%!PS-Adobe-2.0 %%Creator: dvips 5.58 Copyright 1986, 1994 Radical Eye Software %%Title: mma2ltx.dvi %%CreationDate: Thu Jun 22 16:44:25 1995 %%Pages: 15 %%PageOrder: Ascend %%BoundingBox: 0 0 596 842 %%EndComments %DVIPSCommandLine: C:\TEX\BIN\dvips32.EXE mma2ltx -pj:c:\tmp\dv1.mfj %DVIPSParameters: dpi=300, compressed, comments removed %DVIPSSource: TeX output 1995.06.21:1413 %%BeginProcSet: texc.pro /TeXDict 250 dict def TeXDict begin /N{def}def /B{bind def}N /S{exch}N /X{S N}B /TR{translate}N /isls false N /vsize 11 72 mul N /hsize 8.5 72 mul N /landplus90{false}def /@rigin{isls{[0 landplus90{1 -1}{-1 1} ifelse 0 0 0]concat}if 72 Resolution div 72 VResolution div neg scale isls{landplus90{VResolution 72 div vsize mul 0 exch}{Resolution -72 div hsize mul 0}ifelse TR}if Resolution VResolution vsize -72 div 1 add mul TR[matrix currentmatrix{dup dup round sub abs 0.00001 lt{round}if} forall round exch round exch]setmatrix}N /@landscape{/isls true N}B /@manualfeed{statusdict /manualfeed true put}B /@copies{/#copies X}B /FMat[1 0 0 -1 0 0]N /FBB[0 0 0 0]N /nn 0 N /IE 0 N /ctr 0 N /df-tail{ /nn 8 dict N nn begin /FontType 3 N /FontMatrix fntrx N /FontBBox FBB N string /base X array /BitMaps X /BuildChar{CharBuilder}N /Encoding IE N end dup{/foo setfont}2 array copy cvx N load 0 nn put /ctr 0 N[}B /df{ /sf 1 N /fntrx FMat N df-tail}B /dfs{div /sf X /fntrx[sf 0 0 sf neg 0 0] N df-tail}B /E{pop nn dup definefont setfont}B /ch-width{ch-data dup length 5 sub get}B /ch-height{ch-data dup length 4 sub get}B /ch-xoff{ 128 ch-data dup length 3 sub get sub}B /ch-yoff{ch-data dup length 2 sub get 127 sub}B /ch-dx{ch-data dup length 1 sub get}B /ch-image{ch-data dup type /stringtype ne{ctr get /ctr ctr 1 add N}if}B /id 0 N /rw 0 N /rc 0 N /gp 0 N /cp 0 N /G 0 N /sf 0 N /CharBuilder{save 3 1 roll S dup /base get 2 index get S /BitMaps get S get /ch-data X pop /ctr 0 N ch-dx 0 ch-xoff ch-yoff ch-height sub ch-xoff ch-width add ch-yoff setcachedevice ch-width ch-height true[1 0 0 -1 -.1 ch-xoff sub ch-yoff .1 sub]/id ch-image N /rw ch-width 7 add 8 idiv string N /rc 0 N /gp 0 N /cp 0 N{rc 0 ne{rc 1 sub /rc X rw}{G}ifelse}imagemask restore}B /G{{id gp get /gp gp 1 add N dup 18 mod S 18 idiv pl S get exec}loop}B /adv{cp add /cp X}B /chg{rw cp id gp 4 index getinterval putinterval dup gp add /gp X adv}B /nd{/cp 0 N rw exit}B /lsh{rw cp 2 copy get dup 0 eq{pop 1}{ dup 255 eq{pop 254}{dup dup add 255 and S 1 and or}ifelse}ifelse put 1 adv}B /rsh{rw cp 2 copy get dup 0 eq{pop 128}{dup 255 eq{pop 127}{dup 2 idiv S 128 and or}ifelse}ifelse put 1 adv}B /clr{rw cp 2 index string putinterval adv}B /set{rw cp fillstr 0 4 index getinterval putinterval adv}B /fillstr 18 string 0 1 17{2 copy 255 put pop}for N /pl[{adv 1 chg} {adv 1 chg nd}{1 add chg}{1 add chg nd}{adv lsh}{adv lsh nd}{adv rsh}{ adv rsh nd}{1 add adv}{/rc X nd}{1 add set}{1 add clr}{adv 2 chg}{adv 2 chg nd}{pop nd}]dup{bind pop}forall N /D{/cc X dup type /stringtype ne{] }if nn /base get cc ctr put nn /BitMaps get S ctr S sf 1 ne{dup dup length 1 sub dup 2 index S get sf div put}if put /ctr ctr 1 add N}B /I{ cc 1 add D}B /bop{userdict /bop-hook known{bop-hook}if /SI save N @rigin 0 0 moveto /V matrix currentmatrix dup 1 get dup mul exch 0 get dup mul add .99 lt{/QV}{/RV}ifelse load def pop pop}N /eop{SI restore showpage userdict /eop-hook known{eop-hook}if}N /@start{userdict /start-hook known{start-hook}if pop /VResolution X /Resolution X 1000 div /DVImag X /IE 256 array N 0 1 255{IE S 1 string dup 0 3 index put cvn put}for 65781.76 div /vsize X 65781.76 div /hsize X}N /p{show}N /RMat[1 0 0 -1 0 0]N /BDot 260 string N /rulex 0 N /ruley 0 N /v{/ruley X /rulex X V}B /V {}B /RV statusdict begin /product where{pop product dup length 7 ge{0 7 getinterval dup(Display)eq exch 0 4 getinterval(NeXT)eq or}{pop false} ifelse}{false}ifelse end{{gsave TR -.1 .1 TR 1 1 scale rulex ruley false RMat{BDot}imagemask grestore}}{{gsave TR -.1 .1 TR rulex ruley scale 1 1 false RMat{BDot}imagemask grestore}}ifelse B /QV{gsave newpath transform round exch round exch itransform moveto rulex 0 rlineto 0 ruley neg rlineto rulex neg 0 rlineto fill grestore}B /a{moveto}B /delta 0 N /tail {dup /delta X 0 rmoveto}B /M{S p delta add tail}B /b{S p tail}B /c{-4 M} B /d{-3 M}B /e{-2 M}B /f{-1 M}B /g{0 M}B /h{1 M}B /i{2 M}B /j{3 M}B /k{ 4 M}B /w{0 rmoveto}B /l{p -4 w}B /m{p -3 w}B /n{p -2 w}B /o{p -1 w}B /q{ p 1 w}B /r{p 2 w}B /s{p 3 w}B /t{p 4 w}B /x{0 S rmoveto}B /y{3 2 roll p a}B /bos{/SS save N}B /eos{SS restore}B end %%EndProcSet %%BeginProcSet: texmma22.pro /Mathdict 150 dict def Mathdict begin /Mlmarg 0 def /Mrmarg 0 def /Mbmarg 0 def /Mtmarg 0 def /Mtransform{}bind def /Mfixwid true def /Mfixdash false def /Mrot 0 def /Mpstart{MathPictureStart}bind def /Mpend{MathPictureEnd}bind def /Mscale{0 1 0 1 5 -1 roll MathScale}bind def /ISOLatin1Encoding dup where{pop pop}{[/.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /space /exclam /quotedbl /numbersign /dollar /percent /ampersand /quoteright /parenleft /parenright /asterisk /plus /comma /minus /period /slash /zero /one /two /three /four /five /six /seven /eight /nine /colon /semicolon /less /equal /greater /question /at /A /B /C /D /E /F /G /H /I /J /K /L /M /N /O /P /Q /R /S /T /U /V /W /X /Y /Z /bracketleft /backslash /bracketright /asciicircum /underscore /quoteleft /a /b /c /d /e /f /g /h /i /j /k /l /m /n /o /p /q /r /s /t /u /v /w /x /y /z /braceleft /bar /braceright /asciitilde /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /dotlessi /grave /acute /circumflex /tilde /macron /breve /dotaccent /dieresis /.notdef /ring /cedilla /.notdef /hungarumlaut /ogonek /caron /space /exclamdown /cent /sterling /currency /yen /brokenbar /section /dieresis /copyright /ordfeminine /guillemotleft /logicalnot /hyphen /registered /macron /degree /plusminus /twosuperior /threesuperior /acute /mu /paragraph /periodcentered /cedilla /onesuperior /ordmasculine /guillemotright /onequarter /onehalf /threequarters /questiondown /Agrave /Aacute /Acircumflex /Atilde /Adieresis /Aring /AE /Ccedilla /Egrave /Eacute /Ecircumflex /Edieresis /Igrave /Iacute /Icircumflex /Idieresis /Eth /Ntilde /Ograve /Oacute /Ocircumflex /Otilde /Odieresis /multiply /Oslash /Ugrave /Uacute /Ucircumflex /Udieresis /Yacute /Thorn /germandbls /agrave /aacute /acircumflex /atilde /adieresis /aring /ae /ccedilla /egrave /eacute /ecircumflex /edieresis /igrave /iacute /icircumflex /idieresis /eth /ntilde /ograve /oacute /ocircumflex /otilde /odieresis /divide /oslash /ugrave /uacute /ucircumflex /udieresis /yacute /thorn /ydieresis]def}ifelse /MFontDict 50 dict def /MStrCat{exch dup length 2 index length add string dup 3 1 roll copy length exch dup 4 2 roll exch putinterval}def /MCreateEncoding{1 index 255 string cvs(-)MStrCat 1 index MStrCat cvn exch(Encoding)MStrCat cvn dup where{exch get}{pop StandardEncoding}ifelse 3 1 roll dup MFontDict exch known not{1 index findfont dup length dict begin{1 index /FID ne{ def}{pop pop}ifelse}forall /Encoding 3 index def currentdict end 1 index exch definefont pop MFontDict 1 index null put}if exch pop exch pop}def /ISOLatin1{(ISOLatin1)MCreateEncoding}def /ISO8859{(ISOLatin1) MCreateEncoding}def /Mcopyfont{dup maxlength dict exch{1 index /FID eq{ pop pop}{2 index 3 1 roll put}ifelse}forall}def /Plain /Courier findfont Mcopyfont definefont pop /Bold /Courier-Bold findfont Mcopyfont definefont pop /Italic /Courier-Oblique findfont Mcopyfont definefont pop /MathPictureStart{gsave Mtransform Mlmarg Mbmarg translate Mwidth Mlmarg Mrmarg add sub /Mwidth exch def Mheight Mbmarg Mtmarg add sub /Mheight exch def /Mtmatrix matrix currentmatrix def /Mgmatrix matrix currentmatrix def}bind def /MathPictureEnd{grestore}bind def /MFill{0 0 moveto Mwidth 0 lineto Mwidth Mheight lineto 0 Mheight lineto fill}bind def /MPlotRegion{3 index Mwidth mul 2 index Mheight mul translate exch sub Mheight mul /Mheight exch def exch sub Mwidth mul /Mwidth exch def} bind def /MathSubStart{Momatrix Mgmatrix Mtmatrix Mwidth Mheight 7 -2 roll moveto Mtmatrix setmatrix currentpoint Mgmatrix setmatrix 9 -2 roll moveto Mtmatrix setmatrix currentpoint 2 copy translate /Mtmatrix matrix currentmatrix def 3 -1 roll exch sub /Mheight exch def sub /Mwidth exch def}bind def /MathSubEnd{/Mheight exch def /Mwidth exch def /Mtmatrix exch def dup setmatrix /Mgmatrix exch def /Momatrix exch def}bind def /Mdot{moveto 0 0 rlineto stroke}bind def /Mtetra{moveto lineto lineto lineto fill}bind def /Metetra{moveto lineto lineto lineto closepath gsave fill grestore 0 setgray stroke}bind def /Mistroke{flattenpath 0 0 0{4 2 roll pop pop}{4 -1 roll 2 index sub dup mul 4 -1 roll 2 index sub dup mul add sqrt 4 -1 roll add 3 1 roll}{stop}{stop}pathforall pop pop currentpoint stroke moveto currentdash 3 -1 roll add setdash}bind def /Mfstroke{stroke currentdash pop 0 setdash}bind def /Mrotsboxa{gsave dup /Mrot exch def Mrotcheck Mtmatrix dup setmatrix 7 1 roll 4 index 4 index translate rotate 3 index -1 mul 3 index -1 mul translate /Mtmatrix matrix currentmatrix def grestore Msboxa 3 -1 roll /Mtmatrix exch def /Mrot 0 def}bind def /Msboxa{newpath 5 -1 roll Mvboxa pop Mboxout 6 -1 roll 5 -1 roll 4 -1 roll Msboxa1 5 -3 roll Msboxa1 Mboxrot[7 -2 roll 2 copy[3 1 roll 10 -1 roll 9 -1 roll]6 1 roll 5 -2 roll]}bind def /Msboxa1 {sub 2 div dup 2 index 1 add mul 3 -1 roll -1 add 3 -1 roll mul}bind def /Mvboxa{Mfixwid{Mvboxa1}{dup Mwidthcal 0 exch{add}forall exch Mvboxa1 4 index 7 -1 roll add 4 -1 roll pop 3 1 roll}ifelse}bind def /Mvboxa1{ gsave newpath[true 3 -1 roll{Mbbox 5 -1 roll{0 5 1 roll}{7 -1 roll exch sub(m)stringwidth pop .3 mul sub 7 1 roll 6 -1 roll 4 -1 roll Mmin 3 -1 roll 5 index add 5 -1 roll 4 -1 roll Mmax 4 -1 roll}ifelse false}forall{ stop}if counttomark 1 add 4 roll]grestore}bind def /Mbbox{1 dict begin 0 0 moveto /temp(T)def{gsave currentpoint newpath moveto temp 0 3 -1 roll put temp false charpath flattenpath currentpoint pathbbox grestore moveto lineto moveto}forall pathbbox newpath end}bind def /Mmin{2 copy gt{exch}if pop}bind def /Mmax{2 copy lt{exch}if pop}bind def /Mrotshowa{ dup /Mrot exch def Mrotcheck Mtmatrix dup setmatrix 7 1 roll 4 index 4 index translate rotate 3 index -1 mul 3 index -1 mul translate /Mtmatrix matrix currentmatrix def Mgmatrix setmatrix Mshowa /Mtmatrix exch def /Mrot 0 def}bind def /Mshowa{4 -2 roll moveto 2 index Mtmatrix setmatrix Mvboxa 7 1 roll Mboxout 6 -1 roll 5 -1 roll 4 -1 roll Mshowa1 4 1 roll Mshowa1 rmoveto currentpoint Mfixwid{Mshowax}{Mshoway}ifelse pop pop pop pop Mgmatrix setmatrix}bind def /Mshowax{0 1 4 index length -1 add{2 index 4 index 2 index get 3 index add moveto 4 index exch get Mfixdash{ Mfixdashp}if show}for}bind def /Mfixdashp{dup length 1 gt 1 index true exch{45 eq and}forall and{gsave(--)stringwidth pop(-)stringwidth pop sub 2 div 0 rmoveto dup length 1 sub{(-)show}repeat grestore}if}bind def /Mshoway{3 index Mwidthcal 5 1 roll 0 1 4 index length -1 add{2 index 4 index 2 index get 3 index add moveto 4 index exch get[6 index aload length 2 add -1 roll{pop Strform stringwidth pop neg exch add 0 rmoveto} exch kshow cleartomark}for pop}bind def /Mwidthcal{[exch{Mwidthcal1} forall][exch dup Maxlen -1 add 0 1 3 -1 roll{[exch 2 index{1 index Mget exch}forall pop Maxget exch}for pop]Mreva}bind def /Mreva{[exch aload length -1 1{1 roll}for]}bind def /Mget{1 index length -1 add 1 index ge{ get}{pop pop 0}ifelse}bind def /Maxlen{[exch{length}forall Maxget}bind def /Maxget{counttomark -1 add 1 1 3 -1 roll{pop Mmax}for exch pop}bind def /Mwidthcal1{[exch{Strform stringwidth pop}forall]}bind def /Strform{ /tem(x)def tem 0 3 -1 roll put tem}bind def /Mshowa1{2 copy add 4 1 roll sub mul sub -2 div}bind def /MathScale{Mwidth Mheight Mlp translate scale /yscale exch def /ybias exch def /xscale exch def /xbias exch def /Momatrix xscale yscale matrix scale xbias ybias matrix translate matrix concatmatrix def /Mgmatrix matrix currentmatrix def}bind def /Mlp{3 copy Mlpfirst{Mnodistort{Mmin dup}if 4 index 2 index 2 index Mlprun 11 index 11 -1 roll 10 -4 roll Mlp1 8 index 9 -5 roll Mlp1 4 -1 roll and{exit}if 3 -1 roll pop pop}loop exch 3 1 roll 7 -3 roll pop pop pop}bind def /Mlpfirst{3 -1 roll dup length 2 copy -2 add get aload pop pop pop 4 -2 roll -1 add get aload pop pop pop 6 -1 roll 3 -1 roll 5 -1 roll sub div 4 1 roll exch sub div}bind def /Mlprun{2 copy 4 index 0 get dup 4 1 roll Mlprun1 3 copy 8 -2 roll 9 -1 roll{3 copy Mlprun1 3 copy 11 -3 roll /gt Mlpminmax 8 3 roll 11 -3 roll /lt Mlpminmax 8 3 roll}forall pop pop pop pop 3 1 roll pop pop aload pop 5 -1 roll aload pop exch 6 -1 roll Mlprun2 8 2 roll 4 -1 roll Mlprun2 6 2 roll 3 -1 roll Mlprun2 4 2 roll exch Mlprun2 6 2 roll}bind def /Mlprun1{aload pop exch 6 -1 roll 5 -1 roll mul add 4 -2 roll mul 3 -1 roll add}bind def /Mlprun2{2 copy add 2 div 3 1 roll exch sub}bind def /Mlpminmax{cvx 2 index 6 index 2 index exec{7 -3 roll 4 -1 roll}if 1 index 5 index 3 -1 roll exec{4 1 roll pop 5 -1 roll aload pop pop 4 -1 roll aload pop[8 -2 roll pop 5 -2 roll pop 6 -2 roll pop 5 -1 roll]4 1 roll pop}{pop pop pop}ifelse}bind def /Mlp1{ 5 index 3 index sub 5 index 2 index mul 1 index le 1 index 0 le or dup not{1 index 3 index div .99999 mul 8 -1 roll pop 7 1 roll}if 8 -1 roll 2 div 7 -2 roll pop sub 5 index 6 -3 roll pop pop mul sub exch}bind def /intop 0 def /inrht 0 def /inflag 0 def /outflag 0 def /xadrht 0 def /xadlft 0 def /yadtop 0 def /yadbot 0 def /Minner{outflag 1 eq{/outflag 0 def /intop 0 def /inrht 0 def}if 5 index gsave Mtmatrix setmatrix Mvboxa pop grestore 3 -1 roll pop dup intop gt{/intop exch def}{pop} ifelse dup inrht gt{/inrht exch def}{pop}ifelse pop /inflag 1 def}bind def /Mouter{/xadrht 0 def /xadlft 0 def /yadtop 0 def /yadbot 0 def inflag 1 eq{dup 0 lt{dup intop mul neg /yadtop exch def}if dup 0 gt{dup intop mul /yadbot exch def}if pop dup 0 lt{dup inrht mul neg /xadrht exch def}if dup 0 gt{dup inrht mul /xadlft exch def}if pop /outflag 1 def}{pop pop}ifelse /inflag 0 def /inrht 0 def /intop 0 def}bind def /Mboxout{outflag 1 eq{4 -1 roll xadlft leadjust add sub 4 1 roll 3 -1 roll yadbot leadjust add sub 3 1 roll exch xadrht leadjust add add exch yadtop leadjust add add /outflag 0 def /xadlft 0 def /yadbot 0 def /xadrht 0 def /yadtop 0 def}if}bind def /leadjust{(m)stringwidth pop .5 mul}bind def /Mrotcheck{dup 90 eq{yadbot /yadbot xadrht def /xadrht yadtop def /yadtop xadlft def /xadlft exch def}if dup cos 1 index sin Checkaux dup cos 1 index sin neg exch Checkaux 3 1 roll pop pop}bind def /Checkaux{4 index exch 4 index mul 3 1 roll mul add 4 1 roll}bind def /Mboxrot{Mrot 90 eq{brotaux 4 2 roll}if Mrot 180 eq{4 2 roll brotaux 4 2 roll brotaux}if Mrot 270 eq{4 2 roll brotaux}if}bind def /brotaux{neg exch neg}bind def /Mabsproc{0 matrix defaultmatrix dtransform idtransform dup mul exch dup mul add sqrt}bind def /Mabswid{Mabsproc setlinewidth}bind def /Mabsdash{exch[exch{Mabsproc}forall]exch setdash} bind def /MBeginOrig{Momatrix concat}bind def /MEndOrig{Mgmatrix setmatrix}bind def /sampledsound where{pop}{/sampledsound{exch pop exch 5 1 roll mul 4 idiv mul 2 idiv exch pop exch /Mtempproc exch def{ Mtempproc pop}repeat}bind def}ifelse /g{setgray}bind def /k{ setcmykcolor}bind def /m{moveto}bind def /p{gsave}bind def /r{ setrgbcolor}bind def /w{setlinewidth}bind def /C{curveto}bind def /F{ fill}bind def /L{lineto}bind def /P{grestore}bind def /s{stroke}bind def /setcmykcolor where{pop}{/setcmykcolor{4 1 roll[4 1 roll]{1 index sub 1 sub neg dup 0 lt{pop 0}if dup 1 gt{pop 1}if exch}forall pop setrgbcolor} bind def}ifelse /Mcharproc{currentfile(x)readhexstring pop 0 get exch div}bind def /Mshadeproc{dup 3 1 roll{dup Mcharproc 3 1 roll}repeat 1 eq {setgray}{3 eq{setrgbcolor}{setcmykcolor}ifelse}ifelse}bind def /Mrectproc{3 index 2 index moveto 2 index 3 -1 roll lineto dup 3 1 roll lineto lineto fill}bind def /Mcolorimage{7 1 roll pop pop matrix invertmatrix concat 2 exch exp 1 sub 3 1 roll 1 1 2 index{1 1 4 index{ dup 1 sub exch 2 index dup 1 sub exch 7 index 9 index Mshadeproc Mrectproc}for pop}for pop pop pop pop}bind def /Mimage{pop matrix invertmatrix concat 2 exch exp 1 sub 3 1 roll 1 1 2 index{1 1 4 index{ dup 1 sub exch 2 index dup 1 sub exch 7 index Mcharproc setgray Mrectproc}for pop}for pop pop pop}bind def end %%EndProcSet %%BeginProcSet: finclude.pro /fstore{dup dict exch{dup 4 2 roll put}repeat def}bind def /fshow{gsave 72 TeXDict /Resolution get div -72 TeXDict /VResolution get div scale 1 DVImag div dup scale get cvx exec show grestore}bind def %%EndProcSet %%BeginProcSet: special.pro TeXDict begin /SDict 200 dict N SDict begin /@SpecialDefaults{/hs 612 N /vs 792 N /ho 0 N /vo 0 N /hsc 1 N /vsc 1 N /ang 0 N /CLIP 0 N /rwiSeen false N /rhiSeen false N /letter{}N /note{}N /a4{}N /legal{}N}B /@scaleunit 100 N /@hscale{@scaleunit div /hsc X}B /@vscale{@scaleunit div /vsc X}B /@hsize{/hs X /CLIP 1 N}B /@vsize{/vs X /CLIP 1 N}B /@clip{ /CLIP 2 N}B /@hoffset{/ho X}B /@voffset{/vo X}B /@angle{/ang X}B /@rwi{ 10 div /rwi X /rwiSeen true N}B /@rhi{10 div /rhi X /rhiSeen true N}B /@llx{/llx X}B /@lly{/lly X}B /@urx{/urx X}B /@ury{/ury X}B /magscale true def end /@MacSetUp{userdict /md known{userdict /md get type /dicttype eq{userdict begin md length 10 add md maxlength ge{/md md dup length 20 add dict copy def}if end md begin /letter{}N /note{}N /legal{} N /od{txpose 1 0 mtx defaultmatrix dtransform S atan/pa X newpath clippath mark{transform{itransform moveto}}{transform{itransform lineto} }{6 -2 roll transform 6 -2 roll transform 6 -2 roll transform{ itransform 6 2 roll itransform 6 2 roll itransform 6 2 roll curveto}}{{ closepath}}pathforall newpath counttomark array astore /gc xdf pop ct 39 0 put 10 fz 0 fs 2 F/|______Courier fnt invertflag{PaintBlack}if}N /txpose{pxs pys scale ppr aload pop por{noflips{pop S neg S TR pop 1 -1 scale}if xflip yflip and{pop S neg S TR 180 rotate 1 -1 scale ppr 3 get ppr 1 get neg sub neg ppr 2 get ppr 0 get neg sub neg TR}if xflip yflip not and{pop S neg S TR pop 180 rotate ppr 3 get ppr 1 get neg sub neg 0 TR}if yflip xflip not and{ppr 1 get neg ppr 0 get neg TR}if}{noflips{TR pop pop 270 rotate 1 -1 scale}if xflip yflip and{TR pop pop 90 rotate 1 -1 scale ppr 3 get ppr 1 get neg sub neg ppr 2 get ppr 0 get neg sub neg TR}if xflip yflip not and{TR pop pop 90 rotate ppr 3 get ppr 1 get neg sub neg 0 TR}if yflip xflip not and{TR pop pop 270 rotate ppr 2 get ppr 0 get neg sub neg 0 S TR}if}ifelse scaleby96{ppr aload pop 4 -1 roll add 2 div 3 1 roll add 2 div 2 copy TR .96 dup scale neg S neg S TR}if}N /cp {pop pop showpage pm restore}N end}if}if}N /normalscale{Resolution 72 div VResolution 72 div neg scale magscale{DVImag dup scale}if 0 setgray} N /psfts{S 65781.76 div N}N /startTexFig{/psf$SavedState save N userdict maxlength dict begin /magscale true def normalscale currentpoint TR /psf$ury psfts /psf$urx psfts /psf$lly psfts /psf$llx psfts /psf$y psfts /psf$x psfts currentpoint /psf$cy X /psf$cx X /psf$sx psf$x psf$urx psf$llx sub div N /psf$sy psf$y psf$ury psf$lly sub div N psf$sx psf$sy scale psf$cx psf$sx div psf$llx sub psf$cy psf$sy div psf$ury sub TR /showpage{}N /erasepage{}N /copypage{}N /p 3 def @MacSetUp}N /doclip{ psf$llx psf$lly psf$urx psf$ury currentpoint 6 2 roll newpath 4 copy 4 2 roll moveto 6 -1 roll S lineto S lineto S lineto closepath clip newpath moveto}N /endTexFig{end psf$SavedState restore}N /@beginspecial{SDict begin /SpecialSave save N gsave normalscale currentpoint TR @SpecialDefaults count /ocount X /dcount countdictstack N}N /@setspecial {CLIP 1 eq{newpath 0 0 moveto hs 0 rlineto 0 vs rlineto hs neg 0 rlineto closepath clip}if ho vo TR hsc vsc scale ang rotate rwiSeen{rwi urx llx sub div rhiSeen{rhi ury lly sub div}{dup}ifelse scale llx neg lly neg TR }{rhiSeen{rhi ury lly sub div dup scale llx neg lly neg TR}if}ifelse CLIP 2 eq{newpath llx lly moveto urx lly lineto urx ury lineto llx ury lineto closepath clip}if /showpage{}N /erasepage{}N /copypage{}N newpath }N /@endspecial{count ocount sub{pop}repeat countdictstack dcount sub{ end}repeat grestore SpecialSave restore end}N /@defspecial{SDict begin} N /@fedspecial{end}B /li{lineto}B /rl{rlineto}B /rc{rcurveto}B /np{ /SaveX currentpoint /SaveY X N 1 setlinecap newpath}N /st{stroke SaveX SaveY moveto}N /fil{fill SaveX SaveY moveto}N /ellipse{/endangle X /startangle X /yrad X /xrad X /savematrix matrix currentmatrix N TR xrad yrad scale 0 0 1 startangle endangle arc savematrix setmatrix}N end %%EndProcSet TeXDict begin 39158280 55380996 1000 300 300 (/TMP/MMA2LTX-/mma2ltx.dvi) @start /Fa 6 121 df101 D111 D<387FC0FE39FFE3FFC001EF7F6CB57E0003EB83F849C67E01F8133E49133F8149EB0F80 A216C01507A7150F6D1480151F16006D5B157E6D5B9038FF07F8ECFFF001EF5B01E71380 D9E1FEC7FC01E0C8FCACEA7FFFB57EA26C90C8FC222F7F9E26>I<397FF803FC39FFFC1F FE4A7E007F90B5128039007DFE1FEB7FF09138E00F00ECC0064AC7FC91C8FCA2137EA313 7CAD007FB5FCB67EA26C91C7FC211F7E9E26>114 D<1338137CA8007FB512E0B612F0A2 6C14E0D8007CC7FCAF1538157CA5017E13FC90383F03F890381FFFF06D13E06D13C00101 13001E287EA726>116 D<397FF81FFE486C487EA26C486C5A3903E003C03801F0070000 495A6D48C7FCEB7C1EEB3E3EEB1E7C6D5A5C6D5A1303A21307497E1478EB1E3CEB3C3EEB 7C1EEB780F01F07F00016D7E3803E003496C7E397FF80FFF486C481380A26C486C130021 1F7E9E26>120 D E /Fb 2 122 df120 DI E /Fc 8 117 df77 D97 D<903801FF80010F13E090383E01F0EBF8033801F007EA03E03807C003D80F 8013E0001F90C7FC90C8FC5AA2127EA45AA4127CA2127E003E14C0A26CEB0180390F8003 003807C0063803F03C3801FFF038003FC01C1F7C9E20>99 D101 D104 D<130FEB1F80133F14C0EB7F 80133F1400131E90C7FCAA133EEA07FEA21200137CA65BA6485AA6485AA51207A2EAFFFE A212317EB014>I<90263E03F8EB3F80270FFE0FFEEBFFE0913A381F0381F00000903A60 0F8600F890277C8007C8137CD97D0013D0017E14E0A2017C5CA201FC010F14F8495CA548 4890391F0001F0A64848013EEB03E0A50007027E1307A2B5260FFFF0B5FCA2381F7E9E3C >109 D<1318A31338A213301370A213F012011203485A121FB512F8A23803E000A2485A A6485AA648C7FCA21460A4003E13C0A3EB0180121E381F0300EA0F86EA07FCEA01F0152C 7AAB1C>116 D E /Fd 10 120 df100 D<13F8EA0704120CEA1802EA38041230EA7008EA7FF0EAE000A5EA60041308EA30101360 EA0F800F127C9113>I 103 DII108 D110 D115 D<12035AA3120EA4EAFFE0EA1C00A35AA45AA4EAE080A2EAE100A2126612380B1A7C990E >I<381E0183382703871247148338870701A2120EA2381C0E02A31404EA180C131C1408 EA1C1E380C26303807C3C018127C911C>119 D E /Fe 1 1 df 0 D E /Ff 2 60 df<124012E0124003037D8209>58 D<124012E012601220A21240A212 8003087D8209>I E /Fg 6 54 df<120412081210123012201260A2124012C0AA124012 60A212201230121012081204061A7D920C>40 D<128012401220123012101218A2120812 0CAA12081218A212101230122012401280061A7F920C>I<121FEA3180EA60C0EA4040EA C060A8EA4040EA60C0EA3180EA1F000B107F8F0F>48 D<1218127812981218AC12FF0810 7D8F0F>I<121FEA6180EA40C0EA806012C01200A213C0EA0180EA030012065AEA102012 20EA7FC012FF0B107F8F0F>I53 D E /Fh 1 115 df<120FEA3FC0EA7FE0 A2EAFFF0A4EA7FE0A2EA3FC0EA0F000C0C86850C>114 D E /Fi 1 121 df120 D E /Fj 5 121 df<1438147814F81303130F137FEA0FFFEAFFF71387EAF0071200B3B3 B1497EEB3FFFB712C0A3224477C334>49 D<003FBAFCA3903BF8000FFE000701C06D4813 0090C7163F007EF01F80007C180FA200781807A300701803A500F019C0481801A5C893C7 FCB3B3A64B7E92383FFF800103B712F8A342467CC54B>84 D101 D<130EA7131EA4133EA3137EA213FE12011203 1207001FB512FCB6FCA2C648C7FCB3A4150EAB017E131C137F7F151890381F803890380F C070903807E0E0903801FFC09038007F001F417EBF28>116 D<267FFFF890B512C0A300 0101E090387FFC006C6C48EB3FE0013FEC1F80011F92C7FC6E131E6D6C5B01075C6D6C5B 6E5B903801FE010100495A91387F0780DA3F8FC8FC15CEEC1FDEEC0FFC6E5AA26E7E1401 4A7E4A7E4A6C7EEC0E3F91381E1FC04A6C7E02787F4A6C7EECE00301016D7ED903C07F49 486C7E49C77E707E496E7E017F81484881000F6DEB7FFCB5D8E001B512F0A3342C7FAB37 >120 D E /Fk 2 55 df<7E12F012FCB4FC13E013FEA213E0130012FC12F012800F0C67 852A>45 D<1206A4120FA3EA1F80A2EA3FC0A2EA7FE0A3EAFFF00C0F86A72A>54 D E /Fl 1 49 df<1206120FA2120E121EA2121C123C1238A212301270A2126012E012C0 124008117F910A>48 D E /Fm 3 122 df<381FFFFE38381C0E00201304126012401338 128000001300A25BA45BA4485AA41203EA3FFC17177F9615>84 