doc 4

git-svn-id: svn://tug.org/texlive/trunk@80 c570f23f-e606-0410-a88d-b1316a301751
author: Karl Berry <karl@freefriends.org> 2006-01-09 00:44:40 +0000
committer: Karl Berry <karl@freefriends.org> 2006-01-09 00:44:40 +0000
commit: b4fc5f639874db951177ec539299d20908adb654 (patch)
tree: 52f08823ca58fffe3db6a9b075635038c567626c /Master/texmf-dist/doc/latex/aiaa
parent: dec3d98ebe442d7ea93efbaa8dd2e2be8149a467 (diff)
31 files changed, 27944 insertions, 0 deletions
diff --git a/Master/texmf-dist/doc/latex/aiaa/README b/Master/texmf-dist/doc/latex/aiaa/README
new file mode 100644
index 00000000000..3d1f4b1649d
--- /dev/null
+++ b/Master/texmf-dist/doc/latex/aiaa/README
@@ -0,0 +1,15 @@
+This is the file `README' for version 3.6 of the `aiaa' LaTeX package.
+
+Run aiaa.ins through LaTeX to produce the files aiaa-tc.cls and aiaa.bst.
+
+This distribution provides a LaTeX class (aiaa-tc.cls) and
+bibliography style file (aiaa.bst) that are used to create AIAA
+technical conference papers.  The distribution also contains a
+Users Manual (aiaa.pdf), AIAA paper submission instructions
+(author_guide.pdf) and two templates, a bare-bones template and
+an advanced template.
+
+For further details and support, read the Users Manual, aiaa.pdf.
+
+This software is released under the terms of the LaTeX Project Public
+License.  Copyright (C) 2004 by Bil Kleb, Bill Wood, and Erich Knausenberger.
diff --git a/Master/texmf-dist/doc/latex/aiaa/aiaa.pdf b/Master/texmf-dist/doc/latex/aiaa/aiaa.pdf
new file mode 100644
index 00000000000..952efac1342
--- /dev/null
+++ b/Master/texmf-dist/doc/latex/aiaa/aiaa.pdf
diff --git a/Master/texmf-dist/doc/latex/aiaa/author_guide.pdf b/Master/texmf-dist/doc/latex/aiaa/author_guide.pdf
new file mode 100644
index 00000000000..633b6523348
--- /dev/null
+++ b/Master/texmf-dist/doc/latex/aiaa/author_guide.pdf
diff --git a/Master/texmf-dist/doc/latex/aiaa/author_guide.tex b/Master/texmf-dist/doc/latex/aiaa/author_guide.tex
new file mode 100644
index 00000000000..59814add8eb
--- /dev/null
+++ b/Master/texmf-dist/doc/latex/aiaa/author_guide.tex
@@ -0,0 +1,752 @@
+%
+% `author_guide.tex' - AIAA author instructions that use the AIAA class.
+%
+% Typical processing for PostScript (PS) output:
+%
+%  latex author_guide
+%  bibtex author_guide  (bibliography)
+%  makeindex -s nomencl.ist -o author_guide.gls author_guide.glo (nomenclature)
+%  latex author_guide   (repeat as needed to resolve references)
+%
+%  xdvi author_guide    (onscreen draft display)
+%  dvips author_guide   (postscript)
+%  gv author_guide.ps   (onscreen display)
+%  lpr author_guide.ps  (hardcopy)
+%
+% With the above, only Encapsulated PostScript (EPS) images can be used.
+%
+% Typical processing for Portable Document Format (PDF) output:
+%
+%  pdflatex author_guide
+%  bibtex author_guide  (bibliography)
+%  makeindex -s nomencl.ist -o author_guide.gls author_guide.glo (nomenclature)
+%  pdflatex author_guide      (repeat as needed to resolve references)
+%
+%  acroread author_guide.pdf  (onscreen display)
+%
+% If you have EPS figures, you will need to use the epstopdf script
+% to convert them to PDF because PDF is a limmited subset of EPS.
+% pdflatex accepts a variety of other image formats such as JPG, TIF,
+% PNG, and so forth -- check the documentation for your version.
+%
+% If you do *not* specify suffixes when using the graphicx package's
+% \includegraphics command, latex and pdflatex will automatically select
+% the appropriate figure format from those available.  This allows you
+% to produce PS and PDF output from the same LaTeX source file.
+%
+% To generate a large format (e.g., 11"x17") PostScript copy for editing
+% purposes, use
+%
+%  dvips -x 1467 -O -0.65in,0.85in -t tabloid author_guide
+%
+% For further details and support, read the Users Manual, aiaa.pdf.
+%
+% This software is released under the terms of the LaTeX Project Public
+% License.  Copyright (C) 2004 by Bil Kleb, Bill Wood, and Erich Knausenberger.
+
+\documentclass{aiaa-tc}% insert '[draft]' option to show overfull boxes
+
+ \usepackage{wrapfig}% embedding figures/tables in text (i.e., Galileo style)
+ \usepackage{threeparttable}% tables with footnotes
+ \usepackage{dcolumn}% decimal-aligned tabular math columns
+  \newcolumntype{d}{D{.}{.}{-1}}
+ \usepackage{nomencl}% automatic nomenclature generation via makeindex
+  \makeglossary
+ \usepackage{subfigure}% subcaptions for subfigures
+ \usepackage{subfigmat}% matrices of similar subfigures, aka small mulitples
+ \usepackage{fancyvrb}% extended verbatim environments
+  \fvset{fontsize=\footnotesize,xleftmargin=2em}
+ \usepackage{lettrine}% dropped capital at beginning of paragraph
+ \usepackage[dvips]{dropping}% alternative dropped capital package
+ \usepackage{hyperref}% embedding hyperlinks [must be loaded after dropping]
+
+ \title{Preparation of Papers for\\
+        AIAA Technical Conferences}
+
+ \author{%
+  First A. Author\thanks{Job Title, Department, Address, and AIAA
+                              Member Grade.}
+  \ and
+  Second B. Author\thanksibid{1}\\% same footnote as 1st author\\
+  {\normalsize\itshape
+   Business or Academic Affiliation, City, Province, Zipcode, Country}\\
+  \and
+  Third C. Author\thanks{Job Title, Department, Address, and AIAA
+                              Member Grade.}\\
+  {\normalsize\itshape
+   Another Business or Academic Affiliation, City, Province, Zipcode, Country}
+ }
+
+ \AIAApapernumber{200?-????}
+ \AIAAconference{Conference Name, Date, and Location}
+ \AIAAcopyright{\AIAAcopyrightD{200?}}
+
+ % define some commands to maintain consistency
+ \newcommand{\pkg}[1]{\texttt{#1}}
+ \newcommand{\cls}[1]{\textsf{#1}}
+ \newcommand{\file}[1]{\texttt{#1}}
+
+\begin{document}
+
+\maketitle
+
+\begin{abstract}
+These instructions give you guidelines for preparing papers for AIAA
+Technical Conferences.
+Use this document as a guide if you are using \LaTeXe.
+Otherwise, use this document as an instruction set.
+Should this submission be for a non-electronic meeting, the electronic
+file of your paper will be formatted further at AIAA.
+Define all symbols used in the abstract.
+Do not cite references in the abstract.
+The footnote on the first page should list the Job Title and AIAA Member
+Grade for each author.
+\end{abstract}
+
+\printglossary% creates nomenclature section produced by MakeIndex
+
+\section{Introduction}
+
+\lettrine[nindent=0pt]{T}{his} document is a \LaTeX\ template.
+If you are reading a hardcopy or PDF version of this document, please
+download the \LaTeX\ macros and sample files from
+\href{http://www.ctan.org/}{www.ctan.org}
+so you can use it to prepare your manuscript.
+The \cls{aiaa-tc} class uses Computer Modern (CM) fonts, which
+are part of any standard \TeX installation.
+Use the \LaTeX\ files for formatting purposes,
+but please see \file{author\_guide.pdf} for specific layout instructions.
+Authors will first need to save the \cls{AIAA} files to their
+working directory or install them into their \TeX\ distribution.
+
+\section{Procedure for Paper Submission}
+
+All manuscripts are to be submitted electronically via the AIAA
+submission tool at \href{http://www.aiaa.org/author}{www.aiaa.org/author}.
+Select the ``Submit a Paper to an AIAA Conference'' link, then click the
+``Edit Old'' button.
+When you submitted your abstract for review, you should have received a
+tracking number for your paper.
+Use this tracking number, along with the last name of the corresponding
+author, to gain access to the AIAA Author Status Page.
+This site will allow you to track your paper's status, update submission
+data, select a copyright statement, and upload your manuscript.
+
+Before you can upload your manuscript, you will need to select a
+copyright statement to appear on your paper.
+This can be achieved by clicking the ``Copyright Information'' link on
+the Author Status Page.
+Be sure to read the instructions and specific statements carefully
+before selecting a statement for your manuscript.
+
+Once you have selected a copyright statement, you can use the ``Upload
+Manuscript'' feature of the Author Status Page to upload your paper.
+All accepted authors will be notified by AIAA of the relevant
+submission deadlines.
+In addition, the deadlines for every conference can be found under the
+conference title on the Author Status Page.
+
+As with the submission of your abstract, be sure the name of the file
+you upload for processing is short and simple (i.e., ``msc12345.tex'')
+with no spaces, tildes, symbols, or other unusual characters.
+If the file being uploaded is in \LaTeX, the document must be based
+on \cls{article.cls} (this AIAA class is based on this class).
+Failure to meet these requirements could result in a processing error
+that would require you to re-upload your manuscript.%
+\footnote{If you are uploading a PDF or postscript file, please do not
+  include foreign (i.e., non-Roman alphabet) fonts.}
+If you encounter difficulties with the upload and/or conversion of your
+manuscript, please contact AIAA Papers Tech Support for assistance at
+\href{mailto:paper_tech_support@aiaa.org?subject=upload}%
+     {paper\_tech\_support@aiaa.org}.
+
+\section{General Guidelines}
+
+The following section outlines general (non-formatting) guidelines to
+follow, drawn from the original AIAA Manuscript Preparation Kit.
+These guidelines are applicable to all authors (except as noted), and
+include information on the policies and practices relevant to the
+publication of your manuscript.
+
+\subsection{Publication by AIAA}
+
+Your manuscript cannot be published by AIAA if:
+\begin{enumerate}
+ \item It has been published previously or
+ \item An appropriate copyright statement has not yet been selected.
+\end{enumerate}
+
+\subsection{Paper Review and Visa Considerations}
+
+It is the responsibility of the author to obtain any required government or
+company reviews for their papers in advance of publication.
+Start early to determine if the reviews are required; this process can
+take several weeks.
+
+If you plan to attend an AIAA technical conference or professional
+development course held in the United States and you require a visa for
+travel, it is incumbent upon you to apply for a visa with the
+U.S. embassy (consular division) or consulate with ample time for
+processing.
+To avoid bureaucratic problems, AIAA strongly suggests that you submit
+your formal application to U.S. authorities a minimum of 120 days in
+advance of the date of anticipated travel.
+
+Prospective conference and course attendees requiring a visa to travel
+to the United States should first contact AIAA to request an official
+letter of invitation.
+This letter and a copy of the conference call for papers should be presented
+along with the required documentation to the U.S. consular officials as part of
+the formal application process.
+AIAA cannot directly intervene with the U.S. Department of State,
+consular offices, or embassies on behalf of individuals applying for visas.
+A letter of invitation can be requested at
+\href{http://www.aiaa.org/visa-info/}{www.aiaa.org/visa-info/} or you
+may contact AIAA Customer Service at
+\href{mailto:custserv@aiaa.org?subject=visa}{custserv@aiaa.org} for more
+information.
+
+\subsection{Tracking Number vs Paper Number}
+
+Your paper was assigned a tracking number at the time you submitted
+your abstract.
+That number plus the corresponding author's last name is used to access
+the AIAA Author Status Page.
+This number is also useful when contacting AIAA technical support
+regarding submission difficulties.
+The tracking number is not the final AIAA paper number.
+Once the abstract is accepted and assigned to the program, an AIAA
+paper number is created.
+The paper number, which appears in the format
+{\footnotesize\textsf{AIAA-YEAR-NNNN}}, will be used to refer to your
+paper in the program and in any publication format.
+Do not include a paper number anywhere on your paper, as this number
+will be stamped automatically in the top right corner of your paper at
+the time of processing.
+
+\subsection{Copyright}
+
+Before AIAA can print or publish any paper, the copyright information
+must be completed on the AIAA Web site.
+Failure to complete the form correctly could result in your paper not
+being published.
+The following fields must be completed:
+\begin{enumerate}
+ \item Clearance Statement
+ \item Non-Infringement Statement
+ \item Publication Status Statement
+ \item Copyright Assignment Statement
+\end{enumerate}
+For the Copyright Assignment Statement, select either A, B, C, or~D.
+Be sure to read the copyright statements carefully.
+If you are not sure which copyright statement to use, contact your legal
+department; AIAA cannot help you determine which statement to use.
+A hardcopy of the form is found in the Author Kit for your reference.
+As you will be completing this form online, you do not need to fill out
+the hard-copy form. Please do not upload the copyright form with your
+paper, and do not include a copyright statement anywhere on your
+paper. The correct statement will be stamped automatically at the time
+of processing.
+
+\subsection{Submission Deadlines}
+
+\subsubsection{Meetings with Electronic Proceedings}
+
+Manuscripts will be accepted for upload to the system from the receipt
+of the acceptance letter to the beginning of the conference. You will be
+notified of the specific manuscript submission deadline in your
+acceptance letter, and the deadline will also be listed on the Author
+Status Page for your paper. We ask that authors not upload a draft version
+of their manuscript with the intent to upload a final version  later.
+\emph{PLEASE upload only the final version of your manuscript.}
+
+On-line conference proceedings will be made accessible to attendees
+who have registered for the "full conference" option two weeks prior to
+the conference. Please keep that date in mind when preparing and
+uploading the final manuscript.
+
+To ensure conference quality, session chairs will enforce a "no paper,
+no podium" rule. This policy states that if your manuscript is not
+uploaded to the Web site prior to your presentation, you will not be
+allowed to present the paper at the conference. There are times when the
+organizers at the conference request an earlier deadline than the beginning
+of the conference. If such a situation arises, you will be notified in your
+Author Acceptance Letter.
+
+\subsubsection{Loose Papers Meetings}
+
+The manuscript submission deadline for loose papers meetings is generally
+six to eight weeks in advance of the event; you will be notified of the specific
+deadline in your acceptance letter, and the date will also appear on the
+Author Status Page for your paper. Papers uploaded before the deadline
+will be reproduced and shipped to the conference by AIAA at no charge.
+
+Authors who miss the electronic submission deadline will be expected to
+hand-carry 100 copies of their paper to the meeting, and must still upload
+their final manuscript to the AIAA Web site before the start of the conference
+for their paper to be published. A general No paper, no podium rule is in
+effect for all AIAA conferences. If your paper is not submitted to AIAA prior to
+your presentation, you will not be allowed to present. If you miss the initial
+deadline, contact your session chair or the conference Technical Chair for
+further instructions.
+
+\subsection{Color Illustrations}
+
+Papers published electronically (online or on CD-ROMs) will be
+reproduced in color automatically. If your paper is submitted to a loose
+papers meeting (as specified in the author acceptance letter), color
+printing can be arranged for an additional charge. Please contact the
+technical papers specialist for details at 
+\href{mailto:bettyg@aiaa.org?subject=illustrations}%
+        {bettyg@aiaa.org}.
+
+\section{Detailed Formatting Instructions}
+
+\subsection{Document Text}
+
+The default font for AIAA papers written in \LaTeX\ is 10-point Computer
+Modern (CM).
+
+\subsection{Title, Authors' Names, and Affiliations}
+
+The title of your paper should be coded as \verb|\title{Paper Title}|,
+with capital and lower-case letters, and centered at the top of the
+page.
+The names of the authors, business or academic affiliation, city, and
+state/province should follow on separate lines below the title.
+The names of authors with the same affiliation can be listed on the same
+line above their collective affiliation information.
+The authors' names, contact information, and affiliation is coded within
+\LaTeX's standard \verb|\author| using \verb|tabular| environment
+conventions and the \verb|\thanks| and \verb|\and| commands.
+The affiliation line for each author includes the author's city, state,
+and zip/postal code (or city, province, zip/postal code and country, as
+appropriate).
+The contact information for each author is given by the \verb|\thanks|
+command and should include job title, department name, street
+address/mail stop, and the AIAA member grade.
+If this information is the same for two or more authors, the subsequent
+authors should use the \verb|\thanksibid{}| command which requires the
+number of the duplicate author contact information.
+Author names are centered, and affiliations are centered and in italic type.
+The title is created by the \verb|\maketitle| command.
+For example,
+\begin{Verbatim}
+ \documentclass{aiaa-tc}
+  \title{Paper Title}
+  \author{%
+    Bil Kleb\thanks{Aerospace Engineer, Aerothermodynamics Branch,
+                    Mail Stop 408a, Lifetime AIAA member.}
+    and Bill Wood\thanksibid{1}\\
+    {\itseries NASA Langley Research Center, Hampton, Virginia, 23681}
+    \and% issues a \end{tabular} followed by a \begin{tabular}{c}
+    Someone Else\thanks{Job title, department name, street
+                        address/mailstop, AIAA member grade.}\\
+    {\itseries Business or Academic Affiliation, City, State, Zipcode}
+  }
+ \begin{document}
+ \maketitle
+\end{Verbatim}
+
+\subsection{Headings}
+
+AIAA Technical Conferences style defines 3 levels of section
+headings:
+\begin{description}
+ \item Level 1 heading (\verb"\section"): bold, larger font, centered,
+       and numbered with Roman numerals.
+ \item Level 2 heading (\verb"\subsection"): bold, flush left, and
+       numbered with capital letters.  No opening paragraph indentation.
+ \item Level 3 heading (\verb"\subsubsection"): italic, flush left, and
+       numbered with Arabic numbers (e.g., 1, 2, 3).  No opening
+       paragraph indentation.
+\end{description}
+
+\subsection{Abstract}
+
+The abstract should appear at the beginning of your paper.
+It should be one paragraph long (not an introduction) and complete in
+itself (no reference numbers).
+It should indicate subjects dealt with in the paper and state the
+objectives of the investigation.
+Newly observed facts and conclusions of the experiment or argument
+discussed in the paper must be stated in summary form; readers should
+not have to read the paper to understand the abstract.
+
+\subsection{Footnotes and References}
+
+Footnotes, where they appear, should be placed above the 1-inch margin at
+the bottom of the page.
+To insert footnotes, use \verb|\footnote{}| as normal.
+Footnotes are formatted automatically in \verb|aiaa.cls|, but if
+another medium is used, they should appear in as superscript lower case
+letters.
+When adding notes to tables, e.g., as accommodated by the
+\pkg{threeparttable} package, the symbols are down by hand and should be
+in the sequence, *, $\dagger$, $\ddagger$, $\mathsection$,
+$\mathparagraph$, $\|$, **, $\dagger\dagger$, and so forth.
+This sequence should beginning anew with each table.
+
+List and number all bibliographical references at the end of the paper.
+Corresponding superscript numbers are used to cite references in the
+text using the \verb|\cite{}| command,\cite{sutton:85ar} unless the
+citation is an integral part of the sentence (e.g., ``It is shown in
+Ref.~\citen{miner:75ncr} that\ldots[.]'') 
+or follows a mathematical expression: ``$A2 + B = C$
+(Ref.~\citen{wirin:90cp}).''
+For this case, the command, \verb|\citen{}| is used.
+\cite{*}% to load all refences for demonstration purposes which follow
+Multiple citations are sorted and punctuated automatically through the
+\cls{aiaa-tc}'s use of the \pkg{overcite}. 
+Separate reference numbers are shown with
+commas\cite{sutton:85ar,miner:75ncr,turner:64a} and ranges are 
+separated by an en-dash.\cite{sutton:85ar,miner:75ncr,wirin:90cp}
+Reference citations in the text should be in numerical order, which is
+assured by using \textsc{Bib}\TeX.
+
+In the reference list, give all authors' names; do not use ``et al.''
+unless there are six authors or more.
+Papers that have not been published should be cited as ``unpublished'';
+papers that have been submitted or accepted for publication should be
+cited as ``submitted for publication.''
+Private communications and personal Web sites should appear as footnotes
+rather than in the reference list.
+
+References should be cited according to the standard publication
+reference style.
+(For examples, see the ``References'' section of this template.)
+This is facilitated by the Bib\TeX\ database and a style file, \file{aiaa.bst}.
+As a rule, all words are capitalized except for articles, conjunctions,
+and prepositions of four letters or fewer.
+Names and locations of publishers should be listed; month and year
+should be included for reports and papers.
+For papers published in translation journals, please give the English
+citation first, followed by the original foreign language citation.
+
+\subsection{Images, Figures, and Tables}
+
+All artwork, captions, figures, graphs, and tables will be reproduced
+exactly as submitted.
+Be sure to position any figures, tables, graphs, or pictures as you want
+them printed.
+AIAA is not responsible for incorporating your figures, tables,
+etc.%
+\footnote{Company logos and identification numbers are not permitted on
+  your illustrations.}
+
+% an experiment with wrapfig -- read caveats documented in wrapfig.sty
+\begin{wrapfigure}{R}{0.5\linewidth}
+ \includegraphics{figure_magnet}
+ \caption{Magnetization as a function of applied field, which has
+   borders so thick that they overwhelm the data and for some reason the
+   ordinate label is rotated 90 degrees to make it difficult to
+   read. This figure also demonstrates the dangers of using a bitmap
+   as opposed to a vector image.}
+ \label{f:magnetic_field}
+\end{wrapfigure}
+
+Place figure captions below all figures; place table titles above the
+tables.%
+\footnote{Please do not include captions as part of the figure image
+itself.}
+If your figure has multiple parts, include the labels ``a),'' ``b),''
+and so on, below each subfigure and above the figure caption.
+This can be accomplished with the \pkg{subfigure} package.
+Please verify that the figures and tables you mention in the text
+actually exist by using \LaTeX's \verb|\label| and \verb|\ref| mechanisms
+and verifying that there are no undefined references during typesetting.
+
+When citing a figure in the text, use ``figure'' as ``Fig., often used
+to refer to graphics, is an ugly abbreviation and is not worth the two
+spaces saved.''\cite{tufte:83bk}
+Do not abbreviate ``table'' either.
+Each different type of illustration (i.e., figures, tables, or
+images) should be numbered sequentially with relation to other
+illustrations of the same type.
+
+Figure axis labels are often a source of confusion.
+Use words rather than symbols.
+As in the example to the right, write the quantity ``Magnetization''
+rather than just ``M.''
+Do not enclose units in parenthesis, but rather separate them from the
+preceding text by commas.
+Do not label axes only with units.
+As in figure~\ref{f:magnetic_field}, for example, write ``Magnetization,
+A/m'' or ``Magnetization, A m-1,'' not just ``A/m.''
+Do not label axes with a ratio of quantities and units.
+For example, write ``Temperature, K,'' not ``Temperature/K.''
+
+Multipliers can be especially confusing.
+Write ``Magnetization, kA/m'' or ``Magnetization, 103 A/m.''
+Do not write ``Magnetization (A/m) $\times$ 1000'' because the reader
+would not then know whether the top axis label in
+figure~\ref{f:magnetic_field} meant 16000~A/m or 0.016~A/m.
+Figure labels must be legible, approximately 8--12 point type.
+Use of the \pkg{psfrag} package can facilitate this, but it makes
+generating a PDF version of your paper difficult.
+
+Figures and tables are referred to as `Floats' in \LaTeX, reflecting
+their floating nature.
+They are typically numbered whether or not they have a caption and they
+are floated to the first available position near the first reference to
+that figure/table within the text.
+This is accomplished by placing the figure/table environment after
+their first reference.
+The environment can even be placed mid-sentence as long as \LaTeX's
+comment character, \%, is used properly to prevent a paragraph break or
+extra spaces.
+By default, floats are placed at the top of the first available page,
+the bottom of the page, or one a page consisting entirely of floats.
+
+An example of coding a standard \verb|{figure}| is given below:
+\begin{Verbatim}
+ \begin{figure}
+   \includegraphics{magetic_field}
+   \caption{Magnetization as a function of applied field, which has
+     borders so thick that they overwhelm from the data.}
+   \label{f:magnetic_field}
+ \end{figure}
+\end{Verbatim}
+
+\begin{table}
+ \begin{center}
+  \begin{threeparttable}
+   \caption{This is an example of a \pkg{threeparttable} which uses the
+     \pkg{dcolumn} package to allow for columns to be aligned on decimal
+     points.}
+   \label{t:threepart}
+   \begin{tabular}{lcdd}
+    First head\tnote{*}  &
+    Second head &
+    \multicolumn{1}{c}{Third head} &
+    \multicolumn{1}{c}{$V_M(r)$} \\\hline
+    center & doctor &  0.2  & 10.55 \\  
+    tab    & dentist &  0.15 & 33.12 \\ 
+    worse  & man\tnote{\ensuremath{\dagger}} & 10.58 & 45.10 \\ 
+    better & home & 43.9  & 12.34 \\
+   \end{tabular}
+   \begin{tablenotes}
+    \item[*] This is a table footnote, which to span multiple lines, has
+      been greatly extended in length contrary to reason.
+    \item[\ensuremath{\dagger}] A much shorter table footnote.
+   \end{tablenotes}
+  \end{threeparttable}
+ \end{center}
+\end{table}
+Tables with footnotes, such as table~\ref{t:threepart},
+can be coded using the \pkg{threeparttable} package as follows:
+\begin{Verbatim}
+ \begin{table}
+  \begin{center}
+   \begin{threeparttable}
+    \caption{This is an example of table caption.}
+    \label{t:wordtable}
+    \begin{tabular}{ccdd}
+     First head\tnote{a}  &
+     Second head\tnote{b} &
+     \multicolumn{1}{c}{Third head} &
+     \multicolumn{1}{c}{$V_M(r)$} \\\hline
+     Left & Word entries &  0.2  & 10.55 \\  
+     Left & Word entries &  0.15 & 33.12 \\ 
+     Left & Word entries & 10.58 & 45.10 \\ 
+     Left & Word entries & 43.9  & 12.34 \\
+    \end{tabular}
+    \begin{tablenotes}
+     \item[a] This is a table footnote, which to span multiple lines, has
+              been greatly extended in length contrary to reason.
+     \item[b] A much shorter table footnote.
+    \end{tablenotes}
+   \end{threeparttable}
+  \end{center}
+ \end{table}
+\end{Verbatim}
+
+\subsection{Equations, Numbers, Symbols, and Abbreviations}
+
+Equations are centered and numbered consecutively, with equation
+numbers in parentheses flush right, as in Eq.~\ref{e:function}.
+\begin{equation}
+ \label{e:function}
+ \int_{0}^{r_{2}} F(r,\varphi)\,dr\,d\varphi =
+    \left[ \sigma r_{2}/(2\mu_{0}) \right] \cdot
+    \int_{0}^{\infty} \exp(-\rho|z_{j}-z_{i}|) \lambda^{-1} 
+\end{equation}
+Equation~\ref{e:function} is coded as below:
+\begin{Verbatim}
+ \begin{equation}
+  \label{e:function}
+  \int_{0}^{r_{2}} F(r,\varphi)\,dr\,d\varphi =
+     \left[ \sigma r_{2}/(2\mu_{0}) \right] \cdot
+     \int_{0}^{\infty} \exp(-\rho|z_{j}-z_{i}|) \lambda^{-1}
+ \end{equation}
+\end{Verbatim}
+A sample equation is included below, formatted using the preceding
+instructions.
+To make your equation more compact, you can use the solidus ($/$), the
+exp function, or appropriate exponents.
+Use parentheses to avoid ambiguities in denominators.
+\begin{equation}
+  \label{e:displace}
+  \mathbf{J}_i\cdot\Delta\underline{x}_{i+1}=-\underline{f}_i
+\end{equation}
+\nomenclature{$J$}{Jacobian Matrix}
+\nomenclature[b$i$]{$i$}{Variable number}
+\nomenclature[g$\Delta$]{$\Delta x$}{Variable displacement vector}
+\nomenclature{$f$}{Residual value vector}
+\nomenclature{$x$}{Variable value vector}
+\begin{equation}
+  \label{e:newton}
+  F=m\alpha
+\end{equation}
+\nomenclature{$F$}{Force, N}
+\nomenclature{$m$}{Mass, kg}
+\nomenclature[g$\alpha$]{$\alpha$}{Acceleration, m/s\textsuperscript{2}}
+
+The \verb|fleqnarray| environment is used to display a sequence of
+equations or inequalities. It is very much like a three-column
+\verb|array| environment, with consecutive rows separated by
+\verb|\\| and consecutive items within a row separated by an \&.
+\begin{eqnarray}
+&&\sum_{i\in H} p^0\cdot w^{0i}=\sum_i M^i (p^0) =
+  \sum_i\left[p^0\cdot r^i + \sum_j \alpha^{ij} (p^0\cdot
+  y^{0j})\right]\nonumber\\
+&&{\qquad}= p^0 \cdot \sum_i r^i + p^0 \cdot \sum_i
+\sum_i \alpha^{ij}
+\end{eqnarray}
+An equation number is placed on every line unless that line has a
+\verb|\nonumber| command.
+
+Be sure that the symbols in your equation are defined before the
+equation appears, or immediately following.
+In this case the \pkg{nomencl} package is used to automatically generate
+the nomenclature section.
+
+Italicize symbols ($T$ might refer to temperature, but T is the unit
+Tesla).
+Refer to ``Eq. (1),'' not ``(1)'' or ``equation (1)'' except at the
+beginning of a sentence: ``Equation (1) is phat.''
+Equations can be labeled other than ``Eq.'' should they represent
+inequalities, matrices, or boundary conditions.
+If what is represented is really more than one equation, the
+abbreviation ``Eqs.'' can be used.
+
+Define abbreviations and acronyms the first time they are used in the
+text, even after they have already been defined in the abstract.
+Very common abbreviations such as AIAA, SI, ac, and dc do not have to be
+defined.
+Abbreviations that incorporate periods should not have spaces: write
+``P.R.,'' not ``P. R.''
+Delete periods between initials if the abbreviation has three or more
+initials; e.g., U.N. but ESA.\@
+Do not use abbreviations in the title unless they are unavoidable (for
+instance, ``AIAA'' in the title of this article).
+
+\subsection{General Grammar and Preferred Usage}
+
+Use only one space after periods or colons. Hyphenate complex
+modifiers: ``zero-field-cooled magnetization.''
+Avoid dangling participles, such as, ``Using Eq. (1), the potential was
+calculated.''
+[It is not clear who or what used Eq. (1).]
+Write instead ``The potential was calculated using Eq. (1),'' or ``Using
+Eq. (1), we calculated the potential.''
+
+Use a zero before decimal points: ``0.25,'' not ``.25.''
+Use ``cm$^3$,'' not ``cc.''
+Indicate sample dimensions as ``0.1 cm $\times$ 0.2 cm,'' not ``0.1
+$\times$ 0.2~cm$^2$.''
+The preferred abbreviation for ``seconds'' is ``s,'' not ``sec.''
+Do not mix complete spellings and abbreviations of units: use
+``Wb/m$^2$'' or ``webers per square meter,'' not ``webers/m$^2$.''
+When expressing a range of values, write ``7 to 9'' or ``7--9,'' not
+``7~9.''
+
+A parenthetical statement at the end of a sentence is punctuated
+outside of the closing parenthesis (like this).
+(A parenthetical sentence is punctuated within parenthesis.)
+In American English, periods and commas are placed within quotation
+marks, like ``this period.''
+Other punctuation is ``outside''! Avoid contractions; for example, write
+``do not'' instead of ``don't.''
+The serial comma is preferred: ``A, B, and C'' instead of ``A, B and C.''
+
+If you wish, you may write in the first person singular or plural and
+use the active voice (``I observed that\ldots'' or ``We observed that\ldots''
+instead of ``It was observed that�'').
+Remember to check spelling.
+If your native language is not English, please ask a native
+English-speaking colleague to proofread your paper.
+
+The word ``data'' is plural, not singular (i.e., ``data are,'' not ``data
+is'').
+The subscript for the permeability of vacuum $\mu_0$ is zero, not a
+lowercase letter ``oo.''
+The term for residual magnetization is ``remanence''; the adjective is
+``remanent''; do not write ``remnance'' or ``remnant.''
+The word ``micrometer'' is preferred over ``micron'' when spelling out
+this unit of measure.
+A graph within a graph is an ``inset,'' not an ``insert.''
+The word ``alternatively'' is preferred to the word ``alternately''
+(unless you really mean something that alternates).
+Use the word ``whereas'' instead of ``while'' (unless you are referring
+to simultaneous events).
+Do not use the word ``essentially'' to mean ``approximately'' or
+``effectively.''
+Do not use the word ``issue'' as a euphemism for ``problem.''
+When compositions are not specified, separate chemical symbols by
+en-dashes; for example, ``NiMn'' indicates the intermetallic compound
+Ni$_{0.5}$Mn$_{0.5}$ whereas ``Ni--Mn'' indicates an alloy of some
+composition Ni$_{x}$Mn$_{1-x}$.
+
+Be aware of the different meanings of the homophones ``affect'' (usually
+a verb) and ``effect'' (usually a noun), ``complement'' and
+``compliment,'' ``discreet'' and ``discrete,'' ``principal'' (e.g.,
+``principal investigator'') and ``principle'' (e.g., ``principle of
+measurement''). Do not confuse ``imply'' and ``infer.''
+
+Prefixes such as ``non,'' ``sub,'' ``micro,'' ``multi,'' and ``ultra''
+are not independent words; they should be joined to the words they
+modify, usually without a hyphen.
+There is no period after the ``et'' in the abbreviation ``et al.''
+The abbreviation ``i.e.,'' means ``that is,'' and the abbreviation
+``e.g.,'' means ``for example'' (these abbreviations are not
+italicized).
+An excellent source of more detailed style and formatting instructions
+can be found in the AIAA style guide, {\it AIAA Style} (available from AIAA
+upon request).
+
+\section{Conclusion}
+
+A conclusion section is not required, though it is preferred.
+Although a conclusion may review the main points of the paper, do not
+replicate the abstract as the conclusion.
+A conclusion might elaborate on the importance of the work or suggest
+applications and extensions.%
+\footnote{The conclusion section is the last section of
+  the paper that should be numbered.
+  The appendix (if present), acknowledgment, and references should be
+  listed without numbers.}
+
+\section*{Appendix}
+
+An appendix, if needed, should appear before the acknowledgments.
+Use the 'starred' version of the \verb|\section| commands to avoid
+section numbering.
+
+\section*{Acknowledgments}
+
+The preferred spelling of the word ``acknowledgment'' in American
+English is without the ``e'' after the ``g.''
+Avoid expressions such as ``One of us (S.B.A.) would like to thank\ldots[.]''
+Instead, write ``F. A. Author thanks\ldots[.]''
+Sponsor and financial support acknowledgments are also to be listed in
+the acknowledgments section.
+
+% produces the bibliography section when processed by BibTeX
+\bibliography{bibtex_database}
+\bibliographystyle{aiaa}
+
+\end{document}
+
+% $Id: author_guide.tex,v 1.4 2004/05/23 12:49:44 kleb Exp $
+
diff --git a/Master/texmf-dist/doc/latex/aiaa/figure_magnet.eps b/Master/texmf-dist/doc/latex/aiaa/figure_magnet.eps
new file mode 100644
index 00000000000..668ffdc404b
--- /dev/null
+++ b/Master/texmf-dist/doc/latex/aiaa/figure_magnet.eps
@@ -0,0 +1,707 @@
+%!PS-Adobe-3.0 EPSF-3.0
+%%Creator: Adobe Photoshop Version 5.5
+%%Title: fig1.eps
+%%CreationDate: Thu Nov 13 2003 16:14:42
+%%BoundingBox: 0 0 415 314
+%%HiResBoundingBox: 0 0 415 314
+%%SuppressDotGainCompensation
+%%DocumentProcessColors: Black
+%%EndComments
+%%BeginProlog
+%%EndProlog
+%%BeginSetup
+%%EndSetup
+%ImageData: 415 314 1 1 0 52 2 "beginimage"
+%BeginPhotoshop: 4198
+% 3842494D03ED000000000010004800000001000100480000000100013842494D
+% 040D000000000004000000783842494D03F30000000000080000000000000000
+% 3842494D040A00000000000100003842494D271000000000000A000100000000
+% 000000023842494D040800000000001000000001000002400000024000000000
+% 3842494D0414000000000004000000023842494D040C000000000FB700000001
+% 00000070000000550000015000006F9000000F9B00180001FFD8FFE000104A46
+% 494600010201004800480000FFEE000E41646F626500648000000001FFDB0084
+% 000C08080809080C09090C110B0A0B11150F0C0C0F1518131315131318110C0C
+% 0C0C0C0C110C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C
+% 0C010D0B0B0D0E0D100E0E10140E0E0E14140E0E0E0E14110C0C0C0C0C11110C
+% 0C0C0C0C0C110C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C
+% 0C0CFFC00011080055007003012200021101031101FFDD00040007FFC4013F00
+% 00010501010101010100000000000000030001020405060708090A0B01000105
+% 01010101010100000000000000010002030405060708090A0B10000104010302
+% 04020507060805030C33010002110304211231054151611322718132061491A1
+% B14223241552C16233347282D14307259253F0E1F163733516A2B28326449354
+% 6445C2A3743617D255E265F2B384C3D375E3F3462794A485B495C4D4E4F4A5B5
+% C5D5E5F55666768696A6B6C6D6E6F637475767778797A7B7C7D7E7F711000202
+% 0102040403040506070706053501000211032131120441516171221305328191
+% 14A1B14223C152D1F0332462E1728292435315637334F1250616A2B283072635
+% C2D2449354A317644555367465E2F2B384C3D375E3F34694A485B495C4D4E4F4
+% A5B5C5D5E5F55666768696A6B6C6D6E6F62737475767778797A7B7C7FFDA000C
+% 03010002110311003F00F55599F583273703A665754C4B1A0E0E3645CEC7B19B
+% 9961654EB6ADCE6BABBAB7D7756CFA366CF45F915FA5EAFA17E369ACCFAC16E4
+% 63F4CCACB6DCDAB171F1B22CC968ADEEB5C1B539D5BB1ADA72F05D4BEB73777D
+% 3DF6FF0082C8C4FE7D252279FAC9918F6DFD3B2FA739AF73ECC173A9B6C65B43
+% D95BF13D5B6ACB67A6FF0057D66D9914FDA6BBA9F46FAA8ABF99563D3EBE72BF
+% A4620C4166EFE62C363AB27FA3FF004A6D755B556DFE99FA665EFBBFA0637D9B
+% F5A2F4975EFE9586FC9BEBCAC8763D46EC9A4835DAF2C6FA97D2E6358C7556BF
+% F495ED67D056D2538F755F5BC54F14E574E75AD69756F7E35CD6BDC47B297D6D
+% CD7BB198C737FA4FAB95EAFADFD129FB2FEB65CAABEB27A59070F2B08DA5C5D8
+% 8CB71AD0D0D02C8A722CAF37739EE77A1FACD557E8FF004BFAA59EA7E8B4D249
+% 4E65B57D641901F565613F1BD669343B1AD6BFD02F1EAB7ED4DCDB19F68663EF
+% F4DFF63F4ECBBFC1D4C42733EB7FA2E0DBBA71BC536869355C186F6DBFA9B9CD
+% FB439CDC7BF07D992CFE73172BF49559994FE896C24929C9CAAFEB531EEB30F2
+% 302E60B016635B45D5135EE1BAB767579593B2DF47FC37ECF7B3D5FF0000A6EA
+% BEB207501B9584F6ED7B7249C6B5A7716DDE85D437EDB67B196FD9196E359FCE
+% 33ED167DAEAFD154B4D2494E48AFEB56FADE7230360B182DA7D0BA5D58735B91
+% 65793F6AFD15B6D3EA5F4D2EC4B5945BFAA7AF91B3ED964DD57D640EA0372B09
+% EDDAF6E4938D6B4EE2DBBD0BA86FDB6CF632DFB232DC6B3F9C67DA2CFB5D5FA2
+% A969A0E5E47D9716EC9F4ECBFD0ADD67A34B77D8FD80BFD3A6BD37DAF8DB5B3F
+% 7D2539F5D7F5A880DB32301A7D3B03AC6D17380B05C3ECD60A4E5337556E06EF
+% 5E9F5F7E3E67F377E4D2961E4758AFA8E3E1F52BF11E6EC7C8B0B28AED63DC69
+% BAAAEABEB75965F536AFB2E553F68C7B3F4B5E57F31764D3FCCDE17E45AEC6B3
+% 1EA69C5B9A5D73ED2FAAD602D0EA76623E8DCE7B9DFCF577D98AFA3FE13F9B54
+% 45393575FC7DF7FDA2AB31F31FFA5140B2B9B3A7FA54637A55D393F64ADBEAEF
+% FE77DFE8FDB2E7D9F64494FF00FFD0EDED711F5CEA6E2D94FAAEC2073E97FA82
+% CFB3B5F7FD9ACABF596E35AFFB6D9B7FE4EB7ECF4FDABD6CDA3ED3894645BEBC
+% 33474FCBB31FD67B5B8595FA2C67ECBDD696B0E3FD9A28BED6E47B6EF46E659F
+% A2B3FED2E5FF00DA785D97D2BFE7251856DDFAFF00D9CDD563BDCCD9CD95D575
+% 155C7D5FB5FA5FB419EA607FDA5F5BF68FFDE7A5F58E9BEEE959EC6D765F8EFC
+% 0CB6598D4B80B2C7B98DF46BA5BF67C87FAAE67AF5D6FDFF00A37D9FD132FF00
+% ED3A537BA73DD674FC6B1F6B6F73E9ADCEB98F6D8D792D6936B2EAABC7AAD659
+% F4FD4AF1E8659FE86AFA0AC2AFD3AE17F4FC6B83DD68B69ADE2C79ADCE76E6B5
+% DBDEFC3FD51CF77FDD5FD5FF00D07E8958494A4924925292553AA752A3A5E19C
+% CC86D8FA8595545B530D8F9BACAF16BDB533F4967E92E6FB2BDF6FFA2AECB3D8
+% A768EA0F70153A9A5ADB9A49735D69B28DA3D56ED6BF17ECB90EB77B2B7FEB75
+% EC67A9E9FE97D2A529B0B3F1BAA3FA8F4C39DD2E9DEF36595574E5976349A6E7
+% E2DDEAFE8B26EA3F99B1EC63F1BD5FCCBABA7FC1DD14D42D75C18D16BDAD63EC
+% 006E2D617BAB639FF49CCADD6DBB3FE32C5349485D8FBB2ABC9F52C1E9D7657E
+% 887456EF50D4FF0052CAFF003ADABD0DB4BFF31975FF00E912C7C4C5C5F53ECD
+% 4D747AF63AEBBD36866FB1FF00CE5D66C037DAF8F7D8EF7A3249294B3EF73C75
+% FC260BF6B0E26597634BBDE459D3F6DFB437D1FD5F73EBFD23FD5FD67F43FE1F
+% 6682CFBDCF1D7F0982FDAC389965D8D2EF791674FDB7ED0DF47F57DCFAFF0048
+% FF0057F59FD0FF0087D894FF00FFD1EFEEB7347D60AAB7BEBFB03ABAFD26BACB
+% 2978BF6E77A9E8B1B47D9FA97AB8ED67A98B6667EA9F66FB67D9FF0099B147EB
+% 4BAE6F49C97B5EEA71A9C6CABB29E29AB21AE6368B6B18EEC7C9B2BDEF75B733
+% 298DDBE8DDF63B31B22CA997AA9996BAAFAE98155ECA48C9A6D762D9E8B43E29
+% 61F56BFB4BFA8B1D66452EC873A9D9D22D7D58B9B95553FA2B7A8DCAEFD61FB4
+% 8C2C8757AE3B71328E456FF4052F1E9FE8EBB2ECCDCCC7B77FD0BAEA327A77D9
+% FED7F6EA3FA36C4A6F74E65ACE9F8CCB8385ADA6B1607925C1C1ADDFBDCEBB31
+% DBF77FDDCCAFFC337FF3AAC2A9D259E9F4AC366DD9B71EA6ECDBB36C31A36FA7
+% E8617A7B7F73EC589FF8571FF9A561F6B58EADAE0E26D76D6ED6B9C010D759FA
+% 473039B5336D7FCE5BECDFFA2FE76CAD252AEB5B4D4FB5E1C5B5B4B9C18D73DD
+% 0D1B8ECAAA0FB6C7FF00C1D6CDEF5956E46575968C6C41763F49CFC26DF575AC
+% 7B58CB43AC70DB8F4E35F53EEA5F662BBD5FB56CFD17FC1647BD5AC1C2B45583
+% 91D44B6EEAB8D8DE85D90C90D2EB050FCC2C60153365D7E2D6FF00E67FEDB579
+% 2535F17071F19CFB5AC6BB2AE6B1B939658C6DB71ADBE9D7664BE9654DB1ED6F
+% F23657FE0BD356124925292492494A49249252967DEE78EBF84C17ED61C4CB2E
+% C6977BC8B3A7EDBF686FA3FABEE7D7FA47FABFACFE87FC3ECD059F7BBFCBF84D
+% DF589C4CB3E9964D862CE9FEFAEEF4CECA993FA6AFD7AFD57D947E8AEF47F409
+% 4FFFD2EDF3B27A833EB6F4EA039C7A7D94BF7D65CEADA2FDB73EBB9AEFB3B29C
+% B7B69AADA9F81FB46EB3F4B5F50FD9F57ECFFB5AB1F595D1D1F35B915EEE98EC
+% 4C9FDA165766DBD958A9FF00D0E97556537DAFF7FF003F7E3B2AFF0085467747
+% 63FAB37AA59939163EB8F4719CE69A2B0196D2FF00468F4FDB6DBEBB9F6656EF
+% B67FDA7AF21984FBF16DAFF5ADF90CE85D41EDAE9B31598596FC965BBE5E052F
+% F4F1D829752E632D71FD35FEBEF632BF4AAAFF0058FB462A525ABA937031FA5E
+% 37547DCECECD6B290EF41C4BEF0C0FBBD6FB08C9C4C57E965CFF00D3FD9F6577
+% FA76FA1459622F47E98EE9784311D9B93D4035C5CDBB35EDB2D01DAFA66E6575
+% 3AC635DF47D5DEFF00FAD7A6C557EADE4E2F53C53D668736F192D18F566073CB
+% AFA319F7329B7229B31F0198D91EBDD97EAD54E3FA7FF0D655E9ECD8494A4924
+% 925292492494A4924925292492494A59F7BBFCBF84DDF589C4CB3E9964D862CE
+% 9FEFAEEF4CECA993FA6AFD7AFD57D947E8AEF47F41A0B3EFB183AFE1564FBDD8
+% 996E6B7D36990DB3A7871FB493EB55B77B3F415B7D2C8FE72EFE8D424A7FFFD3
+% F55599F580750774CCAAF09CE63ADC6C8ADB656D717D769A9CEC6C96BE97FDA3
+% 656F67A7E9626265E5D975D8FE8FF3562D350BAA6DD53EA79706D8D2D71639CC
+% 74386D3B2DA8B2DADFFF00095BF7B12535FA6BB762D1E9578F5E27D9EA347D9A
+% CDF5EA0CD746DAA9AFEC95D7E8FD9AE67F3CCFF0146CFD24DAFEA1B5A5D4D21C
+% 5B517016B880E73BF5C6B5DF676EE65157BF19FF00F6A9FF00A3B6BC3FE75169
+% A9B4D4CA985C5B5B435A5EE73DD0D1B46FB6D2FB6C7FFC258FDEF53494D4AF27
+% 2AC7DCC6B31DC69B1B5B836F2E2D976F7FACDF43F456B701F8D975D5FE12DBFD
+% 0FD1D3E9E6DD30FEA12E9A690039A1916B8CB4D8F6D8E77EAFED7B713D2BD8CF
+% F0991EA62FA95D55FDB2D2DD755454FBAE7B6AAAA697D963C86B5AD68DCF7BDE
+% EF6B58D6A56DD552D0FB5EDADA5CD60738868DCF70AAA64BBF3ECB5ECAEBFDF7
+% A4A6B9C8CD67A4DB28AF7DBE93618FB1ED0F3BDF981D6371BD95514D7FAADF77
+% A5F6BBFF0056B3EC7BEAF513ECEAA376CC7C7746ED9BAF7898F5FD3DD18AFD9B
+% F6616FFA7E9FDA32BF9DFB255F6D8750BBA4635B565F51BE9A1D8CD7BE975F60
+% 635A1C6BC7B6F0CB1EDAB7B7D7AF1BED1F4EAFB5FA1EA7EB967AB6DF7555BAB6
+% 58F6B1D73B654D7100B9C1AEB76560FD37FA55D967F52B494D4CECAEA18D55F7
+% 32AC6F4A96B9E2CBF21D4B76B454E73EF7FD96F6D0C6B7ED9BFF009DFE628FFB
+% 936FD8ED936FAAD01AD3516B8BDE5C43838167A6D6D7B36B98E6FABBDFEAFE8F
+% F47FA3B3D4FD154CAEA1D21F8ECAF22EA6FAB3A97BA9A045A726A0CF56EFB363
+% 33D47E733D077F3745776F6299EA98028193EACE3BACA6A65C1AE2C7BB20D2CC
+% 53458D6ECBEAB9F95437D7A77D1FF09FA2B76253609B7D5680D69A8B5C5EF2E2
+% 1C1C0B3D36B6BD9B5CC737D5DEFF0057F47FA3FD1D9EA7E8ABD79395632E0D66
+% 3BB229ADA1D5B6F2E0DC92DF55F8D73FD0DF554D63F19F5DFE97AD6557FA9F63
+% AFF47EB171B2F172D86CC5BABBD836CBAA7078F73597D7EE6177D3A6DAAE67FC
+% 15B5D8963E3578FEA7A66C77AD63AD77A963ED873BE90AFD77D9E8D5FB9453B2
+% 8AFF00C1D692932A36B6D3D6B15E321ADA8636487E29790E7B8D985E9E4368FA
+% 363319ADB6B7DBFE07ED55FF00A757941F4D563AB7D8C6BDD4BB7D4E7004B5C5
+% AEAB7D64FD07FA56595FF52C494FFFD4F55497CAA924A7EAA497CAA924A7E9FE
+% A7F60FB333EDFF00CCFDA31F67D2FE7BD7A7EC3FCD7BBFA6FD9FFE0FFD37E897
+% 0B9DFF00337F66667ED2F53D2FD98CFB57A7FB33ED1B3D6A7F677FC8DFACFABB
+% 7F677D8BFEF13EC9F63FB4FE937AF1A49253EFEDFF009B7F6CCB9FB47D83F59F
+% B4FAB1F66F57ED54FED6F4FD7FF2A7D93ED5E8FED3FB3FFD8CFA3EAFDB3FC3A4
+% 7FE6DFDBDBF61FB47F48C3FB37D8A3ECFEB6DC4FE89B7F47FF0022FD8BED9B7F
+% 47FB0BEDBFB3BFEF6D78024929FA519FF2553B3EDFEA7E97EC7BBFA4FD0BFECF
+% EB7ADFABFF0047FE8DFB73FC37D97F69FF009492FF00217D8FF53FE8DDFF0066
+% FA9FF717F47BBF657BFF00E4DF47EC9BBFEE87D97F58FB0AF9AD2494FD2985FB
+% 0BF6AB7D1FF95BEC14C7AFEA7DA7EC7BECF4777DB3F58FE91BFED5BFF58F5BD1
+% FB77FDA75ACBE5549253F5524BE5549253FFD9003842494D03FD000000000006
+% 000000000000
+%EndPhotoshop
+gsave % EPS gsave
+40 dict begin
+/_image systemdict /image get def
+/_setgray systemdict /setgray get def
+/_currentgray systemdict /currentgray get def
+/_settransfer systemdict /settransfer get def
+/_currenttransfer systemdict /currenttransfer get def
+/blank 0 _currenttransfer exec
+1 _currenttransfer exec eq def
+/negative blank
+{0 _currenttransfer exec 0.5 lt}
+{0 _currenttransfer exec 1 _currenttransfer exec gt}
+ifelse def
+/inverted? negative def
+/level2 systemdict /languagelevel known
+{languagelevel 2 ge} {false} ifelse def
+/level3 systemdict /languagelevel known
+{languagelevel 3 ge} {false} ifelse def
+gsave % Image Header gsave
+/rows 314 def
+/cols 415 def
+415 314 scale
+level2 {
+/DeviceGray
+setcolorspace currentdict /PhotoshopDuotoneColorSpace undef currentdict /PhotoshopDuotoneAltColorSpace undef } if
+/picstr1 52 string def
+/readdata {currentfile exch readhexstring pop} def
+/image2 level2 {/image load def} {{begin
+Width Height BitsPerComponent ImageMatrix
+/DataSource load image end} def} ifelse
+/beginimage {
+image2
+} def
+12 dict begin
+/ImageType 1 def
+/Width cols def
+/Height rows def
+/ImageMatrix [cols 0 0 rows neg 0 rows] def
+/BitsPerComponent 1 def
+/Decode [0 1] def
+/DataSource {picstr1 readdata} def
+currentdict end
+%%BeginBinary:      33691
+beginimage
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFEFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFEFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFEFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFEFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFEFFFFFFFFFF7E3FFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFE
+FFFFFFFFFF789FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFC7BDFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFD7BFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFEFFFFFFFF
+FF703FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF719FFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFEFFFFFFFFFF73DFE00000000000000000000000000000000000000000
+000000000000000000000000000000000000000000003FFFFFFFFFFFFF7BDFC0
+0000000000000000000000000000000000000000000000000000000000000000
+000000000000000000003FFFFFFFFFFFFF7BDFC0000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000003FFE
+FFFFFFFFFF799FC7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FF7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFEFFFFFFFFFF7E7FC7FFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF7FFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFF3FFFFFFFFFFFFFFFFFC7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFF7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFFFFFFFF
+FFFFFFC7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF7FFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFEFFFFFFFFFFFFFFC7FFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF7FFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFF3FFFFFFFFFFFFFFFFFC7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFF7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFFFFFFFFFFFFFFC7
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFF3FFFFFFFFFFFFFFFFFC7FFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFE
+FFFFFFFFFFFFFFC7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFEFFFFFFFFFFFFFFC7FFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFF3FFFFFFFFFFFFFFFFFC7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFEFFFFFFFF
+FFFFFFC7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFEFFFFFFFFFFFFFFC7FFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFF3FFEFFFFFFFFFFFFFFC7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFEFFFFFFFFFFFFFFC7
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFF3FFEFFFFFFFFFFFFFFC7FFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFE
+FFFFFFFFFFFFFFC7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFEFFFFFFFFFFFFFFC7FFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFF3FFEFFFFFFFFFFFFFFC7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFEFFFFFFFF
+FFFFFFC7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFFFFFFFFFFFFFFC7FFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FF0F3FFFFFFFFFFFFF7FBFC7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFE073FFFFFFFFFFFFE7F3FC7
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFE073FFEFFFFFFFFFC7E3FC7FFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFE073FFE
+FFFFFFFFFF7EBFC7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFE073FFEFFFFFFFFFF7DBFC7FFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFF0F3FFEFFFFFFFFFF79BFC7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF1FFFFFF3FFFFFFFFFFF
+FF7BBFC7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFE0FFFFFF3FFEFFFFFFFFFF701FC03FFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFC07F
+FFC03FFEFFFFFFFFFF7FBFC7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFC07FFFFF3FFFFFFFFFFFFF7FBFC7
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFE07FFFFF3FFEFFFFFFFFFFFFFFC7FFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFE0FFFFFF3FFF
+FFFFFFFFFFFFFFC7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFBFFFFFF3FFEFFFFFFFFFFFFFFC7FFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+1FFFFFFFFFFF3FFFFFFFFFFFFFFFFFC7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFE0FFFFFFFFFFF3FFEFFFFFFFF
+FFFFFFC7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFC0FFFFFFFFFFF3FFEFFFFFFFFFFFFFFC7FFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFC0FFFFFFF
+FFFF3FFEFFFFFFFFFFFFFFC7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFC0FFFFFFFFFFF3FFEFFFFFFFFFFFFFFC7
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFE0FFFFFFFFFFF3FFEFFFFFFFFFFFFFFC7FFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFE
+FFFFFFFFFFFFFFC7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFE3FFFFFFFFFFFFFFFF3FFEFFFFFFFFFFFFFFC7FFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFC1FFFF
+FFFFFFFFFFFF3FFEFFFFFFFFFFFFFFC7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFC0FFFFFFFFFFFFFFFF3FFFFFF807FF
+FFFFFFC7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFC0FFFFFFFFFFFFFFFF3FFFFFF007FFFFFFFFC7FFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFC0FFFFFFFFFFFF
+FFFF3FFEFFE7FFFFFFFFFFC7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFC1FFFFFFFFFFFFFFFF3FFFFFE7FFFFFFFFFFC7
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFE3FFFFFFFFFFFFFFFF3FFEFFF7FFFFFFFFFFC7FFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFE
+FFFBFFFFFFFFFFC7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFC3FFFFFFFFFFFFFFFFFFFFF3FFEFFF007FFFFFFFFC7FFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF81FFFFFFFFF
+FFFFFFFFFFFF3FFFFFF3FFFFFFFFFFC7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFF81FFFFFFFFFFFFFFFFFFFFF3FFEFFE7FFFF
+FF783FC7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFF81FFFFFFFFFFFFFFFFFFFFF3FFFFFF7FFFFFE7B9FC7FFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF81FFFFFFFFFFFFFFFFF
+FFFF3FFEFFF3FFFFFC7BDFC7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFC3FFFFFFFFFFFFFFFFFFFFF3FFFFFF007FFFF7FDFC7
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFF3FFEFFF007FFFF7F9FC7FFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFE7FFFFFFFFFFFFFFFFFFFFFFFFFF3FFF
+FFFFFFFFFF7F3FC7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFF83FFFFFFFFFFFFFFFFFFFFFFFFFF3FFEFF1FFFFFFF7E7FC7FFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF81FFFFFFFFFFFFFF
+FFFFFFFFFFFF3FFFFFC1FFFFFF7DFFC7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFF01FFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFFF83FFF
+FF79FFC7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+01FFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFFFF87FFFF701FC7FFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF83FFFFFFFFFFFFFFFFFFFFFF
+FFFF3FFFFFFFF7FFFFFFFFC7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFE7FFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFFFFE7FFFFFFFFC7
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFF3FFFFFFF07FFFFFFFFC7FFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFEFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFF
+FFFC3FFFFFFFFFC7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFF83FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFFE17FFFFFFFFFC7FFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF03FFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFF3FFFFF877FFFFFFFFFC7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFF03FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFF3F7FFF
+FFFFFFC7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF03FFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFF877FFFFFFFFFC7FFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF83FFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFF3FFFFFF17FFFFFFFFFC7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFCFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFFFC3FFFFFFFFFC7
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFF3FFFFFFF07FFFFFFFFC7FFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFF
+FFFFE7FFFFFFFFC7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF87
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFFFFFFFFFFFFFFC7FFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF03FFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFF3FFFFFF7E7FFFFFFFFC7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFF03FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFFF38FFF
+FFFFFFC7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF03FFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFFF91FFFFFFFFFC7FFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFF03FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFF3FFFFFF87FFFFFFFFFC7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFF07FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFFFCFFFFFFFFFFC7
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFF3FFFFF0007FFFFFFFFC7FFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFF
+FF0007FFFFFFFFC7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFFFFFFFFFF7C3FC7FFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF0FFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFF3FFFFFFFFFFFFE79DFC7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFE07FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFFFFFFFF
+FD7BDFC7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFE07FFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFFFFFFFFFF7BDFC7FFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFE07FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFF3FFFFFFFFFFFFF7BDFC7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+E07FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFFFFFFFFFF7BDFC7
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF0FFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFF3FFFFFFFFFFFFF7BDFC7FFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFE3FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFF
+FFFFF7FFFF7BDFC7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFC1FFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFFFFC1FFFF799FC7FFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFF80FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFF3FFFFFFFEDFFFF7C3FC7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFF80FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFFFFFFFF
+FFFFFFC7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF80FFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFFFFFFFFFFFFFFC7FFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFC1FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFF3FFFFFFFFFFFFFFFFFC7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFDFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFFF007FFFFFFFFC7
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF87FFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFF3FFFFFF3FFFFFFFFFFC7FFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFF03FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFF
+FFE7FFFFFFFFFFC7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF03FFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFFF7FFFFFFFFFFC7FFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFF03FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFF3FFFFFF7FFFFFFFFFFC7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FF03FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFFF007FF
+FFFFFFC7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF87FFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFFF007FFFFFFFFC7FFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFBFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFF3FFFFFFFFFFFFFFFFFC7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFE0FFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFFFFFFFFFFFFFFC7
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFC0FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFF3FFFFFF81FFFFFFFFFC7FFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFC0FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFF
+FFF18FFFFFFFFFC7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFC0FFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFFF7E7FFFFFFFFC7FFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFE0FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFF3FFFFFE7F7FFFFFFFFC7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF1
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFFE7F7FF
+FFFFFFC7FFFFFFFFFFFFFFFFFFFFFFFFFFFEFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFFF7E7FFFFFFFFC7FFFFFFFFFFFFFFFF
+FFFFFFFFFFF83FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFF3FFFFFF18FFFFFFFFFC7FFFFFFFFFFFFFFFFFFFFFFFFFFF81FFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFFF81FFFFFFE7FC7
+FFFFFFFFFFFFFFFFFFFFFFFFFFF01FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFF3FFFFFFFFFFFFFF99FC7FFFFFFFFFFFFFFFFFFFFFFFF
+FFF01FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFF
+FFFFFFFFFFFBDFC7FFFFFFFFFFFFFFFFFFFFFFFFFFF81FFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFF3007FFFFF9DFC7FFFFFFFF
+FFFFFFFFFFFFFFFFFFFC7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFF3FFFFFFFFFFFFFFC3FC7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFFFFFFFF
+FFFC3FC7FFFFFFFFFFFFFFFFFFFFFFFF9FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFFF7F7FFFFFBDFC7FFFFFFFFFFFFFFFF
+FFFFFFFE0FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFF3FFFFFF7E7FFFFFBDFC7FFFFFFFFFFFFFFFFFFFFFFFE07FFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFF8007FFFFFBDFC7
+FFFFFFFFFFFFFFFFFFFFFFFE07FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFF3FFFFFF7FFFFFFF99FC7FFFFFFFFFFFFFFFFFFFFFFFE
+07FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFF
+FFFFFFFFFFFC3FC7FFFFFFFFFFFFFFFFFFFFFFFE0FFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFFFFF7FFFFFFFFC7FFFFFFFF
+FFFFFFFFFFFFFFFF9FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFF3FFFFFF007FFFFFFFFC7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFFF00FFF
+FFFFFFC7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFFE66FFFFFFFFFC7FFFFFFFFFFFFFFFF
+FFFFC1FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFF3FFFFFE777FFFFFFFFC7FFFFFFFFFFFFFFFFFFFF81FFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFFF777FFFFFFFFC7
+FFFFFFFFFFFFFFFFFFFF81FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFF3FFFFFF367FFFFFFFFC7FFFFFFFFFFFFFFFFFFFF81FF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFF
+FFFB0FFFFFFFFFC7FFFFFFFFFFFFFFFFFFFF81FFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFFFFDFFFFFFFFFC7FFFFFFFF
+FFFFFFFFFFFFC3FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFF3FFFFFFFFFFFFFFFFFC7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFFF3E7FF
+FFFFFFC7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFFF1E7FFFFFFFFC7FFFFFFFFFFFFFFFF
+F8FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFF3FFFFFF4E7FFFFFFFFC7FFFFFFFFFFFFFFFFF07FFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFFF667FFFFFFFFC7
+FFFFFFFFFFFFFFFFF03FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFF3FFFFFF727FFFFFFFFC7FFFFFFFFFFFFFFFFE03FFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFF
+FFF787FFFFFFFFC7FFFFFFFFFFFFFFFFF03FFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFFF7C7FFFFFFFFC7FFFFFFFF
+FFFFFFFFF07FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFF3FFFFFFFFFFFFFFFFFC7FFFFFFFFFFFFFFFFF9FFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFFFFFFFF
+FFFFFFC7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFF3007FFFFFE3FC7FFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFF3FFFFFFFFFFFFFF99FC7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFFFFFFFFFFFBDFC7
+FFFFFFFFFFFFFE1FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFF3FFFFFF7F7FFFFFB7FC7FFFFFFFFFFFFFC0FFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFF
+FF8007FFFFF01FC7FFFFFFFFFFFFFC0FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFF800FFFFFF3DFC7FFFFFFFF
+FFFFFC0FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFF3FFFFFF7FFFFFFF3DFC7FFFFFFFFFFFFFC0FFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFFFFFFFF
+FFFBDFC03FFFFFFFFFFFFE1FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFC03FFFFFFC5FFFFFFBDFC7FFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFF3FFFFFF84FFFFFFC3FC7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFFF267FFFFFFFFC7
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFF3FFFFFF677FFFFFFFFC7FFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFF
+FFF677FFFFFFFFC7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFFF667FFFFFFFFC7FFFFFFFF
+FF83FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFF3FFFFFF24FFFFFFFFFC7FFFFFFFFFF03FFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFFF80FFF
+FFFFFFC7FFFFFFFFFF01FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFFFFFFFFFFFFFFC7FFFFFFFFFF01FFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFF3FFFFFFFFFFFFFFFFFC7FFFFFFFFFF83FFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFFF807FFFFFFFFC7
+FFFFFFFFFF87FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFF3FFFFFF007FFFFFFFFC7FFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFF
+FFF7FFFFFFFFFFC7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFFF7FFFFFFFFFFC7FFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFF3FFFFFF7FFFFFFFFFFC7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFFFBFFFF
+FFFFFFC7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFFF007FFFFFFFFC7FFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFF3FFFFFFFFFFFFFFFFFC7FFFFFFF1FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFFFFFFFFFFFFFFC7
+FFFFFFE0FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFF3FFFFFFFFFFFFFFFFFC7FFFFFFC07FFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFF
+FFF001FFFFFFFFC7FFFFFFC07FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFFF98CFFFFFFFFC7FFFFFFC0
+7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFF3FFFFFF7E6FFFFFFBFC7FFFFFFE0FFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFFF7F67F
+FFFF3FC7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFFF7E67FFFFE3FC7FFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFF3FFFFFF3E6FFFFFEBFC7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFFF80CFFFFFDBFC7
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFF3FFFFFFE7FFFFFFBBFC7FFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFF
+FFFFFFFFFFF01FC7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFFFC07FFFFF01FC7FFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFF3FFFFFF007FFFFFFBFC7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFFF24FFF
+FFFFBFC7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFFF767FFFFFFFFC7FFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFF3FFFFFF777FFFFFFFFC7FFF83FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFFF777FFFFFFFFC7
+FFF81FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFF3FFFFFF127FFFFFFFFC7FFF81FFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFF
+FFFB8FFFFFFFFFC7FFF81FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFFFFFFFFFFFFFFC7FFF81FFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFF3FFFFFFFFFFFFFFFFFC7FFFC3FFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFF8007FF
+FFFFFFC7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFF8007FFFFFFFFC7FFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFF3FFFFF87FFFFFFFFFFC7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFFF0FFFFFFFFFFC7
+FF3FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFF3FFFFFFE1FFFFFFFFFC7FC0FFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFF
+FFFFC7FFFFFFFFC7FC0FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFFFF87FFFFFFFFC7FC0FFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFF3FFFFFFC1FFFFFFFFFC7FC0FFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFFE0FFFF
+FFFFFFC7FC0FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFF8FFFFFFFFFFFC7FF3FFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFF3FFFFF8007FFFFFFFFC7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFF8007FFFFFFFFC7
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFF3FFFFFFFFFFFFFFC7FC7FFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFF
+FFFFFFFFFFF81FC7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFFFFFFFFFFFBDFC7FFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFF3FFFFFFFFFFFFFFFDFC7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFFFFFFFF
+FFFF9FC70FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFFFFFFFFFFFFBFC607FFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFF3FFFFFFFFFFFFFFF7FC607FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFFFFFFFFFFFEFFC6
+07FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFF3FFFFFFFFFFFFFF9FFC607FFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFF
+FFFFFFFFFFFBFFC707FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFFFFFFFFFFF01FC7FFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFF3FFFFFFFFFFFFFFFFFC7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFFFFFFFF
+FFFFFFC7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFFFFFFFFFFFFFFC07FFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFF3FFFFFFFFFFFFFFFFFC03FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFFFFFFFFFFFFFFC0
+3FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFF3FFFFFFFFFFFFFFFFFC03FFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFF
+FFFFFFFFFFFFFFC03FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFFFFFFFFFFFFFFC07FFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFF3FFFFFFFFFFFFFFFFFC7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFFFFFFFF
+FFFFFFC7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFFFFFFFFFFFFFFC7FFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFF3FFFFFFFFFFFFFFFFFC7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFFFFFFFFFFFFFFC7
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFF3FFFFFFFFFFFFFFFFFC7FFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFF
+FFFFFFFFFFFFFFC7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFFFFFFFFFFFFFFC7FFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFF3FFFFFFFFFFFFFFFFFC7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFFFFFFFF
+FFFFFFC7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFFFFFFFFFFFFFFC7FFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFF3FFFFFFFFFFFFFFE7FC7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFFFFFFFFFFFC9FC7
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF7FFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFF3FFFFFFFFFFFFFFBDFC7FFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFF7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFF
+FFFFFFFFFFFBDFC7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FF7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFFFFFFFFFFFBDFC7FFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF7FFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFF3FFFFFFFFFFFFFFBDF83FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFF7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFFFFFFFF
+FFFBDF0000000000000000000000000000000000000000000000000000000000
+00000000000000000000000000003FFFFFFFFFFFFFFBDF000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+00003FFFFFFFFFFFFFFBDF000000000000000000000000000000000000000000
+000000000000000000000000000000000000000000003FFFFFFFFFFFFFF99F83
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFC3F83FFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF83FFFFFFFFFFFFFFFF
+7FFFFFFFFFFFFFFF83FFFFFFFFFFFFFFFC3FFFFFFFFFFFFFFFF9FFFFFFFFFFFF
+FFFE0FFFFFFFFFFFFFFFFFBBFFFFFFFFFFFFFFFE7FFFFFFFFFFFFFFFB9FFFFFF
+FFFFFFFFF99FFFFFFFFFFFFFFFF9FFFFFFFFFFFFFFFEFFFFFFFFFFFFFFFFFF3B
+FFFFFFFFFFFFFFF97FFFFFFFFFFFFFFF3DFFFFFFFFFFFFFFFFDFFFFFFFFFFFFF
+FFF5FFFFFFFFFFFFFFFCFFFFFFFFFFFFFFFFFF7DFFFFFFFFFFFFFFFB7FFFFFFF
+FFFFFFFFFDFFFFFFFFFFFFFFFF9FFFFFFFFFFFFFFFE5FFFFFFFFFFFFFFFD3FFF
+FFFFFFFFFFFFFF7DFFFFFFFFFFFFFFFF7FFFFFFFFFFFFFFFFBFFFFFFFFFFFFFF
+FF3FFFFFFFFFFFFFFFCDFFFFFFFFFFFFFFFCCFFFFFFFFFFFFFFFFF7DFFFFFFFF
+FFFFFFFF7FFFFFFFFFFFFFFFF3FFFFFFFFFFFFFFFFDFFFFFFFFFFFFFFFDDFFFF
+FFFFFFFFFFFFEFFFFFFFFFFFFFFFFF7DFFFFFFFFFFFFFFFF7FFFFFFFFFFFFFFF
+E7FFFFFFFFFFFFFFFFCFFFFFFFFFFFFFFFBDFFFFFFFFFFFFFFFFEFFFFFFFFFFF
+FFFFFF39FFFFFFFFFFFFFFFF7FFFFFFFFFFFFFFFDFFFFFFFFFFFFFFFFBCFFFFF
+FFFFFFFFFF80FFFFFFFFFFFFFFFDEFFFFFFFFFFFFFFFFFBBFFFFFFFFFFFFFFFF
+7FFFFFFFFFFFFFFFBFFFFFFFFFFFFFFFF9DFFFFFFFFFFFFFFFFDFFFFFFFFFFFF
+FFFDCFFFFFFFFFFFFFFFFF83FFFFFFFFFFFFFFFF7FFFFFFFFFFFFFFF01FFFFFF
+FFFFFFFFFC1FFFFFFFFFFFFFFFFDFFFFFFFFFFFFFFFE1FFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFF7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFE7FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFC7FFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF3FFFFFE67FFF
+CFE00DFFE7FBFFFE7E1FD7FF9FEFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFE3FFFFFE7FFFFCFE7FFFFE7FBFFFC7CCFB7FF
+1FEFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFE9FFFFFE7FFFFCFE7FFFFE7FBFFF879EF77FF4FCFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFCDF4380E6707C0FE7FDE0
+E70BFFF679EE03FE6FDD087FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFDCF198C6667398FE7FDCCE663FFFE7BE603FEEFDCC33F
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFDCF3D
+9E666FB3CFE01D9E66F3FFFE7BE7F7FEE7DDE7BFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF9EF7C9E666F93CFE01DBF64F3FFFE
+7BE7F7FCF79DE7BFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFF8077C9F664013CFE7FD8064FBFFFE7BE7FFFC07BDE7BFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFBF77C9F664FF3
+CFE7FDBFE4FBFFFE79EFFFF9F3BDE7BFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFF3F33D9E666F93CFE7FD9E66F3FFFE79EFFFFB
+F93DE7BFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFF7F3198CE667398FE7FDCC66633FFE7CCFFFFBF97DE7BFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFE7FB0380E670780FE7FDC0
+E70B1FFE7C1FFFF3F97DE7BFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFF7F9FFFFFFFFFFFFFFFFFFF9FFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF7F
+9FFFFFFFFFFFFFFFFFFF9FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF7F9FFFFFFFFFFFFFFFFFFF3FFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFF7F9FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+FFFFFFFFFFFFFFFF
+
+%%EndBinary
+grestore end % Image Trailer grestore
+grestore % EPS grestore
diff --git a/Master/texmf-dist/doc/latex/aiaa/figure_magnet.pdf b/Master/texmf-dist/doc/latex/aiaa/figure_magnet.pdf
new file mode 100644
index 00000000000..5219f2d39d2
--- /dev/null
+++ b/Master/texmf-dist/doc/latex/aiaa/figure_magnet.pdf
diff --git a/Master/texmf-dist/doc/latex/aiaa/pre2004/CHANGES b/Master/texmf-dist/doc/latex/aiaa/pre2004/CHANGES
new file mode 100644
index 00000000000..04cd691599d
--- /dev/null
+++ b/Master/texmf-dist/doc/latex/aiaa/pre2004/CHANGES
@@ -0,0 +1,84 @@
+This is the file `CHANGES', which accompanies the `aiaa' distribution,
+version 2.4, dated 1999/02/22 by bil kleb <w.l.kleb@larc.nasa.gov>
+
+v2.4 (1999/02/22)
+
+     fixed \\ errors if some fields were left undefined for article
+     or note options
+
+     changed reprint copy on cover
+
+     moved manifest to its own file
+
+v2.3 (1999/02/22) [never released to CTAN]
+
+     web address
+
+     caption label delimeter for submit class
+
+     played with table of content listings for subfigures under
+     submit class
+
+v2.2 (1998/09/09) [never released to CTAN]
+
+     title/author set to raggedright in makecover for articles/notes
+
+     the field of journalissue to exclude page range, plus...
+     
+     added \JournalPage command to indicate starting page of journal
+     article/note.  now the page range on the cover and page numbers
+     of the document are accounted for automatically
+
+v2.1 (1998/08/04)
+
+     added note about web site home
+
+     zip code for aiaa
+
+     belowcaptionskip for tables
+
+v2.0 (1998/02/28)
+
+  patch level 1: (1998/03/02)
+
+     version numbers
+
+     updated typeouts
+
+  patch level 0:
+
+     font sizes and positions of various elements on the
+     cover page for conference papers.
+
+     eliminated extraneous \endinput from the end of aiaa.bst
+
+     new zip code for AIAA
+
+     updated AIAA logo
+
+     added a space between copyright symbol and year in copyright
+     notices a, b, and d
+
+     added more journal abbreviations to bibliographic style
+
+     added \thanksibid command
+
+     units used in creating the cover pages to inches
+
+
+v1.0 (1997/03/03)
+
+     added subfigmatrix environment to make "tables" of figures
+
+     \Figure and \Reference commands eliminated
+
+     \incfig command modified to be simplier, less intrusive.
+     in fact, now it is really just a shorter version of the
+     antecedent \includegraphics
+
+     subfigure caption skips
+
+
+v0.9 (1997/02/20)
+
+     initial release
diff --git a/Master/texmf-dist/doc/latex/aiaa/pre2004/MANIFEST b/Master/texmf-dist/doc/latex/aiaa/pre2004/MANIFEST
new file mode 100644
index 00000000000..081c38ab41d
--- /dev/null
+++ b/Master/texmf-dist/doc/latex/aiaa/pre2004/MANIFEST
@@ -0,0 +1,39 @@
+This is the file `MANIFEST', which accompanies the `aiaa' distribution,
+version 2.4, dated 1999/02/22 by bil kleb <w.l.kleb@larc.nasa.gov>
+
+The `aiaa' distribution consists of several files.  the first three
+are the core, and the rest are examples and test equipment:
+
+  main directory:
+
+    aiaa.ins      - the installation driver for aiaa.dtx
+    aiaa.dtx      - instructions on how to use the new class,
+                    the code itself, the 9pt style, and the
+                    bibliographic style sheet, all in
+                    `docstrip'-able format
+    aiaalgo.eps   - the aiaa logo in encapsulated postscript format
+    demos         - directory of samples and test equipment
+
+  demos/paper subdirectory:
+  
+    smpaiaa.tex   - a sample document
+    smpfig.eps    - a sample figure
+    smpbtx.bib    - a sample BibTeX database for use with smpaiaa.tex
+
+  demos/subfigs directory:
+
+    smpsubf.tex   - a sample document devoted entirely to various
+                    subfigure layouts
+    smpfig.eps    - a sample figure
+
+  demos/talk subdirectory:
+
+    smptalk.tex   - a sample presentation using `slides' class
+    smptalk.sty   - a sample package for use with smptalk.tex
+    smpfig.eps    - a sample figure
+
+  demos/refs subdirectory:
+
+    tstref.tex    - an additional document made for specifically
+                    testing the aiaa bibliographic style
+    tstbtx.bib    - the BibTeX database that goes with aiaaref.tex
diff --git a/Master/texmf-dist/doc/latex/aiaa/pre2004/README b/Master/texmf-dist/doc/latex/aiaa/pre2004/README
new file mode 100644
index 00000000000..0cb5a5d5015
--- /dev/null
+++ b/Master/texmf-dist/doc/latex/aiaa/pre2004/README
@@ -0,0 +1,57 @@
+This is the file `README', which accompanies the `aiaa' distribution,
+version 2.4, dated 1999/02/22 by bil kleb <w.l.kleb@larc.nasa.gov>
+
+INTRODUCTION:
+
+This distribution is centered around a modification to the standard article
+document class to produce (nearly) aiaa-conformant conference papers
+and journal submittals---it will even simulate the typesetting
+of journal articles and notes for length-determination
+purposes.  The distribution also contains a (mostly) aiaa-compliant
+bibliographic style sheet for use with BibTeX, a 9pt style sheet,
+a sample document, a sample presentation, and other miscellaneous
+examples and test equipment.
+
+USER'S MANUAL:
+
+To produce a users' manual, run LaTeX on `aiaa.dtx'.
+
+INSTALLATION:
+
+To obtain the individual files which are part of the aiaa package,
+run LaTeX on the installation file, `aiaa.ins'.  LaTeX's docstrip
+utility will extract the files from `aiaa.dtx'.
+
+DISTRIBUTING:
+
+You are free to re-distribute these files provided the restrictions
+mentioned in 'aiaa.ins' are obeyed.  These are mainly that the
+three core files always must be distributed as a whole and that
+no one is allowed to distribute the files for profit.
+
+REQUIREMENTS:
+
+This package relies on the presence of a number of other packages:
+
+   caption2     dropping     endfloat     fancyhdr
+   graphicx     lastpage     setspace     subfigure
+
+Most come bundled with the various (La)TeX distributions, others
+are available from any CTAN site or its mirrors---see the users'
+manual for more information on CTAN.  Typically you'll need
+to get `dropping' and `caption2'.
+
+DISCLAIMER:
+
+This distribution is not connected with the AIAA in any way, it
+simply represents the product of several people's efforts to
+create a usable AIAA LaTeX2e template for conference papers
+and journal submissions.
+
+WEBSITE:
+
+http://abweb.larc.nasa.gov:8080/~kleb/aiaa/
+
+INQUIRIES:
+
+Inquiries can be sent to:  <w.l.kleb@larc.nasa.gov>
diff --git a/Master/texmf-dist/doc/latex/aiaa/pre2004/aiaa.dtx b/Master/texmf-dist/doc/latex/aiaa/pre2004/aiaa.dtx
new file mode 100644
index 00000000000..116a768eed3
--- /dev/null
+++ b/Master/texmf-dist/doc/latex/aiaa/pre2004/aiaa.dtx
@@ -0,0 +1,2995 @@
+%
+% \iffalse
+%% Description: a bundle of LaTeX and BibTeX files to produce
+%%              AIAA papers and simulated journal articles/notes
+%% Keywords: LaTeX, class, AIAA, BibTeX, bibliographic-style, 9pt-option
+%% Author: Bil Kleb <w.l.kleb@larc.nasa.gov>
+%% Maintainer: same
+%% Version: 2.4 <22 feb 1999>
+%%
+%% Please see the information in file `aiaa.ins' on how you
+%% may use and (re-)distribute this file.  Run LaTeX on the file 
+%% `aiaa.ins' to get the main aiaa class and other auxilary packages.
+%% Also run LaTeX on `aiaa.dtx' (this file) to obtain a users manual
+%% and code documentation.
+%%
+%% NOTE: This file may NOT be distributed if not accompanied
+%%       by 'aiaa.ins' and `aiaalgo.eps'.
+% \fi
+%
+% \def\filename{aiaa.dtx}
+% \def\fileversion{2.4}
+% \def\filedate{1999/02/22}
+% \def\docdate{\filedate}
+% \date{\docdate}
+%
+% \newcommand*{\cls}[1]{\textsl{#1}}
+% \newcommand*{\pkg}[1]{\textsf{#1}}
+% \newcommand*{\file}[1]{\texttt{#1}}
+% \newcommand*{\kbd}[1]{\texttt{#1}}
+% \setcounter{errorcontextlines}{10}
+%
+% \MakeShortVerb{\|}
+%
+%  \CheckSum{1685}
+%% \CharacterTable
+%%  {Upper-case    \A\B\C\D\E\F\G\H\I\J\K\L\M\N\O\P\Q\R\S\T\U\V\W\X\Y\Z
+%%   Lower-case    \a\b\c\d\e\f\g\h\i\j\k\l\m\n\o\p\q\r\s\t\u\v\w\x\y\z
+%%   Digits        \0\1\2\3\4\5\6\7\8\9
+%%   Exclamation   \!     Double quote  \"     Hash (number) \#
+%%   Dollar        \$     Percent       \%     Ampersand     \&
+%%   Acute accent  \'     Left paren    \(     Right paren   \)
+%%   Asterisk      \*     Plus          \+     Comma         \,
+%%   Minus         \-     Point         \.     Solidus       \/
+%%   Colon         \:     Semicolon     \;     Less than     \<
+%%   Equals        \=     Greater than  \>     Question mark \?
+%%   Commercial at \@     Left bracket  \[     Backslash     \\
+%%   Right bracket \]     Circumflex    \^     Underscore    \_
+%%   Grave accent  \`     Left brace    \{     Vertical bar  \|
+%%   Right brace   \}     Tilde         \~}
+%
+% \title{%
+% \textsf{aiaa} -- a \LaTeX{} Class and \BibTeX{}
+% Style\\ for AIAA\thanks{The American Institute of Aeronautics
+% and Astronautics.}\ \ Conference Papers\\ and Journal
+% Submission/Simulation\thanks{This document describes \textsf{aiaa} version 
+% \fileversion which was born on \docdate .}}
+%
+% \author{bil kleb\thanks{Research Scientist, NASA Langley
+% Research Center, Hampton, Virginia.}}
+%
+% \maketitle
+%
+% \begin{abstract}
+% This document describes the \textsf{aiaa} distribution which 
+% is centered around a modification of the standard \LaTeX{}
+% article class, \cls{article.cls}.  The new class produces
+% AIAA-conformant\footnote{Note this distribution is not a
+% product of, nor endorsed by, the AIAA.}
+% conference papers and journal submittals---it
+% will even simulate the typesetting of journal articles and notes
+% for length-determination purposes.  This distribution also contains
+% a (mostly) AIAA-compliant bibliographic style sheet,
+% sample documents, a sample presentation, and other test equipment.
+% \end{abstract}
+%
+% \tableofcontents
+%
+% \section{Introduction}
+%
+% The \textsf{aiaa} distribution consists of a \LaTeX{} class
+% and various other files which are supposed to simplify
+% the task of producing an AIAA conference paper
+% and the subsequent journal submission
+% For instance, with a simple,
+% one-word option in the beginning of the document, a manuscript can
+% take the form of a two-column conference paper replete with
+% cover-page or a double-spaced journal submission manuscript
+% with figures and tables at the end, including the required
+% caption lists.
+%
+% \section{Userguide}
+%
+% I apologize for the sparseness of this documentation; but, hey,
+% this is not in my job description.\ |;)|\ \ Hopefully the sample
+% documents \file{smpaiaa.tex}, \file{smpsubf.tex}, and \file{smptalk.tex}
+% provide suitable documentation through example.
+%
+% \subsection{Requirements}
+%
+% The \kbd{aiaa} distribution was developed using
+% \LaTeXe{} of 1995/12/01, patch level 1,
+% running \TeX{} 3.14159 and
+% \texttt{dvips} 5.58f---the te\TeX{} distribution 0.3.3.\footnote{
+% The \kbd{aiaa} distribution has also been demonstrated on
+% a Mac running the {\scshape Oz}\TeX{} \TeX{} distribution and a
+% PC running the Mik\TeX{} \TeX{} distribution.}
+% So anything more recent should work, but anything older: no guarantees.
+% In particular, your \kbd{graphicx} package needs
+% to be newer than September 1995 so that the |keepaspectratio|
+% command is available.
+%
+% The \cls{aiaa} class depends
+% on having access to a number of packages.\footnote{When you process
+% a file with \LaTeX{}, it will let you which packages it is
+% missing.  The less common ones are \pkg{dropping} and \pkg{caption2} while
+% the other required packages:
+% \pkg{lastpage}, \pkg{setspace}, \pkg{endfloat}, \pkg{overcite},
+% \pkg{graphicx}, and \pkg{fancyhdr} are usually bundled with
+% most \LaTeX{} distributions.}
+% If your local site does not have all the packages necessary, they
+% can be obtained from your nearest Comprehensive TeX Archive
+% Network (CTAN) site.  In fact, chances are that this is where you found
+% this distribution.  Details on how to obtain packages from a
+% CTAN site are available at |http://www.tug.org/|
+% or various \LaTeX{} reference books~\cite{companion,guide}.
+% Especially helpful in locating various \LaTeX{} packages is
+% the \kbd{Catalogue.html} web page found in the \kbd{help/Catalogue}
+% directory of CTAN.
+%
+% \subsection{Setup}
+%
+% If you have not already run \file{aiaa.ins} through \LaTeX{},
+% do so.  The \pkg{docscript} utility (part of \LaTeX{})
+% will rip the code segments out of \file{aiaa.dtx}
+% and save them in several files. If you encounter an error
+% on installation like:
+% \begin{verbatim}
+% ! Undefined control sequence
+% \batchLine -> generate
+%          {\file {aiaa.cls}{\from{aiaa.dtx}{class}}}
+%  1.728 \processbatchFile
+% \end{verbatim}
+% this means that your \pkg{docstrip} is very old and that you
+% will need to update your entire \LaTeX{} distribution to
+% take advantage of the \pkg{aiaa} package.
+%
+% Move the files \file{aiaa.cls},
+% \file{aiaa9pt.sty}, \file{aiaaenf.cfg}, and \file{aiaalgo.eps}
+% to a directory searched by \TeX{}\footnote{For a Unix te\TeX{} installation,
+% a privileged user could put these files in a directory named
+% something like \kbd{/usr/local/teTeX/texmf/tex/latex/aiaa}\ for
+% the entire site to use, remembering to run \kbd{texhash} to
+% re-configure te\TeX{} to search the new directory;
+% or, a lowly user could make their own directory, {\it e.g.},
+% \kbd{$\sim$/tex/inputs}, put the files in there, and set
+% the environment variable \kbd{TEXINPUTS} via `\kbd{setenv
+% TEXINPUTS $\sim$/tex/inputs:}'. The colon represents the system search
+% path so, in this case, the user files take precedence.
+% On a Mac or PC installation put these files in
+% a folder named something like \file{TeX-inputs}.}
+% and the file \file{aiaa.bst} to
+% a directory searched by \BibTeX{}.\footnote{%
+% Similar to preceding footnote, only on Unix use
+% the environment variable \kbd{BSTINPUTS}
+% for the bibliographic style file and
+% \kbd{BIBINPUTS} for the bibliographic database; for Mac's,
+% use the \file{BibTeX-inputs} folder, failing that try
+% using the \file{TeX-inputs} folder.}
+% Once things are installed, try to \LaTeX{} the sample AIAA
+% paper in the \file{demo/paper} directory, |smpaiaa.tex|.  It should
+% produce something similar to |smpaiaa.ps|.
+% 
+% \subsection{Usage}
+% The \cls{aiaa} class is envoked by including\\
+% |  \documentclass[|{\itshape options}|]{aiaa}|\\
+% at the beginning of your document.  The package
+% recognizes the following options: |submit|, |paper|,
+% |article|, |note|, and |cover|.
+% The |paper| option is the default and the |submit| option
+% overrides any other option.  The |cover| option produces
+% a cover-page for conference papers or simulated journal
+% reprints.
+% In addition, any options that the standard \LaTeX{} article
+% class accepts can be also inserted, {\it e.g.},
+% \kbd{draft}.\footnote{The \kbd{draft}
+% option replaces figures with a labeled box of the appropriate size.}
+% Note, when using the |note|
+% option, your title and author information may need to be
+% modified with extra line breaks (|\\|)
+% since this information is no longer allowed to span both
+% columns and may overfill the short tex twidth available.
+% Other than this, the document is written just like one were
+% using the standard \LaTeX{} article document class; and thus, I
+% don't have to write much more on usage since it has already
+% been documented by others in various \LaTeX{}
+% books~\cite{companion,guide,latex}. However,
+% some of the old commands have slightly different behaviors and there are
+% a few new commands designed to make life a little brighter;
+% these are discussed in the following sections.
+%
+% \subsection{General Commands}
+%
+% Several standard \LaTeX{} commands have been modified
+% to behave differently under the new class. In addition,
+% several new commands have been introduced to ease
+% document preparation. Both types are discussed in the
+% following subsections.
+%
+% \subsubsection{New Behavior from Old Commands}
+%
+% \DescribeMacro{\abstract}
+% The |\abstract| command has been redefined within the \cls{aiaa}
+% class to behave as part of the |\maketitle| sequence.  Simply
+% load |\abstract| as you would |\title| or |\author|, and
+% as long as you have not selected the options |submit| or |note|
+% (which do not allow for abstracts), the text loaded into
+% the |\abstract| command will be typeset, indented and centered,
+% underneath the title/author section. Remember |\abstract| must
+% be loaded {\bfseries before} |\maketitle| is invoked.  This is
+% typically done in the preamble\footnote{%
+% The preamble is defined as anywhere between the
+% \cs{documentclass}\texttt{\string{\string}}
+% and \cs{begin}\texttt{\string{document\string}} commands.}
+% of your \LaTeX{} document.
+%
+% \DescribeMacro{\date}
+% The \cls{aiaa} class automatically nulls the |\date| command used
+% by |\maketitle|.  Standard \LaTeX{} behavior of |\maketitle|
+% is to typeset the current date as part of the title section
+% if one is not given. So, normal one has to issue the command:
+% |\date{}| when producing AIAA papers.  When using the
+% \cls{aiaa} class, this is no longer necessary; this command
+% has already been issued.
+%
+% \DescribeMacro{\and}
+% \DescribeMacro{\maketitle}
+% Suffice it to say that |\maketitle| and |\and| have also been
+% hacked, the ramifications of which I have yet to determine.
+%
+% \DescribeMacro{\section}
+% \DescribeMacro{\subsection}
+% \DescribeMacro{\subsubsection}
+% \DescribeMacro{\paragraph}
+% \DescribeMacro{\subparagraph}
+% One no longer has to use the starred versions of these
+% commands to defeat the numbering of sections.  The counter
+% \kbd{secnumdepth} has been set to $-2$ via,
+% |\setcounter{secnumdepth}{-2}|
+% so that even the unstarred versions of the sectioning commands
+% never produce a number.\footnote{The \kbd{secnumdepth} counter
+% controls how many
+% nesting levels of section numbers should be produced.
+% Of course you can defeat this by changing the counter back to its
+% \LaTeX{} \cls{article} class default value of $3$ which
+% will number sections down to subsections.}
+% In addition, the fonts, sizes, and positions normally produced by
+% these commands have been modified to make the output similar
+% to a typeset journal article.  In other words,
+% we take advantage of the fact that you are not using a
+% typewriter, {\it e.g.}, AIAA-suggested underlining for section
+% names, etc.{} is replaced by the typesetting-capable equivalent.
+%
+% \subsubsection{New Commands}
+%
+% \DescribeMacro{\thanksibid}
+% The command |\thanksibid| is very similar to the standard
+% |\thanks| command which is used when footnoting
+% the author affliations within the |\author| field.
+% The distinction is that the |\thanksibid| command allows one
+% to repeat a given footnote symbol without repeating the associated
+% footnote text.  Example of use:
+% \begin{verbatim}
+%   \author{%
+%  Peter Gnoffo\thanks{Some thanks for a peter.},
+%  Bil Kleb\thanks{Some thanks for a bill.},
+%  Bill Wood\thanksibid{2}, and % use same footnote as for second author.
+%  Marge Mithus\thanks{Some thanks for a marge.}
+%  }
+% \end{verbatim}
+% Thus, |\thanksibid{2}| would only produce a footnote symbol
+% at the end of Bill Wood's name and it would not generate
+% another footnote.  Note that using the |\thanksibid| command
+% does not increment the footnote counter, so for the case given
+% above, an argument of `4' would not be a valid choice.
+% This command was developed so that when you have \cls{aiaa}
+% make a cover sheet, extraneous footnote symbols will not be
+% present.
+%
+% \DescribeMacro{\dropword}
+% The command |\dropword| is used for the first word of the
+% introduction, and for any option other than |submit|, will
+% produce a `dropped' capital for the beginning of the paragraph.
+% Its use is simply:\\
+% |  \dropword First words of the introduction, etc.|\\
+% Note: this command also capitalizes the remaining
+% portion of the first word.
+% This macro relies on the presence of the |dropping| package
+% by Mats Dahlgren~\cite{dropping}.
+%
+% \DescribeMacro{\incfig}
+% The |\incfig| command is used for including figures via David Carlisle's
+% \pkg{graphicx} package~\cite{graphicx}.  The
+% command |\incfig| command is merely a shorter version of
+% the original |\includegraphics| command along with a centering
+% command, {\it i.e.}:\\
+% |   \newcommand{\incfig}{\centering\includegraphics}|\\
+% It is typically used for including Encapsulated Postscript files
+% (|*.eps|) within a |figure| environment.
+% For example, to include
+% a figure named |figa.eps| residing in a |figs| subdirectory, one
+% would use:
+% \begin{verbatim}
+%    and \Figure{f:figurea} shows that things are purple.
+%    \begin{figure}
+%       \incfig{figs/figa}
+%       \caption{This is the caption for figure a.}
+%       \label{f:figurea}
+%    \end{figure}
+%    \Figure{f:figurea} also shows that people are green.
+% \end{verbatim}
+% For more information regarding the inclusion of external
+% graphic files, see the file \file{epslatex.ps} in the \kbd{info}
+% directory of the CTAN.  Also, read the Graphics Guide that
+% is part of the \pkg{graphicx} package.
+%
+% \DescribeEnv{subfigmatrix}
+% Via the \pkg{subfigure} package and a new environment, |subfigmatrix|,
+% one can easily create a ``matrix'' of subfigures. The
+% environment takes one argument: the number of columns across
+% the matrix will be.
+% For instance, to produce a matrix of four subfigures, two by two:
+% \begin{verbatim}
+%   \begin{figure}
+%     \begin{subfigmatrix}{2}
+%        \subfigure[Subfigure one.  ]{\incfig{one}\label{f:matrix_1}}
+%        \subfigure[Subfigure two.  ]{\incfig{two}}
+%        \subfigure[Subfigure three.]{\incfig{three}}
+%        \subfigure[Subfigure four. ]{\incfig{four}\label{f:matrix_4}}
+%     \end{subfigmatrix}
+%     \caption{A `matrix' of four subfigures.}
+%     \label{f:matrix}
+%   \end{figure}
+%   and with imbedded \label commands we can refer to
+%   Figure~\ref{f:matrix} in entirety or specific subfigures like
+%   subfigure~\ref{f:matrix_1} or subfigure~\ref{f:matrix_4}.
+% \end{verbatim}
+% See the  demonstration file \file{smpsubf.tex} which comes with
+% this distribtuion for more extensive examples.
+%
+% \subsection{Layout-specific Commands}
+%
+% The following commands are used to load information for other
+% commands that produce appropriate headers, footers, cover-page
+% items, and document notices---{\it e.g.}, copyright conditions. All
+% of these commands are normally set in the preamble
+% of your document (similar to |\author| and |\title|).
+% For a more modular, and perhaps cleaner approach, you could
+% place all of it in a file, \file{preamble.tex}, and use
+% |\input{preamble}| to include it in your main document.
+%
+% \subsubsection{Header and Footer Information}
+%
+% \DescribeMacro{\SubmitName}
+% \DescribeMacro{\PaperNumber}
+% \DescribeMacro{\ArticleIssue}
+% \DescribeMacro{\ArticleHeader}
+% \DescribeMacro{\NoteHeader}
+% The commands |\SubmitName|, |\PaperNumber|, 
+% |\ArticleIssue|, |\ArticleHeader|, and
+% |\NoteHeader| are used to put appropriate items in the header
+% and footer of each page, {\it e.g.},
+% \begin{verbatim}
+%   \SubmitName{Kleb}
+%   \PaperNumber{96--0825}
+%   \ArticleIssue{Vol.~32, No.~6, November--December 1995}% first page
+%   \ArticleHeader{Kleb et al: Pitch-Over Maneuver}% subsequent pages
+%   \NoteHeader{J.Spacecraft, Vol.~32, No.~6: Engineering Notes}
+% \end{verbatim}
+% The command |\SubmitName| is used to mark the main author's
+% name on all pages for the
+% journal manuscript submission option: |submit|.  The
+% |\PaperNumber| is used to include the paper number
+% for AIAA conference papers.
+% The commands |\ArticleIssue|,
+% |\ArticleHeader|, and |\NoteHeader| are used to create
+% the appropriate headers when simulating a journal article or
+% note.  The contents of |\ArticleIssue| appear on the first page
+% and the contents of |\ArticleHeader| appear on subsequent pages while for
+% journal note simulations the contents of |\NoteHeader| is used for all pages.
+%
+% \subsubsection{Cover-page Information}
+%
+% \DescribeMacro{\CoverFigure}
+% \DescribeMacro{\Conference}
+% \DescribeMacro{\JournalName}
+% \DescribeMacro{\JournalIssue}
+% \DescribeMacro{\JournalPage}
+% The commands |\CoverFigure|,
+% |\Conference|, |\JournalIssue|, |\JournalPage|, and |\JournalName| provide
+% information for producing cover-pages.
+% \begin{verbatim}
+%   \CoverFigure{tstfig.eps}
+%   \Conference{31st AIAA Aerospace Sciences \\
+%                  Meeting and Exhibit \\
+%            {\mfseries January 6--9, 1997/Reno, NV}}% note: non-bold date/loc.
+%   \JournalName{Journal of Spacecraft and Rockets}
+%   \JournalPage{715}
+%   \JournalIssue{Volume 32, Number 6}
+% \end{verbatim}
+% The commands |\CoverFigure| and
+% |\Conference| define a representative figure (optional)
+% and conference name/date/location to be used on the cover-page
+% of a conference paper, while
+% the commands |\JournalName| and |\JournalIssue| are for the
+% cover-page produced for journal article or note reprint simulations.
+%
+% \subsubsection{Copyright and Other Document Notices}
+%
+% \DescribeMacro{\PaperNotice}
+% \DescribeMacro{\JournalNotice}
+% A footnote describing the copyright conditions
+% and other information about the document are incorporated via the
+% |\PaperNotice| and |\JournalNotice| commands.  These normally include
+% one of the the copyright series
+% of commands: |\CopyrightA|, |\CopyrightB|, |\CopyrightC|, or
+% |\CopyrightD|, described below.
+% To use, simply include something like the following in
+% the your document's preamble:
+% \begin{verbatim}
+%   \PaperNotice{\CopyrightA{1996}}
+%   \JournalNotice{Presented as Paper 96--0825 at the AIAA 34th
+%                  Aerospace Sciences Meeting, Reno,~NV,
+%                  Jan.~15--18,~1996; received Feb.~15,~1996;
+%                  revision received Nov.~25,~1996. \CopyrightC}
+% \end{verbatim}
+%
+% \DescribeMacro{\CopyrightA}
+% \DescribeMacro{\CopyrightB}
+% \DescribeMacro{\CopyrightC}
+% \DescribeMacro{\CopyrightD}
+% The copyright commands will expand to one of the standard AIAA
+% forms: A, B, C, or D.
+% Note: they each have different arguments---or no
+% arguments---depending on the requirements:\\
+% |  \CopyrightA{|\textit{year}|}|\\
+% |  \CopyrightB{|\textit{year}|}{|\textit{full name or company}|}|\\
+% |  \CopyrightC|\\
+% |  \CopyrightD{|\textit{year}|}|\\
+% See your AIAA copyright instructions for which form to use.
+%
+% \section{Known Problems}  
+% 
+% \begin{itemize}
+%
+%   \item The bibliographic style sheet |aiaa.bst| isn't fully
+%         tested; and thus, you may need to fiddle with your
+%         |.bbl| file for your final copy, {\it i.e.}, edit |file.bbl|
+%         after running a \LaTeX{}, \BibTeX{}, \LaTeX{} sequence,
+%         but before running \LaTeX{} the final time.  Note, if
+%         you run \BibTeX{} after modifying |file.bbl|, you will
+%         lose your modifications when \LaTeX{} is run
+%         again. Therefore, it is best to turn off write-permission
+%         on \file{file.bbl} after you have it correct.
+%
+%   \item When using the |submit| option for a document which
+%         contains subfigures,\footnote{See
+%         sample documents \file{smpaiaa.tex} and
+%         \file{smpsubf.tex} for examples of subfigure use.}
+%         some of the subfigures my be clipped.
+%         In fact, the way the |submit| option deals with subfigures
+%         needs work---to put it mildly.  The current work-around
+%         is to add \kbd{width} or \kbd{height} options to your |\incfig|
+%         commands until the figures fit properly.  These options
+%         are explained in the documentation which comes with
+%         the \pkg{graphics} package~\cite{graphicx}.
+%
+%   \item Currently you have to make subfigure captions appear
+%         in bold font explicitly, {\it e.g.},\\
+%         |  \subfigure[\bf Subfigure caption.]{\incfig{fig.eps}}|\\
+%         The next version of \pkg{subfigure} is supposed to remedy this.
+%
+%   \item The notices come after the author footnotes.  To
+%         produce the correct behavior requires significant
+%         changes to the |\maketitle| command.
+%
+%   \item The simulated journal article modes use the standard, free,
+%         Computer Modern Fonts.  The AIAA journals most likely
+%         use licensed (\$) fonts.
+%
+%   \item The simulated journal cover-pages do not have anywhre near
+%         the correct font for the journal name---does anyone know
+%         where to get such a {\em free}, tall, bold, squashed
+%         helvetic-style font?  It looks like Bitstream's Aurora
+%         condensed\ldots
+%
+%   \item (Not actually an \pkg{aiaa} problem.)
+%         Using the starred versions of |figure| and |table|
+%         environments (floats which span both columns)
+%         inter-mixed with the unstarred versions (single-column
+%         wide floats) often creates a situation where the
+%         figures or tables appear out of order. For the final
+%         copy, this can normally be corrected with judicious
+%         use of float position specifiers.\footnote{Recall, {\bf
+%         never} use just \kbd{[h]}, always give other options or
+%         that float might get `stuck' and force it and all the
+%         following floats to the end of the document.}
+%         Unfortunately, this is
+%         stock, documented behavior for \LaTeX{}.
+%         However, recently a package \pkg{fix2col} has become available
+%         which appears to rectify this behavior.  It can be
+%         found on CTAN in the
+%         \kbd{macros/latex/contrib/supported/carlisle} directory.
+%
+% \end{itemize}
+%
+% \section{Acknowledgements}
+%
+% Bundling and documenting this |aiaa| distribution in docstrip
+% format was done by using other packages as a model,
+% particularly, Mats Dahlgren's \pkg{dropping}~\cite{dropping}
+% and Jeff Goldberg {\em et al}'s \pkg{endfloat}~\cite{endfloat}.
+%
+% I want to thank the people of the |comp.text.tex| newsgroup,
+% the \TeX{}/\LaTeX{} Frequently Asked Questions maintainers,
+% and various package authors for patiently answering my inane
+% questions, in particular, but in no particular order:
+% \begin{list}
+%       {$\triangleright$}
+%       {\setlength{\itemsep}{0pt}\setlength{\parsep}{0pt}}
+%   \item Donald Arsenau (|asnd@reg.triumf.ca|)
+%   \item Robin Fairbairns (|Robin.Fairbairns@cl.cam.ac.uk|)
+%   \item Piet van Oostrum (|piet@cs.ruu.nl|)
+%   \item Jeroen Nijhof (|nijhof@th.rug.nl|)
+%   \item Steven Douglas Cochran (|sdc+@cs.cmu.edu|)
+%   \item Jeffrey Goldberg (|J.Goldberg@cranfield.ac.uk|)
+%   \item Mark Wooding (|mdw@excessus.demon.co.uk|)
+%   \item Paul Foley (|mycroft@actrix.gen.nz|)
+%   \item David Kastrup (|dak@fsnif.neuroinformatik.ruhr-uni-bochum.de|)
+%   \item Jerry Leichter (|leichter@smarts.com|)
+%   \item P.~W.~Daly (|daly@linpwd.mpae.gwdg.de|)
+%   \item David Carlisle (|carlisle@goofy.zdv.Uni-Mainz.de|)
+%   \item Edward Sznyter (|sznyter@babel.com|)
+% \end{list}
+% 
+% \section{Sending a Bug Report}
+% The \textsf{aiaa} distribution is highly likely to contain
+% bugs.  Reports of bugs in the package are most welcome.
+% However, I consider this to be a minimally ``supported'' package.
+% I will do what I can, when I can---promising nothing.
+% Before filing a bug report, please take the following actions:
+% \begin{enumerate}
+%   \item Ensure your problem is not due to your own input file(s)
+%         styles sheet(s), or package(s);
+%   \item Ensure your problem is not covered in the section 
+%        ``Known Problems'' above;
+%   \item Try to isolate the problem by writing a {\it minimal}
+%         \LaTeX{} input file which reproduces the unexpected behavior.
+%         Include the command\\ 
+%         |  \setcounter{errorcontextlines}{50}|\\ 
+%         in your input to provide extra context when things go awry;
+%   \item Run your file through \LaTeX{};
+%   \item Send a description of your problem, the input file 
+%         and the log file via e-mail to: \texttt{w.l.kleb@larc.nasa.gov}.
+% \end{enumerate}
+% I am not in the business of answering generic \TeX{}/\LaTeX{}
+% questions; so if your problem appears to be such, I will
+% let you know.\bigskip
+% 
+% \noindent{\itshape Enjoy(?) the everpresent deadline and enjoy your
+% \LaTeX!\raisebox{-\baselineskip}{---bil}}
+%
+% \begin{thebibliography}{1}
+%
+% \bibitem{companion}
+% Michel Goossens, Frank Mittelbach, and Alexander Samarin.
+% \newblock{\em The {\LaTeX} Companion}.
+% \newblock Addison-Wesley, Reading, Massachusetts, 1994.
+%
+% \bibitem{guide}
+% Helmut Kopka and Patrick W. Daly.
+% \newblock{\em A Guide to {\LaTeXe}: Document Prepartion for
+%               Beginners and Advanced Users}.
+% \newblock 2nd ed.
+% \newblock Addison-Wesley, Reading, Massachusetts, 1994.
+%
+% \bibitem{latex}
+% Leslie Lamport.
+% \newblock{\em {\LaTeX}: A Document Preparation System}.
+% \newblock 2nd ed.
+% \newblock Addison-Wesley, Reading, Massachusetts, 1994.
+%
+% \bibitem{dropping}
+% Mats Dahlgren.
+% \newblock \pkg{dropping}---A \LaTeX{} Macro for Dropping
+%           the First Character(s) of a Paragraph.
+% \newblock June 1996. (version~0.1)
+% \newblock Electronic Documentation.
+%
+% \bibitem{graphicx}
+% David Carlisle.
+% \newblock Packages in the `graphics' bundle.
+% \newblock December 1995.
+% \newblock Electronic Documentation.
+%
+% \bibitem{endfloat}
+% James Darrell McCauley and Jeff Goldberg.
+% \newblock The \texttt{endfloat} Package.
+% \newblock October 1995. (version~2.4i)
+% \newblock Electronic Documentation.
+%
+% \end{thebibliography}
+%
+% \StopEventually{\PrintChanges}
+%
+% \newpage
+% 
+% \section{The Documentation}
+%
+% The following contains the documentation driver for this user manual.
+%    \begin{macrocode}
+%<*driver>
+\documentclass{ltxdoc}
+\setlength\hfuzz{2pt}% reduce overfull warnings
+\OnlyDescription   % stop at \StopEventually comment to get everything
+%\RecordChanges    % display change information
+\begin{document}
+  \DocInput{aiaa.dtx}
+\end{document}
+%</driver>
+%    \end{macrocode}
+% 
+% \section{The Code}
+%
+% For the interested reader(s), following is a semi-documented
+% of the class code, the 9pt style, bibliographic style file, and
+% the endfloat configuration.  These detailed coding bits
+% are not included in the Users' Manual by default, if you really
+% want to see these in typeset form, you need to comment out the
+% |\OnlyDescription| line in the |<driver>| section of this file
+% \file{aiaa.dtx}.
+% If you feel the need to
+% modify things, simply cut the section you want to change
+% and save it to a file named \file{mymods.sty}.  Then modify
+% the code in \file{mymods.sty} to suit your needs and include
+% it in your document via |\usepackage{mymods}| in the
+% preamble.
+%
+% \subsection{The class code}
+%
+% The underlying logic is supposed to look like:\footnote{Picture
+% environment flowchart generated by flow 0.99b.}\\[1pt]
+%
+% \setlength\unitlength{1.8em}
+% \thicklines
+% \begin{picture}(16.000000,20.000000)(-1.000000,-20.000000)
+% \put(1.0000,-0.5000){\oval(2.0000,1.0000)}
+% \put(0.0000,-1.0000){\makebox(2.0000,1.0000)[c]{\shortstack[c]{
+% begin
+% }}}
+% \put(1.0000,-1.0000){\vector(0,-1){1.0000}}
+% \put(-1.0000,-4.0000){\framebox(4.0000,2.0000)[c]{\shortstack[c]{
+% code common\\
+% to all options
+% }}}
+% \put(1.0000,-4.0000){\vector(0,-1){1.0000}}
+% \put(-0.5000,-6.5000){\line(1,1){1.5000}}
+% \put(-0.5000,-6.5000){\line(1,-1){1.5000}}
+% \put(2.5000,-6.5000){\line(-1,-1){1.5000}}
+% \put(2.5000,-6.5000){\line(-1,1){1.5000}}
+% \put(-0.5000,-8.0000){\makebox(3.0000,3.0000)[c]{\shortstack[c]{
+% \texttt{submit}?
+% }}}
+% \put(2.5000,-6.0500){\makebox(0,0)[lt]{No}}
+% \put(1.4500,-8.0000){\makebox(0,0)[lb]{Yes}}
+% \put(1.0000,-8.0000){\vector(0,-1){1.0000}}
+% \put(0.0000,-11.0000){\framebox(2.0000,2.0000)[c]{\shortstack[c]{
+% \texttt{submit}\\
+% code
+% }}}
+% \put(1.0000,-11.0000){\vector(0,-1){1.0000}}
+% \put(1.0000,-12.5000){\oval(2.0000,1.0000)}
+% \put(0.0000,-13.0000){\makebox(2.0000,1.0000)[c]{\shortstack[c]{
+% done
+% }}}
+% \put(2.5000,-6.5000){\vector(1,0){1.0000}}
+% \put(3.5000,-7.5000){\framebox(5.0000,2.0000)[c]{\shortstack[c]{
+% \texttt{paper}/\texttt{article}\\
+% /\texttt{note} code
+% }}}
+% \put(6.0000,-7.5000){\vector(0,-1){1.0000}}
+% \put(4.5000,-10.0000){\line(1,1){1.5000}}
+% \put(4.5000,-10.0000){\line(1,-1){1.5000}}
+% \put(7.5000,-10.0000){\line(-1,-1){1.5000}}
+% \put(7.5000,-10.0000){\line(-1,1){1.5000}}
+% \put(4.5000,-11.5000){\makebox(3.0000,3.0000)[c]{\shortstack[c]{
+% \texttt{paper}?
+% }}}
+% \put(7.5000,-9.5500){\makebox(0,0)[lt]{No}}
+% \put(6.4500,-11.5000){\makebox(0,0)[lb]{Yes}}
+% \put(7.5000,-10.0000){\vector(1,0){1.0000}}
+% \put(8.5000,-11.0000){\framebox(4.0000,2.0000)[c]{\shortstack[c]{
+% \texttt{article} or\\
+% \texttt{note} code
+% }}}
+% \put(10.5000,-11.0000){\vector(0,-1){1.0000}}
+% \put(9.0000,-13.5000){\line(1,1){1.5000}}
+% \put(9.0000,-13.5000){\line(1,-1){1.5000}}
+% \put(12.0000,-13.5000){\line(-1,-1){1.5000}}
+% \put(12.0000,-13.5000){\line(-1,1){1.5000}}
+% \put(9.0000,-15.0000){\makebox(3.0000,3.0000)[c]{\shortstack[c]{
+% \texttt{article}?
+% }}}
+% \put(12.0000,-13.0500){\makebox(0,0)[lt]{No}}
+% \put(10.9500,-15.0000){\makebox(0,0)[lb]{Yes}}
+% \put(12.0000,-13.5000){\vector(1,0){1.0000}}
+% \put(13.0000,-14.5000){\framebox(2.0000,2.0000)[c]{\shortstack[c]{
+% \texttt{note}\\
+% code
+% }}}
+% \put(14.0000,-14.5000){\vector(0,-1){1.0000}}
+% \put(14.0000,-16.0000){\oval(2.0000,1.0000)}
+% \put(13.0000,-16.5000){\makebox(2.0000,1.0000)[c]{\shortstack[c]{
+% done
+% }}}
+% \put(10.5000,-15.0000){\vector(0,-1){1.0000}}
+% \put(9.0000,-18.0000){\framebox(3.0000,2.0000)[c]{\shortstack[c]{
+% \texttt{article}\\
+% code
+% }}}
+% \put(10.5000,-18.0000){\vector(0,-1){1.0000}}
+% \put(10.5000,-19.5000){\oval(2.0000,1.0000)}
+% \put(9.5000,-20.0000){\makebox(2.0000,1.0000)[c]{\shortstack[c]{
+% done
+% }}}
+% \put(6.0000,-11.5000){\vector(0,-1){1.0000}}
+% \put(5.0000,-14.5000){\framebox(2.0000,2.0000)[c]{\shortstack[c]{
+% \texttt{paper}\\
+% code
+% }}}
+% \put(6.0000,-14.5000){\vector(0,-1){1.0000}}
+% \put(6.0000,-16.0000){\oval(2.0000,1.0000)}
+% \put(5.0000,-16.5000){\makebox(2.0000,1.0000)[c]{\shortstack[c]{
+% done
+% }}}
+% \end{picture}\\
+% This does not mean the code as a whole is organized according
+% to this; but, rather this is the case for each
+% macro/environment defined.
+%
+% First, the package is to identify itself:
+%    \begin{macrocode}
+%
+%<*class>
+%
+\NeedsTeXFormat{LaTeX2e}[1994/06/01]
+\ProvidesClass{aiaa}[1999/02/22 v2.4 AIAA document class]
+%    \end{macrocode}
+% Flags
+%    \begin{macrocode}
+\newif\if@submit
+\newif\if@paper
+\newif\if@article
+\newif\if@note
+\newif\if@cover
+%    \end{macrocode}
+% Default settings
+%    \begin{macrocode}
+\@submitfalse
+\@papertrue
+\@articlefalse
+\@notefalse
+\@coverfalse
+%    \end{macrocode}
+% declaration of options
+% Note that options will be processed in order of the |\DeclareOption|
+% commands in this file, so since we want submit to take precedence
+% over all the other options, we process it last. Note also that
+% all flags are reset with each option, so that they are
+% independent of the defaults.
+%    \begin{macrocode}
+\DeclareOption{note}{\@notetrue\@articlefalse\@submitfalse\@paperfalse}
+\DeclareOption{article}{\@articletrue\@notefalse\@paperfalse\@submitfalse}
+\DeclareOption{paper}{\@papertrue\@articlefalse\@notefalse\@submitfalse}
+\DeclareOption{submit}{\@submittrue\@paperfalse\@articlefalse}
+\DeclareOption{cover}{\@covertrue}
+\DeclareOption*{\PassOptionsToClass{\CurrentOption}{article}%
+                \typeout{NOTE: Passing ``\CurrentOption" option on to the
+                         standard LaTeX article class}}
+%    \end{macrocode}
+% actually process the options
+%    \begin{macrocode}
+\ProcessOptions
+\typeout{}
+\if@submit%
+  \typeout{NOTE: aiaa journal submission mode
+          - all other aiaa options ignored}
+\else% paper, article, or note
+  \if@paper%
+    \typeout{TYPESETTING in AIAA conference PAPER format ...}
+  \else% article or note
+    \if@article%
+      \typeout{TYPESETTING in AIAA journal ARTICLE simulation format ...}
+    \else% note
+      \typeout{TYPESETTING in AIAA journal NOTE simulation ...}
+    \fi
+  \fi
+\fi
+\typeout{}
+%    \end{macrocode}
+% load the \LaTeX{} standard article class with |twoside| and
+% |twocolumn| for all but the submit option.  For a journal article
+% or note, also load the aiaa9pt package.
+%    \begin{macrocode}
+\if@submit%
+  \LoadClass[12pt]{article}%
+  \RequirePackage[noheads,tablesfirst,nomarkers]{endfloat}%
+  \RequirePackage{setspace}%
+  \RequirePackage{lastpage}%
+\else% paper, article or note
+  \LoadClass[twoside,twocolumn]{article}%
+  \RequirePackage[dvips]{dropping}% dvips set to make compatible with pdflatex
+  \RequirePackage{lastpage}%
+  \if@paper%
+    \relax%
+  \else% article or note
+    \RequirePackage{aiaa9pt}%
+  \fi%
+\fi
+%    \end{macrocode}
+% packages used by this class for all options
+%    \begin{macrocode}
+\RequirePackage{graphicx}
+\RequirePackage{overcite}
+\RequirePackage{caption2}
+\RequirePackage{fancyhdr}
+\RequirePackage{subfigure}[1995/03/06]
+%\RequirePackage[bf]{subfigure}[199!/??/??] % when new version comes out
+%    \end{macrocode}
+%
+% main code
+%
+% page sizes:
+%    \begin{macrocode}
+\if@submit
+  \setlength{\topmargin}{-0.25in}
+  \setlength{\headsep}{9.5pt}
+  \setlength{\textheight}{9in}
+  \setlength{\textwidth}{6.5in}
+  \setlength{\oddsidemargin}{0.0in}
+  \AtBeginDocument{\onehalfspacing}% turn on `doublespacing'
+\else% paper, article, or note
+  \setlength{\topmargin}{-0.75in}
+  \if@paper
+    \setlength{\headsep}{9.5pt} 
+    \setlength{\textheight}{9.5in}
+    \setlength{\textwidth}{6.75in}
+    \setlength{\columnsep}{0.25in}
+    \setlength{\footskip}{0.25in}
+  \else% article or note
+    \setlength{\topmargin}{-0.75in}
+    \setlength{\headsep}{10pt}
+    \setlength{\footskip}{16pt}
+    \setlength{\textheight}{10in}
+    \setlength{\textwidth}{7in}
+    \setlength{\columnsep}{0.375in}
+    \setlength{\oddsidemargin}{-0.25in}
+    \renewcommand{\baselinestretch}{0.9}
+  \fi
+  \setlength{\evensidemargin}{\oddsidemargin}
+\fi
+%    \end{macrocode}
+%
+% \begin{macro}{\SubmitName}
+% \begin{macro}{\PaperNumber}
+% \begin{macro}{\ArticleHeader}
+% \begin{macro}{\ArticleIssue}
+% \begin{macro}{\JournalName}
+% \begin{macro}{\JournalIssue}
+% \begin{macro}{\JournalPage}
+% \begin{macro}{\NoteHeader}
+% various macros
+%    \begin{macrocode}
+\newcommand*{\SubmitName}[1]%
+            {\def\AA@submitname{#1}}
+\newcommand*{\PaperNumber}[1]%
+            {\def\AA@papernumber{#1}}
+\newcommand*{\ArticleHeader}[1]%
+            {\def\AA@articleheader{#1}}
+\newcommand*{\ArticleIssue}[1]%
+            {\def\AA@articleissue{#1}}
+\newcommand*{\JournalName}[1]%
+            {\def\AA@journalname{#1}}
+\newcommand*{\JournalIssue}[1]%
+            {\def\AA@journalissue{#1}}
+\newcounter{AA@journalpage}
+\newcommand*{\JournalPage}[1]%
+            {\setcounter{AA@journalpage}{#1}}
+\newcommand*{\NoteHeader}[1]%
+            {\def\AA@noteheader{#1}}
+%    \end{macrocode}
+% \end{macro}
+% \end{macro}
+% \end{macro}
+% \end{macro}
+% \end{macro}
+% \end{macro}
+% \end{macro}
+% \end{macro}
+% initialize them
+%    \begin{macrocode}
+\SubmitName{}
+\PaperNumber{}
+\ArticleHeader{}
+\ArticleIssue{}
+\JournalName{}
+\JournalIssue{}
+\NoteHeader{}
+\setcounter{AA@journalpage}{1}
+%    \end{macrocode}
+% fancy headers/footers:
+%    \begin{macrocode}
+\pagestyle{fancy}% note: must be issued after any \textwidth command
+\renewcommand{\headrulewidth}{0pt}
+\renewcommand{\footrulewidth}{0pt}
+\fancyhf{} % clear all footers and headers
+\if@submit
+  \rfoot{\footnotesize\scshape\thepage\ of \pageref{LastPage}}
+  \lfoot{\footnotesize\scshape\AA@submitname}
+\else% paper, article, or note
+  \if@paper
+    \cfoot{\footnotesize\scshape\thepage\ of \pageref{LastPage}
+           \ifx\AA@papernumber\@empty\relax\else\\
+           \rule[.2\baselineskip]{0.5in}{0.2pt}\\
+           American Institute of Aeronautics
+           and Astronautics Paper \AA@papernumber\fi}
+  \else% article or note
+    \if@article
+      \chead{\footnotesize\scshape\MakeUppercase{\AA@articleheader}}
+      \fancyhead[RO,LE]{\footnotesize\thepage}
+      \fancypagestyle{plain}{%
+        \fancyhf{}
+        \lhead{\ifx\AA@journalname\@empty\relax\else
+               \footnotesize{\scshape\AA@journalname}\\
+               \AA@articleissue\fi}
+        \cfoot{\footnotesize\thepage}}
+    \else% note
+      \chead[\footnotesize\scshape\AA@noteheader]%
+            {\footnotesize\scshape\AA@noteheader}
+      \rhead[]{\footnotesize \thepage}
+      \lhead[\footnotesize \thepage]{}
+    \fi
+  \fi
+\fi
+%    \end{macrocode}
+% \begin{macro}{\abstract}
+% Redefine the |\abstract| command and load the date with nothing
+%    \begin{macrocode}
+\renewcommand{\abstract}[1]%
+             {\def\@abstract{#1}}
+\abstract{}
+\let\@date\@empty
+%    \end{macrocode}
+% \end{macro}
+%
+% \begin{macro}{\dropword}
+% macro to drop first letter of word and capitalize the remaining
+% portion, thanks to jeroen nijhof |<nijhof@th.rug.nl>|
+%
+% use:\\
+% |  \dropword| word with rest of sentence or newline or whatever...
+%    \begin{macrocode}
+\if@submit%
+  \def\dropword{}
+\else
+  \def\dropword#1#2 {\dropping{2}{\bfseries{} #1}\MakeUppercase{#2} }% spaces important!
+\fi
+%    \end{macrocode}
+% \end{macro}
+%
+% increase penalty (x10) for consecutive lines ending in hyphens:
+%    \begin{macrocode}
+\doublehyphendemerits=100000
+%    \end{macrocode}
+% ignore small line overfull errors:
+%    \begin{macrocode}
+\setlength\hfuzz{3pt}% reduce the quantity of overfull warnings
+%    \end{macrocode}
+%
+% \begin{macro}{\makecover}
+% \begin{macro}{\Conference}
+% The command |\makecover| is used  to make a cover for a
+% AIAA conference paper or a simulated journal reprint.
+% It is only active when the |submit| option is not in effect
+% The |\makenotice| command is used to create the footnote
+% containing copyright and other information about the document.
+% The commands |\makecover| and |\makenotice| are internally
+% called by the |\maketitle| command and are constructed
+% similarly to the |\maketitle| command, in that |\makecover| uses
+% information supplied by the commands described in the previous
+% section, and |\makenotice| incorporates one of the appropriate
+% |\_____Notice| commands.
+%    \begin{macrocode}
+\newcommand{\Conference}[1]{\def\AA@conference{#1}}
+\Conference{}
+\newcommand{\CoverFigure}[1]{\def\AA@coverfigure{#1}}
+\CoverFigure{}
+\if@submit%
+  \newcommand{\makecover}{}
+\else% paper, article, or note
+  \newcommand{\makecover}{%
+  \begin{titlepage}
+  \let\AA@sfdefault\sfdefault% save normal fonts
+  \let\AA@rmdefault\rmdefault
+  \let\AA@ttdefault\ttdefault
+  \renewcommand{\sfdefault}{phv}% change to new fonts
+  \renewcommand{\rmdefault}{ptm}
+  \renewcommand{\ttdefault}{pcr}
+  \enlargethispage{1in}
+  \setcounter{page}{0}
+  \renewcommand\thanks[1]{}% locally kill the \thanks{} command
+  \renewcommand\thanksibid[1]{}% kill the ibid version too
+  \setlength{\unitlength}{1in}% unit of measure for the picture
+  \begin{picture}(7.5,9)(0.45,0.495)%  start a 7-1/2'' x 9'' picture:
+  \if@paper%
+    \linethickness{4pt}
+    \put(0,0){\framebox(7.45,8.95){}}% make a framed box accounting
+                                     % for line thickness
+    \linethickness{0.5pt}
+    \renewcommand{\and}{\relax}
+    \put(-0.07,8.7){\incfig[width=3in]{aiaalgo}}% aiaa logo at top left
+    \put(1.2,8.0)% paper number, title, author/location
+        {\makebox(0,0)[tl]{\parbox{5in}
+            {\raggedright\sffamily\bfseries
+          \Huge AIAA \AA@papernumber% paper number
+          \\[5pt]
+          \huge\@title%                title
+          \\[5pt]
+          \Large\mdseries\@author}}}%   author/location
+    \ifx\AA@coverfigure\@empty% optional figure
+      \relax
+    \else
+      \put(3.725,1.7){\makebox(0,0)[b]{%
+          \includegraphics[width=5in,height=4in]%
+          {\AA@coverfigure}}}%
+    \fi
+    \put(3.725,0.05){\makebox(0,0)[b]{\parbox{7.45in}%  meeting, location, and date
+        {\centering\Huge\bfseries\sffamily%
+        \AA@conference}}}
+    \put(-0.055,-0.36){\parbox[t]{7.5in}% notice
+      {\normalsize\sffamily\bfseries
+      For permission to copy or republish, contact the
+      American Institute of Aeronautics and Astronautics\\
+      1801 Alexander Bell Drive, Suite 500, Reston, VA 20191--4344}}
+  \else% article, or note
+    \put(0.7,7.75)% title and authors
+        {\makebox(0,0)[tl]{\parbox{6.5in}
+         {\raggedright\sffamily\bfseries
+          \huge\@title%
+          \\[5pt]
+          \Large\mdseries\@author}}}
+    \ifx\AA@journalname\@empty\relax\else
+      \put(0.7,1.9){\makebox(0,0)[tl]{\parbox{7.5in}%  journal/issue
+        {\raggedright\bfseries\sffamily
+         Simulated Reprint for\\
+        \Huge%
+        \AA@journalname\\
+        \small\mdseries
+	\ifx\AA@journalissue\@empty%
+           \relax
+        \else%
+           \AA@journalissue,
+        \fi
+        Pages \theAA@journalpage--\pageref{LastPage}}}}\fi
+    \put(0.5,0.45){\incfig[width=1in]{aiaalgo}}% aiaa logo at bottom left
+    \put(0.7,0.3)% notice
+        {\makebox(0,0)[tl]{\parbox{6.5in}
+         {\sffamily
+          \slshape A publication of the\\
+          \upshape American Institute of Aeronautics and Astronautics, Inc.\\
+         1801 Alexander Bell Drive, Suite 500\\
+         Reston, VA 20191--4344}}}
+  \fi
+  \end{picture}
+  \renewcommand\sfdefault{\AA@sfdefault}
+  \renewcommand\rmdefault{\AA@rmdefault}
+  \renewcommand\ttdefault{\AA@ttdefault}
+  \end{titlepage}}
+\fi
+%    \end{macrocode}
+% \end{macro}
+% \end{macro}
+%
+% \begin{macro}{\PaperNotice}
+% \begin{macro}{\JournalNotice}
+% \begin{macro}{\makenotice}
+% the footnote notice maker
+%    \begin{macrocode}
+\newcommand{\PaperNotice}[1]{\def\AA@papernotice{\scriptsize #1}}
+\PaperNotice{}
+\newcommand{\JournalNotice}[1]{\def\AA@journalnotice{\scriptsize #1}}
+\JournalNotice{}
+\if@submit%
+  \newcommand\makenotice{}%
+\else% paper, article, or note
+  \newcommand\makenotice{%
+    \begingroup
+    \renewcommand\thefootnote{}
+      \if@paper%
+        \ifx\AA@papernotice\@empty\else\footnotetext{\AA@papernotice}\fi
+      \else% article or note
+        \ifx\AA@journalnotice\@empty\else\footnotetext{\AA@journalnotice}\fi
+      \fi%
+    \endgroup
+%   \renewcommand{\thefootnote}{\arabic{footnote}}%
+  }
+\fi
+%    \end{macrocode}
+% \end{macro}
+% \end{macro}
+% \end{macro}
+% \begin{macro}{\CopyrightA}
+% \begin{macro}{\CopyrightB}
+% \begin{macro}{\CopyrightC}
+% \begin{macro}{\CopyrightD}
+% load copyright commands
+%    \begin{macrocode}
+\newcommand{\CopyrightA}[1]{Copyright \copyright\ #1 by the
+  American Institute of Aeronautics and Astronautics, Inc. All
+  rights reserved.}
+\newcommand{\CopyrightB}[2]{Copyright \copyright\ #1 by
+  #2. Published by the American Institute of Aeronautics
+  and Astronautics, Inc.\ with permission.}
+\newcommand{\CopyrightC}{This paper is a work of the U.S.
+  Government and is not subject to copyright protection in the
+  United States.}
+\newcommand{\CopyrightD}[1]{Copyright \copyright\ #1 by the
+  American Institute of Aeronautics and Astronautics, Inc. No
+  copyright is asserted in the United States under Title 17,
+  U.S. Code.  The U.S. Government has a royalty-free license to
+  exercise all rights under the copyright claimed herein for
+  Governmental Purposes.  All other rights are reserved by the
+  copyright owner.}
+%    \end{macrocode}
+% \end{macro}
+% \end{macro}
+% \end{macro}
+% \end{macro}
+% modify float captions
+%    \begin{macrocode}
+\if@submit
+  \renewcommand\figurename{Figure}
+  \renewcommand\captionlabeldelim{:\hspace{1em}}
+\else% paper, article, or note
+  \renewcommand\figurename{Fig.}% change to the ugly, silly
+                                % abbreviatation as per aiaa---saves
+                                % all of two characters !?
+  \renewcommand\captionlabeldelim{~~}
+\fi
+\renewcommand\captionfont{\small\bfseries}
+\renewcommand\p@subfigure{\thefigure(}
+\renewcommand\thesubfigure{\alph{subfigure})}
+\renewcommand\subcaplabelfont{\captionfont}
+\renewcommand{\subfigcapmargin}{2pt}
+\if@submit
+  \relax
+\else
+  \setlength{\abovecaptionskip}{ 6pt plus 2pt minus 2pt}
+  \setlength{\belowcaptionskip}{ 3pt plus 1pt minus 1pt}% note good for tables!
+  \renewcommand{\subfigcapskip}{.2\abovecaptionskip}%    seem to
+  \renewcommand{\subfigbottomskip}{.7\belowcaptionskip}% have no effect?
+\fi
+%    \end{macrocode}
+% modify float spacing or, if we're submitting something,
+% the behavior of the |endfloat| package.
+%    \begin{macrocode}
+\if@submit% modify endfloat behaviour
+  \InputIfFileExists{aiaaenf.cfg}{\typeout{loading aiaaenf.cfg}}%
+                    {\typeout{WARNING: endfloat behavior will not
+                              be as advertised since aiaaenf.cfg
+                                                   was not found.}}
+\else% modify float spacing
+  \renewcommand{\topfraction}{0.9}
+  \renewcommand{\bottomfraction}{0.9}
+  \renewcommand{\textfraction}{0.1}
+  \renewcommand{\floatpagefraction}{0.8}% 0.5 is the default
+  \renewcommand{\dbltopfraction}{\floatpagefraction}
+  \renewcommand{\dblfloatpagefraction}{\floatpagefraction}
+  \setcounter{topnumber}{10}
+  \setcounter{dbltopnumber}{\value{topnumber}}
+  \setcounter{bottomnumber}{\value{topnumber}}
+  \setcounter{totalnumber}{\value{topnumber}}
+  \addtocounter{totalnumber}{\value{bottomnumber}}
+  \setlength{\floatsep}        { 5pt plus 2pt minus 2pt}
+  \setlength{\textfloatsep}    { 5pt plus 2pt minus 3pt}
+  \setlength{\intextsep}       { 5pt plus 2pt minus 2pt}
+  \setlength{\dblfloatsep}     {\floatsep}
+  \setlength{\dbltextfloatsep} {\textfloatsep}
+\fi
+%    \end{macrocode}
+% modifying bibliography output
+%    \begin{macrocode}
+\renewcommand{\@biblabel}[1]{$^{#1}$}
+\renewenvironment{thebibliography}[1]%
+     {\section*{\refname\@mkboth{\MakeUppercase\refname}%
+                                 {\MakeUppercase\refname}}%
+      \list{\@biblabel{\@arabic\c@enumiv}}%
+           {\setlength{\leftmargin}{0pt}%
+            \settowidth{\labelwidth}{\@biblabel{#1}}%
+            \setlength{\itemindent}{\parindent}%
+            \advance\itemindent by \labelwidth%
+            \setlength{\labelsep}{0.0em}%
+            \setlength{\itemsep}{-\smallskipamount}%
+            \@openbib@code%
+            \usecounter{enumiv}%
+            \let\p@enumiv\@empty%
+            \renewcommand\theenumiv{\@arabic\c@enumiv}%
+            \if@submit%
+              \normalsize%
+            \else%
+              \footnotesize%
+            \fi}
+      \sloppy\clubpenalty4000\widowpenalty4000%
+      \sfcode`\.\@m}
+      {\def\@noitemerr
+        {\@latex@warning{Empty `thebibliography' environment}}%
+      \endlist}
+%    \end{macrocode}
+%
+%  \begin{macro}{\thanksibid}
+%  Define a command that is used in conjunction with the
+%  |\thanks| command.  It is used for the special case
+%  where the argument of the |\thanks| for one author is
+%  the same as another.\footnote{Hence, the use of the latin {\it ibid},
+%  short for {\it ibidem}, meaning the same as.}
+%    \begin{macrocode}
+\newcounter{ibid}
+\newcounter{tempcnt}
+\newcommand{\thanksibid}[1]{%
+    \begingroup
+    \setcounter{tempcnt}{\value{footnote}}%
+    \setcounter{ibid}{#1}%
+    \def\thefootnote{\fnsymbol{ibid}}%
+    \footnotemark%
+    \setcounter{footnote}{\value{tempcnt}}%
+    \endgroup
+}
+%    \end{macrocode}
+% \end{macro}
+%
+%  \begin{macro}{\incfig}
+%  define command that picks-up the current line width
+%  for automatic figure sizing
+%    \begin{macrocode}
+\newcommand{\incfig}{\centering\includegraphics}
+\setkeys{Gin}{width=\linewidth,keepaspectratio}
+\if@submit%
+   \setkeys{Gin}{totalheight=0.35\textheight}
+\else% paper, article, or note
+   \relax
+\fi
+%    \end{macrocode}
+% \end{macro}
+%
+%  \begin{environment}{subfigmatrix}
+%  Define command that makes subfigure `tables'.
+%
+%    \begin{macrocode}
+% 27 Feb 1997  Steven Douglas Cochran - Created.
+% 28 Feb 1997  Bil Kleb - modified to not use minipages
+% Define and initialize the internal variables.
+%
+\newlength{\sfm@width}%               Subfigure width
+\newlength{\sfm@colsep}%              Subfigure column separation
+\setlength{\sfm@colsep}{2\tabcolsep}% Use twice tabular column separation
+\newcounter{sfm@count}%               Item count
+\newenvironment{subfigmatrix}[1]{%
+  \begingroup%
+  \centering%
+  \vspace*{-\subfigtopskip}% remove the vertical spacing inserted
+                           % by the subfigure package
+    % 
+    % Save the "real" subfigure macro and start the item counter off
+    % at -1 to detect the first item.
+    % Set the \sfm@width to the single element size.
+    % 
+    \let\sfm@subfigure\subfigure%
+    \setcounter{sfm@count}{-1}%
+    \setlength{\sfm@width}{\linewidth}%
+    \addtolength{\sfm@width}{\sfm@colsep}%
+    \addtolength{\sfm@width}{-#1\sfm@colsep}%
+    \divide\sfm@width by#1
+    \setkeys{Gin}{width=\sfm@width,keepaspectratio}%
+    % 
+    % Redefine the \subfigure and \subtable macros locally to this
+    % environment so that we can wrap them with minipages.
+    % 
+    \def\subfigure{% try the transpose
+      \ifnum \value{sfm@count} = -1
+      % very first item
+        \setcounter{sfm@count}{1}%
+      \else% Not very first item
+        \addtocounter{sfm@count}{1}%
+        \ifnum \value{sfm@count} = 1
+          % Beginning of next column, finish the last column.
+          \\%
+        \else%
+          % middle or last item
+          \hfill%
+          \ifnum #1 = \value{sfm@count}%
+            % Reset the counter of at the end of the row.
+            \setcounter{sfm@count}{0}%
+          \fi%
+        \fi%
+      \fi%
+      \sfm@subfigure}%
+    \let\subtable\subfigure%
+  }{%
+    \\%
+  \endgroup}%
+%    \end{macrocode}
+% \end{environment}
+%
+%  \begin{macro}{\maketitle}
+%  change maketitle behavior to preserve twocolumn mode for
+%  journal note, to create a cover page if appropriate, and make
+%  the copyright-style notices about the document.
+%    \begin{macrocode}
+\if@paper
+  \renewcommand{\and}{\\[-.9\baselineskip]}
+\else
+  \renewcommand{\and}{\\*[-8pt]}
+\fi
+\renewcommand{\maketitle}{%
+  \if@cover
+    \makecover
+  \else
+    \relax
+  \fi
+  \par
+  \begingroup
+    \renewcommand\thefootnote{\@fnsymbol\c@footnote}%
+    \def\@makefnmark{\rlap{\@textsuperscript{\normalfont\@thefnmark}}}%
+    \long\def\@makefntext##1{\parindent 1em\noindent
+            \hb@xt@1.8em{%
+                \hss\@textsuperscript{\normalfont\@thefnmark}}##1}%
+  \global\@topnum\z@   % Prevents figures from going at top of page.
+  \if@submit%
+    \@maketitle%
+  \else% paper, article, or note
+    \if@note%
+      \@maketitle%
+    \else% paper article -- should already be in twocolumn mode
+      \ifnum \col@number=\@ne% if in column one, good:
+         \@maketitle
+      \else% not in column one, so start new page:
+        \twocolumn[\@maketitle]
+      \fi
+      \if@article%
+        \thispagestyle{plain}
+      \fi
+    \fi
+  \fi
+  \@thanks
+  \endgroup
+  \suppressfloats
+  \setcounter{footnote}{0}%
+  \if@submit% submission
+    \relax
+  \else% paper, article, or note:
+    \if@paper
+      \relax
+    \else% article or note:
+       \setcounter{page}{\theAA@journalpage}
+    \fi
+  \fi
+  \makenotice
+  \global\let\maketitle\relax
+  \global\let\@maketitle\relax
+  \global\let\@abstract\@empty
+  \global\let\@thanks\@empty
+  \global\let\thanks\relax
+  \global\let\@author\@empty
+  \global\let\author\relax
+  \global\let\@title\@empty
+  \global\let\title\relax
+  \global\let\@date\@empty
+  \global\let\abstract\relax
+  \global\let\date\relax
+}
+%    \end{macrocode}
+% \end{macro}
+% \begin{macro}{\@maketitle}
+% modify the fonts used for the title, etc
+%    \begin{macrocode}
+\def\@maketitle{%
+  \newpage
+  \begin{center}%
+  \let \footnote \thanks
+    {\huge\bf \@title \par}%
+    \vskip 1.5em%
+    {\lineskip .5em%
+      \large%
+      \begin{tabular}[t]{c}%
+        \@author
+      \end{tabular}\par}%
+    \vskip 1em%
+    \if@submit
+      \relax
+    \else% paper, article, or note
+      \if@note
+        \relax
+      \else% paper or article
+        \newenvironment{AA@abstract}
+        {\list{}{\listparindent 1.5em%
+                \itemindent \listparindent
+                \leftmargin 0.75in%
+                \rightmargin \leftmargin
+                \parsep \z@ \@plus \p@}%
+                \item\relax}
+         {\endlist}
+         \ifx\@abstract\@empty
+           \relax
+         \else
+           \begin{AA@abstract}
+              \footnotesize\textbf\@abstract
+           \end{AA@abstract}
+         \fi
+      \fi
+    \fi
+  \end{center}%
+  \if@submit%
+    \ifx\@abstract\@empty
+      \relax
+    \else%
+      \section{Abstract} \@abstract%
+    \fi
+  \else% paper, article, or note
+    \par%
+    \if@note%
+      \vskip -\medskipamount%
+    \else%
+      \vskip 1em%
+    \fi%
+  \fi%
+}
+%    \end{macrocode}
+% \end{macro}
+% modify the section headers
+%    \begin{macrocode}
+\setcounter{secnumdepth}{-2}% instead of having to use the *'d
+                            % section commands
+%    \end{macrocode}
+% \begin{macro}{\section}
+%    \begin{macrocode}
+\renewcommand\section{\@startsection
+  {section}%                    % section name
+  {1}%                          % level
+  {\z@}%                        % indentation of heading
+  {1.8ex}%                      % before skip (neg, no parindent)
+  {0.5ex}%                      % after skip (neg, run-on heading space)
+  {\normalfont\center\large\bfseries}}
+%    \end{macrocode}
+% \end{macro}
+% \begin{macro}{\subsection}
+%    \begin{macrocode}
+\renewcommand\subsection{\@startsection{subsection}{2}%
+  {\z@}%
+  {1.5ex}%
+  {0.5ex}%
+  {\normalfont\small\bfseries\raggedright}}
+%    \end{macrocode}
+% \end{macro}
+% \begin{macro}{\subsubsection}
+%    \begin{macrocode}
+\renewcommand\subsubsection{\@startsection{subsubsection}{3}%
+  {\z@}%
+  {1.5ex}%
+  {0.5ex}%
+  {\normalfont\normalsize\itshape\raggedright}}
+%    \end{macrocode}
+% \end{macro}
+% \begin{macro}{\paragraph}
+%    \begin{macrocode}
+\renewcommand\paragraph{\@startsection{paragraph}{4}%
+  {\parindent}%
+  {0.3ex}%
+  {-1em}%
+  {\normalfont\normalsize\sffamily}}
+%    \end{macrocode}
+% \end{macro}
+% \begin{macro}{\subparagraph}
+%    \begin{macrocode}
+\renewcommand\subparagraph{\@startsection{subparagraph}{5}%
+  {\parindent}%
+  {0.3ex}%
+  {-1em}%
+  {\normalfont\normalsize\itshape}}
+%    \end{macrocode}
+% \end{macro}
+% list files used during job:
+%    \begin{macrocode}
+\listfiles
+%
+%</class>
+%
+%    \end{macrocode}
+%
+% This brings us to the end of \cls{aiaa.cls}.
+%
+% \subsection{The 9pt style file}
+% 
+% This is the package \pkg{aiaa9pt.sty}, it provides 9pt font settings
+% for simulation of journal articles/notes.  It is essentially
+% a hack of size10.clo (a the standard \LaTeX{} class option).
+%
+%    \begin{macrocode}
+%
+%<*style>
+%
+\ProvidesFile{aiaa9pt.sty}
+              [1999/02/22 v2.4 AIAA style file (9pt option)]
+\renewcommand\normalsize{%
+   \@setfontsize\normalsize\@ixpt\@xipt
+   \abovedisplayskip 9\p@ \@plus2\p@ \@minus4\p@
+   \abovedisplayshortskip \z@ \@plus3\p@
+   \belowdisplayshortskip 6\p@ \@plus3\p@ \@minus3\p@
+   \belowdisplayskip \abovedisplayskip
+   \let\@listi\@listI}
+\normalsize
+\renewcommand\small{%
+   \@setfontsize\small\@viiipt\@xpt%
+   \abovedisplayskip 7\p@ \@plus2\p@ \@minus3\p@
+   \abovedisplayshortskip \z@ \@plus2\p@
+   \belowdisplayshortskip 3\p@ \@plus2\p@ \@minus2\p@
+   \def\@listi{\leftmargin\leftmargini
+               \topsep 3\p@ \@plus2\p@ \@minus2\p@
+               \parsep \p@ \@plus\p@ \@minus\p@
+               \itemsep \parsep}%
+   \belowdisplayskip \abovedisplayskip
+}
+\renewcommand\footnotesize{%
+   \@setfontsize\footnotesize\@viipt{8.3}%
+   \abovedisplayskip 4\p@ \@plus2\p@ \@minus3\p@
+   \abovedisplayshortskip \z@ \@plus\p@
+   \belowdisplayshortskip 2\p@ \@plus\p@ \@minus\p@
+   \def\@listi{\leftmargin\leftmargini
+               \topsep 2\p@ \@plus\p@ \@minus\p@
+               \parsep 2\p@ \@plus\p@ \@minus\p@
+               \itemsep \parsep}%
+   \belowdisplayskip \abovedisplayskip
+}
+\renewcommand\scriptsize{\@setfontsize\scriptsize\@vipt\@viipt}
+\renewcommand\tiny{\@setfontsize\tiny\@vpt\@vpt}
+\renewcommand\large{\@setfontsize\large\@xipt{13.6}}
+\renewcommand\Large{\@setfontsize\Large\@xivpt{18}}
+\renewcommand\LARGE{\@setfontsize\LARGE\@xviipt{22}}
+\renewcommand\huge{\@setfontsize\huge\@xxpt{25}}
+\renewcommand\Huge{\@setfontsize\Huge\@xxvpt{30}}
+\if@twocolumn
+  \setlength\parindent{1em}
+\else
+  \setlength\parindent{13\p@}
+\fi
+\setlength\smallskipamount{3\p@ \@plus 1\p@ \@minus 1\p@}
+\setlength\medskipamount{6\p@ \@plus 2\p@ \@minus 2\p@}
+\setlength\bigskipamount{12\p@ \@plus 4\p@ \@minus 4\p@}
+\setlength\headheight{12\p@}
+\setlength\headsep   {25\p@}
+\setlength\topskip   {9\p@}
+\setlength\footskip{30\p@}
+\setlength\maxdepth{.5\topskip}
+  \setlength\@tempdima{\paperwidth}
+  \addtolength\@tempdima{-2in}
+  \setlength\@tempdimb{345\p@}
+  \if@twocolumn
+    \ifdim\@tempdima>2\@tempdimb\relax
+      \setlength\textwidth{2\@tempdimb}
+    \else
+      \setlength\textwidth{\@tempdima}
+    \fi
+  \else
+    \ifdim\@tempdima>\@tempdimb\relax
+      \setlength\textwidth{\@tempdimb}
+    \else
+      \setlength\textwidth{\@tempdima}
+    \fi
+  \fi
+  \@settopoint\textwidth
+  \setlength\@tempdima{\paperheight}
+  \addtolength\@tempdima{-2in}
+  \addtolength\@tempdima{-1.5in}
+  \divide\@tempdima\baselineskip
+  \@tempcnta=\@tempdima
+  \setlength\textheight{\@tempcnta\baselineskip}
+\addtolength\textheight{\topskip}
+\if@twocolumn
+ \setlength\marginparsep {10\p@}
+\else
+  \setlength\marginparsep{11\p@}
+\fi
+\setlength\marginparpush{5\p@}
+  \if@twoside
+    \setlength\@tempdima        {\paperwidth}
+    \addtolength\@tempdima      {-\textwidth}
+    \setlength\oddsidemargin    {.4\@tempdima}
+    \addtolength\oddsidemargin  {-1in}
+    \setlength\marginparwidth   {.6\@tempdima}
+    \addtolength\marginparwidth {-\marginparsep}
+    \addtolength\marginparwidth {-0.4in}
+  \else
+    \setlength\@tempdima        {\paperwidth}
+    \addtolength\@tempdima      {-\textwidth}
+    \setlength\oddsidemargin    {.5\@tempdima}
+    \addtolength\oddsidemargin  {-1in}
+    \setlength\marginparwidth   {.5\@tempdima}
+    \addtolength\marginparwidth {-\marginparsep}
+    \addtolength\marginparwidth {-0.4in}
+    \addtolength\marginparwidth {-.4in}
+  \fi
+  \ifdim \marginparwidth >2in
+     \setlength\marginparwidth{2in}
+  \fi
+  \@settopoint\oddsidemargin
+  \@settopoint\marginparwidth
+  \setlength\evensidemargin  {\paperwidth}
+  \addtolength\evensidemargin{-2in}
+  \addtolength\evensidemargin{-\textwidth}
+  \addtolength\evensidemargin{-\oddsidemargin}
+  \@settopoint\evensidemargin
+  \setlength\topmargin{\paperheight}
+  \addtolength\topmargin{-2in}
+  \addtolength\topmargin{-\headheight}
+  \addtolength\topmargin{-\headsep}
+  \addtolength\topmargin{-\textheight}
+  \addtolength\topmargin{-\footskip}     % this might be wrong!
+  \addtolength\topmargin{-.5\topmargin}
+  \@settopoint\topmargin
+\setlength\footnotesep{5.755\p@}
+\setlength{\skip\footins}{9.5\p@ \@plus 4\p@ \@minus 2\p@}
+\setlength\floatsep    {12\p@ \@plus 2\p@ \@minus 2\p@}
+\setlength\textfloatsep{20\p@ \@plus 2\p@ \@minus 4\p@}
+\setlength\intextsep   {12\p@ \@plus 2\p@ \@minus 2\p@}
+\setlength\dblfloatsep    {12\p@ \@plus 2\p@ \@minus 2\p@}
+\setlength\dbltextfloatsep{20\p@ \@plus 2\p@ \@minus 4\p@}
+\setlength\@fptop{0\p@ \@plus 1fil}
+\setlength\@fpsep{8\p@ \@plus 2fil}
+\setlength\@fpbot{0\p@ \@plus 1fil}
+\setlength\@dblfptop{0\p@ \@plus 1fil}
+\setlength\@dblfpsep{8\p@ \@plus 2fil}
+\setlength\@dblfpbot{0\p@ \@plus 1fil}
+\setlength\partopsep{2\p@ \@plus 1\p@ \@minus 1\p@}
+\def\@listi{\leftmargin\leftmargini
+            \parsep 4\p@ \@plus2\p@ \@minus\p@
+            \topsep 8\p@ \@plus2\p@ \@minus4\p@
+            \itemsep4\p@ \@plus2\p@ \@minus\p@}
+\let\@listI\@listi
+\@listi
+\def\@listii {\leftmargin\leftmarginii
+              \labelwidth\leftmarginii
+              \advance\labelwidth-\labelsep
+              \topsep    4\p@ \@plus2\p@ \@minus\p@
+              \parsep    2\p@ \@plus\p@  \@minus\p@
+              \itemsep   \parsep}
+\def\@listiii{\leftmargin\leftmarginiii
+              \labelwidth\leftmarginiii
+              \advance\labelwidth-\labelsep
+              \topsep    2\p@ \@plus\p@\@minus\p@
+              \parsep    \z@
+              \partopsep \p@ \@plus\z@ \@minus\p@
+              \itemsep   \topsep}
+\def\@listiv {\leftmargin\leftmarginiv
+              \labelwidth\leftmarginiv
+              \advance\labelwidth-\labelsep}
+\def\@listv  {\leftmargin\leftmarginv
+              \labelwidth\leftmarginv
+              \advance\labelwidth-\labelsep}
+\def\@listvi {\leftmargin\leftmarginvi
+              \labelwidth\leftmarginvi
+              \advance\labelwidth-\labelsep}
+%</style>
+%
+%    \end{macrocode}
+%
+% This brings us to the end of \pkg{aiaa9pt.sty}.
+%
+% \subsection{AIAA Bibliographic Style File}
+%
+%    \begin{macrocode}
+%
+%<*bibstyle>
+%
+% note: this file generated by p. daly's custom-bib software
+%
+ENTRY
+  { address
+    author
+    booktitle
+    chapter
+    edition
+    editor
+    howpublished
+    institution
+    journal
+    key
+    month
+    note
+    number
+    organization
+    pages
+    publisher
+    school
+    series
+    title
+    type
+    volume
+    year
+  }
+  {}
+  { label }
+
+INTEGERS { output.state before.all mid.sentence after.sentence after.block }
+
+FUNCTION {init.state.consts}
+{ #0 'before.all :=
+  #1 'mid.sentence :=
+  #2 'after.sentence :=
+  #3 'after.block :=
+}
+
+STRINGS { s t }
+
+FUNCTION {output.nonnull}
+{ 's :=
+  output.state mid.sentence =
+    { ", " * write$ }
+    { output.state after.block =
+        { add.period$ write$
+          newline$
+          "\newblock " write$
+        }
+        { output.state before.all =
+            'write$
+            { add.period$ " " * write$ }
+          if$
+        }
+      if$
+      mid.sentence 'output.state :=
+    }
+  if$
+  s
+}
+
+FUNCTION {output}
+{ duplicate$ empty$
+    'pop$
+    'output.nonnull
+  if$
+}
+
+FUNCTION {output.check}
+{ 't :=
+  duplicate$ empty$
+    { pop$ "empty " t * " in " * cite$ * warning$ }
+    'output.nonnull
+  if$
+}
+
+FUNCTION {fin.entry}
+{ add.period$
+  write$
+  newline$
+}
+
+FUNCTION {new.block}
+{ output.state before.all =
+    'skip$
+    { after.block 'output.state := }
+  if$
+}
+
+FUNCTION {new.sentence}
+{ output.state after.block =
+    'skip$
+    { output.state before.all =
+        'skip$
+        { after.sentence 'output.state := }
+      if$
+    }
+  if$
+}
+
+FUNCTION {add.blank}
+{  " " * before.all 'output.state :=
+}
+
+FUNCTION {date.block}
+{
+  skip$
+}
+
+FUNCTION {not}
+{   { #0 }
+    { #1 }
+  if$
+}
+
+FUNCTION {and}
+{   'skip$
+    { pop$ #0 }
+  if$
+}
+
+FUNCTION {or}
+{   { pop$ #1 }
+    'skip$
+  if$
+}
+
+FUNCTION {non.stop}
+{ duplicate$
+   "}" * add.period$
+   #-1 #1 substring$ "." =
+}
+
+FUNCTION {new.block.checka}
+{ empty$
+    'skip$
+    'new.block
+  if$
+}
+
+FUNCTION {new.block.checkb}
+{ empty$
+  swap$ empty$
+  and
+    'skip$
+    'new.block
+  if$
+}
+
+FUNCTION {new.sentence.checka}
+{ empty$
+    'skip$
+    'new.sentence
+  if$
+}
+
+FUNCTION {new.sentence.checkb}
+{ empty$
+  swap$ empty$
+  and
+    'skip$
+    'new.sentence
+  if$
+}
+
+FUNCTION {field.or.null}
+{ duplicate$ empty$
+    { pop$ "" }
+    'skip$
+  if$
+}
+
+FUNCTION {emphasize}
+{ duplicate$ empty$
+    { pop$ "" }
+    { "{\em " swap$ * "\/}" * }
+  if$
+}
+
+FUNCTION {capitalize}
+{ "u" change.case$ "t" change.case$ }
+
+FUNCTION {space.word}
+{ " " swap$ * " " * }
+
+ % Here are the language-specific definitions for explicit words.
+ % Each function has a name bbl.xxx where xxx is the English word.
