summaryrefslogtreecommitdiff
path: root/Master/texmf-dist/doc/metapost/metauml/manual
diff options
context:
space:
mode:
authorKarl Berry <karl@freefriends.org>2019-02-03 22:45:55 +0000
committerKarl Berry <karl@freefriends.org>2019-02-03 22:45:55 +0000
commitc5d84d1a3ab85b1f314ff62717a7af3c6b75c7af (patch)
tree26333edc4a6082f37d75349f84eded8dbc0d5aef /Master/texmf-dist/doc/metapost/metauml/manual
parent2dcfe2f07af05124d5ebee4672d67d7eeae7af60 (diff)
metauml (3feb19)
git-svn-id: svn://tug.org/texlive/trunk@49923 c570f23f-e606-0410-a88d-b1316a301751
Diffstat (limited to 'Master/texmf-dist/doc/metapost/metauml/manual')
-rw-r--r--Master/texmf-dist/doc/metapost/metauml/manual/fig/activity.mp52
-rw-r--r--Master/texmf-dist/doc/metapost/metauml/manual/fig/activity_diagrams.mp59
-rw-r--r--Master/texmf-dist/doc/metapost/metauml/manual/fig/appetizer.mp203
-rw-r--r--Master/texmf-dist/doc/metapost/metauml/manual/fig/boxes_vs_util.mp92
-rw-r--r--Master/texmf-dist/doc/metapost/metauml/manual/fig/class.mp134
-rw-r--r--Master/texmf-dist/doc/metapost/metauml/manual/fig/class_association.mp72
-rw-r--r--Master/texmf-dist/doc/metapost/metauml/manual/fig/class_customization.mp94
-rw-r--r--Master/texmf-dist/doc/metapost/metauml/manual/fig/class_customization2.mp31
-rw-r--r--Master/texmf-dist/doc/metapost/metauml/manual/fig/class_diagrams.mp212
-rw-r--r--Master/texmf-dist/doc/metapost/metauml/manual/fig/class_templates.mp29
-rw-r--r--Master/texmf-dist/doc/metapost/metauml/manual/fig/component.mp61
-rw-r--r--Master/texmf-dist/doc/metapost/metauml/manual/fig/group.mp51
-rw-r--r--Master/texmf-dist/doc/metapost/metauml/manual/fig/how-links-work.mp38
-rw-r--r--Master/texmf-dist/doc/metapost/metauml/manual/fig/instance.mp9
-rw-r--r--Master/texmf-dist/doc/metapost/metauml/manual/fig/mptextmp.mp1
-rw-r--r--Master/texmf-dist/doc/metapost/metauml/manual/fig/note.mp74
-rw-r--r--Master/texmf-dist/doc/metapost/metauml/manual/fig/object_stack.mp46
-rw-r--r--Master/texmf-dist/doc/metapost/metauml/manual/fig/package.mp93
-rw-r--r--Master/texmf-dist/doc/metapost/metauml/manual/fig/paths.mp132
-rw-r--r--Master/texmf-dist/doc/metapost/metauml/manual/fig/paths_man.mp143
-rw-r--r--Master/texmf-dist/doc/metapost/metauml/manual/fig/picture_info.mp86
-rw-r--r--Master/texmf-dist/doc/metapost/metauml/manual/fig/picture_stack.mp44
-rw-r--r--Master/texmf-dist/doc/metapost/metauml/manual/fig/positioning.mp139
-rw-r--r--Master/texmf-dist/doc/metapost/metauml/manual/fig/properties.mp58
-rw-r--r--Master/texmf-dist/doc/metapost/metauml/manual/fig/state.mp55
-rw-r--r--Master/texmf-dist/doc/metapost/metauml/manual/fig/statemachine_diagrams.mp78
-rw-r--r--Master/texmf-dist/doc/metapost/metauml/manual/fig/test_activity.mp46
-rw-r--r--Master/texmf-dist/doc/metapost/metauml/manual/fig/test_class.mp156
-rw-r--r--Master/texmf-dist/doc/metapost/metauml/manual/fig/test_class_feature_types.mp53
-rw-r--r--Master/texmf-dist/doc/metapost/metauml/manual/fig/test_class_qual_assoc.mp53
-rw-r--r--Master/texmf-dist/doc/metapost/metauml/manual/fig/test_class_templates.mp62
-rw-r--r--Master/texmf-dist/doc/metapost/metauml/manual/fig/test_component.mp30
-rw-r--r--Master/texmf-dist/doc/metapost/metauml/manual/fig/test_font.mp81
-rw-r--r--Master/texmf-dist/doc/metapost/metauml/manual/fig/test_group.mp60
-rw-r--r--Master/texmf-dist/doc/metapost/metauml/manual/fig/test_instance.mp35
-rw-r--r--Master/texmf-dist/doc/metapost/metauml/manual/fig/test_lars_issues.mp94
-rw-r--r--Master/texmf-dist/doc/metapost/metauml/manual/fig/test_lowlevel.mp66
-rw-r--r--Master/texmf-dist/doc/metapost/metauml/manual/fig/test_note.mp39
-rw-r--r--Master/texmf-dist/doc/metapost/metauml/manual/fig/test_package.mp54
-rw-r--r--Master/texmf-dist/doc/metapost/metauml/manual/fig/test_paths.mp100
-rw-r--r--Master/texmf-dist/doc/metapost/metauml/manual/fig/test_picture.mp273
-rw-r--r--Master/texmf-dist/doc/metapost/metauml/manual/fig/test_picture_stack.mp130
-rw-r--r--Master/texmf-dist/doc/metapost/metauml/manual/fig/test_picture_tex_rendering.mp43
-rw-r--r--Master/texmf-dist/doc/metapost/metauml/manual/fig/test_positioning.mp195
-rw-r--r--Master/texmf-dist/doc/metapost/metauml/manual/fig/test_skins.mp26
-rw-r--r--Master/texmf-dist/doc/metapost/metauml/manual/fig/test_skins_global_defaults.mp29
-rw-r--r--Master/texmf-dist/doc/metapost/metauml/manual/fig/test_state.mp73
-rw-r--r--Master/texmf-dist/doc/metapost/metauml/manual/fig/test_usecase.mp185
-rw-r--r--Master/texmf-dist/doc/metapost/metauml/manual/fig/usecase.mp43
-rw-r--r--Master/texmf-dist/doc/metapost/metauml/manual/fig/usecase_diagrams.mp48
-rw-r--r--Master/texmf-dist/doc/metapost/metauml/manual/metauml-manual.bib64
-rw-r--r--Master/texmf-dist/doc/metapost/metauml/manual/metauml-manual.tex2072
-rw-r--r--Master/texmf-dist/doc/metapost/metauml/manual/test-suite.tex82
53 files changed, 6278 insertions, 0 deletions
diff --git a/Master/texmf-dist/doc/metapost/metauml/manual/fig/activity.mp b/Master/texmf-dist/doc/metapost/metauml/manual/fig/activity.mp
new file mode 100644
index 00000000000..676d1996eb1
--- /dev/null
+++ b/Master/texmf-dist/doc/metapost/metauml/manual/fig/activity.mp
@@ -0,0 +1,52 @@
+% Sample MetaUML figures.
+% Copyright (C) 2005 Ovidiu Gheorghies
+%
+% This program is free software; you can redistribute it and/or
+% modify it under the terms of the GNU General Public License
+% as published by the Free Software Foundation; either version 2
+% of the License, or (at your option) any later version.
+%
+% This program is distributed in the hope that it will be useful,
+% but WITHOUT ANY WARRANTY; without even the implied warranty of
+% MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
+% GNU General Public License for more details.
+%
+% You should have received a copy of the GNU General Public License
+% along with this program; if not, write to the Free Software
+% Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+
+
+input metauml;
+
+beginfig(1);
+ Begin.b;
+ End.e;
+ FlowFinal.f;
+
+ leftToRight(20)(b, e, f);
+
+ drawObjects(b, e, f);
+endfig;
+
+beginfig(2);
+ Activity.A("Learn MetaUML -",
+ "the MetaPost UML library");
+ drawObject(A);
+endfig;
+
+beginfig(3);
+ Fork.forkA("h", 50);
+ Fork.forkB("v", 20);
+
+ leftToRight(10)(forkA, forkB);
+
+ drawObjects(forkA, forkB);
+endfig;
+
+beginfig(4);
+ Branch.testA;
+
+ drawObject(testA);
+endfig;
+
+end
diff --git a/Master/texmf-dist/doc/metapost/metauml/manual/fig/activity_diagrams.mp b/Master/texmf-dist/doc/metapost/metauml/manual/fig/activity_diagrams.mp
new file mode 100644
index 00000000000..0807619acd9
--- /dev/null
+++ b/Master/texmf-dist/doc/metapost/metauml/manual/fig/activity_diagrams.mp
@@ -0,0 +1,59 @@
+% Part of the MetaUML manual.
+% Copyright (C) 2005 Ovidiu Gheorghies
+%
+% This program is free software; you can redistribute it and/or
+% modify it under the terms of the GNU General Public License
+% as published by the Free Software Foundation; either version 2
+% of the License, or (at your option) any later version.
+%
+% This program is distributed in the hope that it will be useful,
+% but WITHOUT ANY WARRANTY; without even the implied warranty of
+% MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
+% GNU General Public License for more details.
+%
+% You should have received a copy of the GNU General Public License
+% along with this program; if not, write to the Free Software
+% Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+
+% for f in `find . | grep '.*\.[1-9]'`; do echo $f; done
+
+input metauml;
+
+beginfig(1);
+ Begin.b;
+ Activity.eat("Eat something good", "from the kitchen");
+ Branch.enough;
+ Fork.fork("h", 50);
+ Activity.read("Read a book");
+ Activity.listen("Listen to music", "(and ignore it)");
+ Fork.join("h", 50);
+ End.e;
+
+ eat.n = b.s + (0,-20);
+ enough.n = eat.s + (0,-20);
+ fork.n = enough.s + (0, -20);
+
+ read.top = listen.top = fork.bottom - 30;
+ listen.left - read.right = 10;
+ b.midx = .5[listen.left, read.right];
+
+ join.n = (b.midx, listen.bottom - 20);
+ e.n = join.s + (0, -20);
+
+ drawObjects(b, eat, enough, fork, read, listen, join, e);
+
+ clink(transition)(b, eat);
+ clink(transition)(eat, enough);
+ link(transition)(pathStepX(enough.w, eat.w, -80));
+ clink(transition)(enough, fork);
+ clink(transition)(fork, read);
+ clink(transition)(fork, listen);
+ clink(transition)(read, join);
+ clink(transition)(listen, join);
+ clink(transition)(join, e);
+
+ item(iGuard)("still hungry")(obj.se = enough.w + (-20, 0));
+ item(iGuard)("had enough")(obj.nw = enough.s + (0, -4));
+endfig;
+
+end
diff --git a/Master/texmf-dist/doc/metapost/metauml/manual/fig/appetizer.mp b/Master/texmf-dist/doc/metapost/metauml/manual/fig/appetizer.mp
new file mode 100644
index 00000000000..ed90dc77dc1
--- /dev/null
+++ b/Master/texmf-dist/doc/metapost/metauml/manual/fig/appetizer.mp
@@ -0,0 +1,203 @@
+% Sample MetaUML figures.
+% Copyright (C) 2005 Ovidiu Gheorghies
+%
+% This program is free software; you can redistribute it and/or
+% modify it under the terms of the GNU General Public License
+% as published by the Free Software Foundation; either version 2
+% of the License, or (at your option) any later version.
+%
+% This program is distributed in the hope that it will be useful,
+% but WITHOUT ANY WARRANTY; without even the implied warranty of
+% MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
+% GNU General Public License for more details.
+%
+% You should have received a copy of the GNU General Public License
+% along with this program; if not, write to the Free Software
+% Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+
+input metauml;
+
+beginfig(1);
+ Class.Client("Client")()();
+
+ Class._Component("Component")()();
+ %("+Operation()", "+Add(Component)", "+Remove(Component)", "+GetChild(int)");
+ classStereotype._Component("<<interface>>");
+
+ Class.Leaf("Leaf")()("+Operation()");
+
+ Class.Composite("Composite")()();
+ %("+Operation()", "+Add(Component)", "+Remove(Component)", "+GetChild(int)");
+
+ leftToRight.top(30)(Client, _Component);
+ leftToRight.top(20)(Leaf, Composite);
+ .5[Leaf.ne, Composite.nw] = below(_Component.s, 45);
+
+ drawObjects(Client, _Component, Leaf, Composite);
+
+ link(associationUni)(pathHorizontal(Client.e, _Component.left));
+ link(inheritance)(pathStepY(Leaf.n, _Component.s, 20));
+ link(inheritance)(pathStepY(Composite.n, _Component.s, 20));
+
+ link(aggregationUni)(pathStepX(_Component.e, Composite.e, 55));
+endfig;
+
+beginfig(2);
+ Begin.b;
+ Activity.eat("Eat something good", "from the kitchen");
+ Branch.enough;
+ Fork.fork("h", 50);
+ Activity.read("Read a book");
+ Activity.listen("Listen to music", "(and ignore it)");
+ Fork.join("h", 50);
+ End.e;
+
+ leftToRight.top(10)(read, listen);
+ Group.readListen(read, listen);
+
+ leftToRight(30)(b, eat);
+ topToBottom(20)(eat, enough, fork, readListen, join, e);
+
+ drawObjects(b, eat, enough, fork, readListen, join, e);
+
+ clink(transition)(b, eat);
+ clink(transition)(eat, enough);
+ link(transition)(pathStepX(enough.e, eat.e, 80));
+ clink(transition)(enough, fork);
+ clink(transition)(fork, read);
+ clink(transition)(fork, listen);
+ clink(transition)(read, join);
+ clink(transition)(listen, join);
+ clink(transition)(join, e);
+
+ item(iGuard)("still hungry")(obj.sw = enough.e + (20, 0));
+ item(iGuard)("had enough")(obj.nw = enough.s + (0, -4));
+endfig;
+
+beginfig(3);
+ Actor.user("User");
+ Actor.db("Database");
+
+ Usecase.dbquery("Query database");
+ Usecase.auth("Authenticate user");
+ Usecase.authA("Authenticate by", "username, password");
+ Usecase.authB("Authenticate by", "smartcard");
+
+ leftToRight(30)(user.human, auth, dbquery, db.human);
+ leftToRight.top(30)(authA, authB);
+ .5[authA.ne, authB.nw] = below(auth.s, 20);
+
+ drawObjects(user, auth, dbquery, db, authA, authB);
+
+ clink(inheritance)(authA, auth);
+ clink(inheritance)(authB, auth);
+ clink(association)(auth, dbquery);
+ clink(association)(user.human, auth);
+ clink(association)(dbquery, db.human);
+endfig;
+
+beginfig(4);
+ save b, e, reading, processing, composite, exit, error, result, theEnd;
+
+ Begin.b;
+ State.reading("Reading commands")();
+ State.processing("Processing commands")();
+ End.e;
+
+ State.composite("Working")(b, reading, processing, e);
+ composite.info.left := composite.info.right := 10;
+ composite.info.drawNameLine := 1;
+
+ topToBottom(20)(b, reading, processing, e);
+ drawObject(composite);
+
+ clink(transition)(b, reading);
+ clink(transition)(reading, processing);
+ clink(transition)(processing, e);
+
+ ExitPoint.exit;
+ exit.c=(composite.right, reading.midy);
+ drawObject(exit);
+ item(iAssoc)("error")(obj.nw = exit.s);
+
+ clink(transition)(reading, exit);
+
+ State.error("Preparing error report")();
+ State.result("Writing result")();
+ End.theEnd;
+
+ topToBottom(20)(error, result, theEnd);
+ leftToRight(30)(exit, error);
+
+ drawObjects(error, result, theEnd);
+
+ clink(transition)(exit, error);
+ clink(transition)(error, result);
+ clink(transition)(result, theEnd);
+
+ link(transition)(rpathHorizontal(result.w, composite.right));
+endfig;
+
+
+beginfig(5);
+ save A, B;
+
+ Note.A("An important", "UML note");
+ Note.B("Another note");
+
+ leftToRight(20)(A, B);
+ drawObjects(A, B);
+
+ clink(dashedLink)(A, B);
+endfig;
+
+beginfig(6);
+ Class.A("A")()();
+ Class.B("B")()();
+
+ Package.pA("net.foo")();
+ Package.pB("net.foo.bar")(A, B);
+
+ leftToRight(20)(A, B);
+ leftToRight(50)(pA, pB);
+
+ drawObjects(A, B, pA, pB);
+
+ clink(nest)(pB, pA);
+endfig;
+
+beginfig(7);
+ save A;
+
+ Class.A("MyClass")
+ ("attr1: int", "attr2: int")
+ ("method1(): void",
+ "method2(): void");
+
+ A.nw = (0, 0); % optional, implied
+ drawObject(A);
+endfig;
+
+beginfig(8);
+ save A, B;
+ Class.A("A")()();
+ Class.B("B")()();
+
+ A.nw = (0,0);
+ B.w = A.e + (20, 0);
+
+ drawObjects(A, B);
+endfig;
+
+beginfig(9);
+ save A, B;
+
+ Class.A("A")()();
+ Class.B("B")()();
+ B.w = A.e + (20, 0);
+ drawObjects(A, B);
+ link(inheritance)(B.w -- A.e);
+endfig;
+end
+
+end
diff --git a/Master/texmf-dist/doc/metapost/metauml/manual/fig/boxes_vs_util.mp b/Master/texmf-dist/doc/metapost/metauml/manual/fig/boxes_vs_util.mp
new file mode 100644
index 00000000000..985c9bb158b
--- /dev/null
+++ b/Master/texmf-dist/doc/metapost/metauml/manual/fig/boxes_vs_util.mp
@@ -0,0 +1,92 @@
+% Part of the MetaUML manual.
+% Copyright (C) 2005 Ovidiu Gheorghies
+%
+% This program is free software; you can redistribute it and/or
+% modify it under the terms of the GNU General Public License
+% as published by the Free Software Foundation; either version 2
+% of the License, or (at your option) any later version.
+%
+% This program is distributed in the hope that it will be useful,
+% but WITHOUT ANY WARRANTY; without even the implied warranty of
+% MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
+% GNU General Public License for more details.
+%
+% You should have received a copy of the GNU General Public License
+% along with this program; if not, write to the Free Software
+% Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+
+input boxes;
+input util_commons;
+input util_object;
+input util_picture;
+
+beginfig(1);
+ boxit.a ("yummy");
+ boxit.b ("cool");
+
+ a.nw = (0,0);
+ b.sw = a.se + (10,0);
+
+ drawboxed (a, b);
+ draw a.sw -- b.se dashed evenly withpen pencircle scaled 1.1;
+
+ boxit.c ("yummy");
+ boxit.d ("cool");
+
+ c.nw = (0,-20);
+ d.sw = c.se + (10,0);
+
+ drawunboxed (c, d);
+ draw c.sw -- d.se dashed evenly withpen pencircle scaled 1.1;
+endfig;
+
+beginfig(2);
+ save a, b, c, d;
+
+ Picture.a("yummy");
+ Picture.b("cool");
+ a.info.boxed := b.info.boxed := 1;
+
+ a.nw = (0,0);
+ b.sw = a.se + (10,0);
+
+ drawObjects(a, b);
+ draw a.sw -- b.se dashed evenly withpen pencircle scaled 1.1;
+
+ Picture.c("yummy");
+ Picture.d("cool");
+
+ c.nw = (0,-20);
+ d.sw = c.se + (10,0);
+
+ drawObjects(c, d);
+ draw c.sw -- d.se dashed evenly withpen pencircle scaled 1.1;
+endfig;
+
+beginfig(3);
+ save a, b, c, d;
+
+ iPict.ignoreNegativeBase := 1;
+
+ Picture.a("yummy");
+ Picture.b("cool");
+ a.info.boxed := b.info.boxed := 1;
+
+ a.nw = (0,0);
+ b.sw = a.se + (10,0);
+
+ drawObjects(a, b);
+ draw a.sw -- b.se dashed evenly withpen pencircle scaled 1.1;
+
+ Picture.c("yummy");
+ Picture.d("cool");
+
+ c.nw = (0,-20);
+ d.sw = c.se + (10,0);
+
+ drawObjects(c, d);
+ draw c.sw -- d.se dashed evenly withpen pencircle scaled 1.1;
+endfig;
+
+
+end
diff --git a/Master/texmf-dist/doc/metapost/metauml/manual/fig/class.mp b/Master/texmf-dist/doc/metapost/metauml/manual/fig/class.mp
new file mode 100644
index 00000000000..e5d03d3d43d
--- /dev/null
+++ b/Master/texmf-dist/doc/metapost/metauml/manual/fig/class.mp
@@ -0,0 +1,134 @@
+% Sample MetaUML figures.
+% Copyright (C) 2005 Ovidiu Gheorghies
+%
+% This program is free software; you can redistribute it and/or
+% modify it under the terms of the GNU General Public License
+% as published by the Free Software Foundation; either version 2
+% of the License, or (at your option) any later version.
+%
+% This program is distributed in the hope that it will be useful,
+% but WITHOUT ANY WARRANTY; without even the implied warranty of
+% MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
+% GNU General Public License for more details.
+%
+% You should have received a copy of the GNU General Public License
+% along with this program; if not, write to the Free Software
+% Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+
+
+input metauml;
+
+beginfig(1);
+ Class.A("Point")
+ ("#x:int",
+ "#y:int")
+ ("+set(x:int, y:int)",
+ "+getX():int",
+ "+getY():int",
+ "-debug():void",
+ "test():void");
+ drawObject(A);
+endfig;
+
+beginfig(2);
+ save A, T;
+
+ Class.A("User")()();
+ Class_stereotypes.A("<<interface>>", "<<home>>");
+
+ drawObject(A);
+endfig;
+
+beginfig(3);
+ save A, T;
+
+ Class.A("Vector")()();
+ ClassTemplate.T("T", "size: int")(A);
+
+ drawObjects(A, T);
+endfig;
+
+beginfig(4);
+ link(association)( (0,0) -- (50,0) );
+endfig;
+
+beginfig(5);
+ link(associationUni)( (0,0) -- (50,0) );
+endfig;
+
+beginfig(6);
+ link(inheritance)( (0,0) -- (50,0) );
+endfig;
+
+beginfig(7);
+ link(aggregation)( (0,0) -- (50,0) );
+endfig;
+
+beginfig(8);
+ link(aggregationUni)( (0,0) -- (50,0) );
+endfig;
+
+beginfig(9);
+ link(composition)( (0,0) -- (50,0) );
+endfig;
+
+beginfig(10);
+ link(compositionUni)( (0,0) -- (50,0) );
+endfig;
+
+beginfig(11);
+ save A;
+ Interface.A("Observer")
+ ("+update(src:Object)");
+
+ drawObject(A);
+endfig;
+
+beginfig(12);
+ save A;
+ EClass.A(iAbstractClass)("Observable")
+ ("observers: Observer[0..*]")
+ ("+addObserver(o: Observer)",
+ "+notify()");
+
+ drawObject(A);
+endfig;
+
+beginfig(13)
+ save A;
+
+ Class.A("MyModel")()();
+ A.info.iName.top := 10;
+ A.info.iName.bottom := 10;
+ A.info.iAttributeStack.top := 0;
+ A.info.iAttributeStack.bottom := 0;
+ A.info.iMethodStack.top := 0;
+ A.info.iMethodStack.bottom := 0;
+
+ drawObject(A);
+endfig;
+
+beginfig(14)
+ save A, B;
+
+ EClass.A(iClassNameOnly)("MyModel")()();
+ ClassName.B("AnotherModel");
+ classStereotypes.B("<<smart>>");
+
+ topToBottom(20)(A, B);
+
+ drawObjects(A, B);
+endfig;
+
+beginfig(15);
+ save A;
+
+ Class.A("Point")
+ ("#x:int", "#y:int")
+ ("+toString():String");
+ Class_noVisibilityMarkers.A;
+
+ drawObject(A);
+endfig;
+
+end
diff --git a/Master/texmf-dist/doc/metapost/metauml/manual/fig/class_association.mp b/Master/texmf-dist/doc/metapost/metauml/manual/fig/class_association.mp
new file mode 100644
index 00000000000..2ff5037a8c8
--- /dev/null
+++ b/Master/texmf-dist/doc/metapost/metauml/manual/fig/class_association.mp
@@ -0,0 +1,72 @@
+% Part of the MetaUML manual.
+% Copyright (C) 2005 Ovidiu Gheorghies
+%
+% This program is free software; you can redistribute it and/or
+% modify it under the terms of the GNU General Public License
+% as published by the Free Software Foundation; either version 2
+% of the License, or (at your option) any later version.
+%
+% This program is distributed in the hope that it will be useful,
+% but WITHOUT ANY WARRANTY; without even the implied warranty of
+% MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
+% GNU General Public License for more details.
+%
+% You should have received a copy of the GNU General Public License
+% along with this program; if not, write to the Free Software
+% Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+
+input metauml;
+
+beginfig(1);
+ save P,B;
+
+ Class.P("Person")()();
+ Class.B("Bank")()();
+
+ P.nw = (0,0);
+ B.w = P.e + (50,0);
+
+ drawObjects(P, B);
+
+ drawRelation(association)(P.e -- B.w);
+
+ item.assocName(iAssoc)("works for")(assocName.s = .5[P.e,B.w]);
+
+ draw assocName.n -- (assocName.n + (20,20));
+ label.urt("association name" infont "tyxtt", assocName.n + (20,20));
+endfig;
+
+beginfig(2);
+ save P,C;
+
+ Class.P("Person")()();
+ Class.C("Company")()();
+
+ C.n = P.s + (0, -70);
+ drawObjects(P, C);
+
+ link(association)(P.s -- C.n);
+
+ item(iAssoc)("employee")(obj.nw = P.s);
+ item(iAssoc)("1..*")(obj.ne = P.s);
+
+ item(iAssoc)("employer")(obj.sw = C.n);
+ item(iAssoc)("0..*")(obj.se = C.n);
+
+ item(iAssoc)("works for")(obj.w = .5[P.s,C.n]);
+endfig;
+
+beginfig(3);
+ save F, O;
+
+ Class.F("Factory")()();
+ Class.O("Object")()();
+
+ O.n = F.s - (0, 50);
+ drawObjects(F, O);
+
+ clink(dependency)(F, O);
+ item(iStereo)("<<creates>>")(obj.w = .5[F.s,O.n])
+endfig;
+
+end
diff --git a/Master/texmf-dist/doc/metapost/metauml/manual/fig/class_customization.mp b/Master/texmf-dist/doc/metapost/metauml/manual/fig/class_customization.mp
new file mode 100644
index 00000000000..980915ea00e
--- /dev/null
+++ b/Master/texmf-dist/doc/metapost/metauml/manual/fig/class_customization.mp
@@ -0,0 +1,94 @@
+% Part of the MetaUML manual.
+% Copyright (C) 2005 Ovidiu Gheorghies
+%
+% This program is free software; you can redistribute it and/or
+% modify it under the terms of the GNU General Public License
+% as published by the Free Software Foundation; either version 2
+% of the License, or (at your option) any later version.
+%
+% This program is distributed in the hope that it will be useful,
+% but WITHOUT ANY WARRANTY; without even the implied warranty of
+% MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
+% GNU General Public License for more details.
