diff options
Diffstat (limited to 'Build/source/texk/dvipng')
69 files changed, 41346 insertions, 0 deletions
diff --git a/Build/source/texk/dvipng/ChangeLog b/Build/source/texk/dvipng/ChangeLog new file mode 100644 index 00000000000..2608b80abee --- /dev/null +++ b/Build/source/texk/dvipng/ChangeLog @@ -0,0 +1,325 @@ +2020-01-06 Akira Kakuto <kakuto@w32tex.org> + + * version.ac (dvipng_version): 1.17. + * Import dvipng 1.17. + +2019-04-07 Karl Berry <karl@freefriends.org> + + * version.ac (dvipng_version): 1.16. + * Import release 1.16 from Savannah, including these + among other changes: + +2019-04-06 Jan-Åke Larsson <jan-ake.larsson@liu.se> + + * pk.c (InitPK): check for packet_length reading outside file bounds. + Report from Andy Nguyen of ETH Zurich. + + * tfm.c (ReadTFM): check for reading outside file bounds. + Report from Andy Nguyen of ETH Zurich. + + * dvi.c (DVIGetCommand): check for (unsigned value) overflow + so we don't fail to realloc buffer if needed. + Report from Andy Nguyen of ETH Zurich, found using afl-fuzz. + +2016-02-23 Akira Kakuto <kakuto@fuk.kindai.ac.jp> + + * Makefile.am, configure.ac: New convention. + +2015-07-07 Peter Breitenlohner <peb@mppmu.mpg.de> + + * Makefile.am: Better dependencies for 'make check'. + +2015-03-10 Peter Breitenlohner <peb@mppmu.mpg.de> + + * configure.ac: Drop checks for strstr and strtol. + +2015-03-07 Peter Breitenlohner <peb@mppmu.mpg.de> + + * configure.ac: Check for texlive_gs_init(), if Windows. + * Makefile.am: Add '-DTEXLIVE' to AM_CPPFLAGS. + Drop unused DVIPS and TEXI2HTML. + +2015-03-03 Peter Breitenlohner <peb@mppmu.mpg.de> + + * Imported release 1.15 from savannah.nongnu.org. + * doc/Makefile.am, version.ac: Adapted. + +2015-02-16 Peter Breitenlohner <peb@mppmu.mpg.de> + + * Makefile.am: Use the fragment ../../am/dist_hook.am. + +2014-08-22 Peter Breitenlohner <peb@mppmu.mpg.de> + + * Makefile.am: Add explicit dependency on freetype2 and libpng. + +2014-02-26 Peter Breitenlohner <peb@mppmu.mpg.de> + + * configure.ac: Drop AC_FUNC_{ALLOCA,FORK} (results not used). + +2013-09-03 Peter Breitenlohner <peb@mppmu.mpg.de> + + * gs-device.m4, makeinfo.m4: Slightly rewrite, update Copyright. + +2013-09-02 Peter Breitenlohner <peb@mppmu.mpg.de> + + * Makefile.am: Drop ACLOCAL_AMFLAGS. + * configure.ac: Use AC_CONFIG_MACRO_DIRS. + +2013-07-05 Peter Breitenlohner <peb@mppmu.mpg.de> + + * Makefile.am, doc/Makefile.am: + Moved Makefile fragments to ../../am/. + +2013-07-05 Peter Breitenlohner <peb@mppmu.mpg.de> + + * dvipng.test: ALso run 'dvipng --gif'. + * Makefile.am (CLEANFILES): Adapted. + +2013-05-19 Peter Breitenlohner <peb@mppmu.mpg.de> + + * version.ac (new): Define dvipng version. + * configure.ac: Use version.ac. Do not use AC_FUNC_MALLOC + because this might redefine malloc() as rpl_malloc(). + +2013-05-18 Peter Breitenlohner <peb@mppmu.mpg.de> + + * ac/withenable.ac, Makefile.am, configure.ac: Drop t1lib. + +2013-01-30 Peter Breitenlohner <peb@mppmu.mpg.de> + + * Makefile.am, configure.ac: Allow subdir-objects. + +2012-11-22 Peter Breitenlohner <peb@mppmu.mpg.de> + + * Makefile.am (dvipng_dependencies): Drop indirect dependencies. + +2012-07-25 Peter Breitenlohner <peb@mppmu.mpg.de> + + * configure.ac: Drop check for 64-bit integer types, already + done via KPSE_COMMON. + +2012-05-22 Peter Breitenlohner <peb@mppmu.mpg.de> + + * dvipng.test: Cope with spaces in paths returned by kpsewhich. + +2011-10-04 Peter Breitenlohner <peb@mppmu.mpg.de> + + * Makefile.am (CLEANFILES): Adapt to 'new' test script. + +2011-05-30 Peter Breitenlohner <peb@mppmu.mpg.de> + + * Makefile.am: Use ../am/bin_links.am for $(bindir) links. + +2011-02-15 Peter Breitenlohner <peb@mppmu.mpg.de> + + * Makefile.am, configure.ac [WIN32]: Add dvigif.exe wrapper. + +2011-02-08 Peter Breitenlohner <peb@mppmu.mpg.de> + + * doc/Makefile.am: Use ../am/man1_links.am for manpage links. + +2010-12-16 Peter Breitenlohner <peb@mppmu.mpg.de> + + * doc/Makefile.am: Check that the doc/*.texi files are copies + of those in the distributed tree (maintainer mode only). + +2010-12-15 Peter Breitenlohner <peb@mppmu.mpg.de> + + * Imported release 1.14 from savannah.nongnu.org. + * configure.ac: Adapted. + +2010-05-30 Vladimir Volovich <vvv@vsu.ru> + + * dvipng.test: use `...` not $(...). + +2010-05-01 Karl Berry <karl@tug.org> + + * dvipng.texi: include full gd copyright notice; seems the + safe thing to do. + +2010-04-20 Peter Breitenlohner <peb@mppmu.mpg.de> + + * dvipng.test: Check results from running kpsewhich. + * Makefile.am: Reactivate the test. + +2010-04-19 Karl Berry <karl@tug.org> + + * Makefile.am: forget the tests. + +2010-04-19 Peter Breitenlohner <peb@mppmu.mpg.de> + + * Makefile.am: Add dvipng-test.dvi. + +2010-04-18 Karl Berry <karl@tug.org> + + * dvipng.test: do not run latex. + * dvipng-test.dvi: new file. + +2010-03-29 Peter Breitenlohner <peb@mppmu.mpg.de> + + * configure.ac: Remove AC_TYPE_SIZE_T, now part of KPSE_COMMON. + +2010-03-18 Peter Breitenlohner <peb@mppmu.mpg.de> + + * Imported release 1.13 from savannah.nongnu.org. + * configure.ac: Adapted. + +2010-03-09 Peter Breitenlohner <peb@mppmu.mpg.de> + + * configure.ac: Check for kpse_set_program_name() as used in + dvipng.c instead of kpse_set_progname(). + +2010-02-24 Peter Breitenlohner <peb@mppmu.mpg.de> + + * configure.ac, help/Makefile.am: Do not even try to rebuild + doc/dvipng.help when cross compiling. + +2010-02-02 Peter Breitenlohner <peb@mppmu.mpg.de> + + * configure.ac: Fix 'on demand' build. + +2010-01-19 Peter Breitenlohner <peb@mppmu.mpg.de> + + * Makefile.am, configure.ac: Rearrange for 'on demand' build. + +2009-11-03 Peter Breitenlohner <peb@mppmu.mpg.de> + + * Makefile.am, configure.ac: Proxy build system for TeX Live, + using the dvipng-1.12 distribution tree. + * dvipng-1.12-PATCHES: New directory with patches applied to + the dvipng-1.12 distribution. + * dvipng.test: Adapted. + +2009-06-12 Peter Breitenlohner <peb@mppmu.mpg.de> + + Avoid compiler warnings. + * color.c, dvi.c, dvipng.h, fontmap.c, misc.c, papersiz.c, + ppagelist.c, special.c: ANSI C function definitions. Declare + various param strings as const. + * special.c (SetSpecial): Avoid assigning a literal string to + the non-const string variable 'special' (somewhat clumsy). + +2009-06-12 Peter Breitenlohner <peb@mppmu.mpg.de> + + * help/Makefile.am: do not even try to rebuild doc/dvipng.help + unless dvipng$(EXEEXT) has been rebuilt. + +2009-06-09 Peter Breitenlohner <peb@mppmu.mpg.de> + + Avoid warnings when compiling with 'gcc --Wmissing-prototypes'. + * color.c (NewColor, LoadColornameFile, ClearXColorPrologue, + LoadXColorPrologue): declare as static. + * draw.c (DrawPage): declare as static. + * dvi.c (DVIInit, SkipPage, InitPage, DelPageList): declare as + static. + * enc.c (InitEncoding): declare as static. + * font.c (ActualFactor, kpse_find_t1_or_tt, FontFind, DoneFont): + declare as static. + * fontmap.c (newword, find_format, SearchPSFontMap, + ReadPSFontMap): declare as static. + * ft.c (UnLoadFT): declare as static. + * papersiz.c (myatodim): declare as static. + * pk.c (getnyb, pk_packed_num, skip_specials, UnLoadPK): declare + as static. + * ppagelist.c (ListPage): declare as static. + * set.c (ChangeColor): declare as static. + * sfd.c (ReadSubfont): declare as static. + * special.c (PSCodeInit, writepscode, ps2png, rescale, + newpsheader): declare as static. + * t1.c (UnLoadT1): declare as static. + +2009-03-25 Peter Breitenlohner <peb@mppmu.mpg.de> + + * dvipng-1.12-patches (new): patches applied to dvipng-1.12. + +2009-03-25 Peter Breitenlohner <peb@mppmu.mpg.de> + + * color.c, dvipng.h, fontmap.c, ft.c, misc.c, pk.c, set.c, + t1.c, tfm.c: "#if HAVE_ALLOCA_H" => "#ifdef HAVE_ALLOCA_H" + and similar, to avoid preprocessor warnings. + +2009-03-24 Peter Breitenlohner <peb@mppmu.mpg.de> + + * Imported release 1.12 from savannah.nongnu.org. + * *-1.11 (removed), *-1.12 (new): Original files. + + * Makefile.am, configure.ac: New TeX Live build system. + + From Vladimir Volovich <vvv@vsu.ru> + * special.c: portability fix - put variable declarations + at the beginning of the block. + +2008-05-15 Peter Breitenlohner <peb@mppmu.mpg.de> + + * Imported release 1.11 from savannah.nongnu.org. + * *-1.10 (removed), *-1.11 (new): Original files. + * configure.ac: Updated for release 1.11. + + From Vladimir Volovich <vvv@vsu.ru> + * misc.c: fix the field name: mmap => data (oversight from + old code?) + * special.c: portability fix - put variable declarations + at the beginning of the block. + +2008-05-14 Peter Breitenlohner <peb@mppmu.mpg.de> + + * Imported release 1.10 from savannah.nongnu.org. + + * Makefile.in-1.10, aclocal.m4-1.10, config.h.in-1.10, + configure.ac-1.10, configure-1.10 (all new): Original files + from release 1.10. + + * acinclude.m4 (new): M4 macros extracted from aclocal.m4-1.10. + + * Makefile.in, configure.ac: Adapted for TeX Live. + + * aclocal.m4, config.h.in, configure: Regenerated. + + * dvipng.{dvi,help,info}: Updated generated files. + +2008-05-01 Vladimir Volovich <vvv@vsu.ru> + + * misc.c: #include dvipng.h again at the top, since the mmap + clash is resolved. + +2008-04-29 Vladimir Volovich <vvv@vsu.ru> + + * misc.c: #include dvipng.h after sys/mman.h, for AIX. + +2008-04-06 Peter Breitenlohner <peb@mppmu.mpg.de> + + * configure.ac: respect library dependencies. + +2008-04-02 Peter Breitenlohner <peb@mppmu.mpg.de> + + * configure.ac: fix (system and included) library dependencies. + +2008-03-31 Peter Breitenlohner <peb@mppmu.mpg.de> + + * special.c: allow for libgd without jpeg support. + * configure.ac, config.h.in, configure: adapt. + +2008-02-20 Peter Breitenlohner <peb@mppmu.mpg.de> + + * configure.ac: Use AC_SEARCH_LIBS such that -lm and -lgen are + automatically appended to LIBS if needed. + Quote first arg of of AC_DEFUN. + +2006-12-24 Karl Berry <karl@tug.org> + + * dvipng.h: don't try stdbool if we have kpathsea, Staszek's old + machine doesn't define false. + +2006-12-11 Karl Berry <karl@tug.org> + + * Makefile.in (MKINSTALLDIRS): is in $(srcdir). + +2006-12-09 Karl Berry <karl@tug.org> + + * dvipng.h (alloca) [_AIX]: #define as _alloca, per the autoconf + manual. + +2006-12-05 Karl Berry <karl@tug.org> + + * Imported release 1.9. + diff --git a/Build/source/texk/dvipng/Makefile.am b/Build/source/texk/dvipng/Makefile.am new file mode 100644 index 00000000000..a201f29f4a4 --- /dev/null +++ b/Build/source/texk/dvipng/Makefile.am @@ -0,0 +1,106 @@ +## $Id$ +## Makefile.am for the TeX Live subdirectory texk/dvipng/ +## +## Copyright 2017 Karl Berry <tex-live@tug.org> +## Copyright 2009-2015 Peter Breitenlohner <tex-live@tug.org> +## You may freely use, modify and/or distribute this file. +## +# Adapted for TeX Live from dvipng-src/Makefile.in +# Copyright (C) 2002-2008 Jan-Åke Larsson +# +## We want to re-distribute the whole original dvipng source tree. +## +## With current automake (1.10.2) 'make distcheck' fails when +## DISTFILES contains a directory and files in that directory. +## Thus nodist_* for all files in $(DVIPNG_TREE). +EXTRA_DIST = $(DVIPNG_TREE) + +## Patches applied to the original source tree +EXTRA_DIST += TLpatches + +# Files not to be distributed +include $(srcdir)/../../am/dist_hook.am +NEVER_NAMES += $(NEVER_NAMES_SUB) + +AM_CPPFLAGS = -DTEXLIVE -I$(top_srcdir)/$(DVIPNG_TREE) +AM_CPPFLAGS += $(KPATHSEA_INCLUDES) $(FREETYPE2_INCLUDES) $(GD_INCLUDES) +AM_CPPFLAGS += $(LIBPNG_INCLUDES) $(ZLIB_INCLUDES) +AM_CFLAGS = $(WARNING_CFLAGS) + +# In order that `make distcheck' succeeds, we must not attempt to rebuild +# dvipng.info if dvipng.help has not changed, Thus we delegate rebuilding +# dvipng.help and dvipng.info, if necessary, to subdirectories. +SUBDIRS = . help doc + +bin_PROGRAMS = dvipng + +nodist_dvipng_SOURCES = \ + @DVIPNG_TREE@/color.c \ + @DVIPNG_TREE@/draw.c \ + @DVIPNG_TREE@/dvi.c \ + @DVIPNG_TREE@/dvipng.c \ + @DVIPNG_TREE@/font.c \ + @DVIPNG_TREE@/misc.c \ + @DVIPNG_TREE@/papersiz.c \ + @DVIPNG_TREE@/pk.c \ + @DVIPNG_TREE@/ppagelist.c \ + @DVIPNG_TREE@/set.c \ + @DVIPNG_TREE@/special.c \ + @DVIPNG_TREE@/vf.c + +if have_ft2 +nodist_dvipng_SOURCES += \ + @DVIPNG_TREE@/enc.c \ + @DVIPNG_TREE@/fontmap.c \ + @DVIPNG_TREE@/ft.c \ + @DVIPNG_TREE@/sfd.c \ + @DVIPNG_TREE@/tfm.c +endif have_ft2 + +dvipng_dependencies = $(KPATHSEA_DEPEND) $(GD_DEPEND) $(FREETYPE2_DEPEND) $(LIBPNG_DEPEND) + +$(dvipng_OBJECTS): config.force + +config.force: $(dvipng_dependencies) + echo timestamp >config.force + $(SHELL) ./config.status --recheck + $(SHELL) ./config.status Makefile config.h + +DISTCLEANFILES = config.force + +LDADD = $(KPATHSEA_LIBS) $(GD_LIBS) $(FREETYPE2_LIBS) +LDADD += $(LIBPNG_LIBS) $(ZLIB_LIBS) + +dvigif_CPPFLAGS = -DEXEPROG=\"dvipng.exe\" +nodist_dvigif_SOURCES = callexe.c +dvigif_LDADD = + +## Rebuild libkpathsea +@KPATHSEA_RULE@ +## Rebuild gd +@GD_RULE@ +## Rebuild freetype2 +@FREETYPE2_RULE@ +## Rebuild libpng +@LIBPNG_RULE@ + +include $(srcdir)/../../am/bin_links.am + +bin_links = dvipng$(EXEEXT):dvigif + +if have_gif +if WIN32 +bin_PROGRAMS += dvigif +else !WIN32 +install-exec-hook: install-bin-links +uninstall-hook: uninstall-bin-links +endif !WIN32 +endif have_gif + +TESTS = dvipng.test +dvipng.log: dvipng$(EXEEXT) + +EXTRA_DIST += dvipng.test dvipng-test.dvi + +CLEANFILES = dvipng-test*.gif dvipng-test*.png + diff --git a/Build/source/texk/dvipng/Makefile.in b/Build/source/texk/dvipng/Makefile.in new file mode 100644 index 00000000000..9db2a30aec1 --- /dev/null +++ b/Build/source/texk/dvipng/Makefile.in @@ -0,0 +1,1619 @@ +# Makefile.in generated by automake 1.16.3 from Makefile.am. +# @configure_input@ + +# Copyright (C) 1994-2020 Free Software Foundation, Inc. + +# This Makefile.in is free software; the Free Software Foundation +# gives unlimited permission to copy and/or distribute it, +# with or without modifications, as long as this notice is preserved. + +# This program is distributed in the hope that it will be useful, +# but WITHOUT ANY WARRANTY, to the extent permitted by law; without +# even the implied warranty of MERCHANTABILITY or FITNESS FOR A +# PARTICULAR PURPOSE. + +@SET_MAKE@ + +# am/bin_links.am: Makefile fragment for bindir links. +# +# Copyright 2017-2020 Karl Berry <tex-live@tug.org> +# Copyright 2011-2013 Peter Breitenlohner <tex-live@tug.org> +# You may freely use, modify and/or distribute this file. +# +# requires conditional WIN32 +# requires $(bin_links) +# Symlinks within $(bindir): FILE:LINK indicates LINK->FILE +# for binaries and scripts use, e.g., +# binprog$(EXEEXT):foo +# script:bar +# respectively, such that the links created on cygwin are +# 'foo->binprog.exe' and 'bar->script'. + +VPATH = @srcdir@ +am__is_gnu_make = { \ + if test -z '$(MAKELEVEL)'; then \ + false; \ + elif test -n '$(MAKE_HOST)'; then \ + true; \ + elif test -n '$(MAKE_VERSION)' && test -n '$(CURDIR)'; then \ + true; \ + else \ + false; \ + fi; \ +} +am__make_running_with_option = \ + case $${target_option-} in \ + ?) ;; \ + *) echo "am__make_running_with_option: internal error: invalid" \ + "target option '$${target_option-}' specified" >&2; \ + exit 1;; \ + esac; \ + has_opt=no; \ + sane_makeflags=$$MAKEFLAGS; \ + if $(am__is_gnu_make); then \ + sane_makeflags=$$MFLAGS; \ + else \ + case $$MAKEFLAGS in \ + *\\[\ \ ]*) \ + bs=\\; \ + sane_makeflags=`printf '%s\n' "$$MAKEFLAGS" \ + | sed "s/$$bs$$bs[$$bs $$bs ]*//g"`;; \ + esac; \ + fi; \ + skip_next=no; \ + strip_trailopt () \ + { \ + flg=`printf '%s\n' "$$flg" | sed "s/$$1.*$$//"`; \ + }; \ + for flg in $$sane_makeflags; do \ + test $$skip_next = yes && { skip_next=no; continue; }; \ + case $$flg in \ + *=*|--*) continue;; \ + -*I) strip_trailopt 'I'; skip_next=yes;; \ + -*I?*) strip_trailopt 'I';; \ + -*O) strip_trailopt 'O'; skip_next=yes;; \ + -*O?*) strip_trailopt 'O';; \ + -*l) strip_trailopt 'l'; skip_next=yes;; \ + -*l?*) strip_trailopt 'l';; \ + -[dEDm]) skip_next=yes;; \ + -[JT]) skip_next=yes;; \ + esac; \ + case $$flg in \ + *$$target_option*) has_opt=yes; break;; \ + esac; \ + done; \ + test $$has_opt = yes +am__make_dryrun = (target_option=n; $(am__make_running_with_option)) +am__make_keepgoing = (target_option=k; $(am__make_running_with_option)) +pkgdatadir = $(datadir)/@PACKAGE@ +pkgincludedir = $(includedir)/@PACKAGE@ +pkglibdir = $(libdir)/@PACKAGE@ +pkglibexecdir = $(libexecdir)/@PACKAGE@ +am__cd = CDPATH="$${ZSH_VERSION+.}$(PATH_SEPARATOR)" && cd +install_sh_DATA = $(install_sh) -c -m 644 +install_sh_PROGRAM = $(install_sh) -c +install_sh_SCRIPT = $(install_sh) -c +INSTALL_HEADER = $(INSTALL_DATA) +transform = $(program_transform_name) +NORMAL_INSTALL = : +PRE_INSTALL = : +POST_INSTALL = : +NORMAL_UNINSTALL = : +PRE_UNINSTALL = : +POST_UNINSTALL = : +build_triplet = @build@ +host_triplet = @host@ +bin_PROGRAMS = dvipng$(EXEEXT) $(am__EXEEXT_1) +@have_ft2_TRUE@am__append_1 = \ +@have_ft2_TRUE@ @DVIPNG_TREE@/enc.c \ +@have_ft2_TRUE@ @DVIPNG_TREE@/fontmap.c \ +@have_ft2_TRUE@ @DVIPNG_TREE@/ft.c \ +@have_ft2_TRUE@ @DVIPNG_TREE@/sfd.c \ +@have_ft2_TRUE@ @DVIPNG_TREE@/tfm.c + +@WIN32_TRUE@@have_gif_TRUE@am__append_2 = dvigif +subdir = . +ACLOCAL_M4 = $(top_srcdir)/aclocal.m4 +am__aclocal_m4_deps = $(top_srcdir)/m4/gs-device.m4 \ + $(top_srcdir)/m4/makeinfo.m4 \ + $(top_srcdir)/../../m4/kpse-common.m4 \ + $(top_srcdir)/../../m4/kpse-freetype2-flags.m4 \ + $(top_srcdir)/../../m4/kpse-gd-flags.m4 \ + $(top_srcdir)/../../m4/kpse-kpathsea-flags.m4 \ + $(top_srcdir)/../../m4/kpse-libpng-flags.m4 \ + $(top_srcdir)/../../m4/kpse-warnings.m4 \ + $(top_srcdir)/../../m4/kpse-win32.m4 \ + $(top_srcdir)/../../m4/kpse-zlib-flags.m4 \ + $(top_srcdir)/../../m4/libtool.m4 \ + $(top_srcdir)/../../m4/ltoptions.m4 \ + $(top_srcdir)/../../m4/ltsugar.m4 \ + $(top_srcdir)/../../m4/ltversion.m4 \ + $(top_srcdir)/../../m4/lt~obsolete.m4 $(top_srcdir)/version.ac \ + $(top_srcdir)/ac/dvipng.ac $(top_srcdir)/configure.ac +am__configure_deps = $(am__aclocal_m4_deps) $(CONFIGURE_DEPENDENCIES) \ + $(ACLOCAL_M4) +DIST_COMMON = $(srcdir)/Makefile.am $(top_srcdir)/configure \ + $(am__configure_deps) $(am__DIST_COMMON) +am__CONFIG_DISTCLEAN_FILES = config.status config.cache config.log \ + configure.lineno config.status.lineno +mkinstalldirs = $(install_sh) -d +CONFIG_HEADER = config.h +CONFIG_CLEAN_FILES = callexe.c +CONFIG_CLEAN_VPATH_FILES = +@WIN32_TRUE@@have_gif_TRUE@am__EXEEXT_1 = dvigif$(EXEEXT) +am__installdirs = "$(DESTDIR)$(bindir)" +PROGRAMS = $(bin_PROGRAMS) +nodist_dvigif_OBJECTS = dvigif-callexe.$(OBJEXT) +dvigif_OBJECTS = $(nodist_dvigif_OBJECTS) +dvigif_DEPENDENCIES = +AM_V_lt = $(am__v_lt_@AM_V@) +am__v_lt_ = $(am__v_lt_@AM_DEFAULT_V@) +am__v_lt_0 = --silent +am__v_lt_1 = +am__dirstamp = $(am__leading_dot)dirstamp +@have_ft2_TRUE@am__objects_1 = @DVIPNG_TREE@/enc.$(OBJEXT) \ +@have_ft2_TRUE@ @DVIPNG_TREE@/fontmap.$(OBJEXT) \ +@have_ft2_TRUE@ @DVIPNG_TREE@/ft.$(OBJEXT) \ +@have_ft2_TRUE@ @DVIPNG_TREE@/sfd.$(OBJEXT) \ +@have_ft2_TRUE@ @DVIPNG_TREE@/tfm.$(OBJEXT) +nodist_dvipng_OBJECTS = @DVIPNG_TREE@/color.$(OBJEXT) \ + @DVIPNG_TREE@/draw.$(OBJEXT) @DVIPNG_TREE@/dvi.$(OBJEXT) \ + @DVIPNG_TREE@/dvipng.$(OBJEXT) @DVIPNG_TREE@/font.$(OBJEXT) \ + @DVIPNG_TREE@/misc.$(OBJEXT) @DVIPNG_TREE@/papersiz.$(OBJEXT) \ + @DVIPNG_TREE@/pk.$(OBJEXT) @DVIPNG_TREE@/ppagelist.$(OBJEXT) \ + @DVIPNG_TREE@/set.$(OBJEXT) @DVIPNG_TREE@/special.$(OBJEXT) \ + @DVIPNG_TREE@/vf.$(OBJEXT) $(am__objects_1) +dvipng_OBJECTS = $(nodist_dvipng_OBJECTS) +dvipng_LDADD = $(LDADD) +am__DEPENDENCIES_1 = +dvipng_DEPENDENCIES = $(am__DEPENDENCIES_1) $(am__DEPENDENCIES_1) \ + $(am__DEPENDENCIES_1) $(am__DEPENDENCIES_1) \ + $(am__DEPENDENCIES_1) +AM_V_P = $(am__v_P_@AM_V@) +am__v_P_ = $(am__v_P_@AM_DEFAULT_V@) +am__v_P_0 = false +am__v_P_1 = : +AM_V_GEN = $(am__v_GEN_@AM_V@) +am__v_GEN_ = $(am__v_GEN_@AM_DEFAULT_V@) +am__v_GEN_0 = @echo " GEN " $@; +am__v_GEN_1 = +AM_V_at = $(am__v_at_@AM_V@) +am__v_at_ = $(am__v_at_@AM_DEFAULT_V@) +am__v_at_0 = @ +am__v_at_1 = +DEFAULT_INCLUDES = -I.@am__isrc@ +depcomp = $(SHELL) $(top_srcdir)/../../build-aux/depcomp +am__maybe_remake_depfiles = depfiles +am__depfiles_remade = ./$(DEPDIR)/dvigif-callexe.Po \ + @DVIPNG_TREE@/$(DEPDIR)/color.Po \ + @DVIPNG_TREE@/$(DEPDIR)/draw.Po @DVIPNG_TREE@/$(DEPDIR)/dvi.Po \ + @DVIPNG_TREE@/$(DEPDIR)/dvipng.Po \ + @DVIPNG_TREE@/$(DEPDIR)/enc.Po @DVIPNG_TREE@/$(DEPDIR)/font.Po \ + @DVIPNG_TREE@/$(DEPDIR)/fontmap.Po \ + @DVIPNG_TREE@/$(DEPDIR)/ft.Po @DVIPNG_TREE@/$(DEPDIR)/misc.Po \ + @DVIPNG_TREE@/$(DEPDIR)/papersiz.Po \ + @DVIPNG_TREE@/$(DEPDIR)/pk.Po \ + @DVIPNG_TREE@/$(DEPDIR)/ppagelist.Po \ + @DVIPNG_TREE@/$(DEPDIR)/set.Po @DVIPNG_TREE@/$(DEPDIR)/sfd.Po \ + @DVIPNG_TREE@/$(DEPDIR)/special.Po \ + @DVIPNG_TREE@/$(DEPDIR)/tfm.Po @DVIPNG_TREE@/$(DEPDIR)/vf.Po +am__mv = mv -f +COMPILE = $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) \ + $(CPPFLAGS) $(AM_CFLAGS) $(CFLAGS) +LTCOMPILE = $(LIBTOOL) $(AM_V_lt) --tag=CC $(AM_LIBTOOLFLAGS) \ + $(LIBTOOLFLAGS) --mode=compile $(CC) $(DEFS) \ + $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) \ + $(AM_CFLAGS) $(CFLAGS) +AM_V_CC = $(am__v_CC_@AM_V@) +am__v_CC_ = $(am__v_CC_@AM_DEFAULT_V@) +am__v_CC_0 = @echo " CC " $@; +am__v_CC_1 = +CCLD = $(CC) +LINK = $(LIBTOOL) $(AM_V_lt) --tag=CC $(AM_LIBTOOLFLAGS) \ + $(LIBTOOLFLAGS) --mode=link $(CCLD) $(AM_CFLAGS) $(CFLAGS) \ + $(AM_LDFLAGS) $(LDFLAGS) -o $@ +AM_V_CCLD = $(am__v_CCLD_@AM_V@) +am__v_CCLD_ = $(am__v_CCLD_@AM_DEFAULT_V@) +am__v_CCLD_0 = @echo " CCLD " $@; +am__v_CCLD_1 = +SOURCES = $(nodist_dvigif_SOURCES) $(nodist_dvipng_SOURCES) +DIST_SOURCES = +RECURSIVE_TARGETS = all-recursive check-recursive cscopelist-recursive \ + ctags-recursive dvi-recursive html-recursive info-recursive \ + install-data-recursive install-dvi-recursive \ + install-exec-recursive install-html-recursive \ + install-info-recursive install-pdf-recursive \ + install-ps-recursive install-recursive installcheck-recursive \ + installdirs-recursive pdf-recursive ps-recursive \ + tags-recursive uninstall-recursive +am__can_run_installinfo = \ + case $$AM_UPDATE_INFO_DIR in \ + n|no|NO) false;; \ + *) (install-info --version) >/dev/null 2>&1;; \ + esac +RECURSIVE_CLEAN_TARGETS = mostlyclean-recursive clean-recursive \ + distclean-recursive maintainer-clean-recursive +am__recursive_targets = \ + $(RECURSIVE_TARGETS) \ + $(RECURSIVE_CLEAN_TARGETS) \ + $(am__extra_recursive_targets) +AM_RECURSIVE_TARGETS = $(am__recursive_targets:-recursive=) TAGS CTAGS \ + cscope check recheck distdir distdir-am dist dist-all \ + distcheck +am__tagged_files = $(HEADERS) $(SOURCES) $(TAGS_FILES) $(LISP) \ + config.h.in +# Read a list of newline-separated strings from the standard input, +# and print each of them once, without duplicates. Input order is +# *not* preserved. +am__uniquify_input = $(AWK) '\ + BEGIN { nonempty = 0; } \ + { items[$$0] = 1; nonempty = 1; } \ + END { if (nonempty) { for (i in items) print i; }; } \ +' +# Make sure the list of sources is unique. This is necessary because, +# e.g., the same source file might be shared among _SOURCES variables +# for different programs/libraries. +am__define_uniq_tagged_files = \ + list='$(am__tagged_files)'; \ + unique=`for i in $$list; do \ + if test -f "$$i"; then echo $$i; else echo $(srcdir)/$$i; fi; \ + done | $(am__uniquify_input)` +ETAGS = etags +CTAGS = ctags +CSCOPE = cscope +am__tty_colors_dummy = \ + mgn= red= grn= lgn= blu= brg= std=; \ + am__color_tests=no +am__tty_colors = { \ + $(am__tty_colors_dummy); \ + if test "X$(AM_COLOR_TESTS)" = Xno; then \ + am__color_tests=no; \ + elif test "X$(AM_COLOR_TESTS)" = Xalways; then \ + am__color_tests=yes; \ + elif test "X$$TERM" != Xdumb && { test -t 1; } 2>/dev/null; then \ + am__color_tests=yes; \ + fi; \ + if test $$am__color_tests = yes; then \ + red='[0;31m'; \ + grn='[0;32m'; \ + lgn='[1;32m'; \ + blu='[1;34m'; \ + mgn='[0;35m'; \ + brg='[1m'; \ + std='[m'; \ + fi; \ +} +am__vpath_adj_setup = srcdirstrip=`echo "$(srcdir)" | sed 's|.|.|g'`; +am__vpath_adj = case $$p in \ + $(srcdir)/*) f=`echo "$$p" | sed "s|^$$srcdirstrip/||"`;; \ + *) f=$$p;; \ + esac; +am__strip_dir = f=`echo $$p | sed -e 's|^.*/||'`; +am__install_max = 40 +am__nobase_strip_setup = \ + srcdirstrip=`echo "$(srcdir)" | sed 's/[].[^$$\\*|]/\\\\&/g'` +am__nobase_strip = \ + for p in $$list; do echo "$$p"; done | sed -e "s|$$srcdirstrip/||" +am__nobase_list = $(am__nobase_strip_setup); \ + for p in $$list; do echo "$$p $$p"; done | \ + sed "s| $$srcdirstrip/| |;"' / .*\//!s/ .*/ ./; s,\( .*\)/[^/]*$$,\1,' | \ + $(AWK) 'BEGIN { files["."] = "" } { files[$$2] = files[$$2] " " $$1; \ + if (++n[$$2] == $(am__install_max)) \ + { print $$2, files[$$2]; n[$$2] = 0; files[$$2] = "" } } \ + END { for (dir in files) print dir, files[dir] }' +am__base_list = \ + sed '$$!N;$$!N;$$!N;$$!N;$$!N;$$!N;$$!N;s/\n/ /g' | \ + sed '$$!N;$$!N;$$!N;$$!N;s/\n/ /g' +am__uninstall_files_from_dir = { \ + test -z "$$files" \ + || { test ! -d "$$dir" && test ! -f "$$dir" && test ! -r "$$dir"; } \ + || { echo " ( cd '$$dir' && rm -f" $$files ")"; \ + $(am__cd) "$$dir" && rm -f $$files; }; \ + } +am__recheck_rx = ^[ ]*:recheck:[ ]* +am__global_test_result_rx = ^[ ]*:global-test-result:[ ]* +am__copy_in_global_log_rx = ^[ ]*:copy-in-global-log:[ ]* +# A command that, given a newline-separated list of test names on the +# standard input, print the name of the tests that are to be re-run +# upon "make recheck". +am__list_recheck_tests = $(AWK) '{ \ + recheck = 1; \ + while ((rc = (getline line < ($$0 ".trs"))) != 0) \ + { \ + if (rc < 0) \ + { \ + if ((getline line2 < ($$0 ".log")) < 0) \ + recheck = 0; \ + break; \ + } \ + else if (line ~ /$(am__recheck_rx)[nN][Oo]/) \ + { \ + recheck = 0; \ + break; \ + } \ + else if (line ~ /$(am__recheck_rx)[yY][eE][sS]/) \ + { \ + break; \ + } \ + }; \ + if (recheck) \ + print $$0; \ + close ($$0 ".trs"); \ + close ($$0 ".log"); \ +}' +# A command that, given a newline-separated list of test names on the +# standard input, create the global log from their .trs and .log files. +am__create_global_log = $(AWK) ' \ +function fatal(msg) \ +{ \ + print "fatal: making $@: " msg | "cat >&2"; \ + exit 1; \ +} \ +function rst_section(header) \ +{ \ + print header; \ + len = length(header); \ + for (i = 1; i <= len; i = i + 1) \ + printf "="; \ + printf "\n\n"; \ +} \ +{ \ + copy_in_global_log = 1; \ + global_test_result = "RUN"; \ + while ((rc = (getline line < ($$0 ".trs"))) != 0) \ + { \ + if (rc < 0) \ + fatal("failed to read from " $$0 ".trs"); \ + if (line ~ /$(am__global_test_result_rx)/) \ + { \ + sub("$(am__global_test_result_rx)", "", line); \ + sub("[ ]*$$", "", line); \ + global_test_result = line; \ + } \ + else if (line ~ /$(am__copy_in_global_log_rx)[nN][oO]/) \ + copy_in_global_log = 0; \ + }; \ + if (copy_in_global_log) \ + { \ + rst_section(global_test_result ": " $$0); \ + while ((rc = (getline line < ($$0 ".log"))) != 0) \ + { \ + if (rc < 0) \ + fatal("failed to read from " $$0 ".log"); \ + print line; \ + }; \ + printf "\n"; \ + }; \ + close ($$0 ".trs"); \ + close ($$0 ".log"); \ +}' +# Restructured Text title. +am__rst_title = { sed 's/.*/ & /;h;s/./=/g;p;x;s/ *$$//;p;g' && echo; } +# Solaris 10 'make', and several other traditional 'make' implementations, +# pass "-e" to $(SHELL), and POSIX 2008 even requires this. Work around it +# by disabling -e (using the XSI extension "set +e") if it's set. +am__sh_e_setup = case $$- in *e*) set +e;; esac +# Default flags passed to test drivers. +am__common_driver_flags = \ + --color-tests "$$am__color_tests" \ + --enable-hard-errors "$$am__enable_hard_errors" \ + --expect-failure "$$am__expect_failure" +# To be inserted before the command running the test. Creates the +# directory for the log if needed. Stores in $dir the directory +# containing $f, in $tst the test, in $log the log. Executes the +# developer- defined test setup AM_TESTS_ENVIRONMENT (if any), and +# passes TESTS_ENVIRONMENT. Set up options for the wrapper that +# will run the test scripts (or their associated LOG_COMPILER, if +# thy have one). +am__check_pre = \ +$(am__sh_e_setup); \ +$(am__vpath_adj_setup) $(am__vpath_adj) \ +$(am__tty_colors); \ +srcdir=$(srcdir); export srcdir; \ +case "$@" in \ + */*) am__odir=`echo "./$@" | sed 's|/[^/]*$$||'`;; \ + *) am__odir=.;; \ +esac; \ +test "x$$am__odir" = x"." || test -d "$$am__odir" \ + || $(MKDIR_P) "$$am__odir" || exit $$?; \ +if test -f "./$$f"; then dir=./; \ +elif test -f "$$f"; then dir=; \ +else dir="$(srcdir)/"; fi; \ +tst=$$dir$$f; log='$@'; \ +if test -n '$(DISABLE_HARD_ERRORS)'; then \ + am__enable_hard_errors=no; \ +else \ + am__enable_hard_errors=yes; \ +fi; \ +case " $(XFAIL_TESTS) " in \ + *[\ \ ]$$f[\ \ ]* | *[\ \ ]$$dir$$f[\ \ ]*) \ + am__expect_failure=yes;; \ + *) \ + am__expect_failure=no;; \ +esac; \ +$(AM_TESTS_ENVIRONMENT) $(TESTS_ENVIRONMENT) +# A shell command to get the names of the tests scripts with any registered +# extension removed (i.e., equivalently, the names of the test logs, with +# the '.log' extension removed). The result is saved in the shell variable +# '$bases'. This honors runtime overriding of TESTS and TEST_LOGS. Sadly, +# we cannot use something simpler, involving e.g., "$(TEST_LOGS:.log=)", +# since that might cause problem with VPATH rewrites for suffix-less tests. +# See also 'test-harness-vpath-rewrite.sh' and 'test-trs-basic.sh'. +am__set_TESTS_bases = \ + bases='$(TEST_LOGS)'; \ + bases=`for i in $$bases; do echo $$i; done | sed 's/\.log$$//'`; \ + bases=`echo $$bases` +AM_TESTSUITE_SUMMARY_HEADER = ' for $(PACKAGE_STRING)' +RECHECK_LOGS = $(TEST_LOGS) +TEST_SUITE_LOG = test-suite.log +TEST_EXTENSIONS = @EXEEXT@ .test +am__test_logs1 = $(TESTS:=.log) +am__test_logs2 = $(am__test_logs1:@EXEEXT@.log=.log) +TEST_LOGS = $(am__test_logs2:.test.log=.log) +TEST_LOG_DRIVER = $(SHELL) $(top_srcdir)/../../build-aux/test-driver +TEST_LOG_COMPILE = $(TEST_LOG_COMPILER) $(AM_TEST_LOG_FLAGS) \ + $(TEST_LOG_FLAGS) +am__set_b = \ + case '$@' in \ + */*) \ + case '$*' in \ + */*) b='$*';; \ + *) b=`echo '$@' | sed 's/\.log$$//'`; \ + esac;; \ + *) \ + b='$*';; \ + esac +DIST_SUBDIRS = $(SUBDIRS) +am__DIST_COMMON = $(srcdir)/../../am/bin_links.am \ + $(srcdir)/../../am/dist_hook.am $(srcdir)/Makefile.in \ + $(srcdir)/config.h.in $(top_srcdir)/../../build-aux/compile \ + $(top_srcdir)/../../build-aux/config.guess \ + $(top_srcdir)/../../build-aux/config.sub \ + $(top_srcdir)/../../build-aux/depcomp \ + $(top_srcdir)/../../build-aux/install-sh \ + $(top_srcdir)/../../build-aux/ltmain.sh \ + $(top_srcdir)/../../build-aux/missing \ + $(top_srcdir)/../../build-aux/test-driver \ + $(top_srcdir)/../texlive/w32_wrapper/callexe.c \ + ../../build-aux/ar-lib ../../build-aux/compile \ + ../../build-aux/config.guess ../../build-aux/config.sub \ + ../../build-aux/depcomp ../../build-aux/install-sh \ + ../../build-aux/ltmain.sh ../../build-aux/missing \ + ../../build-aux/texinfo.tex ../../build-aux/ylwrap ChangeLog +DISTFILES = $(DIST_COMMON) $(DIST_SOURCES) $(TEXINFOS) $(EXTRA_DIST) +distdir = $(PACKAGE)-$(VERSION) +top_distdir = $(distdir) +am__remove_distdir = \ + if test -d "$(distdir)"; then \ + find "$(distdir)" -type d ! -perm -200 -exec chmod u+w {} ';' \ + && rm -rf "$(distdir)" \ + || { sleep 5 && rm -rf "$(distdir)"; }; \ + else :; fi +am__post_remove_distdir = $(am__remove_distdir) +am__relativize = \ + dir0=`pwd`; \ + sed_first='s,^\([^/]*\)/.*$$,\1,'; \ + sed_rest='s,^[^/]*/*,,'; \ + sed_last='s,^.*/\([^/]*\)$$,\1,'; \ + sed_butlast='s,/*[^/]*$$,,'; \ + while test -n "$$dir1"; do \ + first=`echo "$$dir1" | sed -e "$$sed_first"`; \ + if test "$$first" != "."; then \ + if test "$$first" = ".."; then \ + dir2=`echo "$$dir0" | sed -e "$$sed_last"`/"$$dir2"; \ + dir0=`echo "$$dir0" | sed -e "$$sed_butlast"`; \ + else \ + first2=`echo "$$dir2" | sed -e "$$sed_first"`; \ + if test "$$first2" = "$$first"; then \ + dir2=`echo "$$dir2" | sed -e "$$sed_rest"`; \ + else \ + dir2="../$$dir2"; \ + fi; \ + dir0="$$dir0"/"$$first"; \ + fi; \ + fi; \ + dir1=`echo "$$dir1" | sed -e "$$sed_rest"`; \ + done; \ + reldir="$$dir2" +DIST_ARCHIVES = $(distdir).tar.gz +GZIP_ENV = --best +DIST_TARGETS = dist-gzip +# Exists only to be overridden by the user if desired. +AM_DISTCHECK_DVI_TARGET = dvi +distuninstallcheck_listfiles = find . -type f -print +am__distuninstallcheck_listfiles = $(distuninstallcheck_listfiles) \ + | sed 's|^\./|$(prefix)/|' | grep -v '$(infodir)/dir$$' +distcleancheck_listfiles = find . -type f -print +ACLOCAL = @ACLOCAL@ +AMTAR = @AMTAR@ +AM_DEFAULT_VERBOSITY = @AM_DEFAULT_VERBOSITY@ +AM_MAKEINFOFLAGS = @AM_MAKEINFOFLAGS@ +AR = @AR@ +AS = @AS@ +AUTOCONF = @AUTOCONF@ +AUTOHEADER = @AUTOHEADER@ +AUTOMAKE = @AUTOMAKE@ +AWK = @AWK@ +CC = @CC@ +CCDEPMODE = @CCDEPMODE@ +CFLAGS = @CFLAGS@ +CPP = @CPP@ +CPPFLAGS = @CPPFLAGS@ +CYGPATH_W = @CYGPATH_W@ +DEFS = @DEFS@ +DEPDIR = @DEPDIR@ +DLLTOOL = @DLLTOOL@ +DSYMUTIL = @DSYMUTIL@ +DUMPBIN = @DUMPBIN@ +DVIPNG_TREE = @DVIPNG_TREE@ +ECHO_C = @ECHO_C@ +ECHO_N = @ECHO_N@ +ECHO_T = @ECHO_T@ +EGREP = @EGREP@ +EXEEXT = @EXEEXT@ +FGREP = @FGREP@ +FREETYPE2_DEPEND = @FREETYPE2_DEPEND@ +FREETYPE2_INCLUDES = @FREETYPE2_INCLUDES@ +FREETYPE2_LIBS = @FREETYPE2_LIBS@ +FT2_CONFIG = @FT2_CONFIG@ +GD_DEPEND = @GD_DEPEND@ +GD_INCLUDES = @GD_INCLUDES@ +GD_LIBS = @GD_LIBS@ +GREP = @GREP@ +GS = @GS@ +INSTALL = @INSTALL@ +INSTALL_DATA = @INSTALL_DATA@ +INSTALL_INFO = @INSTALL_INFO@ +INSTALL_PROGRAM = @INSTALL_PROGRAM@ +INSTALL_SCRIPT = @INSTALL_SCRIPT@ +INSTALL_STRIP_PROGRAM = @INSTALL_STRIP_PROGRAM@ +KPATHSEA_DEPEND = @KPATHSEA_DEPEND@ +KPATHSEA_INCLUDES = @KPATHSEA_INCLUDES@ +KPATHSEA_LIBS = @KPATHSEA_LIBS@ +LD = @LD@ +LDFLAGS = @LDFLAGS@ +LIBOBJS = @LIBOBJS@ +LIBPNG_DEPEND = @LIBPNG_DEPEND@ +LIBPNG_INCLUDES = @LIBPNG_INCLUDES@ +LIBPNG_LIBS = @LIBPNG_LIBS@ +LIBS = @LIBS@ +LIBTOOL = @LIBTOOL@ +LIPO = @LIPO@ +LN_S = @LN_S@ +LTLIBOBJS = @LTLIBOBJS@ +LT_SYS_LIBRARY_PATH = @LT_SYS_LIBRARY_PATH@ +MAINT = @MAINT@ +MAKEINFO = @MAKEINFO@ +MANIFEST_TOOL = @MANIFEST_TOOL@ +MKDIR_P = @MKDIR_P@ +NM = @NM@ +NMEDIT = @NMEDIT@ +OBJDUMP = @OBJDUMP@ +OBJEXT = @OBJEXT@ +OTOOL = @OTOOL@ +OTOOL64 = @OTOOL64@ +PACKAGE = @PACKAGE@ +PACKAGE_BUGREPORT = @PACKAGE_BUGREPORT@ +PACKAGE_NAME = @PACKAGE_NAME@ +PACKAGE_STRING = @PACKAGE_STRING@ +PACKAGE_TARNAME = @PACKAGE_TARNAME@ +PACKAGE_URL = @PACKAGE_URL@ +PACKAGE_VERSION = @PACKAGE_VERSION@ +PATH_SEPARATOR = @PATH_SEPARATOR@ +PKG_CONFIG = @PKG_CONFIG@ +POW_LIB = @POW_LIB@ +RANLIB = @RANLIB@ +SED = @SED@ +SET_MAKE = @SET_MAKE@ +SHELL = @SHELL@ +STRIP = @STRIP@ +VERSION = @VERSION@ +WARNING_CFLAGS = @WARNING_CFLAGS@ +ZLIB_DEPEND = @ZLIB_DEPEND@ +ZLIB_INCLUDES = @ZLIB_INCLUDES@ +ZLIB_LIBS = @ZLIB_LIBS@ +abs_builddir = @abs_builddir@ +abs_srcdir = @abs_srcdir@ +abs_top_builddir = @abs_top_builddir@ +abs_top_srcdir = @abs_top_srcdir@ +ac_ct_AR = @ac_ct_AR@ +ac_ct_CC = @ac_ct_CC@ +ac_ct_DUMPBIN = @ac_ct_DUMPBIN@ +am__include = @am__include@ +am__leading_dot = @am__leading_dot@ +am__quote = @am__quote@ +am__tar = @am__tar@ +am__untar = @am__untar@ +bindir = @bindir@ +build = @build@ +build_alias = @build_alias@ +build_cpu = @build_cpu@ +build_os = @build_os@ +build_vendor = @build_vendor@ +builddir = @builddir@ +datadir = @datadir@ +datarootdir = @datarootdir@ +docdir = @docdir@ +dvidir = @dvidir@ +exec_prefix = @exec_prefix@ +host = @host@ +host_alias = @host_alias@ +host_cpu = @host_cpu@ +host_os = @host_os@ +host_vendor = @host_vendor@ +htmldir = @htmldir@ +includedir = @includedir@ +infodir = @infodir@ +install_sh = @install_sh@ +libdir = @libdir@ +libexecdir = @libexecdir@ +localedir = @localedir@ +localstatedir = @localstatedir@ +mandir = @mandir@ +mkdir_p = @mkdir_p@ +oldincludedir = @oldincludedir@ +pdfdir = @pdfdir@ +prefix = @prefix@ +program_transform_name = @program_transform_name@ +psdir = @psdir@ +sbindir = @sbindir@ +sharedstatedir = @sharedstatedir@ +srcdir = @srcdir@ +sysconfdir = @sysconfdir@ +target_alias = @target_alias@ +top_build_prefix = @top_build_prefix@ +top_builddir = @top_builddir@ +top_srcdir = @top_srcdir@ + +# Adapted for TeX Live from dvipng-src/Makefile.in +# Copyright (C) 2002-2008 Jan-Åke Larsson +# +EXTRA_DIST = $(DVIPNG_TREE) TLpatches dvipng.test dvipng-test.dvi +NEVER_DIST = `find . $(NEVER_NAMES)` + +# Files not to be distributed +NEVER_NAMES = -name .svn $(NEVER_NAMES_SUB) +NEVER_NAMES_SUB = -o -name .deps -o -name .dirstamp -o -name '*.$(OBJEXT)' +NEVER_NAMES_LT = -o -name .libs -o -name '*.lo' +AM_CPPFLAGS = -DTEXLIVE -I$(top_srcdir)/$(DVIPNG_TREE) \ + $(KPATHSEA_INCLUDES) $(FREETYPE2_INCLUDES) $(GD_INCLUDES) \ + $(LIBPNG_INCLUDES) $(ZLIB_INCLUDES) +AM_CFLAGS = $(WARNING_CFLAGS) + +# In order that `make distcheck' succeeds, we must not attempt to rebuild +# dvipng.info if dvipng.help has not changed, Thus we delegate rebuilding +# dvipng.help and dvipng.info, if necessary, to subdirectories. +SUBDIRS = . help doc +nodist_dvipng_SOURCES = @DVIPNG_TREE@/color.c @DVIPNG_TREE@/draw.c \ + @DVIPNG_TREE@/dvi.c @DVIPNG_TREE@/dvipng.c \ + @DVIPNG_TREE@/font.c @DVIPNG_TREE@/misc.c \ + @DVIPNG_TREE@/papersiz.c @DVIPNG_TREE@/pk.c \ + @DVIPNG_TREE@/ppagelist.c @DVIPNG_TREE@/set.c \ + @DVIPNG_TREE@/special.c @DVIPNG_TREE@/vf.c $(am__append_1) +dvipng_dependencies = $(KPATHSEA_DEPEND) $(GD_DEPEND) $(FREETYPE2_DEPEND) $(LIBPNG_DEPEND) +DISTCLEANFILES = config.force +LDADD = $(KPATHSEA_LIBS) $(GD_LIBS) $(FREETYPE2_LIBS) $(LIBPNG_LIBS) \ + $(ZLIB_LIBS) +dvigif_CPPFLAGS = -DEXEPROG=\"dvipng.exe\" +nodist_dvigif_SOURCES = callexe.c +dvigif_LDADD = +bin_links = dvipng$(EXEEXT):dvigif +TESTS = dvipng.test +CLEANFILES = dvipng-test*.gif dvipng-test*.png +all: config.h + $(MAKE) $(AM_MAKEFLAGS) all-recursive + +.SUFFIXES: +.SUFFIXES: .c .lo .log .o .obj .test .test$(EXEEXT) .trs +am--refresh: Makefile + @: +$(srcdir)/Makefile.in: @MAINTAINER_MODE_TRUE@ $(srcdir)/Makefile.am $(srcdir)/../../am/dist_hook.am $(srcdir)/../../am/bin_links.am $(am__configure_deps) + @for dep in $?; do \ + case '$(am__configure_deps)' in \ + *$$dep*) \ + echo ' cd $(srcdir) && $(AUTOMAKE) --foreign'; \ + $(am__cd) $(srcdir) && $(AUTOMAKE) --foreign \ + && exit 0; \ + exit 1;; \ + esac; \ + done; \ + echo ' cd $(top_srcdir) && $(AUTOMAKE) --foreign Makefile'; \ + $(am__cd) $(top_srcdir) && \ + $(AUTOMAKE) --foreign Makefile +Makefile: $(srcdir)/Makefile.in $(top_builddir)/config.status + @case '$?' in \ + *config.status*) \ + echo ' $(SHELL) ./config.status'; \ + $(SHELL) ./config.status;; \ + *) \ + echo ' cd $(top_builddir) && $(SHELL) ./config.status $@ $(am__maybe_remake_depfiles)'; \ + cd $(top_builddir) && $(SHELL) ./config.status $@ $(am__maybe_remake_depfiles);; \ + esac; +$(srcdir)/../../am/dist_hook.am $(srcdir)/../../am/bin_links.am $(am__empty): + +$(top_builddir)/config.status: $(top_srcdir)/configure $(CONFIG_STATUS_DEPENDENCIES) + $(SHELL) ./config.status --recheck + +$(top_srcdir)/configure: @MAINTAINER_MODE_TRUE@ $(am__configure_deps) + $(am__cd) $(srcdir) && $(AUTOCONF) +$(ACLOCAL_M4): @MAINTAINER_MODE_TRUE@ $(am__aclocal_m4_deps) + $(am__cd) $(srcdir) && $(ACLOCAL) $(ACLOCAL_AMFLAGS) +$(am__aclocal_m4_deps): + +config.h: stamp-h1 + @test -f $@ || rm -f stamp-h1 + @test -f $@ || $(MAKE) $(AM_MAKEFLAGS) stamp-h1 + +stamp-h1: $(srcdir)/config.h.in $(top_builddir)/config.status + @rm -f stamp-h1 + cd $(top_builddir) && $(SHELL) ./config.status config.h +$(srcdir)/config.h.in: @MAINTAINER_MODE_TRUE@ $(am__configure_deps) + ($(am__cd) $(top_srcdir) && $(AUTOHEADER)) + rm -f stamp-h1 + touch $@ + +distclean-hdr: + -rm -f config.h stamp-h1 +install-binPROGRAMS: $(bin_PROGRAMS) + @$(NORMAL_INSTALL) + @list='$(bin_PROGRAMS)'; test -n "$(bindir)" || list=; \ + if test -n "$$list"; then \ + echo " $(MKDIR_P) '$(DESTDIR)$(bindir)'"; \ + $(MKDIR_P) "$(DESTDIR)$(bindir)" || exit 1; \ + fi; \ + for p in $$list; do echo "$$p $$p"; done | \ + sed 's/$(EXEEXT)$$//' | \ + while read p p1; do if test -f $$p \ + || test -f $$p1 \ + ; then echo "$$p"; echo "$$p"; else :; fi; \ + done | \ + sed -e 'p;s,.*/,,;n;h' \ + -e 's|.*|.|' \ + -e 'p;x;s,.*/,,;s/$(EXEEXT)$$//;$(transform);s/$$/$(EXEEXT)/' | \ + sed 'N;N;N;s,\n, ,g' | \ + $(AWK) 'BEGIN { files["."] = ""; dirs["."] = 1 } \ + { d=$$3; if (dirs[d] != 1) { print "d", d; dirs[d] = 1 } \ + if ($$2 == $$4) files[d] = files[d] " " $$1; \ + else { print "f", $$3 "/" $$4, $$1; } } \ + END { for (d in files) print "f", d, files[d] }' | \ + while read type dir files; do \ + if test "$$dir" = .; then dir=; else dir=/$$dir; fi; \ + test -z "$$files" || { \ + echo " $(INSTALL_PROGRAM_ENV) $(LIBTOOL) $(AM_LIBTOOLFLAGS) $(LIBTOOLFLAGS) --mode=install $(INSTALL_PROGRAM) $$files '$(DESTDIR)$(bindir)$$dir'"; \ + $(INSTALL_PROGRAM_ENV) $(LIBTOOL) $(AM_LIBTOOLFLAGS) $(LIBTOOLFLAGS) --mode=install $(INSTALL_PROGRAM) $$files "$(DESTDIR)$(bindir)$$dir" || exit $$?; \ + } \ + ; done + +uninstall-binPROGRAMS: + @$(NORMAL_UNINSTALL) + @list='$(bin_PROGRAMS)'; test -n "$(bindir)" || list=; \ + files=`for p in $$list; do echo "$$p"; done | \ + sed -e 'h;s,^.*/,,;s/$(EXEEXT)$$//;$(transform)' \ + -e 's/$$/$(EXEEXT)/' \ + `; \ + test -n "$$list" || exit 0; \ + echo " ( cd '$(DESTDIR)$(bindir)' && rm -f" $$files ")"; \ + cd "$(DESTDIR)$(bindir)" && rm -f $$files + +clean-binPROGRAMS: + @list='$(bin_PROGRAMS)'; test -n "$$list" || exit 0; \ + echo " rm -f" $$list; \ + rm -f $$list || exit $$?; \ + test -n "$(EXEEXT)" || exit 0; \ + list=`for p in $$list; do echo "$$p"; done | sed 's/$(EXEEXT)$$//'`; \ + echo " rm -f" $$list; \ + rm -f $$list + +dvigif$(EXEEXT): $(dvigif_OBJECTS) $(dvigif_DEPENDENCIES) $(EXTRA_dvigif_DEPENDENCIES) + @rm -f dvigif$(EXEEXT) + $(AM_V_CCLD)$(LINK) $(dvigif_OBJECTS) $(dvigif_LDADD) $(LIBS) +@DVIPNG_TREE@/$(am__dirstamp): + @$(MKDIR_P) @DVIPNG_TREE@ + @: > @DVIPNG_TREE@/$(am__dirstamp) +@DVIPNG_TREE@/$(DEPDIR)/$(am__dirstamp): + @$(MKDIR_P) @DVIPNG_TREE@/$(DEPDIR) + @: > @DVIPNG_TREE@/$(DEPDIR)/$(am__dirstamp) +@DVIPNG_TREE@/color.$(OBJEXT): @DVIPNG_TREE@/$(am__dirstamp) \ + @DVIPNG_TREE@/$(DEPDIR)/$(am__dirstamp) +@DVIPNG_TREE@/draw.$(OBJEXT): @DVIPNG_TREE@/$(am__dirstamp) \ + @DVIPNG_TREE@/$(DEPDIR)/$(am__dirstamp) +@DVIPNG_TREE@/dvi.$(OBJEXT): @DVIPNG_TREE@/$(am__dirstamp) \ + @DVIPNG_TREE@/$(DEPDIR)/$(am__dirstamp) +@DVIPNG_TREE@/dvipng.$(OBJEXT): @DVIPNG_TREE@/$(am__dirstamp) \ + @DVIPNG_TREE@/$(DEPDIR)/$(am__dirstamp) +@DVIPNG_TREE@/font.$(OBJEXT): @DVIPNG_TREE@/$(am__dirstamp) \ + @DVIPNG_TREE@/$(DEPDIR)/$(am__dirstamp) +@DVIPNG_TREE@/misc.$(OBJEXT): @DVIPNG_TREE@/$(am__dirstamp) \ + @DVIPNG_TREE@/$(DEPDIR)/$(am__dirstamp) +@DVIPNG_TREE@/papersiz.$(OBJEXT): @DVIPNG_TREE@/$(am__dirstamp) \ + @DVIPNG_TREE@/$(DEPDIR)/$(am__dirstamp) +@DVIPNG_TREE@/pk.$(OBJEXT): @DVIPNG_TREE@/$(am__dirstamp) \ + @DVIPNG_TREE@/$(DEPDIR)/$(am__dirstamp) +@DVIPNG_TREE@/ppagelist.$(OBJEXT): @DVIPNG_TREE@/$(am__dirstamp) \ + @DVIPNG_TREE@/$(DEPDIR)/$(am__dirstamp) +@DVIPNG_TREE@/set.$(OBJEXT): @DVIPNG_TREE@/$(am__dirstamp) \ + @DVIPNG_TREE@/$(DEPDIR)/$(am__dirstamp) +@DVIPNG_TREE@/special.$(OBJEXT): @DVIPNG_TREE@/$(am__dirstamp) \ + @DVIPNG_TREE@/$(DEPDIR)/$(am__dirstamp) +@DVIPNG_TREE@/vf.$(OBJEXT): @DVIPNG_TREE@/$(am__dirstamp) \ + @DVIPNG_TREE@/$(DEPDIR)/$(am__dirstamp) +@DVIPNG_TREE@/enc.$(OBJEXT): @DVIPNG_TREE@/$(am__dirstamp) \ + @DVIPNG_TREE@/$(DEPDIR)/$(am__dirstamp) +@DVIPNG_TREE@/fontmap.$(OBJEXT): @DVIPNG_TREE@/$(am__dirstamp) \ + @DVIPNG_TREE@/$(DEPDIR)/$(am__dirstamp) +@DVIPNG_TREE@/ft.$(OBJEXT): @DVIPNG_TREE@/$(am__dirstamp) \ + @DVIPNG_TREE@/$(DEPDIR)/$(am__dirstamp) +@DVIPNG_TREE@/sfd.$(OBJEXT): @DVIPNG_TREE@/$(am__dirstamp) \ + @DVIPNG_TREE@/$(DEPDIR)/$(am__dirstamp) +@DVIPNG_TREE@/tfm.$(OBJEXT): @DVIPNG_TREE@/$(am__dirstamp) \ + @DVIPNG_TREE@/$(DEPDIR)/$(am__dirstamp) + +dvipng$(EXEEXT): $(dvipng_OBJECTS) $(dvipng_DEPENDENCIES) $(EXTRA_dvipng_DEPENDENCIES) + @rm -f dvipng$(EXEEXT) + $(AM_V_CCLD)$(LINK) $(dvipng_OBJECTS) $(dvipng_LDADD) $(LIBS) + +mostlyclean-compile: + -rm -f *.$(OBJEXT) + -rm -f @DVIPNG_TREE@/*.$(OBJEXT) + +distclean-compile: + -rm -f *.tab.c + +@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/dvigif-callexe.Po@am__quote@ # am--include-marker +@AMDEP_TRUE@@am__include@ @am__quote@@DVIPNG_TREE@/$(DEPDIR)/color.Po@am__quote@ # am--include-marker +@AMDEP_TRUE@@am__include@ @am__quote@@DVIPNG_TREE@/$(DEPDIR)/draw.Po@am__quote@ # am--include-marker +@AMDEP_TRUE@@am__include@ @am__quote@@DVIPNG_TREE@/$(DEPDIR)/dvi.Po@am__quote@ # am--include-marker +@AMDEP_TRUE@@am__include@ @am__quote@@DVIPNG_TREE@/$(DEPDIR)/dvipng.Po@am__quote@ # am--include-marker +@AMDEP_TRUE@@am__include@ @am__quote@@DVIPNG_TREE@/$(DEPDIR)/enc.Po@am__quote@ # am--include-marker +@AMDEP_TRUE@@am__include@ @am__quote@@DVIPNG_TREE@/$(DEPDIR)/font.Po@am__quote@ # am--include-marker +@AMDEP_TRUE@@am__include@ @am__quote@@DVIPNG_TREE@/$(DEPDIR)/fontmap.Po@am__quote@ # am--include-marker +@AMDEP_TRUE@@am__include@ @am__quote@@DVIPNG_TREE@/$(DEPDIR)/ft.Po@am__quote@ # am--include-marker +@AMDEP_TRUE@@am__include@ @am__quote@@DVIPNG_TREE@/$(DEPDIR)/misc.Po@am__quote@ # am--include-marker +@AMDEP_TRUE@@am__include@ @am__quote@@DVIPNG_TREE@/$(DEPDIR)/papersiz.Po@am__quote@ # am--include-marker +@AMDEP_TRUE@@am__include@ @am__quote@@DVIPNG_TREE@/$(DEPDIR)/pk.Po@am__quote@ # am--include-marker +@AMDEP_TRUE@@am__include@ @am__quote@@DVIPNG_TREE@/$(DEPDIR)/ppagelist.Po@am__quote@ # am--include-marker +@AMDEP_TRUE@@am__include@ @am__quote@@DVIPNG_TREE@/$(DEPDIR)/set.Po@am__quote@ # am--include-marker +@AMDEP_TRUE@@am__include@ @am__quote@@DVIPNG_TREE@/$(DEPDIR)/sfd.Po@am__quote@ # am--include-marker +@AMDEP_TRUE@@am__include@ @am__quote@@DVIPNG_TREE@/$(DEPDIR)/special.Po@am__quote@ # am--include-marker +@AMDEP_TRUE@@am__include@ @am__quote@@DVIPNG_TREE@/$(DEPDIR)/tfm.Po@am__quote@ # am--include-marker +@AMDEP_TRUE@@am__include@ @am__quote@@DVIPNG_TREE@/$(DEPDIR)/vf.Po@am__quote@ # am--include-marker + +$(am__depfiles_remade): + @$(MKDIR_P) $(@D) + @echo '# dummy' >$@-t && $(am__mv) $@-t $@ + +am--depfiles: $(am__depfiles_remade) + +.c.o: +@am__fastdepCC_TRUE@ $(AM_V_CC)depbase=`echo $@ | sed 's|[^/]*$$|$(DEPDIR)/&|;s|\.o$$||'`;\ +@am__fastdepCC_TRUE@ $(COMPILE) -MT $@ -MD -MP -MF $$depbase.Tpo -c -o $@ $< &&\ +@am__fastdepCC_TRUE@ $(am__mv) $$depbase.Tpo $$depbase.Po +@AMDEP_TRUE@@am__fastdepCC_FALSE@ $(AM_V_CC)source='$<' object='$@' libtool=no @AMDEPBACKSLASH@ +@AMDEP_TRUE@@am__fastdepCC_FALSE@ DEPDIR=$(DEPDIR) $(CCDEPMODE) $(depcomp) @AMDEPBACKSLASH@ +@am__fastdepCC_FALSE@ $(AM_V_CC@am__nodep@)$(COMPILE) -c -o $@ $< + +.c.obj: +@am__fastdepCC_TRUE@ $(AM_V_CC)depbase=`echo $@ | sed 's|[^/]*$$|$(DEPDIR)/&|;s|\.obj$$||'`;\ +@am__fastdepCC_TRUE@ $(COMPILE) -MT $@ -MD -MP -MF $$depbase.Tpo -c -o $@ `$(CYGPATH_W) '$<'` &&\ +@am__fastdepCC_TRUE@ $(am__mv) $$depbase.Tpo $$depbase.Po +@AMDEP_TRUE@@am__fastdepCC_FALSE@ $(AM_V_CC)source='$<' object='$@' libtool=no @AMDEPBACKSLASH@ +@AMDEP_TRUE@@am__fastdepCC_FALSE@ DEPDIR=$(DEPDIR) $(CCDEPMODE) $(depcomp) @AMDEPBACKSLASH@ +@am__fastdepCC_FALSE@ $(AM_V_CC@am__nodep@)$(COMPILE) -c -o $@ `$(CYGPATH_W) '$<'` + +.c.lo: +@am__fastdepCC_TRUE@ $(AM_V_CC)depbase=`echo $@ | sed 's|[^/]*$$|$(DEPDIR)/&|;s|\.lo$$||'`;\ +@am__fastdepCC_TRUE@ $(LTCOMPILE) -MT $@ -MD -MP -MF $$depbase.Tpo -c -o $@ $< &&\ +@am__fastdepCC_TRUE@ $(am__mv) $$depbase.Tpo $$depbase.Plo +@AMDEP_TRUE@@am__fastdepCC_FALSE@ $(AM_V_CC)source='$<' object='$@' libtool=yes @AMDEPBACKSLASH@ +@AMDEP_TRUE@@am__fastdepCC_FALSE@ DEPDIR=$(DEPDIR) $(CCDEPMODE) $(depcomp) @AMDEPBACKSLASH@ +@am__fastdepCC_FALSE@ $(AM_V_CC@am__nodep@)$(LTCOMPILE) -c -o $@ $< + +dvigif-callexe.o: callexe.c +@am__fastdepCC_TRUE@ $(AM_V_CC)$(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(dvigif_CPPFLAGS) $(CPPFLAGS) $(AM_CFLAGS) $(CFLAGS) -MT dvigif-callexe.o -MD -MP -MF $(DEPDIR)/dvigif-callexe.Tpo -c -o dvigif-callexe.o `test -f 'callexe.c' || echo '$(srcdir)/'`callexe.c +@am__fastdepCC_TRUE@ $(AM_V_at)$(am__mv) $(DEPDIR)/dvigif-callexe.Tpo $(DEPDIR)/dvigif-callexe.Po +@AMDEP_TRUE@@am__fastdepCC_FALSE@ $(AM_V_CC)source='callexe.c' object='dvigif-callexe.o' libtool=no @AMDEPBACKSLASH@ +@AMDEP_TRUE@@am__fastdepCC_FALSE@ DEPDIR=$(DEPDIR) $(CCDEPMODE) $(depcomp) @AMDEPBACKSLASH@ +@am__fastdepCC_FALSE@ $(AM_V_CC@am__nodep@)$(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(dvigif_CPPFLAGS) $(CPPFLAGS) $(AM_CFLAGS) $(CFLAGS) -c -o dvigif-callexe.o `test -f 'callexe.c' || echo '$(srcdir)/'`callexe.c + +dvigif-callexe.obj: callexe.c +@am__fastdepCC_TRUE@ $(AM_V_CC)$(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(dvigif_CPPFLAGS) $(CPPFLAGS) $(AM_CFLAGS) $(CFLAGS) -MT dvigif-callexe.obj -MD -MP -MF $(DEPDIR)/dvigif-callexe.Tpo -c -o dvigif-callexe.obj `if test -f 'callexe.c'; then $(CYGPATH_W) 'callexe.c'; else $(CYGPATH_W) '$(srcdir)/callexe.c'; fi` +@am__fastdepCC_TRUE@ $(AM_V_at)$(am__mv) $(DEPDIR)/dvigif-callexe.Tpo $(DEPDIR)/dvigif-callexe.Po +@AMDEP_TRUE@@am__fastdepCC_FALSE@ $(AM_V_CC)source='callexe.c' object='dvigif-callexe.obj' libtool=no @AMDEPBACKSLASH@ +@AMDEP_TRUE@@am__fastdepCC_FALSE@ DEPDIR=$(DEPDIR) $(CCDEPMODE) $(depcomp) @AMDEPBACKSLASH@ +@am__fastdepCC_FALSE@ $(AM_V_CC@am__nodep@)$(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(dvigif_CPPFLAGS) $(CPPFLAGS) $(AM_CFLAGS) $(CFLAGS) -c -o dvigif-callexe.obj `if test -f 'callexe.c'; then $(CYGPATH_W) 'callexe.c'; else $(CYGPATH_W) '$(srcdir)/callexe.c'; fi` + +mostlyclean-libtool: + -rm -f *.lo + +clean-libtool: + -rm -rf .libs _libs + +distclean-libtool: + -rm -f libtool config.lt + +# This directory's subdirectories are mostly independent; you can cd +# into them and run 'make' without going through this Makefile. +# To change the values of 'make' variables: instead of editing Makefiles, +# (1) if the variable is set in 'config.status', edit 'config.status' +# (which will cause the Makefiles to be regenerated when you run 'make'); +# (2) otherwise, pass the desired values on the 'make' command line. +$(am__recursive_targets): + @fail=; \ + if $(am__make_keepgoing); then \ + failcom='fail=yes'; \ + else \ + failcom='exit 1'; \ + fi; \ + dot_seen=no; \ + target=`echo $@ | sed s/-recursive//`; \ + case "$@" in \ + distclean-* | maintainer-clean-*) list='$(DIST_SUBDIRS)' ;; \ + *) list='$(SUBDIRS)' ;; \ + esac; \ + for subdir in $$list; do \ + echo "Making $$target in $$subdir"; \ + if test "$$subdir" = "."; then \ + dot_seen=yes; \ + local_target="$$target-am"; \ + else \ + local_target="$$target"; \ + fi; \ + ($(am__cd) $$subdir && $(MAKE) $(AM_MAKEFLAGS) $$local_target) \ + || eval $$failcom; \ + done; \ + if test "$$dot_seen" = "no"; then \ + $(MAKE) $(AM_MAKEFLAGS) "$$target-am" || exit 1; \ + fi; test -z "$$fail" + +ID: $(am__tagged_files) + $(am__define_uniq_tagged_files); mkid -fID $$unique +tags: tags-recursive +TAGS: tags + +tags-am: $(TAGS_DEPENDENCIES) $(am__tagged_files) + set x; \ + here=`pwd`; \ + if ($(ETAGS) --etags-include --version) >/dev/null 2>&1; then \ + include_option=--etags-include; \ + empty_fix=.; \ + else \ + include_option=--include; \ + empty_fix=; \ + fi; \ + list='$(SUBDIRS)'; for subdir in $$list; do \ + if test "$$subdir" = .; then :; else \ + test ! -f $$subdir/TAGS || \ + set "$$@" "$$include_option=$$here/$$subdir/TAGS"; \ + fi; \ + done; \ + $(am__define_uniq_tagged_files); \ + shift; \ + if test -z "$(ETAGS_ARGS)$$*$$unique"; then :; else \ + test -n "$$unique" || unique=$$empty_fix; \ + if test $$# -gt 0; then \ + $(ETAGS) $(ETAGSFLAGS) $(AM_ETAGSFLAGS) $(ETAGS_ARGS) \ + "$$@" $$unique; \ + else \ + $(ETAGS) $(ETAGSFLAGS) $(AM_ETAGSFLAGS) $(ETAGS_ARGS) \ + $$unique; \ + fi; \ + fi +ctags: ctags-recursive + +CTAGS: ctags +ctags-am: $(TAGS_DEPENDENCIES) $(am__tagged_files) + $(am__define_uniq_tagged_files); \ + test -z "$(CTAGS_ARGS)$$unique" \ + || $(CTAGS) $(CTAGSFLAGS) $(AM_CTAGSFLAGS) $(CTAGS_ARGS) \ + $$unique + +GTAGS: + here=`$(am__cd) $(top_builddir) && pwd` \ + && $(am__cd) $(top_srcdir) \ + && gtags -i $(GTAGS_ARGS) "$$here" +cscope: cscope.files + test ! -s cscope.files \ + || $(CSCOPE) -b -q $(AM_CSCOPEFLAGS) $(CSCOPEFLAGS) -i cscope.files $(CSCOPE_ARGS) +clean-cscope: + -rm -f cscope.files +cscope.files: clean-cscope cscopelist +cscopelist: cscopelist-recursive + +cscopelist-am: $(am__tagged_files) + list='$(am__tagged_files)'; \ + case "$(srcdir)" in \ + [\\/]* | ?:[\\/]*) sdir="$(srcdir)" ;; \ + *) sdir=$(subdir)/$(srcdir) ;; \ + esac; \ + for i in $$list; do \ + if test -f "$$i"; then \ + echo "$(subdir)/$$i"; \ + else \ + echo "$$sdir/$$i"; \ + fi; \ + done >> $(top_builddir)/cscope.files + +distclean-tags: + -rm -f TAGS ID GTAGS GRTAGS GSYMS GPATH tags + -rm -f cscope.out cscope.in.out cscope.po.out cscope.files + +# Recover from deleted '.trs' file; this should ensure that +# "rm -f foo.log; make foo.trs" re-run 'foo.test', and re-create +# both 'foo.log' and 'foo.trs'. Break the recipe in two subshells +# to avoid problems with "make -n". +.log.trs: + rm -f $< $@ + $(MAKE) $(AM_MAKEFLAGS) $< + +# Leading 'am--fnord' is there to ensure the list of targets does not +# expand to empty, as could happen e.g. with make check TESTS=''. +am--fnord $(TEST_LOGS) $(TEST_LOGS:.log=.trs): $(am__force_recheck) +am--force-recheck: + @: + +$(TEST_SUITE_LOG): $(TEST_LOGS) + @$(am__set_TESTS_bases); \ + am__f_ok () { test -f "$$1" && test -r "$$1"; }; \ + redo_bases=`for i in $$bases; do \ + am__f_ok $$i.trs && am__f_ok $$i.log || echo $$i; \ + done`; \ + if test -n "$$redo_bases"; then \ + redo_logs=`for i in $$redo_bases; do echo $$i.log; done`; \ + redo_results=`for i in $$redo_bases; do echo $$i.trs; done`; \ + if $(am__make_dryrun); then :; else \ + rm -f $$redo_logs && rm -f $$redo_results || exit 1; \ + fi; \ + fi; \ + if test -n "$$am__remaking_logs"; then \ + echo "fatal: making $(TEST_SUITE_LOG): possible infinite" \ + "recursion detected" >&2; \ + elif test -n "$$redo_logs"; then \ + am__remaking_logs=yes $(MAKE) $(AM_MAKEFLAGS) $$redo_logs; \ + fi; \ + if $(am__make_dryrun); then :; else \ + st=0; \ + errmsg="fatal: making $(TEST_SUITE_LOG): failed to create"; \ + for i in $$redo_bases; do \ + test -f $$i.trs && test -r $$i.trs \ + || { echo "$$errmsg $$i.trs" >&2; st=1; }; \ + test -f $$i.log && test -r $$i.log \ + || { echo "$$errmsg $$i.log" >&2; st=1; }; \ + done; \ + test $$st -eq 0 || exit 1; \ + fi + @$(am__sh_e_setup); $(am__tty_colors); $(am__set_TESTS_bases); \ + ws='[ ]'; \ + results=`for b in $$bases; do echo $$b.trs; done`; \ + test -n "$$results" || results=/dev/null; \ + all=` grep "^$$ws*:test-result:" $$results | wc -l`; \ + pass=` grep "^$$ws*:test-result:$$ws*PASS" $$results | wc -l`; \ + fail=` grep "^$$ws*:test-result:$$ws*FAIL" $$results | wc -l`; \ + skip=` grep "^$$ws*:test-result:$$ws*SKIP" $$results | wc -l`; \ + xfail=`grep "^$$ws*:test-result:$$ws*XFAIL" $$results | wc -l`; \ + xpass=`grep "^$$ws*:test-result:$$ws*XPASS" $$results | wc -l`; \ + error=`grep "^$$ws*:test-result:$$ws*ERROR" $$results | wc -l`; \ + if test `expr $$fail + $$xpass + $$error` -eq 0; then \ + success=true; \ + else \ + success=false; \ + fi; \ + br='==================='; br=$$br$$br$$br$$br; \ + result_count () \ + { \ + if test x"$$1" = x"--maybe-color"; then \ + maybe_colorize=yes; \ + elif test x"$$1" = x"--no-color"; then \ + maybe_colorize=no; \ + else \ + echo "$@: invalid 'result_count' usage" >&2; exit 4; \ + fi; \ + shift; \ + desc=$$1 count=$$2; \ + if test $$maybe_colorize = yes && test $$count -gt 0; then \ + color_start=$$3 color_end=$$std; \ + else \ + color_start= color_end=; \ + fi; \ + echo "$${color_start}# $$desc $$count$${color_end}"; \ + }; \ + create_testsuite_report () \ + { \ + result_count $$1 "TOTAL:" $$all "$$brg"; \ + result_count $$1 "PASS: " $$pass "$$grn"; \ + result_count $$1 "SKIP: " $$skip "$$blu"; \ + result_count $$1 "XFAIL:" $$xfail "$$lgn"; \ + result_count $$1 "FAIL: " $$fail "$$red"; \ + result_count $$1 "XPASS:" $$xpass "$$red"; \ + result_count $$1 "ERROR:" $$error "$$mgn"; \ + }; \ + { \ + echo "$(PACKAGE_STRING): $(subdir)/$(TEST_SUITE_LOG)" | \ + $(am__rst_title); \ + create_testsuite_report --no-color; \ + echo; \ + echo ".. contents:: :depth: 2"; \ + echo; \ + for b in $$bases; do echo $$b; done \ + | $(am__create_global_log); \ + } >$(TEST_SUITE_LOG).tmp || exit 1; \ + mv $(TEST_SUITE_LOG).tmp $(TEST_SUITE_LOG); \ + if $$success; then \ + col="$$grn"; \ + else \ + col="$$red"; \ + test x"$$VERBOSE" = x || cat $(TEST_SUITE_LOG); \ + fi; \ + echo "$${col}$$br$${std}"; \ + echo "$${col}Testsuite summary"$(AM_TESTSUITE_SUMMARY_HEADER)"$${std}"; \ + echo "$${col}$$br$${std}"; \ + create_testsuite_report --maybe-color; \ + echo "$$col$$br$$std"; \ + if $$success; then :; else \ + echo "$${col}See $(subdir)/$(TEST_SUITE_LOG)$${std}"; \ + if test -n "$(PACKAGE_BUGREPORT)"; then \ + echo "$${col}Please report to $(PACKAGE_BUGREPORT)$${std}"; \ + fi; \ + echo "$$col$$br$$std"; \ + fi; \ + $$success || exit 1 + +check-TESTS: + @list='$(RECHECK_LOGS)'; test -z "$$list" || rm -f $$list + @list='$(RECHECK_LOGS:.log=.trs)'; test -z "$$list" || rm -f $$list + @test -z "$(TEST_SUITE_LOG)" || rm -f $(TEST_SUITE_LOG) + @set +e; $(am__set_TESTS_bases); \ + log_list=`for i in $$bases; do echo $$i.log; done`; \ + trs_list=`for i in $$bases; do echo $$i.trs; done`; \ + log_list=`echo $$log_list`; trs_list=`echo $$trs_list`; \ + $(MAKE) $(AM_MAKEFLAGS) $(TEST_SUITE_LOG) TEST_LOGS="$$log_list"; \ + exit $$?; +recheck: all + @test -z "$(TEST_SUITE_LOG)" || rm -f $(TEST_SUITE_LOG) + @set +e; $(am__set_TESTS_bases); \ + bases=`for i in $$bases; do echo $$i; done \ + | $(am__list_recheck_tests)` || exit 1; \ + log_list=`for i in $$bases; do echo $$i.log; done`; \ + log_list=`echo $$log_list`; \ + $(MAKE) $(AM_MAKEFLAGS) $(TEST_SUITE_LOG) \ + am__force_recheck=am--force-recheck \ + TEST_LOGS="$$log_list"; \ + exit $$? +.test.log: + @p='$<'; \ + $(am__set_b); \ + $(am__check_pre) $(TEST_LOG_DRIVER) --test-name "$$f" \ + --log-file $$b.log --trs-file $$b.trs \ + $(am__common_driver_flags) $(AM_TEST_LOG_DRIVER_FLAGS) $(TEST_LOG_DRIVER_FLAGS) -- $(TEST_LOG_COMPILE) \ + "$$tst" $(AM_TESTS_FD_REDIRECT) +@am__EXEEXT_TRUE@.test$(EXEEXT).log: +@am__EXEEXT_TRUE@ @p='$<'; \ +@am__EXEEXT_TRUE@ $(am__set_b); \ +@am__EXEEXT_TRUE@ $(am__check_pre) $(TEST_LOG_DRIVER) --test-name "$$f" \ +@am__EXEEXT_TRUE@ --log-file $$b.log --trs-file $$b.trs \ +@am__EXEEXT_TRUE@ $(am__common_driver_flags) $(AM_TEST_LOG_DRIVER_FLAGS) $(TEST_LOG_DRIVER_FLAGS) -- $(TEST_LOG_COMPILE) \ +@am__EXEEXT_TRUE@ "$$tst" $(AM_TESTS_FD_REDIRECT) + +distdir: $(BUILT_SOURCES) + $(MAKE) $(AM_MAKEFLAGS) distdir-am + +distdir-am: $(DISTFILES) + $(am__remove_distdir) + test -d "$(distdir)" || mkdir "$(distdir)" + @srcdirstrip=`echo "$(srcdir)" | sed 's/[].[^$$\\*]/\\\\&/g'`; \ + topsrcdirstrip=`echo "$(top_srcdir)" | sed 's/[].[^$$\\*]/\\\\&/g'`; \ + list='$(DISTFILES)'; \ + dist_files=`for file in $$list; do echo $$file; done | \ + sed -e "s|^$$srcdirstrip/||;t" \ + -e "s|^$$topsrcdirstrip/|$(top_builddir)/|;t"`; \ + case $$dist_files in \ + */*) $(MKDIR_P) `echo "$$dist_files" | \ + sed '/\//!d;s|^|$(distdir)/|;s,/[^/]*$$,,' | \ + sort -u` ;; \ + esac; \ + for file in $$dist_files; do \ + if test -f $$file || test -d $$file; then d=.; else d=$(srcdir); fi; \ + if test -d $$d/$$file; then \ + dir=`echo "/$$file" | sed -e 's,/[^/]*$$,,'`; \ + if test -d "$(distdir)/$$file"; then \ + find "$(distdir)/$$file" -type d ! -perm -700 -exec chmod u+rwx {} \;; \ + fi; \ + if test -d $(srcdir)/$$file && test $$d != $(srcdir); then \ + cp -fpR $(srcdir)/$$file "$(distdir)$$dir" || exit 1; \ + find "$(distdir)/$$file" -type d ! -perm -700 -exec chmod u+rwx {} \;; \ + fi; \ + cp -fpR $$d/$$file "$(distdir)$$dir" || exit 1; \ + else \ + test -f "$(distdir)/$$file" \ + || cp -p $$d/$$file "$(distdir)/$$file" \ + || exit 1; \ + fi; \ + done + @list='$(DIST_SUBDIRS)'; for subdir in $$list; do \ + if test "$$subdir" = .; then :; else \ + $(am__make_dryrun) \ + || test -d "$(distdir)/$$subdir" \ + || $(MKDIR_P) "$(distdir)/$$subdir" \ + || exit 1; \ + dir1=$$subdir; dir2="$(distdir)/$$subdir"; \ + $(am__relativize); \ + new_distdir=$$reldir; \ + dir1=$$subdir; dir2="$(top_distdir)"; \ + $(am__relativize); \ + new_top_distdir=$$reldir; \ + echo " (cd $$subdir && $(MAKE) $(AM_MAKEFLAGS) top_distdir="$$new_top_distdir" distdir="$$new_distdir" \\"; \ + echo " am__remove_distdir=: am__skip_length_check=: am__skip_mode_fix=: distdir)"; \ + ($(am__cd) $$subdir && \ + $(MAKE) $(AM_MAKEFLAGS) \ + top_distdir="$$new_top_distdir" \ + distdir="$$new_distdir" \ + am__remove_distdir=: \ + am__skip_length_check=: \ + am__skip_mode_fix=: \ + distdir) \ + || exit 1; \ + fi; \ + done + $(MAKE) $(AM_MAKEFLAGS) \ + top_distdir="$(top_distdir)" distdir="$(distdir)" \ + dist-hook + -test -n "$(am__skip_mode_fix)" \ + || find "$(distdir)" -type d ! -perm -755 \ + -exec chmod u+rwx,go+rx {} \; -o \ + ! -type d ! -perm -444 -links 1 -exec chmod a+r {} \; -o \ + ! -type d ! -perm -400 -exec chmod a+r {} \; -o \ + ! -type d ! -perm -444 -exec $(install_sh) -c -m a+r {} {} \; \ + || chmod -R a+r "$(distdir)" +dist-gzip: distdir + tardir=$(distdir) && $(am__tar) | eval GZIP= gzip $(GZIP_ENV) -c >$(distdir).tar.gz + $(am__post_remove_distdir) + +dist-bzip2: distdir + tardir=$(distdir) && $(am__tar) | BZIP2=$${BZIP2--9} bzip2 -c >$(distdir).tar.bz2 + $(am__post_remove_distdir) + +dist-lzip: distdir + tardir=$(distdir) && $(am__tar) | lzip -c $${LZIP_OPT--9} >$(distdir).tar.lz + $(am__post_remove_distdir) + +dist-xz: distdir + tardir=$(distdir) && $(am__tar) | XZ_OPT=$${XZ_OPT--e} xz -c >$(distdir).tar.xz + $(am__post_remove_distdir) + +dist-zstd: distdir + tardir=$(distdir) && $(am__tar) | zstd -c $${ZSTD_CLEVEL-$${ZSTD_OPT--19}} >$(distdir).tar.zst + $(am__post_remove_distdir) + +dist-tarZ: distdir + @echo WARNING: "Support for distribution archives compressed with" \ + "legacy program 'compress' is deprecated." >&2 + @echo WARNING: "It will be removed altogether in Automake 2.0" >&2 + tardir=$(distdir) && $(am__tar) | compress -c >$(distdir).tar.Z + $(am__post_remove_distdir) + +dist-shar: distdir + @echo WARNING: "Support for shar distribution archives is" \ + "deprecated." >&2 + @echo WARNING: "It will be removed altogether in Automake 2.0" >&2 + shar $(distdir) | eval GZIP= gzip $(GZIP_ENV) -c >$(distdir).shar.gz + $(am__post_remove_distdir) + +dist-zip: distdir + -rm -f $(distdir).zip + zip -rq $(distdir).zip $(distdir) + $(am__post_remove_distdir) + +dist dist-all: + $(MAKE) $(AM_MAKEFLAGS) $(DIST_TARGETS) am__post_remove_distdir='@:' + $(am__post_remove_distdir) + +# This target untars the dist file and tries a VPATH configuration. Then +# it guarantees that the distribution is self-contained by making another +# tarfile. +distcheck: dist + case '$(DIST_ARCHIVES)' in \ + *.tar.gz*) \ + eval GZIP= gzip $(GZIP_ENV) -dc $(distdir).tar.gz | $(am__untar) ;;\ + *.tar.bz2*) \ + bzip2 -dc $(distdir).tar.bz2 | $(am__untar) ;;\ + *.tar.lz*) \ + lzip -dc $(distdir).tar.lz | $(am__untar) ;;\ + *.tar.xz*) \ + xz -dc $(distdir).tar.xz | $(am__untar) ;;\ + *.tar.Z*) \ + uncompress -c $(distdir).tar.Z | $(am__untar) ;;\ + *.shar.gz*) \ + eval GZIP= gzip $(GZIP_ENV) -dc $(distdir).shar.gz | unshar ;;\ + *.zip*) \ + unzip $(distdir).zip ;;\ + *.tar.zst*) \ + zstd -dc $(distdir).tar.zst | $(am__untar) ;;\ + esac + chmod -R a-w $(distdir) + chmod u+w $(distdir) + mkdir $(distdir)/_build $(distdir)/_build/sub $(distdir)/_inst + chmod a-w $(distdir) + test -d $(distdir)/_build || exit 0; \ + dc_install_base=`$(am__cd) $(distdir)/_inst && pwd | sed -e 's,^[^:\\/]:[\\/],/,'` \ + && dc_destdir="$${TMPDIR-/tmp}/am-dc-$$$$/" \ + && am__cwd=`pwd` \ + && $(am__cd) $(distdir)/_build/sub \ + && ../../configure \ + $(AM_DISTCHECK_CONFIGURE_FLAGS) \ + $(DISTCHECK_CONFIGURE_FLAGS) \ + --srcdir=../.. --prefix="$$dc_install_base" \ + && $(MAKE) $(AM_MAKEFLAGS) \ + && $(MAKE) $(AM_MAKEFLAGS) $(AM_DISTCHECK_DVI_TARGET) \ + && $(MAKE) $(AM_MAKEFLAGS) check \ + && $(MAKE) $(AM_MAKEFLAGS) install \ + && $(MAKE) $(AM_MAKEFLAGS) installcheck \ + && $(MAKE) $(AM_MAKEFLAGS) uninstall \ + && $(MAKE) $(AM_MAKEFLAGS) distuninstallcheck_dir="$$dc_install_base" \ + distuninstallcheck \ + && chmod -R a-w "$$dc_install_base" \ + && ({ \ + (cd ../.. && umask 077 && mkdir "$$dc_destdir") \ + && $(MAKE) $(AM_MAKEFLAGS) DESTDIR="$$dc_destdir" install \ + && $(MAKE) $(AM_MAKEFLAGS) DESTDIR="$$dc_destdir" uninstall \ + && $(MAKE) $(AM_MAKEFLAGS) DESTDIR="$$dc_destdir" \ + distuninstallcheck_dir="$$dc_destdir" distuninstallcheck; \ + } || { rm -rf "$$dc_destdir"; exit 1; }) \ + && rm -rf "$$dc_destdir" \ + && $(MAKE) $(AM_MAKEFLAGS) dist \ + && rm -rf $(DIST_ARCHIVES) \ + && $(MAKE) $(AM_MAKEFLAGS) distcleancheck \ + && cd "$$am__cwd" \ + || exit 1 + $(am__post_remove_distdir) + @(echo "$(distdir) archives ready for distribution: "; \ + list='$(DIST_ARCHIVES)'; for i in $$list; do echo $$i; done) | \ + sed -e 1h -e 1s/./=/g -e 1p -e 1x -e '$$p' -e '$$x' +distuninstallcheck: + @test -n '$(distuninstallcheck_dir)' || { \ + echo 'ERROR: trying to run $@ with an empty' \ + '$$(distuninstallcheck_dir)' >&2; \ + exit 1; \ + }; \ + $(am__cd) '$(distuninstallcheck_dir)' || { \ + echo 'ERROR: cannot chdir into $(distuninstallcheck_dir)' >&2; \ + exit 1; \ + }; \ + test `$(am__distuninstallcheck_listfiles) | wc -l` -eq 0 \ + || { echo "ERROR: files left after uninstall:" ; \ + if test -n "$(DESTDIR)"; then \ + echo " (check DESTDIR support)"; \ + fi ; \ + $(distuninstallcheck_listfiles) ; \ + exit 1; } >&2 +distcleancheck: distclean + @if test '$(srcdir)' = . ; then \ + echo "ERROR: distcleancheck can only run from a VPATH build" ; \ + exit 1 ; \ + fi + @test `$(distcleancheck_listfiles) | wc -l` -eq 0 \ + || { echo "ERROR: files left in build directory after distclean:" ; \ + $(distcleancheck_listfiles) ; \ + exit 1; } >&2 +check-am: all-am + $(MAKE) $(AM_MAKEFLAGS) check-TESTS +check: check-recursive +all-am: Makefile $(PROGRAMS) config.h +installdirs: installdirs-recursive +installdirs-am: + for dir in "$(DESTDIR)$(bindir)"; do \ + test -z "$$dir" || $(MKDIR_P) "$$dir"; \ + done +install: install-recursive +install-exec: install-exec-recursive +install-data: install-data-recursive +uninstall: uninstall-recursive + +install-am: all-am + @$(MAKE) $(AM_MAKEFLAGS) install-exec-am install-data-am + +installcheck: installcheck-recursive +install-strip: + if test -z '$(STRIP)'; then \ + $(MAKE) $(AM_MAKEFLAGS) INSTALL_PROGRAM="$(INSTALL_STRIP_PROGRAM)" \ + install_sh_PROGRAM="$(INSTALL_STRIP_PROGRAM)" INSTALL_STRIP_FLAG=-s \ + install; \ + else \ + $(MAKE) $(AM_MAKEFLAGS) INSTALL_PROGRAM="$(INSTALL_STRIP_PROGRAM)" \ + install_sh_PROGRAM="$(INSTALL_STRIP_PROGRAM)" INSTALL_STRIP_FLAG=-s \ + "INSTALL_PROGRAM_ENV=STRIPPROG='$(STRIP)'" install; \ + fi +mostlyclean-generic: + -test -z "$(TEST_LOGS)" || rm -f $(TEST_LOGS) + -test -z "$(TEST_LOGS:.log=.trs)" || rm -f $(TEST_LOGS:.log=.trs) + -test -z "$(TEST_SUITE_LOG)" || rm -f $(TEST_SUITE_LOG) + +clean-generic: + -test -z "$(CLEANFILES)" || rm -f $(CLEANFILES) + +distclean-generic: + -test -z "$(CONFIG_CLEAN_FILES)" || rm -f $(CONFIG_CLEAN_FILES) + -test . = "$(srcdir)" || test -z "$(CONFIG_CLEAN_VPATH_FILES)" || rm -f $(CONFIG_CLEAN_VPATH_FILES) + -rm -f @DVIPNG_TREE@/$(DEPDIR)/$(am__dirstamp) + -rm -f @DVIPNG_TREE@/$(am__dirstamp) + -test -z "$(DISTCLEANFILES)" || rm -f $(DISTCLEANFILES) + +maintainer-clean-generic: + @echo "This command is intended for maintainers to use" + @echo "it deletes files that may require special tools to rebuild." +@WIN32_TRUE@install-exec-hook: +@have_gif_FALSE@install-exec-hook: +@WIN32_TRUE@uninstall-hook: +@have_gif_FALSE@uninstall-hook: +clean: clean-recursive + +clean-am: clean-binPROGRAMS clean-generic clean-libtool mostlyclean-am + +distclean: distclean-recursive + -rm -f $(am__CONFIG_DISTCLEAN_FILES) + -rm -f ./$(DEPDIR)/dvigif-callexe.Po + -rm -f @DVIPNG_TREE@/$(DEPDIR)/color.Po + -rm -f @DVIPNG_TREE@/$(DEPDIR)/draw.Po + -rm -f @DVIPNG_TREE@/$(DEPDIR)/dvi.Po + -rm -f @DVIPNG_TREE@/$(DEPDIR)/dvipng.Po + -rm -f @DVIPNG_TREE@/$(DEPDIR)/enc.Po + -rm -f @DVIPNG_TREE@/$(DEPDIR)/font.Po + -rm -f @DVIPNG_TREE@/$(DEPDIR)/fontmap.Po + -rm -f @DVIPNG_TREE@/$(DEPDIR)/ft.Po + -rm -f @DVIPNG_TREE@/$(DEPDIR)/misc.Po + -rm -f @DVIPNG_TREE@/$(DEPDIR)/papersiz.Po + -rm -f @DVIPNG_TREE@/$(DEPDIR)/pk.Po + -rm -f @DVIPNG_TREE@/$(DEPDIR)/ppagelist.Po + -rm -f @DVIPNG_TREE@/$(DEPDIR)/set.Po + -rm -f @DVIPNG_TREE@/$(DEPDIR)/sfd.Po + -rm -f @DVIPNG_TREE@/$(DEPDIR)/special.Po + -rm -f @DVIPNG_TREE@/$(DEPDIR)/tfm.Po + -rm -f @DVIPNG_TREE@/$(DEPDIR)/vf.Po + -rm -f Makefile +distclean-am: clean-am distclean-compile distclean-generic \ + distclean-hdr distclean-libtool distclean-tags + +dvi: dvi-recursive + +dvi-am: + +html: html-recursive + +html-am: + +info: info-recursive + +info-am: + +install-data-am: + +install-dvi: install-dvi-recursive + +install-dvi-am: + +install-exec-am: install-binPROGRAMS + @$(NORMAL_INSTALL) + $(MAKE) $(AM_MAKEFLAGS) install-exec-hook +install-html: install-html-recursive + +install-html-am: + +install-info: install-info-recursive + +install-info-am: + +install-man: + +install-pdf: install-pdf-recursive + +install-pdf-am: + +install-ps: install-ps-recursive + +install-ps-am: + +installcheck-am: + +maintainer-clean: maintainer-clean-recursive + -rm -f $(am__CONFIG_DISTCLEAN_FILES) + -rm -rf $(top_srcdir)/autom4te.cache + -rm -f ./$(DEPDIR)/dvigif-callexe.Po + -rm -f @DVIPNG_TREE@/$(DEPDIR)/color.Po + -rm -f @DVIPNG_TREE@/$(DEPDIR)/draw.Po + -rm -f @DVIPNG_TREE@/$(DEPDIR)/dvi.Po + -rm -f @DVIPNG_TREE@/$(DEPDIR)/dvipng.Po + -rm -f @DVIPNG_TREE@/$(DEPDIR)/enc.Po + -rm -f @DVIPNG_TREE@/$(DEPDIR)/font.Po + -rm -f @DVIPNG_TREE@/$(DEPDIR)/fontmap.Po + -rm -f @DVIPNG_TREE@/$(DEPDIR)/ft.Po + -rm -f @DVIPNG_TREE@/$(DEPDIR)/misc.Po + -rm -f @DVIPNG_TREE@/$(DEPDIR)/papersiz.Po + -rm -f @DVIPNG_TREE@/$(DEPDIR)/pk.Po + -rm -f @DVIPNG_TREE@/$(DEPDIR)/ppagelist.Po + -rm -f @DVIPNG_TREE@/$(DEPDIR)/set.Po + -rm -f @DVIPNG_TREE@/$(DEPDIR)/sfd.Po + -rm -f @DVIPNG_TREE@/$(DEPDIR)/special.Po + -rm -f @DVIPNG_TREE@/$(DEPDIR)/tfm.Po + -rm -f @DVIPNG_TREE@/$(DEPDIR)/vf.Po + -rm -f Makefile +maintainer-clean-am: distclean-am maintainer-clean-generic + +mostlyclean: mostlyclean-recursive + +mostlyclean-am: mostlyclean-compile mostlyclean-generic \ + mostlyclean-libtool + +pdf: pdf-recursive + +pdf-am: + +ps: ps-recursive + +ps-am: + +uninstall-am: uninstall-binPROGRAMS + @$(NORMAL_INSTALL) + $(MAKE) $(AM_MAKEFLAGS) uninstall-hook +.MAKE: $(am__recursive_targets) all check-am install-am \ + install-exec-am install-strip uninstall-am + +.PHONY: $(am__recursive_targets) CTAGS GTAGS TAGS all all-am \ + am--depfiles am--refresh check check-TESTS check-am clean \ + clean-binPROGRAMS clean-cscope clean-generic clean-libtool \ + cscope cscopelist-am ctags ctags-am dist dist-all dist-bzip2 \ + dist-gzip dist-hook dist-lzip dist-shar dist-tarZ dist-xz \ + dist-zip dist-zstd distcheck distclean distclean-compile \ + distclean-generic distclean-hdr distclean-libtool \ + distclean-tags distcleancheck distdir distuninstallcheck dvi \ + dvi-am html html-am info info-am install install-am \ + install-binPROGRAMS install-data install-data-am install-dvi \ + install-dvi-am install-exec install-exec-am install-exec-hook \ + install-html install-html-am install-info install-info-am \ + install-man install-pdf install-pdf-am install-ps \ + install-ps-am install-strip installcheck installcheck-am \ + installdirs installdirs-am maintainer-clean \ + maintainer-clean-generic mostlyclean mostlyclean-compile \ + mostlyclean-generic mostlyclean-libtool pdf pdf-am ps ps-am \ + recheck tags tags-am uninstall uninstall-am \ + uninstall-binPROGRAMS uninstall-hook + +.PRECIOUS: Makefile + +dist-hook: + cd "$(distdir)" && rm -rf $(NEVER_DIST) + +$(dvipng_OBJECTS): config.force + +config.force: $(dvipng_dependencies) + echo timestamp >config.force + $(SHELL) ./config.status --recheck + $(SHELL) ./config.status Makefile config.h + +@KPATHSEA_RULE@ +@GD_RULE@ +@FREETYPE2_RULE@ +@LIBPNG_RULE@ + +.PHONY: install-bin-links uninstall-bin-links + +install-bin-links: +@WIN32_FALSE@ $(MKDIR_P) $(DESTDIR)$(bindir) +@WIN32_FALSE@ @cd $(DESTDIR)$(bindir) && \ +@WIN32_FALSE@ for s in $(bin_links); do \ +@WIN32_FALSE@ link=`echo $$s | sed 's,.*:,,'`; \ +@WIN32_FALSE@ file=`echo $$s | sed 's,:.*,,'`; \ +@WIN32_FALSE@ rm -f $$link; \ +@WIN32_FALSE@ echo "creating link '$$link' -> '$$file'"; \ +@WIN32_FALSE@ $(LN_S) $$file $$link || exit 1; \ +@WIN32_FALSE@ done + +uninstall-bin-links: +@WIN32_FALSE@ @for s in $(bin_links); do \ +@WIN32_FALSE@ link=`echo $$s | sed 's,.*:,,'`; \ +@WIN32_FALSE@ rm -f $(DESTDIR)$(bindir)/$$link; \ +@WIN32_FALSE@ done +@WIN32_FALSE@@have_gif_TRUE@install-exec-hook: install-bin-links +@WIN32_FALSE@@have_gif_TRUE@uninstall-hook: uninstall-bin-links +dvipng.log: dvipng$(EXEEXT) + +# Tell versions [3.59,3.63) of GNU make to not export all variables. +# Otherwise a system limit (for SysV at least) may be exceeded. +.NOEXPORT: diff --git a/Build/source/texk/dvipng/TLpatches/ChangeLog b/Build/source/texk/dvipng/TLpatches/ChangeLog new file mode 100644 index 00000000000..33072606fa8 --- /dev/null +++ b/Build/source/texk/dvipng/TLpatches/ChangeLog @@ -0,0 +1,142 @@ +2020-01-06 Akira Kakuto <kakuto@w32tex.org> + + Import dvipng-1.17. + * patch-08-win32: add to support non-ascii image file names + on Windows (Windows only). + +2019-04-07 Karl Berry <karl@freefriends.org> + + * patch-02-const, + * patch-03-programname, + * patch-06-WIN32, + * patch-07-w64-ptr: remove; all patches were installed in 1.16. + +2015-03-04 Peter Breitenlohner <peb@mppmu.mpg.de> + + * patch-07-w64-ptr: Better handling of WIN64 ptr->long. + +2015-03-03 Peter Breitenlohner <peb@mppmu.mpg.de> + + * Imported release 1.15 from savannah.nongnu.org. + * patch-01-gd-copyright: Removed. + * patch-05-sys_wait (removed): Included in 1.15. + * patch-02-const, patch-03-programname, patch-06-WIN32, + patch-07-w64-ptr: Adapted. + +2014-11-05 Peter Breitenlohner <peb@mppmu.mpg.de> + + * patch-07-w64-ptr: Fixed a typo. + +2014-07-15 Peter Breitenlohner <peb@mppmu.mpg.de> + + * patch-07-w64-ptr: Avoid WIN64 warning due to different size. + +2013-07-09 Peter Breitenlohner <peb@mppmu.mpg.de> + + * COPYING.gd (new): From libgd-2.1.0/COPYING, with '@' => '@@'. + * patch-01-gd-copyright: Refer to COPYING.gd instead of + including it into dvipng.texi. + + * patch-04-dvigif (removed): Merged into patch-03-programname. + * patch-03-programname: Use kpse_program_basename(). + +2012-08-25 Peter Breitenlohner <peb@mppmu.mpg.de> + + * patch-06-WIN32: Avoid warning when redefining pipe. + +2012-08-01 Peter Breitenlohner <peb@mppmu.mpg.de> + + * patch-06-WIN32: Do not redefine snprintf, handled by kpathsea. + Also, kpathsea has included <fcntl.h>, <io.h>, and <process.h>. + +2011-08-03 Peter Breitenlohner <peb@mppmu.mpg.de> + + * patch-06-WIN32 (new): Call texlive_gs_init() for MINGW32, + as for native WIN32, from Akira. + +2011-02-07 Peter Breitenlohner <peb@mppmu.mpg.de> + + * patch-05-sys_wait (new): #include <sys/wait.h>, not <wait.h>. + Reported by Nikola Lecic <nikola.lecic@anthesphoria.net>. + +2010-12-30 Peter Breitenlohner <peb@mppmu.mpg.de> + + * patch-03-programname (new): Use basename() as defined in + <libgen.h> or xbasename() from kpathsea to extract programname + from argv[0]. Avoid uninitialized use of programname. + + * patch-04-dvigif (new): Check for argv[0] with .exe via + strcasecmp(), if possible. + +2010-12-15 Peter Breitenlohner <peb@mppmu.mpg.de> + + * Imported release 1.14 from savannah.nongnu.org. + * patch-2?-* (removed): Included in 1.14. + + * patch-01-gd-copyright (new): Include full gd copyright notice + into dvipng.texi; seems the safe thing to do. + + * patch-02-const (new): Avoid compiler warnings. + +2010-10-02 Peter Breitenlohner <peb@mppmu.mpg.de> + + * patch-22-win32-bugfix (new): WIN32 bug fix from Akira Kakuto. + +2010-03-18 Peter Breitenlohner <peb@mppmu.mpg.de> + + * Imported release 1.13 from savannah.nongnu.org. + * patch-[01]?-* (removed): Included in 1.13. + + * patch-20-rpl_malloc (new): Avoid implicit decl of malloc(). + * patch-21-win32 (new): Avoid unnecessary warning in WIN32 code. + +2010-03-09 Peter Breitenlohner <peb@mppmu.mpg.de> + + * patch-12-set_program_name: Replace kpse_set_progname() by + kpse_set_program_name(). + +2010-02-24 Peter Breitenlohner <peb@mppmu.mpg.de> + + * patch-10-mmap-for-WIN32 (new): Former MIKTEX code for mmap + from Fabrice Popineau (?) now used for all WIN32 variants. + * patch-11-win32-fork-and-pipe (new): WIN32 specific replacement + for fork and pipe, using code from Akira Kakuto. + +2010-02-21 Peter Breitenlohner <peb@mppmu.mpg.de> + + * patch-07-always-undef (new): Always undefine min/max before + redefining them (for MinGW32). + * patch-08-HAVE_MMAP (new): #include <sys/mman.h> only + #if defined(HAVE_MMAP) (for MinGW32). + * patch-09-sleep (new): Use Sleep and #include <stdlib.h> + (for WIN32/MinGW32). + +2010-01-29 Karl Berry <karl@tug.org> + + * patch-06-mathptmx (new): Do not use \usepackage{mathptmx} + in test_dvipng.tex. + +2009-06-12 Peter Breitenlohner <peb@mppmu.mpg.de> + + * patch-05-warnings (new): Avoid more compiler warnings. + +2009-06-09 Peter Breitenlohner <peb@mppmu.mpg.de> + + * patch-04-static (new): Avoid warnings when compiling with + 'gcc --Wmissing-prototypes'. + +2009-02-22 Peter Breitenlohner <peb@mppmu.mpg.de> + + * patch-03-have-ft2 (new): Bug fix - skip FT2 code when + compiling without FT2 library. + +2009-03-25 Peter Breitenlohner <peb@mppmu.mpg.de> + + * patch-02-use-ifdef (new): Use #ifdef instead of #if to avoid + preprocessor warnings. + +2009-03-24 Peter Breitenlohner <peb@mppmu.mpg.de> + + * patch-01-portability (new): Portability fix - put variable + declarations at the beginning of the block. + diff --git a/Build/source/texk/dvipng/TLpatches/TL-Changes b/Build/source/texk/dvipng/TLpatches/TL-Changes new file mode 100644 index 00000000000..54d548f4d8b --- /dev/null +++ b/Build/source/texk/dvipng/TLpatches/TL-Changes @@ -0,0 +1,18 @@ +Changes applied to the dvipng-1.17 tree as obtained from: + http://mirror.ctan.org/dviware/dvipng/ + +Removed: + configure + config.h + install-sh + mkinstalldirs + +Created Autoconf macro files ../m4/gs-device.m4 and ../m4/makeinfo.m4 + adapting code in aclocal.m4. + +Copied these files to ../doc/: + dvipng.1 + dvipng.texi + install.texi + macros.texi + readme.texi diff --git a/Build/source/texk/dvipng/TLpatches/patch-08-win32 b/Build/source/texk/dvipng/TLpatches/patch-08-win32 new file mode 100644 index 00000000000..eb820419d79 --- /dev/null +++ b/Build/source/texk/dvipng/TLpatches/patch-08-win32 @@ -0,0 +1,28 @@ +--- special.c.orig Fri Aug 31 16:39:04 2018 ++++ special.c Mon Jan 06 18:53:34 2020 +@@ -492,6 +492,25 @@ + + PSCodeInit(&image, NULL); + image.filename=kpse_find_file(psname,kpse_pict_format,0); ++#if !defined(MIKTEX) && defined(WIN32) ++ if (image.filename == NULL) { ++ wchar_t *wnam; ++ char *tmpnam; ++ int tmpcp; ++ tmpcp = file_system_codepage; ++ file_system_codepage = CP_UTF8; ++ tmpnam = kpse_find_file(psname,kpse_pict_format,0); ++ if (tmpnam) { ++ wnam = get_wstring_from_mbstring(CP_UTF8, tmpnam, wnam=NULL); ++ if (wnam) { ++ image.filename = get_mbstring_from_wstring(tmpcp, wnam, image.filename=NULL); ++ free(wnam); ++ } ++ free(tmpnam); ++ } ++ file_system_codepage = tmpcp; ++ } ++#endif + if (MmapFile(image.filename,&(image.fmmap)) || image.fmmap.size==0) { + Warning("Image file %s unusable, image will be left blank", + image.filename); diff --git a/Build/source/texk/dvipng/ac/dvipng.ac b/Build/source/texk/dvipng/ac/dvipng.ac new file mode 100644 index 00000000000..27d4bf31525 --- /dev/null +++ b/Build/source/texk/dvipng/ac/dvipng.ac @@ -0,0 +1,18 @@ +## texk/dvipng/ac/dvipng.ac: configure.ac fragment for the TeX Live subdirectory texk/dvipng/ +dnl +dnl Copyright (C) 2009 Peter Breitenlohner <tex-live@tug.org> +dnl You may freely use, modify and/or distribute this file. +dnl +## configure options for dvipng +m4_define_default([kpse_indent_26], [26])[]dnl +AC_ARG_ENABLE([debug], + AC_HELP_STRING([--disable-debug], + [Compile without debug (-d) option], + kpse_indent_26)) +AC_ARG_ENABLE([timing], + AC_HELP_STRING([--enable-timing], + [Output execution time of dvipng], + kpse_indent_26)) +AC_ARG_WITH([gs], + AC_HELP_STRING([--with-gs=/PATH/TO/gs], + [Hard-wire the location of GhostScript])) diff --git a/Build/source/texk/dvipng/ac/withenable.ac b/Build/source/texk/dvipng/ac/withenable.ac new file mode 100644 index 00000000000..c29e49af72f --- /dev/null +++ b/Build/source/texk/dvipng/ac/withenable.ac @@ -0,0 +1,8 @@ +## texk/dvipng/ac/withenable.ac: configure.ac fragment for the TeX Live subdirectory texk/dvipng/ +dnl +dnl Copyright (C) 2009-2013 Peter Breitenlohner <tex-live@tug.org> +dnl You may freely use, modify and/or distribute this file. +dnl +## configure options and TL libraries required for dvipng +KPSE_ENABLE_PROG([dvipng], [kpathsea gd]) +m4_include(kpse_TL[texk/dvipng/ac/dvipng.ac]) diff --git a/Build/source/texk/dvipng/aclocal.m4 b/Build/source/texk/dvipng/aclocal.m4 new file mode 100644 index 00000000000..b56ed915a72 --- /dev/null +++ b/Build/source/texk/dvipng/aclocal.m4 @@ -0,0 +1,1220 @@ +# generated automatically by aclocal 1.16.3 -*- Autoconf -*- + +# Copyright (C) 1996-2020 Free Software Foundation, Inc. + +# This file is free software; the Free Software Foundation +# gives unlimited permission to copy and/or distribute it, +# with or without modifications, as long as this notice is preserved. + +# This program is distributed in the hope that it will be useful, +# but WITHOUT ANY WARRANTY, to the extent permitted by law; without +# even the implied warranty of MERCHANTABILITY or FITNESS FOR A +# PARTICULAR PURPOSE. + +m4_ifndef([AC_CONFIG_MACRO_DIRS], [m4_defun([_AM_CONFIG_MACRO_DIRS], [])m4_defun([AC_CONFIG_MACRO_DIRS], [_AM_CONFIG_MACRO_DIRS($@)])]) +m4_ifndef([AC_AUTOCONF_VERSION], + [m4_copy([m4_PACKAGE_VERSION], [AC_AUTOCONF_VERSION])])dnl +m4_if(m4_defn([AC_AUTOCONF_VERSION]), [2.69],, +[m4_warning([this file was generated for autoconf 2.69. +You have another version of autoconf. It may work, but is not guaranteed to. +If you have problems, you may need to regenerate the build system entirely. +To do so, use the procedure documented by the package, typically 'autoreconf'.])]) + +# Copyright (C) 2002-2020 Free Software Foundation, Inc. +# +# This file is free software; the Free Software Foundation +# gives unlimited permission to copy and/or distribute it, +# with or without modifications, as long as this notice is preserved. + +# AM_AUTOMAKE_VERSION(VERSION) +# ---------------------------- +# Automake X.Y traces this macro to ensure aclocal.m4 has been +# generated from the m4 files accompanying Automake X.Y. +# (This private macro should not be called outside this file.) +AC_DEFUN([AM_AUTOMAKE_VERSION], +[am__api_version='1.16' +dnl Some users find AM_AUTOMAKE_VERSION and mistake it for a way to +dnl require some minimum version. Point them to the right macro. +m4_if([$1], [1.16.3], [], + [AC_FATAL([Do not call $0, use AM_INIT_AUTOMAKE([$1]).])])dnl +]) + +# _AM_AUTOCONF_VERSION(VERSION) +# ----------------------------- +# aclocal traces this macro to find the Autoconf version. +# This is a private macro too. Using m4_define simplifies +# the logic in aclocal, which can simply ignore this definition. +m4_define([_AM_AUTOCONF_VERSION], []) + +# AM_SET_CURRENT_AUTOMAKE_VERSION +# ------------------------------- +# Call AM_AUTOMAKE_VERSION and AM_AUTOMAKE_VERSION so they can be traced. +# This function is AC_REQUIREd by AM_INIT_AUTOMAKE. +AC_DEFUN([AM_SET_CURRENT_AUTOMAKE_VERSION], +[AM_AUTOMAKE_VERSION([1.16.3])dnl +m4_ifndef([AC_AUTOCONF_VERSION], + [m4_copy([m4_PACKAGE_VERSION], [AC_AUTOCONF_VERSION])])dnl +_AM_AUTOCONF_VERSION(m4_defn([AC_AUTOCONF_VERSION]))]) + +# AM_AUX_DIR_EXPAND -*- Autoconf -*- + +# Copyright (C) 2001-2020 Free Software Foundation, Inc. +# +# This file is free software; the Free Software Foundation +# gives unlimited permission to copy and/or distribute it, +# with or without modifications, as long as this notice is preserved. + +# For projects using AC_CONFIG_AUX_DIR([foo]), Autoconf sets +# $ac_aux_dir to '$srcdir/foo'. In other projects, it is set to +# '$srcdir', '$srcdir/..', or '$srcdir/../..'. +# +# Of course, Automake must honor this variable whenever it calls a +# tool from the auxiliary directory. The problem is that $srcdir (and +# therefore $ac_aux_dir as well) can be either absolute or relative, +# depending on how configure is run. This is pretty annoying, since +# it makes $ac_aux_dir quite unusable in subdirectories: in the top +# source directory, any form will work fine, but in subdirectories a +# relative path needs to be adjusted first. +# +# $ac_aux_dir/missing +# fails when called from a subdirectory if $ac_aux_dir is relative +# $top_srcdir/$ac_aux_dir/missing +# fails if $ac_aux_dir is absolute, +# fails when called from a subdirectory in a VPATH build with +# a relative $ac_aux_dir +# +# The reason of the latter failure is that $top_srcdir and $ac_aux_dir +# are both prefixed by $srcdir. In an in-source build this is usually +# harmless because $srcdir is '.', but things will broke when you +# start a VPATH build or use an absolute $srcdir. +# +# So we could use something similar to $top_srcdir/$ac_aux_dir/missing, +# iff we strip the leading $srcdir from $ac_aux_dir. That would be: +# am_aux_dir='\$(top_srcdir)/'`expr "$ac_aux_dir" : "$srcdir//*\(.*\)"` +# and then we would define $MISSING as +# MISSING="\${SHELL} $am_aux_dir/missing" +# This will work as long as MISSING is not called from configure, because +# unfortunately $(top_srcdir) has no meaning in configure. +# However there are other variables, like CC, which are often used in +# configure, and could therefore not use this "fixed" $ac_aux_dir. +# +# Another solution, used here, is to always expand $ac_aux_dir to an +# absolute PATH. The drawback is that using absolute paths prevent a +# configured tree to be moved without reconfiguration. + +AC_DEFUN([AM_AUX_DIR_EXPAND], +[AC_REQUIRE([AC_CONFIG_AUX_DIR_DEFAULT])dnl +# Expand $ac_aux_dir to an absolute path. +am_aux_dir=`cd "$ac_aux_dir" && pwd` +]) + +# AM_COND_IF -*- Autoconf -*- + +# Copyright (C) 2008-2020 Free Software Foundation, Inc. +# +# This file is free software; the Free Software Foundation +# gives unlimited permission to copy and/or distribute it, +# with or without modifications, as long as this notice is preserved. + +# _AM_COND_IF +# _AM_COND_ELSE +# _AM_COND_ENDIF +# -------------- +# These macros are only used for tracing. +m4_define([_AM_COND_IF]) +m4_define([_AM_COND_ELSE]) +m4_define([_AM_COND_ENDIF]) + +# AM_COND_IF(COND, [IF-TRUE], [IF-FALSE]) +# --------------------------------------- +# If the shell condition COND is true, execute IF-TRUE, otherwise execute +# IF-FALSE. Allow automake to learn about conditional instantiating macros +# (the AC_CONFIG_FOOS). +AC_DEFUN([AM_COND_IF], +[m4_ifndef([_AM_COND_VALUE_$1], + [m4_fatal([$0: no such condition "$1"])])dnl +_AM_COND_IF([$1])dnl +if test -z "$$1_TRUE"; then : + m4_n([$2])[]dnl +m4_ifval([$3], +[_AM_COND_ELSE([$1])dnl +else + $3 +])dnl +_AM_COND_ENDIF([$1])dnl +fi[]dnl +]) + +# AM_CONDITIONAL -*- Autoconf -*- + +# Copyright (C) 1997-2020 Free Software Foundation, Inc. +# +# This file is free software; the Free Software Foundation +# gives unlimited permission to copy and/or distribute it, +# with or without modifications, as long as this notice is preserved. + +# AM_CONDITIONAL(NAME, SHELL-CONDITION) +# ------------------------------------- +# Define a conditional. +AC_DEFUN([AM_CONDITIONAL], +[AC_PREREQ([2.52])dnl + m4_if([$1], [TRUE], [AC_FATAL([$0: invalid condition: $1])], + [$1], [FALSE], [AC_FATAL([$0: invalid condition: $1])])dnl +AC_SUBST([$1_TRUE])dnl +AC_SUBST([$1_FALSE])dnl +_AM_SUBST_NOTMAKE([$1_TRUE])dnl +_AM_SUBST_NOTMAKE([$1_FALSE])dnl +m4_define([_AM_COND_VALUE_$1], [$2])dnl +if $2; then + $1_TRUE= + $1_FALSE='#' +else + $1_TRUE='#' + $1_FALSE= +fi +AC_CONFIG_COMMANDS_PRE( +[if test -z "${$1_TRUE}" && test -z "${$1_FALSE}"; then + AC_MSG_ERROR([[conditional "$1" was never defined. +Usually this means the macro was only invoked conditionally.]]) +fi])]) + +# Copyright (C) 1999-2020 Free Software Foundation, Inc. +# +# This file is free software; the Free Software Foundation +# gives unlimited permission to copy and/or distribute it, +# with or without modifications, as long as this notice is preserved. + + +# There are a few dirty hacks below to avoid letting 'AC_PROG_CC' be +# written in clear, in which case automake, when reading aclocal.m4, +# will think it sees a *use*, and therefore will trigger all it's +# C support machinery. Also note that it means that autoscan, seeing +# CC etc. in the Makefile, will ask for an AC_PROG_CC use... + + +# _AM_DEPENDENCIES(NAME) +# ---------------------- +# See how the compiler implements dependency checking. +# NAME is "CC", "CXX", "OBJC", "OBJCXX", "UPC", or "GJC". +# We try a few techniques and use that to set a single cache variable. +# +# We don't AC_REQUIRE the corresponding AC_PROG_CC since the latter was +# modified to invoke _AM_DEPENDENCIES(CC); we would have a circular +# dependency, and given that the user is not expected to run this macro, +# just rely on AC_PROG_CC. +AC_DEFUN([_AM_DEPENDENCIES], +[AC_REQUIRE([AM_SET_DEPDIR])dnl +AC_REQUIRE([AM_OUTPUT_DEPENDENCY_COMMANDS])dnl +AC_REQUIRE([AM_MAKE_INCLUDE])dnl +AC_REQUIRE([AM_DEP_TRACK])dnl + +m4_if([$1], [CC], [depcc="$CC" am_compiler_list=], + [$1], [CXX], [depcc="$CXX" am_compiler_list=], + [$1], [OBJC], [depcc="$OBJC" am_compiler_list='gcc3 gcc'], + [$1], [OBJCXX], [depcc="$OBJCXX" am_compiler_list='gcc3 gcc'], + [$1], [UPC], [depcc="$UPC" am_compiler_list=], + [$1], [GCJ], [depcc="$GCJ" am_compiler_list='gcc3 gcc'], + [depcc="$$1" am_compiler_list=]) + +AC_CACHE_CHECK([dependency style of $depcc], + [am_cv_$1_dependencies_compiler_type], +[if test -z "$AMDEP_TRUE" && test -f "$am_depcomp"; then + # We make a subdir and do the tests there. Otherwise we can end up + # making bogus files that we don't know about and never remove. For + # instance it was reported that on HP-UX the gcc test will end up + # making a dummy file named 'D' -- because '-MD' means "put the output + # in D". + rm -rf conftest.dir + mkdir conftest.dir + # Copy depcomp to subdir because otherwise we won't find it if we're + # using a relative directory. + cp "$am_depcomp" conftest.dir + cd conftest.dir + # We will build objects and dependencies in a subdirectory because + # it helps to detect inapplicable dependency modes. For instance + # both Tru64's cc and ICC support -MD to output dependencies as a + # side effect of compilation, but ICC will put the dependencies in + # the current directory while Tru64 will put them in the object + # directory. + mkdir sub + + am_cv_$1_dependencies_compiler_type=none + if test "$am_compiler_list" = ""; then + am_compiler_list=`sed -n ['s/^#*\([a-zA-Z0-9]*\))$/\1/p'] < ./depcomp` + fi + am__universal=false + m4_case([$1], [CC], + [case " $depcc " in #( + *\ -arch\ *\ -arch\ *) am__universal=true ;; + esac], + [CXX], + [case " $depcc " in #( + *\ -arch\ *\ -arch\ *) am__universal=true ;; + esac]) + + for depmode in $am_compiler_list; do + # Setup a source with many dependencies, because some compilers + # like to wrap large dependency lists on column 80 (with \), and + # we should not choose a depcomp mode which is confused by this. + # + # We need to recreate these files for each test, as the compiler may + # overwrite some of them when testing with obscure command lines. + # This happens at least with the AIX C compiler. + : > sub/conftest.c + for i in 1 2 3 4 5 6; do + echo '#include "conftst'$i'.h"' >> sub/conftest.c + # Using ": > sub/conftst$i.h" creates only sub/conftst1.h with + # Solaris 10 /bin/sh. + echo '/* dummy */' > sub/conftst$i.h + done + echo "${am__include} ${am__quote}sub/conftest.Po${am__quote}" > confmf + + # We check with '-c' and '-o' for the sake of the "dashmstdout" + # mode. It turns out that the SunPro C++ compiler does not properly + # handle '-M -o', and we need to detect this. Also, some Intel + # versions had trouble with output in subdirs. + am__obj=sub/conftest.${OBJEXT-o} + am__minus_obj="-o $am__obj" + case $depmode in + gcc) + # This depmode causes a compiler race in universal mode. + test "$am__universal" = false || continue + ;; + nosideeffect) + # After this tag, mechanisms are not by side-effect, so they'll + # only be used when explicitly requested. + if test "x$enable_dependency_tracking" = xyes; then + continue + else + break + fi + ;; + msvc7 | msvc7msys | msvisualcpp | msvcmsys) + # This compiler won't grok '-c -o', but also, the minuso test has + # not run yet. These depmodes are late enough in the game, and + # so weak that their functioning should not be impacted. + am__obj=conftest.${OBJEXT-o} + am__minus_obj= + ;; + none) break ;; + esac + if depmode=$depmode \ + source=sub/conftest.c object=$am__obj \ + depfile=sub/conftest.Po tmpdepfile=sub/conftest.TPo \ + $SHELL ./depcomp $depcc -c $am__minus_obj sub/conftest.c \ + >/dev/null 2>conftest.err && + grep sub/conftst1.h sub/conftest.Po > /dev/null 2>&1 && + grep sub/conftst6.h sub/conftest.Po > /dev/null 2>&1 && + grep $am__obj sub/conftest.Po > /dev/null 2>&1 && + ${MAKE-make} -s -f confmf > /dev/null 2>&1; then + # icc doesn't choke on unknown options, it will just issue warnings + # or remarks (even with -Werror). So we grep stderr for any message + # that says an option was ignored or not supported. + # When given -MP, icc 7.0 and 7.1 complain thusly: + # icc: Command line warning: ignoring option '-M'; no argument required + # The diagnosis changed in icc 8.0: + # icc: Command line remark: option '-MP' not supported + if (grep 'ignoring option' conftest.err || + grep 'not supported' conftest.err) >/dev/null 2>&1; then :; else + am_cv_$1_dependencies_compiler_type=$depmode + break + fi + fi + done + + cd .. + rm -rf conftest.dir +else + am_cv_$1_dependencies_compiler_type=none +fi +]) +AC_SUBST([$1DEPMODE], [depmode=$am_cv_$1_dependencies_compiler_type]) +AM_CONDITIONAL([am__fastdep$1], [ + test "x$enable_dependency_tracking" != xno \ + && test "$am_cv_$1_dependencies_compiler_type" = gcc3]) +]) + + +# AM_SET_DEPDIR +# ------------- +# Choose a directory name for dependency files. +# This macro is AC_REQUIREd in _AM_DEPENDENCIES. +AC_DEFUN([AM_SET_DEPDIR], +[AC_REQUIRE([AM_SET_LEADING_DOT])dnl +AC_SUBST([DEPDIR], ["${am__leading_dot}deps"])dnl +]) + + +# AM_DEP_TRACK +# ------------ +AC_DEFUN([AM_DEP_TRACK], +[AC_ARG_ENABLE([dependency-tracking], [dnl +AS_HELP_STRING( + [--enable-dependency-tracking], + [do not reject slow dependency extractors]) +AS_HELP_STRING( + [--disable-dependency-tracking], + [speeds up one-time build])]) +if test "x$enable_dependency_tracking" != xno; then + am_depcomp="$ac_aux_dir/depcomp" + AMDEPBACKSLASH='\' + am__nodep='_no' +fi +AM_CONDITIONAL([AMDEP], [test "x$enable_dependency_tracking" != xno]) +AC_SUBST([AMDEPBACKSLASH])dnl +_AM_SUBST_NOTMAKE([AMDEPBACKSLASH])dnl +AC_SUBST([am__nodep])dnl +_AM_SUBST_NOTMAKE([am__nodep])dnl +]) + +# Generate code to set up dependency tracking. -*- Autoconf -*- + +# Copyright (C) 1999-2020 Free Software Foundation, Inc. +# +# This file is free software; the Free Software Foundation +# gives unlimited permission to copy and/or distribute it, +# with or without modifications, as long as this notice is preserved. + +# _AM_OUTPUT_DEPENDENCY_COMMANDS +# ------------------------------ +AC_DEFUN([_AM_OUTPUT_DEPENDENCY_COMMANDS], +[{ + # Older Autoconf quotes --file arguments for eval, but not when files + # are listed without --file. Let's play safe and only enable the eval + # if we detect the quoting. + # TODO: see whether this extra hack can be removed once we start + # requiring Autoconf 2.70 or later. + AS_CASE([$CONFIG_FILES], + [*\'*], [eval set x "$CONFIG_FILES"], + [*], [set x $CONFIG_FILES]) + shift + # Used to flag and report bootstrapping failures. + am_rc=0 + for am_mf + do + # Strip MF so we end up with the name of the file. + am_mf=`AS_ECHO(["$am_mf"]) | sed -e 's/:.*$//'` + # Check whether this is an Automake generated Makefile which includes + # dependency-tracking related rules and includes. + # Grep'ing the whole file directly is not great: AIX grep has a line + # limit of 2048, but all sed's we know have understand at least 4000. + sed -n 's,^am--depfiles:.*,X,p' "$am_mf" | grep X >/dev/null 2>&1 \ + || continue + am_dirpart=`AS_DIRNAME(["$am_mf"])` + am_filepart=`AS_BASENAME(["$am_mf"])` + AM_RUN_LOG([cd "$am_dirpart" \ + && sed -e '/# am--include-marker/d' "$am_filepart" \ + | $MAKE -f - am--depfiles]) || am_rc=$? + done + if test $am_rc -ne 0; then + AC_MSG_FAILURE([Something went wrong bootstrapping makefile fragments + for automatic dependency tracking. If GNU make was not used, consider + re-running the configure script with MAKE="gmake" (or whatever is + necessary). You can also try re-running configure with the + '--disable-dependency-tracking' option to at least be able to build + the package (albeit without support for automatic dependency tracking).]) + fi + AS_UNSET([am_dirpart]) + AS_UNSET([am_filepart]) + AS_UNSET([am_mf]) + AS_UNSET([am_rc]) + rm -f conftest-deps.mk +} +])# _AM_OUTPUT_DEPENDENCY_COMMANDS + + +# AM_OUTPUT_DEPENDENCY_COMMANDS +# ----------------------------- +# This macro should only be invoked once -- use via AC_REQUIRE. +# +# This code is only required when automatic dependency tracking is enabled. +# This creates each '.Po' and '.Plo' makefile fragment that we'll need in +# order to bootstrap the dependency handling code. +AC_DEFUN([AM_OUTPUT_DEPENDENCY_COMMANDS], +[AC_CONFIG_COMMANDS([depfiles], + [test x"$AMDEP_TRUE" != x"" || _AM_OUTPUT_DEPENDENCY_COMMANDS], + [AMDEP_TRUE="$AMDEP_TRUE" MAKE="${MAKE-make}"])]) + +# Do all the work for Automake. -*- Autoconf -*- + +# Copyright (C) 1996-2020 Free Software Foundation, Inc. +# +# This file is free software; the Free Software Foundation +# gives unlimited permission to copy and/or distribute it, +# with or without modifications, as long as this notice is preserved. + +# This macro actually does too much. Some checks are only needed if +# your package does certain things. But this isn't really a big deal. + +dnl Redefine AC_PROG_CC to automatically invoke _AM_PROG_CC_C_O. +m4_define([AC_PROG_CC], +m4_defn([AC_PROG_CC]) +[_AM_PROG_CC_C_O +]) + +# AM_INIT_AUTOMAKE(PACKAGE, VERSION, [NO-DEFINE]) +# AM_INIT_AUTOMAKE([OPTIONS]) +# ----------------------------------------------- +# The call with PACKAGE and VERSION arguments is the old style +# call (pre autoconf-2.50), which is being phased out. PACKAGE +# and VERSION should now be passed to AC_INIT and removed from +# the call to AM_INIT_AUTOMAKE. +# We support both call styles for the transition. After +# the next Automake release, Autoconf can make the AC_INIT +# arguments mandatory, and then we can depend on a new Autoconf +# release and drop the old call support. +AC_DEFUN([AM_INIT_AUTOMAKE], +[AC_PREREQ([2.65])dnl +dnl Autoconf wants to disallow AM_ names. We explicitly allow +dnl the ones we care about. +m4_pattern_allow([^AM_[A-Z]+FLAGS$])dnl +AC_REQUIRE([AM_SET_CURRENT_AUTOMAKE_VERSION])dnl +AC_REQUIRE([AC_PROG_INSTALL])dnl +if test "`cd $srcdir && pwd`" != "`pwd`"; then + # Use -I$(srcdir) only when $(srcdir) != ., so that make's output + # is not polluted with repeated "-I." + AC_SUBST([am__isrc], [' -I$(srcdir)'])_AM_SUBST_NOTMAKE([am__isrc])dnl + # test to see if srcdir already configured + if test -f $srcdir/config.status; then + AC_MSG_ERROR([source directory already configured; run "make distclean" there first]) + fi +fi + +# test whether we have cygpath +if test -z "$CYGPATH_W"; then + if (cygpath --version) >/dev/null 2>/dev/null; then + CYGPATH_W='cygpath -w' + else + CYGPATH_W=echo + fi +fi +AC_SUBST([CYGPATH_W]) + +# Define the identity of the package. +dnl Distinguish between old-style and new-style calls. +m4_ifval([$2], +[AC_DIAGNOSE([obsolete], + [$0: two- and three-arguments forms are deprecated.]) +m4_ifval([$3], [_AM_SET_OPTION([no-define])])dnl + AC_SUBST([PACKAGE], [$1])dnl + AC_SUBST([VERSION], [$2])], +[_AM_SET_OPTIONS([$1])dnl +dnl Diagnose old-style AC_INIT with new-style AM_AUTOMAKE_INIT. +m4_if( + m4_ifdef([AC_PACKAGE_NAME], [ok]):m4_ifdef([AC_PACKAGE_VERSION], [ok]), + [ok:ok],, + [m4_fatal([AC_INIT should be called with package and version arguments])])dnl + AC_SUBST([PACKAGE], ['AC_PACKAGE_TARNAME'])dnl + AC_SUBST([VERSION], ['AC_PACKAGE_VERSION'])])dnl + +_AM_IF_OPTION([no-define],, +[AC_DEFINE_UNQUOTED([PACKAGE], ["$PACKAGE"], [Name of package]) + AC_DEFINE_UNQUOTED([VERSION], ["$VERSION"], [Version number of package])])dnl + +# Some tools Automake needs. +AC_REQUIRE([AM_SANITY_CHECK])dnl +AC_REQUIRE([AC_ARG_PROGRAM])dnl +AM_MISSING_PROG([ACLOCAL], [aclocal-${am__api_version}]) +AM_MISSING_PROG([AUTOCONF], [autoconf]) +AM_MISSING_PROG([AUTOMAKE], [automake-${am__api_version}]) +AM_MISSING_PROG([AUTOHEADER], [autoheader]) +AM_MISSING_PROG([MAKEINFO], [makeinfo]) +AC_REQUIRE([AM_PROG_INSTALL_SH])dnl +AC_REQUIRE([AM_PROG_INSTALL_STRIP])dnl +AC_REQUIRE([AC_PROG_MKDIR_P])dnl +# For better backward compatibility. To be removed once Automake 1.9.x +# dies out for good. For more background, see: +# <https://lists.gnu.org/archive/html/automake/2012-07/msg00001.html> +# <https://lists.gnu.org/archive/html/automake/2012-07/msg00014.html> +AC_SUBST([mkdir_p], ['$(MKDIR_P)']) +# We need awk for the "check" target (and possibly the TAP driver). The +# system "awk" is bad on some platforms. +AC_REQUIRE([AC_PROG_AWK])dnl +AC_REQUIRE([AC_PROG_MAKE_SET])dnl +AC_REQUIRE([AM_SET_LEADING_DOT])dnl +_AM_IF_OPTION([tar-ustar], [_AM_PROG_TAR([ustar])], + [_AM_IF_OPTION([tar-pax], [_AM_PROG_TAR([pax])], + [_AM_PROG_TAR([v7])])]) +_AM_IF_OPTION([no-dependencies],, +[AC_PROVIDE_IFELSE([AC_PROG_CC], + [_AM_DEPENDENCIES([CC])], + [m4_define([AC_PROG_CC], + m4_defn([AC_PROG_CC])[_AM_DEPENDENCIES([CC])])])dnl +AC_PROVIDE_IFELSE([AC_PROG_CXX], + [_AM_DEPENDENCIES([CXX])], + [m4_define([AC_PROG_CXX], + m4_defn([AC_PROG_CXX])[_AM_DEPENDENCIES([CXX])])])dnl +AC_PROVIDE_IFELSE([AC_PROG_OBJC], + [_AM_DEPENDENCIES([OBJC])], + [m4_define([AC_PROG_OBJC], + m4_defn([AC_PROG_OBJC])[_AM_DEPENDENCIES([OBJC])])])dnl +AC_PROVIDE_IFELSE([AC_PROG_OBJCXX], + [_AM_DEPENDENCIES([OBJCXX])], + [m4_define([AC_PROG_OBJCXX], + m4_defn([AC_PROG_OBJCXX])[_AM_DEPENDENCIES([OBJCXX])])])dnl +]) +AC_REQUIRE([AM_SILENT_RULES])dnl +dnl The testsuite driver may need to know about EXEEXT, so add the +dnl 'am__EXEEXT' conditional if _AM_COMPILER_EXEEXT was seen. This +dnl macro is hooked onto _AC_COMPILER_EXEEXT early, see below. +AC_CONFIG_COMMANDS_PRE(dnl +[m4_provide_if([_AM_COMPILER_EXEEXT], + [AM_CONDITIONAL([am__EXEEXT], [test -n "$EXEEXT"])])])dnl + +# POSIX will say in a future version that running "rm -f" with no argument +# is OK; and we want to be able to make that assumption in our Makefile +# recipes. So use an aggressive probe to check that the usage we want is +# actually supported "in the wild" to an acceptable degree. +# See automake bug#10828. +# To make any issue more visible, cause the running configure to be aborted +# by default if the 'rm' program in use doesn't match our expectations; the +# user can still override this though. +if rm -f && rm -fr && rm -rf; then : OK; else + cat >&2 <<'END' +Oops! + +Your 'rm' program seems unable to run without file operands specified +on the command line, even when the '-f' option is present. This is contrary +to the behaviour of most rm programs out there, and not conforming with +the upcoming POSIX standard: <http://austingroupbugs.net/view.php?id=542> + +Please tell bug-automake@gnu.org about your system, including the value +of your $PATH and any error possibly output before this message. This +can help us improve future automake versions. + +END + if test x"$ACCEPT_INFERIOR_RM_PROGRAM" = x"yes"; then + echo 'Configuration will proceed anyway, since you have set the' >&2 + echo 'ACCEPT_INFERIOR_RM_PROGRAM variable to "yes"' >&2 + echo >&2 + else + cat >&2 <<'END' +Aborting the configuration process, to ensure you take notice of the issue. + +You can download and install GNU coreutils to get an 'rm' implementation +that behaves properly: <https://www.gnu.org/software/coreutils/>. + +If you want to complete the configuration process using your problematic +'rm' anyway, export the environment variable ACCEPT_INFERIOR_RM_PROGRAM +to "yes", and re-run configure. + +END + AC_MSG_ERROR([Your 'rm' program is bad, sorry.]) + fi +fi +dnl The trailing newline in this macro's definition is deliberate, for +dnl backward compatibility and to allow trailing 'dnl'-style comments +dnl after the AM_INIT_AUTOMAKE invocation. See automake bug#16841. +]) + +dnl Hook into '_AC_COMPILER_EXEEXT' early to learn its expansion. Do not +dnl add the conditional right here, as _AC_COMPILER_EXEEXT may be further +dnl mangled by Autoconf and run in a shell conditional statement. +m4_define([_AC_COMPILER_EXEEXT], +m4_defn([_AC_COMPILER_EXEEXT])[m4_provide([_AM_COMPILER_EXEEXT])]) + +# When config.status generates a header, we must update the stamp-h file. +# This file resides in the same directory as the config header +# that is generated. The stamp files are numbered to have different names. + +# Autoconf calls _AC_AM_CONFIG_HEADER_HOOK (when defined) in the +# loop where config.status creates the headers, so we can generate +# our stamp files there. +AC_DEFUN([_AC_AM_CONFIG_HEADER_HOOK], +[# Compute $1's index in $config_headers. +_am_arg=$1 +_am_stamp_count=1 +for _am_header in $config_headers :; do + case $_am_header in + $_am_arg | $_am_arg:* ) + break ;; + * ) + _am_stamp_count=`expr $_am_stamp_count + 1` ;; + esac +done +echo "timestamp for $_am_arg" >`AS_DIRNAME(["$_am_arg"])`/stamp-h[]$_am_stamp_count]) + +# Copyright (C) 2001-2020 Free Software Foundation, Inc. +# +# This file is free software; the Free Software Foundation +# gives unlimited permission to copy and/or distribute it, +# with or without modifications, as long as this notice is preserved. + +# AM_PROG_INSTALL_SH +# ------------------ +# Define $install_sh. +AC_DEFUN([AM_PROG_INSTALL_SH], +[AC_REQUIRE([AM_AUX_DIR_EXPAND])dnl +if test x"${install_sh+set}" != xset; then + case $am_aux_dir in + *\ * | *\ *) + install_sh="\${SHELL} '$am_aux_dir/install-sh'" ;; + *) + install_sh="\${SHELL} $am_aux_dir/install-sh" + esac +fi +AC_SUBST([install_sh])]) + +# Copyright (C) 2003-2020 Free Software Foundation, Inc. +# +# This file is free software; the Free Software Foundation +# gives unlimited permission to copy and/or distribute it, +# with or without modifications, as long as this notice is preserved. + +# Check whether the underlying file-system supports filenames +# with a leading dot. For instance MS-DOS doesn't. +AC_DEFUN([AM_SET_LEADING_DOT], +[rm -rf .tst 2>/dev/null +mkdir .tst 2>/dev/null +if test -d .tst; then + am__leading_dot=. +else + am__leading_dot=_ +fi +rmdir .tst 2>/dev/null +AC_SUBST([am__leading_dot])]) + +# Add --enable-maintainer-mode option to configure. -*- Autoconf -*- +# From Jim Meyering + +# Copyright (C) 1996-2020 Free Software Foundation, Inc. +# +# This file is free software; the Free Software Foundation +# gives unlimited permission to copy and/or distribute it, +# with or without modifications, as long as this notice is preserved. + +# AM_MAINTAINER_MODE([DEFAULT-MODE]) +# ---------------------------------- +# Control maintainer-specific portions of Makefiles. +# Default is to disable them, unless 'enable' is passed literally. +# For symmetry, 'disable' may be passed as well. Anyway, the user +# can override the default with the --enable/--disable switch. +AC_DEFUN([AM_MAINTAINER_MODE], +[m4_case(m4_default([$1], [disable]), + [enable], [m4_define([am_maintainer_other], [disable])], + [disable], [m4_define([am_maintainer_other], [enable])], + [m4_define([am_maintainer_other], [enable]) + m4_warn([syntax], [unexpected argument to AM@&t@_MAINTAINER_MODE: $1])]) +AC_MSG_CHECKING([whether to enable maintainer-specific portions of Makefiles]) + dnl maintainer-mode's default is 'disable' unless 'enable' is passed + AC_ARG_ENABLE([maintainer-mode], + [AS_HELP_STRING([--]am_maintainer_other[-maintainer-mode], + am_maintainer_other[ make rules and dependencies not useful + (and sometimes confusing) to the casual installer])], + [USE_MAINTAINER_MODE=$enableval], + [USE_MAINTAINER_MODE=]m4_if(am_maintainer_other, [enable], [no], [yes])) + AC_MSG_RESULT([$USE_MAINTAINER_MODE]) + AM_CONDITIONAL([MAINTAINER_MODE], [test $USE_MAINTAINER_MODE = yes]) + MAINT=$MAINTAINER_MODE_TRUE + AC_SUBST([MAINT])dnl +] +) + +# Check to see how 'make' treats includes. -*- Autoconf -*- + +# Copyright (C) 2001-2020 Free Software Foundation, Inc. +# +# This file is free software; the Free Software Foundation +# gives unlimited permission to copy and/or distribute it, +# with or without modifications, as long as this notice is preserved. + +# AM_MAKE_INCLUDE() +# ----------------- +# Check whether make has an 'include' directive that can support all +# the idioms we need for our automatic dependency tracking code. +AC_DEFUN([AM_MAKE_INCLUDE], +[AC_MSG_CHECKING([whether ${MAKE-make} supports the include directive]) +cat > confinc.mk << 'END' +am__doit: + @echo this is the am__doit target >confinc.out +.PHONY: am__doit +END +am__include="#" +am__quote= +# BSD make does it like this. +echo '.include "confinc.mk" # ignored' > confmf.BSD +# Other make implementations (GNU, Solaris 10, AIX) do it like this. +echo 'include confinc.mk # ignored' > confmf.GNU +_am_result=no +for s in GNU BSD; do + AM_RUN_LOG([${MAKE-make} -f confmf.$s && cat confinc.out]) + AS_CASE([$?:`cat confinc.out 2>/dev/null`], + ['0:this is the am__doit target'], + [AS_CASE([$s], + [BSD], [am__include='.include' am__quote='"'], + [am__include='include' am__quote=''])]) + if test "$am__include" != "#"; then + _am_result="yes ($s style)" + break + fi +done +rm -f confinc.* confmf.* +AC_MSG_RESULT([${_am_result}]) +AC_SUBST([am__include])]) +AC_SUBST([am__quote])]) + +# Fake the existence of programs that GNU maintainers use. -*- Autoconf -*- + +# Copyright (C) 1997-2020 Free Software Foundation, Inc. +# +# This file is free software; the Free Software Foundation +# gives unlimited permission to copy and/or distribute it, +# with or without modifications, as long as this notice is preserved. + +# AM_MISSING_PROG(NAME, PROGRAM) +# ------------------------------ +AC_DEFUN([AM_MISSING_PROG], +[AC_REQUIRE([AM_MISSING_HAS_RUN]) +$1=${$1-"${am_missing_run}$2"} +AC_SUBST($1)]) + +# AM_MISSING_HAS_RUN +# ------------------ +# Define MISSING if not defined so far and test if it is modern enough. +# If it is, set am_missing_run to use it, otherwise, to nothing. +AC_DEFUN([AM_MISSING_HAS_RUN], +[AC_REQUIRE([AM_AUX_DIR_EXPAND])dnl +AC_REQUIRE_AUX_FILE([missing])dnl +if test x"${MISSING+set}" != xset; then + MISSING="\${SHELL} '$am_aux_dir/missing'" +fi +# Use eval to expand $SHELL +if eval "$MISSING --is-lightweight"; then + am_missing_run="$MISSING " +else + am_missing_run= + AC_MSG_WARN(['missing' script is too old or missing]) +fi +]) + +# Helper functions for option handling. -*- Autoconf -*- + +# Copyright (C) 2001-2020 Free Software Foundation, Inc. +# +# This file is free software; the Free Software Foundation +# gives unlimited permission to copy and/or distribute it, +# with or without modifications, as long as this notice is preserved. + +# _AM_MANGLE_OPTION(NAME) +# ----------------------- +AC_DEFUN([_AM_MANGLE_OPTION], +[[_AM_OPTION_]m4_bpatsubst($1, [[^a-zA-Z0-9_]], [_])]) + +# _AM_SET_OPTION(NAME) +# -------------------- +# Set option NAME. Presently that only means defining a flag for this option. +AC_DEFUN([_AM_SET_OPTION], +[m4_define(_AM_MANGLE_OPTION([$1]), [1])]) + +# _AM_SET_OPTIONS(OPTIONS) +# ------------------------ +# OPTIONS is a space-separated list of Automake options. +AC_DEFUN([_AM_SET_OPTIONS], +[m4_foreach_w([_AM_Option], [$1], [_AM_SET_OPTION(_AM_Option)])]) + +# _AM_IF_OPTION(OPTION, IF-SET, [IF-NOT-SET]) +# ------------------------------------------- +# Execute IF-SET if OPTION is set, IF-NOT-SET otherwise. +AC_DEFUN([_AM_IF_OPTION], +[m4_ifset(_AM_MANGLE_OPTION([$1]), [$2], [$3])]) + +# Copyright (C) 1999-2020 Free Software Foundation, Inc. +# +# This file is free software; the Free Software Foundation +# gives unlimited permission to copy and/or distribute it, +# with or without modifications, as long as this notice is preserved. + +# _AM_PROG_CC_C_O +# --------------- +# Like AC_PROG_CC_C_O, but changed for automake. We rewrite AC_PROG_CC +# to automatically call this. +AC_DEFUN([_AM_PROG_CC_C_O], +[AC_REQUIRE([AM_AUX_DIR_EXPAND])dnl +AC_REQUIRE_AUX_FILE([compile])dnl +AC_LANG_PUSH([C])dnl +AC_CACHE_CHECK( + [whether $CC understands -c and -o together], + [am_cv_prog_cc_c_o], + [AC_LANG_CONFTEST([AC_LANG_PROGRAM([])]) + # Make sure it works both with $CC and with simple cc. + # Following AC_PROG_CC_C_O, we do the test twice because some + # compilers refuse to overwrite an existing .o file with -o, + # though they will create one. + am_cv_prog_cc_c_o=yes + for am_i in 1 2; do + if AM_RUN_LOG([$CC -c conftest.$ac_ext -o conftest2.$ac_objext]) \ + && test -f conftest2.$ac_objext; then + : OK + else + am_cv_prog_cc_c_o=no + break + fi + done + rm -f core conftest* + unset am_i]) +if test "$am_cv_prog_cc_c_o" != yes; then + # Losing compiler, so override with the script. + # FIXME: It is wrong to rewrite CC. + # But if we don't then we get into trouble of one sort or another. + # A longer-term fix would be to have automake use am__CC in this case, + # and then we could set am__CC="\$(top_srcdir)/compile \$(CC)" + CC="$am_aux_dir/compile $CC" +fi +AC_LANG_POP([C])]) + +# For backward compatibility. +AC_DEFUN_ONCE([AM_PROG_CC_C_O], [AC_REQUIRE([AC_PROG_CC])]) + +# Copyright (C) 2001-2020 Free Software Foundation, Inc. +# +# This file is free software; the Free Software Foundation +# gives unlimited permission to copy and/or distribute it, +# with or without modifications, as long as this notice is preserved. + +# AM_RUN_LOG(COMMAND) +# ------------------- +# Run COMMAND, save the exit status in ac_status, and log it. +# (This has been adapted from Autoconf's _AC_RUN_LOG macro.) +AC_DEFUN([AM_RUN_LOG], +[{ echo "$as_me:$LINENO: $1" >&AS_MESSAGE_LOG_FD + ($1) >&AS_MESSAGE_LOG_FD 2>&AS_MESSAGE_LOG_FD + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&AS_MESSAGE_LOG_FD + (exit $ac_status); }]) + +# Check to make sure that the build environment is sane. -*- Autoconf -*- + +# Copyright (C) 1996-2020 Free Software Foundation, Inc. +# +# This file is free software; the Free Software Foundation +# gives unlimited permission to copy and/or distribute it, +# with or without modifications, as long as this notice is preserved. + +# AM_SANITY_CHECK +# --------------- +AC_DEFUN([AM_SANITY_CHECK], +[AC_MSG_CHECKING([whether build environment is sane]) +# Reject unsafe characters in $srcdir or the absolute working directory +# name. Accept space and tab only in the latter. +am_lf=' +' +case `pwd` in + *[[\\\"\#\$\&\'\`$am_lf]]*) + AC_MSG_ERROR([unsafe absolute working directory name]);; +esac +case $srcdir in + *[[\\\"\#\$\&\'\`$am_lf\ \ ]]*) + AC_MSG_ERROR([unsafe srcdir value: '$srcdir']);; +esac + +# Do 'set' in a subshell so we don't clobber the current shell's +# arguments. Must try -L first in case configure is actually a +# symlink; some systems play weird games with the mod time of symlinks +# (eg FreeBSD returns the mod time of the symlink's containing +# directory). +if ( + am_has_slept=no + for am_try in 1 2; do + echo "timestamp, slept: $am_has_slept" > conftest.file + set X `ls -Lt "$srcdir/configure" conftest.file 2> /dev/null` + if test "$[*]" = "X"; then + # -L didn't work. + set X `ls -t "$srcdir/configure" conftest.file` + fi + if test "$[*]" != "X $srcdir/configure conftest.file" \ + && test "$[*]" != "X conftest.file $srcdir/configure"; then + + # If neither matched, then we have a broken ls. This can happen + # if, for instance, CONFIG_SHELL is bash and it inherits a + # broken ls alias from the environment. This has actually + # happened. Such a system could not be considered "sane". + AC_MSG_ERROR([ls -t appears to fail. Make sure there is not a broken + alias in your environment]) + fi + if test "$[2]" = conftest.file || test $am_try -eq 2; then + break + fi + # Just in case. + sleep 1 + am_has_slept=yes + done + test "$[2]" = conftest.file + ) +then + # Ok. + : +else + AC_MSG_ERROR([newly created file is older than distributed files! +Check your system clock]) +fi +AC_MSG_RESULT([yes]) +# If we didn't sleep, we still need to ensure time stamps of config.status and +# generated files are strictly newer. +am_sleep_pid= +if grep 'slept: no' conftest.file >/dev/null 2>&1; then + ( sleep 1 ) & + am_sleep_pid=$! +fi +AC_CONFIG_COMMANDS_PRE( + [AC_MSG_CHECKING([that generated files are newer than configure]) + if test -n "$am_sleep_pid"; then + # Hide warnings about reused PIDs. + wait $am_sleep_pid 2>/dev/null + fi + AC_MSG_RESULT([done])]) +rm -f conftest.file +]) + +# Copyright (C) 2009-2020 Free Software Foundation, Inc. +# +# This file is free software; the Free Software Foundation +# gives unlimited permission to copy and/or distribute it, +# with or without modifications, as long as this notice is preserved. + +# AM_SILENT_RULES([DEFAULT]) +# -------------------------- +# Enable less verbose build rules; with the default set to DEFAULT +# ("yes" being less verbose, "no" or empty being verbose). +AC_DEFUN([AM_SILENT_RULES], +[AC_ARG_ENABLE([silent-rules], [dnl +AS_HELP_STRING( + [--enable-silent-rules], + [less verbose build output (undo: "make V=1")]) +AS_HELP_STRING( + [--disable-silent-rules], + [verbose build output (undo: "make V=0")])dnl +]) +case $enable_silent_rules in @%:@ ((( + yes) AM_DEFAULT_VERBOSITY=0;; + no) AM_DEFAULT_VERBOSITY=1;; + *) AM_DEFAULT_VERBOSITY=m4_if([$1], [yes], [0], [1]);; +esac +dnl +dnl A few 'make' implementations (e.g., NonStop OS and NextStep) +dnl do not support nested variable expansions. +dnl See automake bug#9928 and bug#10237. +am_make=${MAKE-make} +AC_CACHE_CHECK([whether $am_make supports nested variables], + [am_cv_make_support_nested_variables], + [if AS_ECHO([['TRUE=$(BAR$(V)) +BAR0=false +BAR1=true +V=1 +am__doit: + @$(TRUE) +.PHONY: am__doit']]) | $am_make -f - >/dev/null 2>&1; then + am_cv_make_support_nested_variables=yes +else + am_cv_make_support_nested_variables=no +fi]) +if test $am_cv_make_support_nested_variables = yes; then + dnl Using '$V' instead of '$(V)' breaks IRIX make. + AM_V='$(V)' + AM_DEFAULT_V='$(AM_DEFAULT_VERBOSITY)' +else + AM_V=$AM_DEFAULT_VERBOSITY + AM_DEFAULT_V=$AM_DEFAULT_VERBOSITY +fi +AC_SUBST([AM_V])dnl +AM_SUBST_NOTMAKE([AM_V])dnl +AC_SUBST([AM_DEFAULT_V])dnl +AM_SUBST_NOTMAKE([AM_DEFAULT_V])dnl +AC_SUBST([AM_DEFAULT_VERBOSITY])dnl +AM_BACKSLASH='\' +AC_SUBST([AM_BACKSLASH])dnl +_AM_SUBST_NOTMAKE([AM_BACKSLASH])dnl +]) + +# Copyright (C) 2001-2020 Free Software Foundation, Inc. +# +# This file is free software; the Free Software Foundation +# gives unlimited permission to copy and/or distribute it, +# with or without modifications, as long as this notice is preserved. + +# AM_PROG_INSTALL_STRIP +# --------------------- +# One issue with vendor 'install' (even GNU) is that you can't +# specify the program used to strip binaries. This is especially +# annoying in cross-compiling environments, where the build's strip +# is unlikely to handle the host's binaries. +# Fortunately install-sh will honor a STRIPPROG variable, so we +# always use install-sh in "make install-strip", and initialize +# STRIPPROG with the value of the STRIP variable (set by the user). +AC_DEFUN([AM_PROG_INSTALL_STRIP], +[AC_REQUIRE([AM_PROG_INSTALL_SH])dnl +# Installed binaries are usually stripped using 'strip' when the user +# run "make install-strip". However 'strip' might not be the right +# tool to use in cross-compilation environments, therefore Automake +# will honor the 'STRIP' environment variable to overrule this program. +dnl Don't test for $cross_compiling = yes, because it might be 'maybe'. +if test "$cross_compiling" != no; then + AC_CHECK_TOOL([STRIP], [strip], :) +fi +INSTALL_STRIP_PROGRAM="\$(install_sh) -c -s" +AC_SUBST([INSTALL_STRIP_PROGRAM])]) + +# Copyright (C) 2006-2020 Free Software Foundation, Inc. +# +# This file is free software; the Free Software Foundation +# gives unlimited permission to copy and/or distribute it, +# with or without modifications, as long as this notice is preserved. + +# _AM_SUBST_NOTMAKE(VARIABLE) +# --------------------------- +# Prevent Automake from outputting VARIABLE = @VARIABLE@ in Makefile.in. +# This macro is traced by Automake. +AC_DEFUN([_AM_SUBST_NOTMAKE]) + +# AM_SUBST_NOTMAKE(VARIABLE) +# -------------------------- +# Public sister of _AM_SUBST_NOTMAKE. +AC_DEFUN([AM_SUBST_NOTMAKE], [_AM_SUBST_NOTMAKE($@)]) + +# Check how to create a tarball. -*- Autoconf -*- + +# Copyright (C) 2004-2020 Free Software Foundation, Inc. +# +# This file is free software; the Free Software Foundation +# gives unlimited permission to copy and/or distribute it, +# with or without modifications, as long as this notice is preserved. + +# _AM_PROG_TAR(FORMAT) +# -------------------- +# Check how to create a tarball in format FORMAT. +# FORMAT should be one of 'v7', 'ustar', or 'pax'. +# +# Substitute a variable $(am__tar) that is a command +# writing to stdout a FORMAT-tarball containing the directory +# $tardir. +# tardir=directory && $(am__tar) > result.tar +# +# Substitute a variable $(am__untar) that extract such +# a tarball read from stdin. +# $(am__untar) < result.tar +# +AC_DEFUN([_AM_PROG_TAR], +[# Always define AMTAR for backward compatibility. Yes, it's still used +# in the wild :-( We should find a proper way to deprecate it ... +AC_SUBST([AMTAR], ['$${TAR-tar}']) + +# We'll loop over all known methods to create a tar archive until one works. +_am_tools='gnutar m4_if([$1], [ustar], [plaintar]) pax cpio none' + +m4_if([$1], [v7], + [am__tar='$${TAR-tar} chof - "$$tardir"' am__untar='$${TAR-tar} xf -'], + + [m4_case([$1], + [ustar], + [# The POSIX 1988 'ustar' format is defined with fixed-size fields. + # There is notably a 21 bits limit for the UID and the GID. In fact, + # the 'pax' utility can hang on bigger UID/GID (see automake bug#8343 + # and bug#13588). + am_max_uid=2097151 # 2^21 - 1 + am_max_gid=$am_max_uid + # The $UID and $GID variables are not portable, so we need to resort + # to the POSIX-mandated id(1) utility. Errors in the 'id' calls + # below are definitely unexpected, so allow the users to see them + # (that is, avoid stderr redirection). + am_uid=`id -u || echo unknown` + am_gid=`id -g || echo unknown` + AC_MSG_CHECKING([whether UID '$am_uid' is supported by ustar format]) + if test $am_uid -le $am_max_uid; then + AC_MSG_RESULT([yes]) + else + AC_MSG_RESULT([no]) + _am_tools=none + fi + AC_MSG_CHECKING([whether GID '$am_gid' is supported by ustar format]) + if test $am_gid -le $am_max_gid; then + AC_MSG_RESULT([yes]) + else + AC_MSG_RESULT([no]) + _am_tools=none + fi], + + [pax], + [], + + [m4_fatal([Unknown tar format])]) + + AC_MSG_CHECKING([how to create a $1 tar archive]) + + # Go ahead even if we have the value already cached. We do so because we + # need to set the values for the 'am__tar' and 'am__untar' variables. + _am_tools=${am_cv_prog_tar_$1-$_am_tools} + + for _am_tool in $_am_tools; do + case $_am_tool in + gnutar) + for _am_tar in tar gnutar gtar; do + AM_RUN_LOG([$_am_tar --version]) && break + done + am__tar="$_am_tar --format=m4_if([$1], [pax], [posix], [$1]) -chf - "'"$$tardir"' + am__tar_="$_am_tar --format=m4_if([$1], [pax], [posix], [$1]) -chf - "'"$tardir"' + am__untar="$_am_tar -xf -" + ;; + plaintar) + # Must skip GNU tar: if it does not support --format= it doesn't create + # ustar tarball either. + (tar --version) >/dev/null 2>&1 && continue + am__tar='tar chf - "$$tardir"' + am__tar_='tar chf - "$tardir"' + am__untar='tar xf -' + ;; + pax) + am__tar='pax -L -x $1 -w "$$tardir"' + am__tar_='pax -L -x $1 -w "$tardir"' + am__untar='pax -r' + ;; + cpio) + am__tar='find "$$tardir" -print | cpio -o -H $1 -L' + am__tar_='find "$tardir" -print | cpio -o -H $1 -L' + am__untar='cpio -i -H $1 -d' + ;; + none) + am__tar=false + am__tar_=false + am__untar=false + ;; + esac + + # If the value was cached, stop now. We just wanted to have am__tar + # and am__untar set. + test -n "${am_cv_prog_tar_$1}" && break + + # tar/untar a dummy directory, and stop if the command works. + rm -rf conftest.dir + mkdir conftest.dir + echo GrepMe > conftest.dir/file + AM_RUN_LOG([tardir=conftest.dir && eval $am__tar_ >conftest.tar]) + rm -rf conftest.dir + if test -s conftest.tar; then + AM_RUN_LOG([$am__untar <conftest.tar]) + AM_RUN_LOG([cat conftest.dir/file]) + grep GrepMe conftest.dir/file >/dev/null 2>&1 && break + fi + done + rm -rf conftest.dir + + AC_CACHE_VAL([am_cv_prog_tar_$1], [am_cv_prog_tar_$1=$_am_tool]) + AC_MSG_RESULT([$am_cv_prog_tar_$1])]) + +AC_SUBST([am__tar]) +AC_SUBST([am__untar]) +]) # _AM_PROG_TAR + +m4_include([m4/gs-device.m4]) +m4_include([m4/makeinfo.m4]) +m4_include([../../m4/kpse-common.m4]) +m4_include([../../m4/kpse-freetype2-flags.m4]) +m4_include([../../m4/kpse-gd-flags.m4]) +m4_include([../../m4/kpse-kpathsea-flags.m4]) +m4_include([../../m4/kpse-libpng-flags.m4]) +m4_include([../../m4/kpse-warnings.m4]) +m4_include([../../m4/kpse-win32.m4]) +m4_include([../../m4/kpse-zlib-flags.m4]) +m4_include([../../m4/libtool.m4]) +m4_include([../../m4/ltoptions.m4]) +m4_include([../../m4/ltsugar.m4]) +m4_include([../../m4/ltversion.m4]) +m4_include([../../m4/lt~obsolete.m4]) diff --git a/Build/source/texk/dvipng/config.h.in b/Build/source/texk/dvipng/config.h.in new file mode 100644 index 00000000000..a88b7fbb5aa --- /dev/null +++ b/Build/source/texk/dvipng/config.h.in @@ -0,0 +1,287 @@ +/* config.h.in. Generated from configure.ac by autoheader. */ + +/* Define to 1 if the `closedir' function returns void instead of `int'. */ +#undef CLOSEDIR_VOID + +/* Define as 1 to get the debug (-d) option. */ +#undef DEBUG + +/* Define as the path to GhostScript. */ +#undef GS_PATH + +/* Define to 1 if you have the <assert.h> header file. */ +#undef HAVE_ASSERT_H + +/* Define to 1 if you have the declaration of `isascii', and to 0 if you + don't. */ +#undef HAVE_DECL_ISASCII + +/* Define to 1 if you have the <dirent.h> header file, and it defines `DIR'. + */ +#undef HAVE_DIRENT_H + +/* Define to 1 if you have the <dlfcn.h> header file. */ +#undef HAVE_DLFCN_H + +/* Define to 1 if you don't have `vprintf' but do have `_doprnt.' */ +#undef HAVE_DOPRNT + +/* Define to 1 if you have the `dup2' function. */ +#undef HAVE_DUP2 + +/* Define to 1 if you have the <fcntl.h> header file. */ +#undef HAVE_FCNTL_H + +/* Define to 1 if you have the <float.h> header file. */ +#undef HAVE_FLOAT_H + +/* Define to 1 if fseeko (and presumably ftello) exists and is declared. */ +#undef HAVE_FSEEKO + +/* Define to 1 if you have freetype2. */ +#undef HAVE_FT2 + +/* Define to 1 if you have the `ftime' function. */ +#undef HAVE_FTIME + +/* Define to 1 if you have the `FT_Library_Version' function. */ +#undef HAVE_FT_LIBRARY_VERSION + +/* Define to 1 if you have the `gdImageCreateFromJpeg' function. */ +#undef HAVE_GDIMAGECREATEFROMJPEG + +/* Define to 1 if you have the `gdImageCreateFromPngPtr' function. */ +#undef HAVE_GDIMAGECREATEFROMPNGPTR + +/* Define to 1 if you have the `gdImageCreateTrueColor' function. */ +#undef HAVE_GDIMAGECREATETRUECOLOR + +/* Define to 1 if you have the `gdImageGif' function. */ +#undef HAVE_GDIMAGEGIF + +/* Define to 1 if you have the `gdImagePngEx' function. */ +#undef HAVE_GDIMAGEPNGEX + +/* Define to 1 if you have the <gd.h> header file. */ +#undef HAVE_GD_H + +/* Define to 1 if you have the `getcwd' function. */ +#undef HAVE_GETCWD + +/* Define to 1 if you have the `getpagesize' function. */ +#undef HAVE_GETPAGESIZE + +/* Define to 1 if you have the `gettimeofday' function. */ +#undef HAVE_GETTIMEOFDAY + +/* Define to 1 if you have the `getwd' function. */ +#undef HAVE_GETWD + +/* Define to 1 if you have the <inttypes.h> header file. */ +#undef HAVE_INTTYPES_H + +/* Define to 1 if you have the <kpathsea/kpathsea.h> header file. */ +#undef HAVE_KPATHSEA_KPATHSEA_H + +/* Define to 1 if your kpathsea has kpse_enc_format. */ +#undef HAVE_KPSE_ENC_FORMATS + +/* Define to 1 if you have the `kpse_program_basename' function. */ +#undef HAVE_KPSE_PROGRAM_BASENAME + +/* Define to 1 if you have the `gd' library (-lgd). */ +#undef HAVE_LIBGD + +/* Define to 1 if you have the `kpathsea' library (-lkpathsea). */ +#undef HAVE_LIBKPATHSEA + +/* Define to 1 if you have the `png' library (-lpng). */ +#undef HAVE_LIBPNG + +/* Define to 1 if you have the `z' library (-lz). */ +#undef HAVE_LIBZ + +/* Define to 1 if you have the <limits.h> header file. */ +#undef HAVE_LIMITS_H + +/* Define to 1 if you have the `memcmp' function. */ +#undef HAVE_MEMCMP + +/* Define to 1 if you have the `memcpy' function. */ +#undef HAVE_MEMCPY + +/* Define to 1 if you have the <memory.h> header file. */ +#undef HAVE_MEMORY_H + +/* Define to 1 if you have the `memset' function. */ +#undef HAVE_MEMSET + +/* Define to 1 if you have the `mkstemp' function. */ +#undef HAVE_MKSTEMP + +/* Define to 1 if you have the `mktemp' function. */ +#undef HAVE_MKTEMP + +/* Define to 1 if you have a working `mmap' system call. */ +#undef HAVE_MMAP + +/* Define to 1 if you have the `munmap' function. */ +#undef HAVE_MUNMAP + +/* Define to 1 if you have the <ndir.h> header file, and it defines `DIR'. */ +#undef HAVE_NDIR_H + +/* Define to 1 if you have the <png.h> header file. */ +#undef HAVE_PNG_H + +/* Define to 1 if you have the `pow' function. */ +#undef HAVE_POW + +/* Define to 1 if you have the `putenv' function. */ +#undef HAVE_PUTENV + +/* Define to 1 if you have the <pwd.h> header file. */ +#undef HAVE_PWD_H + +/* Define to 1 if stdbool.h conforms to C99. */ +#undef HAVE_STDBOOL_H + +/* Define to 1 if you have the <stdint.h> header file. */ +#undef HAVE_STDINT_H + +/* Define to 1 if you have the <stdlib.h> header file. */ +#undef HAVE_STDLIB_H + +/* Define to 1 if you have the `strchr' function. */ +#undef HAVE_STRCHR + +/* Define to 1 if you have the <strings.h> header file. */ +#undef HAVE_STRINGS_H + +/* Define to 1 if you have the <string.h> header file. */ +#undef HAVE_STRING_H + +/* Define to 1 if you have the `strrchr' function. */ +#undef HAVE_STRRCHR + +/* Define to 1 if `st_mtim' is a member of `struct stat'. */ +#undef HAVE_STRUCT_STAT_ST_MTIM + +/* Define to 1 if you have the <sys/dir.h> header file, and it defines `DIR'. + */ +#undef HAVE_SYS_DIR_H + +/* Define to 1 if you have the <sys/ndir.h> header file, and it defines `DIR'. + */ +#undef HAVE_SYS_NDIR_H + +/* Define to 1 if you have the <sys/param.h> header file. */ +#undef HAVE_SYS_PARAM_H + +/* Define to 1 if you have the <sys/stat.h> header file. */ +#undef HAVE_SYS_STAT_H + +/* Define to 1 if you have the <sys/time.h> header file. */ +#undef HAVE_SYS_TIME_H + +/* Define to 1 if you have the <sys/types.h> header file. */ +#undef HAVE_SYS_TYPES_H + +/* Define to 1 if you have <sys/wait.h> that is POSIX.1 compatible. */ +#undef HAVE_SYS_WAIT_H + +/* Define to 1 if you have the `texlive_gs_init' function. */ +#undef HAVE_TEXLIVE_GS_INIT + +/* Define to 1 if you have the <unistd.h> header file. */ +#undef HAVE_UNISTD_H + +/* Define to 1 if you have the `vprintf' function. */ +#undef HAVE_VPRINTF + +/* Define to 1 if the system has the type `_Bool'. */ +#undef HAVE__BOOL + +/* Define to the sub-directory where libtool stores uninstalled libraries. */ +#undef LT_OBJDIR + +/* Name of package */ +#undef PACKAGE + +/* Define to the address where bug reports for this package should be sent. */ +#undef PACKAGE_BUGREPORT + +/* Define to the full name of this package. */ +#undef PACKAGE_NAME + +/* Define to the full name and version of this package. */ +#undef PACKAGE_STRING + +/* Define to the one symbol short name of this package. */ +#undef PACKAGE_TARNAME + +/* Define to the home page for this package. */ +#undef PACKAGE_URL + +/* Define to the version of this package. */ +#undef PACKAGE_VERSION + +/* Define to 1 if you have the ANSI C header files. */ +#undef STDC_HEADERS + +/* Define to 1 if you can safely include both <sys/time.h> and <time.h>. */ +#undef TIME_WITH_SYS_TIME + +/* Define as 1 to get execution time output. */ +#undef TIMING + +/* Version number of package */ +#undef VERSION + +/* Define to 1 if <zlib.h> declares 'z_const'. */ +#undef ZLIB_CONST + +/* Enable large inode numbers on Mac OS X 10.5. */ +#ifndef _DARWIN_USE_64_BIT_INODE +# define _DARWIN_USE_64_BIT_INODE 1 +#endif + +/* Number of bits in a file offset, on hosts where this is settable. */ +#undef _FILE_OFFSET_BITS + +/* Define to 1 to make fseeko visible on some hosts (e.g. glibc 2.2). */ +#undef _LARGEFILE_SOURCE + +/* Define for large files, on AIX-style hosts. */ +#undef _LARGE_FILES + +/* Define for Solaris 2.5.1 so the uint64_t typedef from <sys/synch.h>, + <pthread.h>, or <semaphore.h> is not used. If the typedef were allowed, the + #define below would cause a syntax error. */ +#undef _UINT64_T + +/* Define to empty if `const' does not conform to ANSI C. */ +#undef const + +/* Define to `__inline__' or `__inline' if that's what the C compiler + calls it, or to nothing if 'inline' is not supported under any name. */ +#ifndef __cplusplus +#undef inline +#endif + +/* Define to the type of a signed integer type of width exactly 64 bits if + such a type exists and the standard includes do not define it. */ +#undef int64_t + +/* Define to `int' if <sys/types.h> does not define. */ +#undef pid_t + +/* Define to `unsigned int' if <sys/types.h> does not define. */ +#undef size_t + +/* Define to the type of an unsigned integer type of width exactly 64 bits if + such a type exists and the standard includes do not define it. */ +#undef uint64_t + +/* Define as empty if not declared in <zlib.h>. */ +#undef z_const diff --git a/Build/source/texk/dvipng/configure b/Build/source/texk/dvipng/configure new file mode 100755 index 00000000000..ddad28ab3e0 --- /dev/null +++ b/Build/source/texk/dvipng/configure @@ -0,0 +1,19151 @@ +#! /bin/sh +# Guess values for system-dependent variables and create Makefiles. +# Generated by GNU Autoconf 2.69 for dvipng (TeX Live) 1.17. +# +# Report bugs to <tex-k@tug.org>. +# +# +# Copyright (C) 1992-1996, 1998-2012 Free Software Foundation, Inc. +# +# +# This configure script is free software; the Free Software Foundation +# gives unlimited permission to copy, distribute and modify it. +## -------------------- ## +## M4sh Initialization. ## +## -------------------- ## + +# Be more Bourne compatible +DUALCASE=1; export DUALCASE # for MKS sh +if test -n "${ZSH_VERSION+set}" && (emulate sh) >/dev/null 2>&1; then : + emulate sh + NULLCMD=: + # Pre-4.2 versions of Zsh do word splitting on ${1+"$@"}, which + # is contrary to our usage. Disable this feature. + alias -g '${1+"$@"}'='"$@"' + setopt NO_GLOB_SUBST +else + case `(set -o) 2>/dev/null` in #( + *posix*) : + set -o posix ;; #( + *) : + ;; +esac +fi + + +as_nl=' +' +export as_nl +# Printing a long string crashes Solaris 7 /usr/bin/printf. +as_echo='\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\' +as_echo=$as_echo$as_echo$as_echo$as_echo$as_echo +as_echo=$as_echo$as_echo$as_echo$as_echo$as_echo$as_echo +# Prefer a ksh shell builtin over an external printf program on Solaris, +# but without wasting forks for bash or zsh. +if test -z "$BASH_VERSION$ZSH_VERSION" \ + && (test "X`print -r -- $as_echo`" = "X$as_echo") 2>/dev/null; then + as_echo='print -r --' + as_echo_n='print -rn --' +elif (test "X`printf %s $as_echo`" = "X$as_echo") 2>/dev/null; then + as_echo='printf %s\n' + as_echo_n='printf %s' +else + if test "X`(/usr/ucb/echo -n -n $as_echo) 2>/dev/null`" = "X-n $as_echo"; then + as_echo_body='eval /usr/ucb/echo -n "$1$as_nl"' + as_echo_n='/usr/ucb/echo -n' + else + as_echo_body='eval expr "X$1" : "X\\(.*\\)"' + as_echo_n_body='eval + arg=$1; + case $arg in #( + *"$as_nl"*) + expr "X$arg" : "X\\(.*\\)$as_nl"; + arg=`expr "X$arg" : ".*$as_nl\\(.*\\)"`;; + esac; + expr "X$arg" : "X\\(.*\\)" | tr -d "$as_nl" + ' + export as_echo_n_body + as_echo_n='sh -c $as_echo_n_body as_echo' + fi + export as_echo_body + as_echo='sh -c $as_echo_body as_echo' +fi + +# The user is always right. +if test "${PATH_SEPARATOR+set}" != set; then + PATH_SEPARATOR=: + (PATH='/bin;/bin'; FPATH=$PATH; sh -c :) >/dev/null 2>&1 && { + (PATH='/bin:/bin'; FPATH=$PATH; sh -c :) >/dev/null 2>&1 || + PATH_SEPARATOR=';' + } +fi + + +# IFS +# We need space, tab and new line, in precisely that order. Quoting is +# there to prevent editors from complaining about space-tab. +# (If _AS_PATH_WALK were called with IFS unset, it would disable word +# splitting by setting IFS to empty value.) +IFS=" "" $as_nl" + +# Find who we are. Look in the path if we contain no directory separator. +as_myself= +case $0 in #(( + *[\\/]* ) as_myself=$0 ;; + *) as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in $PATH +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + test -r "$as_dir/$0" && as_myself=$as_dir/$0 && break + done +IFS=$as_save_IFS + + ;; +esac +# We did not find ourselves, most probably we were run as `sh COMMAND' +# in which case we are not to be found in the path. +if test "x$as_myself" = x; then + as_myself=$0 +fi +if test ! -f "$as_myself"; then + $as_echo "$as_myself: error: cannot find myself; rerun with an absolute file name" >&2 + exit 1 +fi + +# Unset variables that we do not need and which cause bugs (e.g. in +# pre-3.0 UWIN ksh). But do not cause bugs in bash 2.01; the "|| exit 1" +# suppresses any "Segmentation fault" message there. '((' could +# trigger a bug in pdksh 5.2.14. +for as_var in BASH_ENV ENV MAIL MAILPATH +do eval test x\${$as_var+set} = xset \ + && ( (unset $as_var) || exit 1) >/dev/null 2>&1 && unset $as_var || : +done +PS1='$ ' +PS2='> ' +PS4='+ ' + +# NLS nuisances. +LC_ALL=C +export LC_ALL +LANGUAGE=C +export LANGUAGE + +# CDPATH. +(unset CDPATH) >/dev/null 2>&1 && unset CDPATH + +# Use a proper internal environment variable to ensure we don't fall + # into an infinite loop, continuously re-executing ourselves. + if test x"${_as_can_reexec}" != xno && test "x$CONFIG_SHELL" != x; then + _as_can_reexec=no; export _as_can_reexec; + # We cannot yet assume a decent shell, so we have to provide a +# neutralization value for shells without unset; and this also +# works around shells that cannot unset nonexistent variables. +# Preserve -v and -x to the replacement shell. +BASH_ENV=/dev/null +ENV=/dev/null +(unset BASH_ENV) >/dev/null 2>&1 && unset BASH_ENV ENV +case $- in # (((( + *v*x* | *x*v* ) as_opts=-vx ;; + *v* ) as_opts=-v ;; + *x* ) as_opts=-x ;; + * ) as_opts= ;; +esac +exec $CONFIG_SHELL $as_opts "$as_myself" ${1+"$@"} +# Admittedly, this is quite paranoid, since all the known shells bail +# out after a failed `exec'. +$as_echo "$0: could not re-execute with $CONFIG_SHELL" >&2 +as_fn_exit 255 + fi + # We don't want this to propagate to other subprocesses. + { _as_can_reexec=; unset _as_can_reexec;} +if test "x$CONFIG_SHELL" = x; then + as_bourne_compatible="if test -n \"\${ZSH_VERSION+set}\" && (emulate sh) >/dev/null 2>&1; then : + emulate sh + NULLCMD=: + # Pre-4.2 versions of Zsh do word splitting on \${1+\"\$@\"}, which + # is contrary to our usage. Disable this feature. + alias -g '\${1+\"\$@\"}'='\"\$@\"' + setopt NO_GLOB_SUBST +else + case \`(set -o) 2>/dev/null\` in #( + *posix*) : + set -o posix ;; #( + *) : + ;; +esac +fi +" + as_required="as_fn_return () { (exit \$1); } +as_fn_success () { as_fn_return 0; } +as_fn_failure () { as_fn_return 1; } +as_fn_ret_success () { return 0; } +as_fn_ret_failure () { return 1; } + +exitcode=0 +as_fn_success || { exitcode=1; echo as_fn_success failed.; } +as_fn_failure && { exitcode=1; echo as_fn_failure succeeded.; } +as_fn_ret_success || { exitcode=1; echo as_fn_ret_success failed.; } +as_fn_ret_failure && { exitcode=1; echo as_fn_ret_failure succeeded.; } +if ( set x; as_fn_ret_success y && test x = \"\$1\" ); then : + +else + exitcode=1; echo positional parameters were not saved. +fi +test x\$exitcode = x0 || exit 1 +test -x / || exit 1" + as_suggested=" as_lineno_1=";as_suggested=$as_suggested$LINENO;as_suggested=$as_suggested" as_lineno_1a=\$LINENO + as_lineno_2=";as_suggested=$as_suggested$LINENO;as_suggested=$as_suggested" as_lineno_2a=\$LINENO + eval 'test \"x\$as_lineno_1'\$as_run'\" != \"x\$as_lineno_2'\$as_run'\" && + test \"x\`expr \$as_lineno_1'\$as_run' + 1\`\" = \"x\$as_lineno_2'\$as_run'\"' || exit 1 + + test -n \"\${ZSH_VERSION+set}\${BASH_VERSION+set}\" || ( + ECHO='\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\' + ECHO=\$ECHO\$ECHO\$ECHO\$ECHO\$ECHO + ECHO=\$ECHO\$ECHO\$ECHO\$ECHO\$ECHO\$ECHO + PATH=/empty FPATH=/empty; export PATH FPATH + test \"X\`printf %s \$ECHO\`\" = \"X\$ECHO\" \\ + || test \"X\`print -r -- \$ECHO\`\" = \"X\$ECHO\" ) || exit 1 +test \$(( 1 + 1 )) = 2 || exit 1" + if (eval "$as_required") 2>/dev/null; then : + as_have_required=yes +else + as_have_required=no +fi + if test x$as_have_required = xyes && (eval "$as_suggested") 2>/dev/null; then : + +else + as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +as_found=false +for as_dir in /bin$PATH_SEPARATOR/usr/bin$PATH_SEPARATOR$PATH +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + as_found=: + case $as_dir in #( + /*) + for as_base in sh bash ksh sh5; do + # Try only shells that exist, to save several forks. + as_shell=$as_dir/$as_base + if { test -f "$as_shell" || test -f "$as_shell.exe"; } && + { $as_echo "$as_bourne_compatible""$as_required" | as_run=a "$as_shell"; } 2>/dev/null; then : + CONFIG_SHELL=$as_shell as_have_required=yes + if { $as_echo "$as_bourne_compatible""$as_suggested" | as_run=a "$as_shell"; } 2>/dev/null; then : + break 2 +fi +fi + done;; + esac + as_found=false +done +$as_found || { if { test -f "$SHELL" || test -f "$SHELL.exe"; } && + { $as_echo "$as_bourne_compatible""$as_required" | as_run=a "$SHELL"; } 2>/dev/null; then : + CONFIG_SHELL=$SHELL as_have_required=yes +fi; } +IFS=$as_save_IFS + + + if test "x$CONFIG_SHELL" != x; then : + export CONFIG_SHELL + # We cannot yet assume a decent shell, so we have to provide a +# neutralization value for shells without unset; and this also +# works around shells that cannot unset nonexistent variables. +# Preserve -v and -x to the replacement shell. +BASH_ENV=/dev/null +ENV=/dev/null +(unset BASH_ENV) >/dev/null 2>&1 && unset BASH_ENV ENV +case $- in # (((( + *v*x* | *x*v* ) as_opts=-vx ;; + *v* ) as_opts=-v ;; + *x* ) as_opts=-x ;; + * ) as_opts= ;; +esac +exec $CONFIG_SHELL $as_opts "$as_myself" ${1+"$@"} +# Admittedly, this is quite paranoid, since all the known shells bail +# out after a failed `exec'. +$as_echo "$0: could not re-execute with $CONFIG_SHELL" >&2 +exit 255 +fi + + if test x$as_have_required = xno; then : + $as_echo "$0: This script requires a shell more modern than all" + $as_echo "$0: the shells that I found on your system." + if test x${ZSH_VERSION+set} = xset ; then + $as_echo "$0: In particular, zsh $ZSH_VERSION has bugs and should" + $as_echo "$0: be upgraded to zsh 4.3.4 or later." + else + $as_echo "$0: Please tell bug-autoconf@gnu.org and tex-k@tug.org +$0: about your system, including any error possibly output +$0: before this message. Then install a modern shell, or +$0: manually run the script under such a shell if you do +$0: have one." + fi + exit 1 +fi +fi +fi +SHELL=${CONFIG_SHELL-/bin/sh} +export SHELL +# Unset more variables known to interfere with behavior of common tools. +CLICOLOR_FORCE= GREP_OPTIONS= +unset CLICOLOR_FORCE GREP_OPTIONS + +## --------------------- ## +## M4sh Shell Functions. ## +## --------------------- ## +# as_fn_unset VAR +# --------------- +# Portably unset VAR. +as_fn_unset () +{ + { eval $1=; unset $1;} +} +as_unset=as_fn_unset + +# as_fn_set_status STATUS +# ----------------------- +# Set $? to STATUS, without forking. +as_fn_set_status () +{ + return $1 +} # as_fn_set_status + +# as_fn_exit STATUS +# ----------------- +# Exit the shell with STATUS, even in a "trap 0" or "set -e" context. +as_fn_exit () +{ + set +e + as_fn_set_status $1 + exit $1 +} # as_fn_exit + +# as_fn_mkdir_p +# ------------- +# Create "$as_dir" as a directory, including parents if necessary. +as_fn_mkdir_p () +{ + + case $as_dir in #( + -*) as_dir=./$as_dir;; + esac + test -d "$as_dir" || eval $as_mkdir_p || { + as_dirs= + while :; do + case $as_dir in #( + *\'*) as_qdir=`$as_echo "$as_dir" | sed "s/'/'\\\\\\\\''/g"`;; #'( + *) as_qdir=$as_dir;; + esac + as_dirs="'$as_qdir' $as_dirs" + as_dir=`$as_dirname -- "$as_dir" || +$as_expr X"$as_dir" : 'X\(.*[^/]\)//*[^/][^/]*/*$' \| \ + X"$as_dir" : 'X\(//\)[^/]' \| \ + X"$as_dir" : 'X\(//\)$' \| \ + X"$as_dir" : 'X\(/\)' \| . 2>/dev/null || +$as_echo X"$as_dir" | + sed '/^X\(.*[^/]\)\/\/*[^/][^/]*\/*$/{ + s//\1/ + q + } + /^X\(\/\/\)[^/].*/{ + s//\1/ + q + } + /^X\(\/\/\)$/{ + s//\1/ + q + } + /^X\(\/\).*/{ + s//\1/ + q + } + s/.*/./; q'` + test -d "$as_dir" && break + done + test -z "$as_dirs" || eval "mkdir $as_dirs" + } || test -d "$as_dir" || as_fn_error $? "cannot create directory $as_dir" + + +} # as_fn_mkdir_p + +# as_fn_executable_p FILE +# ----------------------- +# Test if FILE is an executable regular file. +as_fn_executable_p () +{ + test -f "$1" && test -x "$1" +} # as_fn_executable_p +# as_fn_append VAR VALUE +# ---------------------- +# Append the text in VALUE to the end of the definition contained in VAR. Take +# advantage of any shell optimizations that allow amortized linear growth over +# repeated appends, instead of the typical quadratic growth present in naive +# implementations. +if (eval "as_var=1; as_var+=2; test x\$as_var = x12") 2>/dev/null; then : + eval 'as_fn_append () + { + eval $1+=\$2 + }' +else + as_fn_append () + { + eval $1=\$$1\$2 + } +fi # as_fn_append + +# as_fn_arith ARG... +# ------------------ +# Perform arithmetic evaluation on the ARGs, and store the result in the +# global $as_val. Take advantage of shells that can avoid forks. The arguments +# must be portable across $(()) and expr. +if (eval "test \$(( 1 + 1 )) = 2") 2>/dev/null; then : + eval 'as_fn_arith () + { + as_val=$(( $* )) + }' +else + as_fn_arith () + { + as_val=`expr "$@" || test $? -eq 1` + } +fi # as_fn_arith + + +# as_fn_error STATUS ERROR [LINENO LOG_FD] +# ---------------------------------------- +# Output "`basename $0`: error: ERROR" to stderr. If LINENO and LOG_FD are +# provided, also output the error to LOG_FD, referencing LINENO. Then exit the +# script with STATUS, using 1 if that was 0. +as_fn_error () +{ + as_status=$1; test $as_status -eq 0 && as_status=1 + if test "$4"; then + as_lineno=${as_lineno-"$3"} as_lineno_stack=as_lineno_stack=$as_lineno_stack + $as_echo "$as_me:${as_lineno-$LINENO}: error: $2" >&$4 + fi + $as_echo "$as_me: error: $2" >&2 + as_fn_exit $as_status +} # as_fn_error + +if expr a : '\(a\)' >/dev/null 2>&1 && + test "X`expr 00001 : '.*\(...\)'`" = X001; then + as_expr=expr +else + as_expr=false +fi + +if (basename -- /) >/dev/null 2>&1 && test "X`basename -- / 2>&1`" = "X/"; then + as_basename=basename +else + as_basename=false +fi + +if (as_dir=`dirname -- /` && test "X$as_dir" = X/) >/dev/null 2>&1; then + as_dirname=dirname +else + as_dirname=false +fi + +as_me=`$as_basename -- "$0" || +$as_expr X/"$0" : '.*/\([^/][^/]*\)/*$' \| \ + X"$0" : 'X\(//\)$' \| \ + X"$0" : 'X\(/\)' \| . 2>/dev/null || +$as_echo X/"$0" | + sed '/^.*\/\([^/][^/]*\)\/*$/{ + s//\1/ + q + } + /^X\/\(\/\/\)$/{ + s//\1/ + q + } + /^X\/\(\/\).*/{ + s//\1/ + q + } + s/.*/./; q'` + +# Avoid depending upon Character Ranges. +as_cr_letters='abcdefghijklmnopqrstuvwxyz' +as_cr_LETTERS='ABCDEFGHIJKLMNOPQRSTUVWXYZ' +as_cr_Letters=$as_cr_letters$as_cr_LETTERS +as_cr_digits='0123456789' +as_cr_alnum=$as_cr_Letters$as_cr_digits + + + as_lineno_1=$LINENO as_lineno_1a=$LINENO + as_lineno_2=$LINENO as_lineno_2a=$LINENO + eval 'test "x$as_lineno_1'$as_run'" != "x$as_lineno_2'$as_run'" && + test "x`expr $as_lineno_1'$as_run' + 1`" = "x$as_lineno_2'$as_run'"' || { + # Blame Lee E. McMahon (1931-1989) for sed's syntax. :-) + sed -n ' + p + /[$]LINENO/= + ' <$as_myself | + sed ' + s/[$]LINENO.*/&-/ + t lineno + b + :lineno + N + :loop + s/[$]LINENO\([^'$as_cr_alnum'_].*\n\)\(.*\)/\2\1\2/ + t loop + s/-\n.*// + ' >$as_me.lineno && + chmod +x "$as_me.lineno" || + { $as_echo "$as_me: error: cannot create $as_me.lineno; rerun with a POSIX shell" >&2; as_fn_exit 1; } + + # If we had to re-execute with $CONFIG_SHELL, we're ensured to have + # already done that, so ensure we don't try to do so again and fall + # in an infinite loop. This has already happened in practice. + _as_can_reexec=no; export _as_can_reexec + # Don't try to exec as it changes $[0], causing all sort of problems + # (the dirname of $[0] is not the place where we might find the + # original and so on. Autoconf is especially sensitive to this). + . "./$as_me.lineno" + # Exit status is that of the last command. + exit +} + +ECHO_C= ECHO_N= ECHO_T= +case `echo -n x` in #((((( +-n*) + case `echo 'xy\c'` in + *c*) ECHO_T=' ';; # ECHO_T is single tab character. + xy) ECHO_C='\c';; + *) echo `echo ksh88 bug on AIX 6.1` > /dev/null + ECHO_T=' ';; + esac;; +*) + ECHO_N='-n';; +esac + +rm -f conf$$ conf$$.exe conf$$.file +if test -d conf$$.dir; then + rm -f conf$$.dir/conf$$.file +else + rm -f conf$$.dir + mkdir conf$$.dir 2>/dev/null +fi +if (echo >conf$$.file) 2>/dev/null; then + if ln -s conf$$.file conf$$ 2>/dev/null; then + as_ln_s='ln -s' + # ... but there are two gotchas: + # 1) On MSYS, both `ln -s file dir' and `ln file dir' fail. + # 2) DJGPP < 2.04 has no symlinks; `ln -s' creates a wrapper executable. + # In both cases, we have to default to `cp -pR'. + ln -s conf$$.file conf$$.dir 2>/dev/null && test ! -f conf$$.exe || + as_ln_s='cp -pR' + elif ln conf$$.file conf$$ 2>/dev/null; then + as_ln_s=ln + else + as_ln_s='cp -pR' + fi +else + as_ln_s='cp -pR' +fi +rm -f conf$$ conf$$.exe conf$$.dir/conf$$.file conf$$.file +rmdir conf$$.dir 2>/dev/null + +if mkdir -p . 2>/dev/null; then + as_mkdir_p='mkdir -p "$as_dir"' +else + test -d ./-p && rmdir ./-p + as_mkdir_p=false +fi + +as_test_x='test -x' +as_executable_p=as_fn_executable_p + +# Sed expression to map a string onto a valid CPP name. +as_tr_cpp="eval sed 'y%*$as_cr_letters%P$as_cr_LETTERS%;s%[^_$as_cr_alnum]%_%g'" + +# Sed expression to map a string onto a valid variable name. +as_tr_sh="eval sed 'y%*+%pp%;s%[^_$as_cr_alnum]%_%g'" + +SHELL=${CONFIG_SHELL-/bin/sh} + + +test -n "$DJDIR" || exec 7<&0 </dev/null +exec 6>&1 + +# Name of the host. +# hostname on some systems (SVR3.2, old GNU/Linux) returns a bogus exit status, +# so uname gets run too. +ac_hostname=`(hostname || uname -n) 2>/dev/null | sed 1q` + +# +# Initializations. +# +ac_default_prefix=/usr/local +ac_clean_files= +ac_config_libobj_dir=. +LIBOBJS= +cross_compiling=no +subdirs= +MFLAGS= +MAKEFLAGS= + +# Identity of this package. +PACKAGE_NAME='dvipng (TeX Live)' +PACKAGE_TARNAME='dvipng--tex-live-' +PACKAGE_VERSION='1.17' +PACKAGE_STRING='dvipng (TeX Live) 1.17' +PACKAGE_BUGREPORT='tex-k@tug.org' +PACKAGE_URL='' + +ac_unique_file="dvipng-src/dvipng.c" +# Factoring default headers for most tests. +ac_includes_default="\ +#include <stdio.h> +#ifdef HAVE_SYS_TYPES_H +# include <sys/types.h> +#endif +#ifdef HAVE_SYS_STAT_H +# include <sys/stat.h> +#endif +#ifdef STDC_HEADERS +# include <stdlib.h> +# include <stddef.h> +#else +# ifdef HAVE_STDLIB_H +# include <stdlib.h> +# endif +#endif +#ifdef HAVE_STRING_H +# if !defined STDC_HEADERS && defined HAVE_MEMORY_H +# include <memory.h> +# endif +# include <string.h> +#endif +#ifdef HAVE_STRINGS_H +# include <strings.h> +#endif +#ifdef HAVE_INTTYPES_H +# include <inttypes.h> +#endif +#ifdef HAVE_STDINT_H +# include <stdint.h> +#endif +#ifdef HAVE_UNISTD_H +# include <unistd.h> +#endif" + +ac_header_list= +ac_subst_vars='am__EXEEXT_FALSE +am__EXEEXT_TRUE +LTLIBOBJS +WIN32_CALL_FALSE +WIN32_CALL_TRUE +WIN32_FALSE +WIN32_TRUE +DVIPNG_TREE +have_gif_FALSE +have_gif_TRUE +have_ft2_FALSE +have_ft2_TRUE +GD_RULE +GD_DEPEND +GD_LIBS +GD_INCLUDES +FREETYPE2_RULE +FREETYPE2_DEPEND +FREETYPE2_LIBS +FREETYPE2_INCLUDES +FT2_CONFIG +LIBPNG_RULE +LIBPNG_DEPEND +LIBPNG_LIBS +LIBPNG_INCLUDES +ZLIB_RULE +ZLIB_DEPEND +ZLIB_LIBS +ZLIB_INCLUDES +KPATHSEA_RULE +KPATHSEA_DEPEND +KPATHSEA_LIBS +KPATHSEA_INCLUDES +PKG_CONFIG +INSTALL_INFO +AM_MAKEINFOFLAGS +LIBOBJS +POW_LIB +GS +cross_FALSE +cross_TRUE +CPP +LT_SYS_LIBRARY_PATH +OTOOL64 +OTOOL +LIPO +NMEDIT +DSYMUTIL +MANIFEST_TOOL +RANLIB +ac_ct_AR +AR +LN_S +NM +ac_ct_DUMPBIN +DUMPBIN +LD +FGREP +EGREP +GREP +SED +host_os +host_vendor +host_cpu +host +build_os +build_vendor +build_cpu +build +LIBTOOL +OBJDUMP +DLLTOOL +AS +WARNING_CFLAGS +am__fastdepCC_FALSE +am__fastdepCC_TRUE +CCDEPMODE +am__nodep +AMDEPBACKSLASH +AMDEP_FALSE +AMDEP_TRUE +am__include +DEPDIR +OBJEXT +EXEEXT +ac_ct_CC +CPPFLAGS +LDFLAGS +CFLAGS +CC +MAINT +MAINTAINER_MODE_FALSE +MAINTAINER_MODE_TRUE +AM_BACKSLASH +AM_DEFAULT_VERBOSITY +AM_DEFAULT_V +AM_V +am__untar +am__tar +AMTAR +am__leading_dot +SET_MAKE +AWK +mkdir_p +MKDIR_P +INSTALL_STRIP_PROGRAM +STRIP +install_sh +MAKEINFO +AUTOHEADER +AUTOMAKE +AUTOCONF +ACLOCAL +VERSION +PACKAGE +CYGPATH_W +am__isrc +INSTALL_DATA +INSTALL_SCRIPT +INSTALL_PROGRAM +target_alias +host_alias +build_alias +LIBS +ECHO_T +ECHO_N +ECHO_C +DEFS +mandir +localedir +libdir +psdir +pdfdir +dvidir +htmldir +infodir +docdir +oldincludedir +includedir +localstatedir +sharedstatedir +sysconfdir +datadir +datarootdir +libexecdir +sbindir +bindir +program_transform_name +prefix +exec_prefix +PACKAGE_URL +PACKAGE_BUGREPORT +PACKAGE_STRING +PACKAGE_VERSION +PACKAGE_TARNAME +PACKAGE_NAME +PATH_SEPARATOR +SHELL +am__quote' +ac_subst_files='' +ac_user_opts=' +enable_option_checking +enable_silent_rules +enable_maintainer_mode +enable_dependency_tracking +enable_compiler_warnings +enable_shared +enable_static +with_pic +enable_fast_install +with_aix_soname +with_gnu_ld +with_sysroot +enable_libtool_lock +enable_largefile +enable_debug +enable_timing +with_gs +with_system_kpathsea +with_system_zlib +with_zlib_includes +with_zlib_libdir +with_system_libpng +with_system_freetype2 +with_system_gd +with_gd_includes +with_gd_libdir +' + ac_precious_vars='build_alias +host_alias +target_alias +CC +CFLAGS +LDFLAGS +LIBS +CPPFLAGS +LT_SYS_LIBRARY_PATH +CPP' + + +# Initialize some variables set by options. +ac_init_help= +ac_init_version=false +ac_unrecognized_opts= +ac_unrecognized_sep= +# The variables have the same names as the options, with +# dashes changed to underlines. +cache_file=/dev/null +exec_prefix=NONE +no_create= +no_recursion= +prefix=NONE +program_prefix=NONE +program_suffix=NONE +program_transform_name=s,x,x, +silent= +site= +srcdir= +verbose= +x_includes=NONE +x_libraries=NONE + +# Installation directory options. +# These are left unexpanded so users can "make install exec_prefix=/foo" +# and all the variables that are supposed to be based on exec_prefix +# by default will actually change. +# Use braces instead of parens because sh, perl, etc. also accept them. +# (The list follows the same order as the GNU Coding Standards.) +bindir='${exec_prefix}/bin' +sbindir='${exec_prefix}/sbin' +libexecdir='${exec_prefix}/libexec' +datarootdir='${prefix}/share' +datadir='${datarootdir}' +sysconfdir='${prefix}/etc' +sharedstatedir='${prefix}/com' +localstatedir='${prefix}/var' +includedir='${prefix}/include' +oldincludedir='/usr/include' +docdir='${datarootdir}/doc/${PACKAGE_TARNAME}' +infodir='${datarootdir}/info' +htmldir='${docdir}' +dvidir='${docdir}' +pdfdir='${docdir}' +psdir='${docdir}' +libdir='${exec_prefix}/lib' +localedir='${datarootdir}/locale' +mandir='${datarootdir}/man' + +ac_prev= +ac_dashdash= +for ac_option +do + # If the previous option needs an argument, assign it. + if test -n "$ac_prev"; then + eval $ac_prev=\$ac_option + ac_prev= + continue + fi + + case $ac_option in + *=?*) ac_optarg=`expr "X$ac_option" : '[^=]*=\(.*\)'` ;; + *=) ac_optarg= ;; + *) ac_optarg=yes ;; + esac + + # Accept the important Cygnus configure options, so we can diagnose typos. + + case $ac_dashdash$ac_option in + --) + ac_dashdash=yes ;; + + -bindir | --bindir | --bindi | --bind | --bin | --bi) + ac_prev=bindir ;; + -bindir=* | --bindir=* | --bindi=* | --bind=* | --bin=* | --bi=*) + bindir=$ac_optarg ;; + + -build | --build | --buil | --bui | --bu) + ac_prev=build_alias ;; + -build=* | --build=* | --buil=* | --bui=* | --bu=*) + build_alias=$ac_optarg ;; + + -cache-file | --cache-file | --cache-fil | --cache-fi \ + | --cache-f | --cache- | --cache | --cach | --cac | --ca | --c) + ac_prev=cache_file ;; + -cache-file=* | --cache-file=* | --cache-fil=* | --cache-fi=* \ + | --cache-f=* | --cache-=* | --cache=* | --cach=* | --cac=* | --ca=* | --c=*) + cache_file=$ac_optarg ;; + + --config-cache | -C) + cache_file=config.cache ;; + + -datadir | --datadir | --datadi | --datad) + ac_prev=datadir ;; + -datadir=* | --datadir=* | --datadi=* | --datad=*) + datadir=$ac_optarg ;; + + -datarootdir | --datarootdir | --datarootdi | --datarootd | --dataroot \ + | --dataroo | --dataro | --datar) + ac_prev=datarootdir ;; + -datarootdir=* | --datarootdir=* | --datarootdi=* | --datarootd=* \ + | --dataroot=* | --dataroo=* | --dataro=* | --datar=*) + datarootdir=$ac_optarg ;; + + -disable-* | --disable-*) + ac_useropt=`expr "x$ac_option" : 'x-*disable-\(.*\)'` + # Reject names that are not valid shell variable names. + expr "x$ac_useropt" : ".*[^-+._$as_cr_alnum]" >/dev/null && + as_fn_error $? "invalid feature name: $ac_useropt" + ac_useropt_orig=$ac_useropt + ac_useropt=`$as_echo "$ac_useropt" | sed 's/[-+.]/_/g'` + case $ac_user_opts in + *" +"enable_$ac_useropt" +"*) ;; + *) ac_unrecognized_opts="$ac_unrecognized_opts$ac_unrecognized_sep--disable-$ac_useropt_orig" + ac_unrecognized_sep=', ';; + esac + eval enable_$ac_useropt=no ;; + + -docdir | --docdir | --docdi | --doc | --do) + ac_prev=docdir ;; + -docdir=* | --docdir=* | --docdi=* | --doc=* | --do=*) + docdir=$ac_optarg ;; + + -dvidir | --dvidir | --dvidi | --dvid | --dvi | --dv) + ac_prev=dvidir ;; + -dvidir=* | --dvidir=* | --dvidi=* | --dvid=* | --dvi=* | --dv=*) + dvidir=$ac_optarg ;; + + -enable-* | --enable-*) + ac_useropt=`expr "x$ac_option" : 'x-*enable-\([^=]*\)'` + # Reject names that are not valid shell variable names. + expr "x$ac_useropt" : ".*[^-+._$as_cr_alnum]" >/dev/null && + as_fn_error $? "invalid feature name: $ac_useropt" + ac_useropt_orig=$ac_useropt + ac_useropt=`$as_echo "$ac_useropt" | sed 's/[-+.]/_/g'` + case $ac_user_opts in + *" +"enable_$ac_useropt" +"*) ;; + *) ac_unrecognized_opts="$ac_unrecognized_opts$ac_unrecognized_sep--enable-$ac_useropt_orig" + ac_unrecognized_sep=', ';; + esac + eval enable_$ac_useropt=\$ac_optarg ;; + + -exec-prefix | --exec_prefix | --exec-prefix | --exec-prefi \ + | --exec-pref | --exec-pre | --exec-pr | --exec-p | --exec- \ + | --exec | --exe | --ex) + ac_prev=exec_prefix ;; + -exec-prefix=* | --exec_prefix=* | --exec-prefix=* | --exec-prefi=* \ + | --exec-pref=* | --exec-pre=* | --exec-pr=* | --exec-p=* | --exec-=* \ + | --exec=* | --exe=* | --ex=*) + exec_prefix=$ac_optarg ;; + + -gas | --gas | --ga | --g) + # Obsolete; use --with-gas. + with_gas=yes ;; + + -help | --help | --hel | --he | -h) + ac_init_help=long ;; + -help=r* | --help=r* | --hel=r* | --he=r* | -hr*) + ac_init_help=recursive ;; + -help=s* | --help=s* | --hel=s* | --he=s* | -hs*) + ac_init_help=short ;; + + -host | --host | --hos | --ho) + ac_prev=host_alias ;; + -host=* | --host=* | --hos=* | --ho=*) + host_alias=$ac_optarg ;; + + -htmldir | --htmldir | --htmldi | --htmld | --html | --htm | --ht) + ac_prev=htmldir ;; + -htmldir=* | --htmldir=* | --htmldi=* | --htmld=* | --html=* | --htm=* \ + | --ht=*) + htmldir=$ac_optarg ;; + + -includedir | --includedir | --includedi | --included | --include \ + | --includ | --inclu | --incl | --inc) + ac_prev=includedir ;; + -includedir=* | --includedir=* | --includedi=* | --included=* | --include=* \ + | --includ=* | --inclu=* | --incl=* | --inc=*) + includedir=$ac_optarg ;; + + -infodir | --infodir | --infodi | --infod | --info | --inf) + ac_prev=infodir ;; + -infodir=* | --infodir=* | --infodi=* | --infod=* | --info=* | --inf=*) + infodir=$ac_optarg ;; + + -libdir | --libdir | --libdi | --libd) + ac_prev=libdir ;; + -libdir=* | --libdir=* | --libdi=* | --libd=*) + libdir=$ac_optarg ;; + + -libexecdir | --libexecdir | --libexecdi | --libexecd | --libexec \ + | --libexe | --libex | --libe) + ac_prev=libexecdir ;; + -libexecdir=* | --libexecdir=* | --libexecdi=* | --libexecd=* | --libexec=* \ + | --libexe=* | --libex=* | --libe=*) + libexecdir=$ac_optarg ;; + + -localedir | --localedir | --localedi | --localed | --locale) + ac_prev=localedir ;; + -localedir=* | --localedir=* | --localedi=* | --localed=* | --locale=*) + localedir=$ac_optarg ;; + + -localstatedir | --localstatedir | --localstatedi | --localstated \ + | --localstate | --localstat | --localsta | --localst | --locals) + ac_prev=localstatedir ;; + -localstatedir=* | --localstatedir=* | --localstatedi=* | --localstated=* \ + | --localstate=* | --localstat=* | --localsta=* | --localst=* | --locals=*) + localstatedir=$ac_optarg ;; + + -mandir | --mandir | --mandi | --mand | --man | --ma | --m) + ac_prev=mandir ;; + -mandir=* | --mandir=* | --mandi=* | --mand=* | --man=* | --ma=* | --m=*) + mandir=$ac_optarg ;; + + -nfp | --nfp | --nf) + # Obsolete; use --without-fp. + with_fp=no ;; + + -no-create | --no-create | --no-creat | --no-crea | --no-cre \ + | --no-cr | --no-c | -n) + no_create=yes ;; + + -no-recursion | --no-recursion | --no-recursio | --no-recursi \ + | --no-recurs | --no-recur | --no-recu | --no-rec | --no-re | --no-r) + no_recursion=yes ;; + + -oldincludedir | --oldincludedir | --oldincludedi | --oldincluded \ + | --oldinclude | --oldinclud | --oldinclu | --oldincl | --oldinc \ + | --oldin | --oldi | --old | --ol | --o) + ac_prev=oldincludedir ;; + -oldincludedir=* | --oldincludedir=* | --oldincludedi=* | --oldincluded=* \ + | --oldinclude=* | --oldinclud=* | --oldinclu=* | --oldincl=* | --oldinc=* \ + | --oldin=* | --oldi=* | --old=* | --ol=* | --o=*) + oldincludedir=$ac_optarg ;; + + -prefix | --prefix | --prefi | --pref | --pre | --pr | --p) + ac_prev=prefix ;; + -prefix=* | --prefix=* | --prefi=* | --pref=* | --pre=* | --pr=* | --p=*) + prefix=$ac_optarg ;; + + -program-prefix | --program-prefix | --program-prefi | --program-pref \ + | --program-pre | --program-pr | --program-p) + ac_prev=program_prefix ;; + -program-prefix=* | --program-prefix=* | --program-prefi=* \ + | --program-pref=* | --program-pre=* | --program-pr=* | --program-p=*) + program_prefix=$ac_optarg ;; + + -program-suffix | --program-suffix | --program-suffi | --program-suff \ + | --program-suf | --program-su | --program-s) + ac_prev=program_suffix ;; + -program-suffix=* | --program-suffix=* | --program-suffi=* \ + | --program-suff=* | --program-suf=* | --program-su=* | --program-s=*) + program_suffix=$ac_optarg ;; + + -program-transform-name | --program-transform-name \ + | --program-transform-nam | --program-transform-na \ + | --program-transform-n | --program-transform- \ + | --program-transform | --program-transfor \ + | --program-transfo | --program-transf \ + | --program-trans | --program-tran \ + | --progr-tra | --program-tr | --program-t) + ac_prev=program_transform_name ;; + -program-transform-name=* | --program-transform-name=* \ + | --program-transform-nam=* | --program-transform-na=* \ + | --program-transform-n=* | --program-transform-=* \ + | --program-transform=* | --program-transfor=* \ + | --program-transfo=* | --program-transf=* \ + | --program-trans=* | --program-tran=* \ + | --progr-tra=* | --program-tr=* | --program-t=*) + program_transform_name=$ac_optarg ;; + + -pdfdir | --pdfdir | --pdfdi | --pdfd | --pdf | --pd) + ac_prev=pdfdir ;; + -pdfdir=* | --pdfdir=* | --pdfdi=* | --pdfd=* | --pdf=* | --pd=*) + pdfdir=$ac_optarg ;; + + -psdir | --psdir | --psdi | --psd | --ps) + ac_prev=psdir ;; + -psdir=* | --psdir=* | --psdi=* | --psd=* | --ps=*) + psdir=$ac_optarg ;; + + -q | -quiet | --quiet | --quie | --qui | --qu | --q \ + | -silent | --silent | --silen | --sile | --sil) + silent=yes ;; + + -sbindir | --sbindir | --sbindi | --sbind | --sbin | --sbi | --sb) + ac_prev=sbindir ;; + -sbindir=* | --sbindir=* | --sbindi=* | --sbind=* | --sbin=* \ + | --sbi=* | --sb=*) + sbindir=$ac_optarg ;; + + -sharedstatedir | --sharedstatedir | --sharedstatedi \ + | --sharedstated | --sharedstate | --sharedstat | --sharedsta \ + | --sharedst | --shareds | --shared | --share | --shar \ + | --sha | --sh) + ac_prev=sharedstatedir ;; + -sharedstatedir=* | --sharedstatedir=* | --sharedstatedi=* \ + | --sharedstated=* | --sharedstate=* | --sharedstat=* | --sharedsta=* \ + | --sharedst=* | --shareds=* | --shared=* | --share=* | --shar=* \ + | --sha=* | --sh=*) + sharedstatedir=$ac_optarg ;; + + -site | --site | --sit) + ac_prev=site ;; + -site=* | --site=* | --sit=*) + site=$ac_optarg ;; + + -srcdir | --srcdir | --srcdi | --srcd | --src | --sr) + ac_prev=srcdir ;; + -srcdir=* | --srcdir=* | --srcdi=* | --srcd=* | --src=* | --sr=*) + srcdir=$ac_optarg ;; + + -sysconfdir | --sysconfdir | --sysconfdi | --sysconfd | --sysconf \ + | --syscon | --sysco | --sysc | --sys | --sy) + ac_prev=sysconfdir ;; + -sysconfdir=* | --sysconfdir=* | --sysconfdi=* | --sysconfd=* | --sysconf=* \ + | --syscon=* | --sysco=* | --sysc=* | --sys=* | --sy=*) + sysconfdir=$ac_optarg ;; + + -target | --target | --targe | --targ | --tar | --ta | --t) + ac_prev=target_alias ;; + -target=* | --target=* | --targe=* | --targ=* | --tar=* | --ta=* | --t=*) + target_alias=$ac_optarg ;; + + -v | -verbose | --verbose | --verbos | --verbo | --verb) + verbose=yes ;; + + -version | --version | --versio | --versi | --vers | -V) + ac_init_version=: ;; + + -with-* | --with-*) + ac_useropt=`expr "x$ac_option" : 'x-*with-\([^=]*\)'` + # Reject names that are not valid shell variable names. + expr "x$ac_useropt" : ".