+ % The language selected here is ENGLISH
+FUNCTION {bbl.and}
+{ "and"}
+
+FUNCTION {bbl.editors}
+{ "editors" }
+
+FUNCTION {bbl.editor}
+{ "editor" }
+
+FUNCTION {bbl.edby}
+{ "edited by" }
+
+FUNCTION {bbl.edition}
+{ "ed." }
+
+FUNCTION {bbl.volume}
+{ "Vol." }
+
+FUNCTION {bbl.of}
+{ "of" }
+
+FUNCTION {bbl.number}
+{ "No." }
+
+FUNCTION {bbl.nr}
+{ "No." }
+
+FUNCTION {bbl.in}
+{ "in" }
+
+FUNCTION {bbl.pages}
+{ "pp." }
+
+FUNCTION {bbl.page}
+{ "p." }
+
+FUNCTION {bbl.chapter}
+{ "chap." }
+
+FUNCTION {bbl.techrep}
+{ "Tech. Rep." }
+
+FUNCTION {bbl.mthesis}
+{ "Master's thesis" }
+
+FUNCTION {bbl.phdthesis}
+{ "Ph.D. thesis" }
+
+FUNCTION {bbl.first}
+{ "1st" }
+
+FUNCTION {bbl.second}
+{ "2nd" }
+
+FUNCTION {bbl.third}
+{ "3rd" }
+
+FUNCTION {bbl.fourth}
+{ "4th" }
+
+FUNCTION {bbl.fifth}
+{ "5th" }
+
+FUNCTION {bbl.st}
+{ "st" }
+
+FUNCTION {bbl.nd}
+{ "nd" }
+
+FUNCTION {bbl.rd}
+{ "rd" }
+
+FUNCTION {bbl.th}
+{ "th" }
+
+MACRO {jan} {"Jan."}
+
+MACRO {feb} {"Feb."}
+
+MACRO {mar} {"March"}
+
+MACRO {apr} {"April"}
+
+MACRO {may} {"May"}
+
+MACRO {jun} {"June"}
+
+MACRO {jul} {"July"}
+
+MACRO {aug} {"Aug."}
+
+MACRO {sep} {"Sept."}
+
+MACRO {oct} {"Oct."}
+
+MACRO {nov} {"Nov."}
+
+MACRO {dec} {"Dec."}
+
+MACRO {jan-feb} {"Jan.-Feb."}
+
+MACRO {mar-apr} {"Mar.-Apr."}
+
+MACRO {may-jun} {"May-Jun."}
+
+MACRO {jul-aug} {"Jul.-Aug."}
+
+MACRO {sep-oct} {"Sep.-Oct."}
+
+MACRO {nov-dec} {"Nov.-Dec."}
+
+FUNCTION {eng.ord}
+{ duplicate$ "1" swap$ *
+  #-2 #1 substring$ "1" =
+     { bbl.th * }
+     { duplicate$ #-1 #1 substring$
+       duplicate$ "1" =
+         { pop$ bbl.st * }
+         { duplicate$ "2" =
+             { pop$ bbl.nd * }
+             { "3" =
+                 { bbl.rd * }
+                 { bbl.th * }
+               if$
+             }
+           if$
+          }
+       if$
+     }
+   if$
+}
+
+MACRO {jsr} {"Journal of Spacecraft and Rockets"}
+
+MACRO {aa} {"Aerospace America"}
+
+MACRO {sn} {"Space News"}
+
+MACRO {awst} {"Aviation Week \& Space Technology"}
+
+MACRO {jcp} {"Journal of Computational Physics"}
+
+MACRO {ijcfd} {"International Journal of Computational Fluid Dynamics"}
+
+MACRO {ijnme} {"International Journal for Numerical Methods in Engineering"}
+
+MACRO {acmcs} {"ACM Computing Surveys"}
+
+MACRO {acta} {"Acta Informatica"}
+
+MACRO {cacm} {"Communications of the ACM"}
+
+MACRO {ibmjrd} {"IBM Journal of Research and Development"}
+
+MACRO {ibmsj} {"IBM Systems Journal"}
+
+MACRO {ieeese} {"IEEE Transactions on Software Engineering"}
+
+MACRO {ieeetc} {"IEEE Transactions on Computers"}
+
+MACRO {ieeetcad}
+ {"IEEE Transactions on Computer-Aided Design of Integrated Circuits"}
+
+MACRO {ipl} {"Information Processing Letters"}
+
+MACRO {jacm} {"Journal of the ACM"}
+
+MACRO {jcss} {"Journal of Computer and System Sciences"}
+
+MACRO {scp} {"Science of Computer Programming"}
+
+MACRO {sicomp} {"SIAM Journal on Computing"}
+
+MACRO {tocs} {"ACM Transactions on Computer Systems"}
+
+MACRO {tods} {"ACM Transactions on Database Systems"}
+
+MACRO {tog} {"ACM Transactions on Graphics"}
+
+MACRO {toms} {"ACM Transactions on Mathematical Software"}
+
+MACRO {toois} {"ACM Transactions on Office Information Systems"}
+
+MACRO {toplas} {"ACM Transactions on Programming Languages and Systems"}
+
+MACRO {tcs} {"Theoretical Computer Science"}
+
+INTEGERS { nameptr namesleft numnames }
+
+FUNCTION {format.names}
+{ 's :=
+  #1 'nameptr :=
+  s num.names$ 'numnames :=
+  numnames 'namesleft :=
+    { namesleft #0 > }
+    { s nameptr
+      "{vv~}{ll}{, jj}{, f.}" format.name$ 't :=
+      nameptr #1 >
+        {
+          namesleft #1 >
+            { ", " * t * }
+            {
+              numnames #2 >
+                { "," * }
+                'skip$
+              if$
+              t "others" =
+                { " et~al." * }
+                { bbl.and space.word * t * }
+              if$
+            }
+          if$
+        }
+        't
+      if$
+      nameptr #1 + 'nameptr :=
+      namesleft #1 - 'namesleft :=
+    }
+  while$
+}
+
+FUNCTION {format.names.ed}
+{ 's :=
+  #1 'nameptr :=
+  s num.names$ 'numnames :=
+  numnames 'namesleft :=
+    { namesleft #0 > }
+    { s nameptr
+      "{f.~}{vv~}{ll}{, jj}"
+      format.name$ 't :=
+      nameptr #1 >
+        {
+          namesleft #1 >
+            { ", " * t * }
+            {
+              numnames #2 >
+                { "," * }
+                'skip$
+              if$
+              t "others" =
+                { " et~al." * }
+                { bbl.and space.word * t * }
+              if$
+            }
+          if$
+        }
+        't
+      if$
+      nameptr #1 + 'nameptr :=
+      namesleft #1 - 'namesleft :=
+    }
+  while$
+}
+
+FUNCTION {format.authors}
+{ author empty$
+    { "" }
+    {
+      author format.names
+    }
+  if$
+}
+
+FUNCTION {format.editors}
+{ editor empty$
+    { "" }
+    {
+      editor format.names
+      editor num.names$ #1 >
+        { ", " * bbl.editors * }
+        { ", " * bbl.editor * }
+      if$
+    }
+  if$
+}
+
+FUNCTION {format.in.editors}
+{ editor empty$
+    { "" }
+    { editor format.names.ed
+    }
+  if$
+}
+
+FUNCTION {format.title}
+{ title empty$
+    { "" }
+    { title
+      "\enquote{" swap$ *
+      non.stop
+        { ",} " * }
+        { "} " * }
+      if$
+    }
+  if$
+}
+
+FUNCTION {end.quote.title}
+{ title empty$
+    'skip$
+    { before.all 'output.state := }
+  if$
+}
+
+FUNCTION {output.bibitem}
+{ newline$
+  "\bibitem{" write$
+  cite$ write$
+  "}" write$
+  newline$
+  ""
+  before.all 'output.state :=
+}
+
+FUNCTION {n.dashify}
+{ 't :=
+  ""
+    { t empty$ not }
+    { t #1 #1 substring$ "-" =
+        { t #1 #2 substring$ "--" = not
+            { "--" *
+              t #2 global.max$ substring$ 't :=
+            }
+            {   { t #1 #1 substring$ "-" = }
+                { "-" *
+                  t #2 global.max$ substring$ 't :=
+                }
+              while$
+            }
+          if$
+        }
+        { t #1 #1 substring$ *
+          t #2 global.max$ substring$ 't :=
+        }
+      if$
+    }
+  while$
+}
+
+FUNCTION {word.in}
+{ "" }
+
+FUNCTION {format.date}
+{ year empty$
+    { month empty$
+        { "" }
+        { "there's a month but no year in " cite$ * warning$
+          month
+        }
+      if$
+    }
+    { month empty$
+        'year
+        { month " " * year * }
+      if$
+    }
+  if$
+}
+
+FUNCTION {format.btitle}
+{ title emphasize
+}
+
+FUNCTION {tie.or.space.connect}
+{ duplicate$ text.length$ #3 <
+    { "~" }
+    { " " }
+  if$
+  swap$ * *
+}
+
+FUNCTION {either.or.check}
+{ empty$
+    'pop$
+    { "can't use both " swap$ * " fields in " * cite$ * warning$ }
+  if$
+}
+
+FUNCTION {format.bvolume}
+{ volume empty$
+    { "" }
+    { bbl.volume volume tie.or.space.connect
+      series empty$
+        'skip$
+        { bbl.of space.word * series emphasize * }
+      if$
+      "volume and number" number either.or.check
+    }
+  if$
+}
+
+FUNCTION {format.number.series}
+{ volume empty$
+    { number empty$
+        { series field.or.null }
+        { output.state mid.sentence =
+            { bbl.number }
+            { bbl.number capitalize }
+          if$
+          number tie.or.space.connect
+          series empty$
+            { "there's a number but no series in " cite$ * warning$ }
+            { bbl.in space.word * series * }
+          if$
+        }
+      if$
+    }
+    { "" }
+  if$
+}
+
+FUNCTION {is.num}
+{ chr.to.int$
+  duplicate$ "0" chr.to.int$ < not
+  swap$ "9" chr.to.int$ > not and
+}
+
+FUNCTION {extract.num}
+{ duplicate$ 't :=
+  "" 's :=
+  { t empty$ not }
+  { t #1 #1 substring$
+    t #2 global.max$ substring$ 't :=
+    duplicate$ is.num
+      { s swap$ * 's := }
+      { pop$ "" 't := }
+    if$
+  }
+  while$
+  s empty$
+    'skip$
+    { pop$ s }
+  if$
+}
+
+FUNCTION {convert.edition}
+{ edition extract.num "l" change.case$ 's :=
+  s "first" = s "1" = or
+    { bbl.first 't := }
+    { s "second" = s "2" = or
+        { bbl.second 't := }
+        { s "third" = s "3" = or
+            { bbl.third 't := }
+            { s "fourth" = s "4" = or
+                { bbl.fourth 't := }
+                { s "fifth" = s "5" = or
+                    { bbl.fifth 't := }
+                    { s #1 #1 substring$ is.num
+                        { s eng.ord 't := }
+                        { edition 't := }
+                      if$
+                    }
+                  if$
+                }
+              if$
+            }
+          if$
+        }
+      if$
+    }
+  if$
+  t
+}
+
+FUNCTION {format.edition}
+{ edition empty$
+    { "" }
+    { output.state mid.sentence =
+        { convert.edition "l" change.case$ " " * bbl.edition * }
+        { convert.edition "t" change.case$ " " * bbl.edition * }
+      if$
+    }
+  if$
+}
+
+INTEGERS { multiresult }
+
+FUNCTION {multi.page.check}
+{ 't :=
+  #0 'multiresult :=
+    { multiresult not
+      t empty$ not
+      and
+    }
+    { t #1 #1 substring$
+      duplicate$ "-" =
+      swap$ duplicate$ "," =
+      swap$ "+" =
+      or or
+        { #1 'multiresult := }
+        { t #2 global.max$ substring$ 't := }
+      if$
+    }
+  while$
+  multiresult
+}
+
+FUNCTION {format.pages}
+{ pages empty$
+    { "" }
+    { pages multi.page.check
+        { bbl.pages pages n.dashify tie.or.space.connect }
+        { bbl.page pages tie.or.space.connect }
+      if$
+    }
+  if$
+}
+
+FUNCTION {format.journal.pages}
+{
+  pages empty$
+    'skip$
+    { duplicate$ empty$
+        { pop$ format.pages }
+        { ", " * bbl.pages "~" * * pages n.dashify * }
+      if$
+    }
+  if$
+}
+
+FUNCTION {format.vol.num.pages}
+{ volume field.or.null
+  volume empty$
+    'skip$
+    { bbl.volume "~" * swap$ * }
+  if$
+  number empty$
+    'skip$
+    {
+      ", " bbl.nr * number tie.or.space.connect *
+      volume empty$
+        { "there's a number but no volume in " cite$ * warning$ }
+        'skip$
+      if$
+    }
+  if$
+}
+
+FUNCTION {format.chapter.pages}
+{ chapter empty$
+    { "" }
+    { type empty$
+        { bbl.chapter }
+        { type "l" change.case$ }
+      if$
+      chapter tie.or.space.connect
+    }
+  if$
+}
+
+FUNCTION {format.in.ed.booktitle}
+{ booktitle empty$
+    { "" }
+    { editor empty$
+        { word.in booktitle emphasize * }
+        { word.in booktitle emphasize *
+          ", " *
+          bbl.edby
+          *
+          " " *
+          format.in.editors *
+        }
+      if$
+    }
+  if$
+}
+
+FUNCTION {empty.misc.check}
+{ author empty$ title empty$ howpublished empty$
+  month empty$ year empty$ note empty$
+  and and and and and
+    { "all relevant fields are empty in " cite$ * warning$ }
+    'skip$
+  if$
+}
+
+FUNCTION {format.thesis.type}
+{ type empty$
+    'skip$
+    { pop$
+      type "t" change.case$
+    }
+  if$
+}
+
+FUNCTION {format.tr.number}
+{ type empty$
+    { bbl.techrep }
+    'type
+  if$
+  number empty$
+    { "t" change.case$ }
+    { number tie.or.space.connect }
+  if$
+}
+
+FUNCTION {format.article.crossref}
+{
+  key empty$
+    { journal empty$
+        { "need key or journal for " cite$ * " to crossref " * crossref *
+          warning$
+          ""
+        }
+        { word.in journal emphasize * }
+      if$
+    }
+    { word.in key * " " *}
+  if$
+  " \cite{" * crossref * "}" *
+}
+
+FUNCTION {format.crossref.editor}
+{ editor #1 "{vv~}{ll}" format.name$
+  editor num.names$ duplicate$
+  #2 >
+    { pop$ " et~al." * }
+    { #2 <
+        'skip$
+        { editor #2 "{ff }{vv }{ll}{ jj}" format.name$ "others" =
+            { " et~al." * }
+            { bbl.and space.word * editor #2 "{vv~}{ll}" format.name$ * }
+          if$
+        }
+      if$
+    }
+  if$
+}
+
+FUNCTION {format.book.crossref}
+{ volume empty$
+    { "empty volume in " cite$ * "'s crossref of " * crossref * warning$
+      word.in
+    }
+    { bbl.volume volume tie.or.space.connect
+      bbl.of space.word *
+    }
+  if$
+  editor empty$
+  editor field.or.null author field.or.null =
+  or
+    { key empty$
+        { series empty$
+            { "need editor, key, or series for " cite$ * " to crossref " *
+              crossref * warning$
+              "" *
+            }
+            { series emphasize * }
+          if$
+        }
+        { key * }
+      if$
+    }
+    { format.crossref.editor * }
+  if$
+  " \cite{" * crossref * "}" *
+}
+
+FUNCTION {format.incoll.inproc.crossref}
+{
+  editor empty$
+  editor field.or.null author field.or.null =
+  or
+    { key empty$
+        { booktitle empty$
+            { "need editor, key, or booktitle for " cite$ * " to crossref " *
+              crossref * warning$
+              ""
+            }
+            { word.in booktitle emphasize * }
+          if$
+        }
+        { word.in key * " " *}
+      if$
+    }
+    { word.in format.crossref.editor * " " *}
+  if$
+  " \cite{" * crossref * "}" *
+}
+
+FUNCTION {format.publisher}
+{ publisher empty$
+    { "empty publisher in " cite$ * warning$ }
+    'skip$
+  if$
+  ""
+  address empty$ publisher empty$ and
+    'skip$
+    {
+      publisher empty$
+        { address empty$
+          'skip$
+          { address * }
+          if$
+        }
+        { publisher *
+          address empty$
+            'skip$
+            { ", " * address * }
+          if$
+        }
+      if$
+    }
+  if$
+  output
+}
+
+FUNCTION {article}
+{ output.bibitem
+  format.authors "author" output.check
+  format.title "title" output.check
+  end.quote.title
+  crossref missing$
+    { journal
+      emphasize
+      "journal" output.check
+      format.vol.num.pages output
+      format.date "year" output.check
+    }
+    { format.article.crossref output.nonnull
+      format.pages output
+    }
+  if$
+  format.journal.pages
+  note output
+  fin.entry
+}
+
+FUNCTION {book}
+{ output.bibitem
+  author empty$
+    { format.editors "author and editor" output.check
+    }
+    { format.authors output.nonnull
+      crossref missing$
+        { "author and editor" editor either.or.check }
+        'skip$
+      if$
+    }
+  if$
+  format.btitle "title" output.check
+  crossref missing$
+    { format.bvolume output
+      format.number.series output
+      format.publisher
+    }
+    {
+      format.book.crossref output.nonnull
+    }
+  if$
+  format.edition output
+  format.date "year" output.check
+  note output
+  fin.entry
+}
+
+FUNCTION {booklet}
+{ output.bibitem
+  format.authors output
+  format.title "title" output.check
+  end.quote.title
+  howpublished output
+  address output
+  format.date output
+  note output
+  fin.entry
+}
+
+FUNCTION {inbook}
+{ output.bibitem
+  author empty$
+    { format.editors "author and editor" output.check
+    }
+    { format.authors output.nonnull
+      crossref missing$
+        { "author and editor" editor either.or.check }
+        'skip$
+      if$
+    }
+  if$
+  format.btitle "title" output.check
+  crossref missing$
+    {
+      format.bvolume output
+      format.chapter.pages "chapter and pages" output.check
+      format.number.series output
+      format.publisher
+    }
+    {
+      format.chapter.pages "chapter and pages" output.check
+      format.book.crossref output.nonnull
+    }
+  if$
+  format.edition output
+  format.date "year" output.check
+  format.pages "pages" output.check
+  note output
+  fin.entry
+}
+
+FUNCTION {incollection}
+{ output.bibitem
+  format.authors "author" output.check
+  format.title "title" output.check
+  end.quote.title
+  crossref missing$
+    { format.in.ed.booktitle "booktitle" output.check
+      format.bvolume output
+      format.number.series output
+      format.chapter.pages output
+      format.publisher
+      format.edition output
+      format.date "year" output.check
+    }
+    { format.incoll.inproc.crossref output.nonnull
+      format.chapter.pages output
+    }
+  if$
+  format.pages "pages" output.check
+  note output
+  fin.entry
+}
+
+FUNCTION {inproceedings}
+{ output.bibitem
+  format.authors "author" output.check
+  format.title "title" output.check
+  end.quote.title
+  crossref missing$
+    { format.in.ed.booktitle "booktitle" output.check
+      format.bvolume output
+      format.number.series output
+      publisher empty$
+        { organization output
+          address output
+        }
+        { organization output
+          format.publisher
+        }
+      if$
+      format.date "year" output.check
+    }
+    { format.incoll.inproc.crossref output.nonnull
+      format.pages output
+    }
+  if$
+  format.pages "pages" output.check
+  note output
+  fin.entry
+}
+
+FUNCTION {conference} { inproceedings }
+
+FUNCTION {manual}
+{ output.bibitem
+  author empty$
+    { organization empty$
+        'skip$
+        { organization output.nonnull
+          address output
+        }
+      if$
+    }
+    { format.authors output.nonnull }
+  if$
+  format.btitle "title" output.check
+  author empty$
+    { organization empty$
+    {
+          address output
+        }
+        'skip$
+      if$
+    }
+    {
+      organization output
+      address output
+    }
+  if$
+  format.edition output
+  format.date output
+  note output
+  fin.entry
+}
+
+FUNCTION {mastersthesis}
+{ output.bibitem
+  format.authors "author" output.check
+  format.btitle "title" output.check
+  bbl.mthesis format.thesis.type output.nonnull
+  school "school" output.check
+  address output
+  format.date "year" output.check
+  note output
+  fin.entry
+}
+
+FUNCTION {misc}
+{ output.bibitem
+  format.authors output
+  format.title output
+  end.quote.title
+  howpublished output
+  format.date output
+  note output
+  fin.entry
+  empty.misc.check
+}
+
+FUNCTION {phdthesis}
+{ output.bibitem
+  format.authors "author" output.check
+  format.btitle "title" output.check
+  bbl.phdthesis format.thesis.type output.nonnull
+  school "school" output.check
+  address output
+  format.date "year" output.check
+  note output
+  fin.entry
+}
+
+FUNCTION {proceedings}
+{ output.bibitem
+  editor empty$
+    { organization output }
+    { format.editors output.nonnull }
+  if$
+  format.btitle "title" output.check
+  format.bvolume output
+  format.number.series output
+  address empty$
+    { editor empty$
+        { publisher new.sentence.checka }
+        { organization publisher new.sentence.checkb
+          organization output
+        }
+      if$
+      publisher output
+      format.date "year" output.check
+    }
+    { address output.nonnull
+      format.date "year" output.check
+      editor empty$
+        'skip$
+        { organization output }
+      if$
+      publisher output
+    }
+  if$
+  note output
+  fin.entry
+}
+
+FUNCTION {techreport}
+{ output.bibitem
+  format.authors "author" output.check
+  format.title "title" output.check
+  end.quote.title
+  format.tr.number output.nonnull
+  institution "institution" output.check
+  address output
+  format.date "year" output.check
+  note output
+  fin.entry
+}
+
+FUNCTION {unpublished}
+{ output.bibitem
+  format.authors "author" output.check
+  format.title "title" output.check
+  end.quote.title
+  note "note" output.check
+  fin.entry
+}
+
+FUNCTION {default.type} { misc }
+
+READ
+
+STRINGS { longest.label }
+
+INTEGERS { number.label longest.label.width }
+
+FUNCTION {initialize.longest.label}
+{ "" 'longest.label :=
+  #1 'number.label :=
+  #0 'longest.label.width :=
+}
+
+FUNCTION {longest.label.pass}
+{ number.label int.to.str$ 'label :=
+  number.label #1 + 'number.label :=
+  label width$ longest.label.width >
+    { label 'longest.label :=
+      label width$ 'longest.label.width :=
+    }
+    'skip$
+  if$
+}
+
+EXECUTE {initialize.longest.label}
+
+ITERATE {longest.label.pass}
+
+FUNCTION {begin.bib}
+{ preamble$ empty$
+    'skip$
+    { preamble$ write$ newline$ }
+  if$
+  "\begin{thebibliography}{"  longest.label  * "}" *
+  write$ newline$
+  "\newcommand{\enquote}[1]{``#1''}"
+  write$ newline$
+}
+
+EXECUTE {begin.bib}
+
+EXECUTE {init.state.consts}
+
+ITERATE {call.type$}
+
+FUNCTION {end.bib}
+{ newline$
+  "\end{thebibliography}" write$ newline$
+}
+
+EXECUTE {end.bib}
+%</bibstyle>
+%    \end{macrocode}
+%
+% This brings us to the end of \file{aiaa.bst}.
+%
+% \subsection{AIAA Endfloat Configuration File}
+%
+%    \begin{macrocode}
+%
+%<*enfconfig>
+  \renewcommand{\listfigurename}{List of Figure Captions}
+  \renewcommand{\listtablename}{List of Table Captions}
+  \setcounter{lofdepth}{2}% puts subfigure captions in lof
+  \def\numberline#1{\setlength{\@tempdima}{0.3in}%
+    \hb@xt@\@tempdima{#1:}}% make bold numbers
+  \renewcommand*{\l@figure}[2]{\vskip\abovedisplayskip%
+   \setlength\@tempdima{1.5em}%
+   \noindent{\bfseries \figurename\ #1}\par}
+  \renewcommand*{\l@table}[2]{%
+   \setlength\@tempdima{1.5em}%
+   \noindent{\bfseries \tablename}\
+  #1\hfil\vskip\belowdisplayskip }
+% change lof behavior for subfigures:
+  \renewcommand{\@dottedxxxline}[6]{%
+    \ifnum #2>\@nameuse{c@#1depth}\else
+      \vskip 3pt\hspace{0em}{\bfseries #5}\par\vskip 1pt
+      \fi}
+  \newcommand{\lox@subfigure}{\thesubfigure}
+  \newcommand{\lox@subtable}{\thesubtable}
+  \renewcommand{\@subcaption}[2]{%
+    \begingroup
+    \let\label\@gobble
+    \let\protect\string
+    \edef\@currentlabel{\csname lox@#1\endcsname}%
+    \xdef\@subfigcaptionlist{%
+        \@subfigcaptionlist,%
+        {\numberline{\@currentlabel}\noexpand{\ignorespaces #2}}}%
+   \endgroup
+   \@nameuse{@make#1caption}{\@nameuse{@the#1}}{#2}}
+  \renewcommand{\@makecaption}[2]{}
+  \renewcommand{\@makesubfigurecaption}[2]{}
+  \renewcommand{\@makesubtablecaption}[2]{}
+  \let\OrigCaption\caption
+  \renewcommand{\caption}[2][X]{\OrigCaption[#2]{}}
+  \newcommand{\processfigures@hooka}{\@empty}
+  \def\AtEndFigures{\g@addto@macro\processfigures@hooka}
+  \newcommand{\processtables@hooka}{\@empty}
+  \def\AtEndTables{\g@addto@macro\processtables@hooka}
+  \AtBeginTables{\cfoot{\footnotesize\scshape\tablename\ \thetable\captionlabeldelim}}
+  \AtEndTables{\cfoot{}}
+  \AtBeginFigures{\cfoot{\footnotesize\scshape\figurename\ \thefigure\captionlabeldelim}}
+  \AtEndFigures{\cfoot{}}
+  \def\processfigures{%
+   \expandafter\ifnum \csname @ef@fffopen\endcsname>0
+    \immediate\closeout\efloat@postfff \ef@setct{fff}{0}
+    \clearpage                                                        % bj
+    \if@figlist                                                       % bj
+      {\normalsize\listoffigures} % bj
+      \clearpage                                                   % bj
+    \fi
+    \if@fighead
+       \section*{\figuresection}                                   % bj
+       \suppressfloats[t]                                          % jpg
+    \fi
+    \markboth{\uppercase{\figuresection}}{\uppercase{\figuresection}}% bj
+    \processfigures@hook \@input{\jobname.fff} \processfigures@hooka
+   \fi}
+  \def\processtables{%
+    \expandafter\ifnum \csname @ef@tttopen\endcsname>0
+    \immediate\closeout\efloat@postttt \ef@setct{ttt}{0}
+    \clearpage                                                      % bj
+    \if@tablist                                                     % bj
+      {\normalsize\listoftables}                                    % bj
+      \clearpage % bj
+    \fi
+    \if@tabhead
+        \section*{\tablesection}                                  % bj
+        \suppressfloats[t]                                        % jpg
+    \fi
+    \markboth{\uppercase{\tablesection}}{\uppercase{\tablesection}}% bj
+    \processtables@hook \@input{\jobname.ttt} \processtables@hooka
+   \fi}
+%</enfconfig>
+%    \end{macrocode}
+%
+% This brings us to the end of \file{aiaaenf.cfg}.
+%
+% \Finale
+%
diff --git a/Master/texmf-dist/doc/latex/aiaa/pre2004/aiaa.ins b/Master/texmf-dist/doc/latex/aiaa/pre2004/aiaa.ins
new file mode 100644
index 00000000000..68d52e2ddf3
--- /dev/null
+++ b/Master/texmf-dist/doc/latex/aiaa/pre2004/aiaa.ins
@@ -0,0 +1,76 @@
+%
+%  This is file `aiaa.ins', the installation file for the `aiaa'
+%  distribution, version 2.4, dated 1999/02/22 by bil kleb
+%  <w.l.kleb@larc.nasa.gov>
+%
+%  To obtain the individual components of the aiaa bundle necessary
+%  to produce a document, RUN THIS FILE THROUGH LATEX.  The files
+%  will be extracted from the file `aiaa.dtx' via the docstrip utility
+%  that is part of latex.  To produce a users' manual, run the
+%  bundle itself, 'aiaa.dtx', through LaTeX.
+%
+%  You may use the `aiaa' distribution freely, but at your own
+%  risk.  The author can not be held responsible for any consequence
+%  of your using any of these files, or files created from these,
+%  including hardware, software, and data damage.  You may not make
+%  any changes to the files aiaa.dtx or aiaa.ins.  You may incorporate
+%  the code from these files in other files under different names,
+%  provided the original author are given at least some token
+%  amount of credit for his work and that you yourself take
+%  the complaints from the user(s) of your file(s).  You may freely
+%  distribute the files aiaa.dtx, aiaa.ins, and aiaalgo.eps provided:
+%
+%    1) You do not take money for the distribution or use
+%       of these files except for a nominal charge for data medium
+%       and postage
+%    2) You always distribute `aiaa.dtx', `aiaa.ins', and `aiaalgo.eps'
+%       at the same time, i.e., as a package.
+%
+%  `aiaa' is based on the standard LaTeX article class and used
+%  patrick daly's custom-bib package to generate the aiaa
+%  bibliographic style file.  These files were created with
+%  copious help from those in the comp.text.tex newsgroup, the
+%  standard LaTeX books, and various package maintainers.
+%  
+\def\batchfile{aiaa.ins}
+\input docstrip.tex
+
+\keepsilent
+\preamble
+
+The "aiaa" distribution by bil kleb <w.l.kleb@larc.nasa.gov>.
+Please see the file `aiaa.ins' for information on how you may
+(re-)distribute the `aiaa' bundle of files.
+
+\endpreamble
+
+\declarepostamble\bstpostamble
+\endpostamble
+
+\generate{\file{aiaa.cls}   {\from{aiaa.dtx}{class}}}
+\generate{\file{aiaa9pt.sty}{\from{aiaa.dtx}{style}}}
+\generate{\usepostamble\bstpostamble%
+          \file{aiaa.bst}   {\from{aiaa.dtx}{bibstyle}}}
+\generate{\file{aiaaenf.cfg}{\from{aiaa.dtx}{enfconfig}}}
+
+\Msg{::::::::::::::::::::::::::::::::::::::::::::::::::::::::::::::::::::::::}
+\Msg{ }
+\Msg{  Now you should have the following files:}
+\Msg{ }
+\Msg{      aiaa.cls  aiaa9pt.sty  aiaaenf.cfg  aiaalgo.eps}
+\Msg{ }
+\Msg{  They need to be moved into a directory searched by (La)TeX.}
+\Msg{  Furthermore, the  bibliographic style file:}
+\Msg{ }
+\Msg{    aiaa.bst}
+\Msg{ }
+\Msg{  needs to be moved into a directory searched by BibTeX.}
+\Msg{ }
+\Msg{  The aiaa users manual, which is created by running}
+\Msg{  the file `aiaa.dtx' through LaTeX, has more detailed}
+\Msg{  installation instructions.}
+\Msg{ }
+\Msg{::::::::::::::::::::::::::::::::::::::::::::::::::::::::::::::::::::::::}
+%%
+%%  end of file aiaa.ins
+%%
diff --git a/Master/texmf-dist/doc/latex/aiaa/pre2004/aiaa.pdf b/Master/texmf-dist/doc/latex/aiaa/pre2004/aiaa.pdf
new file mode 100644
index 00000000000..254012f9bea
--- /dev/null
+++ b/Master/texmf-dist/doc/latex/aiaa/pre2004/aiaa.pdf
diff --git a/Master/texmf-dist/doc/latex/aiaa/pre2004/aiaalgo.eps b/Master/texmf-dist/doc/latex/aiaa/pre2004/aiaalgo.eps
new file mode 100644
index 00000000000..7b084add44b
--- /dev/null
+++ b/Master/texmf-dist/doc/latex/aiaa/pre2004/aiaalgo.eps
@@ -0,0 +1,6416 @@
+%!PS-Adobe-3.0 EPSF-3.0
+%%Creator: Adobe Illustrator(TM) 7.0
+%%For: (Richard A Wheless) (NASA Langley Research Center)
+%%Title: (AIAALOGO)
+%%CreationDate: (2/3/98) (3:59 PM)
+%%BoundingBox: 247 387 357 420
+%%HiResBoundingBox: 247.1666 387.5 356.6667 419.1667
+%%DocumentProcessColors: Black
+%%DocumentSuppliedResources: procset Adobe_level2_AI5 1.2 0
+%%+ procset Adobe_ColorImage_AI6 1.1 0
+%%+ procset Adobe_Illustrator_AI5 1.2 0
+%%+ procset Adobe_cshow 2.0 8
+%AI5_FileFormat 3
+%AI3_ColorUsage: Black&White
+%AI3_IncludePlacedImages
+%AI7_ImageSettings: 1
+%%CMYKCustomColor: 1 0 0.55 0 (Aqua)
+%%+ 1 0.5 0 0 (Blue)
+%%+ 0.5 0.4 0.3 0 (Blue Gray)
+%%+ 0.8 0.05 0 0 (Blue Sky)
+%%+ 0.5 0.85 1 0 (Brown)
+%%+ 1 0.9 0.1 0 (Dark Blue)
+%%+ 1 0.55 1 0 (Forest Green)
+%%+ 0.05 0.2 0.95 0 (Gold)
+%%+ 0.75 0.05 1 0 (Grass Green)
+%%+ 0 0.45 1 0 (Orange)
+%%+ 0.15 1 1 0 (Red)
+%%+ 0.45 0.9 0 0 (Violet)
+%%AI6_ColorSeparationSet: 1 1 (AI6 Default Color Separation Set) 
+%%+ Options: 1 16 0 1 0 1 1 1 0 1 1 1 1 18 0 0 0 0 0 0 0 0 -1 -1
+%%+ PPD: 1 21 0 0 60 45 2 2 1 0 0 1 0 0 0 0 0 0 0 0 0 0 () 
+%AI3_TemplateBox: 306 396 306 396
+%AI3_TileBox: 30 31 582 761
+%AI3_DocumentPreview: Header
+%AI5_ArtSize: 612 792
+%AI5_RulerUnits: 0
+%AI5_ArtFlags: 1 0 0 1 0 0 1 1 0
+%AI5_TargetResolution: 800
+%AI5_NumLayers: 1
+%AI5_OpenToView: 218 464 6 1018 725 18 0 1 3 40 0 0
+%AI5_OpenViewLayers: 7
+%%PageOrigin:30 31
+%%AI3_PaperRect:-30 761 582 -31
+%%AI3_Margin:30 -31 -30 31
+%AI7_GridSettings: 72 8 72 8 1 0 0.768627 0.843137 1 0.884314 0.921569 1
+%%EndComments
+%%BeginProlog
+%%BeginResource: procset Adobe_level2_AI5 1.2 0
+%%Title: (Adobe Illustrator (R) Version 5.0 Level 2 Emulation)
+%%Version: 1.2 0
+%%CreationDate: (04/10/93) ()
+%%Copyright: ((C) 1987-1996 Adobe Systems Incorporated All Rights Reserved)
+userdict /Adobe_level2_AI5 25 dict dup begin
+	put
+	/packedarray where not
+	{
+		userdict begin
+		/packedarray
+		{
+			array astore readonly
+		} bind def
+		/setpacking /pop load def
+		/currentpacking false def
+	 end
+		0
+	} if
+	pop
+	userdict /defaultpacking currentpacking put true setpacking
+	/initialize
+	{
+		Adobe_level2_AI5 begin
+	} bind def
+	/terminate
+	{
+		currentdict Adobe_level2_AI5 eq
+		{
+		 end
+		} if
+	} bind def
+	mark
+	/setcustomcolor where not
+	{
+		/findcmykcustomcolor
+		{
+			0
+			6 packedarray
+		} bind def
+		/findrgbcustomcolor
+		{
+			1
+			5 packedarray
+		} bind def
+		/setcustomcolor
+		{
+			exch 
+			aload pop 
+			0 eq
+			{
+				pop
+				4
+				{
+					4 index mul
+					4 1 roll
+				} repeat
+				5 -1 roll pop
+				setcmykcolor
+			}
+			{
+				pop
+				3
+				{
+					1 exch sub
+					3 index mul 
+					1 exch sub
+					3 1 roll
+				} repeat
+				4 -1 roll pop
+				setrgbcolor
+			} ifelse
+		}
+		def
+	} if
+	
+	/gt38? mark {version cvr cvx exec} stopped {cleartomark true} {38 gt exch pop} ifelse def
+	userdict /deviceDPI 72 0 matrix defaultmatrix dtransform dup mul exch dup mul add sqrt put
+	userdict /level2?
+	systemdict /languagelevel known dup
+	{
+		pop systemdict /languagelevel get 2 ge
+	} if
+	put
+/level2ScreenFreq
+{
+ begin
+		60
+		HalftoneType 1 eq
+		{
+			pop Frequency
+		} if
+		HalftoneType 2 eq
+		{
+			pop GrayFrequency
+		} if
+		HalftoneType 5 eq
+		{
+			pop Default level2ScreenFreq
+		} if
+ end
+} bind def
+userdict /currentScreenFreq  
+	level2? {currenthalftone level2ScreenFreq} {currentscreen pop pop} ifelse put
+level2? not
+	{
+		/setcmykcolor where not
+		{
+			/setcmykcolor
+			{
+				exch .11 mul add exch .59 mul add exch .3 mul add
+				1 exch sub setgray
+			} def
+		} if
+		/currentcmykcolor where not
+		{
+			/currentcmykcolor
+			{
+				0 0 0 1 currentgray sub
+			} def
+		} if
+		/setoverprint where not
+		{
+			/setoverprint /pop load def
+		} if
+		/selectfont where not
+		{
+			/selectfont
+			{
+				exch findfont exch
+				dup type /arraytype eq
+				{
+					makefont
+				}
+				{
+					scalefont
+				} ifelse
+				setfont
+			} bind def
+		} if
+		/cshow where not
+		{
+			/cshow
+			{
+				[
+				0 0 5 -1 roll aload pop
+				] cvx bind forall
+			} bind def
+		} if
+	} if
+	cleartomark
+	/anyColor?
+	{
+		add add add 0 ne
+	} bind def
+	/testColor
+	{
+		gsave
+		setcmykcolor currentcmykcolor
+		grestore
+	} bind def
+	/testCMYKColorThrough
+	{
+		testColor anyColor?
+	} bind def
+	userdict /composite?
+	level2?
+	{
+		gsave 1 1 1 1 setcmykcolor currentcmykcolor grestore
+		add add add 4 eq
+	}
+	{
+		1 0 0 0 testCMYKColorThrough
+		0 1 0 0 testCMYKColorThrough
+		0 0 1 0 testCMYKColorThrough
+		0 0 0 1 testCMYKColorThrough
+		and and and
+	} ifelse
+	put
+	composite? not
+	{
+		userdict begin
+		gsave
+		/cyan? 1 0 0 0 testCMYKColorThrough def
+		/magenta? 0 1 0 0 testCMYKColorThrough def
+		/yellow? 0 0 1 0 testCMYKColorThrough def
+		/black? 0 0 0 1 testCMYKColorThrough def
+		grestore
+		/isCMYKSep? cyan? magenta? yellow? black? or or or def
+		/customColor? isCMYKSep? not def
+	 end
+	} if
+ end defaultpacking setpacking
+%%EndResource
+%%BeginProcSet: Adobe_ColorImage_AI6 1.1 0
+userdict /Adobe_ColorImage_AI6 known not
+{
+	userdict /Adobe_ColorImage_AI6 24 dict put 
+} if
+userdict /Adobe_ColorImage_AI6 get begin
+/initialize
+{ 
+	Adobe_ColorImage_AI6 begin
+	Adobe_ColorImage_AI6
+	{
+		dup type /arraytype eq
+		{
+			dup xcheck
+			{
+				bind
+			} if
+		} if
+		pop pop
+	} forall
+} def
+/terminate { end } def
+currentdict /Adobe_ColorImage_AI6_Vars known not
+{
+	/Adobe_ColorImage_AI6_Vars 15 dict def
+} if
+Adobe_ColorImage_AI6_Vars begin
+	/channelcount 0 def
+	/sourcecount 0 def
+	/sourcearray 4 array def
+	/plateindex -1 def
+	/XIMask 0 def
+	/XIBinary 0 def
+	/XIChannelCount 0 def
+	/XIBitsPerPixel 0 def
+	/XIImageHeight 0 def
+	/XIImageWidth 0 def
+	/XIImageMatrix null def
+	/XIBuffer null def
+	/XIDataProc null def
+	/XIVersion 6 def
+end
+/WalkRGBString null def
+/WalkCMYKString null def
+/StuffRGBIntoGrayString null def
+/RGBToGrayImageProc null def
+/StuffCMYKIntoGrayString null def
+/CMYKToGrayImageProc null def
+/ColorImageCompositeEmulator null def
+/SeparateCMYKImageProc null def
+/FourEqual null def
+/TestPlateIndex null def
+currentdict /_colorimage known not
+{
+	/colorimage where
+	{
+		/colorimage get /_colorimage exch def
+	}
+	{
+		/_colorimage null def
+	} ifelse
+} if
+/_currenttransfer systemdict /currenttransfer get def
+/colorimage null def
+/XI null def
+/WalkRGBString
+{
+	0 3 index
+	dup length 1 sub 0 3 3 -1 roll
+	{
+		3 getinterval { } forall
+		5 index exec
+		3 index
+	} for
+	
+	 5 { pop } repeat
+} def
+/WalkCMYKString
+{
+	0 3 index
+	dup length 1 sub 0 4 3 -1 roll
+	{
+		4 getinterval { } forall
+		
+		6 index exec
+		
+		3 index
+		
+	} for
+	
+	5 { pop } repeat
+	
+} def
+/StuffRGBIntoGrayString
+{
+	.11 mul exch
+	
+	.59 mul add exch
+	
+	.3 mul add
+	
+	cvi 3 copy put
+	
+	pop 1 add
+} def
+/RGBToGrayImageProc
+{	
+	Adobe_ColorImage_AI6_Vars begin 
+		sourcearray 0 get exec
+		dup length 3 idiv string
+		dup 3 1 roll 
+		
+		/StuffRGBIntoGrayString load exch
+		WalkRGBString
+ end
+} def
+/StuffCMYKIntoGrayString
+{
+	exch .11 mul add
+	
+	exch .59 mul add
+	
+	exch .3 mul add
+	
+	dup 255 gt { pop 255 } if
+	
+	255 exch sub cvi 3 copy put
+	
+	pop 1 add
+} def
+/CMYKToGrayImageProc
+{	
+	Adobe_ColorImage_AI6_Vars begin
+		sourcearray 0 get exec
+		dup length 4 idiv string
+		dup 3 1 roll 
+		
+		/StuffCMYKIntoGrayString load exch
+		WalkCMYKString
+ end
+} def
+/ColorImageCompositeEmulator
+{
+	pop true eq
+	{
+		Adobe_ColorImage_AI6_Vars /sourcecount get 5 add { pop } repeat
+	}
+	{
+		Adobe_ColorImage_AI6_Vars /channelcount get 1 ne
+		{
+			Adobe_ColorImage_AI6_Vars begin
+				sourcearray 0 3 -1 roll put
+			
+				channelcount 3 eq 
+				{ 
+					/RGBToGrayImageProc 
+				}
+				{ 
+					/CMYKToGrayImageProc
+				} ifelse
+				load
+		 end
+		} if
+		image
+	} ifelse
+} def
+/SeparateCMYKImageProc
+{	
+	Adobe_ColorImage_AI6_Vars begin
+		sourcecount 0 ne
+		{
+			sourcearray plateindex get exec
+		}
+		{			
+			sourcearray 0 get exec
+			
+			dup length 4 idiv string
+			
+			0 2 index
+			
+			plateindex 4 2 index length 1 sub
+			{
+				get 255 exch sub
+				
+				3 copy put pop 1 add
+				
+				2 index
+			} for
+			pop pop exch pop
+		} ifelse
+ end
+} def
+	
+/FourEqual
+{
+	4 index ne
+	{
+		pop pop pop false
+	}
+	{
+		4 index ne
+		{
+			pop pop false
+		}
+		{
+			4 index ne
+			{
+				pop false
+			}
+			{
+				4 index eq
+			} ifelse
+		} ifelse
+	} ifelse
+} def
+/TestPlateIndex
+{
+	Adobe_ColorImage_AI6_Vars begin
+		/plateindex -1 def
+		/setcmykcolor where
+		{
+			pop
+			gsave
+			1 0 0 0 setcmykcolor systemdict /currentgray get exec 1 exch sub
+			0 1 0 0 setcmykcolor systemdict /currentgray get exec 1 exch sub
+			0 0 1 0 setcmykcolor systemdict /currentgray get exec 1 exch sub
+			0 0 0 1 setcmykcolor systemdict /currentgray get exec 1 exch sub
+			grestore
+			1 0 0 0 FourEqual 
+			{ 
+				/plateindex 0 def
+			}
+			{
+				0 1 0 0 FourEqual
+				{ 
+					/plateindex 1 def
+				}
+				{
+					0 0 1 0 FourEqual
+					{
+						/plateindex 2 def
+					}
+					{
+						0 0 0 1 FourEqual
+						{ 
+							/plateindex 3 def
+						}
+						{
+							0 0 0 0 FourEqual
+							{
+								/plateindex 5 def
+							} if
+						} ifelse
+					} ifelse
+				} ifelse
+			} ifelse
+			pop pop pop pop
+		} if
+		plateindex
+ end
+} def
+/colorimage
+{
+	Adobe_ColorImage_AI6_Vars begin
+		/channelcount 1 index def
+		/sourcecount 2 index 1 eq { channelcount 1 sub } { 0 } ifelse def
+		4 sourcecount add index dup 
+		8 eq exch 1 eq or not
+ end
+	
+	{
+		/_colorimage load null ne
+		{
+			_colorimage
+		}
+		{
+			Adobe_ColorImage_AI6_Vars /sourcecount get
+			7 add { pop } repeat
+		} ifelse
+	}
+	{
+		dup 3 eq
+		TestPlateIndex
+		dup -1 eq exch 5 eq or or
+		{
+			/_colorimage load null eq
+			{
+				ColorImageCompositeEmulator
+			}
+			{
+				dup 1 eq
+				{
+					pop pop image
+				}
+				{
+					Adobe_ColorImage_AI6_Vars /plateindex get 5 eq
+					{
+						gsave
+						
+						0 _currenttransfer exec
+						1 _currenttransfer exec
+						eq
+						{ 0 _currenttransfer exec 0.5 lt }
+						{ 0 _currenttransfer exec 1 _currenttransfer exec gt } ifelse
+						
+						{ { pop 0 } } { { pop 1 } } ifelse
+						systemdict /settransfer get exec
+					} if
+					
+					_colorimage
+					
+					Adobe_ColorImage_AI6_Vars /plateindex get 5 eq
+					{
+						grestore
+					} if
+				} ifelse
+			} ifelse
+		}
+		{
+			dup 1 eq
+			{
+				pop pop
+				image
+			}
+			{
+				pop pop
+				Adobe_ColorImage_AI6_Vars begin
+					sourcecount -1 0
+					{			
+						exch sourcearray 3 1 roll put
+					} for
+					/SeparateCMYKImageProc load
+			 end
+				systemdict /image get exec
+			} ifelse
+		} ifelse
+	} ifelse
+} def
+/XG
+{
+	pop pop
+} def
+/XF
+{
+	13 {pop} repeat
+} def
+/Xh
+{
+	Adobe_ColorImage_AI6_Vars begin
+		gsave
+		/XIMask exch 0 ne def
+		/XIImageHeight exch def
+		/XIImageWidth exch def
+		/XIImageMatrix exch def
+		0 0 moveto
+		XIImageMatrix concat
+		XIImageWidth XIImageHeight scale
+		
+		XIMask
+		{
+			/_lp /null ddef
+			_fc
+			/_lp /imagemask ddef
+		}
+		if
+		/XIVersion 7 def
+ end
+} def
+/XH
+{
+	Adobe_ColorImage_AI6_Vars begin
+		/XIVersion 6 def
+		grestore
+ end
+} def
+/XI
+{
+	Adobe_ColorImage_AI6_Vars begin
+		gsave
+		/XIMask exch 0 ne def
+		/XIBinary exch 0 ne def
+		pop
+		pop
+		/XIChannelCount exch def
+		/XIBitsPerPixel exch def
+		/XIImageHeight exch def
+		/XIImageWidth exch def
+		pop pop pop pop
+		/XIImageMatrix exch def
+		XIBitsPerPixel 1 eq
+		{
+			XIImageWidth 8 div ceiling cvi
+		}
+		{
+			XIImageWidth XIChannelCount mul
+		} ifelse
+		/XIBuffer exch string def
+		XIBinary
+		{
+			/XIDataProc { currentfile XIBuffer readstring pop } def
+			XIVersion 6 le
+			{
+				currentfile 128 string readline pop pop
+			}
+			if
+		}
+		{
+			/XIDataProc { currentfile XIBuffer readhexstring pop } def
+		} ifelse
+		
+		XIVersion 6 le
+		{
+			0 0 moveto
+			XIImageMatrix concat
+			XIImageWidth XIImageHeight scale
+			XIMask
+			{
+				/_lp /null ddef
+				_fc
+				/_lp /imagemask ddef
+			} if
+		} if
+		
+		XIMask
+		{
+			XIImageWidth XIImageHeight
+			false
+			[ XIImageWidth 0 0 XIImageHeight neg 0 0 ]
+			/XIDataProc load
+			imagemask
+		}
+		{
+			XIImageWidth XIImageHeight
+			XIBitsPerPixel
+			[ XIImageWidth 0 0 XIImageHeight neg 0 0 ]
+			/XIDataProc load
+			
+			XIChannelCount 1 eq
+			{
+				gsave
+				0 setgray
+				image
+				grestore
+			}
+			{
+				false
+				XIChannelCount
+				colorimage
+			} ifelse
+		} ifelse
+		grestore
+ end
+} def
+end
+%%EndProcSet
+%%BeginResource: procset Adobe_Illustrator_AI5 1.2 0
+%%Title: (Adobe Illustrator (R) Version 7.0 Full Prolog)
+%%Version: 1.2 0
+%%CreationDate: (3/7/1994) ()
+%%Copyright: ((C) 1987-1996 Adobe Systems Incorporated All Rights Reserved)
+currentpacking true setpacking
+userdict /Adobe_Illustrator_AI5_vars 107 dict dup begin
+put
+/_eo false def
+/_lp /none def
+/_pf
+{
+} def
+/_ps
+{
+} def
+/_psf
+{
+} def
+/_pss
+{
+} def
+/_pjsf
+{
+} def
+/_pjss
+{
+} def
+/_pola 0 def
+/_doClip 0 def
+/cf currentflat def
+/_lineorientation 0 def
+/_charorientation 0 def
+/_yokoorientation 0 def
+/_tm matrix def
+/_renderStart
+[
+/e0 /r0 /a0 /o0 /e1 /r1 /a1 /i0
+] def
+/_renderEnd
+[
+null null null null /i1 /i1 /i1 /i1
+] def
+/_render -1 def
+/_shift [0 0] def
+/_ax 0 def
+/_ay 0 def
+/_cx 0 def
+/_cy 0 def
+/_leading
+[
+0 0
+] def
+/_ctm matrix def
+/_mtx matrix def
+/_sp 16#020 def
+/_hyphen (-) def
+/_fontSize 0 def
+/_fontAscent 0 def
+/_fontDescent 0 def
+/_fontHeight 0 def
+/_fontRotateAdjust 0 def
+/Ss 256 string def
+Ss 0 (fonts/) putinterval
+/_cnt 0 def
+/_scale [1 1] def
+/_nativeEncoding 0 def
+/_useNativeEncoding 0 def
+/_tempEncode 0 def
+/_pntr 0 def
+/_tDict 2 dict def
+/_hfname 100 string def
+/_hffound false def
+/Tx
+{
+} def
+/Tj
+{
+} def
+/CRender
+{
+} def
+/_AI3_savepage
+{
+} def
+/_gf null def
+/_cf 4 array def
+/_rgbf 3 array def
+/_if null def
+/_of false def
+/_fc
+{
+} def
+/_gs null def
+/_cs 4 array def
+/_rgbs 3 array def
+/_is null def
+/_os false def
+/_sc
+{
+} def
+/_pd 1 dict def
+/_ed 15 dict def
+/_pm matrix def
+/_fm null def
+/_fd null def
+/_fdd null def
+/_sm null def
+/_sd null def
+/_sdd null def
+/_i null def
+/_lobyte 0 def
+/_hibyte 0 def
+/_cproc null def
+/_cscript 0 def
+/_hvax 0 def
+/_hvay 0 def
+/_hvwb 0 def
+/_hvcx 0 def
+/_hvcy 0 def
+/_bitfont null def
+/_bitlobyte 0 def
+/_bithibyte 0 def
+/_bitkey null def
+/_bitdata null def
+/_bitindex 0 def
+/discardSave null def
+/buffer 256 string def
+/beginString null def
+/endString null def
+/endStringLength null def
+/layerCnt 1 def
+/layerCount 1 def
+/perCent (%) 0 get def
+/perCentSeen? false def
+/newBuff null def
+/newBuffButFirst null def
+/newBuffLast null def
+/clipForward? false def
+end
+userdict /Adobe_Illustrator_AI5 known not {
+	userdict /Adobe_Illustrator_AI5 95 dict put
+} if
+userdict /Adobe_Illustrator_AI5 get begin
+/initialize
+{
+	Adobe_Illustrator_AI5 dup begin
+	Adobe_Illustrator_AI5_vars begin
+	discardDict
+	{
+		bind pop pop
+	} forall
+	dup /nc get begin
+	{
+		dup xcheck 1 index type /operatortype ne and
+		{
+			bind
+		} if
+		pop pop
+	} forall
+ end
+	newpath
+} def
+/terminate
+{
+ end
+ end
+} def
+/_
+null def
+/ddef
+{
+	Adobe_Illustrator_AI5_vars 3 1 roll put
+} def
+/xput
+{
+	dup load dup length exch maxlength eq
+	{
+		dup dup load dup
+		length 2 mul dict copy def
+	} if
+	load begin
+	def
+ end
+} def
+/npop
+{
+	{
+		pop
+	} repeat
+} def
+/hswj
+{
+	dup stringwidth 3 2 roll
+	{
+		_hvwb eq { exch _hvcx add exch _hvcy add } if
+		exch _hvax add exch _hvay add
+	} cforall
+} def
+/vswj
+{
+	0 0 3 -1 roll
+	{
+		dup 255 le
+		_charorientation 1 eq
+		and
+		{
+			dup cstring stringwidth 5 2 roll
+			_hvwb eq { exch _hvcy sub exch _hvcx sub } if
+			exch _hvay sub exch _hvax sub
+			4 -1 roll sub exch
+			3 -1 roll sub exch
+		}
+		{
+			_hvwb eq { exch _hvcy sub exch _hvcx sub } if
+			exch _hvay sub exch _hvax sub
+			_fontHeight sub
+		} ifelse
+	} cforall
+} def
+/swj
+{
+	6 1 roll
+	/_hvay exch ddef
+	/_hvax exch ddef
+	/_hvwb exch ddef
+	/_hvcy exch ddef
+	/_hvcx exch ddef
+	_lineorientation 0 eq { hswj } { vswj } ifelse
+} def
+/sw
+{
+	0 0 0 6 3 roll swj
+} def
+/vjss
+{
+	4 1 roll
+	{
+		dup cstring
+		dup length 1 eq
+		_charorientation 1 eq
+		and
+		{
+			-90 rotate
+			currentpoint
+			_fontRotateAdjust add
+			moveto
+			gsave
+			false charpath currentpoint
+			5 index setmatrix stroke
+			grestore
+			_fontRotateAdjust sub
+			moveto
+			_sp eq
+			{
+				5 index 5 index rmoveto
+			} if
+			2 copy rmoveto
+			90 rotate
+		}
+		{
+			currentpoint
+			_fontHeight sub
+			5 index sub
+			3 index _sp eq
+			{
+				9 index sub
+			} if
+	
+			currentpoint
+			exch 4 index stringwidth pop 2 div sub
+			exch _fontAscent sub
+			moveto
+	
+			gsave
+			2 index false charpath
+			6 index setmatrix stroke
+			grestore
+	
+			moveto pop pop
+		} ifelse
+	} cforall
+	6 npop
+} def
+/hjss
+{
+	4 1 roll
+	{
+		dup cstring
+		gsave
+		false charpath currentpoint
+		5 index setmatrix stroke
+		grestore
+		moveto
+		_sp eq
+		{
+			5 index 5 index rmoveto
+		} if
+		2 copy rmoveto
+	} cforall
+	6 npop
+} def
+/jss
+{
+	_lineorientation 0 eq { hjss } { vjss } ifelse
+} def
+/ss
+{
+	0 0 0 7 3 roll jss
+} def
+/vjsp
+{
+	4 1 roll
+	{
+		dup cstring
+		dup length 1 eq
+		_charorientation 1 eq
+		and
+		{
+			-90 rotate
+			currentpoint
+			_fontRotateAdjust add
+			moveto
+			false charpath
+            currentpoint
+			_fontRotateAdjust sub
+			moveto
+			_sp eq
+			{
+				5 index 5 index rmoveto
+			} if
+			2 copy rmoveto
+			90 rotate
+		}
+		{
+			currentpoint
+			_fontHeight sub
+			5 index sub
+			3 index _sp eq
+			{
+				9 index sub
+			} if
+	
+			currentpoint
+			exch 4 index stringwidth pop 2 div sub
+			exch _fontAscent sub
+			moveto
+	
+			2 index false charpath
+	
+			moveto pop pop
+		} ifelse
+	} cforall
+	6 npop
+} def
+/hjsp
+{
+    4 1 roll
+    {
+        dup cstring
+        false charpath
+        _sp eq
+        {
+            5 index 5 index rmoveto
+        } if
+        2 copy rmoveto
+    } cforall
+    6 npop
+} def
+/jsp
+{
+	matrix currentmatrix
+    _lineorientation 0 eq {hjsp} {vjsp} ifelse
+} def
+/sp
+{
+    matrix currentmatrix
+    0 0 0 7 3 roll
+    _lineorientation 0 eq {hjsp} {vjsp} ifelse
+} def
+/pl
+{
+	transform
+	0.25 sub round 0.25 add exch
+	0.25 sub round 0.25 add exch
+	itransform
+} def
+/setstrokeadjust where
+{
+	pop true setstrokeadjust
+	/c
+	{
+		curveto
+	} def
+	/C
+	/c load def
+	/v
+	{
+		currentpoint 6 2 roll curveto
+	} def
+	/V
+	/v load def
+	/y
+	{
+		2 copy curveto
+	} def
+	/Y
+	/y load def
+	/l
+	{
+		lineto
+	} def
+	/L
+	/l load def
+	/m
+	{
+		moveto
+	} def
+}
+{
+	/c
+	{
+		pl curveto
+	} def
+	/C
+	/c load def
+	/v
+	{
+		currentpoint 6 2 roll pl curveto
+	} def
+	/V
+	/v load def
+	/y
+	{
+		pl 2 copy curveto
+	} def
+	/Y
+	/y load def
+	/l
+	{
+		pl lineto
+	} def
+	/L
+	/l load def
+	/m
+	{
+		pl moveto
+	} def
+} ifelse
+/d
+{
+	setdash
+} def
+/cf
+{
+} def
+/i
+{
+	dup 0 eq
+	{
+		pop cf
+	} if
+	setflat
+} def
+/j
+{
+	setlinejoin
+} def
+/J
+{
+	setlinecap
+} def
+/M
+{
+	setmiterlimit
+} def
+/w
+{
+	setlinewidth
+} def
+/XR
+{
+	0 ne
+	/_eo exch ddef
+} def
+/H
+{
+} def
+/h
+{
+	closepath
+} def
+/N
+{
+	_pola 0 eq
+	{
+		_doClip 1 eq
+		{
+			_eo {eoclip} {clip} ifelse /_doClip 0 ddef
+		} if
+		newpath
+	}
+	{
+		/CRender
+		{
+			N
+		} ddef
+	} ifelse
+} def
+/n
+{
+	N
+} def
+/F
+{
+	_pola 0 eq
+	{
+		_doClip 1 eq
+		{
+			gsave _pf grestore _eo {eoclip} {clip} ifelse newpath /_lp /none ddef _fc
+			/_doClip 0 ddef
+		}
+		{
+			_pf
+		} ifelse
+	}
+	{
+		/CRender
+		{
+			F
+		} ddef
+	} ifelse
+} def
+/f
+{
+	closepath
+	F
+} def
+/S
+{
+	_pola 0 eq
+	{
+		_doClip 1 eq
+		{
+			gsave _ps grestore _eo {eoclip} {clip} ifelse newpath /_lp /none ddef _sc
+			/_doClip 0 ddef
+		}
+		{
+			_ps
+		} ifelse
+	}
+	{
+		/CRender
+		{
+			S
+		} ddef
+	} ifelse
+} def
+/s
+{
+	closepath
+	S
+} def
+/B
+{
+	_pola 0 eq
+	{
+		_doClip 1 eq
+		gsave F grestore
+		{
+			gsave S grestore _eo {eoclip} {clip} ifelse newpath /_lp /none ddef _sc
+			/_doClip 0 ddef
+		}
+		{
+			S
+		} ifelse
+	}
+	{
+		/CRender
+		{
+			B
+		} ddef
+	} ifelse
+} def
+/b
+{
+	closepath
+	B
+} def
+/W
+{
+	/_doClip 1 ddef
+} def
+/*
+{
+	count 0 ne
+	{
+		dup type /stringtype eq
+		{
+			pop
+		} if
+	} if
+	newpath
+} def
+/u
+{
+} def
+/U
+{
+} def
+/q
+{
+	_pola 0 eq
+	{
+		gsave
+	} if
+} def
+/Q
+{
+	_pola 0 eq
+	{
+		grestore
+	} if
+} def
+/*u
+{
+	_pola 1 add /_pola exch ddef
+} def
+/*U
+{
+	_pola 1 sub /_pola exch ddef
+	_pola 0 eq
+	{
+		CRender
+	} if
+} def
+/D
+{
+	pop
+} def
+/*w
+{
+} def
+/*W
+{
+} def
+/`
+{
+	/_i save ddef
+	clipForward?
+	{
+		nulldevice
+	} if
+	6 1 roll 4 npop
+	concat pop
+	userdict begin
+	/showpage
+	{
+	} def
+	0 setgray
+	0 setlinecap
+	1 setlinewidth
+	0 setlinejoin
+	10 setmiterlimit
+	[] 0 setdash
+	/setstrokeadjust where {pop false setstrokeadjust} if
+	newpath
+	0 setgray
+	false setoverprint
+} def
+/~
+{
+ end
+	_i restore
+} def
+/O
+{
+	0 ne
+	/_of exch ddef
+	/_lp /none ddef
+} def
+/R
+{
+	0 ne
+	/_os exch ddef
+	/_lp /none ddef
+} def
+/g
+{
+	/_gf exch ddef
+	/_fc
+	{
+		_lp /fill ne
+		{
+			_of setoverprint
+			_gf setgray
+			/_lp /fill ddef
+		} if
+	} ddef
+	/_pf
+	{
+		_fc
+		_eo {eofill} {fill} ifelse
+	} ddef
+	/_psf
+	{
+		_fc
+		hvashow
+	} ddef
+	/_pjsf
+	{
+		_fc
+		hvawidthshow
+	} ddef
+	/_lp /none ddef
+} def
+/G
+{
+	/_gs exch ddef
+	/_sc
+	{
+		_lp /stroke ne
+		{
+			_os setoverprint
+			_gs setgray
+			/_lp /stroke ddef
+		} if
+	} ddef
+	/_ps
+	{
+		_sc
+		stroke
+	} ddef
+	/_pss
+	{
+		_sc
+		ss
+	} ddef
+	/_pjss
+	{
+		_sc
+		jss
+	} ddef
+	/_lp /none ddef
+} def
+/k
+{
+	_cf astore pop
+	/_fc
+	{
+		_lp /fill ne
+		{
+			_of setoverprint
+			_cf aload pop setcmykcolor
+			/_lp /fill ddef
+		} if
+	} ddef
+	/_pf
+	{
+		_fc
+		_eo {eofill} {fill} ifelse
+	} ddef
+	/_psf
+	{
+		_fc
+		hvashow
+	} ddef
+	/_pjsf
+	{
+		_fc
+		hvawidthshow
+	} ddef
+	/_lp /none ddef
+} def
+/K
+{
+	_cs astore pop
+	/_sc
+	{
+		_lp /stroke ne
+		{
+			_os setoverprint
+			_cs aload pop setcmykcolor
+			/_lp /stroke ddef
+		} if
+	} ddef
+	/_ps
+	{
+		_sc
+		stroke
+	} ddef
+	/_pss
+	{
+		_sc
+		ss
+	} ddef
+	/_pjss
+	{
+		_sc
+		jss
+	} ddef
+	/_lp /none ddef
+} def
+/Xa
+{
+	_rgbf astore pop
+	/_fc
+	{
+		_lp /fill ne
+		{
+			_of setoverprint
+			_rgbf aload pop setrgbcolor
+			/_lp /fill ddef
+		} if
+	} ddef
+	/_pf
+	{
+		_fc
+		_eo {eofill} {fill} ifelse
+	} ddef
+	/_psf
+	{
+		_fc
+		hvashow
+	} ddef
+	/_pjsf
+	{
+		_fc
+		hvawidthshow
+	} ddef
+	/_lp /none ddef
+} def
+/XA
+{
+	_rgbs astore pop
+	/_sc
+	{
+		_lp /stroke ne
+		{
+			_os setoverprint
+			_rgbs aload pop setrgbcolor
+			/_lp /stroke ddef
+		} if
+	} ddef
+	/_ps
+	{
+		_sc
+		stroke
+	} ddef
+	/_pss
+	{
+		_sc
+		ss
+	} ddef
+	/_pjss
+	{
+		_sc
+		jss
+	} ddef
+	/_lp /none ddef
+} def
+/_rgbtocmyk
+{
+3
+	{
+	1 exch sub 3 1 roll
+	} repeat
+3 copy 1 4 1 roll
+3
+	{
+	3 index 2 copy gt
+		{
+		exch
+		} if
+	pop 4 1 roll
+	} repeat
+pop pop pop
+4 1 roll
+3
+	{
+	3 index sub
+	3 1 roll
+	} repeat
+4 -1 roll
+} def
+/Xx
+{
+	exch
+	/_gf exch ddef
+	0 eq
+	{
+		findcmykcustomcolor
+	}
+	{
+		/findrgbcustomcolor where not {
+			4 1 roll _rgbtocmyk
+			5 -1 roll
+			findcmykcustomcolor
+		}
+		{
+			pop
+			findrgbcustomcolor
+		} ifelse
+	} ifelse
+	/_if exch ddef
+	/_fc
+	{
+		_lp /fill ne
+		{
+			_of setoverprint
+			_if _gf 1 exch sub setcustomcolor
+			/_lp /fill ddef
+		} if
+	} ddef
+	/_pf
+	{
+		_fc
+		_eo {eofill} {fill} ifelse
+	} ddef
+	/_psf
+	{
+		_fc
+		hvashow
+	} ddef
+	/_pjsf
+	{
+		_fc
+		hvawidthshow
+	} ddef
+	/_lp /none ddef
+} def
+/XX
+{
+	exch
+	/_gs exch ddef
+	0 eq
+	{
+		findcmykcustomcolor
+	}
+	{
+		/findrgbcustomcolor where not {
+			4 1 roll _rgbtocmyk
+			5 -1 roll
+			findcmykcustomcolor
+		}
+		{
+			pop
+			findrgbcustomcolor
+		} ifelse
+	} ifelse
+	/_is exch ddef
+	/_sc
+	{
+		_lp /stroke ne
+		{
+			_os setoverprint
+			_is _gs 1 exch sub setcustomcolor
+			/_lp /stroke ddef
+		} if
+	} ddef
+	/_ps
+	{
+		_sc
+		stroke
+	} ddef
+	/_pss
+	{
+		_sc
+		ss
+	} ddef
+	/_pjss
+	{
+		_sc
+		jss
+	} ddef
+	/_lp /none ddef
+} def
+/x
+{
+	/_gf exch ddef
+	findcmykcustomcolor
+	/_if exch ddef
+	/_fc
+	{
+		_lp /fill ne
+		{
+			_of setoverprint
+			_if _gf 1 exch sub setcustomcolor
+			/_lp /fill ddef
+		} if
+	} ddef
+	/_pf
+	{
+		_fc
+		_eo {eofill} {fill} ifelse
+	} ddef
+	/_psf
+	{
+		_fc
+		hvashow
+	} ddef
+	/_pjsf
+	{
+		_fc
+		hvawidthshow
+	} ddef
+	/_lp /none ddef
+} def
+/X
+{
+	/_gs exch ddef
+	findcmykcustomcolor
+	/_is exch ddef
+	/_sc
+	{
+		_lp /stroke ne
+		{
+			_os setoverprint
+			_is _gs 1 exch sub setcustomcolor
+			/_lp /stroke ddef
+		} if
+	} ddef
+	/_ps
+	{
+		_sc
+		stroke
+	} ddef
+	/_pss
+	{
+		_sc
+		ss
+	} ddef
+	/_pjss
+	{
+		_sc
+		jss
+	} ddef
+	/_lp /none ddef
+} def
+/A
+{
+	pop
+} def
+/annotatepage
+{
+userdict /annotatepage 2 copy known {get exec} {pop pop} ifelse
+} def
+/XT {
+	pop pop
+} def
+/discard
+{
+	save /discardSave exch store
+	discardDict begin
+	/endString exch store
+	gt38?
+	{
+		2 add
+	} if
+	load
+	stopped
+	pop
+ end
+	discardSave restore
+} bind def
+userdict /discardDict 7 dict dup begin
+put
+/pre38Initialize
+{
+	/endStringLength endString length store
+	/newBuff buffer 0 endStringLength getinterval store
+	/newBuffButFirst newBuff 1 endStringLength 1 sub getinterval store
+	/newBuffLast newBuff endStringLength 1 sub 1 getinterval store
+} def
+/shiftBuffer
+{
+	newBuff 0 newBuffButFirst putinterval
+	newBuffLast 0
+	currentfile read not
+	{
+	stop
+	} if
+	put
+} def
+0
+{
+	pre38Initialize
+	mark
+	currentfile newBuff readstring exch pop
+	{
+		{
+			newBuff endString eq
+			{
+				cleartomark stop
+			} if
+			shiftBuffer
+		} loop
+	}
+	{
+	stop
+	} ifelse
+} def
+1
+{
+	pre38Initialize
+	/beginString exch store
+	mark
+	currentfile newBuff readstring exch pop
+	{
+		{
+			newBuff beginString eq
+			{
+				/layerCount dup load 1 add store
+			}
+			{
+				newBuff endString eq
+				{
+					/layerCount dup load 1 sub store
+					layerCount 0 eq
+					{
+						cleartomark stop
+					} if
+				} if
+			} ifelse
+			shiftBuffer
+		} loop
+	} if
+} def
+2
+{
+	mark
+	{
+		currentfile buffer readline not
+		{
+		stop
+		} if
+		endString eq
+		{
+			cleartomark stop
+		} if
+	} loop
+} def
+3
+{
+	/beginString exch store
+	/layerCnt 1 store
+	mark
+	{
+		currentfile buffer readline not
+		{
+		stop
+		} if
+		dup beginString eq
+		{
+			pop /layerCnt dup load 1 add store
+		}
+		{
+			endString eq
+			{
+				layerCnt 1 eq
+				{
+					cleartomark stop
+				}
+				{
+					/layerCnt dup load 1 sub store
+				} ifelse
+			} if
+		} ifelse
+	} loop
+} def
+end
+userdict /clipRenderOff 15 dict dup begin
+put
+{
+	/n /N /s /S /f /F /b /B
+}
+{
+	{
+		_doClip 1 eq
+		{
+			/_doClip 0 ddef _eo {eoclip} {clip} ifelse
+		} if
+		newpath
+	} def
+} forall
+/Tr /pop load def
+/Bb {} def
+/BB /pop load def
+/Bg {12 npop} def
+/Bm {6 npop} def
+/Bc /Bm load def
+/Bh {4 npop} def
+end
+/Lb
+{
+	4 npop
+	6 1 roll
+	pop
+	4 1 roll
+	pop pop pop
+	0 eq
+	{
+		0 eq
+		{
+			(%AI5_BeginLayer) 1 (%AI5_EndLayer--) discard
+		}
+		{
+			
+			/clipForward? true def
+			
+			/Tx /pop load def
+			/Tj /pop load def
+			
+			currentdict end clipRenderOff begin begin
+		} ifelse
+	}
+	{
+		0 eq
+		{
+			save /discardSave exch store
+		} if
+	} ifelse
+} bind def
+/LB
+{
+	discardSave dup null ne
+	{
+		restore
+	}
+	{
+		pop
+		clipForward?
+		{
+			currentdict
+		 end
+		 end
+		 begin
+					
+			/clipForward? false ddef
+		} if
+	} ifelse
+} bind def
+/Pb
+{
+	pop pop
+	0 (%AI5_EndPalette) discard
+} bind def
+/Np
+{
+	0 (%AI5_End_NonPrinting--) discard
+} bind def
+/Ln /pop load def
+/Ap
+/pop load def
+/Ar
+{
+	72 exch div
+	0 dtransform dup mul exch dup mul add sqrt
+	dup 1 lt
+	{
+		pop 1
+	} if
+	setflat
+} def
+/Mb
+{
+	q
+} def
+/Md
+{
+} def
+/MB
+{
+	Q
+} def
+/nc 4 dict def
+nc begin
+/setgray
+{
+	pop
+} bind def
+/setcmykcolor
+{
+	4 npop
+} bind def
+/setrgbcolor
+{
+	3 npop
+} bind def
+/setcustomcolor
+{
+	2 npop
+} bind def
+currentdict readonly pop
+end
+end
+setpacking
+%%EndResource
+%%BeginResource: procset Adobe_cshow 2.0 8
+%%Title: (Writing System Operators)
+%%Version: 2.0 8
+%%CreationDate: (1/23/89) ()
+%%Copyright: ((C) 1992-1996 Adobe Systems Incorporated All Rights Reserved)
+currentpacking true setpacking
+userdict /Adobe_cshow 14 dict dup begin put
+/initialize
+{
+	Adobe_cshow begin
+	Adobe_cshow
+	{
+		dup xcheck
+		{
+			bind
+		} if
+		pop pop
+	} forall
+ end
+	Adobe_cshow begin
+} def
+/terminate
+{
+currentdict Adobe_cshow eq
+	{
+ end
+	} if
+} def
+/cforall
+{
+	/_lobyte 0 ddef
+	/_hibyte 0 ddef
+	/_cproc exch ddef
+	/_cscript currentfont /FontScript known { currentfont /FontScript get } { -1 } ifelse ddef
+	{
+		/_lobyte exch ddef
+		_hibyte 0 eq
+		_cscript 1 eq
+		_lobyte 129 ge _lobyte 159 le and
+		_lobyte 224 ge _lobyte 252 le and or and
+		_cscript 2 eq
+		_lobyte 161 ge _lobyte 254 le and and
+		_cscript 3 eq
+		_lobyte 161 ge _lobyte 254 le and and
+    	_cscript 25 eq
+		_lobyte 161 ge _lobyte 254 le and and
+    	_cscript -1 eq
+		or or or or and
+		{
+			/_hibyte _lobyte ddef
+		}
+		{
+			_hibyte 256 mul _lobyte add
+			_cproc
+			/_hibyte 0 ddef
+		} ifelse
+	} forall
+} def
+/cstring
+{
+	dup 256 lt
+	{
+		(s) dup 0 4 3 roll put
+	}
+	{
+		dup 256 idiv exch 256 mod
+		(hl) dup dup 0 6 5 roll put 1 4 3 roll put
+	} ifelse
+} def
+/clength
+{
+	0 exch
+	{ 256 lt { 1 } { 2 } ifelse add } cforall
+} def
+/hawidthshow
+{
+	{
+		dup cstring
+		show
+		_hvax _hvay rmoveto
+		_hvwb eq { _hvcx _hvcy rmoveto } if
+	} cforall
+} def
+/vawidthshow
+{
+	{
+		dup 255 le
+		_charorientation 1 eq
+		and
+		{
+			-90 rotate
+			0 _fontRotateAdjust rmoveto
+			cstring
+			_hvcx _hvcy _hvwb _hvax _hvay 6 -1 roll awidthshow
+			0 _fontRotateAdjust neg rmoveto
+			90 rotate
+		}
+		{
+			currentpoint
+			_fontHeight sub
+			exch _hvay sub exch _hvax sub
+			2 index _hvwb eq { exch _hvcy sub exch _hvcx sub } if
+			3 2 roll
+			cstring
+			dup stringwidth pop 2 div neg _fontAscent neg rmoveto
+			show
+			moveto
+		} ifelse
+	} cforall
+} def
+/hvawidthshow
+{
+	6 1 roll
+	/_hvay exch ddef
+	/_hvax exch ddef
+	/_hvwb exch ddef
+	/_hvcy exch ddef
+	/_hvcx exch ddef
+	_lineorientation 0 eq { hawidthshow } { vawidthshow } ifelse
+} def
+/hvwidthshow
+{
+	0 0 3 -1 roll hvawidthshow
+} def
+/hvashow
+{
+	0 0 0 6 -3 roll hvawidthshow
+} def
+/hvshow
+{
+	0 0 0 0 0 6 -1 roll hvawidthshow
+} def
+currentdict readonly pop end
+setpacking
+%%EndResource
+%%EndProlog
+%%BeginSetup
+Adobe_level2_AI5 /initialize get exec
+Adobe_cshow /initialize get exec
+Adobe_ColorImage_AI6 /initialize get exec
+Adobe_Illustrator_AI5 /initialize get exec
+%AI5_Begin_NonPrinting
+Np
+%AI3_BeginPattern: (Arrow1.2.out/in)
+(Arrow1.2.out/in) 1 1 39.4039 39.4039 [
+%AI3_Tile
+(0 O 0 R  0.75 0.75 0.375 0 k
+ 0.75 0.75 0.375 0 K
+) @
+(
+%AI6_BeginPatternLayer
+800 Ar
+1 J 0 j 1 w 4 M []0 d
+%AI3_Note:
+0 D
+0 XR
+33.9039 15.6187 m
+39.4247 20.202 L
+39.4247 20.202 L
+33.8869 24.6252 L
+S
+39.2997 20.202 m
+24.5706 20.202 l
+20.4039 20.4792 20.4039 16.8125 v
+20.4039 13.1458 20.4039 12.5625 y
+S
+%AI6_EndPatternLayer
+) &
+] E
+%AI3_EndPattern
+%AI3_BeginPattern: (Arrow1.2.side)
+(Arrow1.2.side) 1 1 39.404 39.4039 [
+%AI3_Tile
+(0 O 0 R  0.75 0.75 0.375 0 k
+ 0.75 0.75 0.375 0 K
+) @
+(
+%AI6_BeginPatternLayer
+800 Ar
+1 J 0 j 1 w 4 M []0 d
+%AI3_Note:
+0 D
+0 XR
+20.202 20.202 m
+39.404 20.202 l
+S
+33.904 15.6187 m
+39.4248 20.202 L
+39.4248 20.202 L
+33.887 24.6252 L
+S
+%AI6_EndPatternLayer
+) &
+] E
+%AI3_EndPattern
+%AI3_BeginPattern: (Bricks)
+(Bricks) 1.6 1.6 73.6 73.6 [
+%AI3_Tile
+(0 O 0 R  0.3 0.85 0.85 0 k
+ 0.3 0.85 0.85 0 K
+) @
+(
+%AI6_BeginPatternLayer
+800 Ar
+0 J 0 j 1 w 4 M []0 d
+%AI3_Note:
+0 D
+0 XR
+1.6 1.6 m
+1.6 73.6 L
+73.6 73.6 L
+73.6 1.6 L
+1.6 1.6 L
+f
+%AI6_EndPatternLayer
+) &
+(0 O 0 R  1 g
+ 1 G
+) @
+(
+%AI6_BeginPatternLayer
+800 Ar
+0 J 0 j 0.3 w 4 M []0 d
+%AI3_Note:
+0 D
+0 XR
+1.6 70.01 m
+73.6 70.01 l
+S
+1.6 62.809 m
+73.6 62.809 L
+S
+1.6 55.609 m
+73.6 55.609 L
+S
+1.6 48.408 m
+73.6 48.408 L
+S
+1.6 41.208 m
+73.6 41.208 L
+S
+1.6 34.007 m
+73.6 34.007 L
+S
+1.6 26.807 m
+73.6 26.807 L
+S
+1.6 19.606 m
+73.6 19.606 L
+S
+1.6 12.406 m
+73.6 12.406 L
+S
+1.6 5.206 m
+73.6 5.206 L
+S
+70.01 70.01 m
+70.01 62.822 l
+S
+55.61 70.01 m
+55.61 62.822 L
+S
+41.21 70.01 m
+41.21 62.822 L
+S
+26.81 70.01 m
+26.81 62.822 L
+S
+12.41 70.01 m
+12.41 62.822 L
+S
+70.01 55.572 m
+70.01 48.385 l
+S
+55.61 55.572 m
+55.61 48.385 L
+S
+41.21 55.572 m
+41.21 48.385 L
+S
+26.81 55.572 m
+26.81 48.385 L
+S
+12.41 55.572 m
+12.41 48.385 L
+S
+70.01 41.197 m
+70.01 34.01 l
+S
+55.61 41.197 m
+55.61 34.01 L
+S
+41.21 41.197 m
+41.21 34.01 L
+S
+26.81 41.197 m
+26.81 34.01 L
+S
+12.41 41.197 m
+12.41 34.01 L
+S
+70.01 26.822 m
+70.01 19.635 l
+S
+55.61 26.822 m
+55.61 19.635 L
+S
+41.21 26.822 m
+41.21 19.635 L
+S
+26.81 26.822 m
+26.81 19.635 L
+S
+12.41 26.822 m
+12.41 19.635 L
+S
+70.01 12.385 m
+70.01 5.197 l
+S
+55.61 12.385 m
+55.61 5.197 L
+S
+41.21 12.385 m
+41.21 5.197 L
+S
+26.81 12.385 m
+26.81 5.197 L
+S
+12.41 12.385 m
+12.41 5.197 L
+S
+62.797 5.197 m
+62.797 1.6 L
+S
+48.397 5.197 m
+48.397 1.6 L
+S
+33.997 5.197 m
+33.997 1.6 L
+S
+19.597 5.197 m
+19.597 1.6 L
+S
+5.197 5.197 m
+5.197 1.6 l
+S
+62.797 19.635 m
+62.797 12.447 L
+S
+48.397 19.635 m
+48.397 12.447 L
+S
+33.997 19.635 m
+33.997 12.447 L
+S
+19.597 19.635 m
+19.597 12.447 L
+S
+5.197 19.635 m
+5.197 12.447 l
+S
+62.797 34.01 m
+62.797 26.822 L
+S
+48.397 34.01 m
+48.397 26.822 L
+S
+19.597 34.01 m
+19.597 26.822 L
+S
+5.197 34.01 m
+5.197 26.822 l
+S
+62.797 48.385 m
+62.797 41.197 L
+S
+48.397 48.385 m
+48.397 41.197 L
+S
+33.997 48.385 m
+33.997 41.197 L
+S
+19.597 48.385 m
+19.597 41.197 L
+S
+5.197 48.385 m
+5.197 41.197 l
+S
+62.797 62.822 m
+62.797 55.635 L
+S
+48.397 62.822 m
+48.397 55.635 L
+S
+33.997 62.822 m
+33.997 55.635 L
+S
+19.597 62.822 m
+19.597 55.635 L
+S
+5.197 62.822 m
+5.197 55.635 l
+S
+62.797 73.5589 m
+62.797 70.072 L
+S
+48.397 73.5589 m
+48.397 70.072 L
+S
+33.997 73.5589 m
+33.997 70.072 L
+S
+19.597 73.5589 m
+19.597 70.072 L
+S
+5.197 73.5589 m
+5.197 70.072 l
+S
+33.997 34.01 m
+33.997 26.822 L
+S
+%AI6_EndPatternLayer
+) &
+] E
+%AI3_EndPattern
+%AI3_BeginPattern: (Checks)
+(Checks) 1 1 31.3995 31.3995 [
+%AI3_Tile
+(0 O 0 R  0 0.9 1 0 k
+ 0 0.9 1 0 K
+) @
+(
+%AI6_BeginPatternLayer
+800 Ar
+0 J 0 j 1 w 4 M []0 d
+%AI3_Note:
+0 D
+1 XR
+19.9995 4.8 m
+27.5995 4.8 L
+27.5995 12.3995 L
+19.9995 12.3995 L
+19.9995 4.8 L
+f
+31.3995 27.5995 m
+31.3995 31.3995 L
+27.5995 31.3995 L
+27.5995 27.5995 L
+31.3995 27.5995 L
+f
+19.9995 27.5995 m
+19.9995 19.9995 L
+27.5995 19.9995 L
+27.5995 27.5995 L
+19.9995 27.5995 L
+f
+0 XR
+12.3995 12.3995 m
+19.9995 12.3995 L
+19.9995 19.9995 L
+12.3995 19.9995 L
+12.3995 12.3995 L
+f
+1 XR
+12.3995 27.5995 m
+4.8 27.5995 L
+4.8 19.9995 L
+12.3995 19.9995 L
+12.3995 27.5995 L
+f
+4.8 12.3995 m
+4.8 4.8 L
+12.3995 4.8 L
+12.3995 12.3995 L
+4.8 12.3995 L
+f
+19.9995 27.5995 m
+19.9995 31.3995 L
+12.3995 31.3995 L
+12.3995 27.5995 L
+19.9995 27.5995 L
+f
+12.3995 4.8 m
+12.3995 1 L
+19.9995 1 L
+19.9995 4.8 L
+12.3995 4.8 L
+f
+4.8 19.9995 m
+1 19.9995 L
+1 12.3995 L
+4.8 12.3995 L
+4.8 19.9995 L
+f
+27.5995 19.9995 m
+27.5995 12.3995 L
+31.3995 12.3995 L
+31.3995 19.9995 L
+27.5995 19.9995 L
+f
+4.8 31.3995 m
+1 31.3995 L
+1 27.5995 L
+4.8 27.5995 L
+4.8 31.3995 L
+f
+27.5995 1 m
+31.3995 1 L
+31.3995 4.8 L
+27.5995 4.8 L
+27.5995 1 L
+f
+1 4.8 m
+1 1 L
+4.8 1 L
+4.8 4.8 L
+1 4.8 L
+f
+%AI6_EndPatternLayer
+) &
+(0 O 0 R  0 0.05 0.2 0 k
+ 0 0.05 0.2 0 K
+) @
+(
+%AI6_BeginPatternLayer
+800 Ar
+0 J 0 j 1 w 4 M []0 d
+%AI3_Note:
+0 D
+1 XR
+4.8 4.8 m
+4.8 1 L
+12.3995 1 L
+12.3995 4.8 L
+4.8 4.8 L
+f
+4.8 12.3995 m
+1 12.3995 L
+1 4.8 L
+4.8 4.8 L
+4.8 12.3995 L
+f
+19.9995 4.8 m
+19.9995 1 L
+27.5995 1 L
+27.5995 4.8 L
+19.9995 4.8 L
+f
+12.3995 12.3995 m
+12.3995 4.8 L
+19.9995 4.8 L
+19.9995 12.3995 L
+12.3995 12.3995 L
+f
+27.5995 4.8 m
+31.3995 4.8 L
+31.3995 12.3995 L
+27.5995 12.3995 L
+27.5995 4.8 L
+f
+12.3995 19.9995 m
+4.8 19.9995 L
+4.8 12.3995 L
+12.3995 12.3995 L
+12.3995 19.9995 L
+f
+4.8 27.5995 m
+1 27.5995 L
+1 19.9995 L
+4.8 19.9995 L
+4.8 27.5995 L
+f
+19.9995 12.3995 m
+27.5995 12.3995 L
+27.5995 19.9995 L
+19.9995 19.9995 L
+19.9995 12.3995 L
+f
+19.9995 19.9995 m
+19.9995 27.5995 L
+12.3995 27.5995 L
+12.3995 19.9995 L
+19.9995 19.9995 L
+f
+27.5995 19.9995 m
+31.3995 19.9995 L
+31.3995 27.5995 L
+27.5995 27.5995 L
+27.5995 19.9995 L
+f
+12.3995 27.5995 m
+12.3995 31.3995 L
+4.8 31.3995 L
+4.8 27.5995 L
+12.3995 27.5995 L
+f
+27.5995 27.5995 m
+27.5995 31.3995 L
+19.9995 31.3995 L
+19.9995 27.5995 L
+27.5995 27.5995 L
+f
+%AI6_EndPatternLayer
+) &
+] E
+%AI3_EndPattern
+%AI3_BeginPattern: (Confetti)
+(Confetti) 4.85 3.617 76.85 75.617 [
+%AI3_Tile
+(0 O 0 R  1 g
+ 1 G
+) @
+(
+%AI6_BeginPatternLayer
+800 Ar
+0 J 0 j 1 w 4 M []0 d
+%AI3_Note:
+0 D
+0 XR
+4.85 3.617 m
+4.85 75.617 L
+76.85 75.617 L
+76.85 3.617 L
+4.85 3.617 L
+f
+%AI6_EndPatternLayer
+) &
+(0 O 0 R  0 g
+ 0 G
+) @
+(
+%AI6_BeginPatternLayer
+800 Ar
+0 J 0 j 0.3 w 4 M []0 d
+%AI3_Note:
+0 D
+0 XR
+10.6 64.867 m
+7.85 62.867 l
+S
+9.1 8.617 m
+6.85 6.867 l
+S
+78.1 68.617 m
+74.85 67.867 l
+S
+76.85 56.867 m
+74.35 55.117 l
+S
+79.6 51.617 m
+76.6 51.617 l
+S
+76.35 44.117 m
+73.6 45.867 l
+S
+78.6 35.867 m
+76.6 34.367 l
+S
+76.1 23.867 m
+73.35 26.117 l
+S
+78.1 12.867 m
+73.85 13.617 l
+S
+68.35 14.617 m
+66.1 12.867 l
+S
+76.6 30.617 m
+73.6 30.617 l
+S
+62.85 58.117 m
+60.956 60.941 l
+S
+32.85 59.617 m
+31.196 62.181 l
+S
+47.891 64.061 m
+49.744 66.742 l
+S
+72.814 2.769 m
+73.928 5.729 l
+S
+67.976 2.633 m
+67.35 5.909 l
+S
+61.85 27.617 m
+59.956 30.441 l
+S
+53.504 56.053 m
+51.85 58.617 l
+S
+52.762 1.779 m
+52.876 4.776 l
+S
+45.391 5.311 m
+47.244 7.992 l
+S
+37.062 3.375 m
+35.639 5.43 l
+S
+55.165 34.828 m
+57.518 37.491 l
+S
+20.795 3.242 m
+22.12 5.193 l
+S
+14.097 4.747 m
+15.008 8.965 l
+S
+9.736 1.91 m
+8.073 4.225 l
+S
+31.891 5.573 m
+32.005 8.571 l
+S
+12.1 70.367 m
+15.6 68.867 l
+S
+9.35 54.867 m
+9.6 58.117 l
+S
+12.85 31.867 m
+14.35 28.117 l
+S
+10.1 37.367 m
+12.35 41.117 l
+S
+34.1 71.117 m
+31.85 68.617 l
+S
+38.35 71.117 m
+41.6 68.367 l
+S
+55.1 71.117 m
+58.35 69.117 l
+S
+57.35 65.117 m
+55.35 61.867 l
+S
+64.35 66.367 m
+69.35 68.617 l
+S
+71.85 62.867 m
+69.35 61.117 l
+S
+23.6 70.867 m
+23.6 67.867 l
+S
+20.6 65.867 m
+17.35 65.367 l
+S
+24.85 61.367 m
+25.35 58.117 l
+S
+25.85 65.867 m
+29.35 66.617 l
+S
+14.1 54.117 m
+16.85 56.117 l
+S
+12.35 11.617 m
+12.6 15.617 l
+S
+12.1 19.867 m
+14.35 22.367 l
+S
+26.1 9.867 m
+23.6 13.367 l
+S
+34.6 47.117 m
+32.1 45.367 l
+S
+62.6 41.867 m
+59.85 43.367 l
+S
+31.6 35.617 m
+27.85 36.367 l
+S
+36.35 26.117 m
+34.35 24.617 l
+S
+33.85 14.117 m
+31.1 16.367 l
+S
+37.1 9.867 m
+35.1 11.117 l
+S
+34.35 20.867 m
+31.35 20.867 l
+S
+44.6 56.617 m
+42.1 54.867 l
+S
+47.35 51.367 m
+44.35 51.367 l
+S
+44.1 43.867 m
+41.35 45.617 l
+S
+43.35 33.117 m
+42.6 30.617 l
+S
+43.85 23.617 m
+41.1 25.867 l
+S
+44.35 15.617 m
+42.35 16.867 l
+S
+67.823 31.1 m
+64.823 31.1 l
+S
+27.1 32.617 m
+29.6 30.867 l
+S
+31.85 55.117 m
+34.85 55.117 l
+S
+19.6 40.867 m
+22.1 39.117 l
+S
+16.85 35.617 m
+19.85 35.617 l
+S
+20.1 28.117 m
+22.85 29.867 l
+S
+52.1 42.617 m
+54.484 44.178 l
+S
+52.437 50.146 m
+54.821 48.325 l
+S
+59.572 54.133 m
+59.35 51.117 l
+S
+50.185 10.055 m
+53.234 9.928 l
+S
+51.187 15.896 m
+53.571 14.075 l
+S
+58.322 19.883 m
+59.445 16.823 l
+S
+53.1 32.117 m
+50.6 30.367 l
+S
+52.85 24.617 m
+49.6 25.617 l
+S
+61.85 9.117 m
+59.1 10.867 l
+S
+69.35 34.617 m
+66.6 36.367 l
+S
+67.1 23.617 m
+65.1 22.117 l
+S
+24.435 46.055 m
+27.484 45.928 l
+S
+25.437 51.896 m
+27.821 50.075 l
+S
+62.6 47.117 m
+65.321 46.575 l
+S
+19.85 19.867 m
+20.35 16.617 l
+S
+21.85 21.867 m
+25.35 22.617 l
+S
+37.6 62.867 m
+41.6 62.117 l
+S
+38.323 42.1 m
+38.823 38.6 l
+S
+69.35 52.617 m
+66.85 53.867 l
+S
+14.85 62.117 m
+18.1 59.367 l
+S
+9.6 46.117 m
+7.1 44.367 l
+S
+20.6 51.617 m
+18.6 50.117 l
+S
+46.141 70.811 m
+47.994 73.492 l
+S
+69.391 40.561 m
+71.244 43.242 l
+S
+38.641 49.311 m
+39.35 52.117 l
+S
+25.141 16.811 m
+25.85 19.617 l
+S
+36.6 32.867 m
+34.6 31.367 l
+S
+6.1 68.617 m
+2.85 67.867 l
+S
+4.85 56.867 m
+2.35 55.117 l
+S
+7.6 51.617 m
+4.6 51.617 l
+S
+6.6 35.867 m
+4.6 34.367 l
+S
+6.1 12.867 m
+1.85 13.617 l
+S
+4.6 30.617 m
+1.6 30.617 l
+S
+72.814 74.769 m
+73.928 77.729 l
+S
+67.976 74.633 m
+67.35 77.909 l
+S
+52.762 73.779 m
+52.876 76.776 l
+S
+37.062 75.375 m
+35.639 77.43 l
+S
+20.795 75.242 m
+22.12 77.193 l
+S
+9.736 73.91 m
+8.073 76.225 l
+S
+10.1 23.617 m
+6.35 24.367 l
+S
+73.217 18.276 m
+71.323 21.1 l
+S
+28.823 39.6 m
+29.505 42.389 l
+S
+49.6 38.617 m
+47.6 37.117 l
+S
+60.323 73.6 m
+62.323 76.6 l
+S
+60.323 1.6 m
+62.323 4.6 l
+S
+%AI6_EndPatternLayer
+) &
+] E
+%AI3_EndPattern
+%AI3_BeginPattern: (DblLine1.2.inner)
+(DblLine1.2.inner) 1 1 39.2705 39.2706 [
+%AI3_Tile
+(0 O 0 R  1 0.14 0.09 0 k
+ 1 0.14 0.09 0 K
+) @
+(
+%AI6_BeginPatternLayer
+800 Ar
+0 J 0 j 1 w 4 M []0 d
+%AI3_Note:
+0 D
+0 XR
+39.2702 22.175 m
+39.2702 13.6108 L
+26.66 13.6108 L
+26.66 1.0003 L
+18.0958 1.0003 L
+18.0948 22.175 L
+18.0958 22.175 L
+18.0958 22.1752 L
+39.2702 22.175 L
+f
+39.2708 24.6929 m
+15.5779 24.6929 L
+15.5779 1.0003 L
+14.9037 1.0003 L
+14.9032 25.3675 L
+39.2708 25.3675 L
+39.2708 24.6929 L
+f
+%AI6_EndPatternLayer
+) &
+] E
+%AI3_EndPattern
+%AI3_BeginPattern: (DblLine1.2.outer)
+(DblLine1.2.outer) 1 1.0003 39.2706 39.271 [
+%AI3_Tile
+(0 O 0 R  1 0.14 0.09 0 k
+ 1 0.14 0.09 0 K
+) @
+(
+%AI6_BeginPatternLayer
+800 Ar
+0 J 0 j 0.3 w 4 M []0 d
+%AI3_Note:
+0 D
+0 XR
+39.2708 26.6602 m
+13.6111 26.6602 L
+13.6111 1.0005 L
+22.1751 1 L
+22.1751 18.096 L
+39.2708 18.096 L
+39.2708 26.6602 L
+f
+39.2708 15.578 m
+24.6928 15.578 L
+24.6928 1 L
+25.367 1 L
+25.367 14.9038 L
+39.2708 14.9038 L
+39.2708 15.578 L
+f
+%AI6_EndPatternLayer
+) &
+] E
+%AI3_EndPattern
+%AI3_BeginPattern: (DblLine1.2.side)
+(DblLine1.2.side) 1 1 39.2706 39.2706 [
+%AI3_Tile
+(0 O 0 R  1 0.14 0.09 0 k
+ 1 0.14 0.09 0 K
+) @
+(
+%AI6_BeginPatternLayer
+800 Ar
+0 J 0 j 0.3 w 4 M []0 d
+%AI3_Note:
+0 D
+0 XR
+39.2704 18.0958 m
+39.2704 26.6598 L
+1.0001 26.6598 L
+1.0001 18.0958 L
+39.2704 18.0958 L
+f
+39.2704 14.9037 m
+39.2704 15.5776 L
+1.0001 15.5776 L
+1.0001 14.9037 L
+39.2704 14.9037 L
+f
+%AI6_EndPatternLayer
+) &
+] E
+%AI3_EndPattern
+%AI3_BeginPattern: (Diamonds)
+(Diamonds) 1 1 37.1865 41.9411 [
+%AI3_Tile
+(0 O 0 R  0.2 0 1 0 k
+ 0.2 0 1 0 K
+) @
+(
+%AI6_BeginPatternLayer
+800 Ar
+0 J 0 j 0.3 w 4 M []0 d
+%AI3_Note:
+0 D
+0 XR
+1.0002 1.0004 m
+1.0002 41.9411 L
+37.1865 41.9411 L
+37.1865 1.0004 L
+1.0002 1.0004 L
+f
+%AI6_EndPatternLayer
+) &
+(0 O 0 R  0 g
+ 0 G
+) @
+(
+%AI6_BeginPatternLayer
+800 Ar
+0 J 0 j 1 w 4 M []0 d
+%AI3_Note:
+0 D
+1 XR
+19.0936 41.9408 m
+19.0929 41.9408 L
+19.0933 41.9402 L
+19.0936 41.9408 L
+f
+7.0311 41.9408 m
+7.0304 41.9408 L
+7.0308 41.9402 L
+7.0311 41.9408 L
+f
+31.1556 41.9408 m
+31.1548 41.9408 L
+31.1552 41.9402 L
+31.1556 41.9408 L
+f
+%AI6_EndPatternLayer
+) &
+(0 O 0 R  0.75 0.9 0 0 k
+ 0.75 0.9 0 0 K
+) @
+(
+%AI6_BeginPatternLayer
+800 Ar
+0 J 0 j 0.3 w 4 M []0 d
+%AI3_Note:
+0 D
+1 XR
+37.1865 1 m
+37.1865 11.2349 L
+31.1552 1 L
+37.1865 1 L
+f
+19.0933 1 m
+31.1552 1 L
+25.124 11.2349 L
+19.0933 1 L
+f
+7.0308 1 m
+19.0933 1 L
+13.062 11.2349 L
+7.0308 1 L
+f
+1 1 m
+7.0308 1 L
+1 11.2349 L
+1 1 L
+f
+37.1859 11.2349 m
+37.1865 11.236 L
+37.1865 31.7059 L
+31.1552 21.4704 L
+37.1859 11.2349 L
+f
+19.0933 21.4704 m
+25.124 11.2349 L
+31.1552 21.4704 L
+25.124 31.7059 L
+19.0933 21.4704 L
+f
+7.0308 21.4704 m
+13.062 11.2349 L
+19.0933 21.4704 L
+13.062 31.7059 L
+7.0308 21.4704 L
+f
+1 31.7059 m
+1 11.2349 L
+7.0308 21.4704 L
+1 31.7059 L
+f
+37.1859 31.7059 m
+37.1865 31.707 L
+37.1865 41.9408 L
+31.1556 41.9408 L
+31.1552 41.9402 L
+37.1859 31.7059 L
+f
+25.124 31.7059 m
+31.1552 41.9402 L
+31.1548 41.9408 L
+19.0936 41.9408 L
+19.0933 41.9402 L
+25.124 31.7059 L
+f
+13.062 31.7059 m
+19.0933 41.9402 L
+19.0929 41.9408 L
+7.0311 41.9408 L
+7.0308 41.9402 L
+13.062 31.7059 L
+f
+7.0304 41.9408 m
+1 41.9408 L
+1 31.7059 L
+7.0308 41.9402 L
+7.0304 41.9408 L
+f
+%AI6_EndPatternLayer
+) &
+] E
+%AI3_EndPattern
+%AI3_BeginPattern: (Hexagon)
+(Hexagon) 4 1.6 70.151 77.983 [
+%AI3_Tile
+(0 O 0 R  0 1 0.35 0 k
+ 0 1 0.35 0 K
+) @
+(
+%AI6_BeginPatternLayer
+800 Ar
+0 J 0 j 1 w 4 M []0 d
+%AI3_Note:
+0 D
+0 XR
+70.151 77.983 m
+70.151 1.6 L
+4 1.6 L
+4 77.983 L
+70.151 77.983 L
+f
+%AI6_EndPatternLayer
+) &
+(0 O 0 R  0.9921 1 0 0 k
+ 0.9921 1 0 0 K
+) @
+(
+%AI6_BeginPatternLayer
+800 Ar
+0 J 0 j 0.3 w 4 M []0 d
+%AI3_Note:
+0 D
+0 XR
+20.538 30.244 m
+S
+26.05 20.696 m
+15.025 20.696 L
+9.513 30.244 L
+15.025 39.792 L
+26.05 39.792 L
+31.564 30.244 L
+26.05 20.696 L
+s
+20.537 11.148 m
+S
+26.05 1.6 m
+15.024 1.6 L
+9.512 11.148 L
+15.024 20.696 L
+26.05 20.696 L
+31.563 11.148 L
+26.05 1.6 L
+s
+53.614 30.244 m
+S
+59.126 20.696 m
+48.101 20.696 L
+42.589 30.244 L
+48.101 39.792 L
+59.126 39.792 L
+64.639 30.244 L
+59.126 20.696 L
+s
+53.614 11.148 m
+S
+59.126 1.6 m
+48.101 1.6 L
+42.588 11.148 L
+48.101 20.696 L
+59.126 20.696 L
+64.638 11.148 L
+59.126 1.6 L
+s
+20.538 68.436 m
+S
+26.051 58.888 m
+15.025 58.888 L
+9.513 68.436 L
+15.025 77.984 L
+26.051 77.984 L
+31.564 68.436 L
+26.051 58.888 L
+s
+20.538 49.34 m
+S
+26.051 39.792 m
+15.025 39.792 L
+9.513 49.34 L
+15.025 58.888 L
+26.05 58.888 L
+31.564 49.34 L
+26.051 39.792 L
+s
+53.614 68.436 m
+S
+59.127 58.888 m
+48.102 58.888 L
+42.589 68.436 L
+48.101 77.985 L
+59.127 77.985 L
+64.639 68.436 L
+59.127 58.888 L
+s
+53.614 49.34 m
+S
+59.127 39.792 m
+48.101 39.792 L
+42.589 49.34 L
+48.101 58.888 L
+59.127 58.888 L
+64.639 49.341 L
+59.127 39.792 L
+s
+4 20.696 m
+S
+3.876 30.244 m
+9.512 30.244 L
+15.024 20.696 L
+9.512 11.147 L
+3.876 11.147 L
+S
+37.075 20.696 m
+S
+42.588 11.148 m
+31.563 11.148 L
+26.05 20.696 L
+31.563 30.244 L
+42.589 30.244 L
+48.101 20.696 L
+42.588 11.148 L
+s
+37.076 58.888 m
+S
+42.589 49.34 m
+31.564 49.34 L
+26.05 58.888 L
+31.564 68.436 L
+42.589 68.436 L
+48.101 58.888 L
+42.589 49.34 L
+s
+70.151 20.696 m
+S
+70.2094 11.147 m
+64.639 11.147 L
+59.127 20.696 L
+64.639 30.244 L
+70.2094 30.244 L
+S
+70.152 58.888 m
+S
+70.0427 49.34 m
+64.639 49.34 L
+59.127 58.888 L
+64.639 68.436 L
+70.0427 68.436 L
+S
+4 58.888 m
+S
+3.876 68.436 m
+9.513 68.436 L
+15.025 58.888 L
+9.513 49.34 L
+3.876 49.34 L
+S
+%AI6_EndPatternLayer
+) &
+] E
+%AI3_EndPattern
+%AI3_BeginPattern: (Laurel.inner)
+(Laurel.inner) 1 1 28.5392 28.5392 [
+%AI3_Tile
+(0 O 0 R  0 0.55 1 0.12 k
+ 0 0.55 1 0.12 K
+) @
+(
+%AI6_BeginPatternLayer
+800 Ar
+0 J 0 j 0.3 w 4 M []0 d
+%AI3_Note:
+0 D
+0 XR
+19.2768 15.3585 m
+28.9144 15.3585 L
+28.9144 14.2335 L
+19.2768 14.2335 L
+19.2768 15.3585 L
+f
+%AI6_EndPatternLayer
+) &
+(0 O 0 R  0 0.55 1 0.3 k
+ 0 0.55 1 0.3 K
+) @
+(
+%AI6_BeginPatternLayer
+800 Ar
+0 J 0 j 0.3 w 4 M []0 d
+%AI3_Note:
+0 D
+0 XR
+14.7461 18.9624 m
+13.0264 17.8486 11.3273 14.4193 11.3273 10.0362 c
+11.3273 5.6547 12.9768 2.1518 14.744 1.1112 C
+14.7443 1.1112 L
+16.4707 2.1518 18.1679 5.6547 18.1679 10.0362 c
+18.1679 14.4143 16.432 17.8633 14.7461 18.9624 C
+f
+%AI6_EndPatternLayer
+) &
+] E
+%AI3_EndPattern
+%AI3_BeginPattern: (Laurel.outer)
+(Laurel.outer) 1 1.3751 28.5393 28.9143 [
+%AI3_Tile
+(0 O 0 R  0 0.55 1 0.12 k
+ 0 0.55 1 0.12 K
+) @
+(
+%AI6_BeginPatternLayer
+800 Ar
+0 J 0 j 0.3 w 4 M []0 d
+%AI3_Note:
+0 D
+0 XR
+14.2395 10.6375 m
+14.2395 1 L
+15.3645 1 L
+15.3645 10.6375 L
+14.2395 10.6375 L
+f
+%AI6_EndPatternLayer
+) &
+(0 O 0 R  0 0.55 1 0.3 k
+ 0 0.55 1 0.3 K
+) @
+(
+%AI6_BeginPatternLayer
+800 Ar
+0 J 0 j 0.3 w 4 M []0 d
+%AI3_Note:
+0 D
+0 XR
+10.5769 15.124 m
+11.6906 16.8438 15.1198 18.5429 19.503 18.5429 c
+23.8844 18.5429 27.3874 16.8935 28.428 15.1262 C
+28.428 15.1259 L
+27.3874 13.3995 23.8844 11.7023 19.503 11.7023 c
+15.1249 11.7023 11.676 13.4382 10.5769 15.124 C
+f
+%AI6_EndPatternLayer
+) &
+] E
+%AI3_EndPattern
+%AI3_BeginPattern: (Laurel.side)
+(Laurel.side) 1.3972 1 28.9364 28.5392 [
+%AI3_Tile
+(0 O 0 R  0 0.55 1 0.12 k
+ 0 0.55 1 0.12 K
+) @
+(
+%AI6_BeginPatternLayer
+800 Ar
+0 J 0 j 0.3 w 4 M []0 d
+%AI3_Note:
+0 D
+0 XR
+29.1571 15.2998 m
+1 15.2998 L
+1 14.1748 L
+29.1571 14.1748 L
+29.1571 15.2998 L
+f
+%AI6_EndPatternLayer
+) &
+(0 O 0 R  0 0.55 1 0.3 k
+ 0 0.55 1 0.3 K
+) @
+(
+%AI6_BeginPatternLayer
+800 Ar
+0 J 0 j 0.3 w 4 M []0 d
+%AI3_Note:
+0 D
+0 XR
+2.0183 27.4787 m
+1.5899 25.4751 2.8132 21.8488 5.9125 18.7494 c
+9.0107 15.6513 12.654 14.3407 14.6395 14.8545 C
+14.6398 14.8547 L
+15.1246 16.8113 13.8478 20.4883 10.7496 23.5865 c
+7.6538 26.6824 3.9876 27.8936 2.0183 27.4787 C
+f
+%AI6_EndPatternLayer
+) &
+(0 O 0 R  0 0.39 0.7 0.12 k
+ 0 0.39 0.7 0.12 K
+) @
+(
+%AI6_BeginPatternLayer
+800 Ar
+0 J 0 j 0.3 w 4 M []0 d
+%AI3_Note:
+0 D
+0 XR
+2.0183 2.0091 m
+1.5899 4.0126 2.8132 7.6389 5.9125 10.7382 c
+9.0107 13.8365 12.654 15.147 14.6395 14.6332 C
+14.6398 14.633 L
+15.1246 12.6765 13.8478 8.9993 10.7496 5.9011 c
+7.6538 2.8054 3.9876 1.5941 2.0183 2.0091 C
+f
+%AI6_EndPatternLayer
+) &
+(0 O 0 R  0 0.55 1 0.3 k
+ 0 0.55 1 0.3 K
+) @
+(
+%AI6_BeginPatternLayer
+800 Ar
+0 J 0 j 0.3 w 4 M []0 d
+%AI3_Note:
+0 D
+0 XR
+15.821 2.0091 m
+15.3925 4.0126 16.6159 7.6389 19.7152 10.7382 c
+22.8134 13.8365 26.4567 15.147 28.4422 14.6332 C
+28.4424 14.633 L
+28.9273 12.6765 27.6505 8.9993 24.5523 5.9011 c
+21.4565 2.8054 17.7903 1.5941 15.821 2.0091 C
+f
+%AI6_EndPatternLayer
+) &
+(0 O 0 R  0 0.39 0.7 0.12 k
+ 0 0.39 0.7 0.12 K
+) @
+(
+%AI6_BeginPatternLayer
+800 Ar
+0 J 0 j 0.3 w 4 M []0 d
+%AI3_Note:
+0 D
+0 XR
+15.821 27.4787 m
+15.3925 25.4751 16.6159 21.8488 19.7152 18.7494 c
+22.8134 15.6513 26.4567 14.3407 28.4422 14.8545 C
+28.4424 14.8547 L
+28.9273 16.8113 27.6505 20.4883 24.5523 23.5865 c
+21.4565 26.6824 17.7903 27.8936 15.821 27.4787 C
+f
+%AI6_EndPatternLayer
+) &
+] E
+%AI3_EndPattern
+%AI3_BeginPattern: (Leaves-fall)
+(Leaves-fall) 1 1 52.733 89.816 [
+%AI3_Tile
+(0 O 0 R  0.05 0.2 1 0 k
+ 0.05 0.2 1 0 K
+) @
+(
+%AI6_BeginPatternLayer
+800 Ar
+0 J 0 j 1 w 4 M []0 d
+%AI3_Note:
+0 D
+0 XR
+52.733 89.816 m
+52.733 1 L
+1 1 L
+1 89.816 L
+52.733 89.816 L
+f
+%AI6_EndPatternLayer
+) &
+(0 O 0 R  0.83 0 1 0 k
+ 0.83 0 1 0 K
+) @
+(
+%AI6_BeginPatternLayer
+800 Ar
+0 J 0 j 1 w 4 M []0 d
+%AI3_Note:
+1 D
+0 XR
+25.317 2.083 m
+25.994 2.283 26.284 2.435 V
+24.815 5.147 29.266 9.428 30.186 10.168 C
+30.787 9.943 30.907 7.41 30.23 6.073 C
+31.073 6.196 33.262 4.818 34.02 3.529 C
+34.085 4.217 35.655 7.158 36.481 7.535 C
+35.561 7.933 34.896 9.406 34.134 10.854 C
+35.156 11.021 36.555 10.1 38.026 9.195 C
+38.541 9.996 39.915 10.968 41.174 11.484 C
+40.086 12.171 39.591 12.912 39.094 14.372 C
+38.052 13.806 35.865 13.657 35.336 13.944 C
+35.85 15.057 38.096 15.6 38.827 15.547 C
+38.573 16.409 38.425 18.562 38.598 21.155 C
+36.939 19.839 35.393 18.522 33.734 18.58 C
+34.003 17.158 33.367 15.353 32.99 14.86 C
+32.417 15.604 32.006 16.431 32.361 18.408 C
+30.908 18.893 29.671 19.439 28.297 20.697 C
+28.297 18.866 27.725 17.664 26.857 16.388 C
+28.117 15.9 29.389 14.697 29.385 13.658 C
+28.537 13.81 26.845 14.554 26.352 15.547 C
+25.634 14.8 23.95 13.491 22.346 13.487 C
+23.534 12.632 24.454 11.598 24.549 9.686 C
+25.802 10.657 28.255 11.272 29.635 10.674 C
+24.794 6.438 25.262 3.405 25.317 2.083 C
+f
+12.412 33.743 m
+11.887 33.272 11.691 33.01 V
+14.182 31.192 11.928 25.366 11.415 24.303 C
+10.776 24.247 9.369 26.988 9.405 28.486 C
+8.273 27.73 6.608 27.851 5.006 28.137 C
+5.578 27.049 5.177 25.104 4.376 24.303 C
+5.378 24.339 6.729 23.624 8.038 22.643 C
+7.203 21.823 5.376 21.984 3.46 22.643 C
+3.46 21.27 2.638 19.533 1.801 18.351 C
+3.117 18.408 4.262 17.722 5.12 16.691 C
+5.785 18.26 7.819 19.373 8.725 19.324 C
+8.742 17.959 7.169 15.869 6.147 15.47 C
+6.747 14.801 7.766 13.27 8.725 10.854 C
+9.524 12.78 10.694 14.022 11.927 14.955 C
+10.785 16.517 10.959 17.388 11.358 18.866 C
+12.101 18.325 13.132 17.893 13.303 15.89 C
+15.02 16.176 16.156 16.104 17.653 15.203 C
+17.198 16.865 17.195 18.466 17.515 20.166 C
+15.665 20.026 14.105 20.239 13.075 21.728 C
+13.905 21.955 16.165 22.014 17.039 21.082 C
+17.366 22.064 18.261 23.47 19.707 24.164 C
+18.267 24.424 17.282 25.523 16.373 27.209 C
+15.66 25.793 13.433 24.128 11.93 24.073 C
+13.933 28.137 13.933 31.055 12.412 33.743 C
+f
+31.125 30.5 m
+31.445 31.128 31.648 31.385 V
+34.045 29.444 38.851 32.752 39.746 33.521 C
+39.636 34.153 37.511 35.29 35.794 34.26 C
+36.234 35.549 35.332 37.51 34.134 38.552 C
+35.873 38.451 38.019 39.813 38.541 40.555 C
+38.763 39.577 39.946 38.307 41.231 37.293 C
+41.582 38.266 40.887 40.384 39.971 41.986 C
+41.206 42.487 42.318 43.417 42.776 44.676 C
+43.233 43.359 44.236 42.685 45.58 41.929 C
+44.421 40.502 43.64 38.328 43.92 37.465 C
+45.243 37.8 46.814 40.518 46.937 41.607 C
+47.812 40.841 49.366 40.154 51.947 39.848 C
+50.246 38.77 49.884 36.778 49.3 35.347 C
+48.152 35.794 45.983 35.853 45.008 35.29 C
+45.721 34.711 47.061 34.16 49.071 34.146 C
+49.071 32.601 49.534 31.469 50.788 30.254 C
+49.065 30.267 46.965 29.781 45.469 29.389 C
+45.221 30.718 44.378 32.314 43.233 32.715 C
+43.227 31.854 43.493 29.605 44.378 28.938 C
+43.513 28.37 42.26 26.993 41.803 25.276 C
+41.181 26.601 40.32 27.906 38.457 28.35 C
+39.642 29.403 40.477 31.42 40.143 32.887 C
+35.091 28.905 32.414 30.203 31.125 30.5 C
+f
+25.317 46.491 m
+25.994 46.691 26.284 46.843 V
+24.815 49.556 29.266 53.837 30.186 54.576 C
+30.787 54.351 30.907 51.818 30.23 50.482 C
+31.073 50.605 33.262 49.227 34.02 47.938 C
+34.085 48.625 35.655 51.566 36.481 51.944 C
+35.561 52.341 34.896 53.814 34.134 55.263 C
+35.156 55.43 36.555 54.508 38.026 53.603 C
+38.541 54.404 39.915 55.377 41.174 55.892 C
+40.086 56.579 39.591 57.321 39.094 58.78 C
+38.052 58.215 35.865 58.065 35.336 58.353 C
+35.85 59.465 38.096 60.008 38.827 59.955 C
+38.573 60.817 38.425 62.97 38.598 65.563 C
+36.939 64.247 35.393 62.931 33.734 62.988 C
+34.003 61.567 33.367 59.761 32.99 59.268 C
+32.417 60.012 32.006 60.839 32.361 62.817 C
+30.908 63.302 29.671 63.847 28.297 65.106 C
+28.297 63.274 27.725 62.073 26.857 60.796 C
+28.117 60.308 29.389 59.106 29.385 58.067 C
+28.537 58.219 26.845 58.963 26.352 59.955 C
+25.634 59.209 23.95 57.899 22.346 57.895 C
+23.534 57.041 24.454 56.006 24.549 54.094 C
+25.802 55.065 28.255 55.68 29.635 55.083 C
+24.794 50.846 25.262 47.814 25.317 46.491 C
+f
+12.412 78.151 m
+11.887 77.68 11.691 77.418 V
+14.182 75.601 11.928 69.774 11.415 68.711 C
+10.776 68.655 9.369 71.396 9.405 72.894 C
+8.273 72.138 6.608 72.259 5.006 72.545 C
+5.578 71.458 5.177 69.512 4.376 68.711 C
+5.378 68.747 6.729 68.032 8.038 67.052 C
+7.203 66.231 5.376 66.393 3.46 67.052 C
+3.46 65.678 2.638 63.941 1.801 62.759 C
+3.117 62.817 4.262 62.13 5.12 61.1 C
+5.785 62.669 7.819 63.781 8.725 63.732 C
+8.742 62.367 7.169 60.277 6.147 59.878 C
+6.747 59.209 7.766 57.678 8.725 55.263 C
+9.524 57.189 10.694 58.431 11.927 59.364 C
+10.785 60.925 10.959 61.796 11.358 63.274 C
+12.101 62.734 13.132 62.301 13.303 60.298 C
+15.02 60.584 16.156 60.512 17.653 59.612 C
+17.198 61.273 17.195 62.874 17.515 64.574 C
+15.665 64.434 14.105 64.648 13.075 66.136 C
+13.905 66.363 16.165 66.422 17.039 65.49 C
+17.366 66.472 18.261 67.878 19.707 68.572 C
+18.267 68.832 17.282 69.931 16.373 71.617 C
+15.66 70.202 13.433 68.536 11.93 68.482 C
+13.933 72.545 13.933 75.464 12.412 78.151 C
+f
+31.125 74.908 m
+31.445 75.537 31.648 75.794 V
+34.045 73.853 38.851 77.161 39.746 77.929 C
+39.636 78.562 37.511 79.698 35.794 78.668 C
+36.234 79.957 35.332 81.918 34.134 82.96 C
+35.873 82.86 38.019 84.221 38.541 84.963 C
+38.763 83.986 39.946 82.716 41.231 81.701 C
+41.582 82.675 40.887 84.792 39.971 86.394 C
+41.206 86.895 42.318 87.825 42.776 89.084 C
+43.233 87.768 44.236 87.093 45.58 86.337 C
+44.421 84.91 43.64 82.736 43.92 81.873 C
+45.243 82.208 46.814 84.926 46.937 86.016 C
+47.812 85.249 49.366 84.563 51.947 84.257 C
+50.246 83.179 49.884 81.187 49.3 79.756 C
+48.152 80.203 45.983 80.262 45.008 79.698 C
+45.721 79.119 47.061 78.569 49.071 78.554 C
+49.071 77.009 49.534 75.877 50.788 74.663 C
+49.065 74.675 46.965 74.189 45.469 73.798 C
+45.221 75.126 44.378 76.723 43.233 77.123 C
+43.227 76.262 43.493 74.013 44.378 73.347 C
+43.513 72.779 42.26 71.401 41.803 69.684 C
+41.181 71.009 40.32 72.314 38.457 72.759 C
+39.642 73.812 40.477 75.829 40.143 77.295 C
+35.091 73.313 32.414 74.611 31.125 74.908 C
+f
+%AI6_EndPatternLayer
+) &
+] E
+%AI3_EndPattern
+%AI3_BeginPattern: (Polka dots)
+(Polka dots) 1 1 29.8 29.8 [
+%AI3_Tile
+(0 O 0 R  0.45 0.9 0 0 k
+ 0.45 0.9 0 0 K
+) @
+(
+%AI6_BeginPatternLayer
+800 Ar
+0 J 0 j 0.3 w 4 M []0 d
+%AI3_Note:
+0 D
+0 XR
+1 1 m
+1 29.8 L
+29.8 29.8 L
+29.8 1 L
+1 1 L
+f
+%AI6_EndPatternLayer
+) &
+(0 O 0 R  0.09 0.18 0 0 k
+ 0.09 0.18 0 0 K
+) @
+(
+%AI6_BeginPatternLayer
+*u
+800 Ar
+0 J 0 j 1 w 4 M []0 d
+%AI3_Note:
+0 D
+0 XR
+11.08 8.2 m
+11.08 9.791 9.79 11.08 8.2 11.08 c
+6.609 11.08 5.32 9.791 5.32 8.2 c
+5.32 6.61 6.609 5.32 8.2 5.32 c
+9.79 5.32 11.08 6.61 11.08 8.2 c
+f
+11.08 22.6 m
+11.08 24.191 9.79 25.48 8.2 25.48 c
+6.609 25.48 5.32 24.191 5.32 22.6 c
+5.32 21.01 6.609 19.72 8.2 19.72 c
+9.79 19.72 11.08 21.01 11.08 22.6 c
+f
+18.28 15.4 m
+18.28 16.991 16.99 18.28 15.4 18.28 c
+13.809 18.28 12.52 16.991 12.52 15.4 c
+12.52 13.81 13.809 12.52 15.4 12.52 c
+16.99 12.52 18.28 13.81 18.28 15.4 c
+f
+25.48 8.2 m
+25.48 9.791 24.19 11.08 22.6 11.08 c
+21.009 11.08 19.72 9.791 19.72 8.2 c
+19.72 6.61 21.009 5.32 22.6 5.32 c
+24.19 5.32 25.48 6.61 25.48 8.2 c
+f
+25.48 22.6 m
+25.48 24.191 24.19 25.48 22.6 25.48 c
+21.009 25.48 19.72 24.191 19.72 22.6 c
+19.72 21.01 21.009 19.72 22.6 19.72 c
+24.19 19.72 25.48 21.01 25.48 22.6 c
+f
+*U
+26.92 1 m
+29.8 1 L
+29.8 3.88 L
+28.209 3.88 26.92 2.591 26.92 1 C
+f
+15.4 3.88 m
+13.809 3.88 12.52 2.591 12.52 1 C
+18.28 1 L
+18.28 2.591 16.99 3.88 15.4 3.88 c
+f
+1 3.88 m
+1 1 L
+3.88 1 L
+3.88 2.591 2.59 3.88 1 3.88 C
+f
+1 XR
+26.92 15.4 m
+26.92 13.81 28.209 12.52 29.8 12.52 C
+29.8 18.28 L
+28.209 18.28 26.92 16.991 26.92 15.4 c
+f
+0 XR
+15.4 18.28 m
+13.809 18.28 12.52 16.991 12.52 15.4 c
+12.52 13.81 13.809 12.52 15.4 12.52 c
+16.99 12.52 18.28 13.81 18.28 15.4 c
+18.28 16.991 16.99 18.28 15.4 18.28 c
+f
+1 XR
+3.88 15.4 m
+3.88 16.991 2.59 18.28 1 18.28 C
+1 12.52 L
+2.59 12.52 3.88 13.81 3.88 15.4 c
+f
+0 XR
+29.8 26.92 m
+29.8 29.8 L
+26.92 29.8 L
+26.92 28.21 28.209 26.92 29.8 26.92 C
+f
+15.4 26.92 m
+16.99 26.92 18.28 28.21 18.28 29.8 C
+12.52 29.8 L
+12.52 28.21 13.809 26.92 15.4 26.92 c
+f
+3.88 29.8 m
+1 29.8 L
+1 26.92 L
+2.59 26.92 3.88 28.21 3.88 29.8 C
+f
+1 XR
+8.2 11.08 m
+6.609 11.08 5.32 9.791 5.32 8.2 c
+5.32 6.61 6.609 5.32 8.2 5.32 c
+9.79 5.32 11.08 6.61 11.08 8.2 c
+11.08 9.791 9.79 11.08 8.2 11.08 c
+f
+22.6 11.08 m
+21.009 11.08 19.72 9.791 19.72 8.2 c
+19.72 6.61 21.009 5.32 22.6 5.32 c
+24.19 5.32 25.48 6.61 25.48 8.2 c
+25.48 9.791 24.19 11.08 22.6 11.08 c
+f
+8.2 25.48 m
+6.609 25.48 5.32 24.191 5.32 22.6 c
+5.32 21.01 6.609 19.72 8.2 19.72 c
+9.79 19.72 11.08 21.01 11.08 22.6 c
+11.08 24.191 9.79 25.48 8.2 25.48 c
+f
+22.6 25.48 m
+21.009 25.48 19.72 24.191 19.72 22.6 c
+19.72 21.01 21.009 19.72 22.6 19.72 c
+24.19 19.72 25.48 21.01 25.48 22.6 c
+25.48 24.191 24.19 25.48 22.6 25.48 c
+f
+%AI6_EndPatternLayer
+) &
+] E
+%AI3_EndPattern
+%AI3_BeginPattern: (Random circles)
+(Random circles) 4.365 3.849 51.13 57.85 [
+%AI3_Tile
+(0 O 0 R  0 0.1125 0.45 0 k
+ 0 0.1125 0.45 0 K
+) @
+(
+%AI6_BeginPatternLayer
+800 Ar
+0 J 0 j 0.3 w 4 M []0 d
+%AI3_Note:
+0 D
+0 XR
+4.365 3.849 m
+4.365 57.85 L
+51.13 57.85 L
+51.13 3.849 L
+4.365 3.849 L
+f
+%AI6_EndPatternLayer
+) &
+(0 O 0 R  0.4 0.7 1 0 k
+ 0.4 0.7 1 0 K
+) @
+(
+%AI6_BeginPatternLayer
+800 Ar
+0 J 0 j 0.3 w 4 M []0 d
+%AI3_Note:
+0 D
+0 XR
+45.429 36.274 m
+45.843 36.991 45.598 37.908 44.88 38.323 c
+44.163 38.737 43.245 38.491 42.831 37.774 c
+42.417 37.056 42.663 36.139 43.38 35.725 c
+44.098 35.31 45.015 35.556 45.429 36.274 c
+s
+44.179 27.926 m
+43.765 28.643 42.848 28.889 42.13 28.475 c
+41.413 28.06 41.167 27.143 41.581 26.425 c
+41.995 25.708 42.913 25.462 43.63 25.876 c
+44.348 26.291 44.593 27.208 44.179 27.926 c
+s
+35.929 41.024 m
+35.515 41.741 34.598 41.987 33.88 41.573 c
+33.163 41.158 32.917 40.241 33.331 39.524 c
+33.745 38.806 34.663 38.56 35.38 38.975 c
+36.098 39.389 36.343 40.306 35.929 41.024 c
+s
+28.38 34.225 m
+28.794 34.942 28.549 35.859 27.831 36.274 c
+27.114 36.688 26.196 36.442 25.782 35.725 c
+25.368 35.007 25.614 34.09 26.331 33.675 c
+27.049 33.261 27.966 33.507 28.38 34.225 c
+s
+31.179 28.024 m
+30.765 28.741 29.848 28.987 29.13 28.573 c
+28.413 28.158 28.167 27.241 28.581 26.524 c
+28.995 25.806 29.913 25.56 30.63 25.975 c
+31.348 26.389 31.593 27.306 31.179 28.024 c
+s
+36.792 23.349 m
+35.963 23.349 35.292 22.678 35.292 21.849 c
+35.292 21.021 35.963 20.349 36.792 20.349 c
+37.62 20.349 38.292 21.021 38.292 21.849 c
+38.292 22.678 37.62 23.349 36.792 23.349 c
+s
+10.888 34.175 m
+10.474 34.893 10.72 35.81 11.437 36.225 c
+12.155 36.639 13.072 36.393 13.486 35.675 c
+13.901 34.958 13.655 34.041 12.937 33.626 c
+12.22 33.212 11.303 33.458 10.888 34.175 c
+s
+11.517 26.601 m
+11.931 27.318 12.848 27.564 13.566 27.15 c
+14.283 26.735 14.529 25.818 14.115 25.1 c
+13.701 24.383 12.783 24.137 12.066 24.551 c
+11.348 24.966 11.103 25.883 11.517 26.601 c
+s
+16.782 41.426 m
+17.196 42.143 18.114 42.389 18.831 41.975 c
+19.549 41.56 19.794 40.643 19.38 39.926 c
+18.966 39.208 18.049 38.962 17.331 39.377 c
+16.614 39.791 16.368 40.708 16.782 41.426 c
+s
+22.365 24.35 m
+23.194 24.35 23.865 23.678 23.865 22.85 c
+23.865 22.021 23.194 21.35 22.365 21.35 c
+21.537 21.35 20.865 22.021 20.865 22.85 c
+20.865 23.678 21.537 24.35 22.365 24.35 c
+s
+45.385 7.849 m
+44.971 7.132 44.053 6.886 43.336 7.3 c
+42.619 7.714 42.373 8.632 42.787 9.349 c
+43.201 10.067 44.119 10.312 44.836 9.898 c
+45.553 9.484 45.799 8.567 45.385 7.849 c
+s
+29.679 7.774 m
+29.265 7.056 28.348 6.81 27.63 7.225 c
+26.913 7.639 26.667 8.556 27.081 9.274 c
+27.495 9.991 28.413 10.237 29.13 9.823 c
+29.848 9.408 30.093 8.491 29.679 7.774 c
+s
+35.542 11.349 m
+34.713 11.349 34.042 12.021 34.042 12.849 c
+34.042 13.678 34.713 14.349 35.542 14.349 c
+36.37 14.349 37.042 13.678 37.042 12.849 c
+37.042 12.021 36.37 11.349 35.542 11.349 c
+s
+10.13 7.475 m
+10.544 6.757 11.462 6.511 12.179 6.926 c
+12.897 7.34 13.142 8.257 12.728 8.975 c
+12.314 9.692 11.397 9.938 10.679 9.524 c
+9.962 9.109 9.716 8.192 10.13 7.475 c
+s
+20.203 13.349 m
+21.031 13.349 21.703 14.021 21.703 14.849 c
+21.703 15.678 21.031 16.349 20.203 16.349 c
+19.375 16.349 18.703 15.678 18.703 14.849 c
+18.703 14.021 19.375 13.349 20.203 13.349 c
+s
+44.635 54.1 m
+45.049 53.382 44.803 52.465 44.086 52.051 c
+43.369 51.636 42.451 51.882 42.037 52.6 c
+41.623 53.317 41.869 54.234 42.586 54.649 c
+43.303 55.063 44.221 54.817 44.635 54.1 c
+s
+36.841 48.1 m
+36.427 47.382 35.509 47.136 34.792 47.551 c
+34.074 47.965 33.828 48.882 34.243 49.6 c
+34.657 50.317 35.574 50.563 36.292 50.149 c
+37.009 49.734 37.255 48.817 36.841 48.1 c
+s
+29.728 54.725 m
+30.143 54.007 29.897 53.09 29.179 52.675 c
+28.462 52.261 27.544 52.507 27.13 53.225 c
+26.716 53.942 26.962 54.859 27.679 55.274 c
+28.397 55.688 29.314 55.442 29.728 54.725 c
+s
+10.86 54.1 m
+10.446 53.382 10.691 52.465 11.409 52.051 c
+12.126 51.636 13.044 51.882 13.458 52.6 c
+13.872 53.317 13.626 54.234 12.909 54.649 c
+12.191 55.063 11.274 54.817 10.86 54.1 c
+s
+19.154 49.1 m
+19.568 48.382 20.486 48.136 21.203 48.551 c
+21.92 48.965 22.166 49.882 21.752 50.6 c
+21.338 51.317 20.42 51.563 19.703 51.149 c
+18.986 50.734 18.74 49.817 19.154 49.1 c
+s
+51.88 38.85 m
+51.052 38.85 50.38 39.521 50.38 40.35 c
+50.38 41.178 51.052 41.85 51.88 41.85 c
+52.709 41.85 53.38 41.178 53.38 40.35 c
+53.38 39.521 52.709 38.85 51.88 38.85 c
+s
+51.865 11.349 m
+52.693 11.349 53.365 12.021 53.365 12.849 c
+53.365 13.678 52.693 14.349 51.865 14.349 c
+51.036 14.349 50.365 13.678 50.365 12.849 c
+50.365 12.021 51.036 11.349 51.865 11.349 c
+s
+30.179 18.524 m
+29.765 19.241 28.848 19.487 28.13 19.073 c
+27.413 18.658 27.167 17.741 27.581 17.024 c
+27.995 16.306 28.913 16.06 29.63 16.475 c
+30.348 16.889 30.593 17.806 30.179 18.524 c
+s
+21.679 31.524 m
+21.265 32.241 20.348 32.487 19.63 32.073 c
+18.913 31.658 18.667 30.741 19.081 30.024 c
+19.495 29.306 20.413 29.06 21.13 29.475 c
+21.848 29.889 22.093 30.806 21.679 31.524 c
+s
+37.914 33.399 m
+37.5 34.116 36.583 34.362 35.865 33.948 c
+35.148 33.533 34.902 32.616 35.316 31.899 c
+35.73 31.181 36.648 30.935 37.365 31.35 c
+38.083 31.764 38.328 32.681 37.914 33.399 c
+s
+28.929 45.024 m
+28.515 45.741 27.598 45.987 26.88 45.573 c
+26.163 45.158 25.917 44.241 26.331 43.524 c
+26.745 42.806 27.663 42.56 28.38 42.975 c
+29.098 43.389 29.343 44.306 28.929 45.024 c
+s
+12.429 45.524 m
+12.015 46.241 11.098 46.487 10.38 46.073 c
+9.663 45.658 9.417 44.741 9.831 44.024 c
+10.245 43.306 11.163 43.06 11.88 43.475 c
+12.598 43.889 12.843 44.806 12.429 45.524 c
+s
+44.49 45.6 m
+44.075 46.317 43.158 46.563 42.441 46.149 c
+41.723 45.734 41.477 44.817 41.891 44.1 c
+42.306 43.382 43.223 43.136 43.941 43.55 c
+44.658 43.965 44.904 44.882 44.49 45.6 c
+s
+12.679 18.524 m
+12.265 19.241 11.348 19.487 10.63 19.073 c
+9.913 18.658 9.667 17.741 10.081 17.024 c
+10.495 16.306 11.413 16.06 12.13 16.475 c
+12.848 16.889 13.093 17.806 12.679 18.524 c
+s
+21.179 5.774 m
+20.765 6.491 19.848 6.737 19.13 6.323 c
+18.413 5.908 18.167 4.991 18.581 4.274 c
+18.995 3.557 19.913 3.311 20.63 3.725 c
+21.348 4.139 21.593 5.056 21.179 5.774 c
+s
+38.929 5.274 m
+38.515 5.991 37.598 6.237 36.88 5.823 c
+36.163 5.408 35.917 4.491 36.331 3.774 c
+36.745 3.057 37.663 2.811 38.38 3.225 c
+39.098 3.639 39.343 4.556 38.929 5.274 c
+s
+43.865 18.1 m
+44.694 18.1 45.365 17.429 45.365 16.6 c
+45.365 15.772 44.694 15.1 43.865 15.1 c
+43.037 15.1 42.365 15.772 42.365 16.6 c
+42.365 17.429 43.037 18.1 43.865 18.1 c
+s
+51.13 4.6 m
+50.302 4.6 49.63 3.928 49.63 3.1 c
+49.63 2.272 50.302 1.6 51.13 1.6 c
+51.959 1.6 52.63 2.272 52.63 3.1 c
+52.63 3.928 51.959 4.6 51.13 4.6 c
+s
+52.163 31.649 m
+51.748 32.366 50.831 32.612 50.114 32.198 c
+49.396 31.783 49.15 30.866 49.565 30.149 c
+49.979 29.431 50.896 29.185 51.614 29.6 c
+52.331 30.014 52.577 30.931 52.163 31.649 c
+s
+51.85 51.35 m
+51.021 51.35 50.35 50.678 50.35 49.85 c
+50.35 49.021 51.021 48.35 51.85 48.35 c
+52.678 48.35 53.35 49.021 53.35 49.85 c
+53.35 50.678 52.678 51.35 51.85 51.35 c
+s
+49.85 23.1 m
+50.679 23.1 51.35 22.428 51.35 21.6 c
+51.35 20.771 50.679 20.1 49.85 20.1 c
+49.022 20.1 48.35 20.771 48.35 21.6 c
+48.35 22.428 49.022 23.1 49.85 23.1 c
+s
+5.13 38.85 m
+4.302 38.85 3.63 39.521 3.63 40.35 c
+3.63 41.178 4.302 41.85 5.13 41.85 c
+5.959 41.85 6.63 41.178 6.63 40.35 c
+6.63 39.521 5.959 38.85 5.13 38.85 c
+s
+5.115 11.349 m
+5.943 11.349 6.615 12.021 6.615 12.849 c
+6.615 13.678 5.943 14.349 5.115 14.349 c
+4.286 14.349 3.615 13.678 3.615 12.849 c
+3.615 12.021 4.286 11.349 5.115 11.349 c
+s
+4.38 4.6 m
+3.552 4.6 2.88 3.928 2.88 3.1 c
+2.88 2.272 3.552 1.6 4.38 1.6 c
+5.209 1.6 5.88 2.272 5.88 3.1 c
+5.88 3.928 5.209 4.6 4.38 4.6 c
+s
+5.413 31.649 m
+4.998 32.366 4.081 32.612 3.364 32.198 c
+2.646 31.783 2.4 30.866 2.815 30.149 c
+3.229 29.431 4.146 29.185 4.864 29.6 c
+5.581 30.014 5.827 30.931 5.413 31.649 c
+s
+5.1 51.35 m
+4.271 51.35 3.6 50.678 3.6 49.85 c
+3.6 49.021 4.271 48.35 5.1 48.35 c
+5.928 48.35 6.6 49.021 6.6 49.85 c
+6.6 50.678 5.928 51.35 5.1 51.35 c
+s
+3.1 23.1 m
+3.929 23.1 4.6 22.428 4.6 21.6 c
+4.6 20.771 3.929 20.1 3.1 20.1 c
+2.272 20.1 1.6 20.771 1.6 21.6 c
+1.6 22.428 2.272 23.1 3.1 23.1 c
+s
+21.194 59.775 m
+20.78 60.492 19.863 60.738 19.145 60.324 c
+18.428 59.909 18.182 58.992 18.596 58.275 c
+19.01 57.558 19.928 57.312 20.645 57.726 c
+21.363 58.14 21.608 59.057 21.194 59.775 c
+s
+38.944 59.275 m
+38.53 59.992 37.613 60.238 36.895 59.824 c
+36.178 59.409 35.932 58.492 36.346 57.775 c
+36.76 57.058 37.678 56.812 38.395 57.226 c
+39.113 57.64 39.358 58.557 38.944 59.275 c
+s
+51.145 58.601 m
+50.317 58.601 49.645 57.929 49.645 57.101 c
+49.645 56.273 50.317 55.601 51.145 55.601 c
+51.974 55.601 52.645 56.273 52.645 57.101 c
+52.645 57.929 51.974 58.601 51.145 58.601 c
+s
+4.395 58.601 m
+3.567 58.601 2.895 57.929 2.895 57.101 c
+2.895 56.273 3.567 55.601 4.395 55.601 c
+5.224 55.601 5.895 56.273 5.895 57.101 c
+5.895 57.929 5.224 58.601 4.395 58.601 c
+s
+%AI6_EndPatternLayer
+) &
+] E
+%AI3_EndPattern
+%AI3_BeginPattern: (Rope.side)
+(Rope.side) 1 4.6 60.9998 33.3999 [
+%AI3_Tile
+(0 O 0 R  0 0 0 1 k
+ 0 0 0 1 K
+) @
+(
+%AI6_BeginPatternLayer
+800 Ar
+1 J 1 j 0.6 w 4 M []0 d
+%AI3_Note:
+0 D
+0 XR
+24.9999 7 m
+15.6521 4.663 8.125 8.6981 1 14.1407 C
+S
+36.9999 7 m
+22.3477 3.337 12.168 15.3276 1 23.859 C
+S
+48.9999 7 m
+29.3464 2.0866 17.7386 25.3332 1 30.6213 C
+S
+1 30.9999 m
+24.9999 36.9999 36.9999 1 60.9998 7 C
+S
+13 30.9999 m
+32.6534 35.9133 44.2611 12.6667 60.9998 7.3786 C
+S
+24.9999 30.9999 m
+39.652 34.6629 49.8317 22.6722 60.9998 14.1407 C
+S
+36.9999 30.9999 m
+46.3476 33.3369 53.8749 29.3018 60.9998 23.859 C
+S
+48.9999 30.9999 m
+53.3464 32.0865 57.2978 31.7908 60.9998 30.6213 C
+S
+13 7 m
+8.6535 5.9134 4.7019 6.2091 1 7.3786 C
+S
+%AI6_EndPatternLayer
+) &
+] E
+%AI3_EndPattern
+%AI3_BeginPattern: (Scales)
+(Scales) 1.6 9.3475 48.088 55.8355 [
+%AI3_Tile
+(0 O 0 R  1 g
+ 1 G
+) @
+(
+%AI6_BeginPatternLayer
+800 Ar
+0 J 0 j 1 w 4 M []0 d
+%AI3_Note:
+0 D
+0 XR
+1.6 9.3475 m
+1.6 55.8355 L
+48.088 55.8355 L
+48.088 9.3475 L
+1.6 9.3475 L
+f
+%AI6_EndPatternLayer
+) &
+(0 O 0 R  0 g
+ 0 G
+) @
+(
+%AI6_BeginPatternLayer
+800 Ar
+0 J 0 j 0.3 w 4 M []0 d
+%AI3_Note:
+0 D
+0 XR
+17.0956 9.3475 m
+12.8162 9.3475 9.3475 5.8787 9.3475 1.6 C
+9.3475 5.8787 5.8787 9.3475 1.6 9.3475 C
+1.6 13.6262 5.0687 17.095 9.3475 17.095 c
+13.6268 17.095 17.0956 13.6262 17.0956 9.3475 C
+s
+32.5918 9.3475 m
+28.3125 9.3475 24.8437 5.8787 24.8437 1.6 C
+24.8437 5.8787 21.3743 9.3475 17.0956 9.3475 C
+17.0956 13.6262 20.5644 17.095 24.8437 17.095 c
+29.1224 17.095 32.5918 13.6262 32.5918 9.3475 C
+s
+48.088 9.3475 m
+43.8087 9.3475 40.3399 5.8787 40.3399 1.6 C
+40.3399 5.8787 36.8705 9.3475 32.5918 9.3475 C
+32.5918 13.6262 36.0606 17.095 40.3399 17.095 c
+44.6186 17.095 48.088 13.6262 48.088 9.3475 C
+s
+17.0956 40.3393 m
+12.8162 40.3393 9.3475 36.8699 9.3475 32.5912 C
+9.3475 36.8699 5.8787 40.3393 1.6 40.3393 C
+1.6 44.6181 5.0687 48.0874 9.3475 48.0874 c
+13.6268 48.0874 17.0956 44.6181 17.0956 40.3393 C
+s
+17.0956 24.8431 m
+12.8162 24.8431 9.3475 21.3743 9.3475 17.095 C
+9.3475 21.3743 5.8787 24.8431 1.6 24.8431 C
+1.6 29.1218 5.0687 32.5912 9.3475 32.5912 c
+13.6268 32.5912 17.0956 29.1218 17.0956 24.8431 C
+s
+32.5918 24.8431 m
+28.3125 24.8431 24.8437 21.3743 24.8437 17.095 C
+24.8437 21.3743 21.3743 24.8431 17.0956 24.8431 C
+17.0956 29.1218 20.5644 32.5912 24.8437 32.5912 c
+29.1224 32.5912 32.5918 29.1218 32.5918 24.8431 C
+s
+48.088 24.8431 m
+43.8087 24.8431 40.3399 21.3743 40.3399 17.095 C
+40.3399 21.3743 36.8705 24.8431 32.5918 24.8431 C
+32.5918 29.1218 36.0606 32.5912 40.3399 32.5912 c
+44.6186 32.5912 48.088 29.1218 48.088 24.8431 C
+s
+32.5918 40.3393 m
+28.3125 40.3393 24.8437 36.8699 24.8437 32.5912 C
+24.8437 36.8699 21.3743 40.3393 17.0956 40.3393 C
+17.0956 44.6181 20.5644 48.0874 24.8437 48.0874 c
+29.1224 48.0874 32.5918 44.6181 32.5918 40.3393 C
+s
+48.088 40.3393 m
+43.8087 40.3393 40.3399 36.8699 40.3399 32.5912 C
+40.3399 36.8699 36.8705 40.3393 32.5918 40.3393 C
+32.5918 44.6181 36.0606 48.0874 40.3399 48.0874 c
+44.6186 48.0874 48.088 44.6181 48.088 40.3393 C
+s
+17.0956 55.8355 m
+12.8162 55.8355 9.3475 52.3662 9.3475 48.0874 C
+9.3475 52.3662 5.8787 55.8355 1.6 55.8355 C
+1.6 60.1143 5.0687 63.5836 9.3475 63.5836 c
+13.6268 63.5836 17.0956 60.1143 17.0956 55.8355 C
+s
+32.5918 55.8355 m
+28.3125 55.8355 24.8437 52.3662 24.8437 48.0874 C
+24.8437 52.3662 21.3743 55.8355 17.0956 55.8355 C
+17.0956 60.1143 20.5644 63.5836 24.8437 63.5836 c
+29.1224 63.5836 32.5918 60.1143 32.5918 55.8355 C
+s
+48.088 55.8355 m
+43.8087 55.8355 40.3399 52.3662 40.3399 48.0874 C
+40.3399 52.3662 36.8705 55.8355 32.5918 55.8355 C
+32.5918 60.1143 36.0606 63.5836 40.3399 63.5836 c
+44.6186 63.5836 48.088 60.1143 48.088 55.8355 C
+s
+%AI6_EndPatternLayer
+) &
+] E
+%AI3_EndPattern
+%AI3_BeginPattern: (SolidStar.side)
+(SolidStar.side) 1 1 33.0117 33.0117 [
+%AI3_Tile
+(0 O 0 R  0.05 0.2 0.95 0 k
+ 0.05 0.2 0.95 0 K
+) @
+(
+%AI6_BeginPatternLayer
+800 Ar
+0 J 0 j 1 w 4 M []0 d
+%AI3_Note:
+1 D
+0 XR
+7.9689 26.0458 m
+14.5331 22.9874 l
+17.0095 29.7904 L
+19.4859 22.9874 l
+26.0473 26.0458 l
+22.9889 19.4815 l
+29.792 17.0052 l
+22.9889 14.5288 l
+26.0473 7.9674 l
+19.4859 11.0257 l
+17.0095 4.2226 l
+14.5305 11.0257 l
+7.9689 7.9674 l
+11.0273 14.5288 l
+4.2242 17.0052 l
+11.0273 19.4843 L
+7.9689 26.0458 l
+f
+%AI6_EndPatternLayer
+) &
+] E
+%AI3_EndPattern
+%AI3_BeginPattern: (Stars)
+(Stars) 1 1 63.384 84.766 [
+%AI3_Tile
+(0 O 0 R  1 0.9 0.1 0 k
+ 1 0.9 0.1 0 K
+) @
+(
+%AI6_BeginPatternLayer
+800 Ar
+0 J 0 j 0.3 w 4 M []0 d
+%AI3_Note:
+0 D
+0 XR
+1 1 m
+1 84.766 L
+63.384 84.766 L
+63.384 1 L
+1 1 L
+f
+%AI6_EndPatternLayer
+) &
+(0 O 0 R  0 0.25 1 0 k
+ 0 0.25 1 0 K
+) @
+(
+%AI6_BeginPatternLayer
+*u
+800 Ar
+0 J 0 j 1 w 4 M []0 d
+%AI3_Note:
+0 D
+0 XR
+37.668 67.113 m
+43.924 62.567 L
+41.535 55.213 L
+47.791 59.757 L
+54.046 55.212 L
+51.657 62.566 L
+57.914 67.112 L
+50.18 67.112 L
+47.791 74.467 L
+45.402 67.113 L
+37.668 67.113 L
+f
+16.596 59.757 m
+22.851 55.212 L
+20.462 62.566 L
+26.719 67.112 L
+18.985 67.112 L
+16.596 74.467 L
+14.207 67.113 L
+6.473 67.113 L
+12.729 62.567 L
+10.34 55.213 L
+16.596 59.757 L
+f
+20.462 20.683 m
+26.719 25.229 L
+18.985 25.229 L
+16.596 32.584 L
+14.207 25.23 L
+6.473 25.23 L
+12.729 20.684 L
+10.34 13.33 L
+16.596 17.874 L
+22.851 13.329 L
+20.462 20.683 L
+f
+38.447 34.271 m
+36.058 41.625 L
+42.315 46.171 L
+34.581 46.171 L
+32.192 53.526 L
+29.803 46.172 L
+22.069 46.172 L
+28.325 41.626 L
+25.936 34.272 L
+32.192 38.816 L
+38.447 34.271 L
+f
+51.657 20.683 m
+57.914 25.229 L
+50.18 25.229 L
+47.791 32.584 L
+45.402 25.23 L
+37.668 25.23 L
+43.924 20.684 L
+41.535 13.33 L
+47.791 17.874 L
+54.046 13.329 L
+51.657 20.683 L
+f
+*U
+1 XR
+34.581 4.288 m
+32.192 11.643 L
+29.803 4.289 L
+22.069 4.289 L
+26.5962 1 L
+37.7885 1 L
+42.315 4.288 L
+34.581 4.288 L
+f
+53.261 4.289 m
+57.7882 1 L
+63.384 1 L
+63.384 11.643 L
+60.995 4.289 L
+53.261 4.289 L
+f
+4.866 41.625 m
+11.123 46.171 L
+3.389 46.171 L
+1 53.526 L
+1 38.816 L
+7.255 34.271 L
+4.866 41.625 L
+f
+36.058 41.625 m
+42.315 46.171 L
+34.581 46.171 L
+32.192 53.526 L
+29.803 46.172 L
+22.069 46.172 L
+28.325 41.626 L
+25.936 34.272 L
+32.192 38.816 L
+38.447 34.271 L
+36.058 41.625 L
+f
+53.261 46.172 m
+59.517 41.626 L
+57.128 34.272 L
+63.384 38.816 L
+63.384 53.526 L
+60.995 46.172 L
+53.261 46.172 L
+f
+4.866 83.508 m
+6.5974 84.766 L
+1 84.766 L
+1 80.699 L
+7.255 76.154 L
+4.866 83.508 L
+f
+25.936 76.155 m
+32.192 80.699 L
+38.447 76.154 L
+36.058 83.508 L
+37.7895 84.766 L
+26.5951 84.766 L
+28.325 83.509 L
+25.936 76.155 L
+f
+22.851 55.212 m
+20.462 62.566 L
+26.719 67.112 L
+18.985 67.112 L
+16.596 74.467 L
+14.207 67.113 L
+6.473 67.113 L
+12.729 62.567 L
+10.34 55.213 L
+16.596 59.757 L
+22.851 55.212 L
+f
+41.535 55.213 m
+47.791 59.757 L
+54.046 55.212 L
+51.657 62.566 L
+57.914 67.112 L
+50.18 67.112 L
+47.791 74.467 L
+45.402 67.113 L
+37.668 67.113 L
+43.924 62.567 L
+41.535 55.213 L
+f
+50.18 25.229 m
+47.791 32.584 L
+45.402 25.23 L
+37.668 25.23 L
+43.924 20.684 L
+41.535 13.33 L
+47.791 17.874 L
+54.046 13.329 L
+51.657 20.683 L
+57.914 25.229 L
+50.18 25.229 L
+f
+18.985 25.229 m
+16.596 32.584 L
+14.207 25.23 L
+6.473 25.23 L
+12.729 20.684 L
+10.34 13.33 L
+16.596 17.874 L
+22.851 13.329 L
+20.462 20.683 L
+26.719 25.229 L
+18.985 25.229 L
+f
+3.388 4.289 m
+1 11.643 L
+1 1 L
+6.5948 1 L
+11.122 4.289 L
+3.388 4.289 L
+f
+57.128 76.154 m
+63.384 80.699 L
+63.384 84.766 L
+57.7855 84.766 L
+59.517 83.508 L
+57.128 76.154 L
+f
+%AI6_EndPatternLayer
+) &
+] E
+%AI3_EndPattern
+%AI3_BeginPattern: (Stripes)
+(Stripes) 8.45 4.6001 80.45 76.6001 [
+%AI3_Tile
+(0 O 0 R  1 0.07 1 0 k
+ 1 0.07 1 0 K
+) @
+(
+%AI6_BeginPatternLayer
+800 Ar
+0 J 0 j 3.6 w 4 M []0 d
+%AI3_Note:
+0 D
+0 XR
+8.2 8.2 m
+80.7 8.2 L
+S
+8.2 22.6001 m
+80.7 22.6001 L
+S
+8.2 37.0002 m
+80.7 37.0002 L
+S
+8.2 51.4 m
+80.7 51.4 L
+S
+8.2 65.8001 m
+80.7 65.8001 L
+S
+8.2 15.4 m
+80.7 15.4 L
+S
+8.2 29.8001 m
+80.7 29.8001 L
+S
+8.2 44.2 m
+80.7 44.2 L
+S
+8.2 58.6001 m
+80.7 58.6001 L
+S
+8.2 73.0002 m
+80.7 73.0002 L
+S
+%AI6_EndPatternLayer
+) &
+] E
+%AI3_EndPattern
+%AI3_BeginPattern: (TriBevel.outer)
+(TriBevel.outer) 1 1.0004 31.6124 31.6127 [
+%AI3_Tile
+(0 O 0 R  0 0 0 0.3 k
+ 0 0 0 0.3 K
+) @
+(
+%AI6_BeginPatternLayer
+800 Ar
+0 J 0 j 1 w 4 M []0 d
+%AI3_Note:
+0 D
+0 XR
+31.6118 5.4917 m
+27.1221 5.4917 L
+27.1205 1.0011 L
+27.8031 1.0011 L
+27.8031 4.8091 L
+31.6118 4.8091 L
+31.6118 5.4917 L
+f
+%AI6_EndPatternLayer
+) &
+(0 O 0 R  0 0 0 0.2 k
+ 0 0 0 0.2 K
+) @
+(
+%AI6_BeginPatternLayer
+800 Ar
+0 J 0 j 1 w 4 M []0 d
+%AI3_Note:
+0 D
+0 XR
+31.6149 9.5062 m
+23.1111 9.5062 L
+23.1111 1.0015 L
+27.1205 1.0015 L
+27.1205 5.493 L
+31.6144 5.493 L
+31.6149 9.5062 L
+f
+%AI6_EndPatternLayer
+) &
+(0 O 0 R  0 0 0 0.4 k
+ 0 0 0 0.4 K
+) @
+(
+%AI6_BeginPatternLayer
+800 Ar
+0 J 0 j 1 w 4 M []0 d
+%AI3_Note:
+0 D
+0 XR
+31.6124 10.485 m
+22.1297 10.485 L
+22.1292 1.0015 L
+23.1084 1.0015 L
+23.1084 9.5049 L
+31.6124 9.5049 L
+31.6124 10.485 L
+f
+%AI6_EndPatternLayer
+) &
+(0 O 0 R  0 0 0 0.3 k
+ 0 0 0 0.3 K
+) @
+(
+%AI6_BeginPatternLayer
+800 Ar
+0 J 0 j 1 w 4 M []0 d
+%AI3_Note:
+0 D
+0 XR
+31.6129 17.2066 m
+15.4064 17.2085 L
+15.4064 1 L
+22.1301 1 L
+22.1301 10.4868 L
+31.6129 10.4868 L
+31.6129 17.2066 L
+f
+%AI6_EndPatternLayer
+) &
+(0 O 0 R  0 0 0 0.5 k
+ 0 0 0 0.5 K
+) @
+(
+%AI6_BeginPatternLayer
+800 Ar
+0 J 0 j 1 w 4 M []0 d
+%AI3_Note:
+0 D
+0 XR
+31.6149 18.3658 m
+14.2517 18.3658 L
+14.2515 1.0009 L
+15.4043 1.0009 L
+15.4043 17.2093 L
+31.6149 17.2093 L
+31.6149 18.3658 L
+f
+%AI6_EndPatternLayer
+) &
+(0 O 0 R  0 0 0 0.4 k
+ 0 0 0 0.4 K
+) @
+(
+%AI6_BeginPatternLayer
+800 Ar
+0 J 0 j 1 w 4 M []0 d
+%AI3_Note:
+0 D
+0 XR
+31.6124 30.4755 m
+2.1395 30.4755 L
+2.1395 1.0015 L
+14.249 1 L
+14.249 18.366 L
+31.6149 18.366 L
+31.6124 30.4755 L
+f
+%AI6_EndPatternLayer
+) &
+(0 O 0 R  0 0 0 0.6 k
+ 0 0 0 0.6 K
+) @
+(
+%AI6_BeginPatternLayer
+800 Ar
+0 J 0 j 1 w 4 M []0 d
+%AI3_Note:
+0 D
+0 XR
+15.4066 16.847 m
+14.2778 18.3257 l
+15.4066 17.2057 l
+15.4066 16.847 l
+f
+%AI6_EndPatternLayer
+) &
+(0 O 0 R  0 0 0 0.5 k
+ 0 0 0 0.5 K
+) @
+(
+%AI6_BeginPatternLayer
+800 Ar
+0 J 0 j 1 w 4 M []0 d
+%AI3_Note:
+0 D
+0 XR
+23.1095 9.1906 m
+22.1759 10.4392 l
+23.1082 9.505 l
+23.1095 9.1906 l
+f
+%AI6_EndPatternLayer
+) &
+(0 O 0 R  0 0 0 0.4 k
+ 0 0 0 0.4 K
+) @
+(
+%AI6_BeginPatternLayer
+800 Ar
+0 J 0 j 1 w 4 M []0 d
+%AI3_Note:
+0 D
+0 XR
+27.8039 4.6026 m
+27.1619 5.4533 l
+27.8029 4.8093 l
+27.8039 4.6026 l
+f
+%AI6_EndPatternLayer
+) &
+] E
+%AI3_EndPattern
+%AI3_BeginPattern: (TriBevel.side)
+(TriBevel.side) 1.0006 1 29.0006 31.6124 [
+%AI3_Tile
+(0 O 0 R  0 0 0 0.3 k
+ 0 0 0 0.3 K
+) @
+(
+%AI6_BeginPatternLayer
+800 Ar
+0 J 0 j 1 w 4 M []0 d
+%AI3_Note:
+0 D
+0 XR
+29 4.8087 m
+29 4.8087 L
+29.0026 5.4927 L
+1.0026 5.4927 L
+1 4.8087 L
+1 4.8087 L
+29 4.8087 L
+f
+%AI6_EndPatternLayer
+) &
+(0 O 0 R  0 0 0 0.2 k
+ 0 0 0 0.2 K
+) @
+(
+%AI6_BeginPatternLayer
+800 Ar
+0 J 0 j 1 w 4 M []0 d
+%AI3_Note:
+0 D
+0 XR
+29.0026 5.4927 m
+29.0005 9.5045 L
+1.0005 9.5045 L
+1.0026 5.4927 L
+29.0026 5.4927 L
+f
+%AI6_EndPatternLayer
+) &
+(0 O 0 R  0 0 0 0.4 k
+ 0 0 0 0.4 K
+) @
+(
+%AI6_BeginPatternLayer
+800 Ar
+0 J 0 j 1 w 4 M []0 d
+%AI3_Note:
+0 D
+0 XR
+29.0005 9.5045 m
+29.0011 10.4865 L
+1.0011 10.4865 L
+1.0005 9.5045 L
+29.0005 9.5045 L
+f
+%AI6_EndPatternLayer
+) &
+(0 O 0 R  0 0 0 0.3 k
+ 0 0 0 0.3 K
+) @
+(
+%AI6_BeginPatternLayer
+800 Ar
+0 J 0 j 1 w 4 M []0 d
+%AI3_Note:
+0 D
+0 XR
+29.0011 10.4865 m
+29.003 17.209 L
+1.003 17.209 L
+1.0011 10.4865 L
+29.0011 10.4865 L
+f
+%AI6_EndPatternLayer
+) &
+(0 O 0 R  0 0 0 0.5 k
+ 0 0 0 0.5 K
+) @
+(
+%AI6_BeginPatternLayer
+800 Ar
+0 J 0 j 1 w 4 M []0 d
+%AI3_Note:
+0 D
+0 XR
+29.003 17.209 m
+29.0031 18.3656 L
+1.0031 18.3656 L
+1.003 17.209 L
+29.003 17.209 L
+f
+%AI6_EndPatternLayer
+) &
+(0 O 0 R  0 0 0 0.4 k
+ 0 0 0 0.4 K
+) @
+(
+%AI6_BeginPatternLayer
+800 Ar
+0 J 0 j 1 w 4 M []0 d
+%AI3_Note:
+0 D
+0 XR
+29.0031 18.3656 m
+29.0006 30.4752 L
+1.0006 30.4752 L
+1.0031 18.3656 L
+29.0031 18.3656 L
+f
+%AI6_EndPatternLayer
+) &
+] E
+%AI3_EndPattern
+%AI3_BeginPattern: (Waves-scroll)
+(Waves-scroll) 17.926 10.516 68.663 69.012 [
+%AI3_Tile
+(0 O 0 R  1 0 0.3 0 k
+ 1 0 0.3 0 K
+) @
+(
+%AI6_BeginPatternLayer
+800 Ar
+0 J 0 j 1 w 4 M []0 d
+%AI3_Note:
+1 D
+0 XR
+17.926 69.012 m
+17.926 10.516 L
+68.663 10.516 L
+68.663 69.012 L
+17.926 69.012 L
+f
+%AI6_EndPatternLayer
+) &
+(0 O 0 R  0.55 0 0 0 k
+ 0.55 0 0 0 K
+) @
+(
+%AI6_BeginPatternLayer
+800 Ar
+0 J 0 j 0.75 w 4 M []0 d
+%AI3_Note:
+0 D
+0 XR
+65.335 70.465 m
+65.881 68.746 67.444 68.168 68.663 69.012 C
+67.538 69.668 68.011 71.255 69.686 70.933 c
+72.124 70.464 71.894 67.213 70.53 65.589 c
+68.561 63.245 64.565 60.995 53.241 71.117 C
+S
+39.964 70.465 m
+40.511 68.746 42.074 68.168 43.293 69.012 C
+42.168 69.668 42.64 71.255 44.316 70.933 c
+46.753 70.464 46.524 67.213 45.16 65.589 c
+43.191 63.245 39.195 60.995 27.87 71.117 c
+S
+14.594 70.465 m
+15.141 68.746 16.704 68.168 17.923 69.012 C
+16.798 69.668 17.27 71.255 18.945 70.933 c
+21.382 70.464 21.153 67.213 19.789 65.589 c
+17.821 63.245 13.825 60.995 2.5 71.117 c
+S
+10.959 51.619 m
+22.282 41.497 26.278 43.747 28.247 46.09 c
+29.611 47.715 29.841 50.965 27.403 51.434 c
+25.728 51.757 25.255 50.169 26.38 49.513 C
+25.161 48.669 23.599 49.248 23.052 50.966 c
+22.723 51.997 23.38 53.966 24.872 54.903 c
+27.267 56.406 31.371 56.05 36.328 51.619 c
+47.653 41.497 51.649 43.746 53.618 46.09 c
+54.982 47.715 55.212 50.965 52.774 51.434 c
+51.099 51.757 50.626 50.169 51.751 49.513 C
+50.532 48.669 48.97 49.248 48.423 50.966 c
+48.094 51.997 48.751 53.966 50.243 54.903 c
+52.638 56.406 56.742 56.05 61.699 51.619 C
+73.024 41.497 77.02 43.747 78.988 46.09 c
+S
+70.156 32.12 m
+65.199 36.551 61.095 36.907 58.7 35.404 c
+57.208 34.468 56.552 32.499 56.88 31.468 c
+57.427 29.749 58.99 29.171 60.208 30.015 C
+59.083 30.671 59.556 32.258 61.231 31.936 c
+63.669 31.467 63.439 28.216 62.075 26.592 c
+60.106 24.248 56.11 21.998 44.786 32.12 C
+39.829 36.551 35.725 36.907 33.33 35.404 c
+31.838 34.468 31.182 32.499 31.51 31.468 c
+32.056 29.749 33.619 29.171 34.838 30.015 C
+33.713 30.671 34.186 32.258 35.861 31.936 c
+38.299 31.467 38.069 28.216 36.705 26.592 c
+34.737 24.248 30.74 21.998 19.415 32.12 c
+14.458 36.551 10.354 36.907 7.96 35.404 c
+S
+19.792 7.094 m
+21.157 8.719 21.386 11.968 18.949 12.437 c
+17.274 12.76 16.801 11.172 17.926 10.516 C
+16.708 9.673 15.145 10.252 14.598 11.969 c
+14.27 13 14.926 14.969 16.418 15.906 c
+18.812 17.409 22.916 17.053 27.874 12.622 c
+39.199 2.5 43.195 4.75 45.163 7.094 c
+46.528 8.719 46.757 11.968 44.32 12.437 c
+42.644 12.76 42.172 11.172 43.297 10.516 C
+42.078 9.673 40.515 10.252 39.968 11.969 c
+39.64 13 40.297 14.969 41.788 15.906 c
+44.183 17.409 48.287 17.053 53.245 12.622 C
+64.569 2.5 68.565 4.75 70.534 7.094 c
+71.898 8.719 72.127 11.968 69.69 12.437 c
+68.014 12.76 67.542 11.172 68.667 10.516 C
+67.448 9.673 65.885 10.252 65.338 11.969 c
+65.011 13 65.667 14.969 67.159 15.906 c
+69.553 17.409 73.657 17.053 78.615 12.622 c
+S
+%AI6_EndPatternLayer
+) &
+] E
+%AI3_EndPattern
+%AI5_End_NonPrinting--
+%AI5_Begin_NonPrinting
+Np
+12 Bn
+%AI5_BeginGradient: (Black, White)
+(Black, White) 0 2 Bd
+[
+<
+FFFEFDFCFBFAF9F8F7F6F5F4F3F2F1F0EFEEEDECEBEAE9E8E7E6E5E4E3E2E1E0DFDEDDDCDBDAD9D8
+D7D6D5D4D3D2D1D0CFCECDCCCBCAC9C8C7C6C5C4C3C2C1C0BFBEBDBCBBBAB9B8B7B6B5B4B3B2B1B0
+AFAEADACABAAA9A8A7A6A5A4A3A2A1A09F9E9D9C9B9A999897969594939291908F8E8D8C8B8A8988
+87868584838281807F7E7D7C7B7A797877767574737271706F6E6D6C6B6A69686766656463626160
+5F5E5D5C5B5A595857565554535251504F4E4D4C4B4A494847464544434241403F3E3D3C3B3A3938
+37363534333231302F2E2D2C2B2A292827262524232221201F1E1D1C1B1A19181716151413121110
+0F0E0D0C0B0A09080706050403020100
+>
