From f8a8930b87382c6f2d48deb1530398b5bc9e9646 Mon Sep 17 00:00:00 2001 From: Peter Breitenlohner Date: Thu, 18 Mar 2010 12:30:51 +0000 Subject: dvipng-1.13 git-svn-id: svn://tug.org/texlive/trunk@17494 c570f23f-e606-0410-a88d-b1316a301751 --- Build/source/texk/dvipng/dvipng-1.13/COPYING | 674 +++++++++++ .../source/texk/dvipng/dvipng-1.13/COPYING.LESSER | 165 +++ Build/source/texk/dvipng/dvipng-1.13/ChangeLog | 1176 ++++++++++++++++++++ Build/source/texk/dvipng/dvipng-1.13/ChangeLog.0 | 903 +++++++++++++++ Build/source/texk/dvipng/dvipng-1.13/INSTALL | 168 +++ Build/source/texk/dvipng/dvipng-1.13/Makefile.in | 168 +++ Build/source/texk/dvipng/dvipng-1.13/README | 128 +++ Build/source/texk/dvipng/dvipng-1.13/RELEASE | 13 + Build/source/texk/dvipng/dvipng-1.13/aclocal.m4 | 237 ++++ Build/source/texk/dvipng/dvipng-1.13/color.c | 443 ++++++++ Build/source/texk/dvipng/dvipng-1.13/commands.h | 196 ++++ Build/source/texk/dvipng/dvipng-1.13/config.h.in | 224 ++++ Build/source/texk/dvipng/dvipng-1.13/configure.ac | 225 ++++ Build/source/texk/dvipng/dvipng-1.13/draw.c | 395 +++++++ Build/source/texk/dvipng/dvipng-1.13/dvi.c | 484 ++++++++ Build/source/texk/dvipng/dvipng-1.13/dvipng.1 | 508 +++++++++ Build/source/texk/dvipng/dvipng-1.13/dvipng.c | 164 +++ Build/source/texk/dvipng/dvipng-1.13/dvipng.h | 566 ++++++++++ Build/source/texk/dvipng/dvipng-1.13/enc.c | 128 +++ Build/source/texk/dvipng/dvipng-1.13/font.c | 356 ++++++ Build/source/texk/dvipng/dvipng-1.13/fontmap.c | 340 ++++++ Build/source/texk/dvipng/dvipng-1.13/ft.c | 173 +++ Build/source/texk/dvipng/dvipng-1.13/miktex.h | 272 +++++ Build/source/texk/dvipng/dvipng-1.13/miktex.mak | 196 ++++ Build/source/texk/dvipng/dvipng-1.13/misc.c | 848 ++++++++++++++ Build/source/texk/dvipng/dvipng-1.13/papersiz.c | 73 ++ Build/source/texk/dvipng/dvipng-1.13/pk.c | 403 +++++++ Build/source/texk/dvipng/dvipng-1.13/ppagelist.c | 189 ++++ Build/source/texk/dvipng/dvipng-1.13/set.c | 289 +++++ Build/source/texk/dvipng/dvipng-1.13/sfd.c | 176 +++ Build/source/texk/dvipng/dvipng-1.13/special.c | 862 ++++++++++++++ Build/source/texk/dvipng/dvipng-1.13/t1.c | 192 ++++ .../source/texk/dvipng/dvipng-1.13/test_dvipng.tex | 48 + Build/source/texk/dvipng/dvipng-1.13/tfm.c | 75 ++ Build/source/texk/dvipng/dvipng-1.13/vf.c | 144 +++ 35 files changed, 11601 insertions(+) create mode 100644 Build/source/texk/dvipng/dvipng-1.13/COPYING create mode 100644 Build/source/texk/dvipng/dvipng-1.13/COPYING.LESSER create mode 100644 Build/source/texk/dvipng/dvipng-1.13/ChangeLog create mode 100644 Build/source/texk/dvipng/dvipng-1.13/ChangeLog.0 create mode 100644 Build/source/texk/dvipng/dvipng-1.13/INSTALL create mode 100644 Build/source/texk/dvipng/dvipng-1.13/Makefile.in create mode 100644 Build/source/texk/dvipng/dvipng-1.13/README create mode 100644 Build/source/texk/dvipng/dvipng-1.13/RELEASE create mode 100644 Build/source/texk/dvipng/dvipng-1.13/aclocal.m4 create mode 100644 Build/source/texk/dvipng/dvipng-1.13/color.c create mode 100644 Build/source/texk/dvipng/dvipng-1.13/commands.h create mode 100644 Build/source/texk/dvipng/dvipng-1.13/config.h.in create mode 100644 Build/source/texk/dvipng/dvipng-1.13/configure.ac create mode 100644 Build/source/texk/dvipng/dvipng-1.13/draw.c create mode 100644 Build/source/texk/dvipng/dvipng-1.13/dvi.c create mode 100644 Build/source/texk/dvipng/dvipng-1.13/dvipng.1 create mode 100644 Build/source/texk/dvipng/dvipng-1.13/dvipng.c create mode 100644 Build/source/texk/dvipng/dvipng-1.13/dvipng.h create mode 100644 Build/source/texk/dvipng/dvipng-1.13/enc.c create mode 100644 Build/source/texk/dvipng/dvipng-1.13/font.c create mode 100644 Build/source/texk/dvipng/dvipng-1.13/fontmap.c create mode 100644 Build/source/texk/dvipng/dvipng-1.13/ft.c create mode 100644 Build/source/texk/dvipng/dvipng-1.13/miktex.h create mode 100644 Build/source/texk/dvipng/dvipng-1.13/miktex.mak create mode 100644 Build/source/texk/dvipng/dvipng-1.13/misc.c create mode 100644 Build/source/texk/dvipng/dvipng-1.13/papersiz.c create mode 100644 Build/source/texk/dvipng/dvipng-1.13/pk.c create mode 100644 Build/source/texk/dvipng/dvipng-1.13/ppagelist.c create mode 100644 Build/source/texk/dvipng/dvipng-1.13/set.c create mode 100644 Build/source/texk/dvipng/dvipng-1.13/sfd.c create mode 100644 Build/source/texk/dvipng/dvipng-1.13/special.c create mode 100644 Build/source/texk/dvipng/dvipng-1.13/t1.c create mode 100644 Build/source/texk/dvipng/dvipng-1.13/test_dvipng.tex create mode 100644 Build/source/texk/dvipng/dvipng-1.13/tfm.c create mode 100644 Build/source/texk/dvipng/dvipng-1.13/vf.c (limited to 'Build/source/texk/dvipng/dvipng-1.13') diff --git a/Build/source/texk/dvipng/dvipng-1.13/COPYING b/Build/source/texk/dvipng/dvipng-1.13/COPYING new file mode 100644 index 00000000000..94a9ed024d3 --- /dev/null +++ b/Build/source/texk/dvipng/dvipng-1.13/COPYING @@ -0,0 +1,674 @@ + GNU GENERAL PUBLIC LICENSE + Version 3, 29 June 2007 + + Copyright (C) 2007 Free Software Foundation, Inc. + Everyone is permitted to copy and distribute verbatim copies + of this license document, but changing it is not allowed. + + Preamble + + The GNU General Public License is a free, copyleft license for +software and other kinds of works. + + The licenses for most software and other practical works are designed +to take away your freedom to share and change the works. By contrast, +the GNU General Public License is intended to guarantee your freedom to +share and change all versions of a program--to make sure it remains free +software for all its users. We, the Free Software Foundation, use the +GNU General Public License for most of our software; it applies also to +any other work released this way by its authors. You can apply it to +your programs, too. + + When we speak of free software, we are referring to freedom, not +price. Our General Public Licenses are designed to make sure that you +have the freedom to distribute copies of free software (and charge for +them if you wish), that you receive source code or can get it if you +want it, that you can change the software or use pieces of it in new +free programs, and that you know you can do these things. + + To protect your rights, we need to prevent others from denying you +these rights or asking you to surrender the rights. Therefore, you have +certain responsibilities if you distribute copies of the software, or if +you modify it: responsibilities to respect the freedom of others. + + For example, if you distribute copies of such a program, whether +gratis or for a fee, you must pass on to the recipients the same +freedoms that you received. You must make sure that they, too, receive +or can get the source code. And you must show them these terms so they +know their rights. + + Developers that use the GNU GPL protect your rights with two steps: +(1) assert copyright on the software, and (2) offer you this License +giving you legal permission to copy, distribute and/or modify it. + + For the developers' and authors' protection, the GPL clearly explains +that there is no warranty for this free software. For both users' and +authors' sake, the GPL requires that modified versions be marked as +changed, so that their problems will not be attributed erroneously to +authors of previous versions. + + Some devices are designed to deny users access to install or run +modified versions of the software inside them, although the manufacturer +can do so. This is fundamentally incompatible with the aim of +protecting users' freedom to change the software. The systematic +pattern of such abuse occurs in the area of products for individuals to +use, which is precisely where it is most unacceptable. Therefore, we +have designed this version of the GPL to prohibit the practice for those +products. If such problems arise substantially in other domains, we +stand ready to extend this provision to those domains in future versions +of the GPL, as needed to protect the freedom of users. + + Finally, every program is threatened constantly by software patents. +States should not allow patents to restrict development and use of +software on general-purpose computers, but in those that do, we wish to +avoid the special danger that patents applied to a free program could +make it effectively proprietary. To prevent this, the GPL assures that +patents cannot be used to render the program non-free. + + The precise terms and conditions for copying, distribution and +modification follow. + + TERMS AND CONDITIONS + + 0. Definitions. + + "This License" refers to version 3 of the GNU General Public License. + + "Copyright" also means copyright-like laws that apply to other kinds of +works, such as semiconductor masks. + + "The Program" refers to any copyrightable work licensed under this +License. Each licensee is addressed as "you". "Licensees" and +"recipients" may be individuals or organizations. + + To "modify" a work means to copy from or adapt all or part of the work +in a fashion requiring copyright permission, other than the making of an +exact copy. The resulting work is called a "modified version" of the +earlier work or a work "based on" the earlier work. + + A "covered work" means either the unmodified Program or a work based +on the Program. + + To "propagate" a work means to do anything with it that, without +permission, would make you directly or secondarily liable for +infringement under applicable copyright law, except executing it on a +computer or modifying a private copy. Propagation includes copying, +distribution (with or without modification), making available to the +public, and in some countries other activities as well. + + To "convey" a work means any kind of propagation that enables other +parties to make or receive copies. Mere interaction with a user through +a computer network, with no transfer of a copy, is not conveying. + + An interactive user interface displays "Appropriate Legal Notices" +to the extent that it includes a convenient and prominently visible +feature that (1) displays an appropriate copyright notice, and (2) +tells the user that there is no warranty for the work (except to the +extent that warranties are provided), that licensees may convey the +work under this License, and how to view a copy of this License. If +the interface presents a list of user commands or options, such as a +menu, a prominent item in the list meets this criterion. + + 1. Source Code. + + The "source code" for a work means the preferred form of the work +for making modifications to it. "Object code" means any non-source +form of a work. + + A "Standard Interface" means an interface that either is an official +standard defined by a recognized standards body, or, in the case of +interfaces specified for a particular programming language, one that +is widely used among developers working in that language. + + The "System Libraries" of an executable work include anything, other +than the work as a whole, that (a) is included in the normal form of +packaging a Major Component, but which is not part of that Major +Component, and (b) serves only to enable use of the work with that +Major Component, or to implement a Standard Interface for which an +implementation is available to the public in source code form. A +"Major Component", in this context, means a major essential component +(kernel, window system, and so on) of the specific operating system +(if any) on which the executable work runs, or a compiler used to +produce the work, or an object code interpreter used to run it. + + The "Corresponding Source" for a work in object code form means all +the source code needed to generate, install, and (for an executable +work) run the object code and to modify the work, including scripts to +control those activities. However, it does not include the work's +System Libraries, or general-purpose tools or generally available free +programs which are used unmodified in performing those activities but +which are not part of the work. For example, Corresponding Source +includes interface definition files associated with source files for +the work, and the source code for shared libraries and dynamically +linked subprograms that the work is specifically designed to require, +such as by intimate data communication or control flow between those +subprograms and other parts of the work. + + The Corresponding Source need not include anything that users +can regenerate automatically from other parts of the Corresponding +Source. + + The Corresponding Source for a work in source code form is that +same work. + + 2. Basic Permissions. + + All rights granted under this License are granted for the term of +copyright on the Program, and are irrevocable provided the stated +conditions are met. This License explicitly affirms your unlimited +permission to run the unmodified Program. The output from running a +covered work is covered by this License only if the output, given its +content, constitutes a covered work. This License acknowledges your +rights of fair use or other equivalent, as provided by copyright law. + + You may make, run and propagate covered works that you do not +convey, without conditions so long as your license otherwise remains +in force. You may convey covered works to others for the sole purpose +of having them make modifications exclusively for you, or provide you +with facilities for running those works, provided that you comply with +the terms of this License in conveying all material for which you do +not control copyright. Those thus making or running the covered works +for you must do so exclusively on your behalf, under your direction +and control, on terms that prohibit them from making any copies of +your copyrighted material outside their relationship with you. + + Conveying under any other circumstances is permitted solely under +the conditions stated below. Sublicensing is not allowed; section 10 +makes it unnecessary. + + 3. Protecting Users' Legal Rights From Anti-Circumvention Law. + + No covered work shall be deemed part of an effective technological +measure under any applicable law fulfilling obligations under article +11 of the WIPO copyright treaty adopted on 20 December 1996, or +similar laws prohibiting or restricting circumvention of such +measures. + + When you convey a covered work, you waive any legal power to forbid +circumvention of technological measures to the extent such circumvention +is effected by exercising rights under this License with respect to +the covered work, and you disclaim any intention to limit operation or +modification of the work as a means of enforcing, against the work's +users, your or third parties' legal rights to forbid circumvention of +technological measures. + + 4. Conveying Verbatim Copies. + + You may convey verbatim copies of the Program's source code as you +receive it, in any medium, provided that you conspicuously and +appropriately publish on each copy an appropriate copyright notice; +keep intact all notices stating that this License and any +non-permissive terms added in accord with section 7 apply to the code; +keep intact all notices of the absence of any warranty; and give all +recipients a copy of this License along with the Program. + + You may charge any price or no price for each copy that you convey, +and you may offer support or warranty protection for a fee. + + 5. Conveying Modified Source Versions. + + You may convey a work based on the Program, or the modifications to +produce it from the Program, in the form of source code under the +terms of section 4, provided that you also meet all of these conditions: + + a) The work must carry prominent notices stating that you modified + it, and giving a relevant date. + + b) The work must carry prominent notices stating that it is + released under this License and any conditions added under section + 7. This requirement modifies the requirement in section 4 to + "keep intact all notices". + + c) You must license the entire work, as a whole, under this + License to anyone who comes into possession of a copy. This + License will therefore apply, along with any applicable section 7 + additional terms, to the whole of the work, and all its parts, + regardless of how they are packaged. This License gives no + permission to license the work in any other way, but it does not + invalidate such permission if you have separately received it. + + d) If the work has interactive user interfaces, each must display + Appropriate Legal Notices; however, if the Program has interactive + interfaces that do not display Appropriate Legal Notices, your + work need not make them do so. + + A compilation of a covered work with other separate and independent +works, which are not by their nature extensions of the covered work, +and which are not combined with it such as to form a larger program, +in or on a volume of a storage or distribution medium, is called an +"aggregate" if the compilation and its resulting copyright are not +used to limit the access or legal rights of the compilation's users +beyond what the individual works permit. Inclusion of a covered work +in an aggregate does not cause this License to apply to the other +parts of the aggregate. + + 6. Conveying Non-Source Forms. + + You may convey a covered work in object code form under the terms +of sections 4 and 5, provided that you also convey the +machine-readable Corresponding Source under the terms of this License, +in one of these ways: + + a) Convey the object code in, or embodied in, a physical product + (including a physical distribution medium), accompanied by the + Corresponding Source fixed on a durable physical medium + customarily used for software interchange. + + b) Convey the object code in, or embodied in, a physical product + (including a physical distribution medium), accompanied by a + written offer, valid for at least three years and valid for as + long as you offer spare parts or customer support for that product + model, to give anyone who possesses the object code either (1) a + copy of the Corresponding Source for all the software in the + product that is covered by this License, on a durable physical + medium customarily used for software interchange, for a price no + more than your reasonable cost of physically performing this + conveying of source, or (2) access to copy the + Corresponding Source from a network server at no charge. + + c) Convey individual copies of the object code with a copy of the + written offer to provide the Corresponding Source. This + alternative is allowed only occasionally and noncommercially, and + only if you received the object code with such an offer, in accord + with subsection 6b. + + d) Convey the object code by offering access from a designated + place (gratis or for a charge), and offer equivalent access to the + Corresponding Source in the same way through the same place at no + further charge. You need not require recipients to copy the + Corresponding Source along with the object code. If the place to + copy the object code is a network server, the Corresponding Source + may be on a different server (operated by you or a third party) + that supports equivalent copying facilities, provided you maintain + clear directions next to the object code saying where to find the + Corresponding Source. Regardless of what server hosts the + Corresponding Source, you remain obligated to ensure that it is + available for as long as needed to satisfy these requirements. + + e) Convey the object code using peer-to-peer transmission, provided + you inform other peers where the object code and Corresponding + Source of the work are being offered to the general public at no + charge under subsection 6d. + + A separable portion of the object code, whose source code is excluded +from the Corresponding Source as a System Library, need not be +included in conveying the object code work. + + A "User Product" is either (1) a "consumer product", which means any +tangible personal property which is normally used for personal, family, +or household purposes, or (2) anything designed or sold for incorporation +into a dwelling. In determining whether a product is a consumer product, +doubtful cases shall be resolved in favor of coverage. For a particular +product received by a particular user, "normally used" refers to a +typical or common use of that class of product, regardless of the status +of the particular user or of the way in which the particular user +actually uses, or expects or is expected to use, the product. A product +is a consumer product regardless of whether the product has substantial +commercial, industrial or non-consumer uses, unless such uses represent +the only significant mode of use of the product. + + "Installation Information" for a User Product means any methods, +procedures, authorization keys, or other information required to install +and execute modified versions of a covered work in that User Product from +a modified version of its Corresponding Source. The information must +suffice to ensure that the continued functioning of the modified object +code is in no case prevented or interfered with solely because +modification has been made. + + If you convey an object code work under this section in, or with, or +specifically for use in, a User Product, and the conveying occurs as +part of a transaction in which the right of possession and use of the +User Product is transferred to the recipient in perpetuity or for a +fixed term (regardless of how the transaction is characterized), the +Corresponding Source conveyed under this section must be accompanied +by the Installation Information. But this requirement does not apply +if neither you nor any third party retains the ability to install +modified object code on the User Product (for example, the work has +been installed in ROM). + + The requirement to provide Installation Information does not include a +requirement to continue to provide support service, warranty, or updates +for a work that has been modified or installed by the recipient, or for +the User Product in which it has been modified or installed. Access to a +network may be denied when the modification itself materially and +adversely affects the operation of the network or violates the rules and +protocols for communication across the network. + + Corresponding Source conveyed, and Installation Information provided, +in accord with this section must be in a format that is publicly +documented (and with an implementation available to the public in +source code form), and must require no special password or key for +unpacking, reading or copying. + + 7. Additional Terms. + + "Additional permissions" are terms that supplement the terms of this +License by making exceptions from one or more of its conditions. +Additional permissions that are applicable to the entire Program shall +be treated as though they were included in this License, to the extent +that they are valid under applicable law. If additional permissions +apply only to part of the Program, that part may be used separately +under those permissions, but the entire Program remains governed by +this License without regard to the additional permissions. + + When you convey a copy of a covered work, you may at your option +remove any additional permissions from that copy, or from any part of +it. (Additional permissions may be written to require their own +removal in certain cases when you modify the work.) You may place +additional permissions on material, added by you to a covered work, +for which you have or can give appropriate copyright permission. + + Notwithstanding any other provision of this License, for material you +add to a covered work, you may (if authorized by the copyright holders of +that material) supplement the terms of this License with terms: + + a) Disclaiming warranty or limiting liability differently from the + terms of sections 15 and 16 of this License; or + + b) Requiring preservation of specified reasonable legal notices or + author attributions in that material or in the Appropriate Legal + Notices displayed by works containing it; or + + c) Prohibiting misrepresentation of the origin of that material, or + requiring that modified versions of such material be marked in + reasonable ways as different from the original version; or + + d) Limiting the use for publicity purposes of names of licensors or + authors of the material; or + + e) Declining to grant rights under trademark law for use of some + trade names, trademarks, or service marks; or + + f) Requiring indemnification of licensors and authors of that + material by anyone who conveys the material (or modified versions of + it) with contractual assumptions of liability to the recipient, for + any liability that these contractual assumptions directly impose on + those licensors and authors. + + All other non-permissive additional terms are considered "further +restrictions" within the meaning of section 10. If the Program as you +received it, or any part of it, contains a notice stating that it is +governed by this License along with a term that is a further +restriction, you may remove that term. If a license document contains +a further restriction but permits relicensing or conveying under this +License, you may add to a covered work material governed by the terms +of that license document, provided that the further restriction does +not survive such relicensing or conveying. + + If you add terms to a covered work in accord with this section, you +must place, in the relevant source files, a statement of the +additional terms that apply to those files, or a notice indicating +where to find the applicable terms. + + Additional terms, permissive or non-permissive, may be stated in the +form of a separately written license, or stated as exceptions; +the above requirements apply either way. + + 8. Termination. + + You may not propagate or modify a covered work except as expressly +provided under this License. Any attempt otherwise to propagate or +modify it is void, and will automatically terminate your rights under +this License (including any patent licenses granted under the third +paragraph of section 11). + + However, if you cease all violation of this License, then your +license from a particular copyright holder is reinstated (a) +provisionally, unless and until the copyright holder explicitly and +finally terminates your license, and (b) permanently, if the copyright +holder fails to notify you of the violation by some reasonable means +prior to 60 days after the cessation. + + Moreover, your license from a particular copyright holder is +reinstated permanently if the copyright holder notifies you of the +violation by some reasonable means, this is the first time you have +received notice of violation of this License (for any work) from that +copyright holder, and you cure the violation prior to 30 days after +your receipt of the notice. + + Termination of your rights under this section does not terminate the +licenses of parties who have received copies or rights from you under +this License. If your rights have been terminated and not permanently +reinstated, you do not qualify to receive new licenses for the same +material under section 10. + + 9. Acceptance Not Required for Having Copies. + + You are not required to accept this License in order to receive or +run a copy of the Program. Ancillary propagation of a covered work +occurring solely as a consequence of using peer-to-peer transmission +to receive a copy likewise does not require acceptance. However, +nothing other than this License grants you permission to propagate or +modify any covered work. These actions infringe copyright if you do +not accept this License. Therefore, by modifying or propagating a +covered work, you indicate your acceptance of this License to do so. + + 10. Automatic Licensing of Downstream Recipients. + + Each time you convey a covered work, the recipient automatically +receives a license from the original licensors, to run, modify and +propagate that work, subject to this License. You are not responsible +for enforcing compliance by third parties with this License. + + An "entity transaction" is a transaction transferring control of an +organization, or substantially all assets of one, or subdividing an +organization, or merging organizations. If propagation of a covered +work results from an entity transaction, each party to that +transaction who receives a copy of the work also receives whatever +licenses to the work the party's predecessor in interest had or could +give under the previous paragraph, plus a right to possession of the +Corresponding Source of the work from the predecessor in interest, if +the predecessor has it or can get it with reasonable efforts. + + You may not impose any further restrictions on the exercise of the +rights granted or affirmed under this License. For example, you may +not impose a license fee, royalty, or other charge for exercise of +rights granted under this License, and you may not initiate litigation +(including a cross-claim or counterclaim in a lawsuit) alleging that +any patent claim is infringed by making, using, selling, offering for +sale, or importing the Program or any portion of it. + + 11. Patents. + + A "contributor" is a copyright holder who authorizes use under this +License of the Program or a work on which the Program is based. The +work thus licensed is called the contributor's "contributor version". + + A contributor's "essential patent claims" are all patent claims +owned or controlled by the contributor, whether already acquired or +hereafter acquired, that would be infringed by some manner, permitted +by this License, of making, using, or selling its contributor version, +but do not include claims that would be infringed only as a +consequence of further modification of the contributor version. For +purposes of this definition, "control" includes the right to grant +patent sublicenses in a manner consistent with the requirements of +this License. + + Each contributor grants you a non-exclusive, worldwide, royalty-free +patent license under the contributor's essential patent claims, to +make, use, sell, offer for sale, import and otherwise run, modify and +propagate the contents of its contributor version. + + In the following three paragraphs, a "patent license" is any express +agreement or commitment, however denominated, not to enforce a patent +(such as an express permission to practice a patent or covenant not to +sue for patent infringement). To "grant" such a patent license to a +party means to make such an agreement or commitment not to enforce a +patent against the party. + + If you convey a covered work, knowingly relying on a patent license, +and the Corresponding Source of the work is not available for anyone +to copy, free of charge and under the terms of this License, through a +publicly available network server or other readily accessible means, +then you must either (1) cause the Corresponding Source to be so +available, or (2) arrange to deprive yourself of the benefit of the +patent license for this particular work, or (3) arrange, in a manner +consistent with the requirements of this License, to extend the patent +license to downstream recipients. "Knowingly relying" means you have +actual knowledge that, but for the patent license, your conveying the +covered work in a country, or your recipient's use of the covered work +in a country, would infringe one or more identifiable patents in that +country that you have reason to believe are valid. + + If, pursuant to or in connection with a single transaction or +arrangement, you convey, or propagate by procuring conveyance of, a +covered work, and grant a patent license to some of the parties +receiving the covered work authorizing them to use, propagate, modify +or convey a specific copy of the covered work, then the patent license +you grant is automatically extended to all recipients of the covered +work and works based on it. + + A patent license is "discriminatory" if it does not include within +the scope of its coverage, prohibits the exercise of, or is +conditioned on the non-exercise of one or more of the rights that are +specifically granted under this License. You may not convey a covered +work if you are a party to an arrangement with a third party that is +in the business of distributing software, under which you make payment +to the third party based on the extent of your activity of conveying +the work, and under which the third party grants, to any of the +parties who would receive the covered work from you, a discriminatory +patent license (a) in connection with copies of the covered work +conveyed by you (or copies made from those copies), or (b) primarily +for and in connection with specific products or compilations that +contain the covered work, unless you entered into that arrangement, +or that patent license was granted, prior to 28 March 2007. + + Nothing in this License shall be construed as excluding or limiting +any implied license or other defenses to infringement that may +otherwise be available to you under applicable patent law. + + 12. No Surrender of Others' Freedom. + + If conditions are imposed on you (whether by court order, agreement or +otherwise) that contradict the conditions of this License, they do not +excuse you from the conditions of this License. If you cannot convey a +covered work so as to satisfy simultaneously your obligations under this +License and any other pertinent obligations, then as a consequence you may +not convey it at all. For example, if you agree to terms that obligate you +to collect a royalty for further conveying from those to whom you convey +the Program, the only way you could satisfy both those terms and this +License would be to refrain entirely from conveying the Program. + + 13. Use with the GNU Affero General Public License. + + Notwithstanding any other provision of this License, you have +permission to link or combine any covered work with a work licensed +under version 3 of the GNU Affero General Public License into a single +combined work, and to convey the resulting work. The terms of this +License will continue to apply to the part which is the covered work, +but the special requirements of the GNU Affero General Public License, +section 13, concerning interaction through a network will apply to the +combination as such. + + 14. Revised Versions of this License. + + The Free Software Foundation may publish revised and/or new versions of +the GNU General Public License from time to time. Such new versions will +be similar in spirit to the present version, but may differ in detail to +address new problems or concerns. + + Each version is given a distinguishing version number. If the +Program specifies that a certain numbered version of the GNU General +Public License "or any later version" applies to it, you have the +option of following the terms and conditions either of that numbered +version or of any later version published by the Free Software +Foundation. If the Program does not specify a version number of the +GNU General Public License, you may choose any version ever published +by the Free Software Foundation. + + If the Program specifies that a proxy can decide which future +versions of the GNU General Public License can be used, that proxy's +public statement of acceptance of a version permanently authorizes you +to choose that version for the Program. + + Later license versions may give you additional or different +permissions. However, no additional obligations are imposed on any +author or copyright holder as a result of your choosing to follow a +later version. + + 15. Disclaimer of Warranty. + + THERE IS NO WARRANTY FOR THE PROGRAM, TO THE EXTENT PERMITTED BY +APPLICABLE LAW. EXCEPT WHEN OTHERWISE STATED IN WRITING THE COPYRIGHT +HOLDERS AND/OR OTHER PARTIES PROVIDE THE PROGRAM "AS IS" WITHOUT WARRANTY +OF ANY KIND, EITHER EXPRESSED OR IMPLIED, INCLUDING, BUT NOT LIMITED TO, +THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR +PURPOSE. THE ENTIRE RISK AS TO THE QUALITY AND PERFORMANCE OF THE PROGRAM +IS WITH YOU. SHOULD THE PROGRAM PROVE DEFECTIVE, YOU ASSUME THE COST OF +ALL NECESSARY SERVICING, REPAIR OR CORRECTION. + + 16. Limitation of Liability. + + IN NO EVENT UNLESS REQUIRED BY APPLICABLE LAW OR AGREED TO IN WRITING +WILL ANY COPYRIGHT HOLDER, OR ANY OTHER PARTY WHO MODIFIES AND/OR CONVEYS +THE PROGRAM AS PERMITTED ABOVE, BE LIABLE TO YOU FOR DAMAGES, INCLUDING ANY +GENERAL, SPECIAL, INCIDENTAL OR CONSEQUENTIAL DAMAGES ARISING OUT OF THE +USE OR INABILITY TO USE THE PROGRAM (INCLUDING BUT NOT LIMITED TO LOSS OF +DATA OR DATA BEING RENDERED INACCURATE OR LOSSES SUSTAINED BY YOU OR THIRD +PARTIES OR A FAILURE OF THE PROGRAM TO OPERATE WITH ANY OTHER PROGRAMS), +EVEN IF SUCH HOLDER OR OTHER PARTY HAS BEEN ADVISED OF THE POSSIBILITY OF +SUCH DAMAGES. + + 17. Interpretation of Sections 15 and 16. + + If the disclaimer of warranty and limitation of liability provided +above cannot be given local legal effect according to their terms, +reviewing courts shall apply local law that most closely approximates +an absolute waiver of all civil liability in connection with the +Program, unless a warranty or assumption of liability accompanies a +copy of the Program in return for a fee. + + END OF TERMS AND CONDITIONS + + How to Apply These Terms to Your New Programs + + If you develop a new program, and you want it to be of the greatest +possible use to the public, the best way to achieve this is to make it +free software which everyone can redistribute and change under these terms. + + To do so, attach the following notices to the program. It is safest +to attach them to the start of each source file to most effectively +state the exclusion of warranty; and each file should have at least +the "copyright" line and a pointer to where the full notice is found. + + + Copyright (C) + + This program is free software: you can redistribute it and/or modify + it under the terms of the GNU General Public License as published by + the Free Software Foundation, either version 3 of the License, or + (at your option) any later version. + + This program is distributed in the hope that it will be useful, + but WITHOUT ANY WARRANTY; without even the implied warranty of + MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + GNU General Public License for more details. + + You should have received a copy of the GNU General Public License + along with this program. If not, see . + +Also add information on how to contact you by electronic and paper mail. + + If the program does terminal interaction, make it output a short +notice like this when it starts in an interactive mode: + + Copyright (C) + This program comes with ABSOLUTELY NO WARRANTY; for details type `show w'. + This is free software, and you are welcome to redistribute it + under certain conditions; type `show c' for details. + +The hypothetical commands `show w' and `show c' should show the appropriate +parts of the General Public License. Of course, your program's commands +might be different; for a GUI interface, you would use an "about box". + + You should also get your employer (if you work as a programmer) or school, +if any, to sign a "copyright disclaimer" for the program, if necessary. +For more information on this, and how to apply and follow the GNU GPL, see +. + + The GNU General Public License does not permit incorporating your program +into proprietary programs. If your program is a subroutine library, you +may consider it more useful to permit linking proprietary applications with +the library. If this is what you want to do, use the GNU Lesser General +Public License instead of this License. But first, please read +. diff --git a/Build/source/texk/dvipng/dvipng-1.13/COPYING.LESSER b/Build/source/texk/dvipng/dvipng-1.13/COPYING.LESSER new file mode 100644 index 00000000000..fc8a5de7edf --- /dev/null +++ b/Build/source/texk/dvipng/dvipng-1.13/COPYING.LESSER @@ -0,0 +1,165 @@ + GNU LESSER GENERAL PUBLIC LICENSE + Version 3, 29 June 2007 + + Copyright (C) 2007 Free Software Foundation, Inc. + Everyone is permitted to copy and distribute verbatim copies + of this license document, but changing it is not allowed. + + + This version of the GNU Lesser General Public License incorporates +the terms and conditions of version 3 of the GNU General Public +License, supplemented by the additional permissions listed below. + + 0. Additional Definitions. + + As used herein, "this License" refers to version 3 of the GNU Lesser +General Public License, and the "GNU GPL" refers to version 3 of the GNU +General Public License. + + "The Library" refers to a covered work governed by this License, +other than an Application or a Combined Work as defined below. + + An "Application" is any work that makes use of an interface provided +by the Library, but which is not otherwise based on the Library. +Defining a subclass of a class defined by the Library is deemed a mode +of using an interface provided by the Library. + + A "Combined Work" is a work produced by combining or linking an +Application with the Library. The particular version of the Library +with which the Combined Work was made is also called the "Linked +Version". + + The "Minimal Corresponding Source" for a Combined Work means the +Corresponding Source for the Combined Work, excluding any source code +for portions of the Combined Work that, considered in isolation, are +based on the Application, and not on the Linked Version. + + The "Corresponding Application Code" for a Combined Work means the +object code and/or source code for the Application, including any data +and utility programs needed for reproducing the Combined Work from the +Application, but excluding the System Libraries of the Combined Work. + + 1. Exception to Section 3 of the GNU GPL. + + You may convey a covered work under sections 3 and 4 of this License +without being bound by section 3 of the GNU GPL. + + 2. Conveying Modified Versions. + + If you modify a copy of the Library, and, in your modifications, a +facility refers to a function or data to be supplied by an Application +that uses the facility (other than as an argument passed when the +facility is invoked), then you may convey a copy of the modified +version: + + a) under this License, provided that you make a good faith effort to + ensure that, in the event an Application does not supply the + function or data, the facility still operates, and performs + whatever part of its purpose remains meaningful, or + + b) under the GNU GPL, with none of the additional permissions of + this License applicable to that copy. + + 3. Object Code Incorporating Material from Library Header Files. + + The object code form of an Application may incorporate material from +a header file that is part of the Library. You may convey such object +code under terms of your choice, provided that, if the incorporated +material is not limited to numerical parameters, data structure +layouts and accessors, or small macros, inline functions and templates +(ten or fewer lines in length), you do both of the following: + + a) Give prominent notice with each copy of the object code that the + Library is used in it and that the Library and its use are + covered by this License. + + b) Accompany the object code with a copy of the GNU GPL and this license + document. + + 4. Combined Works. + + You may convey a Combined Work under terms of your choice that, +taken together, effectively do not restrict modification of the +portions of the Library contained in the Combined Work and reverse +engineering for debugging such modifications, if you also do each of +the following: + + a) Give prominent notice with each copy of the Combined Work that + the Library is used in it and that the Library and its use are + covered by this License. + + b) Accompany the Combined Work with a copy of the GNU GPL and this license + document. + + c) For a Combined Work that displays copyright notices during + execution, include the copyright notice for the Library among + these notices, as well as a reference directing the user to the + copies of the GNU GPL and this license document. + + d) Do one of the following: + + 0) Convey the Minimal Corresponding Source under the terms of this + License, and the Corresponding Application Code in a form + suitable for, and under terms that permit, the user to + recombine or relink the Application with a modified version of + the Linked Version to produce a modified Combined Work, in the + manner specified by section 6 of the GNU GPL for conveying + Corresponding Source. + + 1) Use a suitable shared library mechanism for linking with the + Library. A suitable mechanism is one that (a) uses at run time + a copy of the Library already present on the user's computer + system, and (b) will operate properly with a modified version + of the Library that is interface-compatible with the Linked + Version. + + e) Provide Installation Information, but only if you would otherwise + be required to provide such information under section 6 of the + GNU GPL, and only to the extent that such information is + necessary to install and execute a modified version of the + Combined Work produced by recombining or relinking the + Application with a modified version of the Linked Version. (If + you use option 4d0, the Installation Information must accompany + the Minimal Corresponding Source and Corresponding Application + Code. If you use option 4d1, you must provide the Installation + Information in the manner specified by section 6 of the GNU GPL + for conveying Corresponding Source.) + + 5. Combined Libraries. + + You may place library facilities that are a work based on the +Library side by side in a single library together with other library +facilities that are not Applications and are not covered by this +License, and convey such a combined library under terms of your +choice, if you do both of the following: + + a) Accompany the combined library with a copy of the same work based + on the Library, uncombined with any other library facilities, + conveyed under the terms of this License. + + b) Give prominent notice with the combined library that part of it + is a work based on the Library, and explaining where to find the + accompanying uncombined form of the same work. + + 6. Revised Versions of the GNU Lesser General Public License. + + The Free Software Foundation may publish revised and/or new versions +of the GNU Lesser General Public License from time to time. Such new +versions will be similar in spirit to the present version, but may +differ in detail to address new problems or concerns. + + Each version is given a distinguishing version number. If the +Library as you received it specifies that a certain numbered version +of the GNU Lesser General Public License "or any later version" +applies to it, you have the option of following the terms and +conditions either of that published version or of any later version +published by the Free Software Foundation. If the Library as you +received it does not specify a version number of the GNU Lesser +General Public License, you may choose any version of the GNU Lesser +General Public License ever published by the Free Software Foundation. + + If the Library as you received it specifies that a proxy can decide +whether future versions of the GNU Lesser General Public License shall +apply, that proxy's public statement of acceptance of any version is +permanent authorization for you to choose that version for the +Library. diff --git a/Build/source/texk/dvipng/dvipng-1.13/ChangeLog b/Build/source/texk/dvipng/dvipng-1.13/ChangeLog new file mode 100644 index 00000000000..a3bf42d174a --- /dev/null +++ b/Build/source/texk/dvipng/dvipng-1.13/ChangeLog @@ -0,0 +1,1176 @@ +2010-03-17 Jan-Ake Larsson + + * Release 1.13 + + * misc.c: Correct copyright year + + * RELEASE: Prepare for 1.13 + +2010-03-17 Peter Breitenlohner + + * configure.ac: Check for kpse_set_program_name() as used in + dvipng.c instead of kpse_set_progname(). + + Support WIN32 builds (native or MinGW32). + * dvipng.h (min, max): Always undefine before defining. + * dvi.c: For WIN32 use Sleep(1000) instead of sleeep(1). + * misc.c: #include depends on HAVE_MMAP. + * dvipng.h, font.c, misc.c: For mmap code use '#ifdef WIN32' + instead of '#ifdef MIKTEX'. + * special.c: WIN32 specific replacement for fork and pipe, using + code from Akira Kakuto, (e-mail from 23 Feb 2010 23:33:58). + +2010-03-17 Jan-Ake Larsson + + * test_dvipng.tex: Don't use mathptmx + + * color.c, dvi.c, dvipng.h, fontmap.c, misc.c, papersiz.c, + ppagelist.c, special.c: Avoid compiler warnings + + * dvipng.texi, configure.ac: Prepare for 1.13 + + * draw.c, dvipng.h, set.c, vf.c: Adjust glyph-index bounds + test. Remove possible segfault from isprint(). + +2010-02-11 Jan-Ake Larsson + + * color.c, draw.c, dvi.c, enc.c, font.c, fontmap.c, ft.c, + papersiz.c, pk.c, ppagelist.c, set.c, sfd.c, special.c, t1.c: + Declare functions used only in one file as static to avoid + warnings when compiling with 'gcc --Wmissing-prototypes', + suggested by Peter Breitenlohner + +2010-01-28 Jan-Ake Larsson + + * draw.c, dvipng.h, dvipng.texi, misc.c: Add width reporting + +2009-04-14 Jan-Ake Larsson + + * fontmap.c: Make the thing build without FT2 + +2009-03-28 Jan-Ake Larsson + + * config.h.in: Remove the last remnants of alloca + +2009-03-26 Jan-Ake Larsson + + * configure.ac, dvipng.h: Remove the last remnants of alloca + + * draw.c, font.c, ft.c, pk.c, t1.c, vf.c: Make the name element of + the font struct a pointer, not an array + + * dvi.c, ppagelist.c: Change error msg to mention malloc + + * color.c, enc.c, pk.c, set.c, sfd.c, special.c, tfm.c: Don't use + alloca + +2009-03-25 Jan-Ake Larsson + + * config.h.in, configure.ac: Check for libgen.h, not libgen + + * special.c: Put declarations before code + + * color.c, dvipng.h, fontmap.c, ft.c, misc.c, pk.c, set.c, t1.c, + tfm.c: Exchange #if for #ifdef + +2009-02-23 Jan-Ake Larsson + + * Release 1.12 + + * INSTALL, README, install.texi, readme.texi, special.c: Correct + date for copyright + + * RELEASE, configure.ac, dvipng.1, dvipng.texi: Prepare for 1.12 + +2009-01-23 Jan-Ake Larsson + + * special.c: Keep transparent background in rescaled included + bitmaps + +2008-06-04 Jan-Ake Larsson + + * special.c: Add the color PostScript prologue + +2008-06-03 Jan-Ake Larsson + + * dvipng.h, special.c: Support xcolor PostScript prologue + + * color.c: Support x11nam.def, fix handling of xcolor + multiple-model color values, and xcolor PostScript prologue + +2008-06-02 Jan-Ake Larsson + + * special.c: Some (most?) literal PostScript specials seem to + depend on tex.pro and possibly special.pro, always load these + + * configure.ac: Fix gs checks + + * misc.c: Correct last mmap element + +2008-05-27 Jan-Ake Larsson + + * readme.texi: Mention new color models in xcolor + + * color.c: Adjust for new version of xcolor, mainly color prefixes + +2008-05-14 Jan-Ake Larsson + + * Release 1.11 + + * configure.ac, dvipng.1, dvipng.texi, RELEASE: Prepare for 1.11 + + * special.c: Fix PS inclusion regression + +2008-05-09 Jan-Ake Larsson + + * Release 1.10 + + * RELEASE: Prepare for 1.10 + +2008-05-08 Jan-Ake Larsson + + * special.c: Add warning about DVI code in PS environment + +2008-05-07 Jan-Ake Larsson + + * README, readme.texi: Mention gs interpreter lib in TODO + + * aclocal.m4, configure.ac: Move gs device check so that it can be + called from different points + +2008-05-05 Jan-Ake Larsson + + * draw.c, dvi.c, dvipng.h: Revert creation of dvi command struct + + * draw.c, dvi.c: Init dvi command struct + + * draw.c, dvi.c, dvipng.h: Create dvi command struct + + * special.c: Rearrange code + + * color.c, dvipng.h, enc.c, fontmap.c, misc.c, pk.c, sfd.c, + special.c, tfm.c, vf.c: Change name of fmmap struct element + +2008-04-29 Jan-Ake Larsson + + * dvipng.1: Prepare for 1.10 + + * configure.ac: Prepare for 1.10, check for gdImageCreateJpeg + + * aclocal.m4: Cosmetic changes + + * special.c: Change to HAVE_...JPEG + + * dvipng.h: Remove c++ comment + + * dvipng.texi: Prepare for 1.10. Use 'active' in the 'preview' + package, remove unused text + + * Makefile.in: + Install dvipng.1 from the tarball, mark maintainer targets + +2008-02-08 Jan-Ake Larsson + + * Makefile.in, INSTALL, README, color.c, commands.h, configure.ac, + * draw.c, dvi.c, dvipng.1, dvipng.c, dvipng.h, dvipng.texi, enc.c, + * font.c, fontmap.c, ft.c, install.texi, macros.texi, miktex.h, + * misc.c, papersiz.c, pk.c, ppagelist.c, readme.texi, set.c, sfd.c, + * special.c, t1.c, test_dvipng.tex, tfm.c, vf.c, COPYING, + * COPYING.LESSER: Change to LGPLv3 + + * install.texi: + * README: + * dvipng.texi: Add blurb about MediaWiki, and cosmetic changes + +2008-01-10 Jan-Ake Larsson + + * set.c: Correct typo + +2007-12-12 Jan-Ake Larsson + + * special.c: Correct header test, add proper ps::[start] and + ps::[end] detection, add code to make tikz/pgf dvips (~PostScript) + specials work + +2007-10-26 Jan-Ake Larsson + + * draw.c: + * dvi.c: + * special.c: Change DVIGetCommand so that the command is + zero-terminated. This simplifies string operations on specials and + makes the length argument to SetSpecial unnecessary. Handle + preview-bop-hook correctly + + * special.c: Simplify PostScript header and multi-special + handling + + * color.c: + * draw.c: + * dvi.c: + * dvipng.h: + * font.c: + * ft.c: + * misc.c: + * set.c: + * special.c: + * t1.c: Split the flags variable into page_flags, option_flags and + dvi->flags + + * dvi.c: + * dvipng.c: dvi->flags resets now when the dvi is reopened + +2007-08-06 Jan-Ake Larsson + + * ft.c: + * misc.c: + * t1.c: + * tfm.c: + * vf.c: Memory fixes + +2007-07-24 Jan-Ake Larsson + + * special.c: Fix PostScript header usage + +2007-07-22 Jan-Ake Larsson + + * misc.c: Change version info slightly + + * ft.c: Change debug info slightly + +2007-07-21 Jan-Ake Larsson + + * special.c: Rewrite to allow for raw PostScript specials, also + use PostScript headers + + * dvipng.h: + * dvi.c: Add read-ahead for PostScript specials + + * config.h.in: + * configure.ac: Add test for gd pointer->image conversion + +2007-03-19 Jan-Ake Larsson + + * draw.c: Better handling of glyph index bounds + + * set.c: Check bounds for glyph index + +2006-12-11 Jan-Ake Larsson + + * readme.texi: Fix TODO, mention MediaWiki + + * dvipng.h: Fix for alloca under AIX + + * Makefile.in: mkinstalldirs is in $(srcdir) + +2006-11-11 Jan-Ake Larsson + + * Release 1.9 + + * INSTALL: + * README: Update for 1.9 + + * Makefile.in: Make the test fail if fonts not found + + * configure.ac: Don't use "which". Add info about the selfauto + stuff. Report if CJK support present + + * test_dvipng.tex: Remove the (intentional) failing special + +2006-11-07 Jan-Ake Larsson + + * fontmap.c: Don't warn if ttfonts.map is missing, fix pointer + + * Makefile.in: Adjust manpage target so manual intervention isn't + needed anymore + + * dvipng.1: Update manpage + + * dvipng.texi: Update for 1.9 + + * COPYING, Makefile.in, color.c, commands.h, configure.ac, draw.c, + dvi.c, dvipng.c, dvipng.h, dvipng.texi, enc.c, font.c, fontmap.c, + ft.c, macros.texi, miktex.h, miktex.mak, misc.c, papersiz.c, pk.c, + ppagelist.c, set.c, sfd.c, special.c, t1.c, test_dvipng.tex, + tfm.c, vf.c: Update FSF address + + * fontmap.c: Add ttfonts.map to the searched font maps + + * RELEASE: Prepare for 1.9 + +2006-11-02 Jan-Ake Larsson + + * dvipng.texi: Nitpicking on bitmapped graphics + +2006-10-13 Jan-Ake Larsson + + * readme.texi: Add note about subfont (CJK) support + + * install.texi: Add that FreeType2 is needed for subfont (CJK) support + +2006-10-12 Jan-Ake Larsson + + * readme.texi: Fix todo + +2006-10-11 Jan-Ake Larsson + + * sfd.c: Change && to || so that multiple subfonts work + + * ft.c: Adjust debug output + + * configure.ac: Add sfd.o + +2006-10-04 Jan-Ake Larsson + + * configure.ac: Prepare for 1.9 + + * sfd.c: Only look for subfont file on recent kpathsea + + * dvipng.c, ft.c, fontmap.c, dvipng.h: Prepare for subfonts (CJK) + + * sfd.c: Added. Used for subfonts (CJK) + + * configure.ac: Change wording of gs helptext + + * ft.c: Adjust debug message, and encoding selection + + * special.c: Adjust debug messages + + * dvipng.texi: Document the --strict option + + * dvipng.c: Fix timer + + * Makefile.in: Add dist target, simplify distclean + + * fontmap.c: Remove segfault occuring for non-existent font + +2006-08-08 Jan-Ake Larsson + + * special.c: Make showpage flag static + + * special.c: + Fix bug with -dSAFER and non-. paths, and bug with pngalpha and + background color + +2006-05-17 Jan-Ake Larsson + + * fontmap.c: Rearrange, simplify, speed up + +2006-05-16 Jan-Ake Larsson + + * ft.c: FT_LOAD_TARGET_LIGHT does not work in some cases, fall + back to FT_LOAD_NO_HINTING + +2006-05-08 Jan-Ake Larsson + + * dvipng.texi: Add credit + + * Makefile.in: add www target + + * README: + * readme.texi: Update capabilities info and preview-latex link + +2006-03-30 Jan-Ake Larsson + + * Release 1.8 + + * RELEASE: Update for 1.8 + + * set.c: + * readme.texi: + * install.texi: + * ft.c: + * dvi.c: + * draw.c: + * README: + * INSTALL: Update copyright + +2006-03-29 Jan-Ake Larsson + + * dvipng.1: + * dvipng.texi: Document new switch, new PostScript inclusion, + rearrange and adjust + + * misc.c: + * INSTALL: + * README: + * install.texi: + * readme.texi: Minimal documentation adjustments + +2006-03-27 Jan-Ake Larsson + + * ft.c: Change to FT_LOAD_TARGET_LIGHT + + * draw.c: Fix segfault in debug mode + + * aclocal.m4: Make sure the kpse_enc_format test fails for the + right reason only + +2006-02-27 Jan-Ake Larsson + + * special.c: Use gs' pngalpha device, render without clipping, + adjust image position + + * set.c: Simplify code, make color cache (page-)persistent + + * draw.c: Reset new flag + + * misc.c: New switch, remove some old switches from fast-help, use + new flag name + + * dvipng.h: New flags + + * configure.ac: + * config.h.in: Simplify gd tests + + * configure.ac: + * aclocal.m4: Check gs devices + +2006-02-10 Jan-Ake Larsson + + * special.c: Use execlp for gs call + +2006-02-03 Jan-Ake Larsson + * special.c: + Revert message about file type, debug information is enough + + * special.c: Warn for nonexistent image decoder + +2006-02-01 Jan-Ake Larsson + + * special.c: Warn with file type when unable to load included image + + * special.c: Read the first byte of file to be included and + compare with magic number + +2006-01-31 Jan-Ake Larsson + + * special.c: Temporary version, just try the different image + decoders and see + + * special.c: Use correct variables + +2006-01-29 Jan-Ake Larsson + + * special.c: Add code to check image access permission + +2006-01-28 Jan-Ake Larsson + + * special.c: Simplify some code + + * papersiz.c: Fix rounding error for length calculation + +2006-01-26 Jan-Ake Larsson + + * color.c: Fix typo that gave a segfault + + * config.h.in: Remove unneeded function check + + * configure.ac: Update for 1.8, remove unneeded function check + + * dvipng.h: Switch debug numbers to coincide with the manual + + * misc.c: Remove isdigit + + * special.c: Add code to include PNG, JPEG and GIF images + +2006-01-12 Jan-Ake Larsson + + * special.c: Add a space in message + + * misc.c: Do more tests for numeric-parameter options + + * dvi.c: Outfilename: only remove .dvi extension, not others + +2005-10-11 Jan-Ake Larsson + + * Release 1.7 + + * INSTALL: Typographic changes + + * README: + * RELEASE: + * configure.ac: + * dvipng.1: + * dvipng.texi: Adjust for 1.7 + + * install.texi: Insert space + + * miktex.h: Adjust for 1.7, I am uncertain which of the new calls + are available in the MIKTeX environment + + * readme.texi: Remove reference to my old laptop + +2005-09-30 Jan-Ake Larsson + + * config.h.in, configure.ac, ft.c: + Only use FT_Library_Version if available + +2005-07-05 jalar + + * Makefile.in: Enable srcdir != builddir + +2005-07-04 jalar + + * font.c: Add length check for font name + +2005-06-28 Jan-Ake Larsson + + * special.c: Read preview-latex version + +2005-06-27 Jan-Ake Larsson + + * Release 1.6 + + * RELEASE: Report what fixes have been done + + * dvipng.texi: Document xcolor adaptations + + * misc.c: Add 'Transparent' in the quick-help + + * special.c: Cosmetics, do a _small_ message for bop-hook redef + +2005-06-16 Jan-Ake Larsson + + * dvipng.h: + * dvipng.c: + * color.c: Revamp colorname interpreter for xcolor + +2005-06-14 Jan-Ake Larsson + + * misc.c: Adjust MIKTeX stuff + +2005-06-13 Jan-Ake Larsson + + * color.c: Don't use strtok, adjust for xcolor + + * special.c: Don't use strtok + +2005-04-25 Jan-Ake Larsson + + * config.h.in: + * configure.ac: + * set.c: Don't do alpha blending in truecolor mode, write alpha + channel to file + +2005-04-20 Jan-Ake Larsson + + * dvipng.texi: Add Credits + +2005-04-19 Jan-Ake Larsson + + * dvipng.h: Fix for sys/types.h conflict in old IRIX systems + + * special.c: Adjust tightpage test + +2005-04-04 Jan-Ake Larsson + + * special.c: Make tightpage option backwards compatible + + * RELEASE: Prepare for 1.6 + + * dvipng.1: Regenerate man page + + * configure.ac: + * dvipng.texi: + * miktex.h: Update version info + + * configure.ac: + * dvipng.texi: + * README: + * readme.texi: Update mailing list address + + * configure.ac: + * config.h.in: + * special.c: Simplify string search + +2005-04-03 Jan-Ake Larsson + + * special.c: Try to detect all preview-latex versions tightpage + code + +2005-03-02 Jan-Ake Larsson + + * set.c: Remove extra debug printout + + * t1.c: Sizes are given in big points in T1lib, in TeX points in + DVI files + + * ft.c: Sizes are given in big points in FreeType, in TeX points + in DVI files + + * dvipng.h: Fix boolean type again + +2005-02-10 Jan-Ake Larsson + + * config.h.in: + * configure.ac: + * dvipng.texi: + * dvipng.h: + * misc.c: + * set.c: Add proper alpha channel + +2005-02-04 Jan-Ake Larsson + + * color.c: + * draw.c: + * dvi.c: + * dvipng.c: + * font.c: + * ft.c: + * misc.c: + * papersiz.c: + * pk.c: + * set.c: + * special.c: + * t1.c: + * tfm.c: + * vf.c: Cosmetic changes to warnings and fatals + + * Release 1.5 + + * RELEASE: Prepare for 1.5 + + * INSTALL: + * Makefile.in: + * README: + * color.c: + * commands.h: + * configure.ac: + * draw.c: + * dvi.c: + * dvipng.1: + * dvipng.c: + * dvipng.h: + * dvipng.texi: + * enc.c: + * font.c: + * fontmap.c: + * ft.c: + * install.texi: + * macros.texi: + * miktex.h: + * misc.c: + * papersiz.c: + * pk.c: + * ppagelist.c: + * readme.texi: + * set.c: + * special.c: + * t1.c: + * test_dvipng.tex: + * tfm.c: + * vf.c: Update Copyright, set version 1.5 + +2005-02-03 Jan-Ake Larsson + + * draw.c: + * dvipng.h: + * set.c: Fix bug in --picky mode + +2005-01-27 Jan-Ake Larsson + + * dvipng.c: Restore --mfmode and --bdpi functionality + +2005-01-25 Jan-Ake Larsson + + * color.c: Fix segfault when trying to find nonexisting dvipsnam + color + + * dvipng.c: Make dvipsnam colors available on command line + +2004-12-10 Jan-Ake Larsson + + * Release 1.4 + + * RELEASE: + * configure.ac: + * dvipng.1: + * dvipng.texi: Set version 1.4 + + * README: Fix formatting + + * misc.c: Use mmap test. Hopefully, it will fail on ULTRIX, mmap + only works on character special devices (and not on regular files) + +2004-12-02 Jan-Ake Larsson + + * config.h.in: + * configure.ac: + * dvipng.h: Move int64_t and uint64_t tests entirely to autoconf + + * dvi.c: Fix signedness + +2004-11-30 Jan-Ake Larsson + + * misc.c: Fix NULL dereference. + +2004-11-25 Jan-Ake Larsson + + * Release 1.3 + + * Makefile.in, README, dvipng.1, readme.texi: Fix dvigif + installation and docs + + * INSTALL: + * README: Add license + + * dvipng.c: Remove duplicate copyright + + * config.h.in: + * configure.ac: Add some tests + + * dvipng.1: + * dvipng.texi: Add some minor things + +2004-11-24 Jan-Ake Larsson + + * config.h.in: + * configure.ac: Test for 64-bit types. + + * dvipng.h: Use char* arithmetic, not void*. And enable use of + gcc -ansi -pedantic. + + * special.c: Don't use C++ comments. + + * papersiz.c: Rewrite + + * draw.c: + * dvi.c: + * font.c: + * ft.c: + * misc.c: + * pk.c: + * tfm.c: + * vf.c: Fix signedness + +2004-11-15 Reiner Steib + + * draw.c, dvipng.c, enc.c, font.c, ft.c, pk.c, special.c, t1.c: + Don't use C++ comments. + +2004-11-05 David Kastrup + + * Makefile.in (install-dvigif): Don't fail if dvigif already + exists. + +2004-11-02 Jan-Åke Larsson + + * dvipng.h: Fix boolean type + +2004-11-01 Jan-Åke Larsson + + * RELEASE: Update for 1.3 + + * dvipng.h: Load alloca.h when available + + * font.c: + * fontmap.c: Remove inline + + * Makefile.in: + * commands.h: + * config.h.in: + * configure.ac: + * install.texi: + * macros.texi: + * miktex.h: + * readme.texi: + * test_dvipng.tex: Add copyright notice + + * color.c: + * draw.c: + * dvi.c: + * dvipng.c: + * dvipng.h: + * enc.c: + * font.c: + * fontmap.c: + * ft.c: + * misc.c: + * papersiz.c: + * pk.c: + * ppagelist.c: + * set.c: + * special.c: + * t1.c: + * tfm.c: + * vf.c: Change c-in-a-circle to (C) + +2004-10-27 Jan-Åke Larsson + + * dvipng.1: + * dvipng.texi: Amend docs + + * misc.c: Amend helptext + +2004-10-26 Jan-Åke Larsson + + * set.c: + * misc.c: + * dvipng.h: Change background transparency + + * configure.ac: Bump version, add test for libz + +2004-10-07 Jan-Åke Larsson + + * dvipng.texi: document change in -o switch + +2004-10-06 Jan-Åke Larsson + + * set.c: Allow longer pagenumbers in output file (e.g., %06d) + +2004-08-18 Jan-Åke Larsson + + * Release 1.2 + + * RELEASE: Change for 1.2 + + * config.h.in: Update + + * dvipng.1: change help text + + * dvipng.texi: update mailing list text. And version. + + * README: + * readme.texi: update info and todo list + + * draw.c, misc.c, dvipng.c, dvipng.h: + Add an intermediate exit status + +2004-08-17 Jan-Åke Larsson + + * misc.c: add --gamma switch + + * special.c: Fix comment + + * set.c: + * dvipng.h: new Gamma function + + * configure.ac: libm is needed by new gamma code + + * dvipng.1: + * dvipng.texi: document new switches + + * draw.c: change name of picky flag + + * special.c: do not call ghostscript when switch given + + * misc.c: add picky and ghostscript switches + + * dvipng.h: add picky and ghostscript flags + +2004-08-06 Jan-Åke Larsson + + * dvipng.texi: Document --png, --gif, and --picky + + * .cvsignore: Add *.gif + + * Makefile.in: Install 'dvigif' if we have GIF support + + * configure.ac: Test for gdImageGif and 'ln -s' + + * config.h.in: GIF support + + * set.c: GIF writing + + * misc.c: basename fixes, --png and --gif fixes, + --no-image-on-warn changes name to --picky + + * dvi.c: basename fixes + + * dvipng.h: Portability fixes, add GIF image flag + +2004-08-02 Jan-Åke Larsson + + * draw.c: Fix behaviour of --no-image-on-warn + +2004-07-01 Jan-Åke Larsson + + * miktex.mak: New, for MIKTeX + + * dvi.c: + * dvipng.c: + * dvipng.h: + * special.c: Adjust for MIKTeX + + * color.c: + * enc.c: + * font.c: + * fontmap.c: + * misc.c: + * pk.c: + * tfm.c: + * vf.c: Move file-mmapping to misc.c, adjust it for MIKTeX + +2004-06-29 Jan-Åke Larsson + + * configure.ac: + * dvipng.h: inttypes.h not available on all platforms + + * special.c: Remove snprintf, not available on certain platforms + +2004-06-27 Jan-Åke Larsson + + * dvipng.c: Fix case of missing font libs + + * fontmap.c: Remove debug printf + + * draw.c: Fix for case of absent font lib(s), correct typo + +2004-06-24 Jan-Åke Larsson + + * fontmap.c: + * pk.c: + * vf.c: More memory fixes + +2004-06-21 Jan-Åke Larsson + + * config.h.in: + * configure.ac: Test for stdbool, munmap and strtol + + * test_dvipng.tex: Change color test + + * dvipng.h: + * misc.c: + * ppagelist.c: Fix -r switch + + * dvipng.h: + * font.c: + * misc.c: + * ppagelist.c: + * special.c: + * t1.c: + * tfm.c: Use stdbool + + * color.c: + * dvi.c: + * dvipng.c: + * dvipng.h: + * enc.c: + * font.c: + * fontmap.c: + * ppagelist.c: + * special.c: Fix memory leak(s) + + * color.c: + * draw.c: + * dvi.c: + * dvipng.h: + * misc.c: + * set.c: + * special.c: Fix color stack + + * draw.c: + * dvipng.h: + * ft.c: + * pk.c: + * set.c: + * t1.c: + * tfm.c: + * vf.c: Simplify char structs + + * color.c: + * draw.c: + * dvi.c: + * dvipng.c: + * dvipng.h: + * enc.c: + * font.c: + * fontmap.c: + * ft.c: + * misc.c: + * papersiz.c: + * pk.c: + * ppagelist.c: + * set.c: + * special.c: + * t1.c: + * tfm.c: + * vf.c: Add copyright notice + +2004-05-31 Jan-Åke Larsson + + * dvipng.1: + * configure.ac: + * RELEASE: + * INSTALL: Release 1.1 + +2004-05-26 Jan-Åke Larsson + + * special.c: Handle source specials + + * test_dvipng.tex: Add failing special and color test + + * dvipng.c: Adjust coment about SELFAUTO... + + * dvi.c: Fix possible overflow + +2004-05-24 Jan-Åke Larsson + + * misc.c: Remove -t, it is not implemented yet + + * dvipng.h: Undef malloc, if defined + +2004-05-18 Jan-Åke Larsson + + * dvipng.texi: Fix build + +2004-05-14 Jan-Åke Larsson + + * config.h.in: Use more tests + + * dvipng.1: Add documentation + + * dvipng.texi: Fix build. Revert to four-argument @node, my + makeinfo cannot handle the one-argument form (yet). + +2004-05-11 Jan-Åke Larsson + + * configure.ac: More tests + +2004-05-09 Jan-Åke Larsson + + * install.texi: T1lib docs + + * dvipng.1: + * dvipng.texi: Add documentation, and spellcheck + + * special.c: + * color.c: Make colors work again. + +2004-05-08 David Kastrup + + * Create new ChangeLog for dvipng + +2004-05-05 Jan-Åke Larsson + + * fontmap.c: Use both kpse_fontmap_format and + _dvips_header_ + + * enc.c: Use configure test + + * configure.ac: Add test for kpse_enc_format, reorder gd + and png tests + + * aclocal.m4: Add test for kpse_enc_format + + * special.c: More informative warnings + +2004-05-04 Jan-Åke Larsson + + * enc.c: + Use the new kpathsea search format kpse_enc_format if available, + otherwise use kpse_tex_ps_header_format + + * fontmap.c: + Fix new kpathsea search type kpse_fontmap_format, use + kpse_dvips_config_format if not available + + * ft.c: Fix sizing + + * draw.c: Simplify LoadT1 call + + * t1.c: Shorten call, fix sizing + + * dvipng.h: Simplify char-storing structure + +2004-05-03 Jan-Åke Larsson + + * fontmap.c, font.c, t1.c, ft.c: + Fix for ps fonts not in psfontmap + +2004-05-02 Jan-Åke Larsson + + * Makefile.in: + * config.h.in: + * configure.ac: + * draw.c: + * dvipng.c: + * dvipng.h: + * enc.c: + * font.c: + * fontmap.c: + * ft.c: + * t1.c: + * misc.c: Add t1lib support + +2004-04-05 Jan-Åke Larsson + + * dvipng.1: + * readme.texi: + * dvipng.texi: + * Makefile.in: Add man page + +2004-03-27 Jan-Åke Larsson + + * dvipng.texi: Fix debug documentations + + * dvipng.c: Dont fail on --mode without --bdpi, output a warning. + +2004-03-26 Jan-Åke Larsson + + * papersiz.c: Remove compiler warning + + * dvipng.texi: + * misc.c: Change year + +2004-03-25 Jan-Åke Larsson + + * special.c: Revert change, not only resolution but also + offset is needed when generating png from ps + + * misc.c: Change helptext + + * configure.ac: Change version number + + * README: Checkin updated README + + * pk.c: + * ft.c: Speed up color cache + + * dvipng.texi: Add info on resolution, change version number + +2004-03-24 Jan-Åke Larsson + + * special.c: Fix missing 'showpage' and a memory leak + + * font.c: Adjust error message + + * dvipng.h: + * ft.c: + * pk.c: Change ink darkness map + + * draw.c: Output page numbers more often. If the user has a + slow terminal he's to blame himself, not me. + + * tfm.c: Include alloca.h if present + +2004-03-23 Jan-Åke Larsson + + * dvipng.texi: Adjust for the new -D option + +2004-03-19 dakas + + * RELEASE: Remove spurious blanks. + +2004-03-19 Jan-Åke Larsson + + * RELEASE: Update, shorten + +2004-03-18 Jan-Åke Larsson + + * RELEASE: + * dvi.c: + * dvipng.c: + * dvipng.h: + * font.c: + * misc.c: + * papersiz.c: + * special.c: Change the behaviour of the -D switch + +2004-03-08 Jan-Åke Larsson + + * font.c: Don't retry on PK generation failure + +2004-03-02 David Kastrup + + * dvi.c (DVIOpen): Fix a buffer overrun error. diff --git a/Build/source/texk/dvipng/dvipng-1.13/ChangeLog.0 b/Build/source/texk/dvipng/dvipng-1.13/ChangeLog.0 new file mode 100644 index 00000000000..3c4689ad8c4 --- /dev/null +++ b/Build/source/texk/dvipng/dvipng-1.13/ChangeLog.0 @@ -0,0 +1,903 @@ +2004-01-16 Jan-Åke Larsson + + * font.c: fix compile without FT2 + +2004-01-12 Jan-Ake Larsson + + * RELEASE: Prepare for 0.9 + + * misc.c: Enable --expand-bbox + + * color.c: + * draw.c: + * dvipng.h: + * font.c: + * misc.c: + * special.c: Enable --no-image-on-warn + + * draw.c: + * dvi.c: + * dvipng.c: + * dvipng.h: + * readme.texi: + * special.c: Fix tightpage behaviour + +2004-01-09 Jan-Ake Larsson + + * special.c: Add preview-latex's "tightpage" code + +2004-01-08 Jan-Ake Larsson + + * dvipng.texi: + * configure.ac: Prepare for 0.9 + + * Makefile.in: clean target + +2004-01-07 Jan-Ake Larsson + + * color.c: + * draw.c: + * dvi.c: + * dvipng.c: + * dvipng.h: + * enc.c: + * font.c: + * fontmap.c: + * ft.c: + * pk.c: + * set.c: + * special.c: + * tfm.c: + * vf.c: Speedup DEBUG + + * pk.c: Fix subpixel offsets + + * dvipng.c: + * dvipng.h: + * font.c: + * misc.c: + * set.c: + * special.c: Fix flags + + * draw.c: Fix bbox + + * dvipng.h: Adjust for freetype >= 2.1.6 + +2003-12-15 Jan-Ake Larsson + + * tfm.c: + * fontmap.c: + * font.c: Fix freeeeeeeeeing + +2003-12-08 Jan-Ake Larsson + + * dvipng.texi: + * configure.ac: + * RELEASE: Prepare for 0.8 + + * ft.c: Fix debug output + + * draw.c: + * dvipng.h: + * dvipng.texi: + * misc.c: Add --height option + + * test_dvipng.tex: A nice equation is true. Behave! + +2003-12-07 Jan-Ake Larsson + + * enc.c: Encodings are _ps_header_s + +2003-12-05 Jan-Åke Larsson + + * misc.c: + * dvipng.texi: + * dvipng.h: + * draw.c: Change --baseline to --depth + +2003-12-01 Jan-Ake Larsson + + * draw.c: + * dvipng.h: + * misc.c: Change to physical pagenumbers, instead of DVI + pagenumbers. DVI pagenumbers will be indicated on STDOUT if they + differ from physical pagenumbers, but the numbering of PNG files + is physical pagenumbers. Old behaviour can be chosen with the + option -dvinum. + + * ppagelist.c: + * misc.c: + * dvipng.texi: Make negative pages render. Now -pp handles + negative pages gracefully too. Remove -pp code taken from dvips. + +2003-11-30 Jan-Ake Larsson + + * draw.c: + * dvipng.c: + * dvipng.h: + * font.c: + * ft.c: + * misc.c: + * pk.c: + * set.c: + * tfm.c: + * vf.c: Include alloca.h when necessary, start preparing + transition to subpixel rendering, do proper cleanup on exit + +2003-11-18 Jan-Åke Larsson + + * enc.c: Fix bug + + * ft.c: + * tfm.c: + * font.c: + * dvipng.h: Add fallback from FT to PK + +2003-11-14 Jan-Åke Larsson + + * Makefile.in: Use $DESTDIR + +2003-11-06 Jan-Åke Larsson + + * special.c: Fix postscript inclusion: placement and + background color + +2003-10-17 Jan-Åke Larsson + + * misc.c: + * font.c: + * dvipng.texi: + * dvipng.h: Add option for freetype activation + + * configure.ac: Add message when freetype is present + + * ft.c: Apparently FreeType hinting is a no-no. Load glyphs + with FT_LOAD_NO_HINTING. Only then output is acceptable. + +2003-10-15 Jan-Åke Larsson + + * fontmap.c: Remove erroneous match + +2003-10-13 Jan-Åke Larsson + + * font.c: Fix font searching order + + * RELEASE: Prepare for 0.7 + + * fontmap.c: + * psfontmap.c: + * configure.ac: Rename psfontmap.c to fontmap.c + +2003-10-08 Jan-Ake Larsson + + * psfontmap.c: Add third bare word: encoding + +2003-10-07 Jan-Ake Larsson + + * misc.c: + * dvipng.texi: Allow for -- on options + + * configure.ac: Prepare for 0.7 + + * Makefile.in: Adjust hint + + * configure.ac: + * config.h.in: Fix helptext in config.h.in + + * test_dvipng.tex: Add some tests for ligatures and sizes + +2003-10-03 Jan-Åke Larsson + + * readme.texi: Document new font support and switches + + * psfontmap.c: Redesign psfontmap loading to use the syntax + from dvips' docs + + * font.c: Enhance TrueType font finding + + * draw.c: Warn if setting char from null font + + * dvipng.h: + * color.c: Load and use psnames.def + +2003-09-28 Jan-Ake Larsson + + * misc.c: Warn for all bad options + +2003-09-24 Jan-Ake Larsson + + * dvipng.texi: + * install.texi: + * misc.c: Fix documentation + +2003-09-23 Jan-Ake Larsson + + * ft.c: + * enc.c: + * dvipng.h: Only load encodings once + +2003-09-18 Jan-Åke Larsson + + * draw.c: + * dvipng.h: + * misc.c: Add -baseline switch + +2003-09-17 Jan-Ake Larsson + + * font.c: Remove compiler warning + + * config.h.in: + * psfontmap.c: + * dvipng.c: + * configure.ac: Fix SELFAUTO... variables if dvipng is not + being installed in main texmf tree. This will make it find config + files and fonts anyway. + +2003-09-16 Jan-Ake Larsson + + * tfm.c: + * psfontmap.c: + * ft.c: + * enc.c: Added for postscript font handling with freetype + + * font.c: Use freetype font loading + + * dvipng.h: Add freetype-related types and declarations, + and simplify glyph rendering + + * pk.c: Simplify glyph rendering + + * dvipng.c: Init freetype + + * dvi.c: Fix strlen bugs + + * draw.c: Add FONT_TYPE_FT drawing + + * configure.ac: + * config.h.in: + * Makefile.in: Adjust for freetype things + +2003-08-29 Jan-Åke Larsson + + * special.c: fix color handling + + * dvipng.c: Increase TIMING output + + * misc.c: + * draw.c: small speedups + + * dvipng.h: + * configure.ac: + * config.h.in: + * Makefile.in: Change handling of the DEBUG and TIMING + flags + +2003-08-26 Jan-Åke Larsson + + * RELEASE, dvipng.texi, configure.ac: + prepare for 0.6 + + * Makefile.in: another install-docs fix + +2003-08-13 Jan-Åke Larsson + + * configure.ac: new test (ps inclusion speedup) + + * draw.c: simplify preprocessor processing, fix SetSpecial + call + + * special.c: speedup for ps image inclusion, fix SetSpecial + call + + * Makefile.in: fix install-docs + +2003-08-04 Jan-Åke Larsson + + * special.c: Argh!, fix compilation for non-truecolor version + + * dvipng.h: Argh!, fix image cache + + * dvipng.texi: + * configure.ac: + * RELEASE: Prepare for 0.5 + + * misc.c: + * dvipng.h: + * set.c: Add preliminary truecolor support + + * pk.c: Benchmark truecolor rendering, no real code change + + * special.c: + * misc.c: + * dvipng.h: Add preliminary image cacheing + + * draw.c: Small adjustments + +2003-07-30 Jan-Åke Larsson + + * draw.c: Fix two bugs so that bounding box again is + correct + + * configure.ac: configuration printout improved + + +2003-07-02 Jan-Åke Larsson + + * dvipng.h: Add prototypes + + * draw.c: minor change + + * RELEASE: prepare for 0.4 + +2003-07-01 Jan-Åke Larsson + + * draw.c, set.c: + Fix rules (again), this time taking maxdrift into account. + + * pk.c: Unfortunately gdImageColorResolveAlpha only works + on truecolor images. Some other day, then. I did fix the + performance of PROPER_OVERSTRIKE, though. + + * readme.texi: Add todo + +2003-06-30 Jan-Åke Larsson + + * dvipng.texi: small fixes + + * vf.c: Speedup macro start/end + + * set.c: Handle offset in draw.c only, allow choice of + compression if gd can do this + + * pk.c: Handle overstrike, either with gd alpha level, if + support exists for that, or "manually". The latter is active if + PROPER_OVERSTRIKE is #defined, currently yes, at roughly 5% + performance loss. + + * misc.c: -z option: choose compression if gd can do this + + * dvipng.h: Proper rounding, gd bells and whistles + + * draw.c: Allow drift a la dvitype, maxdrift=1, handle + offset here only, speedup vf macro start/end + + * config.h.in: + * configure.ac: New tests for gd bells and whistles + + * Makefile.in: Clean README + + * .cvsignore: More files + +2003-06-23 Jan-Åke Larsson + + * configure.ac: + * config.h.in: Added tests for newly added C code + + * Makefile.in: + * dvipng.texi: Reflect move of readme + + * README: + * readme.texi: Moved from README to readme.texi + +2003-06-19 Jan-Åke Larsson + + * special.c: Fix crash on file not found + + * set.c: Code reformatting + + * misc.c: Fix switches, and send warnings/errors to stderr. + + * vf.c: + * pk.c: + * draw.c: Include header only used in this file, here. + + * commands.h: Make draw.c compile without -DDEBUG + + * Makefile.in: Use --disable-debug, fix docs + generation/install, and add 'test' target. + + * README: Update info + + * configure.ac: Add --disable-debug + + * install.texi: Minor changes + + * dvipng.texi: Document difference between -pp and -p + -l + + * dvipng.h: Fix FreeBSD non-C99 header issue + +2003-06-12 Jan-Åke Larsson + + * Makefile.in: Fix SunOS make suffix rule wierdness + + * color.c: Change comment + + * dvi.c (DVIOpen): bugfix ".dvi" completion + + * dvipng.h (PIXROUND): Round down instead of up, SetRule + now has its own rounding mechanism + + * set.c (SetRule): Refine rule drawing, make sure rule is + inside bounding box + +2003-06-10 Jan-Åke Larsson + + * README: + * RELEASE: + * Makefile.in: + * configure.ac: + * dvipng.texi: Prepare for 0.3 + + * vf.c: + * set.c: + * pk.c: + * font.c: + * dvi.c: + * draw.c: simplify DEBUG_PRINT + + * configure.ac: Look for gs + + * special.c: Fixes to gs interaction + + * set.c: Enable -o for output file, no segfault on empty + image, reposition rule to match dvips + + * draw.c: simplify DEBUG_PRINT macro + + * dvi.c: + * misc.c: Enable -o for output file + + * dvipng.h: Enable -o for output file, simplify DEBUG_PRINT + macro + +2003-04-17 Jan-Ake Larsson + + * install.texi: + * dvipng.texi: Rewrite stuff + + * dvipng.h: New debug flag + + * configure.ac: + * config.h.in: Configure GS_PATH + + * special.c: No tempfiles anymore. Communicate with child + through two pipes. + + * configure.ac: + * Makefile.in: Make docs + +2003-04-15 Jan-Åke Larsson + + * macros.texi: Added + + * install.texi, dvipng.texi: Initial version + +2003-03-28 Jan-Åke Larsson + + * README: + * RELEASE: Release 0.2, PostScript type1 font support and + PostScript inclusion. + + * configure.ac: Added configure error message about where + to find libgd. + + * dvipng.h: + * draw.c (DrawCommand): + * special.c (SetSpecial): Postscript inclusion now works. + + * misc.c (DecodeArgs): Fix --help message + + * COPYING: + * RELEASE: + * README: Added files to repository + +2003-03-12 Jan-Åke Larsson + + * dvi.c (DVIFollowToggle): + * misc.c (DecodeArgs): + * dvipng.h: Added '-follow' switch, and code that + implements a follow mode. + +2003-02-27 Jan-Åke Larsson + + * draw.c (DrawPages): + * misc.c (Message): Speed up slightly when not in DEBUG + mode. + + * misc.c (DecodeArgs): Adjust copyright notice. + + * set.c (SetRule): Reposition rules, one dot up. + +2003-01-30 Jan-Åke Larsson + + * Makefile.in: + * configure.ac: Fix includes and linking + + * draw.c: + * font.c: + * pk.c: + * vf.c: + * dvipng.h (font_entry): remove unnamed union + + * dvipng.h: simplify includes + +2003-01-15 Jan-Ake Larsson + + * misc.c: Use autoconf's stuff, use atoi, fix warning + message + + * dvipng.c: + * dvipng.h: Localize position and spacing to draw.c. Fix + timing + + * pk.c: + * set.c: + * special.c: + * vf.c: + * draw.c: Localize position and spacing to draw.c + + * configure.ac: Require gd and kpathsea + +2002-12-03 Jan-Ake Larsson + + * draw.c: unfinished change: repairing + + * draw.c: + * font.c: + * vf.c: use void* in function call + + * dvipng.h: + * draw.c: + * color.c: + * set.c: change names of some functions + + * dvipng.h: + * draw.c: + * dvi.c: + * ppagelist.c: make dvi data more local + + * .cvsignore: + * dvipng.h: + * special.c: + * font.c: + * misc.c: + * dvipng.c: + * configure.ac: + * config.h.in: + * Makefile.in: autoconfiscate + +2002-11-07 Jan-Ake Larsson + + * dvipng.h: + * dvipng.c (main): + * dvi.c (DVIReOpen): Don't re-init, re-open + +2002-10-31 Jan-Ake Larsson + + * dvipng.h: + * dvi.c: Remove globals and Reopen DVI on change (check + mtime) + + * dvipng.c: Reopen DVI on change (check mtime) + +2002-10-30 Jan-Ake Larsson + + * pk.c: Declaration moved here from dvipng.h + + * Makefile: No io.c, no pagequeue.c but ppagelist.c + + * dvipng.h: Rearranged, some new declarations + + * dvipng.c (main): minor changes + + * draw.c (DoPages): use new page-finding mechanisms + + * dvi.c: outfilename handling fixed, page-finding + mechanisms added. + + * misc.c: Ppagelist handling improved, outfilename now + works, added functionality from io.c + + * ppagelist.c: Added. Functionality slightly different from + pagequeue.c + + * pagequeue.c: Revamped. Functionality changed and moved to + ppagelist.c + + * io.c: Removed. Functionality in misc.c + + * .cvsignore: Additions + +2002-10-24 Jan-Ake Larsson + + * dvipng.c (main): + * dvipng.h: + * misc.c (DecodeString): Improve stdin parser + +2002-10-21 Jan-Ake Larsson + + * dvipng.h: Remove globals, fix message output + + * vf.c (SetVF, InitVF), + * font.c (FontDef), + * draw.c (DrawCommand): Bugfix VF handling, fix message + output + + * pk.c (SetPK, InitPK), + * dvi.c (DVIOpen): Fix message output + + * papersiz.c: use int32_t, fix overflow + + * misc.c (DecodeArgs, Message): Fix -d option, remove + globals, fix message output + +2002-10-16 Jan-Ake Larsson + + * dvipng.h: Remove globals + + * dvipng.c (main): Remove globals, improve stdin parser + + * misc.c (DecodeArgs): remove globals, fix helptext + + * pagequeue.c (FindQdPage, QueuePage, QueueParse): + remove globals + + * dvi.c (FindPage): Remove unnecessary test + + * draw.c (DoPages): Do more normal read-ahead + +2002-10-15 Jan-Ake Larsson + + * pk.c, font.c: Minor change + + * misc.c: Simplify, remove (some) globals, fix helptext + + * pagequeue.c, dvipng.h, dvipng.c, + dvi.c, draw.c: Simplify, remove (some) globals + +2002-10-14 Jan-Ake Larsson + + * misc.c, dvipng.h, draw.c: + Added '-T tight' switch + +2002-10-11 Angus Leeming + + * draw.c: + * dvi.c: + * dvipng.