summaryrefslogtreecommitdiff
path: root/Master/texmf-dist/scripts
diff options
context:
space:
mode:
authorKarl Berry <karl@freefriends.org>2008-10-12 17:18:38 +0000
committerKarl Berry <karl@freefriends.org>2008-10-12 17:18:38 +0000
commit7800349461c795f293e70e58022fcad1055fbf9e (patch)
tree8f32c357e7beac1b65072f113e95411d04f6eb55 /Master/texmf-dist/scripts
parent6c9096722a86a9bc2f9d78b7b4ec5d2245910d6b (diff)
latexmk 4.01 (29sep08)
git-svn-id: svn://tug.org/texlive/trunk@10937 c570f23f-e606-0410-a88d-b1316a301751
Diffstat (limited to 'Master/texmf-dist/scripts')
-rwxr-xr-xMaster/texmf-dist/scripts/latexmk/latexmk.pl6031
1 files changed, 6031 insertions, 0 deletions
diff --git a/Master/texmf-dist/scripts/latexmk/latexmk.pl b/Master/texmf-dist/scripts/latexmk/latexmk.pl
new file mode 100755
index 00000000000..4d124a67893
--- /dev/null
+++ b/Master/texmf-dist/scripts/latexmk/latexmk.pl
@@ -0,0 +1,6031 @@
+eval '(exit $?0)' && eval 'exec perl -x -S "$0" ${1+"$@"}' &&
+eval 'exec perl -x -S "$0" $argv:q'
+if 0;
+#!/usr/bin/perl -w
+#!/opt/local/bin/perl -w
+#!/usr/local/bin/perl -w
+# The above code allows this script to be run under UNIX/LINUX without
+# the need to adjust the path to the perl program in a "shebang" line.
+# (The location of perl changes between different installations, and
+# may even be different when several computers running different
+# flavors of UNIX/LINUX share a copy of latex or other scripts.) The
+# script is started under the default command interpreter sh, and the
+# evals in the first two lines restart the script under perl, and work
+# under various flavors of sh. The -x switch tells perl to start the
+# script at the first #! line containing "perl". The "if 0;" on the
+# 3rd line converts the first two lines into a valid perl statement
+# that does nothing.
+#
+# Source of the above: manpage for perlrun
+
+# Delete #??!! when working
+
+# See ?? <===============================
+
+# Results of 8 Sep 2007:
+
+# Some improvements relative to the issues below.
+
+# ????????:
+# Why is bibtex not always running right? Or running when it shouldn't
+# I've put in rdb_make_links in a few places.
+# and rdb_write
+# Problem is that aux file is always out of date, until after a
+# primary run. Ensure fdb and c. is updated enough etc.
+# I may have it correct now: fdb_write in makeB
+# See also routine rdb_update_files_for_rule, and who calls it
+
+# Apparently excess runs of latex after change in .tex file that entails
+# change in bibliography.
+
+# Now I am missing diagnostics
+
+
+## ???!!!!!!!!!!!!! Should I remove bibtex rule? NO
+## ?? Need to set dependence of extra bibtex rules on .bib file
+## ?? Put $pass as variable in rule.
+
+#=======================================
+
+
+#?? Check all code for rdb stuff.
+#?? Use of $update and $failure, etc
+# Especially in pvc. Should I restore source file set up
+# if there is a latex error??????????????????????
+#?? Force mode doesn't appear to do force (if error in latex file)
+#??? Get banner back in.
+#?? ==> Clean up of rdb. It accumulates files that aren't in use any more.
+# Restrict to dependents (existent or not) discovered during
+# parse of log file, and its consequences.
+#?? CORRECT DIAGNOSTICS ON CHANGED FILES IF THEY DIDN'T EXIST BEFORE
+#?? Further corrections to deal with disappeared source files for custom dependencies.
+# Message repeatedly appears about remake when source file of cusdep doesn't exist.
+#?? logfile w/o fdb file: don't set changed file, perhaps for generated exts.
+# Reconsider
+#?? Do proper run-stuff for bibtex, makeindex, cus-deps. OK I think
+# Parse and correctly find bst and ist files
+#?? Remove superfluous code when it's working. Mostly done.
+#?? update_source_times in particular. I think it's done OK
+#?? Add making of other files to rdb. Unify
+#?? Ditto for printing and viewing?
+#?? Update documentation
+
+# ATTEMPT TO ALLOW FILENAMES WITH SPACES:
+# (as of 1 Apr 2006, and then 14 Sep. 2007)
+
+# Problems:
+# A. Quoting filenames will not always work.
+# a. Under UNIX, quotes are legal in filenames, so when PERL
+# directly runs a binary, a quoted filename will be treated as
+# as a filename containing a quote character. But when it calls
+# a shell, the quotes are handled by the shell as quotes.
+# b. Under MSWin32, quotes are illegal filename characters, and tend
+# to be handled correctly.
+# c. But under cygwin, results are not so clear (there are many
+# combinations: native v. cygwin perl, native v cygwin programs
+# NT v. unix scripts, which shell is called.
+# B. TeX doesn't always handle filenames with spaces gracefully.
+# a. UNIX/LINUX: The version on gluon2 Mar 31, 2006 to Sep. 2007)
+# doesn't handle them at all. (TeX treats space as separator.)
+# b. At least some later versions actually do (Brad Miller e-mail,
+# Sep. 2007).
+# c. fptex [[e-TeXk, Version 3.141592-2.1 (Web2c 7.5.2)] does, on
+# my MSWin at home. In \input the filename must be in quotes.
+# d. Bibtex [BibTeX (Web2c 7.5.2) 0.99c on my MSWin system at home,
+# Sep. 2007] does not allow names of bibfiles to have spaces.
+# C. =====> Using the shell for command lines is not safe, since special
+# characters can cause lots of mayhem.
+# It will therefore be a good idea to sanitize filenames.
+#
+# I've sanitized all calls out:
+# a. system and exec use a single argument, which forces
+# use of shell, under all circumstances
+# Thus I can safely use quotes on filenames: They will be handled by
+# the shell under UNIX, and simply passed on to the program under MSWin32.
+# b. I reorganized Run, Run_Detached to use single command line
+# c. All calls to Run and Run_Detached have quoted filenames.
+# d. So if a space-free filename with wildcards is given on latexmk's
+# command line, and it globs to space-containing filename(s), that
+# works (fptex on home computer, native NT tex)
+# e. ====> But globbing fails: the glob function takes space as filename
+# separator. ====================
+
+#================= TO DO ================
+#
+# 1. See ?? ESPECIALLY $MSWin_fudge_break
+# 2. Check fudged conditions in looping and make_files
+# 3. Should not completely abort after a run that ends in failure from latex
+# Missing input files (including via custom dependency) should be checked for
+# a change in status
+# If sources for missing files from custom dependency
+# are available, then do a rerun
+# If sources of any kind become available rerun (esp. for pvc)
+# rerun
+# Must parse log_file after unsuccessful run of latex: it may give
+# information about missing files.
+# 4. Check file of bug reports and requests
+# 5. Rationalize bibtex warnings and errors. Two almost identical routines.
+# Should 1. Use single routine
+# 2. Convert errors to failure only in calling routine
+# 3. Save first warning/error.
+
+
+# To do:
+# Rationalize again handling of include files.
+# Now I use kpsewhich to do searches, if file not found
+# (How do I avoid getting slowed down too much?)
+# Better parsing of log file for includes.
+# Document the assumptions at each stage of processing algorithm.
+# Option to restart previewer automatically, if it dies under -pvc
+# Test for already running previewer gets wrong answer if another
+# process has the viewed file in its command line
+
+$my_name = 'latexmk';
+$My_name = 'Latexmk';
+$version_num = '4.01';
+$version_details = "$My_name, John Collins, 24 September 2008";
+
+
+use Config;
+use File::Copy;
+use File::Basename;
+use FileHandle;
+use File::Find;
+use Cwd; # To be able to change cwd
+use Cwd "chdir"; # Ensure $ENV{PWD} tracks cwd
+use Digest;
+
+#use strict;
+
+# The following variables are assigned once and then used in symbolic
+# references, so we need to avoid warnings 'name used only once':
+use vars qw( $dvi_update_command $ps_update_command $pdf_update_command );
+
+# Translation of signal names to numbers and vv:
+%signo = ();
+@signame = ();
+if ( defined $Config{sig_name} ) {
+ $i = 0;
+ foreach $name (split(' ', $Config{sig_name})) {
+ $signo{$name} = $i;
+ $signame[$i] = $name;
+ $i++;
+ }
+}
+else {
+ warn "Something wrong with the perl configuration: No signals?\n";
+}
+
+## Copyright John Collins 1998-2008
+## (username collins at node phys.psu.edu)
+## (and thanks to David Coppit (username david at node coppit.org)
+## for suggestions)
+## Copyright Evan McLean
+## (modifications up to version 2)
+## Copyright 1992 by David J. Musliner and The University of Michigan.
+## (original version)
+##
+## This program is free software; you can redistribute it and/or modify
+## it under the terms of the GNU General Public License as published by
+## the Free Software Foundation; either version 2 of the License, or
+## (at your option) any later version.
+##
+## This program is distributed in the hope that it will be useful,
+## but WITHOUT ANY WARRANTY; without even the implied warranty of
+## MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
+## GNU General Public License for more details.
+##
+## You should have received a copy of the GNU General Public License
+## along with this program; if not, write to the Free Software
+## Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307
+##
+##
+##
+## NEW FEATURES, since v. 2.0:
+## 1. Correct algorithm for deciding how many times to run latex:
+## based on whether source file(s) change between runs
+## 2. Continuous preview works, and can be of ps file or dvi file
+## 3. pdf creation by pdflatex possible
+## 4. Defaults for commands are OS dependent.
+## 5. Parsing of log file instead of source file is used to
+## obtain dependencies, by default.
+##
+## Modification log for 28 Mar 2007 onwards in detail
+##
+## 24 Sep 2008, John Collins Release version 4.01.
+##
+## 1998-2008, John Collins. Many improvements and fixes.
+##
+## Modified by Evan McLean (no longer available for support)
+## Original script (RCS version 2.3) called "go" written by David J. Musliner
+##
+## 2.0 - Final release, no enhancements. LatexMk is no longer supported
+## by the author.
+## 1.9 - Fixed bug that was introduced in 1.8 with path name fix.
+## - Fixed buglet in man page.
+## 1.8 - Add not about announcement mailling list above.
+## - Added texput.dvi and texput.aux to files deleted with -c and/or
+## the -C options.
+## - Added landscape mode (-l option and a bunch of RC variables).
+## - Added sensing of "\epsfig{file=...}" forms in dependency generation.
+## - Fixed path names when specified tex file is not in the current
+## directory.
+## - Fixed combined use of -pvc and -s options.
+## - Fixed a bunch of speling errors in the source. :-)
+## - Fixed bugs in xdvi patches in contrib directory.
+## 1.7 - Fixed -pvc continuous viewing to reattach to pre-existing
+## process correctly.
+## - Added $pscmd to allow changing process grepping for different
+## systems.
+## 1.6 - Fixed buglet in help message
+## - Fixed bugs in detection of input and include files.
+## 1.5 - Removed test message I accidentally left in version 1.4
+## - Made dvips use -o option instead of stdout redirection as some
+## people had problems with dvips not going to stdout by default.
+## - Fixed bug in input and include file detection
+## - Fixed dependency resolution process so it detects new .toc file
+## and makeindex files properly.
+## - Added dvi and postscript filtering options -dF and -pF.
+## - Added -v version commmand.
+## 1.4 - Fixed bug in -pvc option.
+## - Made "-F" option include non-existant file in the dependency list.
+## (RC variable: $force_include_mode)
+## - Added .lot and .lof files to clean up list of extensions.
+## - Added file "texput.log" to list of files to clean for -c.
+## - LatexMk now handles file names in a similar fashion to latex.
+## The ".tex" extension is no longer enforced.
+## - Added $texfile_search RC variable to look for default files.
+## - Fixed \input and \include so they add ".tex" extension if necessary.
+## - Allow intermixing of file names and options.
+## - Added "-d" and banner options (-bm, -bs, and -bi).
+## (RC variables: $banner, $banner_message, $banner_scale,
+## $banner_intensity, $tmpdir)
+## - Fixed "-r" option to detect an command line syntax errors better.
+## 1.3 - Added "-F" option, patch supplied by Patrick van der Smagt.
+## 1.2 - Added "-C" option.
+## - Added $clean_ext and $clean_full_ext variables for RC files.
+## - Added custom dependency generation capabilities.
+## - Added command line and variable to specify custom RC file.
+## - Added reading of rc file in current directly.
+## 1.1 - Fixed bug where Dependency file generation header is printed
+## rependatively.
+## - Fixed bug where TEXINPUTS path is searched for file that was
+## specified with absolute an pathname.
+## 1.0 - Ripped from script by David J. Musliner (RCS version 2.3) called "go"
+## - Fixed a couple of file naming bugs
+## e.g. when calling latex, left the ".tex" extension off the end
+## of the file name which could do some interesting things
+## with some file names.
+## - Redirected output of dvips. My version of dvips was a filter.
+## - Cleaned up the rc file mumbo jumbo and created a dependency file
+## instead. Include dependencies are always searched for if a
+## dependency file doesn't exist. The -i option regenerates the
+## dependency file.
+## Getting rid of the rc file stuff also gave the advantage of
+## not being restricted to one tex file per directory.
+## - Can specify multiple files on the command line or no files
+## on the command line.
+## - Removed lpr options stuff. I would guess that generally,
+## you always use the same options in which case they can
+## be set up from an rc file with the $lpr variable.
+## - Removed the dviselect stuff. If I ever get time (or money :-) )
+## I might put it back in if I find myself needing it or people
+## express interest in it.
+## - Made it possible to view dvi or postscript file automatically
+## depending on if -ps option selected.
+## - Made specification of dvi file viewer seperate for -pv and -pvc
+## options.
+##-----------------------------------------------------------------------
+
+
+## Explicit exit codes:
+## 10 = bad command line arguments
+## 11 = file specified on command line not found
+## or other file not found
+## 12 = failure in some part of making files
+## 13 = error in initialization file
+## 20 = probable bug
+## or retcode from called program.
+
+
+#Line length in log file that indicates wrapping.
+# This number EXCLUDES line-end characters, and is one-based
+$log_wrap = 79;
+
+#########################################################################
+## Default parsing and file-handling settings
+
+## Array of reg-exps for patterns in log-file for file-not-found
+## Each item is the string in a regexp, without the enclosing slashes.
+## First parenthesized part is the filename.
+## Note the need to quote slashes and single right quotes to make them
+## appear in the regexp.
+## Add items by push, e.g.,
+## push @file_not_found, '^No data file found `([^\\\']*)\\\'';
+## will give match to line starting "No data file found `filename'"
+@file_not_found = (
+ '^No file\\s*(.*)\\.$',
+ '^\\! LaTeX Error: File `([^\\\']*)\\\' not found\\.',
+ '.*?:\\d*: LaTeX Error: File `([^\\\']*)\\\' not found\\.',
+ '^LaTeX Warning: File `([^\\\']*)\\\' not found',
+ '^Package .* file `([^\\\']*)\\\' not found',
+);
+
+## Hash mapping file extension (w/o period, e.g., 'eps') to a single regexp,
+# whose matching by a line in a file with that extension indicates that the
+# line is to be ignored in the calculation of the hash number (md5 checksum)
+# for the file. Typically used for ignoring datestamps in testing whether
+# a file has changed.
+# Add items e.g., by
+# $hash_calc_ignore_pattern{'eps'} = '^%%CreationDate: ';
+# This makes the hash calculation for an eps file ignore lines starting with
+# '%%CreationDate: '
+# ?? Note that a file will be considered changed if
+# (a) its size changes
+# or (b) its hash changes
+# So it is useful to ignore lines in the hash calculation only if they
+# are of a fixed size (as with a date/time stamp).
+%hash_calc_ignore_pattern =();
+
+#########################################################################
+## Default document processing programs, and related settings,
+## These are mostly the same on all systems.
+## Most of these variables represents the external command needed to
+## perform a certain action. Some represent switches.
+
+## Commands to invoke latex, pdflatex
+$latex = 'latex %O %S';
+$pdflatex = 'pdflatex %O %S';
+## Switch(es) to make them silent:
+$latex_silent_switch = '-interaction=batchmode';
+$pdflatex_silent_switch = '-interaction=batchmode';
+
+## Command to invoke bibtex
+$bibtex = 'bibtex %O %B';
+# Switch(es) to make bibtex silent:
+$bibtex_silent_switch = '-terse';
+
+## Command to invoke makeindex
+$makeindex = 'makeindex %O -o %D %S';
+# Switch(es) to make makeinex silent:
+$makeindex_silent_switch = '-q';
+
+## Command to convert dvi file to pdf file directly:
+$dvipdf = 'dvipdf %O %S %D';
+
+## Command to convert dvi file to ps file:
+$dvips = 'dvips %O -o %D %S';
+## Command to convert dvi file to ps file in landscape format:
+$dvips_landscape = 'dvips -tlandscape %O -o %D %S';
+# Switch(es) to get dvips to make ps file suitable for conversion to good pdf:
+# (If this is not used, ps file and hence pdf file contains bitmap fonts
+# (type 3), which look horrible under acroread. An appropriate switch
+# ensures type 1 fonts are generated. You can put this switch in the
+# dvips command if you prefer.)
+$dvips_pdf_switch = '-P pdf';
+# Switch(es) to make dvips silent:
+$dvips_silent_switch = '-q';
+
+## Command to convert ps file to pdf file:
+$ps2pdf = 'ps2pdf %O %S %D';
+
+## Command to search for tex-related files
+$kpsewhich = 'kpsewhich %S';
+
+
+##Printing:
+$print_type = 'ps'; # When printing, print the postscript file.
+ # Possible values: 'dvi', 'ps', 'pdf', 'none'
+
+## Which treatment of default extensions and filenames with
+## multiple extensions is used, for given filename on
+## tex/latex's command line? See sub find_basename for the
+## possibilities.
+## Current tex's treat extensions like UNIX teTeX:
+$extension_treatment = 'unix';
+
+$dvi_update_signal = undef;
+$ps_update_signal = undef;
+$pdf_update_signal = undef;
+
+$dvi_update_command = undef;
+$ps_update_command = undef;
+$pdf_update_command = undef;
+
+$new_viewer_always = 0; # If 1, always open a new viewer in pvc mode.
+ # If 0, only open a new viewer if no previous
+ # viewer for the same file is detected.
+
+$quote_filenames = 1; # Quote filenames in external commands
+
+#########################################################################
+
+################################################################
+## Special variables for system-dependent fudges, etc.
+$MSWin_fudge_break = 1; # Give special treatment to ctrl/C and ctrl/break
+ # in -pvc mode under MSWin
+ # Under MSWin32 (at least with perl 5.8 and WinXP)
+ # when latemk is running another program, and the
+ # user gives ctrl/C or ctrl/break, to stop the
+ # daughter program, not only does it reach
+ # the daughter, but also latexmk/perl, so
+ # latexmk is stopped also. In -pvc mode,
+ # this is not normally desired. So when the
+ # $MSWin_fudge_break variable is set,
+ # latexmk arranges to ignore ctrl/C and
+ # ctrl/break during processing of files;
+ # only the daughter programs receive them.
+ # This fudge is not applied in other
+ # situations, since then having latexmk also
+ # stopping because of the ctrl/C or
+ # ctrl/break signal is desirable.
+ # The fudge is not needed under UNIX (at least
+ # with Perl 5.005 on Solaris 8). Only the
+ # daughter programs receive the signal. In
+ # fact the inverse would be useful: In
+ # normal processing, as opposed to -pvc, if
+ # force mode (-f) is set, a ctrl/C is
+ # received by a daughter program does not
+ # also stop latexmk. Under tcsh, we get
+ # back to a command prompt, while latexmk
+ # keeps running in the background!
+
+
+################################################################
+
+
+# System-dependent overrides:
+if ( $^O eq "MSWin32" ) {
+# Pure MSWindows configuration
+ ## Configuration parameters:
+
+ ## Use first existing case for $tmpdir:
+ $tmpdir = $ENV{TMPDIR} || $ENV{TEMP} || '.';
+
+ ## List of possibilities for the system-wide initialization file.
+ ## The first one found (if any) is used.
+ @rc_system_files = ( 'C:/latexmk/LatexMk' );
+
+ $search_path_separator = ';'; # Separator of elements in search_path
+
+ # For both fptex and miktex, the following makes error messages explicit:
+ $latex_silent_switch = '-interaction=batchmode -c-style-errors';
+ $pdflatex_silent_switch = '-interaction=batchmode -c-style-errors';
+
+ # For a pdf-file, "start x.pdf" starts the pdf viewer associated with
+ # pdf files, so no program name is needed:
+ $pdf_previewer = 'start %O %S';
+ $ps_previewer = 'start %O %S';
+ $ps_previewer_landscape = $ps_previewer;
+ $dvi_previewer = 'start %O %S';
+ $dvi_previewer_landscape = "$dvi_previewer";
+ # Viewer update methods:
+ # 0 => auto update: viewer watches file (e.g., gv)
+ # 1 => manual update: user must do something: e.g., click on window.
+ # (e.g., ghostview, MSWIN previewers, acroread under UNIX)
+ # 2 => send signal. Number of signal in $dvi_update_signal,
+ # $ps_update_signal, $pdf_update_signal
+ # 3 => viewer can't update, because it locks the file and the file
+ # cannot be updated. (acroread under MSWIN)
+ # 4 => run a command to force the update. The commands are
+ # specified by the variables $dvi_update_command,
+ # $ps_update_command, $pdf_update_command
+ $dvi_update_method = 1;
+ $ps_update_method = 1;
+ $pdf_update_method = 3; # acroread locks the pdf file
+ # Use NONE as flag that I am not implementing some commands:
+ $lpr =
+ 'NONE $lpr variable is not configured to allow printing of ps files';
+ $lpr_dvi =
+ 'NONE $lpr_dvi variable is not configured to allow printing of dvi files';
+ $lpr_pdf =
+ 'NONE $lpr_pdf variable is not configured to allow printing of pdf files';
+ # The $pscmd below holds a command to list running processes. It
+ # is used to find the process ID of the viewer looking at the
+ # current output file. The output of the command must include the
+ # process number and the command line of the processes, since the
+ # relevant process is identified by the name of file to be viewed.
+ # Its use is not essential.
+ $pscmd =
+ 'NONE $pscmd variable is not configured to detect running processes';
+ $pid_position = -1; # offset of PID in output of pscmd.
+ # Negative means I cannot use ps
+}
+elsif ( $^O eq "cygwin" ) {
+ # The problem is a mixed MSWin32 and UNIX environment.
+ # Perl decides the OS is cygwin in two situations:
+ # 1. When latexmk is run from a cygwin shell under a cygwin
+ # environment. Perl behaves in a UNIX way. This is OK, since
+ # the user is presumably expecting UNIXy behavior.
+ # 2. When CYGWIN exectuables are in the path, but latexmk is run
+ # from a native NT shell. Presumably the user is expecting NT
+ # behavior. But perl behaves more UNIXy. This causes some
+ # clashes.
+ # The issues to handle are:
+ # 1. Perl sees both MSWin32 and cygwin filenames. This is
+ # normally only an advantage.
+ # 2. Perl uses a UNIX shell in the system command
+ # This is a nasty problem: under native NT, there is a
+ # start command that knows about NT file associations, so that
+ # we can do, e.g., (under native NT) system("start file.pdf");
+ # But this won't work when perl has decided the OS is cygwin,
+ # even if it is invoked from a native NT command line. An
+ # NT command processor must be used to deal with this.
+ # 3. External executables can be native NT (which only know
+ # NT-style file names) or cygwin executables (which normally
+ # know both cygwin UNIX-style file names and NT file names,
+ # but not always; some do not know about drive names, for
+ # example).
+ # Cygwin executables for tex and latex may only know cygwin
+ # filenames.
+ # 4. The BIBINPUTS and TEXINPUTS environment variables may be
+ # UNIX-style or MSWin-style depending on whether native NT or
+ # cygwin executables are used. They are therefore parsed
+ # differently. Here is the clash:
+ # a. If a user is running under an NT shell, is using a
+ # native NT installation of tex (e.g., fptex or miktex),
+ # but has the cygwin executables in the path, then perl
+ # detects the OS as cygwin, but the user needs NT
+ # behavior from latexmk.
+ # b. If a user is running under an UNIX shell in a cygwin
+ # environment, and is using the cygwin installation of
+ # tex, then perl detects the OS as cygwin, and the user
+ # needs UNIX behavior from latexmk.
+ # Latexmk has no way of detecting the difference. The two
+ # situations may even arise for the same user on the same
+ # computer simply by changing the order of directories in the
+ # path environment variable
+
+
+ ## Configuration parameters: We'll assume native NT executables.
+ ## The user should override if they are not.
+
+ # This may fail: perl converts MSWin temp directory name to cygwin
+ # format. Names containing this string cannot be handled by native
+ # NT executables.
+ $tmpdir = $ENV{TMPDIR} || $ENV{TEMP} || '.';
+
+ ## List of possibilities for the system-wide initialization file.
+ ## The first one found (if any) is used.
+ ## We can stay with MSWin files here, since perl understands them,
+ @rc_system_files = ( 'C:/latexmk/LatexMk' );
+
+ $search_path_separator = ';'; # Separator of elements in search_path
+ # This is tricky. The search_path_separator depends on the kind
+ # of executable: native NT v. cygwin.
+ # So the user will have to override this.
+
+ # For both fptex and miktex, the following makes error messages explicit:
+ $latex_silent_switch = '-interaction=batchmode -c-style-errors';
+ $pdflatex_silent_switch = '-interaction=batchmode -c-style-errors';
+
+ # We will assume that files can be viewed by native NT programs.
+ # Then we must fix the start command/directive, so that the
+ # NT-native start command of a cmd.exe is used.
+ # For a pdf-file, "start x.pdf" starts the pdf viewer associated with
+ # pdf files, so no program name is needed:
+ $start_NT = "cmd /c start";
+ $pdf_previewer = "$start_NT %O %S";
+ $ps_previewer = "$start_NT %O %S";
+ $ps_previewer_landscape = $ps_previewer;
+ $dvi_previewer = "$start_NT %O %S";
+ $dvi_previewer_landscape = $dvi_previewer;
+ # Viewer update methods:
+ # 0 => auto update: viewer watches file (e.g., gv)
+ # 1 => manual update: user must do something: e.g., click on window.
+ # (e.g., ghostview, MSWIN previewers, acroread under UNIX)
+ # 2 => send signal. Number of signal in $dvi_update_signal,
+ # $ps_update_signal, $pdf_update_signal
+ # 3 => viewer can't update, because it locks the file and the file
+ # cannot be updated. (acroread under MSWIN)
+ $dvi_update_method = 1;
+ $ps_update_method = 1;
+ $pdf_update_method = 3; # acroread locks the pdf file
+ # Use NONE as flag that I am not implementing some commands:
+ $lpr =
+ 'NONE $lpr variable is not configured to allow printing of ps files';
+ $lpr_dvi =
+ 'NONE $lpr_dvi variable is not configured to allow printing of dvi files';
+ $lpr_pdf =
+ 'NONE $lpr_pdf variable is not configured to allow printing of pdf files';
+ # The $pscmd below holds a command to list running processes. It
+ # is used to find the process ID of the viewer looking at the
+ # current output file. The output of the command must include the
+ # process number and the command line of the processes, since the
+ # relevant process is identified by the name of file to be viewed.
+ # Its use is not essential.
+ # When the OS is detected as cygwin, there are two possibilities:
+ # a. Latexmk was run from an NT prompt, but cygwin is in the
+ # path. Then the cygwin ps command will not see commands
+ # started from latexmk. So we cannot use it.
+ # b. Latexmk was started within a cygwin environment. Then
+ # the ps command works as we need.
+ # Only the user, not latemk knows which, so we default to not
+ # using the ps command. The user can override this in a
+ # configuration file.
+ $pscmd =
+ 'NONE $pscmd variable is not configured to detect running processes';
+ $pid_position = -1; # offset of PID in output of pscmd.