+0 %_Br
+[
+0 0 50 100 %_Bs
+1 0 50 0 %_Bs
+BD
+%AI5_EndGradient
+%AI5_BeginGradient: (Chrome)
+(Chrome) 0 6 Bd
+[
+0
+<
+464646454545444444444343434342424241414141404040403F3F3F3E3E3E3E3D3D3D3C3C3C3C3B
+3B3B3B3A3A3A39393939383838383737373636363635353535343434333333333232323131313130
+3030302F2F2F2E2E2E2E2D2D2D2D2C2C2C2B2B2B2B2A2A2A2A292929282828282727272726262625
+2525252424242323232322222222212121202020201F1F1F1F1E1E1E1D1D1D1D1C1C1C1C1B1B1B1A
+1A1A1A1919191818181817171717161616151515151414141413131312121212111111101010100F
+0F0F0F0E0E0E0D0D0D0D0C0C0C0C0B0B0B0A0A0A0A09090909080808070707070606060505050504
+04040403030302020202010101010000
+>
+<
+FFFEFDFCFBFAF9F8F7F6F5F4F3F2F1F0EFEEEDECEBEAE9E8E7E6E5E4E3E2E1E0DFDEDDDCDBDAD9D8
+D7D6D5D4D3D2D1D0CFCECDCCCBCAC9C8C7C6C5C4C3C2C1C0BFBEBDBCBBBAB9B8B7B6B5B4B3B2B1B0
+AFAEADACABAAA9A8A7A6A5A4A3A2A1A09F9E9D9C9B9A999897969594939291908F8E8D8C8B8A8988
+87868584838281807F7E7D7C7B7A797877767574737271706F6E6D6C6B6A69686766656463626160
+5F5E5D5C5B5A595857565554535251504F4E4D4C4B4A494847464544434241403F3E3D3C3B3A3938
+37363534333231302F2E2D2C2B2A292827262524232221201F1E1D1C1B1A19181716151413121110
+0F0E0D0C0B0A09080706050403020100
+>
+<
+1F1E1E1E1E1E1E1E1E1E1D1D1D1D1D1D1D1D1C1C1C1C1C1C1C1C1B1B1B1B1B1B1B1B1B1A1A1A1A1A
+1A1A1A19191919191919191818181818181818181717171717171717161616161616161615151515
+15151515151414141414141414131313131313131312121212121212121211111111111111111010
+1010101010100F0F0F0F0F0F0F0F0F0E0E0E0E0E0E0E0E0D0D0D0D0D0D0D0D0C0C0C0C0C0C0C0C0C
+0B0B0B0B0B0B0B0B0A0A0A0A0A0A0A0A090909090909090909080808080808080807070707070707
+07060606060606060606050505050505050504040404040404040303030303030303030202020202
+02020201010101010101010000000000
+>
+1 %_Br
+0
+0.275
+1
+<
+6B6A696867666564636261605F5E5D5C5B5A595857565554535251504F4E4D4C4B4A494847464544
+434241403F3E3D3C3B3A393837363534333231302F2E2D2C2B2A292827262524232221201F
+>
+1 %_Br
+0
+<
+00000101010102020202030303040404040505050506060607070707080808090909090A0A0A0A0B
+0B0B0C0C0C0C0D0D0D0D0E0E0E0F0F0F0F1010101011111112121212131313141414141515151516
+161617171717181818181919191A1A1A1A1B1B1B1B1C1C1C1D1D1D1D1E1E1E1F1F1F1F2020202021
+212122222222232323232424242525252526262626272727282828282929292A2A2A2A2B2B2B2B2C
+2C2C2D2D2D2D2E2E2E2E2F2F2F303030303131313132323233333333343434353535353636363637
+373738383838393939393A3A3A3B3B3B3B3C3C3C3C3D3D3D3E3E3E3E3F3F3F404040404141414142
+42424343434344444444454545464646
+>
+<
+000102030405060708090A0B0C0D0E0F101112131415161718191A1B1C1D1E1F2021222324252627
+28292A2B2C2D2E2F303132333435363738393A3B3C3D3E3F404142434445464748494A4B4C4D4E4F
+505152535455565758595A5B5C5D5E5F606162636465666768696A6B6C6D6E6F7071727374757677
+78797A7B7C7D7E7F808182838485868788898A8B8C8D8E8F909192939495969798999A9B9C9D9E9F
+A0A1A2A3A4A5A6A7A8A9AAABACADAEAFB0B1B2B3B4B5B6B7B8B9BABBBCBDBEBFC0C1C2C3C4C5C6C7
+C8C9CACBCCCDCECFD0D1D2D3D4D5D6D7D8D9DADBDCDDDEDFE0E1E2E3E4E5E6E7E8E9EAEBECEDEEEF
+F0F1F2F3F4F5F6F7F8F9FAFBFCFDFEFF
+>
+<
+00000101020203030304040505050606070708080809090A0A0A0B0B0C0C0D0D0D0E0E0F0F101010
+1111121212131314141515151616171718181819191A1A1A1B1B1C1C1D1D1D1E1E1F1F1F20202121
+222222232324242525252626272727282829292A2A2A2B2B2C2C2D2D2D2E2E2F2F2F303031313232
+32333334343435353636373737383839393A3A3A3B3B3C3C3C3D3D3E3E3F3F3F4040414142424243
+434444444545464647474748484949494A4A4B4B4C4C4C4D4D4E4E4F4F4F50505151515252535354
+54545555565657575758585959595A5A5B5B5C5C5C5D5D5E5E5F5F5F606061616162626363646464
+6565666666676768686969696A6A6B6B
+>
+1 %_Br
+1
+0 %_Br
+<
+FFFEFDFCFBFAF9F8F7F6F5F4F3F2F1F0EFEEEDECEBEAE9E8E7E6E5E4E3E2E1E0DFDEDDDCDBDAD9D8
+D7D6D5D4D3D2D1D0CFCECDCCCBCAC9C8C7C6C5C4C3C2C1C0BFBEBDBCBBBAB9B8B7B6B5B4B3B2B1B0
+AFAEADACABAAA9A8A7A6A5A4A3A2A1A09F9E9D9C9B9A999897969594939291908F8E8D8C8B8A8988
+87868584838281807F7E7D7C7B7A797877767574737271706F6E6D6C6B6A69686766656463626160
+5F5E5D5C5B5A595857565554535251504F4E4D4C4B4A494847464544434241403F3E3D3C3B3A3938
+37363534333231302F2E2D2C2B2A292827262524232221201F1E1D1C1B1A19181716151413121110
+0F0E0D0C0B0A09080706050403020100
+>
+<
+4D4C4C4C4B4B4B4A4A4A4A4949494848484747474746464645454544444444434343424242414141
+414040403F3F3F3E3E3E3E3D3D3D3C3C3C3B3B3B3B3A3A3A39393938383838373737363636353535
+35343434333333323232323131313030302F2F2F2F2E2E2E2D2D2D2C2C2C2C2B2B2B2A2A2A292929
+292828282727272626262625252524242423232323222222212121202020201F1F1F1E1E1E1D1D1D
+1D1C1C1C1B1B1B1A1A1A1A1919191818181717171716161615151514141414131313121212111111
+111010100F0F0F0E0E0E0E0D0D0D0C0C0C0B0B0B0B0A0A0A09090908080808070707060606050505
+05040404030303020202020101010000
+>
+0
+0
+1 %_Br
+[
+1 0 50 92 %_Bs
+0 0.275 1 0.12 1 50 59 %_Bs
+0 0.275 1 0.42 1 50 50 %_Bs
+1 0 50 49 %_Bs
+1 0 50 41 %_Bs
+1 0.3 0 0 1 50 0 %_Bs
+BD
+%AI5_EndGradient
+%AI5_BeginGradient: (Green, Blue)
+(Green, Blue) 0 2 Bd
+[
+<
+99999A9A9B9B9B9C9C9D9D9D9E9E9F9F9FA0A0A1A1A1A2A2A3A3A3A4A4A5A5A5A6A6A7A7A7A8A8A9
+A9A9AAAAABABABACACADADADAEAEAFAFAFB0B0B1B1B1B2B2B3B3B3B4B4B5B5B5B6B6B7B7B7B8B8B9
+B9B9BABABBBBBBBCBCBDBDBDBEBEBFBFBFC0C0C1C1C1C2C2C3C3C3C4C4C5C5C5C6C6C7C7C7C8C8C9
+C9C9CACACBCBCBCCCCCDCDCDCECECFCFCFD0D0D1D1D1D2D2D3D3D3D4D4D5D5D5D6D6D7D7D7D8D8D9
+D9D9DADADBDBDBDCDCDDDDDDDEDEDFDFDFE0E0E1E1E1E2E2E3E3E3E4E4E5E5E5E6E6E7E7E7E8E8E9
+E9E9EAEAEBEBEBECECEDEDEDEEEEEFEFEFF0F0F1F1F1F2F2F3F3F3F4F4F5F5F5F6F6F7F7F7F8F8F9
+F9F9FAFAFBFBFBFCFCFDFDFDFEFEFFFF
+>
+<
+000102020304050506070808090A0B0B0C0D0E0E0F101111121314141516171718191A1A1B1C1D1D
+1E1F20202122232324252626272829292A2B2C2C2D2E2F2F303132323334353536373838393A3B3B
+3C3D3E3E3F404141424344444546474748494A4A4B4C4D4D4E4F5050515253535455565657585959
+5A5B5C5C5D5E5F5F606162626364656566676868696A6B6B6C6D6E6E6F7071717273747475767777
+78797A7A7B7C7D7D7E7F80808182828384858586878888898A8B8B8C8D8E8E8F9091919293949495
+96979798999A9A9B9C9D9D9E9FA0A0A1A2A3A3A4A5A6A6A7A8A9A9AAABACACADAEAFAFB0B1B2B2B3
+B4B5B5B6B7B8B8B9BABBBBBCBDBEBEBF
+>
+<
+FFFEFDFCFBFAF9F8F7F6F5F4F3F2F1F0EFEEEDECEBEAE9E8E7E6E5E4E3E2E1E0DFDEDDDCDBDAD9D8
+D7D6D5D4D3D2D1D0CFCECDCCCBCAC9C8C7C6C5C4C3C2C1C0BFBEBDBCBBBAB9B8B7B6B5B4B3B2B1B0
+AFAEADACABAAA9A8A7A6A5A4A3A2A1A09F9E9D9C9B9A999897969594939291908F8E8D8C8B8A8988
+87868584838281807F7E7D7C7B7A797877767574737271706F6E6D6C6B6A69686766656463626160
+5F5E5D5C5B5A595857565554535251504F4E4D4C4B4A494847464544434241403F3E3D3C3B3A3938
+37363534333231302F2E2D2C2B2A292827262524232221201F1E1D1C1B1A19181716151413121110
+0F0E0D0C0B0A09080706050403020100
+>
+0
+1 %_Br
+[
+1 0.75 0 0 1 50 100 %_Bs
+0.6 0 1 0 1 50 0 %_Bs
+BD
+%AI5_EndGradient
+%AI5_BeginGradient: (Orange, Green, Violet)
+(Orange, Green, Violet) 0 3 Bd
+[
+<
+F0EFEFEFEEEEEEEDEDEDECECECEBEBEBEAEAEAE9E9E9E8E8E8E7E7E7E6E6E6E5E5E5E4E4E4E3E3E3
+E3E2E2E2E1E1E1E0E0E0DFDFDFDEDEDEDDDDDDDCDCDCDBDBDBDADADAD9D9D9D8D8D8D7D7D7D6D6D6
+D5D5D5D4D4D4D3D3D3D2D2D2D1D1D1D0D0D0CFCFCFCECECECDCDCDCCCCCCCBCBCBCACACAC9C9C9C8
+C8C8C7C7C7C6C6C6C5C5C5C4C4C4C3C3C3C2C2C2C2C1C1C1C0C0C0BFBFBFBEBEBEBDBDBDBCBCBCBB
+BBBBBABABAB9B9B9B8B8B8B7B7B7B6B6B6B5B5B5B4B4B4B3B3B3B2B2B2B1B1B1B0B0B0AFAFAFAEAE
+AEADADADACACACABABABAAAAAAA9A9A9A8A8A8A7A7A7A6A6A6A5A5A5A4A4A4A3A3A3A2A2A2A1A1A1
+A0A0A0A09F9F9F9E9E9E9D9D9D9C9C9C
+>
+<
+5455555657575859595A5A5B5C5C5D5E5E5F5F6061616263636465656666676868696A6A6B6B6C6D
+6D6E6F6F707171727273747475767677777879797A7B7B7C7C7D7E7E7F8080818282838384858586
+87878888898A8A8B8C8C8D8D8E8F8F909191929393949495969697989899999A9B9B9C9D9D9E9E9F
+A0A0A1A2A2A3A4A4A5A5A6A7A7A8A9A9AAAAABACACADAEAEAFAFB0B1B1B2B3B3B4B5B5B6B6B7B8B8
+B9BABABBBBBCBDBDBEBFBFC0C1C1C2C2C3C4C4C5C6C6C7C7C8C9C9CACBCBCCCCCDCECECFD0D0D1D2
+D2D3D3D4D5D5D6D7D7D8D8D9DADADBDCDCDDDDDEDFDFE0E1E1E2E3E3E4E4E5E6E6E7E8E8E9E9EAEB
+EBECEDEDEEEFEFF0F0F1F2F2F3F4F4F5
+>
+<
+FFFEFDFCFBFAF9F8F7F6F5F4F3F2F1F0EFEEEDECEBEAE9E8E7E6E5E4E3E2E1E0DFDEDDDCDBDAD9D8
+D7D6D5D4D3D2D1D0CFCECDCCCBCAC9C8C7C6C5C4C3C2C1C0BFBEBDBCBBBAB9B8B7B6B5B4B3B2B1B0
+AFAEADACABAAA9A8A7A6A5A4A3A2A1A09F9E9D9C9B9A999897969594939291908F8E8D8C8B8A8988
+87868584838281807F7E7D7C7B7A797877767574737271706F6E6D6C6B6A69686766656463626160
+5F5E5D5C5B5A595857565554535251504F4E4D4C4B4A494847464544434241403F3E3D3C3B3A3938
+37363534333231302F2E2D2C2B2A292827262524232221201F1E1D1C1B1A19181716151413121110
+0F0E0D0C0B0A09080706050403020100
+>
+<
+00000000000000000000000000000000000000000000000000000000000000000000000000000000
+00000000000000000000000101010101010101010101010101010101010101010101010101010101
+01010101010101010101010101010101010101010101010101010101010101010101010101010101
+01010101010101010101010101010101010101010101010101010101010101020202020202020202
+02020202020202020202020202020202020202020202020202020202020202020202020202020202
+02020202020202020202020202020202020202020202020202020202020202020202020202020202
+02020202020202020202020303030303
+>
+1 %_Br
+<
+000102030405060708090A0B0C0D0E0F101112131415161718191A1B1C1D1E1F2021222324252627
+28292A2B2C2D2E2F303132333435363738393A3B3C3D3E3F404142434445464748494A4B4C4D4E4F
+505152535455565758595A5B5C5D5E5F606162636465666768696A6B6C6D6E6F7071727374757677
+78797A7B7C7D7E7F808182838485868788898A8B8C8D8E8F909192939495969798999A9B9C9D9E9F
+A0A1A2A3A4A5A6A7A8A9AAABACADAEAFB0B1B2B3B4B5B6B7B8B9BABBBCBDBEBFC0C1C2C3C4C5C6C7
+C8C9CACBCCCDCECFD0D1D2D3D4D5D6D7D8D9DADBDCDDDEDFE0E1E2E3E4E5E6E7E8E9EAEBECEDEEEF
+F0
+>
+<
+A1A0A0A09F9F9F9E9E9E9D9D9D9D9C9C9C9B9B9B9A9A9A9999999898989797979696969595959594
+94949393939292929191919090908F8F8F8E8E8E8E8D8D8D8C8C8C8B8B8B8A8A8A89898988888887
+878787868686858585848484838383828282818181808080807F7F7F7E7E7E7D7D7D7C7C7C7B7B7B
+7A7A7A79797978787878777777767676757575747474737373727272717171717070706F6F6F6E6E
+6E6D6D6D6C6C6C6B6B6B6A6A6A6A6969696868686767676666666565656464646363636262626261
+61616060605F5F5F5E5E5E5D5D5D5C5C5C5B5B5B5B5A5A5A59595958585857575756565655555554
+54
+>
+<
+F5F5F5F5F5F5F5F5F5F5F5F5F5F5F5F5F5F6F6F6F6F6F6F6F6F6F6F6F6F6F6F6F6F6F6F6F6F6F6F6
+F7F7F7F7F7F7F7F7F7F7F7F7F7F7F7F7F7F7F7F7F7F7F7F7F8F8F8F8F8F8F8F8F8F8F8F8F8F8F8F8
+F8F8F8F8F8F8F8F8F9F9F9F9F9F9F9F9F9F9F9F9F9F9F9F9F9F9F9F9F9F9F9FAFAFAFAFAFAFAFAFA
+FAFAFAFAFAFAFAFAFAFAFAFAFAFAFAFBFBFBFBFBFBFBFBFBFBFBFBFBFBFBFBFBFBFBFBFBFBFBFCFC
+FCFCFCFCFCFCFCFCFCFCFCFCFCFCFCFCFCFCFCFCFCFCFDFDFDFDFDFDFDFDFDFDFDFDFDFDFDFDFDFD
+FDFDFDFDFDFEFEFEFEFEFEFEFEFEFEFEFEFEFEFEFEFEFEFEFEFEFEFEFEFFFFFFFFFFFFFFFFFFFFFF
+FF
+>
+0
+1 %_Br
+[
+0.61 0.96 0 0.01 1 50 100 %_Bs
+0.94 0.33 1 0 1 50 50 %_Bs
+0 0.63 0.96 0 1 50 0 %_Bs
+BD
+%AI5_EndGradient
+%AI5_BeginGradient: (Pink, Yellow, Green )
+(Pink, Yellow, Green ) 0 3 Bd
+[
+<
+000102030405060708090A0B0C0D0E0F101112131415161718191A1B1C1D1E1F2021222324252627
+28292A2B2C2D2E2F303132333435363738393A3B3C3D3E3F404142434445464748494A4B4C4E4F50
+5152535455565758595A5B5C5D5E5F606162636465666768696A6B6C6D6E6F70717273
+>
+<
+05050505050505050505050505050404040404040404040404040404040404040404040403030303
+03030303030303030303030303030303030303020202020202020202020202020202020202020202
+0201010101010101010101010101010101010101010101000000000000000000000000
+>
+<
+CCCCCCCCCCCBCBCBCBCBCBCBCBCBCACACACACACACACACAC9C9C9C9C9C9C9C9C9C8C8C8C8C8C8C8C8
+C8C7C7C7C7C7C7C7C7C7C6C6C6C6C6C6C6C6C6C5C5C5C5C5C5C5C5C5C4C4C4C4C4C4C4C4C3C3C3C3
+C3C3C3C3C3C2C2C2C2C2C2C2C2C2C1C1C1C1C1C1C1C1C1C0C0C0C0C0C0C0C0C0BFBFBF
+>
+0
+1 %_Br
+<
+0D0D0D0D0D0D0D0D0D0D0D0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0B
+0B0B0B0B0B0B0B0B0B0B0B0B0B0B0B0B0B0B0B0B0B0B0A0A0A0A0A0A0A0A0A0A0A0A0A0A0A0A0A0A
+0A0A0A09090909090909090909090909090909090909090808080808080808080808080808080808
+08080807070707070707070707070707070707070706060606060606060606060606060606060605
+05050505050505050505050505050505050404040404040404040404040404040404030303030303
+03030303030303030303030202020202020202020202020202020201010101010101010101010101
+010101000000000000000000
+>
+<
+B2B2B2B2B1B1B1B0B0B0AFAFAEAEAEADADACACABABAAAAA9A9A8A8A7A7A6A6A5A5A4A4A3A3A2A2A1
+A0A09F9F9E9E9D9D9C9B9B9A9A999898979796959594949392929190908F8F8E8D8D8C8B8B8A8989
+88888786868584848382828180807F7E7D7D7C7B7B7A7979787777767575747372727170706F6E6D
+6D6C6B6B6A69686867666565646363626160605F5E5D5D5C5B5A5A59585757565554545352515150
+4F4E4D4D4C4B4A4A4948474646454443434241403F3F3E3D3C3B3B3A393837373635343333323130
+2F2F2E2D2C2B2B2A2928272726252423222221201F1E1D1D1C1B1A1918181716151413131211100F
+0E0E0D0C0B0A090908070605
+>
+<
+0000010101020202030304040505060607070808090A0A0B0B0C0C0D0E0E0F0F1011111213131415
+151616171818191A1B1B1C1D1D1E1F1F202122222324242526272728292A2A2B2C2C2D2E2F303031
+323333343536363738393A3A3B3C3D3E3E3F4041424243444546464748494A4B4B4C4D4E4F505051
+5253545556565758595A5B5B5C5D5E5F6061626263646566676869696A6B6C6D6E6F707171727374
+75767778797A7B7B7C7D7E7F80818283848586868788898A8B8C8D8E8F9091929394949596979899
+9A9B9C9D9E9FA0A1A2A3A4A5A6A7A8A9AAAAABACADAEAFB0B1B2B3B4B5B6B7B8B9BABBBCBDBEBFC0
+C1C2C3C4C5C6C7C8C9CACBCC
+>
+0
+1 %_Br
+[
+0.45 0 0.75 0 1 50 100 %_Bs
+0 0.02 0.8 0 1 50 64 %_Bs
+0.05 0.7 0 0 1 57 0 %_Bs
+BD
+%AI5_EndGradient
+%AI5_BeginGradient: (Purple, Red, Yellow)
+(Purple, Red, Yellow) 0 3 Bd
+[
+0
+<
+FFFEFDFCFBFAF9F8F7F6F5F4F3F2F1F0EFEEEDECEBEAE9E8E7E6E5E4E3E2E1E0DFDEDDDCDBDAD9D8
+D7D6D5D4D3D2D1D0CFCECDCCCBCAC9C8C7C6C5C4C3C2C1C0BFBEBDBCBBBAB9B8B7B6B5B4B3B2B1B0
+AFAEADACABAAA9A8A7A6A5A4A3A2A1A09F9E9D9C9B9A999897969594939291908F8E8D8C8B8A8988
+87868584838281807F7E7D7C7B7A797877767574737271706F6E6D6C6B6A69686766656463626160
+5F5E5D5C5B5A595857565554535251504F4E4D4C4B4A494847464544434241403F3E3D3C3B3A3938
+37363534333231302F2E2D2C2B2A292827262524232221201F1E1D1C1B1A19181716151413121110
+0F0E0D0C0B0A
+>
+<
+CCCCCCCDCDCDCDCDCECECECECECFCFCFCFD0D0D0D0D0D1D1D1D1D1D2D2D2D2D2D3D3D3D3D3D4D4D4
+D4D5D5D5D5D5D6D6D6D6D6D7D7D7D7D7D8D8D8D8D8D9D9D9D9DADADADADADBDBDBDBDBDCDCDCDCDC
+DDDDDDDDDDDEDEDEDEDFDFDFDFDFE0E0E0E0E0E1E1E1E1E1E2E2E2E2E2E3E3E3E3E4E4E4E4E4E5E5
+E5E5E5E6E6E6E6E6E7E7E7E7E7E8E8E8E8E9E9E9E9E9EAEAEAEAEAEBEBEBEBEBECECECECECEDEDED
+EDEEEEEEEEEEEFEFEFEFEFF0F0F0F0F0F1F1F1F1F1F2F2F2F2F3F3F3F3F3F4F4F4F4F4F5F5F5F5F5
+F6F6F6F6F6F7F7F7F7F8F8F8F8F8F9F9F9F9F9FAFAFAFAFAFBFBFBFBFBFCFCFCFCFDFDFDFDFDFEFE
+FEFEFEFFFFFF
+>
+0
+1 %_Br
+<
+E5E4E3E2E1E0DFDEDDDCDBDAD9D8D7D6D5D4D3D2D1D0CFCECDCCCBCAC9C8C7C6C5C4C3C2C1C0BFBE
+BDBCBBBAB9B8B7B6B5B4B3B2B1B0AFAEADACABAAA9A8A7A6A5A4A3A2A1A09F9E9D9C9B9A99989796
+9594939291908F8E8D8C8B8A898887868584838281807F7E7D7C7B7A797877767574737271706F6E
+6D6C6B6A696867666564636261605F5E5D5C5B5A595857565554535251504F4E4D4C4B4A49484746
+4544434241403F3E3D3C3B3A393837363534333231302F2E2D2C2B2A292827262524232221201F1E
+1D1C1B1A191817161514131211100F0E0D0C0B0A09080706050403020100
+>
+<
+E5E6E6E6E6E6E6E6E6E7E7E7E7E7E7E7E7E7E8E8E8E8E8E8E8E8E8E9E9E9E9E9E9E9E9E9EAEAEAEA
+EAEAEAEAEAEBEBEBEBEBEBEBEBEBECECECECECECECECECEDEDEDEDEDEDEDEDEDEEEEEEEEEEEEEEEE
+EEEFEFEFEFEFEFEFEFEFF0F0F0F0F0F0F0F0F0F1F1F1F1F1F1F1F1F1F2F2F2F2F2F2F2F2F2F3F3F3
+F3F3F3F3F3F3F4F4F4F4F4F4F4F4F4F5F5F5F5F5F5F5F5F5F6F6F6F6F6F6F6F6F6F7F7F7F7F7F7F7
+F7F7F8F8F8F8F8F8F8F8F8F9F9F9F9F9F9F9F9F9FAFAFAFAFAFAFAFAFAFBFBFBFBFBFBFBFBFBFCFC
+FCFCFCFCFCFCFCFDFDFDFDFDFDFDFDFDFEFEFEFEFEFEFEFEFEFFFFFFFFFF
+>
+<
+00010203040405060708090A0B0C0C0D0E0F10111213141415161718191A1B1C1D1D1E1F20212223
+242525262728292A2B2C2D2D2E2F30313233343535363738393A3B3C3D3D3E3F4041424344454546
+4748494A4B4C4D4E4E4F50515253545556565758595A5B5C5D5E5E5F60616263646566666768696A
+6B6C6D6E6E6F70717273747576767778797A7B7C7D7E7F7F80818283848586878788898A8B8C8D8E
+8F8F90919293949596979798999A9B9C9D9E9F9FA0A1A2A3A4A5A6A7A7A8A9AAABACADAEAFAFB0B1
+B2B3B4B5B6B7B8B8B9BABBBCBDBEBFC0C0C1C2C3C4C5C6C7C8C8C9CACBCC
+>
+0
+1 %_Br
+[
+0 0.04 1 0 1 50 100 %_Bs
+0 1 0.8 0 1 50 50 %_Bs
+0.9 0.9 0 0 1 50 0 %_Bs
+BD
+%AI5_EndGradient
+%AI5_BeginGradient: (Rainbow)
+(Rainbow) 0 6 Bd
+[
+<
+FFFEFDFCFBFAF9F8F7F6F5F4F3F2F1F0EFEEEDECEBEAE9E8E7E6E5E4E3E2E1E0DFDEDDDCDBDAD9D8
+D7D6D5D4D3D2D1D0CFCECDCCCBCAC9C8C7C6C5C4C3C2C1C0BFBEBDBCBBBAB9B8B7B6B5B4B3B2B1B0
+AFAEADACABAAA9A8A7A6A5A4A3A2A1A09F9E9D9C9B9A999897969594939291908F8E8D8C8B8A8988
+87868584838281807F7E7D7C7B7A797877767574737271706F6E6D6C6B6A69686766656463626160
+5F5E5D5C5B5A595857565554535251504F4E4D4C4B4A494847464544434241403F3E3D3C3B3A3938
+37363534333231302F2E2D2C2B2A292827262524232221201F1E1D1C1B1A19181716151413121110
+0F0E0D0C0B0A09080706050403020100
+>
+1
+0
+0
+1 %_Br
+1
+<
+0708090A0B0C0D0E0F101112131415161718191A1B1C1D1E1F202122232425262728292A2B2C2D2E
+2F303132333435363738393A3B3C3D3E3F404142434445464748494A4B4C4D4E4F50515253545556
+5758595A5B5C5D5E5F606162636465666768696A6B6C6D6E6F707172737475767778797A7B7C7D7E
+7F808182838485868788898A8B8C8D8E8F909192939495969798999A9B9C9D9E9FA0A1A2A3A4A5A6
+A7A8A9AAABACADAEAFB0B1B2B3B4B5B6B7B8B9BABBBCBDBEBFC0C1C2C3C4C5C6C7C8C9CACBCCCDCE
+CFD0D1D2D3D4D5D6D7D8D9DADBDCDDDEDFE0E1E2E3E4E5E6E7E8E9EAEBECEDEEEFF0F1F2F3F4F5F6
+F7F8F9FAFBFCFDFEFF
+>
+0
+0
+1 %_Br
+1
+<
+00000000000000000000000000000000000001010101010101010101010101010101010101010101
+01010101010101010101010101010202020202020202020202020202020202020202020202020202
+02020202020202020202030303030303030303030303030303030303030303030303030303030303
+03030303030304040404040404040404040404040404040404040404040404040404040404040404
+04040505050505050505050505050505050505050505050505050505050505050505050505050606
+06060606060606060606060606060606060606060606060606060606060606060606070707070707
+07070707070707070707070707070707
+>
+<
+FFFEFDFCFBFAF9F8F7F6F5F4F3F2F1F0EFEEEDECEBEAE9E8E7E6E5E4E3E2E1E0DFDEDDDCDBDAD9D8
+D7D6D5D4D3D2D1D0CFCECDCCCBCAC9C8C7C6C5C4C3C2C1C0BFBEBDBCBBBAB9B8B7B6B5B4B3B2B1B0
+AFAEADACABAAA9A8A7A6A5A4A3A2A1A09F9E9D9C9B9A999897969594939291908F8E8D8C8B8A8988
+87868584838281807F7E7D7C7B7A797877767574737271706F6E6D6C6B6A69686766656463626160
+5F5E5D5C5B5A595857565554535251504F4E4D4C4B4A494847464544434241403F3E3D3C3B3A3938
+37363534333231302F2E2D2C2B2A292827262524232221201F1E1D1C1B1A19181716151413121110
+0F0E0D0C0B0A09080706050403020100
+>
+0
+1 %_Br
+<
+000102030405060708090A0B0C0D0E0F101112131415161718191A1B1C1D1E1F2021222324252627
+28292A2B2C2D2E2F303132333435363738393A3B3C3D3E3F404142434445464748494A4B4C4D4E4F
+505152535455565758595A5B5C5D5E5F606162636465666768696A6B6C6D6E6F7071727374757677
+78797A7B7C7D7E7F808182838485868788898A8B8C8D8E8F909192939495969798999A9B9C9D9E9F
+A0A1A2A3A4A5A6A7A8A9AAABACADAEAFB0B1B2B3B4B5B6B7B8B9BABBBCBDBEBFC0C1C2C3C4C5C6C7
+C8C9CACBCCCDCECFD0D1D2D3D4D5D6D7D8D9DADBDCDDDEDFE0E1E2E3E4E5E6E7E8E9EAEBECEDEEEF
+F0F1F2F3F4F5F6F7F8F9FAFBFCFDFEFF
+>
+0
+1
+0
+1 %_Br
+0
+<
+FFFEFDFCFBFAF9F8F7F6F5F4F3F2F1F0EFEEEDECEBEAE9E8E7E6E5E4E3E2E1E0DFDEDDDCDBDAD9D8
+D7D6D5D4D3D2D1D0CFCECDCCCBCAC9C8C7C6C5C4C3C2C1C0BFBEBDBCBBBAB9B8B7B6B5B4B3B2B1B0
+AFAEADACABAAA9A8A7A6A5A4A3A2A1A09F9E9D9C9B9A999897969594939291908F8E8D8C8B8A8988
+87868584838281807F7E7D7C7B7A797877767574737271706F6E6D6C6B6A69686766656463626160
+5F5E5D5C5B5A595857565554535251504F4E4D4C4B4A494847464544434241403F3E3D3C3B3A3938
+37363534333231302F2E2D2C2B2A292827262524232221201F1E1D1C1B1A19181716151413121110
+0F0E0D0C0B0A09080706050403020100
+>
+1
+0
+1 %_Br
+[
+0 1 0 0 1 50 100 %_Bs
+1 1 0 0 1 50 80 %_Bs
+1 0.0279 0 0 1 50 60 %_Bs
+1 0 1 0 1 50 40 %_Bs
+0 0 1 0 1 50 20 %_Bs
+0 1 1 0 1 50 0 %_Bs
+BD
+%AI5_EndGradient
+%AI5_BeginGradient: (Steel Bar)
+(Steel Bar) 0 3 Bd
+[
+<
+FFFEFDFCFBFAF9F8F7F6F5F4F3F2F1F0EFEEEDECEBEAE9E8E7E6E5E4E3E2E1E0DFDEDDDCDBDAD9D8
+D7D6D5D4D3D2D1D0CFCECDCCCBCAC9C8C7C6C5C4C3C2C1C0BFBEBDBCBBBAB9B8B7B6B5B4B3B2B1B0
+AFAEADACABAAA9A8A7A6A5A4A3A2A1A09F9E9D9C9B9A999897969594939291908F8E8D8C8B8A8988
+87868584838281807F7E7D7C7B7A797877767574737271706F6E6D6C6B6A69686766656463626160
+5F5E5D5C5B5A595857565554535251504F4E4D4C4B4A494847464544434241403F3E3D3C3B3A3938
+37363534333231302F2E2D2C2B2A292827262524232221201F1E1D1C1B1A19181716151413121110
+0F0E0D0C0B0A09080706050403020100
+>
+0 %_Br
+<
+000102030405060708090A0B0C0D0E0F101112131415161718191A1B1C1D1E1F2021222324252627
+28292A2B2C2D2E2F303132333435363738393A3B3C3D3E3F404142434445464748494A4B4C4D4E4F
+505152535455565758595A5B5C5D5E5F606162636465666768696A6B6C6D6E6F7071727374757677
+78797A7B7C7D7E7F808182838485868788898A8B8C8D8E8F909192939495969798999A9B9C9D9E9F
+A0A1A2A3A4A5A6A7A8A9AAABACADAEAFB0B1B2B3B4B5B6B7B8B9BABBBCBDBEBFC0C1C2C3C4C5C6C7
+C8C9CACBCCCDCECFD0D1D2D3D4D5D6D7D8D9DADBDCDDDEDFE0E1E2E3E4E5E6E7E8E9EAEBECEDEEEF
+F0F1F2F3F4F5F6F7F8F9FAFBFCFDFEFF
+>
+0 %_Br
+[
+0 0 50 100 %_Bs
+1 0 50 70 %_Bs
+0 0 50 0 %_Bs
+BD
+%AI5_EndGradient
+%AI5_BeginGradient: (White & Red Radial)
+(White & Red Radial) 1 18 Bd
+[
+0
+1
+1
+0
+1 %_Br
+0
+1
+1
+0
+1 %_Br
+0
+<
+FFFEFDFCFBFAF9F8F7F6F5F4F3F2F1F0EFEEEDECEBEAE9E8E7E6E5E4E3E2E1E0DFDEDDDCDBDAD9D8
+D7D6D5D4D3D2D1D0CFCECDCCCBCAC9C8C7C6C5C4C3C2C1C0BFBEBDBCBBBAB9B8B7B6B5B4B3B2B1B0
+AFAEADACABAAA9A8A7A6A5A4A3A2A1A09F9E9D9C9B9A999897969594939291908F8E8D8C8B8A8988
+87868584838281807F7E7D7C7B7A797877767574737271706F6E6D6C6B6A69686766656463626160
+5F5E5D5C5B5A595857565554535251504F4E4D4C4B4A494847464544434241403F3E3D3C3B3A3938
+37363534333231302F2E2D2C2B2A292827262524232221201F1E1D1C1B1A19181716151413121110
+0F0E0D0C0B0A09080706050403020100
+>
+<
+FFFEFDFCFBFAF9F8F7F6F5F4F3F2F1F0EFEEEDECEBEAE9E8E7E6E5E4E3E2E1E0DFDEDDDCDBDAD9D8
+D7D6D5D4D3D2D1D0CFCECDCCCBCAC9C8C7C6C5C4C3C2C1C0BFBEBDBCBBBAB9B8B7B6B5B4B3B2B1B0
+AFAEADACABAAA9A8A7A6A5A4A3A2A1A09F9E9D9C9B9A999897969594939291908F8E8D8C8B8A8988
+87868584838281807F7E7D7C7B7A797877767574737271706F6E6D6C6B6A69686766656463626160
+5F5E5D5C5B5A595857565554535251504F4E4D4C4B4A494847464544434241403F3E3D3C3B3A3938
+37363534333231302F2E2D2C2B2A292827262524232221201F1E1D1C1B1A19181716151413121110
+0F0E0D0C0B0A09080706050403020100
+>
+0
+1 %_Br
+1
+0 %_Br
+0
+<
+000102030405060708090A0B0C0D0E0F101112131415161718191A1B1C1D1E1F2021222324252627
+28292A2B2C2D2E2F303132333435363738393A3B3C3D3E3F404142434445464748494A4B4C4D4E4F
+505152535455565758595A5B5C5D5E5F606162636465666768696A6B6C6D6E6F7071727374757677
+78797A7B7C7D7E7F808182838485868788898A8B8C8D8E8F909192939495969798999A9B9C9D9E9F
+A0A1A2A3A4A5A6A7A8A9AAABACADAEAFB0B1B2B3B4B5B6B7B8B9BABBBCBDBEBFC0C1C2C3C4C5C6C7
+C8C9CACBCCCDCECFD0D1D2D3D4D5D6D7D8D9DADBDCDDDEDFE0E1E2E3E4E5E6E7E8E9EAEBECEDEEEF
+F0F1F2F3F4F5F6F7F8F9FAFBFCFDFEFF
+>
+<
+000102030405060708090A0B0C0D0E0F101112131415161718191A1B1C1D1E1F2021222324252627
+28292A2B2C2D2E2F303132333435363738393A3B3C3D3E3F404142434445464748494A4B4C4D4E4F
+505152535455565758595A5B5C5D5E5F606162636465666768696A6B6C6D6E6F7071727374757677
+78797A7B7C7D7E7F808182838485868788898A8B8C8D8E8F909192939495969798999A9B9C9D9E9F
+A0A1A2A3A4A5A6A7A8A9AAABACADAEAFB0B1B2B3B4B5B6B7B8B9BABBBCBDBEBFC0C1C2C3C4C5C6C7
+C8C9CACBCCCDCECFD0D1D2D3D4D5D6D7D8D9DADBDCDDDEDFE0E1E2E3E4E5E6E7E8E9EAEBECEDEEEF
+F0F1F2F3F4F5F6F7F8F9FAFBFCFDFEFF
+>
+0
+1 %_Br
+0
+1
+1
+0
+1 %_Br
+0
+<
+FFFEFDFCFBFAF9F8F7F6F5F4F3F2F1F0EFEEEDECEBEAE9E8E7E6E5E4E3E2E1E0DFDEDDDCDBDAD9D8
+D7D6D5D4D3D2D1D0CFCECDCCCBCAC9C8C7C6C5C4C3C2C1C0BFBEBDBCBBBAB9B8B7B6B5B4B3B2B1B0
+AFAEADACABAAA9A8A7A6A5A4A3A2A1A09F9E9D9C9B9A999897969594939291908F8E8D8C8B8A8988
+87868584838281807F7E7D7C7B7A797877767574737271706F6E6D6C6B6A69686766656463626160
+5F5E5D5C5B5A595857565554535251504F4E4D4C4B4A494847464544434241403F3E3D3C3B3A3938
+37363534333231302F2E2D2C2B2A292827262524232221201F1E1D1C1B1A19181716151413121110
+0F0E0D0C0B0A09080706050403020100
+>
+<
+FFFEFDFCFBFAF9F8F7F6F5F4F3F2F1F0EFEEEDECEBEAE9E8E7E6E5E4E3E2E1E0DFDEDDDCDBDAD9D8
+D7D6D5D4D3D2D1D0CFCECDCCCBCAC9C8C7C6C5C4C3C2C1C0BFBEBDBCBBBAB9B8B7B6B5B4B3B2B1B0
+AFAEADACABAAA9A8A7A6A5A4A3A2A1A09F9E9D9C9B9A999897969594939291908F8E8D8C8B8A8988
+87868584838281807F7E7D7C7B7A797877767574737271706F6E6D6C6B6A69686766656463626160
+5F5E5D5C5B5A595857565554535251504F4E4D4C4B4A494847464544434241403F3E3D3C3B3A3938
+37363534333231302F2E2D2C2B2A292827262524232221201F1E1D1C1B1A19181716151413121110
+0F0E0D0C0B0A09080706050403020100
+>
+0
+1 %_Br
+1
+0 %_Br
+0
+<
+000102030405060708090A0B0C0D0E0F101112131415161718191A1B1C1D1E1F2021222324252627
+28292A2B2C2D2E2F303132333435363738393A3B3C3D3E3F404142434445464748494A4B4C4D4E4F
+505152535455565758595A5B5C5D5E5F606162636465666768696A6B6C6D6E6F7071727374757677
+78797A7B7C7D7E7F808182838485868788898A8B8C8D8E8F909192939495969798999A9B9C9D9E9F
+A0A1A2A3A4A5A6A7A8A9AAABACADAEAFB0B1B2B3B4B5B6B7B8B9BABBBCBDBEBFC0C1C2C3C4C5C6C7
+C8C9CACBCCCDCECFD0D1D2D3D4D5D6D7D8D9DADBDCDDDEDFE0E1E2E3E4E5E6E7E8E9EAEBECEDEEEF
+F0F1F2F3F4F5F6F7F8F9FAFBFCFDFEFF
+>
+<
+000102030405060708090A0B0C0D0E0F101112131415161718191A1B1C1D1E1F2021222324252627
+28292A2B2C2D2E2F303132333435363738393A3B3C3D3E3F404142434445464748494A4B4C4D4E4F
+505152535455565758595A5B5C5D5E5F606162636465666768696A6B6C6D6E6F7071727374757677
+78797A7B7C7D7E7F808182838485868788898A8B8C8D8E8F909192939495969798999A9B9C9D9E9F
+A0A1A2A3A4A5A6A7A8A9AAABACADAEAFB0B1B2B3B4B5B6B7B8B9BABBBCBDBEBFC0C1C2C3C4C5C6C7
+C8C9CACBCCCDCECFD0D1D2D3D4D5D6D7D8D9DADBDCDDDEDFE0E1E2E3E4E5E6E7E8E9EAEBECEDEEEF
+F0F1F2F3F4F5F6F7F8F9FAFBFCFDFEFF
+>
+0
+1 %_Br
+0
+1
+1
+0
+1 %_Br
+0
+<
+FFFEFDFCFBFAF9F8F7F6F5F4F3F2F1F0EFEEEDECEBEAE9E8E7E6E5E4E3E2E1E0DFDEDDDCDBDAD9D8
+D7D6D5D4D3D2D1D0CFCECDCCCBCAC9C8C7C6C5C4C3C2C1C0BFBEBDBCBBBAB9B8B7B6B5B4B3B2B1B0
+AFAEADACABAAA9A8A7A6A5A4A3A2A1A09F9E9D9C9B9A999897969594939291908F8E8D8C8B8A8988
+87868584838281807F7E7D7C7B7A797877767574737271706F6E6D6C6B6A69686766656463626160
+5F5E5D5C5B5A595857565554535251504F4E4D4C4B4A494847464544434241403F3E3D3C3B3A3938
+37363534333231302F2E2D2C2B2A292827262524232221201F1E1D1C1B1A19181716151413121110
+0F0E0D0C0B0A09080706050403020100
+>
+<
+FFFEFDFCFBFAF9F8F7F6F5F4F3F2F1F0EFEEEDECEBEAE9E8E7E6E5E4E3E2E1E0DFDEDDDCDBDAD9D8
+D7D6D5D4D3D2D1D0CFCECDCCCBCAC9C8C7C6C5C4C3C2C1C0BFBEBDBCBBBAB9B8B7B6B5B4B3B2B1B0
+AFAEADACABAAA9A8A7A6A5A4A3A2A1A09F9E9D9C9B9A999897969594939291908F8E8D8C8B8A8988
+87868584838281807F7E7D7C7B7A797877767574737271706F6E6D6C6B6A69686766656463626160
+5F5E5D5C5B5A595857565554535251504F4E4D4C4B4A494847464544434241403F3E3D3C3B3A3938
+37363534333231302F2E2D2C2B2A292827262524232221201F1E1D1C1B1A19181716151413121110
+0F0E0D0C0B0A09080706050403020100
+>
+0
+1 %_Br
+1
+0 %_Br
+0
+<
+000102030405060708090A0B0C0D0E0F101112131415161718191A1B1C1D1E1F2021222324252627
+28292A2B2C2D2E2F303132333435363738393A3B3C3D3E3F404142434445464748494A4B4C4D4E4F
+505152535455565758595A5B5C5D5E5F606162636465666768696A6B6C6D6E6F7071727374757677
+78797A7B7C7D7E7F808182838485868788898A8B8C8D8E8F909192939495969798999A9B9C9D9E9F
+A0A1A2A3A4A5A6A7A8A9AAABACADAEAFB0B1B2B3B4B5B6B7B8B9BABBBCBDBEBFC0C1C2C3C4C5C6C7
+C8C9CACBCCCDCECFD0D1D2D3D4D5D6D7D8D9DADBDCDDDEDFE0E1E2E3E4E5E6E7E8E9EAEBECEDEEEF
+F0F1F2F3F4F5F6F7F8F9FAFBFCFDFEFF
+>
+<
+000102030405060708090A0B0C0D0E0F101112131415161718191A1B1C1D1E1F2021222324252627
+28292A2B2C2D2E2F303132333435363738393A3B3C3D3E3F404142434445464748494A4B4C4D4E4F
+505152535455565758595A5B5C5D5E5F606162636465666768696A6B6C6D6E6F7071727374757677
+78797A7B7C7D7E7F808182838485868788898A8B8C8D8E8F909192939495969798999A9B9C9D9E9F
+A0A1A2A3A4A5A6A7A8A9AAABACADAEAFB0B1B2B3B4B5B6B7B8B9BABBBCBDBEBFC0C1C2C3C4C5C6C7
+C8C9CACBCCCDCECFD0D1D2D3D4D5D6D7D8D9DADBDCDDDEDFE0E1E2E3E4E5E6E7E8E9EAEBECEDEEEF
+F0F1F2F3F4F5F6F7F8F9FAFBFCFDFEFF
+>
+0
+1 %_Br
+0
+1
+1
+0
+1 %_Br
+0
+<
+FFFEFDFCFBFAF9F8F7F6F5F4F3F2F1F0EFEEEDECEBEAE9E8E7E6E5E4E3E2E1E0DFDEDDDCDBDAD9D8
+D7D6D5D4D3D2D1D0CFCECDCCCBCAC9C8C7C6C5C4C3C2C1C0BFBEBDBCBBBAB9B8B7B6B5B4B3B2B1B0
+AFAEADACABAAA9A8A7A6A5A4A3A2A1A09F9E9D9C9B9A999897969594939291908F8E8D8C8B8A8988
+87868584838281807F7E7D7C7B7A797877767574737271706F6E6D6C6B6A69686766656463626160
+5F5E5D5C5B5A595857565554535251504F4E4D4C4B4A494847464544434241403F3E3D3C3B3A3938
+37363534333231302F2E2D2C2B2A292827262524232221201F1E1D1C1B1A19181716151413121110
+0F0E0D0C0B0A09080706050403020100
+>
+<
+FFFEFDFCFBFAF9F8F7F6F5F4F3F2F1F0EFEEEDECEBEAE9E8E7E6E5E4E3E2E1E0DFDEDDDCDBDAD9D8
+D7D6D5D4D3D2D1D0CFCECDCCCBCAC9C8C7C6C5C4C3C2C1C0BFBEBDBCBBBAB9B8B7B6B5B4B3B2B1B0
+AFAEADACABAAA9A8A7A6A5A4A3A2A1A09F9E9D9C9B9A999897969594939291908F8E8D8C8B8A8988
+87868584838281807F7E7D7C7B7A797877767574737271706F6E6D6C6B6A69686766656463626160
+5F5E5D5C5B5A595857565554535251504F4E4D4C4B4A494847464544434241403F3E3D3C3B3A3938
+37363534333231302F2E2D2C2B2A292827262524232221201F1E1D1C1B1A19181716151413121110
+0F0E0D0C0B0A09080706050403020100
+>
+0
+1 %_Br
+1
+0 %_Br
+0
+<
+000102030405060708090A0B0C0D0E0F101112131415161718191A1B1C1D1E1F2021222324252627
+28292A2B2C2D2E2F303132333435363738393A3B3C3D3E3F404142434445464748494A4B4C4D4E4F
+505152535455565758595A5B5C5D5E5F606162636465666768696A6B6C6D6E6F7071727374757677
+78797A7B7C7D7E7F808182838485868788898A8B8C8D8E8F909192939495969798999A9B9C9D9E9F
+A0A1A2A3A4A5A6A7A8A9AAABACADAEAFB0B1B2B3B4B5B6B7B8B9BABBBCBDBEBFC0C1C2C3C4C5C6C7
+C8C9CACBCCCDCECFD0D1D2D3D4D5D6D7D8D9DADBDCDDDEDFE0E1E2E3E4E5E6E7E8E9EAEBECEDEEEF
+F0F1F2F3F4F5F6F7F8F9FAFBFCFDFEFF
+>
+<
+000102030405060708090A0B0C0D0E0F101112131415161718191A1B1C1D1E1F2021222324252627
+28292A2B2C2D2E2F303132333435363738393A3B3C3D3E3F404142434445464748494A4B4C4D4E4F
+505152535455565758595A5B5C5D5E5F606162636465666768696A6B6C6D6E6F7071727374757677
+78797A7B7C7D7E7F808182838485868788898A8B8C8D8E8F909192939495969798999A9B9C9D9E9F
+A0A1A2A3A4A5A6A7A8A9AAABACADAEAFB0B1B2B3B4B5B6B7B8B9BABBBCBDBEBFC0C1C2C3C4C5C6C7
+C8C9CACBCCCDCECFD0D1D2D3D4D5D6D7D8D9DADBDCDDDEDFE0E1E2E3E4E5E6E7E8E9EAEBECEDEEEF
+F0F1F2F3F4F5F6F7F8F9FAFBFCFDFEFF
+>
+0
+1 %_Br
+[
+0 1 1 0 1 50 0 %_Bs
+0 1 1 0 1 50 0 %_Bs
+0 1 1 0 1 50 12.5 %_Bs
+0 0 0 0 1 50 12.5 %_Bs
+0 0 0 0 1 50 25 %_Bs
+0 1 1 0 1 50 25 %_Bs
+0 1 1 0 1 50 37.5 %_Bs
+0 0 0 0 1 50 37.5 %_Bs
+0 0 0 0 1 50 50 %_Bs
+0 1 1 0 1 50 50 %_Bs
+0 1 1 0 1 50 62.5 %_Bs
+0 0 0 0 1 50 62.5 %_Bs
+0 0 0 0 1 50 75 %_Bs
+0 1 1 0 1 50 75 %_Bs
+0 1 1 0 1 50 87.5 %_Bs
+0 0 0 0 1 50 87.5 %_Bs
+0 0 0 0 1 50 100 %_Bs
+0 1 1 0 1 50 100 %_Bs
+BD
+%AI5_EndGradient
+%AI5_BeginGradient: (Yellow & Orange Radial)
+(Yellow & Orange Radial) 1 2 Bd
+[
+0
+<
+0001010203040506060708090A0B0C0C0D0E0F10111213131415161718191A1B1C1D1D1E1F202122
+232425262728292A2B2B2C2D2E2F303132333435363738393A3B3C3D3E3E3F404142434445464748
+494A4B4C4D4E4F505152535455565758595A5B5C5D5E5F60606162636465666768696A6B6C6D6E6F
+707172737475767778797A7B7C7D7E7F808182838485868788898A8B8C
+>
+<
+FFFFFFFFFEFEFEFEFEFEFEFDFDFDFDFDFDFCFCFCFCFCFCFBFBFBFBFBFBFAFAFAFAFAFAF9F9F9F9F9
+F9F8F8F8F8F8F8F7F7F7F7F7F7F6F6F6F6F6F6F5F5F5F5F5F5F4F4F4F4F4F3F3F3F3F3F3F2F2F2F2
+F2F2F1F1F1F1F1F0F0F0F0F0F0EFEFEFEFEFEFEEEEEEEEEEEDEDEDEDEDEDECECECECECEBEBEBEBEB
+EBEAEAEAEAEAE9E9E9E9E9E9E8E8E8E8E8E8E7E7E7E7E7E6E6E6E6E6E5
+>
+0
+1 %_Br
+[
+0 0 1 0 1 52 19 %_Bs
+0 0.55 0.9 0 1 50 100 %_Bs
+BD
+%AI5_EndGradient
+%AI5_BeginGradient: (Yellow & Purple Radial)
+(Yellow & Purple Radial) 1 2 Bd
+[
+<
+000102030405060708090A0B0C0D0E0F101112131415161718191A1B1C1D1E1F2021222324252627
+28292A2B2C2D2E2F303132333435363738393A3B3C3D3E3F404142434445464748494A4B4C4D4E4F
+505152535455565758595A5B5C5D5E5F606162636465666768696A6B6C6D6E6F7071727374757677
+78797A7B7C7D7E7F808182838485868788898A8B8C8D8E8F909192939495969798999A9B9C9D9E9F
+A0A1A2A3A4A5A6A7A8A9AAABACADAEAFB0B1B2B3B4B5B6B7B8B9BABBBCBDBEBFC0C1C2C3C4C5C6C7
+C8C9CACBCCCDCECFD0D1D2D3D4D5D6D7D8D9DADBDCDDDEDFE0E1E2E3E4E5E6E7E8E9EAEBECEDEEEF
+F0F1F2F3F4F5F6F7F8F9FAFBFCFDFEFF
+>
+<
+1415161718191A1B1C1D1E1F1F202122232425262728292A2A2B2C2D2E2F30313233343536363738
+393A3B3C3D3E3F40414142434445464748494A4B4C4D4D4E4F50515253545556575858595A5B5C5D
+5E5F60616263646465666768696A6B6C6D6E6F6F707172737475767778797A7B7B7C7D7E7F808182
+83848586868788898A8B8C8D8E8F90919292939495969798999A9B9C9D9D9E9FA0A1A2A3A4A5A6A7
+A8A9A9AAABACADAEAFB0B1B2B3B4B4B5B6B7B8B9BABBBCBDBEBFC0C0C1C2C3C4C5C6C7C8C9CACBCB
+CCCDCECFD0D1D2D3D4D5D6D7D7D8D9DADBDCDDDEDFE0E1E2E2E3E4E5E6E7E8E9EAEBECEDEEEEEFF0
+F1F2F3F4F5F6F7F8F9F9FAFBFCFDFEFF
+>
+<
+ABAAAAA9A8A7A7A6A5A5A4A3A3A2A1A1A09F9F9E9D9D9C9B9B9A9999989797969595949393929191
+908F8F8E8D8D8C8B8B8A8989888787868585848383828181807F7F7E7D7D7C7B7B7A797978777776
+7575747373727171706F6F6E6D6D6C6B6B6A6969686767666565646362626160605F5E5E5D5C5C5B
+5A5A5958585756565554545352525150504F4E4E4D4C4C4B4A4A4948484746464544444342424140
+403F3E3E3D3C3C3B3A3A3938383736363534343332323130302F2E2E2D2C2C2B2A2A292828272626
+25242423222121201F1F1E1D1D1C1B1B1A1919181717161515141313121111100F0F0E0D0D0C0B0B
+0A090908070706050504030302010100
+>
+0
+1 %_Br
+[
+0 0.08 0.67 0 1 50 14 %_Bs
+1 1 0 0 1 50 100 %_Bs
+BD
+%AI5_EndGradient
+%AI5_BeginGradient: (Yellow, Violet, Orange, Blue)
+(Yellow, Violet, Orange, Blue) 0 4 Bd
+[
+<
+000102030405060708090A0B0C0D0E0F101112131415161718191A1B1C1D1E1F2021222324252627
+28292A2B2C2D2E2F303132333435363738393A3B3C3D3E3F404142434445464748494A4B4C4D4E4F
+505152535455565758595A5B5C5D5E5F606162636465666768696A6B6C6D6E6F7071727374757677
+78797A7B7C7D7E7F808182838485868788898A8B8C8D8E8F909192939495969798999A9B9C9D9E9F
+A0A1A2A3A4A5A6A7A8A9AAABACADAEAFB0B1B2B3B4B5B6B7B8B9BABBBCBDBEBFC0C1C2C3C4C5C6C7
+C8C9CACBCCCDCECFD0D1D2D3D4D5D6D7D8D9DADBDCDDDEDFE0E1E2E3E4E5E6E7E8E9EAEBECEDEEEF
+F0F1F2F3F4F5F6F7F8F9FAFBFCFDFEFF
+>
+<
+A1A1A1A1A2A2A2A2A3A3A3A3A4A4A4A4A4A5A5A5A5A6A6A6A6A7A7A7A7A8A8A8A8A9A9A9A9AAAAAA
+AAAAABABABABACACACACADADADADAEAEAEAEAFAFAFAFB0B0B0B0B0B1B1B1B1B2B2B2B2B3B3B3B3B4
+B4B4B4B5B5B5B5B6B6B6B6B6B7B7B7B7B8B8B8B8B9B9B9B9BABABABABBBBBBBBBCBCBCBCBCBDBDBD
+BDBEBEBEBEBFBFBFBFC0C0C0C0C1C1C1C1C2C2C2C2C2C3C3C3C3C4C4C4C4C5C5C5C5C6C6C6C6C7C7
+C7C7C8C8C8C8C8C9C9C9C9CACACACACBCBCBCBCCCCCCCCCDCDCDCDCECECECECECFCFCFCFD0D0D0D0
+D1D1D1D1D2D2D2D2D3D3D3D3D4D4D4D4D4D5D5D5D5D6D6D6D6D7D7D7D7D8D8D8D8D9D9D9D9DADADA
+DADADBDBDBDBDCDCDCDCDDDDDDDDDEDE
+>
+<
+F5F4F3F2F1F0EFEEEDECEBEAE9E8E7E6E5E4E4E3E2E1E0DFDEDDDCDBDAD9D8D7D6D5D4D3D2D1D0CF
+CECDCCCCCBCAC9C8C7C6C5C4C3C2C1C0BFBEBDBCBBBAB9B8B7B6B5B4B4B3B2B1B0AFAEADACABAAA9
+A8A7A6A5A4A3A2A1A09F9E9D9C9C9B9A999897969594939291908F8E8D8C8B8A8988878685848483
+8281807F7E7D7C7B7A797877767574737271706F6E6D6C6C6B6A696867666564636261605F5E5D5C
+5B5A59585756555454535251504F4E4D4C4B4A494847464544434241403F3E3D3C3C3B3A39383736
+3534333231302F2E2D2C2B2A29282726252424232221201F1E1D1C1B1A191817161514131211100F
+0E0D0C0C0B0A09080706050403020100
+>
+0
+1 %_Br
+<
+9C9B9A9A9998989796969595949393929191908F8F8E8E8D8C8C8B8A8A8989888787868585848383
+82828180807F7E7E7D7C7C7B7B7A797978777776757574747372727170706F6E6E6D6D6C6B6B6A69
+6968676766666564646362626161605F5F5E5D5D5C5B5B5A5A595858575656555454535352515150
+4F4F4E4D4D4C4C4B4A4A4948484746464545444343424141403F3F3E3E3D3C3C3B3A3A3939383737
+36353534333332323130302F2E2E2D2C2C2B2B2A292928272726252524242322222120201F1E1E1D
+1D1C1B1B1A191918171716161514141312121111100F0F0E0D0D0C0B0B0A0A090808070606050404
+030302010100
+>
+<
+F5F4F4F4F3F3F3F2F2F2F1F1F1F0F0F0EFEFEFEEEEEEEDEDEDECECECEBEBEAEAEAE9E9E9E8E8E8E7
+E7E7E6E6E6E5E5E5E4E4E4E3E3E3E2E2E2E1E1E1E0E0E0DFDFDEDEDEDDDDDDDCDCDCDBDBDBDADADA
+D9D9D9D8D8D8D7D7D7D6D6D6D5D5D5D4D4D3D3D3D2D2D2D1D1D1D0D0D0CFCFCFCECECECDCDCDCCCC
+CCCBCBCBCACACAC9C9C8C8C8C7C7C7C6C6C6C5C5C5C4C4C4C3C3C3C2C2C2C1C1C1C0C0C0BFBFBFBE
+BEBEBDBDBCBCBCBBBBBBBABABAB9B9B9B8B8B8B7B7B7B6B6B6B5B5B5B4B4B4B3B3B3B2B2B1B1B1B0
+B0B0AFAFAFAEAEAEADADADACACACABABABAAAAAAA9A9A9A8A8A8A7A7A6A6A6A5A5A5A4A4A4A3A3A3
+A2A2A2A1A1A1
+>
+<
+000102030405060708090A0B0C0D0E0F101112131415161718191A1B1C1D1E1F2021222324252627
+28292A2B2C2D2E2F303132333435363738393A3B3C3D3E3F404142434445464748494A4B4C4D4E4F
+505152535455565758595A5B5C5D5E5F606162636465666768696A6B6C6D6E6F7071727374757677
+78797A7B7C7D7E7F808182838485868788898A8B8C8D8E8F909192939495969798999A9B9C9D9E9F
+A0A1A2A3A4A5A6A7A8A9AAABACADAEAFB0B1B2B3B4B5B6B7B8B9BABBBCBDBEBFC0C1C2C3C4C5C6C7
+C8C9CACBCCCDCECFD0D1D2D3D4D5D6D7D8D9DADBDCDDDEDFE0E1E2E3E4E5E6E7E8E9EAEBECEDEEEF
+F0F1F2F3F4F5
+>
+<
+03030303030202020202020202020202020202020202020202020202020202020202020202020202
+02020202020202020202020202020202020202020202020202020202020202020202020202020202
+02020202020202020202020202020202020202020201010101010101010101010101010101010101
+01010101010101010101010101010101010101010101010101010101010101010101010101010101
+01010101010101010101010101010101010101010101010101010101010101010101010101000000
+00000000000000000000000000000000000000000000000000000000000000000000000000000000
+000000000000
+>
+1 %_Br
+<
+0D0D0E0F0F10101111121313141415161617171819191A1A1B1C1C1D1D1E1E1F2020212122232324
+2425262627272828292A2A2B2B2C2D2D2E2E2F30303131323333343435353637373838393A3A3B3B
+3C3D3D3E3E3F3F404141424243444445454647474848494A4A4B4B4C4C4D4E4E4F4F505151525253
+54545555565757585859595A5B5B5C5C5D5E5E5F5F60616162626363646565666667686869696A6B
+6B6C6C6D6E6E6F6F70707172727373747575767677787879797A7B7B7C7C7D7D7E7F7F8080818282
+8383848585868687878889898A8A8B8C8C8D8D8E8F8F90909192929393949495969697979899999A
+9A9B9C
+>
+<
+08090A0B0C0D0E0F0F101112131415161718191A1B1C1D1E1F202122232425262728292A2B2C2D2E
+2F303132333435363738393A3B3C3D3E3F40404142434445464748494A4B4C4D4E4F505152535455
+565758595A5B5C5D5E5F606162636465666768696A6B6C6D6E6F70717172737475767778797A7B7C
+7D7E7F808182838485868788898A8B8C8D8E8F909192939495969798999A9B9C9D9E9FA0A1A2A2A3
+A4A5A6A7A8A9AAABACADAEAFB0B1B2B3B4B5B6B7B8B9BABBBCBDBEBFC0C1C2C3C4C5C6C7C8C9CACB
+CCCDCECFD0D1D2D2D3D4D5D6D7D8D9DADBDCDDDEDFE0E1E2E3E4E5E6E7E8E9EAEBECEDEEEFF0F1F2
+F3F4F5
+>
+<
+F2F1F0EFEEEDECEBEAE9E8E7E6E5E4E3E2E1E0DFDEDDDCDBDAD9D8D7D6D5D4D3D2D1D0CFCECDCCCB
+CAC9C8C7C6C5C4C3C2C1C0BFBEBDBCBBBAB9B8B7B6B5B4B3B2B1B0AFAEADACABAAA9A8A7A6A5A4A3
+A2A1A09F9E9D9C9B9A999897969594939291908F8E8D8C8B8A898887868584838281807F7E7D7C7B
+7A797877767574737271706F6E6D6C6B6A696867666564636261605F5E5D5C5B5A59585756555453
+5251504F4E4D4C4B4A494847464544434241403F3E3D3C3B3A393837363534333231302F2E2D2C2B
+2A292827262524232221201F1E1D1C1B1A191817161514131211100F0E0D0C0B0A09080706050403
+020100
+>
+<
+00000000000000000000000000000000000000000000000000000000000000000000000000000000
+00000000000000000101010101010101010101010101010101010101010101010101010101010101
+01010101010101010101010101010101010101010101010101010101010101010101010101010101
+01010101010101010101010101010101010101010101010202020202020202020202020202020202
+02020202020202020202020202020202020202020202020202020202020202020202020202020202
+02020202020202020202020202020202020202020202020202020202020202020202020202020303
+030303
+>
+1 %_Br
+[
+1 0.87 0 0 1 50 95 %_Bs
+0 0.63 0.96 0 1 50 65 %_Bs
+0.61 0.96 0 0.01 1 50 35 %_Bs
+0.05 0.03 0.95 0 1 50 5 %_Bs
+BD
+%AI5_EndGradient
+%AI5_End_NonPrinting--
+%AI5_BeginPalette
+0 0 Pb
+0 0 0 0 k
+(C=0 M=0 Y=0 K=0) Pc
+0 0 0 1 k
+(C=0 M=0 Y=0 K=100) Pc
+0 0.45 0.6 0 k
+(C=0 M=45 Y=60 K=0) Pc
+0 0.5 0.05 0 k
+(C=0 M=50 Y=5 K=0) Pc
+0 0.9 1 0 k
+(C=0 M=90 Y=100 K=0) Pc
+1 0.2 1 0 k
+(C=100 M=20 Y=100 K=0) Pc
+1 0.4 0.15 0 k
+(C=100 M=40 Y=15 K=0) Pc
+0.2 0 1 0 k
+(C=20 M=0 Y=100 K=0) Pc
+0.25 1 0.25 0 k
+(C=25 M=100 Y=25 K=0) Pc
+0.4 0.4 0.4 0 k
+(C=40 M=40 Y=40 K=0) Pc
+0.4 0.7 1 0 k
+(C=40 M=70 Y=100 K=0) Pc
+0.75 0.9 0 0 k
+(C=75 M=90 Y=0 K=0) Pc
+1 0 0.55 0 (Aqua) 0 x
+(Aqua) Pc
+1 0.5 0 0 (Blue) 0 x
+(Blue) Pc
+0.5 0.4 0.3 0 (Blue Gray) 0 x
+(Blue Gray) Pc
+0.8 0.05 0 0 (Blue Sky) 0 x
+(Blue Sky) Pc
+0.5 0.85 1 0 (Brown) 0 x
+(Brown) Pc
+1 0.9 0.1 0 (Dark Blue) 0 x
+(Dark Blue) Pc
+1 0.55 1 0 (Forest Green) 0 x
+(Forest Green) Pc
+0.05 0.2 0.95 0 (Gold) 0 x
+(Gold) Pc
+0.75 0.05 1 0 (Grass Green) 0 x
+(Grass Green) Pc
+0 0.45 1 0 (Orange) 0 x
+(Orange) Pc
+0.15 1 1 0 (Red) 0 x
+(Red) Pc
+0.45 0.9 0 0 (Violet) 0 x
+(Violet) Pc
+Bb
+2 (Black, White) -4014 4716 0 0 1 0 0 1 0 0 Bg
+0 BB
+(Black, White) Pc
+Bb
+2 (Chrome) -4014 4716 0 0 1 0 0 1 0 0 Bg
+0 BB
+(Chrome) Pc
+Bb
+2 (Green, Blue) -4014 4716 0 0 1 0 0 1 0 0 Bg
+0 BB
+(Green, Blue) Pc
+Bb
+2 (Orange, Green, Violet) -4014 4716 0 0 1 0 0 1 0 0 Bg
+0 BB
+(Orange, Green, Violet) Pc
+Bb
+2 (Pink, Yellow, Green ) -4014 4716 0 0 1 0 0 1 0 0 Bg
+0 BB
+(Pink, Yellow, Green ) Pc
+Bb
+2 (Purple, Red, Yellow) -4014 4716 0 0 1 0 0 1 0 0 Bg
+0 BB
+(Purple, Red, Yellow) Pc
+Bb
+2 (Rainbow) -4014 4716 0 0 1 0 0 1 0 0 Bg
+0 BB
+(Rainbow) Pc
+Bb
+2 (Steel Bar) -4014 4716 0 0 1 0 0 1 0 0 Bg
+0 BB
+(Steel Bar) Pc
+Bb
+0 0 0 0 Bh
+2 (White & Red Radial) -4014 4716 0 0 1 0 0 1 0 0 Bg
+0 BB
+(White & Red Radial) Pc
+Bb
+0 0 0 0 Bh
+2 (Yellow & Orange Radial) -4014 4716 0 0 1 0 0 1 0 0 Bg
+0 BB
+(Yellow & Orange Radial) Pc
+Bb
+0 0 0 0 Bh
+2 (Yellow & Purple Radial) -4014 4716 0 0 1 0 0 1 0 0 Bg
+0 BB
+(Yellow & Purple Radial) Pc
+Bb
+2 (Yellow, Violet, Orange, Blue) -4014 4716 0 0 1 0 0 1 0 0 Bg
+0 BB
+(Yellow, Violet, Orange, Blue) Pc
+(Arrow1.2.out/in) 0 0 1 1 0 0 0 0 0 [1 0 0 1 0 0] p
+(Arrow1.2.out/in) Pc
+(Arrow1.2.side) 0 0 1 1 0 0 0 0 0 [1 0 0 1 0 0] p
+(Arrow1.2.side) Pc
+(Bricks) 0 0 1 1 0 0 0 0 0 [1 0 0 1 0 0] p
+(Bricks) Pc
+(Checks) 0 0 1 1 0 0 0 0 0 [1 0 0 1 0 0] p
+(Checks) Pc
+(Confetti) 0 0 1 1 0 0 0 0 0 [1 0 0 1 0 0] p
+(Confetti) Pc
+(DblLine1.2.inner) 0 0 1 1 0 0 0 0 0 [1 0 0 1 0 0] p
+(DblLine1.2.inner) Pc
+(DblLine1.2.outer) 0 0 1 1 0 0 0 0 0 [1 0 0 1 0 0] p
+(DblLine1.2.outer) Pc
+(DblLine1.2.side) 0 0 1 1 0 0 0 0 0 [1 0 0 1 0 0] p
+(DblLine1.2.side) Pc
+(Diamonds) 0 0 1 1 0 0 0 0 0 [1 0 0 1 0 0] p
+(Diamonds) Pc
+(Hexagon) 0 0 1 1 0 0 0 0 0 [1 0 0 1 0 0] p
+(Hexagon) Pc
+(Laurel.inner) 0 0 1 1 0 0 0 0 0 [1 0 0 1 0 0] p
+(Laurel.inner) Pc
+(Laurel.outer) 0 0 1 1 0 0 0 0 0 [1 0 0 1 0 0] p
+(Laurel.outer) Pc
+(Laurel.side) 0 0 1 1 0 0 0 0 0 [1 0 0 1 0 0] p
+(Laurel.side) Pc
+(Leaves-fall) 0 0 1 1 0 0 0 0 0 [1 0 0 1 0 0] p
+(Leaves-fall) Pc
+(Polka dots) 0 0 1 1 0 0 0 0 0 [1 0 0 1 0 0] p
+(Polka dots) Pc
+(Random circles) 0 0 1 1 0 0 0 0 0 [1 0 0 1 0 0] p
+(Random circles) Pc
+(Rope.side) 0 0 1 1 0 0 0 0 0 [1 0 0 1 0 0] p
+(Rope.side) Pc
+(Scales) 0 0 1 1 0 0 0 0 0 [1 0 0 1 0 0] p
+(Scales) Pc
+(SolidStar.side) 0 0 1 1 0 0 0 0 0 [1 0 0 1 0 0] p
+(SolidStar.side) Pc
+(Stars) 0 0 1 1 0 0 0 0 0 [1 0 0 1 0 0] p
+(Stars) Pc
+(Stripes) 0 0 1 1 0 0 0 0 0 [1 0 0 1 0 0] p
+(Stripes) Pc
+(TriBevel.outer) 0 0 1 1 0 0 0 0 0 [1 0 0 1 0 0] p
+(TriBevel.outer) Pc
+(TriBevel.side) 0 0 1 1 0 0 0 0 0 [1 0 0 1 0 0] p
+(TriBevel.side) Pc
+(Waves-scroll) 0 0 1 1 0 0 0 0 0 [1 0 0 1 0 0] p
+(Waves-scroll) Pc
+PB
+%AI5_EndPalette
+%%EndSetup
+%AI5_BeginLayer
+1 1 1 1 0 0 0 79 128 255 Lb
+(Layer 1) Ln
+0 A
+u
+1 Ap
+0 O
+0 0 0 0 k
+800 Ar
+0 J 0 j 1 w 4 M []0 d
+%AI3_Note:
+0 D
+0 XR
+356.6667 387.5 m
+356.6667 419.1667 L
+247.1666 419.1667 L
+247.1666 387.5 L
+356.6667 387.5 L
+f
+u
+u
+u
+u
+u
+0 Ap
+0 g
+0.1417 w
+349.9796 400.7243 m
+349.5877 401.2344 L
+346.0138 401.2344 L
+346.0883 400.7243 L
+349.9796 400.7243 L
+f
+351.0435 399.3254 m
+350.64 399.8521 L
+346.2172 399.8521 L
+346.3082 399.3254 L
+351.0435 399.3254 L
+f
+352.0889 397.9355 m
+351.6969 398.4622 L
+346.4256 398.4622 L
+346.5001 397.9355 L
+352.0889 397.9355 L
+f
+353.1499 396.5473 m
+352.8027 397.0657 L
+346.6389 397.0657 L
+346.7084 396.5473 L
+353.1499 396.5473 L
+f
+354.1924 395.1701 m
+353.8401 395.673 L
+346.8076 395.673 L
+346.897 395.1701 L
+354.1924 395.1701 L
+f
+U
+U
+u
+u
+u
+0.1362 w
+261.2735 405.9461 m
+264.2217 405.9461 266.6112 403.5556 266.6112 400.6074 c
+266.6112 397.6591 264.2217 395.2686 261.2735 395.2686 c
+258.3253 395.2686 255.9348 397.6591 255.9348 400.6074 c
+255.9348 403.5556 258.3253 405.9461 261.2735 405.9461 c
+f
+261.2735 400.6074 m
+F
+U
+0.1417 w
+263.2787 406.4807 m
+265.6917 405.6403 267.4239 403.3457 267.4239 400.6461 c
+267.4239 397.235 264.6593 394.4703 261.2481 394.4703 c
+257.8379 394.4703 255.0721 397.235 255.0721 400.6461 c
+255.0721 403.7848 257.4809 406.1287 260.1353 406.671 C
+260.1353 411.5726 L
+254.6579 410.9711 250.3076 406.3287 250.3076 400.6909 c
+250.3076 394.6447 255.2093 389.743 261.2555 389.743 c
+267.3008 389.743 272.2025 394.6447 272.2025 400.6909 c
+272.2025 405.9351 268.4668 410.3181 263.5435 411.3879 C
+263.5435 412.4271 l
+259.8638 409.0598 l
+263.2787 405.3026 l
+263.2787 406.4807 l
+f
+267.7419 408.8471 m
+267.7419 413.7097 L
+266.3056 413.7097 l
+269.9043 417.257 l
+273.4301 413.7097 l
+272.1904 413.7097 L
+272.1904 400.5408 l
+F
+U
+U
+u
+u
+344.9476 395.1483 m
+345.2948 393.0208 L
+345.5763 391.6104 346.3665 391.1944 346.4113 391.1775 C
+346.4113 391.0357 L
+337.5144 391.0357 l
+337.5144 391.1775 L
+338.1526 391.1775 338.3296 391.7801 338.2588 392.1346 C
+337.8611 395.1481 L
+344.9476 395.1483 L
+f
+U
+u
+330.1397 395.1447 m
+328.9907 393.0208 L
+328.3882 391.8865 328.6539 391.4612 329.4337 391.1775 C
+329.4337 391.0357 L
+321.2105 391.0357 l
+321.2105 391.1775 L
+321.8485 391.1775 322.6106 392.1878 323.284 393.3574 C
+324.3294 395.1477 L
+330.1397 395.1447 L
+f
+U
+u
+327.843 401.2529 m
+333.8467 411.6119 L
+334.1331 412.1072 334.6648 412.9541 333.3683 413.4728 C
+333.3683 413.5967 l
+341.9628 413.5967 L
+343.9642 401.254 L
+337.0643 401.2535 L
+336.3448 406.7204 l
+333.4007 401.2525 L
+327.843 401.2529 L
+f
+U
+u
+344.2004 399.8667 m
+344.0449 400.7109 L
+327.5394 400.7109 L
+327.0498 399.8667 L
+344.2004 399.8667 L
+f
+U
+u
+344.4022 398.4775 m
+344.283 399.3217 L
+326.7356 399.3217 L
+326.2295 398.4775 L
+344.4022 398.4775 L
+f
+U
+u
+344.6403 397.0883 m
+344.5179 397.9324 L
+325.9584 397.9324 L
+325.4258 397.0883 L
+344.6403 397.0883 L
+f
+U
+u
+344.8586 395.6991 m
+344.7395 396.5433 L
+325.1281 396.5433 L
+324.632 395.6991 L
+344.8586 395.6991 L
+f
+U
+U
+u
+u
+295.6383 401.2527 m
+297.8343 411.6119 L
+297.8977 411.9132 298.2848 413.1005 297.3557 413.4728 C
+297.3557 413.5967 l
+306.3486 413.5967 L
+306.3486 413.455 L
+305.7814 413.2423 305.1266 412.2144 304.9848 411.3992 C
+302.9603 401.2549 L
+295.6383 401.2527 L
+f
+U
+300.9135 391.0231 m
+291.8972 391.0357 L
+291.8972 391.1775 L
+292.5351 391.1775 293.2972 392.1878 293.9707 393.3574 C
+294.3531 395.148 L
+301.7499 395.1638 L
+300.9135 391.0396 L
+300.9135 391.0231 L
+f
+u
+302.6821 399.8667 m
+302.8608 400.7109 L
+295.5287 400.7109 L
+295.3451 399.8667 L
+302.6821 399.8667 L
+f
+U
+u
+302.4043 398.4775 m
+302.5828 399.3217 L
+295.236 399.3217 L
+295.0524 398.4775 L
+302.4043 398.4775 L
+f
+U
+u
+302.1314 397.0883 m
+302.305 397.9324 L
+294.9433 397.9324 L
+294.7547 397.0883 L
+302.1314 397.0883 L
+f
+U
+u
+301.8371 395.6991 m
+302.0272 396.5433 L
+294.6505 396.5433 L
+294.4454 395.6991 L
+301.8371 395.6991 L
+f
+U
+U
+u
+u
+u
+324.11 395.1483 m
+324.4572 393.0208 L
+324.7389 391.6104 325.529 391.1944 325.5738 391.1775 C
+325.5738 391.0357 L
+316.6769 391.0357 l
+316.6769 391.1775 L
+317.3151 391.1775 317.4922 391.7801 317.4212 392.1346 C
+317.0237 395.1481 L
+324.11 395.1483 L
+f
+U
+u
+300.5942 391.0421 m
+303.0951 395.1477 L
+309.3023 395.1447 L
+308.1532 393.0208 L
+307.5507 391.8865 307.8165 391.4612 308.5963 391.1775 C
+308.4584 391.022 L
+300.5657 391.022 L
+300.5942 391.0421 L
+f
+U
+u
+306.774 401.2529 m
+313.0093 411.6119 L
+313.2957 412.1072 313.8273 412.9541 312.5308 413.4728 C
+312.5308 413.5967 l
+321.1253 413.5967 L
+323.1267 401.254 L
+316.2268 401.2535 L
+315.5073 406.7204 l
+312.5632 401.2525 L
+306.774 401.2529 L
+f
+U
+u
+323.3629 399.8667 m
+323.2074 400.7109 L
+306.4373 400.7109 L
+305.9477 399.8667 L
+323.3629 399.8667 L
+f
+U
+u
+323.5646 398.4775 m
+323.4456 399.3217 L
+305.5674 399.3217 L
+305.0613 398.4775 L
+323.5646 398.4775 L
+f
+U
+u
+323.8028 397.0883 m
+323.6805 397.9324 L
+304.757 397.9324 L
+304.2245 397.0883 L
+323.8028 397.0883 L
+f
+U
+u
+324.0211 395.6991 m
+323.9021 396.5433 L
+303.9268 396.5433 L
+303.4307 395.6991 L
+324.0211 395.6991 L
+f
+U
+U
+U
+u
+u
+u
+293.9453 395.1483 m
+294.2925 393.0208 L
+294.5741 391.6104 295.3643 391.1944 295.4091 391.1775 C
+295.4091 391.0357 L
+286.5122 391.0357 l
+286.5122 391.1775 L
+287.1503 391.1775 287.3274 391.7801 287.2566 392.1346 C
+286.8589 395.1481 L
+293.9453 395.1483 L
+f
+U
+u
+279.1375 395.1447 m
+277.9885 393.0208 L
+277.386 391.8865 277.6517 391.4612 278.4315 391.1775 C
+278.4315 391.0357 L
+270.2083 391.0357 l
+270.2083 391.1775 L
+270.8463 391.1775 271.6083 392.1878 272.2817 393.3574 C
+273.3272 395.1477 L
+279.1375 395.1447 L
+f
+U
+u
+276.8408 401.2529 m
+282.8445 411.6119 L
+283.1309 412.1072 283.6625 412.9541 282.3661 413.4728 C
+282.3661 413.5967 l
+290.9606 413.5967 L
+292.9619 401.254 L
+286.0621 401.2535 L
+285.3425 406.7204 l
+282.3985 401.2525 L
+276.8408 401.2529 L
+f
+U
+u
+293.1982 399.8667 m
+293.0427 400.7109 L
+276.5371 400.7109 L
+276.0476 399.8667 L
+293.1982 399.8667 L
+f
+U
+u
+293.4 398.4775 m
+293.2808 399.3217 L
+275.7334 399.3217 L
+275.2273 398.4775 L
+293.4 398.4775 L
+f
+U
+u
+293.638 397.0883 m
+293.5157 397.9324 L
+274.9561 397.9324 L
+274.4235 397.0883 L
+293.638 397.0883 L
+f
+U
+u
+293.8564 395.6991 m
+293.7373 396.5433 L
+274.1259 396.5433 L
+273.6297 395.6991 L
+293.8564 395.6991 L
+f
+U
+U
+U
+U
+U
+U
+U
+LB
+%AI5_EndLayer--
+%%PageTrailer
+gsave annotatepage grestore showpage
+%%Trailer
+Adobe_Illustrator_AI5 /terminate get exec
+Adobe_ColorImage_AI6 /terminate get exec
+Adobe_cshow /terminate get exec
+Adobe_level2_AI5 /terminate get exec
+%%EOF
diff --git a/Master/texmf-dist/doc/latex/aiaa/pre2004/demos/paper/smpaiaa.ps b/Master/texmf-dist/doc/latex/aiaa/pre2004/demos/paper/smpaiaa.ps
new file mode 100644
index 00000000000..d724d27fcb8
--- /dev/null
+++ b/Master/texmf-dist/doc/latex/aiaa/pre2004/demos/paper/smpaiaa.ps
@@ -0,0 +1,11083 @@
+%!PS-Adobe-2.0
+%%Creator: dvips(k) 5.83 Copyright 1998 Radical Eye Software
+%%Title: smpaiaa.dvi
+%%Pages: 6
+%%PageOrder: Ascend
+%%BoundingBox: 0 0 612 792
+%%DocumentFonts: Helvetica-Bold Helvetica Helvetica-Oblique Courier-Bold
+%%EndComments
+%DVIPSWebPage: (www.radicaleye.com)
+%DVIPSCommandLine: dvips smpaiaa
+%DVIPSParameters: dpi=600, compressed
+%DVIPSSource:  TeX output 1999.02.23:1400
+%%BeginProcSet: texc.pro
+%!
+/TeXDict 300 dict def TeXDict begin/N{def}def/B{bind def}N/S{exch}N/X{S
+N}B/A{dup}B/TR{translate}N/isls false N/vsize 11 72 mul N/hsize 8.5 72
+mul N/landplus90{false}def/@rigin{isls{[0 landplus90{1 -1}{-1 1}ifelse 0
+0 0]concat}if 72 Resolution div 72 VResolution div neg scale isls{
+landplus90{VResolution 72 div vsize mul 0 exch}{Resolution -72 div hsize
+mul 0}ifelse TR}if Resolution VResolution vsize -72 div 1 add mul TR[
+matrix currentmatrix{A A round sub abs 0.00001 lt{round}if}forall round
+exch round exch]setmatrix}N/@landscape{/isls true N}B/@manualfeed{
+statusdict/manualfeed true put}B/@copies{/#copies X}B/FMat[1 0 0 -1 0 0]
+N/FBB[0 0 0 0]N/nn 0 N/IE 0 N/ctr 0 N/df-tail{/nn 8 dict N nn begin
+/FontType 3 N/FontMatrix fntrx N/FontBBox FBB N string/base X array
+/BitMaps X/BuildChar{CharBuilder}N/Encoding IE N end A{/foo setfont}2
+array copy cvx N load 0 nn put/ctr 0 N[}B/sf 0 N/df{/sf 1 N/fntrx FMat N
+df-tail}B/dfs{div/sf X/fntrx[sf 0 0 sf neg 0 0]N df-tail}B/E{pop nn A
+definefont setfont}B/Cw{Cd A length 5 sub get}B/Ch{Cd A length 4 sub get
+}B/Cx{128 Cd A length 3 sub get sub}B/Cy{Cd A length 2 sub get 127 sub}
+B/Cdx{Cd A length 1 sub get}B/Ci{Cd A type/stringtype ne{ctr get/ctr ctr
+1 add N}if}B/id 0 N/rw 0 N/rc 0 N/gp 0 N/cp 0 N/G 0 N/CharBuilder{save 3
+1 roll S A/base get 2 index get S/BitMaps get S get/Cd X pop/ctr 0 N Cdx
+0 Cx Cy Ch sub Cx Cw add Cy setcachedevice Cw Ch true[1 0 0 -1 -.1 Cx
+sub Cy .1 sub]/id Ci N/rw Cw 7 add 8 idiv string N/rc 0 N/gp 0 N/cp 0 N{
+rc 0 ne{rc 1 sub/rc X rw}{G}ifelse}imagemask restore}B/G{{id gp get/gp
+gp 1 add N A 18 mod S 18 idiv pl S get exec}loop}B/adv{cp add/cp X}B
+/chg{rw cp id gp 4 index getinterval putinterval A gp add/gp X adv}B/nd{
+/cp 0 N rw exit}B/lsh{rw cp 2 copy get A 0 eq{pop 1}{A 255 eq{pop 254}{
+A A add 255 and S 1 and or}ifelse}ifelse put 1 adv}B/rsh{rw cp 2 copy
+get A 0 eq{pop 128}{A 255 eq{pop 127}{A 2 idiv S 128 and or}ifelse}
+ifelse put 1 adv}B/clr{rw cp 2 index string putinterval adv}B/set{rw cp
+fillstr 0 4 index getinterval putinterval adv}B/fillstr 18 string 0 1 17
+{2 copy 255 put pop}for N/pl[{adv 1 chg}{adv 1 chg nd}{1 add chg}{1 add
+chg nd}{adv lsh}{adv lsh nd}{adv rsh}{adv rsh nd}{1 add adv}{/rc X nd}{
+1 add set}{1 add clr}{adv 2 chg}{adv 2 chg nd}{pop nd}]A{bind pop}
+forall N/D{/cc X A type/stringtype ne{]}if nn/base get cc ctr put nn
+/BitMaps get S ctr S sf 1 ne{A A length 1 sub A 2 index S get sf div put
+}if put/ctr ctr 1 add N}B/I{cc 1 add D}B/bop{userdict/bop-hook known{
+bop-hook}if/SI save N @rigin 0 0 moveto/V matrix currentmatrix A 1 get A
+mul exch 0 get A mul add .99 lt{/QV}{/RV}ifelse load def pop pop}N/eop{
+SI restore userdict/eop-hook known{eop-hook}if showpage}N/@start{
+userdict/start-hook known{start-hook}if pop/VResolution X/Resolution X
+1000 div/DVImag X/IE 256 array N 2 string 0 1 255{IE S A 360 add 36 4
+index cvrs cvn put}for pop 65781.76 div/vsize X 65781.76 div/hsize X}N
+/p{show}N/RMat[1 0 0 -1 0 0]N/BDot 260 string N/Rx 0 N/Ry 0 N/V{}B/RV/v{
+/Ry X/Rx X V}B statusdict begin/product where{pop false[(Display)(NeXT)
+(LaserWriter 16/600)]{A length product length le{A length product exch 0
+exch getinterval eq{pop true exit}if}{pop}ifelse}forall}{false}ifelse
+end{{gsave TR -.1 .1 TR 1 1 scale Rx Ry false RMat{BDot}imagemask
+grestore}}{{gsave TR -.1 .1 TR Rx Ry scale 1 1 false RMat{BDot}
+imagemask grestore}}ifelse B/QV{gsave newpath transform round exch round
+exch itransform moveto Rx 0 rlineto 0 Ry neg rlineto Rx neg 0 rlineto
+fill grestore}B/a{moveto}B/delta 0 N/tail{A/delta X 0 rmoveto}B/M{S p
+delta add tail}B/b{S p tail}B/c{-4 M}B/d{-3 M}B/e{-2 M}B/f{-1 M}B/g{0 M}
+B/h{1 M}B/i{2 M}B/j{3 M}B/k{4 M}B/w{0 rmoveto}B/l{p -4 w}B/m{p -3 w}B/n{
+p -2 w}B/o{p -1 w}B/q{p 1 w}B/r{p 2 w}B/s{p 3 w}B/t{p 4 w}B/x{0 S
+rmoveto}B/y{3 2 roll p a}B/bos{/SS save N}B/eos{SS restore}B end
+
+%%EndProcSet
+%%BeginProcSet: 8r.enc
+% @@psencodingfile@{
+%   author = "S. Rahtz, P. MacKay, Alan Jeffrey, B. Horn, K. Berry",
+%   version = "0.6",
+%   date = "22 June 1996",
+%   filename = "8r.enc",
+%   email = "kb@@mail.tug.org",
+%   address = "135 Center Hill Rd. // Plymouth, MA 02360",
+%   codetable = "ISO/ASCII",
+%   checksum = "119     662    4424",
+%   docstring = "Encoding for TrueType or Type 1 fonts to be used with TeX."
+% @}
+% 
+% Idea is to have all the characters normally included in Type 1 fonts
+% available for typesetting. This is effectively the characters in Adobe
+% Standard Encoding + ISO Latin 1 + extra characters from Lucida.
+% 
+% Character code assignments were made as follows:
+% 
+% (1) the Windows ANSI characters are almost all in their Windows ANSI
+% positions, because some Windows users cannot easily reencode the
+% fonts, and it makes no difference on other systems. The only Windows
+% ANSI characters not available are those that make no sense for
+% typesetting -- rubout (127 decimal), nobreakspace (160), softhyphen
+% (173). quotesingle and grave are moved just because it's such an
+% irritation not having them in TeX positions.
+% 
+% (2) Remaining characters are assigned arbitrarily to the lower part
+% of the range, avoiding 0, 10 and 13 in case we meet dumb software.
+% 
+% (3) Y&Y Lucida Bright includes some extra text characters; in the
+% hopes that other PostScript fonts, perhaps created for public
+% consumption, will include them, they are included starting at 0x12.
+% 
+% (4) Remaining positions left undefined are for use in (hopefully)
+% upward-compatible revisions, if someday more characters are generally
+% available.
+% 
+% (5) hyphen appears twice for compatibility with both ASCII and Windows.
+% 
+/TeXBase1Encoding [
+% 0x00 (encoded characters from Adobe Standard not in Windows 3.1)
+  /.notdef /dotaccent /fi /fl
+  /fraction /hungarumlaut /Lslash /lslash
+  /ogonek /ring /.notdef
+  /breve /minus /.notdef 
+% These are the only two remaining unencoded characters, so may as
+% well include them.
+  /Zcaron /zcaron 
+% 0x10
+ /caron /dotlessi 
+% (unusual TeX characters available in, e.g., Lucida Bright)
+ /dotlessj /ff /ffi /ffl 
+ /.notdef /.notdef /.notdef /.notdef
+ /.notdef /.notdef /.notdef /.notdef
+ % very contentious; it's so painful not having quoteleft and quoteright
+ % at 96 and 145 that we move the things normally found there down to here.
+ /grave /quotesingle 
+% 0x20 (ASCII begins)
+ /space /exclam /quotedbl /numbersign
+ /dollar /percent /ampersand /quoteright
+ /parenleft /parenright /asterisk /plus /comma /hyphen /period /slash
+% 0x30
+ /zero /one /two /three /four /five /six /seven
+ /eight /nine /colon /semicolon /less /equal /greater /question
+% 0x40
+ /at /A /B /C /D /E /F /G /H /I /J /K /L /M /N /O
+% 0x50
+ /P /Q /R /S /T /U /V /W
+ /X /Y /Z /bracketleft /backslash /bracketright /asciicircum /underscore
+% 0x60
+ /quoteleft /a /b /c /d /e /f /g /h /i /j /k /l /m /n /o
+% 0x70
+ /p /q /r /s /t /u /v /w
+ /x /y /z /braceleft /bar /braceright /asciitilde
+ /.notdef % rubout; ASCII ends
+% 0x80
+ /.notdef /.notdef /quotesinglbase /florin
+ /quotedblbase /ellipsis /dagger /daggerdbl
+ /circumflex /perthousand /Scaron /guilsinglleft
+ /OE /.notdef /.notdef /.notdef
+% 0x90
+ /.notdef /.notdef /.notdef /quotedblleft
+ /quotedblright /bullet /endash /emdash
+ /tilde /trademark /scaron /guilsinglright
+ /oe /.notdef /.notdef /Ydieresis
+% 0xA0
+ /.notdef % nobreakspace
+ /exclamdown /cent /sterling
+ /currency /yen /brokenbar /section
+ /dieresis /copyright /ordfeminine /guillemotleft
+ /logicalnot
+ /hyphen % Y&Y (also at 45); Windows' softhyphen
+ /registered
+ /macron
+% 0xD0
+ /degree /plusminus /twosuperior /threesuperior
+ /acute /mu /paragraph /periodcentered
+ /cedilla /onesuperior /ordmasculine /guillemotright
+ /onequarter /onehalf /threequarters /questiondown
+% 0xC0
+ /Agrave /Aacute /Acircumflex /Atilde /Adieresis /Aring /AE /Ccedilla
+ /Egrave /Eacute /Ecircumflex /Edieresis
+ /Igrave /Iacute /Icircumflex /Idieresis
+% 0xD0
+ /Eth /Ntilde /Ograve /Oacute
+ /Ocircumflex /Otilde /Odieresis /multiply
+ /Oslash /Ugrave /Uacute /Ucircumflex
+ /Udieresis /Yacute /Thorn /germandbls
+% 0xE0
+ /agrave /aacute /acircumflex /atilde
+ /adieresis /aring /ae /ccedilla
+ /egrave /eacute /ecircumflex /edieresis
+ /igrave /iacute /icircumflex /idieresis
+% 0xF0
+ /eth /ntilde /ograve /oacute
+ /ocircumflex /otilde /odieresis /divide
+ /oslash /ugrave /uacute /ucircumflex
+ /udieresis /yacute /thorn /ydieresis
+] def
+
+%%EndProcSet
+%%BeginProcSet: texnansi.enc
+% @psencodingfile{
+%   author = "Y&Y, Inc.",
+%   version = "1.1",
+%   date = "1 December 1996",
+%   filename = "texnansi.enc",
+%   email = "help@YandY.com",
+%   address = "45 Walden Street // Concord, MA 01742, USA",
+%   codetable = "ISO/ASCII",
+%   checksum = "xx",
+%   docstring = "Encoding for fonts in Adobe Type 1 format for use with TeX."
+% }
+%
+% The idea is to have all 228 characters normally included in Type 1 text
+% fonts (plus a few more) available for typesetting.  This is effectively
+% the character set in Adobe Standard Encoding, ISO Latin 1, plus a few more.
+%
+% Character code assignments were made as follows:
+%
+% (1) The character layout largely matches `ASCII' in the 32 -- 126 range,
+% except for `circumflex' in 94 and `tilde' in 126, to match `TeX text'
+% (`asciicircumflex' and `asciitilde' appear in 158 and 142 instead).
+%
+% (2) The character layout matches `Windows ANSI' in almost all places,
+% except for `quoteright' in 39 and `quoteleft' in 96 to match ASCII
+% (`quotesingle' and `grave' appear in 129 and 18 instead).
+%
+% (3) The character layout matches `TeX typewriter' used by CM text fonts
+% in most places (except for discordant positions such as hungarumlaut
+% (instead of braceright), dotaccent (instead of underscore) etc.
+%
+% (4) Remaining characters are assigned arbitrarily to the `control character'
+% range (0 -- 31), avoiding 0, 9, 10 and 13 in case we meet dumb software
+% - similarly one should really avoid 127 and 128 if possible.
+% In addition, the 8 open slots in Windows ANSI between 128 and 159 are used.
+%
+% (5) Y&Y Lucida Bright includes some extra ligatures and such; ff, ffi, ffl,
+% and `dotlessj,' these are included 11 -- 15, and 17.
+%
+% (6) Hyphen appears both at 45 and 173 for compatibility with both ASCII
+% and Windows ANSI.
+%
+% (7) It doesn't really matter where ligatures appear (both real, such as ffi,
+% and pseudo such as ---) since these should not be accessed directly, only
+% via ligature information in the TFM file.
+%
+% SAMPLE USAGE (in `psfonts.map' file for DVIPS):
+% 
+% lbr LucidaBright "TeXnANSIEncoding ReEncodeFont" <texnansi.enc <lbr.pfb
+%
+% This tells DVIPS that the font called `lbr' in TeX has PostScript 
+% FontName `LucidaBright.'  It also asks DVIPS to expand the file `lbr.pfb'
+% into PFA form, to include the attached `texnansi.enc' encoding vector,
+% and to then actually reencode the font based on that encoding vector.
+%
+% Revised 1996 June 1 by adding second position for `fl' to avoid Acrobat bug.
+% Revised 1996 June 1 by adding second position for `fraction' for same reason.
+%
+/TeXnANSIEncoding [
+/.notdef /uni20AC /.notdef /.notdef % 0, 1, 2, 3
+/fraction %	4
+/dotaccent %	5
+/hungarumlaut %	6
+/ogonek	%	7
+/fl	%	8
+/.notdef % /fraction %	9	not used (see 4), backward compatability only
+/cwm	%	10	not used, except boundary char internally maybe
+/ff    %	11
+/fi    %	12
+/.notdef % /fl    %	13	not used (see 8), backward compatability only
+/ffi   %	14
+/ffl   %	15
+/dotlessi %	16
+/dotlessj %	17
+/grave %	18
+/acute %	19
+/caron %	20
+/breve %	21
+/macron %	22
+/ring  %	23
+/cedilla %	24
+/germandbls %	25
+/ae    %	26
+/oe    %	27
+/oslash %	28
+/AE    %	29
+/OE    %	30
+/Oslash %	31
+/space %	32	% /suppress in TeX text
+/exclam %	33
+/quotedbl %	34	% /quotedblright in TeX text
+/numbersign %	35
+/dollar %	36
+/percent %	37
+/ampersand %	38
+/quoteright %	39	% /quotesingle in ANSI
+/parenleft %	40
+/parenright %	41
+/asterisk %	42
+/plus  %	43
+/comma %	44
+/hyphen %	45
+/period %	46
+/slash %	47
+/zero  %	48
+/one   %	49
+/two   %	50
+/three %	51
+/four  %	52
+/five  %	53
+/six   %	54
+/seven %	55
+/eight %	56
+/nine  %	57
+/colon %	58
+/semicolon %	59
+/less  %	60	% /exclamdown in Tex text
+/equal %	61
+/greater %	62	% /questiondown in TeX text
+/question %	63
+/at %	64
+/A %	65
+/B %	66
+/C %	67
+/D %	68
+/E %	69
+/F %	70
+/G %	71
+/H %	72
+/I %	73
+/J %	74
+/K %	75
+/L %	76
+/M %	77
+/N %	78
+/O %	79
+/P %	80
+/Q %	81
+/R %	82
+/S %	83
+/T %	84
+/U %	85
+/V %	86
+/W %	87
+/X %	88
+/Y %	89
+/Z %	90
+/bracketleft %	91
+/backslash %	92	% /quotedblleft in TeX text
+/bracketright %	93
+/circumflex %	94	% /asciicircum in ASCII
+/underscore %	95	% /dotaccent in TeX text
+/quoteleft %	96	% /grave accent in ANSI
+/a %	97
+/b %	98
+/c %	99
+/d %	100
+/e %	101
+/f %	102
+/g %	103
+/h %	104
+/i %	105
+/j %	106
+/k %	107
+/l %	108
+/m %	109
+/n %	110
+/o %	111
+/p %	112
+/q %	113
+/r %	114
+/s %	115
+/t %	116
+/u %	117
+/v %	118
+/w %	119
+/x %	120
+/y %	121
+/z %	122
+/braceleft %	123	% /endash in TeX text
+/bar   %	124	% /emdash in TeX test
+/braceright %	125	% /hungarumlaut in TeX text
+/tilde %	126	% /asciitilde in ASCII
+/dieresis %	127	not used (see 168), use higher up instead
+/Lslash	%	128	this position is unfortunate, but now too late to fix
+/quotesingle %	129
+/quotesinglbase %	130
+/florin %	131
+/quotedblbase %	132
+/ellipsis %	133
+/dagger %	134
+/daggerdbl %	135
+/circumflex %	136
+/perthousand %	137
+/Scaron %	138
+/guilsinglleft %	139
+/OE    %	140
+/Zcaron %	141
+/asciicircum %	142
+/minus %	143
+/lslash %	144
+/quoteleft %	145
+/quoteright %	146
+/quotedblleft %	147
+/quotedblright %	148
+/bullet %	149
+/endash %	150
+/emdash %	151
+/tilde %	152
+/trademark %	153
+/scaron %	154
+/guilsinglright %	155
+/oe    %	156
+/zcaron %	157
+/asciitilde %	158
+/Ydieresis %	159
+/nbspace %	160	% /space (no break space)
+/exclamdown %	161
+/cent  %	162
+/sterling %	163
+/currency %	164
+/yen   %	165
+/brokenbar %	166
+/section %	167
+/dieresis %	168
+/copyright %	169
+/ordfeminine %	170
+/guillemotleft %	171
+/logicalnot %	172
+/sfthyphen %	173 % /hyphen (hanging hyphen)
+/registered %	174
+/macron %	175
+/degree %	176
+/plusminus %	177
+/twosuperior %	178
+/threesuperior %	179
+/acute %	180
+/mu    %	181
+/paragraph %	182
+/periodcentered %	183
+/cedilla %	184
+/onesuperior %	185
+/ordmasculine %	186
+/guillemotright %	187
+/onequarter %	188
+/onehalf %	189
+/threequarters %	190
+/questiondown %	191
+/Agrave %	192
+/Aacute %	193
+/Acircumflex %	194
+/Atilde %	195
+/Adieresis %	196
+/Aring %	197
+/AE    %	198
+/Ccedilla %	199
+/Egrave %	200
+/Eacute %	201
+/Ecircumflex %	202
+/Edieresis %	203
+/Igrave %	204
+/Iacute %	205
+/Icircumflex %	206
+/Idieresis %	207
+/Eth   %	208
+/Ntilde %	209
+/Ograve %	210
+/Oacute %	211
+/Ocircumflex %	212
+/Otilde %	213
+/Odieresis %	214
+/multiply %	215	% OE in T1
+/Oslash %	216
+/Ugrave %	217
+/Uacute %	218
+/Ucircumflex %	219
+/Udieresis %	220
+/Yacute %	221
+/Thorn %	222
+/germandbls %	223 % SS in T1
+/agrave %	224
+/aacute %	225
+/acircumflex %	226
+/atilde %	227
+/adieresis %	228
+/aring %	229
+/ae    %	230
+/ccedilla %	231
+/egrave %	232
+/eacute %	233
+/ecircumflex %	234
+/edieresis %	235
+/igrave %	236
+/iacute %	237
+/icircumflex %	238
+/idieresis %	239
+/eth   %	240
+/ntilde %	241
+/ograve %	242
+/oacute %	243
+/ocircumflex %	244
+/otilde %	245
+/odieresis %	246
+/divide %	247	% oe in T1
+/oslash %	248
+/ugrave %	249
+/uacute %	250
+/ucircumflex %	251
+/udieresis %	252
+/yacute %	253
+/thorn %	254
+/ydieresis %	255	% germandbls in T1
+] def
+
+%%EndProcSet
+%%BeginProcSet: texps.pro
+%!
+TeXDict begin/rf{findfont dup length 1 add dict begin{1 index/FID ne 2
+index/UniqueID ne and{def}{pop pop}ifelse}forall[1 index 0 6 -1 roll
+exec 0 exch 5 -1 roll VResolution Resolution div mul neg 0 0]/Metrics
+exch def dict begin Encoding{exch dup type/integertype ne{pop pop 1 sub
+dup 0 le{pop}{[}ifelse}{FontMatrix 0 get div Metrics 0 get div def}
+ifelse}forall Metrics/Metrics currentdict end def[2 index currentdict
+end definefont 3 -1 roll makefont/setfont cvx]cvx def}def/ObliqueSlant{
+dup sin S cos div neg}B/SlantFont{4 index mul add}def/ExtendFont{3 -1
+roll mul exch}def/ReEncodeFont{CharStrings rcheck{/Encoding false def
+dup[exch{dup CharStrings exch known not{pop/.notdef/Encoding true def}
+if}forall Encoding{]exch pop}{cleartomark}ifelse}if/Encoding exch def}
+def end
+
+%%EndProcSet
+%%BeginProcSet: special.pro
+%!
+TeXDict begin/SDict 200 dict N SDict begin/@SpecialDefaults{/hs 612 N
+/vs 792 N/ho 0 N/vo 0 N/hsc 1 N/vsc 1 N/ang 0 N/CLIP 0 N/rwiSeen false N
+/rhiSeen false N/letter{}N/note{}N/a4{}N/legal{}N}B/@scaleunit 100 N
+/@hscale{@scaleunit div/hsc X}B/@vscale{@scaleunit div/vsc X}B/@hsize{
+/hs X/CLIP 1 N}B/@vsize{/vs X/CLIP 1 N}B/@clip{/CLIP 2 N}B/@hoffset{/ho
+X}B/@voffset{/vo X}B/@angle{/ang X}B/@rwi{10 div/rwi X/rwiSeen true N}B
+/@rhi{10 div/rhi X/rhiSeen true N}B/@llx{/llx X}B/@lly{/lly X}B/@urx{
+/urx X}B/@ury{/ury X}B/magscale true def end/@MacSetUp{userdict/md known
+{userdict/md get type/dicttype eq{userdict begin md length 10 add md
+maxlength ge{/md md dup length 20 add dict copy def}if end md begin
+/letter{}N/note{}N/legal{}N/od{txpose 1 0 mtx defaultmatrix dtransform S
+atan/pa X newpath clippath mark{transform{itransform moveto}}{transform{
+itransform lineto}}{6 -2 roll transform 6 -2 roll transform 6 -2 roll
+transform{itransform 6 2 roll itransform 6 2 roll itransform 6 2 roll
+curveto}}{{closepath}}pathforall newpath counttomark array astore/gc xdf
+pop ct 39 0 put 10 fz 0 fs 2 F/|______Courier fnt invertflag{PaintBlack}
+if}N/txpose{pxs pys scale ppr aload pop por{noflips{pop S neg S TR pop 1
+-1 scale}if xflip yflip and{pop S neg S TR 180 rotate 1 -1 scale ppr 3
+get ppr 1 get neg sub neg ppr 2 get ppr 0 get neg sub neg TR}if xflip
+yflip not and{pop S neg S TR pop 180 rotate ppr 3 get ppr 1 get neg sub
+neg 0 TR}if yflip xflip not and{ppr 1 get neg ppr 0 get neg TR}if}{
+noflips{TR pop pop 270 rotate 1 -1 scale}if xflip yflip and{TR pop pop
+90 rotate 1 -1 scale ppr 3 get ppr 1 get neg sub neg ppr 2 get ppr 0 get
+neg sub neg TR}if xflip yflip not and{TR pop pop 90 rotate ppr 3 get ppr
+1 get neg sub neg 0 TR}if yflip xflip not and{TR pop pop 270 rotate ppr
+2 get ppr 0 get neg sub neg 0 S TR}if}ifelse scaleby96{ppr aload pop 4
+-1 roll add 2 div 3 1 roll add 2 div 2 copy TR .96 dup scale neg S neg S
+TR}if}N/cp{pop pop showpage pm restore}N end}if}if}N/normalscale{
+Resolution 72 div VResolution 72 div neg scale magscale{DVImag dup scale
+}if 0 setgray}N/psfts{S 65781.76 div N}N/startTexFig{/psf$SavedState
+save N userdict maxlength dict begin/magscale true def normalscale
+currentpoint TR/psf$ury psfts/psf$urx psfts/psf$lly psfts/psf$llx psfts
+/psf$y psfts/psf$x psfts currentpoint/psf$cy X/psf$cx X/psf$sx psf$x
+psf$urx psf$llx sub div N/psf$sy psf$y psf$ury psf$lly sub div N psf$sx
+psf$sy scale psf$cx psf$sx div psf$llx sub psf$cy psf$sy div psf$ury sub
+TR/showpage{}N/erasepage{}N/copypage{}N/p 3 def @MacSetUp}N/doclip{
+psf$llx psf$lly psf$urx psf$ury currentpoint 6 2 roll newpath 4 copy 4 2
+roll moveto 6 -1 roll S lineto S lineto S lineto closepath clip newpath
+moveto}N/endTexFig{end psf$SavedState restore}N/@beginspecial{SDict
+begin/SpecialSave save N gsave normalscale currentpoint TR
+@SpecialDefaults count/ocount X/dcount countdictstack N}N/@setspecial{
+CLIP 1 eq{newpath 0 0 moveto hs 0 rlineto 0 vs rlineto hs neg 0 rlineto
+closepath clip}if ho vo TR hsc vsc scale ang rotate rwiSeen{rwi urx llx
+sub div rhiSeen{rhi ury lly sub div}{dup}ifelse scale llx neg lly neg TR
+}{rhiSeen{rhi ury lly sub div dup scale llx neg lly neg TR}if}ifelse
+CLIP 2 eq{newpath llx lly moveto urx lly lineto urx ury lineto llx ury
+lineto closepath clip}if/showpage{}N/erasepage{}N/copypage{}N newpath}N
+/@endspecial{count ocount sub{pop}repeat countdictstack dcount sub{end}
+repeat grestore SpecialSave restore end}N/@defspecial{SDict begin}N
+/@fedspecial{end}B/li{lineto}B/rl{rlineto}B/rc{rcurveto}B/np{/SaveX
+currentpoint/SaveY X N 1 setlinecap newpath}N/st{stroke SaveX SaveY
+moveto}N/fil{fill SaveX SaveY moveto}N/ellipse{/endangle X/startangle X
+/yrad X/xrad X/savematrix matrix currentmatrix N TR xrad yrad scale 0 0
+1 startangle endangle arc savematrix setmatrix}N end
+
+%%EndProcSet
+TeXDict begin 40258431 52099146 1000 600 600 (smpaiaa.dvi)
+@start
+%DVIPSBitmapFont: Fa cmti8 8 43
+/Fa 43 122 df<ED3FF8913801FFFE913903F00F8091390FC003C0EC1F00160F143EA214
+7E027CEB070093C7FCA214FC5CA5017FB512FEA2903901F0007E167CA213034A13FC5EA3
+0107130102C05BA31503010F5C1480A2923807E18016C3131FA2140016C7EE87005B013E
+148EED03DEED01FC6F5A017E91C7FC137CA3EA38F812FCA25B12FDEAF1E0EAF3C0EA7F80
+001ECAFC2A3D81AE28>12 D<147E49B46C131C902607C3C0137E90381F01E0EB3E004915
+7C01780170133C9038F803F0D801F015384A481378D803E015F0913903C001E091C71203
+0007ED07C049EC0F80EE1F00167E9039C7C001FF9039DFF003EF903AFC7007878001F8EB
+0F03D803F0011E13C001E0EB3C010007EBF038380FF0E03B1FFFC07B81E090399F0077C0
+48C7EA3FC1A248021F13C0007EEC07011500160300FE16805A16071700160E007C151E00
+7E5D003E1538003F15F06C4A5AD80FC0495AD803E0011FC7FCD801FC13FC39007FFFF001
+0790C8FC2F3077AE37>38 D<EA0380EA0FE0121FA213F0A213E0EA0760120013E013C012
+0113801203EA07001206120E5A5A12F012C00C157B8716>44 D<387FFFC0A2B5FCA26C13
+0012057A901A>I<EC7F80903801FFE0903807C0F890381E007C49133C49133E49131EEA
+01E613C701C3133E120313831387D801CE137E01FC137CD8007813F890C7FCEC01F0EC03
+E0EC0F80EC3F00EB0FFCA2EB001E141FEC0F80A215C0A41218127C141F00FC1480A24813
+3F00E01400147E6C5B387001F8387803F0383C0FC0D80FFFC7FCEA03F81F2D79AB24>51
+D<13F0EA01F812031207A3EA03F0EA01C0C7FCAD121C127F5AA45A12380D1D789C16>58
+D<16E01501821503A21507150FA2151FA2153B157B157315E382EC01C114031581EC0701
+A2140EA2141C143C143802707F15005C13015C49B5FCA249C7FCA2130E131E131C498016
+7E5B13F0485AA21203D80FF014FFD8FFFC011F13F0A22C2F7CAE35>65
+D<DA01FE133091390FFFC07091393F01E0F09138F80079D903E0133D4948EB1FE0D91F80
+130F49C7FC017E14074915C0485A485A5B00071680485AA2485A170048CAFCA25A127EA3
+12FE5AA5163848157816707E16F0007C5D15014B5A6C5D4BC7FC6C140E6C6C133C6C6C5B
+6C6C485A3900F80FC0D97FFFC8FCEB0FF82C2F75AD33>67 D<011FB512FCEEFF80903A00
+FE000FC0EE03E04AEB01F0EE00F80101157C173C4A143E171E0103151FA25CA21307A25C
+A2130FA24A143FA2131F173E4A147EA2013F157C17FC91C8FC17F849EC01F0A2017EEC03
+E0A201FEEC07C0EE0F8049EC1F00163E00015D5E49495AED07C00003023FC7FCB612FC15
+E0302D7BAC36>I<011FB612F8A2903900FE000716014A13001778130117705CA21303A2
+5C16E001071301170002E05B1503130F15074A485A91B5FC5BECC01F4A6CC7FCA2133FA2
+EC000EA25B92C8FC137EA213FEA25BA21201A25BA21203B512F0A22D2D7CAC2E>70
+D<03FF1318020FEBC03891393F00F07802F8EB38F8D903F0131CD907C0EB0FF0EB1F8049
+C71207137E49EC03E0485A485AA2484815C0485AA2485A178048CAFCA25A127EA312FE5A
+A292B512E0A2923801FE006F5A15015EA3007C14035E127E123E001E1407001F5D6C6C13
+0F6C6C133F6C6C13793A00F803F1C090383FFF80D907FCC8FC2D2F75AD37>I<90381FFF
+F8A2903800FE00A25CA21301A25CA21303A25CA21307A25CA2130FA25CA2131FA25CA213
+3FA291C7FCA25BA2137EA213FEA25BA21201A25BA21203B512C0A21D2D7CAC1B>73
+D<91387FFFE0A2913800FE00A25DA214015DA314035DA314075DA3140F5DA3141F5DA314
+3F92C7FCA35CA2147EA2003C13FE127E00FE5BA2495AEAFC0300F05B48485A38700FC0D8
+781FC8FCEA1FFCEA07F0232E7AAC25>I<D91FFFED0FFF600100EE3FC0A2F07F8018EF90
+2601EF8014FF943801DF0014CFEF039F01034B5A183E028F140E171C0107167EDA87C0EB
+387C14071770010FEDE0FC60010EEC01C0EE0380011E158193380701F090381C03E0160E
+013CEC1C036001381438A20178EC700704E05B90387001F0EDF1C001F09038F3800F6001
+E0EBF700A2000102FE131F4B91C7FC13C0486C6C5AD80FF05DD8FFFE9039F00FFFF815E0
+402D7BAC40>77 D<D91FFE903803FFF8A2D900FF9038003F80EF1E00A26F131C49153C6F
+133814CFA201036D137802C714701487EC83F0010715F06F5B1401A2010FEBFC0102005C
+130E157E011E1403037F5B011C133FA2013C1487031F90C7FC1338ED0FC7017814CF16EE
+01701307A201F014FE6F5A5B150112015E491300487E120FD8FFFE1470A2352D7BAC35>
+I<011FB512FCEEFF80903A00FE000FE0EE03F04AEB00F8A20101157CA25C177E130317FC
+5CA20107EC01F8A24AEB03F017E0010FEC07C0EE0F804AEB3F00ED01FC91B512F04991C7
+FC0280C8FCA3133F91C9FCA35B137EA313FE5BA312015BA21203B512C0A22F2D7CAC30>
+80 D<011FB512E016FC903900FE003FEE0FC04AEB07E016030101EC01F0A24A14F8A213
+03EE03F05CA20107EC07E017C04AEB0F80EE1F00010F143E16FC9138C007F091B512805B
+9138C00FE091388003F06F7E133F6F7E91C7FCA2491301A2017E5CA201FE1303A2495C17
+080001163C17384914E0EEF07800031670B5D8C00113E09238007FC0C9EA1F002E2E7BAC
+34>82 D<91380FF00C91383FFC1C9138F80F3C903903C007BC9039078003FC90390F0001
+F8131E491300A24914F0A313F816E0A216007F7F6D7EEB7FF8ECFF806D13E06D13F80107
+7F01017FEB001FEC01FF6E7E8181A281121CA35D003C141EA25DA2007E5C5D007F495A6D
+485A26F1F01FC7FC38E07FFC38C00FF0262F7BAD28>I<000FB712F0A23A1FE00FE00701
+001401001E02C013E0481500141F12380078EC8001A20070013F14C012F0481400A25CC7
+91C7FC147EA214FEA25CA21301A25CA21303A25CA21307A25CA2130FA25CA2131FA25CA2
+133F003FB57EA22C2D74AC33>I<3B3FFFF007FFF0A2D801FCC7EA7F00163C5B16380003
+157816705BA2000715F05E5BA2000F14015E5BA2001F14035E5BA2003F140793C7FC90C7
+FCA2485C150E127EA2151E00FE141C5A153C153815781570007C5C1401007E495A003E49
+5A6C49C8FC6C133C3807C0F83801FFE06C6CC9FC2C2E72AC35>I<B53B807FFF803FFFA2
+3D0FF00007F00007F06C48EE03E04C14C019801807030F1500180E4B7E60153B037B5C03
+73147803E3147018F0DA01C35C4D5AEC03834D5A3903F00703020F4AC7FC020E5C021E14
+0E021C141E0238141C5F027013F803015B14E001F15D14C001F3ECF9C0028013FBD9F700
+5C04FFC8FC13FE5E5B00015D5B5E5B495C5E491300402E72AC47>87
+D<EB07C0EB1FF090387C39C0EBF81FEA01F03803E00FEA07C0120FD81F801380A2EA3F00
+141F481400127EA25C00FE133E5AA2EC7E18EC7C385AA214FCD878011378397C03F870A2
+393C0F78E0381E1E3D390FF81FC03903E00F001D1F799D24>97 D<EB01F8EB0FFE90383E
+0780EBFC03D801F013C03803E0070007130FEA0FC001801380121F48C8FCA25A127EA312
+FE5AA5EC0180007CEB03C0EC0780EC0F006C131E001E137C380F83F03807FFC0C648C7FC
+1A1F799D21>99 D<153EEC07FEA2EC007EA2157CA215FCA215F8A21401A215F0A21403EB
+07C390381FF3E0EB7C3BEBF81FEA01F03903E00FC0EA07C0120FEA1F801580EA3F00141F
+5A007E1400A25C12FE48133EA2EC7E18153848137CA214FCD878011378397C03F870A239
+3C0F78E0381E1E3D390FF81FC03903E00F001F2F79AD24>I<EB03F8EB0FFEEB3E0FEBF8
+073901F00380EA03E0EA07C0000F1307D81F8013005C383F001E5C387F03F8EBFFE049C7
+FC007EC8FC12FE5AA4127CEC0180EC03C0EC07806CEB0F00141E6C137C380F83F03803FF
+C0C648C7FC1A1F799D21>I<EC01F0EC07FCEC0F9EEC1F1EEC1E3EEC3E7EA3EC7C381500
+A314FC5CA590387FFFF0A2903801F000A313035CA413075CA4130F5CA4131F91C7FCA45B
+133EA4137E137CA3EA38F812FCA25B12FDEAF1E0EAF3C0EA7F80001EC8FC1F3D81AE16>
+I<14F8EB03FE90380F873890381F03F8137EEB7C0113F81201EA03F015F0EA07E0140312
+0F01C013E0A21407121F018013C0A2140FA21580141F120F143FEC7F006C6C5AEA03C338
+01FFBF38007E3E1300147EA2147CA214FC00385BEAFC015C495A48485A38F01F80D87FFE
+C7FCEA1FF01D2C7C9D21>I<131FEA03FFA2EA003FA2133EA2137EA2137CA213FCA25BA2
+1201147E9038F3FF809038F787C03903FE03E013FC13F8A2EA07F013E0A213C0000F1307
+15C01380A2001F130F15801300141F481406150E003E133F143E007E141EEC7E1C007C13
+7CEC3C3812FC157048EB1FE00070EB07801F2F7BAD24>I<130E131FEB3F80A2EB1F0013
+0E90C7FCA9EA03E0EA0FF0EA1E78EA1C7C12381278127013FCEAF0F812E012E1EAC1F012
+0112035B12075BA2120F13831387121F13075BEA3F0E123EEA1E1C133C1338EA0FF0EA03
+C0112E7AAC16>I<131FEA03FFA2EA003FA2133EA2137EA2137CA213FCA25BA21201EC01
+E09038F007F0EC1E380003EB3878EC71F8EBE0E1EBE1C13807E381EC00E049130013CEEA
+0FFC13F0A213FF381F9FC0EB87E0EB03F01301003F14301570123EA2007E14F015E0007C
+13E014E100FC14C0903800F38048EB7F000070131E1D2F7BAD21>107
+D<137CEA0FFCA21200A213F8A21201A213F0A21203A213E0A21207A213C0A2120FA21380
+A2121FA21300A25AA2123EA2127EA2127CA2EAFC30137012F8A213F013E012F012F113C0
+12FBEA7F80EA1E000E2F7AAD12>I<3B07801FC007F03B1FE07FF01FFC3B3DF1E0F8783E
+3B38F3C078F01E3B78FF007DC01FD870FEEB7F80A2D8F1FC1400D8E1F8137EA249137C00
+C302FC5B0003163E495BA200070101147E177C01C05B17FC000F0103ECF83018700180EB
+E00117F0001F010715F0040313E0010001C013E0EFE1C048010F1301EFE380003E913980
+00FF00001C6DC7123C341F7A9D3A>I<3907801FC0391FE07FF0393DF1E0F83938F3C078
+3978FF007CEA70FEA2EAF1FCEAE1F8A25B00C314FC00035C5BA2000713015D13C0140300
+0FECE0C015E1EB800715C1001F14C3020F13800100138391380787005A158E003EEB03FC
+001CEB00F0221F7A9D28>I<EB03F8EB0FFE90383E0F809038FC07C03801F003D803E013
+E01207390FC001F01380121FEA3F0014035A127EA2140700FE14E05AA2EC0FC0A2EC1F80
+A2007CEB3F00143E5C6C5B381E01F0380F07C06CB4C7FCEA01FC1C1F799D24>I<90383C
+01F09038FF07FC3901E79E1E9038C7BC0F000301F81380903887F00702E013C038078FC0
+130F1480A2D8061F130F12001400A249131F1680133EA2017EEB3F00A2017C133E157E01
+FC137C5DEBFE015D486C485AEC0F80D9F3FEC7FCEBF0F8000390C8FCA25BA21207A25BA2
+120FA2EAFFFCA2222B7F9D24>I<3807803E391FE0FF80393CF3C1C03938F781E03878FF
+07EA70FE13FC12F139E1F8038091C7FC5B12C312035BA21207A25BA2120FA25BA2121FA2
+90C8FCA25AA2123E121C1B1F7A9D1E>114 D<EB0FC0EB7FF0EBF03C3801E01C3803C01E
+EA0780143EA2000F133C1418EBC00013F813FF6C13C06C13E06C13F0EA007F1307130313
+01EA780012FCA2130100F813E012E0EB03C038F0078038781F00EA1FFCEA07F0171F7A9D
+1D>I<131C133EA2137EA2137CA213FCA25BA21201A2B512E0A23803F000A25BA21207A2
+5BA2120FA25BA2121FA290C7FCA24813C01301123E130314801307003C1300130E131E6C
+5AEA0FF0EA07C0132B7AA918>I<EA03C0D80FF01338D81E78137CD81C7C13FC003814F8
+12781270EBFC01D8F0F813F012E012E138C1F003000114E0120313E01407000714C013C0
+A2EC0FC3000F14871380A2141F158F0007EB3F0E147F01C0131C3903E1E7BC3901FF83F8
+39007E01E0201F7A9D26>I<3903C001C0390FF003E0391E7807F0EA1C7C123800781303
+0070130113FCD8F0F813E012E000E1130038C1F001000114C0120313E014030007148013
+C0A2EC0700120F1380140EA25C12076D5A00035B6D5AC6B45A013FC7FC1C1F7A9D21>I<
+D803C01407D80FF09038700F80D81E789038F81FC0381C7C01003814F00078150F007015
+07EBFC03D8F0F801E0138012E000E1150326C1F007130700011600000314C013E0020F5B
+0007150E01C01380A2161E000F011F131C01801300163C1638167800074913709039C07F
+80F00003EC81E03A01E0E7C3C03A00FFC1FF8090263F007EC7FC2A1F7A9D2F>I<90383E
+01F09038FF87F83903C7DE1E380783DC903803F87EEA0E01001E13F0EA1C03003C143800
+38EBE000A2EA300700005BA3130F5CA3011F1318153814001238D87C3F137012FC15E0EB
+7F0139F0FF03C03970E78780393FC3FE00381F00F81F1F7C9D21>I<EA03C0D80FF01338
+D81E78137CD81C7C13FC003814F812781270EBFC01D8F0F813F012E012E138C1F0030001
+14E0120313E01407000714C013C0A2140F000F14801380A2141F150000075B5C13C03803
+E1FE3801FFBE38007E3EEB007E147CA2003E5BA2387E01F0A2387C03E0387007C06C485A
+D83C3EC7FCEA1FF8EA07E01E2C7A9D23>I E
+%EndDVIPSBitmapFont
+%DVIPSBitmapFont: Fb cmr6 6 10
+/Fb 10 58 df<13FF000313C0380781E0380F00F0001E137848133CA248131EA400F813
+1FAD0078131EA2007C133E003C133CA26C13786C13F0380781E03803FFC0C6130018227D
+A01E>48 D<13E01201120712FF12F91201B3A7487EB512C0A212217AA01E>I<EA01FC38
+07FF80381C0FC0383003E0386001F0EB00F812F86C13FCA2147C1278003013FCC7FC14F8
+A2EB01F0EB03E014C0EB0780EB0F00131E13385B5B3801C00CEA0380380600185A5A383F
+FFF85AB512F0A216217CA01E>I<13FF000313C0380F03E0381C00F014F8003E13FC147C
+A2001E13FC120CC712F8A2EB01F0EB03E0EB0FC03801FF00A2380003E0EB00F01478147C
+143E143F1230127812FCA2143E48137E0060137C003813F8381E03F0380FFFC000011300
+18227DA01E>I<14E01301A213031307A2130D131D13391331136113E113C1EA01811203
+EA07011206120C121C12181230127012E0B6FCA2380001E0A6EB03F0EB3FFFA218227DA1
+1E>I<00101330381E01F0381FFFE014C01480EBFE00EA1BF00018C7FCA513FE381BFF80
+381F03C0381C01E0381800F014F8C71278A2147CA21230127812F8A214784813F8006013
+F0387001E01238381E07803807FF00EA01F816227CA01E>I<EB0FC0EB7FF03801F03838
+03C0183807803C380F007C121E001C1338003C1300A2127C1278EB7FC038F9FFE038FB80
+F038FE0038143C48131EA248131FA41278A36C131EA2001C133C001E13386C1370380781
+E03801FFC038007F0018227DA01E>I<1230123C003FB5FCA24813FE14FC3860001C1438
+14704813E014C0EA0001EB0380EB07001306130E5BA25BA21378A35BA41201A76C5A1823
+7CA11E>I<137F3803FFC0380781E0380E00704813380018131C1238A3123C003F133838
+1FC078EBE0F0380FF9E03807FF80120114C0000713F0380F0FF8381C03FC383801FE3870
+007E141F48130F1407A314060070130E0078130C6C1338001F13F03807FFC0C613001822
+7DA01E>I<13FE3803FFC0380781E0380E0070481378003C133848133CA200F8131EA314
+1FA40078133FA26C137F121C380F01DF3807FF9F3803FE1EC7FCA2143E143C001C133800
+3E13781470003C13E0381801C0381C0780380FFE00EA03F818227DA01E>I
+E
+%EndDVIPSBitmapFont
+%DVIPSBitmapFont: Fc cmitt10 9 7
+/Fc 7 121 df<EC0FF0EC7FFE49B512804914C0010F14E090391FF81FF090393FC007F8
+90387F8001D97E0013FC01FE1300485A49147C485AA25BA26C4814FCC9FCED01F8A2ED03
+F01507ED1FE0ED3FC0EDFF8002031300EC0FFCEC7FF8903801FFE0010713804948C7FCEB
+3FF8EB7FC049C71278D801FC14F8485A48481301485A4848EB03F06D1307D83FFE14E03A
+7FFFC00FC0ECF83F91B51280D8FE3F1400D8FC0313FC48C65B0078EB1FE026307CAE27>
+50 D<EB01FCEB0FFF4913C0017F13E090B5FC4813073803F80FEA07F0EA0FE0EA1FC090
+3880078048C8FCA2127EA2127CA312FCA3127CA2127E15E0007FEB01F0383F801F90B5FC
+6C14E06C14C000031400C613F01C20769F27>99 D<ED1FC0ED7FF0EDFFF84A13FC5C15F1
+15E1140716F8EDC0F01600A2140FA20107B5128016C05BA26D1480D9001FC7FCA45CA214
+3EA3147EA2147CA414FCA25CA31301A25CA41303A25CA21307A25CA2EA3C0F127E38FE1F
+80A249C8FCB5FC5B6C5AEA1FF06C5A263F7DAD27>102 D<147814FC1301A31300147014
+00A813FCEA03FF4813804813C05AEA3F8F1307EA7E0FA200FC1380131F12F838303F0012
+00133E137EA2137C13FC140C3801F81F143F13F00003137EA2EBE0FC13F1EBFFF814F06C
+13E06C13C0EB3F00182F75AE27>105 D<EA7FFC487EA3127FEA007CA213FCA25BA21201
+A25BA21203A25BA21207A25BA2120FA25BA2121FA290C7FCA25AA2383E0180EB03E0EA7E
+07A2007C13C0130FA2387E1F80EA7FFF6C13005BEA0FFCEA03F0132E71AD27>108
+D<EB03F8EB0FFEEB3FFF49138048B512C03803FE1F3907F807E013F0380FE003D81FC013
+F01380EA3F00A2127E15E0127CA2140712FCEC0FC0A2EC1F80143F007CEB7F00007E13FE
+1301383F87FCEBFFF86C13E06C5B6C90C7FCEA01FC1C20779F27>111
+D<90387F01F83901FF87FE4890B5FC000F15804815C0D83FC3130FEB01FC007E141FEB00
+F8EAFC01A200F801F013800030EC0F00D8000390C7FCA25CA21307A2003CEBC003007EEC
+07C0D8FE0F130FA2ED1F80011F133F00FCEC7F0090387FE0FFB65A6C5C01FD13F0D81FF0
+5B260FC03FC7FC22207A9F27>120 D E
+%EndDVIPSBitmapFont
+%DVIPSBitmapFont: Fd cmbxti10 6 1
+/Fd 1 66 df<15F0A21401A214031407A24A7EA2141F143F143B1473A214E31301ECC3FC
+EB03831481EB0701130F130E131CEB1FFF5B5B90387001FEEBE000A2485A485A12073AFF
+F81FFFF0A216E024237CA22B>65 D E
+%EndDVIPSBitmapFont
+%DVIPSBitmapFont: Fe cmbxti10 9 33
+/Fe 33 122 df<EEFFF0030F13FE033FEBFF8092397F801FC09239FE0007E04A48130F4A
+48131F0207143F5D140F18C0A24A48EB0F0094C7FCA3143F5DA3017FB7FC90B8FCA26D5D
+9039007F8001A2160302FF5C1500A216075F5B5C160F5FA30103141F4A5CA218F0EE3FE1
+0107EDC1E05CA2EFC3C0A2010F15874A158093381FCF0070B4FCEE07FC4948EB01F893C8
+FCA3001E5BEA7FBF5C12FFA291CAFC137E12FE485AEA7FF8EA3FE0EA0F80344581B432>
+12 D<EEFFC003079038F07F80031FEBFCFF92387F807E9226FE00FE1300020149B5FC15
+FC02035B60EC07F882EE00F3020FEC03FC5D1707A260141F170F5D013FB75AA25B7F903B
+003FC0001FE0A2173FA2027F5D5D177FA260A202FF14FF92C7FC95C7FCA25E5B4A5C180F
+04035B181E010315FC5C60A2EFF87C187849486D6C5AEE00FF715AEF1F804A91C8FC130F
+A2001E5BEA7F8FA238FF9FC0A25C49CBFC12FEEAFC7EEA7FFCEA3FF0EA0FC0394582B435
+>I<D801E013F03907F803FC000F1307391FFC0FFEA3003F131FA2001F130FA23907B803
+DC390038001C0178133C0170133801F01378491370000114F03903C001E0A239078003C0
+390F000780001EEB0F0048131E00F8137C48137800C013601F1A72B32E>34
+D<387FFFF0B512F8A214F0A314E0150779931F>45 D<EA0780EA1FE0123F127F13F0EAFF
+E0A3EA7FC01380EA1E000C0B788A1B>I<0107B712FE5BA27F903A000FFC0007021F1401
+4B1300187EA2023F153C5DA3147FEDE0071780040F137C02FFEC007803C014384C1300A2
+49143EED80FE15FFA2495CA21501ED007C4914784A15E018F0EEF801010F02F013E04A14
+03047013C0EE0007131F4AEC0F80A2EF1F00013F5D4A143E17FE1601017FEC07FC4A133F
+007FB75AB8FCA26C5E37337CB239>69 D<0107B6FC5BA26D5C9026000FFCC7FC141F5DA3
+143F5DA3147F5DA314FF5DA35B5DA35B92C8FCA35B4A1438173C177C010F15785C17F817
+F0011F14015CEE03E01607013F15C04A130F161FEE7F80017FEB01FFECE007007FB71200
+A2B8FC6C5D2E337CB234>76 D<0003B812C05AA25AD9FC03EB807F01E09138001F80D81F
+C0150F495A1300003E5CA2003C010F1500A2007C5C1278021F5C00F8161E485C0070160E
+C7003F91C7FCA25DA2147FA25DA214FFA25DA25BA25DA25BA292C9FCA25BA25CA2130FA2
+5C007FB6FCB77EA26C92C8FC323273B13B>84 D<0107B539F83FFFFC4D13FEA219FC903C
+000FFE0003FE0018F80207EC07E06F5C170F6E6D485A4DC7FC177E6E6D5AEEC1F86EEBE3
+F0EEE7E0EEEFC06FB45AA26F90C8FC5E5E151FA2150F82151F4B7EA25D92B57EEC01FBDA
+03F17FEC07E1EC0FC1DA1F807F4A5A027E6D7E5CA249486D7E495A49486D7E495A495A49
+C76C7E48B4FCB5D8F803B512FC14FC14F8A23F337BB241>88 D<B60107B5FC6F5A150070
+13FE000101C09038003F80EF7E006E5C6C4B5A4C5A6E5C017F14074C5A6D6C495A4CC7FC
+6E137E011F147C16FC6E485A010F495A4B5A6E485A6D495AA26D01BFC8FC15FE5D6D5B5D
+5D7F5D5DA25BA292C9FCA25BA25CA21307A25CA2130FA2000FB512F85AA27E383370B241
+>I<010C1306011E130F017C133E49137C484813F84913F03903C001E039078003C0390F
+000780000E1400001E5B001C130E003C131E0038131C0078133C3977C03BE0397FE03FF0
+01F013F800FF137FA4397FE03FF0A2393F801FC0391F000F80201A6EB32E>92
+D<14FE903807FF80011F13CE90393F83FF80EBFF0148487E485AA248481400120F5B001F
+5B5DEA3FE0A21403007F5C13C0A2140700FF5C1380163C020F137CEDF078A2EA7F00021F
+13F01380003FEB3FE102FF13E03A1FC1F7F3C0390FFFE3FF0003018113003900FE007E26
+2379A12C>97 D<EB3F80380FFFC0A25CA2C6FCA291C7FCA25AA25BA21203A25BA2120714
+7F9038FBFFC090B512F048EB83F89038FE01FC01FC13FEEBF800485A15FF5BA2003F5BA2
+13C0A2007F5B15FE1380A2140700FF14FC1300A2EC0FF8A215F06CEB1FE0A2EC3FC06CEB
+7F80903880FF00381FC3FC6CB45A000313E0C690C7FC203579B328>I<EC3FC0903801FF
+F0010F13FC90381FE07E90387F803E9038FF00FE3901FE01FFEA03FC0007EB03FEEA0FF8
+13F0001FEB01FCEC00F048481300A3127F5BA4485AA3127F150C150E151F003F147E6D13
+FC001FEB03F8390FF01FE06CB512800001EBFE0038003FF0202379A128>I<ED01FCED7F
+FEA216FCA21507A216F8A2150FA216F0A2151FA216E0A2153F14FE903907FFBFC0011F13
+FFEB3F83EBFF0148486C1380485AA2485A000F15005B001F5BA2D83FE05BA21403127F01
+C05BA2140712FF01805B163C020F137C167815F0EA7F00021F13F01380003FEB3FE102FF
+13E03A1FC1F7F3C0390FFFE3FF0003018113003900FE007E273579B32C>I<EC7F809038
+07FFE0011F13F8EB7FC19038FF00FC4848137C485A485A485A121F4913FC003F14F81403
+397FC007F0ECFFE090B51280B5EAFC0014800180C7FCA390C8FCA41518151C153E6C14FC
+90388001F8393FC007F0391FE03FC06CB51200000313FC38007FE01F2378A128>I<ED07
+E0ED1FF8ED7FFCEDFC3E020113FE913803F9FFA2913807FBFEA2EC0FF3EDF1FCEDF0F016
+00141F5DA5143F013FB512F05BA39039007FC0005DA414FF92C7FCA55B5CA413035CA413
+075CA5495AA45C131F121E387F9FC0A238FFBF80A291C8FC133FEAFE7E485AEA7FF86C5A
+EA0FC0284581B41E>I<EC1FE0EC7FF8903903FFFCE0903907F83FF890381FE01F90383F
+C00FEB7F80A2EBFF004815F05B0003141FA2484814E0A2153F120F4914C0A2157FA24914
+80A215FFA21600A25C00075B6D485A3803FC1F6CB5FC38007FFB90380FE3FCEB00031407
+A25D121E387F800F5D12FF4A5A143F49485A48495AD903FEC7FC387FFFF8001F13E00003
+90C8FC25327CA128>I<EB0FE03803FFF0A25CA2EA001F133F5CA3137F5CA313FF91C8FC
+A348EB0FF09038FE3FFC91B5FC9039FFF07F8048EBC03F028013C014005B485A5BA2157F
+000F15805BA215FF001F15005B5C5D123FEBC003EDFC0F161F007F0107131E018013F816
+3E163C00FFECF07C0100147816F0EDF1E048903803FFC0486D138000789038007E002835
+7BB32C>I<1470EB01FC13031307A4EB03F8EB01E090C7FCAA137C48B4FC4813C0EA078F
+380F0FE0121E123EEA3C1F127CEA783F14C012F8137F00001380A213FF14005A5BA21203
+5B141E0007133EEBF83C120FEBF07C147814F8EBE0F0EBE1E0EA07E33803FFC06C1300EA
+007C17367BB41B>I<EB0FE03803FFF0A25CA2EA001F133F5CA3137F5CA313FF91C8FCA3
+48EC0F8049EB3FC0EDFFE0EC01F10003903803C3F09038FC0F0FEC0E1F141C0007903838
+3FE0EBF87014E09039F9C01FC03A0FFF800F0091C8FC5B7F4813F014FCEBEFFEEBE1FFD8
+3FE07FEBC07F16F01581007F15E01380A2ED83C012FF0100EB8780143FED8F0048EB1FFE
+48EB07FC0078EB01F024357BB328>107 D<EB1FC03803FFE05A14C07EEA007FA21480A2
+13FFA21400A25AA25BA21203A25BA21207A25BA2120FA25BA2121FA25BA2123FA25BA212
+7FA25BEB8780EAFF8F1400130FA25B131E12FE5BEA7F7C6C5A6C5AEA07C013357AB316>
+I<01F890393FC001FE3D03FE01FFF007FF802607FF07D9FC1F13E03D0F3F8FC1FE3E0FF0
+271E1FDF00EBF80702FCD9FFF07F003C4914E0494814C0007C491480007816005CD8F87F
+49140F4C5C00001380A201FF0103141F6102005B183F4802075DA2494A137FF181E00003
+020F158306FF13C0494A140319070007021F1680F0FE0F494A1500191E193E494AEB7FF8
+725AD803C06DC7EA0FC043237BA147>I<01F8EB7F803A03FE01FFE02607FF0713F83A0F
+3F8F83FC391E1FFE0102FC7F003C13F8EB3FF0007C13E0007813C0A2D8F87F13035E0000
+1380A201FF13075E1400150F485DA249131FEEE078000316F8033F13F04914C016C10007
+16E016834915C0EE8780EE8F0049EB1FFE6F5AD803C0EB03F02D237BA131>I<EC3FE090
+3801FFF8010F13FE90381FE07F90397F803F809039FF001FC0484814E0485A4848130F00
+0F15F049131F121FA2485AA2153F007F15E05BA2157F16C0485AA2EDFF80007F15005C5D
+4A5A003F495A6D485A001F495A390FF07FC06CB5C7FC000113FC38003FE0242379A12C>
+I<011FEB3F8090397FC0FFE0D9FFF313F83A01E3F7E1FC3A03C3FF80FE4B7E260783FE7F
+EB87FC000F4914801307A2D81F0F14FFA200005BA2011F5B170014E0A2013F5B5E14C0A2
+017F495AA202805B4B5A13FF4B5A4B5A6E485A486D48C7FCECFFFC4913F0EC3F80000390
+C9FCA25BA21207A25BA2120FA2B57EA429317EA12C>I<3901F003F83907FC0FFE3A0FFF
+3FFF803A1F3F7C0FC0001EEBF807003EEBF01F003C9038E03FE0EB7FC0007CEC7FC00078
+1380A2D8F8FFEB3F80ED1E00C690C8FCA25AA25BA21203A25BA21207A25BA2120FA25BA3
+5BA2EA078023237BA125>114 D<EB01FE90380FFF804913E090387E03F0EBFC019038F8
+03F83801F007A20003EB0FF0A39038F807C001FFC7FC14F014FC6C13FF15806C14C0133F
+010F13E0EB007F000E131F383F800F007F130712FF15C0A2EC0F80130000FCEB1F00007C
+133E007F13FC6CB45A000F13E0000190C7FC1D237AA124>I<1307EB1FC0133FA3137FA2
+1480A213FFA21400A25AA2B512FC14FEA214FC3803FC00A21207A25BA2120FA25BA2121F
+A25BA2123FA25B141E007F133E143CEB807C147814F8EB81F0EB01E0EB07C0383F8F8038
+1FFF00EA0FFCEA03F0173179AF1D>I<137E48B46C13F0489038C003F83807CFE0D80F0F
+1307001F13F0121E003C140F011F5C007813E0A2D8F83F131F02C05BEA007F1480153F01
+FF5C1400A2157F485D5BEE83C0EDFF87EE07805BA2EE0F005C6D48485A0207131E6C6C48
+6C5A90397FFF3FFC90391FFC1FF0903907F007E02A237BA12E>I<017EED078048B46C90
+38F00FE048903AC003F81FF02607CFE0143FD80F0F1307001F13F0121E003C020F131F01
+1FECF00F007801E014071703D8F83F131F02C09038E001E0EA007F1480033F130301FF02
+C013C01400A2037F130748038013805BA2EF0F00A24C5A49151E6D153E9238FF803C4A5C
+D800FF15F8D97F87EBC1F0903A3FFF8FFFE0010F01071380902703FC00FEC7FC34237BA1
+39>119 D<90391FC00FC090397FF83FF03A01FFFC7FF83A03E0FEF87C3907C07FF0D80F
+00EBE1FE4814C3123E003CECC7FC007C1487127800F89038FF83F8ED81E0C790C7FCA25B
+5CA313035CA2001E153CD87F87147C167800FF5B16F8018FEB01F0010F14E0D8FE1F1303
+00FCEC07C090397DFC1F803A7FF8FFFE00393FF03FF83907C00FE027237BA12A>I<137E
+48B46C1378489038C001FC3807CFE0D80F0F1303001F13F0121E003C1407011F14F80078
+13E0A2D8F83F130F02C013F0EA007F1480151F01FF14E01400A2153F4815C05BA2157F16
+805BA215FF16006D5A00005B6D5A6DB45A131FEB07F9EB00035DEA0780390FE007F8121F
+003F495AA24A5A49485A4A5AD900FEC7FC381F83FC380FFFF06C13C0C648C8FC26327BA1
+2A>I E
+%EndDVIPSBitmapFont
+%DVIPSBitmapFont: Ff cmbx6 6 2
+/Ff 2 50 df<EB7FC03801FFF0000713FC380FE0FE381F803F393F001F80A2007EEB0FC0
+A400FE14E0AD007E14C0A2007F131F6C1480A2391F803F00380FE0FE6CB45A6C5B38007F
+C01B227DA023>48 D<130E133EEA01FE12FFA212FE1200B3A6387FFFFEA317217BA023>
+I E
+%EndDVIPSBitmapFont
+%DVIPSBitmapFont: Fg cmcsc10 8 27
+/Fg 27 124 df<EB3FC0EBFFF03803E07C48487E48487E497E001EEB0780A2003E14C0A2
+48EB03E0A500FC14F0B0007C14E0A3007E1307003E14C0A2001E1480001F130F6C14006D
+5A3807C03E3803F0FC3800FFF0EB3FC01C2D7CAB25>48 D<130C131C137CEA01FC12FFEA
+FE7C1200B3B113FE387FFFFEA2172C79AB25>I<EB7F803801FFF0380781FC380E007F00
+18EB1F805A0070EB0FC00060EB07E0127800FC14F07E1403A3007C1307C7FC15E0A2140F
+15C0EC1F8015005C147E14785C495A495A495A49C7FC131C5B5B4913305B485A48C71260
+12064814E0001FB5FC5A4814C0B6FCA21C2C7CAB25>I<EB3FC03801FFF03807C0FC380E
+003E487F1580123FEC0FC0138013007E000E131FC71380A3EC3F00143E5C5CEB03E0EBFF
+8080EB00F8143C141FEC0F8015C0A2EC07E0A215F01238127C12FEA34814E00078130F00
+6014C06C14800038EB1F00001E133E380780FC3801FFF038007FC01C2D7CAB25>I<140E
+A2141E143EA2147E14FEA2EB01BE1303143E1306130E130C131813381330136013E013C0
+EA0180120313001206120E120C5A123812305A12E0B612FCA2C7EA3E00A9147F90381FFF
+FCA21E2D7DAC25>I<000CEB0180380F800F90B512005C5C14F014C0D80C7CC7FC90C8FC
+A8EB1FC0EB7FF8380DE07C380F801E497E000EEB0780000C14C0C7FCEC03E0A315F0A312
+38127C12FCA215E05A0060130715C0007014800030130F6CEB1F00000E133E380780F838
+01FFE038007F801C2D7CAB25>I<1230123C003FB512F8A215F05A15E00070C712C00060
+EB0180A248EB030014065CC7FC5C5C5CA25C13015C130391C7FC5BA2130EA2131EA2133E
+133CA2137CA513FCA813781D2E7BAC25>55 D<EB3FC0EBFFF03801E07C3807801E48487E
+000EEB07805AEC03C0123CA3123EA2003FEB0780EA1FC09038E00F00380FF81E6C6C5AEB
+FF7000015B7EEB3FF8EBFFFC3803C7FE390783FF80EA0E00001EEB3FC048EB1FE0481307
+EC03F0481301A21400A415E00078130115C06C13036CEB07806CEB0F003807E03C3801FF
+F838003FC01C2D7CAB25>I<EB3FC0EBFFF03803E0783807801C48487E48130F001EEB07
+80123E4814C0A2140300FC14E0A415F0A4007C1307A37E001E130F001F131B7E3807C073
+3803FFE3C6EB83E0EB0003A3EC07C0A21580001E130F003F1400A2141E5C003E5B00185B
+380E03E03807FF80D801FEC7FC1C2D7CAB25>I<EC0380A34A7EA24A7EA34A7E141BA2EC
+31F8A2EC71FC1460A2ECE0FEECC07EA249487EA349486C7EA249800106130FA249801507
+A2011FB57EA29038180003496D7EA201708001601300A24980167EA2484880A2486C1580
+D80FE0EC7FC0D8FFFC903807FFFEA22F2F7DAE36>65 D<B512F0A23803FC006C5AB3B3A3
+487EB512F0A2142D7DAC1B>73 D<B612F815FF3A03F8001FC00001EC07E0ED01F8150016
+FC167EA2167FA6167EA216FC16F81501ED07E0ED1FC090B6120015F801F8C8FCB2487EB5
+12F0A2282D7DAC31>80 D<14E0A2497EA3497EA3EB067CA2EB0E7EEB0C3EA2497EA3496C
+7EA201707FEB6007A2496C7E90B5FC4880EB8001A2D803007F1400A20006147CA2000F14
+7E123F3AFFC003FFE0A223237EA229>97 D<903803F80290381FFE0690387E038E3901F8
+00DED803E0137E4848133E485A48C7121EA2003E140EA2127E007C1406A212FC1500A700
+7C1406A2127E123E150C7EA26C6C13186C6C13306C6C1360D801F813C039007E03809038
+1FFF00EB03F81F247DA227>99 D<B512FCECFF80390FC00FE00007EB01F06E7E157C81A2
+81A2ED0F80A316C0A91680A2151F1600151E153E5D5D4A5A000FEB07E0B6128002FCC7FC
+22227EA129>I<B612F8A2380FC0010007EB007815381518151CA2150C140CA31500141C
+143CEBFFFCA2EBC03C141C140CA21503A214001506A3150EA2151E153E000F14FCB6FCA2
+20227EA125>I<B612F8A2380FC0010007EB007815381518151CA2150CA2140CA21500A2
+141C143CEBFFFCA2EBC03C141C140CA491C7FCA7487EB5FCA21E227EA124>I<EAFFFEA2
+EA0FE0EA07C0B3AAEA0FE0EAFFFEA20F227EA114>105 D<D8FFC0ECFFC06D5B000FEDFC
+0000075DD806F0EB0378A301781306A26D130CA36D1318A26D1330A39038078060A39038
+03C0C0A2903801E180A3903800F300A2147EA3000F133CD81F8014FCD8FFF090380FFFC0
+14182A227DA132>109 D<3AFFC001FFE013E03A07F0003F00151ED806F8130C7F137C7F
+7FA2EB0F80EB07C014E01303EB01F014F81300147C143EA2141FEC0F8C15CC1407EC03EC
+15FC14011400157CA2000F143C486C131CEAFFF0150C23227EA129>I<EB07F8EB3FFF90
+38FC0FC03901F003E048486C7E48486C7E4848137C48C77EA2003E80A2007E1580007C14
+0FA200FC15C0A8007C1580007E141FA3003E15006C143EA26C6C5B6C6C5B6C6C485A6C6C
+485A3900FC0FC0D93FFFC7FCEB07F822247DA22A>I<B512FCECFF80390FC00FC00007EB
+03E0EC01F0EC00F8A215FCA515F8A2EC01F0EC03E0EC0FC090B51280ECFC0001C0C7FCAC
+487EEAFFFEA21E227EA125>I<B512F814FF390FC00FC00007EB03E06E7E81140081A45D
+14015D4A5AEC0FC090B5C7FC14FCEBC01F6E7E6E7E140381A481A3163015F8380FE0013A
+FFFE00FC60ED7FC0C8EA1F8024237EA128>114 D<3801F8083807FF18381E07B8383C01
+F8383800785A143812F01418A36C13007E127EEA7FE0EA3FFE381FFF806C13C0000313E0
+38007FF0EB07F81301EB007CA2143C12C0A46C133814786C137000FC13E038EF01C038C7
+FF803880FE0016247DA21E>I<007FB6FCA2397C03E01F00701407006080A200E01580A2
+00C01401A4000091C7FCB3497E48B512C0A221227EA127>I<3AFFFE01FFE0A23A0FE000
+3F006C48131E150CB3A400035C7F12015D6C6C5B01785B90383E0380D90FFFC7FCEB01F8
+23237EA129>I<B712C0A222027F9225>123 D E
+%EndDVIPSBitmapFont
+%DVIPSBitmapFont: Fh cmsy7 7 1
+/Fh 1 14 df<913801FFC0021F13FC91B67E499038007FC0D907F0EB07F0D91F80EB00FC
+49C8127E017C151F01F0ED078048486F7E48486F7E48486F7E90CA1270481778001E8300
+1C171C003C171E0038170E0078170F007083A200F01880481703A96C170700701800A200
+785F0038170E003C171E001C171C001E173C6C5F6C17706D16F06C6C4B5A6C6C4B5A6C6C
+4B5A017C031FC7FC013F157E6D6C5CD907F0EB07F0D901FFEB7FC06D90B55A021F01FCC8
+FC020113C039357CA842>13 D E
+%EndDVIPSBitmapFont
+%DVIPSBitmapFont: Fi cmr8 8 75
+/Fi 75 125 df<9138FF807E01079038E1FF80903A1F807FC3C0D93E00EB87E049EBFF07
+4913FE485A00039138FC018049017CC7FCAAB712FCA22703E0007CC7FCB3A6486C13FE3A
+7FFF0FFFF0A22B2F7FAE29>11 D<003C13F0387E01F838FF03FCA2EB83FEA2EA7F81383D
+80F600011306A30003130EEB000CA248131C00061318000E13384813704813E0387001C0
+0060138017157EAD23>34 D<123C127EB4FCA21380A2127F123D1201A312031300A25A12
+06120E5A5A5A126009157AAD14>39 D<13031307130E131C1338137013F0EA01E013C012
+03EA0780A2EA0F00A2121EA35AA45AA512F8A25AAB7EA21278A57EA47EA37EA2EA0780A2
+EA03C0120113E0EA00F013701338131C130E1307130310437AB11B>I<12C07E12707E7E
+7E120FEA0780120313C0EA01E0A2EA00F0A21378A3133CA4131EA5131FA2130FAB131FA2
+131EA5133CA41378A313F0A2EA01E0A2EA03C013801207EA0F00120E5A5A5A5A5A10437C
+B11B>I<123C127EB4FCA21380A2127F123D1201A312031300A25A1206120E5A5A5A1260
+09157A8714>44 D<B512C0A412047F9018>I<123C127E12FFA4127E123C08087A8714>I<
+15C0140114031580A214071500A25C140EA2141E141CA2143C143814781470A214F05CA2
+13015CA213035C130791C7FCA25B130EA2131E131CA2133C1338A21378137013F05BA212
+015BA212035BA2120790C8FC5A120EA2121E121CA2123C1238A212781270A212F05AA21A
+437CB123>I<EB3FC0EBFFF03803E07C48487E48487E497E001EEB0780A2003E14C0A248
+EB03E0A500FC14F0B0007C14E0A3007E1307003E14C0A36CEB0F806C14006D5A3807C03E
+3803F0FC3800FFF0EB3FC01C2D7DAB23>I<130C133C137CEA03FC12FFEAFC7C1200B3B1
+13FE387FFFFEA2172C7AAB23>I<EB7F803801FFF0380780FC380E003F48EB1F8048EB0F
+C05A0060EB07E012F000FC14F07E1403A3007C1307C7FCA215E0140F15C0141F1580EC3F
+00147E147C5C495A495A495A495A011EC7FC5B5B4913305B485A4848136048C7FC000E14
+E0001FB5FC5A4814C0B6FCA21C2C7DAB23>I<EB3FC03801FFF03807C0FC380E007E487F
+EC1F80003F14C0A2EB800F1300A2000C131FC7FC1580A2EC3F00143E5C5CEB03F0EBFFC0
+14F0EB00FC143FEC1F8015C0140F15E0A2EC07F0A21238127C12FEA3EC0FE012F8006014
+C00070131F6C1480001EEB3F00380780FC3801FFF038007FC01C2D7DAB23>I<140EA214
+1E143EA2147E14FEA2EB01BE1303143E1306130E130C131813381330136013E013C0EA01
+80120313001206120E120C5A123812305A12E0B612FCA2C7EA3E00A9147F90381FFFFCA2
+1E2D7EAC23>I<000CEB0180380FC01F90B512005C5C14F014C0D80C7EC7FC90C8FCA8EB
+1FC0EB7FF8380DE07C380F801F01001380000E130F000CEB07C0C713E0A2140315F0A412
+7812FCA448EB07E012E0006014C00070130F6C14806CEB1F006C133E380780F83801FFE0
+38007F801C2D7DAB23>I<EB03F8EB0FFE90383E0780EBF8013901F007C03803E00FEA07
+C0EA0F80A2391F00078091C7FC123EA2127EA2127CEB0FC038FC3FF0EBF07C38FDC01EB4
+487E01001380EC07C04814E0A214034814F0A4127CA3127EA2003E14E01407121E001F14
+C06CEB0F803907801F003803C03E6C6C5A38007FF0EB1FC01C2D7DAB23>I<1230123C00
+3FB512F8A215F05A15E039700001C000601480140348EB0700140E140CC7121C5C143014
+705C495AA2495AA249C7FCA25B130E131EA2133EA3133C137CA413FCA913781D2E7CAC23
+>I<EB1FC0EBFFF03803E07C3807801E48487E001EEB0780A248EB03C0A4123E1407003F
+1480381FC00F01E01300EBF81E6C6C5A3807FFF86C13E0C6FCEB3FF8EBFFFC3803C7FFD8
+07831380D81F0013C0001E133F48EB1FE0007C13070078EB03F012F84813011400A46C14
+E000781301007C14C0003C13036CEB0780390F800F003807E03C3801FFF038003FC01C2D
+7DAB23>I<EB3F80EBFFF03803E0783807C03E48487E48487E003E14801407007E14C012
+7C00FC14E01403A315F0A5007C1307127EA2003E130F7E6C131F3807803B3803E0F33800
+FFC390383F03E013001407A215C0A2140F001E1480003F14005C143E143C003E5B001C5B
+380E03E03807FF80D801FEC7FC1C2D7DAB23>I<123C127E12FFA4127E123C1200AD123C
+127E12FFA4127E123C081D7A9C14>I<123C127E12FFA4127E123C1200AD123C127E12FE
+12FFA3127F123F1203A312071206A2120E120C121C1218123812701260082A7A9C14>I<
+B812FCA3CBFCADB812FCA32E137C9937>61 D<4A7E4A7EA34A7EA24A7EA3EC1BF81419A2
+EC30FCA2EC70FEEC607EA24A7EA349486C7EA2010380EC000FA201066D7EA3496D7EA201
+1FB57EA29038180001496D7EA349147EA201E0147F4980A20001ED1F801203000716C0D8
+0FF0EC3FE0D8FFFC0103B5FCA2302F7EAE35>65 D<B612FCEDFF803A03F8000FC00001EC
+03F06F7E6F7E82167E167FA6167E16FE5E4B5A4B5AED0FE0ED7F8090B6C7FC16E09039F8
+0003F0ED01FC6F7E167F821780161F17C0A61780163F17005E16FEED03FC0003EC0FF0B7
+12C04BC7FC2A2D7DAC32>I<DA1FF013C09138FFFE01903903F00F8390390F8001E3013F
+C71277017C143F4848141F4848140F48481407A248481403121F491401123F90C8FC4815
+00A300FE1600AB127F17C0A27E7F001F15016D1580120F6C6C1403EE07006C6C14066C6C
+140ED8007C5C013F147890390F8001E0903903F00FC0902600FFFEC7FCEC1FF02A2F7CAD
+33>I<B612F815FF3A03F8001FE00001EC03F0ED00F8167E82EE1F80160F17C0EE07E0A2
+EE03F0A217F81601A317FCAA17F8A3EE03F0A217E0160717C0160FEE1F80EE3F00167E5E
+ED03F00003EC1FE0B7128003F8C7FC2E2D7DAC36>I<B712FEA23903F800010001EC003E
+828282A282A3178016011518A293C7FCA31538157815F890B5FCA2EBF800157815381518
+A21760A392C712C0A4160117801603A21607160F163F0003913801FF00B8FCA22B2D7EAC
+30>I<B712FCA23903F800030001EC007C163E161E160EA21606A3160716031518A21600
+A31538157815F890B5FCA2EBF800157815381518A592C7FCAB487EB512F8A2282D7EAC2E
+>I<DA1FF013C09138FFFE01903903F00F8390390F8001E3013FC71277017C143F484814
+1F4848140F48481407A248481403121F491401123F90C8FC481500A300FE1600A992381F
+FFFEA2007F9138001FE0EE0FC0A27E7F121F7F120F6C7EA26C7E6C6C141FEA007C013F14
+3FD90F8013F3903903F007C10100B51200DA1FF813002F2F7CAD37>I<B539F03FFFFCA2
+D803FCC713006C48147EB290B612FEA201F8C7127EB3486C14FFB5D8F03F13FCA22E2D7D
+AC35>I<B512F0A23803FC006C5AB3B3A3487EB512F0A2142D7EAC19>I<90387FFFF0A201
+001300147EB3AD123812FEA314FE5C1278387001F86C485A381E07E03807FF80D801FCC7
+FC1C2E7DAC24>I<B500F0EB7FFEA2D803FCC7EA1FF06C48EC0FC01700161E16385E5E4B
+5A4B5A4BC7FC150E5D5D15F0EC01C04A5A4A7E4A7E141F4A7EEC73F8ECE1FCEBF9C09038
+FF80FE9038FE007F497F49806F7E6F7E1507826F7E6F7EA26F7E167F821780EE1FC017E0
+486CEC3FF0B5D8F001B5FCA2302D7DAC37>I<B512F8A2D803FCC8FC6C5AB3A7160CA416
+18A41638A2167816F81501ED07F00003141FB7FCA2262D7EAC2C>I<D8FFF8923807FFC0
+6D5D0003EFF00000015F01BE151BA2019F1533A3D98F801463A2D987C014C3A2D983E0EB
+0183A3D981F0EB0303A2D980F81306A3027C130CA26E1318A36E1330A291380F8060A291
+3807C0C0A3913803E180A2913801F300A3EC00FEA2157C487ED80FF04B7EB5D93801B512
+C0A23A2D7DAC41>I<D8FFF8903803FFFC7F00019138003FC06DEC0F006D1406EBBF80A2
+EB9FC0EB8FE0138780EB83F8138180EB80FE147E147FEC3F80EC1FC0140F15E0EC07F014
+0315F8EC01FC140015FE157FED3F86151F16C6ED0FE6150716F6ED03FE1501A21500167E
+163EA2486C141ED80FF0140EB5FC16062E2D7DAC35>I<EC3FF0903801FFFE903907E01F
+8090391F8007E090393E0001F001FCEB00FC4848147E4848804848EC1F8049140F000F16
+C04848EC07E0A248C8EA03F0A24816F8A2007E1501A200FE16FCAA007FED03F8A36C16F0
+6D1407001F16E0A26C6CEC0FC06D141F000716806C6CEC3F006C6C147E6C6C5C017E495A
+90391F8007E0903907E01F80902601FFFEC7FC9038003FF02E2F7CAD37>I<B612FCEDFF
+803A03F8000FE00001EC03F0ED00F882167E167F821780A617005E167E5E5EED03F0ED0F
+E090B6128003FCC7FC01F8C9FCB2487EB512F0A2292D7EAC30>I<EC3FF0903801FFFE90
+3907E01F8090391F8007E090393E0001F001FCEB00FC4848147E4848804848EC1F804914
+0F000F16C04848EC07E0A2003F16F090C812034816F8A3007E150100FE16FCAA007E16F8
+007F1503A26C16F0A26C6CEC07E0A23B0FC007800FC0EC1FE03B07E038701F803B03F070
+183F003A01F8601C7ED800FCEB0CFC017EEB0FF8D91FF013E0903907F81F800101B5EA00
+0C9038003FF79138000780171CED03C0EEE03CEEF078EEFFF88117F0A26F13E0EE7FC0EE
+1F002E3B7CAD37>I<B612C015FC3903F8007F0001EC0FC06F7E6F7E6F7E82150082A55E
+15015E4B5A4B5A4B5A037FC7FC90B512FC15F09038F800FC153E6F7E150F826F7EA582A5
+170316F815031707486C903801FC0EB539F000FE1CEE3FF8C9EA07E0302E7DAC34>I<90
+383F80303901FFF0703807C07C390F000EF0001E13074813034813011400127000F01470
+A315307EA26C1400127E127FEA3FE013FE381FFFE06C13FC6C13FF00011480D8003F13E0
+13039038003FF0EC07F81401140015FC157C12C0153CA37EA215787E6C14706C14F06CEB
+01E039F78003C039E3F00F0038E07FFE38C00FF01E2F7CAD27>I<007FB712F8A2903900
+0FC003007C150000701638A200601618A200E0161CA248160CA5C71500B3A94A7E011FB5
+12E0A22E2D7EAC33>I<B539F003FFFCA2D803FCC7EA3FC06C48EC0F001606B3AB160E00
+00150C7F161C017C1418017E14386D5C6D146090390F8001E0903907E00380902601F80F
+C7FC9038007FFCEC0FF02E2E7DAC35>I<B500C090380FFFC0A2D807FCC73803FE006C48
+EC00F800015E5F6C7E5F6D1401017E5DA26D4AC7FCA26E5B011F140680010F5CA26D6C5B
+A26E133801031430A26D6C5BA26E13E001005C8091387E0180A26E48C8FCA21583EC1F86
+A2EC0FCCA215FC6E5AA26E5AA36E5AA26E5A322E7FAC35>I<B53C801FFFF001FFF8A227
+07FC000190C7EA3FC0D803F06D48EC1F00047E140EA26C6C027F140CA26D171C0000DBDF
+801318A26D1738017E9026018FC01330A2017F17706D90260307E01360A2028016E0011F
+90260603F05BA202C01501010F90260C01F85BA202E01503010790261800FC90C7FCA202
+F05D010349EB7E06A202F8150E010149EB3F0CA202FC151C010049EB1F98A202FE15B8DA
+7F80EB0FF0A2023F5D92C71207A26E5D021E1403A2020E5D020C1401452E7FAC48>I<3B
+7FFFE003FFF8A2000390C713806C48EC7E000000157C017F14786D14706E5B6D6C5B6D6C
+485A15036D6C48C7FC903803F80601015BECFC1C6D6C5AEC7F305DEC3FE06E5A140F816E
+7E81140DEC1DFCEC38FEEC307F14609138E03F8049486C7EEC800FD903007F496D7E010E
+6D7E130C011C6D7E496D7E49147E167F01F0EC3F80000316C0D80FF8EC7FE0D8FFFE0103
+B5FCA2302D7EAC35>I<B500C090380FFFC0A2D807FEC73801FE006C48EC00F8000116E0
+6C6C5D1601017F4A5A6D6C91C7FC5E6D6C130E6D6C130C5E6D6C13386D6C13305E6D6C13
+E06D6C5B4B5AEC7F03DA3F83C8FC1586EC1FCEEC0FEC15F814076E5AB04A7E49B512C0A2
+322D7FAC35>I<0003130C48131C000E13384813704813E0003013C0EA700100601380A2
+EAE00300C01300A300DE137800FF13FCEB83FEA2EA7F81A2383F00FC001E1378171577AD
+23>92 D<13FF000713C0380F01F0381C00F8003F137C80A2143F001E7FC7FCA4EB07FF13
+7F3801FE1FEA07F0EA1FC0EA3F80EA7F00127E00FE14065AA3143F7E007E137F007FEBEF
+8C391F83C7FC390FFF03F83901FC01E01F207D9E23>97 D<EA07C012FFA2120F1207AC14
+FE9038C7FF809038CF03E09038DC01F09038F8007C49137E49133E497F1680A2150F16C0
+A9ED1F80A216005D6D133E6D5B01B05B9038BC01F090380E07E0390607FF80260001FCC7
+FC222F7EAD27>I<EB1FE0EB7FFC3801F01E3803E0073907C01F80EA0F80EA1F005A003E
+EB0F00007E90C7FCA2127C12FCA9127EA215C07E6C130101801380380FC0033907E00700
+3801F03E38007FF8EB1FC01A207E9E1F>I<15F8141FA214011400ACEB0FE0EB7FF83801
+F81E3803E0073807C003380F8001EA1F00481300123E127EA25AA9127C127EA2003E1301
+7EEB8003000F13073903E00EFC3A01F03CFFC038007FF090391FC0F800222F7EAD27>I<
+EB1F80EBFFF03803E0783807C03E380F801E381F001FEC0F80123E007E130715C0127C12
+FCA3B6FCA200FCC8FCA5127EA2003E14C0123F6C1301390F80038001C013003803E00F38
+01F03C38007FF8EB1FC01A207E9E1F>I<EB03F0EB0FFCEB3E1EEB7C3F13F8EA01F0A238
+03E00C1400AAB512E0A23803E000B3A6487E387FFF80A2182F7FAE16>I<013F13F89038
+FFC3FE3903E1FF1E3807807C000F140C391F003E00A2003E7FA76C133EA26C6C5A000713
+78380FE1F0380CFFC0D81C3FC7FC90C8FCA3121E121F380FFFF814FF6C14C04814F0391E
+0007F848130048147C12F848143CA46C147C007C14F86CEB01F06CEB03E03907E01F8039
+01FFFE0038003FF01F2D7E9D23>I<EA07C012FFA2120F1207AC14FE9038C3FF809038C7
+03E09038DE01F013F8496C7EA25BA25BB2486C487E3AFFFE1FFFC0A2222E7EAD27>I<EA
+0780EA0FC0EA1FE0A4EA0FC0EA0780C7FCA8EA07C012FFA2120F1207B3A5EA0FE0EAFFFC
+A20E2E7EAD14>I<EA07C012FFA2120F1207ADEC1FFEA2EC0FF0EC07C05D020EC7FC5C5C
+5C5CEBC3C013C7EBCFE0EBDFF013F9EBF0F8497EEBC07E143E80816E7E14076E7E816E7E
+486C487E3AFFFE07FF80A2212E7EAD25>107 D<EA07C012FFA2120F1207B3B3A3EA0FE0
+EAFFFEA20F2E7EAD14>I<2607C07FEB07F03BFFC3FFC03FFC903AC783F0783F3C0FCE01
+F8E01F803B07DC00F9C00F01F8D9FF8013C04990387F000749137EA249137CB2486C01FE
+EB0FE03CFFFE0FFFE0FFFEA2371E7E9D3C>I<3807C0FE39FFC3FF809038C703E0390FDE
+01F0EA07F8496C7EA25BA25BB2486C487E3AFFFE1FFFC0A2221E7E9D27>I<EB1FE0EB7F
+F83801F03E3803C00F3907800780390F0003C04814E0003EEB01F0A248EB00F8A300FC14
+FCA9007C14F8A26CEB01F0A26CEB03E0A2390F8007C03907C00F803901F03E0038007FF8
+EB1FE01E207E9E23>I<3807C0FE39FFC7FF809038CF03E0390FDC01F03907F800FC4913
+7E49133E49133FED1F80A3ED0FC0A8151F1680A2ED3F00A26D137E6D137C5D9038FC01F0
+9038CE07E09038C7FF80D9C1FCC7FC01C0C8FCA9487EEAFFFEA2222B7E9D27>I<90380F
+E01890387FF8383801F81C3903E00E783807C007390F8003F8001F1301EA3F00A2007E13
+00A212FE5AA8127EA36C13017EEB8003380FC0073803E00E3801F03C38007FF0EB1FC090
+C7FCA94A7E91381FFFC0A2222B7E9D25>I<380781F838FF87FEEB8E3FEA0F9CEA07B813
+B0EBF01EEBE000A45BB0487EB5FCA2181E7E9D1C>I<3801FE183807FFB8381E01F8EA3C
+00481378481338A21418A27E7EB41300EA7FF06CB4FC6C13C06C13F0000113F838001FFC
+130138C0007E143EA26C131EA27EA26C133CA26C137838FF01F038E3FFC000C013001720
+7E9E1C>I<1360A413E0A312011203A21207121FB512F0A23803E000AF1418A714383801
+F03014703800F860EB3FE0EB0F80152A7FA81B>I<D807C013F800FF131FA2000F130100
+071300B21401A314033803E007EC0EFC3A01F81CFFC038007FF890391FE0F800221F7E9D
+27>I<3AFFFC01FFC0A23A0FE0007E000007147C15380003143015706C6C1360A26C6C5B
+A390387C0180A26D48C7FCA2EB3F07EB1F06A2EB0F8CA214DCEB07D8A2EB03F0A36D5AA2
+6D5A221E7F9C25>I<3BFFFC3FFE07FFA23B0FE003F001F801C09038E000F00007010114
+E0812603E00314C0A2913807F8012701F006781380A29039F80E7C030000D90C3C1300A2
+90397C181E06A2151F6D486C5AA2168C90391F600798A216D890390FC003F0A36D486C5A
+A36DC75A301E7F9C33>I<3AFFFC07FF80A23A0FF003FC000003EB01F0000114C06D485A
+000091C7FCEB7C06EB3E0E6D5A14B8EB0FB0EB07E013036D7E497E1307EB067C497EEB1C
+1F01387FEB700F496C7E6E7ED803C07F00076D7E391FE003FC3AFFF007FFC0A2221D7F9C
+25>I<3AFFFC01FFC0A23A0FE0007E000007147C1538000314306D137000011460A26C6C
+5BA2EBFC01017C5BEB7E03013E90C7FCA2EB1F06A2148EEB0F8CA2EB07D8A2EB03F0A36D
+5AA26D5AA2495AA2130391C8FC1278EAFC06A25B131CEA7838EA7070EA3FE0EA0F80222B
+7F9C25>I<003FB51280A2EB003F003C14000038137E00305BEA700100605B495A495A13
+0F00005B495A49C7FC5B137E9038FC0180EA01F8120313F03807E003EA0FC0001F140013
+8048485A007E5B00FE133FB6FCA2191D7E9C1F>I<B712C0A22202809223>I<BB12FCA246
+02809247>I E
+%EndDVIPSBitmapFont
+%DVIPSBitmapFont: Fj cmsy6 6 2
+/Fj 2 122 df<136013701360A20040132000E0137038F861F0387E67E0381FFF803807
+FE00EA00F0EA07FE381FFF80387E67E038F861F038E060700040132000001300A2137013
+6014157B9620>3 D<136013F0A81360A4387C63E0B512F0A2387C63E038006000A313F0
+B3A21360A7142F7CA31E>121 D E
+%EndDVIPSBitmapFont
+%DVIPSBitmapFont: Fk cmtt10 10 6
+/Fk 6 120 df<127812F87EA27E127E127F7E7F121F7F120F7F1207A27F12037F12017F
+12007F137E137F7F80131FA280130F801307801303801301801300A280147E147F808114
+1F81140F811407811403A281140181140081157E157F811680151FA2150FED070021417B
+B92C>92 D<EC0FFE4A7EA380EC003FAAEB07F8EB3FFE90B512BF4814FF5A3807FC0F380F
+F00348487E497E48487F90C7FC007E80A212FE5AA87E007E5CA2007F5C6C7E5C6C6C5A38
+0FF0073807FC1F6CB612FC6CECBFFE6C143FEB3FFC90390FF01FFC27337DB22C>100
+D<EB07FCEB1FFF017F13C048B512F048803907FC07FC390FF001FE48486C7E0180133F00
+3F158090C7121F007EEC0FC0A348EC07E0A76C140F007E15C0A2007F141F6C15806D133F
+6C6CEB7F006D5B6C6C485A3907FC07FC6CB55A6C5C6C6C13C0011F90C7FCEB07FC23247C
+A32C>111 D<397FF01FE039FFF8FFF801FB13FE90B6FC6C158000019038F07FC0913880
+1FE091380007F049EB03F85BED01FC491300A216FE167EA816FE6D14FCA2ED01F86D1303
+6DEB07F0150F9138801FE09138E07FC091B51280160001FB5B01F813F8EC3FC091C8FCAD
+387FFFE0B57EA36C5B27367FA32C>I<D87FFEEB3FC0B53801FFF0020713F8021F13FC6C
+5B39003F7FE1ECFF019138FC00F84A13704A13005CA25C5CA391C8FCAF007FB512E0B67E
+A36C5C26247EA32C>114 D<D87FFFEB7FFF6EB5FCB515806C16004A7ED807C0EB01F0A6
+6C6C495AA3143E147FA2D801F0495AECFF87A214F7A201F113C700005D9038F9E3CFA201
+FB13EFA3D97BC190C7FC017F13FFA21480A2013F5B90381F007C29247FA32C>119
+D E
+%EndDVIPSBitmapFont
+%DVIPSBitmapFont: Fl cmti10 10 41
+/Fl 41 123 df<EE3FFC4BB51280923907E007C092391F8001E0DB3F0013F0037E13034B
+1307A24A5A18E04A48EB038094C7FCA314075DA4140F5DA3010FB7FCA25F903A001F8000
+7EA217FE023F5C92C7FCA216015F5C147E16035FA214FE4A13075FA30101140F5F4AECC1
+C0A2161F1783010316805CA2EF870013074A5CEE0F8EEE079EEE03FC010FEC00F04A91C7
+FCA35C131FA2001C90CAFC127E5BEAFE3E133C137CEAF878EA78F0EA3FE0EA0F80344C82
+BA2F>12 D<3901E003C03907F00FE0000F131F01F813F0001F133FA3000F131F3907B00F
+6038003000A2017013E0016013C0EBE00101C01380000113030180130000035B3807000E
+000E5B485B485B485B48485A00C05B1C1971B92B>34 D<150C151C153815F0EC01E0EC03
+C0EC0780EC0F00141E5C147C5C5C495A1303495A5C130F49C7FCA2133EA25BA25BA2485A
+A212035B12075BA2120F5BA2121FA290C8FCA25AA2123EA2127EA2127CA412FC5AAD1278
+A57EA3121C121EA2120E7EA26C7E6C7EA212001E5274BD22>40 D<140C140E80EC0380A2
+EC01C015E0A2140015F0A21578A4157C153CAB157CA715FCA215F8A21401A215F0A21403
+A215E0A21407A215C0140F1580A2141F1500A2143EA25CA25CA2495AA2495A5C1307495A
+91C7FC5B133E133C5B5B485A12035B48C8FC120E5A12785A12C01E527FBD22>I<EA03C0
+EA07F0120F121F13F8A313F0EA07B0EA003013701360A213E013C01201EA038013005A12
+0E5A5A5A5A5A0D197A8819>44 D<387FFFF8A2B5FCA214F0150579941E>I<120EEA3F80