[ch]: + * font.c: + * io.c: + * misc.c: + * pagequeue.c: + * papersiz.c: + * pk.c: + * set.c: + * special.c: + * vf.c: remove function prototype macros. + + * dvi.c (DVIGetCommand, CommandLength): + * set.c (SetChar): add a 'break' to the end of the switch + statements (prevents a warning with gcc 3.2). + +2002-10-11 Jan-Ake Larsson + + * special.c: Fix DEBUG, prototypes, and code pruning + + * vf.c, set.c, pk.c, io.c, + font.c, draw.c: Fix DEBUG + + * misc.c, dvi.c, pagequeue.c, + dvipng.h, dvipng.c: Fix pagelist and DEBUG + + +2002-09-20 Jan-Ake Larsson + + * dvipng.h: change font structures, add dvi struct, remove old + global variables, include relevant bits of config.h, restructure + somewhat + + * dvipng.c: remove explicit vf stack + + * special.c: use dvi struct + + * misc.c: minor changes + + * io.c: close file descriptors, not FILE pointers. + + * draw.c: simplify, remove explicit vf stack. + + * set.c: use dvi struct, remove explicit dvi stack. + + * vf.c: use mmap, remove explicit vf stack. + + * pk.c: use mmap + + * font.c: enable dvi struct, prepare for mmap (file descriptors, + not FILE pointers), explicit vf stack removed. + + * dvi.c: use dvi struct + + * Makefile: config.h removed + + * config.h, klibtool, klibtool.config: removed. + +2002-08-30 Jan-Ake Larsson + + * dvi.c: fix bug in STRSIZE zap + + * vf.c: simplify, fix debug info, zap STRSIZE limit + + * misc.c: Fix background transparency + + * dvipng.h, draw.c: Fix FormFeed bug (outfilename + wrong) + + * set.c: Fix FormFeed bug (outfilename wrong), and background + transparency + +2002-08-29 Jan-Ake Larsson + + * dvipng.h: type changes, dvi-io abstraction + + * color.c: comment changed + + * dvipng.c: dvi-io abstraction + + * font.c: type changes, STRSIZE killed + + * io.c: ReadCommand and CommandLength moved to dvi.c, preparations + for mmap + + * set.c: type changes + + * vf.c, pk.c: prepare for mmap, type changes + + * pagequeue.c: type change + + * misc.c: dvi fopen moved to dvi.c, type changes + + * Makefile: pagelist.o gone, dvi.o new + + * draw.c: SetVF moved to vf.c, type and dvi-io abstraction + changes + + * commands.h: added length and debug texts + + * dvi.c: Functionality moved from pagelist.c and misc.c to + dvi.c. Still needs work, but is initial stab at proper abstraction + of dvi-reading stuff. STRSIZE killed. + + * pagelist.c: Functionality moved to dvi.c + + * special.c: DoSpecial now takes a const char* argument, as + opposed to before. + +2002-08-19 Jan-Ake Larsson + + * misc.c: Added -mode switch + +2002-08-14 Jan-Ake Larsson + + * dvipng.h: VF additions, general cleanup + + * dvipng.c: Small adjustments connected to the VF support + + * config.h: Remove unnecessary things + + * pagelist.c: Simplifications + + * color.c: Comment changed + + * special.c, set.c: Scale always equal h/v + + * Makefile: Make vf.o + + * io.c: Start pre-conversion to mmap. Much still to be done. + + * misc.c, set.c, font.c, pk.c, draw.c: Adjust for VF support + + * vf.c: VF support added to dvipng + +2002-06-24 Jan-Ake Larsson + + * Makefile: Cleaned. Vacuumed, in fact. + +2002-06-19 Jan-Ake Larsson + + * pagelist.c: remove Debug bug (!) + +2002-06-13 Jan-Ake Larsson + + * Makefile: new object files + + * special.c, set.c, dvipng.h: cleanup + + * misc.c (ActualFactor): moved to font.c + cleanup + + * font.c (ActualFactor): moved here from misc.c + + * draw.c, dvipng.c, pagelist.c: functionality from dvipng.c spread + to these three + + * pagequeue.c, pages.c: functionality moved from pages.c to + pagequeue.c + + * commands.h: minor adjustments + +2002-06-12 Jan-Ake Larsson + + * special.c: on unimplemented \special, give pixel position + + * misc.c: Bugfix + literal response on stdin interface + + * font.c, dvipng.h: Font handling fixed + + * dvipng.c: prompt on stdin interface + +2002-06-11 Jan-Ake Larsson + + * set.c (SetChar): load chars on PASS_DRAW + -T -O bug fixed + +2002-06-11 Jan-Ake Larsson + + * set.c: Cleanup. Still buggy wrt -O, though. + + * Makefile: DEBUG on for now, postamble.? removed + + * postamble.c: Postamble is no longer read + + * pages.c: Improve page handling: now a queue, not an unordered + set + + * font.c: Improve font handling: search for fonts only when used + + * dvipng.h: Cleanup + + * dvipng.c: Major rewrite: page handling improved + + * misc.c: Fix DVI init + cleanup + +2002-05-30 Jan-Ake Larsson + + * misc.c: Transparent border: '-bd' + + * dvipng.h, set.c: Tiding up + transparent border + + * dvipng.c, font.c: Tidying up + +2002-05-29 Jan-Ake Larsson + + * color.c: Fix cmyk->rgb. + + * misc.c: Add '-fg' and '-bg'. + + * font.c: Tidy up + +2002-05-29 Jan-Ake Larsson + + * dvipng.h: Tidying up, and new global vars + + * io.c: Tidying up + + * papersiz.c: Pagesize matters, adapted from dvips + + * pages.c: Page choosing, from dvips. Not sufficient for our + purposes, but a start + + * dvipng.c, color.c, Makefile, misc.c, set.c: Changed to make + pagesize (-T), offset (-O), page choosing (-pp), and output file + (-o) work. + +2002-05-27 Jan-Ake Larsson + + * pk.c: Changed comments + + * .cvsignore, special.c, set.c, postamble.c, pk.c, misc.c, io.c, + font.c, dvipng.c, color.c, commands.h, dvipng.h: Initial version + + * config.h, Makefile: Initial version, to be replaced by + autoconf'ism + + * klibtool.config, klibtool: Included for now. To be + removed. diff --git a/Build/source/texk/dvipng/dvipng-1.13/INSTALL b/Build/source/texk/dvipng/dvipng-1.13/INSTALL new file mode 100644 index 00000000000..bef302aebd8 --- /dev/null +++ b/Build/source/texk/dvipng/dvipng-1.13/INSTALL @@ -0,0 +1,168 @@ +Installing dvipng +***************** + +Installing dvipng should be simple: merely `./configure', `make', and +`make install'. + +Prerequisites +============= + + * The GD Graphics Draw library, libgd + + The drawing library `libgd' is necessary, and is downloadable at + `http://www.boutell.com/gd', and there are binary packages for + most operating systems from their respective distributors. In any + case, the latest version of the library installs using `autoconf' + so it should not be difficult for you to install it from source, + and then proceed with installing dvipng. + + * The path-searching library kpathsea + + Kpathsea is most likely included in your LaTeX installation, but it + may happen that ./configure does not find it; see below. If you do + not have it, download it from `http://www.ctan.org' and compile it. + I have no experience with this, so I cannot help much here. + + * The font-rendering library FreeType 2 + + While not strictly necessary, a recent FreeType 2 is recommended + since dvipng currently will produce better-quality images when + this library is available. To take advantage of this, you should + have at least FreeType 2.1.9. + + FreeType 2 will enable direct support for PostScript and TrueType + fonts, so that dvipng will not need to generate bitmapped variants + on disk of the TeX fonts since modern TeX distributions include + PostScript versions of them. Then, you can render images at + different (and unusual) resolutions without cluttering the disk + with lots of bitmapped fonts. + + Finally, it will enable subfont support in dvipng. That is, if you + want to render CJK-LaTeX characters, you must have FreeType 2 + installed. + + * The font-rendering library T1lib + + An alternative to FreeType 2 is T1lib, but this will enable only + PostScript fonts in dvipng and will not include subfont support. + Also here, you can render images at different (and unusual) + resolutions without cluttering the disk with lots of bitmapped + fonts. If both FreeType 2 and T1lib are present, FreeType will be + internally preferred by dvipng but T1lib can be chosen at runtime. + + * libpng and libz + + To be able to compress and write PNG files to disk, dvipng (or + really libgd) uses libpng which in turn uses libz. These should be + available on any modern system, if not, download them and install + them. + + * The `texinfo' package + + This is needed for building the documentation. + +Configure +========= + +The first step is to configure the source code, telling it where +various files will be. To do so, run + + ./configure OPTIONS + + (Note: if you have fetched dvipng from CVS rather than a regular +release, you will have to first generate `./configure' by running +`autoconf' 2.53 or later.) + + On many machines, you will not need to specify any options, but if +`configure' cannot determine something on its own, you'll need to help +it out. For a list of the options type + + ./configure --help + + On some machines, the libraries will be installed in directories that +are not in the linker's search path. This will generate an error when +running `./configure', indicating that it cannot find libgd or +libkpathsea (most likely). You then need to specify the path to the +respective library's object files. They are typically called e.g., +`libgd.a' or `libgd.so'. If they are located in e.g., `/sw/local/lib', +do + + ./configure LDFLAGS=-L/sw/local/lib + + If the library is available as a shared object file (`.so'), the +runtime linker may also need to be told where to find the library, then +use + + ./configure LDFLAGS='-L/sw/local/lib -R/sw/local/lib' + + When either of these is necessary, it is likely that the C header +files are also installed in directories that are not in the C +preprocessor's search path. This will also generate an error when +running `./configure', indicating that it cannot find e.g., `gd.h' or +`kpathsea.h' (most likely). You then need to specify the path to the +respective library's C header files. If they are located in e.g., +`/sw/local/include', do + + ./configure CPPFLAGS=-I/sw/local/include + + On my SUN Solaris workstation, I had to combine this into + + ./configure CPPFLAGS='-I/sw/local/include -I/sw/tex/teTeX/1.0/include'\ + LDFLAGS='-L/sw/local/lib -R/sw/local/lib -L/sw/tex/teTeX/1.0/lib/' + +where the backslash denotes a continuation of the line. + +Build/install +============= + +Once `configure' has been run, simply enter + + make + +at the prompt to compile the C code, and build the documentation files. +To install the files into the locations chosen earlier, type + + make install + +You may need special privileges to install, e.g., if you are installing +into system directories. + +Installation outside the texmf tree +=================================== + +In some cases, a dvipng binary installed outside the texmf tree will +not be able to find virtual fonts, or the PostScript font maps +(normally used by dvips). This may be because _only_ $SELFAUTOLOC, +$SELFAUTODIR, and $SELFAUTOPARENT are used in the texmf tree +configuration file `texmf.cnf'. If so, give the switch +`--enable-selfauto-set' to `./configure'. This will make dvipng adjust +these three internally so that kpathsea thinks that dvipng _is_ +installed in the texmf tree. + +Installation for non-privileged users +===================================== + +Often people without system administration privileges want to install +software for their private use. In that case you need to specify more +options to the `configure' script, usually this is done by using the +`--prefix' option to the `configure' script, and let it point to the +personal home directory. In that way, resulting binaries will be +installed under the `bin' subdirectory of your home directory, manual +pages under `man' and so on. That way, it is reasonably easy to +maintain a bunch of additional packages, since the prefix argument is +supported by most `configure' scripts. + + You'll have to add something like `/home/myself/bin' to your `PATH' +shell variable, if it isn't there already, and similarly set the +`INFOPATH' and `MANPATH' variables to be able to access the +documentation. + +Copying +======= + +This program is released under the GNU Lesser General Public License +version 3, see the COPYING file in the dvipng distribution or +`http://www.gnu.org/licenses/'. + + Copyright (C) 2002-2009 Jan-AAke Larsson + diff --git a/Build/source/texk/dvipng/dvipng-1.13/Makefile.in b/Build/source/texk/dvipng/dvipng-1.13/Makefile.in new file mode 100644 index 00000000000..0e2ce2eaa00 --- /dev/null +++ b/Build/source/texk/dvipng/dvipng-1.13/Makefile.in @@ -0,0 +1,168 @@ +# Makefile is generated by 'configure' from Makefile.in + +#************************************************************************ +# +# Part of the dvipng distribution +# +# This program is free software: you can redistribute it and/or modify +# it under the terms of the GNU Lesser General Public License as +# published by the Free Software Foundation, either version 3 of the +# License, or (at your option) any later version. +# +# This program is distributed in the hope that it will be useful, but +# WITHOUT ANY WARRANTY; without even the implied warranty of +# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU +# Lesser General Public License for more details. +# +# You should have received a copy of the GNU Lesser General Public +# License along with this program. If not, see +# . +# +# Copyright (C) 2002-2008 Jan-Åke Larsson +# +#************************************************************************ + +PACKAGE_STRING="@PACKAGE_STRING@" + +CC = @CC@ +CFLAGS = @CFLAGS@ -Wall +CPPFLAGS = @CPPFLAGS@ -I. +LN_S = @LN_S@ + +LIBS = @LIBS@ +LDFLAGS = @LDFLAGS@ + +srcdir = @srcdir@ +VPATH = @srcdir@ + +prefix = @prefix@ +exec_prefix = @exec_prefix@ +bindir = @bindir@ +infodir = @infodir@ +mandir = @mandir@ +DESTDIR= +INSTALL = @INSTALL@ +INSTALL_DATA = @INSTALL_DATA@ +MKINSTALLDIRS = $(srcdir)/mkinstalldirs + +MAKEINFO=@MAKEINFO@ @MAKEINFO_MACROS@ +INSTALL_INFO=@INSTALL_INFO@ +TEX=tex +TEXIDVI=texi2dvi +TEXIHTML=texi2html +DVIPS=dvips +TEXIFILES = dvipng.texi readme.texi install.texi macros.texi dvipng.help + +objects = dvipng.o color.o draw.o dvi.o font.o misc.o pk.o \ + set.o special.o papersiz.o ppagelist.o \ + vf.o @PSFONTS_O@ + +all: dvipng docs + +install: @INSTALL_BIN_TARGET@ @INSTALL_BIN_TARGET@-docs + +####################################### The program + +dvipng: $(objects) + $(CC) $(LDFLAGS) $(objects) -o dvipng $(LIBS) + +$(objects): dvipng.h commands.h config.h + +install-dvipng: dvipng + -$(MKINSTALLDIRS) $(DESTDIR)$(bindir) + $(INSTALL) dvipng $(DESTDIR)$(bindir) + +install-dvigif: install-dvipng + (cd $(DESTDIR)$(bindir) && rm -f dvigif && $(LN_S) dvipng dvigif) + +####################################### The documentation + +docs: dvipng.dvi dvipng.info + +dvipng.dvi: $(TEXIFILES) + -$(TEXIDVI) -I $(srcdir) $(srcdir)/dvipng.texi + +dvipng.ps: dvipng.dvi + $(DVIPS) -Ppdf dvipng.dvi + +dvipng.info: $(TEXIFILES) dvipng.help + -$(MAKEINFO) -I$(srcdir) $(srcdir)/dvipng.texi + +dvipng.help: dvipng + -./dvipng > dvipng.tmp + ( test -r dvipng.help && diff dvipng.tmp dvipng.help ) \ + || cp dvipng.tmp dvipng.help + rm -f dvipng.tmp + +www: $(TEXIFILES) dvipng.help + texi2html -split chapter -nosec-nav -subdir html \ + -I $(srcdir) $(srcdir)/dvipng.texi + (cd html; for i in *; do \ + sed -e "s/Jan-A/Jan-\Å\;/g" $$i > ../www/$$i; \ + done) + cp www/dvipng.html www/index.html + rm -rf html + +dvipng_mono.html: $(TEXIFILES) dvipng.help + texi2html --monolithic -nomenu -nosec_nav -o dvipng_mono.html \ + -I $(srcdir) $(srcdir)/dvipng.texi + +install-docs: docs + -$(MKINSTALLDIRS) $(DESTDIR)$(infodir) + for x in dvipng.info* ; do \ + $(INSTALL_DATA) $$x $(DESTDIR)$(infodir) ; \ + done + -$(INSTALL_INFO) --info-dir=$(DESTDIR)$(infodir) dvipng.info + -$(MKINSTALLDIRS) $(DESTDIR)$(mandir)/man1 + $(INSTALL_DATA) $(srcdir)/dvipng.1 $(DESTDIR)$(mandir)/man1 + +install-dvipng-docs: install-docs + +install-dvigif-docs: install-docs + (cd $(DESTDIR)$(mandir)/man1 && rm -f dvigif.1 && $(LN_S) dvipng.1 dvigif.1) + +####################################### The test + +test: test_dvipng.dvi dvipng + ./dvipng -T tight -strict test_dvipng + echo View the result e.g. with xv test_dvipng\*.png + +test_dvipng.dvi: test_dvipng.tex + latex $(srcdir)/test_dvipng.tex + +####################################### The cleaning up + +clean: + rm -f *.o dvipng *.help *.info* *dvipng.dvi *.aux *.log + rm -f *dvipng.ps *.cp *.fn *.ky *~ \#*\# \ + *.tp *.vr *.pg *.toc *.tp *.bak *.cps *.kys *.tps \ + *.fns *.vrs *.pgs *.html *.tmp + +distclean: clean + rm -f Makefile + rm -f config.status config.log config.cache c-auto.h + +####################################### Maintainer targets + +INSTALL: install.texi + -$(MAKEINFO) -D rawfile --no-headers --no-validate \ + --no-number-sections \ + -I$(srcdir) $(srcdir)/install.texi --output INSTALL + +README: readme.texi + -$(MAKEINFO) -D rawfile --no-headers --no-validate \ + --no-number-sections \ + -I$(srcdir) $(srcdir)/readme.texi --output README + +dvipng.1: dvipng.texi readme.texi + texi2pod.pl -D man $(srcdir)/dvipng.texi | \ + sed -es/@//g -es/previewlatex/preview-latex/g -es/{}//g > dvipng.pod + pod2man --center="User commands" --release=$(PACKAGE_STRING)\ + dvipng.pod > dvipng.1 + rm dvipng.pod + +dist: INSTALL README dvipng.1 distclean + +# SunOS make suffix rule wierdness +.cps.h: + diff --git a/Build/source/texk/dvipng/dvipng-1.13/README b/Build/source/texk/dvipng/dvipng-1.13/README new file mode 100644 index 00000000000..da9ba557f4c --- /dev/null +++ b/Build/source/texk/dvipng/dvipng-1.13/README @@ -0,0 +1,128 @@ +dvipng +****** + +This program makes PNG and/or GIF graphics from DVI files as obtained +from TeX and its relatives. + + If GIF support is enabled, GIF output is chosen by using the +`dvigif' binary or with the `--gif' option. + + It is intended to produce anti-aliased screen-resolution images as +fast as is possible. The target audience is people who need to generate +and regenerate many images again and again. The primary target is the +preview-latex (X)Emacs package, a package to preview formulas from +within (X)Emacs. Yes, you get to see your formulas in the (X)Emacs +buffer, see `http://www.gnu.org/software/auctex/preview-latex.html'. + + Another example is WeBWorK, an internet-based method for delivering +homework problems to students over the internet, giving students +instant feedback as to whether or not their answers are correct, see +`http://webwork.math.rochester.edu'. + + A more recent addition to the dvipng-using applications out there is +MediaWiki, the software behind Wikipedia and many other wikis out +there. Dvipng is used to render mathematical formulae from version +1.8.0 of MediaWiki, see `http://www.mediawiki.org'. + + Other applications may also benefit, like web applications as +latex2html and WYSIWYG editors like LyX. + +Benefits of dvipng +================== + + The benefits of `dvipng'/`dvigif' include + + * Speed. It is a very fast bitmap-rendering code for DVI files, which + makes it suitable for generating large amounts of images + on-the-fly, as needed in preview-latex, WeBWorK and others. + + * It does not read the postamble, so it can be started before TeX + finishes. There is a `--follow' switch that makes dvipng wait at + end-of-file for further output, unless it finds the POST marker + that indicates the end of the DVI. + + * Interactive query of options. dvipng can read options interactively + through stdin, and all options are usable. It is even possible to + change the input file through this interface. + + * Supports PK, VF, PostScript Type1, and TrueType fonts, subfonts + (i.e., as used in CJK-LaTeX), color specials, and inclusion of + PostScript, PNG, JPEG or GIF images. + + * and more... + + +Installation +============ + +Read `INSTALL', included in the distribution. + +Usage +===== + +To use dvipng at its simplest, simply type + + dvipng foo + +where `foo.dvi' is the output of TeX that you want to convert to PNG +format. If there are four pages in `foo.dvi', those pages will be +output as `foo1.png', `foo2.png', `foo3.png', and `foo4.png', +respectively. + + Many options are available (see the info manual). For a brief +summary of available options, just type + + dvipng --help + +Availability +============ + +The dvipng package is available at Savannah, the GNU project site. Since +dvipng is not part of the GNU project, although released under the GNU +GPL, the web address is `http://savannah.nongnu.org/projects/dvipng'. +Instructions for anonymous CVS access can be found at +`http://savannah.nongnu.org/cvs/?group=dvipng'. + +Contacts +======== + +Bug reports should be sent to . + + Questions, suggestions for new features, pleas for help, and/or +praise should go to . For more information on this +mailing list, send a message with just the word `help' as subject or +body to or look at +`http://lists.nongnu.org/mailman/listinfo/dvipng'. + + Offers to support further development will be appreciated. For +developer access, ask on . + +Copying +======= + +This program is released under the GNU Lesser General Public License +version 3, see the COPYING file in the dvipng distribution or +`http://www.gnu.org/licenses/'. + + Copyright (C) 2002-2009 Jan-AAke Larsson + +Todo +==== + + * Use gs interpreter library for speed and possibly for + functionality. + + * Add more color models for xcolor compatibility + + * Fix T1lib and PK rendering so it is on par with Freetype. + + * Enable a named pipe as DVI + + * Further speed improvements. + + * Other output specials and source specials. + + * Clean internal structures. Overhaul file handling. + + * Fix the SELFAUTO stuff at runtime rather than at build time + diff --git a/Build/source/texk/dvipng/dvipng-1.13/RELEASE b/Build/source/texk/dvipng/dvipng-1.13/RELEASE new file mode 100644 index 00000000000..d2716760775 --- /dev/null +++ b/Build/source/texk/dvipng/dvipng-1.13/RELEASE @@ -0,0 +1,13 @@ +Release notes for version 1.13 of the dvipng package: + +This program makes PNG graphics from DVI files as obtained from TeX +and its relatives. + + +This release adds the possibility to report the output image width. +Other than that, a segfault occuring from faulty DVIs has been +removed, and a number of build issues have been corrected. + + + +Report any bugs you find, see README for instructions. diff --git a/Build/source/texk/dvipng/dvipng-1.13/aclocal.m4 b/Build/source/texk/dvipng/dvipng-1.13/aclocal.m4 new file mode 100644 index 00000000000..0cd4eddf92e --- /dev/null +++ b/Build/source/texk/dvipng/dvipng-1.13/aclocal.m4 @@ -0,0 +1,237 @@ +# aclocal.m4 generated automatically by aclocal 1.6.3 -*- Autoconf -*- + +# Copyright 1996, 1997, 1998, 1999, 2000, 2001, 2002 +# Free Software Foundation, Inc. +# This file is free software; the Free Software Foundation +# gives unlimited permission to copy and/or distribute it, +# with or without modifications, as long as this notice is preserved. + +# This program is distributed in the hope that it will be useful, +# but WITHOUT ANY WARRANTY, to the extent permitted by law; without +# even the implied warranty of MERCHANTABILITY or FITNESS FOR A +# PARTICULAR PURPOSE. + +# Configure paths for FreeType2 +# Marcelo Magallon 2001-10-26, based on gtk.m4 by Owen Taylor + +dnl AC_CHECK_FT2([MINIMUM-VERSION, [ACTION-IF-FOUND [, ACTION-IF-NOT-FOUND]]]) +dnl Test for FreeType2, and define FT2_CFLAGS and FT2_LIBS +dnl +AC_DEFUN(AC_CHECK_FT2, +[dnl +dnl Get the cflags and libraries from the freetype-config script +dnl +AC_ARG_WITH(ft-prefix, +[ --with-ft-prefix=PREFIX + Prefix where FreeType is installed (optional)], + ft_config_prefix="$withval", ft_config_prefix="") +AC_ARG_WITH(ft-exec-prefix, +[ --with-ft-exec-prefix=PREFIX + Exec prefix where FreeType is installed (optional)], + ft_config_exec_prefix="$withval", ft_config_exec_prefix="") +AC_ARG_ENABLE(freetypetest, +[ --disable-freetypetest Do not try to compile and run + a test FreeType program], + [], enable_fttest=yes) + +if test x$ft_config_exec_prefix != x ; then + ft_config_args="$ft_config_args --exec-prefix=$ft_config_exec_prefix" + if test x${FT2_CONFIG+set} != xset ; then + FT2_CONFIG=$ft_config_exec_prefix/bin/freetype-config + fi +fi +if test x$ft_config_prefix != x ; then + ft_config_args="$ft_config_args --prefix=$ft_config_prefix" + if test x${FT2_CONFIG+set} != xset ; then + FT2_CONFIG=$ft_config_prefix/bin/freetype-config + fi +fi +AC_PATH_PROG(FT2_CONFIG, freetype-config, no) + +min_ft_version=ifelse([$1], ,6.1.0,$1) +AC_MSG_CHECKING(for FreeType - version >= $min_ft_version) +no_ft="" +if test "$FT2_CONFIG" = "no" ; then + no_ft=yes +else + FT2_CFLAGS=`$FT2_CONFIG $ft_config_args --cflags` + FT2_LIBS=`$FT2_CONFIG $ft_config_args --libs` + ft_config_major_version=`$FT2_CONFIG $ft_config_args --version | \ + sed 's/\([[0-9]]*\).\([[0-9]]*\).\([[0-9]]*\)/\1/'` + ft_config_minor_version=`$FT2_CONFIG $ft_config_args --version | \ + sed 's/\([[0-9]]*\).\([[0-9]]*\).\([[0-9]]*\)/\2/'` + ft_config_micro_version=`$FT2_CONFIG $ft_config_args --version | \ + sed 's/\([[0-9]]*\).\([[0-9]]*\).\([[0-9]]*\)/\3/'` + ft_min_major_version=`echo $min_ft_version | \ + sed 's/\([[0-9]]*\).\([[0-9]]*\).\([[0-9]]*\)/\1/'` + ft_min_minor_version=`echo $min_ft_version | \ + sed 's/\([[0-9]]*\).\([[0-9]]*\).\([[0-9]]*\)/\2/'` + ft_min_micro_version=`echo $min_ft_version | \ + sed 's/\([[0-9]]*\).\([[0-9]]*\).\([[0-9]]*\)/\3/'` + if test x$enable_fttest = xyes ; then + ft_config_is_lt="" + if test $ft_config_major_version -lt $ft_min_major_version ; then + ft_config_is_lt=yes + else + if test $ft_config_major_version -eq $ft_min_major_version ; then + if test $ft_config_minor_version -lt $ft_min_minor_version ; then + ft_config_is_lt=yes + else + if test $ft_config_minor_version -eq $ft_min_minor_version ; then + if test $ft_config_micro_version -lt $ft_min_micro_version ; then + ft_config_is_lt=yes + fi + fi + fi + fi + fi + if test x$ft_config_is_lt = xyes ; then + no_ft=yes + else + ac_save_CFLAGS="$CFLAGS" + ac_save_LIBS="$LIBS" + CFLAGS="$CFLAGS $FT2_CFLAGS" + LIBS="$FT2_LIBS $LIBS" +dnl +dnl Sanity checks for the results of freetype-config to some extent +dnl + AC_TRY_RUN([ +#include +#include FT_FREETYPE_H +#include +#include + +int +main() +{ + FT_Library library; + FT_Error error; + + error = FT_Init_FreeType(&library); + + if (error) + return 1; + else + { + FT_Done_FreeType(library); + return 0; + } +} +],, no_ft=yes,[echo $ac_n "cross compiling; assumed OK... $ac_c"]) + CFLAGS="$ac_save_CFLAGS" + LIBS="$ac_save_LIBS" + fi # test $ft_config_version -lt $ft_min_version + fi # test x$enable_fttest = xyes +fi # test "$FT2_CONFIG" = "no" +if test x$no_ft = x ; then + AC_MSG_RESULT(yes) + ifelse([$2], , :, [$2]) +else + AC_MSG_RESULT(no) + if test "$FT2_CONFIG" = "no" ; then + echo "*** The freetype-config script installed by FreeType 2 could not be found." + echo "*** If FreeType 2 was installed in PREFIX, make sure PREFIX/bin is in" + echo "*** your path, or set the FT2_CONFIG environment variable to the" + echo "*** full path to freetype-config." + else + if test x$ft_config_is_lt = xyes ; then + echo "*** Your installed version of the FreeType 2 library is too old." + echo "*** If you have different versions of FreeType 2, make sure that" + echo "*** correct values for --with-ft-prefix or --with-ft-exec-prefix" + echo "*** are used, or set the FT2_CONFIG environment variable to the" + echo "*** full path to freetype-config." + else + echo "*** The FreeType test program failed to run. If your system uses" + echo "*** shared libraries and they are installed outside the normal" + echo "*** system library path, make sure the variable LD_LIBRARY_PATH" + echo "*** (or whatever is appropiate for your system) is correctly set." + fi + fi + FT2_CFLAGS="" + FT2_LIBS="" + ifelse([$3], , :, [$3]) +fi +AC_SUBST(FT2_CFLAGS) +AC_SUBST(FT2_LIBS) +]) + + +dnl +dnl MAKEINFO_CHECK_MACRO( MACRO, [ACTION-IF-FOUND +dnl [, ACTION-IF-NOT-FOUND]]) +dnl +AC_DEFUN(MAKEINFO_CHECK_MACRO, +[if test -n "$MAKEINFO" -a "$makeinfo" != ":"; then + AC_MSG_CHECKING([for @$1{}]) + echo \\\\input texinfo > conftest.texi + echo @$1{test} >> conftest.texi + if $MAKEINFO conftest.texi > /dev/null 2> /dev/null; then + AC_MSG_RESULT(yes) + ifelse([$2], , :, [$2]) + else + AC_MSG_RESULT(no) + ifelse([$3], , :, [$3]) + fi + rm -f conftest.texi conftest.info +fi +]) + +dnl +dnl MAKEINFO_CHECK_MACROS( MACRO ... [, ACTION-IF-FOUND +dnl [, ACTION-IF-NOT-FOUND]]) +dnl +AC_DEFUN(MAKEINFO_CHECK_MACROS, +[for ac_macro in $1; do + MAKEINFO_CHECK_MACRO($ac_macro, $2, + [MAKEINFO_MACROS="-D no-$ac_macro $MAKEINFO_MACROS" + $3])dnl + done +AC_SUBST(MAKEINFO_MACROS) +]) + + +dnl +dnl Check for enc, cmap, sfd formats +dnl +AC_DEFUN(AC_HAS_KPSE_ENC_FORMATS, + [AC_MSG_CHECKING([for kpse_enc_format]) + AC_TRY_COMPILE([ + #include + #include ], + [kpse_enc_format;kpse_cmap_format;kpse_sfd_format], + [AC_MSG_RESULT(yes) + AC_DEFINE(HAVE_KPSE_ENC_FORMATS, 1, + [Define to 1 if your kpathsea has kpse_enc_format])], + [AC_MSG_RESULT(no)])]) + + +dnl +dnl Check devices for GS +dnl AC_GS_HAS_DEVICE(DEVICE,ACTION-IF-FAILED) +dnl +AC_DEFUN(AC_GS_HAS_DEVICE, + [AC_MSG_CHECKING([whether $GS has the $1 device]) + if $GS -h | grep $1 >/dev/null; then + AC_MSG_RESULT(yes) + else + AC_MSG_RESULT(no) + $2 + fi +]) + +dnl +dnl GS_CHECK_DEVICES +dnl +AC_DEFUN(GS_CHECK_DEVICES, + [GS_WARN="" + AC_GS_HAS_DEVICE(pngalpha, + [GS_WARN="Your EPS inclusions will be cropped to the + boundingbox, and rendered on an opaque background. + Upgrade GhostScript to avoid this." + AC_GS_HAS_DEVICE(png16m, + [GS_WARN="Your EPS inclusions may not work. + Upgrade/install GhostScript to avoid this."])]) + if test -n "$GS_WARN"; then + AC_MSG_WARN([$GS_WARN]) + fi +]) diff --git a/Build/source/texk/dvipng/dvipng-1.13/color.c b/Build/source/texk/dvipng/dvipng-1.13/color.c new file mode 100644 index 00000000000..3bc3495a59b --- /dev/null +++ b/Build/source/texk/dvipng/dvipng-1.13/color.c @@ -0,0 +1,443 @@ +/* color.c */ + +/************************************************************************ + + Part of the dvipng distribution + + This program is free software: you can redistribute it and/or modify + it under the terms of the GNU Lesser General Public License as + published by the Free Software Foundation, either version 3 of the + License, or (at your option) any later version. + + This program is distributed in the hope that it will be useful, but + WITHOUT ANY WARRANTY; without even the implied warranty of + MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU + Lesser General Public License for more details. + + You should have received a copy of the GNU Lesser General Public + License along with this program. If not, see + . + + Copyright (C) 2002-2010 Jan-Åke Larsson + +************************************************************************/ + +#include "dvipng.h" + +/* + * Color. We delete and recreate the gdImage for each new page. This + * means that the stack must contain rgb value not color index. + * Besides, the current antialiasing implementation needs rgb anyway. +*/ + +struct colorname { + struct colorname *next; + char* color; + char name[1]; +} *colornamep=NULL,*xcp=NULL; + +const char *colordef[]={"xcolor.sty","dvipsnam.def", + "svgnam.def","x11nam.def",NULL}; +char *xcpname=NULL; + +void initcolor(void) +{ + csp = 1; + cstack[0].red=255; + cstack[0].green=255; + cstack[0].blue=255; + cstack[1].red=0; + cstack[1].green=0; + cstack[1].blue=0; +} + +static struct colorname * NewColor(const char* prefix, int nprefix, + char* name, int nname, + char* model, int nmodel, + char* values, int nvalues) +{ + struct colorname *tmp = + malloc(sizeof(struct colorname)+3+nprefix+nname+nmodel+nvalues); + if (tmp==NULL) + Fatal("Cannot malloc space for color name"); + tmp->color=tmp->name+nprefix+nname+1; + strncpy(tmp->name,prefix,nprefix); + strncpy(tmp->name+nprefix,name,nname); + tmp->name[nprefix+nname]='\0'; + strncpy(tmp->color,model,nmodel); + tmp->color[nmodel]=' '; + strncpy(tmp->color+nmodel+1,values,nvalues); + tmp->color[nmodel+nvalues+1]='\0'; + model=tmp->color; + while(*model!='\0') { + if (*model==',') + *model=' '; + model++; + } + DEBUG_PRINT(DEBUG_COLOR,("\n COLOR NAME:\t'%s' '%s'", + tmp->name,tmp->color)); + return(tmp); +} + +#define FINDWORD(s) while(snext=list; + list=tmp; + } else if ((pos+15next=list; + list=tmp; + FINDWORD(pos); + } + } else { + pos++; + while (posnext; + free(xcp); + xcp=next; + } + if (xcpname!=NULL) { + free(xcpname); + xcpname=NULL; + } +} + +void ClearColorNames(void) +{ + struct colorname *next; + while (colornamep) { + next=colornamep->next; + free(colornamep); + colornamep=next; + } + ClearXColorPrologue(); +} + +void InitXColorPrologue(const char* name) +{ + ClearXColorPrologue(); + xcpname=malloc(strlen(name)+1); + if (xcpname==NULL) + Fatal("cannot malloc memory for xcolor prologue name"); + strcpy(xcpname,name); +} + +static struct colorname* LoadXColorPrologue(void) +{ + struct colorname *list=NULL,*tmp=NULL; + char *filepath,*pos,*max; + const char *prefix=""; + char *name,*values,*model; + int nprefix=0,nname,nvalues,nmodel; + struct filemmap fmmap; + boolean mmapfailed; + + filepath=kpse_find_file(xcpname,kpse_program_text_format,false); + if (filepath == NULL) + return NULL; + DEBUG_PRINT(DEBUG_COLOR,("\n OPEN XCOLOR PROLOGUE:\t'%s'", filepath)); + mmapfailed = MmapFile(filepath,&fmmap); + free(filepath); + if (mmapfailed) + return NULL; + pos=fmmap.data; + max=fmmap.data+fmmap.size; + while(posnext=list; + list=tmp; + } + } + UnMmapFile(&fmmap); + return(list); +} + +#define FTO255(a) ((int) (255*a+0.5)) +#define WARN_IF_FAILED(a,b) if (a==b) { page_flags |= PAGE_GAVE_WARN; \ + Warning("missing color-specification value, treated as zero"); } + +#define SKIPSPACES(s) while(s && *s==' ' && *s!='\0') s++ +#define NEXTFLOAT255(c) FTO255(strtod(c,&end)); WARN_IF_FAILED(c,end); c=end +#define NEXTFLOAT(c) strtod(c,&end); WARN_IF_FAILED(c,end); c=end +#define NEXTINT(c) strtol(c,&end,10); WARN_IF_FAILED(c,end); c=end +#define NEXTHEX(c) strtol(c,&end,16); WARN_IF_FAILED(c,end); c=end + +void stringrgb(const char* color,int *r,int *g,int *b) +{ + char* end; + static int unloaded=1; + + DEBUG_PRINT(DEBUG_COLOR,("\n COLOR SPEC:\t'%s' (",color)); + SKIPSPACES(color); + if (strcmp(color,"Black")==0) { + *r = *g = *b = 0; + } else if (strcmp(color,"White")==0) { + *r = *g = *b = 255; + } else if (strncmp(color,"gray ",5)==0) { + color+=5; + *r = *g = *b = NEXTFLOAT255(color); + } else if (strncmp(color,"rgb ",4)==0) { + color+=4; + *r = NEXTFLOAT255(color); + *g = NEXTFLOAT255(color); + *b = NEXTFLOAT255(color); + } else if (strncmp(color,"Gray ",5)==0) { + color+=5; + *r = *g = *b = NEXTINT(color); + } else if (strncmp(color,"RGB ",4)==0) { + color+=4; + *r = NEXTINT(color); + *g = NEXTINT(color); + *b = NEXTINT(color); + } else if (strncmp(color,"HTML ",5)==0) { + color+=5; + *b = NEXTHEX(color); + *r = *b/65536; + *g = *b/256; + *b -= *g*256; + *g -= *r*256; + } else if (strncmp(color,"cmy ",4)==0 + || strncmp(color,"cmyk ",5)==0) { + int c,m,y,k; + color+=3; + k=(*color=='k'); + if (k) + color++; + c = NEXTFLOAT255(color); + m = NEXTFLOAT255(color); + y = NEXTFLOAT255(color); + if (k) + k = NEXTFLOAT255(color); + *r = c+k<255 ? 255-(c+k) : 0; + *g = m+k<255 ? 255-(m+k) : 0; + *b = y+k<255 ? 255-(y+k) : 0; + } else if (strncmp(color,"hsb ",4)==0 + || strncmp(color,"HSB ",4)==0) { + /* The hsb and HSB models really need more presicion. + Use double and convert back*/ + double hu,sa,br,f,R,G,B; + int i; + if (*color=='h') { + color+=4; + hu = NEXTFLOAT(color); + sa = NEXTFLOAT(color); + br = NEXTFLOAT(color); + } else { + color+=4; + hu = (float)NEXTINT(color); hu /= 255; + sa = (float)NEXTINT(color); sa /= 255; + br = (float)NEXTINT(color); br /= 255; + } + i=6*hu; + f=6*hu-i; + switch(i) { + case 0: + R = br*(1-sa*0); G = br*(1-sa*(1-f)); B = br*(1-sa*1); break; + case 1: + R = br*(1-sa*f); G = br*(1-sa*0); B = br*(1-sa*1); break; + case 2: + R = br*(1-sa*1); G = br*(1-sa*0); B = br*(1-sa*(1-f)); break; + case 3: + R = br*(1-sa*1); G = br*(1-sa*f); B = br*(1-sa*0); break; + case 4: + R = br*(1-sa*(1-f)); G = br*(1-sa*1); B = br*(1-sa*0); break; + case 5: + R = br*(1-sa*0); G = br*(1-sa*1); B = br*(1-sa*f); break; + default: + R = br*(1-sa*0); G = br*(1-sa*1); B = br*(1-sa*1); + } + *r=FTO255(R); + *g=FTO255(G); + *b=FTO255(B); + } else { + /* Model not found, probably a color name */ + struct colorname *tmp; + + if (xcp==NULL && xcpname!=NULL) + xcp=LoadXColorPrologue(); + tmp=xcp; + while(tmp!=NULL && strcmp(color,tmp->name)!=0) + tmp=tmp->next; + if (tmp==NULL) { + if (colornamep==NULL) + colornamep=LoadColornameFile(colordef[0]); + tmp=colornamep; + while((tmp->next!=NULL || colordef[unloaded]!=NULL) + && strcmp(color,tmp->name)!=0) { + if (tmp->next==NULL) + tmp->next=LoadColornameFile(colordef[unloaded++]); + tmp=tmp->next; + } + } + if (strcmp(color,tmp->name)==0) { + /* Found: one-level recursion */ + DEBUG_PRINT(DEBUG_COLOR,("\n ---RECURSION--- ")) + stringrgb(tmp->color,r,g,b); + } else { + /* Not found, warn */ + page_flags |= PAGE_GAVE_WARN; + Warning("unimplemented color specification '%s'",color); + } + } + DEBUG_PRINT(DEBUG_COLOR,("%d %d %d) ",*r,*g,*b)) +} + +void background(const char* p) +{ + stringrgb(p, &cstack[0].red, &cstack[0].green, &cstack[0].blue); + DEBUG_PRINT(DEBUG_COLOR,("\n BACKGROUND:\t(%d %d %d) ", + cstack[0].red, cstack[0].green, cstack[0].blue)); +} + +void pushcolor(const char * p) +{ + if ( ++csp == STACK_SIZE ) + Fatal("out of color stack space") ; + stringrgb(p, &cstack[csp].red, &cstack[csp].green, &cstack[csp].blue); + DEBUG_PRINT(DEBUG_COLOR,("\n COLOR PUSH:\t(%d %d %d) ", + cstack[csp].red, cstack[csp].green, cstack[csp].blue)) +} + +void popcolor(void) +{ + if (csp > 1) csp--; /* Last color is global */ + DEBUG_PRINT(DEBUG_COLOR,("\n COLOR POP\t")) +} + +void resetcolorstack(const char * p) +{ + if ( csp > 1 ) + Warning("global color change within nested colors"); + csp=0; + pushcolor(p) ; + DEBUG_PRINT(DEBUG_COLOR,("\n RESET COLOR:\tbottom of stack:")) +} + +void StoreColorStack(struct page_list *tpagep) +{ + int i=0; + + DEBUG_PRINT(DEBUG_COLOR,("\n STORE COLOR STACK:\t %d ", csp)); + tpagep->csp=csp; + while ( i <= csp ) { + DEBUG_PRINT(DEBUG_COLOR,("\n COLOR STACK:\t %d (%d %d %d) ",i, + cstack[i].red, cstack[i].green, cstack[i].blue)); + tpagep->cstack[i].red = cstack[i].red; + tpagep->cstack[i].green = cstack[i].green; + tpagep->cstack[i].blue = cstack[i].blue; + i++; + } +} + +void ReadColorStack(struct page_list *tpagep) +{ + int i=0; + + DEBUG_PRINT(DEBUG_COLOR,("\n READ COLOR STACK:\t %d ", tpagep->csp)); + csp=tpagep->csp; + while ( i <= tpagep->csp ) { + DEBUG_PRINT(DEBUG_COLOR,("\n COLOR STACK:\t %d (%d %d %d) ",i, + cstack[i].red, cstack[i].green, cstack[i].blue)); + cstack[i].red = tpagep->cstack[i].red; + cstack[i].green = tpagep->cstack[i].green; + cstack[i].blue = tpagep->cstack[i].blue; + i++; + } +} + +void StoreBackgroundColor(struct page_list *tpagep) +{ + /* Background color changes affect the _whole_ page */ + tpagep->cstack[0].red = cstack[0].red; + tpagep->cstack[0].green = cstack[0].green; + tpagep->cstack[0].blue = cstack[0].blue; +} diff --git a/Build/source/texk/dvipng/dvipng-1.13/commands.h b/Build/source/texk/dvipng/dvipng-1.13/commands.h new file mode 100644 index 00000000000..e2a5404bb32 --- /dev/null +++ b/Build/source/texk/dvipng/dvipng-1.13/commands.h @@ -0,0 +1,196 @@ +/* commands.h */ + +/************************************************************************ + + Part of the dvipng distribution + + This program is free software: you can redistribute it and/or modify + it under the terms of the GNU Lesser General Public License as + published by the Free Software Foundation, either version 3 of the + License, or (at your option) any later version. + + This program is distributed in the hope that it will be useful, but + WITHOUT ANY WARRANTY; without even the implied warranty of + MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU + Lesser General Public License for more details. + + You should have received a copy of the GNU Lesser General Public + License along with this program. If not, see + . + + Copyright (C) 2002-2008 Jan-Åke Larsson + +************************************************************************/ + +/* DVI COMMANDS */ +#define DVIFORMAT 2 + +#define SETC_000 0 /* typeset character 0 and move right */ +#define SETC_127 127 /* typeset character 127 and move right */ +#define SET1 128 /* typeset a character and move right */ +#define SET2 129 /* ??? */ +#define SET3 130 /* ??? */ +#define SET4 131 /* ??? */ +#define SET_RULE 132 /* typeset a rule and move right */ +#define PUT1 133 /* typeset a character */ +#define PUT2 134 /* ??? */ +#define PUT3 135 /* ??? */ +#define PUT4 136 /* ??? */ +#define PUT_RULE 137 /* typeset a rule */ +#define NOP 138 /* no operation */ +#define BOP 139 /* beginning of page */ +#define EOP 140 /* ending of page */ +#define PUSH 141 /* save the current positions */ +#define POP 142 /* restore previous positions */ +#define RIGHT1 143 /* move right */ +#define RIGHT2 144 /* ??? */ +#define RIGHT3 145 /* ??? */ +#define RIGHT4 146 /* ??? */ +#define W0 147 /* move right by |w| */ +#define W1 148 /* move right and set |w| */ +#define W2 149 /* ??? */ +#define W3 150 /* ??? */ +#define W4 151 /* ??? */ +#define X0 152 /* move right by |x| */ +#define X1 153 /* move right and set |x| */ +#define X2 154 /* ??? */ +#define X3 155 /* ??? */ +#define X4 156 /* ??? */ +#define DOWN1 157 /* move down */ +#define DOWN2 158 /* ??? */ +#define DOWN3 159 /* ??? */ +#define DOWN4 160 /* ??? */ +#define Y0 161 /* move down by |y| */ +#define Y1 162 /* move down and set |y| */ +#define Y2 163 /* ??? */ +#define Y3 164 /* ??? */ +#define Y4 165 /* ??? */ +#define Z0 166 /* move down by |z| */ +#define Z1 167 /* move down and set |z| */ +#define Z2 168 /* ??? */ +#define Z3 169 /* ??? */ +#define Z4 170 /* ??? */ +#define FONT_00 171 /* set current font to 0 */ +#define FONT_63 234 /* set current font to 63 */ +#define FNT1 235 /* set current font */ +#define FNT2 236 /* Same as FNT1, except that arg is 2 bytes */ +#define FNT3 237 /* Same as FNT1, except that arg is 3 bytes */ +#define FNT4 238 /* Same as FNT1, except that arg is 4 bytes */ +#define XXX1 239 /* extension to \.DVI primitives */ +#define XXX2 240 /* Like XXX1, but 0<=k<65536 */ +#define XXX3 241 /* Like XXX1, but 0<=k<@t$2^{24}$@> */ +#define XXX4 242 /* potentially long extension to \.DVI + primitives */ +#define FNT_DEF1 243 /* define the meaning of a font number */ +#define FNT_DEF2 244 /* ??? */ +#define FNT_DEF3 245 /* ??? */ +#define FNT_DEF4 246 /* ??? */ +#define PRE 247 /* preamble */ +#define POST 248 /* postamble beginning */ +#define POST_POST 249 /* postamble ending */ + +/* undefined_commands 250,251,252,253,254,255 */ + +EXTERN const int8_t dvi_commandlength[256] +#ifdef MAIN +={ + 1,1,1,1,1,1,1,1,1,1, + 1,1,1,1,1,1,1,1,1,1, + 1,1,1,1,1,1,1,1,1,1, + 1,1,1,1,1,1,1,1,1,1, + 1,1,1,1,1,1,1,1,1,1, + 1,1,1,1,1,1,1,1,1,1, + 1,1,1,1,1,1,1,1,1,1, + 1,1,1,1,1,1,1,1,1,1, + 1,1,1,1,1,1,1,1,1,1, + 1,1,1,1,1,1,1,1,1,1, + 1,1,1,1,1,1,1,1,1,1, + 1,1,1,1,1,1,1,1,1,1, + 1,1,1,1,1,1,1,1, /* SETC_000 --- SETC_127 */ + 2,3,4,5,9, /* SET1 --- SET4, SET_RULE */ + 2,3,4,5,9, /* PUT1 --- PUT4, PUT_RULE */ + 1,45,1,1,1, /* NOP, BOP, EOP, PUSH, POP */ + 2,3,4,5, /* RIGHT1 --- RIGHT4 */ + 1,2,3,4,5, /* W0 --- W4 */ + 1,2,3,4,5, /* X0 --- X4 */ + 2,3,4,5, /* DOWN1 --- DOWN4 */ + 1,2,3,4,5, /* Y0 --- Y4 */ + 1,2,3,4,5, /* Z0 --- Z4 */ + 1,1,1,1,1,1,1,1,1,1, + 1,1,1,1,1,1,1,1,1,1, + 1,1,1,1,1,1,1,1,1,1, + 1,1,1,1,1,1,1,1,1,1, + 1,1,1,1,1,1,1,1,1,1, + 1,1,1,1,1,1,1,1,1,1, + 1,1,1,1, /* FONT_00 --- FONT_63 */ + 2,3,4,5, /* FNT1 --- FNT4 */ + 2,3,4,5, /* XXX1 --- XXX4 + special string */ + 16,17,18,19, /* FNT_DEF1 --- FNT_DEF4 + font name */ + 15, /* PRE + TeX comment */ + 29, /* POST */ + 10, /* POST_POST minimum */ + -1,-1,-1,-1,-1,-1 /* undefined */ +} +#endif +; + +EXTERN const char* dvi_commands[256] +#ifdef MAIN +={ +"SETC_000","SETC_001","SETC_002","SETC_003","SETC_004", +"SETC_005","SETC_006","SETC_007","SETC_008","SETC_009", +"SETC_010","SETC_011","SETC_012","SETC_013","SETC_014", +"SETC_015","SETC_016","SETC_017","SETC_018","SETC_019", +"SETC_020","SETC_021","SETC_022","SETC_023","SETC_024", +"SETC_025","SETC_026","SETC_027","SETC_028","SETC_029", +"SETC_030","SETC_031","SETC_032","SETC_033","SETC_034", +"SETC_035","SETC_036","SETC_037","SETC_038","SETC_039", +"SETC_040","SETC_041","SETC_042","SETC_043","SETC_044", +"SETC_045","SETC_046","SETC_047","SETC_048","SETC_049", +"SETC_050","SETC_051","SETC_052","SETC_053","SETC_054", +"SETC_055","SETC_056","SETC_057","SETC_058","SETC_059", +"SETC_060","SETC_061","SETC_062","SETC_063","SETC_064", +"SETC_065","SETC_066","SETC_067","SETC_068","SETC_069", +"SETC_070","SETC_071","SETC_072","SETC_073","SETC_074", +"SETC_075","SETC_076","SETC_077","SETC_078","SETC_079", +"SETC_080","SETC_081","SETC_082","SETC_083","SETC_084", +"SETC_085","SETC_086","SETC_087","SETC_088","SETC_089", +"SETC_090","SETC_091","SETC_092","SETC_093","SETC_094", +"SETC_095","SETC_096","SETC_097","SETC_098","SETC_099", +"SETC_100","SETC_101","SETC_102","SETC_103","SETC_104", +"SETC_105","SETC_106","SETC_107","SETC_108","SETC_109", +"SETC_110","SETC_111","SETC_112","SETC_113","SETC_114", +"SETC_115","SETC_116","SETC_117","SETC_118","SETC_119", +"SETC_120","SETC_121","SETC_122","SETC_123","SETC_124", +"SETC_125","SETC_126","SETC_127", +"SET1","SET2","SET3","SET4","SET_RULE", +"PUT1","PUT2","PUT3","PUT4","PUT_RULE", +"NOP","BOP","EOP","PUSH","POP", +"RIGHT1","RIGHT2","RIGHT3","RIGHT4", +"W0","W1","W2","W3","W4", +"X0","X1","X2","X3","X4", +"DOWN1","DOWN2","DOWN3","DOWN4", +"Y0","Y1","Y2","Y3","Y4", +"Z0","Z1","Z2","Z3","Z4", +"FONT_00","FONT_01","FONT_02","FONT_03","FONT_04", +"FONT_05","FONT_06","FONT_07","FONT_08","FONT_09", +"FONT_10","FONT_11","FONT_12","FONT_13","FONT_14", +"FONT_15","FONT_16","FONT_17","FONT_18","FONT_19", +"FONT_20","FONT_21","FONT_22","FONT_23","FONT_24", +"FONT_25","FONT_26","FONT_27","FONT_28","FONT_29", +"FONT_30","FONT_31","FONT_32","FONT_33","FONT_34", +"FONT_35","FONT_36","FONT_37","FONT_38","FONT_39", +"FONT_40","FONT_41","FONT_42","FONT_43","FONT_44", +"FONT_45","FONT_46","FONT_47","FONT_48","FONT_49", +"FONT_50","FONT_51","FONT_52","FONT_53","FONT_54", +"FONT_55","FONT_56","FONT_57","FONT_58","FONT_59", +"FONT_60","FONT_61","FONT_62","FONT_63", +"FNT1","FNT2","FNT3","FNT4", +"XXX1","XXX2","XXX3","XXX4", +"FNT_DEF1","FNT_DEF2","FNT_DEF3","FNT_DEF4", +"PRE","POST","POST_POST", +"UNDEF_250","UNDEF_251","UNDEF_252","UNDEF_253","UNDEF_254","UNDEF_255" +} +#endif +; + diff --git a/Build/source/texk/dvipng/dvipng-1.13/config.h.in