCEB3FC0EB +FF00EA03FC485AEA1FF05B48486D7E485AA212FF90C76D140CA2191C4B6C141819386DD9 +3EFC1430007FDA7C7E14706D496C14E0003F903B01F01F8001C03D1FE003E007C007803D +07F80F8003F01E002601FFFEC7EAFFF826001FF0EC1FE03E2E7CAC46>26 +D<001EEB03C0397F800FF000FF131F01C013F8A201E013FCA3007F130F391E6003CC0000 +EB000CA401E0131C491318A3000114384913300003147090C712604814E0000614C0000E +130148EB038048EB070048130E0060130C1E1D7DC431>34 D<1438A549B4FC010F13E001 +3F13F89038FE38FED801F0EB0F80D807E0EB03C001C0EB01E0D80F801300D81F00147000 +3E15301638481518A2007815FC00F814031507A47EED03F8ED01F06C91C7FC127E127F13 +80EA3FC013F0EA1FF8EBFFB86C13F86CEBFF806C14E06C14F86C6C7F6D13FF0107148013 +00023F13C0023813E0ED3FF0151F150FED07F81503150116FC001C1400127FEAFF80167C +A413005A00E01578006015F8A2007015F000301401003815E0003C1403001CEC07C0000F +EC0F80D80780EB1F00D803E0137E3901FC39FC39007FFFF0011F13C0D903FEC7FCEB0038 +A526517BCA31>36 D<121EEA7F8012FF13C0A213E0A3127FEA1E601200A413E013C0A312 +011380120313005A1206120E5A5A5A12600B1D78C41B>39 D<140C141C1438147014E0EB +01C01303EB0780EB0F00A2131E5BA25B13F85B12015B1203A2485AA3485AA348C7FCA35A +A2123EA2127EA4127CA312FCB3A2127CA3127EA4123EA2123FA27EA36C7EA36C7EA36C7E +A212017F12007F13787FA27F7FA2EB0780EB03C01301EB00E014701438141C140C166476 +CA26>I<12C07E12707E7E7E120F6C7E6C7EA26C7E6C7EA21378137C133C133E131E131F +A2EB0F80A3EB07C0A3EB03E0A314F0A21301A214F8A41300A314FCB3A214F8A31301A414 +F0A21303A214E0A3EB07C0A3EB0F80A3EB1F00A2131E133E133C137C13785BA2485A485A +A2485A48C7FC120E5A5A5A5A5A16647BCA26>I<121EEA7F8012FF13C0A213E0A3127FEA +1E601200A413E013C0A312011380120313005A1206120E5A5A5A12600B1D78891B>44 +D<B612C0A61A067F9721>I<121EEA7F80A2EAFFC0A4EA7F80A2EA1E000A0A78891B>I<16 +18163C167CA2167816F8A216F01501A216E01503A216C01507A21680150FA2ED1F00A215 +1E153EA2153C157CA2157815F8A25D1401A24A5AA25D1407A25D140FA292C7FC5CA2141E +143EA2143C147CA25CA25C1301A25C1303A25C1307A25C130FA291C8FC5BA2133EA2133C +137CA2137813F8A25B1201A25B1203A2485AA25B120FA290C9FC5AA2121E123EA2123C12 +7CA2127812F8A25A126026647BCA31>I<14FF010713E090381F81F890383E007C01FC13 +3F4848EB1F8049130F4848EB07C04848EB03E0A2000F15F0491301001F15F8A2003F15FC +A390C8FC4815FEA54815FFB3A46C15FEA56D1301003F15FCA3001F15F8A26C6CEB03F0A3 +6C6CEB07E0000315C06D130F6C6CEB1F806C6CEB3F00013E137C90381F81F8903807FFE0 +010090C7FC28447CC131>I<143014F013011303131F13FFB5FC13E713071200B3B3B049 +7E497E007FB6FCA3204278C131>I<EB03FE90381FFFC0017F13F03901F80FFC3903C001 +FE48486C7E000EC7EA7F8048EC3FC0ED1FE04815F00030140F007015F800601407126CB4 +15FC7F7F1503A46C4813076CC7FCC8FC16F8A2150F16F0151F16E0A2ED3FC0ED7F801600 +5D5D4A5A4A5A4A5A5D4A5A4A5A4AC7FC147C5C5C495A495A495A49C7120C131E5B013814 +185B5B485A4848143848C81230000E1570001FB612F0A25A5AB712E0A326427BC131>I< +49B4FC010F13E0013F13FC9038FE01FE3A01F0007F80D803C0EB3FC048C7EA1FE0120EED +0FF0EA0FE0486C14F8A215077F5BA26C48130FEA03C0C813F0A3ED1FE0A2ED3FC01680ED +7F0015FE4A5AEC03F0EC1FC0D90FFFC7FC15F090380001FCEC007FED3F80ED1FC0ED0FE0 +16F0ED07F816FC150316FEA2150116FFA3121EEA7F80487EA416FE491303A2007EC713FC +00701407003015F80038140F6C15F06CEC1FE06C6CEB3FC0D803E0EB7F803A01FE01FE00 +39007FFFF8010F13E0010190C7FC28447CC131>I<ED0380A21507150FA2151F153FA215 +7F15FFA25CEC03BF153F14071406140C141C141814301470146014C013011480EB03005B +13065B131C13185B1370136013E0485A5B120390C7FC1206120E120C5A123812305A12E0 +B812C0A3C8383F8000ADEDFFE0027FEBFFC0A32A437DC231>I<000615C0D807C0130701 +FCEB7F8090B612005D5D5D15E0158026063FFCC7FC90C9FCAE14FF010713C090381F01F0 +90383800FC01F0137ED807C07F49EB1F8016C090C7120F000615E0C8EA07F0A316F81503 +A216FCA5123E127F487EA416F890C712075A006015F0A20070140F003015E00038EC1FC0 +7E001EEC3F806CEC7F006C6C13FE6C6C485A3901F807F039007FFFE0011F90C7FCEB07F8 +26447BC131>I<EC07FCEC3FFF91B512C0903903FC03E0903907E000F0D91FC0133849C7 +1258017EEB01FC01FE1303491307485A485AA24848EB03F8000FEC01F092C7FC485AA348 +5AA3127FA29038007F80903801FFF090380780FC39FF0E003E49EB1F8049EB0FC049EB07 +E0136001E0EB03F04914F8150116FC5BED00FEA390C812FFA47EA57F123FA216FE121F15 +016D14FC120FED03F86C7EED07F06C6C14E06C6CEB0FC06C6CEB1F80017EEB3F0090383F +80FE90380FFFF8010313E00100138028447CC131>I<121CA2EA1F8090B712C0A3481680 +A217005E0038C8120C0030151C00705D0060153016705E5E4814014B5A4BC7FCC8120615 +0E5D151815385D156015E04A5AA24A5A140792C8FC5CA25C141E143EA2147E147CA214FC +A21301A3495AA41307A6130FAA6D5AEB01C02A457BC231>I<14FF010713E0011F13F890 +387F00FE01FC133FD801F0EB1F804848EB0FC049EB07E00007EC03F048481301A290C713 +F8481400A47FA26D130116F07F6C6CEB03E013FC6C6CEB07C09039FF800F806C9038C01F +006CEBF03EECF87839007FFEF090383FFFC07F01077F6D13F8497F90381E7FFFD97C1F13 +80496C13C02601E00313E048486C13F000079038007FF84848EB3FFC48C7120F003EEC07 +FE150148140016FF167F48153FA2161FA56C151E007C153EA2007E153C003E157C6C15F8 +6DEB01F06C6CEB03E06C6CEB07C0D803F8EB1F80C6B4EBFF0090383FFFFC010F13F00101 +138028447CC131>I<14FF010713E0011F13F890387F80FC9038FC007E48487F4848EB1F +804848EB0FC0000FEC07E0485AED03F0485A16F8007F140190C713FCA25AA216FE1500A5 +16FFA46C5CA36C7E5D121F7F000F5C6C6C1306150E6C6C5B6C6C5BD8007C5B90383F01E0 +90390FFF80FE903801FE0090C8FC150116FCA4ED03F8A216F0D80F801307486C14E0486C +130F16C0ED1F80A249EB3F0049137E001EC75A001C495A000F495A3907E01FE06CB51280 +C649C7FCEB1FF028447CC131>I<121EEA7F80A2EAFFC0A4EA7F80A2EA1E00C7FCB3A512 +1EEA7F80A2EAFFC0A4EA7F80A2EA1E000A2B78AA1B>I<121EEA7F80A2EAFFC0A4EA7F80 +A2EA1E00C7FCB3A5121E127FEAFF80A213C0A4127F121E1200A512011380A3120313005A +1206120E120C121C5A5A12600A3E78AA1B>I<007FBAFCBB1280A3CEFCB0BB1280A36C19 +0041187BA44C>61 D<16C04B7EA34B7EA34B7EA34B7EA3ED19FEA3ED30FFA203707FED60 +7FA203E07FEDC03FA2020180ED801FA2DA03007F160FA20206801607A24A6D7EA34A6D7E +A34A6D7EA20270810260147FA202E08191B7FCA249820280C7121FA249C87F170FA20106 +821707A2496F7EA3496F7EA3496F7EA201788313F8486C83D80FFF03037FB500E0027FEB +FFC0A342477DC649>65 D<B8FC17E017FC00019039C00003FF6C6C4801007FEF3FC0717E +717E717E84170384170184A760A21703601707604D5A4D5AEF7FC04DC7FCEE03FEEE3FF0 +91B65A17FC0280C7B47EEF1FC0EF0FF0717E717E717E717E1980187F19C0A2183F19E0A8 +F07FC0A2198018FF4D1300A24D5AEF0FFC4D5AEF7FE048486C903803FFC0B9C7FC17FC17 +C03B447CC345>I<DB0FFE146092B500C013E0020314F0913A0FFC01FC0191393FC0003E +02FFC7EA0F83D903FCEC03C74948EC01E74948EC00FF4948157F4948153F4948151F49C9 +120F485A491607120348481603A248481601A248481600A2123FA2491760127FA3190048 +5AAE6C7EA21960A2123F7FA2001F18E07F000F18C0A26C6C160119806C6C160312016DEE +07006C6C16066D6C150E6D6C5D6D6C5D6D6C15786D6C5D6D6C4A5AD900FFEC0780DA3FC0 +011FC7FCDA0FFC13FC0203B512F0020014C0DB0FFEC8FC3B487BC546>I<B8FC17F017FC +00019039C00007FF6C499038007FC0017FED1FE0EF07F0EF03FC717E717E84727E727E72 +7EA2727E85180385A2180185A38584A31A80AD1A00A36061A361180361180761180F614E +5A183F614EC7FC18FEEF03FC4D5AEF1FE001FFED7FC0486DD907FFC8FCB812FC17F094C9 +FC41447CC34B>I<B912F8A3000101C0C7127F6C6C48EC07FC17011700187C183C181CA2 +84A31806A4180704067FA395C7FCA4160EA2161E163E16FE91B5FCA3EC8000163E161E16 +0EA21606A319C0A3F0018093C7FCA41803A21900A260A260A2181EA2183E187EEF01FE17 +0748486C147FB95AA33A447CC342>I<B912F0A3000101C0C7127F6C6C48EC0FF8170317 +01170018781838A2181CA3180CA4180E1806160CA21800A5161CA2163C167CED01FC91B5 +FCA3EC8001ED007C163C161CA2160CA793C8FCB08048487EB612F8A337447CC340>I<DB +0FFE146092B500C013E0020314F0913A0FFC01FC0191393FC0003E02FFC7EA0F83D903FC +EC03C74948EC01E74948EC00FF4948157F4948153F4948151F49C9120F485A4916071203 +48481603A248481601A248481600A2123FA2491760127FA396C7FC485AAD4CB612C06C7E +A293C7387FF000725A003F171F7FA2121F7F120FA26C7EA26C7E6C7EA26C7E6D7E6D6C15 +3F6D7E6D6C157F6D6C15E7D903FEEC01C7D900FFEC0383DA3FE0EB0F01DA0FFCEBFE0002 +03B500F81360020002E090C7FCDB0FFEC9FC42487BC54D>I<B6D8C003B6FCA3000101E0 +C70007138026007F80913801FE00B3A991B7FCA30280C71201B3AC2601FFE0913807FF80 +B6D8C003B6FCA340447CC349>I<B612F0A3C6EBF0006D5A6D5AB3B3B3A4497E497EB612 +F0A31C447DC323>I<B600C049B512C0A3000101E0C8387FFC006C49ED3FE06D48168006 +3EC7FC183C183860604D5A4D5A4DC8FC171E17385F5F4C5A4C5A4CC9FC160E5E5E5E5E4B +5A4B7E4B7E150F4B7E4B7E1577EDE3FE913881C1FFEC8381DA87007F028E6D7E149C02B8 +6D7E02F06D7E14C04A6D7E707EA2707E707EA2707F717EA2717E717EA2717E717EA2717E +717EA2717F8585496C82486D4A13FCB600C0011FEBFFE0A343447CC34C>75 +D<B612F8A3000101E0C9FC6C6C5A5CB3B31830A418701860A518E0A3EF01C0A217031707 +A2170F173F177FEE01FF48486C011F1380B9FCA334447CC33D>I<B56C933807FFFC6E5E +A20001F1FE0026006FE0EE1BF8A3D967F01633A2D963F81663A3D961FC16C3A3D960FEED +0183A2027FED0303A36E6C1406A36E6C140CA26E6C1418A36E6C1430A36E6C1460A26E6C +14C0A36E6CEB0180A3037FEB0300A292383F8006A36F6C5AA36F6C5AA26F6C5AA36F6C5A +A36F6C5AA26FB45AA370C7FC13F0A2486C143ED80FFFEF0FFEB500F0011C0107B512FCA3 +4E447BC359>I<B56C020FB5FC8080C6040013F06D6CED1F80D96FF8ED0F00A2D967FC15 +06EB63FEA2EB61FF01607FA26E7E6E7EA26E7E6E7EA26E7E6E7EA26E7E6E7FA26F7E6F7E +A26F7E6F7EA26F7E6F7EA26F7E6F1380A2EE7FC0EE3FE0A2EE1FF0EE0FF8A2EE07FCEE03 +FEA2EE01FF701386A2EF7FC6EF3FE6A2EF1FF6EF0FFEA217071703A217011700A201F016 +7E183E487ED80FFF161EB500F0150EA2180640447CC349>I<ED1FFC4AB512C0913907F0 +07F091391F8000FC027EC7123FD901F8EC0FC049486E7E49486E7E49486E7E49486E7E49 +C9127E017E8201FE834848707E4848707EA24848707EA2000F84491603001F84A2484870 +7EA3007F84A24982A300FF1980AD6C6C4C1300A4003F606D1603A2001F60A26C6C4C5AA2 +6C6C4C5AA20003606D161F6C6C4C5A000060017F4CC7FC6E5D013F5E6D6C4A5AD907E0EC +03F06D6C4A5AD901FCEC1FC0D9007E4AC8FCDA1F8013FC913907F007F00201B512C09126 +001FFCC9FC41487BC54C>I<B712FCEEFFC017F800019039C0000FFC6C6C48EB01FF9338 +007F80EF1FE0170FEF07F018F8EF03FCA218FE1701A218FFA718FEA2170318FCA2EF07F8 +18F0EF0FE0EF1FC0EF7F80933801FE00EE0FFC91B612F017800280C9FCB3AA3801FFE0B6 +12C0A338447CC342>I<B712E016FF17C000019039C0003FF86C6C48EB03FCEE00FF717E +717E717E717E717EA284170384A760A21707604D5AA24D5A4D5A4DC8FCEE01FEEE07F8EE +3FE091B6C9FC16FC913980007F80EE0FE0707EEE03FC707E160083717EA2717EA784A71A +6084171FA21AE0716C13C02601FFE002071301B600C01680943801FC03943900FE0700CB +EA3FFEF007F843467CC348>82 D<49B41303010FEBE007013F13F89039FE00FE0FD801F8 +131FD807E0EB079F49EB03DF48486DB4FC48C8FC4881003E81127E82127C00FC81A282A3 +7E82A27EA26C6C91C7FC7F7FEA3FF813FE381FFFE06C13FE6CEBFFE06C14FC6C14FF6C15 +C0013F14F0010F80010180D9001F7F14019138001FFF03031380816F13C0167F163F161F +17E000C0150FA31607A37EA36C16C0160F7E17806C151F6C16006C5D6D147ED8FBC05CD8 +F9F0495AD8F07C495A90393FC00FE0D8E00FB51280010149C7FC39C0003FF02B487BC536 +>I<003FB912F8A3903BF0001FF8001F01806D481303003EC7150048187C0078183CA200 +70181CA30060180CA5481806A5C81600B3B3A54B7EED7FFE49B77EA33F447DC346>I<B6 +00C0010FB5FCA3000101E0C813F026007F80ED1F80F00F00A21806B3B3A7180E6D6C150C +A2181C131F6E1518010F163818306D6C1570606D6C14016D6C5D6D6CEC0780027F4AC7FC +6E6C131EDA1FE0137C913907FC03F00201B55A6E6C1380DB07FCC8FC40467CC349>I<B6 +92383FFFF0A3000301E003071300C649ED01FC4A5E017F705A6E5E133F616E1501011F5F +A26D6C4BC7FCA28001071606A26E150E0103160CA26D6C5DA2806D5EA26F1470027F1560 +81023F5DA281021F4A5AA26F1303020F92C8FC8102071406A26F130E0203140CA26E6C5B +A2816E5CA2EE8070037F1360A26F6C5AA216E092381FE180A216F3030F90C9FC16FBED07 +FEA36F5AA36F5AA26F5AA3166044467EC349>I<B60107B500F890380FFFFEA3000301E0 +D9001F90C813F06C0180DA0FFCED3FC091C86C48ED1F006C871C0E6D6C6E7E1C0CA26D6C +6F5DA36EDA06FF1538011F1A30A26E020E6D1470010FDB0C7F1560A26E021C7F0107DB18 +3F5DA2856D6CDA301F4A5AA36D6C4A6C6C49C7FCA36D6C4A6C6C1306A3DB80016E130E02 +7FDA8003140CA2DBC00380023FDA00015CA203E081021F01066D5CA36E6C486E6C5AA36E +6C486E6C5AA36F48EC1FE1020360A2DBFE7015F302010160020F90C8FCA2DBFFE015FB6E +49EC07FEA36F486E5AA36FC86C5AA3031E6F5AA4030C16605F467EC364>I<003FB500E0 +011FB5FCA3C691C7000713E0D93FFC020190C7FC6D4815FC010F6F5A6D6C15E0A26D6C4A +5A6D6C5D4DC8FC6D6D5B6E6C13065F6E6C131C6E6C13185F6E6C13706E6C13605F913803 +FE01DA01FF5B4CC9FC6E1387ED7FC616CCED3FFC6F5A5E6F7E6F7EA26F7E82A203067F15 +0E92380C7FC04B6C7E15389238301FF04B6C7E15E04B6C7E4A486C7E14034B6C7E02066D +7F140E020C6E7E4A6E7E143802306E7E4A6E7E14E04A6E7E49486E7E130349C86C7E496F +7F5B496C8201FF83000701E0020313F8B500F8021FEBFFF0A344447EC349>I<B66C9138 +0FFFFCA3000101F8C8000313C026007FE0923800FE0061013F17F06D6C5E80010F5F6D6C +4B5A18036D6C93C7FC6E15066D160E6D6D140C181C6E6C14186E6C5C18706E6C146018E0 +6E6C5C6E6C495A17036E6C91C8FC5F6E6C13066E6D5A171C92387FC0185FED3FE06F6C5A +17E06F6C5AEEF980ED07FF6F90C9FCA26F5AB3A6923807FF800203B6FCA346447FC349> +I<EAFFFCA4EAF000B3B3B3B3B3A2EAFFFCA40E6476CA1B>91 D<01C01318000114384848 +137048C712E0000EEB01C0000C1480001C13030018140000385B003013060070130E0060 +130CA300E0131C481318A400CFEB19E039FFC01FF801E013FCA3007F130FA2003F130701 +C013F8390F0001E01E1D71C431>I<EAFFFCA4EA003CB3B3B3B3B3A2EAFFFCA40E647ECA +1B>I<13C01201EA0380EA0700120E120C121C12181238123012701260A312E05AA412CF +EAFFC013E0A3127FA2123F13C0EA0F000B1D79C41B>96 D<EB07FC90383FFF809038F80F +E03903C003F048C66C7E000E6D7ED80FC0137E486C137F6D6D7EA36F7EA26C5AEA0380C8 +FCA4EC0FFF49B5FC90380FFE1FEB3FC0EBFF00EA03FC485A485A485A485A127F5B176048 +C7FCA3153FA36D137F007F14EF6D9038C7E0C0003F13013A1FE00783F13B07F81E03FF80 +2701FFFC0113003A001FE0007C2B2E7CAC31>I<EA01FC12FFA3120712031201B3EC03FC +91380FFF8091383C07E091387001F89039FDE0007E02807F01FFEC1F8091C713C049EC0F +E049140717F0A2EE03F8A217FCA2160117FEAB17FC1603A217F8A2EE07F0A26DEC0FE017 +C06D141F01FBEC3F80D9F380EB7E00D9E1C05B9039E0F001F89039C03C07E09039801FFF +80C7D803FCC7FC2F467DC436>I<EC7F80903803FFF090380FC07C90383F000F01FCEB03 +804848EB01C00003140F4848EB1FE049133F120F485AA2485AED1FC0007FEC070092C7FC +A290C9FC5AAB7E7FA2123F16307F001F15706C6C146016E06C6C14C06C6C13010001EC03 +806C6CEB0700013F131E90381FC078903807FFF001001380242E7DAC2B>I<167FED3FFF +A315018182B3EC7F80903803FFF090380FC07C90383F000E017E1307496D5AD803F87F48 +487F5B000F81485AA2485AA2127FA290C8FC5AAB7E7FA2123FA26C7EA2000F5D7F6C6C5B +00035C6C6C9038077F806C6C010E13C0013F011C13FE90380FC0F8903803FFE09026007F +0013002F467DC436>I<EB01FE903807FFC090381F03F090387E00FC49137E48487F485A +4848EB1F80000F15C049130F121F484814E01507A2007F15F090C7FCA25AA390B6FCA290 +C9FCA67EA27FA2123F16306C7E1670000F15606D14E06C6C14C0000314016C6CEB03806C +6CEB0700013E131E90381F80F8903803FFE0010090C7FC242E7DAC2B>I<EC0FE0EC7FF8 +903801F81E903803F03F90390FE07F8090381FC0FF5C133F495AA2ED7F0001FE131C92C7 +FCAFB67EA3C648C8FCB3B2486C7E007F13FFA321467EC51E>I<EE0F80D901FCEB7FE090 +3A0FFF81F0F090393F07E3819039FC01FF033A01F800FE014848017E13E00007027FC7FC +497F000F8149131F001F81A9000F5D6D133F000792C7FC6D5B0003147E6C6C5B6D485A39 +03BF07E090380FFF80260701FCC8FC90CAFCA25AA37F6C7E7F90B512F86C14FF16E06C15 +F86C6C8048B67E3A07C0000FFF48481300003FC8EA3F80003E151F48ED0FC0A2481507A5 +6C150F007C1680007E151F003E16006C153E6C6C5CD807E0495AD801F8EB07E0D8007FEB +3F8090261FFFFEC7FC010113E02C427DAC31>I<EA01FC12FFA3120712031201B3EC01FE +913807FFC091381E07F091383801F802707FECE000D9FDC07F5C01FF147F91C7FCA25BA3 +5BB3A8486CECFF80B5D8F83F13FEA32F457DC436>I<EA01E0EA07F8A2487EA46C5AA2EA +01E0C8FCADEA01FC12FFA3120712031201B3B0487EB512F8A315437DC21C>I<143C14FF +A2491380A46D1300A2143C91C7FCADEC7F80EB3FFFA31300147F143FB3B3AA123E127F39 +FF807F00A2147EA25C6C485A383C01F06C485A3807FF80D801FEC7FC195785C21E>I<EA +01FC12FFA3120712031201B3A292381FFFE0A36F1300ED07F816E05E5E030EC7FC5D5D5D +5D4A5A4A5A4AC8FC5CEC3F804A7E14FF9038FDCFE09038FF8FF01407496C7E01FC7F1401 +6E7E81816F7E82151F6F7E821507826F7E8282486C491380B5D8F81F13F8A32D457DC433 +>I<EA01FC12FFA3120712031201B3B3B3A5487EB512F8A315457DC41C>I<D801FC01FFEC +1FE000FF010701E0EBFFFC913B0F03F801E07F913C3C01FC07803F800007903C7000FE0E +001FC0000349D97E1C130F2601FDC0D97F38804A143001FFDA3FF06D7E91C75BA2495DA3 +495DB3A8486C4A6C497EB5D8F81FB50003B512E0A34B2C7DAB52>I<3901FC01FE00FF90 +3807FFC091381E07F091383801F8000701707F0003EBE0002601FDC07F5C01FF147F91C7 +FCA25BA35BB3A8486CECFF80B5D8F83F13FEA32F2C7DAB36>I<EC7F80903803FFF09038 +0FC0FC90383E001F496D7E496D7E48486D7E48486D7E48486D7E000F81A24848147E003F +157FA290C87E481680A44816C0AA6C1680A26D147F003F1600A2001F157E6D14FE000F5D +6D130100075D6C6C495A6C6C495A6C6C495A013E49C7FC90381FC0FE903807FFF8903800 +7F802A2E7DAC31>I<3901FC03FC00FF90380FFF8091383C07E091387001F83A07FDE000 +FE00010180137F01FFEC3F8091C7EA1FC04915E049140F17F0160717F8160317FCA3EE01 +FEABEE03FCA3EE07F8A217F0160F6D15E0EE1FC06D143F17806EEB7E00D9FDC05B9039FC +F003F891383C0FE091381FFF80DA03FCC7FC91C9FCAE487EB512F8A32F3F7DAB36>I<91 +387F8003903903FFE00790380FE07890393F801C0F90387E000E496D5AD803F8EB039F00 +07EC01BF4914FF48487F121F5B003F81A2485AA348C8FCAB6C7EA3123F7F121F6D5C120F +6D5B12076C6C5B6C6C497E6C6C130E013F131C90380FC0F8903803FFE09038007F0091C7 +FCAEEEFF80033F13FEA32F3F7DAB33>I<3903F803F000FFEB1FFCEC3C3EEC707F0007EB +E0FF3803F9C000015B13FBEC007E153C01FF13005BA45BB3A748B4FCB512FEA3202C7DAB +26>I<90383FE0183901FFFC383907E01F78390F0003F8001E1301481300007C14781278 +00F81438A21518A27EA27E6C6C13006C7E13FC383FFFE06C13FC6C13FF6C14C06C14E0C6 +14F0011F13F81300EC0FFC140300C0EB01FE1400157E7E153EA27EA36C143C6C147C1578 +6C14F86CEB01F039F38003E039F1F00F8039E07FFE0038C00FF01F2E7DAC26>I<1306A5 +130EA4131EA3133E137EA213FE12011207001FB512F0B6FCA2C648C7FCB3A4150CAA017E +131C017F1318A26D133890381F8030ECC070903807E0E0903801FFC09038007F001E3E7E +BC26>I<D801FC147F00FFEC3FFFA300071401000380000181B3A85EA35DA212006D5B01 +7E9038077F80017F010E13C06D011C13FE90380FC078903803FFF09026007F8013002F2D +7DAB36>I<B539F001FFFCA3000790C7EA7FE06C48EC1F8000011600160E1200160C017F +5CA280013F5CA26E1370011F146080010F5CA2ECF00101075CA26D6C48C7FCA26E5A0101 +1306A26D6C5AA214FF6E5AA215B8EC3FB015F06E5AA36E5AA26E5AA36EC8FC2E2C7EAA33 +>I<B500E0B539E03FFF80A30007903C000FFE000FFC00D803FCD903F8EB03F8F001E012 +0103015D6D80000060A26D6E13036DD9037E91C7FCA20280017F5B013FD9063F1306A2D9 +1FC06E5AED0C1FA2D90FE06E5AED180FA2D907F06E5AED3007A2D903F86E5AED6003A290 +2601FCE06D5AEDC00117FCD900FFECFD80ED800017FF027F92C8FC92C77EA26E147E023E +143EA2021E143C021C141CA2412C7EAA46>I<B539F007FFFCA30003D9C00113C0C6496C +1300017F14FC013F5C6E13E06D7E010F495A6D6C485A02F890C7FC903803FC060101130E +6E5A903800FF186E5AEC3FF05D141F140F6E7E81140FEC0DFCEC19FEEC38FF4A7E913860 +3F8002C07F0101131F49486C7E02007F01066D7E010E1303496D7E013C80017C80D801FC +1580D80FFE4913C0B5D8800F13FFA3302B7FAA33>I<B539F001FFFCA3000790C7EA7FE0 +6C48EC1F8000011600160E0000150C6D141C6D1418A26E1338013F1430A26D6C5BA26E13 +E0010F5CA26D6C485AA2ECF803010391C7FCA2903801FC06A2ECFE0E0100130CA2EC7F18 +A215B8EC3FB0A2EC1FE0A36E5AA26E5AA36EC8FCA21406A35CA25CA2123C007E5BB4FC5C +A25CEAFE01387C0380D87007C9FCEA3C1EEA0FFCEA03F02E3F7EAA33>I<003FB612E0A2 +9038C0003F90C713C0003CEC7F800038ECFF00A20030495A0070495AA24A5A0060495AA2 +4A5A4A5AA2C7485A4AC7FC5B5C495A13075C495A131F4A1360495A495AA249C712C0485A +A2485A485A1501485A48481303A24848EB07804848131F00FF14FF90B6FCA2232B7DAA2B +>I<B9FCA23002809B31>I E /FJ 6 121 df<F07FF0943807FFFE051FEBFFC0057F8093 +3A01FFC07FF8933A03FC000FFCDC0FF06D7EDC1FC0EB01FF4C486D1380047EC813C04CED +7FE04B4816F04B48153F4B4816F84B48151F031F17FC5E4BC913FE157E1A0F5D0201D901 +C015FFEDF803DA03F07FA2912607E0015D83EC0FC01600141F5D143FDB00015D5F5C147E +04035D02FE4A15FE5C16074D14FF0101020F16FC4A91C8FC4C5C041E16F8163E043C4A13 +F04A137C4C4A13E06E48484A13C04B5A010049484A13809126FC3F801600DA7FFFC8485A +4B157F6E484B5ADA0FE05E91C9485B4E5B4E5B4E90C7FC4E5A4E5A4E5AF0FFE005035B4D +5B4D48C8FCEF3FFCEF7FF04D5A04031380040F90C9FCEE1FFCEE7FF04B485A4B13804B48 +CAFCED1FFCED3FF0ED7FC04A485A4A48CBFC4A5A4A5ADA1FE0EE03C04A48EE07E04A5A4A +CA120F494818C0495A4A171F495A4948EF3F80495A013FF07F004A5F49CBFC01FE4D5A19 +0348484D5A49170F48B500E04B5A03FF157F4803F849485A9326FFE0075B260FF00791B6 +FCD9E0015F48486C6C5E031F93C7FC48486D5D03035D90C76C5D486E5D007E033F5C705C +040791C8FC00FE030113FC007C9238003FE0507773F258>50 D<EE3FF0923801FFFC0307 +13FF031FEC803E923A7FF03FC0FF912801FFC00FE17F4A90380007F34A481303DA1FFCEB +01FBDA3FF06DB5FC027F94C7FC4A5A494980495B725A4990C8FC495A131F49485EA24948 +151F01FF163F4A5E5AA24849157F615A5C4817FF61485BA25F486091C8FCA25F48605BA2 +5F00FF95C8FC5BA25F605BA2171F4EEB1F80A25B173F4E133F1B00A2057F5C05FF147E60 +007F5D4C15FE62003F5D4CEBE0014C5D6C6C4A1403053F5C000F15FE6C6CD901FC4A5A6D +903A03F81FF00F0003DA0FF05D6C6C90261FE00F495A6C903BC0FF8007FC7F013FB5486C +B5C7FC6D01FC6D5B010701F09038007FF801000180EC1FE0494E6ECB58>97 +D<ED07F091383FFFF8010FB5FC4914F0A416E0EB00071401A216C0A25CA21680A25CA216 +00A25CA25DA2141FA25DA2143FA25DA2147FA25DA214FFA25DA25BA25DA25BA25DA25BA2 +92C7FCA25BA25CA2131FA25CA2133FA25CA2137FA25CA213FFA25CA25AA25CA25AA25CA2 +5AA291C8FCA25AA25BA2121FA25BA2123F153F5BA2007F5C157E5BA215FE00FF5C5BA214 +015D13C04A5AA214075D007F130F5D003F131F01E05B001F49C7FC380FF0FE6CB45A6C5B +6C5B38003FC0257A71F72C>108 D<D903FCDB0FFEEEFFE090260FFF8091B500C0020F13 +FC496D010702F0027F13FF4901F0496E91B67E90267F0FF890273FF80FFC010301807FD9 +FC0791277FC003FE903A07FC003FE00001902A03FC01FE0001FFD91FE06D7E01F86D4848 +6F484880D803F0DA07F06D6D48C76C7E6F484816FED807E04A48EDC1FC4C4891267FE3F8 +6E7E000F4BC8EBE7F001C002FEEEEFE04C5F001F4BEEFF8013804A4994C8FC003F4B5E13 +004C4B48150FA2007E49495E93C95BA200FE4A4B49151F48011F65127CC7495F4F173F02 +3F654B5FA24F177F027F654B94C9FC1FFF4F6014FF4B5E66071F605B4B4C5D68193F4964 +4B4C94C8FCA2077F5E4953EB07E092C949151F6707FF190F490A3F15C04A4D5EA24E057F +EC1F80011F654A5F0CFFEC3F004E60013F1F7E4A5F55137C4E1AFC017F674A94C914010C +7F495A4E6201FF1E074A4C043F495AF83F80786CB4C7FC4A4C70B45A4A4C7013F86DC96C +4804015B013E70489338007F80834E73CB8D>I<ED03F04B7E150F4B7EA2153FA25EA215 +7FA25EA215FFA25EA25CA25EA25CA25EA25CA293C7FCA25CA25DA2141F003FB712FE4816 +FFA2B9FCA26C16FEC7D83FF8C7FC147FA25DA214FFA25DA25BA25DA25BA25DA25BA292C8 +FCA25BA25CA2131FA25CA2133FA25CA2137FA25CA213FFA25CA25AEE01F85CA248150317 +F04A130717E0160F4816C091C7FCEE1F80A2EE3F00495C167E5E15015E00034A5A4B5A00 +014A5A6D495A6C027FC7FC90387F83FE6DB45A6D13F06D13C0010190C8FC306E71EB39> +116 D<DB1FF0EC0FFCDBFFFE91383FFF8002036D6C90B512E04A6E4814F0913D1FF03FE0 +07F80FF8913D3FC00FF00FE003FC913D7F0007F81FC001FE02FE903B03FC3F8007FFD901 +F802FE495A49480101017E5B49486E5A010F604A5D495A013F4C14FE91C7FC017E4C14FC +1BF849F01FF04EEB07C0000196C7FC495C00035F5BA25E000794C9FC6C5AC9FC5E5FA316 +1F5FA3163F5FA3167F5FA316FF5FA35DF207E05FA24B160F1BC05F1A1F4B1780D803F018 +3FD80FF81900486C92C8FC486C49167E1AFE007F4A5E4F5A4B150348486F5C4B4B5A4901 +7E4B5A6C48496C6C495A9027E001F83F4AC7FC90268003F06D13FE3D3FC007E01FF003FC +3D1FF03FC00FFC0FF86CB5486CB55A6CDA000114C0000101FC6D6C90C8FC26003FF0EC1F +F8504E78CB50>120 D E(cmti10)cvn 9.96265 /Fd 1 fstore +end +%%EndProlog +%%BeginSetup +%%Feature: *Resolution 600dpi +TeXDict begin +%%PaperSize: A4 + +%%EndSetup +%%Page: 0 1 +0 0 bop 1561 735 a FJ(mma2ltx)1620 942 y FI(V)-8 b(ersion)32 +b(1.23)1459 1238 y FH(Giusepp)s(e)41 b(Ghib\022)-60 b(o)1272 +1388 y FG(h)p FF(ghib)-6 b(o@galile)g(o.p)g(olito.it)11 +b FG(i)1521 1620 y FH(June)41 b(21,)f(1995)67 2703 y +FE(Mma2ltx)c FI(is)g(a)g(program)e(whic)m(h)j(allo)m(ws)e(to)h(a)g +FD(Mathematica)f FI(user)i(to)e(include)h(the)g(graphics)g(pro-)-79 +2824 y(duced)e(b)m(y)f FD(Mathematica)f FI(in)g(a)g(L)1153 +2811 y FC(a)1199 2824 y FI(T)1253 2854 y(E)1308 2824 +y(X)g(do)s(cumen)m(t)h(using)f(o)m(wn)i(L)2348 2811 y +FC(a)2394 2824 y FI(T)2448 2854 y(E)2502 2824 y(X)f(fon)m(ts)g(and)g +(sym)m(b)s(ols)f(for)g(lab)s(els.)p eop +%%Page: 1 2 +1 1 bop -79 349 a FB(1)158 b(Intro)t(duction)-79 568 +y FD(Mathematica)45 b FI(has)h(p)s(erhaps)h(the)f(b)s(est)h(data)e +(plotting)f(to)s(ol)g(curren)m(tly)j(a)m(v)-5 b(ailable,)47 +b(but)f(its)f(con)m(trol)-79 688 y(o)m(v)m(er)40 b(mathematical)c(sym)m +(b)s(ols)j(and)g(form)m(ul\032)e(inside)i(graphics)g(is)f(v)m(ery)i(p)s +(o)s(or)2911 652 y FA(1)2950 688 y FI(:)56 b(it)38 b(is)h(limited)d(to) +i(the)-79 808 y(c)m(haracters)c(a)m(v)-5 b(ailable)30 +b(in)i(the)h(fon)m(t)f(`Sym)m(b)s(ol'.)67 929 y(T)121 +950 y(E)176 929 y(X)k(instead)h(is)e(v)m(ery)j(p)s(o)m(w)m(erful)f(in)e +(this)h(sub)5 b(ject)38 b(but)f(has)f(no)h(data)f(plotting)e(capabilit) +m(y:)49 b(it)35 b(can)-79 1049 y(only)d(include)g(external)h(graphics.) +67 1170 y FE(mma2ltx)38 b FI(is)g(the)h(\\bridge")e(across)j(the)f(t)m +(w)m(o)g(w)m(orlds:)55 b(it)38 b(allo)m(ws)f(to)h(use)i(an)m(y)f(L)3077 +1157 y FC(a)3123 1170 y FI(T)3177 1200 y(E)3231 1170 +y(X)g(sym)m(b)s(ol)f(and)-79 1290 y(fon)m(t)33 b(as)f(lab)s(els)g(in)f +(graphics)i(created)g(b)m(y)h FD(Mathematica)p FI(.)