+127F12FFA31300127E123C0909778819>I<15181538157815F0140114031407EC0FE014
+1F147FEB03FF90383FEFC0148FEB1C1F13001580A2143FA21500A25CA2147EA214FEA25C
+A21301A25CA21303A25CA21307A25CA2130FA25CA2131FA25CA2133FA291C7FC497EB612
+80A31D3877B72A>49 D<EC03F8EC0FFE91383C0F809138F007C0903901E003E0D903C013
+F09038078001020013F8130E131E90391C6000FCEB3870EC30011370A213F013E0EC7003
+0001016013F813C014E0ECC00701C114F0903881800F018314E09039C7001FC001FEEB3F
+80D80078140090C7127E5D4A5A4A5AEC07C0EC1F80023EC7FC14FCEB01F0EB07C0495A01
+1EC8FC137C4914C0484813015B485A4848130348C71380000E1407001E140F48EC1F00D8
+3FF85B397FFFC07E39783FFFFCEA700FD8F0075BD8E0015B6D13C0021FC7FC263A79B72A
+>I<EC03FCEC1FFF91387E07C09138F003E0903903C001F0D9078013F849C7FC131E011C
+14FC133CEB38C0EB78E0EB7060150101F014F813E0A2ECE003D971C013F090387F8007D9
+1E0013E090C7EA0FC0ED1F80ED3F00157E5D49B45A4913E092C7FC9038000FC0EC03F014
+016E7E81A381A5007E130100FE5CA31403485C00E05C14074A5A5D4A5A007049C7FC0078
+137E6C13F8381E07F03807FF80D801FCC8FC263A78B72A>I<0107B612FCEFFF8018C090
+3B000FF0001FF04BEB07F81703021F15FC17014B14FEA2023F1400A24B1301A2147F18FC
+92C7120318F84A140718F04AEC0FE0EF1FC00101ED3F80EF7F004AEB01FEEE07F849B612
+E05F9139F80007F0EE01FC01076E7E177F4AEC3F80A2010F16C0171F5CA2131F173F5CA2
+133FEF7F805C1800017F5D4C5A91C7485A5F49140FEE1FE0494A5A00014AB45AB748C7FC
+16F816C037397BB83A>66 D<0107B712FEA3903A000FF000074B1300187C021F153CA25D
+A2143FA25D1838147FA292C8FCEE03804A130718004A91C7FCA201015CA24A131E163E01
+0314FE91B5FC5EA2903807F800167C4A1378A2130FA24A1370A2011F14F0A24A90C8FCA2
+133FA25CA2137FA291CAFCA25BA25B487EB6FCA337397BB836>70
+D<0103B500F890387FFFE0A21AC090260007F8C7380FFC004B15E061020F4BC7FC183E4B
+5C18F0021F4A5A4D5A4BEB0F804DC8FC023F143C5F4B5B4C5A027FEB07C04CC9FCED001E
+5E4A5BED01FCECFE0315070101497E151FECFC7C4B7E903903FDE07FDAFFC07F1580ED00
+3F49488014F84A131F83130F160F4A801607011F81A24A130383133F16014A80A2017F6E
+7EA291C8FC494A7F007F01FE011F13FCB55CA243397CB840>75 D<902603FFF891B512E0
+A281D90007923807F8006F6E5A61020F5E81DA0E7F5DA2021E6D1307033F92C7FC141C82
+DA3C1F5C70130EEC380FA202786D131E0307141C147082DAF003143C70133814E0150101
+016E1378030014705C8201036E13F0604A1480163F010715C1041F5B91C7FC17E149EC0F
+E360010E15F31607011E15FF95C8FC011C80A2013C805F1338160013785F01F8157CEA03
+FC267FFFE0143CB51538A243397CB83E>78 D<92383FC00E913901FFF01C020713FC9139
+1FC07E3C91393F001F7C027CEB0FF84A130749481303495A4948EB01F0A2495AA2011F15
+E091C7FCA34915C0A36E90C7FCA2806D7E14FCECFF806D13F015FE6D6D7E6D14E0010080
+023F7F14079138007FFC150F15031501A21500A2167C120EA3001E15FC5EA3003E4A5AA2
+4B5AA2007F4A5A4B5A6D49C7FC6D133ED8F9F013FC39F8FC03F839F07FFFE0D8E01F1380
+26C003FCC8FC2F3D7ABA2F>83 D<0007B812E0A25AD9F800EB001F01C049EB07C0485AD9
+00011403121E001C5C003C17801403123800785C00701607140700F01700485CA2140FC7
+92C7FC5DA2141FA25DA2143FA25DA2147FA292C9FCA25CA25CA21301A25CA21303A25CA2
+1307A25CA2130FA25CEB3FF0007FB512F8B6FCA2333971B83B>I<B5D8F80FB590381FFF
+F06102F018E0D807FEC7D87FE0903803FE00D803F8DA3F806D5AF100F0A24F5A62190362
+1907047F92C7FC190E16FF4B5DA2DB03BF5C7F0001DA073F5CA2030E5D83DB1C1F495A18
+0303385D4EC8FC157003F0140E15E0DA01C05CA2DA03805CA2DA07005CA2020E5D17C14A
+5DEFC3805C027802C7C9FC14704A14CE13FE6C6C4814DCA24A14F8A291C75B160F495D5F
+5B5F5B4992CAFCA249140E4C3B6FB853>87 D<01181330013813709038F001E03901C003
+800180130000035B3807000E000E5B000C1318001C1338485B00301360A2007013E00060
+5BA238EF01DE38FF81FFA66CC65A003C13781C196AB92B>92 D<14F8EB07FE90381F871C
+90383E03FE137CEBF801120148486C5A485A120FEBC001001F5CA2EA3F801403007F5C13
+00A21407485C5AA2140F5D48ECC1C0A2141F15831680143F1587007C017F1300ECFF076C
+485B9038038F8E391F0F079E3907FE03FC3901F000F0222677A42A>97
+D<133FEA1FFFA3C67E137EA313FE5BA312015BA312035BA31207EBE0F8EBE7FE9038EF0F
+80390FFC07C013F89038F003E013E0D81FC013F0A21380A2123F1300A214075A127EA214
+0F12FE4814E0A2141F15C05AEC3F80A215005C147E5C387801F8007C5B383C03E0383E07
+C0381E1F80D80FFEC7FCEA01F01C3B77B926>I<147F903803FFC090380FC1E090381F00
+70017E13784913383901F801F83803F003120713E0120FD81FC013F091C7FC485AA2127F
+90C8FCA35A5AA45AA3153015381578007C14F0007EEB01E0003EEB03C0EC0F806CEB3E00
+380F81F83803FFE0C690C7FC1D2677A426>I<ED01F815FFA3150316F0A21507A216E0A2
+150FA216C0A2151FA21680A2153FA202F81300EB07FE90381F877F90383E03FF017C5BEB
+F80112013803F00048485B120FEBC001121F5DEA3F801403127F01005BA214075A485CA2
+140FA248ECC1C0A2141F15C3ED8380143F1587007C017F1300ECFF076C485B9038038F8E
+391F0F079E3907FE03FC3901F000F0253B77B92A>I<147F903803FFC090380FC1E09038
+3F00F0017E13785B485A485A485A120F4913F8001F14F0383F8001EC07E0EC1F80397F81
+FF00EBFFF891C7FC90C8FC5A5AA55AA21530007C14381578007E14F0003EEB01E0EC03C0
+6CEB0F806CEB3E00380781F83803FFE0C690C7FC1D2677A426>I<ED07C0ED1FF0ED3E38
+ED7C3CEDF8FC15F9140115F1020313F8EDF0F0160014075DA4140F5DA4141F5D010FB512
+C05B16809039003F800092C7FCA45C147EA414FE5CA413015CA413035CA413075CA4130F
+5CA3131F5CA391C8FC5B121CEA7E3EA2EAFE3C137C1378EAF8F01278EA3FC0EA0F80264C
+82BA19>I<EC07C0EC3FF09138FC38E0903901F01FF0EB03E0903807C00FEB0F80011F13
+07D93F0013E05B017E130F13FE4914C01201151F1203491480A2153F1207491400A25DA2
+49137EA215FEA25D00031301140314076C6C485A0000131FEB787BEB3FF390380FC3F0EB
+00031407A25DA2140F5D121C007E131F5D00FE49C7FC147E5C387801F8387C07E0381FFF
+80D803FEC8FC24367CA426>I<EB03F0EA01FFA3EA00075CA3130F5CA3131F5CA3133F91
+C8FCA35B90387E07F0EC1FFCEC783E9038FFE01F02C01380EC800F1400485A16C05B49EB
+1F8012035BA2153F000715005BA25D000F147E5B15FE5D121FD98001131C15F8163C003F
+01031338010013F0A216704814E0007E15F016E0EDE1C000FE903801E38048903800FF00
+0038143C263B7BB92A>I<EB01C0EB07E014F0130F14E01307EB038090C7FCAB13F0EA03
+FCEA071EEA0E1F121CA212385B1270A25BEAF07E12E013FEC65AA212015B1203A25B1207
+5BA2000F13E013C013C1001F13C01381A2EB83801303EB0700A2130E6C5AEA07F8EA01E0
+143879B619>I<EB03F0EA01FFA3EA00075CA3130F5CA3131F5CA3133F91C8FCA35B017E
+EB0F80ED3FE015F09039FE01C1F09038FC0387EC0707140E0001011C13E0EBF838913830
+03800270C7FC00035BEBF1C0EBF38001FFC8FCEA07FC7FEBFFC0EBE7F8380FE1FCEBC07E
+147F80001F809039801F81C0A21583003F013F138001001303A21507481500007E133EEC
+1E0E151E00FE6D5A48EB07F80038EB01E0243B7BB926>107 D<EB0FC0EA07FFA3EA001F
+1480A2133FA21400A25BA2137EA213FEA25BA21201A25BA21203A25BA21207A25BA2120F
+A25BA2121FA25BA2123FA290C7FCA25AA2EA7E0EA212FE131EEAFC1CA2133C133812F813
+78EA7870EA7CE0121FEA0F80123B79B915>I<D801E001FEEB07F03C07F803FF801FFC3C
+0E3C0F07C0783E3C1E3E3C03E1E01F261C1F78D9F3C013803C383FF001F7800F02E01400
+007801C013FE007018C002805B4A4848EB1F80EAF07FD8E07E5CA200000207143F01FE17
+00495CA2030F5C0001177E495C18FE031F5C120349DA8001131C18F8033F153C00070403
+133849020013F0A24B1570000F17E049017E15F019E003FEECE1C0001FEE01E349499038
+00FF000007C70038143C3E2679A444>I<D801E013FE3A07F803FF803A0E3C0F07C03A1E
+3E3C03E0261C1F787F39383FF00114E0007813C000708114804A485AEAF07FEAE07EA200
+00140701FE5C5BA2150F00015D5B151F5E12034990383F8380160316070007027F130049
+137EA2160E000F147C49141E161C5E001FEC3C7849EB1FE00007C7EA0780292679A42F>
+I<147F903803FFC090380FC1F090381F00F8017E137C5B4848137E4848133E0007143F5B
+120F485AA2485A157F127F90C7FCA215FF5A4814FEA2140115FC5AEC03F8A2EC07F015E0
+140F007C14C0007EEB1F80003EEB3F00147E6C13F8380F83F03803FFC0C648C7FC202677
+A42A>I<9039078007C090391FE03FF090393CF0787C903938F8E03E9038787FC0017049
+7EECFF00D9F0FE148013E05CEA01E113C15CA2D80003143FA25CA20107147FA24A1400A2
+010F5C5E5C4B5A131F5EEC80035E013F495A6E485A5E6E48C7FC017F133EEC70FC90387E
+3FF0EC0F8001FEC9FCA25BA21201A25BA21203A25B1207B512C0A3293580A42A>I<3903
+C003F0390FF01FFC391E783C0F381C7C703A3C3EE03F8038383FC0EB7F80007815000070
+1300151CD8F07E90C7FCEAE0FE5BA2120012015BA312035BA312075BA3120F5BA3121F5B
+A3123F90C9FC120E212679A423>114 D<14FE903807FF8090380F83C090383E00E04913
+F00178137001F813F00001130313F0A215E00003EB01C06DC7FC7FEBFFC06C13F814FE6C
+7F6D13807F010F13C01300143F141F140F123E127E00FE1480A348EB1F0012E06C133E00
+705B6C5B381E03E06CB45AD801FEC7FC1C267AA422>I<EB0380EB07C0130FA4131F1480
+A3133F1400A35B137E007FB5FCA2B6FC3800FC00A312015BA312035BA312075BA3120F5B
+A3121FEB801CA2143C003F1338EB0078147014F014E0EB01C0EA3E03381F0780380F0F00
+EA07FCEA01F0183579B31C>I<13F8D803FEEB01C0D8078FEB03E0390E0F8007121E121C
+0038140F131F007815C01270013F131F00F0130000E015805BD8007E133FA201FE14005B
+5D120149137EA215FE120349EBFC0EA20201131E161C15F813E0163CD9F0031338140700
+01ECF07091381EF8F03A00F83C78E090393FF03FC090390FC00F00272679A42D>I<01F0
+130ED803FC133FD8071EEB7F80EA0E1F121C123C0038143F49131F0070140FA25BD8F07E
+140000E08013FEC6485B150E12015B151E0003141C5BA2153C000714385B5DA35DA24A5A
+140300035C6D48C7FC0001130E3800F83CEB7FF8EB0FC0212679A426>I<01F01507D803
+FC903903801F80D8071E903907C03FC0D80E1F130F121C123C0038021F131F49EC800F00
+701607A249133FD8F07E168000E0ED000313FEC64849130718000001147E5B03FE5B0003
+160E495BA2171E00070101141C01E05B173C1738A217781770020314F05F000301071301
+6D486C485A000190391E7C07802800FC3C3E0FC7FC90393FF81FFE90390FE003F0322679
+A437>I<13F0D803FCEB01C0D8071EEB03E0D80E1F1307121C123C0038140F4914C01270
+A249131FD8F07E148012E013FEC648133F160012015B5D0003147E5BA215FE00075C5BA2
+14015DA314035D14070003130FEBF01F3901F87FE038007FF7EB1FC7EB000F5DA2141F00
+3F5C48133F92C7FC147E147C007E13FC387001F8EB03E06C485A383C1F80D80FFEC8FCEA
+03F0233679A428>121 D<903903C0038090380FF007D91FF81300496C5A017F130E9038
+FFFE1E9038F83FFC3901F007F849C65A495B1401C7485A4A5A4AC7FC141E5C5C5C495A49
+5A495A49C8FC131E5B49131C5B4848133C48481338491378000714F8390FF801F0391FFF
+07E0383E1FFFD83C0F5B00785CD8700790C7FC38F003FC38E000F021267BA422>I
+E
+%EndDVIPSBitmapFont
+%DVIPSBitmapFont: Fm cmbx10 27.44 1
+/Fm 1 79 df[<BA00E0962603FFFE92381FFFF07398B9FC8585A2858586868686C86C9A
+C803C0C7FC74090301F0C8FC74755B86868787A28704FB8204F98204F882877181837182
+718271827182888371827281728172828972828472827282728273818973828573827382
+738273828A8574817481748274828B74828674827482758175818C758287758275827582
+75828C76818876827682768276828D8876827781778177828E7782897782778277827881
+8E7816808A7816C07816E07816F07816F823FC7816FE8B7915FF7916817916C17916E1A1
+12F18B7916F97916FD7A92B5FC8CA28C8C8C8C8C8CA28D8D8D8D8D8DA28D8D8E8E8EA28E
+8E8E8E8E8FA28F8F8F8F8F4B6C8A023FEBFFF0BA00FC87A17EA17EA17EA17EA17EA2A17E
+A17EA16C5B0280C70007795A>188 156 120 283 205 78 D E
+%EndDVIPSBitmapFont
+%DVIPSBitmapFont: Fn cmsy10 10 1
+/Fn 1 50 df<D90FF0ED07F0D93FFEED3FFE90B56C91B5FC00036E903903F807C02707F0
+7FF0903907C001E0270F801FF890390F8000F090260007FC013EC71270001E6D6C491438
+486D6C0178141C00386D6D5A48DA7FC1150E92383FE3E0006091261FF3C01406EEF78000
+E0DA0FFF1507486E90C812036F5AA26F7E6F7F707EA24C7E6C4A6D14070060DBEFF81406
+ED03CF0070912607C7FC140E92380F83FE6CDB01FF141CDB1E006D133C6C023E6D6C1378
+6C4A6D6C13F0000FD901F090381FF8016C6C484890390FFE0FE02703E01FC00103B512C0
+C6B5C76C1400D97FFC9138007FFCD90FE0ED0FF048267BA453>49
+D E
+%EndDVIPSBitmapFont
+%DVIPSBitmapFont: Fo cmbx9 9 46
+/Fo 46 122 df<EC07FF91B512E001078090391FFC01FC90383FE0009039FFC001FE48EB
+80031400484A7E496D5AA36F5AED007093C7FCA4ED3FFFB8FCA43903FE0001B3A7277FFF
+F03F13F8A42D347FB331>12 D<913807FF9F91B6FC130790381FFC0390383FE007EBFFC0
+48138014005A497FA281A8B8FCA43903FE0001B3A7277FFFF03F13F8A42D347FB331>I<
+DA07FFEB07FF027FD9C07F13E00103B500F3B57E903C0FFE01FFFE01FC90261FF000EBF0
+0090267FE00349487E494848EBC00302801480484D7E02004A6C5AA2816F6E5AF0007096
+C7FCA4F03FFFBBFCA40001D90001EB0001B3A7003FD9F83FD9F83F13F8A445347FB34A>
+I<12E07E127C7E7E7F6C7E12077F6C7E6C7EA26C7EA27F137E137FA2EB3F80A3EB1FC0A3
+14E0A3130FA314F0AF14E0A3131FA314C0A3EB3F80A3EB7F00A2137E13FE5BA2485AA248
+5A485A5B120F485A90C7FC123E5A12F05A144B7BB722>41 D<B512FCA816087F931D>45
+D<120FEA3FC0EA7FE0EAFFF0A6EA7FE0EA3FC0EA0F000C0C7A8B19>I<147814F8130313
+1FEA03FFB5FCA3EAFC1F1200B3B2007FB512FEA41F317AB02C>49
+D<EB1FFC90B57E000314E0000F14F8391FE03FFC393F800FFF48487E6D6C1380D8FFC014
+C06D7E16E080A36C5A6C5A6CC7FCC8FC16C05C16805C16004A5A4A5A5D4A5AEC3FC04A5A
+02FEC7FC495A495A903907E001E0EB0FC0EB1F8090383E00034914C05B4848130748B6FC
+5A5A5A5A5AB71280A423317CB02C>I<EB0FFC90387FFF8048B512F03903F01FF83907C0
+0FFE380F8007486C6C7E01F01480123F13F8A5D81FF014006C485AD803805BC7FC4A5A4A
+5A4A5AECFFC0013F90C7FC14FCECFFC09038001FF0EC0FFC6E7E6E7E16806E13C0A2000F
+15E0EA3FC0EA7FE0EAFFF0A416C0A2495AD87FC0148049481300003F5B391FF01FFE6CB5
+12F8000314E0C61480D91FFCC7FC23327CB02C>I<151F5D5DA25D5C5C5C5CA25C143D14
+7D14F9EB01F114E1EB03C1EB0781130FEB1F01133E133C137813F01201EA03E0EA07C013
+80EA0F00121E123E5A5AB712FEA4C700031300A80103B512FEA427317EB02C>I<000C14
+0ED80FE013FE90B5FC5D5D5D5D5D92C7FC14FC14F091C8FC1380A6EB87FE9038BFFFC090
+B512F09038FC0FF89038E003FE01C07F497E01001480000E6D13C0C8FCA216E0A3121FEA
+7F807F487EA316C05B5CD87F801480D87C0014006C5B393F8007FE391FE01FFC0007B512
+F06C14C0C691C7FCEB1FF823327CB02C>I<EC7FC0903803FFF0010F13FC90383FE07E90
+387F801F4848485A4848EBFF8048485A13F8120FEA1FF0A2123F6E13004848133C92C7FC
+A2142039FFE1FF8001E713E001EF13F89038FE03FC496C7E01F87F6E13805B16C0A24914
+E0A5127FA5123F16C0121F6D1480000F5B01F814006C6C485A6C6C485A6CB55A6C6C5B01
+1F13C0D907FEC7FC23327CB02C>I<120FEA3FC0EA7FE0EAFFF0A6EA7FE0EA3FC0EA0F00
+C7FCA9120FEA3FC0EA7FE0EAFFF0A6EA7FE0EA3FC0EA0F000C217AA019>58
+D<EB7FF80003B51280000F14E0391FC03FF0393E000FF8007FEB07FCD8FF8013FE13C0A5
+397F800FFCEA3F00C7EA1FF8EC3FF0EC7FC0ECFF80903801FE005C495A5C495A5CA2495A
+A291C7FCA790C8FCA6EB1F80497E497E497EA66D5A6D5A6D5A1F347BB32A>63
+D<ED1F80A24B7EA24B7EA34B7EA24A7FA34A7FA24A7F15CFA2020F7F1587021F80150302
+3F80EC3E01A2027E80EC7C0002FC804A137FA20101814A133F0103814A131FA249B67EA2
+4981A290271F8000077F91C77EA24982013E80017E82017C80A201FC8249157FB500F001
+3FB512F0A43C347DB343>65 D<DBFFE01338021F01FE137891B6EA80F8010315E1010F90
+38E00FF7903A1FFE0001FFD97FF8EB007FD9FFE0143F4849141F4849140F4890C8120748
+5A1703485A1701123F5B007F1600A349160012FFAB127F7F1878A2123F7F001F17F818F0
+6C7E6D15016CEE03E06C7F6C6DEC07C06C6DEC0F80D97FF8EC3F00D91FFE14FE903A0FFF
+E007FC010390B512F0010015C0021F49C7FC020013F035357BB340>67
+D<B812FCA4C69038E0001FEE03FE16011600177E173EA2171EA3923803C01F170FA40307
+1300A2150F153F91B5FCA4ECE03F150F1507A21503A592C8FCABB612F8A430337DB238>
+70 D<B612F8A4C601E0C8FCB3A81778A417F817F0A31601A21603A21607160F161F167F
+923803FFE0B8FCA42D337DB235>76 D<D90FFC137090397FFF80F048B512E1000714FB39
+0FF803FF391FE0007F4848133F49130F007F140790C7FC1503481401A36D1300A27F6D14
+0013F8387FFFC014FCECFFE06C14F86C14FE816C1580000315C06C15E06C6C14F0131F01
+0014F8140F9138007FFC153F151F150F00F01407A21503A27EA216F86C14076C15F07E6D
+EB0FE001E0131F01FEEB7FC000FDB61200D8F87F5BD8F01F13F8D8E00113C026357BB331
+>83 D<003FB812F8A4D9F003EB801FD87F80ED03FC01001501007E1600007C177CA20078
+173CA400F8173E48171EA4C71600B3A9011FB612F0A437327DB13E>I<B600E090B512F8
+A4C601E0C8EAF800B3B0017F15016E5DA2013F4B5A6E1407011F5E6D6C140F6D6CEC3F80
+6D6C6C01FFC7FC6D9038F007FE6D6CB512F8021F5C020714C09126007FFCC8FC3D347DB2
+44>I<B66C90381FFFFCA4000101E0C8EA7E006C177C6E15FC017F5E6E1401A2013F5E6E
+1403011F5E6E1407010F5E6E140F6D5E81171F6D93C7FC6F5B6D153E6F137E6D157C6F13
+FC027F5C811601023F5CEDFC03021F5CEDFE07020F5CEDFF0F6E5C168F169F6E91C8FC16
+FF6E5BA26E5BA26F5AA36F5AA26F5AA26F5AA23E347EB243>I<B66CB639800FFFFCA400
+019026C0000101C0C7EA1F001B1E6E6F143E6C6F163CA26E6E6C147C017F19786E4A6C14
+F8013F61A26E496D1301011F616E497F010F03CF4A5AA26E01076D13076D03875DA29226
+800F03EB800F6D96C7FCDBC01F6E5A6DDA1E01141EA2DBE03EECE03E6DDA3C00143CDBF0
+7C14F0027F0178017F5BA2DBF8F8ECF8F8023F49013F5BA2DBFDE0EB1FFD021F5F03FF15
+FF6E496D5BA36E496D5BA26E90C76C90C8FCA36E486E5AA24B140002005EA20378157856
+347EB25B>I<EB7FFE0003B512E04814F8390FF00FFC391FF803FF806E138016C0157F6C
+5A6C5AEA0180C8FCEC7FFF010FB5FC90B6FC0003EBF07F000F1300EA1FF8485A485A485A
+5BA315FF7F007F5B6D4813E03A3FF80FBFFF000FB5121F0003EBFC0F39007FE00728217E
+A02B>97 D<EA01FC12FFA4120F1207ADEC07FC91387FFF8001FDB512E09039FFF00FF891
+38C007FC91380003FE496D7E496D1380A217C0167FA217E0A917C0A216FF1780A26D4913
+006D495A9138C007FC9039F3F01FF801E1B512E0D9C07F13809026800FF8C7FC2B347EB3
+31>I<903807FF80013F13F090B512FC3903FE01FE4848487EEA0FF8EA1FF0EA3FE0A200
+7F6D5A496C5A153000FF91C7FCA9127F7FA2003FEC07807F6C6C130F000FEC1F00D807FE
+133E3903FF80FCC6EBFFF8013F13E0010790C7FC21217DA027>I<ED01FC15FFA4150F15
+07ADEB07FE90383FFFC790B512F70003EB01FF3907FC003F4848131F4848130F48481307
+A2127F5BA212FFA9127FA27F123F150F6C6C131F6C6C133F6C6C497E2603FE03B512E0C6
+B512E7013F1387903807FC072B347DB331>I<903803FF80013F13F090B512FC48EB03FE
+3907FC007F4848EB3F804848EB1FC05B003FEC0FE0127F5B16F012FF150790B6FCA301C0
+C8FCA4127F7F123F16F06C7E000F14016C6CEB03E0D803FEEB0FC03A01FF807F806C6CB5
+1200011F13FC010313E024217EA029>I<EC3FE0903803FFF8010F13FC90383FF1FE9038
+7FC3FFEBFF83481303A2EA03FEEC01FEA2EC00781500A7B512FEA4D803FEC7FCB3A7387F
+FFF8A420347EB31B>I<16F890390FFC07FE90387FFF9F48B6127F3907FC0FFC380FF003
+001F14FED9E001133E003FECFF1C1600A6001F5CEBF003000F5C3907FC0FF890B512E048
+6C1380D90FFCC7FC48C9FCA37F7F90B512F015FE6CECFF8016E06C15F06C15F84815FC12
+1F393F80001F48C7EA03FE481401481400A46C14016C6CEB03FC6C6CEB07F86C6CEB0FF0
+D80FFCEB7FE00003B61280C6ECFE00010F13E028327EA12C>I<EA01FC12FFA4120F1207
+ADEC03FF020F13C0023F13F09138FC0FF89039FDE007FCEBFFC04A6C7E1400A25BA25BB2
+B539E07FFFF0A42C347DB331>I<EA03F0487E487E487EA66C5A6C5A6C5AC8FCA8EA01FC
+12FFA4120F1207B3A5B512C0A412357DB418>I<EA01FC12FFA4120F1207ADED7FFFA4ED
+1FC04B5A037EC7FC5DEC03F8EC07E04A5AEC3F804AC8FC4A7E90B5FC8181ECBFF0EC3FF8
+9038FC1FFCEBF80F6E7E6E7E6E7F82806F7E6F7E6F7EB539C07FFFC0A42A347DB32F>
+107 D<EA01FC12FFA4120F1207B3B3A6B512E0A413347DB318>I<2703F803FEEB03FE00
+FF903B1FFFC01FFFC0027FD9E07F7F913BF81FF0F81FF0903CF9E00FF9E00FF8260FFBC0
+EBFBC06CB4486CB4486C7E02001400495CA3495CB2B500E0B500E0B512E0A443217CA04A
+>I<3901F803FF00FF010F13C0023F13F09138FC0FF89039F9E007FC380FFBC06CB4486C
+7E1400A25BA25BB2B539E07FFFF0A42C217DA031>I<903803FF80011F13F090B512FE48
+EB01FF3A07FC007FC0D80FF0EB1FE0001F15F049130F003F15F8491307007F15FCA300FF
+15FEA8007F15FCA26D130F003F15F8001F15F06D131F6C6CEB3FE06C6CEB7FC03A01FF01
+FF006CEBFFFE013F13F80103138027217EA02C>I<3901FC07FC00FF90387FFF8001FDB5
+12E09039FFF01FF89138C007FC000F90380003FE6C4880496D1380A26F13C0A3EE7FE0A9
+EEFFC0A34B1380A26D4913006D495A9138C00FFC9138F03FF801FDB512E0D9FC7F1380DA
+0FF8C7FC91C9FCABB512E0A42B307EA031>I<3901F81F8000FFEB7FF0ECFFF89038F9E3
+FC9038FBC7FE380FFF876C1307A213FEEC03FCEC01F8EC0060491300B1B512F0A41F217E
+A024>114 D<9038FFE1C0000713FF5A383F803F387E000F14075A14037EA26C6CC7FC13
+FCEBFFE06C13FC806CEBFF80000F14C06C14E0C6FC010F13F0EB007F140F00F013071403
+7EA26C14E06C13076CEB0FC09038C01F8090B5120000F913FC38E03FE01C217DA023>I<
+133CA5137CA313FCA21201A212031207001FB51280B6FCA3D807FCC7FCB0EC03C0A79038
+FE078012033901FF0F006C13FEEB3FFCEB0FF01A2F7EAE22>I<D801FC14FE00FF147FA4
+000F140700071403B21507A2150F151F6C6C497E6C6C01FB13F06CEBFFF3013F13C39038
+07FE032C217DA031>I<B539C007FFC0A4D807FEC7EAF80000035D6D13016C5D14806C4A
+5AA2ECC007017F5CECE00F013F91C7FC6E5A011F131EECF83E010F133CECFC7C01071378
+ECFEF801035B14FF6D5BA26D5BA26E5AA26EC8FCA2141E2A217EA02F>I<B53B83FFFC03
+FFE0A43D07FC001FE0003E00183C6D167C00036F1378033F14F86C6C6E5B157F9139807B
+FC016C5FDAC0FB1303017FD9F1FE5B14C19139E1E0FF07013F5E9139F3C07F0F011F038F
+C7FC14F7903A0FFF803FDEA29238001FFE6D5DA26D486D5AA24A130701015DA26D486D5A
+4A13013B217EA040>I<B539C03FFF80A400039039000FC0006C01805B6C4AC7FC90387F
+C03E6D6C5A6E5A90381FF9F0EB0FFF6D5B6D5B6D5B7F816E7E4A7E497FEB03EF903807C7
+FC90380FC3FE90381F83FFD93F017FD97E007F496D7E496D7E4848131FD8FFFE90387FFF
+C0A42A217EA02F>I<B539C007FFC0A4D807FEC7EAF80000035D6D13016C5D14806C4A5A
+A2ECC007017F5CECE00F013F91C7FC6E5A011F131EECF83E010F133CECFC7C01071378EC
+FEF801035B14FF6D5BA26D5BA26E5AA26EC8FCA2141EA25CA2147C003E1378007F13F848
+6C5A1381EB83E0EB87C0495AD87F3FC9FCEA3FFEEA1FF8EA07E02A307EA02F>I
+E
+%EndDVIPSBitmapFont
+%DVIPSBitmapFont: Fp cmr7 7 45
+/Fp 45 124 df<1238127C12FE12FFA2127F123B1203A31206A3120C1218123812701220
+08127B8613>44 D<B5FCA410047F8E16>I<1238127C12FEA3127C123807077B8613>I<EB
+3F803801FFF03803E0F83807803C48487E001E7F003E1480A2003C1307007C14C0A400FC
+14E0AE007C14C0A36CEB0F80A36CEB1F006C131E6C6C5A3803E0F86CB45A38003F801B27
+7EA521>48 D<13381378EA01F8121F12FE12E01200B3AB487EB512F8A215267BA521>I<
+13FF000313E0380E03F0381800F848137C48137E00787F12FC6CEB1F80A4127CC7FC1500
+5C143E147E147C5C495A495A5C495A010EC7FC5B5B903870018013E0EA01803903000300
+12065A001FB5FC5A485BB5FCA219267DA521>I<13FF000313E0380F01F8381C007C0030
+137E003C133E007E133FA4123CC7123E147E147C5C495AEB07E03801FF8091C7FC380001
+E06D7E147C80143F801580A21238127C12FEA21500485B0078133E00705B6C5B381F01F0
+3807FFC0C690C7FC19277DA521>I<1438A2147814F81301A2130313071306130C131C13
+1813301370136013C012011380EA03005A120E120C121C5A12305A12E0B612E0A2C7EAF8
+00A7497E90383FFFE0A21B277EA621>I<0018130C001F137CEBFFF85C5C1480D819FCC7
+FC0018C8FCA7137F3819FFE0381F81F0381E0078001C7F0018133EC7FC80A21580A21230
+127C12FCA3150012F00060133E127000305B001C5B380F03E03803FFC0C648C7FC19277D
+A521>I<EB0FE0EB3FF8EBF81C3801E0063803C01F48485AEA0F005A121E003E131E91C7
+FC5AA21304EB3FC038FCFFF038FDC078EB003CB4133E48131E141FA2481480A4127CA400
+3C1400123E001E131E143E6C133C6C6C5A3803C1F03801FFC06C6CC7FC19277DA521>I<
+1230123C003FB512E0A215C0481480A239700007000060130E140C48131C5C5CC75A5C13
+01495AA249C7FC5B130E131EA3133E133CA2137CA413FCA813781B287DA621>I<137F38
+03FFE0380781F8380E007C48131E5A801278A3127C007E131EEA3F80EBE03C6C6C5A380F
+FCF03807FFC06C5BC613E0487F38079FFC380F07FEEA1E0348C67E48133FEC1F8048130F
+A21407A315001278140E6C5B6C5B380F80F03803FFE0C66CC7FC19277DA521>I<137F38
+01FFC03807C1E0380F0070001E1378003E7F003C133E007C131EA200FC131FA41580A400
+7C133FA2123C003E137F001E135F380F01DF3807FF9F3801FE1FD8001013001300A2143E
+123C007E133CA25C5C007C5B383003C0381C0780D80FFFC7FCEA03F819277DA521>I<14
+0EA2141FA34A7EA3EC6FC0A2ECEFE014C7A290380183F0A390380301F8A201067F1400A2
+49137EA2011C137F01187FA24980013FB5FCA2903960000FC0A201E080491307A248486D
+7EA200038115011207D81FC0497ED8FFF890383FFFE0A22B2A7EA931>65
+D<91387FC002903903FFF80690390FE01E0E90383F0007017CEB019ED801F0EB00FE4848
+147E4848143E5B000F151E48C8FC48150E123EA2007E1506A2127C00FC1500A8127C007E
+1506A2123EA2003F150C7E6C7E000715186D14386C6C14306C6C1460D8007CEB01C0013F
+EB038090390FE01E00903803FFF89038007FC0272A7DA82F>67 D<91387FC002903903FF
+F80690390FE01E0E90383F0007017CEB019ED801F0EB00FE4848147E4848143E5B000F15
+1E48C8FC48150E123EA2007E1506A2127C00FC92C7FCA792387FFFE0127C007E02001300
+167E123EA2123F7E6C7E6C7EA26C7ED801F814FEEA007C013FEB039E90390FE00F0E9039
+03FFFC029026007FE0C7FC2B2A7DA833>71 D<B512C0A23807F8006C5AB3B0487EB512C0
+A212287EA718>73 D<D8FFF0903807FFE07FD803FC9038007E006D143C1618137F6D7E6D
+7EA26D7E6D7E6D7EA26D7E6D7E147FA2EC3F80EC1FC0EC0FE015F01407EC03F8EC01FCEC
+00FEA2157FED3F98ED1FD8A2ED0FF815071503A215011500486C1478487ED8FFFC143816
+182B287EA731>78 D<B612E015FC3907F0003F0003EC0FC0ED03E0ED01F016F8150016FC
+A616F8150116F0ED03E0ED0FC0ED3F0090B512FC15E001F0C8FCAF487EB512C0A226287E
+A72D>80 D<90387F80203903FFF06039078078E0380E000E481307481303007813010070
+130012F0A21560A27E1500127C127FEA3FE013FF6C13F06C13FC000313FFC61480010F13
+C0010013E0EC0FF014031401EC00F8A200C01478A46C1470A26C14F06C14E06CEB01C000
+EFEB078039E3E01F0038C0FFFC38801FF01D2A7DA825>83 D<007FB7FCA23A7E003F003F
+0078150F007081006081A200E01680481501A5C791C7FCB3A64A7E013FB5FCA229287EA7
+2F>I<B539C007FFE0A2D807F8C7EA7E006C48143C1618B3A816386C6C143016706C6C14
+60017C14E0017E495A6D495A90260F8007C7FC903807E03E903801FFF89038003FC02B29
+7EA731>I<13FE3807FFC0380F03E0381C00F0003E1378003F137C143C143E121EC7FCA3
+EB3FFEEA01FF3807F03EEA1FC0EA3F00127EA2481418A3147E127EECDF38393F838FF039
+0FFE0FE03903F807C01D1C7E9A21>97 D<EA0F8012FFA2121F120FAAEB81FCEB8FFF9038
+BC0FC09038F003E09038C001F0EB800015F815FC157CA2157EA7157CA215FC15F89038C0
+01F015E090387003C0390E3C0F80390C0FFF00380003F81F297EA725>I<EB3FC0EBFFF8
+3803E03C3807C00E380F801F381F003F123EA2007E131E007C1300A212FCA7127C127E14
+03123E6C1306EA0F803807C00C3803F0383800FFE0EB3F80181C7E9A1E>I<EC03E0143F
+A214071403AAEB3F833801FFE33803E03B3807800F380F0007481303123E127E127CA212
+FCA7127CA2127E123E001E1307001F130F390F801FF03903E073FE3801FFE339007F03E0
+1F297EA725>I<133F3801FFE03803E1F0380F80F8381F007C143E123E007E131E141F12
+7C12FCA2B6FCA200FCC7FCA4127C127E1403123E6C1307380F800E3807C01C3803E07838
+00FFE0EB3F80181C7E9A1E>I<EB07E0EB3FF0EB7C78EBF0FCEA01E01203EBC078000713
+301400A8B51280A23807C000B3A2487EEA7FFEA216297FA815>I<90387E03E03901FF9F
+F03807C3FC380F00F048EBF800001E1378003E137CA6001E1378001F13F86C5BEBC3E038
+0DFF80D81C7EC7FC90C8FCA3121E380FFFF014FC6C13FF001F1480393E001FC000781307
+EC03E0481301A40078EB03C0007C13076CEB0F80390FC07E003803FFF838007FC01C277E
+9921>I<EA0F8012FFA2121F120FAAEB81FCEB8FFF90389C0F809038B007C013E09038C0
+03E0A31380AF391FC007F039FFF83FFEA21F287EA725>I<120EEA3F80A5EA0E00C7FCA7
+EA078012FFA2121F120FB3121FEAFFF8A20D287EA713>I<EA0F8012FFA2121F120FB3AF
+EA1FC0EAFFF8A20D287EA713>108 D<260F81FC137F3BFF8FFF03FFC0903A9C0F8703E0
+3B1FB007CC01F0D80FE013D8903AC003F000F8A301805BAF486C486C487E3CFFF83FFE0F
+FF80A2311A7E9937>I<380F81FC38FF8FFF90389C0F80391FB007C0EA0FE09038C003E0
+A31380AF391FC007F039FFF83FFEA21F1A7E9925>I<EB3F80EBFFE03803E0F83807803C
+48487E001E7F003E1480A248EB07C0A300FC14E0A7007C14C0A2007E130F003E1480001E
+1400001F5B380F803E3803E0F86CB45A38003F801B1C7E9A21>I<380F81FC38FF8FFF90
+38BC0FC0391FF007E0390FC003F0EB800115F8EC00FCA2157C157EA7157C15FCA2EC01F8
+01C013F0EC03E09038F007C09038BC1F8090388FFF00EB83F80180C7FCA7487EEAFFF8A2
+1F257E9925>I<380F07C038FF1FF0EB38F8EA1F71EA0F6113C1EBC0F014005BAF487EEA
+FFFCA2151A7E991A>114 D<3803F840380FFEC0EA3C07EA7803EA7001EAF000A37E6C13
+00EA7FC013FC6CB4FC6C1380000713C0C613E0130738C003F0130113007EA26C13E01301
+00F813C038EE078038C7FF00EA81FC141C7E9A1A>I<13C0A41201A312031207120F121F
+B512E0A23807C000AC1430A73803E060A23801F0C03800FF80EB3F0014257FA31A>I<39
+0F8003E000FF133FA2001F1307000F1303B01407A20007130F9038C01BF03903E073FE38
+01FFE339007F83E01F1B7E9925>I<39FFF807FEA2390FE001F001C013E0000714C013E0
+00031480EBF00300011400A23800F806A2EB7C0CA2EB7E1CEB3E18A26D5AA2EB0FE0A36D
+5AA26D5AA21F1A7F9823>I<3BFFF8FFF07FE0A23B1FC01FC01F80000F90390F800E00A2
+0007150CEC1FC02603E01B5B15E0143B2601F0315B15F0D9F86013700000156015F89039
+FCC078E0017CEB7CC0137D90393F803D80153FEC001F6D91C7FCA2011E7F010E130EA22B
+1A7F982F>I<39FFF81FFCA2390FF00FE0D807E01380D803F013003801F80E00005BEB7C
+386D5AEB3FE06D5A130F130780497EEB1DF8EB38FCEB707EEBE03E48487E0003EB0F8000
+0714C0001F14E039FFE01FFEA21F197F9823>I<39FFF807FEA2390FE001F001C013E000
+0714C0EA03E01580EBF003000114006D5A0000130613FCEB7C0CA26D5AA26D5AA214F06D
+5AA26D5AA26D5AA291C7FCA213061230EA780EEAFC0C131C1318485AEA70E0EA3FC06CC8
+FC1F257F9823>I<B612FEA21F02808F21>123 D E
+%EndDVIPSBitmapFont
+%DVIPSBitmapFont: Fq cmmi7 7 1
+/Fq 1 116 df<EB0FE0EB7FF8EBF03C3801C00E0003131E3807803EA2143C000F1318EB
+E0006CB4FC14C06C13E06C13F06C13F813071301EA3C00007E1378A24813F05A387001E0
+EB03C0383C0F80381FFE00EA07F8171B7C991F>115 D E
+%EndDVIPSBitmapFont
+%DVIPSBitmapFont: Fr cmr10 10 75
+/Fr 75 125 df<DA0FF813FC91397FFF07FF903B01F807DF83C0903A07E001FF0F903B1F
+8007FE1FE090393F000FFC137E16F85B9338F007804848010790C7FC1503ACB812F8A328
+01F80003F0C7FCB3AB486C497E267FFFE0B512F0A3333B7FBA30>11
+D<EC0FF8EC7FFE903901F80780903907E001C090391F8000E090383F0007017E497EA25B
+A2485A6F5AED018092C8FCA9ED03F0B7FCA33901F8000F1503B3AA486C497E267FFFE0B5
+12C0A32A3B7FBA2E>I<EC0FFC91387FFF70903901F803F0903807E00790381F800FEB3F
+00137EA25B150748481303ADB7FCA33901F80003B3AB486C497E267FFFE0B512C0A32A3B
+7FBA2E>I<DA0FF0EB1FF0DA7FFEEBFFFC903B01F80F83F00F903C07E001CFC00380903C
+1F8000FF0001C090273F0007FE130F017E4948497EA2495CA248485C03076E5A03030203
+C7FC95C8FCA9F007E0BAFCA33C01F80003F0001F1807B3AA486C496C497E267FFFE0B500
+C1B51280A3413B7FBA45>I<001C131C007F137F39FF80FF80A26D13C0A3007F137F001C
+131C00001300A40001130101801380A20003130301001300485B00061306000E130E485B
+485B485B006013601A197DB92A>34 D<121C127FEAFF80A213C0A3127F121C1200A41201
+1380A2120313005A1206120E5A5A5A12600A1979B917>39 D<146014E0EB01C0EB0380EB
+0700130E131E5B5BA25B485AA2485AA212075B120F90C7FCA25A121EA2123EA35AA65AB2
+127CA67EA3121EA2121F7EA27F12077F1203A26C7EA26C7E1378A27F7F130E7FEB0380EB
+01C0EB00E01460135278BD20>I<12C07E12707E7E7E120F6C7E6C7EA26C7E6C7EA21378
+A2137C133C133E131EA2131F7FA21480A3EB07C0A6EB03E0B2EB07C0A6EB0F80A31400A2
+5B131EA2133E133C137C1378A25BA2485A485AA2485A48C7FC120E5A5A5A5A5A13527CBD
+20>I<15301578B3A6007FB812F8B912FCA26C17F8C80078C8FCB3A6153036367BAF41>
+43 D<121C127FEAFF80A213C0A3127F121C1200A412011380A2120313005A1206120E5A
+5A5A12600A19798817>I<B512FCA516057F941C>I<121C127FEAFF80A5EA7F00121C0909
+798817>I<150C151E153EA2153C157CA2157815F8A215F01401A215E01403A215C01407
+A21580140FA215005CA2141E143EA2143C147CA2147814F8A25C1301A25C1303A2495AA2
+5C130FA291C7FC5BA2131E133EA2133C137CA2137813F8A25B1201A25B1203A25B1207A2
+5B120FA290C8FC5AA2121E123EA2123C127CA2127812F8A25A12601F537BBD2A>I<EB03
+F8EB1FFF90387E0FC09038F803E03901E000F0484813780007147C48487FA248C77EA248
+1580A3007EEC0FC0A600FE15E0B3007E15C0A4007F141F6C1580A36C15006D5B000F143E
+A26C6C5B6C6C5B6C6C485A6C6C485A90387E0FC0D91FFFC7FCEB03F8233A7DB72A>I<EB
+01C013031307131F13FFB5FCA2131F1200B3B3A8497E007FB512F0A31C3879B72A>I<EB
+0FF0EB7FFE48B57E3903E03FE0390F000FF0000E6D7E486D7E486D7E123000706D7E1260
+12FCB4EC7F807FA56CC7FC121CC8FCEDFF00A34A5A5D14035D4A5A5D140F4A5A4A5A92C7
+FC147C5C495A495A495A495A91C8FC011EEB01805B5B49130348481400485A485A000EC7
+5A000FB6FC5A5A485CB6FCA321387CB72A>I<EB07F8EB3FFF4913C03901F80FF03903C0
+07F848486C7E380E0001000F80381FE0006D7FA56C5A6C5AC85A1401A25D4A5AA24A5A5D
+EC0F80027EC7FCEB1FFCECFF809038000FE06E7EEC01FC816E7EED7F80A216C0A2153F16
+E0A2121EEA7F80487EA416C049137F007F1580007EC7FC0070ECFF006C495A121E390F80
+03F83907F00FF00001B512C06C6C90C7FCEB0FF8233A7DB72A>I<1538A2157815F8A214
+0114031407A2140F141F141B14331473146314C313011483EB030313071306130C131C13
+1813301370136013C01201EA038013005A120E120C5A123812305A12E0B712F8A3C73803
+F800AB4A7E0103B512F8A325397EB82A>I<0006140CD80780133C9038F003F890B5FC5D
+5D158092C7FC14FC38067FE090C9FCABEB07F8EB3FFE9038780F803907E007E090388003
+F0496C7E12066E7EC87EA28181A21680A4123E127F487EA490C71300485C12E000605C12
+700030495A00385C6C1303001E495A6C6C485A3907E03F800001B5C7FC38007FFCEB1FE0
+213A7CB72A>I<EC3FC0903801FFF0010713FC90380FE03E90383F800790387E001F49EB
+3F804848137F485AA2485A000FEC3F0049131E001F91C7FCA2485AA3127F90C9FCEB01FC
+903807FF8039FF1E07E090383801F0496C7E01607F01E0137E497FA249148016C0151FA2
+90C713E0A57EA56C7E16C0A2121FED3F807F000F15006C6C5B15FE6C6C5B6C6C485A3900
+FE07F090383FFFC06D90C7FCEB03FC233A7DB72A>I<12301238123E003FB612E0A316C0
+5A168016000070C712060060140E5D151800E01438485C5D5DC712014A5A92C7FC5C140E
+140C141C5CA25CA214F0495AA21303A25C1307A2130FA3495AA3133FA5137FA96DC8FC13
+1E233B7BB82A>I<EB03F8EB1FFF017F13C09038FC07F03901E001F848486C7E4848137C
+90C77E48141E000E141F001E80A3121FA27F5D01E0131E6C6C133E01FC133C6D5B6C6C6C
+5AECC1E06CEBF3C06C01FFC7FC6C5BEB3FFF6D13C081017F13F801F07F3903E07FFE3907
+801FFF48486C1380481303003E6D13C0003CEB007F007C143F0078EC0FE000F814075A15
+03A21501A36C15C012781503007C15806CEC07006C5C6C6C131ED807E0137C3903F803F0
+C6B55A013F1380D907FCC7FC233A7DB72A>I<EB03F8EB1FFF017F13C09038FC07E03903
+F803F048486C7E48486C7E49137E121F48487FA2007F158090C7FCA248EC1FC0A616E0A5
+6C143FA27F123F001F147FA26C6C13FF3907E001DF0003149F3801F0033900FC0F1FD93F
+FC13C0EB07F090C7FC153F1680A316005D000F147E487E486C5BA24A5A4A5A49485A6C48
+485A001C495A260F807FC7FC3807FFFC000113F038003FC0233A7DB72A>I<121C127FEA
+FF80A5EA7F00121CC7FCB2121C127FEAFF80A5EA7F00121C092479A317>I<121C127FEA
+FF80A5EA7F00121CC7FCB2121C127F5A1380A4127F121D1201A412031300A25A1206A212
+0E5A121812385A1260093479A317>I<1538A3157CA315FEA34A7EA34A6C7EA202077FEC
+063FA2020E7FEC0C1FA2021C7FEC180FA202387FEC3007A202707FEC6003A202C07F1501
+A2D901807F81A249C77F167FA20106810107B6FCA24981010CC7121FA2496E7EA3496E7E
+A3496E7EA213E0707E1201486C81D80FFC02071380B56C90B512FEA3373C7DBB3E>65
+D<B712E016FC16FF0001903980007FC06C90C7EA1FE0707E707E707EA2707EA283A75F16
+035F4C5A4C5A4C5A4C5AEEFF8091B500FCC7FCA291C7EA7F80EE1FE0EE07F0707E707E83
+707EA21880177F18C0A7188017FFA24C13005F16034C5AEE1FF8486DEB7FF0B812C094C7
+FC16F832397DB83B>I<913A01FF800180020FEBE003027F13F8903A01FF807E07903A03
+FC000F0FD90FF0EB039F4948EB01DFD93F80EB00FF49C8127F01FE153F12014848151F48
+48150FA248481507A2485A1703123F5B007F1601A35B00FF93C7FCAD127F6DED0180A312
+3F7F001F160318006C7E5F6C7E17066C6C150E6C6C5D00001618017F15386D6C5CD91FE0
+5C6D6CEB03C0D903FCEB0F80902701FF803FC7FC9039007FFFFC020F13F002011380313D
+7BBA3C>I<B712C016F816FE000190398001FF806C90C7EA3FE0EE0FF0EE03F8707E707E
+177FA2EF3F8018C0171F18E0170F18F0A3EF07F8A418FCAC18F8A4EF0FF0A218E0A2171F
+18C0EF3F80A2EF7F0017FE4C5A4C5AEE0FF0EE3FE0486DEBFF80B8C7FC16F816C036397D
+B83F>I<B812FCA30001903880000F6C90C71201EE007E173E171E170EA31706A3170783
+16C0A394C7FCA31501A21503150F91B5FCA3EC000F15031501A21500A21860A318E093C7
+12C0A41701A3EF0380A21707A2170F173F177F486D903807FF00B9FCA333397DB839>I<
+B812F8A30001903880001F6C90C71201EE00FC177C173C171CA2170CA4170E1706A2ED01
+80A21700A41503A21507151F91B5FCA3EC001F15071503A21501A692C8FCAD4813C0B612
+C0A32F397DB836>I<DBFF8013C0020FEBF001023F13FC9139FF803F03903A03FC000787
+D90FF0EB03CF4948EB00EF4948147F4948143F49C8121F485A4848150F48481507A24848
+1503A2485A1701123F5B007F1600A448481600AB93B6FCA26C7E9338007FE0EF3FC0A212
+3F7F121FA26C7EA26C7EA26C7E6C7E6C6C157F6D7E6D6C14FF6D6C14EFD90FF8EB03C7D9
+03FEEB0783903A00FFC03F0191393FFFFC00020F01F0130002001380383D7CBA41>I<B6
+48B512FEA30001902680000313006C90C76C5AB3A491B6FCA391C71201B3A6486D497EB6
+48B512FEA337397DB83E>I<B612C0A3C6EBC0006D5AB3B3AD497EB612C0A31A397EB81E>
+I<B649B5FCA3000101809038007FF06C90C8EA3F80053EC7FC173C17385F5F4C5A4C5A4C
+C8FC160E5E5E5E5E4B5AED0780030EC9FC5D153E157E15FF5C4A7F4A6C7E140E4A6C7E4A
+6C7E14704A6C7E4A6C7E14804A6C7E6F7EA26F7F707EA2707E707EA2707EA2707E707EA2
+707E707F8484486D497FB6011FEBFF80A339397DB841>75 D<B612E0A3000101C0C8FC6C
+90C9FCB3AD1718A517381730A31770A317F0A216011603160FEE1FE0486D13FFB8FCA32D
+397DB834>I<B5933807FFF86E5DA20001F0FC002600DFC0ED1BF8A2D9CFE01533A3D9C7
+F01563A3D9C3F815C3A2D9C1FCEC0183A3D9C0FEEC0303A2027F1406A36E6C130CA36E6C
+1318A26E6C1330A36E6C1360A26E6C13C0A3913901FC0180A3913900FE0300A2ED7F06A3
+ED3F8CA2ED1FD8A3ED0FF0A3486C6D5A487ED80FFC6D48497EB500C00203B512F8A2ED01
+8045397DB84C>I<B5913807FFFE8080C69238007FE06EEC1F80D9DFF0EC0F001706EBCF
+F8EBC7FCA2EBC3FEEBC1FFA201C07F6E7EA26E7E6E7E81140F6E7E8114036E7E168080ED
+7FC016E0153FED1FF0ED0FF8A2ED07FCED03FEA2ED01FF6F1386A2EE7FC6EE3FE6A2EE1F
+F6EE0FFEA216071603A216011600A2177E486C153E487ED80FFC151EB500C0140EA21706
+37397DB83E>I<EC03FF021F13E09138FE01FC903901F8007ED907E0EB1F8049486D7ED9
+3F80EB07F049C76C7E01FE6E7E48486E7E49157E0003167F4848ED3F80A24848ED1FC0A2
+001F17E049150F003F17F0A3007F17F8491507A300FF17FCAC007F17F86D150FA3003F17
+F0A26C6CED1FE0A36C6CED3FC0000717806D157F000317006C6C15FEA26C6C4A5A017F4A
+5A6D6C495A6D6C495AD907E0EB1F80D903F8017FC7FC903900FE01FC91381FFFE0020390
+C8FC363D7BBA41>I<B712C016F816FE000190398001FF806C90C7EA3FC0EE0FE0EE07F0
+EE03F817FC17FE1601A217FFA717FEA2EE03FCA2EE07F817F0EE0FE0EE3FC0923801FF00
+91B512FC16F091C9FCB3A5487FB6FCA330397DB839>I<B612FEEDFFE016F80001903880
+07FE6C90C76C7EEE3FC0707E707E707EA2707EA283A65FA24C5AA24C5A4C5AEE3F8004FF
+C8FCED07FC91B512E05E9138000FF0ED03F8ED00FE82707E707EA2161F83A583A6F00180
+A217F8160F1803486D01071400B66D6C5A04011306933800FE0ECAEA3FFCEF07F0393B7D
+B83D>82 D<D90FF813C090383FFE0190B512813903F807E33907E000F74848137F484813
+3F48C7121F003E140F007E1407A2007C140312FC1501A36C1400A37E6D14006C7E7F13F8
+6CB47E6C13F8ECFF806C14E06C14F86C14FEC680013F1480010714C0EB007F020713E0EC
+007FED3FF0151F150FED07F8A200C01403A21501A37EA216F07E15036C15E06C14076C15
+C06C140F6DEB1F80D8FBF0EB3F00D8F0FE13FE39E03FFFF8010F13E0D8C00190C7FC253D
+7CBA2E>I<003FB812E0A3D9C003EB001F273E0001FE130348EE01F00078160000701770
+A300601730A400E01738481718A4C71600B3B0913807FF80011FB612E0A335397DB83C>
+I<B6903807FFFEA3000101809038007FE06C90C8EA1F80EF0F001706B3B2170E6D150C80
+171C133F17186D6C14385F6D6C14F06D6C5C6D6C495A6D6CEB07806D6C49C7FC91387F80
+7E91381FFFF8020713E09138007F80373B7DB83E>I<B500FC91387FFF80A30003018091
+380FFC006C90C8EA07E0715A6C705A6E1403017F93C7FCA280013F1506A26E140E011F15
+0C80010F5DA28001075DA26E147001031560A26D6C5CA2806D4A5AA2ED8003027F91C8FC
+A291383FC006A215E0021F5BA2EDF01C020F1318A26E6C5AA215FC02035BA2EDFEE00201
+5BA26E6C5AA36FC9FCA3153EA2151CA3393B7EB83E>I<B5D8FC07B5D8F001B5FCA30007
+902780001FFEC7EA1FF86C48C7D80FF8EC07E000010307ED03C01B807F6C6F6C1500A26E
+5F017F6E6C1406A280013F4A6C5CA280011F4A6D5BEE067FA26D6C010E6D5BEE0C3FA26D
+6C011C6D5BEE181FA26D6C6F5BEE300FA26D6C6F485AEE6007A26D6C4CC7FC9338C003FC
+A203805D913B7F818001FE06A203C1150EDA3FC3C7EAFF0CA203E3151CDA1FE6EC7F98A2
+15F6DA0FFCEC3FF0A302075E4B141FA202035E4B140FA202015E4B1407A2020093C8FC4B
+80503B7EB855>I<007FB590383FFFFCA3C601F801071380D97FE0D903FCC7FC013FEC01
+F06D6C5C5F6D6C5C6D6C13034CC8FC6D6C1306160E6D6C5B6DEB8018163891387FC0306E
+6C5A16E06E6C5A91380FF18015FB6EB4C9FC5D14036E7EA26E7F6F7EA24B7E15DF913801
+9FF09138038FF8150F91380607FC91380E03FE140C4A6C7EEC38000230804A6D7E14E04A
+6D7E49486D7E130391C76C7E01066E7E130E010C6E7E011C1401013C8101FE822607FF80
+010713E0B500E0013FEBFF80A339397EB83E>I<3901800180000313033907000700000E
+130E485B0018131800381338003013300070137000601360A200E013E0485BA400CE13CE
+39FF80FF806D13C0A3007F137FA2393F803F80390E000E001A1974B92A>92
+D<EB1FE0EBFFFC3803E03F3907000F80390F8007E0486C6C7E13E06E7EA26E7E6C5A6C5A
+C8FCA4147FEB07FFEB3FE0EBFE00EA03F8EA0FF0EA1FC0123F485A90C7FC160C12FEA314
+01A26C13036CEB077C903980063E18383FC01E3A0FE0781FF03A03FFF00FE03A007F8007
+C026277DA52A>97 D<EA03F012FFA3120F1203B0EC1FE0EC7FF89038F1E03E9039F3801F
+809039F7000FC001FEEB07E049EB03F049EB01F85BED00FCA216FEA2167E167FAA167E16
+FEA216FC15016D14F8ED03F07F01EEEB07E001C6EB0FC09039C7801F00903881E07E9038
+00FFF8C7EA1FC0283B7EB92E>I<EB03FC90381FFF8090387E03E03901F80070484813F8
+3907E001FC380FC003A2EA1F80123F90380001F848EB00F01500A2127E12FEAA127E127F
+A26C14067F001F140E6D130C000F141C6C6C13386C6C13706C6C13E039007C07C090381F
+FF00EB07F81F277DA525>I<ED0FC0EC03FFA3EC003F150FB0EB03F8EB1FFF90387E078F
+9038F801EF3903F0007F4848133F4848131FA24848130F123F90C7FC5AA2127E12FEAA12
+7E127FA27EA26C6C131FA26C6C133F6C6C137F6C6CEBEFF03A01F801CFFF39007C078F90
+381FFE0FD907F813C0283B7DB92E>I<EB07F8EB1FFF90387C0FC03901F803E03903F001
+F0D807E013F8380FC0004848137CA248C7127E153E5A153F127E12FEA3B7FCA248C8FCA5
+127EA2127FA26C14037F001F14076C6C13060007140E6D131CD801F013386C6C13709038
+7E03E090381FFF80903803FC0020277EA525>I<147E903803FF8090380FC1E0EB1F8790
+383F0FF0137EA213FCA23901F803C091C7FCADB512FCA3D801F8C7FCB3AB487E387FFFF8
+A31C3B7FBA19>I<ED03F090390FF00FF890393FFC3C3C9039F81F707C3901F00FE03903
+E007C03A07C003E010000FECF000A248486C7EA86C6C485AA200075C6C6C485A6D485A6D
+48C7FC38073FFC38060FF0000EC9FCA4120FA213C06CB512C015F86C14FE6CECFF804815
+C03A0F80007FE048C7EA0FF0003E140348140116F8481400A56C1401007C15F06CEC03E0
+003F1407D80F80EB0F80D807E0EB3F003901FC01FC39007FFFF0010790C7FC26387EA52A
+>I<EA03F012FFA3120F1203B0EC0FF0EC3FFCECF03F9039F1C01F809039F3800FC0EBF7
+0013FE496D7EA25BA35BB3A3486C497EB500C1B51280A3293A7EB92E>I<EA0380EA0FE0
+487EA56C5AEA0380C8FCAAEA03F012FFA312071203B3AA487EB512C0A312387EB717>I<
+EB01C0EB07F0EB0FF8A5EB07F0EB01C090C7FCAAEB01F813FFA313071301B3B3A2123C12
+7E00FF13F01303A214E038FE07C0127C383C0F00EA0FFEEA03F8154984B719>I<EA03F0
+12FFA3120F1203B1913801FFFCA39138007FC01600157C15705D4A5A4A5A4AC7FC141E14
+38147814FC13F1EBF3FEEBF73F01FE7FEBF81F496C7E8114076E7E6E7E811400157E157F
+811680ED1FC0486CEB3FF0B500C0B5FCA3283A7EB92C>I<EA03F012FFA3120F1203B3B3
+AD487EB512C0A3123A7EB917>I<2703F00FF0EB1FE000FFD93FFCEB7FF8913AF03F01E0
+7E903BF1C01F83803F3D0FF3800FC7001F802603F70013CE01FE14DC49D907F8EB0FC0A2
+495CA3495CB3A3486C496CEB1FE0B500C1B50083B5FCA340257EA445>I<3903F00FF000
+FFEB3FFCECF03F9039F1C01F803A0FF3800FC03803F70013FE496D7EA25BA35BB3A3486C
+497EB500C1B51280A329257EA42E>I<EB03FE90380FFF8090383E03E09038F800F84848
+137C48487F48487F4848EB0F80001F15C090C712074815E0A2007EEC03F0A400FE15F8A9
+007E15F0A2007F14076C15E0A26C6CEB0FC0000F15806D131F6C6CEB3F006C6C137EC66C
+13F890387E03F090381FFFC0D903FEC7FC25277EA52A>I<3903F01FE000FFEB7FF89038
+F1E07E9039F3801F803A0FF7000FC0D803FEEB07E049EB03F04914F849130116FC150016
+FEA3167FAA16FEA3ED01FCA26DEB03F816F06D13076DEB0FE001F614C09039F7803F0090
+38F1E07E9038F0FFF8EC1FC091C8FCAB487EB512C0A328357EA42E>I<D903F813C09038
+1FFE0190387E07819038FC01C33903F000E3000714774848133749133F001F141F485A15
+0F48C7FCA312FEAA127FA37E6D131F121F6D133F120F6C6C137F6C6C13EF3901F801CF39
+007E078F90381FFE0FEB07F890C7FCABED1FE00203B5FCA328357DA42C>I<3807E01F00
+FFEB7FC09038E1E3E09038E387F0380FE707EA03E613EE9038EC03E09038FC0080491300
+A45BB3A2487EB512F0A31C257EA421>I<EBFF03000313E7380F80FF381E003F487F487F
+00707F12F0A2807EA27EB490C7FCEA7FE013FF6C13E06C13F86C7F00037FC67F01071380
+EB007F141F00C0EB0FC01407A26C1303A37E15806C13077EEC0F00B4131E38F3C07C38E1
+FFF038C03F801A277DA521>I<1318A51338A31378A313F8120112031207001FB5FCB6FC
+A2D801F8C7FCB215C0A93800FC011580EB7C03017E13006D5AEB0FFEEB01F81A347FB220
+>I<D803F0EB07E000FFEB01FFA3000FEB001F00031407B3A4150FA3151F12016D133F00
+00EC77F86D9038E7FF8090383F03C790381FFF87903A03FC07E00029267EA42E>I<B538
+803FFEA33A0FF8000FF06C48EB07E00003EC03C06D148000011500A26C6C1306A26D130E
+017E130CA26D5BA2EC8038011F1330A26D6C5AA214E001075BA2903803F180A3D901FBC7
+FCA214FF6D5AA2147CA31438A227257EA32C>I<B53A1FFFE03FFEA3260FF8009038000F
+F86C48017EEB03E018C00003023EEB0180A26C6C013FEB0300A36C6CEC8006156FA2017E
+9038EFC00C15C7A2D93F016D5A15830281EBF038D91F831430150102C3EBF87090260FC6
+001360A2D907E66D5A02EC137CA2D903FCEB7F804A133FA2010192C7FC4A7FA20100141E
+4A130E0260130C37257EA33C>I<B538807FFFA33A03FE003FF00001EC1F80000092C7FC
+017E131C6D13186D6C5AECC070010F5B6D6C5AECF180EB03FB6DB4C8FC6D5AA2147F804A
+7E8114CF903801C7E090380383F090380703F8EB0601496C7E011C137E49137F01787F49
+6D7E486C80000FEC3FF0D8FFFE90B51280A329247FA32C>I<B538803FFEA33A0FF8000F
+F06C48EB07C00003EC03806C7E16007F00001406A2017E5BA2137F6D5BA26D6C5AA2ECC0
+70010F1360A26D6C5AA214F101035BA2D901FBC7FCA214FF6D5AA2147CA31438A21430A2
+14701460A25CA2EA7C0100FE5B130391C8FC1306EAFC0EEA701C6C5AEA1FF0EA0FC02735
+7EA32C>I<003FB512FCA2EB8003D83E0013F8003CEB07F00038EB0FE012300070EB1FC0
+EC3F800060137F150014FE495AA2C6485A495AA2495A495A495AA290387F000613FEA248
+5A485A0007140E5B4848130C4848131CA24848133C48C7127C48EB03FC90B5FCA21F247E
+A325>I<BD12C0A25202809653>124 D E
+%EndDVIPSBitmapFont
+%DVIPSBitmapFont: Fs cmmi10 10 21
+/Fs 21 123 df<EC3FC0ECFFF8903807E07C90380F801FD93F00EB800C017E130F499038
+07C01C4848ECE018485A484801031338000FEDF0305B001F16704848156017E0007F16C0
+90C713F1178016F34816004815F716FE5EA2485D5EA4007E1407150F003E91381DF81800
+3F14796C02E11338270F8007C013303B07E03F007CF02601FFF8EB3FC026003FC0EB0F80
+2E267DA435>11 D<D803E0137F3A07F801FFE03A0E7C0781F03A1C3E1E00F826383F3813
+FC00305B4A137C00705B00605BA200E090C712FC485A137EA20000140113FE4914F8A215
+0312014914F0A2150712034914E0A2150F12074914C0A2151F120F491480A2153F121F49
+14000007C7FCC85AA2157EA215FEA25DA21401A25DA21403A25DA2EC01C026377EA429>
+17 D<1338017E14F001FEEB07FC151F49133B15F30001EB01C391380383F89039F80700
+E0020E90C7FC00035B1478EBF0E0EBF1C03807F78001FEC9FCEBFFE014FE390FE1FFC090
+38E01FE09038C007F06E7E001F6D7EA2D98000EB0180A2003F150302011400010013F8A2
+485D1606007E0100130E160C00FE151CED7C3848EC1FF00038EC07C029267CA430>20
+D<15FE913803FF8091380F83E091383E01F091387C00F85C494813FC0103147C4948137E
+5C130F495AA249C7FC16FE5B137EA2150113FE4914FCA20001140316F85BED07F01203ED
+0FE04914C0151F000715806DEB3F00157E6D5B390FEE01F09038E707E09038C3FF80D9C0
+FCC7FC001F90C8FCA25BA2123FA290C9FCA25AA2127EA212FEA25AA2127027377EA42B>
+26 D<121C127FEAFF80A213C0A3127F121C1200A412011380A2120313005A1206120E5A
+5A5A12600A19798817>59 D<902603FFF893383FFF80496081D900079438FF80000206DC
+01BFC7FCA2020E4C5A1A7E020C1606190CDA1C7E16FE4F5A02181630A202381661620230
+16C1F00181DA703F158395380303F002601506A202E0ED0C076202C01518183001016D6C
+140F06605B028015C0A20103923801801FDD03005B140092380FC00649173F4D91C8FC01
+065DA2010E4B5B4D137E130C6F6C5A011C17FEDCE1805B011802E3C7FCA2013802E61301
+04EC5C1330ED03F8017016034C5C01F05CD807FC4C7EB500E0D9C007B512F01680150151
+397CB851>77 D<0103B7FC4916E018F8903B0007F80007FC4BEB00FE187F020FED3F80F0
+1FC05DA2021F16E0A25DA2143FF03FC05DA2027FED7F80A292C8130018FE4A4A5A604AEC
+07F04D5A0101ED3FC04CB4C7FC91B612FC17E0D903FCCAFCA25CA21307A25CA2130FA25C
+A2131FA25CA2133FA25CA2137FA291CBFC497EB6FCA33B397DB835>80
+D<0103B612F849EDFF8018E0903B0007F8001FF84BEB03FCEF00FE020F157FA24BEC3F80
+A2021F16C0A25DA2143FF07F805DA2027FEDFF006092C7485A4D5A4A4A5A4D5A4AEC1F80
+057FC7FC0101EC07F891B612E094C8FC9139FC000FC00103EC03F0707E4A6D7E83130717
+7E5C177F010F5D5F5CA2011F1401A25CA2133F16034A4A1360A2017F17E019C091C71401
+496C01011480B61503933900FE0700EF7E0ECAEA1FFCEF07F03B3B7DB83F>82
+D<0003B812FEA25A903AF8003FC00101C0913880007E4848163C90C7007F141C121E001C
+92C7FCA2485CA200305C007017180060130112E0485CA21403C716005DA21407A25DA214
+0FA25DA2141FA25DA2143FA25DA2147FA292C9FCA25CA25CA21301A25CA21303A25CEB0F
+FC003FB6FC5AA237397EB831>84 D<267FFFFC91383FFFC0B55DA2000390C83807FC006C
+48ED03E06060000094C7FC5F17065FA25F6D5DA26D5D17E05F4C5AA24CC8FC6E1306A201
+3F5C161C16185EA25E6E5BA2011F495A150393C9FC1506A25D6E5AA2010F5B157015605D
+A2ECE18002E3CAFC14F3EB07F614FE5C5CA25C5CA26D5AA25C91CBFC3A3B7CB830>86
+D<147E903803FF8090390FC1C38090391F00EFC0017E137F49133F485A4848EB1F801207
+5B000F143F48481400A2485A5D007F147E90C7FCA215FE485C5AA214015D48150CA21403
+EDF01C16181407007C1538007E010F1330003E131F027B13706C01E113E03A0F83C0F9C0
+3A03FF007F80D800FCEB1F0026267DA42C>97 D<EC3FC0903801FFF0903807E03C90380F
+800E90383F0007017E131F49137F484813FF485A485A120F4913FE001F143848481300A2
+127F90C8FCA35A5AA45AA315031507007E1406150E003E143C003F14706C14E0390F8007
+C03907C03F003801FFF838003FC020267DA424>99 D<EC3FC0903801FFF0903807E07890
+381F801C90387E001E49130E485A485A1207485A49131E001F141C153C484813F8EC03E0
+007FEB3FC09038FFFE0014E090C8FC5A5AA7007E140315071506003E140E153C6C14706C
+6C13E0EC07C03903E03F003801FFF838003FC020267DA427>101
+D<D803E0137F3A07F801FFE03A0E3C0781F03A1C3E1E00F826383F387F00305B4A137C00
+705B00605BA200E090C712FC485A137EA20000140101FE5C5BA2150300015D5B15075E12
+0349010F133016C0031F13700007ED80605B17E0EE00C0000F15014915801603EE070000
+1FEC0F0E49EB07FC0007C7EA01F02C267EA432>110 D<3903E001F83907F807FE390E3C
+1E07391C3E381F3A183F703F800038EBE07F0030EBC0FF00705B00601500EC007E153CD8
+E07F90C7FCEAC07EA2120013FE5BA312015BA312035BA312075BA3120F5BA3121F5B0007
+C9FC21267EA425>114 D<14FF010313C090380F80F090383E00380178131C153C4913FC
+0001130113E0A33903F000F06D13007F3801FFE014FC14FF6C14806D13C0011F13E01303
+9038003FF014071403001E1301127FA24814E0A348EB03C012F800E0EB07800070EB0F00
+6C133E001E13F83807FFE0000190C7FC1E267CA427>I<EB01C0497E1307A4130F5CA313
+1F5CA3133F91C7FC007FB51280A2B6FCD8007EC7FCA313FE5BA312015BA312035BA31207
+5BA3120FEBC006A2140E001F130CEB801C141814385C146014E0380F81C038078780D803
+FEC7FCEA00F819357EB31E>I<01F816F0D803FE9138E001F8D8070F903801F003000ED9
+800314FC121C12180038020713010030EDE000D8701F167C1260030F143CD8E03F163800
+C001005B5BD8007E131F183001FE5C5B033F1470000117604991C7FCA218E000034A14C0
+49137E17011880170318005F03FE1306170E000101015C01F801BF5B3B00FC039F807090
+3A7E0F0FC0E0903A1FFC03FFC0902703F0007FC7FC36267EA43B>119
+D<903907E001F090391FF807FC9039783E0E0F9039E01F1C1FD801C09038383F803A0380
+0FF07F0100EBE0FF5A000E4A1300000C157E021F133C001C4AC7FC1218A2C7123FA292C8
+FCA25CA2147EA214FEA24A130CA20101141C001E1518003F5BD87F81143801835C00FF15
+60010714E03AFE0E7C01C0D87C1C495A2778383E0FC7FC391FF00FFC3907C003F029267E
+A42F>I<13F8D803FE1470D8070F14F8000EEB8001121C121800381403003015F0EA701F
+1260013F130700E0010013E012C05BD8007E130F16C013FE5B151F000115805BA2153F00
+0315005BA25D157EA315FE5D1401000113033800F80790387C1FF8EB3FF9EB0FE1EB0003
+5DA2000E1307D83F805B007F495AA24A5A92C7FCEB003E007C5B00705B6C485A381E07C0
+6CB4C8FCEA01FC25367EA429>I<D901E01360D90FF813E0496C13C090383FFE0190397F
+FF038090B5EA07009038F81FFF3901E003FE9038C0001C495B5DC85A4A5A4A5A4AC7FC14
+0E5C5C14F0495AEB038049C8FC130E5B4913035B495B484813064848130E48C75AD80FFC
+137C391FFF81F8381E0FFFD838075B486C5B00605CD8E00190C7FC38C0007C23267DA427
+>I E
+%EndDVIPSBitmapFont
+%DVIPSBitmapFont: Ft cmbx12 12 28
+/Ft 28 122 df<ED0FFF4AB512C0020F14F0027F80903A01FFF803FC499038C000FE010F
+EB00034948497E49485B5C495A4C138001FF6E13005CA3705AEE01F893C8FCA74BB51280
+B9FCA5C69038E00003B3B0007FD9FFC1B6FCA538467EC53E>12 D<DCFFF01470031F01FF
+14F04AB6EAE0010207EDF803023FEDFE0791B539E001FF0F4949C7EA3F9F010701F0EC0F
+FF4901C0804990C87E4948814948814948167F4849163F4849161F5A4A160F485B190748
+90CAFC19035A5BA2007F1801A34994C7FC12FFAE127F7F1AF0A2123FA27F6C18011AE06C
+7F19036C6D17C06E16077E6C6DEE0F806C6DEE1F006D6C5E6D6C167E6D6C6C5D6D6D4A5A
+6D01F0EC07F0010101FEEC1FE06D903AFFF001FF80023F90B6C7FC020715FC020115F0DA
+001F1480030001F8C8FC44467AC451>67 D<B9FC18F018FE727E19E026003FFEC7001F13
+F805017F9438003FFF060F7F727F727F727F84737E737EA2737EA2737EA21B80A2851BC0
+A51BE0AD1BC0A51B8061A21B006162193F624F5A19FF624E5B06075B4E5B063F90C7FC4D
+B45A050F13F8BA5A19C04EC8FC18F095C9FC4B447CC356>I<DCFFF01470031F01FF14F0
+4AB6EAE0010207EDF803023FEDFE0791B539E001FF0F4949C7EA3F9F010701F0EC0FFF49
+01C0804990C87E4948814948814948167F4849163F4849161F5A4A160F485B19074890CA
+FC19035A5BA2007F1801A34994C8FC12FFAD057FB612F0127F7FA3003FDC0001EBF000A2
+7F7EA26C7FA26C7F807E6C7F6C7F6D7E6D6C5D6D6C7E6D6D5C6D01F05C010101FE143F6D
+903AFFF001FF9F023F90B6120F0207EDFC030201EDF000DA001F02C01330030001FCC9FC
+4C467AC458>71 D<B712E0A5D8001F90C7FCB3B3B3A4B712E0A523447DC32A>73
+D<B500FE067FB512806E95B6FCA26F5EA2D8003F50C7FC013D6DEE03DFA2013C6DEE079F
+A26E6CEE0F1FA26E6C161EA26E6C163CA36E6C1678A26E6C16F0A26E6DEC01E0A26E6DEC
+03C0A36E6DEC0780A26F6CEC0F00A26F6C141EA26F6C5CA36F6C5CA26F6C5CA26F6D485A
+A26F6D485AA26F6D485AA3706C48C7FCA293383FF81EA2706C5AA2706C5AA3706C5AA270
+5BA2705BA2705BA2B6057FB6128071C7FCA2173E171C61447CC36A>77
+D<B64BB512FE8181A281D8003F6D91C7EA780081013D7F81133C6E7E6E7F6E7F6E7F6E7F
+82806E7F6E7F6F7E6F7F83816F7F6F7F6F7F6F7F6F7F8382707F707F707F707F8482707F
+707F717E7113807113C019E0837113F07113F87113FC7113FE19FF847213F884848484A2
+8484197F193F191FA2190F1907B61603190119001A78A24F447CC358>I<B812F8EFFFC0
+18F818FE727ED8001F90C7003F13E005037F05007F727E727E727EA28684A286A762A24E
+90C7FCA24E5A61187F943801FFF005075B053F138092B7C8FC18F818E018F892C77FEF3F
+FF050F7F717F717FA2717FA2717FA785A61B0F85A2187F73131F72141EB700E06DEB803E
+72EBE0FC72EBFFF8060114F0726C13E0CC0007138050457DC354>82
+D<903801FFE0011F13FE017F6D7E48B612E03A03FE007FF84848EB1FFC6D6D7E486C6D7E
+A26F7FA36F7F6C5A6C5AEA00F090C7FCA40203B5FC91B6FC1307013F13F19038FFFC0100
+0313E0000F1380381FFE00485A5B127F5B12FF5BA35DA26D5B6C6C5B4B13F0D83FFE013E
+EBFFC03A1FFF80FC7F0007EBFFF86CECE01FC66CEB8007D90FFCC9FC322F7DAD36>97
+D<EC3FFC49B512C0010F14F0013F14FC90397FF003FE9039FFC001FF0003495A48494813
+805B120F485AA2485A6F1300007F6E5AED00784991C7FCA212FFAC6C7EA3123F6DEC03C0
+A26C6C1407000F16806D140F6C6DEB1F006C6D133E6C01F05B3A007FFC03F86DB55A010F
+14C0010391C7FC9038003FF82A2F7CAD32>99 D<EE03FEED07FFA5ED001F160FB1EC3FE0
+903803FFFC010FEBFF8F013F14CF9039FFF807FF48EBC00148903880007F4890C7123F48
+48141F49140F121F485AA3127F5BA212FFAC127FA37F123FA26C6C141FA26C6C143F0007
+157F6C6C91B5FC6CD9C00314FC6C9038F01FEF6DB5128F011FEBFE0F010713F89026007F
+C0EBF80036467CC43E>I<EC3FF80103B57E010F14E0013F8090397FF83FF89039FFC007
+FC48496C7E48496C7E48486D1380485A001FED7FC05B003FED3FE0A2127F5B17F0161F12
+FFA290B7FCA401F0C9FCA5127FA27FA2123F17F06C7E16016C6C15E06C6C14036C6DEB07
+C06C6DEB0F806C01F0EB3F0090397FFE01FE011FB55A010714F0010114C09026001FFEC7
+FC2C2F7DAD33>I<EDFF80020F13E0027F13F049B512F849EB8FFC90390FFE0FFE90381F
+FC1F14F8133FEB7FF0A2ED0FFCEBFFE0ED03F0ED00C01600ABB612F8A5C601E0C7FCB3B0
+007FEBFFE0A527467DC522>I<DAFFE0137E010F9039FE03FF80013FEBFF8F90B812C048
+D9C07F133F489038001FF84848EB0FFC4848903907FE1F80001F9238FF0F00496D90C7FC
+A2003F82A8001F93C7FCA26D5B000F5D6C6C495A6C6C495A6C9038C07FF04890B55A1680
+D8078F49C8FC018013E0000F90CAFCA47F7F7F90B612C016FC6CEDFF8017E06C826C16FC
+7E000382000F82D81FF0C77ED83FC014074848020113808248C9FC177FA46D15FF007F17
+006D5C6C6C4A5A6C6C4A5AD80FFEEC3FF83B07FFC001FFF0000190B612C06C6C92C7FC01
+0F14F8D9007F90C8FC32427DAC38>I<EB7FC0B5FCA512037EB1ED07FE92383FFF8092B5
+12E002C114F89139C7F03FFC9138CF801F9139DF000FFE14DE14FC4A6D7E5CA25CA35CB3
+A7B60083B512FEA537457CC43E>I<137C48B4FC4813804813C0A24813E0A56C13C0A26C
+13806C1300EA007C90C7FCAAEB7FC0EA7FFFA512037EB3AFB6FCA518467CC520>I<EB7F
+C0B5FCA512037EB293387FFFE0A593380FE0004C5A4CC7FC167E5EED03F8ED07E04B5A4B
+5A037FC8FC15FEECC1FCECC3FE14C7ECDFFF91B57E82A202F97F02E17F02C07FEC807F6F
+7E826F7E816F7F836F7F816F7F83707E163FB60003B512F8A535457DC43B>107
+D<EB7FC0B5FCA512037EB3B3B3A3B61280A519457CC420>I<90277F8007FEEC0FFCB590
+263FFFC090387FFF8092B5D8F001B512E002816E4880913D87F01FFC0FE03FF8913D8FC0
+0FFE1F801FFC0003D99F009026FF3E007F6C019E6D013C130F02BC5D02F86D496D7EA24A
+5D4A5DA34A5DB3A7B60081B60003B512FEA5572D7CAC5E>I<90397F8007FEB590383FFF
+8092B512E0028114F8913987F03FFC91388F801F000390399F000FFE6C139E14BC02F86D
+7E5CA25CA35CB3A7B60083B512FEA5372D7CAC3E>I<EC1FFC49B512C0010714F0011F14
+FC90397FF80FFF9026FFC0017F48496C7F4848C7EA3FE000078248486E7E49140F001F82
+A2003F82491407007F82A400FF1780AA007F1700A46C6C4A5AA2001F5E6D141F000F5E6C
+6C4A5AA26C6C6CEBFFE06C6D485B27007FF80F90C7FC6DB55A010F14F8010114C0902600
+1FFCC8FC312F7DAD38>I<90397FC00FF8B590B57E02C314E002CF14F89139DFC03FFC91
+39FF001FFE000301FCEB07FF6C496D13804A15C04A6D13E05C7013F0A2EF7FF8A4EF3FFC
+ACEF7FF8A318F017FFA24C13E06E15C06E5B6E4913806E4913006E495A9139DFC07FFC02
+CFB512F002C314C002C091C7FCED1FF092C9FCADB67EA536407DAC3E>I<90387F807FB5
+3881FFE0028313F0028F13F8ED8FFC91389F1FFE000313BE6C13BC14F8A214F0ED0FFC91
+38E007F8ED01E092C7FCA35CB3A5B612E0A5272D7DAC2E>114 D<90391FFC038090B512
+87000314FF120F381FF003383FC00049133F48C7121F127E00FE140FA215077EA27F01E0
+90C7FC13FE387FFFF014FF6C14C015F06C14FC6C800003806C15806C7E010F14C0EB003F
+020313E0140000F0143FA26C141F150FA27EA26C15C06C141FA26DEB3F8001E0EB7F0090
+38F803FE90B55A00FC5CD8F03F13E026E007FEC7FC232F7CAD2C>I<EB01E0A51303A413
+07A2130FA2131FA2133F137F13FF1203000F90B51280B7FCA4C601E0C7FCB3A3ED01E0A9
+150302F013C0137F150790393FF80F8090391FFC1F006DB5FC6D13FC01015B9038003FE0
+23407EBE2C>I<D97FC049B4FCB50103B5FCA50003EC000F6C81B3A85EA25EA25E7E6E49
+1380017FD901F713FE9138F807E76DB512C7010F1407010313FE9026007FF0EBFC00372E
+7CAC3E>I<B6903803FFFCA5000101E09038003E006C163C80017F5D8017F8013F5D6E13
+01011F5D6E1303010F5D6E13076D5DED800F6D92C7FC15C05E6DEBE01E163E6D143CEDF0
+7C027F1378EDF8F8023F5B15FD021F5B15FF6E5BA36E5BA26E90C8FCA26E5AA26E5AA215
+78362C7EAB3B>I<B6903803FFFCA5000101E09038003E006C163C80017F5D8017F8013F
+5D6E1301011F5D6E1303010F5D6E13076D5DED800F6D92C7FC15C05E6DEBE01E163E6D14
+3CEDF07C027F1378EDF8F8023F5B15FD021F5B15FF6E5BA36E5BA26E90C8FCA26E5AA26E
+5AA21578A215F85D14015D001F1303D83F805B387FC007D8FFE05B140F92C9FC5C143E49
+5A387FC1F8EB07F06CB45A6C5B000790CAFCEA01FC36407EAB3B>121
+D E
+%EndDVIPSBitmapFont
+%DVIPSBitmapFont: Fu cmbx8 8 37
+/Fu 37 123 df<91393FF803FE0103B5381FFF80010F91B512C090263FF01F131F903BFF
+803FFC3FE048010013F85B000315F05B031FEB1FC0030FEB020094C7FCA5B812F0A42803
+FC000FF0C7FCB3A4263FFFC0B57EA4332E7FAD2F>11 D<EC1FF80103B5FC010F14809039
+3FF00FC0D9FF8013E048EB001F5B0003EC3FF049EB1FE0A3ED078092C7FCA3EDFFF0B7FC
+A43903FC000FB3A4263FFFC0B5FCA4282E7FAD2D>I<91383FFCF00103B5FC130F90383F
+F01F9038FF803F4813005B120349131F150FA7B7FCA43903FC000FB3A4263FFFC0B5FCA4
+282E7FAD2D>I<121FEA3F80EA7FC0EAFFE0A213F0A3127F123FEA1F70120013F013E0A2
+120113C01203EA0780A2EA0F00123E123C12180C187A8A17>44 D<B512F8A715077F921B
+>I<121FEA3F80EA7FC0EAFFE0A5EA7FC0EA3F80EA1F000B0B7A8A17>I<150E151FA2153F
+153E157E157CA215FC15F8140115F0140315E0A2140715C0140F1580141F1500A25C143E
+147E147C14FC5C13015CA213035C13075C130F5CA2131F91C7FC5B133E137E137C13FC5B
+A212015B12035B12075BA2120F5B121F90C8FC5A123EA2127E127C12FC5AA2127020437C
+B129>I<15FCA24A7EA24A7EA34A7FA24A7FA34A7F157F023F7FEC3E3F027E7FEC7C1FA2
+02FC7FECF80F010180ECF007A20103804A7E0107814A7EA2010F6D7F5C49B67EA24981A2
+013EC7123F017E81017C141F01FC8149140FA2000182491407B5D8C001B512FCA4362F7D
+AE3D>65 D<B812C0A40001D9800013E0161F160F16071603A21601A3031E13F01600A317
+00153E157E15FE14FFA41480157E153E151EA592C8FCA9B612C0A42C2E7DAD33>70
+D<B6FCA400011380B3B3A2B6FCA4182E7DAD1E>73 D<90391FF8038090B51207000314CF
+4814FF381FF00FEBC001393F80007F48C7123F007E141FA200FE140FA215077E7F6D90C7
+FC13F06CB4FC14F0ECFF806C14E06C14F86C14FE6C806C1580C615C0131F010114E0EB00
+0F020013F0153F151F150F12F01507A37E16E06C140F6C15C06C141F01C0EB3F8001FCEB
+FF0090B55A00F95CD8F03F13F0D8E003138024307CAE2D>83 D<003FB8FCA4287FE00FFC
+0113800180EC007FD87E00151F007C160FA200781607A448EE03C0A4C792C7FCB3A6013F
+B6FCA4322D7DAC39>I<EB7FF80003B5FC000F14C0391FE01FF09038F007F86E7EA26E7E
+EA0FE0EA07C0C7FCA214FF133F48B5FC000713C1381FFC01EA3FE0EA7FC0EAFF801300A3
+140313806C6C487E263FF03F13F8381FFFFE0007EBF87FC6EBC01F251E7E9D28>97
+D<EA03F012FFA4120FABEC3FE09038F1FFFC01F713FFD9FFC013809039FE003FC049EB1F
+E049EB0FF05B16F8150716FCA916F8A2150F16F06D131F6D14E06DEB3FC09039DF80FF80
+9039C7FFFE00018113F89038007FC0262E7DAD2D>I<EB0FFE90387FFFC048B512F03907
+FC07F8380FF00FEA1FE0123F13C0007FEB07F090388003E091C7FC12FFA8127F7FA26C6C
+133CA26C6C137C6C6C13F83907FE03F00001B512E06C6C138090380FFC001E1E7D9D24>
+I<ED0FC0EC03FFA4EC003FABEB0FF8EB7FFF48B6FC3807FC07380FF001391FE0007F003F
+143F5B127F5BA212FFA9127F7F123F157F6C6C13FF380FF0032607FC0F13FC0001B512BF
+6CEBFE3FEB1FF0262E7DAD2D>I<EB0FFC90387FFF8048B512E03907FC0FF0390FF003F8
+391FE001FC1400484813FE007F147E5B157F12FFA290B6FCA30180C7FCA3127F7FA2003F
+140F6C7E6C6C131F6C6C137E3903FE01FC6CB512F86C6C13E001071300201E7E9D25>I<
+ECFF80010713E0011F13F0EB7FC79038FF0FF8EA01FEA2EA03FCA2EC07F0EC00801500A5
+B512FCA4D803FCC7FCB3A4383FFFE0A41D2E7EAD19>I<ED07C090391FF81FF090B5EA7F
+F8000314FD3907F81FF3380FE007001F14F99039C003F8F0003FECFC00A6001F5CEBE007
+000F5C3907F81FE090B55A4891C7FCEB1FF8001EC9FC121FA27F90B512C06C14F815FF6C
+158016C04815E0123F48C7EA3FF000FE140F4814071503A36C1407007FEC0FE06C6CEB1F
+C0D81FF0EBFF800007B5EAFE00000114F8D8001F1380252D7E9E29>I<EA03F012FFA412
+0FABEC1FF0EC7FFC01F1B5FCD9F7E013809038FF807FD9FE0013C049133FA25BA25BB0B5
+3803FFFCA4262E7CAD2D>I<EA07C0EA0FE0EA1FF0EA3FF8A5EA1FF0EA0FE0EA07C0C7FC
+A6EA03F012FFA4120FB3A3B5FCA4102F7CAE17>I<EB01F0EB03F8EB07FCEB0FFEA5EB07
+FCEB03F8EB01F090C7FCA6147EEB3FFEA41301B3A9121C123E127FEAFF81EB83FCA2EB87
+F8387F0FF0383FFFE06C13803807FE00173C84AE19>I<EA03F012FFA4120FAB913803FF
+F0A4913800FC00EC03F84A5AEC0FC0EC3F804AC7FC14FCEBF1F8EBF7FCEBFFFE80A2497F
+9038F87FC0496C7E496C7E6E7EA26E7E6E7E6E7E6E138026FFFE0313FCA4262E7DAD2B>
+I<EA03F012FFA4120FB3B3B5FCA4102E7CAD17>I<2707E00FF8EB1FF000FFD97FFEEBFF
+FC01E1B5008313FF9028E7E07FCFC01380903BEF803FDF007F260FFE0013FC031FEC3FC0
+495C495CA2495CB0B53B01FFFE03FFFCA43E1E7C9D45>I<3907E01FF000FFEB7FFC01E1
+B5FCD9E7E013809038EF807F260FFE0013C049133FA25BA25BB0B53803FFFCA4261E7C9D
+2D>I<EB07FE90387FFFE048B512F83903FC03FC3907F000FE4848137F4848EB3F80003F
+15C049131F007F15E0A200FF15F0A8007F15E0A26D133F003F15C0001F15806D137F6C6C
+EBFF003903FC03FC6CB55A6C6C13E0D907FEC7FC241E7E9D29>I<3903F03FE039FFF1FF
+FC01F713FFD9FFC013809039FE007FC0D80FFCEB3FE049EB1FF05BED0FF8A216FC1507A8
+ED0FF8A3ED1FF07F6DEB3FE06DEB7FC09039FF81FF809039F7FFFE0001F113F89038F07F
+C091C8FCA9B5FCA4262B7D9D2D>I<90390FF003C090387FFE0748B512873907FE07CF39
+0FF803FF48487E48487E157F4848133FA3485AA87F127FA26C6C137F15FF6C7E380FF803
+3807FC0F0001B512BF39007FFE3FEB1FF090C7FCA9913803FFFCA4262B7D9D2B>I<3807
+E07E39FFE1FF8001E313E0EBE78F9038EF1FF0EA0FFE13FCA29038F80FE0EC07C091C7FC
+5BAFB57EA41C1E7D9D22>I<3801FF8E000713FE121FEA3F00007C137E0078133E00F813
+1EA27EB490C7FC13F0EBFF806C13E06C13F86C13FE7E00037FD8003F13801300143F00F0
+131F140F7EA26CEB1F007E38FF807EEBFFFC00FB13F000E01380191E7D9D20>I<133CA4
+137CA313FCA2120112031207001FB5FCB6FCA3D803FCC7FCAEEC03C0A61407D801FE1380
+EBFF0F6CEBFF00EB3FFCEB0FF01A2A7FA920>I<D803F0EB0FC000FFEB03FFA4000FEB00
+3FB1157FA215FF00075BD9F80713FC6CB512BFC6EBFE3FEB3FF0261E7C9D2D>I<B5EB3F
+FCA4D80FF8EB07C0000715806D130F000315006D5B0001141E6D133E6C143CEC807C017F
+1378ECC0F8013F5B14E1011F5B14F3010F5B14FF6D5BA26D90C7FCA26D5AA26D5AA21478
+261E7E9D2B>I<3CFFFE0FFFC03FFCA43C0FF000FE0003C06D017F130700074A1480EE80
+0F6C6C16005CD801FEECC01E5C01FF9038CFE03E6C163CDA0787137CD97F87EBF078148F
+9139CF03F8F8D93FDF5C9138DE01FDD91FFE5CA26D486CB45AA24A137F01075D4A133F01
+0392C7FCA26D48131E361E7E9D3B>I<B5EB3FFCA4D80FF8EB07C0000715806D130F0003
+15006D5B0001141E6D133E6C143CEC807C017F1378ECC0F8013F5B14E1011F5B14F3010F
+5B14FF6D5BA26D90C7FCA26D5AA26D5AA21478A25CA2EA3C01007E5BEAFF03495A5C011F
+C8FCEA7A3EEA7FFC6C5AEA0FC0262B7E9D2B>121 D<003FB512FCA39038C00FF8903800
+1FF0003E133F48EB7FE0ECFFC049138000781400495A1307C6485A495A5C495A017F133C
+EBFFC048138014004848137C1207485A484813F8485AEBE003387FC00FB6FCA31E1E7E9D
+24>I E
+%EndDVIPSBitmapFont
+%DVIPSBitmapFont: Fv cmbxti10 8 21
+/Fv 21 120 df<120FEA3FC0127FA212FFA31380EA7F00123C0A0A788918>46
+D<1378EA01FE1203A21207A313FCEA03F8EA01E0C7FCAA120FEA3FC0127FA212FFA31380
+EA7F00123C0F1E789D18>58 D<90261FFFF090380FFFFCA281D9007F9138003E006F143C
+A28102FF157CDAFBFF147814F302F17F010116F802F06D5B5C6F7E01031501DB3FF05B14
+C0ED1FF801071503DB0FFC5B1480ED07FE010F1507DB03FF5B14006F138749158F6F01CF
+C7FC131EEE7FEF013E15FF705A133C161F137C705A1378160713F8705A5B00011501B512
+E0705A5C3E2E7CAD3C>78 D<EB03F0EB0FFE90383FFF709038FE0FF83801FC07EA03F838
+07F003120FEBE007121F01C05B123F140F127F01805BA2141F12FF01005BA291383FC7C0
+A248EC8780A2EC7F8F007E1500007FEBFF0F49131ED83F8713BE391FFF9FFC0007EB0FF8
+3901F803E02220799E27>97 D<137EEA1FFEA312015BA312035BA312075BA2EBF3F8380F
+FFFE809038FC1F809038F80FC0D81FF013E013E013C0A2123F1380A2141F127F1300A214
+3F4814C05AA2EC7F80A24814005C5C6C485AEA7E035C383F0FE06CB45A6C90C7FCEA01F8
+1B2F79AD23>I<EB01FCEB0FFF013F13C0EB7F073901FE03E03803FC0F3807F81F13F0EA
+0FE0001F14C0A2393FC00F0091C7FC127F5BA312FF90C8FCA54814C0007FEB01E0140314
+07393F801FC0391FC0FF006CB45A000313F8C613801B20799E23>I<ED0FC0EC03FFA3EC
+003F1680A2157FA21600A25DA25DA2EB03F1EB0FFF013F5BEBFE0F3801FC07EA03F84848
+6C5A120FEBE007121F01C05B123F140F127F01805BA2141F12FF01005BA291383FC7C0A2
+48EC8780A2EC7F8F007E1500007FEBFF0F49131ED83F8713BE391FFF9FFC0007EB0FF839
+01F803E0222F79AD27>I<EB01FE90380FFF80013F13C090387F07E03901FE03F03803F8
+011207EA0FF0EBE003001F14E0EBC007003FEB0FC0143F397FC3FF00EBFFFE14F049C7FC
+EAFF8090C8FCA515C06CEB01E014031407393F801FC0391FC0FF006CB45A000313F8C613
+801C20799E23>I<EB1F80EA07FFA3EA007F91C8FCA25BA25BA21201A25BA20003EB3F80
+ECFFE001FB13F89038FFC1FC481301EBFE005B5B380FF001A213E0A2001F13035D13C0A2
+003F13075D1380140F007FECE1F0141F0100EBC1E0A248ECC3C0EC3F8348EC8780EC1F8F
+ED9F0048EB0FFE6E5A0070EB01F0242F7BAD27>104 D<EB01C0EB07E0EB0FF0A314E014
+C0EB078090C7FCA813F8EA03FEEA0FFFEB1F80121EEA3C3FA21278137F00F8130012F05B
+C65AA212015B12035BA21207EBF0F8120FEBE0F0A2EBE1E0EA1FC1EBC3C0EA0FC7EBCF80
+3807FF006C5AEA00F815307BAE18>I<15F0EC01F814031407A3EC03F0EC01C091C7FCA8
+147CEB03FF49138090380F8FC090381E0FE0133C137C13F8EBF01F120101E013C0A2C7FC
+143F1580A2147FA21500A25CA25CA21301A25CA21303A25CA21307A25C121CEA7F0F00FF
+5B495A133F5C48B4C7FCEAFFFCEA7FF0EA1F801D3D82AE18>I<133FEA0FFFA3C6FC13FE
+A21201A213FCA21203A213F8A21207A213F0A2120FA213E0A2121FA213C0A2123FA21380
+A2127FA21300A2EAFF1FA2EAFE1EA2133E133C12FC1378EAFEF8EA7FF0EA3FE0EA0F8010
+2F7AAD14>108 D<2703E001FCEB3F80270FF80FFFEBFFE0261FFC3F01C313F83C1E7E7C
+1FCFC1FC3B3C7FF00FFF0102E0EBFE000078496C5A02805B01FF90380FF00100F8130048
+4814E0A20001021F1303604914C0A20003023F130760491480170F0007027FECE1F0171F
+490200EBC1E0A2000F4AECC3C0EF3F834949EC8780EF1F8FF09F004949EB0FFE715A6CC7
+0070EB01F03C207B9E3F>I<3903E003F8390FF80FFE3A1FFC3FFF803A1E7EFC1FC0383C
+7FF0ECE00F007813C014809038FF001F12F8485AA20001143F16805BA20003147F16005B
+5D0007ECFE1F140101F0EBFC1EA2000F153CEC03F801E01478020113F8EDF9F09039C000
+FFE0ED7FC06CC7EA1F0028207B9E2B>I<EB01FE90380FFFC0013F13F090387F03F83901
+FE01FCEA03FC3907F800FE5B485A121FA2485A1401127F1380A2140300FF14FC1300A2EC
+07F8A215F048130F007FEB1FE015C0EC3F80393F807F00381FC1FE380FFFF8000313E0C6
+90C7FC1F20799E27>I<013E13FE9039FF83FF804801CF13C09039E7FF07E03A03C7FE03
+F002FC13F8380787F814F0138F120FEB0FE0A2D8001F1307A214C0A2013F130F16F01480
+A2017FEB1FE0A2020013C0153F491480ED7F005D6E5A48EBC3F8ECFFF001FD13C0D9FC7E
+C7FC000390C8FCA25BA21207A25BA2120FEA7FFFB5FCA2252C7F9E27>I<3903E00FC039
+07F83FF0391FFCFFF8391E7FF07C003CEBE03EECC0FE00781381140113FF00F814FCEAF0
+FEEC00F000011400A25BA21203A25BA21207A25BA2120FA25BA35BA26CC8FC1F207B9E21
+>114 D<EB07F0EB1FFCEB7FFFEBFC1F3901F80F80EBF01F3803E03FA212071500EBF01E
+6DC7FCEBFFC06C13F0806C7F6C7F133F1303EB007F123E007F133E5AA2147E48137C4813
+FC48485A387E03F06CB45A6C1380D803FCC7FC19207A9E20>I<130FEB1F80133FA2137F
+A21400A25BA25BA21201B512F8A33803FC00A25BA21207A25BA2120FA25BA2121FA25BA2
+003F137CA2EB807814F814F0EB81E01303EB07C0EB8F80381FFF00EA0FFCEA03F0162C7A
+AA1A>I<13F8D803FE1307D80FFFEB1FC0EB1F80001E143FD83C3F1480A21278017F137F
+00F80100130012F05BC6485B5D12015B140100035C13F8A20203137C000714F801F01478
+A216F8020713F00003EB0FF09039F81FF1E03901FC3FFB9039FFFDFFC026007FF0138090
+391FC03E0026207B9E29>I<01F81570D803FE90380E01FCD80FFFEB3F83261F3F8014FE
+D81E1F137FD83C3F1403127C00781501017FEBFF0000F84948137C12F05B3800FE014B13
+78120113FC020314F8000316F001F85BA216010007010714E001F013F0EE03C0A20003ED
+07809038F80FF8021FEB0F003A01FC3FFC1E3A00FFFCFFFC90393FF83FF890390FE00FE0
+2F207B9E33>119 D E
+%EndDVIPSBitmapFont
+%DVIPSBitmapFont: Fw cmti12 12 33
+/Fw 33 122 df<DDFF80EB07FF040701E0013FEBE0FC93261F80F89038FE01F8933C7E00
+3C03F0003D4C90267C07E0EB7DF84B489026FE0FC013FF922603F00149485A05034A5ADB
+07E04A15F0F0FC3E942601F87EEB01FB92270FC000F0EC00F7DE00FEEC07E061151F4C17
+0F060116C061153F93C7161F1D801803611C3F4B1900157E180791BCFC64A2DA00FCC7D8
+07E0C7127E060F15FE646114014B170164181F61020318034B60A2183F96C71207020761
+5DA24E140F067E5D140F5D1B1F06FE5D60141F4B053F13E01C01050117C060A2023FF07F
+0392C7047E138017034E15071D00027E183E1C0E0507ED1E1E4EEC1F1C02FEF007F84AF0
+01E04D4891C8FCA25C13014D5AA24A92CBFCD81C031338007FD9E0FE5B00FF01E1143E01
+075D14C102815CD8FE0F49485A00F8903901F003E03B701E00E007C0D8783CD9781FCCFC
+D81FF8EB3FFCD807E0EB07F05E5A83C557>15 D<13F0EA03FC1207A2EA0FFEA4EA07FCEA
+03CCEA000C131C1318A2133813301370136013E0EA01C013801203EA0700120E5A5A5A5A
+5A0F1D7A891E>44 D<16C01501A215031507ED0F80151F153F157F913801FF005C140F14
+7F903807FCFEEB0FF0EB0700EB00015DA314035DA314075DA3140F5DA3141F5DA3143F5D
+A3147F92C7FCA35C5CA313015CA313035CA313075CA2130FA2131F133FB612FCA25D2242
+76C132>49 D<ED3FC0913801FFF0913807C07C4AC67E021CEB1F800278130F4AEB07C049
+4814E04A1303494814F0130749C7FCEB0E06D91E0714F8EB1C03133C1338137813704A13
+07D9F00614F013E0140E020C130F0001011C14E0EBC0180238131F4A14C06C6C48EB3F80
+D9E1C0137FD97F801400013EC712FE90C7485A4B5A4B5A4B5AED1F804BC7FC15FC4A5AEC
+03E0EC0FC0023FC8FC147CEB01F0495AEB0780011FC9FC133E49EC03805B491407484815
+00485A48485C90C8121E5A001E5D001C157CD83FFC5C9038FFC0013A7C0FFC07F0D87803
+B55AEA700126F0007F5B486D90C7FCEC0FFEEC03F82D4478C132>I<ED1FE0EDFFFC9138
+03E03F91390F000F80023EEB07C00278EB03E05C4948EB01F0495A495A91C713F85BEB0E
+0CEB1E0EEB1C061603013C15F01338A2020E1307020C14E0141CD91C78EB0FC0D90FE013
+1F6D48148090C8EA3F00167E5E4B5A4B5AED0FE091383FFF804A48C7FC15F8EC007E151F
+6F7E6F7E82150382A482A34B5A121FEA7F80A2150F48C75BA2484A5A12F800E04A5AA24B
+C7FC007014FE5D0078495A0038495A003CEB0FC06C495A260780FEC8FC3803FFF038007F
+802D4477C132>I<ED03FCED1FFF037F13C0913801FE07913903F001E091380FE0009138
+1F800391383F000F027E131F5C495A495A010715C04948EB07004A90C7FC131F495AA249
+C9FCA213FE1201A2485AEC07F09038F83FFC0007EB781F9039F9E00F803A0FFB8007C0EB
+F70001FE80491303001F815B5B82485AA3491307127F5BA2150F5E90C7FCA2151F485DA2
+5A4B5AA2007E5D157F93C7FC5D5D4A5A003E495A003F5C4A5A6C6C485A000FEB3F80D9C0
+FEC8FC3803FFFC6C13F038007F802B4475C132>54 D<ED1FE0EDFFFC020313FF913907E0
+3F8091391F800FC091393E0007E04A13034A14F049481301495AA2495AA2495AA2160301
+1F15E0A216076E14C0EE0F806E131F6EEB3F006E133E6D6C5B02FF13F0ED83E06DEBC7C0
+6D01FFC7FC6D13FC6D5B6E7E6E7E91B57ED901EF7FD907837FEB1F01D93E007F496D7E49
+133F4848131F4848130F48486D7E48481303001F140190C7FC5A003E1400007E5D127CA2
+150100FC5D5A4B5AA24B5A127C4B5A4BC7FC6C143E003F5C6C495A390FC003F03907F01F
+C06CB5C8FCC613FCEB1FE02C4477C132>56 D<ED3FC0EDFFF0020313FC91380FE07E9138
+3F803F4A487E02FC14800101140F494814C0495A495AA2495A133F4A14E0137FA249C7FC
+161FA24816C05BA2163F12035BA2167F17804914FFA34B130012015D5D00005D6D130F01
+7C131D153B6DEBF3FC90381F03C3903907FF83F8903801FC0790C7FC5E150F5E151F5E4B
+5AA24BC7FCA2001C14FE007F5C48495A4A5A14074A5A485C00F8013FC8FC48137E5C387C
+07F0383FFFE06C1380D803FCC9FC2B4476C132>I<EF03801707A24D7EA2171FA2173F17
+7FA217FFA25EA2EE03BF1607173F160F160E161C841638171F167016F016E0ED01C0A2ED
+0380A2ED0700A2150E151E151C5D845D170F5D14015D14035D4AC7FC92B6FC5CA2021CC7
+120F143C14385CA24A81A249481407A2495A130791C8FC130E131EA25B137C13FC00014C
+7ED807FE151FB500E00107B512F8A219F03D477BC648>65 D<DC0FF8130393B513070307
+ECC00F923A1FF803E01F923A7FC000F81E4BC7EA7C3EDA03FCEC3C7EDA0FF0EC1EFE4A48
+EC0FFC4A4814074AC8FC02FE1503494816F8130349481501495A494816F0495A137F5C01
+FF17E04890C9FCA2485A19C0485AA2485A95C7FC121F5BA2123F5BA3127F5BA4485AA418
+38A218781870A218F0007F5F1701601703003F5F17076D4BC7FC001F160E171E6C6C5D6D
+5D00075E6C6C4A5A6DEC07C06C6C4A5AD8007F023EC8FCD93FC013FC90391FF807F00107
+B512C0010191C9FC9038001FF0404872C546>67 D<91B6D8803FB512E0A302010180C738
+7FE0006E90C86C5A4A167FA24B5EA219FF14034B93C7FCA26014074B5DA21803140F4B5D
+A21807141F4B5DA2180F143F4B5DA2181F147F92B75AA3DAFF80C7123F92C85BA2187F5B
+4A5EA218FF13034A93C8FCA25F13074A5DA21703130F4A5DA21707131F4A5DA2170F133F
+4A5DA2017F151FA24A5D496C4A7EB6D8803FB512E0A34B447AC348>72
+D<91B612F0A25F020101C0C7FC6E5B4A90C8FCA25DA314035DA314075DA3140F5DA3141F
+5DA3143F5DA3147F5DA314FF92C9FCA35B5CA3010316104A1538A21878010716705C18F0
+18E0010F15015C18C01703011F15074A1580170FA2013FED1F004A5C5F017F15FE16034A
+130F01FFEC7FFCB8FCA25F35447AC33D>76 D<91B56C49B512E0A28202009239000FFC00
+F107F0706E5A4A5F15DF705D1907EC03CFDB8FF892C7FCA203875D02077F0303150EA270
+141EEC0F01020E161C826F153C141E021C6E1338167F1978023C800238013F1470A27113
+F00278131F02705E83040F130102F014F84A5E1607EFFC0313014A01035C17FE18070103
+14014A02FF90C8FCA2705B0107168F91C8138E177F18DE5B010EED3FDC18FCA2011E151F
+011C5EA2170F133C01386F5A1378A201F81503486C5EEA07FEB500F01401A2604B447AC3
+48>78 D<91B77E18F818FE020190398001FF806E90C7EA3FC04AED1FE0F00FF04BEC07F8
+180319FC14034B15FEA314075DA3020FED07FC5DA2F00FF8141F4B15F0F01FE0F03FC002
+3F16804BEC7F0018FEEF03F8027F4A5A4BEB1FC04CB4C7FC92B512F891B612E092380003
+F8EE00FE177F496F7E4A6E7EA28413034A140FA2171F13075CA2173F130F5CA24D5A131F
+5CA3013F170E5CA2017FEE801E191C4A163C496C1638B66C90383FC070051F13F094380F
+E1E0CA3803FF80943800FE003F467AC347>82 D<DB03FE130C92390FFF801C037FEBE03C
+9238FE03F8913A03F0007C7C4A48EB3EF84A48131F4A48130F4AC7FC027EEC07F05C1703
+495A18E0495AA213074A15C0A3130F1880A28094C7FCA280806D7EECFFE015FC6DEBFF80
+6D14F016FC6D14FF023F80020F801403DA003F7F150703007F163F161F160FA21607A312
+0716031607A2485EA2120E160F001E5EA2001F4B5AA2484BC7FC6D143E167E6D5C007F4A
+5A6D495AD87CF0495AD8787CEB1F8027F03F807FC8FC90381FFFFCD8E00713F039C0007F
+80364879C537>I<48B912F85AA2913B0007FC001FF0D807F84A130701E0010F14034916
+0148485C90C71500A2001E021F15E05E121C123C0038143F4C1301007818C0127000F014
+7F485DA3C800FF91C7FC93C9FCA35C5DA314035DA314075DA3140F5DA3141F5DA3143F5D
+A3147F5DA314FF92CAFCA35B5CA21303A21307497E007FB612C0A25E3D446FC346>I<B6
+913807FFFEA25C000301C0020013E06C90C9EA7F00183E183C60A26C1770601701604D5A
+A24DC7FC5F170E6E5CA2017F5D177817705FA24C5AA24C5A16076E91C8FC160E133F5E16
+3C16385EA25E15015E6E485AA24BC9FC131F150E151E151C5DA25D15F05DECF1C0A29038
+0FF38014F792CAFC14FEA25CA25C5CA25C13075CA25C91CBFC3F466CC348>86
+D<EC1F80EC7FE0903901F07070903907C039F890380F801D90381F001F013E6D5A137E5B
+484813075E485A120749130F000F5DA2485A151F003F5D5BA2153F007F92C7FC90C7FCA2
+5D157E12FEA29238FE0380EDFC071700A2007E13015E913803F80E1407003E010F131E16
+1C6C131C02385B3A0F80F078783A07C3E07C703A01FF801FE03A007E000780292D76AB32
+>97 D<EC0FE0EC7FF8903801F81E903807E00F90390F80078090381F0003017E14C04913
+1F0001143F5B4848EB7F801207485AED3E00484890C7FCA2485AA2127F90C9FCA35A5AA4
+5AA5ED0180ED03C0ED0780A2007CEC0F00007E141E003E147C15F06CEB03E0390F800F80
+2607C07EC7FC3801FFF838007FC0222D75AB2D>99 D<EC0FE0EC7FF8903801F83E903807
+C00F90391F800780EB3F00017E14C0491303485A48481307000715805B000F140F484814
+005D4848133E15FCEC07F0007FEBFFC0D9FFFEC7FC14C090C9FC5A5AA55AA4ED0180ED03
+C0007CEC0780A2007EEC0F00003E141E157C6C14F06CEB03E03907800F802603C07EC7FC
+3801FFF838003FC0222D75AB2D>101 D<15FCEC03FF91390F83838091393E01CFC09138
+7C00EF4A13FF4948137F010315804948133F495A131F4A1400133F91C75A5B167E13FE16
+FE1201495CA215011203495CA21503A2495CA21507A25EA2150F151F5E0001143F157F6C
+6C13FF913801DF8090387C039F90383E0F3FEB0FFCD903F090C7FC90C7FC5DA2157EA215
+FEA25DA2001C495A127F48495A14074A5A485C023FC8FC00F8137E387C01F8381FFFE000
+0390C9FC2A407BAB2D>103 D<14FE137FA3EB01FC13001301A25CA21303A25CA21307A2
+5CA2130FA25CA2131FA25C157F90393F83FFC091388F81F091381E00F802387F4948137C
+5C4A137EA2495A91C7FCA25B484814FE5E5BA2000314015E5BA2000714035E5B1507000F
+5DA249130F5E001F1678031F1370491480A2003F023F13F0EE00E090C7FC160148023E13
+C01603007E1680EE070000FEEC1E0FED1F1E48EC0FF80038EC03E02D467AC432>I<143C
+147E14FE1301A3EB00FC14701400AE137C48B4FC3803C780380703C0000F13E0120E121C
+13071238A21278EA700F14C0131F00F0138012E0EA003F1400A25B137EA213FE5B12015B
+A212035B141E0007131C13E0A2000F133CEBC038A21478EB807014F014E0EB81C0EA0783
+EBC7803803FE00EA00F8174378C11E>I<EB03F8EA01FFA3380007F013031307A214E0A2
+130FA214C0A2131FA21480A2133FA21400A25BA2137EA213FEA25BA21201A25BA21203A2
+5BA21207A25BA2120FA25BA2121FA25BA2123FA290C7FCA2387F01C01303007E1380A213
+0700FE130012FCA25B130EEA7C1E131CEA3C3CEA3E786C5AEA07C0154678C419>108
+D<D801F0D90FE0EB07F0D803FCD97FF8EB3FFC28071E01F03EEBF81F3E0E1F03C01F01E0
+0F80271E0F8700D983807F001C018E90390F870007003C019C148E003801B802DC8002F8
+14FC26781FF05C0070495CA24A5C00F0494948130FD8E03F6091C75B1200043F141F4960
+017E92C7FCA24C143F01FE95C7FC49147E6104FE147E1201494A14FE610301EE07800003
+05011400494A14F8A2030302035B0007F0F00E495C1A1E0307EDE01C000F193C494A1538
+62030F020113F0001FF0F1E0494A903800FF800007C7D80380023EC7FC492D78AB50>I<
+D801F0EB0FE0D803FCEB7FF83A071E01F03E3A0E0F03C01F001ED987001380001C018E13
+0F003C139C003801B814C014F838781FF000705BA25C00F049131FD8E03F158091C7FC12
+00163F491500137EA25E01FE147E5B16FE5E12014913015E170F00030203130E4914F0A2
+0307131E0007EDE01C5B173CEEC038000F167849157017E0ED03C1001FEDE3C049903801
+FF000007C8127C302D78AB37>I<EC0FE0EC7FFC903801F83E903907E00F8090390F8007
+C0EB1F00017EEB03E04914F0A248481301484814F81207485AA2485AA2485A1503127F90
+C7FCA215074815F05AA2150F16E05AED1FC0A21680153F16005D157E5D007C495A007E49
+5A003E5C4A5A6CEB1F80260F803EC7FC3807C0FC3801FFF038003F80252D75AB32>I<D9
+03E0137E903A07F801FF80903A0E3C0783E0903A1C1E0F01F0903A3C1F1C00F801385B01
+7849137C01705BA24A48137E01E05BA292C7FC00015B13C0147EC7FC02FE14FEA25CA201
+01140117FC5CA20103140317F85CA20107EC07F0A24AEB0FE0A2010F15C0EE1F80163F17
+00496C137E5E4B5A9138B803F090393F9C07E091389E0F80DA07FEC7FCEC01F849C9FCA2
+137EA213FEA25BA21201A25BA21203A21207B512F0A25C2F3F7FAB32>I<D801F0EB3F80
+3A03FC01FFF03A071E03C0F83A0E0F0F007C001E90389E01FC001C139CECB803003813F0
+A2D91FE013F80078EC00E00070491300A200F05BEAE03F91C8FC1200A25B137EA313FE5B
+A312015BA312035BA312075BA3120F5BA3121F5B0007C9FC262D78AB29>114
+D<EC0FE0EC7FF8903801F01E903803C00F90390780078090380F0003011E14C015074913
+1FA2017CEB3F801378137CED0E0092C7FC137E137F14F014FF6D13C06D13F06D7F6D7F13
+00EC0FFE14011400157F81120E003F141E487EA2153E48C7123CA200FC5C12705D007849
+5A6C495A6CEB0F80260F803EC7FC3803FFF838007FC0222D7AAB28>I<1470EB01F8A313
+035CA313075CA3130F5CA3131F5CA2007FB512E0B6FC15C0D8003FC7FCA25B137EA313FE
+5BA312015BA312035BA312075BA3120F5BA2EC0780001F140013805C140E003F131EEB00
+1C143C14385C6C13F0495A6C485AEB8780D807FEC7FCEA01F81B3F78BD20>I<017CEE03
+8048B4020EEB0FC02603C780013FEB1FE0380703C0000E7F5E001C037E130F0107160712
+3804FE130300785DEA700F4A1501011F130100F001804914C012E0EA003FDA000314034C
+14805B137E0307140701FE1700495CA2030F5C0001170E495CA260A24848495A60A26012
+01033F5C7F4B6C485A000002F713036D9039E7E0078090267E01C349C7FC903A1F0781F8
+1E903A0FFF007FF8D901FCEB0FE03B2D78AB41>119 D<137C48B414072603C780EB1F80
+380703C0000F7F000E153F001C1600130712385E0078157EEA700F5C011F14FE00F0495B
+12E0EA003FEC00015E5B137E150301FE5C5BA2150700015D5BA2150F00035D5BA2151F5E
+A2153F12014BC7FC6D5B00005BEB7C0390383E0F7EEB1FFEEB03F090C712FE5DA214015D
+121F397F8003F0A24A5A4848485A5D48131F00F049C8FC0070137E007813F8383801F038
+1E07C06CB4C9FCEA01FC294078AB2F>121 D E
+%EndDVIPSBitmapFont
+%DVIPSBitmapFont: Fx cmsy8 8 2
+/Fx 2 122 df<130C131EA50060EB01800078130739FC0C0FC0007FEB3F80393F8C7F00
+3807CCF83801FFE038007F80011EC7FCEB7F803801FFE03807CCF8383F8C7F397F0C3F80
+00FCEB0FC039781E078000601301000090C7FCA5130C1A1D7C9E23>3
+D<1338137CA81338A7007C137CB512FEA3387C387C00001300A5137CB3A41338AD173D7C
+AE20>121 D E
+%EndDVIPSBitmapFont
+%DVIPSBitmapFont: Fy cmr12 12 22
+/Fy 22 118 df<121EEA7F80A2EAFFC0A4EA7F80A2EA1E000A0A78891B>46
+D<16C04B7EA34B7EA34B7EA34B7EA3ED19FEA3ED30FFA203707FED607FA203E07FEDC03F
+A2020180ED801FA2DA03007F160FA20206801607A24A6D7EA34A6D7EA34A6D7EA2027081
+0260147FA202E08191B7FCA249820280C7121FA249C87F170FA20106821707A2496F7EA3
+496F7EA3496F7EA201788313F8486C83D80FFF03037FB500E0027FEBFFC0A342477DC649
+>65 D<B912F0A3000101C0C7127F6C6C48EC0FF817031701170018781838A2181CA3180C
+A4180E1806160CA21800A5161CA2163C167CED01FC91B5FCA3EC8001ED007C163C161CA2
+160CA793C8FCB08048487EB612F8A337447CC340>70 D<B600C049B512C0A3000101E0C8
+387FFC006C49ED3FE06D481680063EC7FC183C183860604D5A4D5A4DC8FC171E17385F5F
+4C5A4C5A4CC9FC160E5E5E5E5E4B5A4B7E4B7E150F4B7E4B7E1577EDE3FE913881C1FFEC
+8381DA87007F028E6D7E149C02B86D7E02F06D7E14C04A6D7E707EA2707E707EA2707F71
+7EA2717E717EA2717E717EA2717E717EA2717F8585496C82486D4A13FCB600C0011FEBFF
+E0A343447CC34C>75 D<B612F8A3000101E0C9FC6C6C5A5CB3B31830A418701860A518E0
+A3EF01C0A217031707A2170F173F177FEE01FF48486C011F1380B9FCA334447CC33D>I<
+B56C020FB5FC8080C6040013F06D6CED1F80D96FF8ED0F00A2D967FC1506EB63FEA2EB61
+FF01607FA26E7E6E7EA26E7E6E7EA26E7E6E7EA26E7E6E7FA26F7E6F7EA26F7E6F7EA26F
+7E6F7EA26F7E6F1380A2EE7FC0EE3FE0A2EE1FF0EE0FF8A2EE07FCEE03FEA2EE01FF7013
+86A2EF7FC6EF3FE6A2EF1FF6EF0FFEA217071703A217011700A201F0167E183E487ED80F
+FF161EB500F0150EA2180640447CC349>78 D<B60107B500F890380FFFFEA3000301E0D9
+001F90C813F06C0180DA0FFCED3FC091C86C48ED1F006C871C0E6D6C6E7E1C0CA26D6C6F
+5DA36EDA06FF1538011F1A30A26E020E6D1470010FDB0C7F1560A26E021C7F0107DB183F
+5DA2856D6CDA301F4A5AA36D6C4A6C6C49C7FCA36D6C4A6C6C1306A3DB80016E130E027F
+DA8003140CA2DBC00380023FDA00015CA203E081021F01066D5CA36E6C486E6C5AA36E6C
+486E6C5AA36F48EC1FE1020360A2DBFE7015F302010160020F90C8FCA2DBFFE015FB6E49
+EC07FEA36F486E5AA36FC86C5AA3031E6F5AA4030C16605F467EC364>87
+D<B66C91380FFFFCA3000101F8C8000313C026007FE0923800FE0061013F17F06D6C5E80
+010F5F6D6C4B5A18036D6C93C7FC6E15066D160E6D6D140C181C6E6C14186E6C5C18706E
+6C146018E06E6C5C6E6C495A17036E6C91C8FC5F6E6C13066E6D5A171C92387FC0185FED
+3FE06F6C5A17E06F6C5AEEF980ED07FF6F90C9FCA26F5AB3A6923807FF800203B6FCA346
+447FC349>89 D<EB07FC90383FFF809038F80FE03903C003F048C66C7E000E6D7ED80FC0
+137E486C137F6D6D7EA36F7EA26C5AEA0380C8FCA4EC0FFF49B5FC90380FFE1FEB3FC0EB
+FF00EA03FC485A485A485A485A127F5B176048C7FCA3153FA36D137F007F14EF6D9038C7
+E0C0003F13013A1FE00783F13B07F81E03FF802701FFFC0113003A001FE0007C2B2E7CAC
+31>97 D<EA01FC12FFA3120712031201B3EC03FC91380FFF8091383C07E091387001F890
+39FDE0007E02807F01FFEC1F8091C713C049EC0FE049140717F0A2EE03F8A217FCA21601
+17FEAB17FC1603A217F8A2EE07F0A26DEC0FE017C06D141F01FBEC3F80D9F380EB7E00D9
+E1C05B9039E0F001F89039C03C07E09039801FFF80C7D803FCC7FC2F467DC436>I<167F
+ED3FFFA315018182B3EC7F80903803FFF090380FC07C90383F000E017E1307496D5AD803
+F87F48487F5B000F81485AA2485AA2127FA290C8FC5AAB7E7FA2123FA26C7EA2000F5D7F
+6C6C5B00035C6C6C9038077F806C6C010E13C0013F011C13FE90380FC0F8903803FFE090
+26007F0013002F467DC436>100 D<EB01FE903807FFC090381F03F090387E00FC49137E
+48487F485A4848EB1F80000F15C049130F121F484814E01507A2007F15F090C7FCA25AA3
+90B6FCA290C9FCA67EA27FA2123F16306C7E1670000F15606D14E06C6C14C0000314016C
+6CEB03806C6CEB0700013E131E90381F80F8903803FFE0010090C7FC242E7DAC2B>I<EE
+0F80D901FCEB7FE0903A0FFF81F0F090393F07E3819039FC01FF033A01F800FE01484801
+7E13E00007027FC7FC497F000F8149131F001F81A9000F5D6D133F000792C7FC6D5B0003
+147E6C6C5B6D485A3903BF07E090380FFF80260701FCC8FC90CAFCA25AA37F6C7E7F90B5
+12F86C14FF16E06C15F86C6C8048B67E3A07C0000FFF48481300003FC8EA3F80003E151F
+48ED0FC0A2481507A56C150F007C1680007E151F003E16006C153E6C6C5CD807E0495AD8
+01F8EB07E0D8007FEB3F8090261FFFFEC7FC010113E02C427DAC31>103
+D<EA01FC12FFA3120712031201B3EC01FE913807FFC091381E07F091383801F802707FEC
+E000D9FDC07F5C01FF147F91C7FCA25BA35BB3A8486CECFF80B5D8F83F13FEA32F457DC4
+36>I<EA01E0EA07F8A2487EA46C5AA2EA01E0C8FCADEA01FC12FFA3120712031201B3B0
+487EB512F8A315437DC21C>I<EA01FC12FFA3120712031201B3B3B3A5487EB512F8A315
+457DC41C>108 D<D801FC01FFEC1FE000FF010701E0EBFFFC913B0F03F801E07F913C3C
+01FC07803F800007903C7000FE0E001FC0000349D97E1C130F2601FDC0D97F38804A1430
+01FFDA3FF06D7E91C75BA2495DA3495DB3A8486C4A6C497EB5D8F81FB50003B512E0A34B
+2C7DAB52>I<3901FC01FE00FF903807FFC091381E07F091383801F8000701707F0003EB
+E0002601FDC07F5C01FF147F91C7FCA25BA35BB3A8486CECFF80B5D8F83F13FEA32F2C7D
+AB36>I<EC7F80903803FFF090380FC0FC90383E001F496D7E496D7E48486D7E48486D7E
+48486D7E000F81A24848147E003F157FA290C87E481680A44816C0AA6C1680A26D147F00
+3F1600A2001F157E6D14FE000F5D6D130100075D6C6C495A6C6C495A6C6C495A013E49C7
+FC90381FC0FE903807FFF89038007F802A2E7DAC31>I<3903F803F000FFEB1FFCEC3C3E
+EC707F0007EBE0FF3803F9C000015B13FBEC007E153C01FF13005BA45BB3A748B4FCB512
+FEA3202C7DAB26>114 D<1306A5130EA4131EA3133E137EA213FE12011207001FB512F0
+B6FCA2C648C7FCB3A4150CAA017E131C017F1318A26D133890381F8030ECC070903807E0
+E0903801FFC09038007F001E3E7EBC26>116 D<D801FC147F00FFEC3FFFA30007140100
+0380000181B3A85EA35DA212006D5B017E9038077F80017F010E13C06D011C13FE90380F
+C078903803FFF09026007F8013002F2D7DAB36>I E
+%EndDVIPSBitmapFont
+%DVIPSBitmapFont: Fz cmbx12 20.74 23
+/Fz 23 119 df<B912E0B033107EAE41>45 D<F103F84F7E4F7EA24F7EA34F7FA24F7FA3
+96B57EA24E80A34E80A24E80A34E80A24E80A34E81A24E81A219BFDEFF9F80191F4D6D80
+A218FE05036D8018FC05076D80A218F8050F6D8018F0051F6D80A260053F6E8060057F6E
+80A26005FF6E8095C7FC4C6F80A25F04036F805F04076F80A25F040F6F805F041F6F80A2
+5F043F70805F047F7080A25F04FF708094C9FC4B7180A25E030371805E4BBB7EA34B86A2
+4B86A3DB3FE0CA6C805E037F7280A25E03FF7280A24A90CB6C80A25D02037380A24A4872
+80A25D020F7380A24B84021F885D023F7480A24B85027F895D902607FFFC7380B86C031F
+B912E0A8837979F892>65 D<B800C051B8128071637163A37163A27163C7003F57C8FC71
+F33FBFA203EF6DF37F3FA303E76E1AFEA203E36EF101FCA203E16EF103F8A203E06EF107
+F0A3706DF10FE0A2706DF11FC0A2706DF13F80A2706DF17F00A3706E18FEA2706E4D5AA2
+706E4D5AA3706E4D5AA2716D4D5AA2716D4D5AA2716D4D5AA3716D4DC7FCA2716E16FEA2
+716E4B5AA2716E4B5AA3716E4B5AA2726D4B5AA2726D4B5AA3726D4B5AA2726D4BC8FCA2
+726E14FEA2726E495AA3726E495AA2726E495AA2736D495AA2736D495AA3736D495AA273
+6D49C9FCA273EC80FEA2F481FC7314C1A273ECE3F8A273ECF7F0A274EBFFE0A3745CA274
+5CA27491CAFCA2745BA3745BA2902603FFFE705BB800F897BA1280745BA2755AA3755A75
+5AA97679F5B8>77 D<95380FFFFC0503B612F0053F15FF0403B812F0040F17FC047FEFFF
+804BBA12E003079126FE001F14F8031F02E0010114FE4B91C8003F7F92B500FC030F14C0
+4A02F0030380020702C0030014F84A4A707F4A91CA6C7F4A01FC050F7F4A49718091B548
+7180494A71804989494A71804C8449894991CC6C7F4949737FA24949738090B589A2484A
+7380A2484A7380A2488B4B85A2488BA3484A7380A3488BA4484A741480A7B61EC0B16C20
+80A36F97B6FCA46C2000A46C6E4F5CA36C676F61A26C67A26C6E4F5CA26C676F616C676F
+616D666F616D9BC7FC6D6E4E5BA26D6E95B55A6D6E4D5C6D656D6E4D5C6D6E4D5C6E6D4D
+5C6E6D4D91C8FC6E6D4D5B6E02C093B55A6E6E4B5C6E02F803075C02006E4B14C06FD9FF
+80027F5C031F02E049B548C9FC030702FE011F14F8030191B812E06F6C1880041F4DCAFC
+040317F0DC003F93CBFC050315F0DD000F01FCCCFC7A7A75F791>79
+D<BC12FCF3FFF01CFF1DE01DFC1DFF1EC08AC7003F91C8000115F8E0000F80090180756C
+6D7E76801C0F76808B7680888B7680A28BA2892080A420C0AB2080A49AB61200A267A267
+6467525C64670A1F5C525C5291C7FC51B55A090F14F850B65A94BA12C09BC8FC1DFC1DF0
+9AC9FC1CF809FCCAFC0580CEFCB3B3A8BA12E0A872767AF584>I<922603FFF8150E037F
+D9FFC0143F0203B600FC5C021F03FF5C027FEEC00149B8EAF00349EFFC07010FDA000F13
+FE4901F09039007FFF8F4901C0020F13DF4990C8000390B5FC494815004801F8163F4884
+4A8248498248844A8248844A834885A291CB7E5A86A286B5FC8680A28680A280A26E8380
+806E187E6E95C7FC6C8015E015FCEDFFC06C15FCEEFFE06C16FF18F06CEFFF8019F06C18
+FE737E6C856C19F06C19FC6D846D846D856D856D850101856D85023F846E841407020084
+031F18801500040F17C0EE007F050716E0EF003F1803DE007F14F0191F8585070114F8A2
+8586007E85B4FC86A286A37F86A36D1AF0A37F1CE06D60A26D1AC06D607F6D1A806E5F6E
+4D13006E606E17FF02FC4C5B02FF4C5B03E04B5B03FC031F5B01FBD9FF80027F5B01F102
+FE0107B55AD9E07F90B8C7FC6E17FCD9C00F5FD9800317E090C76C168048020F4BC8FC48
+020015F00070030349C9FC557A75F76C>83 D<BA057FB71280A8C792CD000F01F0C7FC71
+070013806E5290C8FCA26E6E621F036E6E621F07836E525A836E651F1F6E6E621F3F836E
+525A836E651FFF6F6E96C9FC666F6E601E03846F505AA26F6E601E0F6F6E601E1F846F50
+5AA26F6E601E7F6F6E601EFF85704E90CAFCA2706E5E1D03706E5E1D0785704E5AA2706E
+5E1D1F706E5E1D3F85704E5A8570611DFF716E92CBFC6486714C5A86715F1C07716E5C1C
+0F86714C5A86714C5AA2716E5C1C7F716E5C1CFF8772028190CCFCA272ECC1FE1BC372EC
+E3FC1BE71BF772ECFFF8A2725DA2725DA3725DA2725DA27391CDFCA3735BA2735BA2735B
+A3735BA2735BA2735BA2735B74CEFC89787CF592>86 D<92383FFFF80207B612E0027F15
+FC49B87E010717E0011F83499026F0007F13FC4948C7000F7F90B502036D7E486E6D806F
+6D80727F486E6E7F8486727FA28684A26C5C72806C5C6D90C8FC6D5AEB0FF8EB03E090CA
+FCA70507B6FC041FB7FC0303B8FC157F0203B9FC021FECFE0391B612800103ECF800010F
+14C04991C7FC017F13FC90B512F04814C0485C4891C8FC485B5A485B5C5A5CA2B5FC5CA3
+60A36E5DA26C5F6E5D187E6C6D846E4A48806C6D4A4814FC6C6ED90FF0ECFFFC6C02E090
+263FE07F14FE00019139FC03FFC06C91B6487E013F4B487E010F4B1307010303F01301D9
+003F0280D9003F13FC020101F8CBFC57507ACE5E>97 D<93383FFFF00307B612C0033F15
+F84AB712FE0207707E021F17E0027F8391B526FC001F7F010302C001037F4991C7487F49
+495C495B4901F04A7F5B90B55A485CA2485C4891C8FCA248715B5C48715B725B4A6F5B48
+9438007FC0071FC7FC96C8FC5AA25CA3B5FCAF7E80A47E80A27E806CF11F80F23FC06C6E
+167FA26C6EEEFF80816C606C6E17006D6D4B5A6D6D15076D6D4B5A6D6D6C4A5A6D02E0EC
+7FF06D02F849485A01009126FF801F5B6E91B6C7FC021F5E020716F8020116E06E6C1580
+030702FCC8FCDB003F13804A507ACE56>99 D<93387FFF80030FB512FC037FECFF804AB7
+12E0020716F8021F16FE027FD9F8077F49B5D8C000804991C7003F13E04901FC020F7F49
+496E7F49498049496E7F49496E7F90B55A48727E92C914804884485B1BC048841BE0485B
+A27313F05AA25C5AA21BF885A2B5FCA391BAFCA41BF002F8CCFCA67EA3807EA47E806CF1
+03F0F207F86C7F1A0F6C6E17F06C191F6F17E06C6E163F6D6DEE7FC06D6D16FF6D6D4B13
+806D6D4B13006D6D6CEC0FFE6D02E0EC3FFC6D02F8ECFFF86D9126FFC00F5B023F91B65A
+020F178002034CC7FC020016F8031F15E0030392C8FCDB000F13E04D507BCE58>101
+D<EF7FFE040FB512C093B612F0030715FC031F814B8192B5D8F01F13800203DA803F13C0
+4A9026FC007F13E04A4990B5FC4A5B4A494814F04A13C091B51280A2491400A2495BA271
+14E05B4B6E13C0721380721300F007FC95C8FCB3B912C0A8D8000749CAFCB3B3B3A7007F
+B712FCA844797AF83B>I<903801FFFCB6FCA8C67E131F7FB3AD95380FFFE095B512FE05
+036E7E050F15E0053F15F84D81932701FFF01F7F4CD900077FDC07FC6D80DC0FF06D80DC
+1FC07F4C48824CC8FC047E6F7F5EEDFDF85E03FF707F5EA25EA25EA293C9FCA45DB3B3A6
+B8D8E003B81280A8617879F76C>104 D<EB01FCEB07FF011F13C0497F497F90B57EA248
+80A24880A76C5CA26C5CA26D5B6D5B6D5B010790C8FCEB01FC90CAFCB2903801FFFC007F
+B5FCA8C67E131F7FB3B3B3A5B81280A8297979F835>I<903801FFFCB6FCA8C67E131F7F
+B3B3B3B3B3ABB812C0A82A7879F735>108 D<902601FFF891260FFFE093383FFF80B692
+B500FE0303B512F805036E6C020F14FE050F03E0023F6E7E053F03F891B712E04D6F4982
+932701FFF01F6D0107D9C07F7F4CD900076D90270FFC001F7FDC07FC6D9126801FF06D7F
+C66CDA0FF06D9126C03FC06D7F011FDA1FC06D4BC77E6D4A48DCE0FE834CC8ECE1FC047E
+6FD9F1F86E804CEFF3F0DBF9F8EFF7E04C6003FB7001FF6F804C6015FF4C95C9FCA24C5F
+A293C95CA44B60B3B3A6B8D8E003B8D8800FB712FEA8974E79CDA2>I<902601FFF89138
+0FFFE0B692B512FE05036E7E050F15E0053F15F84D81932701FFF01F7F4CD900077FDC07
+FC6D80C66CDA0FF06D80011FDA1FC07F6D4A48824CC8FC047E6F7F5EEDF9F85E03FB707F
+5E15FF5EA25EA293C9FCA45DB3B3A6B8D8E003B81280A8614E79CD6C>I<93381FFFE003
+03B6FC031F15E092B712FC020316FF020F17C0023FD9FC0014F091B500C0010F13FC4991
+C700037F4901FC02007F010F496F13C049496F7F49496F7F4B8149496F7F90B5C96C7F48
+86A24849707F481B80A248497014C0A2481BE0A348497113F0A3481BF8A5B51AFCAE6C1B
+F8A46C1BF06E94B5FCA36C1BE0A26C6D4C14C0A26C1B806E5E6C1B006C6E4B5BA26C6E4B
+5B6D6D4B5B6D6D4B5B6D6D4B5B6D6D92B55A6D01FF02035C6D02C0010F91C7FC010002FC
+90B512FC6E90B75A021F17E00207178002014CC8FCDA003F15F0030392C9FCDB001F13E0
+56507BCE61>I<902601FFFCEC7FFEB6020FB512F0057F14FE4CB712C0040716F0041F82
+047F16FE93B5C66C7F92B500F0010F14C0C66C0380010380011F4AC76C806D4A6E8004F0
+6F7F4C6F7F4C6F7F4C8193C915804B7014C0861DE0A27414F0A27414F8A47513FCA57513
+FEAF5113FCA598B512F8A31DF0621DE0621DC0621D806F5E701800704B5B505B704B5B70
+92B55A04FC4A5C704A5C706C010F5C05E0013F49C7FC9227FE7FFC01B55A70B712F0040F
+16C0040393C8FC040015F8053F14C0050301F0C9FC94CCFCB3A6B812E0A85F6F7ACD6C>
+I<902601FFF8EB07FEB691383FFFC094B512F00403804C14FE4C8093261FFC3F13809326
+3FE07F13C0DC7F80B5FCC66C5D011FDAFE0114E06DEBF9FC16F815FB16F016E015FF16C0
+7114C05E72138095381FFE0093C76C5AF001E095C8FCA25DA65DB3B3A2B812F8A8434E7A
+CD4F>114 D<912603FFFCEB0780027F9039FFE00FC00103B6EAF83F010FEDFEFF013F92
+B5FC49EB000F2601FFF01300480180143F4890C8120F4848814848814981123F83485A18
+7FA212FF6D163FA37F7F6DEE1F8002C092C7FC14F014FEECFFF06CECFF8016FEEEFFE06C
+16FC6C16FF18C06C836C17F86C836C836C83013F17806D17C0010717E0010117F0EB003F
+020716F8EC001F030015FC1607EE007F051F13FE1707007E82B482836D167FA2183F7F18
+1FA27F19FC7FA26D163F6D17F86D167F19F06D16FF6E4A13E002E04A13C06E4A138002FE
+023F1300913AFFC003FFFE01E790B65A01C316F0018016C026FE003F92C7FC48010714F8
+0070D9007F90C8FC3F507ACE4C>I<15FFA75CA55CA45CA25CA25CA25CA25C91B5FCA25B
+5B5B131F5B90B9FC120FBAFCA6D8000791C9FCB3B3A3F01FE0AE183F7014C07F187F7014
+806D16FF826D4B13006E6D485AEEFE0F6E90B55A020F5D6E5D020115C06E6C5C031F49C7
+FC030113F03B6E7CEC4B>I<DAFFFE933803FFF8B60303B6FCA8C66CEE0001011F717E6D
+84B3B3A862A497B5FCA261A2616D5F1ADF6F150F6DEF1F9F073F806D6EDA7F1F13FF6D6E
+D901FEEDFF8070EB07FC023F01FEEB3FF86E90B612F06E16C0020316800200EDFE00031F
+14F80300028003C0C7FC614F79CD6C>I<B892B612F8A8D8001F49C90003EBF0006D6D04
+001380A26D6E94C7FC626D61701503A26D6E4B5AA26D6E5E1A0F6E6D5E1A1F80704B5AA2
+6E6D4B5AA26E6D5E1AFF6E6E92C8FC61A26E6E495AA26E6E495AA26E6E5C190F6F6D5C19
+1FA26F6D495AA26F6D495AA26F6D5C19FF6F6E90C9FC1881A26FECC3FEA26FECE7FCA26F
+ECF7F818FF705CA3705CA2705CA2705CA27091CAFCA3705BA2705BA2705BA2715AA2715A
+715A5D4E7CCC66>I E
+%EndDVIPSBitmapFont
+/FA 105[46 28[46 46 1[46 51 28 46 32 1[51 51 51 74 23
+2[23 51 1[28 46 51 46 51 46 10[55 2[55 60 8[23 2[51 1[60
+1[60 60 7[46 46 2[46 46 46 46 46 46 3[23 44[{
+TeXBase1Encoding ReEncodeFont}38 83.022 /Helvetica-Bold
+rf /FB 134[60 1[86 2[33 60 40 1[66 66 66 100 27 2[27
+66 66 33 66 1[60 1[66 10[80 1[73 80 86 3[86 1[66 3[86
+4[86 1[80 7[66 66 1[66 2[66 66 66 4[33 40[60 3[{
+TeXBase1Encoding ReEncodeFont}34 119.552 /Helvetica-Oblique
+rf /FC 138[66 33 1[40 2[66 66 100 27 2[27 66 66 1[66
+66 1[66 66 7[80 1[113 8[86 1[66 80 4[73 4[80 18[33 46[{
+TeXBase1Encoding ReEncodeFont}22 119.552 /Helvetica rf
+/FD 137[96 105 57 96 67 1[105 105 105 153 48 2[48 105
+1[57 96 1[96 1[96 10[115 2[115 2[115 134 1[143 11[124
+19[57 45[{TeXBase1Encoding ReEncodeFont}23 172.188 /Helvetica-Bold
+rf /FE 105[115 28[115 115 2[126 69 115 80 1[126 126 126
+4[57 126 126 1[115 126 115 126 115 10[138 2[138 149 3[149
+172 2[115 57 3[138 3[149 7[115 115 115 115 115 1[115
+115 115 115 57 2[57 44[{TeXBase1Encoding ReEncodeFont}38
+206.559 /Helvetica-Bold rf end
+%%EndProlog
+%%BeginSetup
+%%Feature: *Resolution 600dpi
+TeXDict begin
+
+%%EndSetup
+%%Page: 0 1
+0 0 bop -336 55 4537 34 v -336 5425 34 5370 v 4167 5425
+V -336 5459 4537 34 v -345 205 a @beginspecial 247 @llx
+387 @lly 357 @urx 420 @ury 2160 @rwi @setspecial
+%%BeginDocument: aiaalgo.eps
+%!PS-Adobe-3.0 EPSF-3.0
+%%Creator: Adobe Illustrator(TM) 7.0
+%%For: (Richard A Wheless) (NASA Langley Research Center)
+%%Title: (AIAALOGO)
+%%CreationDate: (2/3/98) (3:59 PM)
+%%BoundingBox: 247 387 357 420
+%%HiResBoundingBox: 247.1666 387.5 356.6667 419.1667
+%%DocumentProcessColors: Black
+%%DocumentSuppliedResources: procset Adobe_level2_AI5 1.2 0
+%%+ procset Adobe_ColorImage_AI6 1.1 0
+%%+ procset Adobe_Illustrator_AI5 1.2 0
+%%+ procset Adobe_cshow 2.0 8
+%AI5_FileFormat 3
+%AI3_ColorUsage: Black&White
+%AI3_IncludePlacedImages
+%AI7_ImageSettings: 1
+%%CMYKCustomColor: 1 0 0.55 0 (Aqua)
+%%+ 1 0.5 0 0 (Blue)
+%%+ 0.5 0.4 0.3 0 (Blue Gray)
+%%+ 0.8 0.05 0 0 (Blue Sky)
+%%+ 0.5 0.85 1 0 (Brown)
+%%+ 1 0.9 0.1 0 (Dark Blue)
+%%+ 1 0.55 1 0 (Forest Green)
+%%+ 0.05 0.2 0.95 0 (Gold)
+%%+ 0.75 0.05 1 0 (Grass Green)
+%%+ 0 0.45 1 0 (Orange)
+%%+ 0.15 1 1 0 (Red)
+%%+ 0.45 0.9 0 0 (Violet)
+%%AI6_ColorSeparationSet: 1 1 (AI6 Default Color Separation Set) 
+%%+ Options: 1 16 0 1 0 1 1 1 0 1 1 1 1 18 0 0 0 0 0 0 0 0 -1 -1
+%%+ PPD: 1 21 0 0 60 45 2 2 1 0 0 1 0 0 0 0 0 0 0 0 0 0 () 
+%AI3_TemplateBox: 306 396 306 396
+%AI3_TileBox: 30 31 582 761
+%AI3_DocumentPreview: Header
+%AI5_ArtSize: 612 792
+%AI5_RulerUnits: 0
+%AI5_ArtFlags: 1 0 0 1 0 0 1 1 0
+%AI5_TargetResolution: 800
+%AI5_NumLayers: 1
+%AI5_OpenToView: 218 464 6 1018 725 18 0 1 3 40 0 0
+%AI5_OpenViewLayers: 7
+%%PageOrigin:30 31
+%%AI3_PaperRect:-30 761 582 -31
+%%AI3_Margin:30 -31 -30 31
+%AI7_GridSettings: 72 8 72 8 1 0 0.768627 0.843137 1 0.884314 0.921569 1
+%%EndComments
+%%BeginProlog
+%%BeginResource: procset Adobe_level2_AI5 1.2 0
+%%Title: (Adobe Illustrator (R) Version 5.0 Level 2 Emulation)
+%%Version: 1.2 0
+%%CreationDate: (04/10/93) ()
+%%Copyright: ((C) 1987-1996 Adobe Systems Incorporated All Rights Reserved)
+userdict /Adobe_level2_AI5 25 dict dup begin
+	put
+	/packedarray where not
+	{
+		userdict begin
+		/packedarray
+		{
+			array astore readonly
+		} bind def
+		/setpacking /pop load def
+		/currentpacking false def
+	 end
+		0
+	} if
+	pop
+	userdict /defaultpacking currentpacking put true setpacking
+	/initialize
+	{
+		Adobe_level2_AI5 begin
+	} bind def
+	/terminate
+	{
+		currentdict Adobe_level2_AI5 eq
+		{
+		 end
+		} if
+	} bind def
+	mark
+	/setcustomcolor where not
+	{
+		/findcmykcustomcolor
+		{
+			0
+			6 packedarray
+		} bind def
+		/findrgbcustomcolor
+		{
+			1
+			5 packedarray
+		} bind def
+		/setcustomcolor
+		{
+			exch 
+			aload pop 
+			0 eq
+			{
+				pop
+				4
+				{
+					4 index mul
+					4 1 roll
+				} repeat
+				5 -1 roll pop
+				setcmykcolor
+			}
+			{
+				pop
+				3
+				{
+					1 exch sub
+					3 index mul 
+					1 exch sub
+					3 1 roll
+				} repeat
+				4 -1 roll pop
+				setrgbcolor
+			} ifelse
+		}
+		def
+	} if
+	
+	/gt38? mark {version cvr cvx exec} stopped {cleartomark true} {38 gt exch pop} ifelse def
+	userdict /deviceDPI 72 0 matrix defaultmatrix dtransform dup mul exch dup mul add sqrt put
+	userdict /level2?
+	systemdict /languagelevel known dup
+	{
+		pop systemdict /languagelevel get 2 ge
+	} if
+	put
+/level2ScreenFreq
+{
+ begin
+		60
+		HalftoneType 1 eq
+		{
+			pop Frequency
+		} if
+		HalftoneType 2 eq
+		{
+			pop GrayFrequency
+		} if
+		HalftoneType 5 eq
+		{
+			pop Default level2ScreenFreq
+		} if
+ end
+} bind def
+userdict /currentScreenFreq  
+	level2? {currenthalftone level2ScreenFreq} {currentscreen pop pop} ifelse put
+level2? not
+	{
+		/setcmykcolor where not
+		{
+			/setcmykcolor
+			{
+				exch .11 mul add exch .59 mul add exch .3 mul add
+				1 exch sub setgray
+			} def
+		} if
+		/currentcmykcolor where not
+		{
+			/currentcmykcolor
+			{
+				0 0 0 1 currentgray sub
+			} def
+		} if
+		/setoverprint where not
+		{
+			/setoverprint /pop load def
+		} if
+		/selectfont where not
+		{
+			/selectfont
+			{
+				exch findfont exch
+				dup type /arraytype eq
+				{
+					makefont
+				}
+				{
+					scalefont
+				} ifelse
+				setfont
+			} bind def
+		} if
+		/cshow where not
+		{
+			/cshow
+			{
+				[
+				0 0 5 -1 roll aload pop
+				] cvx bind forall
+			} bind def
+		} if
+	} if
+	cleartomark
+	/anyColor?
+	{
+		add add add 0 ne
+	} bind def
+	/testColor
+	{
+		gsave
+		setcmykcolor currentcmykcolor
+		grestore
+	} bind def
+	/testCMYKColorThrough
+	{
+		testColor anyColor?
+	} bind def
+	userdict /composite?
+	level2?
+	{
+		gsave 1 1 1 1 setcmykcolor currentcmykcolor grestore
+		add add add 4 eq
+	}
+	{
+		1 0 0 0 testCMYKColorThrough
+		0 1 0 0 testCMYKColorThrough
+		0 0 1 0 testCMYKColorThrough
+		0 0 0 1 testCMYKColorThrough
+		and and and
+	} ifelse
+	put
+	composite? not
+	{
+		userdict begin
+		gsave
+		/cyan? 1 0 0 0 testCMYKColorThrough def
+		/magenta? 0 1 0 0 testCMYKColorThrough def
+		/yellow? 0 0 1 0 testCMYKColorThrough def
+		/black? 0 0 0 1 testCMYKColorThrough def
+		grestore
+		/isCMYKSep? cyan? magenta? yellow? black? or or or def
+		/customColor? isCMYKSep? not def
+	 end
+	} if
+ end defaultpacking setpacking
+%%EndResource
+%%BeginProcSet: Adobe_ColorImage_AI6 1.1 0
+userdict /Adobe_ColorImage_AI6 known not
+{
+	userdict /Adobe_ColorImage_AI6 24 dict put 
+} if
+userdict /Adobe_ColorImage_AI6 get begin
+/initialize
+{ 
+	Adobe_ColorImage_AI6 begin
+	Adobe_ColorImage_AI6
+	{
+		dup type /arraytype eq
+		{
+			dup xcheck
+			{
+				bind
+			} if
+		} if
+		pop pop
+	} forall
+} def
+/terminate { end } def
+currentdict /Adobe_ColorImage_AI6_Vars known not
+{
+	/Adobe_ColorImage_AI6_Vars 15 dict def
+} if
+Adobe_ColorImage_AI6_Vars begin
+	/channelcount 0 def
+	/sourcecount 0 def
+	/sourcearray 4 array def
+	/plateindex -1 def
+	/XIMask 0 def
+	/XIBinary 0 def
+	/XIChannelCount 0 def
+	/XIBitsPerPixel 0 def
+	/XIImageHeight 0 def
+	/XIImageWidth 0 def
+	/XIImageMatrix null def
+	/XIBuffer null def
+	/XIDataProc null def
+	/XIVersion 6 def
+end
+/WalkRGBString null def
+/WalkCMYKString null def
+/StuffRGBIntoGrayString null def
+/RGBToGrayImageProc null def
+/StuffCMYKIntoGrayString null def
+/CMYKToGrayImageProc null def
+/ColorImageCompositeEmulator null def
+/SeparateCMYKImageProc null def
+/FourEqual null def
+/TestPlateIndex null def
+currentdict /_colorimage known not
+{
+	/colorimage where
+	{
+		/colorimage get /_colorimage exch def
+	}
+	{
+		/_colorimage null def
+	} ifelse
+} if
+/_currenttransfer systemdict /currenttransfer get def
+/colorimage null def
+/XI null def
+/WalkRGBString
+{
+	0 3 index
+	dup length 1 sub 0 3 3 -1 roll
+	{
+		3 getinterval { } forall
+		5 index exec
+		3 index
+	} for
+	
+	 5 { pop } repeat
+} def
+/WalkCMYKString
+{
+	0 3 index
+	dup length 1 sub 0 4 3 -1 roll
+	{
+		4 getinterval { } forall
+		
+		6 index exec
+		
+		3 index
+		
+	} for
+	
+	5 { pop } repeat
+	
+} def
+/StuffRGBIntoGrayString
+{
+	.11 mul exch
+	
+	.59 mul add exch
+	
+	.3 mul add
+	
+	cvi 3 copy put
+	
+	pop 1 add
+} def
+/RGBToGrayImageProc
+{	
+	Adobe_ColorImage_AI6_Vars begin 
+		sourcearray 0 get exec
+		dup length 3 idiv string
+		dup 3 1 roll 
+		
+		/StuffRGBIntoGrayString load exch
+		WalkRGBString
+ end
+} def
+/StuffCMYKIntoGrayString
+{
+	exch .11 mul add
+	
+	exch .59 mul add
+	
+	exch .3 mul add
+	
+	dup 255 gt { pop 255 } if
+	
+	255 exch sub cvi 3 copy put
+	
+	pop 1 add
+} def
+/CMYKToGrayImageProc
+{	
+	Adobe_ColorImage_AI6_Vars begin
+		sourcearray 0 get exec
+		dup length 4 idiv string
+		dup 3 1 roll 
+		
+		/StuffCMYKIntoGrayString load exch
+		WalkCMYKString
+ end
+} def
+/ColorImageCompositeEmulator
+{
+	pop true eq
+	{
+		Adobe_ColorImage_AI6_Vars /sourcecount get 5 add { pop } repeat
+	}
+	{
+		Adobe_ColorImage_AI6_Vars /channelcount get 1 ne
+		{
+			Adobe_ColorImage_AI6_Vars begin
+				sourcearray 0 3 -1 roll put
+			
+				channelcount 3 eq 
+				{ 
+					/RGBToGrayImageProc 
+				}
+				{ 
+					/CMYKToGrayImageProc
+				} ifelse
+				load
+		 end
+		} if
+		image
+	} ifelse
+} def
+/SeparateCMYKImageProc
+{	
+	Adobe_ColorImage_AI6_Vars begin
+		sourcecount 0 ne
+		{
+			sourcearray plateindex get exec
+		}
+		{			
+			sourcearray 0 get exec
+			
+			dup length 4 idiv string
+			
+			0 2 index
+			
+			plateindex 4 2 index length 1 sub
+			{
+				get 255 exch sub
+				
+				3 copy put pop 1 add
+				
+				2 index
+			} for
+			pop pop exch pop
+		} ifelse
+ end
+} def
+	
+/FourEqual
+{
+	4 index ne
+	{
+		pop pop pop false
+	}
+	{
+		4 index ne
+		{
+			pop pop false
+		}
+		{
+			4 index ne
+			{
+				pop false
+			}
+			{
+				4 index eq
+			} ifelse
+		} ifelse
+	} ifelse
+} def
+/TestPlateIndex
+{
+	Adobe_ColorImage_AI6_Vars begin
+		/plateindex -1 def
+		/setcmykcolor where
+		{
+			pop
+			gsave
+			1 0 0 0 setcmykcolor systemdict /currentgray get exec 1 exch sub
+			0 1 0 0 setcmykcolor systemdict /currentgray get exec 1 exch sub
+			0 0 1 0 setcmykcolor systemdict /currentgray get exec 1 exch sub
+			0 0 0 1 setcmykcolor systemdict /currentgray get exec 1 exch sub
+			grestore
+			1 0 0 0 FourEqual 
+			{ 
+				/plateindex 0 def
+			}
+			{
+				0 1 0 0 FourEqual
+				{ 
+					/plateindex 1 def
+				}
+				{
+					0 0 1 0 FourEqual
+					{
+						/plateindex 2 def
+					}
+					{
+						0 0 0 1 FourEqual
+						{ 
+							/plateindex 3 def
+						}
+						{
+							0 0 0 0 FourEqual
+							{
+								/plateindex 5 def
+							} if
+						} ifelse
+					} ifelse
+				} ifelse
+			} ifelse
+			pop pop pop pop
+		} if
+		plateindex
+ end
+} def
+/colorimage
+{
+	Adobe_ColorImage_AI6_Vars begin
+		/channelcount 1 index def
+		/sourcecount 2 index 1 eq { channelcount 1 sub } { 0 } ifelse def
+		4 sourcecount add index dup 
+		8 eq exch 1 eq or not
+ end
+	
+	{
+		/_colorimage load null ne
+		{
+			_colorimage
+		}
+		{
+			Adobe_ColorImage_AI6_Vars /sourcecount get
+			7 add { pop } repeat
+		} ifelse
+	}
+	{
+		dup 3 eq
+		TestPlateIndex
+		dup -1 eq exch 5 eq or or
+		{
+			/_colorimage load null eq
+			{
+				ColorImageCompositeEmulator
+			}
+			{
+				dup 1 eq
+				{
+					pop pop image
+				}
+				{
+					Adobe_ColorImage_AI6_Vars /plateindex get 5 eq
+					{
+						gsave
+						
+						0 _currenttransfer exec
+						1 _currenttransfer exec
+						eq
+						{ 0 _currenttransfer exec 0.5 lt }
+						{ 0 _currenttransfer exec 1 _currenttransfer exec gt } ifelse
+						
+						{ { pop 0 } } { { pop 1 } } ifelse
+						systemdict /settransfer get exec
+					} if
+					
+					_colorimage
+					
+					Adobe_ColorImage_AI6_Vars /plateindex get 5 eq
+					{
+						grestore
+					} if
+				} ifelse
+			} ifelse
+		}
+		{
+			dup 1 eq
+			{
+				pop pop
+				image
+			}
+			{
+				pop pop
+				Adobe_ColorImage_AI6_Vars begin
+					sourcecount -1 0
+					{			
+						exch sourcearray 3 1 roll put
+					} for
+					/SeparateCMYKImageProc load
+			 end
+				systemdict /image get exec
+			} ifelse
+		} ifelse
+	} ifelse
+} def
+/XG
+{
+	pop pop
+} def
+/XF
+{
+	13 {pop} repeat
+} def
+/Xh
+{
+	Adobe_ColorImage_AI6_Vars begin
+		gsave
+		/XIMask exch 0 ne def
+		/XIImageHeight exch def
+		/XIImageWidth exch def
+		/XIImageMatrix exch def
+		0 0 moveto
+		XIImageMatrix concat
+		XIImageWidth XIImageHeight scale
+		
+		XIMask
+		{
+			/_lp /null ddef
+			_fc
+			/_lp /imagemask ddef
+		}
+		if
+		/XIVersion 7 def
+ end
+} def
+/XH
+{
+	Adobe_ColorImage_AI6_Vars begin
+		/XIVersion 6 def
+		grestore
+ end
+} def
+/XI
+{
+	Adobe_ColorImage_AI6_Vars begin
+		gsave
+		/XIMask exch 0 ne def
+		/XIBinary exch 0 ne def
+		pop
+		pop
+		/XIChannelCount exch def
+		/XIBitsPerPixel exch def
+		/XIImageHeight exch def
+		/XIImageWidth exch def
+		pop pop pop pop
+		/XIImageMatrix exch def
+		XIBitsPerPixel 1 eq
+		{
+			XIImageWidth 8 div ceiling cvi
+		}
+		{
+			XIImageWidth XIChannelCount mul
+		} ifelse
+		/XIBuffer exch string def
+		XIBinary
+		{
+			/XIDataProc { currentfile XIBuffer readstring pop } def
+			XIVersion 6 le
+			{
+				currentfile 128 string readline pop pop
+			}
+			if
+		}
+		{
+			/XIDataProc { currentfile XIBuffer readhexstring pop } def
+		} ifelse
+		
+		XIVersion 6 le
+		{
+			0 0 moveto
+			XIImageMatrix concat
+			XIImageWidth XIImageHeight scale
+			XIMask
+			{
+				/_lp /null ddef
+				_fc
+				/_lp /imagemask ddef
+			} if
+		} if
+		
+		XIMask
+		{
+			XIImageWidth XIImageHeight
+			false
+			[ XIImageWidth 0 0 XIImageHeight neg 0 0 ]
+			/XIDataProc load
+			imagemask
+		}
+		{
+			XIImageWidth XIImageHeight
+			XIBitsPerPixel
+			[ XIImageWidth 0 0 XIImageHeight neg 0 0 ]
+			/XIDataProc load
+			
+			XIChannelCount 1 eq
+			{
+				gsave
+				0 setgray
+				image
+				grestore
+			}
+			{
+				false
+				XIChannelCount
+				colorimage
+			} ifelse
+		} ifelse
+		grestore
+ end
+} def
+end
+%%EndProcSet
+%%BeginResource: procset Adobe_Illustrator_AI5 1.2 0
+%%Title: (Adobe Illustrator (R) Version 7.0 Full Prolog)
+%%Version: 1.2 0
+%%CreationDate: (3/7/1994) ()
+%%Copyright: ((C) 1987-1996 Adobe Systems Incorporated All Rights Reserved)
+currentpacking true setpacking
+userdict /Adobe_Illustrator_AI5_vars 107 dict dup begin
+put
+/_eo false def
+/_lp /none def
+/_pf
+{
+} def
+/_ps
+{
+} def
+/_psf
+{
+} def
+/_pss
+{
+} def
+/_pjsf
+{
+} def
+/_pjss
+{
+} def
+/_pola 0 def
+/_doClip 0 def
+/cf currentflat def
+/_lineorientation 0 def
+/_charorientation 0 def
+/_yokoorientation 0 def
+/_tm matrix def
+/_renderStart
+[
+/e0 /r0 /a0 /o0 /e1 /r1 /a1 /i0
+] def
+/_renderEnd
+[
+null null null null /i1 /i1 /i1 /i1
+] def
+/_render -1 def
+/_shift [0 0] def
+/_ax 0 def
+/_ay 0 def
+/_cx 0 def
+/_cy 0 def
+/_leading
+[
+0 0
+] def
+/_ctm matrix def
+/_mtx matrix def
+/_sp 16#020 def
+/_hyphen (-) def
+/_fontSize 0 def
+/_fontAscent 0 def
+/_fontDescent 0 def
+/_fontHeight 0 def
+/_fontRotateAdjust 0 def
+/Ss 256 string def
+Ss 0 (fonts/) putinterval
+/_cnt 0 def
+/_scale [1 1] def
+/_nativeEncoding 0 def
+/_useNativeEncoding 0 def
+/_tempEncode 0 def
+/_pntr 0 def
+/_tDict 2 dict def
+/_hfname 100 string def
+/_hffound false def
+/Tx
+{
+} def
+/Tj
+{
+} def
+/CRender
+{
+} def
+/_AI3_savepage
+{
+} def
+/_gf null def
+/_cf 4 array def
+/_rgbf 3 array def
+/_if null def
+/_of false def
+/_fc
+{
+} def
+/_gs null def
+/_cs 4 array def
+/_rgbs 3 array def
+/_is null def
+/_os false def
+/_sc
+{
+} def
+/_pd 1 dict def
+/_ed 15 dict def
+/_pm matrix def
+/_fm null def
+/_fd null def
+/_fdd null def
+/_sm null def
+/_sd null def
+/_sdd null def
+/_i null def
+/_lobyte 0 def
+/_hibyte 0 def
+/_cproc null def
+/_cscript 0 def
+/_hvax 0 def
+/_hvay 0 def
+/_hvwb 0 def
+/_hvcx 0 def
+/_hvcy 0 def
+/_bitfont null def
+/_bitlobyte 0 def
+/_bithibyte 0 def
+/_bitkey null def
+/_bitdata null def
+/_bitindex 0 def
+/discardSave null def
+/buffer 256 string def
+/beginString null def
+/endString null def
+/endStringLength null def
+/layerCnt 1 def
+/layerCount 1 def
+/perCent (%) 0 get def
+/perCentSeen? false def
+/newBuff null def
+/newBuffButFirst null def
+/newBuffLast null def
+/clipForward? false def
+end
+userdict /Adobe_Illustrator_AI5 known not {
+	userdict /Adobe_Illustrator_AI5 95 dict put
+} if
+userdict /Adobe_Illustrator_AI5 get begin
+/initialize
+{
+	Adobe_Illustrator_AI5 dup begin
+	Adobe_Illustrator_AI5_vars begin
+	discardDict
+	{
+		bind pop pop
+	} forall
+	dup /nc get begin
+	{
+		dup xcheck 1 index type /operatortype ne and
+		{
+			bind
+		} if
+		pop pop
+	} forall
+ end
+	newpath
+} def
+/terminate
+{
+ end
+ end
+} def
+/_
+null def
+/ddef
+{
+	Adobe_Illustrator_AI5_vars 3 1 roll put
+} def
+/xput
+{
+	dup load dup length exch maxlength eq
+	{
+		dup dup load dup
+		length 2 mul dict copy def
+	} if
+	load begin
+	def
+ end
+} def
+/npop
+{
+	{
+		pop
+	} repeat
+} def
+/hswj
+{
+	dup stringwidth 3 2 roll
+	{
+		_hvwb eq { exch _hvcx add exch _hvcy add } if
+		exch _hvax add exch _hvay add
+	} cforall
+} def
+/vswj
+{
+	0 0 3 -1 roll
+	{
+		dup 255 le
+		_charorientation 1 eq
+		and
+		{
+			dup cstring stringwidth 5 2 roll
+			_hvwb eq { exch _hvcy sub exch _hvcx sub } if
+			exch _hvay sub exch _hvax sub
+			4 -1 roll sub exch
+			3 -1 roll sub exch
+		}
+		{
+			_hvwb eq { exch _hvcy sub exch _hvcx sub } if
+			exch _hvay sub exch _hvax sub
+			_fontHeight sub
+		} ifelse
+	} cforall
+} def
+/swj
+{
+	6 1 roll
+	/_hvay exch ddef
+	/_hvax exch ddef
+	/_hvwb exch ddef
+	/_hvcy exch ddef
+	/_hvcx exch ddef
+	_lineorientation 0 eq { hswj } { vswj } ifelse
+} def
+/sw
+{
+	0 0 0 6 3 roll swj
+} def
+/vjss
+{
+	4 1 roll
+	{
+		dup cstring
+		dup length 1 eq
+		_charorientation 1 eq
+		and
+		{
+			-90 rotate
+			currentpoint
+			_fontRotateAdjust add
+			moveto
+			gsave
+			false charpath currentpoint
+			5 index setmatrix stroke
+			grestore
+			_fontRotateAdjust sub
+			moveto
+			_sp eq
+			{
+				5 index 5 index rmoveto
+			} if
+			2 copy rmoveto
+			90 rotate
+		}
+		{
+			currentpoint
+			_fontHeight sub
+			5 index sub
+			3 index _sp eq
+			{
+				9 index sub
+			} if
+	
+			currentpoint
+			exch 4 index stringwidth pop 2 div sub
+			exch _fontAscent sub
+			moveto
+	
+			gsave
+			2 index false charpath
+			6 index setmatrix stroke
+			grestore
+	
+			moveto pop pop
+		} ifelse
+	} cforall
+	6 npop
+} def
+/hjss
+{
+	4 1 roll
+	{
+		dup cstring
+		gsave
+		false charpath currentpoint
+		5 index setmatrix stroke
+		grestore
+		moveto
+		_sp eq
+		{
+			5 index 5 index rmoveto
+		} if
+		2 copy rmoveto
+	} cforall
+	6 npop
+} def
+/jss
+{
+	_lineorientation 0 eq { hjss } { vjss } ifelse
+} def
+/ss
+{
+	0 0 0 7 3 roll jss
+} def
+/vjsp
+{
+	4 1 roll
+	{
+		dup cstring
+		dup length 1 eq
+		_charorientation 1 eq
+		and
+		{
+			-90 rotate
+			currentpoint
+			_fontRotateAdjust add
+			moveto
+			false charpath
+            currentpoint
+			_fontRotateAdjust sub
+			moveto
+			_sp eq
+			{
+				5 index 5 index rmoveto
+			} if
+			2 copy rmoveto
+			90 rotate
+		}
+		{
+			currentpoint
+			_fontHeight sub
+			5 index sub
+			3 index _sp eq
+			{
+				9 index sub
+			} if
+	
+			currentpoint
+			exch 4 index stringwidth pop 2 div sub
+			exch _fontAscent sub
+			moveto
+	
+			2 index false charpath
+	
+			moveto pop pop
+		} ifelse
+	} cforall
+	6 npop
+} def
+/hjsp
+{
+    4 1 roll
+    {
+        dup cstring
+        false charpath
+        _sp eq
+        {
+            5 index 5 index rmoveto
+        } if
+        2 copy rmoveto
+    } cforall
+    6 npop
+} def
+/jsp
+{
+	matrix currentmatrix
+    _lineorientation 0 eq {hjsp} {vjsp} ifelse
+} def
+/sp
+{
+    matrix currentmatrix
+    0 0 0 7 3 roll
+    _lineorientation 0 eq {hjsp} {vjsp} ifelse
+} def
+/pl
+{
+	transform
+	0.25 sub round 0.25 add exch
+	0.25 sub round 0.25 add exch
+	itransform
+} def
+/setstrokeadjust where
+{
+	pop true setstrokeadjust
+	/c
+	{
+		curveto
+	} def
+	/C
+	/c load def
+	/v
+	{
+		currentpoint 6 2 roll curveto
+	} def
+	/V
+	/v load def
+	/y
+	{
+		2 copy curveto
+	} def
+	/Y
+	/y load def
+	/l
+	{
+		lineto
+	} def
+	/L
+	/l load def
+	/m
+	{
+		moveto
+	} def
+}
+{
+	/c
+	{
+		pl curveto
+	} def
+	/C
+	/c load def
+	/v
+	{
+		currentpoint 6 2 roll pl curveto
+	} def
+	/V
+	/v load def
+	/y
+	{
+		pl 2 copy curveto
+	} def
+	/Y
+	/y load def
+	/l
+	{
+		pl lineto
+	} def
+	/L
+	/l load def
+	/m
+	{
+		pl moveto
+	} def
+} ifelse
+/d
+{
+	setdash
+} def
+/cf
+{
+} def
+/i
+{
+	dup 0 eq
+	{
+		pop cf
+	} if
+	setflat
+} def
+/j
+{
+	setlinejoin
+} def
+/J
+{
+	setlinecap
+} def
+/M
+{
+	setmiterlimit
+} def
+/w
+{
+	setlinewidth
+} def
+/XR
+{
+	0 ne
+	/_eo exch ddef
+} def
+/H
+{
+} def
+/h
+{
+	closepath
+} def
+/N
+{
+	_pola 0 eq
+	{
+		_doClip 1 eq
+		{
+			_eo {eoclip} {clip} ifelse /_doClip 0 ddef
+		} if
+		newpath
+	}
+	{
+		/CRender
+		{
+			N
+		} ddef
+	} ifelse
+} def
+/n
+{
+	N
+} def
+/F
+{
+	_pola 0 eq
+	{
+		_doClip 1 eq
+		{
+			gsave _pf grestore _eo {eoclip} {clip} ifelse newpath /_lp /none ddef _fc
+			/_doClip 0 ddef
+		}
+		{
+			_pf
+		} ifelse
+	}
+	{
+		/CRender
+		{
+			F
+		} ddef
+	} ifelse
+} def
+/f
+{
+	closepath
+	F
+} def
+/S
+{
+	_pola 0 eq
+	{
+		_doClip 1 eq
+		{
+			gsave _ps grestore _eo {eoclip} {clip} ifelse newpath /_lp /none ddef _sc
+			/_doClip 0 ddef
+		}
+		{
+			_ps
+		} ifelse
+	}
+	{
+		/CRender
+		{
+			S
+		} ddef
+	} ifelse
+} def
+/s
+{
+	closepath
+	S
+} def
+/B
+{
+	_pola 0 eq
+	{
+		_doClip 1 eq
+		gsave F grestore
+		{
+			gsave S grestore _eo {eoclip} {clip} ifelse newpath /_lp /none ddef _sc
+			/_doClip 0 ddef
+		}
+		{
+			S
+		} ifelse
+	}
+	{
+		/CRender
+		{
+			B
+		} ddef
+	} ifelse
+} def
+/b
+{
+	closepath
+	B
+} def
+/W
+{
+	/_doClip 1 ddef
+} def
+/*
+{
+	count 0 ne
+	{
+		dup type /stringtype eq
+		{
+			pop
+		} if
+	} if
+	newpath
+} def
+/u
+{
+} def
+/U
+{
+} def
+/q
+{
+	_pola 0 eq
+	{
+		gsave
+	} if
+} def
+/Q
+{
+	_pola 0 eq
+	{
+		grestore
+	} if
+} def
+/*u
+{
+	_pola 1 add /_pola exch ddef
+} def
+/*U
+{
+	_pola 1 sub /_pola exch ddef
+	_pola 0 eq
+	{
+		CRender
+	} if
+} def
+/D
+{
+	pop
+} def
+/*w
+{
+} def
+/*W
+{
+} def
+/`
+{
+	/_i save ddef
+	clipForward?