+%
+% You should have received a copy of the GNU General Public License
+% along with this program; if not, write to the Free Software
+% Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+
+input metauml;
+
+beginfig(1);
+ iClass.foreColor := (.9, .9, 0);
+
+ Class.A("A")()();
+ Class.B("B")()();
+ Class.C("C")()();
+
+ B.w = A.e + (20,0);
+ C.n = .5[A.se, B.sw] + (0, -10);
+
+ drawObjects(A, B, C);
+endfig;
+
+beginfig(2);
+ save A, B, C;
+ iClass.foreColor := (.9, .9, 0);
+
+ Class.A("A")()();
+ Class.B("B")()();
+ Class.C("C")()();
+ C.info.foreColor := (.7, .7, .9);
+ C.info.borderColor := blue;
+ C.info.iName.iFont.scale := 2;
+
+ B.w = A.e + (20,0);
+ C.n = .5[A.se, B.sw] + (0, -10);
+
+ drawObjects(A, B, C);
+endfig;
+
+beginfig(3);
+ ClassInfoCopy.iHome(iClass);
+ iHome.foreColor := (0, .9, .9);
+
+ ClassInfo.iRemote;
+ iRemote.foreColor := (.9, .9, 0);
+ iRemote.borderColor := (0, 0, .9);
+
+ save A, B, C, D;
+
+ EClass.A(iHome)("UserHome")()();
+ EClass.B(iRemote)("UserRemote")()();
+ EClass.C(iHome)("CartHome")()();
+ EClass.D(iRemote)("CartRemote")()();
+
+
+ B.nw = A.ne + (20,0);
+ D.nw = C.ne + (20,0);
+ A.bottom - C.top = 10;
+ A.left = C.left;
+
+ drawObjects(A, B, C, D);
+endfig;
+
+beginfig(4);
+ iClass.foreColor := .9white;
+ save A;
+
+ Class.A("Foo")
+ ("a: int", "b: int")
+ ("foo()", "bar()", "gar()");
+ A.info.iName.iFont.name := metauml_defaultFontBold;
+ A.info.iName.iFont.scale := 1.2;
+
+ A.info.iAttributeStack.iPict.iFont.scale := 0.8;
+ A.info.iAttributeStack.top := 10;
+ A.info.iAttributeStack.spacing := 11;
+
+ A.info.iMethodStack.iPict.iFont.scale := 2;
+ A.info.iMethodStack.spacing := 17;
+ A.info.iMethodStack.bottom := 10;
+ drawObject(A);
+endfig;
+
+end
diff --git a/Master/texmf-dist/doc/metapost/metauml/manual/fig/class_customization2.mp b/Master/texmf-dist/doc/metapost/metauml/manual/fig/class_customization2.mp
new file mode 100644
index 00000000000..be45e95240b
--- /dev/null
+++ b/Master/texmf-dist/doc/metapost/metauml/manual/fig/class_customization2.mp
@@ -0,0 +1,31 @@
+% Part of the MetaUML manual.
+% Copyright (C) 2005 Ovidiu Gheorghies
+%
+% This program is free software; you can redistribute it and/or
+% modify it under the terms of the GNU General Public License
+% as published by the Free Software Foundation; either version 2
+% of the License, or (at your option) any later version.
+%
+% This program is distributed in the hope that it will be useful,
+% but WITHOUT ANY WARRANTY; without even the implied warranty of
+% MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
+% GNU General Public License for more details.
+%
+% You should have received a copy of the GNU General Public License
+% along with this program; if not, write to the Free Software
+% Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+
+input metauml;
+
+beginfig(1);
+ save Test;
+ Class.Test("TestClass")("attribute1: int","attribute2: double")
+ ("oneLongMethod(): void",
+ "anotherLongMethod(): void");
+
+ Test.nw = (0,0);
+ Class_draw.Test;
+endfig;
+
+
+end
diff --git a/Master/texmf-dist/doc/metapost/metauml/manual/fig/class_diagrams.mp b/Master/texmf-dist/doc/metapost/metauml/manual/fig/class_diagrams.mp
new file mode 100644
index 00000000000..614cdbeca60
--- /dev/null
+++ b/Master/texmf-dist/doc/metapost/metauml/manual/fig/class_diagrams.mp
@@ -0,0 +1,212 @@
+% Part of the MetaUML manual.
+% Copyright (C) 2005 Ovidiu Gheorghies
+%
+% This program is free software; you can redistribute it and/or
+% modify it under the terms of the GNU General Public License
+% as published by the Free Software Foundation; either version 2
+% of the License, or (at your option) any later version.
+%
+% This program is distributed in the hope that it will be useful,
+% but WITHOUT ANY WARRANTY; without even the implied warranty of
+% MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
+% GNU General Public License for more details.
+%
+% You should have received a copy of the GNU General Public License
+% along with this program; if not, write to the Free Software
+% Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+
+input metauml;
+
+beginfig(1);
+ Class.Count("Count")
+ ("#n: int")
+ ("+increase(): void",
+ "+get(): int");
+
+ %Count.nw = (0,0);
+ drawObject(Count);
+ %Class_draw.Count;
+endfig;
+
+beginfig(2);
+ Class.A("Point")
+ ("+x: int",
+ "+y: int") ();
+
+ Class.B("Circle")
+ ("radius: int")
+ ("+getRadius(): int",
+ "+setRadius(r: int):void");
+
+ A.nw = (0,0);
+ B.n = A.s - (0,45);
+ Class_draw.A;
+ Class_draw.B;
+
+ drawRelation(aggregationUni)(A.s -- B.n);
+endfig;
+
+beginfig(3);
+ Class.Test("Test")("a1","a2","a3")("aLongMethod():void");
+
+ Test.nw = (0,0);
+ Class_draw.Test;
+
+ dotlabel.ulft(btex nw etex, Test.nw);
+ dotlabel.top(btex n etex, Test.n);
+ dotlabel.urt(btex ne etex, Test.ne);
+ dotlabel.rt(btex e etex, Test.e);
+ dotlabel.lrt(btex se etex, Test.se);
+ dotlabel.bot(btex s etex, Test.s);
+ dotlabel.llft(btex sw etex, Test.sw);
+ dotlabel.lft(btex w etex, Test.w);
+
+ dotlabel.lft(btex c etex, Test.c);
+
+ draw Test.nw - (50,0) -- Test.ne + (10,0);
+ label.urt(btex top etex, Test.nw - (50,0));
+
+ draw Test.sw - (50,0) -- Test.se + (10,0);
+ label.lrt(btex bottom etex, Test.sw - (50,0));
+
+ draw Test.nw + (0,10) -- Test.sw - (0, 50);
+ label.bot(btex left etex, Test.sw - (0,50));
+
+ draw Test.ne + (0,10) -- Test.se - (0, 50);
+ label.bot(btex right etex, Test.se - (0,50));
+
+ drawarrow Test.nw - (25,0) -- Test.sw - (25,0);
+ label.lft(btex height etex, .5[Test.nw, Test.sw] - (25,0));
+
+ drawarrow Test.sw - (0,25) -- Test.se - (0,25);
+ label.bot(btex width etex, .5[Test.sw, Test.se] - (0,25));
+endfig;
+
+%newAssociationDescription.association;
+%newAssociationUniDescription.associationUni;
+%newInheritanceDescription.inheritance;
+%newAggregationDescription.aggregation;
+%newAggregationUniDescription.aggregationUni;
+%newCompositionDescription.composition;
+%newCompositionUniDescription.compositionUni;
+%newDashedLinkDescription.dashedLink;
+%newDependencyDescription.dependency;
+
+beginfig(4);
+ save X, Y;
+ Class.X("X")()();
+ Class.Y("Y")()();
+
+ X.nw = (0,0);
+ Y.w = X.e + (50,0);
+ Class_draw.X;
+ Class_draw.Y;
+
+ drawRelation(association)(X.e -- Y.w);
+endfig;
+
+beginfig(5);
+ save X, Y;
+ Class.X("X")()();
+ Class.Y("Y")()();
+
+ X.nw = (0,0);
+ Y.w = X.e + (50,0);
+ Class_draw.X;
+ Class_draw.Y;
+
+ drawRelation(associationUni)(X.e -- Y.w);
+endfig;
+
+beginfig(6);
+ save X, Y;
+ Class.X("X")()();
+ Class.Y("Y")()();
+
+ X.nw = (0,0);
+ Y.w = X.e + (50,0);
+ Class_draw.X;
+ Class_draw.Y;
+
+ drawRelation(inheritance)(X.e -- Y.w);
+endfig;
+
+beginfig(7);
+ save X, Y;
+ Class.X("X")()();
+ Class.Y("Y")()();
+
+ X.nw = (0,0);
+ Y.w = X.e + (50,0);
+ Class_draw.X;
+ Class_draw.Y;
+
+ drawRelation(aggregation)(X.e -- Y.w);
+endfig;
+
+beginfig(8);
+ save X, Y;
+ Class.X("X")()();
+ Class.Y("Y")()();
+
+ X.nw = (0,0);
+ Y.w = X.e + (50,0);
+ Class_draw.X;
+ Class_draw.Y;
+
+ drawRelation(aggregationUni)(X.e -- Y.w);
+endfig;
+
+beginfig(9);
+ save X, Y;
+ Class.X("X")()();
+ Class.Y("Y")()();
+
+ X.nw = (0,0);
+ Y.w = X.e + (50,0);
+ Class_draw.X;
+ Class_draw.Y;
+
+ drawRelation(composition)(X.e -- Y.w);
+endfig;
+
+beginfig(10);
+ save X, Y;
+ Class.X("X")()();
+ Class.Y("Y")()();
+
+ X.nw = (0,0);
+ Y.w = X.e + (50,0);
+ Class_draw.X;
+ Class_draw.Y;
+
+ drawRelation(compositionUni)(X.e -- Y.w);
+endfig;
+
+beginfig(11);
+ save X, Y;
+ Class.X("X")()();
+ Class.Y("Y")()();
+
+ X.nw = (0,0);
+ Y.w = X.e + (50,0);
+ Class_draw.X;
+ Class_draw.Y;
+
+ drawRelation(dependency)(X.e -- Y.w);
+endfig;
+
+beginfig(12);
+ save X, Y;
+ Class.X("X")()();
+ Class.Y("Y")()();
+
+ X.nw = (0,0);
+ Y.w = X.e + (50,0);
+ Class_draw.X;
+ Class_draw.Y;
+
+ drawRelation(realization)(X.e -- Y.w);
+endfig;
+
+end
diff --git a/Master/texmf-dist/doc/metapost/metauml/manual/fig/class_templates.mp b/Master/texmf-dist/doc/metapost/metauml/manual/fig/class_templates.mp
new file mode 100644
index 00000000000..bf89f9d3cda
--- /dev/null
+++ b/Master/texmf-dist/doc/metapost/metauml/manual/fig/class_templates.mp
@@ -0,0 +1,29 @@
+% Part of the MetaUML manual.
+% Copyright (C) 2005 Ovidiu Gheorghies
+%
+% This program is free software; you can redistribute it and/or
+% modify it under the terms of the GNU General Public License
+% as published by the Free Software Foundation; either version 2
+% of the License, or (at your option) any later version.
+%
+% This program is distributed in the hope that it will be useful,
+% but WITHOUT ANY WARRANTY; without even the implied warranty of
+% MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
+% GNU General Public License for more details.
+%
+% You should have received a copy of the GNU General Public License
+% along with this program; if not, write to the Free Software
+% Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+
+input metauml;
+
+beginfig(1);
+ Class.V("Vector")("elements: T(n)")();
+ Template.T("T", "n: int");
+ Template_attachToClass.T(V);
+
+ drawObjects(V);
+ drawObjects(T);
+endfig;
+
+end
diff --git a/Master/texmf-dist/doc/metapost/metauml/manual/fig/component.mp b/Master/texmf-dist/doc/metapost/metauml/manual/fig/component.mp
new file mode 100644
index 00000000000..da46c9d3465
--- /dev/null
+++ b/Master/texmf-dist/doc/metapost/metauml/manual/fig/component.mp
@@ -0,0 +1,61 @@
+input metauml;
+
+beginfig(1);
+ Component.C("Business Logic")();
+ drawObject(C);
+endfig;
+
+beginfig(2);
+ save A, B, C, BigC;
+
+ Class.A("A")()();
+ Package.B("B")();
+ Component.C("C")();
+
+ Component.BigC("Big Component")(A, B, C);
+
+ leftToRight(10)(A, B);
+ topToBottom(10)(A, C);
+
+ drawObject(BigC);
+endfig;
+
+beginfig(3);
+ save A, B;
+ Component.A("A")();
+ Component.B("B")();
+
+ leftToRight(80)(A, B);
+
+ drawObjects(A, B);
+
+ link(providedInterface)( A.e -- .5[A.e, B.w] );
+endfig;
+
+beginfig(4);
+ save A, B;
+ Component.A("A")();
+ Component.B("B")();
+
+ leftToRight(80)(A, B);
+
+ drawObjects(A, B);
+
+ link(requiredInterface)( B.w -- .5[A.e, B.w]);
+endfig;
+
+beginfig(5);
+ save A, B;
+ Component.A("A")();
+ Component.B("B")();
+
+ leftToRight(80)(A, B);
+
+ drawObjects(A, B);
+
+ link(providedInterface)( A.e -- .5[A.e, B.w] );
+ link(requiredInterface)( B.w -- .5[A.e, B.w] );
+endfig;
+
+
+end
diff --git a/Master/texmf-dist/doc/metapost/metauml/manual/fig/group.mp b/Master/texmf-dist/doc/metapost/metauml/manual/fig/group.mp
new file mode 100644
index 00000000000..0e25e58ea66
--- /dev/null
+++ b/Master/texmf-dist/doc/metapost/metauml/manual/fig/group.mp
@@ -0,0 +1,51 @@
+% Part of the MetaUML manual.
+% Copyright (C) 2005 Ovidiu Gheorghies
+%
+% This program is free software; you can redistribute it and/or
+% modify it under the terms of the GNU General Public License
+% as published by the Free Software Foundation; either version 2
+% of the License, or (at your option) any later version.
+%
+% This program is distributed in the hope that it will be useful,
+% but WITHOUT ANY WARRANTY; without even the implied warranty of
+% MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
+% GNU General Public License for more details.
+%
+% You should have received a copy of the GNU General Public License
+% along with this program; if not, write to the Free Software
+% Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+
+input boxes;
+input util_commons;
+input util_object;
+input util_picture;
+input util_margins;
+input util_group;
+
+beginfig(1);
+ iGroup.left:=20;
+ iGroup.right:=15;
+ iGroup.boxed:=1;
+ iPict.boxed:=1;
+
+ Picture.a("yummy");
+ Picture.b("cool");
+ Picture.c("fool");
+
+ a.nw = (0,0);
+ b.nw = (20,20);
+ c.nw = (15, 40);
+
+ Group.g(a, b, c);
+
+ drawObjects(g);
+endfig;
+
+beginfig(2);
+endfig;
+
+beginfig(3);
+endfig;
+
+
+end
diff --git a/Master/texmf-dist/doc/metapost/metauml/manual/fig/how-links-work.mp b/Master/texmf-dist/doc/metapost/metauml/manual/fig/how-links-work.mp
new file mode 100644
index 00000000000..c8d8500358d
--- /dev/null
+++ b/Master/texmf-dist/doc/metapost/metauml/manual/fig/how-links-work.mp
@@ -0,0 +1,38 @@
+% Part of the MetaUML manual.
+% Copyright (C) 2005 Ovidiu Gheorghies
+%
+% This program is free software; you can redistribute it and/or
+% modify it under the terms of the GNU General Public License
+% as published by the Free Software Foundation; either version 2
+% of the License, or (at your option) any later version.
+%
+% This program is distributed in the hope that it will be useful,
+% but WITHOUT ANY WARRANTY; without even the implied warranty of
+% MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
+% GNU General Public License for more details.
+%
+% You should have received a copy of the GNU General Public License
+% along with this program; if not, write to the Free Software
+% Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+
+input metauml;
+
+beginfig(1);
+ drawRelation(aggregationUni)
+ ((0,0)--(40,0));
+endfig;
+
+
+beginfig(2);
+ path myPath;
+ myPath := (0,0) -- (100,0);
+ LinkStructure.ls(myPath,
+ aggregationUni.widthA,
+ aggregationUni.widthB);
+
+ describeLinkStructure(ls);
+ drawLinkStructure(ls)(aggregationUni);
+endfig;
+
+end
+
diff --git a/Master/texmf-dist/doc/metapost/metauml/manual/fig/instance.mp b/Master/texmf-dist/doc/metapost/metauml/manual/fig/instance.mp
new file mode 100644
index 00000000000..9417224306a
--- /dev/null
+++ b/Master/texmf-dist/doc/metapost/metauml/manual/fig/instance.mp
@@ -0,0 +1,9 @@
+input metauml;
+
+beginfig(1);
+ Instance.order("o: Order")
+ ("name='book'", "{placed}", "{payed}");
+ drawObject(order);
+endfig;
+
+end \ No newline at end of file
diff --git a/Master/texmf-dist/doc/metapost/metauml/manual/fig/mptextmp.mp b/Master/texmf-dist/doc/metapost/metauml/manual/fig/mptextmp.mp
new file mode 100644
index 00000000000..3e16f83e564
--- /dev/null
+++ b/Master/texmf-dist/doc/metapost/metauml/manual/fig/mptextmp.mp
@@ -0,0 +1 @@
+btex But this is insane: $\sum_1^3 f(x) \over x$! etex
diff --git a/Master/texmf-dist/doc/metapost/metauml/manual/fig/note.mp b/Master/texmf-dist/doc/metapost/metauml/manual/fig/note.mp
new file mode 100644
index 00000000000..f04a5b5e4fe
--- /dev/null
+++ b/Master/texmf-dist/doc/metapost/metauml/manual/fig/note.mp
@@ -0,0 +1,74 @@
+% Part of the MetaUML manual.
+% Copyright (C) 2005 Ovidiu Gheorghies
+%
+% This program is free software; you can redistribute it and/or
+% modify it under the terms of the GNU General Public License
+% as published by the Free Software Foundation; either version 2
+% of the License, or (at your option) any later version.
+%
+% This program is distributed in the hope that it will be useful,
+% but WITHOUT ANY WARRANTY; without even the implied warranty of
+% MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
+% GNU General Public License for more details.
+%
+% You should have received a copy of the GNU General Public License
+% along with this program; if not, write to the Free Software
+% Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+
+input metauml;
+input TEX;
+
+beginfig(1);
+ Note.A("This note", "has two lines.");
+ drawObject(A);
+endfig;
+
+beginfig(2);
+ save A, C;
+ Note.A("This is a class");
+ Class.C("Object")()();
+
+ A.sw = C.ne + (20, 20);
+
+ drawObjects(A, C);
+
+ clink(dashedLink)(A, C);
+endfig;
+
+beginfig(3);
+ save C;
+ Note.nA("This is the class name");
+ Note.nB("This is a key attribute");
+ Note.nC("This is a nice method");
+
+ Class.C("Object")("+id:int")
+ ("+clone()", "+serialize()");
+
+ topToBottom.left(10)(nA, nB, nC);
+ leftToRight(10)(C, nB);
+
+ drawObjects(C, nA, nB, nC);
+
+ clink(dashedLink)(C.namePict, nA);
+ clink(dashedLink)(C.attributeStack.pict[0], nB);
+ clink(dashedLink)(C.methodStack.pict[1], nC);
+endfig;
+
+beginfig(4);
+ save A;
+ Note.A("This class implements the formula:",
+ TEX("$\sum_1^n f(x)\cdot dx$"));
+ drawObjects(A);
+endfig;
+
+beginfig(5);
+ save A;
+ Note.A("Can you do it?",
+ TEX("$\sum_1^n f(x) \cdot dx " &
+ "\over \sum_1^m g(y) \cdot dy$"));
+ A.stack.info.spacing := 30;
+ A.stack.pict[1].info.ignoreNegativeBase := 0;
+ drawObjects(A);
+endfig;
+
+end
diff --git a/Master/texmf-dist/doc/metapost/metauml/manual/fig/object_stack.mp b/Master/texmf-dist/doc/metapost/metauml/manual/fig/object_stack.mp
new file mode 100644
index 00000000000..b9cd4d32b34
--- /dev/null
+++ b/Master/texmf-dist/doc/metapost/metauml/manual/fig/object_stack.mp
@@ -0,0 +1,46 @@
+% Part of the MetaUML manual.
+% Copyright (C) 2005 Ovidiu Gheorghies
+%
+% This program is free software; you can redistribute it and/or
+% modify it under the terms of the GNU General Public License
+% as published by the Free Software Foundation; either version 2
+% of the License, or (at your option) any later version.
+%
+% This program is distributed in the hope that it will be useful,
+% but WITHOUT ANY WARRANTY; without even the implied warranty of
+% MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
+% GNU General Public License for more details.
+%
+% You should have received a copy of the GNU General Public License
+% along with this program; if not, write to the Free Software
+% Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+
+input boxes;
+input util_commons;
+input util_object;
+input util_picture;
+
+
+beginfig(1);
+ iPict.ignoreNegativeBase := 1;
+ iPict.boxed := 1;
+ Picture.a0("yummy");
+ Picture.a1("cool");
+ Picture.a2("fool");
+
+ a0.nw = (0,0);
+ setObjectJoin(pa.sw = pb.nw);
+
+ joinObjects(scantokens listArray(a)(3));
+ drawObjects(scantokens listArray(a)(3));
+
+endfig;
+
+beginfig(2);
+endfig;
+
+beginfig(3);
+endfig;
+
+
+end
diff --git a/Master/texmf-dist/doc/metapost/metauml/manual/fig/package.mp b/Master/texmf-dist/doc/metapost/metauml/manual/fig/package.mp
new file mode 100644
index 00000000000..88653b5fee0
--- /dev/null
+++ b/Master/texmf-dist/doc/metapost/metauml/manual/fig/package.mp
@@ -0,0 +1,93 @@
+input metauml;
+input metauml_package;
+input metauml_package_relations;
+
+beginfig(1);
+ Package.P("java.lang")();
+ drawObject(P);
+endfig;
+
+beginfig(2);
+ save P;
+ Package.P("An important", "package")();
+ drawObject(P);
+endfig;
+
+beginfig(3);
+ save P;
+ Package.P("java.lang")();
+ P.info.forceEmptyContent := 1;
+ drawObject(P);
+endfig;
+
+beginfig(4);
+ save P, A, B;
+ Class.A("A")()();
+ Class.B("B")()();
+ Package.P("net.metauml")(A, B);
+
+ leftToRight(10)(A, B);
+
+ drawObject(P);
+endfig;
+
+beginfig(5);
+ Package.X("X")();
+ Package.Y("Y")();
+
+ leftToRight(50)(X, Y);
+ drawObjects(X, Y);
+
+ link(nest)(X.e -- Y.w);
+endfig;
+
+beginfig(8);
+ Package.emptyPackage("")();
+
+ Package.nameOnlyPackage("java.sun.com")();
+
+ Class.oneClass("A class")()();
+ Package.oneClassPackage("One class package")(oneClass);
+
+ Instance.oneInstance("An instance")();
+ State.oneState("A state")();
+ Activity.oneActivity("An activity");
+ Package.multiPackage("Multipackage")(oneInstance, oneState, oneActivity);
+
+ Package.allPackage("This package contains them all")(emptyPackage, nameOnlyPackage,
+ oneClassPackage, multiPackage);
+
+ nameOnlyPackage.nw = emptyPackage.ne + (30, 0);
+ oneClassPackage.ne = emptyPackage.s - (0, 50);
+
+ multiPackage.top = oneClassPackage.top;
+ multiPackage.left = oneClassPackage.right + 20;
+
+ centered_align_top(oneState, oneActivity)(10, below(oneInstance.s, 20));
+
+ drawObjects(allPackage);
+endfig;
+
+beginfig(8);
+ Package.nameOnlyOnTopPackage("Name on top")();
+ nameOnlyOnTopPackage.info.forceEmptyContent := 1;
+ Package.nameOnlyInMiddlePackage("By default name", "is in the middle")();
+
+ Class.cl("A class")("Attribute")("Method");
+ Package.notEmptyPackage("Contains class")(cl);
+
+ nameOnlyInMiddlePackage.n = nameOnlyOnTopPackage.s - (0, 40);
+ notEmptyPackage.w = nameOnlyInMiddlePackage.e + (80, 0);
+ drawObjects(nameOnlyOnTopPackage, nameOnlyInMiddlePackage, notEmptyPackage);
+
+ %link(import)(pathStepX(notEmptyPackage.w, nameOnlyOnTopPackage.e, -30));
+ %link(import)(pathVertical(nameOnlyInMiddlePackage.ne - (10, 0), nameOnlyOnTopPackage.bottom));
+ %link(import)(notEmptyPackage.sw -- nameOnlyInMiddlePackage.ne);
+endfig;
+
+beginfig(8);
+ link(nest)((10,10)--(30,30));
+endfig;
+
+
+end \ No newline at end of file
diff --git a/Master/texmf-dist/doc/metapost/metauml/manual/fig/paths.mp b/Master/texmf-dist/doc/metapost/metauml/manual/fig/paths.mp
new file mode 100644
index 00000000000..06ca5761209
--- /dev/null
+++ b/Master/texmf-dist/doc/metapost/metauml/manual/fig/paths.mp
@@ -0,0 +1,132 @@
+% Part of the MetaUML manual.
+% Copyright (C) 2005 Ovidiu Gheorghies
+%
+% This program is free software; you can redistribute it and/or
+% modify it under the terms of the GNU General Public License
+% as published by the Free Software Foundation; either version 2
+% of the License, or (at your option) any later version.
+%
+% This program is distributed in the hope that it will be useful,
+% but WITHOUT ANY WARRANTY; without even the implied warranty of
+% MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
+% GNU General Public License for more details.
+%
+% You should have received a copy of the GNU General Public License
+% along with this program; if not, write to the Free Software
+% Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+
+input metauml;
+
+beginfig(1);
+ pair za, zb;
+ za = (10,10);
+ zb = (10,-5);
+ path cool;
+ cool := za .. za+(20,10) ..
+ zb+(20,-20) ..
+ zb+(-10,-30) -- zb;
+ link(aggregationUni)(cool);
+endfig;
+
+beginfig(2);
+ save A, B;
+ Class.A("A")()();
+ Class.B("B")()();
+
+ B.sw = A.ne + (10,10);
+
+ drawObjects(A, B);
+
+ link(aggregationUni)
+ (rpathManhattanX(A.e, B.s));
+ link(inheritance)
+ (pathManhattanY(A.n, B.w));
+endfig;
+
+beginfig(3);
+ save A, B;
+ Class.A("A")()();
+ Class.B("B")()();
+
+ B.sw = A.ne + (10,10);
+
+ drawObjects(A, B);
+
+ stepX:=60;
+ link(aggregationUni)
+ (pathStepX(A.e, B.e, stepX));
+
+ stepY:=20;
+ link(inheritance)
+ (pathStepY(B.n, A.n, stepY));
+
+ pair X,Y;
+ X := A.se + (0,-30);
+ Y := X + (stepX, 0);
+ draw A.se -- X dashed evenly;
+ draw (xpart Y, ypart A.e) -- Y dashed evenly;
+ drawdblarrow X + (0,15) -- Y + (0,15);
+ label.top(btex stepX etex, .5[X,Y]);
+
+ pair X,Y;
+ X := B.n + (-70,-0);
+ Y := X + (0, stepY);
+
+ draw B.n -- X dashed evenly;
+ draw B.n + (0,stepY) -- Y dashed evenly;
+ drawdblarrow X + (15,0) -- Y + (15,0);
+ label.lft(btex stepY etex, .5[X,Y]);
+endfig;
+
+% horizontal, vertical
+beginfig(4);
+ save A, B;
+ Class.A("A")()();
+ Class.B("B")("b")();
+ Class.C("C")("foo: int")();
+
+ B.sw = A.se + (30,5);
+ C.sw = A.nw + (0, 30);
+
+ drawObjects(A, B, C);
+
+ untilX := B.left;
+ drawRelation(association)
+ (pathHorizontal(A.e, untilX));
+
+ draw B.nw -- B.sw + (0,-10) dashed evenly;
+ label.bot(btex untilX etex, B.sw + (0,-10));
+
+ untilY:= C.bottom;
+ drawRelation(association)(pathVertical(A.n, untilY));
+
+ draw C.sw -- C.sw + (-20,0) dashed evenly;
+ label.lft(btex untilY etex, C.sw + (-20,-0));
+
+endfig;
+
+beginfig(5);
+ save A,B;
+ Activity.A("A");
+ Activity.B("B");
+
+ B.nw = A.ne + (40,30);
+ drawObjects(A,B);
+
+ z = A.se + (30, -10);
+ link(transition)(pathCut(A, B)
+ (A.c -- z -- B.c));
+endfig;
+
+beginfig(6);
+ save A,B;
+ Class.A("A")()();
+ Class.B("B")()();
+
+ B.nw = A.ne + (20,30);
+ drawObjects(A,B);
+
+ clink(inheritance)(A, B);
+endfig;
+
+end
diff --git a/Master/texmf-dist/doc/metapost/metauml/manual/fig/paths_man.mp b/Master/texmf-dist/doc/metapost/metauml/manual/fig/paths_man.mp
new file mode 100644
index 00000000000..a6c502f147b
--- /dev/null
+++ b/Master/texmf-dist/doc/metapost/metauml/manual/fig/paths_man.mp
@@ -0,0 +1,143 @@
+% Part of the MetaUML manual.