-79 +1623 y FB(2)158 b(What)53 b(do)t(es)h Fz(mma2ltx)f FB(do?)-79 +1842 y FE(Mma2ltx)29 b FI(reads)h(a)f(P)m(ostScript)g(graphic)g(\014le) +g(generated)h(b)m(y)g(the)f FD(Mathematica)f FI(command)g(`)p +Fy(Display)p FI(')3798 1806 y FA(2)-79 1962 y FI(and)35 +b(writes)g(t)m(w)m(o)h(output)f(\014les;)h(the)g(\014rst)f(one)h(is)e +(a)h(L)1904 1949 y FC(a)1950 1962 y FI(T)2004 1992 y(E)2058 +1962 y(X)g(\014le)g(and)g(con)m(tains)g(ev)m(ery)i(string)d(of)h(text)g +(of)-79 2083 y(the)d(original)c(graphics)j(\014le)f(in)h(L)1117 +2070 y FC(a)1163 2083 y FI(T)1217 2113 y(E)1271 2083 +y(X)h(form;)e(the)i(second)g(is)f(an)g(EPSF)h(\014le:)42 +b(it)31 b(substan)m(tially)f(con)m(tains)-79 2203 y(the)38 +b(same)f(things)g(of)g(the)h(original)d(P)m(ostScript)j(\014le,)g +(except)h(it)e(has)g(b)s(een)i(stripp)s(ed)e(of)g(an)m(y)h(string)f(of) +-79 2323 y(text.)-79 2656 y FB(3)158 b(Requirements)-79 +2875 y FI(In)34 b(order)h(to)e(include)h FD(Mathematica)f +FI(graphics)g(pro)s(cessed)j(b)m(y)f FE(mma2ltx)e FI(in)m(to)h(L)2937 +2862 y FC(a)2983 2875 y FI(T)3037 2905 y(E)3091 2875 +y(X)g(do)s(cumen)m(ts)h(y)m(ou)-79 2996 y(need)f(L)175 +2983 y FC(a)221 2996 y FI(T)275 3026 y(E)329 2996 y(X)f(\(ob)m(vious\)) +g(and)f(the)h(Rokic)m(ki's)g Fy(dvips)1893 2959 y FA(3)1966 +2996 y Fy(dvi)g FI(pro)s(cessor.)67 3116 y(Files)j(pro)s(cessed)j(b)m +(y)f FE(mma2ltx)e FI(w)m(ere)i(tested)h(under)e(L)2112 +3103 y FC(a)2158 3116 y FI(T)2212 3146 y(E)2267 3116 +y(X)g(v2.09)g(\(25)f(Marc)m(h)i(1992\))e(and)h Fy(dvips)-79 +3236 y FI(v5.55)c(\(and)f(new)m(er\).)45 b(The)34 b(graphics)e(\014les) +h(used)g(w)m(ere)h(created)g(with)e(Mathematica)3116 +3200 y FA(4)3187 3236 y FI(v2.2.)-79 3569 y FB(4)158 +b(Distribution/Disclaimer)-79 3788 y FE(mma2ltx)34 b +FI(is)h(sharew)m(are.)53 b(If)36 b(y)m(ou)g(\014nd)f(it)g(useful)g +(\(or)g(con)m(tin)m(ue)h(using)f(it)f(longer)g(than)h(a)g(w)m(eek\))j +(please)-79 3909 y(consider)31 b(pa)m(ying)e(the)i(fee)g(\(the)f +(easiest)h(w)m(a)m(y)g(is)f(simply)e(to)i(send)h(the)g(cash)g(in)e(an)h +(en)m(v)m(elop)s(e\))h(of)f(US)g($15)-79 4029 y(\(US)j(Dollars\),)d(or) +i(20)g(DM)h(\(German)e(Marks\))j(to)e(the)h(author)f(\(see)i +Fx(x)p FI(14)e(for)g(the)h(author's)g(address\).)67 4149 +y FE(mma2ltx)f FI(is)g(Cop)m(yrigh)m(t)1045 4146 y(c)1017 +4149 y Fx(\015)g FI(1994)g(b)m(y)h(Giusepp)s(e)g(Ghib\022)-49 +b(o.)67 4270 y(This)36 b(soft)m(w)m(are)g(is)e(pro)m(vided)i(\\as)f +(is")f(with)g(no)h(explicit)f(or)h(implicit)c(w)m(arran)m(t)m(y)36 +b(of)e(an)m(y)i(kind.)51 b(Y)-8 b(ou)-79 4390 y(are)33 +b(using)f(it)g(at)g(y)m(our)h(o)m(wn)g(risk.)67 4510 +y(The)g(author)e(disclaims)e(an)m(y)j(liabilit)m(y)c(for)j(damages,)g +(including)f(an)m(y)i(direct,)f(indirect,)g(inciden)m(tal,)-79 +4631 y(sp)s(ecial,)24 b(exemplary)-8 b(,)24 b(or)f(consequen)m(tial)g +(damages)f(arising)f(in)h(an)m(y)i(w)m(a)m(y)f(out)g(of)f(the)h(use)h +(of)e(this)h(soft)m(w)m(are,)-79 4751 y(ev)m(en)34 b(if)e(advised)h(of) +f(the)h(p)s(ossibilit)m(y)d(of)i(suc)m(h)j(damage.)p +-79 4839 1568 4 v 33 4900 a Fw(1)71 4930 y Fv(Mathematica)28 +b Fu(supp)r(orts)g(output)i(in)f(T)1336 4948 y(E)1382 +4930 y(X)g(form,)g(but)g(this)h(feature)e(is)h(only)f(for)h(form)n +(ul\032)f(and)h(do)r(esn't)f(regard)f(the)-79 5030 y(graphics.)33 +5099 y Fw(2)71 5129 y Fu(The)g(`)p Ft(Display)p Fu(')e(command)i(sa)n +(v)n(es)f(a)h(ra)n(w)g(P)n(ostScript)f(represen)n(tation)g(of)i(a)f +(graphic)f(in)i(a)f(\014le.)33 5199 y Fw(3)71 5229 y +Ft(dvips)j Fu(is)i(a)g(con)n(v)n(erter)e(from)i Ft(dvi)f +Fu(to)h(P)n(ostScript)g(\014les.)50 b(It)33 b(w)n(as)e(dev)n(elop)r(ed) +h(b)n(y)g(T.)h(Rokic)n(ki)e(and)h(is)g(a)n(v)-5 b(ailable)31 +b(via)-79 5328 y(anon)n(ymous)26 b(FTP)h(from)h Ft(labrea.stanford.)o +(ed)o(u)22 b Fu(or)k(in)i(an)n(y)f(CT)-7 b(AN)28 b(site.)33 +5398 y Fw(4)71 5428 y Fv(Mathematica)f Fu(is)g(Cop)n(yrigh)n(t)1072 +5425 y(c)1049 5428 y Fs(\015)p Fu(1988,)f(1995)g(b)n(y)h(W)-7 +b(olfram)27 b(Researc)n(h,)f(Inc.)1856 5828 y FI(1)p +eop +%%Page: 2 3 +2 2 bop 67 332 a FI(This)29 b(soft)m(w)m(are)g(ma)m(y)f(b)s(e)g(freely) +g(distributed)g(and)g(copied)g(as)g(long)f(as)i(the)f(follo)m(wing)e +(conditions)h(are)-79 452 y(ac)m(kno)m(wledged:)66 656 +y Fx(\017)49 b FI(All)31 b(parts)i(of)f(the)h(program)e(and)i(the)g(do) +s(cumen)m(tation)e(m)m(ust)i(b)s(e)g(left)e(in)m(tact)i(in)e(an)m(y)j +(w)m(a)m(ys.)66 859 y Fx(\017)49 b FI(The)33 b(distribution)d(of)h +(single)g(parts)h(is)g(not)f(allo)m(w)m(ed.)43 b(The)33 +b(repac)m(king)f(of)g(this)f(distribution)f(with)165 +980 y(other)j(pac)m(k)m(ers/arc)m(hiv)m(ers)i(is,)e(ho)m(w)m(ev)m(er,)i +(allo)m(w)m(ed.)-79 1312 y FB(5)158 b(Using)53 b Fz(mma2ltx)-79 +1531 y FI(T)-8 b(o)33 b(use)g FE(mma2ltx)p FI(,)f(just)h(t)m(yp)s(e)331 +1735 y Fy(C:\\>)53 b(mma2ltx)g(mypic.ps)-79 1938 y FI(where)35 +b Fy(mypic.ps)g FI(is)e(the)g(output)h(of)f(the)g FD(Mathematica)p +FI('s)g(primitiv)m(e)e(`)p Fy(Display)p FI('.)48 b FE(mma2ltx)32 +b FI(supp)s(orts)-79 2059 y(man)m(y)h(options,)f(as)h(describ)s(ed)g +(in)f(the)h(next)g(section.)-79 2391 y FB(6)158 b(Command)52 +b(Line)i(Options)-79 2610 y FI(Options)25 b(are)h(sp)s(eci\014ed)g(on)f +(the)h(command)e(line)g(using)i(a)f(dash)h(`)p Fy(-)p +FI(')g(follo)m(w)m(ed)e(b)m(y)j(a)e(letter.)40 b(No)26 +b(spaces)h(are)-79 2731 y(allo)m(w)m(ed)33 b(b)s(et)m(w)m(een)j(the)e +(`)p Fy(-)p FI(')h(and)f(the)g(letter.)47 b(The)35 b(letter)e(ma)m(y)h +(b)s(e)g(follo)m(w)m(ed)f(b)m(y)i(an)e(argumen)m(t.)47 +b(Spaces)-79 2851 y(b)s(et)m(w)m(een)35 b(the)e(letter)f(and)h(the)g +(argumen)m(t)f(are)g(allo)m(w)m(ed)g(instead.)67 2972 +y(Here)37 b(follo)m(ws)e(a)h(description)g(of)g(the)g(options)g(supp)s +(orted)h(b)m(y)g FE(mma2ltx)p FI(.)54 b(F)-8 b(acultativ)m(e)35 +b(argumen)m(ts)-79 3092 y(are)e(indicated)e(in)h(the)h(`)p +Fr(T)-9 b(emplate)p FI(')32 b(enclosed)h(b)s(et)m(w)m(een)i(square)e +(brac)m(k)m(ets)i([)p Fq(:)17 b(:)g(:)f FI(].)67 3212 +y(Note)33 b(that)g(ev)m(ery)i(string)d(in)g(the)h(command)f(line)f +(whic)m(h)j(is)e(not)g(an)h(option)f(argumen)m(t)g(is)h(tak)m(en)h(as) +-79 3333 y(an)f(input)f(\014le.)-79 3622 y Fp(6.1)131 +b(Option)44 b Fo(-?)-79 3806 y FI(Option)32 b Fy(-?)h +FI(\()p Fy(-"?")g FI(on)g(Unix\))f(sho)m(ws)i(the)f(follo)m(wing)d +(help)j(messages:)-79 4010 y Fy(mma2ltx)53 b(v1.23)g(-)e(Copyright)j +(\(C\))e(1994,)h(1995)f(by)g(Giuseppe)h(Ghibo`)-79 4251 +y(Usage:)g(mma2ltx)g([<options>])h(<filename\(s\)>)h([<options>])-79 +4371 y(Where)e(<options>)g(is)f(one)g(or)g(more)g(of:)24 +4612 y(-?)103 b(Show)52 b(these)h(messages)24 4732 y(-d)103 +b(Don't)52 b(keep)h(the)f(aspect)h(ratio)24 4852 y(-n)103 +b(Deactivate)54 b(automatic)f($...$)g(enclosing)24 4973 +y(-b)103 b(Enclose)53 b(every)f(string)h(into)g(a)e(white)i(box)f +(\(default)h(=)f(transpar.)h(box\))24 5093 y(-p[<str>])g(Include)g(the) +g(Mathematica)h(PostScript)g(prologue)f(in)f(the)g(.EPS)g(file)24 +5214 y(-h[<dimen>])i(Set)e(picture)h(height)g(to)f(<dimen>)h(\(default) +g(=)f(100bp\))24 5334 y(-w[<dimen>])i(Set)e(picture)h(width)104 +b(to)52 b(<dimen>)h(\(default)g(=)f(161bp\))24 5454 y(-f[<dimen>])i +(Add)e(an)g(\\fbox)g(to)g(the)g(picture)h(\(\\fboxsep=<dimen>\))24 +5575 y(-u<unit>)g(Set)f(all)g(dimensions)i(in)e(the)g(unit)g(<unit>) +1856 5828 y FI(2)p eop +%%Page: 3 4 +3 3 bop 24 332 a Fy(-s<cmd>)104 b(Set)52 b(the)g(font)h(size)f(with)g +(the)g(TeX)g(command)h(<cmd>)24 452 y(-o<str>)104 b(Output)53 +b(filename)24 573 y(-e<str>)104 b(Change)53 b(only)f(MMA)g(labels)h +(which)g(begin)f(with)h(<str>)24 693 y(-c\(sx,sy\)=\(newsx,newsy\)\(<d) +q(imen)q(>,<d)q(ime)q(n>\))58 b(\(change)53 b(alignment\))24 +814 y(-a[<num>:<num>:<num>])k(Draw)52 b(arrows)h(on)f(x)f(and)h(y)g +(axes)24 1054 y(<dimen>)h(=)e(a)h(number)h(followed)g(by)f(one)g(of)g +(TeX's)g(unit)h(\(e.g.)f(10.3cm\))24 1175 y(<num>)155 +b(=)51 b(a)h(number)h(\(e.g.)f(0.0125\))24 1295 y(<unit>)104 +b(=)51 b(a)h(TeX's)g(unit)h(\(e.g.)f(cm\))24 1416 y(<cmd>)155 +b(=)51 b(a)h(TeX)g(command)h(without)g(the)f(backslash)i('\\')24 +1536 y(<str>)155 b(=)51 b(a)h(text)g(string)-79 1777 +y(Example:)383 1897 y(mma2ltx)h(-sfootnotesize)i(-w5in)d(pic1.ps)h +(pic2.ps)-79 2017 y(processes)h(the)e(files)g(`pic1.ps')i(and)e +(`pic2.ps'.)i(The)e(width)h(of)f(the)g(pictures)-79 2138 +y(will)g(be)g(5)g(inch)g(and)g(\\footnotesize)j(will)d(be)g(used)g(as)g +(LaTeX)h(command)g(to)-79 2258 y(set)f(the)g(font)h(size.)-79 +2547 y Fp(6.2)131 b(Options)45 b Fo(-w)e Fp(and)h Fo(-h)-79 +2732 y Fr(T)-9 b(emplate:)42 b Fy(-w)p Fx(h)p FE(dimen)7 +b Fx(i)441 2852 y Fy(-h)p Fx(h)p FE(dimen)g Fx(i)-79 +2997 y FI(Options)43 b Fy(-w)h FI(and)g Fy(-h)g FI(m)m(ust)f(b)s(e)h +(used)h(to)e(sp)s(ecify)h(resp)s(ectiv)m(ely)g(the)g(width)f(and)h(the) +g(heigh)m(t)f(of)g(the)-79 3118 y(picture.)57 b(The)38 +b(argumen)m(t)f Fx(h)p FE(dimen)7 b Fx(i)36 b FI(is)g(a)h(n)m(um)m(b)s +(er)g(follo)m(w)m(ed)g(b)m(y)h(one)f(of)f(T)2751 3139 +y(E)2806 3118 y(X's)i(unit)e(\(i.e.)56 b(one)38 b(of)e +Fy(mm)p FI(,)-79 3238 y Fy(cm)p FI(,)42 b Fy(pt)p FI(,)g +Fy(bp)p FI(,)g Fy(pc)p FI(,)g Fy(in)p FI(,)g Fy(dd)p +FI(,)f Fy(cc)p FI(,)h Fy(sp)p FI(\).)65 b(F)-8 b(or)39 +b(example,)i(`)p Fy(-w10.3cm)p FI(')h(sp)s(eci\014es)f(a)e(10)p +Fq(:)p FI(3)17 b(cm)38 b(wide)i(picture.)-79 3359 y(Note)27 +b(that)f(`)p Fy(-w)52 b(10.3cm)p FI(',)30 b(`)p Fy(-w=10.3cm)p +FI(')f(and)e(`)p Fy(-w:10.3cm)p FI(')i(are)e(accepted)h(to)s(o,)f(but)g +(`)p Fy(-w10.3)53 b(cm)p FI(')27 b(isn't)-79 3479 y(accepted)g(\(note)f +(the)g(space)h(after)f(the)g(n)m(um)m(b)s(er)g Fy(10)p +FI(\).)42 b(Note)26 b(also)e(that)i(w)m(e)h(ma)m(y)e(sp)s(ecify)i(only) +e(one)h(of)f(')p Fy(-w)p FI(')-79 3599 y(or)j(')p Fy(-h)p +FI(':)43 b(the)29 b(other)f(dimension)g(is)g(calculated)f(to)i(k)m(eep) +h(the)f FD(Mathematica)e FI(asp)s(ect)j(ratio.)40 b(If)29 +b(either)f(the)-79 3720 y(width)35 b(and)g(the)h(heigh)m(t)f(are)g(sp)s +(eci\014ed,)h(the)g(picture)f(will)e(ha)m(v)m(e)j(\(appro)m(ximately\)) +e(those)i(dimensions,)-79 3840 y(but)25 b(the)h(inside)e(graphic)h +(will)d(ha)m(v)m(e)27 b(dimensions)d(suc)m(h)i(to)f(\014t)g(one)h(of)e +(heigh)m(t)h(or)g(width,)h(according)f(to)f(the)-79 3960 +y(asp)s(ect)33 b(ratio.)42 b(F)-8 b(or)32 b(instance,)h(sp)s(ecifying)f +(on)h(the)g(command)e(line)g(`)p Fy(-w10cm)53 b(-h10cm)p +FI(')34 b(and)f(the)g(asp)s(ect)-79 4081 y(ratio)123 +4045 y FA(5)201 4081 y FI(is)39 b(0)p Fq(:)p FI(62)h(then)g(the)g +(picture)g(will)e(b)s(e)i(10)17 b(cm)26 b Fx(\002)h FI(10)17 +b(cm)39 b(large)g(\(this)g(is)h(the)g(dimension)e(\\visible")-79 +4201 y(to)j(L)75 4188 y FC(a)121 4201 y FI(T)175 4231 +y(E)229 4201 y(X\),)g(but)g(the)h(inside)e(graphic)g(will)e(b)s(e)j(10) +17 b(cm)40 b(wide)h(and)g(6)p Fq(:)p FI(2)17 b(cm)39 +b(high.)68 b(If)41 b(w)m(e)h(ha)m(v)m(e)g(instead)-79 +4322 y(`)p Fy(-w10cm)53 b(-h3cm)p FI(',)43 b(the)d(picture)g(will)d(b)s +(e)j(10)17 b(cm)26 b Fx(\002)i FI(3)17 b(cm)38 b(large)h(but)h(the)g +(inside)f(graphic)g(will)e(b)s(e)j(just)-79 4442 y(4)p +Fq(:)p FI(84)17 b(cm)28 b(wide)i(and)f(3)17 b(cm)29 b(high.)41 +b(If)30 b(w)m(e)g(don't)g(w)m(an)m(t)g(to)g(k)m(eep)h(the)f +FD(Mathematica)e FI(asp)s(ect)i(ratio)e(w)m(e)j(m)m(ust)-79 +4562 y(use)j(the)f Fy(-d)g FI(option.)42 b(Default)31 +b(width)i(is)f(161)17 b(bp)o(;)33 b(default)f(heigh)m(t)g(is)g(100)17 +b(bp)o(.)-79 4851 y Fp(6.3)131 b(Option)44 b Fo(-d)-79 +5036 y FI(Suppress)35 b(the)e(asp)s(ect)g(ratio)e(k)m(eeping.)p +-79 5123 1568 4 v 33 5185 a Fw(5)71 5215 y Fu(The)c(asp)r(ect)h(ratio)e +(is)i(heigh)n(t)p Fn(=)p Fu(width)f(in)h(scaled)f(co)r(ordinates)f +(\(i.e.,)i(from)f(0)h(to)f(1\).)1856 5828 y FI(3)p eop +%%Page: 4 5 +4 4 bop -79 332 a Fp(6.4)131 b(Option)44 b Fo(-n)-79 +517 y FI(By)31 b(default)f FE(mma2ltx)f FI(encloses)i(ev)m(ery)i +(string)c(grabb)s(ed)i(from)e(the)i FD(Mathematica)e +FI(P)m(ostScript)i(\014le)e(in)m(to)-79 637 y(a)h Fy($)p +Fq(:)17 b(:)g(:)f Fy($)30 b FI(pair.)42 b(Sp)s(ecifying)29 +b(the)i Fy(-n)f FI(option)f(on)h(the)h(command)d(line,)i(this)f(b)s +(eha)m(viour)h(will)e(b)s(e)i(disabled.)-79 926 y Fp(6.5)131 +b(Option)44 b Fo(-b)-79 1111 y FI(By)37 b(default)g(ev)m(ery)h(string)e +(is)h(placed)f(on)h(the)g(graphic)f(as)h(if)f(it)g(w)m(as)h(enclosed)h +(in)e(a)g(transparen)m(t)i(b)s(o)m(x.)-79 1231 y(Using)28 +b(this)g(option)f(ev)m(ery)k(string)c(will)g(b)s(e)h(no)g(longer)g +(\\transparen)m(t",)i(but)e(rather)h(enclosed)g(in)f(a)g(white)-79 +1352 y(b)s(o)m(x)39 b(ha)m(ving)f(the)g(same)g(size)h(\(see)g(the)g +(string)e(\\some)h(text")h(sho)m(wn)g(in)f(Fig.)f(4)h(for)f(the)i(b)s +(eha)m(viour)f(of)-79 1472 y(this)32 b(option\).)-79 +1761 y Fp(6.6)131 b(Option)44 b Fo(-o)-79 1945 y Fr(T)-9 +b(emplate:)42 b Fy(-o)p Fx(h)p FE(\014lename)7 b Fx(i)-79 +2091 y FI(Sp)s(ecify)41 b(the)h(output)f(\014lename.)68 +b(By)42 b(default)f FE(mma2ltx)f FI(uses)i(as)g(output)f(names)g(the)h +(names)f(of)f(the)-79 2211 y(input)27 b(\014les)h(stripp)s(ed)g(of)f +(the)i(extension)f(to)f(whic)m(h)i(app)s(end)f(the)g(prop)s(er)g +(\014le)f(extension)i(\(i.e.,)f(`)p Fy(.tex)p FI(')h(for)-79 +2332 y(the)k(L)115 2319 y FC(a)161 2332 y FI(T)215 2362 +y(E)270 2332 y(X)g(\014le)f(and)h(`)p Fy(.eps)p FI(')h(for)e(the)h +(EPSF)g(\014le\).)44 b(The)34 b Fy(-o)f FI(option)e(allo)m(ws)h(y)m(ou) +i(to)e(sp)s(ecify)h(a)g(di\013eren)m(t)-79 2452 y(name)38 +b(for)g(the)h(EPSF)g(P)m(ostScript)g(output)g(\014le.)61 +b(In)39 b(this)f(case)i(the)f(name)f(of)g(the)h(L)3120 +2439 y FC(a)3166 2452 y FI(T)3220 2482 y(E)3275 2452 +y(X)f(\014le)g(will)f(b)s(e)-79 2572 y Fx(h)p FE(\014lename)7 +b Fx(i)p FI(.)p Fy(tex)32 b FI(an)m(yw)m(a)m(y)-8 b(.)-79 +2861 y Fp(6.7)131 b(Option)44 b Fo(-f)-79 3046 y Fr(T)-9 +b(emplate:)42 b Fy(-f)33 b FI([)p Fx(h)p FE(dimen)7 b +Fx(i)p FI(])-79 3191 y(The)49 b Fy(-f)g FI(option)d(tells)h +FE(mma2ltx)g FI(to)h(enclose)h(the)f(whole)g(picture)g(in)m(to)f(an)h +Fy(\\fbox)p FI(.)91 b(The)49 b(optional)-79 3312 y(argumen)m(t)g(is)f +(the)h(amoun)m(t)g(of)f Fy(\\fboxsep)p FI(;)59 b(b)m(y)50 +b(default)e FE(mma2ltx)g FI(assumes)i Fy(\\fboxsep=0pt)p +FI(.)96 b(F)-8 b(or)-79 3432 y(instance)33 b(the)g(command)331 +3635 y Fy(mma2ltx)53 b(-f5pt)g(-w8cm)g(mypic.ps)-79 3839 +y FI(pro)s(duces)28 b(a)e(picture)g(8)17 b(cm)25 b(wide,)j(enclosed)f +(in)m(to)f Fy(\\fbox)p FI(;)k(from)25 b(eac)m(h)i(edge)g(of)f(the)h(b)s +(o)m(x)g(and)f(its)g(con)m(ten)m(ts)-79 3959 y(there)33 +b(are)g(5)17 b(pt.)-79 4248 y Fp(6.8)131 b(Option)44 +b Fo(-s)-79 4433 y Fr(T)-9 b(emplate:)42 b Fy(-s)p Fx(h)p +FE(c)-5 b(ontr)g(ol)35 b(se)-5 b(quenc)g(e)7 b Fx(i)-79 +4578 y FI(This)44 b(option)f(sp)s(eci\014es)i(a)f(L)978 +4565 y FC(a)1024 4578 y FI(T)1078 4608 y(E)1132 4578 +y(X)g(fon)m(t-size)g(con)m(trol)f(sequence)j(to)e(c)m(hange)h(the)f +(size)g(of)f(the)i(picture)-79 4698 y(lab)s(els.)c(Note)30 +b(that)g FE(mma2ltx)f FI(do)s(esn't)i(c)m(hec)m(k)h(if)d(the)h +Fx(h)p FE(c)-5 b(ontr)g(ol)32 b(se)-5 b(quenc)g(e)7 b +Fx(i)29 b FI(is)g(a)h(v)-5 b(alid)28 b(L)3143 4685 y +FC(a)3189 4698 y FI(T)3243 4728 y(E)3298 4698 y(X)i(command.)-79 +4819 y(So)j(b)s(e)f(careful.)67 4939 y(Generally)h(a)h(L)620 +4926 y FC(a)666 4939 y FI(T)720 4969 y(E)775 4939 y(X)g(fon)m(t-size)g +(command)g(ma)m(y)g(b)s(e)g(one)h(of)e Fy(tiny)p FI(,)j +Fy(scriptsize)p FI(,)h Fy(footnotesize)p FI(,)-79 5059 +y Fy(normalsize)p FI(,)42 b Fy(large)p FI(,)e Fy(Large)p +FI(,)h Fy(LARGE)p FI(,)e Fy(huge)p FI(,)h Fy(Huge)p FI(.)61 +b(No)37 b(leading)g(bac)m(kslash)h(is)g(needed)h(\(y)m(ou)g(m)m(ust)-79 +5180 y(use)34 b Fy(-sfootnotesize)i FI(instead)c(of)h +Fy(-s\\footnotesize)p FI(\).)67 5300 y(By)42 b(default)e(the)i(picture) +f(uses)i(the)e(L)1499 5287 y FC(a)1545 5300 y FI(T)1599 +5330 y(E)1654 5300 y(X)g(curren)m(t)h(fon)m(t)f(size.)69 +b(Note)42 b(that)e(this)h(command)f(will)-79 5421 y(a\013ect)33 +b(size)g(the)g(of)f Fr(all)f FI(the)i(strings)g(con)m(tained)f(in)g +(the)h(picture.)1856 5828 y(4)p eop +%%Page: 5 6 +5 5 bop -79 332 a Fp(6.9)131 b(Option)44 b Fo(-u)-79 +517 y Fr(T)-9 b(emplate:)42 b Fy(-u)p Fx(h)p FE(T)645 +538 y(E)699 517 y(X's)35 b(unit)9 b Fx(i)-79 662 y FI(The)30 +b Fy(-u)f FI(option)f(sp)s(eci\014es)i(the)g(unit)e(of)g(measure)i(of)e +(quan)m(tities)h(con)m(tained)g(in)f(the)h Fy(.tex)h +FI(\014le)f(generated)-79 782 y(b)m(y)39 b FE(mma2ltx)p +FI(.)57 b(Also)37 b(the)h(messages)g(sho)m(wn)h(during)e(L)1965 +769 y FC(a)2011 782 y FI(T)2065 813 y(E)2120 782 y(X)g(and)h +FE(mma2ltx)e FI(pro)s(cessing)i(will)d(use)k(that)-79 +903 y(unit.)-79 1191 y Fp(6.10)130 b(Option)45 b Fo(-p)-79 +1376 y Fr(T)-9 b(emplate:)42 b Fy(-p)p FI([)p Fx(h)p +FE(pr)-5 b(olo)g(gue)35 b(\014le)7 b Fx(i)p FI(])67 1521 +y(By)39 b(default)e(the)h(EPSF)g(\014le)g(pro)s(duced)g(b)m(y)h +FE(mma2ltx)e FI(do)s(esn't)h(con)m(tain)g(the)g FD(Mathematica)e +FI(P)m(ost-)-79 1641 y(Script)f(prologue)f(\(i.e.)52 +b(it)34 b(cannot)i(b)s(e)f(prin)m(ted)h(as)f(is\).)51 +b(In)36 b(fact)f(this)g(prologue)f(is)h(included)g(only)g(once)-79 +1762 y(in)d(the)h(\014nal)f(P)m(ostScript)h(\014le)f(pro)s(duced)h(b)m +(y)h Fy(dvips)p FI(.)67 1882 y(The)43 b Fx(h)p FE(pr)-5 +b(olo)g(gue)43 b(\014le)7 b Fx(i)42 b FI(is)f(an)h(optional)e(argumen)m +(t)i(and)g(allo)m(ws)f(to)h(sp)s(ecify)g(an)g(alternate)g +FD(Mathe-)-79 2003 y(matica)35 b FI(prologue)h(\014le)g(\(e.g.)56 +b(a)36 b(new)m(er)i(prologue)e(\014le\).)55 b(T)-8 b(o)37 +b(obatin)e(a)i(prologue)e(\014le)h(y)m(ou)i(can)f(use)g(the)-79 +2123 y(program)31 b Fy(extpro)p FI(.)45 b(See)34 b Fx(x)p +FI(10)e(for)g(further)h(details.)67 2243 y(Using)48 b(this)g(option)e +(the)j(EPSF)f(\014le)g(pro)s(duced)h(b)m(y)f FE(mma2ltx)f +FI(will)f(con)m(tain)i(the)g FD(Mathematica)-79 2364 +y FI(prologue)31 b(\014le.)43 b(This)33 b(ma)m(y)f(b)s(e)g(v)m(ery)i +(useful)e(for)g(some)g Fy(dvi)g FI(preview)m(er)i(with)e(capabilit)m(y) +e(to)i(sho)m(w)h(P)m(ost-)-79 2484 y(Script)f(sp)s(ecials.)-79 +2772 y Fp(6.11)130 b(Option)45 b Fo(-c)-79 2957 y Fr(T)-9 +b(emplate:)42 b Fy(-c)p Fx(h)p FI(\()p Fq(s)676 2972 +y Fm(x)720 2957 y Fq(;)17 b(s)810 2972 y Fm(y)851 2957 +y FI(\))28 b(=)g(\()p Fq(s)1105 2921 y Fl(0)1105 2982 +y Fm(x)1148 2957 y Fq(;)17 b(s)1238 2921 y Fl(0)1238 +2982 y Fm(y)1279 2957 y FI(\)\()p Fq(dimen)1627 2972 +y Fm(x)1672 2957 y Fq(;)g(dimen)1988 2972 y Fm(y)2030 +2957 y FI(\))p Fx(i)67 3102 y FI(The)38 b Fy(-c)e FI(option)g(can)g(b)s +(e)h(used)g(to)f(o)m(v)m(erride)h(a)f(p)s(eculiar)f(b)s(eha)m(viour)h +(of)g FD(Mathematica)p FI('s)g(primitiv)m(e)-79 3223 +y Fy(Text)p FI(.)80 b(T)-8 b(o)44 b(place)g(text,)k FE(mma2ltx)43 +b FI(normally)f(uses)j(the)g(same)f(con)m(v)m(en)m(tions)i(of)e(the)g +FD(Mathematica)p FI('s)-79 3343 y(primitiv)m(e)30 b(`)p +Fy(Text)p FI(':)45 b(reference)34 b(p)s(oin)m(t)e(\()p +Fq(x;)17 b(y)t FI(\))32 b(is)g(realized)f(as)i(follo)m(ws:)66 +3542 y Fx(\017)49 b FI(The)34 b(text)f(string)f(is)g(placed)g(in)m(to)g +(a)g(b)s(o)m(x)h(ha)m(ving)g(the)g(same)f(size.)66 3744 +y Fx(\017)49 b FI(An)36 b(o\013set)g(\()p Fq(s)673 3759 +y Fm(x)717 3744 y Fq(;)17 b(s)807 3759 y Fm(y)848 3744 +y FI(\))36 b(in)f(the)i(b)s(ounding)e(b)s(o)m(x)h(co)s(ordinates)f +(system)i(\(see)g(the)g(Fig.)d(1\))i(determines)165 3865 +y(where)e(the)f(reference)h(p)s(oin)m(t)e(go)s(es.)p +2363 4594 1418 4 v 3698 4592 a Fk(-)p 3070 5065 4 945 +v 3072 4203 a(6)p 2711 4353 722 7 v 2711 4825 7 473 v +2769 4655 a Fj(T)-17 b(ext)3261 4538 y(1)p 3261 4614 +104 4 v 3263 4773 a Fi(x)p 3426 4825 7 473 v 2711 4832 +722 7 v 3426 4354 a Fh(r)3381 4321 y Fg(\(1)p Ff(;)11 +b Fg(1\))3426 4593 y Fh(r)3450 4569 y Fg(\(1)p Ff(;)g +Fg(0\))3426 4829 y Fh(r)3357 4890 y Fg(\(1)p Ff(;)g Fe(\000)p +Fg(1\))3072 4829 y Fh(r)3096 4890 y Fg(\(0)p Ff(;)g Fe(\000)p +Fg(1\))2718 4829 y Fh(r)2577 4890 y Fg(\()p Fe(\000)p +Fg(1)p Ff(;)g Fe(\000)p Fg(1\))2718 4593 y Fh(r)2508 +4569 y Fg(\()p Fe(\000)p Fg(1)p Ff(;)g Fg(0\))2718 4354 +y Fh(r)2601 4321 y Fg(\()p Fe(\000)p Fg(1)p Ff(;)g Fg(1\))3072 +4354 y Fh(r)3096 4321 y Fg(\(0)p Ff(;)g Fg(1\))3691 4659 +y Fq(s)3737 4674 y Fm(x)2961 4163 y Fq(s)3007 4178 y +Fm(y)2304 5268 y FI(Figure)22 b(1:)39 b(Bounding)22 b(b)s(o)m(x)h(co)s +(ordinates.)67 4064 y(F)-8 b(or)32 b(instance)g(the)h(o\013set)g(\()p +Fx(\000)p FI(1)p Fq(;)17 b FI(1\))31 b(means)i(that)f(the)g(b)s(o)m(x) +-79 4184 y(con)m(taining)i(the)i(string)f(is)g(placed)g(with)h(the)f(p) +s(oin)m(t)g(\()p Fx(\000)p FI(1)p Fq(;)17 b FI(1\))-79 +4305 y(at)34 b(the)g(reference)h(p)s(oin)m(t)e(\()p Fq(x;)17 +b(y)t FI(\),)34 b(i.e.)46 b(left)33 b(and)h(top)g(aligned.)-79 +4425 y(If)40 b(the)g(o\013set)g(is)f(\(0)p Fq(;)17 b +FI(0\))39 b(then)h(the)h(b)s(o)m(x)f(is)f(cen)m(tered)j(on)d(the)-79 +4545 y(reference)48 b(p)s(oin)m(t)d(\()p Fq(x;)17 b(y)t +FI(\).)82 b(Note)46 b(that)g(w)m(e)h(ma)m(y)e(also)g(ha)m(v)m(e)-79 +4666 y(o\013sets)27 b(greater)g(than)f(1.)41 b(F)-8 b(or)25 +b(instance)i(the)g(lab)s(elling)22 b(of)k(the)-79 4786 +y Fq(x)p FI(-axis)36 b(is)f(realized)g(\(b)m(y)i FD(Mathematica)p +FI(\))e(using)g(a)h(reference)-79 4907 y(p)s(oin)m(t)41 +b(lying)g(on)g(the)i Fq(x)p FI(-axis)e(and)h(a)g(b)s(ounding)f(b)s(o)m +(x)h(o\013set)-79 5027 y(of)j(\(0)p Fq(;)17 b FI(2\).)81 +b(With)45 b(suc)m(h)h(o\013set,)j(di\013eren)m(t)d(heigh)m(t)f +Fq(x)p FI(-lab)s(els)-79 5147 y(w)m(ould)33 b(b)s(e)f(placed)h(at)f +(di\013eren)m(t)h(distance)g(from)e(the)i Fq(x)p FI(-axis.)