+	{
+		nulldevice
+	} if
+	6 1 roll 4 npop
+	concat pop
+	userdict begin
+	/showpage
+	{
+	} def
+	0 setgray
+	0 setlinecap
+	1 setlinewidth
+	0 setlinejoin
+	10 setmiterlimit
+	[] 0 setdash
+	/setstrokeadjust where {pop false setstrokeadjust} if
+	newpath
+	0 setgray
+	false setoverprint
+} def
+/~
+{
+ end
+	_i restore
+} def
+/O
+{
+	0 ne
+	/_of exch ddef
+	/_lp /none ddef
+} def
+/R
+{
+	0 ne
+	/_os exch ddef
+	/_lp /none ddef
+} def
+/g
+{
+	/_gf exch ddef
+	/_fc
+	{
+		_lp /fill ne
+		{
+			_of setoverprint
+			_gf setgray
+			/_lp /fill ddef
+		} if
+	} ddef
+	/_pf
+	{
+		_fc
+		_eo {eofill} {fill} ifelse
+	} ddef
+	/_psf
+	{
+		_fc
+		hvashow
+	} ddef
+	/_pjsf
+	{
+		_fc
+		hvawidthshow
+	} ddef
+	/_lp /none ddef
+} def
+/G
+{
+	/_gs exch ddef
+	/_sc
+	{
+		_lp /stroke ne
+		{
+			_os setoverprint
+			_gs setgray
+			/_lp /stroke ddef
+		} if
+	} ddef
+	/_ps
+	{
+		_sc
+		stroke
+	} ddef
+	/_pss
+	{
+		_sc
+		ss
+	} ddef
+	/_pjss
+	{
+		_sc
+		jss
+	} ddef
+	/_lp /none ddef
+} def
+/k
+{
+	_cf astore pop
+	/_fc
+	{
+		_lp /fill ne
+		{
+			_of setoverprint
+			_cf aload pop setcmykcolor
+			/_lp /fill ddef
+		} if
+	} ddef
+	/_pf
+	{
+		_fc
+		_eo {eofill} {fill} ifelse
+	} ddef
+	/_psf
+	{
+		_fc
+		hvashow
+	} ddef
+	/_pjsf
+	{
+		_fc
+		hvawidthshow
+	} ddef
+	/_lp /none ddef
+} def
+/K
+{
+	_cs astore pop
+	/_sc
+	{
+		_lp /stroke ne
+		{
+			_os setoverprint
+			_cs aload pop setcmykcolor
+			/_lp /stroke ddef
+		} if
+	} ddef
+	/_ps
+	{
+		_sc
+		stroke
+	} ddef
+	/_pss
+	{
+		_sc
+		ss
+	} ddef
+	/_pjss
+	{
+		_sc
+		jss
+	} ddef
+	/_lp /none ddef
+} def
+/Xa
+{
+	_rgbf astore pop
+	/_fc
+	{
+		_lp /fill ne
+		{
+			_of setoverprint
+			_rgbf aload pop setrgbcolor
+			/_lp /fill ddef
+		} if
+	} ddef
+	/_pf
+	{
+		_fc
+		_eo {eofill} {fill} ifelse
+	} ddef
+	/_psf
+	{
+		_fc
+		hvashow
+	} ddef
+	/_pjsf
+	{
+		_fc
+		hvawidthshow
+	} ddef
+	/_lp /none ddef
+} def
+/XA
+{
+	_rgbs astore pop
+	/_sc
+	{
+		_lp /stroke ne
+		{
+			_os setoverprint
+			_rgbs aload pop setrgbcolor
+			/_lp /stroke ddef
+		} if
+	} ddef
+	/_ps
+	{
+		_sc
+		stroke
+	} ddef
+	/_pss
+	{
+		_sc
+		ss
+	} ddef
+	/_pjss
+	{
+		_sc
+		jss
+	} ddef
+	/_lp /none ddef
+} def
+/_rgbtocmyk
+{
+3
+	{
+	1 exch sub 3 1 roll
+	} repeat
+3 copy 1 4 1 roll
+3
+	{
+	3 index 2 copy gt
+		{
+		exch
+		} if
+	pop 4 1 roll
+	} repeat
+pop pop pop
+4 1 roll
+3
+	{
+	3 index sub
+	3 1 roll
+	} repeat
+4 -1 roll
+} def
+/Xx
+{
+	exch
+	/_gf exch ddef
+	0 eq
+	{
+		findcmykcustomcolor
+	}
+	{
+		/findrgbcustomcolor where not {
+			4 1 roll _rgbtocmyk
+			5 -1 roll
+			findcmykcustomcolor
+		}
+		{
+			pop
+			findrgbcustomcolor
+		} ifelse
+	} ifelse
+	/_if exch ddef
+	/_fc
+	{
+		_lp /fill ne
+		{
+			_of setoverprint
+			_if _gf 1 exch sub setcustomcolor
+			/_lp /fill ddef
+		} if
+	} ddef
+	/_pf
+	{
+		_fc
+		_eo {eofill} {fill} ifelse
+	} ddef
+	/_psf
+	{
+		_fc
+		hvashow
+	} ddef
+	/_pjsf
+	{
+		_fc
+		hvawidthshow
+	} ddef
+	/_lp /none ddef
+} def
+/XX
+{
+	exch
+	/_gs exch ddef
+	0 eq
+	{
+		findcmykcustomcolor
+	}
+	{
+		/findrgbcustomcolor where not {
+			4 1 roll _rgbtocmyk
+			5 -1 roll
+			findcmykcustomcolor
+		}
+		{
+			pop
+			findrgbcustomcolor
+		} ifelse
+	} ifelse
+	/_is exch ddef
+	/_sc
+	{
+		_lp /stroke ne
+		{
+			_os setoverprint
+			_is _gs 1 exch sub setcustomcolor
+			/_lp /stroke ddef
+		} if
+	} ddef
+	/_ps
+	{
+		_sc
+		stroke
+	} ddef
+	/_pss
+	{
+		_sc
+		ss
+	} ddef
+	/_pjss
+	{
+		_sc
+		jss
+	} ddef
+	/_lp /none ddef
+} def
+/x
+{
+	/_gf exch ddef
+	findcmykcustomcolor
+	/_if exch ddef
+	/_fc
+	{
+		_lp /fill ne
+		{
+			_of setoverprint
+			_if _gf 1 exch sub setcustomcolor
+			/_lp /fill ddef
+		} if
+	} ddef
+	/_pf
+	{
+		_fc
+		_eo {eofill} {fill} ifelse
+	} ddef
+	/_psf
+	{
+		_fc
+		hvashow
+	} ddef
+	/_pjsf
+	{
+		_fc
+		hvawidthshow
+	} ddef
+	/_lp /none ddef
+} def
+/X
+{
+	/_gs exch ddef
+	findcmykcustomcolor
+	/_is exch ddef
+	/_sc
+	{
+		_lp /stroke ne
+		{
+			_os setoverprint
+			_is _gs 1 exch sub setcustomcolor
+			/_lp /stroke ddef
+		} if
+	} ddef
+	/_ps
+	{
+		_sc
+		stroke
+	} ddef
+	/_pss
+	{
+		_sc
+		ss
+	} ddef
+	/_pjss
+	{
+		_sc
+		jss
+	} ddef
+	/_lp /none ddef
+} def
+/A
+{
+	pop
+} def
+/annotatepage
+{
+userdict /annotatepage 2 copy known {get exec} {pop pop} ifelse
+} def
+/XT {
+	pop pop
+} def
+/discard
+{
+	save /discardSave exch store
+	discardDict begin
+	/endString exch store
+	gt38?
+	{
+		2 add
+	} if
+	load
+	stopped
+	pop
+ end
+	discardSave restore
+} bind def
+userdict /discardDict 7 dict dup begin
+put
+/pre38Initialize
+{
+	/endStringLength endString length store
+	/newBuff buffer 0 endStringLength getinterval store
+	/newBuffButFirst newBuff 1 endStringLength 1 sub getinterval store
+	/newBuffLast newBuff endStringLength 1 sub 1 getinterval store
+} def
+/shiftBuffer
+{
+	newBuff 0 newBuffButFirst putinterval
+	newBuffLast 0
+	currentfile read not
+	{
+	stop
+	} if
+	put
+} def
+0
+{
+	pre38Initialize
+	mark
+	currentfile newBuff readstring exch pop
+	{
+		{
+			newBuff endString eq
+			{
+				cleartomark stop
+			} if
+			shiftBuffer
+		} loop
+	}
+	{
+	stop
+	} ifelse
+} def
+1
+{
+	pre38Initialize
+	/beginString exch store
+	mark
+	currentfile newBuff readstring exch pop
+	{
+		{
+			newBuff beginString eq
+			{
+				/layerCount dup load 1 add store
+			}
+			{
+				newBuff endString eq
+				{
+					/layerCount dup load 1 sub store
+					layerCount 0 eq
+					{
+						cleartomark stop
+					} if
+				} if
+			} ifelse
+			shiftBuffer
+		} loop
+	} if
+} def
+2
+{
+	mark
+	{
+		currentfile buffer readline not
+		{
+		stop
+		} if
+		endString eq
+		{
+			cleartomark stop
+		} if
+	} loop
+} def
+3
+{
+	/beginString exch store
+	/layerCnt 1 store
+	mark
+	{
+		currentfile buffer readline not
+		{
+		stop
+		} if
+		dup beginString eq
+		{
+			pop /layerCnt dup load 1 add store
+		}
+		{
+			endString eq
+			{
+				layerCnt 1 eq
+				{
+					cleartomark stop
+				}
+				{
+					/layerCnt dup load 1 sub store
+				} ifelse
+			} if
+		} ifelse
+	} loop
+} def
+end
+userdict /clipRenderOff 15 dict dup begin
+put
+{
+	/n /N /s /S /f /F /b /B
+}
+{
+	{
+		_doClip 1 eq
+		{
+			/_doClip 0 ddef _eo {eoclip} {clip} ifelse
+		} if
+		newpath
+	} def
+} forall
+/Tr /pop load def
+/Bb {} def
+/BB /pop load def
+/Bg {12 npop} def
+/Bm {6 npop} def
+/Bc /Bm load def
+/Bh {4 npop} def
+end
+/Lb
+{
+	4 npop
+	6 1 roll
+	pop
+	4 1 roll
+	pop pop pop
+	0 eq
+	{
+		0 eq
+		{
+			(%AI5_BeginLayer) 1 (%AI5_EndLayer--) discard
+		}
+		{
+			
+			/clipForward? true def
+			
+			/Tx /pop load def
+			/Tj /pop load def
+			
+			currentdict end clipRenderOff begin begin
+		} ifelse
+	}
+	{
+		0 eq
+		{
+			save /discardSave exch store
+		} if
+	} ifelse
+} bind def
+/LB
+{
+	discardSave dup null ne
+	{
+		restore
+	}
+	{
+		pop
+		clipForward?
+		{
+			currentdict
+		 end
+		 end
+		 begin
+					
+			/clipForward? false ddef
+		} if
+	} ifelse
+} bind def
+/Pb
+{
+	pop pop
+	0 (%AI5_EndPalette) discard
+} bind def
+/Np
+{
+	0 (%AI5_End_NonPrinting--) discard
+} bind def
+/Ln /pop load def
+/Ap
+/pop load def
+/Ar
+{
+	72 exch div
+	0 dtransform dup mul exch dup mul add sqrt
+	dup 1 lt
+	{
+		pop 1
+	} if
+	setflat
+} def
+/Mb
+{
+	q
+} def
+/Md
+{
+} def
+/MB
+{
+	Q
+} def
+/nc 4 dict def
+nc begin
+/setgray
+{
+	pop
+} bind def
+/setcmykcolor
+{
+	4 npop
+} bind def
+/setrgbcolor
+{
+	3 npop
+} bind def
+/setcustomcolor
+{
+	2 npop
+} bind def
+currentdict readonly pop
+end
+end
+setpacking
+%%EndResource
+%%BeginResource: procset Adobe_cshow 2.0 8
+%%Title: (Writing System Operators)
+%%Version: 2.0 8
+%%CreationDate: (1/23/89) ()
+%%Copyright: ((C) 1992-1996 Adobe Systems Incorporated All Rights Reserved)
+currentpacking true setpacking
+userdict /Adobe_cshow 14 dict dup begin put
+/initialize
+{
+	Adobe_cshow begin
+	Adobe_cshow
+	{
+		dup xcheck
+		{
+			bind
+		} if
+		pop pop
+	} forall
+ end
+	Adobe_cshow begin
+} def
+/terminate
+{
+currentdict Adobe_cshow eq
+	{
+ end
+	} if
+} def
+/cforall
+{
+	/_lobyte 0 ddef
+	/_hibyte 0 ddef
+	/_cproc exch ddef
+	/_cscript currentfont /FontScript known { currentfont /FontScript get } { -1 } ifelse ddef
+	{
+		/_lobyte exch ddef
+		_hibyte 0 eq
+		_cscript 1 eq
+		_lobyte 129 ge _lobyte 159 le and
+		_lobyte 224 ge _lobyte 252 le and or and
+		_cscript 2 eq
+		_lobyte 161 ge _lobyte 254 le and and
+		_cscript 3 eq
+		_lobyte 161 ge _lobyte 254 le and and
+    	_cscript 25 eq
+		_lobyte 161 ge _lobyte 254 le and and
+    	_cscript -1 eq
+		or or or or and
+		{
+			/_hibyte _lobyte ddef
+		}
+		{
+			_hibyte 256 mul _lobyte add
+			_cproc
+			/_hibyte 0 ddef
+		} ifelse
+	} forall
+} def
+/cstring
+{
+	dup 256 lt
+	{
+		(s) dup 0 4 3 roll put
+	}
+	{
+		dup 256 idiv exch 256 mod
+		(hl) dup dup 0 6 5 roll put 1 4 3 roll put
+	} ifelse
+} def
+/clength
+{
+	0 exch
+	{ 256 lt { 1 } { 2 } ifelse add } cforall
+} def
+/hawidthshow
+{
+	{
+		dup cstring
+		show
+		_hvax _hvay rmoveto
+		_hvwb eq { _hvcx _hvcy rmoveto } if
+	} cforall
+} def
+/vawidthshow
+{
+	{
+		dup 255 le
+		_charorientation 1 eq
+		and
+		{
+			-90 rotate
+			0 _fontRotateAdjust rmoveto
+			cstring
+			_hvcx _hvcy _hvwb _hvax _hvay 6 -1 roll awidthshow
+			0 _fontRotateAdjust neg rmoveto
+			90 rotate
+		}
+		{
+			currentpoint
+			_fontHeight sub
+			exch _hvay sub exch _hvax sub
+			2 index _hvwb eq { exch _hvcy sub exch _hvcx sub } if
+			3 2 roll
+			cstring
+			dup stringwidth pop 2 div neg _fontAscent neg rmoveto
+			show
+			moveto
+		} ifelse
+	} cforall
+} def
+/hvawidthshow
+{
+	6 1 roll
+	/_hvay exch ddef
+	/_hvax exch ddef
+	/_hvwb exch ddef
+	/_hvcy exch ddef
+	/_hvcx exch ddef
+	_lineorientation 0 eq { hawidthshow } { vawidthshow } ifelse
+} def
+/hvwidthshow
+{
+	0 0 3 -1 roll hvawidthshow
+} def
+/hvashow
+{
+	0 0 0 6 -3 roll hvawidthshow
+} def
+/hvshow
+{
+	0 0 0 0 0 6 -1 roll hvawidthshow
+} def
+currentdict readonly pop end
+setpacking
+%%EndResource
+%%EndProlog
+%%BeginSetup
+Adobe_level2_AI5 /initialize get exec
+Adobe_cshow /initialize get exec
+Adobe_ColorImage_AI6 /initialize get exec
+Adobe_Illustrator_AI5 /initialize get exec
+%AI5_Begin_NonPrinting
+Np
+%AI3_BeginPattern: (Arrow1.2.out/in)
+(Arrow1.2.out/in) 1 1 39.4039 39.4039 [
+%AI3_Tile
+(0 O 0 R  0.75 0.75 0.375 0 k
+ 0.75 0.75 0.375 0 K
+) @
+(
+%AI6_BeginPatternLayer
+800 Ar
+1 J 0 j 1 w 4 M []0 d
+%AI3_Note:
+0 D
+0 XR
+33.9039 15.6187 m
+39.4247 20.202 L
+39.4247 20.202 L
+33.8869 24.6252 L
+S
+39.2997 20.202 m
+24.5706 20.202 l
+20.4039 20.4792 20.4039 16.8125 v
+20.4039 13.1458 20.4039 12.5625 y
+S
+%AI6_EndPatternLayer
+) &
+] E
+%AI3_EndPattern
+%AI3_BeginPattern: (Arrow1.2.side)
+(Arrow1.2.side) 1 1 39.404 39.4039 [
+%AI3_Tile
+(0 O 0 R  0.75 0.75 0.375 0 k
+ 0.75 0.75 0.375 0 K
+) @
+(
+%AI6_BeginPatternLayer
+800 Ar
+1 J 0 j 1 w 4 M []0 d
+%AI3_Note:
+0 D
+0 XR
+20.202 20.202 m
+39.404 20.202 l
+S
+33.904 15.6187 m
+39.4248 20.202 L
+39.4248 20.202 L
+33.887 24.6252 L
+S
+%AI6_EndPatternLayer
+) &
+] E
+%AI3_EndPattern
+%AI3_BeginPattern: (Bricks)
+(Bricks) 1.6 1.6 73.6 73.6 [
+%AI3_Tile
+(0 O 0 R  0.3 0.85 0.85 0 k
+ 0.3 0.85 0.85 0 K
+) @
+(
+%AI6_BeginPatternLayer
+800 Ar
+0 J 0 j 1 w 4 M []0 d
+%AI3_Note:
+0 D
+0 XR
+1.6 1.6 m
+1.6 73.6 L
+73.6 73.6 L
+73.6 1.6 L
+1.6 1.6 L
+f
+%AI6_EndPatternLayer
+) &
+(0 O 0 R  1 g
+ 1 G
+) @
+(
+%AI6_BeginPatternLayer
+800 Ar
+0 J 0 j 0.3 w 4 M []0 d
+%AI3_Note:
+0 D
+0 XR
+1.6 70.01 m
+73.6 70.01 l
+S
+1.6 62.809 m
+73.6 62.809 L
+S
+1.6 55.609 m
+73.6 55.609 L
+S
+1.6 48.408 m
+73.6 48.408 L
+S
+1.6 41.208 m
+73.6 41.208 L
+S
+1.6 34.007 m
+73.6 34.007 L
+S
+1.6 26.807 m
+73.6 26.807 L
+S
+1.6 19.606 m
+73.6 19.606 L
+S
+1.6 12.406 m
+73.6 12.406 L
+S
+1.6 5.206 m
+73.6 5.206 L
+S
+70.01 70.01 m
+70.01 62.822 l
+S
+55.61 70.01 m
+55.61 62.822 L
+S
+41.21 70.01 m
+41.21 62.822 L
+S
+26.81 70.01 m
+26.81 62.822 L
+S
+12.41 70.01 m
+12.41 62.822 L
+S
+70.01 55.572 m
+70.01 48.385 l
+S
+55.61 55.572 m
+55.61 48.385 L
+S
+41.21 55.572 m
+41.21 48.385 L
+S
+26.81 55.572 m
+26.81 48.385 L
+S
+12.41 55.572 m
+12.41 48.385 L
+S
+70.01 41.197 m
+70.01 34.01 l
+S
+55.61 41.197 m
+55.61 34.01 L
+S
+41.21 41.197 m
+41.21 34.01 L
+S
+26.81 41.197 m
+26.81 34.01 L
+S
+12.41 41.197 m
+12.41 34.01 L
+S
+70.01 26.822 m
+70.01 19.635 l
+S
+55.61 26.822 m
+55.61 19.635 L
+S
+41.21 26.822 m
+41.21 19.635 L
+S
+26.81 26.822 m
+26.81 19.635 L
+S
+12.41 26.822 m
+12.41 19.635 L
+S
+70.01 12.385 m
+70.01 5.197 l
+S
+55.61 12.385 m
+55.61 5.197 L
+S
+41.21 12.385 m
+41.21 5.197 L
+S
+26.81 12.385 m
+26.81 5.197 L
+S
+12.41 12.385 m
+12.41 5.197 L
+S
+62.797 5.197 m
+62.797 1.6 L
+S
+48.397 5.197 m
+48.397 1.6 L
+S
+33.997 5.197 m
+33.997 1.6 L
+S
+19.597 5.197 m
+19.597 1.6 L
+S
+5.197 5.197 m
+5.197 1.6 l
+S
+62.797 19.635 m
+62.797 12.447 L
+S
+48.397 19.635 m
+48.397 12.447 L
+S
+33.997 19.635 m
+33.997 12.447 L
+S
+19.597 19.635 m
+19.597 12.447 L
+S
+5.197 19.635 m
+5.197 12.447 l
+S
+62.797 34.01 m
+62.797 26.822 L
+S
+48.397 34.01 m
+48.397 26.822 L
+S
+19.597 34.01 m
+19.597 26.822 L
+S
+5.197 34.01 m
+5.197 26.822 l
+S
+62.797 48.385 m
+62.797 41.197 L
+S
+48.397 48.385 m
+48.397 41.197 L
+S
+33.997 48.385 m
+33.997 41.197 L
+S
+19.597 48.385 m
+19.597 41.197 L
+S
+5.197 48.385 m
+5.197 41.197 l
+S
+62.797 62.822 m
+62.797 55.635 L
+S
+48.397 62.822 m
+48.397 55.635 L
+S
+33.997 62.822 m
+33.997 55.635 L
+S
+19.597 62.822 m
+19.597 55.635 L
+S
+5.197 62.822 m
+5.197 55.635 l
+S
+62.797 73.5589 m
+62.797 70.072 L
+S
+48.397 73.5589 m
+48.397 70.072 L
+S
+33.997 73.5589 m
+33.997 70.072 L
+S
+19.597 73.5589 m
+19.597 70.072 L
+S
+5.197 73.5589 m
+5.197 70.072 l
+S
+33.997 34.01 m
+33.997 26.822 L
+S
+%AI6_EndPatternLayer
+) &
+] E
+%AI3_EndPattern
+%AI3_BeginPattern: (Checks)
+(Checks) 1 1 31.3995 31.3995 [
+%AI3_Tile
+(0 O 0 R  0 0.9 1 0 k
+ 0 0.9 1 0 K
+) @
+(
+%AI6_BeginPatternLayer
+800 Ar
+0 J 0 j 1 w 4 M []0 d
+%AI3_Note:
+0 D
+1 XR
+19.9995 4.8 m
+27.5995 4.8 L
+27.5995 12.3995 L
+19.9995 12.3995 L
+19.9995 4.8 L
+f
+31.3995 27.5995 m
+31.3995 31.3995 L
+27.5995 31.3995 L
+27.5995 27.5995 L
+31.3995 27.5995 L
+f
+19.9995 27.5995 m
+19.9995 19.9995 L
+27.5995 19.9995 L
+27.5995 27.5995 L
+19.9995 27.5995 L
+f
+0 XR
+12.3995 12.3995 m
+19.9995 12.3995 L
+19.9995 19.9995 L
+12.3995 19.9995 L
+12.3995 12.3995 L
+f
+1 XR
+12.3995 27.5995 m
+4.8 27.5995 L
+4.8 19.9995 L
+12.3995 19.9995 L
+12.3995 27.5995 L
+f
+4.8 12.3995 m
+4.8 4.8 L
+12.3995 4.8 L
+12.3995 12.3995 L
+4.8 12.3995 L
+f
+19.9995 27.5995 m
+19.9995 31.3995 L
+12.3995 31.3995 L
+12.3995 27.5995 L
+19.9995 27.5995 L
+f
+12.3995 4.8 m
+12.3995 1 L
+19.9995 1 L
+19.9995 4.8 L
+12.3995 4.8 L
+f
+4.8 19.9995 m
+1 19.9995 L
+1 12.3995 L
+4.8 12.3995 L
+4.8 19.9995 L
+f
+27.5995 19.9995 m
+27.5995 12.3995 L
+31.3995 12.3995 L
+31.3995 19.9995 L
+27.5995 19.9995 L
+f
+4.8 31.3995 m
+1 31.3995 L
+1 27.5995 L
+4.8 27.5995 L
+4.8 31.3995 L
+f
+27.5995 1 m
+31.3995 1 L
+31.3995 4.8 L
+27.5995 4.8 L
+27.5995 1 L
+f
+1 4.8 m
+1 1 L
+4.8 1 L
+4.8 4.8 L
+1 4.8 L
+f
+%AI6_EndPatternLayer
+) &
+(0 O 0 R  0 0.05 0.2 0 k
+ 0 0.05 0.2 0 K
+) @
+(
+%AI6_BeginPatternLayer
+800 Ar
+0 J 0 j 1 w 4 M []0 d
+%AI3_Note:
+0 D
+1 XR
+4.8 4.8 m
+4.8 1 L
+12.3995 1 L
+12.3995 4.8 L
+4.8 4.8 L
+f
+4.8 12.3995 m
+1 12.3995 L
+1 4.8 L
+4.8 4.8 L
+4.8 12.3995 L
+f
+19.9995 4.8 m
+19.9995 1 L
+27.5995 1 L
+27.5995 4.8 L
+19.9995 4.8 L
+f
+12.3995 12.3995 m
+12.3995 4.8 L
+19.9995 4.8 L
+19.9995 12.3995 L
+12.3995 12.3995 L
+f
+27.5995 4.8 m
+31.3995 4.8 L
+31.3995 12.3995 L
+27.5995 12.3995 L
+27.5995 4.8 L
+f
+12.3995 19.9995 m
+4.8 19.9995 L
+4.8 12.3995 L
+12.3995 12.3995 L
+12.3995 19.9995 L
+f
+4.8 27.5995 m
+1 27.5995 L
+1 19.9995 L
+4.8 19.9995 L
+4.8 27.5995 L
+f
+19.9995 12.3995 m
+27.5995 12.3995 L
+27.5995 19.9995 L
+19.9995 19.9995 L
+19.9995 12.3995 L
+f
+19.9995 19.9995 m
+19.9995 27.5995 L
+12.3995 27.5995 L
+12.3995 19.9995 L
+19.9995 19.9995 L
+f
+27.5995 19.9995 m
+31.3995 19.9995 L
+31.3995 27.5995 L
+27.5995 27.5995 L
+27.5995 19.9995 L
+f
+12.3995 27.5995 m
+12.3995 31.3995 L
+4.8 31.3995 L
+4.8 27.5995 L
+12.3995 27.5995 L
+f
+27.5995 27.5995 m
+27.5995 31.3995 L
+19.9995 31.3995 L
+19.9995 27.5995 L
+27.5995 27.5995 L
+f
+%AI6_EndPatternLayer
+) &
+] E
+%AI3_EndPattern
+%AI3_BeginPattern: (Confetti)
+(Confetti) 4.85 3.617 76.85 75.617 [
+%AI3_Tile
+(0 O 0 R  1 g
+ 1 G
+) @
+(
+%AI6_BeginPatternLayer
+800 Ar
+0 J 0 j 1 w 4 M []0 d
+%AI3_Note:
+0 D
+0 XR
+4.85 3.617 m
+4.85 75.617 L
+76.85 75.617 L
+76.85 3.617 L
+4.85 3.617 L
+f
+%AI6_EndPatternLayer
+) &
+(0 O 0 R  0 g
+ 0 G
+) @
+(
+%AI6_BeginPatternLayer
+800 Ar
+0 J 0 j 0.3 w 4 M []0 d
+%AI3_Note:
+0 D
+0 XR
+10.6 64.867 m
+7.85 62.867 l
+S
+9.1 8.617 m
+6.85 6.867 l
+S
+78.1 68.617 m
+74.85 67.867 l
+S
+76.85 56.867 m
+74.35 55.117 l
+S
+79.6 51.617 m
+76.6 51.617 l
+S
+76.35 44.117 m
+73.6 45.867 l
+S
+78.6 35.867 m
+76.6 34.367 l
+S
+76.1 23.867 m
+73.35 26.117 l
+S
+78.1 12.867 m
+73.85 13.617 l
+S
+68.35 14.617 m
+66.1 12.867 l
+S
+76.6 30.617 m
+73.6 30.617 l
+S
+62.85 58.117 m
+60.956 60.941 l
+S
+32.85 59.617 m
+31.196 62.181 l
+S
+47.891 64.061 m
+49.744 66.742 l
+S
+72.814 2.769 m
+73.928 5.729 l
+S
+67.976 2.633 m
+67.35 5.909 l
+S
+61.85 27.617 m
+59.956 30.441 l
+S
+53.504 56.053 m
+51.85 58.617 l
+S
+52.762 1.779 m
+52.876 4.776 l
+S
+45.391 5.311 m
+47.244 7.992 l
+S
+37.062 3.375 m
+35.639 5.43 l
+S
+55.165 34.828 m
+57.518 37.491 l
+S
+20.795 3.242 m
+22.12 5.193 l
+S
+14.097 4.747 m
+15.008 8.965 l
+S
+9.736 1.91 m
+8.073 4.225 l
+S
+31.891 5.573 m
+32.005 8.571 l
+S
+12.1 70.367 m
+15.6 68.867 l
+S
+9.35 54.867 m
+9.6 58.117 l
+S
+12.85 31.867 m
+14.35 28.117 l
+S
+10.1 37.367 m
+12.35 41.117 l
+S
+34.1 71.117 m
+31.85 68.617 l
+S
+38.35 71.117 m
+41.6 68.367 l
+S
+55.1 71.117 m
+58.35 69.117 l
+S
+57.35 65.117 m
+55.35 61.867 l
+S
+64.35 66.367 m
+69.35 68.617 l
+S
+71.85 62.867 m
+69.35 61.117 l
+S
+23.6 70.867 m
+23.6 67.867 l
+S
+20.6 65.867 m
+17.35 65.367 l
+S
+24.85 61.367 m
+25.35 58.117 l
+S
+25.85 65.867 m
+29.35 66.617 l
+S
+14.1 54.117 m
+16.85 56.117 l
+S
+12.35 11.617 m
+12.6 15.617 l
+S
+12.1 19.867 m
+14.35 22.367 l
+S
+26.1 9.867 m
+23.6 13.367 l
+S
+34.6 47.117 m
+32.1 45.367 l
+S
+62.6 41.867 m
+59.85 43.367 l
+S
+31.6 35.617 m
+27.85 36.367 l
+S
+36.35 26.117 m
+34.35 24.617 l
+S
+33.85 14.117 m
+31.1 16.367 l
+S
+37.1 9.867 m
+35.1 11.117 l
+S
+34.35 20.867 m
+31.35 20.867 l
+S
+44.6 56.617 m
+42.1 54.867 l
+S
+47.35 51.367 m
+44.35 51.367 l
+S
+44.1 43.867 m
+41.35 45.617 l
+S
+43.35 33.117 m
+42.6 30.617 l
+S
+43.85 23.617 m
+41.1 25.867 l
+S
+44.35 15.617 m
+42.35 16.867 l
+S
+67.823 31.1 m
+64.823 31.1 l
+S
+27.1 32.617 m
+29.6 30.867 l
+S
+31.85 55.117 m
+34.85 55.117 l
+S
+19.6 40.867 m
+22.1 39.117 l
+S
+16.85 35.617 m
+19.85 35.617 l
+S
+20.1 28.117 m
+22.85 29.867 l
+S
+52.1 42.617 m
+54.484 44.178 l
+S
+52.437 50.146 m
+54.821 48.325 l
+S
+59.572 54.133 m
+59.35 51.117 l
+S
+50.185 10.055 m
+53.234 9.928 l
+S
+51.187 15.896 m
+53.571 14.075 l
+S
+58.322 19.883 m
+59.445 16.823 l
+S
+53.1 32.117 m
+50.6 30.367 l
+S
+52.85 24.617 m
+49.6 25.617 l
+S
+61.85 9.117 m
+59.1 10.867 l
+S
+69.35 34.617 m
+66.6 36.367 l
+S
+67.1 23.617 m
+65.1 22.117 l
+S
+24.435 46.055 m
+27.484 45.928 l
+S
+25.437 51.896 m
+27.821 50.075 l
+S
+62.6 47.117 m
+65.321 46.575 l
+S
+19.85 19.867 m
+20.35 16.617 l
+S
+21.85 21.867 m
+25.35 22.617 l
+S
+37.6 62.867 m
+41.6 62.117 l
+S
+38.323 42.1 m
+38.823 38.6 l
+S
+69.35 52.617 m
+66.85 53.867 l
+S
+14.85 62.117 m
+18.1 59.367 l
+S
+9.6 46.117 m
+7.1 44.367 l
+S
+20.6 51.617 m
+18.6 50.117 l
+S
+46.141 70.811 m
+47.994 73.492 l
+S
+69.391 40.561 m
+71.244 43.242 l
+S
+38.641 49.311 m
+39.35 52.117 l
+S
+25.141 16.811 m
+25.85 19.617 l
+S
+36.6 32.867 m
+34.6 31.367 l
+S
+6.1 68.617 m
+2.85 67.867 l
+S
+4.85 56.867 m
+2.35 55.117 l
+S
+7.6 51.617 m
+4.6 51.617 l
+S
+6.6 35.867 m
+4.6 34.367 l
+S
+6.1 12.867 m
+1.85 13.617 l
+S
+4.6 30.617 m
+1.6 30.617 l
+S
+72.814 74.769 m
+73.928 77.729 l
+S
+67.976 74.633 m
+67.35 77.909 l
+S
+52.762 73.779 m
+52.876 76.776 l
+S
+37.062 75.375 m
+35.639 77.43 l
+S
+20.795 75.242 m
+22.12 77.193 l
+S
+9.736 73.91 m
+8.073 76.225 l
+S
+10.1 23.617 m
+6.35 24.367 l
+S
+73.217 18.276 m
+71.323 21.1 l
+S
+28.823 39.6 m
+29.505 42.389 l
+S
+49.6 38.617 m
+47.6 37.117 l
+S
+60.323 73.6 m
+62.323 76.6 l
+S
+60.323 1.6 m
+62.323 4.6 l
+S
+%AI6_EndPatternLayer
+) &
+] E
+%AI3_EndPattern
+%AI3_BeginPattern: (DblLine1.2.inner)
+(DblLine1.2.inner) 1 1 39.2705 39.2706 [
+%AI3_Tile
+(0 O 0 R  1 0.14 0.09 0 k
+ 1 0.14 0.09 0 K
+) @
+(
+%AI6_BeginPatternLayer
+800 Ar
+0 J 0 j 1 w 4 M []0 d
+%AI3_Note:
+0 D
+0 XR
+39.2702 22.175 m
+39.2702 13.6108 L
+26.66 13.6108 L
+26.66 1.0003 L
+18.0958 1.0003 L
+18.0948 22.175 L
+18.0958 22.175 L
+18.0958 22.1752 L
+39.2702 22.175 L
+f
+39.2708 24.6929 m
+15.5779 24.6929 L
+15.5779 1.0003 L
+14.9037 1.0003 L
+14.9032 25.3675 L
+39.2708 25.3675 L
+39.2708 24.6929 L
+f
+%AI6_EndPatternLayer
+) &
+] E
+%AI3_EndPattern
+%AI3_BeginPattern: (DblLine1.2.outer)
+(DblLine1.2.outer) 1 1.0003 39.2706 39.271 [
+%AI3_Tile
+(0 O 0 R  1 0.14 0.09 0 k
+ 1 0.14 0.09 0 K
+) @
+(
+%AI6_BeginPatternLayer
+800 Ar
+0 J 0 j 0.3 w 4 M []0 d
+%AI3_Note:
+0 D
+0 XR
+39.2708 26.6602 m
+13.6111 26.6602 L
+13.6111 1.0005 L
+22.1751 1 L
+22.1751 18.096 L
+39.2708 18.096 L
+39.2708 26.6602 L
+f
+39.2708 15.578 m
+24.6928 15.578 L
+24.6928 1 L
+25.367 1 L
+25.367 14.9038 L
+39.2708 14.9038 L
+39.2708 15.578 L
+f
+%AI6_EndPatternLayer
+) &
+] E
+%AI3_EndPattern
+%AI3_BeginPattern: (DblLine1.2.side)
+(DblLine1.2.side) 1 1 39.2706 39.2706 [
+%AI3_Tile
+(0 O 0 R  1 0.14 0.09 0 k
+ 1 0.14 0.09 0 K
+) @
+(
+%AI6_BeginPatternLayer
+800 Ar
+0 J 0 j 0.3 w 4 M []0 d
+%AI3_Note:
+0 D
+0 XR
+39.2704 18.0958 m
+39.2704 26.6598 L
+1.0001 26.6598 L
+1.0001 18.0958 L
+39.2704 18.0958 L
+f
+39.2704 14.9037 m
+39.2704 15.5776 L
+1.0001 15.5776 L
+1.0001 14.9037 L
+39.2704 14.9037 L
+f
+%AI6_EndPatternLayer
+) &
+] E
+%AI3_EndPattern
+%AI3_BeginPattern: (Diamonds)
+(Diamonds) 1 1 37.1865 41.9411 [
+%AI3_Tile
+(0 O 0 R  0.2 0 1 0 k
+ 0.2 0 1 0 K
+) @
+(
+%AI6_BeginPatternLayer
+800 Ar
+0 J 0 j 0.3 w 4 M []0 d
+%AI3_Note:
+0 D
+0 XR
+1.0002 1.0004 m
+1.0002 41.9411 L
+37.1865 41.9411 L
+37.1865 1.0004 L
+1.0002 1.0004 L
+f
+%AI6_EndPatternLayer
+) &
+(0 O 0 R  0 g
+ 0 G
+) @
+(
+%AI6_BeginPatternLayer
+800 Ar
+0 J 0 j 1 w 4 M []0 d
+%AI3_Note:
+0 D
+1 XR
+19.0936 41.9408 m
+19.0929 41.9408 L
+19.0933 41.9402 L
+19.0936 41.9408 L
+f
+7.0311 41.9408 m
+7.0304 41.9408 L
+7.0308 41.9402 L
+7.0311 41.9408 L
+f
+31.1556 41.9408 m
+31.1548 41.9408 L
+31.1552 41.9402 L
+31.1556 41.9408 L
+f
+%AI6_EndPatternLayer
+) &
+(0 O 0 R  0.75 0.9 0 0 k
+ 0.75 0.9 0 0 K
+) @
+(
+%AI6_BeginPatternLayer
+800 Ar
+0 J 0 j 0.3 w 4 M []0 d
+%AI3_Note:
+0 D
+1 XR
+37.1865 1 m
+37.1865 11.2349 L
+31.1552 1 L
+37.1865 1 L
+f
+19.0933 1 m
+31.1552 1 L
+25.124 11.2349 L
+19.0933 1 L
+f
+7.0308 1 m
+19.0933 1 L
+13.062 11.2349 L
+7.0308 1 L
+f
+1 1 m
+7.0308 1 L
+1 11.2349 L
+1 1 L
+f
+37.1859 11.2349 m
+37.1865 11.236 L
+37.1865 31.7059 L
+31.1552 21.4704 L
+37.1859 11.2349 L
+f
+19.0933 21.4704 m
+25.124 11.2349 L
+31.1552 21.4704 L
+25.124 31.7059 L
+19.0933 21.4704 L
+f
+7.0308 21.4704 m
+13.062 11.2349 L
+19.0933 21.4704 L
+13.062 31.7059 L
+7.0308 21.4704 L
+f
+1 31.7059 m
+1 11.2349 L
+7.0308 21.4704 L
+1 31.7059 L
+f
+37.1859 31.7059 m
+37.1865 31.707 L
+37.1865 41.9408 L
+31.1556 41.9408 L
+31.1552 41.9402 L
+37.1859 31.7059 L
+f
+25.124 31.7059 m
+31.1552 41.9402 L
+31.1548 41.9408 L
+19.0936 41.9408 L
+19.0933 41.9402 L
+25.124 31.7059 L
+f
+13.062 31.7059 m
+19.0933 41.9402 L
+19.0929 41.9408 L
+7.0311 41.9408 L
+7.0308 41.9402 L
+13.062 31.7059 L
+f
+7.0304 41.9408 m
+1 41.9408 L
+1 31.7059 L
+7.0308 41.9402 L
+7.0304 41.9408 L
+f
+%AI6_EndPatternLayer
+) &
+] E
+%AI3_EndPattern
+%AI3_BeginPattern: (Hexagon)
+(Hexagon) 4 1.6 70.151 77.983 [
+%AI3_Tile
+(0 O 0 R  0 1 0.35 0 k
+ 0 1 0.35 0 K
+) @
+(
+%AI6_BeginPatternLayer
+800 Ar
+0 J 0 j 1 w 4 M []0 d
+%AI3_Note:
+0 D
+0 XR
+70.151 77.983 m
+70.151 1.6 L
+4 1.6 L
+4 77.983 L
+70.151 77.983 L
+f
+%AI6_EndPatternLayer
+) &
+(0 O 0 R  0.9921 1 0 0 k
+ 0.9921 1 0 0 K
+) @
+(
+%AI6_BeginPatternLayer
+800 Ar
+0 J 0 j 0.3 w 4 M []0 d
+%AI3_Note:
+0 D
+0 XR
+20.538 30.244 m
+S
+26.05 20.696 m
+15.025 20.696 L
+9.513 30.244 L
+15.025 39.792 L
+26.05 39.792 L
+31.564 30.244 L
+26.05 20.696 L
+s
+20.537 11.148 m
+S
+26.05 1.6 m
+15.024 1.6 L
+9.512 11.148 L
+15.024 20.696 L
+26.05 20.696 L
+31.563 11.148 L
+26.05 1.6 L
+s
+53.614 30.244 m
+S
+59.126 20.696 m
+48.101 20.696 L
+42.589 30.244 L
+48.101 39.792 L
+59.126 39.792 L
+64.639 30.244 L
+59.126 20.696 L
+s
+53.614 11.148 m
+S
+59.126 1.6 m
+48.101 1.6 L
+42.588 11.148 L
+48.101 20.696 L
+59.126 20.696 L
+64.638 11.148 L
+59.126 1.6 L
+s
+20.538 68.436 m
+S
+26.051 58.888 m
+15.025 58.888 L
+9.513 68.436 L
+15.025 77.984 L
+26.051 77.984 L
+31.564 68.436 L
+26.051 58.888 L
+s
+20.538 49.34 m
+S
+26.051 39.792 m
+15.025 39.792 L
+9.513 49.34 L
+15.025 58.888 L
+26.05 58.888 L
+31.564 49.34 L
+26.051 39.792 L
+s
+53.614 68.436 m
+S
+59.127 58.888 m
+48.102 58.888 L
+42.589 68.436 L
+48.101 77.985 L
+59.127 77.985 L
+64.639 68.436 L
+59.127 58.888 L
+s
+53.614 49.34 m
+S
+59.127 39.792 m
+48.101 39.792 L
+42.589 49.34 L
+48.101 58.888 L
+59.127 58.888 L
+64.639 49.341 L
+59.127 39.792 L
+s
+4 20.696 m
+S
+3.876 30.244 m
+9.512 30.244 L
+15.024 20.696 L
+9.512 11.147 L
+3.876 11.147 L
+S
+37.075 20.696 m
+S
+42.588 11.148 m
+31.563 11.148 L
+26.05 20.696 L
+31.563 30.244 L
+42.589 30.244 L
+48.101 20.696 L
+42.588 11.148 L
+s
+37.076 58.888 m
+S
+42.589 49.34 m
+31.564 49.34 L
+26.05 58.888 L
+31.564 68.436 L
+42.589 68.436 L
+48.101 58.888 L
+42.589 49.34 L
+s
+70.151 20.696 m
+S
+70.2094 11.147 m
+64.639 11.147 L
+59.127 20.696 L
+64.639 30.244 L
+70.2094 30.244 L
+S
+70.152 58.888 m
+S
+70.0427 49.34 m
+64.639 49.34 L
+59.127 58.888 L
+64.639 68.436 L
+70.0427 68.436 L
+S
+4 58.888 m
+S
+3.876 68.436 m
+9.513 68.436 L
+15.025 58.888 L
+9.513 49.34 L
+3.876 49.34 L
+S
+%AI6_EndPatternLayer
+) &
+] E
+%AI3_EndPattern
+%AI3_BeginPattern: (Laurel.inner)
+(Laurel.inner) 1 1 28.5392 28.5392 [
+%AI3_Tile
+(0 O 0 R  0 0.55 1 0.12 k
+ 0 0.55 1 0.12 K
+) @
+(
+%AI6_BeginPatternLayer
+800 Ar
+0 J 0 j 0.3 w 4 M []0 d
+%AI3_Note:
+0 D
+0 XR
+19.2768 15.3585 m
+28.9144 15.3585 L
+28.9144 14.2335 L
+19.2768 14.2335 L
+19.2768 15.3585 L
+f
+%AI6_EndPatternLayer
+) &
+(0 O 0 R  0 0.55 1 0.3 k
+ 0 0.55 1 0.3 K
+) @
+(
+%AI6_BeginPatternLayer
+800 Ar
+0 J 0 j 0.3 w 4 M []0 d
+%AI3_Note:
+0 D
+0 XR
+14.7461 18.9624 m
+13.0264 17.8486 11.3273 14.4193 11.3273 10.0362 c
+11.3273 5.6547 12.9768 2.1518 14.744 1.1112 C
+14.7443 1.1112 L
+16.4707 2.1518 18.1679 5.6547 18.1679 10.0362 c
+18.1679 14.4143 16.432 17.8633 14.7461 18.9624 C
+f
+%AI6_EndPatternLayer
+) &
+] E
+%AI3_EndPattern
+%AI3_BeginPattern: (Laurel.outer)
+(Laurel.outer) 1 1.3751 28.5393 28.9143 [
+%AI3_Tile
+(0 O 0 R  0 0.55 1 0.12 k
+ 0 0.55 1 0.12 K
+) @
+(
+%AI6_BeginPatternLayer
+800 Ar
+0 J 0 j 0.3 w 4 M []0 d
+%AI3_Note:
+0 D
+0 XR
+14.2395 10.6375 m
+14.2395 1 L
+15.3645 1 L
+15.3645 10.6375 L
+14.2395 10.6375 L
+f
+%AI6_EndPatternLayer
+) &
+(0 O 0 R  0 0.55 1 0.3 k
+ 0 0.55 1 0.3 K
+) @
+(
+%AI6_BeginPatternLayer
+800 Ar
+0 J 0 j 0.3 w 4 M []0 d
+%AI3_Note:
+0 D
+0 XR
+10.5769 15.124 m
+11.6906 16.8438 15.1198 18.5429 19.503 18.5429 c
+23.8844 18.5429 27.3874 16.8935 28.428 15.1262 C
+28.428 15.1259 L
+27.3874 13.3995 23.8844 11.7023 19.503 11.7023 c
+15.1249 11.7023 11.676 13.4382 10.5769 15.124 C
+f
+%AI6_EndPatternLayer
+) &
+] E
+%AI3_EndPattern
+%AI3_BeginPattern: (Laurel.side)
+(Laurel.side) 1.3972 1 28.9364 28.5392 [
+%AI3_Tile
+(0 O 0 R  0 0.55 1 0.12 k
+ 0 0.55 1 0.12 K
+) @
+(
+%AI6_BeginPatternLayer
+800 Ar
+0 J 0 j 0.3 w 4 M []0 d
+%AI3_Note:
+0 D
+0 XR
+29.1571 15.2998 m
+1 15.2998 L
+1 14.1748 L
+29.1571 14.1748 L
+29.1571 15.2998 L
+f
+%AI6_EndPatternLayer
+) &
+(0 O 0 R  0 0.55 1 0.3 k
+ 0 0.55 1 0.3 K
+) @
+(
+%AI6_BeginPatternLayer
+800 Ar
+0 J 0 j 0.3 w 4 M []0 d
+%AI3_Note:
+0 D
+0 XR
+2.0183 27.4787 m
+1.5899 25.4751 2.8132 21.8488 5.9125 18.7494 c
+9.0107 15.6513 12.654 14.3407 14.6395 14.8545 C
+14.6398 14.8547 L
+15.1246 16.8113 13.8478 20.4883 10.7496 23.5865 c
+7.6538 26.6824 3.9876 27.8936 2.0183 27.4787 C
+f
+%AI6_EndPatternLayer
+) &
+(0 O 0 R  0 0.39 0.7 0.12 k
+ 0 0.39 0.7 0.12 K
+) @
+(
+%AI6_BeginPatternLayer
+800 Ar
+0 J 0 j 0.3 w 4 M []0 d
+%AI3_Note:
+0 D
+0 XR
+2.0183 2.0091 m
+1.5899 4.0126 2.8132 7.6389 5.9125 10.7382 c
+9.0107 13.8365 12.654 15.147 14.6395 14.6332 C
+14.6398 14.633 L
+15.1246 12.6765 13.8478 8.9993 10.7496 5.9011 c
+7.6538 2.8054 3.9876 1.5941 2.0183 2.0091 C
+f
+%AI6_EndPatternLayer
+) &
+(0 O 0 R  0 0.55 1 0.3 k
+ 0 0.55 1 0.3 K
+) @
+(
+%AI6_BeginPatternLayer
+800 Ar
+0 J 0 j 0.3 w 4 M []0 d
+%AI3_Note:
+0 D
+0 XR
+15.821 2.0091 m
+15.3925 4.0126 16.6159 7.6389 19.7152 10.7382 c
+22.8134 13.8365 26.4567 15.147 28.4422 14.6332 C
+28.4424 14.633 L
+28.9273 12.6765 27.6505 8.9993 24.5523 5.9011 c
+21.4565 2.8054 17.7903 1.5941 15.821 2.0091 C
+f
+%AI6_EndPatternLayer
+) &
+(0 O 0 R  0 0.39 0.7 0.12 k
+ 0 0.39 0.7 0.12 K
+) @
+(
+%AI6_BeginPatternLayer
+800 Ar
+0 J 0 j 0.3 w 4 M []0 d
+%AI3_Note:
+0 D
+0 XR
+15.821 27.4787 m
+15.3925 25.4751 16.6159 21.8488 19.7152 18.7494 c
+22.8134 15.6513 26.4567 14.3407 28.4422 14.8545 C
+28.4424 14.8547 L
+28.9273 16.8113 27.6505 20.4883 24.5523 23.5865 c
+21.4565 26.6824 17.7903 27.8936 15.821 27.4787 C
+f
+%AI6_EndPatternLayer
+) &
+] E
+%AI3_EndPattern
+%AI3_BeginPattern: (Leaves-fall)
+(Leaves-fall) 1 1 52.733 89.816 [
+%AI3_Tile
+(0 O 0 R  0.05 0.2 1 0 k
+ 0.05 0.2 1 0 K
+) @
+(
+%AI6_BeginPatternLayer
+800 Ar
+0 J 0 j 1 w 4 M []0 d
+%AI3_Note:
+0 D
+0 XR
+52.733 89.816 m
+52.733 1 L
+1 1 L
+1 89.816 L
+52.733 89.816 L
+f
+%AI6_EndPatternLayer
+) &
+(0 O 0 R  0.83 0 1 0 k
+ 0.83 0 1 0 K
+) @
+(
+%AI6_BeginPatternLayer
+800 Ar
+0 J 0 j 1 w 4 M []0 d
+%AI3_Note:
+1 D
+0 XR
+25.317 2.083 m
+25.994 2.283 26.284 2.435 V
+24.815 5.147 29.266 9.428 30.186 10.168 C
+30.787 9.943 30.907 7.41 30.23 6.073 C
+31.073 6.196 33.262 4.818 34.02 3.529 C
+34.085 4.217 35.655 7.158 36.481 7.535 C
+35.561 7.933 34.896 9.406 34.134 10.854 C
+35.156 11.021 36.555 10.1 38.026 9.195 C
+38.541 9.996 39.915 10.968 41.174 11.484 C
+40.086 12.171 39.591 12.912 39.094 14.372 C
+38.052 13.806 35.865 13.657 35.336 13.944 C
+35.85 15.057 38.096 15.6 38.827 15.547 C
+38.573 16.409 38.425 18.562 38.598 21.155 C
+36.939 19.839 35.393 18.522 33.734 18.58 C
+34.003 17.158 33.367 15.353 32.99 14.86 C
+32.417 15.604 32.006 16.431 32.361 18.408 C
+30.908 18.893 29.671 19.439 28.297 20.697 C
+28.297 18.866 27.725 17.664 26.857 16.388 C
+28.117 15.9 29.389 14.697 29.385 13.658 C
+28.537 13.81 26.845 14.554 26.352 15.547 C
+25.634 14.8 23.95 13.491 22.346 13.487 C
+23.534 12.632 24.454 11.598 24.549 9.686 C
+25.802 10.657 28.255 11.272 29.635 10.674 C
+24.794 6.438 25.262 3.405 25.317 2.083 C
+f
+12.412 33.743 m
+11.887 33.272 11.691 33.01 V
+14.182 31.192 11.928 25.366 11.415 24.303 C
+10.776 24.247 9.369 26.988 9.405 28.486 C
+8.273 27.73 6.608 27.851 5.006 28.137 C
+5.578 27.049 5.177 25.104 4.376 24.303 C
+5.378 24.339 6.729 23.624 8.038 22.643 C
+7.203 21.823 5.376 21.984 3.46 22.643 C
+3.46 21.27 2.638 19.533 1.801 18.351 C
+3.117 18.408 4.262 17.722 5.12 16.691 C
+5.785 18.26 7.819 19.373 8.725 19.324 C
+8.742 17.959 7.169 15.869 6.147 15.47 C
+6.747 14.801 7.766 13.27 8.725 10.854 C
+9.524 12.78 10.694 14.022 11.927 14.955 C
+10.785 16.517 10.959 17.388 11.358 18.866 C
+12.101 18.325 13.132 17.893 13.303 15.89 C
+15.02 16.176 16.156 16.104 17.653 15.203 C
+17.198 16.865 17.195 18.466 17.515 20.166 C
+15.665 20.026 14.105 20.239 13.075 21.728 C
+13.905 21.955 16.165 22.014 17.039 21.082 C
+17.366 22.064 18.261 23.47 19.707 24.164 C
+18.267 24.424 17.282 25.523 16.373 27.209 C
+15.66 25.793 13.433 24.128 11.93 24.073 C
+13.933 28.137 13.933 31.055 12.412 33.743 C
+f
+31.125 30.5 m
+31.445 31.128 31.648 31.385 V
+34.045 29.444 38.851 32.752 39.746 33.521 C
+39.636 34.153 37.511 35.29 35.794 34.26 C
+36.234 35.549 35.332 37.51 34.134 38.552 C
+35.873 38.451 38.019 39.813 38.541 40.555 C
+38.763 39.577 39.946 38.307 41.231 37.293 C
+41.582 38.266 40.887 40.384 39.971 41.986 C
+41.206 42.487 42.318 43.417 42.776 44.676 C
+43.233 43.359 44.236 42.685 45.58 41.929 C
+44.421 40.502 43.64 38.328 43.92 37.465 C
+45.243 37.8 46.814 40.518 46.937 41.607 C
+47.812 40.841 49.366 40.154 51.947 39.848 C
+50.246 38.77 49.884 36.778 49.3 35.347 C
+48.152 35.794 45.983 35.853 45.008 35.29 C
+45.721 34.711 47.061 34.16 49.071 34.146 C
+49.071 32.601 49.534 31.469 50.788 30.254 C
+49.065 30.267 46.965 29.781 45.469 29.389 C
+45.221 30.718 44.378 32.314 43.233 32.715 C
+43.227 31.854 43.493 29.605 44.378 28.938 C
+43.513 28.37 42.26 26.993 41.803 25.276 C
+41.181 26.601 40.32 27.906 38.457 28.35 C
+39.642 29.403 40.477 31.42 40.143 32.887 C
+35.091 28.905 32.414 30.203 31.125 30.5 C
+f
+25.317 46.491 m
+25.994 46.691 26.284 46.843 V
+24.815 49.556 29.266 53.837 30.186 54.576 C
+30.787 54.351 30.907 51.818 30.23 50.482 C
+31.073 50.605 33.262 49.227 34.02 47.938 C
+34.085 48.625 35.655 51.566 36.481 51.944 C
+35.561 52.341 34.896 53.814 34.134 55.263 C
+35.156 55.43 36.555 54.508 38.026 53.603 C
+38.541 54.404 39.915 55.377 41.174 55.892 C
+40.086 56.579 39.591 57.321 39.094 58.78 C
+38.052 58.215 35.865 58.065 35.336 58.353 C
+35.85 59.465 38.096 60.008 38.827 59.955 C
+38.573 60.817 38.425 62.97 38.598 65.563 C
+36.939 64.247 35.393 62.931 33.734 62.988 C
+34.003 61.567 33.367 59.761 32.99 59.268 C
+32.417 60.012 32.006 60.839 32.361 62.817 C
+30.908 63.302 29.671 63.847 28.297 65.106 C
+28.297 63.274 27.725 62.073 26.857 60.796 C
+28.117 60.308 29.389 59.106 29.385 58.067 C
+28.537 58.219 26.845 58.963 26.352 59.955 C
+25.634 59.209 23.95 57.899 22.346 57.895 C
+23.534 57.041 24.454 56.006 24.549 54.094 C
+25.802 55.065 28.255 55.68 29.635 55.083 C
+24.794 50.846 25.262 47.814 25.317 46.491 C
+f
+12.412 78.151 m
+11.887 77.68 11.691 77.418 V
+14.182 75.601 11.928 69.774 11.415 68.711 C
+10.776 68.655 9.369 71.396 9.405 72.894 C
+8.273 72.138 6.608 72.259 5.006 72.545 C
+5.578 71.458 5.177 69.512 4.376 68.711 C
+5.378 68.747 6.729 68.032 8.038 67.052 C
+7.203 66.231 5.376 66.393 3.46 67.052 C
+3.46 65.678 2.638 63.941 1.801 62.759 C
+3.117 62.817 4.262 62.13 5.12 61.1 C
+5.785 62.669 7.819 63.781 8.725 63.732 C
+8.742 62.367 7.169 60.277 6.147 59.878 C
+6.747 59.209 7.766 57.678 8.725 55.263 C
+9.524 57.189 10.694 58.431 11.927 59.364 C
+10.785 60.925 10.959 61.796 11.358 63.274 C
+12.101 62.734 13.132 62.301 13.303 60.298 C
+15.02 60.584 16.156 60.512 17.653 59.612 C
+17.198 61.273 17.195 62.874 17.515 64.574 C
+15.665 64.434 14.105 64.648 13.075 66.136 C
+13.905 66.363 16.165 66.422 17.039 65.49 C
+17.366 66.472 18.261 67.878 19.707 68.572 C
+18.267 68.832 17.282 69.931 16.373 71.617 C
+15.66 70.202 13.433 68.536 11.93 68.482 C
+13.933 72.545 13.933 75.464 12.412 78.151 C
+f
+31.125 74.908 m
+31.445 75.537 31.648 75.794 V
+34.045 73.853 38.851 77.161 39.746 77.929 C
+39.636 78.562 37.511 79.698 35.794 78.668 C
+36.234 79.957 35.332 81.918 34.134 82.96 C
+35.873 82.86 38.019 84.221 38.541 84.963 C
+38.763 83.986 39.946 82.716 41.231 81.701 C
+41.582 82.675 40.887 84.792 39.971 86.394 C
+41.206 86.895 42.318 87.825 42.776 89.084 C
+43.233 87.768 44.236 87.093 45.58 86.337 C
+44.421 84.91 43.64 82.736 43.92 81.873 C
+45.243 82.208 46.814 84.926 46.937 86.016 C
+47.812 85.249 49.366 84.563 51.947 84.257 C
+50.246 83.179 49.884 81.187 49.3 79.756 C
+48.152 80.203 45.983 80.262 45.008 79.698 C
+45.721 79.119 47.061 78.569 49.071 78.554 C
+49.071 77.009 49.534 75.877 50.788 74.663 C
+49.065 74.675 46.965 74.189 45.469 73.798 C
+45.221 75.126 44.378 76.723 43.233 77.123 C
+43.227 76.262 43.493 74.013 44.378 73.347 C
+43.513 72.779 42.26 71.401 41.803 69.684 C
+41.181 71.009 40.32 72.314 38.457 72.759 C
+39.642 73.812 40.477 75.829 40.143 77.295 C
+35.091 73.313 32.414 74.611 31.125 74.908 C
+f
+%AI6_EndPatternLayer
+) &
+] E
+%AI3_EndPattern
+%AI3_BeginPattern: (Polka dots)
+(Polka dots) 1 1 29.8 29.8 [
+%AI3_Tile
+(0 O 0 R  0.45 0.9 0 0 k
+ 0.45 0.9 0 0 K
+) @
+(
+%AI6_BeginPatternLayer
+800 Ar
+0 J 0 j 0.3 w 4 M []0 d
+%AI3_Note:
+0 D
+0 XR
+1 1 m
+1 29.8 L
+29.8 29.8 L
+29.8 1 L
+1 1 L
+f
+%AI6_EndPatternLayer
+) &
+(0 O 0 R  0.09 0.18 0 0 k
+ 0.09 0.18 0 0 K
+) @
+(
+%AI6_BeginPatternLayer
+*u
+800 Ar
+0 J 0 j 1 w 4 M []0 d
+%AI3_Note:
+0 D
+0 XR
+11.08 8.2 m
+11.08 9.791 9.79 11.08 8.2 11.08 c
+6.609 11.08 5.32 9.791 5.32 8.2 c
+5.32 6.61 6.609 5.32 8.2 5.32 c
+9.79 5.32 11.08 6.61 11.08 8.2 c
+f
+11.08 22.6 m
+11.08 24.191 9.79 25.48 8.2 25.48 c
+6.609 25.48 5.32 24.191 5.32 22.6 c
+5.32 21.01 6.609 19.72 8.2 19.72 c
+9.79 19.72 11.08 21.01 11.08 22.6 c
+f
+18.28 15.4 m
+18.28 16.991 16.99 18.28 15.4 18.28 c
+13.809 18.28 12.52 16.991 12.52 15.4 c
+12.52 13.81 13.809 12.52 15.4 12.52 c
+16.99 12.52 18.28 13.81 18.28 15.4 c
+f
+25.48 8.2 m
+25.48 9.791 24.19 11.08 22.6 11.08 c
+21.009 11.08 19.72 9.791 19.72 8.2 c
+19.72 6.61 21.009 5.32 22.6 5.32 c
+24.19 5.32 25.48 6.61 25.48 8.2 c
+f
+25.48 22.6 m
+25.48 24.191 24.19 25.48 22.6 25.48 c
+21.009 25.48 19.72 24.191 19.72 22.6 c
+19.72 21.01 21.009 19.72 22.6 19.72 c
+24.19 19.72 25.48 21.01 25.48 22.6 c
+f
+*U
+26.92 1 m
+29.8 1 L
+29.8 3.88 L
+28.209 3.88 26.92 2.591 26.92 1 C
+f
+15.4 3.88 m
+13.809 3.88 12.52 2.591 12.52 1 C
+18.28 1 L
+18.28 2.591 16.99 3.88 15.4 3.88 c
+f
+1 3.88 m
+1 1 L
+3.88 1 L
+3.88 2.591 2.59 3.88 1 3.88 C
+f
+1 XR
+26.92 15.4 m
+26.92 13.81 28.209 12.52 29.8 12.52 C
+29.8 18.28 L
+28.209 18.28 26.92 16.991 26.92 15.4 c
+f
+0 XR
+15.4 18.28 m
+13.809 18.28 12.52 16.991 12.52 15.4 c
+12.52 13.81 13.809 12.52 15.4 12.52 c
+16.99 12.52 18.28 13.81 18.28 15.4 c
+18.28 16.991 16.99 18.28 15.4 18.28 c
+f
+1 XR
+3.88 15.4 m
+3.88 16.991 2.59 18.28 1 18.28 C
+1 12.52 L
+2.59 12.52 3.88 13.81 3.88 15.4 c
+f
+0 XR
+29.8 26.92 m
+29.8 29.8 L
+26.92 29.8 L
+26.92 28.21 28.209 26.92 29.8 26.92 C
+f
+15.4 26.92 m
+16.99 26.92 18.28 28.21 18.28 29.8 C
+12.52 29.8 L
+12.52 28.21 13.809 26.92 15.4 26.92 c
+f
+3.88 29.8 m
+1 29.8 L
+1 26.92 L
+2.59 26.92 3.88 28.21 3.88 29.8 C
+f
+1 XR
+8.2 11.08 m
+6.609 11.08 5.32 9.791 5.32 8.2 c
+5.32 6.61 6.609 5.32 8.2 5.32 c
+9.79 5.32 11.08 6.61 11.08 8.2 c
+11.08 9.791 9.79 11.08 8.2 11.08 c
+f
+22.6 11.08 m
+21.009 11.08 19.72 9.791 19.72 8.2 c
+19.72 6.61 21.009 5.32 22.6 5.32 c
+24.19 5.32 25.48 6.61 25.48 8.2 c
+25.48 9.791 24.19 11.08 22.6 11.08 c
+f
+8.2 25.48 m
+6.609 25.48 5.32 24.191 5.32 22.6 c
+5.32 21.01 6.609 19.72 8.2 19.72 c
+9.79 19.72 11.08 21.01 11.08 22.6 c
+11.08 24.191 9.79 25.48 8.2 25.48 c
+f
+22.6 25.48 m
+21.009 25.48 19.72 24.191 19.72 22.6 c
+19.72 21.01 21.009 19.72 22.6 19.72 c
+24.19 19.72 25.48 21.01 25.48 22.6 c
+25.48 24.191 24.19 25.48 22.6 25.48 c
+f
+%AI6_EndPatternLayer
+) &
+] E
+%AI3_EndPattern
+%AI3_BeginPattern: (Random circles)
+(Random circles) 4.365 3.849 51.13 57.85 [
+%AI3_Tile
+(0 O 0 R  0 0.1125 0.45 0 k
+ 0 0.1125 0.45 0 K
+) @
+(
+%AI6_BeginPatternLayer
+800 Ar
+0 J 0 j 0.3 w 4 M []0 d
+%AI3_Note:
+0 D
+0 XR
+4.365 3.849 m
+4.365 57.85 L
+51.13 57.85 L
+51.13 3.849 L
+4.365 3.849 L
+f
+%AI6_EndPatternLayer
+) &
+(0 O 0 R  0.4 0.7 1 0 k
+ 0.4 0.7 1 0 K
+) @
+(
+%AI6_BeginPatternLayer
+800 Ar
+0 J 0 j 0.3 w 4 M []0 d
+%AI3_Note:
+0 D
+0 XR
+45.429 36.274 m
+45.843 36.991 45.598 37.908 44.88 38.323 c
+44.163 38.737 43.245 38.491 42.831 37.774 c
+42.417 37.056 42.663 36.139 43.38 35.725 c
+44.098 35.31 45.015 35.556 45.429 36.274 c
+s
+44.179 27.926 m
+43.765 28.643 42.848 28.889 42.13 28.475 c
+41.413 28.06 41.167 27.143 41.581 26.425 c
+41.995 25.708 42.913 25.462 43.63 25.876 c
+44.348 26.291 44.593 27.208 44.179 27.926 c
+s
+35.929 41.024 m
+35.515 41.741 34.598 41.987 33.88 41.573 c
+33.163 41.158 32.917 40.241 33.331 39.524 c
+33.745 38.806 34.663 38.56 35.38 38.975 c
+36.098 39.389 36.343 40.306 35.929 41.024 c
+s
+28.38 34.225 m
+28.794 34.942 28.549 35.859 27.831 36.274 c
+27.114 36.688 26.196 36.442 25.782 35.725 c
+25.368 35.007 25.614 34.09 26.331 33.675 c
+27.049 33.261 27.966 33.507 28.38 34.225 c
+s
+31.179 28.024 m
+30.765 28.741 29.848 28.987 29.13 28.573 c
+28.413 28.158 28.167 27.241 28.581 26.524 c
+28.995 25.806 29.913 25.56 30.63 25.975 c
+31.348 26.389 31.593 27.306 31.179 28.024 c
+s
+36.792 23.349 m
+35.963 23.349 35.292 22.678 35.292 21.849 c
+35.292 21.021 35.963 20.349 36.792 20.349 c
+37.62 20.349 38.292 21.021 38.292 21.849 c
+38.292 22.678 37.62 23.349 36.792 23.349 c
+s
+10.888 34.175 m
+10.474 34.893 10.72 35.81 11.437 36.225 c
+12.155 36.639 13.072 36.393 13.486 35.675 c
+13.901 34.958 13.655 34.041 12.937 33.626 c
+12.22 33.212 11.303 33.458 10.888 34.175 c
+s
+11.517 26.601 m
+11.931 27.318 12.848 27.564 13.566 27.15 c
+14.283 26.735 14.529 25.818 14.115 25.1 c
+13.701 24.383 12.783 24.137 12.066 24.551 c
+11.348 24.966 11.103 25.883 11.517 26.601 c
+s
+16.782 41.426 m
+17.196 42.143 18.114 42.389 18.831 41.975 c
+19.549 41.56 19.794 40.643 19.38 39.926 c
+18.966 39.208 18.049 38.962 17.331 39.377 c
+16.614 39.791 16.368 40.708 16.782 41.426 c
+s
+22.365 24.35 m
+23.194 24.35 23.865 23.678 23.865 22.85 c
+23.865 22.021 23.194 21.35 22.365 21.35 c
+21.537 21.35 20.865 22.021 20.865 22.85 c
+20.865 23.678 21.537 24.35 22.365 24.35 c
+s
+45.385 7.849 m
+44.971 7.132 44.053 6.886 43.336 7.3 c
+42.619 7.714 42.373 8.632 42.787 9.349 c
+43.201 10.067 44.119 10.312 44.836 9.898 c
+45.553 9.484 45.799 8.567 45.385 7.849 c
+s
+29.679 7.774 m
+29.265 7.056 28.348 6.81 27.63 7.225 c
+26.913 7.639 26.667 8.556 27.081 9.274 c
+27.495 9.991 28.413 10.237 29.13 9.823 c
+29.848 9.408 30.093 8.491 29.679 7.774 c
+s
+35.542 11.349 m
+34.713 11.349 34.042 12.021 34.042 12.849 c
+34.042 13.678 34.713 14.349 35.542 14.349 c
+36.37 14.349 37.042 13.678 37.042 12.849 c
+37.042 12.021 36.37 11.349 35.542 11.349 c
+s
+10.13 7.475 m
+10.544 6.757 11.462 6.511 12.179 6.926 c
+12.897 7.34 13.142 8.257 12.728 8.975 c
+12.314 9.692 11.397 9.938 10.679 9.524 c
+9.962 9.109 9.716 8.192 10.13 7.475 c
+s
+20.203 13.349 m
+21.031 13.349 21.703 14.021 21.703 14.849 c
+21.703 15.678 21.031 16.349 20.203 16.349 c
+19.375 16.349 18.703 15.678 18.703 14.849 c
+18.703 14.021 19.375 13.349 20.203 13.349 c
+s
+44.635 54.1 m
+45.049 53.382 44.803 52.465 44.086 52.051 c
+43.369 51.636 42.451 51.882 42.037 52.6 c
+41.623 53.317 41.869 54.234 42.586 54.649 c
+43.303 55.063 44.221 54.817 44.635 54.1 c
+s
+36.841 48.1 m
+36.427 47.382 35.509 47.136 34.792 47.551 c
+34.074 47.965 33.828 48.882 34.243 49.6 c
+34.657 50.317 35.574 50.563 36.292 50.149 c
+37.009 49.734 37.255 48.817 36.841 48.1 c
+s
+29.728 54.725 m
+30.143 54.007 29.897 53.09 29.179 52.675 c
+28.462 52.261 27.544 52.507 27.13 53.225 c
+26.716 53.942 26.962 54.859 27.679 55.274 c
+28.397 55.688 29.314 55.442 29.728 54.725 c
+s
+10.86 54.1 m
+10.446 53.382 10.691 52.465 11.409 52.051 c
+12.126 51.636 13.044 51.882 13.458 52.6 c
+13.872 53.317 13.626 54.234 12.909 54.649 c
+12.191 55.063 11.274 54.817 10.86 54.1 c
+s
+19.154 49.1 m
+19.568 48.382 20.486 48.136 21.203 48.551 c
+21.92 48.965 22.166 49.882 21.752 50.6 c
+21.338 51.317 20.42 51.563 19.703 51.149 c
+18.986 50.734 18.74 49.817 19.154 49.1 c
+s
+51.88 38.85 m
+51.052 38.85 50.38 39.521 50.38 40.35 c
+50.38 41.178 51.052 41.85 51.88 41.85 c
+52.709 41.85 53.38 41.178 53.38 40.35 c
+53.38 39.521 52.709 38.85 51.88 38.85 c
+s
+51.865 11.349 m
+52.693 11.349 53.365 12.021 53.365 12.849 c
+53.365 13.678 52.693 14.349 51.865 14.349 c
+51.036 14.349 50.365 13.678 50.365 12.849 c
+50.365 12.021 51.036 11.349 51.865 11.349 c
+s
+30.179 18.524 m
+29.765 19.241 28.848 19.487 28.13 19.073 c
+27.413 18.658 27.167 17.741 27.581 17.024 c
+27.995 16.306 28.913 16.06 29.63 16.475 c
+30.348 16.889 30.593 17.806 30.179 18.524 c
+s
+21.679 31.524 m
+21.265 32.241 20.348 32.487 19.63 32.073 c
+18.913 31.658 18.667 30.741 19.081 30.024 c
+19.495 29.306 20.413 29.06 21.13 29.475 c
+21.848 29.889 22.093 30.806 21.679 31.524 c
+s
+37.914 33.399 m
+37.5 34.116 36.583 34.362 35.865 33.948 c
+35.148 33.533 34.902 32.616 35.316 31.899 c
+35.73 31.181 36.648 30.935 37.365 31.35 c
+38.083 31.764 38.328 32.681 37.914 33.399 c
+s
+28.929 45.024 m
+28.515 45.741 27.598 45.987 26.88 45.573 c
+26.163 45.158 25.917 44.241 26.331 43.524 c
+26.745 42.806 27.663 42.56 28.38 42.975 c
+29.098 43.389 29.343 44.306 28.929 45.024 c
+s
+12.429 45.524 m
+12.015 46.241 11.098 46.487 10.38 46.073 c
+9.663 45.658 9.417 44.741 9.831 44.024 c
+10.245 43.306 11.163 43.06 11.88 43.475 c
+12.598 43.889 12.843 44.806 12.429 45.524 c
+s
+44.49 45.6 m
+44.075 46.317 43.158 46.563 42.441 46.149 c
+41.723 45.734 41.477 44.817 41.891 44.1 c
+42.306 43.382 43.223 43.136 43.941 43.55 c
+44.658 43.965 44.904 44.882 44.49 45.6 c
+s
+12.679 18.524 m
+12.265 19.241 11.348 19.487 10.63 19.073 c
+9.913 18.658 9.667 17.741 10.081 17.024 c
+10.495 16.306 11.413 16.06 12.13 16.475 c
+12.848 16.889 13.093 17.806 12.679 18.524 c
+s
+21.179 5.774 m
+20.765 6.491 19.848 6.737 19.13 6.323 c
+18.413 5.908 18.167 4.991 18.581 4.274 c
+18.995 3.557 19.913 3.311 20.63 3.725 c
+21.348 4.139 21.593 5.056 21.179 5.774 c
+s
+38.929 5.274 m
+38.515 5.991 37.598 6.237 36.88 5.823 c
+36.163 5.408 35.917 4.491 36.331 3.774 c
+36.745 3.057 37.663 2.811 38.38 3.225 c
+39.098 3.639 39.343 4.556 38.929 5.274 c
+s
+43.865 18.1 m
+44.694 18.1 45.365 17.429 45.365 16.6 c
+45.365 15.772 44.694 15.1 43.865 15.1 c
+43.037 15.1 42.365 15.772 42.365 16.6 c
+42.365 17.429 43.037 18.1 43.865 18.1 c
+s
+51.13 4.6 m
+50.302 4.6 49.63 3.928 49.63 3.1 c
+49.63 2.272 50.302 1.6 51.13 1.6 c
+51.959 1.6 52.63 2.272 52.63 3.1 c
+52.63 3.928 51.959 4.6 51.13 4.6 c
+s
+52.163 31.649 m
+51.748 32.366 50.831 32.612 50.114 32.198 c
+49.396 31.783 49.15 30.866 49.565 30.149 c
+49.979 29.431 50.896 29.185 51.614 29.6 c
+52.331 30.014 52.577 30.931 52.163 31.649 c
+s
+51.85 51.35 m
+51.021 51.35 50.35 50.678 50.35 49.85 c
+50.35 49.021 51.021 48.35 51.85 48.35 c
+52.678 48.35 53.35 49.021 53.35 49.85 c
+53.35 50.678 52.678 51.35 51.85 51.35 c
+s
+49.85 23.1 m
+50.679 23.1 51.35 22.428 51.35 21.6 c
+51.35 20.771 50.679 20.1 49.85 20.1 c
+49.022 20.1 48.35 20.771 48.35 21.6 c
+48.35 22.428 49.022 23.1 49.85 23.1 c
+s
+5.13 38.85 m
+4.302 38.85 3.63 39.521 3.63 40.35 c
+3.63 41.178 4.302 41.85 5.13 41.85 c
+5.959 41.85 6.63 41.178 6.63 40.35 c
+6.63 39.521 5.959 38.85 5.13 38.85 c
+s
+5.115 11.349 m
+5.943 11.349 6.615 12.021 6.615 12.849 c
+6.615 13.678 5.943 14.349 5.115 14.349 c
+4.286 14.349 3.615 13.678 3.615 12.849 c
+3.615 12.021 4.286 11.349 5.115 11.349 c
+s
+4.38 4.6 m
+3.552 4.6 2.88 3.928 2.88 3.1 c
+2.88 2.272 3.552 1.6 4.38 1.6 c
+5.209 1.6 5.88 2.272 5.88 3.1 c
+5.88 3.928 5.209 4.6 4.38 4.6 c
+s
+5.413 31.649 m
+4.998 32.366 4.081 32.612 3.364 32.198 c
+2.646 31.783 2.4 30.866 2.815 30.149 c
+3.229 29.431 4.146 29.185 4.864 29.6 c
+5.581 30.014 5.827 30.931 5.413 31.649 c
+s
+5.1 51.35 m
+4.271 51.35 3.6 50.678 3.6 49.85 c
+3.6 49.021 4.271 48.35 5.1 48.35 c
+5.928 48.35 6.6 49.021 6.6 49.85 c
+6.6 50.678 5.928 51.35 5.1 51.35 c
+s
+3.1 23.1 m
+3.929 23.1 4.6 22.428 4.6 21.6 c
+4.6 20.771 3.929 20.1 3.1 20.1 c
+2.272 20.1 1.6 20.771 1.6 21.6 c
+1.6 22.428 2.272 23.1 3.1 23.1 c
+s
+21.194 59.775 m
+20.78 60.492 19.863 60.738 19.145 60.324 c
+18.428 59.909 18.182 58.992 18.596 58.275 c
+19.01 57.558 19.928 57.312 20.645 57.726 c
+21.363 58.14 21.608 59.057 21.194 59.775 c
+s
+38.944 59.275 m
+38.53 59.992 37.613 60.238 36.895 59.824 c
+36.178 59.409 35.932 58.492 36.346 57.775 c
+36.76 57.058 37.678 56.812 38.395 57.226 c
+39.113 57.64 39.358 58.557 38.944 59.275 c
+s
+51.145 58.601 m
+50.317 58.601 49.645 57.929 49.645 57.101 c
+49.645 56.273 50.317 55.601 51.145 55.601 c
+51.974 55.601 52.645 56.273 52.645 57.101 c
+52.645 57.929 51.974 58.601 51.145 58.601 c
+s
+4.395 58.601 m
+3.567 58.601 2.895 57.929 2.895 57.101 c
+2.895 56.273 3.567 55.601 4.395 55.601 c
+5.224 55.601 5.895 56.273 5.895 57.101 c
+5.895 57.929 5.224 58.601 4.395 58.601 c
+s
+%AI6_EndPatternLayer
+) &
+] E
+%AI3_EndPattern
+%AI3_BeginPattern: (Rope.side)
+(Rope.side) 1 4.6 60.9998 33.3999 [
+%AI3_Tile
+(0 O 0 R  0 0 0 1 k
+ 0 0 0 1 K
+) @
+(
+%AI6_BeginPatternLayer
+800 Ar
+1 J 1 j 0.6 w 4 M []0 d
+%AI3_Note:
+0 D
+0 XR
+24.9999 7 m
+15.6521 4.663 8.125 8.6981 1 14.1407 C
+S
+36.9999 7 m
+22.3477 3.337 12.168 15.3276 1 23.859 C
+S
+48.9999 7 m
+29.3464 2.0866 17.7386 25.3332 1 30.6213 C
+S
+1 30.9999 m
+24.9999 36.9999 36.9999 1 60.9998 7 C
+S
+13 30.9999 m
+32.6534 35.9133 44.2611 12.6667 60.9998 7.3786 C
+S
+24.9999 30.9999 m
+39.652 34.6629 49.8317 22.6722 60.9998 14.1407 C
+S
+36.9999 30.9999 m
+46.3476 33.3369 53.8749 29.3018 60.9998 23.859 C
+S
+48.9999 30.9999 m
+53.3464 32.0865 57.2978 31.7908 60.9998 30.6213 C
+S
+13 7 m
+8.6535 5.9134 4.7019 6.2091 1 7.3786 C
+S
+%AI6_EndPatternLayer
+) &
+] E
+%AI3_EndPattern
+%AI3_BeginPattern: (Scales)
+(Scales) 1.6 9.3475 48.088 55.8355 [
+%AI3_Tile
+(0 O 0 R  1 g
+ 1 G
+) @
+(
+%AI6_BeginPatternLayer
+800 Ar
+0 J 0 j 1 w 4 M []0 d
+%AI3_Note:
+0 D
+0 XR
+1.6 9.3475 m
+1.6 55.8355 L
+48.088 55.8355 L
+48.088 9.3475 L
+1.6 9.3475 L
+f
+%AI6_EndPatternLayer
+) &
+(0 O 0 R  0 g
+ 0 G
+) @
+(
+%AI6_BeginPatternLayer
+800 Ar
+0 J 0 j 0.3 w 4 M []0 d
+%AI3_Note:
+0 D
+0 XR
+17.0956 9.3475 m
+12.8162 9.3475 9.3475 5.8787 9.3475 1.6 C
+9.3475 5.8787 5.8787 9.3475 1.6 9.3475 C
+1.6 13.6262 5.0687 17.095 9.3475 17.095 c
+13.6268 17.095 17.0956 13.6262 17.0956 9.3475 C
+s
+32.5918 9.3475 m
+28.3125 9.3475 24.8437 5.8787 24.8437 1.6 C
+24.8437 5.8787 21.3743 9.3475 17.0956 9.3475 C
+17.0956 13.6262 20.5644 17.095 24.8437 17.095 c
+29.1224 17.095 32.5918 13.6262 32.5918 9.3475 C
+s
+48.088 9.3475 m
+43.8087 9.3475 40.3399 5.8787 40.3399 1.6 C
+40.3399 5.8787 36.8705 9.3475 32.5918 9.3475 C
+32.5918 13.6262 36.0606 17.095 40.3399 17.095 c
+44.6186 17.095 48.088 13.6262 48.088 9.3475 C
+s
+17.0956 40.3393 m
+12.8162 40.3393 9.3475 36.8699 9.3475 32.5912 C
+9.3475 36.8699 5.8787 40.3393 1.6 40.3393 C
+1.6 44.6181 5.0687 48.0874 9.3475 48.0874 c
+13.6268 48.0874 17.0956 44.6181 17.0956 40.3393 C
+s
+17.0956 24.8431 m
+12.8162 24.8431 9.3475 21.3743 9.3475 17.095 C
+9.3475 21.3743 5.8787 24.8431 1.6 24.8431 C
+1.6 29.1218 5.0687 32.5912 9.3475 32.5912 c
+13.6268 32.5912 17.0956 29.1218 17.0956 24.8431 C
+s
+32.5918 24.8431 m
+28.3125 24.8431 24.8437 21.3743 24.8437 17.095 C
+24.8437 21.3743 21.3743 24.8431 17.0956 24.8431 C
+17.0956 29.1218 20.5644 32.5912 24.8437 32.5912 c
+29.1224 32.5912 32.5918 29.1218 32.5918 24.8431 C
+s
+48.088 24.8431 m
+43.8087 24.8431 40.3399 21.3743 40.3399 17.095 C
+40.3399 21.3743 36.8705 24.8431 32.5918 24.8431 C
+32.5918 29.1218 36.0606 32.5912 40.3399 32.5912 c
+44.6186 32.5912 48.088 29.1218 48.088 24.8431 C
+s
+32.5918 40.3393 m
+28.3125 40.3393 24.8437 36.8699 24.8437 32.5912 C
+24.8437 36.8699 21.3743 40.3393 17.0956 40.3393 C
+17.0956 44.6181 20.5644 48.0874 24.8437 48.0874 c
+29.1224 48.0874 32.5918 44.6181 32.5918 40.3393 C
+s
+48.088 40.3393 m
+43.8087 40.3393 40.3399 36.8699 40.3399 32.5912 C
+40.3399 36.8699 36.8705 40.3393 32.5918 40.3393 C
+32.5918 44.6181 36.0606 48.0874 40.3399 48.0874 c
+44.6186 48.0874 48.088 44.6181 48.088 40.3393 C
+s
+17.0956 55.8355 m
+12.8162 55.8355 9.3475 52.3662 9.3475 48.0874 C
+9.3475 52.3662 5.8787 55.8355 1.6 55.8355 C
+1.6 60.1143 5.0687 63.5836 9.3475 63.5836 c
+13.6268 63.5836 17.0956 60.1143 17.0956 55.8355 C
+s
+32.5918 55.8355 m
+28.3125 55.8355 24.8437 52.3662 24.8437 48.0874 C
+24.8437 52.3662 21.3743 55.8355 17.0956 55.8355 C
+17.0956 60.1143 20.5644 63.5836 24.8437 63.5836 c
+29.1224 63.5836 32.5918 60.1143 32.5918 55.8355 C
+s
+48.088 55.8355 m
+43.8087 55.8355 40.3399 52.3662 40.3399 48.0874 C
+40.3399 52.3662 36.8705 55.8355 32.5918 55.8355 C
+32.5918 60.1143 36.0606 63.5836 40.3399 63.5836 c
+44.6186 63.5836 48.088 60.1143 48.088 55.8355 C
+s
+%AI6_EndPatternLayer
+) &
+] E
+%AI3_EndPattern
+%AI3_BeginPattern: (SolidStar.side)
+(SolidStar.side) 1 1 33.0117 33.0117 [
+%AI3_Tile
+(0 O 0 R  0.05 0.2 0.95 0 k
+ 0.05 0.2 0.95 0 K
+) @
+(
+%AI6_BeginPatternLayer
+800 Ar
+0 J 0 j 1 w 4 M []0 d
+%AI3_Note:
+1 D
+0 XR
+7.9689 26.0458 m
+14.5331 22.9874 l
+17.0095 29.7904 L
+19.4859 22.9874 l
+26.0473 26.0458 l
+22.9889 19.4815 l
+29.792 17.0052 l
+22.9889 14.5288 l
+26.0473 7.9674 l
+19.4859 11.0257 l
+17.0095 4.2226 l
+14.5305 11.0257 l
+7.9689 7.9674 l
+11.0273 14.5288 l
+4.2242 17.0052 l
+11.0273 19.4843 L
+7.9689 26.0458 l
+f
+%AI6_EndPatternLayer
+) &
+] E
+%AI3_EndPattern
+%AI3_BeginPattern: (Stars)
+(Stars) 1 1 63.384 84.766 [
+%AI3_Tile
+(0 O 0 R  1 0.9 0.1 0 k
+ 1 0.9 0.1 0 K
+) @
+(
+%AI6_BeginPatternLayer
+800 Ar
+0 J 0 j 0.3 w 4 M []0 d
+%AI3_Note:
+0 D
+0 XR
+1 1 m
+1 84.766 L
+63.384 84.766 L
+63.384 1 L
+1 1 L
+f
+%AI6_EndPatternLayer
+) &
+(0 O 0 R  0 0.25 1 0 k
+ 0 0.25 1 0 K
+) @
+(
+%AI6_BeginPatternLayer
+*u
+800 Ar
+0 J 0 j 1 w 4 M []0 d
+%AI3_Note:
+0 D
+0 XR
+37.668 67.113 m
+43.924 62.567 L
+41.535 55.213 L
+47.791 59.757 L
+54.046 55.212 L
+51.657 62.566 L
+57.914 67.112 L
+50.18 67.112 L
+47.791 74.467 L
+45.402 67.113 L
+37.668 67.113 L
+f
+16.596 59.757 m
+22.851 55.212 L
+20.462 62.566 L
+26.719 67.112 L
+18.985 67.112 L
+16.596 74.467 L
+14.207 67.113 L
+6.473 67.113 L
+12.729 62.567 L
+10.34 55.213 L
+16.596 59.757 L
+f
+20.462 20.683 m
+26.719 25.229 L
+18.985 25.229 L
+16.596 32.584 L
+14.207 25.23 L
+6.473 25.23 L
+12.729 20.684 L
+10.34 13.33 L
+16.596 17.874 L
+22.851 13.329 L
+20.462 20.683 L
+f
+38.447 34.271 m
+36.058 41.625 L
+42.315 46.171 L
+34.581 46.171 L
+32.192 53.526 L
+29.803 46.172 L
+22.069 46.172 L
+28.325 41.626 L
+25.936 34.272 L
+32.192 38.816 L
+38.447 34.271 L
+f
+51.657 20.683 m
+57.914 25.229 L
+50.18 25.229 L
+47.791 32.584 L
+45.402 25.23 L
+37.668 25.23 L
+43.924 20.684 L
+41.535 13.33 L
+47.791 17.874 L
+54.046 13.329 L
+51.657 20.683 L
+f
+*U
+1 XR
+34.581 4.288 m
+32.192 11.643 L
+29.803 4.289 L
+22.069 4.289 L
+26.5962 1 L
+37.7885 1 L
+42.315 4.288 L
+34.581 4.288 L
+f
+53.261 4.289 m
+57.7882 1 L
+63.384 1 L
+63.384 11.643 L
+60.995 4.289 L
+53.261 4.289 L
+f
+4.866 41.625 m
+11.123 46.171 L
+3.389 46.171 L
+1 53.526 L
+1 38.816 L
+7.255 34.271 L
+4.866 41.625 L
+f
+36.058 41.625 m
+42.315 46.171 L
+34.581 46.171 L
+32.192 53.526 L
+29.803 46.172 L
+22.069 46.172 L
+28.325 41.626 L
+25.936 34.272 L
+32.192 38.816 L
+38.447 34.271 L
+36.058 41.625 L
+f
+53.261 46.172 m
+59.517 41.626 L
+57.128 34.272 L
+63.384 38.816 L
+63.384 53.526 L
+60.995 46.172 L
+53.261 46.172 L
+f
+4.866 83.508 m
+6.5974 84.766 L
+1 84.766 L
+1 80.699 L
+7.255 76.154 L
+4.866 83.508 L
+f
+25.936 76.155 m
+32.192 80.699 L
+38.447 76.154 L
+36.058 83.508 L
+37.7895 84.766 L
+26.5951 84.766 L
+28.325 83.509 L
+25.936 76.155 L
+f
+22.851 55.212 m
+20.462 62.566 L
+26.719 67.112 L
+18.985 67.112 L
+16.596 74.467 L
+14.207 67.113 L
+6.473 67.113 L
+12.729 62.567 L
+10.34 55.213 L
+16.596 59.757 L
+22.851 55.212 L
+f
+41.535 55.213 m
+47.791 59.757 L
+54.046 55.212 L
+51.657 62.566 L
+57.914 67.112 L
+50.18 67.112 L
+47.791 74.467 L
+45.402 67.113 L
+37.668 67.113 L
+43.924 62.567 L
+41.535 55.213 L
+f
+50.18 25.229 m
+47.791 32.584 L
+45.402 25.23 L
+37.668 25.23 L
+43.924 20.684 L
+41.535 13.33 L
+47.791 17.874 L
+54.046 13.329 L
+51.657 20.683 L
+57.914 25.229 L
+50.18 25.229 L
+f
+18.985 25.229 m
+16.596 32.584 L
+14.207 25.23 L
+6.473 25.23 L
+12.729 20.684 L
+10.34 13.33 L
+16.596 17.874 L
+22.851 13.329 L
+20.462 20.683 L
+26.719 25.229 L
+18.985 25.229 L
+f
+3.388 4.289 m
+1 11.643 L
+1 1 L
+6.5948 1 L
+11.122 4.289 L
+3.388 4.289 L
+f
+57.128 76.154 m
+63.384 80.699 L
+63.384 84.766 L
+57.7855 84.766 L
+59.517 83.508 L
+57.128 76.154 L
+f
+%AI6_EndPatternLayer
+) &
+] E
+%AI3_EndPattern
+%AI3_BeginPattern: (Stripes)
+(Stripes) 8.45 4.6001 80.45 76.6001 [
+%AI3_Tile
+(0 O 0 R  1 0.07 1 0 k
+ 1 0.07 1 0 K
+) @
+(
+%AI6_BeginPatternLayer
+800 Ar
+0 J 0 j 3.6 w 4 M []0 d
+%AI3_Note:
+0 D
+0 XR
+8.2 8.2 m
+80.7 8.2 L
+S
+8.2 22.6001 m
+80.7 22.6001 L
+S
+8.2 37.0002 m
+80.7 37.0002 L
+S
+8.2 51.4 m
+80.7 51.4 L
+S
+8.2 65.8001 m
+80.7 65.8001 L
+S
+8.2 15.4 m
+80.7 15.4 L
+S
+8.2 29.8001 m
+80.7 29.8001 L
+S
+8.2 44.2 m
+80.7 44.2 L
+S
+8.2 58.6001 m
+80.7 58.6001 L
+S
+8.2 73.0002 m
+80.7 73.0002 L
+S
+%AI6_EndPatternLayer
+) &
+] E
+%AI3_EndPattern
+%AI3_BeginPattern: (TriBevel.outer)
+(TriBevel.outer) 1 1.0004 31.6124 31.6127 [
+%AI3_Tile
+(0 O 0 R  0 0 0 0.3 k
+ 0 0 0 0.3 K
+) @
+(
+%AI6_BeginPatternLayer
+800 Ar
+0 J 0 j 1 w 4 M []0 d
+%AI3_Note:
+0 D
+0 XR
+31.6118 5.4917 m
+27.1221 5.4917 L
+27.1205 1.0011 L
+27.8031 1.0011 L
+27.8031 4.8091 L
+31.6118 4.8091 L
+31.6118 5.4917 L
+f
+%AI6_EndPatternLayer
+) &
+(0 O 0 R  0 0 0 0.2 k
+ 0 0 0 0.2 K
+) @
+(
+%AI6_BeginPatternLayer
+800 Ar
+0 J 0 j 1 w 4 M []0 d
+%AI3_Note:
+0 D
+0 XR
+31.6149 9.5062 m
+23.1111 9.5062 L
+23.1111 1.0015 L
+27.1205 1.0015 L
+27.1205 5.493 L
+31.6144 5.493 L
+31.6149 9.5062 L
+f
+%AI6_EndPatternLayer
+) &
+(0 O 0 R  0 0 0 0.4 k
+ 0 0 0 0.4 K
+) @
+(
+%AI6_BeginPatternLayer
+800 Ar
+0 J 0 j 1 w 4 M []0 d
+%AI3_Note:
+0 D
+0 XR
+31.6124 10.485 m
+22.1297 10.485 L
+22.1292 1.0015 L
+23.1084 1.0015 L
+23.1084 9.5049 L
+31.6124 9.5049 L
+31.6124 10.485 L
+f
+%AI6_EndPatternLayer
+) &
+(0 O 0 R  0 0 0 0.3 k
+ 0 0 0 0.3 K
+) @
+(
+%AI6_BeginPatternLayer
+800 Ar
+0 J 0 j 1 w 4 M []0 d
+%AI3_Note:
+0 D
+0 XR
+31.6129 17.2066 m
+15.4064 17.2085 L
+15.4064 1 L
+22.1301 1 L
+22.1301 10.4868 L
+31.6129 10.4868 L
+31.6129 17.2066 L
+f
+%AI6_EndPatternLayer
+) &
+(0 O 0 R  0 0 0 0.5 k
+ 0 0 0 0.5 K
+) @
+(
+%AI6_BeginPatternLayer
+800 Ar
+0 J 0 j 1 w 4 M []0 d
+%AI3_Note:
+0 D
+0 XR
+31.6149 18.3658 m
+14.2517 18.3658 L
+14.2515 1.0009 L
+15.4043 1.0009 L
+15.4043 17.2093 L
+31.6149 17.2093 L
+31.6149 18.3658 L
+f
+%AI6_EndPatternLayer
+) &
+(0 O 0 R  0 0 0 0.4 k
+ 0 0 0 0.4 K
+) @
+(
+%AI6_BeginPatternLayer
+800 Ar
+0 J 0 j 1 w 4 M []0 d
+%AI3_Note:
+0 D
+0 XR
+31.6124 30.4755 m
+2.1395 30.4755 L
+2.1395 1.0015 L
+14.249 1 L
+14.249 18.366 L
+31.6149 18.366 L
+31.6124 30.4755 L
+f
+%AI6_EndPatternLayer
+) &
+(0 O 0 R  0 0 0 0.6 k
+ 0 0 0 0.6 K
+) @
+(
+%AI6_BeginPatternLayer
+800 Ar
+0 J 0 j 1 w 4 M []0 d
+%AI3_Note:
+0 D
+0 XR
+15.4066 16.847 m
+14.2778 18.3257 l
+15.4066 17.2057 l
+15.4066 16.847 l
+f
+%AI6_EndPatternLayer
+) &
+(0 O 0 R  0 0 0 0.5 k
+ 0 0 0 0.5 K
+) @
+(
+%AI6_BeginPatternLayer
+800 Ar
+0 J 0 j 1 w 4 M []0 d
+%AI3_Note:
+0 D
+0 XR
+23.1095 9.1906 m
+22.1759 10.4392 l
+23.1082 9.505 l
+23.1095 9.1906 l
+f
+%AI6_EndPatternLayer
+) &
+(0 O 0 R  0 0 0 0.4 k
+ 0 0 0 0.4 K
+) @
+(
+%AI6_BeginPatternLayer
+800 Ar
+0 J 0 j 1 w 4 M []0 d
+%AI3_Note:
+0 D
+0 XR
+27.8039 4.6026 m
+27.1619 5.4533 l
+27.8029 4.8093 l
+27.8039 4.6026 l
+f
+%AI6_EndPatternLayer
+) &
+] E
+%AI3_EndPattern
+%AI3_BeginPattern: (TriBevel.side)
+(TriBevel.side) 1.0006 1 29.0006 31.6124 [
+%AI3_Tile
+(0 O 0 R  0 0 0 0.3 k
+ 0 0 0 0.3 K
+) @
+(
+%AI6_BeginPatternLayer
+800 Ar
+0 J 0 j 1 w 4 M []0 d
+%AI3_Note:
+0 D
+0 XR
+29 4.8087 m
+29 4.8087 L
+29.0026 5.4927 L
+1.0026 5.4927 L
+1 4.8087 L
+1 4.8087 L
+29 4.8087 L
+f
+%AI6_EndPatternLayer
+) &
+(0 O 0 R  0 0 0 0.2 k
+ 0 0 0 0.2 K
+) @
+(
+%AI6_BeginPatternLayer
+800 Ar
+0 J 0 j 1 w 4 M []0 d
+%AI3_Note:
+0 D
+0 XR
+29.0026 5.4927 m
+29.0005 9.5045 L
+1.0005 9.5045 L
+1.0026 5.4927 L
+29.0026 5.4927 L
+f
+%AI6_EndPatternLayer
+) &
+(0 O 0 R  0 0 0 0.4 k
+ 0 0 0 0.4 K
+) @
+(
+%AI6_BeginPatternLayer
+800 Ar
+0 J 0 j 1 w 4 M []0 d
+%AI3_Note:
+0 D
+0 XR
+29.0005 9.5045 m
+29.0011 10.4865 L
+1.0011 10.4865 L
+1.0005 9.5045 L
+29.0005 9.5045 L
+f
+%AI6_EndPatternLayer
+) &
+(0 O 0 R  0 0 0 0.3 k
+ 0 0 0 0.3 K
+) @
+(
+%AI6_BeginPatternLayer
+800 Ar
+0 J 0 j 1 w 4 M []0 d
+%AI3_Note:
+0 D
+0 XR
+29.0011 10.4865 m
+29.003 17.209 L
+1.003 17.209 L
+1.0011 10.4865 L
+29.0011 10.4865 L
+f
+%AI6_EndPatternLayer
+) &
+(0 O 0 R  0 0 0 0.5 k
+ 0 0 0 0.5 K
+) @
+(
+%AI6_BeginPatternLayer
+800 Ar
+0 J 0 j 1 w 4 M []0 d
+%AI3_Note:
+0 D
+0 XR
+29.003 17.209 m
+29.0031 18.3656 L
+1.0031 18.3656 L
+1.003 17.209 L
+29.003 17.209 L
+f
+%AI6_EndPatternLayer
+) &
+(0 O 0 R  0 0 0 0.4 k
+ 0 0 0 0.4 K
+) @
+(
+%AI6_BeginPatternLayer
+800 Ar
+0 J 0 j 1 w 4 M []0 d
+%AI3_Note:
+0 D
+0 XR
+29.0031 18.3656 m
+29.0006 30.4752 L
+1.0006 30.4752 L
+1.0031 18.3656 L
+29.0031 18.3656 L
+f
+%AI6_EndPatternLayer
+) &
+] E
+%AI3_EndPattern
+%AI3_BeginPattern: (Waves-scroll)
+(Waves-scroll) 17.926 10.516 68.663 69.012 [
+%AI3_Tile
+(0 O 0 R  1 0 0.3 0 k
+ 1 0 0.3 0 K
+) @
+(
+%AI6_BeginPatternLayer
+800 Ar
+0 J 0 j 1 w 4 M []0 d
+%AI3_Note:
+1 D
+0 XR
+17.926 69.012 m
+17.926 10.516 L
+68.663 10.516 L
+68.663 69.012 L
+17.926 69.012 L
+f
+%AI6_EndPatternLayer
+) &
+(0 O 0 R  0.55 0 0 0 k
+ 0.55 0 0 0 K
+) @
+(
+%AI6_BeginPatternLayer
+800 Ar
+0 J 0 j 0.75 w 4 M []0 d
+%AI3_Note:
+0 D
+0 XR
+65.335 70.465 m
+65.881 68.746 67.444 68.168 68.663 69.012 C
+67.538 69.668 68.011 71.255 69.686 70.933 c
+72.124 70.464 71.894 67.213 70.53 65.589 c
+68.561 63.245 64.565 60.995 53.241 71.117 C
+S
+39.964 70.465 m
+40.511 68.746 42.074 68.168 43.293 69.012 C
+42.168 69.668 42.64 71.255 44.316 70.933 c
+46.753 70.464 46.524 67.213 45.16 65.589 c
+43.191 63.245 39.195 60.995 27.87 71.117 c
+S
+14.594 70.465 m
+15.141 68.746 16.704 68.168 17.923 69.012 C
+16.798 69.668 17.27 71.255 18.945 70.933 c
+21.382 70.464 21.153 67.213 19.789 65.589 c
+17.821 63.245 13.825 60.995 2.5 71.117 c
+S
+10.959 51.619 m
+22.282 41.497 26.278 43.747 28.247 46.09 c
+29.611 47.715 29.841 50.965 27.403 51.434 c
+25.728 51.757 25.255 50.169 26.38 49.513 C
+25.161 48.669 23.599 49.248 23.052 50.966 c
+22.723 51.997 23.38 53.966 24.872 54.903 c
+27.267 56.406 31.371 56.05 36.328 51.619 c
+47.653 41.497 51.649 43.746 53.618 46.09 c
+54.982 47.715 55.212 50.965 52.774 51.434 c
+51.099 51.757 50.626 50.169 51.751 49.513 C
+50.532 48.669 48.97 49.248 48.423 50.966 c
+48.094 51.997 48.751 53.966 50.243 54.903 c
+52.638 56.406 56.742 56.05 61.699 51.619 C
+73.024 41.497 77.02 43.747 78.988 46.09 c
+S
+70.156 32.12 m
+65.199 36.551 61.095 36.907 58.7 35.404 c
+57.208 34.468 56.552 32.499 56.88 31.468 c
+57.427 29.749 58.99 29.171 60.208 30.015 C
+59.083 30.671 59.556 32.258 61.231 31.936 c
+63.669 31.467 63.439 28.216 62.075 26.592 c
+60.106 24.248 56.11 21.998 44.786 32.12 C
+39.829 36.551 35.725 36.907 33.33 35.404 c
+31.838 34.468 31.182 32.499 31.51 31.468 c
+32.056 29.749 33.619 29.171 34.838 30.015 C
+33.713 30.671 34.186 32.258 35.861 31.936 c
+38.299 31.467 38.069 28.216 36.705 26.592 c
+34.737 24.248 30.74 21.998 19.415 32.12 c
+14.458 36.551 10.354 36.907 7.96 35.404 c
+S
+19.792 7.094 m
+21.157 8.719 21.386 11.968 18.949 12.437 c
+17.274 12.76 16.801 11.172 17.926 10.516 C
+16.708 9.673 15.145 10.252 14.598 11.969 c
+14.27 13 14.926 14.969 16.418 15.906 c
+18.812 17.409 22.916 17.053 27.874 12.622 c
+39.199 2.5 43.195 4.75 45.163 7.094 c
+46.528 8.719 46.757 11.968 44.32 12.437 c
+42.644 12.76 42.172 11.172 43.297 10.516 C
+42.078 9.673 40.515 10.252 39.968 11.969 c
+39.64 13 40.297 14.969 41.788 15.906 c
+44.183 17.409 48.287 17.053 53.245 12.622 C
+64.569 2.5 68.565 4.75 70.534 7.094 c
+71.898 8.719 72.127 11.968 69.69 12.437 c
+68.014 12.76 67.542 11.172 68.667 10.516 C
+67.448 9.673 65.885 10.252 65.338 11.969 c
+65.011 13 65.667 14.969 67.159 15.906 c
+69.553 17.409 73.657 17.053 78.615 12.622 c
+S
+%AI6_EndPatternLayer
+) &
+] E
+%AI3_EndPattern
+%AI5_End_NonPrinting--
+%AI5_Begin_NonPrinting
+Np
+12 Bn
+%AI5_BeginGradient: (Black, White)
+(Black, White) 0 2 Bd
+[
+<
+FFFEFDFCFBFAF9F8F7F6F5F4F3F2F1F0EFEEEDECEBEAE9E8E7E6E5E4E3E2E1E0DFDEDDDCDBDAD9D8
+D7D6D5D4D3D2D1D0CFCECDCCCBCAC9C8C7C6C5C4C3C2C1C0BFBEBDBCBBBAB9B8B7B6B5B4B3B2B1B0
+AFAEADACABAAA9A8A7A6A5A4A3A2A1A09F9E9D9C9B9A999897969594939291908F8E8D8C8B8A8988
+87868584838281807F7E7D7C7B7A797877767574737271706F6E6D6C6B6A69686766656463626160
+5F5E5D5C5B5A595857565554535251504F4E4D4C4B4A494847464544434241403F3E3D3C3B3A3938
+37363534333231302F2E2D2C2B2A292827262524232221201F1E1D1C1B1A19181716151413121110
+0F0E0D0C0B0A09080706050403020100
+>
+0 %_Br
+[
+0 0 50 100 %_Bs
+1 0 50 0 %_Bs
+BD
+%AI5_EndGradient
+%AI5_BeginGradient: (Chrome)
+(Chrome) 0 6 Bd
+[
+0
+<
+464646454545444444444343434342424241414141404040403F3F3F3E3E3E3E3D3D3D3C3C3C3C3B
+3B3B3B3A3A3A39393939383838383737373636363635353535343434333333333232323131313130
+3030302F2F2F2E2E2E2E2D2D2D2D2C2C2C2B2B2B2B2A2A2A2A292929282828282727272726262625
+2525252424242323232322222222212121202020201F1F1F1F1E1E1E1D1D1D1D1C1C1C1C1B1B1B1A
+1A1A1A1919191818181817171717161616151515151414141413131312121212111111101010100F
+0F0F0F0E0E0E0D0D0D0D0C0C0C0C0B0B0B0A0A0A0A09090909080808070707070606060505050504
+04040403030302020202010101010000
+>
+<
+FFFEFDFCFBFAF9F8F7F6F5F4F3F2F1F0EFEEEDECEBEAE9E8E7E6E5E4E3E2E1E0DFDEDDDCDBDAD9D8
+D7D6D5D4D3D2D1D0CFCECDCCCBCAC9C8C7C6C5C4C3C2C1C0BFBEBDBCBBBAB9B8B7B6B5B4B3B2B1B0
+AFAEADACABAAA9A8A7A6A5A4A3A2A1A09F9E9D9C9B9A999897969594939291908F8E8D8C8B8A8988
+87868584838281807F7E7D7C7B7A797877767574737271706F6E6D6C6B6A69686766656463626160
+5F5E5D5C5B5A595857565554535251504F4E4D4C4B4A494847464544434241403F3E3D3C3B3A3938
+37363534333231302F2E2D2C2B2A292827262524232221201F1E1D1C1B1A19181716151413121110
+0F0E0D0C0B0A09080706050403020100
+>
+<
+1F1E1E1E1E1E1E1E1E1E1D1D1D1D1D1D1D1D1C1C1C1C1C1C1C1C1B1B1B1B1B1B1B1B1B1A1A1A1A1A
+1A1A1A19191919191919191818181818181818181717171717171717161616161616161615151515
+15151515151414141414141414131313131313131312121212121212121211111111111111111010
+1010101010100F0F0F0F0F0F0F0F0F0E0E0E0E0E0E0E0E0D0D0D0D0D0D0D0D0C0C0C0C0C0C0C0C0C
+0B0B0B0B0B0B0B0B0A0A0A0A0A0A0A0A090909090909090909080808080808080807070707070707
+07060606060606060606050505050505050504040404040404040303030303030303030202020202
+02020201010101010101010000000000
+>
+1 %_Br
+0
+0.275
+1
+<
+6B6A696867666564636261605F5E5D5C5B5A595857565554535251504F4E4D4C4B4A494847464544
+434241403F3E3D3C3B3A393837363534333231302F2E2D2C2B2A292827262524232221201F
+>
+1 %_Br
+0
+<
+00000101010102020202030303040404040505050506060607070707080808090909090A0A0A0A0B
+0B0B0C0C0C0C0D0D0D0D0E0E0E0F0F0F0F1010101011111112121212131313141414141515151516
+161617171717181818181919191A1A1A1A1B1B1B1B1C1C1C1D1D1D1D1E1E1E1F1F1F1F2020202021
+212122222222232323232424242525252526262626272727282828282929292A2A2A2A2B2B2B2B2C
+2C2C2D2D2D2D2E2E2E2E2F2F2F303030303131313132323233333333343434353535353636363637
+373738383838393939393A3A3A3B3B3B3B3C3C3C3C3D3D3D3E3E3E3E3F3F3F404040404141414142
+42424343434344444444454545464646
+>
+<
+000102030405060708090A0B0C0D0E0F101112131415161718191A1B1C1D1E1F2021222324252627
+28292A2B2C2D2E2F303132333435363738393A3B3C3D3E3F404142434445464748494A4B4C4D4E4F
+505152535455565758595A5B5C5D5E5F606162636465666768696A6B6C6D6E6F7071727374757677
+78797A7B7C7D7E7F808182838485868788898A8B8C8D8E8F909192939495969798999A9B9C9D9E9F
+A0A1A2A3A4A5A6A7A8A9AAABACADAEAFB0B1B2B3B4B5B6B7B8B9BABBBCBDBEBFC0C1C2C3C4C5C6C7
+C8C9CACBCCCDCECFD0D1D2D3D4D5D6D7D8D9DADBDCDDDEDFE0E1E2E3E4E5E6E7E8E9EAEBECEDEEEF
+F0F1F2F3F4F5F6F7F8F9FAFBFCFDFEFF
+>
+<
+00000101020203030304040505050606070708080809090A0A0A0B0B0C0C0D0D0D0E0E0F0F101010
+1111121212131314141515151616171718181819191A1A1A1B1B1C1C1D1D1D1E1E1F1F1F20202121
+222222232324242525252626272727282829292A2A2A2B2B2C2C2D2D2D2E2E2F2F2F303031313232
+32333334343435353636373737383839393A3A3A3B3B3C3C3C3D3D3E3E3F3F3F4040414142424243
+434444444545464647474748484949494A4A4B4B4C4C4C4D4D4E4E4F4F4F50505151515252535354
+54545555565657575758585959595A5A5B5B5C5C5C5D5D5E5E5F5F5F606061616162626363646464
+6565666666676768686969696A6A6B6B
+>
+1 %_Br
+1
+0 %_Br
+<
+FFFEFDFCFBFAF9F8F7F6F5F4F3F2F1F0EFEEEDECEBEAE9E8E7E6E5E4E3E2E1E0DFDEDDDCDBDAD9D8
+D7D6D5D4D3D2D1D0CFCECDCCCBCAC9C8C7C6C5C4C3C2C1C0BFBEBDBCBBBAB9B8B7B6B5B4B3B2B1B0
+AFAEADACABAAA9A8A7A6A5A4A3A2A1A09F9E9D9C9B9A999897969594939291908F8E8D8C8B8A8988
+87868584838281807F7E7D7C7B7A797877767574737271706F6E6D6C6B6A69686766656463626160
+5F5E5D5C5B5A595857565554535251504F4E4D4C4B4A494847464544434241403F3E3D3C3B3A3938
+37363534333231302F2E2D2C2B2A292827262524232221201F1E1D1C1B1A19181716151413121110
+0F0E0D0C0B0A09080706050403020100
+>
+<
+4D4C4C4C4B4B4B4A4A4A4A4949494848484747474746464645454544444444434343424242414141
+414040403F3F3F3E3E3E3E3D3D3D3C3C3C3B3B3B3B3A3A3A39393938383838373737363636353535
+35343434333333323232323131313030302F2F2F2F2E2E2E2D2D2D2C2C2C2C2B2B2B2A2A2A292929
+292828282727272626262625252524242423232323222222212121202020201F1F1F1E1E1E1D1D1D
+1D1C1C1C1B1B1B1A1A1A1A1919191818181717171716161615151514141414131313121212111111
+111010100F0F0F0E0E0E0E0D0D0D0C0C0C0B0B0B0B0A0A0A09090908080808070707060606050505
+05040404030303020202020101010000
+>
+0
+0
+1 %_Br
+[
+1 0 50 92 %_Bs
+0 0.275 1 0.12 1 50 59 %_Bs
+0 0.275 1 0.42 1 50 50 %_Bs
+1 0 50 49 %_Bs
+1 0 50 41 %_Bs
+1 0.3 0 0 1 50 0 %_Bs
+BD
+%AI5_EndGradient
+%AI5_BeginGradient: (Green, Blue)
+(Green, Blue) 0 2 Bd
+[
+<
+99999A9A9B9B9B9C9C9D9D9D9E9E9F9F9FA0A0A1A1A1A2A2A3A3A3A4A4A5A5A5A6A6A7A7A7A8A8A9
+A9A9AAAAABABABACACADADADAEAEAFAFAFB0B0B1B1B1B2B2B3B3B3B4B4B5B5B5B6B6B7B7B7B8B8B9
+B9B9BABABBBBBBBCBCBDBDBDBEBEBFBFBFC0C0C1C1C1C2C2C3C3C3C4C4C5C5C5C6C6C7C7C7C8C8C9
+C9C9CACACBCBCBCCCCCDCDCDCECECFCFCFD0D0D1D1D1D2D2D3D3D3D4D4D5D5D5D6D6D7D7D7D8D8D9
+D9D9DADADBDBDBDCDCDDDDDDDEDEDFDFDFE0E0E1E1E1E2E2E3E3E3E4E4E5E5E5E6E6E7E7E7E8E8E9
+E9E9EAEAEBEBEBECECEDEDEDEEEEEFEFEFF0F0F1F1F1F2F2F3F3F3F4F4F5F5F5F6F6F7F7F7F8F8F9
+F9F9FAFAFBFBFBFCFCFDFDFDFEFEFFFF
+>
+<
+000102020304050506070808090A0B0B0C0D0E0E0F101111121314141516171718191A1A1B1C1D1D
+1E1F20202122232324252626272829292A2B2C2C2D2E2F2F303132323334353536373838393A3B3B
+3C3D3E3E3F404141424344444546474748494A4A4B4C4D4D4E4F5050515253535455565657585959
+5A5B5C5C5D5E5F5F606162626364656566676868696A6B6B6C6D6E6E6F7071717273747475767777
+78797A7A7B7C7D7D7E7F80808182828384858586878888898A8B8B8C8D8E8E8F9091919293949495
+96979798999A9A9B9C9D9D9E9FA0A0A1A2A3A3A4A5A6A6A7A8A9A9AAABACACADAEAFAFB0B1B2B2B3
+B4B5B5B6B7B8B8B9BABBBBBCBDBEBEBF
+>
+<
+FFFEFDFCFBFAF9F8F7F6F5F4F3F2F1F0EFEEEDECEBEAE9E8E7E6E5E4E3E2E1E0DFDEDDDCDBDAD9D8
+D7D6D5D4D3D2D1D0CFCECDCCCBCAC9C8C7C6C5C4C3C2C1C0BFBEBDBCBBBAB9B8B7B6B5B4B3B2B1B0
+AFAEADACABAAA9A8A7A6A5A4A3A2A1A09F9E9D9C9B9A999897969594939291908F8E8D8C8B8A8988
+87868584838281807F7E7D7C7B7A797877767574737271706F6E6D6C6B6A69686766656463626160
+5F5E5D5C5B5A595857565554535251504F4E4D4C4B4A494847464544434241403F3E3D3C3B3A3938
+37363534333231302F2E2D2C2B2A292827262524232221201F1E1D1C1B1A19181716151413121110
+0F0E0D0C0B0A09080706050403020100
+>
+0
+1 %_Br
+[
+1 0.75 0 0 1 50 100 %_Bs
+0.6 0 1 0 1 50 0 %_Bs
+BD
+%AI5_EndGradient
+%AI5_BeginGradient: (Orange, Green, Violet)
+(Orange, Green, Violet) 0 3 Bd
+[
+<
+F0EFEFEFEEEEEEEDEDEDECECECEBEBEBEAEAEAE9E9E9E8E8E8E7E7E7E6E6E6E5E5E5E4E4E4E3E3E3
+E3E2E2E2E1E1E1E0E0E0DFDFDFDEDEDEDDDDDDDCDCDCDBDBDBDADADAD9D9D9D8D8D8D7D7D7D6D6D6
+D5D5D5D4D4D4D3D3D3D2D2D2D1D1D1D0D0D0CFCFCFCECECECDCDCDCCCCCCCBCBCBCACACAC9C9C9C8
+C8C8C7C7C7C6C6C6C5C5C5C4C4C4C3C3C3C2C2C2C2C1C1C1C0C0C0BFBFBFBEBEBEBDBDBDBCBCBCBB
+BBBBBABABAB9B9B9B8B8B8B7B7B7B6B6B6B5B5B5B4B4B4B3B3B3B2B2B2B1B1B1B0B0B0AFAFAFAEAE
+AEADADADACACACABABABAAAAAAA9A9A9A8A8A8A7A7A7A6A6A6A5A5A5A4A4A4A3A3A3A2A2A2A1A1A1
+A0A0A0A09F9F9F9E9E9E9D9D9D9C9C9C
+>
+<
+5455555657575859595A5A5B5C5C5D5E5E5F5F6061616263636465656666676868696A6A6B6B6C6D
+6D6E6F6F707171727273747475767677777879797A7B7B7C7C7D7E7E7F8080818282838384858586
+87878888898A8A8B8C8C8D8D8E8F8F909191929393949495969697989899999A9B9B9C9D9D9E9E9F
+A0A0A1A2A2A3A4A4A5A5A6A7A7A8A9A9AAAAABACACADAEAEAFAFB0B1B1B2B3B3B4B5B5B6B6B7B8B8
+B9BABABBBBBCBDBDBEBFBFC0C1C1C2C2C3C4C4C5C6C6C7C7C8C9C9CACBCBCCCCCDCECECFD0D0D1D2
+D2D3D3D4D5D5D6D7D7D8D8D9DADADBDCDCDDDDDEDFDFE0E1E1E2E3E3E4E4E5E6E6E7E8E8E9E9EAEB
+EBECEDEDEEEFEFF0F0F1F2F2F3F4F4F5
+>
+<
+FFFEFDFCFBFAF9F8F7F6F5F4F3F2F1F0EFEEEDECEBEAE9E8E7E6E5E4E3E2E1E0DFDEDDDCDBDAD9D8
+D7D6D5D4D3D2D1D0CFCECDCCCBCAC9C8C7C6C5C4C3C2C1C0BFBEBDBCBBBAB9B8B7B6B5B4B3B2B1B0
+AFAEADACABAAA9A8A7A6A5A4A3A2A1A09F9E9D9C9B9A999897969594939291908F8E8D8C8B8A8988
+87868584838281807F7E7D7C7B7A797877767574737271706F6E6D6C6B6A69686766656463626160
+5F5E5D5C5B5A595857565554535251504F4E4D4C4B4A494847464544434241403F3E3D3C3B3A3938
+37363534333231302F2E2D2C2B2A292827262524232221201F1E1D1C1B1A19181716151413121110
+0F0E0D0C0B0A09080706050403020100
+>
+<
+00000000000000000000000000000000000000000000000000000000000000000000000000000000
+00000000000000000000000101010101010101010101010101010101010101010101010101010101
+01010101010101010101010101010101010101010101010101010101010101010101010101010101
+01010101010101010101010101010101010101010101010101010101010101020202020202020202
+02020202020202020202020202020202020202020202020202020202020202020202020202020202
+02020202020202020202020202020202020202020202020202020202020202020202020202020202
+02020202020202020202020303030303
+>
+1 %_Br
+<
+000102030405060708090A0B0C0D0E0F101112131415161718191A1B1C1D1E1F2021222324252627
+28292A2B2C2D2E2F303132333435363738393A3B3C3D3E3F404142434445464748494A4B4C4D4E4F
+505152535455565758595A5B5C5D5E5F606162636465666768696A6B6C6D6E6F7071727374757677
+78797A7B7C7D7E7F808182838485868788898A8B8C8D8E8F909192939495969798999A9B9C9D9E9F
+A0A1A2A3A4A5A6A7A8A9AAABACADAEAFB0B1B2B3B4B5B6B7B8B9BABBBCBDBEBFC0C1C2C3C4C5C6C7
+C8C9CACBCCCDCECFD0D1D2D3D4D5D6D7D8D9DADBDCDDDEDFE0E1E2E3E4E5E6E7E8E9EAEBECEDEEEF
+F0
+>
+<
+A1A0A0A09F9F9F9E9E9E9D9D9D9D9C9C9C9B9B9B9A9A9A9999999898989797979696969595959594
+94949393939292929191919090908F8F8F8E8E8E8E8D8D8D8C8C8C8B8B8B8A8A8A89898988888887
+878787868686858585848484838383828282818181808080807F7F7F7E7E7E7D7D7D7C7C7C7B7B7B
+7A7A7A79797978787878777777767676757575747474737373727272717171717070706F6F6F6E6E
+6E6D6D6D6C6C6C6B6B6B6A6A6A6A6969696868686767676666666565656464646363636262626261
+61616060605F5F5F5E5E5E5D5D5D5C5C5C5B5B5B5B5A5A5A59595958585857575756565655555554
+54
+>
+<
+F5F5F5F5F5F5F5F5F5F5F5F5F5F5F5F5F5F6F6F6F6F6F6F6F6F6F6F6F6F6F6F6F6F6F6F6F6F6F6F6
+F7F7F7F7F7F7F7F7F7F7F7F7F7F7F7F7F7F7F7F7F7F7F7F7F8F8F8F8F8F8F8F8F8F8F8F8F8F8F8F8
+F8F8F8F8F8F8F8F8F9F9F9F9F9F9F9F9F9F9F9F9F9F9F9F9F9F9F9F9F9F9F9FAFAFAFAFAFAFAFAFA
+FAFAFAFAFAFAFAFAFAFAFAFAFAFAFAFBFBFBFBFBFBFBFBFBFBFBFBFBFBFBFBFBFBFBFBFBFBFBFCFC
+FCFCFCFCFCFCFCFCFCFCFCFCFCFCFCFCFCFCFCFCFCFCFDFDFDFDFDFDFDFDFDFDFDFDFDFDFDFDFDFD
+FDFDFDFDFDFEFEFEFEFEFEFEFEFEFEFEFEFEFEFEFEFEFEFEFEFEFEFEFEFFFFFFFFFFFFFFFFFFFFFF
+FF
+>
+0
+1 %_Br
+[
+0.61 0.96 0 0.01 1 50 100 %_Bs
+0.94 0.33 1 0 1 50 50 %_Bs
+0 0.63 0.96 0 1 50 0 %_Bs
+BD
+%AI5_EndGradient
+%AI5_BeginGradient: (Pink, Yellow, Green )
+(Pink, Yellow, Green ) 0 3 Bd
+[
+<
+000102030405060708090A0B0C0D0E0F101112131415161718191A1B1C1D1E1F2021222324252627
+28292A2B2C2D2E2F303132333435363738393A3B3C3D3E3F404142434445464748494A4B4C4E4F50
+5152535455565758595A5B5C5D5E5F606162636465666768696A6B6C6D6E6F70717273
+>
+<
+05050505050505050505050505050404040404040404040404040404040404040404040403030303
+03030303030303030303030303030303030303020202020202020202020202020202020202020202
+0201010101010101010101010101010101010101010101000000000000000000000000
+>
+<
+CCCCCCCCCCCBCBCBCBCBCBCBCBCBCACACACACACACACACAC9C9C9C9C9C9C9C9C9C8C8C8C8C8C8C8C8
+C8C7C7C7C7C7C7C7C7C7C6C6C6C6C6C6C6C6C6C5C5C5C5C5C5C5C5C5C4C4C4C4C4C4C4C4C3C3C3C3
+C3C3C3C3C3C2C2C2C2C2C2C2C2C2C1C1C1C1C1C1C1C1C1C0C0C0C0C0C0C0C0C0BFBFBF
+>
+0
+1 %_Br
+<
+0D0D0D0D0D0D0D0D0D0D0D0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0B
+0B0B0B0B0B0B0B0B0B0B0B0B0B0B0B0B0B0B0B0B0B0B0A0A0A0A0A0A0A0A0A0A0A0A0A0A0A0A0A0A
+0A0A0A09090909090909090909090909090909090909090808080808080808080808080808080808
+08080807070707070707070707070707070707070706060606060606060606060606060606060605
+05050505050505050505050505050505050404040404040404040404040404040404030303030303
+03030303030303030303030202020202020202020202020202020201010101010101010101010101
+010101000000000000000000
+>
+<
+B2B2B2B2B1B1B1B0B0B0AFAFAEAEAEADADACACABABAAAAA9A9A8A8A7A7A6A6A5A5A4A4A3A3A2A2A1
+A0A09F9F9E9E9D9D9C9B9B9A9A999898979796959594949392929190908F8F8E8D8D8C8B8B8A8989
+88888786868584848382828180807F7E7D7D7C7B7B7A7979787777767575747372727170706F6E6D
+6D6C6B6B6A69686867666565646363626160605F5E5D5D5C5B5A5A59585757565554545352515150
+4F4E4D4D4C4B4A4A4948474646454443434241403F3F3E3D3C3B3B3A393837373635343333323130
+2F2F2E2D2C2B2B2A2928272726252423222221201F1E1D1D1C1B1A1918181716151413131211100F
+0E0E0D0C0B0A090908070605
+>
+<
+0000010101020202030304040505060607070808090A0A0B0B0C0C0D0E0E0F0F1011111213131415
+151616171818191A1B1B1C1D1D1E1F1F202122222324242526272728292A2A2B2C2C2D2E2F303031
+323333343536363738393A3A3B3C3D3E3E3F4041424243444546464748494A4B4B4C4D4E4F505051
+5253545556565758595A5B5B5C5D5E5F6061626263646566676869696A6B6C6D6E6F707171727374
+75767778797A7B7B7C7D7E7F80818283848586868788898A8B8C8D8E8F9091929394949596979899
+9A9B9C9D9E9FA0A1A2A3A4A5A6A7A8A9AAAAABACADAEAFB0B1B2B3B4B5B6B7B8B9BABBBCBDBEBFC0
+C1C2C3C4C5C6C7C8C9CACBCC
+>
+0
+1 %_Br
+[
+0.45 0 0.75 0 1 50 100 %_Bs
+0 0.02 0.8 0 1 50 64 %_Bs
+0.05 0.7 0 0 1 57 0 %_Bs
+BD
+%AI5_EndGradient
+%AI5_BeginGradient: (Purple, Red, Yellow)
+(Purple, Red, Yellow) 0 3 Bd
+[
+0
+<
+FFFEFDFCFBFAF9F8F7F6F5F4F3F2F1F0EFEEEDECEBEAE9E8E7E6E5E4E3E2E1E0DFDEDDDCDBDAD9D8
+D7D6D5D4D3D2D1D0CFCECDCCCBCAC9C8C7C6C5C4C3C2C1C0BFBEBDBCBBBAB9B8B7B6B5B4B3B2B1B0
+AFAEADACABAAA9A8A7A6A5A4A3A2A1A09F9E9D9C9B9A999897969594939291908F8E8D8C8B8A8988
+87868584838281807F7E7D7C7B7A797877767574737271706F6E6D6C6B6A69686766656463626160
+5F5E5D5C5B5A595857565554535251504F4E4D4C4B4A494847464544434241403F3E3D3C3B3A3938
+37363534333231302F2E2D2C2B2A292827262524232221201F1E1D1C1B1A19181716151413121110
+0F0E0D0C0B0A
+>
+<
+CCCCCCCDCDCDCDCDCECECECECECFCFCFCFD0D0D0D0D0D1D1D1D1D1D2D2D2D2D2D3D3D3D3D3D4D4D4
+D4D5D5D5D5D5D6D6D6D6D6D7D7D7D7D7D8D8D8D8D8D9D9D9D9DADADADADADBDBDBDBDBDCDCDCDCDC
+DDDDDDDDDDDEDEDEDEDFDFDFDFDFE0E0E0E0E0E1E1E1E1E1E2E2E2E2E2E3E3E3E3E4E4E4E4E4E5E5
+E5E5E5E6E6E6E6E6E7E7E7E7E7E8E8E8E8E9E9E9E9E9EAEAEAEAEAEBEBEBEBEBECECECECECEDEDED
+EDEEEEEEEEEEEFEFEFEFEFF0F0F0F0F0F1F1F1F1F1F2F2F2F2F3F3F3F3F3F4F4F4F4F4F5F5F5F5F5
+F6F6F6F6F6F7F7F7F7F8F8F8F8F8F9F9F9F9F9FAFAFAFAFAFBFBFBFBFBFCFCFCFCFDFDFDFDFDFEFE
+FEFEFEFFFFFF
+>
+0
+1 %_Br
+<
+E5E4E3E2E1E0DFDEDDDCDBDAD9D8D7D6D5D4D3D2D1D0CFCECDCCCBCAC9C8C7C6C5C4C3C2C1C0BFBE
+BDBCBBBAB9B8B7B6B5B4B3B2B1B0AFAEADACABAAA9A8A7A6A5A4A3A2A1A09F9E9D9C9B9A99989796
+9594939291908F8E8D8C8B8A898887868584838281807F7E7D7C7B7A797877767574737271706F6E
+6D6C6B6A696867666564636261605F5E5D5C5B5A595857565554535251504F4E4D4C4B4A49484746
+4544434241403F3E3D3C3B3A393837363534333231302F2E2D2C2B2A292827262524232221201F1E
+1D1C1B1A191817161514131211100F0E0D0C0B0A09080706050403020100
+>
+<
+E5E6E6E6E6E6E6E6E6E7E7E7E7E7E7E7E7E7E8E8E8E8E8E8E8E8E8E9E9E9E9E9E9E9E9E9EAEAEAEA
+EAEAEAEAEAEBEBEBEBEBEBEBEBEBECECECECECECECECECEDEDEDEDEDEDEDEDEDEEEEEEEEEEEEEEEE
+EEEFEFEFEFEFEFEFEFEFF0F0F0F0F0F0F0F0F0F1F1F1F1F1F1F1F1F1F2F2F2F2F2F2F2F2F2F3F3F3
+F3F3F3F3F3F3F4F4F4F4F4F4F4F4F4F5F5F5F5F5F5F5F5F5F6F6F6F6F6F6F6F6F6F7F7F7F7F7F7F7
+F7F7F8F8F8F8F8F8F8F8F8F9F9F9F9F9F9F9F9F9FAFAFAFAFAFAFAFAFAFBFBFBFBFBFBFBFBFBFCFC
+FCFCFCFCFCFCFCFDFDFDFDFDFDFDFDFDFEFEFEFEFEFEFEFEFEFFFFFFFFFF
+>
+<
+00010203040405060708090A0B0C0C0D0E0F10111213141415161718191A1B1C1D1D1E1F20212223
+242525262728292A2B2C2D2D2E2F30313233343535363738393A3B3C3D3D3E3F4041424344454546
+4748494A4B4C4D4E4E4F50515253545556565758595A5B5C5D5E5E5F60616263646566666768696A
+6B6C6D6E6E6F70717273747576767778797A7B7C7D7E7F7F80818283848586878788898A8B8C8D8E
+8F8F90919293949596979798999A9B9C9D9E9F9FA0A1A2A3A4A5A6A7A7A8A9AAABACADAEAFAFB0B1
+B2B3B4B5B6B7B8B8B9BABBBCBDBEBFC0C0C1C2C3C4C5C6C7C8C8C9CACBCC
+>
+0
+1 %_Br
+[
+0 0.04 1 0 1 50 100 %_Bs
+0 1 0.8 0 1 50 50 %_Bs
+0.9 0.9 0 0 1 50 0 %_Bs
+BD
+%AI5_EndGradient
+%AI5_BeginGradient: (Rainbow)
+(Rainbow) 0 6 Bd
+[
+<
+FFFEFDFCFBFAF9F8F7F6F5F4F3F2F1F0EFEEEDECEBEAE9E8E7E6E5E4E3E2E1E0DFDEDDDCDBDAD9D8
+D7D6D5D4D3D2D1D0CFCECDCCCBCAC9C8C7C6C5C4C3C2C1C0BFBEBDBCBBBAB9B8B7B6B5B4B3B2B1B0
+AFAEADACABAAA9A8A7A6A5A4A3A2A1A09F9E9D9C9B9A999897969594939291908F8E8D8C8B8A8988
+87868584838281807F7E7D7C7B7A797877767574737271706F6E6D6C6B6A69686766656463626160
+5F5E5D5C5B5A595857565554535251504F4E4D4C4B4A494847464544434241403F3E3D3C3B3A3938
+37363534333231302F2E2D2C2B2A292827262524232221201F1E1D1C1B1A19181716151413121110
+0F0E0D0C0B0A09080706050403020100
+>
+1
+0
+0
+1 %_Br
+1
+<
+0708090A0B0C0D0E0F101112131415161718191A1B1C1D1E1F202122232425262728292A2B2C2D2E
+2F303132333435363738393A3B3C3D3E3F404142434445464748494A4B4C4D4E4F50515253545556
+5758595A5B5C5D5E5F606162636465666768696A6B6C6D6E6F707172737475767778797A7B7C7D7E
+7F808182838485868788898A8B8C8D8E8F909192939495969798999A9B9C9D9E9FA0A1A2A3A4A5A6
+A7A8A9AAABACADAEAFB0B1B2B3B4B5B6B7B8B9BABBBCBDBEBFC0C1C2C3C4C5C6C7C8C9CACBCCCDCE
+CFD0D1D2D3D4D5D6D7D8D9DADBDCDDDEDFE0E1E2E3E4E5E6E7E8E9EAEBECEDEEEFF0F1F2F3F4F5F6
+F7F8F9FAFBFCFDFEFF
+>
+0
+0
+1 %_Br
+1
+<
+00000000000000000000000000000000000001010101010101010101010101010101010101010101
+01010101010101010101010101010202020202020202020202020202020202020202020202020202
+02020202020202020202030303030303030303030303030303030303030303030303030303030303
+03030303030304040404040404040404040404040404040404040404040404040404040404040404
+04040505050505050505050505050505050505050505050505050505050505050505050505050606
+06060606060606060606060606060606060606060606060606060606060606060606070707070707
+07070707070707070707070707070707
+>
+<
+FFFEFDFCFBFAF9F8F7F6F5F4F3F2F1F0EFEEEDECEBEAE9E8E7E6E5E4E3E2E1E0DFDEDDDCDBDAD9D8
+D7D6D5D4D3D2D1D0CFCECDCCCBCAC9C8C7C6C5C4C3C2C1C0BFBEBDBCBBBAB9B8B7B6B5B4B3B2B1B0
+AFAEADACABAAA9A8A7A6A5A4A3A2A1A09F9E9D9C9B9A999897969594939291908F8E8D8C8B8A8988
+87868584838281807F7E7D7C7B7A797877767574737271706F6E6D6C6B6A69686766656463626160
+5F5E5D5C5B5A595857565554535251504F4E4D4C4B4A494847464544434241403F3E3D3C3B3A3938
+37363534333231302F2E2D2C2B2A292827262524232221201F1E1D1C1B1A19181716151413121110
+0F0E0D0C0B0A09080706050403020100
+>
+0
+1 %_Br
+<
+000102030405060708090A0B0C0D0E0F101112131415161718191A1B1C1D1E1F2021222324252627
+28292A2B2C2D2E2F303132333435363738393A3B3C3D3E3F404142434445464748494A4B4C4D4E4F
+505152535455565758595A5B5C5D5E5F606162636465666768696A6B6C6D6E6F7071727374757677
+78797A7B7C7D7E7F808182838485868788898A8B8C8D8E8F909192939495969798999A9B9C9D9E9F
+A0A1A2A3A4A5A6A7A8A9AAABACADAEAFB0B1B2B3B4B5B6B7B8B9BABBBCBDBEBFC0C1C2C3C4C5C6C7
+C8C9CACBCCCDCECFD0D1D2D3D4D5D6D7D8D9DADBDCDDDEDFE0E1E2E3E4E5E6E7E8E9EAEBECEDEEEF
+F0F1F2F3F4F5F6F7F8F9FAFBFCFDFEFF
+>
+0
+1
+0
+1 %_Br
+0
+<
+FFFEFDFCFBFAF9F8F7F6F5F4F3F2F1F0EFEEEDECEBEAE9E8E7E6E5E4E3E2E1E0DFDEDDDCDBDAD9D8
+D7D6D5D4D3D2D1D0CFCECDCCCBCAC9C8C7C6C5C4C3C2C1C0BFBEBDBCBBBAB9B8B7B6B5B4B3B2B1B0
+AFAEADACABAAA9A8A7A6A5A4A3A2A1A09F9E9D9C9B9A999897969594939291908F8E8D8C8B8A8988
+87868584838281807F7E7D7C7B7A797877767574737271706F6E6D6C6B6A69686766656463626160
+5F5E5D5C5B5A595857565554535251504F4E4D4C4B4A494847464544434241403F3E3D3C3B3A3938
+37363534333231302F2E2D2C2B2A292827262524232221201F1E1D1C1B1A19181716151413121110
+0F0E0D0C0B0A09080706050403020100
+>
+1
+0
+1 %_Br
+[
+0 1 0 0 1 50 100 %_Bs
+1 1 0 0 1 50 80 %_Bs
+1 0.0279 0 0 1 50 60 %_Bs
+1 0 1 0 1 50 40 %_Bs
+0 0 1 0 1 50 20 %_Bs
+0 1 1 0 1 50 0 %_Bs
+BD
+%AI5_EndGradient
+%AI5_BeginGradient: (Steel Bar)
+(Steel Bar) 0 3 Bd
+[
+<
+FFFEFDFCFBFAF9F8F7F6F5F4F3F2F1F0EFEEEDECEBEAE9E8E7E6E5E4E3E2E1E0DFDEDDDCDBDAD9D8
+D7D6D5D4D3D2D1D0CFCECDCCCBCAC9C8C7C6C5C4C3C2C1C0BFBEBDBCBBBAB9B8B7B6B5B4B3B2B1B0
+AFAEADACABAAA9A8A7A6A5A4A3A2A1A09F9E9D9C9B9A999897969594939291908F8E8D8C8B8A8988
+87868584838281807F7E7D7C7B7A797877767574737271706F6E6D6C6B6A69686766656463626160
+5F5E5D5C5B5A595857565554535251504F4E4D4C4B4A494847464544434241403F3E3D3C3B3A3938
+37363534333231302F2E2D2C2B2A292827262524232221201F1E1D1C1B1A19181716151413121110
+0F0E0D0C0B0A09080706050403020100
+>
+0 %_Br
+<
+000102030405060708090A0B0C0D0E0F101112131415161718191A1B1C1D1E1F2021222324252627
+28292A2B2C2D2E2F303132333435363738393A3B3C3D3E3F404142434445464748494A4B4C4D4E4F
+505152535455565758595A5B5C5D5E5F606162636465666768696A6B6C6D6E6F7071727374757677
+78797A7B7C7D7E7F808182838485868788898A8B8C8D8E8F909192939495969798999A9B9C9D9E9F
+A0A1A2A3A4A5A6A7A8A9AAABACADAEAFB0B1B2B3B4B5B6B7B8B9BABBBCBDBEBFC0C1C2C3C4C5C6C7
+C8C9CACBCCCDCECFD0D1D2D3D4D5D6D7D8D9DADBDCDDDEDFE0E1E2E3E4E5E6E7E8E9EAEBECEDEEEF
+F0F1F2F3F4F5F6F7F8F9FAFBFCFDFEFF
+>
+0 %_Br
+[
+0 0 50 100 %_Bs
+1 0 50 70 %_Bs
+0 0 50 0 %_Bs
+BD
+%AI5_EndGradient
+%AI5_BeginGradient: (White & Red Radial)
+(White & Red Radial) 1 18 Bd
+[
+0
+1
+1
+0
+1 %_Br
+0
+1
+1
+0
+1 %_Br
+0
+<
+FFFEFDFCFBFAF9F8F7F6F5F4F3F2F1F0EFEEEDECEBEAE9E8E7E6E5E4E3E2E1E0DFDEDDDCDBDAD9D8
+D7D6D5D4D3D2D1D0CFCECDCCCBCAC9C8C7C6C5C4C3C2C1C0BFBEBDBCBBBAB9B8B7B6B5B4B3B2B1B0
+AFAEADACABAAA9A8A7A6A5A4A3A2A1A09F9E9D9C9B9A999897969594939291908F8E8D8C8B8A8988
+87868584838281807F7E7D7C7B7A797877767574737271706F6E6D6C6B6A69686766656463626160
+5F5E5D5C5B5A595857565554535251504F4E4D4C4B4A494847464544434241403F3E3D3C3B3A3938
+37363534333231302F2E2D2C2B2A292827262524232221201F1E1D1C1B1A19181716151413121110
+0F0E0D0C0B0A09080706050403020100
+>
+<
+FFFEFDFCFBFAF9F8F7F6F5F4F3F2F1F0EFEEEDECEBEAE9E8E7E6E5E4E3E2E1E0DFDEDDDCDBDAD9D8
+D7D6D5D4D3D2D1D0CFCECDCCCBCAC9C8C7C6C5C4C3C2C1C0BFBEBDBCBBBAB9B8B7B6B5B4B3B2B1B0
+AFAEADACABAAA9A8A7A6A5A4A3A2A1A09F9E9D9C9B9A999897969594939291908F8E8D8C8B8A8988
+87868584838281807F7E7D7C7B7A797877767574737271706F6E6D6C6B6A69686766656463626160
+5F5E5D5C5B5A595857565554535251504F4E4D4C4B4A494847464544434241403F3E3D3C3B3A3938
+37363534333231302F2E2D2C2B2A292827262524232221201F1E1D1C1B1A19181716151413121110
+0F0E0D0C0B0A09080706050403020100
+>
+0
+1 %_Br
+1
+0 %_Br
+0
+<
+000102030405060708090A0B0C0D0E0F101112131415161718191A1B1C1D1E1F2021222324252627
+28292A2B2C2D2E2F303132333435363738393A3B3C3D3E3F404142434445464748494A4B4C4D4E4F
+505152535455565758595A5B5C5D5E5F606162636465666768696A6B6C6D6E6F7071727374757677
+78797A7B7C7D7E7F808182838485868788898A8B8C8D8E8F909192939495969798999A9B9C9D9E9F
+A0A1A2A3A4A5A6A7A8A9AAABACADAEAFB0B1B2B3B4B5B6B7B8B9BABBBCBDBEBFC0C1C2C3C4C5C6C7
+C8C9CACBCCCDCECFD0D1D2D3D4D5D6D7D8D9DADBDCDDDEDFE0E1E2E3E4E5E6E7E8E9EAEBECEDEEEF
+F0F1F2F3F4F5F6F7F8F9FAFBFCFDFEFF
+>
+<
+000102030405060708090A0B0C0D0E0F101112131415161718191A1B1C1D1E1F2021222324252627
+28292A2B2C2D2E2F303132333435363738393A3B3C3D3E3F404142434445464748494A4B4C4D4E4F
+505152535455565758595A5B5C5D5E5F606162636465666768696A6B6C6D6E6F7071727374757677
+78797A7B7C7D7E7F808182838485868788898A8B8C8D8E8F909192939495969798999A9B9C9D9E9F
+A0A1A2A3A4A5A6A7A8A9AAABACADAEAFB0B1B2B3B4B5B6B7B8B9BABBBCBDBEBFC0C1C2C3C4C5C6C7
+C8C9CACBCCCDCECFD0D1D2D3D4D5D6D7D8D9DADBDCDDDEDFE0E1E2E3E4E5E6E7E8E9EAEBECEDEEEF
+F0F1F2F3F4F5F6F7F8F9FAFBFCFDFEFF
+>
+0
+1 %_Br
+0
+1
+1
+0
+1 %_Br
+0
+<
+FFFEFDFCFBFAF9F8F7F6F5F4F3F2F1F0EFEEEDECEBEAE9E8E7E6E5E4E3E2E1E0DFDEDDDCDBDAD9D8
+D7D6D5D4D3D2D1D0CFCECDCCCBCAC9C8C7C6C5C4C3C2C1C0BFBEBDBCBBBAB9B8B7B6B5B4B3B2B1B0
+AFAEADACABAAA9A8A7A6A5A4A3A2A1A09F9E9D9C9B9A999897969594939291908F8E8D8C8B8A8988
+87868584838281807F7E7D7C7B7A797877767574737271706F6E6D6C6B6A69686766656463626160
+5F5E5D5C5B5A595857565554535251504F4E4D4C4B4A494847464544434241403F3E3D3C3B3A3938
+37363534333231302F2E2D2C2B2A292827262524232221201F1E1D1C1B1A19181716151413121110
+0F0E0D0C0B0A09080706050403020100
+>
+<
+FFFEFDFCFBFAF9F8F7F6F5F4F3F2F1F0EFEEEDECEBEAE9E8E7E6E5E4E3E2E1E0DFDEDDDCDBDAD9D8
+D7D6D5D4D3D2D1D0CFCECDCCCBCAC9C8C7C6C5C4C3C2C1C0BFBEBDBCBBBAB9B8B7B6B5B4B3B2B1B0
+AFAEADACABAAA9A8A7A6A5A4A3A2A1A09F9E9D9C9B9A999897969594939291908F8E8D8C8B8A8988
+87868584838281807F7E7D7C7B7A797877767574737271706F6E6D6C6B6A69686766656463626160
+5F5E5D5C5B5A595857565554535251504F4E4D4C4B4A494847464544434241403F3E3D3C3B3A3938
+37363534333231302F2E2D2C2B2A292827262524232221201F1E1D1C1B1A19181716151413121110
+0F0E0D0C0B0A09080706050403020100
+>
+0
+1 %_Br
+1
+0 %_Br
+0
+<
+000102030405060708090A0B0C0D0E0F101112131415161718191A1B1C1D1E1F2021222324252627
+28292A2B2C2D2E2F303132333435363738393A3B3C3D3E3F404142434445464748494A4B4C4D4E4F
+505152535455565758595A5B5C5D5E5F606162636465666768696A6B6C6D6E6F7071727374757677
+78797A7B7C7D7E7F808182838485868788898A8B8C8D8E8F909192939495969798999A9B9C9D9E9F
+A0A1A2A3A4A5A6A7A8A9AAABACADAEAFB0B1B2B3B4B5B6B7B8B9BABBBCBDBEBFC0C1C2C3C4C5C6C7
+C8C9CACBCCCDCECFD0D1D2D3D4D5D6D7D8D9DADBDCDDDEDFE0E1E2E3E4E5E6E7E8E9EAEBECEDEEEF
+F0F1F2F3F4F5F6F7F8F9FAFBFCFDFEFF
+>
+<
+000102030405060708090A0B0C0D0E0F101112131415161718191A1B1C1D1E1F2021222324252627
+28292A2B2C2D2E2F303132333435363738393A3B3C3D3E3F404142434445464748494A4B4C4D4E4F
+505152535455565758595A5B5C5D5E5F606162636465666768696A6B6C6D6E6F7071727374757677
+78797A7B7C7D7E7F808182838485868788898A8B8C8D8E8F909192939495969798999A9B9C9D9E9F
+A0A1A2A3A4A5A6A7A8A9AAABACADAEAFB0B1B2B3B4B5B6B7B8B9BABBBCBDBEBFC0C1C2C3C4C5C6C7
+C8C9CACBCCCDCECFD0D1D2D3D4D5D6D7D8D9DADBDCDDDEDFE0E1E2E3E4E5E6E7E8E9EAEBECEDEEEF
+F0F1F2F3F4F5F6F7F8F9FAFBFCFDFEFF
+>
+0
+1 %_Br
+0
+1
+1
+0
+1 %_Br
+0
+<
+FFFEFDFCFBFAF9F8F7F6F5F4F3F2F1F0EFEEEDECEBEAE9E8E7E6E5E4E3E2E1E0DFDEDDDCDBDAD9D8
+D7D6D5D4D3D2D1D0CFCECDCCCBCAC9C8C7C6C5C4C3C2C1C0BFBEBDBCBBBAB9B8B7B6B5B4B3B2B1B0
+AFAEADACABAAA9A8A7A6A5A4A3A2A1A09F9E9D9C9B9A999897969594939291908F8E8D8C8B8A8988
+87868584838281807F7E7D7C7B7A797877767574737271706F6E6D6C6B6A69686766656463626160
+5F5E5D5C5B5A595857565554535251504F4E4D4C4B4A494847464544434241403F3E3D3C3B3A3938
+37363534333231302F2E2D2C2B2A292827262524232221201F1E1D1C1B1A19181716151413121110
+0F0E0D0C0B0A09080706050403020100
+>
+<
+FFFEFDFCFBFAF9F8F7F6F5F4F3F2F1F0EFEEEDECEBEAE9E8E7E6E5E4E3E2E1E0DFDEDDDCDBDAD9D8
+D7D6D5D4D3D2D1D0CFCECDCCCBCAC9C8C7C6C5C4C3C2C1C0BFBEBDBCBBBAB9B8B7B6B5B4B3B2B1B0
+AFAEADACABAAA9A8A7A6A5A4A3A2A1A09F9E9D9C9B9A999897969594939291908F8E8D8C8B8A8988
+87868584838281807F7E7D7C7B7A797877767574737271706F6E6D6C6B6A69686766656463626160
+5F5E5D5C5B5A595857565554535251504F4E4D4C4B4A494847464544434241403F3E3D3C3B3A3938
+37363534333231302F2E2D2C2B2A292827262524232221201F1E1D1C1B1A19181716151413121110
+0F0E0D0C0B0A09080706050403020100
+>
+0
+1 %_Br
+1
+0 %_Br
+0
+<
+000102030405060708090A0B0C0D0E0F101112131415161718191A1B1C1D1E1F2021222324252627
+28292A2B2C2D2E2F303132333435363738393A3B3C3D3E3F404142434445464748494A4B4C4D4E4F
+505152535455565758595A5B5C5D5E5F606162636465666768696A6B6C6D6E6F7071727374757677
+78797A7B7C7D7E7F808182838485868788898A8B8C8D8E8F909192939495969798999A9B9C9D9E9F
+A0A1A2A3A4A5A6A7A8A9AAABACADAEAFB0B1B2B3B4B5B6B7B8B9BABBBCBDBEBFC0C1C2C3C4C5C6C7
+C8C9CACBCCCDCECFD0D1D2D3D4D5D6D7D8D9DADBDCDDDEDFE0E1E2E3E4E5E6E7E8E9EAEBECEDEEEF
+F0F1F2F3F4F5F6F7F8F9FAFBFCFDFEFF
+>
+<
+000102030405060708090A0B0C0D0E0F101112131415161718191A1B1C1D1E1F2021222324252627
+28292A2B2C2D2E2F303132333435363738393A3B3C3D3E3F404142434445464748494A4B4C4D4E4F
+505152535455565758595A5B5C5D5E5F606162636465666768696A6B6C6D6E6F7071727374757677
+78797A7B7C7D7E7F808182838485868788898A8B8C8D8E8F909192939495969798999A9B9C9D9E9F
+A0A1A2A3A4A5A6A7A8A9AAABACADAEAFB0B1B2B3B4B5B6B7B8B9BABBBCBDBEBFC0C1C2C3C4C5C6C7
+C8C9CACBCCCDCECFD0D1D2D3D4D5D6D7D8D9DADBDCDDDEDFE0E1E2E3E4E5E6E7E8E9EAEBECEDEEEF
+F0F1F2F3F4F5F6F7F8F9FAFBFCFDFEFF
+>
+0
+1 %_Br
+0
+1
+1
+0
+1 %_Br
+0
+<
+FFFEFDFCFBFAF9F8F7F6F5F4F3F2F1F0EFEEEDECEBEAE9E8E7E6E5E4E3E2E1E0DFDEDDDCDBDAD9D8
+D7D6D5D4D3D2D1D0CFCECDCCCBCAC9C8C7C6C5C4C3C2C1C0BFBEBDBCBBBAB9B8B7B6B5B4B3B2B1B0
+AFAEADACABAAA9A8A7A6A5A4A3A2A1A09F9E9D9C9B9A999897969594939291908F8E8D8C8B8A8988
+87868584838281807F7E7D7C7B7A797877767574737271706F6E6D6C6B6A69686766656463626160
+5F5E5D5C5B5A595857565554535251504F4E4D4C4B4A494847464544434241403F3E3D3C3B3A3938
+37363534333231302F2E2D2C2B2A292827262524232221201F1E1D1C1B1A19181716151413121110
+0F0E0D0C0B0A09080706050403020100
+>
+<
+FFFEFDFCFBFAF9F8F7F6F5F4F3F2F1F0EFEEEDECEBEAE9E8E7E6E5E4E3E2E1E0DFDEDDDCDBDAD9D8
+D7D6D5D4D3D2D1D0CFCECDCCCBCAC9C8C7C6C5C4C3C2C1C0BFBEBDBCBBBAB9B8B7B6B5B4B3B2B1B0
+AFAEADACABAAA9A8A7A6A5A4A3A2A1A09F9E9D9C9B9A999897969594939291908F8E8D8C8B8A8988
+87868584838281807F7E7D7C7B7A797877767574737271706F6E6D6C6B6A69686766656463626160
+5F5E5D5C5B5A595857565554535251504F4E4D4C4B4A494847464544434241403F3E3D3C3B3A3938
+37363534333231302F2E2D2C2B2A292827262524232221201F1E1D1C1B1A19181716151413121110
+0F0E0D0C0B0A09080706050403020100
+>
+0
+1 %_Br
+1
+0 %_Br
+0
+<
+000102030405060708090A0B0C0D0E0F101112131415161718191A1B1C1D1E1F2021222324252627
+28292A2B2C2D2E2F303132333435363738393A3B3C3D3E3F404142434445464748494A4B4C4D4E4F
+505152535455565758595A5B5C5D5E5F606162636465666768696A6B6C6D6E6F7071727374757677
+78797A7B7C7D7E7F808182838485868788898A8B8C8D8E8F909192939495969798999A9B9C9D9E9F
+A0A1A2A3A4A5A6A7A8A9AAABACADAEAFB0B1B2B3B4B5B6B7B8B9BABBBCBDBEBFC0C1C2C3C4C5C6C7
+C8C9CACBCCCDCECFD0D1D2D3D4D5D6D7D8D9DADBDCDDDEDFE0E1E2E3E4E5E6E7E8E9EAEBECEDEEEF
+F0F1F2F3F4F5F6F7F8F9FAFBFCFDFEFF
+>
+<
+000102030405060708090A0B0C0D0E0F101112131415161718191A1B1C1D1E1F2021222324252627
+28292A2B2C2D2E2F303132333435363738393A3B3C3D3E3F404142434445464748494A4B4C4D4E4F
+505152535455565758595A5B5C5D5E5F606162636465666768696A6B6C6D6E6F7071727374757677
+78797A7B7C7D7E7F808182838485868788898A8B8C8D8E8F909192939495969798999A9B9C9D9E9F
+A0A1A2A3A4A5A6A7A8A9AAABACADAEAFB0B1B2B3B4B5B6B7B8B9BABBBCBDBEBFC0C1C2C3C4C5C6C7
+C8C9CACBCCCDCECFD0D1D2D3D4D5D6D7D8D9DADBDCDDDEDFE0E1E2E3E4E5E6E7E8E9EAEBECEDEEEF
+F0F1F2F3F4F5F6F7F8F9FAFBFCFDFEFF
+>
+0
+1 %_Br
+[
+0 1 1 0 1 50 0 %_Bs
+0 1 1 0 1 50 0 %_Bs
+0 1 1 0 1 50 12.5 %_Bs
+0 0 0 0 1 50 12.5 %_Bs
+0 0 0 0 1 50 25 %_Bs
+0 1 1 0 1 50 25 %_Bs
+0 1 1 0 1 50 37.5 %_Bs
+0 0 0 0 1 50 37.5 %_Bs
+0 0 0 0 1 50 50 %_Bs
+0 1 1 0 1 50 50 %_Bs
+0 1 1 0 1 50 62.5 %_Bs
+0 0 0 0 1 50 62.5 %_Bs
+0 0 0 0 1 50 75 %_Bs
+0 1 1 0 1 50 75 %_Bs
+0 1 1 0 1 50 87.5 %_Bs
+0 0 0 0 1 50 87.5 %_Bs
+0 0 0 0 1 50 100 %_Bs
+0 1 1 0 1 50 100 %_Bs
+BD
+%AI5_EndGradient
+%AI5_BeginGradient: (Yellow & Orange Radial)
+(Yellow & Orange Radial) 1 2 Bd
+[
+0
+<
+0001010203040506060708090A0B0C0C0D0E0F10111213131415161718191A1B1C1D1D1E1F202122
+232425262728292A2B2B2C2D2E2F303132333435363738393A3B3C3D3E3E3F404142434445464748
+494A4B4C4D4E4F505152535455565758595A5B5C5D5E5F60606162636465666768696A6B6C6D6E6F
+707172737475767778797A7B7C7D7E7F808182838485868788898A8B8C
+>
+<
+FFFFFFFFFEFEFEFEFEFEFEFDFDFDFDFDFDFCFCFCFCFCFCFBFBFBFBFBFBFAFAFAFAFAFAF9F9F9F9F9
+F9F8F8F8F8F8F8F7F7F7F7F7F7F6F6F6F6F6F6F5F5F5F5F5F5F4F4F4F4F4F3F3F3F3F3F3F2F2F2F2
+F2F2F1F1F1F1F1F0F0F0F0F0F0EFEFEFEFEFEFEEEEEEEEEEEDEDEDEDEDEDECECECECECEBEBEBEBEB
+EBEAEAEAEAEAE9E9E9E9E9E9E8E8E8E8E8E8E7E7E7E7E7E6E6E6E6E6E5
+>
+0
+1 %_Br
+[
+0 0 1 0 1 52 19 %_Bs
+0 0.55 0.9 0 1 50 100 %_Bs
+BD
+%AI5_EndGradient
+%AI5_BeginGradient: (Yellow & Purple Radial)
+(Yellow & Purple Radial) 1 2 Bd
+[
+<
+000102030405060708090A0B0C0D0E0F101112131415161718191A1B1C1D1E1F2021222324252627
+28292A2B2C2D2E2F303132333435363738393A3B3C3D3E3F404142434445464748494A4B4C4D4E4F
+505152535455565758595A5B5C5D5E5F606162636465666768696A6B6C6D6E6F7071727374757677
+78797A7B7C7D7E7F808182838485868788898A8B8C8D8E8F909192939495969798999A9B9C9D9E9F
+A0A1A2A3A4A5A6A7A8A9AAABACADAEAFB0B1B2B3B4B5B6B7B8B9BABBBCBDBEBFC0C1C2C3C4C5C6C7
+C8C9CACBCCCDCECFD0D1D2D3D4D5D6D7D8D9DADBDCDDDEDFE0E1E2E3E4E5E6E7E8E9EAEBECEDEEEF
+F0F1F2F3F4F5F6F7F8F9FAFBFCFDFEFF
+>
+<
+1415161718191A1B1C1D1E1F1F202122232425262728292A2A2B2C2D2E2F30313233343536363738
+393A3B3C3D3E3F40414142434445464748494A4B4C4D4D4E4F50515253545556575858595A5B5C5D
+5E5F60616263646465666768696A6B6C6D6E6F6F707172737475767778797A7B7B7C7D7E7F808182
+83848586868788898A8B8C8D8E8F90919292939495969798999A9B9C9D9D9E9FA0A1A2A3A4A5A6A7
+A8A9A9AAABACADAEAFB0B1B2B3B4B4B5B6B7B8B9BABBBCBDBEBFC0C0C1C2C3C4C5C6C7C8C9CACBCB
+CCCDCECFD0D1D2D3D4D5D6D7D7D8D9DADBDCDDDEDFE0E1E2E2E3E4E5E6E7E8E9EAEBECEDEEEEEFF0
+F1F2F3F4F5F6F7F8F9F9FAFBFCFDFEFF
+>
+<
+ABAAAAA9A8A7A7A6A5A5A4A3A3A2A1A1A09F9F9E9D9D9C9B9B9A9999989797969595949393929191
+908F8F8E8D8D8C8B8B8A8989888787868585848383828181807F7F7E7D7D7C7B7B7A797978777776
+7575747373727171706F6F6E6D6D6C6B6B6A6969686767666565646362626160605F5E5E5D5C5C5B
+5A5A5958585756565554545352525150504F4E4E4D4C4C4B4A4A4948484746464544444342424140
+403F3E3E3D3C3C3B3A3A3938383736363534343332323130302F2E2E2D2C2C2B2A2A292828272626
+25242423222121201F1F1E1D1D1C1B1B1A1919181717161515141313121111100F0F0E0D0D0C0B0B
+0A090908070706050504030302010100
+>
+0
+1 %_Br
+[
+0 0.08 0.67 0 1 50 14 %_Bs
+1 1 0 0 1 50 100 %_Bs
+BD
+%AI5_EndGradient
+%AI5_BeginGradient: (Yellow, Violet, Orange, Blue)
+(Yellow, Violet, Orange, Blue) 0 4 Bd
+[
+<
+000102030405060708090A0B0C0D0E0F101112131415161718191A1B1C1D1E1F2021222324252627
+28292A2B2C2D2E2F303132333435363738393A3B3C3D3E3F404142434445464748494A4B4C4D4E4F
+505152535455565758595A5B5C5D5E5F606162636465666768696A6B6C6D6E6F7071727374757677
+78797A7B7C7D7E7F808182838485868788898A8B8C8D8E8F909192939495969798999A9B9C9D9E9F
+A0A1A2A3A4A5A6A7A8A9AAABACADAEAFB0B1B2B3B4B5B6B7B8B9BABBBCBDBEBFC0C1C2C3C4C5C6C7
+C8C9CACBCCCDCECFD0D1D2D3D4D5D6D7D8D9DADBDCDDDEDFE0E1E2E3E4E5E6E7E8E9EAEBECEDEEEF
+F0F1F2F3F4F5F6F7F8F9FAFBFCFDFEFF
+>
+<
+A1A1A1A1A2A2A2A2A3A3A3A3A4A4A4A4A4A5A5A5A5A6A6A6A6A7A7A7A7A8A8A8A8A9A9A9A9AAAAAA
+AAAAABABABABACACACACADADADADAEAEAEAEAFAFAFAFB0B0B0B0B0B1B1B1B1B2B2B2B2B3B3B3B3B4
+B4B4B4B5B5B5B5B6B6B6B6B6B7B7B7B7B8B8B8B8B9B9B9B9BABABABABBBBBBBBBCBCBCBCBCBDBDBD
+BDBEBEBEBEBFBFBFBFC0C0C0C0C1C1C1C1C2C2C2C2C2C3C3C3C3C4C4C4C4C5C5C5C5C6C6C6C6C7C7
+C7C7C8C8C8C8C8C9C9C9C9CACACACACBCBCBCBCCCCCCCCCDCDCDCDCECECECECECFCFCFCFD0D0D0D0
+D1D1D1D1D2D2D2D2D3D3D3D3D4D4D4D4D4D5D5D5D5D6D6D6D6D7D7D7D7D8D8D8D8D9D9D9D9DADADA
+DADADBDBDBDBDCDCDCDCDDDDDDDDDEDE
+>
+<
+F5F4F3F2F1F0EFEEEDECEBEAE9E8E7E6E5E4E4E3E2E1E0DFDEDDDCDBDAD9D8D7D6D5D4D3D2D1D0CF
+CECDCCCCCBCAC9C8C7C6C5C4C3C2C1C0BFBEBDBCBBBAB9B8B7B6B5B4B4B3B2B1B0AFAEADACABAAA9
+A8A7A6A5A4A3A2A1A09F9E9D9C9C9B9A999897969594939291908F8E8D8C8B8A8988878685848483
+8281807F7E7D7C7B7A797877767574737271706F6E6D6C6C6B6A696867666564636261605F5E5D5C
+5B5A59585756555454535251504F4E4D4C4B4A494847464544434241403F3E3D3C3C3B3A39383736
+3534333231302F2E2D2C2B2A29282726252424232221201F1E1D1C1B1A191817161514131211100F
+0E0D0C0C0B0A09080706050403020100
+>
+0
+1 %_Br
+<
+9C9B9A9A9998989796969595949393929191908F8F8E8E8D8C8C8B8A8A8989888787868585848383
+82828180807F7E7E7D7C7C7B7B7A797978777776757574747372727170706F6E6E6D6D6C6B6B6A69
+6968676766666564646362626161605F5F5E5D5D5C5B5B5A5A595858575656555454535352515150
+4F4F4E4D4D4C4C4B4A4A4948484746464545444343424141403F3F3E3E3D3C3C3B3A3A3939383737
+36353534333332323130302F2E2E2D2C2C2B2B2A292928272726252524242322222120201F1E1E1D
+1D1C1B1B1A191918171716161514141312121111100F0F0E0D0D0C0B0B0A0A090808070606050404
+030302010100
+>
+<
+F5F4F4F4F3F3F3F2F2F2F1F1F1F0F0F0EFEFEFEEEEEEEDEDEDECECECEBEBEAEAEAE9E9E9E8E8E8E7
+E7E7E6E6E6E5E5E5E4E4E4E3E3E3E2E2E2E1E1E1E0E0E0DFDFDEDEDEDDDDDDDCDCDCDBDBDBDADADA
+D9D9D9D8D8D8D7D7D7D6D6D6D5D5D5D4D4D3D3D3D2D2D2D1D1D1D0D0D0CFCFCFCECECECDCDCDCCCC
+CCCBCBCBCACACAC9C9C8C8C8C7C7C7C6C6C6C5C5C5C4C4C4C3C3C3C2C2C2C1C1C1C0C0C0BFBFBFBE
+BEBEBDBDBCBCBCBBBBBBBABABAB9B9B9B8B8B8B7B7B7B6B6B6B5B5B5B4B4B4B3B3B3B2B2B1B1B1B0
+B0B0AFAFAFAEAEAEADADADACACACABABABAAAAAAA9A9A9A8A8A8A7A7A6A6A6A5A5A5A4A4A4A3A3A3
+A2A2A2A1A1A1
+>
+<
+000102030405060708090A0B0C0D0E0F101112131415161718191A1B1C1D1E1F2021222324252627
+28292A2B2C2D2E2F303132333435363738393A3B3C3D3E3F404142434445464748494A4B4C4D4E4F
+505152535455565758595A5B5C5D5E5F606162636465666768696A6B6C6D6E6F7071727374757677
+78797A7B7C7D7E7F808182838485868788898A8B8C8D8E8F909192939495969798999A9B9C9D9E9F
+A0A1A2A3A4A5A6A7A8A9AAABACADAEAFB0B1B2B3B4B5B6B7B8B9BABBBCBDBEBFC0C1C2C3C4C5C6C7
+C8C9CACBCCCDCECFD0D1D2D3D4D5D6D7D8D9DADBDCDDDEDFE0E1E2E3E4E5E6E7E8E9EAEBECEDEEEF
+F0F1F2F3F4F5
+>
+<
+03030303030202020202020202020202020202020202020202020202020202020202020202020202
+02020202020202020202020202020202020202020202020202020202020202020202020202020202
+02020202020202020202020202020202020202020201010101010101010101010101010101010101
+01010101010101010101010101010101010101010101010101010101010101010101010101010101
+01010101010101010101010101010101010101010101010101010101010101010101010101000000
+00000000000000000000000000000000000000000000000000000000000000000000000000000000
+000000000000
+>
+1 %_Br
+<
+0D0D0E0F0F10101111121313141415161617171819191A1A1B1C1C1D1D1E1E1F2020212122232324
+2425262627272828292A2A2B2B2C2D2D2E2E2F30303131323333343435353637373838393A3A3B3B
+3C3D3D3E3E3F3F404141424243444445454647474848494A4A4B4B4C4C4D4E4E4F4F505151525253
+54545555565757585859595A5B5B5C5C5D5E5E5F5F60616162626363646565666667686869696A6B
+6B6C6C6D6E6E6F6F70707172727373747575767677787879797A7B7B7C7C7D7D7E7F7F8080818282
+8383848585868687878889898A8A8B8C8C8D8D8E8F8F90909192929393949495969697979899999A
+9A9B9C
+>
+<
+08090A0B0C0D0E0F0F101112131415161718191A1B1C1D1E1F202122232425262728292A2B2C2D2E
+2F303132333435363738393A3B3C3D3E3F40404142434445464748494A4B4C4D4E4F505152535455
+565758595A5B5C5D5E5F606162636465666768696A6B6C6D6E6F70717172737475767778797A7B7C
+7D7E7F808182838485868788898A8B8C8D8E8F909192939495969798999A9B9C9D9E9FA0A1A2A2A3
+A4A5A6A7A8A9AAABACADAEAFB0B1B2B3B4B5B6B7B8B9BABBBCBDBEBFC0C1C2C3C4C5C6C7C8C9CACB
+CCCDCECFD0D1D2D2D3D4D5D6D7D8D9DADBDCDDDEDFE0E1E2E3E4E5E6E7E8E9EAEBECEDEEEFF0F1F2
+F3F4F5
+>
+<
+F2F1F0EFEEEDECEBEAE9E8E7E6E5E4E3E2E1E0DFDEDDDCDBDAD9D8D7D6D5D4D3D2D1D0CFCECDCCCB
+CAC9C8C7C6C5C4C3C2C1C0BFBEBDBCBBBAB9B8B7B6B5B4B3B2B1B0AFAEADACABAAA9A8A7A6A5A4A3
+A2A1A09F9E9D9C9B9A999897969594939291908F8E8D8C8B8A898887868584838281807F7E7D7C7B
+7A797877767574737271706F6E6D6C6B6A696867666564636261605F5E5D5C5B5A59585756555453