*[^-+._$as_cr_alnum]" >/dev/null && + as_fn_error $? "invalid package name: $ac_useropt" + ac_useropt_orig=$ac_useropt + ac_useropt=`$as_echo "$ac_useropt" | sed 's/[-+.]/_/g'` + case $ac_user_opts in + *" +"with_$ac_useropt" +"*) ;; + *) ac_unrecognized_opts="$ac_unrecognized_opts$ac_unrecognized_sep--with-$ac_useropt_orig" + ac_unrecognized_sep=', ';; + esac + eval with_$ac_useropt=\$ac_optarg ;; + + -without-* | --without-*) + ac_useropt=`expr "x$ac_option" : 'x-*without-\(.*\)'` + # Reject names that are not valid shell variable names. + expr "x$ac_useropt" : ".*[^-+._$as_cr_alnum]" >/dev/null && + as_fn_error $? "invalid package name: $ac_useropt" + ac_useropt_orig=$ac_useropt + ac_useropt=`$as_echo "$ac_useropt" | sed 's/[-+.]/_/g'` + case $ac_user_opts in + *" +"with_$ac_useropt" +"*) ;; + *) ac_unrecognized_opts="$ac_unrecognized_opts$ac_unrecognized_sep--without-$ac_useropt_orig" + ac_unrecognized_sep=', ';; + esac + eval with_$ac_useropt=no ;; + + --x) + # Obsolete; use --with-x. + with_x=yes ;; + + -x-includes | --x-includes | --x-include | --x-includ | --x-inclu \ + | --x-incl | --x-inc | --x-in | --x-i) + ac_prev=x_includes ;; + -x-includes=* | --x-includes=* | --x-include=* | --x-includ=* | --x-inclu=* \ + | --x-incl=* | --x-inc=* | --x-in=* | --x-i=*) + x_includes=$ac_optarg ;; + + -x-libraries | --x-libraries | --x-librarie | --x-librari \ + | --x-librar | --x-libra | --x-libr | --x-lib | --x-li | --x-l) + ac_prev=x_libraries ;; + -x-libraries=* | --x-libraries=* | --x-librarie=* | --x-librari=* \ + | --x-librar=* | --x-libra=* | --x-libr=* | --x-lib=* | --x-li=* | --x-l=*) + x_libraries=$ac_optarg ;; + + -*) as_fn_error $? "unrecognized option: \`$ac_option' +Try \`$0 --help' for more information" + ;; + + *=*) + ac_envvar=`expr "x$ac_option" : 'x\([^=]*\)='` + # Reject names that are not valid shell variable names. + case $ac_envvar in #( + '' | [0-9]* | *[!_$as_cr_alnum]* ) + as_fn_error $? "invalid variable name: \`$ac_envvar'" ;; + esac + eval $ac_envvar=\$ac_optarg + export $ac_envvar ;; + + *) + # FIXME: should be removed in autoconf 3.0. + $as_echo "$as_me: WARNING: you should use --build, --host, --target" >&2 + expr "x$ac_option" : ".*[^-._$as_cr_alnum]" >/dev/null && + $as_echo "$as_me: WARNING: invalid host type: $ac_option" >&2 + : "${build_alias=$ac_option} ${host_alias=$ac_option} ${target_alias=$ac_option}" + ;; + + esac +done + +if test -n "$ac_prev"; then + ac_option=--`echo $ac_prev | sed 's/_/-/g'` + as_fn_error $? "missing argument to $ac_option" +fi + +if test -n "$ac_unrecognized_opts"; then + case $enable_option_checking in + no) ;; + fatal) as_fn_error $? "unrecognized options: $ac_unrecognized_opts" ;; + *) $as_echo "$as_me: WARNING: unrecognized options: $ac_unrecognized_opts" >&2 ;; + esac +fi + +# Check all directory arguments for consistency. +for ac_var in exec_prefix prefix bindir sbindir libexecdir datarootdir \ + datadir sysconfdir sharedstatedir localstatedir includedir \ + oldincludedir docdir infodir htmldir dvidir pdfdir psdir \ + libdir localedir mandir +do + eval ac_val=\$$ac_var + # Remove trailing slashes. + case $ac_val in + */ ) + ac_val=`expr "X$ac_val" : 'X\(.*[^/]\)' \| "X$ac_val" : 'X\(.*\)'` + eval $ac_var=\$ac_val;; + esac + # Be sure to have absolute directory names. + case $ac_val in + [\\/$]* | ?:[\\/]* ) continue;; + NONE | '' ) case $ac_var in *prefix ) continue;; esac;; + esac + as_fn_error $? "expected an absolute directory name for --$ac_var: $ac_val" +done + +# There might be people who depend on the old broken behavior: `$host' +# used to hold the argument of --host etc. +# FIXME: To remove some day. +build=$build_alias +host=$host_alias +target=$target_alias + +# FIXME: To remove some day. +if test "x$host_alias" != x; then + if test "x$build_alias" = x; then + cross_compiling=maybe + elif test "x$build_alias" != "x$host_alias"; then + cross_compiling=yes + fi +fi + +ac_tool_prefix= +test -n "$host_alias" && ac_tool_prefix=$host_alias- + +test "$silent" = yes && exec 6>/dev/null + + +ac_pwd=`pwd` && test -n "$ac_pwd" && +ac_ls_di=`ls -di .` && +ac_pwd_ls_di=`cd "$ac_pwd" && ls -di .` || + as_fn_error $? "working directory cannot be determined" +test "X$ac_ls_di" = "X$ac_pwd_ls_di" || + as_fn_error $? "pwd does not report name of working directory" + + +# Find the source files, if location was not specified. +if test -z "$srcdir"; then + ac_srcdir_defaulted=yes + # Try the directory containing this script, then the parent directory. + ac_confdir=`$as_dirname -- "$as_myself" || +$as_expr X"$as_myself" : 'X\(.*[^/]\)//*[^/][^/]*/*$' \| \ + X"$as_myself" : 'X\(//\)[^/]' \| \ + X"$as_myself" : 'X\(//\)$' \| \ + X"$as_myself" : 'X\(/\)' \| . 2>/dev/null || +$as_echo X"$as_myself" | + sed '/^X\(.*[^/]\)\/\/*[^/][^/]*\/*$/{ + s//\1/ + q + } + /^X\(\/\/\)[^/].*/{ + s//\1/ + q + } + /^X\(\/\/\)$/{ + s//\1/ + q + } + /^X\(\/\).*/{ + s//\1/ + q + } + s/.*/./; q'` + srcdir=$ac_confdir + if test ! -r "$srcdir/$ac_unique_file"; then + srcdir=.. + fi +else + ac_srcdir_defaulted=no +fi +if test ! -r "$srcdir/$ac_unique_file"; then + test "$ac_srcdir_defaulted" = yes && srcdir="$ac_confdir or .." + as_fn_error $? "cannot find sources ($ac_unique_file) in $srcdir" +fi +ac_msg="sources are in $srcdir, but \`cd $srcdir' does not work" +ac_abs_confdir=`( + cd "$srcdir" && test -r "./$ac_unique_file" || as_fn_error $? "$ac_msg" + pwd)` +# When building in place, set srcdir=. +if test "$ac_abs_confdir" = "$ac_pwd"; then + srcdir=. +fi +# Remove unnecessary trailing slashes from srcdir. +# Double slashes in file names in object file debugging info +# mess up M-x gdb in Emacs. +case $srcdir in +*/) srcdir=`expr "X$srcdir" : 'X\(.*[^/]\)' \| "X$srcdir" : 'X\(.*\)'`;; +esac +for ac_var in $ac_precious_vars; do + eval ac_env_${ac_var}_set=\${${ac_var}+set} + eval ac_env_${ac_var}_value=\$${ac_var} + eval ac_cv_env_${ac_var}_set=\${${ac_var}+set} + eval ac_cv_env_${ac_var}_value=\$${ac_var} +done + +# +# Report the --help message. +# +if test "$ac_init_help" = "long"; then + # Omit some internal or obsolete options to make the list less imposing. + # This message is too long to be a string in the A/UX 3.1 sh. + cat <<_ACEOF +\`configure' configures dvipng (TeX Live) 1.17 to adapt to many kinds of systems. + +Usage: $0 [OPTION]... [VAR=VALUE]... + +To assign environment variables (e.g., CC, CFLAGS...), specify them as +VAR=VALUE. See below for descriptions of some of the useful variables. + +Defaults for the options are specified in brackets. + +Configuration: + -h, --help display this help and exit + --help=short display options specific to this package + --help=recursive display the short help of all the included packages + -V, --version display version information and exit + -q, --quiet, --silent do not print \`checking ...' messages + --cache-file=FILE cache test results in FILE [disabled] + -C, --config-cache alias for \`--cache-file=config.cache' + -n, --no-create do not create output files + --srcdir=DIR find the sources in DIR [configure dir or \`..'] + +Installation directories: + --prefix=PREFIX install architecture-independent files in PREFIX + [$ac_default_prefix] + --exec-prefix=EPREFIX install architecture-dependent files in EPREFIX + [PREFIX] + +By default, \`make install' will install all the files in +\`$ac_default_prefix/bin', \`$ac_default_prefix/lib' etc. You can specify +an installation prefix other than \`$ac_default_prefix' using \`--prefix', +for instance \`--prefix=\$HOME'. + +For better control, use the options below. + +Fine tuning of the installation directories: + --bindir=DIR user executables [EPREFIX/bin] + --sbindir=DIR system admin executables [EPREFIX/sbin] + --libexecdir=DIR program executables [EPREFIX/libexec] + --sysconfdir=DIR read-only single-machine data [PREFIX/etc] + --sharedstatedir=DIR modifiable architecture-independent data [PREFIX/com] + --localstatedir=DIR modifiable single-machine data [PREFIX/var] + --libdir=DIR object code libraries [EPREFIX/lib] + --includedir=DIR C header files [PREFIX/include] + --oldincludedir=DIR C header files for non-gcc [/usr/include] + --datarootdir=DIR read-only arch.-independent data root [PREFIX/share] + --datadir=DIR read-only architecture-independent data [DATAROOTDIR] + --infodir=DIR info documentation [DATAROOTDIR/info] + --localedir=DIR locale-dependent data [DATAROOTDIR/locale] + --mandir=DIR man documentation [DATAROOTDIR/man] + --docdir=DIR documentation root + [DATAROOTDIR/doc/dvipng--tex-live-] + --htmldir=DIR html documentation [DOCDIR] + --dvidir=DIR dvi documentation [DOCDIR] + --pdfdir=DIR pdf documentation [DOCDIR] + --psdir=DIR ps documentation [DOCDIR] +_ACEOF + + cat <<\_ACEOF + +Program names: + --program-prefix=PREFIX prepend PREFIX to installed program names + --program-suffix=SUFFIX append SUFFIX to installed program names + --program-transform-name=PROGRAM run sed PROGRAM on installed program names + +System types: + --build=BUILD configure for building on BUILD [guessed] + --host=HOST cross-compile to build programs to run on HOST [BUILD] +_ACEOF +fi + +if test -n "$ac_init_help"; then + case $ac_init_help in + short | recursive ) echo "Configuration of dvipng (TeX Live) 1.17:";; + esac + cat <<\_ACEOF + +Optional Features: + --disable-option-checking ignore unrecognized --enable/--with options + --disable-FEATURE do not include FEATURE (same as --enable-FEATURE=no) + --enable-FEATURE[=ARG] include FEATURE [ARG=yes] + --enable-silent-rules less verbose build output (undo: "make V=1") + --disable-silent-rules verbose build output (undo: "make V=0") + --enable-maintainer-mode + enable make rules and dependencies not useful (and + sometimes confusing) to the casual installer + --enable-dependency-tracking + do not reject slow dependency extractors + --disable-dependency-tracking + speeds up one-time build + --enable-compiler-warnings=[no|min|yes|max|all] + Turn on compiler warnings [default: yes if + maintainer-mode, min otherwise] + --enable-shared[=PKGS] build shared libraries [default=yes] + --enable-static[=PKGS] build static libraries [default=yes] + --enable-fast-install[=PKGS] + optimize for fast installation [default=yes] + --disable-libtool-lock avoid locking (might break parallel builds) + --disable-largefile omit support for large files + --disable-debug Compile without debug (-d) option + --enable-timing Output execution time of dvipng + +Optional Packages: + --with-PACKAGE[=ARG] use PACKAGE [ARG=yes] + --without-PACKAGE do not use PACKAGE (same as --with-PACKAGE=no) + --with-pic[=PKGS] try to use only PIC/non-PIC objects [default=use + both] + --with-aix-soname=aix|svr4|both + shared library versioning (aka "SONAME") variant to + provide on AIX, [default=aix]. + --with-gnu-ld assume the C compiler uses GNU ld [default=no] + --with-sysroot[=DIR] Search for dependent libraries within DIR (or the + compiler's sysroot if not specified). + --with-gs=/PATH/TO/gs Hard-wire the location of GhostScript + --with-system-kpathsea use installed kpathsea headers and library (requires + pkg-config) + --with-system-zlib use installed zlib headers and library + --with-zlib-includes=DIR + zlib headers installed in DIR + --with-zlib-libdir=DIR zlib library installed in DIR + --with-system-libpng use installed libpng headers and library (requires + pkg-config) + --with-system-freetype2 use installed freetype2 headers and library + (requires freetype-config) + --with-system-gd use installed gd headers and library + --with-gd-includes=DIR gd headers installed in DIR + --with-gd-libdir=DIR gd library installed in DIR + +Some influential environment variables: + CC C compiler command + CFLAGS C compiler flags + LDFLAGS linker flags, e.g. -L<lib dir> if you have libraries in a + nonstandard directory <lib dir> + LIBS libraries to pass to the linker, e.g. -l<library> + CPPFLAGS (Objective) C/C++ preprocessor flags, e.g. -I<include dir> if + you have headers in a nonstandard directory <include dir> + LT_SYS_LIBRARY_PATH + User-defined run-time library search path. + CPP C preprocessor + +Use these variables to override the choices made by `configure' or to help +it to find libraries and programs with nonstandard names/locations. + +Report bugs to <tex-k@tug.org>. +_ACEOF +ac_status=$? +fi + +if test "$ac_init_help" = "recursive"; then + # If there are subdirs, report their specific --help. + for ac_dir in : $ac_subdirs_all; do test "x$ac_dir" = x: && continue + test -d "$ac_dir" || + { cd "$srcdir" && ac_pwd=`pwd` && srcdir=. && test -d "$ac_dir"; } || + continue + ac_builddir=. + +case "$ac_dir" in +.) ac_dir_suffix= ac_top_builddir_sub=. ac_top_build_prefix= ;; +*) + ac_dir_suffix=/`$as_echo "$ac_dir" | sed 's|^\.[\\/]||'` + # A ".." for each directory in $ac_dir_suffix. + ac_top_builddir_sub=`$as_echo "$ac_dir_suffix" | sed 's|/[^\\/]*|/..|g;s|/||'` + case $ac_top_builddir_sub in + "") ac_top_builddir_sub=. ac_top_build_prefix= ;; + *) ac_top_build_prefix=$ac_top_builddir_sub/ ;; + esac ;; +esac +ac_abs_top_builddir=$ac_pwd +ac_abs_builddir=$ac_pwd$ac_dir_suffix +# for backward compatibility: +ac_top_builddir=$ac_top_build_prefix + +case $srcdir in + .) # We are building in place. + ac_srcdir=. + ac_top_srcdir=$ac_top_builddir_sub + ac_abs_top_srcdir=$ac_pwd ;; + [\\/]* | ?:[\\/]* ) # Absolute name. + ac_srcdir=$srcdir$ac_dir_suffix; + ac_top_srcdir=$srcdir + ac_abs_top_srcdir=$srcdir ;; + *) # Relative name. + ac_srcdir=$ac_top_build_prefix$srcdir$ac_dir_suffix + ac_top_srcdir=$ac_top_build_prefix$srcdir + ac_abs_top_srcdir=$ac_pwd/$srcdir ;; +esac +ac_abs_srcdir=$ac_abs_top_srcdir$ac_dir_suffix + + cd "$ac_dir" || { ac_status=$?; continue; } + # Check for guested configure. + if test -f "$ac_srcdir/configure.gnu"; then + echo && + $SHELL "$ac_srcdir/configure.gnu" --help=recursive + elif test -f "$ac_srcdir/configure"; then + echo && + $SHELL "$ac_srcdir/configure" --help=recursive + else + $as_echo "$as_me: WARNING: no configuration information is in $ac_dir" >&2 + fi || ac_status=$? + cd "$ac_pwd" || { ac_status=$?; break; } + done +fi + +test -n "$ac_init_help" && exit $ac_status +if $ac_init_version; then + cat <<\_ACEOF +dvipng (TeX Live) configure 1.17 +generated by GNU Autoconf 2.69 + +Copyright (C) 2012 Free Software Foundation, Inc. +This configure script is free software; the Free Software Foundation +gives unlimited permission to copy, distribute and modify it. +_ACEOF + exit +fi + +## ------------------------ ## +## Autoconf initialization. ## +## ------------------------ ## + +# ac_fn_c_try_compile LINENO +# -------------------------- +# Try to compile conftest.$ac_ext, and return whether this succeeded. +ac_fn_c_try_compile () +{ + as_lineno=${as_lineno-"$1"} as_lineno_stack=as_lineno_stack=$as_lineno_stack + rm -f conftest.$ac_objext + if { { ac_try="$ac_compile" +case "(($ac_try" in + *\"* | *\`* | *\\*) ac_try_echo=\$ac_try;; + *) ac_try_echo=$ac_try;; +esac +eval ac_try_echo="\"\$as_me:${as_lineno-$LINENO}: $ac_try_echo\"" +$as_echo "$ac_try_echo"; } >&5 + (eval "$ac_compile") 2>conftest.err + ac_status=$? + if test -s conftest.err; then + grep -v '^ *+' conftest.err >conftest.er1 + cat conftest.er1 >&5 + mv -f conftest.er1 conftest.err + fi + $as_echo "$as_me:${as_lineno-$LINENO}: \$? = $ac_status" >&5 + test $ac_status = 0; } && { + test -z "$ac_c_werror_flag" || + test ! -s conftest.err + } && test -s conftest.$ac_objext; then : + ac_retval=0 +else + $as_echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + + ac_retval=1 +fi + eval $as_lineno_stack; ${as_lineno_stack:+:} unset as_lineno + as_fn_set_status $ac_retval + +} # ac_fn_c_try_compile + +# ac_fn_c_try_link LINENO +# ----------------------- +# Try to link conftest.$ac_ext, and return whether this succeeded. +ac_fn_c_try_link () +{ + as_lineno=${as_lineno-"$1"} as_lineno_stack=as_lineno_stack=$as_lineno_stack + rm -f conftest.$ac_objext conftest$ac_exeext + if { { ac_try="$ac_link" +case "(($ac_try" in + *\"* | *\`* | *\\*) ac_try_echo=\$ac_try;; + *) ac_try_echo=$ac_try;; +esac +eval ac_try_echo="\"\$as_me:${as_lineno-$LINENO}: $ac_try_echo\"" +$as_echo "$ac_try_echo"; } >&5 + (eval "$ac_link") 2>conftest.err + ac_status=$? + if test -s conftest.err; then + grep -v '^ *+' conftest.err >conftest.er1 + cat conftest.er1 >&5 + mv -f conftest.er1 conftest.err + fi + $as_echo "$as_me:${as_lineno-$LINENO}: \$? = $ac_status" >&5 + test $ac_status = 0; } && { + test -z "$ac_c_werror_flag" || + test ! -s conftest.err + } && test -s conftest$ac_exeext && { + test "$cross_compiling" = yes || + test -x conftest$ac_exeext + }; then : + ac_retval=0 +else + $as_echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + + ac_retval=1 +fi + # Delete the IPA/IPO (Inter Procedural Analysis/Optimization) information + # created by the PGI compiler (conftest_ipa8_conftest.oo), as it would + # interfere with the next link command; also delete a directory that is + # left behind by Apple's compiler. We do this before executing the actions. + rm -rf conftest.dSYM conftest_ipa8_conftest.oo + eval $as_lineno_stack; ${as_lineno_stack:+:} unset as_lineno + as_fn_set_status $ac_retval + +} # ac_fn_c_try_link + +# ac_fn_c_check_header_compile LINENO HEADER VAR INCLUDES +# ------------------------------------------------------- +# Tests whether HEADER exists and can be compiled using the include files in +# INCLUDES, setting the cache variable VAR accordingly. +ac_fn_c_check_header_compile () +{ + as_lineno=${as_lineno-"$1"} as_lineno_stack=as_lineno_stack=$as_lineno_stack + { $as_echo "$as_me:${as_lineno-$LINENO}: checking for $2" >&5 +$as_echo_n "checking for $2... " >&6; } +if eval \${$3+:} false; then : + $as_echo_n "(cached) " >&6 +else + cat confdefs.h - <<_ACEOF >conftest.$ac_ext +/* end confdefs.h. */ +$4 +#include <$2> +_ACEOF +if ac_fn_c_try_compile "$LINENO"; then : + eval "$3=yes" +else + eval "$3=no" +fi +rm -f core conftest.err conftest.$ac_objext conftest.$ac_ext +fi +eval ac_res=\$$3 + { $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_res" >&5 +$as_echo "$ac_res" >&6; } + eval $as_lineno_stack; ${as_lineno_stack:+:} unset as_lineno + +} # ac_fn_c_check_header_compile + +# ac_fn_c_try_cpp LINENO +# ---------------------- +# Try to preprocess conftest.$ac_ext, and return whether this succeeded. +ac_fn_c_try_cpp () +{ + as_lineno=${as_lineno-"$1"} as_lineno_stack=as_lineno_stack=$as_lineno_stack + if { { ac_try="$ac_cpp conftest.$ac_ext" +case "(($ac_try" in + *\"* | *\`* | *\\*) ac_try_echo=\$ac_try;; + *) ac_try_echo=$ac_try;; +esac +eval ac_try_echo="\"\$as_me:${as_lineno-$LINENO}: $ac_try_echo\"" +$as_echo "$ac_try_echo"; } >&5 + (eval "$ac_cpp conftest.$ac_ext") 2>conftest.err + ac_status=$? + if test -s conftest.err; then + grep -v '^ *+' conftest.err >conftest.er1 + cat conftest.er1 >&5 + mv -f conftest.er1 conftest.err + fi + $as_echo "$as_me:${as_lineno-$LINENO}: \$? = $ac_status" >&5 + test $ac_status = 0; } > conftest.i && { + test -z "$ac_c_preproc_warn_flag$ac_c_werror_flag" || + test ! -s conftest.err + }; then : + ac_retval=0 +else + $as_echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + + ac_retval=1 +fi + eval $as_lineno_stack; ${as_lineno_stack:+:} unset as_lineno + as_fn_set_status $ac_retval + +} # ac_fn_c_try_cpp + +# ac_fn_c_try_run LINENO +# ---------------------- +# Try to link conftest.$ac_ext, and return whether this succeeded. Assumes +# that executables *can* be run. +ac_fn_c_try_run () +{ + as_lineno=${as_lineno-"$1"} as_lineno_stack=as_lineno_stack=$as_lineno_stack + if { { ac_try="$ac_link" +case "(($ac_try" in + *\"* | *\`* | *\\*) ac_try_echo=\$ac_try;; + *) ac_try_echo=$ac_try;; +esac +eval ac_try_echo="\"\$as_me:${as_lineno-$LINENO}: $ac_try_echo\"" +$as_echo "$ac_try_echo"; } >&5 + (eval "$ac_link") 2>&5 + ac_status=$? + $as_echo "$as_me:${as_lineno-$LINENO}: \$? = $ac_status" >&5 + test $ac_status = 0; } && { ac_try='./conftest$ac_exeext' + { { case "(($ac_try" in + *\"* | *\`* | *\\*) ac_try_echo=\$ac_try;; + *) ac_try_echo=$ac_try;; +esac +eval ac_try_echo="\"\$as_me:${as_lineno-$LINENO}: $ac_try_echo\"" +$as_echo "$ac_try_echo"; } >&5 + (eval "$ac_try") 2>&5 + ac_status=$? + $as_echo "$as_me:${as_lineno-$LINENO}: \$? = $ac_status" >&5 + test $ac_status = 0; }; }; then : + ac_retval=0 +else + $as_echo "$as_me: program exited with status $ac_status" >&5 + $as_echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + + ac_retval=$ac_status +fi + rm -rf conftest.dSYM conftest_ipa8_conftest.oo + eval $as_lineno_stack; ${as_lineno_stack:+:} unset as_lineno + as_fn_set_status $ac_retval + +} # ac_fn_c_try_run + +# ac_fn_c_check_func LINENO FUNC VAR +# ---------------------------------- +# Tests whether FUNC exists, setting the cache variable VAR accordingly +ac_fn_c_check_func () +{ + as_lineno=${as_lineno-"$1"} as_lineno_stack=as_lineno_stack=$as_lineno_stack + { $as_echo "$as_me:${as_lineno-$LINENO}: checking for $2" >&5 +$as_echo_n "checking for $2... " >&6; } +if eval \${$3+:} false; then : + $as_echo_n "(cached) " >&6 +else + cat confdefs.h - <<_ACEOF >conftest.$ac_ext +/* end confdefs.h. */ +/* Define $2 to an innocuous variant, in case <limits.h> declares $2. + For example, HP-UX 11i <limits.h> declares gettimeofday. */ +#define $2 innocuous_$2 + +/* System header to define __stub macros and hopefully few prototypes, + which can conflict with char $2 (); below. + Prefer <limits.h> to <assert.h> if __STDC__ is defined, since + <limits.h> exists even on freestanding compilers. */ + +#ifdef __STDC__ +# include <limits.h> +#else +# include <assert.h> +#endif + +#undef $2 + +/* Override any GCC internal prototype to avoid an error. + Use char because int might match the return type of a GCC + builtin and then its argument prototype would still apply. */ +#ifdef __cplusplus +extern "C" +#endif +char $2 (); +/* The GNU C library defines this for functions which it implements + to always fail with ENOSYS. Some functions are actually named + something starting with __ and the normal name is an alias. */ +#if defined __stub_$2 || defined __stub___$2 +choke me +#endif + +int +main () +{ +return $2 (); + ; + return 0; +} +_ACEOF +if ac_fn_c_try_link "$LINENO"; then : + eval "$3=yes" +else + eval "$3=no" +fi +rm -f core conftest.err conftest.$ac_objext \ + conftest$ac_exeext conftest.$ac_ext +fi +eval ac_res=\$$3 + { $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_res" >&5 +$as_echo "$ac_res" >&6; } + eval $as_lineno_stack; ${as_lineno_stack:+:} unset as_lineno + +} # ac_fn_c_check_func + +# ac_fn_c_check_header_mongrel LINENO HEADER VAR INCLUDES +# ------------------------------------------------------- +# Tests whether HEADER exists, giving a warning if it cannot be compiled using +# the include files in INCLUDES and setting the cache variable VAR +# accordingly. +ac_fn_c_check_header_mongrel () +{ + as_lineno=${as_lineno-"$1"} as_lineno_stack=as_lineno_stack=$as_lineno_stack + if eval \${$3+:} false; then : + { $as_echo "$as_me:${as_lineno-$LINENO}: checking for $2" >&5 +$as_echo_n "checking for $2... " >&6; } +if eval \${$3+:} false; then : + $as_echo_n "(cached) " >&6 +fi +eval ac_res=\$$3 + { $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_res" >&5 +$as_echo "$ac_res" >&6; } +else + # Is the header compilable? +{ $as_echo "$as_me:${as_lineno-$LINENO}: checking $2 usability" >&5 +$as_echo_n "checking $2 usability... " >&6; } +cat confdefs.h - <<_ACEOF >conftest.$ac_ext +/* end confdefs.h. */ +$4 +#include <$2> +_ACEOF +if ac_fn_c_try_compile "$LINENO"; then : + ac_header_compiler=yes +else + ac_header_compiler=no +fi +rm -f core conftest.err conftest.$ac_objext conftest.$ac_ext +{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_header_compiler" >&5 +$as_echo "$ac_header_compiler" >&6; } + +# Is the header present? +{ $as_echo "$as_me:${as_lineno-$LINENO}: checking $2 presence" >&5 +$as_echo_n "checking $2 presence... " >&6; } +cat confdefs.h - <<_ACEOF >conftest.$ac_ext +/* end confdefs.h. */ +#include <$2> +_ACEOF +if ac_fn_c_try_cpp "$LINENO"; then : + ac_header_preproc=yes +else + ac_header_preproc=no +fi +rm -f conftest.err conftest.i conftest.$ac_ext +{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_header_preproc" >&5 +$as_echo "$ac_header_preproc" >&6; } + +# So? What about this header? +case $ac_header_compiler:$ac_header_preproc:$ac_c_preproc_warn_flag in #(( + yes:no: ) + { $as_echo "$as_me:${as_lineno-$LINENO}: WARNING: $2: accepted by the compiler, rejected by the preprocessor!" >&5 +$as_echo "$as_me: WARNING: $2: accepted by the compiler, rejected by the preprocessor!" >&2;} + { $as_echo "$as_me:${as_lineno-$LINENO}: WARNING: $2: proceeding with the compiler's result" >&5 +$as_echo "$as_me: WARNING: $2: proceeding with the compiler's result" >&2;} + ;; + no:yes:* ) + { $as_echo "$as_me:${as_lineno-$LINENO}: WARNING: $2: present but cannot be compiled" >&5 +$as_echo "$as_me: WARNING: $2: present but cannot be compiled" >&2;} + { $as_echo "$as_me:${as_lineno-$LINENO}: WARNING: $2: check for missing prerequisite headers?" >&5 +$as_echo "$as_me: WARNING: $2: check for missing prerequisite headers?" >&2;} + { $as_echo "$as_me:${as_lineno-$LINENO}: WARNING: $2: see the Autoconf documentation" >&5 +$as_echo "$as_me: WARNING: $2: see the Autoconf documentation" >&2;} + { $as_echo "$as_me:${as_lineno-$LINENO}: WARNING: $2: section \"Present But Cannot Be Compiled\"" >&5 +$as_echo "$as_me: WARNING: $2: section \"Present But Cannot Be Compiled\"" >&2;} + { $as_echo "$as_me:${as_lineno-$LINENO}: WARNING: $2: proceeding with the compiler's result" >&5 +$as_echo "$as_me: WARNING: $2: proceeding with the compiler's result" >&2;} +( $as_echo "## ---------------------------- ## +## Report this to tex-k@tug.org ## +## ---------------------------- ##" + ) | sed "s/^/$as_me: WARNING: /" >&2 + ;; +esac + { $as_echo "$as_me:${as_lineno-$LINENO}: checking for $2" >&5 +$as_echo_n "checking for $2... " >&6; } +if eval \${$3+:} false; then : + $as_echo_n "(cached) " >&6 +else + eval "$3=\$ac_header_compiler" +fi +eval ac_res=\$$3 + { $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_res" >&5 +$as_echo "$ac_res" >&6; } +fi + eval $as_lineno_stack; ${as_lineno_stack:+:} unset as_lineno + +} # ac_fn_c_check_header_mongrel + +# ac_fn_c_check_type LINENO TYPE VAR INCLUDES +# ------------------------------------------- +# Tests whether TYPE exists after having included INCLUDES, setting cache +# variable VAR accordingly. +ac_fn_c_check_type () +{ + as_lineno=${as_lineno-"$1"} as_lineno_stack=as_lineno_stack=$as_lineno_stack + { $as_echo "$as_me:${as_lineno-$LINENO}: checking for $2" >&5 +$as_echo_n "checking for $2... " >&6; } +if eval \${$3+:} false; then : + $as_echo_n "(cached) " >&6 +else + eval "$3=no" + cat confdefs.h - <<_ACEOF >conftest.$ac_ext +/* end confdefs.h. */ +$4 +int +main () +{ +if (sizeof ($2)) + return 0; + ; + return 0; +} +_ACEOF +if ac_fn_c_try_compile "$LINENO"; then : + cat confdefs.h - <<_ACEOF >conftest.$ac_ext +/* end confdefs.h. */ +$4 +int +main () +{ +if (sizeof (($2))) + return 0; + ; + return 0; +} +_ACEOF +if ac_fn_c_try_compile "$LINENO"; then : + +else + eval "$3=yes" +fi +rm -f core conftest.err conftest.$ac_objext conftest.$ac_ext +fi +rm -f core conftest.err conftest.$ac_objext conftest.$ac_ext +fi +eval ac_res=\$$3 + { $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_res" >&5 +$as_echo "$ac_res" >&6; } + eval $as_lineno_stack; ${as_lineno_stack:+:} unset as_lineno + +} # ac_fn_c_check_type + +# ac_fn_c_find_intX_t LINENO BITS VAR +# ----------------------------------- +# Finds a signed integer type with width BITS, setting cache variable VAR +# accordingly. +ac_fn_c_find_intX_t () +{ + as_lineno=${as_lineno-"$1"} as_lineno_stack=as_lineno_stack=$as_lineno_stack + { $as_echo "$as_me:${as_lineno-$LINENO}: checking for int$2_t" >&5 +$as_echo_n "checking for int$2_t... " >&6; } +if eval \${$3+:} false; then : + $as_echo_n "(cached) " >&6 +else + eval "$3=no" + # Order is important - never check a type that is potentially smaller + # than half of the expected target width. + for ac_type in int$2_t 'int' 'long int' \ + 'long long int' 'short int' 'signed char'; do + cat confdefs.h - <<_ACEOF >conftest.$ac_ext +/* end confdefs.h. */ +$ac_includes_default + enum { N = $2 / 2 - 1 }; +int +main () +{ +static int test_array [1 - 2 * !(0 < ($ac_type) ((((($ac_type) 1 << N) << N) - 1) * 2 + 1))]; +test_array [0] = 0; +return test_array [0]; + + ; + return 0; +} +_ACEOF +if ac_fn_c_try_compile "$LINENO"; then : + cat confdefs.h - <<_ACEOF >conftest.$ac_ext +/* end confdefs.h. */ +$ac_includes_default + enum { N = $2 / 2 - 1 }; +int +main () +{ +static int test_array [1 - 2 * !(($ac_type) ((((($ac_type) 1 << N) << N) - 1) * 2 + 1) + < ($ac_type) ((((($ac_type) 1 << N) << N) - 1) * 2 + 2))]; +test_array [0] = 0; +return test_array [0]; + + ; + return 0; +} +_ACEOF +if ac_fn_c_try_compile "$LINENO"; then : + +else + case $ac_type in #( + int$2_t) : + eval "$3=yes" ;; #( + *) : + eval "$3=\$ac_type" ;; +esac +fi +rm -f core conftest.err conftest.$ac_objext conftest.$ac_ext +fi +rm -f core conftest.err conftest.$ac_objext conftest.$ac_ext + if eval test \"x\$"$3"\" = x"no"; then : + +else + break +fi + done +fi +eval ac_res=\$$3 + { $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_res" >&5 +$as_echo "$ac_res" >&6; } + eval $as_lineno_stack; ${as_lineno_stack:+:} unset as_lineno + +} # ac_fn_c_find_intX_t + +# ac_fn_c_find_uintX_t LINENO BITS VAR +# ------------------------------------ +# Finds an unsigned integer type with width BITS, setting cache variable VAR +# accordingly. +ac_fn_c_find_uintX_t () +{ + as_lineno=${as_lineno-"$1"} as_lineno_stack=as_lineno_stack=$as_lineno_stack + { $as_echo "$as_me:${as_lineno-$LINENO}: checking for uint$2_t" >&5 +$as_echo_n "checking for uint$2_t... " >&6; } +if eval \${$3+:} false; then : + $as_echo_n "(cached) " >&6 +else + eval "$3=no" + # Order is important - never check a type that is potentially smaller + # than half of the expected target width. + for ac_type in uint$2_t 'unsigned int' 'unsigned long int' \ + 'unsigned long long int' 'unsigned short int' 'unsigned char'; do + cat confdefs.h - <<_ACEOF >conftest.$ac_ext +/* end confdefs.h. */ +$ac_includes_default +int +main () +{ +static int test_array [1 - 2 * !((($ac_type) -1 >> ($2 / 2 - 1)) >> ($2 / 2 - 1) == 3)]; +test_array [0] = 0; +return test_array [0]; + + ; + return 0; +} +_ACEOF +if ac_fn_c_try_compile "$LINENO"; then : + case $ac_type in #( + uint$2_t) : + eval "$3=yes" ;; #( + *) : + eval "$3=\$ac_type" ;; +esac +fi +rm -f core conftest.err conftest.$ac_objext conftest.$ac_ext + if eval test \"x\$"$3"\" = x"no"; then : + +else + break +fi + done +fi +eval ac_res=\$$3 + { $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_res" >&5 +$as_echo "$ac_res" >&6; } + eval $as_lineno_stack; ${as_lineno_stack:+:} unset as_lineno + +} # ac_fn_c_find_uintX_t + +# ac_fn_c_check_decl LINENO SYMBOL VAR INCLUDES +# --------------------------------------------- +# Tests whether SYMBOL is declared in INCLUDES, setting cache variable VAR +# accordingly. +ac_fn_c_check_decl () +{ + as_lineno=${as_lineno-"$1"} as_lineno_stack=as_lineno_stack=$as_lineno_stack + as_decl_name=`echo $2|sed 's/ *(.*//'` + as_decl_use=`echo $2|sed -e 's/(/((/' -e 's/)/) 0&/' -e 's/,/) 0& (/g'` + { $as_echo "$as_me:${as_lineno-$LINENO}: checking whether $as_decl_name is declared" >&5 +$as_echo_n "checking whether $as_decl_name is declared... " >&6; } +if eval \${$3+:} false; then : + $as_echo_n "(cached) " >&6 +else + cat confdefs.h - <<_ACEOF >conftest.$ac_ext +/* end confdefs.h. */ +$4 +int +main () +{ +#ifndef $as_decl_name +#ifdef __cplusplus + (void) $as_decl_use; +#else + (void) $as_decl_name; +#endif +#endif + + ; + return 0; +} +_ACEOF +if ac_fn_c_try_compile "$LINENO"; then : + eval "$3=yes" +else + eval "$3=no" +fi +rm -f core conftest.err conftest.$ac_objext conftest.$ac_ext +fi +eval ac_res=\$$3 + { $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_res" >&5 +$as_echo "$ac_res" >&6; } + eval $as_lineno_stack; ${as_lineno_stack:+:} unset as_lineno + +} # ac_fn_c_check_decl + +# ac_fn_c_check_member LINENO AGGR MEMBER VAR INCLUDES +# ---------------------------------------------------- +# Tries to find if the field MEMBER exists in type AGGR, after including +# INCLUDES, setting cache variable VAR accordingly. +ac_fn_c_check_member () +{ + as_lineno=${as_lineno-"$1"} as_lineno_stack=as_lineno_stack=$as_lineno_stack + { $as_echo "$as_me:${as_lineno-$LINENO}: checking for $2.$3" >&5 +$as_echo_n "checking for $2.$3... " >&6; } +if eval \${$4+:} false; then : + $as_echo_n "(cached) " >&6 +else + cat confdefs.h - <<_ACEOF >conftest.$ac_ext +/* end confdefs.h. */ +$5 +int +main () +{ +static $2 ac_aggr; +if (ac_aggr.$3) +return 0; + ; + return 0; +} +_ACEOF +if ac_fn_c_try_compile "$LINENO"; then : + eval "$4=yes" +else + cat confdefs.h - <<_ACEOF >conftest.$ac_ext +/* end confdefs.h. */ +$5 +int +main () +{ +static $2 ac_aggr; +if (sizeof ac_aggr.$3) +return 0; + ; + return 0; +} +_ACEOF +if ac_fn_c_try_compile "$LINENO"; then : + eval "$4=yes" +else + eval "$4=no" +fi +rm -f core conftest.err conftest.$ac_objext conftest.$ac_ext +fi +rm -f core conftest.err conftest.$ac_objext conftest.$ac_ext +fi +eval ac_res=\$$4 + { $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_res" >&5 +$as_echo "$ac_res" >&6; } + eval $as_lineno_stack; ${as_lineno_stack:+:} unset as_lineno + +} # ac_fn_c_check_member +cat >config.log <<_ACEOF +This file contains any messages produced by compilers while +running configure, to aid debugging if configure makes a mistake. + +It was created by dvipng (TeX Live) $as_me 1.17, which was +generated by GNU Autoconf 2.69. Invocation command line was + + $ $0 $@ + +_ACEOF +exec 5>>config.log +{ +cat <<_ASUNAME +## --------- ## +## Platform. ## +## --------- ## + +hostname = `(hostname || uname -n) 2>/dev/null | sed 1q` +uname -m = `(uname -m) 2>/dev/null || echo unknown` +uname -r = `(uname -r) 2>/dev/null || echo unknown` +uname -s = `(uname -s) 2>/dev/null || echo unknown` +uname -v = `(uname -v) 2>/dev/null || echo unknown` + +/usr/bin/uname -p = `(/usr/bin/uname -p) 2>/dev/null || echo unknown` +/bin/uname -X = `(/bin/uname -X) 2>/dev/null || echo unknown` + +/bin/arch = `(/bin/arch) 2>/dev/null || echo unknown` +/usr/bin/arch -k = `(/usr/bin/arch -k) 2>/dev/null || echo unknown` +/usr/convex/getsysinfo = `(/usr/convex/getsysinfo) 2>/dev/null || echo unknown` +/usr/bin/hostinfo = `(/usr/bin/hostinfo) 2>/dev/null || echo unknown` +/bin/machine = `(/bin/machine) 2>/dev/null || echo unknown` +/usr/bin/oslevel = `(/usr/bin/oslevel) 2>/dev/null || echo unknown` +/bin/universe = `(/bin/universe) 2>/dev/null || echo unknown` + +_ASUNAME + +as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in $PATH +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + $as_echo "PATH: $as_dir" + done +IFS=$as_save_IFS + +} >&5 + +cat >&5 <<_ACEOF + + +## ----------- ## +## Core tests. ## +## ----------- ## + +_ACEOF + + +# Keep a trace of the command line. +# Strip out --no-create and --no-recursion so they do not pile up. +# Strip out --silent because we don't want to record it for future runs. +# Also quote any args containing shell meta-characters. +# Make two passes to allow for proper duplicate-argument suppression. +ac_configure_args= +ac_configure_args0= +ac_configure_args1= +ac_must_keep_next=false +for ac_pass in 1 2 +do + for ac_arg + do + case $ac_arg in + -no-create | --no-c* | -n | -no-recursion | --no-r*) continue ;; + -q | -quiet | --quiet | --quie | --qui | --qu | --q \ + | -silent | --silent | --silen | --sile | --sil) + continue ;; + *\'*) + ac_arg=`$as_echo "$ac_arg" | sed "s/'/'\\\\\\\\''/g"` ;; + esac + case $ac_pass in + 1) as_fn_append ac_configure_args0 " '$ac_arg'" ;; + 2) + as_fn_append ac_configure_args1 " '$ac_arg'" + if test $ac_must_keep_next = true; then + ac_must_keep_next=false # Got value, back to normal. + else + case $ac_arg in + *=* | --config-cache | -C | -disable-* | --disable-* \ + | -enable-* | --enable-* | -gas | --g* | -nfp | --nf* \ + | -q | -quiet | --q* | -silent | --sil* | -v | -verb* \ + | -with-* | --with-* | -without-* | --without-* | --x) + case "$ac_configure_args0 " in + "$ac_configure_args1"*" '$ac_arg' "* ) continue ;; + esac + ;; + -* ) ac_must_keep_next=true ;; + esac + fi + as_fn_append ac_configure_args " '$ac_arg'" + ;; + esac + done +done +{ ac_configure_args0=; unset ac_configure_args0;} +{ ac_configure_args1=; unset ac_configure_args1;} + +# When interrupted or exit'd, cleanup temporary files, and complete +# config.log. We remove comments because anyway the quotes in there +# would cause problems or look ugly. +# WARNING: Use '\'' to represent an apostrophe within the trap. +# WARNING: Do not start the trap code with a newline, due to a FreeBSD 4.0 bug. +trap 'exit_status=$? + # Save into config.log some information that might help in debugging. + { + echo + + $as_echo "## ---------------- ## +## Cache variables. ## +## ---------------- ##" + echo + # The following way of writing the cache mishandles newlines in values, +( + for ac_var in `(set) 2>&1 | sed -n '\''s/^\([a-zA-Z_][a-zA-Z0-9_]*\)=.*/\1/p'\''`; do + eval ac_val=\$$ac_var + case $ac_val in #( + *${as_nl}*) + case $ac_var in #( + *_cv_*) { $as_echo "$as_me:${as_lineno-$LINENO}: WARNING: cache variable $ac_var contains a newline" >&5 +$as_echo "$as_me: WARNING: cache variable $ac_var contains a newline" >&2;} ;; + esac + case $ac_var in #( + _ | IFS | as_nl) ;; #( + BASH_ARGV | BASH_SOURCE) eval $ac_var= ;; #( + *) { eval $ac_var=; unset $ac_var;} ;; + esac ;; + esac + done + (set) 2>&1 | + case $as_nl`(ac_space='\'' '\''; set) 2>&1` in #( + *${as_nl}ac_space=\ *) + sed -n \ + "s/'\''/'\''\\\\'\'''\''/g; + s/^\\([_$as_cr_alnum]*_cv_[_$as_cr_alnum]*\\)=\\(.*\\)/\\1='\''\\2'\''/p" + ;; #( + *) + sed -n "/^[_$as_cr_alnum]*_cv_[_$as_cr_alnum]*=/p" + ;; + esac | + sort +) + echo + + $as_echo "## ----------------- ## +## Output variables. ## +## ----------------- ##" + echo + for ac_var in $ac_subst_vars + do + eval ac_val=\$$ac_var + case $ac_val in + *\'\''*) ac_val=`$as_echo "$ac_val" | sed "s/'\''/'\''\\\\\\\\'\'''\''/g"`;; + esac + $as_echo "$ac_var='\''$ac_val'\''" + done | sort + echo + + if test -n "$ac_subst_files"; then + $as_echo "## ------------------- ## +## File substitutions. ## +## ------------------- ##" + echo + for ac_var in $ac_subst_files + do + eval ac_val=\$$ac_var + case $ac_val in + *\'\''*) ac_val=`$as_echo "$ac_val" | sed "s/'\''/'\''\\\\\\\\'\'''\''/g"`;; + esac + $as_echo "$ac_var='\''$ac_val'\''" + done | sort + echo + fi + + if test -s confdefs.h; then + $as_echo "## ----------- ## +## confdefs.h. ## +## ----------- ##" + echo + cat confdefs.h + echo + fi + test "$ac_signal" != 0 && + $as_echo "$as_me: caught signal $ac_signal" + $as_echo "$as_me: exit $exit_status" + } >&5 + rm -f core *.core core.conftest.* && + rm -f -r conftest* confdefs* conf$$* $ac_clean_files && + exit $exit_status +' 0 +for ac_signal in 1 2 13 15; do + trap 'ac_signal='$ac_signal'; as_fn_exit 1' $ac_signal +done +ac_signal=0 + +# confdefs.h avoids OS command line length limits that DEFS can exceed. +rm -f -r conftest* confdefs.h + +$as_echo "/* confdefs.h */" > confdefs.h + +# Predefined preprocessor variables. + +cat >>confdefs.h <<_ACEOF +#define PACKAGE_NAME "$PACKAGE_NAME" +_ACEOF + +cat >>confdefs.h <<_ACEOF +#define PACKAGE_TARNAME "$PACKAGE_TARNAME" +_ACEOF + +cat >>confdefs.h <<_ACEOF +#define PACKAGE_VERSION "$PACKAGE_VERSION" +_ACEOF + +cat >>confdefs.h <<_ACEOF +#define PACKAGE_STRING "$PACKAGE_STRING" +_ACEOF + +cat >>confdefs.h <<_ACEOF +#define PACKAGE_BUGREPORT "$PACKAGE_BUGREPORT" +_ACEOF + +cat >>confdefs.h <<_ACEOF +#define PACKAGE_URL "$PACKAGE_URL" +_ACEOF + + +# Let the site file select an alternate cache file if it wants to. +# Prefer an explicitly selected file to automatically selected ones. +ac_site_file1=NONE +ac_site_file2=NONE +if test -n "$CONFIG_SITE"; then + # We do not want a PATH search for config.site. + case $CONFIG_SITE in #(( + -*) ac_site_file1=./$CONFIG_SITE;; + */*) ac_site_file1=$CONFIG_SITE;; + *) ac_site_file1=./$CONFIG_SITE;; + esac +elif test "x$prefix" != xNONE; then + ac_site_file1=$prefix/share/config.site + ac_site_file2=$prefix/etc/config.site +else + ac_site_file1=$ac_default_prefix/share/config.site + ac_site_file2=$ac_default_prefix/etc/config.site +fi +for ac_site_file in "$ac_site_file1" "$ac_site_file2" +do + test "x$ac_site_file" = xNONE && continue + if test /dev/null != "$ac_site_file" && test -r "$ac_site_file"; then + { $as_echo "$as_me:${as_lineno-$LINENO}: loading site script $ac_site_file" >&5 +$as_echo "$as_me: loading site script $ac_site_file" >&6;} + sed 's/^/| /' "$ac_site_file" >&5 + . "$ac_site_file" \ + || { { $as_echo "$as_me:${as_lineno-$LINENO}: error: in \`$ac_pwd':" >&5 +$as_echo "$as_me: error: in \`$ac_pwd':" >&2;} +as_fn_error $? "failed to load site script $ac_site_file +See \`config.log' for more details" "$LINENO" 5; } + fi +done + +if test -r "$cache_file"; then + # Some versions of bash will fail to source /dev/null (special files + # actually), so we avoid doing that. DJGPP emulates it as a regular file. + if test /dev/null != "$cache_file" && test -f "$cache_file"; then + { $as_echo "$as_me:${as_lineno-$LINENO}: loading cache $cache_file" >&5 +$as_echo "$as_me: loading cache $cache_file" >&6;} + case $cache_file in + [\\/]* | ?:[\\/]* ) . "$cache_file";; + *) . "./$cache_file";; + esac + fi +else + { $as_echo "$as_me:${as_lineno-$LINENO}: creating cache $cache_file" >&5 +$as_echo "$as_me: creating cache $cache_file" >&6;} + >$cache_file +fi + +as_fn_append ac_header_list " stdlib.h" +as_fn_append ac_header_list " unistd.h" +as_fn_append ac_header_list " sys/param.h" +# Check that the precious variables saved in the cache have kept the same +# value. +ac_cache_corrupted=false +for ac_var in $ac_precious_vars; do + eval ac_old_set=\$ac_cv_env_${ac_var}_set + eval ac_new_set=\$ac_env_${ac_var}_set + eval ac_old_val=\$ac_cv_env_${ac_var}_value + eval ac_new_val=\$ac_env_${ac_var}_value + case $ac_old_set,$ac_new_set in + set,) + { $as_echo "$as_me:${as_lineno-$LINENO}: error: \`$ac_var' was set to \`$ac_old_val' in the previous run" >&5 +$as_echo "$as_me: error: \`$ac_var' was set to \`$ac_old_val' in the previous run" >&2;} + ac_cache_corrupted=: ;; + ,set) + { $as_echo "$as_me:${as_lineno-$LINENO}: error: \`$ac_var' was not set in the previous run" >&5 +$as_echo "$as_me: error: \`$ac_var' was not set in the previous run" >&2;} + ac_cache_corrupted=: ;; + ,);; + *) + if test "x$ac_old_val" != "x$ac_new_val"; then + # differences in whitespace do not lead to failure. + ac_old_val_w=`echo x $ac_old_val` + ac_new_val_w=`echo x $ac_new_val` + if test "$ac_old_val_w" != "$ac_new_val_w"; then + { $as_echo "$as_me:${as_lineno-$LINENO}: error: \`$ac_var' has changed since the previous run:" >&5 +$as_echo "$as_me: error: \`$ac_var' has changed since the previous run:" >&2;} + ac_cache_corrupted=: + else + { $as_echo "$as_me:${as_lineno-$LINENO}: warning: ignoring whitespace changes in \`$ac_var' since the previous run:" >&5 +$as_echo "$as_me: warning: ignoring whitespace changes in \`$ac_var' since the previous run:" >&2;} + eval $ac_var=\$ac_old_val + fi + { $as_echo "$as_me:${as_lineno-$LINENO}: former value: \`$ac_old_val'" >&5 +$as_echo "$as_me: former value: \`$ac_old_val'" >&2;} + { $as_echo "$as_me:${as_lineno-$LINENO}: current value: \`$ac_new_val'" >&5 +$as_echo "$as_me: current value: \`$ac_new_val'" >&2;} + fi;; + esac + # Pass precious variables to config.status. + if test "$ac_new_set" = set; then + case $ac_new_val in + *\'*) ac_arg=$ac_var=`$as_echo "$ac_new_val" | sed "s/'/'\\\\\\\\''/g"` ;; + *) ac_arg=$ac_var=$ac_new_val ;; + esac + case " $ac_configure_args " in + *" '$ac_arg' "*) ;; # Avoid dups. Use of quotes ensures accuracy. + *) as_fn_append ac_configure_args " '$ac_arg'" ;; + esac + fi +done +if $ac_cache_corrupted; then + { $as_echo "$as_me:${as_lineno-$LINENO}: error: in \`$ac_pwd':" >&5 +$as_echo "$as_me: error: in \`$ac_pwd':" >&2;} + { $as_echo "$as_me:${as_lineno-$LINENO}: error: changes in the environment can compromise the build" >&5 +$as_echo "$as_me: error: changes in the environment can compromise the build" >&2;} + as_fn_error $? "run \`make distclean' and/or \`rm $cache_file' and start over" "$LINENO" 5 +fi +## -------------------- ## +## Main body of script. ## +## -------------------- ## + +ac_ext=c +ac_cpp='$CPP $CPPFLAGS' +ac_compile='$CC -c $CFLAGS $CPPFLAGS conftest.$ac_ext >&5' +ac_link='$CC -o conftest$ac_exeext $CFLAGS $CPPFLAGS $LDFLAGS conftest.$ac_ext $LIBS >&5' +ac_compiler_gnu=$ac_cv_c_compiler_gnu + + + + +ac_aux_dir= +for ac_dir in ../../build-aux "$srcdir"/../../build-aux; do + if test -f "$ac_dir/install-sh"; then + ac_aux_dir=$ac_dir + ac_install_sh="$ac_aux_dir/install-sh -c" + break + elif test -f "$ac_dir/install.sh"; then + ac_aux_dir=$ac_dir + ac_install_sh="$ac_aux_dir/install.sh -c" + break + elif test -f "$ac_dir/shtool"; then + ac_aux_dir=$ac_dir + ac_install_sh="$ac_aux_dir/shtool install -c" + break + fi +done +if test -z "$ac_aux_dir"; then + as_fn_error $? "cannot find install-sh, install.sh, or shtool in ../../build-aux \"$srcdir\"/../../build-aux" "$LINENO" 5 +fi + +# These three variables are undocumented and unsupported, +# and are intended to be withdrawn in a future Autoconf release. +# They can cause serious problems if a builder's source tree is in a directory +# whose full name contains unusual characters. +ac_config_guess="$SHELL $ac_aux_dir/config.guess" # Please don't use this var. +ac_config_sub="$SHELL $ac_aux_dir/config.sub" # Please don't use this var. +ac_configure="$SHELL $ac_aux_dir/configure" # Please don't use this var. + + + + +# Common code for all programs using libkpathsea. +am__api_version='1.16' + +# Find a good install program. We prefer a C program (faster), +# so one script is as good as another. But avoid the broken or +# incompatible versions: +# SysV /etc/install, /usr/sbin/install +# SunOS /usr/etc/install +# IRIX /sbin/install +# AIX /bin/install +# AmigaOS /C/install, which installs bootblocks on floppy discs +# AIX 4 /usr/bin/installbsd, which doesn't work without a -g flag +# AFS /usr/afsws/bin/install, which mishandles nonexistent args +# SVR4 /usr/ucb/install, which tries to use the nonexistent group "staff" +# OS/2's system install, which has a completely different semantic +# ./install, which can be erroneously created by make from ./install.sh. +# Reject install programs that cannot install multiple files. +{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for a BSD-compatible install" >&5 +$as_echo_n "checking for a BSD-compatible install... " >&6; } +if test -z "$INSTALL"; then +if ${ac_cv_path_install+:} false; then : + $as_echo_n "(cached) " >&6 +else + as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in $PATH +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + # Account for people who put trailing slashes in PATH elements. +case $as_dir/ in #(( + ./ | .// | /[cC]/* | \ + /etc/* | /usr/sbin/* | /usr/etc/* | /sbin/* | /usr/afsws/bin/* | \ + ?:[\\/]os2[\\/]install[\\/]* | ?:[\\/]OS2[\\/]INSTALL[\\/]* | \ + /usr/ucb/* ) ;; + *) + # OSF1 and SCO ODT 3.0 have their own names for install. + # Don't use installbsd from OSF since it installs stuff as root + # by default. + for ac_prog in ginstall scoinst install; do + for ac_exec_ext in '' $ac_executable_extensions; do + if as_fn_executable_p "$as_dir/$ac_prog$ac_exec_ext"; then + if test $ac_prog = install && + grep dspmsg "$as_dir/$ac_prog$ac_exec_ext" >/dev/null 2>&1; then + # AIX install. It has an incompatible calling convention. + : + elif test $ac_prog = install && + grep pwplus "$as_dir/$ac_prog$ac_exec_ext" >/dev/null 2>&1; then + # program-specific install script used by HP pwplus--don't use. + : + else + rm -rf conftest.one conftest.two conftest.dir + echo one > conftest.one + echo two > conftest.two + mkdir conftest.dir + if "$as_dir/$ac_prog$ac_exec_ext" -c conftest.one conftest.two "`pwd`/conftest.dir" && + test -s conftest.one && test -s conftest.two && + test -s conftest.dir/conftest.one && + test -s conftest.dir/conftest.two + then + ac_cv_path_install="$as_dir/$ac_prog$ac_exec_ext -c" + break 3 + fi + fi + fi + done + done + ;; +esac + + done +IFS=$as_save_IFS + +rm -rf conftest.one conftest.two conftest.dir + +fi + if test "${ac_cv_path_install+set}" = set; then + INSTALL=$ac_cv_path_install + else + # As a last resort, use the slow shell script. Don't cache a + # value for INSTALL within a source directory, because that will + # break other packages using the cache if that directory is + # removed, or if the value is a relative name. + INSTALL=$ac_install_sh + fi +fi +{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $INSTALL" >&5 +$as_echo "$INSTALL" >&6; } + +# Use test -z because SunOS4 sh mishandles braces in ${var-val}. +# It thinks the first close brace ends the variable substitution. +test -z "$INSTALL_PROGRAM" && INSTALL_PROGRAM='${INSTALL}' + +test -z "$INSTALL_SCRIPT" && INSTALL_SCRIPT='${INSTALL}' + +test -z "$INSTALL_DATA" && INSTALL_DATA='${INSTALL} -m 644' + +{ $as_echo "$as_me:${as_lineno-$LINENO}: checking whether build environment is sane" >&5 +$as_echo_n "checking whether build environment is sane... " >&6; } +# Reject unsafe characters in $srcdir or the absolute working directory +# name. Accept space and tab only in the latter. +am_lf=' +' +case `pwd` in + *[\\\"\#\$\&\'\`$am_lf]*) + as_fn_error $? "unsafe absolute working directory name" "$LINENO" 5;; +esac +case $srcdir in + *[\\\"\#\$\&\'\`$am_lf\ \ ]*) + as_fn_error $? "unsafe srcdir value: '$srcdir'" "$LINENO" 5;; +esac + +# Do 'set' in a subshell so we don't clobber the current shell's +# arguments. Must try -L first in case configure is actually a +# symlink; some systems play weird games with the mod time of symlinks +# (eg FreeBSD returns the mod time of the symlink's containing +# directory). +if ( + am_has_slept=no + for am_try in 1 2; do + echo "timestamp, slept: $am_has_slept" > conftest.file + set X `ls -Lt "$srcdir/configure" conftest.file 2> /dev/null` + if test "$*" = "X"; then + # -L didn't work. + set X `ls -t "$srcdir/configure" conftest.file` + fi + if test "$*" != "X $srcdir/configure conftest.file" \ + && test "$*" != "X conftest.file $srcdir/configure"; then + + # If neither matched, then we have a broken ls. This can happen + # if, for instance, CONFIG_SHELL is bash and it inherits a + # broken ls alias from the environment. This has actually + # happened. Such a system could not be considered "sane". + as_fn_error $? "ls -t appears to fail. Make sure there is not a broken + alias in your environment" "$LINENO" 5 + fi + if test "$2" = conftest.file || test $am_try -eq 2; then + break + fi + # Just in case. + sleep 1 + am_has_slept=yes + done + test "$2" = conftest.file + ) +then + # Ok. + : +else + as_fn_error $? "newly created file is older than distributed files! +Check your system clock" "$LINENO" 5 +fi +{ $as_echo "$as_me:${as_lineno-$LINENO}: result: yes" >&5 +$as_echo "yes" >&6; } +# If we didn't sleep, we still need to ensure time stamps of config.status and +# generated files are strictly newer. +am_sleep_pid= +if grep 'slept: no' conftest.file >/dev/null 2>&1; then + ( sleep 1 ) & + am_sleep_pid=$! +fi + +rm -f conftest.file + +test "$program_prefix" != NONE && + program_transform_name="s&^&$program_prefix&;$program_transform_name" +# Use a double $ so make ignores it. +test "$program_suffix" != NONE && + program_transform_name="s&\$&$program_suffix&;$program_transform_name" +# Double any \ or $. +# By default was `s,x,x', remove it if useless. +ac_script='s/[\\$]/&&/g;s/;s,x,x,$//' +program_transform_name=`$as_echo "$program_transform_name" | sed "$ac_script"` + +# Expand $ac_aux_dir to an absolute path. +am_aux_dir=`cd "$ac_aux_dir" && pwd` + +if test x"${MISSING+set}" != xset; then + MISSING="\${SHELL} '$am_aux_dir/missing'" +fi +# Use eval to expand $SHELL +if eval "$MISSING --is-lightweight"; then + am_missing_run="$MISSING " +else + am_missing_run= + { $as_echo "$as_me:${as_lineno-$LINENO}: WARNING: 'missing' script is too old or missing" >&5 +$as_echo "$as_me: WARNING: 'missing' script is too old or missing" >&2;} +fi + +if test x"${install_sh+set}" != xset; then + case $am_aux_dir in + *\ * | *\ *) + install_sh="\${SHELL} '$am_aux_dir/install-sh'" ;; + *) + install_sh="\${SHELL} $am_aux_dir/install-sh" + esac +fi + +# Installed binaries are usually stripped using 'strip' when the user +# run "make install-strip". However 'strip' might not be the right +# tool to use in cross-compilation environments, therefore Automake +# will honor the 'STRIP' environment variable to overrule this program. +if test "$cross_compiling" != no; then + if test -n "$ac_tool_prefix"; then + # Extract the first word of "${ac_tool_prefix}strip", so it can be a program name with args. +set dummy ${ac_tool_prefix}strip; ac_word=$2 +{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $ac_word" >&5 +$as_echo_n "checking for $ac_word... " >&6; } +if ${ac_cv_prog_STRIP+:} false; then : + $as_echo_n "(cached) " >&6 +else + if test -n "$STRIP"; then + ac_cv_prog_STRIP="$STRIP" # Let the user override the test. +else +as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in $PATH +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + for ac_exec_ext in '' $ac_executable_extensions; do + if as_fn_executable_p "$as_dir/$ac_word$ac_exec_ext"; then + ac_cv_prog_STRIP="${ac_tool_prefix}strip" + $as_echo "$as_me:${as_lineno-$LINENO}: found $as_dir/$ac_word$ac_exec_ext" >&5 + break 2 + fi +done + done +IFS=$as_save_IFS + +fi +fi +STRIP=$ac_cv_prog_STRIP +if test -n "$STRIP"; then + { $as_echo "$as_me:${as_lineno-$LINENO}: result: $STRIP" >&5 +$as_echo "$STRIP" >&6; } +else + { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5 +$as_echo "no" >&6; } +fi + + +fi +if test -z "$ac_cv_prog_STRIP"; then + ac_ct_STRIP=$STRIP + # Extract the first word of "strip", so it can be a program name with args. +set dummy strip; ac_word=$2 +{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $ac_word" >&5 +$as_echo_n "checking for $ac_word... " >&6; } +if ${ac_cv_prog_ac_ct_STRIP+:} false; then : + $as_echo_n "(cached) " >&6 +else + if test -n "$ac_ct_STRIP"; then + ac_cv_prog_ac_ct_STRIP="$ac_ct_STRIP" # Let the user override the test. +else +as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in $PATH +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + for ac_exec_ext in '' $ac_executable_extensions; do + if as_fn_executable_p "$as_dir/$ac_word$ac_exec_ext"; then + ac_cv_prog_ac_ct_STRIP="strip" + $as_echo "$as_me:${as_lineno-$LINENO}: found $as_dir/$ac_word$ac_exec_ext" >&5 + break 2 + fi +done + done +IFS=$as_save_IFS + +fi +fi +ac_ct_STRIP=$ac_cv_prog_ac_ct_STRIP +if test -n "$ac_ct_STRIP"; then + { $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_ct_STRIP" >&5 +$as_echo "$ac_ct_STRIP" >&6; } +else + { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5 +$as_echo "no" >&6; } +fi + + if test "x$ac_ct_STRIP" = x; then + STRIP=":" + else + case $cross_compiling:$ac_tool_warned in +yes:) +{ $as_echo "$as_me:${as_lineno-$LINENO}: WARNING: using cross tools not prefixed with host triplet" >&5 +$as_echo "$as_me: WARNING: using cross tools not prefixed with host triplet" >&2;} +ac_tool_warned=yes ;; +esac + STRIP=$ac_ct_STRIP + fi +else + STRIP="$ac_cv_prog_STRIP" +fi + +fi +INSTALL_STRIP_PROGRAM="\$(install_sh) -c -s" + +{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for a thread-safe mkdir -p" >&5 +$as_echo_n "checking for a thread-safe mkdir -p... " >&6; } +if test -z "$MKDIR_P"; then + if ${ac_cv_path_mkdir+:} false; then : + $as_echo_n "(cached) " >&6 +else + as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in $PATH$PATH_SEPARATOR/opt/sfw/bin +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + for ac_prog in mkdir gmkdir; do + for ac_exec_ext in '' $ac_executable_extensions; do + as_fn_executable_p "$as_dir/$ac_prog$ac_exec_ext" || continue + case `"$as_dir/$ac_prog$ac_exec_ext" --version 2>&1` in #( + 'mkdir (GNU coreutils) '* | \ + 'mkdir (coreutils) '* | \ + 'mkdir (fileutils) '4.1*) + ac_cv_path_mkdir=$as_dir/$ac_prog$ac_exec_ext + break 3;; + esac + done + done + done +IFS=$as_save_IFS + +fi + + test -d ./--version && rmdir ./--version + if test "${ac_cv_path_mkdir+set}" = set; then + MKDIR_P="$ac_cv_path_mkdir -p" + else + # As a last resort, use the slow shell script. Don't cache a + # value for MKDIR_P within a source directory, because that will + # break other packages using the cache if that directory is + # removed, or if the value is a relative name. + MKDIR_P="$ac_install_sh -d" + fi +fi +{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $MKDIR_P" >&5 +$as_echo "$MKDIR_P" >&6; } + +for ac_prog in gawk mawk nawk awk +do + # Extract the first word of "$ac_prog", so it can be a program name with args. +set dummy $ac_prog; ac_word=$2 +{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $ac_word" >&5 +$as_echo_n "checking for $ac_word... " >&6; } +if ${ac_cv_prog_AWK+:} false; then : + $as_echo_n "(cached) " >&6 +else + if test -n "$AWK"; then + ac_cv_prog_AWK="$AWK" # Let the user override the test. +else +as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in $PATH +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + for ac_exec_ext in '' $ac_executable_extensions; do + if as_fn_executable_p "$as_dir/$ac_word$ac_exec_ext"; then + ac_cv_prog_AWK="$ac_prog" + $as_echo "$as_me:${as_lineno-$LINENO}: found $as_dir/$ac_word$ac_exec_ext" >&5 + break 2 + fi +done + done +IFS=$as_save_IFS + +fi +fi +AWK=$ac_cv_prog_AWK +if test -n "$AWK"; then + { $as_echo "$as_me:${as_lineno-$LINENO}: result: $AWK" >&5 +$as_echo "$AWK" >&6; } +else + { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5 +$as_echo "no" >&6; } +fi + + + test -n "$AWK" && break +done + +{ $as_echo "$as_me:${as_lineno-$LINENO}: checking whether ${MAKE-make} sets \$(MAKE)" >&5 +$as_echo_n "checking whether ${MAKE-make} sets \$(MAKE)... " >&6; } +set x ${MAKE-make} +ac_make=`$as_echo "$2" | sed 's/+/p/g; s/[^a-zA-Z0-9_]/_/g'` +if eval \${ac_cv_prog_make_${ac_make}_set+:} false; then : + $as_echo_n "(cached) " >&6 +else + cat >conftest.make <<\_ACEOF +SHELL = /bin/sh +all: + @echo '@@@%%%=$(MAKE)=@@@%%%' +_ACEOF +# GNU make sometimes prints "make[1]: Entering ...", which would confuse us. +case `${MAKE-make} -f conftest.make 2>/dev/null` in + *@@@%%%=?*=@@@%%%*) + eval ac_cv_prog_make_${ac_make}_set=yes;; + *) + eval ac_cv_prog_make_${ac_make}_set=no;; +esac +rm -f conftest.make +fi +if eval test \$ac_cv_prog_make_${ac_make}_set = yes; then + { $as_echo "$as_me:${as_lineno-$LINENO}: result: yes" >&5 +$as_echo "yes" >&6; } + SET_MAKE= +else + { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5 +$as_echo "no" >&6; } + SET_MAKE="MAKE=${MAKE-make}" +fi + +rm -rf .tst 2>/dev/null +mkdir .tst 2>/dev/null +if test -d .tst; then + am__leading_dot=. +else + am__leading_dot=_ +fi +rmdir .tst 2>/dev/null + +# Check whether --enable-silent-rules was given. +if test "${enable_silent_rules+set}" = set; then : + enableval=$enable_silent_rules; +fi + +case $enable_silent_rules in # ((( + yes) AM_DEFAULT_VERBOSITY=0;; + no) AM_DEFAULT_VERBOSITY=1;; + *) AM_DEFAULT_VERBOSITY=1;; +esac +am_make=${MAKE-make} +{ $as_echo "$as_me:${as_lineno-$LINENO}: checking whether $am_make supports nested variables" >&5 +$as_echo_n "checking whether $am_make supports nested variables... " >&6; } +if ${am_cv_make_support_nested_variables+:} false; then : + $as_echo_n "(cached) " >&6 +else + if $as_echo 'TRUE=$(BAR$(V)) +BAR0=false +BAR1=true +V=1 +am__doit: + @$(TRUE) +.PHONY: am__doit' | $am_make -f - >/dev/null 2>&1; then + am_cv_make_support_nested_variables=yes +else + am_cv_make_support_nested_variables=no +fi +fi +{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $am_cv_make_support_nested_variables" >&5 +$as_echo "$am_cv_make_support_nested_variables" >&6; } +if test $am_cv_make_support_nested_variables = yes; then + AM_V='$(V)' + AM_DEFAULT_V='$(AM_DEFAULT_VERBOSITY)' +else + AM_V=$AM_DEFAULT_VERBOSITY + AM_DEFAULT_V=$AM_DEFAULT_VERBOSITY +fi +AM_BACKSLASH='\' + +DEPDIR="${am__leading_dot}deps" + +ac_config_commands="$ac_config_commands depfiles" + +{ $as_echo "$as_me:${as_lineno-$LINENO}: checking whether ${MAKE-make} supports the include directive" >&5 +$as_echo_n "checking whether ${MAKE-make} supports the include directive... " >&6; } +cat > confinc.mk << 'END' +am__doit: + @echo this is the am__doit target >confinc.out +.PHONY: am__doit +END +am__include="#" +am__quote= +# BSD make does it like this. +echo '.include "confinc.mk" # ignored' > confmf.BSD +# Other make implementations (GNU, Solaris 10, AIX) do it like this. +echo 'include confinc.mk # ignored' > confmf.GNU +_am_result=no +for s in GNU BSD; do + { echo "$as_me:$LINENO: ${MAKE-make} -f confmf.$s && cat confinc.out" >&5 + (${MAKE-make} -f confmf.$s && cat confinc.out) >&5 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } + case $?:`cat confinc.out 2>/dev/null` in #( + '0:this is the am__doit target') : + case $s in #( + BSD) : + am__include='.include' am__quote='"' ;; #( + *) : + am__include='include' am__quote='' ;; +esac ;; #( + *) : + ;; +esac + if test "$am__include" != "#"; then + _am_result="yes ($s style)" + break + fi +done +rm -f confinc.* confmf.* +{ $as_echo "$as_me:${as_lineno-$LINENO}: result: ${_am_result}" >&5 +$as_echo "${_am_result}" >&6; } + +# Check whether --enable-dependency-tracking was given. +if test "${enable_dependency_tracking+set}" = set; then : + enableval=$enable_dependency_tracking; +fi + +if test "x$enable_dependency_tracking" != xno; then + am_depcomp="$ac_aux_dir/depcomp" + AMDEPBACKSLASH='\' + am__nodep='_no' +fi + if test "x$enable_dependency_tracking" != xno; then + AMDEP_TRUE= + AMDEP_FALSE='#' +else + AMDEP_TRUE='#' + AMDEP_FALSE= +fi + + +ac_ext=c +ac_cpp='$CPP $CPPFLAGS' +ac_compile='$CC -c $CFLAGS $CPPFLAGS conftest.$ac_ext >&5' +ac_link='$CC -o conftest$ac_exeext $CFLAGS $CPPFLAGS $LDFLAGS conftest.$ac_ext $LIBS >&5' +ac_compiler_gnu=$ac_cv_c_compiler_gnu +if test -n "$ac_tool_prefix"; then + # Extract the first word of "${ac_tool_prefix}gcc", so it can be a program name with args. +set dummy ${ac_tool_prefix}gcc; ac_word=$2 +{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $ac_word" >&5 +$as_echo_n "checking for $ac_word... " >&6; } +if ${ac_cv_prog_CC+:} false; then : + $as_echo_n "(cached) " >&6 +else + if test -n "$CC"; then + ac_cv_prog_CC="$CC" # Let the user override the test. +else +as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in $PATH +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + for ac_exec_ext in '' $ac_executable_extensions; do + if as_fn_executable_p "$as_dir/$ac_word$ac_exec_ext"; then + ac_cv_prog_CC="${ac_tool_prefix}gcc" + $as_echo "$as_me:${as_lineno-$LINENO}: found $as_dir/$ac_word$ac_exec_ext" >&5 + break 2 + fi +done + done +IFS=$as_save_IFS + +fi +fi +CC=$ac_cv_prog_CC +if test -n "$CC"; then + { $as_echo "$as_me:${as_lineno-$LINENO}: result: $CC" >&5 +$as_echo "$CC" >&6; } +else + { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5 +$as_echo "no" >&6; } +fi + + +fi +if test -z "$ac_cv_prog_CC"; then + ac_ct_CC=$CC + # Extract the first word of "gcc", so it can be a program name with args. +set dummy gcc; ac_word=$2 +{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $ac_word" >&5 +$as_echo_n "checking for $ac_word... " >&6; } +if ${ac_cv_prog_ac_ct_CC+:} false; then : + $as_echo_n "(cached) " >&6 +else + if test -n "$ac_ct_CC"; then + ac_cv_prog_ac_ct_CC="$ac_ct_CC" # Let the user override the test. +else +as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in $PATH +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + for ac_exec_ext in '' $ac_executable_extensions; do + if as_fn_executable_p "$as_dir/$ac_word$ac_exec_ext"; then + ac_cv_prog_ac_ct_CC="gcc" + $as_echo "$as_me:${as_lineno-$LINENO}: found $as_dir/$ac_word$ac_exec_ext" >&5 + break 2 + fi +done + done +IFS=$as_save_IFS + +fi +fi +ac_ct_CC=$ac_cv_prog_ac_ct_CC +if test -n "$ac_ct_CC"; then + { $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_ct_CC" >&5 +$as_echo "$ac_ct_CC" >&6; } +else + { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5 +$as_echo "no" >&6; } +fi + + if test "x$ac_ct_CC" = x; then + CC="" + else + case $cross_compiling:$ac_tool_warned in +yes:) +{ $as_echo "$as_me:${as_lineno-$LINENO}: WARNING: using cross tools not prefixed with host triplet" >&5 +$as_echo "$as_me: WARNING: using cross tools not prefixed with host triplet" >&2;} +ac_tool_warned=yes ;; +esac + CC=$ac_ct_CC + fi +else + CC="$ac_cv_prog_CC" +fi + +if test -z "$CC"; then + if test -n "$ac_tool_prefix"; then + # Extract the first word of "${ac_tool_prefix}cc", so it can be a program name with args. +set dummy ${ac_tool_prefix}cc; ac_word=$2 +{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $ac_word" >&5 +$as_echo_n "checking for $ac_word... " >&6; } +if ${ac_cv_prog_CC+:} false; then : + $as_echo_n "(cached) " >&6 +else + if test -n "$CC"; then + ac_cv_prog_CC="$CC" # Let the user override the test. +else +as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in $PATH +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + for ac_exec_ext in '' $ac_executable_extensions; do + if as_fn_executable_p "$as_dir/$ac_word$ac_exec_ext"; then + ac_cv_prog_CC="${ac_tool_prefix}cc" + $as_echo "$as_me:${as_lineno-$LINENO}: found $as_dir/$ac_word$ac_exec_ext" >&5 + break 2 + fi +done + done +IFS=$as_save_IFS + +fi +fi +CC=$ac_cv_prog_CC +if test -n "$CC"; then + { $as_echo "$as_me:${as_lineno-$LINENO}: result: $CC" >&5 +$as_echo "$CC" >&6; } +else + { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5 +$as_echo "no" >&6; } +fi + + + fi +fi +if test -z "$CC"; then + # Extract the first word of "cc", so it can be a program name with args. +set dummy cc; ac_word=$2 +{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $ac_word" >&5 +$as_echo_n "checking for $ac_word... " >&6; } +if ${ac_cv_prog_CC+:} false; then : + $as_echo_n "(cached) " >&6 +else + if test -n "$CC"; then + ac_cv_prog_CC="$CC" # Let the user override the test. +else + ac_prog_rejected=no +as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in $PATH +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + for ac_exec_ext in '' $ac_executable_extensions; do + if as_fn_executable_p "$as_dir/$ac_word$ac_exec_ext"; then + if test "$as_dir/$ac_word$ac_exec_ext" = "/usr/ucb/cc"; then + ac_prog_rejected=yes + continue + fi + ac_cv_prog_CC="cc" + $as_echo "$as_me:${as_lineno-$LINENO}: found $as_dir/$ac_word$ac_exec_ext" >&5 + break 2 + fi +done + done +IFS=$as_save_IFS + +if test $ac_prog_rejected = yes; then + # We found a bogon in the path, so make sure we never use it. + set dummy $ac_cv_prog_CC + shift + if test $# != 0; then + # We chose a different compiler from the bogus one. + # However, it has the same basename, so the bogon will be chosen + # first if we set CC to just the basename; use the full file name. + shift + ac_cv_prog_CC="$as_dir/$ac_word${1+' '}$@" + fi +fi +fi +fi +CC=$ac_cv_prog_CC +if test -n "$CC"; then + { $as_echo "$as_me:${as_lineno-$LINENO}: result: $CC" >&5 +$as_echo "$CC" >&6; } +else + { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5 +$as_echo "no" >&6; } +fi + + +fi +if test -z "$CC"; then + if test -n "$ac_tool_prefix"; then + for ac_prog in cl.exe + do + # Extract the first word of "$ac_tool_prefix$ac_prog", so it can be a program name with args. +set dummy $ac_tool_prefix$ac_prog; ac_word=$2 +{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $ac_word" >&5 +$as_echo_n "checking for $ac_word... " >&6; } +if ${ac_cv_prog_CC+:} false; then : + $as_echo_n "(cached) " >&6 +else + if test -n "$CC"; then + ac_cv_prog_CC="$CC" # Let the user override the test. +else +as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in $PATH +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + for ac_exec_ext in '' $ac_executable_extensions; do + if as_fn_executable_p "$as_dir/$ac_word$ac_exec_ext"; then + ac_cv_prog_CC="$ac_tool_prefix$ac_prog" + $as_echo "$as_me:${as_lineno-$LINENO}: found $as_dir/$ac_word$ac_exec_ext" >&5 + break 2 + fi +done + done +IFS=$as_save_IFS + +fi +fi +CC=$ac_cv_prog_CC +if test -n "$CC"; then + { $as_echo "$as_me:${as_lineno-$LINENO}: result: $CC" >&5 +$as_echo "$CC" >&6; } +else + { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5 +$as_echo "no" >&6; } +fi + + + test -n "$CC" && break + done +fi +if test -z "$CC"; then + ac_ct_CC=$CC + for ac_prog in cl.exe +do + # Extract the first word of "$ac_prog", so it can be a program name with args. +set dummy $ac_prog; ac_word=$2 +{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $ac_word" >&5 +$as_echo_n "checking for $ac_word... " >&6; } +if ${ac_cv_prog_ac_ct_CC+:} false; then : + $as_echo_n "(cached) " >&6 +else + if test -n "$ac_ct_CC"; then + ac_cv_prog_ac_ct_CC="$ac_ct_CC" # Let the user override the test. +else +as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in $PATH +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + for ac_exec_ext in '' $ac_executable_extensions; do + if as_fn_executable_p "$as_dir/$ac_word$ac_exec_ext"; then + ac_cv_prog_ac_ct_CC="$ac_prog" + $as_echo "$as_me:${as_lineno-$LINENO}: found $as_dir/$ac_word$ac_exec_ext" >&5 + break 2 + fi +done + done +IFS=$as_save_IFS + +fi +fi +ac_ct_CC=$ac_cv_prog_ac_ct_CC +if test -n "$ac_ct_CC"; then + { $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_ct_CC" >&5 +$as_echo "$ac_ct_CC" >&6; } +else + { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5 +$as_echo "no" >&6; } +fi + + + test -n "$ac_ct_CC" && break +done + + if test "x$ac_ct_CC" = x; then + CC="" + else + case $cross_compiling:$ac_tool_warned in +yes:) +{ $as_echo "$as_me:${as_lineno-$LINENO}: WARNING: using cross tools not prefixed with host triplet" >&5 +$as_echo "$as_me: WARNING: using cross tools not prefixed with host triplet" >&2;} +ac_tool_warned=yes ;; +esac + CC=$ac_ct_CC + fi +fi + +fi + + +test -z "$CC" && { { $as_echo "$as_me:${as_lineno-$LINENO}: error: in \`$ac_pwd':" >&5 +$as_echo "$as_me: error: in \`$ac_pwd':" >&2;} +as_fn_error $? "no acceptable C compiler found in \$PATH +See \`config.log' for more details" "$LINENO" 5; } + +# Provide some information about the compiler. +$as_echo "$as_me:${as_lineno-$LINENO}: checking for C compiler version" >&5 +set X $ac_compile +ac_compiler=$2 +for ac_option in --version -v -V -qversion; do + { { ac_try="$ac_compiler $ac_option >&5" +case "(($ac_try" in + *\"* | *\`* | *\\*) ac_try_echo=\$ac_try;; + *) ac_try_echo=$ac_try;; +esac +eval ac_try_echo="\"\$as_me:${as_lineno-$LINENO}: $ac_try_echo\"" +$as_echo "$ac_try_echo"; } >&5 + (eval "$ac_compiler $ac_option >&5") 2>conftest.err + ac_status=$? + if test -s conftest.err; then + sed '10a\ +... rest of stderr output deleted ... + 10q' conftest.err >conftest.er1 + cat conftest.er1 >&5 + fi + rm -f conftest.er1 conftest.err + $as_echo "$as_me:${as_lineno-$LINENO}: \$? = $ac_status" >&5 + test $ac_status = 0; } +done + +cat confdefs.h - <<_ACEOF >conftest.$ac_ext +/* end confdefs.h. */ + +int +main () +{ + + ; + return 0; +} +_ACEOF +ac_clean_files_save=$ac_clean_files +ac_clean_files="$ac_clean_files a.out a.out.dSYM a.exe b.out" +# Try to create an executable without -o first, disregard a.out. +# It will help us diagnose broken compilers, and finding out an intuition +# of exeext. +{ $as_echo "$as_me:${as_lineno-$LINENO}: checking whether the C compiler works" >&5 +$as_echo_n "checking whether the C compiler works... " >&6; } +ac_link_default=`$as_echo "$ac_link" | sed 's/ -o *conftest[^ ]*//'` + +# The possible output files: +ac_files="a.out conftest.exe conftest a.exe a_out.exe b.out conftest.*" + +ac_rmfiles= +for ac_file in $ac_files +do + case $ac_file in + *.$ac_ext | *.xcoff | *.tds | *.d | *.pdb | *.xSYM | *.bb | *.bbg | *.map | *.inf | *.dSYM | *.o | *.obj ) ;; + * ) ac_rmfiles="$ac_rmfiles $ac_file";; + esac +done +rm -f $ac_rmfiles + +if { { ac_try="$ac_link_default" +case "(($ac_try" in + *\"* | *\`* | *\\*) ac_try_echo=\$ac_try;; + *) ac_try_echo=$ac_try;; +esac +eval ac_try_echo="\"\$as_me:${as_lineno-$LINENO}: $ac_try_echo\"" +$as_echo "$ac_try_echo"; } >&5 + (eval "$ac_link_default") 2>&5 + ac_status=$? + $as_echo "$as_me:${as_lineno-$LINENO}: \$? = $ac_status" >&5 + test $ac_status = 0; }; then : + # Autoconf-2.13 could set the ac_cv_exeext variable to `no'. +# So ignore a value of `no', otherwise this would lead to `EXEEXT = no' +# in a Makefile. We should not override ac_cv_exeext if it was cached, +# so that the user can short-circuit this test for compilers unknown to +# Autoconf. +for ac_file in $ac_files '' +do + test -f "$ac_file" || continue + case $ac_file in + *.$ac_ext | *.xcoff | *.tds | *.d | *.pdb | *.xSYM | *.bb | *.bbg | *.map | *.inf | *.dSYM | *.o | *.obj ) + ;; + [ab].out ) + # We found the default executable, but exeext='' is most + # certainly right. + break;; + *.* ) + if test "${ac_cv_exeext+set}" = set && test "$ac_cv_exeext" != no; + then :; else + ac_cv_exeext=`expr "$ac_file" : '[^.]*\(\..*\)'` + fi + # We set ac_cv_exeext here because the later test for it is not + # safe: cross compilers may not add the suffix if given an `-o' + # argument, so we may need to know it at that point already. + # Even if this section looks crufty: it has the advantage of + # actually working. + break;; + * ) + break;; + esac +done +test "$ac_cv_exeext" = no && ac_cv_exeext= + +else + ac_file='' +fi +if test -z "$ac_file"; then : + { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5 +$as_echo "no" >&6; } +$as_echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + +{ { $as_echo "$as_me:${as_lineno-$LINENO}: error: in \`$ac_pwd':" >&5 +$as_echo "$as_me: error: in \`$ac_pwd':" >&2;} +as_fn_error 77 "C compiler cannot create executables +See \`config.log' for more details" "$LINENO" 5; } +else + { $as_echo "$as_me:${as_lineno-$LINENO}: result: yes" >&5 +$as_echo "yes" >&6; } +fi +{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for C compiler default output file name" >&5 +$as_echo_n "checking for C compiler default output file name... " >&6; } +{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_file" >&5 +$as_echo "$ac_file" >&6; } +ac_exeext=$ac_cv_exeext + +rm -f -r a.out a.out.dSYM a.exe conftest$ac_cv_exeext b.out +ac_clean_files=$ac_clean_files_save +{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for suffix of executables" >&5 +$as_echo_n "checking for suffix of executables... " >&6; } +if { { ac_try="$ac_link" +case "(($ac_try" in + *\"* | *\`* | *\\*) ac_try_echo=\$ac_try;; + *) ac_try_echo=$ac_try;; +esac +eval ac_try_echo="\"\$as_me:${as_lineno-$LINENO}: $ac_try_echo\"" +$as_echo "$ac_try_echo"; } >&5 + (eval "$ac_link") 2>&5 + ac_status=$? + $as_echo "$as_me:${as_lineno-$LINENO}: \$? = $ac_status" >&5 + test $ac_status = 0; }; then : + # If both `conftest.exe' and `conftest' are `present' (well, observable) +# catch `conftest.exe'. For instance with Cygwin, `ls conftest' will +# work properly (i.e., refer to `conftest.exe'), while it won't with +# `rm'. +for ac_file in conftest.exe conftest conftest.*; do + test -f "$ac_file" || continue + case $ac_file in + *.$ac_ext | *.xcoff | *.tds | *.d | *.pdb | *.xSYM | *.bb | *.bbg | *.map | *.inf | *.dSYM | *.o | *.obj ) ;; + *.* ) ac_cv_exeext=`expr "$ac_file" : '[^.]*\(\..*\)'` + break;; + * ) break;; + esac +done +else + { { $as_echo "$as_me:${as_lineno-$LINENO}: error: in \`$ac_pwd':" >&5 +$as_echo "$as_me: error: in \`$ac_pwd':" >&2;} +as_fn_error $? "cannot compute suffix of executables: cannot compile and link +See \`config.log' for more details" "$LINENO" 5; } +fi +rm -f conftest conftest$ac_cv_exeext +{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_cv_exeext" >&5 +$as_echo "$ac_cv_exeext" >&6; } + +rm -f conftest.$ac_ext +EXEEXT=$ac_cv_exeext +ac_exeext=$EXEEXT +cat confdefs.h - <<_ACEOF >conftest.$ac_ext +/* end confdefs.h. */ +#include <stdio.h> +int +main () +{ +FILE *f = fopen ("conftest.out", "w"); + return ferror (f) || fclose (f) != 0; + + ; + return 0; +} +_ACEOF +ac_clean_files="$ac_clean_files conftest.out" +# Check that the compiler produces executables we can run. If not, either +# the compiler is broken, or we cross compile. +{ $as_echo "$as_me:${as_lineno-$LINENO}: checking whether we are cross compiling" >&5 +$as_echo_n "checking whether we are cross compiling... " >&6; } +if test "$cross_compiling" != yes; then + { { ac_try="$ac_link" +case "(($ac_try" in + *\"* | *\`* | *\\*) ac_try_echo=\$ac_try;; + *) ac_try_echo=$ac_try;; +esac +eval ac_try_echo="\"\$as_me:${as_lineno-$LINENO}: $ac_try_echo\"" +$as_echo "$ac_try_echo"; } >&5 + (eval "$ac_link") 2>&5 + ac_status=$? + $as_echo "$as_me:${as_lineno-$LINENO}: \$? = $ac_status" >&5 + test $ac_status = 0; } + if { ac_try='./conftest$ac_cv_exeext' + { { case "(($ac_try" in + *\"* | *\`* | *\\*) ac_try_echo=\$ac_try;; + *) ac_try_echo=$ac_try;; +esac +eval ac_try_echo="\"\$as_me:${as_lineno-$LINENO}: $ac_try_echo\"" +$as_echo "$ac_try_echo"; } >&5 + (eval "$ac_try") 2>&5 + ac_status=$? + $as_echo "$as_me:${as_lineno-$LINENO}: \$? = $ac_status" >&5 + test $ac_status = 0; }; }; then + cross_compiling=no + else + if test "$cross_compiling" = maybe; then + cross_compiling=yes + else + { { $as_echo "$as_me:${as_lineno-$LINENO}: error: in \`$ac_pwd':" >&5 +$as_echo "$as_me: error: in \`$ac_pwd':" >&2;} +as_fn_error $? "cannot run C compiled programs. +If you meant to cross compile, use \`--host'. +See \`config.log' for more details" "$LINENO" 5; } + fi + fi +fi +{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $cross_compiling" >&5 +$as_echo "$cross_compiling" >&6; } + +rm -f conftest.$ac_ext conftest$ac_cv_exeext conftest.out +ac_clean_files=$ac_clean_files_save +{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for suffix of object files" >&5 +$as_echo_n "checking for suffix of object files... " >&6; } +if ${ac_cv_objext+:} false; then : + $as_echo_n "(cached) " >&6 +else + cat confdefs.h - <<_ACEOF >conftest.$ac_ext +/* end confdefs.h. */ + +int +main () +{ + + ; + return 0; +} +_ACEOF +rm -f conftest.o conftest.obj +if { { ac_try="$ac_compile" +case "(($ac_try" in + *\"* | *\`* | *\\*) ac_try_echo=\$ac_try;; + *) ac_try_echo=$ac_try;; +esac +eval ac_try_echo="\"\$as_me:${as_lineno-$LINENO}: $ac_try_echo\"" +$as_echo "$ac_try_echo"; } >&5 + (eval "$ac_compile") 2>&5 + ac_status=$? + $as_echo "$as_me:${as_lineno-$LINENO}: \$? = $ac_status" >&5 + test $ac_status = 0; }; then : + for ac_file in conftest.o conftest.obj conftest.*; do + test -f "$ac_file" || continue; + case $ac_file in + *.$ac_ext | *.xcoff | *.tds | *.d | *.pdb | *.xSYM | *.bb | *.bbg | *.map | *.inf | *.dSYM ) ;; + *) ac_cv_objext=`expr "$ac_file" : '.*\.\(.*\)'` + break;; + esac +done +else + $as_echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + +{ { $as_echo "$as_me:${as_lineno-$LINENO}: error: in \`$ac_pwd':" >&5 +$as_echo "$as_me: error: in \`$ac_pwd':" >&2;} +as_fn_error $? "cannot compute suffix of object files: cannot compile +See \`config.log' for more details" "$LINENO" 5; } +fi +rm -f conftest.$ac_cv_objext conftest.$ac_ext +fi +{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_cv_objext" >&5 +$as_echo "$ac_cv_objext" >&6; } +OBJEXT=$ac_cv_objext +ac_objext=$OBJEXT +{ $as_echo "$as_me:${as_lineno-$LINENO}: checking whether we are using the GNU C compiler" >&5 +$as_echo_n "checking whether we are using the GNU C compiler... " >&6; } +if ${ac_cv_c_compiler_gnu+:} false; then : + $as_echo_n "(cached) " >&6 +else + cat confdefs.h - <<_ACEOF >conftest.$ac_ext +/* end confdefs.h. */ + +int +main () +{ +#ifndef __GNUC__ + choke me +#endif + + ; + return 0; +} +_ACEOF +if ac_fn_c_try_compile "$LINENO"; then : + ac_compiler_gnu=yes +else + ac_compiler_gnu=no +fi +rm -f core conftest.err conftest.$ac_objext conftest.$ac_ext +ac_cv_c_compiler_gnu=$ac_compiler_gnu + +fi +{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_cv_c_compiler_gnu" >&5 +$as_echo "$ac_cv_c_compiler_gnu" >&6; } +if test $ac_compiler_gnu = yes; then + GCC=yes +else + GCC= +fi +ac_test_CFLAGS=${CFLAGS+set} +ac_save_CFLAGS=$CFLAGS +{ $as_echo "$as_me:${as_lineno-$LINENO}: checking whether $CC accepts -g" >&5 +$as_echo_n "checking whether $CC accepts -g... " >&6; } +if ${ac_cv_prog_cc_g+:} false; then : + $as_echo_n "(cached) " >&6 +else + ac_save_c_werror_flag=$ac_c_werror_flag + ac_c_werror_flag=yes + ac_cv_prog_cc_g=no + CFLAGS="-g" + cat confdefs.h - <<_ACEOF >conftest.$ac_ext +/* end confdefs.h. */ + +int +main () +{ + + ; + return 0; +} +_ACEOF +if ac_fn_c_try_compile "$LINENO"; then : + ac_cv_prog_cc_g=yes +else + CFLAGS="" + cat confdefs.h - <<_ACEOF >conftest.$ac_ext +/* end confdefs.h. */ + +int +main () +{ + + ; + return 0; +} +_ACEOF +if ac_fn_c_try_compile "$LINENO"; then : + +else + ac_c_werror_flag=$ac_save_c_werror_flag + CFLAGS="-g" + cat confdefs.h - <<_ACEOF >conftest.$ac_ext +/* end confdefs.h. */ + +int +main () +{ + + ; + return 0; +} +_ACEOF +if ac_fn_c_try_compile "$LINENO"; then : + ac_cv_prog_cc_g=yes +fi +rm -f core conftest.err conftest.$ac_objext conftest.$ac_ext +fi +rm -f core conftest.err conftest.$ac_objext conftest.$ac_ext +fi +rm -f core conftest.err conftest.$ac_objext conftest.$ac_ext + ac_c_werror_flag=$ac_save_c_werror_flag +fi +{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_cv_prog_cc_g" >&5 +$as_echo "$ac_cv_prog_cc_g" >&6; } +if test "$ac_test_CFLAGS" = set; then + CFLAGS=$ac_save_CFLAGS +elif test $ac_cv_prog_cc_g = yes; then + if test "$GCC" = yes; then + CFLAGS="-g -O2" + else + CFLAGS="-g" + fi +else + if test "$GCC" = yes; then + CFLAGS="-O2" + else + CFLAGS= + fi +fi +{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $CC option to accept ISO C89" >&5 +$as_echo_n "checking for $CC option to accept ISO C89... " >&6; } +if ${ac_cv_prog_cc_c89+:} false; then : + $as_echo_n "(cached) " >&6 +else + ac_cv_prog_cc_c89=no +ac_save_CC=$CC +cat confdefs.h - <<_ACEOF >conftest.$ac_ext +/* end confdefs.h. */ +#include <stdarg.h> +#include <stdio.h> +struct stat; +/* Most of the following tests are stolen from RCS 5.7's src/conf.sh. */ +struct buf { int x; }; +FILE * (*rcsopen) (struct buf *, struct stat *, int); +static char *e (p, i) + char **p; + int i; +{ + return p[i]; +} +static char *f (char * (*g) (char **, int), char **p, ...) +{ + char *s; + va_list v; + va_start (v,p); + s = g (p, va_arg (v,int)); + va_end (v); + return s; +} + +/* OSF 4.0 Compaq cc is some sort of almost-ANSI by default. It has + function prototypes and stuff, but not '\xHH' hex character constants. + These don't provoke an error unfortunately, instead are silently treated + as 'x'. The following induces an error, until -std is added to get + proper ANSI mode. Curiously '\x00'!='x' always comes out true, for an + array size at least. It's necessary to write '\x00'==0 to get something + that's true only with -std. */ +int osf4_cc_array ['\x00' == 0 ? 1 : -1]; + +/* IBM C 6 for AIX is almost-ANSI by default, but it replaces macro parameters + inside strings and character constants. */ +#define FOO(x) 'x' +int xlc6_cc_array[FOO(a) == 'x' ? 1 : -1]; + +int test (int i, double x); +struct s1 {int (*f) (int a);}; +struct s2 {int (*f) (double a);}; +int pairnames (int, char **, FILE *(*)(struct buf *, struct stat *, int), int, int); +int argc; +char **argv; +int +main () +{ +return f (e, argv, 0) != argv[0] || f (e, argv, 1) != argv[1]; + ; + return 0; +} +_ACEOF +for ac_arg in '' -qlanglvl=extc89 -qlanglvl=ansi -std \ + -Ae "-Aa -D_HPUX_SOURCE" "-Xc -D__EXTENSIONS__" +do + CC="$ac_save_CC $ac_arg" + if ac_fn_c_try_compile "$LINENO"; then : + ac_cv_prog_cc_c89=$ac_arg +fi +rm -f core conftest.err conftest.$ac_objext + test "x$ac_cv_prog_cc_c89" != "xno" && break +done +rm -f conftest.$ac_ext +CC=$ac_save_CC + +fi +# AC_CACHE_VAL +case "x$ac_cv_prog_cc_c89" in + x) + { $as_echo "$as_me:${as_lineno-$LINENO}: result: none needed" >&5 +$as_echo "none needed" >&6; } ;; + xno) + { $as_echo "$as_me:${as_lineno-$LINENO}: result: unsupported" >&5 +$as_echo "unsupported" >&6; } ;; + *) + CC="$CC $ac_cv_prog_cc_c89" + { $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_cv_prog_cc_c89" >&5 +$as_echo "$ac_cv_prog_cc_c89" >&6; } ;; +esac +if test "x$ac_cv_prog_cc_c89" != xno; then : + +fi + +ac_ext=c +ac_cpp='$CPP $CPPFLAGS' +ac_compile='$CC -c $CFLAGS $CPPFLAGS conftest.$ac_ext >&5' +ac_link='$CC -o conftest$ac_exeext $CFLAGS $CPPFLAGS $LDFLAGS conftest.$ac_ext $LIBS >&5' +ac_compiler_gnu=$ac_cv_c_compiler_gnu + +ac_ext=c +ac_cpp='$CPP $CPPFLAGS' +ac_compile='$CC -c $CFLAGS $CPPFLAGS conftest.$ac_ext >&5' +ac_link='$CC -o conftest$ac_exeext $CFLAGS $CPPFLAGS $LDFLAGS conftest.$ac_ext $LIBS >&5' +ac_compiler_gnu=$ac_cv_c_compiler_gnu +{ $as_echo "$as_me:${as_lineno-$LINENO}: checking whether $CC understands -c and -o together" >&5 +$as_echo_n "checking whether $CC understands -c and -o together... " >&6; } +if ${am_cv_prog_cc_c_o+:} false; then : + $as_echo_n "(cached) " >&6 +else + cat confdefs.h - <<_ACEOF >conftest.$ac_ext +/* end confdefs.h. */ + +int +main () +{ + + ; + return 0; +} +_ACEOF + # Make sure it works both with $CC and with simple cc. + # Following AC_PROG_CC_C_O, we do the test twice because some + # compilers refuse to overwrite an existing .o file with -o, + # though they will create one. + am_cv_prog_cc_c_o=yes + for am_i in 1 2; do + if { echo "$as_me:$LINENO: $CC -c conftest.$ac_ext -o conftest2.$ac_objext" >&5 + ($CC -c conftest.$ac_ext -o conftest2.$ac_objext) >&5 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } \ + && test -f conftest2.$ac_objext; then + : OK + else + am_cv_prog_cc_c_o=no + break + fi + done + rm -f core conftest* + unset am_i +fi +{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $am_cv_prog_cc_c_o" >&5 +$as_echo "$am_cv_prog_cc_c_o" >&6; } +if test "$am_cv_prog_cc_c_o" != yes; then + # Losing compiler, so override with the script. + # FIXME: It is wrong to rewrite CC. + # But if we don't then we get into trouble of one sort or another. + # A longer-term fix would be to have automake use am__CC in this case, + # and then we could set am__CC="\$(top_srcdir)/compile \$(CC)" + CC="$am_aux_dir/compile $CC" +fi +ac_ext=c +ac_cpp='$CPP $CPPFLAGS' +ac_compile='$CC -c $CFLAGS $CPPFLAGS conftest.$ac_ext >&5' +ac_link='$CC -o conftest$ac_exeext $CFLAGS $CPPFLAGS $LDFLAGS conftest.$ac_ext $LIBS >&5' +ac_compiler_gnu=$ac_cv_c_compiler_gnu + + +depcc="$CC" am_compiler_list= + +{ $as_echo "$as_me:${as_lineno-$LINENO}: checking dependency style of $depcc" >&5 +$as_echo_n "checking dependency style of $depcc... " >&6; } +if ${am_cv_CC_dependencies_compiler_type+:} false; then : + $as_echo_n "(cached) " >&6 +else + if test -z "$AMDEP_TRUE" && test -f "$am_depcomp"; then + # We make a subdir and do the tests there. Otherwise we can end up + # making bogus files that we don't know about and never remove. For + # instance it was reported that on HP-UX the gcc test will end up + # making a dummy file named 'D' -- because '-MD' means "put the output + # in D". + rm -rf conftest.dir + mkdir conftest.dir + # Copy depcomp to subdir because otherwise we won't find it if we're + # using a relative directory. + cp "$am_depcomp" conftest.dir + cd conftest.dir + # We will build objects and dependencies in a subdirectory because + # it helps to detect inapplicable dependency modes. For instance + # both Tru64's cc and ICC support -MD to output dependencies as a + # side effect of compilation, but ICC will put the dependencies in + # the current directory while Tru64 will put them in the object + # directory. + mkdir sub + + am_cv_CC_dependencies_compiler_type=none + if test "$am_compiler_list" = ""; then + am_compiler_list=`sed -n 's/^#*\([a-zA-Z0-9]*\))$/\1/p' < ./depcomp` + fi + am__universal=false + case " $depcc " in #( + *\ -arch\ *\ -arch\ *) am__universal=true ;; + esac + + for depmode in $am_compiler_list; do + # Setup a source with many dependencies, because some compilers + # like to wrap large dependency lists on column 80 (with \), and + # we should not choose a depcomp mode which is confused by this. + # + # We need to recreate these files for each test, as the compiler may + # overwrite some of them when testing with obscure command lines. + # This happens at least with the AIX C compiler. + : > sub/conftest.c + for i in 1 2 3 4 5 6; do + echo '#include "conftst'$i'.h"' >> sub/conftest.c + # Using ": > sub/conftst$i.h" creates only sub/conftst1.h with + # Solaris 10 /bin/sh. + echo '/* dummy */' > sub/conftst$i.h + done + echo "${am__include} ${am__quote}sub/conftest.Po${am__quote}" > confmf + + # We check with '-c' and '-o' for the sake of the "dashmstdout" + # mode. It turns out that the SunPro C++ compiler does not properly + # handle '-M -o', and we need to detect this. Also, some Intel + # versions had trouble with output in subdirs. + am__obj=sub/conftest.${OBJEXT-o} + am__minus_obj="-o $am__obj" + case $depmode in + gcc) + # This depmode causes a compiler race in universal mode. + test "$am__universal" = false || continue + ;; + nosideeffect) + # After this tag, mechanisms are not by side-effect, so they'll + # only be used when explicitly requested. + if test "x$enable_dependency_tracking" = xyes; then + continue + else + break + fi + ;; + msvc7 | msvc7msys | msvisualcpp | msvcmsys) + # This compiler won't grok '-c -o', but also, the minuso test has + # not run yet. These depmodes are late enough in the game, and + # so weak that their functioning should not be impacted. + am__obj=conftest.${OBJEXT-o} + am__minus_obj= + ;; + none) break ;; + esac + if depmode=$depmode \ + source=sub/conftest.c object=$am__obj \ + depfile=sub/conftest.Po tmpdepfile=sub/conftest.TPo \ + $SHELL ./depcomp $depcc -c $am__minus_obj sub/conftest.c \ + >/dev/null 2>conftest.err && + grep sub/conftst1.h sub/conftest.Po > /dev/null 2>&1 && + grep sub/conftst6.h sub/conftest.Po > /dev/null 2>&1 && + grep $am__obj sub/conftest.Po > /dev/null 2>&1 && + ${MAKE-make} -s -f confmf > /dev/null 2>&1; then + # icc doesn't choke on unknown options, it will just issue warnings + # or remarks (even with -Werror). So we grep stderr for any message + # that says an option was ignored or not supported. + # When given -MP, icc 7.0 and 7.1 complain thusly: + # icc: Command line warning: ignoring option '-M'; no argument required + # The diagnosis changed in icc 8.0: + # icc: Command line remark: option '-MP' not supported + if (grep 'ignoring option' conftest.err || + grep 'not supported' conftest.err) >/dev/null 2>&1; then :; else + am_cv_CC_dependencies_compiler_type=$depmode + break + fi + fi + done + + cd .. + rm -rf conftest.dir +else + am_cv_CC_dependencies_compiler_type=none +fi + +fi +{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $am_cv_CC_dependencies_compiler_type" >&5 +$as_echo "$am_cv_CC_dependencies_compiler_type" >&6; } +CCDEPMODE=depmode=$am_cv_CC_dependencies_compiler_type + + if + test "x$enable_dependency_tracking" != xno \ + && test "$am_cv_CC_dependencies_compiler_type" = gcc3; then + am__fastdepCC_TRUE= + am__fastdepCC_FALSE='#' +else + am__fastdepCC_TRUE='#' + am__fastdepCC_FALSE= +fi + + + +# Check whether --enable-compiler-warnings was given. +if test "${enable_compiler_warnings+set}" = set; then : + enableval=$enable_compiler_warnings; +fi +case $enable_compiler_warnings in #( + no | min | yes | max | all) : + ;; #( + *) : + if test "x$enable_maintainer_mode" = xyes; then : + enable_compiler_warnings=yes +else + enable_compiler_warnings=min +fi ;; +esac + +case `pwd` in + *\ * | *\ *) + { $as_echo "$as_me:${as_lineno-$LINENO}: WARNING: Libtool does not cope well with whitespace in \`pwd\`" >&5 +$as_echo "$as_me: WARNING: Libtool does not cope well with whitespace in \`pwd\`" >&2;} ;; +esac + + + +macro_version='2.4.6' +macro_revision='2.4.6' + + + + + + + + + + + + + +ltmain=$ac_aux_dir/ltmain.sh + +# Make sure we can run config.sub. +$SHELL "$ac_aux_dir/config.sub" sun4 >/dev/null 2>&1 || + as_fn_error $? "cannot run $SHELL $ac_aux_dir/config.sub" "$LINENO" 5 + +{ $as_echo "$as_me:${as_lineno-$LINENO}: checking build system type" >&5 +$as_echo_n "checking build system type... " >&6; } +if ${ac_cv_build+:} false; then : + $as_echo_n "(cached) " >&6 +else + ac_build_alias=$build_alias +test "x$ac_build_alias" = x && + ac_build_alias=`$SHELL "$ac_aux_dir/config.guess"` +test "x$ac_build_alias" = x && + as_fn_error $? "cannot guess build type; you must specify one" "$LINENO" 5 +ac_cv_build=`$SHELL "$ac_aux_dir/config.sub" $ac_build_alias` || + as_fn_error $? "$SHELL $ac_aux_dir/config.sub $ac_build_alias failed" "$LINENO" 5 + +fi +{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_cv_build" >&5 +$as_echo "$ac_cv_build" >&6; } +case $ac_cv_build in +*-*-*) ;; +*) as_fn_error $? "invalid value of canonical build" "$LINENO" 5;; +esac +build=$ac_cv_build +ac_save_IFS=$IFS; IFS='-' +set x $ac_cv_build +shift +build_cpu=$1 +build_vendor=$2 +shift; shift +# Remember, the first character of IFS is used to create $*, +# except with old shells: +build_os=$* +IFS=$ac_save_IFS +case $build_os in *\ *) build_os=`echo "$build_os" | sed 's/ /-/g'`;; esac + + +{ $as_echo "$as_me:${as_lineno-$LINENO}: checking host system type" >&5 +$as_echo_n "checking host system type... " >&6; } +if ${ac_cv_host+:} false; then : + $as_echo_n "(cached) " >&6 +else + if test "x$host_alias" = x; then + ac_cv_host=$ac_cv_build +else + ac_cv_host=`$SHELL "$ac_aux_dir/config.sub" $host_alias` || + as_fn_error $? "$SHELL $ac_aux_dir/config.sub $host_alias failed" "$LINENO" 5 +fi + +fi +{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_cv_host" >&5 +$as_echo "$ac_cv_host" >&6; } +case $ac_cv_host in +*-*-*) ;; +*) as_fn_error $? "invalid value of canonical host" "$LINENO" 5;; +esac +host=$ac_cv_host +ac_save_IFS=$IFS; IFS='-' +set x $ac_cv_host +shift +host_cpu=$1 +host_vendor=$2 +shift; shift +# Remember, the first character of IFS is used to create $*, +# except with old shells: +host_os=$* +IFS=$ac_save_IFS +case $host_os in *\ *) host_os=`echo "$host_os" | sed 's/ /-/g'`;; esac + + +# Backslashify metacharacters that are still active within +# double-quoted strings. +sed_quote_subst='s/\(["`$\\]\)/\\\1/g' + +# Same as above, but do not quote variable references. +double_quote_subst='s/\(["`\\]\)/\\\1/g' + +# Sed substitution to delay expansion of an escaped shell variable in a +# double_quote_subst'ed string. +delay_variable_subst='s/\\\\\\\\\\\$/\\\\\\$/g' + +# Sed substitution to delay expansion of an escaped single quote. +delay_single_quote_subst='s/'\''/'\'\\\\\\\'\''/g' + +# Sed substitution to avoid accidental globbing in evaled expressions +no_glob_subst='s/\*/\\\*/g' + +ECHO='\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\' +ECHO=$ECHO$ECHO$ECHO$ECHO$ECHO +ECHO=$ECHO$ECHO$ECHO$ECHO$ECHO$ECHO + +{ $as_echo "$as_me:${as_lineno-$LINENO}: checking how to print strings" >&5 +$as_echo_n "checking how to print strings... " >&6; } +# Test print first, because it will be a builtin if present. +if test "X`( print -r -- -n ) 2>/dev/null`" = X-n && \ + test "X`print -r -- $ECHO 2>/dev/null`" = "X$ECHO"; then + ECHO='print -r --' +elif test "X`printf %s $ECHO 2>/dev/null`" = "X$ECHO"; then + ECHO='printf %s\n' +else + # Use this function as a fallback that always works. + func_fallback_echo () + { + eval 'cat <<_LTECHO_EOF +$1 +_LTECHO_EOF' + } + ECHO='func_fallback_echo' +fi + +# func_echo_all arg... +# Invoke $ECHO with all args, space-separated. +func_echo_all () +{ + $ECHO "" +} + +case $ECHO in + printf*) { $as_echo "$as_me:${as_lineno-$LINENO}: result: printf" >&5 +$as_echo "printf" >&6; } ;; + print*) { $as_echo "$as_me:${as_lineno-$LINENO}: result: print -r" >&5 +$as_echo "print -r" >&6; } ;; + *) { $as_echo "$as_me:${as_lineno-$LINENO}: result: cat" >&5 +$as_echo "cat" >&6; } ;; +esac + + + + + + + + + + + + + + +{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for a sed that does not truncate output" >&5 +$as_echo_n "checking for a sed that does not truncate output... " >&6; } +if ${ac_cv_path_SED+:} false; then : + $as_echo_n "(cached) " >&6 +else + ac_script=s/aaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaa/bbbbbbbbbbbbbbbbbbbbbbbbbbbbbbbbb/ + for ac_i in 1 2 3 4 5 6 7; do + ac_script="$ac_script$as_nl$ac_script" + done + echo "$ac_script" 2>/dev/null | sed 99q >conftest.sed + { ac_script=; unset ac_script;} + if test -z "$SED"; then + ac_path_SED_found=false + # Loop through the user's path and test for each of PROGNAME-LIST + as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in $PATH +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + for ac_prog in sed gsed; do + for ac_exec_ext in '' $ac_executable_extensions; do + ac_path_SED="$as_dir/$ac_prog$ac_exec_ext" + as_fn_executable_p "$ac_path_SED" || continue +# Check for GNU ac_path_SED and select it if it is found. + # Check for GNU $ac_path_SED +case `"$ac_path_SED" --version 2>&1` in +*GNU*) + ac_cv_path_SED="$ac_path_SED" ac_path_SED_found=:;; +*) + ac_count=0 + $as_echo_n 0123456789 >"conftest.in" + while : + do + cat "conftest.in" "conftest.in" >"conftest.tmp" + mv "conftest.tmp" "conftest.in" + cp "conftest.in" "conftest.nl" + $as_echo '' >> "conftest.nl" + "$ac_path_SED" -f conftest.sed < "conftest.nl" >"conftest.out" 2>/dev/null || break + diff "conftest.out" "conftest.nl" >/dev/null 2>&1 || break + as_fn_arith $ac_count + 1 && ac_count=$as_val + if test $ac_count -gt ${ac_path_SED_max-0}; then + # Best one so far, save it but keep looking for a better one + ac_cv_path_SED="$ac_path_SED" + ac_path_SED_max=$ac_count + fi + # 10*(2^10) chars as input seems more than enough + test $ac_count -gt 10 && break + done + rm -f conftest.in conftest.tmp conftest.nl conftest.out;; +esac + + $ac_path_SED_found && break 3 + done + done + done +IFS=$as_save_IFS + if test -z "$ac_cv_path_SED"; then + as_fn_error $? "no acceptable sed could be found in \$PATH" "$LINENO" 5 + fi +else + ac_cv_path_SED=$SED +fi + +fi +{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_cv_path_SED" >&5 +$as_echo "$ac_cv_path_SED" >&6; } + SED="$ac_cv_path_SED" + rm -f conftest.sed + +test -z "$SED" && SED=sed +Xsed="$SED -e 1s/^X//" + + + + + + + + + + + +{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for grep that handles long lines and -e" >&5 +$as_echo_n "checking for grep that handles long lines and -e... " >&6; } +if ${ac_cv_path_GREP+:} false; then : + $as_echo_n "(cached) " >&6 +else + if test -z "$GREP"; then + ac_path_GREP_found=false + # Loop through the user's path and test for each of PROGNAME-LIST + as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in $PATH$PATH_SEPARATOR/usr/xpg4/bin +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + for ac_prog in grep ggrep; do + for ac_exec_ext in '' $ac_executable_extensions; do + ac_path_GREP="$as_dir/$ac_prog$ac_exec_ext" + as_fn_executable_p "$ac_path_GREP" || continue +# Check for GNU ac_path_GREP and select it if it is found. + # Check for GNU $ac_path_GREP +case `"$ac_path_GREP" --version 2>&1` in +*GNU*) + ac_cv_path_GREP="$ac_path_GREP" ac_path_GREP_found=:;; +*) + ac_count=0 + $as_echo_n 0123456789 >"conftest.in" + while : + do + cat "conftest.in" "conftest.in" >"conftest.tmp" + mv "conftest.tmp" "conftest.in" + cp "conftest.in" "conftest.nl" + $as_echo 'GREP' >> "conftest.nl" + "$ac_path_GREP" -e 'GREP$' -e '-(cannot match)-' < "conftest.nl" >"conftest.out" 2>/dev/null || break + diff "conftest.out" "conftest.nl" >/dev/null 2>&1 || break + as_fn_arith $ac_count + 1 && ac_count=$as_val + if test $ac_count -gt ${ac_path_GREP_max-0}; then + # Best one so far, save it but keep looking for a better one + ac_cv_path_GREP="$ac_path_GREP" + ac_path_GREP_max=$ac_count + fi + # 10*(2^10) chars as input seems more than enough + test $ac_count -gt 10 && break + done + rm -f conftest.in conftest.tmp conftest.nl conftest.out;; +esac + + $ac_path_GREP_found && break 3 + done + done + done +IFS=$as_save_IFS + if test -z "$ac_cv_path_GREP"; then + as_fn_error $? "no acceptable grep could be found in $PATH$PATH_SEPARATOR/usr/xpg4/bin" "$LINENO" 5 + fi +else + ac_cv_path_GREP=$GREP +fi + +fi +{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_cv_path_GREP" >&5 +$as_echo "$ac_cv_path_GREP" >&6; } + GREP="$ac_cv_path_GREP" + + +{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for egrep" >&5 +$as_echo_n "checking for egrep... " >&6; } +if ${ac_cv_path_EGREP+:} false; then : + $as_echo_n "(cached) " >&6 +else + if echo a | $GREP -E '(a|b)' >/dev/null 2>&1 + then ac_cv_path_EGREP="$GREP -E" + else + if test -z "$EGREP"; then + ac_path_EGREP_found=false + # Loop through the user's path and test for each of PROGNAME-LIST + as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in $PATH$PATH_SEPARATOR/usr/xpg4/bin +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + for ac_prog in egrep; do + for ac_exec_ext in '' $ac_executable_extensions; do + ac_path_EGREP="$as_dir/$ac_prog$ac_exec_ext" + as_fn_executable_p "$ac_path_EGREP" || continue +# Check for GNU ac_path_EGREP and select it if it is found. + # Check for GNU $ac_path_EGREP +case `"$ac_path_EGREP" --version 2>&1` in +*GNU*) + ac_cv_path_EGREP="$ac_path_EGREP" ac_path_EGREP_found=:;; +*) + ac_count=0 + $as_echo_n 0123456789 >"conftest.in" + while : + do + cat "conftest.in" "conftest.in" >"conftest.tmp" + mv "conftest.tmp" "conftest.in" + cp "conftest.in" "conftest.nl" + $as_echo 'EGREP' >> "conftest.nl" + "$ac_path_EGREP" 'EGREP$' < "conftest.nl" >"conftest.out" 2>/dev/null || break + diff "conftest.out" "conftest.nl" >/dev/null 2>&1 || break + as_fn_arith $ac_count + 1 && ac_count=$as_val + if test $ac_count -gt ${ac_path_EGREP_max-0}; then + # Best one so far, save it but keep looking for a better one + ac_cv_path_EGREP="$ac_path_EGREP" + ac_path_EGREP_max=$ac_count + fi + # 10*(2^10) chars as input seems more than enough + test $ac_count -gt 10 && break + done + rm -f conftest.in conftest.tmp conftest.nl conftest.out;; +esac + + $ac_path_EGREP_found && break 3 + done + done + done +IFS=$as_save_IFS + if test -z "$ac_cv_path_EGREP"; then + as_fn_error $? "no acceptable egrep could be found in $PATH$PATH_SEPARATOR/usr/xpg4/bin" "$LINENO" 5 + fi +else + ac_cv_path_EGREP=$EGREP +fi + + fi +fi +{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_cv_path_EGREP" >&5 +$as_echo "$ac_cv_path_EGREP" >&6; } + EGREP="$ac_cv_path_EGREP" + + +{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for fgrep" >&5 +$as_echo_n "checking for fgrep... " >&6; } +if ${ac_cv_path_FGREP+:} false; then : + $as_echo_n "(cached) " >&6 +else + if echo 'ab*c' | $GREP -F 'ab*c' >/dev/null 2>&1 + then ac_cv_path_FGREP="$GREP -F" + else + if test -z "$FGREP"; then + ac_path_FGREP_found=false + # Loop through the user's path and test for each of PROGNAME-LIST + as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in $PATH$PATH_SEPARATOR/usr/xpg4/bin +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + for ac_prog in fgrep; do + for ac_exec_ext in '' $ac_executable_extensions; do + ac_path_FGREP="$as_dir/$ac_prog$ac_exec_ext" + as_fn_executable_p "$ac_path_FGREP" || continue +# Check for GNU ac_path_FGREP and select it if it is found. + # Check for GNU $ac_path_FGREP +case `"$ac_path_FGREP" --version 2>&1` in +*GNU*) + ac_cv_path_FGREP="$ac_path_FGREP" ac_path_FGREP_found=:;; +*) + ac_count=0 + $as_echo_n 0123456789 >"conftest.in" + while : + do + cat "conftest.in" "conftest.in" >"conftest.tmp" + mv "conftest.tmp" "conftest.in" + cp "conftest.in" "conftest.nl" + $as_echo 'FGREP' >> "conftest.nl" + "$ac_path_FGREP" FGREP < "conftest.nl" >"conftest.out" 2>/dev/null || break + diff "conftest.out" "conftest.nl" >/dev/null 2>&1 || break + as_fn_arith $ac_count + 1 && ac_count=$as_val + if test $ac_count -gt ${ac_path_FGREP_max-0}; then + # Best one so far, save it but keep looking for a better one + ac_cv_path_FGREP="$ac_path_FGREP" + ac_path_FGREP_max=$ac_count + fi + # 10*(2^10) chars as input seems more than enough + test $ac_count -gt 10 && break + done + rm -f conftest.in conftest.tmp conftest.nl conftest.out;; +esac + + $ac_path_FGREP_found && break 3 + done + done + done +IFS=$as_save_IFS + if test -z "$ac_cv_path_FGREP"; then + as_fn_error $? "no acceptable fgrep could be found in $PATH$PATH_SEPARATOR/usr/xpg4/bin" "$LINENO" 5 + fi +else + ac_cv_path_FGREP=$FGREP +fi + + fi +fi +{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_cv_path_FGREP" >&5 +$as_echo "$ac_cv_path_FGREP" >&6; } + FGREP="$ac_cv_path_FGREP" + + +test -z "$GREP" && GREP=grep + + + + + + + + + + + + + + + + + + + +# Check whether --with-gnu-ld was given. +if test "${with_gnu_ld+set}" = set; then : + withval=$with_gnu_ld; test no = "$withval" || with_gnu_ld=yes +else + with_gnu_ld=no +fi + +ac_prog=ld +if test yes = "$GCC"; then + # Check if gcc -print-prog-name=ld gives a path. + { $as_echo "$as_me:${as_lineno-$LINENO}: checking for ld used by $CC" >&5 +$as_echo_n "checking for ld used by $CC... " >&6; } + case $host in + *-*-mingw*) + # gcc leaves a trailing carriage return, which upsets mingw + ac_prog=`($CC -print-prog-name=ld) 2>&5 | tr -d '\015'` ;; + *) + ac_prog=`($CC -print-prog-name=ld) 2>&5` ;; + esac + case $ac_prog in + # Accept absolute paths. + [\\/]* | ?:[\\/]*) + re_direlt='/[^/][^/]*/\.\./' + # Canonicalize the pathname of ld + ac_prog=`$ECHO "$ac_prog"| $SED 's%\\\\%/%g'` + while $ECHO "$ac_prog" | $GREP "$re_direlt" > /dev/null 2>&1; do + ac_prog=`$ECHO $ac_prog| $SED "s%$re_direlt%/%"` + done + test -z "$LD" && LD=$ac_prog + ;; + "") + # If it fails, then pretend we aren't using GCC. + ac_prog=ld + ;; + *) + # If it is relative, then search for the first ld in PATH. + with_gnu_ld=unknown + ;; + esac +elif test yes = "$with_gnu_ld"; then + { $as_echo "$as_me:${as_lineno-$LINENO}: checking for GNU ld" >&5 +$as_echo_n "checking for GNU ld... " >&6; } +else + { $as_echo "$as_me:${as_lineno-$LINENO}: checking for non-GNU ld" >&5 +$as_echo_n "checking for non-GNU ld... " >&6; } +fi +if ${lt_cv_path_LD+:} false; then : + $as_echo_n "(cached) " >&6 +else + if test -z "$LD"; then + lt_save_ifs=$IFS; IFS=$PATH_SEPARATOR + for ac_dir in $PATH; do + IFS=$lt_save_ifs + test -z "$ac_dir" && ac_dir=. + if test -f "$ac_dir/$ac_prog" || test -f "$ac_dir/$ac_prog$ac_exeext"; then + lt_cv_path_LD=$ac_dir/$ac_prog + # Check to see if the program is GNU ld. I'd rather use --version, + # but apparently some variants of GNU ld only accept -v. + # Break only if it was the GNU/non-GNU ld that we prefer. + case `"$lt_cv_path_LD" -v 2>&1 </dev/null` in + *GNU* | *'with BFD'*) + test no != "$with_gnu_ld" && break + ;; + *) + test yes != "$with_gnu_ld" && break + ;; + esac + fi + done + IFS=$lt_save_ifs +else + lt_cv_path_LD=$LD # Let the user override the test with a path. +fi +fi + +LD=$lt_cv_path_LD +if test -n "$LD"; then + { $as_echo "$as_me:${as_lineno-$LINENO}: result: $LD" >&5 +$as_echo "$LD" >&6; } +else + { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5 +$as_echo "no" >&6; } +fi +test -z "$LD" && as_fn_error $? "no acceptable ld found in \$PATH" "$LINENO" 5 +{ $as_echo "$as_me:${as_lineno-$LINENO}: checking if the linker ($LD) is GNU ld" >&5 +$as_echo_n "checking if the linker ($LD) is GNU ld... " >&6; } +if ${lt_cv_prog_gnu_ld+:} false; then : + $as_echo_n "(cached) " >&6 +else + # I'd rather use --version here, but apparently some GNU lds only accept -v. +case `$LD -v 2>&1 </dev/null` in +*GNU* | *'with BFD'*) + lt_cv_prog_gnu_ld=yes + ;; +*) + lt_cv_prog_gnu_ld=no + ;; +esac +fi +{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $lt_cv_prog_gnu_ld" >&5 +$as_echo "$lt_cv_prog_gnu_ld" >&6; } +with_gnu_ld=$lt_cv_prog_gnu_ld + + + + + + + + + +{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for BSD- or MS-compatible name lister (nm)" >&5 +$as_echo_n "checking for BSD- or MS-compatible name lister (nm)... " >&6; } +if ${lt_cv_path_NM+:} false; then : + $as_echo_n "(cached) " >&6 +else + if test -n "$NM"; then + # Let the user override the test. + lt_cv_path_NM=$NM +else + lt_nm_to_check=${ac_tool_prefix}nm + if test -n "$ac_tool_prefix" && test "$build" = "$host"; then + lt_nm_to_check="$lt_nm_to_check nm" + fi + for lt_tmp_nm in $lt_nm_to_check; do + lt_save_ifs=$IFS; IFS=$PATH_SEPARATOR + for ac_dir in $PATH /usr/ccs/bin/elf /usr/ccs/bin /usr/ucb /bin; do + IFS=$lt_save_ifs + test -z "$ac_dir" && ac_dir=. + tmp_nm=$ac_dir/$lt_tmp_nm + if test -f "$tmp_nm" || test -f "$tmp_nm$ac_exeext"; then + # Check to see if the nm accepts a BSD-compat flag. + # Adding the 'sed 1q' prevents false positives on HP-UX, which says: + # nm: unknown option "B" ignored + # Tru64's nm complains that /dev/null is an invalid object file + # MSYS converts /dev/null to NUL, MinGW nm treats NUL as empty + case $build_os in + mingw*) lt_bad_file=conftest.nm/nofile ;; + *) lt_bad_file=/dev/null ;; + esac + case `"$tmp_nm" -B $lt_bad_file 2>&1 | sed '1q'` in + *$lt_bad_file* | *'Invalid file or object type'*) + lt_cv_path_NM="$tmp_nm -B" + break 2 + ;; + *) + case `"$tmp_nm" -p /dev/null 2>&1 | sed '1q'` in + */dev/null*) + lt_cv_path_NM="$tmp_nm -p" + break 2 + ;; + *) + lt_cv_path_NM=${lt_cv_path_NM="$tmp_nm"} # keep the first match, but + continue # so that we can try to find one that supports BSD flags + ;; + esac + ;; + esac + fi + done + IFS=$lt_save_ifs + done + : ${lt_cv_path_NM=no} +fi +fi +{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $lt_cv_path_NM" >&5 +$as_echo "$lt_cv_path_NM" >&6; } +if test no != "$lt_cv_path_NM"; then + NM=$lt_cv_path_NM +else + # Didn't find any BSD compatible name lister, look for dumpbin. + if test -n "$DUMPBIN"; then : + # Let the user override the test. + else + if test -n "$ac_tool_prefix"; then + for ac_prog in dumpbin "link -dump" + do + # Extract the first word of "$ac_tool_prefix$ac_prog", so it can be a program name with args. +set dummy $ac_tool_prefix$ac_prog; ac_word=$2 +{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $ac_word" >&5 +$as_echo_n "checking for $ac_word... " >&6; } +if ${ac_cv_prog_DUMPBIN+:} false; then : + $as_echo_n "(cached) " >&6 +else + if test -n "$DUMPBIN"; then + ac_cv_prog_DUMPBIN="$DUMPBIN" # Let the user override the test. +else +as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in $PATH +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + for ac_exec_ext in '' $ac_executable_extensions; do + if as_fn_executable_p "$as_dir/$ac_word$ac_exec_ext"; then + ac_cv_prog_DUMPBIN="$ac_tool_prefix$ac_prog" + $as_echo "$as_me:${as_lineno-$LINENO}: found $as_dir/$ac_word$ac_exec_ext" >&5 + break 2 + fi +done + done +IFS=$as_save_IFS + +fi +fi +DUMPBIN=$ac_cv_prog_DUMPBIN +if test -n "$DUMPBIN"; then + { $as_echo "$as_me:${as_lineno-$LINENO}: result: $DUMPBIN" >&5 +$as_echo "$DUMPBIN" >&6; } +else + { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5 +$as_echo "no" >&6; } +fi + + + test -n "$DUMPBIN" && break + done +fi +if test -z "$DUMPBIN"; then + ac_ct_DUMPBIN=$DUMPBIN + for ac_prog in dumpbin "link -dump" +do + # Extract the first word of "$ac_prog", so it can be a program name with args. +set dummy $ac_prog; ac_word=$2 +{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $ac_word" >&5 +$as_echo_n "checking for $ac_word... " >&6; } +if ${ac_cv_prog_ac_ct_DUMPBIN+:} false; then : + $as_echo_n "(cached) " >&6 +else + if test -n "$ac_ct_DUMPBIN"; then + ac_cv_prog_ac_ct_DUMPBIN="$ac_ct_DUMPBIN" # Let the user override the test. +else +as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in $PATH +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + for ac_exec_ext in '' $ac_executable_extensions; do + if as_fn_executable_p "$as_dir/$ac_word$ac_exec_ext"; then + ac_cv_prog_ac_ct_DUMPBIN="$ac_prog" + $as_echo "$as_me:${as_lineno-$LINENO}: found $as_dir/$ac_word$ac_exec_ext" >&5 + break 2 + fi +done + done +IFS=$as_save_IFS + +fi +fi +ac_ct_DUMPBIN=$ac_cv_prog_ac_ct_DUMPBIN +if test -n "$ac_ct_DUMPBIN"; then + { $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_ct_DUMPBIN" >&5 +$as_echo "$ac_ct_DUMPBIN" >&6; } +else + { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5 +$as_echo "no" >&6; } +fi + + + test -n "$ac_ct_DUMPBIN" && break +done + + if test "x$ac_ct_DUMPBIN" = x; then + DUMPBIN=":" + else + case $cross_compiling:$ac_tool_warned in +yes:) +{ $as_echo "$as_me:${as_lineno-$LINENO}: WARNING: using cross tools not prefixed with host triplet" >&5 +$as_echo "$as_me: WARNING: using cross tools not prefixed with host triplet" >&2;} +ac_tool_warned=yes ;; +esac + DUMPBIN=$ac_ct_DUMPBIN + fi +fi + + case `$DUMPBIN -symbols -headers /dev/null 2>&1 | sed '1q'` in + *COFF*) + DUMPBIN="$DUMPBIN -symbols -headers" + ;; + *) + DUMPBIN=: + ;; + esac + fi + + if test : != "$DUMPBIN"; then + NM=$DUMPBIN + fi +fi +test -z "$NM" && NM=nm + + + + + + +{ $as_echo "$as_me:${as_lineno-$LINENO}: checking the name lister ($NM) interface" >&5 +$as_echo_n "checking the name lister ($NM) interface... " >&6; } +if ${lt_cv_nm_interface+:} false; then : + $as_echo_n "(cached) " >&6 +else + lt_cv_nm_interface="BSD nm" + echo "int some_variable = 0;" > conftest.$ac_ext + (eval echo "\"\$as_me:$LINENO: $ac_compile\"" >&5) + (eval "$ac_compile" 2>conftest.err) + cat conftest.err >&5 + (eval echo "\"\$as_me:$LINENO: $NM \\\"conftest.$ac_objext\\\"\"" >&5) + (eval "$NM \"conftest.$ac_objext\"" 2>conftest.err > conftest.out) + cat conftest.err >&5 + (eval echo "\"\$as_me:$LINENO: output\"" >&5) + cat conftest.out >&5 + if $GREP 'External.*some_variable' conftest.out > /dev/null; then + lt_cv_nm_interface="MS dumpbin" + fi + rm -f conftest* +fi +{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $lt_cv_nm_interface" >&5 +$as_echo "$lt_cv_nm_interface" >&6; } + +{ $as_echo "$as_me:${as_lineno-$LINENO}: checking whether ln -s works" >&5 +$as_echo_n "checking whether ln -s works... " >&6; } +LN_S=$as_ln_s +if test "$LN_S" = "ln -s"; then + { $as_echo "$as_me:${as_lineno-$LINENO}: result: yes" >&5 +$as_echo "yes" >&6; } +else + { $as_echo "$as_me:${as_lineno-$LINENO}: result: no, using $LN_S" >&5 +$as_echo "no, using $LN_S" >&6; } +fi + +# find the maximum length of command line arguments +{ $as_echo "$as_me:${as_lineno-$LINENO}: checking the maximum length of command line arguments" >&5 +$as_echo_n "checking the maximum length of command line arguments... " >&6; } +if ${lt_cv_sys_max_cmd_len+:} false; then : + $as_echo_n "(cached) " >&6 +else + i=0 + teststring=ABCD + + case $build_os in + msdosdjgpp*) + # On DJGPP, this test can blow up pretty badly due to problems in libc + # (any single argument exceeding 2000 bytes causes a buffer overrun + # during glob expansion). Even if it were fixed, the result of this + # check would be larger than it should be. + lt_cv_sys_max_cmd_len=12288; # 12K is about right + ;; + + gnu*) + # Under GNU Hurd, this test is not required because there is + # no limit to the length of command line arguments. + # Libtool will interpret -1 as no limit whatsoever + lt_cv_sys_max_cmd_len=-1; + ;; + + cygwin* | mingw* | cegcc*) + # On Win9x/ME, this test blows up -- it succeeds, but takes + # about 5 minutes as the teststring grows exponentially. + # Worse, since 9x/ME are not pre-emptively multitasking, + # you end up with a "frozen" computer, even though with patience + # the test eventually succeeds (with a max line length of 256k). + # Instead, let's just punt: use the minimum linelength reported by + # all of the supported platforms: 8192 (on NT/2K/XP). + lt_cv_sys_max_cmd_len=8192; + ;; + + mint*) + # On MiNT this can take a long time and run out of memory. + lt_cv_sys_max_cmd_len=8192; + ;; + + amigaos*) + # On AmigaOS with pdksh, this test takes hours, literally. + # So we just punt and use a minimum line length of 8192. + lt_cv_sys_max_cmd_len=8192; + ;; + + bitrig* | darwin* | dragonfly* | freebsd* | netbsd* | openbsd*) + # This has been around since 386BSD, at least. Likely further. + if test -x /sbin/sysctl; then + lt_cv_sys_max_cmd_len=`/sbin/sysctl -n kern.argmax` + elif test -x /usr/sbin/sysctl; then + lt_cv_sys_max_cmd_len=`/usr/sbin/sysctl -n kern.argmax` + else + lt_cv_sys_max_cmd_len=65536 # usable default for all BSDs + fi + # And add a safety zone + lt_cv_sys_max_cmd_len=`expr $lt_cv_sys_max_cmd_len \/ 4` + lt_cv_sys_max_cmd_len=`expr $lt_cv_sys_max_cmd_len \* 3` + ;; + + interix*) + # We know the value 262144 and hardcode it with a safety zone (like BSD) + lt_cv_sys_max_cmd_len=196608 + ;; + + os2*) + # The test takes a long time on OS/2. + lt_cv_sys_max_cmd_len=8192 + ;; + + osf*) + # Dr. Hans Ekkehard Plesser reports seeing a kernel panic running configure + # due to this test when exec_disable_arg_limit is 1 on Tru64. It is not + # nice to cause kernel panics so lets avoid the loop below. + # First set a reasonable default. + lt_cv_sys_max_cmd_len=16384 + # + if test -x /sbin/sysconfig; then + case `/sbin/sysconfig -q proc exec_disable_arg_limit` in + *1*) lt_cv_sys_max_cmd_len=-1 ;; + esac + fi + ;; + sco3.2v5*) + lt_cv_sys_max_cmd_len=102400 + ;; + sysv5* | sco5v6* | sysv4.2uw2*) + kargmax=`grep ARG_MAX /etc/conf/cf.d/stune 2>/dev/null` + if test -n "$kargmax"; then + lt_cv_sys_max_cmd_len=`echo $kargmax | sed 's/.*[ ]//'` + else + lt_cv_sys_max_cmd_len=32768 + fi + ;; + *) + lt_cv_sys_max_cmd_len=`(getconf ARG_MAX) 2> /dev/null` + if test -n "$lt_cv_sys_max_cmd_len" && \ + test undefined != "$lt_cv_sys_max_cmd_len"; then + lt_cv_sys_max_cmd_len=`expr $lt_cv_sys_max_cmd_len \/ 4` + lt_cv_sys_max_cmd_len=`expr $lt_cv_sys_max_cmd_len \* 3` + else + # Make teststring a little bigger before we do anything with it. + # a 1K string should be a reasonable start. + for i in 1 2 3 4 5 6 7 8; do + teststring=$teststring$teststring + done + SHELL=${SHELL-${CONFIG_SHELL-/bin/sh}} + # If test is not a shell built-in, we'll probably end up computing a + # maximum length that is only half of the actual maximum length, but + # we can't tell. + while { test X`env echo "$teststring$teststring" 2>/dev/null` \ + = "X$teststring$teststring"; } >/dev/null 2>&1 && + test 17 != "$i" # 1/2 MB should be enough + do + i=`expr $i + 1` + teststring=$teststring$teststring + done + # Only check the string length outside the loop. + lt_cv_sys_max_cmd_len=`expr "X$teststring" : ".*" 2>&1` + teststring= + # Add a significant safety factor because C++ compilers can tack on + # massive amounts of additional arguments before passing them to the + # linker. It appears as though 1/2 is a usable value. + lt_cv_sys_max_cmd_len=`expr $lt_cv_sys_max_cmd_len \/ 2` + fi + ;; + esac + +fi + +if test -n "$lt_cv_sys_max_cmd_len"; then + { $as_echo "$as_me:${as_lineno-$LINENO}: result: $lt_cv_sys_max_cmd_len" >&5 +$as_echo "$lt_cv_sys_max_cmd_len" >&6; } +else + { $as_echo "$as_me:${as_lineno-$LINENO}: result: none" >&5 +$as_echo "none" >&6; } +fi +max_cmd_len=$lt_cv_sys_max_cmd_len + + + + + + +: ${CP="cp -f"} +: ${MV="mv -f"} +: ${RM="rm -f"} + +if ( (MAIL=60; unset MAIL) || exit) >/dev/null 2>&1; then + lt_unset=unset +else + lt_unset=false +fi + + + + + +# test EBCDIC or ASCII +case `echo X|tr X '\101'` in + A) # ASCII based system + # \n is not interpreted correctly by Solaris 8 /usr/ucb/tr + lt_SP2NL='tr \040 \012' + lt_NL2SP='tr \015\012 \040\040' + ;; + *) # EBCDIC based system + lt_SP2NL='tr \100 \n' + lt_NL2SP='tr \r\n \100\100' + ;; +esac + + + + + + + + + +{ $as_echo "$as_me:${as_lineno-$LINENO}: checking how to convert $build file names to $host format" >&5 +$as_echo_n "checking how to convert $build file names to $host format... " >&6; } +if ${lt_cv_to_host_file_cmd+:} false; then : + $as_echo_n "(cached) " >&6 +else + case $host in + *-*-mingw* ) + case $build in + *-*-mingw* ) # actually msys + lt_cv_to_host_file_cmd=func_convert_file_msys_to_w32 + ;; + *-*-cygwin* ) + lt_cv_to_host_file_cmd=func_convert_file_cygwin_to_w32 + ;; + * ) # otherwise, assume *nix + lt_cv_to_host_file_cmd=func_convert_file_nix_to_w32 + ;; + esac + ;; + *-*-cygwin* ) + case $build in + *-*-mingw* ) # actually msys + lt_cv_to_host_file_cmd=func_convert_file_msys_to_cygwin + ;; + *-*-cygwin* ) + lt_cv_to_host_file_cmd=func_convert_file_noop + ;; + * ) # otherwise, assume *nix + lt_cv_to_host_file_cmd=func_convert_file_nix_to_cygwin + ;; + esac + ;; + * ) # unhandled hosts (and "normal" native builds) + lt_cv_to_host_file_cmd=func_convert_file_noop + ;; +esac + +fi + +to_host_file_cmd=$lt_cv_to_host_file_cmd +{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $lt_cv_to_host_file_cmd" >&5 +$as_echo "$lt_cv_to_host_file_cmd" >&6; } + + + + + +{ $as_echo "$as_me:${as_lineno-$LINENO}: checking how to convert $build file names to toolchain format" >&5 +$as_echo_n "checking how to convert $build file names to toolchain format... " >&6; } +if ${lt_cv_to_tool_file_cmd+:} false; then : + $as_echo_n "(cached) " >&6 +else + #assume ordinary cross tools, or native build. +lt_cv_to_tool_file_cmd=func_convert_file_noop +case $host in + *-*-mingw* ) + case $build in + *-*-mingw* ) # actually msys + lt_cv_to_tool_file_cmd=func_convert_file_msys_to_w32 + ;; + esac + ;; +esac + +fi + +to_tool_file_cmd=$lt_cv_to_tool_file_cmd +{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $lt_cv_to_tool_file_cmd" >&5 +$as_echo "$lt_cv_to_tool_file_cmd" >&6; } + + + + + +{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $LD option to reload object files" >&5 +$as_echo_n "checking for $LD option to reload object files... " >&6; } +if ${lt_cv_ld_reload_flag+:} false; then : + $as_echo_n "(cached) " >&6 +else + lt_cv_ld_reload_flag='-r' +fi +{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $lt_cv_ld_reload_flag" >&5 +$as_echo "$lt_cv_ld_reload_flag" >&6; } +reload_flag=$lt_cv_ld_reload_flag +case $reload_flag in +"" | " "*) ;; +*) reload_flag=" $reload_flag" ;; +esac +reload_cmds='$LD$reload_flag -o $output$reload_objs' +case $host_os in + cygwin* | mingw* | pw32* | cegcc*) + if test yes != "$GCC"; then + reload_cmds=false + fi + ;; + darwin*) + if test yes = "$GCC"; then + reload_cmds='$LTCC $LTCFLAGS -nostdlib $wl-r -o $output$reload_objs' + else + reload_cmds='$LD$reload_flag -o $output$reload_objs' + fi + ;; +esac + + + + + + + + + +if test -n "$ac_tool_prefix"; then + # Extract the first word of "${ac_tool_prefix}objdump", so it can be a program name with args. +set dummy ${ac_tool_prefix}objdump; ac_word=$2 +{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $ac_word" >&5 +$as_echo_n "checking for $ac_word... " >&6; } +if ${ac_cv_prog_OBJDUMP+:} false; then : + $as_echo_n "(cached) " >&6 +else + if test -n "$OBJDUMP"; then + ac_cv_prog_OBJDUMP="$OBJDUMP" # Let the user override the test. +else +as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in $PATH +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + for ac_exec_ext in '' $ac_executable_extensions; do + if as_fn_executable_p "$as_dir/$ac_word$ac_exec_ext"; then + ac_cv_prog_OBJDUMP="${ac_tool_prefix}objdump" + $as_echo "$as_me:${as_lineno-$LINENO}: found $as_dir/$ac_word$ac_exec_ext" >&5 + break 2 + fi +done + done +IFS=$as_save_IFS + +fi +fi +OBJDUMP=$ac_cv_prog_OBJDUMP +if test -n "$OBJDUMP"; then + { $as_echo "$as_me:${as_lineno-$LINENO}: result: $OBJDUMP" >&5 +$as_echo "$OBJDUMP" >&6; } +else + { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5 +$as_echo "no" >&6; } +fi + + +fi +if test -z "$ac_cv_prog_OBJDUMP"; then + ac_ct_OBJDUMP=$OBJDUMP + # Extract the first word of "objdump", so it can be a program name with args. +set dummy objdump; ac_word=$2 +{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $ac_word" >&5 +$as_echo_n "checking for $ac_word... " >&6; } +if ${ac_cv_prog_ac_ct_OBJDUMP+:} false; then : + $as_echo_n "(cached) " >&6 +else + if test -n "$ac_ct_OBJDUMP"; then + ac_cv_prog_ac_ct_OBJDUMP="$ac_ct_OBJDUMP" # Let the user override the test. +else +as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in $PATH +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + for ac_exec_ext in '' $ac_executable_extensions; do + if as_fn_executable_p "$as_dir/$ac_word$ac_exec_ext"; then + ac_cv_prog_ac_ct_OBJDUMP="objdump" + $as_echo "$as_me:${as_lineno-$LINENO}: found $as_dir/$ac_word$ac_exec_ext" >&5 + break 2 + fi +done + done +IFS=$as_save_IFS + +fi +fi +ac_ct_OBJDUMP=$ac_cv_prog_ac_ct_OBJDUMP +if test -n "$ac_ct_OBJDUMP"; then + { $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_ct_OBJDUMP" >&5 +$as_echo "$ac_ct_OBJDUMP" >&6; } +else + { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5 +$as_echo "no" >&6; } +fi + + if test "x$ac_ct_OBJDUMP" = x; then + OBJDUMP="false" + else + case $cross_compiling:$ac_tool_warned in +yes:) +{ $as_echo "$as_me:${as_lineno-$LINENO}: WARNING: using cross tools not prefixed with host triplet" >&5 +$as_echo "$as_me: WARNING: using cross tools not prefixed with host triplet" >&2;} +ac_tool_warned=yes ;; +esac + OBJDUMP=$ac_ct_OBJDUMP + fi +else + OBJDUMP="$ac_cv_prog_OBJDUMP" +fi + +test -z "$OBJDUMP" && OBJDUMP=objdump + + + + + + +{ $as_echo "$as_me:${as_lineno-$LINENO}: checking how to recognize dependent libraries" >&5 +$as_echo_n "checking how to recognize dependent libraries... " >&6; } +if ${lt_cv_deplibs_check_method+:} false; then : + $as_echo_n "(cached) " >&6 +else + lt_cv_file_magic_cmd='$MAGIC_CMD' +lt_cv_file_magic_test_file= +lt_cv_deplibs_check_method='unknown' +# Need to set the preceding variable on all platforms that support +# interlibrary dependencies. +# 'none' -- dependencies not supported. +# 'unknown' -- same as none, but documents that we really don't know. +# 'pass_all' -- all dependencies passed with no checks. +# 'test_compile' -- check by making test program. +# 'file_magic [[regex]]' -- check by looking for files in library path +# that responds to the $file_magic_cmd with a given extended regex. +# If you have 'file' or equivalent on your system and you're not sure +# whether 'pass_all' will *always* work, you probably want this one. + +case $host_os in +aix[4-9]*) + lt_cv_deplibs_check_method=pass_all + ;; + +beos*) + lt_cv_deplibs_check_method=pass_all + ;; + +bsdi[45]*) + lt_cv_deplibs_check_method='file_magic ELF [0-9][0-9]*-bit [ML]SB (shared object|dynamic lib)' + lt_cv_file_magic_cmd='/usr/bin/file -L' + lt_cv_file_magic_test_file=/shlib/libc.so + ;; + +cygwin*) + # func_win32_libid is a shell function defined in ltmain.sh + lt_cv_deplibs_check_method='file_magic ^x86 archive import|^x86 DLL' + lt_cv_file_magic_cmd='func_win32_libid' + ;; + +mingw* | pw32*) + # Base MSYS/MinGW do not provide the 'file' command needed by + # func_win32_libid shell function, so use a weaker test based on 'objdump', + # unless we find 'file', for example because we are cross-compiling. + if ( file / ) >/dev/null 2>&1; then + lt_cv_deplibs_check_method='file_magic ^x86 archive import|^x86 DLL' + lt_cv_file_magic_cmd='func_win32_libid' + else + # Keep this pattern in sync with the one in func_win32_libid. + lt_cv_deplibs_check_method='file_magic file format (pei*-i386(.*architecture: i386)?|pe-arm-wince|pe-x86-64)' + lt_cv_file_magic_cmd='$OBJDUMP -f' + fi + ;; + +cegcc*) + # use the weaker test based on 'objdump'. See mingw*. + lt_cv_deplibs_check_method='file_magic file format pe-arm-.*little(.*architecture: arm)?' + lt_cv_file_magic_cmd='$OBJDUMP -f' + ;; + +darwin* | rhapsody*) + lt_cv_deplibs_check_method=pass_all + ;; + +freebsd* | dragonfly*) + if echo __ELF__ | $CC -E - | $GREP __ELF__ > /dev/null; then + case $host_cpu in + i*86 ) + # Not sure whether the presence of OpenBSD here was a mistake. + # Let's accept both of them until this is cleared up. + lt_cv_deplibs_check_method='file_magic (FreeBSD|OpenBSD|DragonFly)/i[3-9]86 (compact )?demand paged shared library' + lt_cv_file_magic_cmd=/usr/bin/file + lt_cv_file_magic_test_file=`echo /usr/lib/libc.so.*` + ;; + esac + else + lt_cv_deplibs_check_method=pass_all + fi + ;; + +haiku*) + lt_cv_deplibs_check_method=pass_all + ;; + +hpux10.20* | hpux11*) + lt_cv_file_magic_cmd=/usr/bin/file + case $host_cpu in + ia64*) + lt_cv_deplibs_check_method='file_magic (s[0-9][0-9][0-9]|ELF-[0-9][0-9]) shared object file - IA64' + lt_cv_file_magic_test_file=/usr/lib/hpux32/libc.so + ;; + hppa*64*) + lt_cv_deplibs_check_method='file_magic (s[0-9][0-9][0-9]|ELF[ -][0-9][0-9])(-bit)?( [LM]SB)? shared object( file)?[, -]* PA-RISC [0-9]\.[0-9]' + lt_cv_file_magic_test_file=/usr/lib/pa20_64/libc.sl + ;; + *) + lt_cv_deplibs_check_method='file_magic (s[0-9][0-9][0-9]|PA-RISC[0-9]\.[0-9]) shared library' + lt_cv_file_magic_test_file=/usr/lib/libc.sl + ;; + esac + ;; + +interix[3-9]*) + # PIC code is broken on Interix 3.x, that's why |\.a not |_pic\.a here + lt_cv_deplibs_check_method='match_pattern /lib[^/]+(\.so|\.a)$' + ;; + +irix5* | irix6* | nonstopux*) + case $LD in + *-32|*"-32 ") libmagic=32-bit;; + *-n32|*"-n32 ") libmagic=N32;; + *-64|*"-64 ") libmagic=64-bit;; + *) libmagic=never-match;; + esac + lt_cv_deplibs_check_method=pass_all + ;; + +# This must be glibc/ELF. +linux* | k*bsd*-gnu | kopensolaris*-gnu | gnu*) + lt_cv_deplibs_check_method=pass_all + ;; + +netbsd*) + if echo __ELF__ | $CC -E - | $GREP __ELF__ > /dev/null; then + lt_cv_deplibs_check_method='match_pattern /lib[^/]+(\.so\.[0-9]+\.[0-9]+|_pic\.a)$' + else + lt_cv_deplibs_check_method='match_pattern /lib[^/]+(\.so|_pic\.a)$' + fi + ;; + +newos6*) + lt_cv_deplibs_check_method='file_magic ELF [0-9][0-9]*-bit [ML]SB (executable|dynamic lib)' + lt_cv_file_magic_cmd=/usr/bin/file + lt_cv_file_magic_test_file=/usr/lib/libnls.so + ;; + +*nto* | *qnx*) + lt_cv_deplibs_check_method=pass_all + ;; + +openbsd* | bitrig*) + if test -z "`echo __ELF__ | $CC -E - | $GREP __ELF__`"; then + lt_cv_deplibs_check_method='match_pattern /lib[^/]+(\.so\.[0-9]+\.[0-9]+|\.so|_pic\.a)$' + else + lt_cv_deplibs_check_method='match_pattern /lib[^/]+(\.so\.[0-9]+\.[0-9]+|_pic\.a)$' + fi + ;; + +osf3* | osf4* | osf5*) + lt_cv_deplibs_check_method=pass_all + ;; + +rdos*) + lt_cv_deplibs_check_method=pass_all + ;; + +solaris*) + lt_cv_deplibs_check_method=pass_all + ;; + +sysv5* | sco3.2v5* | sco5v6* | unixware* | OpenUNIX* | sysv4*uw2*) + lt_cv_deplibs_check_method=pass_all + ;; + +sysv4 | sysv4.3*) + case $host_vendor in + motorola) + lt_cv_deplibs_check_method='file_magic ELF [0-9][0-9]*-bit [ML]SB (shared object|dynamic lib) M[0-9][0-9]* Version [0-9]' + lt_cv_file_magic_test_file=`echo /usr/lib/libc.so*` + ;; + ncr) + lt_cv_deplibs_check_method=pass_all + ;; + sequent) + lt_cv_file_magic_cmd='/bin/file' + lt_cv_deplibs_check_method='file_magic ELF [0-9][0-9]*-bit [LM]SB (shared object|dynamic lib )' + ;; + sni) + lt_cv_file_magic_cmd='/bin/file' + lt_cv_deplibs_check_method="file_magic ELF [0-9][0-9]*-bit [LM]SB dynamic lib" + lt_cv_file_magic_test_file=/lib/libc.so + ;; + siemens) + lt_cv_deplibs_check_method=pass_all + ;; + pc) + lt_cv_deplibs_check_method=pass_all + ;; + esac + ;; + +tpf*) + lt_cv_deplibs_check_method=pass_all + ;; +os2*) + lt_cv_deplibs_check_method=pass_all + ;; +esac + +fi +{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $lt_cv_deplibs_check_method" >&5 +$as_echo "$lt_cv_deplibs_check_method" >&6; } + +file_magic_glob= +want_nocaseglob=no +if test "$build" = "$host"; then + case $host_os in + mingw* | pw32*) + if ( shopt | grep nocaseglob ) >/dev/null 2>&1; then + want_nocaseglob=yes + else + file_magic_glob=`echo aAbBcCdDeEfFgGhHiIjJkKlLmMnNoOpPqQrRsStTuUvVwWxXyYzZ | $SED -e "s/\(..\)/s\/[\1]\/[\1]\/g;/g"` + fi + ;; + esac +fi + +file_magic_cmd=$lt_cv_file_magic_cmd +deplibs_check_method=$lt_cv_deplibs_check_method +test -z "$deplibs_check_method" && deplibs_check_method=unknown + + + + + + + + + + + + + + + + + + + + + + +if test -n "$ac_tool_prefix"; then + # Extract the first word of "${ac_tool_prefix}dlltool", so it can be a program name with args. +set dummy ${ac_tool_prefix}dlltool; ac_word=$2 +{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $ac_word" >&5 +$as_echo_n "checking for $ac_word... " >&6; } +if ${ac_cv_prog_DLLTOOL+:} false; then : + $as_echo_n "(cached) " >&6 +else + if test -n "$DLLTOOL"; then + ac_cv_prog_DLLTOOL="$DLLTOOL" # Let the user override the test. +else +as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in $PATH +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + for ac_exec_ext in '' $ac_executable_extensions; do + if as_fn_executable_p "$as_dir/$ac_word$ac_exec_ext"; then + ac_cv_prog_DLLTOOL="${ac_tool_prefix}dlltool" + $as_echo "$as_me:${as_lineno-$LINENO}: found $as_dir/$ac_word$ac_exec_ext" >&5 + break 2 + fi +done + done +IFS=$as_save_IFS + +fi +fi +DLLTOOL=$ac_cv_prog_DLLTOOL +if test -n "$DLLTOOL"; then + { $as_echo "$as_me:${as_lineno-$LINENO}: result: $DLLTOOL" >&5 +$as_echo "$DLLTOOL" >&6; } +else + { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5 +$as_echo "no" >&6; } +fi + + +fi +if test -z "$ac_cv_prog_DLLTOOL"; then + ac_ct_DLLTOOL=$DLLTOOL + # Extract the first word of "dlltool", so it can be a program name with args. +set dummy dlltool; ac_word=$2 +{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $ac_word" >&5 +$as_echo_n "checking for $ac_word... " >&6; } +if ${ac_cv_prog_ac_ct_DLLTOOL+:} false; then : + $as_echo_n "(cached) " >&6 +else + if test -n "$ac_ct_DLLTOOL"; then + ac_cv_prog_ac_ct_DLLTOOL="$ac_ct_DLLTOOL" # Let the user override the test. +else +as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in $PATH +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + for ac_exec_ext in '' $ac_executable_extensions; do + if as_fn_executable_p "$as_dir/$ac_word$ac_exec_ext"; then + ac_cv_prog_ac_ct_DLLTOOL="dlltool" + $as_echo "$as_me:${as_lineno-$LINENO}: found $as_dir/$ac_word$ac_exec_ext" >&5 + break 2 + fi +done + done +IFS=$as_save_IFS + +fi +fi +ac_ct_DLLTOOL=$ac_cv_prog_ac_ct_DLLTOOL +if test -n "$ac_ct_DLLTOOL"; then + { $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_ct_DLLTOOL" >&5 +$as_echo "$ac_ct_DLLTOOL" >&6; } +else + { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5 +$as_echo "no" >&6; } +fi + + if test "x$ac_ct_DLLTOOL" = x; then + DLLTOOL="false" + else + case $cross_compiling:$ac_tool_warned in +yes:) +{ $as_echo "$as_me:${as_lineno-$LINENO}: WARNING: using cross tools not prefixed with host triplet" >&5 +$as_echo "$as_me: WARNING: using cross tools not prefixed with host triplet" >&2;} +ac_tool_warned=yes ;; +esac + DLLTOOL=$ac_ct_DLLTOOL + fi +else + DLLTOOL="$ac_cv_prog_DLLTOOL" +fi + +test -z "$DLLTOOL" && DLLTOOL=dlltool + + + + + + + +{ $as_echo "$as_me:${as_lineno-$LINENO}: checking how to associate runtime and link libraries" >&5 +$as_echo_n "checking how to associate runtime and link libraries... " >&6; } +if ${lt_cv_sharedlib_from_linklib_cmd+:} false; then : + $as_echo_n "(cached) " >&6 +else + lt_cv_sharedlib_from_linklib_cmd='unknown' + +case $host_os in +cygwin* | mingw* | pw32* | cegcc*) + # two different shell functions defined in ltmain.sh; + # decide which one to use based on capabilities of $DLLTOOL + case `$DLLTOOL --help 2>&1` in + *--identify-strict*) + lt_cv_sharedlib_from_linklib_cmd=func_cygming_dll_for_implib + ;; + *) + lt_cv_sharedlib_from_linklib_cmd=func_cygming_dll_for_implib_fallback + ;; + esac + ;; +*) + # fallback: assume linklib IS sharedlib + lt_cv_sharedlib_from_linklib_cmd=$ECHO + ;; +esac + +fi +{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $lt_cv_sharedlib_from_linklib_cmd" >&5 +$as_echo "$lt_cv_sharedlib_from_linklib_cmd" >&6; } +sharedlib_from_linklib_cmd=$lt_cv_sharedlib_from_linklib_cmd +test -z "$sharedlib_from_linklib_cmd" && sharedlib_from_linklib_cmd=$ECHO + + + + + + + +if test -n "$ac_tool_prefix"; then + for ac_prog in ar + do + # Extract the first word of "$ac_tool_prefix$ac_prog", so it can be a program name with args. +set dummy $ac_tool_prefix$ac_prog; ac_word=$2 +{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $ac_word" >&5 +$as_echo_n "checking for $ac_word... " >&6; } +if ${ac_cv_prog_AR+:} false; then : + $as_echo_n "(cached) " >&6 +else + if test -n "$AR"; then + ac_cv_prog_AR="$AR" # Let the user override the test. +else +as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in $PATH +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + for ac_exec_ext in '' $ac_executable_extensions; do + if as_fn_executable_p "$as_dir/$ac_word$ac_exec_ext"; then + ac_cv_prog_AR="$ac_tool_prefix$ac_prog" + $as_echo "$as_me:${as_lineno-$LINENO}: found $as_dir/$ac_word$ac_exec_ext" >&5 + break 2 + fi +done + done +IFS=$as_save_IFS + +fi +fi +AR=$ac_cv_prog_AR +if test -n "$AR"; then + { $as_echo "$as_me:${as_lineno-$LINENO}: result: $AR" >&5 +$as_echo "$AR" >&6; } +else + { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5 +$as_echo "no" >&6; } +fi + + + test -n "$AR" && break + done +fi +if test -z "$AR"; then + ac_ct_AR=$AR + for ac_prog in ar +do + # Extract the first word of "$ac_prog", so it can be a program name with args. +set dummy $ac_prog; ac_word=$2 +{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $ac_word" >&5 +$as_echo_n "checking for $ac_word... " >&6; } +if ${ac_cv_prog_ac_ct_AR+:} false; then : + $as_echo_n "(cached) " >&6 +else + if test -n "$ac_ct_AR"; then + ac_cv_prog_ac_ct_AR="$ac_ct_AR" # Let the user override the test. +else +as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in $PATH +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + for ac_exec_ext in '' $ac_executable_extensions; do + if as_fn_executable_p "$as_dir/$ac_word$ac_exec_ext"; then + ac_cv_prog_ac_ct_AR="$ac_prog" + $as_echo "$as_me:${as_lineno-$LINENO}: found $as_dir/$ac_word$ac_exec_ext" >&5 + break 2 + fi +done + done +IFS=$as_save_IFS + +fi +fi +ac_ct_AR=$ac_cv_prog_ac_ct_AR +if test -n "$ac_ct_AR"; then + { $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_ct_AR" >&5 +$as_echo "$ac_ct_AR" >&6; } +else + { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5 +$as_echo "no" >&6; } +fi + + + test -n "$ac_ct_AR" && break +done + + if test "x$ac_ct_AR" = x; then + AR="false" + else + case $cross_compiling:$ac_tool_warned in +yes:) +{ $as_echo "$as_me:${as_lineno-$LINENO}: WARNING: using cross tools not prefixed with host triplet" >&5 +$as_echo "$as_me: WARNING: using cross tools not prefixed with host triplet" >&2;} +ac_tool_warned=yes ;; +esac + AR=$ac_ct_AR + fi +fi + +: ${AR=ar} +: ${AR_FLAGS=cru} + + + + + + + + + + + +{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for archiver @FILE support" >&5 +$as_echo_n "checking for archiver @FILE support... " >&6; } +if ${lt_cv_ar_at_file+:} false; then : + $as_echo_n "(cached) " >&6 +else + lt_cv_ar_at_file=no + cat confdefs.h - <<_ACEOF >conftest.$ac_ext +/* end confdefs.h. */ + +int +main () +{ + + ; + return 0; +} +_ACEOF +if ac_fn_c_try_compile "$LINENO"; then : + echo conftest.$ac_objext > conftest.lst + lt_ar_try='$AR $AR_FLAGS libconftest.a @conftest.lst >&5' + { { eval echo "\"\$as_me\":${as_lineno-$LINENO}: \"$lt_ar_try\""; } >&5 + (eval $lt_ar_try) 2>&5 + ac_status=$? + $as_echo "$as_me:${as_lineno-$LINENO}: \$? = $ac_status" >&5 + test $ac_status = 0; } + if test 0 -eq "$ac_status"; then + # Ensure the archiver fails upon bogus file names. + rm -f conftest.$ac_objext libconftest.a + { { eval echo "\"\$as_me\":${as_lineno-$LINENO}: \"$lt_ar_try\""; } >&5 + (eval $lt_ar_try) 2>&5 + ac_status=$? + $as_echo "$as_me:${as_lineno-$LINENO}: \$? = $ac_status" >&5 + test $ac_status = 0; } + if test 0 -ne "$ac_status"; then + lt_cv_ar_at_file=@ + fi + fi + rm -f conftest.* libconftest.a + +fi +rm -f core conftest.err conftest.$ac_objext conftest.$ac_ext + +fi +{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $lt_cv_ar_at_file" >&5 +$as_echo "$lt_cv_ar_at_file" >&6; } + +if test no = "$lt_cv_ar_at_file"; then + archiver_list_spec= +else + archiver_list_spec=$lt_cv_ar_at_file +fi + + + + + + + +if test -n "$ac_tool_prefix"; then + # Extract the first word of "${ac_tool_prefix}strip", so it can be a program name with args. +set dummy ${ac_tool_prefix}strip; ac_word=$2 +{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $ac_word" >&5 +$as_echo_n "checking for $ac_word... " >&6; } +if ${ac_cv_prog_STRIP+:} false; then : + $as_echo_n "(cached) " >&6 +else + if test -n "$STRIP"; then + ac_cv_prog_STRIP="$STRIP" # Let the user override the test. +else +as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in $PATH +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + for ac_exec_ext in '' $ac_executable_extensions; do + if as_fn_executable_p "$as_dir/$ac_word$ac_exec_ext"; then + ac_cv_prog_STRIP="${ac_tool_prefix}strip" + $as_echo "$as_me:${as_lineno-$LINENO}: found $as_dir/$ac_word$ac_exec_ext" >&5 + break 2 + fi +done + done +IFS=$as_save_IFS + +fi +fi +STRIP=$ac_cv_prog_STRIP +if test -n "$STRIP"; then + { $as_echo "$as_me:${as_lineno-$LINENO}: result: $STRIP" >&5 +$as_echo "$STRIP" >&6; } +else + { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5 +$as_echo "no" >&6; } +fi + + +fi +if test -z "$ac_cv_prog_STRIP"; then + ac_ct_STRIP=$STRIP + # Extract the first word of "strip", so it can be a program name with args. +set dummy strip; ac_word=$2 +{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $ac_word" >&5 +$as_echo_n "checking for $ac_word... " >&6; } +if ${ac_cv_prog_ac_ct_STRIP+:} false; then : + $as_echo_n "(cached) " >&6 +else + if test -n "$ac_ct_STRIP"; then + ac_cv_prog_ac_ct_STRIP="$ac_ct_STRIP" # Let the user override the test. +else +as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in $PATH +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + for ac_exec_ext in '' $ac_executable_extensions; do + if as_fn_executable_p "$as_dir/$ac_word$ac_exec_ext"; then + ac_cv_prog_ac_ct_STRIP="strip" + $as_echo "$as_me:${as_lineno-$LINENO}: found $as_dir/$ac_word$ac_exec_ext" >&5 + break 2 + fi +done + done +IFS=$as_save_IFS + +fi +fi +ac_ct_STRIP=$ac_cv_prog_ac_ct_STRIP +if test -n "$ac_ct_STRIP"; then + { $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_ct_STRIP" >&5 +$as_echo "$ac_ct_STRIP" >&6; } +else + { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5 +$as_echo "no" >&6; } +fi + + if test "x$ac_ct_STRIP" = x; then + STRIP=":" + else + case $cross_compiling:$ac_tool_warned in +yes:) +{ $as_echo "$as_me:${as_lineno-$LINENO}: WARNING: using cross tools not prefixed with host triplet" >&5 +$as_echo "$as_me: WARNING: using cross tools not prefixed with host triplet" >&2;} +ac_tool_warned=yes ;; +esac + STRIP=$ac_ct_STRIP + fi +else + STRIP="$ac_cv_prog_STRIP" +fi + +test -z "$STRIP" && STRIP=: + + + + + + +if test -n "$ac_tool_prefix"; then + # Extract the first word of "${ac_tool_prefix}ranlib", so it can be a program name with args. +set dummy ${ac_tool_prefix}ranlib; ac_word=$2 +{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $ac_word" >&5 +$as_echo_n "checking for $ac_word... " >&6; } +if ${ac_cv_prog_RANLIB+:} false; then : + $as_echo_n "(cached) " >&6 +else + if test -n "$RANLIB"; then + ac_cv_prog_RANLIB="$RANLIB" # Let the user override the test. +else +as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in $PATH +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + for ac_exec_ext in '' $ac_executable_extensions; do + if as_fn_executable_p "$as_dir/$ac_word$ac_exec_ext"; then + ac_cv_prog_RANLIB="${ac_tool_prefix}ranlib" + $as_echo "$as_me:${as_lineno-$LINENO}: found $as_dir/$ac_word$ac_exec_ext" >&5 + break 2 + fi +done + done +IFS=$as_save_IFS + +fi +fi +RANLIB=$ac_cv_prog_RANLIB +if test -n "$RANLIB"; then + { $as_echo "$as_me:${as_lineno-$LINENO}: result: $RANLIB" >&5 +$as_echo "$RANLIB" >&6; } +else + { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5 +$as_echo "no" >&6; } +fi + + +fi +if test -z "$ac_cv_prog_RANLIB"; then + ac_ct_RANLIB=$RANLIB + # Extract the first word of "ranlib", so it can be a program name with args. +set dummy ranlib; ac_word=$2 +{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $ac_word" >&5 +$as_echo_n "checking for $ac_word... " >&6; } +if ${ac_cv_prog_ac_ct_RANLIB+:} false; then : + $as_echo_n "(cached) " >&6 +else + if test -n "$ac_ct_RANLIB"; then + ac_cv_prog_ac_ct_RANLIB="$ac_ct_RANLIB" # Let the user override the test. +else +as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in $PATH +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + for ac_exec_ext in '' $ac_executable_extensions; do + if as_fn_executable_p "$as_dir/$ac_word$ac_exec_ext"; then + ac_cv_prog_ac_ct_RANLIB="ranlib" + $as_echo "$as_me:${as_lineno-$LINENO}: found $as_dir/$ac_word$ac_exec_ext" >&5 + break 2 + fi +done + done +IFS=$as_save_IFS + +fi +fi +ac_ct_RANLIB=$ac_cv_prog_ac_ct_RANLIB +if test -n "$ac_ct_RANLIB"; then + { $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_ct_RANLIB" >&5 +$as_echo "$ac_ct_RANLIB" >&6; } +else + { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5 +$as_echo "no" >&6; } +fi + + if test "x$ac_ct_RANLIB" = x; then + RANLIB=":" + else + case $cross_compiling:$ac_tool_warned in +yes:) +{ $as_echo "$as_me:${as_lineno-$LINENO}: WARNING: using cross tools not prefixed with host triplet" >&5 +$as_echo "$as_me: WARNING: using cross tools not prefixed with host triplet" >&2;} +ac_tool_warned=yes ;; +esac + RANLIB=$ac_ct_RANLIB + fi +else + RANLIB="$ac_cv_prog_RANLIB" +fi + +test -z "$RANLIB" && RANLIB=: + + + + + + +# Determine commands to create old-style static archives. +old_archive_cmds='$AR $AR_FLAGS $oldlib$oldobjs' +old_postinstall_cmds='chmod 644 $oldlib' +old_postuninstall_cmds= + +if test -n "$RANLIB"; then + case $host_os in + bitrig* | openbsd*) + old_postinstall_cmds="$old_postinstall_cmds~\$RANLIB -t \$tool_oldlib" + ;; + *) + old_postinstall_cmds="$old_postinstall_cmds~\$RANLIB \$tool_oldlib" + ;; + esac + old_archive_cmds="$old_archive_cmds~\$RANLIB \$tool_oldlib" +fi + +case $host_os in + darwin*) + lock_old_archive_extraction=yes ;; + *) + lock_old_archive_extraction=no ;; +esac + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +# If no C compiler was specified, use CC. +LTCC=${LTCC-"$CC"} + +# If no C compiler flags were specified, use CFLAGS. +LTCFLAGS=${LTCFLAGS-"$CFLAGS"} + +# Allow CC to be a program name with arguments. +compiler=$CC + + +# Check for command to grab the raw symbol name followed by C symbol from nm. +{ $as_echo "$as_me:${as_lineno-$LINENO}: checking command to parse $NM output from $compiler object" >&5 +$as_echo_n "checking command to parse $NM output from $compiler object... " >&6; } +if ${lt_cv_sys_global_symbol_pipe+:} false; then : + $as_echo_n "(cached) " >&6 +else + +# These are sane defaults that work on at least a few old systems. +# [They come from Ultrix. What could be older than Ultrix?!! ;)] + +# Character class describing NM global symbol codes. +symcode='[BCDEGRST]' + +# Regexp to match symbols that can be accessed directly from C. +sympat='\([_A-Za-z][_A-Za-z0-9]*\)' + +# Define system-specific variables. +case $host_os in +aix*) + symcode='[BCDT]' + ;; +cygwin* | mingw* | pw32* | cegcc*) + symcode='[ABCDGISTW]' + ;; +hpux*) + if test ia64 = "$host_cpu"; then + symcode='[ABCDEGRST]' + fi + ;; +irix* | nonstopux*) + symcode='[BCDEGRST]' + ;; +osf*) + symcode='[BCDEGQRST]' + ;; +solaris*) + symcode='[BDRT]' + ;; +sco3.2v5*) + symcode='[DT]' + ;; +sysv4.2uw2*) + symcode='[DT]' + ;; +sysv5* | sco5v6* | unixware* | OpenUNIX*) + symcode='[ABDT]' + ;; +sysv4) + symcode='[DFNSTU]' + ;; +esac + +# If we're using GNU nm, then use its standard symbol codes. +case `$NM -V 2>&1` in +*GNU* | *'with BFD'*) + symcode='[ABCDGIRSTW]' ;; +esac + +if test "$lt_cv_nm_interface" = "MS dumpbin"; then + # Gets list of data symbols to import. + lt_cv_sys_global_symbol_to_import="sed -n -e 's/^I .* \(.*\)$/\1/p'" + # Adjust the below global symbol transforms to fixup imported variables. + lt_cdecl_hook=" -e 's/^I .* \(.*\)$/extern __declspec(dllimport) char \1;/p'" + lt_c_name_hook=" -e 's/^I .* \(.*\)$/ {\"\1\", (void *) 0},/p'" + lt_c_name_lib_hook="\ + -e 's/^I .* \(lib.*\)$/ {\"\1\", (void *) 0},/p'\ + -e 's/^I .* \(.*\)$/ {\"lib\1\", (void *) 0},/p'" +else + # Disable hooks by default. + lt_cv_sys_global_symbol_to_import= + lt_cdecl_hook= + lt_c_name_hook= + lt_c_name_lib_hook= +fi + +# Transform an extracted symbol line into a proper C declaration. +# Some systems (esp. on ia64) link data and code symbols differently, +# so use this general approach. +lt_cv_sys_global_symbol_to_cdecl="sed -n"\ +$lt_cdecl_hook\ +" -e 's/^T .* \(.*\)$/extern int \1();/p'"\ +" -e 's/^$symcode$symcode* .* \(.*\)$/extern char \1;/p'" + +# Transform an extracted symbol line into symbol name and symbol address +lt_cv_sys_global_symbol_to_c_name_address="sed -n"\ +$lt_c_name_hook\ +" -e 's/^: \(.*\) .*$/ {\"\1\", (void *) 0},/p'"\ +" -e 's/^$symcode$symcode* .* \(.*\)$/ {\"\1\", (void *) \&\1},/p'" + +# Transform an extracted symbol line into symbol name with lib prefix and +# symbol address. +lt_cv_sys_global_symbol_to_c_name_address_lib_prefix="sed -n"\ +$lt_c_name_lib_hook\ +" -e 's/^: \(.*\) .*$/ {\"\1\", (void *) 0},/p'"\ +" -e 's/^$symcode$symcode* .* \(lib.*\)$/ {\"\1\", (void *) \&\1},/p'"\ +" -e 's/^$symcode$symcode* .* \(.*\)$/ {\"lib\1\", (void *) \&\1},/p'" + +# Handle CRLF in mingw tool chain +opt_cr= +case $build_os in +mingw*) + opt_cr=`$ECHO 'x\{0,1\}' | tr x '\015'` # option cr in regexp + ;; +esac + +# Try without a prefix underscore, then with it. +for ac_symprfx in "" "_"; do + + # Transform symcode, sympat, and symprfx into a raw symbol and a C symbol. + symxfrm="\\1 $ac_symprfx\\2 \\2" + + # Write the raw and C identifiers. + if test "$lt_cv_nm_interface" = "MS dumpbin"; then + # Fake it for dumpbin and say T for any non-static function, + # D for any global variable and I for any imported variable. + # Also find C++ and __fastcall symbols from MSVC++, + # which start with @ or ?. + lt_cv_sys_global_symbol_pipe="$AWK '"\ +" {last_section=section; section=\$ 3};"\ +" /^COFF SYMBOL TABLE/{for(i in hide) delete hide[i]};"\ +" /Section length .*#relocs.*(pick any)/{hide[last_section]=1};"\ +" /^ *Symbol name *: /{split(\$ 0,sn,\":\"); si=substr(sn[2],2)};"\ +" /^ *Type *: code/{print \"T\",si,substr(si,length(prfx))};"\ +" /^ *Type *: data/{print \"I\",si,substr(si,length(prfx))};"\ +" \$ 0!~/External *\|/{next};"\ +" / 0+ UNDEF /{next}; / UNDEF \([^|]\)*()/{next};"\ +" {if(hide[section]) next};"\ +" {f=\"D\"}; \$ 0~/\(\).*\|/{f=\"T\"};"\ +" {split(\$ 0,a,/\||\r/); split(a[2],s)};"\ +" s[1]~/^[@?]/{print f,s[1],s[1]; next};"\ +" s[1]~prfx {split(s[1],t,\"@\"); print f,t[1],substr(t[1],length(prfx))}"\ +" ' prfx=^$ac_symprfx" + else + lt_cv_sys_global_symbol_pipe="sed -n -e 's/^.*[ ]\($symcode$symcode*\)[ ][ ]*$ac_symprfx$sympat$opt_cr$/$symxfrm/p'" + fi + lt_cv_sys_global_symbol_pipe="$lt_cv_sys_global_symbol_pipe | sed '/ __gnu_lto/d'" + + # Check to see that the pipe works correctly. + pipe_works=no + + rm -f conftest* + cat > conftest.$ac_ext <<_LT_EOF +#ifdef __cplusplus +extern "C" { +#endif +char nm_test_var; +void nm_test_func(void); +void nm_test_func(void){} +#ifdef __cplusplus +} +#endif +int main(){nm_test_var='a';nm_test_func();return(0);} +_LT_EOF + + if { { eval echo "\"\$as_me\":${as_lineno-$LINENO}: \"$ac_compile\""; } >&5 + (eval $ac_compile) 2>&5 + ac_status=$? + $as_echo "$as_me:${as_lineno-$LINENO}: \$? = $ac_status" >&5 + test $ac_status = 0; }; then + # Now try to grab the symbols. + nlist=conftest.nm + if { { eval echo "\"\$as_me\":${as_lineno-$LINENO}: \"$NM conftest.$ac_objext \| "$lt_cv_sys_global_symbol_pipe" \> $nlist\""; } >&5 + (eval $NM conftest.$ac_objext \| "$lt_cv_sys_global_symbol_pipe" \> $nlist) 2>&5 + ac_status=$? + $as_echo "$as_me:${as_lineno-$LINENO}: \$? = $ac_status" >&5 + test $ac_status = 0; } && test -s "$nlist"; then + # Try sorting and uniquifying the output. + if sort "$nlist" | uniq > "$nlist"T; then + mv -f "$nlist"T "$nlist" + else + rm -f "$nlist"T + fi + + # Make sure that we snagged all the symbols we need. + if $GREP ' nm_test_var$' "$nlist" >/dev/null; then + if $GREP ' nm_test_func$' "$nlist" >/dev/null; then + cat <<_LT_EOF > conftest.$ac_ext +/* Keep this code in sync between libtool.m4, ltmain, lt_system.h, and tests. */ +#if defined _WIN32 || defined __CYGWIN__ || defined _WIN32_WCE +/* DATA imports from DLLs on WIN32 can't be const, because runtime + relocations are performed -- see ld's documentation on pseudo-relocs. */ +# define LT_DLSYM_CONST +#elif defined __osf__ +/* This system does not cope well with relocations in const data. */ +# define LT_DLSYM_CONST +#else +# define LT_DLSYM_CONST const +#endif + +#ifdef __cplusplus +extern "C" { +#endif + +_LT_EOF + # Now generate the symbol file. + eval "$lt_cv_sys_global_symbol_to_cdecl"' < "$nlist" | $GREP -v main >> conftest.$ac_ext' + + cat <<_LT_EOF >> conftest.$ac_ext + +/* The mapping between symbol names and symbols. */ +LT_DLSYM_CONST struct { + const char *name; + void *address; +} +lt__PROGRAM__LTX_preloaded_symbols[] = +{ + { "@PROGRAM@", (void *) 0 }, +_LT_EOF + $SED "s/^$symcode$symcode* .* \(.*\)$/ {\"\1\", (void *) \&\1},/" < "$nlist" | $GREP -v main >> conftest.$ac_ext + cat <<\_LT_EOF >> conftest.$ac_ext + {0, (void *) 0} +}; + +/* This works around a problem in FreeBSD linker */ +#ifdef FREEBSD_WORKAROUND +static const void *lt_preloaded_setup() { + return lt__PROGRAM__LTX_preloaded_symbols; +} +#endif + +#ifdef __cplusplus +} +#endif +_LT_EOF + # Now try linking the two files. + mv conftest.$ac_objext conftstm.$ac_objext + lt_globsym_save_LIBS=$LIBS + lt_globsym_save_CFLAGS=$CFLAGS + LIBS=conftstm.$ac_objext + CFLAGS="$CFLAGS$lt_prog_compiler_no_builtin_flag" + if { { eval echo "\"\$as_me\":${as_lineno-$LINENO}: \"$ac_link\""; } >&5 + (eval $ac_link) 2>&5 + ac_status=$? + $as_echo "$as_me:${as_lineno-$LINENO}: \$? = $ac_status" >&5 + test $ac_status = 0; } && test -s conftest$ac_exeext; then + pipe_works=yes + fi + LIBS=$lt_globsym_save_LIBS + CFLAGS=$lt_globsym_save_CFLAGS + else + echo "cannot find nm_test_func in $nlist" >&5 + fi + else + echo "cannot find nm_test_var in $nlist" >&5 + fi + else + echo "cannot run $lt_cv_sys_global_symbol_pipe" >&5 + fi + else + echo "$progname: failed program was:" >&5 + cat conftest.$ac_ext >&5 + fi + rm -rf conftest* conftst* + + # Do not use the global_symbol_pipe unless it works. + if test yes = "$pipe_works"; then + break + else + lt_cv_sys_global_symbol_pipe= + fi +done + +fi + +if test -z "$lt_cv_sys_global_symbol_pipe"; then + lt_cv_sys_global_symbol_to_cdecl= +fi +if test -z "$lt_cv_sys_global_symbol_pipe$lt_cv_sys_global_symbol_to_cdecl"; then + { $as_echo "$as_me:${as_lineno-$LINENO}: result: failed" >&5 +$as_echo "failed" >&6; } +else + { $as_echo "$as_me:${as_lineno-$LINENO}: result: ok" >&5 +$as_echo "ok" >&6; } +fi + +# Response file support. +if test "$lt_cv_nm_interface" = "MS dumpbin"; then + nm_file_list_spec='@' +elif $NM --help 2>/dev/null | grep '[@]FILE' >/dev/null; then + nm_file_list_spec='@' +fi + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for sysroot" >&5 +$as_echo_n "checking for sysroot... " >&6; } + +# Check whether --with-sysroot was given. +if test "${with_sysroot+set}" = set; then : + withval=$with_sysroot; +else + with_sysroot=no +fi + + +lt_sysroot= +case $with_sysroot in #( + yes) + if test yes = "$GCC"; then + lt_sysroot=`$CC --print-sysroot 2>/dev/null` + fi + ;; #( + /*) + lt_sysroot=`echo "$with_sysroot" | sed -e "$sed_quote_subst"` + ;; #( + no|'') + ;; #( + *) + { $as_echo "$as_me:${as_lineno-$LINENO}: result: $with_sysroot" >&5 +$as_echo "$with_sysroot" >&6; } + as_fn_error $? "The sysroot must be an absolute path." "$LINENO" 5 + ;; +esac + + { $as_echo "$as_me:${as_lineno-$LINENO}: result: ${lt_sysroot:-no}" >&5 +$as_echo "${lt_sysroot:-no}" >&6; } + + + + + +{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for a working dd" >&5 +$as_echo_n "checking for a working dd... " >&6; } +if ${ac_cv_path_lt_DD+:} false; then : + $as_echo_n "(cached) " >&6 +else + printf 0123456789abcdef0123456789abcdef >conftest.i +cat conftest.i conftest.i >conftest2.i +: ${lt_DD:=$DD} +if test -z "$lt_DD"; then + ac_path_lt_DD_found=false + # Loop through the user's path and test for each of PROGNAME-LIST + as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in $PATH +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + for ac_prog in dd; do + for ac_exec_ext in '' $ac_executable_extensions; do + ac_path_lt_DD="$as_dir/$ac_prog$ac_exec_ext" + as_fn_executable_p "$ac_path_lt_DD" || continue +if "$ac_path_lt_DD" bs=32 count=1 <conftest2.i >conftest.out 2>/dev/null; then + cmp -s conftest.i conftest.out \ + && ac_cv_path_lt_DD="$ac_path_lt_DD" ac_path_lt_DD_found=: +fi + $ac_path_lt_DD_found && break 3 + done + done + done +IFS=$as_save_IFS + if test -z "$ac_cv_path_lt_DD"; then + : + fi +else + ac_cv_path_lt_DD=$lt_DD +fi + +rm -f conftest.i conftest2.i conftest.out +fi +{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_cv_path_lt_DD" >&5 +$as_echo "$ac_cv_path_lt_DD" >&6; } + + +{ $as_echo "$as_me:${as_lineno-$LINENO}: checking how to truncate binary pipes" >&5 +$as_echo_n "checking how to truncate binary pipes... " >&6; } +if ${lt_cv_truncate_bin+:} false; then : + $as_echo_n "(cached) " >&6 +else + printf 0123456789abcdef0123456789abcdef >conftest.i +cat conftest.i conftest.i >conftest2.i +lt_cv_truncate_bin= +if "$ac_cv_path_lt_DD" bs=32 count=1 <conftest2.i >conftest.out 2>/dev/null; then + cmp -s conftest.i conftest.out \ + && lt_cv_truncate_bin="$ac_cv_path_lt_DD bs=4096 count=1" +fi +rm -f conftest.i conftest2.i conftest.out +test -z "$lt_cv_truncate_bin" && lt_cv_truncate_bin="$SED -e 4q" +fi +{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $lt_cv_truncate_bin" >&5 +$as_echo "$lt_cv_truncate_bin" >&6; } + + + + + + + +# Calculate cc_basename. Skip known compiler wrappers and cross-prefix. +func_cc_basename () +{ + for cc_temp in $*""; do + case $cc_temp in + compile | *[\\/]compile | ccache | *[\\/]ccache ) ;; + distcc | *[\\/]distcc | purify | *[\\/]purify ) ;; + \-*) ;; + *) break;; + esac + done + func_cc_basename_result=`$ECHO "$cc_temp" | $SED "s%.*/%%; s%^$host_alias-%%"` +} + +# Check whether --enable-libtool-lock was given. +if test "${enable_libtool_lock+set}" = set; then : + enableval=$enable_libtool_lock; +fi + +test no = "$enable_libtool_lock" || enable_libtool_lock=yes + +# Some flags need to be propagated to the compiler or linker for good +# libtool support. +case $host in +ia64-*-hpux*) + # Find out what ABI is being produced by ac_compile, and set mode + # options accordingly. + echo 'int i;' > conftest.$ac_ext + if { { eval echo "\"\$as_me\":${as_lineno-$LINENO}: \"$ac_compile\""; } >&5 + (eval $ac_compile) 2>&5 + ac_status=$? + $as_echo "$as_me:${as_lineno-$LINENO}: \$? = $ac_status" >&5 + test $ac_status = 0; }; then + case `/usr/bin/file conftest.$ac_objext` in + *ELF-32*) + HPUX_IA64_MODE=32 + ;; + *ELF-64*) + HPUX_IA64_MODE=64 + ;; + esac + fi + rm -rf conftest* + ;; +*-*-irix6*) + # Find out what ABI is being produced by ac_compile, and set linker + # options accordingly. + echo '#line '$LINENO' "configure"' > conftest.$ac_ext + if { { eval echo "\"\$as_me\":${as_lineno-$LINENO}: \"$ac_compile\""; } >&5 + (eval $ac_compile) 2>&5 + ac_status=$? + $as_echo "$as_me:${as_lineno-$LINENO}: \$? = $ac_status" >&5 + test $ac_status = 0; }; then + if test yes = "$lt_cv_prog_gnu_ld"; then + case `/usr/bin/file conftest.$ac_objext` in + *32-bit*) + LD="${LD-ld} -melf32bsmip" + ;; + *N32*) + LD="${LD-ld} -melf32bmipn32" + ;; + *64-bit*) + LD="${LD-ld} -melf64bmip" + ;; + esac + else + case `/usr/bin/file conftest.$ac_objext` in + *32-bit*) + LD="${LD-ld} -32" + ;; + *N32*) + LD="${LD-ld} -n32" + ;; + *64-bit*) + LD="${LD-ld} -64" + ;; + esac + fi + fi + rm -rf conftest* + ;; + +mips64*-*linux*) + # Find out what ABI is being produced by ac_compile, and set linker + # options accordingly. + echo '#line '$LINENO' "configure"' > conftest.$ac_ext + if { { eval echo "\"\$as_me\":${as_lineno-$LINENO}: \"$ac_compile\""; } >&5 + (eval $ac_compile) 2>&5 + ac_status=$? + $as_echo "$as_me:${as_lineno-$LINENO}: \$? = $ac_status" >&5 + test $ac_status = 0; }; then + emul=elf + case `/usr/bin/file conftest.$ac_objext` in + *32-bit*) + emul="${emul}32" + ;; + *64-bit*) + emul="${emul}64" + ;; + esac + case `/usr/bin/file conftest.$ac_objext` in + *MSB*) + emul="${emul}btsmip" + ;; + *LSB*) + emul="${emul}ltsmip" + ;; + esac + case `/usr/bin/file conftest.$ac_objext` in + *N32*) + emul="${emul}n32" + ;; + esac + LD="${LD-ld} -m $emul" + fi + rm -rf conftest* + ;; + +x86_64-*kfreebsd*-gnu|x86_64-*linux*|powerpc*-*linux*| \ +s390*-*linux*|s390*-*tpf*|sparc*-*linux*) + # Find out what ABI is being produced by ac_compile, and set linker + # options accordingly. Note that the listed cases only cover the + # situations where additional linker options are needed (such as when + # doing 32-bit compilation for a host where ld defaults to 64-bit, or + # vice versa); the common cases where no linker options are needed do + # not appear in the list. + echo 'int i;' > conftest.$ac_ext + if { { eval echo "\"\$as_me\":${as_lineno-$LINENO}: \"$ac_compile\""; } >&5 + (eval $ac_compile) 2>&5 + ac_status=$? + $as_echo "$as_me:${as_lineno-$LINENO}: \$? = $ac_status" >&5 + test $ac_status = 0; }; then + case `/usr/bin/file conftest.o` in + *32-bit*) + case $host in + x86_64-*kfreebsd*-gnu) + LD="${LD-ld} -m elf_i386_fbsd" + ;; + x86_64-*linux*) + case `/usr/bin/file conftest.o` in + *x86-64*) + LD="${LD-ld} -m elf32_x86_64" + ;; + *) + LD="${LD-ld} -m elf_i386" + ;; + esac + ;; + powerpc64le-*linux*) + LD="${LD-ld} -m elf32lppclinux" + ;; + powerpc64-*linux*) + LD="${LD-ld} -m elf32ppclinux" + ;; + s390x-*linux*) + LD="${LD-ld} -m elf_s390" + ;; + sparc64-*linux*) + LD="${LD-ld} -m elf32_sparc" + ;; + esac + ;; + *64-bit*) + case $host in + x86_64-*kfreebsd*-gnu) + LD="${LD-ld} -m elf_x86_64_fbsd" + ;; + x86_64-*linux*) + LD="${LD-ld} -m elf_x86_64" + ;; + powerpcle-*linux*) + LD="${LD-ld} -m elf64lppc" + ;; + powerpc-*linux*) + LD="${LD-ld} -m elf64ppc" + ;; + s390*-*linux*|s390*-*tpf*) + LD="${LD-ld} -m elf64_s390" + ;; + sparc*-*linux*) + LD="${LD-ld} -m elf64_sparc" + ;; + esac + ;; + esac + fi + rm -rf conftest* + ;; + +*-*-sco3.2v5*) + # On SCO OpenServer 5, we need -belf to get full-featured binaries. + SAVE_CFLAGS=$CFLAGS + CFLAGS="$CFLAGS -belf" + { $as_echo "$as_me:${as_lineno-$LINENO}: checking whether the C compiler needs -belf" >&5 +$as_echo_n "checking whether the C compiler needs -belf... " >&6; } +if ${lt_cv_cc_needs_belf+:} false; then : + $as_echo_n "(cached) " >&6 +else + ac_ext=c +ac_cpp='$CPP $CPPFLAGS' +ac_compile='$CC -c $CFLAGS $CPPFLAGS conftest.$ac_ext >&5' +ac_link='$CC -o conftest$ac_exeext $CFLAGS $CPPFLAGS $LDFLAGS conftest.$ac_ext $LIBS >&5' +ac_compiler_gnu=$ac_cv_c_compiler_gnu + + cat confdefs.h - <<_ACEOF >conftest.$ac_ext +/* end confdefs.h. */ + +int +main () +{ + + ; + return 0; +} +_ACEOF +if ac_fn_c_try_link "$LINENO"; then : + lt_cv_cc_needs_belf=yes +else + lt_cv_cc_needs_belf=no +fi +rm -f core conftest.err conftest.$ac_objext \ + conftest$ac_exeext conftest.$ac_ext + ac_ext=c +ac_cpp='$CPP $CPPFLAGS' +ac_compile='$CC -c $CFLAGS $CPPFLAGS conftest.$ac_ext >&5' +ac_link='$CC -o conftest$ac_exeext $CFLAGS $CPPFLAGS $LDFLAGS conftest.$ac_ext $LIBS >&5' +ac_compiler_gnu=$ac_cv_c_compiler_gnu + +fi +{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $lt_cv_cc_needs_belf" >&5 +$as_echo "$lt_cv_cc_needs_belf" >&6; } + if test yes != "$lt_cv_cc_needs_belf"; then + # this is probably gcc 2.8.0, egcs 1.0 or newer; no need for -belf + CFLAGS=$SAVE_CFLAGS + fi + ;; +*-*solaris*) + # Find out what ABI is being produced by ac_compile, and set linker + # options accordingly. + echo 'int i;' > conftest.