+ # Negative means I cannot use ps
+}
+else {
+ # Assume anything else is UNIX or clone
+
+ ## Configuration parameters:
+
+
+ ## Use first existing case for $tmpdir:
+ $tmpdir = $ENV{TMPDIR} || '/tmp';
+
+ ## List of possibilities for the system-wide initialization file.
+ ## The first one found (if any) is used.
+ ## Normally on a UNIX it will be in a subdirectory of /opt/local/share or
+ ## /usr/local/share, depending on the local conventions.
+ ## /usr/local/lib/latexmk/LatexMk is put in the list for
+ ## compatibility with older versions of latexmk.
+ @rc_system_files =
+ ( '/opt/local/share/latexmk/LatexMk',
+ '/usr/local/share/latexmk/LatexMk',
+ '/usr/local/lib/latexmk/LatexMk' );
+
+ $search_path_separator = ':'; # Separator of elements in search_path
+
+ $dvi_update_signal = $signo{USR1}
+ if ( defined $signo{USR1} ); # Suitable for xdvi
+ $ps_update_signal = $signo{HUP}
+ if ( defined $signo{HUP} ); # Suitable for gv
+ $pdf_update_signal = $signo{HUP}
+ if ( defined $signo{HUP} ); # Suitable for gv
+ ## default document processing programs.
+ # Viewer update methods:
+ # 0 => auto update: viewer watches file (e.g., gv)
+ # 1 => manual update: user must do something: e.g., click on window.
+ # (e.g., ghostview, MSWIN previewers, acroread under UNIX)
+ # 2 => send signal. Number of signal in $dvi_update_signal,
+ # $ps_update_signal, $pdf_update_signal
+ # 3 => viewer can't update, because it locks the file and the file
+ # cannot be updated. (acroread under MSWIN)
+ # 4 => Run command to update. Command in $dvi_update_command,
+ # $ps_update_command, $pdf_update_command.
+ $dvi_previewer = 'start xdvi %O %S';
+ $dvi_previewer_landscape = 'start xdvi -paper usr %O %S';
+ if ( defined $dvi_update_signal ) {
+ $dvi_update_method = 2; # xdvi responds to signal to update
+ } else {
+ $dvi_update_method = 1;
+ }
+# if ( defined $ps_update_signal ) {
+# $ps_update_method = 2; # gv responds to signal to update
+# $ps_previewer = 'start gv -nowatch';
+# $ps_previewer_landscape = 'start gv -swap -nowatch';
+# } else {
+# $ps_update_method = 0; # gv -watch watches the ps file
+# $ps_previewer = 'start gv -watch';
+# $ps_previewer_landscape = 'start gv -swap -watch';
+# }
+ # Turn off the fancy options for gv. Regular gv likes -watch etc
+ # GNU gv likes --watch etc. User must configure
+ $ps_update_method = 0; # gv -watch watches the ps file
+ $ps_previewer = 'start gv %O %S';
+ $ps_previewer_landscape = 'start gv -swap %O %S';
+ $pdf_previewer = 'start acroread %O %S';
+ $pdf_update_method = 1; # acroread under unix needs manual update
+ $lpr = 'lpr %O %S'; # Assume lpr command prints postscript files correctly
+ $lpr_dvi =
+ 'NONE $lpr_dvi variable is not configured to allow printing of dvi files';
+ $lpr_pdf =
+ 'NONE $lpr_pdf variable is not configured to allow printing of pdf files';
+ # The $pscmd below holds a command to list running processes. It
+ # is used to find the process ID of the viewer looking at the
+ # current output file. The output of the command must include the
+ # process number and the command line of the processes, since the
+ # relevant process is identified by the name of file to be viewed.
+ # Uses:
+ # 1. In preview_continuous mode, to save running a previewer
+ # when one is already running on the relevant file.
+ # 2. With xdvi in preview_continuous mode, xdvi must be
+ # signalled to make it read a new dvi file.
+ #
+ # The following works on Solaris, LINUX, HP-UX, IRIX
+ # Use -f to get full listing, including command line arguments.
+ # Use -u $ENV{CMD} to get all processes started by current user (not just
+ # those associated with current terminal), but none of other users'
+ # processes.
+ $pscmd = "ps -f -u $ENV{USER}";
+ $pid_position = 1; # offset of PID in output of pscmd; first item is 0.
+ if ( $^O eq "linux" ) {
+ # Ps on Redhat (at least v. 7.2) appears to truncate its output
+ # at 80 cols, so that a long command string is truncated.
+ # Fix this with the --width option. This option works under
+ # other versions of linux even if not necessary (at least
+ # for SUSE 7.2).
+ # However the option is not available under other UNIX-type
+ # systems, e.g., Solaris 8.
+ $pscmd = "ps --width 200 -f -u $ENV{USER}";
+ }
+ elsif ( $^O eq "darwin" ) {
+ # OS-X on Macintosh
+ $lpr_pdf = 'lpr %O %S';
+ $pscmd = "ps -ww -u $ENV{USER}";
+ }
+}
+
+## default parameters
+$max_repeat = 5; # Maximum times I repeat latex. Normally
+ # 3 would be sufficient: 1st run generates aux file,
+ # 2nd run picks up aux file, and maybe toc, lof which
+ # contain out-of-date information, e.g., wrong page
+ # references in toc, lof and index, and unresolved
+ # references in the middle of lines. But the
+ # formatting is more-or-less correct. On the 3rd
+ # run, the page refs etc in toc, lof, etc are about
+ # correct, but some slight formatting changes may
+ # occur, which mess up page numbers in the toc and lof,
+ # Hence a 4th run is conceivably necessary.
+ # At least one document class (JHEP.cls) works
+ # in such a way that a 4th run is needed.
+ # We allow an extra run for safety for a
+ # maximum of 5. Needing further runs is
+ # usually an indication of a problem; further
+ # runs may not resolve the problem, and
+ # instead could cause an infinite loop.
+$clean_ext = ""; # space separated extensions of files that are
+ # to be deleted when doing cleanup, beyond
+ # standard set
+$clean_full_ext = ""; # space separated extensions of files that are
+ # to be deleted when doing cleanup_full, beyond
+ # standard set and those in $clean_ext
+@cus_dep_list = (); # Custom dependency list
+@default_files = ( '*.tex' ); # Array of LaTeX files to process when
+ # no files are specified on the command line.
+ # Wildcards allowed
+ # Best used for project specific files.
+@default_excluded_files = ( );
+ # Array of LaTeX files to exclude when using
+ # @default_files, i.e., when no files are specified
+ # on the command line.
+ # Wildcards allowed
+ # Best used for project specific files.
+$texfile_search = ""; # Specification for extra files to search for
+ # when no files are specified on the command line
+ # and the @default_files variable is empty.
+ # Space separated, and wildcards allowed.
+ # These files are IN ADDITION to *.tex in current
+ # directory.
+ # This variable is obsolete, and only in here for
+ # backward compatibility.
+
+$fdb_ext = 'fdb_latexmk'; # Extension for the file for latexmk's
+ # file-database
+ # Make it long to avoid possible collisions.
+$fdb_ver = 2; # Version number for kind of fdb_file.
+
+$jobname = ''; # Jobname: as with current tex, etc indicates
+ # basename of generated files.
+ # Defined so that --jobname=STRING on latexmk's
+ # command line has same effect as with current
+ # tex, etc. (If $jobname is non-empty, then
+ # the --jobname=... option is used on tex.)
+
+
+## default flag settings.
+$silent = 0; # silence latex's messages?
+$landscape_mode = 0; # default to portrait mode
+
+# The following two arrays contain lists of extensions (without
+# period) for files that are read in during a (pdf)LaTeX run but that
+# are generated automatically from the previous run, as opposed to
+# being user generated files (directly or indirectly from a custom
+# dependency). These files get two kinds of special treatment:
+# 1. In clean up, where depending on the kind of clean up, some
+# or all of these generated files are deleted.
+# (Note that special treatment is given to aux files.)
+# 2. In analyzing the results of a run of (pdf)LaTeX, to
+# determine if another run is needed. With an error free run,
+# a rerun should be provoked by a change in any source file,
+# whether a user file or a generated file. But with a run
+# that ends in an error, only a change in a user file during
+# the run (which might correct the error) should provoke a
+# rerun, but a change in a generated file should not.
+# These arrays can be user-configured.
+@generated_exts = ( 'aux', 'bbl', 'idx', 'ind', 'lof', 'lot', 'out', 'toc' );
+ # N.B. 'out' is generated by hyperref package
+
+# Which kinds of file do I have requests to make?
+# If no requests at all are made, then I will make dvi file
+# If particular requests are made then other files may also have to be
+# made. E.g., ps file requires a dvi file
+$dvi_mode = 0; # No dvi file requested
+$postscript_mode = 0; # No postscript file requested
+$pdf_mode = 0; # No pdf file requested to be made by pdflatex
+ # Possible values:
+ # 0 don't create pdf file
+ # 1 to create pdf file by pdflatex
+ # 2 to create pdf file by ps2pdf
+ # 3 to create pdf file by dvipdf
+$view = 'default'; # Default preview is of highest of dvi, ps, pdf
+$sleep_time = 2; # time to sleep b/w checks for file changes in -pvc mode
+$banner = 0; # Non-zero if we have a banner to insert
+$banner_scale = 220; # Original default scale
+$banner_intensity = 0.95; # Darkness of the banner message
+$banner_message = 'DRAFT'; # Original default message
+$do_cd = 0; # Do not do cd to directory of source file.
+ # Thus behave like latex.
+$dependents_list = 0; # Whether to display list(s) of dependencies
+@dir_stack = (); # Stack of pushed directories.
+$cleanup_mode = 0; # No cleanup of nonessential LaTex-related files.
+ # $cleanup_mode = 0: no cleanup
+ # $cleanup_mode = 1: full cleanup
+ # $cleanup_mode = 2: cleanup except for dvi,
+ # dviF, pdf, ps, & psF
+$cleanup_fdb = 0; # No removal of file for latexmk's file-database
+$cleanup_only = 0; # When doing cleanup, do not go-on to making files
+$diagnostics = 0;
+$dvi_filter = ''; # DVI filter command
+$ps_filter = ''; # Postscript filter command
+
+$force_mode = 0; # =1 to force processing past errors
+$force_include_mode = 0;# =1 to ignore non-existent files when testing
+ # for dependency. (I.e., don't treat them as error)
+$go_mode = 0; # =1 to force processing regardless of time-stamps
+ # =2 full clean-up first
+$preview_mode = 0;
+$preview_continuous_mode = 0;
+$printout_mode = 0; # Don't print the file
+
+# Do we make view file in temporary then move to final destination?
+# (To avoid premature updating by viewer).
+$always_view_file_via_temporary = 0; # Set to 1 if viewed file is always
+ # made through a temporary.
+$pvc_view_file_via_temporary = 1; # Set to 1 if only in -pvc mode is viewed
+ # file made through a temporary.
+
+# State variables initialized here:
+
+$updated = 0; # Flags when something has been remade
+ # Used to allow convenient user message in -pvc mode
+$waiting = 0; # Flags whether we are in loop waiting for an event
+ # Used to avoid unnecessary repeated o/p in wait loop
+
+# Used for some results of parsing log file:
+$reference_changed = 0;
+$bad_reference = 0;
+$bad_citation = 0;
+
+
+# Set search paths for includes.
+# Set them early so that they can be overridden
+$BIBINPUTS = $ENV{'BIBINPUTS'};
+if (!$BIBINPUTS) { $BIBINPUTS = '.'; }
+#?? OBSOLETE
+$TEXINPUTS = $ENV{'TEXINPUTS'};
+if (!$TEXINPUTS) { $TEXINPUTS = '.'; }
+
+# Convert search paths to arrays:
+# If any of the paths end in '//' then recursively search the
+# directory. After these operations, @BIBINPUTS should
+# have all the directories that need to be searched
+
+@BIBINPUTS = find_dirs1 ($BIBINPUTS);
+
+
+######################################################################
+######################################################################
+#
+# ??? UPDATE THE FOLLOWING!!
+#
+# We will need to determine whether source files for runs of various
+# programs are out of date. In a normal situation, this is done by
+# asking whether the times of the source files are later than the
+# destination files. But this won't work for us, since a common
+# situation is that a file is written on one run of latex, for
+# example, and read back in on the next run (e.g., an .aux file).
+# Some situations of this kind are standard in latex generally; others
+# occur with particular macro packages or with particular
+# postprocessors.
+#
+# The correct criterion for whether a source is out-of-date is
+# therefore NOT that its modification time is later than the
+# destination file, but whether the contents of the source file have
+# changed since the last successful run. This also handles the case
+# that the user undoes some changes to a source file by replacing the
+# source file by reverting to an earlier version, which may well have
+# an older time stamp. Since a direct comparison of old and new files
+# would involve storage and access of a large number of backup files,
+# we instead use the md5 signature of the files. (Previous versions
+# of latexmk used the backup file method, but restricted to the case
+# of .aux and .idx files, sufficient for most, but not all,
+# situations.)
+#
+# We will have a database of (time, size, md5) for the relevant
+# files. If the time and size of a file haven't changed, then the file
+# is assumed not to have changed; this saves us from having to
+# determine its md5 signature, which would involve reading the whole
+# file, which is naturally time-consuming, especially if network file
+# access to a server is needed, and many files are involved, when most
+# of them don't change. It is of course possible to change a file
+# without changing its size, but then to adjust its timestamp
+# to what it was previously; this requires a certain amount of
+# perversity. We can safely assume that if the user edits a file or
+# changes its contents, then the file's timestamp changes. The
+# interesting case is that the timestamp does change, because the file
+# has actually been written to, but that the contents do not change;
+# it is for this that we use the md5 signature. However, since
+# computing the md5 signature involves reading the whole file, which
+# may be large, we should avoid computing it more than necessary.
+#
+# So we get the following structure:
+#
+# 1. For each relevant run (latex, pdflatex, each instance of a
+# custom dependency) we have a database of the state of the
+# source files that were last used by the run.
+# 2. On an initial startup, the database for a primary tex file
+# is read that was created by a previous run of latex or
+# pdflatex, if this exists.
+# 3. If the file doesn't exist, then the criterion for
+# out-of-dateness for an initial run is that it goes by file
+# timestamps, as in previous versions of latexmk, with due
+# (dis)regard to those files that are known to be generated by
+# latex and re-read on the next run.
+# 4. Immediately before a run, the database is updated to
+# represent the current conditions of the run's source files.
+# 5. After the run, it is determined whether any of the source
+# files have changed. This covers both files written by the
+# run, which are therefore in a dependency loop, and files that
+# the user may have updated during the run. (The last often
+# happens when latex takes a long time, for a big document,
+# and the user makes edits before latex has finished. This is
+# particularly prevalent when latexmk is used with
+# preview-continuous mode.)
+# 6. In the case of latex or pdflatex, the custom dependencies
+# must also be checked and redone if out-of-date.
+# 7. If any source files have changed, the run is redone,
+# starting at step 1.
+# 8. There is naturally a limit on the number of reruns, to avoid
+# infinite loops from bugs and from pathological or unforeseen
+# conditions.
+# 9. After the run is done, the run's file database is updated.
+# (By hypothesis, the sizes and md5s are correct, if the run
+# is successful.)
+# 10. To allow reuse of data from previous runs, the file database
+# is written to a file after every complete set of passes
+# through latex or pdflatex. (Note that there is separate
+# information for latex and pdflatex; the necessary
+# information won't coincide: Out-of-dateness for the files
+# for each program concerns the properties of the files when
+# the other program was run, and the set of source files could
+# be different, e.g., for graphics files.)
+#
+# We therefore maintain the following data structures.:
+#
+# a. For each run (latex, pdflatex, each custom dependency) a
+# database is maintained. This is a hash from filenames to a
+# reference to an array: [time, size, md5]. The semantics of
+# the database is that it represents the state of the source
+# files used in the run. During a run it represents the state
+# immediately before the run; after a run, with all reruns, it
+# represents the state of the files used, modified by having
+# the latest timestamps for generated files.
+# b. There is a global database for all files, which represents
+# the current state. This saves having to recompute the md5
+# signatures of a changed file used in more than one run
+# (e.g., latex and pdflatex).
+# c. Each of latex and pdflatex has a list of the relevant custom
+# dependencies.
+#
+# In all the following a fdb-hash is a hash of the form:
+# filename -> [time, size, md5]
+# If a file is found to disappear, its entry is removed from the hash.
+# In returns from fdb access routines, a size entry of -1 indicates a
+# non-existent file.
+
+
+# List of known rules. Rule types: primary,
+# external (calls program), internal (calls routine), cusdep.
+
+%known_rules = ( 'latex' => 'primary', 'pdflatex' => 'primary',
+ );
+%primaries = (); # Hash of rules for primary part of make. Keys are
+ # currently 'latex', 'pdflatex' or both. Value is
+ # currently irrelevant. Use hash for ease of lookup
+ # Make remove this later, if use makeB
+
+# Hashes, whose keys give names of particular kinds of rule. We use
+# hashes for ease of lookup.
+%possible_one_time = ( 'view' => 1, 'print' => 1, 'update_view' => 1, );
+%requested_filerules = (); # Hash for rules corresponding to requested files.
+ # The keys are the rulenames and the value is
+ # currently irrelevant.
+%one_time = (); # Hash for requested one-time-only rules, currently
+ # possible values 'print' and 'view'.
+
+
+%rule_db = (); # Database of all rules:
+ # Hash: rulename -> [array of rule data]
+ # Rule data:
+ # 0: [ cmd_type, ext_cmd, int_cmd, out_of_date-crit,
+ # source, dest, base, out_of_date,
+ # out_of_date_user, time_of_last_run ]
+ # where
+ # cmd_type is 'primary', 'external' or 'cusdep',
+ # ext_cmd is string for associated external command
+ # with substitutions (%D for destination, %S
+ # for source, %B for base of current rule,
+ # %R for base of primary tex file, %T for
+ # texfile name, and %O for options.
+ # int_cmd specifies any internal command to be
+ # used to implement the application of the
+ # rule. If this is present, it overrides
+ # the external command, and it is the
+ # responsibility of the perl subroutine
+ # specified in intcmd to execute the
+ # external command if this is appropriate.
+ # This variable intcmd is a reference to an array,
+ # $$intcmd[0] = internal routine
+ # $$intcmd[1...] = its arguments (if any)
+ # out_of_date_crit specifies method of determining
+ # whether a file is out-of-date:
+ # 0 for never
+ # 1 for usual: whether there is a source
+ # file change
+ # 2 for dest earlier than source
+ # 3 for method 2 at first run, 1 thereafter
+ # (used when don't have file data from
+ # previous run).
+ # source = name of primary source file, if any
+ # dest = name of primary destination file,
+ # if any
+ # base = base name, if any, of files for
+ # this rule
+ # out_of_date = 1 if it has been detected that
+ # this rule needs to be run
+ # (typically because a source
+ # file has changed).
+ # 0 otherwise
+ # out_of_date_user is like out_of_date, except
+ # that the detection of out-of-dateness
+ # has been made from a change of a
+ # putative user file, i.e., one that is
+ # not a generated file (e.g., aux). This
+ # kind of out-of-dateness should provoke a
+ # rerun where or not there was an error
+ # during a run of (pdf)LaTeX. Normally,
+ # if there is an error, one should wait
+ # for the user to correct the error. But
+ # it is possible the error condition is
+ # already corrected during the run, e.g.,
+ # by the user changing a source file in
+ # response to an error message.
+ # time_of_last_run = time that this rule was
+ # last applied. (In standard units
+ # from perl, to be directly compared
+ # with file modification times.)
+ # changed flags whether special changes have been made
+ # that require file-existence status to be ignored
+ # 1: {Hash sourcefile -> [source-file data] }
+ # Source-file data array:
+ # 0: time
+ # 1: size
+ # 2: md5
+ # 3: name of rule to make this file
+ # 4: whether the file is of the kind made by epstopdf.sty
+ # during a primary run. It will have been read during
+ # the run, so that even though the file changes during
+ # a primary run, there is no need to trigger another
+ # run because of this.
+
+%fdb_current = (); # Fdb-hash for all files used.
+
+
+#==================================================
+## Read rc files:
+
+sub read_first_rc_file_in_list {
+ foreach my $rc_file ( @_ ) {
+ #print "===Testing for rc file \"$rc_file\" ...\n";
+ if ( -e $rc_file ) {
+ #print "===Reading rc file \"$rc_file\" ...\n";
+ process_rc_file( $rc_file );
+ return;
+ }
+ }
+}
+
+# Read system rc file:
+read_first_rc_file_in_list( @rc_system_files );
+# Read user rc file.
+read_first_rc_file_in_list( "$ENV{'HOME'}/.latexmkrc" );
+# Read rc file in current directory.
+read_first_rc_file_in_list( "latexmkrc", ".latexmkrc" );
+
+#==================================================
+
+#show_array ("BIBINPUTS", @BIBINPUTS); die;
+
+## Process command line args.
+@command_line_file_list = ();
+$bad_options = 0;
+
+#print "Command line arguments:\n"; for ($i = 0; $i <= $#ARGV; $i++ ) { print "$i: '$ARGV[$i]'\n"; }
+
+while ($_ = $ARGV[0])
+{
+ # Make -- and - equivalent at beginning of option:
+ s/^--/-/;
+ shift;
+ if (/^-c$/) { $cleanup_mode = 2; $cleanup_only = 1; }
+ elsif (/^-C$/) { $cleanup_mode = 1; $cleanup_only = 1; }
+ elsif (/^-CA$/) { $cleanup_mode = 1; $cleanup_fdb = 1; $cleanup_only = 1;}
+ elsif (/^-CF$/) { $cleanup_fdb = 1; }
+ elsif (/^-cd$/) { $do_cd = 1; }
+ elsif (/^-cd-$/) { $do_cd = 0; }
+ elsif (/^-commands$/) { &print_commands; exit; }
+ elsif (/^-d$/) { $banner = 1; }
+ elsif (/^-dependents$/) { $dependents_list = 1; }
+ elsif (/^-nodependents$/ || /^-dependents-$/) { $dependents_list = 0; }
+ elsif (/^-dvi$/) { $dvi_mode = 1; }
+ elsif (/^-dvi-$/) { $dvi_mode = 0; }
+ elsif (/^-F$/) { $force_include_mode = 1; }
+ elsif (/^-F-$/) { $force_include_mode = 0; }
+ elsif (/^-f$/) { $force_mode = 1; }
+ elsif (/^-f-$/) { $force_mode = 0; }
+ elsif (/^-g$/) { $go_mode = 1; }
+ elsif (/^-g-$/) { $go_mode = 0; }
+ elsif (/^-gg$/) {
+ $go_mode = 2; $cleanup_mode = 1; $cleanup_fdb = 1; $cleanup_only = 0;
+ }
+ elsif ( /^-h$/ || /^-help$/ ) { &print_help; exit;}
+ elsif (/^-diagnostics/) { $diagnostics = 1; }
+ elsif (/^-jobname=(.*)$/) {
+ $jobname = $1;
+ }
+ elsif (/^-l$/) { $landscape_mode = 1; }
+ elsif (/^-new-viewer$/) {
+ $new_viewer_always = 1;
+ }
+ elsif (/^-new-viewer-$/) {
+ $new_viewer_always = 0;
+ }
+ elsif (/^-l-$/) { $landscape_mode = 0; }
+ elsif (/^-p$/) { $printout_mode = 1;
+ $preview_continuous_mode = 0; # to avoid conflicts
+ $preview_mode = 0;
+ }
+ elsif (/^-p-$/) { $printout_mode = 0; }
+ elsif (/^-pdfdvi$/){ $pdf_mode = 3; }
+ elsif (/^-pdfps$/) { $pdf_mode = 2; }
+ elsif (/^-pdf$/) { $pdf_mode = 1; }
+ elsif (/^-pdf-$/) { $pdf_mode = 0; }
+ elsif (/^-print=(.*)$/) {
+ $value = $1;
+ if ( $value =~ /^dvi$|^ps$|^pdf$/ ) {
+ $print_type = $value;
+ $printout_mode = 1;
+ }
+ else {
+ &exit_help("$My_name: unknown print type '$value' in option '$_'");
+ }
+ }
+ elsif (/^-ps$/) { $postscript_mode = 1; }
+ elsif (/^-ps-$/) { $postscript_mode = 0; }
+ elsif (/^-pv$/) { $preview_mode = 1;
+ $preview_continuous_mode = 0; # to avoid conflicts
+ $printout_mode = 0;
+ }
+ elsif (/^-pv-$/) { $preview_mode = 0; }
+ elsif (/^-pvc$/) { $preview_continuous_mode = 1;
+ $force_mode = 0; # So that errors do not cause loops
+ $preview_mode = 0; # to avoid conflicts
+ $printout_mode = 0;
+ }
+ elsif (/^-pvc-$/) { $preview_continuous_mode = 0; }
+ elsif (/^-silent$/ || /^-quiet$/ ){ $silent = 1; }
+ elsif (/^-v$/ || /^-version$/) {
+ print "\n$version_details. Version $version_num\n";
+ exit;
+ }
+ elsif (/^-verbose$/) { $silent = 0; }
+ elsif (/^-view=default$/) { $view = "default";}
+ elsif (/^-view=dvi$/) { $view = "dvi";}
+ elsif (/^-view=none$/) { $view = "none";}
+ elsif (/^-view=ps$/) { $view = "ps";}
+ elsif (/^-view=pdf$/) { $view = "pdf"; }
+ elsif (/^-e$/) {
+ if ( $ARGV[0] eq '' ) {
+ &exit_help( "No code to execute specified after -e switch");
+ }
+ else {
+ execute_code_string( $ARGV[0] );
+ }
+ shift;
+ }
+ elsif (/^-r$/) {
+ if ( $ARGV[0] eq '' ) {
+ &exit_help( "No RC file specified after -r switch");
+ }
+ if ( -e $ARGV[0] ) {
+ process_rc_file( $ARGV[0] );
+ }
+ else {
+ $! = 11;
+ die "$My_name: RC file [$ARGV[0]] does not exist\n";
+ }
+ shift;
+ }
+ elsif (/^-bm$/) {
+ if ( $ARGV[0] eq '' ) {
+ &exit_help( "No message specified after -bm switch");
+ }
+ $banner = 1; $banner_message = $ARGV[0];
+ shift;
+ }
+ elsif (/^-bi$/) {
+ if ( $ARGV[0] eq '' ) {
+ &exit_help( "No intensity specified after -bi switch");
+ }
+ $banner_intensity = $ARGV[0];
+ shift;
+ }
+ elsif (/^-bs$/) {
+ if ( $ARGV[0] eq '' ) {
+ &exit_help( "No scale specified after -bs switch");
+ }
+ $banner_scale = $ARGV[0];
+ shift;
+ }
+ elsif (/^-dF$/) {
+ if ( $ARGV[0] eq '' ) {
+ &exit_help( "No dvi filter specified after -dF switch");
+ }
+ $dvi_filter = $ARGV[0];
+ shift;
+ }
+ elsif (/^-pF$/) {
+ if ( $ARGV[0] eq '' ) {
+ &exit_help( "No ps filter specified after -pF switch");
+ }
+ $ps_filter = $ARGV[0];
+ shift;
+ }
+ elsif (/^-/) {
+ warn "$My_name: $_ bad option\n";
+ $bad_options++;
+ }
+ else {
+ push @command_line_file_list, $_ ;
+ }
+}
+
+if ( $bad_options > 0 ) {
+ &exit_help( "Bad options specified" );
+}
+
+warn "$My_name: This is $version_details, version: $version_num.\n",
+ "**** Report bugs etc to John Collins <collins at phys.psu.edu>. ****\n"
+ unless $silent;
+
+# For backward compatibility, convert $texfile_search to @default_files
+# Since $texfile_search is initialized to "", a nonzero value indicates
+# that an initialization file has set it.
+if ( $texfile_search ne "" ) {
+ @default_files = split / /, "*.tex $texfile_search";
+}
+
+#printA "A: Command line file list:\n";
+#for ($i = 0; $i <= $#command_line_file_list; $i++ ) { print "$i: '$command_line_file_list[$i]'\n"; }
+
+#Glob the filenames command line if the script was not invoked under a
+# UNIX-like environment.