+% Copyright (C) 2005 Ovidiu Gheorghies
+%
+% This program is free software; you can redistribute it and/or
+% modify it under the terms of the GNU General Public License
+% as published by the Free Software Foundation; either version 2
+% of the License, or (at your option) any later version.
+%
+% This program is distributed in the hope that it will be useful,
+% but WITHOUT ANY WARRANTY; without even the implied warranty of
+% MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
+% GNU General Public License for more details.
+%
+% You should have received a copy of the GNU General Public License
+% along with this program; if not, write to the Free Software
+% Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+
+input metauml;
+
+beginfig(1);
+ save A, B;
+ Class.A("A")("foo:int")("bar()");
+ Class.B("B")()();
+
+ A.nw = (0,0);
+ B.s = A.ne + (30,30);
+
+ Class_draw.A;
+ Class_draw.B;
+
+ drawRelation(aggregationUni)
+ (A.n ..(30,30)..B.w);
+ path cool;
+ cool := A.e .. A.e+(20,10) ..
+ B.s+(20,-40) .. B.s+(-10,-30)
+ -- B.s;
+ drawRelation(inheritance)(cool);
+endfig;
+
+beginfig(2);
+ save A, B;
+ Class.A("A")()();
+ Class.B("B")()();
+
+ A.nw = (0,0);
+ B.sw = A.ne + (10,10);
+
+ Class_draw.A;
+ Class_draw.B;
+
+ drawRelation(aggregationUni)
+ (pathManhattanX(A.e, B.s));
+ drawRelation(inheritance)
+ (pathManhattanY(A.n, B.w));
+endfig;
+
+beginfig(3);
+ save A, B;
+ Class.A("A")()();
+ Class.B("B")()();
+
+ A.nw = (0,0);
+ B.sw = A.ne + (10,10);
+
+ Class_draw.A;
+ Class_draw.B;
+
+ stepX:=60;
+ drawRelation(aggregationUni)
+ (pathStepX(A.e, B.e, stepX));
+
+ stepY:=20;
+ drawRelation(inheritance)
+ (pathStepY(B.n, A.n, stepY));
+
+ pair X,Y;
+ X := A.se + (0,-30);
+ Y := X + (stepX, 0);
+ draw A.se -- X dashed evenly;
+ draw (xpart Y, ypart A.e) -- Y dashed evenly;
+ drawdblarrow X + (0,15) -- Y + (0,15);
+ label.top(btex stepX etex, .5[X,Y]);
+
+ pair X,Y;
+ X := B.n + (-70,-0);
+ Y := X + (0, stepY);
+
+ draw B.n -- X dashed evenly;
+ draw B.n + (0,stepY) -- Y dashed evenly;
+ drawdblarrow X + (15,0) -- Y + (15,0);
+ label.lft(btex stepY etex, .5[X,Y]);
+endfig;
+
+beginfig(4);
+ save A, B;
+ Class.A("A")()();
+ Class.B("B")("a")();
+
+ A.nw = (0,0);
+ B.sw = A.se + (30,5);
+
+ Class_draw.A;
+ Class_draw.B;
+
+ untilX := B.left;
+ drawRelation(association)
+ (pathHorizontal(A.e, untilX));
+
+ draw B.nw -- B.sw + (0,-10) dashed evenly;
+ label.bot(btex untilX etex, B.sw + (0,-10));
+endfig;
+
+beginfig(5);
+ save A, B;
+ Class.A("A")()();
+ Class.B("B")("a")("foo()");
+
+ A.nw = (0,0);
+ B.sw = A.ne + (-20,20);
+
+ Class_draw.A;
+ Class_draw.B;
+
+ untilY:= B.bottom;
+ drawRelation(association)
+ (pathVertical(A.n, untilY));
+
+ draw B.sw -- B.sw + (-20,0) dashed evenly;
+ label.lft(btex untilY etex, B.sw + (-20,-0));
+endfig;
+
+beginfig(6);
+ save A,B;
+ Class.A("A")()();
+ Class.B("B")()();
+
+ B.nw = A.ne + (40,30);
+ drawObjects(A,B);
+
+ link(inheritance)(pathCut(A,B)(A.c -- B.c));
+endfig;
+
+end
diff --git a/Master/texmf-dist/doc/metapost/metauml/manual/fig/picture_info.mp b/Master/texmf-dist/doc/metapost/metauml/manual/fig/picture_info.mp
new file mode 100644
index 00000000000..df3b10145f2
--- /dev/null
+++ b/Master/texmf-dist/doc/metapost/metauml/manual/fig/picture_info.mp
@@ -0,0 +1,86 @@
+% Part of the MetaUML manual.
+% Copyright (C) 2005 Ovidiu Gheorghies
+%
+% This program is free software; you can redistribute it and/or
+% modify it under the terms of the GNU General Public License
+% as published by the Free Software Foundation; either version 2
+% of the License, or (at your option) any later version.
+%
+% This program is distributed in the hope that it will be useful,
+% but WITHOUT ANY WARRANTY; without even the implied warranty of
+% MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
+% GNU General Public License for more details.
+%
+% You should have received a copy of the GNU General Public License
+% along with this program; if not, write to the Free Software
+% Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+
+input boxes;
+input util_commons;
+input util_object;
+input util_picture;
+input util_positioning;
+
+PictureInfoCopy.iBig(iPict);
+iBig.left := iBig.right := 20;
+iBig.top := 10;
+iBig.bottom := 1;
+iBig.boxed := 1;
+iBig.ignoreNegativeBase := 1;
+iBig.iFont.name := defaultfont;
+iBig.iFont.scale := 3;
+
+PictureInfoCopy.iSmall(iPict);
+iSmall.boxed := 1;
+iSmall.borderColor := green;
+
+beginfig(1);
+ EPicture.a(iBig)("yummy");
+ EPicture.b(iSmall)("cool");
+% you can still modify a.info
+% and b.info if you wish.
+
+ a.nw = (0,0);
+ b.nw = a.sw + (0,-10);
+
+ drawObjects(a, b)
+endfig;
+
+beginfig(2);
+ save a, b, c, myFixed;
+ PictureInfoCopy.myFixed(iPict);
+ myFixed.ignoreNegativeBase := 1;
+ myFixed.fixedWidth := 15;
+ myFixed.fixedHeight := 20;
+ myFixed.boxed := 1;
+
+ EPicture.a(myFixed)("a");
+ EPicture.b(myFixed)(".-.");
+ EPicture.c(myFixed)("toolong");
+
+ leftToRight.bottom(10)(a, b, c);
+
+ drawObjects(a, b, c);
+endfig;
+
+beginfig(3);
+ save a, b, c, myFixed;
+ PictureInfoCopy.myFixed(iPict);
+ myFixed.ignoreNegativeBase := 1;
+ myFixed.bottom := 4.5;
+ myFixed.valign := "bottom";
+ myFixed.halign := "center";
+ myFixed.fixedWidth := 25;
+ myFixed.fixedHeight := 15;
+ myFixed.boxed := 1;
+
+ EPicture.a(myFixed)("a");
+ EPicture.b(myFixed)("yum");
+ EPicture.c(myFixed)("b");
+
+ leftToRight.bottom(10)(a, b, c);
+
+ drawObjects(a, b, c);
+endfig;
+
+end
diff --git a/Master/texmf-dist/doc/metapost/metauml/manual/fig/picture_stack.mp b/Master/texmf-dist/doc/metapost/metauml/manual/fig/picture_stack.mp
new file mode 100644
index 00000000000..ee6e09104b7
--- /dev/null
+++ b/Master/texmf-dist/doc/metapost/metauml/manual/fig/picture_stack.mp
@@ -0,0 +1,44 @@
+% Part of the MetaUML manual.
+% Copyright (C) 2005 Ovidiu Gheorghies
+%
+% This program is free software; you can redistribute it and/or
+% modify it under the terms of the GNU General Public License
+% as published by the Free Software Foundation; either version 2
+% of the License, or (at your option) any later version.
+%
+% This program is distributed in the hope that it will be useful,
+% but WITHOUT ANY WARRANTY; without even the implied warranty of
+% MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
+% GNU General Public License for more details.
+%
+% You should have received a copy of the GNU General Public License
+% along with this program; if not, write to the Free Software
+% Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+
+input boxes;
+input util_commons;
+input util_object;
+input util_picture;
+input util_group;
+input util_picture_stack;
+
+beginfig(1);
+ iStack.boxed := 1;
+ iStack.iPict.boxed := 1;
+ PictureStack.myStack("foo",
+ "bar: int" infont "tyxtt",
+ "cool-man-centered" infont defaultfont,
+ "nice")("vcenter");
+
+ myStack.nw = (0,0);
+ drawObject(myStack);
+endfig;
+
+beginfig(2);
+endfig;
+
+beginfig(3);
+endfig;
+
+
+end
diff --git a/Master/texmf-dist/doc/metapost/metauml/manual/fig/positioning.mp b/Master/texmf-dist/doc/metapost/metauml/manual/fig/positioning.mp
new file mode 100644
index 00000000000..f98de47182f
--- /dev/null
+++ b/Master/texmf-dist/doc/metapost/metauml/manual/fig/positioning.mp
@@ -0,0 +1,139 @@
+% Part of the MetaUML manual.
+% Copyright (C) 2005 Ovidiu Gheorghies
+%
+% This program is free software; you can redistribute it and/or
+% modify it under the terms of the GNU General Public License
+% as published by the Free Software Foundation; either version 2
+% of the License, or (at your option) any later version.
+%
+% This program is distributed in the hope that it will be useful,
+% but WITHOUT ANY WARRANTY; without even the implied warranty of
+% MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
+% GNU General Public License for more details.
+%
+% You should have received a copy of the GNU General Public License
+% along with this program; if not, write to the Free Software
+% Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+
+input metauml;
+
+beginfig(1);
+ Class.A("A")()();
+ Class.B("B")()();
+ Class.C("C")()();
+ Class.Base("Base")()();
+
+
+ A.ne = B.nw - (20,0);
+ B.ne = C.nw - (20,0);
+ Base.s = B.n + (0,20);
+
+ drawObjects(Base, A, B, C);
+endfig;
+
+beginfig(2);
+ save A, B, C, Base;
+
+ Class.A("A")()();
+ Class.B("B")()();
+ Class.C("C")()();
+ Class.Base("Base")()();
+
+ leftToRight(20)(A, B, C);
+ topToBottom(20)(Base, B);
+
+ drawObjects(Base, A, B, C);
+endfig;
+
+iPict.boxed := 1;
+spacing := 5;
+string strA, strB, strC;
+strA := "a";
+strB := "...";
+strC := "Cyan";
+
+beginfig(3);
+ save A, B, C, X, Y, Z;
+
+ Picture.X(strA);
+ Picture.Y(strB);
+ Picture.Z(strC);
+
+ leftToRight.top(spacing)(X, Y, Z);
+
+ drawObjects(X, Y, Z);
+
+ draw (X.left, X.top) -- (Z.right, X.top) dashed evenly withpen pencircle withcolor red;
+endfig;
+
+beginfig(4);
+ save A, B, C, X, Y, Z;
+
+ Picture.X(strA);
+ Picture.Y(strB);
+ Picture.Z(strC);
+
+ leftToRight.midy(spacing)(X, Y, Z);
+
+ drawObjects(X, Y, Z);
+
+ draw (X.left, X.midy) -- (Z.right, X.midy) dashed evenly withpen pencircle withcolor red;;
+endfig;
+
+beginfig(5);
+ save A, B, C, X, Y, Z;
+
+ Picture.X(strA);
+ Picture.Y(strB);
+ Picture.Z(strC);
+
+ leftToRight.bottom(spacing)(X, Y, Z);
+
+ drawObjects(X, Y, Z);
+
+ draw (X.left, X.bottom) -- (Z.right, X.bottom) dashed evenly withpen pencircle withcolor red;;
+endfig;
+
+beginfig(6);
+ save A, B, C, X, Y, Z;
+
+ Picture.X(strA);
+ Picture.Y(strB);
+ Picture.Z(strC);
+
+ topToBottom.left(spacing)(X, Y, Z);
+
+ drawObjects(X, Y, Z);
+
+ draw (X.left, X.top) -- (X.left, Z.bottom) dashed evenly withpen pencircle withcolor red;;
+endfig;
+
+beginfig(7);
+ save A, B, C, X, Y, Z;
+
+ Picture.X(strA);
+ Picture.Y(strB);
+ Picture.Z(strC);
+
+ topToBottom.midx(spacing)(X, Y, Z);
+
+ drawObjects(X, Y, Z);
+
+ draw (X.midx, X.top) -- (X.midx, Z.bottom) dashed evenly withpen pencircle withcolor red;;
+endfig;
+
+beginfig(8);
+ save A, B, C, X, Y, Z;
+
+ Picture.X(strA);
+ Picture.Y(strB);
+ Picture.Z(strC);
+
+ topToBottom.right(spacing)(X, Y, Z);
+
+ drawObjects(X, Y, Z);
+
+ draw (X.right, X.top) -- (X.right, Z.bottom) dashed evenly withpen pencircle withcolor red;;
+endfig;
+
+end
diff --git a/Master/texmf-dist/doc/metapost/metauml/manual/fig/properties.mp b/Master/texmf-dist/doc/metapost/metauml/manual/fig/properties.mp
new file mode 100644
index 00000000000..94f71d772ea
--- /dev/null
+++ b/Master/texmf-dist/doc/metapost/metauml/manual/fig/properties.mp
@@ -0,0 +1,58 @@
+% Sample MetaUML figures.
+% Copyright (C) 2005 Ovidiu Gheorghies
+%
+% This program is free software; you can redistribute it and/or
+% modify it under the terms of the GNU General Public License
+% as published by the Free Software Foundation; either version 2
+% of the License, or (at your option) any later version.
+%
+% This program is distributed in the hope that it will be useful,
+% but WITHOUT ANY WARRANTY; without even the implied warranty of
+% MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
+% GNU General Public License for more details.
+%
+% You should have received a copy of the GNU General Public License
+% along with this program; if not, write to the Free Software
+% Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+
+
+input metauml;
+
+beginfig(1);
+ Class.Test("Test")("a1","a2","a3")("aLongMethod():void");
+
+ Test.nw = (0,0);
+ Class_draw.Test;
+
+ dotlabel.ulft(btex nw etex, Test.nw);
+ dotlabel.top(btex n etex, Test.n);
+ dotlabel.urt(btex ne etex, Test.ne);
+ dotlabel.rt(btex e etex, Test.e);
+ dotlabel.lrt(btex se etex, Test.se);
+ dotlabel.bot(btex s etex, Test.s);
+ dotlabel.llft(btex sw etex, Test.sw);
+ dotlabel.lft(btex w etex, Test.w);
+
+ dotlabel.lft(btex c etex, Test.c);
+
+ draw Test.nw - (50,0) -- Test.ne + (10,0);
+ label.urt(btex top etex, Test.nw - (50,0));
+
+ draw Test.sw - (50,0) -- Test.se + (10,0);
+ label.lrt(btex bottom etex, Test.sw - (50,0));
+
+ draw Test.nw + (0,10) -- Test.sw - (0, 50);
+ label.bot(btex left etex, Test.sw - (0,50));
+
+ draw Test.ne + (0,10) -- Test.se - (0, 50);
+ label.bot(btex right etex, Test.se - (0,50));
+
+ drawarrow Test.nw - (25,0) -- Test.sw - (25,0);
+ label.lft(btex height etex, .5[Test.nw, Test.sw] - (25,0));
+
+ drawarrow Test.sw - (0,25) -- Test.se - (0,25);
+ label.bot(btex width etex, .5[Test.sw, Test.se] - (0,25));
+endfig;
+
+
+end
diff --git a/Master/texmf-dist/doc/metapost/metauml/manual/fig/state.mp b/Master/texmf-dist/doc/metapost/metauml/manual/fig/state.mp
new file mode 100644
index 00000000000..77c7691a9a2
--- /dev/null
+++ b/Master/texmf-dist/doc/metapost/metauml/manual/fig/state.mp
@@ -0,0 +1,55 @@
+% Sample MetaUML figures.
+% Copyright (C) 2005 Ovidiu Gheorghies
+%
+% This program is free software; you can redistribute it and/or
+% modify it under the terms of the GNU General Public License
+% as published by the Free Software Foundation; either version 2
+% of the License, or (at your option) any later version.
+%
+% This program is distributed in the hope that it will be useful,
+% but WITHOUT ANY WARRANTY; without even the implied warranty of
+% MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
+% GNU General Public License for more details.
+%
+% You should have received a copy of the GNU General Public License
+% along with this program; if not, write to the Free Software
+% Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+
+
+input metauml;
+
+beginfig(1);
+ State.s("Take order")();
+ drawObject(s);
+endfig;
+
+beginfig(2);
+ Begin.b;
+ End.e;
+ State.c("Component")();
+ State.composite("Composite")(b, e, c);
+
+ b.midx = e.midx = c.midx;
+ c.top = b.bottom - 20;
+ e.top = c.bottom - 20;
+
+ composite.info.drawNameLine := 1;
+ drawObject(composite);
+
+ link(transition)(b.s -- c.n);
+ link(transition)(c.s -- e.n);
+endfig;
+
+beginfig(3);
+ save s;
+ State.s("An interesting state",
+ "which is worth mentioning")();
+ stateTransitions.s(
+ "OnEntry / Open eyes",
+ "OnExit / Sleep well");
+ s.info.drawNameLine := 1;
+
+ drawObject(s);
+endfig;
+
+end
diff --git a/Master/texmf-dist/doc/metapost/metauml/manual/fig/statemachine_diagrams.mp b/Master/texmf-dist/doc/metapost/metauml/manual/fig/statemachine_diagrams.mp
new file mode 100644
index 00000000000..ff93a74dd5d
--- /dev/null
+++ b/Master/texmf-dist/doc/metapost/metauml/manual/fig/statemachine_diagrams.mp
@@ -0,0 +1,78 @@
+% Part of the MetaUML manual.
+% Copyright (C) 2005 Ovidiu Gheorghies
+%
+% This program is free software; you can redistribute it and/or
+% modify it under the terms of the GNU General Public License
+% as published by the Free Software Foundation; either version 2
+% of the License, or (at your option) any later version.
+%
+% This program is distributed in the hope that it will be useful,
+% but WITHOUT ANY WARRANTY; without even the implied warranty of
+% MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
+% GNU General Public License for more details.
+%
+% You should have received a copy of the GNU General Public License
+% along with this program; if not, write to the Free Software
+% Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+
+% for f in `find . | grep '.*\.[1-9]'`; do echo $f; done
+
+input metauml;
+
+beginfig(1);
+ Begin.b;
+ State.on("On")();
+ State.off("Off")();
+ End.e;
+
+ setObjectJoin(pb.w = pa.e + (20,0));
+ joinObjects(b, on, off, e);
+ drawObjects(b, on, off, e);
+
+ clink(transition)(b, on);
+ clink(transition)(on, off);
+ clink(transition)(off, e);
+endfig;
+
+beginfig(2);
+ save b, reading, processing, e, exit;
+
+ Begin.b;
+ State.reading("Commands read")();
+ State.processing("Processing commands")();
+ End.e;
+ setObjectJoin(pb.n = pa.s + (0, -20));
+ joinObjects(b, reading, processing, e);
+
+ State.composite("Work")(b, reading, processing, e);
+ drawObject(composite);
+
+ clink(transition)(b, reading);
+ clink(transition)(reading, processing);
+ clink(transition)(processing, e);
+
+ ExitPoint.exit;
+ exit.c=(composite.right, reading.midy);
+ drawObject(exit);
+ item(iAssoc)("error")(obj.nw = exit.s);
+
+ clink(transition)(reading, exit);
+
+ State.error("Prepare error report")();
+ State.result("Display result")();
+ End.theEnd;
+
+ error.midx = result.midx = theEnd.midx = composite.right + 90;
+ error.midy = exit.midy;
+ result.midy = processing.midy;
+ theEnd.midy = e.midy;
+ drawObjects(error, result, theEnd);
+
+ clink(transition)(exit, error);
+ clink(transition)(error, result);
+ clink(transition)(result, theEnd);
+
+ link(transition)(rpathHorizontal(result.w, composite.right));
+endfig;
+
+end
diff --git a/Master/texmf-dist/doc/metapost/metauml/manual/fig/test_activity.mp b/Master/texmf-dist/doc/metapost/metauml/manual/fig/test_activity.mp
new file mode 100644
index 00000000000..841bdb8a312
--- /dev/null
+++ b/Master/texmf-dist/doc/metapost/metauml/manual/fig/test_activity.mp
@@ -0,0 +1,46 @@
+% Part of the MetaUML manual.
+% Copyright (C) 2005 Ovidiu Gheorghies
+%
+% This program is free software; you can redistribute it and/or
+% modify it under the terms of the GNU General Public License
+% as published by the Free Software Foundation; either version 2
+% of the License, or (at your option) any later version.
+%
+% This program is distributed in the hope that it will be useful,
+% but WITHOUT ANY WARRANTY; without even the implied warranty of
+% MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
+% GNU General Public License for more details.
+%
+% You should have received a copy of the GNU General Public License
+% along with this program; if not, write to the Free Software
+% Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+
+input metauml;
+
+beginfig(1);
+ Begin.b;
+ End.e;
+
+ e.n = (30,30);
+ drawObject(b);
+ show "Object b drawn";
+ drawObject(e);
+
+ link(associationUni)(pathCut(b,e)(b.c--e.c));
+endfig;
+
+beginfig(2);
+ EActivity.act(iActivity)("go to school", "while singing");
+ drawObject(act);
+
+ Branch.br;
+ br.nw = (50,50);
+ drawObject(br);
+
+ Fork.fork("h",30);
+ fork.nw = (30,70);
+ drawObject(fork);
+endfig;
+
+end
+
diff --git a/Master/texmf-dist/doc/metapost/metauml/manual/fig/test_class.mp b/Master/texmf-dist/doc/metapost/metauml/manual/fig/test_class.mp
new file mode 100644
index 00000000000..94e1fdc130a
--- /dev/null
+++ b/Master/texmf-dist/doc/metapost/metauml/manual/fig/test_class.mp
@@ -0,0 +1,156 @@
+% Part of the MetaUML manual.
+% Copyright (C) 2005 Ovidiu Gheorghies
+%
+% This program is free software; you can redistribute it and/or
+% modify it under the terms of the GNU General Public License
+% as published by the Free Software Foundation; either version 2
+% of the License, or (at your option) any later version.
+%
+% This program is distributed in the hope that it will be useful,
+% but WITHOUT ANY WARRANTY; without even the implied warranty of
+% MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
+% GNU General Public License for more details.
+%
+% You should have received a copy of the GNU General Public License
+% along with this program; if not, write to the Free Software
+% Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+
+input metauml;
+
+beginfig(0);
+ show "Copying class info...";
+ ClassInfoCopy.foo(iClass);
+endfig;
+
+beginfig(1);
+ Class.A("A")()();
+ Class_setDebugMode.A;
+
+ A.nw=(0,0);
+ Class_draw.A;
+endfig;
+
+beginfig(2);
+ save B;
+ Class.B("B")("+ a:int")();
+ Class_setDebugMode.B;
+
+ B.nw=(0,0);
+ Class_draw.B;
+endfig;
+
+beginfig(3);
+ save C;
+ Class.C("C")("+ a-#~+:int", "- b-#~+:int", "- g-#~+:int", "~ c-#~+:int", "# g-#~+:double")();
+ Class_setDebugMode.C;
+
+ C.nw=(0,0);
+ Class_draw.C;
+endfig;
+
+beginfig(4);
+ save D;
+ Class.D("D")
+ ("+ a-#~+:int", "- b-#~+:int", "- g-#~+:int", "~ c-#~+:int", "# g-#~+:double")
+ ("+ a()-#~+:int", "- b()-#~+:int", "- g()-#~+:int", "~ c()-#~+:int", "# g()-#~+:double");
+ Class_setDebugMode.D;
+
+ D.nw=(0,0);
+ Class_draw.D;
+endfig;
+
+beginfig(5);
+ save P, Q;
+
+ Class.P("AAA")()();
+ Class_stereotypes.P("ooo", "home", "interface");
+ Class_setDebugMode.P;
+ P.nw=(0,0);
+ Class_draw.P;
+
+ Class.Q("AAA")()();
+ Class_stereotypes.Q("ooo", "home", "interface");
+ Q.nw=P.ne + (20,0);
+ Class_draw.Q;
+endfig;
+
+beginfig(6);
+ save A;
+
+ Class.A("User6")()();
+ Class_stereotypes.A("<<interface>>","<<home>>");
+ A.nw=(0,0);
+ drawObject(A);
+endfig;
+
+beginfig(7)
+ save A;
+ Class.A("User7")()();
+ A.info.iMethodStack.left := A.info.iMethodStack.right := 50;
+ A.info.iMethodStack.top := A.info.iMethodStack.bottom := 20;
+
+ drawObject(A);
+endfig;
+
+beginfig(8)
+ save inter;
+ EClass.inter(iInterface)("Observer")()("+update(src: Object)");
+ drawObjects(inter);
+endfig;
+
+beginfig(9)
+ save inter;
+ EInterface.inter(iInterface)("Observer")("+update(src: Object)");
+ drawObjects(inter);
+endfig;
+
+beginfig(10)
+ save inter;
+ Interface.inter("Observer")("+update(src: Object)");
+ drawObjects(inter);
+endfig;
+
+beginfig(11)
+ save A;
+ EClass.A(iAbstractClass)("AbstractClass")("[]{}")("+update(src: Object)");
+ drawObjects(A);
+endfig;
+
+beginfig(12)
+ save A;
+ AbstractClass.A("AbstractClass")("[]{}")("+update(src: Object)");
+ drawObjects(A);
+endfig;
+
+beginfig(13)
+ save A;
+ EClass.A(iClassNameOnly)("AClassWithNoCompartments")()();
+ drawObjects(A);
+endfig;
+
+beginfig(14)
+ save A;
+ ClassName.A("AnotherClass");
+ drawObjects(A);
+endfig;
+
+beginfig(15)
+ save A;
+ ClassName.A("AnotherClass");
+ classStereotypes.A("<<interface>>","<<remote>>");
+
+ drawObjects(A);
+endfig;
+
+beginfig(16);
+ save A, B, C;
+
+ Class.A("Foo")
+ ("+a: int", "-b: int", "#c: int", "d: int")
+ ("+x()", "-y()", "#z()", "t()");
+ Class_noVisibilityMarkers.A;
+
+ drawObjects(A);
+endfig;
+
+end
diff --git a/Master/texmf-dist/doc/metapost/metauml/manual/fig/test_class_feature_types.mp b/Master/texmf-dist/doc/metapost/metauml/manual/fig/test_class_feature_types.mp
new file mode 100644
index 00000000000..f35c0b7b685
--- /dev/null
+++ b/Master/texmf-dist/doc/metapost/metauml/manual/fig/test_class_feature_types.mp
@@ -0,0 +1,53 @@
+% Copyright 2015 Ovidiu Gheorghies
+% Licensed under the Apache License, Version 2.0.
+
+input metauml;
+
+beginfig(1);
+ if not metauml_private_isAbstract(abstract "foo"):
+ 1 = 2;
+ fi;
+
+ if metauml_private_isAbstract("@abstracp"):
+ 1 = 2;
+ fi;
+endfig;
+
+beginfig(2);
+ if not metauml_private_isStatic(static "bar"):
+ 1 = 2;
+ fi;
+
+ if metauml_private_isStatic("@statique"):
+ 1 = 2;
+ fi;
+endfig;
+
+beginfig(3);
+ Class.A("A")
+ ("+a:int+", static "+b:int")
+ ("+f+():int", static "+g+():int", abstract "+h():int");
+ Class_setDebugMode.A;
+ drawObjects(A);
+endfig;
+
+beginfig(4);
+ save A;
+ Class.A("A")
+ (static "-instanceCount:int")
+ (static "+getInstanceCount():int", abstract "+work()");
+ drawObjects(A);
+endfig;
+
+beginfig(5);
+ save A, B;
+ Class.A("A")()();
+ Class.B(abstract "B")()();
+ Class.C("C")()(abstract "foo()");
+
+ leftToRight(5)(A, B, C);
+
+ drawObjects(A, B, C);
+endfig;
+
+end
diff --git a/Master/texmf-dist/doc/metapost/metauml/manual/fig/test_class_qual_assoc.mp b/Master/texmf-dist/doc/metapost/metauml/manual/fig/test_class_qual_assoc.mp
new file mode 100644
index 00000000000..735bba19e0d
--- /dev/null
+++ b/Master/texmf-dist/doc/metapost/metauml/manual/fig/test_class_qual_assoc.mp
@@ -0,0 +1,53 @@
+% Part of the MetaUML manual.