$ac_ext + if { { eval echo "\"\$as_me\":${as_lineno-$LINENO}: \"$ac_compile\""; } >&5 + (eval $ac_compile) 2>&5 + ac_status=$? + $as_echo "$as_me:${as_lineno-$LINENO}: \$? = $ac_status" >&5 + test $ac_status = 0; }; then + case `/usr/bin/file conftest.o` in + *64-bit*) + case $lt_cv_prog_gnu_ld in + yes*) + case $host in + i?86-*-solaris*|x86_64-*-solaris*) + LD="${LD-ld} -m elf_x86_64" + ;; + sparc*-*-solaris*) + LD="${LD-ld} -m elf64_sparc" + ;; + esac + # GNU ld 2.21 introduced _sol2 emulations. Use them if available. + if ${LD-ld} -V | grep _sol2 >/dev/null 2>&1; then + LD=${LD-ld}_sol2 + fi + ;; + *) + if ${LD-ld} -64 -r -o conftest2.o conftest.o >/dev/null 2>&1; then + LD="${LD-ld} -64" + fi + ;; + esac + ;; + esac + fi + rm -rf conftest* + ;; +esac + +need_locks=$enable_libtool_lock + +if test -n "$ac_tool_prefix"; then + # Extract the first word of "${ac_tool_prefix}mt", so it can be a program name with args. +set dummy ${ac_tool_prefix}mt; ac_word=$2 +{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $ac_word" >&5 +$as_echo_n "checking for $ac_word... " >&6; } +if ${ac_cv_prog_MANIFEST_TOOL+:} false; then : + $as_echo_n "(cached) " >&6 +else + if test -n "$MANIFEST_TOOL"; then + ac_cv_prog_MANIFEST_TOOL="$MANIFEST_TOOL" # Let the user override the test. +else +as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in $PATH +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + for ac_exec_ext in '' $ac_executable_extensions; do + if as_fn_executable_p "$as_dir/$ac_word$ac_exec_ext"; then + ac_cv_prog_MANIFEST_TOOL="${ac_tool_prefix}mt" + $as_echo "$as_me:${as_lineno-$LINENO}: found $as_dir/$ac_word$ac_exec_ext" >&5 + break 2 + fi +done + done +IFS=$as_save_IFS + +fi +fi +MANIFEST_TOOL=$ac_cv_prog_MANIFEST_TOOL +if test -n "$MANIFEST_TOOL"; then + { $as_echo "$as_me:${as_lineno-$LINENO}: result: $MANIFEST_TOOL" >&5 +$as_echo "$MANIFEST_TOOL" >&6; } +else + { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5 +$as_echo "no" >&6; } +fi + + +fi +if test -z "$ac_cv_prog_MANIFEST_TOOL"; then + ac_ct_MANIFEST_TOOL=$MANIFEST_TOOL + # Extract the first word of "mt", so it can be a program name with args. +set dummy mt; ac_word=$2 +{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $ac_word" >&5 +$as_echo_n "checking for $ac_word... " >&6; } +if ${ac_cv_prog_ac_ct_MANIFEST_TOOL+:} false; then : + $as_echo_n "(cached) " >&6 +else + if test -n "$ac_ct_MANIFEST_TOOL"; then + ac_cv_prog_ac_ct_MANIFEST_TOOL="$ac_ct_MANIFEST_TOOL" # Let the user override the test. +else +as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in $PATH +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + for ac_exec_ext in '' $ac_executable_extensions; do + if as_fn_executable_p "$as_dir/$ac_word$ac_exec_ext"; then + ac_cv_prog_ac_ct_MANIFEST_TOOL="mt" + $as_echo "$as_me:${as_lineno-$LINENO}: found $as_dir/$ac_word$ac_exec_ext" >&5 + break 2 + fi +done + done +IFS=$as_save_IFS + +fi +fi +ac_ct_MANIFEST_TOOL=$ac_cv_prog_ac_ct_MANIFEST_TOOL +if test -n "$ac_ct_MANIFEST_TOOL"; then + { $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_ct_MANIFEST_TOOL" >&5 +$as_echo "$ac_ct_MANIFEST_TOOL" >&6; } +else + { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5 +$as_echo "no" >&6; } +fi + + if test "x$ac_ct_MANIFEST_TOOL" = x; then + MANIFEST_TOOL=":" + else + case $cross_compiling:$ac_tool_warned in +yes:) +{ $as_echo "$as_me:${as_lineno-$LINENO}: WARNING: using cross tools not prefixed with host triplet" >&5 +$as_echo "$as_me: WARNING: using cross tools not prefixed with host triplet" >&2;} +ac_tool_warned=yes ;; +esac + MANIFEST_TOOL=$ac_ct_MANIFEST_TOOL + fi +else + MANIFEST_TOOL="$ac_cv_prog_MANIFEST_TOOL" +fi + +test -z "$MANIFEST_TOOL" && MANIFEST_TOOL=mt +{ $as_echo "$as_me:${as_lineno-$LINENO}: checking if $MANIFEST_TOOL is a manifest tool" >&5 +$as_echo_n "checking if $MANIFEST_TOOL is a manifest tool... " >&6; } +if ${lt_cv_path_mainfest_tool+:} false; then : + $as_echo_n "(cached) " >&6 +else + lt_cv_path_mainfest_tool=no + echo "$as_me:$LINENO: $MANIFEST_TOOL '-?'" >&5 + $MANIFEST_TOOL '-?' 2>conftest.err > conftest.out + cat conftest.err >&5 + if $GREP 'Manifest Tool' conftest.out > /dev/null; then + lt_cv_path_mainfest_tool=yes + fi + rm -f conftest* +fi +{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $lt_cv_path_mainfest_tool" >&5 +$as_echo "$lt_cv_path_mainfest_tool" >&6; } +if test yes != "$lt_cv_path_mainfest_tool"; then + MANIFEST_TOOL=: +fi + + + + + + + case $host_os in + rhapsody* | darwin*) + if test -n "$ac_tool_prefix"; then + # Extract the first word of "${ac_tool_prefix}dsymutil", so it can be a program name with args. +set dummy ${ac_tool_prefix}dsymutil; ac_word=$2 +{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $ac_word" >&5 +$as_echo_n "checking for $ac_word... " >&6; } +if ${ac_cv_prog_DSYMUTIL+:} false; then : + $as_echo_n "(cached) " >&6 +else + if test -n "$DSYMUTIL"; then + ac_cv_prog_DSYMUTIL="$DSYMUTIL" # Let the user override the test. +else +as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in $PATH +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + for ac_exec_ext in '' $ac_executable_extensions; do + if as_fn_executable_p "$as_dir/$ac_word$ac_exec_ext"; then + ac_cv_prog_DSYMUTIL="${ac_tool_prefix}dsymutil" + $as_echo "$as_me:${as_lineno-$LINENO}: found $as_dir/$ac_word$ac_exec_ext" >&5 + break 2 + fi +done + done +IFS=$as_save_IFS + +fi +fi +DSYMUTIL=$ac_cv_prog_DSYMUTIL +if test -n "$DSYMUTIL"; then + { $as_echo "$as_me:${as_lineno-$LINENO}: result: $DSYMUTIL" >&5 +$as_echo "$DSYMUTIL" >&6; } +else + { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5 +$as_echo "no" >&6; } +fi + + +fi +if test -z "$ac_cv_prog_DSYMUTIL"; then + ac_ct_DSYMUTIL=$DSYMUTIL + # Extract the first word of "dsymutil", so it can be a program name with args. +set dummy dsymutil; ac_word=$2 +{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $ac_word" >&5 +$as_echo_n "checking for $ac_word... " >&6; } +if ${ac_cv_prog_ac_ct_DSYMUTIL+:} false; then : + $as_echo_n "(cached) " >&6 +else + if test -n "$ac_ct_DSYMUTIL"; then + ac_cv_prog_ac_ct_DSYMUTIL="$ac_ct_DSYMUTIL" # Let the user override the test. +else +as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in $PATH +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + for ac_exec_ext in '' $ac_executable_extensions; do + if as_fn_executable_p "$as_dir/$ac_word$ac_exec_ext"; then + ac_cv_prog_ac_ct_DSYMUTIL="dsymutil" + $as_echo "$as_me:${as_lineno-$LINENO}: found $as_dir/$ac_word$ac_exec_ext" >&5 + break 2 + fi +done + done +IFS=$as_save_IFS + +fi +fi +ac_ct_DSYMUTIL=$ac_cv_prog_ac_ct_DSYMUTIL +if test -n "$ac_ct_DSYMUTIL"; then + { $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_ct_DSYMUTIL" >&5 +$as_echo "$ac_ct_DSYMUTIL" >&6; } +else + { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5 +$as_echo "no" >&6; } +fi + + if test "x$ac_ct_DSYMUTIL" = x; then + DSYMUTIL=":" + else + case $cross_compiling:$ac_tool_warned in +yes:) +{ $as_echo "$as_me:${as_lineno-$LINENO}: WARNING: using cross tools not prefixed with host triplet" >&5 +$as_echo "$as_me: WARNING: using cross tools not prefixed with host triplet" >&2;} +ac_tool_warned=yes ;; +esac + DSYMUTIL=$ac_ct_DSYMUTIL + fi +else + DSYMUTIL="$ac_cv_prog_DSYMUTIL" +fi + + if test -n "$ac_tool_prefix"; then + # Extract the first word of "${ac_tool_prefix}nmedit", so it can be a program name with args. +set dummy ${ac_tool_prefix}nmedit; ac_word=$2 +{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $ac_word" >&5 +$as_echo_n "checking for $ac_word... " >&6; } +if ${ac_cv_prog_NMEDIT+:} false; then : + $as_echo_n "(cached) " >&6 +else + if test -n "$NMEDIT"; then + ac_cv_prog_NMEDIT="$NMEDIT" # Let the user override the test. +else +as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in $PATH +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + for ac_exec_ext in '' $ac_executable_extensions; do + if as_fn_executable_p "$as_dir/$ac_word$ac_exec_ext"; then + ac_cv_prog_NMEDIT="${ac_tool_prefix}nmedit" + $as_echo "$as_me:${as_lineno-$LINENO}: found $as_dir/$ac_word$ac_exec_ext" >&5 + break 2 + fi +done + done +IFS=$as_save_IFS + +fi +fi +NMEDIT=$ac_cv_prog_NMEDIT +if test -n "$NMEDIT"; then + { $as_echo "$as_me:${as_lineno-$LINENO}: result: $NMEDIT" >&5 +$as_echo "$NMEDIT" >&6; } +else + { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5 +$as_echo "no" >&6; } +fi + + +fi +if test -z "$ac_cv_prog_NMEDIT"; then + ac_ct_NMEDIT=$NMEDIT + # Extract the first word of "nmedit", so it can be a program name with args. +set dummy nmedit; ac_word=$2 +{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $ac_word" >&5 +$as_echo_n "checking for $ac_word... " >&6; } +if ${ac_cv_prog_ac_ct_NMEDIT+:} false; then : + $as_echo_n "(cached) " >&6 +else + if test -n "$ac_ct_NMEDIT"; then + ac_cv_prog_ac_ct_NMEDIT="$ac_ct_NMEDIT" # Let the user override the test. +else +as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in $PATH +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + for ac_exec_ext in '' $ac_executable_extensions; do + if as_fn_executable_p "$as_dir/$ac_word$ac_exec_ext"; then + ac_cv_prog_ac_ct_NMEDIT="nmedit" + $as_echo "$as_me:${as_lineno-$LINENO}: found $as_dir/$ac_word$ac_exec_ext" >&5 + break 2 + fi +done + done +IFS=$as_save_IFS + +fi +fi +ac_ct_NMEDIT=$ac_cv_prog_ac_ct_NMEDIT +if test -n "$ac_ct_NMEDIT"; then + { $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_ct_NMEDIT" >&5 +$as_echo "$ac_ct_NMEDIT" >&6; } +else + { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5 +$as_echo "no" >&6; } +fi + + if test "x$ac_ct_NMEDIT" = x; then + NMEDIT=":" + else + case $cross_compiling:$ac_tool_warned in +yes:) +{ $as_echo "$as_me:${as_lineno-$LINENO}: WARNING: using cross tools not prefixed with host triplet" >&5 +$as_echo "$as_me: WARNING: using cross tools not prefixed with host triplet" >&2;} +ac_tool_warned=yes ;; +esac + NMEDIT=$ac_ct_NMEDIT + fi +else + NMEDIT="$ac_cv_prog_NMEDIT" +fi + + if test -n "$ac_tool_prefix"; then + # Extract the first word of "${ac_tool_prefix}lipo", so it can be a program name with args. +set dummy ${ac_tool_prefix}lipo; ac_word=$2 +{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $ac_word" >&5 +$as_echo_n "checking for $ac_word... " >&6; } +if ${ac_cv_prog_LIPO+:} false; then : + $as_echo_n "(cached) " >&6 +else + if test -n "$LIPO"; then + ac_cv_prog_LIPO="$LIPO" # Let the user override the test. +else +as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in $PATH +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + for ac_exec_ext in '' $ac_executable_extensions; do + if as_fn_executable_p "$as_dir/$ac_word$ac_exec_ext"; then + ac_cv_prog_LIPO="${ac_tool_prefix}lipo" + $as_echo "$as_me:${as_lineno-$LINENO}: found $as_dir/$ac_word$ac_exec_ext" >&5 + break 2 + fi +done + done +IFS=$as_save_IFS + +fi +fi +LIPO=$ac_cv_prog_LIPO +if test -n "$LIPO"; then + { $as_echo "$as_me:${as_lineno-$LINENO}: result: $LIPO" >&5 +$as_echo "$LIPO" >&6; } +else + { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5 +$as_echo "no" >&6; } +fi + + +fi +if test -z "$ac_cv_prog_LIPO"; then + ac_ct_LIPO=$LIPO + # Extract the first word of "lipo", so it can be a program name with args. +set dummy lipo; ac_word=$2 +{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $ac_word" >&5 +$as_echo_n "checking for $ac_word... " >&6; } +if ${ac_cv_prog_ac_ct_LIPO+:} false; then : + $as_echo_n "(cached) " >&6 +else + if test -n "$ac_ct_LIPO"; then + ac_cv_prog_ac_ct_LIPO="$ac_ct_LIPO" # Let the user override the test. +else +as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in $PATH +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + for ac_exec_ext in '' $ac_executable_extensions; do + if as_fn_executable_p "$as_dir/$ac_word$ac_exec_ext"; then + ac_cv_prog_ac_ct_LIPO="lipo" + $as_echo "$as_me:${as_lineno-$LINENO}: found $as_dir/$ac_word$ac_exec_ext" >&5 + break 2 + fi +done + done +IFS=$as_save_IFS + +fi +fi +ac_ct_LIPO=$ac_cv_prog_ac_ct_LIPO +if test -n "$ac_ct_LIPO"; then + { $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_ct_LIPO" >&5 +$as_echo "$ac_ct_LIPO" >&6; } +else + { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5 +$as_echo "no" >&6; } +fi + + if test "x$ac_ct_LIPO" = x; then + LIPO=":" + else + case $cross_compiling:$ac_tool_warned in +yes:) +{ $as_echo "$as_me:${as_lineno-$LINENO}: WARNING: using cross tools not prefixed with host triplet" >&5 +$as_echo "$as_me: WARNING: using cross tools not prefixed with host triplet" >&2;} +ac_tool_warned=yes ;; +esac + LIPO=$ac_ct_LIPO + fi +else + LIPO="$ac_cv_prog_LIPO" +fi + + if test -n "$ac_tool_prefix"; then + # Extract the first word of "${ac_tool_prefix}otool", so it can be a program name with args. +set dummy ${ac_tool_prefix}otool; ac_word=$2 +{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $ac_word" >&5 +$as_echo_n "checking for $ac_word... " >&6; } +if ${ac_cv_prog_OTOOL+:} false; then : + $as_echo_n "(cached) " >&6 +else + if test -n "$OTOOL"; then + ac_cv_prog_OTOOL="$OTOOL" # Let the user override the test. +else +as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in $PATH +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + for ac_exec_ext in '' $ac_executable_extensions; do + if as_fn_executable_p "$as_dir/$ac_word$ac_exec_ext"; then + ac_cv_prog_OTOOL="${ac_tool_prefix}otool" + $as_echo "$as_me:${as_lineno-$LINENO}: found $as_dir/$ac_word$ac_exec_ext" >&5 + break 2 + fi +done + done +IFS=$as_save_IFS + +fi +fi +OTOOL=$ac_cv_prog_OTOOL +if test -n "$OTOOL"; then + { $as_echo "$as_me:${as_lineno-$LINENO}: result: $OTOOL" >&5 +$as_echo "$OTOOL" >&6; } +else + { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5 +$as_echo "no" >&6; } +fi + + +fi +if test -z "$ac_cv_prog_OTOOL"; then + ac_ct_OTOOL=$OTOOL + # Extract the first word of "otool", so it can be a program name with args. +set dummy otool; ac_word=$2 +{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $ac_word" >&5 +$as_echo_n "checking for $ac_word... " >&6; } +if ${ac_cv_prog_ac_ct_OTOOL+:} false; then : + $as_echo_n "(cached) " >&6 +else + if test -n "$ac_ct_OTOOL"; then + ac_cv_prog_ac_ct_OTOOL="$ac_ct_OTOOL" # Let the user override the test. +else +as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in $PATH +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + for ac_exec_ext in '' $ac_executable_extensions; do + if as_fn_executable_p "$as_dir/$ac_word$ac_exec_ext"; then + ac_cv_prog_ac_ct_OTOOL="otool" + $as_echo "$as_me:${as_lineno-$LINENO}: found $as_dir/$ac_word$ac_exec_ext" >&5 + break 2 + fi +done + done +IFS=$as_save_IFS + +fi +fi +ac_ct_OTOOL=$ac_cv_prog_ac_ct_OTOOL +if test -n "$ac_ct_OTOOL"; then + { $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_ct_OTOOL" >&5 +$as_echo "$ac_ct_OTOOL" >&6; } +else + { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5 +$as_echo "no" >&6; } +fi + + if test "x$ac_ct_OTOOL" = x; then + OTOOL=":" + else + case $cross_compiling:$ac_tool_warned in +yes:) +{ $as_echo "$as_me:${as_lineno-$LINENO}: WARNING: using cross tools not prefixed with host triplet" >&5 +$as_echo "$as_me: WARNING: using cross tools not prefixed with host triplet" >&2;} +ac_tool_warned=yes ;; +esac + OTOOL=$ac_ct_OTOOL + fi +else + OTOOL="$ac_cv_prog_OTOOL" +fi + + if test -n "$ac_tool_prefix"; then + # Extract the first word of "${ac_tool_prefix}otool64", so it can be a program name with args. +set dummy ${ac_tool_prefix}otool64; ac_word=$2 +{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $ac_word" >&5 +$as_echo_n "checking for $ac_word... " >&6; } +if ${ac_cv_prog_OTOOL64+:} false; then : + $as_echo_n "(cached) " >&6 +else + if test -n "$OTOOL64"; then + ac_cv_prog_OTOOL64="$OTOOL64" # Let the user override the test. +else +as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in $PATH +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + for ac_exec_ext in '' $ac_executable_extensions; do + if as_fn_executable_p "$as_dir/$ac_word$ac_exec_ext"; then + ac_cv_prog_OTOOL64="${ac_tool_prefix}otool64" + $as_echo "$as_me:${as_lineno-$LINENO}: found $as_dir/$ac_word$ac_exec_ext" >&5 + break 2 + fi +done + done +IFS=$as_save_IFS + +fi +fi +OTOOL64=$ac_cv_prog_OTOOL64 +if test -n "$OTOOL64"; then + { $as_echo "$as_me:${as_lineno-$LINENO}: result: $OTOOL64" >&5 +$as_echo "$OTOOL64" >&6; } +else + { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5 +$as_echo "no" >&6; } +fi + + +fi +if test -z "$ac_cv_prog_OTOOL64"; then + ac_ct_OTOOL64=$OTOOL64 + # Extract the first word of "otool64", so it can be a program name with args. +set dummy otool64; ac_word=$2 +{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $ac_word" >&5 +$as_echo_n "checking for $ac_word... " >&6; } +if ${ac_cv_prog_ac_ct_OTOOL64+:} false; then : + $as_echo_n "(cached) " >&6 +else + if test -n "$ac_ct_OTOOL64"; then + ac_cv_prog_ac_ct_OTOOL64="$ac_ct_OTOOL64" # Let the user override the test. +else +as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in $PATH +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + for ac_exec_ext in '' $ac_executable_extensions; do + if as_fn_executable_p "$as_dir/$ac_word$ac_exec_ext"; then + ac_cv_prog_ac_ct_OTOOL64="otool64" + $as_echo "$as_me:${as_lineno-$LINENO}: found $as_dir/$ac_word$ac_exec_ext" >&5 + break 2 + fi +done + done +IFS=$as_save_IFS + +fi +fi +ac_ct_OTOOL64=$ac_cv_prog_ac_ct_OTOOL64 +if test -n "$ac_ct_OTOOL64"; then + { $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_ct_OTOOL64" >&5 +$as_echo "$ac_ct_OTOOL64" >&6; } +else + { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5 +$as_echo "no" >&6; } +fi + + if test "x$ac_ct_OTOOL64" = x; then + OTOOL64=":" + else + case $cross_compiling:$ac_tool_warned in +yes:) +{ $as_echo "$as_me:${as_lineno-$LINENO}: WARNING: using cross tools not prefixed with host triplet" >&5 +$as_echo "$as_me: WARNING: using cross tools not prefixed with host triplet" >&2;} +ac_tool_warned=yes ;; +esac + OTOOL64=$ac_ct_OTOOL64 + fi +else + OTOOL64="$ac_cv_prog_OTOOL64" +fi + + + + + + + + + + + + + + + + + + + + + + + + + + + + { $as_echo "$as_me:${as_lineno-$LINENO}: checking for -single_module linker flag" >&5 +$as_echo_n "checking for -single_module linker flag... " >&6; } +if ${lt_cv_apple_cc_single_mod+:} false; then : + $as_echo_n "(cached) " >&6 +else + lt_cv_apple_cc_single_mod=no + if test -z "$LT_MULTI_MODULE"; then + # By default we will add the -single_module flag. You can override + # by either setting the environment variable LT_MULTI_MODULE + # non-empty at configure time, or by adding -multi_module to the + # link flags. + rm -rf libconftest.dylib* + echo "int foo(void){return 1;}" > conftest.c + echo "$LTCC $LTCFLAGS $LDFLAGS -o libconftest.dylib \ +-dynamiclib -Wl,-single_module conftest.c" >&5 + $LTCC $LTCFLAGS $LDFLAGS -o libconftest.dylib \ + -dynamiclib -Wl,-single_module conftest.c 2>conftest.err + _lt_result=$? + # If there is a non-empty error log, and "single_module" + # appears in it, assume the flag caused a linker warning + if test -s conftest.err && $GREP single_module conftest.err; then + cat conftest.err >&5 + # Otherwise, if the output was created with a 0 exit code from + # the compiler, it worked. + elif test -f libconftest.dylib && test 0 = "$_lt_result"; then + lt_cv_apple_cc_single_mod=yes + else + cat conftest.err >&5 + fi + rm -rf libconftest.dylib* + rm -f conftest.* + fi +fi +{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $lt_cv_apple_cc_single_mod" >&5 +$as_echo "$lt_cv_apple_cc_single_mod" >&6; } + + { $as_echo "$as_me:${as_lineno-$LINENO}: checking for -exported_symbols_list linker flag" >&5 +$as_echo_n "checking for -exported_symbols_list linker flag... " >&6; } +if ${lt_cv_ld_exported_symbols_list+:} false; then : + $as_echo_n "(cached) " >&6 +else + lt_cv_ld_exported_symbols_list=no + save_LDFLAGS=$LDFLAGS + echo "_main" > conftest.sym + LDFLAGS="$LDFLAGS -Wl,-exported_symbols_list,conftest.sym" + cat confdefs.h - <<_ACEOF >conftest.$ac_ext +/* end confdefs.h. */ + +int +main () +{ + + ; + return 0; +} +_ACEOF +if ac_fn_c_try_link "$LINENO"; then : + lt_cv_ld_exported_symbols_list=yes +else + lt_cv_ld_exported_symbols_list=no +fi +rm -f core conftest.err conftest.$ac_objext \ + conftest$ac_exeext conftest.$ac_ext + LDFLAGS=$save_LDFLAGS + +fi +{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $lt_cv_ld_exported_symbols_list" >&5 +$as_echo "$lt_cv_ld_exported_symbols_list" >&6; } + + { $as_echo "$as_me:${as_lineno-$LINENO}: checking for -force_load linker flag" >&5 +$as_echo_n "checking for -force_load linker flag... " >&6; } +if ${lt_cv_ld_force_load+:} false; then : + $as_echo_n "(cached) " >&6 +else + lt_cv_ld_force_load=no + cat > conftest.c << _LT_EOF +int forced_loaded() { return 2;} +_LT_EOF + echo "$LTCC $LTCFLAGS -c -o conftest.o conftest.c" >&5 + $LTCC $LTCFLAGS -c -o conftest.o conftest.c 2>&5 + echo "$AR cru libconftest.a conftest.o" >&5 + $AR cru libconftest.a conftest.o 2>&5 + echo "$RANLIB libconftest.a" >&5 + $RANLIB libconftest.a 2>&5 + cat > conftest.c << _LT_EOF +int main() { return 0;} +_LT_EOF + echo "$LTCC $LTCFLAGS $LDFLAGS -o conftest conftest.c -Wl,-force_load,./libconftest.a" >&5 + $LTCC $LTCFLAGS $LDFLAGS -o conftest conftest.c -Wl,-force_load,./libconftest.a 2>conftest.err + _lt_result=$? + if test -s conftest.err && $GREP force_load conftest.err; then + cat conftest.err >&5 + elif test -f conftest && test 0 = "$_lt_result" && $GREP forced_load conftest >/dev/null 2>&1; then + lt_cv_ld_force_load=yes + else + cat conftest.err >&5 + fi + rm -f conftest.err libconftest.a conftest conftest.c + rm -rf conftest.dSYM + +fi +{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $lt_cv_ld_force_load" >&5 +$as_echo "$lt_cv_ld_force_load" >&6; } + case $host_os in + rhapsody* | darwin1.[012]) + _lt_dar_allow_undefined='$wl-undefined ${wl}suppress' ;; + darwin1.*) + _lt_dar_allow_undefined='$wl-flat_namespace $wl-undefined ${wl}suppress' ;; + darwin*) # darwin 5.x on + # if running on 10.5 or later, the deployment target defaults + # to the OS version, if on x86, and 10.4, the deployment + # target defaults to 10.4. Don't you love it? + case ${MACOSX_DEPLOYMENT_TARGET-10.0},$host in + 10.0,*86*-darwin8*|10.0,*-darwin[91]*) + _lt_dar_allow_undefined='$wl-undefined ${wl}dynamic_lookup' ;; + 10.[012][,.]*) + _lt_dar_allow_undefined='$wl-flat_namespace $wl-undefined ${wl}suppress' ;; + 10.*) + _lt_dar_allow_undefined='$wl-undefined ${wl}dynamic_lookup' ;; + esac + ;; + esac + if test yes = "$lt_cv_apple_cc_single_mod"; then + _lt_dar_single_mod='$single_module' + fi + if test yes = "$lt_cv_ld_exported_symbols_list"; then + _lt_dar_export_syms=' $wl-exported_symbols_list,$output_objdir/$libname-symbols.expsym' + else + _lt_dar_export_syms='~$NMEDIT -s $output_objdir/$libname-symbols.expsym $lib' + fi + if test : != "$DSYMUTIL" && test no = "$lt_cv_ld_force_load"; then + _lt_dsymutil='~$DSYMUTIL $lib || :' + else + _lt_dsymutil= + fi + ;; + esac + +# func_munge_path_list VARIABLE PATH +# ----------------------------------- +# VARIABLE is name of variable containing _space_ separated list of +# directories to be munged by the contents of PATH, which is string +# having a format: +# "DIR[:DIR]:" +# string "DIR[ DIR]" will be prepended to VARIABLE +# ":DIR[:DIR]" +# string "DIR[ DIR]" will be appended to VARIABLE +# "DIRP[:DIRP]::[DIRA:]DIRA" +# string "DIRP[ DIRP]" will be prepended to VARIABLE and string +# "DIRA[ DIRA]" will be appended to VARIABLE +# "DIR[:DIR]" +# VARIABLE will be replaced by "DIR[ DIR]" +func_munge_path_list () +{ + case x$2 in + x) + ;; + *:) + eval $1=\"`$ECHO $2 | $SED 's/:/ /g'` \$$1\" + ;; + x:*) + eval $1=\"\$$1 `$ECHO $2 | $SED 's/:/ /g'`\" + ;; + *::*) + eval $1=\"\$$1\ `$ECHO $2 | $SED -e 's/.*:://' -e 's/:/ /g'`\" + eval $1=\"`$ECHO $2 | $SED -e 's/::.*//' -e 's/:/ /g'`\ \$$1\" + ;; + *) + eval $1=\"`$ECHO $2 | $SED 's/:/ /g'`\" + ;; + esac +} + +ac_ext=c +ac_cpp='$CPP $CPPFLAGS' +ac_compile='$CC -c $CFLAGS $CPPFLAGS conftest.$ac_ext >&5' +ac_link='$CC -o conftest$ac_exeext $CFLAGS $CPPFLAGS $LDFLAGS conftest.$ac_ext $LIBS >&5' +ac_compiler_gnu=$ac_cv_c_compiler_gnu +{ $as_echo "$as_me:${as_lineno-$LINENO}: checking how to run the C preprocessor" >&5 +$as_echo_n "checking how to run the C preprocessor... " >&6; } +# On Suns, sometimes $CPP names a directory. +if test -n "$CPP" && test -d "$CPP"; then + CPP= +fi +if test -z "$CPP"; then + if ${ac_cv_prog_CPP+:} false; then : + $as_echo_n "(cached) " >&6 +else + # Double quotes because CPP needs to be expanded + for CPP in "$CC -E" "$CC -E -traditional-cpp" "/lib/cpp" + do + ac_preproc_ok=false +for ac_c_preproc_warn_flag in '' yes +do + # Use a header file that comes with gcc, so configuring glibc + # with a fresh cross-compiler works. + # Prefer <limits.h> to <assert.h> if __STDC__ is defined, since + # <limits.h> exists even on freestanding compilers. + # On the NeXT, cc -E runs the code through the compiler's parser, + # not just through cpp. "Syntax error" is here to catch this case. + cat confdefs.h - <<_ACEOF >conftest.$ac_ext +/* end confdefs.h. */ +#ifdef __STDC__ +# include <limits.h> +#else +# include <assert.h> +#endif + Syntax error +_ACEOF +if ac_fn_c_try_cpp "$LINENO"; then : + +else + # Broken: fails on valid input. +continue +fi +rm -f conftest.err conftest.i conftest.$ac_ext + + # OK, works on sane cases. Now check whether nonexistent headers + # can be detected and how. + cat confdefs.h - <<_ACEOF >conftest.$ac_ext +/* end confdefs.h. */ +#include <ac_nonexistent.h> +_ACEOF +if ac_fn_c_try_cpp "$LINENO"; then : + # Broken: success on invalid input. +continue +else + # Passes both tests. +ac_preproc_ok=: +break +fi +rm -f conftest.err conftest.i conftest.$ac_ext + +done +# Because of `break', _AC_PREPROC_IFELSE's cleaning code was skipped. +rm -f conftest.i conftest.err conftest.$ac_ext +if $ac_preproc_ok; then : + break +fi + + done + ac_cv_prog_CPP=$CPP + +fi + CPP=$ac_cv_prog_CPP +else + ac_cv_prog_CPP=$CPP +fi +{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $CPP" >&5 +$as_echo "$CPP" >&6; } +ac_preproc_ok=false +for ac_c_preproc_warn_flag in '' yes +do + # Use a header file that comes with gcc, so configuring glibc + # with a fresh cross-compiler works. + # Prefer <limits.h> to <assert.h> if __STDC__ is defined, since + # <limits.h> exists even on freestanding compilers. + # On the NeXT, cc -E runs the code through the compiler's parser, + # not just through cpp. "Syntax error" is here to catch this case. + cat confdefs.h - <<_ACEOF >conftest.$ac_ext +/* end confdefs.h. */ +#ifdef __STDC__ +# include <limits.h> +#else +# include <assert.h> +#endif + Syntax error +_ACEOF +if ac_fn_c_try_cpp "$LINENO"; then : + +else + # Broken: fails on valid input. +continue +fi +rm -f conftest.err conftest.i conftest.$ac_ext + + # OK, works on sane cases. Now check whether nonexistent headers + # can be detected and how. + cat confdefs.h - <<_ACEOF >conftest.$ac_ext +/* end confdefs.h. */ +#include <ac_nonexistent.h> +_ACEOF +if ac_fn_c_try_cpp "$LINENO"; then : + # Broken: success on invalid input. +continue +else + # Passes both tests. +ac_preproc_ok=: +break +fi +rm -f conftest.err conftest.i conftest.$ac_ext + +done +# Because of `break', _AC_PREPROC_IFELSE's cleaning code was skipped. +rm -f conftest.i conftest.err conftest.$ac_ext +if $ac_preproc_ok; then : + +else + { { $as_echo "$as_me:${as_lineno-$LINENO}: error: in \`$ac_pwd':" >&5 +$as_echo "$as_me: error: in \`$ac_pwd':" >&2;} +as_fn_error $? "C preprocessor \"$CPP\" fails sanity check +See \`config.log' for more details" "$LINENO" 5; } +fi + +ac_ext=c +ac_cpp='$CPP $CPPFLAGS' +ac_compile='$CC -c $CFLAGS $CPPFLAGS conftest.$ac_ext >&5' +ac_link='$CC -o conftest$ac_exeext $CFLAGS $CPPFLAGS $LDFLAGS conftest.$ac_ext $LIBS >&5' +ac_compiler_gnu=$ac_cv_c_compiler_gnu + + +{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for ANSI C header files" >&5 +$as_echo_n "checking for ANSI C header files... " >&6; } +if ${ac_cv_header_stdc+:} false; then : + $as_echo_n "(cached) " >&6 +else + cat confdefs.h - <<_ACEOF >conftest.$ac_ext +/* end confdefs.h. */ +#include <stdlib.h> +#include <stdarg.h> +#include <string.h> +#include <float.h> + +int +main () +{ + + ; + return 0; +} +_ACEOF +if ac_fn_c_try_compile "$LINENO"; then : + ac_cv_header_stdc=yes +else + ac_cv_header_stdc=no +fi +rm -f core conftest.err conftest.$ac_objext conftest.$ac_ext + +if test $ac_cv_header_stdc = yes; then + # SunOS 4.x string.h does not declare mem*, contrary to ANSI. + cat confdefs.h - <<_ACEOF >conftest.$ac_ext +/* end confdefs.h. */ +#include <string.h> + +_ACEOF +if (eval "$ac_cpp conftest.$ac_ext") 2>&5 | + $EGREP "memchr" >/dev/null 2>&1; then : + +else + ac_cv_header_stdc=no +fi +rm -f conftest* + +fi + +if test $ac_cv_header_stdc = yes; then + # ISC 2.0.2 stdlib.h does not declare free, contrary to ANSI. + cat confdefs.h - <<_ACEOF >conftest.$ac_ext +/* end confdefs.h. */ +#include <stdlib.h> + +_ACEOF +if (eval "$ac_cpp conftest.$ac_ext") 2>&5 | + $EGREP "free" >/dev/null 2>&1; then : + +else + ac_cv_header_stdc=no +fi +rm -f conftest* + +fi + +if test $ac_cv_header_stdc = yes; then + # /bin/cc in Irix-4.0.5 gets non-ANSI ctype macros unless using -ansi. + if test "$cross_compiling" = yes; then : + : +else + cat confdefs.h - <<_ACEOF >conftest.$ac_ext +/* end confdefs.h. */ +#include <ctype.h> +#include <stdlib.h> +#if ((' ' & 0x0FF) == 0x020) +# define ISLOWER(c) ('a' <= (c) && (c) <= 'z') +# define TOUPPER(c) (ISLOWER(c) ? 'A' + ((c) - 'a') : (c)) +#else +# define ISLOWER(c) \ + (('a' <= (c) && (c) <= 'i') \ + || ('j' <= (c) && (c) <= 'r') \ + || ('s' <= (c) && (c) <= 'z')) +# define TOUPPER(c) (ISLOWER(c) ? ((c) | 0x40) : (c)) +#endif + +#define XOR(e, f) (((e) && !(f)) || (!(e) && (f))) +int +main () +{ + int i; + for (i = 0; i < 256; i++) + if (XOR (islower (i), ISLOWER (i)) + || toupper (i) != TOUPPER (i)) + return 2; + return 0; +} +_ACEOF +if ac_fn_c_try_run "$LINENO"; then : + +else + ac_cv_header_stdc=no +fi +rm -f core *.core core.conftest.* gmon.out bb.out conftest$ac_exeext \ + conftest.$ac_objext conftest.beam conftest.$ac_ext +fi + +fi +fi +{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_cv_header_stdc" >&5 +$as_echo "$ac_cv_header_stdc" >&6; } +if test $ac_cv_header_stdc = yes; then + +$as_echo "#define STDC_HEADERS 1" >>confdefs.h + +fi + +# On IRIX 5.3, sys/types and inttypes.h are conflicting. +for ac_header in sys/types.h sys/stat.h stdlib.h string.h memory.h strings.h \ + inttypes.h stdint.h unistd.h +do : + as_ac_Header=`$as_echo "ac_cv_header_$ac_header" | $as_tr_sh` +ac_fn_c_check_header_compile "$LINENO" "$ac_header" "$as_ac_Header" "$ac_includes_default +" +if eval test \"x\$"$as_ac_Header"\" = x"yes"; then : + cat >>confdefs.h <<_ACEOF +#define `$as_echo "HAVE_$ac_header" | $as_tr_cpp` 1 +_ACEOF + +fi + +done + + +for ac_header in dlfcn.h +do : + ac_fn_c_check_header_compile "$LINENO" "dlfcn.h" "ac_cv_header_dlfcn_h" "$ac_includes_default +" +if test "x$ac_cv_header_dlfcn_h" = xyes; then : + cat >>confdefs.h <<_ACEOF +#define HAVE_DLFCN_H 1 +_ACEOF + +fi + +done + +##tldbg KPSE_COMMON: dvipng (). +##tldbg KPSE_BASIC: Remember dvipng () as Kpse_Package (for future messages). + +if test "`cd $srcdir && pwd`" != "`pwd`"; then + # Use -I$(srcdir) only when $(srcdir) != ., so that make's output + # is not polluted with repeated "-I." + am__isrc=' -I$(srcdir)' + # test to see if srcdir already configured + if test -f $srcdir/config.status; then + as_fn_error $? "source directory already configured; run \"make distclean\" there first" "$LINENO" 5 + fi +fi + +# test whether we have cygpath +if test -z "$CYGPATH_W"; then + if (cygpath --version) >/dev/null 2>/dev/null; then + CYGPATH_W='cygpath -w' + else + CYGPATH_W=echo + fi +fi + + +# Define the identity of the package. + PACKAGE='dvipng--tex-live-' + VERSION='1.17' + + +cat >>confdefs.h <<_ACEOF +#define PACKAGE "$PACKAGE" +_ACEOF + + +cat >>confdefs.h <<_ACEOF +#define VERSION "$VERSION" +_ACEOF + +# Some tools Automake needs. + +ACLOCAL=${ACLOCAL-"${am_missing_run}aclocal-${am__api_version}"} + + +AUTOCONF=${AUTOCONF-"${am_missing_run}autoconf"} + + +AUTOMAKE=${AUTOMAKE-"${am_missing_run}automake-${am__api_version}"} + + +AUTOHEADER=${AUTOHEADER-"${am_missing_run}autoheader"} + + +MAKEINFO=${MAKEINFO-"${am_missing_run}makeinfo"} + +# For better backward compatibility. To be removed once Automake 1.9.x +# dies out for good. For more background, see: +# <https://lists.gnu.org/archive/html/automake/2012-07/msg00001.html> +# <https://lists.gnu.org/archive/html/automake/2012-07/msg00014.html> +mkdir_p='$(MKDIR_P)' + +# We need awk for the "check" target (and possibly the TAP driver). The +# system "awk" is bad on some platforms. +# Always define AMTAR for backward compatibility. Yes, it's still used +# in the wild :-( We should find a proper way to deprecate it ... +AMTAR='$${TAR-tar}' + + +# We'll loop over all known methods to create a tar archive until one works. +_am_tools='gnutar pax cpio none' + +am__tar='$${TAR-tar} chof - "$$tardir"' am__untar='$${TAR-tar} xf -' + + + + + + +# POSIX will say in a future version that running "rm -f" with no argument +# is OK; and we want to be able to make that assumption in our Makefile +# recipes. So use an aggressive probe to check that the usage we want is +# actually supported "in the wild" to an acceptable degree. +# See automake bug#10828. +# To make any issue more visible, cause the running configure to be aborted +# by default if the 'rm' program in use doesn't match our expectations; the +# user can still override this though. +if rm -f && rm -fr && rm -rf; then : OK; else + cat >&2 <<'END' +Oops! + +Your 'rm' program seems unable to run without file operands specified +on the command line, even when the '-f' option is present. This is contrary +to the behaviour of most rm programs out there, and not conforming with +the upcoming POSIX standard: <http://austingroupbugs.net/view.php?id=542> + +Please tell bug-automake@gnu.org about your system, including the value +of your $PATH and any error possibly output before this message. This +can help us improve future automake versions. + +END + if test x"$ACCEPT_INFERIOR_RM_PROGRAM" = x"yes"; then + echo 'Configuration will proceed anyway, since you have set the' >&2 + echo 'ACCEPT_INFERIOR_RM_PROGRAM variable to "yes"' >&2 + echo >&2 + else + cat >&2 <<'END' +Aborting the configuration process, to ensure you take notice of the issue. + +You can download and install GNU coreutils to get an 'rm' implementation +that behaves properly: <https://www.gnu.org/software/coreutils/>. + +If you want to complete the configuration process using your problematic +'rm' anyway, export the environment variable ACCEPT_INFERIOR_RM_PROGRAM +to "yes", and re-run configure. + +END + as_fn_error $? "Your 'rm' program is bad, sorry." "$LINENO" 5 + fi +fi + + +{ $as_echo "$as_me:${as_lineno-$LINENO}: checking whether to enable maintainer-specific portions of Makefiles" >&5 +$as_echo_n "checking whether to enable maintainer-specific portions of Makefiles... " >&6; } + # Check whether --enable-maintainer-mode was given. +if test "${enable_maintainer_mode+set}" = set; then : + enableval=$enable_maintainer_mode; USE_MAINTAINER_MODE=$enableval +else + USE_MAINTAINER_MODE=no +fi + + { $as_echo "$as_me:${as_lineno-$LINENO}: result: $USE_MAINTAINER_MODE" >&5 +$as_echo "$USE_MAINTAINER_MODE" >&6; } + if test $USE_MAINTAINER_MODE = yes; then + MAINTAINER_MODE_TRUE= + MAINTAINER_MODE_FALSE='#' +else + MAINTAINER_MODE_TRUE='#' + MAINTAINER_MODE_FALSE= +fi + + MAINT=$MAINTAINER_MODE_TRUE + + +{ $as_echo "$as_me:${as_lineno-$LINENO}: checking whether the compiler accepts prototypes" >&5 +$as_echo_n "checking whether the compiler accepts prototypes... " >&6; } +if ${kb_cv_c_prototypes+:} false; then : + $as_echo_n "(cached) " >&6 +else + cat confdefs.h - <<_ACEOF >conftest.$ac_ext +/* end confdefs.h. */ +#include <stdarg.h> +int +main () +{ +extern void foo(int i,...); + ; + return 0; +} +_ACEOF +if ac_fn_c_try_link "$LINENO"; then : + kb_cv_c_prototypes=yes +else + kb_cv_c_prototypes=no +fi +rm -f core conftest.err conftest.$ac_objext \ + conftest$ac_exeext conftest.$ac_ext +fi +{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $kb_cv_c_prototypes" >&5 +$as_echo "$kb_cv_c_prototypes" >&6; } +if test "x$kb_cv_c_prototypes" = xno; then + as_fn_error $? "Sorry, your compiler does not understand prototypes." "$LINENO" 5 +fi +{ $as_echo "$as_me:${as_lineno-$LINENO}: checking what warning flags to pass to the C compiler" >&5 +$as_echo_n "checking what warning flags to pass to the C compiler... " >&6; } +if ${kpse_cv_warning_cflags+:} false; then : + $as_echo_n "(cached) " >&6 +else + if test "x$GCC" = xyes; then + kpse_cv_warning_cflags= +if test "x$enable_compiler_warnings" != xno; then + kpse_cv_warning_cflags="-Wimplicit -Wreturn-type" + case `$CC -dumpversion` in #( + 3.4.* | 4.* | 5.*) : + kpse_cv_warning_cflags="$kpse_cv_warning_cflags -Wdeclaration-after-statement" ;; #( + *) : + ;; +esac + case `$CC -dumpversion` in #( + 3.[234].* | 4.* | 5.*) : + kpse_cv_warning_cflags="$kpse_cv_warning_cflags -Wno-unknown-pragmas" ;; #( + *) : + ;; +esac + if test "x$enable_compiler_warnings" != xmin; then + kpse_cv_warning_cflags="-Wall -Wunused $kpse_cv_warning_cflags" + kpse_cv_warning_cflags="$kpse_cv_warning_cflags -Wmissing-prototypes -Wmissing-declarations" + if test "x$enable_compiler_warnings" != xyes; then + kpse_cv_warning_cflags="$kpse_cv_warning_cflags -Wparentheses -Wswitch -Wtrigraphs -Wpointer-arith" + kpse_cv_warning_cflags="$kpse_cv_warning_cflags -Wcast-qual -Wcast-align -Wwrite-strings" + case `$CC -dumpversion` in #( + 3.4.* | 4.* | 5.*) : + kpse_cv_warning_cflags="$kpse_cv_warning_cflags -Wold-style-definition" ;; #( + *) : + ;; +esac + if test "x$enable_compiler_warnings" != xmax; then + kpse_cv_warning_cflags="$kpse_cv_warning_cflags -Wshadow" + fi + fi + fi +fi +elif test "x$enable_compiler_warnings" = xno; then + kpse_cv_warning_cflags= +else + kpse_cv_warning_cflags= # FIXME: warning flags for non-GNU C compilers +fi +fi +{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $kpse_cv_warning_cflags" >&5 +$as_echo "$kpse_cv_warning_cflags" >&6; } +WARNING_CFLAGS=$kpse_cv_warning_cflags + + + + + + + + + + + + +# Set options +enable_win32_dll=yes + +case $host in +*-*-cygwin* | *-*-mingw* | *-*-pw32* | *-*-cegcc*) + if test -n "$ac_tool_prefix"; then + # Extract the first word of "${ac_tool_prefix}as", so it can be a program name with args. +set dummy ${ac_tool_prefix}as; ac_word=$2 +{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $ac_word" >&5 +$as_echo_n "checking for $ac_word... " >&6; } +if ${ac_cv_prog_AS+:} false; then : + $as_echo_n "(cached) " >&6 +else + if test -n "$AS"; then + ac_cv_prog_AS="$AS" # Let the user override the test. +else +as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in $PATH +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + for ac_exec_ext in '' $ac_executable_extensions; do + if as_fn_executable_p "$as_dir/$ac_word$ac_exec_ext"; then + ac_cv_prog_AS="${ac_tool_prefix}as" + $as_echo "$as_me:${as_lineno-$LINENO}: found $as_dir/$ac_word$ac_exec_ext" >&5 + break 2 + fi +done + done +IFS=$as_save_IFS + +fi +fi +AS=$ac_cv_prog_AS +if test -n "$AS"; then + { $as_echo "$as_me:${as_lineno-$LINENO}: result: $AS" >&5 +$as_echo "$AS" >&6; } +else + { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5 +$as_echo "no" >&6; } +fi + + +fi +if test -z "$ac_cv_prog_AS"; then + ac_ct_AS=$AS + # Extract the first word of "as", so it can be a program name with args. +set dummy as; ac_word=$2 +{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $ac_word" >&5 +$as_echo_n "checking for $ac_word... " >&6; } +if ${ac_cv_prog_ac_ct_AS+:} false; then : + $as_echo_n "(cached) " >&6 +else + if test -n "$ac_ct_AS"; then + ac_cv_prog_ac_ct_AS="$ac_ct_AS" # Let the user override the test. +else +as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in $PATH +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + for ac_exec_ext in '' $ac_executable_extensions; do + if as_fn_executable_p "$as_dir/$ac_word$ac_exec_ext"; then + ac_cv_prog_ac_ct_AS="as" + $as_echo "$as_me:${as_lineno-$LINENO}: found $as_dir/$ac_word$ac_exec_ext" >&5 + break 2 + fi +done + done +IFS=$as_save_IFS + +fi +fi +ac_ct_AS=$ac_cv_prog_ac_ct_AS +if test -n "$ac_ct_AS"; then + { $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_ct_AS" >&5 +$as_echo "$ac_ct_AS" >&6; } +else + { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5 +$as_echo "no" >&6; } +fi + + if test "x$ac_ct_AS" = x; then + AS="false" + else + case $cross_compiling:$ac_tool_warned in +yes:) +{ $as_echo "$as_me:${as_lineno-$LINENO}: WARNING: using cross tools not prefixed with host triplet" >&5 +$as_echo "$as_me: WARNING: using cross tools not prefixed with host triplet" >&2;} +ac_tool_warned=yes ;; +esac + AS=$ac_ct_AS + fi +else + AS="$ac_cv_prog_AS" +fi + + if test -n "$ac_tool_prefix"; then + # Extract the first word of "${ac_tool_prefix}dlltool", so it can be a program name with args. +set dummy ${ac_tool_prefix}dlltool; ac_word=$2 +{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $ac_word" >&5 +$as_echo_n "checking for $ac_word... " >&6; } +if ${ac_cv_prog_DLLTOOL+:} false; then : + $as_echo_n "(cached) " >&6 +else + if test -n "$DLLTOOL"; then + ac_cv_prog_DLLTOOL="$DLLTOOL" # Let the user override the test. +else +as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in $PATH +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + for ac_exec_ext in '' $ac_executable_extensions; do + if as_fn_executable_p "$as_dir/$ac_word$ac_exec_ext"; then + ac_cv_prog_DLLTOOL="${ac_tool_prefix}dlltool" + $as_echo "$as_me:${as_lineno-$LINENO}: found $as_dir/$ac_word$ac_exec_ext" >&5 + break 2 + fi +done + done +IFS=$as_save_IFS + +fi +fi +DLLTOOL=$ac_cv_prog_DLLTOOL +if test -n "$DLLTOOL"; then + { $as_echo "$as_me:${as_lineno-$LINENO}: result: $DLLTOOL" >&5 +$as_echo "$DLLTOOL" >&6; } +else + { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5 +$as_echo "no" >&6; } +fi + + +fi +if test -z "$ac_cv_prog_DLLTOOL"; then + ac_ct_DLLTOOL=$DLLTOOL + # Extract the first word of "dlltool", so it can be a program name with args. +set dummy dlltool; ac_word=$2 +{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $ac_word" >&5 +$as_echo_n "checking for $ac_word... " >&6; } +if ${ac_cv_prog_ac_ct_DLLTOOL+:} false; then : + $as_echo_n "(cached) " >&6 +else + if test -n "$ac_ct_DLLTOOL"; then + ac_cv_prog_ac_ct_DLLTOOL="$ac_ct_DLLTOOL" # Let the user override the test. +else +as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in $PATH +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + for ac_exec_ext in '' $ac_executable_extensions; do + if as_fn_executable_p "$as_dir/$ac_word$ac_exec_ext"; then + ac_cv_prog_ac_ct_DLLTOOL="dlltool" + $as_echo "$as_me:${as_lineno-$LINENO}: found $as_dir/$ac_word$ac_exec_ext" >&5 + break 2 + fi +done + done +IFS=$as_save_IFS + +fi +fi +ac_ct_DLLTOOL=$ac_cv_prog_ac_ct_DLLTOOL +if test -n "$ac_ct_DLLTOOL"; then + { $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_ct_DLLTOOL" >&5 +$as_echo "$ac_ct_DLLTOOL" >&6; } +else + { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5 +$as_echo "no" >&6; } +fi + + if test "x$ac_ct_DLLTOOL" = x; then + DLLTOOL="false" + else + case $cross_compiling:$ac_tool_warned in +yes:) +{ $as_echo "$as_me:${as_lineno-$LINENO}: WARNING: using cross tools not prefixed with host triplet" >&5 +$as_echo "$as_me: WARNING: using cross tools not prefixed with host triplet" >&2;} +ac_tool_warned=yes ;; +esac + DLLTOOL=$ac_ct_DLLTOOL + fi +else + DLLTOOL="$ac_cv_prog_DLLTOOL" +fi + + if test -n "$ac_tool_prefix"; then + # Extract the first word of "${ac_tool_prefix}objdump", so it can be a program name with args. +set dummy ${ac_tool_prefix}objdump; ac_word=$2 +{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $ac_word" >&5 +$as_echo_n "checking for $ac_word... " >&6; } +if ${ac_cv_prog_OBJDUMP+:} false; then : + $as_echo_n "(cached) " >&6 +else + if test -n "$OBJDUMP"; then + ac_cv_prog_OBJDUMP="$OBJDUMP" # Let the user override the test. +else +as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in $PATH +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + for ac_exec_ext in '' $ac_executable_extensions; do + if as_fn_executable_p "$as_dir/$ac_word$ac_exec_ext"; then + ac_cv_prog_OBJDUMP="${ac_tool_prefix}objdump" + $as_echo "$as_me:${as_lineno-$LINENO}: found $as_dir/$ac_word$ac_exec_ext" >&5 + break 2 + fi +done + done +IFS=$as_save_IFS + +fi +fi +OBJDUMP=$ac_cv_prog_OBJDUMP +if test -n "$OBJDUMP"; then + { $as_echo "$as_me:${as_lineno-$LINENO}: result: $OBJDUMP" >&5 +$as_echo "$OBJDUMP" >&6; } +else + { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5 +$as_echo "no" >&6; } +fi + + +fi +if test -z "$ac_cv_prog_OBJDUMP"; then + ac_ct_OBJDUMP=$OBJDUMP + # Extract the first word of "objdump", so it can be a program name with args. +set dummy objdump; ac_word=$2 +{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $ac_word" >&5 +$as_echo_n "checking for $ac_word... " >&6; } +if ${ac_cv_prog_ac_ct_OBJDUMP+:} false; then : + $as_echo_n "(cached) " >&6 +else + if test -n "$ac_ct_OBJDUMP"; then + ac_cv_prog_ac_ct_OBJDUMP="$ac_ct_OBJDUMP" # Let the user override the test. +else +as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in $PATH +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + for ac_exec_ext in '' $ac_executable_extensions; do + if as_fn_executable_p "$as_dir/$ac_word$ac_exec_ext"; then + ac_cv_prog_ac_ct_OBJDUMP="objdump" + $as_echo "$as_me:${as_lineno-$LINENO}: found $as_dir/$ac_word$ac_exec_ext" >&5 + break 2 + fi +done + done +IFS=$as_save_IFS + +fi +fi +ac_ct_OBJDUMP=$ac_cv_prog_ac_ct_OBJDUMP +if test -n "$ac_ct_OBJDUMP"; then + { $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_ct_OBJDUMP" >&5 +$as_echo "$ac_ct_OBJDUMP" >&6; } +else + { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5 +$as_echo "no" >&6; } +fi + + if test "x$ac_ct_OBJDUMP" = x; then + OBJDUMP="false" + else + case $cross_compiling:$ac_tool_warned in +yes:) +{ $as_echo "$as_me:${as_lineno-$LINENO}: WARNING: using cross tools not prefixed with host triplet" >&5 +$as_echo "$as_me: WARNING: using cross tools not prefixed with host triplet" >&2;} +ac_tool_warned=yes ;; +esac + OBJDUMP=$ac_ct_OBJDUMP + fi +else + OBJDUMP="$ac_cv_prog_OBJDUMP" +fi + + ;; +esac + +test -z "$AS" && AS=as + + + + + +test -z "$DLLTOOL" && DLLTOOL=dlltool + + + + + +test -z "$OBJDUMP" && OBJDUMP=objdump + + + + + + + + enable_dlopen=no + + + + # Check whether --enable-shared was given. +if test "${enable_shared+set}" = set; then : + enableval=$enable_shared; p=${PACKAGE-default} + case $enableval in + yes) enable_shared=yes ;; + no) enable_shared=no ;; + *) + enable_shared=no + # Look at the argument we got. We use all the common list separators. + lt_save_ifs=$IFS; IFS=$IFS$PATH_SEPARATOR, + for pkg in $enableval; do + IFS=$lt_save_ifs + if test "X$pkg" = "X$p"; then + enable_shared=yes + fi + done + IFS=$lt_save_ifs + ;; + esac +else + enable_shared=yes +fi + + + + + + + + + + # Check whether --enable-static was given. +if test "${enable_static+set}" = set; then : + enableval=$enable_static; p=${PACKAGE-default} + case $enableval in + yes) enable_static=yes ;; + no) enable_static=no ;; + *) + enable_static=no + # Look at the argument we got. We use all the common list separators. + lt_save_ifs=$IFS; IFS=$IFS$PATH_SEPARATOR, + for pkg in $enableval; do + IFS=$lt_save_ifs + if test "X$pkg" = "X$p"; then + enable_static=yes + fi + done + IFS=$lt_save_ifs + ;; + esac +else + enable_static=yes +fi + + + + + + + + + + +# Check whether --with-pic was given. +if test "${with_pic+set}" = set; then : + withval=$with_pic; lt_p=${PACKAGE-default} + case $withval in + yes|no) pic_mode=$withval ;; + *) + pic_mode=default + # Look at the argument we got. We use all the common list separators. + lt_save_ifs=$IFS; IFS=$IFS$PATH_SEPARATOR, + for lt_pkg in $withval; do + IFS=$lt_save_ifs + if test "X$lt_pkg" = "X$lt_p"; then + pic_mode=yes + fi + done + IFS=$lt_save_ifs + ;; + esac +else + pic_mode=default +fi + + + + + + + + + # Check whether --enable-fast-install was given. +if test "${enable_fast_install+set}" = set; then : + enableval=$enable_fast_install; p=${PACKAGE-default} + case $enableval in + yes) enable_fast_install=yes ;; + no) enable_fast_install=no ;; + *) + enable_fast_install=no + # Look at the argument we got. We use all the common list separators. + lt_save_ifs=$IFS; IFS=$IFS$PATH_SEPARATOR, + for pkg in $enableval; do + IFS=$lt_save_ifs + if test "X$pkg" = "X$p"; then + enable_fast_install=yes + fi + done + IFS=$lt_save_ifs + ;; + esac +else + enable_fast_install=yes +fi + + + + + + + + + shared_archive_member_spec= +case $host,$enable_shared in +power*-*-aix[5-9]*,yes) + { $as_echo "$as_me:${as_lineno-$LINENO}: checking which variant of shared library versioning to provide" >&5 +$as_echo_n "checking which variant of shared library versioning to provide... " >&6; } + +# Check whether --with-aix-soname was given. +if test "${with_aix_soname+set}" = set; then : + withval=$with_aix_soname; case $withval in + aix|svr4|both) + ;; + *) + as_fn_error $? "Unknown argument to --with-aix-soname" "$LINENO" 5 + ;; + esac + lt_cv_with_aix_soname=$with_aix_soname +else + if ${lt_cv_with_aix_soname+:} false; then : + $as_echo_n "(cached) " >&6 +else + lt_cv_with_aix_soname=aix +fi + + with_aix_soname=$lt_cv_with_aix_soname +fi + + { $as_echo "$as_me:${as_lineno-$LINENO}: result: $with_aix_soname" >&5 +$as_echo "$with_aix_soname" >&6; } + if test aix != "$with_aix_soname"; then + # For the AIX way of multilib, we name the shared archive member + # based on the bitwidth used, traditionally 'shr.o' or 'shr_64.o', + # and 'shr.imp' or 'shr_64.imp', respectively, for the Import File. + # Even when GNU compilers ignore OBJECT_MODE but need '-maix64' flag, + # the AIX toolchain works better with OBJECT_MODE set (default 32). + if test 64 = "${OBJECT_MODE-32}"; then + shared_archive_member_spec=shr_64 + else + shared_archive_member_spec=shr + fi + fi + ;; +*) + with_aix_soname=aix + ;; +esac + + + + + + + + + + +# This can be used to rebuild libtool when needed +LIBTOOL_DEPS=$ltmain + +# Always use our own libtool. +LIBTOOL='$(SHELL) $(top_builddir)/libtool' + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +test -z "$LN_S" && LN_S="ln -s" + + + + + + + + + + + + + + +if test -n "${ZSH_VERSION+set}"; then + setopt NO_GLOB_SUBST +fi + +{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for objdir" >&5 +$as_echo_n "checking for objdir... " >&6; } +if ${lt_cv_objdir+:} false; then : + $as_echo_n "(cached) " >&6 +else + rm -f .libs 2>/dev/null +mkdir .libs 2>/dev/null +if test -d .libs; then + lt_cv_objdir=.libs +else + # MS-DOS does not allow filenames that begin with a dot. + lt_cv_objdir=_libs +fi +rmdir .libs 2>/dev/null +fi +{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $lt_cv_objdir" >&5 +$as_echo "$lt_cv_objdir" >&6; } +objdir=$lt_cv_objdir + + + + + +cat >>confdefs.h <<_ACEOF +#define LT_OBJDIR "$lt_cv_objdir/" +_ACEOF + + + + +case $host_os in +aix3*) + # AIX sometimes has problems with the GCC collect2 program. For some + # reason, if we set the COLLECT_NAMES environment variable, the problems + # vanish in a puff of smoke. + if test set != "${COLLECT_NAMES+set}"; then + COLLECT_NAMES= + export COLLECT_NAMES + fi + ;; +esac + +# Global variables: +ofile=libtool +can_build_shared=yes + +# All known linkers require a '.a' archive for static linking (except MSVC, +# which needs '.lib'). +libext=a + +with_gnu_ld=$lt_cv_prog_gnu_ld + +old_CC=$CC +old_CFLAGS=$CFLAGS + +# Set sane defaults for various variables +test -z "$CC" && CC=cc +test -z "$LTCC" && LTCC=$CC +test -z "$LTCFLAGS" && LTCFLAGS=$CFLAGS +test -z "$LD" && LD=ld +test -z "$ac_objext" && ac_objext=o + +func_cc_basename $compiler +cc_basename=$func_cc_basename_result + + +# Only perform the check for file, if the check method requires it +test -z "$MAGIC_CMD" && MAGIC_CMD=file +case $deplibs_check_method in +file_magic*) + if test "$file_magic_cmd" = '$MAGIC_CMD'; then + { $as_echo "$as_me:${as_lineno-$LINENO}: checking for ${ac_tool_prefix}file" >&5 +$as_echo_n "checking for ${ac_tool_prefix}file... " >&6; } +if ${lt_cv_path_MAGIC_CMD+:} false; then : + $as_echo_n "(cached) " >&6 +else + case $MAGIC_CMD in +[\\/*] | ?:[\\/]*) + lt_cv_path_MAGIC_CMD=$MAGIC_CMD # Let the user override the test with a path. + ;; +*) + lt_save_MAGIC_CMD=$MAGIC_CMD + lt_save_ifs=$IFS; IFS=$PATH_SEPARATOR + ac_dummy="/usr/bin$PATH_SEPARATOR$PATH" + for ac_dir in $ac_dummy; do + IFS=$lt_save_ifs + test -z "$ac_dir" && ac_dir=. + if test -f "$ac_dir/${ac_tool_prefix}file"; then + lt_cv_path_MAGIC_CMD=$ac_dir/"${ac_tool_prefix}file" + if test -n "$file_magic_test_file"; then + case $deplibs_check_method in + "file_magic "*) + file_magic_regex=`expr "$deplibs_check_method" : "file_magic \(.*\)"` + MAGIC_CMD=$lt_cv_path_MAGIC_CMD + if eval $file_magic_cmd \$file_magic_test_file 2> /dev/null | + $EGREP "$file_magic_regex" > /dev/null; then + : + else + cat <<_LT_EOF 1>&2 + +*** Warning: the command libtool uses to detect shared libraries, +*** $file_magic_cmd, produces output that libtool cannot recognize. +*** The result is that libtool may fail to recognize shared libraries +*** as such. This will affect the creation of libtool libraries that +*** depend on shared libraries, but programs linked with such libtool +*** libraries will work regardless of this problem. Nevertheless, you +*** may want to report the problem to your system manager and/or to +*** bug-libtool@gnu.org + +_LT_EOF + fi ;; + esac + fi + break + fi + done + IFS=$lt_save_ifs + MAGIC_CMD=$lt_save_MAGIC_CMD + ;; +esac +fi + +MAGIC_CMD=$lt_cv_path_MAGIC_CMD +if test -n "$MAGIC_CMD"; then + { $as_echo "$as_me:${as_lineno-$LINENO}: result: $MAGIC_CMD" >&5 +$as_echo "$MAGIC_CMD" >&6; } +else + { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5 +$as_echo "no" >&6; } +fi + + + + + +if test -z "$lt_cv_path_MAGIC_CMD"; then + if test -n "$ac_tool_prefix"; then + { $as_echo "$as_me:${as_lineno-$LINENO}: checking for file" >&5 +$as_echo_n "checking for file... " >&6; } +if ${lt_cv_path_MAGIC_CMD+:} false; then : + $as_echo_n "(cached) " >&6 +else + case $MAGIC_CMD in +[\\/*] | ?:[\\/]*) + lt_cv_path_MAGIC_CMD=$MAGIC_CMD # Let the user override the test with a path. + ;; +*) + lt_save_MAGIC_CMD=$MAGIC_CMD + lt_save_ifs=$IFS; IFS=$PATH_SEPARATOR + ac_dummy="/usr/bin$PATH_SEPARATOR$PATH" + for ac_dir in $ac_dummy; do + IFS=$lt_save_ifs + test -z "$ac_dir" && ac_dir=. + if test -f "$ac_dir/file"; then + lt_cv_path_MAGIC_CMD=$ac_dir/"file" + if test -n "$file_magic_test_file"; then + case $deplibs_check_method in + "file_magic "*) + file_magic_regex=`expr "$deplibs_check_method" : "file_magic \(.*\)"` + MAGIC_CMD=$lt_cv_path_MAGIC_CMD + if eval $file_magic_cmd \$file_magic_test_file 2> /dev/null | + $EGREP "$file_magic_regex" > /dev/null; then + : + else + cat <<_LT_EOF 1>&2 + +*** Warning: the command libtool uses to detect shared libraries, +*** $file_magic_cmd, produces output that libtool cannot recognize. +*** The result is that libtool may fail to recognize shared libraries +*** as such. This will affect the creation of libtool libraries that +*** depend on shared libraries, but programs linked with such libtool +*** libraries will work regardless of this problem. Nevertheless, you +*** may want to report the problem to your system manager and/or to +*** bug-libtool@gnu.org + +_LT_EOF + fi ;; + esac + fi + break + fi + done + IFS=$lt_save_ifs + MAGIC_CMD=$lt_save_MAGIC_CMD + ;; +esac +fi + +MAGIC_CMD=$lt_cv_path_MAGIC_CMD +if test -n "$MAGIC_CMD"; then + { $as_echo "$as_me:${as_lineno-$LINENO}: result: $MAGIC_CMD" >&5 +$as_echo "$MAGIC_CMD" >&6; } +else + { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5 +$as_echo "no" >&6; } +fi + + + else + MAGIC_CMD=: + fi +fi + + fi + ;; +esac + +# Use C for the default configuration in the libtool script + +lt_save_CC=$CC +ac_ext=c +ac_cpp='$CPP $CPPFLAGS' +ac_compile='$CC -c $CFLAGS $CPPFLAGS conftest.$ac_ext >&5' +ac_link='$CC -o conftest$ac_exeext $CFLAGS $CPPFLAGS $LDFLAGS conftest.$ac_ext $LIBS >&5' +ac_compiler_gnu=$ac_cv_c_compiler_gnu + + +# Source file extension for C test sources. +ac_ext=c + +# Object file extension for compiled C test sources. +objext=o +objext=$objext + +# Code to be used in simple compile tests +lt_simple_compile_test_code="int some_variable = 0;" + +# Code to be used in simple link tests +lt_simple_link_test_code='int main(){return(0);}' + + + + + + + +# If no C compiler was specified, use CC. +LTCC=${LTCC-"$CC"} + +# If no C compiler flags were specified, use CFLAGS. +LTCFLAGS=${LTCFLAGS-"$CFLAGS"} + +# Allow CC to be a program name with arguments. +compiler=$CC + +# Save the default compiler, since it gets overwritten when the other +# tags are being tested, and _LT_TAGVAR(compiler, []) is a NOP. +compiler_DEFAULT=$CC + +# save warnings/boilerplate of simple test code +ac_outfile=conftest.$ac_objext +echo "$lt_simple_compile_test_code" >conftest.$ac_ext +eval "$ac_compile" 2>&1 >/dev/null | $SED '/^$/d; /^ *+/d' >conftest.err +_lt_compiler_boilerplate=`cat conftest.err` +$RM conftest* + +ac_outfile=conftest.$ac_objext +echo "$lt_simple_link_test_code" >conftest.$ac_ext +eval "$ac_link" 2>&1 >/dev/null | $SED '/^$/d; /^ *+/d' >conftest.err +_lt_linker_boilerplate=`cat conftest.err` +$RM -r conftest* + + +## CAVEAT EMPTOR: +## There is no encapsulation within the following macros, do not change +## the running order or otherwise move them around unless you know exactly +## what you are doing... +if test -n "$compiler"; then + +lt_prog_compiler_no_builtin_flag= + +if test yes = "$GCC"; then + case $cc_basename in + nvcc*) + lt_prog_compiler_no_builtin_flag=' -Xcompiler -fno-builtin' ;; + *) + lt_prog_compiler_no_builtin_flag=' -fno-builtin' ;; + esac + + { $as_echo "$as_me:${as_lineno-$LINENO}: checking if $compiler supports -fno-rtti -fno-exceptions" >&5 +$as_echo_n "checking if $compiler supports -fno-rtti -fno-exceptions... " >&6; } +if ${lt_cv_prog_compiler_rtti_exceptions+:} false; then : + $as_echo_n "(cached) " >&6 +else + lt_cv_prog_compiler_rtti_exceptions=no + ac_outfile=conftest.$ac_objext + echo "$lt_simple_compile_test_code" > conftest.$ac_ext + lt_compiler_flag="-fno-rtti -fno-exceptions" ## exclude from sc_useless_quotes_in_assignment + # Insert the option either (1) after the last *FLAGS variable, or + # (2) before a word containing "conftest.", or (3) at the end. + # Note that $ac_compile itself does not contain backslashes and begins + # with a dollar sign (not a hyphen), so the echo should work correctly. + # The option is referenced via a variable to avoid confusing sed. + lt_compile=`echo "$ac_compile" | $SED \ + -e 's:.*FLAGS}\{0,1\} :&$lt_compiler_flag :; t' \ + -e 's: [^ ]*conftest\.: $lt_compiler_flag&:; t' \ + -e 's:$: $lt_compiler_flag:'` + (eval echo "\"\$as_me:$LINENO: $lt_compile\"" >&5) + (eval "$lt_compile" 2>conftest.err) + ac_status=$? + cat conftest.err >&5 + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + if (exit $ac_status) && test -s "$ac_outfile"; then + # The compiler can only warn and ignore the option if not recognized + # So say no if there are warnings other than the usual output. + $ECHO "$_lt_compiler_boilerplate" | $SED '/^$/d' >conftest.exp + $SED '/^$/d; /^ *+/d' conftest.err >conftest.er2 + if test ! -s conftest.er2 || diff conftest.exp conftest.er2 >/dev/null; then + lt_cv_prog_compiler_rtti_exceptions=yes + fi + fi + $RM conftest* + +fi +{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $lt_cv_prog_compiler_rtti_exceptions" >&5 +$as_echo "$lt_cv_prog_compiler_rtti_exceptions" >&6; } + +if test yes = "$lt_cv_prog_compiler_rtti_exceptions"; then + lt_prog_compiler_no_builtin_flag="$lt_prog_compiler_no_builtin_flag -fno-rtti -fno-exceptions" +else + : +fi + +fi + + + + + + + lt_prog_compiler_wl= +lt_prog_compiler_pic= +lt_prog_compiler_static= + + + if test yes = "$GCC"; then + lt_prog_compiler_wl='-Wl,' + lt_prog_compiler_static='-static' + + case $host_os in + aix*) + # All AIX code is PIC. + if test ia64 = "$host_cpu"; then + # AIX 5 now supports IA64 processor + lt_prog_compiler_static='-Bstatic' + fi + lt_prog_compiler_pic='-fPIC' + ;; + + amigaos*) + case $host_cpu in + powerpc) + # see comment about AmigaOS4 .so support + lt_prog_compiler_pic='-fPIC' + ;; + m68k) + # FIXME: we need at least 68020 code to build shared libraries, but + # adding the '-m68020' flag to GCC prevents building anything better, + # like '-m68040'. + lt_prog_compiler_pic='-m68020 -resident32 -malways-restore-a4' + ;; + esac + ;; + + beos* | irix5* | irix6* | nonstopux* | osf3* | osf4* | osf5*) + # PIC is the default for these OSes. + ;; + + mingw* | cygwin* | pw32* | os2* | cegcc*) + # This hack is so that the source file can tell whether it is being + # built for inclusion in a dll (and should export symbols for example). + # Although the cygwin gcc ignores -fPIC, still need this for old-style + # (--disable-auto-import) libraries + lt_prog_compiler_pic='-DDLL_EXPORT' + case $host_os in + os2*) + lt_prog_compiler_static='$wl-static' + ;; + esac + ;; + + darwin* | rhapsody*) + # PIC is the default on this platform + # Common symbols not allowed in MH_DYLIB files + lt_prog_compiler_pic='-fno-common' + ;; + + haiku*) + # PIC is the default for Haiku. + # The "-static" flag exists, but is broken. + lt_prog_compiler_static= + ;; + + hpux*) + # PIC is the default for 64-bit PA HP-UX, but not for 32-bit + # PA HP-UX. On IA64 HP-UX, PIC is the default but the pic flag + # sets the default TLS model and affects inlining. + case $host_cpu in + hppa*64*) + # +Z the default + ;; + *) + lt_prog_compiler_pic='-fPIC' + ;; + esac + ;; + + interix[3-9]*) + # Interix 3.x gcc -fpic/-fPIC options generate broken code. + # Instead, we relocate shared libraries at runtime. + ;; + + msdosdjgpp*) + # Just because we use GCC doesn't mean we suddenly get shared libraries + # on systems that don't support them. + lt_prog_compiler_can_build_shared=no + enable_shared=no + ;; + + *nto* | *qnx*) + # QNX uses GNU C++, but need to define -shared option too, otherwise + # it will coredump. + lt_prog_compiler_pic='-fPIC -shared' + ;; + + sysv4*MP*) + if test -d /usr/nec; then + lt_prog_compiler_pic=-Kconform_pic + fi + ;; + + *) + lt_prog_compiler_pic='-fPIC' + ;; + esac + + case $cc_basename in + nvcc*) # Cuda Compiler Driver 2.2 + lt_prog_compiler_wl='-Xlinker ' + if test -n "$lt_prog_compiler_pic"; then + lt_prog_compiler_pic="-Xcompiler $lt_prog_compiler_pic" + fi + ;; + esac + else + # PORTME Check for flag to pass linker flags through the system compiler. + case $host_os in + aix*) + lt_prog_compiler_wl='-Wl,' + if test ia64 = "$host_cpu"; then + # AIX 5 now supports IA64 processor + lt_prog_compiler_static='-Bstatic' + else + lt_prog_compiler_static='-bnso -bI:/lib/syscalls.exp' + fi + ;; + + darwin* | rhapsody*) + # PIC is the default on this platform + # Common symbols not allowed in MH_DYLIB files + lt_prog_compiler_pic='-fno-common' + case $cc_basename in + nagfor*) + # NAG Fortran compiler + lt_prog_compiler_wl='-Wl,-Wl,,' + lt_prog_compiler_pic='-PIC' + lt_prog_compiler_static='-Bstatic' + ;; + esac + ;; + + mingw* | cygwin* | pw32* | os2* | cegcc*) + # This hack is so that the source file can tell whether it is being + # built for inclusion in a dll (and should export symbols for example). + lt_prog_compiler_pic='-DDLL_EXPORT' + case $host_os in + os2*) + lt_prog_compiler_static='$wl-static' + ;; + esac + ;; + + hpux9* | hpux10* | hpux11*) + lt_prog_compiler_wl='-Wl,' + # PIC is the default for IA64 HP-UX and 64-bit HP-UX, but + # not for PA HP-UX. + case $host_cpu in + hppa*64*|ia64*) + # +Z the default + ;; + *) + lt_prog_compiler_pic='+Z' + ;; + esac + # Is there a better lt_prog_compiler_static that works with the bundled CC? + lt_prog_compiler_static='$wl-a ${wl}archive' + ;; + + irix5* | irix6* | nonstopux*) + lt_prog_compiler_wl='-Wl,' + # PIC (with -KPIC) is the default. + lt_prog_compiler_static='-non_shared' + ;; + + linux* | k*bsd*-gnu | kopensolaris*-gnu | gnu*) + case $cc_basename in + # old Intel for x86_64, which still supported -KPIC. + ecc*) + lt_prog_compiler_wl='-Wl,' + lt_prog_compiler_pic='-KPIC' + lt_prog_compiler_static='-static' + ;; + # icc used to be incompatible with GCC. + # ICC 10 doesn't accept -KPIC any more. + icc* | ifort*) + lt_prog_compiler_wl='-Wl,' + lt_prog_compiler_pic='-fPIC' + lt_prog_compiler_static='-static' + ;; + # Lahey Fortran 8.1. + lf95*) + lt_prog_compiler_wl='-Wl,' + lt_prog_compiler_pic='--shared' + lt_prog_compiler_static='--static' + ;; + nagfor*) + # NAG Fortran compiler + lt_prog_compiler_wl='-Wl,-Wl,,' + lt_prog_compiler_pic='-PIC' + lt_prog_compiler_static='-Bstatic' + ;; + tcc*) + # Fabrice Bellard et al's Tiny C Compiler + lt_prog_compiler_wl='-Wl,' + lt_prog_compiler_pic='-fPIC' + lt_prog_compiler_static='-static' + ;; + pgcc* | pgf77* | pgf90* | pgf95* | pgfortran*) + # Portland Group compilers (*not* the Pentium gcc compiler, + # which looks to be a dead project) + lt_prog_compiler_wl='-Wl,' + lt_prog_compiler_pic='-fpic' + lt_prog_compiler_static='-Bstatic' + ;; + ccc*) + lt_prog_compiler_wl='-Wl,' + # All Alpha code is PIC. + lt_prog_compiler_static='-non_shared' + ;; + xl* | bgxl* | bgf* | mpixl*) + # IBM XL C 8.0/Fortran 10.1, 11.1 on PPC and BlueGene + lt_prog_compiler_wl='-Wl,' + lt_prog_compiler_pic='-qpic' + lt_prog_compiler_static='-qstaticlink' + ;; + *) + case `$CC -V 2>&1 | sed 5q` in + *Sun\ Ceres\ Fortran* | *Sun*Fortran*\ [1-7].* | *Sun*Fortran*\ 8.[0-3]*) + # Sun Fortran 8.3 passes all unrecognized flags to the linker + lt_prog_compiler_pic='-KPIC' + lt_prog_compiler_static='-Bstatic' + lt_prog_compiler_wl='' + ;; + *Sun\ F* | *Sun*Fortran*) + lt_prog_compiler_pic='-KPIC' + lt_prog_compiler_static='-Bstatic' + lt_prog_compiler_wl='-Qoption ld ' + ;; + *Sun\ C*) + # Sun C 5.9 + lt_prog_compiler_pic='-KPIC' + lt_prog_compiler_static='-Bstatic' + lt_prog_compiler_wl='-Wl,' + ;; + *Intel*\ [CF]*Compiler*) + lt_prog_compiler_wl='-Wl,' + lt_prog_compiler_pic='-fPIC' + lt_prog_compiler_static='-static' + ;; + *Portland\ Group*) + lt_prog_compiler_wl='-Wl,' + lt_prog_compiler_pic='-fpic' + lt_prog_compiler_static='-Bstatic' + ;; + esac + ;; + esac + ;; + + newsos6) + lt_prog_compiler_pic='-KPIC' + lt_prog_compiler_static='-Bstatic' + ;; + + *nto* | *qnx*) + # QNX uses GNU C++, but need to define -shared option too, otherwise + # it will coredump. + lt_prog_compiler_pic='-fPIC -shared' + ;; + + osf3* | osf4* | osf5*) + lt_prog_compiler_wl='-Wl,' + # All OSF/1 code is PIC. + lt_prog_compiler_static='-non_shared' + ;; + + rdos*) + lt_prog_compiler_static='-non_shared' + ;; + + solaris*) + lt_prog_compiler_pic='-KPIC' + lt_prog_compiler_static='-Bstatic' + case $cc_basename in + f77* | f90* | f95* | sunf77* | sunf90* | sunf95*) + lt_prog_compiler_wl='-Qoption ld ';; + *) + lt_prog_compiler_wl='-Wl,';; + esac + ;; + + sunos4*) + lt_prog_compiler_wl='-Qoption ld ' + lt_prog_compiler_pic='-PIC' + lt_prog_compiler_static='-Bstatic' + ;; + + sysv4 | sysv4.2uw2* | sysv4.3*) + lt_prog_compiler_wl='-Wl,' + lt_prog_compiler_pic='-KPIC' + lt_prog_compiler_static='-Bstatic' + ;; + + sysv4*MP*) + if test -d /usr/nec; then + lt_prog_compiler_pic='-Kconform_pic' + lt_prog_compiler_static='-Bstatic' + fi + ;; + + sysv5* | unixware* | sco3.2v5* | sco5v6* | OpenUNIX*) + lt_prog_compiler_wl='-Wl,' + lt_prog_compiler_pic='-KPIC' + lt_prog_compiler_static='-Bstatic' + ;; + + unicos*) + lt_prog_compiler_wl='-Wl,' + lt_prog_compiler_can_build_shared=no + ;; + + uts4*) + lt_prog_compiler_pic='-pic' + lt_prog_compiler_static='-Bstatic' + ;; + + *) + lt_prog_compiler_can_build_shared=no + ;; + esac + fi + +case $host_os in + # For platforms that do not support PIC, -DPIC is meaningless: + *djgpp*) + lt_prog_compiler_pic= + ;; + *) + lt_prog_compiler_pic="$lt_prog_compiler_pic -DPIC" + ;; +esac + +{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $compiler option to produce PIC" >&5 +$as_echo_n "checking for $compiler option to produce PIC... " >&6; } +if ${lt_cv_prog_compiler_pic+:} false; then : + $as_echo_n "(cached) " >&6 +else + lt_cv_prog_compiler_pic=$lt_prog_compiler_pic +fi +{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $lt_cv_prog_compiler_pic" >&5 +$as_echo "$lt_cv_prog_compiler_pic" >&6; } +lt_prog_compiler_pic=$lt_cv_prog_compiler_pic + +# +# Check to make sure the PIC flag actually works. +# +if test -n "$lt_prog_compiler_pic"; then + { $as_echo "$as_me:${as_lineno-$LINENO}: checking if $compiler PIC flag $lt_prog_compiler_pic works" >&5 +$as_echo_n "checking if $compiler PIC flag $lt_prog_compiler_pic works... " >&6; } +if ${lt_cv_prog_compiler_pic_works+:} false; then : + $as_echo_n "(cached) " >&6 +else + lt_cv_prog_compiler_pic_works=no + ac_outfile=conftest.$ac_objext + echo "$lt_simple_compile_test_code" > conftest.$ac_ext + lt_compiler_flag="$lt_prog_compiler_pic -DPIC" ## exclude from sc_useless_quotes_in_assignment + # Insert the option either (1) after the last *FLAGS variable, or + # (2) before a word containing "conftest.", or (3) at the end. + # Note that $ac_compile itself does not contain backslashes and begins + # with a dollar sign (not a hyphen), so the echo should work correctly. + # The option is referenced via a variable to avoid confusing sed. + lt_compile=`echo "$ac_compile" | $SED \ + -e 's:.*FLAGS}\{0,1\} :&$lt_compiler_flag :; t' \ + -e 's: [^ ]*conftest\.: $lt_compiler_flag&:; t' \ + -e 's:$: $lt_compiler_flag:'` + (eval echo "\"\$as_me:$LINENO: $lt_compile\"" >&5) + (eval "$lt_compile" 2>conftest.err) + ac_status=$? + cat conftest.err >&5 + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + if (exit $ac_status) && test -s "$ac_outfile"; then + # The compiler can only warn and ignore the option if not recognized + # So say no if there are warnings other than the usual output. + $ECHO "$_lt_compiler_boilerplate" | $SED '/^$/d' >conftest.exp + $SED '/^$/d; /^ *+/d' conftest.err >conftest.er2 + if test ! -s conftest.er2 || diff conftest.exp conftest.er2 >/dev/null; then + lt_cv_prog_compiler_pic_works=yes + fi + fi + $RM conftest* + +fi +{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $lt_cv_prog_compiler_pic_works" >&5 +$as_echo "$lt_cv_prog_compiler_pic_works" >&6; } + +if test yes = "$lt_cv_prog_compiler_pic_works"; then + case $lt_prog_compiler_pic in + "" | " "*) ;; + *) lt_prog_compiler_pic=" $lt_prog_compiler_pic" ;; + esac +else + lt_prog_compiler_pic= + lt_prog_compiler_can_build_shared=no +fi + +fi + + + + + + + + + + + +# +# Check to make sure the static flag actually works. +# +wl=$lt_prog_compiler_wl eval lt_tmp_static_flag=\"$lt_prog_compiler_static\" +{ $as_echo "$as_me:${as_lineno-$LINENO}: checking if $compiler static flag $lt_tmp_static_flag works" >&5 +$as_echo_n "checking if $compiler static flag $lt_tmp_static_flag works... " >&6; } +if ${lt_cv_prog_compiler_static_works+:} false; then : + $as_echo_n "(cached) " >&6 +else + lt_cv_prog_compiler_static_works=no + save_LDFLAGS=$LDFLAGS + LDFLAGS="$LDFLAGS $lt_tmp_static_flag" + echo "$lt_simple_link_test_code" > conftest.$ac_ext + if (eval $ac_link 2>conftest.err) && test -s conftest$ac_exeext; then + # The linker can only warn and ignore the option if not recognized + # So say no if there are warnings + if test -s conftest.err; then + # Append any errors to the config.log. + cat conftest.err 1>&5 + $ECHO "$_lt_linker_boilerplate" | $SED '/^$/d' > conftest.exp + $SED '/^$/d; /^ *+/d' conftest.err >conftest.er2 + if diff conftest.exp conftest.er2 >/dev/null; then + lt_cv_prog_compiler_static_works=yes + fi + else + lt_cv_prog_compiler_static_works=yes + fi + fi + $RM -r conftest* + LDFLAGS=$save_LDFLAGS + +fi +{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $lt_cv_prog_compiler_static_works" >&5 +$as_echo "$lt_cv_prog_compiler_static_works" >&6; } + +if test yes = "$lt_cv_prog_compiler_static_works"; then + : +else + lt_prog_compiler_static= +fi + + + + + + + + { $as_echo "$as_me:${as_lineno-$LINENO}: checking if $compiler supports -c -o file.$ac_objext" >&5 +$as_echo_n "checking if $compiler supports -c -o file.$ac_objext... " >&6; } +if ${lt_cv_prog_compiler_c_o+:} false; then : + $as_echo_n "(cached) " >&6 +else + lt_cv_prog_compiler_c_o=no + $RM -r conftest 2>/dev/null + mkdir conftest + cd conftest + mkdir out + echo "$lt_simple_compile_test_code" > conftest.$ac_ext + + lt_compiler_flag="-o out/conftest2.$ac_objext" + # Insert the option either (1) after the last *FLAGS variable, or + # (2) before a word containing "conftest.", or (3) at the end. + # Note that $ac_compile itself does not contain backslashes and begins + # with a dollar sign (not a hyphen), so the echo should work correctly. + lt_compile=`echo "$ac_compile" | $SED \ + -e 's:.*FLAGS}\{0,1\} :&$lt_compiler_flag :; t' \ + -e 's: [^ ]*conftest\.: $lt_compiler_flag&:; t' \ + -e 's:$: $lt_compiler_flag:'` + (eval echo "\"\$as_me:$LINENO: $lt_compile\"" >&5) + (eval "$lt_compile" 2>out/conftest.err) + ac_status=$? + cat out/conftest.err >&5 + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + if (exit $ac_status) && test -s out/conftest2.$ac_objext + then + # The compiler can only warn and ignore the option if not recognized + # So say no if there are warnings + $ECHO "$_lt_compiler_boilerplate" | $SED '/^$/d' > out/conftest.exp + $SED '/^$/d; /^ *+/d' out/conftest.err >out/conftest.er2 + if test ! -s out/conftest.er2 || diff out/conftest.exp out/conftest.er2 >/dev/null; then + lt_cv_prog_compiler_c_o=yes + fi + fi + chmod u+w . 2>&5 + $RM conftest* + # SGI C++ compiler will create directory out/ii_files/ for + # template instantiation + test -d out/ii_files && $RM out/ii_files/* && rmdir out/ii_files + $RM out/* && rmdir out + cd .. + $RM -r conftest + $RM conftest* + +fi +{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $lt_cv_prog_compiler_c_o" >&5 +$as_echo "$lt_cv_prog_compiler_c_o" >&6; } + + + + + + + { $as_echo "$as_me:${as_lineno-$LINENO}: checking if $compiler supports -c -o file.$ac_objext" >&5 +$as_echo_n "checking if $compiler supports -c -o file.$ac_objext... " >&6; } +if ${lt_cv_prog_compiler_c_o+:} false; then : + $as_echo_n "(cached) " >&6 +else + lt_cv_prog_compiler_c_o=no + $RM -r conftest 2>/dev/null + mkdir conftest + cd conftest + mkdir out + echo "$lt_simple_compile_test_code" > conftest.$ac_ext + + lt_compiler_flag="-o out/conftest2.$ac_objext" + # Insert the option either (1) after the last *FLAGS variable, or + # (2) before a word containing "conftest.", or (3) at the end. + # Note that $ac_compile itself does not contain backslashes and begins + # with a dollar sign (not a hyphen), so the echo should work correctly. + lt_compile=`echo "$ac_compile" | $SED \ + -e 's:.*FLAGS}\{0,1\} :&$lt_compiler_flag :; t' \ + -e 's: [^ ]*conftest\.: $lt_compiler_flag&:; t' \ + -e 's:$: $lt_compiler_flag:'` + (eval echo "\"\$as_me:$LINENO: $lt_compile\"" >&5) + (eval "$lt_compile" 2>out/conftest.err) + ac_status=$? + cat out/conftest.err >&5 + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + if (exit $ac_status) && test -s out/conftest2.$ac_objext + then + # The compiler can only warn and ignore the option if not recognized + # So say no if there are warnings + $ECHO "$_lt_compiler_boilerplate" | $SED '/^$/d' > out/conftest.exp + $SED '/^$/d; /^ *+/d' out/conftest.err >out/conftest.er2 + if test ! -s out/conftest.er2 || diff out/conftest.exp out/conftest.er2 >/dev/null; then + lt_cv_prog_compiler_c_o=yes + fi + fi + chmod u+w . 2>&5 + $RM conftest* + # SGI C++ compiler will create directory out/ii_files/ for + # template instantiation + test -d out/ii_files && $RM out/ii_files/* && rmdir out/ii_files + $RM out/* && rmdir out + cd .. + $RM -r conftest + $RM conftest* + +fi +{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $lt_cv_prog_compiler_c_o" >&5 +$as_echo "$lt_cv_prog_compiler_c_o" >&6; } + + + + +hard_links=nottested +if test no = "$lt_cv_prog_compiler_c_o" && test no != "$need_locks"; then + # do not overwrite the value of need_locks provided by the user + { $as_echo "$as_me:${as_lineno-$LINENO}: checking if we can lock with hard links" >&5 +$as_echo_n "checking if we can lock with hard links... " >&6; } + hard_links=yes + $RM conftest* + ln conftest.a conftest.b 2>/dev/null && hard_links=no + touch conftest.a + ln conftest.a conftest.b 2>&5 || hard_links=no + ln conftest.a conftest.b 2>/dev/null && hard_links=no + { $as_echo "$as_me:${as_lineno-$LINENO}: result: $hard_links" >&5 +$as_echo "$hard_links" >&6; } + if test no = "$hard_links"; then + { $as_echo "$as_me:${as_lineno-$LINENO}: WARNING: '$CC' does not support '-c -o', so 'make -j' may be unsafe" >&5 +$as_echo "$as_me: WARNING: '$CC' does not support '-c -o', so 'make -j' may be unsafe" >&2;} + need_locks=warn + fi +else + need_locks=no +fi + + + + + + + { $as_echo "$as_me:${as_lineno-$LINENO}: checking whether the $compiler linker ($LD) supports shared libraries" >&5 +$as_echo_n "checking whether the $compiler linker ($LD) supports shared libraries... " >&6; } + + runpath_var= + allow_undefined_flag= + always_export_symbols=no + archive_cmds= + archive_expsym_cmds= + compiler_needs_object=no + enable_shared_with_static_runtimes=no + export_dynamic_flag_spec= + export_symbols_cmds='$NM $libobjs $convenience | $global_symbol_pipe | $SED '\''s/.* //'\'' | sort | uniq > $export_symbols' + hardcode_automatic=no + hardcode_direct=no + hardcode_direct_absolute=no + hardcode_libdir_flag_spec= + hardcode_libdir_separator= + hardcode_minus_L=no + hardcode_shlibpath_var=unsupported + inherit_rpath=no + link_all_deplibs=unknown + module_cmds= + module_expsym_cmds= + old_archive_from_new_cmds= + old_archive_from_expsyms_cmds= + thread_safe_flag_spec= + whole_archive_flag_spec= + # include_expsyms should be a list of space-separated symbols to be *always* + # included in the symbol list + include_expsyms= + # exclude_expsyms can be an extended regexp of symbols to exclude + # it will be wrapped by ' (' and ')$', so one must not match beginning or + # end of line. Example: 'a|bc|.*d.*' will exclude the symbols 'a' and 'bc', + # as well as any symbol that contains 'd'. + exclude_expsyms='_GLOBAL_OFFSET_TABLE_|_GLOBAL__F[ID]_.*' + # Although _GLOBAL_OFFSET_TABLE_ is a valid symbol C name, most a.out + # platforms (ab)use it in PIC code, but their linkers get confused if + # the symbol is explicitly referenced. Since portable code cannot + # rely on this symbol name, it's probably fine to never include it in + # preloaded symbol tables. + # Exclude shared library initialization/finalization symbols. + extract_expsyms_cmds= + + case $host_os in + cygwin* | mingw* | pw32* | cegcc*) + # FIXME: the MSVC++ port hasn't been tested in a loooong time + # When not using gcc, we currently assume that we are using + # Microsoft Visual C++. + if test yes != "$GCC"; then + with_gnu_ld=no + fi + ;; + interix*) + # we just hope/assume this is gcc and not c89 (= MSVC++) + with_gnu_ld=yes + ;; + openbsd* | bitrig*) + with_gnu_ld=no + ;; + esac + + ld_shlibs=yes + + # On some targets, GNU ld is compatible enough with the native linker + # that we're better off using the native interface for both. + lt_use_gnu_ld_interface=no + if test yes = "$with_gnu_ld"; then + case $host_os in + aix*) + # The AIX port of GNU ld has always aspired to compatibility + # with the native linker. However, as the warning in the GNU ld + # block says, versions before 2.19.5* couldn't really create working + # shared libraries, regardless of the interface used. + case `$LD -v 2>&1` in + *\ \(GNU\ Binutils\)\ 2.19.5*) ;; + *\ \(GNU\ Binutils\)\ 2.[2-9]*) ;; + *\ \(GNU\ Binutils\)\ [3-9]*) ;; + *) + lt_use_gnu_ld_interface=yes + ;; + esac + ;; + *) + lt_use_gnu_ld_interface=yes + ;; + esac + fi + + if test yes = "$lt_use_gnu_ld_interface"; then + # If archive_cmds runs LD, not CC, wlarc should be empty + wlarc='$wl' + + # Set some defaults for GNU ld with shared library support. These + # are reset later if shared libraries are not supported. Putting them + # here allows them to be overridden if necessary. + runpath_var=LD_RUN_PATH + hardcode_libdir_flag_spec='$wl-rpath $wl$libdir' + export_dynamic_flag_spec='$wl--export-dynamic' + # ancient GNU ld didn't support --whole-archive et. al. + if $LD --help 2>&1 | $GREP 'no-whole-archive' > /dev/null; then + whole_archive_flag_spec=$wlarc'--whole-archive$convenience '$wlarc'--no-whole-archive' + else + whole_archive_flag_spec= + fi + supports_anon_versioning=no + case `$LD -v | $SED -e 's/(^)\+)\s\+//' 2>&1` in + *GNU\ gold*) supports_anon_versioning=yes ;; + *\ [01].* | *\ 2.[0-9].* | *\ 2.10.*) ;; # catch versions < 2.11 + *\ 2.11.93.0.2\ *) supports_anon_versioning=yes ;; # RH7.3 ... + *\ 2.11.92.0.12\ *) supports_anon_versioning=yes ;; # Mandrake 8.2 ... + *\ 2.11.*) ;; # other 2.11 versions + *) supports_anon_versioning=yes ;; + esac + + # See if GNU ld supports shared libraries. + case $host_os in + aix[3-9]*) + # On AIX/PPC, the GNU linker is very broken + if test ia64 != "$host_cpu"; then + ld_shlibs=no + cat <<_LT_EOF 1>&2 + +*** Warning: the GNU linker, at least up to release 2.19, is reported +*** to be unable to reliably create shared libraries on AIX. +*** Therefore, libtool is disabling shared libraries support. If you +*** really care for shared libraries, you may want to install binutils +*** 2.20 or above, or modify your PATH so that a non-GNU linker is found. +*** You will then need to restart the configuration process. + +_LT_EOF + fi + ;; + + amigaos*) + case $host_cpu in + powerpc) + # see comment about AmigaOS4 .so support + archive_cmds='$CC -shared $libobjs $deplibs $compiler_flags $wl-soname $wl$soname -o $lib' + archive_expsym_cmds='' + ;; + m68k) + archive_cmds='$RM $output_objdir/a2ixlibrary.data~$ECHO "#define NAME $libname" > $output_objdir/a2ixlibrary.data~$ECHO "#define LIBRARY_ID 1" >> $output_objdir/a2ixlibrary.data~$ECHO "#define VERSION $major" >> $output_objdir/a2ixlibrary.data~$ECHO "#define REVISION $revision" >> $output_objdir/a2ixlibrary.data~$AR $AR_FLAGS $lib $libobjs~$RANLIB $lib~(cd $output_objdir && a2ixlibrary -32)' + hardcode_libdir_flag_spec='-L$libdir' + hardcode_minus_L=yes + ;; + esac + ;; + + beos*) + if $LD --help 2>&1 | $GREP ': supported targets:.* elf' > /dev/null; then + allow_undefined_flag=unsupported + # Joseph Beckenbach <jrb3@best.com> says some releases of gcc + # support --undefined. This deserves some investigation. FIXME + archive_cmds='$CC -nostart $libobjs $deplibs $compiler_flags $wl-soname $wl$soname -o $lib' + else + ld_shlibs=no + fi + ;; + + cygwin* | mingw* | pw32* | cegcc*) + # _LT_TAGVAR(hardcode_libdir_flag_spec, ) is actually meaningless, + # as there is no search path for DLLs. + hardcode_libdir_flag_spec='-L$libdir' + export_dynamic_flag_spec='$wl--export-all-symbols' + allow_undefined_flag=unsupported + always_export_symbols=no + enable_shared_with_static_runtimes=yes + export_symbols_cmds='$NM $libobjs $convenience | $global_symbol_pipe | $SED -e '\''/^[BCDGRS][ ]/s/.*[ ]\([^ ]*\)/\1 DATA/;s/^.*[ ]__nm__\([^ ]*\)[ ][^ ]*/\1 DATA/;/^I[ ]/d;/^[AITW][ ]/s/.* //'\'' | sort | uniq > $export_symbols' + exclude_expsyms='[_]+GLOBAL_OFFSET_TABLE_|[_]+GLOBAL__[FID]_.*|[_]+head_[A-Za-z0-9_]+_dll|[A-Za-z0-9_]+_dll_iname' + + if $LD --help 2>&1 | $GREP 'auto-import' > /dev/null; then + archive_cmds='$CC -shared $libobjs $deplibs $compiler_flags -o $output_objdir/$soname $wl--enable-auto-image-base -Xlinker --out-implib -Xlinker $lib' + # If the export-symbols file already is a .def file, use it as + # is; otherwise, prepend EXPORTS... + archive_expsym_cmds='if test DEF = "`$SED -n -e '\''s/^[ ]*//'\'' -e '\''/^\(;.*\)*$/d'\'' -e '\''s/^\(EXPORTS\|LIBRARY\)\([ ].*\)*$/DEF/p'\'' -e q $export_symbols`" ; then + cp $export_symbols $output_objdir/$soname.def; + else + echo EXPORTS > $output_objdir/$soname.def; + cat $export_symbols >> $output_objdir/$soname.def; + fi~ + $CC -shared $output_objdir/$soname.def $libobjs $deplibs $compiler_flags -o $output_objdir/$soname $wl--enable-auto-image-base -Xlinker --out-implib -Xlinker $lib' + else + ld_shlibs=no + fi + ;; + + haiku*) + archive_cmds='$CC -shared $libobjs $deplibs $compiler_flags $wl-soname $wl$soname -o $lib' + link_all_deplibs=yes + ;; + + os2*) + hardcode_libdir_flag_spec='-L$libdir' + hardcode_minus_L=yes + allow_undefined_flag=unsupported + shrext_cmds=.dll + archive_cmds='$ECHO "LIBRARY ${soname%$shared_ext} INITINSTANCE TERMINSTANCE" > $output_objdir/$libname.def~ + $ECHO "DESCRIPTION \"$libname\"" >> $output_objdir/$libname.def~ + $ECHO "DATA MULTIPLE NONSHARED" >> $output_objdir/$libname.def~ + $ECHO EXPORTS >> $output_objdir/$libname.def~ + emxexp $libobjs | $SED /"_DLL_InitTerm"/d >> $output_objdir/$libname.def~ + $CC -Zdll -Zcrtdll -o $output_objdir/$soname $libobjs $deplibs $compiler_flags $output_objdir/$libname.def~ + emximp -o $lib $output_objdir/$libname.def' + archive_expsym_cmds='$ECHO "LIBRARY ${soname%$shared_ext} INITINSTANCE TERMINSTANCE" > $output_objdir/$libname.def~ + $ECHO "DESCRIPTION \"$libname\"" >> $output_objdir/$libname.def~ + $ECHO "DATA MULTIPLE NONSHARED" >> $output_objdir/$libname.def~ + $ECHO EXPORTS >> $output_objdir/$libname.def~ + prefix_cmds="$SED"~ + if test EXPORTS = "`$SED 1q $export_symbols`"; then + prefix_cmds="$prefix_cmds -e 1d"; + fi~ + prefix_cmds="$prefix_cmds -e \"s/^\(.*\)$/_\1/g\""~ + cat $export_symbols | $prefix_cmds >> $output_objdir/$libname.def~ + $CC -Zdll -Zcrtdll -o $output_objdir/$soname $libobjs $deplibs $compiler_flags $output_objdir/$libname.def~ + emximp -o $lib $output_objdir/$libname.def' + old_archive_From_new_cmds='emximp -o $output_objdir/${libname}_dll.a $output_objdir/$libname.def' + enable_shared_with_static_runtimes=yes + ;; + + interix[3-9]*) + hardcode_direct=no + hardcode_shlibpath_var=no + hardcode_libdir_flag_spec='$wl-rpath,$libdir' + export_dynamic_flag_spec='$wl-E' + # Hack: On Interix 3.x, we cannot compile PIC because of a broken gcc. + # Instead, shared libraries are loaded at an image base (0x10000000 by + # default) and relocated if they conflict, which is a slow very memory + # consuming and fragmenting process. To avoid this, we pick a random, + # 256 KiB-aligned image base between 0x50000000 and 0x6FFC0000 at link + # time. Moving up from 0x10000000 also allows more sbrk(2) space. + archive_cmds='$CC -shared $pic_flag $libobjs $deplibs $compiler_flags $wl-h,$soname $wl--image-base,`expr ${RANDOM-$$} % 4096 / 2 \* 262144 + 1342177280` -o $lib' + archive_expsym_cmds='sed "s|^|_|" $export_symbols >$output_objdir/$soname.expsym~$CC -shared $pic_flag $libobjs $deplibs $compiler_flags $wl-h,$soname $wl--retain-symbols-file,$output_objdir/$soname.expsym $wl--image-base,`expr ${RANDOM-$$} % 4096 / 2 \* 262144 + 1342177280` -o $lib' + ;; + + gnu* | linux* | tpf* | k*bsd*-gnu | kopensolaris*-gnu) + tmp_diet=no + if test linux-dietlibc = "$host_os"; then + case $cc_basename in + diet\ *) tmp_diet=yes;; # linux-dietlibc with static linking (!diet-dyn) + esac + fi + if $LD --help 2>&1 | $EGREP ': supported targets:.* elf' > /dev/null \ + && test no = "$tmp_diet" + then + tmp_addflag=' $pic_flag' + tmp_sharedflag='-shared' + case $cc_basename,$host_cpu in + pgcc*) # Portland Group C compiler + whole_archive_flag_spec='$wl--whole-archive`for conv in $convenience\"\"; do test -n \"$conv\" && new_convenience=\"$new_convenience,$conv\"; done; func_echo_all \"$new_convenience\"` $wl--no-whole-archive' + tmp_addflag=' $pic_flag' + ;; + pgf77* | pgf90* | pgf95* | pgfortran*) + # Portland Group f77 and f90 compilers + whole_archive_flag_spec='$wl--whole-archive`for conv in $convenience\"\"; do test -n \"$conv\" && new_convenience=\"$new_convenience,$conv\"; done; func_echo_all \"$new_convenience\"` $wl--no-whole-archive' + tmp_addflag=' $pic_flag -Mnomain' ;; + ecc*,ia64* | icc*,ia64*) # Intel C compiler on ia64 + tmp_addflag=' -i_dynamic' ;; + efc*,ia64* | ifort*,ia64*) # Intel Fortran compiler on ia64 + tmp_addflag=' -i_dynamic -nofor_main' ;; + ifc* | ifort*) # Intel Fortran compiler + tmp_addflag=' -nofor_main' ;; + lf95*) # Lahey Fortran 8.1 + whole_archive_flag_spec= + tmp_sharedflag='--shared' ;; + nagfor*) # NAGFOR 5.3 + tmp_sharedflag='-Wl,-shared' ;; + xl[cC]* | bgxl[cC]* | mpixl[cC]*) # IBM XL C 8.0 on PPC (deal with xlf below) + tmp_sharedflag='-qmkshrobj' + tmp_addflag= ;; + nvcc*) # Cuda Compiler Driver 2.2 + whole_archive_flag_spec='$wl--whole-archive`for conv in $convenience\"\"; do test -n \"$conv\" && new_convenience=\"$new_convenience,$conv\"; done; func_echo_all \"$new_convenience\"` $wl--no-whole-archive' + compiler_needs_object=yes + ;; + esac + case `$CC -V 2>&1 | sed 5q` in + *Sun\ C*) # Sun C 5.9 + whole_archive_flag_spec='$wl--whole-archive`new_convenience=; for conv in $convenience\"\"; do test -z \"$conv\" || new_convenience=\"$new_convenience,$conv\"; done; func_echo_all \"$new_convenience\"` $wl--no-whole-archive' + compiler_needs_object=yes + tmp_sharedflag='-G' ;; + *Sun\ F*) # Sun Fortran 8.3 + tmp_sharedflag='-G' ;; + esac + archive_cmds='$CC '"$tmp_sharedflag""$tmp_addflag"' $libobjs $deplibs $compiler_flags $wl-soname $wl$soname -o $lib' + + if test yes = "$supports_anon_versioning"; then + archive_expsym_cmds='echo "{ global:" > $output_objdir/$libname.ver~ + cat $export_symbols | sed -e "s/\(.*\)/\1;/" >> $output_objdir/$libname.ver~ + echo "local: *; };" >> $output_objdir/$libname.ver~ + $CC '"$tmp_sharedflag""$tmp_addflag"' $libobjs $deplibs $compiler_flags $wl-soname $wl$soname $wl-version-script $wl$output_objdir/$libname.ver -o $lib' + fi + + case $cc_basename in + tcc*) + export_dynamic_flag_spec='-rdynamic' + ;; + xlf* | bgf* | bgxlf* | mpixlf*) + # IBM XL Fortran 10.1 on PPC cannot create shared libs itself + whole_archive_flag_spec='--whole-archive$convenience --no-whole-archive' + hardcode_libdir_flag_spec='$wl-rpath $wl$libdir' + archive_cmds='$LD -shared $libobjs $deplibs $linker_flags -soname $soname -o $lib' + if test yes = "$supports_anon_versioning"; then + archive_expsym_cmds='echo "{ global:" > $output_objdir/$libname.ver~ + cat $export_symbols | sed -e "s/\(.*\)/\1;/" >> $output_objdir/$libname.ver~ + echo "local: *; };" >> $output_objdir/$libname.ver~ + $LD -shared $libobjs $deplibs $linker_flags -soname $soname -version-script $output_objdir/$libname.ver -o $lib' + fi + ;; + esac + else + ld_shlibs=no + fi + ;; + + netbsd*) + if echo __ELF__ | $CC -E - | $GREP __ELF__ >/dev/null; then + archive_cmds='$LD -Bshareable $libobjs $deplibs $linker_flags -o $lib' + wlarc= + else + archive_cmds='$CC -shared $pic_flag $libobjs $deplibs $compiler_flags $wl-soname $wl$soname -o $lib' + archive_expsym_cmds='$CC -shared $pic_flag $libobjs $deplibs $compiler_flags $wl-soname $wl$soname $wl-retain-symbols-file $wl$export_symbols -o $lib' + fi + ;; + + solaris*) + if $LD -v 2>&1 | $GREP 'BFD 2\.8' > /dev/null; then + ld_shlibs=no + cat <<_LT_EOF 1>&2 + +*** Warning: The releases 2.8.* of the GNU linker cannot reliably +*** create shared libraries on Solaris systems. Therefore, libtool +*** is disabling shared libraries support. We urge you to upgrade GNU +*** binutils to release 2.9.1 or newer. Another option is to modify +*** your PATH or compiler configuration so that the native linker is +*** used, and then restart. + +_LT_EOF + elif $LD --help 2>&1 | $GREP ': supported targets:.* elf' > /dev/null; then + archive_cmds='$CC -shared $pic_flag $libobjs $deplibs $compiler_flags $wl-soname $wl$soname -o $lib' + archive_expsym_cmds='$CC -shared $pic_flag $libobjs $deplibs $compiler_flags $wl-soname $wl$soname $wl-retain-symbols-file $wl$export_symbols -o $lib' + else + ld_shlibs=no + fi + ;; + + sysv5* | sco3.2v5* | sco5v6* | unixware* | OpenUNIX*) + case `$LD -v 2>&1` in + *\ [01].* | *\ 2.[0-9].* | *\ 2.1[0-5].*) + ld_shlibs=no + cat <<_LT_EOF 1>&2 + +*** Warning: Releases of the GNU linker prior to 2.16.91.0.3 cannot +*** reliably create shared libraries on SCO systems. Therefore, libtool +*** is disabling shared libraries support. We urge you to upgrade GNU +*** binutils to release 2.16.91.0.3 or newer. Another option is to modify +*** your PATH or compiler configuration so that the native linker is +*** used, and then restart. + +_LT_EOF + ;; + *) + # For security reasons, it is highly recommended that you always + # use absolute paths for naming shared libraries, and exclude the + # DT_RUNPATH tag from executables and libraries. But doing so + # requires that you compile everything twice, which is a pain. + if $LD --help 2>&1 | $GREP ': supported targets:.* elf' > /dev/null; then + hardcode_libdir_flag_spec='$wl-rpath $wl$libdir' + archive_cmds='$CC -shared $libobjs $deplibs $compiler_flags $wl-soname $wl$soname -o $lib' + archive_expsym_cmds='$CC -shared $libobjs $deplibs $compiler_flags $wl-soname $wl$soname $wl-retain-symbols-file $wl$export_symbols -o $lib' + else + ld_shlibs=no + fi + ;; + esac + ;; + + sunos4*) + archive_cmds='$LD -assert pure-text -Bshareable -o $lib $libobjs $deplibs $linker_flags' + wlarc= + hardcode_direct=yes + hardcode_shlibpath_var=no + ;; + + *) + if $LD --help 2>&1 | $GREP ': supported targets:.* elf' > /dev/null; then + archive_cmds='$CC -shared $pic_flag $libobjs $deplibs $compiler_flags $wl-soname $wl$soname -o $lib' + archive_expsym_cmds='$CC -shared $pic_flag $libobjs $deplibs $compiler_flags $wl-soname $wl$soname $wl-retain-symbols-file $wl$export_symbols -o $lib' + else + ld_shlibs=no + fi + ;; + esac + + if test no = "$ld_shlibs"; then + runpath_var= + hardcode_libdir_flag_spec= + export_dynamic_flag_spec= + whole_archive_flag_spec= + fi + else + # PORTME fill in a description of your system's linker (not GNU ld) + case $host_os in + aix3*) + allow_undefined_flag=unsupported + always_export_symbols=yes + archive_expsym_cmds='$LD -o $output_objdir/$soname $libobjs $deplibs $linker_flags -bE:$export_symbols -T512 -H512 -bM:SRE~$AR $AR_FLAGS $lib $output_objdir/$soname' + # Note: this linker hardcodes the directories in LIBPATH if there + # are no directories specified by -L. + hardcode_minus_L=yes + if test yes = "$GCC" && test -z "$lt_prog_compiler_static"; then + # Neither direct hardcoding nor static linking is supported with a + # broken collect2. + hardcode_direct=unsupported + fi + ;; + + aix[4-9]*) + if test ia64 = "$host_cpu"; then + # On IA64, the linker does run time linking by default, so we don't + # have to do anything special. + aix_use_runtimelinking=no + exp_sym_flag='-Bexport' + no_entry_flag= + else + # If we're using GNU nm, then we don't want the "-C" option. + # -C means demangle to GNU nm, but means don't demangle to AIX nm. + # Without the "-l" option, or with the "-B" option, AIX nm treats + # weak defined symbols like other global defined symbols, whereas + # GNU nm marks them as "W". + # While the 'weak' keyword is ignored in the Export File, we need + # it in the Import File for the 'aix-soname' feature, so we have + # to replace the "-B" option with "-P" for AIX nm. + if $NM -V 2>&1 | $GREP 'GNU' > /dev/null; then + export_symbols_cmds='$NM -Bpg $libobjs $convenience | awk '\''{ if (((\$ 2 == "T") || (\$ 2 == "D") || (\$ 2 == "B") || (\$ 2 == "W")) && (substr(\$ 3,1,1) != ".")) { if (\$ 2 == "W") { print \$ 3 " weak" } else { print \$ 3 } } }'\'' | sort -u > $export_symbols' + else + export_symbols_cmds='`func_echo_all $NM | $SED -e '\''s/B\([^B]*\)$/P\1/'\''` -PCpgl $libobjs $convenience | awk '\''{ if (((\$ 2 == "T") || (\$ 2 == "D") || (\$ 2 == "B") || (\$ 2 == "W") || (\$ 2 == "V") || (\$ 2 == "Z")) && (substr(\$ 1,1,1) != ".")) { if ((\$ 2 == "W") || (\$ 2 == "V") || (\$ 2 == "Z")) { print \$ 1 " weak" } else { print \$ 1 } } }'\'' | sort -u > $export_symbols' + fi + aix_use_runtimelinking=no + + # Test if we are trying to use run time linking or normal + # AIX style linking. If -brtl is somewhere in LDFLAGS, we + # have runtime linking enabled, and use it for executables. + # For shared libraries, we enable/disable runtime linking + # depending on the kind of the shared library created - + # when "with_aix_soname,aix_use_runtimelinking" is: + # "aix,no" lib.a(lib.so.V) shared, rtl:no, for executables + # "aix,yes" lib.so shared, rtl:yes, for executables + # lib.a static archive + # "both,no" lib.so.V(shr.o) shared, rtl:yes + # lib.a(lib.so.V) shared, rtl:no, for executables + # "both,yes" lib.so.V(shr.o) shared, rtl:yes, for executables + # lib.a(lib.so.V) shared, rtl:no + # "svr4,*" lib.so.V(shr.o) shared, rtl:yes, for executables + # lib.a static archive + case $host_os in aix4.[23]|aix4.[23].*|aix[5-9]*) + for ld_flag in $LDFLAGS; do + if (test x-brtl = "x$ld_flag" || test x-Wl,-brtl = "x$ld_flag"); then + aix_use_runtimelinking=yes + break + fi + done + if test svr4,no = "$with_aix_soname,$aix_use_runtimelinking"; then + # With aix-soname=svr4, we create the lib.so.V shared archives only, + # so we don't have lib.a shared libs to link our executables. + # We have to force runtime linking in this case. + aix_use_runtimelinking=yes + LDFLAGS="$LDFLAGS -Wl,-brtl" + fi + ;; + esac + + exp_sym_flag='-bexport' + no_entry_flag='-bnoentry' + fi + + # When large executables or shared objects are built, AIX ld can + # have problems creating the table of contents. If linking a library + # or program results in "error TOC overflow" add -mminimal-toc to + # CXXFLAGS/CFLAGS for g++/gcc. In the cases where that is not + # enough to fix the problem, add -Wl,-bbigtoc to LDFLAGS. + + archive_cmds='' + hardcode_direct=yes + hardcode_direct_absolute=yes + hardcode_libdir_separator=':' + link_all_deplibs=yes + file_list_spec='$wl-f,' + case $with_aix_soname,$aix_use_runtimelinking in + aix,*) ;; # traditional, no import file + svr4,* | *,yes) # use import file + # The Import File defines what to hardcode. + hardcode_direct=no + hardcode_direct_absolute=no + ;; + esac + + if test yes = "$GCC"; then + case $host_os in aix4.[012]|aix4.[012].*) + # We only want to do this on AIX 4.2 and lower, the check + # below for broken collect2 doesn't work under 4.3+ + collect2name=`$CC -print-prog-name=collect2` + if test -f "$collect2name" && + strings "$collect2name" | $GREP resolve_lib_name >/dev/null + then + # We have reworked collect2 + : + else + # We have old collect2 + hardcode_direct=unsupported + # It fails to find uninstalled libraries when the uninstalled + # path is not listed in the libpath. Setting hardcode_minus_L + # to unsupported forces relinking + hardcode_minus_L=yes + hardcode_libdir_flag_spec='-L$libdir' + hardcode_libdir_separator= + fi + ;; + esac + shared_flag='-shared' + if test yes = "$aix_use_runtimelinking"; then + shared_flag="$shared_flag "'$wl-G' + fi + # Need to ensure runtime linking is disabled for the traditional + # shared library, or the linker may eventually find shared libraries + # /with/ Import File - we do not want to mix them. + shared_flag_aix='-shared' + shared_flag_svr4='-shared $wl-G' + else + # not using gcc + if test ia64 = "$host_cpu"; then + # VisualAge C++, Version 5.5 for AIX 5L for IA-64, Beta 3 Release + # chokes on -Wl,-G. The following line is correct: + shared_flag='-G' + else + if test yes = "$aix_use_runtimelinking"; then + shared_flag='$wl-G' + else + shared_flag='$wl-bM:SRE' + fi + shared_flag_aix='$wl-bM:SRE' + shared_flag_svr4='$wl-G' + fi + fi + + export_dynamic_flag_spec='$wl-bexpall' + # It seems that -bexpall does not export symbols beginning with + # underscore (_), so it is better to generate a list of symbols to export. + always_export_symbols=yes + if test aix,yes = "$with_aix_soname,$aix_use_runtimelinking"; then + # Warning - without using the other runtime loading flags (-brtl), + # -berok will link without error, but may produce a broken library. + allow_undefined_flag='-berok' + # Determine the default libpath from the value encoded in an + # empty executable. + if test set = "${lt_cv_aix_libpath+set}"; then + aix_libpath=$lt_cv_aix_libpath +else + if ${lt_cv_aix_libpath_+:} false; then : + $as_echo_n "(cached) " >&6 +else + cat confdefs.h - <<_ACEOF >conftest.$ac_ext +/* end confdefs.h. */ + +int +main () +{ + + ; + return 0; +} +_ACEOF +if ac_fn_c_try_link "$LINENO"; then : + + lt_aix_libpath_sed=' + /Import File Strings/,/^$/ { + /^0/ { + s/^0 *\([^ ]*\) *$/\1/ + p + } + }' + lt_cv_aix_libpath_=`dump -H conftest$ac_exeext 2>/dev/null | $SED -n -e "$lt_aix_libpath_sed"` + # Check for a 64-bit object if we didn't find anything. + if test -z "$lt_cv_aix_libpath_"; then + lt_cv_aix_libpath_=`dump -HX64 conftest$ac_exeext 2>/dev/null | $SED -n -e "$lt_aix_libpath_sed"` + fi +fi +rm -f core conftest.err conftest.$ac_objext \ + conftest$ac_exeext conftest.$ac_ext + if test -z "$lt_cv_aix_libpath_"; then + lt_cv_aix_libpath_=/usr/lib:/lib + fi + +fi + + aix_libpath=$lt_cv_aix_libpath_ +fi + + hardcode_libdir_flag_spec='$wl-blibpath:$libdir:'"$aix_libpath" + archive_expsym_cmds='$CC -o $output_objdir/$soname $libobjs $deplibs $wl'$no_entry_flag' $compiler_flags `if test -n "$allow_undefined_flag"; then func_echo_all "$wl$allow_undefined_flag"; else :; fi` $wl'$exp_sym_flag:\$export_symbols' '$shared_flag + else + if test ia64 = "$host_cpu"; then + hardcode_libdir_flag_spec='$wl-R $libdir:/usr/lib:/lib' + allow_undefined_flag="-z nodefs" + archive_expsym_cmds="\$CC $shared_flag"' -o $output_objdir/$soname $libobjs $deplibs '"\$wl$no_entry_flag"' $compiler_flags $wl$allow_undefined_flag '"\$wl$exp_sym_flag:\$export_symbols" + else + # Determine the default libpath from the value encoded in an + # empty executable. + if test set = "${lt_cv_aix_libpath+set}"; then + aix_libpath=$lt_cv_aix_libpath +else + if ${lt_cv_aix_libpath_+:} false; then : + $as_echo_n "(cached) " >&6 +else + cat confdefs.h - <<_ACEOF >conftest.$ac_ext +/* end confdefs.h. */ + +int +main () +{ + + ; + return 0; +} +_ACEOF +if ac_fn_c_try_link "$LINENO"; then : + + lt_aix_libpath_sed=' + /Import File Strings/,/^$/ { + /^0/ { + s/^0 *\([^ ]*\) *$/\1/ + p + } + }' + lt_cv_aix_libpath_=`dump -H conftest$ac_exeext 2>/dev/null | $SED -n -e "$lt_aix_libpath_sed"` + # Check for a 64-bit object if we didn't find anything. + if test -z "$lt_cv_aix_libpath_"; then + lt_cv_aix_libpath_=`dump -HX64 conftest$ac_exeext 2>/dev/null | $SED -n -e "$lt_aix_libpath_sed"` + fi +fi +rm -f core conftest.err conftest.$ac_objext \ + conftest$ac_exeext conftest.$ac_ext + if test -z "$lt_cv_aix_libpath_"; then + lt_cv_aix_libpath_=/usr/lib:/lib + fi + +fi + + aix_libpath=$lt_cv_aix_libpath_ +fi + + hardcode_libdir_flag_spec='$wl-blibpath:$libdir:'"$aix_libpath" + # Warning - without using the other run time loading flags, + # -berok will link without error, but may produce a broken library. + no_undefined_flag=' $wl-bernotok' + allow_undefined_flag=' $wl-berok' + if test yes = "$with_gnu_ld"; then + # We only use this code for GNU lds that support --whole-archive. + whole_archive_flag_spec='$wl--whole-archive$convenience $wl--no-whole-archive' + else + # Exported symbols can be pulled into shared objects from archives + whole_archive_flag_spec='$convenience' + fi + archive_cmds_need_lc=yes + archive_expsym_cmds='$RM -r $output_objdir/$realname.d~$MKDIR $output_objdir/$realname.d' + # -brtl affects multiple linker settings, -berok does not and is overridden later + compiler_flags_filtered='`func_echo_all "$compiler_flags " | $SED -e "s%-brtl\\([, ]\\)%-berok\\1%g"`' + if test svr4 != "$with_aix_soname"; then + # This is similar to how AIX traditionally builds its shared libraries. + archive_expsym_cmds="$archive_expsym_cmds"'~$CC '$shared_flag_aix' -o $output_objdir/$realname.d/$soname $libobjs $deplibs $wl-bnoentry '$compiler_flags_filtered'$wl-bE:$export_symbols$allow_undefined_flag~$AR $AR_FLAGS $output_objdir/$libname$release.a $output_objdir/$realname.d/$soname' + fi + if test aix != "$with_aix_soname"; then + archive_expsym_cmds="$archive_expsym_cmds"'~$CC '$shared_flag_svr4' -o $output_objdir/$realname.d/$shared_archive_member_spec.o $libobjs $deplibs $wl-bnoentry '$compiler_flags_filtered'$wl-bE:$export_symbols$allow_undefined_flag~$STRIP -e $output_objdir/$realname.d/$shared_archive_member_spec.o~( func_echo_all "#! $soname($shared_archive_member_spec.o)"; if test shr_64 = "$shared_archive_member_spec"; then func_echo_all "# 64"; else func_echo_all "# 32"; fi; cat $export_symbols ) > $output_objdir/$realname.d/$shared_archive_member_spec.imp~$AR $AR_FLAGS $output_objdir/$soname $output_objdir/$realname.d/$shared_archive_member_spec.o $output_objdir/$realname.d/$shared_archive_member_spec.imp' + else + # used by -dlpreopen to get the symbols + archive_expsym_cmds="$archive_expsym_cmds"'~$MV $output_objdir/$realname.d/$soname $output_objdir' + fi + archive_expsym_cmds="$archive_expsym_cmds"'~$RM -r $output_objdir/$realname.d' + fi + fi + ;; + + amigaos*) + case $host_cpu in + powerpc) + # see comment about AmigaOS4 .so support + archive_cmds='$CC -shared $libobjs $deplibs $compiler_flags $wl-soname $wl$soname -o $lib' + archive_expsym_cmds='' + ;; + m68k) + archive_cmds='$RM $output_objdir/a2ixlibrary.data~$ECHO "#define NAME $libname" > $output_objdir/a2ixlibrary.data~$ECHO "#define LIBRARY_ID 1" >> $output_objdir/a2ixlibrary.data~$ECHO "#define VERSION $major" >> $output_objdir/a2ixlibrary.data~$ECHO "#define REVISION $revision" >> $output_objdir/a2ixlibrary.data~$AR $AR_FLAGS $lib $libobjs~$RANLIB $lib~(cd $output_objdir && a2ixlibrary -32)' + hardcode_libdir_flag_spec='-L$libdir' + hardcode_minus_L=yes + ;; + esac + ;; + + bsdi[45]*) + export_dynamic_flag_spec=-rdynamic + ;; + + cygwin* | mingw* | pw32* | cegcc*) + # When not using gcc, we currently assume that we are using + # Microsoft Visual C++. + # hardcode_libdir_flag_spec is actually meaningless, as there is + # no search path for DLLs. + case $cc_basename in + cl*) + # Native MSVC + hardcode_libdir_flag_spec=' ' + allow_undefined_flag=unsupported + always_export_symbols=yes + file_list_spec='@' + # Tell ltmain to make .lib files, not .a files. + libext=lib + # Tell ltmain to make .dll files, not .so files. + shrext_cmds=.dll + # FIXME: Setting linknames here is a bad hack. + archive_cmds='$CC -o $output_objdir/$soname $libobjs $compiler_flags $deplibs -Wl,-DLL,-IMPLIB:"$tool_output_objdir$libname.dll.lib"~linknames=' + archive_expsym_cmds='if test DEF = "`$SED -n -e '\''s/^[ ]*//'\'' -e '\''/^\(;.*\)*$/d'\'' -e '\''s/^\(EXPORTS\|LIBRARY\)\([ ].*\)*$/DEF/p'\'' -e q $export_symbols`" ; then + cp "$export_symbols" "$output_objdir/$soname.def"; + echo "$tool_output_objdir$soname.def" > "$output_objdir/$soname.exp"; + else + $SED -e '\''s/^/-link -EXPORT:/'\'' < $export_symbols > $output_objdir/$soname.exp; + fi~ + $CC -o $tool_output_objdir$soname $libobjs $compiler_flags $deplibs "@$tool_output_objdir$soname.exp" -Wl,-DLL,-IMPLIB:"$tool_output_objdir$libname.dll.lib"~ + linknames=' + # The linker will not automatically build a static lib if we build a DLL. + # _LT_TAGVAR(old_archive_from_new_cmds, )='true' + enable_shared_with_static_runtimes=yes + exclude_expsyms='_NULL_IMPORT_DESCRIPTOR|_IMPORT_DESCRIPTOR_.*' + export_symbols_cmds='$NM $libobjs $convenience | $global_symbol_pipe | $SED -e '\''/^[BCDGRS][ ]/s/.*[ ]\([^ ]*\)/\1,DATA/'\'' | $SED -e '\''/^[AITW][ ]/s/.*[ ]//'\'' | sort | uniq > $export_symbols' + # Don't use ranlib + old_postinstall_cmds='chmod 644 $oldlib' + postlink_cmds='lt_outputfile="@OUTPUT@"~ + lt_tool_outputfile="@TOOL_OUTPUT@"~ + case $lt_outputfile in + *.exe|*.EXE) ;; + *) + lt_outputfile=$lt_outputfile.exe + lt_tool_outputfile=$lt_tool_outputfile.exe + ;; + esac~ + if test : != "$MANIFEST_TOOL" && test -f "$lt_outputfile.manifest"; then + $MANIFEST_TOOL -manifest "$lt_tool_outputfile.manifest" -outputresource:"$lt_tool_outputfile" || exit 1; + $RM "$lt_outputfile.manifest"; + fi' + ;; + *) + # Assume MSVC wrapper + hardcode_libdir_flag_spec=' ' + allow_undefined_flag=unsupported + # Tell ltmain to make .lib files, not .a files. + libext=lib + # Tell ltmain to make .dll files, not .so files. + shrext_cmds=.dll + # FIXME: Setting linknames here is a bad hack. + archive_cmds='$CC -o $lib $libobjs $compiler_flags `func_echo_all "$deplibs" | $SED '\''s/ -lc$//'\''` -link -dll~linknames=' + # The linker will automatically build a .lib file if we build a DLL. + old_archive_from_new_cmds='true' + # FIXME: Should let the user specify the lib program. + old_archive_cmds='lib -OUT:$oldlib$oldobjs$old_deplibs' + enable_shared_with_static_runtimes=yes + ;; + esac + ;; + + darwin* | rhapsody*) + + + archive_cmds_need_lc=no + hardcode_direct=no + hardcode_automatic=yes + hardcode_shlibpath_var=unsupported + if test yes = "$lt_cv_ld_force_load"; then + whole_archive_flag_spec='`for conv in $convenience\"\"; do test -n \"$conv\" && new_convenience=\"$new_convenience $wl-force_load,$conv\"; done; func_echo_all \"$new_convenience\"`' + + else + whole_archive_flag_spec='' + fi + link_all_deplibs=yes + allow_undefined_flag=$_lt_dar_allow_undefined + case $cc_basename in + ifort*|nagfor*) _lt_dar_can_shared=yes ;; + *) _lt_dar_can_shared=$GCC ;; + esac + if test yes = "$_lt_dar_can_shared"; then + output_verbose_link_cmd=func_echo_all + archive_cmds="\$CC -dynamiclib \$allow_undefined_flag -o \$lib \$libobjs \$deplibs \$compiler_flags -install_name \$rpath/\$soname \$verstring $_lt_dar_single_mod$_lt_dsymutil" + module_cmds="\$CC \$allow_undefined_flag -o \$lib -bundle \$libobjs \$deplibs \$compiler_flags$_lt_dsymutil" + archive_expsym_cmds="sed 's|^|_|' < \$export_symbols > \$output_objdir/\$libname-symbols.expsym~\$CC -dynamiclib \$allow_undefined_flag -o \$lib \$libobjs \$deplibs \$compiler_flags -install_name \$rpath/\$soname \$verstring $_lt_dar_single_mod$_lt_dar_export_syms$_lt_dsymutil" + module_expsym_cmds="sed -e 's|^|_|' < \$export_symbols > \$output_objdir/\$libname-symbols.expsym~\$CC \$allow_undefined_flag -o \$lib -bundle \$libobjs \$deplibs \$compiler_flags$_lt_dar_export_syms$_lt_dsymutil" + + else + ld_shlibs=no + fi + + ;; + + dgux*) + archive_cmds='$LD -G -h $soname -o $lib $libobjs $deplibs $linker_flags' + hardcode_libdir_flag_spec='-L$libdir' + hardcode_shlibpath_var=no + ;; + + # FreeBSD 2.2.[012] allows us to include c++rt0.o to get C++ constructor + # support. Future versions do this automatically, but an explicit c++rt0.o + # does not break anything, and helps significantly (at the cost of a little + # extra space). + freebsd2.2*) + archive_cmds='$LD -Bshareable -o $lib $libobjs $deplibs $linker_flags /usr/lib/c++rt0.o' + hardcode_libdir_flag_spec='-R$libdir' + hardcode_direct=yes + hardcode_shlibpath_var=no + ;; + + # Unfortunately, older versions of FreeBSD 2 do not have this feature. + freebsd2.*) + archive_cmds='$LD -Bshareable -o $lib $libobjs $deplibs $linker_flags' + hardcode_direct=yes + hardcode_minus_L=yes + hardcode_shlibpath_var=no + ;; + + # FreeBSD 3 and greater uses gcc -shared to do shared libraries. + freebsd* | dragonfly*) + archive_cmds='$CC -shared $pic_flag -o $lib $libobjs $deplibs $compiler_flags' + hardcode_libdir_flag_spec='-R$libdir' + hardcode_direct=yes + hardcode_shlibpath_var=no + ;; + + hpux9*) + if test yes = "$GCC"; then + archive_cmds='$RM $output_objdir/$soname~$CC -shared $pic_flag $wl+b $wl$install_libdir -o $output_objdir/$soname $libobjs $deplibs $compiler_flags~test "x$output_objdir/$soname" = "x$lib" || mv $output_objdir/$soname $lib' + else + archive_cmds='$RM $output_objdir/$soname~$LD -b +b $install_libdir -o $output_objdir/$soname $libobjs $deplibs $linker_flags~test "x$output_objdir/$soname" = "x$lib" || mv $output_objdir/$soname $lib' + fi + hardcode_libdir_flag_spec='$wl+b $wl$libdir' + hardcode_libdir_separator=: + hardcode_direct=yes + + # hardcode_minus_L: Not really in the search PATH, + # but as the default location of the library. + hardcode_minus_L=yes + export_dynamic_flag_spec='$wl-E' + ;; + + hpux10*) + if test yes,no = "$GCC,$with_gnu_ld"; then + archive_cmds='$CC -shared $pic_flag $wl+h $wl$soname $wl+b $wl$install_libdir -o $lib $libobjs $deplibs $compiler_flags' + else + archive_cmds='$LD -b +h $soname +b $install_libdir -o $lib $libobjs $deplibs $linker_flags' + fi + if test no = "$with_gnu_ld"; then + hardcode_libdir_flag_spec='$wl+b $wl$libdir' + hardcode_libdir_separator=: + hardcode_direct=yes + hardcode_direct_absolute=yes + export_dynamic_flag_spec='$wl-E' + # hardcode_minus_L: Not really in the search PATH, + # but as the default location of the library. + hardcode_minus_L=yes + fi + ;; + + hpux11*) + if test yes,no = "$GCC,$with_gnu_ld"; then + case $host_cpu in + hppa*64*) + archive_cmds='$CC -shared $wl+h $wl$soname -o $lib $libobjs $deplibs $compiler_flags' + ;; + ia64*) + archive_cmds='$CC -shared $pic_flag $wl+h $wl$soname $wl+nodefaultrpath -o $lib $libobjs $deplibs $compiler_flags' + ;; + *) + archive_cmds='$CC -shared $pic_flag $wl+h $wl$soname $wl+b $wl$install_libdir -o $lib $libobjs $deplibs $compiler_flags' + ;; + esac + else + case $host_cpu in + hppa*64*) + archive_cmds='$CC -b $wl+h $wl$soname -o $lib $libobjs $deplibs $compiler_flags' + ;; + ia64*) + archive_cmds='$CC -b $wl+h $wl$soname $wl+nodefaultrpath -o $lib $libobjs $deplibs $compiler_flags' + ;; + *) + + # Older versions of the 11.00 compiler do not understand -b yet + # (HP92453-01 A.11.01.20 doesn't, HP92453-01 B.11.X.35175-35176.GP does) + { $as_echo "$as_me:${as_lineno-$LINENO}: checking if $CC understands -b" >&5 +$as_echo_n "checking if $CC understands -b... " >&6; } +if ${lt_cv_prog_compiler__b+:} false; then : + $as_echo_n "(cached) " >&6 +else + lt_cv_prog_compiler__b=no + save_LDFLAGS=$LDFLAGS + LDFLAGS="$LDFLAGS -b" + echo "$lt_simple_link_test_code" > conftest.$ac_ext + if (eval $ac_link 2>conftest.err) && test -s conftest$ac_exeext; then + # The linker can only warn and ignore the option if not recognized + # So say no if there are warnings + if test -s conftest.err; then + # Append any errors to the config.log. + cat conftest.err 1>&5 + $ECHO "$_lt_linker_boilerplate" | $SED '/^$/d' > conftest.exp + $SED '/^$/d; /^ *+/d' conftest.err >conftest.er2 + if diff conftest.exp conftest.er2 >/dev/null; then + lt_cv_prog_compiler__b=yes + fi + else + lt_cv_prog_compiler__b=yes + fi + fi + $RM -r conftest* + LDFLAGS=$save_LDFLAGS + +fi +{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $lt_cv_prog_compiler__b" >&5 +$as_echo "$lt_cv_prog_compiler__b" >&6; } + +if test yes = "$lt_cv_prog_compiler__b"; then + archive_cmds='$CC -b $wl+h $wl$soname $wl+b $wl$install_libdir -o $lib $libobjs $deplibs $compiler_flags' +else + archive_cmds='$LD -b +h $soname +b $install_libdir -o $lib $libobjs $deplibs $linker_flags' +fi + + ;; + esac + fi + if test no = "$with_gnu_ld"; then + hardcode_libdir_flag_spec='$wl+b $wl$libdir' + hardcode_libdir_separator=: + + case $host_cpu in + hppa*64*|ia64*) + hardcode_direct=no + hardcode_shlibpath_var=no + ;; + *) + hardcode_direct=yes + hardcode_direct_absolute=yes + export_dynamic_flag_spec='$wl-E' + + # hardcode_minus_L: Not really in the search PATH, + # but as the default location of the library. + hardcode_minus_L=yes + ;; + esac + fi + ;; + + irix5* | irix6* | nonstopux*) + if test yes = "$GCC"; then + archive_cmds='$CC -shared $pic_flag $libobjs $deplibs $compiler_flags $wl-soname $wl$soname `test -n "$verstring" && func_echo_all "$wl-set_version $wl$verstring"` $wl-update_registry $wl$output_objdir/so_locations -o $lib' + # Try to use the -exported_symbol ld option, if it does not + # work, assume that -exports_file does not work either and + # implicitly export all symbols. + # This should be the same for all languages, so no per-tag cache variable. + { $as_echo "$as_me:${as_lineno-$LINENO}: checking whether the $host_os linker accepts -exported_symbol" >&5 +$as_echo_n "checking whether the $host_os linker accepts -exported_symbol... " >&6; } +if ${lt_cv_irix_exported_symbol+:} false; then : + $as_echo_n "(cached) " >&6 +else + save_LDFLAGS=$LDFLAGS + LDFLAGS="$LDFLAGS -shared $wl-exported_symbol ${wl}foo $wl-update_registry $wl/dev/null" + cat confdefs.h - <<_ACEOF >conftest.$ac_ext +/* end confdefs.h. */ +int foo (void) { return 0; } +_ACEOF +if ac_fn_c_try_link "$LINENO"; then : + lt_cv_irix_exported_symbol=yes +else + lt_cv_irix_exported_symbol=no +fi +rm -f core conftest.err conftest.$ac_objext \ + conftest$ac_exeext conftest.$ac_ext + LDFLAGS=$save_LDFLAGS +fi +{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $lt_cv_irix_exported_symbol" >&5 +$as_echo "$lt_cv_irix_exported_symbol" >&6; } + if test yes = "$lt_cv_irix_exported_symbol"; then + archive_expsym_cmds='$CC -shared $pic_flag $libobjs $deplibs $compiler_flags $wl-soname $wl$soname `test -n "$verstring" && func_echo_all "$wl-set_version $wl$verstring"` $wl-update_registry $wl$output_objdir/so_locations $wl-exports_file $wl$export_symbols -o $lib' + fi + else + archive_cmds='$CC -shared $libobjs $deplibs $compiler_flags -soname $soname `test -n "$verstring" && func_echo_all "-set_version $verstring"` -update_registry $output_objdir/so_locations -o $lib' + archive_expsym_cmds='$CC -shared $libobjs $deplibs $compiler_flags -soname $soname `test -n "$verstring" && func_echo_all "-set_version $verstring"` -update_registry $output_objdir/so_locations -exports_file $export_symbols -o $lib' + fi + archive_cmds_need_lc='no' + hardcode_libdir_flag_spec='$wl-rpath $wl$libdir' + hardcode_libdir_separator=: + inherit_rpath=yes + link_all_deplibs=yes + ;; + + linux*) + case $cc_basename in + tcc*) + # Fabrice Bellard et al's Tiny C Compiler + ld_shlibs=yes + archive_cmds='$CC -shared $pic_flag -o $lib $libobjs $deplibs $compiler_flags' + ;; + esac + ;; + + netbsd*) + if echo __ELF__ | $CC -E - | $GREP __ELF__ >/dev/null; then + archive_cmds='$LD -Bshareable -o $lib $libobjs $deplibs $linker_flags' # a.out + else + archive_cmds='$LD -shared -o $lib $libobjs $deplibs $linker_flags' # ELF + fi + hardcode_libdir_flag_spec='-R$libdir' + hardcode_direct=yes + hardcode_shlibpath_var=no + ;; + + newsos6) + archive_cmds='$LD -G -h $soname -o $lib $libobjs $deplibs $linker_flags' + hardcode_direct=yes + hardcode_libdir_flag_spec='$wl-rpath $wl$libdir' + hardcode_libdir_separator=: + hardcode_shlibpath_var=no + ;; + + *nto* | *qnx*) + ;; + + openbsd* | bitrig*) + if test -f /usr/libexec/ld.so; then + hardcode_direct=yes + hardcode_shlibpath_var=no + hardcode_direct_absolute=yes + if test -z "`echo __ELF__ | $CC -E - | $GREP __ELF__`"; then + archive_cmds='$CC -shared $pic_flag -o $lib $libobjs $deplibs $compiler_flags' + archive_expsym_cmds='$CC -shared $pic_flag -o $lib $libobjs $deplibs $compiler_flags $wl-retain-symbols-file,$export_symbols' + hardcode_libdir_flag_spec='$wl-rpath,$libdir' + export_dynamic_flag_spec='$wl-E' + else + archive_cmds='$CC -shared $pic_flag -o $lib $libobjs $deplibs $compiler_flags' + hardcode_libdir_flag_spec='$wl-rpath,$libdir' + fi + else + ld_shlibs=no + fi + ;; + + os2*) + hardcode_libdir_flag_spec='-L$libdir' + hardcode_minus_L=yes + allow_undefined_flag=unsupported + shrext_cmds=.dll + archive_cmds='$ECHO "LIBRARY ${soname%$shared_ext} INITINSTANCE TERMINSTANCE" > $output_objdir/$libname.def~ + $ECHO "DESCRIPTION \"$libname\"" >> $output_objdir/$libname.def~ + $ECHO "DATA MULTIPLE NONSHARED" >> $output_objdir/$libname.def~ + $ECHO EXPORTS >> $output_objdir/$libname.def~ + emxexp $libobjs | $SED /"_DLL_InitTerm"/d >> $output_objdir/$libname.def~ + $CC -Zdll -Zcrtdll -o $output_objdir/$soname $libobjs $deplibs $compiler_flags $output_objdir/$libname.def~ + emximp -o $lib $output_objdir/$libname.def' + archive_expsym_cmds='$ECHO "LIBRARY ${soname%$shared_ext} INITINSTANCE TERMINSTANCE" > $output_objdir/$libname.def~ + $ECHO "DESCRIPTION \"$libname\"" >> $output_objdir/$libname.def~ + $ECHO "DATA MULTIPLE NONSHARED" >> $output_objdir/$libname.def~ + $ECHO EXPORTS >> $output_objdir/$libname.def~ + prefix_cmds="$SED"~ + if test EXPORTS = "`$SED 1q $export_symbols`"; then + prefix_cmds="$prefix_cmds -e 1d"; + fi~ + prefix_cmds="$prefix_cmds -e \"s/^\(.*\)$/_\1/g\""~ + cat $export_symbols | $prefix_cmds >> $output_objdir/$libname.def~ + $CC -Zdll -Zcrtdll -o $output_objdir/$soname $libobjs $deplibs $compiler_flags $output_objdir/$libname.def~ + emximp -o $lib $output_objdir/$libname.def' + old_archive_From_new_cmds='emximp -o $output_objdir/${libname}_dll.a $output_objdir/$libname.def' + enable_shared_with_static_runtimes=yes + ;; + + osf3*) + if test yes = "$GCC"; then + allow_undefined_flag=' $wl-expect_unresolved $wl\*' + archive_cmds='$CC -shared$allow_undefined_flag $libobjs $deplibs $compiler_flags $wl-soname $wl$soname `test -n "$verstring" && func_echo_all "$wl-set_version $wl$verstring"` $wl-update_registry $wl$output_objdir/so_locations -o $lib' + else + allow_undefined_flag=' -expect_unresolved \*' + archive_cmds='$CC -shared$allow_undefined_flag $libobjs $deplibs $compiler_flags -soname $soname `test -n "$verstring" && func_echo_all "-set_version $verstring"` -update_registry $output_objdir/so_locations -o $lib' + fi + archive_cmds_need_lc='no' + hardcode_libdir_flag_spec='$wl-rpath $wl$libdir' + hardcode_libdir_separator=: + ;; + + osf4* | osf5*) # as osf3* with the addition of -msym flag + if test yes = "$GCC"; then + allow_undefined_flag=' $wl-expect_unresolved $wl\*' + archive_cmds='$CC -shared$allow_undefined_flag $pic_flag $libobjs $deplibs $compiler_flags $wl-msym $wl-soname $wl$soname `test -n "$verstring" && func_echo_all "$wl-set_version $wl$verstring"` $wl-update_registry $wl$output_objdir/so_locations -o $lib' + hardcode_libdir_flag_spec='$wl-rpath $wl$libdir' + else + allow_undefined_flag=' -expect_unresolved \*' + archive_cmds='$CC -shared$allow_undefined_flag $libobjs $deplibs $compiler_flags -msym -soname $soname `test -n "$verstring" && func_echo_all "-set_version $verstring"` -update_registry $output_objdir/so_locations -o $lib' + archive_expsym_cmds='for i in `cat $export_symbols`; do printf "%s %s\\n" -exported_symbol "\$i" >> $lib.exp; done; printf "%s\\n" "-hidden">> $lib.exp~ + $CC -shared$allow_undefined_flag $wl-input $wl$lib.exp $compiler_flags $libobjs $deplibs -soname $soname `test -n "$verstring" && $ECHO "-set_version $verstring"` -update_registry $output_objdir/so_locations -o $lib~$RM $lib.exp' + + # Both c and cxx compiler support -rpath directly + hardcode_libdir_flag_spec='-rpath $libdir' + fi + archive_cmds_need_lc='no' + hardcode_libdir_separator=: + ;; + + solaris*) + no_undefined_flag=' -z defs' + if test yes = "$GCC"; then + wlarc='$wl' + archive_cmds='$CC -shared $pic_flag $wl-z ${wl}text $wl-h $wl$soname -o $lib $libobjs $deplibs $compiler_flags' + archive_expsym_cmds='echo "{ global:" > $lib.exp~cat $export_symbols | $SED -e "s/\(.*\)/\1;/" >> $lib.exp~echo "local: *; };" >> $lib.exp~ + $CC -shared $pic_flag $wl-z ${wl}text $wl-M $wl$lib.exp $wl-h $wl$soname -o $lib $libobjs $deplibs $compiler_flags~$RM $lib.exp' + else + case `$CC -V 2>&1` in + *"Compilers 5.0"*) + wlarc='' + archive_cmds='$LD -G$allow_undefined_flag -h $soname -o $lib $libobjs $deplibs $linker_flags' + archive_expsym_cmds='echo "{ global:" > $lib.exp~cat $export_symbols | $SED -e "s/\(.*\)/\1;/" >> $lib.exp~echo "local: *; };" >> $lib.exp~ + $LD -G$allow_undefined_flag -M $lib.exp -h $soname -o $lib $libobjs $deplibs $linker_flags~$RM $lib.exp' + ;; + *) + wlarc='$wl' + archive_cmds='$CC -G$allow_undefined_flag -h $soname -o $lib $libobjs $deplibs $compiler_flags' + archive_expsym_cmds='echo "{ global:" > $lib.exp~cat $export_symbols | $SED -e "s/\(.*\)/\1;/" >> $lib.exp~echo "local: *; };" >> $lib.exp~ + $CC -G$allow_undefined_flag -M $lib.exp -h $soname -o $lib $libobjs $deplibs $compiler_flags~$RM $lib.exp' + ;; + esac + fi + hardcode_libdir_flag_spec='-R$libdir' + hardcode_shlibpath_var=no + case $host_os in + solaris2.[0-5] | solaris2.[0-5].*) ;; + *) + # The compiler driver will combine and reorder linker options, + # but understands '-z linker_flag'. GCC discards it without '$wl', + # but is careful enough not to reorder. + # Supported since Solaris 2.6 (maybe 2.5.1?) + if test yes = "$GCC"; then + whole_archive_flag_spec='$wl-z ${wl}allextract$convenience $wl-z ${wl}defaultextract' + else + whole_archive_flag_spec='-z allextract$convenience -z defaultextract' + fi + ;; + esac + link_all_deplibs=yes + ;; + + sunos4*) + if test sequent = "$host_vendor"; then + # Use $CC to link under sequent, because it throws in some extra .o + # files that make .init and .fini sections work. + archive_cmds='$CC -G $wl-h $soname -o $lib $libobjs $deplibs $compiler_flags' + else + archive_cmds='$LD -assert pure-text -Bstatic -o $lib $libobjs $deplibs $linker_flags' + fi + hardcode_libdir_flag_spec='-L$libdir' + hardcode_direct=yes + hardcode_minus_L=yes + hardcode_shlibpath_var=no + ;; + + sysv4) + case $host_vendor in + sni) + archive_cmds='$LD -G -h $soname -o $lib $libobjs $deplibs $linker_flags' + hardcode_direct=yes # is this really true??? + ;; + siemens) + ## LD is ld it makes a PLAMLIB + ## CC just makes a GrossModule. + archive_cmds='$LD -G -o $lib $libobjs $deplibs $linker_flags' + reload_cmds='$CC -r -o $output$reload_objs' + hardcode_direct=no + ;; + motorola) + archive_cmds='$LD -G -h $soname -o $lib $libobjs $deplibs $linker_flags' + hardcode_direct=no #Motorola manual says yes, but my tests say they lie + ;; + esac + runpath_var='LD_RUN_PATH' + hardcode_shlibpath_var=no + ;; + + sysv4.3*) + archive_cmds='$LD -G -h $soname -o $lib $libobjs $deplibs $linker_flags' + hardcode_shlibpath_var=no + export_dynamic_flag_spec='-Bexport' + ;; + + sysv4*MP*) + if test -d /usr/nec; then + archive_cmds='$LD -G -h $soname -o $lib $libobjs $deplibs $linker_flags' + hardcode_shlibpath_var=no + runpath_var=LD_RUN_PATH + hardcode_runpath_var=yes + ld_shlibs=yes + fi + ;; + + sysv4*uw2* | sysv5OpenUNIX* | sysv5UnixWare7.[01].[10]* | unixware7* | sco3.2v5.0.[024]*) + no_undefined_flag='$wl-z,text' + archive_cmds_need_lc=no + hardcode_shlibpath_var=no + runpath_var='LD_RUN_PATH' + + if test yes = "$GCC"; then + archive_cmds='$CC -shared $wl-h,$soname -o $lib $libobjs $deplibs $compiler_flags' + archive_expsym_cmds='$CC -shared $wl-Bexport:$export_symbols $wl-h,$soname -o $lib $libobjs $deplibs $compiler_flags' + else + archive_cmds='$CC -G $wl-h,$soname -o $lib $libobjs $deplibs $compiler_flags' + archive_expsym_cmds='$CC -G $wl-Bexport:$export_symbols $wl-h,$soname -o $lib $libobjs $deplibs $compiler_flags' + fi + ;; + + sysv5* | sco3.2v5* | sco5v6*) + # Note: We CANNOT use -z defs as we might desire, because we do not + # link with -lc, and that would cause any symbols used from libc to + # always be unresolved, which means just about no library would + # ever link correctly. If we're not using GNU ld we use -z text + # though, which does catch some bad symbols but isn't as heavy-handed + # as -z defs. + no_undefined_flag='$wl-z,text' + allow_undefined_flag='$wl-z,nodefs' + archive_cmds_need_lc=no + hardcode_shlibpath_var=no + hardcode_libdir_flag_spec='$wl-R,$libdir' + hardcode_libdir_separator=':' + link_all_deplibs=yes + export_dynamic_flag_spec='$wl-Bexport' + runpath_var='LD_RUN_PATH' + + if test yes = "$GCC"; then + archive_cmds='$CC -shared $wl-h,$soname -o $lib $libobjs $deplibs $compiler_flags' + archive_expsym_cmds='$CC -shared $wl-Bexport:$export_symbols $wl-h,$soname -o $lib $libobjs $deplibs $compiler_flags' + else + archive_cmds='$CC -G $wl-h,$soname -o $lib $libobjs $deplibs $compiler_flags' + archive_expsym_cmds='$CC -G $wl-Bexport:$export_symbols $wl-h,$soname -o $lib $libobjs $deplibs $compiler_flags' + fi + ;; + + uts4*) + archive_cmds='$LD -G -h $soname -o $lib $libobjs $deplibs $linker_flags' + hardcode_libdir_flag_spec='-L$libdir' + hardcode_shlibpath_var=no + ;; + + *) + ld_shlibs=no + ;; + esac + + if test sni = "$host_vendor"; then + case $host in + sysv4 | sysv4.2uw2* | sysv4.3* | sysv5*) + export_dynamic_flag_spec='$wl-Blargedynsym' + ;; + esac + fi + fi + +{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $ld_shlibs" >&5 +$as_echo "$ld_shlibs" >&6; } +test no = "$ld_shlibs" && can_build_shared=no + +with_gnu_ld=$with_gnu_ld + + + + + + + + + + + + + + + +# +# Do we need to explicitly link libc? +# +case "x$archive_cmds_need_lc" in +x|xyes) + # Assume -lc should be added + archive_cmds_need_lc=yes + + if test yes,yes = "$GCC,$enable_shared"; then + case $archive_cmds in + *'~'*) + # FIXME: we may have to deal with multi-command sequences. + ;; + '$CC '*) + # Test whether the compiler implicitly links with -lc since on some + # systems, -lgcc has to come before -lc. If gcc already passes -lc + # to ld, don't add -lc before -lgcc. + { $as_echo "$as_me:${as_lineno-$LINENO}: checking whether -lc should be explicitly linked in" >&5 +$as_echo_n "checking whether -lc should be explicitly linked in... " >&6; } +if ${lt_cv_archive_cmds_need_lc+:} false; then : + $as_echo_n "(cached) " >&6 +else + $RM conftest* + echo "$lt_simple_compile_test_code" > conftest.$ac_ext + + if { { eval echo "\"\$as_me\":${as_lineno-$LINENO}: \"$ac_compile\""; } >&5 + (eval $ac_compile) 2>&5 + ac_status=$? + $as_echo "$as_me:${as_lineno-$LINENO}: \$? = $ac_status" >&5 + test $ac_status = 0; } 2>conftest.err; then + soname=conftest + lib=conftest + libobjs=conftest.$ac_objext + deplibs= + wl=$lt_prog_compiler_wl + pic_flag=$lt_prog_compiler_pic + compiler_flags=-v + linker_flags=-v + verstring= + output_objdir=. + libname=conftest + lt_save_allow_undefined_flag=$allow_undefined_flag + allow_undefined_flag= + if { { eval echo "\"\$as_me\":${as_lineno-$LINENO}: \"$archive_cmds 2\>\&1 \| $GREP \" -lc \" \>/dev/null 2\>\&1\""; } >&5 + (eval $archive_cmds 2\>\&1 \| $GREP \" -lc \" \>/dev/null 2\>\&1) 2>&5 + ac_status=$? + $as_echo "$as_me:${as_lineno-$LINENO}: \$? = $ac_status" >&5 + test $ac_status = 0; } + then + lt_cv_archive_cmds_need_lc=no + else + lt_cv_archive_cmds_need_lc=yes + fi + allow_undefined_flag=$lt_save_allow_undefined_flag + else + cat conftest.err 1>&5 + fi + $RM conftest* + +fi +{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $lt_cv_archive_cmds_need_lc" >&5 +$as_echo "$lt_cv_archive_cmds_need_lc" >&6; } + archive_cmds_need_lc=$lt_cv_archive_cmds_need_lc + ;; + esac + fi + ;; +esac + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + { $as_echo "$as_me:${as_lineno-$LINENO}: checking dynamic linker characteristics" >&5 +$as_echo_n "checking dynamic linker characteristics... " >&6; } + +if test yes = "$GCC"; then + case $host_os in + darwin*) lt_awk_arg='/^libraries:/,/LR/' ;; + *) lt_awk_arg='/^libraries:/' ;; + esac + case $host_os in + mingw* | cegcc*) lt_sed_strip_eq='s|=\([A-Za-z]:\)|\1|g' ;; + *) lt_sed_strip_eq='s|=/|/|g' ;; + esac + lt_search_path_spec=`$CC -print-search-dirs | awk $lt_awk_arg | $SED -e "s/^libraries://" -e $lt_sed_strip_eq` + case $lt_search_path_spec in + *\;*) + # if the path contains ";" then we assume it to be the separator + # otherwise default to the standard path separator (i.e. ":") - it is + # assumed that no part of a normal pathname contains ";" but that should + # okay in the real world where ";" in dirpaths is itself problematic. + lt_search_path_spec=`$ECHO "$lt_search_path_spec" | $SED 's/;/ /g'` + ;; + *) + lt_search_path_spec=`$ECHO "$lt_search_path_spec" | $SED "s/$PATH_SEPARATOR/ /g"` + ;; + esac + # Ok, now we have the path, separated by spaces, we can step through it + # and add multilib dir if necessary... + lt_tmp_lt_search_path_spec= + lt_multi_os_dir=/`$CC $CPPFLAGS $CFLAGS $LDFLAGS -print-multi-os-directory 2>/dev/null` + # ...but if some path component already ends with the multilib dir we assume + # that all is fine and trust -print-search-dirs as is (GCC 4.2? or newer). + case "$lt_multi_os_dir; $lt_search_path_spec " in + "/; "* | "/.; "* | "/./; "* | *"$lt_multi_os_dir "* | *"$lt_multi_os_dir/ "*) + lt_multi_os_dir= + ;; + esac + for lt_sys_path in $lt_search_path_spec; do + if test -d "$lt_sys_path$lt_multi_os_dir"; then + lt_tmp_lt_search_path_spec="$lt_tmp_lt_search_path_spec $lt_sys_path$lt_multi_os_dir" + elif test -n "$lt_multi_os_dir"; then + test -d "$lt_sys_path" && \ + lt_tmp_lt_search_path_spec="$lt_tmp_lt_search_path_spec $lt_sys_path" + fi + done + lt_search_path_spec=`$ECHO "$lt_tmp_lt_search_path_spec" | awk ' +BEGIN {RS = " "; FS = "/|\n";} { + lt_foo = ""; + lt_count = 0; + for (lt_i = NF; lt_i > 0; lt_i--) { + if ($lt_i != "" && $lt_i != ".") { + if ($lt_i == "..") { + lt_count++; + } else { + if (lt_count == 0) { + lt_foo = "/" $lt_i lt_foo; + } else { + lt_count--; + } + } + } + } + if (lt_foo != "") { lt_freq[lt_foo]++; } + if (lt_freq[lt_foo] == 1) { print lt_foo; } +}'` + # AWK program above erroneously prepends '/' to C:/dos/paths + # for these hosts. + case $host_os in + mingw* | cegcc*) lt_search_path_spec=`$ECHO "$lt_search_path_spec" |\ + $SED 's|/\([A-Za-z]:\)|\1|g'` ;; + esac + sys_lib_search_path_spec=`$ECHO "$lt_search_path_spec" | $lt_NL2SP` +else + sys_lib_search_path_spec="/lib /usr/lib /usr/local/lib" +fi +library_names_spec= +libname_spec='lib$name' +soname_spec= +shrext_cmds=.so +postinstall_cmds= +postuninstall_cmds= +finish_cmds= +finish_eval= +shlibpath_var= +shlibpath_overrides_runpath=unknown +version_type=none +dynamic_linker="$host_os ld.so" +sys_lib_dlsearch_path_spec="/lib /usr/lib" +need_lib_prefix=unknown +hardcode_into_libs=no + +# when you set need_version to no, make sure it does not cause -set_version +# flags to be left without arguments +need_version=unknown + + + +case $host_os in +aix3*) + version_type=linux # correct to gnu/linux during the next big refactor + library_names_spec='$libname$release$shared_ext$versuffix $libname.a' + shlibpath_var=LIBPATH + + # AIX 3 has no versioning support, so we append a major version to the name. + soname_spec='$libname$release$shared_ext$major' + ;; + +aix[4-9]*) + version_type=linux # correct to gnu/linux during the next big refactor + need_lib_prefix=no + need_version=no + hardcode_into_libs=yes + if test ia64 = "$host_cpu"; then + # AIX 5 supports IA64 + library_names_spec='$libname$release$shared_ext$major $libname$release$shared_ext$versuffix $libname$shared_ext' + shlibpath_var=LD_LIBRARY_PATH + else + # With GCC up to 2.95.x, collect2 would create an import file + # for dependence libraries. The import file would start with + # the line '#! .'. This would cause the generated library to + # depend on '.', always an invalid library. This was fixed in + # development snapshots of GCC prior to 3.0. + case $host_os in + aix4 | aix4.[01] | aix4.[01].*) + if { echo '#if __GNUC__ > 2 || (__GNUC__ == 2 && __GNUC_MINOR__ >= 97)' + echo ' yes ' + echo '#endif'; } | $CC -E - | $GREP yes > /dev/null; then + : + else + can_build_shared=no + fi + ;; + esac + # Using Import Files as archive members, it is possible to support + # filename-based versioning of shared library archives on AIX. While + # this would work for both with and without runtime linking, it will + # prevent static linking of such archives. So we do filename-based + # shared library versioning with .so extension only, which is used + # when both runtime linking and shared linking is enabled. + # Unfortunately, runtime linking may impact performance, so we do + # not want this to be the default eventually. Also, we use the + # versioned .so libs for executables only if there is the -brtl + # linker flag in LDFLAGS as well, or --with-aix-soname=svr4 only. + # To allow for filename-based versioning support, we need to create + # libNAME.so.V as an archive file, containing: + # *) an Import File, referring to the versioned filename of the + # archive as well as the shared archive member, telling the + # bitwidth (32 or 64) of that shared object, and providing the + # list of exported symbols of that shared object, eventually + # decorated with the 'weak' keyword + # *) the shared object with the F_LOADONLY flag set, to really avoid + # it being seen by the linker. + # At run time we better use the real file rather than another symlink, + # but for link time we create the symlink libNAME.so -> libNAME.so.V + + case $with_aix_soname,$aix_use_runtimelinking in + # AIX (on Power*) has no versioning support, so currently we cannot hardcode correct + # soname into executable. Probably we can add versioning support to + # collect2, so additional links can be useful in future. + aix,yes) # traditional libtool + dynamic_linker='AIX unversionable lib.so' + # If using run time linking (on AIX 4.2 or later) use lib<name>.so + # instead of lib<name>.a to let people know that these are not + # typical AIX shared libraries. + library_names_spec='$libname$release$shared_ext$versuffix $libname$release$shared_ext$major $libname$shared_ext' + ;; + aix,no) # traditional AIX only + dynamic_linker='AIX lib.a(lib.so.V)' + # We preserve .a as extension for shared libraries through AIX4.2 + # and later when we are not doing run time linking. + library_names_spec='$libname$release.a $libname.a' + soname_spec='$libname$release$shared_ext$major' + ;; + svr4,*) # full svr4 only + dynamic_linker="AIX lib.so.V($shared_archive_member_spec.o)" + library_names_spec='$libname$release$shared_ext$major $libname$shared_ext' + # We do not specify a path in Import Files, so LIBPATH fires. + shlibpath_overrides_runpath=yes + ;; + *,yes) # both, prefer svr4 + dynamic_linker="AIX lib.so.V($shared_archive_member_spec.o), lib.a(lib.so.V)" + library_names_spec='$libname$release$shared_ext$major $libname$shared_ext' + # unpreferred sharedlib libNAME.a needs extra handling + postinstall_cmds='test -n "$linkname" || linkname="$realname"~func_stripname "" ".so" "$linkname"~$install_shared_prog "$dir/$func_stripname_result.$libext" "$destdir/$func_stripname_result.$libext"~test -z "$tstripme" || test -z "$striplib" || $striplib "$destdir/$func_stripname_result.$libext"' + postuninstall_cmds='for n in $library_names $old_library; do :; done~func_stripname "" ".so" "$n"~test "$func_stripname_result" = "$n" || func_append rmfiles " $odir/$func_stripname_result.$libext"' + # We do not specify a path in Import Files, so LIBPATH fires. + shlibpath_overrides_runpath=yes + ;; + *,no) # both, prefer aix + dynamic_linker="AIX lib.a(lib.so.V), lib.so.V($shared_archive_member_spec.o)" + library_names_spec='$libname$release.a $libname.a' + soname_spec='$libname$release$shared_ext$major' + # unpreferred sharedlib libNAME.so.V and symlink libNAME.so need extra handling + postinstall_cmds='test -z "$dlname" || $install_shared_prog $dir/$dlname $destdir/$dlname~test -z "$tstripme" || test -z "$striplib" || $striplib $destdir/$dlname~test -n "$linkname" || linkname=$realname~func_stripname "" ".a" "$linkname"~(cd "$destdir" && $LN_S -f $dlname $func_stripname_result.so)' + postuninstall_cmds='test -z "$dlname" || func_append rmfiles " $odir/$dlname"~for n in $old_library $library_names; do :; done~func_stripname "" ".a" "$n"~func_append rmfiles " $odir/$func_stripname_result.so"' + ;; + esac + shlibpath_var=LIBPATH + fi + ;; + +amigaos*) + case $host_cpu in + powerpc) + # Since July 2007 AmigaOS4 officially supports .so libraries. + # When compiling the executable, add -use-dynld -Lsobjs: to the compileline. + library_names_spec='$libname$release$shared_ext$versuffix $libname$release$shared_ext$major $libname$shared_ext' + ;; + m68k) + library_names_spec='$libname.ixlibrary $libname.a' + # Create ${libname}_ixlibrary.a entries in /sys/libs. + finish_eval='for lib in `ls $libdir/*.ixlibrary 2>/dev/null`; do libname=`func_echo_all "$lib" | $SED '\''s%^.*/\([^/]*\)\.ixlibrary$%\1%'\''`; $RM /sys/libs/${libname}_ixlibrary.a; $show "cd /sys/libs && $LN_S $lib ${libname}_ixlibrary.a"; cd /sys/libs && $LN_S $lib ${libname}_ixlibrary.a || exit 1; done' + ;; + esac + ;; + +beos*) + library_names_spec='$libname$shared_ext' + dynamic_linker="$host_os ld.so" + shlibpath_var=LIBRARY_PATH + ;; + +bsdi[45]*) + version_type=linux # correct to gnu/linux during the next big refactor + need_version=no + library_names_spec='$libname$release$shared_ext$versuffix $libname$release$shared_ext$major $libname$shared_ext' + soname_spec='$libname$release$shared_ext$major' + finish_cmds='PATH="\$PATH:/sbin" ldconfig $libdir' + shlibpath_var=LD_LIBRARY_PATH + sys_lib_search_path_spec="/shlib /usr/lib /usr/X11/lib /usr/contrib/lib /lib /usr/local/lib" + sys_lib_dlsearch_path_spec="/shlib /usr/lib /usr/local/lib" + # the default ld.so.conf also contains /usr/contrib/lib and + # /usr/X11R6/lib (/usr/X11 is a link to /usr/X11R6), but let us allow + # libtool to hard-code these into programs + ;; + +cygwin* | mingw* | pw32* | cegcc*) + version_type=windows + shrext_cmds=.dll + need_version=no + need_lib_prefix=no + + case $GCC,$cc_basename in + yes,*) + # gcc + library_names_spec='$libname.dll.a' + # DLL is installed to $(libdir)/../bin by postinstall_cmds + postinstall_cmds='base_file=`basename \$file`~ + dlpath=`$SHELL 2>&1 -c '\''. $dir/'\''\$base_file'\''i; echo \$dlname'\''`~ + dldir=$destdir/`dirname \$dlpath`~ + test -d \$dldir || mkdir -p \$dldir~ + $install_prog $dir/$dlname \$dldir/$dlname~ + chmod a+x \$dldir/$dlname~ + if test -n '\''$stripme'\'' && test -n '\''$striplib'\''; then + eval '\''$striplib \$dldir/$dlname'\'' || exit \$?; + fi' + postuninstall_cmds='dldll=`$SHELL 2>&1 -c '\''. $file; echo \$dlname'\''`~ + dlpath=$dir/\$dldll~ + $RM \$dlpath' + shlibpath_overrides_runpath=yes + + case $host_os in + cygwin*) + # Cygwin DLLs use 'cyg' prefix rather than 'lib' + soname_spec='`echo $libname | sed -e 's/^lib/cyg/'``echo $release | $SED -e 's/[.]/-/g'`$versuffix$shared_ext' + + sys_lib_search_path_spec="$sys_lib_search_path_spec /usr/lib/w32api" + ;; + mingw* | cegcc*) + # MinGW DLLs use traditional 'lib' prefix + soname_spec='$libname`echo $release | $SED -e 's/[.]/-/g'`$versuffix$shared_ext' + ;; + pw32*) + # pw32 DLLs use 'pw' prefix rather than 'lib' + library_names_spec='`echo $libname | sed -e 's/^lib/pw/'``echo $release | $SED -e 's/[.]/-/g'`$versuffix$shared_ext' + ;; + esac + dynamic_linker='Win32 ld.exe' + ;; + + *,cl*) + # Native MSVC + libname_spec='$name' + soname_spec='$libname`echo $release | $SED -e 's/[.]/-/g'`$versuffix$shared_ext' + library_names_spec='$libname.dll.lib' + + case $build_os in + mingw*) + sys_lib_search_path_spec= + lt_save_ifs=$IFS + IFS=';' + for lt_path in $LIB + do + IFS=$lt_save_ifs + # Let DOS variable expansion print the short 8.3 style file name. + lt_path=`cd "$lt_path" 2>/dev/null && cmd //C "for %i in (".") do @echo %~si"` + sys_lib_search_path_spec="$sys_lib_search_path_spec $lt_path" + done + IFS=$lt_save_ifs + # Convert to MSYS style. + sys_lib_search_path_spec=`$ECHO "$sys_lib_search_path_spec" | sed -e 's|\\\\|/|g' -e 's| \\([a-zA-Z]\\):| /\\1|g' -e 's|^ ||'` + ;; + cygwin*) + # Convert to unix form, then to dos form, then back to unix form + # but this time dos style (no spaces!) so that the unix form looks + # like /cygdrive/c/PROGRA~1:/cygdr... + sys_lib_search_path_spec=`cygpath --path --unix "$LIB"` + sys_lib_search_path_spec=`cygpath --path --dos "$sys_lib_search_path_spec" 2>/dev/null` + sys_lib_search_path_spec=`cygpath --path --unix "$sys_lib_search_path_spec" | $SED -e "s/$PATH_SEPARATOR/ /g"` + ;; + *) + sys_lib_search_path_spec=$LIB + if $ECHO "$sys_lib_search_path_spec" | $GREP ';[c-zC-Z]:/' >/dev/null; then + # It is most probably a Windows format PATH. + sys_lib_search_path_spec=`$ECHO "$sys_lib_search_path_spec" | $SED -e 's/;/ /g'` + else + sys_lib_search_path_spec=`$ECHO "$sys_lib_search_path_spec" | $SED -e "s/$PATH_SEPARATOR/ /g"` + fi + # FIXME: find the short name or the path components, as spaces are + # common. (e.g. "Program Files" -> "PROGRA~1") + ;; + esac + + # DLL is installed to $(libdir)/../bin by postinstall_cmds + postinstall_cmds='base_file=`basename \$file`~ + dlpath=`$SHELL 2>&1 -c '\''. $dir/'\''\$base_file'\''i; echo \$dlname'\''`~ + dldir=$destdir/`dirname \$dlpath`~ + test -d \$dldir || mkdir -p \$dldir~ + $install_prog $dir/$dlname \$dldir/$dlname' + postuninstall_cmds='dldll=`$SHELL 2>&1 -c '\''. $file; echo \$dlname'\''`~ + dlpath=$dir/\$dldll~ + $RM \$dlpath' + shlibpath_overrides_runpath=yes + dynamic_linker='Win32 link.exe' + ;; + + *) + # Assume MSVC wrapper + library_names_spec='$libname`echo $release | $SED -e 's/[.]/-/g'`$versuffix$shared_ext $libname.lib' + dynamic_linker='Win32 ld.exe' + ;; + esac + # FIXME: first we should search . and the directory the executable is in + shlibpath_var=PATH + ;; + +darwin* | rhapsody*) + dynamic_linker="$host_os dyld" + version_type=darwin + need_lib_prefix=no + need_version=no + library_names_spec='$libname$release$major$shared_ext $libname$shared_ext' + soname_spec='$libname$release$major$shared_ext' + shlibpath_overrides_runpath=yes + shlibpath_var=DYLD_LIBRARY_PATH + shrext_cmds='`test .$module = .yes && echo .so || echo .dylib`' + + sys_lib_search_path_spec="$sys_lib_search_path_spec /usr/local/lib" + sys_lib_dlsearch_path_spec='/usr/local/lib /lib /usr/lib' + ;; + +dgux*) + version_type=linux # correct to gnu/linux during the next big refactor + need_lib_prefix=no + need_version=no + library_names_spec='$libname$release$shared_ext$versuffix $libname$release$shared_ext$major $libname$shared_ext' + soname_spec='$libname$release$shared_ext$major' + shlibpath_var=LD_LIBRARY_PATH + ;; + +freebsd* | dragonfly*) + # DragonFly does not have aout. When/if they implement a new + # versioning mechanism, adjust this. + if test -x /usr/bin/objformat; then + objformat=`/usr/bin/objformat` + else + case $host_os in + freebsd[23].*) objformat=aout ;; + *) objformat=elf ;; + esac + fi + version_type=freebsd-$objformat + case $version_type in + freebsd-elf*) + library_names_spec='$libname$release$shared_ext$versuffix $libname$release$shared_ext$major $libname$shared_ext' + soname_spec='$libname$release$shared_ext$major' + need_version=no + need_lib_prefix=no + ;; + freebsd-*) + library_names_spec='$libname$release$shared_ext$versuffix $libname$shared_ext$versuffix' + need_version=yes + ;; + esac + shlibpath_var=LD_LIBRARY_PATH + case $host_os in + freebsd2.*) + shlibpath_overrides_runpath=yes + ;; + freebsd3.[01]* | freebsdelf3.[01]*) + shlibpath_overrides_runpath=yes + hardcode_into_libs=yes + ;; + freebsd3.[2-9]* | freebsdelf3.[2-9]* | \ + freebsd4.[0-5] | freebsdelf4.[0-5] | freebsd4.1.1 | freebsdelf4.1.1) + shlibpath_overrides_runpath=no + hardcode_into_libs=yes + ;; + *) # from 4.6 on, and DragonFly + shlibpath_overrides_runpath=yes + hardcode_into_libs=yes + ;; + esac + ;; + +haiku*) + version_type=linux # correct to gnu/linux during the next big refactor + need_lib_prefix=no + need_version=no + dynamic_linker="$host_os runtime_loader" + library_names_spec='$libname$release$shared_ext$versuffix $libname$release$shared_ext$major $libname$shared_ext' + soname_spec='$libname$release$shared_ext$major' + shlibpath_var=LIBRARY_PATH + shlibpath_overrides_runpath=no + sys_lib_dlsearch_path_spec='/boot/home/config/lib /boot/common/lib /boot/system/lib' + hardcode_into_libs=yes + ;; + +hpux9* | hpux10* | hpux11*) + # Give a soname corresponding to the major version so that dld.sl refuses to + # link against other versions. + version_type=sunos + need_lib_prefix=no + need_version=no + case $host_cpu in + ia64*) + shrext_cmds='.so' + hardcode_into_libs=yes + dynamic_linker="$host_os dld.so" + shlibpath_var=LD_LIBRARY_PATH + shlibpath_overrides_runpath=yes # Unless +noenvvar is specified. + library_names_spec='$libname$release$shared_ext$versuffix $libname$release$shared_ext$major $libname$shared_ext' + soname_spec='$libname$release$shared_ext$major' + if test 32 = "$HPUX_IA64_MODE"; then + sys_lib_search_path_spec="/usr/lib/hpux32 /usr/local/lib/hpux32 /usr/local/lib" + sys_lib_dlsearch_path_spec=/usr/lib/hpux32 + else + sys_lib_search_path_spec="/usr/lib/hpux64 /usr/local/lib/hpux64" + sys_lib_dlsearch_path_spec=/usr/lib/hpux64 + fi + ;; + hppa*64*) + shrext_cmds='.sl' + hardcode_into_libs=yes + dynamic_linker="$host_os dld.sl" + shlibpath_var=LD_LIBRARY_PATH # How should we handle SHLIB_PATH + shlibpath_overrides_runpath=yes # Unless +noenvvar is specified. + library_names_spec='$libname$release$shared_ext$versuffix $libname$release$shared_ext$major $libname$shared_ext' + soname_spec='$libname$release$shared_ext$major' + sys_lib_search_path_spec="/usr/lib/pa20_64 /usr/ccs/lib/pa20_64" + sys_lib_dlsearch_path_spec=$sys_lib_search_path_spec + ;; + *) + shrext_cmds='.sl' + dynamic_linker="$host_os dld.sl" + shlibpath_var=SHLIB_PATH + shlibpath_overrides_runpath=no # +s is required to enable SHLIB_PATH + library_names_spec='$libname$release$shared_ext$versuffix $libname$release$shared_ext$major $libname$shared_ext' + soname_spec='$libname$release$shared_ext$major' + ;; + esac + # HP-UX runs *really* slowly unless shared libraries are mode 555, ... + postinstall_cmds='chmod 555 $lib' + # or fails outright, so override atomically: + install_override_mode=555 + ;; + +interix[3-9]*) + version_type=linux # correct to gnu/linux during the next big refactor + need_lib_prefix=no + need_version=no + library_names_spec='$libname$release$shared_ext$versuffix $libname$release$shared_ext$major $libname$shared_ext' + soname_spec='$libname$release$shared_ext$major' + dynamic_linker='Interix 3.x ld.so.1 (PE, like ELF)' + shlibpath_var=LD_LIBRARY_PATH + shlibpath_overrides_runpath=no + hardcode_into_libs=yes + ;; + +irix5* | irix6* | nonstopux*) + case $host_os in + nonstopux*) version_type=nonstopux ;; + *) + if test yes = "$lt_cv_prog_gnu_ld"; then + version_type=linux # correct to gnu/linux during the next big refactor + else + version_type=irix + fi ;; + esac + need_lib_prefix=no + need_version=no + soname_spec='$libname$release$shared_ext$major' + library_names_spec='$libname$release$shared_ext$versuffix $libname$release$shared_ext$major $libname$release$shared_ext $libname$shared_ext' + case $host_os in + irix5* | nonstopux*) + libsuff= shlibsuff= + ;; + *) + case $LD in # libtool.m4 will add one of these switches to LD + *-32|*"-32 "|*-melf32bsmip|*"-melf32bsmip ") + libsuff= shlibsuff= libmagic=32-bit;; + *-n32|*"-n32 "|*-melf32bmipn32|*"-melf32bmipn32 ") + libsuff=32 shlibsuff=N32 libmagic=N32;; + *-64|*"-64 "|*-melf64bmip|*"-melf64bmip ") + libsuff=64 shlibsuff=64 libmagic=64-bit;; + *) libsuff= shlibsuff= libmagic=never-match;; + esac + ;; + esac + shlibpath_var=LD_LIBRARY${shlibsuff}_PATH + shlibpath_overrides_runpath=no + sys_lib_search_path_spec="/usr/lib$libsuff /lib$libsuff /usr/local/lib$libsuff" + sys_lib_dlsearch_path_spec="/usr/lib$libsuff /lib$libsuff" + hardcode_into_libs=yes + ;; + +# No shared lib support for Linux oldld, aout, or coff. +linux*oldld* | linux*aout* | linux*coff*) + dynamic_linker=no + ;; + +linux*android*) + version_type=none # Android doesn't support versioned libraries. + need_lib_prefix=no + need_version=no + library_names_spec='$libname$release$shared_ext' + soname_spec='$libname$release$shared_ext' + finish_cmds= + shlibpath_var=LD_LIBRARY_PATH + shlibpath_overrides_runpath=yes + + # This implies no fast_install, which is unacceptable. + # Some rework will be needed to allow for fast_install + # before this can be enabled. + hardcode_into_libs=yes + + dynamic_linker='Android linker' + # Don't embed -rpath directories since the linker doesn't support them. + hardcode_libdir_flag_spec='-L$libdir' + ;; + +# This must be glibc/ELF. +linux* | k*bsd*-gnu | kopensolaris*-gnu | gnu*) + version_type=linux # correct to gnu/linux during the next big refactor + need_lib_prefix=no + need_version=no + library_names_spec='$libname$release$shared_ext$versuffix $libname$release$shared_ext$major $libname$shared_ext' + soname_spec='$libname$release$shared_ext$major' + finish_cmds='PATH="\$PATH:/sbin" ldconfig -n $libdir' + shlibpath_var=LD_LIBRARY_PATH + shlibpath_overrides_runpath=no + + # Some binutils ld are patched to set DT_RUNPATH + if ${lt_cv_shlibpath_overrides_runpath+:} false; then : + $as_echo_n "(cached) " >&6 +else + lt_cv_shlibpath_overrides_runpath=no + save_LDFLAGS=$LDFLAGS + save_libdir=$libdir + eval "libdir=/foo; wl=\"$lt_prog_compiler_wl\"; \ + LDFLAGS=\"\$LDFLAGS $hardcode_libdir_flag_spec\"" + cat confdefs.h - <<_ACEOF >conftest.$ac_ext +/* end confdefs.h. */ + +int +main () +{ + + ; + return 0; +} +_ACEOF +if ac_fn_c_try_link "$LINENO"; then : + if ($OBJDUMP -p conftest$ac_exeext) 2>/dev/null | grep "RUNPATH.*$libdir" >/dev/null; then : + lt_cv_shlibpath_overrides_runpath=yes +fi +fi +rm -f core conftest.err conftest.$ac_objext \ + conftest$ac_exeext conftest.$ac_ext + LDFLAGS=$save_LDFLAGS + libdir=$save_libdir + +fi + + shlibpath_overrides_runpath=$lt_cv_shlibpath_overrides_runpath + + # This implies no fast_install, which is unacceptable. + # Some rework will be needed to allow for fast_install + # before this can be enabled. + hardcode_into_libs=yes + + # Ideally, we could use ldconfig to report *all* directores which are + # searched for libraries, however this is still not possible. Aside from not + # being certain /sbin/ldconfig is available, command + # 'ldconfig -N -X -v | grep ^/' on 64bit Fedora does not report /usr/lib64, + # even though it is searched at run-time. Try to do the best guess by + # appending ld.so.conf contents (and includes) to the search path. + if test -f /etc/ld.so.conf; then + lt_ld_extra=`awk '/^include / { system(sprintf("cd /etc; cat %s 2>/dev/null", \$2)); skip = 1; } { if (!skip) print \$0; skip = 0; }' < /etc/ld.so.conf | $SED -e 's/#.*//;/^[ ]*hwcap[ ]/d;s/[:, ]/ /g;s/=[^=]*$//;s/=[^= ]* / /g;s/"//g;/^$/d' | tr '\n' ' '` + sys_lib_dlsearch_path_spec="/lib /usr/lib $lt_ld_extra" + fi + + # We used to test for /lib/ld.so.1 and disable shared libraries on + # powerpc, because MkLinux only supported shared libraries with the + # GNU dynamic linker. Since this was broken with cross compilers, + # most powerpc-linux boxes support dynamic linking these days and + # people can always --disable-shared, the test was removed, and we + # assume the GNU/Linux dynamic linker is in use. + dynamic_linker='GNU/Linux ld.so' + ;; + +netbsd*) + version_type=sunos + need_lib_prefix=no + need_version=no + if echo __ELF__ | $CC -E - | $GREP __ELF__ >/dev/null; then + library_names_spec='$libname$release$shared_ext$versuffix $libname$shared_ext$versuffix' + finish_cmds='PATH="\$PATH:/sbin" ldconfig -m $libdir' + dynamic_linker='NetBSD (a.out) ld.so' + else + library_names_spec='$libname$release$shared_ext$versuffix $libname$release$shared_ext$major $libname$shared_ext' + soname_spec='$libname$release$shared_ext$major' + dynamic_linker='NetBSD ld.elf_so' + fi + shlibpath_var=LD_LIBRARY_PATH + shlibpath_overrides_runpath=yes + hardcode_into_libs=yes + ;; + +newsos6) + version_type=linux # correct to gnu/linux during the next big refactor + library_names_spec='$libname$release$shared_ext$versuffix $libname$release$shared_ext$major $libname$shared_ext' + shlibpath_var=LD_LIBRARY_PATH + shlibpath_overrides_runpath=yes + ;; + +*nto* | *qnx*) + version_type=qnx + need_lib_prefix=no + need_version=no + library_names_spec='$libname$release$shared_ext$versuffix $libname$release$shared_ext$major $libname$shared_ext' + soname_spec='$libname$release$shared_ext$major' + shlibpath_var=LD_LIBRARY_PATH + shlibpath_overrides_runpath=no + hardcode_into_libs=yes + dynamic_linker='ldqnx.so' + ;; + +openbsd* | bitrig*) + version_type=sunos + sys_lib_dlsearch_path_spec=/usr/lib + need_lib_prefix=no + if test -z "`echo __ELF__ | $CC -E - | $GREP __ELF__`"; then + need_version=no + else + need_version=yes + fi + library_names_spec='$libname$release$shared_ext$versuffix $libname$shared_ext$versuffix' + finish_cmds='PATH="\$PATH:/sbin" ldconfig -m $libdir' + shlibpath_var=LD_LIBRARY_PATH + shlibpath_overrides_runpath=yes + ;; + +os2*) + libname_spec='$name' + version_type=windows + shrext_cmds=.dll + need_version=no + need_lib_prefix=no + # OS/2 can only load a DLL with a base name of 8 characters or less. + soname_spec='`test -n "$os2dllname" && libname="$os2dllname"; + v=$($ECHO $release$versuffix | tr -d .-); + n=$($ECHO $libname | cut -b -$((8 - ${#v})) | tr . _); + $ECHO $n$v`$shared_ext' + library_names_spec='${libname}_dll.$libext' + dynamic_linker='OS/2 ld.exe' + shlibpath_var=BEGINLIBPATH + sys_lib_search_path_spec="/lib /usr/lib /usr/local/lib" + sys_lib_dlsearch_path_spec=$sys_lib_search_path_spec + postinstall_cmds='base_file=`basename \$file`~ + dlpath=`$SHELL 2>&1 -c '\''. $dir/'\''\$base_file'\''i; $ECHO \$dlname'\''`~ + dldir=$destdir/`dirname \$dlpath`~ + test -d \$dldir || mkdir -p \$dldir~ + $install_prog $dir/$dlname \$dldir/$dlname~ + chmod a+x \$dldir/$dlname~ + if test -n '\''$stripme'\'' && test -n '\''$striplib'\''; then + eval '\''$striplib \$dldir/$dlname'\'' || exit \$?; + fi' + postuninstall_cmds='dldll=`$SHELL 2>&1 -c '\''. $file; $ECHO \$dlname'\''`~ + dlpath=$dir/\$dldll~ + $RM \$dlpath' + ;; + +osf3* | osf4* | osf5*) + version_type=osf + need_lib_prefix=no + need_version=no + soname_spec='$libname$release$shared_ext$major' + library_names_spec='$libname$release$shared_ext$versuffix $libname$release$shared_ext$major $libname$shared_ext' + shlibpath_var=LD_LIBRARY_PATH + sys_lib_search_path_spec="/usr/shlib /usr/ccs/lib /usr/lib/cmplrs/cc /usr/lib /usr/local/lib /var/shlib" + sys_lib_dlsearch_path_spec=$sys_lib_search_path_spec + ;; + +rdos*) + dynamic_linker=no + ;; + +solaris*) + version_type=linux # correct to gnu/linux during the next big refactor + need_lib_prefix=no + need_version=no + library_names_spec='$libname$release$shared_ext$versuffix $libname$release$shared_ext$major $libname$shared_ext' + soname_spec='$libname$release$shared_ext$major' + shlibpath_var=LD_LIBRARY_PATH + shlibpath_overrides_runpath=yes + hardcode_into_libs=yes + # ldd complains unless libraries are executable + postinstall_cmds='chmod +x $lib' + ;; + +sunos4*) + version_type=sunos + library_names_spec='$libname$release$shared_ext$versuffix $libname$shared_ext$versuffix' + finish_cmds='PATH="\$PATH:/usr/etc" ldconfig $libdir' + shlibpath_var=LD_LIBRARY_PATH + shlibpath_overrides_runpath=yes + if test yes = "$with_gnu_ld"; then + need_lib_prefix=no + fi + need_version=yes + ;; + +sysv4 | sysv4.3*) + version_type=linux # correct to gnu/linux during the next big refactor + library_names_spec='$libname$release$shared_ext$versuffix $libname$release$shared_ext$major $libname$shared_ext' + soname_spec='$libname$release$shared_ext$major' + shlibpath_var=LD_LIBRARY_PATH + case $host_vendor in + sni) + shlibpath_overrides_runpath=no + need_lib_prefix=no + runpath_var=LD_RUN_PATH + ;; + siemens) + need_lib_prefix=no + ;; + motorola) + need_lib_prefix=no + need_version=no + shlibpath_overrides_runpath=no + sys_lib_search_path_spec='/lib /usr/lib /usr/ccs/lib' + ;; + esac + ;; + +sysv4*MP*) + if test -d /usr/nec; then + version_type=linux # correct to gnu/linux during the next big refactor + library_names_spec='$libname$shared_ext.$versuffix $libname$shared_ext.$major $libname$shared_ext' + soname_spec='$libname$shared_ext.$major' + shlibpath_var=LD_LIBRARY_PATH + fi + ;; + +sysv5* | sco3.2v5* | sco5v6* | unixware* | OpenUNIX* | sysv4*uw2*) + version_type=sco + need_lib_prefix=no + need_version=no + library_names_spec='$libname$release$shared_ext$versuffix $libname$release$shared_ext $libname$shared_ext' + soname_spec='$libname$release$shared_ext$major' + shlibpath_var=LD_LIBRARY_PATH + shlibpath_overrides_runpath=yes + hardcode_into_libs=yes + if test yes = "$with_gnu_ld"; then + sys_lib_search_path_spec='/usr/local/lib /usr/gnu/lib /usr/ccs/lib /usr/lib /lib' + else + sys_lib_search_path_spec='/usr/ccs/lib /usr/lib' + case $host_os in + sco3.2v5*) + sys_lib_search_path_spec="$sys_lib_search_path_spec /lib" + ;; + esac + fi + sys_lib_dlsearch_path_spec='/usr/lib' + ;; + +tpf*) + # TPF is a cross-target only. Preferred cross-host = GNU/Linux. + version_type=linux # correct to gnu/linux during the next big refactor + need_lib_prefix=no + need_version=no + library_names_spec='$libname$release$shared_ext$versuffix $libname$release$shared_ext$major $libname$shared_ext' + shlibpath_var=LD_LIBRARY_PATH + shlibpath_overrides_runpath=no + hardcode_into_libs=yes + ;; + +uts4*) + version_type=linux # correct to gnu/linux during the next big refactor + library_names_spec='$libname$release$shared_ext$versuffix $libname$release$shared_ext$major $libname$shared_ext' + soname_spec='$libname$release$shared_ext$major' + shlibpath_var=LD_LIBRARY_PATH + ;; + +*) + dynamic_linker=no + ;; +esac +{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $dynamic_linker" >&5 +$as_echo "$dynamic_linker" >&6; } +test no = "$dynamic_linker" && can_build_shared=no + +variables_saved_for_relink="PATH $shlibpath_var $runpath_var" +if test yes = "$GCC"; then + variables_saved_for_relink="$variables_saved_for_relink GCC_EXEC_PREFIX COMPILER_PATH LIBRARY_PATH" +fi + +if test set = "${lt_cv_sys_lib_search_path_spec+set}"; then + sys_lib_search_path_spec=$lt_cv_sys_lib_search_path_spec +fi + +if test set = "${lt_cv_sys_lib_dlsearch_path_spec+set}"; then + sys_lib_dlsearch_path_spec=$lt_cv_sys_lib_dlsearch_path_spec +fi + +# remember unaugmented sys_lib_dlsearch_path content for libtool script decls... +configure_time_dlsearch_path=$sys_lib_dlsearch_path_spec + +# ... but it needs LT_SYS_LIBRARY_PATH munging for other configure-time code +func_munge_path_list sys_lib_dlsearch_path_spec "$LT_SYS_LIBRARY_PATH" + +# to be used as default LT_SYS_LIBRARY_PATH value in generated libtool +configure_time_lt_sys_library_path=$LT_SYS_LIBRARY_PATH + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + { $as_echo "$as_me:${as_lineno-$LINENO}: checking how to hardcode library paths into programs" >&5 +$as_echo_n "checking how to hardcode library paths into programs... " >&6; } +hardcode_action= +if test -n "$hardcode_libdir_flag_spec" || + test -n "$runpath_var" || + test yes = "$hardcode_automatic"; then + + # We can hardcode non-existent directories. + if test no != "$hardcode_direct" && + # If the only mechanism to avoid hardcoding is shlibpath_var, we + # have to relink, otherwise we might link with an installed library + # when we should be linking with a yet-to-be-installed one + ## test no != "$_LT_TAGVAR(hardcode_shlibpath_var, )" && + test no != "$hardcode_minus_L"; then + # Linking always hardcodes the temporary library directory. + hardcode_action=relink + else + # We can link without hardcoding, and we can hardcode nonexisting dirs. + hardcode_action=immediate + fi +else + # We cannot hardcode anything, or else we can only hardcode existing + # directories. + hardcode_action=unsupported +fi +{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $hardcode_action" >&5 +$as_echo "$hardcode_action" >&6; } + +if test relink = "$hardcode_action" || + test yes = "$inherit_rpath"; then + # Fast installation is not supported + enable_fast_install=no +elif test yes = "$shlibpath_overrides_runpath" || + test no = "$enable_shared"; then + # Fast installation is not necessary + enable_fast_install=needless +fi + + + + + + + if test yes != "$enable_dlopen"; then + enable_dlopen=unknown + enable_dlopen_self=unknown + enable_dlopen_self_static=unknown +else + lt_cv_dlopen=no + lt_cv_dlopen_libs= + + case $host_os in + beos*) + lt_cv_dlopen=load_add_on + lt_cv_dlopen_libs= + lt_cv_dlopen_self=yes + ;; + + mingw* | pw32* | cegcc*) + lt_cv_dlopen=LoadLibrary + lt_cv_dlopen_libs= + ;; + + cygwin*) + lt_cv_dlopen=dlopen + lt_cv_dlopen_libs= + ;; + + darwin*) + # if libdl is installed we need to link against it + { $as_echo "$as_me:${as_lineno-$LINENO}: checking for dlopen in -ldl" >&5 +$as_echo_n "checking for dlopen in -ldl... " >&6; } +if ${ac_cv_lib_dl_dlopen+:} false; then : + $as_echo_n "(cached) " >&6 +else + ac_check_lib_save_LIBS=$LIBS +LIBS="-ldl $LIBS" +cat confdefs.h - <<_ACEOF >conftest.$ac_ext +/* end confdefs.h. */ + +/* Override any GCC internal prototype to avoid an error. + Use char because int might match the return type of a GCC + builtin and then its argument prototype would still apply. */ +#ifdef __cplusplus +extern "C" +#endif +char dlopen (); +int +main () +{ +return dlopen (); + ; + return 0; +} +_ACEOF +if ac_fn_c_try_link "$LINENO"; then : + ac_cv_lib_dl_dlopen=yes +else + ac_cv_lib_dl_dlopen=no +fi +rm -f core conftest.err conftest.$ac_objext \ + conftest$ac_exeext conftest.$ac_ext +LIBS=$ac_check_lib_save_LIBS +fi +{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_cv_lib_dl_dlopen" >&5 +$as_echo "$ac_cv_lib_dl_dlopen" >&6; } +if test "x$ac_cv_lib_dl_dlopen" = xyes; then : + lt_cv_dlopen=dlopen lt_cv_dlopen_libs=-ldl +else + + lt_cv_dlopen=dyld + lt_cv_dlopen_libs= + lt_cv_dlopen_self=yes + +fi + + ;; + + tpf*) + # Don't try to run any link tests for TPF. We know it's impossible + # because TPF is a cross-compiler, and we know how we open DSOs. + lt_cv_dlopen=dlopen + lt_cv_dlopen_libs= + lt_cv_dlopen_self=no + ;; + + *) + ac_fn_c_check_func "$LINENO" "shl_load" "ac_cv_func_shl_load" +if test "x$ac_cv_func_shl_load" = xyes; then : + lt_cv_dlopen=shl_load +else + { $as_echo "$as_me:${as_lineno-$LINENO}: checking for shl_load in -ldld" >&5 +$as_echo_n "checking for shl_load in -ldld... " >&6; } +if ${ac_cv_lib_dld_shl_load+:} false; then : + $as_echo_n "(cached) " >&6 +else + ac_check_lib_save_LIBS=$LIBS +LIBS="-ldld $LIBS" +cat confdefs.h - <<_ACEOF >conftest.$ac_ext +/* end confdefs.h. */ + +/* Override any GCC internal prototype to avoid an error. + Use char because int might match the return type of a GCC + builtin and then its argument prototype would still apply. */ +#ifdef __cplusplus +extern "C" +#endif +char shl_load (); +int +main () +{ +return shl_load (); + ; + return 0; +} +_ACEOF +if ac_fn_c_try_link "$LINENO"; then : + ac_cv_lib_dld_shl_load=yes +else + ac_cv_lib_dld_shl_load=no +fi +rm -f core conftest.err conftest.$ac_objext \ + conftest$ac_exeext conftest.