b/Build/source/texk/dvipng/dvipng-1.13/config.h.in new file mode 100644 index 00000000000..9c51686b9df --- /dev/null +++ b/Build/source/texk/dvipng/dvipng-1.13/config.h.in @@ -0,0 +1,224 @@ +/* config.h.in. Generated from configure.ac by autoheader. */ + +/* Define as 1 to get the debug (-d) option. */ +#undef DEBUG + +/* The environment setting for $SELFAUTODIR */ +#undef ENV_SELFAUTODIR + +/* The environment setting for $SELFAUTOLOC */ +#undef ENV_SELFAUTOLOC + +/* The environment setting for $SELFAUTOPARENT */ +#undef ENV_SELFAUTOPARENT + +/* Define as the path to GhostScript. */ +#undef GS_PATH + +/* Define to 1 if you don't have `vprintf' but do have `_doprnt.' */ +#undef HAVE_DOPRNT + +/* Define to 1 if you have the `dup2' function. */ +#undef HAVE_DUP2 + +/* Define to 1 if you have the header file. */ +#undef HAVE_FCNTL_H + +/* Define to 1 if you have the `fork' function. */ +#undef HAVE_FORK + +/* Define to 1 if you have freetype2 */ +#undef HAVE_FT2 + +/* Define to 1 if you have the `ftime' function. */ +#undef HAVE_FTIME + +/* Define to 1 if you have the `FT_Library_Version' function. */ +#undef HAVE_FT_LIBRARY_VERSION + +/* Define to 1 if you have the `gdImageCreateFromJpeg' function. */ +#undef HAVE_GDIMAGECREATEFROMJPEG + +/* Define to 1 if you have the `gdImageCreateFromPngPtr' function. */ +#undef HAVE_GDIMAGECREATEFROMPNGPTR + +/* Define to 1 if you have the `gdImageCreateTrueColor' function. */ +#undef HAVE_GDIMAGECREATETRUECOLOR + +/* Define to 1 if you have the `gdImageGif' function. */ +#undef HAVE_GDIMAGEGIF + +/* Define to 1 if you have the `gdImagePngEx' function. */ +#undef HAVE_GDIMAGEPNGEX + +/* Define to 1 if you have the header file. */ +#undef HAVE_GD_H + +/* Define to 1 if you have the `getpagesize' function. */ +#undef HAVE_GETPAGESIZE + +/* Define to 1 if you have the `gettimeofday' function. */ +#undef HAVE_GETTIMEOFDAY + +/* Define to 1 if you have the header file. */ +#undef HAVE_INTTYPES_H + +/* Define to 1 if you have the header file. */ +#undef HAVE_KPATHSEA_KPATHSEA_H + +/* Define to 1 if your kpathsea has kpse_enc_format */ +#undef HAVE_KPSE_ENC_FORMATS + +/* Define to 1 if you have the `gd' library (-lgd). */ +#undef HAVE_LIBGD + +/* Define to 1 if you have the header file. */ +#undef HAVE_LIBGEN_H + +/* Define to 1 if you have the `kpathsea' library (-lkpathsea). */ +#undef HAVE_LIBKPATHSEA + +/* Define to 1 if you have the `m' library (-lm). */ +#undef HAVE_LIBM + +/* Define to 1 if you have the `png' library (-lpng). */ +#undef HAVE_LIBPNG + +/* Define to 1 if you have the `t1' library (-lt1). */ +#undef HAVE_LIBT1 + +/* Define to 1 if you have the `z' library (-lz). */ +#undef HAVE_LIBZ + +/* Define to 1 if your system has a GNU libc compatible `malloc' function, and + to 0 otherwise. */ +#undef HAVE_MALLOC + +/* Define to 1 if you have the header file. */ +#undef HAVE_MEMORY_H + +/* Define to 1 if you have the `memset' function. */ +#undef HAVE_MEMSET + +/* Define to 1 if you have a working `mmap' system call. */ +#undef HAVE_MMAP + +/* Define to 1 if you have the `munmap' function. */ +#undef HAVE_MUNMAP + +/* Define to 1 if you have the header file. */ +#undef HAVE_PNG_H + +/* Define to 1 if you have the `pow' function. */ +#undef HAVE_POW + +/* Define to 1 if you have the `putenv' function. */ +#undef HAVE_PUTENV + +/* Define to 1 if stdbool.h conforms to C99. */ +#undef HAVE_STDBOOL_H + +/* Define to 1 if you have the header file. */ +#undef HAVE_STDINT_H + +/* Define to 1 if you have the header file. */ +#undef HAVE_STDLIB_H + +/* Define to 1 if you have the `strchr' function. */ +#undef HAVE_STRCHR + +/* Define to 1 if you have the header file. */ +#undef HAVE_STRINGS_H + +/* Define to 1 if you have the header file. */ +#undef HAVE_STRING_H + +/* Define to 1 if you have the `strrchr' function. */ +#undef HAVE_STRRCHR + +/* Define to 1 if you have the `strstr' function. */ +#undef HAVE_STRSTR + +/* Define to 1 if you have the `strtol' function. */ +#undef HAVE_STRTOL + +/* Define to 1 if you have the header file. */ +#undef HAVE_SYS_STAT_H + +/* Define to 1 if you have the header file. */ +#undef HAVE_SYS_TIME_H + +/* Define to 1 if you have the header file. */ +#undef HAVE_SYS_TYPES_H + +/* Define to 1 if you have that is POSIX.1 compatible. */ +#undef HAVE_SYS_WAIT_H + +/* Define to 1 if you have the header file. */ +#undef HAVE_T1LIB_H + +/* Define to 1 if you have the header file. */ +#undef HAVE_UNISTD_H + +/* Define to 1 if you have the `vfork' function. */ +#undef HAVE_VFORK + +/* Define to 1 if you have the header file. */ +#undef HAVE_VFORK_H + +/* Define to 1 if you have the `vprintf' function. */ +#undef HAVE_VPRINTF + +/* Define to 1 if `fork' works. */ +#undef HAVE_WORKING_FORK + +/* Define to 1 if `vfork' works. */ +#undef HAVE_WORKING_VFORK + +/* Define to 1 if the system has the type `_Bool'. */ +#undef HAVE__BOOL + +/* Define to the address where bug reports for this package should be sent. */ +#undef PACKAGE_BUGREPORT + +/* Define to the full name of this package. */ +#undef PACKAGE_NAME + +/* Define to the full name and version of this package. */ +#undef PACKAGE_STRING + +/* Define to the one symbol short name of this package. */ +#undef PACKAGE_TARNAME + +/* Define to the version of this package. */ +#undef PACKAGE_VERSION + +/* Define to 1 if you have the ANSI C header files. */ +#undef STDC_HEADERS + +/* Define to 1 if you can safely include both and . */ +#undef TIME_WITH_SYS_TIME + +/* Define as 1 to get execution time output. */ +#undef TIMING + +/* Define to empty if `const' does not conform to ANSI C. */ +#undef const + +/* Define to `long long' if does not define it. */ +#undef int64_t + +/* Define to rpl_malloc if the replacement function should be used. */ +#undef malloc + +/* Define to `int' if does not define. */ +#undef pid_t + +/* Define to `unsigned int' if does not define. */ +#undef size_t + +/* Define to `unsigned long long' if does not define it. */ +#undef uint64_t + +/* Define as `fork' if `vfork' does not work. */ +#undef vfork diff --git a/Build/source/texk/dvipng/dvipng-1.13/configure.ac b/Build/source/texk/dvipng/dvipng-1.13/configure.ac new file mode 100644 index 00000000000..09e04353fd0 --- /dev/null +++ b/Build/source/texk/dvipng/dvipng-1.13/configure.ac @@ -0,0 +1,225 @@ +# configure.ac + +#************************************************************************ +# +# Part of the dvipng distribution +# +# This program is free software: you can redistribute it and/or modify +# it under the terms of the GNU Lesser General Public License as +# published by the Free Software Foundation, either version 3 of the +# License, or (at your option) any later version. +# +# This program is distributed in the hope that it will be useful, but +# WITHOUT ANY WARRANTY; without even the implied warranty of +# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU +# Lesser General Public License for more details. +# +# You should have received a copy of the GNU Lesser General Public +# License along with this program. If not, see +# . +# +# Copyright (C) 2002-2010 Jan-Åke Larsson +# +#************************************************************************ + +# Process this file with autoconf to produce a configure script. +AC_INIT([dvipng], [1.13], [dvipng@nongnu.org]) +AC_CONFIG_SRCDIR([dvipng.c]) + +AC_ARG_ENABLE(debug, + AC_HELP_STRING([--disable-debug],[Compile without debug (-d) option]), + [ if test "$enableval" = yes ; then + AC_DEFINE(DEBUG, 1, [Define as 1 to get the debug (-d) option.]) + fi ], + [ enable_debug="yes"; + AC_DEFINE(DEBUG, 1, [Define as 1 to get the debug (-d) option.])]) +AC_ARG_ENABLE(timing, + AC_HELP_STRING([--enable-timing],[Output execution time of dvipng]), + [ if test "$enableval" = yes ; then + AC_DEFINE(TIMING, 1, [Define as 1 to get execution time output.]) + fi ]) + +# Checks for programs. +AC_SET_MAKE +AC_PROG_CC +AC_PROG_INSTALL +AC_PROG_LN_S +AC_ARG_WITH(gs, + AC_HELP_STRING([--with-gs=/PATH/TO/gs],[Hard-wire the location of GhostScript]), + [if test "x$withval" != xno ; then + AC_PATH_PROG(GS,["$withval"]) + AC_DEFINE_UNQUOTED(GS_PATH, "$GS", [Define as the path to GhostScript.]) + GS_CHECK_DEVICES + fi], + [AC_CHECK_PROG(GS,gs,gs) + AC_DEFINE_UNQUOTED(GS_PATH, "gs", [Define as the path to GhostScript.]) + if test -n "$GS"; then + GS_CHECK_DEVICES + else + AC_MSG_WARN([Cannot find GhostScript in your PATH]) + fi +]) + +# Checks for libraries. +AC_CHECK_LIB(m, pow) +AC_CHECK_LIB(z, deflate) +AC_CHECK_LIB([png], [png_read_image],, + [AC_MSG_ERROR([cannot find/use libpng])]) +AC_CHECK_LIB([gd], [gdImageCreate],, + [AC_MSG_ERROR([cannot find/use libgd +This drawing library can be downloaded at http://www.boutell.com/gd])]) +AC_CHECK_LIB([kpathsea], [kpse_set_program_name],, + AC_MSG_ERROR([cannot find/use libkpathsea])) +AC_CHECK_LIB([t1], [T1_InitLib]) +PSFONTS_O="" +if test "$ac_cv_lib_t1_T1_InitLib" = yes; then + PSFONTS_O="t1.o" +fi +AC_SUBST(PSFONTS_O) + +# Checks for header files. +AC_HEADER_STDC +AC_CHECK_HEADERS([gd.h png.h kpathsea/kpathsea.h],, + [AC_MSG_ERROR([cannot find/use $ac_header])]) +AC_CHECK_HEADERS([t1lib.h libgen.h]) +AC_CHECK_FT2(,[CFLAGS="$FT2_CFLAGS $CFLAGS" + LIBS="$FT2_LIBS $LIBS" + PSFONTS_O="$PSFONTS_O sfd.o ft.o" + AC_DEFINE(HAVE_FT2, 1, [Define to 1 if you have freetype2]) + ac_have_freetype2="yes"], + [ac_have_freetype2="no"]) +if test -n "$PSFONTS_O"; then + PSFONTS_O="$PSFONTS_O enc.o fontmap.o tfm.o" +fi +AC_HEADER_SYS_WAIT +AC_HEADER_TIME +AC_HEADER_STDBOOL +AC_CHECK_HEADERS([fcntl.h sys/time.h]) + +# Checks for typedefs, structures, and compiler characteristics. +AC_C_CONST +AC_TYPE_PID_T +AC_TYPE_SIZE_T +if test "$ac_cv_header_inttypes_h" = "yes"; then + # Sometimes we want to use gcc -ansi -pedantic as a portability test + # The typedef of int64_t is not in the system header file in that + # case. Then, #define int64_t as "long long", which is non-ansi, but + # is present in most modern compilers. Using a #define rather than a + # typedef can be a problem, but in dvipng int64_t is only used as + # typecast, and there are no problems. autoconf 2.13 equivalent: + # AC_CHECK_TYPE(int64_t, long long) + # AC_CHECK_TYPE(uint64_t, unsigned long long) + AC_CHECK_TYPE([int64_t],, + [AC_DEFINE_UNQUOTED([int64_t], [long long], + [Define to `long long' if + does not define it.])]) + AC_CHECK_TYPE([uint64_t],, + [AC_DEFINE_UNQUOTED([uint64_t], [unsigned long long], + [Define to `unsigned long long' if + does not define it.])]) +fi +AC_HAS_KPSE_ENC_FORMATS + + +# Checks for library functions. +AC_FUNC_FORK +AC_FUNC_MALLOC +AC_FUNC_MMAP +AC_FUNC_STRTOD +AC_FUNC_VPRINTF +AC_CHECK_FUNCS([dup2 memset munmap pow putenv strchr strrchr strtol strstr]) +if test "$enable_timing" = "yes"; then + AC_CHECK_FUNCS([ftime gettimeofday]) +fi +AC_CHECK_FUNCS([gdImageCreateTrueColor gdImageCreateFromJpeg gdImagePngEx gdImageCreateFromPngPtr gdImageGif FT_Library_Version]) +if test "$ac_cv_func_gdImageGif" = "yes"; then + INSTALL_BIN_TARGET="install-dvigif" +else + INSTALL_BIN_TARGET="install-dvipng" +fi +AC_SUBST(INSTALL_BIN_TARGET) + +# Documentation-related checks +AC_PATH_PROG(MAKEINFO, makeinfo, :) +MAKEINFO_CHECK_MACROS(acronym env option) +AC_PATH_PROG(INSTALL_INFO, install-info, :, $PATH /usr/sbin /sbin) + +# SELFAUTO +AC_ARG_ENABLE(selfauto-set, + AC_HELP_STRING([--enable-selfauto-set], + [This option will make the final binary explicitly set the + $SELFAUTO... variables to make it look as dvipng is installed in the + main texmf tree, even if it isn't. This is necessary when texmf.cnf + only uses $SELFAUTO... variables and dvipng is not installed in the + texmf tree. Otherwise, dvipng may not be able to find virtual + fonts, or psfonts.map. To find out, first build the binary and do + 'make test'. If the test fails, you need this switch.]), + [ if test "$enableval" = yes ; then + AC_MSG_CHECKING([for \$SELFAUTOLOC]) + SELFAUTOLOC=`kpsewhich -expand-var=\\\$SELFAUTOLOC` + AC_DEFINE_UNQUOTED(ENV_SELFAUTOLOC,["SELFAUTOLOC=$SELFAUTOLOC"], + [The environment setting for $SELFAUTOLOC]) + AC_MSG_RESULT([$SELFAUTOLOC]) + AC_MSG_CHECKING([for \$SELFAUTODIR]) + SELFAUTODIR=`kpsewhich -expand-var=\\\$SELFAUTODIR` + AC_DEFINE_UNQUOTED(ENV_SELFAUTODIR,["SELFAUTODIR=$SELFAUTODIR"], + [The environment setting for $SELFAUTODIR]) + AC_MSG_RESULT([$SELFAUTODIR]) + AC_MSG_CHECKING([for \$SELFAUTOPARENT]) + SELFAUTOPARENT=`kpsewhich -expand-var=\\\$SELFAUTOPARENT` + AC_DEFINE_UNQUOTED(ENV_SELFAUTOPARENT,["SELFAUTOPARENT=$SELFAUTOPARENT"], + [The environment setting for $SELFAUTOPARENT]) + AC_MSG_RESULT([$SELFAUTOPARENT]) + fi ], + [AC_MSG_CHECKING([for texmf.cnf]) + TEXMF_CNF=`kpsewhich texmf.cnf` + AC_MSG_RESULT([$TEXMF_CNF]) + AC_PATH_PROG(KPSEWHICH, kpsewhich) + AC_MSG_CHECKING([for psfonts.map]) + cp $KPSEWHICH . + PSFONTS_MAP=`./kpsewhich psfonts.map` + rm -f ./kpsewhich + if test -n "$PSFONTS_MAP"; then + AC_MSG_RESULT([$PSFONTS_MAP]) + else + AC_MSG_RESULT([not found from outside the texmf tree]) + AC_MSG_CHECKING([for \$SELFAUTO in texmf.cnf]) + if grep SELFAUTO "$TEXMF_CNF" > /dev/null 2> /dev/null; then + AC_MSG_RESULT([yes +*************************************************************** +texmf.cnf is using \$SELFAUTO... variables. If you are going to +install dvipng outside the texmf tree, you may need to use +--enable-selfauto-set. To find out, do 'make ; make test'. If the test +is unsuccessful, add the mentioned switch and rebuild. +***************************************************************]) + else + AC_MSG_RESULT([no]) + fi + fi]) + +AC_MSG_RESULT([ +** Configuration summary for $PACKAGE_STRING: + + The -d (debug) switch is enabled: $enable_debug + Your gd is new enough (>=2.0) to enable + the --truecolor switch, full alpha + transparency, proper rescaling of + included bitmaps, and jpeg inclusion: $ac_cv_func_gdImageCreateTrueColor + Your gd has jpeg inclusion enabled: $ac_cv_func_gdImageCreateFromJpeg + Your gd is new enough (>=2.0.12) to + enable transparent backgrounds for EPS + inclusion and the -z (compression) + switch: $ac_cv_func_gdImagePngEx + Your gd is new enough (>=2.0.21) to + allow image creation from memory $ac_cv_func_gdImageCreateFromPngPtr + Your gd is new enough (>=2.0.28) to + enable gif inclusion and output + (dvigif): $ac_cv_func_gdImageGif + FreeType font rendering available: $ac_have_freetype2 + Support for subfonts (CJK-LaTeX): $ac_have_freetype2 + T1lib font rendering available: $ac_cv_lib_t1_T1_InitLib +]) + +AC_CONFIG_HEADER([config.h]) +AC_CONFIG_FILES([Makefile]) +AC_OUTPUT diff --git a/Build/source/texk/dvipng/dvipng-1.13/draw.c b/Build/source/texk/dvipng/dvipng-1.13/draw.c new file mode 100644 index 00000000000..a32bd9f19c2 --- /dev/null +++ b/Build/source/texk/dvipng/dvipng-1.13/draw.c @@ -0,0 +1,395 @@ +/* draw.c */ + +/************************************************************************ + + Part of the dvipng distribution + + This program is free software: you can redistribute it and/or modify + it under the terms of the GNU Lesser General Public License as + published by the Free Software Foundation, either version 3 of the + License, or (at your option) any later version. + + This program is distributed in the hope that it will be useful, but + WITHOUT ANY WARRANTY; without even the implied warranty of + MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU + Lesser General Public License for more details. + + You should have received a copy of the GNU Lesser General Public + License along with this program. If not, see + . + + Copyright (C) 2002-2010 Jan-Åke Larsson + +************************************************************************/ + +#include "dvipng.h" + +#ifdef DEBUG +#include /* isprint */ +#endif + +struct stack_entry { + dviunits h, v, w, x, y, z; /* stack entry */ + subpixels hh,vv; +} stack[STACK_SIZE+1]; /* stack + space for current pos */ +struct stack_entry* dvi_stack=stack; + +#define MAXDRIFT 1 +#define CHECK_MAXDRIFT(x,xx) \ + if ( xx-PIXROUND(x,dvi->conv*shrinkfactor) < -MAXDRIFT ) { \ + DEBUG_PRINT(DEBUG_DVI,(" add 1 to")); \ + xx += 1; \ + } \ + if ( xx-PIXROUND(x,dvi->conv*shrinkfactor) > MAXDRIFT ) { \ + DEBUG_PRINT(DEBUG_DVI,(" sub 1 to")); \ + xx -= 1; \ + } \ + if (PIXROUND(dvi_stack->h,dvi->conv*shrinkfactor) != dvi_stack->hh \ + || PIXROUND(dvi_stack->v,dvi->conv*shrinkfactor) != dvi_stack->vv)\ + DEBUG_PRINT(DEBUG_DVI, \ + (" drift (%d,%d)", \ + dvi_stack->hh-PIXROUND(dvi_stack->h,dvi->conv*shrinkfactor), \ + dvi_stack->vv-PIXROUND(dvi_stack->v,dvi->conv*shrinkfactor))); + +#define MoveRight(x) \ + temp=x; dvi_stack->h += temp; \ + if ( currentfont==NULL \ + || temp > currentfont->s/6 || temp < -currentfont->s/6*4 ) \ + dvi_stack->hh = PIXROUND(dvi_stack->h,dvi->conv*shrinkfactor); \ + else \ + dvi_stack->hh += PIXROUND( temp,dvi->conv*shrinkfactor ); \ + CHECK_MAXDRIFT(dvi_stack->h,dvi_stack->hh) + +#define MoveDown(x) \ + temp=x; dvi_stack->v += temp; \ + if ( currentfont==NULL \ + || temp > currentfont->s/6*5 || temp < currentfont->s/6*(-5) ) \ + dvi_stack->vv = PIXROUND(dvi_stack->v,dvi->conv*shrinkfactor); \ + else \ + dvi_stack->vv += PIXROUND( temp,dvi->conv*shrinkfactor ); \ + CHECK_MAXDRIFT(dvi_stack->v,dvi_stack->vv) + +#define DO_VFCONV(a) ((((struct font_entry*) parent)->type==DVI_TYPE)?a:\ + (dviunits)((int64_t) a * ((struct font_entry*) parent)->s / (1 << 20))) + + +dviunits SetChar(int32_t c) +{ + struct char_entry* ptr=NULL; + + if (currentfont==NULL) + Fatal("faulty DVI, trying to set character from null font"); + if (c<0 || c>LASTFNTCHAR) { + Warning("glyph index out of range (%d), skipping",c); + return(0); + } + ptr=currentfont->chr[c]; + if (ptr==NULL) { + Warning("unable to draw glyph %d, skipping",c); + return(0); + } +#ifdef DEBUG + switch (currentfont->type) { + case FONT_TYPE_VF: DEBUG_PRINT(DEBUG_DVI,("\n VF CHAR:\t")); break; + case FONT_TYPE_PK: DEBUG_PRINT(DEBUG_DVI,("\n PK CHAR:\t")); break; + case FONT_TYPE_T1: DEBUG_PRINT(DEBUG_DVI,("\n T1 CHAR:\t")); break; + case FONT_TYPE_FT: DEBUG_PRINT(DEBUG_DVI,("\n FT CHAR:\t")); break; + default: DEBUG_PRINT(DEBUG_DVI,("\n NO CHAR:\t")) + } + if (debug & DEBUG_DVI && c>=0 && c<=UCHAR_MAX && isprint(c)) + DEBUG_PRINT(DEBUG_DVI,("'%c' ",c)); + DEBUG_PRINT(DEBUG_DVI,("%d at (%d,%d) tfmw %d", c, + dvi_stack->hh,dvi_stack->vv,ptr?ptr->tfmw:0)); +#endif + if (currentfont->type==FONT_TYPE_VF) { + return(SetVF(ptr)); + } else { + if (ptr->data == NULL) + switch(currentfont->type) { + case FONT_TYPE_PK: LoadPK(c, ptr); break; +#ifdef HAVE_LIBT1 + case FONT_TYPE_T1: LoadT1(c, ptr); break; +#endif +#ifdef HAVE_FT2 + case FONT_TYPE_FT: LoadFT(c, ptr); break; +#endif + default: + Fatal("undefined fonttype %d",currentfont->type); + } + if (page_imagep != NULL) + return(SetGlyph(ptr, dvi_stack->hh, dvi_stack->vv)); + else { + /* Expand bounding box if necessary */ + min(x_min,dvi_stack->hh - ptr->xOffset/shrinkfactor); + min(y_min,dvi_stack->vv - ptr->yOffset/shrinkfactor); + max(x_max,dvi_stack->hh - ptr->xOffset/shrinkfactor + ptr->w); + max(y_max,dvi_stack->vv - ptr->yOffset/shrinkfactor + ptr->h); + return(ptr->tfmw); + } + } + return(0); +} + +void DrawCommand(unsigned char* command, void* parent /* dvi/vf */) + /* To be used both in plain DVI drawing and VF drawing */ +{ + dviunits temp; + + if (/*command >= SETC_000 &&*/ *command <= SETC_127) { + temp = SetChar((int32_t)*command); + dvi_stack->h += temp; + dvi_stack->hh += PIXROUND(temp,dvi->conv*shrinkfactor); + CHECK_MAXDRIFT(dvi_stack->h,dvi_stack->hh); + } else if (*command >= FONT_00 && *command <= FONT_63) { + SetFntNum((int32_t)*command - FONT_00,parent); + } else switch (*command) { + case PUT1: case PUT2: case PUT3: case PUT4: + DEBUG_PRINT(DEBUG_DVI,(" %d", + UNumRead(command+1, dvi_commandlength[*command]-1))); + (void) SetChar(UNumRead(command+1, dvi_commandlength[*command]-1)); + break; + case SET1: case SET2: case SET3: case SET4: + DEBUG_PRINT(DEBUG_DVI,(" %d", + UNumRead(command+1, dvi_commandlength[*command]-1))); + { + temp = SetChar(UNumRead(command+1, dvi_commandlength[*command]-1)); + dvi_stack->h += temp; + dvi_stack->hh += PIXROUND(temp,dvi->conv*shrinkfactor); + CHECK_MAXDRIFT(dvi_stack->h,dvi_stack->hh); + } + break; + case SET_RULE: + DEBUG_PRINT(DEBUG_DVI,(" %d %d", + UNumRead(command+1, 4), UNumRead(command+5, 4))); + temp = SetRule(DO_VFCONV(UNumRead(command+1, 4)), + DO_VFCONV(UNumRead(command+5, 4)), + dvi_stack->hh, dvi_stack->vv); + dvi_stack->h += temp; + dvi_stack->hh += PIXROUND(temp,dvi->conv*shrinkfactor); + CHECK_MAXDRIFT(dvi_stack->h,dvi_stack->hh); + break; + case PUT_RULE: + DEBUG_PRINT(DEBUG_DVI,(" %d %d", + UNumRead(command+1, 4), UNumRead(command+5, 4))); + (void) SetRule(DO_VFCONV(UNumRead(command+1, 4)), + DO_VFCONV(UNumRead(command+5, 4)), + dvi_stack->hh, dvi_stack->vv); + break; + case BOP: + Fatal("BOP occurs within page"); + break; + case EOP: + break; + case PUSH: + /* is next item on stack? */ + if (dvi_stack == &stack[STACK_SIZE-1]) + Fatal("DVI stack overflow"); + { + struct stack_entry *next=dvi_stack+1; + next->h = dvi_stack->h; + next->v = dvi_stack->v; + next->w = dvi_stack->w; + next->x = dvi_stack->x; + next->y = dvi_stack->y; + next->z = dvi_stack->z; + next->hh = dvi_stack->hh; + next->vv = dvi_stack->vv; + dvi_stack=next; + } + break; + case POP: + if (dvi_stack == stack) + Fatal("DVI stack underflow"); + dvi_stack--; + break; + case RIGHT1: case RIGHT2: case RIGHT3: case RIGHT4: + DEBUG_PRINT(DEBUG_DVI,(" %d", + SNumRead(command+1, dvi_commandlength[*command]-1))); + MoveRight(DO_VFCONV(SNumRead(command+1, dvi_commandlength[*command]-1))); + break; + case W1: case W2: case W3: case W4: + dvi_stack->w = SNumRead(command+1, dvi_commandlength[*command]-1); + DEBUG_PRINT(DEBUG_DVI,(" %d",dvi_stack->w)); + case W0: + MoveRight(DO_VFCONV(dvi_stack->w)); + break; + case X1: case X2: case X3: case X4: + dvi_stack->x = SNumRead(command+1, dvi_commandlength[*command]-1); + DEBUG_PRINT(DEBUG_DVI,(" %d",dvi_stack->x)); + case X0: + MoveRight(DO_VFCONV(dvi_stack->x)); + break; + case DOWN1: case DOWN2: case DOWN3: case DOWN4: + DEBUG_PRINT(DEBUG_DVI,(" %d", + SNumRead(command+1, dvi_commandlength[*command]-1))); + MoveDown(DO_VFCONV(SNumRead(command+1, dvi_commandlength[*command]-1))); + break; + case Y1: case Y2: case Y3: case Y4: + dvi_stack->y = SNumRead(command+1, dvi_commandlength[*command]-1); + DEBUG_PRINT(DEBUG_DVI,(" %d",dvi_stack->y)); + case Y0: + MoveDown(DO_VFCONV(dvi_stack->y)); + break; + case Z1: case Z2: case Z3: case Z4: + dvi_stack->z = SNumRead(command+1, dvi_commandlength[*command]-1); + DEBUG_PRINT(DEBUG_DVI,(" %d",dvi_stack->z)); + case Z0: + MoveDown(DO_VFCONV(dvi_stack->z)); + break; + case FNT1: case FNT2: case FNT3: case FNT4: + DEBUG_PRINT(DEBUG_DVI,(" %d", + UNumRead(command+1, dvi_commandlength[*command]-1))); + SetFntNum(UNumRead(command+1, dvi_commandlength[*command]-1),parent); + break; + case XXX1: case XXX2: case XXX3: case XXX4: + DEBUG_PRINT(DEBUG_DVI,(" %d", + UNumRead(command+1, dvi_commandlength[*command]-1))); + SetSpecial((char*)command + dvi_commandlength[*command], + dvi_stack->hh,dvi_stack->vv); + break; + case FNT_DEF1: case FNT_DEF2: case FNT_DEF3: case FNT_DEF4: + if (((struct font_entry*)parent)->type==DVI_TYPE) { + FontDef(command, parent); + } else { + Fatal("%s within VF macro from %s",dvi_commands[*command], + ((struct font_entry*)parent)->n); + } + break; + case PRE: case POST: case POST_POST: + Fatal("%s occurs within page",dvi_commands[*command]); + break; + case NOP: + break; + default: + Fatal("%s is an undefined command",dvi_commands[*command]); + break; + } +} + +void BeginVFMacro(struct font_entry* currentvf) +{ + struct stack_entry *next=dvi_stack+1; + if (dvi_stack == &stack[STACK_SIZE-1]) + Fatal("DVI stack overflow"); + next->h = dvi_stack->h; + next->v = dvi_stack->v; + next->w = next->x = next->y = next->z = 0; + next->hh = dvi_stack->hh; + next->vv = dvi_stack->vv; + dvi_stack = next; + DEBUG_PRINT(DEBUG_DVI,("\n START VF:\tPUSH, W = X = Y = Z = 0")); + SetFntNum(currentvf->defaultfont,currentvf); +} + +void EndVFMacro(void) +{ + if (dvi_stack == stack) + Fatal("DVI stack underflow"); + dvi_stack--; + DEBUG_PRINT(DEBUG_DVI,("\n END VF:\tPOP ")); +} + + +static void DrawPage(dviunits hoffset, dviunits voffset) + /* To be used after having read BOP and will exit cleanly when + * encountering EOP. + */ +{ + unsigned char* command; /* current command */ + + dvi_stack->h = hoffset; + dvi_stack->v = voffset; + dvi_stack->w = dvi_stack->x = dvi_stack->y = dvi_stack->z = 0; + dvi_stack->hh = PIXROUND( dvi_stack->h , dvi->conv*shrinkfactor ); + dvi_stack->vv = PIXROUND( dvi_stack->v , dvi->conv*shrinkfactor ); + currentfont = NULL; /* No default font */ + + command=DVIGetCommand(dvi); + DEBUG_PRINT(DEBUG_DVI,("DRAW CMD:\t%s", dvi_commands[*command])); + while (*command != EOP) { + DrawCommand(command,dvi); + command=DVIGetCommand(dvi); + DEBUG_PRINT(DEBUG_DVI,("DRAW CMD:\t%s", dvi_commands[*command])); + } +} + +void DrawPages(void) +{ + struct page_list *dvi_pos; + pixels x_width,y_width,x_offset,y_offset; + int pagecounter=(option_flags & DVI_PAGENUM)?0:10; + + dvi_pos=NextPPage(dvi,NULL); + if (dvi_pos!=NULL) { + while(dvi_pos!=NULL) { + SeekPage(dvi,dvi_pos); + Message(BE_NONQUIET,"[%d", dvi_pos->count[pagecounter]); + if (dvi_pos->count[pagecounter]!=dvi_pos->count[0]) + Message(BE_NONQUIET," (%d)", dvi_pos->count[0]); + x_max = y_max = INT32_MIN; + x_min = y_min = INT32_MAX; + DrawPage((dviunits)0,(dviunits)0); + /* Store background color. Background color of a page is given + by the color at EOP rather than the color at BOP. */ + StoreBackgroundColor(dvi_pos); + /* Store pagesize */ + if (dvi->flags & DVI_PREVIEW_LATEX_TIGHTPAGE) { + x_width_def=x_width_tightpage; + y_width_def=y_width_tightpage; + x_offset_def=x_offset_tightpage; + y_offset_def=y_offset_tightpage; + } + if (x_width_def >= 0) { /* extend BBOX */ + min(x_min,-x_offset_def); + max(x_max,x_min + x_width_def); + min(y_min,-y_offset_def); + max(y_max,y_min + y_width_def); + } + if (x_width_def <= 0 || option_flags & EXPAND_BBOX) { + x_width = x_max-x_min; + y_width = y_max-y_min; + x_offset = -x_min; /* offset by moving topleft corner */ + y_offset = -y_min; /* offset by moving topleft corner */ + } else { + x_width=x_width_def; + y_width=y_width_def; + x_offset=x_offset_def; + y_offset=y_offset_def; + } + DEBUG_PRINT(DEBUG_DVI,("\n IMAGE:\t%dx%d",x_width,y_width)); + SeekPage(dvi,dvi_pos); + CreateImage(x_width,y_width); +#ifdef DEBUG + DEBUG_PRINT(DEBUG_DVI,("\n@%d PAGE START:\tBOP",dvi_pos->offset)); + { + int i; + for (i=0;i<10;i++) + DEBUG_PRINT(DEBUG_DVI,(" %d",dvi_pos->count[i])); + DEBUG_PRINT(DEBUG_DVI,(" (%d)\n",dvi_pos->count[10])); + } +#endif + Message(REPORT_DEPTH," depth=%d", y_width-y_offset-1); + Message(REPORT_HEIGHT," height=%d", y_offset+1); + Message(REPORT_WIDTH," width=%d", x_width); + page_flags &= ~PAGE_PREVIEW_BOP; + DrawPage(x_offset*dvi->conv*shrinkfactor, + y_offset*dvi->conv*shrinkfactor); + if ( ! (option_flags & MODE_PICKY && page_flags & PAGE_GAVE_WARN )) { + WriteImage(dvi->outname,dvi_pos->count[pagecounter]); +#ifdef TIMING + ++ndone; +#endif + } else { + exitcode=EXIT_FAILURE; + Message(BE_NONQUIET,"(page not rendered)"); + DestroyImage(); + } + Message(BE_NONQUIET,"] "); + fflush(stdout); + page_flags = 0; + dvi_pos=NextPPage(dvi,dvi_pos); + } + Message(BE_NONQUIET,"\n"); + ClearPpList(); + } +} diff --git a/Build/source/texk/dvipng/dvipng-1.13/dvi.c b/Build/source/texk/dvipng/dvipng-1.13/dvi.c new file mode 100644 index 00000000000..a20290ecfd9 --- /dev/null +++ b/Build/source/texk/dvipng/dvipng-1.13/dvi.c @@ -0,0 +1,484 @@ +/* dvi.c */ + +/************************************************************************ + + Part of the dvipng distribution + + This program is free software: you can redistribute it and/or modify + it under the terms of the GNU Lesser General Public License as + published by the Free Software Foundation, either version 3 of the + License, or (at your option) any later version. + + This program is distributed in the hope that it will be useful, but + WITHOUT ANY WARRANTY; without even the implied warranty of + MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU + Lesser General Public License for more details. + + You should have received a copy of the GNU Lesser General Public + License along with this program. If not, see + . + + Copyright (C) 2002-2010 Jan-Åke Larsson + +************************************************************************/ + +#include "dvipng.h" +#ifdef MIKTEX +# include +# define SLEEP Sleep(1000) +#else /* MIKTEX */ +# ifdef HAVE_LIBGEN_H +# include +# else +# define basename xbasename +# endif +# ifdef WIN32 +# define SLEEP Sleep(1000) +# include +# else +# define SLEEP sleep(1) +# endif /* WIN32 */ +#endif /* MIKTEX */ +#include + +bool followmode=0; + +bool DVIFollowToggle(void) +{ + return followmode = ! followmode; +} + +static unsigned char fgetc_follow(FILE* fp) +{ + int got=fgetc(fp); + + while(followmode && got==EOF) { + SLEEP; + got=fgetc(fp); + } + if (got==EOF) + Fatal("DVI file ends prematurely"); + return (unsigned char)got; +} + +static void DVIInit(struct dvi_data* dvi) +{ + int k; + unsigned char* pre; + struct stat stat; + + fseek(dvi->filep,0,SEEK_SET); + pre=DVIGetCommand(dvi); + if (*pre != PRE) { + Fatal("PRE does not occur first - are you sure this is a DVI file?"); + } + k = UNumRead(pre+1,1); + DEBUG_PRINT(DEBUG_DVI,("DVI START:\tPRE %d",k)); + if (k != DVIFORMAT) { + Fatal("DVI format = %d, can only process DVI format %d files", + k, DVIFORMAT); + } + dvi->num = UNumRead(pre+2, 4); + dvi->den = UNumRead(pre+6, 4); + DEBUG_PRINT(DEBUG_DVI,(" %d/%d",dvi->num,dvi->den)); + dvi->mag = UNumRead(pre+10, 4); /*FIXME, see font.c*/ + DEBUG_PRINT(DEBUG_DVI,(" %d",dvi->mag)); + if ( usermag > 0 && usermag != dvi->mag ) { + Warning("DVI magnification of %d over-ridden by user (%ld)", + (long)dvi->mag, usermag ); + dvi->mag = usermag; + } + dvi->conv = (1.0/(((double)dvi->num / (double)dvi->den) * + ((double)dvi->mag / 1000.0) * + ((double)dpi*shrinkfactor/254000.0)))+0.5; + DEBUG_PRINT(DEBUG_DVI,(" (%d)",dvi->conv)); + k = UNumRead(pre+14,1); + DEBUG_PRINT(DEBUG_DVI,(" '%.*s'",k,pre+15)); + Message(BE_VERBOSE,"'%.*s' -> %s\n",k,pre+15,dvi->outname); + fstat(fileno(dvi->filep), &stat); + dvi->mtime = stat.st_mtime; + dvi->pagelistp=NULL; + dvi->flags = 0; +} + +struct dvi_data* DVIOpen(char* dviname,char* outname) +{ + char* tmpstring; + struct dvi_data* dvi; + + if ((dvi = calloc(1,sizeof(struct dvi_data)))==NULL) + Fatal("cannot malloc memory for DVI struct"); + + dvi->type = DVI_TYPE; + dvi->fontnump=NULL; + + dvi->name = malloc(strlen(dviname)+5); + if (dvi->name==NULL) + Fatal("cannot malloc space for DVI filename"); + strcpy(dvi->name, dviname); + tmpstring = strrchr(dvi->name, '.'); + if (tmpstring == NULL || strcmp(tmpstring,".dvi") != 0) + strcat(dvi->name, ".dvi"); + + if (outname==NULL) { + dvi->outname = malloc(strlen(basename(dviname))+7); + if (dvi->outname==NULL) { + free(dvi->name); + free(dvi); + Fatal("cannot malloc space for output filename"); + } + strcpy(dvi->outname,basename(dviname)); + tmpstring = strrchr(dvi->outname, '.'); + if (tmpstring != NULL && strcmp(tmpstring,".dvi") == 0) + *tmpstring = '\0'; + strcat(dvi->outname, "%d.png"); + } else { + dvi->outname = malloc(strlen(outname)+1); + if (dvi->outname==NULL) { + free(dvi->name); + free(dvi); + Fatal("cannot malloc space for output filename"); + } + strcpy(dvi->outname,outname); + } + + if ((dvi->filep = fopen(dvi->name,"rb")) == NULL) { + /* do not insist on .dvi */ + tmpstring = strrchr(dvi->name, '.'); + *tmpstring='\0'; + dvi->filep = fopen(dvi->name,"rb"); + } + while((dvi->filep == NULL) && followmode) { + SLEEP; + *tmpstring='.'; + if ((dvi->filep = fopen(dvi->name,"rb")) == NULL) { + /* do not insist on .dvi */ + *tmpstring='\0'; + dvi->filep = fopen(dvi->name,"rb"); + } + } + if (dvi->filep == NULL) { + free(dvi->name); + free(dvi->outname); + free(dvi); + perror(dviname); + exit (EXIT_FAILURE); + } + DEBUG_PRINT(DEBUG_DVI,("OPEN FILE\t%s", dvi->name)); + DVIInit(dvi); + return(dvi); +} + +unsigned char* DVIGetCommand(struct dvi_data* dvi) + /* This function reads in and stores the next dvi command. */ + /* Mmap is not appropriate here, we may want to read from + half-written files. */ +{ + static unsigned char* command=NULL; + static uint32_t commlen=0; + unsigned char *current = command; + int length; + uint32_t strlength=0; + + if (commlen==0) { + commlen=STRSIZE; + if ((current=command=malloc(commlen))==NULL) + Fatal("cannot malloc memory for DVI command"); + } + DEBUG_PRINT(DEBUG_DVI,("\n@%ld ", ftell(dvi->filep))); + *(current++) = fgetc_follow(dvi->filep); + length = dvi_commandlength[*command]; + if (length < 0) + Fatal("undefined DVI op-code %d",*command); + while(current < command+length) + *(current++) = fgetc_follow(dvi->filep); + switch (*command) { + case XXX4: + strlength = *(current - 4); + case XXX3: + strlength = strlength * 256 + *(current - 3); + case XXX2: + strlength = strlength * 256 + *(current - 2); + case XXX1: + strlength = strlength * 256 + *(current - 1); + break; + case FNT_DEF1: case FNT_DEF2: case FNT_DEF3: case FNT_DEF4: + strlength = *(current - 1) + *(current - 2); + break; + case PRE: + strlength = *(current - 1); + break; + } + if (strlength > 0) { /* Read string */ + if (strlength+1 + (uint32_t)length > commlen) { + /* string + command length exceeds that of buffer */ + commlen=strlength+1 + (uint32_t)length; + if ((command=realloc(command,commlen))==NULL) + Fatal("cannot malloc memory for DVI command"); + current = command + length; + } + while(current < command+length+strlength) + *(current++) = fgetc_follow(dvi->filep); + *current='\0'; + } + return(command); +} + +bool DVIIsNextPSSpecial(struct dvi_data* dvi) + /* This function checks if the next dvi command is a raw PS + special */ + /* Mmap is not appropriate here, we may want to read from + half-written files. */ +{ + long fpos; + uint32_t strlength=0; + bool israwps=false; + + DEBUG_PRINT(DEBUG_DVI,("\n CHECKING NEXT DVI COMMAND ")); + fpos=ftell(dvi->filep); + switch (fgetc_follow(dvi->filep)) { + case XXX4: + strlength = fgetc_follow(dvi->filep); + case XXX3: + strlength = strlength * 256 + fgetc_follow(dvi->filep); + case XXX2: + strlength = strlength * 256 + fgetc_follow(dvi->filep); + case XXX1: + strlength = strlength * 256 + fgetc_follow(dvi->filep); + } + if (strlength > 0) { + switch(fgetc_follow(dvi->filep)) { + case 'p': + if (strlength > 2 + && fgetc_follow(dvi->filep)=='s' + && fgetc_follow(dvi->filep)==':') + israwps=true; + break; + case '"': + israwps=true; + } + } + fseek(dvi->filep,fpos,SEEK_SET); + return(israwps); +} + +uint32_t CommandLength(unsigned char* command) +{ + /* generally 2^32+5 bytes max, but in practice 32 bit numbers suffice */ + uint32_t length=0; + + length = dvi_commandlength[*command]; + switch (*command) { + case XXX1: case XXX2: case XXX3: case XXX4: + length += UNumRead(command + 1,length - 1); + break; + case FNT_DEF1: case FNT_DEF2: case FNT_DEF3: case FNT_DEF4: + length += *(command + length - 1) + *(command + length - 2); + break; + case PRE: + length += *(command + length - 1); + break; + } + return(length); +} + +static void SkipPage(struct dvi_data* dvi) +{ + /* Skip present page */ + unsigned char* command; + + command=DVIGetCommand(dvi); + while (*command != EOP) { + switch (*command) { + case FNT_DEF1: case FNT_DEF2: case FNT_DEF3: case FNT_DEF4: + DEBUG_PRINT(DEBUG_DVI,("NOSKIP CMD:\t%s", dvi_commands[*command])); + FontDef(command,dvi); + break; + case XXX1: case XXX2: case XXX3: case XXX4: + DEBUG_PRINT(DEBUG_DVI,("NOSKIP CMD:\t%s %d", dvi_commands[*command], + UNumRead(command+1, dvi_commandlength[*command]-1))); + SetSpecial((char*)command + dvi_commandlength[*command],0,0); + break; + case BOP: case PRE: case POST: case POST_POST: + Fatal("%s occurs within page", dvi_commands[*command]); + break; +#ifdef DEBUG + default: + DEBUG_PRINT(DEBUG_DVI,("SKIP CMD:\t%s", dvi_commands[*command])); +#endif + } + command=DVIGetCommand(dvi); + } /* while */ + DEBUG_PRINT(DEBUG_DVI,("SKIP CMD:\t%s", dvi_commands[*command])); +} + +static struct page_list* InitPage(struct dvi_data* dvi) +{ + /* Find page start, return pointer to page_list entry if found */ + struct page_list* tpagelistp=NULL; + unsigned char* command; + + command=DVIGetCommand(dvi); + /* Skip until page start or postamble */ + while((*command != BOP) && (*command != POST)) { + switch(*command) { + case FNT_DEF1: case FNT_DEF2: case FNT_DEF3: case FNT_DEF4: + DEBUG_PRINT(DEBUG_DVI,("NOPAGE CMD:\t%s", dvi_commands[*command])); + FontDef(command,dvi); + break; + case NOP: + DEBUG_PRINT(DEBUG_DVI,("NOPAGE CMD:\tNOP")); + break; + default: + Fatal("%s occurs outside page", dvi_commands[*command]); + } + command=DVIGetCommand(dvi); + } + if ((tpagelistp = + malloc(sizeof(struct page_list) + +(csp+1-2)*sizeof(struct dvi_color)))==NULL) + Fatal("cannot malloc memory for new page entry"); + tpagelistp->next = NULL; + if ( *command == BOP ) { /* Init page */ + int i; + DEBUG_PRINT(DEBUG_DVI,("PAGE START:\tBOP")); + StoreColorStack(tpagelistp); + tpagelistp->offset = ftell(dvi->filep)-45; + for (i = 0; i <= 9; i++) { + tpagelistp->count[i] = UNumRead(command + 1 + i*4, 4); + DEBUG_PRINT(DEBUG_DVI,(" %d",tpagelistp->count[i])); + } + if (dvi->pagelistp==NULL) + tpagelistp->count[10] = 1; + else + tpagelistp->count[10] = dvi->pagelistp->count[10]+1; + DEBUG_PRINT(DEBUG_DVI,(" (%d)", tpagelistp->count[10])); + } else { + DEBUG_PRINT(DEBUG_DVI,("DVI END:\tPOST")); + tpagelistp->offset = ftell(dvi->filep)-1; + tpagelistp->count[0] = PAGE_POST; /* POST */ + tpagelistp->count[10] = PAGE_POST; /* POST */ + } + return(tpagelistp); +} + +int SeekPage(struct dvi_data* dvi, struct page_list* page) +{ + ReadColorStack(page); + return(fseek(dvi->filep, + page->offset+((page->count[0]==PAGE_POST) ? 1L : 45L), + SEEK_SET)); +} + +struct page_list* NextPage(struct dvi_data* dvi, struct page_list* page) +{ + struct page_list* tpagelistp; + + /* if page points to POST there is no next page */ + if (page!=NULL && page->count[0]==PAGE_POST) + return(NULL); + + /* If we have read past the last page in our current list or the + * list is empty, sneak a look at the next page + */ + if (dvi->pagelistp==NULL + || dvi->pagelistp->offset+45L < ftell(dvi->filep)) { + tpagelistp=dvi->pagelistp; + dvi->pagelistp=InitPage(dvi); + dvi->pagelistp->next=tpagelistp; + } + + if (page!=dvi->pagelistp) { + /* also works if page==NULL, we'll get the first page then */ + tpagelistp=dvi->pagelistp; + while(tpagelistp!=NULL && tpagelistp->next!=page) + tpagelistp=tpagelistp->next; + } else { + /* dvi->pagelistp points to the last page we've read so far, + * the last page that we know where it is, so to speak + * So look at the next + */ + (void)SeekPage(dvi,dvi->pagelistp); + SkipPage(dvi); + tpagelistp=dvi->pagelistp; + dvi->pagelistp=InitPage(dvi); + dvi->pagelistp->next=tpagelistp; + tpagelistp=dvi->pagelistp; + } + return(tpagelistp); +} + +struct page_list* PrevPage(struct dvi_data* dvi, struct page_list* page) +{ + return(page->next); +} + + +struct page_list* FindPage(struct dvi_data* dvi, int32_t pagenum, bool abspage) + /* Find first page of certain number, + absolute number if abspage is set */ +{ + struct page_list* page=NextPage(dvi, NULL); + + if (pagenum==PAGE_LASTPAGE || pagenum==PAGE_POST) { + while(page!=NULL && page->count[0]!=PAGE_POST) + page=NextPage(dvi,page); + if (pagenum==PAGE_LASTPAGE) + page=PrevPage(dvi,page); + } else + if (pagenum!=PAGE_FIRSTPAGE) + while(page != NULL && pagenum != page->count[abspage ? 0 : 10]) + page=NextPage(dvi,page); + return(page); +} + + +static void DelPageList(struct dvi_data* dvi) +{ + struct page_list* temp; + + /* Delete the page list */ + + temp=dvi->pagelistp; + while(temp!=NULL) { + dvi->pagelistp=dvi->pagelistp->next; + free(temp); + temp=dvi->pagelistp; + } +} + +void DVIClose(struct dvi_data* dvi) +{ + if (dvi!=NULL) { + fclose(dvi->filep); + DelPageList(dvi); + ClearPSHeaders(); + free(dvi->outname); + free(dvi->name); + free(dvi); + } +} + +bool DVIReOpen(struct dvi_data* dvi) +{ + struct stat stat; + fstat(fileno(dvi->filep), &stat); + if (dvi->mtime != stat.st_mtime) { + fclose(dvi->filep); + dvi->filep=NULL; + DelPageList(dvi); + ClearPSHeaders(); + while(((dvi->filep = fopen(dvi->name,"rb")) == NULL) && followmode) { + SLEEP; + } + if (dvi->filep == NULL) { + perror(dvi->name); + exit(EXIT_FAILURE); + } + Message(PARSE_STDIN,"Reopened file\n"); + DEBUG_PRINT(DEBUG_DVI,("\nREOPEN FILE\t%s", dvi->name)); + DVIInit(dvi); + return(true); + } + return(false); +} diff --git a/Build/source/texk/dvipng/dvipng-1.13/dvipng.1 b/Build/source/texk/dvipng/dvipng-1.13/dvipng.1 new file mode 100644 index 00000000000..7bc3889a947 --- /dev/null +++ b/Build/source/texk/dvipng/dvipng-1.13/dvipng.1 @@ -0,0 +1,508 @@ +.\" Automatically generated by Pod::Man 2.16 (Pod::Simple 3.05) +.\" +.\" Standard preamble: +.\" ======================================================================== +.de Sh \" Subsection heading +.br +.if t .Sp +.ne 5 +.PP +\fB\\$1\fR +.PP +.. +.de Sp \" Vertical space (when we can't use .PP) +.if t .sp .5v +.if n .sp +.. +.de Vb \" Begin verbatim text +.ft CW +.nf +.ne \\$1 +.. +.de Ve \" End verbatim text +.ft R +.fi +.. +.\" Set up some character translations and predefined strings. \*(-- will +.\" give an unbreakable dash, \*(PI will give pi, \*(L" will give a left +.\" double quote, and \*(R" will give a right double quote. \*(C+ will +.\" give a nicer C++. Capital omega is used to do unbreakable dashes and +.\" therefore won't be available. \*(C` and \*(C' expand to `' in nroff, +.\" nothing in troff, for use with C<>. +.tr \(*W- +.ds C+ C\v'-.1v'\h'-1p'\s-2+\h'-1p'+\s0\v'.1v'\h'-1p' +.ie n \{\ +. ds -- \(*W- +. ds PI pi +. if (\n(.H=4u)&(1m=24u) .ds -- \(*W\h'-12u'\(*W\h'-12u'-\" diablo 10 pitch +. if (\n(.H=4u)&(1m=20u) .ds -- \(*W\h'-12u'\(*W\h'-8u'-\" diablo 12 pitch +. ds L" "" +. ds R" "" +. ds C` "" +. ds C' "" +'br\} +.el\{\ +. ds -- \|\(em\| +. ds PI \(*p +. ds L" `` +. ds R" '' +'br\} +.\" +.\" Escape single quotes in literal strings from groff's Unicode transform. +.ie \n(.g .ds Aq \(aq +.el .ds Aq ' +.\" +.\" If the F register is turned on, we'll generate index entries on stderr for +.\" titles (.TH), headers (.SH), subsections (.Sh), items (.Ip), and index +.\" entries marked with X<> in POD. Of course, you'll have to process the +.\" output yourself in some meaningful fashion. +.ie \nF \{\ +. de IX +. tm Index:\\$1\t\\n%\t"\\$2" +.. +. nr % 0 +. rr F +.\} +.el \{\ +. de IX +.. +.\} +.\" +.\" Accent mark definitions (@(#)ms.acc 1.5 88/02/08 SMI; from UCB 4.2). +.\" Fear. Run. Save yourself. No user-serviceable parts. +. \" fudge factors for nroff and troff +.if n \{\ +. ds #H 0 +. ds #V .8m +. ds #F .3m +. ds #[ \f1 +. ds #] \fP +.\} +.if t \{\ +. ds #H ((1u-(\\\\n(.fu%2u))*.13m) +. ds #V .6m +. ds #F 0 +. ds #[ \& +. ds #] \& +.\} +. \" simple accents for nroff and troff +.if n \{\ +. ds ' \& +. ds ` \& +. ds ^ \& +. ds , \& +. ds ~ ~ +. ds / +.\} +.if t \{\ +. ds ' \\k:\h'-(\\n(.wu*8/10-\*(#H)'\'\h"|\\n:u" +. ds ` \\k:\h'-(\\n(.wu*8/10-\*(#H)'\`\h'|\\n:u' +. ds ^ \\k:\h'-(\\n(.wu*10/11-\*(#H)'^\h'|\\n:u' +. ds , \\k:\h'-(\\n(.wu*8/10)',\h'|\\n:u' +. ds ~ \\k:\h'-(\\n(.wu-\*(#H-.1m)'~\h'|\\n:u' +. ds / \\k:\h'-(\\n(.wu*8/10-\*(#H)'\z\(sl\h'|\\n:u' +.\} +. \" troff and (daisy-wheel) nroff accents +.ds : \\k:\h'-(\\n(.wu*8/10-\*(#H+.1m+\*(#F)'\v'-\*(#V'\z.\h'.2m+\*(#F'.\h'|\\n:u'\v'\*(#V' +.ds 8 \h'\*(#H'\(*b\h'-\*(#H' +.ds o \\k:\h'-(\\n(.wu+\w'\(de'u-\*(#H)/2u'\v'-.3n'\*(#[\z\(de\v'.3n'\h'|\\n:u'\*(#] +.ds d- \h'\*(#H'\(pd\h'-\w'~'u'\v'-.25m'\f2\(hy\fP\v'.25m'\h'-\*(#H' +.ds D- D\\k:\h'-\w'D'u'\v'-.11m'\z\(hy\v'.11m'\h'|\\n:u' +.ds th \*(#[\v'.3m'\s+1I\s-1\v'-.3m'\h'-(\w'I'u*2/3)'\s-1o\s+1\*(#] +.ds Th \*(#[\s+2I\s-2\h'-\w'I'u*3/5'\v'-.3m'o\v'.3m'\*(#] +.ds ae a\h'-(\w'a'u*4/10)'e +.ds Ae A\h'-(\w'A'u*4/10)'E +. \" corrections for vroff +.if v .ds ~ \\k:\h'-(\\n(.wu*9/10-\*(#H)'\s-2\u~\d\s+2\h'|\\n:u' +.if v .ds ^ \\k:\h'-(\\n(.wu*10/11-\*(#H)'\v'-.4m'^\v'.4m'\h'|\\n:u' +. \" for low resolution devices (crt and lpr) +.if \n(.H>23 .if \n(.V>19 \ +\{\ +. ds : e +. ds 8 ss +. ds o a +. ds d- d\h'-1'\(ga +. ds D- D\h'-1'\(hy +. ds th \o'bp' +. ds Th \o'LP' +. ds ae ae +. ds Ae AE +.