+# Cases: (1) MS/MSwin native Glob
+# (OS detected as MSWin32)
+# (2) MS/MSwin cygwin Glob [because we do not know whether
+# the cmd interpreter is UNIXy (and does glob) or is
+# native MS-Win (and does not glob).]
+# (OS detected as cygwin)
+# (3) UNIX Don't glob (cmd interpreter does it)
+# (Currently, I assume this is everything else)
+if ( ($^O eq "MSWin32") || ($^O eq "cygwin") ) {
+ # Preserve ordering of files
+ @file_list = glob_list1(@command_line_file_list);
+#print "A1:File list:\n";
+#for ($i = 0; $i <= $#file_list; $i++ ) { print "$i: '$file_list[$i]'\n"; }
+}
+else {
+ @file_list = @command_line_file_list;
+#print "A2:File list:\n";
+#for ($i = 0; $i <= $#file_list; $i++ ) { print "$i: '$file_list[$i]'\n"; }
+}
+@file_list = uniq1( @file_list );
+
+
+# Check we haven't selected mutually exclusive modes.
+# Note that -c overides all other options, but doesn't cause
+# an error if they are selected.
+if (($printout_mode && ( $preview_mode || $preview_continuous_mode ))
+ || ( $preview_mode && $preview_continuous_mode ))
+{
+ # Each of the options -p, -pv, -pvc turns the other off.
+ # So the only reason to arrive here is an incorrect inititalization
+ # file, or a bug.
+ &exit_help( "Conflicting options (print, preview, preview_continuous) selected");
+}
+
+if ( @command_line_file_list ) {
+ # At least one file specified on command line (before possible globbing).
+ if ( !@file_list ) {
+ &exit_help( "Wildcards in file names didn't match any files");
+ }
+}
+else {
+ # No files specified on command line, try and find some
+ # Evaluate in order specified. The user may have some special
+ # for wanting processing in a particular order, especially
+ # if there are no wild cards.
+ # Preserve ordering of files
+ my @file_list1 = uniq1( glob_list1(@default_files) );
+ my @excluded_file_list = uniq1( glob_list1(@default_excluded_files) );
+ # Make hash of excluded files, for easy checking:
+ my %excl = ();
+ foreach my $file (@excluded_file_list) {
+ $excl{$file} = '';
+ }
+ foreach my $file (@file_list1) {
+ push( @file_list, $file) unless ( exists $excl{$file} );
+ }
+ if ( !@file_list ) {
+ &exit_help( "No file name specified, and I couldn't find any");
+ }
+}
+
+$num_files = $#file_list + 1;
+$num_specified = $#command_line_file_list + 1;
+
+#print "Command line file list:\n";
+#for ($i = 0; $i <= $#command_line_file_list; $i++ ) { print "$i: '$command_line_file_list[$i]'\n"; }
+#print "File list:\n";
+#for ($i = 0; $i <= $#file_list; $i++ ) { print "$i: '$file_list[$i]'\n"; }
+
+
+# If selected a preview-continuous mode, make sure exactly one filename was specified
+if ($preview_continuous_mode && ($num_files != 1) ) {
+ if ($num_specified > 1) {
+ &exit_help(
+ "Need to specify exactly one filename for ".
+ "preview-continuous mode\n".
+ " but $num_specified were specified"
+ );
+ }
+ elsif ($num_specified == 1) {
+ &exit_help(
+ "Need to specify exactly one filename for ".
+ "preview-continuous mode\n".
+ " but wildcarding produced $num_files files"
+ );
+ }
+ else {
+ &exit_help(
+ "Need to specify exactly one filename for ".
+ "preview-continuous mode.\n".
+ " Since none were specified on the command line, I looked for \n".
+ " files in '@default_files'.\n".
+ " But I found $num_files files, not 1."
+ );
+ }
+}
+
+# If selected jobname, can only apply that to one file:
+if ( ($jobname ne '') && ($num_files > 1) ) {
+ &exit_help(
+ "Need to specify at most one filename if ".
+ "jobname specified, \n".
+ " but $num_files were found (after defaults and wildcarding)."
+ );
+}
+
+
+# Normalize the commands, to have place-holders for source, dest etc:
+&fix_cmds;
+
+# If landscape mode, change dvips processor, and the previewers:
+if ( $landscape_mode )
+{
+ $dvips = $dvips_landscape;
+ $dvi_previewer = $dvi_previewer_landscape;
+ $ps_previewer = $ps_previewer_landscape;
+}
+
+if ( $silent ) {
+ add_option( \$latex, " $latex_silent_switch" );
+ add_option( \$pdflatex, " $pdflatex_silent_switch" );
+ add_option( \$bibtex, " $bibtex_silent_switch" );
+ add_option( \$makeindex, " $makeindex_silent_switch" );
+ add_option( \$dvips, " $dvips_silent_switch" );
+}
+
+if ( $jobname ne '' ) {
+ $jobstring = "--jobname=$jobname";
+ add_option( \$latex, " $jobstring" );
+ add_option( \$pdflatex, " $jobstring" );
+}
+
+# Which kind of file do we preview?
+if ( $view eq "default" ) {
+ # If default viewer requested, use "highest" of dvi, ps and pdf
+ # that was requested by user.
+ # No explicit request means view dvi.
+ $view = "dvi";
+ if ( $postscript_mode ) { $view = "ps"; }
+ if ( $pdf_mode ) { $view = "pdf"; }
+}
+
+if ( ! ( $dvi_mode || $pdf_mode || $postscript_mode || $printout_mode) ) {
+ print "No specific requests made, so default to dvi by latex\n";
+ $dvi_mode = 1;
+}
+
+# Set new-style requested rules:
+if ( $dvi_mode ) { $requested_filerules{'latex'} = 1; }
+if ( $pdf_mode == 1 ) { $requested_filerules{'pdflatex'} = 1; }
+elsif ( $pdf_mode == 2 ) { $requested_filerules{'ps2pdf'} = 1; }
+elsif ( $pdf_mode == 3 ) { $requested_filerules{'dvipdf'} = 1; }
+if ( $postscript_mode ) { $requested_filerules{'dvips'} = 1; }
+if ( $printout_mode ) { $one_time{'print'} = 1; }
+if ( $preview_continuous_mode || $preview_mode ) { $one_time{'view'} = 1; }
+if ( length($dvi_filter) != 0 ) { $requested_filerules{'dvi_filter'} = 1; }
+if ( length($ps_filter) != 0 ) { $requested_filerules{'ps_filter'} = 1; }
+if ( $banner ) { $requested_filerules{'dvips'} = 1; }
+
+
+%possible_primaries = ();
+foreach (&rdb_possible_primaries) {
+ $possible_primaries{$_} = 1;
+}
+
+#print "POSSIBLE PRIMARIES: ";
+#foreach (keys %possible_primaries ) {print "$_, ";}
+#print "\n";
+
+
+if ( $pdf_mode == 2 ) {
+ # We generate pdf from ps. Make sure we have the correct kind of ps.
+ add_option( \$dvips, " $dvips_pdf_switch" );
+}
+
+
+# Make convenient forms for lookup.
+# Extensions always have period.
+
+# Convert @generated_exts to a hash for ease of look up, with exts
+# preceeded by a '.'
+# %generated_exts_all is used in analyzing file changes, to
+# distinguish changes in user files from changes in generated files.
+%generated_exts_all = ();
+foreach (@generated_exts ) {
+ $generated_exts_all{".$_"} = 1;
+}
+
+$quell_uptodate_msgs = $silent;
+ # Whether to quell informational messages when files are uptodate
+ # Will turn off in -pvc mode
+
+# Process for each file.
+# The value of $bibtex_mode set in an initialization file may get
+# overridden, during file processing, so save it:
+#?? Unneeded now: $save_bibtex_mode = $bibtex_mode;
+
+$failure_count = 0;
+$last_failed = 0; # Flag whether failed on making last file
+ # This is used for showing suitable error diagnostics
+FILE:
+foreach $filename ( @file_list )
+{
+ # Global variables for making of current file:
+ $updated = 0;
+ $failure = 0; # Set nonzero to indicate failure at some point of
+ # a make. Use value as exit code if I exit.
+ $failure_msg = ''; # Indicate reason for failure
+#?? Unneeded now: $bibtex_mode = $save_bibtex_mode;
+
+ if ( $do_cd ) {
+ ($filename, $path) = fileparse( $filename );
+ warn "$My_name: Changing directory to '$path'\n";
+ pushd( $path );
+ }
+ else {
+ $path = '';
+ }
+
+
+ ## remove extension from filename if was given.
+ if ( &find_basename($filename, $root_filename, $texfile_name) )
+ {
+ if ( $force_mode ) {
+ warn "$My_name: Could not find file [$texfile_name]\n";
+ }
+ else {
+ &ifcd_popd;
+ &exit_msg1( "Could not find file [$texfile_name]",
+ 11);
+ }
+ }
+ if ($jobname ne '' ) {
+ $root_filename = $jobname;
+ }
+
+ # Initialize basic dependency information:
+
+ # For use under error conditions:
+ @default_includes = ($texfile_name, "$root_filename.aux");
+
+ $fdb_file = "$root_filename.$fdb_ext";
+
+ if ($cleanup_fdb) { unlink $fdb_file; }
+ if ( $cleanup_mode > 0 ) {
+ my @extra_generated = ();
+ my @aux_files = ();
+ rdb_read_generatedB( $fdb_file, \@extra_generated, \@aux_files );
+ if ( ($go_mode == 2) && !$silent ) {
+ warn "$My_name: Removing all generated files\n" unless $silent;
+ }
+ if ($diagnostics) {
+ show_array( "For deletion:\n Extra_generated:", @extra_generated );
+ show_array( " Aux files:", @aux_files );
+ }
+ # Add to the generated files, some log file and some backup
+ # files used in previous versions of latexmk
+ &cleanup1( 'blg', 'ilg', 'log', 'aux.bak', 'idx.bak',
+ split(' ',$clean_ext),
+ @generated_exts
+ );
+ unlink( 'texput.log', @extra_generated, "texput.aux", @aux_files );
+ if ( $cleanup_mode == 1 ) {
+ &cleanup1( 'dvi', 'dviF', 'ps', 'psF', 'pdf',
+ split(' ', $clean_full_ext)
+ );
+ }
+ }
+ if ($cleanup_only) { next FILE; }
+
+ # Initialize file and rule databases.
+ %rule_list = ();
+ &rdb_make_rule_list;
+ &rdb_set_rules(\%rule_list);
+
+
+#??? The following are not needed if use makeB.
+# ?? They may be set too early?
+# Arrays and hashes for picking out accessible rules.
+# Distinguish rules for making files and others
+ @accessible_all = sort ( &rdb_accessible( keys %requested_filerules, keys %one_time ));
+ %accessible_filerules = ();
+ foreach (@accessible_all) {
+ unless ( /view/ || /print/ ) { $accessible_filerules{$_} = 1; }
+ }
+ @accessible_filerules = sort keys %accessible_filerules;
+
+# show_array ( "=======All rules used", @accessible_all );
+# show_array ( "=======Requested file rules", sort keys %requested_filerules );
+# show_array ( "=======Rules for files", @accessible_filerules );
+
+ if ( $diagnostics ) {
+ print "$My_name: Rules after start up for '$texfile_name'\n";
+ rdb_show();
+ }
+
+ %primaries = ();
+ foreach (@accessible_all) {
+ if ( ($_ eq 'latex') || ($_ eq 'pdflatex') ) { $primaries{$_} = 1; }
+ }
+
+ $have_fdb = 0;
+ if ( (! -e $fdb_file) && (! -e "$root_filename.aux") ) {
+ # No aux and no fdb file => set up trivial aux file
+ # and corresponding fdb_file. Arrange them to provoke one run
+ # as minimum, but no more if actual aux file is trivial.
+ # (Useful on big files without cross references.)
+ &set_trivial_aux_fdb;
+ }
+
+ if ( -e $fdb_file ) {
+ $rdb_errors = rdb_read( $fdb_file );
+ $have_fdb = ($rdb_errors == 0);
+ }
+ if (!$have_fdb) {
+ # We didn't get a valid set of data on files used in
+ # previous run. So use filetime criterion for make
+ # instead of change from previous run, until we have
+ # done our own make.
+ rdb_recurseA( [keys %possible_primaries],
+ sub{ if ( $$Ptest_kind == 1 ) { $$Ptest_kind = 3;} }
+ );
+ if ( -e "$root_filename.log" ) {
+ rdb_for_some( [keys %possible_primaries], \&rdb_set_from_logB );
+ }
+ }
+ if ($go_mode) {
+ # Force everything to be remade.
+ rdb_recurseA( [keys %requested_filerules], sub{$$Pout_of_date=1;} );
+ }
+
+
+ if ( $diagnostics ) {
+ print "$My_name: Rules after initialization\n";
+ rdb_show();
+ }
+
+ #************************************************************
+
+ if ( $preview_continuous_mode ) {
+ &make_preview_continuousB;
+ # Will probably exit by ctrl/C and never arrive here.
+ next FILE;
+ }
+
+
+## Handling of failures:
+## Variable $failure is set to indicate a failure, with information
+## put in $failure_msg.
+## These variables should be set to 0 and '' at any point at which it
+## should be assumed that no failures have occurred.
+## When after a routine is called it is found that $failure is set, then
+## processing should normally be aborted, e.g., by return.
+## Then there is a cascade of returns back to the outermost level whose
+## responsibility is to handle the error.
+## Exception: An outer level routine may reset $failure and $failure_msg
+## after initial processing, when the error condition may get
+## ameliorated later.
+ #Initialize failure flags now.
+ $failure = 0;
+ $failure_msg = '';
+ $failure = rdb_makeB( keys %requested_filerules );
+ if ($failure > 0) { next FILE;}
+ rdb_for_some( [keys %one_time], \&rdb_run1 );
+} # end FILE
+continue {
+ if ($dependents_list) { rdb_list(); }
+ # Handle any errors
+ if ( $failure > 0 ) {
+ if ( $failure_msg ) {
+ #Remove trailing space
+ $failure_msg =~ s/\s*$//;
+ warn "$My_name: Did not finish processing file: $failure_msg\n";
+ $failure = 1;
+ }
+ $failure_count ++;
+ $last_failed = 1;
+ }
+ else {
+ $last_failed = 0;
+ }
+ &ifcd_popd;
+}
+# If we get here without going through the continue section:
+if ( $do_cd && ($#dir_stack > -1) ) {
+ # Just in case we did an abnormal exit from the loop
+ warn "$My_name: Potential bug: dir_stack not yet unwound, undoing all directory changes now\n";
+ &finish_dir_stack;
+}
+
+if ($failure_count > 0) {
+ if ( $last_failed <= 0 ) {
+ # Error occured, but not on last file, so
+ # user may not have seen error messages
+ warn "\n------------\n";
+ warn "$My_name: Some operations failed.\n";
+ }
+ if ( !$force_mode ) {
+ warn "$My_name: Use the -f option to force complete processing.\n";
+ }
+ exit 12;
+}
+
+
+
+# end MAIN PROGRAM
+#############################################################
+
+sub fix_cmds {
+ # If commands do not have placeholders for %S etc, put them in
+ foreach ($latex, $pdflatex, $lpr, $lpr_dvi, $lpr_pdf,
+ $pdf_previewer, $ps_previewer, $ps_previewer_landscape,
+ $dvi_previewer, $dvi_previewer_landscape,
+ $kpsewhich
+ ) {
+ # Source only
+ if ( $_ && ! /%/ ) { $_ .= " %O %S"; }
+ }
+ foreach ($bibtex) {
+ # Base only
+ if ( $_ && ! /%/ ) { $_ .= " %O %B"; }
+ }
+ foreach ($dvipdf, $ps2pdf) {
+ # Source and dest without flag for destination
+ if ( $_ && ! /%/ ) { $_ .= " %O %S %D"; }
+ }
+ foreach ($dvips, $makeindex) {
+ # Source and dest with -o dest before source
+ if ( $_ && ! /%/ ) { $_ .= " %O -o %D %S"; }
+ }
+ foreach ($dvi_filter, $ps_filter) {
+ # Source and dest, but as filters
+ if ( $_ && ! /%/ ) { $_ .= " %O <%S >%D"; }
+ }
+} #END fix_cmds
+
+#############################################################
+
+sub add_option {
+ # Call add_option( \$cmd, $opt )
+ # Add option to command
+ if ( ${$_[0]} !~ /%/ ) { &fix_cmds; }
+ ${$_[0]} =~ s/%O/$_[1] %O/;
+} #END add_option
+
+#############################################################
+
+sub rdb_make_rule_list {
+# Substitutions: %S = source, %D = dest, %B = this rule's base
+# %T = texfile, %R = root = base for latex.
+
+ # Defaults for dvi, ps, and pdf files
+ # Use local, not my, so these variables can be referenced
+ local $dvi_final = "%R.dvi";
+ local $ps_final = "%R.ps";
+ local $pdf_final = "%R.pdf";
+ if ( length($dvi_filter) > 0) {
+ $dvi_final = "%R.dviF";
+ }
+ if ( length($ps_filter) > 0) {
+ $ps_final = "%R.psF";
+ }
+
+ my $print_file = '';
+ my $print_cmd = '';
+ if ( $print_type eq 'dvi' ) {
+ $print_file = $dvi_final;
+ $print_cmd = $lpr_dvi;
+ }
+ elsif ( $print_type eq 'pdf' ) {
+ $print_file = $pdf_final;
+ $print_cmd = $lpr_pdf;
+ }
+ elsif ( $print_type eq 'ps' ) {
+ $print_file = $ps_final;
+ $print_cmd = $lpr;
+ }
+
+ my $view_file = '';
+ my $viewer = '';
+ my $viewer_update_method = 0;
+ my $viewer_update_signal = undef;
+ my $viewer_update_command = undef;
+
+ if ( ($view eq 'dvi') || ($view eq 'pdf') || ($view eq 'ps') ) {
+ $view_file = ${$view.'_final'};
+ $viewer = ${$view.'_previewer'};
+ $viewer_update_method = ${$view.'_update_method'};
+ $viewer_update_signal = ${$view.'_update_signal'};
+ if (defined ${$view.'_update_command'}) {
+ $viewer_update_command = ${$view.'_update_command'};
+ }
+ }
+ # Specification of internal command for viewer update:
+ my $PA_update = ['do_update_view', $viewer_update_method, $viewer_update_signal, 0, 1];
+
+# For test_kind: Use file contents for latex and friends, but file time for the others.
+# This is because, especially for dvi file, the contents of the file may contain
+# a pointer to a file to be included, not the contents of the file!
+ %rule_list = (
+ 'latex' => [ 'primary', "$latex", '', "%T", "%B.dvi", "%R", 1 ],
+ 'pdflatex' => [ 'primary', "$pdflatex", '', "%T", "%B.pdf", "%R", 1 ],
+ 'dvipdf' => [ 'external', "$dvipdf", 'do_viewfile', $dvi_final, "%B.pdf", "%R", 2 ],
+ 'dvips' => [ 'external', "$dvips", 'do_viewfile', $dvi_final, "%B.ps", "%R", 2 ],
+ 'dvifilter'=> [ 'external', $dvi_filter, 'do_viewfile', "%B.dvi", "%B.dviF", "%R", 2 ],
+ 'ps2pdf' => [ 'external', "$ps2pdf", 'do_viewfile', $ps_final, "%B.pdf", "%R", 2 ],
+ 'psfilter' => [ 'external', $ps_filter, 'do_viewfile', "%B.ps", "%B.psF", "%R", 2 ],
+ 'print' => [ 'external', "$print_cmd", 'if_source', $print_file, "", "", 2 ],
+ 'update_view' => [ 'external', $viewer_update_command, $PA_update,
+ $view_file, "", "", 2 ],
+ 'view' => [ 'external', "$viewer", 'if_source', $view_file, "", "", 2 ],
+ );
+ %source_list = ();
+ foreach my $rule (keys %rule_list) {
+ $source_list{$rule} = [];
+ my $PAsources = $source_list{$rule};
+ my ( $cmd_type, $cmd, $source, $dest, $root ) = @{$rule_list{$rule}};
+ if ($source) {
+ push @$PAsources, [ $rule, $source, '' ];
+ }
+ }
+
+# Ensure we only have one way to make pdf file, and that it is appropriate:
+ if ($pdf_mode == 1) { delete $rule_list{'dvipdf'}; delete $rule_list{'ps2pdf'}; }
+ elsif ($pdf_mode == 2) { delete $rule_list{'dvipdf'}; delete $rule_list{'pdflatex'}; }
+ else { delete $rule_list{'pdflatex'}; delete $rule_list{'ps2pdf'}; }
+
+} # END rdb_make_rule_list
+
+#************************************************************
+
+sub rdb_set_rules {
+ # Call rdb_set_rules( \%rule_list, ...)
+ # Set up rule database from definitions
+
+ # Map of files to rules that MAKE them:
+ local %from_rules = ();
+ %rule_db = ();
+
+ foreach my $Prule_list (@_) {
+ foreach my $rule ( sort keys %$Prule_list) {
+ my ( $cmd_type, $ext_cmd, $int_cmd, $source, $dest, $base, $test_kind ) = @{$$Prule_list{$rule}};
+ my $needs_making = 0;
+ # Substitute in the filename variables, since we will use
+ # those for determining filenames. But delay expanding $cmd
+ # until run time, in case of changes.
+ foreach ($base, $source, $dest ) {
+ s/%R/$root_filename/;
+ }
+ foreach ($source, $dest ) {
+ s/%B/$base/;
+ s/%T/$texfile_name/;
+ }
+ # print "$rule: $cmd_type, EC='$ext_cmd', IC='$int_cmd', $test_kind,\n",
+ # " S='$source', D='$dest', B='$base' $needs_making\n";
+ rdb_create_rule( $rule, $cmd_type, $ext_cmd, $int_cmd, $test_kind,
+ $source, $dest, $base,
+ $needs_making );
+ if ($dest) { $from_rules{$dest} = $rule ; }
+ }
+ rdb_for_all(
+ 0,
+ sub{
+ # my ($base, $path, $ext) = fileparse( $file, '\.[^\.]*' );
+ # if ( exists $from_rules{$file} && ! exists $generated_exts_all{$ext} ) {
+ # # Show how to make this file. But don't worry about generated
+ # # files.
+ if ( exists $from_rules{$file} ) {
+ $$Pfrom_rule = $from_rules{$file};
+ }
+ #?? print "$rule: $file, $$Pfrom_rule\n";
+ }
+ );
+ } # End arguments of subroutine
+ &rdb_make_links;
+} # END rdb_set_rules
+
+#************************************************************
+
+sub rdb_make_links {
+# ?? Problem if there are multiple rules for getting a file. Notably pdf.
+# Which one to choose?
+ # Create $from_rule if there's a suitable rule.
+ # Map files to rules:
+ local %from_rules = ();
+ rdb_for_all( sub{ if($$Pdest){$from_rules{$$Pdest} = $rule;} } );
+#?? foreach (sort keys %from_rules) {print "D='$_' F='$from_rules{$_}\n";}
+ rdb_for_all(
+ 0,
+ sub{
+ if ( exists $from_rules{$file} ) { $$Pfrom_rule = $from_rules{$file}; }
+#?? print "$rule: $file, $$Pfrom_rule\n";
+ }
+ );
+ rdb_for_all(
+ 0,
+ sub{
+ if ( exists $from_rules{$file} ) {
+ $$Pfrom_rule = $from_rules{$file};
+ }
+ if ( $$Pfrom_rule && (! rdb_rule_exists( $$Pfrom_rule ) ) ) {
+ $$Pfrom_rule = '';
+ }
+#?? print "$rule: $file, $$Pfrom_rule\n";
+ }
+ );
+} # END rdb_make_links
+
+#************************************************************
+
+sub set_trivial_aux_fdb {
+ # 1. Write aux file EXACTLY as would be written if the tex file
+ # had no cross references, etc. I.e., a minimal .aux file.
+ # 2. Write a corresponding fdb file
+ # 3. Provoke a run of (pdf)latex (actually of all primaries).
+
+ local $aux_file = "$root_filename.aux";
+ open( aux_file, '>', $aux_file )
+ or die "Cannot write file '$aux_file'\n";
+ print aux_file "\\relax \n";
+ close(aux_file);
+
+ foreach my $rule (keys %primaries ) {
+ rdb_ensure_file( $rule, $texfile_name );
+ rdb_ensure_file( $rule, $aux_file );
+ rdb_one_rule( $rule,
+ sub{ $$Pout_of_date = 1; }
+ );
+ }
+ &rdb_write( $fdb_file );
+} #END set_trivial_aux_fdb
+
+#************************************************************
+#### Particular actions
+#************************************************************
+#************************************************************
+
+sub do_cusdep {
+ # Unconditional application of custom-dependency
+ # except that rule is not applied if the source file source
+ # does not exist, and an error is returned if the dest is not made.
+ #
+ # Assumes rule context for the custom-dependency, and that my first
+ # argument is the name of the subroutine to apply
+ my $func_name = $_[0];
+ my $return = 0;
+ if ( !-e $$Psource ) {
+ # Source does not exist. Users of this rule will need to turn
+ # it off when custom dependencies are reset
+ if ( !$silent ) {
+## ??? Was commented out. 1 Sep. 2008 restored, for cusdep no-file-exists issue
+ warn "$My_name: In trying to apply custom-dependency rule\n",
+ " to make '$$Pdest' from '$$Psource'\n",
+ " the source file has disappeared since the last run\n";
+ }
+ # Treat as successful
+ }
+ elsif ( !$func_name ) {
+ warn "$My_name: Possible misconfiguration or bug:\n",
+ " In trying to apply custom-dependency rule\n",
+ " to make '$$Pdest' from '$$Psource'\n",
+ " the function name is blank.\n";
+ }
+ elsif ( ! defined &$func_name ) {
+ warn "$My_name: Misconfiguration or bug,",
+ " in trying to apply custom-dependency rule\n",
+ " to make '$$Pdest' from '$$Psource'\n",
+ " function name '$func_name' does not exists.\n";
+ }
+ else {
+ my $cusdep_ret = &$func_name( $$Pbase );
+ if ( defined $cusdep_ret && ($cusdep_ret != 0) ) {
+ $return = $cusdep_ret;
+ if ($return) {
+ warn "Rule '$rule', function '$func_name'\n",
+ " failed with return code = $return\n";
+ }
+ }
+ elsif ( !-e $$Pdest ) {
+ # Destination non-existent, but routine failed to give an error
+ warn "$My_name: In running custom-dependency rule\n",
+ " to make '$$Pdest' from '$$Psource'\n",
+ " function '$func_name' did not make the destination.\n";
+ $return = -1;
+ }
+ }
+ return $return;
+} # END do_cusdep
+
+#************************************************************
+
+sub do_viewfile {
+ # Unconditionally make file for viewing, going through temporary file if
+ # Assumes rule context
+
+ my $return = 0;
+ my ($base, $path, $ext) = fileparseA( $$Pdest );
+ if ( &view_file_via_temporary ) {
+ my $tmpfile = tempfile1( "${root_filename}_tmp", $ext );
+ $return = &rdb_ext_cmd1( '', '', $tmpfile );
+ move( $tmpfile, $$Pdest );
+ }
+ else {
+ $return = &rdb_ext_cmd;
+ }
+ return $return;
+} #END do_viewfile
+
+#************************************************************
+
+sub do_update_view {
+ # Update viewer
+ # Assumes rule context
+ # Arguments: (method, signal, viewer_process)
+
+ my $return = 0;
+
+ # Although the process is passed as an argument, we'll need to update it.
+ # So (FUDGE??) bypass the standard interface for the process.
+ # We might as well do this for all the arguments.