-79 +5268 y(The)38 b(`)p Fy(-c)p FI(')f(option)f(b)m(y-passes)j(this)d(b)s +(eha)m(viour.)56 b(It)37 b(replaces)-79 5388 y(an)m(y)j(lab)s(el)c(ha)m +(ving)j(\()p Fq(s)758 5403 y Fm(x)802 5388 y Fq(;)17 +b(s)892 5403 y Fm(y)933 5388 y FI(\))38 b(bb-o\013set)h(with)g(lab)s +(els)e(ha)m(ving)-79 5509 y(\()p Fq(s)5 5472 y Fl(0)5 +5533 y Fm(x)49 5509 y Fq(;)17 b(s)139 5472 y Fl(0)139 +5533 y Fm(y)180 5509 y FI(\))30 b(bb-o\013set)g(further)h(shifted)f(b)m +(y)h(\()p Fq(dimen)1728 5524 y Fm(x)1773 5509 y Fq(;)17 +b(dimen)2089 5524 y Fm(y)2131 5509 y FI(\))30 b(from)f(the)h(curren)m +(t)i(p)s(osition)c(\()p Fq(dimen)3608 5524 y Fm(x)3683 +5509 y FI(and)-79 5629 y Fq(dimen)193 5644 y Fm(y)268 +5629 y FI(m)m(ust)33 b(b)s(e)f(n)m(um)m(b)s(ers)i(follo)m(w)m(ed)d(b)m +(y)j(one)f(of)f(T)1892 5650 y(E)1946 5629 y(X's)h(unit\).)1856 +5828 y(5)p eop +%%Page: 6 7 +6 6 bop 67 332 a FI(The)41 b(follo)m(wing)d(example)h(could)h(mak)m(e)g +(this)g(clear.)65 b(Consider)41 b(a)f(graphic)f(ha)m(ving)h(the)g +(follo)m(wing)-79 452 y(lab)s(els)1046 592 y Fx(\000)1133 +525 y FI(3)p 1133 569 49 4 v 1133 661 a(2)1409 592 y +Fx(\000)23 b FI(1)217 b Fx(\000)1885 525 y FI(1)p 1885 +569 V 1885 661 a(2)2148 525 y(1)p 2148 569 V 2148 661 +a(2)2402 592 y(1)2656 525 y(3)p 2656 569 V 2656 661 a(2)-79 +805 y(under)34 b(the)f Fq(x)p FI(-axis.)45 b(Since)33 +b(lab)s(els)f(`)p Fx(\000)1336 766 y FA(3)p 1336 782 +36 4 v 1336 839 a(2)1381 805 y FI(',)i(`)p Fx(\000)1583 +766 y FA(1)p 1583 782 V 1583 839 a(2)1628 805 y FI(',)g(`)1753 +766 y FA(1)p 1753 782 V 1753 839 a(2)1798 805 y FI(')f(and)g(and)g(`) +2275 766 y FA(3)p 2275 782 V 2275 839 a(2)2321 805 y +FI(')g(are)g(higher)f(than)h(lab)s(el)e(`)p Fx(\000)p +FI(1')j(and)f(`1',)-79 925 y(they)40 b(are)e(placed)h(lo)m(w)m(er)g +(than)f(the)h(lab)s(els)f(`)p Fx(\000)p FI(1'.)62 b(Using)38 +b(the)h(option)e(`)p Fy(-c\(0,2\)=\(0,1\)\(0pt,-5pt\))q +FI(')-79 1046 y(ev)m(ery)e(lab)s(els)d(will)f(b)s(e)j(placed)f(with)g +(the)g(top)g(edge)h(of)f(the)h(b)s(o)m(x)f(that)g(b)s(ounds)h(them,)g +(at)f(5)17 b(pt)32 b(from)g(the)-79 1166 y Fq(x)p FI(-axis,)h(as)f(sho) +m(wn)i(in)e(Fig.)f(2.)67 1287 y(Note)i(that)g(it)e(is)h(p)s(ossible)g +(to)g(sp)s(ecify)h(m)m(ultiple)d Fy(-c)j FI(options)f(on)h(the)g(same)f +(command)g(line.)16 2517 y @beginspecial 212.597810 @hsize +131.390900 @vsize @setspecial +%%BeginDocument: 6mag.eps +%MMA2LTXCommandLine: mma2ltx -ucm -p -w7.5cm 6mag.ps +% Mathematica v2.2 prologue +/Mathdict 150 dict def +Mathdict begin +/Mwidth 212.60 def +/Mheight 131.39 def +/Mnodistort true def +/Mlmarg 0 def /Mrmarg 0 def /Mbmarg 0 def /Mtmarg 0 def /Mtransform{} +bind def /Mfixwid true def /Mfixdash false def /Mrot 0 def /Mpstart{ +MathPictureStart}bind def /Mpend{MathPictureEnd}bind def /Mscale{0 1 0 1 +5 -1 roll MathScale}bind def /ISOLatin1Encoding dup where{pop pop}{[ +/.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef +/.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef +/.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef +/.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef +/space /exclam /quotedbl /numbersign /dollar /percent /ampersand +/quoteright /parenleft /parenright /asterisk /plus /comma /minus /period +/slash /zero /one /two /three /four /five /six /seven /eight /nine +/colon /semicolon /less /equal /greater /question /at /A /B /C /D /E /F +/G /H /I /J /K /L /M /N /O /P /Q /R /S /T /U /V /W /X /Y /Z /bracketleft +/backslash /bracketright /asciicircum /underscore /quoteleft /a /b /c /d +/e /f /g /h /i /j /k /l /m /n /o /p /q /r /s /t /u /v /w /x /y /z +/braceleft /bar /braceright /asciitilde /.notdef /.notdef /.notdef +/.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef +/.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /dotlessi /grave +/acute /circumflex /tilde /macron /breve /dotaccent /dieresis /.notdef +/ring /cedilla /.notdef /hungarumlaut /ogonek /caron /space /exclamdown +/cent /sterling /currency /yen /brokenbar /section /dieresis /copyright +/ordfeminine /guillemotleft /logicalnot /hyphen /registered /macron +/degree /plusminus /twosuperior /threesuperior /acute /mu /paragraph +/periodcentered /cedilla /onesuperior /ordmasculine /guillemotright +/onequarter /onehalf /threequarters /questiondown /Agrave /Aacute +/Acircumflex /Atilde /Adieresis /Aring /AE /Ccedilla /Egrave /Eacute +/Ecircumflex /Edieresis /Igrave /Iacute /Icircumflex /Idieresis /Eth +/Ntilde /Ograve /Oacute /Ocircumflex /Otilde /Odieresis /multiply +/Oslash /Ugrave /Uacute /Ucircumflex /Udieresis /Yacute /Thorn +/germandbls /agrave /aacute /acircumflex /atilde /adieresis /aring /ae +/ccedilla /egrave /eacute /ecircumflex /edieresis /igrave /iacute +/icircumflex /idieresis /eth /ntilde /ograve /oacute /ocircumflex +/otilde /odieresis /divide /oslash /ugrave /uacute /ucircumflex +/udieresis /yacute /thorn /ydieresis]def}ifelse /MFontDict 50 dict def +/MStrCat{exch dup length 2 index length add string dup 3 1 roll copy +length exch dup 4 2 roll exch putinterval}def /MCreateEncoding{1 index +255 string cvs(-)MStrCat 1 index MStrCat cvn exch(Encoding)MStrCat cvn +dup where{exch get}{pop StandardEncoding}ifelse 3 1 roll dup MFontDict +exch known not{1 index findfont dup length dict begin{1 index /FID ne{ +def}{pop pop}ifelse}forall /Encoding 3 index def currentdict end 1 index +exch definefont pop MFontDict 1 index null put}if exch pop exch pop}def +/ISOLatin1{(ISOLatin1)MCreateEncoding}def /ISO8859{(ISOLatin1) +MCreateEncoding}def /Mcopyfont{dup maxlength dict exch{1 index /FID eq{ +pop pop}{2 index 3 1 roll put}ifelse}forall}def /Plain /Courier findfont +Mcopyfont definefont pop /Bold /Courier findfont Mcopyfont +definefont pop /Italic /Courier findfont Mcopyfont definefont +pop /MathPictureStart{gsave Mtransform Mlmarg Mbmarg translate Mwidth +Mlmarg Mrmarg add sub /Mwidth exch def Mheight Mbmarg Mtmarg add sub +/Mheight exch def /Mtmatrix matrix currentmatrix def /Mgmatrix matrix +currentmatrix def}bind def /MathPictureEnd{grestore}bind def /MFill{0 0 +moveto Mwidth 0 lineto Mwidth Mheight lineto 0 Mheight lineto fill}bind +def /MPlotRegion{3 index Mwidth mul 2 index Mheight mul translate exch +sub Mheight mul /Mheight exch def exch sub Mwidth mul /Mwidth exch def} +bind def /MathSubStart{Momatrix Mgmatrix Mtmatrix Mwidth Mheight 7 -2 +roll moveto Mtmatrix setmatrix currentpoint Mgmatrix setmatrix 9 -2 roll +moveto Mtmatrix setmatrix currentpoint 2 copy translate /Mtmatrix matrix +currentmatrix def 3 -1 roll exch sub /Mheight exch def sub /Mwidth exch +def}bind def /MathSubEnd{/Mheight exch def /Mwidth exch def /Mtmatrix +exch def dup setmatrix /Mgmatrix exch def /Momatrix exch def}bind def +/Mdot{moveto 0 0 rlineto stroke}bind def /Mtetra{moveto lineto lineto +lineto fill}bind def /Metetra{moveto lineto lineto lineto closepath +gsave fill grestore 0 setgray stroke}bind def /Mistroke{flattenpath 0 0 +0{4 2 roll pop pop}{4 -1 roll 2 index sub dup mul 4 -1 roll 2 index sub +dup mul add sqrt 4 -1 roll add 3 1 roll}{stop}{stop}pathforall pop pop +currentpoint stroke moveto currentdash 3 -1 roll add setdash}bind def +/Mfstroke{stroke currentdash pop 0 setdash}bind def /Mrotsboxa{gsave dup +/Mrot exch def Mrotcheck Mtmatrix dup setmatrix 7 1 roll 4 index 4 index +translate rotate 3 index -1 mul 3 index -1 mul translate /Mtmatrix +matrix currentmatrix def grestore Msboxa 3 -1 roll /Mtmatrix exch def +/Mrot 0 def}bind def /Msboxa{newpath 5 -1 roll Mvboxa pop Mboxout 6 -1 +roll 5 -1 roll 4 -1 roll Msboxa1 5 -3 roll Msboxa1 Mboxrot[7 -2 roll 2 +copy[3 1 roll 10 -1 roll 9 -1 roll]6 1 roll 5 -2 roll]}bind def /Msboxa1 +{sub 2 div dup 2 index 1 add mul 3 -1 roll -1 add 3 -1 roll mul}bind def +/Mvboxa{Mfixwid{Mvboxa1}{dup Mwidthcal 0 exch{add}forall exch Mvboxa1 4 +index 7 -1 roll add 4 -1 roll pop 3 1 roll}ifelse}bind def /Mvboxa1{ +gsave newpath[true 3 -1 roll{Mbbox 5 -1 roll{0 5 1 roll}{7 -1 roll exch +sub(m)stringwidth pop .3 mul sub 7 1 roll 6 -1 roll 4 -1 roll Mmin 3 -1 +roll 5 index add 5 -1 roll 4 -1 roll Mmax 4 -1 roll}ifelse false}forall{ +stop}if counttomark 1 add 4 roll]grestore}bind def /Mbbox{1 dict begin 0 +0 moveto /temp(T)def{gsave currentpoint newpath moveto temp 0 3 -1 roll +put temp false charpath flattenpath currentpoint pathbbox grestore +moveto lineto moveto}forall pathbbox newpath end}bind def /Mmin{2 copy +gt{exch}if pop}bind def /Mmax{2 copy lt{exch}if pop}bind def /Mrotshowa{ +dup /Mrot exch def Mrotcheck Mtmatrix dup setmatrix 7 1 roll 4 index 4 +index translate rotate 3 index -1 mul 3 index -1 mul translate /Mtmatrix +matrix currentmatrix def Mgmatrix setmatrix Mshowa /Mtmatrix exch def +/Mrot 0 def}bind def /Mshowa{4 -2 roll moveto 2 index Mtmatrix setmatrix +Mvboxa 7 1 roll Mboxout 6 -1 roll 5 -1 roll 4 -1 roll Mshowa1 4 1 roll +Mshowa1 rmoveto currentpoint Mfixwid{Mshowax}{Mshoway}ifelse pop pop pop +pop Mgmatrix setmatrix}bind def /Mshowax{0 1 4 index length -1 add{2 +index 4 index 2 index get 3 index add moveto 4 index exch get Mfixdash{ +Mfixdashp}if show}for}bind def /Mfixdashp{dup length 1 gt 1 index true +exch{45 eq and}forall and{gsave(--)stringwidth pop(-)stringwidth pop sub +2 div 0 rmoveto dup length 1 sub{(-)show}repeat grestore}if}bind def +/Mshoway{3 index Mwidthcal 5 1 roll 0 1 4 index length -1 add{2 index 4 +index 2 index get 3 index add moveto 4 index exch get[6 index aload +length 2 add -1 roll{pop Strform stringwidth pop neg exch add 0 rmoveto} +exch kshow cleartomark}for pop}bind def /Mwidthcal{[exch{Mwidthcal1} +forall][exch dup Maxlen -1 add 0 1 3 -1 roll{[exch 2 index{1 index Mget +exch}forall pop Maxget exch}for pop]Mreva}bind def /Mreva{[exch aload +length -1 1{1 roll}for]}bind def /Mget{1 index length -1 add 1 index ge{ +get}{pop pop 0}ifelse}bind def /Maxlen{[exch{length}forall Maxget}bind +def /Maxget{counttomark -1 add 1 1 3 -1 roll{pop Mmax}for exch pop}bind +def /Mwidthcal1{[exch{Strform stringwidth pop}forall]}bind def /Strform{ +/tem(x)def tem 0 3 -1 roll put tem}bind def /Mshowa1{2 copy add 4 1 roll +sub mul sub -2 div}bind def /MathScale{Mwidth Mheight Mlp translate +scale /yscale exch def /ybias exch def /xscale exch def /xbias exch def +/Momatrix xscale yscale matrix scale xbias ybias matrix translate matrix +concatmatrix def /Mgmatrix matrix currentmatrix def}bind def /Mlp{3 copy +Mlpfirst{Mnodistort{Mmin dup}if 4 index 2 index 2 index Mlprun 11 index +11 -1 roll 10 -4 roll Mlp1 8 index 9 -5 roll Mlp1 4 -1 roll and{exit}if +3 -1 roll pop pop}loop exch 3 1 roll 7 -3 roll pop pop pop}bind def +/Mlpfirst{3 -1 roll dup length 2 copy -2 add get aload pop pop pop 4 -2 +roll -1 add get aload pop pop pop 6 -1 roll 3 -1 roll 5 -1 roll sub div +4 1 roll exch sub div}bind def /Mlprun{2 copy 4 index 0 get dup 4 1 roll +Mlprun1 3 copy 8 -2 roll 9 -1 roll{3 copy Mlprun1 3 copy 11 -3 roll /gt +Mlpminmax 8 3 roll 11 -3 roll /lt Mlpminmax 8 3 roll}forall pop pop pop +pop 3 1 roll pop pop aload pop 5 -1 roll aload pop exch 6 -1 roll +Mlprun2 8 2 roll 4 -1 roll Mlprun2 6 2 roll 3 -1 roll Mlprun2 4 2 roll +exch Mlprun2 6 2 roll}bind def /Mlprun1{aload pop exch 6 -1 roll 5 -1 +roll mul add 4 -2 roll mul 3 -1 roll add}bind def /Mlprun2{2 copy add 2 +div 3 1 roll exch sub}bind def /Mlpminmax{cvx 2 index 6 index 2 index +exec{7 -3 roll 4 -1 roll}if 1 index 5 index 3 -1 roll exec{4 1 roll pop +5 -1 roll aload pop pop 4 -1 roll aload pop[8 -2 roll pop 5 -2 roll pop +6 -2 roll pop 5 -1 roll]4 1 roll pop}{pop pop pop}ifelse}bind def /Mlp1{ +5 index 3 index sub 5 index 2 index mul 1 index le 1 index 0 le or dup +not{1 index 3 index div .99999 mul 8 -1 roll pop 7 1 roll}if 8 -1 roll 2 +div 7 -2 roll pop sub 5 index 6 -3 roll pop pop mul sub exch}bind def +/intop 0 def /inrht 0 def /inflag 0 def /outflag 0 def /xadrht 0 def +/xadlft 0 def /yadtop 0 def /yadbot 0 def /Minner{outflag 1 eq{/outflag +0 def /intop 0 def /inrht 0 def}if 5 index gsave Mtmatrix setmatrix +Mvboxa pop grestore 3 -1 roll pop dup intop gt{/intop exch def}{pop} +ifelse dup inrht gt{/inrht exch def}{pop}ifelse pop /inflag 1 def}bind +def /Mouter{/xadrht 0 def /xadlft 0 def /yadtop 0 def /yadbot 0 def +inflag 1 eq{dup 0 lt{dup intop mul neg /yadtop exch def}if dup 0 gt{dup +intop mul /yadbot exch def}if pop dup 0 lt{dup inrht mul neg /xadrht +exch def}if dup 0 gt{dup inrht mul /xadlft exch def}if pop /outflag 1 +def}{pop pop}ifelse /inflag 0 def /inrht 0 def /intop 0 def}bind def +/Mboxout{outflag 1 eq{4 -1 roll xadlft leadjust add sub 4 1 roll 3 -1 +roll yadbot leadjust add sub 3 1 roll exch xadrht leadjust add add exch +yadtop leadjust add add /outflag 0 def /xadlft 0 def /yadbot 0 def +/xadrht 0 def /yadtop 0 def}if}bind def /leadjust{(m)stringwidth pop .5 +mul}bind def /Mrotcheck{dup 90 eq{yadbot /yadbot xadrht def /xadrht +yadtop def /yadtop xadlft def /xadlft exch def}if dup cos 1 index sin +Checkaux dup cos 1 index sin neg exch Checkaux 3 1 roll pop pop}bind def +/Checkaux{4 index exch 4 index mul 3 1 roll mul add 4 1 roll}bind def +/Mboxrot{Mrot 90 eq{brotaux 4 2 roll}if Mrot 180 eq{4 2 roll brotaux 4 2 +roll brotaux}if Mrot 270 eq{4 2 roll brotaux}if}bind def /brotaux{neg +exch neg}bind def /Mabsproc{0 matrix defaultmatrix dtransform +idtransform dup mul exch dup mul add sqrt}bind def /Mabswid{Mabsproc +setlinewidth}bind def /Mabsdash{exch[exch{Mabsproc}forall]exch setdash} +bind def /MBeginOrig{Momatrix concat}bind def /MEndOrig{Mgmatrix +setmatrix}bind def /sampledsound where{pop}{/sampledsound{exch pop exch +5 1 roll mul 4 idiv mul 2 idiv exch pop exch /Mtempproc exch def{ +Mtempproc pop}repeat}bind def}ifelse /g{setgray}bind def /k{ +setcmykcolor}bind def /m{moveto}bind def /p{gsave}bind def /r{ +setrgbcolor}bind def /w{setlinewidth}bind def /C{curveto}bind def /F{ +fill}bind def /L{lineto}bind def /P{grestore}bind def /s{stroke}bind def +/setcmykcolor where{pop}{/setcmykcolor{4 1 roll[4 1 roll]{1 index sub 1 +sub neg dup 0 lt{pop 0}if dup 1 gt{pop 1}if exch}forall pop setrgbcolor} +bind def}ifelse /Mcharproc{currentfile(x)readhexstring pop 0 get exch +div}bind def /Mshadeproc{dup 3 1 roll{dup Mcharproc 3 1 roll}repeat 1 eq +{setgray}{3 eq{setrgbcolor}{setcmykcolor}ifelse}ifelse}bind def +/Mrectproc{3 index 2 index moveto 2 index 3 -1 roll lineto dup 3 1 roll +lineto lineto fill}bind def /Mcolorimage{7 1 roll pop pop matrix +invertmatrix concat 2 exch exp 1 sub 3 1 roll 1 1 2 index{1 1 4 index{ +dup 1 sub exch 2 index dup 1 sub exch 7 index 9 index Mshadeproc +Mrectproc}for pop}for pop pop pop pop}bind def /Mimage{pop matrix +invertmatrix concat 2 exch exp 1 sub 3 1 roll 1 1 2 index{1 1 4 index{ +dup 1 sub exch 2 index dup 1 sub exch 7 index Mcharproc setgray +Mrectproc}for pop}for pop pop pop}bind def +%MMA2LTXComment: Here follow the original Mathematica file stripped of the text strings +MathPictureStart +/Courier findfont 10 scalefont setfont +% Scaling calculations +0.5 0.151576 0.309017 0.257514 [ +[ -0.001 -0.001 0 0 ] +[ 1.001 .61903 0 0 ] +] MathScale +% Start of Graphics +1 setlinecap +1 setlinejoin +newpath +[ ] 0 setdash +0 g +p +p +.002 w +.04527 .30902 m +.04527 .31527 L +s +P +p +.002 w +.19685 .30902 m +.19685 .31527 L +s +P +p +.002 w +.34842 .30902 m +.34842 .31527 L +s +P +p +.002 w +.65158 .30902 m +.65158 .31527 L +s +P +p +.002 w +.80315 .30902 m +.80315 .31527 L +s +P +p +.002 w +.95473 .30902 m +.95473 .31527 L +s +P +p +.001 w +.07559 .30902 m +.07559 .31277 L +s +P +p +.001 w +.1059 .30902 m +.1059 .31277 L +s +P +p +.001 w +.13622 .30902 m +.13622 .31277 L +s +P +p +.001 w +.16653 .30902 m +.16653 .31277 L +s +P +p +.001 w +.22716 .30902 m +.22716 .31277 L +s +P +p +.001 w +.25748 .30902 m +.25748 .31277 L +s +P +p +.001 w +.28779 .30902 m +.28779 .31277 L +s +P +p +.001 w +.31811 .30902 m +.31811 .31277 L +s +P +p +.001 w +.37874 .30902 m +.37874 .31277 L +s +P +p +.001 w +.40905 .30902 m +.40905 .31277 L +s +P +p +.001 w +.43937 .30902 m +.43937 .31277 L +s +P +p +.001 w +.46968 .30902 m +.46968 .31277 L +s +P +p +.001 w +.53032 .30902 m +.53032 .31277 L +s +P +p +.001 w +.56063 .30902 m +.56063 .31277 L +s +P +p +.001 w +.59095 .30902 m +.59095 .31277 L +s +P +p +.001 w +.62126 .30902 m +.62126 .31277 L +s +P +p +.001 w +.68189 .30902 m +.68189 .31277 L +s +P +p +.001 w +.71221 .30902 m +.71221 .31277 L +s +P +p +.001 w +.74252 .30902 m +.74252 .31277 L +s +P +p +.001 w +.77284 .30902 m +.77284 .31277 L +s +P +p +.001 w +.83347 .30902 m +.83347 .31277 L +s +P +p +.001 w +.86378 .30902 m +.86378 .31277 L +s +P +p +.001 w +.8941 .30902 m +.8941 .31277 L +s +P +p +.001 w +.92441 .30902 m +.92441 .31277 L +s +P +p +.001 w +.01496 .30902 m +.01496 .31277 L +s +P +p +.001 w +.98504 .30902 m +.98504 .31277 L +s +P +p +.002 w +0 .30902 m +1 .30902 L +s +P +p +.002 w +.5 .0515 m +.50625 .0515 L +s +P +p +.002 w +.5 .18026 m +.50625 .18026 L +s +P +p +.002 w +.5 .43777 m +.50625 .43777 L +s +P +p +.002 w +.5 .56653 m +.50625 .56653 L +s +P +p +.001 w +.5 .07725 m +.50375 .07725 L +s +P +p +.001 w +.5 .10301 m +.50375 .10301 L +s +P +p +.001 w +.5 .12876 m +.50375 .12876 L +s +P +p +.001 w +.5 .15451 m +.50375 .15451 L +s +P +p +.001 w +.5 .20601 m +.50375 .20601 L +s +P +p +.001 w +.5 .23176 m +.50375 .23176 L +s +P +p +.001 w +.5 .25751 m +.50375 .25751 L +s +P +p +.001 w +.5 .28327 m +.50375 .28327 L +s +P +p +.001 w +.5 .33477 m +.50375 .33477 L +s +P +p +.001 w +.5 .36052 m +.50375 .36052 L +s +P +p +.001 w +.5 .38627 m +.50375 .38627 L +s +P +p +.001 w +.5 .41202 m +.50375 .41202 L +s +P +p +.001 w +.5 .46353 m +.50375 .46353 L +s +P +p +.001 w +.5 .48928 m +.50375 .48928 L +s +P +p +.001 w +.5 .51503 m +.50375 .51503 L +s +P +p +.001 w +.5 .54078 m +.50375 .54078 L +s +P +p +.001 w +.5 .02575 m +.50375 .02575 L +s +P +p +.001 w +.5 .59228 m +.50375 .59228 L +s +P +p +.002 w +.5 0 m +.5 .61803 L +s +P +P +0 0 m +1 0 L +1 .61803 L +0 .61803 L +closepath +clip +newpath +p +[ .025 .025 ] 0 setdash +p +.004 w +.02381 .30902 m +.04325 .27609 L +.06268 .2437 L +.08212 .21238 L +.10155 .18265 L +.12099 .155 L +.14043 .12987 L +.15986 .10768 L +.1793 .08881 L +.19874 .07354 L +.20845 .06735 L +.21817 .06215 L +.22789 .05796 L +.23275 .05625 L +.23761 .0548 L +.24247 .05362 L +.24733 .05269 L +.24976 .05233 L +.25219 .05203 L +.25462 .0518 L +.25583 .05171 L +.25705 .05164 L +.25826 .05158 L +.25887 .05155 L +.25948 .05154 L +.26008 .05152 L +.26069 .05151 L +.2613 .0515 L +.2619 .0515 L +.26251 .0515 L +.26312 .05151 L +.26373 .05152 L +.26433 .05154 L +.26494 .05155 L +.26555 .05158 L +.26676 .05164 L +.26798 .05171 L +.26919 .0518 L +.27162 .05203 L +.27405 .05233 L +.27648 .05269 L +.28134 .05362 L +.2862 .0548 L +.29592 .05796 L +.30564 .06215 L +.31535 .06735 L +.33479 .08071 L +.35423 .09781 L +.37366 .11838 L +.3931 .14209 L +Mistroke +.41254 .16853 L +.43197 .19729 L +.45141 .22787 L +.47085 .25979 L +.49028 .29252 L +.50972 .32552 L +.52915 .35824 L +.54859 .39016 L +.56803 .42075 L +.58746 .4495 L +.6069 .47594 L +.62634 .49965 L +.64577 .52022 L +.66521 .53733 L +.67493 .54449 L +.68465 .55069 L +.69436 .55589 L +.70408 .56007 L +.70894 .56178 L +.7138 .56323 L +.71866 .56442 L +.72352 .56534 L +.72595 .5657 L +.72838 .566 L +.73081 .56623 L +.73202 .56632 L +.73324 .5664 L +.73445 .56646 L +.73506 .56648 L +.73567 .5665 L +.73627 .56651 L +.73688 .56652 L +.73749 .56653 L +.7381 .56653 L +.7387 .56653 L +.73931 .56652 L +.73992 .56651 L +.74052 .5665 L +.74174 .56646 L +.74295 .5664 L +.74417 .56632 L +.74538 .56623 L +.74781 .566 L +.75024 .5657 L +.75267 .56534 L +.75753 .56442 L +.76239 .56323 L +.77211 .56007 L +.78183 .55589 L +.80126 .54449 L +Mistroke +.8207 .52923 L +.84014 .51035 L +.85957 .48817 L +.87901 .46304 L +.89845 .43538 L +.91788 .40565 L +.93732 .37434 L +.95675 .34195 L +.97619 .30902 L +Mfstroke +P +P +% End of Graphics +MathPictureEnd +end +%%EndDocument + @endspecial 36 2162 a Fs(\000)111 2106 y Fu(3)p 111 +2143 42 4 v 111 2219 a(2)313 2053 y Fs(\000)p Fu(1)571 +2162 y Fs(\000)646 2106 y Fu(1)p 646 2143 V 646 2219 +a(2)1148 2106 y(1)p 1148 2143 V 1148 2219 a(2)1416 2050 +y(1)1684 2106 y(3)p 1684 2143 V 1684 2219 a(2)773 2448 +y Fs(\000)p Fu(1)709 2220 y Fs(\000)p Fu(0)p Fn(:)p Fu(5)773 +1769 y(0)p Fn(:)p Fu(5)838 1542 y(1)1976 2517 y @beginspecial +212.597810 @hsize 131.390900 @vsize @setspecial +%%BeginDocument: optc.eps +%MMA2LTXCommandLine: mma2ltx -ucm -p -w7.5cm -c(0,2)=(0,1)(0pt,-5pt) optc.ps +% Mathematica v2.2 prologue +/Mathdict 150 dict def +Mathdict begin +/Mwidth 212.60 def +/Mheight 131.39 def +/Mnodistort true def +/Mlmarg 0 def /Mrmarg 0 def /Mbmarg 0 def /Mtmarg 0 def /Mtransform{} +bind def /Mfixwid true def /Mfixdash false def /Mrot 0 def /Mpstart{ +MathPictureStart}bind def /Mpend{MathPictureEnd}bind def /Mscale{0 1 0 1 +5 -1 roll MathScale}bind def /ISOLatin1Encoding dup where{pop pop}{[ +/.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef +/.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef +/.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef +/.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef +/space /exclam /quotedbl /numbersign /dollar /percent /ampersand +/quoteright /parenleft /parenright /asterisk /plus /comma /minus /period +/slash /zero /one /two /three /four /five /six /seven /eight /nine +/colon /semicolon /less /equal /greater /question /at /A /B /C /D /E /F +/G /H /I /J /K /L /M /N /O /P /Q /R /S /T /U /V /W /X /Y /Z /bracketleft +/backslash /bracketright /asciicircum /underscore /quoteleft /a /b /c /d +/e /f /g /h /i /j /k /l /m /n /o /p /q /r /s /t /u /v /w /x /y /z +/braceleft /bar /braceright /asciitilde /.notdef /.notdef /.notdef +/.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef +/.