\} +.rm #[ #] #H #V #F C +.\" ======================================================================== +.\" +.IX Title "DVIPNG 1" +.TH DVIPNG 1 "2009-02-23" "dvipng 1.12" "User commands" +.\" For nroff, turn off justification. Always turn off hyphenation; it makes +.\" way too many mistakes in technical documents. +.if n .ad l +.nh +.SH "NAME" +dvipng \- A DVI\-to\-PNG translator +.SH "SYNOPSIS" +.IX Header "SYNOPSIS" +dvipng [options] filename +.PP +dvipng [options] [filename] \- +.SH "DESCRIPTION" +.IX Header "DESCRIPTION" +This program makes \s-1PNG\s0 and/or \s-1GIF\s0 graphics from \s-1DVI\s0 files as obtained +from TeX and its relatives. +.PP +If \s-1GIF\s0 support is enabled, \s-1GIF\s0 output is chosen by using the +\&\fBdvigif\fR binary or with the \fB\-\-gif\fR option. +.PP +The benefits of \fBdvipng\fR/\fBdvigif\fR include +.IP "\(bu" 4 +Speed. It is a very fast bitmap-rendering code for \s-1DVI\s0 files, which +makes it suitable for generating large amounts of images on-the-fly, +as needed in preview-latex, WeBWorK and others. +.IP "\(bu" 4 +It does not read the postamble, so it can be started before TeX +finishes. There is a \fB\-\-follow\fR switch that makes dvipng wait at +end-of-file for further output, unless it finds the \s-1POST\s0 marker that +indicates the end of the \s-1DVI\s0. +.IP "\(bu" 4 +Interactive query of options. dvipng can read options interactively +through stdin, and all options are usable. It is even possible to change +the input file through this interface. +.IP "\(bu" 4 +Supports \s-1PK\s0, \s-1VF\s0, PostScript Type1, and TrueType fonts, subfonts (i.e., +as used in CJK-LaTeX), color specials, and inclusion of PostScript, +\&\s-1PNG\s0, \s-1JPEG\s0 or \s-1GIF\s0 images. +.IP "\(bu" 4 +and more... +.SH "OPTIONS" +.IX Header "OPTIONS" +Many of the parameterless options listed here can be turned off by +suffixing the option with a zero (\fB0\fR); for instance, to turn off +page reversal, use \fB\-r0\fR. Such options are marked with a trailing +\&\fB*\fR. +.IP "\fB\-\fR" 4 +.IX Item "-" +Read additional options from standard input after processing the command +line. +.IP "\fB\-\-help\fR" 4 +.IX Item "--help" +Print a usage message and exit. +.IP "\fB\-\-version\fR" 4 +.IX Item "--version" +Print the version number and exit. +.IP "\fB\-bd\fR \fInum\fR" 4 +.IX Item "-bd num" +.PD 0 +.IP "\fB\-bd\fR \fIcolor_spec\fR" 4 +.IX Item "-bd color_spec" +.IP "\fB\-bd '\fR\fInum\fR\fB \fR\fIcolor_spec\fR\fB'\fR" 4 +.IX Item "-bd 'num color_spec'" +.PD +Set the pixel width of the transparent border (default 0). Using this +option will make the image edges transparent, but it only affects pixels +with the background color. Giving a \fIcolor_spec\fR will set the +fallback color, to be used in viewers that cannot handle transparency +(the default is the background color). The color spec should be in +TeX color \especial syntax, e.g., 'rgb 1.0 0.0 0.0'. Setting the +fallback color makes the default border width 1 px. +.IP "\fB\-\-bdpi\fR \fInum\fR" 4 +.IX Item "--bdpi num" +Set the base (Metafont) resolution, both horizontal and vertical, to +\&\fInum\fR dpi (dots per inch). This option is necessary when manually +selecting Metafont mode with the \-\-mode option (see below). +.IP "\fB\-bg\fR \fIcolor_spec\fR" 4 +.IX Item "-bg color_spec" +Choose background color for the images. This option will be ignored if +there is a background color \especial in the \s-1DVI\s0. The color spec should +be in TeX color \especial syntax, e.g., 'rgb 1.0 0.0 0.0'. You can +also specify 'Transparent' or 'transparent' which will give you a +transparent background with the normal background as a fallback color. A +capitalized 'Transparent' will give a full-alpha transparency, while an +all-lowercase 'transparent' will give a simple fully transparent +background with non-transparent antialiased pixels. The latter would be +suitable for viewers who cannot cope with a true alpha channel. \s-1GIF\s0 +images do not support full alpha transparency, so in case of \s-1GIF\s0 output, +both variants will use the latter behaviour. +.IP "\fB\-d\fR \fInum\fR" 4 +.IX Item "-d num" +Set the debug flags, showing what dvipng (thinks it) is doing. This will +work unless dvipng has been compiled without the \f(CW\*(C`DEBUG\*(C'\fR option +(not recommended). Set the flags as you need them, use \fB\-d \-1\fR as +the first option for maximum output. +.IP "\fB\-D\fR \fInum\fR" 4 +.IX Item "-D num" +Set the output resolution, both horizontal and vertical, to \fInum\fR +dpi (dots per inch). +.Sp +One may want to adjust this to fit a certain text font size (e.g., on +a web page), and for a text font height of \fIfont_px\fR pixels (in +Mozilla) the correct formula is +.Sp +.Vb 1 +\& = * 72.27 / 10 [px * TeXpt/in / TeXpt] +.Ve +.Sp +The last division by ten is due to the standard font height 10pt in +your document, if you use 12pt, divide by 12. Unfortunately, some +proprietary browsers have font height in pt (points), not pixels. You +have to rescale that to pixels, using the screen resolution (default +is usually 96 dpi) which means the formula is +.Sp +.Vb 1 +\& = * 96 / 72 [pt * px/in / (pt/in)] +.Ve +.Sp +On some high-res screens, the value is instead 120 dpi. Good luck! +.IP "\fB\-\-depth*\fR" 4 +.IX Item "--depth*" +Report the depth of the image. This only works reliably when the +LaTeX style \fIpreview.sty\fR from preview-latex is used with +the \fBactive\fR option. It reports the number of pixels from the +bottom of the image to the baseline of the image. This can be used for +vertical positioning of the image in, e.g., web documents, where one +would use (Cascading StyleSheets 1) +.Sp +.Vb 1 +\& +.Ve +.Sp +The depth is a negative offset in this case, so the minus sign is +necessary, and the unit is pixels (px). +.IP "\fB\-\-dvinum*\fR" 4 +.IX Item "--dvinum*" +Set this option to make the output page number be the TeX page +numbers rather than the physical page number. See the \fB\-o\fR switch. +.IP "\fB\-fg\fR \fIcolor_spec\fR" 4 +.IX Item "-fg color_spec" +Choose foreground color for the images. This option will be ignored if +there is a foreground color \especial in the \s-1DVI\s0. The color spec should +be in TeX color \especial syntax, e.g., 'rgb 1.0 0.0 0.0'. +.IP "\fB\-\-follow*\fR" 4 +.IX Item "--follow*" +Wait for data at end-of-file. One of the benefits of dvipng is that it +does not read the postamble, so it can be started before TeX +finishes. This switch makes dvipng wait at end-of-file for further +output, unless it finds the \s-1POST\s0 marker that indicates the end of the +\&\s-1DVI\s0. This is similar to \fBtail \-f\fR but for DVI-to-PNG conversion. +.IP "\fB\-\-freetype*\fR" 4 +.IX Item "--freetype*" +Enable/disable FreeType font rendering (default on). This option is +available if the FreeType2 font library was present at compilation time. +If this is the case, dvipng will have direct support for PostScript +Type1 and TrueType fonts internally, rather than using \fBgsftopk\fR +for rendering the fonts. If you have PostScript versions of Computer +Modern installed, there will be no need to generate bitmapped variants +on disk of these. Then, you can render images at different (and unusual) +resolutions without cluttering the disk with lots of bitmapped fonts. +Note that if you have both FreeType and T1lib on your system, FreeType +will be preferred by dvipng. If you for some reason would want to use +T1lib rendering, use this option. +.IP "\fB\-\-gamma\fR \fInum\fR" 4 +.IX Item "--gamma num" +Control the interpolation of colors in the greyscale anti-aliasing +color palette. Default value is 1.0. For 0 < \fInum\fR < 1, the +fonts will be lighter (more like the background), and for \fInum\fR > +1, the fonts will be darker (more like the foreground). +.IP "\fB\-\-gif*\fR" 4 +.IX Item "--gif*" +The images are output in the \s-1GIF\s0 format, if \s-1GIF\s0 support is enabled. +This is the default for the \fBdvigif\fR binary, which only will be +available when \s-1GIF\s0 support is enabled. \s-1GIF\s0 images are palette images +(see the \fB\-\-palette\fR option) and does not support true alpha +channels (see the \fB\-\-bg\fR option). See also the \fB\-\-png\fR +option. +.IP "\fB\-\-height*\fR" 4 +.IX Item "--height*" +Report the height of the image. This only works reliably when the +LaTeX style \fIpreview.sty\fR from preview-latex is used with +the \fBactive\fR option. It reports the number of pixels from the top +of the image to the baseline of the image. The total height of the +image is obtained as the sum of the values reported from +\&\fB\-\-height\fR and \fB\-\-depth\fR. +.IP "\fB\-l [=]\fR\fInum\fR" 4 +.IX Item "-l [=]num" +The last page printed will be the first one numbered \fInum\fR. Default +is the last page in the document. If \fInum\fR is prefixed by an equals +sign, then it (and the argument to the \fB\-p\fR option, if specified) +is treated as a physical (absolute) page number, rather than a value to +compare with the TeX \fB\ecount0\fR values stored in the \s-1DVI\s0 file. +Thus, using \fB\-l =9\fR will end with the ninth page of the document, +no matter what the pages are actually numbered. +.IP "\fB\-\-mode\fR \fImode\fR" 4 +.IX Item "--mode mode" +Use \fImode\fR as the Metafont device name for the \s-1PK\s0 fonts (both for +path searching and font generation). This needs to be augmented with the +base device resolution, given with the \fB\-\-bdpi\fR option. See the +file <\fBftp://ftp.tug.org/tex/modes.mf\fR> for a list of resolutions and +mode names for most devices. +.IP "\fB\-M*\fR" 4 +.IX Item "-M*" +Turns off automatic \s-1PK\s0 font generation (\fImktexpk\fR). This will have +no effect when using PostScript fonts, since no \s-1PK\s0 font generation will +be done anyway. +.IP "\fB\-\-noghostscript*\fR" 4 +.IX Item "--noghostscript*" +This switch prohibits the internal call to GhostScript for displaying +PostScript specials. \fB\-\-noghostscript0\fR turns the call back on. +.IP "\fB\-\-nogssafer*\fR" 4 +.IX Item "--nogssafer*" +Normally, if GhostScript is used to render PostScript specials, the +GhostScript interpreter is run with the option \fB\-dSAFER\fR. The +\&\fB\-\-nogssafer\fR option runs GhostScript without \fB\-dSAFER\fR. The +\&\fB\-dSAFER\fR option in Ghostscript disables PostScript operators such +as deletefile, to prevent possibly malicious PostScript programs from +having any effect. +.IP "\fB\-o\fR \fIname\fR" 4 +.IX Item "-o name" +Send output to the file \fIname\fR. A single occurrence of \fB\f(CB%d\fB\fR or +\&\fB\f(CB%01d\fB\fR, ..., \fB\f(CB%09d\fB\fR will be exchanged for the physical +page number (this can be changed, see the \fB\-\-dvinum\fR switch). The +default output filename is \fIfile\fR\fB\f(CB%d\fB.png\fR where the input \s-1DVI\s0 +file was \fIfile\fR\fB.dvi\fR. +.IP "\fB\-O\fR \fIx\-offset\fR\fB,\fR\fIy\-offset\fR" 4 +.IX Item "-O x-offset,y-offset" +Move the origin by \fIx\-offset\fR,\fIy\-offset\fR, a comma-separated +pair of dimensions such as \fB.1in,\-.3cm\fR. +The origin of the page is shifted from the default position +(of one inch down, one inch to the right from the upper left corner of +the paper) by this amount. +.IP "\fB\-p [=]\fR\fInum\fR" 4 +.IX Item "-p [=]num" +The first page printed will be the first one numbered \fInum\fR. Default +is the first page in the document. If \fInum\fR is prefixed by an +equals sign, then it (and the argument to the \fB\-l\fR option, if +specified) is treated as a physical (absolute) page number, rather than +a value to compare with the TeX \fB\ecount0\fR values stored in the +\&\s-1DVI\s0 file. Thus, using \fB\-p =3\fR will start with the third page of +the document, no matter what the pages are actually numbered. +.IP "\fB\-\-palette*\fR" 4 +.IX Item "--palette*" +Starting from \fBdvipng\fR 1.8, the output \s-1PNG\s0 will be a truecolor +png when an external image is included, to avoid unnecessary delay and +quality reduction, and enable the \s-1EPS\s0 translator to draw on a +transparent background and outside of the boundingbox. This switch +will force palette (256\-color) output and make \fBdvipng\fR revert to +the old behaviour, where included images were opaque and always +clipped to the boundingbox. This will also override the +\&\fB\-\-truecolor\fR switch if present. +.IP "\fB\-\-picky*\fR" 4 +.IX Item "--picky*" +No images are output when a warning occurs. Normally, dvipng will +output an image in spite of a warning, but there may be something +missing in this image. One reason to use this option would be if you +have a more complete but slower fallback converter. Mainly, this is +useful for failed figure inclusion and unknown \especial occurrences, +but warnings will also occur for missing or unknown color specs and +missing \s-1PK\s0 fonts. +.IP "\fB\-\-png*\fR" 4 +.IX Item "--png*" +The images are output in the \s-1PNG\s0 format. This is the default for the +\&\fBdvipng\fR binary. See also the \fB\-\-gif\fR option. +.IP "\fB\-pp\fR \fIfirstpage\fR\fB\-\fR\fIlastpage\fR" 4 +.IX Item "-pp firstpage-lastpage" +Print pages \fIfirstpage\fR through \fIlastpage\fR; but not quite +equivalent to \fB\-p\fR \fIfirstpage\fR \fB\-l\fR \fIlastpage\fR. For example, +when rendering a book, there may be several instances of a page in the +\&\s-1DVI\s0 file (one in \f(CW\*(C`\efrontmatter\*(C'\fR, one in \f(CW\*(C`\emainmatter\*(C'\fR, and one +in \f(CW\*(C`\ebackmatter\*(C'\fR). In case of several pages matching, \fB\-pp\fR +\&\fIfirstpage\fR\fB\-\fR\fIlastpage\fR will render \fIall\fR pages that +matches the specified range, while \fB\-p\fR \fIfirstpage\fR \fB\-l\fR +\&\fIlastpage\fR will render the pages from the \fIfirst\fR occurrence +of \fIfirstpage\fR to the \fIfirst\fR occurrence of \fIlastpage\fR. +This is the (undocumented) behaviour of dvips. In dvipng you can give +both kinds of options, in which case you get all pages that matches the +range in \fB\-pp\fR between the pages from \fB\-p\fR to \fB\-l\fR. Also +multiple \fB\-pp\fR options accumulate, unlike \fB\-p\fR and \fB\-l\fR. +The \fB\-\fR separator can also be \fB:\fR. Note that \fB\-pp \-1\fR +will be interpreted as \*(L"all pages up to and including 1\*(R", if you want a +page numbered \-1 (only the table of contents, say) put \fB\-pp \-1\-\-1\fR, +or more readable, \fB\-pp \-1:\-1\fR. +.IP "\fB\-q*\fR" 4 +.IX Item "-q*" +Run quietly. Don't chatter about pages converted, etc. to standard +output; report no warnings (only errors) to standard error. +.IP "\fB\-Q\fR \fInum\fR" 4 +.IX Item "-Q num" +Set the quality to \fInum\fR. That is, choose the number of antialiasing +levels for \s-1PK\s0 and T1lib rendering to be \fInum\fR*\fInum\fR+1. The default +value is 4 which gives 17 levels of antialiasing for antialiased fonts +from these two. If FreeType is available, its rendering is unaffected by +this option. +.IP "\fB\-r*\fR" 4 +.IX Item "-r*" +Toggle output of pages in reverse/forward order. By default, the first +page in the \s-1DVI\s0 is output first. +.IP "\fB\-\-strict*\fR" 4 +.IX Item "--strict*" +The program exits when a warning occurs. Normally, dvipng will output +an image in spite of a warning, but there may be something missing in +this image. One reason to use this option would be if you have a more +complete but slower fallback converter. See the \fB\-\-picky\fR option +above for a list of when warnings occur. +.IP "\fB\-T\fR \fIimage_size\fR" 4 +.IX Item "-T image_size" +Set the image size to \fIimage_size\fR which can be either of +\&\fBbbox\fR, \fBtight\fR, or a comma-separated pair of dimensions +\&\fIhsize\fR,\fIvsize\fR such as \fB.1in,.3cm\fR. The default is +\&\fBbbox\fR which produces a \s-1PNG\s0 that includes all ink put on the page +and in addition the \s-1DVI\s0 origin, located 1in from the top and 1in from +the left edge of the paper. This usually gives whitespace above and to +the left in the produced image. The value \fBtight\fR will make dvipng +only include all ink put on the page, producing neat images. +.IP "\fB\-\-t1lib*\fR" 4 +.IX Item "--t1lib*" +Enable/disable T1lib font rendering (default on). This option is +available if the T1lib font library was present at compilation time. If +this is the case, dvipng will have direct support for PostScript Type1 +fonts internally, rather than using \fBgsftopk\fR for rendering the +fonts. If you have PostScript versions of Computer Modern installed, +there will be no need to generate bitmapped variants on disk of these. +Then, you can render images at different (and unusual) resolutions +without cluttering the disk with lots of bitmapped fonts. Note that if +you have both FreeType and T1lib on your system FreeType will be +preferred by dvipng, and if you for some reason rather want to use +T1lib, give the option \fB\-\-freetype0\fR (see above). +.IP "\fB\-\-truecolor*\fR" 4 +.IX Item "--truecolor*" +This will make \fBdvipng\fR generate truecolor output. Note that +truecolor output is automatic if you include an external image in your +\&\s-1DVI\s0, e.g., via a PostScript special (i.e., the \fBgraphics\fR or +\&\fBgraphicx\fR package). This switch is overridden by the +\&\fB\-\-palette\fR switch. +.IP "\fB\-v*\fR" 4 +.IX Item "-v*" +Enable verbose operation. This will currently indicate what fonts is +used, in addition to the usual output. +.IP "\fB\-x\fR \fInum\fR" 4 +.IX Item "-x num" +Set the x magnification ratio to \fInum\fR/1000. Overrides +the magnification specified in the \s-1DVI\s0 file. Must be between 10 and +100000. It is recommended that you use standard magstep values (1095, +1200, 1440, 1728, 2074, 2488, 2986, and so on) to help reduce the total +number of \s-1PK\s0 files generated. \fInum\fR may be a real number, not an +integer, for increased precision. +.IP "\fB\-z\fR \fInum\fR" 4 +.IX Item "-z num" +Set the \s-1PNG\s0 compression level to \fInum\fR. This option is enabled if +your \fBlibgd\fR is new enough. The default compression level is 1, +which selects maximum speed at the price of slightly larger PNGs. For an +older \fBlibgd\fR, the hard-soldered value 5 is used. The include file +\&\fBpng.h\fR says +\&\*(L"Currently, valid values range from 0 \- 9, corresponding directly to +the zlib compression levels 0 \- 9 (0 \- no compression, 9 \- \*(R"maximal\*(L" +compression). Note that tests have shown that zlib compression levels +3\-6 usually perform as well as level 9 for \s-1PNG\s0 images, and do +considerably fewer calculations. In the future, these values may not +correspond directly to the zlib compression levels.\*(R" +.SH "NOTES" +.IX Header "NOTES" +The full manual is accessible in the info format, on most systems by typing +.PP +.Vb 1 +\& info dvipng +.Ve +.SH "COPYRIGHT" +.IX Header "COPYRIGHT" +This program is released under the \s-1GNU\s0 Lesser General Public License +version 3, see the \s-1COPYING\s0 file in the dvipng distribution or +<\fBhttp://www.gnu.org/licenses/gpl.html\fR>. +.PP +Copyright (c) 2002\-2008 Jan-AAke Larsson diff --git a/Build/source/texk/dvipng/dvipng-1.13/dvipng.c b/Build/source/texk/dvipng/dvipng-1.13/dvipng.c new file mode 100644 index 00000000000..78b07c1a81f --- /dev/null +++ b/Build/source/texk/dvipng/dvipng-1.13/dvipng.c @@ -0,0 +1,164 @@ +/* dvipng.c */ + +/************************************************************************ + + Part of the dvipng distribution + + This program is free software: you can redistribute it and/or modify + it under the terms of the GNU Lesser General Public License as + published by the Free Software Foundation, either version 3 of the + License, or (at your option) any later version. + + This program is distributed in the hope that it will be useful, but + WITHOUT ANY WARRANTY; without even the implied warranty of + MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU + Lesser General Public License for more details. + + You should have received a copy of the GNU Lesser General Public + License along with this program. If not, see + . + + Copyright (C) 2002-2008 Jan-Åke Larsson + +************************************************************************/ + +/* This program translates TeX's DVI-Code into Portable Network Graphics. */ + +#define MAIN +#include "dvipng.h" + +#ifdef MIKTEX +# define main __cdecl Main +#endif /* MIKTEX */ +/**********************************************************************/ +/******************************* main *******************************/ +/**********************************************************************/ +int main(int argc, char ** argv) +{ + bool parsestdin; + +#ifdef TIMING +# ifdef HAVE_GETTIMEOFDAY + gettimeofday(&Tp, NULL); + timer = Tp.tv_sec + Tp.tv_usec / 1000000.0; +# else +# ifdef HAVE_FTIME + ftime(&timebuffer); + timer = timebuffer.time + timebuffer.millitm / 1000.0; +# endif +# endif +#endif + /* setbuf(stderr, NULL); */ + +#ifdef HAVE_LIBKPATHSEA + /* Use extra paths as used by dvips */ + kpse_set_program_name(argv[0],"dvips"); + /* If dvipng is not installed in the texmf tree, and _only_ + * SELFAUTO... is used in texmf.cnf, kpathsea will not find a) + * Virtual fonts b) ps2pk.map or psfonts.map c) PostScript fonts + * + * We adjust these things here + */ + /* char selfautodir[MAXPATHLEN]; + FILE *self; + self = popen("kpsewhich -expand-var='$SELFAUTODIR'", "r"); + if (!self) + ... + if (!fgets(selfautodir, MAXPATHLEN, self)) + ... + fclose(self); */ +# ifdef ENV_SELFAUTOLOC + putenv(ENV_SELFAUTOLOC); +# endif +# ifdef ENV_SELFAUTODIR + putenv(ENV_SELFAUTODIR); +# endif +# ifdef ENV_SELFAUTOPARENT + putenv(ENV_SELFAUTOPARENT); +# endif + kpse_set_program_enabled (kpse_pk_format, makeTexPK, kpse_src_compile); +#endif + + initcolor(); + parsestdin = DecodeArgs(argc, argv); + +#ifdef HAVE_LIBKPATHSEA + if (user_mfmode) + if (user_bdpi) + kpse_init_prog("DVIPNG", user_bdpi, user_mfmode, "cmr10"); + else { + Warning("--mfmode given without --bdpi"); + /* this will give a lot of warnings but... */ + kpse_init_prog("DVIPNG", 300, user_mfmode, "cmr10"); + } + else + kpse_init_prog("DVIPNG", 300, "cx", "cmr10"); +#endif + +#ifdef HAVE_FT2_OR_LIBT1 + InitPSFontMap(); +#endif + + DrawPages(); + + if (parsestdin) { + char line[STRSIZE]; + + printf("%s> ",dvi!=NULL?dvi->name:""); + fgets(line,STRSIZE,stdin); + while(!feof(stdin)) { + DecodeString(line); + if (dvi!=NULL) { + DVIReOpen(dvi); + DrawPages(); + } + printf("%s> ",dvi!=NULL?dvi->name:""); + fgets(line,STRSIZE,stdin); + } + printf("\n"); + } + +#ifdef TIMING +# ifdef HAVE_GETTIMEOFDAY + gettimeofday(&Tp, NULL); + timer = Tp.tv_sec + Tp.tv_usec/1000000.0 - timer; +# else +# ifdef HAVE_FTIME + ftime(&timebuffer); + timer = timebuffer.time + timebuffer.millitm/1000.0 - timer; +# endif +# endif + + if (ndone > 0) + fprintf(stderr, + "Time of complete run: %.2f s, %d page(s), %.4f s/page.\n", + timer, ndone, timer / ndone); + if (my_toc >= 0.0001) + fprintf(stderr, + "Thereof in TIC/TOC region %.5f s.\n",my_toc); +#endif + + ClearFonts(); + DVIClose(dvi); + ClearColorNames(); +#ifdef HAVE_FT2_OR_LIBT1 + ClearPSFontMap(); + ClearEncoding(); +#endif +#ifdef HAVE_FT2 + ClearSubfont(); + if (libfreetype!=NULL && FT_Done_FreeType(libfreetype)) + Fatal("an error occured during freetype destruction"); + libfreetype = NULL; +#endif +#ifdef HAVE_LIBT1 + if (libt1!=NULL && T1_CloseLib()) + Fatal("an error occured during t1lib destruction"); + libt1 = NULL; +#endif + + exit(exitcode); +} + + + diff --git a/Build/source/texk/dvipng/dvipng-1.13/dvipng.h b/Build/source/texk/dvipng/dvipng-1.13/dvipng.h new file mode 100644 index 00000000000..68b8cc3287c --- /dev/null +++ b/Build/source/texk/dvipng/dvipng-1.13/dvipng.h @@ -0,0 +1,566 @@ +/* dvipng.h */ + +/************************************************************************ + + Part of the dvipng distribution + + This program is free software: you can redistribute it and/or modify + it under the terms of the GNU Lesser General Public License as + published by the Free Software Foundation, either version 3 of the + License, or (at your option) any later version. + + This program is distributed in the hope that it will be useful, but + WITHOUT ANY WARRANTY; without even the implied warranty of + MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU + Lesser General Public License for more details. + + You should have received a copy of the GNU Lesser General Public + License along with this program. If not, see + . + + Copyright (C) 2002-2010 Jan-Åke Larsson + +************************************************************************/ + +#ifndef DVIPNG_H +#define DVIPNG_H +#include "config.h" + +/* Autoconf may define malloc to rpl_malloc, if the system does not + * have a GNU Libc-compatible malloc (for which malloc(0) gives a + * valid pointer). We don't need that (yet) */ +#ifdef malloc +# undef malloc +#endif + +#define STRSIZE 255 /* stringsize for file specifications */ + +#define FIRSTFNTCHAR 0 +#define LASTFNTCHAR 255 +#define NFNTCHARS LASTFNTCHAR+1 + +#define STACK_SIZE 100 /* DVI-stack size */ + +#define DEFAULT_GAMMA 1.0 + +/* Name of the program which is called to generate missing pk files */ +#define MAKETEXPK "mktexpk" + +#ifdef HAVE_INTTYPES_H +# include +#else /* HAVE_INTTYPES_H */ +# ifndef __sgi +/* IRIX has the following types typedef'd in sys/types.h already, + * i.e., _old_ IRIX systems; newer ones have a working inttypes.h */ +typedef signed char int8_t; +typedef short int16_t; +typedef int int32_t; +#endif /* ! __sgi */ +typedef unsigned char uint8_t; +typedef unsigned short uint16_t; +typedef unsigned int uint32_t; +typedef long long int64_t; +typedef unsigned long long uint64_t; +#endif /* HAVE_INTTYPES_H */ + +#ifndef INT32_MIN +#define INT32_MIN (-2147483647-1) +#endif +#ifndef INT32_MAX +#define INT32_MAX (2147483647) +#endif + +#include + +#ifdef HAVE_KPATHSEA_KPATHSEA_H +# include +#else +# error: kpathsea/kpathsea.h is missing from your system +#endif + +#ifdef HAVE_FT2 +#define HAVE_FT2_OR_LIBT1 +#include +#include FT_FREETYPE_H +#endif + +#ifdef HAVE_LIBT1 +#define HAVE_FT2_OR_LIBT1 +#include +#endif + +#ifdef HAVE_STDBOOL_H +# include +#else +# ifdef HAVE_KPATHSEA_KPATHSEA_H +/* boolean is an enum type from kpathsea/types.h loaded in + kpathsea/kpathsea.h, use it as fallback */ +# define bool boolean +# else +typedef int bool; +# define true (bool) 1 +# define false (bool) 0 +# endif +#endif + +#ifndef HAVE_VPRINTF +# ifdef HAVE_DOPRNT +# define vfprintf(stream, message, args) _doprnt(message, args, stream) +# else +# error: vfprintf AND _doprnt are missing!!! + /* If we have neither, should fall back to fprintf with fixed args. */ +# endif +#endif + + +/*************************************************************/ +/************************* protos.h ************************/ +/*************************************************************/ + +typedef int pixels; +typedef int32_t subpixels; +typedef int32_t dviunits; + +#define MM_TO_PXL(x) (int)(((x)*resolution*10)/254) +#define PT_TO_PXL(x) (int)((int32_t)((x)*resolution*100l)/7224) +#define PT_TO_DVI(x) (int32_t)((x)*65536l) + +/*#define PIXROUND(x,c) ((((double)x+(double)(c>>1))/(double)c)+0.5)*/ +/*#define PIXROUND(x,c) (((x)+c)/(c))*/ +/*#define PIXROUND(x,c) ((x+c-1)/(c))*/ +/*#define PIXROUND(x,c) ((x)/(c))*/ +/* integer round to the nearest number, not towards zero */ +#define PIXROUND(num,den) ((num)>0 ? ((num)+(den)/2)/(den) : -(((den)/2-(num))/(den))) + + +/********************************************************/ +/*********************** dvi.h ************************/ +/********************************************************/ + +#define DVI_TYPE 0 +struct dvi_data { /* dvi entry */ + int type; /* This is a DVI */ + struct dvi_data *next; + uint32_t num, den, mag; /* PRE command parameters */ + int32_t conv; /* computed from num and den */ + /* divide dvi units (sp) with conv to get mf device resolution */ + /* divide further with shrinkfactor to get true resolution */ + char * name; /* full name of DVI file */ + char * outname; /* output filename (basename) */ + FILE * filep; /* file pointer */ + time_t mtime; /* modification time */ + struct font_num *fontnump; /* DVI font numbering */ + struct page_list *pagelistp; /* DVI page list */ +#define DVI_PREVIEW_LATEX_TIGHTPAGE 1 +#define DVI_PREVIEW_BOP_HOOK (1<<1) + uint32_t flags; /* Preview-latex flags */ +}; + +#define PAGE_POST INT32_MAX +#define PAGE_LASTPAGE INT32_MAX-1 +#define PAGE_MAXPAGE INT32_MAX-2 /* assume no pages out of this range */ +#define PAGE_FIRSTPAGE INT32_MIN +#define PAGE_MINPAGE INT32_MIN+1 /* assume no pages out of this range */ + +struct dvi_color { + int red,green,blue; +}; + +struct page_list { + struct page_list* next; + int offset; /* file offset to BOP */ + int32_t count[11]; /* 10 dvi counters + absolute pagenum in file */ + int csp; /* color stack pointer at BOP */ + struct dvi_color cstack[2]; /* color stack at BOP, may be longer */ +}; + + + + +struct dvi_data* DVIOpen(char*,char*); +void DVIClose(struct dvi_data*); +bool DVIReOpen(struct dvi_data*); +struct page_list*FindPage(struct dvi_data*, int32_t, bool); +struct page_list*NextPage(struct dvi_data*, struct page_list*); +struct page_list*PrevPage(struct dvi_data*, struct page_list*); +int SeekPage(struct dvi_data*, struct page_list*); +bool DVIFollowToggle(void); +unsigned char* DVIGetCommand(struct dvi_data*); +bool DVIIsNextPSSpecial(struct dvi_data*); +uint32_t CommandLength(unsigned char*); +void ClearPSHeaders(void); + +/********************************************************/ +/********************** misc.h ************************/ +/********************************************************/ + +struct filemmap { +#ifdef WIN32 + HANDLE hFile; + HANDLE hMap; +#else /* WIN32 */ + int fd; +#endif /* WIN32 */ + char* data; + size_t size; +}; + +bool DecodeArgs(int, char *[]); +void DecodeString(char *); +bool MmapFile (char *filename,struct filemmap *fmmap); +void UnMmapFile(struct filemmap* fmmap); + +void Message(int, const char *fmt, ...); +void Warning(const char *fmt, ...); +void Fatal(const char *fmt, ...); + +int32_t SNumRead(unsigned char*, register int); +uint32_t UNumRead(unsigned char*, register int); + +bool MmapFile (char *filename,struct filemmap *fmmap); +void UnMmapFile(struct filemmap* fmmap); + + +/********************************************************/ +/*********************** font.h ***********************/ +/********************************************************/ +struct encoding { + struct encoding* next; + char* name; + char* charname[257]; +}; + +struct subfont { + struct subfont* next; + char* name; + char* infix; + int encoding; + int32_t charindex[256]; +}; + +#ifdef HAVE_FT2_OR_LIBT1 +struct psfontmap { + struct psfontmap *next; + char *line,*psfile,*tfmname,*encname,*end; + struct encoding* encoding; +#ifdef HAVE_FT2 + FT_Matrix* ft_transformp; + FT_Matrix ft_transform; + struct subfont* subfont; +#endif +#ifdef HAVE_LIBT1 + T1_TMATRIX* t1_transformp; + T1_TMATRIX t1_transform; +#endif +}; +#endif + +#define FONT_TYPE_PK 1 +#define FONT_TYPE_VF 2 +#define FONT_TYPE_FT 3 +#define FONT_TYPE_T1 4 +struct char_entry { /* PK/FT/T1 Glyph/VF Macro */ + dviunits tfmw; /* TFM width */ + unsigned char *data; /* glyph data, either pixel data + * (0=transp, 255=max ink) or VF macro */ + uint32_t length; /* Length of PK data or VF macro */ + /* Only used in pixel fonts */ + pixels w,h; /* width and height in pixels */ + subpixels xOffset, yOffset; /* x offset and y offset in subpixels */ + /* Only used in PK fonts */ + unsigned char *pkdata; /* Points to beginning of PK data */ + unsigned char flag_byte; /* PK flagbyte */ +}; + +struct font_entry { /* font entry */ + int type; /* PK/VF/Type1 ... */ + struct font_entry *next; + uint32_t c, s, d; + uint8_t a, l; + char n[STRSIZE]; /* FNT_DEF command parameters */ + int dpi; /* computed from s and d */ + char * name; /* full name of PK/VF file */ + struct filemmap fmmap; /* file memory map */ + uint32_t magnification; /* magnification read from font file */ + uint32_t designsize; /* design size read from font file */ + void * chr[NFNTCHARS]; /* character information */ +#ifdef HAVE_FT2 + FT_Face face; /* Freetype2 face */ +#endif +#ifdef HAVE_LIBT1 + int T1id; /* T1lib font id */ +#endif +#ifdef HAVE_FT2_OR_LIBT1 + struct psfontmap* psfontmap; /* Font transformation */ +#endif + struct font_num *vffontnump; /* VF local font numbering */ + int32_t defaultfont; /* VF default font number */ +}; + +struct font_num { /* Font number. Different for VF/DVI, and several + font_num can point to one font_entry */ + struct font_num *next; + int32_t k; + struct font_entry *fontp; +}; + +void CheckChecksum(uint32_t, uint32_t, const char*); +void InitPK (struct font_entry *newfontp); +void DonePK(struct font_entry *oldfontp); +void InitVF (struct font_entry *newfontp); +void DoneVF(struct font_entry *oldfontp); + +void FontDef(unsigned char*, void* /* dvi/vf */); +void ClearFonts(void); +void SetFntNum(int32_t, void* /* dvi/vf */); +void FreeFontNumP(struct font_num *hfontnump); + +#ifdef HAVE_FT2_OR_LIBT1 +char* copyword(char* orig); +struct psfontmap *NewPSFont(struct psfontmap* copyfrom); +void InitPSFontMap(void); +void ClearPSFontMap(void); +struct psfontmap* FindPSFontMap(char*); +struct encoding* FindEncoding(char*); +void ClearEncoding(void); +bool ReadTFM(struct font_entry *, char*); +#endif + +#ifdef HAVE_FT2 +bool InitFT(struct font_entry *); +void DoneFT(struct font_entry *tfontp); +void LoadFT(int32_t, struct char_entry *); +struct psfontmap* FindSubFont(struct psfontmap* entry, char* fontname); +void ClearSubfont(void); +#endif + +#ifdef HAVE_LIBT1 +bool InitT1(struct font_entry *); +void DoneT1(struct font_entry *tfontp); +void LoadT1(int32_t, struct char_entry *); +#endif + +/********************************************************/ +/********************* ppagelist.h ********************/ +/********************************************************/ + +bool ParsePages(const char*); +void FirstPage(int32_t,bool); +void LastPage(int32_t,bool); +void ClearPpList(void); +void Reverse(bool); +struct page_list* NextPPage(void* /* dvi */, struct page_list*); + + + + +#ifdef MAIN +#define EXTERN +#define INIT(x) =x +#else +#define EXTERN extern +#define INIT(x) +#endif + +/********************************************************/ +/********************** draw.h ************************/ +/********************************************************/ +#include "commands.h" + +void CreateImage(pixels width, pixels height); +void DestroyImage(void); +void DrawCommand(unsigned char*, void* /* dvi/vf */); +void DrawPages(void); +void WriteImage(char*, int); +void LoadPK(int32_t, register struct char_entry *); +int32_t SetChar(int32_t); +dviunits SetGlyph(struct char_entry *ptr, int32_t hh,int32_t vv); +void Gamma(double gamma); +int32_t SetVF(struct char_entry *ptr); +int32_t SetRule(int32_t, int32_t, int32_t, int32_t); +void SetSpecial(char *, int32_t, int32_t); +void BeginVFMacro(struct font_entry*); +void EndVFMacro(void); + +/**************************************************/ +void handlepapersize(const char*,int32_t*,int32_t*); + +void stringrgb(const char* colorstring,int *r,int *g,int *b); +void background(const char *); +void initcolor(void); +void popcolor(void); +void pushcolor(const char *); +void resetcolorstack(const char *); +void StoreColorStack(struct page_list *tpagep); +void ReadColorStack(struct page_list *tpagep); +void StoreBackgroundColor(struct page_list *tpagep); +void ClearColorNames(void); +void InitXColorPrologue(const char* prologuename); + +/**********************************************************************/ +/************************* Global Variables *************************/ +/**********************************************************************/ + +#ifdef MAKETEXPK +#ifdef HAVE_LIBKPATHSEA +EXTERN bool makeTexPK INIT(MAKE_TEX_PK_BY_DEFAULT); +#else +EXTERN bool makeTexPK INIT(_TRUE); +#endif +#endif + +EXTERN uint32_t usermag INIT(0); /* user specified magstep */ +EXTERN struct font_entry *hfontptr INIT(NULL); /* font list pointer */ + +EXTERN struct internal_state { + struct font_entry* currentfont; +} current_state; + +#define BE_NONQUIET 1 +#define BE_VERBOSE (1<<1) +#define PARSE_STDIN (1<<2) +#define EXPAND_BBOX (1<<3) +#define TIGHT_BBOX (1<<4) +#define FORCE_TRUECOLOR (1<<5) +#define USE_FREETYPE (1<<6) +#define USE_LIBT1 (1<<7) +#define REPORT_HEIGHT (1<<8) +#define REPORT_DEPTH (1<<9) +#define REPORT_WIDTH (1<<10) +#define DVI_PAGENUM (1<<11) +#define MODE_PICKY (1<<12) +#define GIF_OUTPUT (1<<13) +#define MODE_STRICT (1<<14) +#define NO_GHOSTSCRIPT (1<<15) +#define NO_GSSAFER (1<<16) +#define BG_TRANSPARENT (1<<17) +#define BG_TRANSPARENT_ALPHA (1<<18) +#define FORCE_PALETTE (1<<19) +EXTERN uint32_t option_flags INIT(BE_NONQUIET | USE_FREETYPE | USE_LIBT1); + +#define PAGE_GAVE_WARN 1 +#define PAGE_PREVIEW_BOP (1<<1) +#define PAGE_TRUECOLOR (1<<2) +EXTERN uint32_t page_flags INIT(0); + + +#ifdef DEBUG +EXTERN unsigned int debug INIT(0); +#define DEBUG_PRINT(a,b) if (debug & a) { printf b; fflush(stdout); } +#define DEBUG_DVI 1 +#define DEBUG_VF (1<<1) +#define DEBUG_PK (1<<2) +#define DEBUG_TFM (1<<3) +#define DEBUG_GLYPH (1<<4) +#define DEBUG_FT (1<<5) +#define DEBUG_ENC (1<<6) +#define DEBUG_COLOR (1<<7) +#define DEBUG_GS (1<<8) +#define DEBUG_T1 (1<<9) +#define LASTDEBUG DEBUG_T1 +#define DEBUG_DEFAULT DEBUG_DVI +#else +#define DEBUG_PRINT(a,b) +#endif + +/************************timing stuff*********************/ +#ifdef TIMING +# ifdef TIME_WITH_SYS_TIME +# include +# include +# else +# ifdef HAVE_SYS_TIME_H +# include +# else +# include +# endif +# endif +EXTERN double timer INIT(0); +EXTERN double my_tic,my_toc INIT(0); +EXTERN int ndone INIT(0); /* number of pages converted */ +# ifdef HAVE_GETTIMEOFDAY +EXTERN struct timeval Tp; +# define TIC { gettimeofday(&Tp, NULL); \ + my_tic= Tp.tv_sec + Tp.tv_usec/1000000.0;} +# define TOC { gettimeofday(&Tp, NULL); \ + my_toc += Tp.tv_sec + Tp.tv_usec/1000000.0 - my_tic;} +# else +# ifdef HAVE_FTIME +EXTERN struct timeb timebuffer; +# define TIC() { ftime(&timebuffer); \ + my_tic= timebuffer.time + timebuffer.millitm/1000.0; +# define TOC() { ftime(&timebuffer); \ + my_toc += timebuffer.time + timebuffer.millitm/1000.0 - my_tic;} +# else +# define TIC() +# define TOC() +# endif +# endif +#endif /* TIMING */ + +EXTERN char* user_mfmode INIT(NULL); +EXTERN int user_bdpi INIT(0); +EXTERN int dpi INIT(100); + +#ifdef HAVE_GDIMAGEPNGEX +EXTERN int compression INIT(1); +#endif +#undef min +#undef max +# define max(x,y) if ((y)>(x)) x = y +# define min(x,y) if ((y)<(x)) x = y + +/* These are in pixels*/ +EXTERN int x_min INIT(0); +EXTERN int y_min INIT(0); +EXTERN int x_max INIT(0); +EXTERN int y_max INIT(0); + +/* Page size: default set by -T */ +EXTERN int x_width_def INIT(0); +EXTERN int y_width_def INIT(0); + +/* Offset: default set by -O and -T bbox */ +EXTERN int x_offset_def INIT(0); +EXTERN int y_offset_def INIT(0); + +/* Preview-latex's tightpage */ +EXTERN int x_width_tightpage INIT(0); +EXTERN int y_width_tightpage INIT(0); +EXTERN int x_offset_tightpage INIT(0); +EXTERN int y_offset_tightpage INIT(0); + +/* Paper size: set by -t, for cropmark purposes only */ +/* This has yet to be written */ +EXTERN int x_pwidth INIT(0); +EXTERN int y_pwidth INIT(0); + +/* The transparent border preview-latex desires */ +EXTERN int borderwidth INIT(0); + +/* fallback color for transparent background */ +EXTERN bool userbordercolor INIT(FALSE); /* if true, use user-supplied color */ +EXTERN struct dvi_color bordercolor; + + +EXTERN gdImagePtr page_imagep INIT(NULL); +EXTERN int32_t shrinkfactor INIT(4); + +EXTERN struct dvi_color cstack[STACK_SIZE]; +EXTERN int csp INIT(1); + +EXTERN struct font_entry* currentfont; +EXTERN struct dvi_data* dvi INIT(NULL); + +#ifdef HAVE_FT2 +EXTERN FT_Library libfreetype INIT(NULL); +#endif + +#ifdef HAVE_LIBT1 +EXTERN void* libt1 INIT(NULL); +#endif + +#define EXIT_FATAL EXIT_FAILURE+1 +EXTERN int exitcode INIT(EXIT_SUCCESS); + +#endif /* DVIPNG_H */ diff --git a/Build/source/texk/dvipng/dvipng-1.13/enc.c b/Build/source/texk/dvipng/dvipng-1.13/enc.c new file mode 100644 index 00000000000..3a17d2a82fa --- /dev/null +++ b/Build/source/texk/dvipng/dvipng-1.13/enc.c @@ -0,0 +1,128 @@ +/* enc.c */ + +/************************************************************************ + + Part of the dvipng distribution + + This program is free software: you can redistribute it and/or modify + it under the terms of the GNU Lesser General Public License as + published by the Free Software Foundation, either version 3 of the + License, or (at your option) any later version. + + This program is distributed in the hope that it will be useful, but + WITHOUT ANY WARRANTY; without even the implied warranty of + MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU + Lesser General Public License for more details. + + You should have received a copy of the GNU Lesser General Public + License along with this program. If not, see + . + + Copyright (C) 2002-2008 Jan-Åke Larsson + +************************************************************************/ + +#include "dvipng.h" + +struct encoding* encodingp=NULL; + +static struct encoding* InitEncoding(char* encoding) +{ + char *pos,*max,*buf,*enc_file; + int i; + struct encoding* encp=NULL; + struct filemmap fmmap; + boolean mmapfailed; + +#ifdef HAVE_KPSE_ENC_FORMATS + enc_file=kpse_find_file(encoding,kpse_enc_format,false); +#else + enc_file=kpse_find_file(encoding,kpse_tex_ps_header_format,false); +#endif + if (enc_file == NULL) { + Warning("encoding file %s could not be found",encoding); + return(NULL); + } + DEBUG_PRINT((DEBUG_FT|DEBUG_ENC),("\n OPEN ENCODING:\t'%s'", enc_file)); + mmapfailed = MmapFile(enc_file,&fmmap); + free(enc_file); + if (mmapfailed) + return(NULL); + if ((encp = calloc(sizeof(struct encoding)+strlen(encoding)+1 + +fmmap.size,1))==NULL) { + Warning("cannot alloc space for encoding",encoding); + UnMmapFile(&fmmap); + return(NULL); + } + encp->name=(char*)encp+sizeof(struct encoding); + strcpy(encp->name,encoding); + pos=fmmap.data; + max=fmmap.data+fmmap.size; + buf=encp->name+strlen(encoding)+1; +#define SKIPCOMMENT(x) if (*x=='%') while (xcharname[256]=buf; + while(poscharname[256])); + while (pos < max && *pos!='[') { + SKIPCOMMENT(pos); + pos++; + } + while(poscharname[i++]=buf; + while(poscharname[i-1])); + while(posname)!=0) + temp=temp->next; + if (temp==NULL) { + temp=InitEncoding(encoding); + if (temp!=NULL) { + temp->next=encodingp; + encodingp=temp; + } + } + return(temp); +} + +void ClearEncoding(void) +{ + struct encoding *temp=encodingp; + + while(temp!