+5251504F4E4D4C4B4A494847464544434241403F3E3D3C3B3A393837363534333231302F2E2D2C2B
+2A292827262524232221201F1E1D1C1B1A191817161514131211100F0E0D0C0B0A09080706050403
+020100
+>
+<
+00000000000000000000000000000000000000000000000000000000000000000000000000000000
+00000000000000000101010101010101010101010101010101010101010101010101010101010101
+01010101010101010101010101010101010101010101010101010101010101010101010101010101
+01010101010101010101010101010101010101010101010202020202020202020202020202020202
+02020202020202020202020202020202020202020202020202020202020202020202020202020202
+02020202020202020202020202020202020202020202020202020202020202020202020202020303
+030303
+>
+1 %_Br
+[
+1 0.87 0 0 1 50 95 %_Bs
+0 0.63 0.96 0 1 50 65 %_Bs
+0.61 0.96 0 0.01 1 50 35 %_Bs
+0.05 0.03 0.95 0 1 50 5 %_Bs
+BD
+%AI5_EndGradient
+%AI5_End_NonPrinting--
+%AI5_BeginPalette
+0 0 Pb
+0 0 0 0 k
+(C=0 M=0 Y=0 K=0) Pc
+0 0 0 1 k
+(C=0 M=0 Y=0 K=100) Pc
+0 0.45 0.6 0 k
+(C=0 M=45 Y=60 K=0) Pc
+0 0.5 0.05 0 k
+(C=0 M=50 Y=5 K=0) Pc
+0 0.9 1 0 k
+(C=0 M=90 Y=100 K=0) Pc
+1 0.2 1 0 k
+(C=100 M=20 Y=100 K=0) Pc
+1 0.4 0.15 0 k
+(C=100 M=40 Y=15 K=0) Pc
+0.2 0 1 0 k
+(C=20 M=0 Y=100 K=0) Pc
+0.25 1 0.25 0 k
+(C=25 M=100 Y=25 K=0) Pc
+0.4 0.4 0.4 0 k
+(C=40 M=40 Y=40 K=0) Pc
+0.4 0.7 1 0 k
+(C=40 M=70 Y=100 K=0) Pc
+0.75 0.9 0 0 k
+(C=75 M=90 Y=0 K=0) Pc
+1 0 0.55 0 (Aqua) 0 x
+(Aqua) Pc
+1 0.5 0 0 (Blue) 0 x
+(Blue) Pc
+0.5 0.4 0.3 0 (Blue Gray) 0 x
+(Blue Gray) Pc
+0.8 0.05 0 0 (Blue Sky) 0 x
+(Blue Sky) Pc
+0.5 0.85 1 0 (Brown) 0 x
+(Brown) Pc
+1 0.9 0.1 0 (Dark Blue) 0 x
+(Dark Blue) Pc
+1 0.55 1 0 (Forest Green) 0 x
+(Forest Green) Pc
+0.05 0.2 0.95 0 (Gold) 0 x
+(Gold) Pc
+0.75 0.05 1 0 (Grass Green) 0 x
+(Grass Green) Pc
+0 0.45 1 0 (Orange) 0 x
+(Orange) Pc
+0.15 1 1 0 (Red) 0 x
+(Red) Pc
+0.45 0.9 0 0 (Violet) 0 x
+(Violet) Pc
+Bb
+2 (Black, White) -4014 4716 0 0 1 0 0 1 0 0 Bg
+0 BB
+(Black, White) Pc
+Bb
+2 (Chrome) -4014 4716 0 0 1 0 0 1 0 0 Bg
+0 BB
+(Chrome) Pc
+Bb
+2 (Green, Blue) -4014 4716 0 0 1 0 0 1 0 0 Bg
+0 BB
+(Green, Blue) Pc
+Bb
+2 (Orange, Green, Violet) -4014 4716 0 0 1 0 0 1 0 0 Bg
+0 BB
+(Orange, Green, Violet) Pc
+Bb
+2 (Pink, Yellow, Green ) -4014 4716 0 0 1 0 0 1 0 0 Bg
+0 BB
+(Pink, Yellow, Green ) Pc
+Bb
+2 (Purple, Red, Yellow) -4014 4716 0 0 1 0 0 1 0 0 Bg
+0 BB
+(Purple, Red, Yellow) Pc
+Bb
+2 (Rainbow) -4014 4716 0 0 1 0 0 1 0 0 Bg
+0 BB
+(Rainbow) Pc
+Bb
+2 (Steel Bar) -4014 4716 0 0 1 0 0 1 0 0 Bg
+0 BB
+(Steel Bar) Pc
+Bb
+0 0 0 0 Bh
+2 (White & Red Radial) -4014 4716 0 0 1 0 0 1 0 0 Bg
+0 BB
+(White & Red Radial) Pc
+Bb
+0 0 0 0 Bh
+2 (Yellow & Orange Radial) -4014 4716 0 0 1 0 0 1 0 0 Bg
+0 BB
+(Yellow & Orange Radial) Pc
+Bb
+0 0 0 0 Bh
+2 (Yellow & Purple Radial) -4014 4716 0 0 1 0 0 1 0 0 Bg
+0 BB
+(Yellow & Purple Radial) Pc
+Bb
+2 (Yellow, Violet, Orange, Blue) -4014 4716 0 0 1 0 0 1 0 0 Bg
+0 BB
+(Yellow, Violet, Orange, Blue) Pc
+(Arrow1.2.out/in) 0 0 1 1 0 0 0 0 0 [1 0 0 1 0 0] p
+(Arrow1.2.out/in) Pc
+(Arrow1.2.side) 0 0 1 1 0 0 0 0 0 [1 0 0 1 0 0] p
+(Arrow1.2.side) Pc
+(Bricks) 0 0 1 1 0 0 0 0 0 [1 0 0 1 0 0] p
+(Bricks) Pc
+(Checks) 0 0 1 1 0 0 0 0 0 [1 0 0 1 0 0] p
+(Checks) Pc
+(Confetti) 0 0 1 1 0 0 0 0 0 [1 0 0 1 0 0] p
+(Confetti) Pc
+(DblLine1.2.inner) 0 0 1 1 0 0 0 0 0 [1 0 0 1 0 0] p
+(DblLine1.2.inner) Pc
+(DblLine1.2.outer) 0 0 1 1 0 0 0 0 0 [1 0 0 1 0 0] p
+(DblLine1.2.outer) Pc
+(DblLine1.2.side) 0 0 1 1 0 0 0 0 0 [1 0 0 1 0 0] p
+(DblLine1.2.side) Pc
+(Diamonds) 0 0 1 1 0 0 0 0 0 [1 0 0 1 0 0] p
+(Diamonds) Pc
+(Hexagon) 0 0 1 1 0 0 0 0 0 [1 0 0 1 0 0] p
+(Hexagon) Pc
+(Laurel.inner) 0 0 1 1 0 0 0 0 0 [1 0 0 1 0 0] p
+(Laurel.inner) Pc
+(Laurel.outer) 0 0 1 1 0 0 0 0 0 [1 0 0 1 0 0] p
+(Laurel.outer) Pc
+(Laurel.side) 0 0 1 1 0 0 0 0 0 [1 0 0 1 0 0] p
+(Laurel.side) Pc
+(Leaves-fall) 0 0 1 1 0 0 0 0 0 [1 0 0 1 0 0] p
+(Leaves-fall) Pc
+(Polka dots) 0 0 1 1 0 0 0 0 0 [1 0 0 1 0 0] p
+(Polka dots) Pc
+(Random circles) 0 0 1 1 0 0 0 0 0 [1 0 0 1 0 0] p
+(Random circles) Pc
+(Rope.side) 0 0 1 1 0 0 0 0 0 [1 0 0 1 0 0] p
+(Rope.side) Pc
+(Scales) 0 0 1 1 0 0 0 0 0 [1 0 0 1 0 0] p
+(Scales) Pc
+(SolidStar.side) 0 0 1 1 0 0 0 0 0 [1 0 0 1 0 0] p
+(SolidStar.side) Pc
+(Stars) 0 0 1 1 0 0 0 0 0 [1 0 0 1 0 0] p
+(Stars) Pc
+(Stripes) 0 0 1 1 0 0 0 0 0 [1 0 0 1 0 0] p
+(Stripes) Pc
+(TriBevel.outer) 0 0 1 1 0 0 0 0 0 [1 0 0 1 0 0] p
+(TriBevel.outer) Pc
+(TriBevel.side) 0 0 1 1 0 0 0 0 0 [1 0 0 1 0 0] p
+(TriBevel.side) Pc
+(Waves-scroll) 0 0 1 1 0 0 0 0 0 [1 0 0 1 0 0] p
+(Waves-scroll) Pc
+PB
+%AI5_EndPalette
+%%EndSetup
+%AI5_BeginLayer
+1 1 1 1 0 0 0 79 128 255 Lb
+(Layer 1) Ln
+0 A
+u
+1 Ap
+0 O
+0 0 0 0 k
+800 Ar
+0 J 0 j 1 w 4 M []0 d
+%AI3_Note:
+0 D
+0 XR
+356.6667 387.5 m
+356.6667 419.1667 L
+247.1666 419.1667 L
+247.1666 387.5 L
+356.6667 387.5 L
+f
+u
+u
+u
+u
+u
+0 Ap
+0 g
+0.1417 w
+349.9796 400.7243 m
+349.5877 401.2344 L
+346.0138 401.2344 L
+346.0883 400.7243 L
+349.9796 400.7243 L
+f
+351.0435 399.3254 m
+350.64 399.8521 L
+346.2172 399.8521 L
+346.3082 399.3254 L
+351.0435 399.3254 L
+f
+352.0889 397.9355 m
+351.6969 398.4622 L
+346.4256 398.4622 L
+346.5001 397.9355 L
+352.0889 397.9355 L
+f
+353.1499 396.5473 m
+352.8027 397.0657 L
+346.6389 397.0657 L
+346.7084 396.5473 L
+353.1499 396.5473 L
+f
+354.1924 395.1701 m
+353.8401 395.673 L
+346.8076 395.673 L
+346.897 395.1701 L
+354.1924 395.1701 L
+f
+U
+U
+u
+u
+u
+0.1362 w
+261.2735 405.9461 m
+264.2217 405.9461 266.6112 403.5556 266.6112 400.6074 c
+266.6112 397.6591 264.2217 395.2686 261.2735 395.2686 c
+258.3253 395.2686 255.9348 397.6591 255.9348 400.6074 c
+255.9348 403.5556 258.3253 405.9461 261.2735 405.9461 c
+f
+261.2735 400.6074 m
+F
+U
+0.1417 w
+263.2787 406.4807 m
+265.6917 405.6403 267.4239 403.3457 267.4239 400.6461 c
+267.4239 397.235 264.6593 394.4703 261.2481 394.4703 c
+257.8379 394.4703 255.0721 397.235 255.0721 400.6461 c
+255.0721 403.7848 257.4809 406.1287 260.1353 406.671 C
+260.1353 411.5726 L
+254.6579 410.9711 250.3076 406.3287 250.3076 400.6909 c
+250.3076 394.6447 255.2093 389.743 261.2555 389.743 c
+267.3008 389.743 272.2025 394.6447 272.2025 400.6909 c
+272.2025 405.9351 268.4668 410.3181 263.5435 411.3879 C
+263.5435 412.4271 l
+259.8638 409.0598 l
+263.2787 405.3026 l
+263.2787 406.4807 l
+f
+267.7419 408.8471 m
+267.7419 413.7097 L
+266.3056 413.7097 l
+269.9043 417.257 l
+273.4301 413.7097 l
+272.1904 413.7097 L
+272.1904 400.5408 l
+F
+U
+U
+u
+u
+344.9476 395.1483 m
+345.2948 393.0208 L
+345.5763 391.6104 346.3665 391.1944 346.4113 391.1775 C
+346.4113 391.0357 L
+337.5144 391.0357 l
+337.5144 391.1775 L
+338.1526 391.1775 338.3296 391.7801 338.2588 392.1346 C
+337.8611 395.1481 L
+344.9476 395.1483 L
+f
+U
+u
+330.1397 395.1447 m
+328.9907 393.0208 L
+328.3882 391.8865 328.6539 391.4612 329.4337 391.1775 C
+329.4337 391.0357 L
+321.2105 391.0357 l
+321.2105 391.1775 L
+321.8485 391.1775 322.6106 392.1878 323.284 393.3574 C
+324.3294 395.1477 L
+330.1397 395.1447 L
+f
+U
+u
+327.843 401.2529 m
+333.8467 411.6119 L
+334.1331 412.1072 334.6648 412.9541 333.3683 413.4728 C
+333.3683 413.5967 l
+341.9628 413.5967 L
+343.9642 401.254 L
+337.0643 401.2535 L
+336.3448 406.7204 l
+333.4007 401.2525 L
+327.843 401.2529 L
+f
+U
+u
+344.2004 399.8667 m
+344.0449 400.7109 L
+327.5394 400.7109 L
+327.0498 399.8667 L
+344.2004 399.8667 L
+f
+U
+u
+344.4022 398.4775 m
+344.283 399.3217 L
+326.7356 399.3217 L
+326.2295 398.4775 L
+344.4022 398.4775 L
+f
+U
+u
+344.6403 397.0883 m
+344.5179 397.9324 L
+325.9584 397.9324 L
+325.4258 397.0883 L
+344.6403 397.0883 L
+f
+U
+u
+344.8586 395.6991 m
+344.7395 396.5433 L
+325.1281 396.5433 L
+324.632 395.6991 L
+344.8586 395.6991 L
+f
+U
+U
+u
+u
+295.6383 401.2527 m
+297.8343 411.6119 L
+297.8977 411.9132 298.2848 413.1005 297.3557 413.4728 C
+297.3557 413.5967 l
+306.3486 413.5967 L
+306.3486 413.455 L
+305.7814 413.2423 305.1266 412.2144 304.9848 411.3992 C
+302.9603 401.2549 L
+295.6383 401.2527 L
+f
+U
+300.9135 391.0231 m
+291.8972 391.0357 L
+291.8972 391.1775 L
+292.5351 391.1775 293.2972 392.1878 293.9707 393.3574 C
+294.3531 395.148 L
+301.7499 395.1638 L
+300.9135 391.0396 L
+300.9135 391.0231 L
+f
+u
+302.6821 399.8667 m
+302.8608 400.7109 L
+295.5287 400.7109 L
+295.3451 399.8667 L
+302.6821 399.8667 L
+f
+U
+u
+302.4043 398.4775 m
+302.5828 399.3217 L
+295.236 399.3217 L
+295.0524 398.4775 L
+302.4043 398.4775 L
+f
+U
+u
+302.1314 397.0883 m
+302.305 397.9324 L
+294.9433 397.9324 L
+294.7547 397.0883 L
+302.1314 397.0883 L
+f
+U
+u
+301.8371 395.6991 m
+302.0272 396.5433 L
+294.6505 396.5433 L
+294.4454 395.6991 L
+301.8371 395.6991 L
+f
+U
+U
+u
+u
+u
+324.11 395.1483 m
+324.4572 393.0208 L
+324.7389 391.6104 325.529 391.1944 325.5738 391.1775 C
+325.5738 391.0357 L
+316.6769 391.0357 l
+316.6769 391.1775 L
+317.3151 391.1775 317.4922 391.7801 317.4212 392.1346 C
+317.0237 395.1481 L
+324.11 395.1483 L
+f
+U
+u
+300.5942 391.0421 m
+303.0951 395.1477 L
+309.3023 395.1447 L
+308.1532 393.0208 L
+307.5507 391.8865 307.8165 391.4612 308.5963 391.1775 C
+308.4584 391.022 L
+300.5657 391.022 L
+300.5942 391.0421 L
+f
+U
+u
+306.774 401.2529 m
+313.0093 411.6119 L
+313.2957 412.1072 313.8273 412.9541 312.5308 413.4728 C
+312.5308 413.5967 l
+321.1253 413.5967 L
+323.1267 401.254 L
+316.2268 401.2535 L
+315.5073 406.7204 l
+312.5632 401.2525 L
+306.774 401.2529 L
+f
+U
+u
+323.3629 399.8667 m
+323.2074 400.7109 L
+306.4373 400.7109 L
+305.9477 399.8667 L
+323.3629 399.8667 L
+f
+U
+u
+323.5646 398.4775 m
+323.4456 399.3217 L
+305.5674 399.3217 L
+305.0613 398.4775 L
+323.5646 398.4775 L
+f
+U
+u
+323.8028 397.0883 m
+323.6805 397.9324 L
+304.757 397.9324 L
+304.2245 397.0883 L
+323.8028 397.0883 L
+f
+U
+u
+324.0211 395.6991 m
+323.9021 396.5433 L
+303.9268 396.5433 L
+303.4307 395.6991 L
+324.0211 395.6991 L
+f
+U
+U
+U
+u
+u
+u
+293.9453 395.1483 m
+294.2925 393.0208 L
+294.5741 391.6104 295.3643 391.1944 295.4091 391.1775 C
+295.4091 391.0357 L
+286.5122 391.0357 l
+286.5122 391.1775 L
+287.1503 391.1775 287.3274 391.7801 287.2566 392.1346 C
+286.8589 395.1481 L
+293.9453 395.1483 L
+f
+U
+u
+279.1375 395.1447 m
+277.9885 393.0208 L
+277.386 391.8865 277.6517 391.4612 278.4315 391.1775 C
+278.4315 391.0357 L
+270.2083 391.0357 l
+270.2083 391.1775 L
+270.8463 391.1775 271.6083 392.1878 272.2817 393.3574 C
+273.3272 395.1477 L
+279.1375 395.1447 L
+f
+U
+u
+276.8408 401.2529 m
+282.8445 411.6119 L
+283.1309 412.1072 283.6625 412.9541 282.3661 413.4728 C
+282.3661 413.5967 l
+290.9606 413.5967 L
+292.9619 401.254 L
+286.0621 401.2535 L
+285.3425 406.7204 l
+282.3985 401.2525 L
+276.8408 401.2529 L
+f
+U
+u
+293.1982 399.8667 m
+293.0427 400.7109 L
+276.5371 400.7109 L
+276.0476 399.8667 L
+293.1982 399.8667 L
+f
+U
+u
+293.4 398.4775 m
+293.2808 399.3217 L
+275.7334 399.3217 L
+275.2273 398.4775 L
+293.4 398.4775 L
+f
+U
+u
+293.638 397.0883 m
+293.5157 397.9324 L
+274.9561 397.9324 L
+274.4235 397.0883 L
+293.638 397.0883 L
+f
+U
+u
+293.8564 395.6991 m
+293.7373 396.5433 L
+274.1259 396.5433 L
+273.6297 395.6991 L
+293.8564 395.6991 L
+f
+U
+U
+U
+U
+U
+U
+U
+LB
+%AI5_EndLayer--
+%%PageTrailer
+gsave annotatepage grestore showpage
+%%Trailer
+Adobe_Illustrator_AI5 /terminate get exec
+Adobe_ColorImage_AI6 /terminate get exec
+Adobe_cshow /terminate get exec
+Adobe_level2_AI5 /terminate get exec
+%%EOF
+
+%%EndDocument
+ @endspecial 417 773 a FE(AIAA)58 b(98\2260879)417 1022
+y FD(Sim)m(ulation)47 b(of)i(an)f(Aer)m(ospace)e(V)-9
+b(ehic)m(le)417 1230 y(Pitc)n(h-Over)48 b(Maneuver)417
+1421 y FC(William)31 b(L.)j(Kleb)417 1570 y FB(NASA)f(Langle)n(y)h
+(Research)h(Center)-6 b(,)35 b(Hampton,)h(V)-10 b(A)33
+b(23681)417 1761 y FC(A.)g(N.)h(A)l(uthor)68 b(and)35
+b(Y)-17 b(.)33 b(F)-18 b(.)34 b(Another)r(longer)s(name)417
+1911 y FB(Someother)h(Af\003iation,)f(Ato)n(wn,)h(ST)e(98293)432
+4405 y @beginspecial 144 @llx 367 @lly 488 @urx 602 @ury
+3600 @rwi 2459 @rhi @setspecial
+%%BeginDocument: smpfig.eps
+%!PS-Adobe-2.0 EPSF-1.2
+%%Creator:Adobe Illustrator(TM) 1.1
+%%For: (RICHARD A WHELESS) (NASA LANGLEY)
+%%Title: (EPS)
+%%CreationDate: (2/9/99) (3:01 PM)
+%%DocumentProcessColors: Black
+%%DocumentFonts: Courier-Bold
+%%DocumentProcSets: Adobe_Illustrator_1.1 0 0
+%%BoundingBox:144 367 488 602
+%%ColorUsage: Black&White
+%AI3_IncludePlacedImages
+%%TemplateBox:306 396 306 396
+%%TileBox: 30 31 582 761
+%%DocumentPreview: Header
+%%EndComments
+%%BeginProcSet:Adobe_Illustrator_1.1 0 0
+/Adobe_Illustrator_1.1 dup 100 dict def load begin
+/Version 0 def
+/Revision 0 def
+/bdef {bind def} bind def
+/ldef {load def} bdef
+/xdef {exch def} bdef
+/_K {3 index add neg dup 0 lt {pop 0} if 3 1 roll} bdef
+/_k /setcmybcolor where 
+{/setcmybcolor get} {{1 sub 4 1 roll _K _K _K setrgbcolor pop} bind} ifelse def
+/g {/_b xdef /p {_b setgray} def} bdef
+/G {/_B xdef /P {_B setgray} def} bdef
+/k {/_b xdef /_y xdef /_m xdef /_c xdef /p {_c _m _y _b _k} def} bdef
+/K {/_B xdef /_Y xdef /_M xdef /_C xdef /P {_C _M _Y _B _k} def} bdef
+/d /setdash ldef
+/_i currentflat def
+/i {dup 0 eq {pop _i} if setflat} bdef
+/j /setlinejoin ldef
+/J /setlinecap ldef
+/M /setmiterlimit ldef
+/w /setlinewidth ldef
+/_R {.25 sub round .25 add} bdef
+/_r {transform _R exch _R exch itransform} bdef
+/c {_r curveto} bdef
+/C /c ldef
+/v {currentpoint 6 2 roll _r curveto} bdef
+/V /v ldef
+/y {_r 2 copy curveto} bdef
+/Y /y ldef
+/l {_r lineto} bdef
+/L /l ldef
+/m {_r moveto} bdef
+/_e [] def
+/_E {_e length 0 ne {gsave 0 g 0 G 0 i 0 J 0 j 1 w 10 M [] 0 d
+/Courier 20 0 0 1 z [0.966 0.259 -0.259 0.966
+_e 0 get _e 2 get add 2 div _e 1 get _e 3 get add 2 div] e _f t T grestore} if} bdef
+/_fill {{fill} stopped
+{/_e [pathbbox] def /_f (ERROR: can't fill, increase flatness) def n _E} if} bdef
+/_stroke {{stroke} stopped
+{/_e [pathbbox] def /_f (ERROR: can't stroke, increase flatness) def n _E} if} bdef
+/n /newpath ldef
+/N /n ldef
+/F {p _fill} bdef
+/f {closepath F} bdef
+/S {P _stroke} bdef
+/s {closepath S} bdef
+/B {gsave F grestore S} bdef
+/b {closepath B} bdef
+/_s /ashow ldef
+/_S {(?) exch {2 copy 0 exch put pop dup false charpath currentpoint _g setmatrix
+_stroke _G setmatrix moveto 3 copy pop rmoveto} forall pop pop pop n} bdef
+/_A {_a moveto _t exch 0 exch} bdef
+/_L {0 _l neg translate _G currentmatrix pop} bdef
+/_w {dup stringwidth exch 3 -1 roll length 1 sub _t mul add exch} bdef
+/_z [{0 0} bind {dup _w exch neg 2 div exch neg 2 div} bind {dup _w exch neg exch neg} bind] def
+/z {_z exch get /_a xdef /_t xdef /_l xdef exch findfont exch scalefont setfont} bdef
+/_g matrix def
+/_G matrix def
+/_D {_g currentmatrix pop gsave concat _G currentmatrix pop} bdef
+/e {_D p /t {_A _s _L} def} bdef
+/r {_D P /t {_A _S _L} def} bdef
+/a {_D /t {dup p _A _s P _A _S _L} def} bdef
+/o {_D /t {pop _L} def} bdef
+/T {grestore} bdef
+/u {} bdef
+/U {} bdef
+/Z {findfont begin currentdict dup length dict begin
+{1 index /FID ne {def} {pop pop} ifelse} forall /FontName exch def dup length 0 ne
+{/Encoding Encoding 256 array copy def 0 exch {dup type /nametype eq
+{Encoding 2 index 2 index put pop 1 add} {exch pop} ifelse} forall} if pop
+currentdict dup end end /FontName get exch definefont pop} bdef
+end
+%%EndProcSet
+%%EndProlog
+%%BeginSetup
+Adobe_Illustrator_1.1 begin
+n
+%%BeginEncoding: _Courier-Bold Courier-Bold
+[39/quotesingle 96/grave 128/Adieresis/Aring/Ccedilla/Eacute/Ntilde/Odieresis
+/Udieresis/aacute/agrave/acircumflex/adieresis/atilde/aring/ccedilla/eacute
+/egrave/ecircumflex/edieresis/iacute/igrave/icircumflex/idieresis/ntilde
+/oacute/ograve/ocircumflex/odieresis/otilde/uacute/ugrave/ucircumflex
+/udieresis/dagger/degree/cent/sterling/section/bullet/paragraph/germandbls
+/registered/copyright/trademark/acute/dieresis/.notdef/AE/Oslash
+/.notdef/plusminus/.notdef/.notdef/yen/mu/.notdef/.notdef
+/.notdef/.notdef/.notdef/ordfeminine/ordmasculine/.notdef/ae/oslash
+/questiondown/exclamdown/logicalnot/.notdef/florin/.notdef/.notdef
+/guillemotleft/guillemotright/ellipsis/.notdef/Agrave/Atilde/Otilde/OE/oe
+/endash/emdash/quotedblleft/quotedblright/quoteleft/quoteright/divide
+/.notdef/ydieresis/Ydieresis/fraction/currency/guilsinglleft/guilsinglright
+/fi/fl/daggerdbl/periodcentered/quotesinglbase/quotedblbase/perthousand
+/Acircumflex/Ecircumflex/Aacute/Edieresis/Egrave/Iacute/Icircumflex
+/Idieresis/Igrave/Oacute/Ocircumflex/.notdef/Ograve/Uacute/Ucircumflex
+/Ugrave/dotlessi/circumflex/tilde/macron/breve/dotaccent/ring/cedilla
+/hungarumlaut/ogonek/caron
+]/_Courier-Bold/Courier-Bold Z
+%%EndEncoding
+%%EndSetup
+0 0 0 0 k
+0 0 0 1 K
+0 i
+0 J 0 j 1 w 4 M []0 d
+%%Note:
+487.5 367.5 m
+487.5 601.5 L
+145.5 601.5 L
+145.5 367.5 L
+487.5 367.5 L
+b
+145.5 601.5 m
+487 368 l
+B
+487 601.5 m
+145 368 l
+B
+0.5 w
+450.5 478 m
+450.5 494 L
+182 494 L
+182 478 L
+450.5 478 L
+b
+u
+0 0 0 1 k
+1 w
+/_Courier-Bold 12 14.5 0 0 z
+[1 0 0 1 187.402 482]e
+(Encapsulated Postscript \(EPS\) Figure)t
+T
+U
+%%PageTrailer
+%%Trailer
+_E end
+%%EOF
+
+%%EndDocument
+ @endspecial 407 4854 a FE(36th)57 b(AIAA)h(Aer)l(ospace)g(Sciences)956
+5103 y(Meeting)g(and)g(Exhibit)445 5352 y(Jan)n(uar)r(y)g(12\22615,)f
+(1998/Reno,)h(NV)-336 5641 y FA(For)23 b(permission)g(to)f(cop)o(y)h
+(or)g(repub)o(lish,)g(contact)f(the)h(American)g(Institute)f(of)h(Aer)n
+(onautics)g(and)f(Astr)n(onautics)-336 5741 y(1801)i(Ale)o(xander)f
+(Bell)g(Drive)q(,)h(Suite)f(500,)g(Reston,)g(V)-7 b(A)24
+b(20191\2264344)p eop
+%%Page: 1 2
+1 1 bop 412 -69 a Fz(Sim)-5 b(ulation)65 b(of)f(an)h(Aerospace)h(V)-16
+b(ehicle)991 139 y(Pitc)-5 b(h-Ov)g(er)66 b(Maneuv)-5
+b(er)1563 379 y Fy(William)28 b(L.)k(Kleb)2255 343 y
+Fx(\003)761 496 y Fw(NASA)k(L)-5 b(angley)35 b(R)-5 b(ese)g(ar)g(ch)34
+b(Center,)g(Hampton,)h(V)-10 b(A)35 b(23681)949 654 y
+Fy(A.)e(N.)f(Author)1520 618 y Fx(y)1586 654 y Fy(and)g(Y.)h(F.)f
+(Anotherlongername)2869 618 y Fx(y)1062 771 y Fw(Some)-5
+b(other)34 b(A\017iation,)h(A)n(town,)g(ST)f(98293)458
+943 y Fv(Note:)41 b(this)30 b(abstr)l(act)h(do)l(es)h(not)e(app)l(e)l
+(ar)i(when)f(a)g(journal)g(note)f(simulation)g(is)g(the)h(chosen)h
+(option.)334 1022 y Fu(The)g(ob)5 b(jectiv)n(e)31 b(of)g(the)h(presen)n
+(t)g(w)n(ork)f(is)h(to)f(summarize)e(the)j(application)e(of)i(unsteady)
+g(compu-)334 1101 y(tational)j(\015uid)k(dynamic)d(metho)r(ds)i(to)f
+(the)h(problem)f(of)g(predicting)h(v)n(erticle)f(tak)n(e-o\013/v)n
+(ertical)334 1179 y(landing)24 b(v)n(ehicle)i(aero)r(dynamics)d(during)
+i(an)h(un-p)r(o)n(w)n(ered)g(pitc)n(h-o)n(v)n(er)e(maneuv)n(er.)34
+b(In)26 b(addition)e(to)334 1258 y(the)31 b(time-dep)r(enden)n(t)f(sim)
+n(ulation)e(of)i(a)g(pitc)n(h-o)n(v)n(er)g(maneuv)n(er,)f(a)i(series)f
+(of)h(steady)f(solutions)g(at)334 1337 y(discrete)24
+b(p)r(oin)n(ts)g(are)g(also)f(computed)h(for)g(comparison)e(with)h
+(wind-tunnel)i(measuremen)n(ts)d(and)i(as)334 1416 y(a)29
+b(means)g(of)h(quan)n(tifying)e(unsteady)i(e\013ects.)45
+b(As)30 b(this)g(application)e(represen)n(ts)i(a)f(new)h(c)n(hallenge)
+334 1495 y(to)f(unsteady)i(computational)c(\015uid)j(dynamics,)f
+(observ)-5 b(ations)30 b(concerning)g(grid)f(resolution,)h(far-)334
+1574 y(\014eld)d(b)r(oundary)g(placemen)n(t,)e(temp)r(oral)g
+(resolution,)g(and)i(the)h(suitabilit)n(y)c(of)j(assuming)e(\015o)n
+(w-\014eld)334 1653 y(symmetry)f(are)j(discussed.)514
+1915 y Ft(Nomenclature)-116 2036 y Fs(c)324 b Fr(Sound)27
+b(sp)r(eed,)h(m/s)-116 2136 y Fs(M)279 b Fr(Mac)n(h)27
+b(n)n(um)n(b)r(er)-116 2236 y Fs(P)307 b Fr(Pressure,)25
+b(P)n(a)-116 2335 y Fs(R)q(e)-13 2347 y Fq(s)244 2335
+y Fr(Reynolds)i(n)n(um)n(b)r(er)g(based)g(on)g(length)h
+Fs(s)-116 2435 y(T)311 b Fr(T)-7 b(emp)r(erature,)27
+b(K)-116 2535 y Fs(V)312 b Fr(V)-7 b(elo)r(cit)n(y)g(,)27
+b(m/s)-116 2634 y Fs(x;)14 b(y)s(;)g(z)156 b Fr(Cartesian)26
+b(b)r(o)r(dy)i(axes,)e(m)-116 2734 y Fs(\013)307 b Fr(Angle)27
+b(of)h(attac)n(k,)e(deg)-116 2833 y Fs(\021)319 b Fr(W)-7
+b(all-normal)26 b(distance,)h(m)-116 2933 y Fs(\032)317
+b Fr(Densit)n(y)-7 b(,)27 b(kg/m)760 2903 y Fp(3)-116
+3124 y Fo(Subscripts)-116 3246 y Fs(tr)r(an)197 b Fr(T)-7
+b(ransition)-116 3346 y Fs(w)301 b Fr(W)-7 b(all)-116
+3445 y Fn(1)277 b Fr(F)-7 b(reestream)-116 3637 y Fo(Sup)r(erscripts)
+-116 3758 y Fr(0)318 b(Fiduciary)27 b(p)r(oin)n(t)-116
+3858 y Fs(n)5 b Fr(+)g(1)193 b(Time)27 b(lev)n(el)550
+4074 y Ft(In)m(tro)s(duction)-116 4295 y Fm(N)89 4196
+y Fr(ASA'S)i(Access)e(to)h(Space)g(Study)1176 4166 y
+Fp(1)1242 4196 y Fr(recommends)f(the)89 4295 y(dev)n(elopmen)n(t)34
+b(of)h(a)g Fl(ful)t(ly)h Fr(reusable)e(launc)n(h)g(v)n(ehicle)1797
+4265 y Fp(2)-116 4395 y Fr(to)40 b(replace)f(the)i(aged)e(Space)h(Sh)n
+(uttle.)75 b Fl(The)42 b Fk(\\dropword)-116 4495 y Fl(c)l(ommand)33
+b(cr)l(e)l(ate)l(d)g(the)f(hanging)i(c)l(apital)g(letter)e(and)h(auto-)
+-116 4594 y(matic)l(al)t(ly)28 b(c)l(apitalizes)g(the)f(r)l(est)f(of)h
+(the)f(wor)l(d.)37 b Fr(A)24 b(metho)r(d)h(of)-116 4694
+y(reac)n(hing)17 b(this)i(goal)f(is)g(to)h(dev)n(elop)f(a)g(v)n(ehicle)
+h(whic)n(h)f(do)r(es)h(not)p -116 4780 780 4 v -25 4834
+a Fj(\003)11 4857 y Fi(Researc)n(h)46 b(Engineer,)k(Aerothermo)r
+(dynamics)44 b(Branc)n(h,)50 b(Aero-)-116 4936 y(and)24
+b(Gas-Dynamics)f(Division,)f(Researc)n(h)j(and)f(T)-6
+b(ec)n(hnology)25 b(Group.)-22 4994 y Fj(y)11 5018 y
+Fi(Deligen)n(t)f(w)n(ork)n(er,)f(AIAA)h(mem)n(b)r(er.)11
+5096 y Fp(Cop)n(yrigh)n(t)334 5094 y(c)315 5096 y Fh(\015)16
+b Fp(1999)h(b)n(y)e(the)g(American)f(Institute)h(of)g(Aeronautics)f
+(and)-116 5163 y(Astronautics,)32 b(Inc.)53 b(No)31 b(cop)n(yrigh)n(t)e
+(is)i(asserted)f(in)g(the)g(United)f(States)-116 5229
+y(under)f(Title)i(17,)i(U.S.)d(Co)r(de.)53 b(The)29 b(U.S.)h(Go)n(v)n
+(ernmen)n(t)f(has)h(a)g(ro)n(y)n(alt)n(y-)-116 5296 y(free)19
+b(license)g(to)i(exercise)e(all)i(righ)n(ts)g(under)f(the)g(cop)n
+(yrigh)n(t)g(claimed)f(herein)-116 5362 y(for)30 b(Go)n(v)n(ernmen)n
+(tal)f(Purp)r(oses.)52 b(All)30 b(other)f(righ)n(ts)i(are)f(reserv)n
+(ed)f(b)n(y)h(the)-116 5428 y(cop)n(yrigh)n(t)21 b(o)n(wner.)1984
+3164 y @beginspecial 144 @llx 367 @lly 488 @urx 602 @ury
+2340 @rwi @setspecial
+%%BeginDocument: smpfig.eps
+%!PS-Adobe-2.0 EPSF-1.2
+%%Creator:Adobe Illustrator(TM) 1.1
+%%For: (RICHARD A WHELESS) (NASA LANGLEY)
+%%Title: (EPS)
+%%CreationDate: (2/9/99) (3:01 PM)
+%%DocumentProcessColors: Black
+%%DocumentFonts: Courier-Bold
+%%DocumentProcSets: Adobe_Illustrator_1.1 0 0
+%%BoundingBox:144 367 488 602
+%%ColorUsage: Black&White
+%AI3_IncludePlacedImages
+%%TemplateBox:306 396 306 396
+%%TileBox: 30 31 582 761
+%%DocumentPreview: Header
+%%EndComments
+%%BeginProcSet:Adobe_Illustrator_1.1 0 0
+/Adobe_Illustrator_1.1 dup 100 dict def load begin
+/Version 0 def
+/Revision 0 def
+/bdef {bind def} bind def
+/ldef {load def} bdef
+/xdef {exch def} bdef
+/_K {3 index add neg dup 0 lt {pop 0} if 3 1 roll} bdef
+/_k /setcmybcolor where 
+{/setcmybcolor get} {{1 sub 4 1 roll _K _K _K setrgbcolor pop} bind} ifelse def
+/g {/_b xdef /p {_b setgray} def} bdef
+/G {/_B xdef /P {_B setgray} def} bdef
+/k {/_b xdef /_y xdef /_m xdef /_c xdef /p {_c _m _y _b _k} def} bdef
+/K {/_B xdef /_Y xdef /_M xdef /_C xdef /P {_C _M _Y _B _k} def} bdef
+/d /setdash ldef
+/_i currentflat def
+/i {dup 0 eq {pop _i} if setflat} bdef
+/j /setlinejoin ldef
+/J /setlinecap ldef
+/M /setmiterlimit ldef
+/w /setlinewidth ldef
+/_R {.25 sub round .25 add} bdef
+/_r {transform _R exch _R exch itransform} bdef
+/c {_r curveto} bdef
+/C /c ldef
+/v {currentpoint 6 2 roll _r curveto} bdef
+/V /v ldef
+/y {_r 2 copy curveto} bdef
+/Y /y ldef
+/l {_r lineto} bdef
+/L /l ldef
+/m {_r moveto} bdef
+/_e [] def
+/_E {_e length 0 ne {gsave 0 g 0 G 0 i 0 J 0 j 1 w 10 M [] 0 d
+/Courier 20 0 0 1 z [0.966 0.259 -0.259 0.966
+_e 0 get _e 2 get add 2 div _e 1 get _e 3 get add 2 div] e _f t T grestore} if} bdef
+/_fill {{fill} stopped
+{/_e [pathbbox] def /_f (ERROR: can't fill, increase flatness) def n _E} if} bdef
+/_stroke {{stroke} stopped
+{/_e [pathbbox] def /_f (ERROR: can't stroke, increase flatness) def n _E} if} bdef
+/n /newpath ldef
+/N /n ldef
+/F {p _fill} bdef
+/f {closepath F} bdef
+/S {P _stroke} bdef
+/s {closepath S} bdef
+/B {gsave F grestore S} bdef
+/b {closepath B} bdef
+/_s /ashow ldef
+/_S {(?) exch {2 copy 0 exch put pop dup false charpath currentpoint _g setmatrix
+_stroke _G setmatrix moveto 3 copy pop rmoveto} forall pop pop pop n} bdef
+/_A {_a moveto _t exch 0 exch} bdef
+/_L {0 _l neg translate _G currentmatrix pop} bdef
+/_w {dup stringwidth exch 3 -1 roll length 1 sub _t mul add exch} bdef
+/_z [{0 0} bind {dup _w exch neg 2 div exch neg 2 div} bind {dup _w exch neg exch neg} bind] def
+/z {_z exch get /_a xdef /_t xdef /_l xdef exch findfont exch scalefont setfont} bdef
+/_g matrix def
+/_G matrix def
+/_D {_g currentmatrix pop gsave concat _G currentmatrix pop} bdef
+/e {_D p /t {_A _s _L} def} bdef
+/r {_D P /t {_A _S _L} def} bdef
+/a {_D /t {dup p _A _s P _A _S _L} def} bdef
+/o {_D /t {pop _L} def} bdef
+/T {grestore} bdef
+/u {} bdef
+/U {} bdef
+/Z {findfont begin currentdict dup length dict begin
+{1 index /FID ne {def} {pop pop} ifelse} forall /FontName exch def dup length 0 ne
+{/Encoding Encoding 256 array copy def 0 exch {dup type /nametype eq
+{Encoding 2 index 2 index put pop 1 add} {exch pop} ifelse} forall} if pop
+currentdict dup end end /FontName get exch definefont pop} bdef
+end
+%%EndProcSet
+%%EndProlog
+%%BeginSetup
+Adobe_Illustrator_1.1 begin
+n
+%%BeginEncoding: _Courier-Bold Courier-Bold
+[39/quotesingle 96/grave 128/Adieresis/Aring/Ccedilla/Eacute/Ntilde/Odieresis
+/Udieresis/aacute/agrave/acircumflex/adieresis/atilde/aring/ccedilla/eacute
+/egrave/ecircumflex/edieresis/iacute/igrave/icircumflex/idieresis/ntilde
+/oacute/ograve/ocircumflex/odieresis/otilde/uacute/ugrave/ucircumflex
+/udieresis/dagger/degree/cent/sterling/section/bullet/paragraph/germandbls
+/registered/copyright/trademark/acute/dieresis/.notdef/AE/Oslash
+/.notdef/plusminus/.notdef/.notdef/yen/mu/.notdef/.notdef
+/.notdef/.notdef/.notdef/ordfeminine/ordmasculine/.notdef/ae/oslash
+/questiondown/exclamdown/logicalnot/.notdef/florin/.notdef/.notdef
+/guillemotleft/guillemotright/ellipsis/.notdef/Agrave/Atilde/Otilde/OE/oe
+/endash/emdash/quotedblleft/quotedblright/quoteleft/quoteright/divide
+/.notdef/ydieresis/Ydieresis/fraction/currency/guilsinglleft/guilsinglright
+/fi/fl/daggerdbl/periodcentered/quotesinglbase/quotedblbase/perthousand
+/Acircumflex/Ecircumflex/Aacute/Edieresis/Egrave/Iacute/Icircumflex
+/Idieresis/Igrave/Oacute/Ocircumflex/.notdef/Ograve/Uacute/Ucircumflex
+/Ugrave/dotlessi/circumflex/tilde/macron/breve/dotaccent/ring/cedilla
+/hungarumlaut/ogonek/caron
+]/_Courier-Bold/Courier-Bold Z
+%%EndEncoding
+%%EndSetup
+0 0 0 0 k
+0 0 0 1 K
+0 i
+0 J 0 j 1 w 4 M []0 d
+%%Note:
+487.5 367.5 m
+487.5 601.5 L
+145.5 601.5 L
+145.5 367.5 L
+487.5 367.5 L
+b
+145.5 601.5 m
+487 368 l
+B
+487 601.5 m
+145 368 l
+B
+0.5 w
+450.5 478 m
+450.5 494 L
+182 494 L
+182 478 L
+450.5 478 L
+b
+u
+0 0 0 1 k
+1 w
+/_Courier-Bold 12 14.5 0 0 z
+[1 0 0 1 187.402 482]e
+(Encapsulated Postscript \(EPS\) Figure)t
+T
+U
+%%PageTrailer
+%%Trailer
+_E end
+%%EOF
+
+%%EndDocument
+ @endspecial 1994 3305 a Fo(Fig.)30 b(1)87 b(T)-7 b(ransition)30
+b(to)g(landing)i(for)e(a)f(VTVL)g(v)n(ehicle.)1984 3513
+y Fr(rely)34 b(on)h(exp)r(endable)g(b)r(o)r(osters)f(to)h(reac)n(h)f
+(orbit,)i(a)f(single-)1984 3613 y(stage-to-orbit)29 b(v)n(ehicle.)2773
+3583 y Fp(3)2860 3613 y Fr(One)i(suc)n(h)h(con\014guration)e(b)r(eing)
+1984 3713 y(in)n(v)n(estigated)18 b(is)h(a)h(V)-7 b(ertical)19
+b(T)-7 b(ak)n(e-o\013)18 b(and)h(V)-7 b(ertical)19 b(Landing)1984
+3812 y(\(VTVL\))36 b(concept.)2620 3782 y Fp(3)2715 3812
+y Fr(In)f(one)g(scenario,)g(the)g(VTVL)h(v)n(ehi-)1984
+3912 y(cle,)25 b(up)r(on)h(completion)e(of)h(its)g(mission)g(in)g(lo)n
+(w-Earth)e(orbit,)1984 4011 y(reen)n(ters)h(nose)g(\014rst,)i
+(decelerates)e(to)h(subsonic)g(sp)r(eeds,)h(and)1984
+4111 y(then)37 b(p)r(erforms)f(a)h(rotation)e(maneuv)n(er)3296
+4081 y Fp(4{)o(6)3435 4111 y Fr(to)i(land)g(v)n(erti-)1984
+4211 y(cally)-7 b(.)2067 4333 y(Figure)40 b(1)g(presen)n(ts)g(a)g(sc)n
+(hematic)g(of)g(the)h(last)f(p)r(ortion)1984 4432 y(of)c(a)f(t)n
+(ypical)h(VTVL)g(en)n(try)-7 b(.)62 b(The)36 b(pitc)n(h-o)n(v)n(er)e
+(maneuv)n(er,)1984 4532 y(whic)n(h)d(o)r(ccurs)f(near)g(Mac)n(h)g(0.2,)
+h(is)g(c)n(haracterized)d(b)n(y)j(high)1984 4631 y(angle)38
+b(of)g(attac)n(k,)j(unsteady)-7 b(,)42 b(v)n(ortical)37
+b(\015o)n(w.)69 b(Accurately)1984 4731 y(predicting)50
+b(v)n(ehicle)f(p)r(erformance)g(during)h(this)g(aero)r(dy-)1984
+4831 y(namic)21 b(pitc)n(h-o)n(v)n(er)f(maneuv)n(er)g(is)i(quite)g(c)n
+(hallenging.)33 b(While)1984 4930 y(ground-based)19 b(facilities)i(can)
+f(readily)g(predict)h(the)h(v)n(ehicle's)1984 5030 y(aero)r(dynamics)i
+(at)i(discrete)g(p)r(oin)n(ts)g(during)g(the)h(maneuv)n(er,)1984
+5130 y(sim)n(ulating)38 b(the)h(transien)n(t)f(motion)h(in)g(a)f(wind)h
+(tunnel)h(is)1984 5229 y(di\016cult.)2283 5199 y Fp(7)2359
+5229 y Fr(Time-dep)r(enden)n(t)e(Computational)f(Fluid)h(Dy-)1984
+5329 y(namics)33 b(\(CFD\))i(o\013ers)e(another)g(means)g(of)h
+(analyzing)e(the)1984 5428 y(pitc)n(h-o)n(v)n(er)40 b(maneuv)n(er.)78
+b(The)41 b(ma)5 b(jorit)n(y)41 b(of)h(w)n(ork)e(in)i(un-)1808
+5578 y Fg(1)25 b(of)g(5)p 1759 5642 300 2 v 737 5736
+a(American)g(Institute)h(of)f(Aer)o(ona)o(utics)f(and)h(Astr)o(ona)o
+(utics)h(P)-6 b(aper)25 b(98{0879)p eop
+%%Page: 2 3
+2 2 bop -116 -188 a Fr(steady)42 b(CFD)h(has,)k(ho)n(w)n(ev)n(er,)d(b)r
+(een)f(restricted)g(to)f(small)-116 -89 y(amplitude,)c(harmonic)c(v)-5
+b(ariations)35 b(in)h(angle)e(of)i(attac)n(k)f(in)-116
+11 y(supp)r(ort)27 b(of)h(aero)r(elastic)e(\015utter)i(predictions.)
+1370 -19 y Fp(8)-33 111 y Fr(The)33 b(ob)5 b(jectiv)n(e)31
+b(of)i(the)g(presen)n(t)f(w)n(ork)g(is)g(to)h(summarize)-116
+210 y(the)22 b(application)f(of)g(unsteady)g(CFD)i(metho)r(ds)e(to)h
+(the)g(prob-)-116 310 y(lem)30 b(of)f(predicting)h(VTVL)g(v)n(ehicle)f
+(aero)r(dynamics)f(during)-116 409 y(an)42 b(un-p)r(o)n(w)n(ered)g
+(pitc)n(h-o)n(v)n(er)f(maneuv)n(er)g(\(further)i(details)-116
+509 y(are)26 b(a)n(v)-5 b(ailable)25 b(in)i(the)h(companion)e
+(conference)g(pap)r(er)1629 479 y Fp(9)1666 509 y Fr(\).)37
+b(In)-116 609 y(addition)29 b(to)g(the)g(time-dep)r(enden)n(t)h(sim)n
+(ulation)e(of)h(a)g(pitc)n(h-)-116 708 y(o)n(v)n(er)c(maneuv)n(er,)i(a)
+f(series)h(of)g(steady)g(solutions)f(at)h(discrete)-116
+808 y(p)r(oin)n(ts)35 b(are)f(also)h(computed)g(for)g(comparison)f
+(with)i(wind-)-116 908 y(tunnel)h(measuremen)n(ts)e(and)h(as)g(a)g
+(means)g(of)g(quan)n(tifying)-116 1007 y(unsteady)26
+b(e\013ects.)37 b(As)27 b(this)h(application)e(represen)n(ts)f(a)i(new)
+-116 1107 y(c)n(hallenge)36 b(to)h(unsteady)g(CFD,)h(observ)-5
+b(ations)35 b(concerning)-116 1206 y(grid)30 b(resolution,)h
+(far-\014eld)f(b)r(oundary)g(placemen)n(t,)i(temp)r(o-)-116
+1306 y(ral)18 b(resolution,)i(and)e(the)i(suitabilit)n(y)f(of)g
+(assuming)f(\015o)n(w-\014eld)-116 1406 y(symmetry)27
+b(are)f(do)r(cumen)n(ted)i(in)g(Ref.)g(9.)615 1606 y
+Ft(Geometry)-33 1723 y Fr(The)23 b(v)n(ehicle's)g(fore)g(b)r(o)r(dy)h
+(is)f(an)g(8)g(deg)g(half-angle)f(sphere)-116 1823 y(cone)28
+b(with)i(nose)e(radius)h(equal)f(to)h(0.3)g(of)g(the)g(base)g(radius.)
+-116 1923 y(The)41 b(aft)g(b)r(o)r(dy)-7 b(,)45 b(b)r(eginning)c(at)g
+(the)h(85)e(p)r(ercen)n(t)h(fuselage)-116 2022 y(station,)23
+b(is)f(a)g(cylinder)g(with)h(a)f(partially)f(squared-o\013)g(cross-)
+-116 2122 y(section)h(pro)r(ducing)f(\015at)h(\\slices")f(extending)h
+(from)g(the)g(base)-116 2221 y(of)g(the)h(v)n(ehicle)f(to)g(appro)n
+(ximately)f(the)i(60)e(p)r(ercen)n(t)i(fuselage)-116
+2321 y(station.)72 b(The)39 b(v)n(ehicle)g(has)g(a)g(\014neness)g
+(ratio)g(of)g(6.4.)72 b(A)-116 2421 y(complete)27 b(description)g(of)h
+(the)g(v)n(ehicle)f(geometry)g(mo)r(deled)-116 2520 y(has)g(b)r(een)h
+(giv)n(en)f(b)n(y)g(W)-7 b(o)r(o)r(ds)28 b(in)f(Ref.)i(10.)-33
+2620 y Fl(Thr)l(ough)41 b(the)g(gener)l(osity)g(of)g(Kar)l(en)f(Bibb,)k
+(we)d(have)g(a)-116 2720 y(demonstr)l(ation)29 b(of)g(a)g(sub\014gur)l
+(e)e(situation.)38 b(Note)29 b(that)f(with)-116 2819
+y(imb)l(e)l(dde)l(d)35 b(lab)l(els)f(you)g(c)l(an)f(r)l(efer)h(to)f
+(Fig.)i(2)f(as)g(a)g(whole)g(or)-116 2919 y(sp)l(e)l(ci\014c)l(al)t
+(ly,)f(things)d(in)h(Fig.)h(2\(a\))f(or)g(Fig.)h(2\(b\).)40
+b Fr(An)29 b(early)-116 3019 y(Lo)r(c)n(kheed-Martin)j(X-33)h
+(con\014guration)f(w)n(as)h(used)h(in)g(the)-116 3118
+y(remainder)c(of)h(the)g(examples.)46 b(The)31 b(full)h(v)n(ehicle)f
+(is)g(sho)n(wn)-116 3218 y(in)d(Fig.)h(2.)39 b(This)28
+b(con\014guration)f(\(B1001A\))g(w)n(as)g(ev)-5 b(aluated)-116
+3317 y(during)29 b(Phase)f(I)h(of)h(the)f(X-33)g(program.)40
+b(It)30 b(has)f(t)n(win)g(v)n(er-)-116 3417 y(tical)e(tails,)g(\014ns,)
+g(and)g(outb)r(oard)f(b)r(o)r(dy)i(\015aps.)36 b(The)27
+b(engines)-116 3517 y(are)e(mo)r(deled)i(b)n(y)f(the)g(b)r(o)n(x-shap)r
+(ed)g(structure)g(on)g(the)g(base.)-116 3616 y Fl(We)35
+b(c)l(an)f(also)i(have)g(a)f(\\table")g(of)g(two,)i(or)e(four,)h(or)f
+(mor)l(e)-116 3716 y(\014gur)l(es)29 b(as)h(in)g(Fig.)h(3.)342
+3916 y Ft(Computational)36 b(Mesh)-33 4034 y Fr(The)24
+b(underlying)f(surface)f(de\014nition)i(database)f(w)n(as)g(gen-)-116
+4133 y(erated)39 b(from)g(structured)g(surface)g(patc)n(hes)g(obtained)
+g(us-)-116 4233 y(ing)52 b(GRIDGEN,)473 4203 y Fp(11)603
+4233 y Fr(GridT)-7 b(o)r(ol,)955 4203 y Fp(12)1084 4233
+y Fr(and)53 b(simple)g(analyti-)-116 4332 y(cal)c(metho)r(ds.)102
+b(The)50 b(unstructured)f(surface)g(and)g(\015o)n(w-)-116
+4432 y(\014eld)36 b(grids)f(w)n(ere)f(then)j(generated)d(using)i
+(FELISA)1594 4402 y Fp(13)1700 4432 y Fr(and)-116 4532
+y(TETMESH.)325 4502 y Fp(14)426 4532 y Fr(The)31 b(coarsest)e(mesh)i
+(has)g(32,374)e(tetrahe-)-116 4631 y(dra)20 b(with)h(6,634)e(no)r(des.)
+35 b(Additional)21 b(meshes)f(are)g(describ)r(ed)-116
+4731 y(in)31 b(Ref.)h(9;)g(ho)n(w)n(ev)n(er,)e(all)h(the)g(results)g
+(sho)n(wn)f(here)g(are)g(the)-116 4831 y(result)d(of)h(the)g(coarsest)d
+(meshes.)-33 4930 y(Since)41 b(the)h(\015o)n(w)f(ab)r(out)g(symmetric)g
+(con\014gurations)f(at)-116 5030 y(high)35 b(angles)f(of)i(attac)n(k,)g
+(ev)n(en)f(with)h(zero)f(side-slip,)i(often)-116 5130
+y(in)n(v)n(olv)n(e)f(asymmetric,)j(v)n(ortex-dominated,)g(features,)
+1665 5099 y Fp(15{)o(18)-116 5229 y Fr(t)n(w)n(o)i(di\013eren)n(t)i
+(options)e(for)h(the)h(computational)e(domain)-116 5329
+y(w)n(ere)19 b(emplo)n(y)n(ed:)32 b(one)19 b(mo)r(deling)h(the)h
+(complete)f(v)n(ehicle)f(and)-116 5428 y(another)37 b(mo)r(deling)h
+(only)g(half)g(of)g(the)g(v)n(ehicle,)j(assuming)1984
+1158 y @beginspecial 144 @llx 367 @lly 488 @urx 602 @ury
+2340 @rwi @setspecial
+%%BeginDocument: smpfig.eps
+%!PS-Adobe-2.0 EPSF-1.2
+%%Creator:Adobe Illustrator(TM) 1.1
+%%For: (RICHARD A WHELESS) (NASA LANGLEY)
+%%Title: (EPS)
+%%CreationDate: (2/9/99) (3:01 PM)
+%%DocumentProcessColors: Black
+%%DocumentFonts: Courier-Bold
+%%DocumentProcSets: Adobe_Illustrator_1.1 0 0
+%%BoundingBox:144 367 488 602
+%%ColorUsage: Black&White
+%AI3_IncludePlacedImages
+%%TemplateBox:306 396 306 396
+%%TileBox: 30 31 582 761
+%%DocumentPreview: Header
+%%EndComments
+%%BeginProcSet:Adobe_Illustrator_1.1 0 0
+/Adobe_Illustrator_1.1 dup 100 dict def load begin
+/Version 0 def
+/Revision 0 def
+/bdef {bind def} bind def
+/ldef {load def} bdef
+/xdef {exch def} bdef
+/_K {3 index add neg dup 0 lt {pop 0} if 3 1 roll} bdef
+/_k /setcmybcolor where 
+{/setcmybcolor get} {{1 sub 4 1 roll _K _K _K setrgbcolor pop} bind} ifelse def
+/g {/_b xdef /p {_b setgray} def} bdef
+/G {/_B xdef /P {_B setgray} def} bdef
+/k {/_b xdef /_y xdef /_m xdef /_c xdef /p {_c _m _y _b _k} def} bdef
+/K {/_B xdef /_Y xdef /_M xdef /_C xdef /P {_C _M _Y _B _k} def} bdef
+/d /setdash ldef
+/_i currentflat def
+/i {dup 0 eq {pop _i} if setflat} bdef
+/j /setlinejoin ldef
+/J /setlinecap ldef
+/M /setmiterlimit ldef
+/w /setlinewidth ldef
+/_R {.25 sub round .25 add} bdef
+/_r {transform _R exch _R exch itransform} bdef
+/c {_r curveto} bdef
+/C /c ldef
+/v {currentpoint 6 2 roll _r curveto} bdef
+/V /v ldef
+/y {_r 2 copy curveto} bdef
+/Y /y ldef
+/l {_r lineto} bdef
+/L /l ldef
+/m {_r moveto} bdef
+/_e [] def
+/_E {_e length 0 ne {gsave 0 g 0 G 0 i 0 J 0 j 1 w 10 M [] 0 d
+/Courier 20 0 0 1 z [0.966 0.259 -0.259 0.966
+_e 0 get _e 2 get add 2 div _e 1 get _e 3 get add 2 div] e _f t T grestore} if} bdef
+/_fill {{fill} stopped
+{/_e [pathbbox] def /_f (ERROR: can't fill, increase flatness) def n _E} if} bdef
+/_stroke {{stroke} stopped
+{/_e [pathbbox] def /_f (ERROR: can't stroke, increase flatness) def n _E} if} bdef
+/n /newpath ldef
+/N /n ldef
+/F {p _fill} bdef
+/f {closepath F} bdef
+/S {P _stroke} bdef
+/s {closepath S} bdef
+/B {gsave F grestore S} bdef
+/b {closepath B} bdef
+/_s /ashow ldef
+/_S {(?) exch {2 copy 0 exch put pop dup false charpath currentpoint _g setmatrix
+_stroke _G setmatrix moveto 3 copy pop rmoveto} forall pop pop pop n} bdef
+/_A {_a moveto _t exch 0 exch} bdef
+/_L {0 _l neg translate _G currentmatrix pop} bdef
+/_w {dup stringwidth exch 3 -1 roll length 1 sub _t mul add exch} bdef
+/_z [{0 0} bind {dup _w exch neg 2 div exch neg 2 div} bind {dup _w exch neg exch neg} bind] def
+/z {_z exch get /_a xdef /_t xdef /_l xdef exch findfont exch scalefont setfont} bdef
+/_g matrix def
+/_G matrix def
+/_D {_g currentmatrix pop gsave concat _G currentmatrix pop} bdef
+/e {_D p /t {_A _s _L} def} bdef
+/r {_D P /t {_A _S _L} def} bdef
+/a {_D /t {dup p _A _s P _A _S _L} def} bdef
+/o {_D /t {pop _L} def} bdef
+/T {grestore} bdef
+/u {} bdef
+/U {} bdef
+/Z {findfont begin currentdict dup length dict begin
+{1 index /FID ne {def} {pop pop} ifelse} forall /FontName exch def dup length 0 ne
+{/Encoding Encoding 256 array copy def 0 exch {dup type /nametype eq
+{Encoding 2 index 2 index put pop 1 add} {exch pop} ifelse} forall} if pop
+currentdict dup end end /FontName get exch definefont pop} bdef
+end
+%%EndProcSet
+%%EndProlog
+%%BeginSetup
+Adobe_Illustrator_1.1 begin
+n
+%%BeginEncoding: _Courier-Bold Courier-Bold
+[39/quotesingle 96/grave 128/Adieresis/Aring/Ccedilla/Eacute/Ntilde/Odieresis
+/Udieresis/aacute/agrave/acircumflex/adieresis/atilde/aring/ccedilla/eacute
+/egrave/ecircumflex/edieresis/iacute/igrave/icircumflex/idieresis/ntilde
+/oacute/ograve/ocircumflex/odieresis/otilde/uacute/ugrave/ucircumflex
+/udieresis/dagger/degree/cent/sterling/section/bullet/paragraph/germandbls
+/registered/copyright/trademark/acute/dieresis/.notdef/AE/Oslash
+/.notdef/plusminus/.notdef/.notdef/yen/mu/.notdef/.notdef
+/.notdef/.notdef/.notdef/ordfeminine/ordmasculine/.notdef/ae/oslash
+/questiondown/exclamdown/logicalnot/.notdef/florin/.notdef/.notdef
+/guillemotleft/guillemotright/ellipsis/.notdef/Agrave/Atilde/Otilde/OE/oe
+/endash/emdash/quotedblleft/quotedblright/quoteleft/quoteright/divide
+/.notdef/ydieresis/Ydieresis/fraction/currency/guilsinglleft/guilsinglright
+/fi/fl/daggerdbl/periodcentered/quotesinglbase/quotedblbase/perthousand
+/Acircumflex/Ecircumflex/Aacute/Edieresis/Egrave/Iacute/Icircumflex
+/Idieresis/Igrave/Oacute/Ocircumflex/.notdef/Ograve/Uacute/Ucircumflex
+/Ugrave/dotlessi/circumflex/tilde/macron/breve/dotaccent/ring/cedilla
+/hungarumlaut/ogonek/caron
+]/_Courier-Bold/Courier-Bold Z
+%%EndEncoding
+%%EndSetup
+0 0 0 0 k
+0 0 0 1 K
+0 i
+0 J 0 j 1 w 4 M []0 d
+%%Note:
+487.5 367.5 m
+487.5 601.5 L
+145.5 601.5 L
+145.5 367.5 L
+487.5 367.5 L
+b
+145.5 601.5 m
+487 368 l
+B
+487 601.5 m
+145 368 l
+B
+0.5 w
+450.5 478 m
+450.5 494 L
+182 494 L
+182 478 L
+450.5 478 L
+b
+u
+0 0 0 1 k
+1 w
+/_Courier-Bold 12 14.5 0 0 z
+[1 0 0 1 187.402 482]e
+(Encapsulated Postscript \(EPS\) Figure)t
+T
+U
+%%PageTrailer
+%%Trailer
+_E end
+%%EOF
+
+%%EndDocument
+ @endspecial 2549 1267 a Fo(a\))23 b Fu(First)k(prett)n(y)f(picture.)
+1984 2727 y @beginspecial 144 @llx 367 @lly 488 @urx
+602 @ury 2340 @rwi @setspecial
+%%BeginDocument: smpfig.eps
+%!PS-Adobe-2.0 EPSF-1.2
+%%Creator:Adobe Illustrator(TM) 1.1
+%%For: (RICHARD A WHELESS) (NASA LANGLEY)
+%%Title: (EPS)
+%%CreationDate: (2/9/99) (3:01 PM)
+%%DocumentProcessColors: Black
+%%DocumentFonts: Courier-Bold
+%%DocumentProcSets: Adobe_Illustrator_1.1 0 0
+%%BoundingBox:144 367 488 602
+%%ColorUsage: Black&White
+%AI3_IncludePlacedImages
+%%TemplateBox:306 396 306 396
+%%TileBox: 30 31 582 761
+%%DocumentPreview: Header
+%%EndComments
+%%BeginProcSet:Adobe_Illustrator_1.1 0 0
+/Adobe_Illustrator_1.1 dup 100 dict def load begin
+/Version 0 def
+/Revision 0 def
+/bdef {bind def} bind def
+/ldef {load def} bdef
+/xdef {exch def} bdef
+/_K {3 index add neg dup 0 lt {pop 0} if 3 1 roll} bdef
+/_k /setcmybcolor where 
+{/setcmybcolor get} {{1 sub 4 1 roll _K _K _K setrgbcolor pop} bind} ifelse def
+/g {/_b xdef /p {_b setgray} def} bdef
+/G {/_B xdef /P {_B setgray} def} bdef
+/k {/_b xdef /_y xdef /_m xdef /_c xdef /p {_c _m _y _b _k} def} bdef
+/K {/_B xdef /_Y xdef /_M xdef /_C xdef /P {_C _M _Y _B _k} def} bdef
+/d /setdash ldef
+/_i currentflat def
+/i {dup 0 eq {pop _i} if setflat} bdef
+/j /setlinejoin ldef
+/J /setlinecap ldef
+/M /setmiterlimit ldef
+/w /setlinewidth ldef
+/_R {.25 sub round .25 add} bdef
+/_r {transform _R exch _R exch itransform} bdef
+/c {_r curveto} bdef
+/C /c ldef
+/v {currentpoint 6 2 roll _r curveto} bdef
+/V /v ldef
+/y {_r 2 copy curveto} bdef
+/Y /y ldef
+/l {_r lineto} bdef
+/L /l ldef
+/m {_r moveto} bdef
+/_e [] def
+/_E {_e length 0 ne {gsave 0 g 0 G 0 i 0 J 0 j 1 w 10 M [] 0 d
+/Courier 20 0 0 1 z [0.966 0.259 -0.259 0.966
+_e 0 get _e 2 get add 2 div _e 1 get _e 3 get add 2 div] e _f t T grestore} if} bdef
+/_fill {{fill} stopped
+{/_e [pathbbox] def /_f (ERROR: can't fill, increase flatness) def n _E} if} bdef
+/_stroke {{stroke} stopped
+{/_e [pathbbox] def /_f (ERROR: can't stroke, increase flatness) def n _E} if} bdef
+/n /newpath ldef
+/N /n ldef
+/F {p _fill} bdef
+/f {closepath F} bdef
+/S {P _stroke} bdef
+/s {closepath S} bdef
+/B {gsave F grestore S} bdef
+/b {closepath B} bdef
+/_s /ashow ldef
+/_S {(?) exch {2 copy 0 exch put pop dup false charpath currentpoint _g setmatrix
+_stroke _G setmatrix moveto 3 copy pop rmoveto} forall pop pop pop n} bdef
+/_A {_a moveto _t exch 0 exch} bdef
+/_L {0 _l neg translate _G currentmatrix pop} bdef
+/_w {dup stringwidth exch 3 -1 roll length 1 sub _t mul add exch} bdef
+/_z [{0 0} bind {dup _w exch neg 2 div exch neg 2 div} bind {dup _w exch neg exch neg} bind] def
+/z {_z exch get /_a xdef /_t xdef /_l xdef exch findfont exch scalefont setfont} bdef
+/_g matrix def
+/_G matrix def
+/_D {_g currentmatrix pop gsave concat _G currentmatrix pop} bdef
+/e {_D p /t {_A _s _L} def} bdef
+/r {_D P /t {_A _S _L} def} bdef
+/a {_D /t {dup p _A _s P _A _S _L} def} bdef
+/o {_D /t {pop _L} def} bdef
+/T {grestore} bdef
+/u {} bdef
+/U {} bdef
+/Z {findfont begin currentdict dup length dict begin
+{1 index /FID ne {def} {pop pop} ifelse} forall /FontName exch def dup length 0 ne
+{/Encoding Encoding 256 array copy def 0 exch {dup type /nametype eq
+{Encoding 2 index 2 index put pop 1 add} {exch pop} ifelse} forall} if pop
+currentdict dup end end /FontName get exch definefont pop} bdef
+end
+%%EndProcSet
+%%EndProlog
+%%BeginSetup
+Adobe_Illustrator_1.1 begin
+n
+%%BeginEncoding: _Courier-Bold Courier-Bold
+[39/quotesingle 96/grave 128/Adieresis/Aring/Ccedilla/Eacute/Ntilde/Odieresis
+/Udieresis/aacute/agrave/acircumflex/adieresis/atilde/aring/ccedilla/eacute
+/egrave/ecircumflex/edieresis/iacute/igrave/icircumflex/idieresis/ntilde
+/oacute/ograve/ocircumflex/odieresis/otilde/uacute/ugrave/ucircumflex
+/udieresis/dagger/degree/cent/sterling/section/bullet/paragraph/germandbls
+/registered/copyright/trademark/acute/dieresis/.notdef/AE/Oslash
+/.notdef/plusminus/.notdef/.notdef/yen/mu/.notdef/.notdef
+/.notdef/.notdef/.notdef/ordfeminine/ordmasculine/.notdef/ae/oslash
+/questiondown/exclamdown/logicalnot/.notdef/florin/.notdef/.notdef
+/guillemotleft/guillemotright/ellipsis/.notdef/Agrave/Atilde/Otilde/OE/oe
+/endash/emdash/quotedblleft/quotedblright/quoteleft/quoteright/divide
+/.notdef/ydieresis/Ydieresis/fraction/currency/guilsinglleft/guilsinglright
+/fi/fl/daggerdbl/periodcentered/quotesinglbase/quotedblbase/perthousand
+/Acircumflex/Ecircumflex/Aacute/Edieresis/Egrave/Iacute/Icircumflex
+/Idieresis/Igrave/Oacute/Ocircumflex/.notdef/Ograve/Uacute/Ucircumflex
+/Ugrave/dotlessi/circumflex/tilde/macron/breve/dotaccent/ring/cedilla
+/hungarumlaut/ogonek/caron
+]/_Courier-Bold/Courier-Bold Z
+%%EndEncoding
+%%EndSetup
+0 0 0 0 k
+0 0 0 1 K
+0 i
+0 J 0 j 1 w 4 M []0 d
+%%Note:
+487.5 367.5 m
+487.5 601.5 L
+145.5 601.5 L
+145.5 367.5 L
+487.5 367.5 L
+b
+145.5 601.5 m
+487 368 l
+B
+487 601.5 m
+145 368 l
+B
+0.5 w
+450.5 478 m
+450.5 494 L
+182 494 L
+182 478 L
+450.5 478 L
+b
+u
+0 0 0 1 k
+1 w
+/_Courier-Bold 12 14.5 0 0 z
+[1 0 0 1 187.402 482]e
+(Encapsulated Postscript \(EPS\) Figure)t
+T
+U
+%%PageTrailer
+%%Trailer
+_E end
+%%EOF
+
+%%EndDocument
+ @endspecial 2506 2836 a Fo(b\))e Fu(Second)k(prett)n(y)e(picture.)1984
+2983 y Fo(Fig.)37 b(2)102 b(T)-7 b(emp)r(erature)37 b(distribution)k
+(comparisons)d(at)1984 3074 y(v)-5 b(arious)45 b(wing)f(semi-span)g
+(stations)h(as)f(a)g(function)i(of)1984 3165 y(c)n(hord.)39
+b(Wh)n(uh?)1984 4083 y @beginspecial 144 @llx 367 @lly
+488 @urx 602 @ury 1110 @rwi @setspecial
+%%BeginDocument: smpfig.eps
+%!PS-Adobe-2.0 EPSF-1.2
+%%Creator:Adobe Illustrator(TM) 1.1
+%%For: (RICHARD A WHELESS) (NASA LANGLEY)
+%%Title: (EPS)
+%%CreationDate: (2/9/99) (3:01 PM)
+%%DocumentProcessColors: Black
+%%DocumentFonts: Courier-Bold
+%%DocumentProcSets: Adobe_Illustrator_1.1 0 0
+%%BoundingBox:144 367 488 602
+%%ColorUsage: Black&White
+%AI3_IncludePlacedImages
+%%TemplateBox:306 396 306 396
+%%TileBox: 30 31 582 761
+%%DocumentPreview: Header
+%%EndComments
+%%BeginProcSet:Adobe_Illustrator_1.1 0 0
+/Adobe_Illustrator_1.1 dup 100 dict def load begin
+/Version 0 def
+/Revision 0 def
+/bdef {bind def} bind def
+/ldef {load def} bdef
+/xdef {exch def} bdef
+/_K {3 index add neg dup 0 lt {pop 0} if 3 1 roll} bdef
+/_k /setcmybcolor where 
+{/setcmybcolor get} {{1 sub 4 1 roll _K _K _K setrgbcolor pop} bind} ifelse def
+/g {/_b xdef /p {_b setgray} def} bdef
+/G {/_B xdef /P {_B setgray} def} bdef
+/k {/_b xdef /_y xdef /_m xdef /_c xdef /p {_c _m _y _b _k} def} bdef
+/K {/_B xdef /_Y xdef /_M xdef /_C xdef /P {_C _M _Y _B _k} def} bdef
+/d /setdash ldef
+/_i currentflat def
+/i {dup 0 eq {pop _i} if setflat} bdef
+/j /setlinejoin ldef
+/J /setlinecap ldef
+/M /setmiterlimit ldef
+/w /setlinewidth ldef
+/_R {.25 sub round .25 add} bdef
+/_r {transform _R exch _R exch itransform} bdef
+/c {_r curveto} bdef
+/C /c ldef
+/v {currentpoint 6 2 roll _r curveto} bdef
+/V /v ldef
+/y {_r 2 copy curveto} bdef
+/Y /y ldef
+/l {_r lineto} bdef
+/L /l ldef
+/m {_r moveto} bdef
+/_e [] def
+/_E {_e length 0 ne {gsave 0 g 0 G 0 i 0 J 0 j 1 w 10 M [] 0 d
+/Courier 20 0 0 1 z [0.966 0.259 -0.259 0.966
+_e 0 get _e 2 get add 2 div _e 1 get _e 3 get add 2 div] e _f t T grestore} if} bdef
+/_fill {{fill} stopped
+{/_e [pathbbox] def /_f (ERROR: can't fill, increase flatness) def n _E} if} bdef
+/_stroke {{stroke} stopped
+{/_e [pathbbox] def /_f (ERROR: can't stroke, increase flatness) def n _E} if} bdef
+/n /newpath ldef
+/N /n ldef
+/F {p _fill} bdef
+/f {closepath F} bdef
+/S {P _stroke} bdef
+/s {closepath S} bdef
+/B {gsave F grestore S} bdef
+/b {closepath B} bdef
+/_s /ashow ldef
+/_S {(?) exch {2 copy 0 exch put pop dup false charpath currentpoint _g setmatrix
+_stroke _G setmatrix moveto 3 copy pop rmoveto} forall pop pop pop n} bdef
+/_A {_a moveto _t exch 0 exch} bdef
+/_L {0 _l neg translate _G currentmatrix pop} bdef
+/_w {dup stringwidth exch 3 -1 roll length 1 sub _t mul add exch} bdef
+/_z [{0 0} bind {dup _w exch neg 2 div exch neg 2 div} bind {dup _w exch neg exch neg} bind] def
+/z {_z exch get /_a xdef /_t xdef /_l xdef exch findfont exch scalefont setfont} bdef
+/_g matrix def
+/_G matrix def
+/_D {_g currentmatrix pop gsave concat _G currentmatrix pop} bdef
+/e {_D p /t {_A _s _L} def} bdef
+/r {_D P /t {_A _S _L} def} bdef
+/a {_D /t {dup p _A _s P _A _S _L} def} bdef
+/o {_D /t {pop _L} def} bdef
+/T {grestore} bdef
+/u {} bdef
+/U {} bdef
+/Z {findfont begin currentdict dup length dict begin
+{1 index /FID ne {def} {pop pop} ifelse} forall /FontName exch def dup length 0 ne
+{/Encoding Encoding 256 array copy def 0 exch {dup type /nametype eq
+{Encoding 2 index 2 index put pop 1 add} {exch pop} ifelse} forall} if pop
+currentdict dup end end /FontName get exch definefont pop} bdef
+end
+%%EndProcSet
+%%EndProlog
+%%BeginSetup
+Adobe_Illustrator_1.1 begin
+n
+%%BeginEncoding: _Courier-Bold Courier-Bold
+[39/quotesingle 96/grave 128/Adieresis/Aring/Ccedilla/Eacute/Ntilde/Odieresis
+/Udieresis/aacute/agrave/acircumflex/adieresis/atilde/aring/ccedilla/eacute
+/egrave/ecircumflex/edieresis/iacute/igrave/icircumflex/idieresis/ntilde
+/oacute/ograve/ocircumflex/odieresis/otilde/uacute/ugrave/ucircumflex
+/udieresis/dagger/degree/cent/sterling/section/bullet/paragraph/germandbls
+/registered/copyright/trademark/acute/dieresis/.notdef/AE/Oslash
+/.notdef/plusminus/.notdef/.notdef/yen/mu/.notdef/.notdef
+/.notdef/.notdef/.notdef/ordfeminine/ordmasculine/.notdef/ae/oslash
+/questiondown/exclamdown/logicalnot/.notdef/florin/.notdef/.notdef
+/guillemotleft/guillemotright/ellipsis/.notdef/Agrave/Atilde/Otilde/OE/oe
+/endash/emdash/quotedblleft/quotedblright/quoteleft/quoteright/divide
+/.notdef/ydieresis/Ydieresis/fraction/currency/guilsinglleft/guilsinglright
+/fi/fl/daggerdbl/periodcentered/quotesinglbase/quotedblbase/perthousand
+/Acircumflex/Ecircumflex/Aacute/Edieresis/Egrave/Iacute/Icircumflex
+/Idieresis/Igrave/Oacute/Ocircumflex/.notdef/Ograve/Uacute/Ucircumflex
+/Ugrave/dotlessi/circumflex/tilde/macron/breve/dotaccent/ring/cedilla
+/hungarumlaut/ogonek/caron
+]/_Courier-Bold/Courier-Bold Z
+%%EndEncoding
+%%EndSetup
+0 0 0 0 k
+0 0 0 1 K
+0 i
+0 J 0 j 1 w 4 M []0 d
+%%Note:
+487.5 367.5 m
+487.5 601.5 L
+145.5 601.5 L
+145.5 367.5 L
+487.5 367.5 L
+b
+145.5 601.5 m
+487 368 l
+B
+487 601.5 m
+145 368 l
+B
+0.5 w
+450.5 478 m
+450.5 494 L
+182 494 L
+182 478 L
+450.5 478 L
+b
+u
+0 0 0 1 k
+1 w
+/_Courier-Bold 12 14.5 0 0 z
+[1 0 0 1 187.402 482]e
+(Encapsulated Postscript \(EPS\) Figure)t
+T
+U
+%%PageTrailer
+%%Trailer
+_E end
+%%EOF
+
+%%EndDocument
+ @endspecial 2036 4192 a(a\))24 b Fu(First)i(prett)n(y)g(picture.)3009
+4083 y @beginspecial 144 @llx 367 @lly 488 @urx 602 @ury
+1110 @rwi @setspecial
+%%BeginDocument: smpfig.eps
+%!PS-Adobe-2.0 EPSF-1.2
+%%Creator:Adobe Illustrator(TM) 1.1
+%%For: (RICHARD A WHELESS) (NASA LANGLEY)
+%%Title: (EPS)
+%%CreationDate: (2/9/99) (3:01 PM)
+%%DocumentProcessColors: Black
+%%DocumentFonts: Courier-Bold
+%%DocumentProcSets: Adobe_Illustrator_1.1 0 0
+%%BoundingBox:144 367 488 602
+%%ColorUsage: Black&White
+%AI3_IncludePlacedImages
+%%TemplateBox:306 396 306 396
+%%TileBox: 30 31 582 761
+%%DocumentPreview: Header
+%%EndComments
+%%BeginProcSet:Adobe_Illustrator_1.1 0 0
+/Adobe_Illustrator_1.1 dup 100 dict def load begin
+/Version 0 def
+/Revision 0 def
+/bdef {bind def} bind def
+/ldef {load def} bdef
+/xdef {exch def} bdef
+/_K {3 index add neg dup 0 lt {pop 0} if 3 1 roll} bdef
+/_k /setcmybcolor where 
+{/setcmybcolor get} {{1 sub 4 1 roll _K _K _K setrgbcolor pop} bind} ifelse def
+/g {/_b xdef /p {_b setgray} def} bdef
+/G {/_B xdef /P {_B setgray} def} bdef
+/k {/_b xdef /_y xdef /_m xdef /_c xdef /p {_c _m _y _b _k} def} bdef
+/K {/_B xdef /_Y xdef /_M xdef /_C xdef /P {_C _M _Y _B _k} def} bdef
+/d /setdash ldef
+/_i currentflat def
+/i {dup 0 eq {pop _i} if setflat} bdef
+/j /setlinejoin ldef
+/J /setlinecap ldef
+/M /setmiterlimit ldef
+/w /setlinewidth ldef
+/_R {.25 sub round .25 add} bdef
+/_r {transform _R exch _R exch itransform} bdef
+/c {_r curveto} bdef
+/C /c ldef
+/v {currentpoint 6 2 roll _r curveto} bdef
+/V /v ldef
+/y {_r 2 copy curveto} bdef
+/Y /y ldef
+/l {_r lineto} bdef
+/L /l ldef
+/m {_r moveto} bdef
+/_e [] def
+/_E {_e length 0 ne {gsave 0 g 0 G 0 i 0 J 0 j 1 w 10 M [] 0 d
+/Courier 20 0 0 1 z [0.966 0.259 -0.259 0.966
+_e 0 get _e 2 get add 2 div _e 1 get _e 3 get add 2 div] e _f t T grestore} if} bdef
+/_fill {{fill} stopped
+{/_e [pathbbox] def /_f (ERROR: can't fill, increase flatness) def n _E} if} bdef
+/_stroke {{stroke} stopped
+{/_e [pathbbox] def /_f (ERROR: can't stroke, increase flatness) def n _E} if} bdef
+/n /newpath ldef
+/N /n ldef
+/F {p _fill} bdef
+/f {closepath F} bdef
+/S {P _stroke} bdef
+/s {closepath S} bdef
+/B {gsave F grestore S} bdef
+/b {closepath B} bdef
+/_s /ashow ldef
+/_S {(?) exch {2 copy 0 exch put pop dup false charpath currentpoint _g setmatrix
+_stroke _G setmatrix moveto 3 copy pop rmoveto} forall pop pop pop n} bdef
+/_A {_a moveto _t exch 0 exch} bdef
+/_L {0 _l neg translate _G currentmatrix pop} bdef
+/_w {dup stringwidth exch 3 -1 roll length 1 sub _t mul add exch} bdef
+/_z [{0 0} bind {dup _w exch neg 2 div exch neg 2 div} bind {dup _w exch neg exch neg} bind] def
+/z {_z exch get /_a xdef /_t xdef /_l xdef exch findfont exch scalefont setfont} bdef
+/_g matrix def
+/_G matrix def
+/_D {_g currentmatrix pop gsave concat _G currentmatrix pop} bdef
+/e {_D p /t {_A _s _L} def} bdef
+/r {_D P /t {_A _S _L} def} bdef
+/a {_D /t {dup p _A _s P _A _S _L} def} bdef
+/o {_D /t {pop _L} def} bdef
+/T {grestore} bdef
+/u {} bdef
+/U {} bdef
+/Z {findfont begin currentdict dup length dict begin
+{1 index /FID ne {def} {pop pop} ifelse} forall /FontName exch def dup length 0 ne
+{/Encoding Encoding 256 array copy def 0 exch {dup type /nametype eq
+{Encoding 2 index 2 index put pop 1 add} {exch pop} ifelse} forall} if pop
+currentdict dup end end /FontName get exch definefont pop} bdef
+end
+%%EndProcSet
+%%EndProlog
+%%BeginSetup
+Adobe_Illustrator_1.1 begin
+n
+%%BeginEncoding: _Courier-Bold Courier-Bold
+[39/quotesingle 96/grave 128/Adieresis/Aring/Ccedilla/Eacute/Ntilde/Odieresis
+/Udieresis/aacute/agrave/acircumflex/adieresis/atilde/aring/ccedilla/eacute
+/egrave/ecircumflex/edieresis/iacute/igrave/icircumflex/idieresis/ntilde
+/oacute/ograve/ocircumflex/odieresis/otilde/uacute/ugrave/ucircumflex
+/udieresis/dagger/degree/cent/sterling/section/bullet/paragraph/germandbls
+/registered/copyright/trademark/acute/dieresis/.notdef/AE/Oslash
+/.notdef/plusminus/.notdef/.notdef/yen/mu/.notdef/.notdef
+/.notdef/.notdef/.notdef/ordfeminine/ordmasculine/.notdef/ae/oslash
+/questiondown/exclamdown/logicalnot/.notdef/florin/.notdef/.notdef
+/guillemotleft/guillemotright/ellipsis/.notdef/Agrave/Atilde/Otilde/OE/oe
+/endash/emdash/quotedblleft/quotedblright/quoteleft/quoteright/divide
+/.notdef/ydieresis/Ydieresis/fraction/currency/guilsinglleft/guilsinglright
+/fi/fl/daggerdbl/periodcentered/quotesinglbase/quotedblbase/perthousand
+/Acircumflex/Ecircumflex/Aacute/Edieresis/Egrave/Iacute/Icircumflex
+/Idieresis/Igrave/Oacute/Ocircumflex/.notdef/Ograve/Uacute/Ucircumflex
+/Ugrave/dotlessi/circumflex/tilde/macron/breve/dotaccent/ring/cedilla
+/hungarumlaut/ogonek/caron
+]/_Courier-Bold/Courier-Bold Z
+%%EndEncoding
+%%EndSetup
+0 0 0 0 k
+0 0 0 1 K
+0 i
+0 J 0 j 1 w 4 M []0 d
+%%Note:
+487.5 367.5 m
+487.5 601.5 L
+145.5 601.5 L
+145.5 367.5 L
+487.5 367.5 L
+b
+145.5 601.5 m
+487 368 l
+B
+487 601.5 m
+145 368 l
+B
+0.5 w
+450.5 478 m
+450.5 494 L
+182 494 L
+182 478 L
+450.5 478 L
+b
+u
+0 0 0 1 k
+1 w
+/_Courier-Bold 12 14.5 0 0 z
+[1 0 0 1 187.402 482]e
+(Encapsulated Postscript \(EPS\) Figure)t
+T
+U
+%%PageTrailer
+%%Trailer
+_E end
+%%EOF
+
+%%EndDocument
+ @endspecial 3025 4192 a Fo(b\))20 b Fu(Second)j(prett)n(y)f(picture.)
+1984 4963 y @beginspecial 144 @llx 367 @lly 488 @urx
+602 @ury 1110 @rwi @setspecial
+%%BeginDocument: smpfig.eps
+%!PS-Adobe-2.0 EPSF-1.2
+%%Creator:Adobe Illustrator(TM) 1.1
+%%For: (RICHARD A WHELESS) (NASA LANGLEY)
+%%Title: (EPS)
+%%CreationDate: (2/9/99) (3:01 PM)
+%%DocumentProcessColors: Black
+%%DocumentFonts: Courier-Bold
+%%DocumentProcSets: Adobe_Illustrator_1.1 0 0
+%%BoundingBox:144 367 488 602
+%%ColorUsage: Black&White
+%AI3_IncludePlacedImages
+%%TemplateBox:306 396 306 396
+%%TileBox: 30 31 582 761
+%%DocumentPreview: Header
+%%EndComments
+%%BeginProcSet:Adobe_Illustrator_1.1 0 0
+/Adobe_Illustrator_1.1 dup 100 dict def load begin
+/Version 0 def
+/Revision 0 def
+/bdef {bind def} bind def
+/ldef {load def} bdef
+/xdef {exch def} bdef
+/_K {3 index add neg dup 0 lt {pop 0} if 3 1 roll} bdef
+/_k /setcmybcolor where 
+{/setcmybcolor get} {{1 sub 4 1 roll _K _K _K setrgbcolor pop} bind} ifelse def
+/g {/_b xdef /p {_b setgray} def} bdef
+/G {/_B xdef /P {_B setgray} def} bdef
+/k {/_b xdef /_y xdef /_m xdef /_c xdef /p {_c _m _y _b _k} def} bdef
+/K {/_B xdef /_Y xdef /_M xdef /_C xdef /P {_C _M _Y _B _k} def} bdef
+/d /setdash ldef
+/_i currentflat def
+/i {dup 0 eq {pop _i} if setflat} bdef
+/j /setlinejoin ldef
+/J /setlinecap ldef
+/M /setmiterlimit ldef
+/w /setlinewidth ldef
+/_R {.25 sub round .25 add} bdef
+/_r {transform _R exch _R exch itransform} bdef
+/c {_r curveto} bdef
+/C /c ldef
+/v {currentpoint 6 2 roll _r curveto} bdef
+/V /v ldef
+/y {_r 2 copy curveto} bdef
+/Y /y ldef
+/l {_r lineto} bdef
+/L /l ldef
+/m {_r moveto} bdef
+/_e [] def
+/_E {_e length 0 ne {gsave 0 g 0 G 0 i 0 J 0 j 1 w 10 M [] 0 d
+/Courier 20 0 0 1 z [0.966 0.259 -0.259 0.966
+_e 0 get _e 2 get add 2 div _e 1 get _e 3 get add 2 div] e _f t T grestore} if} bdef
+/_fill {{fill} stopped
+{/_e [pathbbox] def /_f (ERROR: can't fill, increase flatness) def n _E} if} bdef
+/_stroke {{stroke} stopped
+{/_e [pathbbox] def /_f (ERROR: can't stroke, increase flatness) def n _E} if} bdef
+/n /newpath ldef
+/N /n ldef
+/F {p _fill} bdef
+/f {closepath F} bdef
+/S {P _stroke} bdef
+/s {closepath S} bdef
+/B {gsave F grestore S} bdef
+/b {closepath B} bdef
+/_s /ashow ldef
+/_S {(?) exch {2 copy 0 exch put pop dup false charpath currentpoint _g setmatrix
+_stroke _G setmatrix moveto 3 copy pop rmoveto} forall pop pop pop n} bdef
+/_A {_a moveto _t exch 0 exch} bdef
+/_L {0 _l neg translate _G currentmatrix pop} bdef
+/_w {dup stringwidth exch 3 -1 roll length 1 sub _t mul add exch} bdef
+/_z [{0 0} bind {dup _w exch neg 2 div exch neg 2 div} bind {dup _w exch neg exch neg} bind] def
+/z {_z exch get /_a xdef /_t xdef /_l xdef exch findfont exch scalefont setfont} bdef
+/_g matrix def
+/_G matrix def
+/_D {_g currentmatrix pop gsave concat _G currentmatrix pop} bdef
+/e {_D p /t {_A _s _L} def} bdef
+/r {_D P /t {_A _S _L} def} bdef
+/a {_D /t {dup p _A _s P _A _S _L} def} bdef
+/o {_D /t {pop _L} def} bdef
+/T {grestore} bdef
+/u {} bdef
+/U {} bdef
+/Z {findfont begin currentdict dup length dict begin
+{1 index /FID ne {def} {pop pop} ifelse} forall /FontName exch def dup length 0 ne
+{/Encoding Encoding 256 array copy def 0 exch {dup type /nametype eq
+{Encoding 2 index 2 index put pop 1 add} {exch pop} ifelse} forall} if pop
+currentdict dup end end /FontName get exch definefont pop} bdef
+end
+%%EndProcSet
+%%EndProlog
+%%BeginSetup
+Adobe_Illustrator_1.1 begin
+n
+%%BeginEncoding: _Courier-Bold Courier-Bold
+[39/quotesingle 96/grave 128/Adieresis/Aring/Ccedilla/Eacute/Ntilde/Odieresis
+/Udieresis/aacute/agrave/acircumflex/adieresis/atilde/aring/ccedilla/eacute
+/egrave/ecircumflex/edieresis/iacute/igrave/icircumflex/idieresis/ntilde
+/oacute/ograve/ocircumflex/odieresis/otilde/uacute/ugrave/ucircumflex
+/udieresis/dagger/degree/cent/sterling/section/bullet/paragraph/germandbls
+/registered/copyright/trademark/acute/dieresis/.notdef/AE/Oslash
+/.notdef/plusminus/.notdef/.notdef/yen/mu/.notdef/.notdef
+/.notdef/.notdef/.notdef/ordfeminine/ordmasculine/.notdef/ae/oslash
+/questiondown/exclamdown/logicalnot/.notdef/florin/.notdef/.notdef
+/guillemotleft/guillemotright/ellipsis/.notdef/Agrave/Atilde/Otilde/OE/oe
+/endash/emdash/quotedblleft/quotedblright/quoteleft/quoteright/divide
+/.notdef/ydieresis/Ydieresis/fraction/currency/guilsinglleft/guilsinglright
+/fi/fl/daggerdbl/periodcentered/quotesinglbase/quotedblbase/perthousand
+/Acircumflex/Ecircumflex/Aacute/Edieresis/Egrave/Iacute/Icircumflex
+/Idieresis/Igrave/Oacute/Ocircumflex/.notdef/Ograve/Uacute/Ucircumflex
+/Ugrave/dotlessi/circumflex/tilde/macron/breve/dotaccent/ring/cedilla
+/hungarumlaut/ogonek/caron
+]/_Courier-Bold/Courier-Bold Z
+%%EndEncoding
+%%EndSetup
+0 0 0 0 k
+0 0 0 1 K
+0 i
+0 J 0 j 1 w 4 M []0 d
+%%Note:
+487.5 367.5 m
+487.5 601.5 L
+145.5 601.5 L
+145.5 367.5 L
+487.5 367.5 L
+b
+145.5 601.5 m
+487 368 l
+B
+487 601.5 m
+145 368 l
+B
+0.5 w
+450.5 478 m
+450.5 494 L
+182 494 L
+182 478 L
+450.5 478 L
+b
+u
+0 0 0 1 k
+1 w
+/_Courier-Bold 12 14.5 0 0 z
+[1 0 0 1 187.402 482]e
+(Encapsulated Postscript \(EPS\) Figure)t
+T
+U
+%%PageTrailer
+%%Trailer
+_E end
+%%EOF
+
+%%EndDocument
+ @endspecial 2000 5073 a Fo(c\))i Fu(Second)i(prett)n(y)f(picture,)2000
+5152 y(again.)3009 4963 y @beginspecial 144 @llx 367
+@lly 488 @urx 602 @ury 1110 @rwi @setspecial
+%%BeginDocument: smpfig.eps
+%!PS-Adobe-2.0 EPSF-1.2
+%%Creator:Adobe Illustrator(TM) 1.1
+%%For: (RICHARD A WHELESS) (NASA LANGLEY)
+%%Title: (EPS)
+%%CreationDate: (2/9/99) (3:01 PM)
+%%DocumentProcessColors: Black
+%%DocumentFonts: Courier-Bold
+%%DocumentProcSets: Adobe_Illustrator_1.1 0 0
+%%BoundingBox:144 367 488 602
+%%ColorUsage: Black&White
+%AI3_IncludePlacedImages
+%%TemplateBox:306 396 306 396
+%%TileBox: 30 31 582 761
+%%DocumentPreview: Header
+%%EndComments
+%%BeginProcSet:Adobe_Illustrator_1.1 0 0
+/Adobe_Illustrator_1.1 dup 100 dict def load begin
+/Version 0 def
+/Revision 0 def
+/bdef {bind def} bind def
+/ldef {load def} bdef
+/xdef {exch def} bdef
+/_K {3 index add neg dup 0 lt {pop 0} if 3 1 roll} bdef
+/_k /setcmybcolor where 
+{/setcmybcolor get} {{1 sub 4 1 roll _K _K _K setrgbcolor pop} bind} ifelse def
+/g {/_b xdef /p {_b setgray} def} bdef
+/G {/_B xdef /P {_B setgray} def} bdef
+/k {/_b xdef /_y xdef /_m xdef /_c xdef /p {_c _m _y _b _k} def} bdef
+/K {/_B xdef /_Y xdef /_M xdef /_C xdef /P {_C _M _Y _B _k} def} bdef
+/d /setdash ldef
+/_i currentflat def
+/i {dup 0 eq {pop _i} if setflat} bdef
+/j /setlinejoin ldef
+/J /setlinecap ldef
+/M /setmiterlimit ldef
+/w /setlinewidth ldef
+/_R {.25 sub round .25 add} bdef
+/_r {transform _R exch _R exch itransform} bdef
+/c {_r curveto} bdef
+/C /c ldef
+/v {currentpoint 6 2 roll _r curveto} bdef
+/V /v ldef
+/y {_r 2 copy curveto} bdef
+/Y /y ldef
+/l {_r lineto} bdef
+/L /l ldef
+/m {_r moveto} bdef
+/_e [] def
+/_E {_e length 0 ne {gsave 0 g 0 G 0 i 0 J 0 j 1 w 10 M [] 0 d
+/Courier 20 0 0 1 z [0.966 0.259 -0.259 0.966
+_e 0 get _e 2 get add 2 div _e 1 get _e 3 get add 2 div] e _f t T grestore} if} bdef
+/_fill {{fill} stopped
+{/_e [pathbbox] def /_f (ERROR: can't fill, increase flatness) def n _E} if} bdef
+/_stroke {{stroke} stopped
+{/_e [pathbbox] def /_f (ERROR: can't stroke, increase flatness) def n _E} if} bdef
+/n /newpath ldef
+/N /n ldef
+/F {p _fill} bdef
+/f {closepath F} bdef
+/S {P _stroke} bdef
+/s {closepath S} bdef
+/B {gsave F grestore S} bdef
+/b {closepath B} bdef
+/_s /ashow ldef
+/_S {(?) exch {2 copy 0 exch put pop dup false charpath currentpoint _g setmatrix
+_stroke _G setmatrix moveto 3 copy pop rmoveto} forall pop pop pop n} bdef
+/_A {_a moveto _t exch 0 exch} bdef
+/_L {0 _l neg translate _G currentmatrix pop} bdef
+/_w {dup stringwidth exch 3 -1 roll length 1 sub _t mul add exch} bdef
+/_z [{0 0} bind {dup _w exch neg 2 div exch neg 2 div} bind {dup _w exch neg exch neg} bind] def
+/z {_z exch get /_a xdef /_t xdef /_l xdef exch findfont exch scalefont setfont} bdef
+/_g matrix def
+/_G matrix def
+/_D {_g currentmatrix pop gsave concat _G currentmatrix pop} bdef
+/e {_D p /t {_A _s _L} def} bdef
+/r {_D P /t {_A _S _L} def} bdef
+/a {_D /t {dup p _A _s P _A _S _L} def} bdef
+/o {_D /t {pop _L} def} bdef
+/T {grestore} bdef
+/u {} bdef
+/U {} bdef
+/Z {findfont begin currentdict dup length dict begin
+{1 index /FID ne {def} {pop pop} ifelse} forall /FontName exch def dup length 0 ne
+{/Encoding Encoding 256 array copy def 0 exch {dup type /nametype eq
+{Encoding 2 index 2 index put pop 1 add} {exch pop} ifelse} forall} if pop
+currentdict dup end end /FontName get exch definefont pop} bdef
+end
+%%EndProcSet
+%%EndProlog
+%%BeginSetup
+Adobe_Illustrator_1.1 begin
+n
+%%BeginEncoding: _Courier-Bold Courier-Bold
+[39/quotesingle 96/grave 128/Adieresis/Aring/Ccedilla/Eacute/Ntilde/Odieresis
+/Udieresis/aacute/agrave/acircumflex/adieresis/atilde/aring/ccedilla/eacute
+/egrave/ecircumflex/edieresis/iacute/igrave/icircumflex/idieresis/ntilde
+/oacute/ograve/ocircumflex/odieresis/otilde/uacute/ugrave/ucircumflex
+/udieresis/dagger/degree/cent/sterling/section/bullet/paragraph/germandbls
+/registered/copyright/trademark/acute/dieresis/.notdef/AE/Oslash
+/.notdef/plusminus/.notdef/.notdef/yen/mu/.notdef/.notdef
+/.notdef/.notdef/.notdef/ordfeminine/ordmasculine/.notdef/ae/oslash
+/questiondown/exclamdown/logicalnot/.notdef/florin/.notdef/.notdef
+/guillemotleft/guillemotright/ellipsis/.notdef/Agrave/Atilde/Otilde/OE/oe
+/endash/emdash/quotedblleft/quotedblright/quoteleft/quoteright/divide
+/.notdef/ydieresis/Ydieresis/fraction/currency/guilsinglleft/guilsinglright
+/fi/fl/daggerdbl/periodcentered/quotesinglbase/quotedblbase/perthousand
+/Acircumflex/Ecircumflex/Aacute/Edieresis/Egrave/Iacute/Icircumflex
+/Idieresis/Igrave/Oacute/Ocircumflex/.notdef/Ograve/Uacute/Ucircumflex
+/Ugrave/dotlessi/circumflex/tilde/macron/breve/dotaccent/ring/cedilla
+/hungarumlaut/ogonek/caron
+]/_Courier-Bold/Courier-Bold Z
+%%EndEncoding
+%%EndSetup
+0 0 0 0 k
+0 0 0 1 K
+0 i
+0 J 0 j 1 w 4 M []0 d
+%%Note:
+487.5 367.5 m
+487.5 601.5 L
+145.5 601.5 L
+145.5 367.5 L
+487.5 367.5 L
+b
+145.5 601.5 m
+487 368 l
+B
+487 601.5 m
+145 368 l
+B
+0.5 w
+450.5 478 m
+450.5 494 L
+182 494 L
+182 478 L
+450.5 478 L
+b
+u
+0 0 0 1 k
+1 w
+/_Courier-Bold 12 14.5 0 0 z
+[1 0 0 1 187.402 482]e
+(Encapsulated Postscript \(EPS\) Figure)t
+T
+U
+%%PageTrailer
+%%Trailer
+_E end
+%%EOF
+
+%%EndDocument
+ @endspecial 3025 5073 a Fo(d\))44 b Fu(First)49 b(prett)n(y)g
+(picture,)3025 5152 y(again.)2020 5292 y Fo(Fig.)29 b(3)87
+b(F)-7 b(our)30 b(small)g(\014gures)g(in)g(a)f(table-lik)n(e)i
+(setting.)1808 5578 y Fg(2)25 b(of)g(5)p 1759 5642 300
+2 v 737 5736 a(American)g(Institute)h(of)f(Aer)o(ona)o(utics)f(and)h
+(Astr)o(ona)o(utics)h(P)-6 b(aper)25 b(98{0879)p eop
+%%Page: 3 4
+3 3 bop -116 -188 a Fr(symmetry)33 b(across)e(the)j(pitc)n(h-plane.)55
+b(This)33 b(asp)r(ect)h(of)f(the)-116 -89 y(study)28
+b(is)f(co)n(v)n(ered)f(in)i(Ref.)g(9.)394 100 y Ft(Numerical)35
+b(Metho)s(d)-33 218 y Fr(The)27 b(3D3U)h(co)r(de)f(of)g(Batina)903
+187 y Fp(19)1000 218 y Fr(w)n(as)g(used)g(exclusiv)n(ely)g(in)-116
+317 y(this)21 b(study)-7 b(.)35 b(The)21 b(3D3U)f(co)r(de)h(w)n(as)f
+(originally)f(dev)n(elop)r(ed)h(to)-116 417 y(study)25
+b(harmonically)f(pitc)n(hing)h(wings)g(and)g(wing-b)r(o)r(dies)g(in)
+-116 516 y(transonic)32 b(\015o)n(w.)54 b(The)34 b(co)r(de)f(can)h
+(incorp)r(orate)e(aero)r(elastic)-116 616 y(e\013ects)c(through)f
+(assumed)h(mo)r(de)g(shap)r(es,)g(coupled)g(with)g(a)-116
+716 y(deforming)f(mesh)g(via)g(the)h(linear)f(spring)g(analogy)-7
+b(.)-33 815 y(The)31 b(follo)n(wing)g(defaults)h(w)n(ere)e(used)i(for)f
+(the)h(computed)-116 915 y(results)22 b(in)g(this)h(study:)34
+b(Ro)r(e's)22 b(\015ux-di\013erence)g(splitting,)i(an)-116
+1015 y(eigen)n(v)-5 b(alue)26 b(limiter)h(threshold)g(v)-5
+b(alue)27 b(of)g(0.3,)f(second-order)-116 1114 y(\015ux)j
+(reconstruction)e(using)h(a)g Fs(\024)h Fr(of)f(0.5,)g(and)h
+(Gauss-Seidel)-116 1214 y(implicit)36 b(time)f(in)n(tegration)f(with)i
+(a)f(CFL)g(n)n(um)n(b)r(er)g(of)g(one)-116 1314 y(million.)353
+1502 y Ft(Maneuv)m(er)j(De\014nition)-33 1620 y Fr(The)28
+b(pitc)n(h)g(sc)n(hedule)f(c)n(hosen)g(for)h(this)g(study)g(is)g(the)g
+(\014rst)-116 1720 y(half)21 b(of)g(a)g(sine)f(function.)36
+b(Initially)-7 b(,)22 b(the)g(v)n(ehicle)e(is)h(in)g(steady)-116
+1819 y(\015igh)n(t)36 b(at)g(17.5)e(degrees)h(angle)g(of)h(attac)n(k,)i
+(Mac)n(h)d(0.2.)62 b(A)n(t)-116 1919 y(time)41 b(zero,)h(the)f(v)n
+(ehicle)f(b)r(egins)g(the)h(pitc)n(h-o)n(v)n(er)d(maneu-)-116
+2018 y(v)n(er,)32 b(reac)n(hing)e(a)h(maxim)n(um)h(pitc)n(h)g(rate)f
+(exactly)g(half-w)n(a)n(y)-116 2118 y(through)22 b(the)h(maneuv)n(er)f
+(and)g(\014nishing)h(at)g(a)f(180)f(deg)i(angle)-116
+2218 y(of)f(attac)n(k.)34 b(F)-7 b(or)21 b(this)h(study)-7
+b(,)24 b(the)e(time)g(to)g(complete)g(the)g(ma-)-116
+2317 y(neuv)n(er)32 b(w)n(as)g(c)n(hosen)g(as)g(90)h(seconds,)g(giving)
+f(a)h(maxim)n(um)-116 2417 y(rotation)j(rate)g(of)h(3.1)f(deg)h(p)r(er)
+g(second)g(halfw)n(a)n(y)f(through)-116 2517 y(the)d(maneuv)n(er.)53
+b(F)-7 b(or)33 b(simplicit)n(y)-7 b(,)35 b(it)e(is)g(assumed)g(that)g
+(the)-116 2616 y(free-stream)f(Mac)n(h)h(n)n(um)n(b)r(er)h(remains)f
+(constan)n(t)g(through-)-116 2716 y(out)27 b(the)h(maneuv)n(er.)-33
+2816 y Fl(Sticking)56 b(in)h(a)f(table)h(for)g(guidanc)l(e)g(\(se)l(e)f
+(T)-6 b(able)57 b(1\).)-116 2915 y Fr(Normally)32 b(there)h(w)n(ould)g
+(b)r(e)g(text)h(follo)n(wing)e(the)i(table,)h(so)381
+3070 y Fo(T)-7 b(able)29 b(1)87 b(A)29 b(sample)h(table)p
+420 3121 851 4 v 420 3138 V 470 3208 a Fr(Header)d(1)99
+b(Header)27 b(2)p 420 3241 V 472 3311 a(a)168 b(b)311
+b(c)470 3410 y(d)171 b(e)321 b(f)p 420 3444 V 420 3460
+V -116 3664 a(that)28 b(it)g(is)f(not)h(left)g(\\hanging")e(in)n(to)h
+(the)h(next)g(section.)679 3853 y Ft(Results)-33 3971
+y Fr(The)g(main)g(results)g(are)f(presen)n(ted)h(in)g(t)n(w)n(o)g
+(stages)f(whic)n(h)-116 4070 y(are)43 b(follo)n(w)n(ed)h(b)n(y)g
+(commen)n(ts)h(on)f(\015o)n(w)g(asymmetries)f(for)-116
+4170 y(b)r(oth)e(steady)f(and)g(unsteady)g(\015o)n(ws.)75
+b(The)41 b(\014rst)f(stage)g(is)-116 4269 y(computed)27
+b(steady)g(data)g(as)f(it)i(compares)d(to)i(exp)r(erimen)n(tal)-116
+4369 y(results.)37 b(while)29 b(the)f(second)g(is)g(a)f(comparison)f
+(of)i(steady)g(to)-116 4469 y(unsteady)f(data.)-116 4614
+y Fo(Steady)i(Flo)n(w)-33 4731 y Fr(As)42 b(a)h(baseline)f(to)g
+(examine)g(the)h(unsteady)f(e\013ects)h(of)-116 4831
+y(the)28 b(pitc)n(h-o)n(v)n(er)d(maneuv)n(er)i(itself,)h(steady)f
+(\015o)n(w)g(at)g(selected)-116 4930 y(angles)40 b(of)h(attac)n(k)f(w)n
+(ere)g(computed.)77 b(Figure)41 b(4)f(sho)n(ws)g(a)-116
+5030 y(comparison)21 b(of)i(the)g(normal)f(force)h(co)r(e\016cien)n(t)f
+(with)i(the)f(ex-)-116 5130 y(p)r(erimen)n(tal)e(data)g(of)h(W)-7
+b(o)r(o)r(ds)810 5099 y Fp(10)901 5130 y Fr(for)21 b(angles)g(of)g
+(attac)n(k)g(from)g(0)-116 5229 y(to)j(60)g(deg.)36 b(The)25
+b(computed)g(results)f(agree)f(w)n(ell)i(\(within)h(20)-116
+5329 y(p)r(ercen)n(t\))19 b(at)g(small)f(angles)g(of)h(attac)n(k,)h
+(and)e(div)n(erge)g(from)g(the)-116 5428 y(exp)r(erimen)n(tal)35
+b(results)h(as)g(the)g(angle)g(of)g(attac)n(k)f(increases)1984
+1061 y @beginspecial 144 @llx 367 @lly 488 @urx 602 @ury
+2340 @rwi @setspecial
+%%BeginDocument: smpfig.eps
+%!PS-Adobe-2.0 EPSF-1.2
+%%Creator:Adobe Illustrator(TM) 1.1
+%%For: (RICHARD A WHELESS) (NASA LANGLEY)
+%%Title: (EPS)
+%%CreationDate: (2/9/99) (3:01 PM)
+%%DocumentProcessColors: Black
+%%DocumentFonts: Courier-Bold
+%%DocumentProcSets: Adobe_Illustrator_1.1 0 0
+%%BoundingBox:144 367 488 602
+%%ColorUsage: Black&White
+%AI3_IncludePlacedImages
+%%TemplateBox:306 396 306 396
+%%TileBox: 30 31 582 761
+%%DocumentPreview: Header
+%%EndComments
+%%BeginProcSet:Adobe_Illustrator_1.1 0 0
+/Adobe_Illustrator_1.1 dup 100 dict def load begin
+/Version 0 def
+/Revision 0 def
+/bdef {bind def} bind def
+/ldef {load def} bdef
+/xdef {exch def} bdef
+/_K {3 index add neg dup 0 lt {pop 0} if 3 1 roll} bdef
+/_k /setcmybcolor where 
+{/setcmybcolor get} {{1 sub 4 1 roll _K _K _K setrgbcolor pop} bind} ifelse def
+/g {/_b xdef /p {_b setgray} def} bdef
+/G {/_B xdef /P {_B setgray} def} bdef
+/k {/_b xdef /_y xdef /_m xdef /_c xdef /p {_c _m _y _b _k} def} bdef
+/K {/_B xdef /_Y xdef /_M xdef /_C xdef /P {_C _M _Y _B _k} def} bdef
+/d /setdash ldef
+/_i currentflat def
+/i {dup 0 eq {pop _i} if setflat} bdef
+/j /setlinejoin ldef
+/J /setlinecap ldef
+/M /setmiterlimit ldef
+/w /setlinewidth ldef
+/_R {.25 sub round .25 add} bdef
+/_r {transform _R exch _R exch itransform} bdef
+/c {_r curveto} bdef
+/C /c ldef
+/v {currentpoint 6 2 roll _r curveto} bdef
+/V /v ldef
+/y {_r 2 copy curveto} bdef
+/Y /y ldef
+/l {_r lineto} bdef
+/L /l ldef
+/m {_r moveto} bdef
+/_e [] def
+/_E {_e length 0 ne {gsave 0 g 0 G 0 i 0 J 0 j 1 w 10 M [] 0 d
+/Courier 20 0 0 1 z [0.966 0.259 -0.259 0.966
+_e 0 get _e 2 get add 2 div _e 1 get _e 3 get add 2 div] e _f t T grestore} if} bdef
+/_fill {{fill} stopped
+{/_e [pathbbox] def /_f (ERROR: can't fill, increase flatness) def n _E} if} bdef
+/_stroke {{stroke} stopped
+{/_e [pathbbox] def /_f (ERROR: can't stroke, increase flatness) def n _E} if} bdef
+/n /newpath ldef
+/N /n ldef
+/F {p _fill} bdef
+/f {closepath F} bdef
+/S {P _stroke} bdef
+/s {closepath S} bdef
+/B {gsave F grestore S} bdef
+/b {closepath B} bdef
+/_s /ashow ldef
+/_S {(?) exch {2 copy 0 exch put pop dup false charpath currentpoint _g setmatrix
+_stroke _G setmatrix moveto 3 copy pop rmoveto} forall pop pop pop n} bdef
+/_A {_a moveto _t exch 0 exch} bdef
+/_L {0 _l neg translate _G currentmatrix pop} bdef
+/_w {dup stringwidth exch 3 -1 roll length 1 sub _t mul add exch} bdef
+/_z [{0 0} bind {dup _w exch neg 2 div exch neg 2 div} bind {dup _w exch neg exch neg} bind] def
+/z {_z exch get /_a xdef /_t xdef /_l xdef exch findfont exch scalefont setfont} bdef
+/_g matrix def
+/_G matrix def
+/_D {_g currentmatrix pop gsave concat _G currentmatrix pop} bdef
+/e {_D p /t {_A _s _L} def} bdef
+/r {_D P /t {_A _S _L} def} bdef
+/a {_D /t {dup p _A _s P _A _S _L} def} bdef
+/o {_D /t {pop _L} def} bdef
+/T {grestore} bdef
+/u {} bdef
+/U {} bdef
+/Z {findfont begin currentdict dup length dict begin
+{1 index /FID ne {def} {pop pop} ifelse} forall /FontName exch def dup length 0 ne
+{/Encoding Encoding 256 array copy def 0 exch {dup type /nametype eq
+{Encoding 2 index 2 index put pop 1 add} {exch pop} ifelse} forall} if pop
+currentdict dup end end /FontName get exch definefont pop} bdef
+end
+%%EndProcSet
+%%EndProlog
+%%BeginSetup
+Adobe_Illustrator_1.1 begin
+n
+%%BeginEncoding: _Courier-Bold Courier-Bold
+[39/quotesingle 96/grave 128/Adieresis/Aring/Ccedilla/Eacute/Ntilde/Odieresis
+/Udieresis/aacute/agrave/acircumflex/adieresis/atilde/aring/ccedilla/eacute
+/egrave/ecircumflex/edieresis/iacute/igrave/icircumflex/idieresis/ntilde
+/oacute/ograve/ocircumflex/odieresis/otilde/uacute/ugrave/ucircumflex
+/udieresis/dagger/degree/cent/sterling/section/bullet/paragraph/germandbls
+/registered/copyright/trademark/acute/dieresis/.notdef/AE/Oslash
+/.notdef/plusminus/.notdef/.notdef/yen/mu/.notdef/.notdef
+/.notdef/.notdef/.notdef/ordfeminine/ordmasculine/.notdef/ae/oslash
+/questiondown/exclamdown/logicalnot/.notdef/florin/.notdef/.notdef
+/guillemotleft/guillemotright/ellipsis/.notdef/Agrave/Atilde/Otilde/OE/oe
+/endash/emdash/quotedblleft/quotedblright/quoteleft/quoteright/divide
+/.notdef/ydieresis/Ydieresis/fraction/currency/guilsinglleft/guilsinglright
+/fi/fl/daggerdbl/periodcentered/quotesinglbase/quotedblbase/perthousand
+/Acircumflex/Ecircumflex/Aacute/Edieresis/Egrave/Iacute/Icircumflex
+/Idieresis/Igrave/Oacute/Ocircumflex/.notdef/Ograve/Uacute/Ucircumflex
+/Ugrave/dotlessi/circumflex/tilde/macron/breve/dotaccent/ring/cedilla
+/hungarumlaut/ogonek/caron
+]/_Courier-Bold/Courier-Bold Z
+%%EndEncoding
+%%EndSetup
+0 0 0 0 k
+0 0 0 1 K
+0 i
+0 J 0 j 1 w 4 M []0 d
+%%Note:
+487.5 367.5 m
+487.5 601.5 L
+145.5 601.5 L
+145.5 367.5 L
+487.5 367.5 L
+b
+145.5 601.5 m
+487 368 l
+B
+487 601.5 m
+145 368 l
+B
+0.5 w
+450.5 478 m
+450.5 494 L
+182 494 L
+182 478 L
+450.5 478 L
+b
+u
+0 0 0 1 k
+1 w
+/_Courier-Bold 12 14.5 0 0 z
+[1 0 0 1 187.402 482]e
+(Encapsulated Postscript \(EPS\) Figure)t
+T
+U
+%%PageTrailer
+%%Trailer
+_E end
+%%EOF
+
+%%EndDocument
+ @endspecial 141 x Fo(Fig.)d(4)92 b(Comparison)34 b(of)e(steady)g
+(normal)h(force)g(co)r(e\016-)1984 1293 y(cien)n(t)h(as)f(a)h(function)
+i(of)d(angle)i(of)e(attac)n(k)h(with)h(exp)r(eri-)1984
+1384 y(men)n(tal)29 b(data)h(of)g(W)-7 b(o)r(o)r(ds)2836
+1353 y Ff(10)1984 1545 y Fr(largely)33 b(due)i(to)g(the)h(p)r(osition)f
+(of)g(the)g(lee-side)f(separation)1984 1644 y(line|a)d(viscous)f
+(phenomenon.)47 b(Since)31 b(the)g(computed)h(re-)1984
+1744 y(sults)h(are)f(mo)r(deling)g(in)n(viscid)h(\015o)n(w,)h(the)f
+(only)f(mec)n(hanism)1984 1843 y(for)c(\015o)n(w)h(separation)e(is)j
+(the)f(n)n(umerical)f(dissipation)h(in)g(the)1984 1943
+y(sc)n(heme.)78 b(Th)n(us,)45 b(the)d(exact)f(lo)r(cation)g(of)h(the)g
+(computed)1984 2043 y(separation)32 b(line)i(is)g(highly)f(grid)g(and)h
+(sc)n(heme)f(dep)r(enden)n(t.)1984 2142 y(Comp)r(ounding)26
+b(this)g(is)g(the)g(fact)h(that)f(the)g(lee-side)g(separa-)1984
+2242 y(tion)g(line)g(nearly)f(encompasses)g(the)h(length)h(of)f(the)g
+(v)n(ehicle;)1984 2342 y(and)21 b(th)n(us,)h(a)f(sligh)n(t)f(deviation)
+h(can)f(mak)n(e)h(a)f(large)g(di\013erence)1984 2441
+y(in)28 b(the)g(in)n(tegrated)e(co)r(e\016cien)n(ts.)1984
+2591 y Fo(Unsteady)j(Flo)n(w)2067 2714 y Fr(Figure)40
+b(5)g(compares)f(the)i(normal)f(force)f(co)r(e\016cien)n(t)i(of)1984
+2814 y(b)r(oth)29 b(the)h(steady)e(and)h(unsteady)g(calculations.)40
+b(The)29 b(solid)1984 2914 y(line)34 b(represen)n(ts)f(the)i(unsteady)f
+(results)g(and)h(the)g(sym)n(b)r(ols)1984 3013 y(are)29
+b(the)i(steady-\015o)n(w)e(results.)44 b(Readily)30 b(discernible)g(is)
+g(the)1984 3113 y(fact)36 b(that)g(the)g(steady)f(and)h(unsteady)f
+(results)g(are)g(signif-)1984 3212 y(ican)n(tly)45 b(di\013eren)n(t.)93
+b(The)46 b(time-dep)r(enden)n(t)h(results)e(ha)n(v)n(e)1984
+3312 y(the)g(time)g(lag)e(b)r(eha)n(vior)g(exp)r(ected)i(for)f(mo)r
+(derately)g(un-)1984 3412 y(steady)k(\015o)n(w:)77 b(sho)n(wing)47
+b(the)i(same)f(general)f(qualitativ)n(e)1984 3511 y(trend)31
+b(throughout)g(the)h(angle-of-attac)n(k)c(range,)j(but)h(with)1984
+3611 y(the)46 b(unsteady)g(results)f(lagging)f(b)r(ehind)j(the)f
+(steady)g(re-)1984 3711 y(sults.)89 b(Other)45 b(aero)r(dynamic)f(co)r
+(e\016cien)n(ts)g(sho)n(w)h(similar)1984 3810 y(di\013erences.)2384
+3780 y Fp(9)1984 3961 y Fo(Flo)n(w)29 b(Asymmetry)2067
+4083 y Fr(As)k(do)r(cumen)n(ted)g(in)h(Ref.)g(9,)g(no)f(appreciable)f
+(asymme-)1984 4183 y(tries)k(w)n(ere)g(found)h(for)f(the)h(steady)f
+(\015o)n(w)g(cases)g(computed)1984 4283 y(although)c(they)i(w)n(ere)e
+(presen)n(t)h(in)g(the)h(exp)r(erimen)n(tal)e(data)1984
+4382 y(of)18 b(W)-7 b(o)r(o)r(ds.)2337 4352 y Fp(10)2442
+4382 y Fr(Ho)n(w)n(ev)n(er,)18 b(for)g(the)h(unsteady)g(case,)g
+(asymmet-)1984 4482 y(ric)31 b(\015o)n(w)f(is)h(apparen)n(t)f(as)h(sho)
+n(wn)f(in)i(Figuref:uasym.)47 b(This)1984 4582 y(\014gure)35
+b(sho)n(ws)h(the)g(app)r(earance)f(of)h(a)g(non-zero)f(side-force)1984
+4681 y(similar)f(to)h(that)g(rep)r(orted)f(for)h Fl(ste)l(ady)g
+Fr(\015o)n(w)g(b)n(y)f(W)-7 b(o)r(o)r(ds.)3863 4651 y
+Fp(10)1984 4781 y Fr(The)39 b(most)g(signi\014can)n(t)g(manifestations)
+g(of)g(the)h(asymme-)1984 4880 y(tries)27 b(o)r(ccur)f(in)i(the)g(90)e
+(to)h(135)f(deg)h(angle-of-attac)n(k)e(range.)2447 5106
+y Ft(Concluding)37 b(Remarks)2067 5229 y Fr(The)c(ob)5
+b(jectiv)n(e)33 b(of)g(the)h(presen)n(t)f(w)n(ork)f(w)n(as)g(to)i(fo)r
+(cus)f(an)1984 5329 y(unsteady)42 b(CFD)i(metho)r(d)g(on)e(the)i
+(prediction)e(of)h(VTVL)1984 5428 y(v)n(ehicle)c(aero)r(dynamics)g
+(during)g(a)h(pitc)n(h-o)n(v)n(er)e(maneuv)n(er.)1808
+5578 y Fg(3)25 b(of)g(5)p 1759 5642 300 2 v 737 5736
+a(American)g(Institute)h(of)f(Aer)o(ona)o(utics)f(and)h(Astr)o(ona)o
+(utics)h(P)-6 b(aper)25 b(98{0879)p eop
+%%Page: 4 5
+4 4 bop -116 2495 a @beginspecial 144 @llx 367 @lly 488
+@urx 602 @ury 4860 @rwi @setspecial
+%%BeginDocument: smpfig.eps
+%!PS-Adobe-2.0 EPSF-1.2
+%%Creator:Adobe Illustrator(TM) 1.1
+%%For: (RICHARD A WHELESS) (NASA LANGLEY)
+%%Title: (EPS)
+%%CreationDate: (2/9/99) (3:01 PM)
+%%DocumentProcessColors: Black
+%%DocumentFonts: Courier-Bold
+%%DocumentProcSets: Adobe_Illustrator_1.1 0 0
+%%BoundingBox:144 367 488 602
+%%ColorUsage: Black&White
+%AI3_IncludePlacedImages
+%%TemplateBox:306 396 306 396
+%%TileBox: 30 31 582 761
+%%DocumentPreview: Header
+%%EndComments
+%%BeginProcSet:Adobe_Illustrator_1.1 0 0
+/Adobe_Illustrator_1.1 dup 100 dict def load begin
+/Version 0 def
+/Revision 0 def
+/bdef {bind def} bind def
+/ldef {load def} bdef
+/xdef {exch def} bdef
+/_K {3 index add neg dup 0 lt {pop 0} if 3 1 roll} bdef
+/_k /setcmybcolor where 
+{/setcmybcolor get} {{1 sub 4 1 roll _K _K _K setrgbcolor pop} bind} ifelse def
+/g {/_b xdef /p {_b setgray} def} bdef
+/G {/_B xdef /P {_B setgray} def} bdef
+/k {/_b xdef /_y xdef /_m xdef /_c xdef /p {_c _m _y _b _k} def} bdef
+/K {/_B xdef /_Y xdef /_M xdef /_C xdef /P {_C _M _Y _B _k} def} bdef
+/d /setdash ldef
+/_i currentflat def
+/i {dup 0 eq {pop _i} if setflat} bdef
+/j /setlinejoin ldef
+/J /setlinecap ldef
+/M /setmiterlimit ldef
+/w /setlinewidth ldef
+/_R {.25 sub round .25 add} bdef
+/_r {transform _R exch _R exch itransform} bdef
+/c {_r curveto} bdef
+/C /c ldef
+/v {currentpoint 6 2 roll _r curveto} bdef
+/V /v ldef
+/y {_r 2 copy curveto} bdef
+/Y /y ldef
+/l {_r lineto} bdef
+/L /l ldef
+/m {_r moveto} bdef
+/_e [] def
+/_E {_e length 0 ne {gsave 0 g 0 G 0 i 0 J 0 j 1 w 10 M [] 0 d
+/Courier 20 0 0 1 z [0.966 0.259 -0.259 0.966
+_e 0 get _e 2 get add 2 div _e 1 get _e 3 get add 2 div] e _f t T grestore} if} bdef
+/_fill {{fill} stopped
+{/_e [pathbbox] def /_f (ERROR: can't fill, increase flatness) def n _E} if} bdef
+/_stroke {{stroke} stopped
+{/_e [pathbbox] def /_f (ERROR: can't stroke, increase flatness) def n _E} if} bdef
+/n /newpath ldef
+/N /n ldef
+/F {p _fill} bdef
+/f {closepath F} bdef
+/S {P _stroke} bdef
+/s {closepath S} bdef
+/B {gsave F grestore S} bdef
+/b {closepath B} bdef
+/_s /ashow ldef
+/_S {(?) exch {2 copy 0 exch put pop dup false charpath currentpoint _g setmatrix
+_stroke _G setmatrix moveto 3 copy pop rmoveto} forall pop pop pop n} bdef
+/_A {_a moveto _t exch 0 exch} bdef
+/_L {0 _l neg translate _G currentmatrix pop} bdef
+/_w {dup stringwidth exch 3 -1 roll length 1 sub _t mul add exch} bdef
+/_z [{0 0} bind {dup _w exch neg 2 div exch neg 2 div} bind {dup _w exch neg exch neg} bind] def
+/z {_z exch get /_a xdef /_t xdef /_l xdef exch findfont exch scalefont setfont} bdef
+/_g matrix def
+/_G matrix def
+/_D {_g currentmatrix pop gsave concat _G currentmatrix pop} bdef
+/e {_D p /t {_A _s _L} def} bdef
+/r {_D P /t {_A _S _L} def} bdef
+/a {_D /t {dup p _A _s P _A _S _L} def} bdef
+/o {_D /t {pop _L} def} bdef
+/T {grestore} bdef
+/u {} bdef
+/U {} bdef
+/Z {findfont begin currentdict dup length dict begin
+{1 index /FID ne {def} {pop pop} ifelse} forall /FontName exch def dup length 0 ne
+{/Encoding Encoding 256 array copy def 0 exch {dup type /nametype eq
+{Encoding 2 index 2 index put pop 1 add} {exch pop} ifelse} forall} if pop
+currentdict dup end end /FontName get exch definefont pop} bdef
+end
+%%EndProcSet
+%%EndProlog
+%%BeginSetup
+Adobe_Illustrator_1.1 begin
+n
+%%BeginEncoding: _Courier-Bold Courier-Bold
+[39/quotesingle 96/grave 128/Adieresis/Aring/Ccedilla/Eacute/Ntilde/Odieresis
+/Udieresis/aacute/agrave/acircumflex/adieresis/atilde/aring/ccedilla/eacute
+/egrave/ecircumflex/edieresis/iacute/igrave/icircumflex/idieresis/ntilde
+/oacute/ograve/ocircumflex/odieresis/otilde/uacute/ugrave/ucircumflex
+/udieresis/dagger/degree/cent/sterling/section/bullet/paragraph/germandbls
+/registered/copyright/trademark/acute/dieresis/.notdef/AE/Oslash
+/.notdef/plusminus/.notdef/.notdef/yen/mu/.notdef/.notdef
+/.notdef/.notdef/.notdef/ordfeminine/ordmasculine/.notdef/ae/oslash
+/questiondown/exclamdown/logicalnot/.notdef/florin/.notdef/.notdef
+/guillemotleft/guillemotright/ellipsis/.notdef/Agrave/Atilde/Otilde/OE/oe
+/endash/emdash/quotedblleft/quotedblright/quoteleft/quoteright/divide
+/.notdef/ydieresis/Ydieresis/fraction/currency/guilsinglleft/guilsinglright
+/fi/fl/daggerdbl/periodcentered/quotesinglbase/quotedblbase/perthousand
+/Acircumflex/Ecircumflex/Aacute/Edieresis/Egrave/Iacute/Icircumflex
+/Idieresis/Igrave/Oacute/Ocircumflex/.notdef/Ograve/Uacute/Ucircumflex
+/Ugrave/dotlessi/circumflex/tilde/macron/breve/dotaccent/ring/cedilla
+/hungarumlaut/ogonek/caron
+]/_Courier-Bold/Courier-Bold Z
+%%EndEncoding
+%%EndSetup
+0 0 0 0 k
+0 0 0 1 K
+0 i
+0 J 0 j 1 w 4 M []0 d
+%%Note:
+487.5 367.5 m
+487.5 601.5 L
+145.5 601.5 L
+145.5 367.5 L
+487.5 367.5 L
+b
+145.5 601.5 m
+487 368 l
+B
+487 601.5 m
+145 368 l
+B
+0.5 w
+450.5 478 m
+450.5 494 L
+182 494 L
+182 478 L
+450.5 478 L
+b
+u
+0 0 0 1 k
+1 w
+/_Courier-Bold 12 14.5 0 0 z
+[1 0 0 1 187.402 482]e
+(Encapsulated Postscript \(EPS\) Figure)t
+T
+U
+%%PageTrailer
+%%Trailer
+_E end
+%%EOF
+
+%%EndDocument
+ @endspecial 141 x Fo(Fig.)37 b(5)103 b(Comparison)38
+b(of)g(steady)e(and)i(unsteady)f(normal)i(force)e(co)r(e\016cien)n(ts)h
+(as)g(a)f(function)i(of)f(angle)f(of)h(attac)n(k.)-116
+2728 y Fe(Example)43 b(of)h(a)g(\014gur)l(e)g(that)g(sp)l(ans)g(b)l
+(oth)f(c)l(olumns.)77 b(The)45 b(danger)e(is)h(that)g(the)f(\014gur)l
+(e)h(numb)l(ering)e(may)i(b)l(e)f(out)h(of)-116 2819
+y(or)l(der)39 b(sinc)l(e)e(the)i(single-c)l(olumn)d(\015o)l(at)i(and)h
+(double-c)l(olumn)f(\015o)l(at)g(c)l(ounters)g(ar)l(e)h(not)f(c)l(onne)
+l(cte)l(d)e(when)i(it)g(c)l(omes)g(to)-116 2910 y(determining)28
+b(plac)l(ement)i(or)l(der.)40 b(Y)-7 b(ou)31 b(c)l(an)f(c)l(orr)l(e)l
+(ct)g(this)h(known)f(\\fe)l(atur)l(e")i(of)f(L)2601 2893
+y Fd(A)2631 2910 y Fe(T)2675 2927 y(E)2721 2910 y(X)g(by)f(using)h(the)
+g Fc(fix2col)h Fe(p)l(ackage.)-116 4326 y @beginspecial
+144 @llx 367 @lly 488 @urx 602 @ury 2340 @rwi @setspecial
+%%BeginDocument: smpfig.eps
+%!PS-Adobe-2.0 EPSF-1.2
+%%Creator:Adobe Illustrator(TM) 1.1
+%%For: (RICHARD A WHELESS) (NASA LANGLEY)
+%%Title: (EPS)
+%%CreationDate: (2/9/99) (3:01 PM)
+%%DocumentProcessColors: Black
+%%DocumentFonts: Courier-Bold
+%%DocumentProcSets: Adobe_Illustrator_1.1 0 0
+%%BoundingBox:144 367 488 602
+%%ColorUsage: Black&White
+%AI3_IncludePlacedImages
+%%TemplateBox:306 396 306 396
+%%TileBox: 30 31 582 761
+%%DocumentPreview: Header
+%%EndComments
+%%BeginProcSet:Adobe_Illustrator_1.1 0 0
+/Adobe_Illustrator_1.1 dup 100 dict def load begin
+/Version 0 def
+/Revision 0 def
+/bdef {bind def} bind def
+/ldef {load def} bdef
+/xdef {exch def} bdef
+/_K {3 index add neg dup 0 lt {pop 0} if 3 1 roll} bdef
+/_k /setcmybcolor where 
+{/setcmybcolor get} {{1 sub 4 1 roll _K _K _K setrgbcolor pop} bind} ifelse def
+/g {/_b xdef /p {_b setgray} def} bdef
+/G {/_B xdef /P {_B setgray} def} bdef
+/k {/_b xdef /_y xdef /_m xdef /_c xdef /p {_c _m _y _b _k} def} bdef
+/K {/_B xdef /_Y xdef /_M xdef /_C xdef /P {_C _M _Y _B _k} def} bdef
+/d /setdash ldef
+/_i currentflat def
+/i {dup 0 eq {pop _i} if setflat} bdef
+/j /setlinejoin ldef
+/J /setlinecap ldef
+/M /setmiterlimit ldef
+/w /setlinewidth ldef
+/_R {.25 sub round .25 add} bdef
+/_r {transform _R exch _R exch itransform} bdef
+/c {_r curveto} bdef
+/C /c ldef
+/v {currentpoint 6 2 roll _r curveto} bdef
+/V /v ldef
+/y {_r 2 copy curveto} bdef
+/Y /y ldef
+/l {_r lineto} bdef
+/L /l ldef
+/m {_r moveto} bdef
+/_e [] def
+/_E {_e length 0 ne {gsave 0 g 0 G 0 i 0 J 0 j 1 w 10 M [] 0 d
+/Courier 20 0 0 1 z [0.966 0.259 -0.259 0.966
+_e 0 get _e 2 get add 2 div _e 1 get _e 3 get add 2 div] e _f t T grestore} if} bdef
+/_fill {{fill} stopped
+{/_e [pathbbox] def /_f (ERROR: can't fill, increase flatness) def n _E} if} bdef
+/_stroke {{stroke} stopped
+{/_e [pathbbox] def /_f (ERROR: can't stroke, increase flatness) def n _E} if} bdef
+/n /newpath ldef
+/N /n ldef
+/F {p _fill} bdef
+/f {closepath F} bdef
+/S {P _stroke} bdef
+/s {closepath S} bdef
+/B {gsave F grestore S} bdef
+/b {closepath B} bdef
+/_s /ashow ldef
+/_S {(?) exch {2 copy 0 exch put pop dup false charpath currentpoint _g setmatrix
+_stroke _G setmatrix moveto 3 copy pop rmoveto} forall pop pop pop n} bdef
+/_A {_a moveto _t exch 0 exch} bdef
+/_L {0 _l neg translate _G currentmatrix pop} bdef
+/_w {dup stringwidth exch 3 -1 roll length 1 sub _t mul add exch} bdef
+/_z [{0 0} bind {dup _w exch neg 2 div exch neg 2 div} bind {dup _w exch neg exch neg} bind] def
+/z {_z exch get /_a xdef /_t xdef /_l xdef exch findfont exch scalefont setfont} bdef
+/_g matrix def
+/_G matrix def
+/_D {_g currentmatrix pop gsave concat _G currentmatrix pop} bdef
+/e {_D p /t {_A _s _L} def} bdef
+/r {_D P /t {_A _S _L} def} bdef
+/a {_D /t {dup p _A _s P _A _S _L} def} bdef
+/o {_D /t {pop _L} def} bdef
+/T {grestore} bdef
+/u {} bdef
+/U {} bdef
+/Z {findfont begin currentdict dup length dict begin
+{1 index /FID ne {def} {pop pop} ifelse} forall /FontName exch def dup length 0 ne
+{/Encoding Encoding 256 array copy def 0 exch {dup type /nametype eq
+{Encoding 2 index 2 index put pop 1 add} {exch pop} ifelse} forall} if pop
+currentdict dup end end /FontName get exch definefont pop} bdef
+end
+%%EndProcSet
+%%EndProlog
+%%BeginSetup
+Adobe_Illustrator_1.1 begin
+n
+%%BeginEncoding: _Courier-Bold Courier-Bold
+[39/quotesingle 96/grave 128/Adieresis/Aring/Ccedilla/Eacute/Ntilde/Odieresis
+/Udieresis/aacute/agrave/acircumflex/adieresis/atilde/aring/ccedilla/eacute
+/egrave/ecircumflex/edieresis/iacute/igrave/icircumflex/idieresis/ntilde
+/oacute/ograve/ocircumflex/odieresis/otilde/uacute/ugrave/ucircumflex
+/udieresis/dagger/degree/cent/sterling/section/bullet/paragraph/germandbls
+/registered/copyright/trademark/acute/dieresis/.notdef/AE/Oslash
+/.notdef/plusminus/.notdef/.notdef/yen/mu/.notdef/.notdef
+/.notdef/.notdef/.notdef/ordfeminine/ordmasculine/.notdef/ae/oslash
+/questiondown/exclamdown/logicalnot/.notdef/florin/.notdef/.notdef
+/guillemotleft/guillemotright/ellipsis/.notdef/Agrave/Atilde/Otilde/OE/oe
+/endash/emdash/quotedblleft/quotedblright/quoteleft/quoteright/divide
+/.notdef/ydieresis/Ydieresis/fraction/currency/guilsinglleft/guilsinglright
+/fi/fl/daggerdbl/periodcentered/quotesinglbase/quotedblbase/perthousand
+/Acircumflex/Ecircumflex/Aacute/Edieresis/Egrave/Iacute/Icircumflex
+/Idieresis/Igrave/Oacute/Ocircumflex/.notdef/Ograve/Uacute/Ucircumflex
+/Ugrave/dotlessi/circumflex/tilde/macron/breve/dotaccent/ring/cedilla
+/hungarumlaut/ogonek/caron
+]/_Courier-Bold/Courier-Bold Z
+%%EndEncoding
+%%EndSetup
+0 0 0 0 k
+0 0 0 1 K
+0 i
+0 J 0 j 1 w 4 M []0 d
+%%Note:
+487.5 367.5 m
+487.5 601.5 L
+145.5 601.5 L
+145.5 367.5 L
+487.5 367.5 L
+b
+145.5 601.5 m
+487 368 l
+B
+487 601.5 m
+145 368 l
+B
+0.5 w
+450.5 478 m
+450.5 494 L
+182 494 L
+182 478 L
+450.5 478 L
+b
+u
+0 0 0 1 k
+1 w
+/_Courier-Bold 12 14.5 0 0 z
+[1 0 0 1 187.402 482]e
+(Encapsulated Postscript \(EPS\) Figure)t
+T
+U
+%%PageTrailer
+%%Trailer
+_E end
+%%EOF
+
+%%EndDocument
+ @endspecial 141 x Fo(Fig.)c(6)84 b(Unsteady)27 b(\015o)n(w)h
+(asymmetry:)37 b(side)28 b(force)h(co)r(ef-)-116 4558
+y(\014cien)n(t)h(as)f(a)h(function)h(of)f(angle)g(of)f(attac)n(k.)-116
+4731 y Fr(This)c(w)n(as)g(accomplished)f(through)h(the)h(use)f(of)g
+(the)h(in)n(viscid)-116 4831 y(3D3U)34 b(co)r(de)291
+4801 y Fp(19)396 4831 y Fr(A)i(series)d(of)i(steady)g(solutions)f(at)g
+(discrete)-116 4930 y(p)r(oin)n(ts)44 b(in)g(the)g(maneuv)n(er)f(w)n
+(ere)g(computed)i(and)e(it)i(w)n(as)-116 5030 y(sho)n(wn)21
+b(that,)i(ev)n(en)e(for)g(the)h(unrealistically)f(slo)n(w)g(pitc)n(h-o)
+n(v)n(er)-116 5130 y(rate)i(studied,)i(unsteady)e(e\013ects)h(w)n(ere)f
+(large.)34 b(More)22 b(imp)r(or-)-116 5229 y(tan)n(tly)-7
+b(,)20 b(the)f(rotation)f(maneuv)n(er)f(creates)h(\015o)n(w)g
+(asymmetries)-116 5329 y(whic)n(h)31 b(lead)h(to)f(side)h(forces)e(not)
+i(apparen)n(t)e(for)h(the)h(steady)-116 5428 y(cases.)2067
+3076 y(As)38 b(this)g(is)f(an)h(exploratory)d(study)-7
+b(,)40 b(there)e(is)g(certainly)1984 3176 y(ro)r(om)28
+b(for)g(future)h(w)n(ork.)39 b(The)29 b(follo)n(wing)f(is)h(just)g(a)f
+(handful)1984 3276 y(of)35 b(extensions)g(whic)n(h)g(w)n(ould)g(b)r(e)g
+(necessary)f(to)h(create)f(an)1984 3375 y(e\013ectiv)n(e)28
+b(design)h(to)r(ol:)39 b(incorp)r(orating)26 b(viscous)i(e\013ects,)i
+(al-)1984 3475 y(lo)n(wing)20 b(mo)n(v)-5 b(able)21 b(con)n(trol)f
+(surfaces,)i(coupling)f(a)g(six-degree-)1984 3575 y(of-freedom)j(rigid)
+g(b)r(o)r(dy)i(dynamics)f(solv)n(er,)f(adding)g(con)n(trol)1984
+3674 y(la)n(w,)j(and)g(incorp)r(orating)f(an)h(adaptiv)n(e)g(grid)g
+(capabilit)n(y)-7 b(.)2697 3854 y Ft(References)2103
+3927 y Fb(1)2137 3951 y Fi(Bek)n(ey)h(,)27 b(I.,)e(P)n(o)n(w)n(ell,)g
+(R.,)f(and)i(Austin,)f(R.,)g(\\NASA)g(Studies)h(Ac-)1984
+4030 y(cess)e(to)g(Space,")h Fa(A)l(er)l(osp)l(ac)l(e)j(A)n(meric)l(a)5
+b Fi(,)24 b(Ma)n(y)g(1994,)g(pp.)f(38{43.)2103 4093 y
+Fb(2)2137 4117 y Fi(Dornheim,)g(M.)g(A.,)g(\\NASA)g(Aw)n(ards)h(RL)-8
+b(V)24 b(Con)n(tracts,")h Fa(A)n(via-)1984 4196 y(tion)g(We)l(ek)h(&)f
+(Sp)l(ac)l(e)i(T)-5 b(e)l(chnolo)l(gy)6 b Fi(,)23 b(June)i(1994,)f(pp.)
+g(22{23.)2103 4259 y Fb(3)2137 4283 y Fi(Austin,)c(R.)f(E.)g(and)g(Co)r
+(ok,)i(S.)e(A.,)g(\\SSTO)h(Ro)r(c)n(k)n(ets:)30 b(Streamlin-)1984
+4362 y(ing)18 b(Access)h(to)h(Space,")g Fa(A)l(er)l(osp)l(ac)l(e)j(A)n
+(meric)l(a)5 b Fi(,)21 b(No)n(v.)d(1994,)i(pp.)f(34{38.)2103
+4425 y Fb(4)2137 4449 y Fi(Dornheim,)28 b(M.)g(A.,)h(\\DC-X)f
+(Demonstrates)h(Key)g(Maneuv)n(er,")1984 4528 y Fa(A)n(viation)d(We)l
+(ek)f(&)g(Sp)l(ac)l(e)i(T)-5 b(e)l(chnolo)l(gy)6 b Fi(,)24
+b(July)f(1995,)i(pp.)e(56{59.)2103 4591 y Fb(5)2137 4615
+y Fi(Da)n(vid,)52 b(L.,)f(\\DC-X)46 b(Completes)g(Piv)n(ot)h(T)-6
+b(est)47 b(Ov)n(er)g(White)1984 4694 y(Sands,")24 b Fa(Sp)l(ac)l(e)j
+(News)5 b Fi(,)23 b(V)-6 b(ol.)23 b(6,)h(No.)f(27,)h(July)g(1995,)g
+(pp.)f(1,20.)2103 4757 y Fb(6)2137 4781 y Fi(Dornheim,)32
+b(M.)f(A.,)i(\\DC-X)e(Holds)g(Promise;)j(Big)d(Questions)1984
+4860 y(Remain,")50 b Fa(A)n(viation)c(We)l(ek)g(&)f(Sp)l(ac)l(e)i(T)-5
+b(e)l(chnolo)l(gy)6 b Fi(,)52 b(Aug.)45 b(1995,)1984
+4939 y(pp.)23 b(56{59.)2103 5002 y Fb(7)2137 5026 y Fi(O'Leary)-6
+b(,)25 b(C.)f(O.,)h(W)-6 b(eir,)25 b(B.,)f(and)i(W)-6
+b(alk)n(er,)25 b(J.)g(M.,)f(\\A)h(New)g(Rig)1984 5105
+y(for)e(the)i(Measuremen)n(t)f(of)f(Rotary)i(and)f(T)-6
+b(ranslational)24 b(Deriv)l(ativ)n(es,")1984 5184 y(ICAS)18
+b(94{3.4.1,)h(Sept.)g(1994,)g(In)g(19th)g(Congress)f(of)f(the)i(In)n
+(ternational)1984 5262 y(Council)24 b(of)f(the)h(Aeronautical)h
+(Sciences)g(ICAS)f(Pro)r(ceedings.)2103 5326 y Fb(8)2137
+5350 y Fi(Edw)n(ards,)38 b(J.)e(W.)g(and)g(Malone,)i(J.)e(B.,)i
+(\\Curren)n(t)e(Status)h(of)1984 5428 y(Computational)22
+b(Metho)r(ds)g(for)f(T)-6 b(ransonic)22 b(Unsteady)h(Aero)r(dynamics)
+1808 5578 y Fg(4)i(of)g(5)p 1759 5642 300 2 v 737 5736
+a(American)g(Institute)h(of)f(Aer)o(ona)o(utics)f(and)h(Astr)o(ona)o
+(utics)h(P)-6 b(aper)25 b(98{0879)p eop
+%%Page: 5 6
+5 5 bop -116 -188 a Fi(and)37 b(Aero)r(elastic)g(Applications,")j
+Fa(A)n(GARD)e(Confer)l(enc)l(e)g(Pr)l(o)l(c)l(e)l(e)l(d-)-116
+-110 y(ings:)29 b(T)-5 b(r)l(ansonic)19 b(Unste)l(ady)g(A)l(er)l(o)l
+(dynamics)h(and)f(A)l(er)l(o)l(elasticity)6 b Fi(,)17
+b(No.)-116 -31 y(507,)24 b(Marc)n(h)f(1992,)i(pp.)e(1{1|1{24.)3
+33 y Fb(9)37 56 y Fi(Kleb,)77 b(W.)67 b(L.,)76 b(\\Aero)r(dynamic)67
+b(Characteristics)g(of)f(an)-116 135 y(Aerospace)35 b(V)-6
+b(ehicle)34 b(During)f(a)h(Subsonic)h(Pitc)n(h-Ov)n(er)f(Maneuv)n(er,")
+-116 214 y(AIAA)23 b(P)n(ap)r(er)h(96{0825,)h(Jan.)f(1996.)-28
+278 y Fb(10)37 301 y Fi(W)-6 b(o)r(o)r(ds,)28 b(W.)e(C.)g(and)h
+(Merski,)f(N.)g(R.,)g(\\Aero)r(dynamic)h(Charac-)-116
+380 y(teristics)21 b(of)g(a)g(V)-6 b(ertical)21 b(T)-6
+b(ak)n(eo\013)23 b(/)e(V)-6 b(ertical)21 b(Landing)h(\(VTVL\))g(Single)
+-116 459 y(Stage)28 b(to)f(Orbit)f(V)-6 b(ehicle)27 b(from)e(M)h(=)g
+(0.1)h(to)g(10,")h(AIAA)e(P)n(ap)r(er)h(95{)-116 538
+y(1828,)d(1995.)-28 602 y Fb(11)37 625 y Fi(Stein)n(brenner,)42
+b(J.)37 b(P)-6 b(.,)40 b(Cha)n(wner,)h(J.)c(R.,)j(and)e(F)-6
+b(outs,)42 b(C.)36 b(L.,)-116 704 y(\\The)24 b(GRIDGEN)h(3D)f(Multiple)
+g(Blo)r(c)n(k)g(Grid)f(Generation)j(System,")-116 783
+y(W)-6 b(righ)n(t)21 b(Researc)n(h)h(and)f(Dev)n(elopmen)n(t)h(Cen)n
+(ter)g(Rep)r(ort)f(WRDC{TR{)-116 862 y(90{3022,)k(Oct.)f(1989.)-28
+925 y Fb(12)37 949 y Fi(Samareh-Ab)r(olhassani,)h(J.,)h(\\GridT)-6
+b(o)r(ol:)36 b(A)25 b(Surface)i(Mo)r(deling)-116 1028
+y(and)33 b(Grid)f(Generation)j(T)-6 b(o)r(ol,")35 b Fa(Pr)l(o)l(c)l(e)l
+(e)l(dings)h(of)e(the)g(Workshop)i(on)-116 1107 y(Surfac)l(e)22
+b(Mo)l(deling,)h(Grid)e(Gener)l(ation,)i(and)g(R)l(elate)l(d)f(Issues)g
+(in)f(CFD)-116 1186 y(Solutions)5 b Fi(,)24 b(NASA)g(CP{3291,)g(Ma)n(y)
+g(1995,)g(pp.)g(821{831.)-28 1249 y Fb(13)37 1273 y Fi(P)n(eraire,)k
+(J.,)h(Morgan,)f(K.,)g(and)h(P)n(eiro,)f(J.,)g(\\Unstructured)i(Fi-)
+-116 1352 y(nite)37 b(Elemen)n(t)f(Mesh)h(Generation)h(and)f(Adaptiv)n
+(e)g(Pro)r(cedures)g(for)-116 1430 y(CFD,")27 b Fa(A)n(GARD)i(Confer)l
+(enc)l(e)h(Pr)l(o)l(c)l(e)l(e)l(dings:)42 b(Applic)l(ation)31
+b(of)f(Mesh)-116 1509 y(Gener)l(ation)c(to)f(Complex)h(3-D)f
+(Con\014gur)l(ations)5 b Fi(,)24 b(No.)f(464,)h(1990,)g(pp.)-116
+1588 y(18.1{18.12.)-28 1652 y Fb(14)37 1675 y Fi(Kennon,)j(S.)e(R.,)g
+(Mey)n(ering,)h(J.)f(M.,)g(Berry)-6 b(,)25 b(C.)g(W.,)g(and)i(Oden,)
+-116 1754 y(J.)20 b(T.,)h(\\Geometry-Based)g(Delauna)n(y)h(T)-6
+b(etrahedralization)22 b(and)g(Mesh)-116 1833 y(Mo)n(v)n(emen)n(t)30
+b(Strategies)h(for)f(Multi-Bo)r(dy)f(CFD,")h(AIAA)g(P)n(ap)r(er)g(92{)
+-116 1912 y(4575,)24 b(Aug.)g(1992.)-28 1976 y Fb(15)37
+1999 y Fi(Y)-6 b(oshinaga,)36 b(T.,)f(T)-6 b(ate,)36
+b(A.,)e(and)g(Sekine,)i(H.,)f(\\Side)e(F)-6 b(orce)34
+b(of)-116 2078 y(Blun)n(ted)i(Circular)f(Cylinders)g(at)i(High)f
+(Angles)f(of)h(A)n(ttac)n(k)h(in)f(Su-)-116 2157 y(p)r(ersonic)h(Flo)n
+(w,")j(AIAA)c(P)n(ap)r(er)h(94{3520,)42 b(Aug.)37 b(1994,)j(In)e(AIAA)
+-116 2236 y(A)n(tmospheric)23 b(Fligh)n(t)h(Mec)n(hanics)g(Conference)h
+(Pro)r(ceedings.)-28 2299 y Fb(16)37 2323 y Fi(Cobleigh,)36
+b(B.)c(R.,)j(\\High-Angle-of-A)n(ttac)n(k)f(Y)-6 b(a)n(wing)33
+b(Momen)n(t)-116 2402 y(Asymmetry)25 b(of)h(the)i(X-31)f(Aircraft)f
+(from)f(Fligh)n(t)i(T)-6 b(est,")28 b(AIAA)f(P)n(a-)-116
+2481 y(p)r(er)f(94{1803,)j(June)e(1994,)h(In)f(12th)h(AIAA)e(Applied)g
+(Aero)r(dynamics)-116 2560 y(Conference)e(Pro)r(ceedings.)-28
+2623 y Fb(17)37 2647 y Fi(Dusing,)f(D.)g(W.)g(and)h(Orkwis,)e(P)-6
+b(.)23 b(D.,)g(\\On)h(Computing)f(V)-6 b(ortex)-116 2726
+y(Asymmetries)15 b(Ab)r(out)k(Cones)f(at)g(Angle)g(of)g(A)n(ttac)n(k)h
+(Using)f(the)g(Conical)-116 2804 y(Na)n(vier-Stok)n(es)23
+b(Equations,")h(AIAA)f(P)n(ap)r(er)g(93{3628,)i(Aug.)d(1993,)i(In)-116
+2883 y(AIAA)f(A)n(tmospheric)g(Fligh)n(t)h(Mec)n(hanics)g(Conference)h
+(Pro)r(ceedings.)-28 2947 y Fb(18)37 2971 y Fi(Fisher,)h(D.)g(F.)f(and)
+i(Cobleigh,)g(B.)e(R.,)h(\\Con)n(trolling)h(F)-6 b(oreb)r(o)r(dy)-116
+3049 y(Asymmetries)16 b(in)j(Fligh)n(t|Exp)r(erience)h(with)g(Boundary)
+g(La)n(y)n(er)f(T)-6 b(ran-)-116 3128 y(sition)24 b(Strips,")h(AIAA)f
+(P)n(ap)r(er)h(94{1826,)h(June)g(1994,)f(In)g(12th)h(AIAA)-116
+3207 y(Applied)d(Aero)r(dynamics)g(Conference)i(Pro)r(ceedings.)-28
+3271 y Fb(19)37 3294 y Fi(Batina,)57 b(J.)49 b(T.,)55
+b(\\Implicit)49 b(Up)n(wind)h(Solution)g(Algorithms)-116
+3373 y(for)28 b(Three-Dimensional)f(Unstructured)j(Meshes,")f
+Fa(AIAA)i(Journal)7 b Fi(,)-116 3452 y(V)-6 b(ol.)29
+b(31,)i(No.)e(5,)i(Ma)n(y)e(1993,)j(pp.)e(801{805,)i(See)f(also)e(AIAA)
+g(P)n(ap)r(er)-116 3531 y(92{0447.)1808 5578 y Fg(5)c(of)g(5)p
+1759 5642 300 2 v 737 5736 a(American)g(Institute)h(of)f(Aer)o(ona)o
+(utics)f(and)h(Astr)o(ona)o(utics)h(P)-6 b(aper)25 b(98{0879)p
+eop
+%%Trailer
+end
+userdict /end-hook known{end-hook}if
+%%EOF
diff --git a/Master/texmf-dist/doc/latex/aiaa/pre2004/demos/paper/smpaiaa.ps.gz b/Master/texmf-dist/doc/latex/aiaa/pre2004/demos/paper/smpaiaa.ps.gz
new file mode 100644
index 00000000000..bf67a45756a
--- /dev/null
+++ b/Master/texmf-dist/doc/latex/aiaa/pre2004/demos/paper/smpaiaa.ps.gz
diff --git a/Master/texmf-dist/doc/latex/aiaa/pre2004/demos/paper/smpaiaa.tex b/Master/texmf-dist/doc/latex/aiaa/pre2004/demos/paper/smpaiaa.tex
new file mode 100644
index 00000000000..7f6216014c1
--- /dev/null
+++ b/Master/texmf-dist/doc/latex/aiaa/pre2004/demos/paper/smpaiaa.tex
@@ -0,0 +1,391 @@
+%
+% latex2e adocument: smpaiaa.tex
+%
+%  sample AIAA conference paper, journal article,
+%  journal note, and journal submission
+%
+%  -- bil kleb <10 jan 97>
+%
+
+\documentclass[cover]{aiaa}% options: paper, article, note,
+                           %          cover, and/or submit
+
+% note: until we reach \begin{document}, we're in the `preamble'
+
+% load items used by the aiaa class:
+
+% for a conference paper (`paper' option [default]):
+\PaperNumber{98--0879}
+\PaperNotice{\CopyrightD{1999}}
+\CoverFigure{smpfig}% [optional cover figure]
+\Conference{{\bfseries 36th AIAA Aerospace Sciences \\
+            Meeting and Exhibit} \\
+            January~12--15,~1998/Reno,~NV}
+
+% for journal submission (`submit' option):
+\SubmitName{Kleb ET AL.\ (A10659)}
+
+% for journal simulation (`article' or `note' options):
+\JournalName{Journal of Spacecraft and Rockets}
+\JournalPage{39}
+\JournalIssue{Volume~36, Number~2}
+\JournalNotice{Presented as Paper~98--0879 at the AIAA
+               36th Aerospace Sciences Meeting, Reno,~NV,
+               Jan.~12--15,~1998; received Feb.~13,~1998;
+               revision received Sept.~18,~1998;
+               accepted for publication Oct.~1,~1998.