+ my $viewer_update_method = ${$PAint_cmd}[1];
+ my $viewer_update_signal = ${$PAint_cmd}[2];
+ my $Pviewer_process = \${$PAint_cmd}[3];
+ my $Pneed_to_get_viewer_process = \${$PAint_cmd}[4];
+
+ if ($viewer_update_method == 2) {
+ if ($$Pneed_to_get_viewer_process) {
+ $$Pviewer_process = &find_process_id( $$Psource );
+ if ($$Pviewer_process != 0) {
+ $$Pneed_to_get_viewer_process = 0;
+ }
+ }
+ if ($$Pviewer_process == 0) {
+ print "$My_name: need to signal viewer for file '$$Psource', but didn't get \n",
+ " process ID for some reason, e.g., no viewer, bad configuration, bug\n"
+ if $diagnostics ;
+ }
+ elsif ( defined $viewer_update_signal) {
+ print "$My_name: signalling viewer, process ID $$Pviewer_process\n"
+ if $diagnostics ;
+ kill $viewer_update_signal, $$Pviewer_process;
+ }
+ else {
+ warn "$My_name: viewer is supposed to be sent a signal\n",
+ " but no signal is defined. Misconfiguration or bug?\n";
+ $return = 1;
+ }
+ }
+ elsif ($viewer_update_method == 4) {
+ if (defined $$Pext_cmd) {
+ $return = &rdb_ext_cmd;
+ }
+ else {
+ warn "$My_name: viewer is supposed to be updated by running a command,\n",
+ " but no command is defined. Misconfiguration or bug?\n";
+ }
+ }
+ return $return;
+} #END do_update_view
+
+#************************************************************
+
+sub if_source {
+ # Unconditionally apply rule if source file exists.
+ # Assumes rule context
+ if ( -e $$Psource ) {
+ return &rdb_ext_cmd;
+ }
+ else {
+ return -1;
+ }
+} #END if_source
+
+#************************************************************
+#### Subroutines
+#************************************************************
+#************************************************************
+
+# Finds the basename of the root file
+# Arguments:
+# 1 - Filename to breakdown
+# 2 - Where to place base file
+# 3 - Where to place tex file
+# Returns non-zero if tex file does not exist
+#
+# The rules for determining this depend on the implementation of TeX.
+# The variable $extension_treatment determines which rules are used.
+
+sub find_basename
+#?? Need to use kpsewhich, if possible
+{
+ local($given_name, $base_name, $ext, $path, $tex_name);
+ $given_name = $_[0];
+ if ( "$extension_treatment" eq "miktex_old" ) {
+ # Miktex v. 1.20d:
+ # 1. If the filename has an extension, then use it.
+ # 2. Else append ".tex".
+ # 3. The basename is obtained from the filename by
+ # removing the path component, and the extension, if it
+ # exists. If a filename has a multiple extension, then
+ # all parts of the extension are removed.
+ # 4. The names of generated files (log, aux) are obtained by
+ # appending .log, .aux, etc to the basename. Note that
+ # these are all in the CURRENT directory, and the drive/path
+ # part of the originally given filename is ignored.
+ #
+ # Thus when the given filename is "\tmp\a.b.c", the tex
+ # filename is the same, and the basename is "a".
+
+ ($base_name, $path, $ext) = fileparse( $given_name, '\..*' );
+ if ( "$ext" eq "") { $tex_name = "$given_name.tex"; }
+ else { $tex_name = $given_name; }
+ $_[1] = $base_name;
+ $_[2] = $tex_name;
+ }
+ elsif ( "$extension_treatment" eq "unix" ) {
+ # unix (at least web2c 7.3.1) =>
+ # 1. If filename.tex exists, use it,
+ # 2. else if filename exists, use it.
+ # 3. The base filename is obtained by deleting the path
+ # component and, if an extension exists, the last
+ # component of the extension, even if the extension is
+ # null. (A name ending in "." has a null extension.)
+ # 4. The names of generated files (log, aux) are obtained by
+ # appending .log, .aux, etc to the basename. Note that
+ # these are all in the CURRENT directory, and the drive/path
+ # part of the originally given filename is ignored.
+ #
+ # Thus when the given filename is "/tmp/a.b.c", there are two
+ # cases:
+ # a. /tmp/a.b.c.tex exists. Then this is the tex file,
+ # and the basename is "a.b.c".
+ # b. /tmp/a.b.c.tex does not exist. Then the tex file is
+ # "/tmp/a.b.c", and the basename is "a.b".
+
+ if ( -e "$given_name.tex" ) {
+ $tex_name = "$given_name.tex";
+ }
+ else {
+ $tex_name = "$given_name";
+ }
+ ($base_name, $path, $ext) = fileparse( $tex_name, '\.[^\.]*' );
+ $_[1] = $base_name;
+ $_[2] = $tex_name;
+ }
+ else {
+ die "$My_name: Incorrect configuration gives \$extension_treatment=",
+ "'$extension_treatment'\n";
+ }
+ if ($diagnostics) {
+ print "Given='$given_name', tex='$tex_name', base='$base_name'\n";
+ }
+ return ! -e $tex_name;
+} #END find_basename
+
+#************************************************************
+
+sub make_preview_continuousB {
+ # Version for use with makeB
+ local @changed = ();
+ local @disappeared = ();
+ local @no_dest = (); # Non-existent destination files
+ local @rules_to_apply = ();
+ local $failure = 0;
+ local $runs = 0;
+ local %rules_applied = ();
+ local $updated = 0;
+
+ # What to make?
+ my @targets = keys %requested_filerules;
+
+ $quell_uptodate_msgs = 1;
+
+ local $view_file = '';
+ rdb_one_rule( 'view', sub{ $view_file = $$Psource; } );
+
+ if ( ($view eq 'dvi') || ($view eq 'pdf') || ($view eq 'ps') ) {
+ warn "Viewing $view\n";
+ }
+ elsif ( $view eq 'none' ) {
+ warn "Not using a previewer\n";
+ $view_file = '';
+ }
+ else {
+ warn "$My_name: BUG: Invalid preview method '$view'\n";
+ exit 20;
+ }
+
+ my $viewer_running = 0; # No viewer known to be running yet
+ # Get information from update_view rule
+ local $viewer_update_method = 0;
+ # Pointers so we can update the following:
+ local $Pviewer_process = undef;
+ local $Pneed_to_get_viewer_process = undef;
+ rdb_one_rule( 'update_view',
+ sub{ $viewer_update_method = $$PAint_cmd[1];
+ $Pviewer_process = \$$PAint_cmd[3];
+ $Pneed_to_get_viewer_process = \$$PAint_cmd[4];
+ }
+ );
+ # Note that we don't get the previewer process number from the program
+ # that starts it; that might only be a script to get things set up and the
+ # actual previewer could be (and sometimes IS) another process.
+
+ if ( ($view_file ne '') && (-e $view_file) && !$new_viewer_always ) {
+ # Is a viewer already running?
+ # (We'll save starting up another viewer.)
+ $$Pviewer_process = &find_process_id( $view_file );
+ if ( $$Pviewer_process ) {
+ warn "$My_name: Previewer is already running\n"
+ if !$silent;
+ $viewer_running = 1;
+ $$Pneed_to_get_viewer_process = 0;
+ }
+ }
+
+ # Loop forever, rebuilding .dvi and .ps as necessary.
+ # Set $first_time to flag first run (to save unnecessary diagnostics)
+CHANGE:
+ for (my $first_time = 1; 1; $first_time = 0 ) {
+ $updated = 0;
+ $failure = 0;
+ $failure_msg = '';
+ if ( $MSWin_fudge_break && ($^O eq "MSWin32") ) {
+ # Fudge under MSWin32 ONLY, to stop perl/latexmk from
+ # catching ctrl/C and ctrl/break, and let it only reach
+ # downstream programs. See comments at first definition of
+ # $MSWin_fudge_break.
+ $SIG{BREAK} = $SIG{INT} = 'IGNORE';
+ }
+ $failure = rdb_makeB( @targets );
+
+## warn "=========Viewer PID = $$Pviewer_process; updated=$updated\n";
+
+ if ( $MSWin_fudge_break && ($^O eq "MSWin32") ) {
+ $SIG{BREAK} = $SIG{INT} = 'DEFAULT';
+ }
+ if ( $failure > 0 ) {
+ if ( !$failure_msg ) {
+ $failure_msg = 'Failure to make the files correctly';
+ }
+ # There will be files changed during the run that are irrelevant.
+ # We need to wait for the user to change the files.
+ # So set the GENERATED files as up-to-date
+ rdb_for_some( [keys %current_primaries], \&rdb_update_gen_files );
+
+ $failure_msg =~ s/\s*$//; #Remove trailing space
+ warn "$My_name: $failure_msg\n",
+ " ==> You will need to change a source file before I do another run <==\n";
+ }
+ elsif ( ($view_file ne '') && (-e $view_file) && $updated && $viewer_running ) {
+ # A viewer is running. Explicitly get it to update screen if we have to do it:
+ rdb_one_rule( 'update_view', \&rdb_run1 );
+ }
+ elsif ( ($view_file ne '') && (-e $view_file) && !$viewer_running ) {
+ # Start the viewer
+ if ( !$silent ) {
+ if ($new_viewer_always) {
+ warn "$My_name: starting previewer for '$view_file'\n",
+ "------------\n";
+ }
+ else {
+ warn "$My_name: I have not found a previewer that ",
+ "is already running. \n",
+ " So I will start it for '$view_file'\n",
+ "------------\n";
+ }
+ }
+ local $retcode = rdb_makeB ( 'view' );
+ if ( $retcode != 0 ) {
+ if ($force_mode) {
+ warn "$My_name: I could not run previewer\n";
+ }
+ else {
+ &exit_msg1( "I could not run previewer", $retcode);
+ }
+ }
+ else {
+ $viewer_running = 1;
+ $$Pneed_to_get_viewer_process = 1;
+ } # end analyze result of trying to run viewer
+ } # end start viewer
+ if ( $first_time || $updated || $failure ) {
+ print "\n=== Watching for updated files. Use ctrl/C to stop ...\n";
+ }
+ $waiting = 1; if ($diagnostics) { warn "WAITING\n"; }
+ WAIT: while (1) {
+ sleep($sleep_time);
+ &rdb_clear_change_record;
+ rdb_recurseA( [@targets], \&rdb_flag_changes_here );
+ if ( &rdb_count_changes > 0) {
+ &rdb_diagnose_changes
+ unless $silent;
+#???
+ warn "$My_name: File(s) changed or not used in previous run(s). Remake files.\n";
+ last WAIT;
+ }
+ # Does this do this job????
+ local $new_files = 0;
+ rdb_for_some( [keys %current_primaries], sub{ $new_files += &rdb_find_new_filesB } );
+ if ($new_files > 0) {
+ warn "$My_name: New file(s) found.\n";
+ last WAIT;
+ }
+ } # end WAIT:
+ $waiting = 0; if ($diagnostics) { warn "NOT WAITING\n"; }
+ } #end infinite_loop CHANGE:
+} #END sub make_preview_continuousB
+
+#************************************************************
+
+sub process_rc_file {
+ # Usage process_rc_file( filename )
+ # Run rc_file whose name is given in first argument
+ # Exit with code 11 if file could not be read.
+ # (In general this is not QUITE the right error)
+ # Exit with code 13 if there is a syntax error or other problem.
+ # ???Should I leave the exiting to the caller (perhaps as an option)?
+ # But I can always catch it with an eval if necessary.
+ # That confuses ctrl/C and ctrl/break handling.
+ my $rc_file = $_[0];
+ warn "$My_name: Executing PERL code in file '$rc_file'...\n"
+ if $diagnostics;
+ do( $rc_file );
+ # The return value from the do is not useful, since it is the value of
+ # the last expression evaluated, which could be anything.
+ # The correct test of errors is on the values of $! and $@.
+
+# This is not entirely correct. On gluon2:
+# rc_file does open of file, and $! has error, apparently innocuous
+# See ~/proposal/06/latexmkrc-effect
+
+ my $OK = 1;
+ if ( $! ) {
+ # Get both numeric error and its string, by forcing numeric and
+ # string contexts:
+ my $err_no = $!+0;
+ my $err_string = "$!";
+ warn "$My_name: Initialization file '$rc_file' could not be read,\n",
+ " or it gave some other problem. Error code \$! = $err_no.\n",
+ " Error string = '$err_string'\n";
+ $! = 256;
+ $OK = 0;
+ }
+ if ( $@ ) {
+ $! = 256;
+ # Indent the error message to make it easier to locate
+ my $indented = prefix( $@, " " );
+ $@ = "";
+ warn "$My_name: Initialization file '$rc_file' gave an error:\n",
+ "$indented";
+ $OK = 0;
+ }
+ if ( ! $OK ) {
+ die "$My_name: Stopping because of problem with rc file\n";
+ }
+} #END process_rc_file
+
+#************************************************************
+
+sub execute_code_string {
+ # Usage execute_code_string( string_of_code )
+ # Run the PERL code contained in first argument
+ # Exit with code 13 if there is a syntax error or other problem.
+ # ???Should I leave the exiting to the caller (perhaps as an option)?
+ # But I can always catch it with an eval if necessary.
+ # That confuses ctrl/C and ctrl/break handling.
+ my $code = $_[0];
+ warn "$My_name: Executing initialization code specified by -e:\n",
+ " '$code'...\n"
+ if $diagnostics;
+ eval $code;
+ # The return value from the eval is not useful, since it is the value of
+ # the last expression evaluated, which could be anything.
+ # The correct test of errors is on the values of $! and $@.
+
+ if ( $@ ) {
+ $! = 256;
+ my $message = $@;
+ $@ = "";
+ $message =~ s/\s*$//;
+ die "$My_name: ",
+ "Stopping because executing following code from command line\n",
+ " $code\n",
+ "gave an error:\n",
+ " $message\n";
+ }
+} #END execute_code_string
+
+#************************************************************
+
+sub cleanup1 {
+ # Usage: cleanup1( exts_without_period, ... )
+ foreach (@_) { unlink("$root_filename.$_"); }
+} #END cleanup1
+
+#************************************************************
+#************************************************************
+#************************************************************
+
+# Error handling routines, warning routines, help
+
+#************************************************************
+
+sub die_trace {
+ # Call: die_trace( message );
+ &traceback; # argument(s) passed unchanged
+ die "\n";
+} #END die_trace
+
+#************************************************************
+
+sub traceback {
+ # Call: &traceback
+ # or traceback( message, )
+ my $msg = shift;
+ if ($msg) { warn "$msg\n"; }
+ warn "Traceback:\n";
+ my $i=0; # Start with immediate caller
+ while ( my ($pack, $file, $line, $func) = caller($i++) ) {
+ if ($func eq 'die_trace') { next; }
+ warn " $func called from line $line\n";
+ }
+} #END traceback
+
+#************************************************************
+
+sub exit_msg1
+{
+ # exit_msg1( error_message, retcode [, action])
+ # 1. display error message
+ # 2. if action set, then restore aux file
+ # 3. exit with retcode
+ warn "\n------------\n";
+ warn "$My_name: $_[0].\n";
+ warn "-- Use the -f option to force complete processing.\n";
+
+ my $retcode = $_[1];
+ if ($retcode >= 256) {
+ # Retcode is the kind returned by system from an external command
+ # which is 256 * command's_retcode
+ $retcode /= 256;
+ }
+ exit $retcode;
+} #END exit_msg1
+
+#************************************************************
+
+sub warn_running {
+ # Message about running program:
+ if ( $silent ) {
+ warn "$My_name: @_\n";
+ }
+ else {
+ warn "------------\n@_\n------------\n";
+ }
+} #END warn_running
+
+#************************************************************
+
+sub exit_help
+# Exit giving diagnostic from arguments and how to get help.
+{
+ warn "\n$My_name: @_\n",
+ "Use\n",
+ " $my_name -help\nto get usage information\n";
+ exit 10;
+} #END exit_help
+
+
+#************************************************************
+
+sub print_help
+{
+ print
+ "$My_name $version_num: Automatic LaTeX document generation routine\n\n",
+ "Usage: $my_name [latexmk_options] [filename ...]\n\n",
+ " Latexmk_options:\n",
+ " -bm <message> - Print message across the page when converting to postscript\n",
+ " -bi <intensity> - Set contrast or intensity of banner\n",
+ " -bs <scale> - Set scale for banner\n",
+ " -commands - list commands used by $my_name for processing files\n",
+ " -c - clean up (remove) all nonessential files, except\n",
+ " dvi, ps and pdf files.\n",
+ " This and the other clean-ups are instead of a regular make.\n",
+ " -C - clean up (remove) all nonessential files\n",
+ " including aux, dep, dvi, postscript and pdf files\n",
+ " But exclude file of database of file information\n",
+ " -CA - clean up (remove) absolutely ALL nonessential files\n",
+ " including aux, dep, dvi, postscript and pdf files,\n",
+ " and file of database of file information\n",
+ " -CF - Remove file of database of file information before doing \n",
+ " other actions\n",
+ " -cd - Change to directory of source file when processing it\n",
+ " -cd- - Do NOT change to directory of source file when processing it\n",
+ " -dependents - Show list of dependent files after processing\n",
+ " -dependents- - Do not show list of dependent files after processing\n",
+ " -dF <filter> - Filter to apply to dvi file\n",
+ " -dvi - generate dvi\n",
+ " -dvi- - turn off required dvi\n",
+ " -e <code> - Execute specified PERL code\n",
+ " -f - force continued processing past errors\n",
+ " -f- - turn off forced continuing processing past errors\n",
+ " -F - Ignore non-existent files when testing for dependencies\n",
+ " -F- - Turn off -F\n",
+ " -gg - Super go mode: clean out generated files (-CA), and then\n",
+ " process files regardless of file timestamps\n",
+ " -g - process regardless of file timestamps\n",
+ " -g- - Turn off -g\n",
+ " -h - print help\n",
+ " -help - print help\n",
+ " -jobname=STRING - set basename of output file(s) to STRING.\n",
+ " (Like --jobname=STRING on command line for many current\n",
+ " implementations of latex/pdflatex.)\n",
+ " -l - force landscape mode\n",
+ " -l- - turn off -l\n",
+ " -new-viewer - in -pvc mode, always start a new viewer\n",
+ " -new-viewer- - in -pvc mode, start a new viewer only if needed\n",
+ " -nodependents - Do not show list of dependent files after processing\n",
+ " -pdf - generate pdf by pdflatex\n",
+ " -pdfdvi - generate pdf by dvipdf\n",
+ " -pdfps - generate pdf by ps2pdf\n",
+ " -pdf- - turn off pdf\n",
+ " -ps - generate postscript\n",
+ " -ps- - turn off postscript\n",
+ " -pF <filter> - Filter to apply to postscript file\n",
+ " -p - print document after generating postscript.\n",
+ " (Can also .dvi or .pdf files -- see documentation)\n",
+ " -print=dvi - when file is to be printed, print the dvi file\n",
+ " -print=ps - when file is to be printed, print the ps file (default)\n",
+ " -print=pdf - when file is to be printed, print the pdf file\n",
+ " -pv - preview document. (Side effect turn off continuous preview)\n",
+ " -pv- - turn off preview mode\n",
+ " -pvc - preview document and continuously update. (This also turns\n",
+ " on force mode, so errors do not cause $my_name to stop.)\n",
+ " (Side effect: turn off ordinary preview mode.)\n",
+ " -pvc- - turn off -pvc\n",
+ " -r <file> - Read custom RC file\n",
+ " -silent - silence progress messages from called programs\n",
+ " -v - display program version\n",
+ " -verbose - display usual progress messages from called programs\n",
+ " -version - display program version\n",
+ " -view=default - viewer is default (dvi, ps, pdf)\n",
+ " -view=dvi - viewer is for dvi\n",
+ " -view=none - no viewer is used\n",
+ " -view=ps - viewer is for ps\n",
+ " -view=pdf - viewer is for pdf\n",
+ " filename = the root filename of LaTeX document\n",
+ "\n",
+ "-p, -pv and -pvc are mutually exclusive\n",
+ "-h, -c and -C overides all other options.\n",
+ "-pv and -pvc require one and only one filename specified\n",
+ "All options can be introduced by '-' or '--'. (E.g., --help or -help.)\n",
+ "Contents of RC file specified by -r overrides options specified\n",
+ " before the -r option on the command line\n";
+
+} #END print_help
+
+#************************************************************
+sub print_commands
+{
+ warn "Commands used by $my_name:\n",
+ " To run latex, I use \"$latex\"\n",
+ " To run pdflatex, I use \"$pdflatex\"\n",
+ " To run bibtex, I use \"$bibtex\"\n",
+ " To run makeindex, I use \"$makeindex\"\n",
+ " To make a ps file from a dvi file, I use \"$dvips\"\n",
+ " To make a ps file from a dvi file with landscape format, ",
+ "I use \"$dvips_landscape\"\n",
+ " To make a pdf file from a dvi file, I use \"$dvipdf\"\n",
+ " To make a pdf file from a ps file, I use \"$ps2pdf\"\n",
+ " To view a pdf file, I use \"$pdf_previewer\"\n",
+ " To view a ps file, I use \"$ps_previewer\"\n",
+ " To view a ps file in landscape format, ",
+ "I use \"$ps_previewer_landscape\"\n",
+ " To view a dvi file, I use \"$dvi_previewer\"\n",
+ " To view a dvi file in landscape format, ",
+ "I use \"$dvi_previewer_landscape\"\n",
+ " To print a ps file, I use \"$lpr\"\n",
+ " To print a dvi file, I use \"$lpr_dvi\"\n",
+ " To print a pdf file, I use \"$lpr_pdf\"\n",
+ " To find running processes, I use \"$pscmd\", \n",
+ " and the process number is at position $pid_position\n";
+ warn "Notes:\n",
+ " Command starting with \"start\" is run detached\n",
+ " Command that is just \"start\" without any other command, is\n",
+ " used under MS-Windows to run the command the operating system\n",
+ " has associated with the relevant file.\n",
+ " Command starting with \"NONE\" is not used at all\n";
+} #END print_commands
+
+#************************************************************
+
+sub view_file_via_temporary {
+ return $always_view_file_via_temporary
+ || ($pvc_view_file_via_temporary && $preview_continuous_mode);
+} #END view_file_via_temporary
+
+#************************************************************
+#### Tex-related utilities
+
+
+sub check_bibtex_log {
+ # Check for bibtex warnings:
+ # Usage: check_bibtex_log( base_of_bibtex_run )
+ # return 0: OK, 1: bibtex warnings, 2: bibtex errors,
+ # 3: could not open .blg file.
+
+ my $base = $_[0];
+ my $log_name = "$base.blg";
+ my $log_file = new FileHandle;
+ open( $log_file, "<$log_name" )
+ or return 3;
+ my $have_warning = 0;
+ my $have_error = 0;
+ while (<$log_file>) {
+ if (/Warning--/) {
+ #print "Bibtex warning: $_";
+ $have_warning = 1;
+ }
+ if (/error message/) {
+ #print "Bibtex error: $_";
+ $have_error = 1;
+ }
+ }
+ close $log_file;
+ if ($have_error) {return 2;}
+ if ($have_warning) {return 1;}
+ return 0;
+} #END check_bibtex_log
+
+#**************************************************
+
+sub clean_file_name{
+ # Convert filename found in log file to true filename.
+ # Used normally only by parse_logB, below
+ # 1. For names of form
+ # `"string".ext', which arises e.g., from \jobname.bbl:
+ # when the base filename contains spaces, \jobname has quotes.
+ # and from \includegraphics with basename specified.
+ # 2. Or "string.ext" from \includegraphcs with basename and ext specified.
+ my $filename = $_[0];
+ $filename =~ s/^\"([^\"]*)\"(.*)$/$1$2/;
+ return $filename;
+}
+# ------------------------------
+
+sub parse_logB {
+# Scan log file for: dependent files
+# reference_changed, bad_reference, bad_citation
+# Return value: 1 if success, 0 if no log file.
+# Set global variables:
+# %dependents: maps definite dependents to code:
+# 0 = from missing-file line
+# May have no extension
+# May be missing path
+# 1 = from 'File: ... Graphic file (type ...)' line
+# no path. Should exist, but may need a search, by kpsewhich.
+# 2 = from regular '(...' coding for input file,
+# Has NO path, which it would do if LaTeX file
+# Highly likely to be mis-parsed line
+# 3 = ditto, but has a path character ('/').
+# Should be LaTeX file that exists.
+# If it doesn't exist, we have probably a mis-parsed line.
+# There's no need to do a search.
+# 4 = definitive, which in this subroutine is only
+# done for default dependents
+# Treat the following specially, since they have special rules
+# @bbl_files to list of .bbl files.
+# %idx_files to map from .idx files to .ind files.
+# Also set
+# $reference_changed, $bad_reference, $bad_citation
+# Trivial or default values if log file does not exist/cannot be opened
+
+# Give a quick way of looking up custom-dependency extensions
+ my %cusdep_from = ();
+ my %cusdep_to = ();
+ foreach ( @cus_dep_list ) {
+ my ($fromext, $toext) = split;
+ $cusdep_from{$fromext} = $cusdep_from{".$fromext"} = $_;
+ $cusdep_to{$toext} = $cusdep_to{".$toext"} = $_;
+ }
+# print "==== Cusdep from-exts:"; foreach (keys %cusdep_from) {print " '$_'";} print "\n";
+# print "==== Cusdep to-exts:"; foreach (keys %cusdep_to) {print " '$_'";} print "\n";
+
+ # Returned info:
+ %dependents = ();
+ foreach (@default_includes) { $dependents{$_} = 4; }
+ @bbl_files = ();
+ %idx_files = (); # Maps idx_file to (ind_file, base)
+
+ $reference_changed = 0;
+ $bad_reference = 0;
+ $bad_citation = 0;
+
+ my $log_name = "$root_filename.log";
+ my $log_file = new FileHandle;
+ if ( ! open( $log_file, "<$log_name" ) ) {
+ return 0;
+ }
+
+LINE:
+ while(<$log_file>) {
+ # Could use chomp here, but that fails if there is a mismatch
+ # between the end-of-line sequence used by latex and that
+ # used by perl. (Notably a problem with MSWin latex and
+ # cygwin perl!)
+ s/[\n\r]*$//;
+ if ( $. == 1 ){
+ if ( /^This is / ) {
+ # First line OK
+ next LINE;
+ } else {
+ warn "$My_name: Error on first line of '$log_name'. ".
+ "This is apparently not a TeX log file.\n";
+ close $log_file;
+ $failure = 1;
+ $failure_msg = "Log file '$log_name' appears to have wrong format.";
+ return 0;
+ }
+ }
+ # Handle wrapped lines:
+ # They are lines brutally broken at exactly $log_wrap chars
+ # excluding line-end.
+ my $len = length($_);
+ while ($len == $log_wrap) {
+ my $extra = <$log_file>;
+ $extra =~ s/[\n\r]*$//;
+ $len = length($extra);
+ $_ .= $extra;
+ }
+ # Check for changed references, bad references and bad citations:
+ if (/Rerun to get/) {
+ warn "$My_name: References changed.\n";
+ $reference_changed = 1;
+ }
+ if (/LaTeX Warning: (Reference[^\001]*undefined)./) {
+ warn "$My_name: $1 \n";
+ $bad_reference = 1;
+ }
+ if (/LaTeX Warning: (Citation[^\001]*undefined)./) {
+ warn "$My_name: $1 \n";
+ $bad_citation = 1;
+ }
+ if ( /^Document Class: / ) {
+ # Class sign-on line
+ next LINE;
+ }
+ if ( /^\(Font\)/ ) {
+ # Font info line
+ next LINE;
+ }
+ if ( /^Output written on / ) {
+ # Latex message
+ next LINE;
+ }
+ if ( /^Overfull /
+ || /^Underfull /
+ || /^or enter new name\. \(Default extension: .*\)/
+ || /^\*\*\* \(cannot \\read from terminal in nonstop modes\)/
+ ) {
+ # Latex error/warning, etc.
+ next LINE;
+ }
+# Test for writing of index file. The precise format of the message
+# depends on which package (makeidx.sty , multind.sty or index.sty) and
+# which version writes the message.