$ac_ext +LIBS=$ac_check_lib_save_LIBS +fi +{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_cv_lib_dld_shl_load" >&5 +$as_echo "$ac_cv_lib_dld_shl_load" >&6; } +if test "x$ac_cv_lib_dld_shl_load" = xyes; then : + lt_cv_dlopen=shl_load lt_cv_dlopen_libs=-ldld +else + ac_fn_c_check_func "$LINENO" "dlopen" "ac_cv_func_dlopen" +if test "x$ac_cv_func_dlopen" = xyes; then : + lt_cv_dlopen=dlopen +else + { $as_echo "$as_me:${as_lineno-$LINENO}: checking for dlopen in -ldl" >&5 +$as_echo_n "checking for dlopen in -ldl... " >&6; } +if ${ac_cv_lib_dl_dlopen+:} false; then : + $as_echo_n "(cached) " >&6 +else + ac_check_lib_save_LIBS=$LIBS +LIBS="-ldl $LIBS" +cat confdefs.h - <<_ACEOF >conftest.$ac_ext +/* end confdefs.h. */ + +/* Override any GCC internal prototype to avoid an error. + Use char because int might match the return type of a GCC + builtin and then its argument prototype would still apply. */ +#ifdef __cplusplus +extern "C" +#endif +char dlopen (); +int +main () +{ +return dlopen (); + ; + return 0; +} +_ACEOF +if ac_fn_c_try_link "$LINENO"; then : + ac_cv_lib_dl_dlopen=yes +else + ac_cv_lib_dl_dlopen=no +fi +rm -f core conftest.err conftest.$ac_objext \ + conftest$ac_exeext conftest.$ac_ext +LIBS=$ac_check_lib_save_LIBS +fi +{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_cv_lib_dl_dlopen" >&5 +$as_echo "$ac_cv_lib_dl_dlopen" >&6; } +if test "x$ac_cv_lib_dl_dlopen" = xyes; then : + lt_cv_dlopen=dlopen lt_cv_dlopen_libs=-ldl +else + { $as_echo "$as_me:${as_lineno-$LINENO}: checking for dlopen in -lsvld" >&5 +$as_echo_n "checking for dlopen in -lsvld... " >&6; } +if ${ac_cv_lib_svld_dlopen+:} false; then : + $as_echo_n "(cached) " >&6 +else + ac_check_lib_save_LIBS=$LIBS +LIBS="-lsvld $LIBS" +cat confdefs.h - <<_ACEOF >conftest.$ac_ext +/* end confdefs.h. */ + +/* Override any GCC internal prototype to avoid an error. + Use char because int might match the return type of a GCC + builtin and then its argument prototype would still apply. */ +#ifdef __cplusplus +extern "C" +#endif +char dlopen (); +int +main () +{ +return dlopen (); + ; + return 0; +} +_ACEOF +if ac_fn_c_try_link "$LINENO"; then : + ac_cv_lib_svld_dlopen=yes +else + ac_cv_lib_svld_dlopen=no +fi +rm -f core conftest.err conftest.$ac_objext \ + conftest$ac_exeext conftest.$ac_ext +LIBS=$ac_check_lib_save_LIBS +fi +{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_cv_lib_svld_dlopen" >&5 +$as_echo "$ac_cv_lib_svld_dlopen" >&6; } +if test "x$ac_cv_lib_svld_dlopen" = xyes; then : + lt_cv_dlopen=dlopen lt_cv_dlopen_libs=-lsvld +else + { $as_echo "$as_me:${as_lineno-$LINENO}: checking for dld_link in -ldld" >&5 +$as_echo_n "checking for dld_link in -ldld... " >&6; } +if ${ac_cv_lib_dld_dld_link+:} false; then : + $as_echo_n "(cached) " >&6 +else + ac_check_lib_save_LIBS=$LIBS +LIBS="-ldld $LIBS" +cat confdefs.h - <<_ACEOF >conftest.$ac_ext +/* end confdefs.h. */ + +/* Override any GCC internal prototype to avoid an error. + Use char because int might match the return type of a GCC + builtin and then its argument prototype would still apply. */ +#ifdef __cplusplus +extern "C" +#endif +char dld_link (); +int +main () +{ +return dld_link (); + ; + return 0; +} +_ACEOF +if ac_fn_c_try_link "$LINENO"; then : + ac_cv_lib_dld_dld_link=yes +else + ac_cv_lib_dld_dld_link=no +fi +rm -f core conftest.err conftest.$ac_objext \ + conftest$ac_exeext conftest.$ac_ext +LIBS=$ac_check_lib_save_LIBS +fi +{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_cv_lib_dld_dld_link" >&5 +$as_echo "$ac_cv_lib_dld_dld_link" >&6; } +if test "x$ac_cv_lib_dld_dld_link" = xyes; then : + lt_cv_dlopen=dld_link lt_cv_dlopen_libs=-ldld +fi + + +fi + + +fi + + +fi + + +fi + + +fi + + ;; + esac + + if test no = "$lt_cv_dlopen"; then + enable_dlopen=no + else + enable_dlopen=yes + fi + + case $lt_cv_dlopen in + dlopen) + save_CPPFLAGS=$CPPFLAGS + test yes = "$ac_cv_header_dlfcn_h" && CPPFLAGS="$CPPFLAGS -DHAVE_DLFCN_H" + + save_LDFLAGS=$LDFLAGS + wl=$lt_prog_compiler_wl eval LDFLAGS=\"\$LDFLAGS $export_dynamic_flag_spec\" + + save_LIBS=$LIBS + LIBS="$lt_cv_dlopen_libs $LIBS" + + { $as_echo "$as_me:${as_lineno-$LINENO}: checking whether a program can dlopen itself" >&5 +$as_echo_n "checking whether a program can dlopen itself... " >&6; } +if ${lt_cv_dlopen_self+:} false; then : + $as_echo_n "(cached) " >&6 +else + if test yes = "$cross_compiling"; then : + lt_cv_dlopen_self=cross +else + lt_dlunknown=0; lt_dlno_uscore=1; lt_dlneed_uscore=2 + lt_status=$lt_dlunknown + cat > conftest.$ac_ext <<_LT_EOF +#line $LINENO "configure" +#include "confdefs.h" + +#if HAVE_DLFCN_H +#include <dlfcn.h> +#endif + +#include <stdio.h> + +#ifdef RTLD_GLOBAL +# define LT_DLGLOBAL RTLD_GLOBAL +#else +# ifdef DL_GLOBAL +# define LT_DLGLOBAL DL_GLOBAL +# else +# define LT_DLGLOBAL 0 +# endif +#endif + +/* We may have to define LT_DLLAZY_OR_NOW in the command line if we + find out it does not work in some platform. */ +#ifndef LT_DLLAZY_OR_NOW +# ifdef RTLD_LAZY +# define LT_DLLAZY_OR_NOW RTLD_LAZY +# else +# ifdef DL_LAZY +# define LT_DLLAZY_OR_NOW DL_LAZY +# else +# ifdef RTLD_NOW +# define LT_DLLAZY_OR_NOW RTLD_NOW +# else +# ifdef DL_NOW +# define LT_DLLAZY_OR_NOW DL_NOW +# else +# define LT_DLLAZY_OR_NOW 0 +# endif +# endif +# endif +# endif +#endif + +/* When -fvisibility=hidden is used, assume the code has been annotated + correspondingly for the symbols needed. */ +#if defined __GNUC__ && (((__GNUC__ == 3) && (__GNUC_MINOR__ >= 3)) || (__GNUC__ > 3)) +int fnord () __attribute__((visibility("default"))); +#endif + +int fnord () { return 42; } +int main () +{ + void *self = dlopen (0, LT_DLGLOBAL|LT_DLLAZY_OR_NOW); + int status = $lt_dlunknown; + + if (self) + { + if (dlsym (self,"fnord")) status = $lt_dlno_uscore; + else + { + if (dlsym( self,"_fnord")) status = $lt_dlneed_uscore; + else puts (dlerror ()); + } + /* dlclose (self); */ + } + else + puts (dlerror ()); + + return status; +} +_LT_EOF + if { { eval echo "\"\$as_me\":${as_lineno-$LINENO}: \"$ac_link\""; } >&5 + (eval $ac_link) 2>&5 + ac_status=$? + $as_echo "$as_me:${as_lineno-$LINENO}: \$? = $ac_status" >&5 + test $ac_status = 0; } && test -s "conftest$ac_exeext" 2>/dev/null; then + (./conftest; exit; ) >&5 2>/dev/null + lt_status=$? + case x$lt_status in + x$lt_dlno_uscore) lt_cv_dlopen_self=yes ;; + x$lt_dlneed_uscore) lt_cv_dlopen_self=yes ;; + x$lt_dlunknown|x*) lt_cv_dlopen_self=no ;; + esac + else : + # compilation failed + lt_cv_dlopen_self=no + fi +fi +rm -fr conftest* + + +fi +{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $lt_cv_dlopen_self" >&5 +$as_echo "$lt_cv_dlopen_self" >&6; } + + if test yes = "$lt_cv_dlopen_self"; then + wl=$lt_prog_compiler_wl eval LDFLAGS=\"\$LDFLAGS $lt_prog_compiler_static\" + { $as_echo "$as_me:${as_lineno-$LINENO}: checking whether a statically linked program can dlopen itself" >&5 +$as_echo_n "checking whether a statically linked program can dlopen itself... " >&6; } +if ${lt_cv_dlopen_self_static+:} false; then : + $as_echo_n "(cached) " >&6 +else + if test yes = "$cross_compiling"; then : + lt_cv_dlopen_self_static=cross +else + lt_dlunknown=0; lt_dlno_uscore=1; lt_dlneed_uscore=2 + lt_status=$lt_dlunknown + cat > conftest.$ac_ext <<_LT_EOF +#line $LINENO "configure" +#include "confdefs.h" + +#if HAVE_DLFCN_H +#include <dlfcn.h> +#endif + +#include <stdio.h> + +#ifdef RTLD_GLOBAL +# define LT_DLGLOBAL RTLD_GLOBAL +#else +# ifdef DL_GLOBAL +# define LT_DLGLOBAL DL_GLOBAL +# else +# define LT_DLGLOBAL 0 +# endif +#endif + +/* We may have to define LT_DLLAZY_OR_NOW in the command line if we + find out it does not work in some platform. */ +#ifndef LT_DLLAZY_OR_NOW +# ifdef RTLD_LAZY +# define LT_DLLAZY_OR_NOW RTLD_LAZY +# else +# ifdef DL_LAZY +# define LT_DLLAZY_OR_NOW DL_LAZY +# else +# ifdef RTLD_NOW +# define LT_DLLAZY_OR_NOW RTLD_NOW +# else +# ifdef DL_NOW +# define LT_DLLAZY_OR_NOW DL_NOW +# else +# define LT_DLLAZY_OR_NOW 0 +# endif +# endif +# endif +# endif +#endif + +/* When -fvisibility=hidden is used, assume the code has been annotated + correspondingly for the symbols needed. */ +#if defined __GNUC__ && (((__GNUC__ == 3) && (__GNUC_MINOR__ >= 3)) || (__GNUC__ > 3)) +int fnord () __attribute__((visibility("default"))); +#endif + +int fnord () { return 42; } +int main () +{ + void *self = dlopen (0, LT_DLGLOBAL|LT_DLLAZY_OR_NOW); + int status = $lt_dlunknown; + + if (self) + { + if (dlsym (self,"fnord")) status = $lt_dlno_uscore; + else + { + if (dlsym( self,"_fnord")) status = $lt_dlneed_uscore; + else puts (dlerror ()); + } + /* dlclose (self); */ + } + else + puts (dlerror ()); + + return status; +} +_LT_EOF + if { { eval echo "\"\$as_me\":${as_lineno-$LINENO}: \"$ac_link\""; } >&5 + (eval $ac_link) 2>&5 + ac_status=$? + $as_echo "$as_me:${as_lineno-$LINENO}: \$? = $ac_status" >&5 + test $ac_status = 0; } && test -s "conftest$ac_exeext" 2>/dev/null; then + (./conftest; exit; ) >&5 2>/dev/null + lt_status=$? + case x$lt_status in + x$lt_dlno_uscore) lt_cv_dlopen_self_static=yes ;; + x$lt_dlneed_uscore) lt_cv_dlopen_self_static=yes ;; + x$lt_dlunknown|x*) lt_cv_dlopen_self_static=no ;; + esac + else : + # compilation failed + lt_cv_dlopen_self_static=no + fi +fi +rm -fr conftest* + + +fi +{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $lt_cv_dlopen_self_static" >&5 +$as_echo "$lt_cv_dlopen_self_static" >&6; } + fi + + CPPFLAGS=$save_CPPFLAGS + LDFLAGS=$save_LDFLAGS + LIBS=$save_LIBS + ;; + esac + + case $lt_cv_dlopen_self in + yes|no) enable_dlopen_self=$lt_cv_dlopen_self ;; + *) enable_dlopen_self=unknown ;; + esac + + case $lt_cv_dlopen_self_static in + yes|no) enable_dlopen_self_static=$lt_cv_dlopen_self_static ;; + *) enable_dlopen_self_static=unknown ;; + esac +fi + + + + + + + + + + + + + + + + + +striplib= +old_striplib= +{ $as_echo "$as_me:${as_lineno-$LINENO}: checking whether stripping libraries is possible" >&5 +$as_echo_n "checking whether stripping libraries is possible... " >&6; } +if test -n "$STRIP" && $STRIP -V 2>&1 | $GREP "GNU strip" >/dev/null; then + test -z "$old_striplib" && old_striplib="$STRIP --strip-debug" + test -z "$striplib" && striplib="$STRIP --strip-unneeded" + { $as_echo "$as_me:${as_lineno-$LINENO}: result: yes" >&5 +$as_echo "yes" >&6; } +else +# FIXME - insert some real tests, host_os isn't really good enough + case $host_os in + darwin*) + if test -n "$STRIP"; then + striplib="$STRIP -x" + old_striplib="$STRIP -S" + { $as_echo "$as_me:${as_lineno-$LINENO}: result: yes" >&5 +$as_echo "yes" >&6; } + else + { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5 +$as_echo "no" >&6; } + fi + ;; + *) + { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5 +$as_echo "no" >&6; } + ;; + esac +fi + + + + + + + + + + + + + # Report what library types will actually be built + { $as_echo "$as_me:${as_lineno-$LINENO}: checking if libtool supports shared libraries" >&5 +$as_echo_n "checking if libtool supports shared libraries... " >&6; } + { $as_echo "$as_me:${as_lineno-$LINENO}: result: $can_build_shared" >&5 +$as_echo "$can_build_shared" >&6; } + + { $as_echo "$as_me:${as_lineno-$LINENO}: checking whether to build shared libraries" >&5 +$as_echo_n "checking whether to build shared libraries... " >&6; } + test no = "$can_build_shared" && enable_shared=no + + # On AIX, shared libraries and static libraries use the same namespace, and + # are all built from PIC. + case $host_os in + aix3*) + test yes = "$enable_shared" && enable_static=no + if test -n "$RANLIB"; then + archive_cmds="$archive_cmds~\$RANLIB \$lib" + postinstall_cmds='$RANLIB $lib' + fi + ;; + + aix[4-9]*) + if test ia64 != "$host_cpu"; then + case $enable_shared,$with_aix_soname,$aix_use_runtimelinking in + yes,aix,yes) ;; # shared object as lib.so file only + yes,svr4,*) ;; # shared object as lib.so archive member only + yes,*) enable_static=no ;; # shared object in lib.a archive as well + esac + fi + ;; + esac + { $as_echo "$as_me:${as_lineno-$LINENO}: result: $enable_shared" >&5 +$as_echo "$enable_shared" >&6; } + + { $as_echo "$as_me:${as_lineno-$LINENO}: checking whether to build static libraries" >&5 +$as_echo_n "checking whether to build static libraries... " >&6; } + # Make sure either enable_shared or enable_static is yes. + test yes = "$enable_shared" || enable_static=yes + { $as_echo "$as_me:${as_lineno-$LINENO}: result: $enable_static" >&5 +$as_echo "$enable_static" >&6; } + + + + +fi +ac_ext=c +ac_cpp='$CPP $CPPFLAGS' +ac_compile='$CC -c $CFLAGS $CPPFLAGS conftest.$ac_ext >&5' +ac_link='$CC -o conftest$ac_exeext $CFLAGS $CPPFLAGS $LDFLAGS conftest.$ac_ext $LIBS >&5' +ac_compiler_gnu=$ac_cv_c_compiler_gnu + +CC=$lt_save_CC + + + + + + + + + + + + + + + + ac_config_commands="$ac_config_commands libtool" + + + + +# Only expand once: + + +# Check whether --enable-largefile was given. +if test "${enable_largefile+set}" = set; then : + enableval=$enable_largefile; +fi + +if test "$enable_largefile" != no; then + + { $as_echo "$as_me:${as_lineno-$LINENO}: checking for special C compiler options needed for large files" >&5 +$as_echo_n "checking for special C compiler options needed for large files... " >&6; } +if ${ac_cv_sys_largefile_CC+:} false; then : + $as_echo_n "(cached) " >&6 +else + ac_cv_sys_largefile_CC=no + if test "$GCC" != yes; then + ac_save_CC=$CC + while :; do + # IRIX 6.2 and later do not support large files by default, + # so use the C compiler's -n32 option if that helps. + cat confdefs.h - <<_ACEOF >conftest.$ac_ext +/* end confdefs.h. */ +#include <sys/types.h> + /* Check that off_t can represent 2**63 - 1 correctly. + We can't simply define LARGE_OFF_T to be 9223372036854775807, + since some C++ compilers masquerading as C compilers + incorrectly reject 9223372036854775807. */ +#define LARGE_OFF_T (((off_t) 1 << 62) - 1 + ((off_t) 1 << 62)) + int off_t_is_large[(LARGE_OFF_T % 2147483629 == 721 + && LARGE_OFF_T % 2147483647 == 1) + ? 1 : -1]; +int +main () +{ + + ; + return 0; +} +_ACEOF + if ac_fn_c_try_compile "$LINENO"; then : + break +fi +rm -f core conftest.err conftest.$ac_objext + CC="$CC -n32" + if ac_fn_c_try_compile "$LINENO"; then : + ac_cv_sys_largefile_CC=' -n32'; break +fi +rm -f core conftest.err conftest.$ac_objext + break + done + CC=$ac_save_CC + rm -f conftest.$ac_ext + fi +fi +{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_cv_sys_largefile_CC" >&5 +$as_echo "$ac_cv_sys_largefile_CC" >&6; } + if test "$ac_cv_sys_largefile_CC" != no; then + CC=$CC$ac_cv_sys_largefile_CC + fi + + { $as_echo "$as_me:${as_lineno-$LINENO}: checking for _FILE_OFFSET_BITS value needed for large files" >&5 +$as_echo_n "checking for _FILE_OFFSET_BITS value needed for large files... " >&6; } +if ${ac_cv_sys_file_offset_bits+:} false; then : + $as_echo_n "(cached) " >&6 +else + while :; do + cat confdefs.h - <<_ACEOF >conftest.$ac_ext +/* end confdefs.h. */ +#include <sys/types.h> + /* Check that off_t can represent 2**63 - 1 correctly. + We can't simply define LARGE_OFF_T to be 9223372036854775807, + since some C++ compilers masquerading as C compilers + incorrectly reject 9223372036854775807. */ +#define LARGE_OFF_T (((off_t) 1 << 62) - 1 + ((off_t) 1 << 62)) + int off_t_is_large[(LARGE_OFF_T % 2147483629 == 721 + && LARGE_OFF_T % 2147483647 == 1) + ? 1 : -1]; +int +main () +{ + + ; + return 0; +} +_ACEOF +if ac_fn_c_try_compile "$LINENO"; then : + ac_cv_sys_file_offset_bits=no; break +fi +rm -f core conftest.err conftest.$ac_objext conftest.$ac_ext + cat confdefs.h - <<_ACEOF >conftest.$ac_ext +/* end confdefs.h. */ +#define _FILE_OFFSET_BITS 64 +#include <sys/types.h> + /* Check that off_t can represent 2**63 - 1 correctly. + We can't simply define LARGE_OFF_T to be 9223372036854775807, + since some C++ compilers masquerading as C compilers + incorrectly reject 9223372036854775807. */ +#define LARGE_OFF_T (((off_t) 1 << 62) - 1 + ((off_t) 1 << 62)) + int off_t_is_large[(LARGE_OFF_T % 2147483629 == 721 + && LARGE_OFF_T % 2147483647 == 1) + ? 1 : -1]; +int +main () +{ + + ; + return 0; +} +_ACEOF +if ac_fn_c_try_compile "$LINENO"; then : + ac_cv_sys_file_offset_bits=64; break +fi +rm -f core conftest.err conftest.$ac_objext conftest.$ac_ext + ac_cv_sys_file_offset_bits=unknown + break +done +fi +{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_cv_sys_file_offset_bits" >&5 +$as_echo "$ac_cv_sys_file_offset_bits" >&6; } +case $ac_cv_sys_file_offset_bits in #( + no | unknown) ;; + *) +cat >>confdefs.h <<_ACEOF +#define _FILE_OFFSET_BITS $ac_cv_sys_file_offset_bits +_ACEOF +;; +esac +rm -rf conftest* + if test $ac_cv_sys_file_offset_bits = unknown; then + { $as_echo "$as_me:${as_lineno-$LINENO}: checking for _LARGE_FILES value needed for large files" >&5 +$as_echo_n "checking for _LARGE_FILES value needed for large files... " >&6; } +if ${ac_cv_sys_large_files+:} false; then : + $as_echo_n "(cached) " >&6 +else + while :; do + cat confdefs.h - <<_ACEOF >conftest.$ac_ext +/* end confdefs.h. */ +#include <sys/types.h> + /* Check that off_t can represent 2**63 - 1 correctly. + We can't simply define LARGE_OFF_T to be 9223372036854775807, + since some C++ compilers masquerading as C compilers + incorrectly reject 9223372036854775807. */ +#define LARGE_OFF_T (((off_t) 1 << 62) - 1 + ((off_t) 1 << 62)) + int off_t_is_large[(LARGE_OFF_T % 2147483629 == 721 + && LARGE_OFF_T % 2147483647 == 1) + ? 1 : -1]; +int +main () +{ + + ; + return 0; +} +_ACEOF +if ac_fn_c_try_compile "$LINENO"; then : + ac_cv_sys_large_files=no; break +fi +rm -f core conftest.err conftest.$ac_objext conftest.$ac_ext + cat confdefs.h - <<_ACEOF >conftest.$ac_ext +/* end confdefs.h. */ +#define _LARGE_FILES 1 +#include <sys/types.h> + /* Check that off_t can represent 2**63 - 1 correctly. + We can't simply define LARGE_OFF_T to be 9223372036854775807, + since some C++ compilers masquerading as C compilers + incorrectly reject 9223372036854775807. */ +#define LARGE_OFF_T (((off_t) 1 << 62) - 1 + ((off_t) 1 << 62)) + int off_t_is_large[(LARGE_OFF_T % 2147483629 == 721 + && LARGE_OFF_T % 2147483647 == 1) + ? 1 : -1]; +int +main () +{ + + ; + return 0; +} +_ACEOF +if ac_fn_c_try_compile "$LINENO"; then : + ac_cv_sys_large_files=1; break +fi +rm -f core conftest.err conftest.$ac_objext conftest.$ac_ext + ac_cv_sys_large_files=unknown + break +done +fi +{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_cv_sys_large_files" >&5 +$as_echo "$ac_cv_sys_large_files" >&6; } +case $ac_cv_sys_large_files in #( + no | unknown) ;; + *) +cat >>confdefs.h <<_ACEOF +#define _LARGE_FILES $ac_cv_sys_large_files +_ACEOF +;; +esac +rm -rf conftest* + fi + + +fi + +{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for _LARGEFILE_SOURCE value needed for large files" >&5 +$as_echo_n "checking for _LARGEFILE_SOURCE value needed for large files... " >&6; } +if ${ac_cv_sys_largefile_source+:} false; then : + $as_echo_n "(cached) " >&6 +else + while :; do + cat confdefs.h - <<_ACEOF >conftest.$ac_ext +/* end confdefs.h. */ +#include <sys/types.h> /* for off_t */ + #include <stdio.h> +int +main () +{ +int (*fp) (FILE *, off_t, int) = fseeko; + return fseeko (stdin, 0, 0) && fp (stdin, 0, 0); + ; + return 0; +} +_ACEOF +if ac_fn_c_try_link "$LINENO"; then : + ac_cv_sys_largefile_source=no; break +fi +rm -f core conftest.err conftest.$ac_objext \ + conftest$ac_exeext conftest.$ac_ext + cat confdefs.h - <<_ACEOF >conftest.$ac_ext +/* end confdefs.h. */ +#define _LARGEFILE_SOURCE 1 +#include <sys/types.h> /* for off_t */ + #include <stdio.h> +int +main () +{ +int (*fp) (FILE *, off_t, int) = fseeko; + return fseeko (stdin, 0, 0) && fp (stdin, 0, 0); + ; + return 0; +} +_ACEOF +if ac_fn_c_try_link "$LINENO"; then : + ac_cv_sys_largefile_source=1; break +fi +rm -f core conftest.err conftest.$ac_objext \ + conftest$ac_exeext conftest.$ac_ext + ac_cv_sys_largefile_source=unknown + break +done +fi +{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_cv_sys_largefile_source" >&5 +$as_echo "$ac_cv_sys_largefile_source" >&6; } +case $ac_cv_sys_largefile_source in #( + no | unknown) ;; + *) +cat >>confdefs.h <<_ACEOF +#define _LARGEFILE_SOURCE $ac_cv_sys_largefile_source +_ACEOF +;; +esac +rm -rf conftest* + +# We used to try defining _XOPEN_SOURCE=500 too, to work around a bug +# in glibc 2.1.3, but that breaks too many other things. +# If you want fseeko and ftello with glibc, upgrade to a fixed glibc. +if test $ac_cv_sys_largefile_source != unknown; then + +$as_echo "#define HAVE_FSEEKO 1" >>confdefs.h + +fi + +ac_header_dirent=no +for ac_hdr in dirent.h sys/ndir.h sys/dir.h ndir.h; do + as_ac_Header=`$as_echo "ac_cv_header_dirent_$ac_hdr" | $as_tr_sh` +{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $ac_hdr that defines DIR" >&5 +$as_echo_n "checking for $ac_hdr that defines DIR... " >&6; } +if eval \${$as_ac_Header+:} false; then : + $as_echo_n "(cached) " >&6 +else + cat confdefs.h - <<_ACEOF >conftest.$ac_ext +/* end confdefs.h. */ +#include <sys/types.h> +#include <$ac_hdr> + +int +main () +{ +if ((DIR *) 0) +return 0; + ; + return 0; +} +_ACEOF +if ac_fn_c_try_compile "$LINENO"; then : + eval "$as_ac_Header=yes" +else + eval "$as_ac_Header=no" +fi +rm -f core conftest.err conftest.$ac_objext conftest.$ac_ext +fi +eval ac_res=\$$as_ac_Header + { $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_res" >&5 +$as_echo "$ac_res" >&6; } +if eval test \"x\$"$as_ac_Header"\" = x"yes"; then : + cat >>confdefs.h <<_ACEOF +#define `$as_echo "HAVE_$ac_hdr" | $as_tr_cpp` 1 +_ACEOF + +ac_header_dirent=$ac_hdr; break +fi + +done +# Two versions of opendir et al. are in -ldir and -lx on SCO Xenix. +if test $ac_header_dirent = dirent.h; then + { $as_echo "$as_me:${as_lineno-$LINENO}: checking for library containing opendir" >&5 +$as_echo_n "checking for library containing opendir... " >&6; } +if ${ac_cv_search_opendir+:} false; then : + $as_echo_n "(cached) " >&6 +else + ac_func_search_save_LIBS=$LIBS +cat confdefs.h - <<_ACEOF >conftest.$ac_ext +/* end confdefs.h. */ + +/* Override any GCC internal prototype to avoid an error. + Use char because int might match the return type of a GCC + builtin and then its argument prototype would still apply. */ +#ifdef __cplusplus +extern "C" +#endif +char opendir (); +int +main () +{ +return opendir (); + ; + return 0; +} +_ACEOF +for ac_lib in '' dir; do + if test -z "$ac_lib"; then + ac_res="none required" + else + ac_res=-l$ac_lib + LIBS="-l$ac_lib $ac_func_search_save_LIBS" + fi + if ac_fn_c_try_link "$LINENO"; then : + ac_cv_search_opendir=$ac_res +fi +rm -f core conftest.err conftest.$ac_objext \ + conftest$ac_exeext + if ${ac_cv_search_opendir+:} false; then : + break +fi +done +if ${ac_cv_search_opendir+:} false; then : + +else + ac_cv_search_opendir=no +fi +rm conftest.$ac_ext +LIBS=$ac_func_search_save_LIBS +fi +{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_cv_search_opendir" >&5 +$as_echo "$ac_cv_search_opendir" >&6; } +ac_res=$ac_cv_search_opendir +if test "$ac_res" != no; then : + test "$ac_res" = "none required" || LIBS="$ac_res $LIBS" + +fi + +else + { $as_echo "$as_me:${as_lineno-$LINENO}: checking for library containing opendir" >&5 +$as_echo_n "checking for library containing opendir... " >&6; } +if ${ac_cv_search_opendir+:} false; then : + $as_echo_n "(cached) " >&6 +else + ac_func_search_save_LIBS=$LIBS +cat confdefs.h - <<_ACEOF >conftest.$ac_ext +/* end confdefs.h. */ + +/* Override any GCC internal prototype to avoid an error. + Use char because int might match the return type of a GCC + builtin and then its argument prototype would still apply. */ +#ifdef __cplusplus +extern "C" +#endif +char opendir (); +int +main () +{ +return opendir (); + ; + return 0; +} +_ACEOF +for ac_lib in '' x; do + if test -z "$ac_lib"; then + ac_res="none required" + else + ac_res=-l$ac_lib + LIBS="-l$ac_lib $ac_func_search_save_LIBS" + fi + if ac_fn_c_try_link "$LINENO"; then : + ac_cv_search_opendir=$ac_res +fi +rm -f core conftest.err conftest.$ac_objext \ + conftest$ac_exeext + if ${ac_cv_search_opendir+:} false; then : + break +fi +done +if ${ac_cv_search_opendir+:} false; then : + +else + ac_cv_search_opendir=no +fi +rm conftest.$ac_ext +LIBS=$ac_func_search_save_LIBS +fi +{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_cv_search_opendir" >&5 +$as_echo "$ac_cv_search_opendir" >&6; } +ac_res=$ac_cv_search_opendir +if test "$ac_res" != no; then : + test "$ac_res" = "none required" || LIBS="$ac_res $LIBS" + +fi + +fi + +{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for ANSI C header files" >&5 +$as_echo_n "checking for ANSI C header files... " >&6; } +if ${ac_cv_header_stdc+:} false; then : + $as_echo_n "(cached) " >&6 +else + cat confdefs.h - <<_ACEOF >conftest.$ac_ext +/* end confdefs.h. */ +#include <stdlib.h> +#include <stdarg.h> +#include <string.h> +#include <float.h> + +int +main () +{ + + ; + return 0; +} +_ACEOF +if ac_fn_c_try_compile "$LINENO"; then : + ac_cv_header_stdc=yes +else + ac_cv_header_stdc=no +fi +rm -f core conftest.err conftest.$ac_objext conftest.$ac_ext + +if test $ac_cv_header_stdc = yes; then + # SunOS 4.x string.h does not declare mem*, contrary to ANSI. + cat confdefs.h - <<_ACEOF >conftest.$ac_ext +/* end confdefs.h. */ +#include <string.h> + +_ACEOF +if (eval "$ac_cpp conftest.$ac_ext") 2>&5 | + $EGREP "memchr" >/dev/null 2>&1; then : + +else + ac_cv_header_stdc=no +fi +rm -f conftest* + +fi + +if test $ac_cv_header_stdc = yes; then + # ISC 2.0.2 stdlib.h does not declare free, contrary to ANSI. + cat confdefs.h - <<_ACEOF >conftest.$ac_ext +/* end confdefs.h. */ +#include <stdlib.h> + +_ACEOF +if (eval "$ac_cpp conftest.$ac_ext") 2>&5 | + $EGREP "free" >/dev/null 2>&1; then : + +else + ac_cv_header_stdc=no +fi +rm -f conftest* + +fi + +if test $ac_cv_header_stdc = yes; then + # /bin/cc in Irix-4.0.5 gets non-ANSI ctype macros unless using -ansi. + if test "$cross_compiling" = yes; then : + : +else + cat confdefs.h - <<_ACEOF >conftest.$ac_ext +/* end confdefs.h. */ +#include <ctype.h> +#include <stdlib.h> +#if ((' ' & 0x0FF) == 0x020) +# define ISLOWER(c) ('a' <= (c) && (c) <= 'z') +# define TOUPPER(c) (ISLOWER(c) ? 'A' + ((c) - 'a') : (c)) +#else +# define ISLOWER(c) \ + (('a' <= (c) && (c) <= 'i') \ + || ('j' <= (c) && (c) <= 'r') \ + || ('s' <= (c) && (c) <= 'z')) +# define TOUPPER(c) (ISLOWER(c) ? ((c) | 0x40) : (c)) +#endif + +#define XOR(e, f) (((e) && !(f)) || (!(e) && (f))) +int +main () +{ + int i; + for (i = 0; i < 256; i++) + if (XOR (islower (i), ISLOWER (i)) + || toupper (i) != TOUPPER (i)) + return 2; + return 0; +} +_ACEOF +if ac_fn_c_try_run "$LINENO"; then : + +else + ac_cv_header_stdc=no +fi +rm -f core *.core core.conftest.* gmon.out bb.out conftest$ac_exeext \ + conftest.$ac_objext conftest.beam conftest.$ac_ext +fi + +fi +fi +{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_cv_header_stdc" >&5 +$as_echo "$ac_cv_header_stdc" >&6; } +if test $ac_cv_header_stdc = yes; then + +$as_echo "#define STDC_HEADERS 1" >>confdefs.h + +fi + +{ $as_echo "$as_me:${as_lineno-$LINENO}: checking whether closedir returns void" >&5 +$as_echo_n "checking whether closedir returns void... " >&6; } +if ${ac_cv_func_closedir_void+:} false; then : + $as_echo_n "(cached) " >&6 +else + if test "$cross_compiling" = yes; then : + ac_cv_func_closedir_void=yes +else + cat confdefs.h - <<_ACEOF >conftest.$ac_ext +/* end confdefs.h. */ +$ac_includes_default +#include <$ac_header_dirent> +#ifndef __cplusplus +int closedir (); +#endif + +int +main () +{ +return closedir (opendir (".")) != 0; + ; + return 0; +} +_ACEOF +if ac_fn_c_try_run "$LINENO"; then : + ac_cv_func_closedir_void=no +else + ac_cv_func_closedir_void=yes +fi +rm -f core *.core core.conftest.* gmon.out bb.out conftest$ac_exeext \ + conftest.$ac_objext conftest.beam conftest.$ac_ext +fi + +fi +{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_cv_func_closedir_void" >&5 +$as_echo "$ac_cv_func_closedir_void" >&6; } +if test $ac_cv_func_closedir_void = yes; then + +$as_echo "#define CLOSEDIR_VOID 1" >>confdefs.h + +fi + +for ac_header in assert.h float.h limits.h pwd.h stdlib.h sys/param.h +do : + as_ac_Header=`$as_echo "ac_cv_header_$ac_header" | $as_tr_sh` +ac_fn_c_check_header_mongrel "$LINENO" "$ac_header" "$as_ac_Header" "$ac_includes_default" +if eval test \"x\$"$as_ac_Header"\" = x"yes"; then : + cat >>confdefs.h <<_ACEOF +#define `$as_echo "HAVE_$ac_header" | $as_tr_cpp` 1 +_ACEOF + +fi + +done + +for ac_func in putenv +do : + ac_fn_c_check_func "$LINENO" "putenv" "ac_cv_func_putenv" +if test "x$ac_cv_func_putenv" = xyes; then : + cat >>confdefs.h <<_ACEOF +#define HAVE_PUTENV 1 +_ACEOF + +fi +done + +for ac_func in getcwd getwd memcmp memcpy mkstemp mktemp strchr strrchr +do : + as_ac_var=`$as_echo "ac_cv_func_$ac_func" | $as_tr_sh` +ac_fn_c_check_func "$LINENO" "$ac_func" "$as_ac_var" +if eval test \"x\$"$as_ac_var"\" = x"yes"; then : + cat >>confdefs.h <<_ACEOF +#define `$as_echo "HAVE_$ac_func" | $as_tr_cpp` 1 +_ACEOF + +fi +done + +{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for an ANSI C-conforming const" >&5 +$as_echo_n "checking for an ANSI C-conforming const... " >&6; } +if ${ac_cv_c_const+:} false; then : + $as_echo_n "(cached) " >&6 +else + cat confdefs.h - <<_ACEOF >conftest.$ac_ext +/* end confdefs.h. */ + +int +main () +{ + +#ifndef __cplusplus + /* Ultrix mips cc rejects this sort of thing. */ + typedef int charset[2]; + const charset cs = { 0, 0 }; + /* SunOS 4.1.1 cc rejects this. */ + char const *const *pcpcc; + char **ppc; + /* NEC SVR4.0.2 mips cc rejects this. */ + struct point {int x, y;}; + static struct point const zero = {0,0}; + /* AIX XL C 1.02.0.0 rejects this. + It does not let you subtract one const X* pointer from another in + an arm of an if-expression whose if-part is not a constant + expression */ + const char *g = "string"; + pcpcc = &g + (g ? g-g : 0); + /* HPUX 7.0 cc rejects these. */ + ++pcpcc; + ppc = (char**) pcpcc; + pcpcc = (char const *const *) ppc; + { /* SCO 3.2v4 cc rejects this sort of thing. */ + char tx; + char *t = &tx; + char const *s = 0 ? (char *) 0 : (char const *) 0; + + *t++ = 0; + if (s) return 0; + } + { /* Someone thinks the Sun supposedly-ANSI compiler will reject this. */ + int x[] = {25, 17}; + const int *foo = &x[0]; + ++foo; + } + { /* Sun SC1.0 ANSI compiler rejects this -- but not the above. */ + typedef const int *iptr; + iptr p = 0; + ++p; + } + { /* AIX XL C 1.02.0.0 rejects this sort of thing, saying + "k.c", line 2.27: 1506-025 (S) Operand must be a modifiable lvalue. */ + struct s { int j; const int *ap[3]; } bx; + struct s *b = &bx; b->j = 5; + } + { /* ULTRIX-32 V3.1 (Rev 9) vcc rejects this */ + const int foo = 10; + if (!foo) return 0; + } + return !cs[0] && !zero.x; +#endif + + ; + return 0; +} +_ACEOF +if ac_fn_c_try_compile "$LINENO"; then : + ac_cv_c_const=yes +else + ac_cv_c_const=no +fi +rm -f core conftest.err conftest.$ac_objext conftest.$ac_ext +fi +{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_cv_c_const" >&5 +$as_echo "$ac_cv_c_const" >&6; } +if test $ac_cv_c_const = no; then + +$as_echo "#define const /**/" >>confdefs.h + +fi + +{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for inline" >&5 +$as_echo_n "checking for inline... " >&6; } +if ${ac_cv_c_inline+:} false; then : + $as_echo_n "(cached) " >&6 +else + ac_cv_c_inline=no +for ac_kw in inline __inline__ __inline; do + cat confdefs.h - <<_ACEOF >conftest.$ac_ext +/* end confdefs.h. */ +#ifndef __cplusplus +typedef int foo_t; +static $ac_kw foo_t static_foo () {return 0; } +$ac_kw foo_t foo () {return 0; } +#endif + +_ACEOF +if ac_fn_c_try_compile "$LINENO"; then : + ac_cv_c_inline=$ac_kw +fi +rm -f core conftest.err conftest.$ac_objext conftest.$ac_ext + test "$ac_cv_c_inline" != no && break +done + +fi +{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_cv_c_inline" >&5 +$as_echo "$ac_cv_c_inline" >&6; } + +case $ac_cv_c_inline in + inline | yes) ;; + *) + case $ac_cv_c_inline in + no) ac_val=;; + *) ac_val=$ac_cv_c_inline;; + esac + cat >>confdefs.h <<_ACEOF +#ifndef __cplusplus +#define inline $ac_val +#endif +_ACEOF + ;; +esac + +ac_fn_c_check_type "$LINENO" "size_t" "ac_cv_type_size_t" "$ac_includes_default" +if test "x$ac_cv_type_size_t" = xyes; then : + +else + +cat >>confdefs.h <<_ACEOF +#define size_t unsigned int +_ACEOF + +fi + +ac_fn_c_find_intX_t "$LINENO" "64" "ac_cv_c_int64_t" +case $ac_cv_c_int64_t in #( + no|yes) ;; #( + *) + +cat >>confdefs.h <<_ACEOF +#define int64_t $ac_cv_c_int64_t +_ACEOF +;; +esac + +ac_fn_c_find_uintX_t "$LINENO" "64" "ac_cv_c_uint64_t" +case $ac_cv_c_uint64_t in #( + no|yes) ;; #( + *) + +$as_echo "#define _UINT64_T 1" >>confdefs.h + + +cat >>confdefs.h <<_ACEOF +#define uint64_t $ac_cv_c_uint64_t +_ACEOF +;; + esac + +case :$ac_cv_c_int64_t:$ac_cv_c_int64_t: in #( + *':no:'*) : + as_fn_error $? "Sorry, your compiler does not support 64-bit integer types." "$LINENO" 5 ;; #( + *) : + ;; +esac +ac_fn_c_check_decl "$LINENO" "isascii" "ac_cv_have_decl_isascii" "#include <ctype.h> +" +if test "x$ac_cv_have_decl_isascii" = xyes; then : + ac_have_decl=1 +else + ac_have_decl=0 +fi + +cat >>confdefs.h <<_ACEOF +#define HAVE_DECL_ISASCII $ac_have_decl +_ACEOF + +ac_fn_c_check_member "$LINENO" "struct stat" "st_mtim" "ac_cv_member_struct_stat_st_mtim" "$ac_includes_default" +if test "x$ac_cv_member_struct_stat_st_mtim" = xyes; then : + +cat >>confdefs.h <<_ACEOF +#define HAVE_STRUCT_STAT_ST_MTIM 1 +_ACEOF + + +fi + + +# Configure options for dvipng also shown at the TeX Live top-level. +## texk/dvipng/ac/dvipng.ac: configure.ac fragment for the TeX Live subdirectory texk/dvipng/ +## configure options for dvipng +# Check whether --enable-debug was given. +if test "${enable_debug+set}" = set; then : + enableval=$enable_debug; +fi + +# Check whether --enable-timing was given. +if test "${enable_timing+set}" = set; then : + enableval=$enable_timing; +fi + + +# Check whether --with-gs was given. +if test "${with_gs+set}" = set; then : + withval=$with_gs; +fi + + + + + + if test "x$cross_compiling" = xyes; then + cross_TRUE= + cross_FALSE='#' +else + cross_TRUE='#' + cross_FALSE= +fi + + +if test "x$enable_debug" != xno; then + enable_debug=yes + +$as_echo "#define DEBUG 1" >>confdefs.h + +fi + +if test "x$enable_timing" = xyes; then + +$as_echo "#define TIMING 1" >>confdefs.h + +fi + +# Checks for programs. +# For a native TeX Live build '--with-gs' is ignored. +if test "x$enable_native_texlive_build" = xyes; then : + with_gs= +fi +case $with_gs in #( + "" | yes | no) : + # Extract the first word of "gs", so it can be a program name with args. +set dummy gs; ac_word=$2 +{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $ac_word" >&5 +$as_echo_n "checking for $ac_word... " >&6; } +if ${ac_cv_prog_GS+:} false; then : + $as_echo_n "(cached) " >&6 +else + if test -n "$GS"; then + ac_cv_prog_GS="$GS" # Let the user override the test. +else +as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in $PATH +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + for ac_exec_ext in '' $ac_executable_extensions; do + if as_fn_executable_p "$as_dir/$ac_word$ac_exec_ext"; then + ac_cv_prog_GS="gs" + $as_echo "$as_me:${as_lineno-$LINENO}: found $as_dir/$ac_word$ac_exec_ext" >&5 + break 2 + fi +done + done +IFS=$as_save_IFS + +fi +fi +GS=$ac_cv_prog_GS +if test -n "$GS"; then + { $as_echo "$as_me:${as_lineno-$LINENO}: result: $GS" >&5 +$as_echo "$GS" >&6; } +else + { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5 +$as_echo "no" >&6; } +fi + + ;; #( + *) : + # Extract the first word of ""$with_gs"", so it can be a program name with args. +set dummy "$with_gs"; ac_word=$2 +{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $ac_word" >&5 +$as_echo_n "checking for $ac_word... " >&6; } +if ${ac_cv_path_GS+:} false; then : + $as_echo_n "(cached) " >&6 +else + case $GS in + [\\/]* | ?:[\\/]*) + ac_cv_path_GS="$GS" # Let the user override the test with a path. + ;; + *) + as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in $PATH +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + for ac_exec_ext in '' $ac_executable_extensions; do + if as_fn_executable_p "$as_dir/$ac_word$ac_exec_ext"; then + ac_cv_path_GS="$as_dir/$ac_word$ac_exec_ext" + $as_echo "$as_me:${as_lineno-$LINENO}: found $as_dir/$ac_word$ac_exec_ext" >&5 + break 2 + fi +done + done +IFS=$as_save_IFS + + ;; +esac +fi +GS=$ac_cv_path_GS +if test -n "$GS"; then + { $as_echo "$as_me:${as_lineno-$LINENO}: result: $GS" >&5 +$as_echo "$GS" >&6; } +else + { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5 +$as_echo "no" >&6; } +fi + + ;; +esac +if test -n "$GS"; then : + GS_WARN= +{ $as_echo "$as_me:${as_lineno-$LINENO}: checking whether $GS has the pngalpha device" >&5 +$as_echo_n "checking whether $GS has the pngalpha device... " >&6; } +if $GS -h | grep pngalpha >/dev/null; then + { $as_echo "$as_me:${as_lineno-$LINENO}: result: yes" >&5 +$as_echo "yes" >&6; } +else + { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5 +$as_echo "no" >&6; } + GS_WARN="Your EPS inclusions will be cropped to the + boundingbox, and rendered on an opaque background. + Upgrade GhostScript to avoid this." + { $as_echo "$as_me:${as_lineno-$LINENO}: checking whether $GS has the png16m device" >&5 +$as_echo_n "checking whether $GS has the png16m device... " >&6; } +if $GS -h | grep png16m >/dev/null; then + { $as_echo "$as_me:${as_lineno-$LINENO}: result: yes" >&5 +$as_echo "yes" >&6; } +else + { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5 +$as_echo "no" >&6; } + GS_WARN="Your EPS inclusions may not work. + Upgrade/install GhostScript to avoid this." +fi + +fi + +if test -n "$GS_WARN"; then + { $as_echo "$as_me:${as_lineno-$LINENO}: WARNING: $GS_WARN" >&5 +$as_echo "$as_me: WARNING: $GS_WARN" >&2;} +fi + +else + { $as_echo "$as_me:${as_lineno-$LINENO}: WARNING: Cannot find GhostScript in your PATH" >&5 +$as_echo "$as_me: WARNING: Cannot find GhostScript in your PATH" >&2;} + GS=gs +fi + +cat >>confdefs.h <<_ACEOF +#define GS_PATH "$GS" +_ACEOF + + +# Checks for libraries. +{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for library containing pow" >&5 +$as_echo_n "checking for library containing pow... " >&6; } +if ${ac_cv_search_pow+:} false; then : + $as_echo_n "(cached) " >&6 +else + ac_func_search_save_LIBS=$LIBS +cat confdefs.h - <<_ACEOF >conftest.$ac_ext +/* end confdefs.h. */ + +/* Override any GCC internal prototype to avoid an error. + Use char because int might match the return type of a GCC + builtin and then its argument prototype would still apply. */ +#ifdef __cplusplus +extern "C" +#endif +char pow (); +int +main () +{ +return pow (); + ; + return 0; +} +_ACEOF +for ac_lib in '' m; do + if test -z "$ac_lib"; then + ac_res="none required" + else + ac_res=-l$ac_lib + LIBS="-l$ac_lib $ac_func_search_save_LIBS" + fi + if ac_fn_c_try_link "$LINENO"; then : + ac_cv_search_pow=$ac_res +fi +rm -f core conftest.err conftest.$ac_objext \ + conftest$ac_exeext + if ${ac_cv_search_pow+:} false; then : + break +fi +done +if ${ac_cv_search_pow+:} false; then : + +else + ac_cv_search_pow=no +fi +rm conftest.$ac_ext +LIBS=$ac_func_search_save_LIBS +fi +{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_cv_search_pow" >&5 +$as_echo "$ac_cv_search_pow" >&6; } +ac_res=$ac_cv_search_pow +if test "$ac_res" != no; then : + test "$ac_res" = "none required" || LIBS="$ac_res $LIBS" + +fi + +{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for library containing basename" >&5 +$as_echo_n "checking for library containing basename... " >&6; } +if ${ac_cv_search_basename+:} false; then : + $as_echo_n "(cached) " >&6 +else + ac_func_search_save_LIBS=$LIBS +cat confdefs.h - <<_ACEOF >conftest.$ac_ext +/* end confdefs.h. */ + +/* Override any GCC internal prototype to avoid an error. + Use char because int might match the return type of a GCC + builtin and then its argument prototype would still apply. */ +#ifdef __cplusplus +extern "C" +#endif +char basename (); +int +main () +{ +return basename (); + ; + return 0; +} +_ACEOF +for ac_lib in '' gen; do + if test -z "$ac_lib"; then + ac_res="none required" + else + ac_res=-l$ac_lib + LIBS="-l$ac_lib $ac_func_search_save_LIBS" + fi + if ac_fn_c_try_link "$LINENO"; then : + ac_cv_search_basename=$ac_res +fi +rm -f core conftest.err conftest.$ac_objext \ + conftest$ac_exeext + if ${ac_cv_search_basename+:} false; then : + break +fi +done +if ${ac_cv_search_basename+:} false; then : + +else + ac_cv_search_basename=no +fi +rm conftest.$ac_ext +LIBS=$ac_func_search_save_LIBS +fi +{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_cv_search_basename" >&5 +$as_echo "$ac_cv_search_basename" >&6; } +ac_res=$ac_cv_search_basename +if test "$ac_res" != no; then : + test "$ac_res" = "none required" || LIBS="$ac_res $LIBS" + +fi + + +# Checks for header files. +{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for ANSI C header files" >&5 +$as_echo_n "checking for ANSI C header files... " >&6; } +if ${ac_cv_header_stdc+:} false; then : + $as_echo_n "(cached) " >&6 +else + cat confdefs.h - <<_ACEOF >conftest.$ac_ext +/* end confdefs.h. */ +#include <stdlib.h> +#include <stdarg.h> +#include <string.h> +#include <float.h> + +int +main () +{ + + ; + return 0; +} +_ACEOF +if ac_fn_c_try_compile "$LINENO"; then : + ac_cv_header_stdc=yes +else + ac_cv_header_stdc=no +fi +rm -f core conftest.err conftest.$ac_objext conftest.$ac_ext + +if test $ac_cv_header_stdc = yes; then + # SunOS 4.x string.h does not declare mem*, contrary to ANSI. + cat confdefs.h - <<_ACEOF >conftest.$ac_ext +/* end confdefs.h. */ +#include <string.h> + +_ACEOF +if (eval "$ac_cpp conftest.$ac_ext") 2>&5 | + $EGREP "memchr" >/dev/null 2>&1; then : + +else + ac_cv_header_stdc=no +fi +rm -f conftest* + +fi + +if test $ac_cv_header_stdc = yes; then + # ISC 2.0.2 stdlib.h does not declare free, contrary to ANSI. + cat confdefs.h - <<_ACEOF >conftest.$ac_ext +/* end confdefs.h. */ +#include <stdlib.h> + +_ACEOF +if (eval "$ac_cpp conftest.$ac_ext") 2>&5 | + $EGREP "free" >/dev/null 2>&1; then : + +else + ac_cv_header_stdc=no +fi +rm -f conftest* + +fi + +if test $ac_cv_header_stdc = yes; then + # /bin/cc in Irix-4.0.5 gets non-ANSI ctype macros unless using -ansi. + if test "$cross_compiling" = yes; then : + : +else + cat confdefs.h - <<_ACEOF >conftest.$ac_ext +/* end confdefs.h. */ +#include <ctype.h> +#include <stdlib.h> +#if ((' ' & 0x0FF) == 0x020) +# define ISLOWER(c) ('a' <= (c) && (c) <= 'z') +# define TOUPPER(c) (ISLOWER(c) ? 'A' + ((c) - 'a') : (c)) +#else +# define ISLOWER(c) \ + (('a' <= (c) && (c) <= 'i') \ + || ('j' <= (c) && (c) <= 'r') \ + || ('s' <= (c) && (c) <= 'z')) +# define TOUPPER(c) (ISLOWER(c) ? ((c) | 0x40) : (c)) +#endif + +#define XOR(e, f) (((e) && !(f)) || (!(e) && (f))) +int +main () +{ + int i; + for (i = 0; i < 256; i++) + if (XOR (islower (i), ISLOWER (i)) + || toupper (i) != TOUPPER (i)) + return 2; + return 0; +} +_ACEOF +if ac_fn_c_try_run "$LINENO"; then : + +else + ac_cv_header_stdc=no +fi +rm -f core *.core core.conftest.* gmon.out bb.out conftest$ac_exeext \ + conftest.$ac_objext conftest.beam conftest.$ac_ext +fi + +fi +fi +{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_cv_header_stdc" >&5 +$as_echo "$ac_cv_header_stdc" >&6; } +if test $ac_cv_header_stdc = yes; then + +$as_echo "#define STDC_HEADERS 1" >>confdefs.h + +fi + +for ac_header in fcntl.h sys/time.h +do : + as_ac_Header=`$as_echo "ac_cv_header_$ac_header" | $as_tr_sh` +ac_fn_c_check_header_mongrel "$LINENO" "$ac_header" "$as_ac_Header" "$ac_includes_default" +if eval test \"x\$"$as_ac_Header"\" = x"yes"; then : + cat >>confdefs.h <<_ACEOF +#define `$as_echo "HAVE_$ac_header" | $as_tr_cpp` 1 +_ACEOF + +fi + +done + +{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for sys/wait.h that is POSIX.1 compatible" >&5 +$as_echo_n "checking for sys/wait.h that is POSIX.1 compatible... " >&6; } +if ${ac_cv_header_sys_wait_h+:} false; then : + $as_echo_n "(cached) " >&6 +else + cat confdefs.h - <<_ACEOF >conftest.$ac_ext +/* end confdefs.h. */ +#include <sys/types.h> +#include <sys/wait.h> +#ifndef WEXITSTATUS +# define WEXITSTATUS(stat_val) ((unsigned int) (stat_val) >> 8) +#endif +#ifndef WIFEXITED +# define WIFEXITED(stat_val) (((stat_val) & 255) == 0) +#endif + +int +main () +{ + int s; + wait (&s); + s = WIFEXITED (s) ? WEXITSTATUS (s) : 1; + ; + return 0; +} +_ACEOF +if ac_fn_c_try_compile "$LINENO"; then : + ac_cv_header_sys_wait_h=yes +else + ac_cv_header_sys_wait_h=no +fi +rm -f core conftest.err conftest.$ac_objext conftest.$ac_ext +fi +{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_cv_header_sys_wait_h" >&5 +$as_echo "$ac_cv_header_sys_wait_h" >&6; } +if test $ac_cv_header_sys_wait_h = yes; then + +$as_echo "#define HAVE_SYS_WAIT_H 1" >>confdefs.h + +fi + +{ $as_echo "$as_me:${as_lineno-$LINENO}: checking whether time.h and sys/time.h may both be included" >&5 +$as_echo_n "checking whether time.h and sys/time.h may both be included... " >&6; } +if ${ac_cv_header_time+:} false; then : + $as_echo_n "(cached) " >&6 +else + cat confdefs.h - <<_ACEOF >conftest.$ac_ext +/* end confdefs.h. */ +#include <sys/types.h> +#include <sys/time.h> +#include <time.h> + +int +main () +{ +if ((struct tm *) 0) +return 0; + ; + return 0; +} +_ACEOF +if ac_fn_c_try_compile "$LINENO"; then : + ac_cv_header_time=yes +else + ac_cv_header_time=no +fi +rm -f core conftest.err conftest.$ac_objext conftest.$ac_ext +fi +{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_cv_header_time" >&5 +$as_echo "$ac_cv_header_time" >&6; } +if test $ac_cv_header_time = yes; then + +$as_echo "#define TIME_WITH_SYS_TIME 1" >>confdefs.h + +fi + +{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for stdbool.h that conforms to C99" >&5 +$as_echo_n "checking for stdbool.h that conforms to C99... " >&6; } +if ${ac_cv_header_stdbool_h+:} false; then : + $as_echo_n "(cached) " >&6 +else + cat confdefs.h - <<_ACEOF >conftest.$ac_ext +/* end confdefs.h. */ + + #include <stdbool.h> + #ifndef bool + "error: bool is not defined" + #endif + #ifndef false + "error: false is not defined" + #endif + #if false + "error: false is not 0" + #endif + #ifndef true + "error: true is not defined" + #endif + #if true != 1 + "error: true is not 1" + #endif + #ifndef __bool_true_false_are_defined + "error: __bool_true_false_are_defined is not defined" + #endif + + struct s { _Bool s: 1; _Bool t; } s; + + char a[true == 1 ? 1 : -1]; + char b[false == 0 ? 1 : -1]; + char c[__bool_true_false_are_defined == 1 ? 1 : -1]; + char d[(bool) 0.5 == true ? 1 : -1]; + /* See body of main program for 'e'. */ + char f[(_Bool) 0.0 == false ? 1 : -1]; + char g[true]; + char h[sizeof (_Bool)]; + char i[sizeof s.t]; + enum { j = false, k = true, l = false * true, m = true * 256 }; + /* The following fails for + HP aC++/ANSI C B3910B A.05.55 [Dec 04 2003]. */ + _Bool n[m]; + char o[sizeof n == m * sizeof n[0] ? 1 : -1]; + char p[-1 - (_Bool) 0 < 0 && -1 - (bool) 0 < 0 ? 1 : -1]; + /* Catch a bug in an HP-UX C compiler. See + http://gcc.gnu.org/ml/gcc-patches/2003-12/msg02303.html + http://lists.gnu.org/archive/html/bug-coreutils/2005-11/msg00161.html + */ + _Bool q = true; + _Bool *pq = &q; + +int +main () +{ + + bool e = &s; + *pq |= q; + *pq |= ! q; + /* Refer to every declared value, to avoid compiler optimizations. */ + return (!a + !b + !c + !d + !e + !f + !g + !h + !i + !!j + !k + !!l + + !m + !n + !o + !p + !q + !pq); + + ; + return 0; +} +_ACEOF +if ac_fn_c_try_compile "$LINENO"; then : + ac_cv_header_stdbool_h=yes +else + ac_cv_header_stdbool_h=no +fi +rm -f core conftest.err conftest.$ac_objext conftest.$ac_ext +fi +{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_cv_header_stdbool_h" >&5 +$as_echo "$ac_cv_header_stdbool_h" >&6; } + ac_fn_c_check_type "$LINENO" "_Bool" "ac_cv_type__Bool" "$ac_includes_default" +if test "x$ac_cv_type__Bool" = xyes; then : + +cat >>confdefs.h <<_ACEOF +#define HAVE__BOOL 1 +_ACEOF + + +fi + + +if test $ac_cv_header_stdbool_h = yes; then + +$as_echo "#define HAVE_STDBOOL_H 1" >>confdefs.h + +fi + + +# Checks for typedefs, structures, and compiler characteristics. +{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for an ANSI C-conforming const" >&5 +$as_echo_n "checking for an ANSI C-conforming const... " >&6; } +if ${ac_cv_c_const+:} false; then : + $as_echo_n "(cached) " >&6 +else + cat confdefs.h - <<_ACEOF >conftest.$ac_ext +/* end confdefs.h. */ + +int +main () +{ + +#ifndef __cplusplus + /* Ultrix mips cc rejects this sort of thing. */ + typedef int charset[2]; + const charset cs = { 0, 0 }; + /* SunOS 4.1.1 cc rejects this. */ + char const *const *pcpcc; + char **ppc; + /* NEC SVR4.0.2 mips cc rejects this. */ + struct point {int x, y;}; + static struct point const zero = {0,0}; + /* AIX XL C 1.02.0.0 rejects this. + It does not let you subtract one const X* pointer from another in + an arm of an if-expression whose if-part is not a constant + expression */ + const char *g = "string"; + pcpcc = &g + (g ? g-g : 0); + /* HPUX 7.0 cc rejects these. */ + ++pcpcc; + ppc = (char**) pcpcc; + pcpcc = (char const *const *) ppc; + { /* SCO 3.2v4 cc rejects this sort of thing. */ + char tx; + char *t = &tx; + char const *s = 0 ? (char *) 0 : (char const *) 0; + + *t++ = 0; + if (s) return 0; + } + { /* Someone thinks the Sun supposedly-ANSI compiler will reject this. */ + int x[] = {25, 17}; + const int *foo = &x[0]; + ++foo; + } + { /* Sun SC1.0 ANSI compiler rejects this -- but not the above. */ + typedef const int *iptr; + iptr p = 0; + ++p; + } + { /* AIX XL C 1.02.0.0 rejects this sort of thing, saying + "k.c", line 2.27: 1506-025 (S) Operand must be a modifiable lvalue. */ + struct s { int j; const int *ap[3]; } bx; + struct s *b = &bx; b->j = 5; + } + { /* ULTRIX-32 V3.1 (Rev 9) vcc rejects this */ + const int foo = 10; + if (!foo) return 0; + } + return !cs[0] && !zero.x; +#endif + + ; + return 0; +} +_ACEOF +if ac_fn_c_try_compile "$LINENO"; then : + ac_cv_c_const=yes +else + ac_cv_c_const=no +fi +rm -f core conftest.err conftest.$ac_objext conftest.$ac_ext +fi +{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_cv_c_const" >&5 +$as_echo "$ac_cv_c_const" >&6; } +if test $ac_cv_c_const = no; then + +$as_echo "#define const /**/" >>confdefs.h + +fi + +ac_fn_c_check_type "$LINENO" "pid_t" "ac_cv_type_pid_t" "$ac_includes_default" +if test "x$ac_cv_type_pid_t" = xyes; then : + +else + +cat >>confdefs.h <<_ACEOF +#define pid_t int +_ACEOF + +fi + + +# Checks for library functions. + + + + for ac_header in $ac_header_list +do : + as_ac_Header=`$as_echo "ac_cv_header_$ac_header" | $as_tr_sh` +ac_fn_c_check_header_compile "$LINENO" "$ac_header" "$as_ac_Header" "$ac_includes_default +" +if eval test \"x\$"$as_ac_Header"\" = x"yes"; then : + cat >>confdefs.h <<_ACEOF +#define `$as_echo "HAVE_$ac_header" | $as_tr_cpp` 1 +_ACEOF + +fi + +done + + + + + + + + +for ac_func in getpagesize +do : + ac_fn_c_check_func "$LINENO" "getpagesize" "ac_cv_func_getpagesize" +if test "x$ac_cv_func_getpagesize" = xyes; then : + cat >>confdefs.h <<_ACEOF +#define HAVE_GETPAGESIZE 1 +_ACEOF + +fi +done + +{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for working mmap" >&5 +$as_echo_n "checking for working mmap... " >&6; } +if ${ac_cv_func_mmap_fixed_mapped+:} false; then : + $as_echo_n "(cached) " >&6 +else + if test "$cross_compiling" = yes; then : + ac_cv_func_mmap_fixed_mapped=no +else + cat confdefs.h - <<_ACEOF >conftest.$ac_ext +/* end confdefs.h. */ +$ac_includes_default +/* malloc might have been renamed as rpl_malloc. */ +#undef malloc + +/* Thanks to Mike Haertel and Jim Avera for this test. + Here is a matrix of mmap possibilities: + mmap private not fixed + mmap private fixed at somewhere currently unmapped + mmap private fixed at somewhere already mapped + mmap shared not fixed + mmap shared fixed at somewhere currently unmapped + mmap shared fixed at somewhere already mapped + For private mappings, we should verify that changes cannot be read() + back from the file, nor mmap's back from the file at a different + address. (There have been systems where private was not correctly + implemented like the infamous i386 svr4.0, and systems where the + VM page cache was not coherent with the file system buffer cache + like early versions of FreeBSD and possibly contemporary NetBSD.) + For shared mappings, we should conversely verify that changes get + propagated back to all the places they're supposed to be. + + Grep wants private fixed already mapped. + The main things grep needs to know about mmap are: + * does it exist and is it safe to write into the mmap'd area + * how to use it (BSD variants) */ + +#include <fcntl.h> +#include <sys/mman.h> + +#if !defined STDC_HEADERS && !defined HAVE_STDLIB_H +char *malloc (); +#endif + +/* This mess was copied from the GNU getpagesize.h. */ +#ifndef HAVE_GETPAGESIZE +# ifdef _SC_PAGESIZE +# define getpagesize() sysconf(_SC_PAGESIZE) +# else /* no _SC_PAGESIZE */ +# ifdef HAVE_SYS_PARAM_H +# include <sys/param.h> +# ifdef EXEC_PAGESIZE +# define getpagesize() EXEC_PAGESIZE +# else /* no EXEC_PAGESIZE */ +# ifdef NBPG +# define getpagesize() NBPG * CLSIZE +# ifndef CLSIZE +# define CLSIZE 1 +# endif /* no CLSIZE */ +# else /* no NBPG */ +# ifdef NBPC +# define getpagesize() NBPC +# else /* no NBPC */ +# ifdef PAGESIZE +# define getpagesize() PAGESIZE +# endif /* PAGESIZE */ +# endif /* no NBPC */ +# endif /* no NBPG */ +# endif /* no EXEC_PAGESIZE */ +# else /* no HAVE_SYS_PARAM_H */ +# define getpagesize() 8192 /* punt totally */ +# endif /* no HAVE_SYS_PARAM_H */ +# endif /* no _SC_PAGESIZE */ + +#endif /* no HAVE_GETPAGESIZE */ + +int +main () +{ + char *data, *data2, *data3; + const char *cdata2; + int i, pagesize; + int fd, fd2; + + pagesize = getpagesize (); + + /* First, make a file with some known garbage in it. */ + data = (char *) malloc (pagesize); + if (!data) + return 1; + for (i = 0; i < pagesize; ++i) + *(data + i) = rand (); + umask (0); + fd = creat ("conftest.mmap", 0600); + if (fd < 0) + return 2; + if (write (fd, data, pagesize) != pagesize) + return 3; + close (fd); + + /* Next, check that the tail of a page is zero-filled. File must have + non-zero length, otherwise we risk SIGBUS for entire page. */ + fd2 = open ("conftest.txt", O_RDWR | O_CREAT | O_TRUNC, 0600); + if (fd2 < 0) + return 4; + cdata2 = ""; + if (write (fd2, cdata2, 1) != 1) + return 5; + data2 = (char *) mmap (0, pagesize, PROT_READ | PROT_WRITE, MAP_SHARED, fd2, 0L); + if (data2 == MAP_FAILED) + return 6; + for (i = 0; i < pagesize; ++i) + if (*(data2 + i)) + return 7; + close (fd2); + if (munmap (data2, pagesize)) + return 8; + + /* Next, try to mmap the file at a fixed address which already has + something else allocated at it. If we can, also make sure that + we see the same garbage. */ + fd = open ("conftest.mmap", O_RDWR); + if (fd < 0) + return 9; + if (data2 != mmap (data2, pagesize, PROT_READ | PROT_WRITE, + MAP_PRIVATE | MAP_FIXED, fd, 0L)) + return 10; + for (i = 0; i < pagesize; ++i) + if (*(data + i) != *(data2 + i)) + return 11; + + /* Finally, make sure that changes to the mapped area do not + percolate back to the file as seen by read(). (This is a bug on + some variants of i386 svr4.0.) */ + for (i = 0; i < pagesize; ++i) + *(data2 + i) = *(data2 + i) + 1; + data3 = (char *) malloc (pagesize); + if (!data3) + return 12; + if (read (fd, data3, pagesize) != pagesize) + return 13; + for (i = 0; i < pagesize; ++i) + if (*(data + i) != *(data3 + i)) + return 14; + close (fd); + return 0; +} +_ACEOF +if ac_fn_c_try_run "$LINENO"; then : + ac_cv_func_mmap_fixed_mapped=yes +else + ac_cv_func_mmap_fixed_mapped=no +fi +rm -f core *.core core.conftest.* gmon.out bb.out conftest$ac_exeext \ + conftest.$ac_objext conftest.beam conftest.$ac_ext +fi + +fi +{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_cv_func_mmap_fixed_mapped" >&5 +$as_echo "$ac_cv_func_mmap_fixed_mapped" >&6; } +if test $ac_cv_func_mmap_fixed_mapped = yes; then + +$as_echo "#define HAVE_MMAP 1" >>confdefs.h + +fi +rm -f conftest.mmap conftest.txt + +{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for working strtod" >&5 +$as_echo_n "checking for working strtod... " >&6; } +if ${ac_cv_func_strtod+:} false; then : + $as_echo_n "(cached) " >&6 +else + if test "$cross_compiling" = yes; then : + ac_cv_func_strtod=no +else + cat confdefs.h - <<_ACEOF >conftest.$ac_ext +/* end confdefs.h. */ + +$ac_includes_default +#ifndef strtod +double strtod (); +#endif +int +main() +{ + { + /* Some versions of Linux strtod mis-parse strings with leading '+'. */ + char *string = " +69"; + char *term; + double value; + value = strtod (string, &term); + if (value != 69 || term != (string + 4)) + return 1; + } + + { + /* Under Solaris 2.4, strtod returns the wrong value for the + terminating character under some conditions. */ + char *string = "NaN"; + char *term; + strtod (string, &term); + if (term != string && *(term - 1) == 0) + return 1; + } + return 0; +} + +_ACEOF +if ac_fn_c_try_run "$LINENO"; then : + ac_cv_func_strtod=yes +else + ac_cv_func_strtod=no +fi +rm -f core *.core core.conftest.* gmon.out bb.out conftest$ac_exeext \ + conftest.$ac_objext conftest.beam conftest.$ac_ext +fi + +fi +{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_cv_func_strtod" >&5 +$as_echo "$ac_cv_func_strtod" >&6; } +if test $ac_cv_func_strtod = no; then + case " $LIBOBJS " in + *" strtod.$ac_objext "* ) ;; + *) LIBOBJS="$LIBOBJS strtod.$ac_objext" + ;; +esac + +ac_fn_c_check_func "$LINENO" "pow" "ac_cv_func_pow" +if test "x$ac_cv_func_pow" = xyes; then : + +fi + +if test $ac_cv_func_pow = no; then + { $as_echo "$as_me:${as_lineno-$LINENO}: checking for pow in -lm" >&5 +$as_echo_n "checking for pow in -lm... " >&6; } +if ${ac_cv_lib_m_pow+:} false; then : + $as_echo_n "(cached) " >&6 +else + ac_check_lib_save_LIBS=$LIBS +LIBS="-lm $LIBS" +cat confdefs.h - <<_ACEOF >conftest.$ac_ext +/* end confdefs.h. */ + +/* Override any GCC internal prototype to avoid an error. + Use char because int might match the return type of a GCC + builtin and then its argument prototype would still apply. */ +#ifdef __cplusplus +extern "C" +#endif +char pow (); +int +main () +{ +return pow (); + ; + return 0; +} +_ACEOF +if ac_fn_c_try_link "$LINENO"; then : + ac_cv_lib_m_pow=yes +else + ac_cv_lib_m_pow=no +fi +rm -f core conftest.err conftest.$ac_objext \ + conftest$ac_exeext conftest.$ac_ext +LIBS=$ac_check_lib_save_LIBS +fi +{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_cv_lib_m_pow" >&5 +$as_echo "$ac_cv_lib_m_pow" >&6; } +if test "x$ac_cv_lib_m_pow" = xyes; then : + POW_LIB=-lm +else + { $as_echo "$as_me:${as_lineno-$LINENO}: WARNING: cannot find library containing definition of pow" >&5 +$as_echo "$as_me: WARNING: cannot find library containing definition of pow" >&2;} +fi + +fi + +fi + +for ac_func in vprintf +do : + ac_fn_c_check_func "$LINENO" "vprintf" "ac_cv_func_vprintf" +if test "x$ac_cv_func_vprintf" = xyes; then : + cat >>confdefs.h <<_ACEOF +#define HAVE_VPRINTF 1 +_ACEOF + +ac_fn_c_check_func "$LINENO" "_doprnt" "ac_cv_func__doprnt" +if test "x$ac_cv_func__doprnt" = xyes; then : + +$as_echo "#define HAVE_DOPRNT 1" >>confdefs.h + +fi + +fi +done + + +for ac_func in dup2 memset munmap pow putenv strchr strrchr +do : + as_ac_var=`$as_echo "ac_cv_func_$ac_func" | $as_tr_sh` +ac_fn_c_check_func "$LINENO" "$ac_func" "$as_ac_var" +if eval test \"x\$"$as_ac_var"\" = x"yes"; then : + cat >>confdefs.h <<_ACEOF +#define `$as_echo "HAVE_$ac_func" | $as_tr_cpp` 1 +_ACEOF + +fi +done + + +if test "x$enable_timing" = xyes; then + for ac_func in ftime gettimeofday +do : + as_ac_var=`$as_echo "ac_cv_func_$ac_func" | $as_tr_sh` +ac_fn_c_check_func "$LINENO" "$ac_func" "$as_ac_var" +if eval test \"x\$"$as_ac_var"\" = x"yes"; then : + cat >>confdefs.h <<_ACEOF +#define `$as_echo "HAVE_$ac_func" | $as_tr_cpp` 1 +_ACEOF + +fi +done + +fi + +# Documentation-related checks. +# Extract the first word of "makeinfo", so it can be a program name with args. +set dummy makeinfo; ac_word=$2 +{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $ac_word" >&5 +$as_echo_n "checking for $ac_word... " >&6; } +if ${ac_cv_path_MAKEINFO+:} false; then : + $as_echo_n "(cached) " >&6 +else + case $MAKEINFO in + [\\/]* | ?:[\\/]*) + ac_cv_path_MAKEINFO="$MAKEINFO" # Let the user override the test with a path. + ;; + *) + as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in $PATH +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + for ac_exec_ext in '' $ac_executable_extensions; do + if as_fn_executable_p "$as_dir/$ac_word$ac_exec_ext"; then + ac_cv_path_MAKEINFO="$as_dir/$ac_word$ac_exec_ext" + $as_echo "$as_me:${as_lineno-$LINENO}: found $as_dir/$ac_word$ac_exec_ext" >&5 + break 2 + fi +done + done +IFS=$as_save_IFS + + test -z "$ac_cv_path_MAKEINFO" && ac_cv_path_MAKEINFO=":" + ;; +esac +fi +MAKEINFO=$ac_cv_path_MAKEINFO +if test -n "$MAKEINFO"; then + { $as_echo "$as_me:${as_lineno-$LINENO}: result: $MAKEINFO" >&5 +$as_echo "$MAKEINFO" >&6; } +else + { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5 +$as_echo "no" >&6; } +fi + + +if test -n "$MAKEINFO" -a "$MAKEINFO" != ":"; then + for ac_macro in acronym env option; do + { $as_echo "$as_me:${as_lineno-$LINENO}: checking if $MAKEINFO understands @$ac_macro{}" >&5 +$as_echo_n "checking if $MAKEINFO understands @$ac_macro{}... " >&6; } +echo \\\\input texinfo > conftest.texi +echo @$ac_macro{test} >> conftest.texi +if $MAKEINFO conftest.texi > /dev/null 2> /dev/null; then + { $as_echo "$as_me:${as_lineno-$LINENO}: result: yes" >&5 +$as_echo "yes" >&6; } +else + { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5 +$as_echo "no" >&6; } + AM_MAKEINFOFLAGS="-D no-$ac_macro $AM_MAKEINFOFLAGS" +fi +rm -f conftest.texi conftest.info + + done +fi + + +# Extract the first word of "install-info", so it can be a program name with args. +set dummy install-info; ac_word=$2 +{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $ac_word" >&5 +$as_echo_n "checking for $ac_word... " >&6; } +if ${ac_cv_path_INSTALL_INFO+:} false; then : + $as_echo_n "(cached) " >&6 +else + case $INSTALL_INFO in + [\\/]* | ?:[\\/]*) + ac_cv_path_INSTALL_INFO="$INSTALL_INFO" # Let the user override the test with a path. + ;; + *) + as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in $PATH /usr/sbin /sbin +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + for ac_exec_ext in '' $ac_executable_extensions; do + if as_fn_executable_p "$as_dir/$ac_word$ac_exec_ext"; then + ac_cv_path_INSTALL_INFO="$as_dir/$ac_word$ac_exec_ext" + $as_echo "$as_me:${as_lineno-$LINENO}: found $as_dir/$ac_word$ac_exec_ext" >&5 + break 2 + fi +done + done +IFS=$as_save_IFS + + test -z "$ac_cv_path_INSTALL_INFO" && ac_cv_path_INSTALL_INFO=":" + ;; +esac +fi +INSTALL_INFO=$ac_cv_path_INSTALL_INFO +if test -n "$INSTALL_INFO"; then + { $as_echo "$as_me:${as_lineno-$LINENO}: result: $INSTALL_INFO" >&5 +$as_echo "$INSTALL_INFO" >&6; } +else + { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5 +$as_echo "no" >&6; } +fi + + + +# SELFAUTO -- not used when built as part of the TeX Live tree. + +# We have to check properties of libraries, either installed (system) +# libraries or unistalled (possibly libtool) ones from the TeX Live tree. +# Thus we can not use, e.g., AC_CHECK_LIB(LIB, FUNCTION) + +kpse_save_CPPFLAGS=$CPPFLAGS +kpse_save_LIBS=$LIBS + +##tldbg _KPSE_INIT: Initialize TL infrastructure. +kpse_BLD=`(cd "./../../." && pwd)` +kpse_SRC=`(cd "$srcdir/../../." && pwd)` + +##tldbg _KPSE_USE_LIBTOOL: Generate a libtool script for use in configure tests. +: ${CONFIG_LT=./config.lt} +{ $as_echo "$as_me:${as_lineno-$LINENO}: creating $CONFIG_LT" >&5 +$as_echo "$as_me: creating $CONFIG_LT" >&6;} +as_write_fail=0 +cat >"$CONFIG_LT" <<_ASEOF || as_write_fail=1 +#! $SHELL +# Generated by $as_me. +# Run this file to recreate a libtool stub with the current configuration. +SHELL=\${CONFIG_SHELL-$SHELL} +export SHELL +_ASEOF +cat >>"$CONFIG_LT" <<\_ASEOF || as_write_fail=1 +## -------------------- ## +## M4sh Initialization. ## +## -------------------- ## + +# Be more Bourne compatible +DUALCASE=1; export DUALCASE # for MKS sh +if test -n "${ZSH_VERSION+set}" && (emulate sh) >/dev/null 2>&1; then : + emulate sh + NULLCMD=: + # Pre-4.2 versions of Zsh do word splitting on ${1+"$@"}, which + # is contrary to our usage. Disable this feature. + alias -g '${1+"$@"}'='"$@"' + setopt NO_GLOB_SUBST +else + case `(set -o) 2>/dev/null` in #( + *posix*) : + set -o posix ;; #( + *) : + ;; +esac +fi + + +as_nl=' +' +export as_nl +# Printing a long string crashes Solaris 7 /usr/bin/printf. +as_echo='\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\' +as_echo=$as_echo$as_echo$as_echo$as_echo$as_echo +as_echo=$as_echo$as_echo$as_echo$as_echo$as_echo$as_echo +# Prefer a ksh shell builtin over an external printf program on Solaris, +# but without wasting forks for bash or zsh. +if test -z "$BASH_VERSION$ZSH_VERSION" \ + && (test "X`print -r -- $as_echo`" = "X$as_echo") 2>/dev/null; then + as_echo='print -r --' + as_echo_n='print -rn --' +elif (test "X`printf %s $as_echo`" = "X$as_echo") 2>/dev/null; then + as_echo='printf %s\n' + as_echo_n='printf %s' +else + if test "X`(/usr/ucb/echo -n -n $as_echo) 2>/dev/null`" = "X-n $as_echo"; then + as_echo_body='eval /usr/ucb/echo -n "$1$as_nl"' + as_echo_n='/usr/ucb/echo -n' + else + as_echo_body='eval expr "X$1" : "X\\(.*\\)"' + as_echo_n_body='eval + arg=$1; + case $arg in #( + *"$as_nl"*) + expr "X$arg" : "X\\(.*\\)$as_nl"; + arg=`expr "X$arg" : ".*$as_nl\\(.*\\)"`;; + esac; + expr "X$arg" : "X\\(.*\\)" | tr -d "$as_nl" + ' + export as_echo_n_body + as_echo_n='sh -c $as_echo_n_body as_echo' + fi + export as_echo_body + as_echo='sh -c $as_echo_body as_echo' +fi + +# The user is always right. +if test "${PATH_SEPARATOR+set}" != set; then + PATH_SEPARATOR=: + (PATH='/bin;/bin'; FPATH=$PATH; sh -c :) >/dev/null 2>&1 && { + (PATH='/bin:/bin'; FPATH=$PATH; sh -c :) >/dev/null 2>&1 || + PATH_SEPARATOR=';' + } +fi + + +# IFS +# We need space, tab and new line, in precisely that order. Quoting is +# there to prevent editors from complaining about space-tab. +# (If _AS_PATH_WALK were called with IFS unset, it would disable word +# splitting by setting IFS to empty value.) +IFS=" "" $as_nl" + +# Find who we are. Look in the path if we contain no directory separator. +as_myself= +case $0 in #(( + *[\\/]* ) as_myself=$0 ;; + *) as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in $PATH +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + test -r "$as_dir/$0" && as_myself=$as_dir/$0 && break + done +IFS=$as_save_IFS + + ;; +esac +# We did not find ourselves, most probably we were run as `sh COMMAND' +# in which case we are not to be found in the path. +if test "x$as_myself" = x; then + as_myself=$0 +fi +if test ! -f "$as_myself"; then + $as_echo "$as_myself: error: cannot find myself; rerun with an absolute file name" >&2 + exit 1 +fi + +# Unset variables that we do not need and which cause bugs (e.g. in +# pre-3.0 UWIN ksh). But do not cause bugs in bash 2.01; the "|| exit 1" +# suppresses any "Segmentation fault" message there. '((' could +# trigger a bug in pdksh 5.2.14. +for as_var in BASH_ENV ENV MAIL MAILPATH +do eval test x\${$as_var+set} = xset \ + && ( (unset $as_var) || exit 1) >/dev/null 2>&1 && unset $as_var || : +done +PS1='$ ' +PS2='> ' +PS4='+ ' + +# NLS nuisances. +LC_ALL=C +export LC_ALL +LANGUAGE=C +export LANGUAGE + +# CDPATH. +(unset CDPATH) >/dev/null 2>&1 && unset CDPATH + + +# as_fn_error STATUS ERROR [LINENO LOG_FD] +# ---------------------------------------- +# Output "`basename $0`: error: ERROR" to stderr. If LINENO and LOG_FD are +# provided, also output the error to LOG_FD, referencing LINENO. Then exit the +# script with STATUS, using 1 if that was 0. +as_fn_error () +{ + as_status=$1; test $as_status -eq 0 && as_status=1 + if test "$4"; then + as_lineno=${as_lineno-"$3"} as_lineno_stack=as_lineno_stack=$as_lineno_stack + $as_echo "$as_me:${as_lineno-$LINENO}: error: $2" >&$4 + fi + $as_echo "$as_me: error: $2" >&2 + as_fn_exit $as_status +} # as_fn_error + + +# as_fn_set_status STATUS +# ----------------------- +# Set $? to STATUS, without forking. +as_fn_set_status () +{ + return $1 +} # as_fn_set_status + +# as_fn_exit STATUS +# ----------------- +# Exit the shell with STATUS, even in a "trap 0" or "set -e" context. +as_fn_exit () +{ + set +e + as_fn_set_status $1 + exit $1 +} # as_fn_exit + +# as_fn_unset VAR +# --------------- +# Portably unset VAR. +as_fn_unset () +{ + { eval $1=; unset $1;} +} +as_unset=as_fn_unset +# as_fn_append VAR VALUE +# ---------------------- +# Append the text in VALUE to the end of the definition contained in VAR. Take +# advantage of any shell optimizations that allow amortized linear growth over +# repeated appends, instead of the typical quadratic growth present in naive +# implementations. +if (eval "as_var=1; as_var+=2; test x\$as_var = x12") 2>/dev/null; then : + eval 'as_fn_append () + { + eval $1+=\$2 + }' +else + as_fn_append () + { + eval $1=\$$1\$2 + } +fi # as_fn_append + +# as_fn_arith ARG... +# ------------------ +# Perform arithmetic evaluation on the ARGs, and store the result in the +# global $as_val. Take advantage of shells that can avoid forks. The arguments +# must be portable across $(()) and expr. +if (eval "test \$(( 1 + 1 )) = 2") 2>/dev/null; then : + eval 'as_fn_arith () + { + as_val=$(( $* )) + }' +else + as_fn_arith () + { + as_val=`expr "$@" || test $? -eq 1` + } +fi # as_fn_arith + + +if expr a : '\(a\)' >/dev/null 2>&1 && + test "X`expr 00001 : '.*\(...\)'`" = X001; then + as_expr=expr +else + as_expr=false +fi + +if (basename -- /) >/dev/null 2>&1 && test "X`basename -- / 2>&1`" = "X/"; then + as_basename=basename +else + as_basename=false +fi + +if (as_dir=`dirname -- /` && test "X$as_dir" = X/) >/dev/null 2>&1; then + as_dirname=dirname +else + as_dirname=false +fi + +as_me=`$as_basename -- "$0" || +$as_expr X/"$0" : '.*/\([^/][^/]*\)/*$' \| \ + X"$0" : 'X\(//\)$' \| \ + X"$0" : 'X\(/\)' \| . 2>/dev/null || +$as_echo X/"$0" | + sed '/^.*\/\([^/][^/]*\)\/*$/{ + s//\1/ + q + } + /^X\/\(\/\/\)$/{ + s//\1/ + q + } + /^X\/\(\/\).*/{ + s//\1/ + q + } + s/.*/./; q'` + +# Avoid depending upon Character Ranges. +as_cr_letters='abcdefghijklmnopqrstuvwxyz' +as_cr_LETTERS='ABCDEFGHIJKLMNOPQRSTUVWXYZ' +as_cr_Letters=$as_cr_letters$as_cr_LETTERS +as_cr_digits='0123456789' +as_cr_alnum=$as_cr_Letters$as_cr_digits + +ECHO_C= ECHO_N= ECHO_T= +case `echo -n x` in #((((( +-n*) + case `echo 'xy\c'` in + *c*) ECHO_T=' ';; # ECHO_T is single tab character. + xy) ECHO_C='\c';; + *) echo `echo ksh88 bug on AIX 6.1` > /dev/null + ECHO_T=' ';; + esac;; +*) + ECHO_N='-n';; +esac + +rm -f conf$$ conf$$.exe conf$$.file +if test -d conf$$.dir; then + rm -f conf$$.dir/conf$$.file +else + rm -f conf$$.dir + mkdir conf$$.dir 2>/dev/null +fi +if (echo >conf$$.file) 2>/dev/null; then + if ln -s conf$$.file conf$$ 2>/dev/null; then + as_ln_s='ln -s' + # ... but there are two gotchas: + # 1) On MSYS, both `ln -s file dir' and `ln file dir' fail. + # 2) DJGPP < 2.04 has no symlinks; `ln -s' creates a wrapper executable. + # In both cases, we have to default to `cp -pR'. + ln -s conf$$.file conf$$.dir 2>/dev/null && test ! -f conf$$.exe || + as_ln_s='cp -pR' + elif ln conf$$.file conf$$ 2>/dev/null; then + as_ln_s=ln + else + as_ln_s='cp -pR' + fi +else + as_ln_s='cp -pR' +fi +rm -f conf$$ conf$$.exe conf$$.dir/conf$$.file conf$$.file +rmdir conf$$.dir 2>/dev/null + + +# as_fn_mkdir_p +# ------------- +# Create "$as_dir" as a directory, including parents if necessary. +as_fn_mkdir_p () +{ + + case $as_dir in #( + -*) as_dir=./$as_dir;; + esac + test -d "$as_dir" || eval $as_mkdir_p || { + as_dirs= + while :; do + case $as_dir in #( + *\'*) as_qdir=`$as_echo "$as_dir" | sed "s/'/'\\\\\\\\''/g"`;; #'( + *) as_qdir=$as_dir;; + esac + as_dirs="'$as_qdir' $as_dirs" + as_dir=`$as_dirname -- "$as_dir" || +$as_expr X"$as_dir" : 'X\(.*[^/]\)//*[^/][^/]*/*$' \| \ + X"$as_dir" : 'X\(//\)[^/]' \| \ + X"$as_dir" : 'X\(//\)$' \| \ + X"$as_dir" : 'X\(/\)' \| . 2>/dev/null || +$as_echo X"$as_dir" | + sed '/^X\(.*[^/]\)\/\/*[^/][^/]*\/*$/{ + s//\1/ + q + } + /^X\(\/\/\)[^/].*/{ + s//\1/ + q + } + /^X\(\/\/\)$/{ + s//\1/ + q + } + /^X\(\/\).*/{ + s//\1/ + q + } + s/.*/./; q'` + test -d "$as_dir" && break + done + test -z "$as_dirs" || eval "mkdir $as_dirs" + } || test -d "$as_dir" || as_fn_error $? "cannot create directory $as_dir" + + +} # as_fn_mkdir_p +if mkdir -p . 2>/dev/null; then + as_mkdir_p='mkdir -p "$as_dir"' +else + test -d ./-p && rmdir ./-p + as_mkdir_p=false +fi + + +# as_fn_executable_p FILE +# ----------------------- +# Test if FILE is an executable regular file. +as_fn_executable_p () +{ + test -f "$1" && test -x "$1" +} # as_fn_executable_p +as_test_x='test -x' +as_executable_p=as_fn_executable_p + +# Sed expression to map a string onto a valid CPP name. +as_tr_cpp="eval sed 'y%*$as_cr_letters%P$as_cr_LETTERS%;s%[^_$as_cr_alnum]%_%g'" + +# Sed expression to map a string onto a valid variable name. +as_tr_sh="eval sed 'y%*+%pp%;s%[^_$as_cr_alnum]%_%g'" + + +exec 6>&1 +## --------------------------------- ## +## Main body of "$CONFIG_LT" script. ## +## --------------------------------- ## +_ASEOF +test $as_write_fail = 0 && chmod +x "$CONFIG_LT" + +cat >>"$CONFIG_LT" <<\_LTEOF +lt_cl_silent=false +exec 5>>config.log +{ + echo + sed 'h;s/./-/g;s/^.../## /;s/...$/ ##/;p;x;p;x' <<_ASBOX +## Running $as_me. ## +_ASBOX +} >&5 + +lt_cl_help="\ +'$as_me' creates a local libtool stub from the current configuration, +for use in further configure time tests before the real libtool is +generated. + +Usage: $0 [OPTIONS] + + -h, --help print this help, then exit + -V, --version print version number, then exit + -q, --quiet do not print progress messages + -d, --debug don't remove temporary files + +Report bugs to <bug-libtool@gnu.org>." + +lt_cl_version="\ +dvipng (TeX Live) config.lt 1.17 +configured by $0, generated by GNU Autoconf 2.69. + +Copyright (C) 2011 Free Software Foundation, Inc. +This config.lt script is free software; the Free Software Foundation +gives unlimited permision to copy, distribute and modify it." + +while test 0 != $# +do + case $1 in + --version | --v* | -V ) + echo "$lt_cl_version"; exit 0 ;; + --help | --h* | -h ) + echo "$lt_cl_help"; exit 0 ;; + --debug | --d* | -d ) + debug=: ;; + --quiet | --q* | --silent | --s* | -q ) + lt_cl_silent=: ;; + + -*) as_fn_error $? "unrecognized option: $1 +Try '$0 --help' for more information." "$LINENO" 5 ;; + + *) as_fn_error $? "unrecognized argument: $1 +Try '$0 --help' for more information." "$LINENO" 5 ;; + esac + shift +done + +if $lt_cl_silent; then + exec 6>/dev/null +fi +_LTEOF + +cat >>"$CONFIG_LT" <<_LTEOF + + +# The HP-UX ksh and POSIX shell print the target directory to stdout +# if CDPATH is set. +(unset CDPATH) >/dev/null 2>&1 && unset CDPATH + +sed_quote_subst='$sed_quote_subst' +double_quote_subst='$double_quote_subst' +delay_variable_subst='$delay_variable_subst' +macro_version='`$ECHO "$macro_version" | $SED "$delay_single_quote_subst"`' +macro_revision='`$ECHO "$macro_revision" | $SED "$delay_single_quote_subst"`' +AS='`$ECHO "$AS" | $SED "$delay_single_quote_subst"`' +DLLTOOL='`$ECHO "$DLLTOOL" | $SED "$delay_single_quote_subst"`' +OBJDUMP='`$ECHO "$OBJDUMP" | $SED "$delay_single_quote_subst"`' +enable_shared='`$ECHO "$enable_shared" | $SED "$delay_single_quote_subst"`' +enable_static='`$ECHO "$enable_static" | $SED "$delay_single_quote_subst"`' +pic_mode='`$ECHO "$pic_mode" | $SED "$delay_single_quote_subst"`' +enable_fast_install='`$ECHO "$enable_fast_install" | $SED "$delay_single_quote_subst"`' +shared_archive_member_spec='`$ECHO "$shared_archive_member_spec" | $SED "$delay_single_quote_subst"`' +SHELL='`$ECHO "$SHELL" | $SED "$delay_single_quote_subst"`' +ECHO='`$ECHO "$ECHO" | $SED "$delay_single_quote_subst"`' +PATH_SEPARATOR='`$ECHO "$PATH_SEPARATOR" | $SED "$delay_single_quote_subst"`' +host_alias='`$ECHO "$host_alias" | $SED "$delay_single_quote_subst"`' +host='`$ECHO "$host" | $SED "$delay_single_quote_subst"`' +host_os='`$ECHO "$host_os" | $SED "$delay_single_quote_subst"`' +build_alias='`$ECHO "$build_alias" | $SED "$delay_single_quote_subst"`' +build='`$ECHO "$build" | $SED "$delay_single_quote_subst"`' +build_os='`$ECHO "$build_os" | $SED "$delay_single_quote_subst"`' +SED='`$ECHO "$SED" | $SED "$delay_single_quote_subst"`' +Xsed='`$ECHO "$Xsed" | $SED "$delay_single_quote_subst"`' +GREP='`$ECHO "$GREP" | $SED "$delay_single_quote_subst"`' +EGREP='`$ECHO "$EGREP" | $SED "$delay_single_quote_subst"`' +FGREP='`$ECHO "$FGREP" | $SED "$delay_single_quote_subst"`' +LD='`$ECHO "$LD" | $SED "$delay_single_quote_subst"`' +NM='`$ECHO "$NM" | $SED "$delay_single_quote_subst"`' +LN_S='`$ECHO "$LN_S" | $SED "$delay_single_quote_subst"`' +max_cmd_len='`$ECHO "$max_cmd_len" | $SED "$delay_single_quote_subst"`' +ac_objext='`$ECHO "$ac_objext" | $SED "$delay_single_quote_subst"`' +exeext='`$ECHO "$exeext" | $SED "$delay_single_quote_subst"`' +lt_unset='`$ECHO "$lt_unset" | $SED "$delay_single_quote_subst"`' +lt_SP2NL='`$ECHO "$lt_SP2NL" | $SED "$delay_single_quote_subst"`' +lt_NL2SP='`$ECHO "$lt_NL2SP" | $SED "$delay_single_quote_subst"`' +lt_cv_to_host_file_cmd='`$ECHO "$lt_cv_to_host_file_cmd" | $SED "$delay_single_quote_subst"`' +lt_cv_to_tool_file_cmd='`$ECHO "$lt_cv_to_tool_file_cmd" | $SED "$delay_single_quote_subst"`' +reload_flag='`$ECHO "$reload_flag" | $SED "$delay_single_quote_subst"`' +reload_cmds='`$ECHO "$reload_cmds" | $SED "$delay_single_quote_subst"`' +deplibs_check_method='`$ECHO "$deplibs_check_method" | $SED "$delay_single_quote_subst"`' +file_magic_cmd='`$ECHO "$file_magic_cmd" | $SED "$delay_single_quote_subst"`' +file_magic_glob='`$ECHO "$file_magic_glob" | $SED "$delay_single_quote_subst"`' +want_nocaseglob='`$ECHO "$want_nocaseglob" | $SED "$delay_single_quote_subst"`' +sharedlib_from_linklib_cmd='`$ECHO "$sharedlib_from_linklib_cmd" | $SED "$delay_single_quote_subst"`' +AR='`$ECHO "$AR" | $SED "$delay_single_quote_subst"`' +AR_FLAGS='`$ECHO "$AR_FLAGS" | $SED "$delay_single_quote_subst"`' +archiver_list_spec='`$ECHO "$archiver_list_spec" | $SED "$delay_single_quote_subst"`' +STRIP='`$ECHO "$STRIP" | $SED "$delay_single_quote_subst"`' +RANLIB='`$ECHO "$RANLIB" | $SED "$delay_single_quote_subst"`' +old_postinstall_cmds='`$ECHO "$old_postinstall_cmds" | $SED "$delay_single_quote_subst"`' +old_postuninstall_cmds='`$ECHO "$old_postuninstall_cmds" | $SED "$delay_single_quote_subst"`' +old_archive_cmds='`$ECHO "$old_archive_cmds" | $SED "$delay_single_quote_subst"`' +lock_old_archive_extraction='`$ECHO "$lock_old_archive_extraction" | $SED "$delay_single_quote_subst"`' +CC='`$ECHO "$CC" | $SED "$delay_single_quote_subst"`' +CFLAGS='`$ECHO "$CFLAGS" | $SED "$delay_single_quote_subst"`' +compiler='`$ECHO "$compiler" | $SED "$delay_single_quote_subst"`' +GCC='`$ECHO "$GCC" | $SED "$delay_single_quote_subst"`' +lt_cv_sys_global_symbol_pipe='`$ECHO "$lt_cv_sys_global_symbol_pipe" | $SED "$delay_single_quote_subst"`' +lt_cv_sys_global_symbol_to_cdecl='`$ECHO "$lt_cv_sys_global_symbol_to_cdecl" | $SED "$delay_single_quote_subst"`' +lt_cv_sys_global_symbol_to_import='`$ECHO "$lt_cv_sys_global_symbol_to_import" | $SED "$delay_single_quote_subst"`' +lt_cv_sys_global_symbol_to_c_name_address='`$ECHO "$lt_cv_sys_global_symbol_to_c_name_address" | $SED "$delay_single_quote_subst"`' +lt_cv_sys_global_symbol_to_c_name_address_lib_prefix='`$ECHO "$lt_cv_sys_global_symbol_to_c_name_address_lib_prefix" | $SED "$delay_single_quote_subst"`' +lt_cv_nm_interface='`$ECHO "$lt_cv_nm_interface" | $SED "$delay_single_quote_subst"`' +nm_file_list_spec='`$ECHO "$nm_file_list_spec" | $SED "$delay_single_quote_subst"`' +lt_sysroot='`$ECHO "$lt_sysroot" | $SED "$delay_single_quote_subst"`' +lt_cv_truncate_bin='`$ECHO "$lt_cv_truncate_bin" | $SED "$delay_single_quote_subst"`' +objdir='`$ECHO "$objdir" | $SED "$delay_single_quote_subst"`' +MAGIC_CMD='`$ECHO "$MAGIC_CMD" | $SED "$delay_single_quote_subst"`' +lt_prog_compiler_no_builtin_flag='`$ECHO "$lt_prog_compiler_no_builtin_flag" | $SED "$delay_single_quote_subst"`' +lt_prog_compiler_pic='`$ECHO "$lt_prog_compiler_pic" | $SED "$delay_single_quote_subst"`' +lt_prog_compiler_wl='`$ECHO "$lt_prog_compiler_wl" | $SED "$delay_single_quote_subst"`' +lt_prog_compiler_static='`$ECHO "$lt_prog_compiler_static" | $SED "$delay_single_quote_subst"`' +lt_cv_prog_compiler_c_o='`$ECHO "$lt_cv_prog_compiler_c_o" | $SED "$delay_single_quote_subst"`' +need_locks='`$ECHO "$need_locks" | $SED "$delay_single_quote_subst"`' +MANIFEST_TOOL='`$ECHO "$MANIFEST_TOOL" | $SED "$delay_single_quote_subst"`' +DSYMUTIL='`$ECHO "$DSYMUTIL" | $SED "$delay_single_quote_subst"`' +NMEDIT='`$ECHO "$NMEDIT" | $SED "$delay_single_quote_subst"`' +LIPO='`$ECHO "$LIPO" | $SED "$delay_single_quote_subst"`' +OTOOL='`$ECHO "$OTOOL" | $SED "$delay_single_quote_subst"`' +OTOOL64='`$ECHO "$OTOOL64" | $SED "$delay_single_quote_subst"`' +libext='`$ECHO "$libext" | $SED "$delay_single_quote_subst"`' +shrext_cmds='`$ECHO "$shrext_cmds" | $SED "$delay_single_quote_subst"`' +extract_expsyms_cmds='`$ECHO "$extract_expsyms_cmds" | $SED "$delay_single_quote_subst"`' +archive_cmds_need_lc='`$ECHO "$archive_cmds_need_lc" | $SED "$delay_single_quote_subst"`' +enable_shared_with_static_runtimes='`$ECHO "$enable_shared_with_static_runtimes" | $SED "$delay_single_quote_subst"`' +export_dynamic_flag_spec='`$ECHO "$export_dynamic_flag_spec" | $SED "$delay_single_quote_subst"`' +whole_archive_flag_spec='`$ECHO "$whole_archive_flag_spec" | $SED "$delay_single_quote_subst"`' +compiler_needs_object='`$ECHO "$compiler_needs_object" | $SED "$delay_single_quote_subst"`' +old_archive_from_new_cmds='`$ECHO "$old_archive_from_new_cmds" | $SED "$delay_single_quote_subst"`' +old_archive_from_expsyms_cmds='`$ECHO "$old_archive_from_expsyms_cmds" | $SED "$delay_single_quote_subst"`' +archive_cmds='`$ECHO "$archive_cmds" | $SED "$delay_single_quote_subst"`' +archive_expsym_cmds='`$ECHO "$archive_expsym_cmds" | $SED "$delay_single_quote_subst"`' +module_cmds='`$ECHO "$module_cmds" | $SED "$delay_single_quote_subst"`' +module_expsym_cmds='`$ECHO "$module_expsym_cmds" | $SED "$delay_single_quote_subst"`' +with_gnu_ld='`$ECHO "$with_gnu_ld" | $SED "$delay_single_quote_subst"`' +allow_undefined_flag='`$ECHO "$allow_undefined_flag" | $SED "$delay_single_quote_subst"`' +no_undefined_flag='`$ECHO "$no_undefined_flag" | $SED "$delay_single_quote_subst"`' +hardcode_libdir_flag_spec='`$ECHO "$hardcode_libdir_flag_spec" | $SED "$delay_single_quote_subst"`' +hardcode_libdir_separator='`$ECHO "$hardcode_libdir_separator" | $SED "$delay_single_quote_subst"`' +hardcode_direct='`$ECHO "$hardcode_direct" | $SED "$delay_single_quote_subst"`' +hardcode_direct_absolute='`$ECHO "$hardcode_direct_absolute" | $SED "$delay_single_quote_subst"`' +hardcode_minus_L='`$ECHO "$hardcode_minus_L" | $SED "$delay_single_quote_subst"`' +hardcode_shlibpath_var='`$ECHO "$hardcode_shlibpath_var" | $SED "$delay_single_quote_subst"`' +hardcode_automatic='`$ECHO "$hardcode_automatic" | $SED "$delay_single_quote_subst"`' +inherit_rpath='`$ECHO "$inherit_rpath" | $SED "$delay_single_quote_subst"`' +link_all_deplibs='`$ECHO "$link_all_deplibs" | $SED "$delay_single_quote_subst"`' +always_export_symbols='`$ECHO "$always_export_symbols" | $SED "$delay_single_quote_subst"`' +export_symbols_cmds='`$ECHO "$export_symbols_cmds" | $SED "$delay_single_quote_subst"`' +exclude_expsyms='`$ECHO "$exclude_expsyms" | $SED "$delay_single_quote_subst"`' +include_expsyms='`$ECHO "$include_expsyms" | $SED "$delay_single_quote_subst"`' +prelink_cmds='`$ECHO "$prelink_cmds" | $SED "$delay_single_quote_subst"`' +postlink_cmds='`$ECHO "$postlink_cmds" | $SED "$delay_single_quote_subst"`' +file_list_spec='`$ECHO "$file_list_spec" | $SED "$delay_single_quote_subst"`' +variables_saved_for_relink='`$ECHO "$variables_saved_for_relink" | $SED "$delay_single_quote_subst"`' +need_lib_prefix='`$ECHO "$need_lib_prefix" | $SED "$delay_single_quote_subst"`' +need_version='`$ECHO "$need_version" | $SED "$delay_single_quote_subst"`' +version_type='`$ECHO "$version_type" | $SED "$delay_single_quote_subst"`' +runpath_var='`$ECHO "$runpath_var" | $SED "$delay_single_quote_subst"`' +shlibpath_var='`$ECHO "$shlibpath_var" | $SED "$delay_single_quote_subst"`' +shlibpath_overrides_runpath='`$ECHO "$shlibpath_overrides_runpath" | $SED "$delay_single_quote_subst"`' +libname_spec='`$ECHO "$libname_spec" | $SED "$delay_single_quote_subst"`' +library_names_spec='`$ECHO "$library_names_spec" | $SED "$delay_single_quote_subst"`' +soname_spec='`$ECHO "$soname_spec" | $SED "$delay_single_quote_subst"`' +install_override_mode='`$ECHO "$install_override_mode" | $SED "$delay_single_quote_subst"`' +postinstall_cmds='`$ECHO "$postinstall_cmds" | $SED "$delay_single_quote_subst"`' +postuninstall_cmds='`$ECHO "$postuninstall_cmds" | $SED "$delay_single_quote_subst"`' +finish_cmds='`$ECHO "$finish_cmds" | $SED "$delay_single_quote_subst"`' +finish_eval='`$ECHO "$finish_eval" | $SED "$delay_single_quote_subst"`' +hardcode_into_libs='`$ECHO "$hardcode_into_libs" | $SED "$delay_single_quote_subst"`' +sys_lib_search_path_spec='`$ECHO "$sys_lib_search_path_spec" | $SED "$delay_single_quote_subst"`' +configure_time_dlsearch_path='`$ECHO "$configure_time_dlsearch_path" | $SED "$delay_single_quote_subst"`' +configure_time_lt_sys_library_path='`$ECHO "$configure_time_lt_sys_library_path" | $SED "$delay_single_quote_subst"`' +hardcode_action='`$ECHO "$hardcode_action" | $SED "$delay_single_quote_subst"`' +enable_dlopen='`$ECHO "$enable_dlopen" | $SED "$delay_single_quote_subst"`' +enable_dlopen_self='`$ECHO "$enable_dlopen_self" | $SED "$delay_single_quote_subst"`' +enable_dlopen_self_static='`$ECHO "$enable_dlopen_self_static" | $SED "$delay_single_quote_subst"`' +old_striplib='`$ECHO "$old_striplib" | $SED "$delay_single_quote_subst"`' +striplib='`$ECHO "$striplib" | $SED "$delay_single_quote_subst"`' + +LTCC='$LTCC' +LTCFLAGS='$LTCFLAGS' +compiler='$compiler_DEFAULT' + +# A function that is used when there is no print builtin or printf. +func_fallback_echo () +{ + eval 'cat <<_LTECHO_EOF +\$1 +_LTECHO_EOF' +} + +# Quote evaled strings. +for var in AS \ +DLLTOOL \ +OBJDUMP \ +SHELL \ +ECHO \ +PATH_SEPARATOR \ +SED \ +GREP \ +EGREP \ +FGREP \ +LD \ +NM \ +LN_S \ +lt_SP2NL \ +lt_NL2SP \ +reload_flag \ +deplibs_check_method \ +file_magic_cmd \ +file_magic_glob \ +want_nocaseglob \ +sharedlib_from_linklib_cmd \ +AR \ +AR_FLAGS \ +archiver_list_spec \ +STRIP \ +RANLIB \ +CC \ +CFLAGS \ +compiler \ +lt_cv_sys_global_symbol_pipe \ +lt_cv_sys_global_symbol_to_cdecl \ +lt_cv_sys_global_symbol_to_import \ +lt_cv_sys_global_symbol_to_c_name_address \ +lt_cv_sys_global_symbol_to_c_name_address_lib_prefix \ +lt_cv_nm_interface \ +nm_file_list_spec \ +lt_cv_truncate_bin \ +lt_prog_compiler_no_builtin_flag \ +lt_prog_compiler_pic \ +lt_prog_compiler_wl \ +lt_prog_compiler_static \ +lt_cv_prog_compiler_c_o \ +need_locks \ +MANIFEST_TOOL \ +DSYMUTIL \ +NMEDIT \ +LIPO \ +OTOOL \ +OTOOL64 \ +shrext_cmds \ +export_dynamic_flag_spec \ +whole_archive_flag_spec \ +compiler_needs_object \ +with_gnu_ld \ +allow_undefined_flag \ +no_undefined_flag \ +hardcode_libdir_flag_spec \ +hardcode_libdir_separator \ +exclude_expsyms \ +include_expsyms \ +file_list_spec \ +variables_saved_for_relink \ +libname_spec \ +library_names_spec \ +soname_spec \ +install_override_mode \ +finish_eval \ +old_striplib \ +striplib; do + case \`eval \\\\\$ECHO \\\\""\\\\\$\$var"\\\\"\` in + *[\\\\\\\`\\"\\\$]*) + eval "lt_\$var=\\\\\\"\\\`\\\$ECHO \\"\\\$\$var\\" | \\\$SED \\"\\\$sed_quote_subst\\"\\\`\\\\\\"" ## exclude from sc_prohibit_nested_quotes + ;; + *) + eval "lt_\$var=\\\\\\"\\\$\$var\\\\\\"" + ;; + esac +done + +# Double-quote double-evaled strings. +for var in reload_cmds \ +old_postinstall_cmds \ +old_postuninstall_cmds \ +old_archive_cmds \ +extract_expsyms_cmds \ +old_archive_from_new_cmds \ +old_archive_from_expsyms_cmds \ +archive_cmds \ +archive_expsym_cmds \ +module_cmds \ +module_expsym_cmds \ +export_symbols_cmds \ +prelink_cmds \ +postlink_cmds \ +postinstall_cmds \ +postuninstall_cmds \ +finish_cmds \ +sys_lib_search_path_spec \ +configure_time_dlsearch_path \ +configure_time_lt_sys_library_path; do + case \`eval \\\\\$ECHO \\\\""\\\\\$\$var"\\\\"\` in + *[\\\\\\\`\\"\\\$]*) + eval "lt_\$var=\\\\\\"\\\`\\\$ECHO \\"\\\$\$var\\" | \\\$SED -e \\"\\\$double_quote_subst\\" -e \\"\\\$sed_quote_subst\\" -e \\"\\\$delay_variable_subst\\"\\\`\\\\\\"" ## exclude from sc_prohibit_nested_quotes + ;; + *) + eval "lt_\$var=\\\\\\"\\\$\$var\\\\\\"" + ;; + esac +done + +ac_aux_dir='$ac_aux_dir' + +# See if we are running on zsh, and set the options that allow our +# commands through without removal of \ escapes INIT. +if test -n "\${ZSH_VERSION+set}"; then + setopt NO_GLOB_SUBST +fi + + + PACKAGE='$PACKAGE' + VERSION='$VERSION' + RM='$RM' + ofile='$ofile' + + + +_LTEOF + +cat >>"$CONFIG_LT" <<\_LTEOF +{ $as_echo "$as_me:${as_lineno-$LINENO}: creating $ofile" >&5 +$as_echo "$as_me: creating $ofile" >&6;} + + + # See if we are running on zsh, and set the options that allow our + # commands through without removal of \ escapes. + if test -n "${ZSH_VERSION+set}"; then + setopt NO_GLOB_SUBST + fi + + cfgfile=${ofile}T + trap "$RM \"$cfgfile\"; exit 1" 1 2 15 + $RM "$cfgfile" + + cat <<_LT_EOF >> "$cfgfile" +#! $SHELL +# Generated automatically by $as_me ($PACKAGE) $VERSION +# Libtool was configured on host `(hostname || uname -n) 2>/dev/null | sed 1q`: +# NOTE: Changes made to this file will be lost: look at ltmain.sh. + +# Provide generalized library-building support services. +# Written by Gordon Matzigkeit, 1996 + +# Copyright (C) 2014 Free Software Foundation, Inc. +# This is free software; see the source for copying conditions. There is NO +# warranty; not even for MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. + +# GNU Libtool is free software; you can redistribute it and/or modify +# it under the terms of the GNU General Public License as published by +# the Free Software Foundation; either version 2 of of the License, or +# (at your option) any later version. +# +# As a special exception to the GNU General Public License, if you +# distribute this file as part of a program or library that is built +# using GNU Libtool, you may include this file under the same +# distribution terms that you use for the rest of that program. +# +# GNU Libtool is distributed in the hope that it will be useful, but +# WITHOUT ANY WARRANTY; without even the implied warranty of +# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +# GNU General Public License for more details. +# +# You should have received a copy of the GNU General Public License +# along with this program. If not, see <http://www.gnu.org/licenses/>. + + +# The names of the tagged configurations supported by this script. +available_tags='' + +# Configured defaults for sys_lib_dlsearch_path munging. +: \${LT_SYS_LIBRARY_PATH="$configure_time_lt_sys_library_path"} + +# ### BEGIN LIBTOOL CONFIG + +# Which release of libtool.m4 was used? +macro_version=$macro_version +macro_revision=$macro_revision + +# Assembler program. +AS=$lt_AS + +# DLL creation program. +DLLTOOL=$lt_DLLTOOL + +# Object dumper program. +OBJDUMP=$lt_OBJDUMP + +# Whether or not to build shared libraries. +build_libtool_libs=$enable_shared + +# Whether or not to build static libraries. +build_old_libs=$enable_static + +# What type of objects to build. +pic_mode=$pic_mode + +# Whether or not to optimize for fast installation. +fast_install=$enable_fast_install + +# Shared archive member basename,for filename based shared library versioning on AIX. +shared_archive_member_spec=$shared_archive_member_spec + +# Shell to use when invoking shell scripts. +SHELL=$lt_SHELL + +# An echo program that protects backslashes. +ECHO=$lt_ECHO + +# The PATH separator for the build system. +PATH_SEPARATOR=$lt_PATH_SEPARATOR + +# The host system. +host_alias=$host_alias +host=$host +host_os=$host_os + +# The build system. +build_alias=$build_alias +build=$build +build_os=$build_os + +# A sed program that does not truncate output. +SED=$lt_SED + +# Sed that helps us avoid accidentally triggering echo(1) options like -n. +Xsed="\$SED -e 1s/^X//" + +# A grep program that handles long lines. +GREP=$lt_GREP + +# An ERE matcher. +EGREP=$lt_EGREP + +# A literal string matcher. +FGREP=$lt_FGREP + +# A BSD- or MS-compatible name lister. +NM=$lt_NM + +# Whether we need soft or hard links. +LN_S=$lt_LN_S + +# What is the maximum length of a command? +max_cmd_len=$max_cmd_len + +# Object file suffix (normally "o"). +objext=$ac_objext + +# Executable file suffix (normally ""). +exeext=$exeext + +# whether the shell understands "unset". +lt_unset=$lt_unset + +# turn spaces into newlines. +SP2NL=$lt_lt_SP2NL + +# turn newlines into spaces. +NL2SP=$lt_lt_NL2SP + +# convert \$build file names to \$host format. +to_host_file_cmd=$lt_cv_to_host_file_cmd + +# convert \$build files to toolchain format. +to_tool_file_cmd=$lt_cv_to_tool_file_cmd + +# Method to check whether dependent libraries are shared objects. +deplibs_check_method=$lt_deplibs_check_method + +# Command to use when deplibs_check_method = "file_magic". +file_magic_cmd=$lt_file_magic_cmd + +# How to find potential files when deplibs_check_method = "file_magic". +file_magic_glob=$lt_file_magic_glob + +# Find potential files using nocaseglob when deplibs_check_method = "file_magic". +want_nocaseglob=$lt_want_nocaseglob + +# Command to associate shared and link libraries. +sharedlib_from_linklib_cmd=$lt_sharedlib_from_linklib_cmd + +# The archiver. +AR=$lt_AR + +# Flags to create an archive. +AR_FLAGS=$lt_AR_FLAGS + +# How to feed a file listing to the archiver. +archiver_list_spec=$lt_archiver_list_spec + +# A symbol stripping program. +STRIP=$lt_STRIP + +# Commands used to install an old-style archive. +RANLIB=$lt_RANLIB +old_postinstall_cmds=$lt_old_postinstall_cmds +old_postuninstall_cmds=$lt_old_postuninstall_cmds + +# Whether to use a lock for old archive extraction. +lock_old_archive_extraction=$lock_old_archive_extraction + +# A C compiler. +LTCC=$lt_CC + +# LTCC compiler flags. +LTCFLAGS=$lt_CFLAGS + +# Take the output of nm and produce a listing of raw symbols and C names. +global_symbol_pipe=$lt_lt_cv_sys_global_symbol_pipe + +# Transform the output of nm in a proper C declaration. +global_symbol_to_cdecl=$lt_lt_cv_sys_global_symbol_to_cdecl + +# Transform the output of nm into a list of symbols to manually relocate. +global_symbol_to_import=$lt_lt_cv_sys_global_symbol_to_import + +# Transform the output of nm in a C name address pair. +global_symbol_to_c_name_address=$lt_lt_cv_sys_global_symbol_to_c_name_address + +# Transform the output of nm in a C name address pair when lib prefix is needed. +global_symbol_to_c_name_address_lib_prefix=$lt_lt_cv_sys_global_symbol_to_c_name_address_lib_prefix + +# The name lister interface. +nm_interface=$lt_lt_cv_nm_interface + +# Specify filename containing input files for \$NM. +nm_file_list_spec=$lt_nm_file_list_spec + +# The root where to search for dependent libraries,and where our libraries should be installed. +lt_sysroot=$lt_sysroot + +# Command to truncate a binary pipe. +lt_truncate_bin=$lt_lt_cv_truncate_bin + +# The name of the directory that contains temporary libtool files. +objdir=$objdir + +# Used to examine libraries when file_magic_cmd begins with "file". +MAGIC_CMD=$MAGIC_CMD + +# Must we lock files when doing compilation? +need_locks=$lt_need_locks + +# Manifest tool. +MANIFEST_TOOL=$lt_MANIFEST_TOOL + +# Tool to manipulate archived DWARF debug symbol files on Mac OS X. +DSYMUTIL=$lt_DSYMUTIL + +# Tool to change global to local symbols on Mac OS X. +NMEDIT=$lt_NMEDIT + +# Tool to manipulate fat objects and archives on Mac OS X. +LIPO=$lt_LIPO + +# ldd/readelf like tool for Mach-O binaries on Mac OS X. +OTOOL=$lt_OTOOL + +# ldd/readelf like tool for 64 bit Mach-O binaries on Mac OS X 10.4. +OTOOL64=$lt_OTOOL64 + +# Old archive suffix (normally "a"). +libext=$libext + +# Shared library suffix (normally ".so"). +shrext_cmds=$lt_shrext_cmds + +# The commands to extract the exported symbol list from a shared archive. +extract_expsyms_cmds=$lt_extract_expsyms_cmds + +# Variables whose values should be saved in libtool wrapper scripts and +# restored at link time. +variables_saved_for_relink=$lt_variables_saved_for_relink + +# Do we need the "lib" prefix for modules? +need_lib_prefix=$need_lib_prefix + +# Do we need a version for libraries? +need_version=$need_version + +# Library versioning type. +version_type=$version_type + +# Shared library runtime path variable. +runpath_var=$runpath_var + +# Shared library path variable. +shlibpath_var=$shlibpath_var + +# Is shlibpath searched before the hard-coded library search path? +shlibpath_overrides_runpath=$shlibpath_overrides_runpath + +# Format of library name prefix. +libname_spec=$lt_libname_spec + +# List of archive names. First name is the real one, the rest are links. +# The last name is the one that the linker finds with -lNAME +library_names_spec=$lt_library_names_spec + +# The coded name of the library, if different from the real name. +soname_spec=$lt_soname_spec + +# Permission mode override for installation of shared libraries. +install_override_mode=$lt_install_override_mode + +# Command to use after installation of a shared archive. +postinstall_cmds=$lt_postinstall_cmds + +# Command to use after uninstallation of a shared archive. +postuninstall_cmds=$lt_postuninstall_cmds + +# Commands used to finish a libtool library installation in a directory. +finish_cmds=$lt_finish_cmds + +# As "finish_cmds", except a single script fragment to be evaled but +# not shown. +finish_eval=$lt_finish_eval + +# Whether we should hardcode library paths into libraries. +hardcode_into_libs=$hardcode_into_libs + +# Compile-time system search path for libraries. +sys_lib_search_path_spec=$lt_sys_lib_search_path_spec + +# Detected run-time system search path for libraries. +sys_lib_dlsearch_path_spec=$lt_configure_time_dlsearch_path + +# Explicit LT_SYS_LIBRARY_PATH set during ./configure time. +configure_time_lt_sys_library_path=$lt_configure_time_lt_sys_library_path + +# Whether dlopen is supported. +dlopen_support=$enable_dlopen + +# Whether dlopen of programs is supported. +dlopen_self=$enable_dlopen_self + +# Whether dlopen of statically linked programs is supported. +dlopen_self_static=$enable_dlopen_self_static + +# Commands to strip libraries. +old_striplib=$lt_old_striplib +striplib=$lt_striplib + + +# The linker used to build libraries. +LD=$lt_LD + +# How to create reloadable object files. +reload_flag=$lt_reload_flag +reload_cmds=$lt_reload_cmds + +# Commands used to build an old-style archive. +old_archive_cmds=$lt_old_archive_cmds + +# A language specific compiler. +CC=$lt_compiler + +# Is the compiler the GNU compiler? +with_gcc=$GCC + +# Compiler flag to turn off builtin functions. +no_builtin_flag=$lt_lt_prog_compiler_no_builtin_flag + +# Additional compiler flags for building library objects. +pic_flag=$lt_lt_prog_compiler_pic + +# How to pass a linker flag through the compiler. +wl=$lt_lt_prog_compiler_wl + +# Compiler flag to prevent dynamic linking. +link_static_flag=$lt_lt_prog_compiler_static + +# Does compiler simultaneously support -c and -o options? +compiler_c_o=$lt_lt_cv_prog_compiler_c_o + +# Whether or not to add -lc for building shared libraries. +build_libtool_need_lc=$archive_cmds_need_lc + +# Whether or not to disallow shared libs when runtime libs are static. +allow_libtool_libs_with_static_runtimes=$enable_shared_with_static_runtimes + +# Compiler flag to allow reflexive dlopens. +export_dynamic_flag_spec=$lt_export_dynamic_flag_spec + +# Compiler flag to generate shared objects directly from archives. +whole_archive_flag_spec=$lt_whole_archive_flag_spec + +# Whether the compiler copes with passing no objects directly. +compiler_needs_object=$lt_compiler_needs_object + +# Create an old-style archive from a shared archive. +old_archive_from_new_cmds=$lt_old_archive_from_new_cmds + +# Create a temporary old-style archive to link instead of a shared archive. +old_archive_from_expsyms_cmds=$lt_old_archive_from_expsyms_cmds + +# Commands used to build a shared archive. +archive_cmds=$lt_archive_cmds +archive_expsym_cmds=$lt_archive_expsym_cmds + +# Commands used to build a loadable module if different from building +# a shared archive. +module_cmds=$lt_module_cmds +module_expsym_cmds=$lt_module_expsym_cmds + +# Whether we are building with GNU ld or not. +with_gnu_ld=$lt_with_gnu_ld + +# Flag that allows shared libraries with undefined symbols to be built. +allow_undefined_flag=$lt_allow_undefined_flag + +# Flag that enforces no undefined symbols. +no_undefined_flag=$lt_no_undefined_flag + +# Flag to hardcode \$libdir into a binary during linking. +# This must work even if \$libdir does not exist +hardcode_libdir_flag_spec=$lt_hardcode_libdir_flag_spec + +# Whether we need a single "-rpath" flag with a separated argument. +hardcode_libdir_separator=$lt_hardcode_libdir_separator + +# Set to "yes" if using DIR/libNAME\$shared_ext during linking hardcodes +# DIR into the resulting binary. +hardcode_direct=$hardcode_direct + +# Set to "yes" if using DIR/libNAME\$shared_ext during linking hardcodes +# DIR into the resulting binary and the resulting library dependency is +# "absolute",i.e impossible to change by setting \$shlibpath_var if the +# library is relocated. +hardcode_direct_absolute=$hardcode_direct_absolute + +# Set to "yes" if using the -LDIR flag during linking hardcodes DIR +# into the resulting binary. +hardcode_minus_L=$hardcode_minus_L + +# Set to "yes" if using SHLIBPATH_VAR=DIR during linking hardcodes DIR +# into the resulting binary. +hardcode_shlibpath_var=$hardcode_shlibpath_var + +# Set to "yes" if building a shared library automatically hardcodes DIR +# into the library and all subsequent libraries and executables linked +# against it. +hardcode_automatic=$hardcode_automatic + +# Set to yes if linker adds runtime paths of dependent libraries +# to runtime path list. +inherit_rpath=$inherit_rpath + +# Whether libtool must link a program against all its dependency libraries. +link_all_deplibs=$link_all_deplibs + +# Set to "yes" if exported symbols are required. +always_export_symbols=$always_export_symbols + +# The commands to list exported symbols. +export_symbols_cmds=$lt_export_symbols_cmds + +# Symbols that should not be listed in the preloaded symbols. +exclude_expsyms=$lt_exclude_expsyms + +# Symbols that must always be exported. +include_expsyms=$lt_include_expsyms + +# Commands necessary for linking programs (against libraries) with templates. +prelink_cmds=$lt_prelink_cmds + +# Commands necessary for finishing linking programs. +postlink_cmds=$lt_postlink_cmds + +# Specify filename containing input files. +file_list_spec=$lt_file_list_spec + +# How to hardcode a shared library path into an executable. +hardcode_action=$hardcode_action + +# ### END LIBTOOL CONFIG + +_LT_EOF + + cat <<'_LT_EOF' >> "$cfgfile" + +# ### BEGIN FUNCTIONS SHARED WITH CONFIGURE + +# func_munge_path_list VARIABLE PATH +# ----------------------------------- +# VARIABLE is name of variable containing _space_ separated list of +# directories to be munged by the contents of PATH, which is string +# having a format: +# "DIR[:DIR]:" +# string "DIR[ DIR]" will be prepended to VARIABLE +# ":DIR[:DIR]" +# string "DIR[ DIR]" will be appended to VARIABLE +# "DIRP[:DIRP]::[DIRA:]DIRA" +# string "DIRP[ DIRP]" will be prepended to VARIABLE and string +# "DIRA[ DIRA]" will be appended to VARIABLE +# "DIR[:DIR]" +# VARIABLE will be replaced by "DIR[ DIR]" +func_munge_path_list () +{ + case x$2 in + x) + ;; + *:) + eval $1=\"`$ECHO $2 | $SED 's/:/ /g'` \$$1\" + ;; + x:*) + eval $1=\"\$$1 `$ECHO $2 | $SED 's/:/ /g'`\" + ;; + *::*) + eval $1=\"\$$1\ `$ECHO $2 | $SED -e 's/.*:://' -e 's/:/ /g'`\" + eval $1=\"`$ECHO $2 | $SED -e 's/::.*//' -e 's/:/ /g'`\ \$$1\" + ;; + *) + eval $1=\"`$ECHO $2 | $SED 's/:/ /g'`\" + ;; + esac +} + + +# Calculate cc_basename. Skip known compiler wrappers and cross-prefix. +func_cc_basename () +{ + for cc_temp in $*""; do + case $cc_temp in + compile | *[\\/]compile | ccache | *[\\/]ccache ) ;; + distcc | *[\\/]distcc | purify | *[\\/]purify ) ;; + \-*) ;; + *) break;; + esac + done + func_cc_basename_result=`$ECHO "$cc_temp" | $SED "s%.*/%%; s%^$host_alias-%%"` +} + + +# ### END FUNCTIONS SHARED WITH CONFIGURE + +_LT_EOF + + case $host_os in + aix3*) + cat <<\_LT_EOF >> "$cfgfile" +# AIX sometimes has problems with the GCC collect2 program. For some +# reason, if we set the COLLECT_NAMES environment variable, the problems +# vanish in a puff of smoke. +if test set != "${COLLECT_NAMES+set}"; then + COLLECT_NAMES= + export COLLECT_NAMES +fi +_LT_EOF + ;; + esac + + +ltmain=$ac_aux_dir/ltmain.sh + + + # We use sed instead of cat because bash on DJGPP gets confused if + # if finds mixed CR/LF and LF-only lines. Since sed operates in + # text mode, it properly converts lines to CR/LF. This bash problem + # is reportedly fixed, but why not run on old versions too? + sed '$q' "$ltmain" >> "$cfgfile" \ + || (rm -f "$cfgfile"; exit 1) + + mv -f "$cfgfile" "$ofile" || + (rm -f "$ofile" && cp "$cfgfile" "$ofile" && rm -f "$cfgfile") + chmod +x "$ofile" + + +as_fn_exit 0 +_LTEOF +chmod +x "$CONFIG_LT" + +# configure is writing to config.log, but config.lt does its own redirection, +# appending to config.log, which fails on DOS, as config.log is still kept +# open by configure. Here we exec the FD to /dev/null, effectively closing +# config.log, so it can be properly (re)opened and appended to by config.lt. +lt_cl_success=: +test yes = "$silent" && + lt_config_lt_args="$lt_config_lt_args --quiet" +exec 5>/dev/null +$SHELL "$CONFIG_LT" $lt_config_lt_args || lt_cl_success=false +exec 5>>config.log +$lt_cl_success || as_fn_exit 1 + +ac_ext=c +ac_cpp='$CPP $CPPFLAGS' +ac_compile='$CC -c $CFLAGS $CPPFLAGS conftest.$ac_ext >&5' +ac_link='$CC -o conftest$ac_exeext $CFLAGS $CPPFLAGS $LDFLAGS conftest.$ac_ext $LIBS >&5' +ac_compiler_gnu=$ac_cv_c_compiler_gnu +ac_link="./libtool --mode=link --tag=CC $ac_link" + +if test -n "$ac_tool_prefix"; then + # Extract the first word of "${ac_tool_prefix}pkg-config", so it can be a program name with args. +set dummy ${ac_tool_prefix}pkg-config; ac_word=$2 +{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $ac_word" >&5 +$as_echo_n "checking for $ac_word... " >&6; } +if ${ac_cv_prog_PKG_CONFIG+:} false; then : + $as_echo_n "(cached) " >&6 +else + if test -n "$PKG_CONFIG"; then + ac_cv_prog_PKG_CONFIG="$PKG_CONFIG" # Let the user override the test. +else +as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in $PATH +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + for ac_exec_ext in '' $ac_executable_extensions; do + if as_fn_executable_p "$as_dir/$ac_word$ac_exec_ext"; then + ac_cv_prog_PKG_CONFIG="${ac_tool_prefix}pkg-config" + $as_echo "$as_me:${as_lineno-$LINENO}: found $as_dir/$ac_word$ac_exec_ext" >&5 + break 2 + fi +done + done +IFS=$as_save_IFS + +fi +fi +PKG_CONFIG=$ac_cv_prog_PKG_CONFIG +if test -n "$PKG_CONFIG"; then + { $as_echo "$as_me:${as_lineno-$LINENO}: result: $PKG_CONFIG" >&5 +$as_echo "$PKG_CONFIG" >&6; } +else + { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5 +$as_echo "no" >&6; } +fi + + +fi +if test -z "$ac_cv_prog_PKG_CONFIG"; then + ac_ct_PKG_CONFIG=$PKG_CONFIG + # Extract the first word of "pkg-config", so it can be a program name with args. +set dummy pkg-config; ac_word=$2 +{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $ac_word" >&5 +$as_echo_n "checking for $ac_word... " >&6; } +if ${ac_cv_prog_ac_ct_PKG_CONFIG+:} false; then : + $as_echo_n "(cached) " >&6 +else + if test -n "$ac_ct_PKG_CONFIG"; then + ac_cv_prog_ac_ct_PKG_CONFIG="$ac_ct_PKG_CONFIG" # Let the user override the test. +else +as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in $PATH +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + for ac_exec_ext in '' $ac_executable_extensions; do + if as_fn_executable_p "$as_dir/$ac_word$ac_exec_ext"; then + ac_cv_prog_ac_ct_PKG_CONFIG="pkg-config" + $as_echo "$as_me:${as_lineno-$LINENO}: found $as_dir/$ac_word$ac_exec_ext" >&5 + break 2 + fi +done + done +IFS=$as_save_IFS + +fi +fi +ac_ct_PKG_CONFIG=$ac_cv_prog_ac_ct_PKG_CONFIG +if test -n "$ac_ct_PKG_CONFIG"; then + { $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_ct_PKG_CONFIG" >&5 +$as_echo "$ac_ct_PKG_CONFIG" >&6; } +else + { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5 +$as_echo "no" >&6; } +fi + + if test "x$ac_ct_PKG_CONFIG" = x; then + PKG_CONFIG="false" + else + case $cross_compiling:$ac_tool_warned in +yes:) +{ $as_echo "$as_me:${as_lineno-$LINENO}: WARNING: using cross tools not prefixed with host triplet" >&5 +$as_echo "$as_me: WARNING: using cross tools not prefixed with host triplet" >&2;} +ac_tool_warned=yes ;; +esac + PKG_CONFIG=$ac_ct_PKG_CONFIG + fi +else + PKG_CONFIG="$ac_cv_prog_PKG_CONFIG" +fi + +##tldbg _KPSE_LIB_FLAGS: Setup kpathsea (-lkpathsea) flags. +echo 'tldbg:_KPSE_LIB_FLAGS called: libdir=kpathsea, libname=kpathsea, options=lt, tlincl=-IBLD/texk -ISRC/texk, tllib=BLD/texk/kpathsea/libkpathsea.la, tlextra=, rebuildsrcdeps=${top_srcdir}/../kpathsea/*.[ch], rebuildblddeps=${top_builddir}/../kpathsea/paths.h.' >&5 +##tldbg _KPSE_LIB_FLAGS_TL: kpathsea (kpathsea) lt. + +# Check whether --with-system-kpathsea was given. +if test "${with_system_kpathsea+set}" = set; then : + withval=$with_system_kpathsea; +fi +if test "x$with_system_kpathsea" = xyes; then + if $PKG_CONFIG kpathsea; then + KPATHSEA_INCLUDES=`$PKG_CONFIG kpathsea --cflags` + KPATHSEA_LIBS=`$PKG_CONFIG kpathsea --libs` +elif test "x$need_kpathsea:$with_system_kpathsea" = xyes:yes; then + as_fn_error $? "did not find kpathsea" "$LINENO" 5 +fi +else + KPATHSEA_INCLUDES="-I$kpse_BLD/texk -I$kpse_SRC/texk" + KPATHSEA_LIBS="$kpse_BLD/texk/kpathsea/libkpathsea.la" + KPATHSEA_DEPEND='${top_builddir}/../kpathsea/libkpathsea.la' + KPATHSEA_RULE='# Rebuild libkpathsea +$(KPATHSEA_DEPEND): ${top_srcdir}/../kpathsea/*.[ch] ${top_builddir}/../kpathsea/paths.h + cd ${top_builddir}/../kpathsea && $(MAKE) $(AM_MAKEFLAGS) rebuild +${top_builddir}/../kpathsea/paths.h: + cd ${top_builddir}/../kpathsea && $(MAKE) $(AM_MAKEFLAGS) rebuild' +fi + +{ $as_echo "$as_me:${as_lineno-$LINENO}: checking if libkpathsea supports debugging" >&5 +$as_echo_n "checking if libkpathsea supports debugging... " >&6; } +if ${kpse_cv_kpse_debug+:} false; then : + $as_echo_n "(cached) " >&6 +else + eval CPPFLAGS=\"$KPATHSEA_INCLUDES \$CPPFLAGS\" +eval LIBS=\"$KPATHSEA_LIBS \$LIBS\" + + cat confdefs.h - <<_ACEOF >conftest.$ac_ext +/* end confdefs.h. */ +#include <kpathsea/kpathsea.h> +int +main () +{ +FILE *f = fopen("f", "r") + ; + return 0; +} +_ACEOF +if ac_fn_c_try_link "$LINENO"; then : + kpse_cv_kpse_debug=yes +else + kpse_cv_kpse_debug=no +fi +rm -f core conftest.err conftest.$ac_objext \ + conftest$ac_exeext conftest.$ac_ext + CPPFLAGS=$kpse_save_CPPFLAGS +LIBS=$kpse_save_LIBS + +fi +{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $kpse_cv_kpse_debug" >&5 +$as_echo "$kpse_cv_kpse_debug" >&6; } +if test "x$kpse_cv_kpse_debug" != xyes; then : + KPATHSEA_INCLUDES="$KPATHSEA_INCLUDES -DNO_DEBUG" +fi + +##tldbg _KPSE_LIB_FLAGS: Setup zlib (-lz) flags. +echo 'tldbg:_KPSE_LIB_FLAGS called: libdir=zlib, libname=z, options=, tlincl=-IBLD/libs/zlib/include, tllib=BLD/libs/zlib/libz.a, tlextra=, rebuildsrcdeps=, rebuildblddeps=${top_builddir}/../../libs/zlib/include/zconf.h.' >&5 +##tldbg _KPSE_LIB_FLAGS_TL: zlib (z) . + +# Check whether --with-system-zlib was given. +if test "${with_system_zlib+set}" = set; then : + withval=$with_system_zlib; +fi + +# Check whether --with-zlib-includes was given. +if test "${with_zlib_includes+set}" = set; then : + withval=$with_zlib_includes; +fi + +# Check whether --with-zlib-libdir was given. +if test "${with_zlib_libdir+set}" = set; then : + withval=$with_zlib_libdir; +fi +if test "x$with_system_zlib" = xyes; then + ##tldbg _KPSE_LIB_FLAGS_SYSTEM: zlib (z). +if test "x$with_zlib_includes" != x && test "x$with_zlib_includes" != xyes; then + ZLIB_INCLUDES="-I$with_zlib_includes" +fi +ZLIB_LIBS="-lz" +if test "x$with_zlib_libdir" != x && test "x$with_zlib_libdir" != xyes; then + ZLIB_LIBS="-L$with_zlib_libdir $ZLIB_LIBS" +fi +else + ZLIB_INCLUDES="-I$kpse_BLD/libs/zlib/include" + ZLIB_LIBS="$kpse_BLD/libs/zlib/libz.a" + ZLIB_DEPEND='${top_builddir}/../../libs/zlib/libz.a' + ZLIB_RULE='# Rebuild libz +$(ZLIB_DEPEND): ${top_builddir}/../../libs/zlib/include/zconf.h + cd ${top_builddir}/../../libs/zlib && $(MAKE) $(AM_MAKEFLAGS) rebuild +${top_builddir}/../../libs/zlib/include/zconf.h: + cd ${top_builddir}/../../libs/zlib && $(MAKE) $(AM_MAKEFLAGS) rebuild' +fi +{ $as_echo "$as_me:${as_lineno-$LINENO}: checking if <zlib.h> defines 'z_const'" >&5 +$as_echo_n "checking if <zlib.h> defines 'z_const'... " >&6; } +if ${kpse_cv_have_decl_z_const+:} false; then : + $as_echo_n "(cached) " >&6 +else + eval CPPFLAGS=\"$ZLIB_INCLUDES \$CPPFLAGS\" +eval LIBS=\"$ZLIB_LIBS \$LIBS\" + + cat confdefs.h - <<_ACEOF >conftest.$ac_ext +/* end confdefs.h. */ +#include <zlib.h> +int +main () +{ +z_const char * foo(); + ; + return 0; +} +_ACEOF +if ac_fn_c_try_compile "$LINENO"; then : + kpse_cv_have_decl_z_const=yes +else + kpse_cv_have_decl_z_const=no +fi +rm -f core conftest.err conftest.$ac_objext conftest.$ac_ext + CPPFLAGS=$kpse_save_CPPFLAGS +LIBS=$kpse_save_LIBS + +fi +{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $kpse_cv_have_decl_z_const" >&5 +$as_echo "$kpse_cv_have_decl_z_const" >&6; } +case $kpse_cv_have_decl_z_const in #( + yes) : + +$as_echo "#define ZLIB_CONST 1" >>confdefs.h + ;; #( + *) : + +$as_echo "#define z_const /**/" >>confdefs.h + ;; +esac + +##tldbg _KPSE_LIB_FLAGS: Setup libpng (-lpng) flags. +echo 'tldbg:_KPSE_LIB_FLAGS called: libdir=libpng, libname=png, options=, tlincl=-IBLD/libs/libpng/include, tllib=BLD/libs/libpng/libpng.a, tlextra=, rebuildsrcdeps=, rebuildblddeps=${top_builddir}/../../libs/libpng/include/png.h.' >&5 +##tldbg _KPSE_LIB_FLAGS_TL: libpng (png) . + +# Check whether --with-system-libpng was given. +if test "${with_system_libpng+set}" = set; then : + withval=$with_system_libpng; +fi +if test "x$with_system_libpng" = xyes; then + if $PKG_CONFIG libpng; then + LIBPNG_INCLUDES=`$PKG_CONFIG libpng --cflags` + LIBPNG_LIBS=`$PKG_CONFIG libpng --libs` +elif test "x$need_libpng:$with_system_libpng" = xyes:yes; then + as_fn_error $? "did not find libpng" "$LINENO" 5 +fi +else + LIBPNG_INCLUDES="-I$kpse_BLD/libs/libpng/include" + LIBPNG_LIBS="$kpse_BLD/libs/libpng/libpng.a" + LIBPNG_DEPEND='${top_builddir}/../../libs/libpng/libpng.a' + LIBPNG_RULE='# Rebuild libpng +$(LIBPNG_DEPEND): ${top_builddir}/../../libs/libpng/include/png.h + cd ${top_builddir}/../../libs/libpng && $(MAKE) $(AM_MAKEFLAGS) rebuild +${top_builddir}/../../libs/libpng/include/png.h: + cd ${top_builddir}/../../libs/libpng && $(MAKE) $(AM_MAKEFLAGS) rebuild' +fi + +##tldbg _KPSE_LIB_FLAGS: Setup freetype2 (-lfreetype) flags. +echo 'tldbg:_KPSE_LIB_FLAGS called: libdir=freetype2, libname=freetype, options=, tlincl=-IBLD/libs/freetype2/freetype2, tllib=BLD/libs/freetype2/libfreetype.a, tlextra=, rebuildsrcdeps=, rebuildblddeps=${top_builddir}/../../libs/freetype2/freetype2/ft2build.h.' >&5 +##tldbg _KPSE_LIB_FLAGS_TL: freetype2 (freetype) . + +# Check whether --with-system-freetype2 was given. +if test "${with_system_freetype2+set}" = set; then : + withval=$with_system_freetype2; +fi +if test "x$with_system_freetype2" = xyes; then + if test -n "$ac_tool_prefix"; then + # Extract the first word of "${ac_tool_prefix}freetype-config", so it can be a program name with args. +set dummy ${ac_tool_prefix}freetype-config; ac_word=$2 +{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $ac_word" >&5 +$as_echo_n "checking for $ac_word... " >&6; } +if ${ac_cv_prog_FT2_CONFIG+:} false; then : + $as_echo_n "(cached) " >&6 +else + if test -n "$FT2_CONFIG"; then + ac_cv_prog_FT2_CONFIG="$FT2_CONFIG" # Let the user override the test. +else +as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in $PATH +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + for ac_exec_ext in '' $ac_executable_extensions; do + if as_fn_executable_p "$as_dir/$ac_word$ac_exec_ext"; then + ac_cv_prog_FT2_CONFIG="${ac_tool_prefix}freetype-config" + $as_echo "$as_me:${as_lineno-$LINENO}: found $as_dir/$ac_word$ac_exec_ext" >&5 + break 2 + fi +done + done +IFS=$as_save_IFS + +fi +fi +FT2_CONFIG=$ac_cv_prog_FT2_CONFIG +if test -n "$FT2_CONFIG"; then + { $as_echo "$as_me:${as_lineno-$LINENO}: result: $FT2_CONFIG" >&5 +$as_echo "$FT2_CONFIG" >&6; } +else + { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5 +$as_echo "no" >&6; } +fi + + +fi +if test -z "$ac_cv_prog_FT2_CONFIG"; then + ac_ct_FT2_CONFIG=$FT2_CONFIG + # Extract the first word of "freetype-config", so it can be a program name with args. +set dummy freetype-config; ac_word=$2 +{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $ac_word" >&5 +$as_echo_n "checking for $ac_word... " >&6; } +if ${ac_cv_prog_ac_ct_FT2_CONFIG+:} false; then : + $as_echo_n "(cached) " >&6 +else + if test -n "$ac_ct_FT2_CONFIG"; then + ac_cv_prog_ac_ct_FT2_CONFIG="$ac_ct_FT2_CONFIG" # Let the user override the test. +else +as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in $PATH +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + for ac_exec_ext in '' $ac_executable_extensions; do + if as_fn_executable_p "$as_dir/$ac_word$ac_exec_ext"; then + ac_cv_prog_ac_ct_FT2_CONFIG="freetype-config" + $as_echo "$as_me:${as_lineno-$LINENO}: found $as_dir/$ac_word$ac_exec_ext" >&5 + break 2 + fi +done + done +IFS=$as_save_IFS + +fi +fi +ac_ct_FT2_CONFIG=$ac_cv_prog_ac_ct_FT2_CONFIG +if test -n "$ac_ct_FT2_CONFIG"; then + { $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_ct_FT2_CONFIG" >&5 +$as_echo "$ac_ct_FT2_CONFIG" >&6; } +else + { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5 +$as_echo "no" >&6; } +fi + + if test "x$ac_ct_FT2_CONFIG" = x; then + FT2_CONFIG="false" + else + case $cross_compiling:$ac_tool_warned in +yes:) +{ $as_echo "$as_me:${as_lineno-$LINENO}: WARNING: using cross tools not prefixed with host triplet" >&5 +$as_echo "$as_me: WARNING: using cross tools not prefixed with host triplet" >&2;} +ac_tool_warned=yes ;; +esac + FT2_CONFIG=$ac_ct_FT2_CONFIG + fi +else + FT2_CONFIG="$ac_cv_prog_FT2_CONFIG" +fi +if test -n "$ac_tool_prefix"; then + # Extract the first word of "${ac_tool_prefix}pkg-config", so it can be a program name with args. +set dummy ${ac_tool_prefix}pkg-config; ac_word=$2 +{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $ac_word" >&5 +$as_echo_n "checking for $ac_word... " >&6; } +if ${ac_cv_prog_PKG_CONFIG+:} false; then : + $as_echo_n "(cached) " >&6 +else + if test -n "$PKG_CONFIG"; then + ac_cv_prog_PKG_CONFIG="$PKG_CONFIG" # Let the user override the test. +else +as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in $PATH +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + for ac_exec_ext in '' $ac_executable_extensions; do + if as_fn_executable_p "$as_dir/$ac_word$ac_exec_ext"; then + ac_cv_prog_PKG_CONFIG="${ac_tool_prefix}pkg-config" + $as_echo "$as_me:${as_lineno-$LINENO}: found $as_dir/$ac_word$ac_exec_ext" >&5 + break 2 + fi +done + done +IFS=$as_save_IFS + +fi +fi +PKG_CONFIG=$ac_cv_prog_PKG_CONFIG +if test -n "$PKG_CONFIG"; then + { $as_echo "$as_me:${as_lineno-$LINENO}: result: $PKG_CONFIG" >&5 +$as_echo "$PKG_CONFIG" >&6; } +else + { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5 +$as_echo "no" >&6; } +fi + + +fi +if test -z "$ac_cv_prog_PKG_CONFIG"; then + ac_ct_PKG_CONFIG=$PKG_CONFIG + # Extract the first word of "pkg-config", so it can be a program name with args. +set dummy pkg-config; ac_word=$2 +{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $ac_word" >&5 +$as_echo_n "checking for $ac_word... " >&6; } +if ${ac_cv_prog_ac_ct_PKG_CONFIG+:} false; then : + $as_echo_n "(cached) " >&6 +else + if test -n "$ac_ct_PKG_CONFIG"; then + ac_cv_prog_ac_ct_PKG_CONFIG="$ac_ct_PKG_CONFIG" # Let the user override the test. +else +as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in $PATH +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + for ac_exec_ext in '' $ac_executable_extensions; do + if as_fn_executable_p "$as_dir/$ac_word$ac_exec_ext"; then + ac_cv_prog_ac_ct_PKG_CONFIG="pkg-config" + $as_echo "$as_me:${as_lineno-$LINENO}: found $as_dir/$ac_word$ac_exec_ext" >&5 + break 2 + fi +done + done +IFS=$as_save_IFS + +fi +fi +ac_ct_PKG_CONFIG=$ac_cv_prog_ac_ct_PKG_CONFIG +if test -n "$ac_ct_PKG_CONFIG"; then + { $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_ct_PKG_CONFIG" >&5 +$as_echo "$ac_ct_PKG_CONFIG" >&6; } +else + { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5 +$as_echo "no" >&6; } +fi + + if test "x$ac_ct_PKG_CONFIG" = x; then + PKG_CONFIG="false" + else + case $cross_compiling:$ac_tool_warned in +yes:) +{ $as_echo "$as_me:${as_lineno-$LINENO}: WARNING: using cross tools not prefixed with host triplet" >&5 +$as_echo "$as_me: WARNING: using cross tools not prefixed with host triplet" >&2;} +ac_tool_warned=yes ;; +esac + PKG_CONFIG=$ac_ct_PKG_CONFIG + fi +else + PKG_CONFIG="$ac_cv_prog_PKG_CONFIG" +fi +if $FT2_CONFIG --ftversion >/dev/null 2>&1; then + FREETYPE2_INCLUDES=`$FT2_CONFIG --cflags` + FREETYPE2_LIBS=`$FT2_CONFIG --libs` +elif $PKG_CONFIG --libs freetype2 >/dev/null 2>&1; then + FREETYPE2_INCLUDES=`$PKG_CONFIG --cflags freetype2` + FREETYPE2_LIBS=`$PKG_CONFIG --libs freetype2` +elif test "x$need_freetype2:$with_system_freetype2" = xyes:yes; then + as_fn_error $? "did not find freetype-config required for system freetype2 library" "$LINENO" 5 +fi +else + FREETYPE2_INCLUDES="-I$kpse_BLD/libs/freetype2/freetype2" + FREETYPE2_LIBS="$kpse_BLD/libs/freetype2/libfreetype.a" + FREETYPE2_DEPEND='${top_builddir}/../../libs/freetype2/libfreetype.a' + FREETYPE2_RULE='# Rebuild libfreetype +$(FREETYPE2_DEPEND): ${top_builddir}/../../libs/freetype2/freetype2/ft2build.h + cd ${top_builddir}/../../libs/freetype2 && $(MAKE) $(AM_MAKEFLAGS) rebuild +${top_builddir}/../../libs/freetype2/freetype2/ft2build.h: + cd ${top_builddir}/../../libs/freetype2 && $(MAKE) $(AM_MAKEFLAGS) rebuild' +fi + +{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for native WIN32 or MINGW32" >&5 +$as_echo_n "checking for native WIN32 or MINGW32... " >&6; } +if ${kpse_cv_have_win32+:} false; then : + $as_echo_n "(cached) " >&6 +else + cat confdefs.h - <<_ACEOF >conftest.$ac_ext +/* end confdefs.h. */ +#ifndef WIN32 + choke me +#endif +int +main () +{ + + ; + return 0; +} +_ACEOF +if ac_fn_c_try_compile "$LINENO"; then : + cat confdefs.h - <<_ACEOF >conftest.$ac_ext +/* end confdefs.h. */ +#ifndef __MINGW32__ + choke me +#endif +int +main () +{ + + ; + return 0; +} +_ACEOF +if ac_fn_c_try_compile "$LINENO"; then : + kpse_cv_have_win32=mingw32 +else + kpse_cv_have_win32=native +fi +rm -f core conftest.err conftest.$ac_objext conftest.$ac_ext +else + kpse_cv_have_win32=no +fi +rm -f core conftest.err conftest.$ac_objext conftest.$ac_ext +fi +{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $kpse_cv_have_win32" >&5 +$as_echo "$kpse_cv_have_win32" >&6; } + +##tldbg _KPSE_LIB_FLAGS: Setup gd (-lgd) flags. +echo 'tldbg:_KPSE_LIB_FLAGS called: libdir=gd, libname=gd, options=, tlincl=-IBLD/libs/gd/include, tllib=BLD/libs/gd/libgd.a, tlextra=test "x$kpse_cv_have_win32" = xno || GD_INCLUDES="$GD_INCLUDES -DBGDWIN32 -DNONDLL", rebuildsrcdeps=, rebuildblddeps=${top_builddir}/../../libs/gd/include/gd.h.' >&5 +##tldbg _KPSE_LIB_FLAGS_TL: gd (gd) . + +# Check whether --with-system-gd was given. +if test "${with_system_gd+set}" = set; then : + withval=$with_system_gd; +fi + +# Check whether --with-gd-includes was given. +if test "${with_gd_includes+set}" = set; then : + withval=$with_gd_includes; +fi + +# Check whether --with-gd-libdir was given. +if test "${with_gd_libdir+set}" = set; then : + withval=$with_gd_libdir; +fi +if test "x$with_system_gd" = xyes; then + ##tldbg _KPSE_LIB_FLAGS_SYSTEM: gd (gd). +if test "x$with_gd_includes" != x && test "x$with_gd_includes" != xyes; then + GD_INCLUDES="-I$with_gd_includes" +fi +GD_LIBS="-lgd" +if test "x$with_gd_libdir" != x && test "x$with_gd_libdir" != xyes; then + GD_LIBS="-L$with_gd_libdir $GD_LIBS" +fi +else + GD_INCLUDES="-I$kpse_BLD/libs/gd/include" + GD_LIBS="$kpse_BLD/libs/gd/libgd.a" + test "x$kpse_cv_have_win32" = xno || GD_INCLUDES="$GD_INCLUDES -DBGDWIN32 -DNONDLL" + GD_DEPEND='${top_builddir}/../../libs/gd/libgd.a' + GD_RULE='# Rebuild libgd +$(GD_DEPEND): ${top_builddir}/../../libs/gd/include/gd.h + cd ${top_builddir}/../../libs/gd && $(MAKE) $(AM_MAKEFLAGS) rebuild +${top_builddir}/../../libs/gd/include/gd.h: + cd ${top_builddir}/../../libs/gd && $(MAKE) $(AM_MAKEFLAGS) rebuild' +fi + + +# Assume we have freetype2. +have_ft2=yes + +if test "x$enable_build" != xno || test -f config.force; then + +# Checks for more libraries. +eval CPPFLAGS=\"$ZLIB_INCLUDES \$CPPFLAGS\" +eval LIBS=\"$ZLIB_LIBS \$LIBS\" + +ac_fn_c_check_func "$LINENO" "deflate" "ac_cv_func_deflate" +if test "x$ac_cv_func_deflate" = xyes; then : + +$as_echo "#define HAVE_LIBZ 1" >>confdefs.h + +fi + + +eval CPPFLAGS=\"$LIBPNG_INCLUDES \$CPPFLAGS\" +eval LIBS=\"$LIBPNG_LIBS \$LIBS\" + +ac_fn_c_check_func "$LINENO" "png_read_image" "ac_cv_func_png_read_image" +if test "x$ac_cv_func_png_read_image" = xyes; then : + +$as_echo "#define HAVE_LIBPNG 1" >>confdefs.h + +else + as_fn_error $? "cannot find/use libpng" "$LINENO" 5 +fi + + +eval CPPFLAGS=\"$FREETYPE2_INCLUDES \$CPPFLAGS\" +eval LIBS=\"$FREETYPE2_LIBS \$LIBS\" + +ac_fn_c_check_func "$LINENO" "FT_Init_FreeType" "ac_cv_func_FT_Init_FreeType" +if test "x$ac_cv_func_FT_Init_FreeType" = xyes; then : + +$as_echo "#define HAVE_FT2 1" >>confdefs.h + +else + have_ft2=no +fi + + +eval CPPFLAGS=\"$GD_INCLUDES \$CPPFLAGS\" +eval LIBS=\"$GD_LIBS \$LIBS\" + +ac_fn_c_check_func "$LINENO" "gdImageCreate" "ac_cv_func_gdImageCreate" +if test "x$ac_cv_func_gdImageCreate" = xyes; then : + +$as_echo "#define HAVE_LIBGD 1" >>confdefs.h + +else + as_fn_error $? "cannot find/use gd +This drawing library can be downloaded at http://www.boutell.com/gd" "$LINENO" 5 +fi + + +eval CPPFLAGS=\"$KPATHSEA_INCLUDES \$CPPFLAGS\" +eval LIBS=\"$KPATHSEA_LIBS \$LIBS\" + +ac_fn_c_check_func "$LINENO" "kpse_set_program_name" "ac_cv_func_kpse_set_program_name" +if test "x$ac_cv_func_kpse_set_program_name" = xyes; then : + +$as_echo "#define HAVE_LIBKPATHSEA 1" >>confdefs.h + +else + as_fn_error $? "cannot find/use libkpathsea" "$LINENO" 5 +fi + + +for ac_func in kpse_program_basename +do : + ac_fn_c_check_func "$LINENO" "kpse_program_basename" "ac_cv_func_kpse_program_basename" +if test "x$ac_cv_func_kpse_program_basename" = xyes; then : + cat >>confdefs.h <<_ACEOF +#define HAVE_KPSE_PROGRAM_BASENAME 1 +_ACEOF + +fi +done + + +if test "x$kpse_cv_have_win32" != xno; then : + for ac_func in texlive_gs_init +do : + ac_fn_c_check_func "$LINENO" "texlive_gs_init" "ac_cv_func_texlive_gs_init" +if test "x$ac_cv_func_texlive_gs_init" = xyes; then : + cat >>confdefs.h <<_ACEOF +#define HAVE_TEXLIVE_GS_INIT 1 +_ACEOF + +fi +done + +fi + + +# We need enc, cmap, and sfd formats. +# Introduced together with opentype format (Dec 2003). +{ $as_echo "$as_me:${as_lineno-$LINENO}: checking whether kpathsea declares the kpse_opentype_format" >&5 +$as_echo_n "checking whether kpathsea declares the kpse_opentype_format... " >&6; } +if ${kpse_cv_have_opentype_format+:} false; then : + $as_echo_n "(cached) " >&6 +else + cat confdefs.h - <<_ACEOF >conftest.$ac_ext +/* end confdefs.h. */ +#include <kpathsea/kpathsea.h> +int +main () +{ +kpse_opentype_format + ; + return 0; +} +_ACEOF +if ac_fn_c_try_link "$LINENO"; then : + kpse_cv_have_opentype_format=yes +else + kpse_cv_have_opentype_format=no +fi +rm -f core conftest.err conftest.$ac_objext \ + conftest$ac_exeext conftest.$ac_ext +fi +{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $kpse_cv_have_opentype_format" >&5 +$as_echo "$kpse_cv_have_opentype_format" >&6; } +if test "x$kpse_cv_have_opentype_format" = xyes; then : + +$as_echo "#define HAVE_KPSE_ENC_FORMATS 1" >>confdefs.h + +fi + + +# Checks for more header files. +for ac_header in gd.h png.h kpathsea/kpathsea.h +do : + as_ac_Header=`$as_echo "ac_cv_header_$ac_header" | $as_tr_sh` +ac_fn_c_check_header_mongrel "$LINENO" "$ac_header" "$as_ac_Header" "$ac_includes_default" +if eval test \"x\$"$as_ac_Header"\" = x"yes"; then : + cat >>confdefs.h <<_ACEOF +#define `$as_echo "HAVE_$ac_header" | $as_tr_cpp` 1 +_ACEOF + +else + as_fn_error $? "cannot find/use $ac_header" "$LINENO" 5 +fi + +done + + +# Checks for more library functions. +for ac_func in gdImageCreateTrueColor gdImageCreateFromJpeg gdImagePngEx gdImageCreateFromPngPtr gdImageGif FT_Library_Version +do : + as_ac_var=`$as_echo "ac_cv_func_$ac_func" | $as_tr_sh` +ac_fn_c_check_func "$LINENO" "$ac_func" "$as_ac_var" +if eval test \"x\$"$as_ac_var"\" = x"yes"; then : + cat >>confdefs.h <<_ACEOF +#define `$as_echo "HAVE_$ac_func" | $as_tr_cpp` 1 +_ACEOF + +fi +done + + +CPPFLAGS=$kpse_save_CPPFLAGS +LIBS=$kpse_save_LIBS + + +echo timestamp >config.force + +fi + + if test "x$have_ft2" = xyes; then + have_ft2_TRUE= + have_ft2_FALSE='#' +else + have_ft2_TRUE='#' + have_ft2_FALSE= +fi + + if test "x$ac_cv_func_gdImageGif" = xyes; then + have_gif_TRUE= + have_gif_FALSE='#' +else + have_gif_TRUE='#' + have_gif_FALSE= +fi + + +{ $as_echo "$as_me:${as_lineno-$LINENO}: result: +** Configuration summary for $PACKAGE_STRING: + + The -d (debug) switch is enabled: $enable_debug + Your gd is new enough (>=2.0) to enable + the --truecolor switch, full alpha + transparency, proper rescaling of + included bitmaps, and jpeg inclusion: $ac_cv_func_gdImageCreateTrueColor + Your gd has jpeg inclusion enabled: $ac_cv_func_gdImageCreateFromJpeg + Your gd is new enough (>=2.0.12) to + enable transparent backgrounds for EPS + inclusion and the -z (compression) + switch: $ac_cv_func_gdImagePngEx + Your gd is new enough (>=2.0.21) to + allow image creation from memory $ac_cv_func_gdImageCreateFromPngPtr + Your gd is new enough (>=2.0.28) to + enable gif inclusion and output + (dvigif): $ac_cv_func_gdImageGif + FreeType font rendering available: $ac_cv_func_FT_Init_FreeType + Support for subfonts (CJK-LaTeX): $ac_cv_func_FT_Init_FreeType +" >&5 +$as_echo " +** Configuration summary for $PACKAGE_STRING: + + The -d (debug) switch is enabled: $enable_debug + Your gd is new enough (>=2.0) to enable + the --truecolor switch, full alpha + transparency, proper rescaling of + included bitmaps, and jpeg inclusion: $ac_cv_func_gdImageCreateTrueColor + Your gd has jpeg inclusion enabled: $ac_cv_func_gdImageCreateFromJpeg + Your gd is new enough (>=2.0.12) to + enable transparent backgrounds for EPS + inclusion and the -z (compression) + switch: $ac_cv_func_gdImagePngEx + Your gd is new enough (>=2.0.21) to + allow image creation from memory $ac_cv_func_gdImageCreateFromPngPtr + Your gd is new enough (>=2.0.28) to + enable gif inclusion and output + (dvigif): $ac_cv_func_gdImageGif + FreeType font rendering available: $ac_cv_func_FT_Init_FreeType + Support for subfonts (CJK-LaTeX): $ac_cv_func_FT_Init_FreeType +" >&6; } + +ac_config_headers="$ac_config_headers config.h" + + +DVIPNG_TREE=dvipng-src + + + if test "x$kpse_cv_have_win32" != xno; then + WIN32_TRUE= + WIN32_FALSE='#' +else + WIN32_TRUE='#' + WIN32_FALSE= +fi + + + if test -r "$srcdir/../texlive/w32_wrapper/callexe.c"; then + WIN32_CALL_TRUE= + WIN32_CALL_FALSE='#' +else + WIN32_CALL_TRUE='#' + WIN32_CALL_FALSE= +fi + +if test -z "$WIN32_TRUE"; then : + ac_config_links="$ac_config_links callexe.c:../texlive/w32_wrapper/callexe.c" + +fi + + +ac_config_files="$ac_config_files Makefile help/Makefile doc/Makefile" + + +cat >confcache <<\_ACEOF +# This file is a shell script that caches the results of configure +# tests run on this system so they can be shared between configure +# scripts and configure runs, see configure's option --config-cache. +# It is not useful on other systems. If it contains results you don't +# want to keep, you may remove or edit it. +# +# config.status only pays attention to the cache file if you give it +# the --recheck option to rerun configure. +# +# `ac_cv_env_foo' variables (set or unset) will be overridden when +# loading this file, other *unset* `ac_cv_foo' will be assigned the +# following values. + +_ACEOF + +# The following way of writing the cache mishandles newlines in values, +# but we know of no workaround that is simple, portable, and efficient. +# So, we kill variables containing newlines. +# Ultrix sh set writes to stderr and can't be redirected directly, +# and sets the high bit in the cache file unless we assign to the vars. +( + for ac_var in `(set) 2>&1 | sed -n 's/^\([a-zA-Z_][a-zA-Z0-9_]*\)=.*/\1/p'`; do + eval ac_val=\$$ac_var + case $ac_val in #( + *${as_nl}*) + case $ac_var in #( + *_cv_*) { $as_echo "$as_me:${as_lineno-$LINENO}: WARNING: cache variable $ac_var contains a newline" >&5 +$as_echo "$as_me: WARNING: cache variable $ac_var contains a newline" >&2;} ;; + esac + case $ac_var in #( + _ | IFS | as_nl) ;; #( + BASH_ARGV | BASH_SOURCE) eval $ac_var= ;; #( + *) { eval $ac_var=; unset $ac_var;} ;; + esac ;; + esac + done + + (set) 2>&1 | + case $as_nl`(ac_space=' '; set) 2>&1` in #( + *${as_nl}ac_space=\ *) + # `set' does not quote correctly, so add quotes: double-quote + # substitution turns \\\\ into \\, and sed turns \\ into \. + sed -n \ + "s/'/'\\\\''/g; + s/^\\([_$as_cr_alnum]*_cv_[_$as_cr_alnum]*\\)=\\(.*\\)/\\1='\\2'/p" + ;; #( + *) + # `set' quotes correctly as required by POSIX, so do not add quotes. + sed -n "/^[_$as_cr_alnum]*_cv_[_$as_cr_alnum]*=/p" + ;; + esac | + sort +) | + sed ' + /^ac_cv_env_/b end + t clear + :clear + s/^\([^=]*\)=\(.*[{}].*\)$/test "${\1+set}" = set || &/ + t end + s/^\([^=]*\)=\(.*\)$/\1=${\1=\2}/ + :end' >>confcache +if diff "$cache_file" confcache >/dev/null 2>&1; then :; else + if test -w "$cache_file"; then + if test "x$cache_file" != "x/dev/null"; then + { $as_echo "$as_me:${as_lineno-$LINENO}: updating cache $cache_file" >&5 +$as_echo "$as_me: updating cache $cache_file" >&6;} + if test ! -f "$cache_file" || test -h "$cache_file"; then + cat confcache >"$cache_file" + else + case $cache_file in #( + */* | ?:*) + mv -f confcache "$cache_file"$$ && + mv -f "$cache_file"$$ "$cache_file" ;; #( + *) + mv -f confcache "$cache_file" ;; + esac + fi + fi + else + { $as_echo "$as_me:${as_lineno-$LINENO}: not updating unwritable cache $cache_file" >&5 +$as_echo "$as_me: not updating unwritable cache $cache_file" >&6;} + fi +fi +rm -f confcache + +test "x$prefix" = xNONE && prefix=$ac_default_prefix +# Let make expand exec_prefix. +test "x$exec_prefix" = xNONE && exec_prefix='${prefix}' + +DEFS=-DHAVE_CONFIG_H + +ac_libobjs= +ac_ltlibobjs= +U= +for ac_i in : $LIBOBJS; do test "x$ac_i" = x: && continue + # 1. Remove the extension, and $U if already installed. + ac_script='s/\$U\././;s/\.o$//;s/\.obj$//' + ac_i=`$as_echo "$ac_i" | sed "$ac_script"` + # 2. Prepend LIBOBJDIR. When used with automake>=1.10 LIBOBJDIR + # will be set to the directory where LIBOBJS objects are built. + as_fn_append ac_libobjs " \${LIBOBJDIR}$ac_i\$U.$ac_objext" + as_fn_append ac_ltlibobjs " \${LIBOBJDIR}$ac_i"'$U.lo' +done +LIBOBJS=$ac_libobjs + +LTLIBOBJS=$ac_ltlibobjs + + +{ $as_echo "$as_me:${as_lineno-$LINENO}: checking that generated files are newer than configure" >&5 +$as_echo_n "checking that generated files are newer than configure... " >&6; } + if test -n "$am_sleep_pid"; then + # Hide warnings about reused PIDs. + wait $am_sleep_pid 2>/dev/null + fi + { $as_echo "$as_me:${as_lineno-$LINENO}: result: done" >&5 +$as_echo "done" >&6; } + if test -n "$EXEEXT"; then + am__EXEEXT_TRUE= + am__EXEEXT_FALSE='#' +else + am__EXEEXT_TRUE='#' + am__EXEEXT_FALSE= +fi + +if test -z "${MAINTAINER_MODE_TRUE}" && test -z "${MAINTAINER_MODE_FALSE}"; then + as_fn_error $? "conditional \"MAINTAINER_MODE\" was never defined. +Usually this means the macro was only invoked conditionally." "$LINENO" 5 +fi +if test -z "${AMDEP_TRUE}" && test -z "${AMDEP_FALSE}"; then + as_fn_error $? "conditional \"AMDEP\" was never defined. +Usually this means the macro was only invoked conditionally." "$LINENO" 5 +fi +if test -z "${am__fastdepCC_TRUE}" && test -z "${am__fastdepCC_FALSE}"; then + as_fn_error $? "conditional \"am__fastdepCC\" was never defined. +Usually this means the macro was only invoked conditionally." "$LINENO" 5 +fi +if test -z "${cross_TRUE}" && test -z "${cross_FALSE}"; then + as_fn_error $? "conditional \"cross\" was never defined. +Usually this means the macro was only invoked conditionally." "$LINENO" 5 +fi +if test -z "${have_ft2_TRUE}" && test -z "${have_ft2_FALSE}"; then + as_fn_error $? "conditional \"have_ft2\" was never defined. +Usually this means the macro was only invoked conditionally." "$LINENO" 5 +fi +if test -z "${have_gif_TRUE}" && test -z "${have_gif_FALSE}"; then + as_fn_error $? "conditional \"have_gif\" was never defined. +Usually this means the macro was only invoked conditionally." "$LINENO" 5 +fi +if test -z "${WIN32_TRUE}" && test -z "${WIN32_FALSE}"; then + as_fn_error $? "conditional \"WIN32\" was never defined. +Usually this means the macro was only invoked conditionally." "$LINENO" 5 +fi +if test -z "${WIN32_CALL_TRUE}" && test -z "${WIN32_CALL_FALSE}"; then + as_fn_error $? "conditional \"WIN32_CALL\" was never defined. +Usually this means the macro was only invoked conditionally." "$LINENO" 5 +fi + +: "${CONFIG_STATUS=./config.status}" +ac_write_fail=0 +ac_clean_files_save=$ac_clean_files +ac_clean_files="$ac_clean_files $CONFIG_STATUS" +{ $as_echo "$as_me:${as_lineno-$LINENO}: creating $CONFIG_STATUS" >&5 +$as_echo "$as_me: creating $CONFIG_STATUS" >&6;} +as_write_fail=0 +cat >$CONFIG_STATUS <<_ASEOF || as_write_fail=1 +#! $SHELL +# Generated by $as_me. +# Run this file to recreate the current configuration. +# Compiler output produced by configure, useful for debugging +# configure, is in config.log if it exists. + +debug=false +ac_cs_recheck=false +ac_cs_silent=false + +SHELL=\${CONFIG_SHELL-$SHELL} +export SHELL +_ASEOF +cat >>$CONFIG_STATUS <<\_ASEOF || as_write_fail=1 +## -------------------- ## +## M4sh Initialization. ## +## -------------------- ## + +# Be more Bourne compatible +DUALCASE=1; export DUALCASE # for MKS sh +if test -n "${ZSH_VERSION+set}" && (emulate sh) >/dev/null 2>&1; then : + emulate sh + NULLCMD=: + # Pre-4.2 versions of Zsh do word splitting on ${1+"$@"}, which + # is contrary to our usage. Disable this feature. + alias -g '${1+"$@"}'='"$@"' + setopt NO_GLOB_SUBST +else + case `(set -o) 2>/dev/null` in #( + *posix*) : + set -o posix ;; #( + *) : + ;; +esac +fi + + +as_nl=' +' +export as_nl +# Printing a long string crashes Solaris 7 /usr/bin/printf. +as_echo='\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\' +as_echo=$as_echo$as_echo$as_echo$as_echo$as_echo +as_echo=$as_echo$as_echo$as_echo$as_echo$as_echo$as_echo +# Prefer a ksh shell builtin over an external printf program on Solaris, +# but without wasting forks for bash or zsh. +if test -z "$BASH_VERSION$ZSH_VERSION" \ + && (test "X`print -r -- $as_echo`" = "X$as_echo") 2>/dev/null; then + as_echo='print -r --' + as_echo_n='print -rn --' +elif (test "X`printf %s $as_echo`" = "X$as_echo") 2>/dev/null; then + as_echo='printf %s\n' + as_echo_n='printf %s' +else + if test "X`(/usr/ucb/echo -n -n $as_echo) 2>/dev/null`" = "X-n $as_echo"; then + as_echo_body='eval /usr/ucb/echo -n "$1$as_nl"' + as_echo_n='/usr/ucb/echo -n' + else + as_echo_body='eval expr "X$1" : "X\\(.*\\)"' + as_echo_n_body='eval + arg=$1; + case $arg in #( + *"$as_nl"*) + expr "X$arg" : "X\\(.*\\)$as_nl"; + arg=`expr "X$arg" : ".*$as_nl\\(.*\\)"`;; + esac; + expr "X$arg" : "X\\(.*\\)" | tr -d "$as_nl" + ' + export as_echo_n_body + as_echo_n='sh -c $as_echo_n_body as_echo' + fi + export as_echo_body + as_echo='sh -c $as_echo_body as_echo' +fi + +# The user is always right. +if test "${PATH_SEPARATOR+set}" != set; then + PATH_SEPARATOR=: + (PATH='/bin;/bin'; FPATH=$PATH; sh -c :) >/dev/null 2>&1 && { + (PATH='/bin:/bin'; FPATH=$PATH; sh -c :) >/dev/null 2>&1 || + PATH_SEPARATOR=';' + } +fi + + +# IFS +# We need space, tab and new line, in precisely that order. Quoting is +# there to prevent editors from complaining about space-tab. +# (If _AS_PATH_WALK were called with IFS unset, it would disable word +# splitting by setting IFS to empty value.) +IFS=" "" $as_nl" + +# Find who we are. Look in the path if we contain no directory separator. +as_myself= +case $0 in #(( + *[\\/]* ) as_myself=$0 ;; + *) as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in $PATH +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + test -r "$as_dir/$0" && as_myself=$as_dir/$0 && break + done +IFS=$as_save_IFS + + ;; +esac +# We did not find ourselves, most probably we were run as `sh COMMAND' +# in which case we are not to be found in the path. +if test "x$as_myself" = x; then + as_myself=$0 +fi +if test ! -f "$as_myself"; then + $as_echo "$as_myself: error: cannot find myself; rerun with an absolute file name" >&2 + exit 1 +fi + +# Unset variables that we do not need and which cause bugs (e.g. in +# pre-3.0 UWIN ksh). But do not cause bugs in bash 2.01; the "|| exit 1" +# suppresses any "Segmentation fault" message there. '((' could +# trigger a bug in pdksh 5.2.14. +for as_var in BASH_ENV ENV MAIL MAILPATH +do eval test x\${$as_var+set} = xset \ + && ( (unset $as_var) || exit 1) >/dev/null 2>&1 && unset $as_var || : +done +PS1='$ ' +PS2='> ' +PS4='+ ' + +# NLS nuisances. +LC_ALL=C +export LC_ALL +LANGUAGE=C +export LANGUAGE + +# CDPATH. +(unset CDPATH) >/dev/null 2>&1 && unset CDPATH + + +# as_fn_error STATUS ERROR [LINENO LOG_FD] +# ---------------------------------------- +# Output "`basename $0`: error: ERROR" to stderr. If LINENO and LOG_FD are +# provided, also output the error to LOG_FD, referencing LINENO. Then exit the +# script with STATUS, using 1 if that was 0. +as_fn_error () +{ + as_status=$1; test $as_status -eq 0 && as_status=1 + if test "$4"; then + as_lineno=${as_lineno-"$3"} as_lineno_stack=as_lineno_stack=$as_lineno_stack + $as_echo "$as_me:${as_lineno-$LINENO}: error: $2" >&$4 + fi + $as_echo "$as_me: error: $2" >&2 + as_fn_exit $as_status +} # as_fn_error + + +# as_fn_set_status STATUS +# ----------------------- +# Set $? to STATUS, without forking. +as_fn_set_status () +{ + return $1 +} # as_fn_set_status + +# as_fn_exit STATUS +# ----------------- +# Exit the shell with STATUS, even in a "trap 0" or "set -e" context. +as_fn_exit () +{ + set +e + as_fn_set_status $1 + exit $1 +} # as_fn_exit + +# as_fn_unset VAR +# --------------- +# Portably unset VAR. +as_fn_unset () +{ + { eval $1=; unset $1;} +} +as_unset=as_fn_unset +# as_fn_append VAR VALUE +# ---------------------- +# Append the text in VALUE to the end of the definition contained in VAR. Take +# advantage of any shell optimizations that allow amortized linear growth over +# repeated appends, instead of the typical quadratic growth present in naive +# implementations. +if (eval "as_var=1; as_var+=2; test x\$as_var = x12") 2>/dev/null; then : + eval 'as_fn_append () + { + eval $1+=\$2 + }' +else + as_fn_append () + { + eval $1=\$$1\$2 + } +fi # as_fn_append + +# as_fn_arith ARG... +# ------------------ +# Perform arithmetic evaluation on the ARGs, and store the result in the +# global $as_val. Take advantage of shells that can avoid forks. The arguments +# must be portable across $(()) and expr. +if (eval "test \$(( 1 + 1 )) = 2") 2>/dev/null; then : + eval 'as_fn_arith () + { + as_val=$(( $* )) + }' +else + as_fn_arith () + { + as_val=`expr "$@" || test $? -eq 1` + } +fi # as_fn_arith + + +if expr a : '\(a\)' >/dev/null 2>&1 && + test "X`expr 00001 : '.*\(...\)'`" = X001; then + as_expr=expr +else + as_expr=false +fi + +if (basename -- /) >/dev/null 2>&1 && test "X`basename -- / 2>&1`" = "X/"; then + as_basename=basename +else + as_basename=false +fi + +if (as_dir=`dirname -- /` && test "X$as_dir" = X/) >/dev/null 2>&1; then + as_dirname=dirname +else + as_dirname=false +fi + +as_me=`$as_basename -- "$0" || +$as_expr X/"$0" : '.*/\([^/][^/]*\)/*$' \| \ + X"$0" : 'X\(//\)$' \| \ + X"$0" : 'X\(/\)' \| . 2>/dev/null || +$as_echo X/"$0" | + sed '/^.*\/\([^/][^/]*\)\/*$/{ + s//\1/ + q + } + /^X\/\(\/\/\)$/{ + s//\1/ + q + } + /^X\/\(\/\).*/{ + s//\1/ + q + } + s/.*/./; q'` + +# Avoid depending upon Character Ranges. +as_cr_letters='abcdefghijklmnopqrstuvwxyz' +as_cr_LETTERS='ABCDEFGHIJKLMNOPQRSTUVWXYZ' +as_cr_Letters=$as_cr_letters$as_cr_LETTERS +as_cr_digits='0123456789' +as_cr_alnum=$as_cr_Letters$as_cr_digits + +ECHO_C= ECHO_N= ECHO_T= +case `echo -n x` in #((((( +-n*) + case `echo 'xy\c'` in + *c*) ECHO_T=' ';; # ECHO_T is single tab character. + xy) ECHO_C='\c';; + *) echo `echo ksh88 bug on AIX 6.1` > /dev/null + ECHO_T=' ';; + esac;; +*) + ECHO_N='-n';; +esac + +rm -f conf$$ conf$$.exe conf$$.file +if test -d conf$$.dir; then + rm -f conf$$.dir/conf$$.file +else + rm -f conf$$.dir + mkdir conf$$.dir 2>/dev/null +fi +if (echo >conf$$.file) 2>/dev/null; then + if ln -s conf$$.file conf$$ 2>/dev/null; then + as_ln_s='ln -s' + # ... but there are two gotchas: + # 1) On MSYS, both `ln -s file dir' and `ln file dir' fail. + # 2) DJGPP < 2.04 has no symlinks; `ln -s' creates a wrapper executable. + # In both cases, we have to default to `cp -pR'. + ln -s conf$$.file conf$$.dir 2>/dev/null && test ! -f conf$$.exe || + as_ln_s='cp -pR' + elif ln conf$$.file conf$$ 2>/dev/null; then + as_ln_s=ln + else + as_ln_s='cp -pR' + fi +else + as_ln_s='cp -pR' +fi +rm -f conf$$ conf$$.exe conf$$.dir/conf$$.file conf$$.file +rmdir conf$$.dir 2>/dev/null + + +# as_fn_mkdir_p +# ------------- +# Create "$as_dir" as a directory, including parents if necessary. +as_fn_mkdir_p () +{ + + case $as_dir in #( + -*) as_dir=./$as_dir;; + esac + test -d "$as_dir" || eval $as_mkdir_p || { + as_dirs= + while :; do + case $as_dir in #( + *\'*) as_qdir=`$as_echo "$as_dir" | sed "s/'/'\\\\\\\\''/g"`;; #'( + *) as_qdir=$as_dir;; + esac + as_dirs="'$as_qdir' $as_dirs" + as_dir=`$as_dirname -- "$as_dir" || +$as_expr X"$as_dir" : 'X\(.*[^/]\)//*[^/][^/]*/*$' \| \ + X"$as_dir" : 'X\(//\)[^/]' \| \ + X"$as_dir" : 'X\(//\)$' \| \ + X"$as_dir" : 'X\(/\)' \| . 2>/dev/null || +$as_echo X"$as_dir" | + sed '/^X\(.*[^/]\)\/\/*[^/][^/]*\/*$/{ + s//\1/ + q + } + /^X\(\/\/\)[^/].*/{ + s//\1/ + q + } + /^X\(\/\/\)$/{ + s//\1/ + q + } + /^X\(\/\).*/{ + s//\1/ + q + } + s/.*/./; q'` + test -d "$as_dir" && break + done + test -z "$as_dirs" || eval "mkdir $as_dirs" + } || test -d "$as_dir" || as_fn_error $? "cannot create directory $as_dir" + + +} # as_fn_mkdir_p +if mkdir -p . 2>/dev/null; then + as_mkdir_p='mkdir -p "$as_dir"' +else + test -d ./-p && rmdir ./-p + as_mkdir_p=false +fi + + +# as_fn_executable_p FILE +# ----------------------- +# Test if FILE is an executable regular file. +as_fn_executable_p () +{ + test -f "$1" && test -x "$1" +} # as_fn_executable_p +as_test_x='test -x' +as_executable_p=as_fn_executable_p + +# Sed expression to map a string onto a valid CPP name. +as_tr_cpp="eval sed 'y%*$as_cr_letters%P$as_cr_LETTERS%;s%[^_$as_cr_alnum]%_%g'" + +# Sed expression to map a string onto a valid variable name. +as_tr_sh="eval sed 'y%*+%pp%;s%[^_$as_cr_alnum]%_%g'" + + +exec 6>&1 +## ----------------------------------- ## +## Main body of $CONFIG_STATUS script. ## +## ----------------------------------- ## +_ASEOF +test $as_write_fail = 0 && chmod +x $CONFIG_STATUS || ac_write_fail=1 + +cat >>$CONFIG_STATUS <<\_ACEOF || ac_write_fail=1 +# Save the log message, to keep $0 and so on meaningful, and to +# report actual input values of CONFIG_FILES etc. instead of their +# values after options handling. +ac_log=" +This file was extended by dvipng (TeX Live) $as_me 1.17, which was +generated by GNU Autoconf 2.69. Invocation command line was + + CONFIG_FILES = $CONFIG_FILES + CONFIG_HEADERS = $CONFIG_HEADERS + CONFIG_LINKS = $CONFIG_LINKS + CONFIG_COMMANDS = $CONFIG_COMMANDS + $ $0 $@ + +on `(hostname || uname -n) 2>/dev/null | sed 1q` +" + +_ACEOF + +case $ac_config_files in *" +"*) set x $ac_config_files; shift; ac_config_files=$*;; +esac + +case $ac_config_headers in *" +"*) set x $ac_config_headers; shift; ac_config_headers=$*;; +esac + + +cat >>$CONFIG_STATUS <<_ACEOF || ac_write_fail=1 +# Files that config.status was made for. +config_files="$ac_config_files" +config_headers="$ac_config_headers" +config_links="$ac_config_links" +config_commands="$ac_config_commands" + +_ACEOF + +cat >>$CONFIG_STATUS <<\_ACEOF || ac_write_fail=1 +ac_cs_usage="\ +\`$as_me' instantiates files and other configuration actions +from templates according to the current configuration. Unless the files +and actions are specified as TAGs, all are instantiated by default. + +Usage: $0 [OPTION]... [TAG]... + + -h, --help print this help, then exit + -V, --version print version number and configuration settings, then exit + --config print configuration, then exit + -q, --quiet, --silent + do not print progress messages + -d, --debug don't remove temporary files + --recheck update $as_me by reconfiguring in the same conditions + --file=FILE[:TEMPLATE] + instantiate the configuration file FILE + --header=FILE[:TEMPLATE] + instantiate the configuration header FILE + +Configuration files: +$config_files + +Configuration headers: +$config_headers + +Configuration links: +$config_links + +Configuration commands: +$config_commands + +Report bugs to <tex-k@tug.org>." + +_ACEOF +cat >>$CONFIG_STATUS <<_ACEOF || ac_write_fail=1 +ac_cs_config="`$as_echo "$ac_configure_args" | sed 's/^ //; s/[\\""\`\$]/\\\\&/g'`" +ac_cs_version="\\ +dvipng (TeX Live) config.status 1.17 +configured by $0, generated by GNU Autoconf 2.69, + with options \\"\$ac_cs_config\\" + +Copyright (C) 2012 Free Software Foundation, Inc. +This config.status script is free software; the Free Software Foundation +gives unlimited permission to copy, distribute and modify it." + +ac_pwd='$ac_pwd' +srcdir='$srcdir' +INSTALL='$INSTALL' +MKDIR_P='$MKDIR_P' +AWK='$AWK' +test -n "\$AWK" || AWK=awk +_ACEOF + +cat >>$CONFIG_STATUS <<\_ACEOF || ac_write_fail=1 +# The default lists apply if the user does not specify any file. +ac_need_defaults=: +while test $# != 0 +do + case $1 in + --*=?*) + ac_option=`expr "X$1" : 'X\([^=]*\)='` + ac_optarg=`expr "X$1" : 'X[^=]*=\(.*\)'` + ac_shift=: + ;; + --*=) + ac_option=`expr "X$1" : 'X\([^=]*\)='` + ac_optarg= + ac_shift=: + ;; + *) + ac_option=$1 + ac_optarg=$2 + ac_shift=shift + ;; + esac + + case $ac_option in + # Handling of the options. + -recheck | --recheck | --rechec | --reche | --rech | --rec | --re | --r) + ac_cs_recheck=: ;; + --version | --versio | --versi | --vers | --ver | --ve | --v | -V ) + $as_echo "$ac_cs_version"; exit ;; + --config | --confi | --conf | --con | --co | --c ) + $as_echo "$ac_cs_config"; exit ;; + --debug | --debu | --deb | --de | --d | -d ) + debug=: ;; + --file | --fil | --fi | --f ) + $ac_shift + case $ac_optarg in + *\'*) ac_optarg=`$as_echo "$ac_optarg" | sed "s/'/'\\\\\\\\''/g"` ;; + '') as_fn_error $? "missing file argument" ;; + esac + as_fn_append CONFIG_FILES " '$ac_optarg'" + ac_need_defaults=false;; + --header | --heade | --head | --hea ) + $ac_shift + case $ac_optarg in + *\'*) ac_optarg=`$as_echo "$ac_optarg" | sed "s/'/'\\\\\\\\''/g"` ;; + esac + as_fn_append CONFIG_HEADERS " '$ac_optarg'" + ac_need_defaults=false;; + --he | --h) + # Conflict between --help and --header + as_fn_error $? "ambiguous option: \`$1' +Try \`$0 --help' for more information.";; + --help | --hel | -h ) + $as_echo "$ac_cs_usage"; exit ;; + -q | -quiet | --quiet | --quie | --qui | --qu | --q \ + | -silent | --silent | --silen | --sile | --sil | --si | --s) + ac_cs_silent=: ;; + + # This is an error. + -*) as_fn_error $? "unrecognized option: \`$1' +Try \`$0 --help' for more information." ;; + + *) as_fn_append ac_config_targets " $1" + ac_need_defaults=false ;; + + esac + shift +done + +ac_configure_extra_args= + +if $ac_cs_silent; then + exec 6>/dev/null + ac_configure_extra_args="$ac_configure_extra_args --silent" +fi + +_ACEOF +cat >>$CONFIG_STATUS <<_ACEOF || ac_write_fail=1 +if \$ac_cs_recheck; then + set X $SHELL '$0' $ac_configure_args \$ac_configure_extra_args --no-create --no-recursion + shift + \$as_echo "running CONFIG_SHELL=$SHELL \$*" >&6 + CONFIG_SHELL='$SHELL' + export CONFIG_SHELL + exec "\$@" +fi + +_ACEOF +cat >>$CONFIG_STATUS <<\_ACEOF || ac_write_fail=1 +exec 5>>config.log +{ + echo + sed 'h;s/./-/g;s/^.../## /;s/...$/ ##/;p;x;p;x' <<_ASBOX +## Running $as_me. ## +_ASBOX + $as_echo "$ac_log" +} >&5 + +_ACEOF +cat >>$CONFIG_STATUS <<_ACEOF || ac_write_fail=1 +# +# INIT-COMMANDS +# +AMDEP_TRUE="$AMDEP_TRUE" MAKE="${MAKE-make}" + + +# The HP-UX ksh and POSIX shell print the target directory to stdout +# if CDPATH is set. +(unset CDPATH) >/dev/null 2>&1 && unset CDPATH + +sed_quote_subst='$sed_quote_subst' +double_quote_subst='$double_quote_subst' +delay_variable_subst='$delay_variable_subst' +macro_version='`$ECHO "$macro_version" | $SED "$delay_single_quote_subst"`' +macro_revision='`$ECHO "$macro_revision" | $SED "$delay_single_quote_subst"`' +AS='`$ECHO "$AS" | $SED "$delay_single_quote_subst"`' +DLLTOOL='`$ECHO "$DLLTOOL" | $SED "$delay_single_quote_subst"`' +OBJDUMP='`$ECHO "$OBJDUMP" | $SED "$delay_single_quote_subst"`' +enable_shared='`$ECHO "$enable_shared" | $SED "$delay_single_quote_subst"`' +enable_static='`$ECHO "$enable_static" | $SED "$delay_single_quote_subst"`' +pic_mode='`$ECHO "$pic_mode" | $SED "$delay_single_quote_subst"`' +enable_fast_install='`$ECHO "$enable_fast_install" | $SED "$delay_single_quote_subst"`' +shared_archive_member_spec='`$ECHO "$shared_archive_member_spec" | $SED "$delay_single_quote_subst"`' +SHELL='`$ECHO "$SHELL" | $SED "$delay_single_quote_subst"`' +ECHO='`$ECHO "$ECHO" | $SED "$delay_single_quote_subst"`' +PATH_SEPARATOR='`$ECHO "$PATH_SEPARATOR" | $SED "$delay_single_quote_subst"`' +host_alias='`$ECHO "$host_alias" | $SED "$delay_single_quote_subst"`' +host='`$ECHO "$host" | $SED "$delay_single_quote_subst"`' +host_os='`$ECHO "$host_os" | $SED "$delay_single_quote_subst"`' +build_alias='`$ECHO "$build_alias" | $SED "$delay_single_quote_subst"`' +build='`$ECHO "$build" | $SED "$delay_single_quote_subst"`' +build_os='`$ECHO "$build_os" | $SED "$delay_single_quote_subst"`' +SED='`$ECHO "$SED" | $SED "$delay_single_quote_subst"`' +Xsed='`$ECHO "$Xsed" | $SED "$delay_single_quote_subst"`' +GREP='`$ECHO "$GREP" | $SED "$delay_single_quote_subst"`' +EGREP='`$ECHO "$EGREP" | $SED "$delay_single_quote_subst"`' +FGREP='`$ECHO "$FGREP" | $SED "$delay_single_quote_subst"`' +LD='`$ECHO "$LD" | $SED "$delay_single_quote_subst"`' +NM='`$ECHO "$NM" | $SED "$delay_single_quote_subst"`' +LN_S='`$ECHO "$LN_S" | $SED "$delay_single_quote_subst"`' +max_cmd_len='`$ECHO "$max_cmd_len" | $SED "$delay_single_quote_subst"`' +ac_objext='`$ECHO "$ac_objext" | $SED "$delay_single_quote_subst"`' +exeext='`$ECHO "$exeext" | $SED "$delay_single_quote_subst"`' +lt_unset='`$ECHO "$lt_unset" | $SED "$delay_single_quote_subst"`' +lt_SP2NL='`$ECHO "$lt_SP2NL" | $SED "$delay_single_quote_subst"`' +lt_NL2SP='`$ECHO "$lt_NL2SP" | $SED "$delay_single_quote_subst"`' +lt_cv_to_host_file_cmd='`$ECHO "$lt_cv_to_host_file_cmd" | $SED "$delay_single_quote_subst"`' +lt_cv_to_tool_file_cmd='`$ECHO "$lt_cv_to_tool_file_cmd" | $SED "$delay_single_quote_subst"`' +reload_flag='`$ECHO "$reload_flag" | $SED "$delay_single_quote_subst"`' +reload_cmds='`$ECHO "$reload_cmds" | $SED "$delay_single_quote_subst"`' +deplibs_check_method='`$ECHO "$deplibs_check_method" | $SED "$delay_single_quote_subst"`' +file_magic_cmd='`$ECHO "$file_magic_cmd" | $SED "$delay_single_quote_subst"`' +file_magic_glob='`$ECHO "$file_magic_glob" | $SED "$delay_single_quote_subst"`' +want_nocaseglob='`$ECHO "$want_nocaseglob" | $SED "$delay_single_quote_subst"`' +sharedlib_from_linklib_cmd='`$ECHO "$sharedlib_from_linklib_cmd" | $SED "$delay_single_quote_subst"`' +AR='`$ECHO "$AR" | $SED "$delay_single_quote_subst"`' +AR_FLAGS='`$ECHO "$AR_FLAGS" | $SED "$delay_single_quote_subst"`' +archiver_list_spec='`$ECHO "$archiver_list_spec" | $SED "$delay_single_quote_subst"`' +STRIP='`$ECHO "$STRIP" | $SED "$delay_single_quote_subst"`' +RANLIB='`$ECHO "$RANLIB" | $SED "$delay_single_quote_subst"`' +old_postinstall_cmds='`$ECHO "$old_postinstall_cmds" | $SED "$delay_single_quote_subst"`' +old_postuninstall_cmds='`$ECHO "$old_postuninstall_cmds" | $SED "$delay_single_quote_subst"`' +old_archive_cmds='`$ECHO "$old_archive_cmds" | $SED "$delay_single_quote_subst"`' +lock_old_archive_extraction='`$ECHO "$lock_old_archive_extraction" | $SED "$delay_single_quote_subst"`' +CC='`$ECHO "$CC" | $SED "$delay_single_quote_subst"`' +CFLAGS='`$ECHO "$CFLAGS" | $SED "$delay_single_quote_subst"`' +compiler='`$ECHO "$compiler" | $SED "$delay_single_quote_subst"`' +GCC='`$ECHO "$GCC" | $SED "$delay_single_quote_subst"`' +lt_cv_sys_global_symbol_pipe='`$ECHO "$lt_cv_sys_global_symbol_pipe" | $SED "$delay_single_quote_subst"`' +lt_cv_sys_global_symbol_to_cdecl='`$ECHO "$lt_cv_sys_global_symbol_to_cdecl" | $SED "$delay_single_quote_subst"`' +lt_cv_sys_global_symbol_to_import='`$ECHO "$lt_cv_sys_global_symbol_to_import" | $SED "$delay_single_quote_subst"`' +lt_cv_sys_global_symbol_to_c_name_address='`$ECHO "$lt_cv_sys_global_symbol_to_c_name_address" | $SED "$delay_single_quote_subst"`' +lt_cv_sys_global_symbol_to_c_name_address_lib_prefix='`$ECHO "$lt_cv_sys_global_symbol_to_c_name_address_lib_prefix" | $SED "$delay_single_quote_subst"`' +lt_cv_nm_interface='`$ECHO "$lt_cv_nm_interface" | $SED "$delay_single_quote_subst"`' +nm_file_list_spec='`$ECHO "$nm_file_list_spec" | $SED "$delay_single_quote_subst"`' +lt_sysroot='`$ECHO "$lt_sysroot" | $SED "$delay_single_quote_subst"`' +lt_cv_truncate_bin='`$ECHO "$lt_cv_truncate_bin" | $SED "$delay_single_quote_subst"`' +objdir='`$ECHO "$objdir" | $SED "$delay_single_quote_subst"`' +MAGIC_CMD='`$ECHO "$MAGIC_CMD" | $SED "$delay_single_quote_subst"`' +lt_prog_compiler_no_builtin_flag='`$ECHO "$lt_prog_compiler_no_builtin_flag" | $SED "$delay_single_quote_subst"`' +lt_prog_compiler_pic='`$ECHO "$lt_prog_compiler_pic" | $SED "$delay_single_quote_subst"`' +lt_prog_compiler_wl='`$ECHO "$lt_prog_compiler_wl" | $SED "$delay_single_quote_subst"`' +lt_prog_compiler_static='`$ECHO "$lt_prog_compiler_static" | $SED "$delay_single_quote_subst"`' +lt_cv_prog_compiler_c_o='`$ECHO "$lt_cv_prog_compiler_c_o" | $SED "$delay_single_quote_subst"`' +need_locks='`$ECHO "$need_locks" | $SED "$delay_single_quote_subst"`' +MANIFEST_TOOL='`$ECHO "$MANIFEST_TOOL" | $SED "$delay_single_quote_subst"`' +DSYMUTIL='`$ECHO "$DSYMUTIL" | $SED "$delay_single_quote_subst"`' +NMEDIT='`$ECHO "$NMEDIT" | $SED "$delay_single_quote_subst"`' +LIPO='`$ECHO "$LIPO" | $SED "$delay_single_quote_subst"`' +OTOOL='`$ECHO "$OTOOL" | $SED "$delay_single_quote_subst"`' +OTOOL64='`$ECHO "$OTOOL64" | $SED "$delay_single_quote_subst"`' +libext='`$ECHO "$libext" | $SED "$delay_single_quote_subst"`' +shrext_cmds='`$ECHO "$shrext_cmds" | $SED "$delay_single_quote_subst"`' +extract_expsyms_cmds='`$ECHO "$extract_expsyms_cmds" | $SED "$delay_single_quote_subst"`' +archive_cmds_need_lc='`$ECHO "$archive_cmds_need_lc" | $SED "$delay_single_quote_subst"`' +enable_shared_with_static_runtimes='`$ECHO "$enable_shared_with_static_runtimes" | $SED "$delay_single_quote_subst"`' +export_dynamic_flag_spec='`$ECHO "$export_dynamic_flag_spec" | $SED "$delay_single_quote_subst"`' +whole_archive_flag_spec='`$ECHO "$whole_archive_flag_spec" | $SED "$delay_single_quote_subst"`' +compiler_needs_object='`$ECHO "$compiler_needs_object" | $SED "$delay_single_quote_subst"`' +old_archive_from_new_cmds='`$ECHO "$old_archive_from_new_cmds" | $SED "$delay_single_quote_subst"`' +old_archive_from_expsyms_cmds='`$ECHO "$old_archive_from_expsyms_cmds" | $SED "$delay_single_quote_subst"`' +archive_cmds='`$ECHO "$archive_cmds" | $SED "$delay_single_quote_subst"`' +archive_expsym_cmds='`$ECHO "$archive_expsym_cmds" | $SED "$delay_single_quote_subst"`' +module_cmds='`$ECHO "$module_cmds" | $SED "$delay_single_quote_subst"`' +module_expsym_cmds='`$ECHO "$module_expsym_cmds" | $SED "$delay_single_quote_subst"`' +with_gnu_ld='`$ECHO "$with_gnu_ld" | $SED "$delay_single_quote_subst"`' +allow_undefined_flag='`$ECHO "$allow_undefined_flag" | $SED "$delay_single_quote_subst"`' +no_undefined_flag='`$ECHO "$no_undefined_flag" | $SED "$delay_single_quote_subst"`' +hardcode_libdir_flag_spec='`$ECHO "$hardcode_libdir_flag_spec" | $SED "$delay_single_quote_subst"`' +hardcode_libdir_separator='`$ECHO "$hardcode_libdir_separator" | $SED "$delay_single_quote_subst"`' +hardcode_direct='`$ECHO "$hardcode_direct" | $SED "$delay_single_quote_subst"`' +hardcode_direct_absolute='`$ECHO "$hardcode_direct_absolute" | $SED "$delay_single_quote_subst"`' +hardcode_minus_L='`$ECHO "$hardcode_minus_L" | $SED "$delay_single_quote_subst"`' +hardcode_shlibpath_var='`$ECHO "$hardcode_shlibpath_var" | $SED "$delay_single_quote_subst"`' +hardcode_automatic='`$ECHO "$hardcode_automatic" | $SED "$delay_single_quote_subst"`' +inherit_rpath='`$ECHO "$inherit_rpath" | $SED "$delay_single_quote_subst"`' +link_all_deplibs='`$ECHO "$link_all_deplibs" | $SED "$delay_single_quote_subst"`' +always_export_symbols='`$ECHO "$always_export_symbols" | $SED "$delay_single_quote_subst"`' +export_symbols_cmds='`$ECHO "$export_symbols_cmds" | $SED "$delay_single_quote_subst"`' +exclude_expsyms='`$ECHO "$exclude_expsyms" | $SED "$delay_single_quote_subst"`' +include_expsyms='`$ECHO "$include_expsyms" | $SED "$delay_single_quote_subst"`' +prelink_cmds='`$ECHO "$prelink_cmds" | $SED "$delay_single_quote_subst"`' +postlink_cmds='`$ECHO "$postlink_cmds" | $SED "$delay_single_quote_subst"`' +file_list_spec='`$ECHO "$file_list_spec" | $SED "$delay_single_quote_subst"`' +variables_saved_for_relink='`$ECHO "$variables_saved_for_relink" | $SED "$delay_single_quote_subst"`' +need_lib_prefix='`$ECHO "$need_lib_prefix" | $SED "$delay_single_quote_subst"`' +need_version='`$ECHO "$need_version" | $SED "$delay_single_quote_subst"`' +version_type='`$ECHO "$version_type" | $SED "$delay_single_quote_subst"`' +runpath_var='`$ECHO "$runpath_var" | $SED "$delay_single_quote_subst"`' +shlibpath_var='`$ECHO "$shlibpath_var" | $SED "$delay_single_quote_subst"`' +shlibpath_overrides_runpath='`$ECHO "$shlibpath_overrides_runpath" | $SED "$delay_single_quote_subst"`' +libname_spec='`$ECHO "$libname_spec" | $SED "$delay_single_quote_subst"`' +library_names_spec='`$ECHO "$library_names_spec" | $SED "$delay_single_quote_subst"`' +soname_spec='`$ECHO "$soname_spec" | $SED "$delay_single_quote_subst"`' +install_override_mode='`$ECHO "$install_override_mode" | $SED "$delay_single_quote_subst"`' +postinstall_cmds='`$ECHO "$postinstall_cmds" | $SED "$delay_single_quote_subst"`' +postuninstall_cmds='`$ECHO "$postuninstall_cmds" | $SED "$delay_single_quote_subst"`' +finish_cmds='`$ECHO "$finish_cmds" | $SED "$delay_single_quote_subst"`' +finish_eval='`$ECHO "$finish_eval" | $SED "$delay_single_quote_subst"`' +hardcode_into_libs='`$ECHO "$hardcode_into_libs" | $SED "$delay_single_quote_subst"`' +sys_lib_search_path_spec='`$ECHO "$sys_lib_search_path_spec" | $SED "$delay_single_quote_subst"`' +configure_time_dlsearch_path='`$ECHO "$configure_time_dlsearch_path" | $SED "$delay_single_quote_subst"`' +configure_time_lt_sys_library_path='`$ECHO "$configure_time_lt_sys_library_path" | $SED "$delay_single_quote_subst"`' +hardcode_action='`$ECHO "$hardcode_action" | $SED "$delay_single_quote_subst"`' +enable_dlopen='`$ECHO "$enable_dlopen" | $SED "$delay_single_quote_subst"`' +enable_dlopen_self='`$ECHO "$enable_dlopen_self" | $SED "$delay_single_quote_subst"`' +enable_dlopen_self_static='`$ECHO "$enable_dlopen_self_static" | $SED "$delay_single_quote_subst"`' +old_striplib='`$ECHO "$old_striplib" | $SED "$delay_single_quote_subst"`' +striplib='`$ECHO "$striplib" | $SED "$delay_single_quote_subst"`' + +LTCC='$LTCC' +LTCFLAGS='$LTCFLAGS' +compiler='$compiler_DEFAULT' + +# A function that is used when there is no print builtin or printf. +func_fallback_echo () +{ + eval 'cat <<_LTECHO_EOF +\$1 +_LTECHO_EOF' +} + +# Quote evaled strings. +for var in AS \ +DLLTOOL \ +OBJDUMP \ +SHELL \ +ECHO \ +PATH_SEPARATOR \ +SED \ +GREP \ +EGREP \ +FGREP \ +LD \ +NM \ +LN_S \ +lt_SP2NL \ +lt_NL2SP \ +reload_flag \ +deplibs_check_method \ +file_magic_cmd \ +file_magic_glob \ +want_nocaseglob \ +sharedlib_from_linklib_cmd \ +AR \ +AR_FLAGS \ +archiver_list_spec \ +STRIP \ +RANLIB \ +CC \ +CFLAGS \ +compiler \ +lt_cv_sys_global_symbol_pipe \ +lt_cv_sys_global_symbol_to_cdecl \ +lt_cv_sys_global_symbol_to_import \ +lt_cv_sys_global_symbol_to_c_name_address \ +lt_cv_sys_global_symbol_to_c_name_address_lib_prefix \ +lt_cv_nm_interface \ +nm_file_list_spec \ +lt_cv_truncate_bin \ +lt_prog_compiler_no_builtin_flag \ +lt_prog_compiler_pic \ +lt_prog_compiler_wl \ +lt_prog_compiler_static \ +lt_cv_prog_compiler_c_o \ +need_locks \ +MANIFEST_TOOL \ +DSYMUTIL \ +NMEDIT \ +LIPO \ +OTOOL \ +OTOOL64 \ +shrext_cmds \ +export_dynamic_flag_spec \ +whole_archive_flag_spec \ +compiler_needs_object \ +with_gnu_ld \ +allow_undefined_flag \ +no_undefined_flag \ +hardcode_libdir_flag_spec \ +hardcode_libdir_separator \ +exclude_expsyms \ +include_expsyms \ +file_list_spec \ +variables_saved_for_relink \ +libname_spec \ +library_names_spec \ +soname_spec \ +install_override_mode \ +finish_eval \ +old_striplib \ +striplib; do + case \`eval \\\\\$ECHO \\\\""\\\\\$\$var"\\\\"\` in + *[\\\\\\\`\\"\\\$]*) + eval "lt_\$var=\\\\\\"\\\`\\\$ECHO \\"\\\$\$var\\" | \\\$SED \\"\\\$sed_quote_subst\\"\\\`\\\\\\"" ## exclude from sc_prohibit_nested_quotes + ;; + *) + eval "lt_\$var=\\\\\\"\\\$\$var\\\\\\"" + ;; + esac +done + +# Double-quote double-evaled strings. +for var in reload_cmds \ +old_postinstall_cmds \ +old_postuninstall_cmds \ +old_archive_cmds \ +extract_expsyms_cmds \ +old_archive_from_new_cmds \ +old_archive_from_expsyms_cmds \ +archive_cmds \ +archive_expsym_cmds \ +module_cmds \ +module_expsym_cmds \ +export_symbols_cmds \ +prelink_cmds \ +postlink_cmds \ +postinstall_cmds \ +postuninstall_cmds \ +finish_cmds \ +sys_lib_search_path_spec \ +configure_time_dlsearch_path \ +configure_time_lt_sys_library_path; do + case \`eval \\\\\$ECHO \\\\""\\\\\$\$var"\\\\"\` in + *[\\\\\\\`\\"\\\$]*) + eval "lt_\$var=\\\\\\"\\\`\\\$ECHO \\"\\\$\$var\\" | \\\$SED -e \\"\\\$double_quote_subst\\" -e \\"\\\$sed_quote_subst\\" -e \\"\\\$delay_variable_subst\\"\\\`\\\\\\"" ## exclude from sc_prohibit_nested_quotes + ;; + *) + eval "lt_\$var=\\\\\\"\\\$\$var\\\\\\"" + ;; + esac +done + +ac_aux_dir='$ac_aux_dir' + +# See if we are running on zsh, and set the options that allow our +# commands through without removal of \ escapes INIT. +if test -n "\${ZSH_VERSION+set}"; then + setopt NO_GLOB_SUBST +fi + + + PACKAGE='$PACKAGE' + VERSION='$VERSION' + RM='$RM' + ofile='$ofile' + +ac_aux_dir='$ac_aux_dir' + + + +_ACEOF + +cat >>$CONFIG_STATUS <<\_ACEOF || ac_write_fail=1 + +# Handling of arguments. +for ac_config_target in $ac_config_targets +do + case $ac_config_target in + "depfiles") CONFIG_COMMANDS="$CONFIG_COMMANDS depfiles" ;; + "libtool") CONFIG_COMMANDS="$CONFIG_COMMANDS libtool" ;; + "config.h") CONFIG_HEADERS="$CONFIG_HEADERS config.h" ;; + "callexe.c") CONFIG_LINKS="$CONFIG_LINKS callexe.c:../texlive/w32_wrapper/callexe.c" ;; + "Makefile") CONFIG_FILES="$CONFIG_FILES Makefile" ;; + "help/Makefile") CONFIG_FILES="$CONFIG_FILES help/Makefile" ;; + "doc/Makefile") CONFIG_FILES="$CONFIG_FILES doc/Makefile" ;; + + *) as_fn_error $? "invalid argument: \`$ac_config_target'" "$LINENO" 5;; + esac +done + + +# If the user did not use the arguments to specify the items to instantiate, +# then the envvar interface is used. Set only those that are not. +# We use the long form for the default assignment because of an extremely +# bizarre bug on SunOS 4.1.3. +if $ac_need_defaults; then + test "${CONFIG_FILES+set}" = set || CONFIG_FILES=$config_files + test "${CONFIG_HEADERS+set}" = set || CONFIG_HEADERS=$config_headers + test "${CONFIG_LINKS+set}" = set || CONFIG_LINKS=$config_links + test "${CONFIG_COMMANDS+set}" = set || CONFIG_COMMANDS=$config_commands +fi + +# Have a temporary directory for convenience. Make it in the build tree +# simply because there is no reason against having it here, and in addition, +# creating and moving files from /tmp can sometimes cause problems. +# Hook for its removal unless debugging. +# Note that there is a small window in which the directory will not be cleaned: +# after its creation but before its name has been assigned to `$tmp'. +$debug || +{ + tmp= ac_tmp= + trap 'exit_status=$? + : "${ac_tmp:=$tmp}" + { test ! -d "$ac_tmp" || rm -fr "$ac_tmp"; } && exit $exit_status +' 0 + trap 'as_fn_exit 1' 1 2 13 15 +} +# Create a (secure) tmp directory for tmp files. + +{ + tmp=`(umask 077 && mktemp -d "./confXXXXXX") 2>/dev/null` && + test -d "$tmp" +} || +{ + tmp=./conf$$-$RANDOM + (umask 077 && mkdir "$tmp") +} || as_fn_error $? "cannot create a temporary directory in ." "$LINENO" 5 +ac_tmp=$tmp + +# Set up the scripts for CONFIG_FILES section. +# No need to generate them if there are no CONFIG_FILES. +# This happens for instance with `./config.status config.h'. +if test -n "$CONFIG_FILES"; then + + +ac_cr=`echo X | tr X '\015'` +# On cygwin, bash can eat \r inside `` if the user requested igncr. +# But we know of no other shell where ac_cr would be empty at this +# point, so we can use a bashism as a fallback. +if test "x$ac_cr" = x; then + eval ac_cr=\$\'\\r\' +fi +ac_cs_awk_cr=`$AWK 'BEGIN { print "a\rb" }' </dev/null 2>/dev/null` +if test "$ac_cs_awk_cr" = "a${ac_cr}b"; then + ac_cs_awk_cr='\\r' +else + ac_cs_awk_cr=$ac_cr +fi + +echo 'BEGIN {' >"$ac_tmp/subs1.awk" && +_ACEOF + + +{ + echo "cat >conf$$subs.awk <<_ACEOF" && + echo "$ac_subst_vars" | sed 's/.