+% Copyright (C) 2005 Ovidiu Gheorghies
+%
+% This program is free software; you can redistribute it and/or
+% modify it under the terms of the GNU General Public License
+% as published by the Free Software Foundation; either version 2
+% of the License, or (at your option) any later version.
+%
+% This program is distributed in the hope that it will be useful,
+% but WITHOUT ANY WARRANTY; without even the implied warranty of
+% MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
+% GNU General Public License for more details.
+%
+% You should have received a copy of the GNU General Public License
+% along with this program; if not, write to the Free Software
+% Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+
+input metauml;
+
+beginfig(1);
+ save P,qa;
+
+ Class.P("Person")()();
+ QualifiedAssociation.qa("accountNumber:int", "foo: id");
+
+ P.nw = (0,0);
+ qa.n = P.s;
+
+
+ P.info.iName.left := 35;
+ P.info.iName.right := 35;
+ drawObjects(P);
+
+ drawObject(qa);
+endfig;
+
+beginfig(2);
+ save P,qa;
+
+ Class.P("Person")()();
+ QualifiedAssociation.qa("accountNumber:int", "foo: id", "foolang");
+
+ P.nw = (0,0);
+ qa.w = P.e;
+
+ P.info.shade := 0;
+ P.info.iMethodStack.top := 20;
+ drawObjects(P);
+
+ drawObject(qa);
+endfig;
+
+end
diff --git a/Master/texmf-dist/doc/metapost/metauml/manual/fig/test_class_templates.mp b/Master/texmf-dist/doc/metapost/metauml/manual/fig/test_class_templates.mp
new file mode 100644
index 00000000000..c3fc50209c8
--- /dev/null
+++ b/Master/texmf-dist/doc/metapost/metauml/manual/fig/test_class_templates.mp
@@ -0,0 +1,62 @@
+% Part of the MetaUML manual.
+% Copyright (C) 2005 Ovidiu Gheorghies
+%
+% This program is free software; you can redistribute it and/or
+% modify it under the terms of the GNU General Public License
+% as published by the Free Software Foundation; either version 2
+% of the License, or (at your option) any later version.
+%
+% This program is distributed in the hope that it will be useful,
+% but WITHOUT ANY WARRANTY; without even the implied warranty of
+% MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
+% GNU General Public License for more details.
+%
+% You should have received a copy of the GNU General Public License
+% along with this program; if not, write to the Free Software
+% Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+
+input metauml;
+
+beginfig(1);
+ save P,template;
+
+ Class.P("Person")()();
+ Template.template("foo", "bar");
+
+ drawObjectAt(P)(P.nw=(0,0));
+
+ Template_attachToClass.template(P);
+ drawObject(template);
+endfig;
+
+beginfig(2);
+ save P,template;
+
+ Class.P("Person")()();
+ Template.template("foo: int");
+ Template_attachToClass.template(P);
+
+ drawObjectAt(P)(P.nw=(0,0));
+ drawObject(template);
+endfig;
+
+beginfig(3);
+ save CA, TA, CB, TB, CC, TC;
+ Class.CA("VeryVeryLongClassName")()();
+ ClassTemplate.TA("int foo")(CA);
+
+ Class.CB("Shortie")("abracadabra: long long int")();
+ ClassTemplate.TB("T")(CB);
+
+ Class.CC("Shortie")("abracadabra: long long int")();
+ ClassTemplate.TC("TrulyAmazingLongTypename")(CC);
+
+ CA.s = CB.n + (0,14);
+ CB.s = CC.n + (0,14);
+
+ drawObjects(CA, TA, CB, TB, CC, TC);
+endfig;
+
+
+
+end
diff --git a/Master/texmf-dist/doc/metapost/metauml/manual/fig/test_component.mp b/Master/texmf-dist/doc/metapost/metauml/manual/fig/test_component.mp
new file mode 100644
index 00000000000..94d866c7532
--- /dev/null
+++ b/Master/texmf-dist/doc/metapost/metauml/manual/fig/test_component.mp
@@ -0,0 +1,30 @@
+input metauml;
+input metauml_component;
+input metauml_component_relations;
+
+beginfig(1);
+ Class.classA("Class A")()();
+ Class.classB("Class B")()();
+
+ Component.compA("Component A")();
+ Component.compB("Component B")();
+ Component.compC("Component C")(compA, compB, classA, classB);
+
+ compB.w = compA.e + (40, 0);
+ classA.w = compB.e + (20, 0);
+ classB.w = classA.e + (20, 0);
+
+ drawObjects(compC);
+
+ path open;
+ open := compA.e .. compA.e + (20, 0);
+ path close;
+
+ close := compB.w .. compA.e + (20, 0);
+
+ link(requiredInterface)(open);
+
+ link(providedInterface)(close);
+endfig;
+
+end \ No newline at end of file
diff --git a/Master/texmf-dist/doc/metapost/metauml/manual/fig/test_font.mp b/Master/texmf-dist/doc/metapost/metauml/manual/fig/test_font.mp
new file mode 100644
index 00000000000..21e748a4f74
--- /dev/null
+++ b/Master/texmf-dist/doc/metapost/metauml/manual/fig/test_font.mp
@@ -0,0 +1,81 @@
+% Part of the MetaUML manual.
+% Copyright (C) 2005 Ovidiu Gheorghies
+%
+% This program is free software; you can redistribute it and/or
+% modify it under the terms of the GNU General Public License
+% as published by the Free Software Foundation; either version 2
+% of the License, or (at your option) any later version.
+%
+% This program is distributed in the hope that it will be useful,
+% but WITHOUT ANY WARRANTY; without even the implied warranty of
+% MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
+% GNU General Public License for more details.
+%
+% You should have received a copy of the GNU General Public License
+% along with this program; if not, write to the Free Software
+% Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+
+input metauml;
+
+string theFont;
+
+beginfig(1);
+ theFont := "pcrr";
+
+ boxjoin(a.sw=b.nw);
+
+ boxit.ff(("Font name: ( ) " & theFont) infont theFont);
+ boxit.s0("<<stereotype>> text with guillemets. ><>><<" infont theFont );
+ boxit.s1("<<a>>, <<b>>, <<c>>" infont theFont);
+ boxit.s2("[g uard] text with square brackets []]." infont theFont);
+ boxit.s3("{c onstraint} text with curly brackets {}}." infont theFont);
+
+ drawboxed(ff, s0, s1, s2, s3);
+endfig;
+
+beginfig(2);
+ save ff,s,g,c;
+ theFont := "tyxbtt";
+
+ boxjoin(a.sw=b.nw);
+
+ boxit.ff(("Font name: ( ) " & theFont) infont theFont);
+ boxit.s0("<<stereotype>> text with guillemets. ><>><<" infont theFont );
+ boxit.s1("<<a>>, <<b>>, <<c>>" infont theFont);
+ boxit.s2("[g uard] text with square brackets []]." infont theFont);
+ boxit.s3("{c onstraint} text with curly brackets {}}." infont theFont);
+
+ drawboxed(ff, s0, s1, s2, s3);endfig;
+
+beginfig(3);
+ picture pA, pB, pC;
+ string sA, sB, sC;
+ sA := "assembleElementLocalMatrix(k: KeyType, mat: LocalMatrixType, a: AssembleAction)";
+ sB := "assembleElementLocalMatri(k: KeyType, mat: LocalMatrixType, a: AssembleAction)";
+ sC := "assembleElntLocalMatri(k: KeyType, mat: LocalMatrixType, a: AssembleAction)";
+
+ pA := sA infont "tyxbtt";
+ pB := sB infont "tyxbtt";
+ pC := sC infont "tyxbtt";
+
+ draw pA;
+ draw pB shifted (0,-20);
+ draw pC shifted (0,-40);
+endfig;
+
+beginfig(4);
+ save ff,s,g,c;
+ theFont := "ptmr8r";
+
+ boxjoin(a.sw=b.nw);
+ boxit.ff(("Font name: ( ) " & theFont) infont theFont);
+
+ boxit.s0("<<stereotype>> text with guillemets. ><>><<" infont theFont );
+ boxit.s1("<<a>>, <<b>>, <<c>>" infont theFont);
+ boxit.s2("[g uard] text with square brackets []]." infont theFont);
+ boxit.s3("{c onstraint} text with curly brackets {}}." infont theFont);
+
+ drawboxed(ff, s0, s1, s2, s3);
+endfig;
+
+end
diff --git a/Master/texmf-dist/doc/metapost/metauml/manual/fig/test_group.mp b/Master/texmf-dist/doc/metapost/metauml/manual/fig/test_group.mp
new file mode 100644
index 00000000000..17265c458b2
--- /dev/null
+++ b/Master/texmf-dist/doc/metapost/metauml/manual/fig/test_group.mp
@@ -0,0 +1,60 @@
+% Part of the MetaUML manual.
+% Copyright (C) 2005 Ovidiu Gheorghies
+%
+% This program is free software; you can redistribute it and/or
+% modify it under the terms of the GNU General Public License
+% as published by the Free Software Foundation; either version 2
+% of the License, or (at your option) any later version.
+%
+% This program is distributed in the hope that it will be useful,
+% but WITHOUT ANY WARRANTY; without even the implied warranty of
+% MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
+% GNU General Public License for more details.
+%
+% You should have received a copy of the GNU General Public License
+% along with this program; if not, write to the Free Software
+% Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+
+input metauml;
+
+beginfig(1);
+ save p,q,r,t,g;
+
+ EPicture.p(iPictBoxed)("p0");
+ EPicture.q(iPictBoxed)("p1");
+ p.se = q.nw;
+
+ string f;
+ f= enumToString(p,q)("");
+ show "f=" & f;
+
+ EGroup.g(iGroup)(p,q);
+ g.nw = (0,0);
+
+ drawObject(g);
+endfig;
+
+beginfig(2);
+ save g,h,p,gg;
+
+ Group.g();
+ g.info.boxed := 1;
+ g.nw = (30,30);
+ drawObject(g);
+
+ Picture.p("Test picture in group");
+ p.info.boxed := 1;
+ Group.h(p);
+ h.info.boxed := 1;
+ h.nw = (0,0);
+ drawObject(h);
+
+ Picture.v0("s"); v0.info.boxed := 1;
+ Picture.v1("s"); v1.info.boxed := 1;
+ v1.nw = v0.se + (10,10);
+ Group.gg(v0, v1); gg.info.boxed := 1;
+ gg.nw = (70,70);
+ drawObject(gg);
+endfig;
+
+end
diff --git a/Master/texmf-dist/doc/metapost/metauml/manual/fig/test_instance.mp b/Master/texmf-dist/doc/metapost/metauml/manual/fig/test_instance.mp
new file mode 100644
index 00000000000..d01ff8452e2
--- /dev/null
+++ b/Master/texmf-dist/doc/metapost/metauml/manual/fig/test_instance.mp
@@ -0,0 +1,35 @@
+% Part of the MetaUML manual.
+% Copyright (C) 2005 Radu-George Radulescu
+%
+% This program is free software; you can redistribute it and/or
+% modify it under the terms of the GNU General Public License
+% as published by the Free Software Foundation; either version 2
+% of the License, or (at your option) any later version.
+%
+% This program is distributed in the hope that it will be useful,
+% but WITHOUT ANY WARRANTY; without even the implied warranty of
+% MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
+% GNU General Public License for more details.
+%
+% You should have received a copy of the GNU General Public License
+% along with this program; if not, write to the Free Software
+% Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+
+input metauml;
+
+beginfig(1);
+ Instance.A(":Foo")("int: val1", "bool: val2");
+ Instance.B(":Bar")("very long text for testing purposes");
+ Instance.C("s: Student")("line1", "line2", "line3", "line4", "line5");
+ Instance.D("Example")("small");
+ Instance.E("g: Yummy")("{placed}", "{color=red}");
+
+ B.w = A.e + (20, 0);
+ C.n = A.s - (0, 20);
+ D.w = C.e + (20, 0);
+ E.w = D.e + (20, 0);
+
+ drawObjects(A, B, C, D, E);
+endfig;
+
+end
diff --git a/Master/texmf-dist/doc/metapost/metauml/manual/fig/test_lars_issues.mp b/Master/texmf-dist/doc/metapost/metauml/manual/fig/test_lars_issues.mp
new file mode 100644
index 00000000000..428d7b41445
--- /dev/null
+++ b/Master/texmf-dist/doc/metapost/metauml/manual/fig/test_lars_issues.mp
@@ -0,0 +1,94 @@
+input metauml;
+
+numeric u;
+u = 1.3cm;
+
+beginfig(1);
+
+%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%
+
+Class.ElLocSysAcc("ElementLocalSystemAcceptor")
+()
+("+startElementAssebly()",
+ "+assembleElementLocalMatrix(k: KeyType, mat: LocalMatrixType, a: AssembleAction)",
+ "+assembleElementLocalRHS(k: KeyType, rhs: LocalRHSType, a: AssembleAction)",
+ "+endElementAssembly()");
+
+classStereotypes.ElLocSysAcc("<<interface>>");
+ClassTemplate.TEl("KeyType: typename")(ElLocSysAcc);
+
+%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%
+
+ Class.FaceLocSysAcc("FaceLocalSystemAcceptor")
+ ()
+ ("+startFaceAssebly()",
+ "+assembleFaceLocalMatrix(k1: KeyType, k2: KeyType, mat: LocalMatrixType, a: AssembleAction)",
+ "+assembleFaceLocalRHS(k: KeyType, rhs: LocalRHSType, a: AssembleAction)",
+ "+endFaceAssembly()");
+
+ classStereotypes.FaceLocSysAcc("<<interface>>");
+ ClassTemplate.TFa("KeyType: typename")(FaceLocSysAcc);
+
+ %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%
+
+ Class.SolProvider("SolutionProvider")
+ ()
+ ("+startSortBack()",
+ "+getLocalSolution(k: KeyType, sol: LocalSolutionType)",
+ "+endSortBack()");
+
+ classStereotypes.SolProvider("<<interface>>");
+ ClassTemplate.TSol("KeyType: typename")(SolProvider);
+
+% %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%
+
+ % now inherit from these for LapackMatrixSorter
+ Class.LapackMS("LapackMatrixSorter")
+ ("-indMan: IndexManager",
+ "-A: LaGenMatDouble&",
+ "-x: LaVectorDouble&",
+ "-b: LaVectorDouble&"
+ )
+ ("+startElementAssembly()");
+
+ ClassTemplate.TLap("KeyType: typename", "IndexManager: class")(LapackMS);
+
+%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%
+
+% where to draw these:
+FaceLocSysAcc.nw = ElLocSysAcc.ne + (1.5u, 0);
+SolProvider.nw = FaceLocSysAcc.ne + (1.5u, 0);
+LapackMS.n = FaceLocSysAcc.s + (0, -3u);
+
+drawObjects(ElLocSysAcc, TEl, FaceLocSysAcc, TFa,
+ SolProvider, TSol, LapackMS, TLap);
+
+% 50: how much should the path raise upwards before making a horizontal turn.
+link(inheritance)(pathStepY(LapackMS.n, FaceLocSysAcc.s, 50));
+link(inheritance)(pathStepY(LapackMS.n, SolProvider.s, 50));
+link(inheritance)(pathStepY(LapackMS.n, ElLocSysAcc.s, 50));
+
+endfig;
+
+beginfig(2);
+ Begin.b;
+ Activity.A("Activity A", "on line two");
+ Activity.B("Activity B");
+ End.e;
+
+ % or other positioning code...
+ setObjectJoin(pa.s = pb.n + (0,20));
+ joinObjects(b, A, B, e);
+
+ % important: first draw the activities
+ drawObjects(b, A, B, e);
+
+ % you can now draw the transitions
+ clink(transition)(b, A);
+ clink(transition)(A, B);
+ link(transition)(pathStepX(B.e, e.e, 30));
+
+ item(iGuard)("guard")(obj.sw = .5[b.s, A.n]);
+endfig;
+
+end;
diff --git a/Master/texmf-dist/doc/metapost/metauml/manual/fig/test_lowlevel.mp b/Master/texmf-dist/doc/metapost/metauml/manual/fig/test_lowlevel.mp
new file mode 100644
index 00000000000..952da34f482
--- /dev/null
+++ b/Master/texmf-dist/doc/metapost/metauml/manual/fig/test_lowlevel.mp
@@ -0,0 +1,66 @@
+% Part of the MetaUML manual.
+% Copyright (C) 2005 Ovidiu Gheorghies
+%
+% This program is free software; you can redistribute it and/or
+% modify it under the terms of the GNU General Public License
+% as published by the Free Software Foundation; either version 2
+% of the License, or (at your option) any later version.
+%
+% This program is distributed in the hope that it will be useful,
+% but WITHOUT ANY WARRANTY; without even the implied warranty of
+% MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
+% GNU General Public License for more details.
+%
+% You should have received a copy of the GNU General Public License
+% along with this program; if not, write to the Free Software
+% Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+
+input metauml;
+input util_infrastructure;
+
+beginfig(1);
+ show "Lowlevel test";
+ %string foo;
+ %foo := var_instruction(numeric) x, y;
+ %show foo;
+ %foo := foo & ";";
+ %show foo;
+ attributes(foo);
+ _n_ := "foo";
+ %scantokens foo;
+ %string x;
+ %x := str(numeric);
+ var(numeric) x;
+
+ label.top("nothing shown (intentionally)", (0,0));
+endfig;
+
+vardef _foo@#=
+ attributes(@#);
+ var(string) @#a[];
+ @#a[0] := "fpp";
+ @#a[1] := "gqq";
+enddef;
+
+% _foo.b; % not working
+
+vardef _bar@#(text s)=
+ attributes(@#);
+ var(string) elements;
+ @#elements := enumToString(s)("");
+enddef;
+
+beginfig(2);
+ for f = scantokens "a, b, c":
+ show f;
+ endfor;
+ _bar.xx(a, b, c, d);
+ show xx.elements;
+ for f = scantokens xx.elements:
+ show f;
+ endfor;
+ label.top("nothing shown (intentionally)", (0,0));
+endfig;
+
+end
+
diff --git a/Master/texmf-dist/doc/metapost/metauml/manual/fig/test_note.mp b/Master/texmf-dist/doc/metapost/metauml/manual/fig/test_note.mp
new file mode 100644
index 00000000000..bf8c1aeb2fa
--- /dev/null
+++ b/Master/texmf-dist/doc/metapost/metauml/manual/fig/test_note.mp
@@ -0,0 +1,39 @@
+% Part of the MetaUML manual.
+% Copyright (C) 2005 Ovidiu Gheorghies
+%
+% This program is free software; you can redistribute it and/or
+% modify it under the terms of the GNU General Public License
+% as published by the Free Software Foundation; either version 2
+% of the License, or (at your option) any later version.
+%
+% This program is distributed in the hope that it will be useful,
+% but WITHOUT ANY WARRANTY; without even the implied warranty of
+% MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
+% GNU General Public License for more details.
+%
+% You should have received a copy of the GNU General Public License
+% along with this program; if not, write to the Free Software
+% Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+
+input metauml_note;
+input metauml_base;
+input metauml_paths;
+input metauml_links;
+input metauml_class_relations;
+
+beginfig(1);
+ Note.foo("This is the first line", "and this the second one.");
+ drawObject(foo);
+endfig;
+
+beginfig(2);
+ save foo;
+ Note.foo("Please disregard this note.");
+ Note.bar("Please take the other note", "very seriously.");
+
+ bar.s = foo.n + (10,20);
+ drawObjects(foo, bar);
+ clink(dashedLink)(foo, bar);
+endfig;
+
+end
diff --git a/Master/texmf-dist/doc/metapost/metauml/manual/fig/test_package.mp b/Master/texmf-dist/doc/metapost/metauml/manual/fig/test_package.mp
new file mode 100644
index 00000000000..6d4f97ea9f8
--- /dev/null
+++ b/Master/texmf-dist/doc/metapost/metauml/manual/fig/test_package.mp
@@ -0,0 +1,54 @@
+input metauml;
+input metauml_package;
+input metauml_package_relations;
+
+beginfig(1);
+ Package.emptyPackage("")();
+
+ Package.nameOnlyPackage("java.sun.com")();
+
+ Class.oneClass("A class")()();
+ Package.oneClassPackage("One class package")(oneClass);
+
+ Instance.oneInstance("An instance")();
+ State.oneState("A state")();
+ Activity.oneActivity("An activity");
+ Package.multiPackage("Multipackage")(oneInstance, oneState, oneActivity);
+
+ Package.allPackage("This package contains them all")(emptyPackage, nameOnlyPackage,
+ oneClassPackage, multiPackage);
+
+ nameOnlyPackage.nw = emptyPackage.ne + (30, 0);
+ oneClassPackage.ne = emptyPackage.s - (0, 50);
+
+ multiPackage.top = oneClassPackage.top;
+ multiPackage.left = oneClassPackage.right + 20;
+
+ centered_align_top(oneState, oneActivity)(10, below(oneInstance.s, 20));
+
+ drawObjects(allPackage);
+endfig;
+
+beginfig(2);
+ Package.nameOnlyOnTopPackage("Name on top")();
+ nameOnlyOnTopPackage.info.forceEmptyContent := 1;
+ Package.nameOnlyInMiddlePackage("By default, the name", "is in the middle")();
+
+ Class.cl("A class")("Attribute")("Method");
+ Package.notEmptyPackage("Contains class")(cl);
+
+ nameOnlyInMiddlePackage.n = nameOnlyOnTopPackage.s - (0, 40);
+ notEmptyPackage.w = nameOnlyInMiddlePackage.e + (80, 0);
+ drawObjects(nameOnlyOnTopPackage, nameOnlyInMiddlePackage, notEmptyPackage);
+
+ %link(import)(pathStepX(notEmptyPackage.w, nameOnlyOnTopPackage.e, -30));
+ %link(import)(pathVertical(nameOnlyInMiddlePackage.ne - (10, 0), nameOnlyOnTopPackage.bottom));
+ %link(import)(notEmptyPackage.sw -- nameOnlyInMiddlePackage.ne);
+endfig;
+
+beginfig(3);
+ link(nest)((10,10)--(30,30));
+endfig;
+
+
+end \ No newline at end of file
diff --git a/Master/texmf-dist/doc/metapost/metauml/manual/fig/test_paths.mp b/Master/texmf-dist/doc/metapost/metauml/manual/fig/test_paths.mp
new file mode 100644
index 00000000000..eedd11a9b08
--- /dev/null
+++ b/Master/texmf-dist/doc/metapost/metauml/manual/fig/test_paths.mp
@@ -0,0 +1,100 @@
+% Part of the MetaUML manual.
+% Copyright (C) 2005 Ovidiu Gheorghies
+%
+% This program is free software; you can redistribute it and/or
+% modify it under the terms of the GNU General Public License
+% as published by the Free Software Foundation; either version 2
+% of the License, or (at your option) any later version.
+%
+% This program is distributed in the hope that it will be useful,
+% but WITHOUT ANY WARRANTY; without even the implied warranty of
+% MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
+% GNU General Public License for more details.
+%
+% You should have received a copy of the GNU General Public License
+% along with this program; if not, write to the Free Software
+% Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+
+input metauml;
+
+iPict.boxed := 1;
+
+beginfig(1);
+ iClass.shade := 3;
+ Class.F("Foo")("a: int","b: int")();
+ Class.B("Bar")()();
+
+ B.nw = F.ne + (20,-20);
+
+ drawObjects(B, F);
+
+ link(association)(B.nw -- F.ne);
+
+ draw objectBorder(B) withcolor red;
+ draw objectBorder(F) withcolor blue;
+
+ link(association)(pathCut(B,F)(B.c--F.c));
+endfig;
+
+beginfig(2);
+ save A, B;
+
+ Picture.A("A");
+ Picture.B("Blue");
+
+ B.sw = A.ne + (20,20);
+
+ drawObjects(A, B);
+
+ link(associationUni)(pathManhattanX(A.e, B));
+endfig;
+
+beginfig(3);
+ save A, B, C, D, O;
+
+ Picture.A("Alpha");
+ Picture.B("Beta");
+ Picture.C("Gamma");
+ Picture.D("Delta");
+ Picture.O("Omega");
+
+ A.c = O.c + (-50,50);
+ B.c = O.c + (50,50);
+ C.c = O.c + (-50,-50);
+ D.c = O.c + (50,-50);
+
+ drawObjects(O, A, B, C, D);
+
+ link(associationUni)(pathManhattanX(O, A));
+ link(associationUni)(pathManhattanX(O, B));
+ link(associationUni)(pathManhattanX(O, C));
+ link(associationUni)(pathManhattanX(O, D));
+endfig;
+
+beginfig(3);
+ show "";
+ show "";
+ show " FIGURE 3";
+
+ save A, B, C, D, O;
+
+ Picture.A("Alpha");
+ Picture.B("Beta");
+ Picture.C("Gamma");
+ Picture.D("Delta");
+ Picture.O("Omega");
+
+ A.c = O.c + (-50,50);
+ B.c = O.c + (50,50);
+ C.c = O.c + (-50,-50);
+ D.c = O.c + (50,-50);
+
+ drawObjects(O, A, B, C, D);
+
+ link(associationUni)(pathManhattanX(O, A));
+ link(associationUni)(pathManhattanX(O, B));
+ link(associationUni)(pathManhattanX(O, C));
+ link(associationUni)(pathManhattanX(O, D));
+endfig;
+
+end
diff --git a/Master/texmf-dist/doc/metapost/metauml/manual/fig/test_picture.mp b/Master/texmf-dist/doc/metapost/metauml/manual/fig/test_picture.mp
new file mode 100644
index 00000000000..7a56236e825
--- /dev/null
+++ b/Master/texmf-dist/doc/metapost/metauml/manual/fig/test_picture.mp
@@ -0,0 +1,273 @@
+% Part of the MetaUML manual.
+% Copyright (C) 2005 Ovidiu Gheorghies
+%
+% This program is free software; you can redistribute it and/or
+% modify it under the terms of the GNU General Public License
+% as published by the Free Software Foundation; either version 2
+% of the License, or (at your option) any later version.
+%
+% This program is distributed in the hope that it will be useful,
+% but WITHOUT ANY WARRANTY; without even the implied warranty of
+% MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
+% GNU General Public License for more details.