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /dotlessi /grave +/acute /circumflex /tilde /macron /breve /dotaccent /dieresis /.notdef +/ring /cedilla /.notdef /hungarumlaut /ogonek /caron /space /exclamdown +/cent /sterling /currency /yen /brokenbar /section /dieresis /copyright +/ordfeminine /guillemotleft /logicalnot /hyphen /registered /macron +/degree /plusminus /twosuperior /threesuperior /acute /mu /paragraph +/periodcentered /cedilla /onesuperior /ordmasculine /guillemotright +/onequarter /onehalf /threequarters /questiondown /Agrave /Aacute +/Acircumflex /Atilde /Adieresis /Aring /AE /Ccedilla /Egrave /Eacute +/Ecircumflex /Edieresis /Igrave /Iacute /Icircumflex /Idieresis /Eth +/Ntilde /Ograve /Oacute /Ocircumflex /Otilde /Odieresis /multiply +/Oslash /Ugrave /Uacute /Ucircumflex /Udieresis /Yacute /Thorn +/germandbls /agrave /aacute /acircumflex /atilde /adieresis /aring /ae +/ccedilla /egrave /eacute /ecircumflex /edieresis /igrave /iacute +/icircumflex /idieresis /eth /ntilde /ograve /oacute /ocircumflex +/otilde /odieresis /divide /oslash /ugrave /uacute /ucircumflex +/udieresis /yacute /thorn /ydieresis]def}ifelse /MFontDict 50 dict def +/MStrCat{exch dup length 2 index length add string dup 3 1 roll copy +length exch dup 4 2 roll exch putinterval}def /MCreateEncoding{1 index +255 string cvs(-)MStrCat 1 index MStrCat cvn exch(Encoding)MStrCat cvn +dup where{exch get}{pop StandardEncoding}ifelse 3 1 roll dup MFontDict +exch known not{1 index findfont dup length dict begin{1 index /FID ne{ +def}{pop pop}ifelse}forall /Encoding 3 index def currentdict end 1 index +exch definefont pop MFontDict 1 index null put}if exch pop exch pop}def +/ISOLatin1{(ISOLatin1)MCreateEncoding}def /ISO8859{(ISOLatin1) +MCreateEncoding}def /Mcopyfont{dup maxlength dict exch{1 index /FID eq{ +pop pop}{2 index 3 1 roll put}ifelse}forall}def /Plain /Courier findfont +Mcopyfont definefont pop /Bold /Courier findfont Mcopyfont +definefont pop /Italic /Courier findfont Mcopyfont definefont +pop /MathPictureStart{gsave Mtransform Mlmarg Mbmarg translate Mwidth +Mlmarg Mrmarg add sub /Mwidth exch def Mheight Mbmarg Mtmarg add sub +/Mheight exch def /Mtmatrix matrix currentmatrix def /Mgmatrix matrix +currentmatrix def}bind def /MathPictureEnd{grestore}bind def /MFill{0 0 +moveto Mwidth 0 lineto Mwidth Mheight lineto 0 Mheight lineto fill}bind +def /MPlotRegion{3 index Mwidth mul 2 index Mheight mul translate exch +sub Mheight mul /Mheight exch def exch sub Mwidth mul /Mwidth exch def} +bind def /MathSubStart{Momatrix Mgmatrix Mtmatrix Mwidth Mheight 7 -2 +roll moveto Mtmatrix setmatrix currentpoint Mgmatrix setmatrix 9 -2 roll +moveto Mtmatrix setmatrix currentpoint 2 copy translate /Mtmatrix matrix +currentmatrix def 3 -1 roll exch sub /Mheight exch def sub /Mwidth exch +def}bind def /MathSubEnd{/Mheight exch def /Mwidth exch def /Mtmatrix +exch def dup setmatrix /Mgmatrix exch def /Momatrix exch def}bind def +/Mdot{moveto 0 0 rlineto stroke}bind def /Mtetra{moveto lineto lineto +lineto fill}bind def /Metetra{moveto lineto lineto lineto closepath +gsave fill grestore 0 setgray stroke}bind def /Mistroke{flattenpath 0 0 +0{4 2 roll pop pop}{4 -1 roll 2 index sub dup mul 4 -1 roll 2 index sub +dup mul add sqrt 4 -1 roll add 3 1 roll}{stop}{stop}pathforall pop pop +currentpoint stroke moveto currentdash 3 -1 roll add setdash}bind def +/Mfstroke{stroke currentdash pop 0 setdash}bind def /Mrotsboxa{gsave dup +/Mrot exch def Mrotcheck Mtmatrix dup setmatrix 7 1 roll 4 index 4 index +translate rotate 3 index -1 mul 3 index -1 mul translate /Mtmatrix +matrix currentmatrix def grestore Msboxa 3 -1 roll /Mtmatrix exch def +/Mrot 0 def}bind def /Msboxa{newpath 5 -1 roll Mvboxa pop Mboxout 6 -1 +roll 5 -1 roll 4 -1 roll Msboxa1 5 -3 roll Msboxa1 Mboxrot[7 -2 roll 2 +copy[3 1 roll 10 -1 roll 9 -1 roll]6 1 roll 5 -2 roll]}bind def /Msboxa1 +{sub 2 div dup 2 index 1 add mul 3 -1 roll -1 add 3 -1 roll mul}bind def +/Mvboxa{Mfixwid{Mvboxa1}{dup Mwidthcal 0 exch{add}forall exch Mvboxa1 4 +index 7 -1 roll add 4 -1 roll pop 3 1 roll}ifelse}bind def /Mvboxa1{ +gsave newpath[true 3 -1 roll{Mbbox 5 -1 roll{0 5 1 roll}{7 -1 roll exch +sub(m)stringwidth pop .3 mul sub 7 1 roll 6 -1 roll 4 -1 roll Mmin 3 -1 +roll 5 index add 5 -1 roll 4 -1 roll Mmax 4 -1 roll}ifelse false}forall{ +stop}if counttomark 1 add 4 roll]grestore}bind def /Mbbox{1 dict begin 0 +0 moveto /temp(T)def{gsave currentpoint newpath moveto temp 0 3 -1 roll +put temp false charpath flattenpath currentpoint pathbbox grestore +moveto lineto moveto}forall pathbbox newpath end}bind def /Mmin{2 copy +gt{exch}if pop}bind def /Mmax{2 copy lt{exch}if pop}bind def /Mrotshowa{ +dup /Mrot exch def Mrotcheck Mtmatrix dup setmatrix 7 1 roll 4 index 4 +index translate rotate 3 index -1 mul 3 index -1 mul translate /Mtmatrix +matrix currentmatrix def Mgmatrix setmatrix Mshowa /Mtmatrix exch def +/Mrot 0 def}bind def /Mshowa{4 -2 roll moveto 2 index Mtmatrix setmatrix +Mvboxa 7 1 roll Mboxout 6 -1 roll 5 -1 roll 4 -1 roll Mshowa1 4 1 roll +Mshowa1 rmoveto currentpoint Mfixwid{Mshowax}{Mshoway}ifelse pop pop pop +pop Mgmatrix setmatrix}bind def /Mshowax{0 1 4 index length -1 add{2 +index 4 index 2 index get 3 index add moveto 4 index exch get Mfixdash{ +Mfixdashp}if show}for}bind def /Mfixdashp{dup length 1 gt 1 index true +exch{45 eq and}forall and{gsave(--)stringwidth pop(-)stringwidth pop sub +2 div 0 rmoveto dup length 1 sub{(-)show}repeat grestore}if}bind def +/Mshoway{3 index Mwidthcal 5 1 roll 0 1 4 index length -1 add{2 index 4 +index 2 index get 3 index add moveto 4 index exch get[6 index aload +length 2 add -1 roll{pop Strform stringwidth pop neg exch add 0 rmoveto} +exch kshow cleartomark}for pop}bind def /Mwidthcal{[exch{Mwidthcal1} +forall][exch dup Maxlen -1 add 0 1 3 -1 roll{[exch 2 index{1 index Mget +exch}forall pop Maxget exch}for pop]Mreva}bind def /Mreva{[exch aload +length -1 1{1 roll}for]}bind def /Mget{1 index length -1 add 1 index ge{ +get}{pop pop 0}ifelse}bind def /Maxlen{[exch{length}forall Maxget}bind +def /Maxget{counttomark -1 add 1 1 3 -1 roll{pop Mmax}for exch pop}bind +def /Mwidthcal1{[exch{Strform stringwidth pop}forall]}bind def /Strform{ +/tem(x)def tem 0 3 -1 roll put tem}bind def /Mshowa1{2 copy add 4 1 roll +sub mul sub -2 div}bind def /MathScale{Mwidth Mheight Mlp translate +scale /yscale exch def /ybias exch def /xscale exch def /xbias exch def +/Momatrix xscale yscale matrix scale xbias ybias matrix translate matrix +concatmatrix def /Mgmatrix matrix currentmatrix def}bind def /Mlp{3 copy +Mlpfirst{Mnodistort{Mmin dup}if 4 index 2 index 2 index Mlprun 11 index +11 -1 roll 10 -4 roll Mlp1 8 index 9 -5 roll Mlp1 4 -1 roll and{exit}if +3 -1 roll pop pop}loop exch 3 1 roll 7 -3 roll pop pop pop}bind def +/Mlpfirst{3 -1 roll dup length 2 copy -2 add get aload pop pop pop 4 -2 +roll -1 add get aload pop pop pop 6 -1 roll 3 -1 roll 5 -1 roll sub div +4 1 roll exch sub div}bind def /Mlprun{2 copy 4 index 0 get dup 4 1 roll +Mlprun1 3 copy 8 -2 roll 9 -1 roll{3 copy Mlprun1 3 copy 11 -3 roll /gt +Mlpminmax 8 3 roll 11 -3 roll /lt Mlpminmax 8 3 roll}forall pop pop pop +pop 3 1 roll pop pop aload pop 5 -1 roll aload pop exch 6 -1 roll +Mlprun2 8 2 roll 4 -1 roll Mlprun2 6 2 roll 3 -1 roll Mlprun2 4 2 roll +exch Mlprun2 6 2 roll}bind def /Mlprun1{aload pop exch 6 -1 roll 5 -1 +roll mul add 4 -2 roll mul 3 -1 roll add}bind def /Mlprun2{2 copy add 2 +div 3 1 roll exch sub}bind def /Mlpminmax{cvx 2 index 6 index 2 index +exec{7 -3 roll 4 -1 roll}if 1 index 5 index 3 -1 roll exec{4 1 roll pop +5 -1 roll aload pop pop 4 -1 roll aload pop[8 -2 roll pop 5 -2 roll pop +6 -2 roll pop 5 -1 roll]4 1 roll pop}{pop pop pop}ifelse}bind def /Mlp1{ +5 index 3 index sub 5 index 2 index mul 1 index le 1 index 0 le or dup +not{1 index 3 index div .99999 mul 8 -1 roll pop 7 1 roll}if 8 -1 roll 2 +div 7 -2 roll pop sub 5 index 6 -3 roll pop pop mul sub exch}bind def +/intop 0 def /inrht 0 def /inflag 0 def /outflag 0 def /xadrht 0 def +/xadlft 0 def /yadtop 0 def /yadbot 0 def /Minner{outflag 1 eq{/outflag +0 def /intop 0 def /inrht 0 def}if 5 index gsave Mtmatrix setmatrix +Mvboxa pop grestore 3 -1 roll pop dup intop gt{/intop exch def}{pop} +ifelse dup inrht gt{/inrht exch def}{pop}ifelse pop /inflag 1 def}bind +def /Mouter{/xadrht 0 def /xadlft 0 def /yadtop 0 def /yadbot 0 def +inflag 1 eq{dup 0 lt{dup intop mul neg /yadtop exch def}if dup 0 gt{dup +intop mul /yadbot exch def}if pop dup 0 lt{dup inrht mul neg /xadrht +exch def}if dup 0 gt{dup inrht mul /xadlft exch def}if pop /outflag 1 +def}{pop pop}ifelse /inflag 0 def /inrht 0 def /intop 0 def}bind def +/Mboxout{outflag 1 eq{4 -1 roll xadlft leadjust add sub 4 1 roll 3 -1 +roll yadbot leadjust add sub 3 1 roll exch xadrht leadjust add add exch +yadtop leadjust add add /outflag 0 def /xadlft 0 def /yadbot 0 def +/xadrht 0 def /yadtop 0 def}if}bind def /leadjust{(m)stringwidth pop .5 +mul}bind def /Mrotcheck{dup 90 eq{yadbot /yadbot xadrht def /xadrht +yadtop def /yadtop xadlft def /xadlft exch def}if dup cos 1 index sin +Checkaux dup cos 1 index sin neg exch Checkaux 3 1 roll pop pop}bind def +/Checkaux{4 index exch 4 index mul 3 1 roll mul add 4 1 roll}bind def +/Mboxrot{Mrot 90 eq{brotaux 4 2 roll}if Mrot 180 eq{4 2 roll brotaux 4 2 +roll brotaux}if Mrot 270 eq{4 2 roll brotaux}if}bind def /brotaux{neg +exch neg}bind def /Mabsproc{0 matrix defaultmatrix dtransform +idtransform dup mul exch dup mul add sqrt}bind def /Mabswid{Mabsproc +setlinewidth}bind def /Mabsdash{exch[exch{Mabsproc}forall]exch setdash} +bind def /MBeginOrig{Momatrix concat}bind def /MEndOrig{Mgmatrix +setmatrix}bind def /sampledsound where{pop}{/sampledsound{exch pop exch +5 1 roll mul 4 idiv mul 2 idiv exch pop exch /Mtempproc exch def{ +Mtempproc pop}repeat}bind def}ifelse /g{setgray}bind def /k{ +setcmykcolor}bind def /m{moveto}bind def /p{gsave}bind def /r{ +setrgbcolor}bind def /w{setlinewidth}bind def /C{curveto}bind def /F{ +fill}bind def /L{lineto}bind def /P{grestore}bind def /s{stroke}bind def +/setcmykcolor where{pop}{/setcmykcolor{4 1 roll[4 1 roll]{1 index sub 1 +sub neg dup 0 lt{pop 0}if dup 1 gt{pop 1}if exch}forall pop setrgbcolor} +bind def}ifelse /Mcharproc{currentfile(x)readhexstring pop 0 get exch +div}bind def /Mshadeproc{dup 3 1 roll{dup Mcharproc 3 1 roll}repeat 1 eq +{setgray}{3 eq{setrgbcolor}{setcmykcolor}ifelse}ifelse}bind def +/Mrectproc{3 index 2 index moveto 2 index 3 -1 roll lineto dup 3 1 roll +lineto lineto fill}bind def /Mcolorimage{7 1 roll pop pop matrix +invertmatrix concat 2 exch exp 1 sub 3 1 roll 1 1 2 index{1 1 4 index{ +dup 1 sub exch 2 index dup 1 sub exch 7 index 9 index Mshadeproc +Mrectproc}for pop}for pop pop pop pop}bind def /Mimage{pop matrix +invertmatrix concat 2 exch exp 1 sub 3 1 roll 1 1 2 index{1 1 4 index{ +dup 1 sub exch 2 index dup 1 sub exch 7 index Mcharproc setgray +Mrectproc}for pop}for pop pop pop}bind def +%MMA2LTXComment: Here follow the original Mathematica file stripped of the text strings +MathPictureStart +/Courier findfont 10 scalefont setfont +% Scaling calculations +0.5 0.151576 0.309017 0.257514 [ +[ -0.001 -0.001 0 0 ] +[ 1.001 .61903 0 0 ] +] MathScale +% Start of Graphics +1 setlinecap +1 setlinejoin +newpath +[ ] 0 setdash +0 g +p +p +.002 w +.04527 .30902 m +.04527 .31527 L +s +P +p +.002 w +.19685 .30902 m +.19685 .31527 L +s +P +p +.002 w +.34842 .30902 m +.34842 .31527 L +s +P +p +.002 w +.65158 .30902 m +.65158 .31527 L +s +P +p +.002 w +.80315 .30902 m +.80315 .31527 L +s +P +p +.002 w +.95473 .30902 m +.95473 .31527 L +s +P +p +.001 w +.07559 .30902 m +.07559 .31277 L +s +P +p +.001 w +.1059 .30902 m +.1059 .31277 L +s +P +p +.001 w +.13622 .30902 m +.13622 .31277 L +s +P +p +.001 w +.16653 .30902 m +.16653 .31277 L +s +P +p +.001 w +.22716 .30902 m +.22716 .31277 L +s +P +p +.001 w +.25748 .30902 m +.25748 .31277 L +s +P +p +.001 w +.28779 .30902 m +.28779 .31277 L +s +P +p +.001 w +.31811 .30902 m +.31811 .31277 L +s +P +p +.001 w +.37874 .30902 m +.37874 .31277 L +s +P +p +.001 w +.40905 .30902 m +.40905 .31277 L +s +P +p +.001 w +.43937 .30902 m +.43937 .31277 L +s +P +p +.001 w +.46968 .30902 m +.46968 .31277 L +s +P +p +.001 w +.53032 .30902 m +.53032 .31277 L +s +P +p +.001 w +.56063 .30902 m +.56063 .31277 L +s +P +p +.001 w +.59095 .30902 m +.59095 .31277 L +s +P +p +.001 w +.62126 .30902 m +.62126 .31277 L +s +P +p +.001 w +.68189 .30902 m +.68189 .31277 L +s +P +p +.001 w +.71221 .30902 m +.71221 .31277 L +s +P +p +.001 w +.74252 .30902 m +.74252 .31277 L +s +P +p +.001 w +.77284 .30902 m +.77284 .31277 L +s +P +p +.001 w +.83347 .30902 m +.83347 .31277 L +s +P +p +.001 w +.86378 .30902 m +.86378 .31277 L +s +P +p +.001 w +.8941 .30902 m +.8941 .31277 L +s +P +p +.001 w +.92441 .30902 m +.92441 .31277 L +s +P +p +.001 w +.01496 .30902 m +.01496 .31277 L +s +P +p +.001 w +.98504 .30902 m +.98504 .31277 L +s +P +p +.002 w +0 .30902 m +1 .30902 L +s +P +p +.002 w +.5 .0515 m +.50625 .0515 L +s +P +p +.002 w +.5 .18026 m +.50625 .18026 L +s +P +p +.002 w +.5 .43777 m +.50625 .43777 L +s +P +p +.002 w +.5 .56653 m +.50625 .56653 L +s +P +p +.001 w +.5 .07725 m +.50375 .07725 L +s +P +p +.001 w +.5 .10301 m +.50375 .10301 L +s +P +p +.001 w +.5 .12876 m +.50375 .12876 L +s +P +p +.001 w +.5 .15451 m +.50375 .15451 L +s +P +p +.001 w +.5 .20601 m +.50375 .20601 L +s +P +p +.001 w +.5 .23176 m +.50375 .23176 L +s +P +p +.001 w +.5 .25751 m +.50375 .25751 L +s +P +p +.001 w +.5 .28327 m +.50375 .28327 L +s +P +p +.001 w +.5 .33477 m +.50375 .33477 L +s +P +p +.001 w +.5 .36052 m +.50375 .36052 L +s +P +p +.001 w +.5 .38627 m +.50375 .38627 L +s +P +p +.001 w +.5 .41202 m +.50375 .41202 L +s +P +p +.001 w +.5 .46353 m +.50375 .46353 L +s +P +p +.001 w +.5 .48928 m +.50375 .48928 L +s +P +p +.001 w +.5 .51503 m +.50375 .51503 L +s +P +p +.001 w +.5 .54078 m +.50375 .54078 L +s +P +p +.001 w +.5 .02575 m +.50375 .02575 L +s +P +p +.001 w +.5 .59228 m +.50375 .59228 L +s +P +p +.002 w +.5 0 m +.5 .61803 L +s +P +P +0 0 m +1 0 L +1 .61803 L +0 .61803 L +closepath +clip +newpath +p +[ .025 .025 ] 0 setdash +p +.004 w +.02381 .30902 m +.04325 .27609 L +.06268 .2437 L +.08212 .21238 L +.10155 .18265 L +.12099 .155 L +.14043 .12987 L +.15986 .10768 L +.1793 .08881 L +.19874 .07354 L +.20845 .06735 L +.21817 .06215 L +.22789 .05796 L +.23275 .05625 L +.23761 .0548 L +.24247 .05362 L +.24733 .05269 L +.24976 .05233 L +.25219 .05203 L +.25462 .0518 L +.25583 .05171 L +.25705 .05164 L +.25826 .05158 L +.25887 .05155 L +.25948 .05154 L +.26008 .05152 L +.26069 .05151 L +.2613 .0515 L +.2619 .0515 L +.26251 .0515 L +.26312 .05151 L +.26373 .05152 L +.26433 .05154 L +.26494 .05155 L +.26555 .05158 L +.26676 .05164 L +.26798 .05171 L +.26919 .0518 L +.27162 .05203 L +.27405 .05233 L +.27648 .05269 L +.28134 .05362 L +.2862 .0548 L +.29592 .05796 L +.30564 .06215 L +.31535 .06735 L +.33479 .08071 L +.35423 .09781 L +.37366 .11838 L +.3931 .14209 L +Mistroke +.41254 .16853 L +.43197 .19729 L +.45141 .22787 L +.47085 .25979 L +.49028 .29252 L +.50972 .32552 L +.52915 .35824 L +.54859 .39016 L +.56803 .42075 L +.58746 .4495 L +.6069 .47594 L +.62634 .49965 L +.64577 .52022 L +.66521 .53733 L +.67493 .54449 L +.68465 .55069 L +.69436 .55589 L +.70408 .56007 L +.70894 .56178 L +.7138 .56323 L +.71866 .56442 L +.72352 .56534 L +.72595 .5657 L +.72838 .566 L +.73081 .56623 L +.73202 .56632 L +.73324 .5664 L +.73445 .56646 L +.73506 .56648 L +.73567 .5665 L +.73627 .56651 L +.73688 .56652 L +.73749 .56653 L +.7381 .56653 L +.7387 .56653 L +.73931 .56652 L +.73992 .56651 L +.74052 .5665 L +.74174 .56646 L +.74295 .5664 L +.74417 .56632 L +.74538 .56623 L +.74781 .566 L +.75024 .5657 L +.75267 .56534 L +.75753 .56442 L +.76239 .56323 L +.77211 .56007 L +.78183 .55589 L +.80126 .54449 L +Mistroke +.8207 .52923 L +.84014 .51035 L +.85957 .48817 L +.87901 .46304 L +.89845 .43538 L +.91788 .40565 L +.93732 .37434 L +.95675 .34195 L +.97619 .30902 L +Mfstroke +P +P +% End of Graphics +MathPictureEnd +end +%%EndDocument + @endspecial 1996 2121 a Fs(\000)2071 2065 y Fu(3)p 2071 +2102 V 2071 2178 a(2)2274 2065 y Fs(\000)p Fu(1)2531 +2121 y Fs(\000)2606 2065 y Fu(1)p 2606 2102 V 2606 2178 +a(2)3109 2065 y(1)p 3109 2102 V 3109 2178 a(2)3377 2065 +y(1)225 b(3)p 3644 2102 V 3644 2178 a(2)2734 2448 y Fs(\000)p +Fu(1)2669 2220 y Fs(\000)p Fu(0)p Fn(:)p Fu(5)2734 1769 +y(0)p Fn(:)p Fu(5)2799 1542 y(1)399 2637 y FI(Without)32 +b(`)p Fy(-c)p FI(')h(correction)1026 b(With)32 b(`)p +Fy(-c)p FI(')h(correction)1052 2834 y(Figure)e(2:)43 +b(Beha)m(viour)33 b(of)f(the)h(`)p Fy(-c)p FI(')g(option.)-79 +3239 y Fp(6.12)130 b(Option)45 b Fo(-e)-79 3424 y Fr(T)-9 +b(emplate:)42 b Fy(-e)p Fx(h)p FE(esc)-5 b(ap)g(e)35 +b(se)-5 b(quenc)g(e)7 b Fx(i)67 3569 y FI(This)43 b(option)f(tells)g +FE(mma2ltx)g FI(to)g(con)m(v)m(ert)i(in)m(to)e(L)1952 +3556 y FC(a)1998 3569 y FI(T)2052 3599 y(E)2107 3569 +y(X)h(only)f(the)h(lab)s(els)f(whic)m(h)h(b)s(egin)f(with)g(the)-79 +3690 y(sequence)35 b Fx(h)p FE(esc)-5 b(ap)g(e)34 b(se)-5 +b(quenc)g(e)7 b Fx(i)p FI(.)43 b(F)-8 b(or)32 b(instance)h(with)1267 +3893 y Fy(mma2ltx)53 b(-elatex:)35 b FI(m)m(ypic.ps)-79 +4096 y(only)d(lab)s(els)f(whic)m(h)i(b)s(egin)f(with)g(the)h(string)f +(\\)p Fy(latex:)p FI(")45 b(will)30 b(b)s(e)j(con)m(v)m(erted.)45 +b(Other)33 b(lab)s(els)e(are)i(left)f(as)-79 4217 y(in)g(the)h +(original)c FD(Mathematica)j FI(graphic.)-79 4506 y Fp(6.13)130 +b(Option)45 b Fo(-a)-79 4690 y Fr(T)-9 b(emplate:)42 +b Fy(-a)p FI([)p Fx(h)p FE(length)7 b Fx(i)p FI(:)p Fx(h)p +FE(width)g Fx(i)p FI(:)p Fx(h)p FE(inset)i Fx(i)p FI(])67 +4836 y(Using)41 b(this)g(option,)h FE(mma2ltx)e FI(will)e(add)j(t)m(w)m +(o)h(arro)m(ws)f(on)g(the)h Fq(x)f FI(and)g Fq(y)j FI(axes)e(of)f(a)f +(2D)g(graphic.)-79 4956 y Fx(h)p FE(length)7 b Fx(i)p +FI(,)35 b Fx(h)p FE(width)7 b Fx(i)34 b FI(and)g Fx(h)p +FE(inset)9 b Fx(i)35 b FI(are)f(optional)e(parameters)j(to)f(sp)s +(ecify)h(the)g(arro)m(w)g(size,)g(as)g(sho)m(wn)g(in)-79 +5076 y(\014gure)e(3.)67 5197 y(F)-8 b(or)32 b(instance)229 +5400 y Fy(mma2ltx)53 b(-a)f(mypic.ps)-79 5604 y FI(or)1856 +5828 y(6)p eop +%%Page: 7 8 +7 7 bop 345 1426 a @beginspecial -12 @llx -36 @lly 106 +@urx 38 @ury 1180 @rwi @setspecial +%%BeginDocument: arrparm.1 +%*Font: cmti10 9.96265 9.96265 64:dca19 + 0.1 setgray +newpath 0 0 moveto +-11.33862 22.67725 lineto +68.03174 0 lineto +-11.33862 -22.67725 lineto + closepath fill + 0 setgray 0 0.5 dtransform truncate idtransform setlinewidth pop [] 0 setdash + 1 setlinejoin 10 setmiterlimit +newpath 0 0 moveto +-11.33862 22.67725 lineto +68.03174 0 lineto +-11.33862 -22.67725 lineto + closepath stroke + 1 setlinecap +newpath -11.33862 -34.01587 moveto +68.03174 -34.01587 lineto stroke +newpath 64.336 -35.54674 moveto +68.03174 -34.01587 lineto +64.336 -32.485 lineto + closepath +gsave fill grestore stroke +newpath -7.64288 -32.485 moveto +-11.33862 -34.01587 lineto +-7.64288 -35.54674 lineto + closepath +gsave fill grestore stroke + 0.5 0 dtransform exch truncate exch idtransform pop setlinewidth +newpath 79.37036 22.67725 moveto +79.37036 -22.67725 lineto stroke + 0 0.5 dtransform truncate idtransform setlinewidth pop +newpath 77.83957 -18.98167 moveto +79.37036 -22.67725 lineto +80.90115 -18.98167 lineto + closepath +gsave fill grestore stroke +newpath 80.90115 18.98167 moveto +79.37036 22.67725 lineto +77.83957 18.98167 lineto + closepath +gsave fill grestore stroke +newpath -11.33862 28.34656 moveto +0 28.34656 lineto stroke +newpath -3.69557 26.81577 moveto +0 28.34656 lineto +-3.69557 29.87735 lineto + closepath +gsave fill grestore stroke +newpath -7.64305 29.87735 moveto +-11.33862 28.34656 lineto +-7.64305 26.81577 lineto + closepath +gsave fill grestore stroke +9.81999 -29.07867 moveto +(length) cmti10 9.96265 fshow +82.37036 -3.45926 moveto +(width) cmti10 9.96265 fshow +-10.56125 31.34656 moveto +(inset) cmti10 9.96265 fshow +showpage +%%EndDocument + @endspecial 1172 w @beginspecial 226.771000 @hsize 140.150100 +@vsize @setspecial +%%BeginDocument: arrsamp.eps +%Mma2ltxCommandLine: mma2ltx -a -ucm -w8cm arrsamp.ps +%Mma2ltxComment: For use with Mathematica prologue 'texmma22.pro' +Mathdict begin +/Mwidth 226.77 def +/Mheight 140.15 def +/Mnodistort true def +%Mma2ltxComment: Here follow the original Mathematica file stripped of the text labels +MathPictureStart +/Courier findfont 10 scalefont setfont +% Scaling calculations +0.5 0.10352 0.206011 0.103006 [ +[ -0.001 -0.001 0 0 ] +[ 1.001 .61903 0 0 ] +] MathScale +% Start of Graphics +1 setlinecap +1 setlinejoin +newpath +[ ] 0 setdash +0 g +p +p +.002 w +0 .20601 m +1 .20601 L +s +P +p +.002 w +.5 0 m +.5 .61803 L +s +P +P +0 0 m +1 0 L +1 .61803 L +0 .61803 L +closepath +clip +newpath +p +p +p +.004 w +.18944 .41202 m +.21532 .41202 L +.2412 .41202 L +.26708 .41202 L +.29296 .41202 L +.31884 .41202 L +.34472 .41202 L +.3706 .41202 L +.39648 .41202 L +.42236 .41202 L +.44824 .41202 L +.47412 .41202 L +.5 .41202 L +.52588 .41202 L +.55176 .41202 L +.57764 .41202 L +.60352 .41202 L +.6294 .41202 L +.65528 .41202 L +.68116 .41202 L +.70704 .41202 L +.73292 .41202 L +.7588 .41202 L +.78468 .41202 L +.81056 .41202 L +s +P +P +p +[ .01 .01 ] 0 setdash +.004 w +.18944 .20601 m +.18944 .41202 L +s +.81056 .20601 m +.81056 .41202 L +s +P +P +p +0 w +0 g +1.00100 0.20601 m +0.97600 0.21201 L +0.98200 0.20601 L +0.97600 0.20001 L +F +P +p +0 w +0 g +0.50000 0.61903 m +0.49400 0.59403 L +0.50000 0.60003 L +0.50600 0.59403 L +F +P +% End of Graphics +MathPictureEnd +end +%%EndDocument + @endspecial 2501 324 a Fq(p)2550 339 y Fm(T)2605 324 +y FI(\()p Fq(t)p FI(\))2964 1150 y Fq(T)11 b(=)p FI(2)-1374 +b Fx(\000)p Fq(T)11 b(=)p FI(2)2482 609 y(1)2482 1139 +y(0)3381 1136 y Fq(t)1007 1623 y FI(Figure)31 b(3:)43 +b(Examples)33 b(with)f(the)h(`)p Fy(-a)p FI(')g(option.)229 +1877 y Fy(mma2ltx)53 b(-a)f(0.02:0.01:0.005)j(mypic.ps)67 +2060 y FI(The)45 b(three)g(parameters)f Fx(h)p FE(length)7 +b Fx(i)p FI(,)46 b Fx(h)p FE(width)7 b Fx(i)p FI(,)47 +b Fx(h)p FE(inset)9 b Fx(i)43 b FI(m)m(ust)h(b)s(e)g(sp)s(eci\014ed)h +(as)f(a)g(fraction)f(of)g(the)-79 2181 y(picture)33 b(size)g(\(scaled)f +(co)s(ordinates\).)43 b(Default)31 b(v)-5 b(alues)33 +b(are)1523 2377 y FE(lenght)82 b FI(=)h(0)p Fq(:)p FI(025)1548 +2522 y FE(width)f FI(=)h(0)p Fq(:)p FI(012)1572 2667 +y FE(inset)g FI(=)g(0)p Fq(:)p FI(006)-79 2997 y FB(7)158 +b(Including)54 b Fz(mma2ltx)f FB(\014gures)-79 3216 y +FI(T)-8 b(o)27 b(include)f(a)g(picture)g(pro)s(cessed)i(b)m(y)g +FE(mma2ltx)d FI(in)m(to)h(a)53 b(L)2056 3203 y FC(a)2102 +3216 y FI(T)2156 3246 y(E)2210 3216 y(X)27 b(do)s(cumen)m(t,)h(\014rst) +f(y)m(ou)g(should)f(mo)m(v)m(e)h(the)-79 3336 y(\014le)21 +b(`)p Fy(mmatext.sty)p FI(')k(in)c(y)m(our)i(L)1048 3323 +y FC(a)1094 3336 y FI(T)1148 3366 y(E)1202 3336 y(X)f(input)f +(directory)h(and)g(the)g(\014les)g(`)p Fy(texmma22.pro)p +FI(',)27 b(`)p Fy(mmawhite.eps)p FI(')-79 3456 y(in)k(y)m(our)i(T)310 +3478 y(E)364 3456 y(X)g(P)m(ostScript)f(directory)1327 +3420 y FA(6)1367 3456 y FI(.)43 b(Then)33 b(include)f(the)g(st)m(yle)h +(`)p Fy(mmatext)p FI(')h(at)e(the)g(top)g(of)g(y)m(our)g(do)s(c-)-79 +3577 y(umen)m(t:)331 3760 y Fy(\\documentstyle[...,mmate)q(xt,.)q(..])q +({...)q(})-79 3943 y FI(and)h(in)m(v)m(ok)m(e)h(the)f(follo)m(wing)c +(macro)j(at)g(the)h(p)s(oin)m(t)f(where)i(y)m(ou)f(wish)g(to)f(include) +g(the)h(picture:)331 4125 y Fy(\\input{mypic})-79 4308 +y FI(where)53 b(`)p Fy(mypic)p FI(')f(is)f(the)h(name)f(of)g(the)h +(\014le)e(pro)s(cessed)k(b)m(y)e FE(mma2ltx)p FI(.)99 +b(Note)51 b(that)g(the)h(command)-79 4429 y(`)p Fy(\\input{mypic})p +FI(')30 b(ma)m(y)c(b)s(e)g(in)m(v)m(ok)m(ed)h(within)e(an)m(y)i(L)1848 +4416 y FC(a)1894 4429 y FI(T)1948 4459 y(E)2003 4429 +y(X)f(en)m(vironmen)m(t,)i(for)d(instance)i(the)f(commands:)331 +4612 y Fy(\\begin{figure})485 4732 y(\\centering)485 +4852 y(\\tabcolsep=1cm)485 4973 y(\\begin{tabular}{cc})639 +5093 y(\\input{mypic1})55 b(&\\input{mypic2})g(\\\\[2cm])639 +5213 y(\\input{mypic3})g(&\\input{mypic4})485 5334 y(\\end{tabular})331 +5454 y(\\end{figure})p -79 5538 1568 4 v 33 5599 a Fw(6)71 +5629 y Fu(This)27 b(is)h(the)g(directory)e(where)h(y)n(ou)g(k)n(eep)g +(the)h Ft(dvips)d Fu(prologue)h(\014les.)1856 5828 y +FI(7)p eop +%%Page: 8 9 +8 8 bop -79 332 a FI(will)37 b(pro)s(duce)j(a)f(\014gure)g(con)m +(taining)f(four)h FD(Mathematica)f FI(pictures.)63 b(Sometimes,)40 +b(during)e(the)i(L)3612 319 y FC(a)3658 332 y FI(T)3712 +362 y(E)3767 332 y(X)-79 452 y(pro)s(cessing)33 b(of)f(a)g(L)609 +439 y FC(a)655 452 y FI(T)709 482 y(E)764 452 y(X)h(\014le)f(con)m +(taining)f(one)i(or)f(more)g FE(mma2ltx)g FI(pictures)h(a)f(message)h +(as)331 656 y Fy(Mathematica)54 b(picture:)g('mypic.eps')g +(deltax=0.48502)h(cm)-79 859 y FI(or)32 b(a)h(message)g(as)331 +1063 y Fy(Mathematica)54 b(picture:)g('mypic.eps')g(deltay=1.28744)h +(cm)-79 1266 y FI(or)35 b(b)s(oth,)h(could)f(app)s(ear.)52 +b(If)36 b(this)f(happ)s(ens)h(it)f(means)g(that)g(the)h(picture)g(is)f +(wider)g(or)g(higher)g(\(b)m(y)h(the)-79 1386 y(amoun)m(t)c(sho)m(wn\)) +i(than)f(the)g(picture)f(whose)i(dimensions)e(w)m(ere)h(established)g +(with)f FE(mma2ltx)p FI(.)