+ if ( /Writing index file (.*)$/ ) {
+ my $idx_file = '';
+ if ( /^Writing index file (.*)$/ ) {
+ # From makeidx.sty or multind.sty
+ $idx_file = $1;
+ }
+ elsif ( /^index\.sty> Writing index file (.*)$/ ) {
+ # From old versions of index.sty
+ $idx_file = $1;
+ }
+ elsif ( /^Package \S* Info: Writing index file (.*) on input line/ ) {
+ # From new versions of index.sty
+ $idx_file = $1;
+ }
+ else {
+ warn "$My_name: Message indicates index file was written\n",
+ " ==> but I do not know how to understand it: <==\n",
+ " '$_'\n";
+ next LINE;
+ }
+ # Typically, there is trailing space, not part of filename:
+ $idx_file =~ s/\s*$//;
+ $idx_file = clean_file_name($idx_file);
+ my ($idx_base, $idx_path, $idx_ext) = fileparseA( $idx_file );
+ $idx_base = $idx_path.$idx_base;
+ $idx_file = $idx_base.$idx_ext;
+ if ( $idx_ext eq '.idx' ) {
+ warn "$My_name: Index file '$idx_file' was written\n"
+ unless $silent;
+ $idx_files{$idx_file} = [ "$idx_base.ind", $idx_base ];
+ }
+ elsif ( exists $cusdep_from{$idx_ext} ) {
+ if ( !$silent ) {
+ warn "$My_name: Index file '$idx_file' was written\n";
+ warn " Cusdep '$cusdep_from{$idx_ext}' should be used\n";
+ }
+ # No action needed here
+ }
+ else {
+ warn "$My_name: Index file '$idx_file' written\n",
+ " ==> but it has an extension I do not know how to handle <==\n";
+ }
+
+ next LINE;
+ }
+ if ( /^No file (.*?\.bbl)./ ) {
+ # Notice that the
+ my $bbl_file = clean_file_name($1);
+ warn "$My_name: Non-existent bbl file '$bbl_file'\n $_\n";
+ $dependents{$bbl_file} = 0;
+ push @bbl_files, $bbl_file;
+ next LINE;
+ }
+ foreach my $pattern (@file_not_found) {
+ if ( /$pattern/ ) {
+ my $file = clean_file_name($1);
+ warn "$My_name: Missing input file: '$file' from line\n '$_'\n"
+ unless $silent;
+ $dependents{$file} = 0;
+ next LINE;
+ }
+ }
+ if ( /^File: ([^\s\[]*) Graphic file \(type / ) {
+ # First line of message from includegraphics/x
+ $dependents{$1} = 1;
+ next LINE;
+ }
+ # Now test for generic lines to ignore, only after special cases!
+ if ( /^File: / ) {
+ # Package sign-on line. Includegraphics/x also produces a line
+ # with this signature, but I've already handled it.
+ next LINE;
+ }
+ if ( /^Package: / ) {
+ # Package sign-on line
+ next LINE;
+ }
+ if (/^\! LaTeX Error: / ) {
+ next LINE;
+ }
+ if (/^No pages of output\./) {
+ warn "$My_name: Log file says no output from latex\n"
+ unless $silent;
+ next LINE;
+ }
+ INCLUDE_CANDIDATE:
+ while ( /\((.*$)/ ) {
+ # Filename found by
+ # '(', then filename, then terminator.
+ # Terminators: obvious candidates: ')': end of reading file
+ # '(': beginning of next file
+ # ' ': space is an obvious separator
+ # ' [': start of page: latex
+ # and pdflatex put a
+ # space before the '['
+ # '[': start of config file
+ # in pdflatex, after
+ # basefilename.
+ # '{': some kind of grouping
+ # Problem:
+ # All or almost all special characters are allowed in
+ # filenames under some OS, notably UNIX. Luckily most cases
+ # are rare, if only because the special characters need
+ # escaping. BUT 2 important cases are characters that are
+ # natural punctuation
+ # Under MSWin, spaces are common (e.g., "C:\Program Files")
+ # Under VAX/VMS, '[' delimits directory names. This is
+ # tricky to handle. But I think few users use this OS
+ # anymore.
+ #
+ # Solution: use ' [', but not '[' as first try at delimiter.
+ # Then if candidate filename is of form 'name1[name2]', then
+ # try splitting it. If 'name1' and/or 'name2' exists, put
+ # it/them in list, else just put 'name1[name2]' in list.
+ # So form of filename is now:
+ # '(',
+ # then any number of characters that are NOT ')', '(', or '{'
+ # (these form the filename);
+ # then ' [', or ' (', or ')', or end-of-string.
+ # That fails for pdflatex
+ # In log file:
+ # '(' => start of reading of file, followed by filename
+ # ')' => end of reading of file
+ # '[' => start of page (normally preceeded by space)
+ # Remember:
+ # filename (on VAX/VMS) may include '[' and ']' (directory
+ # separators)
+ # filenames (on MS-Win) commonly include space.
+
+ # First step: replace $_ by whole of line after the '('
+ # Thus $_ is putative filename followed by other stuff.
+ $_ = $1;
+ if ( /^([^\(^\)^\{]*?)\s\[/ ) {
+ # Terminator: space then '['
+ # Use *? in condition: to pick up first ' [' as terminator
+ # 'file [' should give good filename.
+ }
+ elsif ( /^([^\(^\)^\{]*)\s(?=\()/ ) {
+ # Terminator is ' (', but '(' isn't in matched string,
+ # so we keep the '(' ready for the next match
+ }
+ elsif ( /^([^\(^\)^\{]*)(\))/ ) {
+ # Terminator is ')'
+ }
+ elsif ( /^([^\(^\)^\{]*?)\s*\{/ ) {
+ # Terminator: arbitrary space then '{'
+ # Use *? in condition: to pick up first ' [' as terminator
+ # 'file [' should give good filename.
+ }
+ else {
+ #Terminator is end-of-string
+ }
+ $_ = $'; # Put $_ equal to the unmatched tail of string '
+ my $include_candidate = $1;
+ $include_candidate =~ s/\s*$//; # Remove trailing space.
+ if ( $include_candidate eq "[]" ) {
+ # Part of overfull hbox message
+ next INCLUDE_CANDIDATE;
+ }
+ if ( $include_candidate =~ /^\\/ ) {
+ # Part of font message
+ next INCLUDE_CANDIDATE;
+ }
+ # Make list of new include files; sometimes more than one.
+ my @new_includes = ($include_candidate);
+ if ( $include_candidate =~ /^(.+)\[([^\]]+)\]$/ ) {
+ # Construct of form 'file1[file2]', as produced by pdflatex
+ if ( -e $1 ) {
+ # If the first component exists, we probably have the
+ # pdflatex form
+ @new_includes = ($1, $2);
+ }
+ else {
+ # We have something else.
+ # So leave the original candidate in the list
+ }
+ }
+ INCLUDE_NAME:
+ foreach my $include_name (@new_includes) {
+ my ($base, $path, $ext) = fileparseB( $include_name );
+ if ( ($path eq './') || ($path eq '.\\') ) {
+ $include_name = $base.$ext;
+ }
+ if ( $include_name !~ m'[/|\\]' ) {
+ # Filename does not include a path character
+ # High potential for misparsed line
+ $dependents{$include_name} = 2;
+ } else {
+ $dependents{$include_name} = 3;
+ }
+ if ( $ext eq '.bbl' ) {
+ warn "$My_name: Found input bbl file '$include_name'\n"
+ unless $silent;
+ push @bbl_files, $include_name;
+ }
+ } # INCLUDE_NAME
+ } # INCLUDE_CANDIDATE
+ } # LINE
+ close($log_file);
+
+ # Default includes are always definitive:
+ foreach (@default_includes) { $dependents{$_} = 4; }
+
+ ###print "New parse: \n";
+ ###foreach (sort keys %dependents) { print " '$_': $dependents{$_}\n"; }
+
+ my @misparsed = ();
+ my @missing = ();
+ my @not_found = ();
+CANDIDATE:
+ foreach my $candidate (keys %dependents) {
+ my $code = $dependents{$candidate};
+ if ( -e $candidate ) {
+ $dependents{$candidate} = 4;
+ }
+ elsif ($code == 1) {
+ # Graphics file that is supposed to have been read.
+ # Candidate name is as given in source file, not as path
+ # to actual file.
+ # We have already tested that file doesn't exist, as given.
+ # so use kpsewhich.
+ # If the file still is not found, assume non-existent;
+ my @kpse_result = kpsewhich( $candidate );
+ if ($#kpse_result > -1) {
+ $dependents{$kpse_result[0]} = 4;
+ delete $dependents{$candidate};
+ next CANDIDATE;
+ }
+ else {
+ push @not_found, $candidate;
+ }
+ }
+ elsif ($code == 2) {
+ # Candidate is from '(...' construct in log file, for input file
+ # which should include pathname if valid input file.
+ # Name does not have pathname-characteristic character (hence
+ # $code==2.
+ # Candidate file does not exist with given name
+ # Almost surely result of a misparsed line in log file.
+ delete $dependents{$candidate};
+ push @misparse, $candidate;
+ }
+ elsif ($code == 0) {
+ my ($base, $path, $ext) = fileparseA($candidate);
+ $ext =~ s/^\.//;
+ if ( ($ext eq '') && (-e "$path$base.tex") ) {
+ $dependents{"$path$base.tex"} = 4;
+ delete $dependents{$candidate};
+ }
+ push @missing, $candidate;
+ }
+ }
+
+
+ if ( $diagnostics ) {
+ @misparse = uniqs( @misparse );
+ @missing = uniqs( @missing );
+ @not_found = uniqs( @not_found );
+ my @dependents = sort( keys %dependents );
+
+ my $dependents = $#dependents + 1;
+ my $misparse = $#misparse + 1;
+ my $missing = $#missing + 1;
+ my $not_found = $#not_found + 1;
+ my $exist = $dependents - $not_found - $missing;
+ my $bbl = $#bbl_files + 1;
+
+ print "$dependents dependent files detected, of which ",
+ "$exist exist, $not_found were not found,\n",
+ " and $missing appear not to exist.\n";
+ print "Dependents:\n";
+ foreach (@dependents) { print " $_\n"; }
+ if ($not_found > 0) {
+ print "Not found:\n";
+ foreach (@not_found) { print " $_\n"; }
+ }
+ if ($missing > 0) {
+ print "Not existent:\n";
+ foreach (@missing) { print " $_\n"; }
+ }
+ if ( $bbl > 0 ) {
+ print "Input bbl files:\n";
+ foreach (@bbl_files) { print " $_\n"; }
+ }
+
+ if ( $misparse > 0 ) {
+ print "$misparse\n";
+ print "Apparent input files appearently from misunderstood lines in .log file:\n";
+ foreach ( @misparse ) { print " $_\n"; }
+ }
+ }
+
+ return 1;
+} #END parse_logB
+
+#************************************************************
+
+sub parse_aux {
+ #Usage: parse_aux( $aux_file, \@new_bib_files, \@new_aux_files )
+ # Parse aux_file (recursively) for bib files.
+ # If can't open aux file, then
+ # Return 0 and leave @new_bib_files empty
+ # Else set @new_bib_files from information in the aux files
+ # And:
+ # Return 1 if no problems
+ # Return 2 with @new_bib_files empty if there are no \bibdata
+ # lines.
+ # Return 3 if I couldn't locate all the bib_files
+ # Set @new_aux_files to aux files parsed
+
+ my $aux_file = $_[0];
+ local $Pbib_files = $_[1];
+ local $Paux_files = $_[2];
+
+ @$Pbib_files = ();
+ @$Paux_files = ();
+
+ parse_aux1( $aux_file );
+ if ($#{$Paux_files} < 0) {
+ return 0;
+ }
+ @$Pbib_files = uniqs( @$Pbib_files );
+
+ if ( $#{$Pbib_files} == -1 ) {
+ warn "$My_name: No .bib files listed in .aux file '$aux_file' \n",
+ return 2;
+ }
+ my $bibret = &find_file_list1( $Pbib_files, $Pbib_files,
+ '.bib', \@BIBINPUTS );
+ @$Pbib_files = uniqs( @$Pbib_files );
+ if ($bibret == 0) {
+ warn "$My_name: Found bibliography file(s) [@$Pbib_files]\n"
+ unless $silent;
+ }
+ else {
+ warn "$My_name: Failed to find one or more bibliography files ",
+ "in [@$Pbib_files]\n";
+ if ($force_mode) {
+ warn "==== Force_mode is on, so I will continue. ",
+ "But there may be problems ===\n";
+ }
+ else {
+ #$failure = -1;
+ #$failure_msg = 'Failed to find one or more bib files';
+ #warn "$My_name: Failed to find one or more bib files\n";
+ }
+ return 3;
+ }
+ return 1;
+} #END parse_aux
+
+#************************************************************
+
+sub parse_aux1
+# Parse single aux file for bib files.
+# Usage: &parse_aux1( aux_file_name )
+# Append newly found bib_filenames in @$Pbib_files, already
+# initialized/in use.
+# Append aux_file_name to @$Paux_files if aux file opened
+# Recursively check \@input aux files
+# Return 1 if success in opening $aux_file_name and parsing it
+# Return 0 if fail to open it
+{
+ my $aux_file = $_[0];
+ my $aux_fh = new FileHandle;
+ if (! open($aux_fh, $aux_file) ) {
+ warn "$My_name: Couldn't find aux file '$aux_file'\n";
+ return 0;
+ }
+ push @$Paux_files, $aux_file;
+AUX_LINE:
+ while (<$aux_fh>) {
+ if ( /^\\bibdata\{(.*)\}/ ) {
+ # \\bibdata{comma_separated_list_of_bib_file_names}
+ # (Without the '.bib' extension)
+ push( @$Pbib_files, split /,/, $1 );
+ }
+ elsif ( /^\\\@input\{(.*)\}/ ) {
+ # \\@input{next_aux_file_name}
+ &parse_aux1( $1 );
+ }
+ }
+ close($aux_fh);
+ return 1;
+} #END parse_aux1
+
+#************************************************************
+
+#************************************************************
+#************************************************************
+#************************************************************
+
+# Manipulations of main file database:
+
+#************************************************************
+
+sub fdb_get {
+ # Call: fdb_get(filename)
+ # Returns an array (time, size, md5) for the current state of the
+ # named file.
+ # For non-existent file, deletes entry in fdb_current, and returns (0,-1,0)
+ my $file = shift;
+ my ($new_time, $new_size) = get_time_size($file);
+ my @nofile = (0,-1,0); # What we use for initializing
+ # a new entry in fdb or flagging
+ # non-existent file
+ if ( $new_size < 0 ) {
+ delete $fdb_current{$file};
+ return @nofile;
+ }
+ my $recalculate_md5 = 0;
+ if ( ! exists $fdb_current{$file} ) {
+ # Ensure we have a record.
+ $fdb_current{$file} = [@nofile];
+ $recalculate_md5 = 1;
+ }
+ my $file_data = $fdb_current{$file};
+ my ( $time, $size, $md5 ) = @$file_data;
+ if ( ($new_time != $time) || ($new_size != $size) ) {
+ # Only force recalculation of md5 if time or size changed
+ # Else we assume file is really unchanged.
+ $recalculate_md5 = 1;
+ }
+ if ($recalculate_md5) {
+ @$file_data = ( $new_time, $new_size, get_checksum_md5( $file ) );
+ }
+ return @$file_data;;
+} #END fdb_get
+
+#************************************************************
+
+sub fdb_show {
+ # Displays contents of fdb
+ foreach my $file ( sort keys %fdb_current ) {
+ print "'$file': @{$fdb_current{$file}}\n";
+ }
+} #END fdb_show
+
+#************************************************************
+#************************************************************
+#************************************************************
+
+# Routines for manipulating rule database
+
+#************************************************************
+
+sub rdb_read {
+ # Call: rdb_read( $in_name )
+ # Sets rule database from saved file, in format written by rdb_write.
+ # Returns -1 if file could not be read else number of errors.
+ # Thus return value on success is 0
+ my $in_name = $_[0];
+
+ my $in_handle = new FileHandle;
+ $in_handle->open( $in_name, '<' )
+ or return ();
+ my $errors = 0;
+ my $state = 0; # Outside a section
+ my $rule = '';
+ my $run_time = 0;
+ my $source = '';
+ my $dest = '';
+ my $base = '';
+ local %new_sources = (); # Hash: rule => { file=>[ time, size, md5, fromrule ] }
+ my $new_source = undef; # Reference to hash of sources for current rule
+LINE:
+ while ( <$in_handle> ) {
+ # Remove leading and trailing white space.
+ s/^\s*//;
+ s/\s*$//;
+ # Ignore blank lines and comments
+ if ( /^$/ || /^#/ || /^%/ ) { next LINE;}
+ if ( /^\[\"([^\"]+)\"\]/ ) {
+ # Start of section
+ $rule = $1;
+#?? print "--- Starting rule '$rule'\n";
+ my $tail = $'; #' Single quote in comment tricks the parser in
+ # emacs from misparsing an isolated single quote
+ $run_time = 0;
+ $source = $dest = $base = '';
+ if ( $tail =~ /^\s*(\S+)\s*$/ ) {
+ $run_time = $1;
+ }
+ elsif ( $tail =~ /^\s*(\S+)\s+\"([^\"]*)\"\s+\"([^\"]*)\"\s+\"([^\"]*)\"\s*$/ ) {
+ $run_time = $1;
+ $source = $2;
+ $dest = $3;
+ $base = $4;
+ }
+ if ( rdb_rule_exists( $rule ) ) {
+ rdb_one_rule( $rule,
+ sub{ $$Ptest_kind = 1;
+ $$Prun_time = $run_time;
+ #??if ($source) { $$Psource = $source; }
+ #??if ($dest) { $$Pdest = $dest; }
+ #??if ($base) { $$Pbase = $base; }
+ }
+ );
+ }
+ elsif ($rule =~ /^cusdep\s+(\S+)\s+(\S+)\s+(.+)$/ ) {
+ # Create custom dependency
+ my $fromext = $1;
+ my $toext = $2;
+ my $base = $3;
+ $source = "$base.$fromext";
+ $dest = "$base.$toext";
+ my $PAnew_cmd = ['do_cusdep', ''];
+ foreach my $dep ( @cus_dep_list ) {
+ my ($tryfromext,$trytoext,$must,$func_name) = split(' ',$dep);
+ if ( ($tryfromext eq $fromext) && ($trytoext eq $toext) ) {
+ $$PAnew_cmd[1] = $func_name;
+ }
+ }
+ rdb_create_rule( $rule, 'cusdep', '', $PAnew_cmd, 1,
+ $source, $dest, $base, 0, $run_time );
+ }
+ elsif ( $rule =~ /^(makeindex|bibtex)\s*(.*)$/ ) {
+ my $rule_generic = $1;
+ if ( ! $source ) {
+ # If fdb_file was old-style (v. 1)
+ $source = $2;
+ my $path = '';
+ my $ext = '';
+ ($base, $path, $ext) = fileparseA( $source );
+ $base = $path.$base;
+ if ($rule_generic eq 'makeindex') {
+ $dest = "$base.ind";
+ }
+ elsif ($rule_generic eq 'bibtex') {
+ $dest = "$base.bbl";
+ $source = "$base.aux";
+ }
+ }
+ warn "$My_name: File-database '$in_name': setting rule '$rule'\n"
+ if $diagnostics;
+ my $cmd_type = 'external';
+ my $ext_cmd = ${$rule_generic};
+ warn " Rule kind = '$rule_generic'; ext_cmd = '$ext_cmd';\n",
+ " source = '$source'; dest = '$dest'; base = '$base';\n"
+ if $diagnostics;
+ rdb_create_rule( $rule, $cmd_type, $ext_cmd, '', 1,
+ $source, $dest, $base, 0, $run_time);
+ }
+ else {
+ warn "$My_name: In file-database '$in_name' rule '$rule'\n",
+ " is not in use in this session\n"
+ if $diagnostics;
+ $new_source = undef;
+ $state = 3;
+ next LINE;
+ }
+ $new_source = $new_sources{$rule} = {};
+ $state = 1; #Reading a section
+ }
+ elsif ( /^\"([^\"]*)\"\s+(\S+)\s+(\S+)\s+(\S+)\s+\"([^\"]*)\"/ ) {
+ # Source file line
+ if ($state == 3) {
+ # The rule is not being currently used.
+ next LINE;
+ }
+ my $file = $1;
+ my $time = $2;
+ my $size = $3;
+ my $md5 = $4;
+ my $from_rule = $5;
+#?? print " --- File '$file'\n";
+ if ($state != 1) {
+ warn "$My_name: In file-database '$in_name' ",
+ "line $. is outside a section:\n '$_'\n";
+ $errors++;
+ next LINE;
+ }
+ rdb_ensure_file( $rule, $file );
+ rdb_set_file1( $rule, $file, $time, $size, $md5 );
+ # Save the rest of the data, especially the from_fule until we know all
+ # the rules, otherwise the from_rule may not exist.
+ # Also we'll have a better chance of looping through files.
+ ${$new_source}{$file} = [ $time, $size, $md5, $from_rule ];
+ }
+ elsif ($state == 0) {
+ # Outside a section. Nothing to do.
+ }
+ else {
+ warn "$My_name: In file-database '$in_name' ",
+ "line $. is of wrong format:\n '$_'\n";
+ $errors++;
+ next LINE;
+ }
+ }
+ undef $in_handle;
+ # Set cus dependencies.
+ &rdb_set_dependentsA( keys %rule_db );
+
+#?? Check from_rules exist.
+
+ return $errors;
+} # END rdb_read
+
+#************************************************************
+
+sub rdb_read_generatedB {
+ # Call: rdb_read_generatedB( $in_name, \@extra_generated, \@aux_files )
+ # From rule database in saved file, in format written by rdb_write,
+ # finds the non-basic generated files that are to be deleted by a cleanup.
+ # Returns an array of these files, or an empty array if the file
+ # does not exist or cannot be opened.
+ my ($in_name, $Pgenerated, $Paux_files) = @_;
+ @$Pgenerated = ();
+ @$Paux_files = ();
+
+ my $in_handle = new FileHandle;
+ $in_handle->open( $in_name, '<' )
+ or return ();
+ my $rule = '';
+ my $run_time = 0;
+ my $source = '';
+ my $dest = '';
+ my $base = '';
+ my $ext = '';
+ my $path = '';
+ my $state = 0; # Outside a section
+LINE:
+ while ( <$in_handle> ) {
+ # Remove leading and trailing white space.
+ s/^\s*//;
+ s/\s*$//;
+ # Ignore blank lines and comments
+ if ( /^$/ || /^#/ || /^%/ ) { next LINE;}
+ if ( /^\[\"([^\"]+)\"\]/ ) {
+ # Start of section
+ $rule = $1;
+ my $tail = $'; #' Single quote in comment tricks the parser in
+ # emacs from misparsing an isolated single quote
+ $run_time = 0;
+ $source = $dest = $base = '';
+ if ( $tail =~ /^\s*(\S+)\s+\"([^\"]*)\"\s+\"([^\"]*)\"\s+\"([^\"]*)\"\s*$/ ) {
+ $source = $2;
+ $dest = $3;
+ $base = $4;
+ }
+ else { next LINE; }
+ if ( $rule =~ /^makeindex/ ) {
+ push @$Pgenerated, $source, $dest, "$base.ilg";
+ }
+ elsif ( $rule =~ /^bibtex/ ) {
+ push @$Pgenerated, $dest, "$base.blg";
+ push @$Paux_files, $source;
+ }
+ $state = 1; #Reading a section
+ }
+ elsif ( /^\"([^\"]*)\"\s+(\S+)\s+(\S+)\s+(\S+)\s+\"([^\"]*)\"/ ) {
+ # Source file line
+ if ($state == 3) {
+ # The rule is not being currently used.
+ next LINE;
+ }
+ my $file = $1;
+ ($base, $path, $ext) = fileparseA( $file );
+ if ( $ext eq '.aux' ) { push @$Paux_files, $file; }
+ }
+ elsif ($state == 0) {
+ # Outside a section. Nothing to do.
+ }
+ else {
+ warn "$My_name: In file-database '$in_name' ",
+ "line $. is of wrong format:\n '$_'\n";
+ next LINE;
+ }
+ } # LINE
+ undef $in_handle;
+
+} # END rdb_read_generatedB
+
+#************************************************************
+
+sub rdb_write {
+ # Call: rdb_write( $out_name )
+ # Writes to the given file name the database of file and rule data
+ # accessible from the primary rules.
+ # Returns 1 on success, 0 if file couldn't be opened.
+ local $out_name = $_[0];
+ local $out_handle = new FileHandle;
+ if ( ($out_name eq "") || ($out_name eq "-") ) {
+ # Open STDOUT
+ $out_handle->open( '>-' );
+ }
+ else {
+ $out_handle->open( $out_name, '>' );
+ }
+ if (!$out_handle) { return 0; }
+
+ local %current_primaries = (); # Hash whose keys are primary rules
+ # needed, i.e., known latex-like rules which trigger
+ # circular dependencies
+ local @pre_primary = (); # Array of rules
+ local @post_primary = (); # Array of rules
+ local @one_time = (); # Array of rules
+ &rdb_classify_rules( \%possible_primaries, keys %requested_filerules );
+
+ print $out_handle "# Fdb version $fdb_ver\n";
+ my @rules = sort(
+ rdb_accessible(
+ uniq1( keys %known_rules, keys %current_primaries )));
+ rdb_for_some(
+ \@rules,
+ sub { print $out_handle "[\"$rule\"] $$Prun_time \"$$Psource\" \"$$Pdest\" \"$$Pbase\" \n"; },
+ sub { print $out_handle " \"$file\" $$Ptime $$Psize $$Pmd5 \"$$Pfrom_rule\"\n"; },
+ );
+ undef $out_handle;
+ return 1;
+} #END rdb_write
+
+#************************************************************
+
+sub rdb_set_from_logB {
+ # Assume rule context.
+ # This is intended to be applied only for a primary (LaTeX-like) rule
+ # Starting from the log_file, set current details for the current rule.
+
+ # Rules should only be primary
+ if ( $$Pcmd_type ne 'primary' ) {
+ warn "\n$My_name: ==========$My_name: Probable BUG======= \n ",
+ " rdb_set_from_logB called to set files ",
+ "for non-primary rule '$rule'\n\n";
+ return;
+ }
+
+
+#?? # We'll prune this by all files determined to be needed for source files.
+#?? my %unneeded_source = %$PHsource;
+
+ # Parse log file to find relevant filenames
+ # Result in the following variables:
+ local %dependents = (); # Maps files to status
+ local @bbl_files = ();
+ local %idx_files = (); # Maps idx_file to (ind_file, base)
+
+ # The following are also returned, but are global, to be used by caller
+ # $reference_changed, $bad_reference $bad_citation
+
+ &parse_logB;
+
+ IDX_FILE:
+ foreach my $idx_file ( keys %idx_files ) {
+ my ($ind_file, $ind_base) = @{$idx_files{$idx_file}};
+ my $from_rule = "makeindex $idx_file";
+ if ( ! rdb_rule_exists( $from_rule ) ){
+ print "!!!===Creating rule '$from_rule': '$ind_file' from '$idx_file'\n"
+ if ($diagnostics);
+ rdb_create_rule( $from_rule, 'external', $makeindex, '', 1,
+ $idx_file, $ind_file, $ind_base, 1, 0);
+ foreach my $primary ( keys %primaries ) {
+ print " ===Source file '$ind_file' for '$primary'\n"
+ if ($diagnostics > -1);
+ rdb_ensure_file( $primary, $ind_file, $from_rule );
+ }
+ }
+ if ( ! -e $ind_file ) {
+ # Failure was non-existence of makable file
+ # Leave failure issue to other rules.
+ $failure = 0;
+ }
+ }
+
+ BBL_FILE:
+ foreach my $bbl_file ( uniqs( @bbl_files ) ) {
+ my ($bbl_base, $bbl_path, $bbl_ext) = fileparseA( $bbl_file );
+ $bbl_base = $bbl_path.$bbl_base;
+ my @new_bib_files;
+ my @new_aux_files;
+ &parse_aux( "$bbl_base.aux", \@new_bib_files, \@new_aux_files );
+ my $from_rule = "bibtex $bbl_base";
+ if ( ! rdb_rule_exists( $from_rule ) ){
+ print "!!!===Creating rule '$from_rule'\n"
+ if ($diagnostics);
+ rdb_create_rule( $from_rule, 'external', $bibtex, '', 1,
+ "$bbl_base.aux", $bbl_file, $bbl_base, 1, 0);
+ foreach my $source ( @new_bib_files, @new_aux_files ) {
+ print " ===Source file '$source'\n"
+ if ($diagnostics);
+ rdb_ensure_file( $from_rule, $source );
+ }
+ foreach my $primary ( keys %primaries ) {
+ print " ===Source file '$bbl_file' for '$primary'\n"
+ if ($diagnostics);
+ rdb_ensure_file( $primary, $bbl_file, $from_rule );
+ if ( ! -e $bbl_file ) {
+ # Failure was non-existence of makable file
+ # Leave failure issue to other rules.