+               \CopyrightD{1999}}
+
+% specific to journal article:
+\ArticleIssue{Vol.~36, No.~2, March--April 1999}% first page
+\ArticleHeader{Kleb ET AL.}%                      subsequent pages
+
+% specific to journal note:
+\NoteHeader{J.Spacecraft, Vol.~36, No.~2: Engineering Notes}
+
+% load the title, author, and abstract for use with the \maketitle command
+
+\title{Simulation of an Aerospace Vehicle \\
+       Pitch-Over Maneuver}
+                                
+\author{
+%
+William L.~Kleb%
+%
+  \thanks{Research Engineer, Aerothermodynamics Branch,
+          Aero- and Gas-Dynamics Division,
+          Research and Technology Group.} \\
+%
+         {\itshape NASA Langley Research Center,
+                   Hampton,~VA~23681}\\[5pt]
+%
+A.~N.~Author%
+%
+  \thanks{Deligent worker,
+          AIAA member.}
+%
+\ and Y.~F.~Anotherlongername%
+%
+  \thanksibid{2} \\ % use same footnote as second author
+%
+         {\itshape Someother Affliation,
+         Atown,~ST~98293}
+}
+
+\abstract{{\em Note: this abstract does not appear when a
+journal note simulation is the chosen option.}  The objective of
+the present work is to summarize the application of unsteady
+computational fluid dynamic methods to the problem of predicting
+verticle take-off/vertical landing vehicle aerodynamics during an
+un-powered pitch-over maneuver.  In addition to the
+time-dependent simulation of a pitch-over maneuver, a series of
+steady solutions at discrete points are also computed for
+comparison with wind-tunnel measurements and as a means of
+quantifying unsteady effects.  As this application represents a
+new challenge to unsteady computational fluid dynamics,
+observations concerning grid resolution, far-field boundary
+placement, temporal resolution, and the suitability of assuming
+flow-field symmetry are discussed.}
+
+
+\begin{document}
+
+\maketitle%  create the cover page, title block, and notices
+
+\section{Nomenclature}% you could have this generated
+                      % automatically via the nomenclature package
+
+\begin{tabbing}
+12345678 \= Reynolds number based on length $s$ \kill
+$c$      \> Sound speed, m/s \\
+$M$      \> Mach number \\
+$P$      \> Pressure, Pa \\
+$Re_s$   \> Reynolds number based on length $s$ \\
+$T$      \> Temperature, K \\
+$V$      \> Velocity, m/s \\
+$x,y,z$  \> Cartesian body axes, m \\
+$\alpha$ \> Angle of attack, deg \\
+$\eta$   \> Wall-normal distance, m \\
+$\rho$   \> Density, kg/m$^3$
+\end{tabbing}
+
+\subsection{Subscripts}
+\begin{tabbing}
+12345678 \= \kill
+$tran$   \> Transition \\
+$w$      \> Wall \\
+$\infty$ \> Freestream
+\end{tabbing}
+
+\subsection{Superscripts}
+\begin{tabbing}
+12345678  \= \kill
+$0$       \> Fiduciary point \\
+$n\!+\!1$ \> Time level
+\end{tabbing}
+
+\section{Introduction}
+
+\dropword NASA's Access to Space Study\cite{bekey:94ja}
+recommends the development of a {\em fully}\ reusable launch
+vehicle\cite{dornheim:94awst} to replace the aged Space
+Shuttle. {\em The \verb+\dropword+ command created the hanging
+capital letter and automatically capitalizes the rest of the
+word.}  A method of reaching this goal is to develop a vehicle
+which does not rely on expendable boosters to reach orbit, a
+single-stage-to-orbit vehicle\cite{austin:94ja}.  One such
+configuration being investigated is a Vertical Take-off and
+Vertical Landing (VTVL) concept\cite{austin:94ja}.  In one
+scenario, the VTVL vehicle, upon completion of its mission in
+low-Earth orbit, reenters nose first, decelerates to subsonic
+speeds, and then performs a rotation
+maneuver\cite{dornheim:95awst,david:95sn,dornheim:95awst2} to
+land vertically.
+
+
+Figure~\ref{f:trn2lndg} presents a schematic of the last portion
+of a typical VTVL entry.
+\begin{figure}
+  \incfig{smpfig}
+  \caption{Transition to landing for a VTVL vehicle.}
+  \label{f:trn2lndg}
+\end{figure}
+The pitch-over maneuver, which occurs near Mach 0.2, is
+characterized by high angle of attack, unsteady, vortical flow.
+Accurately predicting vehicle performance during this aerodynamic
+pitch-over maneuver is quite challenging. While ground-based
+facilities can readily predict the vehicle's aerodynamics at
+discrete points during the maneuver, simulating the transient
+motion in a wind tunnel is difficult.\cite{oleary:94cp}
+Time-dependent Computational Fluid Dynamics (CFD) offers another
+means of analyzing the pitch-over maneuver. The majority of work
+in unsteady CFD has, however, been restricted to small amplitude,
+harmonic variations in angle of attack in support of aeroelastic
+flutter predictions.\cite{edwards:92cp}
+
+The objective of the present work is to summarize the application
+of unsteady CFD methods to the problem of predicting VTVL vehicle
+aerodynamics during an un-powered pitch-over maneuver (further
+details are available in the companion conference
+paper\cite{kleb:96cp}).  In addition to the time-dependent
+simulation of a pitch-over maneuver, a series of steady solutions
+at discrete points are also computed for comparison with
+wind-tunnel measurements and as a means of quantifying unsteady
+effects.  As this application represents a new challenge to
+unsteady CFD, observations concerning grid resolution, far-field
+boundary placement, temporal resolution, and the suitability of
+assuming flow-field symmetry are documented in
+Ref.~\citen{kleb:96cp}.
+
+\section{Geometry}
+
+The vehicle's fore body is an 8 deg half-angle sphere cone with
+nose radius equal to 0.3 of the base radius.  The aft body,
+beginning at the 85 percent fuselage station, is a cylinder with
+a partially squared-off cross-section producing flat ``slices''
+extending from the base of the vehicle to approximately the 60
+percent fuselage station.  The vehicle has a fineness ratio of
+6.4.  A complete description of the vehicle geometry modeled has
+been given by Woods in Ref.~\citen{woods:95cp}.
+
+{\em Through the generosity of Karen Bibb, we have a
+demonstration of a subfigure situation.  Note that with imbedded
+labels you can refer to Fig.~\ref{fig:both} as a whole or
+specifically, things in Fig.~\ref{fig:first} or
+Fig.~\ref{fig:second}.}  An early Lockheed-Martin X-33
+configuration was used in the remainder of the examples.  The
+full vehicle is shown in Fig.~\ref{fig:both}.
+\begin{figure}
+  \begin{subfigmatrix}{1}
+    \subfigure[\bf First pretty picture.]
+              {\incfig{smpfig}\label{fig:first}}
+    \subfigure[\bf Second pretty picture.]
+              {\incfig{smpfig}\label{fig:second}}
+  \end{subfigmatrix}
+  \caption{Temperature distribution comparisons at various wing
+           semi-span stations as a function of chord.  Whuh?}
+  \label{fig:both}
+\end{figure}
+This configuration (B1001A) was evaluated during
+Phase I of the X-33 program.  It has twin vertical tails, fins,
+and outboard body flaps.  The engines are modeled by the box-shaped
+structure on the base.  {\em We can also have a ``table'' of two,
+or four, or more figures as in Fig.~\ref{fig:four}.}
+\begin{figure}
+  \begin{subfigmatrix}{2}
+    \subfigure[\bf First pretty picture.]
+      {\incfig{smpfig}}
+    \subfigure[\bf Second pretty picture.]
+      {\incfig{smpfig}}
+    \subfigure[\bf Second pretty picture, again.]
+      {\incfig{smpfig}}
+    \subfigure[\bf First pretty picture, again.]
+      {\incfig{smpfig}}
+ \end{subfigmatrix}
+  \caption{Four small figures in a table-like setting.}
+  \label{fig:four}
+\end{figure}
+
+\section{Computational Mesh}
+
+The underlying surface definition database was generated from
+structured surface patches obtained using
+GRIDGEN\cite{GRIDGEN3D_release}, GridTool\cite{GridTool}, and
+simple analytical methods.  The unstructured surface and
+flow-field grids were then generated using
+FELISA\cite{peraire:90cp} and TETMESH.\cite{kennon:92cp} The
+coarsest mesh has 32,374 tetrahedra with 6,634 nodes.  Additional
+meshes are described in Ref.~\citen{kleb:96cp}; however, all the
+results shown here are the result of the coarsest meshes.
+
+Since the flow about symmetric configurations at high angles of attack,
+even with zero side-slip, often involve asymmetric, vortex-dominated,
+features,\cite{yoshinaga:94cp,cobleigh:94cp,dusing:93cp,fisher:94cp}
+two different options for the computational domain were employed:
+one modeling the complete vehicle and another modeling only half
+of the vehicle, assuming symmetry across the pitch-plane.  This
+aspect of the study is covered in Ref.~\citen{kleb:96cp}.
+
+\section{Numerical Method}
+
+The 3D3U code of Batina\cite{batina:93aij} was used exclusively in this
+study. The 3D3U code was originally developed to study harmonically
+pitching wings and wing-bodies in transonic flow.  The code can
+incorporate aeroelastic effects through assumed mode shapes, coupled
+with a deforming mesh via the linear spring analogy.
+
+The following defaults were used for the computed results in this
+study: Roe's flux-difference splitting, an eigenvalue limiter
+threshold value of 0.3, second-order flux reconstruction using a
+$\kappa$ of 0.5, and Gauss-Seidel implicit time integration with
+a CFL number of one million.
+
+\section{Maneuver Definition}
+
+The pitch schedule chosen for this study is the first half of a
+sine function.  Initially, the vehicle is in steady flight at
+17.5 degrees angle of attack, Mach 0.2.  At time zero, the
+vehicle begins the pitch-over maneuver, reaching a maximum pitch
+rate exactly half-way through the maneuver and finishing at a 180
+deg angle of attack.  For this study, the time to complete the
+maneuver was chosen as 90 seconds, giving a maximum rotation rate
+of 3.1 deg per second halfway through the maneuver.  For
+simplicity, it is assumed that the free-stream Mach number
+remains constant throughout the maneuver.
+
+{\em Sticking in a table for guidance (see Table~\ref{tab:sample}).}
+\begin{table}[htbp]
+  \begin{center}
+    \caption{A sample table}
+    \begin{tabular}{ccc} \hline\hline
+      \multicolumn{2}{c}{Header 1} & Header 2 \\ \hline
+      a & b & c \\
+      d & e & f \\ \hline\hline
+    \end{tabular}
+    \label{tab:sample}
+  \end{center}
+\end{table}
+Normally there would be text following the table, so that it
+is not left ``hanging'' into the next section.
+
+\section{Results}
+
+The main results are presented in two stages which are followed
+by comments on flow asymmetries for both steady and unsteady
+flows.  The first stage is computed steady data as it compares to
+experimental results.  while the second is a comparison of steady
+to unsteady data.
+
+\subsection{Steady Flow}
+
+As a baseline to examine the unsteady effects of the pitch-over
+maneuver itself, steady flow at selected angles of attack were
+computed.  Figure~\ref{f:expcomp} shows a comparison of the
+normal force coefficient with the experimental data of
+Woods\cite{woods:95cp} for angles of attack from 0 to 60 deg.
+\begin{figure}
+   \incfig{smpfig}
+   \caption{Comparison of steady normal force coefficient as a
+     function of angle of attack with experimental data of
+     Woods\protect{\cite{woods:95cp}}}
+   \label{f:expcomp}
+\end{figure}
+The computed results agree well (within 20 percent) at small angles of attack,
+and diverge from the experimental results as the angle
+of attack increases largely due to the position of the lee-side
+separation line---a viscous phenomenon.
+Since the computed results are modeling inviscid
+flow, the only mechanism for flow separation is the numerical
+dissipation in the scheme.  Thus, the exact location of the computed
+separation line is highly grid and scheme dependent. Compounding
+this is the fact that the lee-side separation line nearly
+encompasses the length of the vehicle; and thus, a slight
+deviation can make a large difference in the integrated coefficients.
+
+\subsection{Unsteady Flow}
+
+Figure~\ref{f:aerocomp} compares the normal force coefficient of
+both the steady and unsteady calculations.
+\begin{figure*}
+  \incfig{smpfig}
+  \caption{Comparison of steady and unsteady normal force
+    coefficients as a function of angle of attack.  {\em Example
+    of a figure that spans both columns.  The danger is that the
+    figure numbering may be out of order since the single-column
+    float and double-column float counters are not connected when
+    it comes to determining placement order.  You can correct this
+    known ``feature'' of \LaTeX{} by using the \texttt{fix2col} package.}}
+ \label{f:aerocomp}
+\end{figure*}
+The solid line represents the unsteady results and the symbols
+are the steady-flow results.  Readily discernible is the fact
+that the steady and unsteady results are significantly different.
+The time-dependent results have the time lag behavior expected
+for moderately unsteady flow: showing the same general
+qualitative trend throughout the angle-of-attack range, but with
+the unsteady results lagging behind the steady results. Other
+aerodynamic coefficients show similar
+differences.\cite{kleb:96cp}
+
+\subsection{Flow Asymmetry}
+
+As documented in Ref.~\citen{kleb:96cp}, no appreciable
+asymmetries were found for the steady flow cases computed
+although they were present in the experimental data of
+Woods\cite{woods:95cp}.  However, for the unsteady case,
+asymmetric flow is apparent as shown in Figure{f:uasym}.
+\begin{figure}[t]
+  \incfig{smpfig}
+  \caption{Unsteady flow asymmetry: side force coefficient as a
+    function of angle of attack.}
+  \label{f:uasym}
+\end{figure}
+This figure shows the appearance of a non-zero side-force similar
+to that reported for {\em steady} flow by Woods\cite{woods:95cp}.
+The most significant manifestations of the asymmetries occur in
+the 90 to 135 deg angle-of-attack range.
+
+\section{Concluding Remarks}
+
+The objective of the present work was to focus an unsteady CFD
+method on the prediction of VTVL vehicle aerodynamics during a
+pitch-over maneuver.  This was accomplished through the use of
+the inviscid 3D3U code\cite{batina:93aij} A series of steady
+solutions at discrete points in the maneuver were computed and it
+was shown that, even for the unrealistically slow pitch-over rate
+studied, unsteady effects were large.  More importantly, the
+rotation maneuver creates flow asymmetries which lead to side
+forces not apparent for the steady cases.
+
+As this is an exploratory study, there is certainly room for
+future work. The following is just a handful of extensions which
+would be necessary to create an effective design tool:
+incorporating viscous effects, allowing movable control surfaces,
+coupling a six-degree-of-freedom rigid body dynamics solver,
+adding control law, and incorporating an adaptive grid
+capability.
+
+\bibliography{smpbtx}
+\bibliographystyle{aiaa}
+
+\end{document}
diff --git a/Master/texmf-dist/doc/latex/aiaa/pre2004/demos/paper/smpbtx.bib b/Master/texmf-dist/doc/latex/aiaa/pre2004/demos/paper/smpbtx.bib
new file mode 100644
index 00000000000..652f6d94db0
--- /dev/null
+++ b/Master/texmf-dist/doc/latex/aiaa/pre2004/demos/paper/smpbtx.bib
@@ -0,0 +1,222 @@
+
+`smpbtx.bib' sample bibtex database:
+
+to be used from a LaTeX2e document via the,
+
+  \thebibliography{smpbtx}
+
+command.  to process the LaTeX file to include
+the references, a command sequence like,
+
+  latex file
+  bibtex file
+  latex file
+  latex file
+
+would be used.
+
+bil kleb <w.l.kleb(at)larc.nasa.gov> [13 dec 96]
+
+@techreport{GRIDGEN3D_release,
+ author = {J. P. Steinbrenner and J. R. Chawner and C. L. Fouts},
+ title  = {The GRIDGEN 3D Multiple Block Grid Generation System},
+ type   = {Wright Research and Development Center Report},
+ number = {WRDC--TR--90--3022},
+ month  = oct,
+ year   = 1989
+}
+
+@inproceedings{GridTool,
+ author      = {Samareh-Abolhassani, J.},
+ title       = {GridTool: A Surface Modeling and Grid
+   Generation Tool},
+ booktitle   = {Proceedings of the Workshop on Surface Modeling, Grid
+   Generation, and Related Issues in CFD Solutions},
+ publisher   = {NASA CP--3291},
+ pages       = {821--831},
+ month	     = may,
+ year        = 1995
+}
+
+@article{austin:94ja,
+ author = {Robert E. Austin and Stephen A. Cook},
+ title  = {SSTO Rockets: Streamlining Access to Space},
+ journal= {Aerospace America},
+ month  = nov,
+ year   = 1994,
+ pages  = {34--38}
+}
+
+@article{batina:93aij,
+ author = {John T. Batina},
+ title  = {Implicit Upwind Solution Algorithms for Three-Dimensional
+Unstructured Meshes},
+ journal= {AIAA Journal},
+ volume = 31,
+ number = 5,
+ pages  = {801--805},
+ month  = may,
+ year   = 1993,
+ note   = {See also AIAA Paper 92--0447.}
+}
+
+@article{bekey:94ja,
+ author = {Ivan Bekey and Richard Powell and Robert Austin},
+ title  = {NASA Studies Access to Space},
+ journal= {Aerospace America},
+ month  = may,
+ year   = 1994,
+ pages  = {38--43}
+}
+
+@techreport{cobleigh:94cp,
+ author = {Brent R. Cobleigh},
+ title  = {High-Angle-of-Attack Yawing Moment Asymmetry of the X-31
+		  Aircraft from Flight Test},
+ type   = {AIAA Paper},
+ number = {94--1803},
+ month  = jun,
+ year   = 1994,
+ note   = {In 12th AIAA Applied Aerodynamics Conference Proceedings}
+}
+
+@article{david:95sn,
+ author = {Leonard David},
+ title  = {DC-X Completes Pivot Test Over White Sands},
+ journal= {Space News},
+ month  = jul,
+ volume = 6,
+ number = 27,
+ year   = 1995,
+ pages  = {1,20},
+ mynote = {pitchover maneuver}
+}
+
+@article{dornheim:94awst,
+ author = {Michael A. Dornheim},
+ title  = {NASA Awards RLV Contracts},
+ journal= {Aviation Week \& Space Technology},
+ month  = jun,
+ year   = 1994,
+ pages  = {22--23}
+}
+
+@article{dornheim:95awst,
+ author = {Michael A. Dornheim},
+ title  = {DC-X Demonstrates Key Maneuver},
+ journal= {Aviation Week \& Space Technology},
+ month  = jul,
+ year   = 1995,
+ pages  = {56--59},
+ mynote = {pitchover maneuver}
+}
+
+@article{dornheim:95awst2,
+ author = {Michael A. Dornheim},
+ title  = {DC-X Holds Promise; Big Questions Remain},
+ journal= {Aviation Week \& Space Technology},
+ month  = aug,
+ year   = 1995,
+ pages  = {56--59},
+ mynote = {pitchover maneuver}
+}
+
+@techreport{dusing:93cp,
+ author = {Douglas W. Dusing and Paul D. Orkwis},
+ title  = {On Computing Vortex Asymmetries About Cones at Angle of
+		  Attack Using the Conical Navier-Stokes Equations},
+ type   = {AIAA Paper},
+ number = {93--3628},
+ month  = aug,
+ year   = 1993,
+ note   = {In AIAA Atmospheric Flight Mechanics Conference Proceedings}
+}
+
+@inproceedings{edwards:92cp,
+ author    = {John W. Edwards and John B. Malone},
+ title     = {Current Status of Computational Methods for Transonic
+                Unsteady Aerodynamics and Aeroelastic Applications},
+ booktitle = {AGARD Conference Proceedings: Transonic Unsteady
+		  Aerodynamics and Aeroelasticity},
+ number    = 507,
+ pages     = {{1-1---1-24}},
+ month     = mar,
+ year      = 1992
+}
+
+@techreport{fisher:94cp,
+ author = {David F. Fisher and Brent R. Cobleigh},
+ title  = {Controlling Forebody Asymmetries in Flight---Experience with
+		  Boundary Layer Transition Strips},
+ type   = {AIAA Paper},
+ number = {94--1826},
+ month  = jun,
+ year   = 1994,
+ note   = {In 12th AIAA Applied Aerodynamics Conference Proceedings},
+ mynote = {asymmetry}
+}
+
+@techreport{kennon:92cp,
+ author = {Steve R. Kennon and J. M. Meyering and C. W. Berry and J. T. Oden},
+ title  = {Geometry-Based Delaunay Tetrahedralization and Mesh
+            Movement Strategies for Multi-Body CFD},
+ type   = {AIAA Paper},
+ number = {92--4575},
+ month  = aug,
+ year   = 1992
+}
+
+@techreport{kleb:96cp,
+ author = {William L. Kleb},
+ title  = {Aerodynamic Characteristics of an Aerospace Vehicle
+            During a Subsonic Pitch-Over Maneuver},
+ type   = {AIAA Paper},
+ number = {96--0825},
+ month  = jan,
+ year   = 1996
+}
+
+@techreport{oleary:94cp,
+ author = {C. O. O'Leary and B. Weir and J. M. Walker},
+ title  = {A New Rig for the Measurement of Rotary and Translational
+            Derivatives},
+ type   = {ICAS},
+ number = {94--3.4.1},
+ month  = sep,
+ year   = 1994,
+ note   = {In 19th Congress of the International Council of the
+		  Aeronautical Sciences ICAS Proceedings}
+}
+
+@inproceedings{peraire:90cp,
+ author    = {J. Peraire and Kenneth Morgan and J. Peiro},
+ title     = {Unstructured Finite Element Mesh Generation and Adaptive
+		  Procedures for CFD},
+ booktitle = {AGARD Conference Proceedings: Application of Mesh
+		  Generation to Complex 3-D Configurations},
+ number    = 464,
+ pages     = {18.1--18.12},
+ year      = 1990
+}
+
+@techreport{woods:95cp,
+ author = {William C. Woods and Norman R. Merski},
+ title  = {Aerodynamic Characteristics of a Vertical Takeoff / Vertical
+		  Landing (VTVL) Single Stage to Orbit Vehicle from
+		  M = 0.1 to 10},
+ type   = {AIAA Paper},
+ number = {95--1828},
+ year   = 1995
+}
+
+@techreport{yoshinaga:94cp,
+ author = {Takashi Yoshinaga and Atsushi Tate and Hideo Sekine},
+ title  = {Side Force of Blunted Circular Cylinders at High Angles of
+		  Attack in Supersonic Flow},
+ type   = {AIAA Paper},
+ number = {94--3520},
+ month  = aug,
+ year   = 1994,
+ note   = {In AIAA Atmospheric Flight Mechanics Conference Proceedings},
+ mynote = {asymmetry}
+}
diff --git a/Master/texmf-dist/doc/latex/aiaa/pre2004/demos/paper/smpfig.eps b/Master/texmf-dist/doc/latex/aiaa/pre2004/demos/paper/smpfig.eps
new file mode 100644
index 00000000000..498eff7173c
--- /dev/null
+++ b/Master/texmf-dist/doc/latex/aiaa/pre2004/demos/paper/smpfig.eps
@@ -0,0 +1,340 @@
+%!PS-Adobe-2.0 EPSF-1.2
+%%Creator: TECPLOT
+%%Pages:1
+%%BoundingBox: 32 199 575 580
+%%DocumentFonts: Helvetica Helvetica-Bold Symbol Times-Roman Times-Bold Times-Italic Times-BoldItalic Courier Courier-Bold
+%%EndComments
+/tecplotdict 120 dict def
+tecplotdict begin
+/ed  {exch def} def
+/ftl {findfont exch scalefont setfont} def
+/ftr {/Times-Roman ftl} def
+/ftb {/Times-Bold ftl} def
+/fti {/Times-Italic ftl} def
+/ftib {/Times-BoldItalic ftl} def
+/fcr {/Courier ftl} def
+/fcb {/Courier-Bold ftl} def
+/fhn {/Helvetica ftl} def
+/fhb {/Helvetica-Bold ftl} def
+/fsy {/Symbol ftl} def
+/gs /gsave load def
+/gr /grestore load def
+/np /newpath load def
+/cp /closepath load def
+/sg /setgray load def
+/lc {stroke setlinecap} def
+/lj /setlinejoin load def
+/x /setrgbcolor load def
+/y {x moveto} def
+/g /get load def
+/sd /setdash load def
+/s {stroke setlinewidth} def
+/cpt /currentpoint load def
+/m {stroke moveto} def
+/rm /rmoveto load def
+/l /lineto load def
+/r /rlineto load def
+/sf /setflat load def
+/st /stroke load def
+/ct  {cpt st} def
+/stg {st sg} def
+/scg {cpt m sg} def
+/ro /rotate load def
+/sh /show load def
+/clp {st cp gr gs np moveto l l l cp clip np cp} def
+/er {cpt cp np moveto r r r cp sg fill 0 sg cp} def
+/erc {cpt cp np moveto r r r cp x fill 0 sg cp} def
+/br {cpt cp np moveto r r r cp sg cp} def
+/brc {cpt cp np moveto r r r cp x cp} def
+/cir1 {cpt cp m} def
+/cir2 {cp fill cp} def
+/ii 0 def
+/n 0 def
+/CurA 0 def
+/Ry 0 def
+/Rx 0 def
+/CA 0 def
+/SA 0 def
+/SJ 0 def
+/SI 0 def
+/bi 0 def
+/i 0 def
+/ib 0 def
+/ig 0 def
+/ir 0 def
+/ishade 0 def
+/bshade 0 def
+
+/z
+{
+  /ii ed
+  rea ii get
+  gra ii get
+  bla ii get
+} def
+
+/lrgb
+{
+  /ii ed
+  /blue ed
+  /green ed
+  /red ed
+  bla ii blue put
+  gra ii green put
+  rea ii red put
+} def
+
+/trace
+{
+  cp np
+  m
+  1 1 n 
+    {
+      pop
+      r
+    } for
+   cp
+} def
+
+/f
+{
+  /ishade ed
+  /n ed 
+  st
+  trace
+  ishade sg fill
+} def
+
+/b
+{
+  /bshade ed
+  /n ed 
+  m
+  1 1 n 
+    {
+      pop
+      r
+    } for
+  bshade sg stroke
+} def
+
+/fb
+{
+  /bshade ed
+  /ishade ed
+  /n ed 
+  st 
+  n 2 mul 2 add copy
+  trace
+  ishade sg fill
+  trace
+  bshade sg stroke
+} def
+
+/c
+{
+  /n ed 
+  st 
+  trace
+  stroke
+} def
+
+/fc
+{
+  /i ed
+  /n ed 
+  st 
+  trace
+  i z x fill
+} def
+
+/fd
+{
+  /ib ed
+  /ig ed
+  /ir ed
+  /n ed 
+  st 
+  trace
+  ir ig ib x fill
+} def
+
+/bc
+{
+  /i ed
+  /n ed 
+  m
+  1 1 n 
+    {
+      pop
+      r
+    } for
+  i z x stroke
+} def
+
+/fbc
+{
+  /ii ed
+  /bi ed
+  /n ed 
+  st 
+  n 2 mul 2 add copy
+  trace
+  ii z x fill
+  trace
+  bi z x stroke
+} def
+/fbd
+{
+  /ib ed
+  /ig ed
+  /ir ed
+  /bi ed
+  /n ed 
+  st 
+  n 2 mul 2 add copy
+  trace
+  ir ig ib x fill
+  trace
+  bi z x stroke
+} def
+/e
+{
+  /Ry ed
+  /Rx ed
+  /CA ed
+  /SA ed
+  /SJ ed
+  /SI ed
+
+  /DelX SA cos Rx mul def
+  /DelY SA sin Ry mul def
+  /XI SI DelX add def
+  /YI SJ DelY add def
+  /OCX DelX def
+  /OCY DelY def
+  /N 0 def
+  SA CA add
+  CA
+  SA 360 add
+    {
+     /CurA ed
+     /CX CurA cos Rx mul def
+     /CY CurA sin Ry mul def
+     OCX CX sub 
+     OCY CY sub 
+     /OCX CX def
+     /OCY CY def
+     /N N 1 add def
+    }
+  for
+  XI YI N
+} def
+%%EndProlog
+%%Page:? 1
+5 setmiterlimit
+0.0708661 0.0708661 scale np
+gs
+2 lc
+0 lj
+455 2817 455 8195 8118 8195 8118 2817 clp
+456 2818 m
+1 0 -5376 7661 0 0 5376 er
+494 2844 494 8168 8080 8168 8080 2844 clp
+455 2817 455 8195 8118 8195 8118 2817 clp
+494 2844 494 8168 8080 8168 8080 2844 clp
+455 2817 455 8195 8118 8195 8118 2817 clp
+0 stg
+494 2844 494 8168 8080 8168 8080 2844 clp
+0 stg
+26.8787 s
+514 2868 m
+0 0 -5259 7536 0 0 5259 br
+0 stg
+7536 5259 514 2868 1 0 b
+0 stg
+7536 -5259 514 8128 1 0 b
+5.37574 s
+0 -430 6344 0 0 430 1099 5281 3 1 0 fb
+1179 5402 m
+268.787 fcb
+0 sg
+(E) sh
+1351 5402 m
+(n) sh
+1523 5402 m
+(c) sh
+1694 5402 m
+(a) sh
+1866 5402 m
+(p) sh
+2038 5402 m
+(s) sh
+2210 5402 m
+(u) sh
+2381 5402 m
+(l) sh
+2553 5402 m
+(a) sh
+2725 5402 m
+(t) sh
+2896 5402 m
+(e) sh
+3068 5402 m
+(d) sh
+3240 5402 m
+( ) sh
+3412 5402 m
+(P) sh
+3583 5402 m
+(o) sh
+3755 5402 m
+(s) sh
+3927 5402 m
+(t) sh
+4099 5402 m
+(s) sh
+4270 5402 m
+(c) sh
+4442 5402 m
+(r) sh
+4614 5402 m
+(i) sh
+4786 5402 m
+(p) sh
+4957 5402 m
+(t) sh
+5129 5402 m
+( ) sh
+5301 5402 m
+(\() sh
+5472 5402 m
+(E) sh
+5644 5402 m
+(P) sh
+5816 5402 m
+(S) sh
+5988 5402 m
+(\)) sh
+6159 5402 m
+( ) sh
+6331 5402 m
+(F) sh
+6503 5402 m
+(i) sh
+6675 5402 m
+(g) sh
+6846 5402 m
+(u) sh
+7018 5402 m
+(r) sh
+7190 5402 m
+(e) sh
+455 2817 455 8195 8118 8195 8118 2817 clp
+0 stg
+494 2844 494 8168 8080 8168 8080 2844 clp
+455 2817 455 8195 8118 8195 8118 2817 clp
+5.37574 s
+494 2844 494 8168 8080 8168 8080 2844 clp
+st gr end
+showpage
diff --git a/Master/texmf-dist/doc/latex/aiaa/pre2004/demos/refs/tstbtx.bib b/Master/texmf-dist/doc/latex/aiaa/pre2004/demos/refs/tstbtx.bib
new file mode 100644
index 00000000000..f34c6c8e6ab
--- /dev/null
+++ b/Master/texmf-dist/doc/latex/aiaa/pre2004/demos/refs/tstbtx.bib
@@ -0,0 +1,105 @@
+@InCollection{turner:64a,
+  author = 	 {M. J. Turner and H. C. Martin and R. C. Leible},
+  title = 	 {Further Development and Applications of Stiffness Methods},
+  booktitle = 	 {Matrix Methods of Structural Analysis},
+  year = 	 1964,
+  edition =      {1st},
+  publisher =    {Macmillian},
+  address =      {New York},
+  volume =	 1,
+  pages =	 {203-266}
+  }
+
+@Article{bhutta:90jsr,
+  author = 	 {B. A. Bhutta and C. H. Lewis},
+  title = 	 {Large-Angle-of-Attack Vicous Hypersonic Flows over
+                  Complex Lifting Configurations},
+  journal = 	 {Journal of Spacecraft and Rockets},
+  year = 	 1990,
+  volume =	 27,
+  number =	 2,
+  pages =	 {194-204},
+  note =	 {also AIAA Paper 89--0269, Jan. 1989}
+}
+
+@InCollection{blottner:70cp,
+  author = 	 {F. G. Blottner},
+  title = 	 {Prediction of Electron Density in the Boundary Layer
+                  of Entry Vehicles with Ablation},
+  booktitle = 	 {The Entry Plasma Sheath and Its Effects},
+  type =         {NASA SP--252},
+  volume =	 1,
+  year =	 1970,
+  month =	 oct,
+  pages =	 {219--240}
+}
+
+@InProceedings{wirin:90cp,
+  author = 	 {W. B. Wirin},
+  title = 	 {Space Debris 1989},
+  booktitle = 	 {Proceedings of the Thrity-Second Colloquium
+                 on the Law of Outer Space},
+  year =	 1990,
+  publisher =	 {AIAA},
+  address =	 {Wahington, DC},
+  pages =	 {184--196}
+}
+
+@TechReport{bhutta:90vra,
+  author = 	 {B. A. Bhutta and C. H. Lewis},
+  title = 	 {PNS Predictions of External/Internal Hypersonic Flows
+                  for NASP Propulsion Applications},
+  institution =  {VRA, Inc.},
+  type =         {VRA--TR--90--01},
+  year = 	 1990,
+  address =	 {Blacksburg, VA},
+  month =	 jun
+}
+
+@TechReport{miner:75ncr,
+  author = 	 {E. W. Miner and C. H. Lewis},
+  title = 	 {Hypersonic Ionizing Air Viscous Shock-Layer Flows
+                  over Nonanlytic Blunt Bodies},
+  year = 	 1975,
+  type =	 {NASA CR--2250},
+  month =	 may
+}
+
+@TechReport{bhutta:90cp,
+  author = 	 {B. A. Bhutta and C. H. Lewis},
+  title = 	 {Aerothermodynamic Performance of 3-D and Bent-Nose RVs
+                  Hypersonic Conditions},
+  year = 	 1990,
+  type =	 {AIAA Paper 90--3068},
+  month =	 aug
+}
+
+
+@InCollection{sutton:85ar,
+  author = 	 {K. Sutton},
+  title = 	 {Air Radiation Revisted},
+  booktitle = 	 {Thermal Design of Aeroassisted Orbital Transfer Vehicles},
+  publisher =	 {AIAA},
+  year =	 1985,
+  editor =	 {H. F. Nelson},
+  volume =	 96,
+  type =	 {Progress in Astronautics and Aeronautics},
+  address =	 {New York},
+  pages =	 {419--441}
+}
+
+@TechReport{anon:53,
+  author = 	 {Anon.},
+  title = 	 {Equations, Tables, and Charts for Compressible Flow},
+  year = 	 1953,
+  type =	 {NACA Rept.~1135}
+}
+
+@Misc{moss:90pc,
+  author =	 {J. N. Moss},
+  howpublished = {private communication,
+                  NASA Langley Research Center,
+                  Hampton, VA},
+  year =	 1990,
+  month =	 jun
+}
diff --git a/Master/texmf-dist/doc/latex/aiaa/pre2004/demos/refs/tstref.tex b/Master/texmf-dist/doc/latex/aiaa/pre2004/demos/refs/tstref.tex
new file mode 100644
index 00000000000..f418c8db542
--- /dev/null
+++ b/Master/texmf-dist/doc/latex/aiaa/pre2004/demos/refs/tstref.tex
@@ -0,0 +1,150 @@
+%
+% aiaaref.tex
+%
+% contents: specifications for AIAA journal reference format,
+%           including examples
+%
+% use: to test bibliographic style sheets generated with makebst
+%
+% bil kleb <w.l.kleb@larc.nasa.gov> (96 nov 13)
+%
+\documentclass{article}
+\usepackage{overcite}
+%
+\pagestyle{empty}
+%
+\setcounter{secnumdepth}{-1}
+\setlength\topmargin{-.5in}
+\setlength\textheight{9.0in}
+\setlength\textwidth{6.0in}
+\setlength\oddsidemargin{0.25in}
+\setlength\parindent{0em}
+%
+% modify section headers:
+%
+\makeatletter\renewcommand\section{\@startsection{section}{1}{0pt}
+{1.2ex}{0.2ex}{\normalfont\bfseries}}\makeatother
+%
+% modify bibliography output to do superscripted reference list
+% with required indentation
+%
+\makeatletter
+\renewcommand{\@biblabel}[1]{$^{#1}$}
+\renewenvironment{thebibliography}[1]
+     {\section*{\refname\@mkboth{\MakeUppercase\refname}%
+                                 {\MakeUppercase\refname}}%
+      \list{\@biblabel{\@arabic\c@enumiv}}%
+           {\setlength{\leftmargin}{0pt}%
+            \settowidth{\labelwidth}{\@biblabel{#1}}%
+            \setlength{\itemindent}{\parindent}%
+            \advance\itemindent by \labelwidth%
+            \setlength{\labelsep}{0.0em}%
+            \setlength{\itemsep}{-\smallskipamount}%
+            \@openbib@code%
+            \usecounter{enumiv}%
+            \let\p@enumiv\@empty%
+            \renewcommand\theenumiv{\@arabic\c@enumiv}%
+            \normalsize}
+      \sloppy\clubpenalty4000\widowpenalty4000%
+      \sfcode`\.\@m}
+      {\def\@noitemerr
+        {\@latex@warning{Empty `thebibliography' environment}}%
+      \endlist}
+\makeatother
+
+\begin{document}
+
+\begin{center}
+  {\bfseries\LARGE Reference Format for AIAA Journals}
+\end{center}
+
+{\bfseries All references must be complete prior to acceptance of a
+  manuscript.} The following list gives examples of commonly lacking
+information:
+\begin{itemize}\setlength{\itemsep}{0.0ex}
+  \item Name of publishers (for books and {\bfseries proceedings})
+    and their locations.
+  \item Inclusive page numbers or (for books) chapters.
+  \item Complete journal names ({\bfseries no abbreviations}
+    unless part of actual title.
+  \item Journal volume and issue numbers (or months).
+  \item Locations of companies, universities, and societies in
+    reports and papers.
+\end{itemize}
+
+Note for {\bfseries all} references: Spell out {\bfseries
+everything}. AIAA, NASA, NACA, AGARD, NATO are exceptions;
+months may be abbreviated.  All references must be numbered and
+cited in numerical order in the text.  Classified or
+export-restricted references are not permitted.  List
+{\bfseries all} authors.  Follow these examples for format:
+
+\setlength\parindent{2em}
+
+\section{Article in a Book:}
+  \cite{turner:64a}Turner, M.~J., Martin, H.~C., and
+  Leible, R.~C., ``Further Development and Applications of
+  Stiffness Methods,'' {\itshape Matrix Methods of Structural
+  Analysis}, 1st ed., Vol.~1, Macmillan, New York, 1964,
+  pp.~203--266.
+
+\section{Journal Article:}
+  \cite{bhutta:90jsr}Bhutta, B.~A., and Lewis, C.~H.,
+  ``Large-Angle-of-Attack Viscous Hypersonic Flows over Complex
+  Lifting Configurations,'' {\itshape Journal of Spacecraft and
+  Rockets}, Vol.~27, No.~2, 1990, pp.~194--204; also AIAA Paper
+  89--0269, Jan.~1989. [{\itshape Note:} Month acceptable if
+  number is not available.]
+
+\section{Proceedings/Transactions Articles:}
+  \cite{blottner:70cp}Blottner, B.~A.,
+  ``Prediction of Electron Density in the Boundary Layer of Entry
+  Vehicles with Ablation,'' {\itshape The Entry Plasma Sheath and
+  Its Effects on Space Vehicle Electromagnetic Systems}, NASA
+  SP--252, Vol.~1, Oct.~1970, pp.~219--240.
+
+  \cite{wirin:90cp}Wirin, W.~B., ``Space Debris 1989,'' {\itshape Proceedings
+  of the Thirty-Second Colloquium on the Law of Outer Space},
+  AIAA, Washington, DC, 1990, pp.~184--196.
+
+\section{Company Report:}
+  \cite{bhutta:90vra}Bhutta, B.~A., and Lewis, C.~H.,
+  ``PNS Predictions of External/Internal Hypersonic Flows
+  for NASP Propulsion Applications,'' VRA, Inc., VRA--TR--90--01,
+  Blacksburg, VA, June, 1990.
+
+\section{NACA Report:}
+  \cite{miner:75ncr}Miner, E.~W., and Lewis, C.~H.,
+  ``Hypersonic Ionizing Air Viscous Shock-Layer Flows over
+  Nonanalytic Blunt Bodies,'' NASA CR--2550, May 1975.
+
+\section{Meeting Paper:}
+  \cite{bhutta:90cp}Bhutta, B.~A., and Lewis, C.~H.,
+  ``Aerothermodynamic Performance of 3-D and Bent-Nose RVs under
+  Hypersonic Conditions,'' AIAA Paper 90--3068, Aug. 1990.
+
+\section{AIAA Book Series:}
+  \cite{sutton:85ar}Sutton, K., ``Air Radiation
+  Revisted,'' {\itshape Thermal Design of Aeroassisted Orbital
+  Transfer Vehicles}, edited by H.~F.~Nelson, Vol.~96, Progress
+  in Astronautics and Aeronautics, AIAA, New York, 1985,
+  pp.~419--441.
+
+\section{Anonymous Report:}
+  \cite{anon:53}Anon., ``Equations, Tables, and
+  Charts for Compressible Flow,'' NACA Rept.~1135,
+  1953. [{\itshape Note:} Month preferred but not available for
+  this report.]
+
+\section{Private Communication:}
+  \cite{moss:90pc}Moss, J.~N., private
+  communication, NASA Langley Research Center, Hampton, VA, June
+  1990. [{\itshape Note:} Use of private communication is
+  {\bfseries strongly} discouraged.]
+
+\newpage% try the citations contained in testrefs.bib
+
+\bibliography{tstbtx}
+\bibliographystyle{aiaa}
+
+\end{document}
diff --git a/Master/texmf-dist/doc/latex/aiaa/pre2004/demos/subfigs/smpfig.eps b/Master/texmf-dist/doc/latex/aiaa/pre2004/demos/subfigs/smpfig.eps
new file mode 100644
index 00000000000..498eff7173c
--- /dev/null
+++ b/Master/texmf-dist/doc/latex/aiaa/pre2004/demos/subfigs/smpfig.eps
@@ -0,0 +1,340 @@
+%!PS-Adobe-2.0 EPSF-1.2
+%%Creator: TECPLOT
+%%Pages:1
+%%BoundingBox: 32 199 575 580
+%%DocumentFonts: Helvetica Helvetica-Bold Symbol Times-Roman Times-Bold Times-Italic Times-BoldItalic Courier Courier-Bold
+%%EndComments
+/tecplotdict 120 dict def
+tecplotdict begin
+/ed  {exch def} def
+/ftl {findfont exch scalefont setfont} def
+/ftr {/Times-Roman ftl} def
+/ftb {/Times-Bold ftl} def
+/fti {/Times-Italic ftl} def
+/ftib {/Times-BoldItalic ftl} def
+/fcr {/Courier ftl} def
+/fcb {/Courier-Bold ftl} def
+/fhn {/Helvetica ftl} def
+/fhb {/Helvetica-Bold ftl} def
+/fsy {/Symbol ftl} def
+/gs /gsave load def
+/gr /grestore load def
+/np /newpath load def
+/cp /closepath load def
+/sg /setgray load def
+/lc {stroke setlinecap} def
+/lj /setlinejoin load def
+/x /setrgbcolor load def
+/y {x moveto} def
+/g /get load def
+/sd /setdash load def
+/s {stroke setlinewidth} def
+/cpt /currentpoint load def
+/m {stroke moveto} def
+/rm /rmoveto load def
+/l /lineto load def
+/r /rlineto load def
+/sf /setflat load def
+/st /stroke load def
+/ct  {cpt st} def
+/stg {st sg} def
+/scg {cpt m sg} def
+/ro /rotate load def
+/sh /show load def
+/clp {st cp gr gs np moveto l l l cp clip np cp} def
+/er {cpt cp np moveto r r r cp sg fill 0 sg cp} def
+/erc {cpt cp np moveto r r r cp x fill 0 sg cp} def
+/br {cpt cp np moveto r r r cp sg cp} def
+/brc {cpt cp np moveto r r r cp x cp} def
+/cir1 {cpt cp m} def
+/cir2 {cp fill cp} def
+/ii 0 def
+/n 0 def
+/CurA 0 def
+/Ry 0 def
+/Rx 0 def
+/CA 0 def
+/SA 0 def
+/SJ 0 def
+/SI 0 def
+/bi 0 def
+/i 0 def
+/ib 0 def
+/ig 0 def
+/ir 0 def
+/ishade 0 def
+/bshade 0 def
+
+/z
+{
+  /ii ed
+  rea ii get
+  gra ii get
+  bla ii get
+} def
+
+/lrgb
+{
+  /ii ed
+  /blue ed
+  /green ed
+  /red ed
+  bla ii blue put
+  gra ii green put
+  rea ii red put
+} def
+
+/trace
+{
+  cp np
+  m
+  1 1 n 
+    {
+      pop
+      r
+    } for
+   cp
+} def
+
+/f
+{
+  /ishade ed
+  /n ed 
+  st
+  trace
+  ishade sg fill
+} def
+
+/b
+{
+  /bshade ed
+  /n ed 
+  m
+  1 1 n 
+    {
+      pop
+      r
+    } for
+  bshade sg stroke
+} def
+
+/fb
+{
+  /bshade ed
+  /ishade ed
+  /n ed 
+  st 
+  n 2 mul 2 add copy
+  trace
+  ishade sg fill
+  trace
+  bshade sg stroke
+} def
+
+/c
+{
+  /n ed 
+  st 
+  trace
+  stroke
+} def
+
+/fc
+{
+  /i ed
+  /n ed 
+  st 
+  trace
+  i z x fill
+} def
+
+/fd
+{
+  /ib ed
+  /ig ed
+  /ir ed
+  /n ed 
+  st 
+  trace
+  ir ig ib x fill
+} def
+
+/bc
+{
+  /i ed
+  /n ed 
+  m
+  1 1 n 
+    {
+      pop
+      r
+    } for
+  i z x stroke
+} def
+
+/fbc
+{
+  /ii ed
+  /bi ed
+  /n ed 
+  st 
+  n 2 mul 2 add copy
+  trace
+  ii z x fill
+  trace
+  bi z x stroke
+} def
+/fbd
+{
+  /ib ed
+  /ig ed
+  /ir ed
+  /bi ed
+  /n ed 
+  st 
+  n 2 mul 2 add copy
+  trace
+  ir ig ib x fill
+  trace
+  bi z x stroke
+} def
+/e
+{
+  /Ry ed
+  /Rx ed
+  /CA ed
+  /SA ed
+  /SJ ed
+  /SI ed
+
+  /DelX SA cos Rx mul def
+  /DelY SA sin Ry mul def
+  /XI SI DelX add def
+  /YI SJ DelY add def
+  /OCX DelX def
+  /OCY DelY def
+  /N 0 def
+  SA CA add
+  CA
+  SA 360 add
+    {
+     /CurA ed
+     /CX CurA cos Rx mul def
+     /CY CurA sin Ry mul def
+     OCX CX sub 
+     OCY CY sub 
+     /OCX CX def
+     /OCY CY def
+     /N N 1 add def
+    }
+  for
+  XI YI N
+} def
+%%EndProlog
+%%Page:? 1
+5 setmiterlimit
+0.0708661 0.0708661 scale np
+gs
+2 lc
+0 lj
+455 2817 455 8195 8118 8195 8118 2817 clp
+456 2818 m
+1 0 -5376 7661 0 0 5376 er
+494 2844 494 8168 8080 8168 8080 2844 clp
+455 2817 455 8195 8118 8195 8118 2817 clp
+494 2844 494 8168 8080 8168 8080 2844 clp
+455 2817 455 8195 8118 8195 8118 2817 clp
+0 stg
+494 2844 494 8168 8080 8168 8080 2844 clp
+0 stg
+26.8787 s
+514 2868 m
+0 0 -5259 7536 0 0 5259 br
+0 stg
+7536 5259 514 2868 1 0 b
+0 stg
+7536 -5259 514 8128 1 0 b
+5.37574 s
+0 -430 6344 0 0 430 1099 5281 3 1 0 fb
+1179 5402 m
+268.787 fcb
+0 sg
+(E) sh
+1351 5402 m
+(n) sh
+1523 5402 m
+(c) sh
+1694 5402 m
+(a) sh
+1866 5402 m
+(p) sh
+2038 5402 m
+(s) sh
+2210 5402 m
+(u) sh
+2381 5402 m
+(l) sh
+2553 5402 m
+(a) sh
+2725 5402 m
+(t) sh
+2896 5402 m
+(e) sh
+3068 5402 m
+(d) sh
+3240 5402 m
+( ) sh
+3412 5402 m
+(P) sh
+3583 5402 m
+(o) sh
+3755 5402 m
+(s) sh
+3927 5402 m
+(t) sh
+4099 5402 m
+(s) sh
+4270 5402 m
+(c) sh
+4442 5402 m
+(r) sh
+4614 5402 m
+(i) sh
+4786 5402 m
+(p) sh
+4957 5402 m
+(t) sh
+5129 5402 m
+( ) sh
+5301 5402 m
+(\() sh
+5472 5402 m
+(E) sh
+5644 5402 m
+(P) sh
+5816 5402 m
+(S) sh
+5988 5402 m
+(\)) sh
+6159 5402 m
+( ) sh
+6331 5402 m
+(F) sh
+6503 5402 m
+(i) sh
+6675 5402 m
+(g) sh
+6846 5402 m
+(u) sh
+7018 5402 m
+(r) sh
+7190 5402 m
+(e) sh
+455 2817 455 8195 8118 8195 8118 2817 clp
+0 stg
+494 2844 494 8168 8080 8168 8080 2844 clp
+455 2817 455 8195 8118 8195 8118 2817 clp
+5.37574 s
+494 2844 494 8168 8080 8168 8080 2844 clp
+st gr end
+showpage
diff --git a/Master/texmf-dist/doc/latex/aiaa/pre2004/demos/subfigs/smpsubf.tex b/Master/texmf-dist/doc/latex/aiaa/pre2004/demos/subfigs/smpsubf.tex
new file mode 100644
index 00000000000..495e12508b2
--- /dev/null
+++ b/Master/texmf-dist/doc/latex/aiaa/pre2004/demos/subfigs/smpsubf.tex
@@ -0,0 +1,366 @@
+% `smpsubf.tex' - a sample of subfigure usage 
+%
+% see epslatex.{ps,pdf} in the info directory of the CTAN for
+% more discussion on figure placement, usage, etc.
+%
+\documentclass{aiaa}% use draft mode to check for
+                    % over-full boxes (big black lines).
+
+% declare new lengths that are used for computing subfigure
+% layouts when doing up-down, left-right ordered tables of subfigures.
+
+\newlength{\subfigwidth}% subfigure width
+\newlength{\subfigcolsep}% separation between subfigures
+\setlength{\subfigcolsep}{2\tabcolsep}% tie to that used for tabular
+
+% define a command that creates meaningless blocks of text.
+% use is, for example, \replicate{4}{text} where `4' is the
+% number of times to repeat the filler `text'.
+
+\makeatletter
+\newcounter{numrepeat}
+\newcommand{\replicate}[2]{\par
+ \setcounter{numrepeat}{#1}\relax
+ \@whilenum \value{numrepeat} > 0 \do
+  {{#2}\addtocounter{numrepeat}{-1}}\par}
+\makeatother
+
+% make a command to be the filler text
+% for the replicate command above: 
+
+\newcommand{\filler}%
+  {\em More text and even more text and even more text.
+   Followed by some other stuff.
+   Then adding yet additional material.
+   Lets now change gears and talk about some other stuff for a while.
+   I am sick-to-death of this other bit of rambling,
+   and besides I need more material.}
+
+\title{Some Subfigure Layout Choices}
+\author{Bil Kleb\\
+       {\it NASA Langley Research Center, Hampton,~Virginia,~23681}}
+
+\begin{document}
+
+\maketitle
+
+The purpose of this document is to present a number
+of different subfigure layout options.  The methods are currently
+rather {\em ad hoc}, but future versions should make this sort
+of thing more automatic and remove the requirement for
+fiddling on a case-by-case basis.
+
+
+\section{Two stacked figures}
+
+Let's start off with a simple one: two figures stacked one atop the
+other as shown in Fig.~\ref{fig:3f}.
+\begin{figure}
+  \begin{subfigmatrix}{1}
+    \subfigure[The first one. ]{\incfig{smpfig}}
+    \subfigure[The second one.]{\incfig{smpfig}}
+  \end{subfigmatrix}
+  \caption{Two, stacked subfigures.}
+  \label{fig:3f}
+\end{figure}
+\replicate{3}{\filler}
+
+
+\section{Six Figures}
+
+\subsection{Up-down, Left-right Ordering}
+
+This is some text, referencing Fig.~\ref{fig:udlr}. Note that
+the order of the sub figures is up-down, then left-right.
+Beware that alignment will be thrown off if the subcaptions are
+typeset with differing numbers of lines, i.e., a long subcaption
+and a short subcaption and the \texttt{[b]} alignment option for the
+minipages are not used.
+\begin{figure}
+  \setlength{\subfigwidth}{.5\linewidth}
+  \addtolength{\subfigwidth}{-.5\subfigcolsep}
+  \vspace*{-\subfigtopskip}
+  \begin{minipage}[b]{\subfigwidth}
+    \subfigure[The first one. ]{\incfig{smpfig}}
+  \end{minipage}
+  \begin{minipage}[b]{\subfigwidth}
+    \setcounter{subfigure}{3}
+    \subfigure[The fourth one.]{\incfig{smpfig}}
+  \end{minipage}
+  \begin{minipage}[b]{\subfigwidth}
+    \setcounter{subfigure}{1}
+    \subfigure[The second one.]{\incfig{smpfig}}
+  \end{minipage}
+  \begin{minipage}[b]{\subfigwidth}
+    \setcounter{subfigure}{4}
+    \subfigure[The fifth one. ]{\incfig{smpfig}}
+  \end{minipage}
+  \begin{minipage}[b]{\subfigwidth}
+    \setcounter{subfigure}{2}
+    \subfigure[The third one. ]{\incfig{smpfig}}
+  \end{minipage}\hfill
+  \begin{minipage}[b]{\subfigwidth}
+    \setcounter{subfigure}{5}
+    \subfigure[The sixth one. ]{\incfig{smpfig}}
+  \end{minipage}
+  \caption{Up-down ordering of the subfigures
+           using the minipage environment.}
+  \label{fig:udlr}
+\end{figure}
+\replicate{4}{\filler}
+
+\subsection{Left-Right, Up-Down Ordering}
+
+Now, if we wanted the ordering to be left-right, then
+up-down, we could use the tabular environment. This
+is how Fig.~\ref{fig:lrud} was generated.
+\begin{figure}
+  \begin{subfigmatrix}{2}
+    \subfigure[The first one. ]{\incfig{smpfig}}
+    \subfigure[The second one.]{\incfig{smpfig}}
+    \subfigure[The third one. ]{\incfig{smpfig}}
+    \subfigure[The fourth one.]{\incfig{smpfig}}
+    \subfigure[The fifth one. ]{\incfig{smpfig}}
+    \subfigure[The sixth one. ]{\incfig{smpfig}}
+  \end{subfigmatrix}
+  \caption{Ordering the subfigures from left-to-right, then
+    up-down using the tabular environment.}
+  \label{fig:lrud}
+\end{figure}
+\replicate{4}{\filler}
+
+\section{Eight Figures Spanning Both Columns}
+
+This Fig.~\ref{fig:long} shows the method of `continuing'
+the figure onto another page.
+\begin{figure*}
+  \begin{subfigmatrix}{2}
+    \subfigure[The first one. ]{\incfig{smpfig}}
+    \subfigure[The second one.]{\incfig{smpfig}}
+    \subfigure[The third one. ]{\incfig{smpfig}}
+    \subfigure[The fourth one.]{\incfig{smpfig}}
+    \subfigure[The fifth one. ]{\incfig{smpfig}}
+    \subfigure[The sixth one. ]{\incfig{smpfig}}
+  \end{subfigmatrix}
+  \caption{Ordering the subfigures from left-to-right, then
+    up-down using the tabular environment.}
+  \label{fig:long}
+\end{figure*}
+\addtocounter{figure}{-1}
+\setcounter{subfigure}{6}
+\begin{figure*}
+  \begin{subfigmatrix}{2}
+    \subfigure[The seventh one.]{\incfig{smpfig}}
+    \subfigure[The eighth one. ]{\incfig{smpfig}}
+  \end{subfigmatrix}
+  \caption{Concluded.}
+\end{figure*}
+\replicate{4}{\filler}
+
+
+\section{Nine Subfigures}
+
+\subsection{Up-down, Left-right Ordering}
+
+This is some text, referencing Fig.~\ref{fig:3ud3lr}. Note that
+the order of the sub figures is up-down, then left-right.
+\begin{figure}[htb!]
+  \setlength{\subfigwidth}{.333\linewidth}
+  \addtolength{\subfigwidth}{-.667\subfigcolsep}
+  \vspace*{-\subfigtopskip}
+  \begin{minipage}[b]{\subfigwidth}
+    \subfigure[The first.]{\incfig{smpfig}}
+  \end{minipage}
+  \begin{minipage}[b]{\subfigwidth}
+    \setcounter{subfigure}{3}
+    \subfigure[The fourth.]{\incfig{smpfig}}
+  \end{minipage}
+  \begin{minipage}[b]{\subfigwidth}
+    \setcounter{subfigure}{6}
+    \subfigure[The seventh.]{\incfig{smpfig}}
+  \end{minipage}
+  \begin{minipage}[b]{\subfigwidth}
+    \setcounter{subfigure}{1}
+    \subfigure[The second.]{\incfig{smpfig}}
+  \end{minipage}
+  \begin{minipage}[b]{\subfigwidth}
+    \setcounter{subfigure}{4}
+    \subfigure[The fifth.]{\incfig{smpfig}}
+  \end{minipage}
+  \begin{minipage}[b]{\subfigwidth}
+    \setcounter{subfigure}{7}
+    \subfigure[The eighth.]{\incfig{smpfig}}
+  \end{minipage}
+  \begin{minipage}[b]{\subfigwidth}
+    \setcounter{subfigure}{2}
+    \subfigure[The third.]{\incfig{smpfig}}
+  \end{minipage}\hfill
+  \begin{minipage}[b]{\subfigwidth}
+    \setcounter{subfigure}{5}
+    \subfigure[The sixth.]{\incfig{smpfig}}
+  \end{minipage}\hfill
+  \begin{minipage}[b]{\subfigwidth}
+    \setcounter{subfigure}{8}
+    \subfigure[The ninth.]{\incfig{smpfig}}
+  \end{minipage}
+  \caption{Up-down ordering of the subfigures
+           using the minipage environment.}
+  \label{fig:3ud3lr}
+\end{figure}
+\replicate{4}{\filler}
+
+\subsection{Left-Right, Up-Down Ordering}
+
+Now, if we wanted the ordering to be left-right, then
+up-down, we could use the tabular environment. This
+is how Fig.~\ref{fig:3lr3ud} was generated.  This figure spans both
+columns, so it is most likely out of order (and appears near or
+at the end of this document).
+\begin{figure*}
+  \begin{subfigmatrix}{3}
+    \subfigure[The first.  ]{\incfig{smpfig}}
+    \subfigure[The second. ]{\incfig{smpfig}}
+    \subfigure[The third.  ]{\incfig{smpfig}}
+    \subfigure[The fourth. ]{\incfig{smpfig}}
+    \subfigure[The fifth.  ]{\incfig{smpfig}}
+    \subfigure[The sixth.  ]{\incfig{smpfig}}
+    \subfigure[The seventh.]{\incfig{smpfig}}
+    \subfigure[The eighth. ]{\incfig{smpfig}}
+    \subfigure[The ninth.  ]{\incfig{smpfig}}
+  \end{subfigmatrix}
+  \caption{Ordering the subfigures from
+           left-to-right, then up-down
+           using the tabular environment.}
+  \label{fig:3lr3ud}
+\end{figure*}
+\replicate{4}{\filler}
+
+
+\section{Two Small Subfigures and One Large One}
+
+\subsection{A}
+
+Next, we try two small figures with one large one.  This attempt
+is shown in Fig.~\ref{fig:2s1l}.
+\begin{figure}[htb!]
+  \setlength{\subfigwidth}{.284\linewidth}% have to FIDDLE with this
+  \addtolength{\subfigwidth}{-.5\subfigcolsep}
+  \begin{minipage}[b]{\subfigwidth}
+    \begin{subfigmatrix}{1}
+      \subfigure[One.]{\incfig{smpfig}}
+      \subfigure[Two.]{\incfig{smpfig}}
+    \end{subfigmatrix}
+  \end{minipage}
+  \addtolength{\subfigwidth}{.5\subfigcolsep}
+  \addtolength{\subfigwidth}{-\linewidth}
+  \setlength{\subfigwidth}{-\subfigwidth}
+  \addtolength{\subfigwidth}{-.5\subfigcolsep}
+  \begin{minipage}[b]{\subfigwidth}
+    \subfigure[The large one.]{\incfig{smpfig}}
+  \end{minipage}
+  \caption{Two small subfigures and a large one.}
+  \label{fig:2s1l}
+\end{figure}
+\replicate{3}{\filler}
+
+\subsection{B}
+
+Figure~\ref{fig:1l2s} is the same, only with the large/small
+positions swapped about the vertical axis.
+\begin{figure}[htb!]
+  \setlength{\subfigwidth}{.716\linewidth}% have to FIDDLE with this
+  \addtolength{\subfigwidth}{-.5\subfigcolsep}
+  \begin{minipage}[b]{\subfigwidth}
+    \subfigure[The large one.]{\incfig{smpfig}}
+  \end{minipage}
+  \addtolength{\subfigwidth}{.5\subfigcolsep}
+  \addtolength{\subfigwidth}{-\linewidth}
+  \setlength{\subfigwidth}{-\subfigwidth}
+  \addtolength{\subfigwidth}{-.5\subfigcolsep}
+  \begin{minipage}[b]{\subfigwidth}
+    \begin{subfigmatrix}{1}
+        \subfigure[One.]{\incfig{smpfig}}
+        \subfigure[Two.]{\incfig{smpfig}}
+    \end{subfigmatrix}
+  \end{minipage}
+  \caption{One large subfigure beside two small ones.}
+  \label{fig:1l2s}
+\end{figure}
+\replicate{1}{\filler}
+
+\subsection{C}
+
+Now, for a slightly different effect, two subfigures on top with
+a large one on the bottom, see Fig.~\ref{fig:2st1l}.
+\begin{figure}[htb!]
+  \begin{subfigmatrix}{2}
+    \subfigure[One.]{\incfig{smpfig}}
+    \subfigure[Two.]{\incfig{smpfig}}
+  \end{subfigmatrix}%
+  \begin{subfigmatrix}{1}
+    \centering\subfigure[The large one.]{\incfig{smpfig}}
+  \end{subfigmatrix}
+  \caption{Two smaller subfigures over a larger one.}
+  \label{fig:2st1l}
+\end{figure}
+\replicate{1}{\filler}
+
+\subsection{D}
+
+And, of coarse the old large subfigure on top with
+two subfigures beneath. Fig.~\ref{fig:1lt2sb} demonstrates
+this one.
+\begin{figure*}[htb!]
+  \begin{subfigmatrix}{1}
+    \subfigure[The large one.]{\incfig{smpfig}}
+  \end{subfigmatrix}
+  \begin{subfigmatrix}{2}
+    \subfigure[One.]{\incfig{smpfig}}
+    \subfigure[Two.]{\incfig{smpfig}}
+  \end{subfigmatrix}
+  \caption{One large subfigure above two smaller ones.}
+  \label{fig:1lt2sb}
+\end{figure*}
+\replicate{2}{\filler}
+
+\subsection{E}
+
+Steve Alter prompted Figure~\ref{f:twobytwo}: two with two on the side.
+\begin{figure*}
+%
+  \newlength{\firstfigwidth}
+  \newlength{\secondfigwidth}
+  \newlength{\thirdfigwidth}
+%
+  \setlength{\firstfigwidth}{0.39745\linewidth}%  FIDDLE with these
+  \setlength{\secondfigwidth}{0.39745\linewidth}% two numbers
+%
+  \setlength{\thirdfigwidth}{\linewidth}
+  \addtolength{\thirdfigwidth}{-4\tabcolsep}
+  \addtolength{\thirdfigwidth}{-\firstfigwidth}
+  \addtolength{\thirdfigwidth}{-\secondfigwidth}
+%
+  \begin{minipage}[t]{\firstfigwidth}
+    \subfigure[Representative planes of X34 viscous grid.]
+              {\incfig{smpfig}}
+  \end{minipage}% note: `%'s are important in this region
+  \hspace{2\tabcolsep}%
+  \begin{minipage}[t]{\secondfigwidth}
+     \subfigure[Meridnal plane.]
+               {\incfig{smpfig}}
+  \end{minipage}% note: `%'s are important in this region
+  \hspace{2\tabcolsep}%
+  \begin{minipage}[b]{\thirdfigwidth}
+    \begin{subfigmatrix}{1}
+     \subfigure[Wing root.]{\incfig{smpfig}}
+     \subfigure[Wing tip.]{\incfig{smpfig}}
+    \end{subfigmatrix}
+  \end{minipage}
+%
+  \caption{X34 volume grid used for viscous computations.}
+  \label{f:twobytwo}
+%
+\end{figure*}
+\replicate{3}{\filler}
+
+\end{document}
diff --git a/Master/texmf-dist/doc/latex/aiaa/pre2004/demos/talk/smpfig.eps b/Master/texmf-dist/doc/latex/aiaa/pre2004/demos/talk/smpfig.eps
new file mode 100644
index 00000000000..498eff7173c
--- /dev/null
+++ b/Master/texmf-dist/doc/latex/aiaa/pre2004/demos/talk/smpfig.eps
@@ -0,0 +1,340 @@
+%!PS-Adobe-2.0 EPSF-1.2
+%%Creator: TECPLOT
+%%Pages:1
+%%BoundingBox: 32 199 575 580
+%%DocumentFonts: Helvetica Helvetica-Bold Symbol Times-Roman Times-Bold Times-Italic Times-BoldItalic Courier Courier-Bold
+%%EndComments
+/tecplotdict 120 dict def
+tecplotdict begin
+/ed  {exch def} def
+/ftl {findfont exch scalefont setfont} def
+/ftr {/Times-Roman ftl} def
+/ftb {/Times-Bold ftl} def
+/fti {/Times-Italic ftl} def
+/ftib {/Times-BoldItalic ftl} def
+/fcr {/Courier ftl} def
+/fcb {/Courier-Bold ftl} def
+/fhn {/Helvetica ftl} def
+/fhb {/Helvetica-Bold ftl} def
+/fsy {/Symbol ftl} def
+/gs /gsave load def
+/gr /grestore load def
+/np /newpath load def
+/cp /closepath load def
+/sg /setgray load def
+/lc {stroke setlinecap} def
+/lj /setlinejoin load def
+/x /setrgbcolor load def
+/y {x moveto} def
+/g /get load def
+/sd /setdash load def
+/s {stroke setlinewidth} def
+/cpt /currentpoint load def
+/m {stroke moveto} def
+/rm /rmoveto load def
+/l /lineto load def
+/r /rlineto load def
+/sf /setflat load def
+/st /stroke load def
+/ct  {cpt st} def
+/stg {st sg} def
+/scg {cpt m sg} def
+/ro /rotate load def
+/sh /show load def
+/clp {st cp gr gs np moveto l l l cp clip np cp} def
+/er {cpt cp np moveto r r r cp sg fill 0 sg cp} def
+/erc {cpt cp np moveto r r r cp x fill 0 sg cp} def
+/br {cpt cp np moveto r r r cp sg cp} def
+/brc {cpt cp np moveto r r r cp x cp} def
+/cir1 {cpt cp m} def
+/cir2 {cp fill cp} def
+/ii 0 def
+/n 0 def
+/CurA 0 def
+/Ry 0 def
+/Rx 0 def
+/CA 0 def
+/SA 0 def
+/SJ 0 def
+/SI 0 def
+/bi 0 def
+/i 0 def
+/ib 0 def
+/ig 0 def
+/ir 0 def
+/ishade 0 def
+/bshade 0 def
+
+/z
+{
+  /ii ed
+  rea ii get
+  gra ii get
+  bla ii get
+} def
+
+/lrgb
+{
+  /ii ed
+  /blue ed
+  /green ed
+  /red ed
+  bla ii blue put
+  gra ii green put
+  rea ii red put
+} def
+
+/trace
+{
+  cp np
+  m
+  1 1 n 
+    {
+      pop
+      r
+    } for
+   cp
+} def
+
+/f
+{
+  /ishade ed
+  /n ed 
+  st
+  trace
+  ishade sg fill
+} def
+
+/b
+{
+  /bshade ed
+  /n ed 
+  m
+  1 1 n 
+    {
+      pop
+      r
+    } for
+  bshade sg stroke
+} def
+
+/fb
+{
+  /bshade ed
+  /ishade ed
+  /n ed 
+  st 
+  n 2 mul 2 add copy
+  trace
+  ishade sg fill
+  trace
+  bshade sg stroke
+} def
+
+/c
+{
+  /n ed 
+  st 
+  trace
+  stroke
+} def
+
+/fc
+{
+  /i ed
+  /n ed 
+  st 
+  trace
+  i z x fill
+} def
+
+/fd
+{
+  /ib ed
+  /ig ed
+  /ir ed
+  /n ed 
+  st 
+  trace
+  ir ig ib x fill
+} def
+
+/bc
+{
+  /i ed
+  /n ed 
+  m
+  1 1 n 
+    {
+      pop
+      r
+    } for
+  i z x stroke
+} def
+
+/fbc
+{
+  /ii ed
+  /bi ed
+  /n ed 
+  st 
+  n 2 mul 2 add copy
+  trace
+  ii z x fill
+  trace
+  bi z x stroke
+} def
+/fbd
+{
+  /ib ed
+  /ig ed
+  /ir ed
+  /bi ed
+  /n ed 
+  st 
+  n 2 mul 2 add copy
+  trace
+  ir ig ib x fill
+  trace
+  bi z x stroke
+} def
+/e
+{
+  /Ry ed
+  /Rx ed
+  /CA ed
+  /SA ed
+  /SJ ed
+  /SI ed
+
+  /DelX SA cos Rx mul def
+  /DelY SA sin Ry mul def
+  /XI SI DelX add def
+  /YI SJ DelY add def
+  /OCX DelX def
+  /OCY DelY def
+  /N 0 def
+  SA CA add
+  CA
+  SA 360 add
+    {
+     /CurA ed
+     /CX CurA cos Rx mul def
+     /CY CurA sin Ry mul def
+     OCX CX sub 
+     OCY CY sub 
+     /OCX CX def
+     /OCY CY def
+     /N N 1 add def
+    }
+  for
+  XI YI N
+} def
+%%EndProlog
+%%Page:? 1
+5 setmiterlimit
+0.0708661 0.0708661 scale np
+gs
+2 lc
+0 lj
+455 2817 455 8195 8118 8195 8118 2817 clp
+456 2818 m
+1 0 -5376 7661 0 0 5376 er
+494 2844 494 8168 8080 8168 8080 2844 clp
+455 2817 455 8195 8118 8195 8118 2817 clp
+494 2844 494 8168 8080 8168 8080 2844 clp
+455 2817 455 8195 8118 8195 8118 2817 clp
+0 stg
+494 2844 494 8168 8080 8168 8080 2844 clp
+0 stg
+26.8787 s
+514 2868 m
+0 0 -5259 7536 0 0 5259 br
+0 stg
+7536 5259 514 2868 1 0 b
+0 stg
+7536 -5259 514 8128 1 0 b
+5.37574 s
+0 -430 6344 0 0 430 1099 5281 3 1 0 fb
+1179 5402 m
+268.787 fcb
+0 sg
+(E) sh
+1351 5402 m
+(n) sh
+1523 5402 m
+(c) sh
+1694 5402 m
+(a) sh
+1866 5402 m
+(p) sh
+2038 5402 m
+(s) sh
+2210 5402 m
+(u) sh
+2381 5402 m
+(l) sh
+2553 5402 m
+(a) sh
+2725 5402 m
+(t) sh
+2896 5402 m
+(e) sh
+3068 5402 m
+(d) sh
+3240 5402 m
+( ) sh
+3412 5402 m
+(P) sh
+3583 5402 m
+(o) sh
+3755 5402 m
+(s) sh
+3927 5402 m
+(t) sh
+4099 5402 m
+(s) sh
+4270 5402 m
+(c) sh
+4442 5402 m
+(r) sh
+4614 5402 m
+(i) sh
+4786 5402 m
+(p) sh
+4957 5402 m
+(t) sh
+5129 5402 m
+( ) sh
+5301 5402 m
+(\() sh
+5472 5402 m
+(E) sh
+5644 5402 m
+(P) sh
+5816 5402 m
+(S) sh
+5988 5402 m
+(\)) sh
+6159 5402 m
+( ) sh
+6331 5402 m
+(F) sh
+6503 5402 m
+(i) sh
+6675 5402 m
+(g) sh
+6846 5402 m
+(u) sh
+7018 5402 m
+(r) sh
+7190 5402 m
+(e) sh
+455 2817 455 8195 8118 8195 8118 2817 clp
+0 stg
+494 2844 494 8168 8080 8168 8080 2844 clp
+455 2817 455 8195 8118 8195 8118 2817 clp
+5.37574 s
+494 2844 494 8168 8080 8168 8080 2844 clp
+st gr end
+showpage
diff --git a/Master/texmf-dist/doc/latex/aiaa/pre2004/demos/talk/smptalk.ps b/Master/texmf-dist/doc/latex/aiaa/pre2004/demos/talk/smptalk.ps
new file mode 100644
index 00000000000..a62be378d82
--- /dev/null
+++ b/Master/texmf-dist/doc/latex/aiaa/pre2004/demos/talk/smptalk.ps
@@ -0,0 +1,2622 @@
+%!PS-Adobe-2.0
+%%Creator: dvips(k) 5.83 Copyright 1998 Radical Eye Software
+%%Title: smptalk.dvi
+%%Pages: 21
+%%PageOrder: Ascend
+%%Orientation: Landscape
+%%BoundingBox: 0 0 612 792
+%%DocumentFonts: Courier-Bold
+%%EndComments
+%DVIPSWebPage: (www.radicaleye.com)
+%DVIPSCommandLine: dvips -t landscape smptalk
+%DVIPSParameters: dpi=600, compressed
+%DVIPSSource:  TeX output 1999.03.25:0954
+%%BeginProcSet: texc.pro
+%!
+/TeXDict 300 dict def TeXDict begin/N{def}def/B{bind def}N/S{exch}N/X{S
+N}B/A{dup}B/TR{translate}N/isls false N/vsize 11 72 mul N/hsize 8.5 72
+mul N/landplus90{false}def/@rigin{isls{[0 landplus90{1 -1}{-1 1}ifelse 0
+0 0]concat}if 72 Resolution div 72 VResolution div neg scale isls{
+landplus90{VResolution 72 div vsize mul 0 exch}{Resolution -72 div hsize
+mul 0}ifelse TR}if Resolution VResolution vsize -72 div 1 add mul TR[
+matrix currentmatrix{A A round sub abs 0.00001 lt{round}if}forall round
+exch round exch]setmatrix}N/@landscape{/isls true N}B/@manualfeed{
+statusdict/manualfeed true put}B/@copies{/#copies X}B/FMat[1 0 0 -1 0 0]
+N/FBB[0 0 0 0]N/nn 0 N/IE 0 N/ctr 0 N/df-tail{/nn 8 dict N nn begin
+/FontType 3 N/FontMatrix fntrx N/FontBBox FBB N string/base X array
+/BitMaps X/BuildChar{CharBuilder}N/Encoding IE N end A{/foo setfont}2
+array copy cvx N load 0 nn put/ctr 0 N[}B/sf 0 N/df{/sf 1 N/fntrx FMat N
+df-tail}B/dfs{div/sf X/fntrx[sf 0 0 sf neg 0 0]N df-tail}B/E{pop nn A
+definefont setfont}B/Cw{Cd A length 5 sub get}B/Ch{Cd A length 4 sub get
+}B/Cx{128 Cd A length 3 sub get sub}B/Cy{Cd A length 2 sub get 127 sub}
+B/Cdx{Cd A length 1 sub get}B/Ci{Cd A type/stringtype ne{ctr get/ctr ctr
+1 add N}if}B/id 0 N/rw 0 N/rc 0 N/gp 0 N/cp 0 N/G 0 N/CharBuilder{save 3
+1 roll S A/base get 2 index get S/BitMaps get S get/Cd X pop/ctr 0 N Cdx
+0 Cx Cy Ch sub Cx Cw add Cy setcachedevice Cw Ch true[1 0 0 -1 -.1 Cx
+sub Cy .1 sub]/id Ci N/rw Cw 7 add 8 idiv string N/rc 0 N/gp 0 N/cp 0 N{
+rc 0 ne{rc 1 sub/rc X rw}{G}ifelse}imagemask restore}B/G{{id gp get/gp
+gp 1 add N A 18 mod S 18 idiv pl S get exec}loop}B/adv{cp add/cp X}B
+/chg{rw cp id gp 4 index getinterval putinterval A gp add/gp X adv}B/nd{
+/cp 0 N rw exit}B/lsh{rw cp 2 copy get A 0 eq{pop 1}{A 255 eq{pop 254}{
+A A add 255 and S 1 and or}ifelse}ifelse put 1 adv}B/rsh{rw cp 2 copy
+get A 0 eq{pop 128}{A 255 eq{pop 127}{A 2 idiv S 128 and or}ifelse}
+ifelse put 1 adv}B/clr{rw cp 2 index string putinterval adv}B/set{rw cp
+fillstr 0 4 index getinterval putinterval adv}B/fillstr 18 string 0 1 17
+{2 copy 255 put pop}for N/pl[{adv 1 chg}{adv 1 chg nd}{1 add chg}{1 add
+chg nd}{adv lsh}{adv lsh nd}{adv rsh}{adv rsh nd}{1 add adv}{/rc X nd}{
+1 add set}{1 add clr}{adv 2 chg}{adv 2 chg nd}{pop nd}]A{bind pop}
+forall N/D{/cc X A type/stringtype ne{]}if nn/base get cc ctr put nn
+/BitMaps get S ctr S sf 1 ne{A A length 1 sub A 2 index S get sf div put
+}if put/ctr ctr 1 add N}B/I{cc 1 add D}B/bop{userdict/bop-hook known{
+bop-hook}if/SI save N @rigin 0 0 moveto/V matrix currentmatrix A 1 get A
+mul exch 0 get A mul add .99 lt{/QV}{/RV}ifelse load def pop pop}N/eop{
+SI restore userdict/eop-hook known{eop-hook}if showpage}N/@start{
+userdict/start-hook known{start-hook}if pop/VResolution X/Resolution X
+1000 div/DVImag X/IE 256 array N 2 string 0 1 255{IE S A 360 add 36 4
+index cvrs cvn put}for pop 65781.76 div/vsize X 65781.76 div/hsize X}N
+/p{show}N/RMat[1 0 0 -1 0 0]N/BDot 260 string N/Rx 0 N/Ry 0 N/V{}B/RV/v{
+/Ry X/Rx X V}B statusdict begin/product where{pop false[(Display)(NeXT)
+(LaserWriter 16/600)]{A length product length le{A length product exch 0
+exch getinterval eq{pop true exit}if}{pop}ifelse}forall}{false}ifelse
+end{{gsave TR -.1 .1 TR 1 1 scale Rx Ry false RMat{BDot}imagemask
+grestore}}{{gsave TR -.1 .1 TR Rx Ry scale 1 1 false RMat{BDot}
+imagemask grestore}}ifelse B/QV{gsave newpath transform round exch round
+exch itransform moveto Rx 0 rlineto 0 Ry neg rlineto Rx neg 0 rlineto
+fill grestore}B/a{moveto}B/delta 0 N/tail{A/delta X 0 rmoveto}B/M{S p
+delta add tail}B/b{S p tail}B/c{-4 M}B/d{-3 M}B/e{-2 M}B/f{-1 M}B/g{0 M}
+B/h{1 M}B/i{2 M}B/j{3 M}B/k{4 M}B/w{0 rmoveto}B/l{p -4 w}B/m{p -3 w}B/n{
+p -2 w}B/o{p -1 w}B/q{p 1 w}B/r{p 2 w}B/s{p 3 w}B/t{p 4 w}B/x{0 S
+rmoveto}B/y{3 2 roll p a}B/bos{/SS save N}B/eos{SS restore}B end
+
+%%EndProcSet
+%%BeginProcSet: texnansi.enc
+% @psencodingfile{
+%   author = "Y&Y, Inc.",
+%   version = "1.1",
+%   date = "1 December 1996",
+%   filename = "texnansi.enc",
+%   email = "help@YandY.com",
+%   address = "45 Walden Street // Concord, MA 01742, USA",
+%   codetable = "ISO/ASCII",
+%   checksum = "xx",
+%   docstring = "Encoding for fonts in Adobe Type 1 format for use with TeX."
+% }
+%
+% The idea is to have all 228 characters normally included in Type 1 text
+% fonts (plus a few more) available for typesetting.  This is effectively
+% the character set in Adobe Standard Encoding, ISO Latin 1, plus a few more.
+%
+% Character code assignments were made as follows:
+%
+% (1) The character layout largely matches `ASCII' in the 32 -- 126 range,
+% except for `circumflex' in 94 and `tilde' in 126, to match `TeX text'
+% (`asciicircumflex' and `asciitilde' appear in 158 and 142 instead).
+%
+% (2) The character layout matches `Windows ANSI' in almost all places,
+% except for `quoteright' in 39 and `quoteleft' in 96 to match ASCII
+% (`quotesingle' and `grave' appear in 129 and 18 instead).
+%
+% (3) The character layout matches `TeX typewriter' used by CM text fonts
+% in most places (except for discordant positions such as hungarumlaut
+% (instead of braceright), dotaccent (instead of underscore) etc.
+%
+% (4) Remaining characters are assigned arbitrarily to the `control character'
+% range (0 -- 31), avoiding 0, 9, 10 and 13 in case we meet dumb software
+% - similarly one should really avoid 127 and 128 if possible.
+% In addition, the 8 open slots in Windows ANSI between 128 and 159 are used.
+%
+% (5) Y&Y Lucida Bright includes some extra ligatures and such; ff, ffi, ffl,
+% and `dotlessj,' these are included 11 -- 15, and 17.
+%
+% (6) Hyphen appears both at 45 and 173 for compatibility with both ASCII
+% and Windows ANSI.
+%
+% (7) It doesn't really matter where ligatures appear (both real, such as ffi,
+% and pseudo such as ---) since these should not be accessed directly, only
+% via ligature information in the TFM file.
+%
+% SAMPLE USAGE (in `psfonts.map' file for DVIPS):
+% 
+% lbr LucidaBright "TeXnANSIEncoding ReEncodeFont" <texnansi.enc <lbr.pfb
+%
+% This tells DVIPS that the font called `lbr' in TeX has PostScript 
+% FontName `LucidaBright.'  It also asks DVIPS to expand the file `lbr.pfb'
+% into PFA form, to include the attached `texnansi.enc' encoding vector,
+% and to then actually reencode the font based on that encoding vector.
+%
+% Revised 1996 June 1 by adding second position for `fl' to avoid Acrobat bug.
+% Revised 1996 June 1 by adding second position for `fraction' for same reason.
+%
+/TeXnANSIEncoding [
+/.notdef /uni20AC /.notdef /.notdef % 0, 1, 2, 3
+/fraction %	4
+/dotaccent %	5
+/hungarumlaut %	6
+/ogonek	%	7
+/fl	%	8
+/.notdef % /fraction %	9	not used (see 4), backward compatability only
+/cwm	%	10	not used, except boundary char internally maybe
+/ff    %	11
+/fi    %	12
+/.notdef % /fl    %	13	not used (see 8), backward compatability only
+/ffi   %	14
+/ffl   %	15
+/dotlessi %	16
+/dotlessj %	17
+/grave %	18
+/acute %	19
+/caron %	20
+/breve %	21
+/macron %	22
+/ring  %	23
+/cedilla %	24
+/germandbls %	25
+/ae    %	26
+/oe    %	27
+/oslash %	28
+/AE    %	29
+/OE    %	30
+/Oslash %	31
+/space %	32	% /suppress in TeX text
+/exclam %	33
+/quotedbl %	34	% /quotedblright in TeX text
+/numbersign %	35
+/dollar %	36
+/percent %	37
+/ampersand %	38
+/quoteright %	39	% /quotesingle in ANSI
+/parenleft %	40
+/parenright %	41
+/asterisk %	42
+/plus  %	43
+/comma %	44
+/hyphen %	45
+/period %	46
+/slash %	47
+/zero  %	48
+/one   %	49
+/two   %	50
+/three %	51
+/four  %	52
+/five  %	53
+/six   %	54
+/seven %	55
+/eight %	56
+/nine  %	57
+/colon %	58
+/semicolon %	59
+/less  %	60	% /exclamdown in Tex text
+/equal %	61
+/greater %	62	% /questiondown in TeX text
+/question %	63
+/at %	64
+/A %	65
+/B %	66
+/C %	67
+/D %	68
+/E %	69
+/F %	70
+/G %	71
+/H %	72
+/I %	73
+/J %	74
+/K %	75
+/L %	76
+/M %	77
+/N %	78
+/O %	79
+/P %	80
+/Q %	81
+/R %	82
+/S %	83
+/T %	84
+/U %	85
+/V %	86
+/W %	87
+/X %	88
+/Y %	89
+/Z %	90
+/bracketleft %	91
+/backslash %	92	% /quotedblleft in TeX text
+/bracketright %	93
+/circumflex %	94	% /asciicircum in ASCII
+/underscore %	95	% /dotaccent in TeX text
+/quoteleft %	96	% /grave accent in ANSI
+/a %	97
+/b %	98
+/c %	99
+/d %	100
+/e %	101
+/f %	102
+/g %	103
+/h %	104
+/i %	105
+/j %	106
+/k %	107
+/l %	108
+/m %	109
+/n %	110
+/o %	111
+/p %	112
+/q %	113
+/r %	114
+/s %	115
+/t %	116
+/u %	117
+/v %	118
+/w %	119
+/x %	120
+/y %	121
+/z %	122
+/braceleft %	123	% /endash in TeX text
+/bar   %	124	% /emdash in TeX test
+/braceright %	125	% /hungarumlaut in TeX text
+/tilde %	126	% /asciitilde in ASCII
+/dieresis %	127	not used (see 168), use higher up instead
+/Lslash	%	128	this position is unfortunate, but now too late to fix
+/quotesingle %	129
+/quotesinglbase %	130
+/florin %	131
+/quotedblbase %	132
+/ellipsis %	133
+/dagger %	134
+/daggerdbl %	135
+/circumflex %	136
+/perthousand %	137
+/Scaron %	138
+/guilsinglleft %	139
+/OE    %	140
+/Zcaron %	141
+/asciicircum %	142
+/minus %	143
+/lslash %	144
+/quoteleft %	145
+/quoteright %	146
+/quotedblleft %	147
+/quotedblright %	148
+/bullet %	149
+/endash %	150
+/emdash %	151
+/tilde %	152
+/trademark %	153
+/scaron %	154
+/guilsinglright %	155
+/oe    %	156
+/zcaron %	157
+/asciitilde %	158
+/Ydieresis %	159
+/nbspace %	160	% /space (no break space)
+/exclamdown %	161
+/cent  %	162
+/sterling %	163
+/currency %	164
+/yen   %	165
+/brokenbar %	166
+/section %	167
+/dieresis %	168
+/copyright %	169
+/ordfeminine %	170
+/guillemotleft %	171
+/logicalnot %	172
+/sfthyphen %	173 % /hyphen (hanging hyphen)
+/registered %	174
+/macron %	175
+/degree %	176
+/plusminus %	177
+/twosuperior %	178
+/threesuperior %	179
+/acute %	180
+/mu    %	181
+/paragraph %	182
+/periodcentered %	183
+/cedilla %	184
+/onesuperior %	185
+/ordmasculine %	186
+/guillemotright %	187
+/onequarter %	188
+/onehalf %	189
+/threequarters %	190
+/questiondown %	191
+/Agrave %	192
+/Aacute %	193
+/Acircumflex %	194
+/Atilde %	195
+/Adieresis %	196
+/Aring %	197
+/AE    %	198
+/Ccedilla %	199
+/Egrave %	200
+/Eacute %	201
+/Ecircumflex %	202
+/Edieresis %	203
+/Igrave %	204
+/Iacute %	205
+/Icircumflex %	206
+/Idieresis %	207
+/Eth   %	208
+/Ntilde %	209
+/Ograve %	210
+/Oacute %	211
+/Ocircumflex %	212
+/Otilde %	213
+/Odieresis %	214
+/multiply %	215	% OE in T1
+/Oslash %	216
+/Ugrave %	217
+/Uacute %	218
+/Ucircumflex %	219
+/Udieresis %	220
+/Yacute %	221
+/Thorn %	222
+/germandbls %	223 % SS in T1
+/agrave %	224
+/aacute %	225
+/acircumflex %	226
+/atilde %	227
+/adieresis %	228
+/aring %	229
+/ae    %	230
+/ccedilla %	231
+/egrave %	232
+/eacute %	233
+/ecircumflex %	234
+/edieresis %	235
+/igrave %	236
+/iacute %	237
+/icircumflex %	238
+/idieresis %	239
+/eth   %	240
+/ntilde %	241
+/ograve %	242
+/oacute %	243
+/ocircumflex %	244
+/otilde %	245
+/odieresis %	246
+/divide %	247	% oe in T1
+/oslash %	248
+/ugrave %	249
+/uacute %	250
+/ucircumflex %	251
+/udieresis %	252
+/yacute %	253
+/thorn %	254
+/ydieresis %	255	% germandbls in T1
+] def
+
+%%EndProcSet
+%%BeginProcSet: special.pro
+%!
+TeXDict begin/SDict 200 dict N SDict begin/@SpecialDefaults{/hs 612 N
+/vs 792 N/ho 0 N/vo 0 N/hsc 1 N/vsc 1 N/ang 0 N/CLIP 0 N/rwiSeen false N
+/rhiSeen false N/letter{}N/note{}N/a4{}N/legal{}N}B/@scaleunit 100 N
+/@hscale{@scaleunit div/hsc X}B/@vscale{@scaleunit div/vsc X}B/@hsize{
+/hs X/CLIP 1 N}B/@vsize{/vs X/CLIP 1 N}B/@clip{/CLIP 2 N}B/@hoffset{/ho
+X}B/@voffset{/vo X}B/@angle{/ang X}B/@rwi{10 div/rwi X/rwiSeen true N}B
+/@rhi{10 div/rhi X/rhiSeen true N}B/@llx{/llx X}B/@lly{/lly X}B/@urx{
+/urx X}B/@ury{/ury X}B/magscale true def end/@MacSetUp{userdict/md known
+{userdict/md get type/dicttype eq{userdict begin md length 10 add md
+maxlength ge{/md md dup length 20 add dict copy def}if end md begin
+/letter{}N/note{}N/legal{}N/od{txpose 1 0 mtx defaultmatrix dtransform S
+atan/pa X newpath clippath mark{transform{itransform moveto}}{transform{
+itransform lineto}}{6 -2 roll transform 6 -2 roll transform 6 -2 roll
+transform{itransform 6 2 roll itransform 6 2 roll itransform 6 2 roll
+curveto}}{{closepath}}pathforall newpath counttomark array astore/gc xdf
+pop ct 39 0 put 10 fz 0 fs 2 F/|______Courier fnt invertflag{PaintBlack}
+if}N/txpose{pxs pys scale ppr aload pop por{noflips{pop S neg S TR pop 1
+-1 scale}if xflip yflip and{pop S neg S TR 180 rotate 1 -1 scale ppr 3
+get ppr 1 get neg sub neg ppr 2 get ppr 0 get neg sub neg TR}if xflip
+yflip not and{pop S neg S TR pop 180 rotate ppr 3 get ppr 1 get neg sub
+neg 0 TR}if yflip xflip not and{ppr 1 get neg ppr 0 get neg TR}if}{
+noflips{TR pop pop 270 rotate 1 -1 scale}if xflip yflip and{TR pop pop
+90 rotate 1 -1 scale ppr 3 get ppr 1 get neg sub neg ppr 2 get ppr 0 get
+neg sub neg TR}if xflip yflip not and{TR pop pop 90 rotate ppr 3 get ppr
+1 get neg sub neg 0 TR}if yflip xflip not and{TR pop pop 270 rotate ppr
+2 get ppr 0 get neg sub neg 0 S TR}if}ifelse scaleby96{ppr aload pop 4
+-1 roll add 2 div 3 1 roll add 2 div 2 copy TR .96 dup scale neg S neg S
+TR}if}N/cp{pop pop showpage pm restore}N end}if}if}N/normalscale{
+Resolution 72 div VResolution 72 div neg scale magscale{DVImag dup scale
+}if 0 setgray}N/psfts{S 65781.76 div N}N/startTexFig{/psf$SavedState
+save N userdict maxlength dict begin/magscale true def normalscale
+currentpoint TR/psf$ury psfts/psf$urx psfts/psf$lly psfts/psf$llx psfts
+/psf$y psfts/psf$x psfts currentpoint/psf$cy X/psf$cx X/psf$sx psf$x
+psf$urx psf$llx sub div N/psf$sy psf$y psf$ury psf$lly sub div N psf$sx
+psf$sy scale psf$cx psf$sx div psf$llx sub psf$cy psf$sy div psf$ury sub
+TR/showpage{}N/erasepage{}N/copypage{}N/p 3 def @MacSetUp}N/doclip{
+psf$llx psf$lly psf$urx psf$ury currentpoint 6 2 roll newpath 4 copy 4 2
+roll moveto 6 -1 roll S lineto S lineto S lineto closepath clip newpath
+moveto}N/endTexFig{end psf$SavedState restore}N/@beginspecial{SDict
+begin/SpecialSave save N gsave normalscale currentpoint TR
+@SpecialDefaults count/ocount X/dcount countdictstack N}N/@setspecial{
+CLIP 1 eq{newpath 0 0 moveto hs 0 rlineto 0 vs rlineto hs neg 0 rlineto
+closepath clip}if ho vo TR hsc vsc scale ang rotate rwiSeen{rwi urx llx
+sub div rhiSeen{rhi ury lly sub div}{dup}ifelse scale llx neg lly neg TR
+}{rhiSeen{rhi ury lly sub div dup scale llx neg lly neg TR}if}ifelse
+CLIP 2 eq{newpath llx lly moveto urx lly lineto urx ury lineto llx ury
+lineto closepath clip}if/showpage{}N/erasepage{}N/copypage{}N newpath}N
+/@endspecial{count ocount sub{pop}repeat countdictstack dcount sub{end}
+repeat grestore SpecialSave restore end}N/@defspecial{SDict begin}N
+/@fedspecial{end}B/li{lineto}B/rl{rlineto}B/rc{rcurveto}B/np{/SaveX
+currentpoint/SaveY X N 1 setlinecap newpath}N/st{stroke SaveX SaveY
+moveto}N/fil{fill SaveX SaveY moveto}N/ellipse{/endangle X/startangle X
+/yrad X/xrad X/savematrix matrix currentmatrix N TR xrad yrad scale 0 0
+1 startangle endangle arc savematrix setmatrix}N end
+
+%%EndProcSet
+TeXDict begin 52099146 40258431 1000 600 600 (smptalk.dvi)
+@start
+%DVIPSBitmapFont: Fa cmsy8 16.59 2
+/Fa 2 50 df<4AB47E021F13F891B6FC010315C04981011F15F849814901007FD9FFF0EB
+0FFF4801C00103138048496D13C049C8127F4848ED3FE04848ED1FF049150F4848ED07F8
+003F17FC491503491501007F17FEA290CAFC4817FFA248177FA86C17FFA26C17FE6D1501
+A2003F17FC6D15036D1507001F17F86C6CED0FF06D151F6C6CED3FE06C6CED7FC06D6CEB
+01FF6C6D4913806C01F0010F13006DB4EBFFFE6D90B55A6D5D010715E06D5D010092C7FC
+021F13F802011380383878BE49>14 D<912601FFE0953801FFE0021F01FE061F13FC027F
+D9FFC094B67E49B600F0040381010703FC040F15F04903FF4C9038E03FF84904C0923A7F
+FC0003FC4970DBFFF0EB00FE90267FF0006E02030180143FD9FF80011F01FC4A90C86C7E
+4848C700076DDA0FFC6F7E48486E6DDA1FF0ED03E0D807F002006E494882496F6D494815
+0148486F6D49486F7E49030F6D4848CA127C001F706D485A90C96CD9FC07183C003E704B
+173E716D4848171E48724848171F72EBBFC0007871D9FF80838400F87191CB1380725B48
+2007725B727F84737E737F87737F4F7F6C200F4F7F007895B56C180087007C4D486D5F4E
+486C7F003C4D486C183E003E4D486C7F001E051F6F5E001F4E6C6D16FC4E486C6D5E6C6C
+9326FF800301FE15016C6C4B496C6D4B5A6D4B486D6E140700034C486E01E0EC1FE0D801
+F8DB1FF86E6D4A5A6C6CDB7FF06E01FCECFF80017E4B4802079026FF800790C7FC6D6C01
+0701806E91B55AD91FE0011F90C86C5E90280FFE03FFFC6F6C5D6DB648041F5D010103E0
+040715C06D0380040192C8FC021F01FCCB003F13FC020301C0060313C0813D78BB92>49
+D E
+%EndDVIPSBitmapFont
+%DVIPSBitmapFont: Fb cmmi8 16.59 1
+/Fb 1 102 df<923801FFE0031F13FC92B6FC020315C0020F9038807FE0913A3FFC000F
+F0DAFFF013074901C0EB03F84990C71201D90FFE15FC49481400495A495A4948140118F8
+485B484914034817F091C8120748EE0FE04848ED1FC0EF7F80933803FF004848EC3FFE92
+387FFFF890B712E04893C7FC16F003E0C8FC01F8CAFC12FF5BA55BA5127FA2180C181E00
+3F173F6D167E18FE001FEE01FC6DED03F8000FEE0FF06C6CED1FE0EF7FC06C6C913801FF
+006C6CEC07FE6C01C0EB3FF8903A7FF007FFE0011FB612806D4AC7FC010114E09026003F
+FEC8FC383D7ABB44>101 D E
+%EndDVIPSBitmapFont
+%DVIPSBitmapFont: Fc cmmi8 19.907 6
+/Fc 6 106 df<EFFFF0041F13FF93B612E0030315F8030F81033F9038C03FFF9227FFFC
+00077F4A01F06D7F020701C06D6D140F4A496D6D1580DA3FFEC86C6C141F4A486F7E4A48
+7015004949031F5D49498249496F6D133E495B491B7E4990C96C7F494862874948624872
+14015C4874485A485B525A485B734A5A5A4A4F5A5A52C7FC5C481B7E1CFE91CA5D1BF1B5
+F1F9F8F3FBF04919FF6464A2644997C8FC6363A263A485127FA2611907003F606D5F001F
+187F6D4D6C6C131E6CDD03FE153E6C6DED0FF895383FF03F6C6DDBFFE0157E6C6D020390
+26801FFE13FE6C6D91261FFE004A5AD97FFCDAFFF86D6C485A90271FFF801F01E06D130F
+6D90B600806DEBFFF001034BC76C14C0010003F06E6C5B023F02806F48C7FC020301F0C9
+EA07F8614B79C871>11 D<EA03F8EA0FFE487E4813804813C0A2B512E0A76C13C0A26C13
+806C13006C5AEA03F81313719231>58 D<F10780F10FC0F11FE0A3193F1AC0197FA21A80
+19FF1A00A260611803A261180761A2180F61181FA261183F61A2187F6118FFA296C7FC5F
+60A21703601707A260170F60A2171F60173FA260177F60A217FF95C8FC5EA25F16035FA2
+16075F160FA25F161F5FA2163F5F167FA25F16FF94C9FCA25D5E1503A25E15075E150FA2
+5E151F5EA2153F5E157FA25E15FF93CAFCA25C5D1403A25D14075DA2140F5D141FA25D14
+3F5DA2147F5D14FFA292CBFC5B5CA213035C1307A25C130F5CA2131F5C133FA25C137F5C
+A213FF91CCFC5AA25B12035BA212075B120FA25B121F5BA2123F5B127FA25B12FF90CDFC
+A3127E123C43A576FB58>61 D<030FB600E0090FB612804B6F093F15C0856BA0B7FC6F23
+80DB00015302F8C7FCDC003FE203DF13C0726C65E8079F90C8FC057F525AA2057E0A1E5B
+223C726C1B7F05FE1C7805FC0AF05BA29E3801E0FF0401525A05F866726C4F5AF90F0116
+0305F0091E5C213C6A04076D6D187805E06621F056485A160F05C0E003C05C726DEF0780
+6A041FF30F000580081E5DA2565B043F634D6C6D98C9FC6855485B5E047E50485C555A72
+6D197F04FE50C7FC4C081E5DA25514FF0301634C66726D5E54485B15034C4F485D545A69
+03076F6C4BC7FC4C071E5EA2545C150F4C4F5E736C5D69031F4F5A4C4E485EA253485C03
+3F4FC8FC93C86C6C97CAFC1D1E535D5D037E4F5E65736D177F03FE4E5A4B4E485EA25248
+15FF02014FC9FC4B6F01C0601C1E525D14034B4E5F6468020770EBE1E04BDDE3C05FA2E1
+E7805D020F06EFC9FC4B667313FE021F6563023F4E60A2027F4E5E02FF705B01036D5290
+CBFC010F6D4D84017F01FE4D0303B512E0007FB600FE073FB712FEB794C85A704B864C03
+7E621A7C287FF8007FFC03306FD900015BAA7177F0A9>77 D<DFFFF81570061FD9FFC0EB
+01F895B612F0050303FCEB03F0050F03FF1307053FD9800FEBC00FDDFFF8C7EBE01F4C01
+E091391FF03FE004070180913807F87F4C48C83803FCFFDC1FF8ED00FEDC7FF0047F13C0
+4C5A4B49824B49824B90CA6C13804B5A4C834B5A033F1A004C83157F4B5A654A491701A2
+5C4C60A25CA265A35C65821C03A270715A7094C8FCA2826E7F82707E17E06E14FEEFFFE0
+6E15FEF0FFE06E16FE6FEDFFE01AFC6F16FF6F17C06F17F00303836F836F6C82041F8204
+0783DC007F821707DD007F811807DE007F8019071900083F7F868686747F86A286A30138
+197F137C13FC645BA21201A264A200031AFF64A2505B1207A2505B6D4E90C8FC120F505A
+6D611A1F486C4E5A505A6E4D5A6E4C5B486D4C5B6E4C90C9FC6E4C5A02FEEE3FFC277FF3
+FF804B5A01E101E0913803FFE09026C07FFE020F5B9027803FFFF090B5CAFC26FF000F90
+B65A486D16F8020116E048D9003F158048020702FCCBFC48DA001F1380657776F36B>83
+D<163FEE7F80923801FFE05D5DA25DA417C0A26F1380923803FE00ED00F893C7FCB3A4EC
+3FE0ECFFF8010313FE010F6D7E4980D93FE07FEB7F809039FE007FF0485A4848805B1207
+5B485AA2484813FFA248C7FC5C127E5E007C5B12FC4A5B5A5E5C1270C7485BA293C7FC5C
+A25D147FA24A5AA25D5BA2495BA25D5BA25D491538177C495B17FC92C7FC4915F8160149
+5A17F04A1303A2EE07E0495AEE0FC0A2EE1F80017F143F4AEB7F00167E6E13FE013F495A
+ED07F890391FFC1FF06DB55A6D1480010191C7FC6D13FCEC1FF02E707AED3C>105
+D E
+%EndDVIPSBitmapFont
+%DVIPSBitmapFont: Fd lcmss8 16.59 1
+/Fd 1 53 df<EF0FFF4D7F4D7F5FA294B5FC5E5EA2EE07FB160FA2EE1FF3163FEE7FE3A2
+EEFFC35D4B138317035DED0FFE151F16FCED3FF8157F16F0EDFFE05C4A13C016805C4A13
+004A5A5D143F4A5A4A5AA2495B495BA2495B4990C7FC495AA2495A495A13FF5C485B485B
+5A5C4890C8FC485AA2485A485A12FF90BB12801BC01BE0A56C1AC06C1A80CA000301C0C7
+FCB3A3715B7190C8FC4B5C7BDB56>52 D E
+%EndDVIPSBitmapFont
+%DVIPSBitmapFont: Fe cmsy8 19.907 3
+/Fe 3 108 df<ED1FFF4AB512F0020714FC023FECFF8091B712E04982010716FC498249
+824983498390B97E48844884A248844884A24884A3481980A24819C0A4BB12E0AD6C19C0
+A46C1980A26C1900A36C60A26C606C60A26C606C606D5F6D5F6D94C7FC6D5E6D5E010116
+F06D5E023F1580020702FCC8FC020114F0DA001F90C9FC434376CA58>15
+D<F51F80537EA28A777EA2777E1D078A777EA2777E8B89787E8B787E1E1F787E8B787E78
+7E787F787F797E797E003FC07E488BC17E7A7E8D8D6C20F86C8CD3EA1FFF7A7F0E0313E0
+7A13F89D38007FFE7B6C7E0F0F13E07B13FC0F0113FF7B6C13E0101F13FE1007EBFFC010
+0114E07C7E58B5FC100714C0101FEBFE00107F13F09FB512800F0301FCC7FC0F0F13F057
+1380E77FFEC8FC575A5613F00E0713C05690C9FC565A003FC112F84868C25A21809ECAFC
+686C676C67D26C5A555A68545B5490CBFC545A545A67545A545A1E7F67545A5390CCFCA2
+535A661D07661D0F535AA2535A66A2775A9B6076D8B0>41 D<003CED01E0007EED03F000
+7F15074816F8B3B3B3B3B3B3B3B3B06C16F0007E1503003CED01E02DA66BFB58>107
+D E
+%EndDVIPSBitmapFont
+%DVIPSBitmapFont: Ff lcmssb8 19.907 17
+/Ff 17 124 df<387FFFFEB6FCB3A46C13FEC8FCB3B3A5387FFFFEB6FCB3A46C13FE1859
+6DD83F>58 D<001FB500FC9AB612E04802FF0A0315F8486F63B76C5115FC7063A27063A2
+7063A27098B7FCA27062A27062A27161A37161A27161A202FB6E4F5BA202F96E4F5BA202
+F86E96B55AA26F6D4E5CA26F6D4E5CA26F6E4D5CA26F6E4D5CA26F6E4D5CA26F6E4D5BA2
+6F6E4D5BA26F6E94B55AA2706D4C5CA2706D4C5CA2706E4B5CA2706E4B5CA2706E4B91C7
+FCA3706E4B5BA2706E4B5BA2706E92B55AA2716D4A5CA2716D4A5CA2716E495CA2716E49
+5CA2716E4991C8FCA2716E495BA2716E495BA2716E90B55AA2726D485CA2726D485CA272
+02875CA27202CF5CA27291B6C9FCA2725EA2725EA3725EA2735DA2735DA2735DA2735DA2
+7392CAFCA2735CA2735C736C13F0081F13C06C4994CD6C13F87E6C01C00D1F13E096716E
+F0BB>77 D<051FB57E0407B7FC047F16F80303B9FC031F18F0037F18FE4ABB7E02071AF0
+021F1AFC4A8691BCFC5B5B5B49635B499238F8000F4992C87E90B600F015074803C01501
+484ACA6C5B4B171F4802F017074B83484A834B716C5A481B3F92CC121F1C0F1C07481B03
+765A6F725A9AC7FC8181818115FEEDFFC06C15F8EEFFC017FEEFFFF86CEFFFC019FF6C19
+F81AFF6C1AE01BFC6C1AFF6C1BC01CF06D866D1AFE6D866D1BC00103876D876D87023F86
+6E8602078602011B80EC003F030F1AC003011AE0ED003F040119F0EE000FDD003F17F818
+01DE000716FCF1007F1A071A01E0003F14FE871B078787A2871206000F87EA1FC07F6D1C
+FC7F7F01FF97B5FC486D1BF802E06002F84E14F06E6002FF4E14E04802C0173F03F84D14
+C003FF4CB6FC04E0030F158004FE037F1500DCFFF8010FB65ABE5AA2651DE0656C64001F
+99C7FC00071BFCC663013F1AE001071A8001004FC8FC020F18F8020118C0DA000F4CC9FC
+DB007F15E0DC007F01F8CAFC677776F37E>83 D<001FC312FC4822FF5AC51280A86C2300
+A2001F22FCCC001F02FCCDFCB3B3B3B3B3A5735C857314E0917078EFA2>I<93380FFFFE
+0307B612F0037F15FE0207B812C0023F17F091B912FC010718FF011F19C0017F8590BB12
+F887879326FE001F8004C0010315804BC76C15C003F06E7E03C06F14E092C96C14F0D97F
+FC824A19F802E0824A19FC4A8291CAFC017E1AFE017C83131090CBFCA996B6FC0507B7FC
+4CB8FC163F0303B9FC153F4ABAFC140F023F160191B712800103EDF800010F15C0494AC7
+FC017F14F090B612C0485D484AC8FC485C485C485C5D485C5D5A92C9FCA2B6FC5CA561A2
+806C606F5DA26F5D6C6E5D6F92B6FC6C6E5C03FE14076C6E6C133F9339F003FFFD6C92B6
+12F96C18F119E16C18C16C18816D1701011F16FC6D16F06DDCC00014FC010193C7FC6D6C
+02F8023F13F0020F02C091C8FC020001F8CBFC575E79DB6B>97 D<94387FFF80040FB512
+FE047FECFFC00303B712F0030F16FE033F707E92B97E020318F04A84021F844A18FF4A85
+91BB7E49EDF80749922680007F80494AC7001F804902F8020780494A80494A6E80494A80
+90B6486F7F93C9FC484A707F5D48731480485C4B82481CC05DA2484A82A2481CE05DA248
+91BBFCA5BEFCA21DC0A21D004ACEFCA780A27EA381A27E81A27E817E816C1B0E6F181F6C
+6E60646C6E606C6E5F7016076D6E5E6D6E043F13806D6E5E04FC4BB5FC6D6E15076D6E6C
+143F6D03F049B6FC6D03FE133F6D6C91B9FC6E1A006E61020719F86E19E002001980033F
+95C7FC030F17F8030317E003001780041F03F8C8FC040315C0DC000F01F0C9FC5B5E7ADB
+68>101 D<94381FFFFC0407B612F0043F15FE4BB8FC1507151F157F4AB9FC5C140F5C5C
+5C9438FC007F91B600E0130F4992C712034C14004C157F49183F1A1F1A041A00A7001FB9
+FC4818C05ABA7EA76C60A2001F95C7FCD8000302FCC9FCB3B3B3B36D5C7F6E13E048757B
+F445>I<001FB5FC4814C05AB612E0A76C14C0A2001F1400C9FCAE3807FFFE48EBFF805A
+4814C0B3B3B3B3AB6C14807E6CEBFE001B7476F331>105 D<381FFFF84813FE5AB6FCB3
+B3B3B3B3B36C13FE7E6C13F8187374F231>108 D<95267FFF8094387FFF800507B500FC
+0407B512FC261FFFF0023FDAFF80033FECFF804801FC91B700E092B712E048030304F802
+0316F8B56C010F04FE020F16FE043F70023F824C7149178093B96C90B912C04B724818E0
+0307DEF00718F04B610AF819F84BD9E0034CEBE0034B48C76C6E4848C76C14FCDB7FF002
+1FDB7FF0141F4B486E6E48486E14FE04806E04808091B5C86C91B5C87E4B6F4B814B4F18
+FF4B614B6F4B814B61A24B61A24B61A392CA92CAFCB3B3B3A46C4971497113FE6C73856C
+01F87101F87113F8985B74DAB1>I<95387FFF800507B512F8261FFFF0023F14FF4801FC
+91B712C048030316F0B56C010F16FC043F824C8293B91280030318C04B18E05D4B18F0EF
+C0074B48C715F8DB7FF0143FDBFFC0020F14FC5E91B5C87E4B814B18FE5D4B815DA25DA2
+5DA392C9FCB3B3B3A46C497014FC7E6C01F8053F13F0575B74DA70>I<94381FFFC00403
+B512FE043FECFFE093B712F8030716FF031F17C0037F17F04AB912FC4A84020F727E4A85
+4A854A8549B6D8F80015FC490380010F804902FCC70001804902F06E6C8004C0151F494A
+6F804991C96C804949708090B54870804B824888484A717F4B8348884B83481D80A24B83
+481DC0A2481DE0A34891CB6C14F0A5B61BF8AD6C1DF0A36F5FA26C1DE0A36C6E4D14C0A3
+6C6E4D1480A26C6E4D1400A26C6E94B55AA26C6E4C5C6C6E4C5C6F5E6D6E4B5C6D02E003
+3F5C6D6E4B5C6D02FC4AB65A6DDAFF80010F92C7FC6D03F890B65A6D92B85A6D626E616E
+61020F19806E96C8FC020118FC6E6C17F06F5F030794C9FC030116FCDB003F15E004034A
+CAFCDC001F13C0655E7ADB72>I<F03FC0943803FFE0261FFFF0140F4801FC147F484BB5
+FCB56C5B160F5E5E5E93B6FC5D5D5D5D5DA25D4B15C0F0C00092B500F8C7FC178091B548
+C8FC16F816E0168093C9FC5D5D5D5D5DA25DA25DA392CAFCB3B3AE6C5B7E6C13F83B5B74
+DA4B>114 D<0303B57E92B7FC020716F0023F16FE91B912C0010318F84918FE4984133F
+5B90BBFCA24861489138FC000703E0EB003F4891C812074A15014849ED007F4AEE1FFC48
+18074A16031901F1007848193097C7FCA2808080808115F015FE6CECFFF8EEFFC017FF6C
+17F018FCF0FF806C18E06C8419FC6C846C727E6D846D846D846D846D8413016D84023F83
+140F02031880EC007F1507DB001F16C0EE007F1703DD007F14E0181F18078484000C8312
+1E001F847F487E7F6D19C013FC6D94B5FC486C7E6E4B148002F05D02FC5DDAFF804A1400
+03F0147FB70107B55A93B75AA262626C61001F61000761000196C7FCD8003F17FC010F17
+F0010117C0D9001F93C8FC020115F0DA000749C9FC4B5E7ADB57>I<91381FFFF04A13FC
+5C91B57EB3A4001FBAFC4819C05ABB12E0A76C19C0A2001F1900C74AC9FCB3B3B282A21A
+701AF86E6E13011907F10FFC71133F7113FF6EECF00F94B612FEA280A26E17FC1AF06E17
+C06E17006E16FC6E16F06F15806F02FCC7FC030F14C0030101F0C8FC47747CF152>I<26
+1FFFF894383FFFF04801FE94B512FC5AB64C14FEB3B3B3A261A461A361A261617E616F92
+B6FC606CEF07FD6F140F6C6EEC3FF96FECFFF16C02FF130793B612E16C18C16C18816C18
+016C17FE6D16F86D16F0010FDCC00014FC010393C7FC010003FC023F13F0021F02F091C8
+FC020091CBFC575B74D870>I<001FBF12FC007F1EFFA2C11280A76C1F00A2001F1EFC71
+0D80BD72>123 D E
+%EndDVIPSBitmapFont
+%DVIPSBitmapFont: Fg lcmssi8 19.907 31
+/Fg 31 122 df<EB7FFE90B5FCA35A14FEA35A14FCA514F87E38007FF013FF14E014C05A
+14805A14005A5B485AA25B121F5B485AA2485AA2485AA290C7FC127E1827718F39>44
+D<F307FF091F7F517F98B57EA2508062A2625080A262628962F2FFFB1BF34F814F13E31B
+C34F13C14F138109017F61F13FFE507E077F824F5AA24E497F4E4981A24E5B4E5B767F4E
+90C7FC4E5AA24E486E7F4E5AA24D5B4D496E7FA24D5B4D5B8A4D90C87E4D5AA24D48834D
+4881A24C5B4C4983884C5B4C5B4C8695CAFC4C5A167F4D854C48835D5F4B5B4B874D834B
+5B5D94CB804B4884157F93BCFC92BD7E5CA25C4A88A25C5C8B5C4A48CC12035D4A488749
+875D495B491E804B85495B5B92CE14C0494887137F5C49481DE05A4A87485B481FF05C48
+49875A91CFFC48481EF8007F895B485A49886C487613F001800A0013E0757378F285>65
+D<0807B512C00703B77E073F16FC4EB97E060F18F0067F18FE4DBB12C0170F053F1AE094
+BC12C05E04079238FC0007041F92C8001F14804C02F0150393B60080DB007F13004B4ACA
+120F030702F017034B02C0715A4B91CC127E037F49191C92B500F896C7FC4A14E04A5C4A
+5C4A49CFFC4A5B4A5B4A5B91B55A495C5E4991D0FC495B495B5D495B5B5D495B90B55AA2
+4891D1FC5C5A5C5A5C5A5CA25A5C5A5CA35A5CA4B5FC91D2FCAD80A27EA380A27E80A26C
+7FA26C7FA26C7F807E806C80816C806D6DF103806D6D190F03FEF17FC06D6D4E485A6D02
+C017076D6E171F6D02FC94B5FC6D02FF16076D03E0157F023F02FF023FB6FC6E92B9FC6E
+98C8FC02031AFC02001AF0033F1980030F4EC9FC030318F003001880041F04FCCAFC0401
+16C0DC000702E0CBFC737566F284>67 D<DB7FE0F23FF04A486CF2FFF8701BFC4A6D4F13
+FEA34A63A24C1BFCA34A63A24C1BF8A34A63A24C1BF0A24A63A24C1BE0A34A63A24C1BC0
+A391B562A293CD1480A24999B5FCA24B1C00A34963A24B63A34963A24B63A2496392BDFC
+67A35BA267A35BA203C0CC001F5BA34963A24B63A290B562A292CD5CA34899B5FCA24A99
+C7FCA34863A24A63A24863A24A63A34863A24A63A34863A24A63A34863A24A63A24863A2
+4A63A3B562A291CD5CA36C487490C8FC003F87D81FF8F20FFC77716DF086>72
+D<037FB712804AB812C01AE04A17F0A41AE0A26E17C06E6C1680DB001F01F0C7FCA260A3
+5EA260A25EA260A393B5FCA295C8FCA35DA25FA25DA25FA35DA25FA35DA25FA25DA25FA3
+5DA25FA35DA25FA392B5FCA294C9FCA25CA25EA35CA25EA35CA25EA25CA25EA35CA25EA3
+5CA25EA35CA25EA291B5FC001FB712E04816F84882A2B8FCA56C5E7E6C16E044717CF035
+>I<ED7FE04A487E824A7FA35CA25EA35CA25EA35CA25EA25CA25EA35CA25EA391B5FCA2
+93CDFCA25BA25DA35BA25DA35BA25DA25BA25DA35BA25DA35BA25DA35BA25DA290B5FCA2
+92CEFCA35AA25CA35AA25CA25AA25CA35AA25CA35AA25CA35AA25CA25AA291BB12FC1CFF
+1D80BEFCA56C1C007E6C1BFC59716DF075>76 D<92267FFF80993801FFF84AB500E00A07
+13FC710A1F13FE4A5513FF7164A24A9CB6FC69711EFE69695C716304BF524813FCA2575A
+4AD99FFFF37FF9A2041FE2FFF113F8684A6F63705113C303FE5215F0721B83561303027F
+6D515BF83FFE03FC6E08FC14E0207FF8FFF802FF6D525A726003F85101E014C021C0496E
+505C724E138003F00B0014806770505A49704F5B1F7F4B51481500057F62725F4952495B
+684B013F4E5E724D5B499BC712FF664B6D4E485D735F1E7F4952485B716192C76E4B5F53
+5B535B496F63734B5B4A5090C75CA2714D5A017F714B485CA24A50485E714C5B01FF7161
+525B4A4F495E7160735C485190C85A654A037F033F60734A5A654809FF5E063F4A5B4A50
+94C7FC735B4850495D725E4A4E60744890C9FC644871023F17FF644A7148485F1BFF725D
+4807C1495D1AC391C902E3495F7201E75BA24807EF90C95AF2FFFE49704A60A2007F505E
+63497063636300FF726063497190CA5CF11FFCF10FF06C4894CC6C5B003F8BD81FC07848
+C8FC98716CF0A9>I<92267FFFC0F11FC04AB500F0F17FE0711AF04A6EF1FFF8A2834A63
+A2711AF0A2844A63A2049F6D19E0A34A018F6D5FA204076D19C0A24A63707F03FE1C80A2
+707F027F63707F4B1C00A2717E02FF63717F4B63A2496F6D167FA24B63717FA2496F6D16
+FFA24B63717FA24963717F4B63717F4963A24B6E6C5FA349706D5CA292C86C6D5EA34970
+6D5CA24A6F6D5EA3017F706D5CA24A99C7FC727F01FF63727F4A63A2737E481C7FA24A70
+6D5CA2737F481CFFA24A706D5CA248726D5AA24A637313F8A248637313FC4A637313FEA2
+4863F27FFF91CB5EA2741387481B8F7413CF4964A2007F7390B5FCA2497292C8FCA300FF
+85A2496386A26C48725C003F86D81FC0071F13F075716CF086>I<037FB912F04ABB12E0
+1DFE4AF2FFC01EF81EFF4A1CC01FF08B1FFE8B4A01F8CA003F810A0015E04C060F800B01
+80777E4A091F7F0C077F4C737F8A4A877913805E8B21C05CA24C86A391B563218093CEFC
+A249531300A24B515A66545B5B545B4B081F5B545B545B4951B55A0B0791C7FC4B071F5B
+9AB55A49080714F00A7F5C4B053FB6128092BDC8FC1EFC491CF01EC053C9FC1DF81DC049
+50CAFC1CE009FCCBFCA203C0C800017F4983874B707F8690B5858692CA80747F86488786
+4A85747FA248737F874A86757F5A757F4A8489757F5A757F4A8489757F5A767F4A858A76
+7F5A767F5C767F48757FA24A737FA2767FB5757FA291CE6C7FA2896C4887123FD81FF809
+0390C8FC7A716DF087>82 D<0707B57E4EB612FE061FEDFFE095B812FC0507EFFF80051F
+18E0057F18F84CBA12FE0407F1FF80041F1AC05E93BCFC4B9238F800074B92C8003F1480
+4B02F015034B0280ED007F4B49CA001F13004B01F017074B498392B50080EF00FE4A91CC
+127E4A01FC193C4C96C7FC4A5B5E5C5E4A5BA25C93CFFCA45CA282A282A26E7F8216FC82
+6EEBFFC017F06E14FF18F06EEDFF806E16FCF1FFE06E17FF6E18E06F17FC6FEFFF80030F
+18E06F18F80301846F6C17FF041F84040784040084051F83050083060782DE003F811903
+DF001F80080181F2003F090F80871B017580888888A288A488A36466A3525BA25290C7FC
+646500071BFFD80FC04F5B6D61486C4F5B01FC071F5B48B44F5B02C095B55A02F005035C
+4801FE050F91C8FC6E6C043F5BB600F84BB55ADBFF80020F5C04FE0103B65A6C92B95A00
+1F1B80000798C9FC00011AFC6C6C19F0011F19C0010396CAFCD9007F17FC020F17E00200
+94CBFC030F15F0DB000F01FCCCFC6A7775F373>I<001FC212C0007F21E0C312F0A222F8
+A322F0A26C21E0001F21C0CC6C01C0CCFC63A396B5FCA298CDFCA260A262A360A262A360
+A262A260A262A360A262A360A262A260A262A395B5FCA297CEFCA35FA261A35FA261A25F
+A261A35FA261A35FA261A25FA261A35FA261A394B5FCA296CFFCA35EA260A25EA260A35E
+A260A3705B827013C0857062EF94>I<D81FFCF63F80D87FFEF6FFC06D1D03B56C646E64
+21806C665513006E525AA26C545A545B6E656C65545B6E65666C535B5490C7FC80545A6C
+535AA26E505B6C525B67656E505B6C66656F4F90C8FC535A7E535A6F4E5B666D62525B6F
+626D62525B6F97C9FC646D505A525A81515B6D4F5B656F5F6D4F5B65636F4D90CAFC6D62
+1B7F6F4D5A505B6D6262704B5B6D6262505B7094CBFC6E5F505A63704B5A6E5E4F5B636E
+6D5C4F5B63705C6E4C90CCFC62197F704A5A6E5F4E5B60705D6E4B5B60626E6D4990CDFC
+60614E5A6E6E485AA205815B05835B8105C75B05CF5B8105DF90CEFCEFFFFEA26F5C6060
+A26F5C60A26F5C95CFFC6F5B6F5B6F13E07A7264F085>86 D<94383FFFE0040FB512FC93
+B77E030716E0033F16F84AB87E020783021F83027F188091BA12C0DDFC0314E04CC7123F
+04E0020F13F04949C86C13F803F88103C06F13FC92CAFC14FCD900F0EF7FFE146091CBFC
+1A3FA91A7F1BFCA31AFF1BF8A296B5FC0507B6FC4CB7FC043F16F00303B8FC151F92B9FC
+0203EDFE03020FDAFE0014E0023F148091B500F8C7FC010314C04949C85A011F01F817C0
+4913C0495B4948C95A4801F81880485B485B485B4A5E4890CA14005B123F495F127F4960
+A2197FA200FF18FF4E5BA260606D161F6C6C4C5B6D93B5FC6E14036E140F6C01F891B65A
+02FF010F13FD92B612F96C17E318C36C05035B6C16FE6C16F86CDCC0015B6C93C7FC013F
+02F86EC7FC010F028091C8FC010301E0CBFC4F5B71D862>97 D<157FEDFFC04A7FA25CA4
+5CA25EA35CA25EA35CA293CCFCA25CA25DA3027FED1FFE4DB512E04B010F14F8053F14FE
+94B77E02FF010382040F824B48824C824991B87E03F9834BD9FC008003F701C0130F92B5
+C7000314804902FC020014C004F08104C06F13E04C150F93C914F04949824B824B18F84B
+82495B4B824B18FCA21B7F5BA292CBFCA35BA25CA3137FA25CA213FF1BFF4A19F8A34861
+1CF05C621CE05A624A19C0A248611C804A5F501300A2484F5A505AA24F5B61484E5B4F5B
+6E5E4F5B6E4C5B484DB5C7FC6E4B5B060F5B6E4B5B486D037F5B6E0203B55A01FC01C001
+1F5CDBF801B65A6EB8C8FC00FF18FC6E5E496C5E6E16C06E93C9FC6C486C15FC003F6D15
+F0271FC0007F14C0C8001F49CAFC030113C056756FF267>I<943803FFFE057FEBFFF004
+03B612FE040FEDFFC0043F16F093B812FC030383030FEFFF80033F18E05D92BA12F00203
+9126FC000F14E04A02C0EB007F4A49C8120F4A01F8030313C04A01E015004A49163F91B5
+CAEA1F8049491707494994C7FC4913F05D495B495B5B92CDFC495A495AA2485B5C5A5C5A
+5C5A5CA24890CEFCA25A5BA3127F5BA412FF5BAA7FA2127FA37F123F1A1C6D183E6C197E
+6EEE01FE6E16036C6D1607191F6C6D167F6C01FCED01FF6E15076C6D6C023F5B6C02E049
+B5FC03FE013F14F06D90B85A6D18806D95C8FC6D17FC010317F06D17C06D6C93C9FC021F
+15FC020715E002004ACAFC030F13C0545B6FD85C>I<F43F80F47FE0F4FFF0A263A463A2
+1DE0A363A21DC0A363A21D80A263A21D00A3DD1FFE5C4CB512E0040F02F85C043F14FE93
+B7FC0303EEC07F030F16E0033F04F05B4B16F84AB813FF4A834A9226007FFE5B4A02E013
+074A91C76CB5FC4A01FC14004A01F08191B500C06F5B4991C97E495B4901F882495B4B70
+5B495B495B92CAFC49486113FF5C48495FA24849615C5A4A5F5A4A96C7FC5A91CBFC625A
+4961A21A7F127F4961A31AFF12FF4961A361A263A261A263A36D5FA2007F4E5B617F6100
+3F606D94B55A606C6D5D6E5D6E5D6C6D4B91C8FC6E157F6C6D92B6FC02FF020313BF6C02
+E0010FEB3FFE6C02FEEBFFFE6C91B612FCF0F87F6D16F06D04E05B010F16806D16006D03
+FC6D5A010003F0131F023F02C0EB0FE0020F49CCFC020013F05C756FF267>I<94380FFF
+804CB512F8040F14FF043F15C093B712F0030382030F16FE4B82037F178092B912C01403
+4ADAFC0114E04A9126C0001F13F04A49C712074A01F8020113F84A01E08091B50080ED7F
+FC4991C9123F4949EE1FFE4913F84B160F495B4949EE07FF495B92CAFC495A13FF4A8348
+5B5C5A5C5A5C485B62A24890CBFCA291BBFC481AFEA35AA21BFC1BF81BF001F8CDFC12FF
+A45BA37FA4127FA27FA3123F7FA26C6C181C1A3E6C6D17FE6E16016C6D16076E160F6C6D
+163F6E16FF6C6D15036C6D6C021F5B03F049B5FC6D01FE011F14F06D90B85A6D18806D95
+C7FC6D17FC010117F06D17C0023F93C8FC020F15FC020315E0DA007F91C9FC030713E050
+5B70D85C>I<943801FFFE051FEBFFF094B612FE040715FF161F167F93B8FC030316FE5D
+5D5D4B9038FE000F4B01C0EB00FC92B5C812184A01F815005E4A5B5E5CA25C5EA45C93CA
+FCA35C5D001FB812C04817F05AB97EA56C5F7E6C17C0C701F8CAFC5BA25DA35BA25DA25B
+A25DA35BA25DA35BA292CBFCA35BA25CA2137FA25CA313FFA25CA35AA25CA25AA25CA35A
+A25CA35AA25CA35AA291CCFCA25AA25BA3127FA25BA36C5A121FEA0FE048756AF43F>I<
+DE1FFEEC0FE04DB500C0EB3FF0050F02F0EB7FF8057F14FC4CB66C14FC04076F13FF041F
+824C7013F893B87E4B17E1030717F14B4AC601F913F04B02E0131F4B91C7120F4B01FC02
+03B5FC92B500F0804A02C017E04A91C9FC4A49824A5B16F04A497013C04A5B4A5B93CA7E
+4A481980495BA2495B5D49491900A2495B63495B6492CBFC5B4A187F137F645C1BFF13FF
+4A61A262A3484F5BA362A2505BA2627E6E4D5B62A26E94B5FC6D6C5E4F5C6F5D6D6D5D6F
+5D6D6D5D6FDB7FDF90C7FC6D6D913801FF9F03FF4A131F6D02E090381FFE3F6D02FEEBFF
+FC93B600F85B6D17F06DEFE07F6E16C0021F04805B6EEDFE006E5D020103F013FF6E6C14
+C0030F49C75B030013F093C9FC6163A34F5BA263614F5B614F90C8FC4F5A4F5A003C5F00
+3F05075BD87FF04C5B01FE043F5BD9FFF04AB55ADAFFC0011F5CBBC9FC6119F86119C06C
+60001F4DCAFC000117F8D8001F16C001004BCBFC020114E05E7376D767>I<157FEDFFC0
+4A7FA25CA45CA25EA35CA25EA35CA293CCFCA25CA25DA3027F923807FFC0067F13FC4B01
+03B67E050F15E0053F8102FF91B77E0403824B48824C8249143F4C17804BB5EA001F03F1
+01F0010114C003F301806D7E4901F790C87EDBFFFC81DBEFF06F13E0EDFFE04C81495C93
+C9FC5D5D495B1CC05D5DA249495EA24B1880A292CAFC4960A24A1900A3017F60A24A60A2
+01FF187FA24A60A34819FFA24A60A34860A24A60A24860A24A60A34860A24A60A34860A2
+91CA5CA34860A24996C7FCA2007F60A24960A300FF187FA24960A36C48715A003F181FD8
+1FC0EF0FE053736FF267>I<EDFFC0020313E04A13F0A24A13F8A216F0A35CA216E080A2
+6E13C06E130091C8FCAEEC1FC0EC3FF0147F4A7EA45BA25DA35BA25DA35BA25DA25BA25D
+A35BA292C7FCA35BA25CA3137FA25CA213FFA25CA35AA25CA35AA25CA25AA25CA35AA25C
+A35AA291C8FCA35AA25BA2127FA25BA312FFA25BA36C5A123FEA1FC025746FF32E>I<15
+7FEDFFC04A13E0A25CA45CA216C0A35CA21680A35CA21600A25CA25DA3147FA25DA314FF
+A25DA25BA25DA35BA25DA35BA25DA25BA25DA35BA292C7FCA35BA25CA3137FA25CA213FF
+A25CA35AA25CA35AA25CA25AA25CA35AA25CA35AA291C8FCA35AA25BA2127FA25BA312FF
+A25BA36C5A123FEA1FC023736FF22E>108 D<952607FFE0933801FFF8067F01FE041FEB
+FF80DA1F800103B600C092B612F0DA3FE0010F6F020381027F023F03F8020F15FE4A6C90
+B76C023F814C704A168004077049B812C04C714817E0494A60047FDDC01F17F04BB5D800
+1F4BEBC00703E101F001009126E07FFCC7003F13F803E301C0023FDAFFF0140F4901E790
+C86C01E101C080DBEFFC6F01E390C87EDBCFF86FD9F3FE6F13FCDBDFE0EFF7F8DBFFC06F
+D9FFF081494A6093C95D4B614B96CAFC49496023F84B604B60A249494C495EA24B4E18F0
+A292CA5C494E60A24A4F18E0A3017F4E60A24A96CA14C0A201FF4E60A24A4E1980A34807
+7F60A24A4E1900A34807FF60A24A4E60A2484E197FA24A4E60A3484E19FFA24A4E60A348
+4E60A291CA4A60A3484E60A2494F60A2007F4E60A24996CA5CA300FF4E60A2494E61A36C
+4871487190C7FC003F060F84D81FC0DD07F0EF01FC8E586FD7A2>I<953807FFC0067F13
+FCDA1F800103B67EDA3FE0010F15E0027F023F814A6C90B77E0403824C824C8249143F4C
+17804BB5EA001F03E101F0010114C003E301806D7E4901E790C87EDBEFFC81DBCFF06F13
+E0EDDFE0DBFFC081495C93C9FC5D5D495B1CC05D5DA249495EA24B1880A292CAFC4960A2
+4A1900A3017F60A24A60A201FF187FA24A60A34819FFA24A60A34860A24A60A24860A24A
+60A34860A24A60A34860A291CA5CA34860A24996C7FCA2007F60A24960A300FF187FA249
+60A36C48715A003F181FD81FC0EF0FE053586FD767>I<F0FFF0051F13FF4CB612E00407
+15FC043F8193B87E4B83030717F0031F834B8392B97E4A9126FC007F7F4A028001071480
+4A01FCC8FC4A01F0033F13C04A01C06F13E0027F90C912074B7013F0DAFFF882494918F8
+4949824949EF7FFC495B4990CB123F4A19FE133F4948181F5C01FF1AFF5C485B48865C5A
+A25C5A91CCFC4862A25B123FA34848F13FFEA41B7F1CFC485AA2F3FFF8A2621CF0A25013
+E0A25013C0A26D4E1380007F611C00505A6D187F63003F4F5A6D5F4F5B6C6D4C5B6E4C5B
+6C4E5B6E047F90C7FC6C6D4C5A02FC03035B6C6D030F5B6C6D6C023F5B03E049B55A6C02
+FE011F5C6D90B8C8FC6D5F6D5F6D17F0010317C06D94C9FC6D6C15FC021F15F002071580
+020002FCCAFC030F1380585B70D867>I<F1FFF0060F13FF03FE027F14C04A6C6C48B612
+F04A020715FC4AD9C01F81057F8194B87E04C1834A01C78304CF834CD9E00F80DCBFFEC7
+FCDCFFF8023F7F4A02E0020F7F0580804CC86C7F4C814C6F14804A49824C824C18C04C82
+4A90CAFC4B834B19E087A214FFA24B83A35BA25DA35BA25DA25B634B19C0A349611D805D
+631D005B6392CB5B1B7F5B515A4A5F6462017F4E5B6462505B6201FF4E5B97B5C7FC6E5E
+4F5B6F4B5B48061F5B6F4B5B96B55A6F4A5C486E02075C6F023F91C8FCDAE7FE49B55A92
+26FFC01F5C02E390B75A4819E002E15F02C05F6F4BC9FC6F15F8486E15E06F1580DA8003
+4ACAFC030014F048DB0FFECBFC93CDFC91CFFCA35AA25BA3127FA25BA212FFA25BA36C5A
+123FEA1FC05B6F74D767>I<F17F80953807FFC0DA1F80143FDA3FE091B5FC027F14034A
+6C130F053F14805F4CB6FC495C4C1500EDE01F4C14804C01F0C7FC4991B5128003E101FC
+C8FC4B13F003C713C05F49D9CFFEC9FCEDDFFCEDBFF05E49EBFFC05E93CAFC5D5D495BA2
+5D5D5D5B5DA292CBFCA2495AA35C13FFA25CA35AA25CA35AA25CA25AA25CA35AA25CA35A
+A291CCFCA35AA25BA2127FA25BA312FFA25BA36C5A123FEA1FC042586FD745>114
+D<94383FFFF0040FB67E047F15F04BB712FE0307EEFF80031F17E0037F17F892B912FC14
+035C5C4A912680007F13F84A01F8C7120704C0020013F04A90C9121F4A48160703F8EE01
+E0494993C7FCA2495B5D5B5DA35BA581816D7F81816DEBFF8016F8EEFFC06D15FE6DEDFF
+F06E15FE727E021F16E06E16F86E820201826E6C6F7E031F821507DB003F81040181EE00
+0F050080181F06077F848484737E193FA462A4197F6219FF000C61001F5F6D5ED83FE04C
+5B6D4C5BD87FFC5E01FF047F5B02E04AB5FCB500FC020791C7FCDAFFE090B55A92B75A6C
+606C60000F6000031880C64DC8FC013F5E010F16E001011680D9001F02FCC9FC02001480
+4E5B78D84F>I<ED0FC0ED3FE04B7EA24B7EA25EA35CA25EA35CA25EA25CA25EA35CA200
+1FB912C04818F05ABA12F8A56C18F07E6C18C0C7D83FFCC9FCA2147F5DA314FF5DA45B5D
+A45B5DA35B5DA45B92CAFCA45B5CA4133F5CA3137F5CA413FF5CA45A5CA35AA25CA41707
+6EEC1F80177FEE01FF16076E133FDAF803B5FC91B77EA26C5F95C7FC6C16FC17F06D15C0
+6D4AC8FC6D14F06D91C9FC010113E03D716BEE4B>I<02FE187F496C6CEFFFC04960496D
+4C13E0A44960A24B18C0A34960A292CA1480A34960A24A1900A2017F60A24A60A301FF18
+7FA24A60A34819FFA24A60A34860A24A60A24860A24A60A34860A24A60A34860A291CA5C
+A24860A24996C7FCA261127FA2494D5AA219FF6048485E626060606095B55A5F6D1507EF
+1FFD6C6CDB7FF95B6D6C903803FFF102F8013F13E16C90B75A18036C04FE5C6C16F86C16
+E06C4C6C5B6C4BC7FC6C6C02F86EC8FC011F02C091C9FC010101F8CCFC53586CD567>I<
+03FEF103FC912603FF80F00FFE70181F4A6D183F1D7F1EFC6E6DF0FFF8641EF05213E080
+704D13C0641E805213006E6D5F65525AA2037F4E5A705E65515B033F5F7060515BA25190
+C7FC6F5F715E515A1BFF6F60714A5BA2505B6F5E64714A5BA25090C8FC6F4C5A83505A50
+5A814F5B834F5B4F5B814F5B98C9FC715B047F4A5AA24F5A62706C13FF624E5B6062041F
+5B05FF5C4E90CAFCA270495A61183F6170137F614E5AA261705CA296CBFCA2705B60A260
+705BA2604C5B5E605E4C90CCFC5F161F4C5A4C5A4C5A1503003C020F5BD87FE090B55A90
+B75A94CDFC16FCB75A5E16C05E4BCEFC15F06C14C0000301FCCFFC676F7FD55C>121
+D E
+%EndDVIPSBitmapFont
+%DVIPSBitmapFont: Fh lcmss8 19.907 75
+/Fh 75 128 df<DD7FFF94383FFFC0040FB500FC0307B6FC047FDAFF80023F15E04BB76C
+91B712F003071803031F180F4B604B604AB85C4A4EB8FC5CDD80034AECE0004A01F8C700
+1F4901FCC712074A01C0912603000F01E0EC00C093CA028015004A484D90CAFC4B60A202
+7F183FAD001FB800E092B612F04805F818FC5AB96C84A56C4D60A2001F05E018F0C7D87F
+FCCA49CAFCB3B3B3B26E48715A141FDA0FE0EF07F07C757BF479>11
+D<EE0FFF93B500F0EC1FF8030302FCEC7FFE030F80033F94B5FC5D92B6FC5C5C5CA24AEB
+F8034A9038C0007E93C7121C4A4891C8EA7FFEA24BEF1FF8027F95C7FCAE001FB800F0EC
+07F04805FCEC1FFC5AB96CEC3FFEA56C5FA2001F17F0C7D87FFCCAFCB3B3B3B26E48EF1F
+FC141FDA0FE0EF07F058757BF46D>I<EE0FFF93B512F0030302FCEC07F0030F6EEC1FFC
+153F4BEF3FFE92B6FC5C5C5CA24AEBF8034A9038C0007E93C712084A4891C8FCA25D147F
+AE001FB812F04817FC5AB97EA56C5FA2001F17F0C7D87FFCCAFCB3B3B3B26E48EF1FFC14
+1FDA0FE0EF07F057757BF46D>I<932603FFF0933807FF80043FD9FF80037F01F8EC0FFC
+93B600F04AB500FEEC3FFF03036F020780030F061F4D1380033F604B6092B792B7FC4A60
+4A605C4A9026FE001F4AEBFC0104F001014A9038E0003F4A0180D900600380130E93CA48
+90CA6C13004A5A4B4EEF0FFC093F95C8FC147FAD001FB800F092B600F8EC03F84805FC06
+FEEC0FFE5AB96C724A7EA56C4D60A2001F05F018F8C7D87FFCCA49CAFCB3B3B3B26E4871
+48715A021F180FDA0FE0DD07F0EF03F891757BF4A6>I<943801FFC0050F13F8053F13FE
+94B67E040315E0040F814C814C814C8193B8FC5D4B02C0809438FC003F4B49010F7F4B01
+E07F4D6D7F4B5B94C76C7FA24B4880875E037F167FA71AFFA24F5BA24F5B6163705C033F
+4B5B4FF003804F90CAEA07F04F4818FE704949844E616F020F5B4E5B7148494D5A4E5B6F
+0181B55A05C391CB485A05C75B05DF01F8187F6F90B54861616F4B4E5A96CCFC4E606F4A
+6206F0606F4A6203035C4B91CC485B031F49614B6D98C7FC92B66C605C02076F4E5A4A65
+4A6F187F027F6F4E5A91B500E77F010302C34F5B4902037F011F496C6D4D5B49D9F80061
+49496E4D5B90B500C06D6D60484A6D6D5E4849C76E4C90C8FC48496E6D4C5A4801F0804A
+704C5A48496E6D4B5B4A6E6D4B5B4890C86C6D5D496F6E4A5B007F734A5B49706D4A5B72
+6D4A90C9FC00FF716D91B5FC49706D495B726D495B726D495B726E485B726E485B73D9E0
+7F5B7301F8B55A6D7101FD91CAFC7390B55A007F725D6D715D6D7115E06C725D6E715C6C
+6D7191CBFC6E94B612C06C01F8040715F06E041F03FC16386C01FF4BB86CEC01FC6C02E0
+021F05F0141F6C02FF0107BA388003FF6C92BFFC6D19E36D19806D9538FE003F010706F8
+130F6D06C01303010095C8FC021F04F8031F16F802070480030316C0020003F8CA6CECFC
+00030701FCCB000191C7FC867977F59B>38 D<EA3FFF481380AE6C13001207A25B120FA2
+5BA2485AA35BA2123F5BA3485AA25BA212FF6CC7FCA211276DF239>I<EF7FC0933801FF
+E05E5E041F13C04C138093387FFE004C5A4B5B030713E04B5B4B5B4B90C7FC4B5A4B5A5E
+4A5B4A5B4A5B5C4A5B93C8FC4A5A4A5AA24A5A495BA2495B495BA2495BA24990C9FCA249
+5AA2495AA2495AA2485BA3485BA3485BA3485BA34890CAFCA4485AA5127F5BA612FF5BB3
+A27F127FA67F123FA56C7EA46C7FA36C7FA36C7FA36C7FA36C7FA26D7EA26D7EA26D7EA2
+6D7FA26D7FA26D7F6D7FA26D7F6E7EA26E7E6E7E826E7F806E7F6E7F6E7F826F7E6F7E6F
+7F6F7F6F7F030113F86F7F707E93383FFF807013C0040713E082829338007FC033A06FFD
+50>I<EA7FC0EAFFF07F7F6CB4FC6C7F000F7F6C7F6C7FC613FC6D7E6D7E6D7F6D7F6D7F
+7F6D7F6D7F6E7E816E7E806E7F6E7FA26E7F6E7FA26E7F6F7EA26F7EA26F7EA26F7FA26F
+7FA26F7FA26F7FA36F7FA3707EA3707EA3707EA4701380A518C082A618E082B3A25E18C0
+A65E1880A54C1300A44C5AA34C5AA34C5AA34B5BA34B5BA24B5BA24B5BA24B90C7FCA24B
+5AA24B5AA24B5A4A5BA24A5B4A5BA24A5B4A90C8FC5C4A5A5D4A5A495B495B5B495B495B
+4990C9FC495A495A000313F0485B485B003F5B4890CAFCEAFFFC5B5BEA7FC033A075FD50
+>I<EA3FFF481380AE6C13001207A25B120FA25BA2485AA35BA2123F5BA3485AA25BA212
+FF6CC7FCA211276D8F39>44 D<001FB812F0007F17FCA2B912FEA56C17FCA2001F17F037
+0B7EB045>I<EA7FFEB5FCAEEA7FFE10106C8F39>I<F201F8F203FCF207FE1BFF62A262A2
+621BFE1A7F1BFC1AFF1BF8611BF0A24F13E0A24F13C0A2611B80611B006162197F62A24F
+5AA24E5BA2606260626062A24E90C7FCA24E5AA2187F6118FF615F615F61A24D5BA24D5B
+A25F96C8FC5F60177F6017FF60A24C5BA24C5BA25E605E605E95C9FC5E5FA24C5AA24C5A
+A25D5F5D5F5D5FA24B5BA24B90CAFCA25D5E157F5E15FF5E5C5EA24A5BA24A5BA25C5E5C
+93CBFC5C5D147F5DA24A5AA2495BA25B5D5B5D5B5DA24990CCFCA2495AA2137F5C13FF5C
+5A5C5A5CA2485BA2485BA25A91CDFC5A5B127F5B12FF5BA25BA25B127F6C5A6C5A50A075
+FD67>I<EE3FFF0303B512F0031F14FE92B712C0020316F0020F16FC4A82027F707E91B9
+7E4984498449DAE001804949C7001F7F4901F002037F4901C002007F4B814990C96C7FD9
+FFFC040F7F4A824849707FA24849707F4A8248864A177FA2488691CB123FA24848727EA3
+003F864984A4007F1B80A34984A500FF1BC0B3A8007F1B806D60A6003F1B00A26D60A300
+1F626D183FA36C6D4D5AA26C6D4D5AA36C6D4C5B6E5E6C626E5E6C6D4C5B6E5E6D6C4C5B
+6D01C092B5C7FC6F5C6D01F802075B6D01FF023F5B6DDAE001B55A6D91B75A6D606D606E
+5F021F4CC8FC6E5E020316F0020016C0033F92C9FC030314F0DB003F90CAFC527376EF67
+>I<167C16FF5D4B7F150F5D157F4AB5FC1407147F011FB6FC001FB7FC5A5AA2B8FCA36C
+149FECFE1F6C13E0380FF800C8FCB3B3B3B3A70007BAFC001F19804819C0A21AE0A31AC0
+A26C19806C190043706DEF67>I<93B57E031F14FC92B712C0020316F0020F16FE023F70
+7E91B912E04984010718FC4984498449DA000F814901F0D9007F8090B500800207804849
+C80001804A6F6C7F4849041F7F4801E0707F4A16034849707F488491CB6C1380485A7413
+C04848845B7413E0485A86A26C481AF0123F6C4884120F12076C5ACDFCA362A31CE0A262
+1CC0A2621C8062501300A2505A61634F5B4F5B614F5B4F5B4F5B96B5C7FC4E5B06075B4E
+5B4E5B4E13C095B55A4D91C8FC4D5B4D13F8051F5B4D5B94B512804C91C9FC4C13FC4C5B
+041F13E04C5B4C5B4B4848CAFC4B5B4B5B4B13E0033F5B4B5B4B48CBFC4A5B02075B4A13
+E04A5B4A5BDAFFFECCFC495B495B010F13E0495B495B4948CDFC48485A4890BB1280481B
+E05A003F1BF0A66C1BE07E6C1B80547078EF67>I<93380FFFE04BB6FC031F15F092B712
+FC020316FF020F17C0023F17F091B912FC4984010784499126F8007F80013F0280010380
+4901FCC88090B500E0033F7F480280030F7F4849C97E4849707F4801F0824849707F5C91
+CB127F6C48856C5A12035B6C5A6C5A90CCFCA4505AA34F5B61A24F5B614F5B4F5B6196B5
+5A06035C060F91C7FC067F5B0503B55A040FB65A031FB75A4B5E1A8097C8FC19FC19F085
+19FF1AC01AF06F16FC92C86C13FF060780060014E0073F7F070F7F737F07017F737F7413
+801CC0867413E0A27413F0A27413F8A37413FCA9621CF81238007C61007E1BF0127F01C0
+60486C4E13E07F01FC4E13C001FF95B512806E5E6C01E04C14006C01FC040F5B6C01FF04
+3F5B000702E092B5FC6C02FE02035C6CDAFFF0017F5C6C6C91B812C06D61010F96C7FC01
+0318FC010060023F17E0020F178002014CC8FCDA003F15F0030392C9FCDB001F13E05673
+78EF67>I<953807FFC0061F13F060866095B5FC5FA25F5FA25F4D5A173F60177F4D5A4C
+5BA24C5B5E604C5B5E4C5B5F167F4C5A5F5D4B5B4B5BA24B5B4B5B5D94C7FC4B5A15FF5E
+4A5B4A5B5C5E4A5B5C4A5B93C8FC4A5A14FF5D495B5B495B5D495B5B5D4990C9FC5B495A
+5C485B5A485B5C5A485B5C4890CAFC5A485A90BC12FEF4FF80A21DC0A56C1C80A2001FF3
+FE00CB000101F8C8FCB3A7725BA2F13FC05A6F7AEE67>I<010FBA7E013F19E0A24985A5
+63A21B8002F8CDFCB3AA93380FFFF04BB6FC030F15E0033F15F802F9B712FE91B97E1AE0
+86861AFE869326FC003F80048001078003FCC8FC03E06F7F4B031F7F92C96C7F4A824A70
+7F4A846D48824A707FEB0F8090CC6C1380A37413C0A47413E0AC5013C0A4501380120748
+6C95B5FC486C1A006D5F486C61486C4D5B486C5F01FF4D5B6E5E6C01E04C5B6C6D93B55A
+6C01FC03035C6CD9FF80020F5C6C02F0027F91C7FC6C9126FF8007B55AC692B75A6D606D
+18E0010F60010395C8FC010017FC023F16F0020F16C002014BC9FCDA003F14F0030101FC
+CAFC537077EC67>I<943807FFF894B612E0040715FC043FEDFF8093B87E1503150F153F
+5D4AB9FC4A9138FE000F4A02C0EB003F4A49C8EA07804A01F892C8FC4A13E04A138091B5
+CCFC4913FC495B495B495B495B5D4990CDFC495AA2495A5C5A5C5A5C5A5C5AA25C5AEF7F
+FC91C70007B512C048033F14F84BB612FE0307814848011F16C04B8292B87E4A834A834A
+8326FFFC1F9026F8007F7F0480010780DA3FFCC7000180DA7FF06E6C7FDAFFC08101FD49
+030F7F4AC96C7FD9FFFC824A707F5C737F4A177F4A844A83A291CB6C1380A35BA2007F73
+13C0A8123FA37F7EA36E4D13807EA2806C4F1300806C616E606C19FF6E606C606E4C5B6D
+6C4C5B6E5E6D6D4B5B6D6D4B5B03F092B55A6D01FC020391C7FC6D01FF020F5B6D02F090
+B55A6D91B75A6D606E5F6E5F020F94C8FC6E5E020116F86E6C15E0031F92C9FC030314FC
+DB003F1380527376EF67>I<93381FFFE00303B6FC031F15E092B712FC0207EEFF80021F
+17E04A8391B912FC49840107727E499126E0001F804901FCC8804901E0031F7F49018003
+077F4948C900017F02F8EE007F4849717E4849717E4A83481B804A83481BC091CB7EA248
+1BE04984A86C6C4E13C0A36C6D4D1380A26C6D4D13006C6D4D5A6E173F6C6D4D5A6D6C4D
+5A6DB404035B6D01C0030F5B6D01F0033F5B010301FF0203B5C7FC6DDAFE01B55A6D6C90
+B712F8021F17E002071780020004FCC8FC031F15E06F5D92B712FC020316FF021F17E002
+7F17F849B912FE499126C0000F7F010F01FCC814C04901E0031F7F49018003077F4948C9
+00017F4948707F4849717E4849717E484971138048497113C04A83481BE04890CB6C13F0
+A24984007F1BF8A2498400FF1BFCA96C6C4E13F8A46C6C4E13F0A26E5F6C1BE06E5F6C6D
+4D13C06C6D4D13806E5F6C6D94B512006C6D4C5B6C6D6C03075B6D01E0031F5B6D01FC92
+B55A6DD9FFE0011F5C6D91B85A6D616D96C7FC010018FC023F17F06E5F02071780020004
+FCC8FC031F15E0030392C9FCDB001F13E0567378EF67>56 D<EE3FFF0307B512F8033F14
+FE92B712C0020316F0020F82023F16FE4A8291B912C001038449DAE001804949C7003F7F
+4901F002077F49498049018002007F90B5C96C7E4849824849707F4A707F484982484984
+4A824849707FA24890CB7FA34848727EA3747E485AA28786A41C80A71CC06C7E62A36D60
+7E97B5FC806C606E5E6C7F616C6D5E6EEE3FEF6C6D167F6C01FFEEFFCF6F0203138F6C02
+E0020F130F6D01F8EC7FFE6D903AFF8007FFFC6D91B6484813806D17F06D17E06D17C06D
+17006D5E023F03F815006E03E05B020792C7FC020014F8030F01805D92CA127FA2631AFF
+6361A263614F5BA24F5BA24F5B4F90C7FC614F5A4E5B604E5B01704C5B01FC4C5B6D047F
+5B486C6C4AB55A4801E0020791C8FC02FC023F5B489026FFC003B55A92B75A616C18C06C
+606C6C4CC9FC011F16F801075E010116806D6C4ACAFC020F14F09126007FFECBFC527376
+EF67>I<EA7FFEB5FCAEEA7FFEC7FCB3B3B2EA7FFEB5FCAEEA7FFE10566CD539>I<EA3FFF
+481380AE6C1300C8FCB3B3B2EA3FFF481380AE6C13001207A25B120FA25BA2485AA35BA2
+123F5BA3485AA25BA212FF6CC7FCA2116D6DD539>I<001FC212FE488D482280C412C0A6
+6C22806C2200000F21FCD7FCB3AA000FC212FC003F21FF482280C412C0A66C22806C2200
+6C698A3475C7A1>61 D<F007FE95381FFF804E7F4E7F95B57EA24D80A24D80A24D80A24D
+80A34D6D7F18FE053F814E7E057F81A24D486C7FA24C496C7FA24E7E4C82A24C496C7FA2
+4C496C7FA24C90C780A24C6F7F5FA24C486E7FA24C486E7FA24B496E7FA24B496E7FA24B
+844D80A24B496E7FA24B90C980A24B48707FA2037F717F5E03FF854C824A864C82A24A49
+707FA24A49707FA24A864C824A8793CBFC4A874B84A24A48727FA291BD7EA24988A24988
+A24988A34988A24990CD80A249894A86017F894A8601FF894A86A24849747FA24849747F
+A248767F5C488A4A86481F8091CFFC481FC04988A248487613E0A200FF7713F05B4988A2
+01C01C036CD113E0747378F285>65 D<001FB97E4818FF4819F0BCFC1BE01BF81BFE757E
+1CE01CF88849C9000F15FFDE001F81070181DF003F80080780080080093F7F090F7F8775
+7F1B00761380A2881EC088A7521380A26499B51200515B63515B091F5B515B98B55A0803
+5C081F5C97B548C7FC07075C96B612F095B712C090BCC8FC1BFC1BE098C9FC1AF01AFEF2
+FFE01BFCF3FF801CF01CFC49CA15FF070315C0DF003F80080714F8080080093F7F090F7F
+09031480090014C07613E00A1F13F07613F8887613FCA27613FE88A21EFF89A69AB5FC1E
+FE64A25213FC645213F8640A7F13F099B5FC090314E0090F14C0097F148050B61200081F
+5C4FB65A077F5D90BD12E0659AC7FC1CFC1CF01CC051C8FC1BF86C1A806C07F8C9FC6C06
+FCCAFC68716DF087>I<96B512F8063FECFFF00503B87E053F17F894BAFC040719F0041F
+19FC047F854BBBFC15075D033F9238C0003F4B02F8C85C4AB60080151F4A02FCC912034A
+02F0EE007F4A02C0171F4A91CB12074A01FCF001F84A49F0007891B500E096C7FC495C49
+5C4991CFFC495B495B5D495B495B5D90B55A5A92D0FC485BA2485BA2485BA25C5A5C5AA2
+5CA25A5CA4B5FC91D1FCAD807EA4807EA280A27E807E80A26C7FA26C7FA26C7F817E6D7F
+816D7F6D7F816D7F6D7F6D806D806D6E19076E01F8F11F806E6D197F6E01FF19FF6E02C0
+17076E02F0171F6E02FC057F13C06EDAFF800303B5FC6E6C02F8153F6FDAFFC0010FB6FC
+030F92B9FC6F1B800301F2FE006F6C19F8041F19E0040796C7FC040018FC053F17E00503
+94C8FCDD003F15F0060002FCC9FC6A7571F284>I<001FB912FC48F0FFF04819FFBC12F0
+1BFCF3FF801CE01CF81CFE767E8991CA003F15F0070081080F14FE080080093F80090F80
+0903800900800A3F7F767F0A077F767F7680768089777F777F89777F8B89777FA2777FA2
+781380A28A20C0A28A20E0A28A20F0A38AA220F8AE20F0A266A320E066A320C066A25413
+80A29BB51200A2535BA2535B65535B6765535B535B9AB55A640A0791C7FC525B0A3F5B52
+5B51B55A09075C091F5C98B6C8FC08075C087F5C071FB612F091BC5A1D8052C9FC641CF0
+1C8051CAFC1BF06C1A806C07F8CBFC6C06FCCCFC75716EF093>I<001FBEFC481DC05ABF
+12E0A51EC0A21E0091D0FCB3B3A291BC12C01DF0A289A565A21DC091D0FCB3B3A591BD12
+C01EF0A21EF8A66C1DF07E6C1DC065716EF081>I<001FBD12F0481CFC5ABE12FEA51DFC
+A21DF091CFFCB3B3A491BB12F01CFCA288A564A21CF091CFFCB3B3AC6C5A123FEA1FF85F
+716EF07B>I<D81FF8F20FFCD83FFEF23FFF127FB5501380B3B3AA91BDFCAB91CD7EB3B3
+AE6C48741300123FD81FF8F20FFC61716EF086>72 D<001FB712E04816F85AB812FCA56C
+16F8A2001F16E0D8000149C7FCB3B3B3B3B2001FB712E0007F16F8A2B812FCA66C16F87E
+6C16E02E717DF035>I<F13FF0F1FFFCA24E13FEB3B3B3B3B260A21AFC003C5F123E007F
+4D13F801C05E01F05E01FC93B512F0D9FF801403B500F0020F14E09126FF8001B612C092
+B812801A00616C60001F60000318E0C61880011F4CC7FC010116F8D9001F1580DA003F01
+F0C8FC477478F05F>I<D81FF0983803FFE0D83FFC090F13F0007F64486C1B7F9AB5FC52
+14C05214800A0F1400525B5213F899B55A515C515C5191C7FC091F5B515B5113F050B55A
+505C505C5049C8FC083F5B505B97B512E04F5C07075C4F91C9FC4F13FC077F5B96B55A4E
+5C4E1480060F91CAFC4E5B4E13F895B55A4D5C4D5C4D91CBFC051F5B4D5B4D5B94B512E0
+04035C4C5C4C49CCFC043F5B5E93B57E4B800307814B814B814B8192B77E5C4A029F7F02
+0F020F7F4A496C7F4A496C804AD9F0018090B6486C804C6D7F93C77E4B6E7F4B824B6E7F
+03E06E7F4B6E804B6E8092C98002FC824A707F4A8402C0707F4A707F91CA6C7F49718073
+8073808688747F747F747F747F7480748086757F89757F757F757F757F75807580878A76
+7F767F767F767F767F761480887614C01FE07713F0896C4887003F88D81FF0090313E06C
+716DF08B>I<EA1FF8EA3FFE127FB5FCB3B3B3B3B3A991BB12FC1CFFA21D80A56C1C007E
+6C1BFC59716EF075>I<261FFFC0F5FFFE4801F00A03EBFF80486D64B56C5214C06E64A2
+6E64A36F63A26F98B6FCA201FB6D5013EFA201F96D5013CFA26F6201F81E8F6F62027F1D
+0F6F62023F1CFEA26F1A3F6E1CFC70197F6E1CF87019FF6E1CF070606E1CE070606E1CC0
+7060A26E6D4E1380A2037F1B007060033F6270183F6F6271177F6F627117FFA26F6D4C5B
+A26F6D4C5BA26F6D4C5BA26F62715E047F96C7FC715E043F6071163FA2706D4B5AA2706D
+4B5AA2706D4A5BA27060725C7060725C7060725CA2716C4A90C8FCA2716C4A5AA2715E73
+137F715E7313FF715E735A715E735A715EA2735A715E735A067F92C9FC735A063F5CA272
+6C485AA2725C1AFF725CA2725CA3725CA2725C7390CAFCA2F11FFCF107F06C4894CC6C13
+80123FD81FC09B3801FE0082716DF0A9>I<261FFFE0F107F04801F8F11FFC487FB56CF1
+3FFE8081A28181A281A201FB7F01F97FA201F87FA26E7EA26E7F6E7FA26E7FA26E7F6E7F
+A26E7FA26E7F6F7EA26F7FA26F7F6F7FA26F7FA26F7F6F7FA26F7FA2707EA2707F707FA2
+707FA2707F707FA2707FA2707F717EA2717FA2717F717FA2717FA2717F717FA2717FA272
+7EA2727F727FA2727FA2727F727FA2727FA2727F737EA2731380A27313C07313E0A27313
+F0A27313F87313FCA27313FEA2F27FFFA27413BF7413FFA286A28686A286866C487313FC
+003F86D81FC0070F13F05F716DF086>I<96380FFFF80607B612F0067F15FF0507B812F0
+053F17FE94BA7E040719F0041F19FC047F19FF4BBC12C04B87030F9226F0000715F84B02
+FCC8001F80037F02E0030314FF92B548CA003F80020302F8050F14E04A02E00503804A02
+800500804A49CC003F7F4A01F8070F7F4A49737F91B500C0070180494A73804991CE6C7F
+4901FC091F7F4949757F4B874949757F498B4949757F4B8790B5D06C7FA24849777F4849
+777FA24849777FA24A89488D4A89488DA24A89488DA24A89488DA491D27EA2B52180AC6E
+9BB5FCA26C2200A36E65A26C69A26E65A26C6D535BA26C696E65A26C6D535BA26C6D535B
+6E656C696F99B5FC6C6E515C6D9DC7FC6F636D6D515B6D6D515B6F636D6D515B6D6D515B
+6D6E97B55A6D6E4F5C6D6E4F5C6E01F8070F91C8FC6E6D4F5B6E01FF077F5B6E02C04DB5
+5A6E02F005075C6E02FC051F5C020002FF057F14806F02E00303B6C9FC6F02FE033F5C03
+0FDAFFF8010FB612F8030392B912E06F636F6C97CAFC041F19FC040719F004001980053F
+4DCBFC050717F0DD007F93CCFC060715F0DE000F01F8CDFC897775F3A0>I<001FB912F0
+48F0FFC04819FCBC7E1BF01BFC1BFF1CC01CF0881CFE91CA003F80070081080F80080380
+E0007F7F757F090F7F757F1B01757F1E80887613C0881EE0A288A21EF088A7641EE0A264
+A21EC06452138099B5FC1E00515B1B07515B093F5B515B0803B55A080F5C97B65A073F92
+C7FC91BB5A1CF8641CC099C8FC1BFC1BF01B8008FCC9FC1AC007F0CAFC91D0FCB3B3A76C
+5A123FEA1FF864716EF082>I<001FB912F848F0FFF04819FFBC12F01BFEF3FFC01CF01C
+FC1CFF1DC08991CA000715F8DF000F80080014FF091F80090380090080767F1C1F767F76
+7F88767F888A89A21F8089A6651F00A29AB5FC6664525B64525B525B1C7F99B55A09035C
+091F5C98B6C7FC080F14FC0707B65A91BC12E0659AC8FC1CFC1CF01CC051C9FC1BF098CA
+FC1AF0A291C900037F86727F84737E737F87737F85737F737F87737F737F86747F88747F
+747F86747F88747F747F87757F89757F757F757F8789757F757F767F888A767F767F767F
+888A767F767F7713807713C0A27713E06C4887003F7613C0D81FF8090113806B716EF087
+>82 D<4CB512E0043FECFF800303B712FC031FEEFF8092B912F0020318FC020FF0FF8002
+3F19E04A19F849BB7E5B5B49ED8000013F02E0C712034991C9003F5B03F8160790B500E0
+1601480280EE007F4891CB121F02FC18074849725A4A1800484996C7FC5C5A5CA24890CF
+FCA680A3806C7FA28014FC6C7F6E7E6C14E015F86C14FF6C15E016FF6C16F86DEDFFC06D
+16FE6DEEFFF06D17FF6D18F0010118FC6D18FF023F18C0020F18F0020318FC020018FF03
+1F84030384DB007F83040383DC001F82050082060781DE003F8007031580F1007F081F14
+C0080714E01A01746C13F087877513F887A27513FC87A387A75113F8A35113F0003C6212
+3F486C4F13E001E06101F84F13C001FE4F13806D6C4DB5FC02E04D1400B500FC050F5BDA
+FF80043F5B03F84BB5FCDBFF80020F5C04FF49B65A6C93B812C0001F63000798C7FC0001
+1AFCD8003F61010F19E001011980D9003F4DC8FC020717F0DA007F16C0030303FCC9FCDB
+000391CAFC5E7777F373>I<001FC212C04821F05AC312F8A56C21F0A2001F21C0CC001F
+01E0CCFCB3B3B3B3B3A8735B857390CDFC857079EF94>I<D81FF8F201FCD83FFEF207FF
+127FB5501380B3B3B3B3A56E61A26C1D00A26E617E656E197F6C646E19FF6C505B806C6D
+4E5B6E606C505B6E606C6E4D5B6C02E04D5B6D6D4CB5C7FC6D6D5E6D01FE040F5B6D6D6C
+033F5B6D02F04AB55A6D02FE020F5C6D9126FFF001B65A6D92B81280023F96C8FC6E18FC