-79 1719 y FB(8)158 b(Generating)55 +b Fc(Mathematica)49 b FB(pictures)-79 1938 y FE(mma2ltx)24 +b FI(needs)i(a)e(P)m(ostScript)h(\014le.)40 b(This)25 +b(\014le)f(m)m(ust)h(b)s(e)g(created)g(from)e(within)h +FD(Mathematica)f FI(using)h(the)-79 2059 y(primitiv)m(e)f(`)p +Fy(Display)p FI(')j(\(see)g(the)f FD(Mathematica)f FI(man)m(ual)f(for)h +(a)g(detailed)g(description)g(of)h(this)f(primitiv)m(e\).)67 +2179 y(Since)47 b FE(mma2ltx)f FI(just)h(executes)j(a)c(plain)f +(translation)g(of)h(ev)m(ery)j(string)d(con)m(tained)h(in)f(the)h +FD(Ma-)-79 2299 y(thematica)e FI(P)m(ostScript)i(\014le,)j(w)m(e)d(ma)m +(y)f(sp)s(ecify)h(a)f(L)1922 2286 y FC(a)1968 2299 y +FI(T)2022 2329 y(E)2077 2299 y(X)g(con)m(trol)g(sequence)j(directly)d +(from)f(within)-79 2420 y FD(Mathematica)p FI(.)d(F)-8 +b(or)32 b(instance,)h(to)f(mark)g(tic)m(ks)i(with)e(the)h(L)2150 +2407 y FC(a)2196 2420 y FI(T)2250 2450 y(E)2304 2420 +y(X)g(greek)h(letter)e(`)p Fq(\031)t FI(',)g(w)m(e)i(ma)m(y)e(use)75 +2623 y Fy(Show[g,)53 b(Ticks)g(->)e({{0,)i({Pi/2,)g +("\\\\pi\\\\over2"},)i({Pi,)d("\\\\pi"},)946 2744 y({3Pi/2,)i +("3{\\\\Pi\\\\over2}"},)i({2Pi,)c("2\\\\pi"},)i(Automatic}])67 +2947 y FI(Note,)32 b(to)f(obtain)f(the)h(bac)m(kslash)h(`)p +Fy(\\)p FI(')g(from)e(within)g FD(Mathematica)f FI(it)h(m)m(ust)i(b)s +(e)f(doubled.)43 b(So)31 b(ev)m(ery)-79 3067 y(L)-53 +3054 y FC(a)-7 3067 y FI(T)47 3097 y(E)102 3067 y(X)h(con)m(trol)g +(sequence)k(sp)s(eci\014ed)d(in)m(to)f(a)g FD(Mathematica)g +FI(string)f(m)m(ust)i(b)s(e)g(preceded)h(b)m(y)g(a)e(`)p +Fy(\\\\)p FI('.)67 3188 y(F)-8 b(or)32 b(example)g(to)h(place)f(the)h +(form)m(ula)1614 3447 y Fq(f)11 b FI(\()p Fq(x)p FI(\))28 +b(=)f(sin)2085 3379 y(1)p 2082 3423 56 4 v 2082 3515 +a Fq(x)-79 3698 y FI(at)38 b(the)h(p)s(oin)m(t)e(\(0)p +Fq(:)p FI(5)p Fq(;)17 b FI(0)p Fq(:)p FI(5\))37 b(of)h(a)g(graphic,)h +(left)f(and)g(b)s(ottom)f(aligned,)h(w)m(e)i(ma)m(y)e(use)h(the)g +FD(Mathematica)-79 3818 y FI(command)331 4021 y Fy +(Text["f\(x\)=\\\\sin\\\\frac{1)q(}{x})q(",)58 b({0.5,0.5},)53 +b({-1,-1}])-79 4354 y FB(9)158 b(Manual)54 b(adjustment)h(of)d(lab)t +(els)-79 4573 y FI(Sometimes)28 b(ma)m(y)i(happ)s(ens)g(to)g(ha)m(v)m +(e)g(t)m(w)m(o)h(or)e(more)g(lab)s(els)f(to)s(o)h(m)m(uc)m(h)h(closed)g +(eac)m(h)g(other.)43 b(In)30 b(this)f(case)-79 4694 y(a)37 +b(man)m(ual)f(adjustmen)m(t)i(is)f(needed.)59 b(T)-8 +b(o)37 b(do)h(this,)g(edit)f(the)g(\014le)g(generated)i(b)m(y)f +FE(mma2ltx)e FI(ha)m(ving)h(the)-79 4814 y(extension)d(`)p +Fy(.tex)p FI('.)44 b(F)-8 b(or)32 b(instance,)h(let's)f(analyze)h(the)g +(\014le)f(`)p Fy(mypic.tex)p FI(':)-79 5017 y Fy(\045)52 +b(Picture:)h(mypic.eps)-79 5138 y(\045)f(Created)h(by)f(mma2ltx)h(v1.2) +f(-)g(Copyright)h(\(C\))f(1994)h(Giuseppe)g(Ghib\\`o)-79 +5258 y(\045)f(Command)h(line)f(:)g(mma2ltx)h(-ucm)f(-w10cm)h +(-sfootnotesize)i(mypic.ps)-79 5379 y(\045)d(Creation)h(date:)g(Sat)f +(Jul)g(16)g(10:40:43)h(1994)-79 5499 y(\\mmaheaderprotrue)-79 +5619 y({\045)1856 5828 y FI(8)p eop +%%Page: 9 10 +9 9 bop -79 332 a Fy(\\footnotesize\045)-79 452 y +(\\mmasetpic\(10.0000,6.180)q(3\)[c)q(m]{m)q(ypic)q(.ep)q(s})-79 +573 y(\\mmatextfits\(2.152,3.090)q(\)\(0,)q(2\){$)q(0.2$)q(})-79 +693 y(\\mmatextfits\(4.051,3.090)q(\)\(0,)q(2\){$)q(0.4$)q(})-79 +814 y(\\mmatextfits\(5.949,3.090)q(\)\(0,)q(2\){$)q(0.6$)q(})-79 +934 y(\\mmatextfits\(7.848,3.090)q(\)\(0,)q(2\){$)q(0.8$)q(})-79 +1054 y(\\mmatextfits\(9.747,3.090)q(\)\(0,)q(2\){$)q(1$})-79 +1175 y(\\mmatextfits\(0.129,0.157)q(\)\(1,)q(0\){$)q(-1$})-79 +1295 y(\\mmatextfits\(0.129,1.623)q(\)\(1,)q(0\){$)q(-0.5)q($})-79 +1416 y(\\mmatextfits\(0.129,4.557)q(\)\(1,)q(0\){$)q(0.5$)q(})-79 +1536 y(\\mmatextfits\(0.129,6.024)q(\)\(1,)q(0\){$)q(1$})-79 +1656 y(\\mmatextfits\(5.000,4.557)q(\)\(-1)q(,-1\))q({$f\()q(x\)=)58 +b(\\sin)52 b(\\frac{1}{x}$})-79 1777 y(\\begin{mmapicture})-79 +1897 y(\\mmaputtext\(2.152,3.090\))q(\(0,2)q(\){$0)q(.2$})-79 +2017 y(\\mmaputtext\(4.051,3.090\))q(\(0,2)q(\){$0)q(.4$})-79 +2138 y(\\mmaputtext\(5.949,3.090\))q(\(0,2)q(\){$0)q(.6$})-79 +2258 y(\\mmaputtext\(7.848,3.090\))q(\(0,2)q(\){$0)q(.8$})-79 +2379 y(\\mmaputtext\(9.747,3.090\))q(\(0,2)q(\){$1)q($})-79 +2499 y(\\mmaputtext\(0.129,0.157\))q(\(1,0)q(\){$-)q(1$})-79 +2619 y(\\mmaputtext\(0.129,1.623\))q(\(1,0)q(\){$-)q(0.5$)q(})-79 +2740 y(\\mmaputtext\(0.129,4.557\))q(\(1,0)q(\){$0)q(.5$})-79 +2860 y(\\mmaputtext\(0.129,6.024\))q(\(1,0)q(\){$1)q($})-79 +2980 y(\\mmaputtext\(5.000,4.557\))q(\(-1,)q(-1\){)q($f\(x)q(\)=)58 +b(\\sin)52 b(\\frac{1}{x}$})-79 3101 y(\\end{mmapicture}\045)-79 +3221 y(}\045)-79 3414 y FI(W)-8 b(e)52 b(ma)m(y)e(observ)m(e)j(that)e +(ev)m(ery)i(lab)s(el)c(app)s(ears)i(t)m(wice)h(in)e(the)i +Fy(.tex)g FI(\014le:)80 b(within)49 b(the)j(command)-79 +3534 y Fy(\\mmatextfits)25 b FI(and)d(in)f(the)h(command)f +Fy(\\mmaputtext)j FI(\(and)e(sometimes)f(in)g(the)h(command)e +Fy(\\mmaputtext*)p FI(\).)-79 3655 y(These)34 b(commands)e(ha)m(v)m(e)i +(the)f(follo)m(wing)d(syn)m(tax:)858 3847 y Fy(\\mmatextfits\()p +Fq(x;)17 b(y)t Fy(\)\()p Fq(s)1820 3862 y Fm(x)1867 3847 +y Fq(;)g(s)1957 3862 y Fm(y)1998 3847 y Fy(\))p FI([)p +Fy(\()p FE(o\013)2237 3862 y Fb(x)2282 3847 y Fq(;)g +FE(o\013)2436 3862 y Fb(y)2480 3847 y Fy(\))p FI(])p +Fy({)p FE(obje)-5 b(ct)p Fy(})858 3968 y(\\mmaputtext)54 +b(\()p Fq(x;)17 b(y)t Fy(\)\()p Fq(s)1823 3983 y Fm(x)1867 +3968 y Fq(;)g(s)1957 3983 y Fm(y)1998 3968 y Fy(\))p +FI([)p Fy(\()p FE(o\013)2237 3983 y Fb(x)2282 3968 y +Fq(;)g FE(o\013)2436 3983 y Fb(y)2480 3968 y Fy(\))p +FI(])p Fy({)p FE(obje)-5 b(ct)p Fy(})858 4088 y(\\mmaputtext*\()p +Fq(x;)17 b(y)t Fy(\)\()p Fq(s)1820 4103 y Fm(x)1867 4088 +y Fq(;)g(s)1957 4103 y Fm(y)1998 4088 y Fy(\))p FI([)p +Fy(\()p FE(o\013)2237 4103 y Fb(x)2282 4088 y Fq(;)g +FE(o\013)2436 4103 y Fb(y)2480 4088 y Fy(\))p FI(])p +Fy({)p FE(obje)-5 b(ct)p Fy(})-79 4281 y FI(where)37 +b(\()p Fq(x;)17 b(y)t FI(\))36 b(are)g(the)g(co)s(ordinates)g(of)g(the) +g(reference)i(p)s(oin)m(t.)53 b(\()p Fq(s)2414 4296 y +Fm(x)2458 4281 y Fq(;)17 b(s)2548 4296 y Fm(y)2589 4281 +y FI(\))36 b(are)g(the)h(b)s(ounding)e(b)s(o)m(x)i(co)s(or-)-79 +4401 y(dinates)g(as)g(explained)g(at)g Fx(x)p FI(6.11.)56 +b(\()p FE(o\013)1400 4416 y Fb(x)1445 4401 y Fq(;)17 +b FE(o\013)1599 4416 y Fb(y)1643 4401 y FI(\))36 b(is)h(an)g(optional)e +(argumen)m(t)h(and)h(represen)m(ts)j(the)d(o\013set)-79 +4521 y(in)42 b(the)h Fq(x)f FI(and)h Fq(y)i FI(direction)d(from)f(the)i +(reference)h(p)s(oin)m(t)d(\()p Fq(x;)17 b(y)t FI(\).)72 +b Fx(f)p FE(obje)-5 b(ct)9 b Fx(g)42 b FI(ma)m(y)g(b)s(e)h(an)m(y)g(L) +3434 4508 y FC(a)3480 4521 y FI(T)3534 4551 y(E)3589 +4521 y(X)f(ob-)-79 4642 y(ject)49 b(\(ev)m(en)g(another)g +FE(mma2ltx)e FI(picture\).)90 b(The)50 b(unit)d(of)h(measure)g(is)g +(the)h(one)f(whic)m(h)h(app)s(ears)f(in)-79 4762 y(`)p +Fy(\\mmasetpic)p FI(')32 b(command)27 b(\(in)h(this)h(case)h +Fy(cm)p FI(\).)42 b(The)30 b(command)e(`)p Fy(\\mmaputtext*)p +FI(')k(has)d(the)g(same)g(e\013ect)-79 4883 y(of)35 b(`)p +Fy(\\mmaputtext)p FI(',)k(except)d(it)e(encloses)j(the)e +FE(obje)-5 b(ct)35 b FI(in)f(a)h(white)g(b)s(o)m(x)g(\(see)h(the)g(lab) +s(el)d(\\some)i(text")g(in)-79 5003 y(the)e(3D)f(graphic)g(sho)m(wn)i +(in)d(Fig.)h(4\).)67 5123 y(F)-8 b(or)25 b(instance)g(supp)s(ose)h(w)m +(e)g(w)m(an)m(t)g(to)f(mo)m(v)m(e)g(righ)m(t)f(the)i(lab)s(el)d(`0)p +Fq(:)p FI(2')i(b)m(y)h(0)p Fq(:)p FI(5)17 b(cm)n(,)27 +b(then)f(w)m(e)g(m)m(ust)f(replace)-79 5244 y(the)33 +b(line)331 5436 y Fy(\\mmatextfits\(2.152,3.090)q(\)\(0,)q(2\){)q($0.2) +q($})-79 5629 y FI(with)f(the)h(line)1856 5828 y(9)p +eop +%%Page: 10 11 +10 10 bop 331 332 a Fy(\\mmatextfits\(2.152,3.090)q(\)\(0,)q(2\)\()q +(0.5,)q(0\){$)q(0.2$)q(})-79 535 y FI(and)33 b(the)g(line)331 +739 y Fy(\\mmaputtext\(2.152,3.090\))q(\(0,2)q(\){$)q(0.2$)q(})-79 +942 y FI(with)f(the)h(line)331 1146 y Fy(\\mmaputtext\(2.152,3.090\))q +(\(0,2)q(\)\(0)q(.5,0)q(\){$0)q(.2$})-79 1349 y FI(Note)g(that)f(this)g +(approac)m(h)g(is)g(similar)d(to)j(the)h(one)f(explained)g(at)g +Fx(x)p FI(6.11,)g(with)g(the)h(exception)g(that)f(w)m(e)-79 +1469 y(ma)m(y)g(con)m(trol)g(ev)m(ery)j(lab)s(el,)c(rather)h(than)h(a)f +(group)h(of)f(lab)s(els.)67 1590 y(No)m(w)41 b(supp)s(ose)g(w)m(e)g(w)m +(an)m(t)g(to)e(replace)h(the)g(lab)s(el)e(`0)p Fq(:)p +FI(8')i(placed)f(under)i(the)f Fq(x)p FI(-axis)g(with)f(the)i(lab)s(el) +-79 1710 y(`)p Fq(x)3 1725 y FA(1)43 1710 y FI(')36 b(to)f(place)g(o)m +(v)m(er)i(the)f Fq(x)p FI(-axis)f(with)g(the)h(lo)m(w)g(edge)g(of)f +(the)h(\(in)m(visible\))e(b)s(o)m(x)i(that)f(b)s(ounds)h(this)g(lab)s +(el)-79 1831 y(at)c(0)p Fq(:)p FI(2)17 b(cm)32 b(from)f(the)i +Fq(x)p FI(-axis.)43 b(In)33 b(this)f(case)i(w)m(e)g(m)m(ust)e(replace)h +(the)g(lines)331 2034 y Fy(\\mmatextfits\(7.848,3.090)q(\)\(0,)q(2\){)q +($0.8)q($})331 2154 y(.)331 2275 y(.)331 2395 y(.)331 +2516 y(\\mmaputtext\(7.848,3.090\))q(\(0,2)q(\){$)q(0.8$)q(})-79 +2719 y FI(with)f(the)h(lines)331 2922 y Fy(\\mmatextfits\(7.848,3.090)q +(\)\(0,)q(-1\))q(\(0,0)q(.2\){)q($x_1)q($})331 3043 y(.)331 +3163 y(.)331 3284 y(.)331 3404 y(\\mmaputtext\(7.848,3.090\))q(\(0,-)q +(1\)\()q(0,0.)q(2\){$)q(x_1$)q(})-79 3607 y FI(The)h(result)e(is)g(sho) +m(wn)i(in)e(Fig.)f(4.)769 5203 y @beginspecial 283.463750 +@hsize 175.189030 @vsize @setspecial +%%BeginDocument: 12mag.eps +%MMA2LTXCommandLine: mma2ltx -ucm -sfootnotesize -p -w10cm 12mag.ps +% Mathematica v2.2 prologue +/Mathdict 150 dict def +Mathdict begin +/Mwidth 283.46 def +/Mheight 175.19 def +/Mnodistort true def +/Mlmarg 0 def /Mrmarg 0 def /Mbmarg 0 def /Mtmarg 0 def /Mtransform{} +bind def /Mfixwid true def /Mfixdash false def /Mrot 0 def /Mpstart{ +MathPictureStart}bind def /Mpend{MathPictureEnd}bind def /Mscale{0 1 0 1 +5 -1 roll MathScale}bind def /ISOLatin1Encoding dup where{pop pop}{[ +/.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef +/.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef +/.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef +/.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef +/space /exclam /quotedbl /numbersign /dollar /percent /ampersand +/quoteright /parenleft /parenright /asterisk /plus /comma /minus /period +/slash /zero /one /two /three /four /five /six /seven /eight /nine +/colon /semicolon /less /equal /greater /question /at /A /B /C /D /E /F +/G /H /I /J /K /L /M /N /O /P /Q /R /S /T /U /V /W /X /Y /Z /bracketleft +/backslash /bracketright /asciicircum /underscore /quoteleft /a /b /c /d +/e /f /g /h /i /j /k /l /m /n /o /p /q /r /s /t /u /v /w /x /y /z +/braceleft /bar /braceright /asciitilde /.notdef /.notdef /.notdef +/.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef +/.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /dotlessi /grave +/acute /circumflex /tilde /macron /breve /dotaccent /dieresis /.notdef +/ring /cedilla /.notdef /hungarumlaut /ogonek /caron /space /exclamdown +/cent /sterling /currency /yen /brokenbar /section /dieresis /copyright +/ordfeminine /guillemotleft /logicalnot /hyphen /registered /macron +/degree /plusminus /twosuperior /threesuperior /acute /mu /paragraph +/periodcentered /cedilla /onesuperior /ordmasculine /guillemotright +/onequarter /onehalf /threequarters /questiondown /Agrave /Aacute +/Acircumflex /Atilde /Adieresis /Aring /AE /Ccedilla /Egrave /Eacute +/Ecircumflex /Edieresis /Igrave /Iacute /Icircumflex /Idieresis /Eth +/Ntilde /Ograve /Oacute /Ocircumflex /Otilde /Odieresis /multiply +/Oslash /Ugrave /Uacute /Ucircumflex /Udieresis /Yacute /Thorn +/germandbls /agrave /aacute /acircumflex /atilde /adieresis /aring /ae +/ccedilla /egrave /eacute /ecircumflex /edieresis /igrave /iacute +/icircumflex /idieresis /eth /ntilde /ograve /oacute /ocircumflex +/otilde /odieresis /divide /oslash /ugrave /uacute /ucircumflex +/udieresis /yacute /thorn /ydieresis]def}ifelse /MFontDict 50 dict def +/MStrCat{exch dup length 2 index length add string dup 3 1 roll copy +length exch dup 4 2 roll exch putinterval}def /MCreateEncoding{1 index +255 string cvs(-)MStrCat 1 index MStrCat cvn exch(Encoding)MStrCat cvn +dup where{exch get}{pop StandardEncoding}ifelse 3 1 roll dup MFontDict +exch known not{1 index findfont dup length dict begin{1 index /FID ne{ +def}{pop pop}ifelse}forall /Encoding 3 index def currentdict end 1 index +exch definefont pop MFontDict 1 index null put}if exch pop exch pop}def +/ISOLatin1{(ISOLatin1)MCreateEncoding}def /ISO8859{(ISOLatin1) +MCreateEncoding}def /Mcopyfont{dup maxlength dict exch{1 index /FID eq{ +pop pop}{2 index 3 1 roll put}ifelse}forall}def /Plain /Courier findfont +Mcopyfont definefont pop /Bold /Courier findfont Mcopyfont +definefont pop /Italic /Courier findfont Mcopyfont definefont +pop /MathPictureStart{gsave Mtransform Mlmarg Mbmarg translate Mwidth +Mlmarg Mrmarg add sub /Mwidth exch def Mheight Mbmarg Mtmarg add sub +/Mheight exch def /Mtmatrix matrix currentmatrix def /Mgmatrix matrix +currentmatrix def}bind def /MathPictureEnd{grestore}bind def /MFill{0 0 +moveto Mwidth 0 lineto Mwidth Mheight lineto 0 Mheight lineto fill}bind +def /MPlotRegion{3 index Mwidth mul 2 index Mheight mul translate exch +sub Mheight mul /Mheight exch def exch sub Mwidth mul /Mwidth exch def} +bind def /MathSubStart{Momatrix Mgmatrix Mtmatrix Mwidth Mheight 7 -2 +roll moveto Mtmatrix setmatrix currentpoint Mgmatrix setmatrix 9 -2 roll +moveto Mtmatrix setmatrix currentpoint 2 copy translate /Mtmatrix matrix +currentmatrix def 3 -1 roll exch sub /Mheight exch def sub /Mwidth exch +def}bind def /MathSubEnd{/Mheight exch def /Mwidth exch def /Mtmatrix +exch def dup setmatrix /Mgmatrix exch def /Momatrix exch def}bind def +/Mdot{moveto 0 0 rlineto stroke}bind def /Mtetra{moveto lineto lineto +lineto fill}bind def /Metetra{moveto lineto lineto lineto closepath +gsave fill grestore 0 setgray stroke}bind def /Mistroke{flattenpath 0 0 +0{4 2 roll pop pop}{4 -1 roll 2 index sub dup mul 4 -1 roll 2 index sub +dup mul add sqrt 4 -1 roll add 3 1 roll}{stop}{stop}pathforall pop pop +currentpoint stroke moveto currentdash 3 -1 roll add setdash}bind def +/Mfstroke{stroke currentdash pop 0 setdash}bind def /Mrotsboxa{gsave dup +/Mrot exch def Mrotcheck Mtmatrix dup setmatrix 7 1 roll 4 index 4 index +translate rotate 3 index -1 mul 3 index -1 mul translate /Mtmatrix +matrix currentmatrix def grestore Msboxa 3 -1 roll /Mtmatrix exch def +/Mrot 0 def}bind def /Msboxa{newpath 5 -1 roll Mvboxa pop Mboxout 6 -1 +roll 5 -1 roll 4 -1 roll Msboxa1 5 -3 roll Msboxa1 Mboxrot[7 -2 roll 2 +copy[3 1 roll 10 -1 roll 9 -1 roll]6 1 roll 5 -2 roll]}bind def /Msboxa1 +{sub 2 div dup 2 index 1 add mul 3 -1 roll -1 add 3 -1 roll mul}bind def +/Mvboxa{Mfixwid{Mvboxa1}{dup Mwidthcal 0 exch{add}forall exch Mvboxa1 4 +index 7 -1 roll add 4 -1 roll pop 3 1 roll}ifelse}bind def /Mvboxa1{ +gsave newpath[true 3 -1 roll{Mbbox 5 -1 roll{0 5 1 roll}{7 -1 roll exch +sub(m)stringwidth pop .3 mul sub 7 1 roll 6 -1 roll 4 -1 roll Mmin 3 -1 +roll 5 index add 5 -1 roll 4 -1 roll Mmax 4 -1 roll}ifelse false}forall{ +stop}if counttomark 1 add 4 roll]grestore}bind def /Mbbox{1 dict begin 0 +0 moveto /temp(T)def{gsave currentpoint newpath moveto temp 0 3 -1 roll +put temp false charpath flattenpath currentpoint pathbbox grestore +moveto lineto moveto}forall pathbbox newpath end}bind def /Mmin{2 copy +gt{exch}if pop}bind def /Mmax{2 copy lt{exch}if pop}bind def /Mrotshowa{ +dup /Mrot exch def Mrotcheck Mtmatrix dup setmatrix 7 1 roll 4 index 4 +index translate rotate 3 index -1 mul 3 index -1 mul translate /Mtmatrix +matrix currentmatrix def Mgmatrix setmatrix Mshowa /Mtmatrix exch def +/Mrot 0 def}bind def /Mshowa{4 -2 roll moveto 2 index Mtmatrix setmatrix +Mvboxa 7 1 roll Mboxout 6 -1 roll 5 -1 roll 4 -1 roll Mshowa1 4 1 roll +Mshowa1 rmoveto currentpoint Mfixwid{Mshowax}{Mshoway}ifelse pop pop pop +pop Mgmatrix setmatrix}bind def /Mshowax{0 1 4 index length -1 add{2 +index 4 index 2 index get 3 index add moveto 4 index exch get Mfixdash{ +Mfixdashp}if show}for}bind def /Mfixdashp{dup length 1 gt 1 index true +exch{45 eq and}forall and{gsave(--)stringwidth pop(-)stringwidth pop sub +2 div 0 rmoveto dup length 1 sub{(-)show}repeat grestore}if}bind def +/Mshoway{3 index Mwidthcal 5 1 roll 0 1 4 index length -1 add{2 index 4 +index 2 index get 3 index add moveto 4 index exch get[6 index aload +length 2 add -1 roll{pop Strform stringwidth pop neg exch add 0 rmoveto} +exch kshow cleartomark}for pop}bind def /Mwidthcal{[exch{Mwidthcal1} +forall][exch dup Maxlen -1 add 0 1 3 -1 roll{[exch 2 index{1 index Mget +exch}forall pop Maxget exch}for pop]Mreva}bind def /Mreva{[exch aload +length -1 1{1 roll}for]}bind def /Mget{1 index length -1 add 1 index ge{ +get}{pop pop 0}ifelse}bind def /Maxlen{[exch{length}forall Maxget}bind +def /Maxget{counttomark -1 add 1 1 3 -1 roll{pop Mmax}for exch pop}bind +def /Mwidthcal1{[exch{Strform stringwidth pop}forall]}bind def /Strform{ +/tem(x)def tem 0 3 -1 roll put tem}bind def /Mshowa1{2 copy add 4 1 roll +sub mul sub -2 div}bind def /MathScale{Mwidth Mheight Mlp translate +scale /yscale exch def /ybias exch def /xscale exch def /xbias exch def +/Momatrix xscale yscale matrix scale xbias ybias matrix translate matrix +concatmatrix def /Mgmatrix matrix currentmatrix def}bind def /Mlp{3 copy +Mlpfirst{Mnodistort{Mmin dup}if 4 index 2 index 2 index Mlprun 11 index +11 -1 roll 10 -4 roll Mlp1 8 index 9 -5 roll Mlp1 4 -1 roll and{exit}if +3 -1 roll pop pop}loop exch 3 1 roll 7 -3 roll pop pop pop}bind def +/Mlpfirst{3 -1 roll dup length 2 copy -2 add get aload pop pop pop 4 -2 +roll -1 add get aload pop pop pop 6 -1 roll 3 -1 roll 5 -1 roll sub div +4 1 roll exch sub div}bind def /Mlprun{2 copy 4 index 0 get dup 4 1 roll +Mlprun1 3 copy 8 -2 roll 9 -1 roll{3 copy Mlprun1 3 copy 11 -3 roll /gt +Mlpminmax 8 3 roll 11 -3 roll /lt Mlpminmax 8 3 roll}forall pop pop pop +pop 3 1 roll pop pop aload pop 5 -1 roll aload pop exch 6 -1 roll +Mlprun2 8 2 roll 4 -1 roll Mlprun2 6 2 roll 3 -1 roll Mlprun2 4 2 roll +exch Mlprun2 6 2 roll}bind def /Mlprun1{aload pop exch 6 -1 roll 5 -1 +roll mul add 4 -2 roll mul 3 -1 roll add}bind def /Mlprun2{2 copy add 2 +div 3 1 roll exch sub}bind def /Mlpminmax{cvx 2 index 6 index 2 index +exec{7 -3 roll 4 -1 roll}if 1 index 5 index 3 -1 roll exec{4 1 roll pop +5 -1 roll aload pop pop 4 -1 roll aload pop[8 -2 roll pop 5 -2 roll pop +6 -2 roll pop 5 -1 roll]4 1 roll pop}{pop pop pop}ifelse}bind def /Mlp1{ +5 index 3 index sub 5 index 2 index mul 1 index le 1 index 0 le or dup +not{1 index 3 index div .99999 mul 8 -1 roll pop 7 1 roll}if 8 -1 roll 2 +div 7 -2 roll pop sub 5 index 6 -3 roll pop pop mul sub exch}bind def +/intop 0 def /inrht 0 def /inflag 0 def /outflag 0 def /xadrht 0 def +/xadlft 0 def /yadtop 0 def /yadbot 0 def /Minner{outflag 1 eq{/outflag +0 def /intop 0 def /inrht 0 def}if 5 index gsave Mtmatrix setmatrix +Mvboxa pop grestore 3 -1 roll pop dup intop gt{/intop exch def}{pop} +ifelse dup inrht gt{/inrht exch def}{pop}ifelse pop /inflag 1 def}bind +def /Mouter{/xadrht 0 def /xadlft 0 def /yadtop 0 def /yadbot 0 def +inflag 1 eq{dup 0 lt{dup intop mul neg /yadtop exch def}if dup 0 gt{dup +intop mul /yadbot exch def}if pop dup 0 lt{dup inrht mul neg /xadrht +exch def}if dup 0 gt{dup inrht mul /xadlft exch def}if pop /outflag 1 +def}{pop pop}ifelse /inflag 0 def /inrht 0 def /intop 0 def}bind def +/Mboxout{outflag 1 eq{4 -1 roll xadlft leadjust add sub 4 1 roll 3 -1 +roll yadbot leadjust add sub 3 1 roll exch xadrht leadjust add add exch +yadtop leadjust add add /outflag 0 def /xadlft 0 def /yadbot 0 def +/xadrht 0 def /yadtop 0 def}if}bind def /leadjust{(m)stringwidth pop .5 +mul}bind def /Mrotcheck{dup 90 eq{yadbot /yadbot xadrht def /xadrht +yadtop def /yadtop xadlft def /xadlft exch def}if dup cos 1 index sin +Checkaux dup cos 1 index sin neg exch Checkaux 3 1 roll pop pop}bind def +/Checkaux{4 index exch 4 index mul 3 1 roll mul