D120 DI E /Fn 4 121 df<126012F0A2126004047C830C>58 D<130113031306A3130CA31318A31330A31360A213C0A3EA0180A3EA0300A31206A25AA3 5AA35AA35AA35AA210297E9E15>61 D102 D<380787803808C8403810F0C03820F1E0EBE3C03840E1803800E000A2485AA438 63808012F3EB810012E5EA84C6EA787813127E9118>120 D E /Fo 15 120 df<387FFFFEB6FCA36C13FE18057D941F>45 D63 D97 DIII<13 7F3801FFC0000713E04813F0381F81F8383F0078003C133C127C0078131EA2B512FEA400 F0C7FCA21278A2007C131E7E381F803EEBE07C380FFFF8000313F06C13E038003F80171A 7D991F>I<14FCEB03FF010F13805BEB3E0F90383C070049C7FCA5387FFFFEB5FCA3D800 78C7FCB2383FFFF0487FA26C5B19257FA41F>I104 D<387F87E038FF9FF0EBBFF86CB47E3807F83CEBE01E13C0A21380AE39 7FF87FE039FFFCFFF0A2397FF87FE01C1A7F991F>110 D<13FCEA03FF481380001F13E0 1387383E01F0387C00F800781378A248133CA76C137C00781378007C13F8A2383E01F038 1F87E013FF000713806C1300EA00FC161A7C991F>I<387F87E038FF9FF8EBBFFE6CB5FC 3807F83F9038E00F80EBC007EC03C0138015E01401A6140315C0EBC0071580EBE00F9038 F03F00EBFFFEEBBFFCEB9FF8EB87C00180C7FCA9EA7FF8487EA26C5A1B277F991F>I<38 03FC70380FFFF0123F5AEA7C03EAF801EAF000A27E007C1300EA3FE06CB4FC000713C0C6 13E0EB07F0EB00F80070137C00F0133CA27E6C137C38FF01F8EBFFF0A200E713C038E1FE 00161A7C991F>115 D<387F81FEEAFF83A2EA7F813807801EAF143EA2EBC0FE6CB512E0 15F06C139F39007E1FE01C1A7F991F>117 D<39FFE07FF0A4391C000380A3001E130700 0E1400A2EB0F87A2131F000613C638071DCEA2133D14EEA2380338ECA21378EBF8FCEBF0 7CA23801E0781C1A7F991F>119 D E /Fp 20 117 df<12FFA808087B8712>46 D48 D<130E131F137F485A123F5AB5FC7EC6FCB3AD003F 13FE4813FFA26C13FE182B7CAA21>I<13FF000313E0000F7F4813FC487FA2387F83FFD8 FE0113807F007C137F003C14C012380018133F1208C7FC147FA21580A2ECFF00A2495A49 5A5C495A495A495A495A49C7FC13FE13F8485A485A485A485A48C8FC123E007FB51280B6 12C0A46C14801A2B7DAA21>III<000FB5FC481480A4150001E0C7FCA9EBFFE014F814FE8001F01380EB C07F9038803FC0A2EA0F00C713E0A712101230003814C0007C137F127E39FF81FF806CB5 FC6C14006C5B6C5B000313F0C613801B2B7EA921>II<007FB51280B612C0A46C1480C7121FEC3F00147E14FE495A495AA2 495A130F5C131F133F5C137F5CA213FF91C7FC5AA35B1203A5485AA86C5A1A2A7DA921> III79 D97 D100 D<127FEAFF80A7EA7F00C7FCA7123FEA7F80B3A7EA3F0009 2B7EAA0F>105 D<387E03F838FF0FFE497E5B01601380EBC07F1380A21300B2007EEB3F 00191B7C9A22>110 DI<387E07F038FF3FFC497E90B5FC01C113809038007FC0143FA215 E0141FA9EC3FC0A3EC7F80EBC1FF90B512006D5AEB3FF8EB0FE090C8FCAB127E1B277C9A 22>I115 DI E /Fq 17 122 df<000FB5FC5A5A3870418000401300EA8081A21200EA01831303A21203A21206 A2120EA2000C1380121CA2EA180118157E941C>25 D<133F3801FFC0380381E038040040 4813005AA31360EA0B98EA0FF80010C7FC5A5AA35A6C1380124038600100EA300EEA1FFC EA07E013177F9517>34 D<127012F8A3127005057C840E>58 D<127012F812FCA2127412 04A41208A21210A212201240060F7C840E>I<14801301A2EB0300A31306A35BA35BA35B A35BA35BA3485AA448C7FCA31206A35AA35AA35AA35AA35AA311317DA418>61 D<001FB512FE391E01E00E001814061230382003C0A200401404A2EB07801280A2000014 0049C7FCA4131EA45BA45BA45BA41201387FFFC01F227EA11D>84 D<141E14FC141CA31438A41470A414E01378EA01C4EA0302380601C0120E121C123C3838 03801278A338F00700A31408EB0E101270131E38302620EA18C6380F03C017237EA219> 100 D<137EEA038138070080120E5A5A38780100EA7006EAFFF800F0C7FCA25AA41480A2 38700300EA3004EA1838EA0FC011157D9417>I<141EEC638014C71301ECC30014801303 A449C7FCA4EBFFF8010EC7FCA65BA55BA55BA4136013E0A25BA21271EAF18090C8FC1262 123C192D7EA218>I<13E0A21201EA00C01300A9121E1223EA4380A21283EA8700A21207 120EA35AA3EA38201340127013801230EA3100121E0B227EA111>105 D<393C07E01F3A46183061803A47201880C03A87401D00E0EB801E141C1300000E903838 01C0A4489038700380A2ED070016044801E01308150EA2ED0610267001C01320D83000EB 03C026157E942B>109 D<383C07C038461860384720303887403813801300A2000E1370 A44813E0A2EB01C014C1003813C2EB03821484130100701388383000F018157E941D>I< 3803C0F03804631CEB740EEA0878EB7007A2140FEA00E0A43801C01EA3143C38038038A2 EBC07014E038072180EB1E0090C7FCA2120EA45AA3B47E181F819418>112 D<137E138138030080EA0201EA0603140090C7FC120713F0EA03FC6CB4FCEA003FEB0780 1303127000F01300A2EAE002EA4004EA3018EA0FE011157E9417>115 D<136013E0A4EA01C0A4EA0380EAFFFCEA0380A2EA0700A4120EA45AA31308EA3810A213 20EA184013C0EA0F000E1F7F9E12>I<3801E0F03806310C38081A1C0010133CEA201C14 181400C65AA45BA314083860E01012F0142038E1704038423080383C1F0016157E941C> 120 D<001E131800231338EA438014701283EA8700A2000713E0120EA3381C01C0A4EB03 80A21307EA0C0B380E1700EA03E7EA0007A2130E1260EAF01C1318485AEA8060EA41C000 3FC7FC151F7E9418>I E /Fr 20 122 df<1238127C12FEA3127C123807077C8610>46 D<13181378EA01F812FFA21201B3A7387FFFE0A213207C9F1C>49 DI<13FE3807FFC0380F07E0381E03F0123FEB81F8A3EA1F 0314F0120014E0EB07C0EB1F803801FE007F380007C0EB01F014F8EB00FCA2003C13FE12 7EB4FCA314FCEA7E01007813F8381E07F0380FFFC03801FE0017207E9F1C>I<1238127C 12FEA3127C12381200A81238127C12FEA3127C123807167C9510>58 D<007FB61280A2397E03F80F00781407007014030060140100E015C0A200C01400A40000 1500B3A248B512F0A222227EA127>84 D97 D100 D<13FE3807FF80380F87C0381E01E0003E13F0EA7C0014F812FCA2B5FCA200FCC7FCA312 7CA2127E003E13186C1330380FC0703803FFC0C6130015167E951A>I<121C123E127FA3 123E121CC7FCA7B4FCA2121FB2EAFFE0A20B247EA310>105 D108 D<3AFF07F007F090391FFC1FFC3A1F303E303E01401340496C487E A201001300AE3BFFE0FFE0FFE0A22B167E9530>I<38FF07E0EB1FF8381F307CEB403CEB 803EA21300AE39FFE1FFC0A21A167E951F>I<13FE3807FFC0380F83E0381E00F0003E13 F848137CA300FC137EA7007C137CA26C13F8381F01F0380F83E03807FFC03800FE001716 7E951C>I<38FF0FE0EB3FF8381FE07CEB803E497E1580A2EC0FC0A8EC1F80A29038803F 00EBC03EEBE0FCEB3FF8EB0FC090C8FCA8EAFFE0A21A207E951F>I114 DI<487EA412 03A21207A2120F123FB5FCA2EA0F80ABEB8180A5EB8300EA07C3EA03FEEA00F811207F9F 16>I<39FFE01FE0A2391F800700000F1306EBC00E0007130C13E000035BA26C6C5AA26C 6C5AA2EB7CC0A2137F6D5AA26DC7FCA2130EA21B167F951E>118 D<39FFE01FE0A2391F800700000F1306EBC00E0007130C13E000035BA26C6C5AA26C6C5A A2EB7CC0A2137F6D5AA26DC7FCA2130EA2130CA25B1278EAFC3813305BEA69C0EA7F8000 1FC8FC1B207F951E>121 D E /Fs 2 14 df0 D13 D E /Ft 18 122 df<127012F8A312700505788416>46 D68 D97 D<12FCA3121CA4137CEA1DFEEA1FFFEB0780 381E03C0EA1C01EB00E0A6EB01C0EA1E03381F0780EBFF00EA1DFEEA0C7813197F9816> I<133FA31307A4EA03C7EA0FF748B4FCEA3C1F487EEA700712E0A6EA700F12786C5A381F FFE0EA0FF7EA07C713197F9816>100 DI<131E 137F3801FF8013C7380383001380A2EA7FFFB5FCA2EA0380ACEA7FFC487E6C5A11197F98 16>I<1203EA0780A2EA0300C7FCA4EAFF80A31203ACEAFFFC13FE13FC0F1A7C9916>105 D108 D110 DII<387F 0FC038FF3FE0EA7F7F3807F040EBC0005BA290C7FCA8EA7FFC12FF127F13127F9116> 114 DI<12035AA4EA7FFFB5FCA20007C7FC A75BEB0380A3EB8700EA03FE6C5A6C5A11177F9616>II<387F1FC038FF9FE0387F1FC0381C0700A2EA0E0EA36C 5AA4EA03B8A3EA01F0A26C5A13127F9116>I<387F1FC038FF9FE0387F1FC0381C070012 0E130EA212075BA2EA039CA21398EA01B8A2EA00F0A35BA3485A1279127BEA7F8090C7FC 123C131B7F9116>121 D E /Fu 52 122 df<137E3801C180EA0301380703C0120EEB01 8090C7FCA5B512C0EA0E01B0387F87F8151D809C17>12 D<381FC07C3830718339783B01 80131E0030EB00C0EA001CA248B5FCD80F1CC7FC12381270126012E0011E1340A2D86033 1380393061C300381F807C1A127E911E>26 D<126012F012F812681208A31210A2122012 401280050C7C9C0C>39 D<1380EA0100120212065AA25AA25AA35AA412E0AC1260A47EA3 7EA27EA27E12027EEA0080092A7C9E10>I<7E12407E12307EA27EA27EA37EA41380AC13 00A41206A35AA25AA25A12205A5A092A7E9E10>I<126012F0A212701210A41220A21240 1280040C7C830C>44 D<126012F0A2126004047C830C>46 D48 D<5A1207123F12C71207B3A5EAFFF80D1C7C9B15>III<130CA2131C133CA2135C13DC139C EA011C120312021204120C1208121012301220124012C0B512C038001C00A73801FFC012 1C7F9B15>II<13F0EA03 0CEA0404EA0C0EEA181E1230130CEA7000A21260EAE3E0EAE430EAE818EAF00C130EEAE0 061307A51260A2EA7006EA300E130CEA1818EA0C30EA03E0101D7E9B15>I56 DI< 007FB512C0B612E0C9FCA8B612E06C14C01B0C7E8F20>61 D<1306A3130FA3EB1780A2EB 37C01323A2EB43E01341A2EB80F0A338010078A2EBFFF83802003CA3487FA2000C131F80 001E5BB4EBFFF01C1D7F9C1F>65 D<90381F8080EBE0613801801938070007000E13035A 14015A00781300A2127000F01400A8007014801278A212386CEB0100A26C13026C5B3801 80083800E030EB1FC0191E7E9C1E>67 D69 DI73 D78 D80 D82 D<3807E080EA1C19EA300513 03EA600112E01300A36C13007E127CEA7FC0EA3FF8EA1FFEEA07FFC61380130FEB07C013 0313011280A300C01380A238E00300EAD002EACC0CEA83F8121E7E9C17>I<007FB512C0 38700F010060130000401440A200C014201280A300001400B1497E3803FFFC1B1C7F9B1E >I<3AFFE1FFC0FF3A1F003E003C001E013C13186C6D1310A32607801F1320A33A03C027 8040A33A01E043C080A33A00F081E100A39038F900F3017913F2A2017E137E013E137CA2 013C133C011C1338A20118131801081310281D7F9B2B>87 D<39FFF07FC0390FC01E0038 07800CEBC00800035B6C6C5A13F000005BEB7880137C013DC7FC133E7F7F80A2EB13C0EB 23E01321EB40F0497E14783801007C00027F141E0006131F001F148039FF807FF01C1C7F 9B1F>I<1208121012201240A21280A312B012F812781230050C7D9C0C>96 DI<12FC121CAA137CEA1D87381E0180381C00C014E014 601470A6146014E014C0381E018038190700EA10FC141D7F9C17>IIII<13F8EA018CEA071E1206EA 0E0C1300A6EAFFE0EA0E00B0EA7FE00F1D809C0D>II<12FC121CAA13 7C1387EA1D03001E1380121CAD38FF9FF0141D7F9C17>I<1218123CA21218C7FCA712FC 121CB0EAFF80091D7F9C0C>I<12FC121CAAEB0FE0EB0780EB06005B13105B5B13E0121D EA1E70EA1C781338133C131C7F130F148038FF9FE0131D7F9C16>107 D<12FC121CB3A9EAFF80091D7F9C0C>I<39FC7E07E0391C838838391D019018001EEBE0 1C001C13C0AD3AFF8FF8FF8021127F9124>IIII114 DI<1204A4120CA2121C123CEAFFE0EA1C00A9 1310A5120CEA0E20EA03C00C1A7F9910>I<38FC1F80EA1C03AD1307120CEA0E1B3803E3 F014127F9117>I<38FF07E0383C0380381C0100A2EA0E02A2EA0F06EA0704A2EA0388A2 13C8EA01D0A2EA00E0A3134013127F9116>I<39FF3FC7E0393C0703C0001CEB01801500 130B000E1382A21311000713C4A213203803A0E8A2EBC06800011370A2EB803000001320 1B127F911E>I<38FF07E0383C0380381C0100A2EA0E02A2EA0F06EA0704A2EA0388A213 C8EA01D0A2EA00E0A31340A25BA212F000F1C7FC12F312661238131A7F9116>121 D E /Fv 8 117 df77 D97 D<13FEEA0307000E1380001C1300EA380690C7FC5AA35AA31260EA70025BEA3008 EA1C30EA07C011127E9112>99 D101 D104 D<13C01201A21380C7FCA7EA1F8012071203EA07 00A6120EA65A121EEAFF800A1D7F9C0C>I<391F8FC0FC39079061063903E07607380780 78A2EB0070A4000EEBE00EA64848485A001EEBE01E3AFF8FF8FF8021127F9124>109 D<1202A31206A25A121C123CEAFFE0EA1C00A25AA65A1340A41380A2EA3100121E0B1A7C 9910>116 D E /Fw 6 55 df<120C121C12EC120CAFEAFFC00A137D9211>49 D<121FEA60C01360EAF07013301260EA0070A2136013C012011380EA02005AEA08101210 EA2020EA7FE012FF0C137E9211>II<136013E0A2EA01 6012021206120C120812101220126012C0EAFFFCEA0060A5EA03FC0E137F9211>III E /Fx 9 121 df0 D<6C13026C13060060130C6C13186C13306C13 606C13C03803018038018300EA00C6136C1338A2136C13C6EA018338030180380600C048 136048133048131848130C4813064813021718789727>2 D 13 D15 D102 D<12F8120FEA03806C7E6C7EB113707F131E EB03C0EB1E0013385B5BB1485A485A000FC7FC12F812317DA419>I<1320136013C0A3EA 0180A3EA0300A21206A35AA35AA25AA35AA35AA21260A37EA37EA27EA37EA37EA2EA0180 A3EA00C0A3136013200B327CA413>I<12C0A21260A37EA37EA27EA37EA37EA2EA0180A3 EA00C0A31360A213C0A3EA0180A3EA0300A21206A35AA35AA25AA35AA35AA20B327DA413 >I 120 D E /Fy 77 126 df34 D<136013E0A4EA03F8EA0FFE381FFF80383CE7C0EA78E13870E0E012E013E1A2EBE0C000 7013001278123F6C7EEA07FCC6B4FCEBEF80EBE3C013E1EBE0E012F0A312E03870E1C0EA 78E3383CEF80381FFF006C5AEA03F0C65AA3136013277DA21A>36 D<001813C0383C01E0127E130300E713C0A213071480130F1400A2EA7E1F131E123CEA18 3EEA003C137C1378A213F85BA212015B12035B14C03807C3F01383EB8738120F1307121F 121EA2123E383C03F0A2381800C015277EA21A>I<13E0EA03F0487E1338EA0E1CA45BEB 39FC1371EA07F1EBE1C013C11381EB8380120FEA1FC3383DC700EA78E7EA70EEEAE07EA2 EB3C08141C137EEA70FF387FE7F8EA3FC3380F00E0161E7F9D1A>I<1218123C123E121E 120EA5121CA2123812F812F01260070F779D1A>I<1338137813F0EA01E0EA03C0EA0780 EA0F00120E5AA25AA25AA35AAA1270A37EA27EA27E120FEA0780EA03C0EA01E0EA00F813 7813380D2878A21A>I<126012F012787E7E7EEA07801203EA01C0A2EA00E0A21370A313 38AA1370A313E0A2EA01C0A2EA03801207EA0F00121E5A5A5A12600D287CA21A>I<13E0 A538F0E1E0EAFCE7387EEFC0381FFF00EA07FCEA01F0EA07FCEA1FFF387EEFC038FCE7E0 EAF0E13800E000A513157D991A>I<1218123E127E127F123F121F1207120EA2121C12FC 12F81260080D77851A>44 D<387FFFC0B512E0A26C13C013047D901A>I<1230127812FC A212781230060676851A>I<14C0EB01E0A2130314C013071480130F1400A25B131E133E 133C137C1378A213F85B12015B12035BA212075B120F90C7FC5A121EA2123E123C127C12 7812F85AA2126013277DA21A>II<13C01201A212031207120F127F12FD12711201B2EA7FFFA310 1E7B9D1A>IIII<383FFFC05AA20070C7FCA8EA71F8EA7FFEEBFF8038 7E07C0EA7801383000E0C7FC1470A3126012F014E0EAE001387003C0387C0F80383FFF00 EA0FFEEA03F0141E7D9D1A>I<137E3801FF804813C0380781E0EA0F01121E383C00C000 3813005AA3EAE1F8EAE7FEB5FC38FE078038F803C0EAF001EB00E0A25A7E1270A2EB01C0 1238383C0380EA1E0F380FFF00EA07FCEA01F0131E7D9D1A>I<12E0B512F8A214F038E0 00E0EB01C0EA0003EB0780EB0F00130E5BA25BA25BA25BA3485AA4485AA8151F7E9E1A> III<1230127812FCA2127812301200A91230127812FCA212781230061576941A>I<14C0 EB03E01307EB0FC0EB3F80EB7E005BEA03F8EA07E0485AEA3F80007EC7FC5AA2127E6C7E EA0FC06C7EEA03F8C67E137EEB3F80EB0FC0EB07E01303EB00C0131A7D9B1A>60 D<387FFFF0B512F8A26C13F0C8FCA4387FFFF0B512F8A26C13F0150C7E941A>I<126012 F87E127E6C7EEA0FC06C7EEA03F8C67E137EEB3F80EB0FC0EB07E0A2EB0FC0EB3F80EB7E 005BEA03F8EA07E0485AEA3F80007EC7FC5A5A1260131A7D9B1A>II<1338137CA2136C13EEA313C6A2EA01C7A31383 00031380A4380701C0A213FFA24813E0EA0E00A3001E13F0001C1370387F01FC38FF83FE 387F01FC171E7F9D1A>65 D67 DIIII<38FF83 FEA3381C0070AA381FFFF0A3381C0070AB38FF83FEA3171E7F9D1A>II<3801FFC05A7E38000E00B3A212 6012F0131E5BEA7FF86C5AEA0FC0121E7C9D1A>I76 D<00FC137E6C13FEA2383B01B8A31383A200391338A2 13C7A2EA38C613EEA2136CA2137C1338A21300A700FE13FEA3171E7F9D1A>I79 DI82 D<3803F8E0EA0FFEEA1FFF EA3C07EA780112F0EAE000A3140012701278EA3F80EA1FF8EA07FF38007FC0EB07E0EB00 F014701438A2126012E0A214706C13F038FE01E0B512C000EF138038E1FE00151E7E9D1A >I<387FFFFEB5FCA238E0380EA400001300B3A23803FF80A3171E7F9D1A>I<38FF83FEA3 381C0070B3A26C13E0A2380701C013833803FF806C1300EA007C171E7F9D1A>I<00FE13 FEA30070131CA26C1338A7137C00181330381CEE70A513C6A2380DC760A31383A3000F13 E0A2380701C0171E7F9D1A>87 D<387F87F8A3380E01C0EA0703EB8380EA0387EBC700EA 01CF13EEEA00FE5B137C13781338137CA213FE13EEEA01CF13C7380387801383380701C0 A2380E00E0A2387F01FC38FF83FE387F01FC171E7F9D1A>I91 D<126012F0A27E1278127C123C123E121EA2121F7E7F12077F1203 A27F12017F12007F1378A2137C133C133E131E131F7FA21480130714C0130314E01301A2 EB00C013277DA21A>II<387FFFC0B512E0 A26C13C013047D7E1A>95 D<120C121E123E12381270A212E0A512F012F812781230070F 76A11A>II<127E12FE127E12 0EA6133EEBFF80000F13E0EBC1F0EB8070EB0038120E141CA7000F13381478EB80F0EBC1 E0EBFFC0000E138038063E00161E7F9D1A>IIIII< 3801F87C3807FFFE5A381E078C381C0380383801C0A5381C0380EA1E07381FFF005BEA39 F80038C7FCA27E381FFF8014E04813F83878007C0070131C48130EA40070131C0078133C 003E13F8381FFFF0000713C00001130017217F941A>I<127E12FE127E120EA6133EEBFF 80000F13C013C1EB80E01300120EAC387FC3FC38FFE7FE387FC3FC171E7F9D1A>I<13C0 487EA26C5A90C7FCA6EA7FE0A31200AF387FFF80B512C06C1380121F7C9E1A>I<12FEA3 120EA6EB0FFC131F130FEB03C0EB0780EB0F00131E5B5B13FC120F13DE138F380E078013 03EB01C014E0EB00F038FFE3FEA3171E7F9D1A>107 DI<387CE0E038FFFBF8EA7FFF381F1F1CEA1E1EA2EA1C 1CAC387F1F1F39FFBFBF80397F1F1F00191580941A>IIII<387F81F838FF8FFC387F9FFE3803FE1EEBF80CEBE000A25B 5BAAEA7FFFB5FC7E17157F941A>114 D<3807FB80EA1FFF127FEA7807EAE003A30078C7 FCEA7FC0EA1FFCEA07FE38003F801307386001C012E0A2EAF00338FC0780B51200EAEFFE EAE3F812157C941A>I<487E1203A6387FFFE0B5FCA238038000AA1470A43801C1E013FF 6C1380EB3F00141C7F9B1A>I<387E07E0EAFE0FEA7E07EA0E00AD1301EA0F033807FFFC 6C13FE3800FCFC17157F941A>I<387F83FC38FFC7FE387F83FC380E00E0A3380701C0A3 38038380A33801C700A3EA00EEA3137CA2133817157F941A>I<38FF83FEA338380038A2 6C1370A31338137CA2380C6C60380EEEE0A413C6000613C0EA07C71383A217157F941A> I<387FC7F8EBCFFCEBC7F8380703C038038380EBC700EA01EFEA00FE137C13781338137C 13EE120113C738038380000713C0EA0F01387FC7FC00FF13FE007F13FC17157F941A>I< 387F83FC38FFC7FE387F83FC380E00E0A27EEB01C0A2EA0381EB838013C31201EBC700EA 00E7A213E61366136E133CA31338A35BA2EA30F0EA78E01271EA7FC06C5A001EC7FC1720 7F941A>I<387FFFF8B5FCA238E000F0EB01E0EB03C038000780EB0F00131E137C5B485A EA03C0485A380F0038121E5A5AB512F8A315157E941A>II< 127CB4FC7FEA03C06C7E1200AB7F1378EB3FE0131F133FEB78005B5BAB1201485AB45A90 C7FC127C13277DA21A>125 D E /Fz 6 121 df50 D97 D<133EEA07FEA2EA007E137CA413F8A4EA01F0A4EA03E0A4EA07C0A4EA0F80A4EA1F00A4 123EA45AA31310EAF830A3136012F0A213C01279EA3F80EA1E000F327AB112>108 D<3B03C007E003F03B0FF03FF80FFC3B1C78787C1C1E00189039C03E701F3B307D801E60 0FD97F0013C0D8607ED91F8013801600017C16004848013E5BA21200A2484849133EA35F 48485BA25F1808484848481418EE01F0A21830270F8003E013E0186018C0933800E18001 0049EBFF00000E4A133E351F7A9E3B>I<131C133C137CA45BA4485AA3B512C0A23803E0 00A3485AA4485AA448C7FCA4123EA31480EA7C01A2EB0300A21306EA780C5BEA3C70EA1F E0EA0F80122C79AB18>116 D<90383E01F09038FF83FC3901C3C60E390301CC1E0006EB F83E000C147E14F00018147C1538393003E000A21200A2495AA4495AA3150890381F0018 123C127C007E143048481360A239786F01C03970C78380393F83FE006CC65A1F1F7C9E21 >120 D E /FA 12 121 df<1206120E12FE120EB1EAFFE00B157D9412>49 DII<1330A2137013F012011370120212041208121812101220124012C0EAFF FEEA0070A5EA03FE0F157F9412>III101 D<38F8F83E383B1CC7393C 0F0380EA380EAA39FE3F8FE01B0E7F8D1E>109 D111 D115 D<1208A31218A21238EAFFC0EA3800A71340A4EA1C80EA0F000A147F930E>I120 D E /FB 50 122 df12 D<1538157C15FCA2140115F8A2140315F0140715E0A214 0F15C0A2141F1580A2143F15005C147EA214FE5CA213015CA213035C13075CA2130F5CA2 131F5CA2133F91C7FC5B137EA213FE5BA212015BA212035B12075BA2120F5BA2121F5BA2 123F90C8FC5A127EA212FE5AA25A12781E487CB527>47 DIIII< EC7FE04A7EA25BA25BA2EB07DFA2130FEB1F9FA2133F141F137FA213FEA2EA01FCA2EA03 F8A2EA07F0A2EA0FE0121F13C0123F1380127F13005A90B6128016C0A56C1580C7381FF0 00AA6E5A22327EB127>I<000FB512F04814F8A515F001F8C7FCABEBFFF814FF158015C0 15E09038FC3FF09038F01FF813E09038C00FFCA2EA0F80C713FEA812081218003C14FC14 1F127EB4EB3FF8EBC07F6CB512F06C14E06C14C06C14806C1400000113FC38003FE01F33 7DB127>I<49B4FC010F13C0133F5B48B5FC5A48138049C7FCEA0FF8121F5B123F5BA212 7FA25BA238FFC3FF01C713C001CF13E001DF13F090B512F89038F80FFCEBF00715FEEBE0 03A215FF13C0A6127FA313E0A2123FEC07FE13F0001F14FCEBFC1F6CB512F87E6C14F06C 14E06C1480013F1300EB0FF820347DB227>I<007FB512FEB7FCA56C14FEC7EA03FCEC07 F8140FEC1FF015E0143FEC7FC014FF15805B491300A2495AA2495AA2495AA2133F5CA213 7FA25C13FFA3485BA6485BA96C90C7FC20327DB127>III63 D65 D67 D<007FB512E0B612FEEDFFC016F0 8282D9E0017F9138001FFF6F138015036F13C0A26F13E0A2EE7FF0A3163FA217F8AD17F0 A2167FA217E016FFA24B13C05D4B1380031F1300EDFFFE90B65A5E5E16C04BC7FC6C14E0 2D3279B139>I<007FB6FCB71280A5160001E0C8FCAE90B512F881A55D01E0C8FCB3A36C 5A213279B12C>70 DIII76 DI79 D<007FB512C0B612F815FF168016C0 16E0D9E00113F09138007FF8153F151F16FCA2150FA4151FA216F8153FED7FF0EC01FF90 B612E016C0160015FC15E09038E07FF0143F81141F81140F816E7EA26E1380A26E13C0A2 6E13E0A2ED7FF0153F16F8ED1FFCA2ED0FFEA26C48EB07FC273279B132>82 D<007FB712F8B812FCA56C16F8C7D83FF8C7FCB3B3A66E5A2E327DB135>84 DI<00FE912607FF 80EB01FC6C4A6D13036D49150783A27F007F4AED0FF88316DF6C6C18F0DB7FCF141F8316 8F6C6C18E0DBFF87143F8316076C6C18C04A0103147F8315FED807FC18800203010114FF 8315FCD803FE6E150002075D18815D0001047F5B01FF1683020F15C35D6C043F5B148F02 9F15C74B14E7017F031F5BA3DADFC014EFD93FFF6EB45AA25DA26D6F5BA292C7FC6D6F5B 6D486E5B46327EB14B>87 D97 DIIII<903807FF80133F90B5FC5A5A3807FE07EBFC0191C7 FC120FA9387FFFF0B57EA36C5BD80FFCC7FCB3A96C5A19327FB118>I<90391FF801E090 B5EA0FF0000314FF5A4814F0D9F81F130048486C7EEBE007003F80A7001F5CEBF00F6C6C 485A90B5FC6C5C5D000691C7FC380E1FF890C9FC120F487E90B512C06C14FC81EDFF806C 15C0A2001F15E05A3A7F80007FF048C7121F150FA46C6CEB1FE06D133FD83FF0EBFFC06C B612806C15006C5C000114F8D8001F138024307FA027>II II<127F487EB0EC0FF8EC1FFCEC3FF8EC7FF0903881 FFE0018313C001871380018F1300EB9FFEEBBFFCEBFFF85C5C5CA2808080A2EBEFFCEBC7 FEEB83FF13811580018013C0EC7FE0143F15F0EC1FF8EC0FFCEC07FEA2397F0003FC1F32 7CB126>II<277F803FC013FF28FFC1FFF007 13C001C36D4813E001C76D4813F001CF6D4813F8D9DE07EB781F903BF803FFE00FFC01F0 14C001E01480A201C01400B3A46C486C48EB07F836217CA03F>I<397F807F8039FFC1FF E001C313F001CF13F801DF13FCEBDE0F9038F807FE13F013E0A213C0B3A4397F8003FC1F 217CA028>II<387F81FE39FFC7FF8001DF13E090B512F015F8EBF83F 9038E00FFC01C013FE1407A3EC03FFABEC07FEA3EC0FFCEBE01F9038F03FF890B512F015 E001DF13C001CF1300EBC3FC01C0C7FCAD6C5A202F7CA028>I<90381FC1FE9038FFF3FF 000313FB4890B5FC5A381FFC1F383FF807497EEA7FE0A3EAFFC0ABEA7FE0A3EA3FF05C38 1FFC1F6CB6FC7E6C13FB6C13E338003F83EB0003ADEC01FE202F7DA028>I<007F137838 FF81F813831387138F139F13BF1480EBFC005B5B5BA25BB36C5A15217CA01B>III<397F8003FC39FFC007FEB3 A5140FA2141F127FEBE07F383FFFF76C13E76C13870003EB03FC1F217CA028>I<00FED9 07E0137F6C496C13FFD9801F5BA215F8D87FC015FE023F1303A215FCD83FE0EC07FC147D 15FEA2261FF079EB0FF814F915FF14F8D80FF8EC1FF013F94A139F0007027F13E016BF13 FDD9FFE013FF6C6E13C0A314C06C6E1380A36C496C13006D486C5A30217EA035>119 D<007F14FE38FF8001EBC003127F01E013FC1407123F01F013F8001F130F13F8000F14F0 141F13FC120701FE13E00003133FA2000114C013FF7EEC7F80A2137FECFF007FA26D5AA3 6D5AA213075CA35C130FA2495A124038F07FC0B5FC5C91C7FC5BEA7FF8EA1FC01F2F7EA0 24>121 D E /FC 1 98 df<1304130EA3131FA2EB2F801327A2EB43C0A2EBC3E01381A2 48C67EA2487F13FF38020078487FA3487F1218003C131F00FEEB7FE01B1A7F991F>97 D E /FD 9 117 df45 D77 D97 D<13FF380381C0EA0603120C381C018048C7FC1278127012F0A55AA26C13 8038700100A2EA3806EA1C18EA07E012157C9416>99 D<13FE38038380380701C0380C00 E0121C5A12781270B5FC00F0C7FCA45AA26C134000701380123038380300EA0E0CEA03F0 13157D9416>101 D<1378EA03F8EA0070A65BA63801C3F0EBCC18EBD00CEBE00EA213C0 0003131C1380A538070038A6000E1370000F137838FFE7FF18237FA21B>104 D<136013F01201A2EA00E01300A8EA01C0120F1201A4EA0380A6EA0700A6120E120FEAFF C00C227FA10E>I<3A01C1F807E03A0FC60C18303A01D80E60389039E007801CA201C013 000003491338EB800EA54848481370A6000E4913E0000F013C13F03AFFE3FF8FFE27157F 942A>109 D<1380A3120113005AA25A5A5AEAFFFCEA0E00A55AA6EA3810A51320A2EA1C 40EA07800E1F7C9E13>116 D E /FE 31 121 df<91380FC0F8913830718E913860F31E ECC0F70101EB660C9138800E001303A35DEB0700A490B612C090390E003800A45D5BA45D 5BA44A5A1370A44A5A13E0A292C7FC495AA238718E0638F19E0CEB1E1838620C30383C07 C0272D82A21E>11 DI<120C121E 123FA2121D1202A31204A212081210122012401280080F75A20F>39 D<127012F8A212F012E005057A840F>46 D50 D<14FE90380701809038180060012013105B49130848C712043802 01F03804070839080C04023810180290383003C2382060019038E00382EA40C01241A239 83800704A4EC0E08A20081131EEC2E103980C04E209038618E6039403E078090C8FC7EA2 6C14E0000CEB07800003EB7C003800FF801F2379A225>64 D<90B6128090380F00071501 A2131EA21600A25BA2140192C7FCEB7802A21406140EEBFFFCEBF00CA33801E008A21504 EC0008485AA25DA248485B15605D1401380F0007B65A21227DA121>69 D77 D<001FB512F8391E03C03800181418123038200780A200401410A2EB0F001280A2000014 00131EA45BA45BA45BA4485AA41203B5FC1D2277A123>84 D<90397FF80FFC90390FC003 C0D907801380ED02006E5A01035BECE018151001015B6E5A01005B02F1C7FC14FA147CA3 143CA2147E149EEB011EEB031FEB060F01047F1308EB100701207FEB4003138000018038 0300015A001F497E39FFC00FFE26227EA124>88 D97 DI<137EEA 01C138030180EA0703EA0E07121C003CC7FC12381278A35AA45B12701302EA300CEA1830 EA0FC011157B9416>I<143CEB03F8EB0038A31470A414E0A4EB01C013F9EA0185EA0705 380E0380A2121C123C383807001278A3EAF00EA31410EB1C201270133C38305C40138C38 0F078016237BA219>I<13F8EA0384EA0E02121C123C1238EA7804EAF018EAFFE0EAF000 A25AA41302A2EA6004EA7018EA3060EA0F800F157A9416>I103 D<13F0EA0FE01200A3485A A4485AA448C7FC131FEB2180EBC0C0380F00E0A2120EA2381C01C0A438380380A3EB0704 00701308130E1410130600E01320386003C016237DA219>I<13C0EA01E013C0A2C7FCA8 121E12231243A25AA3120EA25AA35AA21340EA7080A3EA71001232121C0B217BA00F>I< 14E01301A2EB00C01400A8131E1323EB43801383A2EA0103A238000700A4130EA45BA45B A45BA3EA70E0EAF0C0EAF1800063C7FC123C132B82A00F>I108 D<391C0F80F8392610C10C39476066063987807807A2EB0070A2000EEBE00EA44848485A A3ED38202638038013401570168015303A7007003100D83003131E23157B9428>I<3838 0F80384C30C0384E4060388E8070EA8F00128EA24813E0A4383801C0A3EB038400701388 14081307EB031012E0386001E016157B941B>I<137EEA01C338038180380701C0120E00 1C13E0123C12381278A338F003C0A21480130700701300130E130CEA3018EA1870EA07C0 13157B9419>I<3801C1F0380262183804741C3808780CEB700EA2141EEA00E0A43801C0 3CA3147838038070A2EBC0E0EBC1C038072380EB1E0090C7FCA2120EA45AA3EAFFC0171F 7F9419>III<13FCEA0183 38020080EA0401EA0C03140090C7FC120F13F0EA07FC6C7EEA003E130F7F1270EAF006A2 EAE004EA4008EA2030EA1FC011157D9414>I<13C01201A4EA0380A4EA0700EAFFF8EA07 00A2120EA45AA45AA31310EA7020A213401380EA3100121E0D1F7C9E10>I<001E136000 