+ $failure = 0;
+ }
+ }
+ }
+ }
+
+NEW_SOURCE:
+ foreach my $new_source (keys %dependents) {
+ foreach my $primary ( keys %primaries ) {
+ rdb_ensure_file( $primary, $new_source );
+ }
+ }
+
+ my @more_sources = &rdb_set_dependentsA( $rule );
+ my $num_new = $#more_sources + 1;
+ foreach (@more_sources) {
+ $dependents{$_} = 4;
+ if ( ! -e $_ ) {
+ # Failure was non-existence of makable file
+ # Leave failure issue to other rules.
+ $failure = 0;
+ $$Pchanged = 1; # New files can be made. Ignore error.
+ }
+ }
+ if ($diagnostics) {
+ if ($num_new > 0 ) {
+ print "$num_new new source files for rule '$rule':\n";
+ foreach (@more_sources) { print " '$_'\n"; }
+ }
+ else {
+ print "No new source files for rule '$rule':\n";
+ }
+ }
+
+ my @files_not_needed = ();
+ foreach (keys %$PHsource) {
+ if ( ! exists $dependents{$_} ) {
+ print "Removing no-longer-needed dependent '$_' from rule '$rule'\n"
+ if $diagnostics>-1;
+ push @files_not_needed, $_;
+ }
+ }
+ rdb_remove_files( $rule, @files_not_needed );
+
+} # END rdb_set_from_logB
+
+#************************************************************
+
+sub rdb_find_new_filesB {
+ # Call: rdb_find_new_filesB
+ # Assumes rule context for primary rule.
+ # Deal with files which were missing and for which a method
+ # of finding them has become available:
+ # (a) A newly available source file for a custom dependency.
+ # (b) When there was no extension, a file with appropriate
+ # extension
+ # (c) When there was no extension, and a newly available source
+ # file for a custom dependency can make it.
+
+ my %new_includes = ();
+
+MISSING_FILE:
+ foreach my $missing ( keys %$PHsource ) {
+ next if ( $$PHsource{$missing} != 0 );
+ my ($base, $path, $ext) = fileparseA( $missing );
+ $ext =~ s/^\.//;
+ if ( -e "$missing.tex" ) {
+ $new_includes{"$missing.tex"} = 1;
+ }
+ if ( -e $missing ) {
+ $new_includes{$missing} = 1;
+ }
+ if ( $ext ne "" ) {
+ foreach my $dep (@cus_dep_list){
+ my ($fromext,$toext) = split(' ',$dep);
+ if ( ( "$ext" eq "$toext" )
+ && ( -e "$path$base.$fromext" )
+ ) {
+ # Source file for the missing file exists
+ # So we have a real include file, and it will be made
+ # next time by rdb_set_dependents
+ $new_includes{$missing} = 1;
+ }
+ else {
+ # no point testing the $toext if the file doesn't exist.
+ }
+ next MISSING_FILE;
+ }
+ }
+ else {
+ # $_ doesn't exist, $_.tex doesn't exist,
+ # and $_ doesn't have an extension
+ foreach my $dep (@cus_dep_list){
+ my ($fromext,$toext) = split(' ',$dep);
+ if ( -e "$path$base.$fromext" ) {
+ # Source file for the missing file exists
+ # So we have a real include file, and it will be made
+ # next time by &rdb__dependents
+ $new_includes{"$path$base.$toext"} = 1;
+# next MISSING_FILE;
+ }
+ if ( -e "$path$base.$toext" ) {
+ # We've found the extension for the missing file,
+ # and the file exists
+ $new_includes{"$path$base.$toext"} = 1;
+# next MISSING_FILE;
+ }
+ }
+ }
+ } # end MISSING_FILES
+
+ # Sometimes bad line-breaks in log file (etc) create the
+ # impression of a missing file e.g., ./file, but with an incorrect
+ # extension. The above tests find the file with an extension,
+ # e.g., ./file.tex, but it is already in the list. So now I will
+ # remove files in the new_include list that are already in the
+ # include list. Also handle aliasing of file.tex and ./file.tex.
+ # For example, I once found:
+# (./qcdbook.aux (./to-do.aux) (./ideas.aux) (./intro.aux) (./why.aux) (./basics
+#.aux) (./classics.aux)
+
+ my $found = 0;
+ foreach my $file (keys %new_includes) {
+ my $stripped = $file;
+ $stripped =~ s{^\./}{};
+ if ( exists $PHsource{$file} ) {
+ delete $new_includes{$file};
+ }
+ else {
+ $found ++;
+ rdb_ensure_file( $rule, $file );
+ }
+ }
+
+## ?? Is this correct? I used to use @includes
+# rdb_update_files_for_rule( keys %PHsources );
+ if ( $diagnostics && ( $found > 0 ) ) {
+ warn "$My_name: Detected previously missing files:\n";
+ foreach ( sort keys %new_includes ) {
+ warn " '$_'\n";
+ }
+ }
+ return $found;
+} # END rdb_find_new_filesB
+
+#************************************************************
+
+sub rdb_update_files_for_rule {
+#=========== APPEARS NOT TO BE USED! =========================
+# Usage: rdb_update_files_for_rule( source_files ...)
+# Assume rule context.
+# Update list of source files for current rule, treating properly cases
+# where file didn't exist before run, etc
+ foreach my $file ( @_ ) {
+ if ( ! rdb_file_exists( $rule, $file ) ) {
+ # File that didn't appear in the source files for the run
+ # before. Two cases: (a) it was created during the run;
+ # (b) it existed before the run.
+ # If case (a), then the file was non-existent before the
+ # run, so we must now label it as non-existent, and
+ # we trigger a new run
+#?? print "?? Adding '$file' to '$rule'\n";
+ rdb_ensure_file( $rule, $file );
+ my $file_time = get_mtime0( $file );
+ if ( ($$Ptest_kind == 2) || ($$Ptest_kind == 3) ) {
+ # Test wrt destination time, but exclude files
+ # which appear to be generated (according to extension)
+ # Assume generated files up-to-date after last run.
+ # I.e., last run was valid.
+ my $ext = ext( $file );
+
+ if ( (! exists $generated_exts_all{$ext} )
+ && ($file_time >= $dest_mtime)
+ ) {
+ # Only changes since the mtime of the destination matter,
+ # and only non-generated files count.
+ # Non-existent destination etc gives $dest_mtime=0
+ # so this will automatically give out-of-date condition
+ # Flag out-of-date for a file by treating it as non-existent
+ rdb_set_file1( $rule, $file, 0, -1, 0);
+ }
+ }
+ elsif ($file_time >= $$Prun_time ) {
+ # File generated during run. So treat as non-existent at beginning
+ rdb_set_file1( $rule, $file, 0, -1, 0);
+ $$Pout_of_date = 1;
+ }
+ # Else default of current state of file is correct.
+ } # END not previously existent file
+ } # END file
+} # END rdb_update_files_for_rule
+
+#************************************************************
+
+sub rdb_set_dependentsA {
+ # Call rdb_set_dependentsA( rules ...)
+ # Returns array (sorted), of new source files.
+ local @new_sources = ();
+ rdb_recurseA( [@_], 0, \&rdb_one_depA );
+ &rdb_make_links;
+ return uniqs( @new_sources );
+} #END rdb_set_dependentsA
+
+#************************************************************
+
+sub rdb_one_depA {
+ # Helper for finding dependencies. One case, $rule and $file given
+ # Assume file (and rule) context for DESTINATION file.
+ local $new_dest = $file;
+ my ($base_name, $path, $toext) = fileparseA( $new_dest );
+ $base_name = $path.$base_name;
+ $toext =~ s/^\.//;
+DEP:
+ foreach my $dep ( @cus_dep_list ) {
+ my ($fromext,$proptoext,$must,$func_name) = split(' ',$dep);
+ if ( $toext eq $proptoext ) {
+ my $source = "$base_name.$fromext";
+ # Found match of rule
+ if ($diagnostics) {
+ print "Found cusdep: $source to make $rule:$new_dest ====\n";
+ }
+ if ( -e $source ) {
+ $$Pfrom_rule = "cusdep $fromext $toext $base_name";
+#?? print "?? Ensuring rule for '$$Pfrom_rule'\n";
+ local @PAnew_cmd = ( 'do_cusdep', $func_name );
+ if ( !-e $new_dest ) {
+ push @new_sources, $new_dest;
+ }
+ if (! rdb_rule_exists( $$Pfrom_rule ) ) {
+ rdb_create_rule( $$Pfrom_rule, 'cusdep', '', \@PAnew_cmd, 3,
+ $source, $new_dest, $base_name, 0 );
+ }
+ else {
+ rdb_one_rule(
+ $$Pfrom_rule,
+ sub{ @$PAint_cmd = @PAnew_cmd; $$Pdest = $new_dest;}
+ );
+ }
+ return;
+ }
+ else {
+ # Source file does not exist
+ if ( !$force_mode && ( $must != 0 ) ) {
+ # But it is required that the source exist ($must !=0)
+ $failure = 1;
+ $failure_msg = "File '$base_name.$fromext' does not exist ".
+ "to build '$base_name.$toext'";
+ return;
+ }
+ elsif ( $$Pfrom_rule =~ /^cusdep $fromext $toext / ) {
+ # Source file does not exist, destination has the rule set.
+ # So turn the from_rule off
+ $$Pfrom_rule = '';
+ }
+ else {
+ }
+ }
+ }
+ elsif ( ($toext eq '') && (! -e $file ) ) {
+ # Empty extension and non-existent destination
+ # This normally results from \includegraphics{A}
+ # without graphics extension for file, when file does
+ # not exist. So we will try to find something to make it.
+ my $source = "$base_name.$fromext";
+ if ( -e $source ) {
+ $new_dest = "$base_name.$proptoext";
+ my $from_rule = "cusdep $fromext $toext $base_name";
+ push @new_sources, $new_dest;
+ print "Ensuring rule for '$from_rule', to make '$new_dest'\n"
+ if $diagnostics > -1;
+ local @PAnew_cmd = ( 'do_cusdep', $func_name );
+ if (! rdb_rule_exists( $from_rule ) ) {
+ rdb_create_rule( $from_rule, 'cusdep', '', \@PAnew_cmd, 3,
+ $source, $new_dest, $base_name, 0);
+ }
+ else {
+ rdb_one_rule(
+ $$Pfrom_rule,
+ sub{ @$PAint_cmd = @PAnew_cmd; $$Pdest = $new_dest;}
+ );
+ }
+ rdb_ensure_file( $rule, $new_dest, $from_rule );
+ return;
+ }
+ } # End of Rule found
+ } # End DEP
+} #END rdb_one_depA
+
+#************************************************************
+
+sub rdb_list {
+ # Call: rdb_list()
+ # List rules and their source files
+ print "===Rules:\n";
+ local $count_rules = 0;
+ my @accessible_all = rdb_accessible( keys %requested_filerules );
+ rdb_for_some(
+ \@accessible_all,
+ sub{ $count_rules++;
+ print "Rule '$rule' depends on:\n";
+ },
+ sub{ print " '$file'\n"; }
+ );
+ if ($count_rules <= 0) {
+ print " ---No rules defined\n";
+ }
+} #END rdb_list
+
+#************************************************************
+
+sub rdb_show {
+ # Call: rdb_show()
+ # Displays contents of rule data base.
+ # Side effect: Exercises access routines!
+ print "===Rules:\n";
+ local $count_rules = 0;
+ rdb_for_all(
+ sub{ $count_rules++;
+ my @int_cmd = @$PAint_cmd;
+ foreach (@int_cmd) {
+ if ( !defined($_) ) { $_='undef';}
+ }
+ print " [$rule]: '$$Pcmd_type' '$$Pext_cmd' '@int_cmd' $$Ptest_kind ",
+ "'$$Psource' '$$Pdest' '$$Pbase' $$Pout_of_date $$Pout_of_date_user\n"; },
+ sub{ print " '$file': $$Ptime $$Psize $$Pmd5 '$$Pfrom_rule'\n"; }
+ );
+ if ($count_rules <= 0) {
+ print " ---No rules defined\n";
+ }
+} #END rdb_show
+
+#************************************************************
+
+sub rdb_accessible {
+ # Call: rdb_accessible( rule, ...)
+ # Returns array of rules accessible from the given rules
+ local @accessible = ();
+ rdb_recurseA( [@_], sub{ push @accessible, $rule; } );
+ return @accessible;
+} #END rdb_accessible
+
+#************************************************************
+
+sub rdb_possible_primaries {
+ # Returns array of possible primaries
+ my @rules = ();
+ foreach my $rule ( keys %known_rules ) {
+ if ( $known_rules{$rule} eq 'primary') {
+ push @rules, $rule;
+ }
+ }
+ return @rules;
+} #END rdb_possible_primaries
+
+#************************************************************
+#************************************************************
+#************************************************************
+
+# Routines for makes. NEW VERSIONS ??
+
+#????????Debugging routines:
+sub R1 {print "===START $rule\n"}
+sub R2 {print "===END $rule\n"}
+sub F1 {print " ---START $file\n"}
+sub F2 {print " ---END $file\n"}
+#************************************************************
+
+sub rdb_makeB {
+ # Call: rdb_makeB( target, ... )
+ # Makes the targets and prerequisites.
+ # Leaves one-time rules to last.
+ # Does appropriate repeated makes to resolve dependency loops
+
+ # Returns 0 on success, nonzero on failure.
+
+ # General method: Find all accessible rules, then repeatedly make
+ # them until all accessible rules are up-to-date and the source
+ # files are unchanged between runs. On termination, all
+ # accessible rules have stable source files.
+ #
+ # One-time rules are view and print rules that should not be
+ # repeated in an algorithm that repeats rules until the source
+ # files are stable. It is the calling routine's responsibility to
+ # arrange to call them, or to use them here with caution.
+ #
+ # Note that an update-viewer rule need not be considered
+ # one-time. It can be legitimately applied everytime the viewed
+ # file changes.
+ #
+ # Note also that the criterion of stability is to be applied to
+ # source files, not to output files. Repeated application of a
+ # rule to IDENTICALLY CONSTANT source files may produce different
+ # output files. This may be for a trivial reason (e.g., the
+ # output file contains a time stamp, as in the header comments for
+ # a typical postscript file), or for a non-trivial reason (e.g., a
+ # stochastic algorithm, as in abcm2ps).
+ #
+ # This caused me some actual trouble. In general, circular
+ # dependencies produce non-termination, and the the following
+ # situation is an example of a generic situation where certain
+ # rules must be obeyed in order to obtain proper results:
+ # 1. A/the latex source file contains specifications for
+ # certain postprocessing operations. Standard (pdf)latex
+ # already has this, for indexing and bibliography.
+ # 2. In the case in point that caused me trouble, the
+ # specification was for musical tunes that were contained
+ # in external source files not directly input to
+ # (pdf)latex. But in the original version, there was a
+ # style file (abc.sty) that caused latex itself to call
+ # abcm2ps to make .eps files for each tune that were to be
+ # read in on the next run of latex.
+ # 3. Thus the specification can cause a non-terminating loop
+ # for latexmk, because the output files of abcm2ps changed
+ # even with identical input.
+ # 4. The solution was to
+ # a. Use a style file abc_get.sty that simply wrote the
+ # specification on the tunes to the .aux file in a
+ # completely deterministic fashion.
+ # b. Instead of latex, use a script abclatex.pl that runs
+ # latex and then extracts the abc contents for each tune
+ # from the source abc file. This is also
+ # deterministic.
+ # c. Use a cusdep rule in latexmk to convert the tune abc
+ # files to eps. This is non-deterministic, but only
+ # gets called when the (deterministic) source file
+ # changes.
+ # This solves the problem. Latexmk works. Also, it is no
+ # longer necessary to enable write18 in latex, and multiple
+ # unnecessary runs of abcm2ps are no longer used.
+ #
+ # The order of testing and applying rules is chosen by the
+ # following heuristics:
+ # 1. Both latex and pdflatex may be used, but the resulting
+ # aux files etc may not be completely identical. Define
+ # latex and pdflatex as primary rules. Apply the general
+ # method of repeated circulating through all rules until
+ # the source files are stable for each primary rule
+ # separately. Naturally the rules are all accessible
+ # rules, but excluding primary rules except for the current
+ # primary.
+ # 2. Assume that the primary rules are relatively
+ # time-consuming, so that unnecessary passes through them
+ # to check stability of the source files should be avoided.
+ # 3. Assume that although circular dependencies exist, the
+ # rules can nevertheless be thought of as basically
+ # non-circular, and that many rules are strictly or
+ # normally non-circular. In particular cusdep rules are
+ # typically non-circular (e.g., fig2eps), as are normal
+ # output processing rules like dvi2ps.
+ # 4. The order for the non-circular approximation is
+ # determined by applying the assumption that an output file
+ # from one rule that is read in for an earlier stage is
+ # unchanged.
+ # HOWEVER, at a first attempt, the ordering is not needed. It
+ # only gives an optimization
+ # 5. (Note that these assumptions could be violated, e.g., if
+ # $dvips is arranged not only to do the basic dvips
+ # command, but also to extract information from the ps file
+ # and feed it back to an input file for (pdf)latex.)
+ # 6. Nevertheless, the overall algorithm should allow
+ # circularities. Then the general criterion of stability
+ # of source files covers the general case, and also
+ # robustly handles the case that the USER changes source
+ # files during a run. This is particularly important in
+ # -pvc mode, given that a full make on a large document can
+ # be quite lengthy in time, and moreover that a user
+ # naturally wishes to make corrections in response to
+ # errors, particularly latex errors, and have them apply
+ # right away.
+ # This leads to the following approach:
+ # 1. Classify accessible rules as: primary, pre-primary
+ # (typically cusdep, bibtex, makeindex, etc), post-primary
+ # (typically dvips, etc), and one-time
+ # 2. Then stratify the rules into an order of application that
+ # corresponds to the basic feedforward structure, with the
+ # exclusion of one-time rules.
+ # 3. Always require that one-time rules are among the
+ # explicitly requested rules, i.e., the last to be applied,
+ # were we to apply them. Anything else would not match the
+ # idea of a one-time rule.
+ # 4. Then work as follows:
+ # a. Loop over primaries
+ # b. For each primary, examine each pre-primary rule and
+ # apply if needed, then the primary rule and then each
+ # post-primary rule. The ordering of the pre-primary
+ # and post-primary rules was found in step 2.
+ # BUT applying the ordering is not essential
+ # c. Any time that a pre-primary or primary rule is
+ # applied, loop back to the beginning of step b. This
+ # ensures that bibtex etc are applied before rerunning
+ # (pdf)latex, and also covers changing source files, and
+ # gives priority to quick pre-primary rules for changing
+ # source files against slow reruns of latex.
+ # d. Then apply post-primary rules in order, but not
+ # looping back after each rule. This non-looping back
+ # is because the rules are normally feed-forward only.
+ # BUT applying the ordering is not essential
+ # e. But after completing post-primary rules do loop back
+ # to b if any rules were applied. This covers exotic
+ # circular dependence (and as a byproduct, changing
+ # source files).
+ # f. On each case of looping back to b, re-evaluate the
+ # dependence setup to allow for the effect of changing
+ # source files.
+ #
+
+ local @requested_targets = @_;
+ local %current_primaries = (); # Hash whose keys are primary rules
+ # needed, i.e., known latex-like rules which trigger
+ # circular dependencies
+ local @pre_primary = (); # Array of rules
+ local @post_primary = (); # Array of rules
+ local @one_time = (); # Array of rules
+
+
+ # For diagnostics on changed files, etc:
+ local @changed = ();
+ local @disappeared = ();
+ local @no_dest = (); # Non-existent destination files
+ local @rules_to_apply = ();
+
+ &rdb_classify_rules( \%possible_primaries, @requested_targets );
+
+ local %pass = ();
+ local $failure = 0; # General accumulated error flag
+ local $runs = 0;
+ local $too_many_runs = 0;
+ local %rules_applied = ();
+ my $retry_msg = 0; # Did I earlier say I was going to attempt
+ # another pass after a failure?
+ PRIMARY:
+ foreach my $primary (keys %current_primaries ) {
+ foreach my $rule (keys %rule_db) {
+ $pass{$rule} = 0;
+ }
+ PASS:
+ while (1==1) {
+ $runs = 0;
+ my $previous_failure = $failure;
+ $failure = 0;
+ local $newrule_nofile = 0; # Flags whether rule created for
+ # making currently non-existent file, which
+ # could become a needed source file for a run
+ # and therefore undo an error condition
+ if ($diagnostics) {
+ print "MakeB: doing pre_primary and primary...\n";
+ }
+ rdb_for_some( [@pre_primary, $primary], \&rdb_makeB1 );
+ if ( ($runs > 0) && ! $too_many_runs ) {
+ $retry_msg = 0;
+ if ( $failure && $newrule_nofile ) {
+ $retry_msg = 1;
+ print "$My_name: Error on run, but found possibility to ",
+ "make new source files\n";
+ next PASS;
+ }
+ elsif ( ! $failure ) {
+ next PASS;
+ }
+ }
+ elsif ($runs == 0) {
+ # $failure not set on this pass, so use value from previous pass:
+ $failure = $previous_failure;
+ if ($retry_msg) {
+ print "But in fact no new files made\n";
+ }
+ }
+ if ($failure && !$force_mode ) { last PASS; }
+ if ($diagnostics) {
+ print "MakeB: doing post_primary...\n";
+ }
+ rdb_for_some( [@post_primary], \&rdb_makeB1 );
+ if ($failure) { last PASS; }
+ if ($runs > 0) { next PASS; }
+ # Get here if nothing was run.
+ last PASS;
+ }
+ continue {
+ # Re-evaluate rule classification and accessibility,
+ # but do not change primaries.
+ &rdb_classify_rules( \%current_primaries, @requested_targets );
+ &rdb_make_links;
+ }
+ }
+ rdb_for_some( [@one_time], \&rdb_makeB1 );
+ rdb_write( $fdb_file );
+
+ if (! $silent) {
+ # Diagnose of the runs
+ if ( $#{keys %rules_applied } > -1 ) {
+ print "$My_name: $runs runs. Rules applied:\n";
+ foreach (sort keys %rules_applied) {
+ print " '$_'\n";
+ }
+ }
+ elsif ($failure && $force_mode) {
+ print "$My_name: Errors, in force_mode: so I tried finishing targets\n";
+ }
+ elsif ($failure) {
+ print "$My_name: Errors, so I did not complete making targets\n";
+ }
+ else {
+ local @dests = ();
+ rdb_for_some( [@_], sub{ push @dests, $$Pdest if ($$Pdest); } );
+ print "$My_name: All targets (@dests) are up-to-date\n";
+ }
+ }
+ return $failure;
+} #END rdb_makeB
+
+#-------------------
+
+sub rdb_makeB1 {
+ # Call: rdb_makeB1
+ # Helper routine for rdb_makeB.
+ # Carries out make at level of given rule (all data available).
+ # Assumes contexts for recursion, make, and rule, and
+ # assumes that source files for the rule are to be considered
+ # up-to-date.
+ if ($diagnostics) { print " MakeB1 $rule\n"; }
+ if ($failure & ! $force_mode) {return;}
+ &rdb_clear_change_record;
+ &rdb_flag_changes_here;
+# if ($diagnostics>-1) { print " MakeB1.1 $rule $$Pout_of_date\n"; }
+
+ my $return = 0; # Return code from called routine
+#?? print "makeB1: Trying '$rule' for '$$Pdest': ";
+ if (!$$Pout_of_date) {
+#?? if ( ($$Pcmd_type eq 'primary') && (! $silent) ) {
+# print "Rule '$rule' up to date\n";
+# }
+ return;
+ }
+ if ($diagnostics) { print " remake\n"; }
+ if (!$silent) {
+ print "$My_name: applying rule '$rule'...\n";
+ &rdb_diagnose_changes( "Rule $rule: ");
+ }
+##????????????????????????????????????: variable rules_applied not used
+ $rules_applied{$rule} = 1;
+ $runs++;
+#?? print "$rule: $$Pcmd_type\n";
+
+ # We are applying the rule, so its source file state for when it
+ # was last made is as of now:
+ # ??IS IT CORRECT TO DO NOTHING IN CURRENT VERSION?
+
+ # The actual run
+ $return = 0;
+ # Rule may have been created since last run:
+ if ( ! defined $pass{$rule} ) {$pass{$rule} = 0; }
+ if ( $pass{$rule} ge $max_repeat ) {
+ # Avoid infinite loop by having a maximum repeat count
+ # Getting here represents some kind of weird error.
+ warn "$My_name: Maximum runs of $rule reached ",
+ "without getting stable files\n";
+ $too_many_runs = 1;
+ $failure = 1;
+ $failure_msg = "'$rule' needed too many passes";
+ return;
+ }
+ $pass{$rule}++;
+ warn_running( "Run number $pass{$rule} of rule '$rule'" );
+ if ($$Pcmd_type eq 'primary' ) {
+ $return = &rdb_primary_run;
+ }
+ else { $return = &rdb_run1; }
+ if ($$Pchanged) {
+ $newrule_nofile = 1;
+ $return = 0;
+ }
+ elsif ( $$Pdest && ( !-e $$Pdest ) && (! $failure) ){
+ # If there is a destination to make, but for some reason
+ # it did not get made, then make sure a failure gets reported.
+ # But if the failure has already been reported, there's no need
+ # to report here, since that would give a generic error
+ # message instead of a specific one.
+
+## ??? 1 Sep. 2008, for cusdep no-file-exists issue
+ if ( ( $$Pcmd_type eq 'cusdep') && $$Psource && (! -e $$Psource) ) {
+ # However, if the rule is a custom dependency, this is not by
+ # itself an error, if also the source file does not exist. In
+ # that case, we may have the situation that (1) the dest file is no
+ # longer needed by the tex file, and (2) therefore the user
+ # has deleted the source and dest files. After the next
+ # latex run and the consequent analysis of the log file, the
+ # cusdep rule will no longer be needed, and will be removed.
+
+ # So in this case, do NOT report an error
+ $$Pout_of_date = 0;
+ }
+ else {
+ $failure = 1;
+ $failure_msg = "'$rule' did not make '$$Pdest'";
+ }
+ }
+ if ($return != 0) {$failure = 1;}
+} #END rdb_makeB1
+
+#************************************************************
+
+sub rdb_submakeB {
+ # Call: rdb_submakeB
+ # Makes all the source files for a given rule.
+ # Assumes contexts for recursion, for make, and rule.
+ %visited = %visited_at_rule_start;
+ local $failure = 0; # Error flag
+ my @v = keys %visited;
+#?? print "---submakeB $rule. @v \n";
+ rdb_do_files( sub{ rdb_recurse_rule( $$Pfrom_rule, 0,0,0, \&rdb_makeB1 ) } );
+ return $failure;
+} #END rdb_submakeB
+
+#************************************************************
+
+
+sub rdb_classify_rules {
+ # Usage: rdb_classify_rules( \%allowed_primaries, requested targets )
+ # Assume the following variables are available (global or local):
+ # Input:
+ # @requested_targets # Set to target rules
+
+ # Output:
+ # %current_primaries # Keys are actual primaries
+ # @pre_primary # Array of rules
+ # @post_primary # Array of rules
+ # @one_time # Array of rules
+ # @pre_primary and @post_primary are in natural order of application.
+
+ local $P_allowed_primaries = shift;
+ local @requested_targets = @_;
+ local $state = 0; # Post-primary
+ local @classify_stack = ();
+
+ %current_primaries = ();
+ @pre_primary = ();
+ @post_primary = ();
+ @one_time = ();
+
+ rdb_recurseA( \@requested_targets, \&rdb_classify1, 0,0, \&rdb_classify2 );
+
+ # Reverse, as tendency is to find last rules first.