+%
+% You should have received a copy of the GNU General Public License
+% along with this program; if not, write to the Free Software
+% Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+
+input metauml;
+
+string theFont;
+theFont := "tyxbtt";
+
+beginfig(1);
+ draw "xxx" infont defaultfont scaled defaultscale shifted (0,0);
+ draw "yyy" infont (iFont.name) scaled (iFont.scale) shifted (25, 0);
+
+ Picture.p("foo, bar, baz");
+ p.nw = (0,0);
+ drawObject(p);
+
+ Picture.q("qux, norf");
+ drawObjectAt(q)( q.nw = (30,30) );
+
+ FontInfo.foo("tyxbtt", 1);
+ PictureInfo.iNice(3,6,5,10)(foo);
+ iNice.boxed := 1;
+
+ EPicture.myPic(iNice)("Custom iPicture");
+ drawObjectAt(myPic)( myPic.nw = (70,0));
+endfig;
+
+beginfig(2);
+ save p, q, r, t;
+
+ Picture.p("foo");
+ Picture.q("bar");
+ p.nw = (10, 10);
+ q.nw = (20, 20);
+
+ drawObject(p);
+ drawObject(q);
+
+ drawObjects(p, q);
+
+ Picture.a0("root" infont defaultfont);
+ Picture.a1("toof");
+
+ a[0].nw = (30, 30);
+ a[1].nw = (50, 50);
+
+ drawObjects(scantokens listArray(a)(2));
+endfig;
+
+beginfig(3);
+ save p, q, r, t, u, pp;
+
+ bboxmargin := 0;
+
+ picture pp;
+ pp = "a" infont theFont;
+ Picture.p(pp);
+ Picture.q("foo" infont theFont);
+ Picture.r("bar" infont theFont);
+ Picture.t("baz");
+ Picture.u("norf" infont theFont);
+
+ p.nw = (0,0);
+ setObjectJoin(pa.left=pb.left; pa.bottom = pb.top + 1);
+ joinDrawObjects(p, q, r, t, u);
+
+ defaultdy:=0;
+ boxjoin(a.sw=b.nw; a.se=b.ne);
+ boxit.A0("foo1");
+ boxit.A1("bar1");
+ boxit.A2("baz2");
+ boxit.A3("norf2");
+ boxit.A4("..");
+ A0.nw=(50,0);
+ drawboxed(A0,A1,A2,A3,A4);
+
+ myy := 10;
+
+ bboxmargin := 0;
+
+ pair p;
+ p := (30,myy);
+ dotlabel.lrt(".", p);
+ picture x;
+ x := "f: int" infont theFont;
+ draw bbox(x) shifted p;
+ draw x shifted p;
+
+ pair q;
+ q := (70,myy);
+ dotlabel.lrt(".", q);
+ picture y;
+ y := "goofy: int" infont theFont;
+ draw bbox(y) shifted q;
+ draw y shifted q;
+
+ pair qq;
+ qq := (135,myy);
+ dotlabel.lrt(".", qq);
+ picture y;
+ y := "goot" infont theFont;
+ draw bbox(y) shifted qq;
+ draw y shifted qq;
+
+ draw (0,myy)--(150, myy) dashed evenly;
+
+ myyb := 30;
+ Picture.aa(btex goof etex);
+ aa.sw = (30, myyb);
+ Picture_draw.aa;
+
+ draw (0,myyb)--(100, myyb) dashed evenly;
+endfig;
+
+beginfig(4);
+ save a, b;
+ FontInfo.myFont(theFont, 1);
+ PictureInfo.myWay(0,0,0,0)(myFont);
+ myWay.boxed := 1;
+
+ EPicture.a0(myWay)("goof");
+ EPicture.a1(myWay)("Aoorian");
+ EPicture.a2(myWay)("fpp");
+ EPicture.a3(myWay)("f: int");
+ EPicture.a4(myWay)("aa()");
+
+ a0.nw = (0,0);
+ setObjectJoin(pa.bottom = pb.bottom; pa.right = pb.left - 10);
+ joinDrawObjects(scantokens listArray(a)(5));
+
+ draw a0.sw -- a4.se withcolor black dashed evenly;
+
+ myWay.ignoreNegativeBase := 1;
+ EPicture.b0(myWay)("foo");
+ EPicture.b1(myWay)("Bar baz");
+ EPicture.b2(myWay)("qux");
+ EPicture.b3(myWay)("f: int");
+ EPicture.b4(myWay)("aa()");
+
+ b0.nw = (0,-20);
+ setObjectJoin(pa.bottom = pb.bottom; pa.right = pb.left - 10);
+ joinDrawObjects(scantokens listArray(b)(5));
+
+ draw b0.sw -- b4.se withcolor black dashed evenly;
+endfig;
+
+beginfig(5);
+ truecorners := 1;
+ bboxmargin := 0;
+ save p;
+ picture basepict;
+ basepict := "<<foo>>" infont "tyxtt";
+
+ draw basepict;
+ draw bbox basepict;
+endfig;
+
+beginfig(6);
+ item.foo(iPictBoxed)("foo bar baz")(foo.nw = (0,0));
+ item.bar(iPict)("x: int")(bar.nw = (20,20));
+
+ aitem(iPictBoxed)("an anounymous item")(obj.nw = (40,10));
+endfig;
+
+beginfig(7);
+ save a, b, c, d, e, myFixed;
+ PictureInfoCopy.myFixed(iPict);
+ myFixed.ignoreNegativeBase := 1;
+ myFixed.fixedWidth := 20;
+ myFixed.boxed := 1;
+
+ EPicture.a(myFixed)("a");
+ EPicture.b(myFixed)("bar");
+ EPicture.c(myFixed)(".-.");
+ EPicture.d(myFixed)("baz");
+ EPicture.e(myFixed)("qux norf");
+
+ leftToRight.bottom(20)(a, b, c, d, e);
+
+ drawObjects(a, b, c, d, e);
+endfig;
+
+beginfig(8);
+ save a, b, c, d, e, myFixed;
+ PictureInfoCopy.myFixed(iPict);
+ myFixed.halign := "center";
+ myFixed.ignoreNegativeBase := 1;
+ myFixed.fixedWidth := 20;
+ myFixed.boxed := 1;
+
+ EPicture.a(myFixed)("a");
+ EPicture.b(myFixed)("bar");
+ EPicture.c(myFixed)(".-.");
+ EPicture.d(myFixed)("baz");
+ EPicture.e(myFixed)("qux norf");
+
+ leftToRight.bottom(20)(a, b, c, d, e);
+
+ drawObjects(a, b, c, d, e);
+endfig;
+
+beginfig(9);
+ save a, b, c, d, e, myFixed;
+ PictureInfoCopy.myFixed(iPict);
+ myFixed.halign := "center";
+ myFixed.ignoreNegativeBase := 1;
+ myFixed.fixedWidth := 20;
+ myFixed.fixedHeight := 30;
+ myFixed.boxed := 1;
+
+ EPicture.a(myFixed)("a");
+ EPicture.b(myFixed)("bar");
+ EPicture.c(myFixed)(".-.");
+ EPicture.d(myFixed)("baz");
+ EPicture.e(myFixed)("qux norf");
+
+ leftToRight.bottom(20)(a, b, c, d, e);
+
+ drawObjects(a, b, c, d, e);
+endfig;
+
+beginfig(10);
+ save a, b, c, d, e, myFixed;
+ PictureInfoCopy.myFixed(iPict);
+ myFixed.halign := "center";
+ myFixed.valign := "center";
+ myFixed.ignoreNegativeBase := 1;
+ myFixed.fixedWidth := 20;
+ myFixed.fixedHeight := 30;
+ myFixed.boxed := 1;
+
+ EPicture.a(myFixed)("a");
+ EPicture.b(myFixed)("bar");
+ EPicture.c(myFixed)(".-.");
+ EPicture.d(myFixed)("baz");
+ EPicture.e(myFixed)("qux norf");
+
+ leftToRight.bottom(20)(a, b, c, d, e);
+
+ drawObjects(a, b, c, d, e);
+endfig;
+
+beginfig(11);
+ save a, b, c;
+ Picture.a("goo");
+ a.info.textDecoration := "underline";
+
+ Picture.b("foo()");
+ b.info.textDecoration := "underline";
+
+ Picture.c("x");
+ c.info.textDecoration := "underline";
+
+ topToBottom(5)(a, b, c);
+
+ drawObjects(a, b, c);
+endfig;
+
+end
diff --git a/Master/texmf-dist/doc/metapost/metauml/manual/fig/test_picture_stack.mp b/Master/texmf-dist/doc/metapost/metauml/manual/fig/test_picture_stack.mp
new file mode 100644
index 00000000000..8ad4776fa44
--- /dev/null
+++ b/Master/texmf-dist/doc/metapost/metauml/manual/fig/test_picture_stack.mp
@@ -0,0 +1,130 @@
+% Part of the MetaUML manual.
+% Copyright (C) 2005 Ovidiu Gheorghies
+%
+% This program is free software; you can redistribute it and/or
+% modify it under the terms of the GNU General Public License
+% as published by the Free Software Foundation; either version 2
+% of the License, or (at your option) any later version.
+%
+% This program is distributed in the hope that it will be useful,
+% but WITHOUT ANY WARRANTY; without even the implied warranty of
+% MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
+% GNU General Public License for more details.
+%
+% You should have received a copy of the GNU General Public License
+% along with this program; if not, write to the Free Software
+% Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+
+input metauml;
+
+string theFont;
+theFont := "tyxtt";
+
+util_log_thresholdlevel := 100;
+
+beginfig(1);
+ PictureStackInfoCopy.stackWay(iStack);
+
+ EPictureStack.emptyStack(stackWay)()("vcenter");
+ emptyStack.nw=(10,10);
+ drawObject(emptyStack);
+endfig;
+
+beginfig(2);
+ PictureStack.myStack("foo")("vcenter");
+ myStack.nw = (0,0);
+ PictureStack_draw.myStack;
+endfig;
+
+beginfig(3);
+ PictureStack.myStackB("foo", "bar")("vcenter");
+ myStackB.nw = (0,0);
+ PictureStack_draw.myStackB;
+endfig;
+
+beginfig(4);
+ % 1
+ PictureStack.stack("item A", "item B long", "C")("vcenter");
+ stack.info.boxed := 1;
+ stack.info.iPict.boxed := 1; % this does nothing, it's too late
+
+ stack.nw = (0,0);
+ drawObject(stack);
+
+ % 2
+ PictureStack.stackb("item A", "item B long", "C")("vcenter");
+ stackb.info.boxed := 1;
+ stackb.pict[0].info.boxed := 1;
+ stackb.pict[2].info.boxed := 1;
+
+ stackb.nw = (100,0);
+ drawObject(stackb);
+
+ % 3
+ PictureStackInfoCopy.myInfo(iStack);
+ myInfo.boxed := 1;
+ myInfo.iPict.boxed := 1;
+ EPictureStack.stackc(myInfo)("item A", "item B long", "C")("vcenter");
+
+ stackc.nw = (200,0);
+ drawObject(stackc);
+endfig;
+
+beginfig(5);
+ vardef joinCallback= enddef;
+ PictureStack.custom("A.A", "B__________B", "C-----C")
+ ("joinCallback");
+
+ drawObject(custom);
+endfig;
+
+beginfig(6);
+ save custom;
+
+ pickup pencircle scaled 4pt;
+ drawdot origin;
+
+ vardef joinCallbackA=
+ setObjectJoin(pa.bottom = pb.top + index*10; pa.left = pb.left);
+ setObjectJoinFirst(pa.nw = (30,0));
+ enddef;
+
+ PictureStack.customA("go", "further", "and further", "and further still")
+ ("joinCallbackA");
+
+ vardef joinCallbackB=
+ setObjectJoin(pb.bottom = customA.pict[index].bottom; pb.midx = pa.midx);
+ setObjectJoinFirst(pa.bottom = customA.pict[index].bottom);
+ enddef;
+
+ PictureStack.customB(".", "..", "...", "....")
+ ("joinCallbackB");
+
+ drawObjects(customA, customB);
+endfig;
+
+beginfig(7);
+ save stackX;
+ save stylePA, stylePB;
+ save stylePictureStack;
+
+ PictureInfoCopy.stylePA(iPict);
+ stylePA.borderColor := green;
+ stylePA.boxed := 1;
+
+ PictureInfoCopy.stylePB(iPict);
+ stylePB.borderColor := red;
+ stylePB.boxed := 1;
+
+ PictureStackInfoCopy.stylePictureStack(iStack);
+
+ def styleSupplier(expr i)= if i mod 2 = 0: stylePA else: stylePB fi enddef;
+
+ stylePictureStack.childStyleSupplier := "styleSupplier";
+
+ EPictureStack.stackX(stylePictureStack)("a","b","c","d","e")("vcenter");
+
+ drawObjects(stackX);
+endfig;
+
+end
diff --git a/Master/texmf-dist/doc/metapost/metauml/manual/fig/test_picture_tex_rendering.mp b/Master/texmf-dist/doc/metapost/metauml/manual/fig/test_picture_tex_rendering.mp
new file mode 100644
index 00000000000..3c041298699
--- /dev/null
+++ b/Master/texmf-dist/doc/metapost/metauml/manual/fig/test_picture_tex_rendering.mp
@@ -0,0 +1,43 @@
+% Part of the MetaUML manual.
+% Copyright (C) 2005 Ovidiu Gheorghies
+%
+% This program is free software; you can redistribute it and/or
+% modify it under the terms of the GNU General Public License
+% as published by the Free Software Foundation; either version 2
+% of the License, or (at your option) any later version.
+%
+% This program is distributed in the hope that it will be useful,
+% but WITHOUT ANY WARRANTY; without even the implied warranty of
+% MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
+% GNU General Public License for more details.
+%
+% You should have received a copy of the GNU General Public License
+% along with this program; if not, write to the Free Software
+% Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+
+input metauml;
+
+input TEX;
+
+beginfig(1);
+ PictureInfoCopy.myP(iPict);
+ myP.boxed := 1;
+ myP.ignoreNegativeBase := 1;
+
+ EPicture.p(myP)( TEX("Hello, world $x=7$") );
+
+ PictureStackInfoCopy.myPS(iStack);
+ myPS.boxed := 1;
+ myPS.iPict.boxed := 1;
+ myPS.iPict.ignoreNegativeBase := 1;
+
+ EPictureStack.ps(myPS)("Hello, world!",
+ TEX("This is cool: $x=y$."),
+ TEX("But this is insane: $\sum_1^3 f(x) \over x$!") ) ("vleft");
+
+ leftToRight(20)(p, ps);
+
+ drawObjects(p, ps);
+endfig;
+
+end
diff --git a/Master/texmf-dist/doc/metapost/metauml/manual/fig/test_positioning.mp b/Master/texmf-dist/doc/metapost/metauml/manual/fig/test_positioning.mp
new file mode 100644
index 00000000000..66034767716
--- /dev/null
+++ b/Master/texmf-dist/doc/metapost/metauml/manual/fig/test_positioning.mp
@@ -0,0 +1,195 @@
+% Part of the MetaUML manual.
+% Copyright (C) 2005 Ovidiu Gheorghies
+%
+% This program is free software; you can redistribute it and/or
+% modify it under the terms of the GNU General Public License
+% as published by the Free Software Foundation; either version 2
+% of the License, or (at your option) any later version.
+%
+% This program is distributed in the hope that it will be useful,
+% but WITHOUT ANY WARRANTY; without even the implied warranty of
+% MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
+% GNU General Public License for more details.
+%
+% You should have received a copy of the GNU General Public License
+% along with this program; if not, write to the Free Software
+% Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+
+input metauml;
+
+iPict.boxed := 1;
+spacing := 5;
+string strA, strB, strC;
+strA := "a";
+strB := "...";
+strC := "XYZ";
+
+beginfig(1);
+ save A, B, C, X, Y, Z;
+
+ Picture.A(strA);
+ Picture.B(strB);
+ Picture.C(strC);
+
+ align(top, left, right)(spacing)("+")(A, B, C);
+
+ drawObjects(A, B, C);
+
+ draw (A.left, A.top) -- (C.right, A.top);
+
+ %%%%
+
+ Picture.X(strA);
+ Picture.Y(strB);
+ Picture.Z(strC);
+
+ leftToRight.top(spacing)(X, Y, Z);
+
+ X.top = A.bottom - 10;
+
+ drawObjects(X, Y, Z);
+
+ draw (X.left, X.top) -- (Z.right, X.top);
+endfig;
+
+beginfig(2);
+ save A, B, C, X, Y, Z;
+
+ Picture.A(strA);
+ Picture.B(strB);
+ Picture.C(strC);
+
+ align(midy, left, right)(spacing)("+")(A, B, C);
+
+ drawObjects(A, B, C);
+
+ draw (A.left, A.midy) -- (C.right, A.midy);
+
+ %%%%
+
+ Picture.X(strA);
+ Picture.Y(strB);
+ Picture.Z(strC);
+
+ leftToRight.midy(spacing)(X, Y, Z);
+
+ X.top = A.bottom - 10;
+
+ drawObjects(X, Y, Z);
+
+ draw (X.left, X.midy) -- (Z.right, X.midy);
+endfig;
+
+beginfig(3);
+ save A, B, C, X, Y, Z;
+
+ Picture.A(strA);
+ Picture.B(strB);
+ Picture.C(strC);
+
+ align(bottom, left, right)(spacing)("+")(A, B, C);
+
+ drawObjects(A, B, C);
+
+ draw (A.left, A.bottom) -- (C.right, A.bottom);
+
+ %%%%
+
+ Picture.X(strA);
+ Picture.Y(strB);
+ Picture.Z(strC);
+
+ leftToRight.bottom(spacing)(X, Y, Z);
+
+ X.top = A.bottom - 10;
+
+ drawObjects(X, Y, Z);
+
+ draw (X.left, X.bottom) -- (Z.right, X.bottom);
+endfig;
+
+beginfig(4);
+ save A, B, C, X, Y, Z;
+
+ Picture.A(strA);
+ Picture.B(strB);
+ Picture.C(strC);
+
+ align(left, top, bottom)(spacing)("-")(A, B, C);
+
+ drawObjects(A, B, C);
+
+ draw (A.left, A.top) -- (A.left, C.bottom);
+
+ %%%%
+
+ Picture.X(strA);
+ Picture.Y(strB);
+ Picture.Z(strC);
+
+ topToBottom.left(spacing)(X, Y, Z);
+
+ X.top = C.bottom - 10;
+
+ drawObjects(X, Y, Z);
+
+ draw (X.left, X.top) -- (X.left, Z.bottom);
+endfig;
+
+beginfig(5);
+ save A, B, C, X, Y, Z;
+
+ Picture.A(strA);
+ Picture.B(strB);
+ Picture.C(strC);
+
+ align(midx, top, bottom)(spacing)("-")(A, B, C);
+
+ drawObjects(A, B, C);
+
+ draw (A.midx, A.top) -- (A.midx, C.bottom);
+
+ %%%%
+
+ Picture.X(strA);
+ Picture.Y(strB);
+ Picture.Z(strC);
+
+ topToBottom.midx(spacing)(X, Y, Z);
+
+ X.top = C.bottom - 10;
+
+ drawObjects(X, Y, Z);
+
+ draw (X.midx, X.top) -- (X.midx, Z.bottom);
+endfig;
+
+beginfig(6);
+ save A, B, C, X, Y, Z;
+
+ Picture.A(strA);
+ Picture.B(strB);
+ Picture.C(strC);
+
+ align(right, top, bottom)(spacing)("-")(A, B, C);
+
+ drawObjects(A, B, C);
+
+ draw (A.right, A.top) -- (A.right, C.bottom);
+
+ %%%%
+
+ Picture.X(strA);
+ Picture.Y(strB);
+ Picture.Z(strC);
+
+ topToBottom.right(spacing)(X, Y, Z);
+
+ X.top = C.bottom - 10;
+
+ drawObjects(X, Y, Z);
+
+ draw (X.right, X.top) -- (X.right, Z.bottom);
+endfig;
+
+end
diff --git a/Master/texmf-dist/doc/metapost/metauml/manual/fig/test_skins.mp b/Master/texmf-dist/doc/metapost/metauml/manual/fig/test_skins.mp
new file mode 100644
index 00000000000..750cee4e975
--- /dev/null
+++ b/Master/texmf-dist/doc/metapost/metauml/manual/fig/test_skins.mp
@@ -0,0 +1,26 @@
+% Part of the MetaUML manual.
+% Copyright (C) 2005 Ovidiu Gheorghies
+%
+% This program is free software; you can redistribute it and/or
+% modify it under the terms of the GNU General Public License
+% as published by the Free Software Foundation; either version 2
+% of the License, or (at your option) any later version.
+%
+% This program is distributed in the hope that it will be useful,
+% but WITHOUT ANY WARRANTY; without even the implied warranty of
+% MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
+% GNU General Public License for more details.
+%
+% You should have received a copy of the GNU General Public License
+% along with this program; if not, write to the Free Software
+% Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+
+input metauml;
+input metauml_skin_simple;
+
+beginfig(1);
+ Class.HelloSkin("HelloSkin")("nice: int")("done(): void");
+ drawObject(HelloSkin);
+endfig;
+
+end
diff --git a/Master/texmf-dist/doc/metapost/metauml/manual/fig/test_skins_global_defaults.mp b/Master/texmf-dist/doc/metapost/metauml/manual/fig/test_skins_global_defaults.mp
new file mode 100644
index 00000000000..aaeffd043b7
--- /dev/null
+++ b/Master/texmf-dist/doc/metapost/metauml/manual/fig/test_skins_global_defaults.mp
@@ -0,0 +1,29 @@
+% Part of the MetaUML manual.
+% Copyright (C) 2005 Ovidiu Gheorghies
+%
+% This program is free software; you can redistribute it and/or
+% modify it under the terms of the GNU General Public License
+% as published by the Free Software Foundation; either version 2
+% of the License, or (at your option) any later version.
+%
+% This program is distributed in the hope that it will be useful,
+% but WITHOUT ANY WARRANTY; without even the implied warranty of
+% MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
+% GNU General Public License for more details.
+%
+% You should have received a copy of the GNU General Public License
+% along with this program; if not, write to the Free Software
+% Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+
+string metauml_defaultFont, metauml_defaultFontLight;
+metauml_defaultFont := "cmr12";
+metauml_defaultFontLight := "cmr10";
+
+input metauml;
+
+beginfig(1);
+ Class.HelloSkinB("HelloSkinGlobal")("foo: int")("bar(): void");
+ drawObject(HelloSkinB);
+endfig;
+
+end
diff --git a/Master/texmf-dist/doc/metapost/metauml/manual/fig/test_state.mp b/Master/texmf-dist/doc/metapost/metauml/manual/fig/test_state.mp
new file mode 100644
index 00000000000..54207507492
--- /dev/null
+++ b/Master/texmf-dist/doc/metapost/metauml/manual/fig/test_state.mp
@@ -0,0 +1,73 @@
+% Part of the MetaUML manual.
+% Copyright (C) 2005 Ovidiu Gheorghies
+%
+% This program is free software; you can redistribute it and/or
+% modify it under the terms of the GNU General Public License
+% as published by the Free Software Foundation; either version 2
+% of the License, or (at your option) any later version.
+%
+% This program is distributed in the hope that it will be useful,
+% but WITHOUT ANY WARRANTY; without even the implied warranty of
+% MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
+% GNU General Public License for more details.
+%
+% You should have received a copy of the GNU General Public License
+% along with this program; if not, write to the Free Software
+% Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+
+input metauml;
+
+beginfig(1);
+ EntryPoint.entry;
+ ExitPoint.exit;
+
+ entry.nw = (0,0);
+ exit.nw = (50,50);
+
+ drawObjects(entry, exit);
+ clink(transition)(entry, exit);
+endfig;
+
+beginfig(2);
+ EState.myState(iState)("The light is", "visibly on")();
+ drawObject(myState);
+
+ State.anotherState("Another nice state")();
+ anotherState.info.drawNameLine := 1;
+ drawObjectAt(anotherState)(anotherState.nw = (0,50));
+endfig;
+
+beginfig(3);
+ State.interesting("Interesting state")();
+ State_internalTransitions.interesting("OnEntry / doVeryHappy", "OnExit / doSomewhatSad");
+ interesting.info.drawNameLine := 1;
+
+ drawObject(interesting);
+endfig;
+
+beginfig(4);
+ Begin.b;
+ End.e;
+ State.sa("A state")();
+ State.sb("Another state")();
+ setObjectJoin(pb.w = pa.e + (40, 0));
+ joinObjects(b, sa, sb, e);
+
+ State.composite("Composite state")(b, e, sa, sb);
+ drawObject(composite);
+
+ clink(transition)(b, sa);
+ clink(transition)(sa, sb);
+ clink(transition)(sb, e);
+endfig;
+
+beginfig(5);
+endfig;
+
+beginfig(6);
+endfig;
+
+beginfig(7);
+endfig;
+
+end
diff --git a/Master/texmf-dist/doc/metapost/metauml/manual/fig/test_usecase.mp b/Master/texmf-dist/doc/metapost/metauml/manual/fig/test_usecase.mp
new file mode 100644
index 00000000000..32688814cfd
--- /dev/null
+++ b/Master/texmf-dist/doc/metapost/metauml/manual/fig/test_usecase.mp
@@ -0,0 +1,185 @@
+% Part of the MetaUML manual.
+% Copyright (C) 2005 Ovidiu Gheorghies
+%
+% This program is free software; you can redistribute it and/or
+% modify it under the terms of the GNU General Public License
+% as published by the Free Software Foundation; either version 2
+% of the License, or (at your option) any later version.
+%
+% This program is distributed in the hope that it will be useful,
+% but WITHOUT ANY WARRANTY; without even the implied warranty of
+% MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
+% GNU General Public License for more details.
+%
+% You should have received a copy of the GNU General Public License
+% along with this program; if not, write to the Free Software
+% Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+
+input metauml;
+
+HumanInfoCopy.iDwarf(iHuman);
+iDwarf.width := 60;
+iDwarf.height := 20;
+iDwarf.foreColor := blue;
+iDwarf.shadeColor := .8blue;
+
+beginfig(1);
+ Human.h;
+ drawObject(h);
+ draw objectBox(h);
+
+ Human.h1;
+ h1.n = (35, 0);
+ h1.info.foreColor := red;
+ drawObject(h1);
+
+ Human.h2;
+ h2.info.height := 90;
+ h2.nw = (50,0);
+ drawObject(h2);
+ draw objectBox(h2);
+
+ EHuman.d(iDwarf);
+ drawObjectAt(d)(d.s = (10,-50));
+
+ EHuman.d2(iDwarf);
+ d2.info.shadeColor := red;
+ drawObjectAt(d2)(d2.s = (10,-80));
+endfig;
+
+beginfig(2);
+ save a,b;
+
+ Actor.a("foo");
+ drawObject(a);
+
+ Actor.b("Actor line one", "and line two");
+ Actor_setDebugMode.b;
+ b.n = (70,0);
+ drawObject(b);
+endfig;
+
+beginfig(3);
+ Usecase.u("foo");
+ drawObject(u);
+
+ draw objectBox(u) withpen pencircle scaled .1;
+
+ draw u.n withpen pencircle scaled 2 withcolor red;
+ draw u.s withpen pencircle scaled 2 withcolor red;
+ draw u.e withpen pencircle scaled 2 withcolor red;
+ draw u.w withpen pencircle scaled 2 withcolor red;
+
+ draw u.ulft withpen pencircle scaled 2 withcolor blue;
+ draw u.urt withpen pencircle scaled 2 withcolor blue;
+ draw u.llft withpen pencircle scaled 2 withcolor blue;
+ draw u.lrt withpen pencircle scaled 2 withcolor blue;
+
+ Usecase.login("Log in for an eagerly", "awaiting user", "which spans well into a very long 3rd line.");
+ login.s = (0, 5);
+ drawObject(login);
+
+ Usecase.t("Line 1 goo bar", "Line 2");
+ t.s = login.n + (0,10);
+ drawObject(t);
+
+ Usecase.q("Line 1 abcdefg hij", "abcde", "Line 3 abc def ghe jkl", "Line 4 x");
+ q.s = t.n + (0,10);
+ drawObject(q);
+
+endfig;
+
+beginfig(4);
+ Actor.userA("User A2", "line 2", "line 3 long long long");
+ % Any Actor object is made of two sub-objects: nameStack and human.
+ % Each individual picture in the nameStack can be configured individually.
+ %
+ % However, it is not possible to configure all the lines in the nameStack at
+ % once now, saying something like:
+ %
+ % userA.nameStack.info.iPict.iFont.scale := 3;
+ %
+ % This happens because the information above is copied into the Picture objects
+ % in the Actor constructor (and it is useless to modify it afterwards).
+ %
+ % If you do want to make such global modifications of the settings, see the
+ % next two examples.