2313E0EA4380EB81C01283EA8701A238070380120EA3381C0700A31408EB0E101218121C EB1E20EA0C263807C3C015157B941A>I<001EEB60E00023EBE0F0384380E1EB81C00083 1470D887011330A23907038020120EA3391C070040A31580A2EC0100130F380C0B023806 13843803E0F81C157B9420>119 D<3803C1E0380462103808347038103CF0EA20381460 1400C65AA45BA314203861C04012F1148038E2C100EA4462EA383C14157D9416>I E /FF 12 117 df<1238127C12FCA212F812700606798512>46 D64 D<133EEBE1183801C0BC380380FC380700785A121EA2003E5B5AA34848 5AA448485AECC180A39038078300EA700FEB0B86EA38333818618C380F80F0191A79991F >97 DI101 D 103 D<133CEA07FCA2EA007C1378A45BA4485AA43803C3E0EBCC38EBD01C13E00007131E 13C01380A248485AA4001E5BA35C5A1560EB01E01540007814C0ECC08014C1ECC30038F0 00C6006013781B2A7BA91F>I<131C133EA2133C13381300A9EA03C0EA0CE0EA1860EA30 F0A21260A2EA61E012C11201EA03C0A2EA0780A3EA0F00A2130C121E13081318121C1330 1320EA0C40EA07800F287BA712>I<1378EA07F8120F120013F0A4EA01E0A4EA03C0A4EA 0780A4EA0F00A4121EA45AA45A1360A3EAF0C0A21270EA7180EA3100121E0D2A7BA90F> 108 D111 D<9038780F8090388C18E039018E607038030FC0EC80780006EB0038 157CA2EA0C1E1200A34913F8A315F0EB7801A215E0EC03C013F8EC07801500EBFC0E3801 E638EBE3E001E0C7FCA2485AA4485AA3120FEA7FF812FF1E267F991F>I<13301378A213 F0A4EA01E0A4B5FCA2EA03C0A2EA0780A4EA0F00A4121EA45A1306A2130C12781318EA38 101320EA1840EA0F8010257AA414>116 D E /FG 2 106 df<130C131CA21338A21370A3 13E0A3EA01C0A2EA0380A3EA0700A3120EA25AA35AA35AA25AA31270A27EA37EA37EA27E A3EA0380A3EA01C0A2EA00E0A31370A31338A2131CA2130C0E3D7BAC17>104 D<12C07EA21270A27EA37EA37EA27EA3EA0380A3EA01C0A2EA00E0A31370A31338A2131C A31338A21370A313E0A3EA01C0A2EA0380A3EA0700A3120EA25AA35AA35AA25AA25A0E3D 7DAC17>I E /FH 17 118 df<12E07E7E127C123C7E1207EA0380EA01C0120013200B0B 7AA91E>18 D<127812FCA212FEA2127A1202A41204A31208A212101220124007127B8511 >44 D<1310137013F0120712FF12F81200B3AD487E387FFFE0A213287BA71E>49 D<13FE3807FF80380E07E0381803F0382001F8130048137CA200F8137E7E143EA3007813 7EC7FC147CA214F8A2EB01F014E0EB03C0EB07801400130E5B5B5B13605B38018002EA03 00000613045A5A0010130C383FFFFC4813F8B5FCA217287DA71E>I<00181318001F13F0 EBFFE014C01480EBFE00EA11F80010C7FCA8137E38138380381400C0001813E000101370 C71278147C143CA2143EA3127012F8A3143C12800040137C14787E003013F0381801E038 0E07C03807FF00EA01FC17297DA71E>53 D<137F3801FFC03807C1E0380F0070001E7F48 133C141C48131EA200F87FA41580A41278141F7EA2001C132F6C134F6C13CF3803810FEA 007E01001300A3141EA35C121C003E5B1470003C5B381801C0381C0780D80FFFC7FCEA03 F819297EA71E>57 D<02FF13100107EBE03090381FC07890393E000C7001F8EB06F04848 1303484813014848130048481470A248C812305A123E1610127EA2007C150012FCA892B5 FC127C007EEC03F01501123EA2123F7E6C7EA26C7E6C7E6C6C13026C7E013EEB0C709039 1FC03830903907FFE0100100EB8000282B7DA92F>71 D<48B5FCA2380003F01301B3AA12 30127812FCA214E0EAF803004013C03820078000101300EA0C1EEA03F0182A7DA81F>74 D<120FB4FCA2121F7EACEB07E0EB1838EB600EEB8007158090380003C0A2EC01E0A215F0 A715E0A2140315C01580EB8007000EEB0F00EB401C380C303838080FC01C2A7EA921>98 D<137E3803C380380700E0000E13F0481370003C1378143848133CA212F8A2B512FC00F8 C7FCA51278127C003C1304A26C1308000E13106C13203801C0C038007F00161A7E991B> 101 D<120FB4FCA2121F7EACEB07F0EB1838EB201C497E140F1380A21300B139FFF0FFF0 A21C2A7EA921>104 D<121E123FA4121EC7FCA9120FB4FCA2121F7EB3A2EAFFF0A20C29 7EA811>I<380F07F038FF1838EB201C381F400E000F130F1380A21300B139FFF0FFF0A2 1C1A7E9921>110 D<137F3801C1C038070070000E7F487F003C131EA2487FA200F81480 A800781400A26C131EA26C5B000E13386C5B3801C1C0D8007FC7FC191A7E991E>I<380F 07E038FF1838EB601E380F800FEC0780010013C0140315E0A2EC01F0A715E01403A215C0 EC07801380EC0F00EB401CEB3078EB0FC090C8FCAAEAFFF0A21C267E9921>I<3807F840 381C06C0EA3001EA6000A200E01340A27E6C1300127EEA7FF0EA3FFEEA0FFF0003138038 003FC01307388001E0A2EAC000A36C13C0EAF00100F8138038C40700EA83F8131A7E9918 >115 D<000F130FB413FFA2001F131F6C7FB05CA26C132F3903804F803901C08FF03800 7F0F1C1A7E9921>117 D E /FI 80 124 df<90381FC1F090387037189038C03E3C3801 807C000313783907003800A9B612C03907003800B2143C397FE1FFC01E2380A21C>11 DI<12E0A212F012781238121C12061202120108097BA218> 18 D<391FF00FC039301C18703978066018903807E01C383003C00000140E1480A29038 7FFFFE3907C38000EA0E03123C1278A200F07F1502A290380260043978063008393C1818 30390FE007C01F157E9423>26 D34 D<7FA2EA03F0EA0C8CEA1082EA20811260384080 8012C01387A338E08300138012701278123F13E0EA1FF8EA07FCEA01FEEA009F1387A2EB 8380A2EAF081A312E00080130012401383EA2086EA1084EA0898EA07E0EA0080A311287D A418>36 D<127012F812FCA212741204A41208A21210A212201240060F7CA20E>39 D<132013401380EA01005A12061204120CA25AA25AA312701260A312E0AE1260A3127012 30A37EA27EA2120412067E7EEA0080134013200B327CA413>I<7E12407E7E12187E1204 1206A27EA2EA0180A313C01200A313E0AE13C0A312011380A3EA0300A21206A21204120C 5A12105A5A5A0B327DA413>I<127012F812FCA212741204A41208A21210A21220124006 0F7C840E>44 DI<127012F8A3127005057C840E>I<14801301A2 EB0300A31306A35BA35BA35BA35BA35BA3485AA448C7FCA31206A35AA35AA35AA35AA35A A311317DA418>II<1380120312 0F12F31203B3A9EA07C0EAFFFE0F217CA018>III<1303A25BA25B1317A213271367134713871201130712021206 12041208A212101220A2124012C0B512F838000700A7EB0F80EB7FF015217FA018>I<00 101380381E0700EA1FFF5B13F8EA17E00010C7FCA6EA11F8EA120CEA1C07381803801210 380001C0A214E0A4127012F0A200E013C01280EA4003148038200700EA1006EA0C1CEA03 F013227EA018>I<137EEA01C138030080380601C0EA0C03121C381801800038C7FCA212 781270A2EAF0F8EAF30CEAF4067F00F81380EB01C012F014E0A51270A3003813C0A23818 0380001C1300EA0C06EA070CEA01F013227EA018>I<12401260387FFFE014C0A2384000 8038C0010012801302A2485A5BA25B5BA21360134013C0A21201A25B1203A41207A76CC7 FC13237DA118>III< 127012F8A312701200AB127012F8A3127005157C940E>I<127012F8A312701200AB1270 12F8A312781208A41210A312201240A2051F7C940E>I61 D<497EA3497EA3EB05E0A2EB09F01308A2EB1078A3497EA3497EA2EBC01F49 7EA248B51280EB0007A20002EB03C0A348EB01E0A348EB00F0121C003EEB01F839FF800F FF20237EA225>65 DI<903807E0109038381830EBE0063901C00170 39038000F048C7FC000E1470121E001C1430123CA2007C14101278A200F81400A8127815 10127C123CA2001C1420121E000E14407E6C6C13803901C001003800E002EB381CEB07E0 1C247DA223>IIII<903807F00890383C0C18EBE0023901C001B83903 8000F848C71278481438121E15185AA2007C14081278A200F81400A7EC1FFF0078EB00F8 1578127C123CA27EA27E7E6C6C13B86C7E3900E0031890383C0C08903807F00020247DA2 26>I<39FFFC3FFF390FC003F039078001E0AE90B5FCEB8001AF390FC003F039FFFC3FFF 20227EA125>II75 DII<39FF8007FF3907C000F81570D805E01320EA04 F0A21378137C133C7F131F7FEB0780A2EB03C0EB01E0A2EB00F014F81478143C143E141E 140FA2EC07A0EC03E0A21401A21400000E1460121FD8FFE0132020227EA125>III82 D<3803F020380C0C60EA1802383001E0EA70000060136012E0A2 1420A36C1300A21278127FEA3FF0EA1FFE6C7E0003138038003FC0EB07E01301EB00F0A2 14707EA46C1360A26C13C07E38C8018038C60700EA81FC14247DA21B>I<007FB512F839 780780780060141800401408A300C0140C00801404A400001400B3A3497E3801FFFE1E22 7EA123>I<39FFFC07FF390FC000F86C4813701520B3A5000314407FA2000114806C7E90 38600100EB3006EB1C08EB03F020237EA125>II<3BFFF03FFC03 FE3B1F8007E000F86C486C48137017206E7ED807801540A24A7E2603C0021480A39039E0 04780100011600A2EC083CD800F01402A2EC101E01785CA2EC200F013C5CA20260138890 391E400790A216D090391F8003F0010F5CA2EC00016D5CA20106130001025C2F237FA132 >I<397FF803FF390FE001F83907C000E06C6C5B00015CEBF001D800F890C7FCEB7802EB 7C04133EEB1E08EB1F10EB0FB0EB07A014C06D7E130180497EEB0278EB047CEB0C3EEB08 1EEB101F496C7E140701407F496C7E1401D801007F486D7E5AD81F807F3AFFC003FFC022 227FA125>II<12FEA212C0B3B3A912FEA207317BA40E>91 DI<12FEA21206B3B3A912FEA207317FA40E>I<120812101220A21240A21280A412B812 FCA2127C1238060F7DA20E>96 DI<120E 12FE121E120EAB131FEB61C0EB8060380F0030000E1338143C141C141EA7141C143C1438 000F1370380C8060EB41C038083F0017237FA21B>II<14E0130F13011300ABEA01F8EA0704EA0C02EA1C01EA38001278127012F0A71270 12781238EA1801EA0C0238070CF03801F0FE17237EA21B>II<133E13E33801C780EA0387130748C7FCA9EAFFF80007C7 FCB27FEA7FF0112380A20F>I<14703803F198380E1E18EA1C0E38380700A200781380A4 00381300A2EA1C0EEA1E1CEA33F00020C7FCA212301238EA3FFE381FFFC06C13E0383000 F0481330481318A400601330A2003813E0380E03803803FE0015217F9518>I<120E12FE 121E120EABEB1F80EB60C0EB80E0380F0070A2120EAF38FFE7FF18237FA21B>I<121C12 3EA3121CC7FCA8120E127E121E120EB1EAFFC00A227FA10E>I<13E0EA01F0A3EA00E013 00A81370EA07F012001370B3A51260EAF0E013C0EA6180EA3F000C2C83A10F>I<120E12 FE121E120EABEB03FCEB01F014C01480EB02005B5B5B133813F8EA0F1CEA0E1E130E7F14 80EB03C0130114E0EB00F014F838FFE3FE17237FA21A>I<120E12FE121E120EB3ADEAFF E00B237FA20E>I<390E1FC07F3AFE60E183803A1E807201C03A0F003C00E0A2000E1338 AF3AFFE3FF8FFE27157F942A>I<380E1F8038FE60C0381E80E0380F0070A2120EAF38FF E7FF18157F941B>III<3801F82038070460EA0E02EA1C010038 13E0EA7800A25AA71278A2EA3801121CEA0C02EA070CEA01F0C7FCA9EB0FFE171F7E941A >III<1202A41206A3120E121E123EEAFFFCEA0E 00AB1304A6EA07081203EA01F00E1F7F9E13>I<000E137038FE07F0EA1E00000E1370AD 14F0A238060170380382783800FC7F18157F941B>I<38FF80FE381E00781430000E1320 A26C1340A2EB80C000031380A23801C100A2EA00E2A31374A21338A3131017157F941A> I<39FF8FF87F393E01E03C001CEBC01814E0000E1410EB0260147000071420EB04301438 D803841340EB8818141CD801C81380EBD00C140E3900F00F00497EA2EB6006EB40022015 7F9423>I<38FF83FE381F00F0000E13C06C1380EB8100EA0383EA01C2EA00E41378A213 38133C134E138FEA0187EB0380380201C0000413E0EA0C00383E01F038FF03FE17157F94 1A>I<38FF80FE381E00781430000E1320A26C1340A2EB80C000031380A23801C100A2EA 00E2A31374A21338A31310A25BA35B12F05B12F10043C7FC123C171F7F941A>I<383FFF C038380380EA300700201300EA600EEA401C133C1338C65A5B12015B38038040EA07005A 000E13C04813805AEA7801EA7007B5FC12157F9416>II E /FJ 6 121 df50 D<147CEB03FF90380F838690381F01CF90383C00 FF5B01F87F485A4848137E120749133E120F001F5C5B123FA290C75A5AA300FE495AA448 495A1670A3913807C0E0140F127C141F91383FC1C0003C1377003E01E31380391E01C3C3 3A0F0781C7003903FE00FED800F8137C242777A52C>97 D108 D I116 D<903907E003F090391FF80FFC90393C3C1C1E 9038701E309039E00E703F3A01C00FE07FD8038013C00100147E48148000061538000E15 00A24849C7FCA2C7FCA2143EA45CA45C1638A349481370121C003E15E0EA7E0300FEEC01 C00107EB038026FC0678130039780E380E3938381C1C391FF00FF83907E007E028277CA5 28>120 D E(cmti10)cvn 9.96265 /Fd 1 fstore end %%EndProlog %%BeginSetup %%Feature: *Resolution 300dpi TeXDict begin %%PaperSize: A4 %%EndSetup %%Page: 0 1 0 0 bop 781 367 a FJ(mma2ltx)810 471 y FI(V)l(ersion)16 b(1.23)730 619 y FH(Giusepp)r(e)i(Ghib\022)-30 b(o)636 694 y FG(h)p FF(ghib)m(o@galile)m(o.p)m(olito.it)6 b FG(i)760 810 y FH(June)20 b(21,)f(1995)34 1352 y FE(Mma2ltx)f FI(is)g(a)g(program)g(whic)o(h)g(allo)o(ws)g(to)g(a)g FD(Mathematica)f FI(user)h(to)g(include)f(the)h(graphics)g(pro-)-39 1412 y(duced)d(b)o(y)h FD(Mathematica)f FI(in)h(a)g(L)575 1406 y FC(a)599 1412 y FI(T)626 1427 y(E)654 1412 y(X)g(do)q(cumen)o(t) f(using)h(o)o(wn)h(L)1173 1406 y FC(a)1197 1412 y FI(T)1224 1427 y(E)1251 1412 y(X)f(fon)o(ts)g(and)h(sym)o(b)q(ols)e(for)i(lab)q (els.)p eop %%Page: 1 2 1 1 bop -39 174 a FB(1)79 b(Intro)r(duction)-39 284 y FD(Mathematica)21 b FI(has)j(p)q(erhaps)f(the)g(b)q(est)g(data)h (plotting)f(to)q(ol)h(curren)o(tly)d(a)o(v)m(ailable,)i(but)h(its)e (con)o(trol)-39 344 y(o)o(v)o(er)c(mathematical)e(sym)o(b)q(ols)j(and)h (form)o(ul\032)e(inside)g(graphics)i(is)g(v)o(ery)e(p)q(o)q(or)1454 326 y FA(1)1475 344 y FI(:)28 b(it)19 b(is)g(limited)d(to)k(the)-39 404 y(c)o(haracters)c(a)o(v)m(ailable)f(in)h(the)g(fon)o(t)g(`Sym)o(b)q (ol'.)34 464 y(T)61 475 y(E)88 464 y(X)i(instead)g(is)g(v)o(ery)f(p)q (o)o(w)o(erful)g(in)h(this)g(sub)s(ject)g(but)g(has)h(no)f(data)h (plotting)f(capabilit)o(y:)24 b(it)18 b(can)-39 525 y(only)e(include)f (external)g(graphics.)34 585 y FE(mma2ltx)20 b FI(is)e(the)h(\\bridge") h(across)g(the)f(t)o(w)o(o)g(w)o(orlds:)28 b(it)18 b(allo)o(ws)h(to)h (use)f(an)o(y)g(L)1537 579 y FC(a)1561 585 y FI(T)1588 600 y(E)1616 585 y(X)f(sym)o(b)q(ol)g(and)-39 645 y(fon)o(t)e(as)h(lab) q(els)f(in)g(graphics)g(created)g(b)o(y)g FD(Mathematica)p FI(.)-39 811 y FB(2)79 b(What)26 b(do)r(es)h Fz(mma2ltx)e FB(do?)-39 921 y FE(Mma2ltx)15 b FI(reads)f(a)h(P)o(ostScript)g (graphic)f(\014le)g(generated)h(b)o(y)f(the)g FD(Mathematica)f FI(command)g(`)p Fy(Display)p FI(')1903 903 y FA(2)-39 981 y FI(and)18 b(writes)f(t)o(w)o(o)g(output)h(\014les;)f(the)g (\014rst)h(one)g(is)f(a)h(L)951 975 y FC(a)975 981 y FI(T)1002 996 y(E)1029 981 y(X)f(\014le)g(and)h(con)o(tains)f(ev)o(ery) f(string)i(of)g(text)f(of)-39 1041 y(the)e(original)g(graphics)h (\014le)f(in)g(L)557 1035 y FC(a)581 1041 y FI(T)608 1056 y(E)636 1041 y(X)g(form;)f(the)h(second)h(is)g(an)g(EPSF)f (\014le:)21 b(it)15 b(substan)o(tially)g(con)o(tains)-39 1101 y(the)j(same)g(things)h(of)g(the)f(original)h(P)o(ostScript)f (\014le,)g(except)g(it)g(has)i(b)q(een)e(stripp)q(ed)h(of)g(an)o(y)g (string)g(of)-39 1162 y(text.)-39 1328 y FB(3)79 b(Requirements)-39 1438 y FI(In)16 b(order)h(to)h(include)d FD(Mathematica)h FI(graphics)h(pro)q(cessed)h(b)o(y)e FE(mma2ltx)i FI(in)o(to)e(L)1467 1432 y FC(a)1491 1438 y FI(T)1518 1453 y(E)1546 1438 y(X)g(do)q(cumen)o(ts)g(y)o(ou)-39 1498 y(need)f(L)86 1492 y FC(a)110 1498 y FI(T)137 1513 y(E)165 1498 y(X)h(\(ob)o(vious\)) g(and)h(the)f(Rokic)o(ki's)e Fy(dvips)949 1480 y FA(3)983 1498 y Fy(dvi)h FI(pro)q(cessor.)34 1558 y(Files)i(pro)q(cessed)i(b)o (y)f FE(mma2ltx)h FI(w)o(ere)f(tested)g(under)g(L)1055 1552 y FC(a)1079 1558 y FI(T)1106 1573 y(E)1134 1558 y(X)g(v2.09)g(\(25)i(Marc)o(h)e(1992\))i(and)f Fy(dvips)-39 1618 y FI(v5.55)d(\(and)h(new)o(er\).)k(The)16 b(graphics)g(\014les)g (used)h(w)o(ere)e(created)h(with)g(Mathematica)1559 1600 y FA(4)1593 1618 y FI(v2.2.)-39 1785 y FB(4)79 b (Distribution/Disclaime)o(r)-39 1894 y FE(mma2ltx)18 b FI(is)f(sharew)o(are.)26 b(If)17 b(y)o(ou)g(\014nd)h(it)f(useful)g (\(or)h(con)o(tin)o(ue)f(using)h(it)f(longer)h(than)g(a)g(w)o(eek\))e (please)-39 1954 y(consider)e(pa)o(ying)h(the)g(fee)f(\(the)h(easiest)g (w)o(a)o(y)g(is)f(simply)f(to)j(send)f(the)g(cash)g(in)g(an)g(en)o(v)o (elop)q(e\))f(of)h(US)g($15)-39 2014 y(\(US)g(Dollars\),)i(or)f(20)h (DM)f(\(German)g(Marks\))g(to)h(the)f(author)h(\(see)f Fx(x)p FI(14)h(for)f(the)g(author's)h(address\).)34 2075 y FE(mma2ltx)g FI(is)f(Cop)o(yrigh)o(t)523 2073 y(c)509 2075 y Fx(\015)g FI(1994)h(b)o(y)f(Giusepp)q(e)h(Ghib\022)-24 b(o.)34 2135 y(This)17 b(soft)o(w)o(are)h(is)f(pro)o(vided)g(\\as)h (is")g(with)f(no)h(explicit)d(or)j(implicit)c(w)o(arran)o(t)o(y)j(of)h (an)o(y)g(kind.)24 b(Y)l(ou)-39 2195 y(are)16 b(using)g(it)g(at)h(y)o (our)f(o)o(wn)h(risk.)34 2255 y(The)e(author)i(disclaims)d(an)o(y)h (liabilit)o(y)e(for)j(damages,)g(including)e(an)o(y)i(direct,)e (indirect,)g(inciden)o(tal,)-39 2315 y(sp)q(ecial,)d(exemplary)l(,)e (or)j(consequen)o(tial)e(damages)h(arising)h(in)f(an)o(y)g(w)o(a)o(y)g (out)h(of)f(the)g(use)h(of)f(this)g(soft)o(w)o(are,)-39 2376 y(ev)o(en)k(if)g(advised)h(of)h(the)f(p)q(ossibilit)o(y)f(of)i (suc)o(h)f(damage.)p -39 2419 784 2 v 17 2450 a Fw(1)35 2465 y Fv(Mathematica)d Fu(supp)q(orts)j(output)f(in)f(T)668 2474 y(E)691 2465 y(X)h(form,)d(but)j(this)f(feature)i(is)e(only)g(for) g(form)o(ul\032)e(and)i(do)q(esn't)h(regard)g(the)-39 2515 y(graphics.)17 2550 y Fw(2)35 2565 y Fu(The)g(`)p Ft(Display)p Fu(')c(command)g(sa)o(v)o(es)k(a)e(ra)o(w)h(P)o(ostScript) h(represen)o(tation)g(of)e(a)h(graphic)g(in)f(a)h(\014le.)17 2599 y Fw(3)35 2614 y Ft(dvips)h Fu(is)i(a)e(con)o(v)o(erter)j(from)d Ft(dvi)g Fu(to)h(P)o(ostScript)h(\014les.)26 b(It)16 b(w)o(as)g(dev)o(elop)q(ed)h(b)o(y)f(T.)g(Rokic)o(ki)f(and)h(is)g(a)o (v)n(ailable)e(via)-39 2664 y(anon)o(ymous)e(FTP)i(from)e Ft(labrea.stanford.e)o(du)f Fu(or)j(in)f(an)o(y)g(CT)m(AN)h(site.)17 2699 y Fw(4)35 2714 y Fv(Mathematica)f Fu(is)h(Cop)o(yrigh)o(t)536 2713 y(c)525 2714 y Fs(\015)o Fu(1988,)e(1995)h(b)o(y)h(W)m(olfram)d (Researc)o(h,)j(Inc.)928 2914 y FI(1)p eop %%Page: 2 3 2 2 bop 34 166 a FI(This)14 b(soft)o(w)o(are)g(ma)o(y)e(b)q(e)j(freely) d(distributed)h(and)i(copied)f(as)g(long)h(as)f(the)g(follo)o(wing)g (conditions)g(are)-39 226 y(ac)o(kno)o(wledged:)33 328 y Fx(\017)25 b FI(All)14 b(parts)j(of)g(the)f(program)g(and)h(the)f(do) q(cumen)o(tation)f(m)o(ust)g(b)q(e)h(left)g(in)o(tact)f(in)h(an)o(y)g (w)o(a)o(ys.)33 430 y Fx(\017)25 b FI(The)15 b(distribution)h(of)g (single)g(parts)g(is)g(not)g(allo)o(w)o(ed.)k(The)c(repac)o(king)g(of)g (this)g(distribution)f(with)83 490 y(other)h(pac)o(k)o(ers/arc)o(hiv)o (ers)e(is,)i(ho)o(w)o(ev)o(er,)e(allo)o(w)o(ed.)-39 656 y FB(5)79 b(Using)26 b Fz(mma2ltx)-39 766 y FI(T)l(o)16 b(use)h FE(mma2ltx)p FI(,)f(just)g(t)o(yp)q(e)166 867 y Fy(C:\\>)24 b(mma2ltx)f(mypic.ps)-39 969 y FI(where)16 b Fy(mypic.ps)d FI(is)k(the)f(output)h(of)g(the)g FD(Mathematica)p FI('s)d(primitiv)o(e)f(`)p Fy(Display)p FI('.)19 b FE(mma2ltx)e FI(supp)q(orts)-39 1029 y(man)o(y)d(options,)j(as)g(describ)q(ed)e(in)h (the)g(next)g(section.)-39 1196 y FB(6)79 b(Command)26 b(Line)f(Options)-39 1305 y FI(Options)13 b(are)f(sp)q(eci\014ed)g(on)i (the)e(command)f(line)g(using)i(a)g(dash)h(`)p Fy(-)p FI(')d(follo)o(w)o(ed)h(b)o(y)g(a)h(letter.)19 b(No)13 b(spaces)g(are)-39 1365 y(allo)o(w)o(ed)j(b)q(et)o(w)o(een)g(the)g(`)p Fy(-)p FI(')g(and)h(the)g(letter.)22 b(The)17 b(letter)f(ma)o(y)f(b)q (e)i(follo)o(w)o(ed)f(b)o(y)g(an)i(argumen)o(t.)k(Spaces)-39 1426 y(b)q(et)o(w)o(een)15 b(the)h(letter)f(and)i(the)f(argumen)o(t)f (are)h(allo)o(w)o(ed)g(instead.)34 1486 y(Here)h(follo)o(ws)h(a)g (description)f(of)i(the)f(options)g(supp)q(orted)h(b)o(y)f FE(mma2ltx)p FI(.)27 b(F)l(acultativ)o(e)17 b(argumen)o(ts)-39 1546 y(are)f(indicated)f(in)h(the)g(`)p Fr(T)-5 b(emplate)p FI(')13 b(enclosed)j(b)q(et)o(w)o(een)f(square)i(brac)o(k)o(ets)e([)p Fq(:)8 b(:)g(:)f FI(].)34 1606 y(Note)16 b(that)g(ev)o(ery)f(string)i (in)f(the)g(command)e(line)i(whic)o(h)f(is)h(not)h(an)g(option)g (argumen)o(t)e(is)h(tak)o(en)g(as)-39 1666 y(an)g(input)g(\014le.)-39 1811 y Fp(6.1)65 b(Option)22 b Fo(-?)-39 1903 y FI(Option)16 b Fy(-?)f FI(\()p Fy(-"?")g FI(on)i(Unix\))e(sho)o(ws)i(the)f(follo)o (wing)g(help)g(messages:)-39 2005 y Fy(mma2ltx)23 b(v1.23)g(-)j (Copyright)c(\(C\))j(1994,)e(1995)i(by)f(Giuseppe)f(Ghibo`)-39 2125 y(Usage:)g(mma2ltx)g([)o(])g()g ([])-39 2185 y(Where)g()g(is)i(one)f(or)h(more)f (of:)12 2306 y(-?)50 b(Show)25 b(these)e(messages)12 2366 y(-d)50 b(Don't)24 b(keep)g(the)h(aspect)e(ratio)12 2426 y(-n)50 b(Deactivate)22 b(automatic)h($...$)g(enclosing)12 2486 y(-b)50 b(Enclose)23 b(every)h(string)g(into)g(a)h(white)f(box)g (\(default)f(=)i(transpar.)e(box\))12 2547 y(-p[])f(Include)h(the) i(Mathemati)o(ca)d(PostScript)g(prologue)h(in)i(the)f(.EPS)h(file)12 2607 y(-h[)o(])d(Set)j(picture)e(height)g(to)i()e (\(default)g(=)i(100bp\))12 2667 y(-w[)o(])d(Set)j(picture)e (width)49 b(to)25 b()e(\(default)g(=)i(161bp\))12 2727 y(-f[)o(])d(Add)j(an)g(\\fbox)f(to)h(the)f(picture)f (\(\\fboxsep=)o(\))12 2787 y(-u)g(Set)h(all)h (dimension)o(s)e(in)h(the)h(unit)f()928 2914 y FI(2)p eop %%Page: 3 4 3 3 bop 12 166 a Fy(-s)49 b(Set)24 b(the)h(font)f(size)g(with)g (the)h(TeX)f(command)f()12 226 y(-o)49 b(Output)23 b(filename)12 286 y(-e)49 b(Change)23 b(only)h(MMA)h(labels)e (which)h(begin)g(with)g()12 347 y(-c\(sx,sy\)=)o(\(n)o(ews)o(x,n)o (ew)o(sy\))o(\()o(,\))e(\(change)h (alignment\))12 407 y(-a[:<)o(nu)o(m>:)o()o(])g(Draw)h (arrows)f(on)i(x)h(and)e(y)h(axes)12 527 y()e(=)i(a)g(number)f (followed)f(by)h(one)h(of)g(TeX's)f(unit)g(\(e.g.)g(10.3cm\))12 587 y()75 b(=)25 b(a)g(number)f(\(e.g.)g(0.0125\))12 648 y()49 b(=)25 b(a)g(TeX's)f(unit)g(\(e.g.)g(cm\))12 708 y()75 b(=)25 b(a)g(TeX)g(command)e(without)g(the)i(backslash)d ('\\')12 768 y()75 b(=)25 b(a)g(text)g(string)-39 888 y(Example:)191 949 y(mma2ltx)e(-sfootnotes)o(ize)f(-w5in)i(pic1.ps) f(pic2.ps)-39 1009 y(processes)f(the)i(files)g(`pic1.ps')f(and)h (`pic2.ps'.)e(The)j(width)e(of)i(the)g(pictures)-39 1069 y(will)f(be)h(5)g(inch)f(and)h(\\footnote)o(siz)o(e)d(will)j(be)g(used) f(as)h(LaTeX)e(command)g(to)-39 1129 y(set)h(the)h(font)f(size.)-39 1274 y Fp(6.2)65 b(Options)22 b Fo(-w)h Fp(and)e Fo(-h)-39 1366 y Fr(T)-5 b(emplate:)19 b Fy(-w)p Fx(h)p FE(dimen)t Fx(i)220 1426 y Fy(-h)p Fx(h)p FE(dimen)t Fx(i)-39 1499 y FI(Options)j Fy(-w)f FI(and)h Fy(-h)f FI(m)o(ust)f(b)q(e)i(used)g(to) g(sp)q(ecify)f(resp)q(ectiv)o(ely)e(the)j(width)f(and)i(the)e(heigh)o (t)g(of)h(the)-39 1559 y(picture.)27 b(The)18 b(argumen)o(t)f Fx(h)p FE(dimen)t Fx(i)j FI(is)e(a)h(n)o(um)o(b)q(er)e(follo)o(w)o(ed)g (b)o(y)h(one)h(of)g(T)1376 1570 y(E)1403 1559 y(X's)f(unit)g(\(i.e.)27 b(one)18 b(of)h Fy(mm)p FI(,)-39 1619 y Fy(cm)p FI(,)g Fy(pt)p FI(,)g Fy(bp)p FI(,)h Fy(pc)p FI(,)f Fy(in)p FI(,)h Fy(dd)p FI(,)f Fy(cc)p FI(,)h Fy(sp)p FI(\).)31 b(F)l(or)20 b(example,)d(`)p Fy(-w10.3cm)p FI(')f(sp)q(eci\014es)k(a)g (10)p Fq(:)p FI(3)8 b(cm)19 b(wide)g(picture.)-39 1679 y(Note)12 b(that)i(`)p Fy(-w)25 b(10.3cm)p FI(',)10 b(`)p Fy(-w=10.3cm)p FI(')g(and)j(`)p Fy(-w:10.3cm)p FI(')c(are)14 b(accepted)e(to)q(o,)j(but)e(`)p Fy(-w10.3)23 b(cm)p FI(')12 b(isn't)-39 1739 y(accepted)g(\(note)h(the)f(space)h(after)g (the)f(n)o(um)o(b)q(er)g Fy(10)p FI(\).)19 b(Note)12 b(also)i(that)f(w)o(e)f(ma)o(y)g(sp)q(ecify)g(only)g(one)h(of)h(')p Fy(-w)p FI(')-39 1800 y(or)g(')p Fy(-h)p FI(':)19 b(the)14 b(other)g(dimension)f(is)h(calculated)f(to)i(k)o(eep)e(the)h FD(Mathematica)f FI(asp)q(ect)h(ratio.)21 b(If)14 b(either)f(the)-39 1860 y(width)k(and)h(the)f(heigh)o(t)g(are)h(sp)q(eci\014ed,)f(the)g (picture)f(will)h(ha)o(v)o(e)g(\(appro)o(ximately\))e(those)j (dimensions,)-39 1920 y(but)12 b(the)g(inside)g(graphic)h(will)e(ha)o (v)o(e)h(dimensions)f(suc)o(h)h(to)h(\014t)g(one)f(of)h(heigh)o(t)f(or) h(width,)g(according)f(to)h(the)-39 1980 y(asp)q(ect)j(ratio.)22 b(F)l(or)16 b(instance,)g(sp)q(ecifying)f(on)i(the)f(command)e(line)h (`)p Fy(-w10cm)23 b(-h10cm)p FI(')14 b(and)i(the)g(asp)q(ect)-39 2040 y(ratio)61 2022 y FA(5)100 2040 y FI(is)k(0)p Fq(:)p FI(62)h(then)f(the)f(picture)g(will)g(b)q(e)h(10)8 b(cm)13 b Fx(\002)g FI(10)8 b(cm)20 b(large)f(\(this)h(is)g(the)f(dimension)g (\\visible")-39 2101 y(to)h(L)36 2095 y FC(a)60 2101 y FI(T)87 2116 y(E)115 2101 y(X\),)f(but)i(the)f(inside)f(graphic)i (will)e(b)q(e)i(10)8 b(cm)19 b(wide)h(and)h(6)p Fq(:)p FI(2)8 b(cm)20 b(high.)33 b(If)20 b(w)o(e)g(ha)o(v)o(e)g(instead)-39 2161 y(`)p Fy(-w10cm)j(-h3cm)p FI(',)18 b(the)h(picture)g(will)g(b)q(e) h(10)8 b(cm)13 b Fx(\002)g FI(3)8 b(cm)19 b(large)g(but)h(the)g(inside) f(graphic)h(will)f(b)q(e)h(just)-39 2221 y(4)p Fq(:)p FI(84)8 b(cm)14 b(wide)g(and)h(3)8 b(cm)14 b(high.)21 b(If)14 b(w)o(e)g(don't)h(w)o(an)o(t)g(to)g(k)o(eep)e(the)i FD(Mathematica)e FI(asp)q(ect)i(ratio)g(w)o(e)f(m)o(ust)-39 2281 y(use)i(the)g Fy(-d)f FI(option.)22 b(Default)16 b(width)g(is)g(161)8 b(bp)r(;)16 b(default)g(heigh)o(t)f(is)i(100)8 b(bp)q(.)-39 2426 y Fp(6.3)65 b(Option)22 b Fo(-d)-39 2518 y FI(Suppress)16 b(the)g(asp)q(ect)h(ratio)g(k)o(eeping.)p -39 2562 784 2 v 17 2592 a Fw(5)35 2607 y Fu(The)e(asp)q(ect)g(ratio)e (is)h(heigh)o(t)p Fn(=)p Fu(width)f(in)h(scaled)g(co)q(ordinates)h (\(i.e.,)d(from)g(0)i(to)g(1\).)928 2914 y FI(3)p eop %%Page: 4 5 4 4 bop -39 166 a Fp(6.4)65 b(Option)22 b Fo(-n)-39 258 y FI(By)14 b(default)h FE(mma2ltx)h FI(encloses)e(ev)o(ery)g(string)h (grabb)q(ed)h(from)e(the)h FD(Mathematica)f FI(P)o(ostScript)h(\014le)f (in)o(to)-39 319 y(a)h Fy($)p Fq(:)8 b(:)g(:)f Fy($)15 b FI(pair.)21 b(Sp)q(ecifying)14 b(the)g Fy(-n)h FI(option)g(on)h(the)e (command)f(line,)h(this)h(b)q(eha)o(viour)g(will)f(b)q(e)h(disabled.) -39 463 y Fp(6.5)65 b(Option)22 b Fo(-b)-39 555 y FI(By)17 b(default)h(ev)o(ery)f(string)i(is)f(placed)g(on)h(the)f(graphic)g(as)h (if)f(it)g(w)o(as)h(enclosed)e(in)h(a)h(transparen)o(t)g(b)q(o)o(x.)-39 616 y(Using)14 b(this)g(option)g(ev)o(ery)f(string)h(will)f(b)q(e)i(no) f(longer)g(\\transparen)o(t",)i(but)e(rather)g(enclosed)g(in)g(a)g (white)-39 676 y(b)q(o)o(x)19 b(ha)o(ving)g(the)g(same)f(size)g(\(see)h (the)f(string)i(\\some)e(text")h(sho)o(wn)h(in)e(Fig.)h(4)g(for)h(the)f (b)q(eha)o(viour)g(of)-39 736 y(this)d(option\).)