*/&!$&$ac_delim/' && + echo "_ACEOF" +} >conf$$subs.sh || + as_fn_error $? "could not make $CONFIG_STATUS" "$LINENO" 5 +ac_delim_num=`echo "$ac_subst_vars" | grep -c '^'` +ac_delim='%!_!# ' +for ac_last_try in false false false false false :; do + . ./conf$$subs.sh || + as_fn_error $? "could not make $CONFIG_STATUS" "$LINENO" 5 + + ac_delim_n=`sed -n "s/.*$ac_delim\$/X/p" conf$$subs.awk | grep -c X` + if test $ac_delim_n = $ac_delim_num; then + break + elif $ac_last_try; then + as_fn_error $? "could not make $CONFIG_STATUS" "$LINENO" 5 + else + ac_delim="$ac_delim!$ac_delim _$ac_delim!! " + fi +done +rm -f conf$$subs.sh + +cat >>$CONFIG_STATUS <<_ACEOF || ac_write_fail=1 +cat >>"\$ac_tmp/subs1.awk" <<\\_ACAWK && +_ACEOF +sed -n ' +h +s/^/S["/; s/!.*/"]=/ +p +g +s/^[^!]*!// +:repl +t repl +s/'"$ac_delim"'$// +t delim +:nl +h +s/\(.\{148\}\)..*/\1/ +t more1 +s/["\\]/\\&/g; s/^/"/; s/$/\\n"\\/ +p +n +b repl +:more1 +s/["\\]/\\&/g; s/^/"/; s/$/"\\/ +p +g +s/.\{148\}// +t nl +:delim +h +s/\(.\{148\}\)..*/\1/ +t more2 +s/["\\]/\\&/g; s/^/"/; s/$/"/ +p +b +:more2 +s/["\\]/\\&/g; s/^/"/; s/$/"\\/ +p +g +s/.\{148\}// +t delim +' <conf$$subs.awk | sed ' +/^[^""]/{ + N + s/\n// +} +' >>$CONFIG_STATUS || ac_write_fail=1 +rm -f conf$$subs.awk +cat >>$CONFIG_STATUS <<_ACEOF || ac_write_fail=1 +_ACAWK +cat >>"\$ac_tmp/subs1.awk" <<_ACAWK && + for (key in S) S_is_set[key] = 1 + FS = "" + +} +{ + line = $ 0 + nfields = split(line, field, "@") + substed = 0 + len = length(field[1]) + for (i = 2; i < nfields; i++) { + key = field[i] + keylen = length(key) + if (S_is_set[key]) { + value = S[key] + line = substr(line, 1, len) "" value "" substr(line, len + keylen + 3) + len += length(value) + length(field[++i]) + substed = 1 + } else + len += 1 + keylen + } + + print line +} + +_ACAWK +_ACEOF +cat >>$CONFIG_STATUS <<\_ACEOF || ac_write_fail=1 +if sed "s/$ac_cr//" < /dev/null > /dev/null 2>&1; then + sed "s/$ac_cr\$//; s/$ac_cr/$ac_cs_awk_cr/g" +else + cat +fi < "$ac_tmp/subs1.awk" > "$ac_tmp/subs.awk" \ + || as_fn_error $? "could not setup config files machinery" "$LINENO" 5 +_ACEOF + +# VPATH may cause trouble with some makes, so we remove sole $(srcdir), +# ${srcdir} and @srcdir@ entries from VPATH if srcdir is ".", strip leading and +# trailing colons and then remove the whole line if VPATH becomes empty +# (actually we leave an empty line to preserve line numbers). +if test "x$srcdir" = x.; then + ac_vpsub='/^[ ]*VPATH[ ]*=[ ]*/{ +h +s/// +s/^/:/ +s/[ ]*$/:/ +s/:\$(srcdir):/:/g +s/:\${srcdir}:/:/g +s/:@srcdir@:/:/g +s/^:*// +s/:*$// +x +s/\(=[ ]*\).*/\1/ +G +s/\n// +s/^[^=]*=[ ]*$// +}' +fi + +cat >>$CONFIG_STATUS <<\_ACEOF || ac_write_fail=1 +fi # test -n "$CONFIG_FILES" + +# Set up the scripts for CONFIG_HEADERS section. +# No need to generate them if there are no CONFIG_HEADERS. +# This happens for instance with `./config.status Makefile'. +if test -n "$CONFIG_HEADERS"; then +cat >"$ac_tmp/defines.awk" <<\_ACAWK || +BEGIN { +_ACEOF + +# Transform confdefs.h into an awk script `defines.awk', embedded as +# here-document in config.status, that substitutes the proper values into +# config.h.in to produce config.h. + +# Create a delimiter string that does not exist in confdefs.h, to ease +# handling of long lines. +ac_delim='%!_!# ' +for ac_last_try in false false :; do + ac_tt=`sed -n "/$ac_delim/p" confdefs.h` + if test -z "$ac_tt"; then + break + elif $ac_last_try; then + as_fn_error $? "could not make $CONFIG_HEADERS" "$LINENO" 5 + else + ac_delim="$ac_delim!$ac_delim _$ac_delim!! " + fi +done + +# For the awk script, D is an array of macro values keyed by name, +# likewise P contains macro parameters if any. Preserve backslash +# newline sequences. + +ac_word_re=[_$as_cr_Letters][_$as_cr_alnum]* +sed -n ' +s/.\{148\}/&'"$ac_delim"'/g +t rset +:rset +s/^[ ]*#[ ]*define[ ][ ]*/ / +t def +d +:def +s/\\$// +t bsnl +s/["\\]/\\&/g +s/^ \('"$ac_word_re"'\)\(([^()]*)\)[ ]*\(.*\)/P["\1"]="\2"\ +D["\1"]=" \3"/p +s/^ \('"$ac_word_re"'\)[ ]*\(.*\)/D["\1"]=" \2"/p +d +:bsnl +s/["\\]/\\&/g +s/^ \('"$ac_word_re"'\)\(([^()]*)\)[ ]*\(.*\)/P["\1"]="\2"\ +D["\1"]=" \3\\\\\\n"\\/p +t cont +s/^ \('"$ac_word_re"'\)[ ]*\(.*\)/D["\1"]=" \2\\\\\\n"\\/p +t cont +d +:cont +n +s/.\{148\}/&'"$ac_delim"'/g +t clear +:clear +s/\\$// +t bsnlc +s/["\\]/\\&/g; s/^/"/; s/$/"/p +d +:bsnlc +s/["\\]/\\&/g; s/^/"/; s/$/\\\\\\n"\\/p +b cont +' <confdefs.h | sed ' +s/'"$ac_delim"'/"\\\ +"/g' >>$CONFIG_STATUS || ac_write_fail=1 + +cat >>$CONFIG_STATUS <<_ACEOF || ac_write_fail=1 + for (key in D) D_is_set[key] = 1 + FS = "" +} +/^[\t ]*#[\t ]*(define|undef)[\t ]+$ac_word_re([\t (]|\$)/ { + line = \$ 0 + split(line, arg, " ") + if (arg[1] == "#") { + defundef = arg[2] + mac1 = arg[3] + } else { + defundef = substr(arg[1], 2) + mac1 = arg[2] + } + split(mac1, mac2, "(") #) + macro = mac2[1] + prefix = substr(line, 1, index(line, defundef) - 1) + if (D_is_set[macro]) { + # Preserve the white space surrounding the "#". + print prefix "define", macro P[macro] D[macro] + next + } else { + # Replace #undef with comments. This is necessary, for example, + # in the case of _POSIX_SOURCE, which is predefined and required + # on some systems where configure will not decide to define it. + if (defundef == "undef") { + print "/*", prefix defundef, macro, "*/" + next + } + } +} +{ print } +_ACAWK +_ACEOF +cat >>$CONFIG_STATUS <<\_ACEOF || ac_write_fail=1 + as_fn_error $? "could not setup config headers machinery" "$LINENO" 5 +fi # test -n "$CONFIG_HEADERS" + + +eval set X " :F $CONFIG_FILES :H $CONFIG_HEADERS :L $CONFIG_LINKS :C $CONFIG_COMMANDS" +shift +for ac_tag +do + case $ac_tag in + :[FHLC]) ac_mode=$ac_tag; continue;; + esac + case $ac_mode$ac_tag in + :[FHL]*:*);; + :L* | :C*:*) as_fn_error $? "invalid tag \`$ac_tag'" "$LINENO" 5;; + :[FH]-) ac_tag=-:-;; + :[FH]*) ac_tag=$ac_tag:$ac_tag.in;; + esac + ac_save_IFS=$IFS + IFS=: + set x $ac_tag + IFS=$ac_save_IFS + shift + ac_file=$1 + shift + + case $ac_mode in + :L) ac_source=$1;; + :[FH]) + ac_file_inputs= + for ac_f + do + case $ac_f in + -) ac_f="$ac_tmp/stdin";; + *) # Look for the file first in the build tree, then in the source tree + # (if the path is not absolute). The absolute path cannot be DOS-style, + # because $ac_f cannot contain `:'. + test -f "$ac_f" || + case $ac_f in + [\\/$]*) false;; + *) test -f "$srcdir/$ac_f" && ac_f="$srcdir/$ac_f";; + esac || + as_fn_error 1 "cannot find input file: \`$ac_f'" "$LINENO" 5;; + esac + case $ac_f in *\'*) ac_f=`$as_echo "$ac_f" | sed "s/'/'\\\\\\\\''/g"`;; esac + as_fn_append ac_file_inputs " '$ac_f'" + done + + # Let's still pretend it is `configure' which instantiates (i.e., don't + # use $as_me), people would be surprised to read: + # /* config.h. Generated by config.status. */ + configure_input='Generated from '` + $as_echo "$*" | sed 's|^[^:]*/||;s|:[^:]*/|, |g' + `' by configure.' + if test x"$ac_file" != x-; then + configure_input="$ac_file. $configure_input" + { $as_echo "$as_me:${as_lineno-$LINENO}: creating $ac_file" >&5 +$as_echo "$as_me: creating $ac_file" >&6;} + fi + # Neutralize special characters interpreted by sed in replacement strings. + case $configure_input in #( + *\&* | *\|* | *\\* ) + ac_sed_conf_input=`$as_echo "$configure_input" | + sed 's/[\\\\&|]/\\\\&/g'`;; #( + *) ac_sed_conf_input=$configure_input;; + esac + + case $ac_tag in + *:-:* | *:-) cat >"$ac_tmp/stdin" \ + || as_fn_error $? "could not create $ac_file" "$LINENO" 5 ;; + esac + ;; + esac + + ac_dir=`$as_dirname -- "$ac_file" || +$as_expr X"$ac_file" : 'X\(.*[^/]\)//*[^/][^/]*/*$' \| \ + X"$ac_file" : 'X\(//\)[^/]' \| \ + X"$ac_file" : 'X\(//\)$' \| \ + X"$ac_file" : 'X\(/\)' \| . 2>/dev/null || +$as_echo X"$ac_file" | + sed '/^X\(.*[^/]\)\/\/*[^/][^/]*\/*$/{ + s//\1/ + q + } + /^X\(\/\/\)[^/].*/{ + s//\1/ + q + } + /^X\(\/\/\)$/{ + s//\1/ + q + } + /^X\(\/\).*/{ + s//\1/ + q + } + s/.*/./; q'` + as_dir="$ac_dir"; as_fn_mkdir_p + ac_builddir=. + +case "$ac_dir" in +.) ac_dir_suffix= ac_top_builddir_sub=. ac_top_build_prefix= ;; +*) + ac_dir_suffix=/`$as_echo "$ac_dir" | sed 's|^\.[\\/]||'` + # A ".." for each directory in $ac_dir_suffix. + ac_top_builddir_sub=`$as_echo "$ac_dir_suffix" | sed 's|/[^\\/]*|/..|g;s|/||'` + case $ac_top_builddir_sub in + "") ac_top_builddir_sub=. ac_top_build_prefix= ;; + *) ac_top_build_prefix=$ac_top_builddir_sub/ ;; + esac ;; +esac +ac_abs_top_builddir=$ac_pwd +ac_abs_builddir=$ac_pwd$ac_dir_suffix +# for backward compatibility: +ac_top_builddir=$ac_top_build_prefix + +case $srcdir in + .) # We are building in place. + ac_srcdir=. + ac_top_srcdir=$ac_top_builddir_sub + ac_abs_top_srcdir=$ac_pwd ;; + [\\/]* | ?:[\\/]* ) # Absolute name. + ac_srcdir=$srcdir$ac_dir_suffix; + ac_top_srcdir=$srcdir + ac_abs_top_srcdir=$srcdir ;; + *) # Relative name. + ac_srcdir=$ac_top_build_prefix$srcdir$ac_dir_suffix + ac_top_srcdir=$ac_top_build_prefix$srcdir + ac_abs_top_srcdir=$ac_pwd/$srcdir ;; +esac +ac_abs_srcdir=$ac_abs_top_srcdir$ac_dir_suffix + + + case $ac_mode in + :F) + # + # CONFIG_FILE + # + + case $INSTALL in + [\\/$]* | ?:[\\/]* ) ac_INSTALL=$INSTALL ;; + *) ac_INSTALL=$ac_top_build_prefix$INSTALL ;; + esac + ac_MKDIR_P=$MKDIR_P + case $MKDIR_P in + [\\/$]* | ?:[\\/]* ) ;; + */*) ac_MKDIR_P=$ac_top_build_prefix$MKDIR_P ;; + esac +_ACEOF + +cat >>$CONFIG_STATUS <<\_ACEOF || ac_write_fail=1 +# If the template does not know about datarootdir, expand it. +# FIXME: This hack should be removed a few years after 2.60. +ac_datarootdir_hack=; ac_datarootdir_seen= +ac_sed_dataroot=' +/datarootdir/ { + p + q +} +/@datadir@/p +/@docdir@/p +/@infodir@/p +/@localedir@/p +/@mandir@/p' +case `eval "sed -n \"\$ac_sed_dataroot\" $ac_file_inputs"` in +*datarootdir*) ac_datarootdir_seen=yes;; +*@datadir@*|*@docdir@*|*@infodir@*|*@localedir@*|*@mandir@*) + { $as_echo "$as_me:${as_lineno-$LINENO}: WARNING: $ac_file_inputs seems to ignore the --datarootdir setting" >&5 +$as_echo "$as_me: WARNING: $ac_file_inputs seems to ignore the --datarootdir setting" >&2;} +_ACEOF +cat >>$CONFIG_STATUS <<_ACEOF || ac_write_fail=1 + ac_datarootdir_hack=' + s&@datadir@&$datadir&g + s&@docdir@&$docdir&g + s&@infodir@&$infodir&g + s&@localedir@&$localedir&g + s&@mandir@&$mandir&g + s&\\\${datarootdir}&$datarootdir&g' ;; +esac +_ACEOF + +# Neutralize VPATH when `$srcdir' = `.'. +# Shell code in configure.ac might set extrasub. +# FIXME: do we really want to maintain this feature? +cat >>$CONFIG_STATUS <<_ACEOF || ac_write_fail=1 +ac_sed_extra="$ac_vpsub +$extrasub +_ACEOF +cat >>$CONFIG_STATUS <<\_ACEOF || ac_write_fail=1 +:t +/@[a-zA-Z_][a-zA-Z_0-9]*@/!b +s|@configure_input@|$ac_sed_conf_input|;t t +s&@top_builddir@&$ac_top_builddir_sub&;t t +s&@top_build_prefix@&$ac_top_build_prefix&;t t +s&@srcdir@&$ac_srcdir&;t t +s&@abs_srcdir@&$ac_abs_srcdir&;t t +s&@top_srcdir@&$ac_top_srcdir&;t t +s&@abs_top_srcdir@&$ac_abs_top_srcdir&;t t +s&@builddir@&$ac_builddir&;t t +s&@abs_builddir@&$ac_abs_builddir&;t t +s&@abs_top_builddir@&$ac_abs_top_builddir&;t t +s&@INSTALL@&$ac_INSTALL&;t t +s&@MKDIR_P@&$ac_MKDIR_P&;t t +$ac_datarootdir_hack +" +eval sed \"\$ac_sed_extra\" "$ac_file_inputs" | $AWK -f "$ac_tmp/subs.awk" \ + >$ac_tmp/out || as_fn_error $? "could not create $ac_file" "$LINENO" 5 + +test -z "$ac_datarootdir_hack$ac_datarootdir_seen" && + { ac_out=`sed -n '/\${datarootdir}/p' "$ac_tmp/out"`; test -n "$ac_out"; } && + { ac_out=`sed -n '/^[ ]*datarootdir[ ]*:*=/p' \ + "$ac_tmp/out"`; test -z "$ac_out"; } && + { $as_echo "$as_me:${as_lineno-$LINENO}: WARNING: $ac_file contains a reference to the variable \`datarootdir' +which seems to be undefined. Please make sure it is defined" >&5 +$as_echo "$as_me: WARNING: $ac_file contains a reference to the variable \`datarootdir' +which seems to be undefined. Please make sure it is defined" >&2;} + + rm -f "$ac_tmp/stdin" + case $ac_file in + -) cat "$ac_tmp/out" && rm -f "$ac_tmp/out";; + *) rm -f "$ac_file" && mv "$ac_tmp/out" "$ac_file";; + esac \ + || as_fn_error $? "could not create $ac_file" "$LINENO" 5 + ;; + :H) + # + # CONFIG_HEADER + # + if test x"$ac_file" != x-; then + { + $as_echo "/* $configure_input */" \ + && eval '$AWK -f "$ac_tmp/defines.awk"' "$ac_file_inputs" + } >"$ac_tmp/config.h" \ + || as_fn_error $? "could not create $ac_file" "$LINENO" 5 + if diff "$ac_file" "$ac_tmp/config.h" >/dev/null 2>&1; then + { $as_echo "$as_me:${as_lineno-$LINENO}: $ac_file is unchanged" >&5 +$as_echo "$as_me: $ac_file is unchanged" >&6;} + else + rm -f "$ac_file" + mv "$ac_tmp/config.h" "$ac_file" \ + || as_fn_error $? "could not create $ac_file" "$LINENO" 5 + fi + else + $as_echo "/* $configure_input */" \ + && eval '$AWK -f "$ac_tmp/defines.awk"' "$ac_file_inputs" \ + || as_fn_error $? "could not create -" "$LINENO" 5 + fi +# Compute "$ac_file"'s index in $config_headers. +_am_arg="$ac_file" +_am_stamp_count=1 +for _am_header in $config_headers :; do + case $_am_header in + $_am_arg | $_am_arg:* ) + break ;; + * ) + _am_stamp_count=`expr $_am_stamp_count + 1` ;; + esac +done +echo "timestamp for $_am_arg" >`$as_dirname -- "$_am_arg" || +$as_expr X"$_am_arg" : 'X\(.*[^/]\)//*[^/][^/]*/*$' \| \ + X"$_am_arg" : 'X\(//\)[^/]' \| \ + X"$_am_arg" : 'X\(//\)$' \| \ + X"$_am_arg" : 'X\(/\)' \| . 2>/dev/null || +$as_echo X"$_am_arg" | + sed '/^X\(.*[^/]\)\/\/*[^/][^/]*\/*$/{ + s//\1/ + q + } + /^X\(\/\/\)[^/].*/{ + s//\1/ + q + } + /^X\(\/\/\)$/{ + s//\1/ + q + } + /^X\(\/\).*/{ + s//\1/ + q + } + s/.*/./; q'`/stamp-h$_am_stamp_count + ;; + :L) + # + # CONFIG_LINK + # + + if test "$ac_source" = "$ac_file" && test "$srcdir" = '.'; then + : + else + # Prefer the file from the source tree if names are identical. + if test "$ac_source" = "$ac_file" || test ! -r "$ac_source"; then + ac_source=$srcdir/$ac_source + fi + + { $as_echo "$as_me:${as_lineno-$LINENO}: linking $ac_source to $ac_file" >&5 +$as_echo "$as_me: linking $ac_source to $ac_file" >&6;} + + if test ! -r "$ac_source"; then + as_fn_error $? "$ac_source: file not found" "$LINENO" 5 + fi + rm -f "$ac_file" + + # Try a relative symlink, then a hard link, then a copy. + case $ac_source in + [\\/$]* | ?:[\\/]* ) ac_rel_source=$ac_source ;; + *) ac_rel_source=$ac_top_build_prefix$ac_source ;; + esac + ln -s "$ac_rel_source" "$ac_file" 2>/dev/null || + ln "$ac_source" "$ac_file" 2>/dev/null || + cp -p "$ac_source" "$ac_file" || + as_fn_error $? "cannot link or copy $ac_source to $ac_file" "$LINENO" 5 + fi + ;; + :C) { $as_echo "$as_me:${as_lineno-$LINENO}: executing $ac_file commands" >&5 +$as_echo "$as_me: executing $ac_file commands" >&6;} + ;; + esac + + + case $ac_file$ac_mode in + "depfiles":C) test x"$AMDEP_TRUE" != x"" || { + # Older Autoconf quotes --file arguments for eval, but not when files + # are listed without --file. Let's play safe and only enable the eval + # if we detect the quoting. + # TODO: see whether this extra hack can be removed once we start + # requiring Autoconf 2.70 or later. + case $CONFIG_FILES in #( + *\'*) : + eval set x "$CONFIG_FILES" ;; #( + *) : + set x $CONFIG_FILES ;; #( + *) : + ;; +esac + shift + # Used to flag and report bootstrapping failures. + am_rc=0 + for am_mf + do + # Strip MF so we end up with the name of the file. + am_mf=`$as_echo "$am_mf" | sed -e 's/:.*$//'` + # Check whether this is an Automake generated Makefile which includes + # dependency-tracking related rules and includes. + # Grep'ing the whole file directly is not great: AIX grep has a line + # limit of 2048, but all sed's we know have understand at least 4000. + sed -n 's,^am--depfiles:.*,X,p' "$am_mf" | grep X >/dev/null 2>&1 \ + || continue + am_dirpart=`$as_dirname -- "$am_mf" || +$as_expr X"$am_mf" : 'X\(.*[^/]\)//*[^/][^/]*/*$' \| \ + X"$am_mf" : 'X\(//\)[^/]' \| \ + X"$am_mf" : 'X\(//\)$' \| \ + X"$am_mf" : 'X\(/\)' \| . 2>/dev/null || +$as_echo X"$am_mf" | + sed '/^X\(.*[^/]\)\/\/*[^/][^/]*\/*$/{ + s//\1/ + q + } + /^X\(\/\/\)[^/].*/{ + s//\1/ + q + } + /^X\(\/\/\)$/{ + s//\1/ + q + } + /^X\(\/\).*/{ + s//\1/ + q + } + s/.*/./; q'` + am_filepart=`$as_basename -- "$am_mf" || +$as_expr X/"$am_mf" : '.*/\([^/][^/]*\)/*$' \| \ + X"$am_mf" : 'X\(//\)$' \| \ + X"$am_mf" : 'X\(/\)' \| . 2>/dev/null || +$as_echo X/"$am_mf" | + sed '/^.*\/\([^/][^/]*\)\/*$/{ + s//\1/ + q + } + /^X\/\(\/\/\)$/{ + s//\1/ + q + } + /^X\/\(\/\).*/{ + s//\1/ + q + } + s/.*/./; q'` + { echo "$as_me:$LINENO: cd "$am_dirpart" \ + && sed -e '/# am--include-marker/d' "$am_filepart" \ + | $MAKE -f - am--depfiles" >&5 + (cd "$am_dirpart" \ + && sed -e '/# am--include-marker/d' "$am_filepart" \ + | $MAKE -f - am--depfiles) >&5 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } || am_rc=$? + done + if test $am_rc -ne 0; then + { { $as_echo "$as_me:${as_lineno-$LINENO}: error: in \`$ac_pwd':" >&5 +$as_echo "$as_me: error: in \`$ac_pwd':" >&2;} +as_fn_error $? "Something went wrong bootstrapping makefile fragments + for automatic dependency tracking. If GNU make was not used, consider + re-running the configure script with MAKE=\"gmake\" (or whatever is + necessary). You can also try re-running configure with the + '--disable-dependency-tracking' option to at least be able to build + the package (albeit without support for automatic dependency tracking). +See \`config.log' for more details" "$LINENO" 5; } + fi + { am_dirpart=; unset am_dirpart;} + { am_filepart=; unset am_filepart;} + { am_mf=; unset am_mf;} + { am_rc=; unset am_rc;} + rm -f conftest-deps.mk +} + ;; + "libtool":C) + + # See if we are running on zsh, and set the options that allow our + # commands through without removal of \ escapes. + if test -n "${ZSH_VERSION+set}"; then + setopt NO_GLOB_SUBST + fi + + cfgfile=${ofile}T + trap "$RM \"$cfgfile\"; exit 1" 1 2 15 + $RM "$cfgfile" + + cat <<_LT_EOF >> "$cfgfile" +#! $SHELL +# Generated automatically by $as_me ($PACKAGE) $VERSION +# Libtool was configured on host `(hostname || uname -n) 2>/dev/null | sed 1q`: +# NOTE: Changes made to this file will be lost: look at ltmain.sh. + +# Provide generalized library-building support services. +# Written by Gordon Matzigkeit, 1996 + +# Copyright (C) 2014 Free Software Foundation, Inc. +# This is free software; see the source for copying conditions. There is NO +# warranty; not even for MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. + +# GNU Libtool is free software; you can redistribute it and/or modify +# it under the terms of the GNU General Public License as published by +# the Free Software Foundation; either version 2 of of the License, or +# (at your option) any later version. +# +# As a special exception to the GNU General Public License, if you +# distribute this file as part of a program or library that is built +# using GNU Libtool, you may include this file under the same +# distribution terms that you use for the rest of that program. +# +# GNU Libtool is distributed in the hope that it will be useful, but +# WITHOUT ANY WARRANTY; without even the implied warranty of +# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +# GNU General Public License for more details. +# +# You should have received a copy of the GNU General Public License +# along with this program. If not, see <http://www.gnu.org/licenses/>. + + +# The names of the tagged configurations supported by this script. +available_tags='' + +# Configured defaults for sys_lib_dlsearch_path munging. +: \${LT_SYS_LIBRARY_PATH="$configure_time_lt_sys_library_path"} + +# ### BEGIN LIBTOOL CONFIG + +# Which release of libtool.m4 was used? +macro_version=$macro_version +macro_revision=$macro_revision + +# Assembler program. +AS=$lt_AS + +# DLL creation program. +DLLTOOL=$lt_DLLTOOL + +# Object dumper program. +OBJDUMP=$lt_OBJDUMP + +# Whether or not to build shared libraries. +build_libtool_libs=$enable_shared + +# Whether or not to build static libraries. +build_old_libs=$enable_static + +# What type of objects to build. +pic_mode=$pic_mode + +# Whether or not to optimize for fast installation. +fast_install=$enable_fast_install + +# Shared archive member basename,for filename based shared library versioning on AIX. +shared_archive_member_spec=$shared_archive_member_spec + +# Shell to use when invoking shell scripts. +SHELL=$lt_SHELL + +# An echo program that protects backslashes. +ECHO=$lt_ECHO + +# The PATH separator for the build system. +PATH_SEPARATOR=$lt_PATH_SEPARATOR + +# The host system. +host_alias=$host_alias +host=$host +host_os=$host_os + +# The build system. +build_alias=$build_alias +build=$build +build_os=$build_os + +# A sed program that does not truncate output. +SED=$lt_SED + +# Sed that helps us avoid accidentally triggering echo(1) options like -n. +Xsed="\$SED -e 1s/^X//" + +# A grep program that handles long lines. +GREP=$lt_GREP + +# An ERE matcher. +EGREP=$lt_EGREP + +# A literal string matcher. +FGREP=$lt_FGREP + +# A BSD- or MS-compatible name lister. +NM=$lt_NM + +# Whether we need soft or hard links. +LN_S=$lt_LN_S + +# What is the maximum length of a command? +max_cmd_len=$max_cmd_len + +# Object file suffix (normally "o"). +objext=$ac_objext + +# Executable file suffix (normally ""). +exeext=$exeext + +# whether the shell understands "unset". +lt_unset=$lt_unset + +# turn spaces into newlines. +SP2NL=$lt_lt_SP2NL + +# turn newlines into spaces. +NL2SP=$lt_lt_NL2SP + +# convert \$build file names to \$host format. +to_host_file_cmd=$lt_cv_to_host_file_cmd + +# convert \$build files to toolchain format. +to_tool_file_cmd=$lt_cv_to_tool_file_cmd + +# Method to check whether dependent libraries are shared objects. +deplibs_check_method=$lt_deplibs_check_method + +# Command to use when deplibs_check_method = "file_magic". +file_magic_cmd=$lt_file_magic_cmd + +# How to find potential files when deplibs_check_method = "file_magic". +file_magic_glob=$lt_file_magic_glob + +# Find potential files using nocaseglob when deplibs_check_method = "file_magic". +want_nocaseglob=$lt_want_nocaseglob + +# Command to associate shared and link libraries. +sharedlib_from_linklib_cmd=$lt_sharedlib_from_linklib_cmd + +# The archiver. +AR=$lt_AR + +# Flags to create an archive. +AR_FLAGS=$lt_AR_FLAGS + +# How to feed a file listing to the archiver. +archiver_list_spec=$lt_archiver_list_spec + +# A symbol stripping program. +STRIP=$lt_STRIP + +# Commands used to install an old-style archive. +RANLIB=$lt_RANLIB +old_postinstall_cmds=$lt_old_postinstall_cmds +old_postuninstall_cmds=$lt_old_postuninstall_cmds + +# Whether to use a lock for old archive extraction. +lock_old_archive_extraction=$lock_old_archive_extraction + +# A C compiler. +LTCC=$lt_CC + +# LTCC compiler flags. +LTCFLAGS=$lt_CFLAGS + +# Take the output of nm and produce a listing of raw symbols and C names. +global_symbol_pipe=$lt_lt_cv_sys_global_symbol_pipe + +# Transform the output of nm in a proper C declaration. +global_symbol_to_cdecl=$lt_lt_cv_sys_global_symbol_to_cdecl + +# Transform the output of nm into a list of symbols to manually relocate. +global_symbol_to_import=$lt_lt_cv_sys_global_symbol_to_import + +# Transform the output of nm in a C name address pair. +global_symbol_to_c_name_address=$lt_lt_cv_sys_global_symbol_to_c_name_address + +# Transform the output of nm in a C name address pair when lib prefix is needed. +global_symbol_to_c_name_address_lib_prefix=$lt_lt_cv_sys_global_symbol_to_c_name_address_lib_prefix + +# The name lister interface. +nm_interface=$lt_lt_cv_nm_interface + +# Specify filename containing input files for \$NM. +nm_file_list_spec=$lt_nm_file_list_spec + +# The root where to search for dependent libraries,and where our libraries should be installed. +lt_sysroot=$lt_sysroot + +# Command to truncate a binary pipe. +lt_truncate_bin=$lt_lt_cv_truncate_bin + +# The name of the directory that contains temporary libtool files. +objdir=$objdir + +# Used to examine libraries when file_magic_cmd begins with "file". +MAGIC_CMD=$MAGIC_CMD + +# Must we lock files when doing compilation? +need_locks=$lt_need_locks + +# Manifest tool. +MANIFEST_TOOL=$lt_MANIFEST_TOOL + +# Tool to manipulate archived DWARF debug symbol files on Mac OS X. +DSYMUTIL=$lt_DSYMUTIL + +# Tool to change global to local symbols on Mac OS X. +NMEDIT=$lt_NMEDIT + +# Tool to manipulate fat objects and archives on Mac OS X. +LIPO=$lt_LIPO + +# ldd/readelf like tool for Mach-O binaries on Mac OS X. +OTOOL=$lt_OTOOL + +# ldd/readelf like tool for 64 bit Mach-O binaries on Mac OS X 10.4. +OTOOL64=$lt_OTOOL64 + +# Old archive suffix (normally "a"). +libext=$libext + +# Shared library suffix (normally ".so"). +shrext_cmds=$lt_shrext_cmds + +# The commands to extract the exported symbol list from a shared archive. +extract_expsyms_cmds=$lt_extract_expsyms_cmds + +# Variables whose values should be saved in libtool wrapper scripts and +# restored at link time. +variables_saved_for_relink=$lt_variables_saved_for_relink + +# Do we need the "lib" prefix for modules? +need_lib_prefix=$need_lib_prefix + +# Do we need a version for libraries? +need_version=$need_version + +# Library versioning type. +version_type=$version_type + +# Shared library runtime path variable. +runpath_var=$runpath_var + +# Shared library path variable. +shlibpath_var=$shlibpath_var + +# Is shlibpath searched before the hard-coded library search path? +shlibpath_overrides_runpath=$shlibpath_overrides_runpath + +# Format of library name prefix. +libname_spec=$lt_libname_spec + +# List of archive names. First name is the real one, the rest are links. +# The last name is the one that the linker finds with -lNAME +library_names_spec=$lt_library_names_spec + +# The coded name of the library, if different from the real name. +soname_spec=$lt_soname_spec + +# Permission mode override for installation of shared libraries. +install_override_mode=$lt_install_override_mode + +# Command to use after installation of a shared archive. +postinstall_cmds=$lt_postinstall_cmds + +# Command to use after uninstallation of a shared archive. +postuninstall_cmds=$lt_postuninstall_cmds + +# Commands used to finish a libtool library installation in a directory. +finish_cmds=$lt_finish_cmds + +# As "finish_cmds", except a single script fragment to be evaled but +# not shown. +finish_eval=$lt_finish_eval + +# Whether we should hardcode library paths into libraries. +hardcode_into_libs=$hardcode_into_libs + +# Compile-time system search path for libraries. +sys_lib_search_path_spec=$lt_sys_lib_search_path_spec + +# Detected run-time system search path for libraries. +sys_lib_dlsearch_path_spec=$lt_configure_time_dlsearch_path + +# Explicit LT_SYS_LIBRARY_PATH set during ./configure time. +configure_time_lt_sys_library_path=$lt_configure_time_lt_sys_library_path + +# Whether dlopen is supported. +dlopen_support=$enable_dlopen + +# Whether dlopen of programs is supported. +dlopen_self=$enable_dlopen_self + +# Whether dlopen of statically linked programs is supported. +dlopen_self_static=$enable_dlopen_self_static + +# Commands to strip libraries. +old_striplib=$lt_old_striplib +striplib=$lt_striplib + + +# The linker used to build libraries. +LD=$lt_LD + +# How to create reloadable object files. +reload_flag=$lt_reload_flag +reload_cmds=$lt_reload_cmds + +# Commands used to build an old-style archive. +old_archive_cmds=$lt_old_archive_cmds + +# A language specific compiler. +CC=$lt_compiler + +# Is the compiler the GNU compiler? +with_gcc=$GCC + +# Compiler flag to turn off builtin functions. +no_builtin_flag=$lt_lt_prog_compiler_no_builtin_flag + +# Additional compiler flags for building library objects. +pic_flag=$lt_lt_prog_compiler_pic + +# How to pass a linker flag through the compiler. +wl=$lt_lt_prog_compiler_wl + +# Compiler flag to prevent dynamic linking. +link_static_flag=$lt_lt_prog_compiler_static + +# Does compiler simultaneously support -c and -o options? +compiler_c_o=$lt_lt_cv_prog_compiler_c_o + +# Whether or not to add -lc for building shared libraries. +build_libtool_need_lc=$archive_cmds_need_lc + +# Whether or not to disallow shared libs when runtime libs are static. +allow_libtool_libs_with_static_runtimes=$enable_shared_with_static_runtimes + +# Compiler flag to allow reflexive dlopens. +export_dynamic_flag_spec=$lt_export_dynamic_flag_spec + +# Compiler flag to generate shared objects directly from archives. +whole_archive_flag_spec=$lt_whole_archive_flag_spec + +# Whether the compiler copes with passing no objects directly. +compiler_needs_object=$lt_compiler_needs_object + +# Create an old-style archive from a shared archive. +old_archive_from_new_cmds=$lt_old_archive_from_new_cmds + +# Create a temporary old-style archive to link instead of a shared archive. +old_archive_from_expsyms_cmds=$lt_old_archive_from_expsyms_cmds + +# Commands used to build a shared archive. +archive_cmds=$lt_archive_cmds +archive_expsym_cmds=$lt_archive_expsym_cmds + +# Commands used to build a loadable module if different from building +# a shared archive. +module_cmds=$lt_module_cmds +module_expsym_cmds=$lt_module_expsym_cmds + +# Whether we are building with GNU ld or not. +with_gnu_ld=$lt_with_gnu_ld + +# Flag that allows shared libraries with undefined symbols to be built. +allow_undefined_flag=$lt_allow_undefined_flag + +# Flag that enforces no undefined symbols. +no_undefined_flag=$lt_no_undefined_flag + +# Flag to hardcode \$libdir into a binary during linking. +# This must work even if \$libdir does not exist +hardcode_libdir_flag_spec=$lt_hardcode_libdir_flag_spec + +# Whether we need a single "-rpath" flag with a separated argument. +hardcode_libdir_separator=$lt_hardcode_libdir_separator + +# Set to "yes" if using DIR/libNAME\$shared_ext during linking hardcodes +# DIR into the resulting binary. +hardcode_direct=$hardcode_direct + +# Set to "yes" if using DIR/libNAME\$shared_ext during linking hardcodes +# DIR into the resulting binary and the resulting library dependency is +# "absolute",i.e impossible to change by setting \$shlibpath_var if the +# library is relocated. +hardcode_direct_absolute=$hardcode_direct_absolute + +# Set to "yes" if using the -LDIR flag during linking hardcodes DIR +# into the resulting binary. +hardcode_minus_L=$hardcode_minus_L + +# Set to "yes" if using SHLIBPATH_VAR=DIR during linking hardcodes DIR +# into the resulting binary. +hardcode_shlibpath_var=$hardcode_shlibpath_var + +# Set to "yes" if building a shared library automatically hardcodes DIR +# into the library and all subsequent libraries and executables linked +# against it. +hardcode_automatic=$hardcode_automatic + +# Set to yes if linker adds runtime paths of dependent libraries +# to runtime path list. +inherit_rpath=$inherit_rpath + +# Whether libtool must link a program against all its dependency libraries. +link_all_deplibs=$link_all_deplibs + +# Set to "yes" if exported symbols are required. +always_export_symbols=$always_export_symbols + +# The commands to list exported symbols. +export_symbols_cmds=$lt_export_symbols_cmds + +# Symbols that should not be listed in the preloaded symbols. +exclude_expsyms=$lt_exclude_expsyms + +# Symbols that must always be exported. +include_expsyms=$lt_include_expsyms + +# Commands necessary for linking programs (against libraries) with templates. +prelink_cmds=$lt_prelink_cmds + +# Commands necessary for finishing linking programs. +postlink_cmds=$lt_postlink_cmds + +# Specify filename containing input files. +file_list_spec=$lt_file_list_spec + +# How to hardcode a shared library path into an executable. +hardcode_action=$hardcode_action + +# ### END LIBTOOL CONFIG + +_LT_EOF + + cat <<'_LT_EOF' >> "$cfgfile" + +# ### BEGIN FUNCTIONS SHARED WITH CONFIGURE + +# func_munge_path_list VARIABLE PATH +# ----------------------------------- +# VARIABLE is name of variable containing _space_ separated list of +# directories to be munged by the contents of PATH, which is string +# having a format: +# "DIR[:DIR]:" +# string "DIR[ DIR]" will be prepended to VARIABLE +# ":DIR[:DIR]" +# string "DIR[ DIR]" will be appended to VARIABLE +# "DIRP[:DIRP]::[DIRA:]DIRA" +# string "DIRP[ DIRP]" will be prepended to VARIABLE and string +# "DIRA[ DIRA]" will be appended to VARIABLE +# "DIR[:DIR]" +# VARIABLE will be replaced by "DIR[ DIR]" +func_munge_path_list () +{ + case x$2 in + x) + ;; + *:) + eval $1=\"`$ECHO $2 | $SED 's/:/ /g'` \$$1\" + ;; + x:*) + eval $1=\"\$$1 `$ECHO $2 | $SED 's/:/ /g'`\" + ;; + *::*) + eval $1=\"\$$1\ `$ECHO $2 | $SED -e 's/.*:://' -e 's/:/ /g'`\" + eval $1=\"`$ECHO $2 | $SED -e 's/::.*//' -e 's/:/ /g'`\ \$$1\" + ;; + *) + eval $1=\"`$ECHO $2 | $SED 's/:/ /g'`\" + ;; + esac +} + + +# Calculate cc_basename. Skip known compiler wrappers and cross-prefix. +func_cc_basename () +{ + for cc_temp in $*""; do + case $cc_temp in + compile | *[\\/]compile | ccache | *[\\/]ccache ) ;; + distcc | *[\\/]distcc | purify | *[\\/]purify ) ;; + \-*) ;; + *) break;; + esac + done + func_cc_basename_result=`$ECHO "$cc_temp" | $SED "s%.*/%%; s%^$host_alias-%%"` +} + + +# ### END FUNCTIONS SHARED WITH CONFIGURE + +_LT_EOF + + case $host_os in + aix3*) + cat <<\_LT_EOF >> "$cfgfile" +# AIX sometimes has problems with the GCC collect2 program. For some +# reason, if we set the COLLECT_NAMES environment variable, the problems +# vanish in a puff of smoke. +if test set != "${COLLECT_NAMES+set}"; then + COLLECT_NAMES= + export COLLECT_NAMES +fi +_LT_EOF + ;; + esac + + +ltmain=$ac_aux_dir/ltmain.sh + + + # We use sed instead of cat because bash on DJGPP gets confused if + # if finds mixed CR/LF and LF-only lines. Since sed operates in + # text mode, it properly converts lines to CR/LF. This bash problem + # is reportedly fixed, but why not run on old versions too? + sed '$q' "$ltmain" >> "$cfgfile" \ + || (rm -f "$cfgfile"; exit 1) + + mv -f "$cfgfile" "$ofile" || + (rm -f "$ofile" && cp "$cfgfile" "$ofile" && rm -f "$cfgfile") + chmod +x "$ofile" + + ;; + + esac +done # for ac_tag + + +as_fn_exit 0 +_ACEOF +ac_clean_files=$ac_clean_files_save + +test $ac_write_fail = 0 || + as_fn_error $? "write failure creating $CONFIG_STATUS" "$LINENO" 5 + + +# configure is writing to config.log, and then calls config.status. +# config.status does its own redirection, appending to config.log. +# Unfortunately, on DOS this fails, as config.log is still kept open +# by configure, so config.status won't be able to write to it; its +# output is simply discarded. So we exec the FD to /dev/null, +# effectively closing config.log, so it can be properly (re)opened and +# appended to by config.status. When coming back to configure, we +# need to make the FD available again. +if test "$no_create" != yes; then + ac_cs_success=: + ac_config_status_args= + test "$silent" = yes && + ac_config_status_args="$ac_config_status_args --quiet" + exec 5>/dev/null + $SHELL $CONFIG_STATUS $ac_config_status_args || ac_cs_success=false + exec 5>>config.log + # Use ||, not &&, to avoid exiting from the if with $? = 1, which + # would make configure fail if this is the last instruction. + $ac_cs_success || as_fn_exit 1 +fi +if test -n "$ac_unrecognized_opts" && test "$enable_option_checking" != no; then + { $as_echo "$as_me:${as_lineno-$LINENO}: WARNING: unrecognized options: $ac_unrecognized_opts" >&5 +$as_echo "$as_me: WARNING: unrecognized options: $ac_unrecognized_opts" >&2;} +fi + diff --git a/Build/source/texk/dvipng/configure.ac b/Build/source/texk/dvipng/configure.ac new file mode 100644 index 00000000000..a04da46a9a1 --- /dev/null +++ b/Build/source/texk/dvipng/configure.ac @@ -0,0 +1,188 @@ +dnl Process this file with autoconf to produce a configure script. +dnl +dnl Copyright (C) 2009-2015 Peter Breitenlohner <tex-live@tug.org> +dnl +dnl This file is free software; the copyright holder +dnl gives unlimited permission to copy and/or distribute it, +dnl with or without modifications, as long as this notice is preserved. +dnl +dnl ********************************************************************* +dnl +dnl Adapted for TeX Live from dvipng-1.12/configure.ac +dnl Copyright (C) 2002-2008 Jan-Åke Larsson +dnl +dnl ********************************************************************* +dnl +m4_include([version.ac])[] dnl define dvipng_version +AC_INIT([dvipng (TeX Live)], dvipng_version, [tex-k@tug.org]) +AC_PREREQ([2.65]) +AC_CONFIG_SRCDIR([dvipng-src/dvipng.c]) +AC_CONFIG_AUX_DIR([../../build-aux]) +AC_CONFIG_MACRO_DIRS([../../m4 m4]) + +# Common code for all programs using libkpathsea. +KPSE_COMMON([dvipng]) +# Configure options for dvipng also shown at the TeX Live top-level. +m4_include([ac/dvipng.ac]) + +AC_CANONICAL_HOST + +AM_CONDITIONAL([cross], [test "x$cross_compiling" = xyes]) + +if test "x$enable_debug" != xno; then + enable_debug=yes + AC_DEFINE([DEBUG], 1, [Define as 1 to get the debug (-d) option.]) +fi + +if test "x$enable_timing" = xyes; then + AC_DEFINE([TIMING], 1, [Define as 1 to get execution time output.]) +fi + +# Checks for programs. +# For a native TeX Live build '--with-gs' is ignored. +AS_IF([test "x$enable_native_texlive_build" = xyes], + [with_gs=]) +AS_CASE([$with_gs], + ["" | yes | no], [AC_CHECK_PROG([GS], [gs], [gs])], + [AC_PATH_PROG([GS], ["$with_gs"])]) +AS_IF([test -n "$GS"], + [GS_CHECK_DEVICES], + [AC_MSG_WARN([Cannot find GhostScript in your PATH]) + GS=gs]) +AC_DEFINE_UNQUOTED([GS_PATH], ["$GS"], [Define as the path to GhostScript.]) + +# Checks for libraries. +AC_SEARCH_LIBS([pow], [m]) +AC_SEARCH_LIBS([basename], [gen]) + +# Checks for header files. +AC_HEADER_STDC +AC_CHECK_HEADERS([fcntl.h sys/time.h]) +AC_HEADER_SYS_WAIT +AC_HEADER_TIME +AC_HEADER_STDBOOL + +# Checks for typedefs, structures, and compiler characteristics. +AC_C_CONST +AC_TYPE_PID_T + +# Checks for library functions. +AC_FUNC_MMAP +AC_FUNC_STRTOD +AC_FUNC_VPRINTF +AC_CHECK_FUNCS([dup2 memset munmap pow putenv strchr strrchr]) + +if test "x$enable_timing" = xyes; then + AC_CHECK_FUNCS([ftime gettimeofday]) +fi + +# Documentation-related checks. +AC_PATH_PROG([MAKEINFO], [makeinfo], [:]) +MAKEINFO_CHECK_MACROS([acronym env option]) +AC_PATH_PROG([INSTALL_INFO], [install-info], [:], [$PATH /usr/sbin /sbin]) + +# SELFAUTO -- not used when built as part of the TeX Live tree. + +# We have to check properties of libraries, either installed (system) +# libraries or unistalled (possibly libtool) ones from the TeX Live tree. +# Thus we can not use, e.g., AC_CHECK_LIB(LIB, FUNCTION) + +KPSE_KPATHSEA_FLAGS +KPSE_ZLIB_FLAGS +KPSE_LIBPNG_FLAGS +KPSE_FREETYPE2_FLAGS +KPSE_GD_FLAGS + +# Assume we have freetype2. +have_ft2=yes + +if test "x$enable_build" != xno || test -f config.force; then + +# Checks for more libraries. +KPSE_ADD_FLAGS([zlib]) +AC_CHECK_FUNC([deflate], + [AC_DEFINE([HAVE_LIBZ], 1, + [Define to 1 if you have the `z' library (-lz).])]) + +KPSE_ADD_FLAGS([libpng]) +AC_CHECK_FUNC([png_read_image], + [AC_DEFINE([HAVE_LIBPNG], 1, + [Define to 1 if you have the `png' library (-lpng).])], + [AC_MSG_ERROR([cannot find/use libpng])]) + +KPSE_ADD_FLAGS([freetype2]) +AC_CHECK_FUNC([FT_Init_FreeType], + [AC_DEFINE([HAVE_FT2], 1, + [Define to 1 if you have freetype2.])], + [have_ft2=no]) + +KPSE_ADD_FLAGS([gd]) +AC_CHECK_FUNC([gdImageCreate], + [AC_DEFINE([HAVE_LIBGD], 1, + [Define to 1 if you have the `gd' library (-lgd).])], + [AC_MSG_ERROR([cannot find/use gd +This drawing library can be downloaded at http://www.boutell.com/gd])]) + +KPSE_ADD_FLAGS([kpathsea]) +AC_CHECK_FUNC([kpse_set_program_name], + [AC_DEFINE([HAVE_LIBKPATHSEA], 1, + [Define to 1 if you have the `kpathsea' library (-lkpathsea).])], + [AC_MSG_ERROR([cannot find/use libkpathsea])]) + +AC_CHECK_FUNCS([kpse_program_basename]) + +KPSE_DO_IF_WIN32([AC_CHECK_FUNCS([texlive_gs_init])]) + +# We need enc, cmap, and sfd formats. +# Introduced together with opentype format (Dec 2003). +KPSE_CHECK_KPSE_FORMAT([opentype], + [AC_DEFINE([HAVE_KPSE_ENC_FORMATS], 1, + [Define to 1 if your kpathsea has kpse_enc_format.])]) + +# Checks for more header files. +AC_CHECK_HEADERS([gd.h png.h kpathsea/kpathsea.h], , + [AC_MSG_ERROR([cannot find/use $ac_header])]) + +# Checks for more library functions. +AC_CHECK_FUNCS([gdImageCreateTrueColor gdImageCreateFromJpeg gdImagePngEx gdImageCreateFromPngPtr gdImageGif FT_Library_Version]) + +KPSE_RESTORE_FLAGS + +echo timestamp >config.force + +fi + +AM_CONDITIONAL([have_ft2], [test "x$have_ft2" = xyes]) +AM_CONDITIONAL([have_gif], [test "x$ac_cv_func_gdImageGif" = xyes]) + +AC_MSG_RESULT([ +** Configuration summary for $PACKAGE_STRING: + + The -d (debug) switch is enabled: $enable_debug + Your gd is new enough (>=2.0) to enable + the --truecolor switch, full alpha + transparency, proper rescaling of + included bitmaps, and jpeg inclusion: $ac_cv_func_gdImageCreateTrueColor + Your gd has jpeg inclusion enabled: $ac_cv_func_gdImageCreateFromJpeg + Your gd is new enough (>=2.0.12) to + enable transparent backgrounds for EPS + inclusion and the -z (compression) + switch: $ac_cv_func_gdImagePngEx + Your gd is new enough (>=2.0.21) to + allow image creation from memory $ac_cv_func_gdImageCreateFromPngPtr + Your gd is new enough (>=2.0.28) to + enable gif inclusion and output + (dvigif): $ac_cv_func_gdImageGif + FreeType font rendering available: $ac_cv_func_FT_Init_FreeType + Support for subfonts (CJK-LaTeX): $ac_cv_func_FT_Init_FreeType +]) + +AC_CONFIG_HEADERS([config.h]) + +AC_SUBST([DVIPNG_TREE], [dvipng-src]) + +KPSE_WIN32_CALL + +AC_CONFIG_FILES([Makefile help/Makefile doc/Makefile]) + +AC_OUTPUT diff --git a/Build/source/texk/dvipng/doc/Makefile.am b/Build/source/texk/dvipng/doc/Makefile.am new file mode 100644 index 00000000000..e61015bb4d5 --- /dev/null +++ b/Build/source/texk/dvipng/doc/Makefile.am @@ -0,0 +1,53 @@ +## Makefile.am for the TeX Live subdirectory texk/dvipng/doc/ +## +## Copyright (C) 2009-2015 Peter Breitenlohner <tex-live@tug.org> +## You may freely use, modify and/or distribute this file. +# +info_TEXINFOS = \ + dvipng.texi +dvipng_TEXINFOS = \ + dvipng.help \ + install.texi \ + macros.texi \ + readme.texi + +BUILT_SOURCES = doc-stamp + +doc-stamp: +if MAINTAINER_MODE +## Check that the .texi files here are copies of those in ../$(DVIPNG_TREE)/. + @for f in dvipng install macros readme; do \ + f1="$(top_srcdir)/$(DVIPNG_TREE)/$$f.texi"; \ + f2="$(srcdir)/$$f.texi"; \ + echo "diff '$$f1' '$$f2'"; \ + if diff "$$f1" "$$f2"; then :; \ + else \ + echo "cp -p '$$f1' '$$f2'"; \ + cp -p "$$f1" "$$f2"; \ + fi; \ + done +endif MAINTAINER_MODE + echo timestamp >$@ + +dist_noinst_SCRIPTS = texi2pod.pl + +dist_man1_MANS = dvipng.1 +dvipng.1: dvipng.texi readme.texi + $(srcdir)/texi2pod.pl -D man $(srcdir)/dvipng.texi | \ + sed -es/@//g -es/previewlatex/preview-latex/g -es/{}//g > dvipng.pod + pod2man --center="User commands" --release="$(PACKAGE_STRING)" \ + dvipng.pod > dvipng.1 + rm dvipng.pod + +# Symlinks within $(man1dir): FILE:LINK indicates LINK.1->FILE.1 +man1_links = dvipng:dvigif + +include $(top_srcdir)/../../am/man1_links.am + +if have_gif +install-data-hook: install-man1-links +uninstall-hook: uninstall-man1-links +endif have_gif + +DISTCLEANFILES = doc-stamp + diff --git a/Build/source/texk/dvipng/doc/Makefile.in b/Build/source/texk/dvipng/doc/Makefile.in new file mode 100644 index 00000000000..d2135706454 --- /dev/null +++ b/Build/source/texk/dvipng/doc/Makefile.in @@ -0,0 +1,909 @@ +# Makefile.in generated by automake 1.16.3 from Makefile.am. +# @configure_input@ + +# Copyright (C) 1994-2020 Free Software Foundation, Inc. + +# This Makefile.in is free software; the Free Software Foundation +# gives unlimited permission to copy and/or distribute it, +# with or without modifications, as long as this notice is preserved. + +# This program is distributed in the hope that it will be useful, +# but WITHOUT ANY WARRANTY, to the extent permitted by law; without +# even the implied warranty of MERCHANTABILITY or FITNESS FOR A +# PARTICULAR PURPOSE. + +@SET_MAKE@ + +VPATH = @srcdir@ +am__is_gnu_make = { \ + if test -z '$(MAKELEVEL)'; then \ + false; \ + elif test -n '$(MAKE_HOST)'; then \ + true; \ + elif test -n '$(MAKE_VERSION)' && test -n '$(CURDIR)'; then \ + true; \ + else \ + false; \ + fi; \ +} +am__make_running_with_option = \ + case $${target_option-} in \ + ?) ;; \ + *) echo "am__make_running_with_option: internal error: invalid" \ + "target option '$${target_option-}' specified" >&2; \ + exit 1;; \ + esac; \ + has_opt=no; \ + sane_makeflags=$$MAKEFLAGS; \ + if $(am__is_gnu_make); then \ + sane_makeflags=$$MFLAGS; \ + else \ + case $$MAKEFLAGS in \ + *\\[\ \ ]*) \ + bs=\\; \ + sane_makeflags=`printf '%s\n' "$$MAKEFLAGS" \ + | sed "s/$$bs$$bs[$$bs $$bs ]*//g"`;; \ + esac; \ + fi; \ + skip_next=no; \ + strip_trailopt () \ + { \ + flg=`printf '%s\n' "$$flg" | sed "s/$$1.*$$//"`; \ + }; \ + for flg in $$sane_makeflags; do \ + test $$skip_next = yes && { skip_next=no; continue; }; \ + case $$flg in \ + *=*|--*) continue;; \ + -*I) strip_trailopt 'I'; skip_next=yes;; \ + -*I?*) strip_trailopt 'I';; \ + -*O) strip_trailopt 'O'; skip_next=yes;; \ + -*O?*) strip_trailopt 'O';; \ + -*l) strip_trailopt 'l'; skip_next=yes;; \ + -*l?*) strip_trailopt 'l';; \ + -[dEDm]) skip_next=yes;; \ + -[JT]) skip_next=yes;; \ + esac; \ + case $$flg in \ + *$$target_option*) has_opt=yes; break;; \ + esac; \ + done; \ + test $$has_opt = yes +am__make_dryrun = (target_option=n; $(am__make_running_with_option)) +am__make_keepgoing = (target_option=k; $(am__make_running_with_option)) +pkgdatadir = $(datadir)/@PACKAGE@ +pkgincludedir = $(includedir)/@PACKAGE@ +pkglibdir = $(libdir)/@PACKAGE@ +pkglibexecdir = $(libexecdir)/@PACKAGE@ +am__cd = CDPATH="$${ZSH_VERSION+.}$(PATH_SEPARATOR)" && cd +install_sh_DATA = $(install_sh) -c -m 644 +install_sh_PROGRAM = $(install_sh) -c +install_sh_SCRIPT = $(install_sh) -c +INSTALL_HEADER = $(INSTALL_DATA) +transform = $(program_transform_name) +NORMAL_INSTALL = : +PRE_INSTALL = : +POST_INSTALL = : +NORMAL_UNINSTALL = : +PRE_UNINSTALL = : +POST_UNINSTALL = : +build_triplet = @build@ +host_triplet = @host@ +subdir = doc +ACLOCAL_M4 = $(top_srcdir)/aclocal.m4 +am__aclocal_m4_deps = $(top_srcdir)/m4/gs-device.m4 \ + $(top_srcdir)/m4/makeinfo.m4 \ + $(top_srcdir)/../../m4/kpse-common.m4 \ + $(top_srcdir)/../../m4/kpse-freetype2-flags.m4 \ + $(top_srcdir)/../../m4/kpse-gd-flags.m4 \ + $(top_srcdir)/../../m4/kpse-kpathsea-flags.m4 \ + $(top_srcdir)/../../m4/kpse-libpng-flags.m4 \ + $(top_srcdir)/../../m4/kpse-warnings.m4 \ + $(top_srcdir)/../../m4/kpse-win32.m4 \ + $(top_srcdir)/../../m4/kpse-zlib-flags.m4 \ + $(top_srcdir)/../../m4/libtool.m4 \ + $(top_srcdir)/../../m4/ltoptions.m4 \ + $(top_srcdir)/../../m4/ltsugar.m4 \ + $(top_srcdir)/../../m4/ltversion.m4 \ + $(top_srcdir)/../../m4/lt~obsolete.m4 $(top_srcdir)/version.ac \ + $(top_srcdir)/ac/dvipng.ac $(top_srcdir)/configure.ac +am__configure_deps = $(am__aclocal_m4_deps) $(CONFIGURE_DEPENDENCIES) \ + $(ACLOCAL_M4) +DIST_COMMON = $(srcdir)/Makefile.am $(dist_noinst_SCRIPTS) \ + $(am__DIST_COMMON) +mkinstalldirs = $(install_sh) -d +CONFIG_HEADER = $(top_builddir)/config.h +CONFIG_CLEAN_FILES = +CONFIG_CLEAN_VPATH_FILES = +SCRIPTS = $(dist_noinst_SCRIPTS) +AM_V_P = $(am__v_P_@AM_V@) +am__v_P_ = $(am__v_P_@AM_DEFAULT_V@) +am__v_P_0 = false +am__v_P_1 = : +AM_V_GEN = $(am__v_GEN_@AM_V@) +am__v_GEN_ = $(am__v_GEN_@AM_DEFAULT_V@) +am__v_GEN_0 = @echo " GEN " $@; +am__v_GEN_1 = +AM_V_at = $(am__v_at_@AM_V@) +am__v_at_ = $(am__v_at_@AM_DEFAULT_V@) +am__v_at_0 = @ +am__v_at_1 = +SOURCES = +DIST_SOURCES = +AM_V_DVIPS = $(am__v_DVIPS_@AM_V@) +am__v_DVIPS_ = $(am__v_DVIPS_@AM_DEFAULT_V@) +am__v_DVIPS_0 = @echo " DVIPS " $@; +am__v_DVIPS_1 = +AM_V_MAKEINFO = $(am__v_MAKEINFO_@AM_V@) +am__v_MAKEINFO_ = $(am__v_MAKEINFO_@AM_DEFAULT_V@) +am__v_MAKEINFO_0 = @echo " MAKEINFO" $@; +am__v_MAKEINFO_1 = +AM_V_INFOHTML = $(am__v_INFOHTML_@AM_V@) +am__v_INFOHTML_ = $(am__v_INFOHTML_@AM_DEFAULT_V@) +am__v_INFOHTML_0 = @echo " INFOHTML" $@; +am__v_INFOHTML_1 = +AM_V_TEXI2DVI = $(am__v_TEXI2DVI_@AM_V@) +am__v_TEXI2DVI_ = $(am__v_TEXI2DVI_@AM_DEFAULT_V@) +am__v_TEXI2DVI_0 = @echo " TEXI2DVI" $@; +am__v_TEXI2DVI_1 = +AM_V_TEXI2PDF = $(am__v_TEXI2PDF_@AM_V@) +am__v_TEXI2PDF_ = $(am__v_TEXI2PDF_@AM_DEFAULT_V@) +am__v_TEXI2PDF_0 = @echo " TEXI2PDF" $@; +am__v_TEXI2PDF_1 = +AM_V_texinfo = $(am__v_texinfo_@AM_V@) +am__v_texinfo_ = $(am__v_texinfo_@AM_DEFAULT_V@) +am__v_texinfo_0 = -q +am__v_texinfo_1 = +AM_V_texidevnull = $(am__v_texidevnull_@AM_V@) +am__v_texidevnull_ = $(am__v_texidevnull_@AM_DEFAULT_V@) +am__v_texidevnull_0 = > /dev/null +am__v_texidevnull_1 = +INFO_DEPS = $(srcdir)/dvipng.info +TEXINFO_TEX = $(top_srcdir)/../../build-aux/texinfo.tex +am__TEXINFO_TEX_DIR = $(top_srcdir)/../../build-aux +DVIS = dvipng.dvi +PDFS = dvipng.pdf +PSS = dvipng.ps +HTMLS = dvipng.html +TEXINFOS = dvipng.texi +TEXI2DVI = texi2dvi +TEXI2PDF = $(TEXI2DVI) --pdf --batch +MAKEINFOHTML = $(MAKEINFO) --html +AM_MAKEINFOHTMLFLAGS = $(AM_MAKEINFOFLAGS) +DVIPS = dvips +am__can_run_installinfo = \ + case $$AM_UPDATE_INFO_DIR in \ + n|no|NO) false;; \ + *) (install-info --version) >/dev/null 2>&1;; \ + esac +am__installdirs = "$(DESTDIR)$(infodir)" "$(DESTDIR)$(man1dir)" +am__vpath_adj_setup = srcdirstrip=`echo "$(srcdir)" | sed 's|.|.|g'`; +am__vpath_adj = case $$p in \ + $(srcdir)/*) f=`echo "$$p" | sed "s|^$$srcdirstrip/||"`;; \ + *) f=$$p;; \ + esac; +am__strip_dir = f=`echo $$p | sed -e 's|^.*/||'`; +am__install_max = 40 +am__nobase_strip_setup = \ + srcdirstrip=`echo "$(srcdir)" | sed 's/[].[^$$\\*|]/\\\\&/g'` +am__nobase_strip = \ + for p in $$list; do echo "$$p"; done | sed -e "s|$$srcdirstrip/||" +am__nobase_list = $(am__nobase_strip_setup); \ + for p in $$list; do echo "$$p $$p"; done | \ + sed "s| $$srcdirstrip/| |;"' / .*\//!s/ .*/ ./; s,\( .*\)/[^/]*$$,\1,' | \ + $(AWK) 'BEGIN { files["."] = "" } { files[$$2] = files[$$2] " " $$1; \ + if (++n[$$2] == $(am__install_max)) \ + { print $$2, files[$$2]; n[$$2] = 0; files[$$2] = "" } } \ + END { for (dir in files) print dir, files[dir] }' +am__base_list = \ + sed '$$!N;$$!N;$$!N;$$!N;$$!N;$$!N;$$!N;s/\n/ /g' | \ + sed '$$!N;$$!N;$$!N;$$!N;s/\n/ /g' +am__uninstall_files_from_dir = { \ + test -z "$$files" \ + || { test ! -d "$$dir" && test ! -f "$$dir" && test ! -r "$$dir"; } \ + || { echo " ( cd '$$dir' && rm -f" $$files ")"; \ + $(am__cd) "$$dir" && rm -f $$files; }; \ + } +man1dir = $(mandir)/man1 +NROFF = nroff +MANS = $(dist_man1_MANS) +am__tagged_files = $(HEADERS) $(SOURCES) $(TAGS_FILES) $(LISP) +am__DIST_COMMON = $(dist_man1_MANS) $(dvipng_TEXINFOS) \ + $(srcdir)/Makefile.in $(top_srcdir)/../../am/man1_links.am \ + $(top_srcdir)/../../build-aux/texinfo.tex +DISTFILES = $(DIST_COMMON) $(DIST_SOURCES) $(TEXINFOS) $(EXTRA_DIST) +ACLOCAL = @ACLOCAL@ +AMTAR = @AMTAR@ +AM_DEFAULT_VERBOSITY = @AM_DEFAULT_VERBOSITY@ +AM_MAKEINFOFLAGS = @AM_MAKEINFOFLAGS@ +AR = @AR@ +AS = @AS@ +AUTOCONF = @AUTOCONF@ +AUTOHEADER = @AUTOHEADER@ +AUTOMAKE = @AUTOMAKE@ +AWK = @AWK@ +CC = @CC@ +CCDEPMODE = @CCDEPMODE@ +CFLAGS = @CFLAGS@ +CPP = @CPP@ +CPPFLAGS = @CPPFLAGS@ +CYGPATH_W = @CYGPATH_W@ +DEFS = @DEFS@ +DEPDIR = @DEPDIR@ +DLLTOOL = @DLLTOOL@ +DSYMUTIL = @DSYMUTIL@ +DUMPBIN = @DUMPBIN@ +DVIPNG_TREE = @DVIPNG_TREE@ +ECHO_C = @ECHO_C@ +ECHO_N = @ECHO_N@ +ECHO_T = @ECHO_T@ +EGREP = @EGREP@ +EXEEXT = @EXEEXT@ +FGREP = @FGREP@ +FREETYPE2_DEPEND = @FREETYPE2_DEPEND@ +FREETYPE2_INCLUDES = @FREETYPE2_INCLUDES@ +FREETYPE2_LIBS = @FREETYPE2_LIBS@ +FT2_CONFIG = @FT2_CONFIG@ +GD_DEPEND = @GD_DEPEND@ +GD_INCLUDES = @GD_INCLUDES@ +GD_LIBS = @GD_LIBS@ +GREP = @GREP@ +GS = @GS@ +INSTALL = @INSTALL@ +INSTALL_DATA = @INSTALL_DATA@ +INSTALL_INFO = @INSTALL_INFO@ +INSTALL_PROGRAM = @INSTALL_PROGRAM@ +INSTALL_SCRIPT = @INSTALL_SCRIPT@ +INSTALL_STRIP_PROGRAM = @INSTALL_STRIP_PROGRAM@ +KPATHSEA_DEPEND = @KPATHSEA_DEPEND@ +KPATHSEA_INCLUDES = @KPATHSEA_INCLUDES@ +KPATHSEA_LIBS = @KPATHSEA_LIBS@ +LD = @LD@ +LDFLAGS = @LDFLAGS@ +LIBOBJS = @LIBOBJS@ +LIBPNG_DEPEND = @LIBPNG_DEPEND@ +LIBPNG_INCLUDES = @LIBPNG_INCLUDES@ +LIBPNG_LIBS = @LIBPNG_LIBS@ +LIBS = @LIBS@ +LIBTOOL = @LIBTOOL@ +LIPO = @LIPO@ +LN_S = @LN_S@ +LTLIBOBJS = @LTLIBOBJS@ +LT_SYS_LIBRARY_PATH = @LT_SYS_LIBRARY_PATH@ +MAINT = @MAINT@ +MAKEINFO = @MAKEINFO@ +MANIFEST_TOOL = @MANIFEST_TOOL@ +MKDIR_P = @MKDIR_P@ +NM = @NM@ +NMEDIT = @NMEDIT@ +OBJDUMP = @OBJDUMP@ +OBJEXT = @OBJEXT@ +OTOOL = @OTOOL@ +OTOOL64 = @OTOOL64@ +PACKAGE = @PACKAGE@ +PACKAGE_BUGREPORT = @PACKAGE_BUGREPORT@ +PACKAGE_NAME = @PACKAGE_NAME@ +PACKAGE_STRING = @PACKAGE_STRING@ +PACKAGE_TARNAME = @PACKAGE_TARNAME@ +PACKAGE_URL = @PACKAGE_URL@ +PACKAGE_VERSION = @PACKAGE_VERSION@ +PATH_SEPARATOR = @PATH_SEPARATOR@ +PKG_CONFIG = @PKG_CONFIG@ +POW_LIB = @POW_LIB@ +RANLIB = @RANLIB@ +SED = @SED@ +SET_MAKE = @SET_MAKE@ +SHELL = @SHELL@ +STRIP = @STRIP@ +VERSION = @VERSION@ +WARNING_CFLAGS = @WARNING_CFLAGS@ +ZLIB_DEPEND = @ZLIB_DEPEND@ +ZLIB_INCLUDES = @ZLIB_INCLUDES@ +ZLIB_LIBS = @ZLIB_LIBS@ +abs_builddir = @abs_builddir@ +abs_srcdir = @abs_srcdir@ +abs_top_builddir = @abs_top_builddir@ +abs_top_srcdir = @abs_top_srcdir@ +ac_ct_AR = @ac_ct_AR@ +ac_ct_CC = @ac_ct_CC@ +ac_ct_DUMPBIN = @ac_ct_DUMPBIN@ +am__include = @am__include@ +am__leading_dot = @am__leading_dot@ +am__quote = @am__quote@ +am__tar = @am__tar@ +am__untar = @am__untar@ +bindir = @bindir@ +build = @build@ +build_alias = @build_alias@ +build_cpu = @build_cpu@ +build_os = @build_os@ +build_vendor = @build_vendor@ +builddir = @builddir@ +datadir = @datadir@ +datarootdir = @datarootdir@ +docdir = @docdir@ +dvidir = @dvidir@ +exec_prefix = @exec_prefix@ +host = @host@ +host_alias = @host_alias@ +host_cpu = @host_cpu@ +host_os = @host_os@ +host_vendor = @host_vendor@ +htmldir = @htmldir@ +includedir = @includedir@ +infodir = @infodir@ +install_sh = @install_sh@ +libdir = @libdir@ +libexecdir = @libexecdir@ +localedir = @localedir@ +localstatedir = @localstatedir@ +mandir = @mandir@ +mkdir_p = @mkdir_p@ +oldincludedir = @oldincludedir@ +pdfdir = @pdfdir@ +prefix = @prefix@ +program_transform_name = @program_transform_name@ +psdir = @psdir@ +sbindir = @sbindir@ +sharedstatedir = @sharedstatedir@ +srcdir = @srcdir@ +sysconfdir = @sysconfdir@ +target_alias = @target_alias@ +top_build_prefix = @top_build_prefix@ +top_builddir = @top_builddir@ +top_srcdir = @top_srcdir@ + +# +info_TEXINFOS = \ + dvipng.texi + +dvipng_TEXINFOS = \ + dvipng.help \ + install.texi \ + macros.texi \ + readme.texi + +BUILT_SOURCES = doc-stamp +dist_noinst_SCRIPTS = texi2pod.pl +dist_man1_MANS = dvipng.1 + +# Symlinks within $(man1dir): FILE:LINK indicates LINK.1->FILE.1 +man1_links = dvipng:dvigif +DISTCLEANFILES = doc-stamp +all: $(BUILT_SOURCES) + $(MAKE) $(AM_MAKEFLAGS) all-am + +.SUFFIXES: +.SUFFIXES: .dvi .html .info .pdf .ps .texi +$(srcdir)/Makefile.in: @MAINTAINER_MODE_TRUE@ $(srcdir)/Makefile.am $(top_srcdir)/../../am/man1_links.am $(am__configure_deps) + @for dep in $?; do \ + case '$(am__configure_deps)' in \ + *$$dep*) \ + ( cd $(top_builddir) && $(MAKE) $(AM_MAKEFLAGS) am--refresh ) \ + && { if test -f $@; then exit 0; else break; fi; }; \ + exit 1;; \ + esac; \ + done; \ + echo ' cd $(top_srcdir) && $(AUTOMAKE) --foreign doc/Makefile'; \ + $(am__cd) $(top_srcdir) && \ + $(AUTOMAKE) --foreign doc/Makefile +Makefile: $(srcdir)/Makefile.in $(top_builddir)/config.status + @case '$?' in \ + *config.status*) \ + cd $(top_builddir) && $(MAKE) $(AM_MAKEFLAGS) am--refresh;; \ + *) \ + echo ' cd $(top_builddir) && $(SHELL) ./config.status $(subdir)/$@ $(am__maybe_remake_depfiles)'; \ + cd $(top_builddir) && $(SHELL) ./config.status $(subdir)/$@ $(am__maybe_remake_depfiles);; \ + esac; +$(top_srcdir)/../../am/man1_links.am $(am__empty): + +$(top_builddir)/config.status: $(top_srcdir)/configure $(CONFIG_STATUS_DEPENDENCIES) + cd $(top_builddir) && $(MAKE) $(AM_MAKEFLAGS) am--refresh + +$(top_srcdir)/configure: @MAINTAINER_MODE_TRUE@ $(am__configure_deps) + cd $(top_builddir) && $(MAKE) $(AM_MAKEFLAGS) am--refresh +$(ACLOCAL_M4): @MAINTAINER_MODE_TRUE@ $(am__aclocal_m4_deps) + cd $(top_builddir) && $(MAKE) $(AM_MAKEFLAGS) am--refresh +$(am__aclocal_m4_deps): + +mostlyclean-libtool: + -rm -f *.lo + +clean-libtool: + -rm -rf .libs _libs + +.texi.info: + $(AM_V_MAKEINFO)restore=: && backupdir="$(am__leading_dot)am$$$$" && \ + am__cwd=`pwd` && $(am__cd) $(srcdir) && \ + rm -rf $$backupdir && mkdir $$backupdir && \ + if ($(MAKEINFO) --version) >/dev/null 2>&1; then \ + for f in $@ $@-[0-9] $@-[0-9][0-9] $(@:.info=).i[0-9] $(@:.info=).i[0-9][0-9]; do \ + if test -f $$f; then mv $$f $$backupdir; restore=mv; else :; fi; \ + done; \ + else :; fi && \ + cd "$$am__cwd"; \ + if $(MAKEINFO) $(AM_MAKEINFOFLAGS) $(MAKEINFOFLAGS) -I $(srcdir) \ + -o $@ $<; \ + then \ + rc=0; \ + $(am__cd) $(srcdir); \ + else \ + rc=$$?; \ + $(am__cd) $(srcdir) && \ + $$restore $$backupdir/* `echo "./$@" | sed 's|[^/]*$$||'`; \ + fi; \ + rm -rf $$backupdir; exit $$rc + +.texi.dvi: + $(AM_V_TEXI2DVI)TEXINPUTS="$(am__TEXINFO_TEX_DIR)$(PATH_SEPARATOR)$$TEXINPUTS" \ + MAKEINFO='$(MAKEINFO) $(AM_MAKEINFOFLAGS) $(MAKEINFOFLAGS) -I $(srcdir)' \ + $(TEXI2DVI) $(AM_V_texinfo) --build-dir=$(@:.dvi=.t2d) -o $@ $(AM_V_texidevnull) \ + $< + +.texi.pdf: + $(AM_V_TEXI2PDF)TEXINPUTS="$(am__TEXINFO_TEX_DIR)$(PATH_SEPARATOR)$$TEXINPUTS" \ + MAKEINFO='$(MAKEINFO) $(AM_MAKEINFOFLAGS) $(MAKEINFOFLAGS) -I $(srcdir)' \ + $(TEXI2PDF) $(AM_V_texinfo) --build-dir=$(@:.pdf=.t2p) -o $@ $(AM_V_texidevnull) \ + $< + +.texi.html: + $(AM_V_MAKEINFO)rm -rf $(@:.html=.htp) + $(AM_V_at)if $(MAKEINFOHTML) $(AM_MAKEINFOHTMLFLAGS) $(MAKEINFOFLAGS) -I $(srcdir) \ + -o $(@:.html=.htp) $<; \ + then \ + rm -rf $@ && mv $(@:.html=.htp) $@; \ + else \ + rm -rf $(@:.html=.htp); exit 1; \ + fi +$(srcdir)/dvipng.info: dvipng.texi $(dvipng_TEXINFOS) +dvipng.dvi: dvipng.texi $(dvipng_TEXINFOS) +dvipng.pdf: dvipng.texi $(dvipng_TEXINFOS) +dvipng.html: dvipng.texi $(dvipng_TEXINFOS) +.dvi.ps: + $(AM_V_DVIPS)TEXINPUTS="$(am__TEXINFO_TEX_DIR)$(PATH_SEPARATOR)$$TEXINPUTS" \ + $(DVIPS) $(AM_V_texinfo) -o $@ $< + +uninstall-dvi-am: + @$(NORMAL_UNINSTALL) + @list='$(DVIS)'; test -n "$(dvidir)" || list=; \ + for p in $$list; do \ + $(am__strip_dir) \ + echo " rm -f '$(DESTDIR)$(dvidir)/$$f'"; \ + rm -f "$(DESTDIR)$(dvidir)/$$f"; \ + done + +uninstall-html-am: + @$(NORMAL_UNINSTALL) + @list='$(HTMLS)'; test -n "$(htmldir)" || list=; \ + for p in $$list; do \ + $(am__strip_dir) \ + echo " rm -rf '$(DESTDIR)$(htmldir)/$$f'"; \ + rm -rf "$(DESTDIR)$(htmldir)/$$f"; \ + done + +uninstall-info-am: + @$(PRE_UNINSTALL) + @if test -d '$(DESTDIR)$(infodir)' && $(am__can_run_installinfo); then \ + list='$(INFO_DEPS)'; \ + for file in $$list; do \ + relfile=`echo "$$file" | sed 's|^.*/||'`; \ + echo " install-info --info-dir='$(DESTDIR)$(infodir)' --remove '$(DESTDIR)$(infodir)/$$relfile'"; \ + if install-info --info-dir="$(DESTDIR)$(infodir)" --remove "$(DESTDIR)$(infodir)/$$relfile"; \ + then :; else test ! -f "$(DESTDIR)$(infodir)/$$relfile" || exit 1; fi; \ + done; \ + else :; fi + @$(NORMAL_UNINSTALL) + @list='$(INFO_DEPS)'; \ + for file in $$list; do \ + relfile=`echo "$$file" | sed 's|^.*/||'`; \ + relfile_i=`echo "$$relfile" | sed 's|\.info$$||;s|$$|.i|'`; \ + (if test -d "$(DESTDIR)$(infodir)" && cd "$(DESTDIR)$(infodir)"; then \ + echo " cd '$(DESTDIR)$(infodir)' && rm -f $$relfile $$relfile-[0-9] $$relfile-[0-9][0-9] $$relfile_i[0-9] $$relfile_i[0-9][0-9]"; \ + rm -f $$relfile $$relfile-[0-9] $$relfile-[0-9][0-9] $$relfile_i[0-9] $$relfile_i[0-9][0-9]; \ + else :; fi); \ + done + +uninstall-pdf-am: + @$(NORMAL_UNINSTALL) + @list='$(PDFS)'; test -n "$(pdfdir)" || list=; \ + for p in $$list; do \ + $(am__strip_dir) \ + echo " rm -f '$(DESTDIR)$(pdfdir)/$$f'"; \ + rm -f "$(DESTDIR)$(pdfdir)/$$f"; \ + done + +uninstall-ps-am: + @$(NORMAL_UNINSTALL) + @list='$(PSS)'; test -n "$(psdir)" || list=; \ + for p in $$list; do \ + $(am__strip_dir) \ + echo " rm -f '$(DESTDIR)$(psdir)/$$f'"; \ + rm -f "$(DESTDIR)$(psdir)/$$f"; \ + done + +dist-info: $(INFO_DEPS) + @srcdirstrip=`echo "$(srcdir)" | sed 's|.|.|g'`; \ + list='$(INFO_DEPS)'; \ + for base in $$list; do \ + case $$base in \ + $(srcdir)/*) base=`echo "$$base" | sed "s|^$$srcdirstrip/||"`;; \ + esac; \ + if test -f $$base; then d=.; else d=$(srcdir); fi; \ + base_i=`echo "$$base" | sed 's|\.info$$||;s|$$|.i|'`; \ + for file in $$d/$$base $$d/$$base-[0-9] $$d/$$base-[0-9][0-9] $$d/$$base_i[0-9] $$d/$$base_i[0-9][0-9]; do \ + if test -f $$file; then \ + relfile=`expr "$$file" : "$$d/\(.*\)"`; \ + test -f "$(distdir)/$$relfile" || \ + cp -p $$file "$(distdir)/$$relfile"; \ + else :; fi; \ + done; \ + done + +mostlyclean-aminfo: + -rm -rf dvipng.t2d dvipng.t2p + +clean-aminfo: + -test -z "dvipng.dvi dvipng.pdf dvipng.ps dvipng.html" \ + || rm -rf dvipng.dvi dvipng.pdf dvipng.ps dvipng.html + +maintainer-clean-aminfo: + @list='$(INFO_DEPS)'; for i in $$list; do \ + i_i=`echo "$$i" | sed 's|\.info$$||;s|$$|.i|'`; \ + echo " rm -f $$i $$i-[0-9] $$i-[0-9][0-9] $$i_i[0-9] $$i_i[0-9][0-9]"; \ + rm -f $$i $$i-[0-9] $$i-[0-9][0-9] $$i_i[0-9] $$i_i[0-9][0-9]; \ + done +install-man1: $(dist_man1_MANS) + @$(NORMAL_INSTALL) + @list1='$(dist_man1_MANS)'; \ + list2=''; \ + test -n "$(man1dir)" \ + && test -n "`echo $$list1$$list2`" \ + || exit 0; \ + echo " $(MKDIR_P) '$(DESTDIR)$(man1dir)'"; \ + $(MKDIR_P) "$(DESTDIR)$(man1dir)" || exit 1; \ + { for i in $$list1; do echo "$$i"; done; \ + if test -n "$$list2"; then \ + for i in $$list2; do echo "$$i"; done \ + | sed -n '/\.1[a-z]*$$/p'; \ + fi; \ + } | while read p; do \ + if test -f $$p; then d=; else d="$(srcdir)/"; fi; \ + echo "$$d$$p"; echo "$$p"; \ + done | \ + sed -e 'n;s,.*/,,;p;h;s,.*\.,,;s,^[^1][0-9a-z]*$$,1,;x' \ + -e 's,\.[0-9a-z]*$$,,;$(transform);G;s,\n,.,' | \ + sed 'N;N;s,\n, ,g' | { \ + list=; while read file base inst; do \ + if test "$$base" = "$$inst"; then list="$$list $$file"; else \ + echo " $(INSTALL_DATA) '$$file' '$(DESTDIR)$(man1dir)/$$inst'"; \ + $(INSTALL_DATA) "$$file" "$(DESTDIR)$(man1dir)/$$inst" || exit $$?; \ + fi; \ + done; \ + for i in $$list; do echo "$$i"; done | $(am__base_list) | \ + while read files; do \ + test -z "$$files" || { \ + echo " $(INSTALL_DATA) $$files '$(DESTDIR)$(man1dir)'"; \ + $(INSTALL_DATA) $$files "$(DESTDIR)$(man1dir)" || exit $$?; }; \ + done; } + +uninstall-man1: + @$(NORMAL_UNINSTALL) + @list='$(dist_man1_MANS)'; test -n "$(man1dir)" || exit 0; \ + files=`{ for i in $$list; do echo "$$i"; done; \ + } | sed -e 's,.*/,,;h;s,.*\.,,;s,^[^1][0-9a-z]*$$,1,;x' \ + -e 's,\.[0-9a-z]*$$,,;$(transform);G;s,\n,.,'`; \ + dir='$(DESTDIR)$(man1dir)'; $(am__uninstall_files_from_dir) +tags TAGS: + +ctags CTAGS: + +cscope cscopelist: + + +distdir: $(BUILT_SOURCES) + $(MAKE) $(AM_MAKEFLAGS) distdir-am + +distdir-am: $(DISTFILES) + @srcdirstrip=`echo "$(srcdir)" | sed 's/[].[^$$\\*]/\\\\&/g'`; \ + topsrcdirstrip=`echo "$(top_srcdir)" | sed 's/[].[^$$\\*]/\\\\&/g'`; \ + list='$(DISTFILES)'; \ + dist_files=`for file in $$list; do echo $$file; done | \ + sed -e "s|^$$srcdirstrip/||;t" \ + -e "s|^$$topsrcdirstrip/|$(top_builddir)/|;t"`; \ + case $$dist_files in \ + */*) $(MKDIR_P) `echo "$$dist_files" | \ + sed '/\//!d;s|^|$(distdir)/|;s,/[^/]*$$,,' | \ + sort -u` ;; \ + esac; \ + for file in $$dist_files; do \ + if test -f $$file || test -d $$file; then d=.; else d=$(srcdir); fi; \ + if test -d $$d/$$file; then \ + dir=`echo "/$$file" | sed -e 's,/[^/]*$$,,'`; \ + if test -d "$(distdir)/$$file"; then \ + find "$(distdir)/$$file" -type d ! -perm -700 -exec chmod u+rwx {} \;; \ + fi; \ + if test -d $(srcdir)/$$file && test $$d != $(srcdir); then \ + cp -fpR $(srcdir)/$$file "$(distdir)$$dir" || exit 1; \ + find "$(distdir)/$$file" -type d ! -perm -700 -exec chmod u+rwx {} \;; \ + fi; \ + cp -fpR $$d/$$file "$(distdir)$$dir" || exit 1; \ + else \ + test -f "$(distdir)/$$file" \ + || cp -p $$d/$$file "$(distdir)/$$file" \ + || exit 1; \ + fi; \ + done + $(MAKE) $(AM_MAKEFLAGS) \ + top_distdir="$(top_distdir)" distdir="$(distdir)" \ + dist-info +check-am: all-am +check: $(BUILT_SOURCES) + $(MAKE) $(AM_MAKEFLAGS) check-am +all-am: Makefile $(INFO_DEPS) $(SCRIPTS) $(MANS) +installdirs: + for dir in "$(DESTDIR)$(infodir)" "$(DESTDIR)$(man1dir)"; do \ + test -z "$$dir" || $(MKDIR_P) "$$dir"; \ + done +install: $(BUILT_SOURCES) + $(MAKE) $(AM_MAKEFLAGS) install-am +install-exec: $(BUILT_SOURCES) + $(MAKE) $(AM_MAKEFLAGS) install-exec-am +install-data: install-data-am +uninstall: uninstall-am + +install-am: all-am + @$(MAKE) $(AM_MAKEFLAGS) install-exec-am install-data-am + +installcheck: installcheck-am +install-strip: + if test -z '$(STRIP)'; then \ + $(MAKE) $(AM_MAKEFLAGS) INSTALL_PROGRAM="$(INSTALL_STRIP_PROGRAM)" \ + install_sh_PROGRAM="$(INSTALL_STRIP_PROGRAM)" INSTALL_STRIP_FLAG=-s \ + install; \ + else \ + $(MAKE) $(AM_MAKEFLAGS) INSTALL_PROGRAM="$(INSTALL_STRIP_PROGRAM)" \ + install_sh_PROGRAM="$(INSTALL_STRIP_PROGRAM)" INSTALL_STRIP_FLAG=-s \ + "INSTALL_PROGRAM_ENV=STRIPPROG='$(STRIP)'" install; \ + fi +mostlyclean-generic: + +clean-generic: + +distclean-generic: + -test -z "$(CONFIG_CLEAN_FILES)" || rm -f $(CONFIG_CLEAN_FILES) + -test . = "$(srcdir)" || test -z "$(CONFIG_CLEAN_VPATH_FILES)" || rm -f $(CONFIG_CLEAN_VPATH_FILES) + -test -z "$(DISTCLEANFILES)" || rm -f $(DISTCLEANFILES) + +maintainer-clean-generic: + @echo "This command is intended for maintainers to use" + @echo "it deletes files that may require special tools to rebuild." + -test -z "$(BUILT_SOURCES)" || rm -f $(BUILT_SOURCES) +@have_gif_FALSE@install-data-hook: +@have_gif_FALSE@uninstall-hook: +clean: clean-am + +clean-am: clean-aminfo clean-generic clean-libtool mostlyclean-am + +distclean: distclean-am + -rm -f Makefile +distclean-am: clean-am distclean-generic + +dvi: dvi-am + +dvi-am: $(DVIS) + +html: html-am + +html-am: $(HTMLS) + +info: info-am + +info-am: $(INFO_DEPS) + +install-data-am: install-info-am install-man + @$(NORMAL_INSTALL) + $(MAKE) $(AM_MAKEFLAGS) install-data-hook +install-dvi: install-dvi-am + +install-dvi-am: $(DVIS) + @$(NORMAL_INSTALL) + @list='$(DVIS)'; test -n "$(dvidir)" || list=; \ + if test -n "$$list"; then \ + echo " $(MKDIR_P) '$(DESTDIR)$(dvidir)'"; \ + $(MKDIR_P) "$(DESTDIR)$(dvidir)" || exit 1; \ + fi; \ + for p in $$list; do \ + if test -f "$$p"; then d=; else d="$(srcdir)/"; fi; \ + echo "$$d$$p"; \ + done | $(am__base_list) | \ + while read files; do \ + echo " $(INSTALL_DATA) $$files '$(DESTDIR)$(dvidir)'"; \ + $(INSTALL_DATA) $$files "$(DESTDIR)$(dvidir)" || exit $$?; \ + done +install-exec-am: + +install-html: install-html-am + +install-html-am: $(HTMLS) + @$(NORMAL_INSTALL) + @list='$(HTMLS)'; list2=; test -n "$(htmldir)" || list=; \ + if test -n "$$list"; then \ + echo " $(MKDIR_P) '$(DESTDIR)$(htmldir)'"; \ + $(MKDIR_P) "$(DESTDIR)$(htmldir)" || exit 1; \ + fi; \ + for p in $$list; do \ + if test -f "$$p" || test -d "$$p"; then d=; else d="$(srcdir)/"; fi; \ + $(am__strip_dir) \ + d2=$$d$$p; \ + if test -d "$$d2"; then \ + echo " $(MKDIR_P) '$(DESTDIR)$(htmldir)/$$f'"; \ + $(MKDIR_P) "$(DESTDIR)$(htmldir)/$$f" || exit 1; \ + echo " $(INSTALL_DATA) '$$d2'/* '$(DESTDIR)$(htmldir)/$$f'"; \ + $(INSTALL_DATA) "$$d2"/* "$(DESTDIR)$(htmldir)/$$f" || exit $$?; \ + else \ + list2="$$list2 $$d2"; \ + fi; \ + done; \ + test -z "$$list2" || { echo "$$list2" | $(am__base_list) | \ + while read files; do \ + echo " $(INSTALL_DATA) $$files '$(DESTDIR)$(htmldir)'"; \ + $(INSTALL_DATA) $$files "$(DESTDIR)$(htmldir)" || exit $$?; \ + done; } +install-info: install-info-am + +install-info-am: $(INFO_DEPS) + @$(NORMAL_INSTALL) + @srcdirstrip=`echo "$(srcdir)" | sed 's|.|.|g'`; \ + list='$(INFO_DEPS)'; test -n "$(infodir)" || list=; \ + if test -n "$$list"; then \ + echo " $(MKDIR_P) '$(DESTDIR)$(infodir)'"; \ + $(MKDIR_P) "$(DESTDIR)$(infodir)" || exit 1; \ + fi; \ + for file in $$list; do \ + case $$file in \ + $(srcdir)/*) file=`echo "$$file" | sed "s|^$$srcdirstrip/||"`;; \ + esac; \ + if test -f $$file; then d=.; else d=$(srcdir); fi; \ + file_i=`echo "$$file" | sed 's|\.info$$||;s|$$|.i|'`; \ + for ifile in $$d/$$file $$d/$$file-[0-9] $$d/$$file-[0-9][0-9] \ + $$d/$$file_i[0-9] $$d/$$file_i[0-9][0-9] ; do \ + if test -f $$ifile; then \ + echo "$$ifile"; \ + else : ; fi; \ + done; \ + done | $(am__base_list) | \ + while read files; do \ + echo " $(INSTALL_DATA) $$files '$(DESTDIR)$(infodir)'"; \ + $(INSTALL_DATA) $$files "$(DESTDIR)$(infodir)" || exit $$?; done + @$(POST_INSTALL) + @if $(am__can_run_installinfo); then \ + list='$(INFO_DEPS)'; test -n "$(infodir)" || list=; \ + for file in $$list; do \ + relfile=`echo "$$file" | sed 's|^.*/||'`; \ + echo " install-info --info-dir='$(DESTDIR)$(infodir)' '$(DESTDIR)$(infodir)/$$relfile'";\ + install-info --info-dir="$(DESTDIR)$(infodir)" "$(DESTDIR)$(infodir)/$$relfile" || :;\ + done; \ + else : ; fi +install-man: install-man1 + +install-pdf: install-pdf-am + +install-pdf-am: $(PDFS) + @$(NORMAL_INSTALL) + @list='$(PDFS)'; test -n "$(pdfdir)" || list=; \ + if test -n "$$list"; then \ + echo " $(MKDIR_P) '$(DESTDIR)$(pdfdir)'"; \ + $(MKDIR_P) "$(DESTDIR)$(pdfdir)" || exit 1; \ + fi; \ + for p in $$list; do \ + if test -f "$$p"; then d=; else d="$(srcdir)/"; fi; \ + echo "$$d$$p"; \ + done | $(am__base_list) | \ + while read files; do \ + echo " $(INSTALL_DATA) $$files '$(DESTDIR)$(pdfdir)'"; \ + $(INSTALL_DATA) $$files "$(DESTDIR)$(pdfdir)" || exit $$?; done +install-ps: install-ps-am + +install-ps-am: $(PSS) + @$(NORMAL_INSTALL) + @list='$(PSS)'; test -n "$(psdir)" || list=; \ + if test -n "$$list"; then \ + echo " $(MKDIR_P) '$(DESTDIR)$(psdir)'"; \ + $(MKDIR_P) "$(DESTDIR)$(psdir)" || exit 1; \ + fi; \ + for p in $$list; do \ + if test -f "$$p"; then d=; else d="$(srcdir)/"; fi; \ + echo "$$d$$p"; \ + done | $(am__base_list) | \ + while read files; do \ + echo " $(INSTALL_DATA) $$files '$(DESTDIR)$(psdir)'"; \ + $(INSTALL_DATA) $$files "$(DESTDIR)$(psdir)" || exit $$?; done +installcheck-am: + +maintainer-clean: maintainer-clean-am + -rm -f Makefile +maintainer-clean-am: distclean-am maintainer-clean-aminfo \ + maintainer-clean-generic + +mostlyclean: mostlyclean-am + +mostlyclean-am: mostlyclean-aminfo mostlyclean-generic \ + mostlyclean-libtool + +pdf: pdf-am + +pdf-am: $(PDFS) + +ps: ps-am + +ps-am: $(PSS) + +uninstall-am: uninstall-dvi-am uninstall-html-am uninstall-info-am \ + uninstall-man uninstall-pdf-am uninstall-ps-am + @$(NORMAL_INSTALL) + $(MAKE) $(AM_MAKEFLAGS) uninstall-hook +uninstall-man: uninstall-man1 + +.MAKE: all check install install-am install-data-am install-exec \ + install-strip uninstall-am + +.PHONY: all all-am check check-am clean clean-aminfo clean-generic \ + clean-libtool cscopelist-am ctags-am dist-info distclean \ + distclean-generic distclean-libtool distdir dvi dvi-am html \ + html-am info info-am install install-am install-data \ + install-data-am install-data-hook install-dvi install-dvi-am \ + install-exec install-exec-am install-html install-html-am \ + install-info install-info-am install-man install-man1 \ + install-pdf install-pdf-am install-ps install-ps-am \ + install-strip installcheck installcheck-am installdirs \ + maintainer-clean maintainer-clean-aminfo \ + maintainer-clean-generic mostlyclean mostlyclean-aminfo \ + mostlyclean-generic mostlyclean-libtool pdf pdf-am ps ps-am \ + tags-am uninstall uninstall-am uninstall-dvi-am uninstall-hook \ + uninstall-html-am uninstall-info-am uninstall-man \ + uninstall-man1 uninstall-pdf-am uninstall-ps-am + +.PRECIOUS: Makefile + + +doc-stamp: +@MAINTAINER_MODE_TRUE@ @for f in dvipng install macros readme; do \ +@MAINTAINER_MODE_TRUE@ f1="$(top_srcdir)/$(DVIPNG_TREE)/$$f.texi"; \ +@MAINTAINER_MODE_TRUE@ f2="$(srcdir)/$$f.texi"; \ +@MAINTAINER_MODE_TRUE@ echo "diff '$$f1' '$$f2'"; \ +@MAINTAINER_MODE_TRUE@ if diff "$$f1" "$$f2"; then :; \ +@MAINTAINER_MODE_TRUE@ else \ +@MAINTAINER_MODE_TRUE@ echo "cp -p '$$f1' '$$f2'"; \ +@MAINTAINER_MODE_TRUE@ cp -p "$$f1" "$$f2"; \ +@MAINTAINER_MODE_TRUE@ fi; \ +@MAINTAINER_MODE_TRUE@ done + echo timestamp >$@ +dvipng.1: dvipng.texi readme.texi + $(srcdir)/texi2pod.pl -D man $(srcdir)/dvipng.texi | \ + sed -es/@//g -es/previewlatex/preview-latex/g -es/{}//g > dvipng.pod + pod2man --center="User commands" --release="$(PACKAGE_STRING)" \ + dvipng.pod > dvipng.1 + rm dvipng.pod +.PHONY: install-man1-links uninstall-man1-links + +install-man1-links: + @cd $(DESTDIR)$(man1dir) && \ + for s in $(man1_links); do \ + link=`echo $$s | sed 's,.*:,,'`; \ + file=`echo $$s | sed 's,:.*,,'`; \ + rm -f $$link.1; \ + echo "creating link '$$link.1' -> '$$file.1'"; \ + echo ".so man1/$$file.1" >$$link.1; \ + done + +uninstall-man1-links: + @for s in $(man1_links); do \ + link=`echo $$s | sed 's,.*:,,'`; \ + rm -f $(DESTDIR)$(man1dir)/$$link.1; \ + done + +@have_gif_TRUE@install-data-hook: install-man1-links +@have_gif_TRUE@uninstall-hook: uninstall-man1-links + +# Tell versions [3.59,3.63) of GNU make to not export all variables. +# Otherwise a system limit (for SysV at least) may be exceeded. +.NOEXPORT: diff --git a/Build/source/texk/dvipng/doc/dvipng.1 b/Build/source/texk/dvipng/doc/dvipng.1 new file mode 100644 index 00000000000..613912fea6d --- /dev/null +++ b/Build/source/texk/dvipng/doc/dvipng.1 @@ -0,0 +1,506 @@ +.\" Automatically generated by Pod::Man 4.09 (Pod::Simple 3.35) +.\" +.\" Standard preamble: +.\" ======================================================================== +.de Sp \" Vertical space (when we can't use .PP) +.if t .sp .5v +.if n .sp +.. +.de Vb \" Begin verbatim text +.ft CW +.nf +.ne \\$1 +.. +.de Ve \" End verbatim text +.ft R +.fi +.. +.\" Set up some character translations and predefined strings. \*(-- will +.\" give an unbreakable dash, \*(PI will give pi, \*(L" will give a left +.\" double quote, and \*(R" will give a right double quote. \*(C+ will +.\" give a nicer C++. Capital omega is used to do unbreakable dashes and +.\" therefore won't be available. \*(C` and \*(C' expand to `' in nroff, +.\" nothing in troff, for use with C<>. +.tr \(*W- +.ds C+ C\v'-.1v'\h'-1p'\s-2+\h'-1p'+\s0\v'.1v'\h'-1p' +.ie n \{\ +. ds -- \(*W- +. ds PI pi +. if (\n(.H=4u)&(1m=24u) .ds -- \(*W\h'-12u'\(*W\h'-12u'-\" diablo 10 pitch +. if (\n(.H=4u)&(1m=20u) .ds -- \(*W\h'-12u'\(*W\h'-8u'-\" diablo 12 pitch +. ds L" "" +. ds R" "" +. ds C` "" +. ds C' "" +'br\} +.el\{\ +. ds -- \|\(em\| +. ds PI \(*p +. ds L" `` +. ds R" '' +. ds C` +. ds C' +'br\} +.\" +.\" Escape single quotes in literal strings from groff's Unicode transform. +.ie \n(.g .ds Aq \(aq +.el .ds Aq ' +.\" +.\" If the F register is >0, we'll generate index entries on stderr for +.\" titles (.TH), headers (.SH), subsections (.SS), items (.Ip), and index +.\" entries marked with X<> in POD. Of course, you'll have to process the +.\" output yourself in some meaningful fashion. +.\" +.\" Avoid warning from groff about undefined register 'F'. +.de IX +.. +.if !\nF .nr F 0 +.if \nF>0 \{\ +. de IX +. tm Index:\\$1\t\\n%\t"\\$2" +.. +. if !\nF==2 \{\ +. nr % 0 +. nr F 2 +. \} +.\} +.\" +.\" Accent mark definitions (@(#)ms.acc 1.5 88/02/08 SMI; from UCB 4.2). +.\" Fear. Run. Save yourself. No user-serviceable parts. +. \" fudge factors for nroff and troff +.if n \{\ +. ds #H 0 +. ds #V .8m +. ds #F .3m +. ds #[ \f1 +. ds #] \fP +.\} +.if t \{\ +. ds #H ((1u-(\\\\n(.fu%2u))*.13m) +. ds #V .6m +. ds #F 0 +. ds #[ \& +. ds #] \& +.\} +. \" simple accents for nroff and troff +.if n \{\ +. ds ' \& +. ds ` \& +. ds ^ \& +. ds , \& +. ds ~ ~ +. ds / +.\} +.if t \{\ +. ds ' \\k:\h'-(\\n(.wu*8/10-\*(#H)'\'\h"|\\n:u" +. ds ` \\k:\h'-(\\n(.wu*8/10-\*(#H)'\`\h'|\\n:u' +. ds ^ \\k:\h'-(\\n(.wu*10/11-\*(#H)'^\h'|\\n:u' +. ds , \\k:\h'-(\\n(.wu*8/10)',\h'|\\n:u' +. ds ~ \\k:\h'-(\\n(.wu-\*(#H-.1m)'~\h'|\\n:u' +. ds / \\k:\h'-(\\n(.wu*8/10-\*(#H)'\z\(sl\h'|\\n:u' +.\} +. \" troff and (daisy-wheel) nroff accents +.ds : \\k:\h'-(\\n(.wu*8/10-\*(#H+.1m+\*(#F)'\v'-\*(#V'\z.\h'.2m+\*(#F'.\h'|\\n:u'\v'\*(#V' +.ds 8 \h'\*(#H'\(*b\h'-\*(#H' +.ds o \\k:\h'-(\\n(.wu+\w'\(de'u-\*(#H)/2u'\v'-.3n'\*(#[\z\(de\v'.3n'\h'|\\n:u'\*(#] +.ds d- \h'\*(#H'\(pd\h'-\w'~'u'\v'-.25m'\f2\(hy\fP\v'.25m'\h'-\*(#H' +.ds D- D\\k:\h'-\w'D'u'\v'-.11m'\z\(hy\v'.11m'\h'|\\n:u' +.ds th \*(#[\v'.3m'\s+1I\s-1\v'-.3m'\h'-(\w'I'u*2/3)'\s-1o\s+1\*(#] +.ds Th \*(#[\s+2I\s-2\h'-\w'I'u*3/5'\v'-.3m'o\v'.3m'\*(#] +.ds ae a\h'-(\w'a'u*4/10)'e +.ds Ae A\h'-(\w'A'u*4/10)'E +. \" corrections for vroff +.if v .ds ~ \\k:\h'-(\\n(.wu*9/10-\*(#H)'\s-2\u~\d\s+2\h'|\\n:u' +.if v .ds ^ \\k:\h'-(\\n(.wu*10/11-\*(#H)'\v'-.4m'^\v'.4m'\h'|\\n:u' +. \" for low resolution devices (crt and lpr) +.if \n(.H>23 .if \n(.V>19 \ +\{\ +. ds : e +. ds 8 ss +. ds o a +. ds d- d\h'-1'\(ga +. ds D- D\h'-1'\(hy +. ds th \o'bp' +. ds Th \o'LP' +. ds ae ae +. ds Ae AE +.\} +.rm #[ #] #H #V #F C +.\" ======================================================================== +.\" +.IX Title "DVIPNG 1" +.TH DVIPNG 1 "2020-01-05" "dvipng 1.17" "User commands" +.\" For nroff, turn off justification. Always turn off hyphenation; it makes +.\" way too many mistakes in technical documents. +.if n .ad l +.nh +.SH "NAME" +dvipng \- A DVI\-to\-PNG translator +.SH "SYNOPSIS" +.IX Header "SYNOPSIS" +dvipng [options] filename +.PP +dvipng [options] [filename] \- +.SH "DESCRIPTION" +.IX Header "DESCRIPTION" +This program makes \s-1PNG\s0 and/or \s-1GIF\s0 graphics from \s-1DVI\s0 files as obtained +from TeX and its relatives. +.PP +If \s-1GIF\s0 support is enabled, \s-1GIF\s0 output is chosen by using the +\&\fBdvigif\fR binary or with the \fB\-\-gif\fR option. +.PP +The benefits of \fBdvipng\fR/\fBdvigif\fR include +.IP "*" 4 +Speed. It is a very fast bitmap-rendering code for \s-1DVI\s0 files, which +makes it suitable for generating large amounts of images on-the-fly, +as needed in preview-latex, WeBWorK and others. +.IP "*" 4 +It does not read the postamble, so it can be started before TeX +finishes. There is a \fB\-\-follow\fR switch that makes dvipng wait at +end-of-file for further output, unless it finds the \s-1POST\s0 marker that +indicates the end of the \s-1DVI.\s0 +.IP "*" 4 +Interactive query of options. dvipng can read options interactively +through stdin, and all options are usable. It is even possible to change +the input file through this interface. +.IP "*" 4 +Supports \s-1PK, VF,\s0 PostScript Type1, and TrueType fonts, subfonts (i.e., +as used in CJK-LaTeX), color specials, and inclusion of PostScript, +\&\s-1PNG, JPEG\s0 or \s-1GIF\s0 images. +.IP "*" 4 +and more... +.SH "OPTIONS" +.IX Header "OPTIONS" +Many of the parameterless options listed here can be turned off by +suffixing the option with a zero (\fB0\fR); for instance, to turn off +page reversal, use \fB\-r0\fR. Such options are marked with a trailing +\&\fB*\fR. +.IP "\fB\-\fR" 4 +.IX Item "-" +Read additional options from standard input after processing the command +line. +.IP "\fB\-\-help\fR" 4 +.IX Item "--help" +Print a usage message and exit. +.IP "\fB\-\-version\fR" 4 +.IX Item "--version" +Print the version number and exit. +.IP "\fB\-bd\fR \fInum\fR" 4 +.IX Item "-bd num" +.PD 0 +.IP "\fB\-bd\fR \fIcolor_spec\fR" 4 +.IX Item "-bd color_spec" +.IP "\fB\-bd '\fR\fInum\fR\fB \fR\fIcolor_spec\fR\fB'\fR" 4 +.IX Item "-bd 'num color_spec'" +.PD +Set the pixel width of the transparent border (default 0). Using this +option will make the image edges transparent, but it only affects pixels +with the background color. Giving a \fIcolor_spec\fR will set the +fallback color, to be used in viewers that cannot handle transparency +(the default is the background color). The color spec should be in +TeX color \especial syntax, e.g., 'rgb 1.0 0.0 0.0'. Setting the +fallback color makes the default border width 1 px. +.IP "\fB\-\-bdpi\fR \fInum\fR" 4 +.IX Item "--bdpi num" +This option only has an effect when using bitmapped (\s-1PK\s0) fonts. The +option sets the base (Metafont) resolution, both horizontal and +vertical, to \fInum\fR dpi (dots per inch). This option is necessary +when manually selecting Metafont mode with the \-\-mode option (see +below). +.IP "\fB\-bg\fR \fIcolor_spec\fR" 4 +.IX Item "-bg color_spec" +Choose background color for the images. This option will be ignored if +there is a background color \especial in the \s-1DVI.\s0 The color spec should +be in TeX color \especial syntax, e.g., 'rgb 1.0 0.0 0.0'. You can +also specify 'Transparent' or 'transparent' which will give you a +transparent background with the normal background as a fallback color. A +capitalized 'Transparent' will give a full-alpha transparency, while an +all-lowercase 'transparent' will give a simple fully transparent +background with non-transparent antialiased pixels. The latter would be +suitable for viewers who cannot cope with a true alpha channel. \s-1GIF\s0 +images do not support full alpha transparency, so in case of \s-1GIF\s0 output, +both variants will use the latter behaviour. +.IP "\fB\-d\fR \fInum\fR" 4 +.IX Item "-d num" +Set the debug flags, showing what dvipng (thinks it) is doing. This will +work unless dvipng has been compiled without the \f(CW\*(C`DEBUG\*(C'\fR option +(not recommended). Set the flags as you need them, use \fB\-d \-1\fR as +the first option for maximum output. +.IP "\fB\-D\fR \fInum\fR" 4 +.IX Item "-D num" +Set the output resolution, both horizontal and vertical, to \fInum\fR +dpi (dots per inch). +.Sp +One may want to adjust this to fit a certain text font size (e.g., on +a web page), and for a text font height of \fIfont_px\fR pixels (in +Mozilla) the correct formula is +.Sp +.Vb 1 +\& <dpi> = <font_px> * 72.27 / 10 [px * TeXpt/in / TeXpt] +.Ve +.Sp +The last division by ten is due to the standard font height 10pt in +your document, if you use 12pt, divide by 12. Unfortunately, some +proprietary browsers have font height in pt (points), not pixels. You +have to rescale that to pixels, using the screen resolution (default +is usually 96 dpi) which means the formula is +.Sp +.Vb 1 +\& <font_px> = <font_pt> * 96 / 72 [pt * px/in / (pt/in)] +.Ve +.Sp +On some high-res screens, the value is instead 120 dpi. Good luck! +.IP "\fB\-\-depth*\fR" 4 +.IX Item "--depth*" +Report the depth of the image. This only works reliably when the +LaTeX style \fIpreview.sty\fR from preview-latex is used with +the \fBactive\fR option. It reports the number of pixels from the +bottom of the image to the baseline of the image. This can be used for +vertical positioning of the image in, e.g., web documents, where one +would use (Cascading StyleSheets 1) +.Sp +.Vb 1 +\& <IMG SRC="<filename.png>" STYLE="vertical\-align: \-<depth>px"> +.Ve +.Sp +The depth is a negative offset in this case, so the minus sign is +necessary, and the unit is pixels (px). +.IP "\fB\-\-dvinum*\fR" 4 +.IX Item "--dvinum*" +Set this option to make the output page number be the TeX page +numbers rather than the physical page number. See the \fB\-o\fR switch. +.IP "\fB\-fg\fR \fIcolor_spec\fR" 4 +.IX Item "-fg color_spec" +Choose foreground color for the images. This option will be ignored if +there is a foreground color \especial in the \s-1DVI.\s0 The color spec should +be in TeX color \especial syntax, e.g., 'rgb 1.0 0.0 0.0'. +.IP "\fB\-\-follow*\fR" 4 +.IX Item "--follow*" +Wait for data at end-of-file. One of the benefits of dvipng is that it +does not read the postamble, so it can be started before TeX +finishes. This switch makes dvipng wait at end-of-file for further +output, unless it finds the \s-1POST\s0 marker that indicates the end of the +\&\s-1DVI.\s0 This is similar to \fBtail \-f\fR but for DVI-to-PNG conversion. +.IP "\fB\-\-freetype*\fR" 4 +.IX Item "--freetype*" +Enable/disable FreeType font rendering (default on). This option is +available if the FreeType2 font library was present at compilation time. +If this is the case, dvipng will have direct support for PostScript +Type1 and TrueType fonts internally, rather than using \fBgsftopk\fR +for rendering the fonts. If you have PostScript versions of Computer +Modern installed, there will be no need to generate bitmapped (\s-1PK\s0) +variants on disk of these. Then, you can render images at different (and +unusual) resolutions without cluttering the disk with lots of bitmapped +fonts. +One reason to disable FreeType font rendering would be to generate +identical output on different platforms, since FreeType uses the native +renderer and therefore can give slightly different output on each platform. +.IP "\fB\-\-gamma\fR \fInum\fR" 4 +.IX Item "--gamma num" +Control the interpolation of colors in the greyscale anti-aliasing +color palette. Default value is 1.0. For 0 < \fInum\fR < 1, the +fonts will be lighter (more like the background), and for \fInum\fR > +1, the fonts will be darker (more like the foreground). +.IP "\fB\-\-gif*\fR" 4 +.IX Item "--gif*" +The images are output in the \s-1GIF\s0 format, if \s-1GIF\s0 support is enabled. +This is the default for the \fBdvigif\fR binary, which only will be +available when \s-1GIF\s0 support is enabled. \s-1GIF\s0 images are palette images +(see the \fB\-\-palette\fR option) and does not support true alpha +channels (see the \fB\-\-bg\fR option). See also the \fB\-\-png\fR +option. +.IP "\fB\-\-height*\fR" 4 +.IX Item "--height*" +Report the height of the image. This only works reliably when the +LaTeX style \fIpreview.sty\fR from preview-latex is used with +the \fBactive\fR option. It reports the number of pixels from the top +of the image to the baseline of the image. The total height of the +image is obtained as the sum of the values reported from +\&\fB\-\-height\fR and \fB\-\-depth\fR. +.IP "\fB\-l [=]\fR\fInum\fR" 4 +.IX Item "-l [=]num" +The last page printed will be the first one numbered \fInum\fR. Default +is the last page in the document. If \fInum\fR is prefixed by an equals +sign, then it (and the argument to the \fB\-p\fR option, if specified) +is treated as a physical (absolute) page number, rather than a value to +compare with the TeX \fB\ecount0\fR values stored in the \s-1DVI\s0 file. +Thus, using \fB\-l =9\fR will end with the ninth page of the document, +no matter what the pages are actually numbered. +.IP "\fB\-\-mode\fR \fImode\fR" 4 +.IX Item "--mode mode" +This option only has an effect when using bitmapped (\s-1PK\s0) fonts. Use +\&\fImode\fR as the Metafont device name for the \s-1PK\s0 fonts (both for path +searching and font generation). This needs to be augmented with the base +device resolution, given with the \fB\-\-bdpi\fR option. See the file +<\fBftp://ftp.tug.org/tex/modes.mf\fR> for a list of resolutions and mode +names for most devices. +.IP "\fB\-M*\fR" 4 +.IX Item "-M*" +This option only has an effect when using bitmapped (\s-1PK\s0) fonts. It turns +off automatic \s-1PK\s0 font generation (\fImktexpk\fR). +.IP "\fB\-\-nogs*\fR" 4 +.IX Item "--nogs*" +This switch prohibits the internal call to GhostScript for displaying +PostScript specials. \fB\-\-nogs0\fR turns the call back on. +.IP "\fB\-\-nogssafer*\fR" 4 +.IX Item "--nogssafer*" +Normally, if GhostScript is used to render PostScript specials, the +GhostScript interpreter is run with the option \fB\-dSAFER\fR. The +\&\fB\-\-nogssafer\fR option runs GhostScript without \fB\-dSAFER\fR. The +\&\fB\-dSAFER\fR option in Ghostscript disables PostScript operators such +as deletefile, to prevent possibly malicious PostScript programs from +having any effect. +.IP "\fB\-\-norawps*\fR" 4 +.IX Item "--norawps*" +Some packages generate raw PostScript specials, even non-rendering such +specials. This switch turns off the internal call to GhostScript +intended to display these raw PostScript specials. \fB\-\-norawps0\fR +turns the call back on. +.IP "\fB\-o\fR \fIname\fR" 4 +.IX Item "-o name" +Send output to the file \fIname\fR. A single occurrence of \fB\f(CB%d\fB\fR or +\&\fB\f(CB%01d\fB\fR, ..., \fB\f(CB%09d\fB\fR will be exchanged for the physical +page number (this can be changed, see the \fB\-\-dvinum\fR switch). The +default output filename is \fIfile\fR\fB\f(CB%d\fB.png\fR where the input \s-1DVI\s0 +file was \fIfile\fR\fB.dvi\fR. +.IP "\fB\-O\fR \fIx\-offset\fR\fB,\fR\fIy\-offset\fR" 4 +.IX Item "-O x-offset,y-offset" +Move the origin by \fIx\-offset\fR,\fIy\-offset\fR, a comma-separated +pair of dimensions such as \fB.1in,\-.3cm\fR. +The origin of the page is shifted from the default position +(of one inch down, one inch to the right from the upper left corner of +the paper) by this amount. +.IP "\fB\-p [=]\fR\fInum\fR" 4 +.IX Item "-p [=]num" +The first page printed will be the first one numbered \fInum\fR. Default +is the first page in the document. If \fInum\fR is prefixed by an +equals sign, then it (and the argument to the \fB\-l\fR option, if +specified) is treated as a physical (absolute) page number, rather than +a value to compare with the TeX \fB\ecount0\fR values stored in the +\&\s-1DVI\s0 file. Thus, using \fB\-p =3\fR will start with the third page of +the document, no matter what the pages are actually numbered. +.IP "\fB\-\-palette*\fR" 4 +.IX Item "--palette*" +When an external image is included, \fBdvipng\fR will automatically +switch to truecolor mode, to avoid unnecessary delay and quality +reduction, and enable the \s-1EPS\s0 translator to draw on a transparent +background and outside of the boundingbox. This switch will force +palette (256\-color) output and make \fBdvipng\fR revert to opaque +clipped image inclusion. This will also override the \fB\-\-truecolor\fR +switch if present. +.IP "\fB\-\-picky*\fR" 4 +.IX Item "--picky*" +No images are output when a warning occurs. Normally, dvipng will +output an image in spite of a warning, but there may be something +missing in this image. One reason to use this option would be if you +have a more complete but slower fallback converter. Mainly, this is +useful for failed figure inclusion and unknown \especial occurrences, +but warnings will also occur for missing or unknown color specs and +missing \s-1PK\s0 fonts. +.IP "\fB\-\-png*\fR" 4 +.IX Item "--png*" +The images are output in the \s-1PNG\s0 format. This is the default for the +\&\fBdvipng\fR binary. See also the \fB\-\-gif\fR option. +.IP "\fB\-pp\fR \fIfirstpage\fR\fB\-\fR\fIlastpage\fR" 4 +.IX Item "-pp firstpage-lastpage" +Print pages \fIfirstpage\fR through \fIlastpage\fR; but not quite +equivalent to \fB\-p\fR \fIfirstpage\fR \fB\-l\fR \fIlastpage\fR. For example, +when rendering a book, there may be several instances of a page in the +\&\s-1DVI\s0 file (one in \f(CW\*(C`\efrontmatter\*(C'\fR, one in \f(CW\*(C`\emainmatter\*(C'\fR, and one +in \f(CW\*(C`\ebackmatter\*(C'\fR). In case of several pages matching, \fB\-pp\fR +\&\fIfirstpage\fR\fB\-\fR\fIlastpage\fR will render \fIall\fR pages that +matches the specified range, while \fB\-p\fR \fIfirstpage\fR \fB\-l\fR +\&\fIlastpage\fR will render the pages from the \fIfirst\fR occurrence +of \fIfirstpage\fR to the \fIfirst\fR occurrence of \fIlastpage\fR. +This is the (undocumented) behaviour of dvips. In dvipng you can give +both kinds of options, in which case you get all pages that matches the +range in \fB\-pp\fR between the pages from \fB\-p\fR to \fB\-l\fR. Also +multiple \fB\-pp\fR options accumulate, unlike \fB\-p\fR and \fB\-l\fR. +The \fB\-\fR separator can also be \fB:\fR. Note that \fB\-pp \-1\fR +will be interpreted as \*(L"all pages up to and including 1\*(R", if you want a +page numbered \-1 (only the table of contents, say) put \fB\-pp \-1\-\-1\fR, +or more readable, \fB\-pp \-1:\-1\fR. +.IP "\fB\-q*\fR" 4 +.IX Item "-q*" +Run quietly. Don't chatter about pages converted, etc. to standard +output; report no warnings (only errors) to standard error. +.IP "\fB\-Q\fR \fInum\fR" 4 +.IX Item "-Q num" +Set the quality to \fInum\fR. That is, choose the number of antialiasing +levels for bitmapped fonts (\s-1PK\s0), to be +\&\fInum\fR*\fInum\fR+1. The default value is 4 which gives 17 levels of +antialiasing for antialiased fonts from these two. If FreeType is +available, its rendering is unaffected by this option. +.IP "\fB\-r*\fR" 4 +.IX Item "-r*" +Toggle output of pages in reverse/forward order. By default, the first +page in the \s-1DVI\s0 is output first. +.IP "\fB\-\-strict*\fR" 4 +.IX Item "--strict*" +The program exits when a warning occurs. Normally, dvipng will output +an image in spite of a warning, but there may be something missing in +this image. One reason to use this option would be if you have a more +complete but slower fallback converter. See the \fB\-\-picky\fR option +above for a list of when warnings occur. +.IP "\fB\-T\fR \fIimage_size\fR" 4 +.IX Item "-T image_size" +Set the image size to \fIimage_size\fR which can be either of +\&\fBbbox\fR, \fBtight\fR, or a comma-separated pair of dimensions +\&\fIhsize\fR,\fIvsize\fR such as \fB.1in,.3cm\fR. The default is +\&\fBbbox\fR which produces a \s-1PNG\s0 that includes all ink put on the page +and in addition the \s-1DVI\s0 origin, located 1in from the top and 1in from +the left edge of the paper. This usually gives whitespace above and to +the left in the produced image. The value \fBtight\fR will make dvipng +only include all ink put on the page, producing neat images. +.IP "\fB\-\-truecolor*\fR" 4 +.IX Item "--truecolor*" +This will make \fBdvipng\fR generate truecolor output. Note that +truecolor output is automatic if you include an external image in your +\&\s-1DVI,\s0 e.g., via a PostScript special (i.e., the \fBgraphics\fR or +\&\fBgraphicx\fR package). This switch is overridden by the +\&\fB\-\-palette\fR switch. +.IP "\fB\-v*\fR" 4 +.IX Item "-v*" +Enable verbose operation. This will currently indicate what fonts is +used, in addition to the usual output. +.IP "\fB\-\-width*\fR" 4 +.IX Item "--width*" +Report the width of the image. See also \fB\-\-height\fR and +\&\fB\-\-depth\fR. +.IP "\fB\-x\fR \fInum\fR" 4 +.IX Item "-x num" +This option is deprecated; it should not be used. It is much better to +select the output resolution directly with the \fB\-D\fR option. This +option sets the magnification ratio to \fInum\fR/1000 and +overrides the magnification specified in the \s-1DVI\s0 file. Must be between +10 and 100000. It is recommended that you use standard magstep values +(1095, 1200, 1440, 1728, 2074, 2488, 2986, and so on) to help reduce the +total number of \s-1PK\s0 files generated. \fInum\fR may be a real number, not +an integer, for increased precision. +.IP "\fB\-z\fR \fInum\fR" 4 +.IX Item "-z num" +Set the \s-1PNG\s0 compression level to \fInum\fR. This option is enabled if +your \fBlibgd\fR is new enough. The default compression level is 1, +which selects maximum speed at the price of slightly larger PNGs. For an +older \fBlibgd\fR, the hard-soldered value 5 is used. The include file +\&\fBpng.h\fR says +\&\*(L"Currently, valid values range from 0 \- 9, corresponding directly to +the zlib compression levels 0 \- 9 (0 \- no compression, 9 \- \*(R"maximal\*(L" +compression). Note that tests have shown that zlib compression levels +3\-6 usually perform as well as level 9 for \s-1PNG\s0 images, and do +considerably fewer calculations. In the future, these values may not +correspond directly to the zlib compression levels.\*(R" +.SH "NOTES" +.IX Header "NOTES" +The full manual is accessible in info format, on most systems by typing +.PP +.Vb 1 +\& info dvipng +.Ve +.SH "COPYRIGHT" +.IX Header "COPYRIGHT" +This program is released under the \s-1GNU\s0 Lesser General Public License +version 3, see the \s-1COPYING\s0 file in the dvipng distribution or +<\fBhttp://www.gnu.org/licenses/gpl.html\fR>. +.PP +Copyright (c) 2002\-2015, 2019 Jan-AAke Larsson diff --git a/Build/source/texk/dvipng/doc/dvipng.help b/Build/source/texk/dvipng/doc/dvipng.help new file mode 100644 index 00000000000..b8cd13354a3 --- /dev/null +++ b/Build/source/texk/dvipng/doc/dvipng.help @@ -0,0 +1,43 @@ +This is ./dvipng 1.17 Copyright 2002-2015, 2019 Jan-Ake Larsson + +Usage: ./dvipng [OPTION]... FILENAME[.dvi] +Options are chosen to be similar to dvips' options where possible: + -d # Debug (# is the debug bitmap, 1 if not given) + -D # Output resolution + -l # Last page to be output + -o f Output file, '%d' is pagenumber + -O c Image offset + -p # First page to be output + -pp #,#.. Page list to be output + -q* Quiet operation + -T c Image size (also accepts '-T bbox' and '-T tight') + -v* Verbose operation + - Interactive query of options + +These do not correspond to dvips options: + -bd # Transparent border width in dots + -bd s Transparent border fallback color (TeX-style color) + -bg s Background color (TeX-style color or 'Transparent') + --depth* Output the image depth on stdout + --dvinum* Use TeX page numbers in output filenames + -fg s Foreground color (TeX-style color) + --follow* Wait for data at end-of-file + --freetype* FreeType font rendering (preferred, default on) + --gamma # Control color interpolation + --gif Output GIF images (dvigif default) + --height* Output the image height on stdout + --nogs* Don't use ghostscript for PostScript specials + --nogssafer* Don't use -dSAFER in ghostscript calls + --norawps* Don't convert raw PostScript specials + --palette* Force palette output + --picky When a warning occurs, don't output image + --png Output PNG images (dvipng default) + --strict When a warning occurs, exit + --truecolor* Truecolor output + -Q # Quality (PK subsampling) + --width* Output the image width on stdout + -z # PNG compression level + + # = number f = file s = string * = suffix, '0' to turn off + c = comma-separated dimension pair (e.g., 3.2in,-32.1cm) + diff --git a/Build/source/texk/dvipng/doc/dvipng.info b/Build/source/texk/dvipng/doc/dvipng.info new file mode 100644 index 00000000000..142b5b9f9e4 --- /dev/null +++ b/Build/source/texk/dvipng/doc/dvipng.info @@ -0,0 +1,1101 @@ +This is dvipng.info, produced by makeinfo version 5.1 from dvipng.texi. + +INFO-DIR-SECTION TeX +START-INFO-DIR-ENTRY +* DVI-to-PNG: (dvipng). Translating TeX DVI files to Portable Network Graphics (PNG). +* dvipng: (dvipng). A DVI-to-PNG translator. +END-INFO-DIR-ENTRY + + +File: dvipng.info, Node: Top, Next: Introduction, Up: (dir) + +dvipng +****** + +This manual documents dvipng, a program to translate a DVI (DeVice +Independent) file into PNG (Portable Network Graphics). + + This file documents dvipng version 1.17 + + Corrections or perhaps rewrites of sections are _very welcome_. + + Jan-AAke Larsson + +* Menu: + +* Introduction:: Introduction +* Installation:: How to compile and install dvipng +* Basic usage:: First things first +* Command-line options:: Advanced usage +* Graphics:: Including PostScript and/or bitmaps +* Color:: Using color with dvipng +* Diagnosing problems:: Problems? +* Credits:: People who have contributed +* Copying:: GNU Lesser General Public License +* Index:: General index + + +File: dvipng.info, Node: Introduction, Next: Installation, Prev: Top, Up: Top + +1 Introduction +************** + +This program makes PNG and/or GIF graphics from DVI files as obtained +from TeX and its relatives. + + If GIF support is enabled, GIF output is chosen by using the 'dvigif' +binary or with the '--gif' option. + + It is intended to produce anti-aliased screen-resolution images as +fast as is possible. The target audience is people who need to generate +and regenerate many images again and again. The primary target is the +preview-latex (X)Emacs package, a package to preview formulas from +within (X)Emacs. Yes, you get to see your formulas in the (X)Emacs +buffer, see <http://www.gnu.org/software/auctex/preview-latex.html>. + + Another example is WeBWorK, an internet-based method for delivering +homework problems to students over the internet, giving students instant +feedback as to whether or not their answers are correct, see +<http://webwork.math.rochester.edu>. + + A more recent addition to the dvipng-using applications out there is +MediaWiki, the software behind Wikipedia and many other wikis out there. +Dvipng is used to render mathematical formulae from version 1.8.0 of +MediaWiki, see <http://www.mediawiki.org>. + + Other applications may also benefit, like web applications as +latex2html and WYSIWYG editors like LyX. + + The benefits of 'dvipng'/'dvigif' include + + * Speed. It is a very fast bitmap-rendering code for DVI files, + which makes it suitable for generating large amounts of images + on-the-fly, as needed in preview-latex, WeBWorK and others. + + * It does not read the postamble, so it can be started before TeX + finishes. There is a '--follow' switch that makes dvipng wait at + end-of-file for further output, unless it finds the POST marker + that indicates the end of the DVI. + + * Interactive query of options. dvipng can read options + interactively through stdin, and all options are usable. It is + even possible to change the input file through this interface. + + * Supports PK, VF, PostScript Type1, and TrueType fonts, subfonts + (i.e., as used in CJK-LaTeX), color specials, and inclusion of + PostScript, PNG, JPEG or GIF images. + + * and more... + + +File: dvipng.info, Node: Installation, Next: Basic usage, Prev: Introduction, Up: Top + +2 Installation +************** + +Installing dvipng should be simple: merely './configure', 'make', and +'make install'. + +* Menu: + +* Prerequisites:: +* Configure:: +* Build/install:: +* Installation outside the texmf tree:: +* Advice for non-privileged users:: + + +File: dvipng.info, Node: Prerequisites, Next: Configure, Up: Installation + +2.1 Prerequisites +================= + + * The GD Graphics Draw library, libgd + + The drawing library 'libgd' is necessary, and is downloadable at + <https://bitbucket.org/libgd/gd-libgd/downloads>, and there are + binary packages for most operating systems from their respective + distributors. In any case, the library installs using 'autoconf' + so it should not be difficult for you to install it from source, + and then proceed with installing dvipng. + + * The path-searching library kpathsea + + Kpathsea is most likely included in your LaTeX installation, but it + may happen that ./configure does not find it; see below. If you do + not have it, download it from <http://www.ctan.org> and compile it. + I have no experience with this, so I cannot help much here. + + * The font-rendering library FreeType 2 + + While not strictly necessary, a recent FreeType 2 is recommended + since dvipng currently will produce better-quality images when this + library is available. To take advantage of this, you should have + at least FreeType 2.1.9. + + FreeType 2 will enable direct support for PostScript and TrueType + fonts, so that dvipng will not need to generate bitmapped variants + on disk of the TeX fonts since modern TeX distributions include + PostScript versions of them. Then, you can render images at + different (and unusual) resolutions without cluttering the disk + with lots of bitmapped fonts. + + Finally, it will enable subfont support in dvipng. That is, if you + want to render CJK-LaTeX characters, you must have FreeType 2 + installed. + + * libpng and libz + + To be able to compress and write PNG files to disk, dvipng (or + really libgd) uses libpng which in turn uses libz. These should be + available on any modern system, if not, download them and install + them. + + * The 'texinfo' package + + This is needed for building the documentation. + + +File: dvipng.info, Node: Configure, Next: Build/install, Prev: Prerequisites, Up: Installation + +2.2 Configure +============= + +The first step is to configure the source code, telling it where various +files will be. To do so, run + + ./configure OPTIONS + + (Note: if you have fetched dvipng from CVS rather than a regular +release, you will have to first generate './configure' by running +'autoconf' 2.53 or later.) + + On many machines, you will not need to specify any options, but if +'configure' cannot determine something on its own, you'll need to help +it out. For a list of the options type + + ./configure --help + + On some machines, the libraries will be installed in directories that +are not in the linker's search path. This will generate an error when +running './configure', indicating that it cannot find libgd or +libkpathsea (most likely). You then need to specify the path to the +respective library's object files. They are typically called e.g., +'libgd.a' or 'libgd.so'. If they are located in e.g., '/sw/local/lib', +do + + ./configure LDFLAGS=-L/sw/local/lib + + If the library is available as a shared object file ('.so'), the +runtime linker may also need to be told where to find the library, then +use + + ./configure LDFLAGS='-L/sw/local/lib -R/sw/local/lib' + + When either of these is necessary, it is likely that the C header +files are also installed in directories that are not in the C +preprocessor's search path. This will also generate an error when +running './configure', indicating that it cannot find e.g., 'gd.h' or +'kpathsea.h' (most likely). You then need to specify the path to the +respective library's C header files. If they are located in e.g., +'/sw/local/include', do + + ./configure CPPFLAGS=-I/sw/local/include + + On my SUN Solaris workstation, I had to combine this into + + ./configure CPPFLAGS='-I/sw/local/include -I/sw/tex/teTeX/1.0/include'\ + LDFLAGS='-L/sw/local/lib -R/sw/local/lib -L/sw/tex/teTeX/1.0/lib/' + +where the backslash denotes a continuation of the line. + + +File: dvipng.info, Node: Build/install, Next: Installation outside the texmf tree, Prev: Configure, Up: Installation + +2.3 Build/install +================= + +Once 'configure' has been run, simply enter + + make + +at the prompt to compile the C code, and build the documentation files. +To install the files into the locations chosen earlier, type + + make install + +You may need special privileges to install, e.g., if you are installing +into system directories. + + +File: dvipng.info, Node: Installation outside the texmf tree, Next: Advice for non-privileged users, Prev: Build/install, Up: Installation + +2.4 Installation outside the texmf tree +======================================= + +In some cases, a dvipng binary installed outside the texmf tree will not +be able to find virtual fonts, or the PostScript font maps (normally +used by dvips). This may be because _only_ $SELFAUTOLOC, $SELFAUTODIR, +and $SELFAUTOPARENT are used in the texmf tree configuration file +'texmf.cnf'. If so, give the switch '--enable-selfauto-set' to +'./configure'. This will make dvipng adjust these three internally so +that kpathsea thinks that dvipng _is_ installed in the texmf tree. + + +File: dvipng.info, Node: Advice for non-privileged users, Prev: Installation outside the texmf tree, Up: Installation + +2.5 Installation for non-privileged users +========================================= + +Often people without system administration privileges want to install +software for their private use. In that case you need to specify more +options to the 'configure' script, usually this is done by using the +'--prefix' option to the 'configure' script, and let it point to the +personal home directory. In that way, resulting binaries will be +installed under the 'bin' subdirectory of your home directory, manual +pages under 'man' and so on. That way, it is reasonably easy to +maintain a bunch of additional packages, since the prefix argument is +supported by most 'configure' scripts. + + You'll have to add something like '/home/myself/bin' to your 'PATH' +shell variable, if it isn't there already, and similarly set the +'INFOPATH' and 'MANPATH' variables to be able to access the +documentation. + + +File: dvipng.info, Node: Basic usage, Next: Command-line options, Prev: Installation, Up: Top + +3 Basic usage of dvipng +*********************** + +To use dvipng at its simplest, simply type + + dvipng foo + +where 'foo.dvi' is the output of TeX that you want to convert to PNG +format. If there are four pages in 'foo.dvi', those pages will be +output as 'foo1.png', 'foo2.png', 'foo3.png', and 'foo4.png', +respectively. + + If you have enabled the PostScript font support (via FreeType), fonts +will be rendered as they are needed. Otherwise, dvipng will use +bitmapped (PK) fonts, and if you use PK fonts that have not been used on +your system before, they may be automatically generated; this process +can take a few minutes, so progress reports appear by default. The next +time the same font is used, it will have been saved on disk, so +rendering will go much faster. (If dvipng tries to endlessly generate +the same fonts over and over again, something is wrong. *Note +(kpathsea)Unable to generate fonts::.) + + Many options are available (see the next section). For a brief +summary of available options, just type + + dvipng --help + + +File: dvipng.info, Node: Command-line options, Next: Graphics, Prev: Basic usage, Up: Top + +4 Command-line options +********************** + +dvipng has a plethora of command line options. Reading through this +section will give a good idea of the capabilities of the driver. + +* Menu: + +* Option summary:: Quick listing, from dvipng -help. +* Option details:: More information about each option. + + +File: dvipng.info, Node: Option summary, Next: Option details, Up: Command-line options + +4.1 Option summary +================== + +Here is a handy summary of the options; it is printed out when you run +dvipng with no arguments or with the standard '--help' option. + + This is ./dvipng 1.17 Copyright 2002-2015, 2019 Jan-Ake Larsson + + Usage: ./dvipng [OPTION]... FILENAME[.dvi] + Options are chosen to be similar to dvips' options where possible: + -d # Debug (# is the debug bitmap, 1 if not given) + -D # Output resolution + -l # Last page to be output + -o f Output file, '%d' is pagenumber + -O c Image offset + -p # First page to be output + -pp #,#.. Page list to be output + -q* Quiet operation + -T c Image size (also accepts '-T bbox' and '-T tight') + -v* Verbose operation + - Interactive query of options + + These do not correspond to dvips options: + -bd # Transparent border width in dots + -bd s Transparent border fallback color (TeX-style color) + -bg s Background color (TeX-style color or 'Transparent') + --depth* Output the image depth on stdout + --dvinum* Use TeX page numbers in output filenames + -fg s Foreground color (TeX-style color) + --follow* Wait for data at end-of-file + --freetype* FreeType font rendering (preferred, default on) + --gamma # Control color interpolation + --gif Output GIF images (dvigif default) + --height* Output the image height on stdout + --nogs* Don't use ghostscript for PostScript specials + --nogssafer* Don't use -dSAFER in ghostscript calls + --norawps* Don't convert raw PostScript specials + --palette* Force palette output + --picky When a warning occurs, don't output image + --png Output PNG images (dvipng default) + --strict When a warning occurs, exit + --truecolor* Truecolor output + -Q # Quality (PK subsampling) + --width* Output the image width on stdout + -z # PNG compression level + + # = number f = file s = string * = suffix, '0' to turn off + c = comma-separated dimension pair (e.g., 3.2in,-32.1cm) + + +File: dvipng.info, Node: Option details, Prev: Option summary, Up: Command-line options + +4.2 Option details +================== + +Many of the parameterless options listed here can be turned off by +suffixing the option with a zero ('0'); for instance, to turn off page +reversal, use '-r0'. Such options are marked with a trailing '*'. + +'-' + Read additional options from standard input after processing the + command line. + +'--help' + Print a usage message and exit. + +'--version' + Print the version number and exit. + +'-bd NUM' +'-bd COLOR_SPEC' +'-bd 'NUM COLOR_SPEC'' + Set the pixel width of the transparent border (default 0). Using + this option will make the image edges transparent, but it only + affects pixels with the background color. Giving a COLOR_SPEC will + set the fallback color, to be used in viewers that cannot handle + transparency (the default is the background color). The color spec + should be in TeX color \special syntax, e.g., 'rgb 1.0 0.0 0.0'. + Setting the fallback color makes the default border width 1 px. + *Note Color::. + +'--bdpi NUM' + This option only has an effect when using bitmapped (PK) fonts. + The option sets the base (Metafont) resolution, both horizontal and + vertical, to NUM dpi (dots per inch). This option is necessary + when manually selecting Metafont mode with the -mode option (see + below). + +'-bg COLOR_SPEC' + Choose background color for the images. This option will be + ignored if there is a background color \special in the DVI. The + color spec should be in TeX color \special syntax, e.g., 'rgb 1.0 + 0.0 0.0'. You can also specify 'Transparent' or 'transparent' + which will give you a transparent background with the normal + background as a fallback color. A capitalized 'Transparent' will + give a full-alpha transparency, while an all-lowercase + 'transparent' will give a simple fully transparent background with + non-transparent antialiased pixels. The latter would be suitable + for viewers who cannot cope with a true alpha channel. GIF images + do not support full alpha transparency, so in case of GIF output, + both variants will use the latter behaviour. *Note Color::. + +'-d NUM' + Set the debug flags, showing what dvipng (thinks it) is doing. + This will work unless dvipng has been compiled without the 'DEBUG' + option (not recommended). Set the flags as you need them, use '-d + -1' as the first option for maximum output. *Note Debug options::. + +'-D NUM' + Set the output resolution, both horizontal and vertical, to NUM dpi + (dots per inch). + + One may want to adjust this to fit a certain text font size (e.g., + on a web page), and for a text font height of FONT_PX pixels (in + Mozilla) the correct formula is + DPI = FONT_PX * 72.27 / 10 [px * TeXpt/in / TeXpt] + The last division by ten is due to the standard font height 10pt in + your document, if you use 12pt, divide by 12. Unfortunately, some + proprietary browsers have font height in pt (points), not pixels. + You have to rescale that to pixels, using the screen resolution + (default is usually 96 dpi) which means the formula is + FONT_PX = FONT_PT * 96 / 72 [pt * px/in / (pt/in)] + On some high-res screens, the value is instead 120 dpi. Good luck! + +'--depth*' + Report the depth of the image. This only works reliably when the + LaTeX style 'preview.sty' from preview-latex is used with the + 'active' option. It reports the number of pixels from the bottom + of the image to the baseline of the image. This can be used for + vertical positioning of the image in, e.g., web documents, where + one would use (Cascading StyleSheets 1) + <IMG SRC="FILENAME.PNG" STYLE="vertical-align: -DEPTHpx"> + The depth is a negative offset in this case, so the minus sign is + necessary, and the unit is pixels (px). + +'--dvinum*' + Set this option to make the output page number be the TeX page + numbers rather than the physical page number. See the '-o' switch. + +'-fg COLOR_SPEC' + Choose foreground color for the images. This option will be + ignored if there is a foreground color \special in the DVI. The + color spec should be in TeX color \special syntax, e.g., 'rgb 1.0 + 0.0 0.0'. *Note Color::. + +'--follow*' + Wait for data at end-of-file. One of the benefits of dvipng is + that it does not read the postamble, so it can be started before + TeX finishes. This switch makes dvipng wait at end-of-file for + further output, unless it finds the POST marker that indicates the + end of the DVI. This is similar to 'tail -f' but for DVI-to-PNG + conversion. + +'--freetype*' + Enable/disable FreeType font rendering (default on). This option + is available if the FreeType2 font library was present at + compilation time. If this is the case, dvipng will have direct + support for PostScript Type1 and TrueType fonts internally, rather + than using 'gsftopk' for rendering the fonts. If you have + PostScript versions of Computer Modern installed, there will be no + need to generate bitmapped (PK) variants on disk of these. Then, + you can render images at different (and unusual) resolutions + without cluttering the disk with lots of bitmapped fonts. One + reason to disable FreeType font rendering would be to generate + identical output on different platforms, since FreeType uses the + native renderer and therefore can give slightly different output on + each platform. + +'--gamma NUM' + Control the interpolation of colors in the greyscale anti-aliasing + color palette. Default value is 1.0. For 0 < NUM < 1, the fonts + will be lighter (more like the background), and for NUM > 1, the + fonts will be darker (more like the foreground). + +'--gif*' + The images are output in the GIF format, if GIF support is enabled. + This is the default for the 'dvigif' binary, which only will be + available when GIF support is enabled. GIF images are palette + images (see the '--palette' option) and does not support true alpha + channels (see the '--bg' option). See also the '--png' option. + +'--height*' + Report the height of the image. This only works reliably when the + LaTeX style 'preview.sty' from preview-latex is used with the + 'active' option. It reports the number of pixels from the top of + the image to the baseline of the image. The total height of the + image is obtained as the sum of the values reported from '--height' + and '--depth'. + +'-l [=]NUM' + The last page printed will be the first one numbered NUM. Default + is the last page in the document. If NUM is prefixed by an equals + sign, then it (and the argument to the '-p' option, if specified) + is treated as a physical (absolute) page number, rather than a + value to compare with the TeX '\count0' values stored in the DVI + file. Thus, using '-l =9' will end with the ninth page of the + document, no matter what the pages are actually numbered. + +'--mode MODE' + This option only has an effect when using bitmapped (PK) fonts. + Use MODE as the Metafont device name for the PK fonts (both for + path searching and font generation). This needs to be augmented + with the base device resolution, given with the '--bdpi' option. + See the file <ftp://ftp.tug.org/tex/modes.mf> for a list of + resolutions and mode names for most devices. *Note + (kpathsea)Unable to generate fonts::. + +'-M*' + This option only has an effect when using bitmapped (PK) fonts. It + turns off automatic PK font generation ('mktexpk'). + +'--nogs*' + This switch prohibits the internal call to GhostScript for + displaying PostScript specials. '--nogs0' turns the call back on. + +'--nogssafer*' + Normally, if GhostScript is used to render PostScript specials, the + GhostScript interpreter is run with the option '-dSAFER'. The + '--nogssafer' option runs GhostScript without '-dSAFER'. The + '-dSAFER' option in Ghostscript disables PostScript operators such + as deletefile, to prevent possibly malicious PostScript programs + from having any effect. + +'--norawps*' + Some packages generate raw PostScript specials, even non-rendering + such specials. This switch turns off the internal call to + GhostScript intended to display these raw PostScript specials. + '--norawps0' turns the call back on. + +'-o NAME' + Send output to the file NAME. A single occurrence of '%d' or + '%01d', ..., '%09d' will be exchanged for the physical page number + (this can be changed, see the '--dvinum' switch). The default + output filename is 'FILE%d.png' where the input DVI file was + 'FILE.dvi'. + +'-O X-OFFSET,Y-OFFSET' + Move the origin by X-OFFSET,Y-OFFSET, a comma-separated pair of + dimensions such as '.1in,-.3cm'. The origin of the page is shifted + from the default position (of one inch down, one inch to the right + from the upper left corner of the paper) by this amount. + +'-p [=]NUM' + The first page printed will be the first one numbered NUM. Default + is the first page in the document. If NUM is prefixed by an equals + sign, then it (and the argument to the '-l' option, if specified) + is treated as a physical (absolute) page number, rather than a + value to compare with the TeX '\count0' values stored in the DVI + file. Thus, using '-p =3' will start with the third page of the + document, no matter what the pages are actually numbered. + +'--palette*' + When an external image is included, 'dvipng' will automatically + switch to truecolor mode, to avoid unnecessary delay and quality + reduction, and enable the EPS translator to draw on a transparent + background and outside of the boundingbox. This switch will force + palette (256-color) output and make 'dvipng' revert to opaque + clipped image inclusion. This will also override the '--truecolor' + switch if present. + +'--picky*' + No images are output when a warning occurs. Normally, dvipng will + output an image in spite of a warning, but there may be something + missing in this image. One reason to use this option would be if + you have a more complete but slower fallback converter. Mainly, + this is useful for failed figure inclusion and unknown \special + occurrences, but warnings will also occur for missing or unknown + color specs and missing PK fonts. + +'--png*' + The images are output in the PNG format. This is the default for + the 'dvipng' binary. See also the '--gif' option. + +'-pp FIRSTPAGE-LASTPAGE' + Print pages FIRSTPAGE through LASTPAGE; but not quite equivalent to + '-p FIRSTPAGE -l LASTPAGE'. For example, when rendering a book, + there may be several instances of a page in the DVI file (one in + '\frontmatter', one in '\mainmatter', and one in '\backmatter'). + In case of several pages matching, '-pp FIRSTPAGE-LASTPAGE' will + render _all_ pages that matches the specified range, while '-p + FIRSTPAGE -l LASTPAGE' will render the pages from the _first_ + occurrence of FIRSTPAGE to the _first_ occurrence of LASTPAGE. + This is the (undocumented) behaviour of dvips. In dvipng you can + give both kinds of options, in which case you get all pages that + matches the range in '-pp' between the pages from '-p' to '-l'. + Also multiple '-pp' options accumulate, unlike '-p' and '-l'. The + '-' separator can also be ':'. Note that '-pp -1' will be + interpreted as "all pages up to and including 1", if you want a + page numbered -1 (only the table of contents, say) put '-pp -1--1', + or more readable, '-pp -1:-1'. + +'-q*' + Run quietly. Don't chatter about pages converted, etc. to standard + output; report no warnings (only errors) to standard error. + +'-Q NUM' + Set the quality to NUM. That is, choose the number of antialiasing + levels for bitmapped fonts (PK), to be NUM*NUM+1. The default + value is 4 which gives 17 levels of antialiasing for antialiased + fonts from these two. If FreeType is available, its rendering is + unaffected by this option. + +'-r*' + Toggle output of pages in reverse/forward order. By default, the + first page in the DVI is output first. + +'--strict*' + The program exits when a warning occurs. Normally, dvipng will + output an image in spite of a warning, but there may be something + missing in this image. One reason to use this option would be if + you have a more complete but slower fallback converter. See the + '--picky' option above for a list of when warnings occur. + +'-T IMAGE_SIZE' + Set the image size to IMAGE_SIZE which can be either of 'bbox', + 'tight', or a comma-separated pair of dimensions HSIZE,VSIZE such + as '.1in,.3cm'. The default is 'bbox' which produces a PNG that + includes all ink put on the page and in addition the DVI origin, + located 1in from the top and 1in from the left edge of the paper. + This usually gives whitespace above and to the left in the produced + image. The value 'tight' will make dvipng only include all ink put + on the page, producing neat images. + +'--truecolor*' + This will make 'dvipng' generate truecolor output. Note that + truecolor output is automatic if you include an external image in + your DVI, e.g., via a PostScript special (i.e., the 'graphics' or + 'graphicx' package). This switch is overridden by the '--palette' + switch. + +'-v*' + Enable verbose operation. This will currently indicate what fonts + is used, in addition to the usual output. + +'--width*' + Report the width of the image. See also '--height' and '--depth'. + +'-x NUM' + This option is deprecated; it should not be used. It is much + better to select the output resolution directly with the '-D' + option. This option sets the magnification ratio to NUM/1000 and + overrides the magnification specified in the DVI file. Must be + between 10 and 100000. It is recommended that you use standard + magstep values (1095, 1200, 1440, 1728, 2074, 2488, 2986, and so + on) to help reduce the total number of PK files generated. NUM may + be a real number, not an integer, for increased precision. + +'-z NUM' + Set the PNG compression level to NUM. This option is enabled if + your 'libgd' is new enough. The default compression level is 1, + which selects maximum speed at the price of slightly larger PNGs. + For an older 'libgd', the hard-soldered value 5 is used. The + include file 'png.h' says + Currently, valid values range from 0 - 9, corresponding + directly to the zlib compression levels 0 - 9 (0 - no + compression, 9 - "maximal" compression). Note that tests have + shown that zlib compression levels 3-6 usually perform as well + as level 9 for PNG images, and do considerably fewer + calculations. In the future, these values may not correspond + directly to the zlib compression levels. + + +File: dvipng.info, Node: Graphics, Next: Color, Prev: Command-line options, Up: Top + +5 Graphics +********** + +'dvipng' attempts to handle graphics as included by the 'graphicx' and +'graphics' packages, without the need of specifying a driver to these +packages. This means that it recognizes the encapsulated postscript +inclusion meant for 'dvips', but is also able (from version 1.8) to +include bitmapped graphics. It also tries to handle some of the raw +PostScript that is output from various packages. Some of the +possibilities and problems are mentioned below. + +* Menu: + +* Encapsulated PostScript:: An internal call to GhostScript +* Bitmapped graphics:: PNG, JPEG and GIF +* Raw PostScript:: Ignore or give to GhostScript + + +File: dvipng.info, Node: Encapsulated PostScript, Next: Bitmapped graphics, Up: Graphics + +5.1 Encapsulated PostScript +=========================== + +When an EPS file is included, a call to GhostScript is performed to +produce a bitmapped image that can be included. The default is to +produce an image with transparent background, at the same size as the +DVI page currently being converted to PNG, and include that as +foreground on the PNG. Of course, if the image is to be cropped, that is +done. The included image will be a truecolor image, so for maximum +performance the output PNG will be in truecolor mode as well. + + This conversion needs the 'pngalpha' output device to be present in +your copy of GhostScript. If that device is not present, or you use the +'--palette' switch or request GIF output, the fallback is to use the +'png16m' device to produce a cropped opaque image for inclusion. Other +relevant switches are '--noghostscript' and '--nogssafer'. *Note Option +details::. + + The most common problem with including graphics is an incorrect +bounding box. Complain to whoever wrote the software that generated the +file if the bounding box is indeed incorrect. An adjusted boundingbox +can be specified in the '\includegraphics' call, as in this example +(using 'graphicx'): + + \includegraphics[bb=10 20 100 200]{imagename.eps} + + +File: dvipng.info, Node: Bitmapped graphics, Next: Raw PostScript, Prev: Encapsulated PostScript, Up: Graphics + +5.2 Bitmapped graphics +====================== + +dvipng can include PNG, JPEG and GIF graphics. When including such +images via '\includegraphics' you need to specify the bounding box since +TeX itself cannot read them from the files in question. The bounding +box size should be given as '0 0 w h' in pixels, e.g., if the file +'imagename.png' is 300x400 pixels, the inclusion would read + + \includegraphics[bb=0 0 300 400]{imagename.png} + + The default size is the image size in bp ("big points" in TeX +nomenclature or PostScript points as other people have it, 72 per inch). +That is, default resolution will be 72 dpi for included bitmaps, which +is the default size in the few other bitmap-capable drivers that are +known to me (dvipdfm and PDFLaTeX). + + If you want 100 dpi you need to specify the width accordingly. You +just divide your image width by 100: a 135 pixel wide image at 100 dpi +will take up 1.35 inches. If you want 200 dpi you divide by 200, and so +on. Simple, eh? The example above at 200 dpi would be 1.5 inches wide: + + \includegraphics[bb=0 0 300 400,witdh=1.5in]{imagename.png} + + +File: dvipng.info, Node: Raw PostScript, Prev: Bitmapped graphics, Up: Graphics + +5.3 Raw PostScript +================== + +dvipng attempts to handle raw PostScript. Rendering raw PostScript +specials is done on top of the page by including a transparent image +generated by the 'pngalpha' device in GhostScript (automatically +selecting 'truecolor' mode in dvipng). + + Included PostScript headers are respected, and if the header +'tex.pro' is included, dvipng also throws in 'color.pro' and +'special.pro'. The package 'xcolor' includes its own headers with color +names, and this is not only kept as a PostScript header, but is also +read and interpreted by dvipng itself. An attempt is also made to +respect the PGF header. The non-rendering specials from 'hyperref' are +handled via some heuristics and do not give an error. + + Really rendering and moving things with raw PostScript specials is +more troublesome. The \rotatebox macro serves as a good example. The +dvips driver of the graphicx package surrounds DVI glyphs with +PostScript code so that after conversion by dvips, the glyphs (now +themselves in PostScript) will be rotated in the desired way. dvipng +does not handle this, at present. An attempt has been made to handle +the rendering specials output by PGF (tikz), and also PSTricks. Some +things work, but others do not. This is especially clear when mixing +PostScript and DVI rendering commands such as glyphs. dvipng cannot at +present detect if PostScript code moves 'currentpoint' or rotates the +frame since GhostScript does not return such information. A +recommendation would be to produce images from these packages as EPS +files and include them into your document in the standard manner. + + Another way to handle this would be to use a slower fallback (with +dvips and gs, for example). If you want to disable raw PostScript +handling in dvipng, use the switch '--norawps'. This switch turns off +the internal call to GhostScript intended to display these raw +PostScript specials. Further, when dvipng encounters raw PostScript and +the gs call is turned off, it gives a warning. It is now possible to +use the switch '--picky' to disable page rendering of pages with +warnings, and use the slower fallback for these pages. + + +File: dvipng.info, Node: Color, Next: Diagnosing problems, Prev: Graphics, Up: Top + +6 Color +******* + +To support color, dvipng recognizes a certain set of specials as +generated by the 'color' and 'xcolor' style files. These specials start +with the keyword 'color' or the keyword 'background', followed by a +color specification. + +* Menu: + +* Color specifications:: +* Color specials:: + + +File: dvipng.info, Node: Color specifications, Next: Color specials, Up: Color + +6.1 Color specifications +======================== + +The color specification supported by dvipng is by-value or by-name. The +by-value spec starts with the name of a color model (one of 'rgb', +'hsb', 'cmy', 'cmyk', or 'gray') followed by the appropriate number of +parameters. Thus, the color specification 'rgb 0.3 0.4 0.5' would +correspond to the color that is '0.3 0.4 0.5' in its red, blue and green +values. The color model used internally in dvipng is 'RGB' (discretized +to 256 levels), for details on the formulas used in conversion, see the +'xcolor' documentation. + + By-name color specifications are single (case-dependent) words and +are compared with color names defined in 'dvipsnam.def' (from the +'graphics' bundle), 'svgnam.def' and 'xcolor.sty' (from the 'xcolor' +bundle). See the 'xcolor' documentation for a list of names and the +corresponding colors. + + On the command-line, the name 'Transparent' can also be used as an +argument to '--bg' to choose transparent background. *Note Option +details::. + + +File: dvipng.info, Node: Color specials, Prev: Color specifications, Up: Color + +6.2 Color specials +================== + +We will describe 'background' first, since it is the simplest. The +'background' keyword must be followed by a color specification. That +color specification is used as a fill color for the background. The +last 'background' special on a page is the one that gets used, and is +used for the whole of the page image. (This is possible because the +prescan phase of dvipng notices all of the color specials so that the +appropriate information can be written out during the second phase.) + + The 'color' special itself has three forms. The first is just +'color' followed by a color specification. In this case, the current +global color is set to that color; the color stack must be empty when +such a command is executed. + + The second form is 'color push' followed by a color specification. +This saves the current color on the color stack and sets the color to be +that given by the color specification. This is the most common way to +set a color. + + The final form of the 'color' special is just 'color pop', with no +color specification; this says to pop the color last pushed on the color +stack from the color stack and set the current color to be that color. + + dvipng correctly handles these color specials across pages, even when +the pages are rendered repeatedly or in reverse order. + + +File: dvipng.info, Node: Diagnosing problems, Next: Credits, Prev: Color, Up: Top + +7 Diagnosing problems +********************* + +You've gone through all the trouble of installing dvipng, carefully read +all the instructions in this manual, and still can't get something to +work. The following sections provide some helpful hints if you find +yourself in such a situation. + +* Menu: + +* Contact information:: Who to ask. +* Debug options:: Getting diagnostics. + + +File: dvipng.info, Node: Contact information, Next: Debug options, Up: Diagnosing problems + +7.1 Contact information +======================= + +Bug reports should be sent to <dvipng@nongnu.org>. + + Questions, suggestions for new features, pleas for help, and/or +praise should go to <dvipng@nongnu.org>. For more information on this +mailing list, send a message with just the word 'help' as subject or +body to <dvipng-request@nongnu.org> or look at +<http://lists.nongnu.org/mailman/listinfo/dvipng>. + + Offers to support further development will be appreciated. For +developer access, ask on <dvipng@nongnu.org>. + + For details on the TeX path-searching library, and 'mktexpk' +problems, *note (kpathsea)Common problems::. + + +File: dvipng.info, Node: Debug options, Prev: Contact information, Up: Diagnosing problems + +7.2 Debug options +================= + +The '-d' flag to dvipng helps in tracking down certain errors. The +parameter to this flag is an integer that tells what errors are +currently being tracked. To track a certain class of debug messages, +simply provide the appropriate number given below; if you wish to track +multiple classes, sum the numbers of the classes you wish to track. To +track all classes, you can use '-1'. + + Some of these debugging options are actually provided by Kpathsea +(*note (kpathsea)Debugging::). + + The classes are: +1 + Normal dvi op-codes +2 + Virtual fonts +4 + PK fonts +8 + TFM files +16 + Glyph rendering +32 + FreeType calls +64 + Encoding loads +128 + Color specials +256 + GhostScript specials +512 + Kpathsea 'stat' calls +1024 + Kpathsea hash table lookups +2048 + Kpathsea path element expansion +4096 + Kpathsea path searches + + +File: dvipng.info, Node: Credits, Next: Copying, Prev: Diagnosing problems, Up: Top + +8 Credits +********* + +A number of persons have contributed, if I forget to mention someone, I +apologize. First and foremost we have David Kastrup whose preview-latex +project provided the incentive to write this program. There is also a +number of people who have contributed by reporting bugs and suggesting +improvements as the thing has evolved. These include but is perhaps not +limited to (in semi-random order): Thomas Esser (teTeX), Christian +Schenk (MIKTeX), Brian R Furry (debian package), Angus Leeming (LyX), +Thomas Boutell (libgd), John Jones (first user report), Uwe Kern +(xcolor), Karl Berry and Peter Breitenlohner (TeX Live), David Harvey +(hinting in Freetype), Neal Harmon, Alan Shutko, Reiner Stieb, Nick +Alcock, Adam Buchbinder, Svend Tollak Munkejord, James Longstreet, +Bernhard Simon, Bob McElrath, Georg Schwarz, Jason Farmer, Brian V. +Smith, Samuel Hathaway, Thomas R. Shemanske, Stephen Gibson, Christian +Ridderstro"m, Ezra Peisach, William H Wheeler, Thomas Klausner, Harald +Koenig, Adrian Bunk, Kevin Smith, Jason Riedy, Wolfram Krause, Reinhard +Kotucha, Takeshi Abe, Waldeck Schutzer, Ahzo, and Andy Nguyen. + + +File: dvipng.info, Node: Copying, Next: Index, Prev: Credits, Up: Top + +9 Copying +********* + +This program is free software: you can redistribute it and/or modify it +under the terms of the GNU Lesser General Public License as published by +the Free Software Foundation, either version 3 of the License, or (at +your option) any later version. + + This program is distributed in the hope that it will be useful, but +WITHOUT ANY WARRANTY; without even the implied warranty of +MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU Lesser +General Public License for more details. + + You should have received a copy of the GNU Lesser General Public +License along with this program. If not, see +<http://www.gnu.org/licenses/>. + + + +Copyright (C) 2002-2015, 2019 Jan-AAke Larsson + + +File: dvipng.info, Node: Index, Prev: Copying, Up: Top + +Index +***** + + +* Menu: + +* -dSAFER: Option details. (line 167) +* absolute page number, and '-l': Option details. (line 141) +* absolute page number, and '-p': Option details. (line 194) +* antialiasing levels, number of: Option details. (line 247) +* background color (option): Option details. (line 40) +* base resolution, setting: Option details. (line 33) +* baseline reporting: Option details. (line 76) +* baseline reporting <1>: Option details. (line 133) +* color specifications: Color specifications. + (line 6) +* command-line options: Command-line options. + (line 6) +* compilation: Installation. (line 6) +* compression: Option details. (line 299) +* configuration, of dvipng: Installation. (line 6) +* dark fonts: Option details. (line 120) +* debugging: Option details. (line 54) +* debugging <1>: Diagnosing problems. (line 6) +* depth reporting: Option details. (line 76) +* exit on erroneous images: Option details. (line 258) +* first page printed: Option details. (line 194) +* follow mode: Option details. (line 97) +* font generation, avoiding: Option details. (line 159) +* forcing palette output: Option details. (line 203) +* foreground color (option): Option details. (line 91) +* FreeType font rendering: Option details. (line 105) +* fuzzy images: Option details. (line 120) +* gamma: Option details. (line 120) +* GhostScript and -dSAFER: Option details. (line 167) +* GhostScript, turning off: Option details. (line 163) +* GIF image format: Option details. (line 126) +* height reporting: Option details. (line 133) +* installation, of dvipng: Installation. (line 6) +* invoking dvipng: Basic usage. (line 6) +* last page printed: Option details. (line 141) +* light fonts: Option details. (line 120) +* magnification, overriding DVI: Option details. (line 289) +* Metafont mode, specifying: Option details. (line 150) +* mktexpk, avoiding: Option details. (line 159) +* mode name, specifying: Option details. (line 150) +* no erroneous images: Option details. (line 212) +* offset pages: Option details. (line 188) +* option, details of: Option details. (line 6) +* options, dvipng: Command-line options. + (line 6) +* options, reading from standard input: Option details. (line 11) +* options, summary: Option summary. (line 6) +* output resolution, setting: Option details. (line 60) +* output, redirecting: Option details. (line 181) +* page range: Option details. (line 225) +* page, first printed: Option details. (line 194) +* page, last printed: Option details. (line 141) +* physical page number, and '-l': Option details. (line 141) +* physical page number, and '-p': Option details. (line 194) +* PNG image format: Option details. (line 221) +* PostScript inclusion problems: Encapsulated PostScript. + (line 21) +* PostScript, turning off raw PostScript specials: Option details. + (line 175) +* problems: Diagnosing problems. (line 6) +* quality: Option details. (line 247) +* quiet operation: Option details. (line 243) +* reverse pagination: Option details. (line 254) +* silent operation: Option details. (line 243) +* standard input, reading options from: Option details. (line 11) +* standard output, output to: Option details. (line 181) +* transparent border fallback color: Option details. (line 23) +* transparent border width: Option details. (line 23) +* trouble: Diagnosing problems. (line 6) +* truecolor output: Option details. (line 275) +* warnings, suppressing: Option details. (line 243) +* width reporting: Option details. (line 286) + + + +Tag Table: +Node: Top296 +Node: Introduction1191 +Node: Installation3436 +Node: Prerequisites3783 +Node: Configure5822 +Node: Build/install7869 +Node: Installation outside the texmf tree8337 +Node: Advice for non-privileged users9047 +Node: Basic usage10058 +Node: Command-line options11202 +Node: Option summary11625 +Node: Option details13993 +Node: Graphics29167 +Node: Encapsulated PostScript29922 +Node: Bitmapped graphics31272 +Node: Raw PostScript32500 +Node: Color34753 +Node: Color specifications35142 +Node: Color specials36245 +Node: Diagnosing problems37662 +Node: Contact information38146 +Node: Debug options38874 +Node: Credits39863 +Node: Copying41088 +Node: Index41875 + +End Tag Table diff --git a/Build/source/texk/dvipng/doc/dvipng.texi b/Build/source/texk/dvipng/doc/dvipng.texi new file mode 100644 index 00000000000..2b8e157bdc2 --- /dev/null +++ b/Build/source/texk/dvipng/doc/dvipng.texi @@ -0,0 +1,984 @@ +\input texinfo +@setfilename dvipng.info +@settitle A DVI-to-PNG translator +@ifset man +@c man begin SYNOPSIS +dvipng [options] filename + +dvipng [options] [filename] - +@c man end +@end ifset + +@set version 1.17 +@set month-year January 2020 + +@c Put everything in one index (arbitrarily chosen to be the concept index). +@syncodeindex fn cp +@syncodeindex ky cp +@syncodeindex pg cp +@syncodeindex vr cp + +@include macros.texi +@iftex +@tolerance 10000 @emergencystretch 3em +@end iftex + +@dircategory TeX +@direntry +* DVI-to-PNG: (dvipng). Translating TeX DVI files to Portable Network Graphics (PNG). +* dvipng: (dvipng). A DVI-to-PNG translator. +@end direntry + +@finalout +@titlepage +@title dvipng +@subtitle A DVI-to-PNG Translator +@subtitle Version @value{version} + + +@author by Jan-@AA{}ke Larsson. +@page +@vskip 0pt plus 1filll +Copyright @copyright{} 2002-2020 Jan-@AA{}ke Larsson + +Permission is granted to make and distribute verbatim copies of +this manual provided the copyright notice and this permission notice +are preserved on all copies. + +@ignore +Permission is granted to process this file through TeX and print the +results, provided the printed document carries copying permission +notice identical to this one except for the removal of this paragraph +(this paragraph not being relevant to the printed manual). +@end ignore + +Permission is granted to copy and distribute modified versions of this +manual under the conditions for verbatim copying, provided also that the +section entitled ``Copying'' is included exactly as in the original, and +provided that the entire resulting derived work is distributed under the +terms of a permission notice identical to this one. + +Permission is granted to copy and distribute translations of this manual +into another language, under the above conditions for modified versions, +except that this permission notice may be stated in a translation +approved by the Free Software Foundation. +@end titlepage +@page + +@c @summarycontents +@contents + +@ifnottex +@node Top +@top dvipng + +This manual documents dvipng, a program to translate a DVI (DeVice +Independent) file into PNG (Portable Network Graphics). + +This file documents dvipng version @value{version} + +Corrections or perhaps rewrites of sections are @emph{very welcome}. + +Jan-@AA{}ke Larsson + +@end ifnottex + +@menu +* Introduction:: Introduction +* Installation:: How to compile and install dvipng +* Basic usage:: First things first +* Command-line options:: Advanced usage +* Graphics:: Including PostScript and/or bitmaps +* Color:: Using color with dvipng +* Diagnosing problems:: Problems? +* Credits:: People who have contributed +* Copying:: GNU Lesser General Public License +* Index:: General index +@end menu + + + +@node Introduction +@chapter Introduction + +@c man begin DESCRIPTION +@include readme.texi +@c man end + +@node Installation +@chapter Installation + +@cindex configuration, of dvipng +@cindex compilation +@cindex installation, of dvipng + +@include install.texi + +@node Basic usage +@chapter Basic usage of dvipng + +@cindex invoking dvipng + +To use dvipng at its simplest, simply type + +@example +dvipng foo +@end example + +@noindent +where @file{foo.dvi} is the output of @TeX{} that you want to convert to +PNG format. If there are four pages in @file{foo.dvi}, those pages will +be output as @file{foo1.png}, @file{foo2.png}, @file{foo3.png}, and +@file{foo4.png}, respectively. + +If you have enabled the PostScript font support (via FreeType), +fonts will be rendered as they are needed. Otherwise, dvipng will use +bitmapped (PK) fonts, and if you use PK fonts that have not been used on +your system before, they may be automatically generated; this process +can take a few minutes, so progress reports appear by default. The next +time the same font is used, it will have been saved on disk, so +rendering will go much faster. (If dvipng tries to endlessly generate +the same fonts over and over again, something is wrong. @xref{Unable to +generate fonts,,, kpathsea, Kpathsea}.) + +Many options are available (see the next section). For a brief summary +of available options, just type + +@example +dvipng --help +@end example + +@node Command-line options +@chapter Command-line options + +@cindex command-line options +@cindex options, dvipng + +dvipng has a plethora of command line options. Reading through this +section will give a good idea of the capabilities of the driver. + +@menu +* Option summary:: Quick listing, from dvipng --help. +* Option details:: More information about each option. +@end menu + + +@node Option summary +@section Option summary + +@cindex options, summary +Here is a handy summary of the options; it is printed out when you run +dvipng with no arguments or with the standard @samp{--help} option. + +@example +@include dvipng.help +@end example + + +@node Option details +@section Option details + +@cindex option, details of +@c man begin OPTIONS + +Many of the parameterless options listed here can be turned off by +suffixing the option with a zero (@samp{0}); for instance, to turn off +page reversal, use @samp{-r0}. Such options are marked with a trailing +@samp{*}. + +@table @samp +@item - +@cindex options, reading from standard input +@cindex standard input, reading options from +Read additional options from standard input after processing the command +line. + +@item --help +Print a usage message and exit. + +@item --version +Print the version number and exit. + +@item -bd @var{num} +@item -bd @var{color_spec} +@item -bd '@var{num} @var{color_spec}' +@cindex transparent border width +@cindex transparent border fallback color +Set the pixel width of the transparent border (default 0). Using this +option will make the image edges transparent, but it only affects pixels +with the background color. Giving a @var{color_spec} will set the +fallback color, to be used in viewers that cannot handle transparency +(the default is the background color). The color spec should be in +@TeX{} color \special syntax, e.g., 'rgb 1.0 0.0 0.0'. Setting the +fallback color makes the default border width 1 px. @xref{Color}. + +@item --bdpi @var{num} +@cindex base resolution, setting +This option only has an effect when using bitmapped (PK) fonts. The +option sets the base (Metafont) resolution, both horizontal and +vertical, to @var{num} dpi (dots per inch). This option is necessary +when manually selecting Metafont mode with the --mode option (see +below). + +@item -bg @var{color_spec} +@cindex background color (option) +Choose background color for the images. This option will be ignored if +there is a background color \special in the DVI. The color spec should +be in @TeX{} color \special syntax, e.g., 'rgb 1.0 0.0 0.0'. You can +also specify 'Transparent' or 'transparent' which will give you a +transparent background with the normal background as a fallback color. A +capitalized 'Transparent' will give a full-alpha transparency, while an +all-lowercase 'transparent' will give a simple fully transparent +background with non-transparent antialiased pixels. The latter would be +suitable for viewers who cannot cope with a true alpha channel. GIF +images do not support full alpha transparency, so in case of GIF output, +both variants will use the latter behaviour. @xref{Color}. + +@item -d @var{num} +@cindex debugging +Set the debug flags, showing what dvipng (thinks it) is doing. This will +work unless dvipng has been compiled without the @code{DEBUG} option +(not recommended). Set the flags as you need them, use @samp{-d -1} as +the first option for maximum output. @xref{Debug options}. + +@item -D @var{num} +@cindex output resolution, setting +Set the output resolution, both horizontal and vertical, to @var{num} +dpi (dots per inch). + +One may want to adjust this to fit a certain text font size (e.g., on +a web page), and for a text font height of @var{font_px} pixels (in +Mozilla) the correct formula is +@example +@var{dpi} = @var{font_px} * 72.27 / 10 [px * @TeX{}pt/in / @TeX{}pt] +@end example +The last division by ten is due to the standard font height 10pt in +your document, if you use 12pt, divide by 12. Unfortunately, some +proprietary browsers have font height in pt (points), not pixels. You +have to rescale that to pixels, using the screen resolution (default +is usually 96 dpi) which means the formula is +@example +@var{font_px} = @var{font_pt} * 96 / 72 [pt * px/in / (pt/in)] +@end example +On some high-res screens, the value is instead 120 dpi. Good luck! + +@item --depth* +@cindex baseline reporting +@cindex depth reporting +Report the depth of the image. This only works reliably when the +@LaTeX{} style @file{preview.sty} from @previewlatex{} is used with +the @samp{active} option. It reports the number of pixels from the +bottom of the image to the baseline of the image. This can be used for +vertical positioning of the image in, e.g., web documents, where one +would use (Cascading StyleSheets 1) +@example +<IMG SRC="@var{filename.png}" STYLE="vertical-align: -@var{depth}px"> +@end example +The depth is a negative offset in this case, so the minus sign is +necessary, and the unit is pixels (px). + +@item --dvinum* +Set this option to make the output page number be the @TeX{} page +numbers rather than the physical page number. See the @samp{-o} switch. + +@ignore +@item -e @var{num} +@cindex maxdrift +@cindex accuracy in positioning +@cindex positioning accuracy +Maximum drift in pixels of each character from its `true' +resolution-independent position on the page. The default value of this +parameter is resolution dependent (it is the number of entries in the +list [100, 200, 300, 400, 500, 600, 800, 1000, 1200, 1600, 2000, 2400, +2800, 3200, @dots{}] that are less than or equal to the resolution in +dots per inch). Allowing individual characters to `drift' from their +correctly rounded positions by a few pixels, while regaining the true +position at the beginning of each new word, improves the spacing of +letters in words. + +@item -f* +@cindex filter, running as a +@cindex standard I/O +@cindex pipes, not readable +@vindex PRINTER@r{, avoided with @samp{-f}} +Run as a filter. Read the DVI file from standard input and write the +PostScript to standard output. The standard input must be seekable, so +it cannot be a pipe. If your input must be a pipe, write a shell script +that copies the pipe output to a temporary file and then points dvipng at +this file. This option also disables the automatic reading of the +@code{PRINTER} environment variable; use @samp{-P$PRINTER} after the +@samp{-f} to read it anyway. It also turns off the automatic sending of +control-D if it was turned on with the @samp{-F} option or in the +configuration file; use @samp{-F} after the @samp{-f} to send it anyway. + +@item -k* +@cindex cropmarks +Print crop marks. This option increases the paper size (which should be +specified, either with a paper size special or with the @samp{-T} +option) by a half inch in each dimension. It translates each page by a +quarter inch and draws cross-style crop marks. It is mostly useful with +typesetters that can set the page size automatically. This works by +downloading @file{crop.pro}. +@end ignore + +@item -fg @var{color_spec} +@cindex foreground color (option) +Choose foreground color for the images. This option will be ignored if +there is a foreground color \special in the DVI. The color spec should +be in @TeX{} color \special syntax, e.g., 'rgb 1.0 0.0 0.0'. +@xref{Color}. + +@item --follow* +@cindex follow mode +Wait for data at end-of-file. One of the benefits of dvipng is that it +does not read the postamble, so it can be started before @TeX{} +finishes. This switch makes dvipng wait at end-of-file for further +output, unless it finds the POST marker that indicates the end of the +DVI. This is similar to @samp{tail -f} but for DVI-to-PNG conversion. + +@item --freetype* +@cindex FreeType font rendering +Enable/disable FreeType font rendering (default on). This option is +available if the FreeType2 font library was present at compilation time. +If this is the case, dvipng will have direct support for PostScript +Type1 and TrueType fonts internally, rather than using @samp{gsftopk} +for rendering the fonts. If you have PostScript versions of Computer +Modern installed, there will be no need to generate bitmapped (PK) +variants on disk of these. Then, you can render images at different (and +unusual) resolutions without cluttering the disk with lots of bitmapped +fonts. +One reason to disable FreeType font rendering would be to generate +identical output on different platforms, since FreeType uses the native +renderer and therefore can give slightly different output on each platform. + +@item --gamma @var{num} +@cindex gamma +@cindex dark fonts +@cindex light fonts +@cindex fuzzy images +Control the interpolation of colors in the greyscale anti-aliasing +color palette. Default value is 1.0. For 0 < @var{num} < 1, the +fonts will be lighter (more like the background), and for @var{num} > +1, the fonts will be darker (more like the foreground). + +@item --gif* +@cindex GIF image format +The images are output in the GIF format, if GIF support is enabled. +This is the default for the @samp{dvigif} binary, which only will be +available when GIF support is enabled. GIF images are palette images +(see the @samp{--palette} option) and does not support true alpha +channels (see the @samp{--bg} option). See also the @samp{--png} +option. + +@item --height* +@cindex baseline reporting +@cindex height reporting +Report the height of the image. This only works reliably when the +@LaTeX{} style @file{preview.sty} from @previewlatex{} is used with +the @samp{active} option. It reports the number of pixels from the top +of the image to the baseline of the image. The total height of the +image is obtained as the sum of the values reported from +@samp{--height} and @samp{--depth}. + +@item -l [=]@var{num} +@cindex last page printed +@cindex page, last printed +@cindex physical page number, and @samp{-l} +@cindex absolute page number, and @samp{-l} +The last page printed will be the first one numbered @var{num}. Default +is the last page in the document. If @var{num} is prefixed by an equals +sign, then it (and the argument to the @samp{-p} option, if specified) +is treated as a physical (absolute) page number, rather than a value to +compare with the @TeX{} @samp{\count0} values stored in the DVI file. +Thus, using @samp{-l =9} will end with the ninth page of the document, +no matter what the pages are actually numbered. + +@item --mode @var{mode} +@cindex mode name, specifying +@cindex Metafont mode, specifying +This option only has an effect when using bitmapped (PK) fonts. Use +@var{mode} as the Metafont device name for the PK fonts (both for path +searching and font generation). This needs to be augmented with the base +device resolution, given with the @samp{--bdpi} option. See the file +@url{ftp://ftp.tug.org/tex/modes.mf} for a list of resolutions and mode +names for most devices. @xref{Unable to generate fonts,,, kpathsea, +Kpathsea}. + +@item -M* +@cindex font generation, avoiding +@pindex mktexpk@r{, avoiding} +@c this description repeated in kpathsea.texi +This option only has an effect when using bitmapped (PK) fonts. It turns +off automatic PK font generation (@file{mktexpk}). +@ignore +@flindex missfont.log +If @code{mktexpk}, the invocation is appended to a file +@file{missfont.log} (by default) in the current directory. You can then +execute the log file to create the missing files after fixing the +problem. +@vindex TEXMFOUTPUT +@vindex MISSFONT_LOG +If the current directory is not writable and the environment variable or +configuration file value @samp{TEXMFOUTPUT} is set, its value is used. +Otherwise, nothing is written. The name @samp{missfont.log} is +overridden by the @samp{MISSFONT_LOG} environment variable or +configuration file value. +@end ignore + +@item --nogs* +@cindex GhostScript, turning off +This switch prohibits the internal call to GhostScript for displaying +PostScript specials. @samp{--nogs0} turns the call back on. + +@item --nogssafer* +@cindex GhostScript and -dSAFER +@cindex -dSAFER +Normally, if GhostScript is used to render PostScript specials, the +GhostScript interpreter is run with the option @samp{-dSAFER}. The +@samp{--nogssafer} option runs GhostScript without @samp{-dSAFER}. The +@samp{-dSAFER} option in Ghostscript disables PostScript operators such +as deletefile, to prevent possibly malicious PostScript programs from +having any effect. + +@item --norawps* +@cindex PostScript, turning off raw PostScript specials +Some packages generate raw PostScript specials, even non-rendering such +specials. This switch turns off the internal call to GhostScript +intended to display these raw PostScript specials. @samp{--norawps0} +turns the call back on. + +@item -o @var{name} +@cindex output, redirecting +@cindex standard output, output to +Send output to the file @var{name}. A single occurrence of @samp{%d} or +@samp{%01d}, @dots{}, @samp{%09d} will be exchanged for the physical +page number (this can be changed, see the @samp{--dvinum} switch). The +default output filename is @samp{@var{file}%d.png} where the input DVI +file was @samp{@var{file}.dvi}. + +@item -O @var{x-offset},@var{y-offset} +@cindex offset pages +Move the origin by @var{x-offset},@var{y-offset}, a comma-separated +pair of dimensions such as @samp{.1in,-.3cm}. +@c (@pxref{papersize special}). +The origin of the page is shifted from the default position +(of one inch down, one inch to the right from the upper left corner of +the paper) by this amount. + +@item -p [=]@var{num} +@cindex first page printed +@cindex page, first printed +@cindex physical page number, and @samp{-p} +@cindex absolute page number, and @samp{-p} +The first page printed will be the first one numbered @var{num}. Default +is the first page in the document. If @var{num} is prefixed by an +equals sign, then it (and the argument to the @samp{-l} option, if +specified) is treated as a physical (absolute) page number, rather than +a value to compare with the @TeX{} @samp{\count0} values stored in the +DVI file. Thus, using @samp{-p =3} will start with the third page of +the document, no matter what the pages are actually numbered. + +@item --palette* +@cindex forcing palette output +When an external image is included, @samp{dvipng} will automatically +switch to truecolor mode, to avoid unnecessary delay and quality +reduction, and enable the EPS translator to draw on a transparent +background and outside of the boundingbox. This switch will force +palette (256-color) output and make @samp{dvipng} revert to opaque +clipped image inclusion. This will also override the @samp{--truecolor} +switch if present. + +@item --picky* +@cindex no erroneous images +No images are output when a warning occurs. Normally, dvipng will +output an image in spite of a warning, but there may be something +missing in this image. One reason to use this option would be if you +have a more complete but slower fallback converter. Mainly, this is +useful for failed figure inclusion and unknown \special occurrences, +but warnings will also occur for missing or unknown color specs and +missing PK fonts. + +@item --png* +@cindex PNG image format +The images are output in the PNG format. This is the default for the +@samp{dvipng} binary. See also the @samp{--gif} option. + +@item -pp @var{firstpage}-@var{lastpage} +@cindex page range +Print pages @var{firstpage} through @var{lastpage}; but not quite +equivalent to @samp{-p @var{firstpage} -l @var{lastpage}}. For example, +when rendering a book, there may be several instances of a page in the +DVI file (one in @code{\frontmatter}, one in @code{\mainmatter}, and one +in @code{\backmatter}). In case of several pages matching, @samp{-pp +@var{firstpage}-@var{lastpage}} will render @emph{all} pages that +matches the specified range, while @samp{-p @var{firstpage} -l +@var{lastpage}} will render the pages from the @emph{first} occurrence +of @var{firstpage} to the @emph{first} occurrence of @var{lastpage}. +This is the (undocumented) behaviour of dvips. In dvipng you can give +both kinds of options, in which case you get all pages that matches the +range in @samp{-pp} between the pages from @samp{-p} to @samp{-l}. Also +multiple @samp{-pp} options accumulate, unlike @samp{-p} and @samp{-l}. +The @samp{-} separator can also be @samp{:}. Note that @samp{-pp -1} +will be interpreted as "all pages up to and including 1", if you want a +page numbered -1 (only the table of contents, say) put @samp{-pp -1--1}, +or more readable, @samp{-pp -1:-1}. + +@item -q* +@cindex quiet operation +@cindex silent operation +@cindex warnings, suppressing +Run quietly. Don't chatter about pages converted, etc.