+020760020118E06E6C1780031F4CC9FC030716F8030016C0041F4ACAFCDC007F13806174
+6EF086>I<D83FF81E7FD87FFE9A3801FF80B55313C06E64676C6D1E8067806C54130080
+6C545A806C545A806C535B806C535B806C535B816C535B816D525B816D9BC7FC6F626D65
+6F1A7F6D656F1AFF6D656F616D65656D6D6365826D515B826E505B826E5090C8FC826E50
+5A826E505A826E4F5B826E4F5B826E63715E6E63715E6F62715E6F97C9FC646F6D5F1C7F
+6F6D5F1CFF6F6D5F636F6D5F63836F4D5B846F4D5B847060725C7095CAFC725C705F1B7F
+706D5D1BFF706D5D62706D5D62706D5D627002805C627101C05CA2716D4890CBFCA2714A
+5A19F0714A5A19F8505A717FA27101FD5B96B5FC715DA2715DA2725CA27291CCFCA2725B
+A2725B060313F0060013C07A727BF085>I<D83FF0972603FF80F207F0D87FFC5001E0F2
+1FF86D506D1A3FB5506DF27FFC6C516DF2FFF880A26C516D4F13F08099B5626C771BE080
+51646C0ADF6D1AC0805101CF6D606C6D088F1C80A26C506F4E13006E1A87510107626C78
+616E86E11FFE1B7F6C78616E86E13FFC6E18FF6DA15B6F856D4F486E4D5B8109FF147F6D
+506E4D5B81506F606D506F606F8650715E6D50646F866D4E496F4C90C7FC818A6D4E90C7
+6E4C5A81506F187F6D4F705F81083F6F18FF6E4E705F826E057F6F6D4B5B63826E05FF70
+6C4B5B6370866E4C49714A5B824F715E6E4E715E826E4C714C90C8FC5183826E4C714C5A
+98C980826E4C716D4A5A6270866F4B48724A5AA26F6D735F4F48725BA26F6D087F5E4F48
+725BA26F6D745E4E49735AA26F01F0745E4E49735A6F7693C9FC05F85C4E755A6F765D05
+FC91CBFC4EF3F03F6F765D05FE5B061FF3F87F047F755D05FF5B70756D485A4E5AA27001
+BF087F5C4F1AFD06FF98B5FC70765C61A270765C618D704A99CAFCA270765B96CDFC7049
+745B7148745BDD1FF89738007FE0B6727CF0BF>I<260FFFE0F37FF84801F8F201FF6E50
+7F6E62535B6C6D626C6E4F5B6C6E636C6E4F5B6C6E96B55A6D6D4E91C7FC6D6D4E5B6D50
+5B6D6D4E5B6D6D4E5B6D6E5F70616D6E4D5B6D6E94B55A6E6D4C91C8FC6E4E5B6E6D4C5B
+6E6D4C5B6E6D4C5B6E6E4B5B6E806E6E4B5B6F6D92B55A6F4C91C9FC6F6D4A5B6F6D4A5B
+6F6D4A5B6F6D4A5B6F6E495B6F6E5D706D5B7092B55A706D4891CAFC706D485B72485B70
+6D485B706D485B7002BF5B7091B55A715D7192CBFC83715C715C715C715C715C725B8460
+95B57E4D804D804D804D804D804D814D01BF7F071F7F4D486C7F4C824C496C7F4C496C7F
+4C496C7F4C496C804C496D7F4C496D7F93B58295C76C7F4B496E7F4B49804B496E7F4B49
+6E7F4B496E804B49834B717F92B5486F7F4A91C96C7F4A49707F4C707F4A49707F4A4970
+804A49854A72804A49717F91B548717F4991CB6C7F4949727F4949727F4B874949728049
+86494972804949737F90B548737F4891CD6C7F4849884849747F487614804A7414C04849
+7414E048497414F048497513F8B5481DFC91CF7E498849886C480A0313F8767179F085>
+I<D87FFCF63FE0D9FF80F401FFB500E05213F06E1C0F6E646C6D5213E06C6D1EC06C6D52
+13806C9BB512006C6E505B6F505B6C6E626C6E646C6E505B6D525B6D6D505B6D6D505B6F
+97B5FC6D6E4E91C7FC6D6E626D6E4E5B6D515B6D6E4E5B704E5B6E6D606E6D4E5B6E6D62
+6E97B5C8FC6E6E4C5B6E6E4C5B714C5B6E6E5E6E6E4C5B6F6D606F4E5B6F6D4C5B7193B5
+C9FC6F6E5C6F6E4A5B6F6E5E6F4D5B6F6E4A5B706D4A5B724A5B706D5C706D91B55A706E
+92CAFC704B5B706E485B73485B706E485B706E5A716D485B715E716D485B7190B6CBFC63
+715D83715D715D725C725C63847291CCFC725B725BB3B3A6628462726C5A7C717CF085>
+I<137FA2EBFF801400A25AA2485AA312075BA2120FA3485AA2123FA25B127FA213FEB5FC
+AE6C5A11276CF239>96 D<92380FFFF00203B6FC023F15E049B712F8010716FE013F707E
+90B97E000384000F844884DC007F7F03C001077F02FCC700017F02E06E6C13806C90C97E
+01FC7013C001F07013E0498201807013F00002CAFCCB7E1AF884A21AFC197FACF03FFF4C
+B6FC167F030FB7FC157F0203B8FC141F027FED807F49B6EA8000010702F0C7FC011F91C8
+FC4913F84913C048B5C9FC4813FC4813F05C485B485B91CAFC485A5B127F5B12FF5BA519
+FFA27F606C6C5EA26D160F6D5E6C6D5D02E092B5FC6C6D140302FE021F137F6C9026FFE0
+03B5FC92B612FE6C17F86C17F06C17E06C17806DEDFE006D03F8EB3FF86D15E0010792C7
+EA0FE0010102F891C7FC9026003FFECAFC465B75D862>I<EA1FC0EA3FF0127F487EB3A6
+EE3FFC0303B512C0030F14F0033F14FC92B7FC020316C04A82021F16F84A824A8291B9FC
+01F9D9FC008101FB01E0010F8090B5C70001804A6E7E02F86F7F4A030F7F4A814A6F7F4A
+6F7F91CAFC49717E854919804983851BC0851BE0A285A21BF085A41BF885AD611BF0A461
+1BE0A3611BC0611B806D5FA26D4D1300616D4D5A606E4B5B6E4B5B6E5D6E4B5B6E037F5B
+6E92B55A6E02075C9026FBFF80133F01F9D9F003B6C7FC01F890B75A19F86E5E6E5E020F
+5E6E93C8FC6C486C15FC003F010015F0D81FC0013F14C0C8000F49C9FC030113E04D7570
+F267>I<93380FFFF84BB612C0030F15FC033F15FF92B812C0020317F04A17FC021F17FF
+4A18C04A18E049BAFC499138F8001F490280EB007F4949C8120F4901F8030313C003E015
+004949163F4949161F4948CAEA07804A94C7FC5A485B5C485BA2485B5CA24890CDFCA25A
+5BA3485AA5485AAD7F127FA47F123FA27F7EA2807E806C7FF201C06C6DEF03E06E17076C
+190F6E171F6C6D177F6D6C6CEEFFF06D6D5D6F15076D01F8151F6D01FE157F6D6D6C0107
+B512E06D02F8017F14C06D91B812806DF0FE00023F5F6E5F6E17E00203178002004CC7FC
+033F15F8030F15C003014AC8FCDB000F13C04C5B77D85C>I<F21FC0F27FF0A2F2FFF8B3
+A6EE7FF80307B57E033F14E092B612F8020315FE4A81021F16C04A8291B87E4983498349
+4AC66C7E4902E0010FB5FC4991C712034901F814004B814901C08190B5488192C97E4801
+FC8248845C4849825C484982A2485BA291CBFC5A5BA2127FA25BA312FF5BAE7F127FA47F
+123FA27F7EA26E5E7E6E5E6C7F616C6D5E806C6D5E6E5E6C6D5E6F92B5FC6D01E05C6D6D
+4A5A6D01FC140F6DD9FF80EB3FFC9339F803FFF86D91B65A01015F6D5F6E5E6E5E020F5D
+6E03F8EB7FF0020115E06E6C0280EB1FC0030F49C9FC030013E04D7577F267>I<EE3FFE
+0303B512F0031F14FC037FECFF804AB712E00207824A16FC023F824A8291B97E498449DA
+F007804991C7003F7F4901FC020F7F4901F002037F4901C0140049496F7E92C9123F4948
+707E4849824A701380485B4A7013C048845C48497013E0A24890CBFCF27FF0485AA34918
+3F127F1BF85BA312FF90BBFCA61BF0A21BC001F0CDFCA27FA3127FA27FA3123F7FA26C7E
+A26C7FA2806C7FA26C6DEF01C06C6DEF03E06E17076C6D170F6E173F6D6DEE7FF06D6DED
+01FF6D01F05D6D01FC151F6D01FF157F6D02C00103B512E06D02FC017F14C06D91B81280
+6EEFFE006E5F6E5F020717E0020117806E6C4BC7FC031F15F8030715C003004AC8FC040F
+13C04D5B78D85C>I<94B5FC040F14F8047F14FF4BB712801507151F5D92B8FC5C5C5CEF
+80034A01F8C7123F4A01C0EC060093CAFC4A5A5DA2147FAD001FB812C04817F05AB97EA5
+6C5FA2001F17C0C7D87FFCCAFCB3B3B3B26E5A141FEC0FE041757BF43F>I<DC3FFCEC1F
+C00303B56CEB7FF0031F14E0037F02F8EBFFF84AB612FE020781021F824A824A8291B87E
+010383494AC67F4902E0131F0480EB07FE4949C712014901F86EB5FC4901E08190B54881
+4B814891C9FC4849825C4849824A82485BA24A82485BA24890CBFCA35B127FA25BA312FF
+5BAA617FA2127F617FA26C7E61806C60806C6D5EA26C6D5E806C6D5E6E16FE6C6D6C1401
+6C6E4A5A03F014076D01FCEC1FF86DD9FF80137F6D9139F803FFF06D91B65A6D5F6D5F01
+005F6E5D6E5D020F5D020315E002001580031F49C7FC030013E093C9FCA51BF0A2611BE0
+A2614F13C0A24F1380D803805FD807F0057F130001FF4D5A02E0150302FF031F5B03FE49
+B55A92B85A6262624FC7FC6C60C66C17F0010F17C0D9007F93C8FC020315F8DA00071480
+4D7377D767>I<EA1FC0EA3FF0127F487EB3A693380FFF8093B512F8030714FF031F15C0
+037F15F092B77E0203824A824A824A17804A17C04AEB001FDAFFF0010114E003C0EB003F
+01F990C86C13F0D9FBFE814A81D9FFF86F13F84A815C4A811AFC5C91CAFC197F5BA35BA4
+5BB3B3B16C48EF3FF8123FD81FC0EF0FE0467370F267>I<EA1FF8EA3FFE127FB5FCAAEA
+7FFEA2EA1FF8C7FCAEEA07F0EA0FFC121FEA3FFEB3B3B3B3A8EA1FFC120FEA07F0107472
+F32E>I<EE07FE93381FFF80A24C13C0AA701380A2933807FE0093C8FCAE17FE933803FF
+80A24C13C0B3B3B3B3B24C13805E5E001C4B1300D83F8091B5FC01F801075B267FFFE0B5
+FC91B65A5FB8FC5F5F17806C93C7FC001F15FC000115F0D8001F14C0010049C8FC328D8F
+F334>I<EA1FC0EA3FF0127F487EB3A8F10FFEF13FFF96B512804E1400604E5B4E5B4E5B
+067F5B95B512C04D5C4D91C7FC4D5B4D5B053F5B4D5B94B512C04C5C4C91C8FC4C5B4C5B
+043F5B4C5B93B512C04B5C4B91C9FC4B5B4B5B033F5B4B5B92B512C04A5C4A91CAFC4A5B
+4A5B023F7F4A7F91B6FC01F98101FB8190B77E83A203E37F03C17F03817F03007F4A7F4A
+6D7F4A6D7F02E0814A6D7F4A7F91C76C7F496E7F4982496E7F4981717F717F717F85717F
+83717F717F85727F84727F727F86727F84727F727F86731380857313C07313E01BF0856C
+4883003F84D81F809438007FE04C7370F262>I<EA1FC0EA3FF0127FEAFFF8B3B3B3B3B3
+B3EA7FF0123FEA1FC00D7370F22E>I<93260FFFC0933803FFF093B500FC043F13FFD81F
+800103DAFF8092B612E0D83FE0010F03E0020315F8007F023F03F8020F15FE486C90B76C
+023F814A704A8202077049B87E4A7148834A7148834A7148834AD9000F4BEBC00303F801
+0002F049C7003F7FDAFFC0023FDA3FF0140F01F149020F6D484802037FD9F3FEC86CDAFF
+80804A6F92C9FCD9F7F86FD9FDFE707E4A6F4A82D9FFE0EFFFF84A70498222804A6091CA
+5C73844961A34996CAFCA44960B3B3B16C487148711300003F060F84D81FC0DD07F0EF01
+FC815870D7A2>I<93380FFF8093B512F8D81F80010714FFD83FE0011F15C0007F027F15
+F0486C90B77E0203824A824A824A17804A17C04AEB001FDAFFF0010114E003C0EB003F01
+F190C86C13F0D9F3FE814A81D9F7F86F13F84A81EBFFE04A811AFC5C91CAFC197F5BA35B
+A45BB3B3B16C48EF3FF8123FD81FC0EF0FE0465870D767>I<933807FF8093B512FC0307
+ECFF80031F15E0037F15F84AB712FE0207707E4A83023F17F04A8391B97E499126F8007F
+7F49028001077F4901FCC8804901F0033F7F4901C0030F7F49496F7F4990C96C7F02FC16
+004948717E4849717EA24849717E4A83481B804A83481BC091CB7E481BE04984A2003F1B
+F04984A2007F1BF8A349197FA200FF1BFCAD6D19FF007F1BF8A46D60003F1BF0A36C6C4E
+13E0A26E5F6C1BC06E5F6C1B806E5F6C1B006E5F6C6D4D5A6E17FF6C6D4C5B6D6C4C5B6D
+6D4B5B03E0151F6D6D4B5B6D01FE4AB55A6D6D6C01075C6D02F8017F91C7FC6D91B75A6D
+6C17F86E5F6E5F020717806E94C8FC020016FC033F15F003071580030002FCC9FC040713
+80565B78D867>I<EE3FFC0303B512C0D81FC0010F14F0D83FF0013F14FC007F91B7FC26
+FFF80316C04A82021F16F84A824A8291B9FC01F9D9FC008101FB01E0011F8090B5C70003
+804A140002F86F7F4A031F7F4A814A6F7F4A6F7F91C97E49707F854919804983851BC085
+1BE085A2851BF0A285A31BF8A285AC611BF0A361A21BE061A34F13C0A24F13806D5FA26D
+4D130096B5FC6D4C5B606E4B5B6E4B5B6E5D6E4B5B6E92B55A6E02035C6E020F5C9026FB
+FF80133F01F9D9F003B6C7FC01F890B75A19F86E5E6E5E020F5E6E93C8FC6E15FC020015
+F0033F14C0030F49C9FC030113E092CCFCB26C5A123FEA1FC04D6F70D767>I<DC3FFCEC
+1FC00303B56CEB7FF0031F14E0037F02F8EBFFF84AB612FE020781021F824A824A8291B8
+7E010383494AC67F4902E0131F0480EB07FE4949C712014901F86EB5FC4901E08190B548
+814B814891C9FC4849825C4849824A82485BA24A82485BA24890CBFCA35B127FA25BA312
+FF5BAC7FA2127FA37FA2123F7FA26C6D5EA26E5E7E806C6D5E616C7F6E5E6C6D5E806C6E
+5D6D6D92B5FC03F04A5A6D6D14076D01FE4A5A6DD9FFC0EB3FF86D9138F803FF6D91B65A
+6D5F6D5F6E5E6E5E020F5D020315F86E5DDA003F14C0030F49C7FC030013F093C9FCB2F2
+7FF0A2F21FC04D6F77D767>I<17FF040F1380D81F80143FD83FE049B5FC007F1407486C
+5B153F5D92B6FC5C5C4A15004A14804A01F8C7FC4A13C04A48C8FCECFFF85D01F113C05D
+01F390C9FC5CEBF7FC5CEBFFF05CA25C5CA291CAFCA25BA35BA45BB3B3AA6C5A123FEA1F
+C0315870D745>I<92387FFFE0020FB67E027F15F049B712FE0107EEFFC0011F17F04917
+FC498390B9FC5A5A489138C0003F4801FCC700015B02E0EC003F484915074A15014890CA
+12784994C7FC5BA2127F5BA67FA27F6C7E80806C7F14F86C13FF6C14F0EDFFC06C15FE6C
+EDFFF06C16FE6DEDFFC06D16F0010F16FC6D820101707E6D6C82021F82020382DA001F81
+030081040780EE003F05077F1701716C1380847213C084847213E0A384A660003819C012
+3C007F5F01C05E6D188001F85EB5047F130002E092B5FC02FC02075BDAFFE0137F92B75A
+6C60001F606C60000360C695C7FC011F5E010716F8010016C0020F4AC8FCDA003F13C043
+5B7AD84F>I<EC03F0EC07FC140F4A7EB3A4001FB912C04818F05ABA7EA56C60A2001F18
+C0C7D81FFECAFCB3B3B3A281A3191C6E6D143E19FE70EB03FF180F6E6D137FDCF807B512
+8093B7FC80A26E170019FC6E16F06F15C06F4AC7FC6F14F003071480030101F0C8FC4171
+7CEE4B>I<D81FC0EF0FE0D83FF0EF3FF8127F486CEF7FFCB3B3B3A319FFA360A260A260
+607F007F5F606D93B5FC4D137F6C6CED07FE02C0140F6C01F0EC7FFC02FF903807FFF86C
+91B612F06C17E018806C17006C16FC6C6C4BEB3FF86D15E0010F92C7EA0FE0010102F891
+C7FCD9001F1380465870D567>I<D87F8019FFD8FFE0060313806D607F627F626C6C1A00
+62003F627F1A7F6C6D601AFF6C6280616C6D60616C6280616C6D60616C6280616D6C95C7
+FC61013F6080197F6D6D5E19FF6D6081606D6D5E606D6081606D6D5E606D6081606E6C93
+C8FC60023F5E81187F6E6D5C18FF6E5E825F6E01E05C5F6E5E16F05F6E01F85C5F6E5E16
+FC5FDB7FFE91C9FC5F033F5C16FF177F6F495AA26F5CA36F5CA26F5CA36F5CA26F5C7090
+CAFCEE1FFC51577BD55C>I<D83FC0DD0FF018FE486CDD1FFCEF03FF6D4D6C5F486C057F
+4E13806D94B5FC007F551300876D5E003F555A876D5E6C555A876E4B5A6C555A747E6E15
+0F6C545B07FC7F806C051F013F4C5B876E16F86C053F011F4C5B87806CDD7FF04D5B1A0F
+876EDBFFE05F017F9CC7FC747F6E5C013F05C04D5A747F6E5C6D05804D5A747F6F5B6D05
+004D5A747F6F5B6D525B4E816F177F6D031F4E5B4E816F173F6D033F4E5B4E811B1F6D6D
+017F4E5B60757E6E6C01FF4E90C8FC607513806E6C634C49173F1DC0021F725D6F48197F
+4E16E06E725D048719FF95C8FC6E726D5BA2DCCFFE17F16EDF7FF95BA24D17FB04EF173F
+6E01FF95B55A5F886E645F886F98C9FC5F886F625F6F49705B6F90CA6C5BDB03FE943800
+7FE081577CD58A>I<D83FF0F007FED87FFCF01FFF6D606D606E94B5FC6C6D4C5B6C626C
+6D4C5B6C6D4C5B6C6D4C5B6C6D4C5B6C6D4C5B806D6D4B90C7FC6D4D5A6D6D4A5B6D6D4A
+5B6D6D4A5B6D6D5E6D6D4A5B6D6D5C027F4B5B6F4A90C8FC6E6D495A6E6D5C6E6D485B6E
+6D485B6E6D485B6E6D5A6E4A5BDB7FFE5C6F6C4890C9FCEFFFFE6F5C6F5C6F5C816F5C6F
+5C705B7090CAFC705A4C7E4C7F93B57E4B805D844B804B804BEB3FFE4B486C7E4B486C7F
+4B486C7F854A496C7F4A497E4A496C7F4A496D7E4A6F7E4A90C77F4A486E7F4B6E7F4A48
+6E7F49707F49498249498049496E7F49496F7E49717E92C96C7F4948844948707F484970
+7F48727F4849707F4849824849844A717E487313804890CB6C13C048487213E05B498449
+846C48060013C053567CD55C>I<D83F8019FFD8FFE0060313806D607F6D60A26C6C4E13
+00A26C6C60631A7F6C6D60A26C6D17FF636C6D5E637E6E4C5BA26C6D5E636C7F4F5B6D7E
+61013F96C7FC6E5E626D7F4F5A6D7F19FF6D60816D4C5B81606D6D5EA26D4C5B81027F4B
+5B81143F6F4A90C8FCA26E4B5A828070495A80617013FF8070485B80616E6D5A61ED7FFC
+5F61ED3FFE4D90C9FC151F16FF6F495AA26FEB9FFC17BF608117FF6F5CA26F5CA28260A2
+705BA27090CAFCA2825F161F5F163FA25F167F5F16FF4B5B5D030F5B0078023F5B26FFE0
+01B5FC90B7CBFC5E5E5E5E16C05E6C4ACCFC15F86C14E0000149CDFC516F7BD55C>I<00
+1FBE12E0007F1DF8A2BF12FCA56C1DF8A2001F1DE0660B80BA67>123
+D<D81FF0ED3FE0D87FF8ED7FF8486CEDFFFCA26D5CA74980A26C48ED7FF8D81FF0ED3FE0
+360F68F367>127 D E
+%EndDVIPSBitmapFont
+%DVIPSBitmapFont: Fi lcmssb8 23.89 56
+/Fi 56 128 df[<943801FFFE057FD9FFF84AB512F80403B7020714FE041F82047F4E80
+4BB8FC03074F15805D153F5D92B9FC5C5C5CA24AEDE01F4ADB80036F15004D487E4A706F
+5C4D147F083F020114F84A97CAFC1A1FA274CCFC1A0697CDFCA7000FBA00FC4AB512FC00
+3F734A8048734A8075491580BCFCA86C97C7FC6C616C61C76C02FCCAFCB3B3B3B3B0804D
+7115006E4A715C02074A715C>121 140 122 267 143 12 D[<953807FFC04E13E0183F
+604DB5FC4D14804D1400051F5B4D5B4D5B94B55A04035C4C5C4C5C4C91C7FC4C5B4C5B93
+B5FC4B5C4B5C4B5C5D4B5C604B91C8FC5D92B55A5C5F4A5C5C4A5CA24A5C5C5F5C5F91B6
+FC4992C9FCA2495CA25B5E5B5E5BA2495CA25B5E90B6FCA3485DA3485DA35AA293CAFC5A
+A35A5DA45AA25DA35AA65DA2B6FCB3A47EA281A67EA381A27EA4817EA37E82A27EA36C81
+A36C81A37F827FA26D80A27F827F827FA26D80A26D8180838083806E80A26E80806E8083
+806F7F816F80846F80816F806F806F8082707F707F708070807080040080717F717F717F
+05077F7114C07114E0717E84180F7213C0>67 194 105 279 106
+40 D[<EA3FFC487EB57E806C13F06C7F6C7F6C13FF6C806C806C806C14F86D7F6D7F6D7F
+6D806D80826D806D806D80826E7F806E80836E8083806E80836E80A26E8084818481846F
+80A26F80A28481848184A26F81A2858185A37080A37080A385A28285A38582A41A80A282
+A31AC0A682A21AE0B3A41AC0A25EA61A80A35EA21A00A45E61A3615EA261A34C5CA393B6
+5AA3615D61A24B92C7FCA2605D605D60A24B5CA24B5C605D6092B6FC95C8FC4A5CA24A5C
+5F4A5C5C5F4A5C5F4A91C9FC5C91B55A5E495C495C495C5E495C4991CAFC495B495B90B5
+5A4814E0485C485C4891CBFC4813FC485B485BB512C05C6C48CCFC6C5A>67
+194 113 279 106 I<001FBA12F84819FC4819FEBCFCA96C19FE6C19FC6C19F8480F7DBC
+5B>45 D<007FB512E0B612F0B3A77E6C14E01C1C689B4C>I[<95387FFFC0051FB6FC4CB7
+12F0040F16FE047FEEFFC04BB912F0030718FC031F18FF4B8592BB12E04A8602071AFC4A
+864A864A874ADBF0018291B7C7001F814903F802038105E01400490380033F804992C96C
+80494A70804C82494A7080494A70814C82494A7180A290B6487180A2488A93CB7EA2488A
+4B84488AA3488A4B84A2488AA5481F80A24B84A3481FC0A9B61DE0B3A96C1FC0A76F60A2
+6C1F80A56C1F00A36F606C66A46C666F60A26C66A26C6F4D5CA26C6F4D5CA26D6E94B65A
+A26D6E4C5D705E6D9AC7FC705E6D6E4C5C6D6E6C033F5C6D6F4B5C05F04AB6FC6D03FC02
+075D6D03FF021F5D6EDBF001B75A6E92B95A6E98C8FC6E626E6202011AF06E626F61031F
+96C9FC030718FC030118F06F6C17C0040F4CCAFC040116F0DC001F92CBFCDD007F13C0>
+115 146 118 269 136 48 D[<94381FFFFE0407B612F8047FEDFF800303B812F8031F17
+FF037F18C04ABA12F0020719FC021F19FF4A1AC091BC7E491BF849874987011F757E4988
+498890B7D8E00183484BC7000F824803F00201824803C06E7E4C031F81484AC900078148
+4A82484A701680484A706C15C0B65A4B7115E04B836C7415F092CB7E6C1EF86C49846C5B
+6C7415FC7E6C5B6C866D5A013F1DFE131F6D5A01078613036D5A90CEFCA599B6FCA21FFC
+A363A21FF8631FF0A25115E0A25115C0631F80635115006698B65A62505D505D505D505D
+505D5092C7FC97B65A4F5D4F15F04F5D4F5D4F5D077F4AC8FC96B65A4E15F04E5D4E1580
+061F92C9FC4E14FC4E5C4DB612E04D5D4D92CAFC4D5C053F14F84D5C94B612C04C5D0407
+4ACBFC4C5C4C14F04C5C4C14804BB6CCFC4B5C4B14F84B5C4B5C037F148092B6CDFC4A5C
+4A14F8020F5C4A5C4A14804A91CEFC91B512FC01035C495C4914C0495C4991CFFC90B512
+FC4891BD12F0481EF8481EFC001F1EFE5AAA7E1FFC6C1EF800031EF0>111
+142 117 269 136 50 D[<0507B5FC4CB612FC041FEDFFC04BB812F8030F17FF033F18C0
+4ABA12F0020719FC021F19FF027F1AC091BC7E01031BF8010F874987017F8790BE7E48DD
+000F82000704E0010082484BC8003F8104F0150F04C00303816C92C96C8115FC6C4A7081
+6C02E0836C4A866D5B4ACB7E6D48886D5A6D5A6D5A6D48846D5A90CD5AA59CC7FCA263A2
+98B65AA3505D626662505D505D62505D97B75A070393C8FC070F5D073F5D4EB75A0507B8
+5A041FB95A4C609AC9FC641CF81CE01C8051CAFC871CE01CF81CFEF4FFC0897018F893C8
+000F15FE07006F7E081F810807817415F808008175807580758175818B8775818B878BA2
+7581A28BA3761580AB200099B7FCA2120C001F66486C617F6D65D87FF8616D6501FF616E
+6402E060B500F84E5D6E4E5DDAFF805F03E094B75A03F84C93C7FC6C02FF04075D001F03
+F0031F5D6C03FF92B75A6C04FC010F5E000193BA5A6C656D64011F51C8FC0107636D1BF0
+010063023F1A80020F4FC9FC020319F8DA007F18E0030F95CAFC030117FCDB003F16C004
+0303FCCBFCDC000791CCFC>113 146 117 269 136 I[<49BD12F801078849888A5BAA66
+66664CCFFCB3AE953807FFF895B612C0050F15FC057FEDFF8093B912E01CFC1CFF891DE0
+891DFC89891EC08A9526FC007F81068001078105FCC700018105E06E7E05806F8094C96C
+8004FC70814C70815E4C70815E4C70816D91CAFC8B6D4983010101F88790CEFC8BA2888B
+A52080AC2000A299B7FC1338137C01FC65487E486C4F5DA2487F486D4E5D487F6E64486D
+4E5D486D6002FF64B66C4D5D6F5F03F04D92C7FC6C02FC4CB65A6C02FF4C5D6C03C0030F
+5D6C03F8033F5D000303FF4AB75A6C04F8013F5E6C93BA5A6D99C8FC6D63010F1BF86D63
+01011BC06D6C626E4FC9FC020F19F8020319E0DA007F1880031F05FCCAFC030317E0DB00
+7F93CBFC040715E0DC001F01F8CCFC>113 142 119 265 136 53
+D[<4FB57E077F14FC0607B712C0063F16F84DB9FC050F84173F94BAFC1603160F5E167F
+93BBFC15035D5D033FEE80014B03F0C7120F92B7008014014A03FCC9123F4A03F0040FC8
+FC4A03C093C9FC4A5D4A4ACEFC4A5C4A5C5F91B65A495D495D4992CFFC5E5B495C5E5B5E
+5B5E90B6FC5E5AA2485DA25AA293C912404895387FFFF00607B6FC48051F15E0067F15F8
+4B49B712FE0507707E484C83053F17F04D8394B97E484B844B48844C854C854C854C9026
+E0001F81B692C7000181DC7FFC6E6C80DCFFF06F804D6F8003FD018003078192B5C9FC4C
+70814C7081874C864C838B5E4C7180A25E8BA293CBFC7680A25D7EA22080A45DA27EA281
+A37EA47E2000A2817EA2525C7E826C66A26C6370627F7094B65A6D65705E6D65705E6D6E
+4C5D6D6E4C92C7FC704C5C6D03C04B5C6D6F4B5C6D03F84AB65A05FF020F5D6E03F090B7
+5A6E92B95A6E98C8FC6E626E620201626E1AE06F61031F96C9FC6F60030318F8030018E0
+043F178004074CCAFC040016F0051F92CBFCDD007F13C0>113 146
+117 269 136 I[<001FBF12FC488A488AC11280AB20006C666C666C66CF6C5C99B65A51
+5D5192C7FC515C091F5C515C6398B65A505D505D505D5092C8FC505C505C505C97B6FC4F
+5D654F5D4F5D614F92C9FC4F5C646196B65A4E5DA24E5D4E5DA24E5D4E92CAFC60636063
+95B65A5F635F635F4D5DA24D5DA24D92CBFCA24D5CA294B65AA25E625E62A25E625E62A2
+5E625EA297CCFC5EA261A293B6FCA2615DA261A25DA3615DA4615DA5615DA94B5DAF6F92
+CDFC6F5C6F5C>113 140 117 265 136 I[<95B512C0053F14FE0403B712C0041F16F804
+7F16FF4BB912C0030718F0031F84037F18FE92BBFC02031AC04A864A86023F864A8691BC
+7E49DCC001814903FCC7003F814903E00207814903800201814992C9FC4902FC043F8049
+4A708090B648824C85487480484B824C85488693CA8248868B485C8B4887A28B485CA276
+80A3B688A48BA388A38BA264A47EA2208064A26C8099B7FCA27E63A26C6E5F637E705E6C
+62826C6F5E6C6F5E973801FFDF6D02FC4B139F6D6E5D6D6E031F131F6D03C0EC7FFE6D03
+FCD903FF17006D92B712FC6D19F86D19F06E18E06E18C06E4E5A6E06005D6E5F020117F8
+6E5F033F04C05E030F93C7FC030315FCDB007F02F04A5C040791C8FCDC0001C9FC94CA5D
+A299B6FC67A2515DA267639CC7FCA2515CA2515C6366515C636698B65A505D62D901E04D
+92C8FC496C051F5CD907FC4D5C6E4D5C496C6C4BB65A4901E003075D03FC031F5D49D9FF
+8091B75A04FC011F93C9FC4991B95A6490BC12F064646D97CAFC011F19FC010761010119
+E06D1980023F4DCBFC020717F8020117C0DA003F4BCCFC030315E0DB000F01F8CDFC>
+113 146 117 269 136 57 D[<0707B612FC073FEDFF804F8296B87E4E83A24E83A24E83
+A34E83A24E83A24E84A34E84A295BA7EA24D85A34D85A24D851BEF4D851BC7A24D851B83
+4D861B014D86507EA294B684507F4C87507F4C87507F4C87A2507F4C87507F4C87507F4C
+8897C7FC884C884F8093B6864F814B894F81A24B894F814B894F814B894F81A24B894F81
+4B8A96C97E4B8A4E82A292B6884E834A8B4E834A8B4E834A8BA24E834A8B4E834A8B4E83
+4A8CA295CB7E4A92BE7EA291C27EA2498DA3498DA2498DA2498DA3498DA2498EA2498EA3
+90B648CE824C87488F4C87488F4C87488FA24C87488F4C87488F4C8748A11280A293CF7E
+48A112C04B88B622E04B89A24B894B896C4A7715C06C02800B031580>155
+138 118 265 176 65 D[<000FBCFC003F1BFF481CF8F5FF80BF12F81EFF1FC01FF81FFE
+797E20E020F88C20FF8D21E08D8D8D8D8D4BCA850900840A07831C000B1F820B0382F500
+7F1E1F78818A8A78818AA8545DA2545D66545D66545D545D53B75A5393C7FC0B0F5D0B7F
+15F852B75A0A0F16C00A7F5E090FB748C8FC080FB812F892BE12E020800DFCC9FC1FE09C
+CAFC1EF89BCBFC1EF0F6FF801FF81FFF20E020F820FF21C04BCA000F17F0E1003F16FC0A
+0116FFE2003F820B0716E00B0182776C810C1F15FE0C07810C0116807816C08B0D1F15E0
+7915F023F88B7915FCA28BA27915FEA767A25515FC67675515F81F7F9CB712F01E030C0F
+16E01E7F0B03B812C00B3F17800A03B9FC51BA120092C05A6A6A6A6A22809FC7FC21FC69
+21E021809EC8FC20FC20E020800DFCC9FC1FE06C9BCAFC1EF06C52CBFC000F51CCFC>
+143 136 108 263 179 I[<51B67E50B812C0083F17FF0703BA12F8073FF1FF804EBC12
+F8060FF3FF80067F1CF04DBE12F81707171F177F4CBFFC04071EF0161F5E93C0FC4B9538
+E0001F030705F8C87E4B0580030F15E04B04F8C91201037F04E0EE003F92B8CB120F4A04
+FC18034A04F0844A04C0726C13C04A4C854A4BCD7E4A4B1A074A4B8691B700E074138049
+4C86494C1B7F4993CF123F4D1C1F494BF40F00494B1C06494B99C7FC5F5B5F90B75A4893
+D2FCA2485DA2485D5E5A5EA25A5EA25A5EA25A5EA4B7FC93D3FCAE827EA4827EA2827EA2
+827EA2827E826C81A26C81A26C826D81837F836D816D6F1D386D6F1DFC711C016D701B03
+6D701B076D701B0F6E03F81B1F6E6FF37FFE6E6F1BFF6E6F6C616E7019076E04F0616E04
+FC193F6E04FF96B5FC6F04E01703031F04F8170F6FDCFF80167F6F05F80307B7FC0301DD
+FFE00103B8FC6F95BBFC163F8216071601706C1DFE051F1DF005071DC005011D00716C1B
+F8060F1BE0060198C7FCDE003F19FC070319C0DF003F4DC8FC080117C0E0000103C0C9FC
+>144 140 113 265 174 I[<000FBC12F8003FF3FFF848F4FFC01EF8C07E1FF01FFCF7FF
+8020E020F820FE7A7E21E08D21FC8D7B7E8E22F08E8E93CA000184E1000383E2001F830B
+0183E3003F820C0F820C03820C00820D3F810D0F8179821F0179827A818C7A817A818C7A
+81A17E8C7A81A27B1580A28DA113C08DA113E0A28DA113F0A28DA2A113F8A38DA3A113FC
+AEA113F8A369A3A113F069A2A113E0A269A113C069A2571580A29EB71200A2565D68A15A
+68565D565D68565D55B75A555E670D1F93C7FC0D7F5D54B75A0C075E0C3F5E53B85A0B0F
+5F52B95A51BAC8FC93BF5A6A22F06A6A9FC9FC6921F86921C09ECAFC20FC20F020C055CB
+FC1FF01F806C0BFCCCFC1EC06C0AF8CDFC000F09FCCEFC>158 136
+108 263 194 I[<000FC212C0003F8D488D8EC3FCAA6A6A6A93D3FCB3B3A593BE12C08D
+8D8DAA69696993D3FCB3B3A893BF12FC8E8E2380AB7E23006C69000F69>137
+136 108 263 169 I[<000FC112FE003F8C48218022C0C3FCAA228022006993D2FCB3B3
+A793BD12E08C8C8CAA68686893D2FCB3B3B3A27E5D6C5C000F5C>130
+136 108 263 162 I[<51B67E50B87E083F17FE0703BA12F0073F19FE4EBC12E0060F1B
+FC063FF3FF804DBE12F005071DFC051FF5FF80057F1EC04CC0FC1607161F5E93C112804B
+9538E0001F030705F8C87E4B058015074B04FCCA7E037F04E0171F92B8CB000715004A04
+FC18014A04F0727E4A4C191F4A0480854A4BCD7E4A4B08015B4A4B8691B700E01B7F494C
+1B3F494C1B1F4993CF6C5A4D1C07494B1C03494B1C01494B1C004D1D784921304D9AC7FC
+90B75A4893D3FCA2485DA2485D5E5AA25E5A5EA25A5EA25A5E0B07B912E05318F065B7FC
+93CCFCAB899AC81201A2827EA4827EA2827EA2827E82A27E826C81A26C81A26C826D8183
+7F836D816D816D81836D826D826D826E15F86E816E816E6F7E6E16E06E826E16FC6E16FF
+6F04E05F031F04FC171F6FDCFF804BB7FC6F05F8151F0301DDFFE0010FB8FC6F95BBFC16
+3F8216071601707E051F1EE005071E0005011DF8DD003F1CC0060F51C7FC06011BF0DE00
+3F97C8FC070319F0DF003F4DC9FC080194CAFCE000014ACBFC>148
+140 113 265 182 I[<000FB500F8090FB512FC003F6E5180486E51806F511580B7FCB3
+B3B193C0FCB093CE7EB3B3B3A57E4B7515006C4A755C000F4A755C>137
+136 108 263 178 I[<000FB912C0003F18E04818F019F8BAFCAA6C18F06C18E06C18C0
+D800014BC7FCB3B3B3B3B3AB001FB912C04818E04818F0BA12F8AB7E19F06C18E0000F18
+C0>61 136 123 263 72 I[<000FB512F8003F80488081B7FCB3B3B3B3B3B3A793BD12FE
+8C218021C0AA7E21806C2000000F67>122 136 108 263 154 76
+D[<000FB600E09CB7FC003F03F80C0316804803FE0C0F16C0705416E0B86C65A27165A2
+719AB8FCA27164A27164A27164A27164A37164A27263A27263A27298B9FCA203BF6E5081
+A2039F6E5014FEA2038F6E5014FCA203876E5014F8A203836E5014F0A203816F4F14E0A2
+03806F4F14C0A2706E96B61280A2706E4E1500A2706E4E5CA2706E4E5CA2706E4E5CA370
+6E4E5CA2706F4D5CA2706F4D5CA2716E94B65AA2716E4C92C7FCA2716E4C5CA2716E4C5C
+A2716E4C5CA2716E4C5CA2716F4B5CA2716F4B5CA2726E92B65AA2726E4A92C8FCA2726E
+4A5CA2726E4A5CA2726E4A5CA3726E4A5CA2726F495CA2726F495CA2736E90B65AA2736E
+4892C9FCA2736E485CA2736E485CA2736E485CA2736E485CA27303BF5CA27392B65AA274
+5FA27494CAFCA2745EA2745EA2745EA3745EA2745EA2745EA2755DA27592CBFCA2755C75
+5C090314F0090014C06C98CEFC92D56C14C06C497C1480000F497C1400>179
+136 106 263 224 I[<51B512F050B712F0083FEEFF800703B912F8073FF0FF804EBB12
+F0060F1AFE063F747E4DBD12F005071CFC051F1CFF057F1DC04CBF12F004071EFC4C8A04
+3F787E4C942680003F834BB800E0C817F04B4CC9000F82030F04E0040016FE4B0480053F
+814B03FCCB0007824B03F006018292B700C0726C814A93CD001F8102074B7415FC4A03F8
+0803814A4B74814A4B748206801B3F4A92CF6C8191B6487681494B7681494B7681494B76
+814D8849A17E494B77804D894992D16C8149A17F4C8A90B68F4C8A48A1804C8A48A1804C
+8A48A1804C8A48A180A24C8B48A180A3484B791580A448A115C0A293D37EA3B7A112E0AD
+7067A26CA115C0A47067A26CA11580A2709CB7FC6CA11500A270666CA15CA270666CA15C
+A26C6F545DA26C6F545DA26C6F545D71656DA15B71656D6F9AB75A6DA190C7FC71646D6F
+525D6D6F525D6D6F525D71646D70515D6D70515D6E6F98B75A6E6F505E6E6F5093C8FC6E
+03FE080F5D6E6F505D6E04C0077F5D6E7096B75A6E04F806035E6F03FE060F5E031FDBFF
+C0057F93C9FC6F04F04CB75A6F04FE040F5E0301DCFFE092B812F06FDDFF80013F5F043F
+94BB1280709CCAFC04071EFC04011EF0706C1DC0051F9ACBFC05071CFC05011CF0716C1B
+C0060F50CCFC06011AF0DE003F1980070306F8CDFCDF003F1780080104F0CEFCE0000102
+F0CFFC>179 144 113 267 210 79 D[<000FBC12C0003FF3FF80481CF8F5FF80BF12F0
+1EFE787E1FF01FFC1FFF8C20E08C20FC8C8C21C08D8D8D8D93CA000183E1000382F4007F
+0B0F16800B0316C01D000C3F15E07815F08A7815F8A27815FCA28A22FE8AA37914FFAB9C
+B612FEA35415FCA26622F8665415F0A20C3F15E05415C09BB7FC0B0316800B0F16000B7F
+5D0A07B75A51B85A93BE5A69696956C7FC6820F068208055C8FC1FF81FC09CC9FC1EF81E
+C00BFCCAFC1D800AC0CBFC93D2FCB3B3AA7E5D6C5C000F5C>136
+136 108 263 172 I[<000FBC12E0003FF3FFE0481CFF1EF0C0FC1FE01FFC1FFF20E020
+F820FE7A7E8D21F08D21FE8D8E22E08E8E93CB000783E2000F821D000C1F810C03827882
+787E79818B7981A27981A28BA27981A8676BA2676B67555D555D679CB75A5493C7FC0C07
+5D0C3F5D53B75A0B1F5E0A0FB812C093BF5A57C8FC6921F021C09EC9FC20FC20E020800D
+FCCAFC1FC054CBFC1EC08A8A93C900078186748174818A758187758175818B7581877581
+8B758176818876818C768176818876818C768177818977818D77817781898D7781778178
+818A8E7881788178818A8E7881788179818B8F798179817981A27981798179817A1580A2
+6C8B4B886C4A761500000F4A0A035C>145 136 108 263 178 82
+D[<0603B512F84DB712F8053FEEFFC04CB912FC040FF0FFC0047F19F84BBCFC03071BC0
+031F1BF8037F1BFE92BE12C00203895C141F5C5C91BF5A5B5B494CC7FC49048014034903
+F8C9123F4903C0040F5D4992CA120104FC717E90B600F0181F484B84048018034892CC6C
+91C7FC4B737E48894B868A484A745A1E031E01481D001F7E1F3C6F1B189CC8FC81818282
+8216F816FE6CEDFFC017FCEFFFC018FE6CEFFFF8F1FFC01AFF6C1AF8F3FFC06C1BFC6CF3
+FF801DF06D1BFC1DFF6D1CC06D1CF06D1CFC6D1CFF6D896D896D1DF06E88021F886E886E
+880201896E6C88031F880307880301886F7E040F87040187EE003F050186EF000FDE003F
+19801901DF000718C0F2003F1B01E1003F16E01C071C01767E0B1F15F0891D0389A2898A
+1203487E486C887F7F01FC1FE07F487E6E6302E01EC08002FC98B6FC486D5015806E7E03
+E04F15006F190F03FC4F5CDBFF80604803E095B65A04FC05035DDCFF80160F05F0047F5D
+DDFF800207B75A06FE49B85AC15A9DC7FC6767676C66000F6600031E80C69BC8FC013F1C
+FC01076401011CE0D9003F1B80020750C9FC02001AF8030F19C003004ECAFC040717F0DC
+001F93CBFCDD001F1480>124 144 116 267 152 I[<000FC5B512E0003FA114F048A114
+F8A115FCC5B6FCAA6CA114F86CA114F06CA114E0CD00014BCEFCB3B3B3B3B3B3A6866675
+5C091F5C>174 135 118 262 195 I[<000FB500F80903B512F8003F6E5114FC486E5114
+FE6F5114FFB7FCB3B3B3B3B3A270626C21FEA370626C21FC9CB6FC826C5315F8826C6F61
+5415F06C6F61704F15E06C6F4F15C071606C04E04DB712806C704D160005FC170F6DDBFF
+80043F5D6D04E04BB75A6D04FC031F5E6DDCFFF00107B85A6D94BB5A6D676D676D9CC7FC
+6E65021F656E1DF06E650201656E9AC8FC033F1BFC030F6303031BE003001B80043F4FC9
+FC040719F004001980051F05FCCAFC050117C0DD000F03FCCBFCDE003F49CCFC>136
+140 108 263 177 I[<003FB500F80D3FB512804802FE54B612C0B76C5315E070657065
+A26C6F5315C0A26C6F531580A26C571500826C9EB65A82696C6F68696C7067A26C70515D
+A26C565D836D555D83696D6F67696D6F9CC7FCA26D6F98B65AA26D6F505DA26D545D846D
+545D84686D7065686E6F65A26E6F4F5DA26E6F4F92C8FCA26E9AB65A846E525D84676E70
+63676E7063A26E704D5DA26F6F4D5DA26F515D856F5192C9FC859CB7FC6F6F62666F6F62
+A26F704B5DA26F704B5DA26F505D8666706F6166706F6166706F96CAFCA2706F92B65AA2
+704E5D86704E5D876570705F6570705FA2716F495DA2716F495DA2714D92CBFC877194B6
+5A87647103FF5E647104835DA27104C75DA27104EF5DA27292B75AA27261A37296CCFCA2
+7260A27260A27260A27260A27260A3735FA2735FA27394CDFC735E735E735E070016E0>
+163 137 122 263 176 I[<0003B7091FB612C04804C0087F814804F04FB7FC718A555E
+6C70616C704F5E6C704F5E6C714E93C7FC6D704E5D6D829CB75A6D704D5E6D704D5E6D70
+4D5E6D704D5E6D704D5E6D714C93C8FC6E70626E636E7093B75A6E704B5E6E704B5E6E70
+4B5E6E704B5E6E70626F4F93C9FC6F704A5D6F704A5D6F7091B7FC6F70495E6F70495E74
+495E6F70606F4E5E706F4993CAFC7070485D7070485D7070B75A7016F17004F95E7004FB
+5E7093B85A71627197CBFC7161716171618371617161726072607295CCFC66725F725F72
+5F84725F735E735E7393CDFC735D89614F824F8296B87E4E834E834E834E838A4E844E84
+4E8495BA7E4D854D854D854D858C4D864D15FB4D03F18294B700E0824C4C6C814C71814C
+0480824C4C6C81506D824C4B6D824C4B6D824C718293B748844B4C6D824B4C6E814B4C6E
+814B93C86C824B73824F864B4B6F824B4B8192B7486F824A4C6F824A75814A4C864A4C70
+824A93CA6C824E71824A4B71824A758291B74888494C7182494C7182494C7282494C7282
+4977824993CC834D7382494B738290B74885487882484C7382484C1F80484C7416C0484C
+7416E04893CE6C16F07A16F8484B7516FCB75A4C7516FE4C7516FC6C4B876C03800A3F15
+F8>159 136 120 263 176 88 D[<003FB600C053B612E04803F80B0715F0B700FE0B1F
+15F8701D7F05C099B7FC6C705116F0696C705116E06C705116C06C705116806C7020006C
+70515D6C71505D6C7197B7FC565E6D704F5E6D704F5E6D70666D704F5E6D704F93C7FC6D
+70616D714E5D9DB75A6D714D5E6E704D5E6E70646E704D5E6E704D5E6E705F6E704D93C8
+FC555D6E7193B75A6E71626F704B5E6F704B5E6F705D6F704B5E744B5E6F5093C9FC6F70
+4B5D6F71606F7191B75A7070495E70705B7070495E75495E704E5E707095CAFC7070495D
+7071485D7071B7FC7104E15E7104F35E0AF75E7193B85A71637198CBFC83716271627261
+68726172617261847296CCFC7260726067735F735F85735F735F7394CDFC735E66735E74
+5D86745DB3B3AE6686A2745D08014ACEFC>165 136 123 263 176
+I<050FB57E0407B612FE93B812E0030F17FC92BAFC020719C0021F19F091BB12FC01031A
+FF010F87491BE0498789899426FE000781058001008104FCC8003F158004E06F15C093C9
+7E03FC7015E04B7015F06D01E08203807015F892CBFC4A7214FC14F84A7214FE5C5C4A1B
+FF6DCC7E90CDFCAC081FB7FC4EB9FC95BAFC171F0403BBFC161F4BBCFC150F157F4AB8EA
+FC1F0207EEFC00021F1680027F03F8C7FC49B712C001074BC8FC4915F84915E049158090
+B648C9FC485D4815F05E485D485D4892CAFC5D5A5D5A5DA2B6FC5DA663A281637E6F94B7
+FC626C806F5E1A0F6C6F5D04E05D6C6F92B8FC04FC14036C03FF141F6CDCF003B512DF94
+B7129F6C1A1F6C19FE6D18FC6D18F86D18E06D18C06D180001015F6D17F8023F04E06D14
+FE020F93C76C14FC020103F86E14F8DA003F02C091C9FC030301F0CCFC687078ED80>97
+D<063FB5FC0507B612FE057FEDFFE00403B812FC040FEFFF80047F18F04BBA12FC4B19FF
+030F1AC0033F1AF84B1AFC4ABCFC5C5C5C023F1BF84A9238FC000791B700C0EB003F494B
+C812034903F8150005E0163F494B040F13F0494B16034992CA7E494AEF007F4C183F494A
+181F90B648F007E04C180348F401C04C95C7FC5A5E5A93CEFC5AA2485CA35A5DA35AA35D
+A2B6FCAF7E81A47EA281A27E817EA2827E1E1C6C6F197E1EFE6C6F18017018036C1C076D
+6E180F70183F6D6E187F6D6EEF01FF6D6F040713FF715E6D03F0167F6D6F4BB6FC6D03FE
+150F6DDBFFC091B7FC6E03FC133F6E92BAFC808002031BFC6E1BF86E1BE0033F1A80030F
+F1FE006F19F8030119E06F6C1880041F05FCC7FC040317E0DC007F93C8FC050715E0DD00
+3F01F8C9FC687077ED79>99 D[<0A0FB512E05214F05214F85214FCB3A8943807FFE094
+B6FC040715E0043F15F893B712FE0303EEFF80030F17E0033F17F84B17FC4AB912FE4A18
+FF4A96B6FC141F5C5C91B8EA001F4904E013014993C87E05FC151F4903F015074903C081
+494B15004992CA7E5E495C90B65A5E485DA2485DA2485DA24892CBFCA3485CA25A5DA35A
+A45DA2B6FCB07EA281A37EA46C80A37E817E827EA26C81827E7094B6FC6D6E5E705E6D6E
+5E6D6E5E6D6F5D05E05D6D6F92B7FC6D03FC14036DDBFF80131F6D04F890B8FC6E92BAFC
+806E856E18FE6E18FC020118F06E18E0033F17C06F170003075E030104F86D14F86F6C03
+E06D14F0040F03806D14E0040102FCCBFCDC000F1380>110 140
+119 265 135 I<95383FFFE00507B67E057F15F80403B8FC041F17E0047F17F84BB912FE
+0307727E031F854B19F092BB7E4A864A86020F864A874ADBFC00824A03C0011F8191B7C7
+0007814903FC1401494B6E6C804903E06F80494B814D6F804992C96C80495C494A701580
+4C8290B6FC4C7015C0485D5A4C7114E0485DA2488793CB15F0A2485CA288484A1BF8A392
+BDFC5AA5C0FCA21FF01FE01FC003F0CFFCA96C80A56C80A46C80A2817E827E826CF50380
+70F107C06C1D0F70191F6C6F197F6D6E19FF656D6E606D6E180F6D6F5F71057F13E06D03
+F094B5FC6D6F16036D03FE161F6D6F167F6E03C00203B6FC6E03F8143F6E9226FF8007B7
+FC6E93B9FC02031C806E1C006E1BFC033F626F1AE003071A8003014FC7FC6F6C18F8041F
+18E0040795C8FC040017F8050F16C0050003F8C9FC060349CAFC6D7079ED7C>I[<0607B5
+12E00503B712C0053F16FC4CB812FE160F163F93B9FC1503150F5D157F92BAFC5C5C5C4A
+EE800706F0C7FC4A0380141F95C812074A02FC15031B014A18001C7E1C3C1C00A9000FBA
+12F0003F85488586BBFCA86C616C616C61C76C02FCCAFCB3B3B3B3B0805F6E5C02075C>
+87 140 122 267 83 I<942601FFF8020FB512E0053F01FF4A14F04CB600E04914F8040F
+03F84914FC047F15FE4BB8FC030717C04B17E0033F17F092B912F84A18FC4A18FE020F18
+FF5C4A96B6FC4AEE803F91B738F800074904C013014993C87E494B814903F8814D81494B
+81490380814992C97EA290B648825E484B835A5E485DA25E5A5E5A93CBFCA25A5DA25A5D
+A5B6FC5DA899B6FCA4817EA263A2817EA26F5F7E82636C81A26C6F5EA26C6F5E6C81705E
+6C81705E6D6F92B7FC6D6F5C6D03F04A7F6D6F5C6D03FEEC0FFE6DDBFFC0133F6D9339FC
+01FFFC6D93B6FC6E18F86E18F0806E18E0020318C06E18806E6C1700031F5E03075E0301
+16F06F6C5D040F158004004AC7FC050713E094CAFCA51FF8A31FF099B6FCA2010E1DE001
+1F61D93FC04E15C014F002FC4E158002FF4E150003E05F03FC4D5CDBFF8093B65A04F003
+035DDCFF80020F5D05FF91B75A95B95A669BC7FC65651DF06D636D1B80010350C8FCD900
+7F19F8020719E0DA007F95C9FC030317F8DB001F1680DC000F02E0CAFC6E8E77EC87>I[<
+000FB512C0003F80488081B6FCB3A796381FFFF04EB612C0060F15F8067F15FF4DB812C0
+050783051F17F84D8394B97E4C844C19804C19C04C19E05E4C19F04CEBF00193B5C7001F
+15F803F901F8140703FB01E06E15FC05808092B5C915FE04FC825E4C825E4C19FFA24C82
+93CAFCA25DA35DA45DB3B3B3AE7E4B7114FE6C4A7114FC000F4A7114F8>104
+138 113 265 135 I[<000FB512F8003F14FC4814FE15FFB7FCA86C14FE6C14FC6C14F8
+C9FCB10003B512F0000F14F84814FC15FE5AB3B3B3B3B3A97E15FC6C14F8000314F0>32
+139 115 266 60 I[<380FFFFC003F7F487F81B6FCB3A90807B61280083F15C0624FB7FC
+61614F16804FEDFE004F5D96B75A4E5E4E5E4E5E4E5E4E4BC7FC4E5D95B75A4D5E4D5E4D
+5E4D93C8FC4D5D4D5D94B75A4C5E4C5E4C5E4C93C9FC4C5D047F5D93B75A03815E03835E
+03875E038F93CAFC039F5D92B75A616161198096CBFCA28585A285858585A2858586A286
+868604FB8116F104C0814C814C6C804B7F4B6D814B6D814B8303C06D814B7F92C76C8187
+718184728072818872818472818872818473807380897381857381897381857381748089
+741580867415C01EE07415F0867415F87415FCA26C864A846C4984000F49060714F8>
+102 138 111 265 127 107 D[<000FB512C0003F14E04814F015F8B6FCB3B3B3B3B3B3
+B3A47E15F06C14E0000F14C0>29 138 113 265 60 I<96260FFFF896B57E4EB600E005
+1F14FE000FB56C020F03FC94B712C0003F6E027F03FF040716F0486E49B800C0031F16FC
+6F010705F0037F16FFB6021F05FC4AB912C04D714A8494BA020F844C7349844C7349844C
+7349844C7390BBFC4C624C73481A804CD9F0004DEC000F93B5C7000F6F4801F0010016C0
+03F101F802034C0180143F03F301E06E6F4848C86C15E005806E05F88103F790C96C6E48
+486F15F0DBFFFE704B488104F81B804C7093C97E4C62A116F84C624C704B8293CA5EA24B
+63A34B63A44B63B3B3B3AE6C74874B98CB15F06C4A714A7214E0000F4A05004A060F14C0
+B56D71ECD4>I<96381FFFF04EB612C0000FB56C020F15F8003F6E027F15FF486E49B812
+C06F010783B6021F17F84D8394B97E4C844C19804C19C04C19E05E4C19F04CEBF00193B5
+C7001F15F803F101F8140703F301E06E15FC05808003F790C915FEDBFFFC825E4C825E4C
+19FFA24C8293CAFCA25DA35DA45DB3B3B3AE7E4B7114FE6C4A7114FC000F4A7114F8686D
+71EC87>I<95380FFFF84DB612C0051F15FC94B87E040717F0041F17FC93BA7E4B850307
+19F0031F19FC4B8592BC7E4A8702071BF04A874A9226FC001F814A03C00101814A4AC800
+3F8091B600F8030F814903E00303814903800300814992CA6C80494A71804C83494A7180
+494A7180494A71804C8390B6884C83488B4892CC6C80A2488B4B85A2488B4B85488BA348
+8BA24B85A2488BA5B61E80AE6C2000A36F61A26C67A46C6E4F5CA36C676F616C677095B6
+FC6C67705F6C67705F6C676D6E4D92C7FC705F6D6E4D5C6D6E4D5C6D6E4D5C05C04BB6FC
+6D6F4B5D6D03F8030F5D6D03FE033F5D6DDBFFC049B75A6E03FC011F93C8FC6E92B95A02
+0F1BF86E636E636E636E6C97C9FC6F61030F19F8030319E003001980043F4DCAFC040F17
+F8040117C0DC003F4BCBFC050315E0DD000F01F8CCFC797079ED88>I<953801FFFC063F
+EBFFC0000FB500C049B612F8003F6E010F15FE486E017F6F7E6F48B812E0B6010717F84C
+83043F17FF4C8403F9BA7E03FB8592BB7E898989DDFC00820580011F8204FCC700038204
+F002008204C08193C9001F814B70814B824B70818674818A87751580A2877515C0A27515
+E0A37515F0A3871FF8A287A41FFC88AE99B6FC1FF8A5631FF0A2631FE0A2631FC0631F80
+63A2511500636698B65A62505DA26F4C5D6F041F5D6F4C5D705D04E04AB75A704A93C7FC
+04FC020F5D04FF027F5DDDF007B75A94B95A656503FB6103F94EC8FC03F8607017F0705F
+70178004074CC9FC040116F87016C0051F92CAFC050714F09426007FFECBFC95CDFCB3A4
+7E5D6C5C000F5C6E8971EC87>I<F10FF8F1FFFC000FB56C1407003F6E141F486E147F6F
+49B5FCB614075F173F5F94B6FC5E5E5E5E5E5EA25E93B7FCA215F103F316F8F1F00003F7
+02FCC7FC18E092B6C8FC17F817E05F94C9FC5E16F85E5E5EA25E93CAFCA25DA25DA35DB3
+B3B3A67E5D6C5C000F5C466D71EC5A>114 D<041FB57E0307B7FC033F16F84AB97E020F
+18F0023F18FE91BB7E491AF00107865B5B5B5B90BC5A5A9338F000074892C8123F4802F8
+15074B15004802C0043F5B4B160F48190392CA7EF2007F4849183FF30FC01B07755A4897
+C8FCA280A28181818115FCEDFF8016F06CEDFFC017FEEFFFF8F0FFC06C18FCF1FF806C19
+E01AF86C19FE747E6C866C1AF06C866D856D856D856D866D866D866D866D6C85141F0207
+8514016E6C84150F030184ED001FDC007F17801701EF000F1800071F15C0190719018586
+000685D80F8084121F6D847F7F7F486C1B807F7F6E5F02E01A006E5F4813FC02FF4D5B03
+C093B5FC03F003035C03FE150FDBFFC0023F5CB700FE0107B6FC93B95A6464646C98C7FC
+001F62000762000162D8003F61010F19C0010396C8FCD9007F17FC020F17F00200178003
+0703F8C9FCDB000F49CAFC5A7078ED69>I[<0203B512E0020F804A80835CB3A8000FBB12
+FC003F8648861C80BDFCA86C1B006C626C62C7003F02FCCAFCB3B3B3AC83A2F301C0F307
+E06E6E150F1B1F1B3F72ECFFF01A036E6F130F72133FDEF807B512F86E92B7FCA2801CF0
+6E19E01C806EF0FE00636F17F06F17806F4CC7FC6F16F8030316C06F03FCC8FCDB003F14
+C0040701E0C9FC>85 139 123 264 98 I<000FB500C00503B512F8003F6E4D14FC486E
+4D14FE6F4D14FFB6FCB3B3B3AD63A463A398B7FCA262A2627E62626F5E6C6162F2FFDF6C
+6E5D0707139F6C6E6C021F131F04E0147F6C03FE903807FFFE93B712FC6C19F86C19F06C
+19E06D18C06D18806DEFFE006D5F010317F001004D6D14FE023F04806D14FC020703FCC7
+6C14F8020003F091C9FC030349CCFC686D71EA87>I<263FFFF04FB512804801FC070714
+C0B64F14E06F60648164A26C6E1BC099B6FC816C501580A2816C501500A26C6E6263A26C
+6E6263A26C6E6263A26C6F6163A26C6F6163826D96B65AA2826D4E5DA26D6E96C7FC62A2
+6D6E6062A26D6E6062A26D6E6062A26D6F5F62836D4E5CA2836E94B65AA26E6E5F61A26E
+6E94C8FC61A26E6E5E61A26E6E5E61A26E6E5E6118806E4C5CA218C06E4C5CA218E06F92
+B65AA26F6E5D18F1A26F02F992C9FC18FBA26F91B65AA36F5FA36F5FA36F5FA36F5FA270
+5EA3705EA27093CAFC705D705D040115F06B6C7AEA78>I<261FFFF8952607FFE095380F
+FFFC4801FE061F01F8063F7F486D4E6D4E7FB66C4D6D95B612806F8598B65F6CA114006F
+8650626CA15B6F865062A26C6E7461626B6CA15B6F8650626CA15B6F865062A26C6E7461
+626B6CA15B70855097B6FC6CA15B708597B85DA26D6E716E95C7FC4F13FE6A6D6B707180
+4F01FC606D6B70864F6E5F1BF86D6E745F61516C5F6D6B70864F6E5F6D07E06370864F62
+517E6D6F735F617694B6FC6D078063718596B56D5E6E95C797C8FC711A804E62896E02F0
+4A05C05D60775D6E4D6305F81AE04E626E746005FC4A17F04E62896E02FE4A05F85D6077
+5D6E4D6305FF1AFC4E626E746006BF4917FE95B596B6FC896E4D94B75AA36F93C995C9FC
+A36F745E61A28A6F4B63A36F4B705EA36F745E61A26F745E616F745E4F826F6C4A7093CA
+FC041F49CB003F14FCA96C7BEAB4>I<000FB500E0067FB5FC4802F895B612C0486E1703
+816F5F636C6F4C15806C6F4C15006C6F616C6F4C5C6C6F93B6FC6C4F5D70616D6E4B5D6D
+6E4B5D6D6F4A5D6D6F5C6D99C7FC6D6F4A5C6D6F4A5C7191B65A6D6F495D6E626E6E5B6E
+6E495D6E6F485D6E03C093C8FC6E6F485C4F5C6E6F5A6E6FB65A6F6E5D6F91B75A6F606F
+606F95C9FCA26F5F6F5F6F5F705E705E705E82637093CAFC705D705D705D83715C715C4D
+805F94B67E4C81864C814C824C825E4C82874C8293B87E4B834B834B02FD814B14FC4E6C
+804B02F0814B4A6C804B6F8092B6486C804A03808173804A4B7E4A4A6D814A4A834A7081
+4A4A6E804D6E804A8691B6486E80494B80494B6E8049884992C86C814C6F81497281494A
+85494A8290B64870804874804C85484B701580487415C0484B1AE04892CA6C15F0484A83
+487415F84B1BFCB6487214FE884B7214FC6C4A846C0280060314F86F6B7CEA78>I<263F
+FFF84FB512804801FF070714C0B66C4E14E06F606F60646C80A26C6E95B612C0A26C6E1B
+8063816C1E006F5F7E515C6C81A26C6F4C5CA26C6F61636D8066705E7F666D6E5EA26D6E
+93B65AA26D6E61626D819BC7FC715C7F656D6F5CA26E6E5F626E6E5F626E80656E5F8365
+6E6E5CA26E6F5E97B6FC6E6F5EA26E5E06E093C8FC81725A646F14F8616F6018FC6F4B5C
+18FE814F5C6F14FFA26F4B5C19BFA26F92B65AA282648299C9FC82A2705EA3705EA28263
+826382A2715DA28363A283638398CAFC83A2715CA283625FA2625F62001C5E123FD87FC0
+4B5C01F8157FD9FFC0010FB65A91B9FC6297CBFCA26C60616161616196CCFC6018F818E0
+188005FCCDFC6C16E06C4BCEFCD8003F91CFFC6B897AEA78>I<001FC212F04821F84821
+FCC312FEA96C21FC6C21F86C21F0870F80C988>123 D[<001FB500E092B6FC4802F80203
+1580486E4A15C0B619E0A26F5CA34B806C1BC06C4A6E15806C02E002001500>83
+12 102 266 136 127 D E
+%EndDVIPSBitmapFont
+%DVIPSBitmapFont: Fj lcmssb8 28.66 23
+/Fj 23 122 df[<9BB612FC52B9FC0A3F18FE0907BB12F8097FF2FF800807BD12FC083F
+F4FF804FBF12F8070FF6FF80193F4EC112C01807181F187F4DC2FC05072180171F5F94C3
+FC5E04079638F000034C06F8C800071700043F0680ED007F4C05F8CA120F93B900C01701
+030395CC7E4B05FC191F4B05E007075C4B0580854B94CEFC4B04FC1B3F92B800F0874A4D
+755B4A05801B034A94CF7E4A4C884A04F81D7F4A4C1D3F4A4C775A91B8481D0F4F1D0749
+94D11203494C785A494CF600404E9CC7FC495E495E605B495E95D5FC90B8FC5F485EA248
+5EA2485EA2485EA3485EA25F5AA294D6FCA25AA25EA4B7FCA25EAD82A27EA482A27EA283
+A27E83A26C82A36C82A26C82A26C82A26C82837F846D827F846D826D82846D70F701E06D
+701F076D71F60FF0731E1F6E701E3F6E701E7F6E701EFF6E04FE1D036E705313F86E7164
+6E05E01C3F6E71646F04FC51B5FC6F04FF636F711A0F6F05E0626F05FC1A7F6F05FF4FB6
+FC030006C0180F7005F8183F70DDFF800403B712FC040F06F8163F70DEFFF0023FB8FC04
+0196BCFC82173F831707050121F8717E061F20C00607200006011FF8DE003F1EE0070F9B
+C7FC07011DFCDF003F1CE0080799C8FCE0007F1AF809071A80E1003F06F8C9FC0A014DCA
+FC99C703FCCBFC>174 167 110 292 209 67 D[<0007C412FC001F23FF48A1128048A1
+12C0A2C5B412E0AAA113C0A2A11380A11300A112FC04FCD4FCB3B3B093C07E23E08F8FA2
+8FA96BA26B6B238004FCD4FCB3B3B3AD6C5DA26C5D6C5D00071580>155
+163 104 290 194 70 D[<0007B66C0B0FB6FC001F03E00B3F15C0486F5315E0486F9AB7
+12F0A2B76C5216F8B3B3B3AA93C3FCB304FCCF1201B3B3B3B06C4B7616F0A26C4B7715E0
+6C4B7715C0000703800B0F1500>165 163 104 290 214 72 D[<0007B76C0F03B712E0
+001F04F00F1F16F848705716FC4804FE9EB812FE7168B9A114FF72677267A27267A27267
+A27267A27267A2729CBAFCA27266A37365A27365A27365A27365A27365A203FD6F535CA2
+03FC6F9AB65AA2706E525DA2706F515DA2706F515DA2706F515DA2706F515DA2706F515D
+A2706F515CA2706F98B65AA2716E505DA2716F4F5DA2716F4F5DA2716F4F5DA3716F4F5D
+A2716F4F92C7FCA2716F4F5CA2716F96B65AA2726E4E5DA2726F4D5DA2726F4D5DA2726F
+4D5DA2726F4D5DA2726F4D92C8FCA2726F4D5CA2726F94B65AA2736E4C5DA2736F4B5DA2
+736F4B5DA2736F4B5DA2736F4B5DA2736F4B92C9FCA2736F4B5CA3736F92B65AA2746E4A
+5DA2746F495DA2746F495DA2746F495DA2746F495DA2746F4992CAFCA2746F495CA2746F
+90B65AA2756E485DA27503835DA27503C75DA27503EF5DA27592B75AA27596CBFCA27560
+A27560A2765FA2765FA3765FA2765FA2765FA27694CCFCA2765EA2765EA2775D775DA277
+5D0B0715807792CDFCE3007F13F86C4A97D06C14FEA26C4AA16D14FC6C4AA16D14F80007
+0280A1010714E0>216 163 102 290 269 77 D[<9BB512FE52B8FC0A3F17F80907BA12
+C0097F19FC0803BC7E081F1BF097BD12FE0707F4FFC0071F1DF096BF12FE0603787E060F
+1FE0063F1FF895C112FE05037A7E4D8D051F21F0057F21FC94BA26C0000784040306E0C8
+000F717E4C4DCA84041F05E0050F17F04C94CB0001834C04F8DE003F8293B800E0070F82
+030305800703707E4B4CCE834B04F8093F824B04E0090F824B04800903824B93CF6C8292
+B74876824A04F80B3F814A4C77824A4C77824A4C77824A93D10001824A4B78824E8B4AA1
+8191B7487981494C79814E8B494C7982494C7982A24993D36C82494B7A82A2494B7B81A2
+494B7B8190B7A1804D8D48A1844D8DA248A119804D8D48A119C04D8D48A119E0A34893D5
+6C16F0A4484B7C16F8A448A119FCA24C8FA4B7A116FEAE70A0B7FCA36CA119FCA4706A6C
+A119F8A37169A26CA119F0A271696CA119E0A271696CA119C071696CA11980A271696CA1
+190071696CA160719EB7FC6DA15F6D6F565E72676DA15F72676D70555E6DA15F72676D70
+555E6D705593C7FCA26D709CB75A6E6F545E6E70535E6E70535E6E70535E73656E04FC0B
+7F5E6E709AB85A6E705294C8FC6E05C009075E6F70515E6F04F8093F5E6F70515E030704
+FF50B812C06F05C007075F6F05F0071F94C9FC6F05FE96B85A043F706C050317F87005F0
+051F5F7005FF4CB95A040306F0031F188070DEFFC00107BACAFC706C95BC12FC7169050F
+21E005032180050056CBFC7267061F1FF006031F80060054CCFC073F1DF807071DC00701
+9ACDFCDF003F1BF808071BC0E0007F07FCCEFC090719C0E1007F05FCCFFC0A0194D0FC99
+C74AD1FC>215 173 110 295 252 79 D[<0007B66C0B03B512FE001F03E00B0FECFF80
+486F5315C0486F5315E0A2B76C5315F0B3B3B3B3B3B2709AB7FCA46CA113E07064A36C70
+5116C0A2696C702080696C702000696C70515D836C70515D7198B7FC6C7008035E6C7161
+06E04F5E6D70073F5E6D04FC96B8FC06FF06035F6D05C0050F5F6D05F0053F94C7FC6D05
+FE4CB85A6DDDFFE0033F5F6DDEFFC0010FB9FC6D96BC5A6E696E696E21806E9EC8FC6E68
+6E680200686F1FE0031F676F9CC9FC0303666F1EF86F6C1DE0041F1D80040752CAFC0400
+1CF8053F1BE0050798CBFC05001AF8061F19C006034ECCFCDE003F17E0070104FCCDFCDF
+000102FCCEFC>164 168 104 290 213 85 D[<0603B512F80503B712F094B9FC040F18
+E0047F18FC0307BB7E033F1AE04ABC12F802071BFE023F757E91BE12E00103894989491D
+FE8B8C8C96C7003F8206C0020F8205FCC80003826D03F00300820580824CCA6C8104F871
+8104E0834C71168093CB6C16C05D03F87216E05D6D498403801DF092CD7E5C5C4A1EF86D
+488690CFFCAE0903B8FC081FB9FC070FBAFC0603BBFC187F0507BCFC177F0403BDFC161F
+93BEFC1507033FF0003F92B912C0020305F8C7FC020F1780023F04F8C8FC4A16E049B8C9
+FC4916FC010F16F04916C04993CAFC4915FC90B75A485E485E17804893CBFC5A5E485D48
+5DA25E5A5EA2B7FCA25EA565A282A29AB7FC7E705FA2705F6C63705F705F6C6F5F7193B8
+FC6C705D7115076C04F8151F05FE157F6C706C0107B512BF6C05F890B6FC95B8123F6C1B
+FE6D1AFC6D1AF86D1AF06D1AE06D1A806D1A006D19FC6D61023F18E06E06806D15F00207
+4DC7FC020105F06E15E06E6C04806E15C0030F03FCC800011500030103C092CAFCDB000F
+01F0CEFC>125 133 118 258 154 97 D[<0707B512F84EB712F8061FEEFFC095B912FC
+0507F0FF80053F19F094BB12FE0403747E040F1BF0043F1BFC93BE12805D03071DC05D15
+3F5D92BFFC4A1E805C4A943880007F4A04F0C8FC4A04C0150F4A93C912014A03FC706C14
+0091B700F0171F494C1707490480834993CCFC4D85494BF11FFE494B190F4D1907491D01
+494B735A4D1A7890B798C7FC5F5A94D0FC5A5E5AA2485DA3485DA35A5EA35AA45EB7FCB2
+6C81A57E82A37E82A27EA2827E826CF70780711A0F6CF71FC0711A3F6C1F7F71F101FF6D
+656D6F4F13E071616D6F193F6D6F617196B5FC6D7017036D70170F6D70173F6D04F894B6
+FC7216036E03FF040F15F06E04C0157F6E04F0020FB7FC6E9326FF8003B8FC6E94BAFC80
+14006F1DE06F1DC06F1D800307F4FE006F1CF803001CE0043F1B807050C7FC04071AF804
+001AC0053F96C8FC050718F805001880061F04F8C9FC06011680DE00070280CAFC>124
+133 117 258 145 99 D[<0C03B512FE0C0FECFF805415C05415E0A25415F0B3AC953801
+FFFC067FEBFFE00503B612FE051F6F7E94B812F0040717FC041F17FF047F18C093BA12E0
+030319F84B19FC031F19FE4B96B8FC5D4AC0FC5C5C5C4AEFE0004A04FCC7120F4A04E014
+0191B800806E7E494CC9121F06F8824904E01603494C82494C824DCB7E495D495D5F5B5F
+90B75A5A5F4893CCFCA3485DA2485DA3485DA35AA25EA25AA45EA2B7FCB27EA382A37EA4
+6C81A46C81A27E82A27E827E837E836D816D99B7FC715F6D6F5F715F6D6F5F6D6F5F6D04
+C05E7293B8FC6D04F85D6D04FE15076E6F6C141F6E04F091B9FC6E04FF130F6E94BBFC80
+6E876E1AFE6E1AFC6F19F86F19F0030F19E06F19C0030119006F6C5F7005F86D15E0040F
+17E0040105806D15C0706C4BC76C1580050F03F00203ECFE000500038091CAFC060701F0
+CDFC>132 167 117 292 162 I[<070FB5FC4EB612FC061FEDFFC04DB812FC050FEFFF80
+053F18E04CBA12FC040719FF041F86047F1AE093BC7E03031BFC4B87031F874B884B8892
+BE7E0203894ADD801F824A9326F80001824A04E0D9003F814A0480020F814A4BC87E06F8
+03018291B7486F82494C8249048070814993CA7E494B71815F497581495D4D7181495D77
+8190B75A484C838D4893CCFCA248894C1D805A5E8A5A4C1DC0A25A5E93BFFCA25AA5C3FC
+A22280A222006921F804C0D1FCAA82A27EA4827EA2827EA2827EA2827E827E836C203C71
+1B7C6CF701FE6D6F1A03711A076D6F1A0F201F6D6F1A3F6D6F1AFF6D6F617218076D704E
+7F6D70183F6D04F895B6FC6E6F17036E03FF170F6E70163F6E04E04BB7FC6E04F8150F6E
+04FF92B8FC6E05F8133F6E94BBFC6F656F65030F656F1DE00301656F9AC7FC043F1BFC04
+0F1BF0701BC0040050C8FC053F19F8050F19C005014EC9FCDD003F17F0060394CAFCDE00
+3F15E0070002F0CBFC>130 133 119 258 149 I[<0007B512FC001F14FF48814881A2B7
+7EB3AC98B512E0081FECFF8097B712F8070716FF073F17C096B912F8060384060F18FF06
+3F854E8595BB7E0503864D864D864D865F4D8694BD128004E19138FE001F04E302C00101
+17C04EC8123F04E701F88104EF01E0030716E04E8193B5C97E4D1BF005F8825F4D835F21
+F85F94CB7E5EA25EA25EA35EA45EB3B3B3B3A96C4B7215F0A26C4B7215E06C92CC6C15C0
+000702FC07011500>125 165 110 292 162 104 D[<0007B61280001F15E04815F04815
+F8A2B712FCA86C15F8A26C15F06C15E000071580CAFCB3A248B6FC000715C04815E04815
+F0A24815F8B3B3B3B3B3B3AA6C15F0A26C15E06C15C000011500>38
+166 112 293 72 I[<0007B512FC001F14FF4815804815C0A2B712E0B3B3B3B3B3B3B3B3
+AB6C15C0A26C15806C1500000714FC>35 165 110 292 72 108
+D[<98267FFFF097380FFFFE081FB600C00603B612F80007B500F893B700FC061FEDFF80
+001F02FE0307DCFF8094B812F0486E033F05E0040717FC486F91B900F8041F17FF060306
+FE047F18C0B76C010F726C4ABA12F04E734A85067F73020F8595BB6C4A85050374027F85
+4D7491BC7E4D7449874D7449874D644D75488794BD5B04C19126FE000F7148DAC0018304
+C302C00100714801F8C7001F824EC8003F07C0140704C701F8030F94B5C8120104CF01E0
+6F04F101FC6F824E03014E163F04DF90CA04F301E082DCFFFE98B548864D714D8205F052
+CAFC4D644D714C83A11B804D6494CB5F4C724C83A24C65A24C9ACBFCA34C64A44C64B3B3
+B3B3A96C4B724B721600A26C4B724B725D6C92CC6C4B735C000702FC07000380071F14F0
+>217 130 110 257 254 I[<98B512E0081FECFF800007B500F893B712F8001F02FE0307
+16FF486E033F17C0486F91B912F8060384B76C010F18FF063F854E8595BB7E0503864D86
+4D864D865F4D8694BD128004C19138FE001F04C302C0010117C04EC8123F04C701F88104
+CF01E0030716E04E8104DF90C97EDCFFFE1BF005F8825F4D835F21F85F94CB7E5EA25EA2
+5EA35EA45EB3B3B3B3A96C4B7215F0A26C4B7215E06C92CC6C15C0000702FC07011500>
+125 130 110 257 162 I[<97B57E077F14FF0607B712F0067F16FF0503B912E0050F18
+F8057F18FF4CBB12C004071AF0041F1AFC4C8693BD7E4B8803071CF04B88033F1CFE4B88
+92BF7E4ADD8000834A04F8C7000F824A04800200824A4BC9003F814A03F8040F814A03E0
+0403814A4B708191B7CB6C81494B7281494B7281494B72814D84494B7281494B7281A249
+4B72814992CD6C80A290B6487481A2484B7481A2488E4C86488EA2488E4C86A2488EA348
+8EA24C86A2488EA6B72080AF6C2300A37062A36C6AA46C6F505DA36C6A70626C6AA27062
+6C6AA26C6F505DA26C7096B75A6D9EC7FC71606D6F4E5D71606D686D6F4E5D6D6F4E5D71
+606D6F6C94B75A6D704C5E6D704C5E6E03F8040F93C8FC6E03FE043F5D6EDBFFC04AB75A
+6E04F8020F5E6E9326FFC001B85A6E94BA5A6E666E66033F52C9FC6F646F6403031CE06F
+646F6C98CAFC041F1AFC04071AF004011AC0706C96CBFC051F18FC050318E0DD007F94CC
+FC060716F0DE007F92CDFC070114C0>145 133 119 258 164 I[<97381FFFE00703B6FC
+0007B500FC033F15E0001F02FF0203B712FC486F010F16FF486F017F17C04DB912F0B7D8
+E00718FC051F18FF4D8594BB7E04E11AF004E78604EF8693BC7E8B8C8C8C9526FE001F83
+06C00103834DC87E05F8031F8205E06F82058015034CC96C824C706C824C8304E0718276
+82887682A27682887781A27781A2898D89228089A37716C0A38922E0A389A322F0A38AAE
+9BB7FCA222E0A465A222C0A265A2228065A2531600A2535DA2656965699AB7FC525EA252
+5E525E64525E704D93C7FC705F7094B75A704C5E70160705C04B5E71033F5E05F892B85A
+05FE02035F716C010F5FDEF801B9C8FC95BA5A67676704EF1AC004E76204E397C9FC04E1
+19FC04E0617118E0051F1880714DCAFC050317F8050017C0063F93CBFC060F15F8060015
+80070F01E0CCFC96CFFCB3A86C5DA26C5D6C92D2FC000714FC>132
+163 110 257 162 I[<F37FE0F20FFF0007B500F8047F13F0001F02FE0303B5FC486E15
+0F486F143F96B6FCB76C13036060183F6095B7FC5F5F5F5F5F5F5FA294B8FC16C1A216C3
+04C717E0A204CFEE800004DF03E0C7FC07FCC8FC93B612E019804EC9FC18F818E0188095
+CAFC17FC5F5F5F5F5F94CBFC5EA25EA25EA35EA45EB3B3B3B06C5DA26C5D6C92CCFC0007
+14FC>84 130 110 257 108 114 D[<050FB512F00407B712E0047F16FF0303B912F003
+1F18FF92BB12E002031AFC020FF2FF804A1BE0027F1BFC91BDFC49885B5B5B5B49645BA2
+90B738F000014893C8120704F8ED007F4803E0040F5C4C1603484B160093CB123F484A18
+0F4B840A015B48874B193F1D1F775A481C039AC8FC81A38181828216F016FC16FF17F0EF
+FF806C17FCF0FFF0F1FFC06C19FEF2FFC01BF86C1AFF1CC06C1BF01CFC6C1BFF6C881DE0
+6D876D876D1BFE896D886D8813016D886E876E87020F87800201876E6C86151F03071B80
+1500041F1AC01601EE000FDD007F18E01801F00007F1003F080716F01A01747E1B1F8787
+4886D807C085486C857F7F6D86487E7F6E1CE080804801F896B6FC806E4E15C06E7E03E0
+5F03F84D15804802FE5F6F6C4C150004E0167F04FC4BB65ADCFFC0140F05FF49B75ABFFC
+666666A26C6566001F9AC7FC00076400011CF8D8003F63010F6301011B806D6C4FC8FC02
+0F19F8020019E0031F95C9FC030117F0DB000793CAFCDC000F14C0>108
+133 119 258 125 I[<031FB512E0037F14F892B67E4A81A24A81B3AE0007BD12F0001F
+1CFC48884888A2BF1280A86C1D00A26C646C6400071CF0C7000393CBFCB3B3B3B3A585A5
+F503C06E70150FF51FE01D3F73EDFFF0647314076E70141F0A7F13F807FE0103B5FC6F6F
+137F97B712FCA281A2811EF86F1AF06F1AC01E006F19FC6F19F06F1980704DC7FC7017F0
+701780040704FCC8FC040116C0706C02F8C9FC050701F8CAFC>102
+167 122 292 118 I<0007B500FC4FB6FC001F02FF070715C0486F4E15E0486F4E15F0A2
+B76C4E15F8B3B3B3B3A765A59AB7FCA364A264A264A2647E646482646C98B8FC635113BF
+6C6F160F51133F6C6FEE7FFE7016FF6C6F6C020313FC05E0021F13F86C04FF49B512F06C
+94B7FC1CE06C1BC06D1A806D1A006D616D19F80103616D616D6C06806D15F0021F4DC7FC
+020705F86E15E0020005E06E15C0031F93C800011500030103F892CAFCDB000714807D82
+6EFFA2>I<001FB5972607FFF097381FFFFE007F02C0071F01FC97B612806F4F01FF61B6
+6C4F6E4E15C06F96B6616F4E817A606F60A15DA26C6E4E6F1C80A15DA26C6F4D6F1C00A2
+A15D6C6F756364A192B6FC8C6C6F4D67A15CA26C6F4D6F63A15CA26C6F94B86C62A2A15C
+6C7A62705EA15C8D6C6F4C68A15CA26D6E4C7162A2A15C6D6F7597C7FC515BA15C78806D
+6F4B670BFC97B6FCA26D6F4B6E6E610BF861A26D6F4B6E6E61A20BF0616D7A607192B57F
+A15B0BE0826D6F4A6F64A15B1DC06D6F4A73608AA15B6E6E4A028070608AA15B0B00826E
+6F499DC8FC7860646E6F49735F7994B6FCA26E6F4949715FA2795E6E4F715F725B795E23
+806E6F90B54865795EA26E6F484A06C05EA2795E6E6F484A06E05EA2795E6F0DF05E7248
+5C795EA26F038F91C804F893C9FCA15A8B6F03DF4907FC5DA27A92B6FC6F4D735D96B5FC
+7A91B7FCA26F4D658CA26F4D65A28C6F4D65A28C6F6B638CA2704C65A28C7093CA96CAFC
+A28C7069628D704B65704B725E704B725E704B06075E706C028006011680CA8179FFD9>
+119 D<000FB56C98387FFFFC003F02F050B57E486E08078003FE5015806F62B7FC6C6F61
+825415007E826C9AB65A827E704E5D7E70646C64826C525D82A26C525D837F714D5D7F71
+636D63836D5192C7FC83A26D98B65A837F714C5D7F71626D62846E4F5D8480525D848072
+4B5D8072616E61846E9AC8FC725D8099B65A6E81A273495D81735F6F5F856F63636F8167
+6F6F5BA26F6F5F63676F81636F6F94C9FCA2706F5A668274B6FC7061867003E15DA21AF1
+7003F35D1AFB8297B75A82A27061A27160A2839BCAFCA2836583A2715FA2715FA28365A2
+836584A2725EA2725EA2849ACBFC84A26484A2725DA2725DA364A2606460A2001E63003F
+5FD87FE04C5D01F85ED9FF8092B7CCFC02FC141F91BA5AA263636C62A263636350CDFC62
+621AE06297CEFC6C18FC19F0198006FCCFFC18C06C04FCD0FCD8000F4AD1FC81A379FF90
+>121 D E
+%EndDVIPSBitmapFont
+end
+%%EndProlog
+%%BeginSetup
+%%Feature: *Resolution 600dpi
+TeXDict begin
+ @landscape
+%%EndSetup
+%%Page: 1 1
+1 0 bop 354 668 a Fj(Hyp)9 b(ersonic)109 b(Flo)-9 b(w)107
+b(Computations)f(On)1289 901 y(Unstructured)k(Meshes)1877
+1465 y Fi(AIAA)91 b(97{0625)1045 1872 y Fh(K.)69 b(L.)h(Bibb)1466
+b(J.)69 b(P)-6 b(eraire)465 2131 y Fg(NASA)69 b(Langley)g(Resea)-6
+b(rch)294 b(Massachusetts)68 b(Institute)1212 2330 y(Center)1435
+b(of)69 b(T)-17 b(echnology)720 2530 y(Hampton,)68 b(Virginia)421
+b(Camb)-6 b(ridge,)68 b(Massachusetts)2255 2968 y Fh(C.)h(J.)h(Riley)
+1356 3261 y Fg(NASA)f(Langley)g(Resea)-6 b(rch)68 b(Center)1926
+3493 y(Hampton,)h(Virginia)p eop
+%%Page: 1 2
+1 1 bop 2 1494 a Ff(Session:)241 b Fh(Applied)69 b(Computational)e
+(Aero)2 1760 y Ff(Time:)428 b Fh(w)-6 b(ed)69 b(afterno)6
+b(on)2 2026 y Ff(Mention:)160 b Fh(colleagues)1063 2283
+y Fe(\017)83 b Fh(Ram)67 b(Prabhu)i(fo)-6 b(r)69 b(running)h(co)6
+b(des)1063 2565 y Fe(\017)83 b Fh(Bill)69 b(Scallion)f(&)h(Matt)e(Rho)6
+b(de)70 b(fo)-6 b(r)69 b(UPWT)f(data)p eop
+%%Page: 2 3
+2 2 bop 2039 893 a Fi(Background)146 1500 y Fe(\017)83
+b Fh(Rapid,)69 b(accurate)f(aero)6 b(dynamic)66 b(screening)j
+(capabilit)-6 b(y)68 b(is)h(needed:)370 1782 y Ff({)82
+b Fh(aero)6 b(dynamic)67 b(p)6 b(erfo)-6 b(rmance)67
+b(co)6 b(e\016cients)370 2064 y Ff({)82 b Fh(p)-6 b(ressure)70
+b(loads)f(fo)-6 b(r)69 b(p)-6 b(relimina)g(ry)68 b(structural)f
+(analysis)370 2346 y Ff({)82 b Fh(general)69 b(\015o)-6
+b(w)69 b(features,)f(fo)-6 b(r)70 b(example,)d(sho)6
+b(ck)69 b(lo)6 b(cation)146 2629 y Fe(\017)83 b Fh(Unstructured)69
+b(grids)g(o\013er)g(\015exible)f(and)h(rapid)g(grid)g(generation)146
+2911 y Fe(\017)83 b Fh(Histo)-6 b(rically)-17 b(,)69
+b(unstructured)g(Euler)f(schemes)g(a)-6 b(re)68 b(not)h(robust)317
+3143 y(hyp)6 b(ersonically)p eop
+%%Page: 3 4
+3 3 bop 2289 1176 a Fi(Outline)146 1782 y Fe(\017)83
+b Fh(Computational)67 b(algo)-6 b(rithm)146 2064 y Fe(\017)83
+b Fh(Compa)-6 b(risons)69 b(to)g(other)f(co)6 b(des)317
+2297 y(and)69 b(exp)6 b(eriment)146 2579 y Fe(\017)83
+b Fh(Use)69 b(as)f(a)h(screening)g(to)6 b(ol)146 2861
+y Fe(\017)83 b Fh(Concluding)71 b(rema)-6 b(rks)p eop
+%%Page: 3 5
+3 4 bop 146 1877 a Fe(\017)83 b Fh(details)68 b(a)-6
+b(re)69 b(in)g(the)f(pap)6 b(er)69 b(fo)-6 b(r)69 b(the)g(algo)-6
+b(rithm)146 2160 y Fe(\017)83 b Fh(screening)69 b(to)6
+b(ols)69 b(a)-6 b(re)69 b(talk)-6 b(ed)68 b(ab)6 b(out)68
+b(throughout)p eop
+%%Page: 4 6
+4 5 bop 1807 880 a Fi(FELISA)91 b(System)146 1486 y Fe(\017)83
+b Fh(Unstructured)69 b(mesh)f(generation)146 1768 y Fe(\017)83
+b Fh(`Standa)-6 b(rd')69 b(Euler)g(\015o)-6 b(w)69 b(solver,)g(fo)-6
+b(r)69 b(subsonic)i Fe(\))d Fh(lo)-6 b(w)69 b(sup)6 b(ersonic)146
+2051 y Fe(\017)83 b Fh(Hyp)6 b(ersonic)69 b(Euler)g(\015o)-6
+b(w)69 b(solver,)g(FELISA)p 3515 2051 62 4 v 74 w(HYP)370
+2333 y Ff({)82 b Fh(p)6 b(erfect)68 b(gas)370 2615 y
+Ff({)82 b Fh(equilib)-6 b(rium)69 b(air)370 2897 y Ff({)82
+b Fh(CF)821 2931 y Fd(4)146 3180 y Fe(\017)h Fh(P)-6
+b(a)g(rallel)68 b(versions)h(of)g(\015o)-6 b(w)70 b(solvers)p
+eop
+%%Page: 4 7
+4 6 bop 146 1877 a Fe(\017)83 b Fh(fo)-6 b(r)70 b(pa)-6
+b(rallel:)91 b(w)-6 b(o)g(rk)69 b(on)g(IBM)g(sP2,)g(J90,)i(w)-6
+b(o)g(rkstation)68 b(clusters.)146 2160 y Fe(\017)83
+b Fh(not)69 b(used)h(fo)-6 b(r)69 b(the)g(calculations)f(in)h(the)f
+(pap)6 b(er)p eop
+%%Page: 5 8
+5 7 bop 1529 661 a Fi(Unstructured)93 b(Inviscid)1397
+1010 y(Hyp)8 b(ersonic)91 b(Flo)-8 b(w)91 b(Solver)1839
+1358 y(\(FELISA)p 2846 1358 82 4 v 98 w(HYP\))146 1964
+y Fe(\017)83 b Fh(Euler)69 b(equations)146 2247 y Fe(\017)83
+b Fh(Finite)68 b(volume)g(fo)-6 b(rmulation)146 2529
+y Fe(\017)83 b Fh(Edge)69 b(data)f(structure)146 2811
+y Fe(\017)83 b Fh(H)m(\177)-100 b(anel)69 b(\015ux)g(vecto)-6
+b(r)68 b(splitting)146 3094 y Fe(\017)83 b Fh(MUSCL)68
+b(reconstruction)146 3376 y Fe(\017)83 b Fh(Explicit)68
+b(time)f(stepping)p eop
+%%Page: 5 9
+5 8 bop 1873 1574 a Fi(Time)89 b(Stepping)146 2180 y
+Fe(\017)83 b Fh(check)68 b(to)h(ensure)g(monotonicit)-6
+b(y)146 2463 y Fe(\017)83 b Fh(eliminate)67 b(limit)g(cycle)h(b)6
+b(ehavio)-6 b(r)p eop
+%%Page: 6 10
+6 9 bop 1531 1013 a Fi(Edge)91 b(Data)h(Structure)68
+3068 y @beginspecial 144 @llx 367 @lly 488 @urx 602 @ury
+2914 @rwi @setspecial
+%%BeginDocument: smpfig.eps
+%!PS-Adobe-2.0 EPSF-1.2
+%%Creator:Adobe Illustrator(TM) 1.1
+%%For: (RICHARD A WHELESS) (NASA LANGLEY)
+%%Title: (EPS)
+%%CreationDate: (2/9/99) (3:01 PM)
+%%DocumentProcessColors: Black
+%%DocumentFonts: Courier-Bold
+%%DocumentProcSets: Adobe_Illustrator_1.1 0 0
+%%BoundingBox:144 367 488 602
+%%ColorUsage: Black&White
+%AI3_IncludePlacedImages
+%%TemplateBox:306 396 306 396
+%%TileBox: 30 31 582 761
+%%DocumentPreview: Header
+%%EndComments
+%%BeginProcSet:Adobe_Illustrator_1.1 0 0
+/Adobe_Illustrator_1.1 dup 100 dict def load begin
+/Version 0 def
+/Revision 0 def
+/bdef {bind def} bind def
+/ldef {load def} bdef
+/xdef {exch def} bdef
+/_K {3 index add neg dup 0 lt {pop 0} if 3 1 roll} bdef
+/_k /setcmybcolor where 
+{/setcmybcolor get} {{1 sub 4 1 roll _K _K _K setrgbcolor pop} bind} ifelse def
+/g {/_b xdef /p {_b setgray} def} bdef
+/G {/_B xdef /P {_B setgray} def} bdef
+/k {/_b xdef /_y xdef /_m xdef /_c xdef /p {_c _m _y _b _k} def} bdef
+/K {/_B xdef /_Y xdef /_M xdef /_C xdef /P {_C _M _Y _B _k} def} bdef
+/d /setdash ldef
+/_i currentflat def
+/i {dup 0 eq {pop _i} if setflat} bdef
+/j /setlinejoin ldef
+/J /setlinecap ldef
+/M /setmiterlimit ldef
+/w /setlinewidth ldef
+/_R {.25 sub round .25 add} bdef
+/_r {transform _R exch _R exch itransform} bdef
+/c {_r curveto} bdef
+/C /c ldef
+/v {currentpoint 6 2 roll _r curveto} bdef
+/V /v ldef
+/y {_r 2 copy curveto} bdef
+/Y /y ldef
+/l {_r lineto} bdef
+/L /l ldef
+/m {_r moveto} bdef
+/_e [] def
+/_E {_e length 0 ne {gsave 0 g 0 G 0 i 0 J 0 j 1 w 10 M [] 0 d
+/Courier 20 0 0 1 z [0.966 0.259 -0.259 0.966
+_e 0 get _e 2 get add 2 div _e 1 get _e 3 get add 2 div] e _f t T grestore} if} bdef
+/_fill {{fill} stopped
+{/_e [pathbbox] def /_f (ERROR: can't fill, increase flatness) def n _E} if} bdef
+/_stroke {{stroke} stopped
+{/_e [pathbbox] def /_f (ERROR: can't stroke, increase flatness) def n _E} if} bdef
+/n /newpath ldef
+/N /n ldef
+/F {p _fill} bdef
+/f {closepath F} bdef
+/S {P _stroke} bdef
+/s {closepath S} bdef
+/B {gsave F grestore S} bdef
+/b {closepath B} bdef
+/_s /ashow ldef
+/_S {(?) exch {2 copy 0 exch put pop dup false charpath currentpoint _g setmatrix
+_stroke _G setmatrix moveto 3 copy pop rmoveto} forall pop pop pop n} bdef
+/_A {_a moveto _t exch 0 exch} bdef
+/_L {0 _l neg translate _G currentmatrix pop} bdef
+/_w {dup stringwidth exch 3 -1 roll length 1 sub _t mul add exch} bdef
+/_z [{0 0} bind {dup _w exch neg 2 div exch neg 2 div} bind {dup _w exch neg exch neg} bind] def
+/z {_z exch get /_a xdef /_t xdef /_l xdef exch findfont exch scalefont setfont} bdef
+/_g matrix def
+/_G matrix def
+/_D {_g currentmatrix pop gsave concat _G currentmatrix pop} bdef
+/e {_D p /t {_A _s _L} def} bdef
+/r {_D P /t {_A _S _L} def} bdef
+/a {_D /t {dup p _A _s P _A _S _L} def} bdef
+/o {_D /t {pop _L} def} bdef
+/T {grestore} bdef
+/u {} bdef
+/U {} bdef
+/Z {findfont begin currentdict dup length dict begin
+{1 index /FID ne {def} {pop pop} ifelse} forall /FontName exch def dup length 0 ne
+{/Encoding Encoding 256 array copy def 0 exch {dup type /nametype eq
+{Encoding 2 index 2 index put pop 1 add} {exch pop} ifelse} forall} if pop
+currentdict dup end end /FontName get exch definefont pop} bdef
+end
+%%EndProcSet
+%%EndProlog
+%%BeginSetup
+Adobe_Illustrator_1.1 begin
+n
+%%BeginEncoding: _Courier-Bold Courier-Bold
+[39/quotesingle 96/grave 128/Adieresis/Aring/Ccedilla/Eacute/Ntilde/Odieresis
+/Udieresis/aacute/agrave/acircumflex/adieresis/atilde/aring/ccedilla/eacute
+/egrave/ecircumflex/edieresis/iacute/igrave/icircumflex/idieresis/ntilde
+/oacute/ograve/ocircumflex/odieresis/otilde/uacute/ugrave/ucircumflex
+/udieresis/dagger/degree/cent/sterling/section/bullet/paragraph/germandbls
+/registered/copyright/trademark/acute/dieresis/.notdef/AE/Oslash
+/.notdef/plusminus/.notdef/.notdef/yen/mu/.notdef/.notdef
+/.notdef/.notdef/.notdef/ordfeminine/ordmasculine/.notdef/ae/oslash
+/questiondown/exclamdown/logicalnot/.notdef/florin/.notdef/.notdef
+/guillemotleft/guillemotright/ellipsis/.notdef/Agrave/Atilde/Otilde/OE/oe
+/endash/emdash/quotedblleft/quotedblright/quoteleft/quoteright/divide
+/.notdef/ydieresis/Ydieresis/fraction/currency/guilsinglleft/guilsinglright
+/fi/fl/daggerdbl/periodcentered/quotesinglbase/quotedblbase/perthousand
+/Acircumflex/Ecircumflex/Aacute/Edieresis/Egrave/Iacute/Icircumflex
+/Idieresis/Igrave/Oacute/Ocircumflex/.notdef/Ograve/Uacute/Ucircumflex
+/Ugrave/dotlessi/circumflex/tilde/macron/breve/dotaccent/ring/cedilla
+/hungarumlaut/ogonek/caron
+]/_Courier-Bold/Courier-Bold Z
+%%EndEncoding
+%%EndSetup
+0 0 0 0 k
+0 0 0 1 K
+0 i
+0 J 0 j 1 w 4 M []0 d
+%%Note:
+487.5 367.5 m
+487.5 601.5 L
+145.5 601.5 L
+145.5 367.5 L
+487.5 367.5 L
+b
+145.5 601.5 m
+487 368 l
+B
+487 601.5 m
+145 368 l
+B
+0.5 w
+450.5 478 m
+450.5 494 L
+182 494 L
+182 478 L
+450.5 478 L
+b
+u
+0 0 0 1 k
+1 w
+/_Courier-Bold 12 14.5 0 0 z
+[1 0 0 1 187.402 482]e
+(Encapsulated Postscript \(EPS\) Figure)t
+T
+U
+%%PageTrailer
+%%Trailer
+_E end
+%%EOF
+
+%%EndDocument
+ @endspecial 3048 1421 a Fe(\017)83 b Fh(control)69 b(volumes)f(a)-6
+b(re)3219 1654 y(tetrahedra)67 b(surrounding)3219 1886
+y(each)i(no)6 b(de)3048 2168 y Fe(\017)83 b Fh(\015uxes)69
+b(computed)f(across)3219 2401 y(outer)h(faces)f(of)i(control)3219
+2633 y(volume)3048 2916 y Fe(\017)83 b Fh(\015ux)69 b(computations)3219
+3148 y(group)6 b(ed)70 b(b)-6 b(y)69 b(edge)p eop
+%%Page: 6 11
+6 10 bop 756 678 a Fi(Old)91 b(Edge)g(Data)h(Structure)g(notes.)46
+b(.)f(.)146 1284 y Fe(\017)83 b Fh(edge)69 b(il)g(is)g(used)g(in)h(all)
+e(of)h(the)g(\014gures.)35 b(.)g(.)229 1953 y Fe(\017)83
+b Fh(\015uxes)69 b(computed)f(across)400 2186 y(faces)h(of)g
+(tetrahedra)229 2468 y Fe(\017)83 b Fh(control)69 b(volume)f(is)400
+2701 y(tetrahedra)229 2983 y Fe(\017)83 b Fh(no)6 b(dal)69
+b(info)h(fo)-6 b(r)69 b(cells)g(is)400 3215 y(sto)-6
+b(red)2824 1953 y Fe(\017)83 b Fh(\015uxes)69 b(computed)f(across)2995
+2186 y Fc(S)3111 2128 y Fb(e)3250 2186 y Fh(fo)-6 b(r)68
+b(all)e(edges)i(of)f(no)6 b(de)68 b Fc(i)2824 2468 y
+Fe(\017)83 b Fh(control)69 b(volume)2995 2701 y(surrounds)h(no)6
+b(de)2824 2983 y Fe(\017)83 b Fh(w)-6 b(eights)69 b(fo)-6
+b(r)69 b Fc(S)4108 2925 y Fb(e)4249 2983 y Fh(sto)-6
+b(red)p eop
+%%Page: 7 12
+7 11 bop 1182 1201 a Fi(H)l(\177)-132 b(anel)91 b(Flux)e(V)-8
+b(ecto)g(r)94 b(Splitting)146 1807 y Fe(\017)83 b Fh(Up)-6
+b(wind)70 b(fo)-6 b(rmulation;)68 b(allo)-6 b(ws)69 b(fo)-6
+b(r)69 b(stable)f(computations)g(across)317 2039 y(strong)i(sho)6
+b(cks)146 2321 y Fe(\017)83 b Fh(No)70 b('free')f(pa)-6
+b(rameters)66 b(a)-6 b(re)69 b(required)146 2604 y Fe(\017)83
+b Fh(Allo)-6 b(ws)70 b(fo)-6 b(r)69 b(constant)f(enthalp)-6
+b(y)69 b(solution)h(where)e(solution)i(is)f(fully)317
+2836 y(converged)p eop
+%%Page: 8 13
+8 12 bop 1342 485 a Fi(Gradient)91 b(Reconstruction)541
+3700 y @beginspecial 144 @llx 367 @lly 488 @urx 602 @ury
+5180 @rwi @setspecial
+%%BeginDocument: smpfig.eps
+%!PS-Adobe-2.0 EPSF-1.2
+%%Creator:Adobe Illustrator(TM) 1.1
+%%For: (RICHARD A WHELESS) (NASA LANGLEY)
+%%Title: (EPS)
+%%CreationDate: (2/9/99) (3:01 PM)
+%%DocumentProcessColors: Black
+%%DocumentFonts: Courier-Bold
+%%DocumentProcSets: Adobe_Illustrator_1.1 0 0
+%%BoundingBox:144 367 488 602
+%%ColorUsage: Black&White
+%AI3_IncludePlacedImages
+%%TemplateBox:306 396 306 396
+%%TileBox: 30 31 582 761
+%%DocumentPreview: Header
+%%EndComments
+%%BeginProcSet:Adobe_Illustrator_1.1 0 0
+/Adobe_Illustrator_1.1 dup 100 dict def load begin
+/Version 0 def
+/Revision 0 def
+/bdef {bind def} bind def
+/ldef {load def} bdef
+/xdef {exch def} bdef
+/_K {3 index add neg dup 0 lt {pop 0} if 3 1 roll} bdef
+/_k /setcmybcolor where 
+{/setcmybcolor get} {{1 sub 4 1 roll _K _K _K setrgbcolor pop} bind} ifelse def
+/g {/_b xdef /p {_b setgray} def} bdef
+/G {/_B xdef /P {_B setgray} def} bdef
+/k {/_b xdef /_y xdef /_m xdef /_c xdef /p {_c _m _y _b _k} def} bdef
+/K {/_B xdef /_Y xdef /_M xdef /_C xdef /P {_C _M _Y _B _k} def} bdef
+/d /setdash ldef
+/_i currentflat def
+/i {dup 0 eq {pop _i} if setflat} bdef
+/j /setlinejoin ldef
+/J /setlinecap ldef
+/M /setmiterlimit ldef
+/w /setlinewidth ldef
+/_R {.25 sub round .25 add} bdef
+/_r {transform _R exch _R exch itransform} bdef
+/c {_r curveto} bdef
+/C /c ldef
+/v {currentpoint 6 2 roll _r curveto} bdef
+/V /v ldef
+/y {_r 2 copy curveto} bdef
+/Y /y ldef
+/l {_r lineto} bdef
+/L /l ldef
+/m {_r moveto} bdef
+/_e [] def
+/_E {_e length 0 ne {gsave 0 g 0 G 0 i 0 J 0 j 1 w 10 M [] 0 d
+/Courier 20 0 0 1 z [0.966 0.259 -0.259 0.966
+_e 0 get _e 2 get add 2 div _e 1 get _e 3 get add 2 div] e _f t T grestore} if} bdef
+/_fill {{fill} stopped
+{/_e [pathbbox] def /_f (ERROR: can't fill, increase flatness) def n _E} if} bdef
+/_stroke {{stroke} stopped
+{/_e [pathbbox] def /_f (ERROR: can't stroke, increase flatness) def n _E} if} bdef
+/n /newpath ldef
+/N /n ldef
+/F {p _fill} bdef
+/f {closepath F} bdef
+/S {P _stroke} bdef
+/s {closepath S} bdef
+/B {gsave F grestore S} bdef
+/b {closepath B} bdef
+/_s /ashow ldef
+/_S {(?) exch {2 copy 0 exch put pop dup false charpath currentpoint _g setmatrix
+_stroke _G setmatrix moveto 3 copy pop rmoveto} forall pop pop pop n} bdef
+/_A {_a moveto _t exch 0 exch} bdef
+/_L {0 _l neg translate _G currentmatrix pop} bdef
+/_w {dup stringwidth exch 3 -1 roll length 1 sub _t mul add exch} bdef
+/_z [{0 0} bind {dup _w exch neg 2 div exch neg 2 div} bind {dup _w exch neg exch neg} bind] def
+/z {_z exch get /_a xdef /_t xdef /_l xdef exch findfont exch scalefont setfont} bdef
+/_g matrix def
+/_G matrix def
+/_D {_g currentmatrix pop gsave concat _G currentmatrix pop} bdef
+/e {_D p /t {_A _s _L} def} bdef
+/r {_D P /t {_A _S _L} def} bdef
+/a {_D /t {dup p _A _s P _A _S _L} def} bdef
+/o {_D /t {pop _L} def} bdef
+/T {grestore} bdef
+/u {} bdef
+/U {} bdef
+/Z {findfont begin currentdict dup length dict begin
+{1 index /FID ne {def} {pop pop} ifelse} forall /FontName exch def dup length 0 ne
+{/Encoding Encoding 256 array copy def 0 exch {dup type /nametype eq
+{Encoding 2 index 2 index put pop 1 add} {exch pop} ifelse} forall} if pop
+currentdict dup end end /FontName get exch definefont pop} bdef
+end
+%%EndProcSet
+%%EndProlog
+%%BeginSetup
+Adobe_Illustrator_1.1 begin
+n
+%%BeginEncoding: _Courier-Bold Courier-Bold
+[39/quotesingle 96/grave 128/Adieresis/Aring/Ccedilla/Eacute/Ntilde/Odieresis
+/Udieresis/aacute/agrave/acircumflex/adieresis/atilde/aring/ccedilla/eacute
+/egrave/ecircumflex/edieresis/iacute/igrave/icircumflex/idieresis/ntilde
+/oacute/ograve/ocircumflex/odieresis/otilde/uacute/ugrave/ucircumflex
+/udieresis/dagger/degree/cent/sterling/section/bullet/paragraph/germandbls
+/registered/copyright/trademark/acute/dieresis/.notdef/AE/Oslash
+/.notdef/plusminus/.notdef/.notdef/yen/mu/.notdef/.notdef
+/.notdef/.notdef/.notdef/ordfeminine/ordmasculine/.notdef/ae/oslash
+/questiondown/exclamdown/logicalnot/.notdef/florin/.notdef/.notdef
+/guillemotleft/guillemotright/ellipsis/.notdef/Agrave/Atilde/Otilde/OE/oe
+/endash/emdash/quotedblleft/quotedblright/quoteleft/quoteright/divide
+/.notdef/ydieresis/Ydieresis/fraction/currency/guilsinglleft/guilsinglright
+/fi/fl/daggerdbl/periodcentered/quotesinglbase/quotedblbase/perthousand
+/Acircumflex/Ecircumflex/Aacute/Edieresis/Egrave/Iacute/Icircumflex
+/Idieresis/Igrave/Oacute/Ocircumflex/.notdef/Ograve/Uacute/Ucircumflex
+/Ugrave/dotlessi/circumflex/tilde/macron/breve/dotaccent/ring/cedilla
+/hungarumlaut/ogonek/caron
+]/_Courier-Bold/Courier-Bold Z
+%%EndEncoding
+%%EndSetup
+0 0 0 0 k
+0 0 0 1 K
+0 i
+0 J 0 j 1 w 4 M []0 d
+%%Note:
+487.5 367.5 m
+487.5 601.5 L
+145.5 601.5 L
+145.5 367.5 L
+487.5 367.5 L
+b
+145.5 601.5 m
+487 368 l
+B
+487 601.5 m
+145 368 l
+B
+0.5 w
+450.5 478 m
+450.5 494 L
+182 494 L
+182 478 L
+450.5 478 L
+b
+u
+0 0 0 1 k
+1 w
+/_Courier-Bold 12 14.5 0 0 z
+[1 0 0 1 187.402 482]e
+(Encapsulated Postscript \(EPS\) Figure)t
+T
+U
+%%PageTrailer
+%%Trailer
+_E end
+%%EOF
+
+%%EndDocument
+ @endspecial eop
+%%Page: 8 14
+8 13 bop 997 1311 a Fi(Gradient)91 b(Reconstruction)h(notes)146
+1917 y Fe(\017)83 b Fh(compa)-6 b(re)68 b(to)g(structured)h(grid)g
+(gradient)g(calculation)146 2199 y Fe(\017)83 b Fh(edge)69
+b(il)g(is)g(used)g(in)h(all)e(of)h(the)g(\014gures...)146
+2482 y Fe(\017)83 b Fh(MUSCL)68 b(reconstruction)h(\(Monotone)h(Up)-6
+b(wind)69 b(Scheme)317 2714 y(Conservation)g(La)-6 b(w\))p
+eop
+%%Page: 9 15
+9 14 bop 272 943 a Fi(Recent)93 b(Applications)c(of)j(the)f(FELISA)g
+(System)146 1549 y Fe(\017)83 b Fh(Lo)6 b(ckheed-Ma)-6
+b(rtin)68 b(RL)-23 b(V/X-33)70 b(Phase)e(I;)h(aero)6
+b(dynamics)146 1832 y Fe(\017)83 b Fh(Lo)6 b(ckheed-Ma)-6
+b(rtin)68 b(RL)-23 b(V/X-33)70 b(Phase)e(I)6 b(I;)69
+b(Ascent)f(sho)6 b(ck)317 2064 y(interaction)68 b(study;)i(transonic)e
+(aero)6 b(dynamic)67 b(screening)146 2346 y Fe(\017)83
+b Fh(McDonnell)69 b(Douglas)g(Phase)g(I)f(RL)-23 b(V/X-33;)71
+b(control)e(surface)317 2579 y(loading)h(\(NASA)f(CR)g(201606\))i(and)e
+(aero)6 b(dynamics)317 2811 y(\(subsonic)71 b Fe(\))d
+Fh(hyp)6 b(ersonic\))146 3094 y Fe(\017)83 b Fh(OSC)68
+b(X-34,)i(transonic)f(screening,)h(control)e(surface)h(loading)p
+eop
+%%Page: 10 16
+10 15 bop 969 678 a Fi(Co)8 b(de)91 b(to)h(Co)8 b(de)91
+b(Compa)-8 b(risons)90 b(fo)-8 b(r)313 1026 y(Prelimina)g(ry)88
+b(Lo)8 b(ckheed{Ma)-8 b(rtin)93 b(X-33)f(V)-8 b(ehicle)146
+1632 y Fe(\017)83 b Fh(Co)6 b(des:)317 1865 y({)69 b(FELISA)p
+1171 1865 62 4 v 74 w(HYP:)g(inviscid,)h(unstructured)f(mesh)317
+2097 y({)g(LA)-6 b(URA:)70 b(viscous,)g(structured)e(grid)317
+2330 y({)h(DPLUR:)g(inviscid,)g(structured)g(grid,)g(pa)-6
+b(rallel)146 2612 y Fe(\017)83 b Fh(Flo)-6 b(w)69 b(feature,)f(surface)
+h(p)-6 b(ressure)69 b(compa)-6 b(risons:)317 2844 y({)69
+b Fc(M)658 2865 y Fa(1)857 2844 y Fh(=)49 b(9)p Fc(:)p
+Fh(8,)69 b Fc(\013)49 b Fh(=)f(40)2025 2786 y Fa(\016)146
+3127 y Fe(\017)83 b Fh(Aero)6 b(dynamic)67 b(fo)-6 b(rce)69
+b(and)g(moment)e(compa)-6 b(risons:)317 3359 y({)69 b
+Fc(M)658 3380 y Fa(1)857 3359 y Fh(=)49 b(4)p Fc(:)p
+Fh(5,)69 b(exp)6 b(erimental)66 b(data)i(from)g(LaRC)g(UPWT)p
+eop
+%%Page: 11 17
+11 16 bop 1677 1087 a Fi(X33)92 b(Con\014guration)189
+3039 y @beginspecial 144 @llx 367 @lly 488 @urx 602 @ury
+2914 @rwi @setspecial
+%%BeginDocument: smpfig.eps
+%!PS-Adobe-2.0 EPSF-1.2
+%%Creator:Adobe Illustrator(TM) 1.1
+%%For: (RICHARD A WHELESS) (NASA LANGLEY)
+%%Title: (EPS)
+%%CreationDate: (2/9/99) (3:01 PM)
+%%DocumentProcessColors: Black
+%%DocumentFonts: Courier-Bold
+%%DocumentProcSets: Adobe_Illustrator_1.1 0 0
+%%BoundingBox:144 367 488 602
+%%ColorUsage: Black&White
+%AI3_IncludePlacedImages
+%%TemplateBox:306 396 306 396
+%%TileBox: 30 31 582 761
+%%DocumentPreview: Header
+%%EndComments
+%%BeginProcSet:Adobe_Illustrator_1.1 0 0
+/Adobe_Illustrator_1.1 dup 100 dict def load begin
+/Version 0 def
+/Revision 0 def
+/bdef {bind def} bind def
+/ldef {load def} bdef
+/xdef {exch def} bdef
+/_K {3 index add neg dup 0 lt {pop 0} if 3 1 roll} bdef
+/_k /setcmybcolor where 
+{/setcmybcolor get} {{1 sub 4 1 roll _K _K _K setrgbcolor pop} bind} ifelse def
+/g {/_b xdef /p {_b setgray} def} bdef
+/G {/_B xdef /P {_B setgray} def} bdef
+/k {/_b xdef /_y xdef /_m xdef /_c xdef /p {_c _m _y _b _k} def} bdef
+/K {/_B xdef /_Y xdef /_M xdef /_C xdef /P {_C _M _Y _B _k} def} bdef
+/d /setdash ldef
+/_i currentflat def
+/i {dup 0 eq {pop _i} if setflat} bdef
+/j /setlinejoin ldef
+/J /setlinecap ldef
+/M /setmiterlimit ldef
+/w /setlinewidth ldef
+/_R {.25 sub round .25 add} bdef
+/_r {transform _R exch _R exch itransform} bdef
+/c {_r curveto} bdef
+/C /c ldef
+/v {currentpoint 6 2 roll _r curveto} bdef
+/V /v ldef
+/y {_r 2 copy curveto} bdef
+/Y /y ldef
+/l {_r lineto} bdef
+/L /l ldef
+/m {_r moveto} bdef
+/_e [] def
+/_E {_e length 0 ne {gsave 0 g 0 G 0 i 0 J 0 j 1 w 10 M [] 0 d
+/Courier 20 0 0 1 z [0.966 0.259 -0.259 0.966
+_e 0 get _e 2 get add 2 div _e 1 get _e 3 get add 2 div] e _f t T grestore} if} bdef
+/_fill {{fill} stopped
+{/_e [pathbbox] def /_f (ERROR: can't fill, increase flatness) def n _E} if} bdef
+/_stroke {{stroke} stopped
+{/_e [pathbbox] def /_f (ERROR: can't stroke, increase flatness) def n _E} if} bdef
+/n /newpath ldef
+/N /n ldef
+/F {p _fill} bdef
+/f {closepath F} bdef
+/S {P _stroke} bdef
+/s {closepath S} bdef
+/B {gsave F grestore S} bdef
+/b {closepath B} bdef
+/_s /ashow ldef
+/_S {(?) exch {2 copy 0 exch put pop dup false charpath currentpoint _g setmatrix
+_stroke _G setmatrix moveto 3 copy pop rmoveto} forall pop pop pop n} bdef
+/_A {_a moveto _t exch 0 exch} bdef
+/_L {0 _l neg translate _G currentmatrix pop} bdef
+/_w {dup stringwidth exch 3 -1 roll length 1 sub _t mul add exch} bdef
+/_z [{0 0} bind {dup _w exch neg 2 div exch neg 2 div} bind {dup _w exch neg exch neg} bind] def
+/z {_z exch get /_a xdef /_t xdef /_l xdef exch findfont exch scalefont setfont} bdef
+/_g matrix def
+/_G matrix def
+/_D {_g currentmatrix pop gsave concat _G currentmatrix pop} bdef
+/e {_D p /t {_A _s _L} def} bdef
+/r {_D P /t {_A _S _L} def} bdef
+/a {_D /t {dup p _A _s P _A _S _L} def} bdef
+/o {_D /t {pop _L} def} bdef
+/T {grestore} bdef
+/u {} bdef
+/U {} bdef
+/Z {findfont begin currentdict dup length dict begin
+{1 index /FID ne {def} {pop pop} ifelse} forall /FontName exch def dup length 0 ne
+{/Encoding Encoding 256 array copy def 0 exch {dup type /nametype eq
+{Encoding 2 index 2 index put pop 1 add} {exch pop} ifelse} forall} if pop
+currentdict dup end end /FontName get exch definefont pop} bdef
+end
+%%EndProcSet
+%%EndProlog
+%%BeginSetup
+Adobe_Illustrator_1.1 begin
+n
+%%BeginEncoding: _Courier-Bold Courier-Bold
+[39/quotesingle 96/grave 128/Adieresis/Aring/Ccedilla/Eacute/Ntilde/Odieresis
+/Udieresis/aacute/agrave/acircumflex/adieresis/atilde/aring/ccedilla/eacute
+/egrave/ecircumflex/edieresis/iacute/igrave/icircumflex/idieresis/ntilde
+/oacute/ograve/ocircumflex/odieresis/otilde/uacute/ugrave/ucircumflex
+/udieresis/dagger/degree/cent/sterling/section/bullet/paragraph/germandbls
+/registered/copyright/trademark/acute/dieresis/.notdef/AE/Oslash
+/.notdef/plusminus/.notdef/.notdef/yen/mu/.notdef/.notdef
+/.notdef/.notdef/.notdef/ordfeminine/ordmasculine/.notdef/ae/oslash
+/questiondown/exclamdown/logicalnot/.notdef/florin/.notdef/.notdef
+/guillemotleft/guillemotright/ellipsis/.notdef/Agrave/Atilde/Otilde/OE/oe
+/endash/emdash/quotedblleft/quotedblright/quoteleft/quoteright/divide
+/.notdef/ydieresis/Ydieresis/fraction/currency/guilsinglleft/guilsinglright
+/fi/fl/daggerdbl/periodcentered/quotesinglbase/quotedblbase/perthousand
+/Acircumflex/Ecircumflex/Aacute/Edieresis/Egrave/Iacute/Icircumflex
+/Idieresis/Igrave/Oacute/Ocircumflex/.notdef/Ograve/Uacute/Ucircumflex
+/Ugrave/dotlessi/circumflex/tilde/macron/breve/dotaccent/ring/cedilla
+/hungarumlaut/ogonek/caron
+]/_Courier-Bold/Courier-Bold Z
+%%EndEncoding
+%%EndSetup
+0 0 0 0 k
+0 0 0 1 K
+0 i
+0 J 0 j 1 w 4 M []0 d
+%%Note:
+487.5 367.5 m
+487.5 601.5 L
+145.5 601.5 L
+145.5 367.5 L
+487.5 367.5 L
+b
+145.5 601.5 m
+487 368 l
+B
+487 601.5 m
+145 368 l
+B
+0.5 w
+450.5 478 m
+450.5 494 L
+182 494 L
+182 478 L
+450.5 478 L
+b
+u
+0 0 0 1 k
+1 w
+/_Courier-Bold 12 14.5 0 0 z
+[1 0 0 1 187.402 482]e
+(Encapsulated Postscript \(EPS\) Figure)t
+T
+U
+%%PageTrailer
+%%Trailer
+_E end
+%%EOF
+
+%%EndDocument
+ @endspecial 2594 w @beginspecial 144 @llx 367 @lly 488
+@urx 602 @ury 2914 @rwi @setspecial
+%%BeginDocument: smpfig.eps
+%!PS-Adobe-2.0 EPSF-1.2
+%%Creator:Adobe Illustrator(TM) 1.1
+%%For: (RICHARD A WHELESS) (NASA LANGLEY)
+%%Title: (EPS)
+%%CreationDate: (2/9/99) (3:01 PM)
+%%DocumentProcessColors: Black
+%%DocumentFonts: Courier-Bold
+%%DocumentProcSets: Adobe_Illustrator_1.1 0 0
+%%BoundingBox:144 367 488 602
+%%ColorUsage: Black&White
+%AI3_IncludePlacedImages
+%%TemplateBox:306 396 306 396
+%%TileBox: 30 31 582 761
+%%DocumentPreview: Header
+%%EndComments
+%%BeginProcSet:Adobe_Illustrator_1.1 0 0
+/Adobe_Illustrator_1.1 dup 100 dict def load begin
+/Version 0 def
+/Revision 0 def
+/bdef {bind def} bind def
+/ldef {load def} bdef
+/xdef {exch def} bdef
+/_K {3 index add neg dup 0 lt {pop 0} if 3 1 roll} bdef
+/_k /setcmybcolor where 
+{/setcmybcolor get} {{1 sub 4 1 roll _K _K _K setrgbcolor pop} bind} ifelse def
+/g {/_b xdef /p {_b setgray} def} bdef
+/G {/_B xdef /P {_B setgray} def} bdef
+/k {/_b xdef /_y xdef /_m xdef /_c xdef /p {_c _m _y _b _k} def} bdef
+/K {/_B xdef /_Y xdef /_M xdef /_C xdef /P {_C _M _Y _B _k} def} bdef
+/d /setdash ldef
+/_i currentflat def
+/i {dup 0 eq {pop _i} if setflat} bdef
+/j /setlinejoin ldef
+/J /setlinecap ldef
+/M /setmiterlimit ldef
+/w /setlinewidth ldef
+/_R {.25 sub round .25 add} bdef
+/_r {transform _R exch _R exch itransform} bdef
+/c {_r curveto} bdef
+/C /c ldef
+/v {currentpoint 6 2 roll _r curveto} bdef
+/V /v ldef
+/y {_r 2 copy curveto} bdef
+/Y /y ldef
+/l {_r lineto} bdef
+/L /l ldef
+/m {_r moveto} bdef
+/_e [] def
+/_E {_e length 0 ne {gsave 0 g 0 G 0 i 0 J 0 j 1 w 10 M [] 0 d
+/Courier 20 0 0 1 z [0.966 0.259 -0.259 0.966
+_e 0 get _e 2 get add 2 div _e 1 get _e 3 get add 2 div] e _f t T grestore} if} bdef
+/_fill {{fill} stopped
+{/_e [pathbbox] def /_f (ERROR: can't fill, increase flatness) def n _E} if} bdef
+/_stroke {{stroke} stopped
+{/_e [pathbbox] def /_f (ERROR: can't stroke, increase flatness) def n _E} if} bdef
+/n /newpath ldef
+/N /n ldef
+/F {p _fill} bdef
+/f {closepath F} bdef
+/S {P _stroke} bdef
+/s {closepath S} bdef
+/B {gsave F grestore S} bdef
+/b {closepath B} bdef
+/_s /ashow ldef
+/_S {(?) exch {2 copy 0 exch put pop dup false charpath currentpoint _g setmatrix
+_stroke _G setmatrix moveto 3 copy pop rmoveto} forall pop pop pop n} bdef
+/_A {_a moveto _t exch 0 exch} bdef
+/_L {0 _l neg translate _G currentmatrix pop} bdef
+/_w {dup stringwidth exch 3 -1 roll length 1 sub _t mul add exch} bdef
+/_z [{0 0} bind {dup _w exch neg 2 div exch neg 2 div} bind {dup _w exch neg exch neg} bind] def
+/z {_z exch get /_a xdef /_t xdef /_l xdef exch findfont exch scalefont setfont} bdef
+/_g matrix def
+/_G matrix def
+/_D {_g currentmatrix pop gsave concat _G currentmatrix pop} bdef
+/e {_D p /t {_A _s _L} def} bdef
+/r {_D P /t {_A _S _L} def} bdef
+/a {_D /t {dup p _A _s P _A _S _L} def} bdef
+/o {_D /t {pop _L} def} bdef
+/T {grestore} bdef
+/u {} bdef
+/U {} bdef
+/Z {findfont begin currentdict dup length dict begin
+{1 index /FID ne {def} {pop pop} ifelse} forall /FontName exch def dup length 0 ne
+{/Encoding Encoding 256 array copy def 0 exch {dup type /nametype eq
+{Encoding 2 index 2 index put pop 1 add} {exch pop} ifelse} forall} if pop
+currentdict dup end end /FontName get exch definefont pop} bdef
+end
+%%EndProcSet
+%%EndProlog
+%%BeginSetup
+Adobe_Illustrator_1.1 begin
+n
+%%BeginEncoding: _Courier-Bold Courier-Bold
+[39/quotesingle 96/grave 128/Adieresis/Aring/Ccedilla/Eacute/Ntilde/Odieresis
+/Udieresis/aacute/agrave/acircumflex/adieresis/atilde/aring/ccedilla/eacute
+/egrave/ecircumflex/edieresis/iacute/igrave/icircumflex/idieresis/ntilde
+/oacute/ograve/ocircumflex/odieresis/otilde/uacute/ugrave/ucircumflex
+/udieresis/dagger/degree/cent/sterling/section/bullet/paragraph/germandbls
+/registered/copyright/trademark/acute/dieresis/.notdef/AE/Oslash
+/.notdef/plusminus/.notdef/.notdef/yen/mu/.notdef/.notdef
+/.notdef/.notdef/.notdef/ordfeminine/ordmasculine/.notdef/ae/oslash
+/questiondown/exclamdown/logicalnot/.notdef/florin/.notdef/.notdef
+/guillemotleft/guillemotright/ellipsis/.notdef/Agrave/Atilde/Otilde/OE/oe
+/endash/emdash/quotedblleft/quotedblright/quoteleft/quoteright/divide
+/.notdef/ydieresis/Ydieresis/fraction/currency/guilsinglleft/guilsinglright
+/fi/fl/daggerdbl/periodcentered/quotesinglbase/quotedblbase/perthousand
+/Acircumflex/Ecircumflex/Aacute/Edieresis/Egrave/Iacute/Icircumflex
+/Idieresis/Igrave/Oacute/Ocircumflex/.notdef/Ograve/Uacute/Ucircumflex
+/Ugrave/dotlessi/circumflex/tilde/macron/breve/dotaccent/ring/cedilla
+/hungarumlaut/ogonek/caron
+]/_Courier-Bold/Courier-Bold Z
+%%EndEncoding
+%%EndSetup
+0 0 0 0 k
+0 0 0 1 K
+0 i
+0 J 0 j 1 w 4 M []0 d
+%%Note:
+487.5 367.5 m
+487.5 601.5 L
+145.5 601.5 L
+145.5 367.5 L
+487.5 367.5 L
+b
+145.5 601.5 m
+487 368 l
+B
+487 601.5 m
+145 368 l
+B
+0.5 w
+450.5 478 m
+450.5 494 L
+182 494 L
+182 478 L
+450.5 478 L
+b
+u
+0 0 0 1 k
+1 w
+/_Courier-Bold 12 14.5 0 0 z
+[1 0 0 1 187.402 482]e
+(Encapsulated Postscript \(EPS\) Figure)t
+T
+U
+%%PageTrailer
+%%Trailer
+_E end
+%%EOF
+
+%%EndDocument
+ @endspecial eop
+%%Page: 11 18
+11 17 bop 303 1553 a Fi(Co)8 b(de)92 b(to)f(Co)8 b(de)92
+b(Compa)-8 b(risons)89 b(fo)-8 b(r)93 b(Prelimina)-8
+b(ry)979 1901 y(Lo)8 b(ckheed{Ma)-8 b(rtin)93 b(X-33)e(V)-8
+b(ehicle)146 2507 y Fe(\017)83 b Fh(mention)68 b(co)6
+b(de)69 b(autho)-6 b(rs)p eop
+%%Page: 12 19
+12 18 bop 726 652 a Fi(Grid)90 b(Generation)i(Time)d(Compa)-8
+b(risons)146 1258 y Fe(\017)83 b Fh(Initial)68 b(geometry)f
+(de\014nition,)j(surface)e(and)h(volume)f(mesh)317 1490
+y(generation)h(fo)-6 b(r)69 b(an)g(X-33)g(con\014guration,)h(\014rst)f
+(time)e Fe(k)317 1723 y Fh(most)h(recent:)370 2005 y
+Ff({)82 b Fh(FELISA:)69 b(1.5)h(w)-6 b(eeks)68 b Fe(k)g
+Fh(4)i(da)-6 b(ys)370 2287 y Ff({)82 b Fh(structured:)92
+b(6)69 b(w)-6 b(eeks)69 b Fe(k)f Fh(3.5)i(w)-6 b(eeks)146
+2570 y Fe(\017)83 b Fh(Case-sp)6 b(eci\014c)68 b(grid)h(generation:)92
+b(b)6 b(o)-6 b(w)70 b(sho)6 b(ck)68 b(spacing:)93 b(time)317
+2802 y(consuming)65 b(fo)-6 b(r)65 b(FELISA,)f(1-2)h(da)-6
+b(ys)64 b(control)h(surface)f(de\015ections:)370 3084
+y Ff({)82 b Fh(1)p Fc(=)p Fh(2)70 b(da)-6 b(y)68 b(fo)-6
+b(r)70 b(unstructured)370 3367 y Ff({)82 b Fh(1)p Fc(=)p
+Fh(2)70 b(w)-6 b(eek)68 b(fo)-6 b(r)69 b(LA)-6 b(URA)p
+eop
+%%Page: 12 20
+12 19 bop 726 1702 a Fi(Grid)90 b(Generation)i(Time)d(Compa)-8
+b(risons)2 2092 y Ff(felisa:)95 b Fh(put)69 b(together)f(surfaces,)h
+(intersection)g(curves,)g(top)6 b(ology)2 2358 y Ff(laura:)110
+b Fh(build)69 b(surface)g(on)g(cad)p eop
+%%Page: 13 21
+13 20 bop 1564 1035 a Fi(Concluding)90 b(Rema)-8 b(rks)146
+1641 y Fe(\017)83 b Fh(FELISA)p 999 1641 62 4 v 74 w(HYP)69
+b(\015o)-6 b(w)69 b(solver)g(develop)6 b(ed)146 1923
+y Fe(\017)83 b Fh(Applied)70 b(FELISA)e(System)f(with)h(FELISA)p
+3545 1923 V 73 w(HYP)h(to)g(complex)317 2155 y(con\014gurations)370
+2438 y Ff({)82 b Fh(Compa)-6 b(rable)68 b(accuracy)f(to)i(structured)f
+(grid)i(solvers)370 2720 y Ff({)82 b Fh(F)-6 b(aster)68
+b(turn{a)-6 b(round)70 b(time)d(than)i(structured)f(grid)i(metho)6
+b(ds)146 3002 y Fe(\017)83 b Fh(Signi\014cant)69 b(impact)d(on)k(majo)
+-6 b(r)67 b(NASA)i(p)-6 b(rograms)p eop
+%%Trailer
+end
+userdict /end-hook known{end-hook}if
+%%EOF
diff --git a/Master/texmf-dist/doc/latex/aiaa/pre2004/demos/talk/smptalk.ps.gz b/Master/texmf-dist/doc/latex/aiaa/pre2004/demos/talk/smptalk.ps.gz
new file mode 100644
index 00000000000..97654c0c43a
--- /dev/null
+++ b/Master/texmf-dist/doc/latex/aiaa/pre2004/demos/talk/smptalk.ps.gz
diff --git a/Master/texmf-dist/doc/latex/aiaa/pre2004/demos/talk/smptalk.sty b/Master/texmf-dist/doc/latex/aiaa/pre2004/demos/talk/smptalk.sty
new file mode 100644
index 00000000000..585f5ce0b89
--- /dev/null
+++ b/Master/texmf-dist/doc/latex/aiaa/pre2004/demos/talk/smptalk.sty
@@ -0,0 +1,97 @@
+%
+% `smptalk.sty' custom commands and settings used to make slides
+%
+% for use with `smptalk.tex' via \usepackage{smptalk}
+%
+% this is an example of a `package'. in this case, it merely
+% defines some macros which are useful when making slides.
+% one doesn't really need the next three, or the last command
+% in this package, these are just formalities.
+
+\NeedsTeXFormat{LaTeX2e}
+\ProvidesPackage{smptalk}[1997/02/20 v0.1a Sample user-developed package (BK)]
+\typeout{Package: smptalk v0.1a <1997/02/20> (Bil Kleb)}
+
+% turn off page numbers:
+
+\pagestyle{empty}
+
+% in general, we don't want filled and hyphenated output on slides:
+
+\raggedright
+
+% make sure we have the graphicx package loaded
+% since it is used to include figures:
+
+\RequirePackage{graphicx}
+
+% define a command to include figures:
+% use: \incfig{epsfigure} or \incfig[2in]{epsfigure}
+
+\newcommand{\incfig}%             - name of command
+           [2]%                   - number of arguments
+           [\linewidth]%          - default value for optional 1st argument
+           {%                     - begin definition
+            \centering%           - center figure
+            \includegraphics%     - graphicx's include command
+               [width=#1,%        - set graphic width
+                keepaspectratio]% - leave aspect ratio alone
+               {#2}%              - name of figure
+           }%                     - end definition
+
+% un-comment one of the following to use Helvetica or Times
+% fonts in place of Computer Modern (requires psfont distribution):
+%\RequirePackage{times}
+%\RequirePackage{helvetic}
+
+% redefine an old command to make titles for each slide:
+% use: \title{This is the Large, Centered Slide Title}
+
+\renewcommand{\title}%     - name of command
+             [1]%          - number of arguments
+             {%            - begin definition
+              \bgroup%     - begin a local group
+              \centering%  - turn on centering
+              \large\bf%   - select font
+              #1%          - insert title text
+              \par%        - end a paragraph (skip \parsep)
+              \egroup%     - terminate local group
+             }%            - complete definition
+
+% define new itemize-like environment
+% to make the vertical spacing tighter:
+
+\newenvironment{items}%                  - define a new environment
+  {%                                     - begin beginning definition
+   \begin{itemize}%                      - revamp the itemize environment
+   \raggedright%                         - don't hyphenate/fill lines
+   \setlength{\itemsep}%                 - space between items
+             {2pt plus 2pt minus 1pt}%     (rubber length)
+   \setlength{\parskip}%                 - space between list and body
+             {4pt plus 2pt minus 2pt}%     (rubber length)
+   \setlength{\parsep}%                  - paragraphs within items
+             {2pt plus 2pt minus 1pt}%     (rubber length)
+  }%                                     - close beginning definition
+  {\end{itemize}}%                       - ending definition
+
+% make a description-like environment which
+% justifies the labels according to an optional
+% parameter and allows hyphenation of the labels
+
+\newenvironment{describe}[1][1.25in]%
+  {\begin{list}{}%
+   {\renewcommand{\makelabel}{\describelabel}%
+       \setlength{\labelwidth}{#1}%
+       \setlength{\leftmargin}{\labelwidth}%
+       \addtolength{\leftmargin}{\labelsep}%
+       \setlength{\itemsep}{2pt plus 2pt minus 1pt}%
+       \setlength{\parskip}{4pt plus 2pt minus 2pt}%
+       \setlength{\parsep}{2pt plus 2pt minus 1pt}}}%
+  {\end{list}}
+\newcommand{\describelabel}[1]%
+  {\raisebox{0pt}[1ex][0pt]{\makebox[\labelwidth][l]%
+      {\parbox[t]{\labelwidth}{\hspace{0pt}\textbf{#1:}}}}}
+
+% tell them we're through messing around, and get on with it:
+
+\endinput
+\ No newline at end of file
diff --git a/Master/texmf-dist/doc/latex/aiaa/pre2004/demos/talk/smptalk.tex b/Master/texmf-dist/doc/latex/aiaa/pre2004/demos/talk/smptalk.tex
new file mode 100644
index 00000000000..4dba1b85ff5
--- /dev/null
+++ b/Master/texmf-dist/doc/latex/aiaa/pre2004/demos/talk/smptalk.tex
@@ -0,0 +1,296 @@
+%
+%  'smptalk.tex' sample slide presentation - courtesy of karen bibb
+%
+%  typical (unix) processing sequence for postscript printer:
+%
+%    latex smptalk                         - create dvi file
+%    xdvi -paper usr smptalk               - preview dvi file
+%    dvips -t landscape smptalk            - transform dvi file to postscript
+%    ghostview -landscape -swap smptalk.ps - check postscript output
+%    lpr smptalk.ps                        - print postscript file
+
+\documentclass[landscape]{slides}
+
+% load custom command definitions and other default settings:
+\usepackage{smptalk}
+
+% un-comment for ``page'' numbers:
+%\pagestyle{plain}
+
+% un-comment for processing only a select few slides or notes:
+%\onlyslides{1-2,5,10-999}
+%\onlynotes{1-2,12}
+% or, for interactive prompting, un-comment the following:
+%\typein[\slides]{Which slides to do?}
+%\onlyslides{\slides}
+%\onlynotes{\slides}
+
+\begin{document}
+
+\begin{slide}\typeout{Title:}
+  \begin{center}
+    {\Large\bf Hypersonic Flow Computations On Unstructured Meshes}
+
+    {\large\bf AIAA 97--0625}
+
+    \begin{tabular}{cc}
+      K. L. Bibb                & J. Peraire               \\[.1in]
+      \it NASA Langley Research & \it Massachusetts Institute  \\
+      \it Center                & \it of Technology           \\
+      \it Hampton, Virginia     & \it Cambridge, Massachusetts
+    \end{tabular}
+
+    C. J. Riley \\[.1in]
+    \it NASA Langley Research Center \\
+        Hampton, Virginia
+  \end{center}
+\end{slide}
+
+\begin{note}
+  \begin{describe}[1.5in]
+    \item [Session] Applied Computational Aero
+    \item [Time] wed afternoon
+    \item [Mention] colleagues
+          \begin{items} 
+             \item Ram Prabhu for running codes
+             \item Bill Scallion \& Matt Rhode for UPWT data
+          \end{items}
+  \end{describe}
+\end{note}
+
+\begin{slide}\typeout{Background:}
+  \title{Background}
+  \begin{items}
+    \item Rapid, accurate aerodynamic screening capability is
+          needed:
+          \begin{items}
+            \item aerodynamic performance coefficients
+            \item pressure loads for preliminary structural analysis
+            \item general flow features, for example, shock location
+          \end{items}
+    \item Unstructured grids offer flexible and rapid grid generation
+    \item Historically, unstructured Euler schemes
+          are not robust hypersonically
+  \end{items}
+\end{slide}
+
+\begin{slide}\typeout{Outline:}
+  \title{Outline}
+  \leftmargin 3in
+  \begin{items}
+    \item Computational algorithm
+    \item Comparisons to other codes\\
+          and experiment
+    \item Use as a screening tool
+    \item Concluding remarks
+  \end{items}
+\end{slide}
+
+\begin{note}
+  \begin{items}
+     \item details are in the paper for the algorithm
+     \item screening tools are talked about throughout
+  \end{items}
+\end{note}
+
+\begin{slide}\typeout{Flow solver (overview):}
+  \title{FELISA System}
+  \begin{items} 
+    \item Unstructured mesh generation
+    \item `Standard' Euler flow solver, 
+          for subsonic $\Rightarrow$ low supersonic
+    \item Hypersonic Euler flow solver, FELISA\_HYP
+          \begin{items}
+            \item perfect gas
+            \item equilibrium air
+            \item CF$_4$
+          \end{items}
+    \item Parallel versions of flow solvers
+  \end{items}
+\end{slide}
+
+\begin{note}
+  \begin{items}
+    \item for parallel:  work on IBM sP2, J90, workstation clusters.
+    \item not used for the calculations in the paper
+  \end{items}
+\end{note}
+
+\begin{slide}\typeout{Flow solver (FELISA):}
+
+  \title{Unstructured Inviscid\\ Hypersonic Flow Solver\\ (FELISA\_HYP)}
+  \leftmargin 3in
+  \begin{items}
+    \item Euler equations
+    \item Finite volume formulation
+    \item Edge data structure
+    \item H\"{a}nel flux vector splitting
+    \item MUSCL reconstruction
+    \item Explicit time stepping
+  \end{items}
+\end{slide}
+
+\begin{note}
+  \title{Time Stepping}
+  \leftmargin 2.5in
+  \begin{items}
+    \item check to ensure monotonicity
+    \item eliminate limit cycle behavior
+  \end{items}
+\end{note}
+
+\begin{slide}\typeout{Edge Data Structure:}
+  \title{Edge Data Structure}
+  \begin{center}
+    \begin{minipage}{.45\linewidth}
+      \incfig[\linewidth]{smpfig}
+    \end{minipage}
+    \hspace{0.05\linewidth}
+    \begin{minipage}{.45\linewidth}
+      \begin{items}
+        \item control volumes are tetrahedra surrounding each node
+        \item fluxes computed across outer faces of control volume
+        \item flux computations grouped by edge
+      \end{items}
+    \end{minipage}
+  \end{center}
+\end{slide}
+
+\begin{note}
+  \title{Old Edge Data Structure notes\ldots}
+  \leftmargin 2in
+  \begin{items}
+    \item edge il is used in all of the figures\ldots\
+  \end{items}
+  \leftmargin 0in
+  \begin{tabular}{p{.45\linewidth}p{.45\linewidth}}
+    \begin{items}
+      \item fluxes computed across faces of tetrahedra 
+      \item control volume is tetrahedra 
+      \item nodal info for cells is stored
+    \end{items}&
+    \begin{items}
+      \item fluxes computed across $S^e$ for all edges of node~$i$
+      \item control volume surrounds node
+      \item weights for $S^e$ stored
+    \end{items}
+  \end{tabular}
+\end{note}
+
+\begin{slide}
+  \typeout{Flux vector splitting:}
+  \title{H\"anel Flux Vector Splitting}
+  \begin{items}
+    \item Upwind formulation; allows for stable computations
+          across strong shocks
+    \item No 'free' parameters are required
+    \item Allows for constant enthalpy solution where solution is
+          fully converged 
+  \end{items}
+\end{slide}
+
+\begin{slide}\typeout{Reconstruction:}
+  \title{Gradient Reconstruction}
+  \incfig[.8\linewidth]{smpfig}
+\end{slide}
+
+\begin{note}
+  \title{Gradient Reconstruction notes}
+  \begin{items}
+    \item compare to structured grid gradient calculation\\ 
+    \item edge il is used in all of the figures...\\
+    \item MUSCL reconstruction
+          (Monotone Upwind Scheme Conservation Law)
+  \end{items}
+\end{note}
+
+\begin{slide}\typeout{NASA's use of FELISA:}
+  \title{Recent Applications of the FELISA System}
+  \leftmargin 1in
+  \begin{items}
+    \item Lockheed-Martin RLV/X-33 Phase I; aerodynamics
+    \item Lockheed-Martin RLV/X-33 Phase II; 
+          Ascent shock interaction study; transonic aerodynamic screening
+    \item McDonnell Douglas Phase I RLV/X-33;
+          control surface loading (NASA CR 201606)
+          and aerodynamics\\
+          (subsonic $\Rightarrow$ hypersonic)  
+    \item OSC X-34, transonic screening, control surface loading
+  \end{items}
+\end{slide}
+
+\begin{slide}\typeout{X-33 body:}
+  \title{Code to Code Comparisons for\\
+         Preliminary Lockheed--Martin X-33 Vehicle}
+  \begin{items}
+    \item Codes:\\
+      -- FELISA\_HYP:  inviscid, unstructured mesh\\
+      -- LAURA:  viscous, structured grid\\
+      -- DPLUR:  inviscid, structured grid, parallel
+    \item Flow feature, surface pressure comparisons:\\
+      -- $M_\infty = 9.8$, $\alpha = 40^{\circ}$
+    \item Aerodynamic force and moment comparisons:\\
+      -- $M_\infty = 4.5$, experimental data from LaRC UPWT
+  \end{items}
+\end{slide}
+
+\begin{slide}
+  \title{X33 Configuration}
+  \begin{center}
+    \begin{tabular}{cc}
+      \incfig[.45\linewidth]{smpfig}&
+      \incfig[.45\linewidth]{smpfig}
+    \end{tabular}
+  \end{center}
+\end{slide}
+
+\begin{note}
+  \title{Code to Code Comparisons for
+         Preliminary Lockheed--Martin X-33 Vehicle}
+  \leftmargin 3in
+  \begin{items}
+    \item mention code authors
+  \end{items}
+\end{note}
+
+\begin{slide}\typeout{How has FELISAHYP been used?}
+  \title{Grid Generation Time Comparisons}
+  \begin{items}
+    \item Initial geometry definition, surface and volume mesh generation
+          for an X-33 configuration, first~time~$\|$ most~recent:
+          \begin{items}
+            \item FELISA:  1.5 weeks $\|$ 4 days
+            \item structured: 6 weeks $\|$ 3.5 weeks
+          \end{items}
+    \item Case-specific grid generation:
+          bow shock spacing: time consuming for FELISA, 1-2 days
+          control surface deflections:
+          \begin{items}
+            \item $1/2$ day for unstructured
+            \item $1/2$ week for LAURA 
+          \end{items}
+  \end{items}
+\end{slide}
+
+\begin{note}
+  \title{Grid Generation Time Comparisons}
+  \begin{describe}[.9in]
+    \item[felisa] put together surfaces, intersection curves, topology
+    \item[laura] build surface on cad
+  \end{describe}
+\end{note}
+
+\begin{slide}\typeout{Concluding Remarks:}
+  \title{Concluding Remarks}
+  \begin{items}
+    \item FELISA\_HYP flow solver  developed\\
+    \item Applied FELISA System with FELISA\_HYP to complex \\configurations
+          \begin{items}
+            \item Comparable accuracy to structured grid solvers
+            \item Faster turn--around time than structured grid methods
+          \end{items}
+    \item Significant impact on major NASA programs
+  \end{items}
+\end{slide}
+
+\end{document}
diff --git a/Master/texmf-dist/doc/latex/aiaa/template_advanced.pdf b/Master/texmf-dist/doc/latex/aiaa/template_advanced.pdf
new file mode 100644
index 00000000000..6f8e903369a
--- /dev/null
+++ b/Master/texmf-dist/doc/latex/aiaa/template_advanced.pdf
diff --git a/Master/texmf-dist/doc/latex/aiaa/template_advanced.tex b/Master/texmf-dist/doc/latex/aiaa/template_advanced.tex
new file mode 100644
index 00000000000..a8631d4c374
--- /dev/null
+++ b/Master/texmf-dist/doc/latex/aiaa/template_advanced.tex
@@ -0,0 +1,254 @@
+%
+% `template_advanced.tex' - An advanced example of using the AIAA class.
+%                           For a bare-bones usage, see `template_basic.tex'.
+%
+% Typical processing for PostScript (PS) output:
+%
+%  latex template_advanced
+%  bibtex template_advanced  (bibliography)
+%  makeindex -s nomencl.ist -o template_advanced.gls template_advanced.glo
+%                            (nomenclature)
+%  latex template_advanced   (repeat as needed to resolve references)
+%
+%  xdvi template_advanced    (onscreen draft display)
+%  dvips template_advanced   (postscript)
+%  gv template_advanced.ps   (onscreen display)
+%  lpr template_advanced.ps  (hardcopy)
+%
+% With the above, only Encapsulated PostScript (EPS) images can be used.
+%
+% Typical processing for Portable Document Format (PDF) output:
+%
+%  pdflatex template_advanced
+%  bibtex template_advanced    (bibliography)
+%  makeindex -s nomencl.ist -o template_advanced.gls template_advanced.glo
+%                              (nomenclature)
+%  pdflatex template_advanced  (repeat as needed to resolve references)
+%
+%  acroread template_advanced.pdf  (onscreen display)
+%
+% If you have EPS figures, you will need to use the epstopdf script
+% to convert them to PDF because PDF is a limmited subset of EPS.
+% pdflatex accepts a variety of other image formats such as JPG, TIFF,
+% PNG, and so forth -- check the documentation for your version.
+%
+% If you do *not* specify suffixes when using the graphicx package's
+% \includegraphics command, latex and pdflatex will automatically select
+% the appropriate figure format from those available.  This allows you
+% to produce PS and PDF output from the same LaTeX source file.
+%
+% To generate a large format (e.g., 11"x17") PostScript copy for editing
+% purposes, use
+%
+%  dvips -x 1467 -O -0.65in,0.85in -t tabloid template_advanced
+%
+% For further details and support, read the Users Manual, aiaa.pdf.
+%
+% This software is released under the terms of the LaTeX Project Public
+% License.  Copyright (C) 2004 by Bil Kleb, Bill Wood, and Erich Knausenberger.
+
+
+\documentclass{aiaa-tc}% insert '[draft]' option to show overfull boxes
+
+ \usepackage{varioref}%  smart page, figure, table, and equation referencing
+ \usepackage{wrapfig}%   wrap figures/tables in text (i.e., Di Vinci style)
+ \usepackage{threeparttable}% tables with footnotes
+ \usepackage{dcolumn}%   decimal-aligned tabular math columns
+  \newcolumntype{d}{D{.}{.}{-1}}
+ \usepackage{nomencl}%   nomenclature generation via makeindex
+  \makeglossary
+ \usepackage{subfigure}% subcaptions for subfigures
+ \usepackage{subfigmat}% matrices of similar subfigures, aka small mulitples
+ \usepackage{fancyvrb}%  extended verbatim environments
+  \fvset{fontsize=\footnotesize,xleftmargin=2em}
+ \usepackage{lettrine}%  dropped capital letter at beginning of paragraph
+ \usepackage[dvips]{dropping}% alternative dropped capital package
+ \usepackage[colorlinks]{hyperref}%  hyperlinks [must be loaded after dropping]
+
+ \title{Advanced AIAA Technical Conference Paper Template}
+
+ \author{
+  First A. Author\thanks{Job Title, Department, Address, and AIAA Member Grade.}
+  \ and Second B. Author\thanksibid{1}\\
+  {\normalsize\itshape
+   Business or Academic Affiliation, City, Province, Zipcode, Country}\\
+  \and
+  Third C. Author\thanks{Job Title, Department, Address,
+                         and AIAA Member Grade.}\\
+  {\normalsize\itshape
+  Business or Academic Affiliation, City, Province, Zipcode, Country}
+ }
+
+ % Data used by 'handcarry' option
+ \AIAApapernumber{YEAR-NUMBER}
+ \AIAAconference{Conference Name, Date, and Location}
+ \AIAAcopyright{\AIAAcopyrightD{YEAR}}
+
+ % Define commands to assure consistent treatment throughout document
+ \newcommand{\eqnref}[1]{(\ref{#1})}
+ \newcommand{\class}[1]{\texttt{#1}}
+ \newcommand{\package}[1]{\texttt{#1}}
+ \newcommand{\file}[1]{\texttt{#1}}
+ \newcommand{\BibTeX}{\textsc{Bib}\TeX}
+
+\begin{document}
+
+\maketitle
+
+\begin{abstract}
+This is the advanced \LaTeX\ template of an AIAA technical conference paper.
+It is intended to demonstrate advanced \LaTeX\ capabilities for
+producing an AIAA technical conference paper.
+Fundamental topics are covered in the bare-bones template.
+For detailed AIAA layout and style guidelines, please refer to the AIAA
+\LaTeX\ Package Users Manual, \file{aiaa.pdf}.
+\end{abstract}
+
+\printglossary% creates nomenclature section produced by MakeIndex
+
+\section{Introduction}
+
+\lettrine[nindent=0pt]{T}{his} is an example of a dropped capital letter
+at the beginning of a paragraph using the \package{lettrine} package.
+This package is usually included with the more comprehensive \TeX\
+distributions, but those with more trim installations may need to
+retrieve this package from the Comprehensive \TeX\ Archive Network
+(CTAN), which is located at \href{http://www.ctan.org}{www.ctan.org}.
+This package does not gracefully handle the AIAA class' \verb|submit|
+option.
+
+\dropping{2}{A}{\textsc{nd}} this is an example of a dropped capital
+letter at the beginning of a paragraph using the \package{dropping}
+package.
+This package is a bit less refined than the \package{lettrine} package,
+but some authors may already have it around if they used the old
+(unofficial) \LaTeX\ AIAA distribution.
+This package accommodates the AIAA class' \verb|submit| option.
+
+\begin{wrapfigure}{R}{0.3\linewidth}
+ \includegraphics{figure_magnet}
+ \caption{Magnetization as a function of applied field.}
+ \label{f:magnetic_field}
+\end{wrapfigure}
+
+In an effort to more tightly integrate text and image, the
+\package{wrapfig} package is employed.
+This package works by modifying paragraph shape to accommodate a figure
+(or a table or other items).
+Typically one inserts its \verb|wrapfigure| or \verb|wraptable|
+environment just before the paragraph in which it is to be placed.
+Also specified is the width of the item to be inserted and the
+placement, for example, left or right side.
+(This package does not provide for center placement.)
+The rest of this paragraph is filler so that the \verb|wrapfigure|
+example will be placed in this paragraph.
+Documentation of the \package{wrapfigure} package is available at the
+end of the style file itself (check the package loading lines shown
+during \LaTeX\ processing to find its location).
+
+Code listings and other such artifacts can be typeset in a large variety
+of styles by using the \package{fancyvrb} package.
+\begin{Verbatim}[numbers=left]
+ def testCircularAdvection
+  position.each_index do |i|
+   @position = position[i]
+   assert_equal speed[i], waveSpeed
+  end
+ end
+\end{Verbatim}
+
+Tables with footnotes, such as table~\vref{t:threepart},
+can be coded using the \package{threeparttable} package.
+Note: This table was purposely placed on another page through the use of
+the \verb|[p]| placement specifier to demonstrate the automated page
+reference mechanism provided by the \package{varioref} package.
+Of course, one would normally have the table integrated into the text
+that describes it.
+\begin{table}[p]
+ \begin{center}
+  \begin{threeparttable}
+   \caption{This is an example of a \package{threeparttable} which uses the
+     \package{dcolumn} package to allow for columns to be aligned on decimal
+     points.}
+   \label{t:threepart}
+   \begin{tabular}{lcdd}
+    First head\tnote{*}  &
+    Second head &
+    \multicolumn{1}{c}{Third head} &
+    \multicolumn{1}{c}{$V_M(r)$} \\\hline
+    center & doctor &  0.2  & 10.55 \\  
+    tab    & dentist &  0.15 & 33.12 \\ 
+    worse  & man\tnote{\ensuremath{\dagger}} & 10.58 & 45.10 \\ 
+    better & home & 43.9  & 12.34 \\
+   \end{tabular}
+   \begin{tablenotes}
+    \item[*] This is a table footnote, which to span multiple lines, has
+      been greatly extended in length contrary to reason.
+    \item[\ensuremath{\dagger}] A much shorter table footnote.
+   \end{tablenotes}
+  \end{threeparttable}
+ \end{center}
+\end{table}
+
+Equation~\eqnref{e:displace} is serving as a demonstration of the
+\package{nomenclature} package.
+\begin{equation}
+  \label{e:displace}
+  \mathbf{J}_i\cdot\Delta\underline{x}_{i+1}=-\underline{f}_i
+\end{equation}%
+\nomenclature{$J$}{Jacobian Matrix}%
+\nomenclature[b$i$]{$i$}{Variable number}%
+\nomenclature[g$\Delta$]{$\Delta x$}{Variable displacement vector}%
+\nomenclature{$f$}{Residual value vector}%
+\nomenclature{$x$}{Variable value vector}%
+The same can be said for Eq.~\eqnref{e:newton} that uses $\alpha$ to add
+another Greek letter to the mix.
+\begin{equation}
+  \label{e:newton}
+  F=m\alpha
+\end{equation}%
+\nomenclature{$F$}{Force, N}%
+\nomenclature{$m$}{Mass, kg}%
+\nomenclature[g$\alpha$]{$\alpha$}{Acceleration, m/s\textsuperscript{2}}%
+The \package{nomencl} package is fed entries with the
+\verb|\nomenclature| command.
+These entries are then collected and sorted using \verb|makeindex|.
+The optional sorting argument to the \verb|\nomenclature| command uses
+a key of `b' for subscripts, `g' for Greek symbols, `c' for conventions,
+and `t' for superscripts.
+
+When many figures share a similar style and beg to be compared to one
+another, the \package{subfigmat} and \package{subfigure} packages can be
+used to create a matrix of subfigures as shown by
+figure~\vref{f:small_multiple}.
+\begin{figure}
+ \begin{subfigmatrix}{4}% number of columns
+  \subfigure[2 AM.]{\includegraphics{figure_magnet}}
+  \subfigure[3 AM.]{\includegraphics{figure_magnet}}
+  \subfigure[4 AM.]{\includegraphics{figure_magnet}}
+  \subfigure[5 AM.]{\includegraphics{figure_magnet}}
+  \subfigure[6 AM.]{\includegraphics{figure_magnet}}
+  \subfigure[7 AM.]{\includegraphics{figure_magnet}}
+  \subfigure[8 AM.]{\includegraphics{figure_magnet}}
+  \subfigure[9 AM.]{\includegraphics{figure_magnet}}
+ \end{subfigmatrix}
+ \caption{A time series shown of magnetic field that does not change
+          because we are using the same figure each time.}
+ \label{f:small_multiple}
+\end{figure}
+These are called ``small multiples'' by Tufte.\cite{tufte:83bk}
+
+\section{Conclusion}
+
+This had been a brief example of some of the more advanced options
+available for \LaTeX.
+Please see the documentation for each package for extended discussion or
+usage.
+
+% produces the bibliography section when processed by BibTeX
+\bibliography{bibtex_database}
+\bibliographystyle{aiaa}
+
+\end{document}
+
+% $Id: template_advanced.tex,v 1.6 2004/05/23 12:49:44 kleb Exp $
diff --git a/Master/texmf-dist/doc/latex/aiaa/template_basic.pdf b/Master/texmf-dist/doc/latex/aiaa/template_basic.pdf
new file mode 100644
index 00000000000..3888ed660c6
--- /dev/null
+++ b/Master/texmf-dist/doc/latex/aiaa/template_basic.pdf
diff --git a/Master/texmf-dist/doc/latex/aiaa/template_basic.tex b/Master/texmf-dist/doc/latex/aiaa/template_basic.tex
new file mode 100644
index 00000000000..2ec4f957f1e
--- /dev/null
+++ b/Master/texmf-dist/doc/latex/aiaa/template_basic.tex
@@ -0,0 +1,197 @@
+%
+% `template_basic.tex' - A bare-bones example of using the AIAA class.
+%                        For a more advanced usage, see `template_advanced.tex'.
+%
+% Typical processing for PostScript (PS) output:
+%
+%  latex template_basic
+%  latex template_basic   (repeat as needed to resolve references)
+%
+%  xdvi template_basic    (onscreen draft display)
+%  dvips template_basic   (postscript)
+%  gv template_basic.ps   (onscreen display)
+%  lpr template_basic.ps  (hardcopy)
+%
+% With the above, only Encapsulated PostScript (EPS) images can be used.
+%
+% Typical processing for Portable Document Format (PDF) output:
+%
+%  pdflatex template_basic
+%  pdflatex template_basic      (repeat as needed to resolve references)
+%
+%  acroread template_basic.pdf  (onscreen display)
+%
+% If you have EPS figures, you will need to use the epstopdf script
+% to convert them to PDF because PDF is a limmited subset of EPS.
+% pdflatex accepts a variety of other image formats such as JPG, TIF,
+% PNG, and so forth -- check the documentation for your version.
+%
+% If you do *not* specify suffixes when using the graphicx package's
+% \includegraphics command, latex and pdflatex will automatically select
+% the appropriate figure format from those available.  This allows you
+% to produce PS and PDF output from the same LaTeX source file.
+%
+% To generate a large format (e.g., 11"x17") PostScript copy for editing
+% purposes, use
+%
+%  dvips -x 1467 -O -0.65in,0.85in -t tabloid template_basic
+%
+% For further details and support, read the Users Manual, aiaa.pdf.
+%
+% This software is released under the terms of the LaTeX Project Public
+% License.  Copyright (C) 2004 by Bil Kleb, Bill Wood, and Erich Knausenberger.
+
+\documentclass[]{aiaa-tc}% insert '[draft]' option to show overfull boxes
+
+ \title{Bare-Bones \LaTeX\ Template for\\
+        AIAA Technical Conference Papers}
+
+ \author{
+  First A. Author%
+    \thanks{Job Title, Department, Address, and AIAA Member Grade.}
+  \ and Second B. Author\thanksibid{1}\\
+  {\normalsize\itshape
+   Business or Academic Affiliation, City, Province, Zipcode, Country}\\
+  \and
+  Third C. Author%
+   \thanks{Job Title, Department, Address, and AIAA Member Grade.}\\
+  {\normalsize\itshape
+  Business or Academic Affiliation, City, Province, Zipcode, Country}
+ }
+
+ % Data used by 'handcarry' option if invoked
+ \AIAApapernumber{YEAR-NUMBER}
+ \AIAAconference{Conference Name, Date, and Location}
+ \AIAAcopyright{\AIAAcopyrightD{YEAR}}
+
+ % Define commands to assure consistent treatment throughout document
+ \newcommand{\eqnref}[1]{(\ref{#1})}
+ \newcommand{\class}[1]{\texttt{#1}}
+ \newcommand{\package}[1]{\texttt{#1}}
+ \newcommand{\file}[1]{\texttt{#1}}
+ \newcommand{\BibTeX}{\textsc{Bib}\TeX}
+
+\begin{document}
+
+\maketitle
+
+\begin{abstract}
+This is a bare-bones \LaTeX\ template of an AIAA technical conference paper.
+It is intended to demonstrate the bare minimum set of \LaTeX\ commands
+to produce an AIAA technical conference paper.
+To explore more \LaTeX\ capabilities, see the advanced template.
+For detailed AIAA layout and style guidelines, please refer to the AIAA
+author guide for paper submission, format, and other procedures.
+\end{abstract}
+
+\section*{Nomenclature}
+
+\begin{tabbing}
+  XXX \= \kill% this line sets tab stop
+  $J$ \> Jacobian Matrix \\
+  $f$ \> Residual value vector \\
+  $x$ \> Variable value vector \\
+  $F$ \> Force, N \\
+  $m$ \> Mass, kg \\
+  $\Delta x$ \> Variable displacement vector \\
+  $\alpha$ \> Acceleration, m/s\textsuperscript{2} \\[5pt]
+  \textit{Subscript}\\
+  $i$ \> Variable number \\
+ \end{tabbing}
+
+\section{Introduction}
+
+This would be a good place to insert some text that make sense relative
+to the paper being written.
+Of course, for example purposes, the text is quite meaningless.
+
+\subsection{Background}
+
+This background section is here only to demonstrate \verb|\subsection|
+usage.
+And following this, the next section level will need to be demonstrated.
+
+\subsubsection{Detail}
+
+Here is a \verb|\subsubsection| that would normally come in pairs of two
+according to the requirements of an outline, but for the sake of
+demonstration, we are only showing a single \verb|\subsubsection|.
+
+\section{Model}
+
+We should probably include some math.
+Here we begin with Eq.~(\ref{e:function}) that demonstrates some math
+typesetting.
+\begin{equation}
+ \label{e:function}
+ \int_{0}^{r_{2}} F(r,\varphi) \, dr \, d\varphi =
+    \left[ \sigma r_{2}/(2\mu_{0}) \right] \cdot
+    \int_{0}^{\infty} \exp(-\rho|z_{j}-z_{i}|) \, \lambda^{-1} 
+\end{equation}
+Eq.~(\ref{e:function}) is grand.
+Some say it is due to Rebek.\cite{rebek:82bk}
+
+\section{Results}
+
+In this section we will introduce some figures and tables.
+It can be seen in figure~\ref{f:magnetic_field} that magnetization is a
+function of applied field.
+\begin{figure}[htb]% order of placement preference: here, top, bottom
+ \includegraphics{figure_magnet}
+ \caption{Magnetization as a function of applied field, which has
+   borders so thick that they overwhelm the data and for some reason the
+   ordinate label is rotated 90 degrees to make it difficult to
+   read. This figure also demonstrates the dangers of using a bitmap
+   as opposed to a vector image.}
+ \label{f:magnetic_field}
+\end{figure}
+Sometimes writing meaningless text can be quiet easy, but other times
+one is hard pressed to keep the words flowing.\footnote{And sometimes
+things get carried away in endless detail.}
+Meanwhile back in the other world, table~\ref{t:scheme_comparison} shows
+a nifty comparison.
+\begin{table}% no placement specified: defaults to here, top, bottom, page
+ \begin{center}
+  \caption{Variable and Fixed Coefficient Runge-Kutta Schemes as a
+           Function of Reynolds Number}
+  \label{t:scheme_comparison}
+  \begin{tabular}{rrr}
+       Re & Vary & Fixed \\\hline
+        1 &  868 & 4,271 \\
+       10 &  422 & 2,736 \\
+       25 &  252 & 1,374 \\
+       50 &  151 &   736 \\
+      100 &  110 &   387 \\
+      500 &   85 &   136 \\
+    1,000 &   77 &   117 \\
+    5,000 &   81 &    98 \\
+   10,000 &   82 &    99
+  \end{tabular}
+ \end{center}
+\end{table}
+
+\section{Conclusion}
+
+After much typing, the paper can now conclude.
+Four rocks were next to the channel.
+This caused a few standing waves during the rip that one could ride on
+the way in or jump on the way out.
+
+\section*{Appendix}
+
+An appendix, if needed, should appear before the acknowledgments.
+Use the 'starred' version of the \verb|\section| commands to avoid
+section numbering.
+
+\section*{Acknowledgments}
+
+A place to recognize others.
+
+\begin{thebibliography}{9}% maximum number of references (for label width)
+ \bibitem{rebek:82bk}
+ Rebek, A., {\it Fickle Rocks}, Fink Publishing, Chesapeake, 1982.
+\end{thebibliography}
+
+\end{document}
+
+% $Id: template_basic.tex,v 1.5 2004/05/23 12:49:44 kleb Exp $
author	Karl Berry <karl@freefriends.org>	2006-01-09 00:44:40 +0000
committer	Karl Berry <karl@freefriends.org>	2006-01-09 00:44:40 +0000
commit	b4fc5f639874db951177ec539299d20908adb654 (patch)
tree	52f08823ca58fffe3db6a9b075635038c567626c /Master/texmf-dist/doc/latex/aiaa
parent	dec3d98ebe442d7ea93efbaa8dd2e2be8149a467 (diff)