=NULL) { + encodingp=encodingp->next; + free(temp); + temp=encodingp; + } +} diff --git a/Build/source/texk/dvipng/dvipng-1.13/font.c b/Build/source/texk/dvipng/dvipng-1.13/font.c new file mode 100644 index 00000000000..2a8b59b9723 --- /dev/null +++ b/Build/source/texk/dvipng/dvipng-1.13/font.c @@ -0,0 +1,356 @@ +/* font.c */ + +/************************************************************************ + + Part of the dvipng distribution + + This program is free software: you can redistribute it and/or modify + it under the terms of the GNU Lesser General Public License as + published by the Free Software Foundation, either version 3 of the + License, or (at your option) any later version. + + This program is distributed in the hope that it will be useful, but + WITHOUT ANY WARRANTY; without even the implied warranty of + MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU + Lesser General Public License for more details. + + You should have received a copy of the GNU Lesser General Public + License along with this program. If not, see + . + + Copyright (C) 2002-2010 Jan-Åke Larsson + +************************************************************************/ + +#include "dvipng.h" + +void CheckChecksum(uint32_t c1, uint32_t c2, const char* name) +{ + /* Report a warning if both checksums are nonzero, they don't match, + and the user hasn't turned it off. */ + if (c1 && c2 && c1 != c2 +#ifdef HAVE_LIBKPATHSEA + && !kpse_tex_hush ("checksum") +#endif + ) { + Warning ("checksum mismatch in %s", name) ; + } +} + + +static double ActualFactor(uint32_t unmodsize) +/* compute the actual size factor given the approximation */ +/* actually factor * 1000 */ +{ + double realsize; /* the actual magnification factor */ + realsize = (double)unmodsize / 1000.0; + if (abs((int)(unmodsize - 1095l))<2) + realsize = 1.095445115; /*stephalf*/ + else if (abs((int)(unmodsize - 1315l))<2) + realsize = 1.31453414; /*stepihalf*/ + else if (abs((int)(unmodsize - 1577l))<2) + realsize = 1.57744097; /*stepiihalf*/ + else if (abs((int)(unmodsize - 1893l))<2) + realsize = 1.89292916; /*stepiiihalf*/ + else if (abs((int)(unmodsize - 2074l))<2) + realsize = 2.0736; /*stepiv*/ + else if (abs((int)(unmodsize - 2488l))<2) + realsize = 2.48832; /*stepv*/ + else if (abs((int)(unmodsize - 2986l))<2) + realsize = 2.985984; /*stepvi*/ + /* the remaining magnification steps are represented with sufficient + accuracy already */ + return(realsize); +} + + +void FontDef(unsigned char* command, void* parent) +{ + int32_t k; + uint32_t c, s, d; + uint8_t a, l; + unsigned char* current; + struct font_entry *tfontptr; /* temporary font_entry pointer */ + struct font_num *tfontnump = NULL; /* temporary font_num pointer */ + unsigned short i; + + current = command + 1; + k = UNumRead(current, (int)*command - FNT_DEF1 + 1); + current += (int)*command - FNT_DEF1 + 1; + c = UNumRead(current, 4); /* checksum */ + s = UNumRead(current+4, 4); /* space size */ + d = UNumRead(current+8, 4); /* design size */ + a = UNumRead(current+12, 1); /* length for font name */ + l = UNumRead(current+13, 1); /* device length */ + if (((struct font_entry*)parent)->type==FONT_TYPE_VF) { + DEBUG_PRINT(DEBUG_VF,(" %d %d %d",k,c,s)); + /* Rescale. s is relative to the actual scale /(1<<20) */ + s = (uint32_t)((uint64_t) s * (((struct font_entry*) parent)->s) + / (1<<20)); + DEBUG_PRINT(DEBUG_VF,(" (%d) %d",s,d)); + /* Oddly, d differs in the DVI and the VF that my system produces */ + d = (uint32_t)((uint64_t) d * ((struct font_entry*)parent)->d + / ((struct font_entry*)parent)->designsize); + DEBUG_PRINT(DEBUG_VF,(" (%d)",d)); + DEBUG_PRINT(DEBUG_VF,(" %d %d '%.*s'",a,l,a+l,current+14)); +#ifdef DEBUG + } else { + DEBUG_PRINT(DEBUG_DVI,(" %d %d %d %d %d %d '%.*s'",k,c,s,d,a,l, + a+l,current+14)); +#endif + } + if (a+l > STRSIZE-1) + Fatal("too long font name for font %ld",k); + + /* Find entry with this font number in use */ + switch (((struct font_entry*)parent)->type) { + case FONT_TYPE_VF: + tfontnump = ((struct font_entry*)parent)->vffontnump; + break; + case DVI_TYPE: + tfontnump = ((struct dvi_data*)parent)->fontnump; + } + while (tfontnump != NULL && tfontnump->k != k) { + tfontnump = tfontnump->next; + } + /* If found, return if it is correct */ + if (tfontnump!=NULL + && tfontnump->fontp->s == s + && tfontnump->fontp->d == d + && strlen(tfontnump->fontp->n) == a+l + && strncmp(tfontnump->fontp->n,(char*)current+14,a+l) == 0) { + DEBUG_PRINT((DEBUG_DVI|DEBUG_VF),("\n FONT %d:\tMatch found",k)); + return; + } + /* If not found, create new */ + if (tfontnump==NULL) { + if ((tfontnump=malloc(sizeof(struct font_num)))==NULL) + Fatal("cannot malloc memory for new font number"); + tfontnump->k=k; + switch (((struct font_entry*)parent)->type) { + case FONT_TYPE_VF: + tfontnump->next=((struct font_entry*)parent)->vffontnump; + ((struct font_entry*)parent)->vffontnump=tfontnump; + break; + case DVI_TYPE: + tfontnump->next=((struct dvi_data*)parent)->fontnump; + ((struct dvi_data*)parent)->fontnump=tfontnump; + } + } + + /* Search font list for possible match */ + tfontptr = hfontptr; + while (tfontptr != NULL + && (tfontptr->s != s + || tfontptr->d != d + || strlen(tfontptr->n) != a+l + || strncmp(tfontptr->n,(char*)current+14,a+l) != 0 ) ) { + tfontptr = tfontptr->next; + } + /* If found, set its number and return */ + if (tfontptr!=NULL) { + DEBUG_PRINT((DEBUG_DVI|DEBUG_VF),("\n FONT %d:\tMatch found, number set",k)); + tfontnump->fontp = tfontptr; + return; + } + + DEBUG_PRINT((DEBUG_DVI|DEBUG_VF),("\n FONT %d:\tNew entry created",k)); + /* No fitting font found, create new entry. */ + if ((tfontptr = calloc(1,sizeof(struct font_entry))) == NULL) + Fatal("cannot malloc space for font_entry"); + tfontptr->next = hfontptr; + hfontptr = tfontptr; + tfontnump->fontp = tfontptr; +#ifndef WIN32 + tfontptr->fmmap.fd = 0; +#else /* WIN32 */ + tfontptr->fmmap.hFile = INVALID_HANDLE_VALUE; +#endif + tfontptr->c = c; /* checksum */ + tfontptr->s = s; /* space size */ + tfontptr->d = d; /* design size */ + tfontptr->a = a; /* length for font name */ + tfontptr->l = l; /* device length */ + strncpy(tfontptr->n,(char*)current+14,a+l); /* full font name */ + tfontptr->n[a+l] = '\0'; + + tfontptr->name = NULL; + for (i = FIRSTFNTCHAR; i <= LASTFNTCHAR; i++) { + tfontptr->chr[i] = NULL; + } + + tfontptr->dpi = + (uint32_t)((ActualFactor((uint32_t)(1000.0*tfontptr->s + /(double)tfontptr->d+0.5)) + * ActualFactor(dvi->mag) * dpi*shrinkfactor) + 0.5); +#ifdef HAVE_FT2_OR_LIBT1 + tfontptr->psfontmap=NULL; +#endif +} + +#ifdef HAVE_FT2_OR_LIBT1 +static char* kpse_find_t1_or_tt(char* filename) +{ + char* filepath = kpse_find_file(filename, kpse_type1_format, false); +#ifdef HAVE_FT2 + if ((option_flags & USE_FREETYPE) && filepath==NULL) + filepath = kpse_find_file(filename, kpse_truetype_format, false); +#endif + return(filepath); +} +#endif + +static void FontFind(struct font_entry * tfontptr) +{ + kpse_glyph_file_type font_ret; + + /* tfontptr->dpi = kpse_magstep_fix (tfontptr->dpi, resolution, NULL); */ + DEBUG_PRINT(DEBUG_DVI,("\n FIND FONT:\t%s %d",tfontptr->n,tfontptr->dpi)); + + tfontptr->name = kpse_find_vf (tfontptr->n); + if (tfontptr->name!=NULL) + InitVF(tfontptr); +#ifdef HAVE_FT2_OR_LIBT1 + else if (option_flags & (USE_FREETYPE | USE_LIBT1)) { + tfontptr->psfontmap = FindPSFontMap(tfontptr->n); + if (tfontptr->psfontmap!=NULL) + tfontptr->name=kpse_find_t1_or_tt(tfontptr->psfontmap->psfile); + else + tfontptr->name=kpse_find_t1_or_tt(tfontptr->n); + if (tfontptr->name!=NULL) { + char* tfmname=kpse_find_file(tfontptr->n, kpse_tfm_format, false); + if (tfmname!=NULL) { + if (!ReadTFM(tfontptr,tfmname)) { + Warning("unable to read tfm file %s", tfmname); + free(tfontptr->name); + tfontptr->name=NULL; + } else +#ifdef HAVE_FT2 + if ((option_flags & USE_FREETYPE)==0 || !InitFT(tfontptr)) { +#endif +#ifdef HAVE_LIBT1 + if ((option_flags & USE_LIBT1)==0 || !InitT1(tfontptr)) { +#endif + /* if Freetype or T1 loading fails for some reason, fall + back to PK font */ + free(tfontptr->name); + tfontptr->name=NULL; +#ifdef HAVE_LIBT1 + } +#endif +#ifdef HAVE_FT2 + } +#endif + free(tfmname); + } + } + } +#endif /* HAVE_FT2_OR_LIBT1 */ + if (tfontptr->name==NULL) { + tfontptr->name=kpse_find_pk (tfontptr->n, tfontptr->dpi, &font_ret); + if (tfontptr->name!=NULL) { + if (!FILESTRCASEEQ (tfontptr->n, font_ret.name)) { + page_flags |= PAGE_GAVE_WARN; + Warning("font %s not found, using %s at %d dpi instead", + tfontptr->n, font_ret.name, font_ret.dpi); + tfontptr->c = 0; /* no checksum warning */ + } else if (!kpse_bitmap_tolerance ((double)font_ret.dpi, + (double) tfontptr->dpi)) { + page_flags |= PAGE_GAVE_WARN; + Warning("font %s at %d dpi not found, using %d dpi instead", + tfontptr->n, tfontptr->dpi, font_ret.dpi); + } + InitPK(tfontptr); + } else { + page_flags |= PAGE_GAVE_WARN; + Warning("font %s at %d dpi not found, characters will be left blank", + tfontptr->n, tfontptr->dpi); +#ifndef WIN32 + tfontptr->fmmap.fd = 0; +#else /* WIN32 */ + tfontptr->fmmap.hFile = INVALID_HANDLE_VALUE; +#endif + tfontptr->magnification = 0; + tfontptr->designsize = 0; + } + } +} + + +static void DoneFont(struct font_entry *tfontp) +{ + switch (tfontp->type) { + case FONT_TYPE_PK: + DonePK(tfontp); + break; + case FONT_TYPE_VF: + DoneVF(tfontp); + break; +#ifdef HAVE_FT2 + case FONT_TYPE_FT: + DoneFT(tfontp); + break; +#endif +#ifdef HAVE_LIBT1 + case FONT_TYPE_T1: + DoneT1(tfontp); + break; +#endif + } +} + + +void FreeFontNumP(struct font_num *hfontnump) +{ + struct font_num *tmp; + while(hfontnump!=NULL) { + tmp=hfontnump->next; + free(hfontnump); + hfontnump=tmp; + } +} + +void ClearFonts(void) +{ + struct font_entry *tmp; + + while(hfontptr!=NULL) { + tmp=hfontptr->next; + DoneFont(hfontptr); + if (hfontptr->name != NULL) + free(hfontptr->name); + free(hfontptr); + hfontptr=tmp; + } + if (dvi!=NULL) + FreeFontNumP(dvi->fontnump); +} + +/*-->SetFntNum*/ +/**********************************************************************/ +/**************************** SetFntNum *****************************/ +/**********************************************************************/ +void SetFntNum(int32_t k, void* parent /* dvi/vf */) +/* this routine is used to specify the font to be used in printing future + characters */ +{ + struct font_num *tfontnump=NULL; /* temporary font_num pointer */ + + switch (((struct font_entry*)parent)->type) { + case FONT_TYPE_VF: + tfontnump = ((struct font_entry*)parent)->vffontnump; + break; + case DVI_TYPE: + tfontnump = ((struct dvi_data*)parent)->fontnump; + } + while (tfontnump != NULL && tfontnump->k != k) + tfontnump = tfontnump->next; + if (tfontnump == NULL) + Fatal("font %d undefined", k); + + currentfont = tfontnump->fontp; + if (currentfont->name==NULL) + FontFind(currentfont); +} + + diff --git a/Build/source/texk/dvipng/dvipng-1.13/fontmap.c b/Build/source/texk/dvipng/dvipng-1.13/fontmap.c new file mode 100644 index 00000000000..c779d6674b4 --- /dev/null +++ b/Build/source/texk/dvipng/dvipng-1.13/fontmap.c @@ -0,0 +1,340 @@ +/* fontmap.c */ + +/************************************************************************ + + Part of the dvipng distribution + + This program is free software: you can redistribute it and/or modify + it under the terms of the GNU Lesser General Public License as + published by the Free Software Foundation, either version 3 of the + License, or (at your option) any later version. + + This program is distributed in the hope that it will be useful, but + WITHOUT ANY WARRANTY; without even the implied warranty of + MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU + Lesser General Public License for more details. + + You should have received a copy of the GNU Lesser General Public + License along with this program. If not, see + . + + Copyright (C) 2002-2010 Jan-Åke Larsson + +************************************************************************/ + +#include "dvipng.h" + +static struct filemmap psfont_mmap; +#ifdef HAVE_FT2 +static struct filemmap ttfont_mmap; +#endif +static struct psfontmap *psfontmap=NULL; + +static char* newword(char** buffer, char* end) +{ + char *word,*pos=*buffer; + + while(posline = copyfrom->line; + newentry->tfmname = copyword(copyfrom->tfmname); + newentry->psfile = copyword(copyfrom->psfile); + newentry->encname = copyword(copyfrom->encname); + newentry->encoding = copyfrom->encoding; +#ifdef HAVE_LIBT1 + newentry->t1_transformp = copyfrom->t1_transformp; +#endif +#ifdef HAVE_FT2 + newentry->ft_transformp = copyfrom->ft_transformp; + newentry->subfont = copyfrom->subfont; +#endif + newentry->end = copyfrom->end; + } else { + newentry->line = NULL; + newentry->tfmname = NULL; + newentry->psfile = NULL; + newentry->encname = NULL; + newentry->encoding = NULL; +#ifdef HAVE_LIBT1 + newentry->t1_transformp = NULL; +#endif +#ifdef HAVE_FT2 + newentry->ft_transformp = NULL; + newentry->subfont = NULL; +#endif + newentry->end = NULL; + } + newentry->next=psfontmap; + psfontmap=newentry; + return(newentry); +} + +static struct psfontmap *SearchPSFontMap(char* fontname, + struct filemmap* search_mmap) +{ + static char *pos=NULL,*end=NULL; + static struct filemmap* searching_mmap=NULL; + struct psfontmap *entry=NULL; + + if (pos==end && search_mmap!=searching_mmap) { + searching_mmap=search_mmap; + pos=searching_mmap->data; + end=searching_mmap->data+searching_mmap->size; + } + while(postfmname,fontname)!=0)) { + while(pos < end + && (*pos=='\n' || *pos==' ' || *pos=='\t' + || *pos=='%' || *pos=='*' || *pos==';' || *pos=='#')) { + while(pos < end && *pos!='\n') pos++; /* skip comments/empty rows */ + pos++; + } + if (pos < end) { + entry=NewPSFont(NULL); + entry->line = pos; + /* skip tfmname = newword(&pos,end); + while(pos < end && *pos!='\n') pos++; + entry->end = pos; + } + pos++; + } + if (entry!=NULL && strcmp(entry->tfmname,fontname)!=0) + entry=NULL; + return(entry); +} + +void ClearPSFontMap(void) +{ + struct psfontmap *entry; + + while(psfontmap!=NULL) { + entry=psfontmap; + psfontmap=psfontmap->next; + free(entry->tfmname); + if (entry->psfile!=NULL) + free(entry->psfile); + if (entry->encname!=NULL) + free(entry->encname); + free(entry); + } + UnMmapFile(&psfont_mmap); +#ifdef HAVE_FT2 + UnMmapFile(&ttfont_mmap); +#endif +} + +static void ReadPSFontMap(struct psfontmap *entry) +{ + char *pos,*end,*psname; + int nameno = 0; + + DEBUG_PRINT((DEBUG_FT|DEBUG_T1),("\n PSFONTMAP: %s ",entry->tfmname)); + pos=entry->line; + end=entry->end; + while(pos < end) { + if (*pos=='<') { /* filename follows */ + pos++; + if (pospsfile = newword((char**)&pos,end); + DEBUG_PRINT((DEBUG_FT|DEBUG_T1),("<%s ",entry->psfile)); + } else if (posencname = newword((char**)&pos,end); + DEBUG_PRINT((DEBUG_FT|DEBUG_T1),("<[%s ",entry->encname)); + } else { /* encname=word; + DEBUG_PRINT((DEBUG_FT|DEBUG_T1),("<[%s ",entry->encname)); + } else { /* psfile=word; + DEBUG_PRINT((DEBUG_FT|DEBUG_T1),("<%s ",entry->psfile)); + } + } + } else if (*pos=='"') { /* PS code: reencoding/tranformation exists */ + char *word; + double cxx=1.0,cxy=0.0; + pos++; + DEBUG_PRINT((DEBUG_FT|DEBUG_T1),("\"")); + while(pos < end && *pos!='"') { + word=newword((char**)&pos,end); + while(pos < end && (*pos==' ' || *pos=='\t')) pos++; + if (pos+10ft_transformp=&(entry->ft_transform); + entry->ft_transform.xx=(FT_Fixed)(cxx*0x10000); + entry->ft_transform.xy=(FT_Fixed)(cxy*0x10000); + entry->ft_transform.yx=0; + entry->ft_transform.yy=0x10000; +#endif +#ifdef HAVE_LIBT1 + entry->t1_transformp=&(entry->t1_transform); + entry->t1_transform.cxx=cxx; + entry->t1_transform.cxy=cxy; + entry->t1_transform.cyx=0.0; + entry->t1_transform.cyy=1.0; +#endif + DEBUG_PRINT((DEBUG_FT|DEBUG_T1),("\" ")); + pos++; + } else { /* bare word */ + switch (++nameno) { + case 1: /* first word is tfmname and perhaps psname, NOT psfile */ + while(postfmname; + break; + case 2: /* second word is psname, NOT psfile */ + psname = newword((char**)&pos,end); + DEBUG_PRINT((DEBUG_FT|DEBUG_T1),("(%s) ",psname)); + free(psname); + break; + case 3: /* third word is encoding */ + entry->encname = newword((char**)&pos,end); + DEBUG_PRINT((DEBUG_FT|DEBUG_T1),("<[%s ",entry->encname)); + break; + default: + while(pospsfile==NULL) { + /* No psfile-name given, use tfmname */ + entry->psfile=copyword(entry->tfmname); + DEBUG_PRINT((DEBUG_FT|DEBUG_T1),(" <%s ",entry->psfile)); + } + if (entry->encname!=NULL + && (entry->encoding=FindEncoding(entry->encname))==NULL) + Warning("unable to load font encoding '%s' for %s", + entry->encname,entry->tfmname); +} + + +struct psfontmap* FindPSFontMap(char* fontname) +{ + struct psfontmap *entry; + static struct filemmap* search_mmap_p=&psfont_mmap; + + entry=psfontmap; + while(entry!=NULL && strcmp(entry->tfmname,fontname)!=0) + entry=entry->next; + if(entry==NULL) { + entry=SearchPSFontMap(fontname,search_mmap_p); +#ifdef HAVE_FT2 + if(entry==NULL && search_mmap_p!=&ttfont_mmap) { + search_mmap_p=&ttfont_mmap; + entry=SearchPSFontMap(fontname,search_mmap_p); + } + } + if(entry==NULL) { + struct psfontmap* entry_subfont=NULL; + entry=psfontmap; + while(entry!=NULL && strcmp(entry->tfmname,fontname)!=0) { + while(entry!=NULL && strchr(entry->tfmname,'@')==NULL) + entry=entry->next; + if (entry!=NULL) { + entry_subfont=FindSubFont(entry,fontname); + if (entry_subfont!=NULL) + entry=entry_subfont; + else + entry=entry->next; + } + } +#endif + } + if (entry!=NULL && entry->psfile==NULL) + ReadPSFontMap(entry); + if (entry!=NULL && entry->encname!=NULL && entry->encoding==NULL) + /* Encoding given but it cannot be found. Unusable font */ + return(NULL); + return(entry); +} diff --git a/Build/source/texk/dvipng/dvipng-1.13/ft.c b/Build/source/texk/dvipng/dvipng-1.13/ft.c new file mode 100644 index 00000000000..fdb8a89489c --- /dev/null +++ b/Build/source/texk/dvipng/dvipng-1.13/ft.c @@ -0,0 +1,173 @@ +/* ft.c */ + +/************************************************************************ + + Part of the dvipng distribution + + This program is free software: you can redistribute it and/or modify + it under the terms of the GNU Lesser General Public License as + published by the Free Software Foundation, either version 3 of the + License, or (at your option) any later version. + + This program is distributed in the hope that it will be useful, but + WITHOUT ANY WARRANTY; without even the implied warranty of + MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU + Lesser General Public License for more details. + + You should have received a copy of the GNU Lesser General Public + License along with this program. If not, see + . + + Copyright (C) 2002-2009 Jan-Åke Larsson + +************************************************************************/ + +#include "dvipng.h" + +void LoadFT(int32_t c, struct char_entry * ptr) +{ + FT_Bitmap bitmap; + FT_UInt glyph_i; + int i,j,k; + unsigned char* bit; + + DEBUG_PRINT(DEBUG_FT,("\n LOAD FT CHAR\t%d (%d)",c,ptr->tfmw)); + if (currentfont->psfontmap!=NULL + && currentfont->psfontmap->encoding != NULL) { + DEBUG_PRINT(DEBUG_FT,(" %s",currentfont->psfontmap->encoding->charname[c])); + glyph_i = FT_Get_Name_Index(currentfont->face, + currentfont->psfontmap->encoding->charname[c]); + } else if (currentfont->psfontmap!=NULL + && currentfont->psfontmap->subfont != NULL) { + glyph_i = FT_Get_Char_Index( currentfont->face, + currentfont->psfontmap->subfont->charindex[c] ); + DEBUG_PRINT(DEBUG_FT,(" 0x%X",currentfont->psfontmap->subfont->charindex[c])); + } else + glyph_i = FT_Get_Char_Index( currentfont->face, c ); + if (FT_Load_Glyph( currentfont->face, glyph_i, + FT_LOAD_RENDER | FT_LOAD_TARGET_LIGHT ) + /* On some configurations (with FreeType <= 2.1.7) the above + fails, while the below works */ + && FT_Load_Glyph( currentfont->face, glyph_i, + FT_LOAD_RENDER | FT_LOAD_NO_HINTING )) + Fatal("cannot load FT char %d",c); + ptr->xOffset = -currentfont->face->glyph->bitmap_left*shrinkfactor; + ptr->yOffset = (currentfont->face->glyph->bitmap_top-1)*shrinkfactor; + bitmap=currentfont->face->glyph->bitmap; + DEBUG_PRINT(DEBUG_FT,(" (%dx%d)",bitmap.width,bitmap.rows)); + + if ((ptr->data = calloc(bitmap.width*bitmap.rows,sizeof(char))) == NULL) + Fatal("unable to malloc image space for char %c", (char)c); + ptr->w = bitmap.width; + ptr->h = bitmap.rows; + +#define GREYLEVELS 16 + DEBUG_PRINT(DEBUG_GLYPH,("\nDRAW GLYPH %d\n", (int)c)); + bit=ptr->data; + for(i=0;i0 ? k*16-1 : 0; */ + DEBUG_PRINT(DEBUG_GLYPH,("%3u ",k)); + bit[i*bitmap.width+j]=k; + } + DEBUG_PRINT(DEBUG_GLYPH,("|\n")); + } +} + +bool InitFT(struct font_entry * tfontp) +{ + int error; + + if (libfreetype==NULL) { + if (FT_Init_FreeType( &libfreetype )) { + Warning("an error occured during freetype initialisation, disabling it"); + option_flags &= ~USE_FREETYPE; + return(false); + } +# ifdef DEBUG + else { + FT_Int amajor, aminor, apatch; + + DEBUG_PRINT(DEBUG_FT,("\n COMPILED WITH FREETYPE %d.%d.%d", + FREETYPE_MAJOR, FREETYPE_MINOR, FREETYPE_PATCH)); +# ifdef HAVE_FT_LIBRARY_VERSION + FT_Library_Version( libfreetype, &amajor, &aminor, &apatch ); + DEBUG_PRINT(DEBUG_FT,("\n USING LIBFT %d.%d.%d", + amajor, aminor, apatch)); +# endif + } +# endif + } + DEBUG_PRINT((DEBUG_DVI|DEBUG_FT),("\n OPEN FT FONT:\t'%s'", tfontp->name)); + error = FT_New_Face( libfreetype, tfontp->name, 0, &tfontp->face ); + if (error == FT_Err_Unknown_File_Format) { + Warning("font file %s has unknown format", tfontp->name); + return(false); + } else if (error) { + Warning("font file %s could not be opened", tfontp->name); + return(false); + } + Message(BE_VERBOSE,"<%s>", tfontp->name); + if (tfontp->psfontmap != NULL && tfontp->psfontmap->subfont != NULL) + error=FT_Select_Charmap(tfontp->face, tfontp->psfontmap->subfont->encoding); + else if (tfontp->psfontmap == NULL || tfontp->psfontmap->encoding == NULL) +#ifndef FT_ENCODING_ADOBE_CUSTOM +# define FT_ENCODING_ADOBE_CUSTOM ft_encoding_adobe_custom +# define FT_ENCODING_ADOBE_STANDARD ft_encoding_adobe_standard +#endif + error=FT_Select_Charmap(tfontp->face, FT_ENCODING_ADOBE_CUSTOM); + if (error) { + Warning("unable to set font encoding for %s", tfontp->name); + if(FT_Select_Charmap( tfontp->face, FT_ENCODING_ADOBE_STANDARD )) { + Warning("unable to set fallback font encoding for %s", tfontp->name); + return(false); + } + } + if (FT_Set_Char_Size( tfontp->face, /* handle to face object */ + 0, /* char_width in 1/64th of points */ + ((int64_t)tfontp->d*64*7200)/7227/65536, + /* char_height in 1/64th of _big_points, + not TeX points */ + tfontp->dpi/shrinkfactor, /* horizontal resolution */ + tfontp->dpi/shrinkfactor )) /* vertical resolution */ { + Warning("unable to set font size for %s", tfontp->name); + return(false); + } + if (tfontp->psfontmap!=NULL) + FT_Set_Transform(tfontp->face, tfontp->psfontmap->ft_transformp, NULL); + tfontp->type = FONT_TYPE_FT; + return(true); +} + + +static void UnLoadFT(struct char_entry *ptr) +{ + if (ptr->data!=NULL) + free(ptr->data); + ptr->data=NULL; +} + + +void DoneFT(struct font_entry *tfontp) +{ + int c=0; + + int error = FT_Done_Face( tfontp->face ); + if (error) + Warning("font file %s could not be closed", tfontp->name); + while(cchr[c]!=NULL) { + UnLoadFT((struct char_entry*)tfontp->chr[c]); + free(tfontp->chr[c]); + tfontp->chr[c]=NULL; + } + c++; + } + if (tfontp->name!=NULL) + free(tfontp->name); + tfontp->name=NULL; +} + + diff --git a/Build/source/texk/dvipng/dvipng-1.13/miktex.h b/Build/source/texk/dvipng/dvipng-1.13/miktex.h new file mode 100644 index 00000000000..c949cd1aff6 --- /dev/null +++ b/Build/source/texk/dvipng/dvipng-1.13/miktex.h @@ -0,0 +1,272 @@ +/* config.h. Edited for MiKTeX. */ + +/************************************************************************ + + Part of the dvipng distribution + + This program is free software: you can redistribute it and/or modify + it under the terms of the GNU Lesser General Public License as + published by the Free Software Foundation, either version 3 of the + License, or (at your option) any later version. + + This program is distributed in the hope that it will be useful, but + WITHOUT ANY WARRANTY; without even the implied warranty of + MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU + Lesser General Public License for more details. + + You should have received a copy of the GNU Lesser General Public + License along with this program. If not, see + . + + Copyright (C) 2002-2008 Jan-Åke Larsson + +************************************************************************/ + +/* Define to one of `_getb67', `GETB67', `getb67' for Cray-2 and Cray-YMP + systems. This function is required for `alloca.c' support on those systems. + */ +#undef CRAY_STACKSEG_END + +/* Define to 1 if using `alloca.c'. */ +#undef C_ALLOCA + +/* Define as 1 to get the debug (-d) option. */ +#define DEBUG 1 + +/* The environment setting for $SELFAUTODIR */ +#undef ENV_SELFAUTODIR + +/* The environment setting for $SELFAUTOLOC */ +#undef ENV_SELFAUTOLOC + +/* The environment setting for $SELFAUTOPARENT */ +#undef ENV_SELFAUTOPARENT + +/* Define as the path to GhostScript. */ +#undef GS_PATH + +/* Define to 1 if you have `alloca', as a function or macro. */ +#define HAVE_ALLOCA 1 + +/* Define to 1 if you have and it should be used (not on Ultrix). + */ +#undef HAVE_ALLOCA_H + +/* Define to 1 if you don't have `vprintf' but do have `_doprnt.' */ +#undef HAVE_DOPRNT + +/* Define to 1 if you have the `dup2' function. */ +#undef HAVE_DUP2 + +/* Define to 1 if you have the header file. */ +#define HAVE_FCNTL_H 1 + +/* Define to 1 if you have the `fork' function. */ +#undef HAVE_FORK + +/* Define to 1 if you have freetype2 */ +#undef HAVE_FT2 + +/* Define to 1 if you have the `ftime' function. */ +#undef HAVE_FTIME + +/* Define to 1 if you have the `FT_Library_Version' function. */ +#undef HAVE_FT_LIBRARY_VERSION + +/* Define to 1 if you have the `gdImageAlphaBlending' function. */ +#undef HAVE_GDIMAGEALPHABLENDING + +/* Define to 1 if you have the `gdImageColorResolveAlpha' function. */ +#undef HAVE_GDIMAGECOLORRESOLVEALPHA + +/* Define to 1 if you have the `gdImageCreateTrueColor' function. */ +#define HAVE_GDIMAGECREATETRUECOLOR 1 + +/* Define to 1 if you have the `gdImageGif' function. */ +#undef HAVE_GDIMAGEGIF + +/* Define to 1 if you have the `gdImagePngEx' function. */ +#define HAVE_GDIMAGEPNGEX 1 + +/* Define to 1 if you have the `gdImageTrueColorToPalette' function. */ +#define HAVE_GDIMAGETRUECOLORTOPALETTE 1 + +/* Define to 1 if you have the header file. */ +#define HAVE_GD_H 1 + +/* Define to 1 if you have the `getpagesize' function. */ +#undef HAVE_GETPAGESIZE + +/* Define to 1 if you have the `gettimeofday' function. */ +#undef HAVE_GETTIMEOFDAY + +/* Define to 1 if you have the header file. */ +#define HAVE_INTTYPES_H 1 + +/* Define to 1 if you have the header file. */ +#define HAVE_KPATHSEA_KPATHSEA_H 1 + +/* Define to 1 if your kpathsea has kpse_enc_format */ +#define HAVE_KPSE_ENC_FORMATS 1 + +/* Define to 1 if you have the `gd' library (-lgd). */ +#define HAVE_LIBGD 1 + +/* Define to 1 if you have the `gen' library (-lgen). */ +#undef HAVE_LIBGEN + +/* Define to 1 if you have the `kpathsea' library (-lkpathsea). */ +#define HAVE_LIBKPATHSEA 1 + +/* Define to 1 if you have the `m' library (-lm). */ +#define HAVE_LIBM 1 + +/* Define to 1 if you have the `png' library (-lpng). */ +#define HAVE_LIBPNG 1 + +/* Define to 1 if you have the `t1' library (-lt1). */ +#undef HAVE_LIBT1 + +/* Define to 1 if you have the `z' library (-lz). */ +#undef HAVE_LIBZ + +/* Define to 1 if your system has a GNU libc compatible `malloc' function, and + to 0 otherwise. */ +#undef HAVE_MALLOC + +/* Define to 1 if you have the header file. */ +#undef HAVE_MEMORY_H + +/* Define to 1 if you have the `memset' function. */ +#define HAVE_MEMSET 1 + +/* Define to 1 if you have a working `mmap' system call. */ +#undef HAVE_MMAP + +/* Define to 1 if you have the `munmap' function. */ +#undef HAVE_MUNMAP + +/* Define to 1 if you have the header file. */ +#define HAVE_PNG_H 1 + +/* Define to 1 if you have the `pow' function. */ +#undef HAVE_POW + +/* Define to 1 if you have the `putenv' function. */ +#undef HAVE_PUTENV + +/* Define to 1 if stdbool.h conforms to C99. */ +#undef HAVE_STDBOOL_H 1 + +/* Define to 1 if you have the header file. */ +#undef HAVE_STDINT_H + +/* Define to 1 if you have the header file. */ +#define HAVE_STDLIB_H 1 + +/* Define to 1 if you have the `strchr' function. */ +#define HAVE_STRCHR 1 + +/* Define to 1 if you have the header file. */ +#undef HAVE_STRINGS_H + +/* Define to 1 if you have the header file. */ +#define HAVE_STRING_H 1 + +/* Define to 1 if you have the `strrchr' function. */ +#undef HAVE_STRRCHR + +/* Define to 1 if you have the `strstr' function. */ +#undef HAVE_STRSTR + +/* Define to 1 if you have the `strtol' function. */ +#undef HAVE_STRTOL + +/* Define to 1 if you have the header file. */ +#define HAVE_SYS_STAT_H 1 + +/* Define to 1 if you have the header file. */ +#undef HAVE_SYS_TIME_H + +/* Define to 1 if you have the header file. */ +#undef HAVE_SYS_TYPES_H + +/* Define to 1 if you have that is POSIX.1 compatible. */ +#undef HAVE_SYS_WAIT_H + +/* Define to 1 if you have the header file. */ +#undef HAVE_T1LIB_H + +/* Define to 1 if you have the header file. */ +#undef HAVE_UNISTD_H + +/* Define to 1 if you have the `vfork' function. */ +#undef HAVE_VFORK + +/* Define to 1 if you have the header file. */ +#undef HAVE_VFORK_H + +/* Define to 1 if you have the `vprintf' function. */ +#define HAVE_VPRINTF 1 + +/* Define to 1 if `fork' works. */ +#undef HAVE_WORKING_FORK + +/* Define to 1 if `vfork' works. */ +#undef HAVE_WORKING_VFORK + +/* Define to 1 if the system has the type `_Bool'. */ +#undef HAVE__BOOL 1 + +/* Define to the address where bug reports for this package should be sent. */ +#define PACKAGE_BUGREPORT "dvipng@nongnu.org" + +/* Define to the full name of this package. */ +#define PACKAGE_NAME "dvipng" + +/* Define to the full name and version of this package. */ +#define PACKAGE_STRING "dvipng 1.7" + +/* Define to the one symbol short name of this package. */ +#define PACKAGE_TARNAME "dvipng" + +/* Define to the version of this package. */ +#define PACKAGE_VERSION "1.7" + +/* If using the C implementation of alloca, define if you know the + direction of stack growth for your system; otherwise it will be + automatically deduced at run-time. + STACK_DIRECTION > 0 => grows toward higher addresses + STACK_DIRECTION < 0 => grows toward lower addresses + STACK_DIRECTION = 0 => direction of growth unknown */ +#undef STACK_DIRECTION + +/* Define to 1 if you have the ANSI C header files. */ +#undef STDC_HEADERS + +/* Define to 1 if you can safely include both and . */ +#undef TIME_WITH_SYS_TIME + +/* Define as 1 to get execution time output. */ +#undef TIMING + +/* Define to empty if `const' does not conform to ANSI C. */ +#undef const + +/* Define to `long long' if does not define it. */ +#undef int64_t + +/* Define to rpl_malloc if the replacement function should be used. */ +#undef malloc + +/* Define to `int' if does not define. */ +#undef pid_t + +/* Define to `unsigned' if does not define. */ +#undef size_t + +/* Define to `unsigned long long' if does not define it. */ +#undef uint64_t + +/* Define as `fork' if `vfork' does not work. */ +#undef vfork diff --git a/Build/source/texk/dvipng/dvipng-1.13/miktex.mak b/Build/source/texk/dvipng/dvipng-1.13/miktex.mak new file mode 100644 index 00000000000..b291ba67207 --- /dev/null +++ b/Build/source/texk/dvipng/dvipng-1.13/miktex.mak @@ -0,0 +1,196 @@ +## miktex.mak: dvipng +## +## Copyright (C) 2004 Christian Schenk +## +## This file is free software; you can redistribute it and/or modify +## it under the terms of the GNU General Public License as published +## by the Free Software Foundation; either version 2, or (at your +## option) any later version. +## +## This file is distributed in the hope that it will be useful, but +## WITHOUT ANY WARRANTY; without even the implied warranty of +## MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU +## General Public License for more details. +## +## You should have received a copy of the GNU General Public License +## along with this file; if not, write to the Free Software +## Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA +## 02110-1301 USA. + +miktex_cc_no_warnings = 1 +miktex_cc_disable_optimization = 1 + +!include ..\miktex.inc + +objects = \ + $(outdir)\color.obj \ + $(outdir)\draw.obj \ + $(outdir)\dvi.obj \ + $(outdir)\dvipng.obj \ + $(outdir)\font.obj \ + $(outdir)\misc.obj \ + $(outdir)\papersiz.obj \ + $(outdir)\pk.obj \ + $(outdir)\ppagelist.obj \ + $(outdir)\set.obj \ + $(outdir)\special.obj \ + $(outdir)\vf.obj \ + $(wrapper_obj) \ + +sources = \ + color.c \ + draw.c \ + dvi.c \ + dvipng.c \ + font.c \ + misc.c \ + papersiz.c \ + pk.c \ + ppagelist.c \ + set.c \ + special.c \ + vf.c \ + +extra_cdefines = \ + -Dalloca=_alloca \ + -DUSE_MIKTEX_EXIT \ + +extra_cincludes = \ + -I$(gdlibdir) \ + -I$(kpslibdir) \ + +.c{$(outdir)\}.obj: + $(cc) $(cstandard) \ + $(extra_cdefines) \ + $(extra_cincludes) \ + $(ccopt_output_directory)$(outdir)\ $< + +binaries = $(outdir)\dvipng.exe + +all: common-all $(binaries) + +install: common-install install-binaries + +qrt: common-qrt + +# ----------------------------------------------------------------------------- +# dvipng +# ----------------------------------------------------------------------------- + +libs = \ + $(miktex_lib) \ + $(gd_lib) \ + $(kps_lib) \ + $(gnu_lib) \ + $(texmf_lib) \ + +$(outdir)\dvipng.exe: \ + $(outdir) \ + $(objects) \ + $(libs) \ + $(outdir)\dvipng.res \ + + $(link) $(lstandard) \ + -out:$@ \ + $(objects) \ + $(libs) \ + $(outdir)\dvipng.res \ + +$(outdir)\dvipng.res: \ + $(libdir)\miktex-version.h \ + $(outdir) \ + dvipng-version.h \ + dvipng.rc \ + + $(rc) $(rcstandard) $(rcopt_output_file)$@ dvipng.rc + +# ----------------------------------------------------------------------------- +# clean-up +# ----------------------------------------------------------------------------- + +mostlyclean: common-mostlyclean + +clean: common-clean mostlyclean + +distclean: common-distclean clean + +realclean: common-realclean distclean + +# ----------------------------------------------------------------------------- +# dependencies +# ----------------------------------------------------------------------------- + +!include ..\common-dependencies.inc + +depend: $(sources) + $(MAKEDEPEND1) $(extra_cincludes) $(extra_cdefines) $(sources) + +# DO NOT DELETE + +$(outdir)\color.obj: dvipng.h config.h .\inttypes.h $(gdlibdir)\gd.h +$(outdir)\color.obj: $(gdlibdir)\gd_io.h $(gdlibdir)\gdfx.h +$(outdir)\color.obj: $(kpslibdir)\kpathsea\kpathsea.h +$(outdir)\color.obj: $(kpslibdir)\web2c-miktex.h ..\lib\miktex.h +$(outdir)\color.obj: ..\lib\miktex-features.h commands.h +$(outdir)\draw.obj: dvipng.h config.h .\inttypes.h $(gdlibdir)\gd.h +$(outdir)\draw.obj: $(gdlibdir)\gd_io.h $(gdlibdir)\gdfx.h +$(outdir)\draw.obj: $(kpslibdir)\kpathsea\kpathsea.h +$(outdir)\draw.obj: $(kpslibdir)\web2c-miktex.h ..\lib\miktex.h +$(outdir)\draw.obj: ..\lib\miktex-features.h commands.h +$(outdir)\dvi.obj: dvipng.h config.h .\inttypes.h $(gdlibdir)\gd.h +$(outdir)\dvi.obj: $(gdlibdir)\gd_io.h $(gdlibdir)\gdfx.h +$(outdir)\dvi.obj: $(kpslibdir)\kpathsea\kpathsea.h +$(outdir)\dvi.obj: $(kpslibdir)\web2c-miktex.h ..\lib\miktex.h +$(outdir)\dvi.obj: ..\lib\miktex-features.h commands.h ..\libgnu\gnu-miktex.h +$(outdir)\dvipng.obj: dvipng.h config.h .\inttypes.h +$(outdir)\dvipng.obj: $(gdlibdir)\gd.h $(gdlibdir)\gd_io.h +$(outdir)\dvipng.obj: $(gdlibdir)\gdfx.h +$(outdir)\dvipng.obj: $(kpslibdir)\kpathsea\kpathsea.h +$(outdir)\dvipng.obj: $(kpslibdir)\web2c-miktex.h ..\lib\miktex.h +$(outdir)\dvipng.obj: ..\lib\miktex-features.h commands.h +$(outdir)\font.obj: dvipng.h config.h .\inttypes.h $(gdlibdir)\gd.h +$(outdir)\font.obj: $(gdlibdir)\gd_io.h $(gdlibdir)\gdfx.h +$(outdir)\font.obj: $(kpslibdir)\kpathsea\kpathsea.h +$(outdir)\font.obj: $(kpslibdir)\web2c-miktex.h ..\lib\miktex.h +$(outdir)\font.obj: ..\lib\miktex-features.h commands.h +$(outdir)\misc.obj: dvipng.h config.h .\inttypes.h $(gdlibdir)\gd.h +$(outdir)\misc.obj: $(gdlibdir)\gd_io.h $(gdlibdir)\gdfx.h +$(outdir)\misc.obj: $(kpslibdir)\kpathsea\kpathsea.h +$(outdir)\misc.obj: $(kpslibdir)\web2c-miktex.h ..\lib\miktex.h +$(outdir)\misc.obj: ..\lib\miktex-features.h commands.h +$(outdir)\misc.obj: ..\libgnu\gnu-miktex.h +$(outdir)\papersiz.obj: dvipng.h config.h .\inttypes.h +$(outdir)\papersiz.obj: $(gdlibdir)\gd.h +$(outdir)\papersiz.obj: $(gdlibdir)\gd_io.h +$(outdir)\papersiz.obj: $(gdlibdir)\gdfx.h +$(outdir)\papersiz.obj: $(kpslibdir)\kpathsea\kpathsea.h +$(outdir)\papersiz.obj: $(kpslibdir)\web2c-miktex.h ..\lib\miktex.h +$(outdir)\papersiz.obj: ..\lib\miktex-features.h commands.h +$(outdir)\pk.obj: dvipng.h config.h .\inttypes.h $(gdlibdir)\gd.h +$(outdir)\pk.obj: $(gdlibdir)\gd_io.h $(gdlibdir)\gdfx.h +$(outdir)\pk.obj: $(kpslibdir)\kpathsea\kpathsea.h +$(outdir)\pk.obj: $(kpslibdir)\web2c-miktex.h ..\lib\miktex.h +$(outdir)\pk.obj: ..\lib\miktex-features.h commands.h +$(outdir)\ppagelist.obj: dvipng.h config.h .\inttypes.h +$(outdir)\ppagelist.obj: $(gdlibdir)\gd.h +$(outdir)\ppagelist.obj: $(gdlibdir)\gd_io.h +$(outdir)\ppagelist.obj: $(gdlibdir)\gdfx.h +$(outdir)\ppagelist.obj: $(kpslibdir)\kpathsea\kpathsea.h +$(outdir)\ppagelist.obj: $(kpslibdir)\web2c-miktex.h ..\lib\miktex.h +$(outdir)\ppagelist.obj: ..\lib\miktex-features.h commands.h +$(outdir)\set.obj: dvipng.h config.h .\inttypes.h $(gdlibdir)\gd.h +$(outdir)\set.obj: $(gdlibdir)\gd_io.h $(gdlibdir)\gdfx.h +$(outdir)\set.obj: $(kpslibdir)\kpathsea\kpathsea.h +$(outdir)\set.obj: $(kpslibdir)\web2c-miktex.h ..\lib\miktex.h +$(outdir)\set.obj: ..\lib\miktex-features.h commands.h +$(outdir)\special.obj: dvipng.h config.h .\inttypes.h +$(outdir)\special.obj: $(gdlibdir)\gd.h $(gdlibdir)\gd_io.h +$(outdir)\special.obj: $(gdlibdir)\gdfx.h +$(outdir)\special.obj: $(kpslibdir)\kpathsea\kpathsea.h +$(outdir)\special.obj: $(kpslibdir)\web2c-miktex.h ..\lib\miktex.h +$(outdir)\special.obj: ..\lib\miktex-features.h commands.h +$(outdir)\vf.obj: dvipng.h config.h .\inttypes.h $(gdlibdir)\gd.h +$(outdir)\vf.obj: $(gdlibdir)\gd_io.h $(gdlibdir)\gdfx.h +$(outdir)\vf.obj: $(kpslibdir)\kpathsea\kpathsea.h +$(outdir)\vf.obj: $(kpslibdir)\web2c-miktex.h ..\lib\miktex.h +$(outdir)\vf.obj: ..\lib\miktex-features.h commands.h diff --git a/Build/source/texk/dvipng/dvipng-1.13/misc.c b/Build/source/texk/dvipng/dvipng-1.13/misc.c new file mode 100644 index 00000000000..a1d8c3d95eb --- /dev/null +++ b/Build/source/texk/dvipng/dvipng-1.13/misc.c @@ -0,0 +1,848 @@ +/* misc.c */ + +/************************************************************************ + + Part of the dvipng distribution + + This program is free software: you can redistribute it and/or modify + it under the terms of the GNU Lesser General Public License as + published by the Free Software Foundation, either version 3 of the + License, or (at your option) any later version. + + This program is distributed in the hope that it will be useful, but + WITHOUT ANY WARRANTY; without even the implied warranty of + MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU + Lesser General Public License for more details. + + You should have received a copy of the GNU Lesser General Public + License along with this program. If not, see + . + + Copyright (C) 2002-2010 Jan-Åke Larsson + +************************************************************************/ + +#include "dvipng.h" +#ifdef HAVE_LIBGEN_H +# include +#else +#define basename xbasename +#endif +#include /* open/close */ +#ifdef HAVE_MMAP +#include +#endif +#include + +static char *programname; + +/*-->DecodeArgs*/ +/*********************************************************************/ +/***************************** DecodeArgs ****************************/ +/*********************************************************************/ +bool DecodeArgs(int argc, char ** argv) +{ + int i; /* argument index for options */ + bool ppused=false; /* Flag when -pp is used */ + int32_t number; /* Temporary storage for numeric parameter */ + char *dviname=NULL; /* Name of dvi file */ + char *outname=NULL; /* Name of output file */ + + if (argv[0]) { +#ifdef HAVE_GDIMAGEGIF + programname=strrchr(argv[0],'/'); + if (programname!=NULL) + programname++; + else + programname=argv[0]; + if (strncmp(programname,"dvigif",6)==0) + option_flags |= GIF_OUTPUT; +#endif + programname=argv[0]; + Message(BE_NONQUIET,"This is %s",programname); + if (strcmp(basename(programname),PACKAGE_NAME)!=0) + Message(BE_NONQUIET," (%s)", PACKAGE_NAME); + Message(BE_NONQUIET," %s Copyright 2002-2010 Jan-Ake Larsson\n", + PACKAGE_VERSION); + } + + for (i=1; i'9' && *p!='-') { + if (strncmp(p,"vinum",5)==0) { + if (p[5] != '0') { + option_flags |= DVI_PAGENUM; + Message(PARSE_STDIN,"DVI page number output on\n",p); + } else { + option_flags &= ~DVI_PAGENUM; + Message(PARSE_STDIN,"DVI page number output off\n"); + } + break; + } else if (strncmp(p,"epth",4)==0) { /* Depth reporting */ + if (p[4] != '0') { + option_flags |= REPORT_DEPTH; + Message(PARSE_STDIN,"Depth reporting on\n",p); + } else { + option_flags &= ~REPORT_DEPTH; + Message(PARSE_STDIN,"Depth reporting off\n"); + } + break; + } + goto DEFAULT; + } else { +#ifdef DEBUG + if (*p == 0 && argv[i+1]) + p = argv[i+1]; + debug = atoi(p); + if (debug > 0) { + if (p == argv[i+1]) i++; + } else + debug = DEBUG_DEFAULT; + Message(PARSE_STDIN,"Debug output enabled\n"); +#ifdef HAVE_LIBKPATHSEA + kpathsea_debug = debug / LASTDEBUG / 2 ; +#endif +#else + Warning("This instance of %s was compiled without the debug (-d) option", + programname); +#endif + break; + } + case 'o': /* Output file is specified */ + if (*p == 0 && argv[i+1]) + p = argv[++i] ; + outname=p; + /* remove .png extension */ + Message(PARSE_STDIN,"Output file: %s\n", + outname); + break; +#ifdef MAKETEXPK + case 'M': + /* -M, -M1 => don't make font; -M0 => do. */ + makeTexPK = (*p == '0'); +#ifdef HAVE_LIBKPATHSEA + kpse_set_program_enabled (kpse_pk_format, makeTexPK, kpse_src_cmdline); +#endif + if (makeTexPK) + Message(PARSE_STDIN,"MakeTeXPK enabled\n"); + else + Message(PARSE_STDIN,"MakeTeXPK disabled\n"); + break; +#endif /* MAKETEXPK */ + case 'm': + if (strcmp(p,"ode") == 0 ) { + if (argv[i+1]) + user_mfmode = argv[++i] ; + Message(PARSE_STDIN,"MetaFont mode: %s\n",user_mfmode); + break; + } + goto DEFAULT; + case 'h': + if (strcmp(p,"elp") == 0 ) { + break; + } else if (strncmp(p,"eight",5) == 0 ) { /* Height reporting */ + if (p[5] != '0') { + option_flags |= REPORT_HEIGHT; + Message(PARSE_STDIN,"Height reporting on\n",p); + } else { + option_flags &= ~REPORT_HEIGHT; + Message(PARSE_STDIN,"Height reporting off\n"); + } + break; + } + goto DEFAULT; + case 'O' : /* Offset */ + if (*p == 0 && argv[i+1]) + p = argv[++i] ; + handlepapersize(p, &x_offset_def, &y_offset_def) ; + Message(PARSE_STDIN,"Offset: (%d,%d)\n",x_offset_def,y_offset_def); + break ; + case 'e': + if (strncmp(p,"xpand-bbox",10) == 0 ) { + if (p[10] != '0') { + option_flags |= EXPAND_BBOX; + Message(PARSE_STDIN,"BBox expansion on\n",p); + } else { + option_flags &= ~EXPAND_BBOX; + Message(PARSE_STDIN,"BBox expansion off\n"); + } + break; + } + goto DEFAULT; + case 'T' : + if (*p == 0 && argv[i+1]) + p = argv[++i]; + if (strcmp(p,"bbox")==0) { + x_width_def=0; + y_width_def=0; + Message(PARSE_STDIN,"Pagesize: (bbox)\n"); + } else if (strcmp(p,"tight")==0) { + x_width_def=-1; + y_width_def=-1; + Message(PARSE_STDIN,"Pagesize: (tight bbox)\n"); + } else { + handlepapersize(p, &x_width_def, &y_width_def) ; + Message(PARSE_STDIN,"Pagesize: (%d,%d)\n", + x_width_def,y_width_def); + } + break ; + case 't': /* specify paper format, only for cropmarks */ +#ifdef HAVE_GDIMAGECREATETRUECOLOR + /* Truecolor */ + if (strncmp(p,"ruecolor",8)==0) { + if (p[8] != '0') { + option_flags |= FORCE_TRUECOLOR; + Message(PARSE_STDIN,"Truecolor mode on\n",p); + } else { + option_flags &= ~FORCE_TRUECOLOR; + Message(PARSE_STDIN,"Truecolor mode off\n"); + } + } else +#endif +#ifdef HAVE_LIBT1 + if ( strncmp(p,"1lib",4) == 0 ) { /* -t1lib activation */ + if (p[4] != '0') { + option_flags |= USE_LIBT1; + Message(PARSE_STDIN,"t1lib rendering on\n",p); + } else { + option_flags &= ~USE_LIBT1; + Message(PARSE_STDIN,"t1lib rendering off\n"); + } + } else +#endif + + { /* cropmarks not implemented yet */ + if (*p == 0 && argv[i+1]) + p = argv[++i] ; + if (strcmp(p,"a4")==0) { + handlepapersize("210mm,297mm",&x_pwidth,&y_pwidth); + } else if (strcmp(p,"letter")==0) { + handlepapersize("8.5in,11in",&x_pwidth,&y_pwidth); + } else if (strcmp(p,"legal")==0) { + handlepapersize("8.5in,14in",&x_pwidth,&y_pwidth); + } else if (strcmp(p,"executive")==0) { + handlepapersize("7.25in,10.5in",&x_pwidth,&y_pwidth); + } else + Fatal("papersize %s is not implemented",p); + Message(PARSE_STDIN,"Papersize: %s\n",p); + } + break; +/* case 'c': */ +/* if (strncmp(p,"acheimages",10)==0) { */ +/* if (p[10] != '0') { */ +/* option_flags |= CACHE_IMAGES; */ +/* Message(PARSE_STDIN,"Caching images\n",p); */ +/* } else { */ +/* option_flags &= ~CACHE_IMAGES; */ +/* Message(PARSE_STDIN,"Not caching images\n"); */ +/* } */ +/* break; */ +/* } */ +/* goto DEFAULT; */ + case 'b': + if ( *p == 'g' ) { /* -bg background color */ + p++; + if (*p == 0 && argv[i+1]) + p = argv[++i] ; + if (strncmp(p,"Transparent",11) == 0 ) + option_flags |= BG_TRANSPARENT_ALPHA; + else if (strncmp(p,"transparent",11) == 0 ) + option_flags |= BG_TRANSPARENT; + else + background(p); + if (option_flags & BG_TRANSPARENT) + Message(PARSE_STDIN,"Transp. background (fallback rgb %d,%d,%d)\n", + cstack[0].red,cstack[0].green,cstack[0].blue); + else + Message(PARSE_STDIN,"Background: rgb %d,%d,%d\n", + cstack[0].red,cstack[0].green,cstack[0].blue); + break; + } else if (strcmp(p, "dpi")==0) { + p+=3; + if (*p == 0 && argv[i+1]) + p = argv[++i]; + number = atoi(p); + if (number < 10 || number > 10000) + Warning("Bad --bdpi parameter, ignored"); + else { + user_bdpi=number; + Message(PARSE_STDIN,"Bdpi: %d\n",user_bdpi); + } + break; + } else if ( *p == 'd' ) { /* -bd border width */ + int tmpi; + char* tmps; + p++; + if (*p == 0 && argv[i+1]) + p = argv[++i] ; + tmpi = strtol(p, &tmps, 10); + if (p 1000000) + Warning("Bad magnification parameter (-x or -y), ignored"); + else { + usermag=number; + Message(PARSE_STDIN,"Magstep: %d\n",usermag); + /*overridemag = (c == 'x' ? 