+ @pre_primary = reverse @pre_primary;
+ @post_primary = reverse @post_primary;
+
+ if ($diagnostics) {
+ print "Rule classification: \n";
+ if ($#requested_targets < 0) {
+ print " No requested rules\n";
+ }
+ else {
+ print " Requested rules:\n";
+ foreach ( @requested_targets ) { print " $_\n"; }
+ }
+ if ($#pre_primary < 0) {
+ print " No pre-primaries\n";
+ }
+ else {
+ print " Pre-primaries:\n";
+ foreach (@pre_primary) { print " $_\n"; }
+ }
+ print " Primaries:\n";
+ foreach (keys %current_primaries) { print " $_\n"; }
+ if ($#post_primary < 0) {
+ print " No post-primaries\n";
+ }
+ else {
+ print " Post-primaries:\n";
+ foreach (@post_primary) { print " $_\n"; }
+ }
+ if ($#one_time < 0) {
+ print " No one_time rules\n";
+ }
+ else {
+ print " One_time rules:\n";
+ foreach ( @one_time ) { print " $_\n"; }
+ }
+ } #end diagnostics
+} #END rdb_classify_rules
+
+#-------------------
+
+sub rdb_classify1 {
+ # Helper routine for rdb_classify_rules
+ # Applied as rule_act1 in recursion over rules
+ # Assumes rule context, and local variables from rdb_classify_rules
+# print "=========== '$rule' $depth ========== \n";
+ push @classify_stack, [$state];
+ if ( exists $possible_one_time{$rule} ) {
+ # Normally, we will have already extracted the one_time rules,
+ # and they will never be accessed here. But just in case of
+ # problems or generalizations, we will cover all possibilities:
+ if ($depth > 1) {
+ warn "ONE TIME rule not at outer level '$rule'\n";
+ }
+ push @one_time, $rule;
+ }
+ elsif ($state == 0) {
+ if ( exists ${$P_allowed_primaries}{$rule} ) {
+ $state = 1; # In primary rule
+ $current_primaries{ $rule } = 1;
+ }
+ else {
+ push @post_primary, $rule;
+ }
+ }
+ else {
+ $state = 2; # in post-primary rule
+ push @pre_primary, $rule;
+ }
+} #END rdb_classify1
+
+#-------------------
+
+sub rdb_classify2 {
+ # Helper routine for rdb_classify_rules
+ # Applied as rule_act2 in recursion over rules
+ # Assumes rule context
+ ($state) = @{ pop @classify_stack };
+} #END rdb_classify2
+
+#************************************************************
+
+
+sub rdb_run1 {
+ # Assumes contexts for: rule.
+ # Unconditionally apply the rule
+ # Returns return code from applying the rule.
+ # Otherwise: 0 on other kind of success, -1 on error.
+
+ # Source file data, by definition, correspond to the file state just before
+ # the latest run, and the run_time to the time just before the run:
+ &rdb_update_filesA;
+ $$Prun_time = time;
+ $$Pchanged = 0; # No special changes in files
+
+ # Return values for external command:
+ my $return = 0;
+
+ # Find any internal command
+ my @int_args = @$PAint_cmd;
+ my $int_cmd = shift @int_args;
+ my @int_args_for_printing = @int_args;
+ foreach (@int_args_for_printing) {
+ if ( ! defined $_ ) { $_ = 'undef'; }
+ }
+ if ($int_cmd) {
+ print "For rule '$rule', running '\&$int_cmd( @int_args_for_printing )' ...\n";
+ $return = &$int_cmd( @int_args );
+ }
+ elsif ($$Pext_cmd) {
+ $return = &rdb_ext_cmd;
+ }
+ else {
+ warn "$My_name: Either a bug OR a configuration error:\n",
+ " Need to implement the command for '$rule'\n";
+ &traceback();
+ $return = -1;
+ }
+ if ( $rule =~ /^bibtex/ ) {
+ my $retcode = &check_bibtex_log($$Pbase);
+ if ($retcode == 3) {
+ push @warnings,
+ "Could not open bibtex log file for '$$Pbase'";
+ }
+ elsif ($retcode == 2) {
+ push @warnings, "Bibtex errors for '$$Pbase'";
+ }
+ elsif ($retcode == 1) {
+ push @warnings, "Bibtex warnings for '$$Pbase'";
+ }
+ }
+
+ $updated = 1;
+ if ($$Ptest_kind == 3) {
+ # We are time-criterion first time only. Now switch to
+ # file-change criterion
+ $$Ptest_kind = 1;
+ }
+ $$Pout_of_date = $$Pout_of_date_user = 0;
+ return $return;
+} # END rdb_run1
+
+#-----------------
+
+sub rdb_ext_cmd {
+ # Call: rdb_ext_cmd
+ # Assumes rule context. Runs external command with substitutions.
+ # Uses defaults for the substitutions. See rdb_ext_cmd1.
+ return rdb_ext_cmd1();
+} #END rdb_ext_cmd
+
+#-----------------
+
+sub rdb_ext_cmd1 {
+ # Call: rdb_ext_cmd1( options, source, dest, base ) or rdb_ext_cmd1() or ...
+ # Assumes rule context. Returns command with substitutions.
+ # Null arguments or unprovided arguments => use defaults.
+ # for %S=source, %D=dest, %B=base, %R=root=base for latex, %O='', %T=texfile
+ my ($options, $source, $dest, $base ) = @_;
+ # Apply defaults
+ $options ||= '';
+ $source ||= $$Psource;
+ $dest ||= $$Pdest;
+ $base ||= $$Pbase;
+
+ my $ext_cmd = $$Pext_cmd;
+
+ #Set character to surround filenames:
+ my $q = $quote_filenames ? '"' : '';
+ foreach ($ext_cmd) {
+ s/%O/$options/g;
+ s/%R/$q$root_filename$q/g;
+ s/%B/$q$base$q/g;
+ s/%T/$q$texfile_name$q/g;
+ s/%S/$q$source$q/g;
+ s/%D/$q$dest$q/g;
+ }
+ # print "quote is '$q'; ext_cmd = '$ext_cmd'\n";
+ my ($pid, $return) = &Run_msg($ext_cmd);
+ return $return;
+} #END rdb_ext_cmd1
+
+#-----------------
+
+sub rdb_primary_run {
+#?? See multipass_run in previous version Aug 2007 for issues
+ # Call: rdb_primary_run
+ # Assumes contexts for: recursion, make, & rule.
+ # Assumes (a) the rule is a primary,
+ # (b) a run has to be made,
+ # (c) source files have been made.
+ # This routine carries out the run of the rule unconditionally,
+ # and then parses log file etc.
+ my $return = 0;
+
+ my $return_latex = &rdb_run1;
+
+ ######### Analyze results of run:
+ if ( ! -e "$root_filename.log" ) {
+ $failure = 1;
+ $failure_msg = "(Pdf)LaTeX failed to generate a log file";
+ return -1;
+ }
+ ####### NOT ANY MORE! Capture any changes in source file status before we
+ # check for errors in the latex run
+
+ # Find current set of source files:
+ &rdb_set_from_logB;
+
+ # For each file of the kind made by epstopdf.sty during a run,
+ # if the file has changed during a run, then the new version of
+ # the file will have been read during the run. Unlike the usual
+ # case, we will need to redo the primary run because of the
+ # change of this file during the run. Therefore set the file as
+ # up-to-date:
+ rdb_do_files( sub { if ($$Pcorrect_after_primary) {&rdb_update1;} } );
+
+ # There may be new source files, and the run may have caused
+ # circular-dependency files to be changed. And the regular
+ # source files may have been updated during a lengthy run of
+ # latex. So redo the makes for sources of the current rule:
+ my $submake_return = &rdb_submakeB;
+ &rdb_clear_change_record;
+ &rdb_flag_changes_here;
+ $updated = 1; # Flag that some dependent file has been remade
+ # Fix the state of the files as of now: this will solve the
+ # problem of latex and pdflatex interfering with each other,
+ # at the expense of some non-optimality
+ #?? Check this is correct:
+ &rdb_update_filesA;
+ if ( $diagnostics ) {
+ print "$My_name: Rules after run: \n";
+ rdb_show();
+ }
+
+ $return = $return_latex;
+ if ($return_latex && $$Pout_of_date_user) {
+ print "Error in (pdf)LaTeX, but change of user file(s), ",
+ "so ignore error & provoke rerun\n"
+ if (! $silent);
+ $return = 0;
+ }
+
+ # Summarize issues that may have escaped notice:
+ my @warnings = ();
+ if ($bad_reference) {
+ push @warnings, "Latex could not resolve all references";
+ }
+ if ($bad_citation) {
+ push @warnings, "Latex could not resolve all citations";
+ }
+ if ($#warnings > 0) {
+ show_array( "$My_name: Summary of warnings:", @warnings );
+ }
+ return $return;
+} #END rdb_primary_run
+
+#************************************************************
+
+sub rdb_clear_change_record {
+ @changed = ();
+ @disappeared = ();
+ @no_dest = ();
+ @rules_to_apply = ();
+#??????????????? $failure = 0;
+##????????????????????????????????????: variable rules_applied not used
+ $rules_applied = 0;
+} #END rdb_clear_change_record
+
+#************************************************************
+
+sub rdb_flag_changes_here {
+ # Flag changes in current rule.
+ # Assumes rule context.
+ local $dest_mtime = 0;
+ $dest_mtime = get_mtime($$Pdest) if ($$Pdest);
+ rdb_do_files( \&rdb_file_change1);
+ if ( $$Pdest && (! -e $$Pdest) ) {
+## ??? 1 Sep. 2008, for cusdep no-file-exists issue
+ if ( ( $$Pcmd_type eq 'cusdep') && $$Psource && (! -e $$Psource) ) {
+ # However, if the rule is a custom dependency, this is not by
+ # itself an error, if also the source file does not exist. In
+ # that case, we may have the situation that (1) the dest file is no
+ # longer needed by the tex file, and (2) therefore the user
+ # has deleted the source and dest files. After the next
+ # latex run and the consequent analysis of the log file, the
+ # cusdep rule will no longer be needed, and will be removed.
+
+ # So in this case, do NOT report an error
+ }
+ else {
+ $$Pout_of_date = 1;
+ push @no_dest, $$Pdest;
+ }
+ }
+ if ($$Pout_of_date) {
+ push @rules_to_apply, $rule;
+ }
+#?? print "======== flag: $rule $$Pout_of_date ==========\n";
+} #END rdb_flag_changes_here
+
+#************************************************************
+
+sub rdb_file_change1 {
+ # Call: &rdb_file_change1
+ # Assumes rule and file context. Assumes $dest_mtime set.
+ # Flag whether $file in $rule has changed or disappeared.
+ # Set rule's make flag if there's a change.
+ my ($new_time, $new_size, $new_md5) = fdb_get($file);
+#?? print "FC1 '$rule':$file $$Pout_of_date TK=$$Ptest_kind\n";
+#?? print " OLD $$Ptime, $$Psize, $$Pmd5\n",
+#?? " New $new_time, $new_size, $new_md5\n";
+ my $ext = ext( $file );
+ if ( ($new_size < 0) && ($$Psize >= 0) ) {
+ print "Disappeared '$file' in '$rule'\n";
+ push @disappeared, $file;
+ # No reaction is good.
+ #$$Pout_of_date = 1;
+ # ??? 1 Sep. 2008: I do NOT think so, for cusdep no-file-exists issue
+ $$Pout_of_date = 1;
+ return;
+ }
+ if ( ($new_size < 0) && ($$Psize < 0) ) {
+ return;
+ }
+ if ( ($new_size != $$Psize) || ($new_md5 ne $$Pmd5) ) {
+#?? print "FC1: changed $file: ($new_size != $$Psize) $new_md5 ne $$Pmd5)\n";
+ push @changed, $file;
+ $$Pout_of_date = 1;
+ if ( ! exists $generated_exts_all{$ext} ) {
+ $$Pout_of_date_user = 1;
+ }
+ }
+ if ( ( ($$Ptest_kind == 2) || ($$Ptest_kind == 3) )
+ && (! exists $generated_exts_all{$ext} )
+ && ( $new_time > $dest_mtime )
+ ) {
+#?? print "FC1: changed $file: ($new_time > $dest_mtime)\n";
+ push @changed, $file;
+ $$Pout_of_date = $$Pout_of_date_user = 1;
+ }
+} #END rdb_file_change1
+
+#************************************************************
+
+sub rdb_count_changes {
+ return $#changed + $#disappeared + $#no_dest + $#rules_to_apply + 4;
+} #END rdb_count_changes
+
+#************************************************************
+
+sub rdb_diagnose_changes {
+ # Call: rdb_diagnose_changes or rdb_diagnose_changes( heading )
+ # List changes on STDERR
+ # Precede the message by the optional heading, else by "$My_name: "
+ my $heading = defined($_[0]) ? $_[0] : "$My_name: ";
+
+ if ( &rdb_count_changes == 0 ) {
+ warn "${heading}No changes\n";
+ return;
+ }
+ warn "${heading}Changes:\n";
+ if ( $#changed >= 0 ) {
+ warn " Changed files, or newly in use since previous run(s):\n";
+ foreach (uniqs(@changed)) { warn " '$_'\n"; }
+ }
+ if ( $#disappeared >= 0 ) {
+ warn " No-longer-existing files:\n";
+ foreach (uniqs(@disappeared)) { warn " '$_'\n"; }
+ }
+ if ( $#no_dest >= 0 ) {
+ warn " Non-existent destination files:\n";
+ foreach (uniqs(@no_dest)) { warn " '$_'\n"; }
+ }
+ if ( $#rules_to_apply >= 0 ) {
+ warn " Rules to apply:\n";
+ foreach (uniqs(@rules_to_apply)) { warn " '$_'\n"; }
+ }
+} #END rdb_diagnose_changes
+
+
+#************************************************************
+#************************************************************
+#************************************************************
+#************************************************************
+
+#************************************************************
+#************************************************************
+#************************************************************
+#************************************************************
+
+# Routines for convenient looping and recursion through rule database
+# ================= NEW VERSION ================
+
+# There are several places where we need to loop through or recurse
+# through rules and files. This tends to involve repeated, tedious
+# and error-prone coding of much book-keeping detail. In particular,
+# working on files and rules needs access to the variables involved,
+# which either involves direct access to the elements of the database,
+# and consequent fragility against changes and upgrades in the
+# database structure, or involves lots of routines for reading and
+# writing data in the database, then with lots of repetitious
+# house-keeping code.
+#
+# The routines below provide a solution. Looping and recursion
+# through the database are provided by a set of basic routines where
+# each necessary kind of looping and iteration is coded once. The
+# actual actions are provided as references to action subroutines.
+# (These can be either actual references, as in \&routine, or
+# anonymous subroutines, as in sub{...}, or aas a zero value 0 or an
+# omitted argument, to indicate that no action is to be performed.)
+#
+# When the action subroutine(s) are actually called, a context for the
+# rule and/or file (as appropriate) is given by setting named
+## NEW ??
+# variables to REFERENCES to the relevant data values. These can be
+# used to retrieve and set the data values. As a convention,
+# references to scalars are given by variables named start with "$P",
+# as in "$Pdest", while references to arrays start with "$PA", as in
+# "$PAint_cmd", and references to hashes with "$PH", as in "$PHsource".
+# After the action subroutine has finished, checks for data
+# consistency may be made.
+## ??? OLD
+# variables to the relevant data values. After the action subroutine
+# has finished, the database is updated with the values of these named
+# variables, with any necessary consistency checks. Thus the action
+# subroutines can act on sensibly named variables without needed to
+# know the database structure.
+#
+# The only routines that actually use the database structure and need
+# to be changed if that is changed are: (a) the routines rdb_one_rule
+# and rdb_one_file that implement the calling of the action subroutines,
+# (b) routines for creation of single rules and file items, and (c) to
+# a lesser extent, the routine for destroying a file item.
+#
+# Note that no routine is provided for destroying a rule. During a
+# run, a rule, with its source files, may become inaccessible or
+# unused. This happens dynamically, depending on the dependencies
+# caused by changes in the source file or by error conditions that
+# cause the computation of dependencies, particular of latex files, to
+# become wrong. In that situation the files certainly come and go in
+# the database, but subsidiary rules, with their content information
+# on their source files, need to be retained so that their use can be
+# reinstated later depending on dynamic changes in other files.
+#
+# However, there is a potential memory leak unless some pruning is
+# done in what is written to the fdb file. (Probably only accessible
+# rules and those for which source files exist. Other cases have no
+# relevant information that needs to be preserved between runs.)
+
+#
+#
+
+
+#************************************************************
+
+# First the top level routines for recursion and iteration
+
+#************************************************************
+
+sub rdb_recurseA {
+ # Call: rdb_recurseA( rule | [ rules],
+ # \&rule_act1, \&file_act1, \&file_act2,
+ # \&rule_act2 )
+ # The actions are pointers to subroutines, and may be null (0, or
+ # undefined) to indicate no action to be applied.
+ # Recursively acts on the given rules and all ancestors:
+ # foreach rule found:
+ # apply rule_act1
+ # loop through its files:
+ # apply file_act1
+ # act on its ancestor rule, if any
+ # apply file_act2
+ # apply rule_act2
+ # Guards against loops.
+ # Access to the rule and file data by local variables, only
+ # for getting and setting.
+
+ # This routine sets a context for anything recursive, with @heads,
+ # %visited and $depth being set as local variables.
+ local @heads = ();
+ my $rules = shift;
+
+ # Distinguish between single rule (a string) and a reference to an
+ # array of rules:
+ if ( ref $rules eq 'ARRAY' ) { @heads = @$rules; }
+ else { @heads = ( $rules ); }
+
+ # Keep a list of visited rules, used to block loops in recursion:
+ local %visited = ();
+ local $depth = 0;
+
+ foreach $rule ( @heads ) { rdb_recurse_rule( $rule, @_ ); }
+
+} #END rdb_recurseA
+
+#************************************************************
+
+sub rdb_for_all {
+ # Call: rdb_for_all( \&rule_act1, \&file_act, \&rule_act2 )
+ # Loops through all rules and their source files, using the
+ # specified set of actions, which are pointers to subroutines.
+ # Sorts rules alphabetically.
+ # See rdb_for_some for details.
+ rdb_for_some( [ sort keys %rule_db ], @_);
+} #END rdb_for_all
+
+#************************************************************
+
+sub rdb_for_some {
+ # Call: rdb_for_some( rule | [ rules],
+ # \&rule_act1, \&file_act, \&rule_act2)
+ # Actions can be zero, and rules at tail of argument list can be
+ # omitted. E.g. rdb_for_some( rule, 0, \&file_act ).
+ # Anonymous subroutines can be used, e.g., rdb_for_some( rule, sub{...} ).
+ #
+ # Loops through rules and their source files, using the
+ # specified set of rules:
+ # foreach rule:
+ # apply rule_act1
+ # loop through its files:
+ # apply file_act
+ # apply rule_act2
+ #
+ # Rule data and file data are made available in local variables
+ # for access by the subroutines.
+
+ local @heads = ();
+ my $rules = shift;
+ # Distinguish between single rule (a string) and a reference to an
+ # array of rules:
+ if ( ref $rules eq 'ARRAY' ) { @heads = @$rules; }
+ else { @heads = ( $rules ); }
+
+ foreach $rule ( @heads ) {
+ # $rule is implicitly local
+ &rdb_one_rule( $rule, @_ );
+ }
+} #END rdb_for_some
+
+#************************************************************
+
+sub rdb_for_one_file {
+ my $rule = shift;
+ # Avoid name collisions with general recursion and iteraction routines:
+ local $file1 = shift;
+ local $action1 = shift;
+ rdb_for_some( $rule, sub{rdb_one_file($file1,$action1)} );
+} #END rdb_for_one_file
+
+
+#************************************************************
+
+# Routines for inner part of recursion and iterations
+
+#************************************************************
+
+sub rdb_recurse_rule {
+ # Call: rdb_recurse_rule($rule, \&rule_act1, \&file_act1, \&file_act2,
+ # \&rule_act2 )
+ # to do the work for one rule, recurisvely called from_rules for
+ # the sources of the rules.
+ # Assumes recursion context, i.e. that %visited, @heads, $depth.
+ # We are overriding actions:
+ my ($rule, $rule_act1, $new_file_act1, $new_file_act2, $rule_act2)
+ = @_;
+ # and must propagate the file actions:
+ local $file_act1 = $new_file_act1;
+ local $file_act2 = $new_file_act2;
+ # Prevent loops:
+ if ( (! $rule) || exists $visited{$rule} ) { return; }
+ $visited{$rule} = 1;
+ # Recursion depth
+ $depth++;
+ # We may need to repeat actions on dependent rules, without being
+ # blocked by the test on visited files. So save %visited:
+ local %visited_at_rule_start = %visited;
+ # At end, the last value set for %visited wins.
+ rdb_one_rule( $rule, $rule_act1, \&rdb_recurse_file, $rule_act2 );
+ $depth--;
+ } #END rdb_recurse_rule
+
+#************************************************************
+
+sub rdb_recurse_file {
+ # Call: rdb_recurse_file to do the work for one file.
+ # This has no arguments, since it is used as an action subroutine,
+ # passed as a reference in calls in higher-level subroutine.
+ # Assumes contexts set for: Recursion, rule, and file
+ &$file_act1 if $file_act1;
+ rdb_recurse_rule( $$Pfrom_rule, $rule_act1, $file_act1, $file_act2,
+ $rule_act2 )
+ if $$Pfrom_rule;
+ &$file_act2 if $file_act2;
+} #END rdb_recurse_file
+
+#************************************************************
+
+sub rdb_do_files {
+ # Assumes rule context, including $PHsource.
+ # Applies an action to all the source files of the rule.
+ local $file_act = shift;
+ my @file_list = sort keys %$PHsource;
+ foreach my $file ( @file_list ){
+ rdb_one_file( $file, $file_act );
+ }
+} #END rdb_do_files
+
+#************************************************************
+
+# Routines for action on one rule and one file. These are the main
+# places (in addition to creation and destruction routines for rules
+# and files) where the database structure is accessed.
+
+#************************************************************
+
+sub rdb_one_rule {
+ # Call: rdb_one_rule( $rule, $rule_act1, $file_act, $rule_act2 )
+ # Sets context for rule and carries out the actions.
+#===== Accesses rule part of database structure =======
+
+ local ( $rule, $rule_act1, $file_act, $rule_act2 ) = @_;
+#?? &R1;
+ if ( (! $rule) || ! rdb_rule_exists($rule) ) { return; }
+
+ local ( $PArule_data, $PHsource ) = @{$rule_db{$rule}};
+ local ($Pcmd_type, $Pext_cmd, $PAint_cmd, $Ptest_kind,
+ $Psource, $Pdest, $Pbase,
+ $Pout_of_date, $Pout_of_date_user, $Prun_time, $Pchanged )
+ = Parray( $PArule_data );
+ # Correct array ref:
+ $PAint_cmd = $$PArule_data[2];
+
+ &$rule_act1 if $rule_act1;
+ &rdb_do_files( $file_act ) if $file_act;
+ &$rule_act2 if $rule_act2;
+
+#?? &R2;
+} #END rdb_one_rule
+
+#************************************************************
+
+sub rdb_one_file {
+ # Call: rdb_one_file($file, $file_act)
+ # Sets context for file and carries out the action.
+ # Assumes $rule context set.
+#===== Accesses file part of database structure =======
+ local ($file, $file_act) = @_;
+#?? &F1;
+ if ( (!$file) ||(!exists ${$PHsource}{$file}) ) { return; }
+ local $PAfile_data = ${$PHsource}{$file};
+ local ($Ptime, $Psize, $Pmd5, $Pfrom_rule, $Pcorrect_after_primary )
+ = Parray( $PAfile_data );
+ &$file_act if $file_act;
+ if ( ! rdb_rule_exists( $$Pfrom_rule ) ) {
+ $$Pfrom_rule = '';
+ }
+#?? &F2;
+} #END rdb_one_file
+
+#************************************************************
+
+# Routines for creation of rules and file items, and for removing file
+# items.
+
+#************************************************************
+
+sub rdb_create_rule {
+ # rdb_create_rule( rule, command_type, ext_cmd, int_cmd, test_kind,
+ # source, dest, base,
+ # needs_making, run_time )
+ # int_cmd is either a string naming a perl subroutine or it is a
+ # reference to an array containing the subroutine name and its
+ # arguments.
+ # Makes rule. Error if it already exists.
+ # Omitted arguments: replaced by 0 or '' as needed.
+# ==== Sets rule data ====
+ my ( $rule, $cmd_type, $int_cmd, $PAext_cmd, $test_kind,
+ $source, $dest, $base,
+ $needs_making, $run_time ) = @_;
+ my $changed = 0;
+ # Set defaults, and normalize parameters:
+ foreach ( $cmd_type, $int_cmd, $PAext_cmd, $source, $dest, $base ) {
+ if (! defined $_) { $_ = ''; }
+ }
+ foreach ( $needs_making, $run_time, $test_kind ) {
+ if (! defined $_) { $_ = 0; }
+ }
+ if (!defined $test_kind) {
+ # Default to test on file change
+ $test_kind = 1;
+ }
+ if ( ref( $PAext_cmd ) eq '' ) {
+ # It is a single command. Convert to array reference:
+ $PAext_cmd = [ $PAext_cmd ];
+ }
+ else {
+ # COPY the referenced array:
+ $PAext_cmd = [ @$PAext_cmd ];
+ }
+
+ $rule_db{$rule} =
+ [ [$cmd_type, $int_cmd, $PAext_cmd, $test_kind,
+ $source, $dest, $base, $needs_making, 0, $run_time,
+ $changed ],
+ {}
+ ];
+ if ($source) { rdb_ensure_file( $rule, $source ); }
+} #END rdb_create_rule
+
+#************************************************************
+
+sub rdb_ensure_file {
+ # rdb_ensure_file( rule, file[, fromrule] )
+ # Ensures the source file item exists in the given rule.
+ # Initialize to current file state if the item is created.
+ # Then if the fromrule is specified, set it for the file item.
+#============ rule and file data set here ======================================
+ my $rule = shift;
+ local ( $new_file, $new_from_rule ) = @_;
+ if ( ! rdb_rule_exists( $rule ) ) {
+ die_trace( "$My_name: BUG in rdb_ensure_file: non-existent rule '$rule'" );
+ }
+ if ( ! defined $new_file ) {
+ die_trace( "$My_name: BUG in rdb_ensure_file: undefined file for '$rule'" );
+ }
+ rdb_one_rule( $rule,
+ sub{
+ if (! exists ${$PHsource}{$new_file} ) {
+ ${$PHsource}{$new_file} = [fdb_get($new_file), '', 0];
+ }
+ }
+ );
+ if (defined $new_from_rule ) {
+ rdb_for_one_file( $rule, $new_file, sub{ $$Pfrom_rule = $new_from_rule; });
+ }
+} #END rdb_ensure_file
+
+#************************************************************
+
+sub rdb_remove_files {
+ # rdb_remove_file( rule, file,... )
+ # Removes file(s) for the rule.
+ my $rule = shift;
+ if (!$rule) { return; }
+ local @files = @_;
+ rdb_one_rule( $rule,
+ sub{ foreach (@files) { delete ${$PHsource}{$_}; } }
+ );
+} #END rdb_remove_files
+
+#************************************************************
+
+sub rdb_rule_exists {
+ # Call rdb_rule_exists($rule): Returns whether rule exists.
+ my $rule = shift;
+ if (! $rule ) { return 0; }
+ return exists $rule_db{$rule};
+} #END rdb_rule_exists
+
+#************************************************************
+
+sub rdb_file_exists {
+ # Call rdb_file_exists($rule, $file):
+ # Returns whether source file item in rule exists.
+ local ( $rule, $file ) = @_;
+ local $exists = 0;
+ rdb_one_rule( $rule,
+ sub{ $exists = exists( ${$PHsource}{$file} ) ? 1:0; }
+ );
+ return $exists;
+} #END rdb_file_exists
+
+#************************************************************
+
+sub rdb_update_gen_files {
+ # Call: fdb_updateA
+ # Assumes rule context. Update source files of rule to current state.
+ rdb_do_files(
+ sub{
+ if ( exists $generated_exts_all{ ext($file) } ) {&rdb_update1;}
+ }
+ );
+} #END rdb_update_gen_files
+
+#************************************************************
+
+sub rdb_update_filesA {
+ # Call: fdb_updateA
+ # Assumes rule context. Update source files of rule to current state.