-39 880 y Fp(6.6)65 b(Option)22 b Fo(-o)-39 973 y Fr(T)-5 b(emplate:)19 b Fy(-o)p Fx(h)p FE(\014lename)t Fx(i)-39 1045 y FI(Sp)q(ecify)g(the)h(output)i(\014lename.)32 b(By)20 b(default)g FE(mma2ltx)h FI(uses)g(as)g(output)g(names)e(the)i (names)e(of)i(the)-39 1106 y(input)13 b(\014les)h(stripp)q(ed)g(of)g (the)f(extension)h(to)g(whic)o(h)f(app)q(end)i(the)e(prop)q(er)i (\014le)e(extension)g(\(i.e.,)f(`)p Fy(.tex)p FI(')g(for)-39 1166 y(the)k(L)57 1160 y FC(a)81 1166 y FI(T)108 1181 y(E)135 1166 y(X)g(\014le)g(and)g(`)p Fy(.eps)p FI(')e(for)j(the)f (EPSF)h(\014le\).)j(The)d Fy(-o)e FI(option)i(allo)o(ws)g(y)o(ou)f(to)g (sp)q(ecify)g(a)h(di\013eren)o(t)-39 1226 y(name)h(for)h(the)g(EPSF)h (P)o(ostScript)f(output)h(\014le.)29 b(In)19 b(this)g(case)g(the)g (name)f(of)i(the)f(L)1559 1220 y FC(a)1583 1226 y FI(T)1610 1241 y(E)1637 1226 y(X)g(\014le)g(will)f(b)q(e)-39 1286 y Fx(h)p FE(\014lename)t Fx(i)p FI(.)p Fy(tex)f FI(an)o(yw)o(a)o(y)l(.) -39 1431 y Fp(6.7)65 b(Option)22 b Fo(-f)-39 1523 y Fr(T)-5 b(emplate:)19 b Fy(-f)c FI([)p Fx(h)p FE(dimen)t Fx(i)p FI(])-39 1596 y(The)24 b Fy(-f)f FI(option)h(tells)f FE(mma2ltx)i FI(to)f(enclose)f(the)h(whole)g(picture)f(in)o(to)h(an)g Fy(\\fbox)p FI(.)42 b(The)24 b(optional)-39 1656 y(argumen)o(t)f(is)h (the)g(amoun)o(t)g(of)h Fy(\\fboxsep)p FI(;)g(b)o(y)f(default)g FE(mma2ltx)h FI(assumes)e Fy(\\fboxsep=0p)o(t)p FI(.)43 b(F)l(or)-39 1716 y(instance)16 b(the)g(command)166 1818 y Fy(mma2ltx)23 b(-f5pt)g(-w8cm)h(mypic.ps)-39 1919 y FI(pro)q(duces)13 b(a)h(picture)e(8)c(cm)k(wide,)h(enclosed)g(in)o(to)f Fy(\\fbox)p FI(;)g(from)g(eac)o(h)h(edge)g(of)h(the)e(b)q(o)o(x)i(and)g (its)e(con)o(ten)o(ts)-39 1980 y(there)j(are)i(5)8 b(pt.)-39 2124 y Fp(6.8)65 b(Option)22 b Fo(-s)-39 2216 y Fr(T)-5 b(emplate:)19 b Fy(-s)p Fx(h)p FE(c)n(ontr)n(ol)e(se)n(quenc)n(e)t Fx(i)-39 2289 y FI(This)22 b(option)g(sp)q(eci\014es)f(a)i(L)488 2283 y FC(a)512 2289 y FI(T)539 2304 y(E)566 2289 y(X)f(fon)o(t-size)f (con)o(trol)g(sequence)g(to)h(c)o(hange)g(the)g(size)f(of)h(the)g (picture)-39 2349 y(lab)q(els.)e(Note)15 b(that)g FE(mma2ltx)h FI(do)q(esn't)f(c)o(hec)o(k)e(if)h(the)h Fx(h)p FE(c)n(ontr)n(ol)h(se)n (quenc)n(e)t Fx(i)h FI(is)e(a)g(v)m(alid)g(L)1571 2343 y FC(a)1595 2349 y FI(T)1622 2364 y(E)1649 2349 y(X)f(command.)-39 2409 y(So)i(b)q(e)h(careful.)34 2470 y(Generally)f(a)h(L)309 2464 y FC(a)333 2470 y FI(T)360 2485 y(E)388 2470 y(X)f(fon)o(t-size)h (command)e(ma)o(y)g(b)q(e)j(one)f(of)g Fy(tiny)p FI(,)f Fy(scriptsiz)o(e)p FI(,)e Fy(footnotes)o(ize)o FI(,)-39 2530 y Fy(normalsiz)o(e)p FI(,)i Fy(large)p FI(,)h Fy(Large)p FI(,)g Fy(LARGE)p FI(,)g Fy(huge)p FI(,)h Fy(Huge)p FI(.)27 b(No)19 b(leading)g(bac)o(kslash)g(is)f(needed)h(\(y)o(ou)f(m)o(ust)-39 2590 y(use)e Fy(-sfootnote)o(si)o(ze)d FI(instead)j(of)h Fy(-s\\footno)o(tes)o(ize)o FI(\).)34 2650 y(By)j(default)g(the)g (picture)g(uses)g(the)h(L)749 2644 y FC(a)773 2650 y FI(T)800 2665 y(E)827 2650 y(X)f(curren)o(t)g(fon)o(t)g(size.)33 b(Note)20 b(that)h(this)g(command)d(will)-39 2710 y(a\013ect)e(size)f (the)h(of)h Fr(all)f FI(the)g(strings)g(con)o(tained)g(in)g(the)g (picture.)928 2914 y(4)p eop %%Page: 5 6 5 5 bop -39 166 a Fp(6.9)65 b(Option)22 b Fo(-u)-39 258 y Fr(T)-5 b(emplate:)19 b Fy(-u)p Fx(h)p FE(T)324 269 y(E)350 258 y(X's)e(unit)5 b Fx(i)-39 331 y FI(The)14 b Fy(-u)g FI(option)h(sp)q(eci\014es)f(the)g(unit)g(of)h(measure)e(of)i (quan)o(tities)e(con)o(tained)h(in)g(the)g Fy(.tex)f FI(\014le)h(generated)-39 391 y(b)o(y)k FE(mma2ltx)p FI(.)29 b(Also)18 b(the)h(messages)f(sho)o(wn)i(during)e(L)981 385 y FC(a)1005 391 y FI(T)1032 406 y(E)1060 391 y(X)g(and)h FE(mma2ltx)h FI(pro)q(cessing)f(will)f(use)g(that)-39 451 y(unit.)-39 595 y Fp(6.10)65 b(Option)22 b Fo(-p)-39 688 y Fr(T)-5 b(emplate:)19 b Fy(-p)p FI([)p Fx(h)p FE(pr)n(olo)n(gue)d (\014le)t Fx(i)p FI(])34 761 y(By)i(default)g(the)h(EPSF)g(\014le)f (pro)q(duced)i(b)o(y)e FE(mma2ltx)h FI(do)q(esn't)h(con)o(tain)e(the)h FD(Mathematica)e FI(P)o(ost-)-39 821 y(Script)g(prologue)h(\(i.e.)24 b(it)17 b(cannot)h(b)q(e)g(prin)o(ted)f(as)h(is\).)25 b(In)17 b(fact)h(this)g(prologue)g(is)f(included)g(only)g(once)-39 881 y(in)e(the)h(\014nal)h(P)o(ostScript)f(\014le)f(pro)q(duced)i(b)o (y)f Fy(dvips)p FI(.)34 941 y(The)21 b Fx(h)p FE(pr)n(olo)n(gue)h (\014le)t Fx(i)g FI(is)f(an)g(optional)h(argumen)o(t)e(and)h(allo)o(ws) g(to)g(sp)q(ecify)g(an)g(alternate)g FD(Mathe-)-39 1001 y(matica)16 b FI(prologue)j(\014le)f(\(e.g.)27 b(a)18 b(new)o(er)g(prologue)h(\014le\).)27 b(T)l(o)18 b(obatin)h(a)g (prologue)g(\014le)e(y)o(ou)h(can)h(use)f(the)-39 1061 y(program)e Fy(extpro)p FI(.)j(See)c Fx(x)q FI(10)i(for)f(further)g (details.)34 1122 y(Using)24 b(this)f(option)i(the)e(EPSF)i(\014le)e (pro)q(duced)h(b)o(y)g FE(mma2ltx)g FI(will)f(con)o(tain)h(the)f FD(Mathematica)-39 1182 y FI(prologue)16 b(\014le.)21 b(This)16 b(ma)o(y)e(b)q(e)i(v)o(ery)f(useful)h(for)g(some)f Fy(dvi)g FI(preview)o(er)g(with)g(capabilit)o(y)g(to)i(sho)o(w)f(P)o (ost-)-39 1242 y(Script)f(sp)q(ecials.)-39 1386 y Fp(6.11)65 b(Option)22 b Fo(-c)-39 1478 y Fr(T)-5 b(emplate:)19 b Fy(-c)p Fx(h)p FI(\()p Fq(s)339 1485 y Fm(x)360 1478 y Fq(;)8 b(s)405 1485 y Fm(y)426 1478 y FI(\))14 b(=)f(\()p Fq(s)552 1460 y Fl(0)552 1491 y Fm(x)574 1478 y Fq(;)8 b(s)619 1460 y Fl(0)619 1491 y Fm(y)640 1478 y FI(\)\()p Fq(dimen)815 1485 y Fm(x)836 1478 y Fq(;)g(dimen)995 1485 y Fm(y)1015 1478 y FI(\))p Fx(i)34 1551 y FI(The)18 b Fy(-c)f FI(option)i(can)f(b)q(e)g(used)h(to)f(o)o(v)o(erride)f(a)h(p) q(eculiar)g(b)q(eha)o(viour)g(of)g FD(Mathematica)p FI('s)e(primitiv)o (e)-39 1611 y Fy(Text)p FI(.)37 b(T)l(o)22 b(place)g(text,)g FE(mma2ltx)h FI(normally)d(uses)j(the)f(same)f(con)o(v)o(en)o(tions)f (of)j(the)f FD(Mathematica)p FI('s)-39 1671 y(primitiv)n(e)13 b(`)p Fy(Text)p FI(':)19 b(reference)c(p)q(oin)o(t)h(\()p Fq(x;)8 b(y)r FI(\))15 b(is)h(realized)f(as)i(follo)o(ws:)33 1771 y Fx(\017)25 b FI(The)16 b(text)f(string)i(is)f(placed)g(in)o(to)g (a)g(b)q(o)o(x)h(ha)o(ving)f(the)g(same)f(size.)33 1872 y Fx(\017)25 b FI(An)17 b(o\013set)i(\()p Fq(s)337 1879 y Fm(x)359 1872 y Fq(;)8 b(s)404 1879 y Fm(y)424 1872 y FI(\))18 b(in)g(the)f(b)q(ounding)i(b)q(o)o(x)f(co)q(ordinates)h (system)e(\(see)g(the)h(Fig.)f(1\))h(determines)83 1932 y(where)d(the)h(reference)f(p)q(oin)o(t)h(go)q(es.)p 1182 2297 709 2 v 1849 2296 a Fk(-)p 1535 2532 2 473 v 1536 2102 a(6)p 1356 2177 361 4 v 1356 2413 4 237 v 1385 2327 a Fj(T)-9 b(ext)1631 2269 y(1)p 1631 2307 52 2 v 1632 2387 a Fi(x)p 1713 2413 4 237 v 1356 2416 361 4 v 1713 2177 a Fh(r)1690 2160 y Fg(\(1)p Ff(;)6 b Fg(1\))1713 2296 y Fh(r)1725 2284 y Fg(\(1)p Ff(;)g Fg(0\))1713 2414 y Fh(r)1678 2445 y Fg(\(1)p Ff(;)g Fe(\000)p Fg(1\))1536 2414 y Fh(r)1548 2445 y Fg(\(0)p Ff(;)g Fe(\000)p Fg(1\))1359 2414 y Fh(r)1288 2445 y Fg(\()p Fe(\000)p Fg(1)p Ff(;)g Fe(\000)p Fg(1\))1359 2296 y Fh(r)1254 2284 y Fg(\()p Fe(\000)p Fg(1)p Ff(;)g Fg(0\))1359 2177 y Fh(r)1300 2160 y Fg(\()p Fe(\000)p Fg(1)p Ff(;)g Fg(1\))1536 2177 y Fh(r)1548 2160 y Fg(\(0)p Ff(;)g Fg(1\))1845 2330 y Fq(s)1868 2337 y Fm(x)1481 2081 y Fq(s)1504 2088 y Fm(y)1152 2634 y FI(Figure)11 b(1:)19 b(Bounding)12 b(b)q(o)o(x)g(co)q (ordinates.)34 2032 y(F)l(or)k(instance)g(the)g(o\013set)g(\()p Fx(\000)p FI(1)p Fq(;)8 b FI(1\))17 b(means)e(that)h(the)g(b)q(o)o(x) -39 2092 y(con)o(taining)h(the)h(string)g(is)f(placed)g(with)h(the)f(p) q(oin)o(t)h(\()p Fx(\000)p FI(1)p Fq(;)8 b FI(1\))-39 2152 y(at)17 b(the)f(reference)g(p)q(oin)o(t)h(\()p Fq(x;)8 b(y)r FI(\),)15 b(i.e.)22 b(left)16 b(and)i(top)f(aligned.)-39 2213 y(If)i(the)g(o\013set)i(is)f(\(0)p Fq(;)8 b FI(0\))20 b(then)g(the)f(b)q(o)o(x)h(is)g(cen)o(tered)e(on)j(the)-39 2273 y(reference)g(p)q(oin)o(t)i(\()p Fq(x;)8 b(y)r FI(\).)40 b(Note)23 b(that)g(w)o(e)f(ma)o(y)g(also)h(ha)o(v)o(e)-39 2333 y(o\013sets)14 b(greater)f(than)g(1.)21 b(F)l(or)13 b(instance)g(the)g(lab)q(elling)f(of)i(the)-39 2393 y Fq(x)p FI(-axis)j(is)h(realized)f(\(b)o(y)g FD(Mathematica)p FI(\))f(using)j(a)f(reference)-39 2453 y(p)q(oin)o(t)j(lying)f(on)h (the)g Fq(x)p FI(-axis)g(and)g(a)g(b)q(ounding)h(b)q(o)o(x)g(o\013set) -39 2513 y(of)g(\(0)p Fq(;)8 b FI(2\).)41 b(With)23 b(suc)o(h)f (o\013set,)j(di\013eren)o(t)c(heigh)o(t)i Fq(x)p FI(-lab)q(els)-39 2574 y(w)o(ould)16 b(b)q(e)g(placed)g(at)g(di\013eren)o(t)g(distance)g (from)f(the)h Fq(x)p FI(-axis.)-39 2634 y(The)i(`)p Fy(-c)p FI(')f(option)h(b)o(y-passes)h(this)g(b)q(eha)o(viour.)27 b(It)18 b(replaces)-39 2694 y(an)o(y)h(lab)q(el)g(ha)o(ving)g(\()p Fq(s)379 2701 y Fm(x)401 2694 y Fq(;)8 b(s)446 2701 y Fm(y)466 2694 y FI(\))20 b(bb-o\013set)g(with)f(lab)q(els)g(ha)o(ving) -39 2754 y(\()p Fq(s)3 2736 y Fl(0)3 2767 y Fm(x)24 2754 y Fq(;)8 b(s)69 2736 y Fl(0)69 2767 y Fm(y)90 2754 y FI(\))15 b(bb-o\013set)h(further)f(shifted)g(b)o(y)f(\()p Fq(dimen)865 2761 y Fm(x)886 2754 y Fq(;)8 b(dimen)1045 2761 y Fm(y)1065 2754 y FI(\))15 b(from)f(the)h(curren)o(t)f(p)q (osition)i(\()p Fq(dimen)1805 2761 y Fm(x)1841 2754 y FI(and)-39 2814 y Fq(dimen)98 2821 y Fm(y)134 2814 y FI(m)o(ust)f(b)q(e)h(n)o(um)o(b)q(ers)f(follo)o(w)o(ed)g(b)o(y)h(one)g (of)h(T)946 2825 y(E)973 2814 y(X's)f(unit\).)928 2914 y(5)p eop %%Page: 6 7 6 6 bop 34 166 a FI(The)20 b(follo)o(wing)f(example)f(could)i(mak)o(e)e (this)i(clear.)32 b(Consider)20 b(a)g(graphic)h(ha)o(ving)e(the)h (follo)o(wing)-39 226 y(lab)q(els)523 296 y Fx(\000)567 262 y FI(3)p 567 285 25 2 v 567 330 a(2)705 296 y Fx(\000)11 b FI(1)109 b Fx(\000)942 262 y FI(1)p 942 285 V 942 330 a(2)1074 262 y(1)p 1074 285 V 1074 330 a(2)1201 296 y(1)1328 262 y(3)p 1328 285 V 1328 330 a(2)-39 403 y(under)16 b(the)g Fq(x)p FI(-axis.)22 b(Since)15 b(lab)q(els)i(`)p Fx(\000)669 383 y FA(3)p 669 391 18 2 v 669 420 a(2)691 403 y FI(',)e(`)p Fx(\000)792 383 y FA(1)p 792 391 V 792 420 a(2)814 403 y FI(',)h(`)877 383 y FA(1)p 877 391 V 877 420 a(2)899 403 y FI(')g(and)h(and)g(`)1138 383 y FA(3)p 1138 391 V 1138 420 a(2)1160 403 y FI(')f(are)h(higher)f (than)h(lab)q(el)f(`)p Fx(\000)p FI(1')g(and)h(`1',)-39 463 y(they)h(are)i(placed)e(lo)o(w)o(er)h(than)h(the)f(lab)q(els)g(`)p Fx(\000)p FI(1'.)29 b(Using)19 b(the)g(option)h(`)p Fy(-c\(0,2\)=\()o (0,1)o(\)\(0)o(pt,)o(-5)o(pt\))o FI(')-39 523 y(ev)o(ery)15 b(lab)q(els)h(will)g(b)q(e)g(placed)g(with)h(the)f(top)h(edge)g(of)g (the)f(b)q(o)o(x)h(that)g(b)q(ounds)h(them,)c(at)j(5)8 b(pt)18 b(from)d(the)-39 583 y Fq(x)p FI(-axis,)g(as)i(sho)o(wn)g(in)f (Fig.)g(2.)34 643 y(Note)g(that)g(it)g(is)g(p)q(ossible)h(to)f(sp)q (ecify)g(m)o(ultiple)d Fy(-c)i FI(options)i(on)g(the)f(same)f(command)f (line.)8 1259 y @beginspecial 212.597809 @hsize 131.390900 @vsize @setspecial %%BeginDocument: 6mag.eps %MMA2LTXCommandLine: mma2ltx -ucm -p -w7.5cm 6mag.ps % Mathematica v2.2 prologue /Mathdict 150 dict def Mathdict begin /Mwidth 212.60 def /Mheight 131.39 def /Mnodistort true def /Mlmarg 0 def /Mrmarg 0 def /Mbmarg 0 def /Mtmarg 0 def /Mtransform{} bind def /Mfixwid true def /Mfixdash false def /Mrot 0 def /Mpstart{ MathPictureStart}bind def /Mpend{MathPictureEnd}bind def /Mscale{0 1 0 1 5 -1 roll MathScale}bind def /ISOLatin1Encoding dup where{pop pop}{[ /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /space /exclam /quotedbl /numbersign /dollar /percent /ampersand /quoteright /parenleft /parenright /asterisk /plus /comma /minus /period /slash /zero /one /two /three /four /five /six /seven /eight /nine /colon /semicolon /less /equal /greater /question /at /A /B /C /D /E /F /G /H /I /J /K /L /M /N /O /P /Q /R /S /T /U /V /W /X /Y /Z /bracketleft /backslash /bracketright /asciicircum /underscore /quoteleft /a /b /c /d /e /f /g /h /i /j /k /l /m /n /o /p /q /r /s /t /u /v /w /x /y /z /braceleft /bar /braceright /asciitilde /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /dotlessi /grave /acute /circumflex /tilde /macron /breve /dotaccent /dieresis /.notdef /ring /cedilla /.notdef /hungarumlaut /ogonek /caron /space /exclamdown /cent /sterling /currency /yen /brokenbar /section /dieresis /copyright /ordfeminine /guillemotleft /logicalnot /hyphen /registered /macron /degree /plusminus /twosuperior /threesuperior /acute /mu /paragraph /periodcentered /cedilla /onesuperior /ordmasculine /guillemotright /onequarter /onehalf /threequarters /questiondown /Agrave /Aacute /Acircumflex /Atilde /Adieresis /Aring /AE /Ccedilla /Egrave /Eacute /Ecircumflex /Edieresis /Igrave /Iacute /Icircumflex /Idieresis /Eth /Ntilde /Ograve /Oacute /Ocircumflex /Otilde /Odieresis /multiply /Oslash /Ugrave /Uacute /Ucircumflex /Udieresis /Yacute /Thorn /germandbls /agrave /aacute /acircumflex /atilde /adieresis /aring /ae /ccedilla /egrave /eacute /ecircumflex /edieresis /igrave /iacute /icircumflex /idieresis /eth /ntilde /ograve /oacute /ocircumflex /otilde /odieresis /divide /oslash /ugrave /uacute /ucircumflex /udieresis /yacute /thorn /ydieresis]def}ifelse /MFontDict 50 dict def /MStrCat{exch dup length 2 index length add string dup 3 1 roll copy length exch dup 4 2 roll exch putinterval}def /MCreateEncoding{1 index 255 string cvs(-)MStrCat 1 index MStrCat cvn exch(Encoding)MStrCat cvn dup where{exch get}{pop StandardEncoding}ifelse 3 1 roll dup MFontDict exch known not{1 index findfont dup length dict begin{1 index /FID ne{ def}{pop pop}ifelse}forall /Encoding 3 index def currentdict end 1 index exch definefont pop MFontDict 1 index null put}if exch pop exch pop}def /ISOLatin1{(ISOLatin1)MCreateEncoding}def /ISO8859{(ISOLatin1) MCreateEncoding}def /Mcopyfont{dup maxlength dict exch{1 index /FID eq{ pop pop}{2 index 3 1 roll put}ifelse}forall}def /Plain /Courier findfont Mcopyfont definefont pop /Bold /Courier findfont Mcopyfont definefont pop /Italic /Courier findfont Mcopyfont definefont pop /MathPictureStart{gsave Mtransform Mlmarg Mbmarg translate Mwidth Mlmarg Mrmarg add sub /Mwidth exch def Mheight Mbmarg Mtmarg add sub /Mheight exch def /Mtmatrix matrix currentmatrix def /Mgmatrix matrix currentmatrix def}bind def /MathPictureEnd{grestore}bind def /MFill{0 0 moveto Mwidth 0 lineto Mwidth Mheight lineto 0 Mheight lineto fill}bind def /MPlotRegion{3 index Mwidth mul 2 index Mheight mul translate exch sub Mheight mul /Mheight exch def exch sub Mwidth mul /Mwidth exch def} bind def /MathSubStart{Momatrix Mgmatrix Mtmatrix Mwidth Mheight 7 -2 roll moveto Mtmatrix setmatrix currentpoint Mgmatrix setmatrix 9 -2 roll moveto Mtmatrix setmatrix currentpoint 2 copy translate /Mtmatrix matrix currentmatrix def 3 -1 roll exch sub /Mheight exch def sub /Mwidth exch def}bind def /MathSubEnd{/Mheight exch def /Mwidth exch def /Mtmatrix exch def dup setmatrix /Mgmatrix exch def /Momatrix exch def}bind def /Mdot{moveto 0 0 rlineto stroke}bind def /Mtetra{moveto lineto lineto lineto fill}bind def /Metetra{moveto lineto lineto lineto closepath gsave fill grestore 0 setgray stroke}bind def /Mistroke{flattenpath 0 0 0{4 2 roll pop pop}{4 -1 roll 2 index sub dup mul 4 -1 roll 2 index sub dup mul add sqrt 4 -1 roll add 3 1 roll}{stop}{stop}pathforall pop pop currentpoint stroke moveto currentdash 3 -1 roll add setdash}bind def /Mfstroke{stroke currentdash pop 0 setdash}bind def /Mrotsboxa{gsave dup /Mrot exch def Mrotcheck Mtmatrix dup setmatrix 7 1 roll 4 index 4 index translate rotate 3 index -1 mul 3 index -1 mul translate /Mtmatrix matrix currentmatrix def grestore Msboxa 3 -1 roll /Mtmatrix exch def /Mrot 0 def}bind def /Msboxa{newpath 5 -1 roll Mvboxa pop Mboxout 6 -1 roll 5 -1 roll 4 -1 roll Msboxa1 5 -3 roll Msboxa1 Mboxrot[7 -2 roll 2 copy[3 1 roll 10 -1 roll 9 -1 roll]6 1 roll 5 -2 roll]}bind def /Msboxa1 {sub 2 div dup 2 index 1 add mul 3 -1 roll -1 add 3 -1 roll mul}bind def /Mvboxa{Mfixwid{Mvboxa1}{dup Mwidthcal 0 exch{add}forall exch Mvboxa1 4 index 7 -1 roll add 4 -1 roll pop 3 1 roll}ifelse}bind def /Mvboxa1{ gsave newpath[true 3 -1 roll{Mbbox 5 -1 roll{0 5 1 roll}{7 -1 roll exch sub(m)stringwidth pop .3 mul sub 7 1 roll 6 -1 roll 4 -1 roll Mmin 3 -1 roll 5 index add 5 -1 roll 4 -1 roll Mmax 4 -1 roll}ifelse false}forall{ stop}if counttomark 1 add 4 roll]grestore}bind def /Mbbox{1 dict begin 0 0 moveto /temp(T)def{gsave currentpoint newpath moveto temp 0 3 -1 roll put temp false charpath flattenpath currentpoint pathbbox grestore moveto lineto moveto}forall pathbbox newpath end}bind def /Mmin{2 copy gt{exch}if pop}bind def /Mmax{2 copy lt{exch}if pop}bind def /Mrotshowa{ dup /Mrot exch def Mrotcheck Mtmatrix dup setmatrix 7 1 roll 4 index 4 index translate rotate 3 index -1 mul 3 index -1 mul translate /Mtmatrix matrix currentmatrix def Mgmatrix setmatrix Mshowa /Mtmatrix exch def /Mrot 0 def}bind def /Mshowa{4 -2 roll moveto 2 index Mtmatrix setmatrix Mvboxa 7 1 roll Mboxout 6 -1 roll 5 -1 roll 4 -1 roll Mshowa1 4 1 roll Mshowa1 rmoveto currentpoint Mfixwid{Mshowax}{Mshoway}ifelse pop pop pop pop Mgmatrix setmatrix}bind def /Mshowax{0 1 4 index length -1 add{2 index 4 index 2 index get 3 index add moveto 4 index exch get Mfixdash{ Mfixdashp}if show}for}bind def /Mfixdashp{dup length 1 gt 1 index true exch{45 eq and}forall and{gsave(--)stringwidth pop(-)stringwidth pop sub 2 div 0 rmoveto dup length 1 sub{(-)show}repeat grestore}if}bind def /Mshoway{3 index Mwidthcal 5 1 roll 0 1 4 index length -1 add{2 index 4 index 2 index get 3 index add moveto 4 index exch get[6 index aload length 2 add -1 roll{pop Strform stringwidth pop neg exch add 0 rmoveto} exch kshow cleartomark}for pop}bind def /Mwidthcal{[exch{Mwidthcal1} forall][exch dup Maxlen -1 add 0 1 3 -1 roll{[exch 2 index{1 index Mget exch}forall pop Maxget exch}for pop]Mreva}bind def /Mreva{[exch aload length -1 1{1 roll}for]}bind def /Mget{1 index length -1 add 1 index ge{ get}{pop pop 0}ifelse}bind def /Maxlen{[exch{length}forall Maxget}bind def /Maxget{counttomark -1 add 1 1 3 -1 roll{pop Mmax}for exch pop}bind def /Mwidthcal1{[exch{Strform stringwidth pop}forall]}bind def /Strform{ /tem(x)def tem 0 3 -1 roll put tem}bind def /Mshowa1{2 copy add 4 1 roll sub mul sub -2 div}bind def /MathScale{Mwidth Mheight Mlp translate scale /yscale exch def /ybias exch def /xscale exch def /xbias exch def /Momatrix xscale yscale matrix scale xbias ybias matrix translate matrix concatmatrix def /Mgmatrix matrix currentmatrix def}bind def /Mlp{3 copy Mlpfirst{Mnodistort{Mmin dup}if 4 index 2 index 2 index Mlprun 11 index 11 -1 roll 10 -4 roll Mlp1 8 index 9 -5 roll Mlp1 4 -1 roll and{exit}if 3 -1 roll pop pop}loop exch 3 1 roll 7 -3 roll pop pop pop}bind def /Mlpfirst{3 -1 roll dup length 2 copy -2 add get aload pop pop pop 4 -2 roll -1 add get aload pop pop pop 6 -1 roll 3 -1 roll 5 -1 roll sub div 4 1 roll exch sub div}bind def /Mlprun{2 copy 4 index 0 get dup 4 1 roll Mlprun1 3 copy 8 -2 roll 9 -1 roll{3 copy Mlprun1 3 copy 11 -3 roll /gt Mlpminmax 8 3 roll 11 -3 roll /lt Mlpminmax 8 3 roll}forall pop pop pop pop 3 1 roll pop pop aload pop 5 -1 roll aload pop exch 6 -1 roll Mlprun2 8 2 roll 4 -1 roll Mlprun2 6 2 roll 3 -1 roll Mlprun2 4 2 roll exch Mlprun2 6 2 roll}bind def /Mlprun1{aload pop exch 6 -1 roll 5 -1 roll mul add 4 -2 roll mul 3 -1 roll add}bind def /Mlprun2{2 copy add 2 div 3 1 roll exch sub}bind def /Mlpminmax{cvx 2 index 6 index 2 index exec{7 -3 roll 4 -1 roll}if 1 index 5 index 3 -1 roll exec{4 1 roll pop 5 -1 roll aload pop pop 4 -1 roll aload pop[8 -2 roll pop 5 -2 roll pop 6 -2 roll pop 5 -1 roll]4 1 roll pop}{pop pop pop}ifelse}bind def /Mlp1{ 5 index 3 index sub 5 index 2 index mul 1 index le 1 index 0 le or dup not{1 index 3 index div .99999 mul 8 -1 roll pop 7 1 roll}if 8 -1 roll 2 div 7 -2 roll pop sub 5 index 6 -3 roll pop pop mul sub exch}bind def /intop 0 def /inrht 0 def /inflag 0 def /outflag 0 def /xadrht 0 def /xadlft 0 def /yadtop 0 def /yadbot 0 def /Minner{outflag 1 eq{/outflag 0 def /intop 0 def /inrht 0 def}if 5 index gsave Mtmatrix setmatrix Mvboxa pop grestore 3 -1 roll pop dup intop gt{/intop exch def}{pop} ifelse dup inrht gt{/inrht exch def}{pop}ifelse pop /inflag 1 def}bind def /Mouter{/xadrht 0 def /xadlft 0 def /yadtop 0 def /yadbot 0 def inflag 1 eq{dup 0 lt{dup intop mul neg /yadtop exch def}if dup 0 gt{dup intop mul /yadbot exch def}if pop dup 0 lt{dup inrht mul neg /xadrht exch def}if dup 0 gt{dup inrht mul /xadlft exch def}if pop /outflag 1 def}{pop pop}ifelse /inflag 0 def /inrht 0 def /intop 0 def}bind def /Mboxout{outflag 1 eq{4 -1 roll xadlft leadjust add sub 4 1 roll 3 -1 roll yadbot leadjust add sub 3 1 roll exch xadrht leadjust add add exch yadtop leadjust add add /outflag 0 def /xadlft 0 def /yadbot 0 def /xadrht 0 def /yadtop 0 def}if}bind def /leadjust{(m)stringwidth pop .5 mul}bind def /Mrotcheck{dup 90 eq{yadbot /yadbot xadrht def /xadrht yadtop def /yadtop xadlft def /xadlft exch def}if dup cos 1 index sin Checkaux dup cos 1 index sin neg exch Checkaux 3 1 roll pop pop}bind def /Checkaux{4 index exch 4 index mul 3 1 roll mul add 4 1 roll}bind def /Mboxrot{Mrot 90 eq{brotaux 4 2 roll}if Mrot 180 eq{4 2 roll brotaux 4 2 roll brotaux}if Mrot 270 eq{4 2 roll brotaux}if}bind def /brotaux{neg exch neg}bind def /Mabsproc{0 matrix defaultmatrix dtransform idtransform dup mul exch dup mul add sqrt}bind def /Mabswid{Mabsproc setlinewidth}bind def /Mabsdash{exch[exch{Mabsproc}forall]exch setdash} bind def /MBeginOrig{Momatrix concat}bind def /MEndOrig{Mgmatrix setmatrix}bind def /sampledsound where{pop}{/sampledsound{exch pop exch 5 1 roll mul 4 idiv mul 2 idiv exch pop exch /Mtempproc exch def{ Mtempproc pop}repeat}bind def}ifelse /g{setgray}bind def /k{ setcmykcolor}bind def /m{moveto}bind def /p{gsave}bind def /r{ setrgbcolor}bind def /w{setlinewidth}bind def /C{curveto}bind def /F{ fill}bind def /L{lineto}bind def /P{grestore}bind def /s{stroke}bind def /setcmykcolor where{pop}{/setcmykcolor{4 1 roll[4 1 roll]{1 index sub 1 sub neg dup 0 lt{pop 0}if dup 1 gt{pop 1}if exch}forall pop setrgbcolor} bind def}ifelse /Mcharproc{currentfile(x)readhexstring pop 0 get exch div}bind def /Mshadeproc{dup 3 1 roll{dup Mcharproc 3 1 roll}repeat 1 eq {setgray}{3 eq{setrgbcolor}{setcmykcolor}ifelse}ifelse}bind def /Mrectproc{3 index 2 index moveto 2 index 3 -1 roll lineto dup 3 1 roll lineto lineto fill}bind def /Mcolorimage{7 1 roll pop pop matrix invertmatrix concat 2 exch exp 1 sub 3 1 roll 1 1 2 index{1 1 4 index{ dup 1 sub exch 2 index dup 1 sub exch 7 index 9 index Mshadeproc Mrectproc}for pop}for pop pop pop pop}bind def /Mimage{pop matrix invertmatrix concat 2 exch exp 1 sub 3 1 roll 1 1 2 index{1 1 4 index{ dup 1 sub exch 2 index dup 1 sub exch 7 index Mcharproc setgray Mrectproc}for pop}for pop pop pop}bind def %MMA2LTXComment: Here follow the original Mathematica file stripped of the text strings MathPictureStart /Courier findfont 10 scalefont setfont % Scaling calculations 0.5 0.151576 0.309017 0.257514 [ [ -0.001 -0.001 0 0 ] [ 1.001 .61903 0 0 ] ] MathScale % Start of Graphics 1 setlinecap 1 setlinejoin newpath [ ] 0 setdash 0 g p p .002 w .04527 .30902 m .04527 .31527 L s P p .002 w .19685 .30902 m .19685 .31527 L s P p .002 w .34842 .30902 m .34842 .31527 L s P p .002 w .65158 .30902 m .65158 .31527 L s P p .002 w .80315 .30902 m .80315 .31527 L s P p .002 w .95473 .30902 m .95473 .31527 L s P p .001 w .07559 .30902 m .07559 .31277 L s P p .001 w .1059 .30902 m .1059 .31277 L s P p .001 w .13622 .30902 m .13622 .31277 L s P p .001 w .16653 .30902 m .16653 .31277 L s P p .001 w .22716 .30902 m .22716 .31277 L s P p .001 w .25748 .30902 m .25748 .31277 L s P p .001 w .28779 .30902 m .28779 .31277 L s P p .001 w .31811 .30902 m .31811 .31277 L s P p .001 w .37874 .30902 m .37874 .31277 L s P p .001 w .40905 .30902 m .40905 .31277 L s P p .001 w .43937 .30902 m .43937 .31277 L s P p .001 w .46968 .30902 m .46968 .31277 L s P p .001 w .53032 .30902 m .53032 .31277 L s P p .001 w .56063 .30902 m .56063 .31277 L s P p .001 w .59095 .30902 m .59095 .31277 L s P p .001 w .62126 .30902 m .62126 .31277 L s P p .001 w .68189 .30902 m .68189 .31277 L s P p .001 w .71221 .30902 m .71221 .31277 L s P p .001 w .74252 .30902 m .74252 .31277 L s P p .001 w .77284 .30902 m .77284 .31277 L s P p .001 w .83347 .30902 m .83347 .31277 L s P p .001 w .86378 .30902 m .86378 .31277 L s P p .001 w .8941 .30902 m .8941 .31277 L s P p .001 w .92441 .30902 m .92441 .31277 L s P p .001 w .01496 .30902 m .01496 .31277 L s P p .001 w .98504 .30902 m .98504 .31277 L s P p .002 w 0 .30902 m 1 .30902 L s P p .002 w .5 .0515 m .50625 .0515 L s P p .002 w .5 .18026 m .50625 .18026 L s P p .002 w .5 .43777 m .50625 .43777 L s P p .002 w .5 .56653 m .50625 .56653 L s P p .001 w .5 .07725 m .50375 .07725 L s P p .001 w .5 .10301 m .50375 .10301 L s P p .001 w .5 .12876 m .50375 .12876 L s P p .001 w .5 .15451 m .50375 .15451 L s P p .001 w .5 .20601 m .50375 .20601 L s P p .001 w .5 .23176 m .50375 .23176 L s P p .001 w .5 .25751 m .50375 .25751 L s P p .001 w .5 .28327 m .50375 .28327 L s P p .001 w .5 .33477 m .50375 .33477 L s P p .001 w .5 .36052 m .50375 .36052 L s P p .001 w .5 .38627 m .50375 .38627 L s P p .001 w .5 .41202 m .50375 .41202 L s P p .001 w .5 .46353 m .50375 .46353 L s P p .001 w .5 .48928 m .50375 .48928 L s P p .001 w .5 .51503 m .50375 .51503 L s P p .001 w .5 .54078 m .50375 .54078 L s P p .001 w .5 .02575 m .50375 .02575 L s P p .001 w .5 .59228 m .50375 .59228 L s P p .002 w .5 0 m .5 .61803 L s P P 0 0 m 1 0 L 1 .61803 L 0 .61803 L closepath clip newpath p [ .025 .025 ] 0 setdash p .004 w .02381 .30902 m .04325 .27609 L .06268 .2437 L .08212 .21238 L .10155 .18265 L .12099 .155 L .14043 .12987 L .15986 .10768 L .1793 .08881 L .19874 .07354 L .20845 .06735 L .21817 .06215 L .22789 .05796 L .23275 .05625 L .23761 .0548 L .24247 .05362 L .24733 .05269 L .24976 .05233 L .25219 .05203 L .25462 .0518 L .25583 .05171 L .25705 .05164 L .25826 .05158 L .25887 .05155 L .25948 .05154 L .26008 .05152 L .26069 .05151 L .2613 .0515 L .2619 .0515 L .26251 .0515 L .26312 .05151 L .26373 .05152 L .26433 .05154 L .26494 .05155 L .26555 .05158 L .26676 .05164 L .26798 .05171 L .26919 .0518 L .27162 .05203 L .27405 .05233 L .27648 .05269 L .28134 .05362 L .2862 .0548 L .29592 .05796 L .30564 .06215 L .31535 .06735 L .33479 .08071 L .35423 .09781 L .37366 .11838 L .3931 .14209 L Mistroke .41254 .16853 L .43197 .19729 L .45141 .22787 L .47085 .25979 L .49028 .29252 L .50972 .32552 L .52915 .35824 L .54859 .39016 L .56803 .42075 L .58746 .4495 L .6069 .47594 L .62634 .49965 L .64577 .52022 L .66521 .53733 L .67493 .54449 L .68465 .55069 L .69436 .55589 L .70408 .56007 L .70894 .56178 L .7138 .56323 L .71866 .56442 L .72352 .56534 L .72595 .5657 L .72838 .566 L .73081 .56623 L .73202 .56632 L .73324 .5664 L .73445 .56646 L .73506 .56648 L .73567 .5665 L .73627 .56651 L .73688 .56652 L .73749 .56653 L .7381 .56653 L .7387 .56653 L .73931 .56652 L .73992 .56651 L .74052 .5665 L .74174 .56646 L .74295 .5664 L .74417 .56632 L .74538 .56623 L .74781 .566 L .75024 .5657 L .75267 .56534 L .75753 .56442 L .76239 .56323 L .77211 .56007 L .78183 .55589 L .80126 .54449 L Mistroke .8207 .52923 L .84014 .51035 L .85957 .48817 L .87901 .46304 L .89845 .43538 L .91788 .40565 L .93732 .37434 L .95675 .34195 L .97619 .30902 L Mfstroke P P % End of Graphics MathPictureEnd end %%EndDocument @endspecial 18 1081 a Fs(\000)55 1053 y Fu(3)p 55 1072 21 2 v 55 1110 a(2)157 1027 y Fs(\000)p Fu(1)285 1081 y Fs(\000)322 1053 y Fu(1)p 322 1072 V 322 1110 a(2)574 1053 y(1)p 574 1072 V 574 1110 a(2)708 1025 y(1)842 1053 y(3)p 842 1072 V 842 1110 a(2)387 1224 y Fs(\000)p Fu(1)354 1110 y Fs(\000)p Fu(0)p Fn(:)p Fu(5)387 885 y(0)p Fn(:)p Fu(5)419 771 y(1)988 1259 y @beginspecial 212.597809 @hsize 131.390900 @vsize @setspecial %%BeginDocument: optc.eps %MMA2LTXCommandLine: mma2ltx -ucm -p -w7.5cm -c(0,2)=(0,1)(0pt,-5pt) optc.ps % Mathematica v2.2 prologue /Mathdict 150 dict def Mathdict begin /Mwidth 212.60 def /Mheight 131.39 def /Mnodistort true def /Mlmarg 0 def /Mrmarg 0 def /Mbmarg 0 def /Mtmarg 0 def /Mtransform{} bind def /Mfixwid true def /Mfixdash false def /Mrot 0 def /Mpstart{ MathPictureStart}bind def /Mpend{MathPictureEnd}bind def /Mscale{0 1 0 1 5 -1 roll MathScale}bind def /ISOLatin1Encoding dup where{pop pop}{[ /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /space /exclam /quotedbl /numbersign /dollar /percent /ampersand /quoteright /parenleft /parenright /asterisk /plus /comma /minus /period /slash /zero /one /two /three /four /five /six /seven /eight /nine /colon /semicolon /less /equal /greater /question /at /A /B /C /D /E /F /G /H /I /J /K /L /M /N /O /P /Q /R /S /T /U /V /W /X /Y /Z /bracketleft /backslash /bracketright /asciicircum /underscore /quoteleft /a /b /c /d /e /f /g /h /i /j /k /l /m /n /o /p /q /r /s /t /u /v /w /x /y /z /braceleft /bar /braceright /asciitilde /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /dotlessi /grave /acute /circumflex /tilde /macron /breve /dotaccent /dieresis /.notdef /ring /cedilla /.notdef /hungarumlaut /ogonek /caron /space /exclamdown /cent /sterling /currency /yen /brokenbar /section /dieresis /copyright /ordfeminine /guillemotleft /logicalnot /hyphen /registered /macron /degree /plusminus /twosuperior /threesuperior /acute /mu /paragraph /periodcentered /cedilla /onesuperior /ordmasculine /guillemotright /onequarter /onehalf /threequarters /questiondown /Agrave /Aacute /Acircumflex /Atilde /Adieresis /Aring /AE /Ccedilla /Egrave /Eacute /Ecircumflex /Edieresis /Igrave /Iacute /Icircumflex /Idieresis /Eth /Ntilde /Ograve /Oacute /Ocircumflex /Otilde /Odieresis /multiply /Oslash /Ugrave /Uacute /Ucircumflex /Udieresis /Yacute /Thorn /germandbls /agrave /aacute /acircumflex /atilde /adieresis /aring /ae /ccedilla /egrave /eacute /ecircumflex /edieresis /igrave /iacute /icircumflex /idieresis /eth /ntilde /ograve /oacute /ocircumflex /otilde /odieresis /divide /oslash /ugrave /uacute /ucircumflex /udieresis /yacute /thorn /ydieresis]def}ifelse /MFontDict 50 dict def /MStrCat{exch dup length 2 index length add string dup 3 1 roll copy length exch dup 4 2 roll exch putinterval}def /MCreateEncoding{1 index 255 string cvs(-)MStrCat 1 index MStrCat cvn exch(Encoding)MStrCat cvn dup where{exch get}{pop StandardEncoding}ifelse 3 1 roll dup MFontDict exch known not{1 index findfont dup length dict begin{1 index /FID ne{ def}{pop pop}ifelse}forall /Encoding 3 index def currentdict end 1 index exch definefont pop MFontDict 1 index null put}if exch pop exch pop}def /ISOLatin1{(ISOLatin1)MCreateEncoding}def /ISO8859{(ISOLatin1) MCreateEncoding}def /Mcopyfont{dup maxlength dict exch{1 index /FID eq{ pop pop}{2 index 3 1 roll put}ifelse}forall}def /Plain /Courier findfont Mcopyfont definefont pop /Bold /Courier findfont Mcopyfont definefont pop /Italic /Courier findfont Mcopyfont definefont pop /MathPictureStart{gsave Mtransform Mlmarg Mbmarg translate Mwidth Mlmarg Mrmarg add sub /Mwidth exch def Mheight Mbmarg Mtmarg add sub /Mheight exch def /Mtmatrix matrix currentmatrix def /Mgmatrix matrix currentmatrix def}bind def /MathPictureEnd{grestore}bind def /MFill{0 0 moveto Mwidth 0 lineto Mwidth Mheight lineto 0 Mheight lineto fill}bind def /MPlotRegion{3 index Mwidth mul 2 index Mheight mul translate exch sub Mheight mul /Mheight exch def exch sub Mwidth mul /Mwidth exch def} bind def /MathSubStart{Momatrix Mgmatrix Mtmatrix Mwidth Mheight 7 -2 roll moveto Mtmatrix setmatrix currentpoint Mgmatrix setmatrix 9 -2 roll moveto Mtmatrix setmatrix currentpoint 2 copy translate /Mtmatrix matrix currentmatrix def 3 -1 roll exch sub /Mheight exch def sub /Mwidth exch def}bind def /MathSubEnd{/Mheight exch def /Mwidth exch def /Mtmatrix exch def dup setmatrix /Mgmatrix exch def /Momatrix exch def}bind def /Mdot{moveto 0 0 rlineto stroke}bind def /Mtetra{moveto lineto lineto lineto fill}bind def /Metetra{moveto lineto lineto lineto closepath gsave fill grestore 0 setgray stroke}bind def /Mistroke{flattenpath 0 0 0{4 2 roll pop pop}{4 -1 roll 2 index sub dup mul 4 -1 roll 2 index sub dup mul add sqrt 4 -1 roll add 3 1 roll}{stop}{stop}pathforall pop pop currentpoint stroke moveto currentdash 3 -1 roll add setdash}bind def /Mfstroke{stroke currentdash pop 0 setdash}bind def /Mrotsboxa{gsave dup /Mrot exch def Mrotcheck Mtmatrix dup setmatrix 7 1 roll 4 index 4 index translate rotate 3 index -1 mul 3 index -1 mul translate /Mtmatrix matrix currentmatrix def grestore Msboxa 3 -1 roll /Mtmatrix exch def /Mrot 0 def}bind def /Msboxa{newpath 5 -1 roll Mvboxa pop Mboxout 6 -1 roll 5 -1 roll 4 -1 roll Msboxa1 5 -3 roll Msboxa1 Mboxrot[7 -2 roll 2 copy[3 1 roll 10 -1 roll 9 -1 roll]6 1 roll 5 -2 roll]}bind def /Msboxa1 {sub 2 div dup 2 index 1 add mul 3 -1 roll -1 add 3 -1 roll mul}bind def /Mvboxa{Mfixwid{Mvboxa1}{dup Mwidthcal 0 exch{add}forall exch Mvboxa1 4 index 7 -1 roll add 4 -1 roll pop 3 1 roll}ifelse}bind def /Mvboxa1{ gsave newpath[true 3 -1 roll{Mbbox 5 -1 roll{0 5 1 roll}{7 -1 roll exch sub(m)stringwidth pop .3 mul sub 7 1 roll 6 -1 roll 4 -1 roll Mmin 3 -1 roll 5 index add 5 -1 roll 4 -1 roll Mmax 4 -1 roll}ifelse false}forall{ stop}if counttomark 1 add 4 roll]grestore}bind def /Mbbox{1 dict begin 0 0 moveto /temp(T)def{gsave currentpoint newpath moveto temp 0 3 -1 roll put temp false charpath flattenpath currentpoint pathbbox grestore moveto lineto moveto}forall pathbbox newpath end}bind def /Mmin{2 copy gt{exch}if pop}bind def /Mmax{2 copy lt{exch}if pop}bind def /Mrotshowa{ dup /Mrot exch def Mrotcheck Mtmatrix dup setmatrix 7 1 roll 4 index 4 index translate rotate 3 index -1 mul 3 index -1 mul translate /Mtmatrix matrix currentmatrix def Mgmatrix setmatrix Mshowa /Mtmatrix exch def /Mrot 0 def}bind def /Mshowa{4 -2 roll moveto 2 index Mtmatrix setmatrix Mvboxa 7 1 roll Mboxout 6 -1 roll 5 -1 roll 4 -1 roll Mshowa1 4 1 roll Mshowa1 rmoveto currentpoint Mfixwid{Mshowax}{Mshoway}ifelse pop pop pop pop Mgmatrix setmatrix}bind def /Mshowax{0 1 4 index length -1 add{2 index 4 index 2 index get 3 index add moveto 4 index exch get Mfixdash{ Mfixdashp}if show}for}bind def /Mfixdashp{dup length 1 gt 1 index true exch{45 eq and}forall and{gsave(--)stringwidth pop(-)stringwidth pop sub 2 div 0 rmoveto dup length 1 sub{(-)show}repeat grestore}if}bind def /Mshoway{3 index Mwidthcal 5 1 roll 0 1 4 index length -1 add{2 index 4 index 2 index get 3 index add moveto 4 index exch get[6 index aload length 2 add -1 roll{pop Strform stringwidth pop neg exch add 0 rmoveto} exch kshow cleartomark}for pop}bind def /Mwidthcal{[exch{Mwidthcal1} forall][exch dup Maxlen -1 add 0 1 3 -1 roll{[exch 2 index{1 index Mget exch}forall pop Maxget exch}for pop]Mreva}bind def /Mreva{[exch aload length -1 1{1 roll}for]}bind def /Mget{1 index length -1 add 1 index ge{ get}{pop pop 0}ifelse}bind def /Maxlen{[exch{length}forall Maxget}bind def /Maxget{counttomark -1 add 1 1 3 -1 roll{pop Mmax}for exch pop}bind def /Mwidthcal1{[exch{Strform stringwidth pop}forall]}bind def /Strform{ /tem(x)def tem 0 3 -1 roll put tem}bind def /Mshowa1{2 copy add 4 1 roll sub mul sub -2 div}bind def /MathScale{Mwidth Mheight Mlp translate scale /yscale exch def /ybias exch def /xscale exch def /xbias exch def /Momatrix xscale yscale matrix scale xbias ybias matrix translate matrix concatmatrix def /Mgmatrix matrix currentmatrix def}bind def /Mlp{3 copy Mlpfirst{Mnodistort{Mmin dup}if 4 index 2 index 2 index Mlprun 11 index 11 -1 roll 10 -4 roll Mlp1 8 index 9 -5 roll Mlp1 4 -1 roll and{exit}if 3 -1 roll pop pop}loop exch 3 1 roll 7 -3 roll pop pop pop}bind def /Mlpfirst{3 -1 roll dup length 2 copy -2 add get aload pop pop pop 4 -2 roll -1 add get aload pop pop pop 6 -1 roll 3 -1 roll 5 -1 roll sub div 4 1 roll exch sub div}bind def /Mlprun{2 copy 4 index 0 get dup 4 1 roll Mlprun1 3 copy 8 -2 roll 9 -1 roll{3 copy Mlprun1 3 copy 11 -3 roll /gt Mlpminmax 8 3 roll 11 -3 roll /lt Mlpminmax 8 3 roll}forall pop pop pop pop 3 1 roll pop pop aload pop 5 -1 roll aload pop exch 6 -1 roll Mlprun2 8 2 roll 4 -1 roll Mlprun2 6 2 roll 3 -1 roll Mlprun2 4 2 roll exch Mlprun2 6 2 roll}bind def /Mlprun1{aload pop exch 6 -1 roll 5 -1 roll mul add 4 -2 roll mul 3 -1 roll add}bind def /Mlprun2{2 copy add 2 div 3 1 roll exch sub}bind def /Mlpminmax{cvx 2 index 6 index 2 index exec{7 -3 roll 4 -1 roll}if 1 index 5 index 3 -1 roll exec{4 1 roll pop 5 -1 roll aload pop pop 4 -1 roll aload pop[8 -2 roll pop 5 -2 roll pop 6 -2 roll pop 5 -1 roll]4 1 roll pop}{pop pop pop}ifelse}bind def /Mlp1{ 5 index 3 index sub 5 index 2 index mul 1 index le 1 index 0 le or dup not{1 index 3 index div .99999 mul 8 -1 roll pop 7 1 roll}if 8 -1 roll 2 div 7 -2 roll pop sub 5 index 6 -3 roll pop pop mul sub exch}bind def /intop 0 def /inrht 0 def /inflag 0 def /outflag 0 def /xadrht 0 def /xadlft 0 def /yadtop 0 def /yadbot 0 def /Minner{outflag 1 eq{/outflag 0 def /intop 0 def /inrht 0 def}if 5 index gsave Mtmatrix setmatrix Mvboxa pop grestore 3 -1 roll pop dup intop gt{/intop exch def}{pop} ifelse dup inrht gt{/inrht exch def}{pop}ifelse pop /inflag 1 def}bind def /Mouter{/xadrht 0 def /xadlft 0 def /yadtop 0 def /yadbot 0 def inflag 1 eq{dup 0 lt{dup intop mul neg /yadtop exch def}if dup 0 gt{dup intop mul /yadbot exch def}if pop dup 0 lt{dup inrht mul neg /xadrht exch def}if dup 0 gt{dup inrht mul /xadlft exch def}if pop /outflag 1 def}{pop pop}ifelse /inflag 0 def /inrht 0 def /intop 0 def}bind def /Mboxout{outflag 1 eq{4 -1 roll xadlft leadjust add sub 4 1 roll 3 -1 roll yadbot leadjust add sub 3 1 roll exch xadrht leadjust add add exch yadtop leadjust add add /outflag 0 def /xadlft 0 def /yadbot 0 def /xadrht 0 def /yadtop 0 def}if}bind def /leadjust{(m)stringwidth pop .5 mul}bind def /Mrotcheck{dup 90 eq{yadbot /yadbot xadrht def /xadrht yadtop def /yadtop xadlft def /xadlft exch def}if dup cos 1 index sin Checkaux dup cos 1 index sin neg exch Checkaux 3 1 roll pop pop}bind def /Checkaux{4 index exch 4 index mul 3 1 roll mul add 4 1 roll}bind def /Mboxrot{Mrot 90 eq{brotaux 4 2 roll}if Mrot 180 eq{4 2 roll brotaux 4 2 roll brotaux}if Mrot 270 eq{4 2 roll brotaux}if}bind def /brotaux{neg exch neg}bind def /Mabsproc{0 matrix defaultmatrix dtransform idtransform dup mul exch dup mul add sqrt}bind def /Mabswid{Mabsproc setlinewidth}bind def /Mabsdash{exch[exch{Mabsproc}forall]exch setdash} bind def /MBeginOrig{Momatrix concat}bind def /MEndOrig{Mgmatrix setmatrix}bind def /sampledsound where{pop}{/sampledsound{exch pop exch 5 1 roll mul 4 idiv mul 2 idiv exch pop exch /Mtempproc exch def{ Mtempproc pop}repeat}bind def}ifelse /g{setgray}bind def /k{ setcmykcolor}bind def /m{moveto}bind def /p{gsave}bind def /r{ setrgbcolor}bind def /w{setlinewidth}bind def /C{curveto}bind def /F{ fill}bind def /L{lineto}bind def /P{grestore}bind def /s{stroke}bind def /setcmykcolor where{pop}{/setcmykcolor{4 1 roll[4 1 roll]{1 index sub 1 sub neg dup 0 lt{pop 0}if dup 1 gt{pop 1}if exch}forall pop setrgbcolor} bind def}ifelse /Mcharproc{currentfile(x)readhexstring pop 0 get exch div}bind def /Mshadeproc{dup 3 1 roll{dup Mcharproc 3 1 roll}repeat 1 eq {setgray}{3 eq{setrgbcolor}{setcmykcolor}ifelse}ifelse}bind def /Mrectproc{3 index 2 index moveto 2 index 3 -1 roll lineto dup 3 1 roll lineto lineto fill}bind def /Mcolorimage{7 1 roll pop pop matrix invertmatrix concat 2 exch exp 1 sub 3 1 roll 1 1 2 index{1 1 4 index{ dup 1 sub exch 2 index dup 1 sub exch 7 index 9 index Mshadeproc Mrectproc}for pop}for pop pop pop pop}bind def /Mimage{pop matrix invertmatrix concat 2 exch exp 1 sub 3 1 roll 1 1 2 index{1 1 4 index{ dup 1 sub exch 2 index dup 1 sub exch 7 index Mcharproc setgray Mrectproc}for pop}for pop pop pop}bind def %MMA2LTXComment: Here follow the original Mathematica file stripped of the text strings MathPictureStart /Courier findfont 10 scalefont setfont % Scaling calculations 0.5 0.151576 0.309017 0.257514 [ [ -0.001 -0.001 0 0 ] [ 1.001 .61903 0 0 ] ] MathScale % Start of Graphics 1 setlinecap 1 setlinejoin newpath [ ] 0 setdash 0 g p p .002 w .04527 .30902 m .04527 .31527 L s P p .002 w .19685 .30902 m .19685 .31527 L s P p .002 w .34842 .30902 m .34842 .31527 L s P p .002 w .65158 .30902 m .65158 .31527 L s P p .002 w .80315 .30902 m .80315 .31527 L s P p .002 w .95473 .30902 m .95473 .31527 L s P p .001 w .07559 .30902 m .07559 .31277 L s P p .001 w .1059 .30902 m .1059 .31277 L s P p .001 w .13622 .30902 m .13622 .31277 L s P p .001 w .16653 .30902 m .16653 .31277 L s P p .001 w .22716 .30902 m .22716 .31277 L s P p .001 w .25748 .30902 m .25748 .31277 L s P p .001 w .28779 .30902 m .28779 .31277 L s P p .001 w .31811 .30902 m .31811 .31277 L s P p .001 w .37874 .30902 m .37874 .31277 L s P p .001 w .40905 .30902 m .40905 .31277 L s P p .001 w .43937 .30902 m .43937 .31277 L s P p .001 w .46968 .30902 m .46968 .31277 L s P p .001 w .53032 .30902 m .53032 .31277 L s P p .001 w .56063 .30902 m .56063 .31277 L s P p .001 w .59095 .30902 m .59095 .31277 L s P p .001 w .62126 .30902 m .62126 .31277 L s P p .001 w .68189 .30902 m .68189 .31277 L s P p .001 w .71221 .30902 m .71221 .31277 L s P p .001 w .74252 .30902 m .74252 .31277 L s P p .001 w .77284 .30902 m .77284 .31277 L s P p .001 w .83347 .30902 m .83347 .31277 L s P p .001 w .86378 .30902 m .86378 .31277 L s P p .001 w .8941 .30902 m .8941 .31277 L s P p .001 w .92441 .30902 m .92441 .31277 L s P p .001 w .01496 .30902 m .01496 .31277 L s P p .001 w .98504 .30902 m .98504 .31277 L s P p .002 w 0 .30902 m 1 .30902 L s P p .002 w .5 .0515 m .50625 .0515 L s P p .002 w .5 .18026 m .50625 .18026 L s P p .002 w .5 .43777 m .50625 .43777 L s P p .002 w .5 .56653 m .50625 .56653 L s P p .001 w .5 .07725 m .50375 .07725 L s P p .001 w .5 .10301 m .50375 .10301 L s P p .001 w .5 .12876 m .50375 .12876 L s P p .001 w .5 .15451 m .50375 .15451 L s P p .001 w .5 .20601 m .50375 .20601 L s P p .001 w .5 .23176 m .50375 .23176 L s P p .001 w .5 .25751 m .50375 .25751 L s P p .001 w .5 .28327 m .50375 .28327 L s P p .001 w .5 .33477 m .50375 .33477 L s P p .001 w .5 .36052 m .50375 .36052 L s P p .001 w .5 .38627 m .50375 .38627 L s P p .001 w .5 .41202 m .50375 .41202 L s P p .001 w .5 .46353 m .50375 .46353 L s P p .001 w .5 .48928 m .50375 .48928 L s P p .001 w .5 .51503 m .50375 .51503 L s P p .001 w .5 .54078 m .50375 .54078 L s P p .001 w .5 .02575 m .50375 .02575 L s P p .001 w .5 .59228 m .50375 .59228 L s P p .002 w .5 0 m .5 .61803 L s P P 0 0 m 1 0 L 1 .61803 L 0 .61803 L closepath clip newpath p [ .025 .025 ] 0 setdash p .004 w .02381 .30902 m .04325 .27609 L .06268 .2437 L .08212 .21238 L .10155 .18265 L .12099 .155 L .14043 .12987 L .15986 .10768 L .1793 .08881 L .19874 .07354 L .20845 .06735 L .21817 .06215 L .22789 .05796 L .23275 .05625 L .23761 .0548 L .24247 .05362 L .24733 .05269 L .24976 .05233 L .25219 .05203 L .25462 .0518 L .25583 .05171 L .25705 .05164 L .25826 .05158 L .25887 .05155 L .25948 .05154 L .26008 .05152 L .26069 .05151 L .2613 .0515 L .2619 .0515 L .26251 .0515 L .26312 .05151 L .26373 .05152 L .26433 .05154 L .26494 .05155 L .26555 .05158 L .26676 .05164 L .26798 .05171 L .26919 .0518 L .27162 .05203 L .27405 .05233 L .27648 .05269 L .28134 .05362 L .2862 .0548 L .29592 .05796 L .30564 .06215 L .31535 .06735 L .33479 .08071 L .35423 .09781 L .37366 .11838 L .3931 .14209 L Mistroke .41254 .16853 L .43197 .19729 L .45141 .22787 L .47085 .25979 L .49028 .29252 L .50972 .32552 L .52915 .35824 L .54859 .39016 L .56803 .42075 L .58746 .4495 L .6069 .47594 L .62634 .49965 L .64577 .52022 L .66521 .53733 L .67493 .54449 L .68465 .55069 L .69436 .55589 L .70408 .56007 L .70894 .56178 L .7138 .56323 L .71866 .56442 L .72352 .56534 L .72595 .5657 L .72838 .566 L .73081 .56623 L .73202 .56632 L .73324 .5664 L .73445 .56646 L .73506 .56648 L .73567 .5665 L .73627 .56651 L .73688 .56652 L .73749 .56653 L .7381 .56653 L .7387 .56653 L .73931 .56652 L .73992 .56651 L .74052 .5665 L .74174 .56646 L .74295 .5664 L .74417 .56632 L .74538 .56623 L .74781 .566 L .75024 .5657 L .75267 .56534 L .75753 .56442 L .76239 .56323 L .77211 .56007 L .78183 .55589 L .80126 .54449 L Mistroke .8207 .52923 L .84014 .51035 L .85957 .48817 L .87901 .46304 L .89845 .43538 L .91788 .40565 L .93732 .37434 L .95675 .34195 L .97619 .30902 L Mfstroke P P % End of Graphics MathPictureEnd end %%EndDocument @endspecial 998 1060 a Fs(\000)1035 1032 y Fu(3)p 1035 1051 V 1035 1089 a(2)1137 1032 y Fs(\000)p Fu(1)1266 1060 y Fs(\000)1303 1032 y Fu(1)p 1303 1051 V 1303 1089 a(2)1554 1032 y(1)p 1554 1051 V 1554 1089 a(2)1688 1032 y(1)113 b(3)p 1822 1051 V 1822 1089 a(2)1367 1224 y Fs(\000)p Fu(1)1335 1110 y Fs(\000)p Fu(0)p Fn(:)p Fu(5)1367 885 y(0)p Fn(:)p Fu(5)1399 771 y(1)200 1319 y FI(Without)16 b(`)p Fy(-c)p FI(')f(correction)512 b(With)16 b(`)p Fy(-c)p FI(')f(correction)526 1417 y(Figure)h(2:)21 b(Beha)o(viour)15 b(of)i(the)f(`)p Fy(-c)p FI(')f(option.)-39 1620 y Fp(6.12)65 b(Option)22 b Fo(-e)-39 1712 y Fr(T)-5 b(emplate:)19 b Fy(-e)p Fx(h)p FE(esc)n(ap)n(e)e(se)n(quenc)n(e)t Fx(i)34 1785 y FI(This)k(option)h(tells)e FE(mma2ltx)i FI(to)g(con)o(v)o(ert)e (in)o(to)h(L)975 1779 y FC(a)999 1785 y FI(T)1026 1800 y(E)1053 1785 y(X)g(only)h(the)f(lab)q(els)g(whic)o(h)f(b)q(egin)i (with)f(the)-39 1845 y(sequence)15 b Fx(h)p FE(esc)n(ap)n(e)j(se)n (quenc)n(e)t Fx(i)p FI(.)k(F)l(or)17 b(instance)f(with)633 1946 y Fy(mma2ltx)23 b(-elatex:)14 b FI(m)o(ypic.ps)-39 2048 y(only)i(lab)q(els)g(whic)o(h)f(b)q(egin)i(with)f(the)g(string)g (\\)p Fy(latex:)p FI(")k(will)15 b(b)q(e)i(con)o(v)o(erted.)j(Other)c (lab)q(els)g(are)g(left)f(as)-39 2108 y(in)g(the)h(original)h FD(Mathematica)d FI(graphic.)-39 2253 y Fp(6.13)65 b(Option)22 b Fo(-a)-39 2345 y Fr(T)-5 b(emplate:)19 b Fy(-a)p FI([)p Fx(h)p FE(length)t Fx(i)p FI(:)p Fx(h)p FE(width)t Fx(i)p FI(:)p Fx(h)p FE(inset)5 b Fx(i)p FI(])34 2418 y(Using)20 b(this)g(option,)i FE(mma2ltx)f FI(will)e(add)i(t)o(w)o(o)f(arro)o(ws)i (on)f(the)f Fq(x)g FI(and)h Fq(y)h FI(axes)f(of)f(a)h(2D)g(graphic.)