+
+ userA.nameStack.pict[0].info.iFont.scale := 1.2;
+ userA.nameStack.pict[1].info.iFont.scale := .7;
+ userA.nameStack.info.borderColor := blue;
+ userA.nameStack.info.boxed := 1;
+ userA.nameStack.group.info.left := 30;
+ userA.nameStack.group.info.right := 5;
+ userA.human.info.foreColor := red;
+
+ drawObject(userA);
+ %draw objectBox(userA.nameStack);
+ %draw objectBox(userA.human);
+endfig;
+
+beginfig(5);
+ save userA;
+ % If you want to have preset a info for specific objects
+
+ ActorInfoCopy.iBig(iActor);
+
+ % ActorInfo contains info-s for two objects
+ % iNameStack: for the stack representing the actor's name
+ % iHuman: for the little human
+
+ iBig.iNameStack.iPict.iFont.scale := 3;
+ iBig.iNameStack.spacing := 25;
+ iBig.iHuman.height := 25;
+
+ EActor.userA(iBig)("User A", "Specifically configured");
+ drawObject(userA);
+endfig;
+
+beginfig(6);
+ save userA;
+
+ iActor.iNameStack.iPict.iFont.scale := 2;
+ iActor.iNameStack.spacing := 18;
+
+ Actor.userA("User A", "Globally configured");
+ drawObject(userA);
+endfig;
+
+beginfig(7);
+ save usecaseA;
+ Usecase.usecaseA("A highly customizable", "usecase. Foo bar!");
+ usecaseA.info.iNameStack.iPict.iFont.scale := .5;
+ drawObject(usecaseA);
+endfig;
+
+beginfig(8);
+ save usecaseA;
+ Usecase.usecaseA("A highly customizable", "usecase. Foo bar 2!");
+ usecaseA.info.iNameStack.iPict.iFont.scale := 1.1;
+ usecaseA.info.foreColor := red;
+ usecaseA.info.borderColor := blue;
+ usecaseA.info.iShade.background := green;
+ usecaseA.info.iShade.shift := 4;
+ drawObject(usecaseA);
+endfig;
+
+beginfig(9);
+ save usecaseA;
+ UsecaseInfoCopy.iMyUsecase(iUsecase);
+ iMyUsecase.iNameStack.iPict.iFont.scale := .6;
+ iMyUsecase.iNameStack.spacing := 5;
+ iMyUsecase.foreColor := green;
+ iMyUsecase.iShade.background := red;
+
+ EUsecase.usecaseA(iMyUsecase)("A highly ", " customizable usecase.");
+ EUsecase.usecaseB(iMyUsecase)("Another very ", " customizable usecase.");
+
+ usecaseB.info.iShade.background := green;
+
+ leftToRight(20)(usecaseA, usecaseB);
+ drawObjects(usecaseA, usecaseB);
+endfig;
+
+end
+
diff --git a/Master/texmf-dist/doc/metapost/metauml/manual/fig/usecase.mp b/Master/texmf-dist/doc/metapost/metauml/manual/fig/usecase.mp
new file mode 100644
index 00000000000..ca8040f57b2
--- /dev/null
+++ b/Master/texmf-dist/doc/metapost/metauml/manual/fig/usecase.mp
@@ -0,0 +1,43 @@
+% Sample MetaUML figures.
+% Copyright (C) 2005 Ovidiu Gheorghies
+%
+% This program is free software; you can redistribute it and/or
+% modify it under the terms of the GNU General Public License
+% as published by the Free Software Foundation; either version 2
+% of the License, or (at your option) any later version.
+%
+% This program is distributed in the hope that it will be useful,
+% but WITHOUT ANY WARRANTY; without even the implied warranty of
+% MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
+% GNU General Public License for more details.
+%
+% You should have received a copy of the GNU General Public License
+% along with this program; if not, write to the Free Software
+% Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+
+
+input metauml;
+
+beginfig(1);
+ Usecase.U("Authenticate user",
+ "by name, password");
+ drawObject(U);
+endfig;
+
+beginfig(2);
+ Actor.A("User");
+ drawObject(A);
+endfig;
+
+beginfig(3);
+ save A;
+
+ Actor.A("Administrator");
+ drawObject(A);
+ draw A.nw -- A.ne -- A.se -- A.sw -- cycle;
+ draw A.human.nw -- A.human.ne -- A.human.se -- A.human.sw -- cycle;
+
+endfig;
+
+
+end
diff --git a/Master/texmf-dist/doc/metapost/metauml/manual/fig/usecase_diagrams.mp b/Master/texmf-dist/doc/metapost/metauml/manual/fig/usecase_diagrams.mp
new file mode 100644
index 00000000000..110ca35c072
--- /dev/null
+++ b/Master/texmf-dist/doc/metapost/metauml/manual/fig/usecase_diagrams.mp
@@ -0,0 +1,48 @@
+% Part of the MetaUML manual.
+% Copyright (C) 2005 Ovidiu Gheorghies
+%
+% This program is free software; you can redistribute it and/or
+% modify it under the terms of the GNU General Public License
+% as published by the Free Software Foundation; either version 2
+% of the License, or (at your option) any later version.
+%
+% This program is distributed in the hope that it will be useful,
+% but WITHOUT ANY WARRANTY; without even the implied warranty of
+% MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
+% GNU General Public License for more details.
+%
+% You should have received a copy of the GNU General Public License
+% along with this program; if not, write to the Free Software
+% Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+
+% for f in `find . | grep '.*\.[1-9]'`; do echo $f; done
+
+input metauml;
+
+beginfig(1);
+ Actor.user("User");
+ Actor.db("Database");
+
+ Usecase.dbquery("Query database");
+ Usecase.auth("Authentification");
+ Usecase.authA("Authentification by", "username, password");
+ Usecase.authB("Authentification by", "smartcard");
+
+ auth.w = user.human.e + (30,0);
+ dbquery.s = auth.n + (0,30);
+ db.human.w = dbquery.e + (30,0);
+
+ authB.left - authA.right = 30;
+ authB.midy = authA.midy;
+ .5[authB.w, authA.e] = (auth.midx, auth.bottom - 50);
+
+ drawObjects(user, auth, dbquery, db, authA, authB);
+
+ clink(inheritance)(authA, auth);
+ clink(inheritance)(authB, auth);
+ clink(association)(auth, dbquery);
+ clink(association)(user.human, auth);
+ clink(association)(dbquery, db.human);
+endfig;
+
+end
diff --git a/Master/texmf-dist/doc/metapost/metauml/manual/metauml-manual.bib b/Master/texmf-dist/doc/metapost/metauml/manual/metauml-manual.bib
new file mode 100644
index 00000000000..845db1968fa
--- /dev/null
+++ b/Master/texmf-dist/doc/metapost/metauml/manual/metauml-manual.bib
@@ -0,0 +1,64 @@
+@misc{metaobj,
+ author = "Denis Roegel",
+ title = "The {METAOBJ} tutorial and reference manual",
+ year = "2002",
+ url = "http://texdoc.net/texmf-dist/doc/metapost/metaobj/momanual.pdf"
+}
+@book{texbook,
+ author = "Donald E. Knuth",
+ title = "The {\TeX{}}book",
+ year = "1986",
+ publisher = "Addison-Wesley Publishing Company"
+}
+@book{latexbook,
+ author = "Leslie Lamport",
+ title = "{\LaTeX} a {D}ocument {P}reparation {S}ystem",
+ year = "1994",
+ publisher = "Addison-Wesley Publishing Company"
+}
+@misc{metapost,
+ author = "John D. Hobby",
+ title = "{METAPOST} {A} {U}ser's {M}anual",
+ year = "2018",
+ url = "http://www.tug.org/tutorials/mp/mpman.pdf"
+}
+@misc{umlsty,
+ author = "Ellef Fange Gjelstad",
+ title = "uml.sty, a package for writing {UML} diagrams in {LATEX}",
+ year = "2010",
+ url = "http://mirror.hmc.edu/ctan/graphics/pstricks/contrib/uml/uml.pdf"
+}
+
+@misc{pstumlsty,
+ author = "Maurice Diamantini",
+ title = "Interface utilisateur du package pst-uml",
+ year = "2006",
+ url = "http://mirrors.nxthost.com/ctan/graphics/pstricks/contrib/pst-uml/pst-uml-doc.pdf"
+}
+
+@misc{umldoc,
+ author = "Doug Palmer",
+ title = "The umldoc {UML} {D}ocumentation {P}ackage",
+ year = "1999",
+ url = "https://www.charvolant.org/elements/umldoc.pdf"
+}
+
+@misc{tikzuml,
+ author = "Nicolas Kielbasiewicz",
+ title = "The {T}ik{Z}-{UML} package",
+ year = "2016",
+ url = "http://perso.ensta-paristech.fr/~kielbasi/tikzuml/var/files/doc/tikzumlmanual.pdf"
+}
+
+@misc{svglatex,
+ author = "Johan B. C. Engelen",
+ title = "How to include an SVG image in LATEX",
+ url = "http://tug.ctan.org/info/svg-inkscape/InkscapePDFLaTeX.pdf"
+}
+
+@misc{umlomg,
+ publisher = "Object Management Group",
+ title = "{OMG}® {U}nified {M}odeling {L}anguage® ({OMG} {UML}®)",
+ year = "2017",
+ url = "https://www.omg.org/spec/UML/2.5.1/"
+}
diff --git a/Master/texmf-dist/doc/metapost/metauml/manual/metauml-manual.tex b/Master/texmf-dist/doc/metapost/metauml/manual/metauml-manual.tex
new file mode 100644
index 00000000000..933130a33d3
--- /dev/null
+++ b/Master/texmf-dist/doc/metapost/metauml/manual/metauml-manual.tex
@@ -0,0 +1,2072 @@
+% MetaUML: Tutorial, Reference and Test Suite
+%
+% Copyright (c) 2005-2019 Ovidiu Gheorghies
+% Permission is granted to copy, distribute and/or modify this document
+% under the terms of the GNU Free Documentation License, Version 1.2
+% or any later version published by the Free Software Foundation;
+% with no Invariant Sections, no Front-Cover Texts, and no Back-Cover Texts.
+% A copy of the license is included in the section entitled "GNU
+% Free Documentation License".
+
+\documentclass{article}
+
+\usepackage[utf8]{inputenc}
+\usepackage[pdftex,colorlinks=true]{hyperref}
+\usepackage{multicol}
+\usepackage{multido}
+\usepackage[style=ieee]{biblatex}
+\addbibresource{metauml-manual.bib}
+
+\ifx\pdftexversion\undefined
+ \usepackage[dvips]{graphicx}
+\else
+ \usepackage[pdftex]{graphicx}
+ \DeclareGraphicsRule{*}{mps}{*}{}
+\fi
+
+\newcommand{\code}{\ttfamily}
+
+\setcounter{page}{1}
+
+\begin{document}
+
+MetaUML: A Manual and Test Suite
+
+\begin{quote}
+ Copyright \copyright 2005-2019 Ovidiu Gheorghie\c{s}.
+ Permission is granted to copy, distribute and/or modify this document
+ under the terms of the GNU Free Documentation License, Version 1.2
+ or any later version published by the Free Software Foundation;
+ with no Invariant Sections, no Front-Cover Texts, and no Back-Cover Texts.
+\end{quote}
+
+\pagebreak
+This page is intentionally left blank.
+
+\pagebreak
+\title{MetaUML: A Manual and Test Suite}
+
+\author{Ovidiu Gheorghie\c{s}}
+
+\maketitle
+
+\begin{abstract}
+MetaUML is a MetaPost \cite {metapost} library for creating UML \cite{umlomg} diagrams by means of a textual notation.
+While presenting the inner workings of MetaUML, this manual doubles as a step-by-step tutorial.
+More importantly, its source code contains many useful examples of diagrams, ranging from the very basic to the
+more advanced and customized.
+\end{abstract}
+
+\section{Introduction}
+
+Here is a quick MetaUML showcase:
+
+\begin{multicols}{2}
+\paragraph{A} Class Diagram\\
+\includegraphics[scale=.55]{fig/appetizer.1}
+\paragraph{B} Activity Diagram\\
+\includegraphics[scale=.55]{fig/appetizer.2}
+\paragraph{C} Notes\\
+\includegraphics[scale=.55]{fig/appetizer.5}
+\columnbreak
+\paragraph{D} Use Case Diagram\\
+\includegraphics[scale=.55]{fig/appetizer.3}
+\paragraph{E} State Machine Diagram\\
+\includegraphics[scale=.55]{fig/appetizer.4}
+\paragraph{F} Package Diagram\\
+\includegraphics[scale=.55]{fig/appetizer.6}
+\end{multicols}
+
+\pagebreak
+
+The code that generates these diagrams is quite straightforward, combining a natural object-oriented parlance
+with the power of MetaPost equation solving.
+
+For example, a UML class is drawn as follows:
+
+\begin{multicols}{2}
+\begin{verbatim}
+Class.A("MyClass")
+ ("attr1: int", "attr2: int")
+ ("method1(): void",
+ "method2(): void");
+
+A.nw = (0, 0); % optional, implied
+drawObject(A);
+\end{verbatim}
+\columnbreak
+\hspace{1cm}\includegraphics{fig/appetizer.7}
+\end{multicols}
+
+This code creates a visual object, referenced by its name {\code A}, of the MetaUML-defined type {\code Class}.
+Object {\code A} has the following content properties: a name
+({\code MyClass}), a list of attributes ({\code attr1}, {\code attr2})
+and a list of methods ({\code method1}, {\code method2}). To set the object's location, we assign a value to the
+so-called ``north-west'' point of the encompassing rectangle, {\code A.nw} --- a point which in actual fact references
+the upper-left corner.
+
+Every MetaUML visual object has the layout properties shown in figure \ref{fig:properties}.
+These properties may be used to set the location of any given object, either by assigning to them absolute values,
+or by linking them relatively to other objects via equations.
+
+\begin{figure}
+\centering
+\includegraphics{fig/properties.1}
+\caption{Layout properties of MetaUML objects. Here, a {\code Class} object is depicted.}
+\label{fig:properties}
+\end{figure}
+
+The following example demonstrates, respectively, the use of absolute and relative positioning for two classes, {\code A} and {\code B}.
+
+\begin{multicols}{2}
+\begin{verbatim}
+A.nw = (0,0);
+B.w = A.e + (20, 0);
+\end{verbatim}
+\columnbreak
+\includegraphics{fig/appetizer.8}
+\end{multicols}
+
+After the objects have been drawn, it becomes possible to attach links to them. In a class diagram, inheritance
+or association relations are meaningful links between classes, while in a state machine diagram, transitions between
+states can be used. Here is the general pattern used by MetaUML for drawing links:
+
+\begin{verbatim}
+link(<how-to-draw-information>)(<path-to-draw>);
+\end{verbatim}
+
+The ``how-to-draw-information'' is an object which defines the style of the line (e.g. solid, dashed) and the appearance
+of the heads (e.g. nothing, arrow, diamond). One such object, appropriately called {\code inheritance}, defines a solid
+line style and a white triangle head. The other parameter, the ``path-to-draw'', is simply a MetaPost path.
+
+For example, the following call draws an inheritance relation from class {\code B} to class {\code A}.
+
+\begin{verbatim}
+link(inheritance)(B.e -- A.w);
+\end{verbatim}
+
+The direction of the path is important, as MetaUML uses it to determine the
+type of adornment to attach to the link ends (if applicable). In our example, a white triangle,
+denoting inheritance, points towards the end of the path, that is towards class {\code A}.
+
+Let us sum up with a diagram typical for MetaUML use. Firstly, we define the objects that we want to include
+in our diagram. Secondly, we position these objects relative to each other. Thirdly, we draw the objects. Finally, we
+draw the links, by referencing the layout properties of the previously drawn objects. Note that in our example the
+positioning of {\code A} need not be set explicitly because ``floating'' objects are automatically positioned at
+{\code (0,0)} by their draw method.
+
+\begin{multicols}{2}
+
+\begin{verbatim}
+input metauml;
+
+beginfig(1);
+ Class.A("A")()(); % 1. Define the objects
+ Class.B("B")()();
+ B.w = A.e + (20, 0); % 2. Position the objects
+ drawObjects(A, B); % 3. Draw the objects
+ link(inheritance)(B.w -- A.e); % 4. Draw links between objects
+endfig;
+end
+\end{verbatim}
+\columnbreak
+\includegraphics{fig/appetizer.9}
+\end{multicols}
+
+As far as a user is concerned, this is all there is to MetaUML. With a reference describing how the
+UML elements are created, arbitrarily complex diagrams can be crafted.
+
+\section{Class Diagrams}
+
+A class is created as follows:
+
+\begin{verbatim}
+Class.<name>(<class-name>)
+ (<list-of-attributes>)
+ (<list-of-methods>);
+\end{verbatim}
+
+The suffix {\code <name>} specifies an identifier for the newly created {\code Class} object
+(which, of course, represents a UML class).
+The name of the UML class is a string given by {\code <class-name>};
+the attributes and methods are given as list of strings, {\code <list-of-attributes>} and {\code <list-of-methods>}
+respectively. The list of attributes and the list of methods may be void.
+
+An attribute or a method string may begin with a visibility marker: ``$+$'' for
+public, ``\#'' for protected, ``$-$'' for private, and ``\textasciitilde'' for package private.
+The default visibility is package private.
+
+\begin{multicols}{2}
+\begin{verbatim}
+Class.A("Point")
+ ("#x:int", "#y:int")
+ ("+set(x:int, y:int)",
+ "+getX():int",
+ "+getY():int",
+ "-debug():void",
+ "test():void");
+drawObject(A);
+\end{verbatim}
+\columnbreak
+\includegraphics{fig/class.1}
+\end{multicols}
+
+To disable showing the visibility markers, use {\code Class\_noVisibilityMarkers}, as shown below:
+
+\begin{multicols}{2}
+\begin{verbatim}
+ Class.A("Point")
+ ("#x:int", "#y:int")
+ ("+toString():String");
+ Class_noVisibilityMarkers.A;
+
+ drawObject(A);
+\end{verbatim}
+\columnbreak
+\includegraphics{fig/class.15}
+\end{multicols}
+
+\subsection{Stereotypes}
+
+After a class is created, but before it is drawn, its stereotypes may be specified by using {\code Class\_stereotypes}:
+
+\begin{verbatim}
+Class_stereotypes.<name>(<list-of-stereotypes>);
+\end{verbatim}
+
+Here, {\code <name>} is the object name of a previously created class and {\code <list-of-stereotypes>}
+is a comma-separated list of strings. Here is an example:
+
+\begin{multicols}{2}
+\begin{verbatim}
+Class.A("User")()();
+Class_stereotypes.A("<<interface>>","<<home>>");
+
+drawObject(A);
+\end{verbatim}
+\columnbreak
+\hspace{3cm}\includegraphics{fig/class.2}
+\end{multicols}
+
+\subsection{Interfaces and Abstract Classes}
+
+At times it is preferred to write the name of an interface in an oblique font, rather than using the ``interface''
+stereotype. This can be easily achieved by using the macro {\code Interface}:
+
+\begin{verbatim}
+Interface.name(class-name)
+ (list-of-methods);
+\end{verbatim}
+
+Here is an example:
+
+\begin{multicols}{2}
+\begin{verbatim}
+Interface.A("Observer")
+ ("+update(src:Object)");
+
+drawObject(A);
+\end{verbatim}
+\columnbreak
+\hspace{1cm}\includegraphics{fig/class.11}
+\end{multicols}
+
+Since internally {\code Interface} treated as a special kind of {\code Class}, the code above is equivalent to:
+\begin{verbatim}
+EClass.A(iInterface)("Observer")()
+ ("+update(src:Object)");
+\end{verbatim}
+
+Abstract classes can be drawn similarly using the {\code iAbstractClass} style:
+\begin{samepage}
+\begin{multicols}{2}
+\begin{verbatim}
+EClass.A(iAbstractClass)("Observable")
+ ("observers: Observer[0..*]")
+ ("+addObserver(o: Observer)",
+ "+notify()");
+
+drawObject(A);
+\end{verbatim}
+\columnbreak
+\hspace{1cm}\includegraphics{fig/class.12}
+\end{multicols}
+\end{samepage}
+
+If you prefer, you can use equivalent construct:
+
+\begin{verbatim}
+AbstractClass.A("Observable")
+ ("observers: Observer[0..*]")
+ ("+addObserver(o: Observer)",
+ "+notify()");
+\end{verbatim}
+
+\subsection{Displaying Class Name Only}
+
+If you want the empty methods and attributes compartments in a class not being displayed, one way is to set the spacing
+at their top and the bottom to {\code 0}:
+\begin{samepage}
+\begin{multicols}{2}
+\begin{verbatim}
+Class.A("MyModel")()();
+A.info.iName.top := 10;
+A.info.iName.bottom := 10;
+A.info.iAttributeStack.top := 0;
+A.info.iAttributeStack.bottom := 0;
+A.info.iMethodStack.top := 0;
+A.info.iMethodStack.bottom := 0;
+
+drawObject(A);
+\end{verbatim}
+\columnbreak
+\hspace{1cm}\includegraphics{fig/class.13}
+\end{multicols}
+\end{samepage}
+
+The same effect can be achieved by using the formatting information object {\code iClassNameOnly} or the {\code ClassName} macro:
+
+\begin{multicols}{2}
+\begin{verbatim}
+EClass.A(iClassNameOnly)("MyModel")()();
+ClassName.B("AnotherModel");
+Class_stereotypes.B("<<smart>>");
+
+topToBottom(20)(A, B);
+
+drawObjects(A, B);
+\end{verbatim}
+\columnbreak
+\hspace{2cm}\includegraphics{fig/class.14}
+\end{multicols}
+
+To customize the space around the class name globally, you can set the values of {\code iClassNameOnly.iName.top} and {\code iClassNameOnly.iName.bottom}. Individually, for a given object, say {\code B}, the attributes {\code B.info.iName.top} and {\code B.info.iName.bottom} can be used.
+
+\subsection{Objects (or Class Instances)}
+
+A UML object (or class instance) is created as follows:
+
+\begin{verbatim}
+Instance.name(object-name)
+ (list-of-attributes);
+\end{verbatim}
+
+The suffix {\code name} gives a name to the {\code Instance} object. The name of the object (given by {\code object-name}) is typeset underlined. The attributes are given as a comma-separated list of strings, {\code list-of-attributes}.
+
+\begin{multicols}{2}
+\begin{verbatim}
+Instance.order("o: Order")
+ ("name='book'", "{placed}", "{payed}");
+drawObject(order);
+\end{verbatim}
+\columnbreak
+\hspace{2cm}\includegraphics{fig/instance.1}
+\end{multicols}
+
+
+\subsection{Parametrized Classes (Templates)}
+
+The most convenient way of typesetting a class template in MetaUML is to use the macro {\code ClassTemplate}.
+This macro creates a visual object which is appropriately positioned near the class object it adorns.
+
+\begin{verbatim}
+ClassTemplate.name(list-of-templates)
+ (class-object);
+\end{verbatim}
+
+The {\code name} is the name of the template object, {\code list-of-templates} is a comma-separated list of strings and the {\code class-object} is the name of a class object.
+
+Here is an example:
+
+\begin{multicols}{2}
+\begin{verbatim}
+Class.A("Vector")()();
+ClassTemplate.T("T", "size: int")(A);
+
+drawObjects(A, T);
+\end{verbatim}
+\columnbreak
+\hspace{1cm}\includegraphics{fig/class.3}
+\end{multicols}
+
+The macro {\code Template} can also be used to create a template object, but this time the resulting
+object can be positioned freely.
+
+\begin{verbatim}
+Template.name(list-of-templates);
+\end{verbatim}
+
+Of course, it is possible to specify both stereotypes and template parameters for a given class.
+
+\subsection{Types of Links}
+
+In this section we enumerate the relations that can be drawn between classes by means
+of MetaUML macros. Suppose that we have the declared two points, {\code A} (on the left)
+and {\code B} (on the right):
+
+\begin{verbatim}
+pair A, B;
+A = (0,0);
+B = (50,0);
+\end{verbatim}
+
+\begin{tabular}{||l|c||}
+\hline
+{\code link(association)(X.e -- Y.w)} & \includegraphics{fig/class_diagrams.4} \\
+\hline
+{\code link(associationUni)(X.e -- Y.w)} & \includegraphics{fig/class_diagrams.5} \\
+\hline
+{\code link(inheritance)(X.e -- Y.w)} & \includegraphics{fig/class_diagrams.6} \\
+\hline
+{\code link(realization)(X.e -- Y.w)} & \includegraphics{fig/class_diagrams.12} \\
+\hline
+{\code link(aggregation)(X.e -- Y.w)} & \includegraphics{fig/class_diagrams.7} \\
+\hline
+{\code link(aggregationUni)(X.e -- Y.w)} & \includegraphics{fig/class_diagrams.8} \\
+\hline
+{\code link(composition)(X.e -- Y.w)} & \includegraphics{fig/class_diagrams.9} \\
+\hline
+{\code link(compositionUni)(X.e -- Y.w)} & \includegraphics{fig/class_diagrams.10} \\
+\hline
+{\code link(dependency)(X.e -- Y.w)} & \includegraphics{fig/class_diagrams.11} \\
+\hline
+\end{tabular}
+
+\subsection{Associations}
+In UML an association typically has two of association ends and may have a name specified for it.
+In turn, each association end may specify a multiplicity, a role, a visibility, an ordering.
+These entities are treated in MetaUML as pictures having specific drawing information
+(spacings, font).
+
+The first method of creating association ``items'' is by giving them explicit names.
+Having a name for an association item comes in handy when referring to its properties
+is later needed (see the non UML-compliant diagram below). The last parameter of the macro {\code item} is an equation which may use the item's name to perform positioning.
+
+\begin{multicols}{2}
+\begin{verbatim}
+Class.P("Person")()();
+Class.C("Company")()();
+% drawing code ommited
+
+item.aName(iAssoc)("works for")
+ (aName.s = .5[P.w, C.w]);
+draw aName.n -- (aName.n + (20,20));
+label.urt("association name" infont "tyxtt",
+ aName.n + (20,20));
+\end{verbatim}
+\columnbreak
+\hspace{1cm}\includegraphics[scale=.8]{fig/class_association.1}
+\end{multicols}
+
+However, giving names to every association item may become an annoying burden
+(especially when there are many of them). Because of this, MetaUML also allows for
+``anonymous items''. In this case, the positioning is set by an equation
+which refers to the anonymous item as {\code obj}.
+
+\begin{multicols}{2}
+\begin{verbatim}
+% P and C defined as in the previous example
+
+item(iAssoc)("employee")(obj.nw = P.s);
+item(iAssoc)("1..*")(obj.ne = P.s);
+
+% other items are drawn similarly
+\end{verbatim}
+\columnbreak
+\hspace{3cm}\includegraphics{fig/class_association.2}
+\end{multicols}
+
+\subsection{Dependencies and Stereotypes}
+
+Stereotypes are frequently used with dependencies. Below is an example.
+\pagebreak
+
+\begin{multicols}{2}
+\begin{verbatim}
+Class.F("Factory")()();
+Class.O("Object")()();
+
+O.n = F.s - (0, 50);
+drawObjects(F, O);
+
+clink(dependency)(F, O);
+item(iStereo)("<<creates>>")(obj.w = .5[F.s,O.n])
+\end{verbatim}
+\columnbreak
+\hspace{3cm}\includegraphics{fig/class_association.3}
+\end{multicols}
+
+\section{Notes}
+
+A note is created as follows:
+
+\begin{verbatim}
+Note.name(list-of-lines);
+\end{verbatim}
+
+The suffix {\code name} is the name of the {\code Note} object. The contents of the note is given by a comma-separated
+list of strings, {\code list-of-lines}, gives the text contents of the note object, each string being drawn on its own
+line.
+
+Here is an example:
+
+\begin{multicols}{2}
+\begin{verbatim}
+Note.A("This note", "has two lines.");
+drawObject(A);
+\end{verbatim}
+\columnbreak
+\hspace{3cm}\includegraphics{fig/note.1}
+\end{multicols}
+
+\subsection{Attaching notes to diagram elements}
+
+Notes can be attached to diagram elements by using a link of type {\code dashedLink}.
+
+\begin{multicols}{2}
+\begin{verbatim}
+Note.A("This is a class");
+Class.C("Object")()();
+
+A.sw = C.ne + (20, 20);
+
+drawObject(A, C);
+
+clink(dashedLink)(A, C);
+\end{verbatim}
+\columnbreak
+\hspace{1cm}\includegraphics{fig/note.2}
+\end{multicols}
+
+Now let us see a more complex example, which demontrates the ability of accessing sub-elements in a MetaUML diagram.
+\pagebreak
+
+\begin{multicols}{2}
+\begin{verbatim}
+Note.nA("This is the class name");
+Note.nB("This is a key attribute");
+Note.nC("This is a nice method");
+
+Class.C("Object")("+id:int")
+ ("+clone()", "+serialize()");
+
+topToBottom.left(10)(nA, nB, nC);
+leftToRight(10)(C, nB);
+
+drawObjects(C, nA, nB, nC);
+
+clink(dashedLink)(C.namePict, nA);
+clink(dashedLink)(C.attributeStack.pict[0], nB);
+clink(dashedLink)(C.methodStack.pict[1], nC);
+\end{verbatim}
+\columnbreak
+\hspace{1cm}\includegraphics{fig/note.3}
+\end{multicols}
+
+Macros like {\code leftToRight} and {\code topToBottom} are presented in section \ref{section:positioning}.