@: to standard +output; report no warnings (only errors) to standard error. + +@item -Q @var{num} +@cindex antialiasing levels@r{, number of} +@cindex quality +Set the quality to @var{num}. That is, choose the number of antialiasing +levels for bitmapped fonts (PK), to be +@var{num}*@var{num}+1. The default value is 4 which gives 17 levels of +antialiasing for antialiased fonts from these two. If FreeType is +available, its rendering is unaffected by this option. + +@item -r* +@cindex reverse pagination +Toggle output of pages in reverse/forward order. By default, the first +page in the DVI is output first. + +@ignore +@item -R +@cindex security +@cindex shell command execution, disabling +@cindex absolute filenames, disabling +@cindex pipes, disabling output to +Run securely. This disables shell command execution in @code{\special} +(via @samp{`}, @pxref{Dynamic creation of graphics}) and config files +(via the @samp{E} option, @pxref{Configuration file commands}), pipes as +output files, and opening of any absolute filenames. + +@item -t @var{papertype} +@cindex paper type +@cindex media +@cindex letter papertype +@cindex legal papertype +@cindex ledger papertype +@cindex a4 papertype +@cindex a3 papertype +@cindex landscape papertype +Set the paper type to @var{papertype}. +@c usually defined in one of the +@c configuration files, along with the appropriate PostScript code to +@c select it (@pxref{Config file paper sizes}). +You can also specify a @var{papertype} of @samp{landscape}, which +rotates a document by 90 degrees. To rotate a document whose paper type +is not the default, you can use the @samp{-t} option twice, once for the +paper type, and once for @samp{landscape}. +@end ignore + +@item --strict* +@cindex exit on erroneous images +The program exits when a warning occurs. Normally, dvipng will output +an image in spite of a warning, but there may be something missing in +this image. One reason to use this option would be if you have a more +complete but slower fallback converter. See the @samp{--picky} option +above for a list of when warnings occur. + +@item -T @var{image_size} +Set the image size to @var{image_size} which can be either of +@samp{bbox}, @samp{tight}, or a comma-separated pair of dimensions +@var{hsize},@var{vsize} such as @samp{.1in,.3cm}. The default is +@samp{bbox} which produces a PNG that includes all ink put on the page +and in addition the DVI origin, located 1in from the top and 1in from +the left edge of the paper. This usually gives whitespace above and to +the left in the produced image. The value @samp{tight} will make dvipng +only include all ink put on the page, producing neat images. +@c (@pxref{papersize special}). +@c This option overrides any papersize special in the DVI file. + +@item --truecolor* +@cindex truecolor output +This will make @samp{dvipng} generate truecolor output. Note that +truecolor output is automatic if you include an external image in your +DVI, e.g., via a PostScript special (i.e., the @samp{graphics} or +@samp{graphicx} package). This switch is overridden by the +@samp{--palette} switch. + +@item -v* +Enable verbose operation. This will currently indicate what fonts is +used, in addition to the usual output. + +@item --width* +@cindex width reporting +Report the width of the image. See also @samp{--height} and +@samp{--depth}. + +@item -x @var{num} +@cindex magnification, overriding DVI +This option is deprecated; it should not be used. It is much better to +select the output resolution directly with the @samp{-D} option. This +option sets the magnification ratio to @math{@var{num}/1000} and +overrides the magnification specified in the DVI file. Must be between +10 and 100000. It is recommended that you use standard magstep values +(1095, 1200, 1440, 1728, 2074, 2488, 2986, and so on) to help reduce the +total number of PK files generated. @var{num} may be a real number, not +an integer, for increased precision. + +@item -z @var{num} +@cindex compression +Set the PNG compression level to @var{num}. This option is enabled if +your @samp{libgd} is new enough. The default compression level is 1, +which selects maximum speed at the price of slightly larger PNGs. For an +older @samp{libgd}, the hard-soldered value 5 is used. The include file +@samp{png.h} says +@ifclear man +@quotation +Currently, valid values range from 0 - 9, corresponding directly to the +zlib compression levels 0 - 9 (0 - no compression, 9 - "maximal" +compression). Note that tests have shown that zlib compression levels +3-6 usually perform as well as level 9 for PNG images, and do +considerably fewer calculations. In the future, these values may not +correspond directly to the zlib compression levels. +@end quotation +@end ifclear +@ifset man +``Currently, valid values range from 0 - 9, corresponding directly to +the zlib compression levels 0 - 9 (0 - no compression, 9 - "maximal" +compression). Note that tests have shown that zlib compression levels +3-6 usually perform as well as level 9 for PNG images, and do +considerably fewer calculations. In the future, these values may not +correspond directly to the zlib compression levels.'' +@end ifset +@end table +@c man end + +@node Graphics +@chapter Graphics + +@samp{dvipng} attempts to handle graphics as included by the +@samp{graphicx} and @samp{graphics} packages, without the need of +specifying a driver to these packages. This means that it recognizes +the encapsulated postscript inclusion meant for @samp{dvips}, but is +also able (from version 1.8) to include bitmapped graphics. It also +tries to handle some of the raw PostScript that is output from various +packages. Some of the possibilities and problems are mentioned below. + +@menu +* Encapsulated PostScript:: An internal call to GhostScript +* Bitmapped graphics:: PNG, JPEG and GIF +* Raw PostScript:: Ignore or give to GhostScript +@end menu + +@node Encapsulated PostScript +@section Encapsulated PostScript + +When an EPS file is included, a call to GhostScript is performed to +produce a bitmapped image that can be included. The default is to +produce an image with transparent background, at the same size as the +DVI page currently being converted to PNG, and include that as +foreground on the PNG. Of course, if the image is to be cropped, that +is done. The included image will be a truecolor image, so for maximum +performance the output PNG will be in truecolor mode as well. + +This conversion needs the @samp{pngalpha} output device to be present +in your copy of GhostScript. If that device is not present, or you use +the @samp{--palette} switch or request GIF output, the fallback is to +use the @samp{png16m} device to produce a cropped opaque image for +inclusion. Other relevant switches are @samp{--noghostscript} and +@samp{--nogssafer}. @xref{Option details}. + +@cindex PostScript inclusion problems +The most common problem with including graphics is an incorrect +bounding box. Complain to whoever wrote the software that generated +the file if the bounding box is indeed incorrect. An adjusted +boundingbox can be specified in the @samp{\includegraphics} call, as +in this example (using @samp{graphicx}): + +@example +\includegraphics[bb=10 20 100 200]@{imagename.eps@} +@end example + + +@node Bitmapped graphics +@section Bitmapped graphics + +dvipng can include PNG, JPEG and GIF graphics. When including such +images via @samp{\includegraphics} you need to specify the bounding +box since @TeX{} itself cannot read them from the files in question. +The bounding box size should be given as @samp{0 0 w h} in pixels, +e.g., if the file @samp{imagename.png} is 300x400 pixels, the +inclusion would read + +@example +\includegraphics[bb=0 0 300 400]@{imagename.png@} +@end example + +The default size is the image size in bp (``big points'' in TeX +nomenclature or PostScript points as other people have it, 72 per inch). +That is, default resolution will be 72 dpi for included bitmaps, which +is the default size in the few other bitmap-capable drivers that are +known to me (dvipdfm and PDFLaTeX). + +If you want 100 dpi you need to specify the width accordingly. You +just divide your image width by 100: a 135 pixel wide image at 100 dpi +will take up 1.35 inches. If you want 200 dpi you divide by 200, and +so on. Simple, eh? The example above at 200 dpi would be 1.5 inches +wide: + +@example +\includegraphics[bb=0 0 300 400,witdh=1.5in]@{imagename.png@} +@end example + +@node Raw PostScript +@section Raw PostScript + +dvipng attempts to handle raw PostScript. Rendering raw PostScript +specials is done on top of the page by including a transparent image +generated by the @samp{pngalpha} device in GhostScript (automatically +selecting @samp{truecolor} mode in dvipng). + +Included PostScript headers are respected, and if the header +@samp{tex.pro} is included, dvipng also throws in @samp{color.pro} and +@samp{special.pro}. The package @samp{xcolor} includes its own headers +with color names, and this is not only kept as a PostScript header, but +is also read and interpreted by dvipng itself. An attempt is also made +to respect the PGF header. The non-rendering specials from +@samp{hyperref} are handled via some heuristics and do not give an +error. + +Really rendering and moving things with raw PostScript specials is more +troublesome. The \rotatebox macro serves as a good example. The dvips +driver of the graphicx package surrounds DVI glyphs with PostScript code +so that after conversion by dvips, the glyphs (now themselves in +PostScript) will be rotated in the desired way. dvipng does not handle +this, at present. An attempt has been made to handle the rendering +specials output by PGF (tikz), and also PSTricks. Some things work, but +others do not. This is especially clear when mixing PostScript and DVI +rendering commands such as glyphs. dvipng cannot at present detect if +PostScript code moves @samp{currentpoint} or rotates the frame since +GhostScript does not return such information. A recommendation would be +to produce images from these packages as EPS files and include them into +your document in the standard manner. + +Another way to handle this would be to use a slower fallback (with dvips +and gs, for example). If you want to disable raw PostScript handling in +dvipng, use the switch @samp{--norawps}. This switch turns off the +internal call to GhostScript intended to display these raw PostScript +specials. Further, when dvipng encounters raw PostScript and the gs call +is turned off, it gives a warning. It is now possible to use the switch +@samp{--picky} to disable page rendering of pages with warnings, and use +the slower fallback for these pages. + +@node Color +@chapter Color + +To support color, dvipng recognizes a certain set of specials as +generated by the @samp{color} and @samp{xcolor} style files. These +specials start with the keyword @samp{color} or the keyword +@samp{background}, followed by a color specification. + +@menu +* Color specifications:: +* Color specials:: +@end menu + + +@node Color specifications +@section Color specifications + +@cindex color specifications + +The color specification supported by dvipng is by-value or by-name. The +by-value spec starts with the name of a color model (one of @samp{rgb}, +@samp{hsb}, @samp{cmy}, @samp{cmyk}, or @samp{gray}) followed by the +appropriate number of parameters. Thus, the color specification +@samp{rgb 0.3 0.4 0.5} would correspond to the color that is @samp{0.3 +0.4 0.5} in its red, blue and green values. The color model used +internally in dvipng is @samp{RGB} (discretized to 256 levels), for +details on the formulas used in conversion, see the @samp{xcolor} +documentation. + +By-name color specifications are single (case-dependent) words and are +compared with color names defined in @samp{dvipsnam.def} (from the +@samp{graphics} bundle), @samp{svgnam.def} and @samp{xcolor.sty} (from +the @samp{xcolor} bundle). See the @samp{xcolor} documentation for a +list of names and the corresponding colors. + +On the command-line, the name @samp{Transparent} can also be used as +an argument to @samp{--bg} to choose transparent background. +@xref{Option details}. + +@node Color specials +@section Color specials + +We will describe @samp{background} first, since it is the simplest. The +@samp{background} keyword must be followed by a color specification. +That color specification is used as a fill color for the background. The +last @samp{background} special on a page is the one that gets used, and +is used for the whole of the page image. (This is possible because the +prescan phase of dvipng notices all of the color specials so that the +appropriate information can be written out during the second phase.) + +The @samp{color} special itself has three forms. The first is just +@samp{color} followed by a color specification. In this case, the +current global color is set to that color; the color stack must be empty +when such a command is executed. + +The second form is @samp{color push} followed by a color specification. +This saves the current color on the color stack and sets the color to be +that given by the color specification. This is the most common way to +set a color. + +The final form of the @samp{color} special is just @samp{color pop}, +with no color specification; this says to pop the color last pushed on +the color stack from the color stack and set the current color to be +that color. + +dvipng correctly handles these color specials across pages, even when +the pages are rendered repeatedly or in reverse order. + +@node Diagnosing problems +@chapter Diagnosing problems + +@cindex problems +@cindex trouble +@cindex debugging + +You've gone through all the trouble of installing dvipng, carefully read +all the instructions in this manual, and still can't get something to +work. The following sections provide some helpful hints if you find +yourself in such a situation. + +@menu +* Contact information:: Who to ask. +* Debug options:: Getting diagnostics. +@end menu + +@node Contact information +@section Contact information + +Bug reports should be sent to +@email{dvipng@@nongnu.org}. + +Questions, suggestions for new features, pleas for help, and/or praise +should go to @email{dvipng@@nongnu.org}. For more information on this +mailing list, send a message with just the word `help' as subject or +body to @email{dvipng-request@@nongnu.org} or look at +@url{http://lists.nongnu.org/mailman/listinfo/dvipng}. + +Offers to support further development will be appreciated. For developer +access, ask on @email{dvipng@@nongnu.org}. + +For details on the @TeX{} path-searching library, and @code{mktexpk} +problems, @pxref{Common problems,,, kpathsea, Kpathsea}. + + +@node Debug options +@section Debug options + +The @samp{-d} flag to dvipng helps in tracking down certain errors. The +parameter to this flag is an integer that tells what errors are +currently being tracked. To track a certain class of debug messages, +simply provide the appropriate number given below; if you wish to track +multiple classes, sum the numbers of the classes you wish to track. To +track all classes, you can use @code{-1}. + +Some of these debugging options are actually provided by Kpathsea +(@pxref{Debugging, , , kpathsea, Kpathsea}). + +The classes are: +@table @asis +@item 1 +Normal dvi op-codes +@item 2 +Virtual fonts +@item 4 +PK fonts +@item 8 +TFM files +@item 16 +Glyph rendering +@item 32 +FreeType calls +@item 64 +Encoding loads +@item 128 +Color specials +@item 256 +GhostScript specials +@item 512 +Kpathsea @code{stat} calls +@item 1024 +Kpathsea hash table lookups +@item 2048 +Kpathsea path element expansion +@item 4096 +Kpathsea path searches +@ignore +@item 8192 +@item 16384 +@end ignore + +@end table + +@node Credits +@chapter Credits + +A number of persons have contributed, if I forget to mention someone, +I apologize. First and foremost we have David Kastrup whose +@previewlatex{} project provided the incentive to write this program. +There is also a number of people who have contributed by reporting +bugs and suggesting improvements as the thing has evolved. These +include but is perhaps not limited to (in semi-random order): Thomas +Esser (te@TeX{}), Christian Schenk (MIK@TeX{}), Brian R Furry (debian +package), Angus Leeming (LyX), Thomas Boutell (libgd), John Jones +(first user report), Uwe Kern (xcolor), Karl Berry and Peter +Breitenlohner (@TeX{} Live), David Harvey (hinting in Freetype), Neal +Harmon, Alan Shutko, Reiner Stieb, Nick Alcock, Adam Buchbinder, Svend +Tollak Munkejord, James Longstreet, Bernhard Simon, Bob McElrath, +Georg Schwarz, Jason Farmer, Brian V. Smith, Samuel Hathaway, Thomas +R. Shemanske, Stephen Gibson, Christian Ridderstr@"om, Ezra Peisach, +William H Wheeler, Thomas Klausner, Harald Koenig, Adrian Bunk, Kevin +Smith, Jason Riedy, Wolfram Krause, Reinhard Kotucha, Takeshi Abe, +Waldeck Schutzer, Ahzo, and Andy Nguyen. + +@ifset man +@c man begin NOTES +The full manual is accessible in info format, on most systems by typing +@example +info dvipng +@end example +@c man end +@c man begin COPYRIGHT +This program is released under the GNU Lesser General Public License +version 3, see the COPYING file in the dvipng distribution or +@url{http://www.gnu.org/licenses/gpl.html}. + +Copyright @copyright{} 2002-2015, 2019 Jan-@AA{}ke Larsson +@c man end +@end ifset + +@node Copying +@chapter Copying + +This program is free software: you can redistribute it and/or modify +it under the terms of the GNU Lesser General Public License as +published by the Free Software Foundation, either version 3 of the +License, or (at your option) any later version. + +This program is distributed in the hope that it will be useful, but +WITHOUT ANY WARRANTY; without even the implied warranty of +MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU +Lesser General Public License for more details. + +You should have received a copy of the GNU Lesser General Public +License along with this program. If not, see +<http://www.gnu.org/licenses/>. + +@sp 2 +@noindent +Copyright @copyright{} 2002-2015, 2019 Jan-@AA{}ke Larsson + +@node Index +@unnumbered Index + +@printindex cp +@bye diff --git a/Build/source/texk/dvipng/doc/install.texi b/Build/source/texk/dvipng/doc/install.texi new file mode 100644 index 00000000000..61e47e565b9 --- /dev/null +++ b/Build/source/texk/dvipng/doc/install.texi @@ -0,0 +1,194 @@ +@c install.texi +@c +@c Part of the dvipng distribution + +@include macros.texi +@ifset rawfile +@chapter Installing dvipng + +@end ifset +@c ----------------------- +Installing dvipng should be simple: merely @code{./configure}, +@code{make}, and @code{make install}. + +@ifclear rawfile +@menu +* Prerequisites:: +* Configure:: +* Build/install:: +* Installation outside the texmf tree:: +* Advice for non-privileged users:: +@end menu +@end ifclear + +@node Prerequisites +@section Prerequisites + +@itemize @bullet +@item The GD Graphics Draw library, libgd + +The drawing library @samp{libgd} is necessary, and is downloadable at +@uref{https://bitbucket.org/libgd/gd-libgd/downloads}, and there are +binary packages for most operating systems from their respective +distributors. In any case, the library installs using @samp{autoconf} so +it should not be difficult for you to install it from source, and then +proceed with installing dvipng. + +@item The path-searching library kpathsea + +Kpathsea is most likely included in your @LaTeX{} installation, but it +may happen that ./configure does not find it; see below. If you do not +have it, download it from @uref{http://www.ctan.org} and compile it. +I have no experience with this, so I cannot help much here. + +@item The font-rendering library FreeType 2 + +While not strictly necessary, a recent FreeType 2 is recommended since +dvipng currently will produce better-quality images when this library is +available. To take advantage of this, you should have at least FreeType +2.1.9. + +FreeType 2 will enable direct support for PostScript and TrueType fonts, +so that dvipng will not need to generate bitmapped variants on disk of +the @TeX{} fonts since modern @TeX{} distributions include PostScript +versions of them. Then, you can render images at different (and unusual) +resolutions without cluttering the disk with lots of bitmapped fonts. + +Finally, it will enable subfont support in dvipng. That is, if you want +to render CJK-@LaTeX{} characters, you must have FreeType 2 installed. + +@item libpng and libz + +To be able to compress and write PNG files to disk, dvipng (or really +libgd) uses libpng which in turn uses libz. These should be available on +any modern system, if not, download them and install them. + +@item The @code{texinfo} package + +This is needed for building the documentation. +@end itemize + +@node Configure +@section Configure + +The first step is to configure the source code, telling it where +various files will be. To do so, run + +@example +./configure @var{options} +@end example + +(Note: if you have fetched dvipng from CVS rather than a regular +release, you will have to first generate @file{./configure} by running +@code{autoconf} 2.53 or later.) + +On many machines, you will not need to specify any options, but if +@code{configure} cannot determine something on its own, you'll need to +help it out. For a list of the options type + +@example +./configure --help +@end example + +On some machines, the libraries will be installed in directories that +are not in the linker's search path. This will generate an error when +running @file{./configure}, indicating that it cannot find libgd or +libkpathsea (most likely). You then need to specify the path to the +respective library's object files. They are typically called e.g., +@file{libgd.a} or @file{libgd.so}. If they are located in e.g., +@file{/sw/local/lib}, do + +@example +./configure LDFLAGS=-L/sw/local/lib +@end example + +If the library is available as a shared object file (@file{.so}), the +runtime linker may also need to be told where to find the library, +then use + +@example +./configure LDFLAGS='-L/sw/local/lib -R/sw/local/lib' +@end example + +When either of these is necessary, it is likely that the C header +files are also installed in directories that are not in the C +preprocessor's search path. This will also generate an error when +running @file{./configure}, indicating that it cannot find e.g., +@file{gd.h} or @file{kpathsea.h} (most likely). You then need to +specify the path to the respective library's C header files. If they +are located in e.g., @file{/sw/local/include}, do + +@example +./configure CPPFLAGS=-I/sw/local/include +@end example + +On my SUN Solaris workstation, I had to combine this into + +@example +./configure CPPFLAGS='-I/sw/local/include -I/sw/tex/teTeX/1.0/include'\ + LDFLAGS='-L/sw/local/lib -R/sw/local/lib -L/sw/tex/teTeX/1.0/lib/' +@end example + +@noindent +where the backslash denotes a continuation of the line. + +@node Build/install +@section Build/install + +Once @file{configure} has been run, simply enter + +@example +make +@end example + +@noindent +at the prompt to compile the C code, and build the documentation files. +To install the files into the locations chosen earlier, type + +@example +make install +@end example + +@noindent +You may need special privileges to install, e.g., if you are installing +into system directories. + +@node Installation outside the texmf tree +@section Installation outside the texmf tree + +In some cases, a dvipng binary installed outside the texmf tree will +not be able to find virtual fonts, or the PostScript font maps +(normally used by dvips). This may be because @emph{only} +$SELFAUTOLOC, $SELFAUTODIR, and $SELFAUTOPARENT are used in the texmf +tree configuration file @samp{texmf.cnf}. If so, give the switch +@samp{--enable-selfauto-set} to @samp{./configure}. This will make +dvipng adjust these three internally so that kpathsea thinks that +dvipng @emph{is} installed in the texmf tree. + +@node Advice for non-privileged users +@section Installation for non-privileged users + +Often people without system administration privileges want to install +software for their private use. In that case you need to specify more +options to the @file{configure} script, usually this is done by using +the @samp{--prefix} option to the @file{configure} script, and let it +point to the personal home directory. In that way, resulting binaries +will be installed under the @file{bin} subdirectory of your home +directory, manual pages under @file{man} and so on. That way, it is +reasonably easy to maintain a bunch of additional packages, since the +prefix argument is supported by most @file{configure} scripts. + +You'll have to add something like @file{/home/myself/bin} to your +@code{PATH} shell variable, if it isn't there already, and similarly +set the @code{INFOPATH} and @code{MANPATH} variables to be able to +access the documentation. + +@ifset rawfile +@section Copying + +This program is released under the GNU Lesser General Public License +version 3, see the COPYING file in the dvipng distribution or +@url{http://www.gnu.org/licenses/}. + +Copyright @copyright{} 2002-2015, 2019 Jan-@AA{}ke Larsson +@end ifset diff --git a/Build/source/texk/dvipng/doc/macros.texi b/Build/source/texk/dvipng/doc/macros.texi new file mode 100644 index 00000000000..3c90a59eb15 --- /dev/null +++ b/Build/source/texk/dvipng/doc/macros.texi @@ -0,0 +1,61 @@ +@ignore +macros.texi + +Part of the dvipng distribution + +This program is free software: you can redistribute it and/or modify +it under the terms of the GNU Lesser General Public License as +published by the Free Software Foundation, either version 3 of the +License, or (at your option) any later version. + +This program is distributed in the hope that it will be useful, but +WITHOUT ANY WARRANTY; without even the implied warranty of +MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU +Lesser General Public License for more details. + +You should have received a copy of the GNU Lesser General Public +License along with this program. If not, see +<http://www.gnu.org/licenses/>. + +Copyright @copyright{} 2002-2008 Jan-@AA{}ke Larsson +@end ignore + +@ifclear macros +@set macros +@macro AUCTeX {} +AUC@TeX{} +@end macro +@ifnottex +@macro LaTeX {} +La@TeX{} +@end macro +@macro previewlatex {} +preview-latex +@end macro +@ifset no-acronym +@clear no-acronym +@macro acronym {text} +@sc{\text\} +@end macro +@end ifset +@ifset no-env +@clear no-env +@macro env {text} +@code{\text\} +@end macro +@end ifset +@ifset no-option +@clear no-option +@macro option {text} +@samp{\text\} +@end macro +@end ifset +@end ifnottex +@tex +\gdef\LaTeX{L\kern-.36em\raise.3ex\hbox{\sc{a}}\kern-.15em\TeX} +\gdef\previewlatex{Preview-\LaTeX} +\ifx\acronym\undefined \gdef\acronym#1{{\smallcaps \lowercase{#1}}} \fi +\ifx\env\undefined \global\let\env=\code \fi +\ifx\option\undefined \global\let\option=\samp \fi +@end tex +@end ifclear diff --git a/Build/source/texk/dvipng/doc/readme.texi b/Build/source/texk/dvipng/doc/readme.texi new file mode 100644 index 00000000000..32faa64c02b --- /dev/null +++ b/Build/source/texk/dvipng/doc/readme.texi @@ -0,0 +1,158 @@ +@c readme.texi +@c +@c Part of the dvipng distribution + +@ifclear man +@include macros.texi +@ifset rawfile +@chapter dvipng + +@end ifset +@end ifclear +@c ----------------------- + +This program makes PNG and/or GIF graphics from DVI files as obtained +from @TeX{} and its relatives. + +If GIF support is enabled, GIF output is chosen by using the +@samp{dvigif} binary or with the @samp{--gif} option. + +@ifclear man + +It is intended to produce anti-aliased screen-resolution images as fast +as is possible. The target audience is people who need to generate and +regenerate many images again and again. The primary target is the +@previewlatex{} (X)Emacs package, a package to preview formulas from +within (X)Emacs. Yes, you get to see your formulas in the (X)Emacs +buffer, see @url{http://www.gnu.org/software/auctex/preview-latex.html}. + +Another example is WeBWorK, an internet-based method for delivering +homework problems to students over the internet, giving students +instant feedback as to whether or not their answers are correct, see +@url{http://webwork.math.rochester.edu}. + +A more recent addition to the dvipng-using applications out there is +MediaWiki, the software behind Wikipedia and many other wikis out +there. Dvipng is used to render mathematical formulae from version +1.8.0 of MediaWiki, see @url{http://www.mediawiki.org}. + +Other applications may also benefit, like web applications as latex2html +and WYSIWYG editors like LyX. + +@ifset rawfile +@section Benefits of dvipng +@end ifset +@end ifclear + +The benefits of @samp{dvipng}/@samp{dvigif} include + +@itemize @bullet +@item +Speed. It is a very fast bitmap-rendering code for DVI files, which +makes it suitable for generating large amounts of images on-the-fly, +as needed in @previewlatex{}, WeBWorK and others. + +@item +It does not read the postamble, so it can be started before @TeX{} +finishes. There is a @samp{--follow} switch that makes dvipng wait at +end-of-file for further output, unless it finds the POST marker that +indicates the end of the DVI. + +@item +Interactive query of options. dvipng can read options interactively +through stdin, and all options are usable. It is even possible to change +the input file through this interface. + +@item +Supports PK, VF, PostScript Type1, and TrueType fonts, subfonts (i.e., +as used in CJK-@LaTeX{}), color specials, and inclusion of PostScript, +PNG, JPEG or GIF images. + +@item +and more... + +@end itemize + +@ifset rawfile +@section Installation + +Read @file{INSTALL}, included in the distribution. + +@section Usage + +To use dvipng at its simplest, simply type + +@example +dvipng foo +@end example + +@noindent +where @file{foo.dvi} is the output of @TeX{} that you want to convert to +PNG format. If there are four pages in @file{foo.dvi}, those pages will +be output as @file{foo1.png}, @file{foo2.png}, @file{foo3.png}, and +@file{foo4.png}, respectively. + +Many options are available (see the info manual). For a brief summary +of available options, just type + +@example +dvipng --help +@end example + +@section Availability + +The dvipng package is available at Savannah, the GNU project site. Since +dvipng is not part of the GNU project, although released under the GNU +GPL, the web address is +@url{http://savannah.nongnu.org/projects/dvipng}. Instructions for +anonymous CVS access can be found at +@url{http://savannah.nongnu.org/cvs/?group=dvipng}. + +@section Contacts + +Bug reports should be sent to @email{dvipng@@nongnu.org}. + +Questions, suggestions for new features, pleas for help, and/or praise +should go to @email{dvipng@@nongnu.org}. For more information on this +mailing list, send a message with just the word `help' as subject or +body to @email{dvipng-request@@nongnu.org} or look at +@url{http://lists.nongnu.org/mailman/listinfo/dvipng}. + +Offers to support further development will be appreciated. For developer +access, ask on @email{dvipng@@nongnu.org}. + +@section Copying + +This program is released under the GNU Lesser General Public License +version 3, see the COPYING file in the dvipng distribution or +@url{http://www.gnu.org/licenses/}. + +Copyright @copyright{} 2002-2014 Jan-@AA{}ke Larsson + +@section Todo + +@itemize @bullet +@item +Use gs interpreter library for speed and possibly for functionality. + +@item +Add more color models for xcolor compatibility + +@item +Enable a named pipe as DVI + +@item +Further speed improvements. + +@item +Other output specials and source specials. + +@item +Clean internal structures. Overhaul file handling. + +@item +Fix the SELFAUTO stuff at runtime rather than at build time +@end itemize + + +@end ifset diff --git a/Build/source/texk/dvipng/doc/texi2pod.pl b/Build/source/texk/dvipng/doc/texi2pod.pl new file mode 100755 index 00000000000..9c6d8cc2792 --- /dev/null +++ b/Build/source/texk/dvipng/doc/texi2pod.pl @@ -0,0 +1,444 @@ +#! /usr/bin/env perl + +# Copyright (C) 1999, 2000, 2001, 2003, 2007 Free Software +# Foundation, Inc. + +# This file is part of GCC. + +# GCC is free software; you can redistribute it and/or modify +# it under the terms of the GNU General Public License as published by +# the Free Software Foundation; either version 3, or (at your option) +# any later version. + +# GCC is distributed in the hope that it will be useful, +# but WITHOUT ANY WARRANTY; without even the implied warranty of +# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +# GNU General Public License for more details. + +# You should have received a copy of the GNU General Public License +# along with GCC. If not, see <http://www.gnu.org/licenses/>. + +# This does trivial (and I mean _trivial_) conversion of Texinfo +# markup to Perl POD format. It's intended to be used to extract +# something suitable for a manpage from a Texinfo document. + +use warnings; + +$output = 0; +$skipping = 0; +%sects = (); +$section = ""; +@icstack = (); +@endwstack = (); +@skstack = (); +@instack = (); +$shift = ""; +%defs = (); +$fnno = 1; +$inf = ""; +$ibase = ""; + +while ($_ = shift) { + if (/^-D(.*)$/) { + if ($1 ne "") { + $flag = $1; + } else { + $flag = shift; + } + $value = ""; + ($flag, $value) = ($flag =~ /^([^=]+)(?:=(.+))?/); + die "no flag specified for -D\n" + unless $flag ne ""; + die "flags may only contain letters, digits, hyphens, dashes and underscores\n" + unless $flag =~ /^[a-zA-Z0-9_-]+$/; + $defs{$flag} = $value; + } elsif (/^-/) { + usage(); + } else { + $in = $_, next unless defined $in; + $out = $_, next unless defined $out; + usage(); + } +} + +if (defined $in) { + $inf = gensym(); + open($inf, "<$in") or die "opening \"$in\": $!\n"; + $ibase = $1 if $in =~ m|^(.+)/[^/]+$|; +} else { + $inf = \*STDIN; +} + +if (defined $out) { + open(STDOUT, ">$out") or die "opening \"$out\": $!\n"; +} + +while(defined $inf) { +while(<$inf>) { + # Certain commands are discarded without further processing. + /^\@(?: + [a-z]+index # @*index: useful only in complete manual + |need # @need: useful only in printed manual + |(?:end\s+)?group # @group .. @end group: ditto + |page # @page: ditto + |node # @node: useful only in .info file + |(?:end\s+)?ifnottex # @ifnottex .. @end ifnottex: use contents + )\b/x and next; + + chomp; + + # Look for filename and title markers. + /^\@setfilename\s+([^.]+)/ and $fn = $1, next; + /^\@settitle\s+([^.]+)/ and $tl = postprocess($1), next; + + # Identify a man title but keep only the one we are interested in. + /^\@c\s+man\s+title\s+([A-Za-z0-9-]+)\s+(.+)/ and do { + if (exists $defs{$1}) { + $fn = $1; + $tl = postprocess($2); + } + next; + }; + + # Look for blocks surrounded by @c man begin SECTION ... @c man end. + # This really oughta be @ifman ... @end ifman and the like, but such + # would require rev'ing all other Texinfo translators. + /^\@c\s+man\s+begin\s+([A-Z]+)\s+([A-Za-z0-9-]+)/ and do { + $output = 1 if exists $defs{$2}; + $sect = $1; + next; + }; + /^\@c\s+man\s+begin\s+([A-Z]+)/ and $sect = $1, $output = 1, next; + /^\@c\s+man\s+end/ and do { + $sects{$sect} = "" unless exists $sects{$sect}; + $sects{$sect} .= postprocess($section); + $section = ""; + $output = 0; + next; + }; + + # handle variables + /^\@set\s+([a-zA-Z0-9_-]+)\s*(.*)$/ and do { + $defs{$1} = $2; + next; + }; + /^\@clear\s+([a-zA-Z0-9_-]+)/ and do { + delete $defs{$1}; + next; + }; + + next unless $output; + + # Discard comments. (Can't do it above, because then we'd never see + # @c man lines.) + /^\@c\b/ and next; + + # End-block handler goes up here because it needs to operate even + # if we are skipping. + /^\@end\s+([a-z]+)/ and do { + # Ignore @end foo, where foo is not an operation which may + # cause us to skip, if we are presently skipping. + my $ended = $1; + next if $skipping && $ended !~ /^(?:ifset|ifclear|ignore|menu|iftex|copying)$/; + + die "\@end $ended without \@$ended at line $.\n" unless defined $endw; + die "\@$endw ended by \@end $ended at line $.\n" unless $ended eq $endw; + + $endw = pop @endwstack; + + if ($ended =~ /^(?:ifset|ifclear|ignore|menu|iftex)$/) { + $skipping = pop @skstack; + next; + } elsif ($ended =~ /^(?:example|smallexample|display)$/) { + $shift = ""; + $_ = ""; # need a paragraph break + } elsif ($ended =~ /^(?:itemize|enumerate|[fv]?table)$/) { + $_ = "\n=back\n"; + $ic = pop @icstack; + } else { + die "unknown command \@end $ended at line $.\n"; + } + }; + + # We must handle commands which can cause skipping even while we + # are skipping, otherwise we will not process nested conditionals + # correctly. + /^\@ifset\s+([a-zA-Z0-9_-]+)/ and do { + push @endwstack, $endw; + push @skstack, $skipping; + $endw = "ifset"; + $skipping = 1 unless exists $defs{$1}; + next; + }; + + /^\@ifclear\s+([a-zA-Z0-9_-]+)/ and do { + push @endwstack, $endw; + push @skstack, $skipping; + $endw = "ifclear"; + $skipping = 1 if exists $defs{$1}; + next; + }; + + /^\@(ignore|menu|iftex|copying)\b/ and do { + push @endwstack, $endw; + push @skstack, $skipping; + $endw = $1; + $skipping = 1; + next; + }; + + next if $skipping; + + # Character entities. First the ones that can be replaced by raw text + # or discarded outright: + s/\@copyright\{\}/(c)/g; + s/\@dots\{\}/.../g; + s/\@enddots\{\}/..../g; + s/\@([.!? ])/$1/g; + s/\@[:-]//g; + s/\@bullet(?:\{\})?/*/g; + s/\@TeX\{\}/TeX/g; + s/\@pounds\{\}/\#/g; + s/\@minus(?:\{\})?/-/g; + s/\\,/,/g; + + # Now the ones that have to be replaced by special escapes + # (which will be turned back into text by unmunge()) + s/&/&/g; + s/\@\@/&at;/g; + s/\@\{/{/g; + s/\@\}/}/g; + + # Inside a verbatim block, handle @var specially. + if ($shift ne "") { + s/\@var\{([^\}]*)\}/<$1>/g; + } + + # POD doesn't interpret E<> inside a verbatim block. + if ($shift eq "") { + s/</</g; + s/>/>/g; + } else { + s/</</g; + s/>/>/g; + } + + # Single line command handlers. + + /^\@include\s+(.+)$/ and do { + push @instack, $inf; + $inf = gensym(); + $file = postprocess($1); + + # Try cwd and $ibase. + open($inf, "<" . $file) + or open($inf, "<" . $ibase . "/" . $file) + or die "cannot open $file or $ibase/$file: $!\n"; + next; + }; + + /^\@(?:section|unnumbered|unnumberedsec|center)\s+(.+)$/ + and $_ = "\n=head2 $1\n"; + /^\@subsection\s+(.+)$/ + and $_ = "\n=head3 $1\n"; + + # Block command handlers: + /^\@itemize(?:\s+(\@[a-z]+|\*|-))?/ and do { + push @endwstack, $endw; + push @icstack, $ic; + if (defined $1) { + $ic = $1; + } else { + $ic = '@bullet'; + } + $_ = "\n=over 4\n"; + $endw = "itemize"; + }; + + /^\@enumerate(?:\s+([a-zA-Z0-9]+))?/ and do { + push @endwstack, $endw; + push @icstack, $ic; + if (defined $1) { + $ic = $1 . "."; + } else { + $ic = "1."; + } + $_ = "\n=over 4\n"; + $endw = "enumerate"; + }; + + /^\@([fv]?table)\s+(\@[a-z]+)/ and do { + push @endwstack, $endw; + push @icstack, $ic; + $endw = $1; + $ic = $2; + $ic =~ s/\@(?:samp|strong|key|gcctabopt|env)/B/; + $ic =~ s/\@(?:code|kbd)/C/; + $ic =~ s/\@(?:dfn|var|emph|cite|i)/I/; + $ic =~ s/\@(?:file)/F/; + $_ = "\n=over 4\n"; + }; + + /^\@((?:small)?example|display)/ and do { + push @endwstack, $endw; + $endw = $1; + $shift = "\t"; + $_ = ""; # need a paragraph break + }; + + /^\@itemx?\s*(.+)?$/ and do { + if (defined $1) { + # Entity escapes prevent munging by the <> processing below. + $_ = "\n=item $ic\<$1\>\n"; + } else { + $_ = "\n=item $ic\n"; + $ic =~ y/A-Ya-y/B-Zb-z/; + $ic =~ s/(\d+)/$1 + 1/eg; + } + }; + + $section .= $shift.$_."\n"; +} +# End of current file. +close($inf); +$inf = pop @instack; +} + +die "No filename or title\n" unless defined $fn && defined $tl; + +$sects{NAME} = "$fn \- $tl\n"; +$sects{FOOTNOTES} .= "=back\n" if exists $sects{FOOTNOTES}; + +for $sect (qw(NAME SYNOPSIS DESCRIPTION OPTIONS ENVIRONMENT FILES + BUGS NOTES FOOTNOTES SEEALSO AUTHOR COPYRIGHT)) { + if(exists $sects{$sect}) { + $head = $sect; + $head =~ s/SEEALSO/SEE ALSO/; + print "=head1 $head\n\n"; + print scalar unmunge ($sects{$sect}); + print "\n"; + } +} + +sub usage +{ + die "usage: $0 [-D toggle...] [infile [outfile]]\n"; +} + +sub postprocess +{ + local $_ = $_[0]; + + # @value{foo} is replaced by whatever 'foo' is defined as. + while (m/(\@value\{([a-zA-Z0-9_-]+)\})/g) { + if (! exists $defs{$2}) { + print STDERR "Option $2 not defined\n"; + s/\Q$1\E//; + } else { + $value = $defs{$2}; + s/\Q$1\E/$value/; + } + } + + # Formatting commands. + # Temporary escape for @r. + s/\@r\{([^\}]*)\}/R<$1>/g; + s/\@(?:dfn|var|emph|cite|i)\{([^\}]*)\}/I<$1>/g; + s/\@(?:code|kbd)\{([^\}]*)\}/C<$1>/g; + s/\@(?:gccoptlist|samp|strong|key|option|env|command|b)\{([^\}]*)\}/B<$1>/g; + s/\@sc\{([^\}]*)\}/\U$1/g; + s/\@file\{([^\}]*)\}/F<$1>/g; + s/\@w\{([^\}]*)\}/S<$1>/g; + s/\@(?:dmn|math)\{([^\}]*)\}/$1/g; + + # keep references of the form @ref{...}, print them bold + s/\@(?:ref)\{([^\}]*)\}/B<$1>/g; + + # Change double single quotes to double quotes. + s/''/"/g; + s/``/"/g; + + # Cross references are thrown away, as are @noindent and @refill. + # (@noindent is impossible in .pod, and @refill is unnecessary.) + # @* is also impossible in .pod; we discard it and any newline that + # follows it. Similarly, our macro @gol must be discarded. + + s/\(?\@xref\{(?:[^\}]*)\}(?:[^.<]|(?:<[^<>]*>))*\.\)?//g; + s/\s+\(\@pxref\{(?:[^\}]*)\}\)//g; + s/;\s+\@pxref\{(?:[^\}]*)\}//g; + s/\@noindent\s*//g; + s/\@refill//g; + s/\@gol//g; + s/\@\*\s*\n?//g; + + # @uref can take one, two, or three arguments, with different + # semantics each time. @url and @email are just like @uref with + # one argument, for our purposes. + s/\@(?:uref|url|email)\{([^\},]*)\}/<B<$1>>/g; + s/\@uref\{([^\},]*),([^\},]*)\}/$2 (C<$1>)/g; + s/\@uref\{([^\},]*),([^\},]*),([^\},]*)\}/$3/g; + + # Un-escape <> at this point. + s/</</g; + s/>/>/g; + + # Now un-nest all B<>, I<>, R<>. Theoretically we could have + # indefinitely deep nesting; in practice, one level suffices. + 1 while s/([BIR])<([^<>]*)([BIR])<([^<>]*)>/$1<$2>$3<$4>$1</g; + + # Replace R<...> with bare ...; eliminate empty markup, B<>; + # shift white space at the ends of [BI]<...> expressions outside + # the expression. + s/R<([^<>]*)>/$1/g; + s/[BI]<>//g; + s/([BI])<(\s+)([^>]+)>/$2$1<$3>/g; + s/([BI])<([^>]+?)(\s+)>/$1<$2>$3/g; + + # Extract footnotes. This has to be done after all other + # processing because otherwise the regexp will choke on formatting + # inside @footnote. + while (/\@footnote/g) { + s/\@footnote\{([^\}]+)\}/[$fnno]/; + add_footnote($1, $fnno); + $fnno++; + } + + return $_; +} + +sub unmunge +{ + # Replace escaped symbols with their equivalents. + local $_ = $_[0]; + + s/</E<lt>/g; + s/>/E<gt>/g; + s/{/\{/g; + s/}/\}/g; + s/&at;/\@/g; + s/&/&/g; + return $_; +} + +sub add_footnote +{ + unless (exists $sects{FOOTNOTES}) { + $sects{FOOTNOTES} = "\n=over 4\n\n"; + } + + $sects{FOOTNOTES} .= "=item $fnno.\n\n"; $fnno++; + $sects{FOOTNOTES} .= $_[0]; + $sects{FOOTNOTES} .= "\n\n"; +} + +# stolen from Symbol.pm +{ + my $genseq = 0; + sub gensym + { + my $name = "GEN" . $genseq++; + my $ref = \*{$name}; + delete $::{$name}; + return $ref; + } +} diff --git a/Build/source/texk/dvipng/dvipng-src/COPYING b/Build/source/texk/dvipng/dvipng-src/COPYING new file mode 100644 index 00000000000..94a9ed024d3 --- /dev/null +++ b/Build/source/texk/dvipng/dvipng-src/COPYING @@ -0,0 +1,674 @@ + GNU GENERAL PUBLIC LICENSE + Version 3, 29 June 2007 + + Copyright (C) 2007 Free Software Foundation, Inc. <http://fsf.org/> + Everyone is permitted to copy and distribute verbatim copies + of this license document, but changing it is not allowed. + + Preamble + + The GNU General Public License is a free, copyleft license for +software and other kinds of works. + + The licenses for most software and other practical works are designed +to take away your freedom to share and change the works. By contrast, +the GNU General Public License is intended to guarantee your freedom to +share and change all versions of a program--to make sure it remains free +software for all its users. We, the Free Software Foundation, use the +GNU General Public License for most of our software; it applies also to +any other work released this way by its authors. You can apply it to +your programs, too. + + When we speak of free software, we are referring to freedom, not +price. Our General Public Licenses are designed to make sure that you +have the freedom to distribute copies of free software (and charge for +them if you wish), that you receive source code or can get it if you +want it, that you can change the software or use pieces of it in new +free programs, and that you know you can do these things. + + To protect your rights, we need to prevent others from denying you +these rights or asking you to surrender the rights. Therefore, you have +certain responsibilities if you distribute copies of the software, or if +you modify it: responsibilities to respect the freedom of others. + + For example, if you distribute copies of such a program, whether +gratis or for a fee, you must pass on to the recipients the same +freedoms that you received. You must make sure that they, too, receive +or can get the source code. And you must show them these terms so they +know their rights. + + Developers that use the GNU GPL protect your rights with two steps: +(1) assert copyright on the software, and (2) offer you this License +giving you legal permission to copy, distribute and/or modify it. + + For the developers' and authors' protection, the GPL clearly explains +that there is no warranty for this free software. For both users' and +authors' sake, the GPL requires that modified versions be marked as +changed, so that their problems will not be attributed erroneously to +authors of previous versions. + + Some devices are designed to deny users access to install or run +modified versions of the software inside them, although the manufacturer +can do so. This is fundamentally incompatible with the aim of +protecting users' freedom to change the software. The systematic +pattern of such abuse occurs in the area of products for individuals to +use, which is precisely where it is most unacceptable. Therefore, we +have designed this version of the GPL to prohibit the practice for those +products. If such problems arise substantially in other domains, we +stand ready to extend this provision to those domains in future versions +of the GPL, as needed to protect the freedom of users. + + Finally, every program is threatened constantly by software patents. +States should not allow patents to restrict development and use of +software on general-purpose computers, but in those that do, we wish to +avoid the special danger that patents applied to a free program could +make it effectively proprietary. To prevent this, the GPL assures that +patents cannot be used to render the program non-free. + + The precise terms and conditions for copying, distribution and +modification follow. + + TERMS AND CONDITIONS + + 0. Definitions. + + "This License" refers to version 3 of the GNU General Public License. + + "Copyright" also means copyright-like laws that apply to other kinds of +works, such as semiconductor masks. + + "The Program" refers to any copyrightable work licensed under this +License. Each licensee is addressed as "you". "Licensees" and +"recipients" may be individuals or organizations. + + To "modify" a work means to copy from or adapt all or part of the work +in a fashion requiring copyright permission, other than the making of an +exact copy. The resulting work is called a "modified version" of the +earlier work or a work "based on" the earlier work. + + A "covered work" means either the unmodified Program or a work based +on the Program. + + To "propagate" a work means to do anything with it that, without +permission, would make you directly or secondarily liable for +infringement under applicable copyright law, except executing it on a +computer or modifying a private copy. Propagation includes copying, +distribution (with or without modification), making available to the +public, and in some countries other activities as well. + + To "convey" a work means any kind of propagation that enables other +parties to make or receive copies. Mere interaction with a user through +a computer network, with no transfer of a copy, is not conveying. + + An interactive user interface displays "Appropriate Legal Notices" +to the extent that it includes a convenient and prominently visible +feature that (1) displays an appropriate copyright notice, and (2) +tells the user that there is no warranty for the work (except to the +extent that warranties are provided), that licensees may convey the +work under this License, and how to view a copy of this License. If +the interface presents a list of user commands or options, such as a +menu, a prominent item in the list meets this criterion. + + 1. Source Code. + + The "source code" for a work means the preferred form of the work +for making modifications to it. "Object code" means any non-source +form of a work. + + A "Standard Interface" means an interface that either is an official +standard defined by a recognized standards body, or, in the case of +interfaces specified for a particular programming language, one that +is widely used among developers working in that language. + + The "System Libraries" of an executable work include anything, other +than the work as a whole, that (a) is included in the normal form of +packaging a Major Component, but which is not part of that Major +Component, and (b) serves only to enable use of the work with that +Major Component, or to implement a Standard Interface for which an +implementation is available to the public in source code form. A +"Major Component", in this context, means a major essential component +(kernel, window system, and so on) of the specific operating system +(if any) on which the executable work runs, or a compiler used to +produce the work, or an object code interpreter used to run it. + + The "Corresponding Source" for a work in object code form means all +the source code needed to generate, install, and (for an executable +work) run the object code and to modify the work, including scripts to +control those activities. However, it does not include the work's +System Libraries, or general-purpose tools or generally available free +programs which are used unmodified in performing those activities but +which are not part of the work. For example, Corresponding Source +includes interface definition files associated with source files for +the work, and the source code for shared libraries and dynamically +linked subprograms that the work is specifically designed to require, +such as by intimate data communication or control flow between those +subprograms and other parts of the work. + + The Corresponding Source need not include anything that users +can regenerate automatically from other parts of the Corresponding +Source. + + The Corresponding Source for a work in source code form is that +same work. + + 2. Basic Permissions. + + All rights granted under this License are granted for the term of +copyright on the Program, and are irrevocable provided the stated +conditions are met. This License explicitly affirms your unlimited +permission to run the unmodified Program. The output from running a +covered work is covered by this License only if the output, given its +content, constitutes a covered work. This License acknowledges your +rights of fair use or other equivalent, as provided by copyright law. + + You may make, run and propagate covered works that you do not +convey, without conditions so long as your license otherwise remains +in force. You may convey covered works to others for the sole purpose +of having them make modifications exclusively for you, or provide you +with facilities for running those works, provided that you comply with +the terms of this License in conveying all material for which you do +not control copyright. Those thus making or running the covered works +for you must do so exclusively on your behalf, under your direction +and control, on terms that prohibit them from making any copies of +your copyrighted material outside their relationship with you. + + Conveying under any other circumstances is permitted solely under +the conditions stated below. Sublicensing is not allowed; section 10 +makes it unnecessary. + + 3. Protecting Users' Legal Rights From Anti-Circumvention Law. + + No covered work shall be deemed part of an effective technological +measure under any applicable law fulfilling obligations under article +11 of the WIPO copyright treaty adopted on 20 December 1996, or +similar laws prohibiting or restricting circumvention of such +measures. + + When you convey a covered work, you waive any legal power to forbid +circumvention of technological measures to the extent such circumvention +is effected by exercising rights under this License with respect to +the covered work, and you disclaim any intention to limit operation or +modification of the work as a means of enforcing, against the work's +users, your or third parties' legal rights to forbid circumvention of +technological measures. + + 4. Conveying Verbatim Copies. + + You may convey verbatim copies of the Program's source code as you +receive it, in any medium, provided that you conspicuously and +appropriately publish on each copy an appropriate copyright notice; +keep intact all notices stating that this License and any +non-permissive terms added in accord with section 7 apply to the code; +keep intact all notices of the absence of any warranty; and give all +recipients a copy of this License along with the Program. + + You may charge any price or no price for each copy that you convey, +and you may offer support or warranty protection for a fee. + + 5. Conveying Modified Source Versions. + + You may convey a work based on the Program, or the modifications to +produce it from the Program, in the form of source code under the +terms of section 4, provided that you also meet all of these conditions: + + a) The work must carry prominent notices stating that you modified + it, and giving a relevant date. + + b) The work must carry prominent notices stating that it is + released under this License and any conditions added under section + 7. This requirement modifies the requirement in section 4 to + "keep intact all notices". + + c) You must license the entire work, as a whole, under this + License to anyone who comes into possession of a copy. This + License will therefore apply, along with any applicable section 7 + additional terms, to the whole of the work, and all its parts, + regardless of how they are packaged. This License gives no + permission to license the work in any other way, but it does not + invalidate such permission if you have separately received it. + + d) If the work has interactive user interfaces, each must display + Appropriate Legal Notices; however, if the Program has interactive + interfaces that do not display Appropriate Legal Notices, your + work need not make them do so. + + A compilation of a covered work with other separate and independent +works, which are not by their nature extensions of the covered work, +and which are not combined with it such as to form a larger program, +in or on a volume of a storage or distribution medium, is called an +"aggregate" if the compilation and its resulting copyright are not +used to limit the access or legal rights of the compilation's users +beyond what the individual works permit. Inclusion of a covered work +in an aggregate does not cause this License to apply to the other +parts of the aggregate. + + 6. Conveying Non-Source Forms. + + You may convey a covered work in object code form under the terms +of sections 4 and 5, provided that you also convey the +machine-readable Corresponding Source under the terms of this License, +in one of these ways: + + a) Convey the object code in, or embodied in, a physical product + (including a physical distribution medium), accompanied by the + Corresponding Source fixed on a durable physical medium + customarily used for software interchange. + + b) Convey the object code in, or embodied in, a physical product + (including a physical distribution medium), accompanied by a + written offer, valid for at least three years and valid for as + long as you offer spare parts or customer support for that product + model, to give anyone who possesses the object code either (1) a + copy of the Corresponding Source for all the software in the + product that is covered by this License, on a durable physical + medium customarily used for software interchange, for a price no + more than your reasonable cost of physically performing this + conveying of source, or (2) access to copy the + Corresponding Source from a network server at no charge. + + c) Convey individual copies of the object code with a copy of the + written offer to provide the Corresponding Source. This + alternative is allowed only occasionally and noncommercially, and + only if you received the object code with such an offer, in accord + with subsection 6b. + + d) Convey the object code by offering access from a designated + place (gratis or for a charge), and offer equivalent access to the + Corresponding Source in the same way through the same place at no + further charge. You need not require recipients to copy the + Corresponding Source along with the object code. If the place to + copy the object code is a network server, the Corresponding Source + may be on a different server (operated by you or a third party) + that supports equivalent copying facilities, provided you maintain + clear directions next to the object code saying where to find the + Corresponding Source. Regardless of what server hosts the + Corresponding Source, you remain obligated to ensure that it is + available for as long as needed to satisfy these requirements. + + e) Convey the object code using peer-to-peer transmission, provided + you inform other peers where the object code and Corresponding + Source of the work are being offered to the general public at no + charge under subsection 6d. + + A separable portion of the object code, whose source code is excluded +from the Corresponding Source as a System Library, need not be +included in conveying the object code work. + + A "User Product" is either (1) a "consumer product", which means any +tangible personal property which is normally used for personal, family, +or household purposes, or (2) anything designed or sold for incorporation +into a dwelling. In determining whether a product is a consumer product, +doubtful cases shall be resolved in favor of coverage. For a particular +product received by a particular user, "normally used" refers to a +typical or common use of that class of product, regardless of the status +of the particular user or of the way in which the particular user +actually uses, or expects or is expected to use, the product. A product +is a consumer product regardless of whether the product has substantial +commercial, industrial or non-consumer uses, unless such uses represent +the only significant mode of use of the product. + + "Installation Information" for a User Product means any methods, +procedures, authorization keys, or other information required to install +and execute modified versions of a covered work in that User Product from +a modified version of its Corresponding Source. The information must +suffice to ensure that the continued functioning of the modified object +code is in no case prevented or interfered with solely because +modification has been made. + + If you convey an object code work under this section in, or with, or +specifically for use in, a User Product, and the conveying occurs as +part of a transaction in which the right of possession and use of the +User Product is transferred to the recipient in perpetuity or for a +fixed term (regardless of how the transaction is characterized), the +Corresponding Source conveyed under this section must be accompanied +by the Installation Information. But this requirement does not apply +if neither you nor any third party retains the ability to install +modified object code on the User Product (for example, the work has +been installed in ROM). + + The requirement to provide Installation Information does not include a +requirement to continue to provide support service, warranty, or updates +for a work that has been modified or installed by the recipient, or for +the User Product in which it has been modified or installed. Access to a +network may be denied when the modification itself materially and +adversely affects the operation of the network or violates the rules and +protocols for communication across the network. + + Corresponding Source conveyed, and Installation Information provided, +in accord with this section must be in a format that is publicly +documented (and with an implementation available to the public in +source code form), and must require no special password or key for +unpacking, reading or copying. + + 7. Additional Terms. + + "Additional permissions" are terms that supplement the terms of this +License by making exceptions from one or more of its conditions. +Additional permissions that are applicable to the entire Program shall +be treated as though they were included in this License, to the extent +that they are valid under applicable law. If additional permissions +apply only to part of the Program, that part may be used separately +under those permissions, but the entire Program remains governed by +this License without regard to the additional permissions. + + When you convey a copy of a covered work, you may at your option +remove any additional permissions from that copy, or from any part of +it. (Additional permissions may be written to require their own +removal in certain cases when you modify the work.) You may place +additional permissions on material, added by you to a covered work, +for which you have or can give appropriate copyright permission. + + Notwithstanding any other provision of this License, for material you +add to a covered work, you may (if authorized by the copyright holders of +that material) supplement the terms of this License with terms: + + a) Disclaiming warranty or limiting liability differently from the + terms of sections 15 and 16 of this License; or + + b) Requiring preservation of specified reasonable legal notices or + author attributions in that material or in the Appropriate Legal + Notices displayed by works containing it; or + + c) Prohibiting misrepresentation of the origin of that material, or + requiring that modified versions of such material be marked in + reasonable ways as different from the original version; or + + d) Limiting the use for publicity purposes of names of licensors or + authors of the material; or + + e) Declining to grant rights under trademark law for use of some + trade names, trademarks, or service marks; or + + f) Requiring indemnification of licensors and authors of that + material by anyone who conveys the material (or modified versions of + it) with contractual assumptions of liability to the recipient, for + any liability that these contractual assumptions directly impose on + those licensors and authors. + + All other non-permissive additional terms are considered "further +restrictions" within the meaning of section 10. If the Program as you +received it, or any part of it, contains a notice stating that it is +governed by this License along with a term that is a further +restriction, you may remove that term. If a license document contains +a further restriction but permits relicensing or conveying under this +License, you may add to a covered work material governed by the terms +of that license document, provided that the further restriction does +not survive such relicensing or conveying. + + If you add terms to a covered work in accord with this section, you +must place, in the relevant source files, a statement of the +additional terms that apply to those files, or a notice indicating +where to find the applicable terms. + + Additional terms, permissive or non-permissive, may be stated in the +form of a separately written license, or stated as exceptions; +the above requirements apply either way. + + 8. Termination. + + You may not propagate or modify a covered work except as expressly +provided under this License. Any attempt otherwise to propagate or +modify it is void, and will automatically terminate your rights under +this License (including any patent licenses granted under the third +paragraph of section 11). + + However, if you cease all violation of this License, then your +license from a particular copyright holder is reinstated (a) +provisionally, unless and until the copyright holder explicitly and +finally terminates your license, and (b) permanently, if the copyright +holder fails to notify you of the violation by some reasonable means +prior to 60 days after the cessation. + + Moreover, your license from a particular copyright holder is +reinstated permanently if the copyright holder notifies you of the +violation by some reasonable means, this is the first time you have +received notice of violation of this License (for any work) from that +copyright holder, and you cure the violation prior to 30 days after +your receipt of the notice. + + Termination of your rights under this section does not terminate the +licenses of parties who have received copies or rights from you under +this License. If your rights have been terminated and not permanently +reinstated, you do not qualify to receive new licenses for the same +material under section 10. + + 9. Acceptance Not Required for Having Copies. + + You are not required to accept this License in order to receive or +run a copy of the Program. Ancillary propagation of a covered work +occurring solely as a consequence of using peer-to-peer transmission +to receive a copy likewise does not require acceptance. However, +nothing other than this License grants you permission to propagate or +modify any covered work. These actions infringe copyright if you do +not accept this License. Therefore, by modifying or propagating a +covered work, you indicate your acceptance of this License to do so. + + 10. Automatic Licensing of Downstream Recipients. + + Each time you convey a covered work, the recipient automatically +receives a license from the original licensors, to run, modify and +propagate that work, subject to this License. You are not responsible +for enforcing compliance by third parties with this License. + + An "entity transaction" is a transaction transferring control of an +organization, or substantially all assets of one, or subdividing an +organization, or merging organizations. If propagation of a covered +work results from an entity transaction, each party to that +transaction who receives a copy of the work also receives whatever +licenses to the work the party's predecessor in interest had or could +give under the previous paragraph, plus a right to possession of the +Corresponding Source of the work from the predecessor in interest, if +the predecessor has it or can get it with reasonable efforts. + + You may not impose any further restrictions on the exercise of the +rights granted or affirmed under this License. For example, you may +not impose a license fee, royalty, or other charge for exercise of +rights granted under this License, and you may not initiate litigation +(including a cross-claim or counterclaim in a lawsuit) alleging that +any patent claim is infringed by making, using, selling, offering for +sale, or importing the Program or any portion of it. + + 11. Patents. + + A "contributor" is a copyright holder who authorizes use under this +License of the Program or a work on which the Program is based. The +work thus licensed is called the contributor's "contributor version". + + A contributor's "essential patent claims" are all patent claims +owned or controlled by the contributor, whether already acquired or +hereafter acquired, that would be infringed by some manner, permitted +by this License, of making, using, or selling its contributor version, +but do not include claims that would be infringed only as a +consequence of further modification of the contributor version. For +purposes of this definition, "control" includes the right to grant +patent sublicenses in a manner consistent with the requirements of +this License. + + Each contributor grants you a non-exclusive, worldwide, royalty-free +patent license under the contributor's essential patent claims, to +make, use, sell, offer for sale, import and otherwise run, modify and +propagate the contents of its contributor version. + + In the following three paragraphs, a "patent license" is any express +agreement or commitment, however denominated, not to enforce a patent +(such as an express permission to practice a patent or covenant not to +sue for patent infringement). To "grant" such a patent license to a +party means to make such an agreement or commitment not to enforce a +patent against the party. + + If you convey a covered work, knowingly relying on a patent license, +and the Corresponding Source of the work is not available for anyone +to copy, free of charge and under the terms of this License, through a +publicly available network server or other readily accessible means, +then you must either (1) cause the Corresponding Source to be so +available, or (2) arrange to deprive yourself of the benefit of the +patent license for this particular work, or (3) arrange, in a manner +consistent with the requirements of this License, to extend the patent +license to downstream recipients. "Knowingly relying" means you have +actual knowledge that, but for the patent license, your conveying the +covered work in a country, or your recipient's use of the covered work +in a country, would infringe one or more identifiable patents in that +country that you have reason to believe are valid. + + If, pursuant to or in connection with a single transaction or +arrangement, you convey, or propagate by procuring conveyance of, a +covered work, and grant a patent license to some of the parties +receiving the covered work authorizing them to use, propagate, modify +or convey a specific copy of the covered work, then the patent license +you grant is automatically extended to all recipients of the covered +work and works based on it. + + A patent license is "discriminatory" if it does not include within +the scope of its coverage, prohibits the exercise of, or is +conditioned on the non-exercise of one or more of the rights that are +specifically granted under this License. You may not convey a covered +work if you are a party to an arrangement with a third party that is +in the business of distributing software, under which you make payment +to the third party based on the extent of your activity of conveying +the work, and under which the third party grants, to any of the +parties who would receive the covered work from you, a discriminatory +patent license (a) in connection with copies of the covered work +conveyed by you (or copies made from those copies), or (b) primarily +for and in connection with specific products or compilations that +contain the covered work, unless you entered into that arrangement, +or that patent license was granted, prior to 28 March 2007. + + Nothing in this License shall be construed as excluding or limiting +any implied license or other defenses to infringement that may +otherwise be available to you under applicable patent law. + + 12. No Surrender of Others' Freedom. + + If conditions are imposed on you (whether by court order, agreement or +otherwise) that contradict the conditions of this License, they do not +excuse you from the conditions of this License. If you cannot convey a +covered work so as to satisfy simultaneously your obligations under this +License and any other pertinent obligations, then as a consequence you may +not convey it at all. For example, if you agree to terms that obligate you +to collect a royalty for further conveying from those to whom you convey +the Program, the only way you could satisfy both those terms and this +License would be to refrain entirely from conveying the Program. + + 13. Use with the GNU Affero General Public License. + + Notwithstanding any other provision of this License, you have +permission to link or combine any covered work with a work licensed +under version 3 of the GNU Affero General Public License into a single +combined work, and to convey the resulting work. The terms of this +License will continue to apply to the part which is the covered work, +but the special requirements of the GNU Affero General Public License, +section 13, concerning interaction through a network will apply to the +combination as such. + + 14. Revised Versions of this License. + + The Free Software Foundation may publish revised and/or new versions of +the GNU General Public License from time to time. Such new versions will +be similar in spirit to the present version, but may differ in detail to +address new problems or concerns. + + Each version is given a distinguishing version number. If the +Program specifies that a certain numbered version of the GNU General +Public License "or any later version" applies to it, you have the +option of following the terms and conditions either of that numbered +version or of any later version published by the Free Software +Foundation. If the Program does not specify a version number of the +GNU General Public License, you may choose any version ever published +by the Free Software Foundation. + + If the Program specifies that a proxy can decide which future +versions of the GNU General Public License can be used, that proxy's +public statement of acceptance of a version permanently authorizes you +to choose that version for the Program. + + Later license versions may give you additional or different +permissions. However, no additional obligations are imposed on any +author or copyright holder as a result of your choosing to follow a +later version. + + 15. Disclaimer of Warranty. + + THERE IS NO WARRANTY FOR THE PROGRAM, TO THE EXTENT PERMITTED BY +APPLICABLE LAW. EXCEPT WHEN OTHERWISE STATED IN WRITING THE COPYRIGHT +HOLDERS AND/OR OTHER PARTIES PROVIDE THE PROGRAM "AS IS" WITHOUT WARRANTY +OF ANY KIND, EITHER EXPRESSED OR IMPLIED, INCLUDING, BUT NOT LIMITED TO, +THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR +PURPOSE. THE ENTIRE RISK AS TO THE QUALITY AND PERFORMANCE OF THE PROGRAM +IS WITH YOU. SHOULD THE PROGRAM PROVE DEFECTIVE, YOU ASSUME THE COST OF +ALL NECESSARY SERVICING, REPAIR OR CORRECTION. + + 16. Limitation of Liability. + + IN NO EVENT UNLESS REQUIRED BY APPLICABLE LAW OR AGREED TO IN WRITING +WILL ANY COPYRIGHT HOLDER, OR ANY OTHER PARTY WHO MODIFIES AND/OR CONVEYS +THE PROGRAM AS PERMITTED ABOVE, BE LIABLE TO YOU FOR DAMAGES, INCLUDING ANY +GENERAL, SPECIAL, INCIDENTAL OR CONSEQUENTIAL DAMAGES ARISING OUT OF THE +USE OR INABILITY TO USE THE PROGRAM (INCLUDING BUT NOT LIMITED TO LOSS OF +DATA OR DATA BEING RENDERED INACCURATE OR LOSSES SUSTAINED BY YOU OR THIRD +PARTIES OR A FAILURE OF THE PROGRAM TO OPERATE WITH ANY OTHER PROGRAMS), +EVEN IF SUCH HOLDER OR OTHER PARTY HAS BEEN ADVISED OF THE POSSIBILITY OF +SUCH DAMAGES. + + 17. Interpretation of Sections 15 and 16. + + If the disclaimer of warranty and limitation of liability provided +above cannot be given local legal effect according to their terms, +reviewing courts shall apply local law that most closely approximates +an absolute waiver of all civil liability in connection with the +Program, unless a warranty or assumption of liability accompanies a +copy of the Program in return for a fee. + + END OF TERMS AND CONDITIONS + + How to Apply These Terms to Your New Programs + + If you develop a new program, and you want it to be of the greatest +possible use to the public, the best way to achieve this is to make it +free software which everyone can redistribute and change under these terms. + + To do so, attach the following notices to the program. It is safest +to attach them to the start of each source file to most effectively +state the exclusion of warranty; and each file should have at least +the "copyright" line and a pointer to where the full notice is found. + + <one line to give the program's name and a brief idea of what it does.> + Copyright (C) <year> <name of author> + + This program is free software: you can redistribute it and/or modify + it under the terms of the GNU General Public License as published by + the Free Software Foundation, either version 3 of the License, or + (at your option) any later version. + + This program is distributed in the hope that it will be useful, + but WITHOUT ANY WARRANTY; without even the implied warranty of + MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + GNU General Public License for more details. + + You should have received a copy of the GNU General Public License + along with this program. If not, see <http://www.gnu.org/licenses/>. + +Also add information on how to contact you by electronic and paper mail. + + If the program does terminal interaction, make it output a short +notice like this when it starts in an interactive mode: + + <program> Copyright (C) <year> <name of author> + This program comes with ABSOLUTELY NO WARRANTY; for details type `show w'. + This is free software, and you are welcome to redistribute it + under certain conditions; type `show c' for details. + +The hypothetical commands `show w' and `show c' should show the appropriate +parts of the General Public License. Of course, your program's commands +might be different; for a GUI interface, you would use an "about box". + + You should also get your employer (if you work as a programmer) or school, +if any, to sign a "copyright disclaimer" for the program, if necessary. +For more information on this, and how to apply and follow the GNU GPL, see +<http://www.gnu.org/licenses/>. + + The GNU General Public License does not permit incorporating your program +into proprietary programs. If your program is a subroutine library, you +may consider it more useful to permit linking proprietary applications with +the library. If this is what you want to do, use the GNU Lesser General +Public License instead of this License. But first, please read +<http://www.gnu.org/philosophy/why-not-lgpl.html>. diff --git a/Build/source/texk/dvipng/dvipng-src/COPYING.LESSER b/Build/source/texk/dvipng/dvipng-src/COPYING.LESSER new file mode 100644 index 00000000000..fc8a5de7edf --- /dev/null +++ b/Build/source/texk/dvipng/dvipng-src/COPYING.LESSER @@ -0,0 +1,165 @@ + GNU LESSER GENERAL PUBLIC LICENSE + Version 3, 29 June 2007 + + Copyright (C) 2007 Free Software Foundation, Inc. <http://fsf.org/> + Everyone is permitted to copy and distribute verbatim copies + of this license document, but changing it is not allowed. + + + This version of the GNU Lesser General Public License incorporates +the terms and conditions of version 3 of the GNU General Public +License, supplemented by the additional permissions listed below. + + 0. Additional Definitions. + + As used herein, "this License" refers to version 3 of the GNU Lesser +General Public License, and the "GNU GPL" refers to version 3 of the GNU +General Public License. + + "The Library" refers to a covered work governed by this License, +other than an Application or a Combined Work as defined below. + + An "Application" is any work that makes use of an interface provided +by the Library, but which is not otherwise based on the Library. +Defining a subclass of a class defined by the Library is deemed a mode +of using an interface provided by the Library. + + A "Combined Work" is a work produced by combining or linking an +Application with the Library. The particular version of the Library +with which the Combined Work was made is also called the "Linked +Version". + + The "Minimal Corresponding Source" for a Combined Work means the +Corresponding Source for the Combined Work, excluding any source code +for portions of the Combined Work that, considered in isolation, are +based on the Application, and not on the Linked Version. + + The "Corresponding Application Code" for a Combined Work means the +object code and/or source code for the Application, including any data +and utility programs needed for reproducing the Combined Work from the +Application, but excluding the System Libraries of the Combined Work. + + 1. Exception to Section 3 of the GNU GPL. + + You may convey a covered work under sections 3 and 4 of this License +without being bound by section 3 of the GNU GPL. + + 2. Conveying Modified Versions. + + If you modify a copy of the Library, and, in your modifications, a +facility refers to a function or data to be supplied by an Application +that uses the facility (other than as an argument passed when the +facility is invoked), then you may convey a copy of the modified +version: + + a) under this License, provided that you make a good faith effort to + ensure that, in the event an Application does not supply the + function or data, the facility still operates, and performs + whatever part of its purpose remains meaningful, or + + b) under the GNU GPL, with none of the additional permissions of + this License applicable to that copy. + + 3. Object Code Incorporating Material from Library Header Files. + + The object code form of an Application may incorporate material from +a header file that is part of the Library. You may convey such object +code under terms of your choice, provided that, if the incorporated +material is not limited to numerical parameters, data structure +layouts and accessors, or small macros, inline functions and templates +(ten or fewer lines in length), you do both of the following: + + a) Give prominent notice with each copy of the object code that the + Library is used in it and that the Library and its use are + covered by this License. + + b) Accompany the object code with a copy of the GNU GPL and this license + document. + + 4. Combined Works. + + You may convey a Combined Work under terms of your choice that, +taken together, effectively do not restrict modification of the +portions of the Library contained in the Combined Work and reverse +engineering for debugging such modifications, if you also do each of +the following: + + a) Give prominent notice with each copy of the Combined Work that + the Library is used in it and that the Library and its use are + covered by this License. + + b) Accompany the Combined Work with a copy of the GNU GPL and this license + document. + + c) For a Combined Work that displays copyright notices during + execution, include the copyright notice for the Library among + these notices, as well as a reference directing the user to the + copies of the GNU GPL and this license document. + + d) Do one of the following: + + 0) Convey the Minimal Corresponding Source under the terms of this + License, and the Corresponding Application Code in a form + suitable for, and under terms that permit, the user to + recombine or relink the Application with a modified version of + the Linked Version to produce a modified Combined Work, in the + manner specified by section 6 of the GNU GPL for conveying + Corresponding Source. + + 1) Use a suitable shared library mechanism for linking with the + Library. A suitable mechanism is one that (a) uses at run time + a copy of the Library already present on the user's computer + system, and (b) will operate properly with a modified version + of the Library that is interface-compatible with the Linked + Version. + + e) Provide Installation Information, but only if you would otherwise + be required to provide such information under section 6 of the + GNU GPL, and only to the extent that such information is + necessary to install and execute a modified version of the + Combined Work produced by recombining or relinking the + Application with a modified version of the Linked Version. (If + you use option 4d0, the Installation Information must accompany + the Minimal Corresponding Source and Corresponding Application + Code. If you use option 4d1, you must provide the Installation + Information in the manner specified by section 6 of the GNU GPL + for conveying Corresponding Source.) + + 5. Combined Libraries. + + You may place library facilities that are a work based on the +Library side by side in a single library together with other library +facilities that are not Applications and are not covered by this +License, and convey such a combined library under terms of your +choice, if you do both of the following: + + a) Accompany the combined library with a copy of the same work based + on the Library, uncombined with any other library facilities, + conveyed under the terms of this License. + + b) Give prominent notice with the combined library that part of it + is a work based on the Library, and explaining where to find the + accompanying uncombined form of the same work. + + 6. Revised Versions of the GNU Lesser General Public License. + + The Free Software Foundation may publish revised and/or new versions +of the GNU Lesser General Public License from time to time. Such new +versions will be similar in spirit to the present version, but may +differ in detail to address new problems or concerns. + + Each version is given a distinguishing version number. If the +Library as you received it specifies that a certain numbered version +of the GNU Lesser General Public License "or any later version" +applies to it, you have the option of following the terms and +conditions either of that published version or of any later version +published by the Free Software Foundation. If the Library as you +received it does not specify a version number of the GNU Lesser +General Public License, you may choose any version of the GNU Lesser +General Public License ever published by the Free Software Foundation. + + If the Library as you received it specifies that a proxy can decide +whether future versions of the GNU Lesser General Public License shall +apply, that proxy's public statement of acceptance of any version is +permanent authorization for you to choose that version for the +Library. diff --git a/Build/source/texk/dvipng/dvipng-src/COPYING.gd b/Build/source/texk/dvipng/dvipng-src/COPYING.gd new file mode 100644 index 00000000000..db6a326580c --- /dev/null +++ b/Build/source/texk/dvipng/dvipng-src/COPYING.gd @@ -0,0 +1,54 @@ +The below is the copyright notice of the gd library. +---------------------------------------------------- + +Portions copyright 1994, 1995, 1996, 1997, 1998, 1999, 2000, 2001, +2002 by Cold Spring Harbor Laboratory. Funded under Grant P41-RR02188 +by the National Institutes of Health. + +Portions copyright 1996, 1997, 1998, 1999, 2000, 2001, 2002 by +Boutell.Com, Inc. + +Portions relating to GD2 format copyright 1999, 2000, 2001, 2002 +Philip Warner. + +Portions relating to PNG copyright 1999, 2000, 2001, 2002 Greg +Roelofs. + +Portions relating to gdttf.c copyright 1999, 2000, 2001, 2002 John +Ellson (ellson@lucent.com). + +Portions relating to gdft.c copyright 2001, 2002 John Ellson +(ellson@lucent.com). + +Portions copyright 2000, 2001, 2002, 2003, 2004, 2005, 2006, 2007 +Pierre-Alain Joye (pierre@libgd.org). + +Portions relating to JPEG and to color quantization copyright 2000, +2001, 2002, Doug Becker and copyright (C) 1994, 1995, 1996, 1997, +1998, 1999, 2000, 2001, 2002, Thomas G. Lane. This software is +based in part on the work of the Independent JPEG Group. See the +file README-JPEG.TXT for more information. + +Portions relating to WBMP copyright 2000, 2001, 2002 Maurice +Szmurlo and Johan Van den Brande. + +Permission has been granted to copy, distribute and modify gd in +any context without fee, including a commercial application, +provided that this notice is present in user-accessible supporting +documentation. + +This does not affect your ownership of the derived work itself, and +the intent is to assure proper credit for the authors of gd, not to +interfere with your productive use of gd. If you have questions, +ask. "Derived works" includes all programs that utilize the +library. Credit must be given in user-accessible documentation. + +This software is provided "AS IS." The copyright holders disclaim +all warranties, either express or implied, including but not +limited to implied warranties of merchantability and fitness for a +particular purpose, with respect to this code and accompanying +documentation. + +Although their code does not appear in gd, the authors wish to thank +David Koblas, David Rowley, and Hutchison Avenue Software Corporation +for their prior contributions. diff --git a/Build/source/texk/dvipng/dvipng-src/ChangeLog b/Build/source/texk/dvipng/dvipng-src/ChangeLog new file mode 100644 index 00000000000..f30d538bda1 --- /dev/null +++ b/Build/source/texk/dvipng/dvipng-src/ChangeLog @@ -0,0 +1,1332 @@ +2020-01-05 Jan-Åke Larsson <jan-ake.larsson@liu.se> + + Prepare for 1.17 + +2019-11-29 Jan-Åke Larsson <jan-ake.larsson@liu.se> + + Fix typo that cause PK files to fail + +2019-07-03 Jan-Åke Larsson <jan-ake.larsson@liu.se> + + Fix format for gamma interactive printout. Add credit. + +2019-07-01 Jan-Åke Larsson <jan-ake.larsson@liu.se> + + Fix segfault when starting interactive mode without DVI. Thanks to Ahzo for finding the issue. + +2019-06-29 Jan-Åke Larsson <jan-ake.larsson@liu.se> + + Revert change for acinclude.m4, and add test for strncasecmp + +2019-06-27 Jan-Åke Larsson <jan-ake.larsson@liu.se> + + Remove segfault for invalid color names + +2019-04-06 Jan-Åke Larsson <jan-ake.larsson@liu.se> + + Release 1.16 + +2019-04-06 Jan-Åke Larsson <jan-ake.larsson@liu.se> + + Check for a possible integer addition overflow + Check bounds for mmap access + Update copyright notice + +2019-02-26 Jan-Åke Larsson <jan-ake.larsson@liu.se> + + Add sentence on disabling Freetype for identical output on different platforms. + Amend FT2 test, move remaining local scripts to acinclude.m4, regenerate aclocal.m4 + +2015-03-28 Jan-Åke Larsson <jan-ake.larsson@liu.se> + + Add const where needed + Don't re-define pipe and snprintf + Test for and use texlive_gs_init() + Use WIN32 _spawnlp + Use char* in debug printout calculations + Don't use basename, ignore case, and use correct directory delimiter + +2015-03-05 Jan-Åke Larsson <jan-ake.larsson@liu.se> + + Change libgd download address + +2015-03-02 Jan-Åke Larsson <jan-ake.larsson@liu.se> + + Remove datarootdir configure warning, adjust distclean target + Remove texi2pod.pl, we only use that for building the man page + Remove cvs remnants + Adjust distclean target + +2015-03-01 Jan-Åke Larsson <jan-ake.larsson@liu.se> + + * RELEASE: Release 1.15 + + * color.c, config.h.in, configure.ac, dvi.c, dvipng.h, misc.c, + pk.c, set.c, sfd.c, tfm.c, vf.c: Remove references to kpathsea + xmalloc, and enable non-GNU malloc + + * dvi.c: Fix long sleep interval in --follow + + * INSTALL, Makefile.in, README, config.h.in, configure.ac, draw.c, + dvipng.1, dvipng.c, dvipng.h, dvipng.texi, font.c, fontmap.c, + install.texi, miktex.h, misc.c, readme.texi, t1.c: Remove support + for the now dead libt1 + + * special.c: Use <sys/wait.h> + + * color.c: Fix segfault at missing xcolor.sty + + * set.c: Added check for out of memory in libgd allocate + +2012-09-15 Jan-Åke Larsson <jan-ake.larsson@liu.se> + + * ft.c: Add warning for missing target_light hinting + +2012-09-15 Jan-Åke Larsson <jan-ake.larsson@liu.se> + + * dvipng.c: Use return value of fgets better + +2010-12-17 Jan-Åke Larsson <jan-ake.larsson@liu.se> + + * COPYING.gd: Inclusion of the gd copyright notice + +2010-12-14 Jan-Åke Larsson <jan-ake.larsson@liu.se> + + * RELEASE: Spell correctly + +2010-12-06 Jan-Åke Larsson <jan-ake.larsson@liu.se> + + * special.c: Warn when --norawps hinders output + * dvipng.texi: Document usage of a fallback + * Makefile.in: Add www directory + +2010-10-23 Jan-Åke Larsson <jan-ake.larsson@liu.se> + + * dvipng.1, RELEASE: Prepare for 1.14 + +2010-10-22 Jan-Åke Larsson <jan-ake.larsson@liu.se> + + * configure.ac: Prepare for 1.14 + + * special.c: Tidy up the three different calls to gs on different + systems. + + * dvipng.texi: Some adjustments, document handling of raw + PostScript + +2010-10-21 Jan-Åke Larsson <jan-ake.larsson@liu.se> + + * special.c: Code cleanup + +2010-10-14 Jan-Åke Larsson <jan-ake.larsson@liu.se> + + * dvipng.h (malloc): Put malloc def first + + * special.c (ps2png): Ensure one and only one showpage, and do it + in PostScript instead of in C as suggested by Akira's previous patch + +2010-10-02 Peter Breitenlohner <peb@mppmu.mpg.de> + + * special.c (ps2png): Drop unused 'bool showpage' for WIN32. + +2010-10-01 Jan-Åke Larsson <jan-ake.larsson@liu.se> + + * special.c: Add heuristics to ignore non-rendering specials from + hyperref + +2010-09-30 Jan-Åke Larsson <jan-ake.larsson@liu.se> + + * special.c, misc.c, dvipng.h, dvipng.texi: Add option to not try + converting raw PostScript + +2010-09-29 Jan-Åke Larsson <jan-ake.larsson@liu.se> + + * special.c (ps2png): Reap zombies + + * papersiz.c: Fix bug in length decoder + +2010-09-22 Jan-Åke Larsson <jan-ake.larsson@liu.se> + + * color.c, enc.c, fontmap.c, misc.c, sfd.c: Handle CRLF correctly + +2010-09-20 Akira Kakuto <kakuto@fuk.kindai.ac.jp> + + * special.c (ps2png): fix WIN32 bug that dvipng.exe waits + infinitely for some kind of eps files. + +2010-03-17 Jan-Ake Larsson <jalar@mai.liu.se> + + * Release 1.13 + + * misc.c: Correct copyright year + + * RELEASE: Prepare for 1.13 + +2010-03-17 Peter Breitenlohner <peb@mppmu.mpg.de> + + * configure.ac: Check for kpse_set_program_name() as used in + dvipng.c instead of kpse_set_progname(). + + Support WIN32 builds (native or MinGW32). + * dvipng.h (min, max): Always undefine before defining. + * dvi.c: For WIN32 use Sleep(1000) instead of sleeep(1). + * misc.c: #include <sys/mman.h> depends on HAVE_MMAP. + * dvipng.h, font.c, misc.c: For mmap code use '#ifdef WIN32' + instead of '#ifdef MIKTEX'. + * special.c: WIN32 specific replacement for fork and pipe, using + code from Akira Kakuto, (e-mail from 23 Feb 2010 23:33:58). + +2010-03-17 Jan-Ake Larsson <jalar@mai.liu.se> + + * test_dvipng.tex: Don't use mathptmx + + * color.c, dvi.c, dvipng.h, fontmap.c, misc.c, papersiz.c, + ppagelist.c, special.c: Avoid compiler warnings + + * dvipng.texi, configure.ac: Prepare for 1.13 + + * draw.c, dvipng.h, set.c, vf.c: Adjust glyph-index bounds + test. Remove possible segfault from isprint(). + +2010-02-11 Jan-Ake Larsson <jalar@mai.liu.se> + + * color.c, draw.c, dvi.c, enc.c, font.c, fontmap.c, ft.c, + papersiz.c, pk.c, ppagelist.c, set.c, sfd.c, special.c, t1.c: + Declare functions used only in one file as static to avoid + warnings when compiling with 'gcc --Wmissing-prototypes', + suggested by Peter Breitenlohner <peb@mppmu.mpg.de> + +2010-01-28 Jan-Ake Larsson <jalar@mai.liu.se> + + * draw.c, dvipng.h, dvipng.texi, misc.c: Add width reporting + +2009-04-14 Jan-Ake Larsson <jalar@mai.liu.se> + + * fontmap.c: Make the thing build without FT2 + +2009-03-28 Jan-Ake Larsson <jalar@mai.liu.se> + + * config.h.in: Remove the last remnants of alloca + +2009-03-26 Jan-Ake Larsson <jalar@mai.liu.se> + + * configure.ac, dvipng.h: Remove the last remnants of alloca + + * draw.c, font.c, ft.c, pk.c, t1.c, vf.c: Make the name element of + the font struct a pointer, not an array + + * dvi.c, ppagelist.c: Change error msg to mention malloc + + * color.c, enc.c, pk.c, set.c, sfd.c, special.c, tfm.c: Don't use + alloca + +2009-03-25 Jan-Ake Larsson <jalar@mai.liu.se> + + * config.h.in, configure.ac: Check for libgen.h, not libgen + + * special.c: Put declarations before code + + * color.c, dvipng.h, fontmap.c, ft.c, misc.c, pk.c, set.c, t1.c, + tfm.c: Exchange #if for #ifdef + +2009-02-23 Jan-Ake Larsson <jalar@mai.liu.se> + + * Release 1.12 + + * INSTALL, README, install.texi, readme.texi, special.c: Correct + date for copyright + + * RELEASE, configure.ac, dvipng.1, dvipng.texi: Prepare for 1.12 + +2009-01-23 Jan-Ake Larsson <jalar@mai.liu.se> + + * special.c: Keep transparent background in rescaled included + bitmaps + +2008-06-04 Jan-Ake Larsson <jalar@mai.liu.se> + + * special.c: Add the color PostScript prologue + +2008-06-03 Jan-Ake Larsson <jalar@mai.liu.se> + + * dvipng.h, special.c: Support xcolor PostScript prologue + + * color.c: Support x11nam.def, fix handling of xcolor + multiple-model color values, and xcolor PostScript prologue + +2008-06-02 Jan-Ake Larsson <jalar@mai.liu.se> + + * special.c: Some (most?) literal PostScript specials seem to + depend on tex.pro and possibly special.pro, always load these + + * configure.ac: Fix gs checks + + * misc.c: Correct last mmap element + +2008-05-27 Jan-Ake Larsson <jalar@mai.liu.se> + + * readme.texi: Mention new color models in xcolor + + * color.c: Adjust for new version of xcolor, mainly color prefixes + +2008-05-14 Jan-Ake Larsson <jalar@mai.liu.se> + + * Release 1.11 + + * configure.ac, dvipng.1, dvipng.texi, RELEASE: Prepare for 1.11 + + * special.c: Fix PS inclusion regression + +2008-05-09 Jan-Ake Larsson <jalar@mai.liu.se> + + * Release 1.10 + + * RELEASE: Prepare for 1.10 + +2008-05-08 Jan-Ake Larsson <jalar@mai.liu.se> + + * special.c: Add warning about DVI code in PS environment + +2008-05-07 Jan-Ake Larsson <jalar@mai.liu.se> + + * README, readme.texi: Mention gs interpreter lib in TODO + + * aclocal.m4, configure.ac: Move gs device check so that it can be + called from different points + +2008-05-05 Jan-Ake Larsson <jalar@mai.liu.se> + + * draw.c, dvi.c, dvipng.h: Revert creation of dvi command struct + + * draw.c, dvi.c: Init dvi command struct + + * draw.c, dvi.c, dvipng.h: Create dvi command struct + + * special.c: Rearrange code + + * color.c, dvipng.h, enc.c, fontmap.c, misc.c, pk.c, sfd.c, + special.c, tfm.c, vf.c: Change name of fmmap struct element + +2008-04-29 Jan-Ake Larsson <jalar@mai.liu.se> + + * dvipng.1: Prepare for 1.10 + + * configure.ac: Prepare for 1.10, check for gdImageCreateJpeg + + * aclocal.m4: Cosmetic changes + + * special.c: Change to HAVE_...JPEG + + * dvipng.h: Remove c++ comment + + * dvipng.texi: Prepare for 1.10. Use 'active' in the 'preview' + package, remove unused text + + * Makefile.in: + Install dvipng.1 from the tarball, mark maintainer targets + +2008-02-08 Jan-Ake Larsson <jalar@mai.liu.se> + + * Makefile.in, INSTALL, README, color.c, commands.h, configure.ac, + * draw.c, dvi.c, dvipng.1, dvipng.c, dvipng.h, dvipng.texi, enc.c, + * font.c, fontmap.c, ft.c, install.texi, macros.texi, miktex.h, + * misc.c, papersiz.c, pk.c, ppagelist.c, readme.texi, set.c, sfd.c, + * special.c, t1.c, test_dvipng.tex, tfm.c, vf.c, COPYING, + * COPYING.LESSER: Change to LGPLv3 + + * install.texi: + * README: + * dvipng.texi: Add blurb about MediaWiki, and cosmetic changes + +2008-01-10 Jan-Ake Larsson <jalar@mai.liu.se> + + * set.c: Correct typo + +2007-12-12 Jan-Ake Larsson <jalar@mai.liu.se> + + * special.c: Correct header test, add proper ps::[start] and + ps::[end] detection, add code to make tikz/pgf dvips (~PostScript) + specials work + +2007-10-26 Jan-Ake Larsson <jalar@mai.liu.se> + + * draw.c: + * dvi.c: + * special.c: Change DVIGetCommand so that the command is + zero-terminated. This simplifies string operations on specials and + makes the length argument to SetSpecial unnecessary. Handle + preview-bop-hook correctly + + * special.c: Simplify PostScript header and multi-special + handling + + * color.c: + * draw.c: + * dvi.c: + * dvipng.h: + * font.c: + * ft.c: + * misc.c: + * set.c: + * special.c: + * t1.c: Split the flags variable into page_flags, option_flags and + dvi->flags + + * dvi.c: + * dvipng.c: dvi->flags resets now when the dvi is reopened + +2007-08-06 Jan-Ake Larsson <jalar@mai.liu.se> + + * ft.c: + * misc.c: + * t1.c: + * tfm.c: + * vf.c: Memory fixes + +2007-07-24 Jan-Ake Larsson <jalar@mai.liu.se> + + * special.c: Fix PostScript header usage + +2007-07-22 Jan-Ake Larsson <jalar@mai.liu.se> + + * misc.c: Change version info slightly + + * ft.c: Change debug info slightly + +2007-07-21 Jan-Ake Larsson <jalar@mai.liu.se> + + * special.c: Rewrite to allow for raw PostScript specials, also + use PostScript headers + + * dvipng.h: + * dvi.c: Add read-ahead for PostScript specials + + * config.h.in: + * configure.ac: Add test for gd pointer->image conversion + +2007-03-19 Jan-Ake Larsson <jalar@mai.liu.se> + + * draw.c: Better handling of glyph index bounds + + * set.c: Check bounds for glyph index + +2006-12-11 Jan-Ake Larsson <jalar@mai.liu.se> + + * readme.texi: Fix TODO, mention MediaWiki + + * dvipng.h: Fix for alloca under AIX + + * Makefile.in: mkinstalldirs is in $(srcdir) + +2006-11-11 Jan-Ake Larsson <jalar@mai.liu.se> + + * Release 1.9 + + * INSTALL: + * README: Update for 1.9 + + * Makefile.in: Make the test fail if fonts not found + + * configure.ac: Don't use "which". Add info about the selfauto + stuff. Report if CJK support present + + * test_dvipng.tex: Remove the (intentional) failing special + +2006-11-07 Jan-Ake Larsson <jalar@mai.liu.se> + + * fontmap.c: Don't warn if ttfonts.map is missing, fix pointer + + * Makefile.in: Adjust manpage target so manual intervention isn't + needed anymore + + * dvipng.1: Update manpage + + * dvipng.texi: Update for 1.9 + + * COPYING, Makefile.in, color.c, commands.h, configure.ac, draw.c, + dvi.c, dvipng.c, dvipng.h, dvipng.texi, enc.c, font.c, fontmap.c, + ft.c, macros.texi, miktex.h, miktex.mak, misc.c, papersiz.c, pk.c, + ppagelist.c, set.c, sfd.c, special.c, t1.c, test_dvipng.tex, + tfm.c, vf.c: Update FSF address + + * fontmap.c: Add ttfonts.map to the searched font maps + + * RELEASE: Prepare for 1.9 + +2006-11-02 Jan-Ake Larsson <jalar@mai.liu.se> + + * dvipng.texi: Nitpicking on bitmapped graphics + +2006-10-13 Jan-Ake Larsson <jalar@mai.liu.se> + + * readme.texi: Add note about subfont (CJK) support + + * install.texi: Add that FreeType2 is needed for subfont (CJK) support + +2006-10-12 Jan-Ake Larsson <jalar@mai.liu.se> + + * readme.texi: Fix todo + +2006-10-11 Jan-Ake Larsson <jalar@mai.liu.se> + + * sfd.c: Change && to || so that multiple subfonts work + + * ft.c: Adjust debug output + + * configure.ac: Add sfd.o + +2006-10-04 Jan-Ake Larsson <jalar@mai.liu.se> + + * configure.ac: Prepare for 1.9 + + * sfd.c: Only look for subfont file on recent kpathsea + + * dvipng.c, ft.c, fontmap.c, dvipng.h: Prepare for subfonts (CJK) + + * sfd.c: Added. Used for subfonts (CJK) + + * configure.ac: Change wording of gs helptext + + * ft.c: Adjust debug message, and encoding selection + + * special.c: Adjust debug messages + + * dvipng.texi: Document the --strict option + + * dvipng.c: Fix timer + + * Makefile.in: Add dist target, simplify distclean + + * fontmap.c: Remove segfault occuring for non-existent font + +2006-08-08 Jan-Ake Larsson <jalar@mai.liu.se> + + * special.c: Make showpage flag static + + * special.c: + Fix bug with -dSAFER and non-. paths, and bug with pngalpha and + background color + +2006-05-17 Jan-Ake Larsson <jalar@mai.liu.se> + + * fontmap.c: Rearrange, simplify, speed up + +2006-05-16 Jan-Ake Larsson <jalar@mai.liu.se> + + * ft.c: FT_LOAD_TARGET_LIGHT does not work in some cases, fall + back to FT_LOAD_NO_HINTING + +2006-05-08 Jan-Ake Larsson <jalar@mai.liu.se> + + * dvipng.texi: Add credit + + * Makefile.in: add www target + + * README: + * readme.texi: Update capabilities info and preview-latex link + +2006-03-30 Jan-Ake Larsson <jalar@mai.liu.se> + + * Release 1.8 + + * RELEASE: Update for 1.8 + + * set.c: + * readme.texi: + * install.texi: + * ft.c: + * dvi.c: + * draw.c: + * README: + * INSTALL: Update copyright + +2006-03-29 Jan-Ake Larsson <jalar@mai.liu.se> + + * dvipng.1: + * dvipng.texi: Document new switch, new PostScript inclusion, + rearrange and adjust + + * misc.c: + * INSTALL: + * README: + * install.texi: + * readme.texi: Minimal documentation adjustments + +2006-03-27 Jan-Ake Larsson <jalar@mai.liu.se> + + * ft.c: Change to FT_LOAD_TARGET_LIGHT + + * draw.c: Fix segfault in debug mode + + * aclocal.m4: Make sure the kpse_enc_format test fails for the + right reason only + +2006-02-27 Jan-Ake Larsson <jalar@mai.liu.se> + + * special.c: Use gs' pngalpha device, render without clipping, + adjust image position + + * set.c: Simplify code, make color cache (page-)persistent + + * draw.c: Reset new flag + + * misc.c: New switch, remove some old switches from fast-help, use + new flag name + + * dvipng.h: New flags + + * configure.ac: + * config.h.in: Simplify gd tests + + * configure.ac: + * aclocal.m4: Check gs devices + +2006-02-10 Jan-Ake Larsson <jalar@mai.liu.se> + + * special.c: Use execlp for gs call + +2006-02-03 Jan-Ake Larsson <jalar@mai.liu.se> + * special.c: + Revert message about file type, debug information is enough + + * special.c: Warn for nonexistent image decoder + +2006-02-01 Jan-Ake Larsson <jalar@mai.liu.se> + + * special.c: Warn with file type when unable to load included image + + * special.c: Read the first byte of file to be included and + compare with magic number + +2006-01-31 Jan-Ake Larsson <jalar@mai.liu.se> + + * special.c: Temporary version, just try the different image + decoders and see + + * special.c: Use correct variables + +2006-01-29 Jan-Ake Larsson <jalar@mai.liu.se> + + * special.c: Add code to check image access permission + +2006-01-28 Jan-Ake Larsson <jalar@mai.liu.se> + + * special.c: Simplify some code + + * papersiz.c: Fix rounding error for length calculation + +2006-01-26 Jan-Ake Larsson <jalar@mai.liu.se> + + * color.c: Fix typo that gave a segfault + + * config.h.in: Remove unneeded function check + + * configure.ac: Update for 1.8, remove unneeded function check + + * dvipng.h: Switch debug numbers to coincide with the manual + + * misc.c: Remove isdigit + + * special.c: Add code to include PNG, JPEG and GIF images + +2006-01-12 Jan-Ake Larsson <jalar@mai.liu.se> + + * special.c: Add a space in message + + * misc.c: Do more tests for numeric-parameter options + + * dvi.c: Outfilename: only remove .dvi extension, not others + +2005-10-11 Jan-Ake Larsson <jalar@mai.liu.se> + + * Release 1.7 + + * INSTALL: Typographic changes + + * README: + * RELEASE: + * configure.ac: + * dvipng.1: + * dvipng.texi: Adjust for 1.7 + + * install.texi: Insert space + + * miktex.h: Adjust for 1.7, I am uncertain which of the new calls + are available in the MIKTeX environment + + * readme.texi: Remove reference to my old laptop + +2005-09-30 Jan-Ake Larsson <jalar@mai.liu.se> + + * config.h.in, configure.ac, ft.c: + Only use FT_Library_Version if available + +2005-07-05 jalar <jalar@mai.liu.se> + + * Makefile.in: Enable srcdir != builddir + +2005-07-04 jalar <jalar@mai.liu.se> + + * font.c: Add length check for font name + +2005-06-28 Jan-Ake Larsson <jalar@mai.liu.se> + + * special.c: Read preview-latex version + +2005-06-27 Jan-Ake Larsson <jalar@mai.liu.se> + + * Release 1.6 + + * RELEASE: Report what fixes have been done + + * dvipng.texi: Document xcolor adaptations + + * misc.c: Add 'Transparent' in the quick-help + + * special.c: Cosmetics, do a _small_ message for bop-hook redef + +2005-06-16 Jan-Ake Larsson <jalar@mai.liu.se> + + * dvipng.h: + * dvipng.c: + * color.c: Revamp colorname interpreter for xcolor + +2005-06-14 Jan-Ake Larsson <jalar@mai.liu.se> + + * misc.c: Adjust MIKTeX stuff + +2005-06-13 Jan-Ake Larsson <jalar@mai.liu.se> + + * color.c: Don't use strtok, adjust for xcolor + + * special.c: Don't use strtok + +2005-04-25 Jan-Ake Larsson <jalar@mai.liu.se> + + * config.h.in: + * configure.ac: + * set.c: Don't do alpha blending in truecolor mode, write alpha + channel to file + +2005-04-20 Jan-Ake Larsson <jalar@mai.liu.se> + + * dvipng.texi: Add Credits + +2005-04-19 Jan-Ake Larsson <jalar@mai.liu.se> + + * dvipng.h: Fix for sys/types.h conflict in old IRIX systems + + * special.c: Adjust tightpage test + +2005-04-04 Jan-Ake Larsson <jalar@mai.liu.se> + + * special.c: Make tightpage option backwards compatible + + * RELEASE: Prepare for 1.6 + + * dvipng.1: Regenerate man page + + * configure.ac: + * dvipng.texi: + * miktex.h: Update version info + + * configure.ac: + * dvipng.texi: + * README: + * readme.texi: Update mailing list address + + * configure.ac: + * config.h.in: + * special.c: Simplify string search + +2005-04-03 Jan-Ake Larsson <jalar@mai.liu.se> + + * special.c: Try to detect all preview-latex versions tightpage + code + +2005-03-02 Jan-Ake Larsson <jalar@mai.liu.se> + + * set.c: Remove extra debug printout + + * t1.c: Sizes are given in big points in T1lib, in TeX points in + DVI files + + * ft.c: Sizes are given in big points in FreeType, in TeX points + in DVI files + + * dvipng.h: Fix boolean type again + +2005-02-10 Jan-Ake Larsson <jalar@mai.liu.se> + + * config.h.in: + * configure.ac: + * dvipng.texi: + * dvipng.h: + * misc.c: + * set.c: Add proper alpha channel + +2005-02-04 Jan-Ake Larsson <jalar@mai.liu.se> + + * color.c: + * draw.c: + * dvi.c: + * dvipng.c: + * font.c: + * ft.c: + * misc.c: + * papersiz.c: + * pk.c: + * set.c: + * special.c: + * t1.c: + * tfm.c: + * vf.c: Cosmetic changes to warnings and fatals + + * Release 1.5 + + * RELEASE: Prepare for 1.5 + + * INSTALL: + * Makefile.in: + * README: + * color.c: + * commands.h: + * configure.ac: + * draw.c: + * dvi.c: + * dvipng.1: + * dvipng.c: + * dvipng.h: + * dvipng.texi: + * enc.c: + * font.c: + * fontmap.c: + * ft.c: + * install.texi: + * macros.texi: + * miktex.h: + * misc.c: + * papersiz.c: + * pk.c: + * ppagelist.c: + * readme.texi: + * set.c: + * special.c: + * t1.c: + * test_dvipng.tex: + * tfm.c: + * vf.c: Update Copyright, set version 1.5 + +2005-02-03 Jan-Ake Larsson <jalar@mai.liu.se> + + * draw.c: + * dvipng.h: + * set.c: Fix bug in --picky mode + +2005-01-27 Jan-Ake Larsson <jalar@mai.liu.se> + + * dvipng.c: Restore --mfmode and --bdpi functionality + +2005-01-25 Jan-Ake Larsson <jalar@mai.liu.se> + + * color.c: Fix segfault when trying to find nonexisting dvipsnam + color + + * dvipng.c: Make dvipsnam colors available on command line + +2004-12-10 Jan-Ake Larsson <jalar@mai.liu.se> + + * Release 1.4 + + * RELEASE: + * configure.ac: + * dvipng.1: + * dvipng.texi: Set version 1.4 + + * README: Fix formatting + + * misc.c: Use mmap test. Hopefully, it will fail on ULTRIX, mmap + only works on character special devices (and not on regular files) + +2004-12-02 Jan-Ake Larsson <jalar@mai.liu.se> + + * config.h.in: + * configure.ac: + * dvipng.h: Move int64_t and uint64_t tests entirely to autoconf + + * dvi.c: Fix signedness + +2004-11-30 Jan-Ake Larsson <jalar@mai.liu.se> + + * misc.c: Fix NULL dereference. + +2004-11-25 Jan-Ake Larsson <jalar@mai.liu.se> + + * Release 1.3 + + * Makefile.in, README, dvipng.1, readme.texi: Fix dvigif + installation and docs + + * INSTALL: + * README: Add license + + * dvipng.c: Remove duplicate copyright + + * config.h.in: + * configure.ac: Add some tests + + * dvipng.1: + * dvipng.texi: Add some minor things + +2004-11-24 Jan-Ake Larsson <jalar@mai.liu.se> + + * config.h.in: + * configure.ac: Test for 64-bit types. + + * dvipng.h: Use char* arithmetic, not void*. And enable use of + gcc -ansi -pedantic. + + * special.c: Don't use C++ comments. + + * papersiz.c: Rewrite + + * draw.c: + * dvi.c: + * font.c: + * ft.c: + * misc.c: + * pk.c: + * tfm.c: + * vf.c: Fix signedness + +2004-11-15 Reiner Steib <Reiner.Steib@gmx.de> + + * draw.c, dvipng.c, enc.c, font.c, ft.c, pk.c, special.c, t1.c: + Don't use C++ comments. + +2004-11-05 David Kastrup <dakas@users.sourceforge.net> + + * Makefile.in (install-dvigif): Don't fail if dvigif already + exists. + +2004-11-02 Jan-Åke Larsson <jalar@mai.liu.se> + + * dvipng.h: Fix boolean type + +2004-11-01 Jan-Åke Larsson <jalar@mai.liu.se> + + * RELEASE: Update for 1.3 + + * dvipng.h: Load alloca.h when available + + * font.c: + * fontmap.c: Remove inline + + * Makefile.in: + * commands.h: + * config.h.in: + * configure.ac: + * install.texi: + * macros.texi: + * miktex.h: + * readme.texi: + * test_dvipng.tex: Add copyright notice + + * color.c: + * draw.c: + * dvi.c: + * dvipng.c: + * dvipng.h: + * enc.c: + * font.c: + * fontmap.c: + * ft.c: + * misc.c: + * papersiz.c: + * pk.c: + * ppagelist.c: + * set.c: + * special.c: + * t1.c: + * tfm.c: + * vf.c: Change c-in-a-circle to (C) + +2004-10-27 Jan-Åke Larsson <jalar@mai.liu.se> + + * dvipng.1: + * dvipng.texi: Amend docs + + * misc.c: Amend helptext + +2004-10-26 Jan-Åke Larsson <jalar@mai.liu.se> + + * set.c: + * misc.c: + * dvipng.h: Change background transparency + + * configure.ac: Bump version, add test for libz + +2004-10-07 Jan-Åke Larsson <jalar@mai.liu.se> + + * dvipng.texi: document change in -o switch + +2004-10-06 Jan-Åke Larsson <jalar@mai.liu.se> + + * set.c: Allow longer pagenumbers in output file (e.g., %06d) + +2004-08-18 Jan-Åke Larsson <jalar@mai.liu.se> + + * Release 1.2 + + * RELEASE: Change for 1.2 + + * config.h.in: Update + + * dvipng.1: change help text + + * dvipng.texi: update mailing list text. And version. + + * README: + * readme.texi: update info and todo list + + * draw.c, misc.c, dvipng.c, dvipng.h: + Add an intermediate exit status + +2004-08-17 Jan-Åke Larsson <jalar@mai.liu.se> + + * misc.c: add --gamma switch + + * special.c: Fix comment + + * set.c: + * dvipng.h: new Gamma function + + * configure.ac: libm is needed by new gamma code + + * dvipng.1: + * dvipng.texi: document new switches + + * draw.c: change name of picky flag + + * special.c: do not call ghostscript when switch given + + * misc.c: add picky and ghostscript switches + + * dvipng.h: add picky and ghostscript flags + +2004-08-06 Jan-Åke Larsson <jalar@mai.liu.se> + + * dvipng.texi: Document --png, --gif, and --picky + + * .cvsignore: Add *.gif + + * Makefile.in: Install 'dvigif' if we have GIF support + + * configure.ac: Test for gdImageGif and 'ln -s' + + * config.h.in: GIF support + + * set.c: GIF writing + + * misc.c: basename fixes, --png and --gif fixes, + --no-image-on-warn changes name to --picky + + * dvi.c: basename fixes + + * dvipng.h: Portability fixes, add GIF image flag + +2004-08-02 Jan-Åke Larsson <jalar@mai.liu.se> + + * draw.c: Fix behaviour of --no-image-on-warn + +2004-07-01 Jan-Åke Larsson <jalar@mai.liu.se> + + * miktex.mak: New, for MIKTeX + + * dvi.c: + * dvipng.c: + * dvipng.h: + * special.c: Adjust for MIKTeX + + * color.c: + * enc.c: + * font.c: + * fontmap.c: + * misc.c: + * pk.c: + * tfm.c: + * vf.c: Move file-mmapping to misc.c, adjust it for MIKTeX + +2004-06-29 Jan-Åke Larsson <jalar@mai.liu.se> + + * configure.ac: + * dvipng.h: inttypes.h not available on all platforms + + * special.c: Remove snprintf, not available on certain platforms + +2004-06-27 Jan-Åke Larsson <jalar@mai.liu.se> + + * dvipng.c: Fix case of missing font libs + + * fontmap.c: Remove debug printf + + * draw.c: Fix for case of absent font lib(s), correct typo + +2004-06-24 Jan-Åke Larsson <jalar@mai.liu.se> + + * fontmap.c: + * pk.c: + * vf.c: More memory fixes + +2004-06-21 Jan-Åke Larsson <jalar@mai.liu.se> + + * config.h.in: + * configure.ac: Test for stdbool, munmap and strtol + + * test_dvipng.tex: Change color test + + * dvipng.h: + * misc.c: + * ppagelist.c: Fix -r switch + + * dvipng.h: + * font.c: + * misc.c: + * ppagelist.c: + * special.c: + * t1.c: + * tfm.c: Use stdbool + + * color.c: + * dvi.c: + * dvipng.c: + * dvipng.h: + * enc.c: + * font.c: + * fontmap.c: + * ppagelist.c: + * special.c: Fix memory leak(s) + + * color.c: + * draw.c: + * dvi.c: + * dvipng.h: + * misc.c: + * set.c: + * special.c: Fix color stack + + * draw.c: + * dvipng.h: + * ft.c: + * pk.c: + * set.c: + * t1.c: + * tfm.c: + * vf.c: Simplify char structs + + * color.c: + * draw.c: + * dvi.c: + * dvipng.c: + * dvipng.h: + * enc.c: + * font.c: + * fontmap.c: + * ft.c: + * misc.c: + * papersiz.c: + * pk.c: + * ppagelist.c: + * set.c: + * special.c: + * t1.c: + * tfm.c: + * vf.c: Add copyright notice + +2004-05-31 Jan-Åke Larsson <jalar@mai.liu.se> + + * dvipng.1: + * configure.ac: + * RELEASE: + * INSTALL: Release 1.1 + +2004-05-26 Jan-Åke Larsson <jalar@mai.liu.se> + + * special.c: Handle source specials + + * test_dvipng.tex: Add failing special and color test + + * dvipng.c: Adjust coment about SELFAUTO... + + * dvi.c: Fix possible overflow + +2004-05-24 Jan-Åke Larsson <jalar@mai.liu.se> + + * misc.c: Remove -t, it is not implemented yet + + * dvipng.h: Undef malloc, if defined + +2004-05-18 Jan-Åke Larsson <jalar@mai.liu.se> + + * dvipng.texi: Fix build + +2004-05-14 Jan-Åke Larsson <jalar@mai.liu.se> + + * config.h.in: Use more tests + + * dvipng.1: Add documentation + + * dvipng.texi: Fix build. Revert to four-argument @node, my + makeinfo cannot handle the one-argument form (yet). + +2004-05-11 Jan-Åke Larsson <jalar@mai.liu.se> + + * configure.ac: More tests + +2004-05-09 Jan-Åke Larsson <jalar@mai.liu.se> + + * install.texi: T1lib docs + + * dvipng.1: + * dvipng.texi: Add documentation, and spellcheck + + * special.c: + * color.c: Make colors work again. + +2004-05-08 David Kastrup <dakas@users.sourceforge.net> + + * Create new ChangeLog for dvipng + +2004-05-05 Jan-Åke Larsson <jalar@mai.liu.se> + + * fontmap.c: Use both kpse_fontmap_format and + _dvips_header_ + + * enc.c: Use configure test + + * configure.ac: Add test for kpse_enc_format, reorder gd + and png tests + + * aclocal.m4: Add test for kpse_enc_format + + * special.c: More informative warnings + +2004-05-04 Jan-Åke Larsson <jalar@mai.liu.se> + + * enc.c: + Use the new kpathsea search format kpse_enc_format if available, + otherwise use kpse_tex_ps_header_format + + * fontmap.c: + Fix new kpathsea search type kpse_fontmap_format, use + kpse_dvips_config_format if not available + + * ft.c: Fix sizing + + * draw.c: Simplify LoadT1 call + + * t1.c: Shorten call, fix sizing + + * dvipng.h: Simplify char-storing structure + +2004-05-03 Jan-Åke Larsson <jalar@mai.liu.se> + + * fontmap.c, font.c, t1.c, ft.c: + Fix for ps fonts not in psfontmap + +2004-05-02 Jan-Åke Larsson <jalar@mai.liu.se> + + * Makefile.in: + * config.h.in: + * configure.ac: + * draw.c: + * dvipng.c: + * dvipng.h: + * enc.c: + * font.c: + * fontmap.c: + * ft.c: + * t1.c: + * misc.c: Add t1lib support + +2004-04-05 Jan-Åke Larsson <jalar@mai.liu.se> + + * dvipng.1: + * readme.texi: + * dvipng.texi: + * Makefile.in: Add man page + +2004-03-27 Jan-Åke Larsson <jalar@mai.liu.se> + + * dvipng.texi: Fix debug documentations + + * dvipng.c: Dont fail on --mode without --bdpi, output a warning. + +2004-03-26 Jan-Åke Larsson <jalar@mai.liu.se> + + * papersiz.c: Remove compiler warning + + * dvipng.texi: + * misc.c: Change year + +2004-03-25 Jan-Åke Larsson <jalar@mai.liu.se> + + * special.c: Revert change, not only resolution but also + offset is needed when generating png from ps + + * misc.c: Change helptext + + * configure.ac: Change version number + + * README: Checkin updated README + + * pk.c: + * ft.c: Speed up color cache + + * dvipng.texi: Add info on resolution, change version number + +2004-03-24 Jan-Åke Larsson <jalar@mai.liu.se> + + * special.c: Fix missing 'showpage' and a memory leak + + * font.c: Adjust error message + + * dvipng.h: + * ft.c: + * pk.c: Change ink darkness map + + * draw.c: Output page numbers more often. If the user has a + slow terminal he's to blame himself, not me. + + * tfm.c: Include alloca.h if present + +2004-03-23 Jan-Åke Larsson <jalar@mai.liu.se> + + * dvipng.texi: Adjust for the new -D option + +2004-03-19 dakas <dakas@users.sourceforge.net> + + * RELEASE: Remove spurious blanks. + +2004-03-19 Jan-Åke Larsson <jalar@mai.liu.se> + + * RELEASE: Update, shorten + +2004-03-18 Jan-Åke Larsson <jalar@mai.liu.se> + + * RELEASE: + * dvi.c: + * dvipng.c: + * dvipng.h: + * font.c: + * misc.c: + * papersiz.c: + * special.c: Change the behaviour of the -D switch + +2004-03-08 Jan-Åke Larsson <jalar@mai.liu.se> + + * font.c: Don't retry on PK generation failure + +2004-03-02 David Kastrup <dakas@users.sourceforge.net> + + * dvi.c (DVIOpen): Fix a buffer overrun error. diff --git a/Build/source/texk/dvipng/dvipng-src/ChangeLog.0 b/Build/source/texk/dvipng/dvipng-src/ChangeLog.0 new file mode 100644 index 00000000000..3c4689ad8c4 --- /dev/null +++ b/Build/source/texk/dvipng/dvipng-src/ChangeLog.0 @@ -0,0 +1,903 @@ +2004-01-16 Jan-Åke Larsson <jalar@mai.liu.se> + + * font.c: fix compile without FT2 + +2004-01-12 Jan-Ake Larsson <jalar@mai.liu.se> + + * RELEASE: Prepare for 0.9 + + * misc.c: Enable --expand-bbox + + * color.c: + * draw.c: + * dvipng.h: + * font.c: + * misc.c: + * special.c: Enable --no-image-on-warn + + * draw.c: + * dvi.c: + * dvipng.c: + * dvipng.h: + * readme.texi: + * special.c: Fix tightpage behaviour + +2004-01-09 Jan-Ake Larsson <jalar@mai.liu.se> + + * special.c: Add preview-latex's "tightpage" code + +2004-01-08 Jan-Ake Larsson <jalar@mai.liu.se> + + * dvipng.texi: + * configure.ac: Prepare for 0.9 + + * Makefile.in: clean target + +2004-01-07 Jan-Ake Larsson <jalar@mai.liu.se> + + * color.c: + * draw.c: + * dvi.c: + * dvipng.c: + * dvipng.h: + * enc.c: + * font.c: + * fontmap.c: + * ft.c: + * pk.c: + * set.c: + * special.c: + * tfm.c: + * vf.c: Speedup DEBUG + + * pk.c: Fix subpixel offsets + + * dvipng.c: + * dvipng.h: + * font.c: + * misc.c: + * set.c: + * special.c: Fix flags + + * draw.c: Fix bbox + + * dvipng.h: Adjust for freetype >= 2.1.6 + +2003-12-15 Jan-Ake Larsson <jalar@mai.liu.se> + + * tfm.c: + * fontmap.c: + * font.c: Fix freeeeeeeeeing + +2003-12-08 Jan-Ake Larsson <jalar@mai.liu.se> + + * dvipng.texi: + * configure.ac: + * RELEASE: Prepare for 0.8 + + * ft.c: Fix debug output + + * draw.c: + * dvipng.h: + * dvipng.texi: + * misc.c: Add --height option + + * test_dvipng.tex: A nice equation is true. Behave! + +2003-12-07 Jan-Ake Larsson <jalar@mai.liu.se> + + * enc.c: Encodings are _ps_header_s + +2003-12-05 Jan-Åke Larsson <jalar@mai.liu.se> + + * misc.c: + * dvipng.texi: + * dvipng.h: + * draw.c: Change --baseline to --depth + +2003-12-01 Jan-Ake Larsson <jalar@mai.liu.se> + + * draw.c: + * dvipng.h: + * misc.c: Change to physical pagenumbers, instead of DVI + pagenumbers. DVI pagenumbers will be indicated on STDOUT if they + differ from physical pagenumbers, but the numbering of PNG files + is physical pagenumbers. Old behaviour can be chosen with the + option -dvinum. + + * ppagelist.c: + * misc.c: + * dvipng.texi: Make negative pages render. Now -pp handles + negative pages gracefully too. Remove -pp code taken from dvips. + +2003-11-30 Jan-Ake Larsson <jalar@mai.liu.se> + + * draw.c: + * dvipng.c: + * dvipng.h: + * font.c: + * ft.c: + * misc.c: + * pk.c: + * set.c: + * tfm.c: + * vf.c: Include alloca.h when necessary, start preparing + transition to subpixel rendering, do proper cleanup on exit + +2003-11-18 Jan-Åke Larsson <jalar@mai.liu.se> + + * enc.c: Fix bug + + * ft.c: + * tfm.c: + * font.c: + * dvipng.h: Add fallback from FT to PK + +2003-11-14 Jan-Åke Larsson <jalar@mai.liu.se> + + * Makefile.in: Use $DESTDIR + +2003-11-06 Jan-Åke Larsson <jalar@mai.liu.se> + + * special.c: Fix postscript inclusion: placement and + background color + +2003-10-17 Jan-Åke Larsson <jalar@mai.liu.se> + + * misc.c: + * font.c: + * dvipng.texi: + * dvipng.h: Add option for freetype activation + + * configure.ac: Add message when freetype is present + + * ft.c: Apparently FreeType hinting is a no-no. Load glyphs + with FT_LOAD_NO_HINTING. Only then output is acceptable. + +2003-10-15 Jan-Åke Larsson <jalar@mai.liu.se> + + * fontmap.c: Remove erroneous match + +2003-10-13 Jan-Åke Larsson <jalar@mai.liu.se> + + * font.c: Fix font searching order + + * RELEASE: Prepare for 0.7 + + * fontmap.c: + * psfontmap.c: + * configure.ac: Rename psfontmap.c to fontmap.c + +2003-10-08 Jan-Ake Larsson <jalar@mai.liu.se> + + * psfontmap.c: Add third bare word: encoding + +2003-10-07 Jan-Ake Larsson <jalar@mai.liu.se> + + * misc.c: + * dvipng.texi: Allow for -- on options + + * configure.ac: Prepare for 0.7 + + * Makefile.in: Adjust hint + + * configure.ac: + * config.h.in: Fix helptext in config.h.in + + * test_dvipng.tex: Add some tests for ligatures and sizes + +2003-10-03 Jan-Åke Larsson <jalar@mai.liu.se> + + * readme.texi: Document new font support and switches + + * psfontmap.c: Redesign psfontmap loading to use the syntax + from dvips' docs + + * font.c: Enhance TrueType font finding + + * draw.c: Warn if setting char from null font + + * dvipng.h: + * color.c: Load and use psnames.def + +2003-09-28 Jan-Ake Larsson <jalar@mai.liu.se> + + * misc.c: Warn for all bad options + +2003-09-24 Jan-Ake Larsson <jalar@mai.liu.se> + + * dvipng.texi: + * install.texi: + * misc.c: Fix documentation + +2003-09-23 Jan-Ake Larsson <jalar@mai.liu.se> + + * ft.c: + * enc.c: + * dvipng.h: Only load encodings once + +2003-09-18 Jan-Åke Larsson <jalar@mai.liu.se> + + * draw.c: + * dvipng.h: + * misc.c: Add -baseline switch + +2003-09-17 Jan-Ake Larsson <jalar@mai.liu.se> + + * font.c: Remove compiler warning + + * config.h.in: + * psfontmap.c: + * dvipng.c: + * configure.ac: Fix SELFAUTO... variables if dvipng is not + being installed in main texmf tree. This will make it find config + files and fonts anyway. + +2003-09-16 Jan-Ake Larsson <jalar@mai.liu.se> + + * tfm.c: + * psfontmap.c: + * ft.c: + * enc.c: Added for postscript font handling with freetype + + * font.c: Use freetype font loading + + * dvipng.h: Add freetype-related types and declarations, + and simplify glyph rendering + + * pk.c: Simplify glyph rendering + + * dvipng.c: Init freetype + + * dvi.c: Fix strlen bugs + + * draw.c: Add FONT_TYPE_FT drawing + + * configure.ac: + * config.h.in: + * Makefile.in: Adjust for freetype things + +2003-08-29 Jan-Åke Larsson <jalar@mai.liu.se> + + * special.c: fix color handling + + * dvipng.c: Increase TIMING output + + * misc.c: + * draw.c: small speedups + + * dvipng.h: + * configure.ac: + * config.h.in: + * Makefile.in: Change handling of the DEBUG and TIMING + flags + +2003-08-26 Jan-Åke Larsson <jalar@mai.liu.se> + + * RELEASE, dvipng.texi, configure.ac: + prepare for 0.6 + + * Makefile.in: another install-docs fix + +2003-08-13 Jan-Åke Larsson <jalar@mai.liu.se> + + * configure.ac: new test (ps inclusion speedup) + + * draw.c: simplify preprocessor processing, fix SetSpecial + call + + * special.c: speedup for ps image inclusion, fix SetSpecial + call + + * Makefile.in: fix install-docs + +2003-08-04 Jan-Åke Larsson <jalar@mai.liu.se> + + * special.c: Argh!, fix compilation for non-truecolor version + + * dvipng.h: Argh!, fix image cache + + * dvipng.texi: + * configure.ac: + * RELEASE: Prepare for 0.5 + + * misc.c: + * dvipng.h: + * set.c: Add preliminary truecolor support + + * pk.c: Benchmark truecolor rendering, no real code change + + * special.c: + * misc.c: + * dvipng.h: Add preliminary image cacheing + + * draw.c: Small adjustments + +2003-07-30 Jan-Åke Larsson <jalar@mai.liu.se> + + * draw.c: Fix two bugs so that bounding box again is + correct + + * configure.ac: configuration printout improved + + +2003-07-02 Jan-Åke Larsson <jalar@mai.liu.se> + + * dvipng.h: Add prototypes + + * draw.c: minor change + + * RELEASE: prepare for 0.4 + +2003-07-01 Jan-Åke Larsson <jalar@mai.liu.se> + + * draw.c, set.c: + Fix rules (again), this time taking maxdrift into account. + + * pk.c: Unfortunately gdImageColorResolveAlpha only works + on truecolor images. Some other day, then. I did fix the + performance of PROPER_OVERSTRIKE, though. + + * readme.texi: Add todo + +2003-06-30 Jan-Åke Larsson <jalar@mai.liu.se> + + * dvipng.texi: small fixes + + * vf.c: Speedup macro start/end + + * set.c: Handle offset in draw.c only, allow choice of + compression if gd can do this + + * pk.c: Handle overstrike, either with gd alpha level, if + support exists for that, or "manually". The latter is active if + PROPER_OVERSTRIKE is #defined, currently yes, at roughly 5% + performance loss. + + * misc.c: -z option: choose compression if gd can do this + + * dvipng.h: Proper rounding, gd bells and whistles + + * draw.c: Allow drift a la dvitype, maxdrift=1, handle + offset here only, speedup vf macro start/end + + * config.h.in: + * configure.ac: New tests for gd bells and whistles + + * Makefile.in: Clean README + + * .cvsignore: More files + +2003-06-23 Jan-Åke Larsson <jalar@mai.liu.se> + + * configure.ac: + * config.h.in: Added tests for newly added C code + + * Makefile.in: + * dvipng.texi: Reflect move of readme + + * README: + * readme.texi: Moved from README to readme.texi + +2003-06-19 Jan-Åke Larsson <jalar@mai.liu.se> + + * special.c: Fix crash on file not found + + * set.c: Code reformatting + + * misc.c: Fix switches, and send warnings/errors to stderr. + + * vf.c: + * pk.c: + * draw.c: Include header only used in this file, here. + + * commands.h: Make draw.c compile without -DDEBUG + + * Makefile.in: Use --disable-debug, fix docs + generation/install, and add 'test' target. + + * README: Update info + + * configure.ac: Add --disable-debug + + * install.texi: Minor changes + + * dvipng.texi: Document difference between -pp and -p + -l + + * dvipng.h: Fix FreeBSD non-C99 header issue + +2003-06-12 Jan-Åke Larsson <jalar@mai.liu.se> + + * Makefile.in: Fix SunOS make suffix rule wierdness + + * color.c: Change comment + + * dvi.c (DVIOpen): bugfix ".dvi" completion + + * dvipng.h (PIXROUND): Round down instead of up, SetRule + now has its own rounding mechanism + + * set.c (SetRule): Refine rule drawing, make sure rule is + inside bounding box + +2003-06-10 Jan-Åke Larsson <jalar@mai.liu.se> + + * README: + * RELEASE: + * Makefile.in: + * configure.ac: + * dvipng.texi: Prepare for 0.3 + + * vf.c: + * set.c: + * pk.c: + * font.c: + * dvi.c: + * draw.c: simplify DEBUG_PRINT + + * configure.ac: Look for gs + + * special.c: Fixes to gs interaction + + * set.c: Enable -o for output file, no segfault on empty + image, reposition rule to match dvips + + * draw.c: simplify DEBUG_PRINT macro + + * dvi.c: + * misc.c: Enable -o for output file + + * dvipng.h: Enable -o for output file, simplify DEBUG_PRINT + macro + +2003-04-17 Jan-Ake Larsson <jalar@mai.liu.se> + + * install.texi: + * dvipng.texi: Rewrite stuff + + * dvipng.h: New debug flag + + * configure.ac: + * config.h.in: Configure GS_PATH + + * special.c: No tempfiles anymore. Communicate with child + through two pipes. + + * configure.ac: + * Makefile.in: Make docs + +2003-04-15 Jan-Åke Larsson <jalar@mai.liu.se> + + * macros.texi: Added + + * install.texi, dvipng.texi: Initial version + +2003-03-28 Jan-Åke Larsson <jalar@mai.liu.se> + + * README: + * RELEASE: Release 0.2, PostScript type1 font support and + PostScript inclusion. + + * configure.ac: Added configure error message about where + to find libgd. + + * dvipng.h: + * draw.c (DrawCommand): + * special.c (SetSpecial): Postscript inclusion now works. + + * misc.c (DecodeArgs): Fix --help message + + * COPYING: + * RELEASE: + * README: Added files to repository + +2003-03-12 Jan-Åke Larsson <jalar@mai.liu.se> + + * dvi.c (DVIFollowToggle): + * misc.c (DecodeArgs): + * dvipng.h: Added '-follow' switch, and code that + implements a follow mode. + +2003-02-27 Jan-Åke Larsson <jalar@mai.liu.se> + + * draw.c (DrawPages): + * misc.c (Message): Speed up slightly when not in DEBUG + mode. + + * misc.c (DecodeArgs): Adjust copyright notice. + + * set.c (SetRule): Reposition rules, one dot up. + +2003-01-30 Jan-Åke Larsson <jalar@mai.liu.se> + + * Makefile.in: + * configure.ac: Fix includes and linking + + * draw.c: + * font.c: + * pk.c: + * vf.c: + * dvipng.h (font_entry): remove unnamed union + + * dvipng.h: simplify includes + +2003-01-15 Jan-Ake Larsson <jalar@mai.liu.se> + + * misc.c: Use autoconf's stuff, use atoi, fix warning + message + + * dvipng.c: + * dvipng.h: Localize position and spacing to draw.c. Fix + timing + + * pk.c: + * set.c: + * special.c: + * vf.c: + * draw.c: Localize position and spacing to draw.c + + * configure.ac: Require gd and kpathsea + +2002-12-03 Jan-Ake Larsson <jalar@mai.liu.se> + + * draw.c: unfinished change: repairing + + * draw.c: + * font.c: + * vf.c: use void* in function call + + * dvipng.h: + * draw.c: + * color.c: + * set.c: change names of some functions + + * dvipng.h: + * draw.c: + * dvi.c: + * ppagelist.c: make dvi data more local + + * .cvsignore: + * dvipng.h: + * special.c: + * font.c: + * misc.c: + * dvipng.c: + * configure.ac: + * config.h.in: + * Makefile.in: autoconfiscate + +2002-11-07 Jan-Ake Larsson <jalar@mai.liu.se> + + * dvipng.h: + * dvipng.c (main): + * dvi.c (DVIReOpen): Don't re-init, re-open + +2002-10-31 Jan-Ake Larsson <jalar@mai.liu.se> + + * dvipng.h: + * dvi.c: Remove globals and Reopen DVI on change (check + mtime) + + * dvipng.c: Reopen DVI on change (check mtime) + +2002-10-30 Jan-Ake Larsson <jalar@mai.liu.se> + + * pk.c: Declaration moved here from dvipng.h + + * Makefile: No io.c, no pagequeue.c but ppagelist.c + + * dvipng.h: Rearranged, some new declarations + + * dvipng.c (main): minor changes + + * draw.c (DoPages): use new page-finding mechanisms + + * dvi.c: outfilename handling fixed, page-finding + mechanisms added. + + * misc.c: Ppagelist handling improved, outfilename now + works, added functionality from io.c + + * ppagelist.c: Added. Functionality slightly different from + pagequeue.c + + * pagequeue.c: Revamped. Functionality changed and moved to + ppagelist.c + + * io.c: Removed. Functionality in misc.c + + * .cvsignore: Additions + +2002-10-24 Jan-Ake Larsson <jalar@mai.liu.se> + + * dvipng.c (main): + * dvipng.h: + * misc.c (DecodeString): Improve stdin parser + +2002-10-21 Jan-Ake Larsson <jalar@mai.liu.se> + + * dvipng.h: Remove globals, fix message output + + * vf.c (SetVF, InitVF), + * font.c (FontDef), + * draw.c (DrawCommand): Bugfix VF handling, fix message + output + + * pk.c (SetPK, InitPK), + * dvi.c (DVIOpen): Fix message output + + * papersiz.c: use int32_t, fix overflow + + * misc.c (DecodeArgs, Message): Fix -d option, remove + globals, fix message output + +2002-10-16 Jan-Ake Larsson <jalar@mai.liu.se> + + * dvipng.h: Remove globals + + * dvipng.c (main): Remove globals, improve stdin parser + + * misc.c (DecodeArgs): remove globals, fix helptext + + * pagequeue.c (FindQdPage, QueuePage, QueueParse): + remove globals + + * dvi.c (FindPage): Remove unnecessary test + + * draw.c (DoPages): Do more normal read-ahead + +2002-10-15 Jan-Ake Larsson <jalar@mai.liu.se> + + * pk.c, font.c: Minor change + + * misc.c: Simplify, remove (some) globals, fix helptext + + * pagequeue.c, dvipng.h, dvipng.c, + dvi.c, draw.c: Simplify, remove (some) globals + +2002-10-14 Jan-Ake Larsson <jalar@mai.liu.se> + + * misc.c, dvipng.h, draw.c: + Added '-T tight' switch + +2002-10-11 Angus Leeming <leeming@lyx.org> + + * draw.c: + * dvi.c: + * dvipng.[ch]: + * font.c: + * io.c: + * misc.c: + * pagequeue.c: + * papersiz.c: + * pk.c: + * set.c: + * special.c: + * vf.c: remove function prototype macros. + + * dvi.c (DVIGetCommand, CommandLength): + * set.c (SetChar): add a 'break' to the end of the switch + statements (prevents a warning with gcc 3.2). + +2002-10-11 Jan-Ake Larsson <jalar@mai.liu.se> + + * special.c: Fix DEBUG, prototypes, and code pruning + + * vf.c, set.c, pk.c, io.c, + font.c, draw.c: Fix DEBUG + + * misc.c, dvi.c, pagequeue.c, + dvipng.h, dvipng.c: Fix pagelist and DEBUG + + +2002-09-20 Jan-Ake Larsson <jalar@imf.au.dk> + + * dvipng.h: change font structures, add dvi struct, remove old + global variables, include relevant bits of config.h, restructure + somewhat + + * dvipng.c: remove explicit vf stack + + * special.c: use dvi struct + + * misc.c: minor changes + + * io.c: close file descriptors, not FILE pointers. + + * draw.c: simplify, remove explicit vf stack. + + * set.c: use dvi struct, remove explicit dvi stack. + + * vf.c: use mmap, remove explicit vf stack. + + * pk.c: use mmap + + * font.c: enable dvi struct, prepare for mmap (file descriptors, + not FILE pointers), explicit vf stack removed. + + * dvi.c: use dvi struct + + * Makefile: config.h removed + + * config.h, klibtool, klibtool.config: removed. + +2002-08-30 Jan-Ake Larsson <jalar@imf.au.dk> + + * dvi.c: fix bug in STRSIZE zap + + * vf.c: simplify, fix debug info, zap STRSIZE limit + + * misc.c: Fix background transparency + + * dvipng.h, draw.c: Fix FormFeed bug (outfilename + wrong) + + * set.c: Fix FormFeed bug (outfilename wrong), and background + transparency + +2002-08-29 Jan-Ake Larsson <jalar@imf.au.dk> + + * dvipng.h: type changes, dvi-io abstraction + + * color.c: comment changed + + * dvipng.c: dvi-io abstraction + + * font.c: type changes, STRSIZE killed + + * io.c: ReadCommand and CommandLength moved to dvi.c, preparations + for mmap + + * set.c: type changes + + * vf.c, pk.c: prepare for mmap, type changes + + * pagequeue.c: type change + + * misc.c: dvi fopen moved to dvi.c, type changes + + * Makefile: pagelist.o gone, dvi.o new + + * draw.c: SetVF moved to vf.c, type and dvi-io abstraction + changes + + * commands.h: added length and debug texts + + * dvi.c: Functionality moved from pagelist.c and misc.c to + dvi.c. Still needs work, but is initial stab at proper abstraction + of dvi-reading stuff. STRSIZE killed. + + * pagelist.c: Functionality moved to dvi.c + + * special.c: DoSpecial now takes a const char* argument, as + opposed to before. + +2002-08-19 Jan-Ake Larsson <jalar@imf.au.dk> + + * misc.c: Added -mode switch + +2002-08-14 Jan-Ake Larsson <jalar@imf.au.dk> + + * dvipng.h: VF additions, general cleanup + + * dvipng.c: Small adjustments connected to the VF support + + * config.h: Remove unnecessary things + + * pagelist.c: Simplifications + + * color.c: Comment changed + + * special.c, set.c: Scale always equal h/v + + * Makefile: Make vf.o + + * io.c: Start pre-conversion to mmap. Much still to be done. + + * misc.c, set.c, font.c, pk.c, draw.c: Adjust for VF support + + * vf.c: VF support added to dvipng + +2002-06-24 Jan-Ake Larsson <jalar@imf.au.dk> + + * Makefile: Cleaned. Vacuumed, in fact. + +2002-06-19 Jan-Ake Larsson <jalar@imf.au.dk> + + * pagelist.c: remove Debug bug (!) + +2002-06-13 Jan-Ake Larsson <jalar@imf.au.dk> + + * Makefile: new object files + + * special.c, set.c, dvipng.h: cleanup + + * misc.c (ActualFactor): moved to font.c + cleanup + + * font.c (ActualFactor): moved here from misc.c + + * draw.c, dvipng.c, pagelist.c: functionality from dvipng.c spread + to these three + + * pagequeue.c, pages.c: functionality moved from pages.c to + pagequeue.c + + * commands.h: minor adjustments + +2002-06-12 Jan-Ake Larsson <jalar@imf.au.dk> + + * special.c: on unimplemented \special, give pixel position + + * misc.c: Bugfix + literal response on stdin interface + + * font.c, dvipng.h: Font handling fixed + + * dvipng.c: prompt on stdin interface + +2002-06-11 Jan-Ake Larsson <jalar@imf.au.dk> + + * set.c (SetChar): load chars on PASS_DRAW <sigh> + -T -O bug fixed + +2002-06-11 Jan-Ake Larsson <jalar@imf.au.dk> + + * set.c: Cleanup. Still buggy wrt -O, though. + + * Makefile: DEBUG on for now, postamble.? removed + + * postamble.c: Postamble is no longer read + + * pages.c: Improve page handling: now a queue, not an unordered + set + + * font.c: Improve font handling: search for fonts only when used + + * dvipng.h: Cleanup + + * dvipng.c: Major rewrite: page handling improved + + * misc.c: Fix DVI init + cleanup + +2002-05-30 Jan-Ake Larsson <jalar@imf.au.dk> + + * misc.c: Transparent border: '-bd' + + * dvipng.h, set.c: Tiding up + transparent border + + * dvipng.c, font.c: Tidying up + +2002-05-29 Jan-Ake Larsson <jalar@imf.au.dk> + + * color.c: Fix cmyk->rgb. + + * misc.c: Add '-fg' and '-bg'. + + * font.c: Tidy up + +2002-05-29 Jan-Ake Larsson <jalar@imf.au.dk> + + * dvipng.h: Tidying up, and new global vars + + * io.c: Tidying up + + * papersiz.c: Pagesize matters, adapted from dvips + + * pages.c: Page choosing, from dvips. Not sufficient for our + purposes, but a start + + * dvipng.c, color.c, Makefile, misc.c, set.c: Changed to make + pagesize (-T), offset (-O), page choosing (-pp), and output file + (-o) work. + +2002-05-27 Jan-Ake Larsson <jalar@imf.au.dk> + + * pk.c: Changed comments + + * .cvsignore, special.c, set.c, postamble.c, pk.c, misc.c, io.c, + font.c, dvipng.c, color.c, commands.h, dvipng.h: Initial version + + * config.h, Makefile: Initial version, to be replaced by + autoconf'ism + + * klibtool.config, klibtool: Included for now. To be + removed. diff --git a/Build/source/texk/dvipng/dvipng-src/INSTALL b/Build/source/texk/dvipng/dvipng-src/INSTALL new file mode 100644 index 00000000000..0fecfaa2a29 --- /dev/null +++ b/Build/source/texk/dvipng/dvipng-src/INSTALL @@ -0,0 +1,157 @@ +Installing dvipng +***************** + +Installing dvipng should be simple: merely './configure', 'make', and +'make install'. + +Prerequisites +============= + + * The GD Graphics Draw library, libgd + + The drawing library 'libgd' is necessary, and is downloadable at + <https://bitbucket.org/libgd/gd-libgd/downloads>, and there are + binary packages for most operating systems from their respective + distributors. In any case, the library installs using 'autoconf' + so it should not be difficult for you to install it from source, + and then proceed with installing dvipng. + + * The path-searching library kpathsea + + Kpathsea is most likely included in your LaTeX installation, but it + may happen that ./configure does not find it; see below. If you do + not have it, download it from <http://www.ctan.org> and compile it. + I have no experience with this, so I cannot help much here. + + * The font-rendering library FreeType 2 + + While not strictly necessary, a recent FreeType 2 is recommended + since dvipng currently will produce better-quality images when this + library is available. To take advantage of this, you should have + at least FreeType 2.1.9. + + FreeType 2 will enable direct support for PostScript and TrueType + fonts, so that dvipng will not need to generate bitmapped variants + on disk of the TeX fonts since modern TeX distributions include + PostScript versions of them. Then, you can render images at + different (and unusual) resolutions without cluttering the disk + with lots of bitmapped fonts. + + Finally, it will enable subfont support in dvipng. That is, if you + want to render CJK-LaTeX characters, you must have FreeType 2 + installed. + + * libpng and libz + + To be able to compress and write PNG files to disk, dvipng (or + really libgd) uses libpng which in turn uses libz. These should be + available on any modern system, if not, download them and install + them. + + * The 'texinfo' package + + This is needed for building the documentation. + +Configure +========= + +The first step is to configure the source code, telling it where various +files will be. To do so, run + + ./configure OPTIONS + + (Note: if you have fetched dvipng from CVS rather than a regular +release, you will have to first generate './configure' by running +'autoconf' 2.53 or later.) + + On many machines, you will not need to specify any options, but if +'configure' cannot determine something on its own, you'll need to help +it out. For a list of the options type + + ./configure --help + + On some machines, the libraries will be installed in directories that +are not in the linker's search path. This will generate an error when +running './configure', indicating that it cannot find libgd or +libkpathsea (most likely). You then need to specify the path to the +respective library's object files. They are typically called e.g., +'libgd.a' or 'libgd.so'. If they are located in e.g., '/sw/local/lib', +do + + ./configure LDFLAGS=-L/sw/local/lib + + If the library is available as a shared object file ('.so'), the +runtime linker may also need to be told where to find the library, then +use + + ./configure LDFLAGS='-L/sw/local/lib -R/sw/local/lib' + + When either of these is necessary, it is likely that the C header +files are also installed in directories that are not in the C +preprocessor's search path. This will also generate an error when +running './configure', indicating that it cannot find e.g., 'gd.h' or +'kpathsea.h' (most likely). You then need to specify the path to the +respective library's C header files. If they are located in e.g., +'/sw/local/include', do + + ./configure CPPFLAGS=-I/sw/local/include + + On my SUN Solaris workstation, I had to combine this into + + ./configure CPPFLAGS='-I/sw/local/include -I/sw/tex/teTeX/1.0/include'\ + LDFLAGS='-L/sw/local/lib -R/sw/local/lib -L/sw/tex/teTeX/1.0/lib/' + +where the backslash denotes a continuation of the line. + +Build/install +============= + +Once 'configure' has been run, simply enter + + make + +at the prompt to compile the C code, and build the documentation files. +To install the files into the locations chosen earlier, type + + make install + +You may need special privileges to install, e.g., if you are installing +into system directories. + +Installation outside the texmf tree +=================================== + +In some cases, a dvipng binary installed outside the texmf tree will not +be able to find virtual fonts, or the PostScript font maps (normally +used by dvips). This may be because _only_ $SELFAUTOLOC, $SELFAUTODIR, +and $SELFAUTOPARENT are used in the texmf tree configuration file +'texmf.cnf'. If so, give the switch '--enable-selfauto-set' to +'./configure'. This will make dvipng adjust these three internally so +that kpathsea thinks that dvipng _is_ installed in the texmf tree. + +Installation for non-privileged users +===================================== + +Often people without system administration privileges want to install +software for their private use. In that case you need to specify more +options to the 'configure' script, usually this is done by using the +'--prefix' option to the 'configure' script, and let it point to the +personal home directory. In that way, resulting binaries will be +installed under the 'bin' subdirectory of your home directory, manual +pages under 'man' and so on. That way, it is reasonably easy to +maintain a bunch of additional packages, since the prefix argument is +supported by most 'configure' scripts. + + You'll have to add something like '/home/myself/bin' to your 'PATH' +shell variable, if it isn't there already, and similarly set the +'INFOPATH' and 'MANPATH' variables to be able to access the +documentation. + +Copying +======= + +This program is released under the GNU Lesser General Public License +version 3, see the COPYING file in the dvipng distribution or +<http://www.gnu.org/licenses/>. + + Copyright (C) 2002-2015, 2019 Jan-AAke Larsson diff --git a/Build/source/texk/dvipng/dvipng-src/Makefile.in b/Build/source/texk/dvipng/dvipng-src/Makefile.in new file mode 100644 index 00000000000..d57b925324a --- /dev/null +++ b/Build/source/texk/dvipng/dvipng-src/Makefile.in @@ -0,0 +1,170 @@ +# Makefile is generated by 'configure' from Makefile.in + +#************************************************************************ +# +# Part of the dvipng distribution +# +# This program is free software: you can redistribute it and/or modify +# it under the terms of the GNU Lesser General Public License as +# published by the Free Software Foundation, either version 3 of the +# License, or (at your option) any later version. +# +# This program is distributed in the hope that it will be useful, but +# WITHOUT ANY WARRANTY; without even the implied warranty of +# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU +# Lesser General Public License for more details. +# +# You should have received a copy of the GNU Lesser General Public +# License along with this program. If not, see +# <http://www.gnu.org/licenses/>. +# +# Copyright (C) 2002-2015 Jan-Åke Larsson +# +#************************************************************************ + +PACKAGE_STRING="@PACKAGE_STRING@" + +CC = @CC@ +CFLAGS = @CFLAGS@ -Wall +CPPFLAGS = @CPPFLAGS@ -I. +LN_S = @LN_S@ + +LIBS = @LIBS@ +LDFLAGS = @LDFLAGS@ + +srcdir = @srcdir@ +VPATH = @srcdir@ + +prefix = @prefix@ +exec_prefix = @exec_prefix@ +bindir = @bindir@ +infodir = @infodir@ +mandir = @mandir@ +datarootdir = @datarootdir@ +DESTDIR= +INSTALL = @INSTALL@ +INSTALL_DATA = @INSTALL_DATA@ +MKINSTALLDIRS = $(srcdir)/mkinstalldirs + +MAKEINFO=@MAKEINFO@ @MAKEINFO_MACROS@ +INSTALL_INFO=@INSTALL_INFO@ +TEX=tex +TEXIDVI=texi2dvi +TEXIHTML=texi2html +DVIPS=dvips +TEXIFILES = dvipng.texi readme.texi install.texi macros.texi dvipng.help + +objects = dvipng.o color.o draw.o dvi.o font.o misc.o pk.o \ + set.o special.o papersiz.o ppagelist.o \ + vf.o @PSFONTS_O@ + +all: dvipng docs + +install: @INSTALL_BIN_TARGET@ @INSTALL_BIN_TARGET@-docs + +####################################### The program + +dvipng: $(objects) + $(CC) $(LDFLAGS) $(objects) -o dvipng $(LIBS) + +$(objects): dvipng.h commands.h config.h + +install-dvipng: dvipng + -$(MKINSTALLDIRS) $(DESTDIR)$(bindir) + $(INSTALL) dvipng $(DESTDIR)$(bindir) + +install-dvigif: install-dvipng + (cd $(DESTDIR)$(bindir) && rm -f dvigif && $(LN_S) dvipng dvigif) + +####################################### The documentation + +docs: dvipng.dvi dvipng.info + +dvipng.dvi: $(TEXIFILES) + -$(TEXIDVI) -I $(srcdir) $(srcdir)/dvipng.texi + +dvipng.ps: dvipng.dvi + $(DVIPS) -Ppdf dvipng.dvi + +dvipng.info: $(TEXIFILES) dvipng.help + -$(MAKEINFO) -I$(srcdir) $(srcdir)/dvipng.texi + +dvipng.help: dvipng + -./dvipng > dvipng.tmp + ( test -r dvipng.help && diff dvipng.tmp dvipng.help ) \ + || cp dvipng.tmp dvipng.help + rm -f dvipng.tmp + +www: $(TEXIFILES) dvipng.help + mkdir -p www + texi2html -split chapter -nosec-nav -subdir html \ + -I $(srcdir) $(srcdir)/dvipng.texi + (cd html; for i in *; do \ + sed -e "s/Jan-A/Jan-\Å\;/g" $$i > ../www/$$i; \ + done) + cp www/dvipng.html www/index.html + rm -rf html + +dvipng_mono.html: $(TEXIFILES) dvipng.help + texi2html --monolithic -nomenu -nosec_nav -o dvipng_mono.html \ + -I $(srcdir) $(srcdir)/dvipng.texi + +install-docs: docs + -$(MKINSTALLDIRS) $(DESTDIR)$(infodir) + for x in dvipng.info* ; do \ + $(INSTALL_DATA) $$x $(DESTDIR)$(infodir) ; \ + done + -$(INSTALL_INFO) --info-dir=$(DESTDIR)$(infodir) dvipng.info + -$(MKINSTALLDIRS) $(DESTDIR)$(mandir)/man1 + $(INSTALL_DATA) $(srcdir)/dvipng.1 $(DESTDIR)$(mandir)/man1 + +install-dvipng-docs: install-docs + +install-dvigif-docs: install-docs + (cd $(DESTDIR)$(mandir)/man1 && rm -f dvigif.1 && $(LN_S) dvipng.1 dvigif.1) + +####################################### The test + +test: test_dvipng.dvi dvipng + ./dvipng -T tight -strict test_dvipng + echo View the result e.g. with xv test_dvipng\*.png + +test_dvipng.dvi: test_dvipng.tex + latex $(srcdir)/test_dvipng.tex + +####################################### The cleaning up + +clean: + rm -f *.o dvipng *.help *.info* *dvipng.dvi *.aux *.log + rm -f *dvipng*.png *.cp *.fn *.ky *~ \#*\# \ + *.tp *.vr *.pg *.toc *.tp *.bak *.cps *.kys *.tps \ + *.fns *.vrs *.pgs *.html *.tmp + +distclean: clean + rm -f Makefile + rm -f config.status config.log config.cache c-auto.h + rm -rf autom4te.cache + +####################################### Maintainer targets + +INSTALL: install.texi + -$(MAKEINFO) -D rawfile --no-headers --no-validate \ + --no-number-sections \ + -I$(srcdir) $(srcdir)/install.texi --output INSTALL + +README: readme.texi + -$(MAKEINFO) -D rawfile --no-headers --no-validate \ + --no-number-sections \ + -I$(srcdir) $(srcdir)/readme.texi --output README + +dvipng.1: dvipng.texi readme.texi + ~/bin/texi2pod.pl -D man $(srcdir)/dvipng.texi | \ + sed -es/@//g -es/previewlatex/preview-latex/g -es/{}//g > dvipng.pod + pod2man --center="User commands" --release=$(PACKAGE_STRING)\ + dvipng.pod > dvipng.1 + rm dvipng.pod + +dist: INSTALL README dvipng.1 distclean + +# SunOS make suffix rule wierdness +.cps.h: diff --git a/Build/source/texk/dvipng/dvipng-src/README b/Build/source/texk/dvipng/dvipng-src/README new file mode 100644 index 00000000000..a4e78345058 --- /dev/null +++ b/Build/source/texk/dvipng/dvipng-src/README @@ -0,0 +1,126 @@ +dvipng +****** + +This program makes PNG and/or GIF graphics from DVI files as obtained +from TeX and its relatives. + + If GIF support is enabled, GIF output is chosen by using the 'dvigif' +binary or with the '--gif' option. + + It is intended to produce anti-aliased screen-resolution images as +fast as is possible. The target audience is people who need to generate +and regenerate many images again and again. The primary target is the +preview-latex (X)Emacs package, a package to preview formulas from +within (X)Emacs. Yes, you get to see your formulas in the (X)Emacs +buffer, see <http://www.gnu.org/software/auctex/preview-latex.html>. + + Another example is WeBWorK, an internet-based method for delivering +homework problems to students over the internet, giving students instant +feedback as to whether or not their answers are correct, see +<http://webwork.math.rochester.edu>. + + A more recent addition to the dvipng-using applications out there is +MediaWiki, the software behind Wikipedia and many other wikis out there. +Dvipng is used to render mathematical formulae from version 1.8.0 of +MediaWiki, see <http://www.mediawiki.org>. + + Other applications may also benefit, like web applications as +latex2html and WYSIWYG editors like LyX. + +Benefits of dvipng +================== + +The benefits of 'dvipng'/'dvigif' include + + * Speed. It is a very fast bitmap-rendering code for DVI files, + which makes it suitable for generating large amounts of images + on-the-fly, as needed in preview-latex, WeBWorK and others. + + * It does not read the postamble, so it can be started before TeX + finishes. There is a '--follow' switch that makes dvipng wait at + end-of-file for further output, unless it finds the POST marker + that indicates the end of the DVI. + + * Interactive query of options. dvipng can read options + interactively through stdin, and all options are usable. It is + even possible to change the input file through this interface. + + * Supports PK, VF, PostScript Type1, and TrueType fonts, subfonts + (i.e., as used in CJK-LaTeX), color specials, and inclusion of + PostScript, PNG, JPEG or GIF images. + + * and more... + +Installation +============ + +Read 'INSTALL', included in the distribution. + +Usage +===== + +To use dvipng at its simplest, simply type + + dvipng foo + +where 'foo.dvi' is the output of TeX that you want to convert to PNG +format. If there are four pages in 'foo.dvi', those pages will be +output as 'foo1.png', 'foo2.png', 'foo3.png', and 'foo4.png', +respectively. + + Many options are available (see the info manual). For a brief +summary of available options, just type + + dvipng --help + +Availability +============ + +The dvipng package is available at Savannah, the GNU project site. +Since dvipng is not part of the GNU project, although released under the +GNU GPL, the web address is +<http://savannah.nongnu.org/projects/dvipng>. Instructions for +anonymous CVS access can be found at +<http://savannah.nongnu.org/cvs/?group=dvipng>. + +Contacts +======== + +Bug reports should be sent to <dvipng@nongnu.org>. + + Questions, suggestions for new features, pleas for help, and/or +praise should go to <dvipng@nongnu.org>. For more information on this +mailing list, send a message with just the word 'help' as subject or +body to <dvipng-request@nongnu.org> or look at +<http://lists.nongnu.org/mailman/listinfo/dvipng>. + + Offers to support further development will be appreciated. For +developer access, ask on <dvipng@nongnu.org>. + +Copying +======= + +This program is released under the GNU Lesser General Public License +version 3, see the COPYING file in the dvipng distribution or +<http://www.gnu.org/licenses/>. + + Copyright (C) 2002-2014 Jan-AAke Larsson + +Todo +==== + + * Use gs interpreter library for speed and possibly for + functionality. + + * Add more color models for xcolor compatibility + + * Enable a named pipe as DVI + + * Further speed improvements. + + * Other output specials and source specials. + + * Clean internal structures. Overhaul file handling. + + * Fix the SELFAUTO stuff at runtime rather than at build time + diff --git a/Build/source/texk/dvipng/dvipng-src/RELEASE b/Build/source/texk/dvipng/dvipng-src/RELEASE new file mode 100644 index 00000000000..5417af0f867 --- /dev/null +++ b/Build/source/texk/dvipng/dvipng-src/RELEASE @@ -0,0 +1,10 @@ +Release notes for version 1.17 of the dvipng package: + +This program makes PNG graphics from DVI files as obtained from TeX +and its relatives. + + +This is a bugfix release that re-enables PK font rendering and enables gamma printout and interactive mode startup without DVI. + + +Report any bugs you find, see README for instructions. diff --git a/Build/source/texk/dvipng/dvipng-src/acinclude.m4 b/Build/source/texk/dvipng/dvipng-src/acinclude.m4 new file mode 100644 index 00000000000..2bc2d6cd870 --- /dev/null +++ b/Build/source/texk/dvipng/dvipng-src/acinclude.m4 @@ -0,0 +1,104 @@ +# acinclude.m4 + +#************************************************************************ +# +# Part of the dvipng distribution +# +# This program is free software: you can redistribute it and/or modify +# it under the terms of the GNU Lesser General Public License as +# published by the Free Software Foundation, either version 3 of the +# License, or (at your option) any later version. +# +# This program is distributed in the hope that it will be useful, but +# WITHOUT ANY WARRANTY; without even the implied warranty of +# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU +# Lesser General Public License for more details. +# +# You should have received a copy of the GNU Lesser General Public +# License along with this program. If not, see +# <http://www.gnu.org/licenses/>. +# +# Copyright (C) 2002-2015,2019 Jan-Ã