-39 2478 y Fx(h)p FE(length)t Fx(i)p FI(,)e Fx(h)p FE(width)t Fx(i)f FI(and)g Fx(h)p FE(inset)5 b Fx(i)18 b FI(are)g(optional)f (parameters)f(to)i(sp)q(ecify)e(the)h(arro)o(w)h(size,)e(as)i(sho)o(wn) g(in)-39 2538 y(\014gure)e(3.)34 2598 y(F)l(or)g(instance)114 2700 y Fy(mma2ltx)23 b(-a)i(mypic.ps)-39 2802 y FI(or)928 2914 y(6)p eop %%Page: 7 8 7 7 bop 173 713 a @beginspecial -12 @llx -36 @lly 106 @urx 38 @ury 1180 @rwi @setspecial %%BeginDocument: arrparm.1 %*Font: cmti10 9.96265 9.96265 64:dca19 0.1 setgray newpath 0 0 moveto -11.33862 22.67725 lineto 68.03174 0 lineto -11.33862 -22.67725 lineto closepath fill 0 setgray 0 0.5 dtransform truncate idtransform setlinewidth pop [] 0 setdash 1 setlinejoin 10 setmiterlimit newpath 0 0 moveto -11.33862 22.67725 lineto 68.03174 0 lineto -11.33862 -22.67725 lineto closepath stroke 1 setlinecap newpath -11.33862 -34.01587 moveto 68.03174 -34.01587 lineto stroke newpath 64.336 -35.54674 moveto 68.03174 -34.01587 lineto 64.336 -32.485 lineto closepath gsave fill grestore stroke newpath -7.64288 -32.485 moveto -11.33862 -34.01587 lineto -7.64288 -35.54674 lineto closepath gsave fill grestore stroke 0.5 0 dtransform exch truncate exch idtransform pop setlinewidth newpath 79.37036 22.67725 moveto 79.37036 -22.67725 lineto stroke 0 0.5 dtransform truncate idtransform setlinewidth pop newpath 77.83957 -18.98167 moveto 79.37036 -22.67725 lineto 80.90115 -18.98167 lineto closepath gsave fill grestore stroke newpath 80.90115 18.98167 moveto 79.37036 22.67725 lineto 77.83957 18.98167 lineto closepath gsave fill grestore stroke newpath -11.33862 28.34656 moveto 0 28.34656 lineto stroke newpath -3.69557 26.81577 moveto 0 28.34656 lineto -3.69557 29.87735 lineto closepath gsave fill grestore stroke newpath -7.64305 29.87735 moveto -11.33862 28.34656 lineto -7.64305 26.81577 lineto closepath gsave fill grestore stroke 9.81999 -29.07867 moveto (length) cmti10 9.96265 fshow 82.37036 -3.45926 moveto (width) cmti10 9.96265 fshow -10.56125 31.34656 moveto (inset) cmti10 9.96265 fshow showpage %%EndDocument @endspecial 586 w @beginspecial 226.770996 @hsize 140.150101 @vsize @setspecial %%BeginDocument: arrsamp.eps %Mma2ltxCommandLine: mma2ltx -a -ucm -w8cm arrsamp.ps %Mma2ltxComment: For use with Mathematica prologue 'texmma22.pro' Mathdict begin /Mwidth 226.77 def /Mheight 140.15 def /Mnodistort true def %Mma2ltxComment: Here follow the original Mathematica file stripped of the text labels MathPictureStart /Courier findfont 10 scalefont setfont % Scaling calculations 0.5 0.10352 0.206011 0.103006 [ [ -0.001 -0.001 0 0 ] [ 1.001 .61903 0 0 ] ] MathScale % Start of Graphics 1 setlinecap 1 setlinejoin newpath [ ] 0 setdash 0 g p p .002 w 0 .20601 m 1 .20601 L s P p .002 w .5 0 m .5 .61803 L s P P 0 0 m 1 0 L 1 .61803 L 0 .61803 L closepath clip newpath p p p .004 w .18944 .41202 m .21532 .41202 L .2412 .41202 L .26708 .41202 L .29296 .41202 L .31884 .41202 L .34472 .41202 L .3706 .41202 L .39648 .41202 L .42236 .41202 L .44824 .41202 L .47412 .41202 L .5 .41202 L .52588 .41202 L .55176 .41202 L .57764 .41202 L .60352 .41202 L .6294 .41202 L .65528 .41202 L .68116 .41202 L .70704 .41202 L .73292 .41202 L .7588 .41202 L .78468 .41202 L .81056 .41202 L s P P p [ .01 .01 ] 0 setdash .004 w .18944 .20601 m .18944 .41202 L s .81056 .20601 m .81056 .41202 L s P P p 0 w 0 g 1.00100 0.20601 m 0.97600 0.21201 L 0.98200 0.20601 L 0.97600 0.20001 L F P p 0 w 0 g 0.50000 0.61903 m 0.49400 0.59403 L 0.50000 0.60003 L 0.50600 0.59403 L F P % End of Graphics MathPictureEnd end %%EndDocument @endspecial 1251 162 a Fq(p)1275 169 y Fm(T)1303 162 y FI(\()p Fq(t)p FI(\))1482 575 y Fq(T)5 b(=)p FI(2)-686 b Fx(\000)p Fq(T)5 b(=)p FI(2)1241 305 y(1)1241 570 y(0)1690 568 y Fq(t)503 811 y FI(Figure)16 b(3:)22 b(Examples)14 b(with)j(the)f(`)p Fy(-a)p FI(')e(option.)114 939 y Fy(mma2ltx)23 b(-a)i(0.02:0.01:0)o(.00)o(5)d(mypic.ps)34 1030 y FI(The)g(three)f (parameters)g Fx(h)p FE(length)t Fx(i)p FI(,)k Fx(h)p FE(width)t Fx(i)p FI(,)f Fx(h)p FE(inset)5 b Fx(i)23 b FI(m)o(ust)e(b)q(e)h(sp)q(eci\014ed)f(as)i(a)f(fraction)g(of)g(the) -39 1090 y(picture)15 b(size)g(\(scaled)h(co)q(ordinates\).)22 b(Default)16 b(v)m(alues)g(are)761 1188 y FE(lenght)44 b FI(=)d(0)p Fq(:)p FI(025)774 1261 y FE(width)h FI(=)f(0)p Fq(:)p FI(012)786 1334 y FE(inset)i FI(=)e(0)p Fq(:)p FI(006)-39 1498 y FB(7)79 b(Including)26 b Fz(mma2ltx)f FB(\014gures)-39 1608 y FI(T)l(o)13 b(include)f(a)i(picture)e(pro)q (cessed)i(b)o(y)e FE(mma2ltx)i FI(in)o(to)f(a)27 b(L)1027 1602 y FC(a)1051 1608 y FI(T)1078 1623 y(E)1105 1608 y(X)13 b(do)q(cumen)o(t,)f(\014rst)h(y)o(ou)h(should)f(mo)o(v)o(e)e (the)-39 1668 y(\014le)f(`)p Fy(mmatext.)o(sty)o FI(')e(in)i(y)o(our)h (L)523 1662 y FC(a)547 1668 y FI(T)574 1683 y(E)601 1668 y(X)g(input)f(directory)g(and)h(the)g(\014les)f(`)p Fy(texmma22.p)o(ro) p FI(')o(,)f(`)p Fy(mmawhite)o(.e)o(ps)p FI(')-39 1728 y(in)15 b(y)o(our)h(T)155 1739 y(E)182 1728 y(X)g(P)o(ostScript)g (directory)665 1710 y FA(6)683 1728 y FI(.)21 b(Then)c(include)d(the)i (st)o(yle)f(`)p Fy(mmatext)p FI(')d(at)17 b(the)f(top)g(of)g(y)o(our)g (do)q(c-)-39 1788 y(umen)o(t:)166 1880 y Fy(\\document)o(sty)o(le)o ([..)o(.,m)o(mat)o(ex)o(t,.)o(..])o({..)o(.})-39 1971 y FI(and)g(in)o(v)o(ok)o(e)f(the)h(follo)o(wing)g(macro)f(at)i(the)f(p) q(oin)o(t)g(where)g(y)o(ou)g(wish)g(to)h(include)e(the)h(picture:)166 2063 y Fy(\\input{my)o(pic)o(})-39 2154 y FI(where)25 b(`)p Fy(mypic)p FI(')e(is)i(the)h(name)e(of)i(the)f(\014le)g(pro)q (cessed)h(b)o(y)f FE(mma2ltx)p FI(.)50 b(Note)26 b(that)g(the)f (command)-39 2214 y(`)p Fy(\\input{m)o(yp)o(ic})o FI(')10 b(ma)o(y)h(b)q(e)i(in)o(v)o(ok)o(ed)f(within)g(an)o(y)h(L)923 2208 y FC(a)947 2214 y FI(T)974 2229 y(E)1001 2214 y(X)g(en)o(vironmen) o(t,)d(for)k(instance)e(the)h(commands:)166 2306 y Fy(\\begin{fi)o(gur) o(e})243 2366 y(\\centerin)o(g)243 2426 y(\\tabcolse)o(p=)o(1cm)243 2486 y(\\begin{ta)o(bu)o(lar)o(}{c)o(c})319 2547 y(\\input{mypi)o(c1}) 22 b(&\\input{my)o(pic)o(2})g(\\\\[2cm])319 2607 y(\\input{mypi)o(c3})g (&\\input{my)o(pic)o(4})243 2667 y(\\end{tabu)o(la)o(r})166 2727 y(\\end{figu)o(re})p -39 2769 784 2 v 17 2799 a Fw(6)35 2814 y Fu(This)14 b(is)g(the)g(directory)h(where)g(y)o(ou)e(k)o (eep)i(the)f Ft(dvips)f Fu(prologue)h(\014les.)928 2914 y FI(7)p eop %%Page: 8 9 8 8 bop -39 166 a FI(will)18 b(pro)q(duce)i(a)g(\014gure)g(con)o (taining)f(four)h FD(Mathematica)e FI(pictures.)30 b(Sometimes,)17 b(during)j(the)f(L)1805 160 y FC(a)1829 166 y FI(T)1856 181 y(E)1883 166 y(X)-39 226 y(pro)q(cessing)d(of)h(a)g(L)304 220 y FC(a)328 226 y FI(T)355 241 y(E)382 226 y(X)f(\014le)f(con)o (taining)i(one)f(or)h(more)e FE(mma2ltx)h FI(pictures)g(a)h(message)e (as)166 328 y Fy(Mathemati)o(ca)22 b(picture:)h('mypic.eps)o(')g (deltax=0.)o(48)o(502)f(cm)-39 430 y FI(or)16 b(a)h(message)e(as)166 531 y Fy(Mathemati)o(ca)22 b(picture:)h('mypic.eps)o(')g(deltay=1.)o (28)o(744)f(cm)-39 633 y FI(or)c(b)q(oth,)g(could)g(app)q(ear.)26 b(If)17 b(this)h(happ)q(ens)h(it)e(means)g(that)h(the)f(picture)g(is)g (wider)g(or)i(higher)e(\(b)o(y)g(the)-39 693 y(amoun)o(t)e(sho)o(wn\))i (than)g(the)f(picture)f(whose)i(dimensions)e(w)o(ere)g(established)h (with)g FE(mma2ltx)p FI(.)-39 860 y FB(8)79 b(Generating)25 b Fc(Mathematica)g FB(pictures)-39 969 y FE(mma2ltx)12 b FI(needs)g(a)h(P)o(ostScript)f(\014le.)19 b(This)13 b(\014le)e(m)o(ust)g(b)q(e)h(created)g(from)f(within)h FD(Mathematica)f FI(using)h(the)-39 1029 y(primitiv)n(e)d(`)p Fy(Display)p FI(')g(\(see)j(the)g FD(Mathematica)f FI(man)o(ual)g(for)i (a)f(detailed)g(description)f(of)i(this)f(primitiv)o(e)o(\).)34 1090 y(Since)22 b FE(mma2ltx)i FI(just)g(executes)e(a)i(plain)f (translation)h(of)f(ev)o(ery)f(string)i(con)o(tained)e(in)h(the)h FD(Ma-)-39 1150 y(thematica)d FI(P)o(ostScript)i(\014le,)h(w)o(e)e(ma)o (y)g(sp)q(ecify)g(a)i(L)960 1144 y FC(a)984 1150 y FI(T)1011 1165 y(E)1038 1150 y(X)f(con)o(trol)g(sequence)f(directly)f(from)h (within)-39 1210 y FD(Mathematica)p FI(.)d(F)l(or)e(instance,)e(to)i (mark)e(tic)o(ks)g(with)h(the)g(L)1074 1204 y FC(a)1098 1210 y FI(T)1125 1225 y(E)1152 1210 y(X)g(greek)g(letter)f(`)p Fq(\031)r FI(',)f(w)o(e)i(ma)o(y)f(use)37 1312 y Fy(Show[g,)24 b(Ticks)f(->)i({{0,)f({Pi/2,)g("\\\\pi\\\\ove)o(r2)o("},)e({Pi,)i ("\\\\pi"},)473 1372 y({3Pi/2,)f("3{\\\\Pi\\\\ov)o(er2)o(}")o(},)f ({2Pi,)i("2\\\\pi"},)e(Automatic}])34 1474 y FI(Note,)15 b(to)g(obtain)h(the)g(bac)o(kslash)f(`)p Fy(\\)p FI(')f(from)h(within)g FD(Mathematica)f FI(it)h(m)o(ust)f(b)q(e)h(doubled.)21 b(So)16 b(ev)o(ery)-39 1534 y(L)-27 1528 y FC(a)-3 1534 y FI(T)24 1549 y(E)51 1534 y(X)g(con)o(trol)g(sequence)f(sp)q (eci\014ed)h(in)o(to)f(a)i FD(Mathematica)e FI(string)h(m)o(ust)f(b)q (e)h(preceded)g(b)o(y)f(a)i(`)p Fy(\\\\)p FI('.)34 1594 y(F)l(or)f(example)e(to)j(place)e(the)h(form)o(ula)807 1723 y Fq(f)5 b FI(\()p Fq(x)p FI(\))14 b(=)g(sin)1042 1690 y(1)p 1041 1712 28 2 v 1041 1758 a Fq(x)-39 1849 y FI(at)19 b(the)g(p)q(oin)o(t)g(\(0)p Fq(:)p FI(5)p Fq(;)8 b FI(0)p Fq(:)p FI(5\))20 b(of)f(a)h(graphic,)f(left)f(and)i(b)q (ottom)f(aligned,)g(w)o(e)g(ma)o(y)e(use)j(the)e FD(Mathematica)-39 1909 y FI(command)166 2011 y Fy(Text["f\(x)o(\)=\\)o(\\s)o(in\\)o(\\fr) o(ac{)o(1})o({x})o(",)k({0.5,0.5},)g({-1,-1}])-39 2177 y FB(9)79 b(Manual)26 b(adjustment)f(of)i(lab)r(els)-39 2287 y FI(Sometime)o(s)12 b(ma)o(y)h(happ)q(ens)j(to)f(ha)o(v)o(e)f(t)o (w)o(o)h(or)g(more)e(lab)q(els)i(to)q(o)h(m)o(uc)o(h)c(closed)j(eac)o (h)f(other.)21 b(In)14 b(this)h(case)-39 2347 y(a)k(man)o(ual)e (adjustmen)o(t)g(is)i(needed.)27 b(T)l(o)20 b(do)f(this,)f(edit)g(the)h (\014le)f(generated)g(b)o(y)g FE(mma2ltx)i FI(ha)o(ving)e(the)-39 2407 y(extension)d(`)p Fy(.tex)p FI('.)k(F)l(or)d(instance,)g(let's)f (analyze)h(the)g(\014le)g(`)p Fy(mypic.te)o(x)p FI(')o(:)-39 2509 y Fy(\045)25 b(Picture:)e(mypic.eps)-39 2569 y(\045)i(Created)e (by)i(mma2ltx)e(v1.2)h(-)h(Copyright)e(\(C\))h(1994)g(Giuseppe)f (Ghib\\`o)-39 2629 y(\045)i(Command)e(line)h(:)h(mma2ltx)e(-ucm)i (-w10cm)e(-sfootnote)o(siz)o(e)f(mypic.ps)-39 2689 y(\045)j(Creation)e (date:)g(Sat)i(Jul)f(16)h(10:40:43)e(1994)-39 2749 y(\\mmaheade)o(rpr)o (ot)o(rue)-39 2810 y({\045)928 2914 y FI(8)p eop %%Page: 9 10 9 9 bop -39 166 a Fy(\\footnote)o(siz)o(e\045)-39 226 y(\\mmasetpi)o(c\(1)o(0.)o(000)o(0,6)o(.1)o(803)o(\)[c)o(m]{)o(my)o (pic)o(.ep)o(s})-39 286 y(\\mmatextf)o(its)o(\(2)o(.15)o(2,3)o(.0)o (90\))o(\(0,)o(2\){)o($0)o(.2$)o(})-39 347 y(\\mmatextf)o(its)o(\(4)o (.05)o(1,3)o(.0)o(90\))o(\(0,)o(2\){)o($0)o(.4$)o(})-39 407 y(\\mmatextf)o(its)o(\(5)o(.94)o(9,3)o(.0)o(90\))o(\(0,)o(2\){)o ($0)o(.6$)o(})-39 467 y(\\mmatextf)o(its)o(\(7)o(.84)o(8,3)o(.0)o(90\)) o(\(0,)o(2\){)o($0)o(.8$)o(})-39 527 y(\\mmatextf)o(its)o(\(9)o(.74)o (7,3)o(.0)o(90\))o(\(0,)o(2\){)o($1)o($})-39 587 y(\\mmatextf)o(its)o (\(0)o(.12)o(9,0)o(.1)o(57\))o(\(1,)o(0\){)o($-)o(1$})-39 648 y(\\mmatextf)o(its)o(\(0)o(.12)o(9,1)o(.6)o(23\))o(\(1,)o(0\){)o ($-)o(0.5)o($})-39 708 y(\\mmatextf)o(its)o(\(0)o(.12)o(9,4)o(.5)o (57\))o(\(1,)o(0\){)o($0)o(.5$)o(})-39 768 y(\\mmatextf)o(its)o(\(0)o (.12)o(9,6)o(.0)o(24\))o(\(1,)o(0\){)o($1)o($})-39 828 y(\\mmatextf)o(its)o(\(5)o(.00)o(0,4)o(.5)o(57\))o(\(-1)o(,-1)o(\){)o ($f\()o(x\)=)22 b(\\sin)i(\\frac{1}{x)o(}$})-39 888 y(\\begin{mm)o(api) o(ct)o(ure)o(})-39 949 y(\\mmaputte)o(xt\()o(2.)o(152)o(,3.)o(09)o (0\)\()o(0,2)o(\){$)o(0.)o(2$})-39 1009 y(\\mmaputte)o(xt\()o(4.)o(051) o(,3.)o(09)o(0\)\()o(0,2)o(\){$)o(0.)o(4$})-39 1069 y(\\mmaputte)o (xt\()o(5.)o(949)o(,3.)o(09)o(0\)\()o(0,2)o(\){$)o(0.)o(6$})-39 1129 y(\\mmaputte)o(xt\()o(7.)o(848)o(,3.)o(09)o(0\)\()o(0,2)o(\){$)o (0.)o(8$})-39 1189 y(\\mmaputte)o(xt\()o(9.)o(747)o(,3.)o(09)o(0\)\()o (0,2)o(\){$)o(1$)o(})-39 1249 y(\\mmaputte)o(xt\()o(0.)o(129)o(,0.)o (15)o(7\)\()o(1,0)o(\){$)o(-1)o($})-39 1310 y(\\mmaputte)o(xt\()o(0.)o (129)o(,1.)o(62)o(3\)\()o(1,0)o(\){$)o(-0)o(.5$)o(})-39 1370 y(\\mmaputte)o(xt\()o(0.)o(129)o(,4.)o(55)o(7\)\()o(1,0)o(\){$)o (0.)o(5$})-39 1430 y(\\mmaputte)o(xt\()o(0.)o(129)o(,6.)o(02)o(4\)\()o (1,0)o(\){$)o(1$)o(})-39 1490 y(\\mmaputte)o(xt\()o(5.)o(000)o(,4.)o (55)o(7\)\()o(-1,)o(-1\))o({$)o(f\(x)o(\)=)e(\\sin)i(\\frac{1}{x})o($}) -39 1550 y(\\end{mmap)o(ict)o(ur)o(e}\045)-39 1611 y(}\045)-39 1707 y FI(W)l(e)h(ma)o(y)f(observ)o(e)h(that)g(ev)o(ery)f(lab)q(el)i (app)q(ears)g(t)o(wice)e(in)i(the)f Fy(.tex)f FI(\014le:)39 b(within)25 b(the)g(command)-39 1767 y Fy(\\mmatextf)o(its)7 b FI(and)k(in)g(the)f(command)f Fy(\\mmaputtext)e FI(\(and)k(sometimes) d(in)j(the)f(command)f Fy(\\mmaputtex)o(t*)p FI(\).)-39 1827 y(These)16 b(commands)e(ha)o(v)o(e)i(the)g(follo)o(wing)g(syn)o (tax:)429 1924 y Fy(\\mmatextfi)o(ts\()o Fq(x;)8 b(y)q Fy(\)\()p Fq(s)915 1931 y Fm(x)934 1924 y Fq(;)g(s)979 1931 y Fm(y)999 1924 y Fy(\))p FI([)p Fy(\()p FE(o\013)1120 1931 y Fb(x)1141 1924 y Fq(;)g FE(o\013)1218 1931 y Fb(y)1240 1924 y Fy(\))p FI(])p Fy({)p FE(obje)n(ct)p Fy(})429 1984 y(\\mmaputtex)o(t)23 b(\()p Fq(x;)8 b(y)r Fy(\)\()p Fq(s)914 1991 y Fm(x)934 1984 y Fq(;)g(s)979 1991 y Fm(y)999 1984 y Fy(\))p FI([)p Fy(\()p FE(o\013)1120 1991 y Fb(x)1141 1984 y Fq(;)g FE(o\013)1218 1991 y Fb(y)1240 1984 y Fy(\))p FI(])p Fy({)p FE(obje)n(ct)p Fy(})429 2044 y(\\mmaputtex)o(t*\()o Fq(x;)g(y)q Fy(\)\()p Fq(s)915 2051 y Fm(x)934 2044 y Fq(;)g(s)979 2051 y Fm(y)999 2044 y Fy(\))p FI([)p Fy(\()p FE(o\013)1120 2051 y Fb(x)1141 2044 y Fq(;)g FE(o\013)1218 2051 y Fb(y)1240 2044 y Fy(\))p FI(])p Fy({)p FE(obje)n(ct)p Fy(})-39 2140 y FI(where)17 b(\()p Fq(x;)8 b(y)r FI(\))17 b(are)h(the)g(co)q(ordinates)h(of)f(the)g(reference)e(p)q(oin)o(t.)27 b(\()p Fq(s)1207 2147 y Fm(x)1229 2140 y Fq(;)8 b(s)1274 2147 y Fm(y)1295 2140 y FI(\))18 b(are)g(the)f(b)q(ounding)j(b)q(o)o(x) e(co)q(or-)-39 2200 y(dinates)g(as)h(explained)e(at)i Fx(x)p FI(6.11.)29 b(\()p FE(o\013)700 2207 y Fb(x)722 2200 y Fq(;)8 b FE(o\013)799 2207 y Fb(y)821 2200 y FI(\))19 b(is)f(an)h(optional)g(argumen)o(t)e(and)i(represen)o(ts)f(the)g (o\013set)-39 2261 y(in)i(the)h Fq(x)g FI(and)h Fq(y)h FI(direction)d(from)g(the)h(reference)e(p)q(oin)o(t)j(\()p Fq(x;)8 b(y)r FI(\).)35 b Fx(f)p FE(obje)n(ct)5 b Fx(g)21 b FI(ma)o(y)f(b)q(e)h(an)o(y)g(L)1716 2255 y FC(a)1740 2261 y FI(T)1767 2276 y(E)1794 2261 y(X)g(ob-)-39 2321 y(ject)i(\(ev)o(en)g(another)h FE(mma2ltx)h FI(picture\).)44 b(The)24 b(unit)g(of)g(measure)f(is)h(the)f(one)i(whic)o(h)e(app)q (ears)i(in)-39 2381 y(`)p Fy(\\mmasetp)o(ic)o FI(')11 b(command)i(\(in)h(this)g(case)g Fy(cm)p FI(\).)20 b(The)14 b(command)f(`)p Fy(\\mmaputt)o(ext)o(*)p FI(')e(has)k(the)f(same)f (e\013ect)-39 2441 y(of)k(`)p Fy(\\mmaputtex)o(t)p FI(')o(,)e(except)h (it)h(encloses)g(the)h FE(obje)n(ct)g FI(in)f(a)h(white)f(b)q(o)o(x)h (\(see)f(the)g(lab)q(el)g(\\some)g(text")g(in)-39 2501 y(the)f(3D)g(graphic)h(sho)o(wn)g(in)f(Fig.)f(4\).)34 2562 y(F)l(or)d(instance)g(supp)q(ose)i(w)o(e)e(w)o(an)o(t)h(to)f(mo)o (v)o(e)f(righ)o(t)h(the)g(lab)q(el)g(`0)p Fq(:)p FI(2')g(b)o(y)g(0)p Fq(:)p FI(5)c(cm)o(,)k(then)h(w)o(e)f(m)o(ust)f(replace)-39 2622 y(the)16 b(line)166 2718 y Fy(\\mmatextf)o(its)o(\(2)o(.15)o(2,3)o (.09)o(0\))o(\(0,)o(2\){)o($0.)o(2$)o(})-39 2814 y FI(with)g(the)g (line)928 2914 y(9)p eop %%Page: 10 11 10 10 bop 166 166 a Fy(\\mmatextf)o(its)o(\(2)o(.15)o(2,3)o(.09)o(0\))o (\(0,)o(2\)\()o(0.5)o(,0)o(\){$)o(0.2)o($})-39 268 y FI(and)16 b(the)g(line)166 369 y Fy(\\mmaputte)o(xt\()o(2.)o(152)o(,3.) o(090)o(\)\()o(0,2)o(\){$)o(0.2)o($})-39 471 y FI(with)g(the)g(line)166 573 y Fy(\\mmaputte)o(xt\()o(2.)o(152)o(,3.)o(090)o(\)\()o(0,2)o(\)\(0) o(.5,)o(0\))o({$0)o(.2$)o(})-39 675 y FI(Note)f(that)i(this)f(approac)o (h)h(is)e(similar)f(to)j(the)f(one)g(explained)f(at)i Fx(x)p FI(6.11,)f(with)g(the)g(exception)f(that)h(w)o(e)-39 735 y(ma)o(y)e(con)o(trol)i(ev)o(ery)f(lab)q(el,)g(rather)i(than)f(a)h (group)g(of)g(lab)q(els.)34 795 y(No)o(w)i(supp)q(ose)i(w)o(e)f(w)o(an) o(t)g(to)g(replace)f(the)h(lab)q(el)f(`0)p Fq(:)p FI(8')g(placed)h (under)g(the)f Fq(x)p FI(-axis)h(with)g(the)f(lab)q(el)-39 855 y(`)p Fq(x)3 862 y FA(1)22 855 y FI(')e(to)h(place)f(o)o(v)o(er)g (the)g Fq(x)p FI(-axis)h(with)g(the)f(lo)o(w)h(edge)f(of)h(the)g(\(in)o (visible\))d(b)q(o)o(x)j(that)h(b)q(ounds)g(this)e(lab)q(el)-39 915 y(at)f(0)p Fq(:)p FI(2)8 b(cm)15 b(from)h(the)g Fq(x)p FI(-axis.)21 b(In)16 b(this)g(case)g(w)o(e)g(m)o(ust)f(replace)g(the)h (lines)166 1017 y Fy(\\mmatextf)o(its)o(\(7)o(.84)o(8,3)o(.09)o(0\))o (\(0,)o(2\){)o($0.)o(8$)o(})166 1077 y(.)166 1137 y(.)166 1198 y(.)166 1258 y(\\mmaputte)o(xt\()o(7.)o(848)o(,3.)o(090)o(\)\()o (0,2)o(\){$)o(0.8)o($})-39 1359 y FI(with)g(the)g(lines)166 1461 y Fy(\\mmatextf)o(its)o(\(7)o(.84)o(8,3)o(.09)o(0\))o(\(0,)o(-1\)) o(\(0,)o(0.)o(2\){)o($x_)o(1$)o(})166 1521 y(.)166 1582 y(.)166 1642 y(.)166 1702 y(\\mmaputte)o(xt\()o(7.)o(848)o(,3.)o(090)o (\)\()o(0,-)o(1\)\()o(0,0)o(.2)o(\){$)o(x_1)o($})-39 1804 y FI(The)g(result)g(is)g(sho)o(wn)h(in)e(Fig.)h(4.)385 2601 y @beginspecial 283.463745 @hsize 175.189026 @vsize @setspecial %%BeginDocument: 12mag.eps %MMA2LTXCommandLine: mma2ltx -ucm -sfootnotesize -p -w10cm 12mag.ps % Mathematica v2.2 prologue /Mathdict 150 dict def Mathdict begin /Mwidth 283.46 def /Mheight 175.19 def /Mnodistort true def /Mlmarg 0 def /Mrmarg 0 def /Mbmarg 0 def /Mtmarg 0 def /Mtransform{} bind def /Mfixwid true def /Mfixdash false def /Mrot 0 def /Mpstart{ MathPictureStart}bind def /Mpend{MathPictureEnd}bind def /Mscale{0 1 0 1 5 -1 roll MathScale}bind def /ISOLatin1Encoding dup where{pop pop}{[ /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /space /exclam /quotedbl /numbersign /dollar /percent /ampersand /quoteright /parenleft /parenright /asterisk /plus /comma /minus /period /slash /zero /one /two /three /four /five /six /seven /eight /nine /colon /semicolon /less /equal /greater /question /at /A /B /C /D /E /F /G /H /I /J /K /L /M /N /O /P /Q /R /S /T /U /V /W /X /Y /Z /bracketleft /backslash /bracketright /asciicircum /underscore /quoteleft /a /b /c /d /e /f /g /h /i /j /k /l /m /n /o /p /q /r /s /t /u /v /w /x /y /z /braceleft /bar /braceright /asciitilde /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /dotlessi /grave /acute /circumflex /tilde /macron /breve /dotaccent /dieresis /.notdef /ring /cedilla /.notdef /hungarumlaut /ogonek /caron /space /exclamdown /cent /sterling /currency /yen /brokenbar /section /dieresis /copyright /ordfeminine /guillemotleft /logicalnot /hyphen /registered /macron /degree /plusminus /twosuperior /threesuperior /acute /mu /paragraph /periodcentered /cedilla /onesuperior /ordmasculine /guillemotright /onequarter /onehalf /threequarters /questiondown /Agrave /Aacute /Acircumflex /Atilde /Adieresis /Aring /AE /Ccedilla /Egrave /Eacute /Ecircumflex /Edieresis /Igrave /Iacute /Icircumflex /Idieresis /Eth /Ntilde /Ograve /Oacute /Ocircumflex /Otilde /Odieresis /multiply /Oslash /Ugrave /Uacute /Ucircumflex /Udieresis /Yacute /Thorn /germandbls /agrave /aacute /acircumflex /atilde /adieresis /aring /ae /ccedilla /egrave /eacute /ecircumflex /edieresis /igrave /iacute /icircumflex /idieresis /eth /ntilde /ograve /oacute /ocircumflex /otilde /odieresis /divide /oslash /ugrave /uacute /ucircumflex /udieresis /yacute /thorn /ydieresis]def}ifelse /MFontDict 50 dict def /MStrCat{exch dup length 2 index length add string dup 3 1 roll copy length exch dup 4 2 roll exch putinterval}def /MCreateEncoding{1 index 255 string cvs(-)MStrCat 1 index MStrCat cvn exch(Encoding)MStrCat cvn dup where{exch get}{pop StandardEncoding}ifelse 3 1 roll dup MFontDict exch known not{1 index findfont dup length dict begin{1 index /FID ne{ def}{pop pop}ifelse}forall /Encoding 3 index def currentdict end 1 index exch definefont pop MFontDict 1 index null put}if exch pop exch pop}def /ISOLatin1{(ISOLatin1)MCreateEncoding}def /ISO8859{(ISOLatin1) MCreateEncoding}def /Mcopyfont{dup maxlength dict exch{1 index /FID eq{ pop pop}{2 index 3 1 roll put}ifelse}forall}def /Plain /Courier findfont Mcopyfont definefont pop /Bold /Courier findfont Mcopyfont definefont pop /Italic /Courier findfont Mcopyfont definefont pop /MathPictureStart{gsave Mtransform Mlmarg Mbmarg translate Mwidth Mlmarg Mrmarg add sub /Mwidth exch def Mheight Mbmarg Mtmarg add sub /Mheight exch def /Mtmatrix matrix currentmatrix def /Mgmatrix matrix currentmatrix def}bind def /MathPictureEnd{grestore}bind def /MFill{0 0 moveto Mwidth 0 lineto Mwidth Mheight lineto 0 Mheight lineto fill}bind def /MPlotRegion{3 index Mwidth mul 2 index Mheight mul translate exch sub Mheight mul /Mheight exch def exch sub Mwidth mul /Mwidth exch def} bind def /MathSubStart{Momatrix Mgmatrix Mtmatrix Mwidth Mheight 7 -2 roll moveto Mtmatrix setmatrix currentpoint Mgmatrix setmatrix 9 -2 roll moveto Mtmatrix setmatrix currentpoint 2 copy translate /Mtmatrix matrix currentmatrix def 3 -1 roll exch sub /Mheight exch def sub /Mwidth exch def}bind def /MathSubEnd{/Mheight exch def /Mwidth exch def /Mtmatrix exch def dup setmatrix /Mgmatrix exch def /Momatrix exch def}bind def /Mdot{moveto 0 0 rlineto stroke}bind def /Mtetra{moveto lineto lineto lineto fill}bind def /Metetra{moveto lineto lineto lineto closepath gsave fill grestore 0 setgray stroke}bind def /Mistroke{flattenpath 0 0 0{4 2 roll pop pop}{4 -1 roll 2 index sub dup mul 4 -1 roll 2 index sub dup mul add sqrt 4 -1 roll add 3 1 roll}{stop}{stop}pathforall pop pop currentpoint stroke moveto currentdash 3 -1 roll add setdash}bind def /Mfstroke{stroke currentdash pop 0 setdash}bind def /Mrotsboxa{gsave dup /Mrot exch def Mrotcheck Mtmatrix dup setmatrix 7 1 roll 4 index 4 index translate rotate 3 index -1 mul 3 index -1 mul translate /Mtmatrix matrix currentmatrix def grestore Msboxa 3 -1 roll /Mtmatrix exch def /Mrot 0 def}bind def /Msboxa{newpath 5 -1 roll Mvboxa pop Mboxout 6 -1 roll 5 -1 roll 4 -1 roll Msboxa1 5 -3 roll Msboxa1 Mboxrot[7 -2 roll 2 copy[3 1 roll 10 -1 roll 9 -1 roll]6 1 roll 5 -2 roll]}bind def /Msboxa1 {sub 2 div dup 2 index 1 add mul 3 -1 roll -1 add 3 -1 roll mul}bind def /Mvboxa{Mfixwid{Mvboxa1}{dup Mwidthcal 0 exch{add}forall exch Mvboxa1 4 index 7 -1 roll add 4 -1 roll pop 3 1 roll}ifelse}bind def /Mvboxa1{ gsave newpath[true 3 -1 roll{Mbbox 5 -1 roll{0 5 1 roll}{7 -1 roll exch sub(m)stringwidth pop .3 mul sub 7 1 roll 6 -1 roll 4 -1 roll Mmin 3 -1 roll 5 index add 5 -1 roll 4 -1 roll Mmax 4 -1 roll}ifelse false}forall{ stop}if counttomark 1 add 4 roll]grestore}bind def /Mbbox{1 dict begin 0 0 moveto /temp(T)def{gsave currentpoint newpath moveto temp 0 3 -1 roll put temp false charpath flattenpath currentpoint pathbbox grestore moveto lineto moveto}forall pathbbox newpath end}bind def /Mmin{2 copy gt{exch}if pop}bind def /Mmax{2 copy lt{exch}if pop}bind def /Mrotshowa{ dup /Mrot exch def Mrotcheck Mtmatrix dup setmatrix 7 1 roll 4 index 4 index translate rotate 3 index -1 mul 3 index -1 mul translate /Mtmatrix matrix currentmatrix def Mgmatrix setmatrix Mshowa /Mtmatrix exch def /Mrot 0 def}bind def /Mshowa{4 -2 roll moveto 2 index Mtmatrix setmatrix Mvboxa 7 1 roll Mboxout 6 -1 roll 5 -1 roll 4 -1 roll Mshowa1 4 1 roll Mshowa1 rmoveto currentpoint Mfixwid{Mshowax}{Mshoway}ifelse pop pop pop pop Mgmatrix setmatrix}bind def /Mshowax{0 1 4 index length -1 add{2 index 4 index 2 index get 3 index add moveto 4 index exch get Mfixdash{ Mfixdashp}if show}for}bind def /Mfixdashp{dup length 1 gt 1 index true exch{45 eq and}forall and{gsave(--)stringwidth pop(-)stringwidth pop sub 2 div 0 rmoveto dup length 1 sub{(-)show}repeat grestore}if}bind def /Mshoway{3 index Mwidthcal 5 1 roll 0 1 4 index length -1 add{2 index 4 index 2 index get 3 index add moveto 4 index exch get[6 index aload length 2 add -1 roll{pop Strform stringwidth pop neg exch add 0 rmoveto} exch kshow cleartomark}for pop}bind def /Mwidthcal{[exch{Mwidthcal1} forall][exch dup Maxlen -1 add 0 1 3 -1 roll{[exch 2 index{1 index Mget exch}forall pop Maxget exch}for pop]Mreva}bind def /Mreva{[exch aload length -1 1{1 roll}for]}bind def /Mget{1 index length -1 add 1 index ge{ get}{pop pop 0}ifelse}bind def /Maxlen{[exch{length}forall Maxget}bind def /Maxget{counttomark -1 add 1 1 3 -1 roll{pop Mmax}for exch pop}bind def /Mwidthcal1{[exch{Strform stringwidth pop}forall]}bind def /Strform{ /tem(x)def tem 0 3 -1 roll put tem}bind def /Mshowa1{2 copy add 4 1 roll sub mul sub -2 div}bind def /MathScale{Mwidth Mheight Mlp translate scale /yscale exch def /ybias exch def /xscale exch def /xbias exch def /Momatrix xscale yscale matrix scale xbias ybias matrix translate matrix concatmatrix def /Mgmatrix matrix currentmatrix def}bind def /Mlp{3 copy Mlpfirst{Mnodistort{Mmin dup}if 4 index 2 index 2 index Mlprun 11 index 11 -1 roll 10 -4 roll Mlp1 8 index 9 -5 roll Mlp1 4 -1 roll and{exit}if 3 -1 roll pop pop}loop exch 3 1 roll 7 -3 roll pop pop pop}bind def /Mlpfirst{3 -1 roll dup length 2 copy -2 add get aload pop pop pop 4 -2 roll -1 add get aload pop pop pop 6 -1 roll 3 -1 roll 5 -1 roll sub div 4 1 roll exch sub div}bind def /Mlprun{2 copy 4 index 0 get dup 4 1 roll Mlprun1 3 copy 8 -2 roll 9 -1 roll{3 copy Mlprun1 3 copy 11 -3 roll /gt Mlpminmax 8 3 roll 11 -3 roll /lt Mlpminmax 8 3 roll}forall pop pop pop pop 3 1 roll pop pop aload pop 5 -1 roll aload pop exch 6 -1 roll Mlprun2 8 2 roll 4 -1 roll Mlprun2 6 2 roll 3 -1 roll Mlprun2 4 2 roll exch Mlprun2 6 2 roll}bind def /Mlprun1{aload pop exch 6 -1 roll 5 -1 roll mul add 4 -2 roll mul 3 -1 roll add}bind def /Mlprun2{2 copy add 2 div 3 1 roll exch sub}bind def /Mlpminmax{cvx 2 index 6 index 2 index exec{7 -3 roll 4 -1 roll}if 1 index 5 index 3 -1 roll exec{4 1 roll pop 5 -1 roll aload pop pop 4 -1 roll aload pop[8 -2 roll pop 5 -2 roll pop 6 -2 roll pop 5 -1 roll]4 1 roll pop}{pop pop pop}ifelse}bind def /Mlp1{ 5 index 3 index sub 5 index 2 index mul 1 index le 1 index 0 le or dup not{1 index 3 index div .99999 mul 8 -1 roll pop 7 1 roll}if 8 -1 roll 2 div 7 -2 roll pop sub 5 index 6 -3 roll pop pop mul sub exch}bind def /intop 0 def /inrht 0 def /inflag 0 def /outflag 0 def /xadrht 0 def /xadlft 0 def /yadtop 0 def /yadbot 0 def /Minner{outflag 1 eq{/outflag 0 def /intop 0 def /inrht 0 def}if 5 index gsave Mtmatrix setmatrix Mvboxa pop grestore 3 -1 roll pop dup intop gt{/intop exch def}{pop} ifelse dup inrht gt{/inrht exch def}{pop}ifelse pop /inflag 1 def}bind def /Mouter{/xadrht 0 def /xadlft 0 def /yadtop 0 def /yadbot 0 def inflag 1 eq{dup 0 lt{dup intop mul neg /yadtop exch def}if dup 0 gt{dup intop mul /yadbot exch def}if pop