add 4 1 roll}bind def +/Mboxrot{Mrot 90 eq{brotaux 4 2 roll}if Mrot 180 eq{4 2 roll brotaux 4 2 +roll brotaux}if Mrot 270 eq{4 2 roll brotaux}if}bind def /brotaux{neg +exch neg}bind def /Mabsproc{0 matrix defaultmatrix dtransform +idtransform dup mul exch dup mul add sqrt}bind def /Mabswid{Mabsproc +setlinewidth}bind def /Mabsdash{exch[exch{Mabsproc}forall]exch setdash} +bind def /MBeginOrig{Momatrix concat}bind def /MEndOrig{Mgmatrix +setmatrix}bind def /sampledsound where{pop}{/sampledsound{exch pop exch +5 1 roll mul 4 idiv mul 2 idiv exch pop exch /Mtempproc exch def{ +Mtempproc pop}repeat}bind def}ifelse /g{setgray}bind def /k{ +setcmykcolor}bind def /m{moveto}bind def /p{gsave}bind def /r{ +setrgbcolor}bind def /w{setlinewidth}bind def /C{curveto}bind def /F{ +fill}bind def /L{lineto}bind def /P{grestore}bind def /s{stroke}bind def +/setcmykcolor where{pop}{/setcmykcolor{4 1 roll[4 1 roll]{1 index sub 1 +sub neg dup 0 lt{pop 0}if dup 1 gt{pop 1}if exch}forall pop setrgbcolor} +bind def}ifelse /Mcharproc{currentfile(x)readhexstring pop 0 get exch +div}bind def /Mshadeproc{dup 3 1 roll{dup Mcharproc 3 1 roll}repeat 1 eq +{setgray}{3 eq{setrgbcolor}{setcmykcolor}ifelse}ifelse}bind def +/Mrectproc{3 index 2 index moveto 2 index 3 -1 roll lineto dup 3 1 roll +lineto lineto fill}bind def /Mcolorimage{7 1 roll pop pop matrix +invertmatrix concat 2 exch exp 1 sub 3 1 roll 1 1 2 index{1 1 4 index{ +dup 1 sub exch 2 index dup 1 sub exch 7 index 9 index Mshadeproc +Mrectproc}for pop}for pop pop pop pop}bind def /Mimage{pop matrix +invertmatrix concat 2 exch exp 1 sub 3 1 roll 1 1 2 index{1 1 4 index{ +dup 1 sub exch 2 index dup 1 sub exch 7 index Mcharproc setgray +Mrectproc}for pop}for pop pop pop}bind def +%MMA2LTXComment: Here follow the original Mathematica file stripped of the text strings +MathPictureStart +/Courier findfont 10 scalefont setfont +% Scaling calculations +0.0238095 0.952381 0.309017 0.294302 [ +[ -0.001 -0.001 0 0 ] +[ 1.001 .61903 0 0 ] +] MathScale +% Start of Graphics +1 setlinecap +1 setlinejoin +newpath +[ ] 0 setdash +0 g +p +p +.002 w +.21429 .30902 m +.21429 .31527 L +s +P +p +.002 w +.40476 .30902 m +.40476 .31527 L +s +P +p +.002 w +.59524 .30902 m +.59524 .31527 L +s +P +p +.002 w +.78571 .30902 m +.78571 .31527 L +s +P +p +.002 w +.97619 .30902 m +.97619 .31527 L +s +P +p +.001 w +.0619 .30902 m +.0619 .31277 L +s +P +p +.001 w +.1 .30902 m +.1 .31277 L +s +P +p +.001 w +.1381 .30902 m +.1381 .31277 L +s +P +p +.001 w +.17619 .30902 m +.17619 .31277 L +s +P +p +.001 w +.25238 .30902 m +.25238 .31277 L +s +P +p +.001 w +.29048 .30902 m +.29048 .31277 L +s +P +p +.001 w +.32857 .30902 m +.32857 .31277 L +s +P +p +.001 w +.36667 .30902 m +.36667 .31277 L +s +P +p +.001 w +.44286 .30902 m +.44286 .31277 L +s +P +p +.001 w +.48095 .30902 m +.48095 .31277 L +s +P +p +.001 w +.51905 .30902 m +.51905 .31277 L +s +P +p +.001 w +.55714 .30902 m +.55714 .31277 L +s +P +p +.001 w +.63333 .30902 m +.63333 .31277 L +s +P +p +.001 w +.67143 .30902 m +.67143 .31277 L +s +P +p +.001 w +.70952 .30902 m +.70952 .31277 L +s +P +p +.001 w +.74762 .30902 m +.74762 .31277 L +s +P +p +.001 w +.82381 .30902 m +.82381 .31277 L +s +P +p +.001 w +.8619 .30902 m +.8619 .31277 L +s +P +p +.001 w +.9 .30902 m +.9 .31277 L +s +P +p +.001 w +.9381 .30902 m +.9381 .31277 L +s +P +p +.002 w +0 .30902 m +1 .30902 L +s +P +p +.002 w +.02381 .01472 m +.03006 .01472 L +s +P +p +.002 w +.02381 .16187 m +.03006 .16187 L +s +P +p +.002 w +.02381 .45617 m +.03006 .45617 L +s +P +p +.002 w +.02381 .60332 m +.03006 .60332 L +s +P +p +.001 w +.02381 .04415 m +.02756 .04415 L +s +P +p +.001 w +.02381 .07358 m +.02756 .07358 L +s +P +p +.001 w +.02381 .10301 m +.02756 .10301 L +s +P +p +.001 w +.02381 .13244 m +.02756 .13244 L +s +P +p +.001 w +.02381 .1913 m +.02756 .1913 L +s +P +p +.001 w +.02381 .22073 m +.02756 .22073 L +s +P +p +.001 w +.02381 .25016 m +.02756 .25016 L +s +P +p +.001 w +.02381 .27959 m +.02756 .27959 L +s +P +p +.001 w +.02381 .33845 m +.02756 .33845 L +s +P +p +.001 w +.02381 .36788 m +.02756 .36788 L +s +P +p +.001 w +.02381 .39731 m +.02756 .39731 L +s +P +p +.001 w +.02381 .42674 m +.02756 .42674 L +s +P +p +.001 w +.02381 .4856 m +.02756 .4856 L +s +P +p +.001 w +.02381 .51503 m +.02756 .51503 L +s +P +p +.001 w +.02381 .54446 m +.02756 .54446 L +s +P +p +.001 w +.02381 .57389 m +.02756 .57389 L +s +P +p +.002 w +.02381 0 m +.02381 .61803 L +s +P +P +0 0 m +1 0 L +1 .61803 L +0 .61803 L +closepath +clip +newpath +p +p +p +.004 w +.02505 .60122 m +.02629 .50433 L +.02753 .01495 L +.02877 .20456 L +.03001 .40662 L +.03125 .52122 L +.03249 .37939 L +.03373 .59849 L +.03497 .16526 L +.03621 .59913 L +.03745 .49932 L +.03869 .57978 L +.03993 .47842 L +.04117 .01686 L +.04241 .54573 L +.04365 .08292 L +.04489 .58269 L +.04613 .02424 L +.04737 .42893 L +.04861 .49881 L +.04985 .04314 L +.05109 .20767 L +.05233 .57956 L +.05357 .4713 L +.05481 .12034 L +.05605 .02845 L +.05729 .25919 L +.05853 .5293 L +.05977 .59618 L +.06101 .44158 L +.06225 .20574 L +.06349 .0425 L +.06473 .02694 L +.06597 .14355 L +.06721 .32322 L +.06845 .48895 L +.07341 .41006 L +.07465 .27441 L +.07589 .15173 L +.07713 .06312 L +.07837 .01925 L +.07961 .02131 L +.08085 .06335 L +.08209 .13505 L +.08333 .22429 L +.08581 .40937 L +.08705 .48692 L +.08829 .54646 L +.08953 .58513 L +.09077 .60225 L +Mistroke +.09201 .5989 L +.09325 .57739 L +.09449 .54088 L +.09573 .49293 L +.09821 .37715 L +.10069 .25654 L +.10317 .1511 L +.10441 .1082 L +.10565 .0731 L +.10689 .04624 L +.10813 .02773 L +.10938 .01739 L +.11062 .0148 L +.11186 .0194 L +.1131 .03049 L +.11558 .06901 L +.11682 .0948 L +.11806 .12385 L +.12302 .25771 L +.12798 .39089 L +.13046 .4487 L +.13294 .49805 L +.13542 .53798 L +.1379 .56815 L +.13914 .57962 L +.14038 .58873 L +.14162 .59555 L +.14286 .60019 L +.1441 .60272 L +.14534 .60328 L +.14658 .60195 L +.14782 .59888 L +.14906 .59417 L +.1503 .58795 L +.15278 .57149 L +.15774 .52578 L +.1627 .46881 L +.17262 .34332 L +.18254 .22678 L +.19246 .13418 L +.19742 .09842 L +.20238 .06965 L +.20734 .04754 L +.20982 .03883 L +.2123 .03159 L +.21478 .02574 L +.21726 .02122 L +.2185 .01943 L +.21974 .01795 L +.22098 .01675 L +Mistroke +.22222 .01584 L +.22346 .01521 L +.2247 .01483 L +.22594 .01472 L +.22718 .01484 L +.22842 .01521 L +.22966 .0158 L +.2309 .01661 L +.23214 .01763 L +.23462 .02028 L +.2371 .02367 L +.24206 .03243 L +.25198 .05636 L +.2619 .08629 L +.30159 .22571 L +.34127 .35055 L +.36111 .40105 L +.38095 .44359 L +.40079 .47888 L +.42063 .50781 L +.44048 .53126 L +.46032 .55007 L +.48016 .56498 L +.5 .57662 L +.51984 .58556 L +.53968 .59223 L +.5496 .59485 L +.55952 .59704 L +.56944 .59884 L +.57937 .60029 L +.58929 .60143 L +.59921 .60227 L +.60417 .60259 L +.60913 .60285 L +.61409 .60305 L +.61657 .60313 L +.61905 .60319 L +.62153 .60324 L +.62277 .60326 L +.62401 .60328 L +.62525 .6033 L +.62649 .60331 L +.62773 .60331 L +.62897 .60332 L +.63021 .60332 L +.63145 .60332 L +.63269 .60331 L +.63393 .6033 L +.63641 .60328 L +.63765 .60326 L +Mistroke +.63889 .60325 L +.64385 .60314 L +.64881 .60299 L +.65873 .60258 L +.66865 .60202 L +.67857 .60133 L +.69841 .59961 L +.7381 .59506 L +.77778 .5895 L +.81746 .58332 L +.85714 .57678 L +.89683 .57008 L +.93651 .56334 L +.97619 .55666 L +Mfstroke +P +P +P +% End of Graphics +MathPictureEnd +end +%%EndDocument + @endspecial 1343 4553 a Fu(0)p Fn(:)p Fu(2)1673 4426 +y(0)p Fn(:)p Fu(4)2122 4553 y(0)p Fn(:)p Fu(6)2581 4413 +y Fn(x)2628 4425 y Fw(1)3051 4553 y Fu(1)694 5189 y Fs(\000)p +Fu(1)629 4843 y Fs(\000)p Fu(0)p Fn(:)p Fu(5)694 4153 +y(0)p Fn(:)p Fu(5)758 3807 y(1)1951 4069 y Fn(f)9 b Fu(\()p +Fn(x)p Fu(\))23 b(=)g(sin)2352 4013 y(1)p 2349 4050 48 +4 v 2349 4126 a Fn(x)2268 5203 y @beginspecial 103.637100 +@hsize 85.039120 @vsize @setspecial +%%BeginDocument: 12mag_3d.eps +%MMA2LTXCommandLine: mma2ltx -stiny -ucm -p -h3cm 12mag_3d.ps +% Mathematica v2.2 prologue +/Mathdict 150 dict def +Mathdict begin +/Mwidth 103.64 def +/Mheight 85.04 def +/Mnodistort true def +/Mlmarg 0 def /Mrmarg 0 def /Mbmarg 0 def /Mtmarg 0 def /Mtransform{} +bind def /Mfixwid true def /Mfixdash false def /Mrot 0 def /Mpstart{ +MathPictureStart}bind def /Mpend{MathPictureEnd}bind def /Mscale{0 1 0 1 +5 -1 roll MathScale}bind def /ISOLatin1Encoding dup where{pop pop}{[ +/.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef +/.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef +/.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef +/.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef +/space /exclam /quotedbl /numbersign /dollar /percent /ampersand +/quoteright /parenleft /parenright /asterisk /plus /comma /minus /period +/slash /zero /one /two /three /four /five /six /seven /eight /nine +/colon /semicolon /less /equal /greater /question /at /A /B /C /D /E /F +/G /H /I /J /K /L /M /N /O /P /Q /R /S /T /U /V /W /X /Y /Z /bracketleft +/backslash /bracketright /asciicircum /underscore /quoteleft /a /b /c /d +/e /f /g /h /i /j /k /l /m /n /o /p /q /r /s /t /u /v /w /x /y /z +/braceleft /bar /braceright /asciitilde /.notdef /.notdef /.notdef +/.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef +/.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /dotlessi /grave +/acute /circumflex /tilde /macron /breve /dotaccent /dieresis /.notdef +/ring /cedilla /.notdef /hungarumlaut /ogonek /caron /space /exclamdown +/cent /sterling /currency /yen /brokenbar /section /dieresis /copyright +/ordfeminine /guillemotleft /logicalnot /hyphen /registered /macron +/degree /plusminus /twosuperior /threesuperior /acute /mu /paragraph +/periodcentered /cedilla /onesuperior /ordmasculine /guillemotright +/onequarter /onehalf /threequarters /questiondown /Agrave /Aacute +/Acircumflex /Atilde /Adieresis /Aring /AE /Ccedilla /Egrave /Eacute +/Ecircumflex /Edieresis /Igrave /Iacute /Icircumflex /Idieresis /Eth +/Ntilde /Ograve /Oacute /Ocircumflex /Otilde /Odieresis /multiply +/Oslash /Ugrave /Uacute /Ucircumflex /Udieresis /Yacute /Thorn +/germandbls /agrave /aacute /acircumflex /atilde /adieresis /aring /ae +/ccedilla /egrave /eacute /ecircumflex /edieresis /igrave /iacute +/icircumflex /idieresis /eth /ntilde /ograve /oacute /ocircumflex +/otilde /odieresis /divide /oslash /ugrave /uacute /ucircumflex +/udieresis /yacute /thorn /ydieresis]def}ifelse /MFontDict 50 dict def +/MStrCat{exch dup length 2 index length add string dup 3 1 roll copy +length exch dup 4 2 roll exch putinterval}def /MCreateEncoding{1 index +255 string cvs(-)MStrCat 1 index MStrCat cvn exch(Encoding)MStrCat cvn +dup where{exch get}{pop StandardEncoding}ifelse 3 1 roll dup MFontDict +exch known not{1 index findfont dup length dict begin{1 index /FID ne{ +def}{pop pop}ifelse}forall /Encoding 3 index def currentdict end 1 index +exch definefont pop MFontDict 1 index null put}if exch pop exch pop}def +/ISOLatin1{(ISOLatin1)MCreateEncoding}def /ISO8859{(ISOLatin1) +MCreateEncoding}def /Mcopyfont{dup maxlength dict exch{1 index /FID eq{ +pop pop}{2 index 3 1 roll put}ifelse}forall}def /Plain /Courier findfont +Mcopyfont definefont pop /Bold /Courier findfont Mcopyfont +definefont pop /Italic /Courier findfont Mcopyfont definefont +pop /MathPictureStart{gsave Mtransform Mlmarg Mbmarg translate Mwidth +Mlmarg Mrmarg add sub /Mwidth exch def Mheight Mbmarg Mtmarg add sub +/Mheight exch def /Mtmatrix matrix currentmatrix def /Mgmatrix matrix +currentmatrix def}bind def /MathPictureEnd{grestore}bind def /MFill{0 0 +moveto Mwidth 0 lineto Mwidth Mheight lineto 0 Mheight lineto fill}bind +def /MPlotRegion{3 index Mwidth mul 2 index Mheight mul translate exch +sub Mheight mul /Mheight exch def exch sub Mwidth mul /Mwidth exch def} +bind def /MathSubStart{Momatrix Mgmatrix Mtmatrix Mwidth Mheight 7 -2 +roll moveto Mtmatrix setmatrix currentpoint Mgmatrix setmatrix 9 -2 roll +moveto Mtmatrix setmatrix currentpoint 2 copy translate /Mtmatrix matrix +currentmatrix def 3 -1 roll exch sub /Mheight exch def sub /Mwidth exch +def}bind def /MathSubEnd{/Mheight exch def /Mwidth exch def /Mtmatrix +exch def dup setmatrix /Mgmatrix exch def /Momatrix exch def}bind def +/Mdot{moveto 0 0 rlineto stroke}bind def /Mtetra{moveto lineto lineto +lineto fill}bind def /Metetra{moveto lineto lineto lineto closepath +gsave fill grestore 0 setgray stroke}bind def /Mistroke{flattenpath 0 0 +0{4 2 roll pop pop}{4 -1 roll 2 index sub dup mul 4 -1 roll 2 index sub +dup mul add sqrt 4 -1 roll add 3 1 roll}{stop}{stop}pathforall pop pop +currentpoint stroke moveto currentdash 3 -1 roll add setdash}bind def +/Mfstroke{stroke currentdash pop 0 setdash}bind def /Mrotsboxa{gsave dup +/Mrot exch def Mrotcheck Mtmatrix dup setmatrix 7 1 roll 4 index 4 index +translate rotate 3 index -1 mul 3 index -1 mul translate /Mtmatrix +matrix currentmatrix def grestore Msboxa 3 -1 roll /Mtmatrix exch def +/Mrot 0 def}bind def /Msboxa{newpath 5 -1 roll Mvboxa pop Mboxout 6 -1 +roll 5 -1 roll 4 -1 roll Msboxa1 5 -3 roll Msboxa1 Mboxrot[7 -2 roll 2 +copy[3 1 roll 10 -1 roll 9 -1 roll]6 1 roll 5 -2 roll]}bind def /Msboxa1 +{sub 2 div dup 2 index 1 add mul 3 -1 roll -1 add 3 -1 roll mul}bind def +/Mvboxa{Mfixwid{Mvboxa1}{dup Mwidthcal 0 exch{add}forall exch Mvboxa1 4 +index 7 -1 roll add 4 -1 roll pop 3 1 roll}ifelse}bind def /Mvboxa1{ +gsave newpath[true 3 -1 roll{Mbbox 5 -1 roll{0 5 1 roll}{7 -1 roll exch +sub(m)stringwidth pop .3 mul sub 7 1 roll 6 -1 roll 4 -1 roll Mmin 3 -1 +roll 5 index add 5 -1 roll 4 -1 roll Mmax 4 -1 roll}ifelse false}forall{ +stop}if counttomark 1 add 4 roll]grestore}bind def /Mbbox{1 dict begin 0 +0 moveto /temp(T)def{gsave currentpoint newpath moveto temp 0 3 -1 roll +put temp false charpath flattenpath currentpoint pathbbox grestore +moveto lineto moveto}forall pathbbox newpath end}bind def /Mmin{2 copy +gt{exch}if pop}bind def /Mmax{2 copy lt{exch}if pop}bind def /Mrotshowa{ +dup /Mrot exch def Mrotcheck Mtmatrix dup setmatrix 7 1 roll 4 index 4 +index translate rotate 3 index -1 mul 3 index -1 mul translate /Mtmatrix +matrix currentmatrix def Mgmatrix setmatrix Mshowa /Mtmatrix exch def +/Mrot 0 def}bind def /Mshowa{4 -2 roll moveto 2 index Mtmatrix setmatrix +Mvboxa 7 1 roll Mboxout 6 -1 roll 5 -1 roll 4 -1 roll Mshowa1 4 1 roll +Mshowa1 rmoveto currentpoint Mfixwid{Mshowax}{Mshoway}ifelse pop pop pop +pop Mgmatrix setmatrix}bind def /Mshowax{0 1 4 index length -1 add{2 +index 4 index 2 index get 3 index add moveto 4 index exch get Mfixdash{ +Mfixdashp}if show}for}bind def /Mfixdashp{dup length 1 gt 1 index true +exch{45 eq and}forall and{gsave(--)stringwidth pop(-)stringwidth pop sub +2 div 0 rmoveto dup length 1 sub{(-)show}repeat grestore}if}bind def +/Mshoway{3 index Mwidthcal 5 1 roll 0 1 4 index length -1 add{2 index 4 +index 2 index get 3 index add moveto 4 index exch get[6 index aload +length 2 add -1 roll{pop Strform stringwidth pop neg exch add 0 rmoveto} +exch kshow cleartomark}for pop}bind def /Mwidthcal{[exch{Mwidthcal1} +forall][exch dup Maxlen -1 add 0 1 3 -1 roll{[exch 2 index{1 index Mget +exch}forall pop Maxget exch}for pop]Mreva}bind def /Mreva{[exch aload +length -1 1{1 roll}for]}bind def /Mget{1 index length -1 add 1 index ge{ +get}{pop pop 0}ifelse}bind def /Maxlen{[exch{length}forall Maxget}bind +def /Maxget{counttomark -1 add 1 1 3 -1 roll{pop Mmax}for exch pop}bind +def /Mwidthcal1{[exch{Strform stringwidth pop}forall]}bind def /Strform{ +/tem(x)def tem 0 3 -1 roll put tem}bind def /Mshowa1{2 copy add 4 1 roll +sub mul sub -2 div}bind def /MathScale{Mwidth Mheight Mlp translate +scale /yscale exch def /ybias exch def /xscale exch def /xbias exch def +/Momatrix xscale yscale matrix scale xbias ybias matrix translate matrix +concatmatrix def /Mgmatrix matrix currentmatrix def}bind def /Mlp{3 copy +Mlpfirst{Mnodistort{Mmin dup}if 4 index 2 index 2 index Mlprun 11 index +11 -1 roll 10 -4 roll Mlp1 8 index 9 -5 roll Mlp1 4 -1 roll and{exit}if +3 -1 roll pop pop}loop exch 3 1 roll 7 -3 roll pop pop pop}bind def +/Mlpfirst{3 -1 roll dup length 2 copy -2 add get aload pop pop pop 4 -2 +roll -1 add get aload pop pop pop 6 -1 roll 3 -1 roll 5 -1 roll sub div +4 1 roll exch sub div}bind def /Mlprun{2 copy 4 index 0 get dup 4 1 roll +Mlprun1 3 copy 8 -2 roll 9 -1 roll{3 copy Mlprun1 3 copy 11 -3 roll /gt +Mlpminmax 8 3 roll 11 -3 roll /lt Mlpminmax 8 3 roll}forall pop pop pop +pop 3 1 roll pop pop aload pop 5 -1 roll aload pop exch 6 -1 roll +Mlprun2 8 2 roll 4 -1 roll Mlprun2 6 2 roll 3 -1 roll Mlprun2 4 2 roll +exch Mlprun2 6 2 roll}bind def /Mlprun1{aload pop exch 6 -1 roll 5 -1 +roll mul add 4 -2 roll mul 3 -1 roll add}bind def /Mlprun2{2 copy add 2 +div 3 1 roll exch sub}bind def /Mlpminmax{cvx 2 index 6 index 2 index +exec{7 -3 roll 4 -1 roll}if 1 index 5 index 3 -1 roll exec{4 1 roll pop +5 -1 roll aload pop pop 4 -1 roll aload pop[8 -2 roll pop 5 -2 roll pop +6 -2 roll pop 5 -1 roll]4 1 roll pop}{pop pop pop}ifelse}bind def /Mlp1{ +5 index 3 index sub 5 index 2 index mul 1 index le 1 index 0 le or dup +not{1 index 3 index div .99999 mul 8 -1 roll pop 7 1 roll}if 8 -1 roll 2 +div 7 -2 roll pop sub 5 index 6 -3 roll pop pop mul sub exch}bind def +/intop 0 def /inrht 0 def /inflag 0 def /outflag 0 def /xadrht 0 def +/xadlft 0 def /yadtop 0 def /yadbot 0 def /Minner{outflag 1 eq{/outflag +0 def /intop 0 def /inrht 0 def}if 5 index gsave Mtmatrix setmatrix +Mvboxa pop grestore 3 -1 roll pop dup intop gt{/intop exch def}{pop} +ifelse dup inrht gt{/inrht exch def}{pop}ifelse pop /inflag 1 def}bind +def /Mouter{/xadrht 0 def /xadlft 0 def /yadtop 0 def /yadbot 0 def +inflag 1 eq{dup 0 lt{dup intop mul neg /yadtop exch def}if dup 0 gt{dup +intop mul /yadbot exch def}if pop dup 0 lt{dup inrht mul neg /xadrht +exch def}if dup 0 gt{dup inrht mul /xadlft exch def}if pop /outflag 1 +def}{pop pop}ifelse /inflag 0 def /inrht 0 def /intop 0 def}bind def +/Mboxout{outflag 1 eq{4 -1 roll xadlft leadjust add sub 4 1 roll 3 -1 +roll yadbot leadjust add sub 3 1 roll exch xadrht leadjust add add exch +yadtop leadjust add add /outflag 0 def /xadlft 0 def /yadbot 0 def +/xadrht 0 def /yadtop 0 def}if}bind def /leadjust{(m)stringwidth pop .5 +mul}bind def /Mrotcheck{dup 90 eq{yadbot /yadbot xadrht def /xadrht +yadtop def /yadtop xadlft def /xadlft exch def}if dup cos 1 index sin +Checkaux dup cos 1 index sin neg exch Checkaux 3 1 roll pop pop}bind def +/Checkaux{4 index exch 4 index mul 3 1 roll mul add 4 1 roll}bind def +/Mboxrot{Mrot 90 eq{brotaux 4 2 roll}if Mrot 180 eq{4 2 roll brotaux 4 2 +roll brotaux}if Mrot 270 eq{4 2 roll brotaux}if}bind def /brotaux{neg +exch neg}bind def /Mabsproc{0 matrix defaultmatrix dtransform +idtransform dup mul exch dup mul add sqrt}bind def /Mabswid{Mabsproc +setlinewidth}bind def /Mabsdash{exch[exch{Mabsproc}forall]exch setdash} +bind def /MBeginOrig{Momatrix concat}bind def /MEndOrig{Mgmatrix +setmatrix}bind def /sampledsound where{pop}{/sampledsound{exch pop exch +5 1 roll mul 4 idiv mul 2 idiv exch pop exch /Mtempproc exch def{ +Mtempproc pop}repeat}bind def}ifelse /g{setgray}bind def /k{ +setcmykcolor}bind def /m{moveto}bind def /p{gsave}bind def /r{ +setrgbcolor}bind def /w{setlinewidth}bind def /C{curveto}bind def /F{ +fill}bind def /L{lineto}bind def /P{grestore}bind def /s{stroke}bind def +/setcmykcolor where{pop}{/setcmykcolor{4 1 roll[4 1 roll]{1 index sub 1 +sub neg dup 0 lt{pop 0}if dup 1 gt{pop 1}if exch}forall pop setrgbcolor} +bind def}ifelse /Mcharproc{currentfile(x)readhexstring pop 0 get exch +div}bind def /Mshadeproc{dup 3 1 roll{dup Mcharproc 3 1 roll}repeat 1 eq +{setgray}{3 eq{setrgbcolor}{setcmykcolor}ifelse}ifelse}bind def +/Mrectproc{3 index 2 index moveto 2 index 3 -1 roll lineto dup 3 1 roll +lineto lineto fill}bind def /Mcolorimage{7 1 roll pop pop matrix +invertmatrix concat 2 exch exp 1 sub 3 1 roll 1 1 2 index{1 1 4 index{ +dup 1 sub exch 2 index dup 1 sub exch 7 index 9 index Mshadeproc +Mrectproc}for pop}for pop pop pop pop}bind def /Mimage{pop matrix +invertmatrix concat 2 exch exp 1 sub 3 1 roll 1 1 2 index{1 1 4 index{ +dup 1 sub exch 2 index dup 1 sub exch 7 index Mcharproc setgray +Mrectproc}for pop}for pop pop pop}bind def +%MMA2LTXComment: Here follow the original Mathematica file stripped of the text strings +MathPictureStart +/Courier findfont 10 scalefont setfont +% Scaling calculations +0.0249355 0.99742 -0.0396341 0.99742 [ +[ 0 0 0 0 ] +[ 1 .82055 0 0 ] +] MathScale +% Start of Graphics +1 setlinecap +1 setlinejoin +newpath +[ ] 0 setdash +0 g +p +p +.002 w +.06024 .26735 m +.67932 .02494 L +s +P +p +.002 w +.16191 .22754 m +.16631 .23196 L +s +P +p +.002 w +.35089 .15354 m +.35496 .15826 L +s +P +p +.002 w +.55515 .07356 m +.55883 .07859 L +s +P +p +.001 w +.19857 .21319 m +.20117 .21587 L +s +P +p +.001 w +.23578 .19861 m +.23834 .20134 L +s +P +p +.001 w +.27356 .18382 m +.27609 .18658 L +s +P +p +.001 w +.31193 .1688 m +.31441 .17159 L +s +P +p +.001 w +.39046 .13804 m +.39286 .14091 L +s +P +p +.001 w +.43066 .1223 m +.43301 .12521 L +s +P +p +.001 w +.4715 .10631 m +.4738 .10926 L +s +P +p +.001 w +.51299 .09007 m +.51525 .09305 L +s +P +p +.001 w +.1258 .24168 m +.12847 .2443 L +s +P +p +.001 w +.09021 .25561 m +.09292 .25819 L +s +P +p +.001 w +.598 .05678 m +.60015 .05984 L +s +P +p +.001 w +.64156 .03972 m +.64365 .04282 L +s +P +P +p +p +.002 w +.67932 .02494 m +.94594 .43277 L +s +P +p +.002 w +.73688 .11298 m +.73104 .11515 L +s +P +p +.002 w +.82692 .2507 m +.82101 .25271 L +s +P +p +.002 w +.90545 .37083 m +.8995 .3727 L +s +P +p +.001 w +.75593 .14211 m +.75241 .14339 L +s +P +p +.001 w +.77443 .17042 m +.77091 .17168 L +s +P +p +.001 w +.79242 .19793 m +.78889 .19917 L +s +P +p +.001 w +.8099 .22468 m +.80637 .2259 L +s +P +p +.001 w +.84347 .27602 m +.83992 .27721 L +s +P +p +.001 w +.85958 .30067 m +.85603 .30184 L +s +P +p +.001 w +.87527 .32467 m +.87171 .32582 L +s +P +p +.001 w +.89056 .34805 m +.88699 .34919 L +s +P +p +.001 w +.71727 .08298 m +.71377 .0843 L +s +P +p +.001 w +.69707 .05207 m +.69358 .05342 L +s +P +p +.001 w +.91997 .39304 m +.9164 .39415 L +s +P +p +.001 w +.93413 .4147 m +.93055 .41579 L +s +P +P +p +p +.002 w +.06024 .26735 m +.02494 .49015 L +s +P +p +.002 w +.05986 .26974 m +.06567 .26747 L +s +P +p +.002 w +.0517 .32128 m +.05752 .31906 L +s +P +p +.002 w +.04324 .37466 m +.04908 .37249 