ke Larsson +# +#************************************************************************ + + +dnl +dnl MAKEINFO_CHECK_MACRO( MACRO, [ACTION-IF-FOUND +dnl [, ACTION-IF-NOT-FOUND]]) +dnl +AC_DEFUN([MAKEINFO_CHECK_MACRO], +[if test -n "$MAKEINFO" -a "$makeinfo" != ":"; then + AC_MSG_CHECKING([for @$1{}]) + echo \\\\input texinfo > conftest.texi + echo @$1{test} >> conftest.texi + if $MAKEINFO conftest.texi > /dev/null 2> /dev/null; then + AC_MSG_RESULT(yes) + ifelse([$2], , :, [$2]) + else + AC_MSG_RESULT(no) + ifelse([$3], , :, [$3]) + fi + rm -f conftest.texi conftest.info +fi +]) + +dnl +dnl MAKEINFO_CHECK_MACROS( MACRO ... [, ACTION-IF-FOUND +dnl [, ACTION-IF-NOT-FOUND]]) +dnl +AC_DEFUN([MAKEINFO_CHECK_MACROS], +[for ac_macro in $1; do + MAKEINFO_CHECK_MACRO($ac_macro, $2, + [MAKEINFO_MACROS="-D no-$ac_macro $MAKEINFO_MACROS" + $3])dnl + done +AC_SUBST(MAKEINFO_MACROS) +]) + + +dnl +dnl Check for enc, cmap, sfd formats +dnl +AC_DEFUN([AC_HAS_KPSE_ENC_FORMATS], + [AC_MSG_CHECKING([for kpse_enc_format]) + AC_TRY_COMPILE([ + #include <stdio.h> + #include <kpathsea/kpathsea.h>], + [kpse_enc_format;kpse_cmap_format;kpse_sfd_format], + [AC_MSG_RESULT(yes) + AC_DEFINE(HAVE_KPSE_ENC_FORMATS, 1, + [Define to 1 if your kpathsea has kpse_enc_format])], + [AC_MSG_RESULT(no)])]) + + +dnl +dnl Check devices for GS +dnl AC_GS_HAS_DEVICE(DEVICE,ACTION-IF-FAILED) +dnl +AC_DEFUN([AC_GS_HAS_DEVICE], + [AC_MSG_CHECKING([whether $GS has the $1 device]) + if $GS -h | grep $1 >/dev/null; then + AC_MSG_RESULT(yes) + else + AC_MSG_RESULT(no) + $2 + fi +]) + +dnl +dnl GS_CHECK_DEVICES +dnl +AC_DEFUN([GS_CHECK_DEVICES], + [GS_WARN="" + AC_GS_HAS_DEVICE(pngalpha, + [GS_WARN="Your EPS inclusions will be cropped to the + boundingbox, and rendered on an opaque background. + Upgrade GhostScript to avoid this." + AC_GS_HAS_DEVICE(png16m, + [GS_WARN="Your EPS inclusions may not work. + Upgrade/install GhostScript to avoid this."])]) + if test -n "$GS_WARN"; then + AC_MSG_WARN([$GS_WARN]) + fi +]) diff --git a/Build/source/texk/dvipng/dvipng-src/aclocal.m4 b/Build/source/texk/dvipng/dvipng-src/aclocal.m4 new file mode 100644 index 00000000000..a8189afc3f3 --- /dev/null +++ b/Build/source/texk/dvipng/dvipng-src/aclocal.m4 @@ -0,0 +1,291 @@ +# generated automatically by aclocal 1.15.1 -*- Autoconf -*- + +# Copyright (C) 1996-2017 Free Software Foundation, Inc. + +# This file is free software; the Free Software Foundation +# gives unlimited permission to copy and/or distribute it, +# with or without modifications, as long as this notice is preserved. + +# This program is distributed in the hope that it will be useful, +# but WITHOUT ANY WARRANTY, to the extent permitted by law; without +# even the implied warranty of MERCHANTABILITY or FITNESS FOR A +# PARTICULAR PURPOSE. + +m4_ifndef([AC_CONFIG_MACRO_DIRS], [m4_defun([_AM_CONFIG_MACRO_DIRS], [])m4_defun([AC_CONFIG_MACRO_DIRS], [_AM_CONFIG_MACRO_DIRS($@)])]) +dnl pkg.m4 - Macros to locate and utilise pkg-config. -*- Autoconf -*- +dnl serial 11 (pkg-config-0.29.1) +dnl +dnl Copyright © 2004 Scott James Remnant <scott@netsplit.com>. +dnl Copyright © 2012-2015 Dan Nicholson <dbn.lists@gmail.com> +dnl +dnl This program is free software; you can redistribute it and/or modify +dnl it under the terms of the GNU General Public License as published by +dnl the Free Software Foundation; either version 2 of the License, or +dnl (at your option) any later version. +dnl +dnl This program is distributed in the hope that it will be useful, but +dnl WITHOUT ANY WARRANTY; without even the implied warranty of +dnl MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU +dnl General Public License for more details. +dnl +dnl You should have received a copy of the GNU General Public License +dnl along with this program; if not, write to the Free Software +dnl Foundation, Inc., 59 Temple Place - Suite 330, Boston, MA +dnl 02111-1307, USA. +dnl +dnl As a special exception to the GNU General Public License, if you +dnl distribute this file as part of a program that contains a +dnl configuration script generated by Autoconf, you may include it under +dnl the same distribution terms that you use for the rest of that +dnl program. + +dnl PKG_PREREQ(MIN-VERSION) +dnl ----------------------- +dnl Since: 0.29 +dnl +dnl Verify that the version of the pkg-config macros are at least +dnl MIN-VERSION. Unlike PKG_PROG_PKG_CONFIG, which checks the user's +dnl installed version of pkg-config, this checks the developer's version +dnl of pkg.m4 when generating configure. +dnl +dnl To ensure that this macro is defined, also add: +dnl m4_ifndef([PKG_PREREQ], +dnl [m4_fatal([must install pkg-config 0.29 or later before running autoconf/autogen])]) +dnl +dnl See the "Since" comment for each macro you use to see what version +dnl of the macros you require. +m4_defun([PKG_PREREQ], +[m4_define([PKG_MACROS_VERSION], [0.29.1]) +m4_if(m4_version_compare(PKG_MACROS_VERSION, [$1]), -1, + [m4_fatal([pkg.m4 version $1 or higher is required but ]PKG_MACROS_VERSION[ found])]) +])dnl PKG_PREREQ + +dnl PKG_PROG_PKG_CONFIG([MIN-VERSION]) +dnl ---------------------------------- +dnl Since: 0.16 +dnl +dnl Search for the pkg-config tool and set the PKG_CONFIG variable to +dnl first found in the path. Checks that the version of pkg-config found +dnl is at least MIN-VERSION. If MIN-VERSION is not specified, 0.9.0 is +dnl used since that's the first version where most current features of +dnl pkg-config existed. +AC_DEFUN([PKG_PROG_PKG_CONFIG], +[m4_pattern_forbid([^_?PKG_[A-Z_]+$]) +m4_pattern_allow([^PKG_CONFIG(_(PATH|LIBDIR|SYSROOT_DIR|ALLOW_SYSTEM_(CFLAGS|LIBS)))?$]) +m4_pattern_allow([^PKG_CONFIG_(DISABLE_UNINSTALLED|TOP_BUILD_DIR|DEBUG_SPEW)$]) +AC_ARG_VAR([PKG_CONFIG], [path to pkg-config utility]) +AC_ARG_VAR([PKG_CONFIG_PATH], [directories to add to pkg-config's search path]) +AC_ARG_VAR([PKG_CONFIG_LIBDIR], [path overriding pkg-config's built-in search path]) + +if test "x$ac_cv_env_PKG_CONFIG_set" != "xset"; then + AC_PATH_TOOL([PKG_CONFIG], [pkg-config]) +fi +if test -n "$PKG_CONFIG"; then + _pkg_min_version=m4_default([$1], [0.9.0]) + AC_MSG_CHECKING([pkg-config is at least version $_pkg_min_version]) + if $PKG_CONFIG --atleast-pkgconfig-version $_pkg_min_version; then + AC_MSG_RESULT([yes]) + else + AC_MSG_RESULT([no]) + PKG_CONFIG="" + fi +fi[]dnl +])dnl PKG_PROG_PKG_CONFIG + +dnl PKG_CHECK_EXISTS(MODULES, [ACTION-IF-FOUND], [ACTION-IF-NOT-FOUND]) +dnl ------------------------------------------------------------------- +dnl Since: 0.18 +dnl +dnl Check to see whether a particular set of modules exists. Similar to +dnl PKG_CHECK_MODULES(), but does not set variables or print errors. +dnl +dnl Please remember that m4 expands AC_REQUIRE([PKG_PROG_PKG_CONFIG]) +dnl only at the first occurence in configure.ac, so if the first place +dnl it's called might be skipped (such as if it is within an "if", you +dnl have to call PKG_CHECK_EXISTS manually +AC_DEFUN([PKG_CHECK_EXISTS], +[AC_REQUIRE([PKG_PROG_PKG_CONFIG])dnl +if test -n "$PKG_CONFIG" && \ + AC_RUN_LOG([$PKG_CONFIG --exists --print-errors "$1"]); then + m4_default([$2], [:]) +m4_ifvaln([$3], [else + $3])dnl +fi]) + +dnl _PKG_CONFIG([VARIABLE], [COMMAND], [MODULES]) +dnl --------------------------------------------- +dnl Internal wrapper calling pkg-config via PKG_CONFIG and setting +dnl pkg_failed based on the result. +m4_define([_PKG_CONFIG], +[if test -n "$$1"; then + pkg_cv_[]$1="$$1" + elif test -n "$PKG_CONFIG"; then + PKG_CHECK_EXISTS([$3], + [pkg_cv_[]$1=`$PKG_CONFIG --[]$2 "$3" 2>/dev/null` + test "x$?" != "x0" && pkg_failed=yes ], + [pkg_failed=yes]) + else + pkg_failed=untried +fi[]dnl +])dnl _PKG_CONFIG + +dnl _PKG_SHORT_ERRORS_SUPPORTED +dnl --------------------------- +dnl Internal check to see if pkg-config supports short errors. +AC_DEFUN([_PKG_SHORT_ERRORS_SUPPORTED], +[AC_REQUIRE([PKG_PROG_PKG_CONFIG]) +if $PKG_CONFIG --atleast-pkgconfig-version 0.20; then + _pkg_short_errors_supported=yes +else + _pkg_short_errors_supported=no +fi[]dnl +])dnl _PKG_SHORT_ERRORS_SUPPORTED + + +dnl PKG_CHECK_MODULES(VARIABLE-PREFIX, MODULES, [ACTION-IF-FOUND], +dnl [ACTION-IF-NOT-FOUND]) +dnl -------------------------------------------------------------- +dnl Since: 0.4.0 +dnl +dnl Note that if there is a possibility the first call to +dnl PKG_CHECK_MODULES might not happen, you should be sure to include an +dnl explicit call to PKG_PROG_PKG_CONFIG in your configure.ac +AC_DEFUN([PKG_CHECK_MODULES], +[AC_REQUIRE([PKG_PROG_PKG_CONFIG])dnl +AC_ARG_VAR([$1][_CFLAGS], [C compiler flags for $1, overriding pkg-config])dnl +AC_ARG_VAR([$1][_LIBS], [linker flags for $1, overriding pkg-config])dnl + +pkg_failed=no +AC_MSG_CHECKING([for $1]) + +_PKG_CONFIG([$1][_CFLAGS], [cflags], [$2]) +_PKG_CONFIG([$1][_LIBS], [libs], [$2]) + +m4_define([_PKG_TEXT], [Alternatively, you may set the environment variables $1[]_CFLAGS +and $1[]_LIBS to avoid the need to call pkg-config. +See the pkg-config man page for more details.]) + +if test $pkg_failed = yes; then + AC_MSG_RESULT([no]) + _PKG_SHORT_ERRORS_SUPPORTED + if test $_pkg_short_errors_supported = yes; then + $1[]_PKG_ERRORS=`$PKG_CONFIG --short-errors --print-errors --cflags --libs "$2" 2>&1` + else + $1[]_PKG_ERRORS=`$PKG_CONFIG --print-errors --cflags --libs "$2" 2>&1` + fi + # Put the nasty error message in config.log where it belongs + echo "$$1[]_PKG_ERRORS" >&AS_MESSAGE_LOG_FD + + m4_default([$4], [AC_MSG_ERROR( +[Package requirements ($2) were not met: + +$$1_PKG_ERRORS + +Consider adjusting the PKG_CONFIG_PATH environment variable if you +installed software in a non-standard prefix. + +_PKG_TEXT])[]dnl + ]) +elif test $pkg_failed = untried; then + AC_MSG_RESULT([no]) + m4_default([$4], [AC_MSG_FAILURE( +[The pkg-config script could not be found or is too old. Make sure it +is in your PATH or set the PKG_CONFIG environment variable to the full +path to pkg-config. + +_PKG_TEXT + +To get pkg-config, see <http://pkg-config.freedesktop.org/>.])[]dnl + ]) +else + $1[]_CFLAGS=$pkg_cv_[]$1[]_CFLAGS + $1[]_LIBS=$pkg_cv_[]$1[]_LIBS + AC_MSG_RESULT([yes]) + $3 +fi[]dnl +])dnl PKG_CHECK_MODULES + + +dnl PKG_CHECK_MODULES_STATIC(VARIABLE-PREFIX, MODULES, [ACTION-IF-FOUND], +dnl [ACTION-IF-NOT-FOUND]) +dnl --------------------------------------------------------------------- +dnl Since: 0.29 +dnl +dnl Checks for existence of MODULES and gathers its build flags with +dnl static libraries enabled. Sets VARIABLE-PREFIX_CFLAGS from --cflags +dnl and VARIABLE-PREFIX_LIBS from --libs. +dnl +dnl Note that if there is a possibility the first call to +dnl PKG_CHECK_MODULES_STATIC might not happen, you should be sure to +dnl include an explicit call to PKG_PROG_PKG_CONFIG in your +dnl configure.ac. +AC_DEFUN([PKG_CHECK_MODULES_STATIC], +[AC_REQUIRE([PKG_PROG_PKG_CONFIG])dnl +_save_PKG_CONFIG=$PKG_CONFIG +PKG_CONFIG="$PKG_CONFIG --static" +PKG_CHECK_MODULES($@) +PKG_CONFIG=$_save_PKG_CONFIG[]dnl +])dnl PKG_CHECK_MODULES_STATIC + + +dnl PKG_INSTALLDIR([DIRECTORY]) +dnl ------------------------- +dnl Since: 0.27 +dnl +dnl Substitutes the variable pkgconfigdir as the location where a module +dnl should install pkg-config .pc files. By default the directory is +dnl $libdir/pkgconfig, but the default can be changed by passing +dnl DIRECTORY. The user can override through the --with-pkgconfigdir +dnl parameter. +AC_DEFUN([PKG_INSTALLDIR], +[m4_pushdef([pkg_default], [m4_default([$1], ['${libdir}/pkgconfig'])]) +m4_pushdef([pkg_description], + [pkg-config installation directory @<:@]pkg_default[@:>@]) +AC_ARG_WITH([pkgconfigdir], + [AS_HELP_STRING([--with-pkgconfigdir], pkg_description)],, + [with_pkgconfigdir=]pkg_default) +AC_SUBST([pkgconfigdir], [$with_pkgconfigdir]) +m4_popdef([pkg_default]) +m4_popdef([pkg_description]) +])dnl PKG_INSTALLDIR + + +dnl PKG_NOARCH_INSTALLDIR([DIRECTORY]) +dnl -------------------------------- +dnl Since: 0.27 +dnl +dnl Substitutes the variable noarch_pkgconfigdir as the location where a +dnl module should install arch-independent pkg-config .pc files. By +dnl default the directory is $datadir/pkgconfig, but the default can be +dnl changed by passing DIRECTORY. The user can override through the +dnl --with-noarch-pkgconfigdir parameter. +AC_DEFUN([PKG_NOARCH_INSTALLDIR], +[m4_pushdef([pkg_default], [m4_default([$1], ['${datadir}/pkgconfig'])]) +m4_pushdef([pkg_description], + [pkg-config arch-independent installation directory @<:@]pkg_default[@:>@]) +AC_ARG_WITH([noarch-pkgconfigdir], + [AS_HELP_STRING([--with-noarch-pkgconfigdir], pkg_description)],, + [with_noarch_pkgconfigdir=]pkg_default) +AC_SUBST([noarch_pkgconfigdir], [$with_noarch_pkgconfigdir]) +m4_popdef([pkg_default]) +m4_popdef([pkg_description]) +])dnl PKG_NOARCH_INSTALLDIR + + +dnl PKG_CHECK_VAR(VARIABLE, MODULE, CONFIG-VARIABLE, +dnl [ACTION-IF-FOUND], [ACTION-IF-NOT-FOUND]) +dnl ------------------------------------------- +dnl Since: 0.28 +dnl +dnl Retrieves the value of the pkg-config variable for the given module. +AC_DEFUN([PKG_CHECK_VAR], +[AC_REQUIRE([PKG_PROG_PKG_CONFIG])dnl +AC_ARG_VAR([$1], [value of $3 for $2, overriding pkg-config])dnl + +_PKG_CONFIG([$1], [variable="][$3]["], [$2]) +AS_VAR_COPY([$1], [pkg_cv_][$1]) + +AS_VAR_IF([$1], [""], [$5], [$4])dnl +])dnl PKG_CHECK_VAR + +m4_include([acinclude.m4]) diff --git a/Build/source/texk/dvipng/dvipng-src/color.c b/Build/source/texk/dvipng/dvipng-src/color.c new file mode 100644 index 00000000000..76cb7004a4a --- /dev/null +++ b/Build/source/texk/dvipng/dvipng-src/color.c @@ -0,0 +1,440 @@ +/* color.c */ + +/************************************************************************ + + Part of the dvipng distribution + + This program is free software: you can redistribute it and/or modify + it under the terms of the GNU Lesser General Public License as + published by the Free Software Foundation, either version 3 of the + License, or (at your option) any later version. + + This program is distributed in the hope that it will be useful, but + WITHOUT ANY WARRANTY; without even the implied warranty of + MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU + Lesser General Public License for more details. + + You should have received a copy of the GNU Lesser General Public + License along with this program. If not, see + <http://www.gnu.org/licenses/>. + + Copyright (C) 2002-2015,2019 Jan-Åke Larsson + +************************************************************************/ + +#include "dvipng.h" + +/* + * Color. We delete and recreate the gdImage for each new page. This + * means that the stack must contain rgb value not color index. + * Besides, the current antialiasing implementation needs rgb anyway. +*/ + +struct colorname { + struct colorname *next; + char* color; + char name[1]; +} *colornamep=NULL,*xcp=NULL; + +const char *colordef[]={"xcolor.sty","dvipsnam.def", + "svgnam.def","x11nam.def",NULL}; +char *xcpname=NULL; + +void initcolor(void) +{ + csp = 1; + cstack[0].red=255; + cstack[0].green=255; + cstack[0].blue=255; + cstack[1].red=0; + cstack[1].green=0; + cstack[1].blue=0; +} + +static struct colorname * NewColor(const char* prefix, int nprefix, + char* name, int nname, + char* model, int nmodel, + char* values, int nvalues) +{ + struct colorname *tmp; + if ((tmp=malloc(sizeof(struct colorname)+3+nprefix+nname+nmodel+nvalues))==NULL) + Fatal("Cannot malloc space for color name"); + tmp->color=tmp->name+nprefix+nname+1; + strncpy(tmp->name,prefix,nprefix); + strncpy(tmp->name+nprefix,name,nname); + tmp->name[nprefix+nname]='\0'; + strncpy(tmp->color,model,nmodel); + tmp->color[nmodel]=' '; + strncpy(tmp->color+nmodel+1,values,nvalues); + tmp->color[nmodel+nvalues+1]='\0'; + model=tmp->color; + while(*model!='\0') { + if (*model==',') + *model=' '; + model++; + } + DEBUG_PRINT(DEBUG_COLOR,("\n COLOR NAME:\t'%s' '%s'", + tmp->name,tmp->color)); + return(tmp); +} + +#define FINDWORD(s) while(s<max && \ + (*s=='{'||*s==' '||*s=='%'||*s==';'||*s=='\r'||*s=='\n')) s++ +#define FINDARG(s) while(s<max && *s!='{') s++; FINDWORD(s) +#define FINDMODELEND(s,n) n=0; while(s<max && *s!='}' && *s!='/') { s++; n++; } +#define FINDNAMEEND(s,n) n=0; while(s<max && *s!='}' && *s!=',') { s++; n++; } +#define FINDVALEND(s,n) n=0; while(s<max && *s!='}' && *s!='/' && *s!=';') { s++; n++; } +#define FINDLASTVALEND(s) while(s<max && *s!='}' && *s!=';') s++ +#define FINDPSNAMEEND(s,n) n=0; while(s<max && *s!='{') { s++; n++; } +#define BLANKCOMMAS(s) + +static struct colorname* LoadColornameFile(const char* filename) +{ + struct colorname *list=NULL,*tmp=NULL; + char *filepath,*pos,*max; + const char *prefix=""; + char *name,*values,*model; + int nprefix=0,nname,nvalues,nmodel; + struct filemmap fmmap; + boolean mmapfailed; + + filepath=kpse_find_file(filename,kpse_tex_format,false); + if (filepath == NULL) + return NULL; + DEBUG_PRINT(DEBUG_COLOR,("\n OPEN COLOR NAMES:\t'%s'", filepath)); + mmapfailed=MmapFile(filepath,&fmmap); + free(filepath); + if (mmapfailed) + return NULL; + pos=fmmap.data; + max=fmmap.data+fmmap.size; + while (pos<max && *pos!='\\') pos++; + while(pos+9<max && strncmp(pos,"\\endinput",9)!=0) { + if ((pos+20<max && strncmp(pos,"\\def\\colornameprefix",20)==0) + || (pos+32<max + && strncmp(pos,"\\providecommand*\\colornameprefix",32)==0)) { + DEBUG_PRINT(DEBUG_COLOR,("\n \t'%.20s'", pos)); + FINDARG(pos); + prefix=pos; + FINDNAMEEND(pos,nprefix); + DEBUG_PRINT(DEBUG_COLOR,("\n \tCOLOR PREFIX '%.*s'",nprefix,prefix)); + } else if (pos+17<max && strncmp(pos,"\\DefineNamedColor",17)==0) { + DEBUG_PRINT(DEBUG_COLOR,("\n \t'%.17s'", pos)); + model=NULL; + nname=nmodel=nvalues=0; + FINDARG(pos); /* skip first argument */ + FINDARG(pos); /* find second argument: color name */ + name=pos; + FINDNAMEEND(pos,nname); + FINDARG(pos); /* find third argument: color model */ + model=pos; + FINDMODELEND(pos,nmodel); + FINDARG(pos); /* find fourth argument: color values */ + values=pos; + FINDVALEND(pos,nvalues); + tmp=NewColor(prefix,nprefix,name,nname,model,nmodel,values,nvalues); + tmp->next=list; + list=tmp; + } else if ((pos+15<max && strncmp(pos,"\\definecolorset",15)==0) + || (pos+16<max && strncmp(pos,"\\preparecolorset",16)==0)) { + char *model; + DEBUG_PRINT(DEBUG_COLOR,("\n \t'%.15s'", pos)); + FINDARG(pos); /* find first argument: color model */ + model=pos; + FINDMODELEND(pos,nmodel); + FINDARG(pos); /* skip second argument */ + FINDARG(pos); /* skip third argument */ + FINDARG(pos); /* find fourth argument: names, values */ + while(pos<max && *pos!='}'){ + name=pos; + FINDNAMEEND(pos,nname); + pos++; + values=pos; + FINDVALEND(pos,nvalues); + FINDLASTVALEND(pos); + tmp=NewColor(prefix,nprefix,name,nname,model,nmodel,values,nvalues); + tmp->next=list; + list=tmp; + FINDWORD(pos); + } + } else { + pos++; + while (pos<max && *pos!='\\') pos++; + } + } + UnMmapFile(&fmmap); + return(list); +} + +static void ClearXColorPrologue(void) +{ + struct colorname *next; + while (xcp) { + next=xcp->next; + free(xcp); + xcp=next; + } + if (xcpname!=NULL) { + free(xcpname); + xcpname=NULL; + } +} + +void ClearColorNames(void) +{ + struct colorname *next; + while (colornamep) { + next=colornamep->next; + free(colornamep); + colornamep=next; + } + ClearXColorPrologue(); +} + +void InitXColorPrologue(const char* name) +{ + ClearXColorPrologue(); + if ((xcpname=malloc(strlen(name)+1))==NULL) + Fatal("cannot malloc memory for xcolor prologue name"); + strcpy(xcpname,name); +} + +static struct colorname* LoadXColorPrologue(void) +{ + struct colorname *list=NULL,*tmp=NULL; + char *filepath,*pos,*max; + const char *prefix=""; + char *name,*values,*model; + int nprefix=0,nname,nvalues,nmodel; + struct filemmap fmmap; + boolean mmapfailed; + + filepath=kpse_find_file(xcpname,kpse_program_text_format,false); + if (filepath == NULL) + return NULL; + DEBUG_PRINT(DEBUG_COLOR,("\n OPEN XCOLOR PROLOGUE:\t'%s'", filepath)); + mmapfailed = MmapFile(filepath,&fmmap); + free(filepath); + if (mmapfailed) + return NULL; + pos=fmmap.data; + max=fmmap.data+fmmap.size; + while(pos<max) { + while (pos<max && *pos!='/') pos++; + if (*pos=='/') { + nname=nmodel=nvalues=0; + name=++pos; /* first argument: color name */ + FINDPSNAMEEND(pos,nname); + values=++pos; /* second argument: color values */ + FINDVALEND(pos,nvalues); + model=pos+3; /* third argument: color model, prefixed by 'XC' */ + while(pos<max && *pos!=' ' && *pos!='\r' && *pos!='\n') pos++; + nmodel=pos-model; + tmp=NewColor(prefix,nprefix,name,nname,model,nmodel,values,nvalues); + tmp->next=list; + list=tmp; + } + } + UnMmapFile(&fmmap); + return(list); +} + +#define FTO255(a) ((int) (255*a+0.5)) +#define WARN_IF_FAILED(a,b) if (a==b) { page_flags |= PAGE_GAVE_WARN; \ + Warning("missing color-specification value, treated as zero"); } + +#define SKIPSPACES(s) while(s && *s==' ' && *s!='\0') s++ +#define NEXTFLOAT255(c) FTO255(strtod(c,&end)); WARN_IF_FAILED(c,end); c=end +#define NEXTFLOAT(c) strtod(c,&end); WARN_IF_FAILED(c,end); c=end +#define NEXTINT(c) strtol(c,&end,10); WARN_IF_FAILED(c,end); c=end +#define NEXTHEX(c) strtol(c,&end,16); WARN_IF_FAILED(c,end); c=end + +void stringrgb(const char* color,int *r,int *g,int *b) +{ + char* end; + static int unloaded=0; + + DEBUG_PRINT(DEBUG_COLOR,("\n COLOR SPEC:\t'%s' (",color)); + SKIPSPACES(color); + if (strcmp(color,"Black")==0) { + *r = *g = *b = 0; + } else if (strcmp(color,"White")==0) { + *r = *g = *b = 255; + } else if (strncmp(color,"gray ",5)==0) { + color+=5; + *r = *g = *b = NEXTFLOAT255(color); + } else if (strncmp(color,"rgb ",4)==0) { + color+=4; + *r = NEXTFLOAT255(color); + *g = NEXTFLOAT255(color); + *b = NEXTFLOAT255(color); + } else if (strncmp(color,"Gray ",5)==0) { + color+=5; + *r = *g = *b = NEXTINT(color); + } else if (strncmp(color,"RGB ",4)==0) { + color+=4; + *r = NEXTINT(color); + *g = NEXTINT(color); + *b = NEXTINT(color); + } else if (strncmp(color,"HTML ",5)==0) { + color+=5; + *b = NEXTHEX(color); + *r = *b/65536; + *g = *b/256; + *b -= *g*256; + *g -= *r*256; + } else if (strncmp(color,"cmy ",4)==0 + || strncmp(color,"cmyk ",5)==0) { + int c,m,y,k; + color+=3; + k=(*color=='k'); + if (k) + color++; + c = NEXTFLOAT255(color); + m = NEXTFLOAT255(color); + y = NEXTFLOAT255(color); + if (k) + k = NEXTFLOAT255(color); + *r = c+k<255 ? 255-(c+k) : 0; + *g = m+k<255 ? 255-(m+k) : 0; + *b = y+k<255 ? 255-(y+k) : 0; + } else if (strncmp(color,"hsb ",4)==0 + || strncmp(color,"HSB ",4)==0) { + /* The hsb and HSB models really need more presicion. + Use double and convert back*/ + double hu,sa,br,f,R,G,B; + int i; + if (*color=='h') { + color+=4; + hu = NEXTFLOAT(color); + sa = NEXTFLOAT(color); + br = NEXTFLOAT(color); + } else { + color+=4; + hu = (float)NEXTINT(color); hu /= 255; + sa = (float)NEXTINT(color); sa /= 255; + br = (float)NEXTINT(color); br /= 255; + } + i=6*hu; + f=6*hu-i; + switch(i) { + case 0: + R = br*(1-sa*0); G = br*(1-sa*(1-f)); B = br*(1-sa*1); break; + case 1: + R = br*(1-sa*f); G = br*(1-sa*0); B = br*(1-sa*1); break; + case 2: + R = br*(1-sa*1); G = br*(1-sa*0); B = br*(1-sa*(1-f)); break; + case 3: + R = br*(1-sa*1); G = br*(1-sa*f); B = br*(1-sa*0); break; + case 4: + R = br*(1-sa*(1-f)); G = br*(1-sa*1); B = br*(1-sa*0); break; + case 5: + R = br*(1-sa*0); G = br*(1-sa*1); B = br*(1-sa*f); break; + default: + R = br*(1-sa*0); G = br*(1-sa*1); B = br*(1-sa*1); + } + *r=FTO255(R); + *g=FTO255(G); + *b=FTO255(B); + } else { + /* Model not found, probably a color name */ + struct colorname *tmp; + + if (xcp==NULL && xcpname!=NULL) + xcp=LoadXColorPrologue(); + tmp=xcp; + while(tmp!=NULL && strcmp(color,tmp->name)!=0) + tmp=tmp->next; + if (tmp==NULL) { + while (colornamep==NULL && colordef[unloaded]!=NULL) + colornamep=LoadColornameFile(colordef[unloaded++]); + tmp=colornamep; + while(tmp!=NULL && strcmp(color,tmp->name)!=0) { + while (tmp->next==NULL && colordef[unloaded]!=NULL) + tmp->next=LoadColornameFile(colordef[unloaded++]); + tmp=tmp->next; + } + } + if (tmp!=NULL) { + /* Found: one-level recursion */ + DEBUG_PRINT(DEBUG_COLOR,("\n ---RECURSION--- ")) + stringrgb(tmp->color,r,g,b); + } else { + /* Not found, warn */ + page_flags |= PAGE_GAVE_WARN; + Warning("unimplemented color specification '%s'",color); + } + } + DEBUG_PRINT(DEBUG_COLOR,("%d %d %d) ",*r,*g,*b)) +} + +void background(const char* p) +{ + stringrgb(p, &cstack[0].red, &cstack[0].green, &cstack[0].blue); + DEBUG_PRINT(DEBUG_COLOR,("\n BACKGROUND:\t(%d %d %d) ", + cstack[0].red, cstack[0].green, cstack[0].blue)); +} + +void pushcolor(const char * p) +{ + if ( ++csp == STACK_SIZE ) + Fatal("out of color stack space") ; + stringrgb(p, &cstack[csp].red, &cstack[csp].green, &cstack[csp].blue); + DEBUG_PRINT(DEBUG_COLOR,("\n COLOR PUSH:\t(%d %d %d) ", + cstack[csp].red, cstack[csp].green, cstack[csp].blue)) +} + +void popcolor(void) +{ + if (csp > 1) csp--; /* Last color is global */ + DEBUG_PRINT(DEBUG_COLOR,("\n COLOR POP\t")) +} + +void resetcolorstack(const char * p) +{ + if ( csp > 1 ) + Warning("global color change within nested colors"); + csp=0; + pushcolor(p) ; + DEBUG_PRINT(DEBUG_COLOR,("\n RESET COLOR:\tbottom of stack:")) +} + +void StoreColorStack(struct page_list *tpagep) +{ + int i=0; + + DEBUG_PRINT(DEBUG_COLOR,("\n STORE COLOR STACK:\t %d ", csp)); + tpagep->csp=csp; + while ( i <= csp ) { + DEBUG_PRINT(DEBUG_COLOR,("\n COLOR STACK:\t %d (%d %d %d) ",i, + cstack[i].red, cstack[i].green, cstack[i].blue)); + tpagep->cstack[i].red = cstack[i].red; + tpagep->cstack[i].green = cstack[i].green; + tpagep->cstack[i].blue = cstack[i].blue; + i++; + } +} + +void ReadColorStack(struct page_list *tpagep) +{ + int i=0; + + DEBUG_PRINT(DEBUG_COLOR,("\n READ COLOR STACK:\t %d ", tpagep->csp)); + csp=tpagep->csp; + while ( i <= tpagep->csp ) { + DEBUG_PRINT(DEBUG_COLOR,("\n COLOR STACK:\t %d (%d %d %d) ",i, + cstack[i].red, cstack[i].green, cstack[i].blue)); + cstack[i].red = tpagep->cstack[i].red; + cstack[i].green = tpagep->cstack[i].green; + cstack[i].blue = tpagep->cstack[i].blue; + i++; + } +} + +void StoreBackgroundColor(struct page_list *tpagep) +{ + /* Background color changes affect the _whole_ page */ + tpagep->cstack[0].red = cstack[0].red; + tpagep->cstack[0].green = cstack[0].green; + tpagep->cstack[0].blue = cstack[0].blue; +} diff --git a/Build/source/texk/dvipng/dvipng-src/commands.h b/Build/source/texk/dvipng/dvipng-src/commands.h new file mode 100644 index 00000000000..e2a5404bb32 --- /dev/null +++ b/Build/source/texk/dvipng/dvipng-src/commands.h @@ -0,0 +1,196 @@ +/* commands.h */ + +/************************************************************************ + + Part of the dvipng distribution + + This program is free software: you can redistribute it and/or modify + it under the terms of the GNU Lesser General Public License as + published by the Free Software Foundation, either version 3 of the + License, or (at your option) any later version. + + This program is distributed in the hope that it will be useful, but + WITHOUT ANY WARRANTY; without even the implied warranty of + MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU + Lesser General Public License for more details. + + You should have received a copy of the GNU Lesser General Public + License along with this program. If not, see + <http://www.gnu.org/licenses/>. + + Copyright (C) 2002-2008 Jan-Åke Larsson + +************************************************************************/ + +/* DVI COMMANDS */ +#define DVIFORMAT 2 + +#define SETC_000 0 /* typeset character 0 and move right */ +#define SETC_127 127 /* typeset character 127 and move right */ +#define SET1 128 /* typeset a character and move right */ +#define SET2 129 /* ??? */ +#define SET3 130 /* ??? */ +#define SET4 131 /* ??? */ +#define SET_RULE 132 /* typeset a rule and move right */ +#define PUT1 133 /* typeset a character */ +#define PUT2 134 /* ??? */ +#define PUT3 135 /* ??? */ +#define PUT4 136 /* ??? */ +#define PUT_RULE 137 /* typeset a rule */ +#define NOP 138 /* no operation */ +#define BOP 139 /* beginning of page */ +#define EOP 140 /* ending of page */ +#define PUSH 141 /* save the current positions */ +#define POP 142 /* restore previous positions */ +#define RIGHT1 143 /* move right */ +#define RIGHT2 144 /* ??? */ +#define RIGHT3 145 /* ??? */ +#define RIGHT4 146 /* ??? */ +#define W0 147 /* move right by |w| */ +#define W1 148 /* move right and set |w| */ +#define W2 149 /* ??? */ +#define W3 150 /* ??? */ +#define W4 151 /* ??? */ +#define X0 152 /* move right by |x| */ +#define X1 153 /* move right and set |x| */ +#define X2 154 /* ??? */ +#define X3 155 /* ??? */ +#define X4 156 /* ??? */ +#define DOWN1 157 /* move down */ +#define DOWN2 158 /* ??? */ +#define DOWN3 159 /* ??? */ +#define DOWN4 160 /* ??? */ +#define Y0 161 /* move down by |y| */ +#define Y1 162 /* move down and set |y| */ +#define Y2 163 /* ??? */ +#define Y3 164 /* ??? */ +#define Y4 165 /* ??? */ +#define Z0 166 /* move down by |z| */ +#define Z1 167 /* move down and set |z| */ +#define Z2 168 /* ??? */ +#define Z3 169 /* ??? */ +#define Z4 170 /* ??? */ +#define FONT_00 171 /* set current font to 0 */ +#define FONT_63 234 /* set current font to 63 */ +#define FNT1 235 /* set current font */ +#define FNT2 236 /* Same as FNT1, except that arg is 2 bytes */ +#define FNT3 237 /* Same as FNT1, except that arg is 3 bytes */ +#define FNT4 238 /* Same as FNT1, except that arg is 4 bytes */ +#define XXX1 239 /* extension to \.DVI primitives */ +#define XXX2 240 /* Like XXX1, but 0<=k<65536 */ +#define XXX3 241 /* Like XXX1, but 0<=k<@t$2^{24}$@> */ +#define XXX4 242 /* potentially long extension to \.DVI + primitives */ +#define FNT_DEF1 243 /* define the meaning of a font number */ +#define FNT_DEF2 244 /* ??? */ +#define FNT_DEF3 245 /* ??? */ +#define FNT_DEF4 246 /* ??? */ +#define PRE 247 /* preamble */ +#define POST 248 /* postamble beginning */ +#define POST_POST 249 /* postamble ending */ + +/* undefined_commands 250,251,252,253,254,255 */ + +EXTERN const int8_t dvi_commandlength[256] +#ifdef MAIN +={ + 1,1,1,1,1,1,1,1,1,1, + 1,1,1,1,1,1,1,1,1,1, + 1,1,1,1,1,1,1,1,1,1, + 1,1,1,1,1,1,1,1,1,1, + 1,1,1,1,1,1,1,1,1,1, + 1,1,1,1,1,1,1,1,1,1, + 1,1,1,1,1,1,1,1,1,1, + 1,1,1,1,1,1,1,1,1,1, + 1,1,1,1,1,1,1,1,1,1, + 1,1,1,1,1,1,1,1,1,1, + 1,1,1,1,1,1,1,1,1,1, + 1,1,1,1,1,1,1,1,1,1, + 1,1,1,1,1,1,1,1, /* SETC_000 --- SETC_127 */ + 2,3,4,5,9, /* SET1 --- SET4, SET_RULE */ + 2,3,4,5,9, /* PUT1 --- PUT4, PUT_RULE */ + 1,45,1,1,1, /* NOP, BOP, EOP, PUSH, POP */ + 2,3,4,5, /* RIGHT1 --- RIGHT4 */ + 1,2,3,4,5, /* W0 --- W4 */ + 1,2,3,4,5, /* X0 --- X4 */ + 2,3,4,5, /* DOWN1 --- DOWN4 */ + 1,2,3,4,5, /* Y0 --- Y4 */ + 1,2,3,4,5, /* Z0 --- Z4 */ + 1,1,1,1,1,1,1,1,1,1, + 1,1,1,1,1,1,1,1,1,1, + 1,1,1,1,1,1,1,1,1,1, + 1,1,1,1,1,1,1,1,1,1, + 1,1,1,1,1,1,1,1,1,1, + 1,1,1,1,1,1,1,1,1,1, + 1,1,1,1, /* FONT_00 --- FONT_63 */ + 2,3,4,5, /* FNT1 --- FNT4 */ + 2,3,4,5, /* XXX1 --- XXX4 + special string */ + 16,17,18,19, /* FNT_DEF1 --- FNT_DEF4 + font name */ + 15, /* PRE + TeX comment */ + 29, /* POST */ + 10, /* POST_POST minimum */ + -1,-1,-1,-1,-1,-1 /* undefined */ +} +#endif +; + +EXTERN const char* dvi_commands[256] +#ifdef MAIN +={ +"SETC_000","SETC_001","SETC_002","SETC_003","SETC_004", +"SETC_005","SETC_006","SETC_007","SETC_008","SETC_009", +"SETC_010","SETC_011","SETC_012","SETC_013","SETC_014", +"SETC_015","SETC_016","SETC_017","SETC_018","SETC_019", +"SETC_020","SETC_021","SETC_022","SETC_023","SETC_024", +"SETC_025","SETC_026","SETC_027","SETC_028","SETC_029", +"SETC_030","SETC_031","SETC_032","SETC_033","SETC_034", +"SETC_035","SETC_036","SETC_037","SETC_038","SETC_039", +"SETC_040","SETC_041","SETC_042","SETC_043","SETC_044", +"SETC_045","SETC_046","SETC_047","SETC_048","SETC_049", +"SETC_050","SETC_051","SETC_052","SETC_053","SETC_054", +"SETC_055","SETC_056","SETC_057","SETC_058","SETC_059", +"SETC_060","SETC_061","SETC_062","SETC_063","SETC_064", +"SETC_065","SETC_066","SETC_067","SETC_068","SETC_069", +"SETC_070","SETC_071","SETC_072","SETC_073","SETC_074", +"SETC_075","SETC_076","SETC_077","SETC_078","SETC_079", +"SETC_080","SETC_081","SETC_082","SETC_083","SETC_084", +"SETC_085","SETC_086","SETC_087","SETC_088","SETC_089", +"SETC_090","SETC_091","SETC_092","SETC_093","SETC_094", +"SETC_095","SETC_096","SETC_097","SETC_098","SETC_099", +"SETC_100","SETC_101","SETC_102","SETC_103","SETC_104", +"SETC_105","SETC_106","SETC_107","SETC_108","SETC_109", +"SETC_110","SETC_111","SETC_112","SETC_113","SETC_114", +"SETC_115","SETC_116","SETC_117","SETC_118","SETC_119", +"SETC_120","SETC_121","SETC_122","SETC_123","SETC_124", +"SETC_125","SETC_126","SETC_127", +"SET1","SET2","SET3","SET4","SET_RULE", +"PUT1","PUT2","PUT3","PUT4","PUT_RULE", +"NOP","BOP","EOP","PUSH","POP", +"RIGHT1","RIGHT2","RIGHT3","RIGHT4", +"W0","W1","W2","W3","W4", +"X0","X1","X2","X3","X4", +"DOWN1","DOWN2","DOWN3","DOWN4", +"Y0","Y1","Y2","Y3","Y4", +"Z0","Z1","Z2","Z3","Z4", +"FONT_00","FONT_01","FONT_02","FONT_03","FONT_04", +"FONT_05","FONT_06","FONT_07","FONT_08","FONT_09", +"FONT_10","FONT_11","FONT_12","FONT_13","FONT_14", +"FONT_15","FONT_16","FONT_17","FONT_18","FONT_19", +"FONT_20","FONT_21","FONT_22","FONT_23","FONT_24", +"FONT_25","FONT_26","FONT_27","FONT_28","FONT_29", +"FONT_30","FONT_31","FONT_32","FONT_33","FONT_34", +"FONT_35","FONT_36","FONT_37","FONT_38","FONT_39", +"FONT_40","FONT_41","FONT_42","FONT_43","FONT_44", +"FONT_45","FONT_46","FONT_47","FONT_48","FONT_49", +"FONT_50","FONT_51","FONT_52","FONT_53","FONT_54", +"FONT_55","FONT_56","FONT_57","FONT_58","FONT_59", +"FONT_60","FONT_61","FONT_62","FONT_63", +"FNT1","FNT2","FNT3","FNT4", +"XXX1","XXX2","XXX3","XXX4", +"FNT_DEF1","FNT_DEF2","FNT_DEF3","FNT_DEF4", +"PRE","POST","POST_POST", +"UNDEF_250","UNDEF_251","UNDEF_252","UNDEF_253","UNDEF_254","UNDEF_255" +} +#endif +; + diff --git a/Build/source/texk/dvipng/dvipng-src/config.h.in b/Build/source/texk/dvipng/dvipng-src/config.h.in new file mode 100644 index 00000000000..a8ba47bb6e1 --- /dev/null +++ b/Build/source/texk/dvipng/dvipng-src/config.h.in @@ -0,0 +1,223 @@ +/* config.h.in. Generated from configure.ac by autoheader. */ + +/* Define as 1 to get the debug (-d) option. */ +#undef DEBUG + +/* The environment setting for $SELFAUTODIR */ +#undef ENV_SELFAUTODIR + +/* The environment setting for $SELFAUTOLOC */ +#undef ENV_SELFAUTOLOC + +/* The environment setting for $SELFAUTOPARENT */ +#undef ENV_SELFAUTOPARENT + +/* Define as the path to GhostScript. */ +#undef GS_PATH + +/* Define to 1 if you don't have `vprintf' but do have `_doprnt.' */ +#undef HAVE_DOPRNT + +/* Define to 1 if you have the `dup2' function. */ +#undef HAVE_DUP2 + +/* Define to 1 if you have the <fcntl.h> header file. */ +#undef HAVE_FCNTL_H + +/* Define to 1 if you have the `fork' function. */ +#undef HAVE_FORK + +/* Define to 1 if you have freetype2 */ +#undef HAVE_FT2 + +/* Define to 1 if you have the `ftime' function. */ +#undef HAVE_FTIME + +/* Define to 1 if you have the `FT_Library_Version' function. */ +#undef HAVE_FT_LIBRARY_VERSION + +/* Define to 1 if you have the `gdImageCreateFromJpeg' function. */ +#undef HAVE_GDIMAGECREATEFROMJPEG + +/* Define to 1 if you have the `gdImageCreateFromPngPtr' function. */ +#undef HAVE_GDIMAGECREATEFROMPNGPTR + +/* Define to 1 if you have the `gdImageCreateTrueColor' function. */ +#undef HAVE_GDIMAGECREATETRUECOLOR + +/* Define to 1 if you have the `gdImageGif' function. */ +#undef HAVE_GDIMAGEGIF + +/* Define to 1 if you have the `gdImagePngEx' function. */ +#undef HAVE_GDIMAGEPNGEX + +/* Define to 1 if you have the <gd.h> header file. */ +#undef HAVE_GD_H + +/* Define to 1 if you have the `getpagesize' function. */ +#undef HAVE_GETPAGESIZE + +/* Define to 1 if you have the `gettimeofday' function. */ +#undef HAVE_GETTIMEOFDAY + +/* Define to 1 if you have the <inttypes.h> header file. */ +#undef HAVE_INTTYPES_H + +/* Define to 1 if you have the <kpathsea/kpathsea.h> header file. */ +#undef HAVE_KPATHSEA_KPATHSEA_H + +/* Define to 1 if your kpathsea has kpse_enc_format */ +#undef HAVE_KPSE_ENC_FORMATS + +/* Define to 1 if you have the `gd' library (-lgd). */ +#undef HAVE_LIBGD + +/* Define to 1 if you have the <libgen.h> header file. */ +#undef HAVE_LIBGEN_H + +/* Define to 1 if you have the `kpathsea' library (-lkpathsea). */ +#undef HAVE_LIBKPATHSEA + +/* Define to 1 if you have the `m' library (-lm). */ +#undef HAVE_LIBM + +/* Define to 1 if you have the `png' library (-lpng). */ +#undef HAVE_LIBPNG + +/* Define to 1 if you have the `z' library (-lz). */ +#undef HAVE_LIBZ + +/* Define to 1 if you have the <memory.h> header file. */ +#undef HAVE_MEMORY_H + +/* Define to 1 if you have the `memset' function. */ +#undef HAVE_MEMSET + +/* Define to 1 if you have a working `mmap' system call. */ +#undef HAVE_MMAP + +/* Define to 1 if you have the `munmap' function. */ +#undef HAVE_MUNMAP + +/* Define to 1 if you have the <png.h> header file. */ +#undef HAVE_PNG_H + +/* Define to 1 if you have the `pow' function. */ +#undef HAVE_POW + +/* Define to 1 if you have the `putenv' function. */ +#undef HAVE_PUTENV + +/* Define to 1 if stdbool.h conforms to C99. */ +#undef HAVE_STDBOOL_H + +/* Define to 1 if you have the <stdint.h> header file. */ +#undef HAVE_STDINT_H + +/* Define to 1 if you have the <stdlib.h> header file. */ +#undef HAVE_STDLIB_H + +/* Define to 1 if you have the `strchr' function. */ +#undef HAVE_STRCHR + +/* Define to 1 if you have the <strings.h> header file. */ +#undef HAVE_STRINGS_H + +/* Define to 1 if you have the <string.h> header file. */ +#undef HAVE_STRING_H + +/* Define to 1 if you have the `strncasecmp' function. */ +#undef HAVE_STRNCASECMP + +/* Define to 1 if you have the `strrchr' function. */ +#undef HAVE_STRRCHR + +/* Define to 1 if you have the `strstr' function. */ +#undef HAVE_STRSTR + +/* Define to 1 if you have the `strtol' function. */ +#undef HAVE_STRTOL + +/* Define to 1 if you have the <sys/param.h> header file. */ +#undef HAVE_SYS_PARAM_H + +/* Define to 1 if you have the <sys/stat.h> header file. */ +#undef HAVE_SYS_STAT_H + +/* Define to 1 if you have the <sys/time.h> header file. */ +#undef HAVE_SYS_TIME_H + +/* Define to 1 if you have the <sys/types.h> header file. */ +#undef HAVE_SYS_TYPES_H + +/* Define to 1 if you have <sys/wait.h> that is POSIX.1 compatible. */ +#undef HAVE_SYS_WAIT_H + +/* Define to 1 if you have the `texlive_gs_init' function. */ +#undef HAVE_TEXLIVE_GS_INIT + +/* Define to 1 if you have the <unistd.h> header file. */ +#undef HAVE_UNISTD_H + +/* Define to 1 if you have the `vfork' function. */ +#undef HAVE_VFORK + +/* Define to 1 if you have the <vfork.h> header file. */ +#undef HAVE_VFORK_H + +/* Define to 1 if you have the `vprintf' function. */ +#undef HAVE_VPRINTF + +/* Define to 1 if `fork' works. */ +#undef HAVE_WORKING_FORK + +/* Define to 1 if `vfork' works. */ +#undef HAVE_WORKING_VFORK + +/* Define to 1 if the system has the type `_Bool'. */ +#undef HAVE__BOOL + +/* Define to the address where bug reports for this package should be sent. */ +#undef PACKAGE_BUGREPORT + +/* Define to the full name of this package. */ +#undef PACKAGE_NAME + +/* Define to the full name and version of this package. */ +#undef PACKAGE_STRING + +/* Define to the one symbol short name of this package. */ +#undef PACKAGE_TARNAME + +/* Define to the home page for this package. */ +#undef PACKAGE_URL + +/* Define to the version of this package. */ +#undef PACKAGE_VERSION + +/* Define to 1 if you have the ANSI C header files. */ +#undef STDC_HEADERS + +/* Define to 1 if you can safely include both <sys/time.h> and <time.h>. */ +#undef TIME_WITH_SYS_TIME + +/* Define as 1 to get execution time output. */ +#undef TIMING + +/* Define to empty if `const' does not conform to ANSI C. */ +#undef const + +/* Define to `long long' if <inttypes.h> does not define it. */ +#undef int64_t + +/* Define to `int' if <sys/types.h> does not define. */ +#undef pid_t + +/* Define to `unsigned int' if <sys/types.h> does not define. */ +#undef size_t + +/* Define to `unsigned long long' if <inttypes.h> does not define it. */ +#undef uint64_t + +/* Define as `fork' if `vfork' does not work. */ +#undef vfork diff --git a/Build/source/texk/dvipng/dvipng-src/configure.ac b/Build/source/texk/dvipng/dvipng-src/configure.ac new file mode 100644 index 00000000000..62e252deab5 --- /dev/null +++ b/Build/source/texk/dvipng/dvipng-src/configure.ac @@ -0,0 +1,223 @@ +# configure.ac + +#************************************************************************ +# +# Part of the dvipng distribution +# +# This program is free software: you can redistribute it and/or modify +# it under the terms of the GNU Lesser General Public License as +# published by the Free Software Foundation, either version 3 of the +# License, or (at your option) any later version. +# +# This program is distributed in the hope that it will be useful, but +# WITHOUT ANY WARRANTY; without even the implied warranty of +# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU +# Lesser General Public License for more details. +# +# You should have received a copy of the GNU Lesser General Public +# License along with this program. If not, see +# <http://www.gnu.org/licenses/>. +# +# Copyright (C) 2002-2015,2019 Jan-Åke Larsson +# +#************************************************************************ + +# Process this file with autoconf to produce a configure script. +AC_INIT([dvipng], [1.17], [dvipng@nongnu.org]) +AC_CONFIG_SRCDIR([dvipng.c]) + +AC_ARG_ENABLE(debug, + AC_HELP_STRING([--disable-debug],[Compile without debug (-d) option]), + [ if test "$enableval" = yes ; then + AC_DEFINE(DEBUG, 1, [Define as 1 to get the debug (-d) option.]) + fi ], + [ enable_debug="yes"; + AC_DEFINE(DEBUG, 1, [Define as 1 to get the debug (-d) option.])]) +AC_ARG_ENABLE(timing, + AC_HELP_STRING([--enable-timing],[Output execution time of dvipng]), + [ if test "$enableval" = yes ; then + AC_DEFINE(TIMING, 1, [Define as 1 to get execution time output.]) + fi ]) + +# Checks for programs. +AC_SET_MAKE +AC_PROG_CC +AC_PROG_INSTALL +AC_PROG_LN_S +AC_ARG_WITH(gs, + AC_HELP_STRING([--with-gs=/PATH/TO/gs],[Hard-wire the location of GhostScript]), + [if test "x$withval" != xno ; then + AC_PATH_PROG(GS,["$withval"]) + AC_DEFINE_UNQUOTED(GS_PATH, "$GS", [Define as the path to GhostScript.]) + GS_CHECK_DEVICES + fi], + [AC_CHECK_PROG(GS,gs,gs) + AC_DEFINE_UNQUOTED(GS_PATH, "gs", [Define as the path to GhostScript.]) + if test -n "$GS"; then + GS_CHECK_DEVICES + else + AC_MSG_WARN([Cannot find GhostScript in your PATH]) + fi +]) + +# Checks for libraries. +AC_CHECK_LIB(m, pow) +AC_CHECK_LIB(z, deflate) +AC_CHECK_LIB([png], [png_read_image],, + [AC_MSG_ERROR([cannot find/use libpng])]) +AC_CHECK_LIB([gd], [gdImageCreate],, + [AC_MSG_ERROR([cannot find/use libgd +This drawing library can be downloaded at +https://bitbucket.org/libgd/gd-libgd/downloads])]) +AC_CHECK_LIB([kpathsea], [kpse_set_program_name],, + AC_MSG_ERROR([cannot find/use libkpathsea])) + +# Checks for header files. +AC_HEADER_STDC +AC_CHECK_HEADERS([gd.h png.h kpathsea/kpathsea.h],, + [AC_MSG_ERROR([cannot find/use $ac_header])]) +AC_CHECK_HEADERS([libgen.h]) +PSFONTS_O="" +AC_SUBST(PSFONTS_O) +PKG_CHECK_MODULES([FT2], [freetype2 >= 6.1.0], + [CFLAGS="$FT2_CFLAGS $CFLAGS" + LIBS="$FT2_LIBS $LIBS" + PSFONTS_O="sfd.o ft.o enc.o fontmap.o tfm.o" + AC_DEFINE(HAVE_FT2, 1, [Define to 1 if you have freetype2]) + ac_have_freetype2="yes"], + [ac_have_freetype2="no"]) +AC_HEADER_SYS_WAIT +AC_HEADER_TIME +AC_HEADER_STDBOOL +AC_CHECK_HEADERS([fcntl.h sys/time.h]) + +# Checks for typedefs, structures, and compiler characteristics. +AC_C_CONST +AC_TYPE_PID_T +AC_TYPE_SIZE_T +if test "$ac_cv_header_inttypes_h" = "yes"; then + # Sometimes we want to use gcc -ansi -pedantic as a portability test + # The typedef of int64_t is not in the system header file in that + # case. Then, #define int64_t as "long long", which is non-ansi, but + # is present in most modern compilers. Using a #define rather than a + # typedef can be a problem, but in dvipng int64_t is only used as + # typecast, and there are no problems. autoconf 2.13 equivalent: + # AC_CHECK_TYPE(int64_t, long long) + # AC_CHECK_TYPE(uint64_t, unsigned long long) + AC_CHECK_TYPE([int64_t],, + [AC_DEFINE_UNQUOTED([int64_t], [long long], + [Define to `long long' if + <inttypes.h> does not define it.])]) + AC_CHECK_TYPE([uint64_t],, + [AC_DEFINE_UNQUOTED([uint64_t], [unsigned long long], + [Define to `unsigned long long' if + <inttypes.h> does not define it.])]) +fi +AC_HAS_KPSE_ENC_FORMATS + + +# Checks for library functions. +AC_FUNC_FORK +# We always allocate nonzero chunks +# AC_FUNC_MALLOC +AC_FUNC_MMAP +# AC_FUNC_REALLOC +AC_FUNC_STRTOD +AC_FUNC_VPRINTF +AC_CHECK_FUNCS([dup2 memset munmap pow putenv strchr strrchr strtol strstr strncasecmp]) +if test "$enable_timing" = "yes"; then + AC_CHECK_FUNCS([ftime gettimeofday]) +fi +AC_CHECK_FUNCS([gdImageCreateTrueColor gdImageCreateFromJpeg gdImagePngEx gdImageCreateFromPngPtr gdImageGif FT_Library_Version]) +if test "$ac_cv_func_gdImageGif" = "yes"; then + INSTALL_BIN_TARGET="install-dvigif" +else + INSTALL_BIN_TARGET="install-dvipng" +fi +AC_CHECK_FUNCS([texlive_gs_init]) +AC_SUBST(INSTALL_BIN_TARGET) + +# Documentation-related checks +AC_PATH_PROG(MAKEINFO, makeinfo, :) +MAKEINFO_CHECK_MACROS(acronym env option) +AC_PATH_PROG(INSTALL_INFO, install-info, :, $PATH /usr/sbin /sbin) + +# SELFAUTO +AC_ARG_ENABLE(selfauto-set, + AC_HELP_STRING([--enable-selfauto-set], + [This option will make the final binary explicitly set the + $SELFAUTO... variables to make it look as dvipng is installed in the + main texmf tree, even if it isn't. This is necessary when texmf.cnf + only uses $SELFAUTO... variables and dvipng is not installed in the + texmf tree. Otherwise, dvipng may not be able to find virtual + fonts, or psfonts.map. To find out, first build the binary and do + 'make test'. If the test fails, you need this switch.]), + [ if test "$enableval" = yes ; then + AC_MSG_CHECKING([for \$SELFAUTOLOC]) + SELFAUTOLOC=`kpsewhich -expand-var=\\\$SELFAUTOLOC` + AC_DEFINE_UNQUOTED(ENV_SELFAUTOLOC,["SELFAUTOLOC=$SELFAUTOLOC"], + [The environment setting for $SELFAUTOLOC]) + AC_MSG_RESULT([$SELFAUTOLOC]) + AC_MSG_CHECKING([for \$SELFAUTODIR]) + SELFAUTODIR=`kpsewhich -expand-var=\\\$SELFAUTODIR` + AC_DEFINE_UNQUOTED(ENV_SELFAUTODIR,["SELFAUTODIR=$SELFAUTODIR"], + [The environment setting for $SELFAUTODIR]) + AC_MSG_RESULT([$SELFAUTODIR]) + AC_MSG_CHECKING([for \$SELFAUTOPARENT]) + SELFAUTOPARENT=`kpsewhich -expand-var=\\\$SELFAUTOPARENT` + AC_DEFINE_UNQUOTED(ENV_SELFAUTOPARENT,["SELFAUTOPARENT=$SELFAUTOPARENT"], + [The environment setting for $SELFAUTOPARENT]) + AC_MSG_RESULT([$SELFAUTOPARENT]) + fi ], + [AC_MSG_CHECKING([for texmf.cnf]) + TEXMF_CNF=`kpsewhich texmf.cnf` + AC_MSG_RESULT([$TEXMF_CNF]) + AC_PATH_PROG(KPSEWHICH, kpsewhich) + AC_MSG_CHECKING([for psfonts.map]) + cp $KPSEWHICH . + PSFONTS_MAP=`./kpsewhich psfonts.map` + rm -f ./kpsewhich + if test -n "$PSFONTS_MAP"; then + AC_MSG_RESULT([$PSFONTS_MAP]) + else + AC_MSG_RESULT([not found from outside the texmf tree]) + AC_MSG_CHECKING([for \$SELFAUTO in texmf.cnf]) + if grep SELFAUTO "$TEXMF_CNF" > /dev/null 2> /dev/null; then + AC_MSG_RESULT([yes +*************************************************************** +texmf.cnf is using \$SELFAUTO... variables. If you are going to +install dvipng outside the texmf tree, you may need to use +--enable-selfauto-set. To find out, do 'make ; make test'. If the test +is unsuccessful, add the mentioned switch and rebuild. +***************************************************************]) + else + AC_MSG_RESULT([no]) + fi + fi]) + +AC_MSG_RESULT([ +** Configuration summary for $PACKAGE_STRING: + + The -d (debug) switch is enabled: $enable_debug + Your gd is new enough (>=2.0) to enable + the --truecolor switch, full alpha + transparency, proper rescaling of + included bitmaps, and jpeg inclusion: $ac_cv_func_gdImageCreateTrueColor + Your gd has jpeg inclusion enabled: $ac_cv_func_gdImageCreateFromJpeg + Your gd is new enough (>=2.0.12) to + enable transparent backgrounds for EPS + inclusion and the -z (compression) + switch: $ac_cv_func_gdImagePngEx + Your gd is new enough (>=2.0.21) to + allow image creation from memory $ac_cv_func_gdImageCreateFromPngPtr + Your gd is new enough (>=2.0.28) to + enable gif inclusion and output + (dvigif): $ac_cv_func_gdImageGif + FreeType font rendering available: $ac_have_freetype2 + Support for subfonts (CJK-LaTeX): $ac_have_freetype2 + Building within TeX Live: $ac_cv_func_texlive_gs_init +]) + +AC_CONFIG_HEADER([config.h]) +AC_CONFIG_FILES([Makefile]) +AC_OUTPUT diff --git a/Build/source/texk/dvipng/dvipng-src/draw.c b/Build/source/texk/dvipng/dvipng-src/draw.c new file mode 100644 index 00000000000..6f772b92204 --- /dev/null +++ b/Build/source/texk/dvipng/dvipng-src/draw.c @@ -0,0 +1,393 @@ +/* draw.c */ + +/************************************************************************ + + Part of the dvipng distribution + + This program is free software: you can redistribute it and/or modify + it under the terms of the GNU Lesser General Public License as + published by the Free Software Foundation, either version 3 of the + License, or (at your option) any later version. + + This program is distributed in the hope that it will be useful, but + WITHOUT ANY WARRANTY; without even the implied warranty of + MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU + Lesser General Public License for more details. + + You should have received a copy of the GNU Lesser General Public + License along with this program. If not, see + <http://www.gnu.org/licenses/>. + + Copyright (C) 2002-2015 Jan-Åke Larsson + +************************************************************************/ + +#include "dvipng.h" + +#ifdef DEBUG +#include <ctype.h> /* isprint */ +#endif + +struct stack_entry { + dviunits h, v, w, x, y, z; /* stack entry */ + subpixels hh,vv; +} stack[STACK_SIZE+1]; /* stack + space for current pos */ +struct stack_entry* dvi_stack=stack; + +#define MAXDRIFT 1 +#define CHECK_MAXDRIFT(x,xx) \ + if ( xx-PIXROUND(x,dvi->conv*shrinkfactor) < -MAXDRIFT ) { \ + DEBUG_PRINT(DEBUG_DVI,(" add 1 to")); \ + xx += 1; \ + } \ + if ( xx-PIXROUND(x,dvi->conv*shrinkfactor) > MAXDRIFT ) { \ + DEBUG_PRINT(DEBUG_DVI,(" sub 1 to")); \ + xx -= 1; \ + } \ + if (PIXROUND(dvi_stack->h,dvi->conv*shrinkfactor) != dvi_stack->hh \ + || PIXROUND(dvi_stack->v,dvi->conv*shrinkfactor) != dvi_stack->vv)\ + DEBUG_PRINT(DEBUG_DVI, \ + (" drift (%d,%d)", \ + dvi_stack->hh-PIXROUND(dvi_stack->h,dvi->conv*shrinkfactor), \ + dvi_stack->vv-PIXROUND(dvi_stack->v,dvi->conv*shrinkfactor))); + +#define MoveRight(x) \ + temp=x; dvi_stack->h += temp; \ + if ( currentfont==NULL \ + || temp > currentfont->s/6 || temp < -currentfont->s/6*4 ) \ + dvi_stack->hh = PIXROUND(dvi_stack->h,dvi->conv*shrinkfactor); \ + else \ + dvi_stack->hh += PIXROUND( temp,dvi->conv*shrinkfactor ); \ + CHECK_MAXDRIFT(dvi_stack->h,dvi_stack->hh) + +#define MoveDown(x) \ + temp=x; dvi_stack->v += temp; \ + if ( currentfont==NULL \ + || temp > currentfont->s/6*5 || temp < currentfont->s/6*(-5) ) \ + dvi_stack->vv = PIXROUND(dvi_stack->v,dvi->conv*shrinkfactor); \ + else \ + dvi_stack->vv += PIXROUND( temp,dvi->conv*shrinkfactor ); \ + CHECK_MAXDRIFT(dvi_stack->v,dvi_stack->vv) + +#define DO_VFCONV(a) ((((struct font_entry*) parent)->type==DVI_TYPE)?a:\ + (dviunits)((int64_t) a * ((struct font_entry*) parent)->s / (1 << 20))) + + +dviunits SetChar(int32_t c) +{ + struct char_entry* ptr=NULL; + + if (currentfont==NULL) + Fatal("faulty DVI, trying to set character from null font"); + if (c<0 || c>LASTFNTCHAR) { + Warning("glyph index out of range (%d), skipping",c); + return(0); + } + ptr=currentfont->chr[c]; + if (ptr==NULL) { + Warning("unable to draw glyph %d, skipping",c); + return(0); + } +#ifdef DEBUG + switch (currentfont->type) { + case FONT_TYPE_VF: DEBUG_PRINT(DEBUG_DVI,("\n VF CHAR:\t")); break; + case FONT_TYPE_PK: DEBUG_PRINT(DEBUG_DVI,("\n PK CHAR:\t")); break; + case FONT_TYPE_FT: DEBUG_PRINT(DEBUG_DVI,("\n FT CHAR:\t")); break; + default: DEBUG_PRINT(DEBUG_DVI,("\n NO CHAR:\t")) + } + if (debug & DEBUG_DVI && c>=0 && c<=UCHAR_MAX && isprint(c)) + DEBUG_PRINT(DEBUG_DVI,("'%c' ",c)); + DEBUG_PRINT(DEBUG_DVI,("%d at (%d,%d) tfmw %d", c, + dvi_stack->hh,dvi_stack->vv,ptr?ptr->tfmw:0)); +#endif + if (currentfont->type==FONT_TYPE_VF) { + return(SetVF(ptr)); + } else { + if (ptr->data == NULL) + switch(currentfont->type) { + case FONT_TYPE_PK: LoadPK(c, ptr); break; +#ifdef HAVE_FT2 + case FONT_TYPE_FT: LoadFT(c, ptr); break; +#endif + default: + Fatal("undefined fonttype %d",currentfont->type); + } + if (page_imagep != NULL) + return(SetGlyph(ptr, dvi_stack->hh, dvi_stack->vv)); + else { + /* Expand bounding box if necessary */ + min(x_min,dvi_stack->hh - ptr->xOffset/shrinkfactor); + min(y_min,dvi_stack->vv - ptr->yOffset/shrinkfactor); + max(x_max,dvi_stack->hh - ptr->xOffset/shrinkfactor + ptr->w); + max(y_max,dvi_stack->vv - ptr->yOffset/shrinkfactor + ptr->h); + return(ptr->tfmw); + } + } + return(0); +} + +void DrawCommand(unsigned char* command, void* parent /* dvi/vf */) + /* To be used both in plain DVI drawing and VF drawing */ +{ + dviunits temp; + + if (/*command >= SETC_000 &&*/ *command <= SETC_127) { + temp = SetChar((int32_t)*command); + dvi_stack->h += temp; + dvi_stack->hh += PIXROUND(temp,dvi->conv*shrinkfactor); + CHECK_MAXDRIFT(dvi_stack->h,dvi_stack->hh); + } else if (*command >= FONT_00 && *command <= FONT_63) { + SetFntNum((int32_t)*command - FONT_00,parent); + } else switch (*command) { + case PUT1: case PUT2: case PUT3: case PUT4: + DEBUG_PRINT(DEBUG_DVI,(" %d", + UNumRead(command+1, dvi_commandlength[*command]-1))); + (void) SetChar(UNumRead(command+1, dvi_commandlength[*command]-1)); + break; + case SET1: case SET2: case SET3: case SET4: + DEBUG_PRINT(DEBUG_DVI,(" %d", + UNumRead(command+1, dvi_commandlength[*command]-1))); + { + temp = SetChar(UNumRead(command+1, dvi_commandlength[*command]-1)); + dvi_stack->h += temp; + dvi_stack->hh += PIXROUND(temp,dvi->conv*shrinkfactor); + CHECK_MAXDRIFT(dvi_stack->h,dvi_stack->hh); + } + break; + case SET_RULE: + DEBUG_PRINT(DEBUG_DVI,(" %d %d", + UNumRead(command+1, 4), UNumRead(command+5, 4))); + temp = SetRule(DO_VFCONV(UNumRead(command+1, 4)), + DO_VFCONV(UNumRead(command+5, 4)), + dvi_stack->hh, dvi_stack->vv); + dvi_stack->h += temp; + dvi_stack->hh += PIXROUND(temp,dvi->conv*shrinkfactor); + CHECK_MAXDRIFT(dvi_stack->h,dvi_stack->hh); + break; + case PUT_RULE: + DEBUG_PRINT(DEBUG_DVI,(" %d %d", + UNumRead(command+1, 4), UNumRead(command+5, 4))); + (void) SetRule(DO_VFCONV(UNumRead(command+1, 4)), + DO_VFCONV(UNumRead(command+5, 4)), + dvi_stack->hh, dvi_stack->vv); + break; + case BOP: + Fatal("BOP occurs within page"); + break; + case EOP: + break; + case PUSH: + /* is next item on stack? */ + if (dvi_stack == &stack[STACK_SIZE-1]) + Fatal("DVI stack overflow"); + { + struct stack_entry *next=dvi_stack+1; + next->h = dvi_stack->h; + next->v = dvi_stack->v; + next->w = dvi_stack->w; + next->x = dvi_stack->x; + next->y = dvi_stack->y; + next->z = dvi_stack->z; + next->hh = dvi_stack->hh; + next->vv = dvi_stack->vv; + dvi_stack=next; + } + break; + case POP: + if (dvi_stack == stack) + Fatal("DVI stack underflow"); + dvi_stack--; + break; + case RIGHT1: case RIGHT2: case RIGHT3: case RIGHT4: + DEBUG_PRINT(DEBUG_DVI,(" %d", + SNumRead(command+1, dvi_commandlength[*command]-1))); + MoveRight(DO_VFCONV(SNumRead(command+1, dvi_commandlength[*command]-1))); + break; + case W1: case W2: case W3: case W4: + dvi_stack->w = SNumRead(command+1, dvi_commandlength[*command]-1); + DEBUG_PRINT(DEBUG_DVI,(" %d",dvi_stack->w)); + case W0: + MoveRight(DO_VFCONV(dvi_stack->w)); + break; + case X1: case X2: case X3: case X4: + dvi_stack->x = SNumRead(command+1, dvi_commandlength[*command]-1); + DEBUG_PRINT(DEBUG_DVI,(" %d",dvi_stack->x)); + case X0: + MoveRight(DO_VFCONV(dvi_stack->x)); + break; + case DOWN1: case DOWN2: case DOWN3: case DOWN4: + DEBUG_PRINT(DEBUG_DVI,(" %d", + SNumRead(command+1, dvi_commandlength[*command]-1))); + MoveDown(DO_VFCONV(SNumRead(command+1, dvi_commandlength[*command]-1))); + break; + case Y1: case Y2: case Y3: case Y4: + dvi_stack->y = SNumRead(command+1, dvi_commandlength[*command]-1); + DEBUG_PRINT(DEBUG_DVI,(" %d",dvi_stack->y)); + case Y0: + MoveDown(DO_VFCONV(dvi_stack->y)); + break; + case Z1: case Z2: case Z3: case Z4: + dvi_stack->z = SNumRead(command+1, dvi_commandlength[*command]-1); + DEBUG_PRINT(DEBUG_DVI,(" %d",dvi_stack->z)); + case Z0: + MoveDown(DO_VFCONV(dvi_stack->z)); + break; + case FNT1: case FNT2: case FNT3: case FNT4: + DEBUG_PRINT(DEBUG_DVI,(" %d", + UNumRead(command+1, dvi_commandlength[*command]-1))); + SetFntNum(UNumRead(command+1, dvi_commandlength[*command]-1),parent); + break; + case XXX1: case XXX2: case XXX3: case XXX4: + DEBUG_PRINT(DEBUG_DVI,(" %d", + UNumRead(command+1, dvi_commandlength[*command]-1))); + SetSpecial((char*)command + dvi_commandlength[*command], + (char*)command + dvi_commandlength[*command] + +UNumRead(command+1, dvi_commandlength[*command]-1), + dvi_stack->hh,dvi_stack->vv); + break; + case FNT_DEF1: case FNT_DEF2: case FNT_DEF3: case FNT_DEF4: + if (((struct font_entry*)parent)->type==DVI_TYPE) { + FontDef(command, parent); + } else { + Fatal("%s within VF macro from %s",dvi_commands[*command], + ((struct font_entry*)parent)->n); + } + break; + case PRE: case POST: case POST_POST: + Fatal("%s occurs within page",dvi_commands[*command]); + break; + case NOP: + break; + default: + Fatal("%s is an undefined command",dvi_commands[*command]); + break; + } +} + +void BeginVFMacro(struct font_entry* currentvf) +{ + struct stack_entry *next=dvi_stack+1; + if (dvi_stack == &stack[STACK_SIZE-1]) + Fatal("DVI stack overflow"); + next->h = dvi_stack->h; + next->v = dvi_stack->v; + next->w = next->x = next->y = next->z = 0; + next->hh = dvi_stack->hh; + next->vv = dvi_stack->vv; + dvi_stack = next; + DEBUG_PRINT(DEBUG_DVI,("\n START VF:\tPUSH, W = X = Y = Z = 0")); + SetFntNum(currentvf->defaultfont,currentvf); +} + +void EndVFMacro(void) +{ + if (dvi_stack == stack) + Fatal("DVI stack underflow"); + dvi_stack--; + DEBUG_PRINT(DEBUG_DVI,("\n END VF:\tPOP ")); +} + + +static void DrawPage(dviunits hoffset, dviunits voffset) + /* To be used after having read BOP and will exit cleanly when + * encountering EOP. + */ +{ + unsigned char* command; /* current command */ + + dvi_stack->h = hoffset; + dvi_stack->v = voffset; + dvi_stack->w = dvi_stack->x = dvi_stack->y = dvi_stack->z = 0; + dvi_stack->hh = PIXROUND( dvi_stack->h , dvi->conv*shrinkfactor ); + dvi_stack->vv = PIXROUND( dvi_stack->v , dvi->conv*shrinkfactor ); + currentfont = NULL; /* No default font */ + + command=DVIGetCommand(dvi); + DEBUG_PRINT(DEBUG_DVI,("DRAW CMD:\t%s", dvi_commands[*command])); + while (*command != EOP) { + DrawCommand(command,dvi); + command=DVIGetCommand(dvi); + DEBUG_PRINT(DEBUG_DVI,("DRAW CMD:\t%s", dvi_commands[*command])); + } +} + +void DrawPages(void) +{ + struct page_list *dvi_pos; + pixels x_width,y_width,x_offset,y_offset; + int pagecounter=(option_flags & DVI_PAGENUM)?0:10; + + dvi_pos=NextPPage(dvi,NULL); + if (dvi_pos!=NULL) { + while(dvi_pos!=NULL) { + SeekPage(dvi,dvi_pos); + Message(BE_NONQUIET,"[%d", dvi_pos->count[pagecounter]); + if (dvi_pos->count[pagecounter]!=dvi_pos->count[0]) + Message(BE_NONQUIET," (%d)", dvi_pos->count[0]); + x_max = y_max = INT32_MIN; + x_min = y_min = INT32_MAX; + DrawPage((dviunits)0,(dviunits)0); + /* Store background color. Background color of a page is given + by the color at EOP rather than the color at BOP. */ + StoreBackgroundColor(dvi_pos); + /* Store pagesize */ + if (dvi->flags & DVI_PREVIEW_LATEX_TIGHTPAGE) { + x_width_def=x_width_tightpage; + y_width_def=y_width_tightpage; + x_offset_def=x_offset_tightpage; + y_offset_def=y_offset_tightpage; + } + if (x_width_def >= 0) { /* extend BBOX */ + min(x_min,-x_offset_def); + max(x_max,x_min + x_width_def); + min(y_min,-y_offset_def); + max(y_max,y_min + y_width_def); + } + if (x_width_def <= 0 || option_flags & EXPAND_BBOX) { + x_width = x_max-x_min; + y_width = y_max-y_min; + x_offset = -x_min; /* offset by moving topleft corner */ + y_offset = -y_min; /* offset by moving topleft corner */ + } else { + x_width=x_width_def; + y_width=y_width_def; + x_offset=x_offset_def; + y_offset=y_offset_def; + } + DEBUG_PRINT(DEBUG_DVI,("\n IMAGE:\t%dx%d",x_width,y_width)); + SeekPage(dvi,dvi_pos); + CreateImage(x_width,y_width); +#ifdef DEBUG + DEBUG_PRINT(DEBUG_DVI,("\n@%d PAGE START:\tBOP",dvi_pos->offset)); + { + int i; + for (i=0;i<10;i++) + DEBUG_PRINT(DEBUG_DVI,(" %d",dvi_pos->count[i])); + DEBUG_PRINT(DEBUG_DVI,(" (%d)\n",dvi_pos->count[10])); + } +#endif + Message(REPORT_DEPTH," depth=%d", y_width-y_offset-1); + Message(REPORT_HEIGHT," height=%d", y_offset+1); + Message(REPORT_WIDTH," width=%d", x_width); + page_flags &= ~PAGE_PREVIEW_BOP; + DrawPage(x_offset*dvi->conv*shrinkfactor, + y_offset*dvi->conv*shrinkfactor); + if ( ! (option_flags & MODE_PICKY && page_flags & PAGE_GAVE_WARN )) { + WriteImage(dvi->outname,dvi_pos->count[pagecounter]); +#ifdef TIMING + ++ndone; +#endif + } else { + exitcode=EXIT_FAILURE; + Message(BE_NONQUIET,"(page not rendered)"); + DestroyImage(); + } + Message(BE_NONQUIET,"] "); + fflush(stdout); + page_flags = 0; + dvi_pos=NextPPage(dvi,dvi_pos); + } + Message(BE_NONQUIET,"\n"); + ClearPpList(); + } +} diff --git a/Build/source/texk/dvipng/dvipng-src/dvi.c b/Build/source/texk/dvipng/dvipng-src/dvi.c new file mode 100644 index 00000000000..139d0ea13c4 --- /dev/null +++ b/Build/source/texk/dvipng/dvipng-src/dvi.c @@ -0,0 +1,487 @@ +/* dvi.c */ + +/************************************************************************ + + Part of the dvipng distribution + + This program is free software: you can redistribute it and/or modify + it under the terms of the GNU Lesser General Public License as + published by the Free Software Foundation, either version 3 of the + License, or (at your option) any later version. + + This program is distributed in the hope that it will be useful, but + WITHOUT ANY WARRANTY; without even the implied warranty of + MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU + Lesser General Public License for more details. + + You should have received a copy of the GNU Lesser General Public + License along with this program. If not, see + <http://www.gnu.org/licenses/>. + + Copyright (C) 2002-2015, 2019 Jan-Åke Larsson + +************************************************************************/ + +#include "dvipng.h" +#ifdef MIKTEX +# include <gnu-miktex.h> +# define USLEEP Sleep +#else /* MIKTEX */ +# ifdef HAVE_LIBGEN_H +# include <libgen.h> +# else +# define basename xbasename +# endif +# ifdef WIN32 +# define USLEEP Sleep +# include <stdlib.h> +# else +# include <unistd.h> +# define USLEEP usleep +# endif /* WIN32 */ +#endif /* MIKTEX */ +#include <sys/stat.h> +#include <fcntl.h> + +bool followmode=0; + +bool DVIFollowToggle(void) +{ + return followmode = ! followmode; +} + +static unsigned char fgetc_follow(FILE* fp) +{ + int got=fgetc(fp),nsleep=1; + + while(followmode && got==EOF) { + USLEEP(nsleep/1310); /* After a few trials, poll every 65536/1310=50 usec */ + clearerr(fp); + got=fgetc(fp); + if (nsleep<50000) + nsleep*=2; + } + if (got==EOF) + Fatal("DVI file ends prematurely"); + return (unsigned char)got; +} + +static void DVIInit(struct dvi_data* dvi) +{ + int k; + unsigned char* pre; + struct stat stat; + + fseek(dvi->filep,0,SEEK_SET); + pre=DVIGetCommand(dvi); + if (*pre != PRE) { + Fatal("PRE does not occur first - are you sure this is a DVI file?"); + } + k = UNumRead(pre+1,1); + DEBUG_PRINT(DEBUG_DVI,("DVI START:\tPRE %d",k)); + if (k != DVIFORMAT) { + Fatal("DVI format = %d, can only process DVI format %d files", + k, DVIFORMAT); + } + dvi->num = UNumRead(pre+2, 4); + dvi->den = UNumRead(pre+6, 4); + DEBUG_PRINT(DEBUG_DVI,(" %d/%d",dvi->num,dvi->den)); + dvi->mag = UNumRead(pre+10, 4); /*FIXME, see font.c*/ + DEBUG_PRINT(DEBUG_DVI,(" %d",dvi->mag)); + if ( usermag > 0 && usermag != dvi->mag ) { + Warning("DVI magnification of %d over-ridden by user (%ld)", + (long)dvi->mag, usermag ); + dvi->mag = usermag; + } + dvi->conv = (1.0/(((double)dvi->num / (double)dvi->den) * + ((double)dvi->mag / 1000.0) * + ((double)dpi*shrinkfactor/254000.0)))+0.5; + DEBUG_PRINT(DEBUG_DVI,(" (%d)",dvi->conv)); + k = UNumRead(pre+14,1); + DEBUG_PRINT(DEBUG_DVI,(" '%.*s'",k,pre+15)); + Message(BE_VERBOSE,"'%.*s' -> %s\n",k,pre+15,dvi->outname); + fstat(fileno(dvi->filep), &stat); + dvi->mtime = stat.st_mtime; + dvi->pagelistp=NULL; + dvi->flags = 0; +} + +struct dvi_data* DVIOpen(char* dviname,char* outname) +{ + char* tmpstring; + struct dvi_data* dvi; + + if ((dvi = calloc(1,sizeof(struct dvi_data)))==NULL) + Fatal("cannot allocate memory for DVI struct"); + dvi->type = DVI_TYPE; + dvi->fontnump=NULL; + if ((dvi->name = malloc(strlen(dviname)+5))==NULL) + Fatal("cannot allocate space for DVI filename"); + strcpy(dvi->name, dviname); + tmpstring = strrchr(dvi->name, '.'); + if (tmpstring == NULL || strcmp(tmpstring,".dvi") != 0) + strcat(dvi->name, ".dvi"); + if (outname==NULL) { + if ((dvi->outname = malloc(strlen(basename(dviname))+7))==NULL) { + free(dvi->name); + free(dvi); + Fatal("cannot allocate space for output filename"); + } + strcpy(dvi->outname,basename(dviname)); + tmpstring = strrchr(dvi->outname, '.'); + if (tmpstring != NULL && strcmp(tmpstring,".dvi") == 0) + *tmpstring = '\0'; + strcat(dvi->outname, "%d.png"); + } else { + if ((dvi->outname = malloc(strlen(outname)+1))==NULL) { + free(dvi->name); + free(dvi); + Fatal("cannot allocate space for output filename"); + } + strcpy(dvi->outname,outname); + } + if ((dvi->filep = fopen(dvi->name,"rb")) == NULL) { + /* do not insist on .dvi */ + tmpstring = strrchr(dvi->name, '.'); + *tmpstring='\0'; + dvi->filep = fopen(dvi->name,"rb"); + } + while((dvi->filep == NULL) && followmode) { + USLEEP(50); + *tmpstring='.'; + if ((dvi->filep = fopen(dvi->name,"rb")) == NULL) { + /* do not insist on .dvi */ + *tmpstring='\0'; + dvi->filep = fopen(dvi->name,"rb"); + } + } + if (dvi->filep == NULL) { + free(dvi->name); + free(dvi->outname); + free(dvi); + perror(dviname); + exit (EXIT_FAILURE); + } + DEBUG_PRINT(DEBUG_DVI,("OPEN FILE\t%s", dvi->name)); + DVIInit(dvi); + return(dvi); +} + +unsigned char* DVIGetCommand(struct dvi_data* dvi) + /* This function reads in and stores the next dvi command. */ + /* Mmap is not appropriate here, we may want to read from + half-written files. */ +{ + static unsigned char* command=NULL; + static uint32_t commlen=0; + unsigned char *current = command; + int length; + uint32_t strlength=0; + + if (commlen==0) { + commlen=STRSIZE; + if ((current=command=malloc(commlen))==NULL) + Fatal("cannot allocate memory for DVI command"); + } + DEBUG_PRINT(DEBUG_DVI,("\n@%ld ", ftell(dvi->filep))); + *(current++) = fgetc_follow(dvi->filep); + length = dvi_commandlength[*command]; + if (length < 0) + Fatal("undefined DVI op-code %d",*command); + while(current < command+length) + *(current++) = fgetc_follow(dvi->filep); + switch (*command) { + case XXX4: + strlength = *(current - 4); + case XXX3: + strlength = strlength * 256 + *(current - 3); + case XXX2: + strlength = strlength * 256 + *(current - 2); + case XXX1: + strlength = strlength * 256 + *(current - 1); + break; + case FNT_DEF1: case FNT_DEF2: case FNT_DEF3: case FNT_DEF4: + strlength = *(current - 1) + *(current - 2); + break; + case PRE: + strlength = *(current - 1); + break; + } + if (strlength > 0) { /* Read string */ + if (strlength > UINT32_MAX - (uint32_t)length - 1) + Fatal("integer overflow in DVI command length"); + if (strlength+1 + (uint32_t)length > commlen) { + /* string + command length exceeds that of buffer */ + commlen=strlength+1 + (uint32_t)length; + if ((command=realloc(command,commlen))==NULL) + Fatal("cannot allocate memory for DVI command"); + current = command + length; + } + while(current < command+length+strlength) + *(current++) = fgetc_follow(dvi->filep); + *current='\0'; + } + return(command); +} + +bool DVIIsNextPSSpecial(struct dvi_data* dvi) + /* This function checks if the next dvi command is a raw PS + special */ + /* Mmap is not appropriate here, we may want to read from + half-written files. */ +{ + long fpos; + uint32_t strlength=0; + bool israwps=false; + + DEBUG_PRINT(DEBUG_DVI,("\n CHECKING NEXT DVI COMMAND ")); + fpos=ftell(dvi->filep); + switch (fgetc_follow(dvi->filep)) { + case XXX4: + strlength = fgetc_follow(dvi->filep); + case XXX3: + strlength = strlength * 256 + fgetc_follow(dvi->filep); + case XXX2: + strlength = strlength * 256 + fgetc_follow(dvi->filep); + case XXX1: + strlength = strlength * 256 + fgetc_follow(dvi->filep); + } + if (strlength > 0) { + switch(fgetc_follow(dvi->filep)) { + case 'p': + if (strlength > 2 + && fgetc_follow(dvi->filep)=='s' + && fgetc_follow(dvi->filep)==':') + israwps=true; + break; + case '"': + israwps=true; + } + } + fseek(dvi->filep,fpos,SEEK_SET); + return(israwps); +} + +uint32_t CommandLength(unsigned char* command) +{ + /* generally 2^32+5 bytes max, but in practice 32 bit numbers suffice */ + uint32_t length=0; + + length = dvi_commandlength[*command]; + switch (*command) { + case XXX1: case XXX2: case XXX3: case XXX4: + length += UNumRead(command + 1,length - 1); + break; + case FNT_DEF1: case FNT_DEF2: case FNT_DEF3: case FNT_DEF4: + length += *(command + length - 1) + *(command + length - 2); + break; + case PRE: + length += *(command + length - 1); + break; + } + return(length); +} + +static void SkipPage(struct dvi_data* dvi) +{ + /* Skip present page */ + unsigned char* command; + + command=DVIGetCommand(dvi); + while (*command != EOP) { + switch (*command) { + case FNT_DEF1: case FNT_DEF2: case FNT_DEF3: case FNT_DEF4: + DEBUG_PRINT(DEBUG_DVI,("NOSKIP CMD:\t%s", dvi_commands[*command])); + FontDef(command,dvi); + break; + case XXX1: case XXX2: case XXX3: case XXX4: + DEBUG_PRINT(DEBUG_DVI,("NOSKIP CMD:\t%s %d", dvi_commands[*command], + UNumRead(command+1, dvi_commandlength[*command]-1))); + SetSpecial((char*)command + dvi_commandlength[*command], + (char*)command + dvi_commandlength[*command] + +UNumRead(command+1, dvi_commandlength[*command]-1), + 0,0); + break; + case BOP: case PRE: case POST: case POST_POST: + Fatal("%s occurs within page", dvi_commands[*command]); + break; +#ifdef DEBUG + default: + DEBUG_PRINT(DEBUG_DVI,("SKIP CMD:\t%s", dvi_commands[*command])); +#endif + } + command=DVIGetCommand(dvi); + } /* while */ + DEBUG_PRINT(DEBUG_DVI,("SKIP CMD:\t%s", dvi_commands[*command])); +} + +static struct page_list* InitPage(struct dvi_data* dvi) +{ + /* Find page start, return pointer to page_list entry if found */ + struct page_list* tpagelistp=NULL; + unsigned char* command; + + command=DVIGetCommand(dvi); + /* Skip until page start or postamble */ + while((*command != BOP) && (*command != POST)) { + switch(*command) { + case FNT_DEF1: case FNT_DEF2: case FNT_DEF3: case FNT_DEF4: + DEBUG_PRINT(DEBUG_DVI,("NOPAGE CMD:\t%s", dvi_commands[*command])); + FontDef(command,dvi); + break; + case NOP: + DEBUG_PRINT(DEBUG_DVI,("NOPAGE CMD:\tNOP")); + break; + default: + Fatal("%s occurs outside page", dvi_commands[*command]); + } + command=DVIGetCommand(dvi); + } + if ((tpagelistp = + malloc(sizeof(struct page_list) + +(csp+1-2)*sizeof(struct dvi_color)))==NULL) + Fatal("cannot allocate memory for new page entry"); + tpagelistp->next = NULL; + if ( *command == BOP ) { /* Init page */ + int i; + DEBUG_PRINT(DEBUG_DVI,("PAGE START:\tBOP")); + StoreColorStack(tpagelistp); + tpagelistp->offset = ftell(dvi->filep)-45; + for (i = 0; i <= 9; i++) { + tpagelistp->count[i] = UNumRead(command + 1 + i*4, 4); + DEBUG_PRINT(DEBUG_DVI,(" %d",tpagelistp->count[i])); + } + if (dvi->pagelistp==NULL) + tpagelistp->count[10] = 1; + else + tpagelistp->count[10] = dvi->pagelistp->count[10]+1; + DEBUG_PRINT(DEBUG_DVI,(" (%d)", tpagelistp->count[10])); + } else { + DEBUG_PRINT(DEBUG_DVI,("DVI END:\tPOST")); + tpagelistp->offset = ftell(dvi->filep)-1; + tpagelistp->count[0] = PAGE_POST; /* POST */ + tpagelistp->count[10] = PAGE_POST; /* POST */ + } + return(tpagelistp); +} + +int SeekPage(struct dvi_data* dvi, struct page_list* page) +{ + ReadColorStack(page); + return(fseek(dvi->filep, + page->offset+((page->count[0]==PAGE_POST) ? 1L : 45L), + SEEK_SET)); +} + +struct page_list* NextPage(struct dvi_data* dvi, struct page_list* page) +{ + struct page_list* tpagelistp; + + /* if page points to POST there is no next page */ + if (page!=NULL && page->count[0]==PAGE_POST) + return(NULL); + + /* If we have read past the last page in our current list or the + * list is empty, sneak a look at the next page + */ + if (dvi->pagelistp==NULL + || dvi->pagelistp->offset+45L < ftell(dvi->filep)) { + tpagelistp=dvi->pagelistp; + dvi->pagelistp=InitPage(dvi); + dvi->pagelistp->next=tpagelistp; + } + + if (page!=dvi->pagelistp) { + /* also works if page==NULL, we'll get the first page then */ + tpagelistp=dvi->pagelistp; + while(tpagelistp!=NULL && tpagelistp->next!=page) + tpagelistp=tpagelistp->next; + } else { + /* dvi->pagelistp points to the last page we've read so far, + * the last page that we know where it is, so to speak + * So look at the next + */ + (void)SeekPage(dvi,dvi->pagelistp); + SkipPage(dvi); + tpagelistp=dvi->pagelistp; + dvi->pagelistp=InitPage(dvi); + dvi->pagelistp->next=tpagelistp; + tpagelistp=dvi->pagelistp; + } + return(tpagelistp); +} + +struct page_list* PrevPage(struct dvi_data* dvi, struct page_list* page) +{ + return(page->next); +} + + +struct page_list* FindPage(struct dvi_data* dvi, int32_t pagenum, bool abspage) + /* Find first page of certain number, + absolute number if abspage is set */ +{ + struct page_list* page=NextPage(dvi, NULL); + + if (pagenum==PAGE_LASTPAGE || pagenum==PAGE_POST) { + while(page!=NULL && page->count[0]!=PAGE_POST) + page=NextPage(dvi,page); + if (pagenum==PAGE_LASTPAGE) + page=PrevPage(dvi,page); + } else + if (pagenum!=PAGE_FIRSTPAGE) + while(page != NULL && pagenum != page->count[abspage ? 0 : 10]) + page=NextPage(dvi,page); + return(page); +} + + +static void DelPageList(struct dvi_data* dvi) +{ + struct page_list* temp; + + /* Delete the page list */ + + temp=dvi->pagelistp; + while(temp!=NULL) { + dvi->pagelistp=dvi->pagelistp->next; + free(temp); + temp=dvi->pagelistp; + } +} + +void DVIClose(struct dvi_data* dvi) +{ + if (dvi!=NULL) { + fclose(dvi->filep); + DelPageList(dvi); + ClearPSHeaders(); + free(dvi->outname); + free(dvi->name); + free(dvi); + } +} + +bool DVIReOpen(struct dvi_data* dvi) +{ + struct stat stat; + fstat(fileno(dvi->filep), &stat); + if (dvi->mtime != stat.st_mtime) { + fclose(dvi->filep); + dvi->filep=NULL; + DelPageList(dvi); + ClearPSHeaders(); + while(((dvi->filep = fopen(dvi->name,"rb")) == NULL) && followmode) { + USLEEP(50); + } + if (dvi->filep == NULL) { + perror(dvi->name); + exit(EXIT_FAILURE); + } + Message(PARSE_STDIN,"Reopened file\n"); + DEBUG_PRINT(DEBUG_DVI,("\nREOPEN FILE\t%s", dvi->name)); + DVIInit(dvi); + return(true); + } + return(false); +} diff --git a/Build/source/texk/dvipng/dvipng-src/dvipng.1 b/Build/source/texk/dvipng/dvipng-src/dvipng.1 new file mode 100644 index 00000000000..613912fea6d --- /dev/null +++ b/Build/source/texk/dvipng/dvipng-src/dvipng.1 @@ -0,0 +1,506 @@ +.\" Automatically generated by Pod::Man 4.09 (Pod::Simple 3.35) +.\" +.\" Standard preamble: +.\" ======================================================================== +.de Sp \" Vertical space (when we can't use .PP) +.if t .sp .5v +.if n .sp +.. +.de Vb \" Begin verbatim text +.ft CW +.nf +.ne \\$1 +.. +.de Ve \" End verbatim text +.ft R +.fi +.. +.\" Set up some character translations and predefined strings. \*(-- will +.\" give an unbreakable dash, \*(PI will give pi, \*(L" will give a left +.\" double quote, and \*(R" will give a right double quote. \*(C+ will +.\" give a nicer C++. Capital omega is used to do unbreakable dashes and +.\" therefore won't be available. \*(C` and \*(C' expand to `' in nroff, +.\" nothing in troff, for use with C<>. +.tr \(*W- +.ds C+ C\v'-.1v'\h'-1p'\s-2+\h'-1p'+\s0\v'.1v'\h'-1p' +.ie n \{\ +. ds -- \(*W- +. ds PI pi +. if (\n(.H=4u)&(1m=24u) .ds -- \(*W\h'-12u'\(*W\h'-12u'-\" diablo 10 pitch +. if (\n(.H=4u)&(1m=20u) .ds -- \(*W\h'-12u'\(*W\h'-8u'-\" diablo 12 pitch +. ds L" "" +. ds R" "" +. ds C` "" +. ds C' "" +'br\} +.el\{\ +. ds -- \|\(em\| +. ds PI \(*p +. ds L" `` +. ds R" '' +. ds C` +. ds C' +'br\} +.\" +.\" Escape single quotes in literal strings from groff's Unicode transform. +.ie \n(.g .ds Aq \(aq +.el .ds Aq ' +.\" +.\" If the F register is >0, we'll generate index entries on stderr for +.\" titles (.TH), headers (.SH), subsections (.SS), items (.Ip), and index +.\" entries marked with X<> in POD. Of course, you'll have to process the +.\" output yourself in some meaningful fashion. +.\" +.\" Avoid warning from groff about undefined register 'F'. +.de IX +.. +.if !\nF .nr F 0 +.if \nF>0 \{\ +. de IX +. tm Index:\\$1\t\\n%\t"\\$2" +.. +. if !\nF==2 \{\ +. nr % 0 +. nr F 2 +. \} +.\} +.\" +.\" Accent mark definitions (@(#)ms.acc 1.5 88/02/08 SMI; from UCB 4.2). +.\" Fear. Run. Save yourself. No user-serviceable parts. +. \" fudge factors for nroff and troff +.if n \{\ +. ds #H 0 +. ds #V .8m +. ds #F .3m +. ds #[ \f1 +. ds #] \fP +.\} +.if t \{\ +. ds #H ((1u-(\\\\n(.fu%2u))*.13m) +. ds #V .6m +. ds #F 0 +. ds #[ \& +. ds #] \& +.\} +. \" simple accents for nroff and troff +.if n \{\ +. ds ' \& +. ds ` \& +. ds ^ \& +. ds , \& +. ds ~ ~ +. ds / +.\} +.if t \{\ +. ds ' \\k:\h'-(\\n(.wu*8/10-\*(#H)'\'\h"|\\n:u" +. ds ` \\k:\h'-(\\n(.wu*8/10-\*(#H)'\`\h'|\\n:u' +. ds ^ \\k:\h'-(\\n(.wu*10/11-\*(#H)'^\h'|\\n:u' +. ds , \\k:\h'-(\\n(.wu*8/10)',\h'|\\n:u' +. ds ~ \\k:\h'-(\\n(.wu-\*(#H-.1m)'~\h'|\\n:u' +. ds / \\k:\h'-(\\n(.wu*8/10-\*(#H)'\z\(sl\h'|\\n:u' +.\} +. \" troff and (daisy-wheel) nroff accents +.ds : \\k:\h'-(\\n(.wu*8/10-\*(#H+.1m+\*(#F)'\v'-\*(#V'\z.\h'.2m+\*(#F'.\h'|\\n:u'\v'\*(#V' +.ds 8 \h'\*(#H'\(*b\h'-\*(#H' +.ds o \\k:\h'-(\\n(.wu+\w'\(de'u-\*(#H)/2u'\v'-.3n'\*(#[\z\(de\v'.3n'\h'|\\n:u'\*(#] +.ds d- \h'\*(#H'\(pd\h'-\w'~'u'\v'-.25m'\f2\(hy\fP\v'.25m'\h'-\*(#H' +.ds D- D\\k:\h'-\w'D'u'\v'-.11m'\z\(hy\v'.11m'\h'|\\n:u' +.ds th \*(#[\v'.3m'\s+1I\s-1\v'-.3m'\h'-(\w'I'u*2/3)'\s-1o\s+1\*(#] +.ds Th \*(#[\s+2I\s-2\h'-\w'I'u*3/5'\v'-.3m'o\v'.3m'\*(#] +.ds ae a\h'-(\w'a'u*4/10)'e +.ds Ae A\h'-(\w'A'u*4/10)'E +. \" corrections for vroff +.if v .ds ~ \\k:\h'-(\\n(.wu*9/10-\*(#H)'\s-2\u~\d\s+2\h'|\\n:u' +.if v .ds ^ \\k:\h'-(\\n(.wu*10/11-\*(#H)'\v'-.4m'^\v'.4m'\h'|\\n:u' +. \" for low resolution devices (crt and lpr) +.if \n(.H>23 .if \n(.V>19 \ +\{\ +. ds : e +. ds 8 ss +. ds o a +. ds d- d\h'-1'\(ga +. ds D- D\h'-1'\(hy +. ds th \o'bp' +. ds Th \o'LP' +. ds ae ae +. ds Ae AE +.\} +.rm #[ #] #H #V #F C +.\" ======================================================================== +.\" +.IX Title "DVIPNG 1" +.TH DVIPNG 1 "2020-01-05" "dvipng 1.17" "User commands" +.\" For nroff, turn off justification. Always turn off hyphenation; it makes +.\" way too many mistakes in technical documents. +.if n .ad l +.nh +.SH "NAME" +dvipng \- A DVI\-to\-PNG translator +.SH "SYNOPSIS" +.IX Header "SYNOPSIS" +dvipng [options] filename +.PP +dvipng [options] [filename] \- +.SH "DESCRIPTION" +.IX Header "DESCRIPTION" +This program makes \s-1PNG\s0 and/or \s-1GIF\s0 graphics from \s-1DVI\s0 files as obtained +from TeX and its relatives. +.PP +If \s-1GIF\s0 support is enabled, \s-1GIF\s0 output is chosen by using the +\&\fBdvigif\fR binary or with the \fB\-\-gif\fR option. +.PP +The benefits of \fBdvipng\fR/\fBdvigif\fR include +.IP "*" 4 +Speed. It is a very fast bitmap-rendering code for \s-1DVI\s0 files, which +makes it suitable for generating large amounts of images on-the-fly, +as needed in preview-latex, WeBWorK and others. +.IP "*" 4 +It does not read the postamble, so it can be started before TeX +finishes. There is a \fB\-\-follow\fR switch that makes dvipng wait at +end-of-file for further output, unless it finds the \s-1POST\s0 marker that +indicates the end of the \s-1DVI.\s0 +.IP "*" 4 +Interactive query of options. dvipng can read options interactively +through stdin, and all options are usable. It is even possible to change +the input file through this interface. +.IP "*" 4 +Supports \s-1PK, VF,\s0 PostScript Type1, and TrueType fonts, subfonts (i.e., +as used in CJK-LaTeX), color specials, and inclusion of PostScript, +\&\s-1PNG, JPEG\s0 or \s-1GIF\s0 images. +.IP "*" 4 +and more... +.SH "OPTIONS" +.IX Header "OPTIONS" +Many of the parameterless options listed here can be turned off by +suffixing the option with a zero (\fB0\fR); for instance, to turn off +page reversal, use \fB\-r0\fR. Such options are marked with a trailing +\&\fB*\fR. +.IP "\fB\-\fR" 4 +.IX Item "-" +Read additional options from standard input after processing the command +line. +.IP "\fB\-\-help\fR" 4 +.IX Item "--help" +Print a usage message and exit. +.IP "\fB\-\-version\fR" 4 +.IX Item "--version" +Print the version number and exit. +.IP "\fB\-bd\fR \fInum\fR" 4 +.IX Item "-bd num" +.PD 0 +.IP "\fB\-bd\fR \fIcolor_spec\fR" 4 +.IX Item "-bd color_spec" +.IP "\fB\-bd '\fR\fInum\fR\fB \fR\fIcolor_spec\fR\fB'\fR" 4 +.IX Item "-bd 'num color_spec'" +.PD +Set the pixel width of the transparent border (default 0). Using this +option will make the image edges transparent, but it only affects pixels +with the background color. Giving a \fIcolor_spec\fR will set the +fallback color, to be used in viewers that cannot handle transparency +(the default is the background color). The color spec should be in +TeX color \especial syntax, e.g., 'rgb 1.0 0.0 0.0'. Setting the +fallback color makes the default border width 1 px. +.IP "\fB\-\-bdpi\fR \fInum\fR" 4 +.IX Item "--bdpi num" +This option only has an effect when using bitmapped (\s-1PK\s0) fonts. The +option sets the base (Metafont) resolution, both horizontal and +vertical, to \fInum\fR dpi (dots per inch). This option is necessary +when manually selecting Metafont mode with the \-\-mode option (see +below). +.IP "\fB\-bg\fR \fIcolor_spec\fR" 4 +.IX Item "-bg color_spec" +Choose background color for the images. This option will be ignored if +there is a background color \especial in the \s-1DVI.\s0 The color spec should +be in TeX color \especial syntax, e.g., 'rgb 1.0 0.0 0.0'. You can +also specify 'Transparent' or 'transparent' which will give you a +transparent background with the normal background as a fallback color. A +capitalized 'Transparent' will give a full-alpha transparency, while an +all-lowercase 'transparent' will give a simple fully transparent +background with non-transparent antialiased pixels. The latter would be +suitable for viewers who cannot cope with a true alpha channel. \s-1GIF\s0 +images do not support full alpha transparency, so in case of \s-1GIF\s0 output, +both variants will use the latter behaviour. +.IP "\fB\-d\fR \fInum\fR" 4 +.IX Item "-d num" +Set the debug flags, showing what dvipng (thinks it) is doing. This will +work unless dvipng has been compiled without the \f(CW\*(C`DEBUG\*(C'\fR option +(not recommended). Set the flags as you need them, use \fB\-d \-1\fR as +the first option for maximum output. +.IP "\fB\-D\fR \fInum\fR" 4 +.IX Item "-D num" +Set the output resolution, both horizontal and vertical, to \fInum\fR +dpi (dots per inch). +.Sp +One may want to adjust this to fit a certain text font size (e.g., on +a web page), and for a text font height of \fIfont_px\fR pixels (in +Mozilla) the correct formula is +.Sp +.Vb 1 +\& <dpi> = <font_px> * 72.27 / 10 [px * TeXpt/in / TeXpt] +.Ve +.Sp +The last division by ten is due to the standard font height 10pt in +your document, if you use 12pt, divide by 12. Unfortunately, some +proprietary browsers have font height in pt (points), not pixels. You +have to rescale that to pixels, using the screen resolution (default +is usually 96 dpi) which means the formula is +.Sp +.Vb 1 +\& <font_px> = <font_pt> * 96 / 72 [pt * px/in / (pt/in)] +.Ve +.Sp +On some high-res screens, the value is instead 120 dpi. Good luck! +.IP "\fB\-\-depth*\fR" 4 +.IX Item "--depth*" +Report the depth of the image. This only works reliably when the +LaTeX style \fIpreview.sty\fR from preview-latex is used with +the \fBactive\fR option. It reports the number of pixels from the +bottom of the image to the baseline of the image. This can be used for +vertical positioning of the image in, e.g., web documents, where one +would use (Cascading StyleSheets 1) +.Sp +.Vb 1 +\& <IMG SRC="<filename.png>" STYLE="vertical\-align: \-<depth>px"> +.Ve +.Sp +The depth is a negative offset in this case, so the minus sign is +necessary, and the unit is pixels (px). +.IP "\fB\-\-dvinum*\fR" 4 +.IX Item "--dvinum*" +Set this option to make the output page number be the TeX page +numbers rather than the physical page number. See the \fB\-o\fR switch. +.IP "\fB\-fg\fR \fIcolor_spec\fR" 4 +.IX Item "-fg color_spec" +Choose foreground color for the images. This option will be ignored if +there is a foreground color \especial in the \s-1DVI.\s0 The color spec should +be in TeX color \especial syntax, e.g., 'rgb 1.0 0.0 0.0'. +.IP "\fB\-\-follow*\fR" 4 +.IX Item "--follow*" +Wait for data at end-of-file. One of the benefits of dvipng is that it +does not read the postamble, so it can be started before TeX +finishes. This switch makes dvipng wait at end-of-file for further +output, unless it finds the \s-1POST\s0 marker that indicates the end of the +\&\s-1DVI.\s0 This is similar to \fBtail \-f\fR but for DVI-to-PNG conversion. +.IP "\fB\-\-freetype*\fR" 4 +.IX Item "--freetype*" +Enable/disable FreeType font rendering (default on). This option is +available if the FreeType2 font library was present at compilation time. +If this is the case, dvipng will have direct support for PostScript +Type1 and TrueType fonts internally, rather than using \fBgsftopk\fR +for rendering the fonts. If you have PostScript versions of Computer +Modern installed, there will be no need to generate bitmapped (\s-1PK\s0) +variants on disk of these. Then, you can render images at different (and +unusual) resolutions without cluttering the disk with lots of bitmapped +fonts. +One reason to disable FreeType font rendering would be to generate +identical output on different platforms, since FreeType uses the native +renderer and therefore can give slightly different output on each platform. +.IP "\fB\-\-gamma\fR \fInum\fR" 4 +.IX Item "--gamma num" +Control the interpolation of colors in the greyscale anti-aliasing +color palette. Default value is 1.0. For 0 < \fInum\fR < 1, the +fonts will be lighter (more like the background), and for \fInum\fR > +1, the fonts will be darker (more like the foreground). +.IP "\fB\-\-gif*\fR" 4 +.IX Item "--gif*" +The images are output in the \s-1GIF\s0 format, if \s-1GIF\s0 support is enabled. +This is the default for the \fBdvigif\fR binary, which only will be +available when \s-1GIF\s0 support is enabled. \s-1GIF\s0 images are palette images +(see the \fB\-\-palette\fR option) and does not support true alpha +channels (see the \fB\-\-bg\fR option). See also the \fB\-\-png\fR +option. +.IP "\fB\-\-height*\fR" 4 +.IX Item "--height*" +Report the height of the image. This only works reliably when the +LaTeX style \fIpreview.sty\fR from preview-latex is used with +the \fBactive\fR option. It reports the number of pixels from the top +of the image to the baseline of the image. The total height of the +image is obtained as the sum of the values reported from +\&\fB\-\-height\fR and \fB\-\-depth\fR. +.IP "\fB\-l [=]\fR\fInum\fR" 4 +.IX Item "-l [=]num" +The last page printed will be the first one numbered \fInum\fR. Default +is the last page in the document. If \fInum\fR is prefixed by an equals +sign, then it (and the argument to the \fB\-p\fR option, if specified) +is treated as a physical (absolute) page number, rather than a value to +compare with the TeX \fB\ecount0\fR values stored in the \s-1DVI\s0 file. +Thus, using \fB\-l =9\fR will end with the ninth page of the document, +no matter what the pages are actually numbered. +.IP "\fB\-\-mode\fR \fImode\fR" 4 +.IX Item "--mode mode" +This option only has an effect when using bitmapped (\s-1PK\s0) fonts. Use +\&\fImode\fR as the Metafont device name for the \s-1PK\s0 fonts (both for path +searching and font generation). This needs to be augmented with the base +device resolution, given with the \fB\-\-bdpi\fR option. See the file +<\fBftp://ftp.tug.org/tex/modes.mf\fR> for a list of resolutions and mode +names for most devices. +.IP "\fB\-M*\fR" 4 +.IX Item "-M*" +This option only has an effect when using bitmapped (\s-1PK\s0) fonts. It turns +off automatic \s-1PK\s0 font generation (\fImktexpk\fR). +.IP "\fB\-\-nogs*\fR" 4 +.IX Item "--nogs*" +This switch prohibits the internal call to GhostScript for displaying +PostScript specials. \fB\-\-nogs0\fR turns the call back on. +.IP "\fB\-\-nogssafer*\fR" 4 +.IX Item "--nogssafer*" +Normally, if GhostScript is used to render PostScript specials, the +GhostScript interpreter is run with the option \fB\-dSAFER\fR. The +\&\fB\-\-nogssafer\fR option runs GhostScript without \fB\-dSAFER\fR. The +\&\fB\-dSAFER\fR option in Ghostscript disables PostScript operators such +as deletefile, to prevent possibly malicious PostScript programs from +having any effect. +.IP "\fB\-\-norawps*\fR" 4 +.IX Item "--norawps*" +Some packages generate raw PostScript specials, even non-rendering such +specials. This switch turns off the internal call to GhostScript +intended to display these raw PostScript specials. \fB\-\-norawps0\fR +turns the call back on. +.IP "\fB\-o\fR \fIname\fR" 4 +.IX Item "-o name" +Send output to the file \fIname\fR. A single occurrence of \fB\f(CB%d\fB\fR or +\&\fB\f(CB%01d\fB\fR, ..., \fB\f(CB%09d\fB\fR will be exchanged for the physical +page number (this can be changed, see the \fB\-\-dvinum\fR switch). The +default output filename is \fIfile\fR\fB\f(CB%d\fB.png\fR where the input \s-1DVI\s0 +file was \fIfile\fR\fB.dvi\fR. +.IP "\fB\-O\fR \fIx\-offset\fR\fB,\fR\fIy\-offset\fR" 4 +.IX Item "-O x-offset,y-offset" +Move the origin by \fIx\-offset\fR,\fIy\-offset\fR, a comma-separated +pair of dimensions such as \fB.1in,\-.3cm\fR. +The origin of the page is shifted from the default position +(of one inch down, one inch to the right from the upper left corner of +the paper) by this amount. +.IP "\fB\-p [=]\fR\fInum\fR" 4 +.IX Item "-p [=]num" +The first page printed will be the first one numbered \fInum\fR. Default +is the first page in the document. If \fInum\fR is prefixed by an +equals sign, then it (and the argument to the \fB\-l\fR option, if +specified) is treated as a physical (absolute) page number, rather than +a value to compare with the TeX \fB\ecount0\fR values stored in the +\&\s-1DVI\s0 file. Thus, using \fB\-p =3\fR will start with the third page of +the document, no matter what the pages are actually numbered. +.IP "\fB\-\-palette*\fR" 4 +.IX Item "--palette*" +When an external image is included, \fBdvipng\fR will automatically +switch to truecolor mode, to avoid unnecessary delay and quality +reduction, and enable the \s-1EPS\s0 translator to draw on a transparent +background and outside of the boundingbox. This switch will force +palette (256\-color) output and make \fBdvipng\fR revert to opaque +clipped image inclusion. This will also override the \fB\-\-truecolor\fR +switch if present. +.IP "\fB\-\-picky*\fR" 4 +.IX Item "--picky*" +No images are output when a warning occurs. Normally, dvipng will +output an image in spite of a warning, but there may be something +missing in this image. One reason to use this option would be if you +have a more complete but slower fallback converter. Mainly, this is +useful for failed figure inclusion and unknown \especial occurrences, +but warnings will also occur for missing or unknown color specs and +missing \s-1PK\s0 fonts. +.IP "\fB\-\-png*\fR" 4 +.IX Item "--png*" +The images are output in the \s-1PNG\s0 format. This is the default for the +\&\fBdvipng\fR binary. See also the \fB\-\-gif\fR option. +.IP "\fB\-pp\fR \fIfirstpage\fR\fB\-\fR\fIlastpage\fR" 4 +.IX Item "-pp firstpage-lastpage" +Print pages \fIfirstpage\fR through \fIlastpage\fR; but not quite +equivalent to \fB\-p\fR \fIfirstpage\fR \fB\-l\fR \fIlastpage\fR. For example, +when rendering a book, there may be several instances of a page in the +\&\s-1DVI\s0 file (one in \f(CW\*(C`\efrontmatter\*(C'\fR, one in \f(CW\*(C`\emainmatter\*(C'\fR, and one +in \f(CW\*(C`\ebackmatter\*(C'\fR). In case of several pages matching, \fB\-pp\fR +\&\fIfirstpage\fR\fB\-\fR\fIlastpage\fR will render \fIall\fR pages that +matches the specified range, while \fB\-p\fR \fIfirstpage\fR \fB\-l\fR +\&\fIlastpage\fR will render the pages from the \fIfirst\fR occurrence +of \fIfirstpage\fR to the \fIfirst\fR occurrence of \fIlastpage\fR. +This is the (undocumented) behaviour of dvips. In dvipng you can give +both kinds of options, in which case you get all pages that matches the +range in \fB\-pp\fR between the pages from \fB\-p\fR to \fB\-l\fR. Also +multiple \fB\-pp\fR options accumulate, unlike \fB\-p\fR and \fB\-l\fR. +The \fB\-\fR separator can also be \fB:\fR. Note that \fB\-pp \-1\fR +will be interpreted as \*(L"all pages up to and including 1\*(R", if you want a +page numbered \-1 (only the table of contents, say) put \fB\-pp \-1\-\-1\fR, +or more readable, \fB\-pp \-1:\-1\fR. +.IP "\fB\-q*\fR" 4 +.IX Item "-q*" +Run quietly. Don't chatter about pages converted, etc. to standard +output; report no warnings (only errors) to standard error. +.IP "\fB\-Q\fR \fInum\fR" 4 +.IX Item "-Q num" +Set the quality to \fInum\fR. That is, choose the number of antialiasing +levels for bitmapped fonts (\s-1PK\s0), to be +\&\fInum\fR*\fInum\fR+1. The default value is 4 which gives 17 levels of +antialiasing for antialiased fonts from these two. If FreeType is +available, its rendering is unaffected by this option. +.IP "\fB\-r*\fR" 4 +.IX Item "-r*" +Toggle output of pages in reverse/forward order. By default, the first +page in the \s-1DVI\s0 is output first. +.IP "\fB\-\-strict*\fR" 4 +.IX Item "--strict*" +The program exits when a warning occurs. Normally, dvipng will output +an image in spite of a warning, but there may be something missing in +this image. One reason to use this option would be if you have a more +complete but slower fallback converter. See the \fB\-\-picky\fR option +above for a list of when warnings occur. +.IP "\fB\-T\fR \fIimage_size\fR" 4 +.IX Item "-T image_size" +Set the image size to \fIimage_size\fR which can be either of +\&\fBbbox\fR, \fBtight\fR, or a comma-separated pair of dimensions +\&\fIhsize\fR,\fIvsize\fR such as \fB.1in,.3cm\fR. The default is +\&\fBbbox\fR which produces a \s-1PNG\s0 that includes all ink put on the page +and in addition the \s-1DVI\s0 origin, located 1in from the top and 1in from +the left edge of the paper. This usually gives whitespace above and to +the left in the produced image. The value \fBtight\fR will make dvipng +only include all ink put on the page, producing neat images. +.IP "\fB\-\-truecolor*\fR" 4 +.IX Item "--truecolor*" +This will make \fBdvipng\fR generate truecolor output. Note that +truecolor output is automatic if you include an external image in your +\&\s-1DVI,\s0 e.g., via a PostScript special (i.e., the \fBgraphics\fR or +\&\fBgraphicx\fR package). This switch is overridden by the +\&\fB\-\-palette\fR switch. +.IP "\fB\-v*\fR" 4 +.IX Item "-v*" +Enable verbose operation. This will currently indicate what fonts is +used, in addition to the usual output. +.IP "\fB\-\-width*\fR" 4 +.IX Item "--width*" +Report the width of the image. See also \fB\-\-height\fR and +\&\fB\-\-depth\fR. +.IP "\fB\-x\fR \fInum\fR" 4 +.IX Item "-x num" +This option is deprecated; it should not be used. It is much better to +select the output resolution directly with the \fB\-D\fR option. This +option sets the magnification ratio to \fInum\fR/1000 and +overrides the magnification specified in the \s-1DVI\s0 file. Must be between +10 and 100000. It is recommended that you use standard magstep values +(1095, 1200, 1440, 1728, 2074, 2488, 2986, and so on) to help reduce the +total number of \s-1PK\s0 files generated. \fInum\fR may be a real number, not +an integer, for increased precision. +.IP "\fB\-z\fR \fInum\fR" 4 +.IX Item "-z num" +Set the \s-1PNG\s0 compression level to \fInum\fR. This option is enabled if +your \fBlibgd\fR is new enough. The default compression level is 1, +which selects maximum speed at the price of slightly larger PNGs. For an +older \fBlibgd\fR, the hard-soldered value 5 is used. The include file +\&\fBpng.h\fR says +\&\*(L"Currently, valid values range from 0 \- 9, corresponding directly to +the zlib compression levels 0 \- 9 (0 \- no compression, 9 \- \*(R"maximal\*(L" +compression). Note that tests have shown that zlib compression levels +3\-6 usually perform as well as level 9 for \s-1PNG\s0 images, and do +considerably fewer calculations. In the future, these values may not +correspond directly to the zlib compression levels.\*(R" +.SH "NOTES" +.IX Header "NOTES" +The full manual is accessible in info format, on most systems by typing +.PP +.Vb 1 +\& info dvipng +.Ve +.SH "COPYRIGHT" +.IX Header "COPYRIGHT" +This program is released under the \s-1GNU\s0 Lesser General Public License +version 3, see the \s-1COPYING\s0 file in the dvipng distribution or +<\fBhttp://www.gnu.org/licenses/gpl.html\fR>. +.PP +Copyright (c) 2002\-2015, 2019 Jan-AAke Larsson diff --git a/Build/source/texk/dvipng/dvipng-src/dvipng.c b/Build/source/texk/dvipng/dvipng-src/dvipng.c new file mode 100644 index 00000000000..c71d1a26695 --- /dev/null +++ b/Build/source/texk/dvipng/dvipng-src/dvipng.c @@ -0,0 +1,156 @@ +/* dvipng.c */ + +/************************************************************************ + + Part of the dvipng distribution + + This program is free software: you can redistribute it and/or modify + it under the terms of the GNU Lesser General Public License as + published by the Free Software Foundation, either version 3 of the + License, or (at your option) any later version. + + This program is distributed in the hope that it will be useful, but + WITHOUT ANY WARRANTY; without even the implied warranty of + MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU + Lesser General Public License for more details. + + You should have received a copy of the GNU Lesser General Public + License along with this program. If not, see + <http://www.gnu.org/licenses/>. + + Copyright (C) 2002-2015,2019 Jan-Åke Larsson + +************************************************************************/ + +/* This program translates TeX's DVI-Code into Portable Network Graphics. */ + +#define MAIN +#include "dvipng.h" + +#ifdef MIKTEX +# define main __cdecl Main +#endif /* MIKTEX */ +/**********************************************************************/ +/******************************* main *******************************/ +/**********************************************************************/ +int main(int argc, char ** argv) +{ + bool parsestdin; + +#ifdef TIMING +# ifdef HAVE_GETTIMEOFDAY + gettimeofday(&Tp, NULL); + timer = Tp.tv_sec + Tp.tv_usec / 1000000.0; +# else +# ifdef HAVE_FTIME + ftime(&timebuffer); + timer = timebuffer.time + timebuffer.millitm / 1000.0; +# endif +# endif +#endif + /* setbuf(stderr, NULL); */ + +#ifdef HAVE_LIBKPATHSEA + /* Use extra paths as used by dvips */ + kpse_set_program_name(argv[0],"dvips"); + /* If dvipng is not installed in the texmf tree, and _only_ + * SELFAUTO... is used in texmf.cnf, kpathsea will not find a) + * Virtual fonts b) ps2pk.map or psfonts.map c) PostScript fonts + * + * We adjust these things here + */ + /* char selfautodir[MAXPATHLEN]; + FILE *self; + self = popen("kpsewhich -expand-var='$SELFAUTODIR'", "r"); + if (!self) + ... + if (!fgets(selfautodir, MAXPATHLEN, self)) + ... + fclose(self); */ +# ifdef ENV_SELFAUTOLOC + putenv(ENV_SELFAUTOLOC); +# endif +# ifdef ENV_SELFAUTODIR + putenv(ENV_SELFAUTODIR); +# endif +# ifdef ENV_SELFAUTOPARENT + putenv(ENV_SELFAUTOPARENT); +# endif + kpse_set_program_enabled (kpse_pk_format, makeTexPK, kpse_src_compile); +#endif + +#ifdef HAVE_TEXLIVE_GS_INIT + texlive_gs_init(); +#endif + + initcolor(); + parsestdin = DecodeArgs(argc, argv); + +#ifdef HAVE_LIBKPATHSEA + if (user_mfmode) + if (user_bdpi) + kpse_init_prog("DVIPNG", user_bdpi, user_mfmode, "cmr10"); + else { + Warning("--mfmode given without --bdpi"); + /* this will give a lot of warnings but... */ + kpse_init_prog("DVIPNG", 300, user_mfmode, "cmr10"); + } + else + kpse_init_prog("DVIPNG", 300, "cx", "cmr10"); +#endif + +#ifdef HAVE_FT2 + InitPSFontMap(); +#endif + + if (dvi!=NULL) DrawPages(); + + if (parsestdin) { + char line[STRSIZE]; + + printf("%s> ",dvi!=NULL?dvi->name:""); + while(fgets(line,STRSIZE,stdin)) { + DecodeString(line); + if (dvi!=NULL) { + DVIReOpen(dvi); + DrawPages(); + } + printf("%s> ",dvi!=NULL?dvi->name:""); + } + printf("\n"); + } + +#ifdef TIMING +# ifdef HAVE_GETTIMEOFDAY + gettimeofday(&Tp, NULL); + timer = Tp.tv_sec + Tp.tv_usec/1000000.0 - timer; +# else +# ifdef HAVE_FTIME + ftime(&timebuffer); + timer = timebuffer.time + timebuffer.millitm/1000.0 - timer; +# endif +# endif + + if (ndone > 0) + fprintf(stderr, + "Time of complete run: %.2f s, %d page(s), %.4f s/page.\n", + timer, ndone, timer / ndone); + if (my_toc >= 0.0001) + fprintf(stderr, + "Thereof in TIC/TOC region %.5f s.\n",my_toc); +#endif + + ClearFonts(); + DVIClose(dvi); + ClearColorNames(); +#ifdef HAVE_FT2 + ClearPSFontMap(); + ClearEncoding(); + ClearSubfont(); + if (libfreetype!=NULL && FT_Done_FreeType(libfreetype)) + Fatal("an error occured during freetype destruction"); + libfreetype = NULL; +#endif + + exit(exitcode); +} diff --git a/Build/source/texk/dvipng/dvipng-src/dvipng.h b/Build/source/texk/dvipng/dvipng-src/dvipng.h new file mode 100644 index 00000000000..9b5c5684730 --- /dev/null +++ b/Build/source/texk/dvipng/dvipng-src/dvipng.h @@ -0,0 +1,526 @@ +/* dvipng.h */ + +/************************************************************************ + + Part of the dvipng distribution + + This program is free software: you can redistribute it and/or modify + it under the terms of the GNU Lesser General Public License as + published by the Free Software Foundation, either version 3 of the + License, or (at your option) any later version. + + This program is distributed in the hope that it will be useful, but + WITHOUT ANY WARRANTY; without even the implied warranty of + MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU + Lesser General Public License for more details. + + You should have received a copy of the GNU Lesser General Public + License along with this program. If not, see + <http://www.gnu.org/licenses/>. + + Copyright (C) 2002-2015 Jan-Åke Larsson + +************************************************************************/ + +#ifndef DVIPNG_H +#define DVIPNG_H +#include "config.h" + +#define STRSIZE 255 /* stringsize for file specifications */ + +#define FIRSTFNTCHAR 0 +#define LASTFNTCHAR 255 +#define NFNTCHARS LASTFNTCHAR+1 + +#define STACK_SIZE 100 /* DVI-stack size */ + +#define DEFAULT_GAMMA 1.0 + +/* Name of the program which is called to generate missing pk files */ +#define MAKETEXPK "mktexpk" + +#ifdef HAVE_INTTYPES_H +# include <inttypes.h> +#else /* HAVE_INTTYPES_H */ +# ifndef __sgi +/* IRIX has the following types typedef'd in sys/types.h already, + * i.e., _old_ IRIX systems; newer ones have a working inttypes.h */ +typedef signed char int8_t; +typedef short int16_t; +typedef int int32_t; +#endif /* ! __sgi */ +typedef unsigned char uint8_t; +typedef unsigned short uint16_t; +typedef unsigned int uint32_t; +typedef long long int64_t; +typedef unsigned long long uint64_t; +#endif /* HAVE_INTTYPES_H */ + +#ifndef INT32_MIN +#define INT32_MIN (-2147483647-1) +#endif +#ifndef INT32_MAX +#define INT32_MAX (2147483647) +#endif + +#include <gd.h> + +#ifdef HAVE_KPATHSEA_KPATHSEA_H +# include <kpathsea/kpathsea.h> +#else +# error: kpathsea/kpathsea.h is missing from your system +#endif + +#ifdef HAVE_FT2 +#include <ft2build.h> +#include FT_FREETYPE_H +#endif + +#ifdef HAVE_STDBOOL_H +# include <stdbool.h> +#else +# ifdef HAVE_KPATHSEA_KPATHSEA_H +/* boolean is an enum type from kpathsea/types.h loaded in + kpathsea/kpathsea.h, use it as fallback */ +# define bool boolean +# else +typedef int bool; +# define true (bool) 1 +# define false (bool) 0 +# endif +#endif + +#ifndef HAVE_VPRINTF +# ifdef HAVE_DOPRNT +# define vfprintf(stream, message, args) _doprnt(message, args, stream) +# else +# error: vfprintf AND _doprnt are missing!!! + /* If we have neither, should fall back to fprintf with fixed args. */ +# endif +#endif + +/*************************************************************/ +/************************* protos.h ************************/ +/*************************************************************/ + +typedef int pixels; +typedef int32_t subpixels; +typedef int32_t dviunits; + +#define MM_TO_PXL(x) (int)(((x)*resolution*10)/254) +#define PT_TO_PXL(x) (int)((int32_t)((x)*resolution*100l)/7224) +#define PT_TO_DVI(x) (int32_t)((x)*65536l) + +/*#define PIXROUND(x,c) ((((double)x+(double)(c>>1))/(double)c)+0.5)*/ +/*#define PIXROUND(x,c) (((x)+c)/(c))*/ +/*#define PIXROUND(x,c) ((x+c-1)/(c))*/ +/*#define PIXROUND(x,c) ((x)/(c))*/ +/* integer round to the nearest number, not towards zero */ +#define PIXROUND(num,den) ((num)>0 ? ((num)+(den)/2)/(den) : -(((den)/2-(num))/(den))) + + +/********************************************************/ +/*********************** dvi.h ************************/ +/********************************************************/ + +#define DVI_TYPE 0 +struct dvi_data { /* dvi entry */ + int type; /* This is a DVI */ + struct dvi_data *next; + uint32_t num, den, mag; /* PRE command parameters */ + int32_t conv; /* computed from num and den */ + /* divide dvi units (sp) with conv to get mf device resolution */ + /* divide further with shrinkfactor to get true resolution */ + char * name; /* full name of DVI file */ + char * outname; /* output filename (basename) */ + FILE * filep; /* file pointer */ + time_t mtime; /* modification time */ + struct font_num *fontnump; /* DVI font numbering */ + struct page_list *pagelistp; /* DVI page list */ +#define DVI_PREVIEW_LATEX_TIGHTPAGE 1 +#define DVI_PREVIEW_BOP_HOOK (1<<1) + uint32_t flags; /* Preview-latex flags */ +}; + +#define PAGE_POST INT32_MAX +#define PAGE_LASTPAGE INT32_MAX-1 +#define PAGE_MAXPAGE INT32_MAX-2 /* assume no pages out of this range */ +#define PAGE_FIRSTPAGE INT32_MIN +#define PAGE_MINPAGE INT32_MIN+1 /* assume no pages out of this range */ + +struct dvi_color { + int red,green,blue; +}; + +struct page_list { + struct page_list* next; + int offset; /* file offset to BOP */ + int32_t count[11]; /* 10 dvi counters + absolute pagenum in file */ + int csp; /* color stack pointer at BOP */ + struct dvi_color cstack[2]; /* color stack at BOP, may be longer */ +}; + + + + +struct dvi_data* DVIOpen(char*,char*); +void DVIClose(struct dvi_data*); +bool DVIReOpen(struct dvi_data*); +struct page_list*FindPage(struct dvi_data*, int32_t, bool); +struct page_list*NextPage(struct dvi_data*, struct page_list*); +struct page_list*PrevPage(struct dvi_data*, struct page_list*); +int SeekPage(struct dvi_data*, struct page_list*); +bool DVIFollowToggle(void); +unsigned char* DVIGetCommand(struct dvi_data*); +bool DVIIsNextPSSpecial(struct dvi_data*); +uint32_t CommandLength(unsigned char*); +void ClearPSHeaders(void); + +/********************************************************/ +/********************** misc.h ************************/ +/********************************************************/ + +struct filemmap { +#ifdef WIN32 + HANDLE hFile; + HANDLE hMap; +#else /* WIN32 */ + int fd; +#endif /* WIN32 */ + char* data; + size_t size; +}; + +bool DecodeArgs(int, char *[]); +void DecodeString(char *); +bool MmapFile (char *filename,struct filemmap *fmmap); +void UnMmapFile(struct filemmap* fmmap); + +void Message(int, const char *fmt, ...); +void Warning(const char *fmt, ...); +void Fatal(const char *fmt, ...); + +int32_t SNumRead(unsigned char*, register int); +uint32_t UNumRead(unsigned char*, register int); + +bool MmapFile (char *filename,struct filemmap *fmmap); +void UnMmapFile(struct filemmap* fmmap); + + +/********************************************************/ +/*********************** font.h ***********************/ +/********************************************************/ +struct encoding { + struct encoding* next; + char* name; + char* charname[257]; +}; + +struct subfont { + struct subfont* next; + char* name; + char* infix; + int encoding; + int32_t charindex[256]; +}; + +#ifdef HAVE_FT2 +struct psfontmap { + struct psfontmap *next; + char *line,*psfile,*tfmname,*encname,*end; + struct encoding* encoding; + FT_Matrix* ft_transformp; + FT_Matrix ft_transform; + struct subfont* subfont; +}; +#endif + +#define FONT_TYPE_PK 1 +#define FONT_TYPE_VF 2 +#define FONT_TYPE_FT 3 +struct char_entry { /* PK/FT Glyph/VF Macro */ + dviunits tfmw; /* TFM width */ + unsigned char *data; /* glyph data, either pixel data + * (0=transp, 255=max ink) or VF macro */ + uint32_t length; /* Length of PK data or VF macro */ + /* Only used in pixel fonts */ + pixels w,h; /* width and height in pixels */ + subpixels xOffset, yOffset; /* x offset and y offset in subpixels */ + /* Only used in PK fonts */ + unsigned char *pkdata; /* Points to beginning of PK data */ + unsigned char flag_byte; /* PK flagbyte */ +}; + +struct font_entry { /* font entry */ + int type; /* PK/VF/Type1 ... */ + struct font_entry *next; + uint32_t c, s, d; + uint8_t a, l; + char n[STRSIZE]; /* FNT_DEF command parameters */ + int dpi; /* computed from s and d */ + char * name; /* full name of PK/VF file */ + struct filemmap fmmap; /* file memory map */ + uint32_t magnification; /* magnification read from font file */ + uint32_t designsize; /* design size read from font file */ + void * chr[NFNTCHARS]; /* character information */ +#ifdef HAVE_FT2 + FT_Face face; /* Freetype2 face */ + struct psfontmap* psfontmap; /* Font transformation */ +#endif + struct font_num *vffontnump; /* VF local font numbering */ + int32_t defaultfont; /* VF default font number */ +}; + +struct font_num { /* Font number. Different for VF/DVI, and several + font_num can point to one font_entry */ + struct font_num *next; + int32_t k; + struct font_entry *fontp; +}; + +void CheckChecksum(uint32_t, uint32_t, const char*); +void InitPK (struct font_entry *newfontp); +void DonePK(struct font_entry *oldfontp); +void InitVF (struct font_entry *newfontp); +void DoneVF(struct font_entry *oldfontp); + +void FontDef(unsigned char*, void* /* dvi/vf */); +void ClearFonts(void); +void SetFntNum(int32_t, void* /* dvi/vf */); +void FreeFontNumP(struct font_num *hfontnump); + +#ifdef HAVE_FT2 +char* copyword(char* orig); +struct psfontmap *NewPSFont(struct psfontmap* copyfrom); +void InitPSFontMap(void); +void ClearPSFontMap(void); +struct psfontmap* FindPSFontMap(char*); +struct encoding* FindEncoding(char*); +void ClearEncoding(void); +bool ReadTFM(struct font_entry *, char*); +bool InitFT(struct font_entry *); +void DoneFT(struct font_entry *tfontp); +void LoadFT(int32_t, struct char_entry *); +struct psfontmap* FindSubFont(struct psfontmap* entry, char* fontname); +void ClearSubfont(void); +#endif + +/********************************************************/ +/********************* ppagelist.h ********************/ +/********************************************************/ + +bool ParsePages(const char*); +void FirstPage(int32_t,bool); +void LastPage(int32_t,bool); +void ClearPpList(void); +void Reverse(bool); +struct page_list* NextPPage(void* /* dvi */, struct page_list*); + + + + +#ifdef MAIN +#define EXTERN +#define INIT(x) =x +#else +#define EXTERN extern +#define INIT(x) +#endif + +/********************************************************/ +/********************** draw.h ************************/ +/********************************************************/ +#include "commands.h" + +void CreateImage(pixels width, pixels height); +void DestroyImage(void); +void DrawCommand(unsigned char*, void* /* dvi/vf */); +void DrawPages(void); +void WriteImage(char*, int); +void LoadPK(int32_t, register struct char_entry *); +int32_t SetChar(int32_t); +dviunits SetGlyph(struct char_entry *ptr, int32_t hh,int32_t vv); +void Gamma(double gamma); +int32_t SetVF(struct char_entry *ptr); +int32_t SetRule(int32_t, int32_t, int32_t, int32_t); +void SetSpecial(char *, char *, int32_t, int32_t); +void BeginVFMacro(struct font_entry*); +void EndVFMacro(void); + +/**************************************************/ +void handlepapersize(const char*,int32_t*,int32_t*); + +void stringrgb(const char* colorstring,int *r,int *g,int *b); +void background(const char *); +void initcolor(void); +void popcolor(void); +void pushcolor(const char *); +void resetcolorstack(const char *); +void StoreColorStack(struct page_list *tpagep); +void ReadColorStack(struct page_list *tpagep); +void StoreBackgroundColor(struct page_list *tpagep); +void ClearColorNames(void); +void InitXColorPrologue(const char* prologuename); + +/**********************************************************************/ +/************************* Global Variables *************************/ +/**********************************************************************/ + +#ifdef MAKETEXPK +#ifdef HAVE_LIBKPATHSEA +EXTERN bool makeTexPK INIT(MAKE_TEX_PK_BY_DEFAULT); +#else +EXTERN bool makeTexPK INIT(_TRUE); +#endif +#endif + +EXTERN uint32_t usermag INIT(0); /* user specified magstep */ +EXTERN struct font_entry *hfontptr INIT(NULL); /* font list pointer */ + +EXTERN struct internal_state { + struct font_entry* currentfont; +} current_state; + +#define BE_NONQUIET 1 +#define BE_VERBOSE (1<<1) +#define PARSE_STDIN (1<<2) +#define EXPAND_BBOX (1<<3) +#define TIGHT_BBOX (1<<4) +#define FORCE_TRUECOLOR (1<<5) +#define USE_FREETYPE (1<<6) +#define REPORT_HEIGHT (1<<7) +#define REPORT_DEPTH (1<<8) +#define REPORT_WIDTH (1<<9) +#define DVI_PAGENUM (1<<10) +#define MODE_PICKY (1<<11) +#define GIF_OUTPUT (1<<12) +#define MODE_STRICT (1<<13) +#define NO_GHOSTSCRIPT (1<<14) +#define NO_GSSAFER (1<<15) +#define BG_TRANSPARENT (1<<16) +#define BG_TRANSPARENT_ALPHA (1<<17) +#define FORCE_PALETTE (1<<18) +#define NO_RAW_PS (1<<19) +EXTERN uint32_t option_flags INIT(BE_NONQUIET | USE_FREETYPE); + +#define PAGE_GAVE_WARN 1 +#define PAGE_PREVIEW_BOP (1<<1) +#define PAGE_TRUECOLOR (1<<2) +EXTERN uint32_t page_flags INIT(0); + + +#ifdef DEBUG +EXTERN unsigned int debug INIT(0); +#define DEBUG_PRINT(a,b) if (debug & a) { printf b; fflush(stdout); } +#define DEBUG_DVI 1 +#define DEBUG_VF (1<<1) +#define DEBUG_PK (1<<2) +#define DEBUG_TFM (1<<3) +#define DEBUG_GLYPH (1<<4) +#define DEBUG_FT (1<<5) +#define DEBUG_ENC (1<<6) +#define DEBUG_COLOR (1<<7) +#define DEBUG_GS (1<<8) +#define LASTDEBUG DEBUG_GS +#define DEBUG_DEFAULT DEBUG_DVI +#else +#define DEBUG_PRINT(a,b) +#endif + +/************************timing stuff*********************/ +#ifdef TIMING +# ifdef TIME_WITH_SYS_TIME +# include <sys/time.h> +# include <time.h> +# else +# ifdef HAVE_SYS_TIME_H +# include <sys/time.h> +# else +# include <time.h> +# endif +# endif +EXTERN double timer INIT(0); +EXTERN double my_tic,my_toc INIT(0); +EXTERN int ndone INIT(0); /* number of pages converted */ +# ifdef HAVE_GETTIMEOFDAY +EXTERN struct timeval Tp; +# define TIC { gettimeofday(&Tp, NULL); \ + my_tic= Tp.tv_sec + Tp.tv_usec/1000000.0;} +# define TOC { gettimeofday(&Tp, NULL); \ + my_toc += Tp.tv_sec + Tp.tv_usec/1000000.0 - my_tic;} +# else +# ifdef HAVE_FTIME +EXTERN struct timeb timebuffer; +# define TIC() { ftime(&timebuffer); \ + my_tic= timebuffer.time + timebuffer.millitm/1000.0; +# define TOC() { ftime(&timebuffer); \ + my_toc += timebuffer.time + timebuffer.millitm/1000.0 - my_tic;} +# else +# define TIC() +# define TOC() +# endif +# endif +#endif /* TIMING */ + +EXTERN char* user_mfmode INIT(NULL); +EXTERN int user_bdpi INIT(0); +EXTERN int dpi INIT(100); + +#ifdef HAVE_GDIMAGEPNGEX +EXTERN int compression INIT(1); +#endif +#undef min +#undef max +# define max(x,y) if ((y)>(x)) x = y +# define min(x,y) if ((y)<(x)) x = y + +/* These are in pixels*/ +EXTERN int x_min INIT(0); +EXTERN int y_min INIT(0); +EXTERN int x_max INIT(0); +EXTERN int y_max INIT(0); + +/* Page size: default set by -T */ +EXTERN int x_width_def INIT(0); +EXTERN int y_width_def INIT(0); + +/* Offset: default set by -O and -T bbox */ +EXTERN int x_offset_def INIT(0); +EXTERN int y_offset_def INIT(0); + +/* Preview-latex's tightpage */ +EXTERN int x_width_tightpage INIT(0); +EXTERN int y_width_tightpage INIT(0); +EXTERN int x_offset_tightpage INIT(0); +EXTERN int y_offset_tightpage INIT(0); + +/* Paper size: set by -t, for cropmark purposes only */ +/* This has yet to be written */ +EXTERN int x_pwidth INIT(0); +EXTERN int y_pwidth INIT(0); + +/* The transparent border preview-latex desires */ +EXTERN int borderwidth INIT(0); + +/* fallback color for transparent background */ +EXTERN bool userbordercolor INIT(FALSE); /* if true, use user-supplied color */ +EXTERN struct dvi_color bordercolor; + + +EXTERN gdImagePtr page_imagep INIT(NULL); +EXTERN int32_t shrinkfactor INIT(4); + +EXTERN struct dvi_color cstack[STACK_SIZE]; +EXTERN int csp INIT(1); + +EXTERN struct font_entry* currentfont; +EXTERN struct dvi_data* dvi INIT(NULL); + +#ifdef HAVE_FT2 +EXTERN FT_Library libfreetype INIT(NULL); +#endif + +#define EXIT_FATAL EXIT_FAILURE+1 +EXTERN int exitcode INIT(EXIT_SUCCESS); + +#endif /* DVIPNG_H */ diff --git a/Build/source/texk/dvipng/dvipng-src/dvipng.texi b/Build/source/texk/dvipng/dvipng-src/dvipng.texi new file mode 100644 index 00000000000..2b8e157bdc2 --- /dev/null +++ b/Build/source/texk/dvipng/dvipng-src/dvipng.texi @@ -0,0 +1,984 @@ +\input texinfo +@setfilename dvipng.info +@settitle A DVI-to-PNG translator +@ifset man +@c man begin SYNOPSIS +dvipng [options] filename + +dvipng [options] [filename] - +@c man end +@end ifset + +@set version 1.17 +@set month-year January 2020 + +@c Put everything in one index (arbitrarily chosen to be the concept index). +@syncodeindex fn cp +@syncodeindex ky cp +@syncodeindex pg cp +@syncodeindex vr cp + +@include macros.texi +@iftex +@tolerance 10000 @emergencystretch 3em +@end iftex + +@dircategory TeX +@direntry +* DVI-to-PNG: (dvipng). Translating TeX DVI files to Portable Network Graphics (PNG). +* dvipng: (dvipng). A DVI-to-PNG translator. +@end direntry + +@finalout +@titlepage +@title dvipng +@subtitle A DVI-to-PNG Translator +@subtitle Version @value{version} + + +@author by Jan-@AA{}ke Larsson. +@page +@vskip 0pt plus 1filll +Copyright @copyright{} 2002-2020 Jan-@AA{}ke Larsson + +Permission is granted to make and distribute verbatim copies of +this manual provided the copyright notice and this permission notice +are preserved on all copies. + +@ignore +Permission is granted to process this file through TeX and print the +results, provided the printed document carries copying permission +notice identical to this one except for the removal of this paragraph +(this paragraph not being relevant to the printed manual). +@end ignore + +Permission is granted to copy and distribute modified versions of this +manual under the conditions for verbatim copying, provided also that the +section entitled ``Copying'' is included exactly as in the original, and +provided that the entire resulting derived work is distributed under the +terms of a permission notice identical to this one. + +Permission is granted to copy and distribute translations of this manual +into another language, under the above conditions for modified versions, +except that this permission notice may be stated in a translation +approved by the Free Software Foundation. +@end titlepage +@page + +@c @summarycontents +@contents + +@ifnottex +@node Top +@top dvipng + +This manual documents dvipng, a program to translate a DVI (DeVice +Independent) file into PNG (Portable Network Graphics). + +This file documents dvipng version @value{version} + +Corrections or perhaps rewrites of sections are @emph{very welcome}. + +Jan-@AA{}ke Larsson + +@end ifnottex + +@menu +* Introduction:: Introduction +* Installation:: How to compile and install dvipng +* Basic usage:: First things first +* Command-line options:: Advanced usage +* Graphics:: Including PostScript and/or bitmaps +* Color:: Using color with dvipng +* Diagnosing problems:: Problems? +* Credits:: People who have contributed +* Copying:: GNU Lesser General Public License +* Index:: General index +@end menu + + + +@node Introduction +@chapter Introduction + +@c man begin DESCRIPTION +@include readme.texi +@c man end + +@node Installation +@chapter Installation + +@cindex configuration, of dvipng +@cindex compilation +@cindex installation, of dvipng + +@include install.texi + +@node Basic usage +@chapter Basic usage of dvipng + +@cindex invoking dvipng + +To use dvipng at its simplest, simply type + +@example +dvipng foo +@end example + +@noindent +where @file{foo.dvi} is the output of @TeX{} that you want to convert to +PNG format. If there are four pages in @file{foo.dvi}, those pages will +be output as @file{foo1.png}, @file{foo2.png}, @file{foo3.png}, and +@file{foo4.png}, respectively. + +If you have enabled the PostScript font support (via FreeType), +fonts will be rendered as they are needed. Otherwise, dvipng will use +bitmapped (PK) fonts, and if you use PK fonts that have not been used on +your system before, they may be automatically generated; this process +can take a few minutes, so progress reports appear by default. The next +time the same font is used, it will have been saved on disk, so +rendering will go much faster. (If dvipng tries to endlessly generate +the same fonts over and over again, something is wrong. @xref{Unable to +generate fonts,,, kpathsea, Kpathsea}.) + +Many options are available (see the next section). For a brief summary +of available options, just type + +@example +dvipng --help +@end example + +@node Command-line options +@chapter Command-line options + +@cindex command-line options +@cindex options, dvipng + +dvipng has a plethora of command line options. Reading through this +section will give a good idea of the capabilities of the driver. + +@menu +* Option summary:: Quick listing, from dvipng --help. +* Option details:: More information about each option. +@end menu + + +@node Option summary +@section Option summary + +@cindex options, summary +Here is a handy summary of the options; it is printed out when you run +dvipng with no arguments or with the standard @samp{--help} option. + +@example +@include dvipng.help +@end example + + +@node Option details +@section Option details + +@cindex option, details of +@c man begin OPTIONS + +Many of the parameterless options listed here can be turned off by +suffixing the option with a zero (@samp{0}); for instance, to turn off +page reversal, use @samp{-r0}. Such options are marked with a trailing +@samp{*}. + +@table @samp +@item - +@cindex options, reading from standard input +@cindex standard input, reading options from +Read additional options from standard input after processing the command +line. + +@item --help +Print a usage message and exit. + +@item --version +Print the version number and exit. + +@item -bd @var{num} +@item -bd @var{color_spec} +@item -bd '@var{num} @var{color_spec}' +@cindex transparent border width +@cindex transparent border fallback color +Set the pixel width of the transparent border (default 0). Using this +option will make the image edges transparent, but it only affects pixels +with the background color. Giving a @var{color_spec} will set the +fallback color, to be used in viewers that cannot handle transparency +(the default is the background color). The color spec should be in +@TeX{} color \special syntax, e.g., 'rgb 1.0 0.0 0.0'. Setting the +fallback color makes the default border width 1 px. @xref{Color}. + +@item --bdpi @var{num} +@cindex base resolution, setting +This option only has an effect when using bitmapped (PK) fonts. The +option sets the base (Metafont) resolution, both horizontal and +vertical, to @var{num} dpi (dots per inch). This option is necessary +when manually selecting Metafont mode with the --mode option (see +below). + +@item -bg @var{color_spec} +@cindex background color (option) +Choose background color for the images. This option will be ignored if +there is a background color \special in the DVI. The color spec should +be in @TeX{} color \special syntax, e.g., 'rgb 1.0 0.0 0.0'. You can +also specify 'Transparent' or 'transparent' which will give you a +transparent background with the normal background as a fallback color. A +capitalized 'Transparent' will give a full-alpha transparency, while an +all-lowercase 'transparent' will give a simple fully transparent +background with non-transparent antialiased pixels. The latter would be +suitable for viewers who cannot cope with a true alpha channel. GIF +images do not support full alpha transparency, so in case of GIF output, +both variants will use the latter behaviour. @xref{Color}. + +@item -d @var{num} +@cindex debugging +Set the debug flags, showing what dvipng (thinks it) is doing. This will +work unless dvipng has been compiled without the @code{DEBUG} option +(not recommended). Set the flags as you need them, use @samp{-d -1} as +the first option for maximum output. @xref{Debug options}. + +@item -D @var{num} +@cindex output resolution, setting +Set the output resolution, both horizontal and vertical, to @var{num} +dpi (dots per inch). + +One may want to adjust this to fit a certain text font size (e.g., on +a web page), and for a text font height of @var{font_px} pixels (in +Mozilla) the correct formula is +@example +@var{dpi} = @var{font_px} * 72.27 / 10 [px * @TeX{}pt/in / @TeX{}pt] +@end example +The last division by ten is due to the standard font height 10pt in +your document, if you use 12pt, divide by 12. Unfortunately, some +proprietary browsers have font height in pt (points), not pixels. You +have to rescale that to pixels, using the screen resolution (default +is usually 96 dpi) which means the formula is +@example +@var{font_px} = @var{font_pt} * 96 / 72 [pt * px/in / (pt/in)] +@end example +On some high-res screens, the value is instead 120 dpi. Good luck! + +@item --depth* +@cindex baseline reporting +@cindex depth reporting +Report the depth of the image. This only works reliably when the +@LaTeX{} style @file{preview.sty} from @previewlatex{} is used with +the @samp{active} option. It reports the number of pixels from the +bottom of the image to the baseline of the image. This can be used for +vertical positioning of the image in, e.g., web documents, where one +would use (Cascading StyleSheets 1) +@example +<IMG SRC="@var{filename.png}" STYLE="vertical-align: -@var{depth}px"> +@end example +The depth is a negative offset in this case, so the minus sign is +necessary, and the unit is pixels (px). + +@item --dvinum* +Set this option to make the output page number be the @TeX{} page +numbers rather than the physical page number. See the @samp{-o} switch. + +@ignore +@item -e @var{num} +@cindex maxdrift +@cindex accuracy in positioning +@cindex positioning accuracy +Maximum drift in pixels of each character from its `true' +resolution-independent position on the page. The default value of this +parameter is resolution dependent (it is the number of entries in the +list [100, 200, 300, 400, 500, 600, 800, 1000, 1200, 1600, 2000, 2400, +2800, 3200, @dots{}] that are less than or equal to the resolution in +dots per inch). Allowing individual characters to `drift' from their +correctly rounded positions by a few pixels, while regaining the true +position at the beginning of each new word, improves the spacing of +letters in words. + +@item -f* +@cindex filter, running as a +@cindex standard I/O +@cindex pipes, not readable +@vindex PRINTER@r{, avoided with @samp{-f}} +Run as a filter. Read the DVI file from standard input and write the +PostScript to standard output. The standard input must be seekable, so +it cannot be a pipe. If your input must be a pipe, write a shell script +that copies the pipe output to a temporary file and then points dvipng at +this file. This option also disables the automatic reading of the +@code{PRINTER} environment variable; use @samp{-P$PRINTER} after the +@samp{-f} to read it anyway. It also turns off the automatic sending of +control-D if it was turned on with the @samp{-F} option or in the +configuration file; use @samp{-F} after the @samp{-f} to send it anyway. + +@item -k* +@cindex cropmarks +Print crop marks. This option increases the paper size (which should be +specified, either with a paper size special or with the @samp{-T} +option) by a half inch in each dimension. It translates each page by a +quarter inch and draws cross-style crop marks. It is mostly useful with +typesetters that can set the page size automatically. This works by +downloading @file{crop.pro}. +@end ignore + +@item -fg @var{color_spec} +@cindex foreground color (option) +Choose foreground color for the images. This option will be ignored if +there is a foreground color \special in the DVI. The color spec should +be in @TeX{} color \special syntax, e.g., 'rgb 1.0 0.0 0.0'. +@xref{Color}. + +@item --follow* +@cindex follow mode +Wait for data at end-of-file. One of the benefits of dvipng is that it +does not read the postamble, so it can be started before @TeX{} +finishes. This switch makes dvipng wait at end-of-file for further +output, unless it finds the POST marker that indicates the end of the +DVI. This is similar to @samp{tail -f} but for DVI-to-PNG conversion. + +@item --freetype* +@cindex FreeType font rendering +Enable/disable FreeType font rendering (default on). This option is +available if the FreeType2 font library was present at compilation time. +If this is the case, dvipng will have direct support for PostScript +Type1 and TrueType fonts internally, rather than using @samp{gsftopk} +for rendering the fonts. If you have PostScript versions of Computer +Modern installed, there will be no need to generate bitmapped (PK) +variants on disk of these. Then, you can render images at different (and +unusual) resolutions without cluttering the disk with lots of bitmapped +fonts. +One reason to disable FreeType font rendering would be to generate +identical output on different platforms, since FreeType uses the native +renderer and therefore can give slightly different output on each platform. + +@item --gamma @var{num} +@cindex gamma +@cindex dark fonts +@cindex light fonts +@cindex fuzzy images +Control the interpolation of colors in the greyscale anti-aliasing +color palette. Default value is 1.0. For 0 < @var{num} < 1, the +fonts will be lighter (more like the background), and for @var{num} > +1, the fonts will be darker (more like the foreground). + +@item --gif* +@cindex GIF image format +The images are output in the GIF format, if GIF support is enabled. +This is the default for the @samp{dvigif} binary, which only will be +available when GIF support is enabled. GIF images are palette images +(see the @samp{--palette} option) and does not support true alpha +channels (see the @samp{--bg} option). See also the @samp{--png} +option. + +@item --height* +@cindex baseline reporting +@cindex height reporting +Report the height of the image. This only works reliably when the +@LaTeX{} style @file{preview.sty} from @previewlatex{} is used with +the @samp{active} option. It reports the number of pixels from the top +of the image to the baseline of the image. The total height of the +image is obtained as the sum of the values reported from +@samp{--height} and @samp{--depth}. + +@item -l [=]@var{num} +@cindex last page printed +@cindex page, last printed +@cindex physical page number, and @samp{-l} +@cindex absolute page number, and @samp{-l} +The last page printed will be the first one numbered @var{num}. Default +is the last page in the document. If @var{num} is prefixed by an equals +sign, then it (and the argument to the @samp{-p} option, if specified) +is treated as a physical (absolute) page number, rather than a value to +compare with the @TeX{} @samp{\count0} values stored in the DVI file. +Thus, using @samp{-l =9} will end with the ninth page of the document, +no matter what the pages are actually numbered. + +@item --mode @var{mode} +@cindex mode name, specifying +@cindex Metafont mode, specifying +This option only has an effect when using bitmapped (PK) fonts. Use +@var{mode} as the Metafont device name for the PK fonts (both for path +searching and font generation). This needs to be augmented with the base +device resolution, given with the @samp{--bdpi} option. See the file +@url{ftp://ftp.tug.org/tex/modes.mf} for a list of resolutions and mode +names for most devices. @xref{Unable to generate fonts,,, kpathsea, +Kpathsea}. + +@item -M* +@cindex font generation, avoiding +@pindex mktexpk@r{, avoiding} +@c this description repeated in kpathsea.texi +This option only has an effect when using bitmapped (PK) fonts. It turns +off automatic PK font generation (@file{mktexpk}). +@ignore +@flindex missfont.log +If @code{mktexpk}, the invocation is appended to a file +@file{missfont.log} (by default) in the current directory. You can then +execute the log file to create the missing files after fixing the +problem. +@vindex TEXMFOUTPUT +@vindex MISSFONT_LOG +If the current directory is not writable and the environment variable or +configuration file value @samp{TEXMFOUTPUT} is set, its value is used. +Otherwise, nothing is written. The name @samp{missfont.log} is +overridden by the @samp{MISSFONT_LOG} environment variable or +configuration file value. +@end ignore + +@item --nogs* +@cindex GhostScript, turning off +This switch prohibits the internal call to GhostScript for displaying +PostScript specials. @samp{--nogs0} turns the call back on. + +@item --nogssafer* +@cindex GhostScript and -dSAFER +@cindex -dSAFER +Normally, if GhostScript is used to render PostScript specials, the +GhostScript interpreter is run with the option @samp{-dSAFER}. The +@samp{--nogssafer} option runs GhostScript without @samp{-dSAFER}. The +@samp{-dSAFER} option in Ghostscript disables PostScript operators such +as deletefile, to prevent possibly malicious PostScript programs from +having any effect. + +@item --norawps* +@cindex PostScript, turning off raw PostScript specials +Some packages generate raw PostScript specials, even non-rendering such +specials. This switch turns off the internal call to GhostScript +intended to display these raw PostScript specials. @samp{--norawps0} +turns the call back on. + +@item -o @var{name} +@cindex output, redirecting +@cindex standard output, output to +Send output to the file @var{name}. A single occurrence of @samp{%d} or +@samp{%01d}, @dots{}, @samp{%09d} will be exchanged for the physical +page number (this can be changed, see the @samp{--dvinum} switch). The +default output filename is @samp{@var{file}%d.png} where the input DVI +file was @samp{@var{file}.dvi}. + +@item -O @var{x-offset},@var{y-offset} +@cindex offset pages +Move the origin by @var{x-offset},@var{y-offset}, a comma-separated +pair of dimensions such as @samp{.1in,-.3cm}. +@c (@pxref{papersize special}). +The origin of the page is shifted from the default position +(of one inch down, one inch to the right from the upper left corner of +the paper) by this amount. + +@item -p [=]@var{num} +@cindex first page printed +@cindex page, first printed +@cindex physical page number, and @samp{-p} +@cindex absolute page number, and @samp{-p} +The first page printed will be the first one numbered @var{num}. Default +is the first page in the document. If @var{num} is prefixed by an +equals sign, then it (and the argument to the @samp{-l} option, if +specified) is treated as a physical (absolute) page number, rather than +a value to compare with the @TeX{} @samp{\count0} values stored in the +DVI file. Thus, using @samp{-p =3} will start with the third page of +the document, no matter what the pages are actually numbered. + +@item --palette* +@cindex forcing palette output +When an external image is included, @samp{dvipng} will automatically +switch to truecolor mode, to avoid unnecessary delay and quality +reduction, and enable the EPS translator to draw on a transparent +background and outside of the boundingbox. This switch will force +palette (256-color) output and make @samp{dvipng} revert to opaque +clipped image inclusion. This will also override the @samp{--truecolor} +switch if present. + +@item --picky* +@cindex no erroneous images +No images are output when a warning occurs. Normally, dvipng will +output an image in spite of a warning, but there may be something +missing in this image. One reason to use this option would be if you +have a more complete but slower fallback converter. Mainly, this is +useful for failed figure inclusion and unknown \special occurrences, +but warnings will also occur for missing or unknown color specs and +missing PK fonts. + +@item --png* +@cindex PNG image format +The images are output in the PNG format. This is the default for the +@samp{dvipng} binary. See also the @samp{--gif} option. + +@item -pp @var{firstpage}-@var{lastpage} +@cindex page range +Print pages @var{firstpage} through @var{lastpage}; but not quite +equivalent to @samp{-p @var{firstpage} -l @var{lastpage}}. For example, +when rendering a book, there may be several instances of a page in the +DVI file (one in @code{\frontmatter}, one in @code{\mainmatter}, and one +in @code{\backmatter}). In case of several pages matching, @samp{-pp +@var{firstpage}-@var{lastpage}} will render @emph{all} pages that +matches the specified range, while @samp{-p @var{firstpage} -l +@var{lastpage}} will render the pages from the @emph{first} occurrence +of @var{firstpage} to the @emph{first} occurrence of @var{lastpage}. +This is the (undocumented) behaviour of dvips. In dvipng you can give +both kinds of options, in which case you get all pages that matches the +range in @samp{-pp} between the pages from @samp{-p} to @samp{-l}. Also +multiple @samp{-pp} options accumulate, unlike @samp{-p} and @samp{-l}. +The @samp{-} separator can also be @samp{:}. Note that @samp{-pp -1} +will be interpreted as "all pages up to and including 1", if you want a +page numbered -1 (only the table of contents, say) put @samp{-pp -1--1}, +or more readable, @samp{-pp -1:-1}. + +@item -q* +@cindex quiet operation +@cindex silent operation +@cindex warnings, suppressing +Run quietly. Don't chatter about pages converted, etc.@: to standard +output; report no warnings (only errors) to standard error. + +@item -Q @var{num} +@cindex antialiasing levels@r{, number of} +@cindex quality +Set the quality to @var{num}. That is, choose the number of antialiasing +levels for bitmapped fonts (PK), to be +@var{num}*@var{num}+1. The default value is 4 which gives 17 levels of +antialiasing for antialiased fonts from these two. If FreeType is +available, its rendering is unaffected by this option. + +@item -r* +@cindex reverse pagination +Toggle output of pages in reverse/forward order. By default, the first +page in the DVI is output first. + +@ignore +@item -R +@cindex security +@cindex shell command execution, disabling +@cindex absolute filenames, disabling +@cindex pipes, disabling output to +Run securely. This disables shell command execution in @code{\special} +(via @samp{`}, @pxref{Dynamic creation of graphics}) and config files +(via the @samp{E} option, @pxref{Configuration file commands}), pipes as +output files, and opening of any absolute filenames. + +@item -t @var{papertype} +@cindex paper type +@cindex media +@cindex letter papertype +@cindex legal papertype +@cindex ledger papertype +@cindex a4 papertype +@cindex a3 papertype +@cindex landscape papertype +Set the paper type to @var{papertype}. +@c usually defined in one of the +@c configuration files, along with the appropriate PostScript code to +@c select it (@pxref{Config file paper sizes}). +You can also specify a @var{papertype} of @samp{landscape}, which +rotates a document by 90 degrees. To rotate a document whose paper type +is not the default, you can use the @samp{-t} option twice, once for the +paper type, and once for @samp{landscape}. +@end ignore + +@item --strict* +@cindex exit on erroneous images +The program exits when a warning occurs. Normally, dvipng will output +an image in spite of a warning, but there may be something missing in +this image. One reason to use this option would be if you have a more +complete but slower fallback converter. See the @samp{--picky} option +above for a list of when warnings occur. + +@item -T @var{image_size} +Set the image size to @var{image_size} which can be either of +@samp{bbox}, @samp{tight}, or a comma-separated pair of dimensions +@var{hsize},@var{vsize} such as @samp{.1in,.3cm}. The default is +@samp{bbox} which produces a PNG that includes all ink put on the page +and in addition the DVI origin, located 1in from the top and 1in from +the left edge of the paper. This usually gives whitespace above and to +the left in the produced image. The value @samp{tight} will make dvipng +only include all ink put on the page, producing neat images. +@c (@pxref{papersize special}). +@c This option overrides any papersize special in the DVI file. + +@item --truecolor* +@cindex truecolor output +This will make @samp{dvipng} generate truecolor output. Note that +truecolor output is automatic if you include an external image in your +DVI, e.g., via a PostScript special (i.e., the @samp{graphics} or +@samp{graphicx} package). This switch is overridden by the +@samp{--palette} switch. + +@item -v* +Enable verbose operation. This will currently indicate what fonts is +used, in addition to the usual output. + +@item --width* +@cindex width reporting +Report the width of the image. See also @samp{--height} and +@samp{--depth}. + +@item -x @var{num} +@cindex magnification, overriding DVI +This option is deprecated; it should not be used. It is much better to +select the output resolution directly with the @samp{-D} option. This +option sets the magnification ratio to @math{@var{num}/1000} and +overrides the magnification specified in the DVI file. Must be between +10 and 100000. It is recommended that you use standard magstep values +(1095, 1200, 1440, 1728, 2074, 2488, 2986, and so on) to help reduce the +total number of PK files generated. @var{num} may be a real number, not +an integer, for increased precision. + +@item -z @var{num} +@cindex compression +Set the PNG compression level to @var{num}. This option is enabled if +your @samp{libgd} is new enough. The default compression level is 1, +which selects maximum speed at the price of slightly larger PNGs. For an +older @samp{libgd}, the hard-soldered value 5 is used. The include file +@samp{png.h} says +@ifclear man +@quotation +Currently, valid values range from 0 - 9, corresponding directly to the +zlib compression levels 0 - 9 (0 - no compression, 9 - "maximal" +compression). Note that tests have shown that zlib compression levels +3-6 usually perform as well as level 9 for PNG images, and do +considerably fewer calculations. In the future, these values may not +correspond directly to the zlib compression levels. +@end quotation +@end ifclear +@ifset man +``Currently, valid values range from 0 - 9, corresponding directly to +the zlib compression levels 0 - 9 (0 - no compression, 9 - "maximal" +compression). Note that tests have shown that zlib compression levels +3-6 usually perform as well as level 9 for PNG images, and do +considerably fewer calculations. In the future, these values may not +correspond directly to the zlib compression levels.'' +@end ifset +@end table +@c man end + +@node Graphics +@chapter Graphics + +@samp{dvipng} attempts to handle graphics as included by the +@samp{graphicx} and @samp{graphics} packages, without the need of +specifying a driver to these packages. This means that it recognizes +the encapsulated postscript inclusion meant for @samp{dvips}, but is +also able (from version 1.8) to include bitmapped graphics. It also +tries to handle some of the raw PostScript that is output from various +packages. Some of the possibilities and problems are mentioned below. + +@menu +* Encapsulated PostScript:: An internal call to GhostScript +* Bitmapped graphics:: PNG, JPEG and GIF +* Raw PostScript:: Ignore or give to GhostScript +@end menu + +@node Encapsulated PostScript +@section Encapsulated PostScript + +When an EPS file is included, a call to GhostScript is performed to +produce a bitmapped image that can be included. The default is to +produce an image with transparent background, at the same size as the +DVI page currently being converted to PNG, and include that as +foreground on the PNG. Of course, if the image is to be cropped, that +is done. The included image will be a truecolor image, so for maximum +performance the output PNG will be in truecolor mode as well. + +This conversion needs the @samp{pngalpha} output device to be present +in your copy of GhostScript. If that device is not present, or you use +the @samp{--palette} switch or request GIF output, the fallback is to +use the @samp{png16m} device to produce a cropped opaque image for +inclusion. Other relevant switches are @samp{--noghostscript} and +@samp{--nogssafer}. @xref{Option details}. + +@cindex PostScript inclusion problems +The most common problem with including graphics is an incorrect +bounding box. Complain to whoever wrote the software that generated +the file if the bounding box is indeed incorrect. An adjusted +boundingbox can be specified in the @samp{\includegraphics} call, as +in this example (using @samp{graphicx}): + +@example +\includegraphics[bb=10 20 100 200]@{imagename.eps@} +@end example + + +@node Bitmapped graphics +@section Bitmapped graphics + +dvipng can include PNG, JPEG and GIF graphics. When including such +images via @samp{\includegraphics} you need to specify the bounding +box since @TeX{} itself cannot read them from the files in question. +The bounding box size should be given as @samp{0 0 w h} in pixels, +e.g., if the file @samp{imagename.png} is 300x400 pixels, the +inclusion would read + +@example +\includegraphics[bb=0 0 300 400]@{imagename.png@} +@end example + +The default size is the image size in bp (``big points'' in TeX +nomenclature or PostScript points as other people have it, 72 per inch). +That is, default resolution will be 72 dpi for included bitmaps, which +is the default size in the few other bitmap-capable drivers that are +known to me (dvipdfm and PDFLaTeX). + +If you want 100 dpi you need to specify the width accordingly. You +just divide your image width by 100: a 135 pixel wide image at 100 dpi +will take up 1.35 inches. If you want 200 dpi you divide by 200, and +so on. Simple, eh? The example above at 200 dpi would be 1.5 inches +wide: + +@example +\includegraphics[bb=0 0 300 400,witdh=1.5in]@{imagename.png@} +@end example + +@node Raw PostScript +@section Raw PostScript + +dvipng attempts to handle raw PostScript. Rendering raw PostScript +specials is done on top of the page by including a transparent image +generated by the @samp{pngalpha} device in GhostScript (automatically +selecting @samp{truecolor} mode in dvipng). + +Included PostScript headers are respected, and if the header +@samp{tex.pro} is included, dvipng also throws in @samp{color.pro} and +@samp{special.pro}. The package @samp{xcolor} includes its own headers +with color names, and this is not only kept as a PostScript header, but +is also read and interpreted by dvipng itself. An attempt is also made +to respect the PGF header. The non-rendering specials from +@samp{hyperref} are handled via some heuristics and do not give an +error. + +Really rendering and moving things with raw PostScript specials is more +troublesome. The \rotatebox macro serves as a good example. The dvips +driver of the graphicx package surrounds DVI glyphs with PostScript code +so that after conversion by dvips, the glyphs (now themselves in +PostScript) will be rotated in the desired way. dvipng does not handle +this, at present. An attempt has been made to handle the rendering +specials output by PGF (tikz), and also PSTricks. Some things work, but +others do not. This is especially clear when mixing PostScript and DVI +rendering commands such as glyphs. dvipng cannot at present detect if +PostScript code moves @samp{currentpoint} or rotates the frame since +GhostScript does not return such information. A recommendation would be +to produce images from these packages as EPS files and include them into +your document in the standard manner. + +Another way to handle this would be to use a slower fallback (with dvips +and gs, for example). If you want to disable raw PostScript handling in +dvipng, use the switch @samp{--norawps}. This switch turns off the +internal call to GhostScript intended to display these raw PostScript +specials. Further, when dvipng encounters raw PostScript and the gs call +is turned off, it gives a warning. It is now possible to use the switch +@samp{--picky} to disable page rendering of pages with warnings, and use +the slower fallback for these pages. + +@node Color +@chapter Color + +To support color, dvipng recognizes a certain set of specials as +generated by the @samp{color} and @samp{xcolor} style files. These +specials start with the keyword @samp{color} or the keyword +@samp{background}, followed by a color specification. + +@menu +* Color specifications:: +* Color specials:: +@end menu + + +@node Color specifications +@section Color specifications + +@cindex color specifications + +The color specification supported by dvipng is by-value or by-name. The +by-value spec starts with the name of a color model (one of @samp{rgb}, +@samp{hsb}, @samp{cmy}, @samp{cmyk}, or @samp{gray}) followed by the +appropriate number of parameters. Thus, the color specification +@samp{rgb 0.3 0.4 0.5} would correspond to the color that is @samp{0.3 +0.4 0.5} in its red, blue and green values. The color model used +internally in dvipng is @samp{RGB} (discretized to 256 levels), for +details on the formulas used in conversion, see the @samp{xcolor} +documentation. + +By-name color specifications are single (case-dependent) words and are +compared with color names defined in @samp{dvipsnam.def} (from the +@samp{graphics} bundle), @samp{svgnam.def} and @samp{xcolor.sty} (from +the @samp{xcolor} bundle). See the @samp{xcolor} documentation for a +list of names and the corresponding colors. + +On the command-line, the name @samp{Transparent} can also be used as +an argument to @samp{--bg} to choose transparent background. +@xref{Option details}. + +@node Color specials +@section Color specials + +We will describe @samp{background} first, since it is the simplest. The +@samp{background} keyword must be followed by a color specification. +That color specification is used as a fill color for the background. The +last @samp{background} special on a page is the one that gets used, and +is used for the whole of the page image. (This is possible because the +prescan phase of dvipng notices all of the color specials so that the +appropriate information can be written out during the second phase.) + +The @samp{color} special itself has three forms. The first is just +@samp{color} followed by a color specification. In this case, the +current global color is set to that color; the color stack must be empty +when such a command is executed. + +The second form is @samp{color push} followed by a color specification. +This saves the current color on the color stack and sets the color to be +that given by the color specification. This is the most common way to +set a color. + +The final form of the @samp{color} special is just @samp{color pop}, +with no color specification; this says to pop the color last pushed on +the color stack from the color stack and set the current color to be +that color. + +dvipng correctly handles these color specials across pages, even when +the pages are rendered repeatedly or in reverse order. + +@node Diagnosing problems +@chapter Diagnosing problems + +@cindex problems +@cindex trouble +@cindex debugging + +You've gone through all the trouble of installing dvipng, carefully read +all the instructions in this manual, and still can't get something to +work. The following sections provide some helpful hints if you find +yourself in such a situation. + +@menu +* Contact information:: Who to ask. +* Debug options:: Getting diagnostics. +@end menu + +@node Contact information +@section Contact information + +Bug reports should be sent to +@email{dvipng@@nongnu.org}. + +Questions, suggestions for new features, pleas for help, and/or praise +should go to @email{dvipng@@nongnu.org}. For more information on this +mailing list, send a message with just the word `help' as subject or +body to @email{dvipng-request@@nongnu.org} or look at +@url{http://lists.nongnu.org/mailman/listinfo/dvipng}. + +Offers to support further development will be appreciated. For developer +access, ask on @email{dvipng@@nongnu.org}. + +For details on the @TeX{} path-searching library, and @code{mktexpk} +problems, @pxref{Common problems,,, kpathsea, Kpathsea}. + + +@node Debug options +@section Debug options + +The @samp{-d} flag to dvipng helps in tracking down certain errors. The +parameter to this flag is an integer that tells what errors are +currently being tracked. To track a certain class of debug messages, +simply provide the appropriate number given below; if you wish to track +multiple classes, sum the numbers of the classes you wish to track. To +track all classes, you can use @code{-1}. + +Some of these debugging options are actually provided by Kpathsea +(@pxref{Debugging, , , kpathsea, Kpathsea}). + +The classes are: +@table @asis +@item 1 +Normal dvi op-codes +@item 2 +Virtual fonts +@item 4 +PK fonts +@item 8 +TFM files +@item 16 +Glyph rendering +@item 32 +FreeType calls +@item 64 +Encoding loads +@item 128 +Color specials +@item 256 +GhostScript specials +@item 512 +Kpathsea @code{stat} calls +@item 1024 +Kpathsea hash table lookups +@item 2048 +Kpathsea path element expansion +@item 4096 +Kpathsea path searches +@ignore +@item 8192 +@item 16384 +@end ignore + +@end table + +@node Credits +@chapter Credits + +A number of persons have contributed, if I forget to mention someone, +I apologize. First and foremost we have David Kastrup whose +@previewlatex{} project provided the incentive to write this program. +There is also a number of people who have contributed by reporting +bugs and suggesting improvements as the thing has evolved. These +include but is perhaps not limited to (in semi-random order): Thomas +Esser (te@TeX{}), Christian Schenk (MIK@TeX{}), Brian R Furry (debian +package), Angus Leeming (LyX), Thomas Boutell (libgd), John Jones +(first user report), Uwe Kern (xcolor), Karl Berry and Peter +Breitenlohner (@TeX{} Live), David Harvey (hinting in Freetype), Neal +Harmon, Alan Shutko, Reiner Stieb, Nick Alcock, Adam Buchbinder, Svend +Tollak Munkejord, James Longstreet, Bernhard Simon, Bob McElrath, +Georg Schwarz, Jason Farmer, Brian V. Smith, Samuel Hathaway, Thomas +R. Shemanske, Stephen Gibson, Christian Ridderstr@"om, Ezra Peisach, +William H Wheeler, Thomas Klausner, Harald Koenig, Adrian Bunk, Kevin +Smith, Jason Riedy, Wolfram Krause, Reinhard Kotucha, Takeshi Abe, +Waldeck Schutzer, Ahzo, and Andy Nguyen. + +@ifset man +@c man begin NOTES +The full manual is accessible in info format, on most systems by typing +@example +info dvipng +@end example +@c man end +@c man begin COPYRIGHT +This program is released under the GNU Lesser General Public License +version 3, see the COPYING file in the dvipng distribution or +@url{http://www.gnu.org/licenses/gpl.html}. + +Copyright @copyright{} 2002-2015, 2019 Jan-@AA{}ke Larsson +@c man end +@end ifset + +@node Copying +@chapter Copying + +This program is free software: you can redistribute it and/or modify +it under the terms of the GNU Lesser General Public License as +published by the Free Software Foundation, either version 3 of the +License, or (at your option) any later version. + +This program is distributed in the hope that it will be useful, but +WITHOUT ANY WARRANTY; without even the implied warranty of +MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU +Lesser General Public License for more details. + +You should have received a copy of the GNU Lesser General Public +License along with this program. If not, see +<http://www.gnu.org/licenses/>. + +@sp 2 +@noindent +Copyright @copyright{} 2002-2015, 2019 Jan-@AA{}ke Larsson + +@node Index +@unnumbered Index + +@printindex cp +@bye diff --git a/Build/source/texk/dvipng/dvipng-src/enc.c b/Build/source/texk/dvipng/dvipng-src/enc.c new file mode 100644 index 00000000000..03224769c78 --- /dev/null +++ b/Build/source/texk/dvipng/dvipng-src/enc.c @@ -0,0 +1,129 @@ +/* enc.c */ + +/************************************************************************ + + Part of the dvipng distribution + + This program is free software: you can redistribute it and/or modify + it under the terms of the GNU Lesser General Public License as + published by the Free Software Foundation, either version 3 of the + License, or (at your option) any later version. + + This program is distributed in the hope that it will be useful, but + WITHOUT ANY WARRANTY; without even the implied warranty of + MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU + Lesser General Public License for more details. + + You should have received a copy of the GNU Lesser General Public + License along with this program. If not, see + <http://www.gnu.org/licenses/>. + + Copyright (C) 2002-2008 Jan-Åke Larsson + +************************************************************************/ + +#include "dvipng.h" + +struct encoding* encodingp=NULL; + +static struct encoding* InitEncoding(char* encoding) +{ + char *pos,*max,*buf,*enc_file; + int i; + struct encoding* encp=NULL; + struct filemmap fmmap; + boolean mmapfailed; + +#ifdef HAVE_KPSE_ENC_FORMATS + enc_file=kpse_find_file(encoding,kpse_enc_format,false); +#else + enc_file=kpse_find_file(encoding,kpse_tex_ps_header_format,false); +#endif + if (enc_file == NULL) { + Warning("encoding file %s could not be found",encoding); + return(NULL); + } + DEBUG_PRINT((DEBUG_FT|DEBUG_ENC),("\n OPEN ENCODING:\t'%s'", enc_file)); + mmapfailed = MmapFile(enc_file,&fmmap); + free(enc_file); + if (mmapfailed) + return(NULL); + if ((encp = calloc(sizeof(struct encoding)+strlen(encoding)+1 + +fmmap.size,1))==NULL) { + Warning("cannot alloc space for encoding",encoding); + UnMmapFile(&fmmap); + return(NULL); + } + encp->name=(char*)encp+sizeof(struct encoding); + strcpy(encp->name,encoding); + pos=fmmap.data; + max=fmmap.data+fmmap.size; + buf=encp->name+strlen(encoding)+1; +#define SKIPCOMMENT(x) if (*x=='%') while (x<max && *x!='\r' && *x!='\n') x++; + while(pos<max && *pos!='/') { + SKIPCOMMENT(pos); + pos++; + } + pos++; + encp->charname[256]=buf; + while(pos<max && *pos!='[' && *pos!='%' + && *pos!=' ' && *pos!='\t' && *pos!='\r' && *pos!='\n') + *buf++=*pos++; + *buf++='\0'; + DEBUG_PRINT(DEBUG_ENC,("\n PS ENCODING '%s'", + encp->charname[256])); + while (pos < max && *pos!='[') { + SKIPCOMMENT(pos); + pos++; + } + while(pos<max && *pos!='/') { + SKIPCOMMENT(pos); + pos++; + } + i=0; + while(pos<max && *pos!=']') { + pos++; + encp->charname[i++]=buf; + while(pos<max && *pos!='%' && *pos!=' ' \ + && *pos!='\t' && *pos!='\r' && *pos!='\n') + *buf++=*pos++; + *buf++='\0'; + DEBUG_PRINT(DEBUG_ENC,("\n PS ENCODING %d '%s'", + i-1,encp->charname[i-1])); + while(pos<max && *pos!='/' && *pos!=']') { + SKIPCOMMENT(pos); + pos++; + } + } + UnMmapFile(&fmmap); + return(encp); +} + + +struct encoding* FindEncoding(char* encoding) +{ + struct encoding *temp=encodingp; + + /* printf("{%s} \n",encoding); */ + while(temp!=NULL && strcmp(encoding,temp->name)!=0) + temp=temp->next; + if (temp==NULL) { + temp=InitEncoding(encoding); + if (temp!=NULL) { + temp->next=encodingp; + encodingp=temp; + } + } + return(temp); +} + +void ClearEncoding(void) +{ + struct encoding *temp=encodingp; + + while(temp!=NULL) { + encodingp=encodingp->next; + free(temp); + temp=encodingp; + } +} diff --git a/Build/source/texk/dvipng/dvipng-src/font.c b/Build/source/texk/dvipng/dvipng-src/font.c new file mode 100644 index 00000000000..d8a374e473a --- /dev/null +++ b/Build/source/texk/dvipng/dvipng-src/font.c @@ -0,0 +1,335 @@ +/* font.c */ + +/************************************************************************ + + Part of the dvipng distribution + + This program is free software: you can redistribute it and/or modify + it under the terms of the GNU Lesser General Public License as + published by the Free Software Foundation, either version 3 of the + License, or (at your option) any later version. + + This program is distributed in the hope that it will be useful, but + WITHOUT ANY WARRANTY; without even the implied warranty of + MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU + Lesser General Public License for more details. + + You should have received a copy of the GNU Lesser General Public + License along with this program. If not, see + <http://www.gnu.org/licenses/>. + + Copyright (C) 2002-2015 Jan-Åke Larsson + +************************************************************************/ + +#include "dvipng.h" + +void CheckChecksum(uint32_t c1, uint32_t c2, const char* name) +{ + /* Report a warning if both checksums are nonzero, they don't match, + and the user hasn't turned it off. */ + if (c1 && c2 && c1 != c2 +#ifdef HAVE_LIBKPATHSEA + && !kpse_tex_hush ("checksum") +#endif + ) { + Warning ("checksum mismatch in %s", name) ; + } +} + + +static double ActualFactor(uint32_t unmodsize) +/* compute the actual size factor given the approximation */ +/* actually factor * 1000 */ +{ + double realsize; /* the actual magnification factor */ + realsize = (double)unmodsize / 1000.0; + if (abs((int)(unmodsize - 1095l))<2) + realsize = 1.095445115; /*stephalf*/ + else if (abs((int)(unmodsize - 1315l))<2) + realsize = 1.31453414; /*stepihalf*/ + else if (abs((int)(unmodsize - 1577l))<2) + realsize = 1.57744097; /*stepiihalf*/ + else if (abs((int)(unmodsize - 1893l))<2) + realsize = 1.89292916; /*stepiiihalf*/ + else if (abs((int)(unmodsize - 2074l))<2) + realsize = 2.0736; /*stepiv*/ + else if (abs((int)(unmodsize - 2488l))<2) + realsize = 2.48832; /*stepv*/ + else if (abs((int)(unmodsize - 2986l))<2) + realsize = 2.985984; /*stepvi*/ + /* the remaining magnification steps are represented with sufficient + accuracy already */ + return(realsize); +} + + +void FontDef(unsigned char* command, void* parent) +{ + int32_t k; + uint32_t c, s, d; + uint8_t a, l; + unsigned char* current; + struct font_entry *tfontptr; /* temporary font_entry pointer */ + struct font_num *tfontnump = NULL; /* temporary font_num pointer */ + unsigned short i; + + current = command + 1; + k = UNumRead(current, (int)*command - FNT_DEF1 + 1); + current += (int)*command - FNT_DEF1 + 1; + c = UNumRead(current, 4); /* checksum */ + s = UNumRead(current+4, 4); /* space size */ + d = UNumRead(current+8, 4); /* design size */ + a = UNumRead(current+12, 1); /* length for font name */ + l = UNumRead(current+13, 1); /* device length */ + if (((struct font_entry*)parent)->type==FONT_TYPE_VF) { + DEBUG_PRINT(DEBUG_VF,(" %d %d %d",k,c,s)); + /* Rescale. s is relative to the actual scale /(1<<20) */ + s = (uint32_t)((uint64_t) s * (((struct font_entry*) parent)->s) + / (1<<20)); + DEBUG_PRINT(DEBUG_VF,(" (%d) %d",s,d)); + /* Oddly, d differs in the DVI and the VF that my system produces */ + d = (uint32_t)((uint64_t) d * ((struct font_entry*)parent)->d + / ((struct font_entry*)parent)->designsize); + DEBUG_PRINT(DEBUG_VF,(" (%d)",d)); + DEBUG_PRINT(DEBUG_VF,(" %d %d '%.*s'",a,l,a+l,current+14)); +#ifdef DEBUG + } else { + DEBUG_PRINT(DEBUG_DVI,(" %d %d %d %d %d %d '%.*s'",k,c,s,d,a,l, + a+l,current+14)); +#endif + } + if (a+l > STRSIZE-1) + Fatal("too long font name for font %ld",k); + + /* Find entry with this font number in use */ + switch (((struct font_entry*)parent)->type) { + case FONT_TYPE_VF: + tfontnump = ((struct font_entry*)parent)->vffontnump; + break; + case DVI_TYPE: + tfontnump = ((struct dvi_data*)parent)->fontnump; + } + while (tfontnump != NULL && tfontnump->k != k) { + tfontnump = tfontnump->next; + } + /* If found, return if it is correct */ + if (tfontnump!=NULL + && tfontnump->fontp->s == s + && tfontnump->fontp->d == d + && strlen(tfontnump->fontp->n) == a+l + && strncmp(tfontnump->fontp->n,(char*)current+14,a+l) == 0) { + DEBUG_PRINT((DEBUG_DVI|DEBUG_VF),("\n FONT %d:\tMatch found",k)); + return; + } + /* If not found, create new */ + if (tfontnump==NULL) { + if ((tfontnump=malloc(sizeof(struct font_num)))==NULL) + Fatal("cannot malloc memory for new font number"); + tfontnump->k=k; + switch (((struct font_entry*)parent)->type) { + case FONT_TYPE_VF: + tfontnump->next=((struct font_entry*)parent)->vffontnump; + ((struct font_entry*)parent)->vffontnump=tfontnump; + break; + case DVI_TYPE: + tfontnump->next=((struct dvi_data*)parent)->fontnump; + ((struct dvi_data*)parent)->fontnump=tfontnump; + } + } + + /* Search font list for possible match */ + tfontptr = hfontptr; + while (tfontptr != NULL + && (tfontptr->s != s + || tfontptr->d != d + || strlen(tfontptr->n) != a+l + || strncmp(tfontptr->n,(char*)current+14,a+l) != 0 ) ) { + tfontptr = tfontptr->next; + } + /* If found, set its number and return */ + if (tfontptr!=NULL) { + DEBUG_PRINT((DEBUG_DVI|DEBUG_VF),("\n FONT %d:\tMatch found, number set",k)); + tfontnump->fontp = tfontptr; + return; + } + + DEBUG_PRINT((DEBUG_DVI|DEBUG_VF),("\n FONT %d:\tNew entry created",k)); + /* No fitting font found, create new entry. */ + if ((tfontptr = calloc(1,sizeof(struct font_entry))) == NULL) + Fatal("cannot malloc space for font_entry"); + tfontptr->next = hfontptr; + hfontptr = tfontptr; + tfontnump->fontp = tfontptr; +#ifndef WIN32 + tfontptr->fmmap.fd = 0; +#else /* WIN32 */ + tfontptr->fmmap.hFile = INVALID_HANDLE_VALUE; +#endif + tfontptr->c = c; /* checksum */ + tfontptr->s = s; /* space size */ + tfontptr->d = d; /* design size */ + tfontptr->a = a; /* length for font name */ + tfontptr->l = l; /* device length */ + strncpy(tfontptr->n,(char*)current+14,a+l); /* full font name */ + tfontptr->n[a+l] = '\0'; + + tfontptr->name = NULL; + for (i = FIRSTFNTCHAR; i <= LASTFNTCHAR; i++) { + tfontptr->chr[i] = NULL; + } + + tfontptr->dpi = + (uint32_t)((ActualFactor((uint32_t)(1000.0*tfontptr->s + /(double)tfontptr->d+0.5)) + * ActualFactor(dvi->mag) * dpi*shrinkfactor) + 0.5); +#ifdef HAVE_FT2 + tfontptr->psfontmap=NULL; +#endif +} + +#ifdef HAVE_FT2 +static char* kpse_find_t1_or_tt(char* filename) +{ + char* filepath = kpse_find_file(filename, kpse_type1_format, false); + if ((option_flags & USE_FREETYPE) && filepath==NULL) + filepath = kpse_find_file(filename, kpse_truetype_format, false); + return(filepath); +} +#endif + +static void FontFind(struct font_entry * tfontptr) +{ + kpse_glyph_file_type font_ret; + + /* tfontptr->dpi = kpse_magstep_fix (tfontptr->dpi, resolution, NULL); */ + DEBUG_PRINT(DEBUG_DVI,("\n FIND FONT:\t%s %d",tfontptr->n,tfontptr->dpi)); + + tfontptr->name = kpse_find_vf (tfontptr->n); + if (tfontptr->name!=NULL) + InitVF(tfontptr); +#ifdef HAVE_FT2 + else if (option_flags & USE_FREETYPE) { + tfontptr->psfontmap = FindPSFontMap(tfontptr->n); + if (tfontptr->psfontmap!=NULL) + tfontptr->name=kpse_find_t1_or_tt(tfontptr->psfontmap->psfile); + else + tfontptr->name=kpse_find_t1_or_tt(tfontptr->n); + if (tfontptr->name!=NULL) { + char* tfmname=kpse_find_file(tfontptr->n, kpse_tfm_format, false); + if (tfmname!=NULL) { + if (!ReadTFM(tfontptr,tfmname)) { + Warning("unable to read tfm file %s", tfmname); + free(tfontptr->name); + tfontptr->name=NULL; + } else if ((option_flags & USE_FREETYPE)==0 || !InitFT(tfontptr)) { + /* if Freetype loading fails for some reason, fall back to PK font */ + free(tfontptr->name); + tfontptr->name=NULL; + } + free(tfmname); + } + } + } +#endif /* HAVE_FT2 */ + if (tfontptr->name==NULL) { + tfontptr->name=kpse_find_pk (tfontptr->n, tfontptr->dpi, &font_ret); + if (tfontptr->name!