1 : -1) ;*/ + } + break ; + case 'g' : + if (strncmp(p,"amma",4)==0) { /* --gamma correction */ + double gamma=0.0; + + p+=4; + if (*p == 0 && argv[i+1]) + p = argv[++i]; + if (p!=NULL) + gamma=atof(p); + if (gamma==0.0) { + Warning("Bad gamma value, default is %f",DEFAULT_GAMMA); + gamma=DEFAULT_GAMMA; + } + Gamma(gamma); + Message(PARSE_STDIN,"Gamma value is %s\n", gamma); + break; +#ifdef HAVE_GDIMAGEGIF + } else if (strncmp(p,"if",2)==0) { /* --gif output */ + option_flags |= GIF_OUTPUT; + Message(PARSE_STDIN,"GIF output\n"); + break; +#endif + } + goto DEFAULT; + case 'p' : + if (*p == 'p') { /* a -pp specifier for a page list */ + ppused=true; + p++ ; + if (*p == 0 && argv[i+1]) + p = argv[++i]; + Message(PARSE_STDIN,"Page list: %s\n",p); + if (ParsePages(p)) + Fatal("bad page list specifier (-pp)"); + } else if (strncmp(p,"ng",2)==0) { /* --png output */ + option_flags &= ~GIF_OUTPUT; + Message(PARSE_STDIN,"PNG output\n"); + } else if (strncmp(p,"icky",4)==0) { + if (p[4] != '0') { + option_flags |= MODE_PICKY; + Message(PARSE_STDIN,"No images output for pages with warnings\n",p); + } else { + option_flags &= ~MODE_PICKY; + Message(PARSE_STDIN,"Images output even for pages with warnings\n"); + } + } else if (strncmp(p,"alette",6)==0) { + if (p[6] != '0') { + option_flags |= FORCE_PALETTE; + Message(PARSE_STDIN,"Forcing 256-color PNG output\n",p); + } else { + option_flags &= ~FORCE_PALETTE; + Message(PARSE_STDIN,"Allows truecolor PNG output\n"); + } + } else { /* a -p specifier for first page */ + int32_t firstpage; + bool abspage=false; + + if (*p == 0 && argv[i+1]) + p = argv[++i] ; + if (*p == '=') { + abspage=true; + p++ ; + } + if ((*p>='0'&&*p<='9') || (*p=='-' && *(p+1)>='0' && *(p+1)<='9')) { + firstpage = atoi(p); + FirstPage(firstpage,abspage); + Message(PARSE_STDIN,"First page: %d\n",firstpage); + } else + Warning("Bad firstpage (-p) parameter, ignored"); + } + break ; + case 's' : + if (strncmp(p,"trict",5)==0) { + if (p[5] != '0') { + option_flags |= MODE_STRICT; + Message(PARSE_STDIN,"Warnings are fatal\n",p); + } else { + option_flags &= ~MODE_STRICT; + Message(PARSE_STDIN,"Warnings are not fatal\n"); + } + } else + goto DEFAULT; + break ; + case 'n' : + if (strncmp(p,"oghostscript",12)==0) { + if (p[12] != '0') { + option_flags |= NO_GHOSTSCRIPT; + Message(PARSE_STDIN,"No GhostScript calls\n",p); + } else { + option_flags &= ~NO_GHOSTSCRIPT; + Message(PARSE_STDIN,"GhostScript calls made\n"); + } + } else if (strncmp(p,"ogssafer",8)==0) { + if (p[8] != '0') { + option_flags |= NO_GSSAFER; + Message(PARSE_STDIN,"GhostScript calls does not use -dSAFER\n",p); + } else { + option_flags &= ~NO_GSSAFER; + Message(PARSE_STDIN,"GhostScript calls use -dSAFER\n"); + } + } else + goto DEFAULT; + break ; + case 'l': + { + int32_t lastpage; + bool abspage=false; + + if (*p == 0 && argv[i+1]) + p = argv[++i] ; + if (*p == '=') { + abspage=true; + p++ ; + } + if ((*p>='0'&&*p<='9') || (*p=='-' && *(p+1)>='0' && *(p+1)<='9')) { + lastpage = atoi(p); + LastPage(lastpage,abspage); + Message(PARSE_STDIN,"Last page: %d\n",lastpage); + } else + Warning("Bad lastpage (-l) parameter, ignored"); + } + break ; + case 'q': /* quiet operation */ + if (*p != '0') + option_flags &= (~BE_NONQUIET & ~BE_VERBOSE); + else + option_flags |= BE_NONQUIET; + break; + case 'r': /* process pages in reverse order */ + if (*p != '0') { + Message(PARSE_STDIN,"Reverse order\n"); + Reverse(true); + } else { + Message(PARSE_STDIN,"Normal order\n"); + Reverse(false); + } + break; + case 'v': /* verbatim mode */ + if (strcmp(p, "ersion")==0) { + if (strcmp(basename(programname),PACKAGE_NAME)!=0) + printf("%s (%s) %s\n",basename(programname), + PACKAGE_NAME,PACKAGE_VERSION); + else + puts(PACKAGE_STRING); +#ifdef HAVE_LIBKPATHSEA + puts (KPSEVERSION); +#endif +#ifdef HAVE_FT2 + printf("Compiled with Freetype %d.%d.%d\n", + FREETYPE_MAJOR, FREETYPE_MINOR, FREETYPE_PATCH); +# ifdef HAVE_FT_LIBRARY_VERSION + if (FT_Init_FreeType( &libfreetype )) + Warning("the Freetype library seems unusable"); + else { + FT_Int amajor, aminor, apatch; + + FT_Library_Version( libfreetype, &amajor, &aminor, &apatch ); + printf("Using libft %d.%d.%d\n",amajor, aminor, apatch); + FT_Done_FreeType(libfreetype); + } +# endif +#endif +#ifdef HAVE_LIBT1 + printf("Using t1lib %s\n", T1_GetLibIdent()); +#endif + puts ("Copyright (C) 2002-2010 Jan-Ake Larsson.\n\ +There is NO warranty. You may redistribute this software\n\ +under the terms of the GNU Lesser General Public License\n\ +version 3, see the COPYING file in the dvipng distribution\n\ +or ."); + exit (EXIT_SUCCESS); + } + if (*p != '0') + option_flags |= BE_NONQUIET | BE_VERBOSE; + else + option_flags &= ~BE_VERBOSE; + break; + case 'D' : + if (*p == 0 && argv[i+1]) + p = argv[++i] ; + number = atoi(p); + if (number < 10 || number > 10000) + Warning("Bad resolution (-D) parameter, ignored") ; + else { + dpi=number; + Message(PARSE_STDIN,"Dpi: %d\n",dpi); + } + break; + case 'Q': /* quality (= shrinkfactor) */ + if (*p == 0 && argv[i+1]) + p = argv[++i]; + if (*p>='0'&&*p<='9') { + shrinkfactor = atoi(p); + Message(PARSE_STDIN,"Quality: %d\n",shrinkfactor); + } else { + Warning("Non-numeric quality (-Q) value, ignored"); + } + break; + case 'w': + if (strncmp(p,"idth",4) == 0 ) { /* Width reporting */ + if (p[4] != '0') { + option_flags |= REPORT_WIDTH; + Message(PARSE_STDIN,"Width reporting on\n",p); + } else { + option_flags &= ~REPORT_WIDTH; + Message(PARSE_STDIN,"Width reporting off\n"); + } + break; + } + goto DEFAULT; +#ifdef HAVE_GDIMAGEPNGEX + case 'z': + if (*p == 0 && argv[i+1]) + p = argv[++i]; + number = atoi(p); + if (number<1 || number>9) + Warning("Bad compression (-z) value, ignored"); + else { + compression=number; + Message(PARSE_STDIN,"Compression: %d\n",shrinkfactor); + } + break; +#endif + case '\0': + option_flags |= PARSE_STDIN; + break; + DEFAULT: default: + Warning("%s is not a valid option", argv[i]); + } + } else { + dviname=argv[i]; + } + } + if (dviname != NULL) { + if (dvi != NULL && dvi->filep != NULL) + DVIClose(dvi); + dvi=DVIOpen(dviname,outname); + } + + if (dvi==NULL) { + fprintf(stdout,"\nUsage: %s [OPTION]... FILENAME[.dvi]\n", programname); + fprintf(stdout,"Options are chosen to be similar to dvips' options where possible:\n"); +#ifdef DEBUG + fprintf(stdout," -d # Debug (# is the debug bitmap, 1 if not given)\n"); +#endif + fprintf(stdout," -D # Output resolution\n"); + fprintf(stdout," -l # Last page to be output\n"); + fprintf(stdout," -o f Output file, '%%d' is pagenumber\n"); + fprintf(stdout," -O c Image offset\n"); + fprintf(stdout," -p # First page to be output\n"); + fprintf(stdout," -pp #,#.. Page list to be output\n"); + fprintf(stdout," -q* Quiet operation\n"); + fprintf(stdout," -T c Image size (also accepts '-T bbox' and '-T tight')\n"); + fprintf(stdout," -v* Verbose operation\n"); + fprintf(stdout," - Interactive query of options\n"); + fprintf(stdout,"\nThese do not correspond to dvips options:\n"); + fprintf(stdout," -bd # Transparent border width in dots\n"); + fprintf(stdout," -bd s Transparent border fallback color (TeX-style color)\n"); + fprintf(stdout," -bg s Background color (TeX-style color or 'Transparent')\n"); + fprintf(stdout," --depth* Output the image depth on stdout\n"); + fprintf(stdout," --dvinum* Use TeX page numbers in output filenames\n"); + fprintf(stdout," -fg s Foreground color (TeX-style color)\n"); + fprintf(stdout," --follow* Wait for data at end-of-file\n"); +#ifdef HAVE_FT2 + fprintf(stdout," --freetype* FreeType font rendering (default on)\n"); +#endif + fprintf(stdout," --gamma # Control color interpolation\n"); +#ifdef HAVE_GDIMAGEGIF + fprintf(stdout," --gif Output GIF images (dvigif default)\n"); +#endif + fprintf(stdout," --height* Output the image height on stdout\n"); + fprintf(stdout," --noghostscript* Don't use ghostscript for PostScript specials\n"); + fprintf(stdout," --nogssafer* Don't use -dSAFER in ghostscript calls\n"); +#ifdef HAVE_GDIMAGECREATETRUECOLOR + fprintf(stdout," --palette* Force palette output\n"); +#endif + fprintf(stdout," --picky When a warning occurs, don't output image\n"); +#ifdef HAVE_GDIMAGEGIF + fprintf(stdout," --png Output PNG images (dvipng default)\n"); +#endif + fprintf(stdout," --strict When a warning occurs, exit\n"); +#ifdef HAVE_LIBT1 + fprintf(stdout," --t1lib* T1lib font rendering (default on)\n"); +#endif +#ifdef HAVE_GDIMAGECREATETRUECOLOR + fprintf(stdout," --truecolor* Truecolor output\n"); +#endif + fprintf(stdout," -Q # Quality (T1lib and PK subsampling)\n"); +#ifdef HAVE_GDIMAGEPNGEX + fprintf(stdout," -z # PNG compression level\n"); +#endif + + fprintf(stdout,"\n # = number f = file s = string * = suffix, '0' to turn off\n"); + fprintf(stdout," c = comma-separated dimension pair (e.g., 3.2in,-32.1cm)\n\n"); + /*#ifdef HAVE_LIBKPATHSEA + { + extern DllImport char *kpse_bug_address; + putc ('\n', stdout); + fputs (kpse_bug_address, stdout); + } + #endif*/ + if ((option_flags & PARSE_STDIN) == 0) { + exit(EXIT_SUCCESS); + } + } + if ((option_flags & PARSE_STDIN) == 0 && (!ppused)) + ParsePages("-"); + return((option_flags & PARSE_STDIN) != 0); +} + +void DecodeString(char *string) +{ +#define PARSEARGS 10 + char *strv[PARSEARGS]; + int strc=1; + strv[0]=NULL; /* No program name */ + + while (*string==' ' || *string=='\t' || *string=='\n') + string++; + while (*string!='\0') { + strv[strc++]=string; + if (*string!='\'') { + /* Normal split at whitespace */ + while (*string!=' ' && *string!='\t' && *string!='\n' && *string!='\0') + string++; + } else { + /* String delimiter found , so search for next */ + strv[strc-1]=++string; + while (*string!='\'' && *string!='\0') + string++; + } + if (*string!='\0') + *string++='\0'; + while (*string==' ' || *string=='\t' || *string=='\n') + string++; + } + if (strc>1) /* Nonempty */ + (void) DecodeArgs(strc,strv); +} + + + +uint32_t UNumRead(unsigned char* current, register int n) +{ + uint32_t x = (unsigned char) *(current)++; /* number being constructed */ + while(--n) + x = (x << 8) | *(current)++; + return(x); +} + +int32_t SNumRead(unsigned char* current, register int n) +{ + int32_t x = (signed char) *(current)++; /* number being constructed */ + while(--n) + x = (x << 8) | *(current)++; + return(x); +} + + +/**********************************************************************/ +/****************************** Fatal *******************************/ +/**********************************************************************/ +void Fatal (const char *fmt, ...) +{ + va_list args; + + va_start(args, fmt); + fflush(stdout); + fprintf(stderr, "\n"); + fprintf(stderr, "%s: Fatal error, ", programname); + vfprintf(stderr, fmt, args); + + fprintf(stderr, "\n\n"); + va_end(args); + + ClearFonts(); +#ifdef HAVE_FT2 + if (libfreetype) + (void) FT_Done_FreeType(libfreetype); /* at this point, ignore error */ +#endif +#ifdef HAVE_LIBT1 + if (libt1) + (void) T1_CloseLib(); /* at this point, ignore error */ +#endif + exit(EXIT_FATAL); +} + +/*-->Warning*/ +/**********************************************************************/ +/***************************** Warning ******************************/ +/**********************************************************************/ +void Warning(const char *fmt, ...) +{ + va_list args; + + va_start(args, fmt); + + if ( option_flags & BE_NONQUIET ) { + fflush(stdout); + fprintf(stderr, "%s warning: ", programname); + vfprintf(stderr, fmt, args); + fprintf(stderr, " "); + } + va_end(args); +} + +/*-->Message*/ +/**********************************************************************/ +/***************************** Message ******************************/ +/**********************************************************************/ +void Message(int activeflags, const char *fmt, ...) +{ + va_list args; + + va_start(args, fmt); + if ( option_flags & activeflags ) { + vfprintf(stdout, fmt, args); + } + va_end(args); +} + + +bool MmapFile (char *filename,struct filemmap *fmmap) +{ +#ifndef WIN32 + struct stat stat; +#endif + + DEBUG_PRINT(DEBUG_DVI,("\n OPEN FILE:\t'%s'", filename)); + fmmap->data=NULL; +#ifndef WIN32 + if ((fmmap->fd = open(filename,O_RDONLY)) == -1) { + Warning("cannot open file <%s>", filename); + return(true); + } + fstat(fmmap->fd,&stat); + fmmap->size=stat.st_size; +# ifdef HAVE_MMAP + fmmap->data = mmap(NULL,fmmap->size, PROT_READ, MAP_SHARED,fmmap->fd,0); + if (fmmap->data == (char*)-1) { + Warning("cannot mmap file <%s>",filename); + fmmap->data=NULL; + close(fmmap->fd); + return(true); + } +# else /* HAVE_MMAP */ + fmmap->data = malloc(fmmap->size); + if (fmmap->data == NULL) { + Warning("cannot malloc space for <%s>",filename); + close(fmmap->fd); + return(true); + } + if (read(fmmap->fd,fmmap->data,fmmap->size)size) { + Warning("too little data in <%s>",filename); + free(fmmap->data); + fmmap->data=NULL; + close(fmmap->fd); + return(true); + } + close(fmmap->fd); +# endif /* HAVE_MMAP */ +#else /* WIN32 */ + fmmap->hFile = CreateFile(filename, GENERIC_READ, FILE_SHARE_READ, 0, + OPEN_EXISTING, FILE_FLAG_RANDOM_ACCESS, 0); + if (fmmap->hFile == INVALID_HANDLE_VALUE) { + Warning("cannot open file <%s>", filename); + return(true); + } + fmmap->size = GetFileSize(fmmap->hFile, 0); + fmmap->hMap = CreateFileMapping(fmmap->hFile, 0, PAGE_READONLY, 0, 0, 0); + if (fmmap->hMap == 0) { + CloseHandle (fmmap->hFile); + Warning("cannot CreateFileMapping() file <%s>", filename); + return(true); + } + fmmap->data = MapViewOfFile(fmmap->hMap, FILE_MAP_READ, 0, 0, 0); + if (fmmap->data == NULL) { + Warning("cannot MapViewOfFile() file <%s>", filename); + CloseHandle (fmmap->hMap); + CloseHandle (fmmap->hFile); + return(true); + } +#endif /* WIN32 */ + return(false); +} + +void UnMmapFile(struct filemmap* fmmap) +{ + if (fmmap->data!=NULL) { +#ifndef WIN32 +# ifdef HAVE_MMAP + if (munmap(fmmap->data,fmmap->size)) + Warning("cannot munmap file at 0x%X",fmmap->data); + if (close(fmmap->fd)) + Warning("cannot close file descriptor %d",fmmap->fd); +# else /* HAVE_MMAP */ + free(fmmap->data); +# endif /* HAVE_MMAP */ +#else /* WIN32 */ + UnmapViewOfFile (fmmap->data); + CloseHandle (fmmap->hMap); + CloseHandle (fmmap->hFile); +#endif /* WIN32 */ + } + fmmap->data=NULL; +} diff --git a/Build/source/texk/dvipng/dvipng-1.13/papersiz.c b/Build/source/texk/dvipng/dvipng-1.13/papersiz.c new file mode 100644 index 00000000000..3cf15d7a06c --- /dev/null +++ b/Build/source/texk/dvipng/dvipng-1.13/papersiz.c @@ -0,0 +1,73 @@ +/* papersiz.c */ + +/************************************************************************ + + Part of the dvipng distribution + + This program is free software: you can redistribute it and/or modify + it under the terms of the GNU Lesser General Public License as + published by the Free Software Foundation, either version 3 of the + License, or (at your option) any later version. + + This program is distributed in the hope that it will be useful, but + WITHOUT ANY WARRANTY; without even the implied warranty of + MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU + Lesser General Public License for more details. + + You should have received a copy of the GNU Lesser General Public + License along with this program. If not, see + . + + Copyright (C) 2002-2010 Jan-Åke Larsson + +************************************************************************/ + +#include "dvipng.h" + +const char *lengthnames[]={ "sp", "pt", "bp", + "dd", "mm", "pc", + "cc", "cm", "in" }; +const int32_t lengthsp[]={ 1L, 65536L, 65782L, + 70124L, 186468L, 786432L, + 841489L, 1864680L, 4736286L }; + +/* + * Convert a double[unit], e.g., "3.2cm" or "1.0in" into length in pixels. + * Advance the passed pointer as well. + */ + +static int32_t myatodim(const char ** p) +{ + double tmp; /* double accuracy is enough, I think */ + int i=0; + char *q; + + tmp = strtod(*p,&q); + while (*q == ' ') + q++; + while (i<8 && (q[0]!=lengthnames[i][0] || q[1]!=lengthnames[i][1])) + i++; + if (i==8 && (q[0]!=lengthnames[i][0] || q[1]!=lengthnames[i][1])) + Warning("unrecognized length unit \"%.2s\", assuming inches",q); + while (*q != ',' && *q !='\0') + q++; + tmp = tmp*lengthsp[i]*dpi/4736286L; /* sp * dots/in / (sp/in), convert sp to pixels */ + return((int32_t) tmp); +} + + +/* + * The routine where we handle the paper size special. We need to pass in + * the string after the `papersize=' specification. + */ + +void handlepapersize(const char * p, int32_t * x, int32_t * y) +{ + while (*p == ' ') + p++ ; + *x = myatodim(&p) ; + while (*p == ' ' || *p == ',') + p++ ; + *y = myatodim(&p) ; +} + diff --git a/Build/source/texk/dvipng/dvipng-1.13/pk.c b/Build/source/texk/dvipng/dvipng-1.13/pk.c new file mode 100644 index 00000000000..446dc7ed2ee --- /dev/null +++ b/Build/source/texk/dvipng/dvipng-1.13/pk.c @@ -0,0 +1,403 @@ +/* pk.c */ + +/************************************************************************ + + Part of the dvipng distribution + + This program is free software: you can redistribute it and/or modify + it under the terms of the GNU Lesser General Public License as + published by the Free Software Foundation, either version 3 of the + License, or (at your option) any later version. + + This program is distributed in the hope that it will be useful, but + WITHOUT ANY WARRANTY; without even the implied warranty of + MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU + Lesser General Public License for more details. + + You should have received a copy of the GNU Lesser General Public + License along with this program. If not, see + . + + Copyright (C) 2002-2009 Jan-Åke Larsson + +************************************************************************/ + +#include "dvipng.h" + +#define PK_POST 245 +#define PK_PRE 247 +#define PK_ID 89 + +unsigned char dyn_f; +int repeatcount; +int poshalf; + +static unsigned char getnyb(unsigned char** pos) +{ + if (poshalf == 0) { + poshalf=1; + return(**pos / 16); + } else { + poshalf=0; + return(*(*pos)++ & 15); + } +} + +static uint32_t pk_packed_num(unsigned char** pos) +{ + register int i; + uint32_t j; + + i = (int)getnyb(pos); + if (i == 0) { + do { + j = (uint32_t)getnyb(pos); + i++; + } while (j == 0); + while (i > 0) { + j = j * 16 + (uint32_t)getnyb(pos); + i--; + }; + return (j - 15 + (13 - dyn_f) * 16 + dyn_f); + } else if (i <= (int)dyn_f) { + return ((uint32_t)i); + } else if (i < 14) { + return ((i-(uint32_t)dyn_f - 1) * 16 + (uint32_t)getnyb(pos) + + dyn_f + 1); + } else { + if (i == 14) { + repeatcount = (int)pk_packed_num(pos); + } else { + repeatcount = 1; + } + return (pk_packed_num(pos)); /* tail end recursion !! */ + } +} + +static unsigned char* skip_specials(unsigned char* pos) +{ + uint32_t i; + + while (*pos >= 240 && *pos != PK_POST) { + i=0; + switch (*pos++) { + case 243: + i = *pos++; + case 242: + i = 256 * i + *pos++; + case 241: + i = 256 * i + *pos++; + case 240: + i = 256 * i + *pos++; + DEBUG_PRINT(DEBUG_PK,("\n PK SPECIAL\t'%.*s' ",(int)i,pos)); + pos += i; + break; + case 244: +#ifdef DEBUG + { + uint32_t c; + c=UNumRead(pos,4); + DEBUG_PRINT(DEBUG_PK,("\n PK SPECIAL\t%d",c)); + } +#endif + pos += 4; + break; + case 245: + break; + case 246: + DEBUG_PRINT(DEBUG_PK,("\n PK\tNOP ")); + break; + case 247: case 248: case 249: case 250: + case 251: case 252: case 253: case 254: + case 255: + Fatal("unexpected PK flagbyte %d", (int)*pos); + } + } + return(pos); +} + + +void LoadPK(int32_t c, register struct char_entry * ptr) +{ + unsigned short shrunk_width,shrunk_height; + unsigned short width,height; + short xoffset,yoffset; + unsigned short i_offset,j_offset; + int i,j,k,n; + int count=0; + bool paint_switch; + unsigned char *pos,*buffer; + + DEBUG_PRINT(DEBUG_PK,("\n LOAD PK CHAR\t%d",c)); + pos=ptr->pkdata; + if ((ptr->flag_byte & 7) == 7) n=4; + else if ((ptr->flag_byte & 4) == 4) n=2; + else n=1; + dyn_f = ptr->flag_byte / 16; + paint_switch = ((ptr->flag_byte & 8) != 0); + /* + * Read character preamble + */ + if (n != 4) { + ptr->tfmw = UNumRead(pos, 3); + /* +n: vertical escapement not used */ + pos+=3+n; + } else { + ptr->tfmw = UNumRead(pos, 4); + /* +4: horizontal escapement not used */ + /* +n: vertical escapement not used */ + pos+=8+n; + } + DEBUG_PRINT(DEBUG_PK,(" %d",ptr->tfmw)); + ptr->tfmw = (dviunits) + ((int64_t) ptr->tfmw * currentfont->s / 0x100000 ); + DEBUG_PRINT(DEBUG_PK,(" (%d)",ptr->tfmw)); + + width = UNumRead(pos, n); + height = UNumRead(pos+=n, n); + DEBUG_PRINT(DEBUG_PK,(" %dx%d",width,height)); + + if (width > 0x7fff || height > 0x7fff) + Fatal("character %d too large in file %s", c, currentfont->name); + + /* + * Hotspot issues: Shrinking to the topleft corner rather than the + hotspot will displace glyphs a fraction of a pixel. We deal with + this in as follows: The glyph is shrunk to its hotspot by + offsetting the bitmap somewhat to put the hotspot in the lower + left corner of a "shrink square". Shrinking to the topleft corner + will then act as shrinking to the hotspot. This may enlarge the + bitmap somewhat, of course. (Also remember that the below + calculation of i/j_offset is in integer arithmetics.) + + There will still be a displacement from rounding the dvi + position, but vertically it will be equal for all glyphs on a + line, so we displace a whole line vertically by fractions of a + pixel. This is acceptible, IMHO. Sometime there will be support + for subpixel positioning, horizontally. Will do for now, I + suppose. + */ + xoffset = SNumRead(pos+=n, n); + i_offset = ( shrinkfactor - xoffset % shrinkfactor ) % shrinkfactor; + width += i_offset; + ptr->xOffset = xoffset+i_offset; + + yoffset = SNumRead(pos+=n, n); + j_offset = ( shrinkfactor - (yoffset-(shrinkfactor-1)) % shrinkfactor ) + % shrinkfactor; + height += j_offset; + ptr->yOffset = yoffset+j_offset; + + DEBUG_PRINT(DEBUG_PK,(" (%dx%d)",width,height)); + /* + Extra marginal so that we do not crop the image when shrinking. + */ + shrunk_width = (width + shrinkfactor - 1) / shrinkfactor; + shrunk_height = (height + shrinkfactor - 1) / shrinkfactor; + ptr->w = shrunk_width; + ptr->h = shrunk_height; + pos+=n; + buffer = calloc(shrunk_width*shrunk_height* + shrinkfactor*shrinkfactor,sizeof(char)); + DEBUG_PRINT(DEBUG_GLYPH,("\nDRAW GLYPH %d\n", (int)c)); + /* Raster char */ + if (dyn_f == 14) { /* get raster by bits */ + int bitweight = 0; + for (j = j_offset; j < (int) height; j++) { /* get all rows */ + for (i = i_offset; i < (int) width; i++) { /* get one row */ + bitweight /= 2; + if (bitweight == 0) { + count = *pos++; + bitweight = 128; + } + if (count & bitweight) { + buffer[i+j*width]=1; +#ifdef DEBUG + DEBUG_PRINT(DEBUG_GLYPH,("+")); + } else { + DEBUG_PRINT(DEBUG_GLYPH,(" ")); +#endif + } + } + DEBUG_PRINT(DEBUG_GLYPH,("|\n")); + } + } else { /* get packed raster */ + poshalf=0; + repeatcount = 0; + for(i=i_offset, j=j_offset; j 0) { + if (i+count < width) { + if (paint_switch) + for(k=0;k0; repeatcount--,j++) { + for (i = i_offset; i0) { + DEBUG_PRINT(DEBUG_GLYPH,("=")); + } else { + DEBUG_PRINT(DEBUG_GLYPH,(" ")); + } +#endif + } + DEBUG_PRINT(DEBUG_GLYPH,("|\n")); + } + i=i_offset; + } + } + paint_switch = 1 - paint_switch; + } + if (i>i_offset) + Fatal("wrong number of bits stored: char. %c, font %s", + (char)c, currentfont->name); + if (j>height) + Fatal("bad PK file %s, too many bits", currentfont->name); + } + /* + Shrink raster while doing antialiasing. (See above. The + single-glyph output seems better than what xdvi at 300 dpi, + shrinkfactor 3 produces.) + */ + if ((ptr->data = calloc(shrunk_width*shrunk_height,sizeof(char))) == NULL) + Fatal("unable to malloc image space for char %c", (char)c); + for (j = 0; j < (int) height; j++) { + for (i = 0; i < (int) width; i++) { + /* if (((i % shrinkfactor) == 0) && ((j % shrinkfactor) == 0)) + ptr->data[i/shrinkfactor+j/shrinkfactor*shrunk_width] = + buffer[i+j*width]; + else */ + ptr->data[i/shrinkfactor+j/shrinkfactor*shrunk_width] += + buffer[i+j*width]; + } + } + for (j = 0; j < shrunk_height; j++) { + for (i = 0; i < shrunk_width; i++) { + ptr->data[i+j*shrunk_width] = ptr->data[i+j*shrunk_width] + *255/shrinkfactor/shrinkfactor; + DEBUG_PRINT(DEBUG_GLYPH,("%3u ",ptr->data[i+j*shrunk_width])); + } + DEBUG_PRINT(DEBUG_GLYPH,("|\n")); + } + free(buffer); +} + +void InitPK(struct font_entry * tfontp) +{ + unsigned char* position; + struct char_entry *tcharptr; /* temporary char_entry pointer */ + uint32_t hppp, vppp, packet_length; + uint32_t c; + + DEBUG_PRINT((DEBUG_DVI|DEBUG_PK),("\n OPEN FONT:\t'%s'", tfontp->name)); + Message(BE_VERBOSE,"<%s>", tfontp->name); + if (MmapFile(tfontp->name,&(tfontp->fmmap))) + Fatal("font file %s unusable", tfontp->name); + position=(unsigned char*)tfontp->fmmap.data; + if (tfontp->fmmap.size < 2 || tfontp->fmmap.size < 3+*(position+2)+16) + Fatal("PK file %s ends prematurely",tfontp->name); + if (*position++ != PK_PRE) + Fatal("unknown font format in file %s",tfontp->name); + if (*position++ != PK_ID) + Fatal( "wrong version %d of PK file %s (should be 89)", + (int)*(position-1),tfontp->name); + DEBUG_PRINT(DEBUG_PK,("\n PK_PRE:\t'%.*s'",(int)*position, position+1)); + position += *position + 1; + + tfontp->designsize = UNumRead(position, 4); + DEBUG_PRINT(DEBUG_PK,(" %d", tfontp->designsize)); + tfontp->type = FONT_TYPE_PK; + + c = UNumRead(position+4, 4); + DEBUG_PRINT(DEBUG_PK,(" %d", c)); + CheckChecksum (tfontp->c, c, tfontp->name); + + hppp = UNumRead(position+8, 4); + vppp = UNumRead(position+12, 4); + DEBUG_PRINT(DEBUG_PK,(" %d %d", hppp,vppp)); + if (hppp != vppp) + Warning("aspect ratio is %d:%d (should be 1:1)", hppp, vppp); + tfontp->magnification = (uint32_t)((uint64_t)hppp * 7227 * 5 / 65536l + 50)/100; + position+=16; + /* Read char definitions */ + position = skip_specials(position); + while (*position != PK_POST) { + DEBUG_PRINT(DEBUG_PK,("\n @%ld PK CHAR:\t%d", + (long)position - (long)tfontp->fmmap.data, *position)); + if ((tcharptr = malloc(sizeof(struct char_entry))) == NULL) + Fatal("cannot malloc space for char_entry"); + tcharptr->flag_byte = *position; + tcharptr->data = NULL; + tcharptr->tfmw = 0; + if ((*position & 7) == 7) { + packet_length = UNumRead(position+1,4); + c = UNumRead(position+5, 4); + position += 9; + } else if (*position & 4) { + packet_length = (*position & 3) * 65536l + + UNumRead(position+1, 2); + c = UNumRead(position+3, 1); + position += 4; + } else { + packet_length = (*position & 3) * 256 + + UNumRead(position+1, 1); + c = UNumRead(position+2, 1); + position += 3; + } + DEBUG_PRINT(DEBUG_PK,(" %d %d",packet_length,c)); + if (c > (LASTFNTCHAR)) + Fatal("PK font %s exceeds char numbering limit",tfontp->name); + tcharptr->length = packet_length; + tcharptr->pkdata = position; + tfontp->chr[c]=tcharptr; + position += packet_length; + position = skip_specials(position); + } +} + +static void UnLoadPK(struct char_entry *ptr) +{ + if (ptr->data!=NULL) + free(ptr->data); + ptr->data=NULL; +} + +void DonePK(struct font_entry *tfontp) +{ + int c=FIRSTFNTCHAR; + + UnMmapFile(&(tfontp->fmmap)); + while(c<=LASTFNTCHAR) { + if (tfontp->chr[c]!=NULL) { + UnLoadPK((struct char_entry*)tfontp->chr[c]); + free(tfontp->chr[c]); + } + c++; + } + if (tfontp->name!=NULL) + free(tfontp->name); + tfontp->name=NULL; +} diff --git a/Build/source/texk/dvipng/dvipng-1.13/ppagelist.c b/Build/source/texk/dvipng/dvipng-1.13/ppagelist.c new file mode 100644 index 00000000000..b7467a98539 --- /dev/null +++ b/Build/source/texk/dvipng/dvipng-1.13/ppagelist.c @@ -0,0 +1,189 @@ +/* ppagelist.c */ + +/************************************************************************ + + Part of the dvipng distribution + + This program is free software: you can redistribute it and/or modify + it under the terms of the GNU Lesser General Public License as + published by the Free Software Foundation, either version 3 of the + License, or (at your option) any later version. + + This program is distributed in the hope that it will be useful, but + WITHOUT ANY WARRANTY; without even the implied warranty of + MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU + Lesser General Public License for more details. + + You should have received a copy of the GNU Lesser General Public + License along with this program. If not, see + . + + Copyright (C) 2002-2010 Jan-Åke Larsson + +************************************************************************/ + +#include "dvipng.h" + +/* Some code at the end of this file is adapted from dvips */ + +static int32_t first=PAGE_FIRSTPAGE, last=PAGE_LASTPAGE; +static bool abspage=false, reverse=false; +bool no_ppage=true; + +/* dvips' behaviour: + * -pp outputs _all_ pages with the correct numbers, + * -p, -l outputs from the first occurrence of firstpage to the first + * occurrence of lastpage. Using '=' means absolute pagenumbers + */ + +void FirstPage(int32_t page, bool data) +{ + first=page; + abspage |= data; +} +void LastPage(int32_t page,bool data) +{ + last=page; + abspage |= data; +} +void Reverse(bool new) +{ + reverse=new; +} +/*-->NextPPage*/ +/**********************************************************************/ +/**************************** NextPPage *****************************/ +/**********************************************************************/ +/* Return the page in turn on our queue */ +/* (Implicitly, PAGE_POST is never in the pagelist) */ +bool InPageList(int32_t i); + +struct page_list* NextPPage(void* dvi, struct page_list* page) +{ + if (! reverse) { /*********** normal order */ + if (page == NULL) { /* first call: find first page */ + if (no_ppage) + return(NULL); + page=FindPage(dvi,first,abspage); + } else /* later calls: count up, except "last" page */ + page=(last==page->count[abspage ? 0 : 10]) ? NULL : NextPage(dvi,page); + /* seek for pages in pagelist */ + while (page!=NULL && ! InPageList(page->count[0])) + page=(last==page->count[abspage ? 0 : 10]) ? NULL : NextPage(dvi,page); + } else { /******************** reverse order */ + if (page == NULL) { /* first call: find "last" page */ + if (no_ppage) + return(NULL); + page=FindPage(dvi,last,abspage); + } else /* later calls: count down, except "first" page */ + page=(first==page->count[abspage ? 0 : 10]) ? NULL : PrevPage(dvi,page); + /* seek for pages in pagelist */ + while (page!=NULL && ! InPageList(page->count[0])) + page=(first==page->count[abspage ? 0 : 10]) ? NULL : PrevPage(dvi,page); + } + return(page); +} + +struct pp_list { + struct pp_list *next; /* next in a series of alternates */ + int32_t ps_low, ps_high; /* allowed range */ +} *ppages = 0; /* the list of allowed pages */ + +/*-->InPageList*/ +/**********************************************************************/ +/****************************** InPageList **************************/ +/**********************************************************************/ +/* Return true iff i is one of the desired output pages */ + +bool InPageList(int32_t i) +{ + register struct pp_list *pl = ppages; + + while (pl) { + if ( i >= pl -> ps_low && i <= pl -> ps_high) + return(true); /* success */ + pl = pl -> next; + } + return(false); +} + +static void ListPage(int32_t pslow, int32_t pshigh) +{ + register struct pp_list *pl; + + /* Some added code, we want to reuse the list */ + no_ppage=false; + pl = ppages; + while (pl != NULL && pl->ps_low <= pl->ps_high) + pl = pl->next; + if (pl == NULL) { + if ((pl = (struct pp_list *)malloc(sizeof(struct pp_list))) + ==NULL) + Fatal("cannot malloc memory for page queue"); + pl -> next = ppages; + ppages = pl; + } + pl -> ps_low = pslow; + pl -> ps_high = pshigh; +} + +/* Parse a string representing a list of pages. Return 0 iff ok. As a + side effect, the page selection(s) is (are) prepended to ppages. */ + +bool ParsePages(const char *s) +{ + const char *c; /* conversion start */ + char *t; + long int ps_low = PAGE_MINPAGE, ps_high = PAGE_MAXPAGE; + + while (*s==' ' || *s=='\t') s++; + while (*s!='\0') { + if (*s=='-' || *s==':') { /* range with no starting value */ + ps_low = PAGE_MINPAGE; + c=s+1; + ps_high = strtol(c,&t,10); + s = t; + if (c==s) ps_high=PAGE_MAXPAGE; /* no number */ + while (*s==' ' || *s=='\t') s++; + if (*s=='-' || *s==':') { /* Oh, range with negative starting value */ + ps_low = -ps_high; + c=s+1; + ps_high = strtol(c,&t,10); + s = t; + if (c==s) ps_high=PAGE_MAXPAGE; /* no number */ + } + } else { /* range with starting value, or singleton */ + c=s; + ps_low = ps_high = strtol(c,&t,10); + s = t; + if (c==s) + return(true); + if (*s=='-' || *s==':') { /* range */ + c=s+1; + ps_high = strtol(c,&t,10); + s = t; + if (c==s) ps_high=PAGE_MAXPAGE; /* no number */ + } + } + ListPage(ps_low, ps_high); + while (*s==' ' || *s=='\t' || *s==',') s++; + } + return(false); +} + +/* Addition, we want to be able to clear the pplist */ +void ClearPpList(void) +{ + register struct pp_list *pl = ppages; + + while (pl) { + ppages=ppages->next; + free(pl); + pl = ppages; + } + first=PAGE_FIRSTPAGE; + last=PAGE_LASTPAGE; + abspage = false; + no_ppage=true; +} + diff --git a/Build/source/texk/dvipng/dvipng-1.13/set.c b/Build/source/texk/dvipng/dvipng-1.13/set.c new file mode 100644 index 00000000000..af4e4ebdfaa --- /dev/null +++ b/Build/source/texk/dvipng/dvipng-1.13/set.c @@ -0,0 +1,289 @@ +/* set.c */ + +/************************************************************************ + + Part of the dvipng distribution + + This program is free software: you can redistribute it and/or modify + it under the terms of the GNU Lesser General Public License as + published by the Free Software Foundation, either version 3 of the + License, or (at your option) any later version. + + This program is distributed in the hope that it will be useful, but + WITHOUT ANY WARRANTY; without even the implied warranty of + MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU + Lesser General Public License for more details. + + You should have received a copy of the GNU Lesser General Public + License along with this program. If not, see + . + + Copyright (C) 2002-2010 Jan-Åke Larsson + +************************************************************************/ + +#include "dvipng.h" +#include + +#ifndef HAVE_GDIMAGECREATETRUECOLOR +#define gdImageColorAllocateAlpha(i,r,g,b,a) gdImageColorAllocate(i,r,g,b) +#define gdImageColorResolveAlpha(i,r,g,b,a) gdImageColorResolve(i,r,g,b) +#define gdImageAlpha(i,c) 0 +#define gdAlphaMax 127 +#endif +#ifndef HAVE_GDIMAGEPNGEX +#define gdImagePngEx(i,f,z) gdImagePng(i,f) +#endif + +/* Persistent color cache. Index is ink thickness, + 0=no ink, 127=total coverage */ +static int ColorCache[gdAlphaMax+1]; + +void CreateImage(pixels x_width,pixels y_width) +{ + if (page_imagep) + gdImageDestroy(page_imagep); + if (x_width <= 0) x_width=1; + if (y_width <= 0) y_width=1; +#ifdef HAVE_GDIMAGECREATETRUECOLOR + /* GIFs are 256-color */ + if ((option_flags & FORCE_TRUECOLOR + || page_flags & PAGE_TRUECOLOR) + && ~option_flags & GIF_OUTPUT + && ~option_flags & FORCE_PALETTE) + page_imagep=gdImageCreateTrueColor(x_width,y_width); + else +#endif + page_imagep=gdImageCreate(x_width,y_width); + /* Set bg color. GIFs cannot handle an alpha channel, resort to + transparent color index, set in WriteImage */ + ColorCache[0] + = gdImageColorAllocateAlpha(page_imagep, + cstack[0].red, + cstack[0].green, + cstack[0].blue, + (option_flags & BG_TRANSPARENT_ALPHA + && ~option_flags & GIF_OUTPUT) ? 127 : 0); + ColorCache[gdAlphaMax]=-1; +#ifdef HAVE_GDIMAGECREATETRUECOLOR + /* Alpha blending in libgd is only performed for truecolor images. + We need it for palette images also. Turn libgd alpha blending off + and calculate color blending where needed. We turn it back on + briefly for image inclusion. */ + gdImageAlphaBlending(page_imagep, 0); + if (option_flags & BG_TRANSPARENT_ALPHA) + gdImageSaveAlpha(page_imagep, 1); + if (page_imagep->trueColor) + /* Truecolor: there is no background color index, fill image instead. */ + gdImageFilledRectangle(page_imagep, 0, 0, + x_width-1, y_width-1, ColorCache[0]); +#endif +} + + +static void ChangeColor(gdImagePtr imagep,int x1,int y1, + int x2,int y2,int color1,int color2) +/* In the given rectangle, change color1 to color2 */ +{ + int x,y; + for( y=y1; y<=y2; y++) { + for( x=x1; x<=x2; x++) { + if (gdImageGetPixel(imagep, x, y)==color1) + gdImageSetPixel(imagep, x, y, color2); + } + } +} + +void WriteImage(char *pngname, int pagenum) +{ + char* pos, *freeme=NULL; + FILE* outfp=NULL; + + /* Set transparent background. Maybe alpha is not available or + perhaps we are producing GIFs, so test for BG_TRANSPARENT_ALPHA + too */ + if (option_flags & (BG_TRANSPARENT|BG_TRANSPARENT_ALPHA)) + gdImageColorTransparent(page_imagep,ColorCache[0]); + /* Transparent border */ + if (borderwidth>0) { + int Transparent; + pixels x_width,y_width; + + x_width=gdImageSX(page_imagep); + y_width=gdImageSY(page_imagep); + + /* Set ANOTHER bg color, transparent this time */ + /* No semi-transparency here, given the motivation for this code + * (box cursor visibility in Emacs) */ + if (userbordercolor) + Transparent = gdImageColorAllocate(page_imagep, + bordercolor.red, + bordercolor.green, + bordercolor.blue); + else + Transparent = gdImageColorAllocate(page_imagep, + gdImageRed(page_imagep,ColorCache[0]), + gdImageGreen(page_imagep,ColorCache[0]), + gdImageBlue(page_imagep,ColorCache[0])); + gdImageColorTransparent(page_imagep,Transparent); + ChangeColor(page_imagep,0,0,x_width-1,borderwidth-1, + ColorCache[0],Transparent); + ChangeColor(page_imagep,0,0,borderwidth-1,y_width-1, + ColorCache[0],Transparent); + ChangeColor(page_imagep,x_width-borderwidth,0,x_width-1,y_width-1, + ColorCache[0],Transparent); + ChangeColor(page_imagep,0,y_width-borderwidth,x_width-1,y_width-1, + ColorCache[0],Transparent); + } + + if ((pos=strchr(pngname,'%')) != NULL) { + if (strchr(++pos,'%')) + Fatal("too many %%s in output file name"); + if (*pos == 'd' + || (*pos=='0' && pos[1]>='1' && pos[1]<='9' && pos[2]=='d')) { + /* %d -> pagenumber, so add 9 string positions + since pagenumber max +-2^31 or +-2*10^9 */ + freeme = malloc(strlen(pngname)+9); + sprintf(freeme,pngname,pagenum); + pngname = freeme; + } else { + Fatal("unacceptible format spec in output file name"); + } + } +#ifdef HAVE_GDIMAGEGIF + if (option_flags & GIF_OUTPUT && (pos=strrchr(pngname,'.')) != NULL + && strcmp(pos,".png")==0) { + *(pos+1)='g'; + *(pos+2)='i'; + *(pos+3)='f'; + } +#endif + if ((outfp = fopen(pngname,"wb")) == NULL) + Fatal("cannot open output file %s",pngname); +#ifdef HAVE_GDIMAGEGIF + if (option_flags & GIF_OUTPUT) + gdImageGif(page_imagep,outfp); + else +#endif + gdImagePngEx(page_imagep,outfp,compression); + fclose(outfp); + DEBUG_PRINT(DEBUG_DVI,("\n WROTE: \t%s\n",pngname)); + if (freeme) + free(freeme); + DestroyImage(); +} + +void DestroyImage(void) +{ + gdImageDestroy(page_imagep); + page_imagep=NULL; +} + +static int gammatable[]= + {0,1,2,3,4,5,6,7,8,9,10,11,12,13,14,15,16,17,18,19, + 20,21,22,23,24,25,26,27,28,29,30,31,32,33,34,35,36,37,38,39, + 40,41,42,43,44,45,46,47,48,49,50,51,52,53,54,55,56,57,58,59, + 60,61,62,63,64,65,66,67,68,69,70,71,72,73,74,75,76,77,78,79, + 80,81,82,83,84,85,86,87,88,89,90,91,92,93,94,95,96,97,98,99, + 100,101,102,103,104,105,106,107,108,109, + 110,111,112,113,114,115,116,117,118,119, + 120,121,122,123,124,125,126,127}; + +void Gamma(double gamma) +{ + int i=0; + + while (i<=gdAlphaMax) { + gammatable[i]=gdAlphaMax- + (int)(pow((gdAlphaMax-i)/((double)gdAlphaMax),gamma)*gdAlphaMax); + DEBUG_PRINT(DEBUG_GLYPH, + ("\n GAMMA GREYSCALE: %d -> %d ",i,gammatable[i])); + i++; + } +} + +dviunits SetGlyph(struct char_entry *ptr, int32_t hh,int32_t vv) +/* gdImageChar can only do monochrome glyphs */ +{ + int dst_alpha,dst_weight,tot_weight,alpha; + int x,y,pos=0; + int bgColor,pixelgrey,pixelcolor; + + hh -= ptr->xOffset/shrinkfactor; + vv -= ptr->yOffset/shrinkfactor; + /* Initialize persistent color cache. Perhaps this should be in + color.c? */ + pixelcolor=gdImageColorResolve(page_imagep, + cstack[csp].red, + cstack[csp].green, + cstack[csp].blue); + if (ColorCache[gdAlphaMax]!=pixelcolor) { + for( x=1; xh; y++) { + for( x=0; xw; x++) { + if (ptr->data[pos]>0) { + pixelgrey=gammatable[(int)ptr->data[pos]/2]; + bgColor = gdImageGetPixel(page_imagep, hh + x, vv + y); + if (ColorCache[0]!=bgColor || ColorCache[pixelgrey]==-1) { + DEBUG_PRINT(DEBUG_GLYPH,("\n GAMMA GREYSCALE: %d -> %d ", + ptr->data[pos]/2,pixelgrey)); + alpha = gdAlphaMax-pixelgrey; + dst_alpha = gdImageAlpha(page_imagep,bgColor); + dst_weight = (gdAlphaMax - dst_alpha) * alpha / gdAlphaMax; + tot_weight = pixelgrey + dst_weight; + pixelcolor = gdImageColorResolveAlpha(page_imagep, + (cstack[csp].red*pixelgrey + + gdImageRed(page_imagep,bgColor)*dst_weight)/tot_weight, + (cstack[csp].green*pixelgrey + + gdImageGreen(page_imagep,bgColor)*dst_weight)/tot_weight, + (cstack[csp].blue*pixelgrey + + gdImageBlue(page_imagep,bgColor)*dst_weight)/tot_weight, + alpha*dst_alpha/gdAlphaMax); + if (ColorCache[0]==bgColor) + ColorCache[pixelgrey]=pixelcolor; + } else + pixelcolor=ColorCache[pixelgrey]; + gdImageSetPixel(page_imagep, hh + x, vv + y, pixelcolor); + } + pos++; + } + } + return(ptr->tfmw); +} + +dviunits SetRule(dviunits a, dviunits b, subpixels hh,subpixels vv) +{ + /* This routine will draw a \rule */ + int Color; + pixels width=0, height=0; + + if ( a > 0 && b > 0 ) { + /* Calculate width and height, round up */ + width = (b+dvi->conv*shrinkfactor-1)/dvi->conv/shrinkfactor; + height = (a+dvi->conv*shrinkfactor-1)/dvi->conv/shrinkfactor; + } + if (page_imagep != NULL) { + if ((height>0) && (width>0)) { + /* This code produces too dark rules. But what the hell. Grey + * rules look fuzzy. */ + Color = gdImageColorResolve(page_imagep, + cstack[csp].red, + cstack[csp].green, + cstack[csp].blue); + /* +1 and -1 are because the Rectangle coords include last pixels */ + gdImageFilledRectangle(page_imagep,hh,vv-height+1,hh+width-1,vv,Color); + DEBUG_PRINT(DEBUG_DVI,("\n RULE \t%dx%d at (%d,%d)", + width, height, hh, vv)); + } + } else { + /* The +1's are because things are cut _at_that_coordinate_. */ + min(x_min,hh); + min(y_min,vv-height+1); + max(x_max,hh+width); + max(y_max,vv+1); + } + return(b); +} diff --git a/Build/source/texk/dvipng/dvipng-1.13/sfd.c b/Build/source/texk/dvipng/dvipng-1.13/sfd.c new file mode 100644 index 00000000000..99520b116ce --- /dev/null +++ b/Build/source/texk/dvipng/dvipng-1.13/sfd.c @@ -0,0 +1,176 @@ +/* sfd.c */ + +/************************************************************************ + + Part of the dvipng distribution + + This program is free software: you can redistribute it and/or modify + it under the terms of the GNU Lesser General Public License as + published by the Free Software Foundation, either version 3 of the + License, or (at your option) any later version. + + This program is distributed in the hope that it will be useful, but + WITHOUT ANY WARRANTY; without even the implied warranty of + MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU + Lesser General Public License for more details. + + You should have received a copy of the GNU Lesser General Public + License along with this program. If not, see + . + + Copyright (C) 2002-2008 Jan-Åke Larsson + +************************************************************************/ + +#include "dvipng.h" +struct subfont* subfontp=NULL; + +static struct subfont* ReadSubfont(char* sfdname, char *infix) +{ + char *pos,*max,*sfdfile=NULL; + struct subfont* sfdp=NULL; + struct filemmap fmmap; + boolean mmapfailed; + + /* OK, find subfont and look for correct infix */ +#ifdef HAVE_KPSE_ENC_FORMATS + sfdfile=kpse_find_file(sfdname,kpse_sfd_format,false); +#endif + if (sfdfile == NULL) { + Warning("subfont file %s could not be found",sfdname); + return(NULL); + } + DEBUG_PRINT((DEBUG_FT|DEBUG_ENC),("\n OPEN SUBFONT:\t'%s'", sfdfile)); + mmapfailed = MmapFile(sfdfile,&fmmap); + free(sfdfile); + if (mmapfailed) + return(NULL); + pos=fmmap.data; + max=fmmap.data+fmmap.size; + while(posname=(char*)sfdp+sizeof(struct subfont); + strcpy(sfdp->name,sfdname); + sfdp->infix=(char*)sfdp+sizeof(struct subfont)+strlen(sfdname)+1; + strcpy(sfdp->infix,infix); + sfdp->encoding=FT_ENCODING_UNICODE; + while (poscharindex[codepoint]=number; + DEBUG_PRINT(DEBUG_ENC,("\n SUBFONT MAP %d %d",codepoint,number)); + number++; + codepoint++; + } + default: + if (codepoint<256) + sfdp->charindex[codepoint]=number; + DEBUG_PRINT(DEBUG_ENC,("\n SUBFONT MAP %d %d",codepoint,number)); + } + while(postfmname,*sfdwant=fontname, + *sfdname,*infix,*postfix; + + while (*sfdspec!