dup 0 lt{dup inrht mul neg /xadrht exch def}if dup 0 gt{dup inrht mul /xadlft exch def}if pop /outflag 1 def}{pop pop}ifelse /inflag 0 def /inrht 0 def /intop 0 def}bind def /Mboxout{outflag 1 eq{4 -1 roll xadlft leadjust add sub 4 1 roll 3 -1 roll yadbot leadjust add sub 3 1 roll exch xadrht leadjust add add exch yadtop leadjust add add /outflag 0 def /xadlft 0 def /yadbot 0 def /xadrht 0 def /yadtop 0 def}if}bind def /leadjust{(m)stringwidth pop .5 mul}bind def /Mrotcheck{dup 90 eq{yadbot /yadbot xadrht def /xadrht yadtop def /yadtop xadlft def /xadlft exch def}if dup cos 1 index sin Checkaux dup cos 1 index sin neg exch Checkaux 3 1 roll pop pop}bind def /Checkaux{4 index exch 4 index mul 3 1 roll mul add 4 1 roll}bind def /Mboxrot{Mrot 90 eq{brotaux 4 2 roll}if Mrot 180 eq{4 2 roll brotaux 4 2 roll brotaux}if Mrot 270 eq{4 2 roll brotaux}if}bind def /brotaux{neg exch neg}bind def /Mabsproc{0 matrix defaultmatrix dtransform idtransform dup mul exch dup mul add sqrt}bind def /Mabswid{Mabsproc setlinewidth}bind def /Mabsdash{exch[exch{Mabsproc}forall]exch setdash} bind def /MBeginOrig{Momatrix concat}bind def /MEndOrig{Mgmatrix setmatrix}bind def /sampledsound where{pop}{/sampledsound{exch pop exch 5 1 roll mul 4 idiv mul 2 idiv exch pop exch /Mtempproc exch def{ Mtempproc pop}repeat}bind def}ifelse /g{setgray}bind def /k{ setcmykcolor}bind def /m{moveto}bind def /p{gsave}bind def /r{ setrgbcolor}bind def /w{setlinewidth}bind def /C{curveto}bind def /F{ fill}bind def /L{lineto}bind def /P{grestore}bind def /s{stroke}bind def /setcmykcolor where{pop}{/setcmykcolor{4 1 roll[4 1 roll]{1 index sub 1 sub neg dup 0 lt{pop 0}if dup 1 gt{pop 1}if exch}forall pop setrgbcolor} bind def}ifelse /Mcharproc{currentfile(x)readhexstring pop 0 get exch div}bind def /Mshadeproc{dup 3 1 roll{dup Mcharproc 3 1 roll}repeat 1 eq {setgray}{3 eq{setrgbcolor}{setcmykcolor}ifelse}ifelse}bind def /Mrectproc{3 index 2 index moveto 2 index 3 -1 roll lineto dup 3 1 roll lineto lineto fill}bind def /Mcolorimage{7 1 roll pop pop matrix invertmatrix concat 2 exch exp 1 sub 3 1 roll 1 1 2 index{1 1 4 index{ dup 1 sub exch 2 index dup 1 sub exch 7 index 9 index Mshadeproc Mrectproc}for pop}for pop pop pop pop}bind def /Mimage{pop matrix invertmatrix concat 2 exch exp 1 sub 3 1 roll 1 1 2 index{1 1 4 index{ dup 1 sub exch 2 index dup 1 sub exch 7 index Mcharproc setgray Mrectproc}for pop}for pop pop pop}bind def %MMA2LTXComment: Here follow the original Mathematica file stripped of the text strings MathPictureStart /Courier findfont 10 scalefont setfont % Scaling calculations 0.0238095 0.952381 0.309017 0.294302 [ [ -0.001 -0.001 0 0 ] [ 1.001 .61903 0 0 ] ] MathScale % Start of Graphics 1 setlinecap 1 setlinejoin newpath [ ] 0 setdash 0 g p p .002 w .21429 .30902 m .21429 .31527 L s P p .002 w .40476 .30902 m .40476 .31527 L s P p .002 w .59524 .30902 m .59524 .31527 L s P p .002 w .78571 .30902 m .78571 .31527 L s P p .002 w .97619 .30902 m .97619 .31527 L s P p .001 w .0619 .30902 m .0619 .31277 L s P p .001 w .1 .30902 m .1 .31277 L s P p .001 w .1381 .30902 m .1381 .31277 L s P p .001 w .17619 .30902 m .17619 .31277 L s P p .001 w .25238 .30902 m .25238 .31277 L s P p .001 w .29048 .30902 m .29048 .31277 L s P p .001 w .32857 .30902 m .32857 .31277 L s P p .001 w .36667 .30902 m .36667 .31277 L s P p .001 w .44286 .30902 m .44286 .31277 L s P p .001 w .48095 .30902 m .48095 .31277 L s P p .001 w .51905 .30902 m .51905 .31277 L s P p .001 w .55714 .30902 m .55714 .31277 L s P p .001 w .63333 .30902 m .63333 .31277 L s P p .001 w .67143 .30902 m .67143 .31277 L s P p .001 w .70952 .30902 m .70952 .31277 L s P p .001 w .74762 .30902 m .74762 .31277 L s P p .001 w .82381 .30902 m .82381 .31277 L s P p .001 w .8619 .30902 m .8619 .31277 L s P p .001 w .9 .30902 m .9 .31277 L s P p .001 w .9381 .30902 m .9381 .31277 L s P p .002 w 0 .30902 m 1 .30902 L s P p .002 w .02381 .01472 m .03006 .01472 L s P p .002 w .02381 .16187 m .03006 .16187 L s P p .002 w .02381 .45617 m .03006 .45617 L s P p .002 w .02381 .60332 m .03006 .60332 L s P p .001 w .02381 .04415 m .02756 .04415 L s P p .001 w .02381 .07358 m .02756 .07358 L s P p .001 w .02381 .10301 m .02756 .10301 L s P p .001 w .02381 .13244 m .02756 .13244 L s P p .001 w .02381 .1913 m .02756 .1913 L s P p .001 w .02381 .22073 m .02756 .22073 L s P p .001 w .02381 .25016 m .02756 .25016 L s P p .001 w .02381 .27959 m .02756 .27959 L s P p .001 w .02381 .33845 m .02756 .33845 L s P p .001 w .02381 .36788 m .02756 .36788 L s P p .001 w .02381 .39731 m .02756 .39731 L s P p .001 w .02381 .42674 m .02756 .42674 L s P p .001 w .02381 .4856 m .02756 .4856 L s P p .001 w .02381 .51503 m .02756 .51503 L s P p .001 w .02381 .54446 m .02756 .54446 L s P p .001 w .02381 .57389 m .02756 .57389 L s P p .002 w .02381 0 m .02381 .61803 L s P P 0 0 m 1 0 L 1 .61803 L 0 .61803 L closepath clip newpath p p p .004 w .02505 .60122 m .02629 .50433 L .02753 .01495 L .02877 .20456 L .03001 .40662 L .03125 .52122 L .03249 .37939 L .03373 .59849 L .03497 .16526 L .03621 .59913 L .03745 .49932 L .03869 .57978 L .03993 .47842 L .04117 .01686 L .04241 .54573 L .04365 .08292 L .04489 .58269 L .04613 .02424 L .04737 .42893 L .04861 .49881 L .04985 .04314 L .05109 .20767 L .05233 .57956 L .05357 .4713 L .05481 .12034 L .05605 .02845 L .05729 .25919 L .05853 .5293 L .05977 .59618 L .06101 .44158 L .06225 .20574 L .06349 .0425 L .06473 .02694 L .06597 .14355 L .06721 .32322 L .06845 .48895 L .07341 .41006 L .07465 .27441 L .07589 .15173 L .07713 .06312 L .07837 .01925 L .07961 .02131 L .08085 .06335 L .08209 .13505 L .08333 .22429 L .08581 .40937 L .08705 .48692 L .08829 .54646 L .08953 .58513 L .09077 .60225 L Mistroke .09201 .5989 L .09325 .57739 L .09449 .54088 L .09573 .49293 L .09821 .37715 L .10069 .25654 L .10317 .1511 L .10441 .1082 L .10565 .0731 L .10689 .04624 L .10813 .02773 L .10938 .01739 L .11062 .0148 L .11186 .0194 L .1131 .03049 L .11558 .06901 L .11682 .0948 L .11806 .12385 L .12302 .25771 L .12798 .39089 L .13046 .4487 L .13294 .49805 L .13542 .53798 L .1379 .56815 L .13914 .57962 L .14038 .58873 L .14162 .59555 L .14286 .60019 L .1441 .60272 L .14534 .60328 L .14658 .60195 L .14782 .59888 L .14906 .59417 L .1503 .58795 L .15278 .57149 L .15774 .52578 L .1627 .46881 L .17262 .34332 L .18254 .22678 L .19246 .13418 L .19742 .09842 L .20238 .06965 L .20734 .04754 L .20982 .03883 L .2123 .03159 L .21478 .02574 L .21726 .02122 L .2185 .01943 L .21974 .01795 L .22098 .01675 L Mistroke .22222 .01584 L .22346 .01521 L .2247 .01483 L .22594 .01472 L .22718 .01484 L .22842 .01521 L .22966 .0158 L .2309 .01661 L .23214 .01763 L .23462 .02028 L .2371 .02367 L .24206 .03243 L .25198 .05636 L .2619 .08629 L .30159 .22571 L .34127 .35055 L .36111 .40105 L .38095 .44359 L .40079 .47888 L .42063 .50781 L .44048 .53126 L .46032 .55007 L .48016 .56498 L .5 .57662 L .51984 .58556 L .53968 .59223 L .5496 .59485 L .55952 .59704 L .56944 .59884 L .57937 .60029 L .58929 .60143 L .59921 .60227 L .60417 .60259 L .60913 .60285 L .61409 .60305 L .61657 .60313 L .61905 .60319 L .62153 .60324 L .62277 .60326 L .62401 .60328 L .62525 .6033 L .62649 .60331 L .62773 .60331 L .62897 .60332 L .63021 .60332 L .63145 .60332 L .63269 .60331 L .63393 .6033 L .63641 .60328 L .63765 .60326 L Mistroke .63889 .60325 L .64385 .60314 L .64881 .60299 L .65873 .60258 L .66865 .60202 L .67857 .60133 L .69841 .59961 L .7381 .59506 L .77778 .5895 L .81746 .58332 L .85714 .57678 L .89683 .57008 L .93651 .56334 L .97619 .55666 L Mfstroke P P P % End of Graphics MathPictureEnd end %%EndDocument @endspecial 671 2277 a Fu(0)p Fn(:)p Fu(2)837 2213 y(0)p Fn(:)p Fu(4)1061 2277 y(0)p Fn(:)p Fu(6)1290 2207 y Fn(x)1314 2213 y Fw(1)1526 2277 y Fu(1)347 2594 y Fs(\000)p Fu(1)315 2421 y Fs(\000)p Fu(0)p Fn(:)p Fu(5)347 2077 y(0)p Fn(:)p Fu(5)379 1903 y(1)975 2035 y Fn(f)t Fu(\()p Fn(x)p Fu(\))d(=)e(sin)1176 2007 y(1)p 1174 2025 24 2 v 1174 2063 a Fn(x)1134 2601 y @beginspecial 103.637100 @hsize 85.039124 @vsize @setspecial %%BeginDocument: 12mag_3d.eps %MMA2LTXCommandLine: mma2ltx -stiny -ucm -p -h3cm 12mag_3d.ps % Mathematica v2.2 prologue /Mathdict 150 dict def Mathdict begin /Mwidth 103.64 def /Mheight 85.04 def /Mnodistort true def /Mlmarg 0 def /Mrmarg 0 def /Mbmarg 0 def /Mtmarg 0 def /Mtransform{} bind def /Mfixwid true def /Mfixdash false def /Mrot 0 def /Mpstart{ MathPictureStart}bind def /Mpend{MathPictureEnd}bind def /Mscale{0 1 0 1 5 -1 roll MathScale}bind def /ISOLatin1Encoding dup where{pop pop}{[ /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /space /exclam /quotedbl /numbersign /dollar /percent /ampersand /quoteright /parenleft /parenright /asterisk /plus /comma /minus /period /slash /zero /one /two /three /four /five /six /seven /eight /nine /colon /semicolon /less /equal /greater /question /at /A /B /C /D /E /F /G /H /I /J /K /L /M /N /O /P /Q /R /S /T /U /V /W /X /Y /Z /bracketleft /backslash /bracketright /asciicircum /underscore /quoteleft /a /b /c /d /e /f /g /h /i /j /k /l /m /n /o /p /q /r /s /t /u /v /w /x /y /z /braceleft /bar /braceright /asciitilde /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /dotlessi /grave /acute /circumflex /tilde /macron /breve /dotaccent /dieresis /.notdef /ring /cedilla /.notdef /hungarumlaut /ogonek /caron /space /exclamdown /cent /sterling /currency /yen /brokenbar /section /dieresis /copyright /ordfeminine /guillemotleft /logicalnot /hyphen /registered /macron /degree /plusminus /twosuperior /threesuperior /acute /mu /paragraph /periodcentered /cedilla /onesuperior /ordmasculine /guillemotright /onequarter /onehalf /threequarters /questiondown /Agrave /Aacute /Acircumflex /Atilde /Adieresis /Aring /AE /Ccedilla /Egrave /Eacute /Ecircumflex /Edieresis /Igrave /Iacute /Icircumflex /Idieresis /Eth /Ntilde /Ograve /Oacute /Ocircumflex /Otilde /Odieresis /multiply /Oslash /Ugrave /Uacute /Ucircumflex /Udieresis /Yacute /Thorn /germandbls /agrave /aacute /acircumflex /atilde /adieresis /aring /ae /ccedilla /egrave /eacute /ecircumflex /edieresis /igrave /iacute /icircumflex /idieresis /eth /ntilde /ograve /oacute /ocircumflex /otilde /odieresis /divide /oslash /ugrave /uacute /ucircumflex /udieresis /yacute /thorn /ydieresis]def}ifelse /MFontDict 50 dict def /MStrCat{exch dup length 2 index length add string dup 3 1 roll copy length exch dup 4 2 roll exch putinterval}def /MCreateEncoding{1 index 255 string cvs(-)MStrCat 1 index MStrCat cvn exch(Encoding)MStrCat cvn dup where{exch get}{pop StandardEncoding}ifelse 3 1 roll dup MFontDict exch known not{1 index findfont dup length dict begin{1 index /FID ne{ def}{pop pop}ifelse}forall /Encoding 3 index def currentdict end 1 index exch definefont pop MFontDict 1 index null put}if exch pop exch pop}def /ISOLatin1{(ISOLatin1)MCreateEncoding}def /ISO8859{(ISOLatin1) MCreateEncoding}def /Mcopyfont{dup maxlength dict exch{1 index /FID eq{ pop pop}{2 index 3 1 roll put}ifelse}forall}def /Plain /Courier findfont Mcopyfont definefont pop /Bold /Courier findfont Mcopyfont definefont pop /Italic /Courier findfont Mcopyfont definefont pop /MathPictureStart{gsave Mtransform Mlmarg Mbmarg translate Mwidth Mlmarg Mrmarg add sub /Mwidth exch def Mheight Mbmarg Mtmarg add sub /Mheight exch def /Mtmatrix matrix currentmatrix def /Mgmatrix matrix currentmatrix def}bind def /MathPictureEnd{grestore}bind def /MFill{0 0 moveto Mwidth 0 lineto Mwidth Mheight lineto 0 Mheight lineto fill}bind def /MPlotRegion{3 index Mwidth mul 2 index Mheight mul translate exch sub Mheight mul /Mheight exch def exch sub Mwidth mul /Mwidth exch def} bind def /MathSubStart{Momatrix Mgmatrix Mtmatrix Mwidth Mheight 7 -2 roll moveto Mtmatrix setmatrix currentpoint Mgmatrix setmatrix 9 -2 roll moveto Mtmatrix setmatrix currentpoint 2 copy translate /Mtmatrix matrix currentmatrix def 3 -1 roll exch sub /Mheight exch def sub /Mwidth exch def}bind def /MathSubEnd{/Mheight exch def /Mwidth exch def /Mtmatrix exch def dup setmatrix /Mgmatrix exch def /Momatrix exch def}bind def /Mdot{moveto 0 0 rlineto stroke}bind def /Mtetra{moveto lineto lineto lineto fill}bind def /Metetra{moveto lineto lineto lineto closepath gsave fill grestore 0 setgray stroke}bind def /Mistroke{flattenpath 0 0 0{4 2 roll pop pop}{4 -1 roll 2 index sub dup mul 4 -1 roll 2 index sub dup mul add sqrt 4 -1 roll add 3 1 roll}{stop}{stop}pathforall pop pop currentpoint stroke moveto currentdash 3 -1 roll add setdash}bind def /Mfstroke{stroke currentdash pop 0 setdash}bind def /Mrotsboxa{gsave dup /Mrot exch def Mrotcheck Mtmatrix dup setmatrix 7 1 roll 4 index 4 index translate rotate 3 index -1 mul 3 index -1 mul translate /Mtmatrix matrix currentmatrix def grestore Msboxa 3 -1 roll /Mtmatrix exch def /Mrot 0 def}bind def /Msboxa{newpath 5 -1 roll Mvboxa pop Mboxout 6 -1 roll 5 -1 roll 4 -1 roll Msboxa1 5 -3 roll Msboxa1 Mboxrot[7 -2 roll 2 copy[3 1 roll 10 -1 roll 9 -1 roll]6 1 roll 5 -2 roll]}bind def /Msboxa1 {sub 2 div dup 2 index 1 add mul 3 -1 roll -1 add 3 -1 roll mul}bind def /Mvboxa{Mfixwid{Mvboxa1}{dup Mwidthcal 0 exch{add}forall exch Mvboxa1 4 index 7 -1 roll add 4 -1 roll pop 3 1 roll}ifelse}bind def /Mvboxa1{ gsave newpath[true 3 -1 roll{Mbbox 5 -1 roll{0 5 1 roll}{7 -1 roll exch sub(m)stringwidth pop .3 mul sub 7 1 roll 6 -1 roll 4 -1 roll Mmin 3 -1 roll 5 index add 5 -1 roll 4 -1 roll Mmax 4 -1 roll}ifelse false}forall{ stop}if counttomark 1 add 4 roll]grestore}bind def /Mbbox{1 dict begin 0 0 moveto /temp(T)def{gsave currentpoint newpath moveto temp 0 3 -1 roll put temp false charpath flattenpath currentpoint pathbbox grestore moveto lineto moveto}forall pathbbox newpath end}bind def /Mmin{2 copy gt{exch}if pop}bind def /Mmax{2 copy lt{exch}if pop}bind def /Mrotshowa{ dup /Mrot exch def Mrotcheck Mtmatrix dup setmatrix 7 1 roll 4 index 4 index translate rotate 3 index -1 mul 3 index -1 mul translate /Mtmatrix matrix currentmatrix def Mgmatrix setmatrix Mshowa /Mtmatrix exch def /Mrot 0 def}bind def /Mshowa{4 -2 roll moveto 2 index Mtmatrix setmatrix Mvboxa 7 1 roll Mboxout 6 -1 roll 5 -1 roll 4 -1 roll Mshowa1 4 1 roll Mshowa1 rmoveto currentpoint Mfixwid{Mshowax}{Mshoway}ifelse pop pop pop pop Mgmatrix setmatrix}bind def /Mshowax{0 1 4 index length -1 add{2 index 4 index 2 index get 3 index add moveto 4 index exch get Mfixdash{ Mfixdashp}if show}for}bind def /Mfixdashp{dup length 1 gt 1 index true exch{45 eq and}forall and{gsave(--)stringwidth pop(-)stringwidth pop sub 2 div 0 rmoveto dup length 1 sub{(-)show}repeat grestore}if}bind def /Mshoway{3 index Mwidthcal 5 1 roll 0 1 4 index length -1 add{2 index 4 index 2 index get 3 index add moveto 4 index exch get[6 index aload length 2 add -1 roll{pop Strform stringwidth pop neg exch add 0 rmoveto} exch kshow cleartomark}for pop}bind def /Mwidthcal{[exch{Mwidthcal1} forall][exch dup Maxlen -1 add 0 1 3 -1 roll{[exch 2 index{1 index Mget exch}forall pop Maxget exch}for pop]Mreva}bind def /Mreva{[exch aload length -1 1{1 roll}for]}bind def /Mget{1 index length -1 add 1 index ge{ get}{pop pop 0}ifelse}bind def /Maxlen{[exch{length}forall Maxget}bind def /Maxget{counttomark -1 add 1 1 3 -1 roll{pop Mmax}for exch pop}bind def /Mwidthcal1{[exch{Strform stringwidth pop}forall]}bind def /Strform{ /tem(x)def tem 0 3 -1 roll put tem}bind def /Mshowa1{2 copy add 4 1 roll sub mul sub -2 div}bind def /MathScale{Mwidth Mheight Mlp translate scale /yscale exch def /ybias exch def /xscale exch def /xbias exch def /Momatrix xscale yscale matrix scale xbias ybias matrix translate matrix concatmatrix def /Mgmatrix matrix currentmatrix def}bind def /Mlp{3 copy Mlpfirst{Mnodistort{Mmin dup}if 4 index 2 index 2 index Mlprun 11 index 11 -1 roll 10 -4 roll Mlp1 8 index 9 -5 roll Mlp1 4 -1 roll and{exit}if 3 -1 roll pop pop}loop exch 3 1 roll 7 -3 roll pop pop pop}bind def /Mlpfirst{3 -1 roll dup length 2 copy -2 add get aload pop pop pop 4 -2 roll -1 add get aload pop pop pop 6 -1 roll 3 -1 roll 5 -1 roll sub div 4 1 roll exch sub div}bind def /Mlprun{2 copy 4 index 0 get dup 4 1 roll Mlprun1 3 copy 8 -2 roll 9 -1 roll{3 copy Mlprun1 3 copy 11 -3 roll /gt Mlpminmax 8 3 roll 11 -3 roll /lt Mlpminmax 8 3 roll}forall pop pop pop pop 3 1 roll pop pop aload pop 5 -1 roll aload pop exch 6 -1 roll Mlprun2 8 2 roll 4 -1 roll Mlprun2 6 2 roll 3 -1 roll Mlprun2 4 2 roll exch Mlprun2 6 2 roll}bind def /Mlprun1{aload pop exch 6 -1 roll 5 -1 roll mul add 4 -2 roll mul 3 -1 roll add}bind def /Mlprun2{2 copy add 2 div 3 1 roll exch sub}bind def /Mlpminmax{cvx 2 index 6 index 2 index exec{7 -3 roll 4 -1 roll}if 1 index 5 index 3 -1 roll exec{4 1 roll pop 5 -1 roll aload pop pop 4 -1 roll aload pop[8 -2 roll pop 5 -2 roll pop 6 -2 roll pop 5 -1 roll]4 1 roll pop}{pop pop pop}ifelse}bind def /Mlp1{ 5 index 3 index sub 5 index 2 index mul 1 index le 1 index 0 le or dup not{1 index 3 index div .99999 mul 8 -1 roll pop 7 1 roll}if 8 -1 roll 2 div 7 -2 roll pop sub 5 index 6 -3 roll pop pop mul sub exch}bind def /intop 0 def /inrht 0 def /inflag 0 def /outflag 0 def /xadrht 0 def /xadlft 0 def /yadtop 0 def /yadbot 0 def /Minner{outflag 1 eq{/outflag 0 def /intop 0 def /inrht 0 def}if 5 index gsave Mtmatrix setmatrix Mvboxa pop grestore 3 -1 roll pop dup intop gt{/intop exch def}{pop} ifelse dup inrht gt{/inrht exch def}{pop}ifelse pop /inflag 1 def}bind def /Mouter{/xadrht 0 def /xadlft 0 def /yadtop 0 def /yadbot 0 def inflag 1 eq{dup 0 lt{dup intop mul neg /yadtop exch def}if dup 0 gt{dup intop mul /yadbot exch def}if pop dup 0 lt{dup inrht mul neg /xadrht exch def}if dup 0 gt{dup inrht mul /xadlft exch def}if pop /outflag 1 def}{pop pop}ifelse /inflag 0 def /inrht 0 def /intop 0 def}bind def /Mboxout{outflag 1 eq{4 -1 roll xadlft leadjust add sub 4 1 roll 3 -1 roll yadbot leadjust add sub 3 1 roll exch xadrht leadjust add add exch yadtop leadjust add add /outflag 0 def /xadlft 0 def /yadbot 0 def /xadrht 0 def /yadtop 0 def}if}bind def /leadjust{(m)stringwidth pop .5 mul}bind def /Mrotcheck{dup 90 eq{yadbot /yadbot xadrht def /xadrht yadtop def /yadtop xadlft def /xadlft exch def}if dup cos 1 index sin Checkaux dup cos 1 index sin neg exch Checkaux 3 1 roll pop pop}bind def /Checkaux{4 index exch 4 index mul 3 1 roll mul add 4 1 roll}bind def /Mboxrot{Mrot 90 eq{brotaux 4 2 roll}if Mrot 180 eq{4 2 roll brotaux 4 2 roll brotaux}if Mrot 270 eq{4 2 roll brotaux}if}bind def /brotaux{neg exch neg}bind def /Mabsproc{0 matrix defaultmatrix dtransform idtransform dup mul exch dup mul add sqrt}bind def /Mabswid{Mabsproc setlinewidth}bind def /Mabsdash{exch[exch{Mabsproc}forall]exch setdash} bind def /MBeginOrig{Momatrix concat}bind def /MEndOrig{Mgmatrix setmatrix}bind def /sampledsound where{pop}{/sampledsound{exch pop exch 5 1 roll mul 4 idiv mul 2 idiv exch pop exch /Mtempproc exch def{ Mtempproc pop}repeat}bind def}ifelse /g{setgray}bind def /k{ setcmykcolor}bind def /m{moveto}bind def /p{gsave}bind def /r{ setrgbcolor}bind def /w{setlinewidth}bind def /C{curveto}bind def /F{ fill}bind def /L{lineto}bind def /P{grestore}bind def /s{stroke}bind def /setcmykcolor where{pop}{/setcmykcolor{4 1 roll[4 1 roll]{1 index sub 1 sub neg dup 0 lt{pop 0}if dup 1 gt{pop 1}if exch}forall pop setrgbcolor} bind def}ifelse /Mcharproc{currentfile(x)readhexstring pop 0 get exch div}bind def /Mshadeproc{dup 3 1 roll{dup Mcharproc 3 1 roll}repeat 1 eq {setgray}{3 eq{setrgbcolor}{setcmykcolor}ifelse}ifelse}bind def /Mrectproc{3 index 2 index moveto 2 index 3 -1 roll lineto dup 3 1 roll lineto lineto fill}bind def /Mcolorimage{7 1 roll pop pop matrix invertmatrix concat 2 exch exp 1 sub 3 1 roll 1 1 2 index{1 1 4 index{ dup 1 sub exch 2 index dup 1 sub exch 7 index 9 index Mshadeproc Mrectproc}for pop}for pop pop pop pop}bind def /Mimage{pop matrix invertmatrix concat 2 exch exp 1 sub 3 1 roll 1 1 2 index{1 1 4 index{ dup 1 sub exch 2 index dup 1 sub exch 7 index Mcharproc setgray Mrectproc}for pop}for pop pop pop}bind def %MMA2LTXComment: Here follow the original Mathematica file stripped of the text strings MathPictureStart /Courier findfont 10 scalefont setfont % Scaling calculations 0.0249355 0.99742 -0.0396341 0.99742 [ [ 0 0 0 0 ] [ 1 .82055 0 0 ] ] MathScale % Start of Graphics 1 setlinecap 1 setlinejoin newpath [ ] 0 setdash 0 g p p .002 w .06024 .26735 m .67932 .02494 L s P p .002 w .16191 .22754 m .16631 .23196 L s P p .002 w .35089 .15354 m .35496 .15826 L s P p .002 w .55515 .07356 m .55883 .07859 L s P p .001 w .19857 .21319 m .20117 .21587 L s P p .001 w .23578 .19861 m .23834 .20134 L s P p .001 w .27356 .18382 m .27609 .18658 L s P p .001 w .31193 .1688 m .31441 .17159 L s P p .001 w .39046 .13804 m .39286 .14091 L s P p .001 w .43066 .1223 m .43301 .12521 L s P p .001 w .4715 .10631 m .4738 .10926 L s P p .001 w .51299 .09007 m .51525 .09305 L s P p .001 w .1258 .24168 m .12847 .2443 L s P p .001 w .09021 .25561 m .09292 .25819 L s P p .001 w .598 .05678 m .60015 .05984 L s P p .001 w .64156 .03972 m .64365 .04282 L s P P p p .002 w .67932 .02494 m .94594 .43277 L s P p .002 w .73688 .11298 m .73104 .11515 L s P p .002 w .82692 .2507 m .82101 .25271 L s P p .002 w .90545 .37083 m .8995 .3727 L s P p .001 w .75593 .14211 m .75241 .14339 L s P p .001 w .77443 .17042 m .77091 .17168 L s P p .001 w .79242 .19793 m .78889 .19917 L s P p .001 w .8099 .22468 m .80637 .2259 L s P p .001 w .84347 .27602 m .83992 .27721 L s P p .001 w .85958 .30067 m .85603 .30184 L s P p .001 w .87527 .32467 m .87171 .32582 L s P p .001 w .89056 .34805 m .88699 .34919 L s P p .001 w .71727 .08298 m .71377 .0843 L s P p .001 w .69707 .05207 m .69358 .05342 L s P p .001 w .91997 .39304 m .9164 .39415 L s P p .001 w .93413 .4147 m .93055 .41579 L s P P p p .002 w .06024 .26735 m .02494 .49015 L s P p .002 w .05986 .26974 m .06567 .26747 L s P p .002 w .0517 .32128 m .05752 .31906 L s P p .002 w .04324 .37466 m .04908 .37249 L s P p .002 w .03447 .42999 m .04034 .42788 L s P p .002 w .02537 .48738 m .03126 .48533 L s P p .001 w .05825 .27991 m .06174 .27855 L s P p .001 w .05663 .29014 m .06012 .28879 L s P p .001 w .055 .30045 m .05849 .2991 L s P p .001 w .05335 .31083 m .05685 .30949 L s P p .001 w .05003 .3318 m .05353 .33048 L s P p .001 w .04835 .3424 m .05185 .34108 L s P p .001 w .04666 .35308 m .05016 .35177 L s P p .001 w .04495 .36383 m .04846 .36252 L s P p .001 w .04151 .38557 m .04502 .38427 L s P p .001 w .03977 .39655 m .04328 .39527 L s P p .001 w .03801 .40762 m .04153 .40634 L s P p .001 w .03625 .41876 m .03977 .41749 L s P p .001 w .03268 .4413 m .0362 .44004 L s P p .001 w .03087 .45269 m .0344 .45144 L s P p .001 w .02905 .46417 m .03258 .46292 L s P p .001 w .02722 .47573 m .03075 .47449 L s P P 0 0 m 1 0 L 1 .82055 L 0 .82055 L closepath clip newpath p .002 w .06024 .26735 m .02494 .49015 L s .02494 .49015 m .40296 .79562 L s .40296 .79562 m .41001 .59401 L s .41001 .59401 m .06024 .26735 L s .67932 .02494 m .94594 .43277 L s .94594 .43277 m .97506 .64585 L s .97506 .64585 m .69286 .25814 L s .69286 .25814 m .67932 .02494 L s .06024 .26735 m .02494 .49015 L s .02494 .49015 m .69286 .25814 L s .69286 .25814 m .67932 .02494 L s .67932 .02494 m .06024 .26735 L s .41001 .59401 m .94594 .43277 L s .94594 .43277 m .97506 .64585 L s .97506 .64585 m .40296 .79562 L s .40296 .79562 m .41001 .59401 L s P p 0 .096 .575 r .0015 w .38505 .67298 .40659 .69179 .44146 .72507 .42007 .70194 Metetra 0 .368 .834 r .42007 .70194 .44146 .72507 .47787 .75077 .45661 .72394 Metetra .421 .591 .913 r .45661 .72394 .47787 .75077 .51565 .76096 .49455 .73186 Metetra .65 .676 .861 r .49455 .73186 .51565 .76096 .55426 .75082 .53342 .72139 Metetra .757 .71 .808 r .53342 .72139 .55426 .75082 .59303 .72006 .5726 .69228 Metetra .813 .734 .776 r .5726 .69228 .59303 .72006 .63138 .67312 .61156 .64848 Metetra .846 .757 .765 r .61156 .64848 .63138 .67312 .66909 .61778 .65002 .59698 Metetra .862 .786 .775 r .65002 .59698 .66909 .61778 .70634 .56311 .68812 .54597 