+
+\subsection{Using mathematical formulae}
+
+MetaUML notes can contain mathematical formulae written in TeX \cite{texbook}. Regretably, LaTeX \cite{latexbook} support for formulae is {\bf not} available.
+Limited as it may be, this feature is considered experimental, as it is not always straightforward to use. In the example below, note that the MetaPost package {\code TEX} is imported.
+
+\begin{multicols}{2}
+\begin{verbatim}
+input metauml;
+input TEX;
+
+beginfig(1);
+ Note.A("This class implements the formula:",
+ TEX("$\sum_1^n f(x) \cdot dx$"));
+ drawObjects(A);
+endfig;
+
+end
+\end{verbatim}
+\columnbreak
+\hspace{0.5cm}\includegraphics{fig/note.4}
+\end{multicols}
+
+For taller formulae, you must be prepared to do some advanced stunts. Remark: {\code "aaa" \& "bbb"} is MetaPost's way to concatenate the strings into {\code "aaabbb"};
+the string containing the formula was split in two for layout reasons.
+
+\begin{multicols}{2}
+\begin{verbatim}
+Note.A("Can you do it?",
+ TEX("$\sum_1^n f(x) \cdot dx " &
+ "\over \sum_1^m g(y) \cdot dy$"));
+A.stack.info.spacing := 30;
+A.stack.pict[1].info.ignoreNegativeBase := 0;
+
+drawObject(A);
+\end{verbatim}
+\columnbreak
+\hspace{3cm}\includegraphics{fig/note.5}
+\end{multicols}
+
+Alas, this trick does not entirely solve the problem: a third line in the note would be badly aligned. Therefore,
+until MetaUML's {\code Note} class is upgraded to better support this scenario, you may want to limit yourself
+to two lines per note --- at least when tall formulae are involved.
+
+\section{Packages}
+
+MetaUML allows for the creation of packages in various forms. Firstly, we have the option of writing the package
+name in the middle of the main box. Secondly, we can write the name on the tiny box above the main box, leaving
+the main box empty. Lastly, we can write the package name as in the second case, but the main box can have an arbitrary
+contents: classes, other packages, or even other UML items.
+
+The macro that creates a package has the following synopsis:
+
+\begin{verbatim}
+Package.name(package-name)(subitems-list);
+\end{verbatim}
+
+The parameter {\code package-name} is a string or a list of comma-separated strings representing the package's name.
+The {\code subitems-list} parameter is used to specify the subitems (tipically classes or packages) of this package;
+its form is as a comma-separated list of objects, which can be void.
+
+\begin{multicols}{2}
+\begin{verbatim}
+Package.P("java.lang")();
+drawObject(P);
+\end{verbatim}
+\columnbreak
+\hspace{3cm}\includegraphics{fig/package.1}
+\end{multicols}
+
+Below is another example:
+
+\begin{multicols}{2}
+\begin{verbatim}
+Package.P("An important", "package")();
+drawObject(P);
+\end{verbatim}
+\columnbreak
+\hspace{3cm}\includegraphics{fig/package.2}
+\end{multicols}
+
+If you wish to leave the main box empty, you can use the following code:
+
+\begin{multicols}{2}
+\begin{verbatim}
+Package.P("java.lang")();
+P.info.forceEmptyContent := 1;
+drawObject(P);
+\end{verbatim}
+\columnbreak
+\hspace{3cm}\includegraphics{fig/package.3}
+\end{multicols}
+
+The same effect as above can be achieved globally by doing:
+
+\begin{verbatim}
+iPackage.forceEmptyContent := 1;
+\end{verbatim}
+
+More information on MetaUML's way of managing global and per-object configuration data can be found in
+section \ref{section:infrastructure} and section \ref{section:customization}.
+
+Here is an example involving items contained in a package.
+
+\begin{multicols}{2}
+\begin{verbatim}
+Class.A("A")()();
+Class.B("B")()();
+Package.P("net.metauml")(A, B);
+
+leftToRight(10)(A, B);
+
+drawObject(P);
+\end{verbatim}
+\columnbreak
+\hspace{3cm}\includegraphics{fig/package.4}
+\end{multicols}
+
+\subsection{Types of Links}
+
+The nesting relation between packages is created by using the {\code nest} link information.
+
+\begin{tabular}{||l|c||}
+\hline
+{\code link(nest)(X.e -- Y.w)} & \includegraphics{fig/package.5} \\
+\hline
+\end{tabular}
+
+\section{Component Diagrams}
+
+A component is created by the macro {\code Component}:
+
+\begin{verbatim}
+Component.name(component-name)
+ (subitems-list)
+\end{verbatim}
+
+The parameter {\code component-name} is a string representing the component's name. The {\code subitems-list} parameter
+is used to specify the subitems of this component (possibly classes, packages or other components); its form is as a
+comma-separated list of objects, which can be void.
+
+\begin{multicols}{2}
+\begin{verbatim}
+Component.C("Business Logic")();
+drawObject(C);
+\end{verbatim}
+\columnbreak
+\hspace{3cm}\includegraphics{fig/component.1}
+\end{multicols}
+
+Here is an example involving subitems in a component:
+
+\begin{multicols}{2}
+\begin{verbatim}
+Class.A("A")()();
+Package.B("B")();
+Component.C("C")();
+
+Component.BigC("Big Component")(A, B, C);
+
+leftToRight(10)(A, B);
+topToBottom(10)(A, C);
+
+drawObject(BigC);
+\end{verbatim}
+\columnbreak
+\hspace{3cm}\includegraphics{fig/component.2}
+\end{multicols}
+
+\subsection{Types of Links}
+
+\begin{tabular}{||l|c||}
+\hline
+{\code link(requiredInterface)( A.e -- .5[A.e, B.w] );} & \includegraphics{fig/component.3} \\
+\hline
+{\code link(providedInterface)( .5[A.e, B.w] -- B.w );} & \includegraphics{fig/component.4} \\
+\hline
+\end{tabular}
+
+\vspace{0.5cm}
+
+The {\code requiredInterface} and {\code providedInterface} visual constructs can be easily combined, as shown in the following example:
+
+\begin{multicols}{2}
+\begin{verbatim}
+Component.A("A")();
+Component.B("B")();
+
+leftToRight(80)(A, B);
+
+drawObjects(A, B);
+
+link(providedInterface)( A.e -- .5[A.e, B.w] );
+link(requiredInterface)( B.w -- .5[A.e, B.w] );
+\end{verbatim}
+\columnbreak
+\hspace{-1cm}\includegraphics{fig/component.5}
+\end{multicols}
+
+
+\section{Use Case Diagrams}
+
+\subsection{Use Cases}
+An use case is created by the macro {\code Usecase}:
+
+\begin{verbatim}
+Usecase.name(list-of-lines);
+\end{verbatim}
+
+The {\code list-of-lines} is a comma-separated list of strings. These strings are placed
+on top of each other, centered and surrounded by the appropriate visual UML notation.
+
+Here is an use case example:
+
+\begin{multicols}{2}
+\begin{verbatim}
+Usecase.U("Authenticate user",
+ "by name, password");
+drawObject(U);
+\end{verbatim}
+\columnbreak
+\hspace{1cm}\includegraphics{fig/usecase.1}
+\end{multicols}
+
+\subsection{Actors}
+
+An actor is created by the macro {\code Actor}:
+
+\begin{verbatim}
+Actor.name(list-of-lines);
+\end{verbatim}
+
+Here, {\code list-of-lines} represents the actor's name. For convenience, the name may be
+given as a list of strings which are placed on top of each other, to provide support for
+the situations when the role is quite long. Otherwise, giving a single string
+as an argument to the Actor constructor is perfectly fine.
+
+Here is an actor example:
+
+\begin{multicols}{2}
+\begin{verbatim}
+Actor.A("User");
+drawObject(A);
+\end{verbatim}
+\columnbreak
+\hspace{1cm}\includegraphics{fig/usecase.2}
+\end{multicols}
+
+Sometimes it may be preferable to draw diagram relations positioned relatively to
+the visual representation of an actor (the ``human'') rather than relatively to the whole
+actor object (which also includes the text). Because of that, MetaUML provides access
+to the ``human'' of every actor object {\code actor} by means of the sub-object {\code actor.human}.
+
+\begin{multicols}{2}
+\begin{verbatim}
+Actor.A("Administrator");
+drawObject(A);
+draw objectBox(A);
+draw objectBox(A.human);
+\end{verbatim}
+\columnbreak
+\hspace{1cm}\includegraphics{fig/usecase.3}
+\end{multicols}
+
+In MetaUML, {\code objectBox(X)} is equivalent to {\code X.nw -- X.ne -- X.se -- X.sw -- cycle} for every object {\code X}. {\code A.human} is considered a MetaUML object, so you can use expressions like {\code A.human.n} or {\code A.human.midx}.
+
+\subsection{Types of Links}
+
+Some of the types of links defined for class diagrams (such as inheritance, association etc.) can be used with similar semantics within use case diagrams.
+
+\section{Activity Diagrams}
+
+\subsection{Begin, End and Flow End}
+
+The begin and the end of an activity diagram can be marked by using the macros {\code Begin}
+and {\code End} or {\code FlowFinal}, respectively. The constructors of these visual objects take no parameters:
+
+\begin{verbatim}
+Begin.beginName;
+End.endName;
+\end{verbatim}
+
+Below is an example:
+
+\begin{multicols}{2}
+\begin{verbatim}
+Begin.b;
+End.e;
+FlowFinal.f;
+
+leftToRight(20)(b, e, f);
+
+drawObjects(b, e, f);
+\end{verbatim}
+\columnbreak
+\hspace{1cm}\includegraphics{fig/activity.1}
+\end{multicols}
+
+\subsection{Activity}
+
+An activity is constructed as follows:
+\begin{verbatim}
+Activity.name(list-of-strings);
+\end{verbatim}
+
+The parameter {\code list-of-strings} is a comma-separated list of strings. These strings are
+centered on top of each other to allow for the accommodation of a longer activity description
+within a reasonable space.
+
+An example is given below:
+
+\begin{multicols}{2}
+\begin{verbatim}
+Activity.A("Learn MetaUML -",
+ "the MetaPost UML library");
+drawObject(A);
+\end{verbatim}
+\columnbreak
+\hspace{1cm}\includegraphics{fig/activity.2}
+\end{multicols}
+
+\subsection{Fork and Join}
+
+A fork or join is created by the macro:
+
+\begin{verbatim}
+Fork.name(type, length);
+\end{verbatim}
+
+The parameter {\code type} is a string and can be either of {\code "h"}, {\code "horiz"}, {\code "horizontal"}
+for horizontal bars, and either of {\code "v"}, {\code "vert"}, {\code "vertical"} for vertical bars.
+The {\code length} gives the bar's length.
+
+\begin{multicols}{2}
+\begin{verbatim}
+Fork.forkA("h", 100);
+Fork.forkB("v", 20);
+
+leftToRight(10)(forkA, forkB);
+
+drawObject(forkA, forkB);
+\end{verbatim}
+\columnbreak
+\hspace{1cm}\includegraphics{fig/activity.3}
+\end{multicols}
+
+\subsection{Branch}
+
+A branch is created by the macro:
+
+\begin{verbatim}
+Branch.name;
+\end{verbatim}
+
+Here is an example:
+
+\begin{multicols}{2}
+\begin{verbatim}
+Branch.testA;
+
+drawObject(testA);
+\end{verbatim}
+\columnbreak
+\hspace{1cm}\includegraphics{fig/activity.4}
+\end{multicols}
+
+
+\subsection{Types of Links}
+
+In activity diagrams, transitions between activities are needed. They are typeset
+as in the example below. In section \ref{composite-states} such a transition
+is showed. This type of link is also used for state machine diagrams.
+
+\begin{verbatim}
+link(transition)( pointA -- pointB );
+\end{verbatim}
+
+\section{State Diagrams}
+
+The constructor of a state allows for aggregated sub-states:
+
+\begin{verbatim}
+State.name(state-name)(substates-list);
+\end{verbatim}
+
+The parameter {\code state-name} is a string or a list of comma-separated strings representing
+the state's name or description. The {\code substates-list} parameter is used to specify
+the substates of this state as a comma-separated list of objects; this list may be void.
+
+An example of a simple state:
+
+\begin{multicols}{2}
+\begin{verbatim}
+State.s("Take order")();
+drawObject(s);
+\end{verbatim}
+\columnbreak
+\hspace{1cm}\includegraphics{fig/state.1}
+\end{multicols}
+
+
+\subsection{Composite States}
+\label{composite-states}
+
+A composite state is defined by enumerating at the end of its constructor the inner
+states. Interestingly enough, the composite state takes care of drawing the sub-states it
+contains. The transitions must be drawn after the composite state, as seen in the
+next example:
+
+\begin{multicols}{2}
+\begin{verbatim}
+Begin.b;
+End.e;
+State.c("Component")();
+State.composite("Composite")(b, e, c);
+
+b.midx = e.midx = c.midx;
+c.top = b.bottom - 20;
+e.top = c.bottom - 20;
+
+composite.info.drawNameLine := 1;
+drawObject(composite);
+
+link(transition)(b.s -- c.n);
+link(transition)(c.s -- e.n);
+\end{verbatim}
+\columnbreak
+\hspace{1cm}\includegraphics{fig/state.2}
+\end{multicols}
+
+\subsection{Internal Transitions}
+
+Internal transitions can be specified by using the macro:
+\begin{verbatim}
+stateTransitions.name(list-transitions);
+\end{verbatim}
+
+Identifier {\code name} gives the state object whose internal transitions are being set,
+and parameter {\code list-transitions} is a comma-separated string list.
+
+
+An example is given below:
+
+\begin{multicols}{2}
+\begin{verbatim}
+State.s("An interesting state",
+ "which is worth mentioning")();
+stateTransitions.s(
+ "OnEntry / Open eyes",
+ "OnExit / Sleep well");
+s.info.drawNameLine := 1;
+
+drawObject(s);
+\end{verbatim}
+\columnbreak
+\hspace{1cm}\includegraphics{fig/state.3}
+\end{multicols}
+
+\subsection{Special States}
+
+Similarly to the usage of {\code Begin} and {\code End} macros, one can define history states,
+exit/entry point states and terminate pseudo-states, by using the following constructors.
+
+\begin{verbatim}
+History.nameA;
+ExitPoint.nameB;
+EntryPoint.nameC;
+Terminate.nameD;
+\end{verbatim}
+
+\section{Drawing Paths}
+
+The {\code link} macro is powerful enough to draw relations following arbitrary paths:
+
+\begin{multicols}{2}
+\begin{verbatim}
+path cool;
+cool := A.e .. A.e+(20,10) ..
+ B.s+(20,-40) .. B.s+(-10,-30)
+ -- B.s;
+link(inheritance)(cool);
+
+link(aggregationUni)
+ (A.n ..(30,30)..B.w);
+\end{verbatim}
+\columnbreak
+\hspace{1cm}\includegraphics{fig/paths.1}
+\end{multicols}
+
+Amusing as it may be, this feature gets old soon. When typesetting UML diagrams in good style, rectangular paths are usually preferred.
+It is for this kind of paths that MetaUML offers extensive support, by means of ``syntactic sugar'' constructs which
+are not only self-documenting, but reduce the amount of typing and thinking required.
+
+\subsection{Manhattan Paths}
+
+The ``Manhattan'' path macros generate a path between two points consisting of one
+horizontal and one vertical segment. The macro {\code pathManhattanX} generates first a
+horizontal segment, while the macro {\code pathManhattanY} generates first a
+vertical segment. In MetaUML it also matters the direction of a path, so you
+can choose to reverse it by using {\code rpathManhattanX} and {\code rpathManhattanY}
+(note the prefix ``{\code r}''):
+
+\begin{verbatim}
+pathManhattanX(A, B)
+pathManhattanY(A, B)
+
+rpathManhattanX(A, B)
+rpathManhattanY(A, B)
+\end{verbatim}
+
+\pagebreak
+Here is an example:
+
+\begin{multicols}{2}
+\begin{verbatim}
+Class.A("A")()();
+Class.B("B")()();
+
+B.sw = A.ne + (10,10);
+drawObjects(A, B);
+
+link(aggregationUni)
+ (rpathManhattanX(A.e, B.s));
+link(inheritance)
+ (pathManhattanY(A.n, B.w));
+\end{verbatim}
+\columnbreak
+\hspace{1cm}\includegraphics{fig/paths.2}
+\end{multicols}
+
+\subsection{Stair Step Paths}
+
+These path macros generate stair-like paths between two points.
+The ``stair'' can ``rise'' first in the direction of $Ox$ axis ({\code pathStepX})
+or in the direction of $Oy$ axis ({\code pathStepY}). How much should a step
+rise is given by an additional parameter, {\code delta}. Again, the macros
+prefixed with ``{\code r}'' reverse the direction of the path given by their
+unprefixed counterparts.
+
+\begin{verbatim}
+pathStepX(A, B, delta)
+pathStepY(A, B, delta)
+
+rpathStepX(A, B, delta)
+rpathStepY(A, B, delta)
+\end{verbatim}
+
+Here is an example:
+
+\begin{multicols}{2}
+\begin{verbatim}
+stepX:=60;
+link(aggregationUni)
+ (pathStepX(A.e, B.e, stepX));
+
+stepY:=20;
+link(inheritance)
+ (pathStepY(B.n, A.n, stepY));
+\end{verbatim}
+\columnbreak
+\hspace{1cm}\includegraphics{fig/paths.3}
+\end{multicols}
+
+\subsection{Horizontal and Vertical Paths}
+
+There are times when drawing horizontal or vertical links is required,
+even when the objects are not properly aligned. To this aim, the following macros
+are useful:
+
+\begin{verbatim}
+pathHorizontal(pA, untilX)
+pathVertical(pA, untilY)
+
+rpathHorizontal(pA, untilX)
+rpathVertical(pA, untilY)
+\end{verbatim}
+
+A path created by {\code pathHorizonal} starts from the point {\code pA}
+and continues horizontally until coordinate {\code untilX} is reached. The macro
+{\code pathVertical} constructs the path dually, working vertically.
+The prefix ``{\code r}'' reverses the direction of the path.
+
+Usage example:
+
+\begin{multicols}{2}
+\begin{verbatim}
+untilX := B.left;
+link(association)
+ (pathHorizontal(A.e, untilX));
+
+untilY:= C.bottom;
+link(association)
+ (pathVertical(A.n, untilY));
+\end{verbatim}
+\columnbreak
+\hspace{1cm}\includegraphics{fig/paths.4}
+\end{multicols}
+
+\subsection{Direct Paths}
+
+A direct path can be created with {\code directPath}. The call {\code directPath(A, B)}
+is equivalent to {\code A -{}- B}.
+
+\subsection{Paths between Objects}
+
+Using the constructs presented above, links between diagram objects are drawn easily like this:
+
+\begin{verbatim}
+link(transition)(directPath(objA.nw, objB.se));
+\end{verbatim}
+
+There are times however when this direct approach may yield unsatisfactory visual results,
+especially when the object's corners is round. To tackle these situations, MetaUML provides the macro
+{\code pathCut}, whose aim is to limit a given path exactly to the region outside the actual
+borders of the objects it connects. The macro's synopsis is:
+
+\begin{verbatim}
+pathCut(thePath)(objectA, objectB)
+\end{verbatim}
+
+Here, {\code thePath} is a given MetaPost path and {\code objectA} and {\code objectB}
+are two MetaUML objects. By contract, each MetaUML object of type, say, {\code X}
+defines a macro {\code X\_border} which returns the path that surrounds it. Because
+of that, {\code pathCut} can make the appropriate modifications to {\code thePath}.
+
+The following code demonstrates the benefits of the {\code pathCut} macro:
+
+\begin{multicols}{2}
+\begin{verbatim}
+z = A.se + (30, -10);
+link(transition)
+ (pathCut(A, B)(A.c--z--B.c));
+\end{verbatim}
+\columnbreak
+\hspace{1cm}\includegraphics{fig/paths.5}
+\end{multicols}
+
+\subsubsection{Direct Paths between Centers}
+
+At times is quicker to just draw direct paths between the center of two objects,
+minding of course the object margins. The macro which does this is {\code clink}:
+
+\begin{verbatim}
+clink(how-to-draw-information)(objA, objB);
+\end{verbatim}
+
+The parameter {\code how-to-draw-information} is the same as for the macro {\code link};
+{\code objA} and {\code objB} are two MetaUML objects.
+
+Below is an example which involves the inheritance relation:
+
+\begin{multicols}{2}
+\begin{verbatim}
+clink(inheritance)(A, B);
+\end{verbatim}
+\columnbreak
+\hspace{1cm}\includegraphics{fig/paths.6}
+\end{multicols}
+
+\section{Arranging Diagram Items}
+\label{section:positioning}
+
+Using equations involving cardinal points, such as {\code A.nw = B.ne + (10,0)}, is
+good enough for achieving the desired results. However, programs are best to
+be written for human audience, rather than for compilers. It does become a bit
+tiresome to think all the time of cardinal points and figure out the
+direction of positive or negative offsets. Because of that, MetaUML offers
+syntactic sugar which allows for an easier understanding of the intent behind
+the positioning code.
+
+Suppose that we have three classes, {\code A}, {\code B}, {\code C} and their base class
+{\code Base}. We want the base class to be at the top, and the derived classes to be
+on a line below. This code will do:
+
+\begin{verbatim}
+A.ne = B.nw + (20,0);
+B.ne = C.nw + (20,0);
+Base.s = B.n + (0,-20);
+\end{verbatim}
+
+Unfortunately, writing code such as this makes it hard for fellow programmers to visualize
+its intent upon reading it. And ``fellow programmers`` include the author, five minutes later.
+
+Perhaps the next version of the code will drive home the point. The outcome is
+the same as before, but the layout is stated in a more human-friendly way. You might even
+infer by yourself that the numeric argument represents the distance between the objects.
+
+\begin{multicols}{2}
+\begin{verbatim}
+leftToRight(20)(A, B, C);
+topToBottom(20)(Base, B);
+\end{verbatim}
+\columnbreak
+\hspace{1cm}\includegraphics{fig/positioning.2}
+\end{multicols}
+
+Below there are examples which show how these macros can be used. Suppose that we have the
+following definitions for objects {\code X}, {\code Y}, and {\code Z}; also, let's assume
+that {\code spacing} is a numeric variable set to {\code 5}.
+
+\begin{verbatim}
+Picture.X("a");
+Picture.Y("...");
+Picture.Z("Cyan");
+\end{verbatim}
+
+\begin{tabular}{||l|c||}
+\hline
+{\code leftToRight.top(spacing)(X, Y, Z);} & \includegraphics{fig/positioning.3} \\
+\hline
+{\code leftToRight.midy(spacing)(X, Y, Z);} & \includegraphics{fig/positioning.4} \\
+\hline
+{\code leftToRight.bottom(spacing)(X, Y, Z);} & \includegraphics{fig/positioning.5} \\
+\hline
+{\code topToBottom.left(spacing)(X, Y, Z);} & \includegraphics{fig/positioning.6} \\
+\hline
+{\code topToBottom.midx(spacing)(X, Y, Z);} & \includegraphics{fig/positioning.7} \\
+\hline
+{\code topToBottom.right(spacing)(X, Y, Z);} & \includegraphics{fig/positioning.8} \\
+\hline
+\end{tabular} \\
+
+To make things even easier, the following equivalent contructs are also allowed:
+
+\begin{verbatim}
+leftToRight.midy(spacing)(X, Y, Z);
+leftToRight(spacing)(X, Y, Z);
+\end{verbatim}
+
+\begin{verbatim}
+topToBottom.midx(spacing)(X, Y, Z);
+topToBottom(spacing)(X, Y, Z);
+\end{verbatim}
+
+If you want to specify that some objects have a given property equal, while the distance between them is given elsewhere, you can use the macro {\code same}.
+This macro accepts a variable number of parameters, but at least two. The following table gives the interpretation of the macro for a simple example.
+
+\begin{tabular}{||l|l||}
+\hline
+{\code same.top(X, Y, Z);} & {\code X.top = Y.top = Z.top;} \\
+\hline
+{\code same.midy(X, Y, Z);} & {\code X.midy = Y.midy = Z.midy;} \\
+\hline
+{\code same.bottom(X, Y, Z);} & {\code X.bottom = Y.bottom = Z.bottom;} \\
+\hline
+{\code same.left(X, Y, Z);} & {\code X.left = Y.left = Z.left;} \\
+\hline
+{\code same.midx(X, Y, Z);} & {\code X.midx = Y.midx = Z.midx;} \\
+\hline
+{\code same.right(X, Y, Z);} & {\code X.right = Y.right = Z.right;} \\
+\hline
+\end{tabular} \\
+
+Relative positions of two points can be declared more easily using the macros {\code below}, {\code above}, {\code atright}, {\code atleft}.
+Let us assume that {\code A} and {\code B} are two points (objects of type {\code pair} in MetaPost). The following constructs are equivalent:
+
+\begin{tabular}{||l|l||}
+\hline
+{\code B = A + (5,0);} & {\code B = atright(A, 5);} \\
+{\code B = A - (5,0);} & {\code B = atleft(A, 5);} \\
+{\code B = A + (0,5);} & {\code B = above(A, 5);} \\
+{\code B = A - (0,5);} & {\code B = below(A, 5);} \\
+\hline
+\end{tabular}
+
+
+\section{The MetaUML Infrastructure}
+\label{section:infrastructure}
+
+MetaPost is a macro language based on equation solving. Using it may seem quite
+tricky at first for a programmer accustomed to modern object-oriented languages.
+However, the great power of MetaPost consists in its versatility. Indeed, it is possible to write
+a system which mimics quite well object-oriented behavior. Along this line, METAOBJ
+\cite{metaobj} is a library worth mentioning: it provides a high-level objects
+infrastructure along with a battery of predefined objects.
+
+Surprisingly enough, MetaUML does not use METAOBJ. Instead, it uses a custom written,
+lightweight object-oriented infrastructure, provisionally called ``{\code util}''.
+METAOBJ's facilities, although impressive, were perceived by me as being a bit too much
+for what was initially intented as a quick way of getting some UML diagrams layed out.
+Inspired by METAOBJ, ``{\code util}'' was designed to fulfill with minimal effort
+the specific tasks needed to confortably position, allign or group visual objects
+which include text.
+
+Another library having some object-oriented traits is the {\code boxes}
+library, which comes with the standard MetaPost distribution. Early versions of
+MetaUML did use {\code boxes} as an infrastructure, but this approach had to be abandoned eventually.
+The main reason was that it was difficult to achieve good visual results when stacking texts
+(more on that further on). For all it's worth, it did not fit well with the way in which MetaUML's
+layout mechanism was shaping up at the time.
+
+\subsection{Motivation}
+
+Suppose that we want to typeset two texts with their bottom lines aligned, using {\code boxit}:
+
+\begin{multicols}{2}
+\begin{verbatim}
+boxit.a ("yummy");
+boxit.b ("cool");
+
+a.nw = (0,0); b.sw = a.se + (10,0);
+
+drawboxed (a, b); % or drawunboxed(a,b)
+draw a.sw -- b.se dashed evenly
+ withpen pencircle scaled 1.1;
+\end{verbatim}
+\columnbreak
+\hspace{1cm}\includegraphics{fig/boxes_vs_util.1}
+\end{multicols}
+
+Note that, despite supposedly having their bottom lines alligned,
+``yummy'' {\it looks} slightly higher than ``cool''. This would be unacceptable
+in a UML class diagram, when roles are placed at the ends of a horizontal association.
+Regardless of the default spacing being smaller in the {\code util} library,
+the very same unfortunate misalignment effect rears its ugly head:
+
+\begin{multicols}{2}
+\begin{verbatim}
+Picture.a("yummy");
+Picture.b("cool");
+% comment next line for unboxed
+a.info.boxed := b.info.boxed := 1;
+
+b.sw = a.se + (10,0);
+
+drawObjects(a, b);
+\end{verbatim}
+\columnbreak
+\hspace{1cm}\includegraphics{fig/boxes_vs_util.2}
+\end{multicols}
+
+However, the strong point of {\code util} is that we have a recourse to this problem:
+
+\begin{multicols}{2}
+\begin{verbatim}
+iPict.ignoreNegativeBase := 1;
+
+Picture.a("yummy");
+Picture.b("cool");
+% the rest the same as above
+drawObjects(a, b);
+\end{verbatim}
+\columnbreak
+\hspace{1cm}\includegraphics{fig/boxes_vs_util.3}
+\end{multicols}
+
+\subsection{The Picture Macro}
+
+We have seen previously the line {\code iPict.ignoreNegativeBase := 1}.