+ rdb_do_files( \&rdb_update1 );
+}
+
+#************************************************************
+
+sub rdb_update1 {
+ # Call: fdb_update1.
+ # Assumes file context. Updates file data to correspond to
+ # current file state on disk
+ ($$Ptime, $$Psize, $$Pmd5) = fdb_get($file);
+}
+
+#************************************************************
+
+sub rdb_set_file1 {
+ # Call: fdb_file1(rule, file, new_time, new_size, new_md5)
+ # Sets file time, size and md5.
+ my $rule = shift;
+ my $file = shift;
+ local @new_file_data = @_;
+ rdb_for_one_file( $rule, $file, sub{ ($$Ptime,$$Psize,$$Pmd5)=@new_file_data; } );
+}
+
+#************************************************************
+
+sub rdb_dummy_file {
+ # Returns file data for non-existent file
+# ==== Uses rule_db structure ====
+ return (0, -1, 0, '');
+}
+
+#************************************************************
+#************************************************************
+
+# Predefined subroutines for custom dependency
+
+sub cus_dep_delete_dest {
+ # This subroutine is used for situations like epstopdf.sty, when
+ # the destination (target) of the custom dependency invoking
+ # this subroutine will be made by the primary run provided the
+ # file (destination of the custom dependency, source of the
+ # primary run) doesn't exist.
+ # It is assumed that the resulting file will be read by the
+ # primary run.
+
+ # Remove the destination file, to indicate it needs to be remade:
+ unlink $$Pdest;
+ # Arrange that the non-existent destination file is not treated as
+ # an error. The variable changed here is a bit misnamed.
+ $$Pchanged = 1;
+ # Ensure a primary run is done
+ &cus_dep_require_primary_run;
+ # Return success:
+ return 0;
+}
+
+#************************************************************
+
+sub cus_dep_require_primary_run {
+ # This subroutine is used for situations like epstopdf.sty, when
+ # the destination (target) of the custom dependency invoking
+ # this subroutine will be made by the primary run provided the
+ # file (destination of the custom dependency, source of the
+ # primary run) doesn't exist.
+ # It is assumed that the resulting file will be read by the
+ # primary run.
+
+ local $cus_dep_target = $$Pdest;
+ # Loop over all rules and source files:
+ rdb_for_all( 0,
+ sub { if ($file eq $cus_dep_target) {
+ $$Pout_of_date = 1;
+ $$Pcorrect_after_primary = 1;
+ }
+ }
+ );
+ # Return success:
+ return 0;
+}
+
+
+#************************************************************
+#************************************************************
+#************************************************************
+#
+# UTILITIES:
+#
+
+#************************************************************
+# Miscellaneous
+
+sub show_array {
+# For use in diagnostics and debugging.
+# On stderr, print line with $_[0] = label.
+# Then print rest of @_, one item per line preceeded by some space
+ warn "$_[0]\n";
+ shift;
+ foreach (@_){ warn " $_\n";}
+}
+
+#************************************************************
+
+sub Parray {
+ # Call: Parray( \@A )
+ # Returns array of references to the elements of @A
+ my $PA = shift;
+ my @P = (undef) x (1+$#$PA);
+ foreach my $i (0..$#$PA) { $P[$i] = \$$PA[$i]; }
+ return @P;
+}
+
+#************************************************************
+
+sub glob_list {
+ # Glob a collection of filenames. Sort and eliminate duplicates
+ # Usage: e.g., @globbed = glob_list(string, ...);
+ my @globbed = ();
+ foreach (@_) {
+ push @globbed, glob;
+ }
+ return uniqs( @globbed );
+}
+
+#==================================================
+
+sub glob_list1 {
+ # Glob a collection of filenames.
+ # But no sorting or elimination of duplicates
+ # Usage: e.g., @globbed = glob_list1(string, ...);
+ # Since perl's glob appears to use space as separator, I'll do a special check
+ # for existence of non-globbed file (assumed to be tex like)
+
+ my @globbed = ();
+ foreach my $file_spec (@_) {
+ # Problem, when the PATTERN contains spaces, the space(s) are
+ # treated as pattern separaters (in MSWin at least).
+ # MSWin: I can quote the pattern (is that MSWin native, or also
+ # cygwin?)
+ # Linux: Quotes in a pattern are treated as part of the filename!
+ # So quoting a pattern is definitively wrong.
+ # The following hack solves this partly, for the cases that there is no wildcarding
+ # and the specified file exists possibly space-containing, and that there is wildcarding,
+ # but spaces are prohibited.
+ if ( -e $file_spec || -e "$file_spec.tex" ) {
+ # Non-globbed file exists, return the file_spec.
+ # Return $file_spec only because this is not a file-finding subroutine, but
+ # only a globber
+ push @globbed, $file_spec;
+ }
+ else {
+ # This glob fails to work as desired, if the pattern contains spaces.
+ push @globbed, glob( "$file_spec" );
+ }
+ }
+ return @globbed;
+}
+
+#************************************************************
+# Miscellaneous
+
+sub prefix {
+ #Usage: prefix( string, prefix );
+ #Return string with prefix inserted at the front of each line
+ my @line = split( /\n/, $_[0] );
+ my $prefix = $_[1];
+ for (my $i = 0; $i <= $#line; $i++ ) {
+ $line[$i] = $prefix.$line[$i]."\n";
+ }
+ return join( "", @line );
+}
+
+
+#************************************************************
+#************************************************************
+# File handling utilities:
+
+
+#************************************************************
+
+sub get_latest_mtime
+# - arguments: each is a filename.
+# - returns most recent modify time.
+{
+ my $return_mtime = 0;
+ foreach my $include (@_)
+ {
+ my $include_mtime = &get_mtime($include);
+ # The file $include may not exist. If so ignore it, otherwise
+ # we'll get an undefined variable warning.
+ if ( ($include_mtime) && ($include_mtime > $return_mtime) )
+ {
+ $return_mtime = $include_mtime;
+ }
+ }
+ return $return_mtime;
+}
+
+#************************************************************
+
+sub get_mtime_raw
+{
+ my $mtime = (stat($_[0]))[9];
+ return $mtime;
+}
+
+#************************************************************
+
+sub get_mtime {
+ return get_mtime0($_[0]);
+}
+
+#************************************************************
+
+sub get_mtime0 {
+ # Return time of file named in argument
+ # If file does not exist, return 0;
+ if ( -e $_[0] ) {
+ return get_mtime_raw($_[0]);
+ }
+ else {
+ return 0;
+ }
+}
+
+#************************************************************
+
+sub get_size {
+ # Return time of file named in argument
+ # If file does not exist, return 0;
+ if ( -e $_[0] ) {
+ return get_size_raw($_[0]);
+ }
+ else {
+ return 0;
+ }
+}
+
+#************************************************************
+
+sub get_size_raw
+{
+ my $size = (stat($_[0]))[7];
+ return $size;
+}
+
+#************************************************************
+
+sub get_time_size {
+ # Return time and size of file named in argument
+ # If file does not exist, return (0,-1);
+ if ( -e $_[0] ) {
+ return get_time_size_raw($_[0]);
+ }
+ else {
+ return (0,-1);
+ }
+}
+
+#************************************************************
+
+sub get_time_size_raw
+{
+ my $mtime = (stat($_[0]))[9];
+ my $size = (stat($_[0]))[7];
+ return ($mtime, $size);
+}
+
+#************************************************************
+
+sub get_checksum_md5 {
+ my $source = shift;
+ my $input = new FileHandle;
+ my $md5 = Digest->MD5;
+ my $ignore_pattern = '';
+
+ if ( $source eq "" ) {
+ # STDIN:
+ open( $input, '-' );
+ }
+ else {
+ open( $input, '<', $source )
+ or return 0;
+ my ($base, $path, $ext) = fileparseA( $source );
+ $ext =~ s/^\.//;
+ if ( exists $hash_calc_ignore_pattern{$ext} ) {
+ $ignore_pattern = $hash_calc_ignore_pattern{$ext};
+ }
+ }
+
+ if ( $ignore_pattern ) {
+ while (<$input>) {
+ if ( /$ignore_pattern/ ){
+ $_= '';
+ }
+ $md5->add($_);
+ }
+ }
+ else {
+ $md5->addfile($input);
+ }
+ close $input;
+ return $md5->hexdigest();
+}
+
+#************************************************************
+
+#?? OBSOLETE
+# Find file with default extension
+# Usage: find_file_ext( name, default_ext, ref_to_array_search_path)
+sub find_file_ext
+#?? Need to use kpsewhich, if possible. Leave to find_file?
+{
+ my $full_filename = shift;
+ my $ext = shift;
+ my $ref_search_path = shift;
+ my $full_filename1 = &find_file($full_filename, $ref_search_path, '1');
+#print "Finding \"$full_filename\" with ext \"$ext\" ... ";
+ if (( $full_filename1 eq '' ) || ( ! -e $full_filename1 ))
+ {
+ my $full_filename2 =
+ &find_file("$full_filename.$ext",$ref_search_path,'1');
+ if (( $full_filename2 ne '' ) && ( -e $full_filename2 ))
+ {
+ $full_filename = $full_filename2;
+ }
+ else
+ {
+ $full_filename = $full_filename1;
+ }
+ }
+ else
+ {
+ $full_filename = $full_filename1;
+ }
+#print "Found \"$full_filename\".\n";
+ return $full_filename;
+}
+
+#************************************************************
+#?? OBSOLETE
+# given filename and path, return full name of file, or die if none found.
+# when force_include_mode=1, only warn if an include file was not
+# found, and return 0 (PvdS).
+# Usage: find_file(name, ref_to_array_search_path, warn_on_continue)
+sub find_file
+#?? Need to use kpsewhich, if possible
+{
+ my $name = $_[0];
+ my $ref_path = $_[1];
+ my $dir;
+ if ( $name =~ /^\// )
+ {
+ #Aboslute pathname (by UNIX standards)
+ if ( (!-e $name) && ( $_[2] eq '' ) ) {
+ if ($force_include_mode) {
+ warn "$My_name: Could not find file [$name]\n";
+ }
+ else {
+ die "$My_name: Could not find file [$name]\n";
+ }
+ }
+ return $name;
+ }
+ # Relative pathname
+ foreach $dir ( @{$ref_path} )
+ {
+#warn "\"$dir\", \"$name\"\n";
+ if (-e "$dir/$name")
+ {
+ return("$dir/$name");
+ }
+ }
+ if ($force_include_mode)
+ {
+ if ( $_[2] eq '' )
+ {
+ warn "$My_name: Could not find file [$name] in path [@{$ref_path}]\n";
+ warn " assuming in current directory (./$name)\n";
+ }
+ return("./$name");
+ }
+ else
+ {
+ if ( $_[2] ne '' )
+ {
+ return('');
+ }
+# warn "\"$name\", \"$ref_path\", \"$dir\"\n";
+ die "$My_name: Could not find file [$name] in path [@{$ref_path}]\n";
+ }
+}
+
+#************************************************************
+
+sub find_file1 {
+#?? Need to use kpsewhich, if possible
+
+ # Usage: find_file1(name, ref_to_array_search_path)
+ # Modified find_file, which doesn't die.
+ # Given filename and path, return array of:
+ # full name
+ # retcode
+ # On success: full_name = full name with path, retcode = 0
+ # On failure: full_name = given name, retcode = 1
+
+ my $name = $_[0];
+ # Make local copy of path, since we may rewrite it!
+ my @path = @{$_[1]};
+ if ( $name =~ /^\// ) {
+ # Absolute path (if under UNIX)
+ # This needs fixing, in general
+ if (-e $name) { return( $name, 0 );}
+ else { return( $name, 1 );}
+ }
+ foreach my $dir ( @path ) {
+ #??print "-------------dir='$dir', ";
+ # Make $dir concatenatable, and empty for current dir:
+ if ( $dir eq '.' ) {
+ $dir = '';
+ }
+ elsif ( $dir =~ /[\/\\:]$/ ) {
+ #OK if dir ends in / or \ or :
+ }
+ elsif ( $dir ne '' ) {
+ #Append directory separator only to non-empty dir
+ $dir = "$dir/";
+ }
+ #?? print " newdir='$dir'\n";
+ if (-e "$dir$name") {
+ return("$dir$name", 0);
+ }
+ }
+ my @kpse_result = kpsewhich( $name );
+ if ($#kpse_result > -1) {
+ return( $kpse_result[0], 0);
+ }
+ return("$name" , 1);
+} #END find_file1
+
+#************************************************************
+
+sub find_file_list1 {
+ # Modified version of find_file_list that doesn't die.
+ # Given output and input arrays of filenames, a file suffix, and a path,
+ # fill the output array with full filenames
+ # Return a status code:
+ # Retcode = 0 on success
+ # Retocde = 1 if at least one file was not found
+ # Usage: find_file_list1( ref_to_output_file_array,
+ # ref_to_input_file_array,
+ # suffix,
+ # ref_to_array_search_path
+ # )
+
+ my $ref_output = $_[0];
+ my $ref_input = $_[1];
+ my $suffix = $_[2];
+ my $ref_search = $_[3];
+
+#?? show_array( "=====find_file_list1. Suffix: '$suffix'\n Source:", @$ref_input );
+#?? show_array( " Bibinputs:", @$ref_search );
+
+ my @return_list = (); # Generate list in local array, since input
+ # and output arrays may be same
+ my $retcode = 0;
+ foreach my $file (@$ref_input) {
+ my ($tmp_file, $find_retcode) = &find_file1( "$file$suffix", $ref_search );
+ if ($tmp_file) {
+ push @return_list, $tmp_file;
+ }
+ if ( $find_retcode != 0 ) {
+ $retcode = 1;
+ }
+ }
+ @$ref_output = @return_list;
+#?? show_array( " Output", @$ref_output );
+#?? foreach (@$ref_output) { if ( /\/\// ) { print " ====== double slash in '$_'\n"; } }
+ return $retcode;
+} #END find_file_list1
+
+#************************************************************
+
+sub kpsewhich {
+# Usage: kpsewhich( filespec, ...)
+# Returns array of files with paths as found by kpsewhich
+# kpsewhich( 'try.sty', 'jcc.bib' );
+# Can also do, e.g.,
+# kpsewhich( '-format=bib', 'trial.bib', 'file with spaces');
+ my $cmd = $kpsewhich;
+ my @args = @_;
+ foreach (@args) {
+ if ( ! /^-/ ) {
+ $_ = "\"$_\"";
+ }
+ }
+ foreach ($cmd) {
+ s/%[RBTDO]//g;
+ }
+ $cmd =~ s/%S/@args/g;
+ my @found = ();
+ local $fh;
+ open $fh, "$cmd|"
+ or die "Cannot open pipe for \"$cmd\"\n";
+ while ( <$fh> ) {
+ s/^\s*//;
+ s/\s*$//;
+ push @found, $_;
+ }
+ close $fh;
+# show_array( "Kpsewhich: '$cmd', '$file_list' ==>", @found );
+ return @found;
+}
+
+####################################################
+
+sub add_cus_dep {
+ # Usage: add_cus_dep( from_ext, to_ext, flag, sub_name )
+ # Add cus_dep after removing old versions
+ my ($from_ext, $to_ext, $must, $sub_name) = @_;
+ remove_cus_dep( $from_ext, $to_ext );
+ push @cus_dep_list, "$from_ext $to_ext $must $sub_name";
+}
+
+####################################################
+
+sub remove_cus_dep {
+ # Usage: remove_cus_dep( from_ext, to_ext )
+ my ($from_ext, $to_ext) = @_;
+ my $i = 0;
+ while ($i <= $#cus_dep_list) {
+ if ( $cus_dep_list[$i] =~ /^$from_ext $to_ext / ) {
+ splice @cus_dep_list, $i, 1;
+ }
+ else {
+ $i++;
+ }
+ }
+}
+
+####################################################
+
+sub show_cus_dep {
+ show_array( "Custom dependency list:", @cus_dep_list );
+}
+
+####################################################
+
+sub find_dirs1 {
+ # Same as find_dirs, but argument is single string with directories
+ # separated by $search_path_separator
+ find_dirs( &split_search_path( $search_path_separator, ".", $_[0] ) );
+}
+
+
+#************************************************************
+
+sub find_dirs {
+# @_ is list of directories
+# return: same list of directories, except that for each directory
+# name ending in //, a list of all subdirectories (recursive)
+# is added to the list.
+# Non-existent directories and non-directories are removed from the list
+# Trailing "/"s and "\"s are removed
+ local @result = ();
+ my $find_action
+ = sub
+ { ## Subroutine for use in File::find
+ ## Check to see if we have a directory
+ if (-d) { push @result, $File::Find::name; }
+ };
+ foreach my $directory (@_) {
+ my $recurse = ( $directory =~ m[//$] );
+ # Remove all trailing /s, since directory name with trailing /
+ # is not always allowed:
+ $directory =~ s[/+$][];
+ # Similarly for MSWin reverse slash
+ $directory =~ s[\\+$][];
+ if ( ! -e $directory ){
+ next;
+ }
+ elsif ( $recurse ){
+ # Recursively search directory
+ find( $find_action, $directory );
+ }
+ else {
+ push @result, $directory;
+ }
+ }
+ return @result;
+}
+
+#************************************************************
+
+sub uniq
+# Read arguments, delete neighboring items that are identical,
+# return array of results
+{
+ my @sort = ();
+ my ($current, $prev);
+ my $first = 1;
+ while (@_)
+ {
+ $current = shift;
+ if ($first || ($current ne $prev) )
+ {
+ push @sort, $current;
+ $prev = $current;
+ $first = 0;
+ }
+ }
+ return @sort;
+}
+
+#==================================================
+
+sub uniq1 {
+ # Usage: uniq1( strings )
+ # Returns array of strings with duplicates later in list than
+ # first occurence deleted. Otherwise preserves order.
+
+ my @strings = ();
+ my %string_hash = ();
+
+ foreach my $string (@_) {
+ if (!exists( $string_hash{$string} )) {
+ $string_hash{$string} = 1;
+ push @strings, $string;
+ }
+ }
+ return @strings;
+}
+
+#************************************************************
+
+sub uniqs {
+ # Usage: uniq2( strings )
+ # Returns array of strings sorted and with duplicates deleted
+ return uniq( sort @_ );
+}
+
+#************************************************************
+
+sub ext {
+ # Return extension of filename. Extension includes the period
+ my $file_name = $_[0];
+ my ($base_name, $path, $ext) = fileparseA( $file_name );
+ return $ext;
+ }
+
+#************************************************************
+
+sub fileparseA {
+ # Like fileparse but replace $path for current dir ('./' or '.\') by ''
+ # Also default second argument to get normal extension.
+ my $given = $_[0];
+ my $pattern = '\.[^\.]*';
+ if ($#_ > 0 ) { $pattern = $_[1]; }
+ my ($base_name, $path, $ext) = fileparse( $given, $pattern );
+ if ( ($path eq './') || ($path eq '.\\') ) {
+ $path = '';
+ }
+ return ($base_name, $path, $ext);
+ }
+
+#************************************************************
+
+sub fileparseB {
+ # Like fileparse but with default second argument for normal extension
+ my $given = $_[0];
+ my $pattern = '\.[^\.]*';
+ if ($#_ > 0 ) { $pattern = $_[1]; }
+ my ($base_name, $path, $ext) = fileparse( $given, $pattern );
+ return ($base_name, $path, $ext);
+ }
+
+#************************************************************
+
+sub split_search_path
+{
+# Usage: &split_search_path( separator, default, string )
+# Splits string by separator and returns array of the elements
+# Allow empty last component.
+# Replace empty terms by the default.
+ my $separator = $_[0];
+ my $default = $_[1];
+ my $search_path = $_[2];
+ my @list = split( /$separator/, $search_path);
+ if ( $search_path =~ /$separator$/ ) {
+ # If search path ends in a blank item, the split subroutine
+ # won't have picked it up.
+ # So add it to the list by hand:
+ push @list, "";
+ }
+ # Replace each blank argument (default) by current directory:
+ for ($i = 0; $i <= $#list ; $i++ ) {
+ if ($list[$i] eq "") {$list[$i] = $default;}
+ }
+ return @list;
+}
+
+#################################
+
+
+sub tempfile1 {
+ # Makes a temporary file of a unique name. I could use file::temp,
+ # but it is not present in all versions of perl
+ # Filename is of form $tmpdir/$_[0]nnn$suffix, where nnn is an integer
+ my $tmp_file_count = 0;
+ my $prefix = $_[0];
+ my $suffix = $_[1];
+ while (1==1) {
+ # Find a new temporary file, and make it.
+ $tmp_file_count++;
+ my $tmp_file = "${tmpdir}/${prefix}${tmp_file_count}${suffix}";
+ if ( ! -e $tmp_file ) {
+ open( TMP, ">$tmp_file" )
+ or next;
+ close(TMP);
+ return $tmp_file;
+ }
+ }
+ die "$My_name.tempfile1: BUG TO ARRIVE HERE\n";
+}
+
+#################################
+
+#************************************************************
+#************************************************************
+# Process/subprocess routines
+
+sub Run_msg {
+ # Same as Run, but give message about my running
+ warn_running( "Running '$_[0]'" );
+ Run($_[0]);
+}
+
+sub Run {
+# Usage: Run ("program arguments ");
+# or Run ("start program arguments");
+# or Run ("NONE program arguments");
+# First form is just a call to system, and the routine returns after the
+# program has finished executing.
+# Second form (with 'start') runs the program detached, as appropriate for
+# the operating system: It runs "program arguments &" on UNIX, and
+# "start program arguments" on WIN95 and WINNT. If multiple start
+# words are at the beginning of the command, the extra ones are removed.
+# Third form (with 'NONE') does not run anything, but prints an error
+# message. This is provided to allow program names defined in the
+# configuration to flag themselves as unimplemented.
+# Return value is a list (pid, exitcode):
+# If process is spawned sucessfully, and I know the PID,
+# return (pid, 0),
+# else if process is spawned sucessfully, but I do not know the PID,
+# return (0, 0),
+# else if process is run,
+# return (0, exitcode of process)
+# else (I fail to run the requested process)
+# return (0, suitable return code)
+# where return code is 1 if cmdline is null or begins with "NONE" (for
+# an unimplemented command)
+# or the return value of the system subroutine.
+
+
+# Split command line into one word per element, separating words by
+# one (OR MORE) spaces:
+# The purpose of this is to identify latexmk-defined pseudocommands
+# 'start' and 'NONE'.
+# After dealing with them, the command line is reassembled
+ my $cmd_line = $_[0];
+ if ( $cmd_line eq '' ) {
+ traceback( "$My_name: Bug OR configuration error\n".
+ " In run of'$rule', attempt to run a null program" );
+ return (0, 1);
+ }
+ if ( $cmd_line =~ /^start +/ ) {
+ #warn "Before: '$cmd_line'\n";
+ # Run detached. How to do this depends on the OS
+ # But first remove extra starts (which may have been inserted
+ # to force a command to be run detached, when the command
+ # already contained a "start").
+ while ( $cmd_line =~ s/^start +// ) {}
+ #warn "After: '$cmd_line'\n";
+ return &Run_Detached( $cmd_line );
+ }
+ elsif ( $cmd_line =~ /^NONE/ ) {
+ warn "$My_name: ",
+ "Program not implemented for this version. Command line:\n";
+ warn " '$cmd_line'\n";
+ return (0, 1);
+ }
+ else {
+ # The command is given to system as a single argument, to force shell
+ # metacharacters to be interpreted:
+ return( 0, system( $cmd_line ) );
+ }
+}
+
+#************************************************************
+
+sub Run_Detached {
+# Usage: Run_Detached ("program arguments ");
+# Runs program detached. Returns 0 on success, 1 on failure.
+# Under UNIX use a trick to avoid the program being killed when the
+# parent process, i.e., me, gets a ctrl/C, which is undesirable for pvc
+# mode. (The simplest method, system ("program arguments &"), makes the
+# child process respond to the ctrl/C.)
+# Return value is a list (pid, exitcode):
+# If process is spawned sucessfully, and I know the PID,
+# return (pid, 0),
+# else if process is spawned sucessfully, but I do not know the PID,
+# return (0, 0),
+# else if I fail to spawn a process
+# return (0, 1)
+
+ my $cmd_line = $_[0];
+
+## warn "Running '$cmd_line' detached...\n";
+ if ( $cmd_line =~ /^NONE / ) {
+ warn "$My_name: ",
+ "Program not implemented for this version. Command line:\n";
+ warn " '$cmd_line'\n";
+ return (0, 1);
+ }
+
+ if ( "$^O" eq "MSWin32" ){
+ # Win95, WinNT, etc: Use MS's start command:
+ return( 0, system( "start $cmd_line" ) );
+ } else {
+ # Assume anything else is UNIX or clone
+ # For this purpose cygwin behaves like UNIX.
+ ## warn "Run_Detached.UNIX: A\n";
+ my $pid = fork();
+ ## warn "Run_Detached.UNIX: B pid=$pid\n";
+ if ( ! defined $pid ) {
+ ## warn "Run_Detached.UNIX: C\n";
+ warn "$My_name: Could not fork to run the following command:\n";
+ warn " '$cmd_line'\n";
+ return (0, 1);
+ }
+ elsif( $pid == 0 ){
+ ## warn "Run_Detached.UNIX: D\n";
+ # Forked child process arrives here
+ # Insulate child process from interruption by ctrl/C to kill parent:
+ # setpgrp(0,0);
+ # Perhaps this works if setpgrp doesn't exist
+ # (and therefore gives fatal error):
+ eval{ setpgrp(0,0);};
+ exec( $cmd_line );
+ # Exec never returns; it replaces current process by new process
+ die "$My_name forked process: could not run the command\n",
+ " '$cmd_line'\n";
+ }
+ ##warn "Run_Detached.UNIX: E\n";
+ # Original process arrives here
+ return ($pid, 0);
+ }
+ # NEVER GET HERE.
+ ##warn "Run_Detached.UNIX: F\n";
+}
+
+#************************************************************
+
+sub find_process_id {
+# find_process_id(string) finds id of process containing string and
+# being run by the present user. Typically the string will be the
+# name of the process or part of its command line.
+# On success, this subroutine returns the process ID.
+# On failure, it returns 0.
+# This subroutine only works on UNIX systems at the moment.
+
+ if ( $pid_position < 0 ) {
+ # I cannot do a ps on this system
+ return (0);
+ }
+
+ my $looking_for = $_[0];
+ my @ps_output = `$pscmd`;
+
+# There may be multiple processes. Find only latest,
+# almost surely the one with the highest process number
+# This will deal with cases like xdvi where a script is used to
+# run the viewer and both the script and the actual viewer binary
+# have running processes.
+ my @found = ();
+
+ shift(@ps_output); # Discard the header line from ps
+ foreach (@ps_output) {
+ next unless ( /$looking_for/ ) ;
+ my @ps_line = split (' ');
+# OLD return($ps_line[$pid_position]);
+ push @found, $ps_line[$pid_position];
+ }
+
+ if ($#found < 0) {
+ # No luck in finding the specified process.
+ return(0);
+ }
+ @found = reverse sort @found;
+ if ($diagnostics) {
+ print "Found the following processes concerning '$looking_for'\n",
+ " @found\n",
+ " I will use $found[0]\n";
+ }
+ return $found[0];
+}
+
+#************************************************************
+#************************************************************
+#************************************************************
+
+# Directory stack routines
+
+sub pushd {
+ push @dir_stack, cwd();
+ if ( $#_ > -1) { chdir $_[0]; }
+}
+
+#************************************************************
+
+sub popd {
+ if ($#dir_stack > -1 ) { chdir pop @dir_stack; }
+}
+
+#************************************************************
+
+sub ifcd_popd {
+ if ( $do_cd ) {
+ warn "$My_name: Undoing directory change\n";
+ &popd;
+ }
+}
+
+#************************************************************
+
+sub finish_dir_stack {
+ while ($#dir_stack > -1 ) { &popd; }
+}
+
+#************************************************************
+#************************************************************
+#************************************************************
+#************************************************************
+#************************************************************
+#************************************************************
+#************************************************************
+#************************************************************