Metetra .856 .821 .813 r .68812 .54597 .70634 .56311 .74372 .51741 .72634 .50303 Metetra .805 .855 .887 r .72634 .50303 .74372 .51741 .78207 .48688 .76543 .47385 Metetra .64 .84 .977 r .76543 .47385 .78207 .48688 .8223 .47481 .8062 .46148 Metetra .314 .683 .978 r .8062 .46148 .8223 .47481 .86517 .48141 .84938 .46611 Metetra .036 .47 .88 r .84938 .46611 .86517 .48141 .91111 .5037 .89538 .48498 Metetra 0 .378 .836 r .89538 .48498 .91111 .5037 .96002 .53575 .94412 .51262 Metetra .009 .432 .863 r .36293 .65367 .38505 .67298 .42007 .70194 .39846 .67034 Metetra .386 .535 .882 r .39846 .67034 .42007 .70194 .45661 .72394 .43526 .68197 Metetra .552 .56 .816 r .43526 .68197 .45661 .72394 .49455 .73186 .47327 .68377 Metetra .637 .582 .776 r .47327 .68377 .49455 .73186 .53342 .72139 .51218 .67288 Metetra .695 .61 .758 r .51218 .67288 .53342 .72139 .5726 .69228 .55158 .64914 Metetra .742 .649 .757 r .55158 .64914 .5726 .69228 .61156 .64848 .59107 .61514 Metetra .786 .705 .774 r .59107 .61514 .61156 .64848 .65002 .59698 .63043 .57559 Metetra .826 .787 .814 r .63043 .57559 .65002 .59698 .68812 .54597 .6697 .53613 Metetra .839 .902 .882 r .6697 .53613 .68812 .54597 .72634 .50303 .70921 .50211 Metetra .693 .975 .914 r .70921 .50211 .72634 .50303 .76543 .47385 .74946 .47765 Metetra .245 .752 .721 r .74946 .47765 .76543 .47385 .8062 .46148 .79104 .46503 Metetra .104 0 0 r .79104 .46503 .8062 .46148 .84938 .46611 .83448 .46437 Metetra .183 0 0 r .83448 .46437 .84938 .46611 .89538 .48498 .88006 .47363 Metetra .003 .499 .865 r .88006 .47363 .89538 .48498 .94412 .51262 .92776 .4888 Metetra .515 .706 .958 r .34022 .63385 .36293 .65367 .39846 .67034 .37667 .63267 Metetra .587 .599 .831 r .37667 .63267 .39846 .67034 .43526 .68197 .41394 .6295 Metetra .611 .554 .766 r .41394 .6295 .43526 .68197 .47327 .68377 .45203 .62271 Metetra .628 .543 .739 r .45203 .62271 .47327 .68377 .51218 .67288 .49085 .61134 Metetra .647 .553 .735 r .49085 .61134 .51218 .67288 .55158 .64914 .53025 .59534 Metetra .671 .585 .751 r .53025 .59534 .55158 .64914 .59107 .61514 .57008 .57556 Metetra .702 .65 .795 r .57008 .57556 .59107 .61514 .63043 .57559 .61028 .55361 Metetra .739 .774 .882 r .61028 .55361 .63043 .57559 .6697 .53613 .65084 .53145 Metetra .68 .946 .96 r .65084 .53145 .6697 .53613 .70921 .50211 .69188 .51105 Metetra .69188 .51105 .70921 .50211 .74946 .47765 .73358 .494 Metetra .135 0 0 r .73358 .494 .74946 .47765 .79104 .46503 .77618 .48116 Metetra .221 0 0 r .77618 .48116 .79104 .46503 .83448 .46437 .81987 .47259 Metetra .124 0 0 r .81987 .47259 .83448 .46437 .88006 .47363 .86478 .46747 Metetra .288 .761 .936 r .86478 .46747 .88006 .47363 .92776 .4888 .91091 .46428 Metetra .739 .766 .875 r .31689 .61349 .34022 .63385 .37667 .63267 .35461 .59244 Metetra .689 .635 .79 r .35461 .59244 .37667 .63267 .41394 .6295 .3926 .57313 Metetra .652 .566 .746 r .3926 .57313 .41394 .6295 .45203 .62271 .43086 .55711 Metetra .625 .532 .728 r .43086 .55711 .45203 .62271 .49085 .61134 .46952 .54525 Metetra .606 .52 .732 r .46952 .54525 .49085 .61134 .53025 .59534 .50875 .53759 Metetra .591 .533 .758 r .50875 .53759 .53025 .59534 .57008 .57556 .54872 .53334 Metetra .576 .582 .822 r .54872 .53334 .57008 .57556 .61028 .55361 .58955 .53099 Metetra .533 .704 .949 r .58955 .53099 .61028 .55361 .65084 .53145 .63128 .52859 Metetra .241 .749 .878 r .63128 .52859 .65084 .53145 .69188 .51105 .67385 .5241 Metetra .143 0 0 r .67385 .5241 .69188 .51105 .73358 .494 .7171 .51584 Metetra .214 0 0 r .7171 .51584 .73358 .494 .77618 .48116 .76082 .5028 Metetra .136 0 0 r .76082 .5028 .77618 .48116 .81987 .47259 .80484 .48492 Metetra .80484 .48492 .81987 .47259 .86478 .46747 .84907 .46311 Metetra .668 .963 .933 r .84907 .46311 .86478 .46747 .91091 .46428 .89354 .43901 Metetra .817 .767 .806 r .29291 .59257 .31689 .61349 .35461 .59244 .33211 .55352 Metetra .751 .666 .767 r .33211 .55352 .35461 .59244 .3926 .57313 .37097 .51988 Metetra .688 .594 .745 r .37097 .51988 .3926 .57313 .43086 .55711 .40953 .49576 Metetra .628 .543 .739 r .40953 .49576 .43086 .55711 .46952 .54525 .44809 .48341 Metetra .566 .507 .748 r .44809 .48341 .46952 .54525 .50875 .53759 .48709 .48297 Metetra .491 .486 .779 r .48709 .48297 .50875 .53759 .54872 .53334 .52702 .4924 Metetra .383 .488 .842 r .52702 .4924 .54872 .53334 .58955 .53099 .56822 .50772 Metetra .172 .509 .912 r .56822 .50772 .58955 .53099 .63128 .52859 .61084 .52356 Metetra 0 .429 .692 r .61084 .52356 .63128 .52859 .67385 .5241 .65469 .53409 Metetra .253 0 0 r .65469 .53409 .67385 .5241 .7171 .51584 .69935 .53424 Metetra .138 0 0 r .69935 .53424 .7171 .51584 .76082 .5028 .74419 .52098 Metetra .74419 .52098 .76082 .5028 .80484 .48492 .78867 .49412 Metetra .589 .911 .664 r .78867 .49412 .80484 .48492 .84907 .46311 .83246 .45646 Metetra .867 .973 .855 r .83246 .45646 .84907 .46311 .89354 .43901 .87565 .41296 Metetra .846 .762 .77 r .26827 .57106 .29291 .59257 .33211 .55352 .30886 .51932 Metetra .793 .699 .761 r .30886 .51932 .33211 .55352 .37097 .51988 .34863 .47573 Metetra .726 .641 .763 r .34863 .47573 .37097 .51988 .40953 .49576 .38761 .446 Metetra .639 .582 .774 r .38761 .446 .40953 .49576 .44809 .48341 .42622 .43321 Metetra .52 .518 .794 r .42622 .43321 .44809 .48341 .48709 .48297 .46508 .43754 Metetra .35 .445 .817 r .46508 .43754 .48709 .48297 .52702 .4924 .5049 .45623 Metetra .114 .36 .823 r .5049 .45623 .52702 .4924 .56822 .50772 .54626 .48375 Metetra 0 .285 .771 r .54626 .48375 .56822 .50772 .61084 .52356 .5894 .51247 Metetra 0 .288 .664 r .5894 .51247 .61084 .52356 .65469 .53409 .63415 .53378 Metetra .162 0 0 r .63415 .53378 .65469 .53409 .69935 .53424 .67988 .54001 Metetra .67988 .54001 .69935 .53424 .74419 .52098 .7257 .52645 Metetra .635 .957 .781 r .7257 .52645 .74419 .52098 .78867 .49412 .77075 .49287 Metetra .874 .992 .81 r .77075 .49287 .78867 .49412 .83246 .45646 .81455 .44356 Metetra .919 .912 .796 r .81455 .44356 .83246 .45646 .87565 .41296 .85719 .3861 Metetra .853 .76 .759 r .24293 .54895 .26827 .57106 .30886 .51932 .28455 .49224 Metetra .824 .739 .771 r .28455 .49224 .30886 .51932 .34863 .47573 .3251 .44474 Metetra .767 .714 .803 r .3251 .44474 .34863 .47573 .38761 .446 .36458 .41272 Metetra .657 .669 .85 r .36458 .41272 .38761 .446 .42622 .43321 .40344 .39954 Metetra .448 .575 .889 r .40344 .39954 .42622 .43321 .46508 .43754 .44238 .40538 Metetra .133 .408 .855 r .44238 .40538 .46508 .43754 .5049 .45623 .48222 .42724 Metetra 0 .243 .753 r .48222 .42724 .5049 .45623 .54626 .48375 .52365 .45908 Metetra 0 .199 .701 r .52365 .45908 .54626 .48375 .5894 .51247 .56702 .49241 Metetra 0 .325 .778 r .56702 .49241 .5894 .51247 .63415 .53378 .6122 .51759 Metetra .192 .616 .946 r .6122 .51759 .63415 .53378 .67988 .54001 .65855 .52589 Metetra .608 .857 .991 r .65855 .52589 .67988 .54001 .7257 .52645 .70508 .51195 Metetra .823 .904 .896 r .70508 .51195 .7257 .52645 .77075 .49287 .75081 .47548 Metetra .894 .879 .813 r .75081 .47548 .77075 .49287 .81455 .44356 .79515 .42142 Metetra .908 .846 .771 r .79515 .42142 .81455 .44356 .85719 .3861 .83815 .35839 Metetra .846 .762 .77 r .21687 .5262 .24293 .54895 .28455 .49224 .25887 .4732 Metetra .842 .792 .804 r .25887 .4732 .28455 .49224 .3251 .44474 .2999 .42848 Metetra .8 .827 .872 r .2999 .42848 .3251 .44474 .36458 .41272 .3399 .3978 Metetra .652 .831 .969 r .3399 .3978 .36458 .41272 .40344 .39954 .37924 .38427 Metetra .275 .671 .97 r .37924 .38427 .40344 .39954 .44238 .40538 .41859 .38806 Metetra 0 .379 .796 r .41859 .38806 .44238 .40538 .48222 .42724 .45873 .40637 Metetra 0 .238 .708 r .45873 .40637 .48222 .42724 .52365 .45908 .50034 .43365 Metetra 0 .285 .771 r .50034 .43365 .52365 .45908 .56702 .49241 .5438 .46214 Metetra .138 .445 .879 r .5438 .46214 .56702 .49241 .6122 .51759 .58906 .48313 Metetra .443 .595 .907 r .58906 .48313 .6122 .51759 .65855 .52589 .63558 .48879 Metetra .646 .68 .868 r .63558 .48879 .65855 .52589 .70508 .51195 .6825 .47434 Metetra .761 .725 .819 r .6825 .47434 .70508 .51195 .75081 .47548 .72891 .43954 Metetra .827 .756 .784 r .72891 .43954 .75081 .47548 .79515 .42142 .77425 .38878 Metetra .865 .784 .77 r .77425 .38878 .79515 .42142 .83815 .35839 .81849 .32978 Metetra .817 .767 .806 r .19004 .50278 .21687 .5262 .25887 .4732 .23163 .46155 Metetra .831 .861 .868 r .23163 .46155 .25887 .4732 .2999 .42848 .27268 .42589 Metetra .757 .955 .938 r .27268 .42589 .2999 .42848 .3399 .3978 .31312 .39999 Metetra .429 .871 .878 r .31312 .39999 .3399 .3978 .37924 .38427 .35318 .38615 Metetra .35318 .38615 .37924 .38427 .41859 .38806 .39336 .3845 Metetra .183 0 0 r .39336 .3845 .41859 .38806 .45873 .40637 .43423 .39295 Metetra 0 .432 .794 r .43423 .39295 .45873 .40637 .50034 .43365 .47632 .40743 Metetra .172 .509 .912 r .47632 .40743 .50034 .43365 .5438 .46214 .51994 .42245 Metetra .408 .541 .878 r .51994 .42245 .5438 .46214 .58906 .48313 .5651 .43198 Metetra .544 .559 .82 r .5651 .43198 .58906 .48313 .63558 .48879 .61146 .43079 Metetra .629 .582 .782 r .61146 .43079 .63558 .48879 .6825 .47434 .65846 .41575 Metetra .693 .615 .764 r .65846 .41575 .6825 .47434 .72891 .43954 .70547 .38667 Metetra .747 .66 .764 r .70547 .38667 .72891 .43954 .77425 .38878 .75207 .34645 Metetra .797 .723 .783 r .75207 .34645 .77425 .38878 .81849 .32978 .79819 .30023 Metetra .739 .766 .875 r .16241 .47867 .19004 .50278 .23163 .46155 .20277 .4551 Metetra .721 .922 .96 r .20277 .4551 .23163 .46155 .27268 .42589 .24333 .43331 Metetra .447 .88 .813 r .24333 .43331 .27268 .42589 .31312 .39999 .28405 .41491 Metetra .28405 .41491 .31312 .39999 .35318 .38615 .32503 .4008 Metetra .031 0 0 r .32503 .4008 .35318 .38615 .39336 .3845 .36645 .39102 Metetra .36645 .39102 .39336 .3845 .43423 .39295 .40855 .38474 Metetra .336 .781 .96 r .40855 .38474 .43423 .39295 .47632 .40743 .45154 .3804 Metetra .533 .704 .949 r .45154 .3804 .47632 .40743 .51994 .42245 .49558 .37595 Metetra .581 .599 .836 r .49558 .37595 .51994 .42245 .5651 .43198 .54068 .36927 Metetra .6 .551 .771 r .54068 .36927 .5651 .43198 .61146 .43079 .58675 .3586 Metetra .618 .538 .742 r .58675 .3586 .61146 .43079 .65846 .41575 .63362 .34288 Metetra .639 .55 .738 r .63362 .34288 .65846 .41575 .70547 .38667 .68106 .32207 Metetra .665 .586 .757 r .68106 .32207 .70547 .38667 .75207 .34645 .72894 .2971 Metetra .701 .657 .804 r .72894 .2971 .75207 .34645 .79819 .30023 .77721 .2697 Metetra .515 .706 .958 r .13396 .45384 .16241 .47867 .20277 .4551 .17246 .45043 Metetra .32 .789 .93 r .17246 .45043 .20277 .4551 .24333 .43331 .21206 .44486 Metetra .21206 .44486 .24333 .43331 .28405 .41491 .25288 .4354 Metetra .25288 .4354 .28405 .41491 .32503 .4008 .29486 .42102 Metetra .29486 .42102 .32503 .4008 .36645 .39102 .33785 .40167 Metetra .447 .87 .747 r .33785 .40167 .36645 .39102 .40855 .38474 .38163 .37827 Metetra .729 .946 .952 r .38163 .37827 .40855 .38474 .45154 .3804 .42598 .3525 Metetra .739 .774 .882 r .42598 .3525 .45154 .3804 .49558 .37595 .47078 .32647 Metetra .687 .64 .798 r .47078 .32647 .49558 .37595 .54068 .36927 .51605 .30224 Metetra .644 .564 .75 r .51605 .30224 .54068 .36927 .58675 .3586 .5619 .28147 Metetra .614 .525 .73 r .5619 .28147 .58675 .3586 .63362 .34288 .60855 .26507 Metetra .593 .513 .733 r .60855 .26507 .63362 .34288 .68106 .32207 .65625 .25308 Metetra .579 .527 .761 r .65625 .25308 .68106 .32207 .72894 .2971 .70521 .24464 Metetra .569 .581 .826 r .70521 .24464 .72894 .2971 .77721 .2697 .75552 .23814 Metetra .009 .432 .863 r .10464 .42825 .13396 .45384 .17246 .45043 .14104 .44346 Metetra .195 0 0 r .14104 .44346 .17246 .45043 .21206 .44486 .17944 .45321 Metetra .138 0 0 r .17944 .45321 .21206 .44486 .25288 .4354 .22019 .45232 Metetra .22019 .45232 .25288 .4354 .29486 .42102 .26317 .43765 Metetra .465 .864 .685 r .26317 .43765 .29486 .42102 .33785 .40167 .30787 .40904 Metetra .784 .998 .846 r .30787 .40904 .33785 .40167 .38163 .37827 .35357 .36935 Metetra .869 .919 .859 r .35357 .36935 .38163 .37827 .42598 .3525 .39958 .3237 Metetra .826 .787 .814 r .39958 .3237 .42598 .3525 .47078 .32647 .44549 .27816 Metetra .756 .677 .774 r .44549 .27816 .47078 .32647 .51605 .30224 .49121 .23844 Metetra .686 .596 .75 r .49121 .23844 .51605 .30224 .5619 .28147 .53706 .20887 Metetra .618 .538 .742 r .53706 .20887 .5619 .28147 .60855 .26507 .58357 .19179 Metetra .552 .499 .751 r .58357 .19179 .60855 .26507 .65625 .25308 .63141 .18732 Metetra .482 .482 .78 r .63141 .18732 .65625 .25308 .70521 .24464 .68114 .19329 Metetra .401 .495 .84 r .68114 .19329 .70521 .24464 .75552 .23814 .73309 .20548 Metetra 0 .096 .575 r .07442 .40187 .10464 .42825 .14104 .44346 .10905 .43019 Metetra .414 0 0 r .10905 .43019 .14104 .44346 .17944 .45321 .14636 .45093 Metetra .13 0 0 r .14636 .45093 .17944 .45321 .22019 .45232 .18699 .45621 Metetra .394 .852 .852 r .18699 .45621 .22019 .45232 .26317 .43765 .23082 .44119 Metetra .773 .989 .892 r .23082 .44119 .26317 .43765 .30787 .40904 .27708 .40561 Metetra .889 .94 .841 r .27708 .40561 .30787 .40904 .35357 .36935 .32462 .35393 Metetra .896 .861 .798 r .32462 .35393 .35357 .36935 .39958 .3237 .37232 .29396 Metetra .862 .786 .775 r .37232 .29396 .39958 .3237 .44549 .27816 .41948 .23467 Metetra .805 .716 .767 r .41948 .23467 .44549 .27816 .49121 .23844 .46594 .18421 Metetra .728 .649 .77 r .46594 .18421 .49121 .23844 .53706 .20887 .51208 .14854 Metetra .631 .582 .78 r .51208 .14854 .53706 .20887 .58357 .19179 .55866 .13082 Metetra .511 .515 .796 r .55866 .13082 .58357 .19179 .63141 .18732 .60663 .13118 Metetra .369 .453 .816 r .60663 .13118 .63141 .18732 .68114 .19329 .65686 .14672 Metetra .214 .41 .839 r .65686 .14672 .68114 .19329 .73309 .20548 .70986 .17168 Metetra .537 .015 0 r .04324 .37466 .07442 .40187 .10905 .43019 .077 .40763 Metetra 0 .168 .606 r .077 .40763 .10905 .43019 .14636 .45093 .1138 .43228 Metetra .116 .582 .916 r .1138 .43228 .14636 .45093 .18699 .45621 .15445 .43963 Metetra .627 .848 .984 r .15445 .43963 .18699 .45621 .23082 .44119 .19889 .42414 Metetra .819 .866 .881 r .19889 .42414 .23082 .44119 .27708 .40561 .24623 .38554 Metetra .874 .836 .806 r .24623 .38554 .27708 .40561 .32462 .35393 .2951 .32894 Metetra .883 .808 .77 r .2951 .32894 .32462 .35393 .37232 .29396 .34415 .26321 Metetra .871 .784 .763 r .34415 .26321 .37232 .29396 .41948 .23467 .39247 .19847 Metetra .837 .76 .778 r .39247 .19847 .41948 .23467 .46594 .18421 .43981 .14372 Metetra .772 .728 .812 r .43981 .14372 .46594 .18421 .51208 .14854 .48654 .10547 Metetra .653 .673 .856 r .48654 .10547 .51208 .14854 .55866 .13082 .5335 .08713 Metetra .465 .578 .883 r .5335 .08713 .55866 .13082 .60663 .13118 .58175 .08883 Metetra .239 .456 .869 r .58175 .08883 .60663 .13118 .65686 .14672 .6323 .10744 Metetra .062 .362 .832 r .6323 .10744 .65686 .14672 .70986 .17168 .68581 .13668 Metetra P p .002 w .67932 .02494 m .94594 .43277 L s .94594 .43277 m .97506 .64585 L s .97506 .64585 m .69286 .25814 L s .69286 .25814 m .67932 .02494 L s .06024 .26735 m .02494 .49015 L s .02494 .49015 m .69286 .25814 L s .69286 .25814 m .67932 .02494 L s .67932 .02494 m .06024 .26735 L s P p p .002 w .06024 .26735 m .67932 .02494 L s P p .002 w .16191 .22754 m .16631 .23196 L s P p .002 w .35089 .15354 m .35496 .15826 L s P p .002 w .55515 .07356 m .55883 .07859 L s P p .001 w .19857 .21319 m .20117 .21587 L s P p .001 w .23578 .19861 m .23834 .20134 L s P p .001 w .27356 .18382 m .27609 .18658 L s P p .001 w .31193 .1688 m .31441 .17159 L s P p .001 w .39046 .13804 m .39286 .14091 L s P p .001 w .43066 .1223 m .43301 .12521 L s P p .001 w .4715 .10631 m .4738 .10926 L s P p .001 w .51299 .09007 m .51525 .09305 L s P p .001 w .1258 .24168 m .12847 .2443 L s P p .001 w .09021 .25561 m .09292 .25819 L s P p .001 w .598 .05678 m .60015 .05984 L s P p .001 w .64156 .03972 m .64365 .04282 L s P P % End of Graphics MathPictureEnd end %%EndDocument @endspecial 1161 2523 a Fe(\000)p Fg(2)1268 2555 y(0)1357 2590 y(2)1457 2564 y Fe(\000)p Fg(2)1496 2506 y(0)1530 2453 y(2)1116 2485 y Fe(\000)p Fg(1)1087 2463 y Fe(\000)p Fg(0)p Ff(:)p Fg(5)1132 2443 y(0)1104 2419 y(0)p Ff(:)p Fg(5)1125 2394 y(1)1161 2523 y Fe(\000)p Fg(2)1268 2555 y(0)1357 2590 y(2)1281 2437 y @beginspecial 42.812069 @hsize 11.676800 @vsize @setspecial %%BeginDocument: mmawhite.eps gsave 1 setgray clippath fill grestore %%EndDocument @endspecial 1281 2390 179 2 v 1281 2435 2 46 v 1295 2423 a FA(some)g(text)p 1458 2435 V 1281 2437 179 2 v 659 2703 a FI(Figure)16 b(4:)22 b(A)16 b(sample)e(\014gure.)916 2914 y(10)p eop %%Page: 11 12 11 11 bop -39 174 a FB(10)79 b(The)26 b(p)n(rogram)g Fa(extpro)-39 284 y FI(The)16 b(program)h Fy(extpro)e FI(extracts)h(a)h(prologue)g(\014le)f(from)g(a)h FD(Mathematica)f FI(P)o(ostScript)g(sa)o(v)o(ed)g(picture.)-39 344 y(Simply)c(sa)o(v)o (e)j(a)g(graphics)h(within)f FD(Mathematica)e FI(is)i Fy(PS)g FI(format,)f(or)h(pass)h(the)f(output)h(through)g Fy(psfix)p FI(.)-39 404 y(Then)g(use)586 506 y Fy(extpro)e Fx(h)p FE(mma)j(\014le)t Fx(i)h(h)p FE(pr)n(olo)n(gue)f(\014le)t Fx(i)-39 608 y FI(where)g Fx(h)p FE(mma)i(\014le)t Fx(i)g FI(is)f(the)g(name)e(of)j(the)e(graphics)h(sa)o(v)o(ed)g(in)f Fy(PS)h FI(format,)f(and)h Fx(h)p FE(pr)n(olo)n(gue)h(\014le)t Fx(i)g FI(is)f(the)-39 668 y(name)d(of)h(the)g(prologue)h(\014le)f(to)g (sa)o(v)o(e.)21 b(E.g.)556 770 y Fy(extpro)i(mygraph.ps)f(texmma23.p)o (ro)-39 871 y FI(The)16 b(obtained)g(prologue)h(\014le)f(can)g(b)q(e)h (used)f(as)h(optional)f(argumen)o(t)g(for)g(the)g(option)h Fy(-p)p FI(.)916 2914 y(11)p eop %%Page: 12 13 12 12 bop -39 174 a FB(11)79 b(Distribution)26 b(Files)-39 284 y FI(This)16 b(arc)o(hiv)o(e)f(con)o(tains)h(the)g(follo)o(wing)g (\014les:)59 361 y Fy(msdos/mma)o(2lt)o(x.)o(exe)46 b FI(Binary)16 b(executable)f(for)h(MS/DOS)59 421 y Fy(msdos/ext)o(pro)o (.e)o(xe)72 b FI(Binary)16 b(executable)f(for)h(MS/DOS)59 481 y Fy(amiga/mma)o(2lt)o(x)149 b FI(Binary)16 b(executable)f(for)h (the)g(Amiga)59 541 y Fy(amiga/ext)o(pro)174 b FI(Binary)16 b(executable)f(for)h(the)g(Amiga)59 601 y Fy(mma2ltx.c)251 b FI(C)17 b(source)f(of)h FE(mma2ltx)59 662 y Fy(extpro.c)277 b FI(C)17 b(source)f(of)h Fy(extpro)59 722 y(mmatext.s)o(ty)200 b FI(L)556 716 y FC(a)580 722 y FI(T)607 737 y(E)635 722 y(X)15 b(macro)h(\014le)59 782 y Fy(texmma22.)o(lpr)o(o)149 b FD(Mathematica)15 b FI(v2.2)h(P)o(ostScript)g(prologue)h(\014le)59 842 y Fy(texmma22.)o(pro)174 b FI(Squeezed)15 b(v)o(ersion)h(of)g(`)p Fy(texmma22.l)o(pr)o(o)p FI(')59 902 y Fy(mmawhite.)o(eps)174 b FI(A)16 b(P)o(ostScript)g(\014le)g(needed)f(to)i(`)p Fy(mmatext.)o(sty)o FI(')59 963 y Fy(Makefile)277 b FI(A)16 b(Unix)f(Mak)o(e\014le)59 1023 y Fy(makefile.)o(ami)174 b FI(Mak)o(e\014le)15 b(for)h(the)g(Amiga)59 1083 y Fy(makefile.)o(msc) 174 b FI(Mak)o(e\014le)15 b(for)h(MS/DOS)59 1143 y Fy(doc/mma2l)o(tx.)o (dv)o(i)98 b FI(Do)q(cumen)o(tation)16 b(of)g FE(mma2ltx)h FI(\()p Fy(dvi)e FI(form\))59 1203 y Fy(doc/mma2l)o(tx.)o(ps)123 b FI(Do)q(cumen)o(tation)16 b(of)g FE(mma2ltx)h FI(\(P)o(ostScript)f (form)f(at)i(300)g(dpi\))59 1263 y Fy(doc/mma2l)o(tx6)o(.p)o(s)98 b FI(Do)q(cumen)o(tation)16 b(of)g FE(mma2ltx)h FI(\(P)o(ostScript)f (form)f(at)i(600)g(dpi\))59 1324 y Fy(doc/6mag.)o(eps)174 b FE(mma2ltx)17 b FI(EPSF)g(\014le)e(\(needed)h(to)g(`)p Fy(mma2ltx.dv)o(i)p FI(')o(\))59 1384 y Fy(doc/12mag)o(.ep)o(s)149 b FE(mma2ltx)17 b FI(EPSF)g(\014le)e(\(needed)h(to)g(`)p Fy(mma2ltx.dv)o(i)p FI(')o(\))59 1444 y Fy(doc/12mag)p 295 1444 16 2 v 15 w(3d.eps)80 b FE(mma2ltx)17 b FI(EPSF)g(\014le)e (\(needed)h(to)g(`)p Fy(mma2ltx.dv)o(i)p FI(')o(\))59 1504 y Fy(doc/optc.)o(eps)174 b FE(mma2ltx)17 b FI(EPSF)g(\014le)e (\(needed)h(to)g(`)p Fy(mma2ltx.dv)o(i)p FI(')o(\))59 1564 y Fy(doc/arrsa)o(mp.)o(ep)o(s)98 b FE(mma2ltx)17 b FI(EPSF)g(\014le)e(\(needed)h(to)g(`)p Fy(mma2ltx.dv)o(i)p FI(')o(\))59 1625 y Fy(doc/arrpa)o(rm.)o(1)149 b FE(mma2ltx)17 b FI(EPSF)g(\014le)e(\(needed)h(to)g(`)p Fy(mma2ltx.dv)o(i)p FI(')o(\))59 1685 y Fy(mysample.)o(tex)174 b FI(A)16 b(sample)f(\014le)59 1745 y Fy(mypic.ps)277 b FI(A)16 b(sample)f(picture)g(created)h(b)o(y)g FD(Mathematica)59 1805 y Fy(mypic.tex)251 b FI(The)16 b(\014le)g(`)p Fy(mypic.ps)p FI(')c(as)17 b(pro)q(cessed)g(b)o(y)f FE(mma2ltx)59 1865 y Fy(mypic.eps)251 b FI(The)16 b(\014le)g(`)p Fy(mypic.ps)p FI(')c(as)17 b(pro)q(cessed)g(b)o(y)f FE(mma2ltx)59 1926 y Fy(README)329 b FI(A)16 b(short)h(description)f(of)g FE(mma2ltx)p FI(.)-39 2073 y FB(12)79 b(Limits)24 b(of)j Fz(mma2ltx)-39 2182 y FI(Curren)o(tly)15 b(aren't)h(\(y)o(et\))f(supp)q (orted:)33 2284 y Fx(\017)25 b FI(rotated)16 b(lab)q(els.)33 2386 y Fx(\017)25 b FI(m)o(ultiple)13 b(graphics)j(\(the)g(ones)h(pro)q (duced)g(with)f Fy(GraphicsA)o(rra)o(y)p FI(\).)33 2487 y Fx(\017)25 b FI(the)16 b(`)p Fy(...->Fo)o(ntF)o(orm)o FI(')d FD(Mathematica)i FI(parameter.)-39 2654 y FB(13)79 b(T)-7 b(o)27 b(do)g(list)-39 2763 y FI(Here)15 b(follo)o(w)h(future)g (enhancemen)o(ts)e(whic)o(h)h(are)i(on)f(m)o(y)f(list:)916 2914 y(12)p eop %%Page: 13 14 13 13 bop 33 166 a Fx(\017)25 b FI(Add)16 b(supp)q(ort)h(for)g(L)457 160 y FC(a)481 166 y FI(T)508 181 y(E)535 166 y(X)f(2)612 177 y Fq(")635 166 y FI(.)33 268 y Fx(\017)25 b FI(Add)16 b(supp)q(ort)h(for)g(rotated)f(lab)q(els.)33 369 y Fx(\017)25 b FI(Add)16 b(supp)q(ort)h(for)g(others)f Fy(dvi)f FI(to)i(P)o (ostScript)f(pro)q(cessors.)-39 536 y FB(14)79 b(Autho)n(r)27 b(info)-39 645 y FI(If)21 b(y)o(ou)g(ha)o(v)o(e)g(some)f(questions,)j (suggestions,)h(commen)o(t)o(s,)c(bug)i(rep)q(ort)g(or)g(enhancemen)o (t)e(requests,)-39 706 y(please)15 b(feel)h(free)f(to)i(con)o(tact)f (me)e(at)j(one)f(of)h(the)f(follo)o(wing)g(addresses:)33 807 y Fx(\017)25 b Fr(ordinary)18 b(mail:)83 930 y FI(Giusepp)q(e)e (Ghib\022)-24 b(o)83 990 y(via)15 b(Sestriere,)g(133)83 1050 y(I-10090)j(Cascine)e(Vica)f({)i(Riv)o(oli)d(\(T)l(orino\))83 1110 y(IT)l(AL)l(Y)33 1233 y Fx(\017)25 b Fr(in)n(ternet:)20 b FE(ghib)n(o@galile)n(o.p)n(olito.it)-39 1399 y FB(15)79 b(Ackno)n(wledgements)-39 1509 y FI(The)16 b(author)h(wishes)f(to)h (thanks:)33 1610 y Fx(\017)25 b FI(P)l(.)15 b(Lep)q(ora)j(for)f(his)f (signi\014cativ)o(e)f(suggestions)i(and)g(collab)q(oration.)33 1712 y Fx(\017)25 b FI(P)l(.)15 b(Boieri)g(for)i(his)f(suggestions)i (and)e(for)h(ha)o(ving)f(in)o(tensely)f(tested)g FE(mma2ltx)p FI(.)-39 1878 y FB(16)79 b(Histo)n(ry)-39 1988 y Fr(v)n(ersion)18 b(1.23)141 2102 y Fx(\017)24 b FI(Added)16 b(option)g Fy(-a)g FI(to)g(dra)o(w)h(arro)o(ws)g(on)g(axes)f(of)h(a)f(2D)h (graphic.)141 2183 y Fx(\017)24 b FI(Fixed)15 b(a)i(bug)f(in)g(the)g (st)o(yle)f Fy(mmatext.sty)o FI(.)-39 2297 y Fr(v)n(ersion)j(1.22)141 2411 y Fx(\017)24 b FI(Fixed)15 b(a)i(small)d(bug)j(whic)o(h)f(caused)g ('segmen)o(tation)f(fault')g(under)i(Lin)o(ux.)141 2492 y Fx(\017)24 b FI(Use)16 b(of)g(p)q(error\(\))h(instead)f(of)h (strerror\(\))f(\(suggested)h(b)o(y)f(P)o(eter)f(Whaite\).)-39 2606 y Fr(v)n(ersion)j(1.21)141 2721 y Fx(\017)24 b FI(P)o(ossibilit)o (y)14 b(to)j(use)f(new)o(er)g(prologue)h(\014les)e(from)h FD(Mathematica)p FI(.)141 2802 y Fx(\017)24 b FI(Added)16 b(supp)q(ort)h(for)g(m)o(ultiple)c Fy(-c)i FI(options.)916 2914 y(13)p eop %%Page: 14 15 14 14 bop 141 166 a Fx(\017)24 b FI(Added)16 b(option)g Fy(-e)g FI(\(suggested)h(b)o(y)f(Holger)f(Danielsson\).)141 247 y Fx(\017)24 b FI(Fixed)15 b(a)i(bug)f(in)g(the)g(function)g (strtolwr\(\))h(\(rep)q(orted)f(b)o(y)g(Klaus)g(Burkhard\).)-39 361 y Fr(v)n(ersion)i(1.2)141 475 y Fx(\017)24 b FI(Added)16 b(supp)q(ort)i(to)f(obtain)g(non-transparen)o(t)h(ob)s(jects.)j(No)o(w) c(ob)s(jects)f(\(strings,)h(pictures)190 535 y(and)g(so)h(on\),)f(can)g (b)q(e)g(placed)f(to)h(o)o(v)o(erlap)f(the)h(bac)o(kground)g(graphic,)g (i.e.)22 b(as)17 b(if)f(they)h(w)o(ere)190 596 y(non-transparen)o(t.) 141 677 y Fx(\017)24 b FI(Added)16 b(P)o(ostScript)g(do)q(cumen)o (tation)f(for)h(600)i(dpi)e(prin)o(ters.)141 758 y Fx(\017)24 b FI(Added)16 b(binary)g(executable)f(for)h(the)g(Amiga.)-39 872 y Fr(v)n(ersion)i(1.1)24 b FI(First)15 b(public)h(release.)916 2914 y(14)p eop %%Trailer end userdict /end-hook known{end-hook}if %%EOF