L +s +P +p +.002 w +.03447 .42999 m +.04034 .42788 L +s +P +p +.002 w +.02537 .48738 m +.03126 .48533 L +s +P +p +.001 w +.05825 .27991 m +.06174 .27855 L +s +P +p +.001 w +.05663 .29014 m +.06012 .28879 L +s +P +p +.001 w +.055 .30045 m +.05849 .2991 L +s +P +p +.001 w +.05335 .31083 m +.05685 .30949 L +s +P +p +.001 w +.05003 .3318 m +.05353 .33048 L +s +P +p +.001 w +.04835 .3424 m +.05185 .34108 L +s +P +p +.001 w +.04666 .35308 m +.05016 .35177 L +s +P +p +.001 w +.04495 .36383 m +.04846 .36252 L +s +P +p +.001 w +.04151 .38557 m +.04502 .38427 L +s +P +p +.001 w +.03977 .39655 m +.04328 .39527 L +s +P +p +.001 w +.03801 .40762 m +.04153 .40634 L +s +P +p +.001 w +.03625 .41876 m +.03977 .41749 L +s +P +p +.001 w +.03268 .4413 m +.0362 .44004 L +s +P +p +.001 w +.03087 .45269 m +.0344 .45144 L +s +P +p +.001 w +.02905 .46417 m +.03258 .46292 L +s +P +p +.001 w +.02722 .47573 m +.03075 .47449 L +s +P +P +0 0 m +1 0 L +1 .82055 L +0 .82055 L +closepath +clip +newpath +p +.002 w +.06024 .26735 m +.02494 .49015 L +s +.02494 .49015 m +.40296 .79562 L +s +.40296 .79562 m +.41001 .59401 L +s +.41001 .59401 m +.06024 .26735 L +s +.67932 .02494 m +.94594 .43277 L +s +.94594 .43277 m +.97506 .64585 L +s +.97506 .64585 m +.69286 .25814 L +s +.69286 .25814 m +.67932 .02494 L +s +.06024 .26735 m +.02494 .49015 L +s +.02494 .49015 m +.69286 .25814 L +s +.69286 .25814 m +.67932 .02494 L +s +.67932 .02494 m +.06024 .26735 L +s +.41001 .59401 m +.94594 .43277 L +s +.94594 .43277 m +.97506 .64585 L +s +.97506 .64585 m +.40296 .79562 L +s +.40296 .79562 m +.41001 .59401 L +s +P +p +0 .096 .575 r +.0015 w +.38505 .67298 .40659 .69179 .44146 .72507 .42007 .70194 Metetra +0 .368 .834 r +.42007 .70194 .44146 .72507 .47787 .75077 .45661 .72394 Metetra +.421 .591 .913 r +.45661 .72394 .47787 .75077 .51565 .76096 .49455 .73186 Metetra +.65 .676 .861 r +.49455 .73186 .51565 .76096 .55426 .75082 .53342 .72139 Metetra +.757 .71 .808 r +.53342 .72139 .55426 .75082 .59303 .72006 .5726 .69228 Metetra +.813 .734 .776 r +.5726 .69228 .59303 .72006 .63138 .67312 .61156 .64848 Metetra +.846 .757 .765 r +.61156 .64848 .63138 .67312 .66909 .61778 .65002 .59698 Metetra +.862 .786 .775 r +.65002 .59698 .66909 .61778 .70634 .56311 .68812 .54597 Metetra +.856 .821 .813 r +.68812 .54597 .70634 .56311 .74372 .51741 .72634 .50303 Metetra +.805 .855 .887 r +.72634 .50303 .74372 .51741 .78207 .48688 .76543 .47385 Metetra +.64 .84 .977 r +.76543 .47385 .78207 .48688 .8223 .47481 .8062 .46148 Metetra +.314 .683 .978 r +.8062 .46148 .8223 .47481 .86517 .48141 .84938 .46611 Metetra +.036 .47 .88 r +.84938 .46611 .86517 .48141 .91111 .5037 .89538 .48498 Metetra +0 .378 .836 r +.89538 .48498 .91111 .5037 .96002 .53575 .94412 .51262 Metetra +.009 .432 .863 r +.36293 .65367 .38505 .67298 .42007 .70194 .39846 .67034 Metetra +.386 .535 .882 r +.39846 .67034 .42007 .70194 .45661 .72394 .43526 .68197 Metetra +.552 .56 .816 r +.43526 .68197 .45661 .72394 .49455 .73186 .47327 .68377 Metetra +.637 .582 .776 r +.47327 .68377 .49455 .73186 .53342 .72139 .51218 .67288 Metetra +.695 .61 .758 r +.51218 .67288 .53342 .72139 .5726 .69228 .55158 .64914 Metetra +.742 .649 .757 r +.55158 .64914 .5726 .69228 .61156 .64848 .59107 .61514 Metetra +.786 .705 .774 r +.59107 .61514 .61156 .64848 .65002 .59698 .63043 .57559 Metetra +.826 .787 .814 r +.63043 .57559 .65002 .59698 .68812 .54597 .6697 .53613 Metetra +.839 .902 .882 r +.6697 .53613 .68812 .54597 .72634 .50303 .70921 .50211 Metetra +.693 .975 .914 r +.70921 .50211 .72634 .50303 .76543 .47385 .74946 .47765 Metetra +.245 .752 .721 r +.74946 .47765 .76543 .47385 .8062 .46148 .79104 .46503 Metetra +.104 0 0 r +.79104 .46503 .8062 .46148 .84938 .46611 .83448 .46437 Metetra +.183 0 0 r +.83448 .46437 .84938 .46611 .89538 .48498 .88006 .47363 Metetra +.003 .499 .865 r +.88006 .47363 .89538 .48498 .94412 .51262 .92776 .4888 Metetra +.515 .706 .958 r +.34022 .63385 .36293 .65367 .39846 .67034 .37667 .63267 Metetra +.587 .599 .831 r +.37667 .63267 .39846 .67034 .43526 .68197 .41394 .6295 Metetra +.611 .554 .766 r +.41394 .6295 .43526 .68197 .47327 .68377 .45203 .62271 Metetra +.628 .543 .739 r +.45203 .62271 .47327 .68377 .51218 .67288 .49085 .61134 Metetra +.647 .553 .735 r +.49085 .61134 .51218 .67288 .55158 .64914 .53025 .59534 Metetra +.671 .585 .751 r +.53025 .59534 .55158 .64914 .59107 .61514 .57008 .57556 Metetra +.702 .65 .795 r +.57008 .57556 .59107 .61514 .63043 .57559 .61028 .55361 Metetra +.739 .774 .882 r +.61028 .55361 .63043 .57559 .6697 .53613 .65084 .53145 Metetra +.68 .946 .96 r +.65084 .53145 .6697 .53613 .70921 .50211 .69188 .51105 Metetra +.69188 .51105 .70921 .50211 .74946 .47765 .73358 .494 Metetra +.135 0 0 r +.73358 .494 .74946 .47765 .79104 .46503 .77618 .48116 Metetra +.221 0 0 r +.77618 .48116 .79104 .46503 .83448 .46437 .81987 .47259 Metetra +.124 0 0 r +.81987 .47259 .83448 .46437 .88006 .47363 .86478 .46747 Metetra +.288 .761 .936 r +.86478 .46747 .88006 .47363 .92776 .4888 .91091 .46428 Metetra +.739 .766 .875 r +.31689 .61349 .34022 .63385 .37667 .63267 .35461 .59244 Metetra +.689 .635 .79 r +.35461 .59244 .37667 .63267 .41394 .6295 .3926 .57313 Metetra +.652 .566 .746 r +.3926 .57313 .41394 .6295 .45203 .62271 .43086 .55711 Metetra +.625 .532 .728 r +.43086 .55711 .45203 .62271 .49085 .61134 .46952 .54525 Metetra +.606 .52 .732 r +.46952 .54525 .49085 .61134 .53025 .59534 .50875 .53759 Metetra +.591 .533 .758 r +.50875 .53759 .53025 .59534 .57008 .57556 .54872 .53334 Metetra +.576 .582 .822 r +.54872 .53334 .57008 .57556 .61028 .55361 .58955 .53099 Metetra +.533 .704 .949 r +.58955 .53099 .61028 .55361 .65084 .53145 .63128 .52859 Metetra +.241 .749 .878 r +.63128 .52859 .65084 .53145 .69188 .51105 .67385 .5241 Metetra +.143 0 0 r +.67385 .5241 .69188 .51105 .73358 .494 .7171 .51584 Metetra +.214 0 0 r +.7171 .51584 .73358 .494 .77618 .48116 .76082 .5028 Metetra +.136 0 0 r +.76082 .5028 .77618 .48116 .81987 .47259 .80484 .48492 Metetra +.80484 .48492 .81987 .47259 .86478 .46747 .84907 .46311 Metetra +.668 .963 .933 r +.84907 .46311 .86478 .46747 .91091 .46428 .89354 .43901 Metetra +.817 .767 .806 r +.29291 .59257 .31689 .61349 .35461 .59244 .33211 .55352 Metetra +.751 .666 .767 r +.33211 .55352 .35461 .59244 .3926 .57313 .37097 .51988 Metetra +.688 .594 .745 r +.37097 .51988 .3926 .57313 .43086 .55711 .40953 .49576 Metetra +.628 .543 .739 r +.40953 .49576 .43086 .55711 .46952 .54525 .44809 .48341 Metetra +.566 .507 .748 r +.44809 .48341 .46952 .54525 .50875 .53759 .48709 .48297 Metetra +.491 .486 .779 r +.48709 .48297 .50875 .53759 .54872 .53334 .52702 .4924 Metetra +.383 .488 .842 r +.52702 .4924 .54872 .53334 .58955 .53099 .56822 .50772 Metetra +.172 .509 .912 r +.56822 .50772 .58955 .53099 .63128 .52859 .61084 .52356 Metetra +0 .429 .692 r +.61084 .52356 .63128 .52859 .67385 .5241 .65469 .53409 Metetra +.253 0 0 r +.65469 .53409 .67385 .5241 .7171 .51584 .69935 .53424 Metetra +.138 0 0 r +.69935 .53424 .7171 .51584 .76082 .5028 .74419 .52098 Metetra +.74419 .52098 .76082 .5028 .80484 .48492 .78867 .49412 Metetra +.589 .911 .664 r +.78867 .49412 .80484 .48492 .84907 .46311 .83246 .45646 Metetra +.867 .973 .855 r +.83246 .45646 .84907 .46311 .89354 .43901 .87565 .41296 Metetra +.846 .762 .77 r +.26827 .57106 .29291 .59257 .33211 .55352 .30886 .51932 Metetra +.793 .699 .761 r +.30886 .51932 .33211 .55352 .37097 .51988 .34863 .47573 Metetra +.726 .641 .763 r +.34863 .47573 .37097 .51988 .40953 .49576 .38761 .446 Metetra +.639 .582 .774 r +.38761 .446 .40953 .49576 .44809 .48341 .42622 .43321 Metetra +.52 .518 .794 r +.42622 .43321 .44809 .48341 .48709 .48297 .46508 .43754 Metetra +.35 .445 .817 r +.46508 .43754 .48709 .48297 .52702 .4924 .5049 .45623 Metetra +.114 .36 .823 r +.5049 .45623 .52702 .4924 .56822 .50772 .54626 .48375 Metetra +0 .285 .771 r +.54626 .48375 .56822 .50772 .61084 .52356 .5894 .51247 Metetra +0 .288 .664 r +.5894 .51247 .61084 .52356 .65469 .53409 .63415 .53378 Metetra +.162 0 0 r +.63415 .53378 .65469 .53409 .69935 .53424 .67988 .54001 Metetra +.67988 .54001 .69935 .53424 .74419 .52098 .7257 .52645 Metetra +.635 .957 .781 r +.7257 .52645 .74419 .52098 .78867 .49412 .77075 .49287 Metetra +.874 .992 .81 r +.77075 .49287 .78867 .49412 .83246 .45646 .81455 .44356 Metetra +.919 .912 .796 r +.81455 .44356 .83246 .45646 .87565 .41296 .85719 .3861 Metetra +.853 .76 .759 r +.24293 .54895 .26827 .57106 .30886 .51932 .28455 .49224 Metetra +.824 .739 .771 r +.28455 .49224 .30886 .51932 .34863 .47573 .3251 .44474 Metetra +.767 .714 .803 r +.3251 .44474 .34863 .47573 .38761 .446 .36458 .41272 Metetra +.657 .669 .85 r +.36458 .41272 .38761 .446 .42622 .43321 .40344 .39954 Metetra +.448 .575 .889 r +.40344 .39954 .42622 .43321 .46508 .43754 .44238 .40538 Metetra +.133 .408 .855 r +.44238 .40538 .46508 .43754 .5049 .45623 .48222 .42724 Metetra +0 .243 .753 r +.48222 .42724 .5049 .45623 .54626 .48375 .52365 .45908 Metetra +0 .199 .701 r +.52365 .45908 .54626 .48375 .5894 .51247 .56702 .49241 Metetra +0 .325 .778 r +.56702 .49241 .5894 .51247 .63415 .53378 .6122 .51759 Metetra +.192 .616 .946 r +.6122 .51759 .63415 .53378 .67988 .54001 .65855 .52589 Metetra +.608 .857 .991 r +.65855 .52589 .67988 .54001 .7257 .52645 .70508 .51195 Metetra +.823 .904 .896 r +.70508 .51195 .7257 .52645 .77075 .49287 .75081 .47548 Metetra +.894 .879 .813 r +.75081 .47548 .77075 .49287 .81455 .44356 .79515 .42142 Metetra +.908 .846 .771 r +.79515 .42142 .81455 .44356 .85719 .3861 .83815 .35839 Metetra +.846 .762 .77 r +.21687 .5262 .24293 .54895 .28455 .49224 .25887 .4732 Metetra +.842 .792 .804 r +.25887 .4732 .28455 .49224 .3251 .44474 .2999 .42848 Metetra +.8 .827 .872 r +.2999 .42848 .3251 .44474 .36458 .41272 .3399 .3978 Metetra +.652 .831 .969 r +.3399 .3978 .36458 .41272 .40344 .39954 .37924 .38427 Metetra +.275 .671 .97 r +.37924 .38427 .40344 .39954 .44238 .40538 .41859 .38806 Metetra +0 .379 .796 r +.41859 .38806 .44238 .40538 .48222 .42724 .45873 .40637 Metetra +0 .238 .708 r +.45873 .40637 .48222 .42724 .52365 .45908 .50034 .43365 Metetra +0 .285 .771 r +.50034 .43365 .52365 .45908 .56702 .49241 .5438 .46214 Metetra +.138 .445 .879 r +.5438 .46214 .56702 .49241 .6122 .51759 .58906 .48313 Metetra +.443 .595 .907 r +.58906 .48313 .6122 .51759 .65855 .52589 .63558 .48879 Metetra +.646 .68 .868 r +.63558 .48879 .65855 .52589 .70508 .51195 .6825 .47434 Metetra +.761 .725 .819 r +.6825 .47434 .70508 .51195 .75081 .47548 .72891 .43954 Metetra +.827 .756 .784 r +.72891 .43954 .75081 .47548 .79515 .42142 .77425 .38878 Metetra +.865 .784 .77 r +.77425 .38878 .79515 .42142 .83815 .35839 .81849 .32978 Metetra +.817 .767 .806 r +.19004 .50278 .21687 .5262 .25887 .4732 .23163 .46155 Metetra +.831 .861 .868 r +.23163 .46155 .25887 .4732 .2999 .42848 .27268 .42589 Metetra +.757 .955 .938 r +.27268 .42589 .2999 .42848 .3399 .3978 .31312 .39999 Metetra +.429 .871 .878 r +.31312 .39999 .3399 .3978 .37924 .38427 .35318 .38615 Metetra +.35318 .38615 .37924 .38427 .41859 .38806 .39336 .3845 Metetra +.183 0 0 r +.39336 .3845 .41859 .38806 .45873 .40637 .43423 .39295 Metetra +0 .432 .794 r +.43423 .39295 .45873 .40637 .50034 .43365 .47632 .40743 Metetra +.172 .509 .912 r +.47632 .40743 .50034 .43365 .5438 .46214 .51994 .42245 Metetra +.408 .541 .878 r +.51994 .42245 .5438 .46214 .58906 .48313 .5651 .43198 Metetra +.544 .559 .82 r +.5651 .43198 .58906 .48313 .63558 .48879 .61146 .43079 Metetra +.629 .582 .782 r +.61146 .43079 .63558 .48879 .6825 .47434 .65846 .41575 Metetra +.693 .615 .764 r +.65846 .41575 .6825 .47434 .72891 .43954 .70547 .38667 Metetra +.747 .66 .764 r +.70547 .38667 .72891 .43954 .77425 .38878 .75207 .34645 Metetra +.797 .723 .783 r +.75207 .34645 .77425 .38878 .81849 .32978 .79819 .30023 Metetra +.739 .766 .875 r +.16241 .47867 .19004 .50278 .23163 .46155 .20277 .4551 Metetra +.721 .922 .96 r +.20277 .4551 .23163 .46155 .27268 .42589 .24333 .43331 Metetra +.447 .88 .813 r +.24333 .43331 .27268 .42589 .31312 .39999 .28405 .41491 Metetra +.28405 .41491 .31312 .39999 .35318 .38615 .32503 .4008 Metetra +.031 0 0 r +.32503 .4008 .35318 .38615 .39336 .3845 .36645 .39102 Metetra +.36645 .39102 .39336 .3845 .43423 .39295 .40855 .38474 Metetra +.336 .781 .96 r +.40855 .38474 .43423 .39295 .47632 .40743 .45154 .3804 Metetra +.533 .704 .949 r +.45154 .3804 .47632 .40743 .51994 .42245 .49558 .37595 Metetra +.581 .599 .836 r +.49558 .37595 .51994 .42245 .5651 .43198 .54068 .36927 Metetra +.6 .551 .771 r +.54068 .36927 .5651 .43198 .61146 .43079 .58675 .3586 Metetra +.618 .538 .742 r +.58675 .3586 .61146 .43079 .65846 .41575 .63362 .34288 Metetra +.639 .55 .738 r +.63362 .34288 .65846 .41575 .70547 .38667 .68106 .32207 Metetra +.665 .586 .757 r +.68106 .32207 .70547 .38667 .75207 .34645 .72894 .2971 Metetra +.701 .657 .804 r +.72894 .2971 .75207 .34645 .79819 .30023 .77721 .2697 Metetra +.515 .706 .958 r +.13396 .45384 .16241 .47867 .20277 .4551 .17246 .45043 Metetra +.32 .789 .93 r +.17246 .45043 .20277 .4551 .24333 .43331 .21206 .44486 Metetra +.21206 .44486 .24333 .43331 .28405 .41491 .25288 .4354 Metetra +.25288 .4354 .28405 .41491 .32503 .4008 .29486 .42102 Metetra +.29486 .42102 .32503 .4008 .36645 .39102 .33785 .40167 Metetra +.447 .87 .747 r +.33785 .40167 .36645 .39102 .40855 .38474 .38163 .37827 Metetra +.729 .946 .952 r +.38163 .37827 .40855 .38474 .45154 .3804 .42598 .3525 Metetra +.739 .774 .882 r +.42598 .3525 .45154 .3804 .49558 .37595 .47078 .32647 Metetra +.687 .64 .798 r +.47078 .32647 .49558 .37595 .54068 .36927 .51605 .30224 Metetra +.644 .564 .75 r +.51605 .30224 .54068 .36927 .58675 .3586 .5619 .28147 Metetra +.614 .525 .73 r +.5619 .28147 .58675 .3586 .63362 .34288 .60855 .26507 Metetra +.593 .513 .733 r +.60855 .26507 .63362 .34288 .68106 .32207 .65625 .25308 Metetra +.579 .527 .761 r +.65625 .25308 .68106 .32207 .72894 .2971 .70521 .24464 Metetra +.569 .581 .826 r +.70521 .24464 .72894 .2971 .77721 .2697 .75552 .23814 Metetra +.009 .432 .863 r +.10464 .42825 .13396 .45384 .17246 .45043 .14104 .44346 Metetra +.195 0 0 r +.14104 .44346 .17246 .45043 .21206 .44486 .17944 .45321 Metetra +.138 0 0 r +.17944 .45321 .21206 .44486 .25288 .4354 .22019 .45232 Metetra +.22019 .45232 .25288 .4354 .29486 .42102 .26317 .43765 Metetra +.465 .864 .685 r +.26317 .43765 .29486 .42102 .33785 .40167 .30787 .40904 Metetra +.784 .998 .846 r +.30787 .40904 .33785 .40167 .38163 .37827 .35357 .36935 Metetra +.869 .919 .859 r +.35357 .36935 .38163 .37827 .42598 .3525 .39958 .3237 Metetra +.826 .787 .814 r +.39958 .3237 .42598 .3525 .47078 .32647 .44549 .27816 Metetra +.756 .677 .774 r +.44549 .27816 .47078 .32647 .51605 .30224 .49121 .23844 Metetra +.686 .596 .75 r +.49121 .23844 .51605 .30224 .5619 .28147 .53706 .20887 Metetra +.618 .538 .742 r +.53706 .20887 .5619 .28147 .60855 .26507 .58357 .19179 Metetra +.552 .499 .751 r +.58357 .19179 .60855 .26507 .65625 .25308 .63141 .18732 Metetra +.482 .482 .78 r +.63141 .18732 .65625 .25308 .70521 .24464 .68114 .19329 Metetra +.401 .495 .84 r +.68114 .19329 .70521 .24464 .75552 .23814 .73309 .20548 Metetra +0 .096 .575 r +.07442 .40187 .10464 .42825 .14104 .44346 .10905 .43019 Metetra +.414 0 0 r +.10905 .43019 .14104 .44346 .17944 .45321 .14636 .45093 Metetra +.13 0 0 r +.14636 .45093 .17944 .45321 .22019 .45232 .18699 .45621 Metetra +.394 .852 .852 r +.18699 .45621 .22019 .45232 .26317 .43765 .23082 .44119 Metetra +.773 .989 .892 r +.23082 .44119 .26317 .43765 .30787 .40904 .27708 .40561 Metetra +.889 .94 .841 r +.27708 .40561 .30787 .40904 .35357 .36935 .32462 .35393 Metetra +.896 .861 .798 r +.32462 .35393 .35357 .36935 .39958 .3237 .37232 .29396 Metetra +.862 .786 .775 r +.37232 .29396 .39958 .3237 .44549 .27816 .41948 .23467 Metetra +.805 .716 .767 r +.41948 .23467 .44549 .27816 .49121 .23844 .46594 .18421 Metetra +.728 .649 .77 r +.46594 .18421 .49121 .23844 .53706 .20887 .51208 .14854 Metetra +.631 .582 .78 r +.51208 .14854 .53706 .20887 .58357 .19179 .55866 .13082 Metetra +.511 .515 .796 r +.55866 .13082 .58357 .19179 .63141 .18732 .60663 .13118 Metetra +.369 .453 .816 r +.60663 .13118 .63141 .18732 .68114 .19329 .65686 .14672 Metetra +.214 .41 .839 r +.65686 .14672 .68114 .19329 .73309 .20548 .70986 .17168 Metetra +.537 .015 0 r +.04324 .37466 .07442 .40187 .10905 .43019 .077 .40763 Metetra +0 .168 .606 r +.077 .40763 .10905 .43019 .14636 .45093 .1138 .43228 Metetra +.116 .582 .916 r +.1138 .43228 .14636 .45093 .18699 .45621 .15445 .43963 Metetra +.627 .848 .984 r +.15445 .43963 .18699 .45621 .23082 .44119 .19889 .42414 Metetra +.819 .866 .881 r +.19889 .42414 .23082 .44119 .27708 .40561 .24623 .38554 Metetra +.874 .836 .806 r +.24623 .38554 .27708 .40561 .32462 .35393 .2951 .32894 Metetra +.883 .808 .77 r +.2951 .32894 .32462 .35393 .37232 .29396 .34415 .26321 Metetra +.871 .784 .763 r +.34415 .26321 .37232 .29396 .41948 .23467 .39247 .19847 Metetra +.837 .76 .778 r +.39247 .19847 .41948 .23467 .46594 .18421 .43981 .14372 Metetra +.772 .728 .812 r +.43981 .14372 .46594 .18421 .51208 .14854 .48654 .10547 Metetra +.653 .673 .856 r +.48654 .10547 .51208 .14854 .55866 .13082 .5335 .08713 Metetra +.465 .578 .883 r +.5335 .08713 .55866 .13082 .60663 .13118 .58175 .08883 Metetra +.239 .456 .869 r +.58175 .08883 .60663 .13118 .65686 .14672 .6323 .10744 Metetra +.062 .362 .832 r +.6323 .10744 .65686 .14672 .70986 .17168 .68581 .13668 Metetra +P +p +.002 w +.67932 .02494 m +.94594 .43277 L +s +.94594 .43277 m +.97506 .64585 L +s +.97506 .64585 m +.69286 .25814 L +s +.69286 .25814 m +.67932 .02494 L +s +.06024 .26735 m +.02494 .49015 L +s +.02494 .49015 m +.69286 .25814 L +s +.69286 .25814 m +.67932 .02494 L +s +.67932 .02494 m +.06024 .26735 L +s +P +p +p +.002 w +.06024 .26735 m +.67932 .02494 L +s +P +p +.002 w +.16191 .22754 m +.16631 .23196 L +s +P +p +.002 w +.35089 .15354 m +.35496 .15826 L +s +P +p +.002 w +.55515 .07356 m +.55883 .07859 L +s +P +p +.001 w +.19857 .21319 m +.20117 .21587 L +s +P +p +.001 w +.23578 .19861 m +.23834 .20134 L +s +P +p +.001 w +.27356 .18382 m +.27609 .18658 L +s +P +p +.001 w +.31193 .1688 m +.31441 .17159 L +s +P +p +.001 w +.39046 .13804 m +.39286 .14091 L +s +P +p +.001 w +.43066 .1223 m +.43301 .12521 L +s +P +p +.001 w +.4715 .10631 m +.4738 .10926 L +s +P +p +.001 w +.51299 .09007 m +.51525 .09305 L +s +P +p +.001 w +.1258 .24168 m +.12847 .2443 L +s +P +p +.001 w +.09021 .25561 m +.09292 .25819 L +s +P +p +.001 w +.598 .05678 m +.60015 .05984 L +s +P +p +.001 w +.64156 .03972 m +.64365 .04282 L +s +P +P +% End of Graphics +MathPictureEnd +end +%%EndDocument + @endspecial 2322 5046 a Fe(\000)p Fg(2)2536 5110 y(0)2715 +5180 y(2)2915 5129 y Fe(\000)p Fg(2)2992 5011 y(0)3060 +4907 y(2)2231 4971 y Fe(\000)p Fg(1)2175 4927 y Fe(\000)p +Fg(0)p Ff(:)p Fg(5)2265 4886 y(0)2208 4838 y(0)p Ff(:)p +Fg(5)2249 4789 y(1)2322 5046 y Fe(\000)p Fg(2)2536 5110 +y(0)2715 5180 y(2)2562 4874 y @beginspecial 42.812070 +@hsize 11.676800 @vsize @setspecial +%%BeginDocument: mmawhite.eps +gsave 1 setgray clippath fill grestore +%%EndDocument + @endspecial 2562 4780 357 4 v 2562 4870 4 91 v 2590 +4845 a FA(some)g(text)p 2916 4870 V 2562 4873 357 4 v +1319 5406 a FI(Figure)31 b(4:)43 b(A)33 b(sample)f(\014gure.)1832 +5828 y(10)p eop +%%Page: 11 12 +11 11 bop -79 349 a FB(10)158 b(The)53 b(p)l(rogram)g +Fa(extpro)-79 568 y FI(The)35 b(program)d Fy(extpro)j +FI(extracts)g(a)e(prologue)g(\014le)g(from)f(a)i FD(Mathematica)e +FI(P)m(ostScript)i(sa)m(v)m(ed)i(picture.)-79 688 y(Simply)29 +b(sa)m(v)m(e)j(a)e(graphics)g(within)f FD(Mathematica)g +FI(is)h Fy(PS)h FI(format,)e(or)h(pass)i(the)f(output)f(through)g +Fy(psfix)p FI(.)-79 808 y(Then)k(use)1171 1012 y Fy(extpro)h +Fx(h)p FE(mma)e(\014le)7 b Fx(i)33 b(h)p FE(pr)-5 b(olo)g(gue)34 +b(\014le)7 b Fx(i)-79 1215 y FI(where)37 b Fx(h)p FE(mma)g(\014le)7 +b Fx(i)36 b FI(is)f(the)h(name)g(of)f(the)h(graphics)g(sa)m(v)m(ed)i +(in)d Fy(PS)h FI(format,)f(and)h Fx(h)p FE(pr)-5 b(olo)g(gue)37 +b(\014le)7 b Fx(i)36 b FI(is)f(the)-79 1336 y(name)d(of)g(the)h +(prologue)f(\014le)g(to)g(sa)m(v)m(e.)45 b(E.g.)1111 +1539 y Fy(extpro)53 b(mygraph.ps)h(texmma23.pro)-79 1742 +y FI(The)34 b(obtained)e(prologue)f(\014le)h(can)h(b)s(e)g(used)h(as)f +(optional)d(argumen)m(t)i(for)g(the)h(option)f Fy(-p)p +FI(.)1832 5828 y(11)p eop +%%Page: 12 13 +12 12 bop -79 349 a FB(11)158 b(Distribution)54 b(Files)-79 +568 y FI(This)33 b(arc)m(hiv)m(e)g(con)m(tains)g(the)g(follo)m(wing)d +(\014les:)117 721 y Fy(msdos/mma2ltx.exe)104 b FI(Binary)33 +b(executable)g(for)f(MS/DOS)117 842 y Fy(msdos/extpro.exe)155 +b FI(Binary)33 b(executable)g(for)f(MS/DOS)117 962 y +Fy(amiga/mma2ltx)308 b FI(Binary)33 b(executable)g(for)f(the)h(Amiga) +117 1082 y Fy(amiga/extpro)359 b FI(Binary)33 b(executable)g(for)f(the) +h(Amiga)117 1203 y Fy(mma2ltx.c)512 b FI(C)33 b(source)h(of)e +FE(mma2ltx)117 1323 y Fy(extpro.c)563 b FI(C)33 b(source)h(of)e +Fy(extpro)117 1443 y(mmatext.sty)410 b FI(L)1114 1430 +y FC(a)1160 1443 y FI(T)1214 1474 y(E)1269 1443 y(X)33 +b(macro)e(\014le)117 1564 y Fy(texmma22.lpro)308 b FD(Mathematica)32 +b FI(v2.2)g(P)m(ostScript)i(prologue)d(\014le)117 1684 +y Fy(texmma22.pro)359 b FI(Squeezed)35 b(v)m(ersion)f(of)e(`)p +Fy(texmma22.lpro)p FI(')117 1805 y Fy(mmawhite.eps)359 +b FI(A)33 b(P)m(ostScript)g(\014le)f(needed)i(to)f(`)p +Fy(mmatext.sty)p FI(')117 1925 y Fy(Makefile)563 b FI(A)33 +b(Unix)f(Mak)m(e\014le)117 2045 y Fy(makefile.ami)359 +b FI(Mak)m(e\014le)34 b(for)e(the)h(Amiga)117 2166 y +Fy(makefile.msc)359 b FI(Mak)m(e\014le)34 b(for)e(MS/DOS)117 +2286 y Fy(doc/mma2ltx.dvi)206 b FI(Do)s(cumen)m(tation)31 +b(of)h FE(mma2ltx)g FI(\()p Fy(dvi)h FI(form\))117 2407 +y Fy(doc/mma2ltx.ps)257 b FI(Do)s(cumen)m(tation)31 b(of)h +FE(mma2ltx)g FI(\(P)m(ostScript)h(form)e(at)i(300)e(dpi\))117 +2527 y Fy(doc/mma2ltx6.ps)206 b FI(Do)s(cumen)m(tation)31 +b(of)h FE(mma2ltx)g FI(\(P)m(ostScript)h(form)e(at)i(600)e(dpi\))117 +2647 y Fy(doc/6mag.eps)359 b FE(mma2ltx)32 b FI(EPSF)h(\014le)f +(\(needed)i(to)f(`)p Fy(mma2ltx.dvi)p FI('\))117 2768 +y Fy(doc/12mag.eps)308 b FE(mma2ltx)32 b FI(EPSF)h(\014le)f(\(needed)i +(to)f(`)p Fy(mma2ltx.dvi)p FI('\))117 2888 y Fy(doc/12mag)p +582 2888 31 4 v 40 w(3d.eps)166 b FE(mma2ltx)32 b FI(EPSF)h(\014le)f +(\(needed)i(to)f(`)p Fy(mma2ltx.dvi)p FI('\))117 3008 +y Fy(doc/optc.eps)359 b FE(mma2ltx)32 b FI(EPSF)h(\014le)f(\(needed)i +(to)f(`)p Fy(mma2ltx.dvi)p FI('\))117 3129 y Fy(doc/arrsamp.eps)206 +b FE(mma2ltx)32 b FI(EPSF)h(\014le)f(\(needed)i(to)f(`)p +Fy(mma2ltx.dvi)p FI('\))117 3249 y Fy(doc/arrparm.1)308 +b FE(mma2ltx)32 b FI(EPSF)h(\014le)f(\(needed)i(to)f(`)p +Fy(mma2ltx.dvi)p FI('\))117 3370 y Fy(mysample.tex)359 +b FI(A)33 b(sample)f(\014le)117 3490 y Fy(mypic.ps)563 +b FI(A)33 b(sample)f(picture)g(created)i(b)m(y)f FD(Mathematica)117 +3610 y Fy(mypic.tex)512 b FI(The)34 b(\014le)e(`)p Fy(mypic.ps)p +FI(')j(as)e(pro)s(cessed)h(b)m(y)g FE(mma2ltx)117 3731 +y Fy(mypic.eps)512 b FI(The)34 b(\014le)e(`)p Fy(mypic.ps)p +FI(')j(as)e(pro)s(cessed)h(b)m(y)g FE(mma2ltx)117 3851 +y Fy(README)665 b FI(A)33 b(short)g(description)f(of)g +FE(mma2ltx)p FI(.)