='\0' && *sfdspec==*sfdwant) { + sfdspec++; + sfdwant++; + } + /* Find delimiter */ + if (*sfdspec!='@') + return(NULL); + sfdspec++; + postfix=sfdspec; + while (*postfix!='\0' && *postfix!='@') + postfix++; + if (*postfix!='@') + return(NULL); + /* Extract subfont name */ + sfdname=malloc(postfix-sfdspec+1); + strncpy(sfdname,sfdspec,postfix-sfdspec); + sfdname[postfix-sfdspec]='\0'; + /* Check postfix */ + postfix++; + if (strcmp(sfdwant+strlen(sfdwant)-strlen(postfix),postfix)!=0) + return(NULL); + /* Extract infix */ + infix=malloc(strlen(sfdwant)-strlen(postfix)+1); + strncpy(infix,sfdwant,strlen(sfdwant)-strlen(postfix)); + infix[strlen(sfdwant)-strlen(postfix)]='\0'; + DEBUG_PRINT(DEBUG_ENC,("\n SUBFONT %s %s %s",fontname,sfdname,infix)); + /* Find subfont */ + while(temp!=NULL + && (strcmp(sfdname,temp->name)!=0 || strcmp(infix,temp->infix)!=0)) + temp=temp->next; + if (temp==NULL) { + temp=ReadSubfont(sfdname,infix); + if (temp!=NULL) { + temp->next=subfontp; + subfontp=temp; + } + } + entry=NewPSFont(entry); + if (entry!=NULL) { + entry->tfmname=copyword(fontname); + entry->subfont=temp; + } + free(infix); + free(sfdname); + return(entry); +} + +void ClearSubfont(void) +{ + struct subfont *temp=subfontp; + + while(temp!=NULL) { + subfontp=subfontp->next; + free(temp); + temp=subfontp; + } +} + diff --git a/Build/source/texk/dvipng/dvipng-1.13/special.c b/Build/source/texk/dvipng/dvipng-1.13/special.c new file mode 100644 index 00000000000..8f74e7f9aac --- /dev/null +++ b/Build/source/texk/dvipng/dvipng-1.13/special.c @@ -0,0 +1,862 @@ +/* special.c */ + +/************************************************************************ + + Part of the dvipng distribution + + This program is free software: you can redistribute it and/or modify + it under the terms of the GNU Lesser General Public License as + published by the Free Software Foundation, either version 3 of the + License, or (at your option) any later version. + + This program is distributed in the hope that it will be useful, but + WITHOUT ANY WARRANTY; without even the implied warranty of + MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU + Lesser General Public License for more details. + + You should have received a copy of the GNU Lesser General Public + License along with this program. If not, see + . + + Copyright (C) 2002-2010 Jan-Åke Larsson + +************************************************************************/ + +#include "dvipng.h" + +#ifndef MIKTEX +#ifdef WIN32 +#include +#include +#include +#define snprintf _snprintf +#endif /* WIN32 */ +#endif + +#define SKIPSPACES(s) while(s && *s==' ' && *s!='\0') s++ + +/* PostScript can come as a string (headers and raw specials) or + a memory-mapped file (headers and included EPS figures). */ + +struct pscode { + struct pscode* next; + char* special; /* complete special */ + char* code; /* PS string, null if a file */ + char* filename; /* file name, null if a string */ + char* postcode; /* post PS string */ + struct filemmap fmmap; /* file mmap */ +}; + +struct pscode* psheaderp=NULL; /* static, DVI-specific header list */ + +static void PSCodeInit(struct pscode *entry, char *special) +{ + entry->next=NULL; + entry->special=special; + entry->code=NULL; + entry->filename=NULL; + entry->postcode=NULL; + entry->fmmap.data=NULL; + if (special==NULL) + return; + if (strncmp(special,"header=",7)==0) + entry->filename=special+7; + else if (strncmp(special,"ps:: plotfile ",14)==0) + entry->filename=special+14; + else if (special[0]=='"' || special[0]=='!') + entry->code=special+1; + else if (strncmp(special,"ps::[begin]",11)==0) + entry->code=special+11; + else if (strncmp(special,"ps::[end]",9)==0) + entry->code=special+9; + else if (strncmp(special,"ps::",4)==0) + entry->code=special+4; + else if (strncmp(special,"ps:",3)==0) + entry->code=special+3; + else + entry->code=special; +#ifdef DEBUG + if (entry->code!=NULL) + DEBUG_PRINT(DEBUG_GS,(" '%s'",entry->code)); + if (entry->filename!=NULL) + DEBUG_PRINT(DEBUG_GS,(" {%s}",entry->filename)); + if (entry->postcode!=NULL) + DEBUG_PRINT(DEBUG_GS,(" '%s'",entry->postcode)); +#endif +} + + + +void ClearPSHeaders(void) +{ + struct pscode *temp=psheaderp; + + while(temp!=NULL) { + psheaderp=psheaderp->next; + if (temp->fmmap.data!=NULL) + UnMmapFile(&(temp->fmmap)); + free(temp); + temp=psheaderp; + } +} + +static void writepscode(struct pscode* pscodep, FILE* psstream) +{ + while (pscodep!=NULL) { + if (pscodep->code!=NULL) { + fputs(pscodep->code,psstream); + putc('\n',psstream); + DEBUG_PRINT(DEBUG_GS,("\n PS CODE:\t%s",pscodep->code)); + } + if (pscodep->filename!=NULL && pscodep->fmmap.data==NULL) { + char* filepath= + kpse_find_file(pscodep->filename,kpse_tex_ps_header_format,false); + if (filepath==NULL) { + Warning("Cannot find PostScript file %s, ignored", pscodep->filename); + page_flags |= PAGE_GAVE_WARN; + } else if (MmapFile(filepath,&(pscodep->fmmap))) { + Warning("PostScript file %s unusable, ignored", pscodep->filename); + page_flags |= PAGE_GAVE_WARN; + } + } + if (pscodep->fmmap.data!=NULL) { + unsigned char* position; + + DEBUG_PRINT(DEBUG_GS,("\n PS FILE:\t%s",pscodep->filename)); + position=(unsigned char*)pscodep->fmmap.data; + while(position + < (unsigned char*)pscodep->fmmap.data + pscodep->fmmap.size) { + putc(*position,psstream); + position++; + } + } + if (pscodep->postcode!=NULL) { + fputs(pscodep->postcode,psstream); + putc('\n',psstream); + DEBUG_PRINT(DEBUG_GS,("\n PS POST CODE:\t%s",pscodep->postcode)); + } + pscodep=pscodep->next; + } +} + + +static gdImagePtr +ps2png(struct pscode* pscodep, const char *device, int hresolution, int vresolution, + int llx, int lly, int urx, int ury, int bgred, int bggreen, int bgblue) +{ +#ifndef MIKTEX + int downpipe[2], uppipe[2]; +#ifdef WIN32 + unsigned long nexitcode = STILL_ACTIVE; + HANDLE hchild; + int savestdin, savestdout; +#else /* !WIN32 */ + pid_t pid; +#endif /* !WIN32 */ +#else /* MIKTEX */ + HANDLE hPngStream; + HANDLE hPsStream; + HANDLE hStdErr; + PROCESS_INFORMATION pi; + _TCHAR szCommandLine[2048]; + _TCHAR szGsPath[_MAX_PATH]; +#define GS_PATH szGsPath + int fd; +#endif /* MIKTEX */ + FILE *psstream=NULL, *pngstream=NULL; + char resolution[STRSIZE]; + /* char devicesize[STRSIZE]; */ + gdImagePtr psimage=NULL; + static bool showpage=false; + + sprintf(resolution, "-r%dx%d",hresolution,vresolution); + /* Future extension for \rotatebox + status=sprintf(devicesize, "-g%dx%d", + //(int)((sin(atan(1.0))+1)* + (urx - llx)*hresolution/72,//), + //(int)((sin(atan(1.0))+1)* + (ury - lly)*vresolution/72);//); + */ + DEBUG_PRINT(DEBUG_GS, + ("\n GS CALL:\t%s %s %s %s %s %s %s %s %s %s %s",/* %s", */ + GS_PATH, device, resolution, /*devicesize,*/ + "-dBATCH", "-dNOPAUSE", "-q", "-sOutputFile=-", + "-dTextAlphaBits=4", "-dGraphicsAlphaBits=4", + (option_flags & NO_GSSAFER) ? "-": "-dSAFER", + (option_flags & NO_GSSAFER) ? "": "- ")); +#ifndef MIKTEX +#ifndef WIN32 + if (pipe(downpipe) || pipe(uppipe)) return(NULL); + /* Ready to fork */ + pid = fork (); + if (pid == 0) { /* Child process. Execute gs. */ + close(downpipe[1]); + dup2(downpipe[0], STDIN_FILENO); + close(downpipe[0]); + close(uppipe[0]); + dup2(uppipe[1], STDOUT_FILENO); + close(uppipe[1]); + execlp(GS_PATH, GS_PATH, device, resolution, /*devicesize,*/ + "-dBATCH", "-dNOPAUSE", "-q", "-sOutputFile=-", + "-dTextAlphaBits=4", "-dGraphicsAlphaBits=4", + (option_flags & NO_GSSAFER) ? "-": "-dSAFER", + (option_flags & NO_GSSAFER) ? NULL: "-", + NULL); + _exit (EXIT_FAILURE); +#else /* WIN32 */ + if (_pipe(downpipe, 65536, O_BINARY | _O_NOINHERIT)==-1 || + _pipe(uppipe, 65536, O_BINARY | _O_NOINHERIT)==-1) { + fprintf(stderr, "Pipe error.\n"); + return NULL; +#endif /* WIN32 */ + } + /* Parent process. */ +#ifdef WIN32 + savestdin = _dup(fileno(stdin)); + _dup2(downpipe[0], fileno(stdin)); +#endif /* WIN32 */ + close(downpipe[0]); +#ifdef WIN32 + savestdout = _dup(fileno(stdout)); + _dup2(uppipe[1], fileno(stdout)); + close(uppipe[1]); +#endif /* WIN32 */ + psstream=fdopen(downpipe[1],"wb"); + /* fclose(psstream); psstream=fopen("test.ps","wb"); */ +#ifndef WIN32 + if (psstream == NULL) + close(downpipe[1]); + close(uppipe[1]); + pngstream=fdopen(uppipe[0],"rb"); + if (pngstream == NULL) + close(uppipe[0]); +#else /* WIN32 */ + if (psstream == NULL) { + fprintf(stderr, "psstream == NULL\n"); + close(downpipe[1]); + } + pngstream=fdopen(uppipe[0],"rb"); + if (pngstream == NULL) { + fprintf(stderr, "pngstream == NULL\n"); + close(uppipe[0]); + } + hchild=(HANDLE)spawnlp(_P_NOWAIT, GS_PATH, GS_PATH, device, resolution, + "-dBATCH", "-dNOPAUSE", "-q", "-sOutputFile=-", + "-dTextAlphaBits=4", "-dGraphicsAlphaBits=4", + (option_flags & NO_GSSAFER) ? "-": "-dSAFER", + (option_flags & NO_GSSAFER) ? NULL : "-", NULL); + + if(hchild) { +#endif /* WIN32 */ +#else /* MIKTEX */ + if (! miktex_find_miktex_executable("mgs.exe", szGsPath)) { + Warning("Ghostscript could not be found"); + return(NULL); + } + sprintf(szCommandLine,"\"%s\" %s %s %s %s %s %s %s %s %s %s",/* %s",*/ + szGsPath, device, resolution, /*devicesize,*/ + "-dBATCH", "-dNOPAUSE", "-q", "-sOutputFile=-", + "-dTextAlphaBits=4", "-dGraphicsAlphaBits=4", + (option_flags & NO_GSSAFER) ? "-": "-dSAFER", + (option_flags & NO_GSSAFER) ? "": "-"); + if (! miktex_start_process_3(szCommandLine, &pi, INVALID_HANDLE_VALUE, + &hPsStream, &hPngStream, &hStdErr, 0)) { + Warning("Ghostscript could not be started"); + return(NULL); + } + CloseHandle (pi.hThread); + fd = _open_osfhandle((intptr_t)hPsStream, _O_WRONLY); + if (fd >= 0) { + psstream = _tfdopen(fd, "wb"); + if (psstream == NULL) + _close (fd); + } + fd = _open_osfhandle((intptr_t)hPngStream, _O_RDONLY); + if (fd >= 0) { + pngstream = _tfdopen(fd, "rb"); + if (pngstream == NULL) + _close (fd); + } +#endif /* MIKTEX */ + if (psstream) { + writepscode(psheaderp,psstream); + DEBUG_PRINT(DEBUG_GS,("\n PS CODE:\t<>setpagedevice", + urx - llx, ury - lly,llx,lly)); + fprintf(psstream, "<>setpagedevice\n", + urx - llx, ury - lly,llx,lly); + if ( bgred < 255 || bggreen < 255 || bgblue < 255 ) { + DEBUG_PRINT(DEBUG_GS,("\n PS CODE:\tgsave %f %f %f setrgbcolor clippath fill grestore", + bgred/255.0, bggreen/255.0, bgblue/255.0)); + fprintf(psstream, "gsave %f %f %f setrgbcolor clippath fill grestore", + bgred/255.0, bggreen/255.0, bgblue/255.0); + } + writepscode(pscodep,psstream); + if (showpage) { + DEBUG_PRINT(DEBUG_GS,("\n PS CODE:\tshowpage")); + fprintf(psstream, " showpage "); + } + fclose(psstream); + } + if (pngstream) { + psimage = gdImageCreateFromPng(pngstream); + fclose(pngstream); + } +#ifdef MIKTEX + CloseHandle(pi.hProcess); +#else /* !MIKTEX */ +#ifdef WIN32 + } + while(nexitcode == STILL_ACTIVE) + GetExitCodeProcess((HANDLE)hchild, &nexitcode); + + CloseHandle((HANDLE)hchild); + _dup2(savestdin, fileno(stdin)); + _dup2(savestdout, fileno(stdout)); + close(savestdin); + close(savestdout); + close(uppipe[0]); + close(uppipe[1]); + close(downpipe[0]); + close(downpipe[1]); +#endif /* WIN32 */ +#endif /* !MIKTEX */ + + if (psimage == NULL) { + DEBUG_PRINT(DEBUG_GS,("\n GS OUTPUT:\tNO IMAGE ")); + if (!showpage) { + showpage=true; + DEBUG_PRINT(DEBUG_GS,("(will try adding \"showpage\") ")); + psimage=ps2png(pscodep, + device, hresolution, vresolution, llx, lly, urx, ury, + bgred,bggreen,bgblue); + showpage=false; + } +#ifdef DEBUG + } else { + DEBUG_PRINT(DEBUG_GS,("\n GS OUTPUT:\t%dx%d image ", + gdImageSX(psimage),gdImageSY(psimage))); +#endif + } + return psimage; +} + +static gdImagePtr +rescale(gdImagePtr psimage, int pngwidth, int pngheight) +{ + gdImagePtr scaledimage=psimage; + /* Rescale unless correct size */ + if (psimage!=NULL + && gdImageSX(psimage)!=pngwidth + && gdImageSY(psimage)!=pngheight) { + DEBUG_PRINT(DEBUG_DVI, + ("\n RESCALE INCLUDED BITMAP \t(%d,%d) -> (%d,%d)", + gdImageSX(psimage),gdImageSY(psimage), + pngwidth,pngheight)); +#ifdef HAVE_GDIMAGECREATETRUECOLOR + scaledimage=gdImageCreateTrueColor(pngwidth,pngheight); + /* Copy with overwrite, remember that this is the rescaled source + image. The real target has alpha blending on. */ + gdImageAlphaBlending(scaledimage,0); + gdImageCopyResampled(scaledimage,psimage,0,0,0,0, + pngwidth,pngheight, + gdImageSX(psimage),gdImageSY(psimage)); +#else + scaledimage=gdImageCreate(pngwidth,pngheight); + gdImageCopyResized(scaledimage,psimage,0,0,0,0, + pngwidth,pngheight, + gdImageSX(psimage),gdImageSY(psimage)); +#endif + gdImageDestroy(psimage); + } + return(scaledimage); +} + +static void newpsheader(const char* special) { + struct pscode* tmp; + char* txt; + + if (psheaderp==NULL && strcmp(special,"header=tex.pro")!=0) { + newpsheader("header=tex.pro"); + newpsheader("header=color.pro"); + newpsheader("header=special.pro"); + } + if (strcmp(special+strlen(special)-4,".xcp")==0 + && strncmp(special,"header=",7)==0) + InitXColorPrologue(special+7); + if (strncmp(special,"! /pgfH",7)==0) + newpsheader("! TeXDict begin"); + if (psheaderp==NULL) { + if ((tmp=psheaderp=malloc(sizeof(struct pscode)))==NULL) + Fatal("cannot malloc space for PostScript header struct"); + } else { + /* No duplicates. This still misses pre=..., because we still + change that. To be fixed */ + tmp=psheaderp; + if (strcmp(tmp->special,special)==0) + return; + while(tmp->next!=NULL) { + tmp=tmp->next; + if (strcmp(tmp->special,special)==0) + return; + } + if ((tmp->next=malloc(sizeof(struct pscode)))==NULL) + Fatal("cannot malloc space for PostScript header struct"); + tmp=tmp->next; + } + DEBUG_PRINT(DEBUG_GS,("\n PS HEADER ")); + if ((txt=malloc(strlen(special)+1))==NULL) + Fatal("cannot malloc space for PostScript header"); + strcpy(txt,special); + PSCodeInit(tmp,txt); +} + +/*********************************************************************/ +/**************************** SetSpecial ***************************/ +/*********************************************************************/ + +void SetSpecial(char * special, int32_t hh, int32_t vv) +/* interpret a \special command, made up of keyword=value pairs, + * or !header or ps:literal_PostScript + */ +{ + DEBUG_PRINT(DEBUG_DVI,(" '%s'",special)); + SKIPSPACES(special); + /********************** Color specials ***********************/ + if (strncmp(special,"background ",11)==0) { + background(special+11); + return; + } + if (strncmp(special,"color ",6)==0) { + special+=6; + SKIPSPACES(special); + if (strncmp(special,"push ",5)==0) { + pushcolor(special+5); + } else { + if (strcmp(special,"pop")==0) + popcolor(); + else + resetcolorstack(special); + } + return; + } + + /******************* Image inclusion ********************/ + + /* Needed tests for regression: PNG, GIF, JPEG and EPS inclusion, + * for different gd versions */ + + if (strncmp(special,"PSfile=",7)==0) { /* PSfile */ + char* psname = special+7; + int llx=0,lly=0,urx=0,ury=0,rwi=0,rhi=0; + bool clip=false; + int hresolution,vresolution; + int pngheight,pngwidth; + + /* Remove quotation marks around filename. If no quotation marks, + use first word as filename */ + if (*psname=='"') { + psname++; + special=strrchr(psname,'"'); + } else { + special=strchr(psname,' '); + } + if (special!=NULL) { + *special='\0'; + special++; + } + + /* Retrieve parameters */ + SKIPSPACES(special); + while(special && *special) { + if (strncmp(special,"llx=",4)==0) + llx = strtol(special+4,&special,10); + else if (strncmp(special,"lly=",4)==0) + lly = strtol(special+4,&special,10); + else if (strncmp(special,"urx=",4)==0) + urx = strtol(special+4,&special,10); + else if (strncmp(special,"ury=",4)==0) + ury = strtol(special+4,&special,10); + else if (strncmp(special,"rwi=",4)==0) + rwi = strtol(special+4,&special,10); + else if (strncmp(special,"rhi=",4)==0) + rhi = strtol(special+4,&special,10); + else if (strncmp(special,"clip",4)==0) + {clip = true; special=special+4;} + while (*special && *special!=' ') special++; + SKIPSPACES(special); + } + + /* Calculate resolution, and use our base resolution as a fallback. */ + /* The factor 10 is magic, the dvips graphicx driver needs this. */ + hresolution = ((dpi*rwi+urx-llx-1)/(urx - llx)+9)/10; + vresolution = ((dpi*rhi+ury-lly-1)/(ury - lly)+9)/10; + if (vresolution==0) vresolution = hresolution; + if (hresolution==0) hresolution = vresolution; + if (hresolution==0) hresolution = vresolution = dpi; + + /* Convert from postscript 72 dpi resolution to our given resolution */ + pngwidth = (dpi*rwi+719)/720; /* +719: round up */ + pngheight = (dpi*rhi+719)/720; + if (pngwidth==0) + pngwidth = ((dpi*rhi*(urx-llx)+ury-lly-1)/(ury-lly)+719)/720; + if (pngheight==0) + pngheight = ((dpi*rwi*(ury-lly)+urx-llx-1)/(urx-llx)+719)/720; + if (pngheight==0) { + pngwidth = (dpi*(urx-llx)+71)/72; + pngheight = (dpi*(ury-lly)+71)/72; + } + if (page_imagep != NULL) { /* Draw into image */ + struct pscode image; + gdImagePtr psimage=NULL; +#ifndef HAVE_GDIMAGECREATEFROMPNGPTR + FILE* psstream; +#endif + + PSCodeInit(&image, NULL); + image.filename=kpse_find_file(psname,kpse_pict_format,0); + if (MmapFile(image.filename,&(image.fmmap)) || image.fmmap.size==0) { + Warning("Image file %s unusable, image will be left blank", + image.filename); + page_flags |= PAGE_GAVE_WARN; + return; + } + Message(BE_NONQUIET," <%s",psname); + switch ((unsigned char)*image.fmmap.data) { + case 0x89: /* PNG magic: "\211PNG\r\n\032\n" */ + DEBUG_PRINT(DEBUG_DVI,("\n INCLUDE PNG \t%s",image.filename)); +#ifdef HAVE_GDIMAGECREATEFROMPNGPTR + psimage=gdImageCreateFromPngPtr(image.fmmap.size,image.fmmap.data); +#else + psstream=fopen(image.filename,"rb"); + psimage=gdImageCreateFromPng(psstream); + fclose(psstream); +#endif + psimage=rescale(psimage,pngwidth,pngheight); + break; + case 'G': /* GIF magic: "GIF87" or "GIF89" */ + DEBUG_PRINT(DEBUG_DVI,("\n INCLUDE GIF \t%s",image.filename)); +#ifdef HAVE_GDIMAGEGIF + psimage=rescale(gdImageCreateFromGifPtr(image.fmmap.size, + image.fmmap.data), + pngwidth,pngheight); +#else + DEBUG_PRINT(DEBUG_DVI,(" (NO GIF DECODER)")); +#endif + break; + case 0xff: /* JPEG magic: 0xffd8 */ + DEBUG_PRINT(DEBUG_DVI,("\n INCLUDE JPEG \t%s",image.filename)); +#ifdef HAVE_GDIMAGECREATEFROMJPEG +#ifdef HAVE_GDIMAGECREATEFROMPNGPTR + psimage=gdImageCreateFromJpegPtr(image.fmmap.size,image.fmmap.data); +#else + psstream=fopen(image.filename,"rb"); + psimage=gdImageCreateFromJpeg(psstream); + fclose(psstream); +#endif + psimage=rescale(psimage,pngwidth,pngheight); +#else + DEBUG_PRINT(DEBUG_DVI,(" (NO JPEG DECODER)")); +#endif + break; + default: /* Default, PostScript magic: "%!PS-Adobe" */ + if (option_flags & NO_GHOSTSCRIPT) { + Warning("GhostScript calls disallowed by --noghostscript" ); + page_flags |= PAGE_GAVE_WARN; + } else { + /* Use alpha blending, and render transparent postscript + images. The alpha blending works correctly only from + libgd 2.0.12 upwards */ +#ifdef HAVE_GDIMAGEPNGEX + if (page_imagep->trueColor) { + int tllx=llx,tlly=lly,turx=urx,tury=ury; + + DEBUG_PRINT((DEBUG_DVI | DEBUG_GS), + ("\n GS RENDER \t%s -> pngalpha ",image.filename)); + if (!clip) { + /* Render across the whole image */ + tllx=llx-(hh+1)*72/hresolution; + tlly=lly-(gdImageSY(page_imagep)-vv-1)*72/vresolution; + turx=llx+(gdImageSX(page_imagep)-hh)*72/hresolution; + tury=lly+(vv+1)*72/vresolution; + DEBUG_PRINT((DEBUG_DVI | DEBUG_GS), + ("\n EXPAND BBOX \t%d %d %d %d -> %d %d %d %d", + llx,lly,urx,ury,tllx,tlly,turx,tury)); +#ifdef DEBUG + } else { + DEBUG_PRINT((DEBUG_DVI | DEBUG_GS),(", CLIPPED TO BBOX")); +#endif + } + psimage = ps2png(&image, "-sDEVICE=pngalpha", + hresolution, vresolution, + tllx, tlly, turx, tury, + 255,255,255); + if (psimage==NULL) + Warning("No GhostScript pngalpha output, opaque image inclusion"); + } else + Warning("Palette output, opaque image inclusion"); +#endif + if (psimage==NULL) { + /* png256 gives inferior result */ + DEBUG_PRINT((DEBUG_DVI | DEBUG_GS), + ("\n GS RENDER \t%s -> png16m", image.filename)); + psimage = ps2png(&image, "-sDEVICE=png16m", + hresolution, vresolution, + llx, lly, urx, ury, + cstack[0].red,cstack[0].green,cstack[0].blue); + clip=true; + page_flags |= PAGE_GAVE_WARN; + } + if (!clip) { + /* Rendering across the whole image */ + hh=0; + vv=gdImageSY(psimage)-1; + } + } + } + UnMmapFile(&(image.fmmap)); + if (psimage!=NULL) { + DEBUG_PRINT(DEBUG_DVI, + ("\n GRAPHIC(X|S) INCLUDE \t%s (%d,%d) res %dx%d at (%d,%d)", + psname,gdImageSX(psimage),gdImageSY(psimage), + hresolution,vresolution,hh,vv)); +#ifdef HAVE_GDIMAGECREATETRUECOLOR + if (psimage->trueColor && !page_imagep->trueColor) + gdImageTrueColorToPalette(psimage,0,256); +#endif +#ifdef HAVE_GDIMAGEPNGEX + gdImageAlphaBlending(page_imagep,1); +#else + Warning("Using libgd < 2.0.12, opaque image inclusion"); + page_flags |= PAGE_GAVE_WARN; +#endif + gdImageCopy(page_imagep, psimage, + hh, vv-gdImageSY(psimage)+1, + 0,0, + gdImageSX(psimage),gdImageSY(psimage)); +#ifdef HAVE_GDIMAGEPNGEX + gdImageAlphaBlending(page_imagep,0); +#endif + gdImageDestroy(psimage); + } else { + Warning("Unable to load %s, image will be left blank",image.filename); + page_flags |= PAGE_GAVE_WARN; + } + free(image.filename); + Message(BE_NONQUIET,">"); + } else { /* Don't draw */ + page_flags |= PAGE_TRUECOLOR; + DEBUG_PRINT(DEBUG_DVI, + ("\n GRAPHIC(X|S) INCLUDE \t%s (%d,%d) res %dx%d at (%d,%d)", + psname,pngheight,pngwidth, + hresolution,vresolution,hh,vv)); + min(x_min,hh); + min(y_min,vv-pngheight+1); + max(x_max,hh+pngwidth); + max(y_max,vv+1); + } + return; + } + + /******************* Raw PostScript ********************/ + + if (strncmp(special,"!/preview@version(",18)==0) { + int length=0; + special+=18; + while (special[length]!='\0' && special[length]!=')') + length++; + if (page_imagep==NULL) + Message(BE_NONQUIET," (preview-latex version %.*s)",length,special); + return; + } + + /* preview-latex' tightpage option */ + if (strncmp(special,"!/preview@tightpage",19)==0) { + special+=19; + SKIPSPACES(special); + if (strncmp(special,"true",4)==0) { + if (page_imagep==NULL) + Message(BE_NONQUIET," (preview-latex tightpage option detected, will use its bounding box)"); + dvi->flags |= DVI_PREVIEW_LATEX_TIGHTPAGE; + } + return; + } + if (strncmp(special,"!userdict",9)==0 + && strstr(special+10,"7{currentfile token not{stop}if 65781.76 div")!=NULL) { + if (page_imagep==NULL && ~dvi->flags & DVI_PREVIEW_LATEX_TIGHTPAGE) + Message(BE_NONQUIET," (preview-latex <= 0.9.1 tightpage option detected, will use its bounding box)"); + dvi->flags |= DVI_PREVIEW_LATEX_TIGHTPAGE; + return; + } + + /* preview-latex' dvips bop-hook redefinition */ + if (strncmp(special,"!userdict",9)==0 + && strstr(special+10,"preview-bop-")!=NULL) { + dvi->flags |= DVI_PREVIEW_BOP_HOOK; + if (page_imagep==NULL) + Message(BE_VERBOSE," (preview-latex beginning-of-page-hook detected)"); + return; + } + + if (dvi->flags & DVI_PREVIEW_BOP_HOOK && ~page_flags & PAGE_PREVIEW_BOP + && strncmp(special,"ps::",4)==0) { + /* Hokay, decode bounding box */ + dviunits adj_llx,adj_lly,adj_urx,adj_ury,ht,dp,wd; + adj_llx = strtol(special+4,&special,10); + adj_lly = strtol(special,&special,10); + adj_urx = strtol(special,&special,10); + adj_ury = strtol(special,&special,10); + ht = strtol(special,&special,10); + dp = strtol(special,&special,10); + wd = strtol(special,&special,10); + page_flags |= PAGE_PREVIEW_BOP; + if (wd>0) { + x_offset_tightpage = + (-adj_llx+dvi->conv*shrinkfactor-1)/dvi->conv/shrinkfactor; + x_width_tightpage = x_offset_tightpage + +(wd+adj_urx+dvi->conv*shrinkfactor-1)/dvi->conv/shrinkfactor; + } else { + x_offset_tightpage = + (-wd+adj_urx+dvi->conv*shrinkfactor-1)/dvi->conv/shrinkfactor; + x_width_tightpage = x_offset_tightpage + +(-adj_llx+dvi->conv*shrinkfactor-1)/dvi->conv/shrinkfactor; + } + /* y-offset = height - 1 */ + y_offset_tightpage = + (((ht>0)?ht:0)+adj_ury+dvi->conv*shrinkfactor-1)/dvi->conv/shrinkfactor-1; + y_width_tightpage = y_offset_tightpage+1 + +(((dp>0)?dp:0)-adj_lly+dvi->conv*shrinkfactor-1)/dvi->conv/shrinkfactor; + return; + } + + if (special[0]=='"' || strncmp(special,"ps:",3)==0) { /* Literal PostScript */ + if (page_imagep != NULL) { /* Draw into image */ + static struct pscode *pscodep=NULL; + static bool psenvironment=false; + bool nextisps; + struct pscode *tmp; + gdImagePtr psimage=NULL; + char *txt; + const char *newspecial=NULL; /* Avoid warning from special="..." */ + + /* Some packages split their literal PostScript code into + several specials. Check for those, and concatenate them so + that they're given to one and the same invocation of gs */ + if (pscodep==NULL) { + Message(BE_NONQUIET," next != NULL) + tmp=tmp->next; + if ((tmp->next=malloc(sizeof(struct pscode)))==NULL) + Fatal("cannot malloc space for raw PostScript struct"); + tmp=tmp->next; + } + if (strncmp(special,"ps::[begin]",11)==0) + psenvironment=true; + else if (strncmp(special,"ps::[end]",9)==0) + psenvironment=false; + else if (strcmp(special,"ps:: pgfo")==0) + /* PostScript code to start page for pgf PostScript + specials. The first numbers are generally valid for the bop + instruction, and the latter code is to move the origin to + the right place. */ + newspecial="ps:: 39139632 55387786 1000 600 600 (tikzdefault.dvi) @start 1 0 bop pgfo 0 0 matrix defaultmatrix transform itransform translate"; + else if (strcmp(special,"ps:: pgfc")==0) + newspecial="ps:: pgfc eop end"; + nextisps=DVIIsNextPSSpecial(dvi); + if (psenvironment || nextisps) { + if (!nextisps) { + Warning("PostScript environment contains DVI commands"); + page_flags |= PAGE_GAVE_WARN; + } + DEBUG_PRINT(DEBUG_GS,("\n PS SPECIAL ")); + if (newspecial == NULL) + newspecial=special; + if ((txt=malloc(strlen(newspecial)+1))==NULL) + Fatal("cannot allocate space for raw PostScript special"); + strcpy(txt,newspecial); + PSCodeInit(tmp,txt); + return; + } + DEBUG_PRINT(DEBUG_DVI,("\n LAST PS SPECIAL ")); + if (newspecial != NULL) { + if ((special=malloc(strlen(newspecial)+1))==NULL) + Fatal("cannot allocate space for raw PostScript special"); + strcpy(special,newspecial); + } + PSCodeInit(tmp,special); + /* Now, render image */ + if (option_flags & NO_GHOSTSCRIPT) + Warning("GhostScript calls disallowed by --noghostscript" ); + else { + /* Use alpha blending, and render transparent postscript + images. The alpha blending works correctly only from + libgd 2.0.12 upwards */ +#ifdef HAVE_GDIMAGEPNGEX + if (page_imagep->trueColor) { + /* Render across the whole image */ + psimage = ps2png(pscodep, "-sDEVICE=pngalpha", + dpi,dpi, + -(hh+1)*72/dpi, + -(gdImageSY(page_imagep)-vv-1)*72/dpi, + (gdImageSX(page_imagep)-hh)*72/dpi, + (vv+1)*72/dpi, + 255,255,255); + if (psimage!=NULL) { + gdImageAlphaBlending(page_imagep,1); + gdImageCopy(page_imagep, psimage, + 0,0,0,0, + gdImageSX(psimage),gdImageSY(psimage)); + gdImageAlphaBlending(page_imagep,0); + gdImageDestroy(psimage); + } else + Warning("No GhostScript pngalpha output, cannot render raw PostScript"); + } else + Warning("Palette output, cannot include raw PostScript"); +#else + Warning("Using libgd < 2.0.12, unable to include raw PostScript"); +#endif + } + while(pscodep->next != NULL) { + tmp=pscodep->next; + free(pscodep->special); + free(pscodep); + pscodep=tmp; + } + free(pscodep); + pscodep=NULL; + if (newspecial != NULL) + free(special); + if (psimage==NULL) + page_flags |= PAGE_GAVE_WARN; + Message(BE_NONQUIET,">"); + } else { /* Don't draw */ + page_flags |= PAGE_TRUECOLOR; + } + return; + } + + if (strncmp(special,"papersize=",10)==0) { /* papersize spec, ignored */ + return; + } + + if (special[0]=='!' || strncmp(special,"header=",7)==0) { /* PS header */ + newpsheader(special); + return; + } + + if (strncmp(special,"src:",4)==0) { /* source special */ + if ( page_imagep != NULL ) + Message(BE_NONQUIET," at (%ld,%ld) source \\special{%s}", + hh, vv, special); + return; + } + if ( page_imagep != NULL ) { + Warning("at (%ld,%ld) unimplemented \\special{%s}", + hh, vv, special); + page_flags |= PAGE_GAVE_WARN; + } +} + diff --git a/Build/source/texk/dvipng/dvipng-1.13/t1.c b/Build/source/texk/dvipng/dvipng-1.13/t1.c new file mode 100644 index 00000000000..4a74a8274f4 --- /dev/null +++ b/Build/source/texk/dvipng/dvipng-1.13/t1.c @@ -0,0 +1,192 @@ +/* t1.c */ + +/************************************************************************ + + Part of the dvipng distribution + + This program is free software: you can redistribute it and/or modify + it under the terms of the GNU Lesser General Public License as + published by the Free Software Foundation, either version 3 of the + License, or (at your option) any later version. + + This program is distributed in the hope that it will be useful, but + WITHOUT ANY WARRANTY; without even the implied warranty of + MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU + Lesser General Public License for more details. + + You should have received a copy of the GNU Lesser General Public + License along with this program. If not, see + . + + Copyright (C) 2002-2009 Jan-Åke Larsson + +************************************************************************/ + +#include "dvipng.h" + +void LoadT1(int32_t c, struct char_entry * ptr) +{ + GLYPH *glyph; + int original_width,original_height; + int i,j,k,width,height; + unsigned short shrunk_width,shrunk_height; + short xoffset,yoffset; + unsigned short i_offset,j_offset; + + DEBUG_PRINT(DEBUG_T1,("\n LOAD T1 CHAR\t%d",c)); + if ((glyph= + T1_SetChar(currentfont->T1id, c, + (float)currentfont->dpi*currentfont->d/65536/72.27, + currentfont->psfontmap==NULL ? NULL : currentfont->psfontmap->t1_transformp)) + ==NULL) + Fatal("cannot load T1 char %d",c); + + DEBUG_PRINT(DEBUG_T1,(" (%d)",ptr->tfmw)); + + original_width = glyph->metrics.rightSideBearing + - glyph->metrics.leftSideBearing; + original_height = glyph->metrics.ascent - glyph->metrics.descent; + DEBUG_PRINT(DEBUG_T1,(" %dx%d",original_width,original_height)); + + if (original_width > 0x7fff || original_height > 0x7fff) + Fatal("character %d too large in file %s", c, currentfont->name); + + /* + * Hotspot issues: Shrinking to the topleft corner rather than the + hotspot will displace glyphs a fraction of a pixel. We deal with + this in as follows: The glyph is shrunk to its hotspot by + offsetting the bitmap somewhat to put the hotspot in the lower + left corner of a "shrink square". Shrinking to the topleft corner + will then act as shrinking to the hotspot. This may enlarge the + bitmap somewhat, of course. (Also remember that the below + calculation of i/j_offset is in integer arithmetics.) + + There will still be a displacement from rounding the dvi + position, but vertically it will be equal for all glyphs on a + line, so we displace a whole line vertically by fractions of a + pixel. This is acceptible, IMHO. Sometime there will be support + for subpixel positioning, horizontally. Will do for now, I + suppose. + */ + xoffset = -glyph->metrics.leftSideBearing; + /* printf("xoffset: %d\n",xoffset); */ + i_offset = ( shrinkfactor - xoffset % shrinkfactor ) % shrinkfactor; + width = original_width+i_offset; + ptr->xOffset = xoffset+i_offset; + + yoffset = glyph->metrics.ascent-1; + /* printf("yoffset: %d\n",yoffset); */ + j_offset = ( shrinkfactor - (yoffset-(shrinkfactor-1)) % shrinkfactor ) + % shrinkfactor; + height = original_height+j_offset; + ptr->yOffset = yoffset+j_offset; + + DEBUG_PRINT(DEBUG_T1,(" (%dx%d)",width,height)); + /* + Extra marginal so that we do not crop the image when shrinking. + */ + shrunk_width = (width + shrinkfactor - 1) / shrinkfactor; + shrunk_height = (height + shrinkfactor - 1) / shrinkfactor; + ptr->w = shrunk_width; + ptr->h = shrunk_height; + + /* printf("(%d,%d) ",ptr->w,ptr->h); */ + DEBUG_PRINT(DEBUG_GLYPH,("\nDRAW GLYPH %d\n", (int)c)); + + /* + Shrink raster while doing antialiasing. + */ + if ((ptr->data = calloc(shrunk_width*shrunk_height,sizeof(char))) == NULL) + Fatal("unable to malloc image space for char %c", (char)c); + for (j = 0; j < original_height; j++) { + for (i = 0; i < (original_width+7)/8 ; i++) { + for (k = 0; k < 8 ; k++) { + DEBUG_PRINT(DEBUG_GLYPH, + ("%c", + (glyph->bits[i+j*((original_width+7)/8)] & (1<data[(i*8+k+i_offset)/shrinkfactor + +(j+j_offset)/shrinkfactor*shrunk_width] += + (glyph->bits[i+j*((original_width+7)/8)] & (1<data[i+j*shrunk_width] = ptr->data[i+j*shrunk_width] + *255/shrinkfactor/shrinkfactor; + DEBUG_PRINT(DEBUG_GLYPH,("%3u ",ptr->data[i+j*shrunk_width])); + } + DEBUG_PRINT(DEBUG_GLYPH,("|\n")); + } +} + +bool InitT1(struct font_entry * tfontp) +{ + if (libt1==NULL) { + if ((libt1=T1_InitLib( NO_LOGFILE | IGNORE_CONFIGFILE + | IGNORE_FONTDATABASE | T1_NO_AFM)) == NULL) { + Warning("an error occured during t1lib initialisation, disabling it"); + option_flags &= ~USE_LIBT1; + return(false); + } +# ifdef DEBUG + else + DEBUG_PRINT(DEBUG_T1,("\n T1LIB VERSION: %s", T1_GetLibIdent())); +# endif + } + + DEBUG_PRINT((DEBUG_DVI|DEBUG_T1),("\n OPEN T1 FONT:\t'%s'", tfontp->name)); + tfontp->T1id = T1_AddFont( tfontp->name ); + if (tfontp->T1id < 0) { + Warning("t1lib could not open font file %s", tfontp->name); + return(false); + } + if (T1_LoadFont(tfontp->T1id)) { + Warning("t1lib could not load font file %s", tfontp->name); + return(false); + } + Message(BE_VERBOSE,"<%s>", tfontp->name); + if (tfontp->psfontmap!=NULL && tfontp->psfontmap->encoding != NULL) { + DEBUG_PRINT(DEBUG_T1,("\n USE ENCODING:\t'%s'", tfontp->psfontmap->encoding->name)); + if (T1_ReencodeFont(tfontp->T1id,tfontp->psfontmap->encoding->charname)) { + Warning("unable to use font encoding '%s' for %s", + tfontp->psfontmap->encoding->name,tfontp->name); + return(false); + } + } + tfontp->type = FONT_TYPE_T1; + return(true); +} + + +static void UnLoadT1(struct char_entry *ptr) +{ + if (ptr->data!=NULL) + free(ptr->data); + ptr->data=NULL; +} + + +void DoneT1(struct font_entry *tfontp) +{ + int c=0; + + int error = T1_DeleteFont( tfontp->T1id ); + if (error) + Warning("font file %s could not be closed", tfontp->name); + while(cchr[c]!=NULL) { + UnLoadT1((struct char_entry*)tfontp->chr[c]); + free(tfontp->chr[c]); + tfontp->chr[c]=NULL; + } + c++; + } + if (tfontp->name!=NULL) + free(tfontp->name); + tfontp->name=NULL; +} + + diff --git a/Build/source/texk/dvipng/dvipng-1.13/test_dvipng.tex b/Build/source/texk/dvipng/dvipng-1.13/test_dvipng.tex new file mode 100644 index 00000000000..34814776070 --- /dev/null +++ b/Build/source/texk/dvipng/dvipng-1.13/test_dvipng.tex @@ -0,0 +1,48 @@ +% test_dvipng.tex +% +% Part of the dvipng distribution +% +% This program is free software: you can redistribute it and/or modify +% it under the terms of the GNU Lesser General Public License as +% published by the Free Software Foundation, either version 3 of the +% License, or (at your option) any later version. +% +% This program is distributed in the hope that it will be useful, but +% WITHOUT ANY WARRANTY; without even the implied warranty of +% MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU +% Lesser General Public License for more details. +% +% You should have received a copy of the GNU Lesser General Public +% License along with this program. If not, see +% . +% +% Copyright (C) 2002-2010 Jan-{\AA}ke Larsson + +\documentclass{article} +%\usepackage[active,textmath]{preview} +\usepackage{color} +\pagestyle{empty} + +\begin{document} +\begin{equation} + \int dx +\end{equation} +\newpage +$\int dx$ +\newpage +$\sqrt2+1=\frac1{\sqrt2-1}$ +\newpage +\framebox{\textbackslash\ttfamily framebox} +\newpage +\( \begin{array}{|r|} \hline a \cr \hline \end{array} \) +\newpage +fig, pig, flask, efficiency, effluent +\newpage +\Huge A \LARGE A \Large A \large A \normalsize A \small A +\footnotesize A \scriptsize A \tiny A +\newpage +\color{yellow} + +\section*{Hello world} +\pagecolor{blue} +\end{document} diff --git a/Build/source/texk/dvipng/dvipng-1.13/tfm.c b/Build/source/texk/dvipng/dvipng-1.13/tfm.c new file mode 100644 index 00000000000..a8a829cc932 --- /dev/null +++ b/Build/source/texk/dvipng/dvipng-1.13/tfm.c @@ -0,0 +1,75 @@ +/* tfm.c */ + +/************************************************************************ + + Part of the dvipng distribution + + This program is free software: you can redistribute it and/or modify + it under the terms of the GNU Lesser General Public License as + published by the Free Software Foundation, either version 3 of the + License, or (at your option) any later version. + + This program is distributed in the hope that it will be useful, but + WITHOUT ANY WARRANTY; without even the implied warranty of + MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU + Lesser General Public License for more details. + + You should have received a copy of the GNU Lesser General Public + License along with this program. If not, see + . + + Copyright (C) 2002-2009 Jan-Åke Larsson + +************************************************************************/ + +#include "dvipng.h" + +bool ReadTFM(struct font_entry * tfontp, char* tfmname) +{ + struct filemmap fmmap; + struct char_entry *tcharptr; + unsigned char *position; + int lh,bc,ec,nw, c; + dviunits* width; + + DEBUG_PRINT((DEBUG_DVI|DEBUG_FT|DEBUG_TFM), + ("\n OPEN METRICS:\t'%s'", tfmname)); + if (MmapFile(tfmname,&fmmap)) return(false); + position=(unsigned char*)fmmap.data; + lh = UNumRead(position+2,2); + bc = UNumRead(position+4,2); + ec = UNumRead(position+6,2); + nw = UNumRead(position+8,2); + DEBUG_PRINT(DEBUG_TFM,(" %d %d %d %d",lh,bc,ec,nw)); + width=malloc(nw*sizeof(dviunits)); + c=0; + position=position+24+(lh+ec-bc+1)*4; + while( c < nw ) { + width[c] = SNumRead(position,4); + c++; + position += 4; + } + + /* Read char widths */ + c=bc; + position=(unsigned char*)fmmap.data+24+lh*4; + while(c <= ec) { + DEBUG_PRINT(DEBUG_TFM,("\n@%ld TFM METRICS:\t", + (long)position - (long)fmmap.data)); + tcharptr=xmalloc(sizeof(struct char_entry)); + tcharptr->data=NULL; + tcharptr->tfmw=width[*position]; + DEBUG_PRINT(DEBUG_TFM,("%d [%d] %d",c,*position,tcharptr->tfmw)); + tcharptr->tfmw = (dviunits) + ((int64_t) tcharptr->tfmw * tfontp->s / (1 << 20)); + DEBUG_PRINT(DEBUG_TFM,(" (%d)",tcharptr->tfmw)); + if (c >= NFNTCHARS) /* Only positive for now */ + Fatal("tfm file %s exceeds char numbering limit",tfmname); + tfontp->chr[c] = tcharptr; + c++; + position += 4; + } + free(width); + UnMmapFile(&fmmap); + return(true); +} diff --git a/Build/source/texk/dvipng/dvipng-1.13/vf.c b/Build/source/texk/dvipng/dvipng-1.13/vf.c new file mode 100644 index 00000000000..d1d33fe6d7e --- /dev/null +++ b/Build/source/texk/dvipng/dvipng-1.13/vf.c @@ -0,0 +1,144 @@ +/* vf.c */ + +/************************************************************************ + + Part of the dvipng distribution + + This program is free software: you can redistribute it and/or modify + it under the terms of the GNU Lesser General Public License as + published by the Free Software Foundation, either version 3 of the + License, or (at your option) any later version. + + This program is distributed in the hope that it will be useful, but + WITHOUT ANY WARRANTY; without even the implied warranty of + MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU + Lesser General Public License for more details. + + You should have received a copy of the GNU Lesser General Public + License along with this program. If not, see + . + + Copyright (C) 2002-2010 Jan-Åke Larsson + +************************************************************************/ + +#include "dvipng.h" + +#define VF_ID 202 +#define LONG_CHAR 242 + +int32_t SetVF(struct char_entry* ptr) +{ + struct font_entry* currentvf; + unsigned char *command,*end; + + currentvf=currentfont; + BeginVFMacro(currentvf); + command = ptr->data; + end = command + ptr->length; + while (command < end) { + DEBUG_PRINT(DEBUG_DVI,("\n VF MACRO:\t%s ", dvi_commands[*command])); + DrawCommand(command,currentvf); + command += CommandLength(command); + } + EndVFMacro(); + currentfont=currentvf; + return(ptr->tfmw); +} + + + +void InitVF(struct font_entry * tfontp) +{ + unsigned char* position; + int length; + struct char_entry *tcharptr; + uint32_t c=0; + struct font_num *tfontnump; /* temporary font_num pointer */ + + DEBUG_PRINT((DEBUG_DVI|DEBUG_VF),("\n OPEN FONT:\t'%s'", tfontp->name)); + Message(BE_VERBOSE,"<%s>", tfontp->name); + if (MmapFile(tfontp->name,&(tfontp->fmmap))) + Fatal("font file %s unusable", tfontp->name); + position=(unsigned char*)tfontp->fmmap.data; + if (*(position) != PRE) + Fatal("unknown font format in file %s",tfontp->name); + if (*(position+1) != VF_ID) + Fatal( "wrong version %d of vf file %s (should be 202)", + (int)*(position+1),tfontp->name); + DEBUG_PRINT(DEBUG_VF,("\n VF_PRE:\t'%.*s'", + (int)*(position+2), position+3)); + position = position+3 + *(position+2); + c=UNumRead(position, 4); + DEBUG_PRINT(DEBUG_VF,(" %d", c)); + CheckChecksum (tfontp->c, c, tfontp->name); + tfontp->designsize = UNumRead(position+4,4); + DEBUG_PRINT(DEBUG_VF,(" %d", tfontp->designsize)); + tfontp->type = FONT_TYPE_VF; + tfontp->vffontnump=NULL; + /* Read font definitions */ + position += 8; + while(*position >= FNT_DEF1 && *position <= FNT_DEF4) { + DEBUG_PRINT(DEBUG_VF,("\n @%ld VF:\t%s", + (long)position - (long)tfontp->fmmap.data, + dvi_commands[*position])); + FontDef(position,tfontp); + length = dvi_commandlength[*position]; + position += length + *(position + length-1) + *(position+length-2); + } + /* Default font is the first defined */ + tfontnump = tfontp->vffontnump; + while (tfontnump->next != NULL) { + tfontnump = tfontnump->next; + } + tfontp->defaultfont=tfontnump->k; + + /* Read char definitions */ + while(*position < FNT_DEF1) { + DEBUG_PRINT(DEBUG_VF,("\n@%ld VF CHAR:\t", + (long)position - (long)tfontp->fmmap.data)); + tcharptr=xmalloc(sizeof(struct char_entry)); + switch (*position) { + case LONG_CHAR: + tcharptr->length = UNumRead(position+1,4); + c = UNumRead(position+5,4); + tcharptr->tfmw = UNumRead(position+9,4); + position += 13; + break; + default: + tcharptr->length = UNumRead(position,1); + c = UNumRead(position+1,1); + tcharptr->tfmw = UNumRead(position+2,3); + position += 5; + } + DEBUG_PRINT(DEBUG_VF,("%d %d %d",tcharptr->length,c,tcharptr->tfmw)); + tcharptr->tfmw = (int32_t) + ((int64_t) tcharptr->tfmw * tfontp->s / (1 << 20)); + DEBUG_PRINT(DEBUG_VF,(" (%d)",tcharptr->tfmw)); + if (c >= NFNTCHARS) /* Only positive for now */ + Fatal("VF font %s exceeds char numbering limit",tfontp->name); + tfontp->chr[c] = tcharptr; + tcharptr->data=position; + position += tcharptr->length; + } +} + + +void DoneVF(struct font_entry *tfontp) +{ + int c=FIRSTFNTCHAR; + + UnMmapFile(&(tfontp->fmmap)); + while(c<=LASTFNTCHAR) { + if (tfontp->chr[c]!=NULL) { + free(tfontp->chr[c]); + tfontp->chr[c]=NULL; + } + c++; + } + FreeFontNumP(tfontp->vffontnump); + tfontp->vffontnump=NULL; + if (tfontp->name!=NULL) + free(tfontp->name); + tfontp->name=NULL; +} -- cgit v1.2.3