+Who is {\code iPict} and what is it doing in our program? MetaUML
+aims at separating the ``business logic'' (what to draw) from the
+``interface'' (how to draw). In order to achieve this, it records the ``how to draw''
+information within the so-called {\code Info} structures. The object {\code iPict}
+is an instance of {\code PictureInfo} structure, which has the following properties
+(or attributes):
+\begin{verbatim}
+left, right, top, bottom
+ignoreNegativeBase
+boxed, borderColor
+\end{verbatim}
+
+The first four attributes specify how much space should be left around the
+actual item to be drawn. The marvelous effect of {\code ignoreNegativeBase}
+has just been shown (off), while the last two attributes control whether the border
+should be drawn (when {\code boxed=1}) and if drawn, in which color.
+
+There's one more thing: the font to typeset the text in. This is specified
+in a {\code FontInfo} structure which has two attributes: the font name
+and the font scale. This information is kept within the {\code PictureInfo} structure
+as a contained attribute {\code iFont}. Both {\code FontInfo} and {\code PictureInfo}
+have ``copy constructors'' which can be used to make copies. We have already
+the effect of these copy constructors at work, when we used:
+
+\begin{verbatim}
+Picture.a("yummy");
+a.info.boxed := 1;
+\end{verbatim}
+
+A copy of the default info for a picture, {\code iPict}, has been made within
+the object {\code a} and can be accessed as {\code a.info}. Having a copy of the
+info in each object may seem like an overkill, but it allows for a fine grained
+control of the drawing mode of each individual object. This feature comes in very
+handy when working with a large number of settings, as it is the case for MetaUML.
+
+Let us imagine for a moment that we have two types of text to write: one with a small font
+and a small margin and one with a big font and a big margin. We could in theory
+configure each individual object or set back and forth global parameters, but
+this is far for convenient. It is preferable to have two sets of settings and specify
+them explicitly when they are needed. The following code could be placed somewhere
+in a configuration file and loaded before any {\code beginfig} macro:
+\begin{verbatim}
+PictureInfoCopy.iBig(iPict);
+iBig.left := iBig.right := 20;
+iBig.top := 10;
+iBig.bottom := 1;
+iBig.boxed := 1;
+iBig.ignoreNegativeBase := 1;
+iBig.iFont.name := defaultfont;
+iBig.iFont.scale := 3;
+
+PictureInfoCopy.iSmall(iPict);
+iSmall.boxed := 1;
+iSmall.borderColor := green;
+\end{verbatim}
+
+Below is an usage example of these definitions. Note the name of the macro: {\code EPicture}.
+The prefix comes form ``explicit'' and it's used to acknowledge that the
+``how to draw'' information is given explicitly --- as a parameter,
+rather than defaulted to what's recorded in {\code iPict}, as with the {\code Picture} macro.
+Having predefined configurations yields short, convenient code.
+
+\begin{multicols}{2}
+\begin{verbatim}
+EPicture.a(iBig)("yummy");
+EPicture.b(iSmall)("cool");
+% you can still modify a.info, b.info
+
+b.sw = a.se + (10,0);
+
+drawObjects(a, b);
+\end{verbatim}
+\columnbreak
+\hspace{1cm}\includegraphics{fig/picture_info.1}
+\end{multicols}
+
+\subsubsection{Fixed Sizes}
+
+By default, the size of a {\code Picture} object is set by its contents. However,
+it is possible to specify fixed dimensions both the width and the height, independently.
+This can be done by setting the {\code info}'s attributes {\code fixedWidth} and {\code fixedHeight} to values
+greater than 0. If any of these attributes is left to its default value, {\code -1}, then for the corresponding
+axis the dimension is set according to the dimension of the content. Nevertheless, the fixed dimensions are enforced, even though the contained object would have needed additional space.
+
+\begin{multicols}{2}
+\begin{verbatim}
+PictureInfoCopy.myFixed(iPict);
+myFixed.ignoreNegativeBase := 1;
+myFixed.fixedWidth := 15;
+myFixed.fixedHeight := 20;
+myFixed.boxed := 1;
+
+EPicture.a(myFixed)("a");
+EPicture.b(myFixed)(".-.");
+EPicture.c(myFixed)("toolong");
+
+leftToRight.bottom(10)(a, b, c);
+
+drawObjects(a, b, c);
+\end{verbatim}
+\columnbreak
+\hspace{1cm}\includegraphics{fig/picture_info.2}
+\end{multicols}
+
+\subsubsection{Content alignment}
+
+When fixed dimensions are used, one most likely would prefer a centered alignement of the contents in the
+{\code Picture} box. This option can be expressed independently for each of the axes,
+by setting the {\code info}'s attributes {\code valign} and {\code halign} to descriptive string values.
+For horizontal alignement, {\code halign} can be set to {\code "left"} or {\code "center"}, and for
+vertical alignement, {\code valign} can be set to {\code "bottom} or {\code "center"}. The default
+values for these attributes are {\code "left"} and {\code "bottom"}, respectively.
+
+The next example uses horizontal centered alignement and a bottom alignement with a {\code 4.5} base offset, for
+vertical alignement. This vertical alignement gives a better visual result than the centered one, at
+least for the situations in which there are texts to be placed horizontally.
+
+\begin{multicols}{2}
+\begin{verbatim}
+PictureInfoCopy.myFixed(iPict);
+myFixed.ignoreNegativeBase := 1;
+myFixed.bottom := 4.5;
+myFixed.valign := "bottom";
+myFixed.halign := "center";
+myFixed.fixedWidth := 25;
+myFixed.fixedHeight := 15;
+myFixed.boxed := 1;
+
+EPicture.a(myFixed)("a");
+EPicture.b(myFixed)("yum");
+EPicture.c(myFixed)("b");
+
+leftToRight.bottom(10)(a, b, c);
+
+drawObjects(a, b, c);
+\end{verbatim}
+\columnbreak
+\hspace{1cm}\includegraphics{fig/picture_info.3}
+\end{multicols}
+
+\subsection{Stacking Objects}
+
+It is possible to stack objects, much in the style of {\code setboxjoin}
+from {\code boxes} library.
+
+\begin{multicols}{2}
+\begin{verbatim}
+Picture.a0("yummy");
+Picture.a1("cool");
+Picture.a2("fool");
+
+setObjectJoin(pa.sw = pb.nw);
+joinObjects(scantokens listArray(a)(3));
+
+drawObjects(scantokens listArray(a)(3));
+% or drawObjects (a0, a1, a2);
+\end{verbatim}
+\columnbreak
+\hspace{1cm}\includegraphics{fig/object_stack.1}
+\end{multicols}
+
+The {\code listArray} macro provides here a shortcut for writing
+{\code a0, a1, a2}. This macro is particularly useful for generic
+code which does not know beforehand the number of elements to be drawn.
+Having to write the {\code scantokens} keyword is admittedly a nuisance, but
+this is required.
+
+
+\subsection{The Group Macro}
+
+It is possible to group objects in MetaUML. This feature is the cornerstone
+of MetaUML, allowing for the easy development of complex objects, such as
+composite stats in state machine diagrams.
+
+Similarly to the macro {\code Picture}, the structure {\code GroupInfo}
+is used for specifying group properties; its default instantiation is
+{\code iGroup}. Furthermore, the macro {\code EGroup} explicitely sets the
+layout information.
+
+Here is an example:
+
+\begin{multicols}{2}
+\begin{verbatim}
+iGroup.left:=20;
+iGroup.right:=15;
+iGroup.boxed:=1;
+iPicture.boxed:=1;
+
+Picture.a("yummy");
+Picture.b("cool");
+Picture.c("fool");
+
+b.nw = a.nw + (20,20); % A
+c.nw = a.nw + (15, 40); % B
+
+Group.g(a, b, c);
+g.nw = (10,10); % C
+
+drawObject(g);
+\end{verbatim}
+\columnbreak
+\hspace{1cm}\includegraphics{fig/group.1}
+\end{multicols}
+
+After some objects are grouped, they can only be drawn
+by invoking the {\code drawObject} macro on the group that aggregates them, and not individually.
+Conveniently, once the relative positioning of objects within a group is set (line A and B), the whole
+group can be ``moved'' do the desired position (line C), and all the contained objects will move along.
+
+\subsection{The PictureStack Macro}
+
+The {\code PictureStack} macro is a syntactic sugar for a set of pictures,
+stacked according to predefined equations and grouped together.
+
+\begin{multicols}{2}
+\begin{verbatim}
+iStack.boxed := 1;
+iStack.iPict.boxed := 1;
+PictureStack.myStack("foo",
+ "bar: int" infont "tyxtt",
+ "nicely-centered" infont defaultfont,
+ "nice")("vcenter");
+
+drawObject(myStack);
+\end{verbatim}
+\columnbreak
+\hspace{1cm}\includegraphics{fig/picture_stack.1}
+\end{multicols}
+
+Note the last parameter of the macro {\code PictureStack}, here {\code vcenter}.
+It is used to generate appropriate equations based on a descriptive name.
+The spacing between individual picture objects is set by the field
+{\code iStack.spacing}. Currently, the following alignment names are
+defined: {\code vleft}, {\code vright}, {\code vcenter},
+{\code vleftbase}, {\code vrightbase}, {\code vcenterbase}. All these
+names refer to vertical alignment (the prefix ``{\code v}''); alignment can
+be at left, right or centered. The variants having the suffix ``{\code base}'' align
+the pictures so that {\code iStack.spacing} refer to the distance between the
+bottom lines of the pictures. The unsuffixed variants use {\code iStack.spacing} as
+the distance between one's bottom line and the next's top line.
+
+The ``{\code base}'' alignment is particularly useful for stacking text, since it
+offers better visual appearance when {\code iPict.ignoreNegativeBase} is set to {\code 1}.
+
+\section{Components Design}
+
+Each MetaUML component (e.g. {\code Picture}, {\code PictureStack}, {\code Class}) is
+designed according to an established pattern. This section gives more insight
+on this.
+
+In order to draw a component, MetaUML categorizes the required information as follows:
+\begin{itemize}
+\item what to draw, or what are the elements of a component.
+\item how to draw, or how are the elements positioned in relation to each other within the component
+\item where to draw
+\end{itemize}
+
+For example, in order to draw a picture object we must know, respectively:
+\begin{itemize}
+\item what is the text or the native picture that needs to be drawn
+\item what are the margins that should be left around the contents
+\item where is the picture to be drawn
+\end{itemize}
+
+Why do we bother with these questions? Why don't we just simply draw the picture
+component as soon as it was created and get it over with?
+That is, why doesn't the following code just work?
+
+\begin{verbatim}
+Picture.pict("foo");
+\end{verbatim}
+
+Well, although we have the answer to question 1 (what to draw),
+we still need to have question 3 answered. The code below becomes thus a
+necessity (actually, you are not forced to specify the positioning of an object,
+because its draw method positions it to {\code (0,0)} by default):
+
+\begin{verbatim}
+% question 1: what to draw
+Picture.pict("foo");
+
+% question 3: where to draw
+pict.nw = (10,10);
+
+% now we can draw
+drawObject(pict);
+\end{verbatim}
+
+How about question 2, how to draw? By default, this problem is addressed behind the
+scenes by the component. This means, for the Picture object, that a native picture is created
+from the given string, and around that picture certain margins are placed, by means of MetaPost equations.
+(The margins also come in handy when stacking Picture objects, so that the result doesn't look too cluttered.)
+If these equations were defined within the Picture constructor, then an
+usability problem would have appeared, because it wouldn't have been possible to modify the margins,
+as in the code below:
+
+\begin{verbatim}
+% question 1: what to draw
+Picture.pict("foo");
+
+% question 2: how to draw
+pict.info.left := 10;
+pict.info.boxed := 1;
+
+% question 3: where to draw
+pict.nw = (0,0);
+
+% now we can draw
+drawObject(pict);
+\end{verbatim}
+
+To allow for this type of code, the equations that define the layout of the {\code Picture} object (here, what the margins are)
+must be defined somewhere after the constructor. This is done by a macro called {\code Picture\_layout}.
+This macro defines all the equations which link the ``what to draw'' information to the ``how to draw''
+information (which in our case is taken from the {\code info} member, a copy of {\code iPict}).
+Nevertheless, notice that {\code Picture\_layouts} is not explicitly invoked. To the user's
+great relief, this is taken care of automatically within the {\code Picture\_draw} macro.
+
+There are times however, when explicitly invoking a macro like {\code Picture\_layout}
+becomes a necessity. This is because, by contract, it is only after the {\code layout}
+macro is invoked that the final dimensions (width, height) of an object are
+definitely and permanently known. Imagine that we have a component whose job is to
+surround in a red-filled rectangle some other objects. This component
+needs to know what the dimensions of the contained objects are, in order to be able to set
+its own dimensions. At drawing time, the contained objects must not have been drawn already,
+because the red rectangle of the container would overwrite them.
+Therefore, the whole pseudo-code would be:
+\begin{verbatim}
+Create objects o1, o2, ... ok;
+Create container c(o1, o2, ..., ok);
+Optional: modify info-s for o1, o2, ... ok;
+Optional: modify info for c;
+
+layout c, requiring layout of o1, o2, ... ok;
+establish where to draw c;
+draw red rectangle defined by c;
+draw components o1, o2, ...ok within c
+\end{verbatim}
+
+A natural conclusion is that an object must not be laid out more than once, because otherwise
+inconsistent or superfluous equations would arise. To enforce this, by contract,
+any object must keep record of whether its layout method has already been invoked,
+and if the answer is affirmative, subsequent invocations of the layout macro would
+do nothing. It is very important to mention that after the {\code layout} macro is
+invoked over an object, modifying the {\code info} member of that object has
+no subsequent effect, since the layout equations are declared and interpreted only once.
+
+\subsection{Notes on the Implementation of Links}
+
+MetaUML considers edges in diagram graphs as links. A link is composed of a path and the
+heads (possible none, one or two). For example, since an association has no heads, it suffices
+to draw along the path with a solid pen; however, an unidirectional aggregation has, in addition
+to a solid path, two heads: one is an arrow and the other is a diamond.
+
+The general algorithm for drawing a link is:
+
+\begin{verbatim}
+0. Reserve space for heads
+1. Draw the path (except for the heads)
+2. Draw head 1
+3. Draw head 2
+\end{verbatim}
+
+Each of the UML link types define how the drawing should be done, in each of the
+cases (1, 2 and 3). Consider the link type of unidirectional composition.
+Its ``class'' is declared as:
+
+\begin{verbatim}
+vardef CompositionUniInfo@# =
+ LinkInfo@#;
+
+ @#widthA = defaultRelationHeadWidth;
+ @#heightA = defaultRelationHeadHeight;
+ @#drawMethodA = "drawArrow";
+
+ @#widthB = defaultRelationHeadWidth;
+ @#heightB = defaultRelationHeadHeight;
+ @#drawMethodB = "drawDiamondBlack";
+
+ @#drawMethod = "drawLine";
+enddef;
+\end{verbatim}
+
+Using this definition, the actual description is created like this:
+
+\begin{verbatim}
+CompositionUniInfo.compositionUni;
+\end{verbatim}
+
+As shown previously, is is the macro {\code link} which
+performs the actual drawing, using the link description information
+which is given as parameter (generally called {\code iLink}).
+For example, we can use:
+
+\begin{verbatim}
+link(aggregationUni)((0,0)--(40,0));
+\end{verbatim}
+
+%\begin{figure}
+%\centering
+%\includegraphics{fig/how-links-work.1}
+%\caption{An example of a picture stack.}
+%\label{fig:hlw}
+%\end{figure}
+
+Let us see now the inner workings of macro {\code link}. Its definition is:
+
+\begin{verbatim}
+vardef link(text iLink)(expr myPath)=
+ LinkStructure.ls(myPath,
+ iLink.widthA, iLink.widthB);
+ drawLinkStructure(ls)(iLink);
+enddef;
+\end{verbatim}
+
+\begin{figure}
+\centering
+\begin{tabular}{l|l}
+$AB$ & the path specified by the user \\
+$|AA'|$ & {\code iLink.widthA}\\
+$|BB'|$ & {\code iLink.widthB}
+\end{tabular}
+\includegraphics{fig/how-links-work.2}
+\caption{Details on how a link is drawn by MetaUML.}
+\label{fig:hlw2}
+\end{figure}
+
+First, space is reserved for heads, by ``shortening'' the given path {\code myPath}
+by {\code iLink.widthA} at the beginning and by {\code iLink.widthB} at the end.
+After that, the shortened path is drawn with the ``method''
+given by {\code iLink.drawMethod} and the heads with the ``methods''
+{\code iLink.drawMethodA} and {\code iLink.drawMethodB},
+respectively (figure \ref{fig:hlw2}).
+
+\subsection{Object Definitions: Easier {\code generic\_declare}}
+
+In MetaPost, if somebody wants to define something resembling a class in an object-oriented language,
+named, say, {\code Person}, he would do something like this:
+
+\begin{verbatim}
+vardef Person@#(expr _name, _age)=
+ % @# prefix can be seen as `this` pointer
+ string @#name;
+ numeric @#age;
+
+ @#name := _name;
+ @#age := _age;
+enddef;
+\end{verbatim}
+
+This allows for the creation of instances (or objects) of class {\code Person} by using
+declarations like:
+
+\begin{verbatim}
+Person.personA;
+Person.personB;
+\end{verbatim}
+
+ However, if one also wants to able able to create indexed arrays of persons, such as
+{\code Person.student0}, {\code Person.student1} etc., the definition of class
+{\code Person} must read:
+
+\begin{verbatim}
+vardef Person@#(expr _name, _age)=
+ _n_ := str @#;
+ generic_declare(string) _n.name;
+ generic_declare(numeric) _n.age;
+
+ @#name := _name;
+ @#age := _age;
+enddef;
+\end{verbatim}
+
+This construction is rather inelegant. MetaUML offers alternative macros to achieve
+the same effect, uncluttering the code by removing the need for the unaesthetic {\code \_n\_} and
+{\code \_n}.
+
+\begin{verbatim}
+vardef Person@#(expr _name, _age)=
+ attributes(@#);
+ var(string) name;
+ var(numeric) age;
+
+ @#name := _name;
+ @#age := _age;
+enddef;
+\end{verbatim}
+
+\section{Customization in MetaUML: Examples}
+\label{section:customization}
+
+We have seen that in MetaUML the ``how to draw'' information is memorized into the so-called
+``{\code Info}'' structures. For example, the default way in which a {\code Picture} object is
+to be drawn is recorded into an instance of {\code PictureInfo}, named {\code iPict}. In this section we
+present a case study involving the customization of {\code Class} objects. The customization of
+any other MetaUML objects works similarly. Here we cannot possibly present all the customization
+options for all kinds of MetaUML objects: this would take too long. Nevertheless, an interested reader can refer
+to the top of the appropriate MetaUML library file, where {\code Info} structures are defined.
+For example, class diagram related definitions are in {\code metauml\_class.mp}, activity diagram
+definitions are in {\code metauml\_activity.mp} etc.
+
+\subsection{Global settings}
+
+Let us assume that we do not particularly like the default foreground color of all classes, and wish
+to change it so something yellowish. In this scenario, one would most likely want to change
+the appropriate field in {\code iClass}:
+
+\begin{verbatim}
+iClass.foreColor := (.9, .9, 0);
+\end{verbatim}
+
+After this, we can obtain the following result:
+
+\begin{multicols}{2}
+\begin{verbatim}
+Class.A("A")()();
+Class.B("B")()();
+Class.C("C")()();
+
+B.w = A.e + (20,0);
+C.n = .5[A.se, B.sw] + (0, -10);
+
+drawObjects(A, B, C);
+\end{verbatim}
+\columnbreak
+\hspace{1cm}\includegraphics{fig/class_customization.1}
+\end{multicols}
+
+\subsection{Individual settings}
+
+To modify the settings of one particular {\code Class} objects, another strategy is more appropriate. How about having class
+{\code C} stand out with a light blue foreground color, a bigger font size for the class name and a blue border?
+
+\begin{multicols}{2}
+\begin{verbatim}
+iPict.foreColor := (.9, .9, 0);
+
+Class.A("A")()();
+Class.B("B")()();
+Class.C("C")()();
+C.info.foreColor := (.9, .7, .7);
+C.info.borderColor := green;
+C.info.iName.iFont.scale := 2;
+
+% positioning code ommited
+drawObjects(A, B, C);
+\end{verbatim}
+\columnbreak
+\hspace{1cm}\includegraphics{fig/class_customization.2}
+\end{multicols}
+
+As an aside, each {\code Class} object has an {\code info} member which is created as
+a copy of {\code iClass}; the actual drawing is performed using this copied
+information. Because of that, the {\code info} member can be safely modified after the object
+has been created, obtaining the expected results and not influencing other objects.
+
+Another thing worth mentioning is that the {\code ClassInfo} structure contains
+the {\code iName} member, which is an instance of {\code PictureInfo}. In our example we
+do not want to modify the spacings around the {\code Picture} object,
+but the characteristics of the font its contents is typeset into. To do that,
+we modify the {\code iName.iFont} member, which by default is a copy of {\code iFont}
+(an instance of {\code FontInfo}, defined in {\code util\_picture.mp}).
+If, for example, we want to change the font the class name is rendered into, we would set
+the attribute {\code iName.iFont.name} to a string representing a font name
+on our system (as used with the MetaPost {\code infont} operator).
+
+\subsection{Predefined settings}
+
+This usage scenario is perhaps more interesting. Suppose that we have two
+types of classes which we want to draw differently. Making the setting adjustments
+for each individual class object would soon become a nuisance. MetaUML's solution consists in the
+ability of using predefined ``how to draw'' {\code Info} objects. Let us create such objects:
+
+\begin{verbatim}
+ClassInfoCopy.iHome(iClass);
+iHome.foreColor := (0, .9, .9);
+
+ClassInfo.iRemote;
+iRemote.foreColor := (.9, .9, 0);
+iRemote.borderColor := green;
+\end{verbatim}
+
+Object {\code iHome} is a copy of {\code iClass} (as it might have been set at
+the time of the macro call). Object {\code iRemote} is created just as {\code iClass}
+is originally created. We can now use these {\code Info} objects to easily set the
+``how to draw'' information for classes. The result is depicted below,
+please note the ``{\code E}'' prefix in {\code EClass}:
+
+\begin{multicols}{2}
+\begin{verbatim}
+EClass.A(iHome)("UserHome")()();
+EClass.B(iRemote)("UserRemote")()();
+EClass.C(iHome)("CartHome")()();
+EClass.D(iRemote)("CartRemote")()();
+\end{verbatim}
+\columnbreak
+\hspace{1cm}\includegraphics{fig/class_customization.3}
+\end{multicols}
+
+\subsection{Extreme customization}
+
+When another font (or font size) is used, it may become necessary to change the space between the
+baselines of attributes and methods. Figure below is the result of the (unlikely) code:
+
+\begin{multicols}{2}
+\begin{verbatim}
+Class.A("Foo")
+ ("a: int", "b: int")
+ ("foo()", "bar()", "gar()");
+
+A.info.iName.iFont.name := metauml_defaultFontBold;
+A.info.iName.iFont.scale := 1.2;
+
+A.info.iAttributeStack.iPict.iFont.scale := 0.8;
+A.info.iAttributeStack.top := 10;
+A.info.iAttributeStack.spacing := 11;
+
+A.info.iMethodStack.iPict.iFont.scale := 2;
+A.info.iMethodStack.spacing := 17;
+A.info.iMethodStack.bottom := 10;
+
+drawObject(A);
+\end{verbatim}
+\columnbreak
+\hspace{4cm}\includegraphics{fig/class_customization.4}
+\end{multicols}
+
+\begin{verbatim}
+\end{verbatim}
+
+Both {\code iAttributeStack} and {\code iMethodStack} are instances of
+{\code PictureStackInfo}, which is used to control the display of {\code PictureStack} objects.
+%We can also customize the size and colors of the ``locks'' by setting {\code A.info.iLock}.
+
+As font names, you can choose from the globally defined {\code metauml\_defaultFont}, {\code metauml\_defaultFontOblique}, {\code metauml\_defaultFontBold}, {\code metauml\_defaultFontBoldOblique}, or any other name of a font that is available on your system.
+
+\section{Alternatives to MetaUML}
+
+No software package is perfect, and for this MetaUML is a prime example. Here is a list of packages that may also be used to create UML diagrams for LaTeX work:
+
+\begin{itemize}
+\item uml.sty \cite{umlsty}
+\item pst-uml \cite{pstumlsty}
+\item umldoc \cite{umldoc}
+\item TiKZ-UML \cite{tikzuml}
+\end{itemize}
+
+Do not ignore the possibility of creating your diagrams using a GUI program, and then exporting them into a LaTex-friendly open format such as SVG \cite{svglatex}.
+
+\pagebreak
+\input{test-suite}
+
+\pagebreak
+\section{References}
+\printbibliography[heading=none]
+
+\end{document}
diff --git a/Master/texmf-dist/doc/metapost/metauml/manual/test-suite.tex b/Master/texmf-dist/doc/metapost/metauml/manual/test-suite.tex
new file mode 100644
index 00000000000..b0aa9a66856
--- /dev/null
+++ b/Master/texmf-dist/doc/metapost/metauml/manual/test-suite.tex
@@ -0,0 +1,82 @@
+% Part of the MetaUML manual
+% Copyright (c) 2005 Ovidiu Gheorghies
+%
+% Permission is granted to copy, distribute and/or modify this document
+% under the terms of the GNU Free Documentation License, Version 1.2
+% or any later version published by the Free Software Foundation;
+% with no Invariant Sections, no Front-Cover Texts, and no Back-Cover Texts.
+% A copy of the license is included in the section entitled "GNU
+% Free Documentation License".
+
+\newcommand{\metaumltest}[2]{Test #2 --- \\ \includegraphics{fig/test_#1.#2} \\ }
+\newcommand{\metaumltests}[2]{\multido{\iA=1+1}{#2}{\metaumltest{#1}{\iA}}}
+
+\section{Test Suite}
+
+\subsection{Low-level}
+ \metaumltests{lowlevel}{2}
+
+\subsection{Fonts}
+ \metaumltests{font}{3}
+
+\subsection{Util library}
+ \subsubsection{Picture tests}
+ \metaumltests{picture}{10}
+
+ \subsubsection{Picture tests - TeX rendering}
+ \metaumltests{picture_tex_rendering}{1}
+
+ \subsubsection{Group tests}
+ \metaumltests{group}{2}
+
+ \subsubsection{PictureStack tests}
+ \metaumltests{picture_stack}{7}
+
+ \subsubsection{Positioning tests}
+ \metaumltests{positioning}{6}
+
+\subsection{Class diagram}
+ \subsubsection{Class tests}
+ \metaumltests{class}{16}
+ \subsubsection{Class feature types tests}
+ \metaumltests{class_feature_types}{5}
+ \subsubsection{Class template tests}
+ \metaumltests{class_templates}{3}
+
+ \subsubsection{Qualified Association tests}
+ \metaumltests{class_qual_assoc}{2}
+
+\subsection{Package diagram}
+\subsubsection{Package tests}
+ \metaumltests{package}{2}
+
+\subsection{Component diagram}
+\subsubsection{Component tests}
+ \metaumltests{component}{1}
+
+\subsection{Paths}
+ \metaumltests{paths}{3}
+
+\subsection{Behavioral diagrams}
+ \subsubsection{Activity tests}
+ \metaumltests{activity}{2}
+
+ \subsubsection{State Machine tests}
+ \metaumltests{state}{5}
+
+ \subsubsection{Usecase tests}
+ \metaumltests{usecase}{9}
+
+\subsection{Miscelaneous}
+ \subsubsection{Notes}
+ \metaumltests{note}{2}
+ \subsubsection{Objects (Class Instances)}
+ \metaumltests{instance}{1}
+
+\subsection{User requests}
+ Test 1 --- \\ \includegraphics[scale=.2]{fig/test_lars_issues.1} \\
+ \metaumltest{lars_issues}{2}
+
+\subsection{Skins}
+ \metaumltests{skins}{1}
+ \metaumltests{skins_global_defaults}{1}