-79 4145 y FB(12)158 b(Limits)52 b(of)h +Fz(mma2ltx)-79 4364 y FI(Curren)m(tly)34 b(aren't)e(\(y)m(et\))i(supp)s +(orted:)66 4568 y Fx(\017)49 b FI(rotated)32 b(lab)s(els.)66 +4771 y Fx(\017)49 b FI(m)m(ultiple)30 b(graphics)i(\(the)h(ones)h(pro)s +(duced)f(with)f Fy(GraphicsArray)p FI(\).)66 4975 y Fx(\017)49 +b FI(the)33 b(`)p Fy(...->FontForm)p FI(')j FD(Mathematica)c +FI(parameter.)-79 5307 y FB(13)158 b(T)-13 b(o)52 b(do)h(list)-79 +5526 y FI(Here)33 b(follo)m(w)e(future)i(enhancemen)m(ts)i(whic)m(h)e +(are)f(on)h(m)m(y)f(list:)1832 5828 y(12)p eop +%%Page: 13 14 +13 13 bop 66 332 a Fx(\017)49 b FI(Add)33 b(supp)s(ort)g(for)f(L)915 +319 y FC(a)961 332 y FI(T)1015 362 y(E)1070 332 y(X)g(2)1224 +354 y Fq(")1270 332 y FI(.)66 535 y Fx(\017)49 b FI(Add)33 +b(supp)s(ort)g(for)f(rotated)g(lab)s(els.)66 739 y Fx(\017)49 +b FI(Add)33 b(supp)s(ort)g(for)f(others)h Fy(dvi)h FI(to)e(P)m +(ostScript)h(pro)s(cessors.)-79 1072 y FB(14)158 b(Autho)l(r)53 +b(info)-79 1291 y FI(If)43 b(y)m(ou)h(ha)m(v)m(e)h(some)e(questions,)k +(suggestions,)f(commen)m(ts,)g(bug)e(rep)s(ort)f(or)g(enhancemen)m(t)h +(requests,)-79 1411 y(please)33 b(feel)f(free)h(to)f(con)m(tact)h(me)g +(at)f(one)h(of)f(the)h(follo)m(wing)d(addresses:)66 1615 +y Fx(\017)49 b Fr(ordinary)37 b(mail:)165 1859 y FI(Giusepp)s(e)c +(Ghib\022)-49 b(o)165 1980 y(via)32 b(Sestriere,)h(133)165 +2100 y(I-10090)e(Cascine)i(Vica)f({)g(Riv)m(oli)f(\(T)-8 +b(orino\))165 2221 y(IT)g(AL)g(Y)66 2465 y Fx(\017)49 +b Fr(in)m(ternet:)42 b FE(ghib)-5 b(o@galile)g(o.p)g(olito.it)-79 +2798 y FB(15)158 b(Ackno)l(wledgements)-79 3017 y FI(The)34 +b(author)e(wishes)i(to)e(thanks:)66 3221 y Fx(\017)49 +b FI(P)-8 b(.)33 b(Lep)s(ora)f(for)g(his)g(signi\014cativ)m(e)g +(suggestions)h(and)g(collab)s(oration.)66 3424 y Fx(\017)49 +b FI(P)-8 b(.)33 b(Boieri)e(for)h(his)g(suggestions)h(and)g(for)f(ha)m +(ving)g(in)m(tensely)h(tested)h FE(mma2ltx)p FI(.)-79 +3757 y FB(16)158 b(Histo)l(ry)-79 3976 y Fr(v)m(ersion)37 +b(1.23)281 4204 y Fx(\017)49 b FI(Added)33 b(option)f +Fy(-a)h FI(to)f(dra)m(w)h(arro)m(ws)g(on)g(axes)g(of)f(a)h(2D)f +(graphic.)281 4366 y Fx(\017)49 b FI(Fixed)32 b(a)g(bug)h(in)f(the)h +(st)m(yle)g Fy(mmatext.sty)p FI(.)-79 4594 y Fr(v)m(ersion)k(1.22)281 +4823 y Fx(\017)49 b FI(Fixed)32 b(a)g(small)e(bug)j(whic)m(h)g(caused)h +('segmen)m(tation)e(fault')g(under)h(Lin)m(ux.)281 4985 +y Fx(\017)49 b FI(Use)33 b(of)f(p)s(error\(\))g(instead)h(of)f +(strerror\(\))h(\(suggested)h(b)m(y)f(P)m(eter)h(Whaite\).)-79 +5213 y Fr(v)m(ersion)j(1.21)281 5441 y Fx(\017)49 b FI(P)m(ossibilit)m +(y)31 b(to)h(use)i(new)m(er)g(prologue)d(\014les)i(from)e +FD(Mathematica)p FI(.)281 5603 y Fx(\017)49 b FI(Added)33 +b(supp)s(ort)g(for)f(m)m(ultiple)e Fy(-c)j FI(options.)1832 +5828 y(13)p eop +%%Page: 14 15 +14 14 bop 281 332 a Fx(\017)49 b FI(Added)33 b(option)f +Fy(-e)h FI(\(suggested)h(b)m(y)f(Holger)f(Danielsson\).)281 +494 y Fx(\017)49 b FI(Fixed)32 b(a)g(bug)h(in)f(the)h(function)f +(strtolwr\(\))g(\(rep)s(orted)h(b)m(y)g(Klaus)f(Burkhard\).)-79 +722 y Fr(v)m(ersion)37 b(1.2)281 951 y Fx(\017)49 b FI(Added)34 +b(supp)s(ort)f(to)g(obtain)f(non-transparen)m(t)i(ob)5 +b(jects.)47 b(No)m(w)34 b(ob)5 b(jects)34 b(\(strings,)f(pictures)380 +1071 y(and)g(so)h(on\),)g(can)g(b)s(e)g(placed)g(to)f(o)m(v)m(erlap)h +(the)g(bac)m(kground)h(graphic,)f(i.e.)46 b(as)34 b(if)f(they)h(w)m +(ere)380 1191 y(non-transparen)m(t.)281 1353 y Fx(\017)49 +b FI(Added)33 b(P)m(ostScript)g(do)s(cumen)m(tation)f(for)g(600)g(dpi)g +(prin)m(ters.)281 1515 y Fx(\017)49 b FI(Added)33 b(binary)f +(executable)i(for)e(the)h(Amiga.)-79 1743 y Fr(v)m(ersion)k(1.1)49 +b FI(First)32 b(public)f(release.)1832 5828 y(14)p eop +%%Trailer +end +userdict /end-hook known{end-hook}if +%%EOF diff --git a/graphics/mma2ltx/doc/optc.eps b/graphics/mma2ltx/doc/optc.eps new file mode 100644 index 0000000000..ed8d4d0f78 --- /dev/null +++ b/graphics/mma2ltx/doc/optc.eps @@ -0,0 +1,670 @@ +%!PS-Adobe-2.0 EPSF-2.0 +%%BoundingBox: 0 0 212.60 131.39 +%%Title: optc.eps +%%Creator: mma2ltx v1.2 +%%CreationDate: Mon Jul 18 10:23:07 1994 +%%EndComments +%MMA2LTXCommandLine: mma2ltx -ucm -p -w7.5cm -c(0,2)=(0,1)(0pt,-5pt) optc.ps +%%BeginProcSet: texmma22.pro +% Mathematica v2.2 prologue +/Mathdict 150 dict def +Mathdict begin +/Mwidth 212.60 def +/Mheight 131.39 def +/Mnodistort true def +/Mlmarg 0 def /Mrmarg 0 def /Mbmarg 0 def /Mtmarg 0 def /Mtransform{} +bind def /Mfixwid true def /Mfixdash false def /Mrot 0 def /Mpstart{ +MathPictureStart}bind def /Mpend{MathPictureEnd}bind def /Mscale{0 1 0 1 +5 -1 roll MathScale}bind def /ISOLatin1Encoding dup where{pop pop}{[ +/.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef +/.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef +/.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef +/.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef +/space /exclam /quotedbl /numbersign /dollar /percent /ampersand +/quoteright /parenleft /parenright /asterisk /plus /comma /minus /period +/slash /zero /one /two /three /four /five /six /seven /eight /nine +/colon /semicolon /less /equal /greater /question /at /A /B /C /D /E /F +/G /H /I /J /K /L /M /N /O /P /Q /R /S /T /U /V /W /X /Y /Z /bracketleft +/backslash /bracketright /asciicircum /underscore /quoteleft /a /b /c /d +/e /f /g /h /i /j /k /l /m /n /o /p /q /r /s /t /u /v /w /x /y /z +/braceleft /bar /braceright /asciitilde /.notdef /.notdef /.notdef +/.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef +/.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /dotlessi /grave +/acute /circumflex /tilde /macron /breve /dotaccent /dieresis /.notdef +/ring /cedilla /.notdef /hungarumlaut /ogonek /caron /space /exclamdown +/cent /sterling /currency /yen /brokenbar /section /dieresis /copyright +/ordfeminine /guillemotleft /logicalnot /hyphen /registered /macron +/degree /plusminus /twosuperior /threesuperior /acute /mu /paragraph +/periodcentered /cedilla /onesuperior /ordmasculine /guillemotright +/onequarter /onehalf /threequarters /questiondown /Agrave /Aacute +/Acircumflex /Atilde /Adieresis /Aring /AE /Ccedilla /Egrave /Eacute +/Ecircumflex /Edieresis /Igrave /Iacute /Icircumflex /Idieresis /Eth +/Ntilde /Ograve /Oacute /Ocircumflex /Otilde /Odieresis /multiply +/Oslash /Ugrave /Uacute /Ucircumflex /Udieresis /Yacute /Thorn +/germandbls /agrave /aacute /acircumflex /atilde /adieresis /aring /ae +/ccedilla /egrave /eacute /ecircumflex /edieresis /igrave /iacute +/icircumflex /idieresis /eth /ntilde /ograve /oacute /ocircumflex +/otilde /odieresis /divide /oslash /ugrave /uacute /ucircumflex +/udieresis /yacute /thorn /ydieresis]def}ifelse /MFontDict 50 dict def +/MStrCat{exch dup length 2 index length add string dup 3 1 roll copy +length exch dup 4 2 roll exch putinterval}def /MCreateEncoding{1 index +255 string cvs(-)MStrCat 1 index MStrCat cvn exch(Encoding)MStrCat cvn +dup where{exch get}{pop StandardEncoding}ifelse 3 1 roll dup MFontDict +exch known not{1 index findfont dup length dict begin{1 index /FID ne{ +def}{pop pop}ifelse}forall /Encoding 3 index def currentdict end 1 index +exch definefont pop MFontDict 1 index null put}if exch pop exch pop}def +/ISOLatin1{(ISOLatin1)MCreateEncoding}def /ISO8859{(ISOLatin1) +MCreateEncoding}def /Mcopyfont{dup maxlength dict exch{1 index /FID eq{ +pop pop}{2 index 3 1 roll put}ifelse}forall}def /Plain /Courier findfont +Mcopyfont definefont pop /Bold /Courier findfont Mcopyfont +definefont pop /Italic /Courier findfont Mcopyfont definefont +pop /MathPictureStart{gsave Mtransform Mlmarg Mbmarg translate Mwidth +Mlmarg Mrmarg add sub /Mwidth exch def Mheight Mbmarg Mtmarg add sub +/Mheight exch def /Mtmatrix matrix currentmatrix def /Mgmatrix matrix +currentmatrix def}bind def /MathPictureEnd{grestore}bind def /MFill{0 0 +moveto Mwidth 0 lineto Mwidth Mheight lineto 0 Mheight lineto fill}bind +def /MPlotRegion{3 index Mwidth mul 2 index Mheight mul translate exch +sub Mheight mul /Mheight exch def exch sub Mwidth mul /Mwidth exch def} +bind def /MathSubStart{Momatrix Mgmatrix Mtmatrix Mwidth Mheight 7 -2 +roll moveto Mtmatrix setmatrix currentpoint Mgmatrix setmatrix 9 -2 roll +moveto Mtmatrix setmatrix currentpoint 2 copy translate /Mtmatrix matrix +currentmatrix def 3 -1 roll exch sub /Mheight exch def sub /Mwidth exch +def}bind def /MathSubEnd{/Mheight exch def /Mwidth exch def /Mtmatrix +exch def dup setmatrix /Mgmatrix exch def /Momatrix exch def}bind def +/Mdot{moveto 0 0 rlineto stroke}bind def /Mtetra{moveto lineto lineto +lineto fill}bind def /Metetra{moveto lineto lineto lineto closepath +gsave fill grestore 0 setgray stroke}bind def /Mistroke{flattenpath 0 0 +0{4 2 roll pop pop}{4 -1 roll 2 index sub dup mul 4 -1 roll 2 index sub +dup mul add sqrt 4 -1 roll add 3 1 roll}{stop}{stop}pathforall pop pop +currentpoint stroke moveto currentdash 3 -1 roll add setdash}bind def +/Mfstroke{stroke currentdash pop 0 setdash}bind def /Mrotsboxa{gsave dup +/Mrot exch def Mrotcheck Mtmatrix dup setmatrix 7 1 roll 4 index 4 index +translate rotate 3 index -1 mul 3 index -1 mul translate /Mtmatrix +matrix currentmatrix def grestore Msboxa 3 -1 roll /Mtmatrix exch def +/Mrot 0 def}bind def /Msboxa{newpath 5 -1 roll Mvboxa pop Mboxout 6 -1 +roll 5 -1 roll 4 -1 roll Msboxa1 5 -3 roll Msboxa1 Mboxrot[7 -2 roll 2 +copy[3 1 roll 10 -1 roll 9 -1 roll]6 1 roll 5 -2 roll]}bind def /Msboxa1 +{sub 2 div dup 2 index 1 add mul 3 -1 roll -1 add 3 -1 roll mul}bind def +/Mvboxa{Mfixwid{Mvboxa1}{dup Mwidthcal 0 exch{add}forall exch Mvboxa1 4 +index 7 -1 roll add 4 -1 roll pop 3 1 roll}ifelse}bind def /Mvboxa1{ +gsave newpath[true 3 -1 roll{Mbbox 5 -1 roll{0 5 1 roll}{7 -1 roll exch +sub(m)stringwidth pop .3 mul sub 7 1 roll 6 -1 roll 4 -1 roll Mmin 3 -1 +roll 5 index add 5 -1 roll 4 -1 roll Mmax 4 -1 roll}ifelse false}forall{ +stop}if counttomark 1 add 4 roll]grestore}bind def /Mbbox{1 dict begin 0 +0 moveto /temp(T)def{gsave currentpoint newpath moveto temp 0 3 -1 roll +put temp false charpath flattenpath currentpoint pathbbox grestore +moveto lineto moveto}forall pathbbox newpath end}bind def /Mmin{2 copy +gt{exch}if pop}bind def /Mmax{2 copy lt{exch}if pop}bind def /Mrotshowa{ +dup /Mrot exch def Mrotcheck Mtmatrix dup setmatrix 7 1 roll 4 index 4 +index translate rotate 3 index -1 mul 3 index -1 mul translate /Mtmatrix +matrix currentmatrix def Mgmatrix setmatrix Mshowa /Mtmatrix exch def +/Mrot 0 def}bind def /Mshowa{4 -2 roll moveto 2 index Mtmatrix setmatrix +Mvboxa 7 1 roll Mboxout 6 -1 roll 5 -1 roll 4 -1 roll Mshowa1 4 1 roll +Mshowa1 rmoveto currentpoint Mfixwid{Mshowax}{Mshoway}ifelse pop pop pop +pop Mgmatrix setmatrix}bind def /Mshowax{0 1 4 index length -1 add{2 +index 4 index 2 index get 3 index add moveto 4 index exch get Mfixdash{ +Mfixdashp}if show}for}bind def /Mfixdashp{dup length 1 gt 1 index true +exch{45 eq and}forall and{gsave(--)stringwidth pop(-)stringwidth pop sub +2 div 0 rmoveto dup length 1 sub{(-)show}repeat grestore}if}bind def +/Mshoway{3 index Mwidthcal 5 1 roll 0 1 4 index length -1 add{2 index 4 +index 2 index get 3 index add moveto 4 index exch get[6 index aload +length 2 add -1 roll{pop Strform stringwidth pop neg exch add 0 rmoveto} +exch kshow cleartomark}for pop}bind def /Mwidthcal{[exch{Mwidthcal1} +forall][exch dup Maxlen -1 add 0 1 3 -1 roll{[exch 2 index{1 index Mget +exch}forall pop Maxget exch}for pop]Mreva}bind def /Mreva{[exch aload +length -1 1{1 roll}for]}bind def /Mget{1 index length -1 add 1 index ge{ +get}{pop pop 0}ifelse}bind def /Maxlen{[exch{length}forall Maxget}bind +def /Maxget{counttomark -1 add 1 1 3 -1 roll{pop Mmax}for exch pop}bind +def /Mwidthcal1{[exch{Strform stringwidth pop}forall]}bind def /Strform{ +/tem(x)def tem 0 3 -1 roll put tem}bind def /Mshowa1{2 copy add 4 1 roll +sub mul sub -2 div}bind def /MathScale{Mwidth Mheight Mlp translate +scale /yscale exch def /ybias exch def /xscale exch def /xbias exch def +/Momatrix xscale yscale matrix scale xbias ybias matrix translate matrix +concatmatrix def /Mgmatrix matrix currentmatrix def}bind def /Mlp{3 copy +Mlpfirst{Mnodistort{Mmin dup}if 4 index 2 index 2 index Mlprun 11 index +11 -1 roll 10 -4 roll Mlp1 8 index 9 -5 roll Mlp1 4 -1 roll and{exit}if +3 -1 roll pop pop}loop exch 3 1 roll 7 -3 roll pop pop pop}bind def +/Mlpfirst{3 -1 roll dup length 2 copy -2 add get aload pop pop pop 4 -2 +roll -1 add get aload pop pop pop 6 -1 roll 3 -1 roll 5 -1 roll sub div +4 1 roll exch sub div}bind def /Mlprun{2 copy 4 index 0 get dup 4 1 roll +Mlprun1 3 copy 8 -2 roll 9 -1 roll{3 copy Mlprun1 3 copy 11 -3 roll /gt +Mlpminmax 8 3 roll 11 -3 roll /lt Mlpminmax 8 3 roll}forall pop pop pop +pop 3 1 roll pop pop aload pop 5 -1 roll aload pop exch 6 -1 roll +Mlprun2 8 2 roll 4 -1 roll Mlprun2 6 2 roll 3 -1 roll Mlprun2 4 2 roll +exch Mlprun2 6 2 roll}bind def /Mlprun1{aload pop exch 6 -1 roll 5 -1 +roll mul add 4 -2 roll mul 3 -1 roll add}bind def /Mlprun2{2 copy add 2 +div 3 1 roll exch sub}bind def /Mlpminmax{cvx 2 index 6 index 2 index +exec{7 -3 roll 4 -1 roll}if 1 index 5 index 3 -1 roll exec{4 1 roll pop +5 -1 roll aload pop pop 4 -1 roll aload pop[8 -2 roll pop 5 -2 roll pop +6 -2 roll pop 5 -1 roll]4 1 roll pop}{pop pop pop}ifelse}bind def /Mlp1{ +5 index 3 index sub 5 index 2 index mul 1 index le 1 index 0 le or dup +not{1 index 3 index div .99999 mul 8 -1 roll pop 7 1 roll}if 8 -1 roll 2 +div 7 -2 roll pop sub 5 index 6 -3 roll pop pop mul sub exch}bind def +/intop 0 def /inrht 0 def /inflag 0 def /outflag 0 def /xadrht 0 def +/xadlft 0 def /yadtop 0 def /yadbot 0 def /Minner{outflag 1 eq{/outflag +0 def /intop 0 def /inrht 0 def}if 5 index gsave Mtmatrix setmatrix +Mvboxa pop grestore 3 -1 roll pop dup intop gt{/intop exch def}{pop} +ifelse dup inrht gt{/inrht exch def}{pop}ifelse pop /inflag 1 def}bind +def /Mouter{/xadrht 0 def /xadlft 0 def /yadtop 0 def /yadbot 0 def +inflag 1 eq{dup 0 lt{dup intop mul neg /yadtop exch def}if dup 0 gt{dup +intop mul /yadbot exch def}if pop dup 0 lt{dup inrht mul neg /xadrht +exch def}if dup 0 gt{dup inrht mul /xadlft exch def}if pop /outflag 1 +def}{pop pop}ifelse /inflag 0 def /inrht 0 def /intop 0 def}bind def +/Mboxout{outflag 1 eq{4 -1 roll xadlft leadjust add sub 4 1 roll 3 -1 +roll yadbot leadjust add sub 3 1 roll exch xadrht leadjust add add exch +yadtop leadjust add add /outflag 0 def /xadlft 0 def /yadbot 0 def +/xadrht 0 def /yadtop 0 def}if}bind def /leadjust{(m)stringwidth pop .5 +mul}bind def /Mrotcheck{dup 90 eq{yadbot /yadbot xadrht def /xadrht +yadtop def /yadtop xadlft def /xadlft exch def}if dup cos 1 index sin +Checkaux dup cos 1 index sin neg exch Checkaux 3 1 roll pop pop}bind def +/Checkaux{4 index exch 4 index mul 3 1 roll mul add 4 1 roll}bind def +/Mboxrot{Mrot 90 eq{brotaux 4 2 roll}if Mrot 180 eq{4 2 roll brotaux 4 2 +roll brotaux}if Mrot 270 eq{4 2 roll brotaux}if}bind def /brotaux{neg +exch neg}bind def /Mabsproc{0 matrix defaultmatrix dtransform +idtransform dup mul exch dup mul add sqrt}bind def /Mabswid{Mabsproc +setlinewidth}bind def /Mabsdash{exch[exch{Mabsproc}forall]exch setdash} +bind def /MBeginOrig{Momatrix concat}bind def /MEndOrig{Mgmatrix +setmatrix}bind def /sampledsound where{pop}{/sampledsound{exch pop exch +5 1 roll mul 4 idiv mul 2 idiv exch pop exch /Mtempproc exch def{ +Mtempproc pop}repeat}bind def}ifelse /g{setgray}bind def /k{ +setcmykcolor}bind def /m{moveto}bind def /p{gsave}bind def /r{ +setrgbcolor}bind def /w{setlinewidth}bind def /C{curveto}bind def /F{ +fill}bind def /L{lineto}bind def /P{grestore}bind def /s{stroke}bind def +/setcmykcolor where{pop}{/setcmykcolor{4 1 roll[4 1 roll]{1 index sub 1 +sub neg dup 0 lt{pop 0}if dup 1 gt{pop 1}if exch}forall pop setrgbcolor} +bind def}ifelse /Mcharproc{currentfile(x)readhexstring pop 0 get exch +div}bind def /Mshadeproc{dup 3 1 roll{dup Mcharproc 3 1 roll}repeat 1 eq +{setgray}{3 eq{setrgbcolor}{setcmykcolor}ifelse}ifelse}bind def +/Mrectproc{3 index 2 index moveto 2 index 3 -1 roll lineto dup 3 1 roll +lineto lineto fill}bind def /Mcolorimage{7 1 roll pop pop matrix +invertmatrix concat 2 exch exp 1 sub 3 1 roll 1 1 2 index{1 1 4 index{ +dup 1 sub exch 2 index dup 1 sub exch 7 index 9 index Mshadeproc +Mrectproc}for pop}for pop pop pop pop}bind def /Mimage{pop matrix +invertmatrix concat 2 exch exp 1 sub 3 1 roll 1 1 2 index{1 1 4 index{ +dup 1 sub exch 2 index dup 1 sub exch 7 index Mcharproc setgray +Mrectproc}for pop}for pop pop pop}bind def +%%EndProcSet: texmma22.pro +%MMA2LTXComment: Here follow the original Mathematica file stripped of the text strings +%! +%%Creator: Mathematica +%%AspectRatio: .61803 +MathPictureStart +%% Graphics +/Courier findfont 10 scalefont setfont +% Scaling calculations +0.5 0.151576 0.309017 0.257514 [ +[ -0.001 -0.001 0 0 ] +[ 1.001 .61903 0 0 ] +] MathScale +% Start of Graphics +1 setlinecap +1 setlinejoin +newpath +[ ] 0 setdash +0 g +p +p +.002 w +.04527 .30902 m +.04527 .31527 L +s +P +p +.002 w +.19685 .30902 m +.19685 .31527 L +s +P +p +.002 w +.34842 .30902 m +.34842 .31527 L +s +P +p +.002 w +.65158 .30902 m +.65158 .31527 L +s +P +p +.002 w +.80315 .30902 m +.80315 .31527 L +s +P +p +.002 w +.95473 .30902 m +.95473 .31527 L +s +P +p +.001 w +.07559 .30902 m +.07559 .31277 L +s +P +p +.001 w +.1059 .30902 m +.1059 .31277 L +s +P +p +.001 w +.13622 .30902 m +.13622 .31277 L +s +P +p +.001 w +.16653 .30902 m +.16653 .31277 L +s +P +p +.001 w +.22716 .30902 m +.22716 .31277 L +s +P +p +.001 w +.25748 .30902 m +.25748 .31277 L +s +P +p +.001 w +.28779 .30902 m +.28779 .31277 L +s +P +p +.001 w +.31811 .30902 m +.31811 .31277 L +s +P +p +.001 w +.37874 .30902 m +.37874 .31277 L +s +P +p +.001 w +.40905 .30902 m +.40905 .31277 L +s +P +p +.001 w +.43937 .30902 m +.43937 .31277 L +s +P +p +.001 w +.46968 .30902 m +.46968 .31277 L +s +P +p +.001 w +.53032 .30902 m +.53032 .31277 L +s +P +p +.001 w +.56063 .30902 m +.56063 .31277 L +s +P +p +.001 w +.59095 .30902 m +.59095 .31277 L +s +P +p +.001 w +.62126 .30902 m +.62126 .31277 L +s +P +p +.001 w +.68189 .30902 m +.68189 .31277 L +s +P +p +.001 w +.71221 .30902 m +.71221 .31277 L +s +P +p +.001 w +.74252 .30902 m +.74252 .31277 L +s +P +p +.001 w +.77284 .30902 m +.77284 .31277 L +s +P +p +.001 w +.83347 .30902 m +.83347 .31277 L +s +P +p +.001 w +.86378 .30902 m +.86378 .31277 L +s +P +p +.001 w +.8941 .30902 m +.8941 .31277 L +s +P +p +.001 w +.92441 .30902 m +.92441 .31277 L +s +P +p +.001 w +.01496 .30902 m +.01496 .31277 L +s +P +p +.001 w +.98504 .30902 m +.98504 .31277 L +s +P +p +.002 w +0 .30902 m +1 .30902 L +s +P +p +.002 w +.5 .0515 m +.50625 .0515 L +s +P +p +.002 w +.5 .18026 m +.50625 .18026 L +s +P +p +.002 w +.5 .43777 m +.50625 .43777 L +s +P +p +.002 w +.5 .56653 m +.50625 .56653 L +s +P +p +.001 w +.5 .07725 m +.50375 .07725 L +s +P +p +.001 w +.5 .10301 m +.50375 .10301 L +s +P +p +.001 w +.5 .12876 m +.50375 .12876 L +s +P +p +.001 w +.5 .15451 m +.50375 .15451 L +s +P +p +.001 w +.5 .20601 m +.50375 .20601 L +s +P +p +.001 w +.5 .23176 m +.50375 .23176 L +s +P +p +.001 w +.5 .25751 m +.50375 .25751 L +s +P +p +.001 w +.5 .28327 m +.50375 .28327 L +s +P +p +.001 w +.5 .33477 m +.50375 .33477 L +s +P +p +.001 w +.5 .36052 m +.50375 .36052 L +s +P +p +.001 w +.5 .38627 m +.50375 .38627 L +s +P +p +.001 w +.5 .41202 m +.50375 .41202 L +s +P +p +.001 w +.5 .46353 m +.50375 .46353 L +s +P +p +.001 w +.5 .48928 m +.50375 .48928 L +s +P +p +.001 w +.5 .51503 m +.50375 .51503 L +s +P +p +.001 w +.5 .54078 m +.50375 .54078 L +s +P +p +.001 w +.5 .02575 m +.50375 .02575 L +s +P +p +.001 w +.5 .59228 m +.50375 .59228 L +s +P +p +.002 w +.5 0 m +.5 .61803 L +s +P +P +0 0 m +1 0 L +1 .61803 L +0 .61803 L +closepath +clip +newpath +p +[ .025 .025 ] 0 setdash +p +.004 w +.02381 .30902 m +.04325 .27609 L +.06268 .2437 L +.08212 .21238 L +.10155 .18265 L +.12099 .155 L +.14043 .12987 L +.15986 .10768 L +.1793 .08881 L +.19874 .07354 L +.20845 .06735 L +.21817 .06215 L +.22789 .05796 L +.23275 .05625 L +.23761 .0548 L +.24247 .05362 L +.24733 .05269 L +.24976 .05233 L +.25219 .05203 L +.25462 .0518 L +.25583 .05171 L +.25705 .05164 L +.25826 .05158 L +.25887 .05155 L +.25948 .05154 L +.26008 .05152 L +.26069 .05151 L +.2613 .0515 L +.2619 .0515 L +.26251 .0515 L +.26312 .05151 L +.26373 .05152 L +.26433 .05154 L +.26494 .05155 L +.26555 .05158 L +.26676 .05164 L +.26798 .05171 L +.26919 .0518 L +.27162 .05203 L +.27405 .05233 L +.27648 .05269 L +.28134 .05362 L +.2862 .0548 L +.29592 .05796 L +.30564 .06215 L +.31535 .06735 L +.33479 .08071 L +.35423 .09781 L +.37366 .11838 L +.3931 .14209 L +Mistroke +.41254 .16853 L +.43197 .19729 L +.45141 .22787 L +.47085 .25979 L +.49028 .29252 L +.50972 .32552 L +.52915 .35824 L +.54859 .39016 L +.56803 .42075 L +.58746 .4495 L +.6069 .47594 L +.62634 .49965 L +.64577 .52022 L +.66521 .53733 L +.67493 .54449 L +.68465 .55069 L +.69436 .55589 L +.70408 .56007 L +.70894 .56178 L +.7138 .56323 L +.71866 .56442 L +.72352 .56534 L +.72595 .5657 L +.72838 .566 L +.73081 .56623 L +.73202 .56632 L +.73324 .5664 L +.73445 .56646 L +.73506 .56648 L +.73567 .5665 L +.73627 .56651 L +.73688 .56652 L +.73749 .56653 L +.7381 .56653 L +.7387 .56653 L +.73931 .56652 L +.73992 .56651 L +.74052 .5665 L +.74174 .56646 L +.74295 .5664 L +.74417 .56632 L +.74538 .56623 L +.74781 .566 L +.75024 .5657 L +.75267 .56534 L +.75753 .56442 L +.76239 .56323 L +.77211 .56007 L +.78183 .55589 L +.80126 .54449 L +Mistroke +.8207 .52923 L +.84014 .51035 L +.85957 .48817 L +.87901 .46304 L +.89845 .43538 L +.91788 .40565 L +.93732 .37434 L +.95675 .34195 L +.97619 .30902 L +Mfstroke +P +P +% End of Graphics +MathPictureEnd +end |