=NULL) { + if (!FILESTRCASEEQ (tfontptr->n, font_ret.name)) { + page_flags |= PAGE_GAVE_WARN; + Warning("font %s not found, using %s at %d dpi instead", + tfontptr->n, font_ret.name, font_ret.dpi); + tfontptr->c = 0; /* no checksum warning */ + } else if (!kpse_bitmap_tolerance ((double)font_ret.dpi, + (double) tfontptr->dpi)) { + page_flags |= PAGE_GAVE_WARN; + Warning("font %s at %d dpi not found, using %d dpi instead", + tfontptr->n, tfontptr->dpi, font_ret.dpi); + } + InitPK(tfontptr); + } else { + page_flags |= PAGE_GAVE_WARN; + Warning("font %s at %d dpi not found, characters will be left blank", + tfontptr->n, tfontptr->dpi); +#ifndef WIN32 + tfontptr->fmmap.fd = 0; +#else /* WIN32 */ + tfontptr->fmmap.hFile = INVALID_HANDLE_VALUE; +#endif + tfontptr->magnification = 0; + tfontptr->designsize = 0; + } + } +} + + +static void DoneFont(struct font_entry *tfontp) +{ + switch (tfontp->type) { + case FONT_TYPE_PK: + DonePK(tfontp); + break; + case FONT_TYPE_VF: + DoneVF(tfontp); + break; +#ifdef HAVE_FT2 + case FONT_TYPE_FT: + DoneFT(tfontp); + break; +#endif + } +} + + +void FreeFontNumP(struct font_num *hfontnump) +{ + struct font_num *tmp; + while(hfontnump!=NULL) { + tmp=hfontnump->next; + free(hfontnump); + hfontnump=tmp; + } +} + +void ClearFonts(void) +{ + struct font_entry *tmp; + + while(hfontptr!=NULL) { + tmp=hfontptr->next; + DoneFont(hfontptr); + if (hfontptr->name != NULL) + free(hfontptr->name); + free(hfontptr); + hfontptr=tmp; + } + if (dvi!=NULL) + FreeFontNumP(dvi->fontnump); +} + +/*-->SetFntNum*/ +/**********************************************************************/ +/**************************** SetFntNum *****************************/ +/**********************************************************************/ +void SetFntNum(int32_t k, void* parent /* dvi/vf */) +/* this routine is used to specify the font to be used in printing future + characters */ +{ + struct font_num *tfontnump=NULL; /* temporary font_num pointer */ + + switch (((struct font_entry*)parent)->type) { + case FONT_TYPE_VF: + tfontnump = ((struct font_entry*)parent)->vffontnump; + break; + case DVI_TYPE: + tfontnump = ((struct dvi_data*)parent)->fontnump; + } + while (tfontnump != NULL && tfontnump->k != k) + tfontnump = tfontnump->next; + if (tfontnump == NULL) + Fatal("font %d undefined", k); + + currentfont = tfontnump->fontp; + if (currentfont->name==NULL) + FontFind(currentfont); +} diff --git a/Build/source/texk/dvipng/dvipng-src/fontmap.c b/Build/source/texk/dvipng/dvipng-src/fontmap.c new file mode 100644 index 00000000000..f362a57defa --- /dev/null +++ b/Build/source/texk/dvipng/dvipng-src/fontmap.c @@ -0,0 +1,327 @@ +/* fontmap.c */ + +/************************************************************************ + + Part of the dvipng distribution + + This program is free software: you can redistribute it and/or modify + it under the terms of the GNU Lesser General Public License as + published by the Free Software Foundation, either version 3 of the + License, or (at your option) any later version. + + This program is distributed in the hope that it will be useful, but + WITHOUT ANY WARRANTY; without even the implied warranty of + MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU + Lesser General Public License for more details. + + You should have received a copy of the GNU Lesser General Public + License along with this program. If not, see + <http://www.gnu.org/licenses/>. + + Copyright (C) 2002-2015 Jan-Åke Larsson + +************************************************************************/ + +#include "dvipng.h" + +static struct filemmap psfont_mmap; +#ifdef HAVE_FT2 +static struct filemmap ttfont_mmap; +#endif +static struct psfontmap *psfontmap=NULL; + +static char* newword(char** buffer, char* end) +{ + char *word,*pos=*buffer; + + while(pos<end && *pos!=' ' && *pos!='\t' && *pos!='"') pos++; + if ((word=malloc(pos-*buffer+1))==NULL) + Fatal("cannot malloc space for string"); + strncpy(word,*buffer,pos-*buffer); + word[pos-*buffer]='\0'; + *buffer=pos; + return(word); +} + +char* copyword(char* orig) +{ + char *word; + + if (orig==NULL) + return(NULL); + if ((word=malloc(strlen(orig)+1))==NULL) + Fatal("cannot malloc space for string"); + strcpy(word,orig); + return(word); +} + +static char* find_format(const char* name) +{ + /* Cater for both new (first case) and old (second case) kpathsea */ + char* format = + kpse_find_file(name,kpse_fontmap_format,false); + + if (format==NULL) + format = kpse_find_file(name,kpse_dvips_config_format,false); + return(format); +} + +void InitPSFontMap(void) +{ + char* psfont_name=NULL; + /* Prefer ps2pk.map, fonts are present more often */ + psfont_name=find_format("ps2pk.map"); + if (psfont_name==NULL) + psfont_name=find_format("psfonts.map"); + if (psfont_name==NULL) { + Warning("cannot find ps2pk.map, nor psfonts.map"); + } else { + DEBUG_PRINT(DEBUG_FT, + ("\n OPEN PSFONT MAP:\t'%s'", psfont_name)); + if (MmapFile(psfont_name,&psfont_mmap)) { + Warning("psfonts map %s could not be opened", psfont_name); + } + free(psfont_name); + } +#ifdef HAVE_FT2 + psfont_name=find_format("ttfonts.map"); + if (psfont_name!=NULL) { + DEBUG_PRINT(DEBUG_FT,("\n OPEN TTFONT MAP:\t'%s'", psfont_name)); + if (MmapFile(psfont_name,&ttfont_mmap)) { + Warning("ttfonts map %s could not be opened", psfont_name); + } + free(psfont_name); + } +#endif +} + +struct psfontmap *NewPSFont(struct psfontmap* copyfrom) +{ + struct psfontmap *newentry=NULL; + if ((newentry=malloc(sizeof(struct psfontmap)))==NULL) + Fatal("cannot malloc psfontmap space"); + if (copyfrom!=NULL) { + newentry->line = copyfrom->line; + newentry->tfmname = copyword(copyfrom->tfmname); + newentry->psfile = copyword(copyfrom->psfile); + newentry->encname = copyword(copyfrom->encname); + newentry->encoding = copyfrom->encoding; +#ifdef HAVE_FT2 + newentry->ft_transformp = copyfrom->ft_transformp; + newentry->subfont = copyfrom->subfont; +#endif + newentry->end = copyfrom->end; + } else { + newentry->line = NULL; + newentry->tfmname = NULL; + newentry->psfile = NULL; + newentry->encname = NULL; + newentry->encoding = NULL; +#ifdef HAVE_FT2 + newentry->ft_transformp = NULL; + newentry->subfont = NULL; +#endif + newentry->end = NULL; + } + newentry->next=psfontmap; + psfontmap=newentry; + return(newentry); +} + +static struct psfontmap *SearchPSFontMap(char* fontname, + struct filemmap* search_mmap) +{ + static char *pos=NULL,*end=NULL; + static struct filemmap* searching_mmap=NULL; + struct psfontmap *entry=NULL; + + if (pos==end && search_mmap!=searching_mmap) { + searching_mmap=search_mmap; + pos=searching_mmap->data; + end=searching_mmap->data+searching_mmap->size; + } + while(pos<end && (entry==NULL || strcmp(entry->tfmname,fontname)!=0)) { + while(pos < end + && (*pos=='\r' || *pos=='\n' || *pos==' ' || *pos=='\t' + || *pos=='%' || *pos=='*' || *pos==';' || *pos=='#')) { + while(pos < end && *pos!='\r' && *pos!='\n') pos++; /* skip comments/empty rows */ + pos++; + } + if (pos < end) { + entry=NewPSFont(NULL); + entry->line = pos; + /* skip <something and quoted entries */ + while(pos < end && (*pos=='<' || *pos=='"')) { + if (*pos=='<') + while(pos < end && *pos!=' ' && *pos!='\t') pos++; + else + while(pos < end && *pos!='"') pos++; + while(pos < end && (*pos==' ' || *pos=='\t')) pos++; + } + /* first word is font name */ + entry->tfmname = newword(&pos,end); + while(pos < end && *pos!='\r' && *pos!='\n') pos++; + entry->end = pos; + } + pos++; + } + if (entry!=NULL && strcmp(entry->tfmname,fontname)!=0) + entry=NULL; + return(entry); +} + +void ClearPSFontMap(void) +{ + struct psfontmap *entry; + + while(psfontmap!=NULL) { + entry=psfontmap; + psfontmap=psfontmap->next; + free(entry->tfmname); + if (entry->psfile!=NULL) + free(entry->psfile); + if (entry->encname!=NULL) + free(entry->encname); + free(entry); + } + UnMmapFile(&psfont_mmap); +#ifdef HAVE_FT2 + UnMmapFile(&ttfont_mmap); +#endif +} + +static void ReadPSFontMap(struct psfontmap *entry) +{ + char *pos,*end,*psname; + int nameno = 0; + + DEBUG_PRINT(DEBUG_FT,("\n PSFONTMAP: %s ",entry->tfmname)); + pos=entry->line; + end=entry->end; + while(pos < end) { + if (*pos=='<') { /* filename follows */ + pos++; + if (pos<end && *pos=='<') { /* <<download.font */ + pos++; + entry->psfile = newword((char**)&pos,end); + DEBUG_PRINT(DEBUG_FT,("<%s ",entry->psfile)); + } else if (pos<end && *pos=='[') { /* <[encoding.file */ + pos++; + entry->encname = newword((char**)&pos,end); + DEBUG_PRINT(DEBUG_FT,("<[%s ",entry->encname)); + } else { /* <some.file */ + char* word =newword((char**)&pos,end); + if (strncmp(word+strlen(word)-4,".enc",4)==0) {/* <some.enc */ + entry->encname=word; + DEBUG_PRINT(DEBUG_FT,("<[%s ",entry->encname)); + } else { /* <font */ + entry->psfile=word; + DEBUG_PRINT(DEBUG_FT,("<%s ",entry->psfile)); + } + } + } else if (*pos=='"') { /* PS code: reencoding/tranformation exists */ + char *word; + double cxx=1.0,cxy=0.0; + pos++; + DEBUG_PRINT(DEBUG_FT,("\"")); + while(pos < end && *pos!='"') { + word=newword((char**)&pos,end); + while(pos < end && (*pos==' ' || *pos=='\t')) pos++; + if (pos+10<end && strncmp(pos,"ExtendFont",10)==0) { + cxx=strtod(word,NULL); + pos+=10; + DEBUG_PRINT(DEBUG_FT,("%f ExtendFont ",cxx)); + } else if (pos+9<end && strncmp(pos,"SlantFont",9)==0) { + pos+=9; + cxy=strtod(word,NULL); + DEBUG_PRINT(DEBUG_FT,("%f SlantFont ",cxy)); + } else if (pos+12<end && strncmp(pos,"ReEncodeFont",12)==0) { + pos+=12; + DEBUG_PRINT(DEBUG_FT,("%s ReEncodeFont ",word)); + } else { + DEBUG_PRINT(DEBUG_FT,("(?:%s) ",word)); + } + free(word); + } +#ifdef HAVE_FT2 + entry->ft_transformp=&(entry->ft_transform); + entry->ft_transform.xx=(FT_Fixed)(cxx*0x10000); + entry->ft_transform.xy=(FT_Fixed)(cxy*0x10000); + entry->ft_transform.yx=0; + entry->ft_transform.yy=0x10000; +#endif + DEBUG_PRINT(DEBUG_FT,("\" ")); + pos++; + } else { /* bare word */ + switch (++nameno) { + case 1: /* first word is tfmname and perhaps psname, NOT psfile */ + while(pos<end && *pos!=' ' && *pos!='\t') pos++; + psname=entry->tfmname; + break; + case 2: /* second word is psname, NOT psfile */ + psname = newword((char**)&pos,end); + DEBUG_PRINT(DEBUG_FT,("(%s) ",psname)); + free(psname); + break; + case 3: /* third word is encoding */ + entry->encname = newword((char**)&pos,end); + DEBUG_PRINT(DEBUG_FT,("<[%s ",entry->encname)); + break; + default: + while(pos<end && *pos!=' ' && *pos!='\t') pos++; + Warning("more than three bare words in font map entry"); + } + } + while(pos < end && (*pos==' ' || *pos=='\t')) pos++; + } + if (entry->psfile==NULL) { + /* No psfile-name given, use tfmname */ + entry->psfile=copyword(entry->tfmname); + DEBUG_PRINT(DEBUG_FT,(" <%s ",entry->psfile)); + } + if (entry->encname!=NULL + && (entry->encoding=FindEncoding(entry->encname))==NULL) + Warning("unable to load font encoding '%s' for %s", + entry->encname,entry->tfmname); +} + + +struct psfontmap* FindPSFontMap(char* fontname) +{ + struct psfontmap *entry; + static struct filemmap* search_mmap_p=&psfont_mmap; + + entry=psfontmap; + while(entry!=NULL && strcmp(entry->tfmname,fontname)!=0) + entry=entry->next; + if(entry==NULL) { + entry=SearchPSFontMap(fontname,search_mmap_p); +#ifdef HAVE_FT2 + if(entry==NULL && search_mmap_p!=&ttfont_mmap) { + search_mmap_p=&ttfont_mmap; + entry=SearchPSFontMap(fontname,search_mmap_p); + } + } + if(entry==NULL) { + struct psfontmap* entry_subfont=NULL; + entry=psfontmap; + while(entry!=NULL && strcmp(entry->tfmname,fontname)!=0) { + while(entry!=NULL && strchr(entry->tfmname,'@')==NULL) + entry=entry->next; + if (entry!=NULL) { + entry_subfont=FindSubFont(entry,fontname); + if (entry_subfont!=NULL) + entry=entry_subfont; + else + entry=entry->next; + } + } +#endif + } + if (entry!=NULL && entry->psfile==NULL) + ReadPSFontMap(entry); + if (entry!=NULL && entry->encname!=NULL && entry->encoding==NULL) + /* Encoding given but it cannot be found. Unusable font */ + return(NULL); + return(entry); +} diff --git a/Build/source/texk/dvipng/dvipng-src/ft.c b/Build/source/texk/dvipng/dvipng-src/ft.c new file mode 100644 index 00000000000..9609b10a10e --- /dev/null +++ b/Build/source/texk/dvipng/dvipng-src/ft.c @@ -0,0 +1,179 @@ +/* ft.c */ + +/************************************************************************ + + Part of the dvipng distribution + + This program is free software: you can redistribute it and/or modify + it under the terms of the GNU Lesser General Public License as + published by the Free Software Foundation, either version 3 of the + License, or (at your option) any later version. + + This program is distributed in the hope that it will be useful, but + WITHOUT ANY WARRANTY; without even the implied warranty of + MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU + Lesser General Public License for more details. + + You should have received a copy of the GNU Lesser General Public + License along with this program. If not, see + <http://www.gnu.org/licenses/>. + + Copyright (C) 2002-2009 Jan-Åke Larsson + +************************************************************************/ + +#include "dvipng.h" + +void LoadFT(int32_t c, struct char_entry * ptr) +{ + FT_Bitmap bitmap; + FT_UInt glyph_i; + int i,j,k; + unsigned char* bit; + static bool hintwarning=false; + + DEBUG_PRINT(DEBUG_FT,("\n LOAD FT CHAR\t%d (%d)",c,ptr->tfmw)); + if (currentfont->psfontmap!=NULL + && currentfont->psfontmap->encoding != NULL) { + DEBUG_PRINT(DEBUG_FT,(" %s",currentfont->psfontmap->encoding->charname[c])); + glyph_i = FT_Get_Name_Index(currentfont->face, + currentfont->psfontmap->encoding->charname[c]); + } else if (currentfont->psfontmap!=NULL + && currentfont->psfontmap->subfont != NULL) { + glyph_i = FT_Get_Char_Index( currentfont->face, + currentfont->psfontmap->subfont->charindex[c] ); + DEBUG_PRINT(DEBUG_FT,(" 0x%X",currentfont->psfontmap->subfont->charindex[c])); + } else + glyph_i = FT_Get_Char_Index( currentfont->face, c ); + if (FT_Load_Glyph( currentfont->face, glyph_i, + FT_LOAD_RENDER | FT_LOAD_TARGET_LIGHT )) { + /* On some configurations (with FreeType <= 2.1.7) the above + fails, while the below works */ + if (!hintwarning) { + hintwarning=true; + Warning("the used FreeType does not have target_light hinting"); + } + if (FT_Load_Glyph( currentfont->face, glyph_i, + FT_LOAD_RENDER | FT_LOAD_NO_HINTING )) + Fatal("cannot load FT char %d",c); + } + ptr->xOffset = -currentfont->face->glyph->bitmap_left*shrinkfactor; + ptr->yOffset = (currentfont->face->glyph->bitmap_top-1)*shrinkfactor; + bitmap=currentfont->face->glyph->bitmap; + DEBUG_PRINT(DEBUG_FT,(" (%dx%d)",bitmap.width,bitmap.rows)); + + if ((ptr->data = calloc(bitmap.width*bitmap.rows,sizeof(char))) == NULL) + Fatal("unable to malloc image space for char %c", (char)c); + ptr->w = bitmap.width; + ptr->h = bitmap.rows; + +#define GREYLEVELS 16 + DEBUG_PRINT(DEBUG_GLYPH,("\nDRAW GLYPH %d\n", (int)c)); + bit=ptr->data; + for(i=0;i<bitmap.rows;i++) { + for(j=0;j<bitmap.width;j++) { + k=bitmap.buffer[i*bitmap.pitch+j]/(256/GREYLEVELS)*17; + /* k=(bitmap.buffer[i*bitmap.pitch+j]+1)/16; */ + /* k= k>0 ? k*16-1 : 0; */ + DEBUG_PRINT(DEBUG_GLYPH,("%3u ",k)); + bit[i*bitmap.width+j]=k; + } + DEBUG_PRINT(DEBUG_GLYPH,("|\n")); + } +} + +bool InitFT(struct font_entry * tfontp) +{ + int error; + + if (libfreetype==NULL) { + if (FT_Init_FreeType( &libfreetype )) { + Warning("an error occured during freetype initialisation, disabling it"); + option_flags &= ~USE_FREETYPE; + return(false); + } +# ifdef DEBUG + else { + FT_Int amajor, aminor, apatch; + + DEBUG_PRINT(DEBUG_FT,("\n COMPILED WITH FREETYPE %d.%d.%d", + FREETYPE_MAJOR, FREETYPE_MINOR, FREETYPE_PATCH)); +# ifdef HAVE_FT_LIBRARY_VERSION + FT_Library_Version( libfreetype, &amajor, &aminor, &apatch ); + DEBUG_PRINT(DEBUG_FT,("\n USING LIBFT %d.%d.%d", + amajor, aminor, apatch)); +# endif + } +# endif + } + DEBUG_PRINT((DEBUG_DVI|DEBUG_FT),("\n OPEN FT FONT:\t'%s'", tfontp->name)); + error = FT_New_Face( libfreetype, tfontp->name, 0, &tfontp->face ); + if (error == FT_Err_Unknown_File_Format) { + Warning("font file %s has unknown format", tfontp->name); + return(false); + } else if (error) { + Warning("font file %s could not be opened", tfontp->name); + return(false); + } + Message(BE_VERBOSE,"<%s>", tfontp->name); + if (tfontp->psfontmap != NULL && tfontp->psfontmap->subfont != NULL) + error=FT_Select_Charmap(tfontp->face, tfontp->psfontmap->subfont->encoding); + else if (tfontp->psfontmap == NULL || tfontp->psfontmap->encoding == NULL) +#ifndef FT_ENCODING_ADOBE_CUSTOM +# define FT_ENCODING_ADOBE_CUSTOM ft_encoding_adobe_custom +# define FT_ENCODING_ADOBE_STANDARD ft_encoding_adobe_standard +#endif + error=FT_Select_Charmap(tfontp->face, FT_ENCODING_ADOBE_CUSTOM); + if (error) { + Warning("unable to set font encoding for %s", tfontp->name); + if(FT_Select_Charmap( tfontp->face, FT_ENCODING_ADOBE_STANDARD )) { + Warning("unable to set fallback font encoding for %s", tfontp->name); + return(false); + } + } + if (FT_Set_Char_Size( tfontp->face, /* handle to face object */ + 0, /* char_width in 1/64th of points */ + ((int64_t)tfontp->d*64*7200)/7227/65536, + /* char_height in 1/64th of _big_points, + not TeX points */ + tfontp->dpi/shrinkfactor, /* horizontal resolution */ + tfontp->dpi/shrinkfactor )) /* vertical resolution */ { + Warning("unable to set font size for %s", tfontp->name); + return(false); + } + if (tfontp->psfontmap!=NULL) + FT_Set_Transform(tfontp->face, tfontp->psfontmap->ft_transformp, NULL); + tfontp->type = FONT_TYPE_FT; + return(true); +} + + +static void UnLoadFT(struct char_entry *ptr) +{ + if (ptr->data!=NULL) + free(ptr->data); + ptr->data=NULL; +} + + +void DoneFT(struct font_entry *tfontp) +{ + int c=0; + + int error = FT_Done_Face( tfontp->face ); + if (error) + Warning("font file %s could not be closed", tfontp->name); + while(c<NFNTCHARS) { + if (tfontp->chr[c]!=NULL) { + UnLoadFT((struct char_entry*)tfontp->chr[c]); + free(tfontp->chr[c]); + tfontp->chr[c]=NULL; + } + c++; + } + if (tfontp->name!=NULL) + free(tfontp->name); + tfontp->name=NULL; +} + + diff --git a/Build/source/texk/dvipng/dvipng-src/install.texi b/Build/source/texk/dvipng/dvipng-src/install.texi new file mode 100644 index 00000000000..61e47e565b9 --- /dev/null +++ b/Build/source/texk/dvipng/dvipng-src/install.texi @@ -0,0 +1,194 @@ +@c install.texi +@c +@c Part of the dvipng distribution + +@include macros.texi +@ifset rawfile +@chapter Installing dvipng + +@end ifset +@c ----------------------- +Installing dvipng should be simple: merely @code{./configure}, +@code{make}, and @code{make install}. + +@ifclear rawfile +@menu +* Prerequisites:: +* Configure:: +* Build/install:: +* Installation outside the texmf tree:: +* Advice for non-privileged users:: +@end menu +@end ifclear + +@node Prerequisites +@section Prerequisites + +@itemize @bullet +@item The GD Graphics Draw library, libgd + +The drawing library @samp{libgd} is necessary, and is downloadable at +@uref{https://bitbucket.org/libgd/gd-libgd/downloads}, and there are +binary packages for most operating systems from their respective +distributors. In any case, the library installs using @samp{autoconf} so +it should not be difficult for you to install it from source, and then +proceed with installing dvipng. + +@item The path-searching library kpathsea + +Kpathsea is most likely included in your @LaTeX{} installation, but it +may happen that ./configure does not find it; see below. If you do not +have it, download it from @uref{http://www.ctan.org} and compile it. +I have no experience with this, so I cannot help much here. + +@item The font-rendering library FreeType 2 + +While not strictly necessary, a recent FreeType 2 is recommended since +dvipng currently will produce better-quality images when this library is +available. To take advantage of this, you should have at least FreeType +2.1.9. + +FreeType 2 will enable direct support for PostScript and TrueType fonts, +so that dvipng will not need to generate bitmapped variants on disk of +the @TeX{} fonts since modern @TeX{} distributions include PostScript +versions of them. Then, you can render images at different (and unusual) +resolutions without cluttering the disk with lots of bitmapped fonts. + +Finally, it will enable subfont support in dvipng. That is, if you want +to render CJK-@LaTeX{} characters, you must have FreeType 2 installed. + +@item libpng and libz + +To be able to compress and write PNG files to disk, dvipng (or really +libgd) uses libpng which in turn uses libz. These should be available on +any modern system, if not, download them and install them. + +@item The @code{texinfo} package + +This is needed for building the documentation. +@end itemize + +@node Configure +@section Configure + +The first step is to configure the source code, telling it where +various files will be. To do so, run + +@example +./configure @var{options} +@end example + +(Note: if you have fetched dvipng from CVS rather than a regular +release, you will have to first generate @file{./configure} by running +@code{autoconf} 2.53 or later.) + +On many machines, you will not need to specify any options, but if +@code{configure} cannot determine something on its own, you'll need to +help it out. For a list of the options type + +@example +./configure --help +@end example + +On some machines, the libraries will be installed in directories that +are not in the linker's search path. This will generate an error when +running @file{./configure}, indicating that it cannot find libgd or +libkpathsea (most likely). You then need to specify the path to the +respective library's object files. They are typically called e.g., +@file{libgd.a} or @file{libgd.so}. If they are located in e.g., +@file{/sw/local/lib}, do + +@example +./configure LDFLAGS=-L/sw/local/lib +@end example + +If the library is available as a shared object file (@file{.so}), the +runtime linker may also need to be told where to find the library, +then use + +@example +./configure LDFLAGS='-L/sw/local/lib -R/sw/local/lib' +@end example + +When either of these is necessary, it is likely that the C header +files are also installed in directories that are not in the C +preprocessor's search path. This will also generate an error when +running @file{./configure}, indicating that it cannot find e.g., +@file{gd.h} or @file{kpathsea.h} (most likely). You then need to +specify the path to the respective library's C header files. If they +are located in e.g., @file{/sw/local/include}, do + +@example +./configure CPPFLAGS=-I/sw/local/include +@end example + +On my SUN Solaris workstation, I had to combine this into + +@example +./configure CPPFLAGS='-I/sw/local/include -I/sw/tex/teTeX/1.0/include'\ + LDFLAGS='-L/sw/local/lib -R/sw/local/lib -L/sw/tex/teTeX/1.0/lib/' +@end example + +@noindent +where the backslash denotes a continuation of the line. + +@node Build/install +@section Build/install + +Once @file{configure} has been run, simply enter + +@example +make +@end example + +@noindent +at the prompt to compile the C code, and build the documentation files. +To install the files into the locations chosen earlier, type + +@example +make install +@end example + +@noindent +You may need special privileges to install, e.g., if you are installing +into system directories. + +@node Installation outside the texmf tree +@section Installation outside the texmf tree + +In some cases, a dvipng binary installed outside the texmf tree will +not be able to find virtual fonts, or the PostScript font maps +(normally used by dvips). This may be because @emph{only} +$SELFAUTOLOC, $SELFAUTODIR, and $SELFAUTOPARENT are used in the texmf +tree configuration file @samp{texmf.cnf}. If so, give the switch +@samp{--enable-selfauto-set} to @samp{./configure}. This will make +dvipng adjust these three internally so that kpathsea thinks that +dvipng @emph{is} installed in the texmf tree. + +@node Advice for non-privileged users +@section Installation for non-privileged users + +Often people without system administration privileges want to install +software for their private use. In that case you need to specify more +options to the @file{configure} script, usually this is done by using +the @samp{--prefix} option to the @file{configure} script, and let it +point to the personal home directory. In that way, resulting binaries +will be installed under the @file{bin} subdirectory of your home +directory, manual pages under @file{man} and so on. That way, it is +reasonably easy to maintain a bunch of additional packages, since the +prefix argument is supported by most @file{configure} scripts. + +You'll have to add something like @file{/home/myself/bin} to your +@code{PATH} shell variable, if it isn't there already, and similarly +set the @code{INFOPATH} and @code{MANPATH} variables to be able to +access the documentation. + +@ifset rawfile +@section Copying + +This program is released under the GNU Lesser General Public License +version 3, see the COPYING file in the dvipng distribution or +@url{http://www.gnu.org/licenses/}. + +Copyright @copyright{} 2002-2015, 2019 Jan-@AA{}ke Larsson +@end ifset diff --git a/Build/source/texk/dvipng/dvipng-src/macros.texi b/Build/source/texk/dvipng/dvipng-src/macros.texi new file mode 100644 index 00000000000..3c90a59eb15 --- /dev/null +++ b/Build/source/texk/dvipng/dvipng-src/macros.texi @@ -0,0 +1,61 @@ +@ignore +macros.texi + +Part of the dvipng distribution + +This program is free software: you can redistribute it and/or modify +it under the terms of the GNU Lesser General Public License as +published by the Free Software Foundation, either version 3 of the +License, or (at your option) any later version. + +This program is distributed in the hope that it will be useful, but +WITHOUT ANY WARRANTY; without even the implied warranty of +MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU +Lesser General Public License for more details. + +You should have received a copy of the GNU Lesser General Public +License along with this program. If not, see +<http://www.gnu.org/licenses/>. + +Copyright @copyright{} 2002-2008 Jan-@AA{}ke Larsson +@end ignore + +@ifclear macros +@set macros +@macro AUCTeX {} +AUC@TeX{} +@end macro +@ifnottex +@macro LaTeX {} +La@TeX{} +@end macro +@macro previewlatex {} +preview-latex +@end macro +@ifset no-acronym +@clear no-acronym +@macro acronym {text} +@sc{\text\} +@end macro +@end ifset +@ifset no-env +@clear no-env +@macro env {text} +@code{\text\} +@end macro +@end ifset +@ifset no-option +@clear no-option +@macro option {text} +@samp{\text\} +@end macro +@end ifset +@end ifnottex +@tex +\gdef\LaTeX{L\kern-.36em\raise.3ex\hbox{\sc{a}}\kern-.15em\TeX} +\gdef\previewlatex{Preview-\LaTeX} +\ifx\acronym\undefined \gdef\acronym#1{{\smallcaps \lowercase{#1}}} \fi +\ifx\env\undefined \global\let\env=\code \fi +\ifx\option\undefined \global\let\option=\samp \fi +@end tex +@end ifclear diff --git a/Build/source/texk/dvipng/dvipng-src/miktex.h b/Build/source/texk/dvipng/dvipng-src/miktex.h new file mode 100644 index 00000000000..f609a69a4db --- /dev/null +++ b/Build/source/texk/dvipng/dvipng-src/miktex.h @@ -0,0 +1,266 @@ +/* config.h. Edited for MiKTeX. */ + +/************************************************************************ + + Part of the dvipng distribution + + This program is free software: you can redistribute it and/or modify + it under the terms of the GNU Lesser General Public License as + published by the Free Software Foundation, either version 3 of the + License, or (at your option) any later version. + + This program is distributed in the hope that it will be useful, but + WITHOUT ANY WARRANTY; without even the implied warranty of + MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU + Lesser General Public License for more details. + + You should have received a copy of the GNU Lesser General Public + License along with this program. If not, see + <http://www.gnu.org/licenses/>. + + Copyright (C) 2002-2015 Jan-Åke Larsson + +************************************************************************/ + +/* Define to one of `_getb67', `GETB67', `getb67' for Cray-2 and Cray-YMP + systems. This function is required for `alloca.c' support on those systems. + */ +#undef CRAY_STACKSEG_END + +/* Define to 1 if using `alloca.c'. */ +#undef C_ALLOCA + +/* Define as 1 to get the debug (-d) option. */ +#define DEBUG 1 + +/* The environment setting for $SELFAUTODIR */ +#undef ENV_SELFAUTODIR + +/* The environment setting for $SELFAUTOLOC */ +#undef ENV_SELFAUTOLOC + +/* The environment setting for $SELFAUTOPARENT */ +#undef ENV_SELFAUTOPARENT + +/* Define as the path to GhostScript. */ +#undef GS_PATH + +/* Define to 1 if you have `alloca', as a function or macro. */ +#define HAVE_ALLOCA 1 + +/* Define to 1 if you have <alloca.h> and it should be used (not on Ultrix). + */ +#undef HAVE_ALLOCA_H + +/* Define to 1 if you don't have `vprintf' but do have `_doprnt.' */ +#undef HAVE_DOPRNT + +/* Define to 1 if you have the `dup2' function. */ +#undef HAVE_DUP2 + +/* Define to 1 if you have the <fcntl.h> header file. */ +#define HAVE_FCNTL_H 1 + +/* Define to 1 if you have the `fork' function. */ +#undef HAVE_FORK + +/* Define to 1 if you have freetype2 */ +#undef HAVE_FT2 + +/* Define to 1 if you have the `ftime' function. */ +#undef HAVE_FTIME + +/* Define to 1 if you have the `FT_Library_Version' function. */ +#undef HAVE_FT_LIBRARY_VERSION + +/* Define to 1 if you have the `gdImageAlphaBlending' function. */ +#undef HAVE_GDIMAGEALPHABLENDING + +/* Define to 1 if you have the `gdImageColorResolveAlpha' function. */ +#undef HAVE_GDIMAGECOLORRESOLVEALPHA + +/* Define to 1 if you have the `gdImageCreateTrueColor' function. */ +#define HAVE_GDIMAGECREATETRUECOLOR 1 + +/* Define to 1 if you have the `gdImageGif' function. */ +#undef HAVE_GDIMAGEGIF + +/* Define to 1 if you have the `gdImagePngEx' function. */ +#define HAVE_GDIMAGEPNGEX 1 + +/* Define to 1 if you have the `gdImageTrueColorToPalette' function. */ +#define HAVE_GDIMAGETRUECOLORTOPALETTE 1 + +/* Define to 1 if you have the <gd.h> header file. */ +#define HAVE_GD_H 1 + +/* Define to 1 if you have the `getpagesize' function. */ +#undef HAVE_GETPAGESIZE + +/* Define to 1 if you have the `gettimeofday' function. */ +#undef HAVE_GETTIMEOFDAY + +/* Define to 1 if you have the <inttypes.h> header file. */ +#define HAVE_INTTYPES_H 1 + +/* Define to 1 if you have the <kpathsea/kpathsea.h> header file. */ +#define HAVE_KPATHSEA_KPATHSEA_H 1 + +/* Define to 1 if your kpathsea has kpse_enc_format */ +#define HAVE_KPSE_ENC_FORMATS 1 + +/* Define to 1 if you have the `gd' library (-lgd). */ +#define HAVE_LIBGD 1 + +/* Define to 1 if you have the `gen' library (-lgen). */ +#undef HAVE_LIBGEN + +/* Define to 1 if you have the `kpathsea' library (-lkpathsea). */ +#define HAVE_LIBKPATHSEA 1 + +/* Define to 1 if you have the `m' library (-lm). */ +#define HAVE_LIBM 1 + +/* Define to 1 if you have the `png' library (-lpng). */ +#define HAVE_LIBPNG 1 + +/* Define to 1 if you have the `z' library (-lz). */ +#undef HAVE_LIBZ + +/* Define to 1 if your system has a GNU libc compatible `malloc' function, and + to 0 otherwise. */ +#undef HAVE_MALLOC + +/* Define to 1 if you have the <memory.h> header file. */ +#undef HAVE_MEMORY_H + +/* Define to 1 if you have the `memset' function. */ +#define HAVE_MEMSET 1 + +/* Define to 1 if you have a working `mmap' system call. */ +#undef HAVE_MMAP + +/* Define to 1 if you have the `munmap' function. */ +#undef HAVE_MUNMAP + +/* Define to 1 if you have the <png.h> header file. */ +#define HAVE_PNG_H 1 + +/* Define to 1 if you have the `pow' function. */ +#undef HAVE_POW + +/* Define to 1 if you have the `putenv' function. */ +#undef HAVE_PUTENV + +/* Define to 1 if stdbool.h conforms to C99. */ +#undef HAVE_STDBOOL_H 1 + +/* Define to 1 if you have the <stdint.h> header file. */ +#undef HAVE_STDINT_H + +/* Define to 1 if you have the <stdlib.h> header file. */ +#define HAVE_STDLIB_H 1 + +/* Define to 1 if you have the `strchr' function. */ +#define HAVE_STRCHR 1 + +/* Define to 1 if you have the <strings.h> header file. */ +#undef HAVE_STRINGS_H + +/* Define to 1 if you have the <string.h> header file. */ +#define HAVE_STRING_H 1 + +/* Define to 1 if you have the `strrchr' function. */ +#undef HAVE_STRRCHR + +/* Define to 1 if you have the `strstr' function. */ +#undef HAVE_STRSTR + +/* Define to 1 if you have the `strtol' function. */ +#undef HAVE_STRTOL + +/* Define to 1 if you have the <sys/stat.h> header file. */ +#define HAVE_SYS_STAT_H 1 + +/* Define to 1 if you have the <sys/time.h> header file. */ +#undef HAVE_SYS_TIME_H + +/* Define to 1 if you have the <sys/types.h> header file. */ +#undef HAVE_SYS_TYPES_H + +/* Define to 1 if you have <sys/wait.h> that is POSIX.1 compatible. */ +#undef HAVE_SYS_WAIT_H + +/* Define to 1 if you have the <unistd.h> header file. */ +#undef HAVE_UNISTD_H + +/* Define to 1 if you have the `vfork' function. */ +#undef HAVE_VFORK + +/* Define to 1 if you have the <vfork.h> header file. */ +#undef HAVE_VFORK_H + +/* Define to 1 if you have the `vprintf' function. */ +#define HAVE_VPRINTF 1 + +/* Define to 1 if `fork' works. */ +#undef HAVE_WORKING_FORK + +/* Define to 1 if `vfork' works. */ +#undef HAVE_WORKING_VFORK + +/* Define to 1 if the system has the type `_Bool'. */ +#undef HAVE__BOOL 1 + +/* Define to the address where bug reports for this package should be sent. */ +#define PACKAGE_BUGREPORT "dvipng@nongnu.org" + +/* Define to the full name of this package. */ +#define PACKAGE_NAME "dvipng" + +/* Define to the full name and version of this package. */ +#define PACKAGE_STRING "dvipng 1.7" + +/* Define to the one symbol short name of this package. */ +#define PACKAGE_TARNAME "dvipng" + +/* Define to the version of this package. */ +#define PACKAGE_VERSION "1.7" + +/* If using the C implementation of alloca, define if you know the + direction of stack growth for your system; otherwise it will be + automatically deduced at run-time. + STACK_DIRECTION > 0 => grows toward higher addresses + STACK_DIRECTION < 0 => grows toward lower addresses + STACK_DIRECTION = 0 => direction of growth unknown */ +#undef STACK_DIRECTION + +/* Define to 1 if you have the ANSI C header files. */ +#undef STDC_HEADERS + +/* Define to 1 if you can safely include both <sys/time.h> and <time.h>. */ +#undef TIME_WITH_SYS_TIME + +/* Define as 1 to get execution time output. */ +#undef TIMING + +/* Define to empty if `const' does not conform to ANSI C. */ +#undef const + +/* Define to `long long' if <inttypes.h> does not define it. */ +#undef int64_t + +/* Define to rpl_malloc if the replacement function should be used. */ +#undef malloc + +/* Define to `int' if <sys/types.h> does not define. */ +#undef pid_t + +/* Define to `unsigned' if <sys/types.h> does not define. */ +#undef size_t + +/* Define to `unsigned long long' if <inttypes.h> does not define it. */ +#undef uint64_t + +/* Define as `fork' if `vfork' does not work. */ +#undef vfork diff --git a/Build/source/texk/dvipng/dvipng-src/miktex.mak b/Build/source/texk/dvipng/dvipng-src/miktex.mak new file mode 100644 index 00000000000..b291ba67207 --- /dev/null +++ b/Build/source/texk/dvipng/dvipng-src/miktex.mak @@ -0,0 +1,196 @@ +## miktex.mak: dvipng +## +## Copyright (C) 2004 Christian Schenk <cs@miktex.org> +## +## This file is free software; you can redistribute it and/or modify +## it under the terms of the GNU General Public License as published +## by the Free Software Foundation; either version 2, or (at your +## option) any later version. +## +## This file is distributed in the hope that it will be useful, but +## WITHOUT ANY WARRANTY; without even the implied warranty of +## MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU +## General Public License for more details. +## +## You should have received a copy of the GNU General Public License +## along with this file; if not, write to the Free Software +## Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA +## 02110-1301 USA. + +miktex_cc_no_warnings = 1 +miktex_cc_disable_optimization = 1 + +!include ..\miktex.inc + +objects = \ + $(outdir)\color.obj \ + $(outdir)\draw.obj \ + $(outdir)\dvi.obj \ + $(outdir)\dvipng.obj \ + $(outdir)\font.obj \ + $(outdir)\misc.obj \ + $(outdir)\papersiz.obj \ + $(outdir)\pk.obj \ + $(outdir)\ppagelist.obj \ + $(outdir)\set.obj \ + $(outdir)\special.obj \ + $(outdir)\vf.obj \ + $(wrapper_obj) \ + +sources = \ + color.c \ + draw.c \ + dvi.c \ + dvipng.c \ + font.c \ + misc.c \ + papersiz.c \ + pk.c \ + ppagelist.c \ + set.c \ + special.c \ + vf.c \ + +extra_cdefines = \ + -Dalloca=_alloca \ + -DUSE_MIKTEX_EXIT \ + +extra_cincludes = \ + -I$(gdlibdir) \ + -I$(kpslibdir) \ + +.c{$(outdir)\}.obj: + $(cc) $(cstandard) \ + $(extra_cdefines) \ + $(extra_cincludes) \ + $(ccopt_output_directory)$(outdir)\ $< + +binaries = $(outdir)\dvipng.exe + +all: common-all $(binaries) + +install: common-install install-binaries + +qrt: common-qrt + +# ----------------------------------------------------------------------------- +# dvipng +# ----------------------------------------------------------------------------- + +libs = \ + $(miktex_lib) \ + $(gd_lib) \ + $(kps_lib) \ + $(gnu_lib) \ + $(texmf_lib) \ + +$(outdir)\dvipng.exe: \ + $(outdir) \ + $(objects) \ + $(libs) \ + $(outdir)\dvipng.res \ + + $(link) $(lstandard) \ + -out:$@ \ + $(objects) \ + $(libs) \ + $(outdir)\dvipng.res \ + +$(outdir)\dvipng.res: \ + $(libdir)\miktex-version.h \ + $(outdir) \ + dvipng-version.h \ + dvipng.rc \ + + $(rc) $(rcstandard) $(rcopt_output_file)$@ dvipng.rc + +# ----------------------------------------------------------------------------- +# clean-up +# ----------------------------------------------------------------------------- + +mostlyclean: common-mostlyclean + +clean: common-clean mostlyclean + +distclean: common-distclean clean + +realclean: common-realclean distclean + +# ----------------------------------------------------------------------------- +# dependencies +# ----------------------------------------------------------------------------- + +!include ..\common-dependencies.inc + +depend: $(sources) + $(MAKEDEPEND1) $(extra_cincludes) $(extra_cdefines) $(sources) + +# DO NOT DELETE + +$(outdir)\color.obj: dvipng.h config.h .\inttypes.h $(gdlibdir)\gd.h +$(outdir)\color.obj: $(gdlibdir)\gd_io.h $(gdlibdir)\gdfx.h +$(outdir)\color.obj: $(kpslibdir)\kpathsea\kpathsea.h +$(outdir)\color.obj: $(kpslibdir)\web2c-miktex.h ..\lib\miktex.h +$(outdir)\color.obj: ..\lib\miktex-features.h commands.h +$(outdir)\draw.obj: dvipng.h config.h .\inttypes.h $(gdlibdir)\gd.h +$(outdir)\draw.obj: $(gdlibdir)\gd_io.h $(gdlibdir)\gdfx.h +$(outdir)\draw.obj: $(kpslibdir)\kpathsea\kpathsea.h +$(outdir)\draw.obj: $(kpslibdir)\web2c-miktex.h ..\lib\miktex.h +$(outdir)\draw.obj: ..\lib\miktex-features.h commands.h +$(outdir)\dvi.obj: dvipng.h config.h .\inttypes.h $(gdlibdir)\gd.h +$(outdir)\dvi.obj: $(gdlibdir)\gd_io.h $(gdlibdir)\gdfx.h +$(outdir)\dvi.obj: $(kpslibdir)\kpathsea\kpathsea.h +$(outdir)\dvi.obj: $(kpslibdir)\web2c-miktex.h ..\lib\miktex.h +$(outdir)\dvi.obj: ..\lib\miktex-features.h commands.h ..\libgnu\gnu-miktex.h +$(outdir)\dvipng.obj: dvipng.h config.h .\inttypes.h +$(outdir)\dvipng.obj: $(gdlibdir)\gd.h $(gdlibdir)\gd_io.h +$(outdir)\dvipng.obj: $(gdlibdir)\gdfx.h +$(outdir)\dvipng.obj: $(kpslibdir)\kpathsea\kpathsea.h +$(outdir)\dvipng.obj: $(kpslibdir)\web2c-miktex.h ..\lib\miktex.h +$(outdir)\dvipng.obj: ..\lib\miktex-features.h commands.h +$(outdir)\font.obj: dvipng.h config.h .\inttypes.h $(gdlibdir)\gd.h +$(outdir)\font.obj: $(gdlibdir)\gd_io.h $(gdlibdir)\gdfx.h +$(outdir)\font.obj: $(kpslibdir)\kpathsea\kpathsea.h +$(outdir)\font.obj: $(kpslibdir)\web2c-miktex.h ..\lib\miktex.h +$(outdir)\font.obj: ..\lib\miktex-features.h commands.h +$(outdir)\misc.obj: dvipng.h config.h .\inttypes.h $(gdlibdir)\gd.h +$(outdir)\misc.obj: $(gdlibdir)\gd_io.h $(gdlibdir)\gdfx.h +$(outdir)\misc.obj: $(kpslibdir)\kpathsea\kpathsea.h +$(outdir)\misc.obj: $(kpslibdir)\web2c-miktex.h ..\lib\miktex.h +$(outdir)\misc.obj: ..\lib\miktex-features.h commands.h +$(outdir)\misc.obj: ..\libgnu\gnu-miktex.h +$(outdir)\papersiz.obj: dvipng.h config.h .\inttypes.h +$(outdir)\papersiz.obj: $(gdlibdir)\gd.h +$(outdir)\papersiz.obj: $(gdlibdir)\gd_io.h +$(outdir)\papersiz.obj: $(gdlibdir)\gdfx.h +$(outdir)\papersiz.obj: $(kpslibdir)\kpathsea\kpathsea.h +$(outdir)\papersiz.obj: $(kpslibdir)\web2c-miktex.h ..\lib\miktex.h +$(outdir)\papersiz.obj: ..\lib\miktex-features.h commands.h +$(outdir)\pk.obj: dvipng.h config.h .\inttypes.h $(gdlibdir)\gd.h +$(outdir)\pk.obj: $(gdlibdir)\gd_io.h $(gdlibdir)\gdfx.h +$(outdir)\pk.obj: $(kpslibdir)\kpathsea\kpathsea.h +$(outdir)\pk.obj: $(kpslibdir)\web2c-miktex.h ..\lib\miktex.h +$(outdir)\pk.obj: ..\lib\miktex-features.h commands.h +$(outdir)\ppagelist.obj: dvipng.h config.h .\inttypes.h +$(outdir)\ppagelist.obj: $(gdlibdir)\gd.h +$(outdir)\ppagelist.obj: $(gdlibdir)\gd_io.h +$(outdir)\ppagelist.obj: $(gdlibdir)\gdfx.h +$(outdir)\ppagelist.obj: $(kpslibdir)\kpathsea\kpathsea.h +$(outdir)\ppagelist.obj: $(kpslibdir)\web2c-miktex.h ..\lib\miktex.h +$(outdir)\ppagelist.obj: ..\lib\miktex-features.h commands.h +$(outdir)\set.obj: dvipng.h config.h .\inttypes.h $(gdlibdir)\gd.h +$(outdir)\set.obj: $(gdlibdir)\gd_io.h $(gdlibdir)\gdfx.h +$(outdir)\set.obj: $(kpslibdir)\kpathsea\kpathsea.h +$(outdir)\set.obj: $(kpslibdir)\web2c-miktex.h ..\lib\miktex.h +$(outdir)\set.obj: ..\lib\miktex-features.h commands.h +$(outdir)\special.obj: dvipng.h config.h .\inttypes.h +$(outdir)\special.obj: $(gdlibdir)\gd.h $(gdlibdir)\gd_io.h +$(outdir)\special.obj: $(gdlibdir)\gdfx.h +$(outdir)\special.obj: $(kpslibdir)\kpathsea\kpathsea.h +$(outdir)\special.obj: $(kpslibdir)\web2c-miktex.h ..\lib\miktex.h +$(outdir)\special.obj: ..\lib\miktex-features.h commands.h +$(outdir)\vf.obj: dvipng.h config.h .\inttypes.h $(gdlibdir)\gd.h +$(outdir)\vf.obj: $(gdlibdir)\gd_io.h $(gdlibdir)\gdfx.h +$(outdir)\vf.obj: $(kpslibdir)\kpathsea\kpathsea.h +$(outdir)\vf.obj: $(kpslibdir)\web2c-miktex.h ..\lib\miktex.h +$(outdir)\vf.obj: ..\lib\miktex-features.h commands.h diff --git a/Build/source/texk/dvipng/dvipng-src/misc.c b/Build/source/texk/dvipng/dvipng-src/misc.c new file mode 100644 index 00000000000..01bd94d33a7 --- /dev/null +++ b/Build/source/texk/dvipng/dvipng-src/misc.c @@ -0,0 +1,848 @@ +/* misc.c */ + +/************************************************************************ + + Part of the dvipng distribution + + This program is free software: you can redistribute it and/or modify + it under the terms of the GNU Lesser General Public License as + published by the Free Software Foundation, either version 3 of the + License, or (at your option) any later version. + + This program is distributed in the hope that it will be useful, but + WITHOUT ANY WARRANTY; without even the implied warranty of + MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU + Lesser General Public License for more details. + + You should have received a copy of the GNU Lesser General Public + License along with this program. If not, see + <http://www.gnu.org/licenses/>. + + Copyright (C) 2002-2015, 2019 Jan-Åke Larsson + +************************************************************************/ + +#include "dvipng.h" +#ifdef HAVE_LIBGEN_H +# include <libgen.h> +#endif +#include <fcntl.h> /* open/close */ +#ifdef HAVE_MMAP +#include <sys/mman.h> +#endif +#include <sys/stat.h> + +#if defined _WIN32 && !defined __CYGWIN__ && !defined __CYGWIN32__ + /* Use Windows separators on all _WIN32 defining + environments, except Cygwin. */ +# define DIR_SEPARATOR_CHAR '\\' +#endif +#ifndef DIR_SEPARATOR_CHAR +# define DIR_SEPARATOR_CHAR '/' +#endif /* !DIR_SEPARATOR_CHAR */ + +static char *programname; + +/*-->DecodeArgs*/ +/*********************************************************************/ +/***************************** DecodeArgs ****************************/ +/*********************************************************************/ +bool DecodeArgs(int argc, char ** argv) +{ + int i; /* argument index for options */ + bool ppused=false; /* Flag when -pp is used */ + int32_t number; /* Temporary storage for numeric parameter */ + char *dviname=NULL; /* Name of dvi file */ + char *outname=NULL; /* Name of output file */ + + programname=PACKAGE_NAME; + if (argv[0]) { +#ifdef HAVE_GDIMAGEGIF + programname=strrchr(argv[0],DIR_SEPARATOR_CHAR); + if (programname!=NULL) + programname++; + else + programname=argv[0]; + if (strncasecmp(programname,"dvigif",6)==0) + option_flags |= GIF_OUTPUT; +#endif + programname=argv[0]; + } + Message(BE_NONQUIET,"This is %s",programname); + if (option_flags & GIF_OUTPUT) + Message(BE_NONQUIET," (%s)", PACKAGE_NAME); + Message(BE_NONQUIET," %s Copyright 2002-2015, 2019 Jan-Ake Larsson\n", + PACKAGE_VERSION); + + for (i=1; i<argc; i++) { + if (*argv[i]=='-') { + char *p=argv[i]+2 ; + char c=argv[i][1] ; + if (c=='-') { + p++; + c=argv[i][2]; + } + switch (c) { + case 'd': /* selects Debug output */ + if (*p>'9' && *p!='-') { + if (strncmp(p,"vinum",5)==0) { + if (p[5] != '0') { + option_flags |= DVI_PAGENUM; + Message(PARSE_STDIN,"DVI page number output on\n",p); + } else { + option_flags &= ~DVI_PAGENUM; + Message(PARSE_STDIN,"DVI page number output off\n"); + } + break; + } else if (strncmp(p,"epth",4)==0) { /* Depth reporting */ + if (p[4] != '0') { + option_flags |= REPORT_DEPTH; + Message(PARSE_STDIN,"Depth reporting on\n",p); + } else { + option_flags &= ~REPORT_DEPTH; + Message(PARSE_STDIN,"Depth reporting off\n"); + } + break; + } + goto DEFAULT; + } else { +#ifdef DEBUG + if (*p == 0 && argv[i+1]) + p = argv[i+1]; + debug = atoi(p); + if (debug > 0) { + if (p == argv[i+1]) i++; + } else + debug = DEBUG_DEFAULT; + Message(PARSE_STDIN,"Debug output enabled\n"); +#ifdef HAVE_LIBKPATHSEA + kpathsea_debug = debug / LASTDEBUG / 2 ; +#endif +#else + Warning("This instance of %s was compiled without the debug (-d) option", + programname); +#endif + break; + } + case 'o': /* Output file is specified */ + if (*p == 0 && argv[i+1]) + p = argv[++i] ; + outname=p; + /* remove .png extension */ + Message(PARSE_STDIN,"Output file: %s\n", + outname); + break; +#ifdef MAKETEXPK + case 'M': + /* -M, -M1 => don't make font; -M0 => do. */ + makeTexPK = (*p == '0'); +#ifdef HAVE_LIBKPATHSEA + kpse_set_program_enabled (kpse_pk_format, makeTexPK, kpse_src_cmdline); +#endif + if (makeTexPK) + Message(PARSE_STDIN,"MakeTeXPK enabled\n"); + else + Message(PARSE_STDIN,"MakeTeXPK disabled\n"); + break; +#endif /* MAKETEXPK */ + case 'm': + if (strcmp(p,"ode") == 0 ) { + if (argv[i+1]) + user_mfmode = argv[++i] ; + Message(PARSE_STDIN,"MetaFont mode: %s\n",user_mfmode); + break; + } + goto DEFAULT; + case 'h': + if (strcmp(p,"elp") == 0 ) { + break; + } else if (strncmp(p,"eight",5) == 0 ) { /* Height reporting */ + if (p[5] != '0') { + option_flags |= REPORT_HEIGHT; + Message(PARSE_STDIN,"Height reporting on\n",p); + } else { + option_flags &= ~REPORT_HEIGHT; + Message(PARSE_STDIN,"Height reporting off\n"); + } + break; + } + goto DEFAULT; + case 'O' : /* Offset */ + if (*p == 0 && argv[i+1]) + p = argv[++i] ; + handlepapersize(p, &x_offset_def, &y_offset_def) ; + Message(PARSE_STDIN,"Offset: (%d,%d)\n",x_offset_def,y_offset_def); + break ; + case 'e': + if (strncmp(p,"xpand-bbox",10) == 0 ) { + if (p[10] != '0') { + option_flags |= EXPAND_BBOX; + Message(PARSE_STDIN,"BBox expansion on\n",p); + } else { + option_flags &= ~EXPAND_BBOX; + Message(PARSE_STDIN,"BBox expansion off\n"); + } + break; + } + goto DEFAULT; + case 'T' : + if (*p == 0 && argv[i+1]) + p = argv[++i]; + if (strcmp(p,"bbox")==0) { + x_width_def=0; + y_width_def=0; + Message(PARSE_STDIN,"Pagesize: (bbox)\n"); + } else if (strcmp(p,"tight")==0) { + x_width_def=-1; + y_width_def=-1; + Message(PARSE_STDIN,"Pagesize: (tight bbox)\n"); + } else { + handlepapersize(p, &x_width_def, &y_width_def) ; + Message(PARSE_STDIN,"Pagesize: (%d,%d)\n", + x_width_def,y_width_def); + } + break ; + case 't': /* specify paper format, only for cropmarks */ +#ifdef HAVE_GDIMAGECREATETRUECOLOR + /* Truecolor */ + if (strncmp(p,"ruecolor",8)==0) { + if (p[8] != '0') { + option_flags |= FORCE_TRUECOLOR; + Message(PARSE_STDIN,"Truecolor mode on\n",p); + } else { + option_flags &= ~FORCE_TRUECOLOR; + Message(PARSE_STDIN,"Truecolor mode off\n"); + } + } else +#endif + { /* cropmarks not implemented yet */ + if (*p == 0 && argv[i+1]) + p = argv[++i] ; + if (strcmp(p,"a4")==0) { + handlepapersize("210mm,297mm",&x_pwidth,&y_pwidth); + } else if (strcmp(p,"letter")==0) { + handlepapersize("8.5in,11in",&x_pwidth,&y_pwidth); + } else if (strcmp(p,"legal")==0) { + handlepapersize("8.5in,14in",&x_pwidth,&y_pwidth); + } else if (strcmp(p,"executive")==0) { + handlepapersize("7.25in,10.5in",&x_pwidth,&y_pwidth); + } else + Fatal("papersize %s is not implemented",p); + Message(PARSE_STDIN,"Papersize: %s\n",p); + } + break; +/* case 'c': */ +/* if (strncmp(p,"acheimages",10)==0) { */ +/* if (p[10] != '0') { */ +/* option_flags |= CACHE_IMAGES; */ +/* Message(PARSE_STDIN,"Caching images\n",p); */ +/* } else { */ +/* option_flags &= ~CACHE_IMAGES; */ +/* Message(PARSE_STDIN,"Not caching images\n"); */ +/* } */ +/* break; */ +/* } */ +/* goto DEFAULT; */ + case 'b': + if ( *p == 'g' ) { /* -bg background color */ + p++; + if (*p == 0 && argv[i+1]) + p = argv[++i] ; + if (strncmp(p,"Transparent",11) == 0 ) + option_flags |= BG_TRANSPARENT_ALPHA; + else if (strncmp(p,"transparent",11) == 0 ) + option_flags |= BG_TRANSPARENT; + else + background(p); + if (option_flags & BG_TRANSPARENT) + Message(PARSE_STDIN,"Transp. background (fallback rgb %d,%d,%d)\n", + cstack[0].red,cstack[0].green,cstack[0].blue); + else + Message(PARSE_STDIN,"Background: rgb %d,%d,%d\n", + cstack[0].red,cstack[0].green,cstack[0].blue); + break; + } else if (strcmp(p, "dpi")==0) { + p+=3; + if (*p == 0 && argv[i+1]) + p = argv[++i]; + number = atoi(p); + if (number < 10 || number > 10000) + Warning("Bad --bdpi parameter, ignored"); + else { + user_bdpi=number; + Message(PARSE_STDIN,"Bdpi: %d\n",user_bdpi); + } + break; + } else if ( *p == 'd' ) { /* -bd border width */ + int tmpi; + char* tmps; + p++; + if (*p == 0 && argv[i+1]) + p = argv[++i] ; + tmpi = strtol(p, &tmps, 10); + if (p<tmps) { + borderwidth=tmpi; + Message(PARSE_STDIN,"Transp. border: %d dots\n",borderwidth); + } + if (*tmps) { + stringrgb(tmps, &bordercolor.red, &bordercolor.green, &bordercolor.blue); + userbordercolor=TRUE; + if (borderwidth==0) { + borderwidth=1; + Message(PARSE_STDIN,"Transp. border: %d dots\n",borderwidth); + } + Message(PARSE_STDIN,"Transp. border: rgb %d,%d,%d\n", + bordercolor.red, bordercolor.green, bordercolor.blue); + } + break; + } + goto DEFAULT; + case 'f': + if ( *p == 'g' ) { /* -fg foreground color */ + p++; + if (*p == 0 && argv[i+1]) + p = argv[++i] ; + resetcolorstack(p); + Message(PARSE_STDIN,"Foreground: rgb %d,%d,%d\n", + cstack[1].red,cstack[1].green,cstack[1].blue); + break; +#ifdef HAVE_FT2 + } else if ( strncmp(p,"reetype",7) == 0 ) { /* -freetype activation */ + if (p[7] != '0') { + option_flags |= USE_FREETYPE; + Message(PARSE_STDIN,"FreeType rendering on\n",p); + } else { + option_flags &= ~USE_FREETYPE; + Message(PARSE_STDIN,"FreeType rendering off\n"); + } + break; +#endif + } else if (strcmp(p,"ollow") == 0 ) { + if (DVIFollowToggle()) + Message(PARSE_STDIN,"Follow mode on\n"); + else + Message(PARSE_STDIN,"Follow mode off\n"); + break; + } + goto DEFAULT; + case 'x' : case 'y' : + if (*p == 0 && argv[i+1]) + p = argv[++i] ; + number = atoi(p); + if (number < 1 || number > 1000000) + Warning("Bad magnification parameter (-x or -y), ignored"); + else { + usermag=number; + Message(PARSE_STDIN,"Magstep: %d\n",usermag); + /*overridemag = (c == 'x' ? 1 : -1) ;*/ + } + break ; + case 'g' : + if (strncmp(p,"amma",4)==0) { /* --gamma correction */ + double gamma=0.0; + + p+=4; + if (*p == 0 && argv[i+1]) + p = argv[++i]; + if (p!=NULL) + gamma=atof(p); + if (gamma==0.0) { + Warning("Bad gamma value, default is %f",DEFAULT_GAMMA); + gamma=DEFAULT_GAMMA; + } + Gamma(gamma); + Message(PARSE_STDIN,"Gamma value is %f\n", gamma); + break; +#ifdef HAVE_GDIMAGEGIF + } else if (strncmp(p,"if",2)==0) { /* --gif output */ + option_flags |= GIF_OUTPUT; + Message(PARSE_STDIN,"GIF output\n"); + break; +#endif + } + goto DEFAULT; + case 'p' : + if (*p == 'p') { /* a -pp specifier for a page list */ + ppused=true; + p++ ; + if (*p == 0 && argv[i+1]) + p = argv[++i]; + Message(PARSE_STDIN,"Page list: %s\n",p); + if (ParsePages(p)) + Fatal("bad page list specifier (-pp)"); + } else if (strncmp(p,"ng",2)==0) { /* --png output */ + option_flags &= ~GIF_OUTPUT; + Message(PARSE_STDIN,"PNG output\n"); + } else if (strncmp(p,"icky",4)==0) { + if (p[4] != '0') { + option_flags |= MODE_PICKY; + Message(PARSE_STDIN,"No images output for pages with warnings\n",p); + } else { + option_flags &= ~MODE_PICKY; + Message(PARSE_STDIN,"Images output even for pages with warnings\n"); + } + } else if (strncmp(p,"alette",6)==0) { + if (p[6] != '0') { + option_flags |= FORCE_PALETTE; + Message(PARSE_STDIN,"Forcing 256-color PNG output\n",p); + } else { + option_flags &= ~FORCE_PALETTE; + Message(PARSE_STDIN,"Allows truecolor PNG output\n"); + } + } else { /* a -p specifier for first page */ + int32_t firstpage; + bool abspage=false; + + if (*p == 0 && argv[i+1]) + p = argv[++i] ; + if (*p == '=') { + abspage=true; + p++ ; + } + if ((*p>='0'&&*p<='9') || (*p=='-' && *(p+1)>='0' && *(p+1)<='9')) { + firstpage = atoi(p); + FirstPage(firstpage,abspage); + Message(PARSE_STDIN,"First page: %d\n",firstpage); + } else + Warning("Bad firstpage (-p) parameter, ignored"); + } + break ; + case 's' : + if (strncmp(p,"trict",5)==0) { + if (p[5] != '0') { + option_flags |= MODE_STRICT; + Message(PARSE_STDIN,"Warnings are fatal\n",p); + } else { + option_flags &= ~MODE_STRICT; + Message(PARSE_STDIN,"Warnings are not fatal\n"); + } + } else + goto DEFAULT; + break ; + case 'n' : + if (strncmp(p,"oghostscript",12)==0) { + if (p[12] != '0') { + option_flags |= NO_GHOSTSCRIPT; + Message(PARSE_STDIN,"No GhostScript calls\n",p); + } else { + option_flags &= ~NO_GHOSTSCRIPT; + Message(PARSE_STDIN,"GhostScript calls made\n"); + } + } else if (strncmp(p,"ogssafer",8)==0) { + if (p[8] != '0') { + option_flags |= NO_GSSAFER; + Message(PARSE_STDIN,"GhostScript calls does not use -dSAFER\n",p); + } else { + option_flags &= ~NO_GSSAFER; + Message(PARSE_STDIN,"GhostScript calls use -dSAFER\n"); + } + } else if (strncmp(p,"ogs",3)==0) { + if (p[3] != '0') { + option_flags |= NO_GHOSTSCRIPT; + Message(PARSE_STDIN,"No GhostScript calls\n",p); + } else { + option_flags &= ~NO_GHOSTSCRIPT; + Message(PARSE_STDIN,"GhostScript calls made\n"); + } + } else if (strncmp(p,"orawps",6)==0) { + if (p[6] != '0') { + option_flags |= NO_RAW_PS; + Message(PARSE_STDIN,"Conversion of raw PostScript will not be attempted\n",p); + } else { + option_flags &= ~NO_RAW_PS; + Message(PARSE_STDIN,"Conversion of raw PostScript will be attempted\n",p); + } + } else + goto DEFAULT; + break ; + case 'l': + { + int32_t lastpage; + bool abspage=false; + + if (*p == 0 && argv[i+1]) + p = argv[++i] ; + if (*p == '=') { + abspage=true; + p++ ; + } + if ((*p>='0'&&*p<='9') || (*p=='-' && *(p+1)>='0' && *(p+1)<='9')) { + lastpage = atoi(p); + LastPage(lastpage,abspage); + Message(PARSE_STDIN,"Last page: %d\n",lastpage); + } else + Warning("Bad lastpage (-l) parameter, ignored"); + } + break ; + case 'q': /* quiet operation */ + if (*p != '0') + option_flags &= (~BE_NONQUIET & ~BE_VERBOSE); + else + option_flags |= BE_NONQUIET; + break; + case 'r': /* process pages in reverse order */ + if (*p != '0') { + Message(PARSE_STDIN,"Reverse order\n"); + Reverse(true); + } else { + Message(PARSE_STDIN,"Normal order\n"); + Reverse(false); + } + break; + case 'v': /* verbatim mode */ + if (strcmp(p, "ersion")==0) { + puts(PACKAGE_STRING); +#ifdef HAVE_LIBKPATHSEA + puts (KPSEVERSION); +#endif +#ifdef HAVE_FT2 + printf("Compiled with Freetype %d.%d.%d\n", + FREETYPE_MAJOR, FREETYPE_MINOR, FREETYPE_PATCH); +# ifdef HAVE_FT_LIBRARY_VERSION + if (FT_Init_FreeType( &libfreetype )) + Warning("the Freetype library seems unusable"); + else { + FT_Int amajor, aminor, apatch; + + FT_Library_Version( libfreetype, &amajor, &aminor, &apatch ); + printf("Using libft %d.%d.%d\n",amajor, aminor, apatch); + FT_Done_FreeType(libfreetype); + } +# endif +#endif + puts ("Copyright (C) 2002-2015, 2019 Jan-Ake Larsson.\n\ +There is NO warranty. You may redistribute this software\n\ +under the terms of the GNU Lesser General Public License\n\ +version 3, see the COPYING file in the dvipng distribution\n\ +or <http://www.gnu.org/licenses/>."); + exit (EXIT_SUCCESS); + } + if (*p != '0') + option_flags |= BE_NONQUIET | BE_VERBOSE; + else + option_flags &= ~BE_VERBOSE; + break; + case 'D' : + if (*p == 0 && argv[i+1]) + p = argv[++i] ; + number = atoi(p); + if (number < 10 || number > 10000) + Warning("Bad resolution (-D) parameter, ignored") ; + else { + dpi=number; + Message(PARSE_STDIN,"Dpi: %d\n",dpi); + } + break; + case 'Q': /* quality (= shrinkfactor) */ + if (*p == 0 && argv[i+1]) + p = argv[++i]; + if (*p>='0'&&*p<='9') { + shrinkfactor = atoi(p); + Message(PARSE_STDIN,"Quality: %d\n",shrinkfactor); + } else { + Warning("Non-numeric quality (-Q) value, ignored"); + } + break; + case 'w': + if (strncmp(p,"idth",4) == 0 ) { /* Width reporting */ + if (p[4] != '0') { + option_flags |= REPORT_WIDTH; + Message(PARSE_STDIN,"Width reporting on\n",p); + } else { + option_flags &= ~REPORT_WIDTH; + Message(PARSE_STDIN,"Width reporting off\n"); + } + break; + } + goto DEFAULT; +#ifdef HAVE_GDIMAGEPNGEX + case 'z': + if (*p == 0 && argv[i+1]) + p = argv[++i]; + number = atoi(p); + if (number<1 || number>9) + Warning("Bad compression (-z) value, ignored"); + else { + compression=number; + Message(PARSE_STDIN,"Compression: %d\n",shrinkfactor); + } + break; +#endif + case '\0': + option_flags |= PARSE_STDIN; + break; + DEFAULT: default: + Warning("%s is not a valid option", argv[i]); + } + } else { + dviname=argv[i]; + } + } + if (dviname != NULL) { + if (dvi != NULL && dvi->filep != NULL) + DVIClose(dvi); + dvi=DVIOpen(dviname,outname); + } + + if (dvi==NULL) { + fprintf(stdout,"\nUsage: %s [OPTION]... FILENAME[.dvi]\n", programname); + fprintf(stdout,"Options are chosen to be similar to dvips' options where possible:\n"); +#ifdef DEBUG + fprintf(stdout," -d # Debug (# is the debug bitmap, 1 if not given)\n"); +#endif + fprintf(stdout," -D # Output resolution\n"); + fprintf(stdout," -l # Last page to be output\n"); + fprintf(stdout," -o f Output file, '%%d' is pagenumber\n"); + fprintf(stdout," -O c Image offset\n"); + fprintf(stdout," -p # First page to be output\n"); + fprintf(stdout," -pp #,#.. Page list to be output\n"); + fprintf(stdout," -q* Quiet operation\n"); + fprintf(stdout," -T c Image size (also accepts '-T bbox' and '-T tight')\n"); + fprintf(stdout," -v* Verbose operation\n"); + fprintf(stdout," - Interactive query of options\n"); + fprintf(stdout,"\nThese do not correspond to dvips options:\n"); + fprintf(stdout," -bd # Transparent border width in dots\n"); + fprintf(stdout," -bd s Transparent border fallback color (TeX-style color)\n"); + fprintf(stdout," -bg s Background color (TeX-style color or 'Transparent')\n"); + fprintf(stdout," --depth* Output the image depth on stdout\n"); + fprintf(stdout," --dvinum* Use TeX page numbers in output filenames\n"); + fprintf(stdout," -fg s Foreground color (TeX-style color)\n"); + fprintf(stdout," --follow* Wait for data at end-of-file\n"); +#ifdef HAVE_FT2 + fprintf(stdout," --freetype* FreeType font rendering (preferred, default on)\n"); +#endif + fprintf(stdout," --gamma # Control color interpolation\n"); +#ifdef HAVE_GDIMAGEGIF + fprintf(stdout," --gif Output GIF images (dvigif default)\n"); +#endif + fprintf(stdout," --height* Output the image height on stdout\n"); + fprintf(stdout," --nogs* Don't use ghostscript for PostScript specials\n"); + fprintf(stdout," --nogssafer* Don't use -dSAFER in ghostscript calls\n"); + fprintf(stdout," --norawps* Don't convert raw PostScript specials\n"); +#ifdef HAVE_GDIMAGECREATETRUECOLOR + fprintf(stdout," --palette* Force palette output\n"); +#endif + fprintf(stdout," --picky When a warning occurs, don't output image\n"); +#ifdef HAVE_GDIMAGEGIF + fprintf(stdout," --png Output PNG images (dvipng default)\n"); +#endif + fprintf(stdout," --strict When a warning occurs, exit\n"); +#ifdef HAVE_GDIMAGECREATETRUECOLOR + fprintf(stdout," --truecolor* Truecolor output\n"); +#endif + fprintf(stdout," -Q # Quality (PK subsampling)\n"); + fprintf(stdout," --width* Output the image width on stdout\n"); +#ifdef HAVE_GDIMAGEPNGEX + fprintf(stdout," -z # PNG compression level\n"); +#endif + + fprintf(stdout,"\n # = number f = file s = string * = suffix, '0' to turn off\n"); + fprintf(stdout," c = comma-separated dimension pair (e.g., 3.2in,-32.1cm)\n\n"); + /*#ifdef HAVE_LIBKPATHSEA + { + extern DllImport char *kpse_bug_address; + putc ('\n', stdout); + fputs (kpse_bug_address, stdout); + } + #endif*/ + if ((option_flags & PARSE_STDIN) == 0) { + exit(EXIT_SUCCESS); + } + } + if ((option_flags & PARSE_STDIN) == 0 && (!ppused)) + ParsePages("-"); + return((option_flags & PARSE_STDIN) != 0); +} + +void DecodeString(char *string) +{ +#define PARSEARGS 10 + char *strv[PARSEARGS]; + int strc=1; + strv[0]=NULL; /* No program name */ + + while (*string==' ' || *string=='\t' || *string=='\r' || *string=='\n') + string++; + while (*string!='\0') { + strv[strc++]=string; + if (*string!='\'') { + /* Normal split at whitespace */ + while (*string!=' ' && *string!='\t' \ + && *string!='\n' && *string!='\r' && *string!='\0') + string++; + } else { + /* String delimiter found , so search for next */ + strv[strc-1]=++string; + while (*string!='\'' && *string!='\0') + string++; + } + if (*string!='\0') + *string++='\0'; + while (*string==' ' || *string=='\t' || *string=='\r' || *string=='\n') + string++; + } + if (strc>1) /* Nonempty */ + (void) DecodeArgs(strc,strv); +} + + + +uint32_t UNumRead(unsigned char* current, register int n) +{ + uint32_t x = (unsigned char) *(current)++; /* number being constructed */ + while(--n) + x = (x << 8) | *(current)++; + return(x); +} + +int32_t SNumRead(unsigned char* current, register int n) +{ + int32_t x = (signed char) *(current)++; /* number being constructed */ + while(--n) + x = (x << 8) | *(current)++; + return(x); +} + + +/**********************************************************************/ +/****************************** Fatal *******************************/ +/**********************************************************************/ +void Fatal (const char *fmt, ...) +{ + va_list args; + + va_start(args, fmt); + fflush(stdout); + fprintf(stderr, "\n"); + fprintf(stderr, "%s: Fatal error, ", programname); + vfprintf(stderr, fmt, args); + + fprintf(stderr, "\n\n"); + va_end(args); + + ClearFonts(); +#ifdef HAVE_FT2 + if (libfreetype) + (void) FT_Done_FreeType(libfreetype); /* at this point, ignore error */ +#endif + exit(EXIT_FATAL); +} + +/*-->Warning*/ +/**********************************************************************/ +/***************************** Warning ******************************/ +/**********************************************************************/ +void Warning(const char *fmt, ...) +{ + va_list args; + + va_start(args, fmt); + + if ( option_flags & BE_NONQUIET ) { + fflush(stdout); + fprintf(stderr, "%s warning: ", programname); + vfprintf(stderr, fmt, args); + fprintf(stderr, " "); + } + va_end(args); +} + +/*-->Message*/ +/**********************************************************************/ +/***************************** Message ******************************/ +/**********************************************************************/ +void Message(int activeflags, const char *fmt, ...) +{ + va_list args; + + va_start(args, fmt); + if ( option_flags & activeflags ) { + vfprintf(stdout, fmt, args); + } + va_end(args); +} + + +bool MmapFile (char *filename,struct filemmap *fmmap) +{ +#ifndef WIN32 + struct stat stat; +#endif + + DEBUG_PRINT(DEBUG_DVI,("\n OPEN FILE:\t'%s'", filename)); + fmmap->data=NULL; +#ifndef WIN32 + if ((fmmap->fd = open(filename,O_RDONLY)) == -1) { + Warning("cannot open file <%s>", filename); + return(true); + } + fstat(fmmap->fd,&stat); + fmmap->size=stat.st_size; +# ifdef HAVE_MMAP + fmmap->data = mmap(NULL,fmmap->size, PROT_READ, MAP_SHARED,fmmap->fd,0); + if (fmmap->data == (char*)-1) { + Warning("cannot mmap file <%s>",filename); + fmmap->data=NULL; + close(fmmap->fd); + return(true); + } +# else /* HAVE_MMAP */ + if ((fmmap->data = malloc(fmmap->size+1)) == NULL) { + Warning("cannot malloc space for <%s>",filename); + close(fmmap->fd); + return(true); + } + if (read(fmmap->fd,fmmap->data,fmmap->size)<fmmap->size) { + Warning("too little data in <%s>",filename); + free(fmmap->data); + fmmap->data=NULL; + close(fmmap->fd); + return(true); + } + close(fmmap->fd); +# endif /* HAVE_MMAP */ +#else /* WIN32 */ + fmmap->hFile = CreateFile(filename, GENERIC_READ, FILE_SHARE_READ, 0, + OPEN_EXISTING, FILE_FLAG_RANDOM_ACCESS, 0); + if (fmmap->hFile == INVALID_HANDLE_VALUE) { + Warning("cannot open file <%s>", filename); + return(true); + } + fmmap->size = GetFileSize(fmmap->hFile, 0); + fmmap->hMap = CreateFileMapping(fmmap->hFile, 0, PAGE_READONLY, 0, 0, 0); + if (fmmap->hMap == 0) { + CloseHandle (fmmap->hFile); + Warning("cannot CreateFileMapping() file <%s>", filename); + return(true); + } + fmmap->data = MapViewOfFile(fmmap->hMap, FILE_MAP_READ, 0, 0, 0); + if (fmmap->data == NULL) { + Warning("cannot MapViewOfFile() file <%s>", filename); + CloseHandle (fmmap->hMap); + CloseHandle (fmmap->hFile); + return(true); + } +#endif /* WIN32 */ + return(false); +} + +void UnMmapFile(struct filemmap* fmmap) +{ + if (fmmap->data!=NULL) { +#ifndef WIN32 +# ifdef HAVE_MMAP + if (munmap(fmmap->data,fmmap->size)) + Warning("cannot munmap file at 0x%X",fmmap->data); + if (close(fmmap->fd)) + Warning("cannot close file descriptor %d",fmmap->fd); +# else /* HAVE_MMAP */ + free(fmmap->data); +# endif /* HAVE_MMAP */ +#else /* WIN32 */ + UnmapViewOfFile (fmmap->data); + CloseHandle (fmmap->hMap); + CloseHandle (fmmap->hFile); +#endif /* WIN32 */ + } + fmmap->data=NULL; +} diff --git a/Build/source/texk/dvipng/dvipng-src/papersiz.c b/Build/source/texk/dvipng/dvipng-src/papersiz.c new file mode 100644 index 00000000000..6f5e99794d2 --- /dev/null +++ b/Build/source/texk/dvipng/dvipng-src/papersiz.c @@ -0,0 +1,74 @@ +/* papersiz.c */ + +/************************************************************************ + + Part of the dvipng distribution + + This program is free software: you can redistribute it and/or modify + it under the terms of the GNU Lesser General Public License as + published by the Free Software Foundation, either version 3 of the + License, or (at your option) any later version. + + This program is distributed in the hope that it will be useful, but + WITHOUT ANY WARRANTY; without even the implied warranty of + MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU + Lesser General Public License for more details. + + You should have received a copy of the GNU Lesser General Public + License along with this program. If not, see + <http://www.gnu.org/licenses/>. + + Copyright (C) 2002-2010 Jan-Åke Larsson + +************************************************************************/ + +#include "dvipng.h" + +const char *lengthnames[]={ "sp", "pt", "bp", + "dd", "mm", "pc", + "cc", "cm", "in" }; +const int32_t lengthsp[]={ 1L, 65536L, 65782L, + 70124L, 186468L, 786432L, + 841489L, 1864680L, 4736286L }; + +/* + * Convert a double[unit], e.g., "3.2cm" or "1.0in" into length in pixels. + * Advance the passed pointer as well. + */ + +static int32_t myatodim(const char ** p) +{ + double tmp; /* double accuracy is enough, I think */ + int i=0; + char *q; + + tmp = strtod(*p,&q); + while (*q == ' ') + q++; + while (i<8 && (q[0]!=lengthnames[i][0] || q[1]!=lengthnames[i][1])) + i++; + if (i==8 && (q[0]!=lengthnames[i][0] || q[1]!=lengthnames[i][1])) + Warning("unrecognized length unit \"%.2s\", assuming inches",q); + while (*q != ',' && *q !='\0') + q++; + tmp = tmp*lengthsp[i]*dpi/4736286L; /* sp * dots/in / (sp/in), convert sp to pixels */ + *p=q; + return((int32_t) tmp); +} + + +/* + * The routine where we handle the paper size special. We need to pass in + * the string after the `papersize=' specification. + */ + +void handlepapersize(const char * p, int32_t * x, int32_t * y) +{ + while (*p == ' ') + p++ ; + *x = myatodim(&p) ; + while (*p == ' ' || *p == ',') + p++ ; + *y = myatodim(&p) ; +} + diff --git a/Build/source/texk/dvipng/dvipng-src/pk.c b/Build/source/texk/dvipng/dvipng-src/pk.c new file mode 100644 index 00000000000..4e0b0c0e1b1 --- /dev/null +++ b/Build/source/texk/dvipng/dvipng-src/pk.c @@ -0,0 +1,410 @@ +/* pk.c */ + +/************************************************************************ + + Part of the dvipng distribution + + This program is free software: you can redistribute it and/or modify + it under the terms of the GNU Lesser General Public License as + published by the Free Software Foundation, either version 3 of the + License, or (at your option) any later version. + + This program is distributed in the hope that it will be useful, but + WITHOUT ANY WARRANTY; without even the implied warranty of + MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU + Lesser General Public License for more details. + + You should have received a copy of the GNU Lesser General Public + License along with this program. If not, see + <http://www.gnu.org/licenses/>. + + Copyright (C) 2002-2009, 2019 Jan-Åke Larsson + +************************************************************************/ + +#include "dvipng.h" + +#define PK_POST 245 +#define PK_PRE 247 +#define PK_ID 89 + +unsigned char dyn_f; +int repeatcount; +int poshalf; + +static unsigned char getnyb(unsigned char** pos) +{ + if (poshalf == 0) { + poshalf=1; + return(**pos / 16); + } else { + poshalf=0; + return(*(*pos)++ & 15); + } +} + +static uint32_t pk_packed_num(unsigned char** pos) +{ + register int i; + uint32_t j; + + i = (int)getnyb(pos); + if (i == 0) { + do { + j = (uint32_t)getnyb(pos); + i++; + } while (j == 0); + while (i > 0) { + j = j * 16 + (uint32_t)getnyb(pos); + i--; + }; + return (j - 15 + (13 - dyn_f) * 16 + dyn_f); + } else if (i <= (int)dyn_f) { + return ((uint32_t)i); + } else if (i < 14) { + return ((i-(uint32_t)dyn_f - 1) * 16 + (uint32_t)getnyb(pos) + + dyn_f + 1); + } else { + if (i == 14) { + repeatcount = (int)pk_packed_num(pos); + } else { + repeatcount = 1; + } + return (pk_packed_num(pos)); /* tail end recursion !! */ + } +} + +static unsigned char* skip_specials(unsigned char* pos, unsigned char* end) +{ + uint32_t i; + + while (pos < end && *pos >= 240 && *pos != PK_POST) { + i=0; + switch (*pos++) { + case 243: + i = *pos++; + case 242: + if (pos >= end) break; + i = 256 * i + *pos++; + case 241: + if (pos >= end) break; + i = 256 * i + *pos++; + case 240: + if (pos >= end) break; + i = 256 * i + *pos++; + DEBUG_PRINT(DEBUG_PK,("\n PK SPECIAL\t'%.*s' ",(int)i,pos)); + pos += i; + break; + case 244: +#ifdef DEBUG + { + uint32_t c; + c=UNumRead(pos,4); + DEBUG_PRINT(DEBUG_PK,("\n PK SPECIAL\t%d",c)); + } +#endif + pos += 4; + break; + case 245: + break; + case 246: + DEBUG_PRINT(DEBUG_PK,("\n PK\tNOP ")); + break; + case 247: case 248: case 249: case 250: + case 251: case 252: case 253: case 254: + case 255: + Fatal("unexpected PK flagbyte %d", (int)*pos); + } + } + return(pos); +} + + +void LoadPK(int32_t c, register struct char_entry * ptr) +{ + unsigned short shrunk_width,shrunk_height; + unsigned short width,height; + short xoffset,yoffset; + unsigned short i_offset,j_offset; + int i,j,k,n; + int count=0; + bool paint_switch; + unsigned char *pos,*buffer; + + DEBUG_PRINT(DEBUG_PK,("\n LOAD PK CHAR\t%d",c)); + pos=ptr->pkdata; + if ((ptr->flag_byte & 7) == 7) n=4; + else if ((ptr->flag_byte & 4) == 4) n=2; + else n=1; + dyn_f = ptr->flag_byte / 16; + paint_switch = ((ptr->flag_byte & 8) != 0); + /* + * Read character preamble + */ + if (n != 4) { + ptr->tfmw = UNumRead(pos, 3); + /* +n: vertical escapement not used */ + pos+=3+n; + } else { + ptr->tfmw = UNumRead(pos, 4); + /* +4: horizontal escapement not used */ + /* +n: vertical escapement not used */ + pos+=8+n; + } + DEBUG_PRINT(DEBUG_PK,(" %d",ptr->tfmw)); + ptr->tfmw = (dviunits) + ((int64_t) ptr->tfmw * currentfont->s / 0x100000 ); + DEBUG_PRINT(DEBUG_PK,(" (%d)",ptr->tfmw)); + + width = UNumRead(pos, n); + height = UNumRead(pos+=n, n); + DEBUG_PRINT(DEBUG_PK,(" %dx%d",width,height)); + + if (width > 0x7fff || height > 0x7fff) + Fatal("character %d too large in file %s", c, currentfont->name); + + /* + * Hotspot issues: Shrinking to the topleft corner rather than the + hotspot will displace glyphs a fraction of a pixel. We deal with + this in as follows: The glyph is shrunk to its hotspot by + offsetting the bitmap somewhat to put the hotspot in the lower + left corner of a "shrink square". Shrinking to the topleft corner + will then act as shrinking to the hotspot. This may enlarge the + bitmap somewhat, of course. (Also remember that the below + calculation of i/j_offset is in integer arithmetics.) + + There will still be a displacement from rounding the dvi + position, but vertically it will be equal for all glyphs on a + line, so we displace a whole line vertically by fractions of a + pixel. This is acceptible, IMHO. Sometime there will be support + for subpixel positioning, horizontally. Will do for now, I + suppose. + */ + xoffset = SNumRead(pos+=n, n); + i_offset = ( shrinkfactor - xoffset % shrinkfactor ) % shrinkfactor; + width += i_offset; + ptr->xOffset = xoffset+i_offset; + + yoffset = SNumRead(pos+=n, n); + j_offset = ( shrinkfactor - (yoffset-(shrinkfactor-1)) % shrinkfactor ) + % shrinkfactor; + height += j_offset; + ptr->yOffset = yoffset+j_offset; + + DEBUG_PRINT(DEBUG_PK,(" (%dx%d)",width,height)); + /* + Extra marginal so that we do not crop the image when shrinking. + */ + shrunk_width = (width + shrinkfactor - 1) / shrinkfactor; + shrunk_height = (height + shrinkfactor - 1) / shrinkfactor; + ptr->w = shrunk_width; + ptr->h = shrunk_height; + pos+=n; + if ((buffer = calloc(shrunk_width*shrunk_height* + shrinkfactor*shrinkfactor,sizeof(char)))==NULL) + Fatal("cannot allocate space for pk buffer"); + DEBUG_PRINT(DEBUG_GLYPH,("\nDRAW GLYPH %d\n", (int)c)); + /* Raster char */ + if (dyn_f == 14) { /* get raster by bits */ + int bitweight = 0; + for (j = j_offset; j < (int) height; j++) { /* get all rows */ + for (i = i_offset; i < (int) width; i++) { /* get one row */ + bitweight /= 2; + if (bitweight == 0) { + count = *pos++; + bitweight = 128; + } + if (count & bitweight) { + buffer[i+j*width]=1; +#ifdef DEBUG + DEBUG_PRINT(DEBUG_GLYPH,("+")); + } else { + DEBUG_PRINT(DEBUG_GLYPH,(" ")); +#endif + } + } + DEBUG_PRINT(DEBUG_GLYPH,("|\n")); + } + } else { /* get packed raster */ + poshalf=0; + repeatcount = 0; + for(i=i_offset, j=j_offset; j<height; ) { + count = pk_packed_num(&pos); + while (count > 0) { + if (i+count < width) { + if (paint_switch) + for(k=0;k<count;k++) { + buffer[k+i+j*width]=1; + DEBUG_PRINT(DEBUG_GLYPH,("*")); + } +#ifdef DEBUG + else for(k=0;k<count;k++) + DEBUG_PRINT(DEBUG_GLYPH,(" ")); +#endif + i += count; + count = 0; + } else { + if (paint_switch) + for(k=i;k<width;k++) { + buffer[k+j*width]=1; + DEBUG_PRINT(DEBUG_GLYPH,("#")); + } +#ifdef DEBUG + else for(k=i;k<width;k++) + DEBUG_PRINT(DEBUG_GLYPH,(" ")); +#endif + DEBUG_PRINT(DEBUG_GLYPH,("|\n")); + j++; + count -= width-i; + /* Repeat row(s) */ + for (;repeatcount>0; repeatcount--,j++) { + for (i = i_offset; i<width; i++) { + buffer[i+j*width]=buffer[i+(j-1)*width]; +#ifdef DEBUG + if (buffer[i+j*width]>0) { + DEBUG_PRINT(DEBUG_GLYPH,("=")); + } else { + DEBUG_PRINT(DEBUG_GLYPH,(" ")); + } +#endif + } + DEBUG_PRINT(DEBUG_GLYPH,("|\n")); + } + i=i_offset; + } + } + paint_switch = 1 - paint_switch; + } + if (i>i_offset) + Fatal("wrong number of bits stored: char. %c, font %s", + (char)c, currentfont->name); + if (j>height) + Fatal("bad PK file %s, too many bits", currentfont->name); + } + /* + Shrink raster while doing antialiasing. (See above. The + single-glyph output seems better than what xdvi at 300 dpi, + shrinkfactor 3 produces.) + */ + if ((ptr->data = calloc(shrunk_width*shrunk_height,sizeof(char))) == NULL) + Fatal("unable to malloc image space for char %c", (char)c); + for (j = 0; j < (int) height; j++) { + for (i = 0; i < (int) width; i++) { + /* if (((i % shrinkfactor) == 0) && ((j % shrinkfactor) == 0)) + ptr->data[i/shrinkfactor+j/shrinkfactor*shrunk_width] = + buffer[i+j*width]; + else */ + ptr->data[i/shrinkfactor+j/shrinkfactor*shrunk_width] += + buffer[i+j*width]; + } + } + for (j = 0; j < shrunk_height; j++) { + for (i = 0; i < shrunk_width; i++) { + ptr->data[i+j*shrunk_width] = ptr->data[i+j*shrunk_width] + *255/shrinkfactor/shrinkfactor; + DEBUG_PRINT(DEBUG_GLYPH,("%3u ",ptr->data[i+j*shrunk_width])); + } + DEBUG_PRINT(DEBUG_GLYPH,("|\n")); + } + free(buffer); +} + +void InitPK(struct font_entry * tfontp) +{ + unsigned char* position, *end; + struct char_entry *tcharptr; /* temporary char_entry pointer */ + uint32_t hppp, vppp, packet_length; + uint32_t c; + + DEBUG_PRINT((DEBUG_DVI|DEBUG_PK),("\n OPEN FONT:\t'%s'", tfontp->name)); + Message(BE_VERBOSE,"<%s>", tfontp->name); + if (MmapFile(tfontp->name,&(tfontp->fmmap))) + Fatal("font file %s unusable", tfontp->name); + position=(unsigned char*)tfontp->fmmap.data; + if (tfontp->fmmap.size < 3 || tfontp->fmmap.size < 3+*(position+2)+16) + Fatal("PK file %s ends prematurely",tfontp->name); + if (*position++ != PK_PRE) + Fatal("unknown font format in file %s",tfontp->name); + if (*position++ != PK_ID) + Fatal( "wrong version %d of PK file %s (should be 89)", + (int)*(position-1),tfontp->name); + DEBUG_PRINT(DEBUG_PK,("\n PK_PRE:\t'%.*s'",(int)*position, position+1)); + position += *position + 1; + + tfontp->designsize = UNumRead(position, 4); + DEBUG_PRINT(DEBUG_PK,(" %d", tfontp->designsize)); + tfontp->type = FONT_TYPE_PK; + + c = UNumRead(position+4, 4); + DEBUG_PRINT(DEBUG_PK,(" %d", c)); + CheckChecksum (tfontp->c, c, tfontp->name); + + hppp = UNumRead(position+8, 4); + vppp = UNumRead(position+12, 4); + DEBUG_PRINT(DEBUG_PK,(" %d %d", hppp,vppp)); + if (hppp != vppp) + Warning("aspect ratio is %d:%d (should be 1:1)", hppp, vppp); + tfontp->magnification = (uint32_t)((uint64_t)hppp * 7227 * 5 / 65536l + 50)/100; + position+=16; + /* Read char definitions */ + end=(unsigned char *) tfontp->fmmap.data+tfontp->fmmap.size; + position = skip_specials(position,end); + while (position < end && *position != PK_POST) { + DEBUG_PRINT(DEBUG_PK,("\n @%ld PK CHAR:\t%d", + (long)((char *)position - tfontp->fmmap.data), *position)); + if ((tcharptr = malloc(sizeof(struct char_entry))) == NULL) + Fatal("cannot allocate space for char_entry"); + tcharptr->flag_byte = *position; + tcharptr->data = NULL; + tcharptr->tfmw = 0; + if ((*position & 7) == 7) { + if (position >= end - 9) Fatal("PK file %s ends prematurely",tfontp->name); + packet_length = UNumRead(position+1,4); + c = UNumRead(position+5, 4); + position += 9; + } else if (*position & 4) { + if (position >= end - 4) Fatal("PK file %s ends prematurely",tfontp->name); + packet_length = (*position & 3) * 65536l + UNumRead(position+1, 2); + c = UNumRead(position+3, 1); + position += 4; + } else { + if (position >= end - 3) Fatal("PK file %s ends prematurely",tfontp->name); + packet_length = (*position & 3) * 256 + UNumRead(position+1, 1); + c = UNumRead(position+2, 1); + position += 3; + } + DEBUG_PRINT(DEBUG_PK,(" %d %d",packet_length,c)); + if (c > (LASTFNTCHAR)) + Fatal("PK font %s exceeds char numbering limit",tfontp->name); + tcharptr->length = packet_length; + tcharptr->pkdata = position; + tfontp->chr[c]=tcharptr; + position += packet_length; + position = skip_specials(position, end); + } + if (position >= end) Fatal("PK file %s ends prematurely",tfontp->name); +} + +static void UnLoadPK(struct char_entry *ptr) +{ + if (ptr->data!=NULL) + free(ptr->data); + ptr->data=NULL; +} + +void DonePK(struct font_entry *tfontp) +{ + int c=FIRSTFNTCHAR; + + UnMmapFile(&(tfontp->fmmap)); + while(c<=LASTFNTCHAR) { + if (tfontp->chr[c]!=NULL) { + UnLoadPK((struct char_entry*)tfontp->chr[c]); + free(tfontp->chr[c]); + } + c++; + } + if (tfontp->name!=NULL) + free(tfontp->name); + tfontp->name=NULL; +} diff --git a/Build/source/texk/dvipng/dvipng-src/ppagelist.c b/Build/source/texk/dvipng/dvipng-src/ppagelist.c new file mode 100644 index 00000000000..b7467a98539 --- /dev/null +++ b/Build/source/texk/dvipng/dvipng-src/ppagelist.c @@ -0,0 +1,189 @@ +/* ppagelist.c */ + +/************************************************************************ + + Part of the dvipng distribution + + This program is free software: you can redistribute it and/or modify + it under the terms of the GNU Lesser General Public License as + published by the Free Software Foundation, either version 3 of the + License, or (at your option) any later version. + + This program is distributed in the hope that it will be useful, but + WITHOUT ANY WARRANTY; without even the implied warranty of + MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU + Lesser General Public License for more details. + + You should have received a copy of the GNU Lesser General Public + License along with this program. If not, see + <http://www.gnu.org/licenses/>. + + Copyright (C) 2002-2010 Jan-Åke Larsson + +************************************************************************/ + +#include "dvipng.h" + +/* Some code at the end of this file is adapted from dvips */ + +static int32_t first=PAGE_FIRSTPAGE, last=PAGE_LASTPAGE; +static bool abspage=false, reverse=false; +bool no_ppage=true; + +/* dvips' behaviour: + * -pp outputs _all_ pages with the correct numbers, + * -p, -l outputs from the first occurrence of firstpage to the first + * occurrence of lastpage. Using '=' means absolute pagenumbers + */ + +void FirstPage(int32_t page, bool data) +{ + first=page; + abspage |= data; +} +void LastPage(int32_t page,bool data) +{ + last=page; + abspage |= data; +} +void Reverse(bool new) +{ + reverse=new; +} +/*-->NextPPage*/ +/**********************************************************************/ +/**************************** NextPPage *****************************/ +/**********************************************************************/ +/* Return the page in turn on our queue */ +/* (Implicitly, PAGE_POST is never in the pagelist) */ +bool InPageList(int32_t i); + +struct page_list* NextPPage(void* dvi, struct page_list* page) +{ + if (! reverse) { /*********** normal order */ + if (page == NULL) { /* first call: find first page */ + if (no_ppage) + return(NULL); + page=FindPage(dvi,first,abspage); + } else /* later calls: count up, except "last" page */ + page=(last==page->count[abspage ? 0 : 10]) ? NULL : NextPage(dvi,page); + /* seek for pages in pagelist */ + while (page!=NULL && ! InPageList(page->count[0])) + page=(last==page->count[abspage ? 0 : 10]) ? NULL : NextPage(dvi,page); + } else { /******************** reverse order */ + if (page == NULL) { /* first call: find "last" page */ + if (no_ppage) + return(NULL); + page=FindPage(dvi,last,abspage); + } else /* later calls: count down, except "first" page */ + page=(first==page->count[abspage ? 0 : 10]) ? NULL : PrevPage(dvi,page); + /* seek for pages in pagelist */ + while (page!=NULL && ! InPageList(page->count[0])) + page=(first==page->count[abspage ? 0 : 10]) ? NULL : PrevPage(dvi,page); + } + return(page); +} + +struct pp_list { + struct pp_list *next; /* next in a series of alternates */ + int32_t ps_low, ps_high; /* allowed range */ +} *ppages = 0; /* the list of allowed pages */ + +/*-->InPageList*/ +/**********************************************************************/ +/****************************** InPageList **************************/ +/**********************************************************************/ +/* Return true iff i is one of the desired output pages */ + +bool InPageList(int32_t i) +{ + register struct pp_list *pl = ppages; + + while (pl) { + if ( i >= pl -> ps_low && i <= pl -> ps_high) + return(true); /* success */ + pl = pl -> next; + } + return(false); +} + +static void ListPage(int32_t pslow, int32_t pshigh) +{ + register struct pp_list *pl; + + /* Some added code, we want to reuse the list */ + no_ppage=false; + pl = ppages; + while (pl != NULL && pl->ps_low <= pl->ps_high) + pl = pl->next; + if (pl == NULL) { + if ((pl = (struct pp_list *)malloc(sizeof(struct pp_list))) + ==NULL) + Fatal("cannot malloc memory for page queue"); + pl -> next = ppages; + ppages = pl; + } + pl -> ps_low = pslow; + pl -> ps_high = pshigh; +} + +/* Parse a string representing a list of pages. Return 0 iff ok. As a + side effect, the page selection(s) is (are) prepended to ppages. */ + +bool ParsePages(const char *s) +{ + const char *c; /* conversion start */ + char *t; + long int ps_low = PAGE_MINPAGE, ps_high = PAGE_MAXPAGE; + + while (*s==' ' || *s=='\t') s++; + while (*s!='\0') { + if (*s=='-' || *s==':') { /* range with no starting value */ + ps_low = PAGE_MINPAGE; + c=s+1; + ps_high = strtol(c,&t,10); + s = t; + if (c==s) ps_high=PAGE_MAXPAGE; /* no number */ + while (*s==' ' || *s=='\t') s++; + if (*s=='-' || *s==':') { /* Oh, range with negative starting value */ + ps_low = -ps_high; + c=s+1; + ps_high = strtol(c,&t,10); + s = t; + if (c==s) ps_high=PAGE_MAXPAGE; /* no number */ + } + } else { /* range with starting value, or singleton */ + c=s; + ps_low = ps_high = strtol(c,&t,10); + s = t; + if (c==s) + return(true); + if (*s=='-' || *s==':') { /* range */ + c=s+1; + ps_high = strtol(c,&t,10); + s = t; + if (c==s) ps_high=PAGE_MAXPAGE; /* no number */ + } + } + ListPage(ps_low, ps_high); + while (*s==' ' || *s=='\t' || *s==',') s++; + } + return(false); +} + +/* Addition, we want to be able to clear the pplist */ +void ClearPpList(void) +{ + register struct pp_list *pl = ppages; + + while (pl) { + ppages=ppages->next; + free(pl); + pl = ppages; + } + first=PAGE_FIRSTPAGE; + last=PAGE_LASTPAGE; + abspage = false; + no_ppage=true; +} + diff --git a/Build/source/texk/dvipng/dvipng-src/readme.texi b/Build/source/texk/dvipng/dvipng-src/readme.texi new file mode 100644 index 00000000000..32faa64c02b --- /dev/null +++ b/Build/source/texk/dvipng/dvipng-src/readme.texi @@ -0,0 +1,158 @@ +@c readme.texi +@c +@c Part of the dvipng distribution + +@ifclear man +@include macros.texi +@ifset rawfile +@chapter dvipng + +@end ifset +@end ifclear +@c ----------------------- + +This program makes PNG and/or GIF graphics from DVI files as obtained +from @TeX{} and its relatives. + +If GIF support is enabled, GIF output is chosen by using the +@samp{dvigif} binary or with the @samp{--gif} option. + +@ifclear man + +It is intended to produce anti-aliased screen-resolution images as fast +as is possible. The target audience is people who need to generate and +regenerate many images again and again. The primary target is the +@previewlatex{} (X)Emacs package, a package to preview formulas from +within (X)Emacs. Yes, you get to see your formulas in the (X)Emacs +buffer, see @url{http://www.gnu.org/software/auctex/preview-latex.html}. + +Another example is WeBWorK, an internet-based method for delivering +homework problems to students over the internet, giving students +instant feedback as to whether or not their answers are correct, see +@url{http://webwork.math.rochester.edu}. + +A more recent addition to the dvipng-using applications out there is +MediaWiki, the software behind Wikipedia and many other wikis out +there. Dvipng is used to render mathematical formulae from version +1.8.0 of MediaWiki, see @url{http://www.mediawiki.org}. + +Other applications may also benefit, like web applications as latex2html +and WYSIWYG editors like LyX. + +@ifset rawfile +@section Benefits of dvipng +@end ifset +@end ifclear + +The benefits of @samp{dvipng}/@samp{dvigif} include + +@itemize @bullet +@item +Speed. It is a very fast bitmap-rendering code for DVI files, which +makes it suitable for generating large amounts of images on-the-fly, +as needed in @previewlatex{}, WeBWorK and others. + +@item +It does not read the postamble, so it can be started before @TeX{} +finishes. There is a @samp{--follow} switch that makes dvipng wait at +end-of-file for further output, unless it finds the POST marker that +indicates the end of the DVI. + +@item +Interactive query of options. dvipng can read options interactively +through stdin, and all options are usable. It is even possible to change +the input file through this interface. + +@item +Supports PK, VF, PostScript Type1, and TrueType fonts, subfonts (i.e., +as used in CJK-@LaTeX{}), color specials, and inclusion of PostScript, +PNG, JPEG or GIF images. + +@item +and more... + +@end itemize + +@ifset rawfile +@section Installation + +Read @file{INSTALL}, included in the distribution. + +@section Usage + +To use dvipng at its simplest, simply type + +@example +dvipng foo +@end example + +@noindent +where @file{foo.dvi} is the output of @TeX{} that you want to convert to +PNG format. If there are four pages in @file{foo.dvi}, those pages will +be output as @file{foo1.png}, @file{foo2.png}, @file{foo3.png}, and +@file{foo4.png}, respectively. + +Many options are available (see the info manual). For a brief summary +of available options, just type + +@example +dvipng --help +@end example + +@section Availability + +The dvipng package is available at Savannah, the GNU project site. Since +dvipng is not part of the GNU project, although released under the GNU +GPL, the web address is +@url{http://savannah.nongnu.org/projects/dvipng}. Instructions for +anonymous CVS access can be found at +@url{http://savannah.nongnu.org/cvs/?group=dvipng}. + +@section Contacts + +Bug reports should be sent to @email{dvipng@@nongnu.org}. + +Questions, suggestions for new features, pleas for help, and/or praise +should go to @email{dvipng@@nongnu.org}. For more information on this +mailing list, send a message with just the word `help' as subject or +body to @email{dvipng-request@@nongnu.org} or look at +@url{http://lists.nongnu.org/mailman/listinfo/dvipng}. + +Offers to support further development will be appreciated. For developer +access, ask on @email{dvipng@@nongnu.org}. + +@section Copying + +This program is released under the GNU Lesser General Public License +version 3, see the COPYING file in the dvipng distribution or +@url{http://www.gnu.org/licenses/}. + +Copyright @copyright{} 2002-2014 Jan-@AA{}ke Larsson + +@section Todo + +@itemize @bullet +@item +Use gs interpreter library for speed and possibly for functionality. + +@item +Add more color models for xcolor compatibility + +@item +Enable a named pipe as DVI + +@item +Further speed improvements. + +@item +Other output specials and source specials. + +@item +Clean internal structures. Overhaul file handling. + +@item +Fix the SELFAUTO stuff at runtime rather than at build time +@end itemize + + +@end ifset diff --git a/Build/source/texk/dvipng/dvipng-src/set.c b/Build/source/texk/dvipng/dvipng-src/set.c new file mode 100644 index 00000000000..9f3ce99b05a --- /dev/null +++ b/Build/source/texk/dvipng/dvipng-src/set.c @@ -0,0 +1,292 @@ +/* set.c */ + +/************************************************************************ + + Part of the dvipng distribution + + This program is free software: you can redistribute it and/or modify + it under the terms of the GNU Lesser General Public License as + published by the Free Software Foundation, either version 3 of the + License, or (at your option) any later version. + + This program is distributed in the hope that it will be useful, but + WITHOUT ANY WARRANTY; without even the implied warranty of + MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU + Lesser General Public License for more details. + + You should have received a copy of the GNU Lesser General Public + License along with this program. If not, see + <http://www.gnu.org/licenses/>. + + Copyright (C) 2002-2015 Jan-Åke Larsson + +************************************************************************/ + +#include "dvipng.h" +#include <math.h> + +#ifndef HAVE_GDIMAGECREATETRUECOLOR +#define gdImageColorAllocateAlpha(i,r,g,b,a) gdImageColorAllocate(i,r,g,b) +#define gdImageColorResolveAlpha(i,r,g,b,a) gdImageColorResolve(i,r,g,b) +#define gdImageAlpha(i,c) 0 +#define gdAlphaMax 127 +#endif +#ifndef HAVE_GDIMAGEPNGEX +#define gdImagePngEx(i,f,z) gdImagePng(i,f) +#endif + +/* Persistent color cache. Index is ink thickness, + 0=no ink, 127=total coverage */ +static int ColorCache[gdAlphaMax+1]; + +void CreateImage(pixels x_width,pixels y_width) +{ + if (page_imagep) + gdImageDestroy(page_imagep); + if (x_width <= 0) x_width=1; + if (y_width <= 0) y_width=1; +#ifdef HAVE_GDIMAGECREATETRUECOLOR + /* GIFs are 256-color */ + if ((option_flags & FORCE_TRUECOLOR + || page_flags & PAGE_TRUECOLOR) + && ~option_flags & GIF_OUTPUT + && ~option_flags & FORCE_PALETTE) + page_imagep=gdImageCreateTrueColor(x_width,y_width); + else +#endif + page_imagep=gdImageCreate(x_width,y_width); + /* Set bg color. GIFs cannot handle an alpha channel, resort to + transparent color index, set in WriteImage */ + if (!page_imagep) + Fatal("cannot allocate GD image for DVI"); + ColorCache[0] + = gdImageColorAllocateAlpha(page_imagep, + cstack[0].red, + cstack[0].green, + cstack[0].blue, + (option_flags & BG_TRANSPARENT_ALPHA + && ~option_flags & GIF_OUTPUT) ? 127 : 0); + ColorCache[gdAlphaMax]=-1; +#ifdef HAVE_GDIMAGECREATETRUECOLOR + /* Alpha blending in libgd is only performed for truecolor images. + We need it for palette images also. Turn libgd alpha blending off + and calculate color blending where needed. We turn it back on + briefly for image inclusion. */ + gdImageAlphaBlending(page_imagep, 0); + if (option_flags & BG_TRANSPARENT_ALPHA) + gdImageSaveAlpha(page_imagep, 1); + if (page_imagep->trueColor) + /* Truecolor: there is no background color index, fill image instead. */ + gdImageFilledRectangle(page_imagep, 0, 0, + x_width-1, y_width-1, ColorCache[0]); +#endif +} + + +static void ChangeColor(gdImagePtr imagep,int x1,int y1, + int x2,int y2,int color1,int color2) +/* In the given rectangle, change color1 to color2 */ +{ + int x,y; + for( y=y1; y<=y2; y++) { + for( x=x1; x<=x2; x++) { + if (gdImageGetPixel(imagep, x, y)==color1) + gdImageSetPixel(imagep, x, y, color2); + } + } +} + +void WriteImage(char *pngname, int pagenum) +{ + char* pos, *freeme=NULL; + FILE* outfp=NULL; + + /* Set transparent background. Maybe alpha is not available or + perhaps we are producing GIFs, so test for BG_TRANSPARENT_ALPHA + too */ + if (option_flags & (BG_TRANSPARENT|BG_TRANSPARENT_ALPHA)) + gdImageColorTransparent(page_imagep,ColorCache[0]); + /* Transparent border */ + if (borderwidth>0) { + int Transparent; + pixels x_width,y_width; + + x_width=gdImageSX(page_imagep); + y_width=gdImageSY(page_imagep); + + /* Set ANOTHER bg color, transparent this time */ + /* No semi-transparency here, given the motivation for this code + * (box cursor visibility in Emacs) */ + if (userbordercolor) + Transparent = gdImageColorAllocate(page_imagep, + bordercolor.red, + bordercolor.green, + bordercolor.blue); + else + Transparent = gdImageColorAllocate(page_imagep, + gdImageRed(page_imagep,ColorCache[0]), + gdImageGreen(page_imagep,ColorCache[0]), + gdImageBlue(page_imagep,ColorCache[0])); + gdImageColorTransparent(page_imagep,Transparent); + ChangeColor(page_imagep,0,0,x_width-1,borderwidth-1, + ColorCache[0],Transparent); + ChangeColor(page_imagep,0,0,borderwidth-1,y_width-1, + ColorCache[0],Transparent); + ChangeColor(page_imagep,x_width-borderwidth,0,x_width-1,y_width-1, + ColorCache[0],Transparent); + ChangeColor(page_imagep,0,y_width-borderwidth,x_width-1,y_width-1, + ColorCache[0],Transparent); + } + + if ((pos=strchr(pngname,'%')) != NULL) { + if (strchr(++pos,'%')) + Fatal("too many %%s in output file name"); + if (*pos == 'd' + || (*pos=='0' && pos[1]>='1' && pos[1]<='9' && pos[2]=='d')) { + /* %d -> pagenumber, so add 9 string positions + since pagenumber max +-2^31 or +-2*10^9 */ + if ((freeme = malloc(strlen(pngname)+9))==NULL) + Fatal("cannot allocate memory for output file name"); + sprintf(freeme,pngname,pagenum); + pngname = freeme; + } else { + Fatal("unacceptible format spec in output file name"); + } + } +#ifdef HAVE_GDIMAGEGIF + if (option_flags & GIF_OUTPUT && (pos=strrchr(pngname,'.')) != NULL + && strcmp(pos,".png")==0) { + *(pos+1)='g'; + *(pos+2)='i'; + *(pos+3)='f'; + } +#endif + if ((outfp = fopen(pngname,"wb")) == NULL) + Fatal("cannot open output file %s",pngname); +#ifdef HAVE_GDIMAGEGIF + if (option_flags & GIF_OUTPUT) + gdImageGif(page_imagep,outfp); + else +#endif + gdImagePngEx(page_imagep,outfp,compression); + fclose(outfp); + DEBUG_PRINT(DEBUG_DVI,("\n WROTE: \t%s\n",pngname)); + if (freeme) + free(freeme); + DestroyImage(); +} + +void DestroyImage(void) +{ + gdImageDestroy(page_imagep); + page_imagep=NULL; +} + +static int gammatable[]= + {0,1,2,3,4,5,6,7,8,9,10,11,12,13,14,15,16,17,18,19, + 20,21,22,23,24,25,26,27,28,29,30,31,32,33,34,35,36,37,38,39, + 40,41,42,43,44,45,46,47,48,49,50,51,52,53,54,55,56,57,58,59, + 60,61,62,63,64,65,66,67,68,69,70,71,72,73,74,75,76,77,78,79, + 80,81,82,83,84,85,86,87,88,89,90,91,92,93,94,95,96,97,98,99, + 100,101,102,103,104,105,106,107,108,109, + 110,111,112,113,114,115,116,117,118,119, + 120,121,122,123,124,125,126,127}; + +void Gamma(double gamma) +{ + int i=0; + + while (i<=gdAlphaMax) { + gammatable[i]=gdAlphaMax- + (int)(pow((gdAlphaMax-i)/((double)gdAlphaMax),gamma)*gdAlphaMax); + DEBUG_PRINT(DEBUG_GLYPH, + ("\n GAMMA GREYSCALE: %d -> %d ",i,gammatable[i])); + i++; + } +} + +dviunits SetGlyph(struct char_entry *ptr, int32_t hh,int32_t vv) +/* gdImageChar can only do monochrome glyphs */ +{ + int dst_alpha,dst_weight,tot_weight,alpha; + int x,y,pos=0; + int bgColor,pixelgrey,pixelcolor; + + hh -= ptr->xOffset/shrinkfactor; + vv -= ptr->yOffset/shrinkfactor; + /* Initialize persistent color cache. Perhaps this should be in + color.c? */ + pixelcolor=gdImageColorResolve(page_imagep, + cstack[csp].red, + cstack[csp].green, + cstack[csp].blue); + if (ColorCache[gdAlphaMax]!=pixelcolor) { + for( x=1; x<gdAlphaMax; x++ ) + ColorCache[x]=-1; + ColorCache[gdAlphaMax]=pixelcolor; + } + for( y=0; y<ptr->h; y++) { + for( x=0; x<ptr->w; x++) { + if (ptr->data[pos]>0) { + pixelgrey=gammatable[(int)ptr->data[pos]/2]; + bgColor = gdImageGetPixel(page_imagep, hh + x, vv + y); + if (ColorCache[0]!=bgColor || ColorCache[pixelgrey]==-1) { + DEBUG_PRINT(DEBUG_GLYPH,("\n GAMMA GREYSCALE: %d -> %d ", + ptr->data[pos]/2,pixelgrey)); + alpha = gdAlphaMax-pixelgrey; + dst_alpha = gdImageAlpha(page_imagep,bgColor); + dst_weight = (gdAlphaMax - dst_alpha) * alpha / gdAlphaMax; + tot_weight = pixelgrey + dst_weight; + pixelcolor = gdImageColorResolveAlpha(page_imagep, + (cstack[csp].red*pixelgrey + + gdImageRed(page_imagep,bgColor)*dst_weight)/tot_weight, + (cstack[csp].green*pixelgrey + + gdImageGreen(page_imagep,bgColor)*dst_weight)/tot_weight, + (cstack[csp].blue*pixelgrey + + gdImageBlue(page_imagep,bgColor)*dst_weight)/tot_weight, + alpha*dst_alpha/gdAlphaMax); + if (ColorCache[0]==bgColor) + ColorCache[pixelgrey]=pixelcolor; + } else + pixelcolor=ColorCache[pixelgrey]; + gdImageSetPixel(page_imagep, hh + x, vv + y, pixelcolor); + } + pos++; + } + } + return(ptr->tfmw); +} + +dviunits SetRule(dviunits a, dviunits b, subpixels hh,subpixels vv) +{ + /* This routine will draw a \rule */ + int Color; + pixels width=0, height=0; + + if ( a > 0 && b > 0 ) { + /* Calculate width and height, round up */ + width = (b+dvi->conv*shrinkfactor-1)/dvi->conv/shrinkfactor; + height = (a+dvi->conv*shrinkfactor-1)/dvi->conv/shrinkfactor; + } + if (page_imagep != NULL) { + if ((height>0) && (width>0)) { + /* This code produces too dark rules. But what the hell. Grey + * rules look fuzzy. */ + Color = gdImageColorResolve(page_imagep, + cstack[csp].red, + cstack[csp].green, + cstack[csp].blue); + /* +1 and -1 are because the Rectangle coords include last pixels */ + gdImageFilledRectangle(page_imagep,hh,vv-height+1,hh+width-1,vv,Color); + DEBUG_PRINT(DEBUG_DVI,("\n RULE \t%dx%d at (%d,%d)", + width, height, hh, vv)); + } + } else { + /* The +1's are because things are cut _at_that_coordinate_. */ + min(x_min,hh); + min(y_min,vv-height+1); + max(x_max,hh+width); + max(y_max,vv+1); + } + return(b); +} diff --git a/Build/source/texk/dvipng/dvipng-src/sfd.c b/Build/source/texk/dvipng/dvipng-src/sfd.c new file mode 100644 index 00000000000..5c059e9add9 --- /dev/null +++ b/Build/source/texk/dvipng/dvipng-src/sfd.c @@ -0,0 +1,180 @@ +/* sfd.c */ + +/************************************************************************ + + Part of the dvipng distribution + + This program is free software: you can redistribute it and/or modify + it under the terms of the GNU Lesser General Public License as + published by the Free Software Foundation, either version 3 of the + License, or (at your option) any later version. + + This program is distributed in the hope that it will be useful, but + WITHOUT ANY WARRANTY; without even the implied warranty of + MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU + Lesser General Public License for more details. + + You should have received a copy of the GNU Lesser General Public + License along with this program. If not, see + <http://www.gnu.org/licenses/>. + + Copyright (C) 2002-2008 Jan-Åke Larsson + +************************************************************************/ + +#include "dvipng.h" +struct subfont* subfontp=NULL; + +static struct subfont* ReadSubfont(char* sfdname, char *infix) +{ + char *pos,*max,*sfdfile=NULL; + struct subfont* sfdp=NULL; + struct filemmap fmmap; + boolean mmapfailed; + + /* OK, find subfont and look for correct infix */ +#ifdef HAVE_KPSE_ENC_FORMATS + sfdfile=kpse_find_file(sfdname,kpse_sfd_format,false); +#endif + if (sfdfile == NULL) { + Warning("subfont file %s could not be found",sfdname); + return(NULL); + } + DEBUG_PRINT((DEBUG_FT|DEBUG_ENC),("\n OPEN SUBFONT:\t'%s'", sfdfile)); + mmapfailed = MmapFile(sfdfile,&fmmap); + free(sfdfile); + if (mmapfailed) + return(NULL); + pos=fmmap.data; + max=fmmap.data+fmmap.size; + while(pos<max && (*pos==' ' || *pos=='\r' || *pos=='\n' || *pos=='\t')) pos++; + while (pos<max && *pos=='#') { + while(pos<max && *pos!='\r' && *pos!='\n') pos++; + while(pos<max && (*pos==' ' || *pos=='\r' || *pos=='\n' || *pos=='\t')) pos++; + } + while(pos+strlen(infix)<max + && (strncmp(pos,infix,strlen(infix))!=0 + || (pos[strlen(infix)]!=' ' && pos[strlen(infix)]!='\t'))) { + /* skip lines, taking line continuation into account */ + while(pos+1<max && (*(pos+1)!='\r' || *(pos+1)!='\n' || *pos=='\\')) + pos++; + pos++; + while(pos<max && (*pos==' ' || *pos=='\r' || *pos=='\n' || *pos=='\t')) pos++; + while (pos<max && *pos=='#') { + while(pos<max && *pos!='\r' && *pos!='\n') pos++; + while(pos<max && (*pos==' ' || *pos=='\r' || *pos=='\n' || *pos=='\t')) pos++; + } + } + pos=pos+strlen(infix); + if (pos<max) { + int number,range,codepoint=0; + + if ((sfdp = calloc(sizeof(struct subfont)+strlen(sfdname)+1 + +strlen(infix)+1,1))==NULL) { + Warning("cannot allocate memory for subfont",sfdname); + UnMmapFile(&fmmap); + return(NULL); + } + sfdp->name=(char*)sfdp+sizeof(struct subfont); + strcpy(sfdp->name,sfdname); + sfdp->infix=(char*)sfdp+sizeof(struct subfont)+strlen(sfdname)+1; + strcpy(sfdp->infix,infix); + sfdp->encoding=FT_ENCODING_UNICODE; + while (pos<max && *pos != '\r' && *pos != '\n') { + number=strtol(pos,&pos,0); + while(pos<max && (*pos==' ' || *pos=='\t')) pos++; + switch(*pos) { + case ':': + codepoint=number; + pos++; + break; + case '_': + range=strtol(pos+1,&pos,0); + while(codepoint<256 && number<range) { + sfdp->charindex[codepoint]=number; + DEBUG_PRINT(DEBUG_ENC,("\n SUBFONT MAP %d %d",codepoint,number)); + number++; + codepoint++; + } + default: + if (codepoint<256) + sfdp->charindex[codepoint]=number; + DEBUG_PRINT(DEBUG_ENC,("\n SUBFONT MAP %d %d",codepoint,number)); + } + while(pos<max && (*pos==' ' || *pos=='\t')) pos++; + /* take line continuation into account */ + while(pos+1<max && *pos=='\\' && (*(pos+1)=='\r' || *(pos+1)=='\n')) { + if (pos+2<max && *(pos+1)=='\r' && *(pos+2)=='\n') pos++; + pos+=2; + while(pos<max && (*pos==' ' || *pos=='\t')) pos++; + } + } + } + return (sfdp); +} + +struct psfontmap* FindSubFont(struct psfontmap* entry, char* fontname) +{ + struct subfont *temp=subfontp; + char *sfdspec=entry->tfmname,*sfdwant=fontname, + *sfdname,*infix,*postfix; + + while (*sfdspec!='\0' && *sfdspec==*sfdwant) { + sfdspec++; + sfdwant++; + } + /* Find delimiter */ + if (*sfdspec!='@') + return(NULL); + sfdspec++; + postfix=sfdspec; + while (*postfix!='\0' && *postfix!='@') + postfix++; + if (*postfix!='@') + return(NULL); + /* Extract subfont name */ + if ((sfdname=malloc(postfix-sfdspec+1))==NULL) + Fatal("cannot allocate memory for subfont name"); + strncpy(sfdname,sfdspec,postfix-sfdspec); + sfdname[postfix-sfdspec]='\0'; + /* Check postfix */ + postfix++; + if (strcmp(sfdwant+strlen(sfdwant)-strlen(postfix),postfix)!=0) + return(NULL); + /* Extract infix */ + if ((infix=malloc(strlen(sfdwant)-strlen(postfix)+1))==NULL) + Fatal("cannot allocate memory for subfont infix"); + strncpy(infix,sfdwant,strlen(sfdwant)-strlen(postfix)); + infix[strlen(sfdwant)-strlen(postfix)]='\0'; + DEBUG_PRINT(DEBUG_ENC,("\n SUBFONT %s %s %s",fontname,sfdname,infix)); + /* Find subfont */ + while(temp!=NULL + && (strcmp(sfdname,temp->name)!=0 || strcmp(infix,temp->infix)!=0)) + temp=temp->next; + if (temp==NULL) { + temp=ReadSubfont(sfdname,infix); + if (temp!=NULL) { + temp->next=subfontp; + subfontp=temp; + } + } + entry=NewPSFont(entry); + if (entry!=NULL) { + entry->tfmname=copyword(fontname); + entry->subfont=temp; + } + free(infix); + free(sfdname); + return(entry); +} + +void ClearSubfont(void) +{ + struct subfont *temp=subfontp; + + while(temp!=NULL) { + subfontp=subfontp->next; + free(temp); + temp=subfontp; + } +} diff --git a/Build/source/texk/dvipng/dvipng-src/special.c b/Build/source/texk/dvipng/dvipng-src/special.c new file mode 100644 index 00000000000..544bbabd307 --- /dev/null +++ b/Build/source/texk/dvipng/dvipng-src/special.c @@ -0,0 +1,895 @@ +/* special.c */ + +/************************************************************************ + + Part of the dvipng distribution + + This program is free software: you can redistribute it and/or modify + it under the terms of the GNU Lesser General Public License as + published by the Free Software Foundation, either version 3 of the + License, or (at your option) any later version. + + This program is distributed in the hope that it will be useful, but + WITHOUT ANY WARRANTY; without even the implied warranty of + MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU + Lesser General Public License for more details. + + You should have received a copy of the GNU Lesser General Public + License along with this program. If not, see + <http://www.gnu.org/licenses/>. + + Copyright (C) 2002-2015 Jan-Åke Larsson + +************************************************************************/ + +#include "dvipng.h" + +#ifndef MIKTEX +#ifndef WIN32 +#include <sys/wait.h> +#else /* WIN32 */ +#include <fcntl.h> +#include <io.h> +#include <process.h> +#ifndef pipe +#define pipe(p) _pipe(p, 65536, O_BINARY | _O_NOINHERIT) +#endif +#ifndef snprintf +#define snprintf _snprintf +#endif +#endif /* WIN32 */ +#endif + +#define SKIPSPACES(s) while(s && *s==' ' && *s!='\0') s++ + +/* PostScript can come as a string (headers and raw specials) or + a memory-mapped file (headers and included EPS figures). */ + +struct pscode { + struct pscode* next; + char* special; /* complete special */ + const char* code; /* PS string, null if a file */ + char* filename; /* file name, null if a string */ + const char* postcode; /* post PS string */ + struct filemmap fmmap; /* file mmap */ +}; + +struct pscode* psheaderp=NULL; /* static, DVI-specific header list */ + +static void PSCodeInit(struct pscode *entry, char *special) +{ + entry->next=NULL; + entry->special=special; + entry->code=NULL; + entry->filename=NULL; + entry->postcode=NULL; + entry->fmmap.data=NULL; + if (special==NULL) + return; + if (strncmp(special,"header=",7)==0) + entry->filename=special+7; + else if (strncmp(special,"ps:: plotfile ",14)==0) + entry->filename=special+14; + else if (special[0]=='"' || special[0]=='!') + entry->code=special+1; + else if (strncmp(special,"ps::[begin]",11)==0) + entry->code=special+11; + else if (strncmp(special,"ps::[end]",9)==0) + entry->code=special+9; + else if (strncmp(special,"ps::",4)==0) + entry->code=special+4; + else if (strncmp(special,"ps:",3)==0) + entry->code=special+3; + else + entry->code=special; +#ifdef DEBUG + if (entry->code!=NULL) + DEBUG_PRINT(DEBUG_GS,(" '%s'",entry->code)); + if (entry->filename!=NULL) + DEBUG_PRINT(DEBUG_GS,(" {%s}",entry->filename)); + if (entry->postcode!=NULL) + DEBUG_PRINT(DEBUG_GS,(" '%s'",entry->postcode)); +#endif +} + + + +void ClearPSHeaders(void) +{ + struct pscode *temp=psheaderp; + + while(temp!=NULL) { + psheaderp=psheaderp->next; + if (temp->fmmap.data!=NULL) + UnMmapFile(&(temp->fmmap)); + free(temp); + temp=psheaderp; + } +} + +static void writepscode(FILE* psstream,struct pscode* pscodep) +{ + while (pscodep!=NULL) { + if (pscodep->code!=NULL) { + fputs(pscodep->code,psstream); + putc('\n',psstream); + DEBUG_PRINT(DEBUG_GS,("\n PS CODE:\t%s",pscodep->code)); + } + if (pscodep->filename!=NULL && pscodep->fmmap.data==NULL) { + char* filepath= + kpse_find_file(pscodep->filename,kpse_tex_ps_header_format,false); + if (filepath==NULL) { + Warning("Cannot find PostScript file %s, ignored", pscodep->filename); + page_flags |= PAGE_GAVE_WARN; + } else if (MmapFile(filepath,&(pscodep->fmmap))) { + Warning("PostScript file %s unusable, ignored", pscodep->filename); + page_flags |= PAGE_GAVE_WARN; + } + } + if (pscodep->fmmap.data!=NULL) { + unsigned char* position; + + DEBUG_PRINT(DEBUG_GS,("\n PS FILE:\t%s",pscodep->filename)); + position=(unsigned char*)pscodep->fmmap.data; + while(position + < (unsigned char*)pscodep->fmmap.data + pscodep->fmmap.size) { + putc(*position,psstream); + position++; + } + } + if (pscodep->postcode!=NULL) { + fputs(pscodep->postcode,psstream); + putc('\n',psstream); + DEBUG_PRINT(DEBUG_GS,("\n PS POST CODE:\t%s",pscodep->postcode)); + } + pscodep=pscodep->next; + } +} + + +static gdImagePtr +ps2png(struct pscode* pscodep, const char *device, int hresolution, int vresolution, + int llx, int lly, int urx, int ury, int bgred, int bggreen, int bgblue) +{ + int pspipe[2], pngpipe[2]; +#define READ_END 0 +#define WRITE_END 1 + FILE *psstream=NULL, *pngstream=NULL; + char resolution[STRSIZE]; + /* char devicesize[STRSIZE]; */ + gdImagePtr psimage=NULL; +#ifndef MIKTEX +#ifndef WIN32 + pid_t pid; +#else /* WIN32 */ + unsigned long nexitcode = STILL_ACTIVE; + HANDLE hchild; + int savestdin, savestdout; +#endif /* WIN32 */ +#else /* MIKTEX */ + HANDLE hPngStream; + HANDLE hPsStream; + HANDLE hStdErr; + PROCESS_INFORMATION pi; + _TCHAR szCommandLine[2048]; + _TCHAR szGsPath[_MAX_PATH]; +#define GS_PATH szGsPath +#define fdopen _tfdopen +#define close _close +#endif /* MIKTEX */ + + snprintf(resolution,STRSIZE,"-r%dx%d",hresolution,vresolution); + /* Future extension for \rotatebox + status=sprintf(devicesize, "-g%dx%d", + //(int)((sin(atan(1.0))+1)* + (urx - llx)*hresolution/72,//), + //(int)((sin(atan(1.0))+1)* + (ury - lly)*vresolution/72);//); + */ + DEBUG_PRINT(DEBUG_GS, + ("\n GS CALL:\t%s %s %s %s %s %s %s %s %s %s %s",/* %s", */ + GS_PATH, device, resolution, /*devicesize,*/ + "-dBATCH", "-dNOPAUSE", "-q", "-sOutputFile=-", + "-dTextAlphaBits=4", "-dGraphicsAlphaBits=4", + (option_flags & NO_GSSAFER) ? "-": "-dSAFER", + (option_flags & NO_GSSAFER) ? "": "- ")); +#ifndef MIKTEX + if (pipe(pspipe) || pipe(pngpipe)) return(NULL); +#ifndef WIN32 + /* We have fork: execute gs in child */ + pid = fork(); + if (pid == 0) { /* Child, execute gs. */ + close(pspipe[WRITE_END]); + dup2(pspipe[READ_END], STDIN_FILENO); + close(pspipe[READ_END]); + close(pngpipe[READ_END]); + dup2(pngpipe[WRITE_END], STDOUT_FILENO); + close(pngpipe[WRITE_END]); + execlp(GS_PATH, GS_PATH, device, resolution, /*devicesize,*/ + "-dBATCH", "-dNOPAUSE", "-q", "-sOutputFile=-", + "-dTextAlphaBits=4", "-dGraphicsAlphaBits=4", + (option_flags & NO_GSSAFER) ? "-": "-dSAFER", + (option_flags & NO_GSSAFER) ? NULL: "-", + NULL); + _exit (EXIT_FAILURE); + } +#else /* WIN32 */ + /* No fork but spawn: execute gs in present process environment. + Save fileno's, attach pipes to this process' stdin and stdout. */ + savestdin = _dup(fileno(stdin)); + _dup2(pspipe[READ_END], fileno(stdin)); + savestdout = _dup(fileno(stdout)); + _dup2(pngpipe[WRITE_END], fileno(stdout)); + if ((hchild= + (HANDLE)_spawnlp(_P_NOWAIT, GS_PATH, GS_PATH, device, resolution, + "-dBATCH", "-dNOPAUSE", "-q", "-sOutputFile=-", + "-dTextAlphaBits=4", "-dGraphicsAlphaBits=4", + (option_flags & NO_GSSAFER) ? "-": "-dSAFER", + (option_flags & NO_GSSAFER) ? NULL : "-", NULL))==0) + return NULL; +#endif /* WIN32 */ + close(pspipe[READ_END]); + close(pngpipe[WRITE_END]); +#else /* MIKTEX */ + /* No fork but miktex_start_process3: execute gs using that. + Attach file descriptors to that process' stdin and stdout. */ + if (! miktex_find_miktex_executable("mgs.exe", szGsPath)) { + Warning("Ghostscript could not be found"); + return(NULL); + } + snprintf(szCommandLine,2048,"\"%s\" %s %s %s %s %s %s %s %s %s %s",/* %s",*/ + szGsPath, device, resolution, /*devicesize,*/ + "-dBATCH", "-dNOPAUSE", "-q", "-sOutputFile=-", + "-dTextAlphaBits=4", "-dGraphicsAlphaBits=4", + (option_flags & NO_GSSAFER) ? "-": "-dSAFER", + (option_flags & NO_GSSAFER) ? "": "-"); + if (! miktex_start_process_3(szCommandLine, &pi, INVALID_HANDLE_VALUE, + &hPsStream, &hPngStream, &hStdErr, 0)) { + Warning("Ghostscript could not be started"); + return(NULL); + } + CloseHandle (pi.hThread); + pspipe[WRITE_END] = _open_osfhandle((intptr_t)hPsStream, _O_WRONLY); + pngpipe[READ_END] = _open_osfhandle((intptr_t)hPngStream, _O_RDONLY); +#endif /* MIKTEX */ + if (pspipe[WRITE_END] >= 0) { + if ((psstream=fdopen(pspipe[WRITE_END],"wb")) == NULL) + close(pspipe[WRITE_END]); + else { + writepscode(psstream,psheaderp); + /* Page size */ + DEBUG_PRINT(DEBUG_GS,("\n PS CODE:\t<</PageSize[%d %d]/PageOffset[%d %d[1 1 dtransform exch]{0 ge{neg}if exch}forall]>>setpagedevice", + urx - llx, ury - lly,llx,lly)); + fprintf(psstream, "<</PageSize[%d %d]/PageOffset[%d %d[1 1 dtransform exch]{0 ge{neg}if exch}forall]>>setpagedevice\n", + urx - llx, ury - lly,llx,lly); + /* Background color */ + if ( bgred < 255 || bggreen < 255 || bgblue < 255 ) { + DEBUG_PRINT(DEBUG_GS,("\n PS CODE:\tgsave %f %f %f setrgbcolor clippath fill grestore", + bgred/255.0, bggreen/255.0, bgblue/255.0)); + fprintf(psstream, "gsave %f %f %f setrgbcolor clippath fill grestore\n", + bgred/255.0, bggreen/255.0, bgblue/255.0); + } + writepscode(psstream,pscodep); + fclose(psstream); + } + } + if (pngpipe[READ_END] >= 0) { + if((pngstream=fdopen(pngpipe[READ_END],"rb")) == NULL) + close(pngpipe[READ_END]); + else { + psimage = gdImageCreateFromPng(pngstream); + fclose(pngstream); + } + } +#ifndef MIKTEX +#ifndef WIN32 + /* Wait for child */ + waitpid(pid,NULL,0); +#else + /* Wait for spawned process, restore stdin and stdout */ + while(nexitcode == STILL_ACTIVE) + GetExitCodeProcess((HANDLE)hchild, &nexitcode); + CloseHandle((HANDLE)hchild); + _dup2(savestdin, fileno(stdin)); + _dup2(savestdout, fileno(stdout)); + close(savestdin); + close(savestdout); +#endif /* WIN32 */ +#else /* MIKTEX */ + /* Close miktex process */ + CloseHandle(pi.hProcess); +#endif /* MIKTEX */ +#ifdef DEBUG + if (psimage == NULL) { + DEBUG_PRINT(DEBUG_GS,("\n GS OUTPUT:\tNO IMAGE ")); + } else { + DEBUG_PRINT(DEBUG_GS,("\n GS OUTPUT:\t%dx%d image ", + gdImageSX(psimage),gdImageSY(psimage))); + } +#endif + return psimage; +} + +static gdImagePtr +rescale(gdImagePtr psimage, int pngwidth, int pngheight) +{ + gdImagePtr scaledimage=psimage; + /* Rescale unless correct size */ + if (psimage!=NULL + && gdImageSX(psimage)!=pngwidth + && gdImageSY(psimage)!=pngheight) { + DEBUG_PRINT(DEBUG_DVI, + ("\n RESCALE INCLUDED BITMAP \t(%d,%d) -> (%d,%d)", + gdImageSX(psimage),gdImageSY(psimage), + pngwidth,pngheight)); +#ifdef HAVE_GDIMAGECREATETRUECOLOR + scaledimage=gdImageCreateTrueColor(pngwidth,pngheight); + /* Copy with overwrite, remember that this is the rescaled source + image. The real target has alpha blending on. */ + gdImageAlphaBlending(scaledimage,0); + gdImageCopyResampled(scaledimage,psimage,0,0,0,0, + pngwidth,pngheight, + gdImageSX(psimage),gdImageSY(psimage)); +#else + scaledimage=gdImageCreate(pngwidth,pngheight); + gdImageCopyResized(scaledimage,psimage,0,0,0,0, + pngwidth,pngheight, + gdImageSX(psimage),gdImageSY(psimage)); +#endif + gdImageDestroy(psimage); + } + return(scaledimage); +} + +static void newpsheader(const char* special) { + struct pscode* tmp; + char* txt; + + if (psheaderp==NULL && strcmp(special,"header=tex.pro")!=0) { + newpsheader("header=tex.pro"); + newpsheader("header=color.pro"); + newpsheader("header=special.pro"); + } + if (strcmp(special+strlen(special)-4,".xcp")==0 + && strncmp(special,"header=",7)==0) + InitXColorPrologue(special+7); + if (strncmp(special,"! /pgfH",7)==0) + newpsheader("! TeXDict begin"); + if (psheaderp==NULL) { + if ((tmp=psheaderp=malloc(sizeof(struct pscode)))==NULL) + Fatal("cannot malloc space for PostScript header struct"); + } else { + /* No duplicates. This still misses pre=..., because we still + change that. To be fixed */ + tmp=psheaderp; + if (strcmp(tmp->special,special)==0) + return; + while(tmp->next!=NULL) { + tmp=tmp->next; + if (strcmp(tmp->special,special)==0) + return; + } + if ((tmp->next=malloc(sizeof(struct pscode)))==NULL) + Fatal("cannot malloc space for PostScript header struct"); + tmp=tmp->next; + } + DEBUG_PRINT(DEBUG_GS,("\n PS HEADER ")); + if ((txt=malloc(strlen(special)+1))==NULL) + Fatal("cannot malloc space for PostScript header"); + strcpy(txt,special); + PSCodeInit(tmp,txt); +} + +/*********************************************************************/ +/**************************** SetSpecial ***************************/ +/*********************************************************************/ + +void SetSpecial(char *start, char *end, int32_t hh, int32_t vv) +/* interpret a \special command, made up of keyword=value pairs, + * or !header or ps:raw_PostScript + */ +{ + char *buffer,*special; + + if ((buffer=malloc(end-start+1))==NULL) + Fatal("Cannot allocate space for special"); + special=memcpy(buffer,start,end-start); + special[end-start]='\0'; + DEBUG_PRINT(DEBUG_DVI,(" '%s'",special)); + SKIPSPACES(special); + /********************** Color specials ***********************/ + if (strncmp(special,"background ",11)==0) { + background(special+11); + free(buffer); + return; + } + if (strncmp(special,"color ",6)==0) { + special+=6; + SKIPSPACES(special); + if (strncmp(special,"push ",5)==0) { + pushcolor(special+5); + } else { + if (strcmp(special,"pop")==0) + popcolor(); + else + resetcolorstack(special); + } + free(buffer); + return; + } + + /******************* Image inclusion ********************/ + + /* Needed tests for regression: PNG, GIF, JPEG and EPS inclusion, + * for different gd versions */ + + if (strncmp(special,"PSfile=",7)==0) { /* PSfile */ + char* psname = special+7; + int llx=0,lly=0,urx=0,ury=0,rwi=0,rhi=0; + bool clip=false; + int hresolution,vresolution; + int pngheight,pngwidth; + + /* Remove quotation marks around filename. If no quotation marks, + use first word as filename */ + if (*psname=='"') { + psname++; + special=strrchr(psname,'"'); + } else { + special=strchr(psname,' '); + } + if (special!=NULL) { + *special='\0'; + special++; + } + + /* Retrieve parameters */ + SKIPSPACES(special); + while(special && *special) { + if (strncmp(special,"llx=",4)==0) + llx = strtol(special+4,&special,10); + else if (strncmp(special,"lly=",4)==0) + lly = strtol(special+4,&special,10); + else if (strncmp(special,"urx=",4)==0) + urx = strtol(special+4,&special,10); + else if (strncmp(special,"ury=",4)==0) + ury = strtol(special+4,&special,10); + else if (strncmp(special,"rwi=",4)==0) + rwi = strtol(special+4,&special,10); + else if (strncmp(special,"rhi=",4)==0) + rhi = strtol(special+4,&special,10); + else if (strncmp(special,"clip",4)==0) + {clip = true; special=special+4;} + while (*special && *special!=' ') special++; + SKIPSPACES(special); + } + + /* Calculate resolution, and use our base resolution as a fallback. */ + /* The factor 10 is magic, the dvips graphicx driver needs this. */ + hresolution = ((dpi*rwi+urx-llx-1)/(urx - llx)+9)/10; + vresolution = ((dpi*rhi+ury-lly-1)/(ury - lly)+9)/10; + if (vresolution==0) vresolution = hresolution; + if (hresolution==0) hresolution = vresolution; + if (hresolution==0) hresolution = vresolution = dpi; + + /* Convert from postscript 72 dpi resolution to our given resolution */ + pngwidth = (dpi*rwi+719)/720; /* +719: round up */ + pngheight = (dpi*rhi+719)/720; + if (pngwidth==0) + pngwidth = ((dpi*rhi*(urx-llx)+ury-lly-1)/(ury-lly)+719)/720; + if (pngheight==0) + pngheight = ((dpi*rwi*(ury-lly)+urx-llx-1)/(urx-llx)+719)/720; + if (pngheight==0) { + pngwidth = (dpi*(urx-llx)+71)/72; + pngheight = (dpi*(ury-lly)+71)/72; + } + if (page_imagep != NULL) { /* Draw into image */ + struct pscode image; + gdImagePtr psimage=NULL; +#ifndef HAVE_GDIMAGECREATEFROMPNGPTR + FILE* psstream; +#endif + + PSCodeInit(&image, NULL); + image.filename=kpse_find_file(psname,kpse_pict_format,0); +#if !defined(MIKTEX) && defined(WIN32) + if (image.filename == NULL) { + wchar_t *wnam; + char *tmpnam; + int tmpcp; + tmpcp = file_system_codepage; + file_system_codepage = CP_UTF8; + tmpnam = kpse_find_file(psname,kpse_pict_format,0); + if (tmpnam) { + wnam = get_wstring_from_mbstring(CP_UTF8, tmpnam, wnam=NULL); + if (wnam) { + image.filename = get_mbstring_from_wstring(tmpcp, wnam, image.filename=NULL); + free(wnam); + } + free(tmpnam); + } + file_system_codepage = tmpcp; + } +#endif + if (MmapFile(image.filename,&(image.fmmap)) || image.fmmap.size==0) { + Warning("Image file %s unusable, image will be left blank", + image.filename); + page_flags |= PAGE_GAVE_WARN; + free(buffer); + return; + } + Message(BE_NONQUIET," <%s",psname); + switch ((unsigned char)*image.fmmap.data) { + case 0x89: /* PNG magic: "\211PNG\r\n\032\n" */ + DEBUG_PRINT(DEBUG_DVI,("\n INCLUDE PNG \t%s",image.filename)); +#ifdef HAVE_GDIMAGECREATEFROMPNGPTR + psimage=gdImageCreateFromPngPtr(image.fmmap.size,image.fmmap.data); +#else + psstream=fopen(image.filename,"rb"); + psimage=gdImageCreateFromPng(psstream); + fclose(psstream); +#endif + psimage=rescale(psimage,pngwidth,pngheight); + break; + case 'G': /* GIF magic: "GIF87" or "GIF89" */ + DEBUG_PRINT(DEBUG_DVI,("\n INCLUDE GIF \t%s",image.filename)); +#ifdef HAVE_GDIMAGEGIF + psimage=rescale(gdImageCreateFromGifPtr(image.fmmap.size, + image.fmmap.data), + pngwidth,pngheight); +#else + DEBUG_PRINT(DEBUG_DVI,(" (NO GIF DECODER)")); +#endif + break; + case 0xff: /* JPEG magic: 0xffd8 */ + DEBUG_PRINT(DEBUG_DVI,("\n INCLUDE JPEG \t%s",image.filename)); +#ifdef HAVE_GDIMAGECREATEFROMJPEG +#ifdef HAVE_GDIMAGECREATEFROMPNGPTR + psimage=gdImageCreateFromJpegPtr(image.fmmap.size,image.fmmap.data); +#else + psstream=fopen(image.filename,"rb"); + psimage=gdImageCreateFromJpeg(psstream); + fclose(psstream); +#endif + psimage=rescale(psimage,pngwidth,pngheight); +#else + DEBUG_PRINT(DEBUG_DVI,(" (NO JPEG DECODER)")); +#endif + break; + default: /* Default, PostScript magic: "%!PS-Adobe" */ + if (option_flags & NO_GHOSTSCRIPT) { + Warning("GhostScript calls disallowed by --nogs" ); + page_flags |= PAGE_GAVE_WARN; + } else { + /* Ensure one (and only one) showpage */ + image.code=" /DVIPNGDICT 100 dict def DVIPNGDICT begin /showpage {} def "; + image.postcode=" end showpage\n"; + /* Use alpha blending, and render transparent postscript + images. The alpha blending works correctly only from + libgd 2.0.12 upwards */ +#ifdef HAVE_GDIMAGEPNGEX + if (page_imagep->trueColor) { + int tllx=llx,tlly=lly,turx=urx,tury=ury; + + DEBUG_PRINT((DEBUG_DVI | DEBUG_GS), + ("\n GS RENDER \t%s -> pngalpha ",image.filename)); + if (!clip) { + /* Render across the whole image */ + tllx=llx-(hh+1)*72/hresolution; + tlly=lly-(gdImageSY(page_imagep)-vv-1)*72/vresolution; + turx=llx+(gdImageSX(page_imagep)-hh)*72/hresolution; + tury=lly+(vv+1)*72/vresolution; + DEBUG_PRINT((DEBUG_DVI | DEBUG_GS), + ("\n EXPAND BBOX \t%d %d %d %d -> %d %d %d %d", + llx,lly,urx,ury,tllx,tlly,turx,tury)); +#ifdef DEBUG + } else { + DEBUG_PRINT((DEBUG_DVI | DEBUG_GS),(", CLIPPED TO BBOX")); +#endif + } + psimage = ps2png(&image, "-sDEVICE=pngalpha", + hresolution, vresolution, + tllx, tlly, turx, tury, + 255,255,255); + if (psimage==NULL) + Warning("No GhostScript pngalpha output, opaque image inclusion"); + } else + Warning("Palette output, opaque image inclusion"); +#endif + if (psimage==NULL) { + /* png256 gives inferior result */ + DEBUG_PRINT((DEBUG_DVI | DEBUG_GS), + ("\n GS RENDER \t%s -> png16m", image.filename)); + psimage = ps2png(&image, "-sDEVICE=png16m", + hresolution, vresolution, + llx, lly, urx, ury, + cstack[0].red,cstack[0].green,cstack[0].blue); + clip=true; + page_flags |= PAGE_GAVE_WARN; + } + if (!clip) { + /* Rendering across the whole image */ + hh=0; + vv=gdImageSY(psimage)-1; + } + } + } + UnMmapFile(&(image.fmmap)); + if (psimage!=NULL) { + DEBUG_PRINT(DEBUG_DVI, + ("\n GRAPHIC(X|S) INCLUDE \t%s (%d,%d) res %dx%d at (%d,%d)", + psname,gdImageSX(psimage),gdImageSY(psimage), + hresolution,vresolution,hh,vv)); +#ifdef HAVE_GDIMAGECREATETRUECOLOR + if (psimage->trueColor && !page_imagep->trueColor) + gdImageTrueColorToPalette(psimage,0,256); +#endif +#ifdef HAVE_GDIMAGEPNGEX + gdImageAlphaBlending(page_imagep,1); +#else + Warning("Using libgd < 2.0.12, opaque image inclusion"); + page_flags |= PAGE_GAVE_WARN; +#endif + gdImageCopy(page_imagep, psimage, + hh, vv-gdImageSY(psimage)+1, + 0,0, + gdImageSX(psimage),gdImageSY(psimage)); +#ifdef HAVE_GDIMAGEPNGEX + gdImageAlphaBlending(page_imagep,0); +#endif + gdImageDestroy(psimage); + } else { + Warning("Unable to load %s, image will be left blank",image.filename); + page_flags |= PAGE_GAVE_WARN; + } + free(image.filename); + Message(BE_NONQUIET,">"); + } else { /* Don't draw */ + page_flags |= PAGE_TRUECOLOR; + DEBUG_PRINT(DEBUG_DVI, + ("\n GRAPHIC(X|S) INCLUDE \t%s (%d,%d) res %dx%d at (%d,%d)", + psname,pngheight,pngwidth, + hresolution,vresolution,hh,vv)); + min(x_min,hh); + min(y_min,vv-pngheight+1); + max(x_max,hh+pngwidth); + max(y_max,vv+1); + } + free(buffer); + return; + } + + /******************* Raw PostScript ********************/ + + if (strncmp(special,"!/preview@version(",18)==0) { + int length=0; + special+=18; + while (special[length]!='\0' && special[length]!=')') + length++; + if (page_imagep==NULL) + Message(BE_NONQUIET," (preview-latex version %.*s)",length,special); + free(buffer); + return; + } + + /* preview-latex' tightpage option */ + if (strncmp(special,"!/preview@tightpage",19)==0) { + special+=19; + SKIPSPACES(special); + if (strncmp(special,"true",4)==0) { + if (page_imagep==NULL) + Message(BE_NONQUIET," (preview-latex tightpage option detected, will use its bounding box)"); + dvi->flags |= DVI_PREVIEW_LATEX_TIGHTPAGE; + } + free(buffer); + return; + } + if (strncmp(special,"!userdict",9)==0 + && strstr(special+10,"7{currentfile token not{stop}if 65781.76 div")!=NULL) { + if (page_imagep==NULL && ~dvi->flags & DVI_PREVIEW_LATEX_TIGHTPAGE) + Message(BE_NONQUIET," (preview-latex <= 0.9.1 tightpage option detected, will use its bounding box)"); + dvi->flags |= DVI_PREVIEW_LATEX_TIGHTPAGE; + free(buffer); + return; + } + + /* preview-latex' dvips bop-hook redefinition */ + if (strncmp(special,"!userdict",9)==0 + && strstr(special+10,"preview-bop-")!=NULL) { + dvi->flags |= DVI_PREVIEW_BOP_HOOK; + if (page_imagep==NULL) + Message(BE_VERBOSE," (preview-latex beginning-of-page-hook detected)"); + free(buffer); + return; + } + + if (dvi->flags & DVI_PREVIEW_BOP_HOOK && ~page_flags & PAGE_PREVIEW_BOP + && strncmp(special,"ps::",4)==0) { + /* Hokay, decode bounding box */ + dviunits adj_llx,adj_lly,adj_urx,adj_ury,ht,dp,wd; + adj_llx = strtol(special+4,&special,10); + adj_lly = strtol(special,&special,10); + adj_urx = strtol(special,&special,10); + adj_ury = strtol(special,&special,10); + ht = strtol(special,&special,10); + dp = strtol(special,&special,10); + wd = strtol(special,&special,10); + page_flags |= PAGE_PREVIEW_BOP; + if (wd>0) { + x_offset_tightpage = + (-adj_llx+dvi->conv*shrinkfactor-1)/dvi->conv/shrinkfactor; + x_width_tightpage = x_offset_tightpage + +(wd+adj_urx+dvi->conv*shrinkfactor-1)/dvi->conv/shrinkfactor; + } else { + x_offset_tightpage = + (-wd+adj_urx+dvi->conv*shrinkfactor-1)/dvi->conv/shrinkfactor; + x_width_tightpage = x_offset_tightpage + +(-adj_llx+dvi->conv*shrinkfactor-1)/dvi->conv/shrinkfactor; + } + /* y-offset = height - 1 */ + y_offset_tightpage = + (((ht>0)?ht:0)+adj_ury+dvi->conv*shrinkfactor-1)/dvi->conv/shrinkfactor-1; + y_width_tightpage = y_offset_tightpage+1 + +(((dp>0)?dp:0)-adj_lly+dvi->conv*shrinkfactor-1)/dvi->conv/shrinkfactor; + free(buffer); + return; + } + + if (special[0]=='"' || strncmp(special,"ps:",3)==0) { /* Raw PostScript */ + if (option_flags & NO_RAW_PS) { + Warning("Raw PostScript rendering disallowed by --norawps" ); + page_flags |= PAGE_GAVE_WARN; + free(buffer); + return; + } + if (page_imagep != NULL) { /* Draw into image */ + static struct pscode *pscodep=NULL; + static bool psenvironment=false; + bool nextisps; + struct pscode *tmp; + gdImagePtr psimage=NULL; + char *txt; + const char *specialend=special+strlen(special); + const char *newspecial=NULL; + + /* hyperref non-rendering PostScript specials. */ + if (strcmp(specialend-11,"pdfmark end")==0 + || strcmp(specialend-7,"H.A end")==0 + || strcmp(specialend-7,"H.B end")==0 + || strcmp(specialend-7,"H.L end")==0 + || strcmp(specialend-7,"H.R end")==0 + || strcmp(specialend-7,"H.S end")==0 + || strcmp(specialend-7,"H.V end")==0 + || strncmp(special,"ps:SDict begin /product",23)==0) + if (pscodep==NULL) { + free(buffer); + return; + } else + newspecial=""; + /* pgf PostScript specials. */ + else if (strcmp(special,"ps:: pgfo")==0) + /* pgf page start. The first numbers are generally valid for + the bop instruction, and the latter code is to move the + origin to the right place. */ + newspecial="ps:: 39139632 55387786 1000 600 600 (tikzdefault.dvi) @start 1 0 bop pgfo 0 0 matrix defaultmatrix transform itransform translate"; + else if (strcmp(special,"ps:: pgfc")==0) + newspecial="ps:: pgfc eop end"; + /* Some packages split their raw PostScript code into + several specials. Check for those, and concatenate them so + that they're given to one and the same invocation of gs */ + else if (strncmp(special,"ps::[begin]",11)==0) + psenvironment=true; + else if (strncmp(special,"ps::[end]",9)==0) + psenvironment=false; + if (pscodep==NULL) { + Message(BE_NONQUIET," <raw PostScript"); + if ((tmp=pscodep=malloc(sizeof(struct pscode)))==NULL) + Fatal("cannot malloc space for raw PostScript struct"); + } else { + tmp=pscodep; + while(tmp->next != NULL) + tmp=tmp->next; + if ((tmp->next=malloc(sizeof(struct pscode)))==NULL) + Fatal("cannot malloc space for raw PostScript struct"); + tmp=tmp->next; + } + nextisps=DVIIsNextPSSpecial(dvi); + if (psenvironment || nextisps) { + if (!nextisps) { + Warning("PostScript environment contains DVI commands"); + page_flags |= PAGE_GAVE_WARN; + } + DEBUG_PRINT(DEBUG_GS,("\n PS SPECIAL ")); + if (newspecial == NULL) + newspecial=special; + if ((txt=malloc(strlen(newspecial)+1))==NULL) + Fatal("cannot allocate space for raw PostScript special"); + strcpy(txt,newspecial); + PSCodeInit(tmp,txt); + free(buffer); + return; + } + DEBUG_PRINT(DEBUG_DVI,("\n LAST PS SPECIAL ")); + if (newspecial != NULL) { + if ((special=malloc(strlen(newspecial)+1))==NULL) + Fatal("cannot allocate space for raw PostScript special"); + strcpy(special,newspecial); + } + PSCodeInit(tmp,special); + /* Now, render image */ + if (option_flags & NO_GHOSTSCRIPT) + Warning("GhostScript calls disallowed by --nogs" ); + else { + /* Use alpha blending, and render transparent postscript + images. The alpha blending works correctly only from + libgd 2.0.12 upwards */ +#ifdef HAVE_GDIMAGEPNGEX + if (page_imagep->trueColor) { + /* Render across the whole image */ + psimage = ps2png(pscodep, "-sDEVICE=pngalpha", + dpi,dpi, + -(hh+1)*72/dpi, + -(gdImageSY(page_imagep)-vv-1)*72/dpi, + (gdImageSX(page_imagep)-hh)*72/dpi, + (vv+1)*72/dpi, + 255,255,255); + if (psimage!=NULL) { + gdImageAlphaBlending(page_imagep,1); + gdImageCopy(page_imagep, psimage, + 0,0,0,0, + gdImageSX(psimage),gdImageSY(psimage)); + gdImageAlphaBlending(page_imagep,0); + gdImageDestroy(psimage); + } else + Warning("No image output from inclusion of raw PostScript"); + } else + Warning("Palette output, cannot include raw PostScript"); +#else + Warning("Using libgd < 2.0.12, unable to include raw PostScript"); +#endif + } + while(pscodep->next != NULL) { + tmp=pscodep->next; + free(pscodep->special); + free(pscodep); + pscodep=tmp; + } + free(pscodep); + pscodep=NULL; + if (newspecial != NULL) + free(special); + if (psimage==NULL) + page_flags |= PAGE_GAVE_WARN; + Message(BE_NONQUIET,">"); + } else { /* Don't draw */ + page_flags |= PAGE_TRUECOLOR; + } + free(buffer); + return; + } + + if (strncmp(special,"papersize=",10)==0) { /* papersize spec, ignored */ + free(buffer); + return; + } + + if (special[0]=='!' || strncmp(special,"header=",7)==0) { /* PS header */ + newpsheader(special); + free(buffer); + return; + } + + if (strncmp(special,"src:",4)==0) { /* source special */ + if ( page_imagep != NULL ) + Message(BE_NONQUIET," at (%ld,%ld) source \\special{%s}", + hh, vv, special); + free(buffer); + return; + } + if ( page_imagep != NULL ) { + Warning("at (%ld,%ld) unimplemented \\special{%s}", + hh, vv, special); + page_flags |= PAGE_GAVE_WARN; + } + free(buffer); +} diff --git a/Build/source/texk/dvipng/dvipng-src/test_dvipng.tex b/Build/source/texk/dvipng/dvipng-src/test_dvipng.tex new file mode 100644 index 00000000000..34814776070 --- /dev/null +++ b/Build/source/texk/dvipng/dvipng-src/test_dvipng.tex @@ -0,0 +1,48 @@ +% test_dvipng.tex +% +% Part of the dvipng distribution +% +% This program is free software: you can redistribute it and/or modify +% it under the terms of the GNU Lesser General Public License as +% published by the Free Software Foundation, either version 3 of the +% License, or (at your option) any later version. +% +% This program is distributed in the hope that it will be useful, but +% WITHOUT ANY WARRANTY; without even the implied warranty of +% MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU +% Lesser General Public License for more details. +% +% You should have received a copy of the GNU Lesser General Public +% License along with this program. If not, see +% <http://www.gnu.org/licenses/>. +% +% Copyright (C) 2002-2010 Jan-{\AA}ke Larsson + +\documentclass{article} +%\usepackage[active,textmath]{preview} +\usepackage{color} +\pagestyle{empty} + +\begin{document} +\begin{equation} + \int dx +\end{equation} +\newpage +$\int dx$ +\newpage +$\sqrt2+1=\frac1{\sqrt2-1}$ +\newpage +\framebox{\textbackslash\ttfamily framebox} +\newpage +\( \begin{array}{|r|} \hline a \cr \hline \end{array} \) +\newpage +fig, pig, flask, efficiency, effluent +\newpage +\Huge A \LARGE A \Large A \large A \normalsize A \small A +\footnotesize A \scriptsize A \tiny A +\newpage +\color{yellow} + +\section*{Hello world} +\pagecolor{blue} +\end{document} diff --git a/Build/source/texk/dvipng/dvipng-src/tfm.c b/Build/source/texk/dvipng/dvipng-src/tfm.c new file mode 100644 index 00000000000..ee04383cb45 --- /dev/null +++ b/Build/source/texk/dvipng/dvipng-src/tfm.c @@ -0,0 +1,86 @@ +/* tfm.c */ + +/************************************************************************ + + Part of the dvipng distribution + + This program is free software: you can redistribute it and/or modify + it under the terms of the GNU Lesser General Public License as + published by the Free Software Foundation, either version 3 of the + License, or (at your option) any later version. + + This program is distributed in the hope that it will be useful, but + WITHOUT ANY WARRANTY; without even the implied warranty of + MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU + Lesser General Public License for more details. + + You should have received a copy of the GNU Lesser General Public + License along with this program. If not, see + <http://www.gnu.org/licenses/>. + + Copyright (C) 2002-2009, 2019 Jan-Åke Larsson + +************************************************************************/ + +#include "dvipng.h" + +bool ReadTFM(struct font_entry * tfontp, char* tfmname) +{ + struct filemmap fmmap; + struct char_entry *tcharptr; + unsigned char *position; + int lh,bc,ec,nw, c; + dviunits* width; + + DEBUG_PRINT((DEBUG_DVI|DEBUG_FT|DEBUG_TFM), + ("\n OPEN METRICS:\t'%s'", tfmname)); + if (MmapFile(tfmname,&fmmap)) return(false); + position=(unsigned char*)fmmap.data; + if (fmmap.size<10) Fatal("TFM file %s ends prematurely",tfmname); + lh = UNumRead(position+2,2); + bc = UNumRead(position+4,2); + ec = UNumRead(position+6,2); + nw = UNumRead(position+8,2); + DEBUG_PRINT(DEBUG_TFM,(" %d %d %d %d",lh,bc,ec,nw)); + if (nw>0) { + unsigned char *end=(unsigned char *) fmmap.data+fmmap.size; + if ((width=malloc(nw*sizeof(dviunits)))==NULL) + Fatal("cannot allocate memory for TFM widths"); + c=0; + position=position+24+(lh+ec-bc+1)*4; + while( c < nw ) { + if (position >= end - 4) Fatal("TFM file %s ends prematurely",tfmname); + width[c] = SNumRead(position,4); + c++; + position += 4; + } + /* Read char widths */ + c=bc; + position=(unsigned char*)fmmap.data+24+lh*4; + while(c <= ec) { + if (position >= end) Fatal("TFM file %s ends prematurely",tfmname); + DEBUG_PRINT(DEBUG_TFM,("\n@%ld TFM METRICS:\t", + (long)((char *)position - fmmap.data))); + if ((tcharptr=malloc(sizeof(struct char_entry)))==NULL) + Fatal("cannot allocate memory for TFM char entry"); + tcharptr->data=NULL; + if (*position < nw) { + tcharptr->tfmw=width[*position]; + } else { + Fatal("TFM file %s lacks width for char %u", tfmname, *position); + } + DEBUG_PRINT(DEBUG_TFM,("%d [%d] %d",c,*position,tcharptr->tfmw)); + tcharptr->tfmw = (dviunits) + ((int64_t) tcharptr->tfmw * tfontp->s / (1 << 20)); + DEBUG_PRINT(DEBUG_TFM,(" (%d)",tcharptr->tfmw)); + if (c >= NFNTCHARS) /* Only positive for now */ + Fatal("tfm file %s exceeds char numbering limit %u",tfmname,NFNTCHARS); + tfontp->chr[c] = tcharptr; + c++; + position += 4; + } + free(width); + } + UnMmapFile(&fmmap); + return(true); +} diff --git a/Build/source/texk/dvipng/dvipng-src/vf.c b/Build/source/texk/dvipng/dvipng-src/vf.c new file mode 100644 index 00000000000..28e429eb264 --- /dev/null +++ b/Build/source/texk/dvipng/dvipng-src/vf.c @@ -0,0 +1,144 @@ +/* vf.c */ + +/************************************************************************ + + Part of the dvipng distribution + + This program is free software: you can redistribute it and/or modify + it under the terms of the GNU Lesser General Public License as + published by the Free Software Foundation, either version 3 of the + License, or (at your option) any later version. + + This program is distributed in the hope that it will be useful, but + WITHOUT ANY WARRANTY; without even the implied warranty of + MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU + Lesser General Public License for more details. + + You should have received a copy of the GNU Lesser General Public + License along with this program. If not, see + <http://www.gnu.org/licenses/>. + + Copyright (C) 2002-2015 Jan-Åke Larsson + +************************************************************************/ + +#include "dvipng.h" + +#define VF_ID 202 +#define LONG_CHAR 242 + +int32_t SetVF(struct char_entry* ptr) +{ + struct font_entry* currentvf; + unsigned char *command,*end; + + currentvf=currentfont; + BeginVFMacro(currentvf); + command = ptr->data; + end = command + ptr->length; + while (command < end) { + DEBUG_PRINT(DEBUG_DVI,("\n VF MACRO:\t%s ", dvi_commands[*command])); + DrawCommand(command,currentvf); + command += CommandLength(command); + } + EndVFMacro(); + currentfont=currentvf; + return(ptr->tfmw); +} + + + +void InitVF(struct font_entry * tfontp) +{ + unsigned char* position; + int length; + struct char_entry *tcharptr; + uint32_t c=0; + struct font_num *tfontnump; /* temporary font_num pointer */ + + DEBUG_PRINT((DEBUG_DVI|DEBUG_VF),("\n OPEN FONT:\t'%s'", tfontp->name)); + Message(BE_VERBOSE,"<%s>", tfontp->name); + if (MmapFile(tfontp->name,&(tfontp->fmmap))) + Fatal("font file %s unusable", tfontp->name); + position=(unsigned char*)tfontp->fmmap.data; + if (*(position) != PRE) + Fatal("unknown font format in file %s",tfontp->name); + if (*(position+1) != VF_ID) + Fatal( "wrong version %d of vf file %s (should be 202)", + (int)*(position+1),tfontp->name); + DEBUG_PRINT(DEBUG_VF,("\n VF_PRE:\t'%.*s'", + (int)*(position+2), position+3)); + position = position+3 + *(position+2); + c=UNumRead(position, 4); + DEBUG_PRINT(DEBUG_VF,(" %d", c)); + CheckChecksum (tfontp->c, c, tfontp->name); + tfontp->designsize = UNumRead(position+4,4); + DEBUG_PRINT(DEBUG_VF,(" %d", tfontp->designsize)); + tfontp->type = FONT_TYPE_VF; + tfontp->vffontnump=NULL; + /* Read font definitions */ + position += 8; + while(*position >= FNT_DEF1 && *position <= FNT_DEF4) { + DEBUG_PRINT(DEBUG_VF,("\n @%ld VF:\t%s", + (long)((char *)position - tfontp->fmmap.data), + dvi_commands[*position])); + FontDef(position,tfontp); + length = dvi_commandlength[*position]; + position += length + *(position + length-1) + *(position+length-2); + } + /* Default font is the first defined */ + tfontnump = tfontp->vffontnump; + while (tfontnump->next != NULL) { + tfontnump = tfontnump->next; + } + tfontp->defaultfont=tfontnump->k; + /* Read char definitions */ + while(*position < FNT_DEF1) { + DEBUG_PRINT(DEBUG_VF,("\n@%ld VF CHAR:\t", + (long)((char *)position - tfontp->fmmap.data))); + if ((tcharptr=malloc(sizeof(struct char_entry)))==NULL) + Fatal("cannot allocate memory for VF char entry"); + switch (*position) { + case LONG_CHAR: + tcharptr->length = UNumRead(position+1,4); + c = UNumRead(position+5,4); + tcharptr->tfmw = UNumRead(position+9,4); + position += 13; + break; + default: + tcharptr->length = UNumRead(position,1); + c = UNumRead(position+1,1); + tcharptr->tfmw = UNumRead(position+2,3); + position += 5; + } + DEBUG_PRINT(DEBUG_VF,("%d %d %d",tcharptr->length,c,tcharptr->tfmw)); + tcharptr->tfmw = (int32_t) + ((int64_t) tcharptr->tfmw * tfontp->s / (1 << 20)); + DEBUG_PRINT(DEBUG_VF,(" (%d)",tcharptr->tfmw)); + if (c >= NFNTCHARS) /* Only positive for now */ + Fatal("VF font %s exceeds char numbering limit",tfontp->name); + tfontp->chr[c] = tcharptr; + tcharptr->data=position; + position += tcharptr->length; + } +} + + +void DoneVF(struct font_entry *tfontp) +{ + int c=FIRSTFNTCHAR; + + UnMmapFile(&(tfontp->fmmap)); + while(c<=LASTFNTCHAR) { + if (tfontp->chr[c]!=NULL) { + free(tfontp->chr[c]); + tfontp->chr[c]=NULL; + } + c++; + } + FreeFontNumP(tfontp->vffontnump); + tfontp->vffontnump=NULL; + if (tfontp->name!=NULL) + free(tfontp->name); + tfontp->name=NULL; +} diff --git a/Build/source/texk/dvipng/dvipng-test.dvi b/Build/source/texk/dvipng/dvipng-test.dvi Binary files differnew file mode 100644 index 00000000000..50c00c67bf0 --- /dev/null +++ b/Build/source/texk/dvipng/dvipng-test.dvi diff --git a/Build/source/texk/dvipng/dvipng.test b/Build/source/texk/dvipng/dvipng.test new file mode 100755 index 00000000000..f40c793e859 --- /dev/null +++ b/Build/source/texk/dvipng/dvipng.test @@ -0,0 +1,31 @@ +#! /bin/sh -vx +# $Id$ +# Public domain. Originally written by Peter Breitenlohner, 2009. + +get_val () { + res=`kpsewhich "$@"` || { echo "\"kpsewhich $@\" failed"; exit 77; } +} + +get_val mktex.cnf +TEXMFCNF=`dirname "$res"` +get_val psfonts.map +par=`dirname "$res"` +TEXFONTMAPS=`dirname "$par"`// +get_val 8r.enc +par=`dirname "$res"` +ENCFONTS=`dirname "$par"`// +get_val --expand-var='$TEXMFMAIN' +TEXMFMAIN=$res +get_val --expand-var='$TEXMFDIST' +TEXMFDIST=$res +TEXMFLOCAL=`kpsewhich --expand-var='$TEXMFLOCAL'` + +export TEXMFCNF TEXFONTMAPS ENCFONTS TEXMFMAIN TEXMFDIST TEXMFLOCAL + +./dvipng -T tight -strict $srcdir/dvipng-test.dvi || exit 1 + +echo View the result e.g. with display dvipng-test\*.png + +./dvipng --gif -T tight -strict $srcdir/dvipng-test.dvi || exit 1 + +echo View the result e.g. with display dvipng-test\*.gif diff --git a/Build/source/texk/dvipng/help/Makefile.am b/Build/source/texk/dvipng/help/Makefile.am new file mode 100644 index 00000000000..b9e7f8aea7d --- /dev/null +++ b/Build/source/texk/dvipng/help/Makefile.am @@ -0,0 +1,30 @@ +## Makefile.am for the TeX Live subdirectory texk/dvipng/help/ +## +## Copyright (C) 2009-2013 Peter Breitenlohner <tex-live@tug.org> +## You may freely use, modify and/or distribute this file. +## +DVIPNG_HELP = $(top_srcdir)/doc/dvipng.help + +all-local: help-stamp $(DVIPNG_HELP) + +# If dvipng.help is to be rebuilt, this would fail for a read-only source +# directory, but rebuilding dvipng.info would equally fail. +# Do not even try to rebuild dvipng.help if help-stamp is up to date. +$(DVIPNG_HELP): help-stamp +help-stamp: ../dvipng$(EXEEXT) +if !cross + -(cd .. && ./dvipng$(EXEEXT)) | \ + sed -e's/dvipng.exe/dvipng/' \ + -e's/ (dvipng) / /' \ + -e's/ (dvipng (TeX Live)) / (TeX Live) /' \ + -e's,/lt-dvipng ,/dvipng ,' \ + -e's,^This is .*/dvipng ,This is ./dvipng ,' \ + -e's,^Usage: .*/dvipng ,Usage: ./dvipng ,' > dvipng.tmp + ( test -r $(DVIPNG_HELP) && diff dvipng.tmp $(DVIPNG_HELP) ) \ + || cp dvipng.tmp $(DVIPNG_HELP) + rm -f dvipng.tmp +endif !cross + echo timestamp >$@ + +DISTCLEANFILES = help-stamp + diff --git a/Build/source/texk/dvipng/help/Makefile.in b/Build/source/texk/dvipng/help/Makefile.in new file mode 100644 index 00000000000..c28bca1e956 --- /dev/null +++ b/Build/source/texk/dvipng/help/Makefile.in @@ -0,0 +1,497 @@ +# Makefile.in generated by automake 1.16.3 from Makefile.am. +# @configure_input@ + +# Copyright (C) 1994-2020 Free Software Foundation, Inc. + +# This Makefile.in is free software; the Free Software Foundation +# gives unlimited permission to copy and/or distribute it, +# with or without modifications, as long as this notice is preserved. + +# This program is distributed in the hope that it will be useful, +# but WITHOUT ANY WARRANTY, to the extent permitted by law; without +# even the implied warranty of MERCHANTABILITY or FITNESS FOR A +# PARTICULAR PURPOSE. + +@SET_MAKE@ +VPATH = @srcdir@ +am__is_gnu_make = { \ + if test -z '$(MAKELEVEL)'; then \ + false; \ + elif test -n '$(MAKE_HOST)'; then \ + true; \ + elif test -n '$(MAKE_VERSION)' && test -n '$(CURDIR)'; then \ + true; \ + else \ + false; \ + fi; \ +} +am__make_running_with_option = \ + case $${target_option-} in \ + ?) ;; \ + *) echo "am__make_running_with_option: internal error: invalid" \ + "target option '$${target_option-}' specified" >&2; \ + exit 1;; \ + esac; \ + has_opt=no; \ + sane_makeflags=$$MAKEFLAGS; \ + if $(am__is_gnu_make); then \ + sane_makeflags=$$MFLAGS; \ + else \ + case $$MAKEFLAGS in \ + *\\[\ \ ]*) \ + bs=\\; \ + sane_makeflags=`printf '%s\n' "$$MAKEFLAGS" \ + | sed "s/$$bs$$bs[$$bs $$bs ]*//g"`;; \ + esac; \ + fi; \ + skip_next=no; \ + strip_trailopt () \ + { \ + flg=`printf '%s\n' "$$flg" | sed "s/$$1.*$$//"`; \ + }; \ + for flg in $$sane_makeflags; do \ + test $$skip_next = yes && { skip_next=no; continue; }; \ + case $$flg in \ + *=*|--*) continue;; \ + -*I) strip_trailopt 'I'; skip_next=yes;; \ + -*I?*) strip_trailopt 'I';; \ + -*O) strip_trailopt 'O'; skip_next=yes;; \ + -*O?*) strip_trailopt 'O';; \ + -*l) strip_trailopt 'l'; skip_next=yes;; \ + -*l?*) strip_trailopt 'l';; \ + -[dEDm]) skip_next=yes;; \ + -[JT]) skip_next=yes;; \ + esac; \ + case $$flg in \ + *$$target_option*) has_opt=yes; break;; \ + esac; \ + done; \ + test $$has_opt = yes +am__make_dryrun = (target_option=n; $(am__make_running_with_option)) +am__make_keepgoing = (target_option=k; $(am__make_running_with_option)) +pkgdatadir = $(datadir)/@PACKAGE@ +pkgincludedir = $(includedir)/@PACKAGE@ +pkglibdir = $(libdir)/@PACKAGE@ +pkglibexecdir = $(libexecdir)/@PACKAGE@ +am__cd = CDPATH="$${ZSH_VERSION+.}$(PATH_SEPARATOR)" && cd +install_sh_DATA = $(install_sh) -c -m 644 +install_sh_PROGRAM = $(install_sh) -c +install_sh_SCRIPT = $(install_sh) -c +INSTALL_HEADER = $(INSTALL_DATA) +transform = $(program_transform_name) +NORMAL_INSTALL = : +PRE_INSTALL = : +POST_INSTALL = : +NORMAL_UNINSTALL = : +PRE_UNINSTALL = : +POST_UNINSTALL = : +build_triplet = @build@ +host_triplet = @host@ +subdir = help +ACLOCAL_M4 = $(top_srcdir)/aclocal.m4 +am__aclocal_m4_deps = $(top_srcdir)/m4/gs-device.m4 \ + $(top_srcdir)/m4/makeinfo.m4 \ + $(top_srcdir)/../../m4/kpse-common.m4 \ + $(top_srcdir)/../../m4/kpse-freetype2-flags.m4 \ + $(top_srcdir)/../../m4/kpse-gd-flags.m4 \ + $(top_srcdir)/../../m4/kpse-kpathsea-flags.m4 \ + $(top_srcdir)/../../m4/kpse-libpng-flags.m4 \ + $(top_srcdir)/../../m4/kpse-warnings.m4 \ + $(top_srcdir)/../../m4/kpse-win32.m4 \ + $(top_srcdir)/../../m4/kpse-zlib-flags.m4 \ + $(top_srcdir)/../../m4/libtool.m4 \ + $(top_srcdir)/../../m4/ltoptions.m4 \ + $(top_srcdir)/../../m4/ltsugar.m4 \ + $(top_srcdir)/../../m4/ltversion.m4 \ + $(top_srcdir)/../../m4/lt~obsolete.m4 $(top_srcdir)/version.ac \ + $(top_srcdir)/ac/dvipng.ac $(top_srcdir)/configure.ac +am__configure_deps = $(am__aclocal_m4_deps) $(CONFIGURE_DEPENDENCIES) \ + $(ACLOCAL_M4) +DIST_COMMON = $(srcdir)/Makefile.am $(am__DIST_COMMON) +mkinstalldirs = $(install_sh) -d +CONFIG_HEADER = $(top_builddir)/config.h +CONFIG_CLEAN_FILES = +CONFIG_CLEAN_VPATH_FILES = +AM_V_P = $(am__v_P_@AM_V@) +am__v_P_ = $(am__v_P_@AM_DEFAULT_V@) +am__v_P_0 = false +am__v_P_1 = : +AM_V_GEN = $(am__v_GEN_@AM_V@) +am__v_GEN_ = $(am__v_GEN_@AM_DEFAULT_V@) +am__v_GEN_0 = @echo " GEN " $@; +am__v_GEN_1 = +AM_V_at = $(am__v_at_@AM_V@) +am__v_at_ = $(am__v_at_@AM_DEFAULT_V@) +am__v_at_0 = @ +am__v_at_1 = +SOURCES = +DIST_SOURCES = +am__can_run_installinfo = \ + case $$AM_UPDATE_INFO_DIR in \ + n|no|NO) false;; \ + *) (install-info --version) >/dev/null 2>&1;; \ + esac +am__tagged_files = $(HEADERS) $(SOURCES) $(TAGS_FILES) $(LISP) +am__DIST_COMMON = $(srcdir)/Makefile.in +DISTFILES = $(DIST_COMMON) $(DIST_SOURCES) $(TEXINFOS) $(EXTRA_DIST) +ACLOCAL = @ACLOCAL@ +AMTAR = @AMTAR@ +AM_DEFAULT_VERBOSITY = @AM_DEFAULT_VERBOSITY@ +AM_MAKEINFOFLAGS = @AM_MAKEINFOFLAGS@ +AR = @AR@ +AS = @AS@ +AUTOCONF = @AUTOCONF@ +AUTOHEADER = @AUTOHEADER@ +AUTOMAKE = @AUTOMAKE@ +AWK = @AWK@ +CC = @CC@ +CCDEPMODE = @CCDEPMODE@ +CFLAGS = @CFLAGS@ +CPP = @CPP@ +CPPFLAGS = @CPPFLAGS@ +CYGPATH_W = @CYGPATH_W@ +DEFS = @DEFS@ +DEPDIR = @DEPDIR@ +DLLTOOL = @DLLTOOL@ +DSYMUTIL = @DSYMUTIL@ +DUMPBIN = @DUMPBIN@ +DVIPNG_TREE = @DVIPNG_TREE@ +ECHO_C = @ECHO_C@ +ECHO_N = @ECHO_N@ +ECHO_T = @ECHO_T@ +EGREP = @EGREP@ +EXEEXT = @EXEEXT@ +FGREP = @FGREP@ +FREETYPE2_DEPEND = @FREETYPE2_DEPEND@ +FREETYPE2_INCLUDES = @FREETYPE2_INCLUDES@ +FREETYPE2_LIBS = @FREETYPE2_LIBS@ +FT2_CONFIG = @FT2_CONFIG@ +GD_DEPEND = @GD_DEPEND@ +GD_INCLUDES = @GD_INCLUDES@ +GD_LIBS = @GD_LIBS@ +GREP = @GREP@ +GS = @GS@ +INSTALL = @INSTALL@ +INSTALL_DATA = @INSTALL_DATA@ +INSTALL_INFO = @INSTALL_INFO@ +INSTALL_PROGRAM = @INSTALL_PROGRAM@ +INSTALL_SCRIPT = @INSTALL_SCRIPT@ +INSTALL_STRIP_PROGRAM = @INSTALL_STRIP_PROGRAM@ +KPATHSEA_DEPEND = @KPATHSEA_DEPEND@ +KPATHSEA_INCLUDES = @KPATHSEA_INCLUDES@ +KPATHSEA_LIBS = @KPATHSEA_LIBS@ +LD = @LD@ +LDFLAGS = @LDFLAGS@ +LIBOBJS = @LIBOBJS@ +LIBPNG_DEPEND = @LIBPNG_DEPEND@ +LIBPNG_INCLUDES = @LIBPNG_INCLUDES@ +LIBPNG_LIBS = @LIBPNG_LIBS@ +LIBS = @LIBS@ +LIBTOOL = @LIBTOOL@ +LIPO = @LIPO@ +LN_S = @LN_S@ +LTLIBOBJS = @LTLIBOBJS@ +LT_SYS_LIBRARY_PATH = @LT_SYS_LIBRARY_PATH@ +MAINT = @MAINT@ +MAKEINFO = @MAKEINFO@ +MANIFEST_TOOL = @MANIFEST_TOOL@ +MKDIR_P = @MKDIR_P@ +NM = @NM@ +NMEDIT = @NMEDIT@ +OBJDUMP = @OBJDUMP@ +OBJEXT = @OBJEXT@ +OTOOL = @OTOOL@ +OTOOL64 = @OTOOL64@ +PACKAGE = @PACKAGE@ +PACKAGE_BUGREPORT = @PACKAGE_BUGREPORT@ +PACKAGE_NAME = @PACKAGE_NAME@ +PACKAGE_STRING = @PACKAGE_STRING@ +PACKAGE_TARNAME = @PACKAGE_TARNAME@ +PACKAGE_URL = @PACKAGE_URL@ +PACKAGE_VERSION = @PACKAGE_VERSION@ +PATH_SEPARATOR = @PATH_SEPARATOR@ +PKG_CONFIG = @PKG_CONFIG@ +POW_LIB = @POW_LIB@ +RANLIB = @RANLIB@ +SED = @SED@ +SET_MAKE = @SET_MAKE@ +SHELL = @SHELL@ +STRIP = @STRIP@ +VERSION = @VERSION@ +WARNING_CFLAGS = @WARNING_CFLAGS@ +ZLIB_DEPEND = @ZLIB_DEPEND@ +ZLIB_INCLUDES = @ZLIB_INCLUDES@ +ZLIB_LIBS = @ZLIB_LIBS@ +abs_builddir = @abs_builddir@ +abs_srcdir = @abs_srcdir@ +abs_top_builddir = @abs_top_builddir@ +abs_top_srcdir = @abs_top_srcdir@ +ac_ct_AR = @ac_ct_AR@ +ac_ct_CC = @ac_ct_CC@ +ac_ct_DUMPBIN = @ac_ct_DUMPBIN@ +am__include = @am__include@ +am__leading_dot = @am__leading_dot@ +am__quote = @am__quote@ +am__tar = @am__tar@ +am__untar = @am__untar@ +bindir = @bindir@ +build = @build@ +build_alias = @build_alias@ +build_cpu = @build_cpu@ +build_os = @build_os@ +build_vendor = @build_vendor@ +builddir = @builddir@ +datadir = @datadir@ +datarootdir = @datarootdir@ +docdir = @docdir@ +dvidir = @dvidir@ +exec_prefix = @exec_prefix@ +host = @host@ +host_alias = @host_alias@ +host_cpu = @host_cpu@ +host_os = @host_os@ +host_vendor = @host_vendor@ +htmldir = @htmldir@ +includedir = @includedir@ +infodir = @infodir@ +install_sh = @install_sh@ +libdir = @libdir@ +libexecdir = @libexecdir@ +localedir = @localedir@ +localstatedir = @localstatedir@ +mandir = @mandir@ +mkdir_p = @mkdir_p@ +oldincludedir = @oldincludedir@ +pdfdir = @pdfdir@ +prefix = @prefix@ +program_transform_name = @program_transform_name@ +psdir = @psdir@ +sbindir = @sbindir@ +sharedstatedir = @sharedstatedir@ +srcdir = @srcdir@ +sysconfdir = @sysconfdir@ +target_alias = @target_alias@ +top_build_prefix = @top_build_prefix@ +top_builddir = @top_builddir@ +top_srcdir = @top_srcdir@ +DVIPNG_HELP = $(top_srcdir)/doc/dvipng.help +DISTCLEANFILES = help-stamp +all: all-am + +.SUFFIXES: +$(srcdir)/Makefile.in: @MAINTAINER_MODE_TRUE@ $(srcdir)/Makefile.am $(am__configure_deps) + @for dep in $?; do \ + case '$(am__configure_deps)' in \ + *$$dep*) \ + ( cd $(top_builddir) && $(MAKE) $(AM_MAKEFLAGS) am--refresh ) \ + && { if test -f $@; then exit 0; else break; fi; }; \ + exit 1;; \ + esac; \ + done; \ + echo ' cd $(top_srcdir) && $(AUTOMAKE) --foreign help/Makefile'; \ + $(am__cd) $(top_srcdir) && \ + $(AUTOMAKE) --foreign help/Makefile +Makefile: $(srcdir)/Makefile.in $(top_builddir)/config.status + @case '$?' in \ + *config.status*) \ + cd $(top_builddir) && $(MAKE) $(AM_MAKEFLAGS) am--refresh;; \ + *) \ + echo ' cd $(top_builddir) && $(SHELL) ./config.status $(subdir)/$@ $(am__maybe_remake_depfiles)'; \ + cd $(top_builddir) && $(SHELL) ./config.status $(subdir)/$@ $(am__maybe_remake_depfiles);; \ + esac; + +$(top_builddir)/config.status: $(top_srcdir)/configure $(CONFIG_STATUS_DEPENDENCIES) + cd $(top_builddir) && $(MAKE) $(AM_MAKEFLAGS) am--refresh + +$(top_srcdir)/configure: @MAINTAINER_MODE_TRUE@ $(am__configure_deps) + cd $(top_builddir) && $(MAKE) $(AM_MAKEFLAGS) am--refresh +$(ACLOCAL_M4): @MAINTAINER_MODE_TRUE@ $(am__aclocal_m4_deps) + cd $(top_builddir) && $(MAKE) $(AM_MAKEFLAGS) am--refresh +$(am__aclocal_m4_deps): + +mostlyclean-libtool: + -rm -f *.lo + +clean-libtool: + -rm -rf .libs _libs +tags TAGS: + +ctags CTAGS: + +cscope cscopelist: + + +distdir: $(BUILT_SOURCES) + $(MAKE) $(AM_MAKEFLAGS) distdir-am + +distdir-am: $(DISTFILES) + @srcdirstrip=`echo "$(srcdir)" | sed 's/[].[^$$\\*]/\\\\&/g'`; \ + topsrcdirstrip=`echo "$(top_srcdir)" | sed 's/[].[^$$\\*]/\\\\&/g'`; \ + list='$(DISTFILES)'; \ + dist_files=`for file in $$list; do echo $$file; done | \ + sed -e "s|^$$srcdirstrip/||;t" \ + -e "s|^$$topsrcdirstrip/|$(top_builddir)/|;t"`; \ + case $$dist_files in \ + */*) $(MKDIR_P) `echo "$$dist_files" | \ + sed '/\//!d;s|^|$(distdir)/|;s,/[^/]*$$,,' | \ + sort -u` ;; \ + esac; \ + for file in $$dist_files; do \ + if test -f $$file || test -d $$file; then d=.; else d=$(srcdir); fi; \ + if test -d $$d/$$file; then \ + dir=`echo "/$$file" | sed -e 's,/[^/]*$$,,'`; \ + if test -d "$(distdir)/$$file"; then \ + find "$(distdir)/$$file" -type d ! -perm -700 -exec chmod u+rwx {} \;; \ + fi; \ + if test -d $(srcdir)/$$file && test $$d != $(srcdir); then \ + cp -fpR $(srcdir)/$$file "$(distdir)$$dir" || exit 1; \ + find "$(distdir)/$$file" -type d ! -perm -700 -exec chmod u+rwx {} \;; \ + fi; \ + cp -fpR $$d/$$file "$(distdir)$$dir" || exit 1; \ + else \ + test -f "$(distdir)/$$file" \ + || cp -p $$d/$$file "$(distdir)/$$file" \ + || exit 1; \ + fi; \ + done +check-am: all-am +check: check-am +all-am: Makefile all-local +installdirs: +install: install-am +install-exec: install-exec-am +install-data: install-data-am +uninstall: uninstall-am + +install-am: all-am + @$(MAKE) $(AM_MAKEFLAGS) install-exec-am install-data-am + +installcheck: installcheck-am +install-strip: + if test -z '$(STRIP)'; then \ + $(MAKE) $(AM_MAKEFLAGS) INSTALL_PROGRAM="$(INSTALL_STRIP_PROGRAM)" \ + install_sh_PROGRAM="$(INSTALL_STRIP_PROGRAM)" INSTALL_STRIP_FLAG=-s \ + install; \ + else \ + $(MAKE) $(AM_MAKEFLAGS) INSTALL_PROGRAM="$(INSTALL_STRIP_PROGRAM)" \ + install_sh_PROGRAM="$(INSTALL_STRIP_PROGRAM)" INSTALL_STRIP_FLAG=-s \ + "INSTALL_PROGRAM_ENV=STRIPPROG='$(STRIP)'" install; \ + fi +mostlyclean-generic: + +clean-generic: + +distclean-generic: + -test -z "$(CONFIG_CLEAN_FILES)" || rm -f $(CONFIG_CLEAN_FILES) + -test . = "$(srcdir)" || test -z "$(CONFIG_CLEAN_VPATH_FILES)" || rm -f $(CONFIG_CLEAN_VPATH_FILES) + -test -z "$(DISTCLEANFILES)" || rm -f $(DISTCLEANFILES) + +maintainer-clean-generic: + @echo "This command is intended for maintainers to use" + @echo "it deletes files that may require special tools to rebuild." +clean: clean-am + +clean-am: clean-generic clean-libtool mostlyclean-am + +distclean: distclean-am + -rm -f Makefile +distclean-am: clean-am distclean-generic + +dvi: dvi-am + +dvi-am: + +html: html-am + +html-am: + +info: info-am + +info-am: + +install-data-am: + +install-dvi: install-dvi-am + +install-dvi-am: + +install-exec-am: + +install-html: install-html-am + +install-html-am: + +install-info: install-info-am + +install-info-am: + +install-man: + +install-pdf: install-pdf-am + +install-pdf-am: + +install-ps: install-ps-am + +install-ps-am: + +installcheck-am: + +maintainer-clean: maintainer-clean-am + -rm -f Makefile +maintainer-clean-am: distclean-am maintainer-clean-generic + +mostlyclean: mostlyclean-am + +mostlyclean-am: mostlyclean-generic mostlyclean-libtool + +pdf: pdf-am + +pdf-am: + +ps: ps-am + +ps-am: + +uninstall-am: + +.MAKE: install-am install-strip + +.PHONY: all all-am all-local check check-am clean clean-generic \ + clean-libtool cscopelist-am ctags-am distclean \ + distclean-generic distclean-libtool distdir dvi dvi-am html \ + html-am info info-am install install-am install-data \ + install-data-am install-dvi install-dvi-am install-exec \ + install-exec-am install-html install-html-am install-info \ + install-info-am install-man install-pdf install-pdf-am \ + install-ps install-ps-am install-strip installcheck \ + installcheck-am installdirs maintainer-clean \ + maintainer-clean-generic mostlyclean mostlyclean-generic \ + mostlyclean-libtool pdf pdf-am ps ps-am tags-am uninstall \ + uninstall-am + +.PRECIOUS: Makefile + + +all-local: help-stamp $(DVIPNG_HELP) + +# If dvipng.help is to be rebuilt, this would fail for a read-only source +# directory, but rebuilding dvipng.info would equally fail. +# Do not even try to rebuild dvipng.help if help-stamp is up to date. +$(DVIPNG_HELP): help-stamp +help-stamp: ../dvipng$(EXEEXT) +@cross_FALSE@ -(cd .. && ./dvipng$(EXEEXT)) | \ +@cross_FALSE@ sed -e's/dvipng.exe/dvipng/' \ +@cross_FALSE@ -e's/ (dvipng) / /' \ +@cross_FALSE@ -e's/ (dvipng (TeX Live)) / (TeX Live) /' \ +@cross_FALSE@ -e's,/lt-dvipng ,/dvipng ,' \ +@cross_FALSE@ -e's,^This is .*/dvipng ,This is ./dvipng ,' \ +@cross_FALSE@ -e's,^Usage: .*/dvipng ,Usage: ./dvipng ,' > dvipng.tmp +@cross_FALSE@ ( test -r $(DVIPNG_HELP) && diff dvipng.tmp $(DVIPNG_HELP) ) \ +@cross_FALSE@ || cp dvipng.tmp $(DVIPNG_HELP) +@cross_FALSE@ rm -f dvipng.tmp + echo timestamp >$@ + +# Tell versions [3.59,3.63) of GNU make to not export all variables. +# Otherwise a system limit (for SysV at least) may be exceeded. +.NOEXPORT: diff --git a/Build/source/texk/dvipng/m4/gs-device.m4 b/Build/source/texk/dvipng/m4/gs-device.m4 new file mode 100644 index 00000000000..6b726f2e91f --- /dev/null +++ b/Build/source/texk/dvipng/m4/gs-device.m4 @@ -0,0 +1,41 @@ +# Autoconf macros for dvipng. +# Copyright (C) 2002-2010 Jan-Åke Larsson <jan-ake.larsson@liu.se> +# Copyright (C) 2010-2013 Peter Breitenlohner <tex-live@tug.org> +# +# This file is free software; the copyright holders +# give unlimited permission to copy and/or distribute it, +# with or without modifications, as long as this notice is preserved. +# +# Extracted from dvipng-1.12/aclocal.m4 and adapted for use in TeX Live. + +# GS_CHECK_DEVICES +# ---------------- +# Check GS (ghostscript) devices. +AC_DEFUN([GS_CHECK_DEVICES], [dnl +GS_WARN= +_GS_HAS_DEVICE([pngalpha], + [GS_WARN="Your EPS inclusions will be cropped to the + boundingbox, and rendered on an opaque background. + Upgrade GhostScript to avoid this." + _GS_HAS_DEVICE([png16m], + [GS_WARN="Your EPS inclusions may not work. + Upgrade/install GhostScript to avoid this."])]) +if test -n "$GS_WARN"; then + AC_MSG_WARN([$GS_WARN]) +fi +]) # GS_CHECK_DEVICES + +# _GS_HAS_DEVICE(DEVICE, ACTION-IF-FAILED) +# ---------------------------------------- +# Internal subroutine. Check if GS has the device DEVICE and +# execute the shell code ACTION-IF-FAILED if not. +m4_define([_GS_HAS_DEVICE], [dnl +AC_MSG_CHECKING([whether $GS has the $1 device]) +if $GS -h | grep $1 >/dev/null; then + AC_MSG_RESULT([yes]) +else + AC_MSG_RESULT([no]) + $2 +fi +])# _GS_HAS_DEVICE + diff --git a/Build/source/texk/dvipng/m4/makeinfo.m4 b/Build/source/texk/dvipng/m4/makeinfo.m4 new file mode 100644 index 00000000000..0ddff45ecde --- /dev/null +++ b/Build/source/texk/dvipng/m4/makeinfo.m4 @@ -0,0 +1,41 @@ +# Autoconf macros for dvipng. +# Copyright (C) 2002-2008 Jan-Åke Larsson <jan-ake.larsson@liu.se> +# Copyright (C) 2008-2013 Peter Breitenlohner <tex-live@tug.org> +# +# This file is free software; the copyright holders +# give unlimited permission to copy and/or distribute it, +# with or without modifications, as long as this notice is preserved. +# +# Extracted from dvipng-1.9/aclocal.m4 and adapted for use in TeX Live. + +# MAKEINFO_CHECK_MACROS(MACRO ...) +# -------------------------------- +# For each MACRO check if makeinfo understands @MACRO{}. +# Prepend '-D no-MACRO' for each MACRO not understood to the +# output variable AM_MAKEINFOFLAGS. +AC_DEFUN([MAKEINFO_CHECK_MACROS], [dnl +if test -n "$MAKEINFO" -a "$MAKEINFO" != ":"; then + for ac_macro in $1; do + _MAKEINFO_CHECK_MACRO([$ac_macro]) + done +fi +AC_SUBST([AM_MAKEINFOFLAGS]) +])# MAKEINFO_CHECK_MACROS + +# _MAKEINFO_CHECK_MACRO(MACRO) +# ---------------------------- +# Internal subroutine. Check if makeinfo understands @MACRO{} +# and prepend '-D no-MACRO' to AM_MAKEINFOFLAGS if not. +m4_define([_MAKEINFO_CHECK_MACRO], [dnl +AC_MSG_CHECKING([if $MAKEINFO understands @$1{}]) +echo \\\\input texinfo > conftest.texi +echo @$1{test} >> conftest.texi +if $MAKEINFO conftest.texi > /dev/null 2> /dev/null; then + AC_MSG_RESULT([yes]) +else + AC_MSG_RESULT([no]) + AM_MAKEINFOFLAGS="-D no-$1 $AM_MAKEINFOFLAGS" +fi +rm -f conftest.texi conftest.info +])# _MAKEINFO_CHECK_MACRO + diff --git a/Build/source/texk/dvipng/version.ac b/Build/source/texk/dvipng/version.ac new file mode 100644 index 00000000000..63e89299a64 --- /dev/null +++ b/Build/source/texk/dvipng/version.ac @@ -0,0 +1,12 @@ +dnl +dnl Copyright 2016-2019 Karl Berry <tex-live@tug.org> +dnl Copyright 2013-2015 Peter Breitenlohner <tex-live@tug.org> +dnl +dnl This file is free software; the copyright holder +dnl gives unlimited permission to copy and/or distribute it, +dnl with or without modifications, as long as this notice is preserved. +dnl +dnl -------------------------------------------------------- +dnl +dnl m4-include this file to define the current dvipng version +m4_define([dvipng_version], [1.17]) |